@itwin/core-geometry 3.0.0-dev.76 → 3.0.0-dev.80

package/lib/esm/clipping/ClipVector.js.map

@@ -0,0 +1 @@
+{"version":3,"file":"ClipVector.js","sourceRoot":"","sources":["../../../src/clipping/ClipVector.ts"],"names":[],"mappings":"AAAA;;;+FAG+F;AAE/F;;GAEG;AAEH,OAAO,EAAE,MAAM,EAAE,MAAM,qBAAqB,CAAC;AAC7C,OAAO,EAAE,aAAa,EAAE,MAAM,wBAAwB,CAAC;AACvD,OAAO,EAAE,QAAQ,EAAE,MAAM,aAAa,CAAC;AAEvC,OAAO,EAAE,OAAO,EAAE,MAAM,qBAAqB,CAAC;AAE9C,OAAO,EAAE,SAAS,EAAE,MAAM,yBAAyB,CAAC;AAGpD,OAAO,EAAE,sBAAsB,EAAE,aAAa,EAAsB,SAAS,EAAE,MAAM,iBAAiB,CAAC;AACvG,OAAO,EAAE,oBAAoB,EAAE,MAAM,aAAa,CAAC;AAQnD;;;;GAIG;AACH,MAAM,OAAO,UAAU;IAWrB,YAAoB,KAAuB;QAT3C;;;WAGG;QACI,kBAAa,GAAY,OAAO,CAAC,UAAU,EAAE,CAAC;QAMnD,IAAI,CAAC,MAAM,GAAG,KAAK,CAAC,CAAC,CAAC,KAAK,CAAC,CAAC,CAAC,EAAE,CAAC;IACnC,CAAC;IALD,sDAAsD;IACtD,IAAW,KAAK,KAAK,OAAO,IAAI,CAAC,MAAM,CAAC,CAAC,CAAC;IAM1C,gEAAgE;IAChE,IAAW,OAAO,KAAc,OAAO,IAAI,CAAC,MAAM,CAAC,MAAM,GAAG,CAAC,CAAC,CAAC,CAAC;IAEhE,2DAA2D;IACpD,MAAM,CAAC,WAAW,CAAC,MAAmB;QAC3C,IAAI,MAAM,EAAE;YACV,MAAM,CAAC,MAAM,CAAC,MAAM,GAAG,CAAC,CAAC;YACzB,OAAO,MAAM,CAAC;SACf;QACD,OAAO,IAAI,UAAU,EAAE,CAAC;IAC1B,CAAC;IAED,sGAAsG;IAC/F,MAAM,CAAC,aAAa,CAAC,KAAsB,EAAE,MAAmB;QACrE,IAAI,MAAM,EAAE;YACV,MAAM,CAAC,MAAM,GAAG,KAAK,CAAC;YACtB,OAAO,MAAM,CAAC;SACf;QACD,OAAO,IAAI,UAAU,CAAC,KAAK,CAAC,CAAC;IAC/B,CAAC;IAED,sEAAsE;IAC/D,MAAM,CAAC,MAAM,CAAC,KAAsB,EAAE,MAAmB;QAC9D,MAAM,UAAU,GAAoB,EAAE,CAAC;QACvC,KAAK,MAAM,IAAI,IAAI,KAAK;YACtB,UAAU,CAAC,IAAI,CAAC,IAAI,CAAC,KAAK,EAAE,CAAC,CAAC;QAChC,OAAO,UAAU,CAAC,aAAa,CAAC,UAAU,EAAE,MAAM,CAAC,CAAC;IACtD,CAAC;IAED,+CAA+C;IACxC,KAAK,CAAC,MAAmB;QAC9B,MAAM,MAAM,GAAG,MAAM,CAAC,CAAC,CAAC,MAAM,CAAC,CAAC,CAAC,IAAI,UAAU,EAAE,CAAC;QAClD,MAAM,CAAC,MAAM,CAAC,MAAM,GAAG,CAAC,CAAC;QACzB,KAAK,MAAM,IAAI,IAAI,IAAI,CAAC,MAAM,EAAE;YAC9B,MAAM,CAAC,MAAM,CAAC,IAAI,CAAC,IAAI,CAAC,KAAK,EAAE,CAAC,CAAC;SAClC;QACD,MAAM,CAAC,aAAa,CAAC,OAAO,CAAC,IAAI,CAAC,aAAa,CAAC,CAAC;QACjD,OAAO,MAAM,CAAC;IAChB,CAAC;IAED,gDAAgD;IACzC,MAAM;QACX,IAAI,CAAC,IAAI,CAAC,OAAO;YACf,OAAO,EAAE,CAAC;QAEZ,OAAO,IAAI,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC,IAAI,EAAE,EAAE,CAAC,IAAI,CAAC,MAAM,EAAE,CAAC,CAAC;IACjD,CAAC;IAED,iDAAiD;IAC1C,MAAM,CAAC,QAAQ,CAAC,IAAiC,EAAE,MAAmB;QAC3E,MAAM,GAAG,MAAM,CAAC,CAAC,CAAC,MAAM,CAAC,CAAC,CAAC,IAAI,UAAU,EAAE,CAAC;QAC5C,MAAM,CAAC,KAAK,EAAE,CAAC;QACf,IAAI,CAAC,KAAK,CAAC,OAAO,CAAC,IAAI,CAAC;YACtB,OAAO,MAAM,CAAC;QAEhB,IAAI;YACF,KAAK,MAAM,IAAI,IAAI,IAAI,EAAE;gBACvB,MAAM,QAAQ,GAAG,aAAa,CAAC,QAAQ,CAAC,IAAI,CAAC,CAAC;gBAC9C,IAAI,QAAQ;oBACV,MAAM,CAAC,MAAM,CAAC,IAAI,CAAC,QAAQ,CAAC,CAAC;aAChC;SACF;QAAC,OAAO,CAAC,EAAE;YACV,MAAM,CAAC,KAAK,EAAE,CAAC;SAChB;QAED,OAAO,MAAM,CAAC;IAChB,CAAC;IAED,2CAA2C;IACpC,KAAK;QACV,IAAI,CAAC,MAAM,CAAC,MAAM,GAAG,CAAC,CAAC;IACzB,CAAC;IAED,wEAAwE;IACjE,WAAW,CAAC,IAAmB;QACpC,IAAI,CAAC,MAAM,CAAC,IAAI,CAAC,IAAI,CAAC,KAAK,EAAE,CAAC,CAAC;IACjC,CAAC;IAED,wEAAwE;IACjE,eAAe,CAAC,IAAmB;QACxC,IAAI,CAAC,MAAM,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;IACzB,CAAC;IAED,0HAA0H;IACnH,WAAW,CAAC,KAAgB,EAAE,IAAa,EAAE,KAAc,EAChE,SAAqB,EAAE,SAAkB,KAAK,EAAE,YAAqB,KAAK;QAC1E,MAAM,IAAI,GAAG,SAAS,CAAC,WAAW,CAAC,KAAK,EAAE,IAAI,EAAE,KAAK,EAAE,SAAS,EAAE,MAAM,EAAE,SAAS,CAAC,CAAC;QACrF,IAAI,CAAC,IAAI;YACP,OAAO,KAAK,CAAC;QACf,IAAI,CAAC,MAAM,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;QACvB,OAAO,IAAI,CAAC;IACd,CAAC;IAED,iHAAiH;IAC1G,WAAW,CAAC,KAAc,EAAE,cAAsB,QAAQ,CAAC,0BAA0B;QAC1F,IAAI,CAAC,IAAI,CAAC,aAAa,CAAC,MAAM,IAAI,CAAC,IAAI,CAAC,aAAa,CAAC,aAAa,CAAC,KAAK,CAAC;YACxE,OAAO,KAAK,CAAC;QAEf,KAAK,MAAM,IAAI,IAAI,IAAI,CAAC,MAAM,EAAE;YAC9B,IAAI,CAAC,IAAI,CAAC,WAAW,CAAC,KAAK,EAAE,WAAW,CAAC;gBACvC,OAAO,KAAK,CAAC;SAChB;QACD,OAAO,IAAI,CAAC;IACd,CAAC;IAED;;;OAGG;IACI,gBAAgB,CAAC,SAAoB;QAC1C,KAAK,MAAM,IAAI,IAAI,IAAI,CAAC,MAAM;YAC5B,IAAI,IAAI,CAAC,gBAAgB,CAAC,SAAS,CAAC,KAAK,KAAK;gBAC5C,OAAO,KAAK,CAAC;QAEjB,IAAI,CAAC,IAAI,CAAC,aAAa,CAAC,MAAM;YAC5B,SAAS,CAAC,aAAa,CAAC,IAAI,CAAC,aAAa,EAAE,IAAI,CAAC,aAAa,CAAC,CAAC;QAElE,OAAO,IAAI,CAAC;IACd,CAAC;IAED;;;;;;;;;;;;OAYG;IACI,oBAAoB,CAAC,UAAuB,EAAE,SAAqB;QACxE,IAAI,KAAK,GAAG,sBAAsB,CAAC,IAAI,CAAC;QACxC,IAAI,KAAK,GAAG,CAAC,MAAM,CAAC,SAAS,CAAC;QAC9B,IAAI,MAAM,GAAG,MAAM,CAAC,SAAS,CAAC;QAC9B,MAAM,MAAM,GAAa,EAAE,CAAC;QAC5B,IAAI,MAAM,GAAG,CAAC,CAAC;QAEf,IAAI,IAAI,CAAC,MAAM,CAAC,MAAM,KAAK,CAAC;YAC1B,OAAO,MAAM,CAAC;QAChB,IAAI,cAAqC,CAAC;QAC1C,MAAM,UAAU,GAAG,SAAS,CAAC,cAAc,EAAE,CAAC;QAE9C,KAAK,MAAM,IAAI,IAAI,IAAI,CAAC,MAAM,EAAE;YAC9B,IAAI,IAAI,YAAY,SAAS,EAAE;gBAC7B,IAAI,cAAc,KAAK,SAAS,IAAI,IAAI,KAAK,cAAc,EAAE,EAAO,6BAA6B;oBAC/F,IAAI,QAAQ,GAAG,SAAS,CAAC,cAAc,EAAE,CAAC;oBAC1C,IAAI,QAAQ,GAAG,SAAS,CAAC,cAAc,EAAE,CAAC;oBAE1C,IAAI,cAAc,CAAC,cAAc,IAAI,IAAI,CAAC,cAAc,EAAE;wBACxD,QAAQ,GAAG,IAAI,CAAC,iBAAkB,CAAC,KAAK,EAAE,CAAC;wBAC3C,QAAQ,GAAG,cAAc,CAAC,eAAgB,CAAC,KAAK,EAAE,CAAC;qBACpD;oBACD,UAAU,CAAC,OAAO,CAAC,QAAQ,CAAC,0BAA0B,CAAC,QAAQ,CAAC,CAAC,CAAC;iBACnE;gBACD,IAAI,CAAC,cAAc;oBACjB,cAAc,GAAG,IAAI,CAAC;gBACxB,UAAU,CAAC,MAAM,CAAC,GAAG,EAAE,CAAC;gBAExB,IAAI,IAAI,CAAC,OAAO,KAAK,SAAS,EAAE;oBAC9B,KAAK,GAAG,sBAAsB,CAAC,KAAK,CAAC;oBAErC,IAAI,IAAI,CAAC,UAAU,EAAE;wBACnB,KAAK,GAAG,KAAK,GAAG,sBAAsB,CAAC,KAAK,CAAC;wBAC7C,MAAM,GAAG,IAAI,CAAC,KAAM,CAAC;qBACtB;oBACD,IAAI,IAAI,CAAC,SAAS,EAAE;wBAClB,KAAK,GAAG,KAAK,GAAG,sBAAsB,CAAC,IAAI,CAAC;wBAC5C,KAAK,GAAG,IAAI,CAAC,IAAK,CAAC;qBACpB;oBAED,KAAK,MAAM,KAAK,IAAI,IAAI,CAAC,OAAO;wBAC9B,UAAU,CAAC,MAAM,CAAC,CAAC,IAAI,CAAC,KAAK,CAAC,KAAK,EAAE,CAAC,CAAC;oBACzC,UAAU,CAAC,oBAAoB,CAAC,UAAU,CAAC,MAAM,CAAC,EAAE,UAAU,CAAC,MAAM,CAAC,CAAC,CAAC;oBACxE,MAAM,EAAE,CAAC;iBACV;aACF;SACF;QAED,MAAM,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC;QACnB,MAAM,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC;QACnB,MAAM,CAAC,IAAI,CAAC,MAAM,CAAC,CAAC;QAEpB,IAAI,SAAS,IAAI,cAAc;YAC7B,SAAS,CAAC,OAAO,CAAC,cAAc,CAAC,iBAAkB,CAAC,CAAC;QAEvD,OAAO,MAAM,CAAC;IAChB,CAAC;IAED,+EAA+E;IACxE,YAAY,CAAC,SAAkB;QACpC,KAAK,MAAM,IAAI,IAAI,IAAI,CAAC,MAAM;YAC5B,IAAI,CAAC,YAAY,CAAC,SAAS,CAAC,CAAC;IACjC,CAAC;IAED,gIAAgI;IACzH,eAAe;QACpB,KAAK,MAAM,IAAI,IAAI,IAAI,CAAC,MAAM;YAC5B,IAAI,CAAC,kBAAkB,EAAE,CAAC;IAC9B,CAAC;IAED;;;;;;;;;;OAUG;IACI,wBAAwB,CAAC,MAAgB,EAAE,SAAkB,IAAI,EAAE,YAAqB,IAAI;QACjG,IAAI,MAAM,EAAE,EAAG,+CAA+C;YAC5D,MAAM,OAAO,GAAG,MAAM,CAAC,aAAa,EAAE,CAAC;YACvC,IAAI,CAAC,OAAO;gBACV,OAAO,KAAK,CAAC;YACf,OAAO,IAAI,CAAC,wBAAwB,CAAC,OAAO,EAAE,KAAK,EAAE,SAAS,CAAC,CAAC;SACjE;QACD,mDAAmD;QACnD,KAAK,MAAM,IAAI,IAAI,IAAI,CAAC,MAAM;YAC5B,IAAI,CAAC,wBAAwB,CAAC,MAAM,EAAE,KAAK,EAAE,SAAS,CAAC,CAAC;QAC1D,OAAO,IAAI,CAAC;IACd,CAAC;IAED;;;OAGG;IACI,wBAAwB,CAAC,MAAiB,EAAE,cAAuB,KAAK;QAC7E,IAAI,kBAAkB,GAAG,oBAAoB,CAAC,SAAS,CAAC;QAExD,KAAK,MAAM,SAAS,IAAI,IAAI,CAAC,MAAM,EAAE;YACnC,MAAM,eAAe,GAAG,SAAS,CAAC,wBAAwB,CAAC,MAAM,EAAE,WAAW,CAAC,CAAC;YAEhF,IAAI,oBAAoB,CAAC,SAAS,KAAK,eAAe;gBACpD,OAAO,oBAAoB,CAAC,SAAS,CAAC;YAExC,IAAI,oBAAoB,CAAC,SAAS,KAAK,kBAAkB;gBACvD,kBAAkB,GAAG,eAAe,CAAC;iBAClC,IAAI,kBAAkB,KAAK,eAAe;gBAC7C,OAAO,oBAAoB,CAAC,SAAS,CAAC;SACzC;QACD,OAAO,kBAAkB,CAAC;IAC5B,CAAC;IAED;;;OAGG;IACI,wBAAwB,CAAC,KAAc,EAAE,WAAoB;QAClE,MAAM,OAAO,GAAc,KAAK,CAAC,OAAO,EAAE,CAAC;QAC3C,OAAO,IAAI,CAAC,wBAAwB,CAAC,OAAO,EAAE,WAAW,CAAC,CAAC;IAC7D,CAAC;IAED;;;OAGG;IACI,0BAA0B,CAAC,MAAiB;QACjD,KAAK,MAAM,IAAI,IAAI,IAAI,CAAC,MAAM,EAAE;YAC9B,MAAM,YAAY,GAAG,IAAI,CAAC,kBAAkB,EAAE,CAAC;YAC/C,IAAI,YAAY,KAAK,SAAS,EAAE;gBAC9B,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,CAAC,GAAG,MAAM,CAAC,MAAM,EAAE,CAAC,EAAE,EAAE;oBAC1C,MAAM,OAAO,GAAG,aAAa,CAAC,MAAM,CAAC,MAAM,CAAC,CAAC,CAAC,EAAE,MAAM,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC,CAAC;oBAC/D,IAAI,YAAY,CAAC,2BAA2B,CAAC,OAAO,CAAC;wBACnD,OAAO,IAAI,CAAC;iBACf;aACF;SACF;QACD,OAAO,KAAK,CAAC;IACf,CAAC;IAED,oGAAoG;IAC7F,QAAQ,CAAC,SAAsB,EAAE,KAAa,EAAE,GAAW;QAChE,IAAI,CAAC,GAAG,GAAG,CAAC;QACZ,KAAK,IAAI,CAAC,GAAG,KAAK,EAAE,CAAC,GAAG,GAAG,EAAE,CAAC,EAAE;YAC9B,CAAC,IAAI,CAAC,SAAS,CAAC,CAAC,CAAC,CAAC,EAAE,GAAG,SAAS,CAAC,CAAC,CAAC,CAAC,EAAE,CAAC,CAAC;QAC3C,OAAO,CAAC,CAAC;IACX,CAAC;IAGD;;;OAGG;IACI,+BAA+B,CAAC,MAAiB;QACtD,MAAM,aAAa,GAAgB,EAAE,CAAC;QAEtC,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,CAAC,GAAG,MAAM,CAAC,MAAM,EAAE,CAAC,EAAE,EAAE;YAC1C,MAAM,OAAO,GAAG,aAAa,CAAC,MAAM,CAAC,MAAM,CAAC,CAAC,CAAC,EAAE,MAAM,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC,CAAC;YAC/D,IAAI,WAAW,GAAG,GAAG,CAAC;YACtB,IAAI,MAAM,GAAG,CAAC,CAAC;YAEf,KAAK,MAAM,IAAI,IAAI,IAAI,CAAC,MAAM,EAAE;gBAC9B,MAAM,YAAY,GAAG,IAAI,CAAC,kBAAkB,EAAE,CAAC;gBAC/C,IAAI,YAAY,KAAK,SAAS,EAAE;oBAC9B,YAAY,CAAC,0BAA0B,CAAC,OAAO,EAAE,aAAa,CAAC,CAAC;oBAChE,MAAM,MAAM,GAAG,aAAa,CAAC,MAAM,CAAC;oBACpC,WAAW,IAAI,IAAI,CAAC,QAAQ,CAAC,aAAa,EAAE,MAAM,EAAE,MAAM,CAAC,CAAC;oBAC5D,MAAM,GAAG,MAAM,CAAC;oBAChB,2CAA2C;oBAC3C,IAAI,WAAW,IAAI,UAAU,CAAC,oBAAoB;wBAChD,MAAM;iBACT;aACF;YACD,IAAI,WAAW,GAAG,UAAU,CAAC,oBAAoB;gBAC/C,OAAO,KAAK,CAAC;SAChB;QACD,OAAO,IAAI,CAAC;IACd,CAAC;IAED;;;;;;;;;;;;;;;;;;;;;OAqBG;IACI,eAAe;QACpB,SAAS,YAAY,CAAC,GAAW;YAC/B,OAAO,GAAG,GAAG,CAAC,QAAQ,EAAE,GAAG,CAAC;QAC9B,CAAC;QAED,SAAS,cAAc,CAAC,GAAa;YACnC,OAAO,GAAG,YAAY,CAAC,GAAG,CAAC,CAAC,CAAC,GAAG,YAAY,CAAC,GAAG,CAAC,CAAC,CAAC,GAAG,YAAY,CAAC,GAAG,CAAC,CAAC,CAAC,EAAE,CAAC;QAC9E,CAAC;QAED,SAAS,WAAW,CAAC,KAAa;YAChC,MAAM,CAAC,GAAG,KAAK,CAAC,QAAQ,EAAE,CAAC;YAC3B,MAAM,CAAC,CAAC,KAAK,CAAC,CAAC,MAAM,CAAC,CAAC;YACvB,OAAO,CAAC,CAAC;QACX,CAAC;QAED,SAAS,WAAW,CAAC,KAAgB;YACnC,IAAI,KAAK,GAAG,KAAK,CAAC,SAAS,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC;YACpC,KAAK,IAAI,CAAC,KAAK,CAAC,QAAQ,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC;YAClC,OAAO,GAAG,WAAW,CAAC,KAAK,CAAC,GAAG,cAAc,CAAC,KAAK,CAAC,eAAe,CAAC,GAAG,YAAY,CAAC,KAAK,CAAC,QAAQ,CAAC,EAAE,CAAC;QACxG,CAAC;QAED,SAAS,cAAc,CAAC,GAAuB;YAC7C,IAAI,MAAM,GAAG,EAAE,CAAC;YAChB,KAAK,MAAM,KAAK,IAAI,GAAG,CAAC,MAAM;gBAC5B,MAAM,GAAG,GAAG,MAAM,GAAG,WAAW,CAAC,KAAK,CAAC,EAAE,CAAC;YAE5C,OAAO,GAAG,MAAM,GAAG,CAAC;QACtB,CAAC;QAED,SAAS,eAAe,CAAC,IAAmB;YAC1C,MAAM,KAAK,GAAG,IAAI,CAAC,SAAS,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC;YACrC,IAAI,GAAG,GAAG,KAAK,CAAC,QAAQ,EAAE,CAAC;YAC3B,MAAM,CAAC,CAAC,KAAK,GAAG,CAAC,MAAM,CAAC,CAAC;YAEzB,MAAM,KAAK,GAAG,IAAI,CAAC,kBAAkB,EAAE,CAAC;YACxC,IAAI,KAAK,EAAE;gBACT,KAAK,MAAM,CAAC,IAAI,KAAK,CAAC,UAAU;oBAC9B,GAAG,GAAG,GAAG,GAAG,GAAG,cAAc,CAAC,CAAC,CAAC,EAAE,CAAC;aACtC;YAED,OAAO,GAAG,GAAG,GAAG,CAAC;QACnB,CAAC;QAED,IAAI,MAAM,GAAG,EAAE,CAAC;QAChB,KAAK,MAAM,SAAS,IAAI,IAAI,CAAC,KAAK;YAChC,MAAM,GAAG,GAAG,MAAM,GAAG,eAAe,CAAC,SAAS,CAAC,EAAE,CAAC;QAEpD,OAAO,GAAG,MAAM,GAAG,CAAC;IACtB,CAAC;;AArGuB,+BAAoB,GAAG,UAAU,CAAC;AAgH5D;;;GAGG;AACH,MAAM,KAAW,qBAAqB,CAkBrC;AAlBD,WAAiB,qBAAqB;IACpC;;;;OAIG;IACH,SAAgB,cAAc,CAAC,IAAiB;QAC9C,IAAI,CAAC,IAAI,IAAI,CAAC,IAAI,CAAC,OAAO;YACxB,OAAO,SAAS,CAAC;QAEnB,MAAM,GAAG,GAAG,IAAW,CAAC;QACxB,IAAI,SAAS,KAAK,GAAG,CAAC,UAAU;YAC9B,GAAG,CAAC,UAAU,GAAG,IAAI,CAAC,eAAe,EAAE,CAAC;QAE1C,MAAM,WAAW,GAAG,GAA4B,CAAC;QACjD,MAAM,CAAC,SAAS,KAAK,WAAW,CAAC,UAAU,CAAC,CAAC;QAC7C,OAAO,WAAW,CAAC;IACrB,CAAC;IAXe,oCAAc,iBAW7B,CAAA;AACH,CAAC,EAlBgB,qBAAqB,KAArB,qBAAqB,QAkBrC","sourcesContent":["/*---------------------------------------------------------------------------------------------\n* Copyright (c) Bentley Systems, Incorporated. All rights reserved.\n* See LICENSE.md in the project root for license terms and full copyright notice.\n*--------------------------------------------------------------------------------------------*/\n\n/** @packageDocumentation\n * @module CartesianGeometry\n */\n\nimport { assert } from \"@itwin/core-bentley\";\nimport { LineSegment3d } from \"../curve/LineSegment3d\";\nimport { Geometry } from \"../Geometry\";\nimport { Point3d, Vector3d } from \"../geometry3d/Point3dVector3d\";\nimport { Range3d } from \"../geometry3d/Range\";\nimport { Segment1d } from \"../geometry3d/Segment1d\";\nimport { Transform } from \"../geometry3d/Transform\";\nimport { Matrix4d } from \"../geometry4d/Matrix4d\";\nimport { ClipPlane } from \"./ClipPlane\";\nimport { ClipMaskXYZRangePlanes, ClipPrimitive, ClipPrimitiveProps, ClipShape } from \"./ClipPrimitive\";\nimport { ClipPlaneContainment } from \"./ClipUtils\";\nimport { ConvexClipPlaneSet } from \"./ConvexClipPlaneSet\";\n\n/** Wire format describing a [[ClipVector]].\n * @public\n */\nexport type ClipVectorProps = ClipPrimitiveProps[];\n\n/** Class holding an array structure of shapes defined by `ClipPrimitive`\n * * The `ClipVector` defines an intersection of the member `ClipPrimitive` regions.\n * * In the most common usage, one of the `ClipPrimitive` will be an outer region, and all others are holes with marker flag indicating that they outside of each hole is live.\n * @public\n */\nexport class ClipVector {\n  private _clips: ClipPrimitive[];\n  /** range acting as first filter.\n   * * This is understood as overall range limit, not as precise planes.\n   * * applying any rotation to the whole ClipVector generally expands this range, rather than exactly transforming its planes.\n   */\n  public boundingRange: Range3d = Range3d.createNull();\n\n  /** Returns a reference to the array of ClipShapes. */\n  public get clips() { return this._clips; }\n\n  private constructor(clips?: ClipPrimitive[]) {\n    this._clips = clips ? clips : [];\n  }\n\n  /** Returns true if this ClipVector contains a ClipPrimitive. */\n  public get isValid(): boolean { return this._clips.length > 0; }\n\n  /** Create a ClipVector with an empty set of ClipShapes. */\n  public static createEmpty(result?: ClipVector): ClipVector {\n    if (result) {\n      result._clips.length = 0;\n      return result;\n    }\n    return new ClipVector();\n  }\n\n  /** Create a ClipVector from an array of ClipPrimitives (or derived classes) (capture the pointers) */\n  public static createCapture(clips: ClipPrimitive[], result?: ClipVector): ClipVector {\n    if (result) {\n      result._clips = clips;\n      return result;\n    }\n    return new ClipVector(clips);\n  }\n\n  /** Create a ClipVector from (clones of) an array of ClipPrimitives */\n  public static create(clips: ClipPrimitive[], result?: ClipVector): ClipVector {\n    const clipClones: ClipPrimitive[] = [];\n    for (const clip of clips)\n      clipClones.push(clip.clone());\n    return ClipVector.createCapture(clipClones, result);\n  }\n\n  /** Create a deep copy of another ClipVector */\n  public clone(result?: ClipVector): ClipVector {\n    const retVal = result ? result : new ClipVector();\n    retVal._clips.length = 0;\n    for (const clip of this._clips) {\n      retVal._clips.push(clip.clone());\n    }\n    retVal.boundingRange.setFrom(this.boundingRange);\n    return retVal;\n  }\n\n  /** Parse this ClipVector into a JSON object. */\n  public toJSON(): ClipVectorProps {\n    if (!this.isValid)\n      return [];\n\n    return this.clips.map((clip) => clip.toJSON());\n  }\n\n  /** Parse a JSON object into a new ClipVector. */\n  public static fromJSON(json: ClipVectorProps | undefined, result?: ClipVector): ClipVector {\n    result = result ? result : new ClipVector();\n    result.clear();\n    if (!Array.isArray(json))\n      return result;\n\n    try {\n      for (const clip of json) {\n        const clipPrim = ClipPrimitive.fromJSON(clip);\n        if (clipPrim)\n          result._clips.push(clipPrim);\n      }\n    } catch (e) {\n      result.clear();\n    }\n\n    return result;\n  }\n\n  /** Empties out the array of ClipShapes. */\n  public clear() {\n    this._clips.length = 0;\n  }\n\n  /** Append a deep copy of the given ClipPrimitive to this ClipVector. */\n  public appendClone(clip: ClipPrimitive) {\n    this._clips.push(clip.clone());\n  }\n\n  /** Append a reference of the given ClipPrimitive to this ClipVector. */\n  public appendReference(clip: ClipPrimitive) {\n    this._clips.push(clip);\n  }\n\n  /** Create and append a new ClipPrimitive to the array given a shape as an array of points. Returns true if successful. */\n  public appendShape(shape: Point3d[], zLow?: number, zHigh?: number,\n    transform?: Transform, isMask: boolean = false, invisible: boolean = false): boolean {\n    const clip = ClipShape.createShape(shape, zLow, zHigh, transform, isMask, invisible);\n    if (!clip)\n      return false;\n    this._clips.push(clip);\n    return true;\n  }\n\n  /** Returns true if the given point lies inside all of this ClipVector's ClipShapes (by rule of intersection). */\n  public pointInside(point: Point3d, onTolerance: number = Geometry.smallMetricDistanceSquared): boolean {\n    if (!this.boundingRange.isNull && !this.boundingRange.containsPoint(point))\n      return false;\n\n    for (const clip of this._clips) {\n      if (!clip.pointInside(point, onTolerance))\n        return false;\n    }\n    return true;\n  }\n\n  /** Transforms this ClipVector to a new coordinate-system.\n   * Note that if the transform has rotate and scale the boundingRange member expands.\n   * Returns true if successful.\n   */\n  public transformInPlace(transform: Transform): boolean {\n    for (const clip of this._clips)\n      if (clip.transformInPlace(transform) === false)\n        return false;\n\n    if (!this.boundingRange.isNull)\n      transform.multiplyRange(this.boundingRange, this.boundingRange);\n\n    return true;\n  }\n\n  /**\n   * A simple way of packaging this ClipVector's ClipShape points into a multidimensional array, while also\n   * taking into account each ClipPrimitive's individual transforms.\n   *\n   * ClipPrimitives OTHER THAN ClipShape are ignored.\n   *\n   * Information out:\n   *  - All of the loop points are stored in the multidimensional Point3d array given (will return unchanged upon failure)\n   *  - If given a transform, will be set from the transformFromClip of the first ClipPrimitive\n   *  - The ClipMask of the final ClipPrimitive is stored in the returned array at index 0\n   *  - The last valid zLow found is stored in the returned array at index 1\n   *  - The last valid zHigh found is stored in the returned array at index 2\n   */\n  public extractBoundaryLoops(loopPoints: Point3d[][], transform?: Transform): number[] {\n    let clipM = ClipMaskXYZRangePlanes.None;\n    let zBack = -Number.MAX_VALUE;\n    let zFront = Number.MAX_VALUE;\n    const retVal: number[] = [];\n    let nLoops = 0;\n\n    if (this._clips.length === 0)\n      return retVal;\n    let firstClipShape: ClipShape | undefined;\n    const deltaTrans = Transform.createIdentity();\n\n    for (const clip of this._clips) {\n      if (clip instanceof ClipShape) {\n        if (firstClipShape !== undefined && clip !== firstClipShape) {      // Is not the first iteration\n          let fwdTrans = Transform.createIdentity();\n          let invTrans = Transform.createIdentity();\n\n          if (firstClipShape.transformValid && clip.transformValid) {\n            fwdTrans = clip.transformFromClip!.clone();\n            invTrans = firstClipShape.transformToClip!.clone();\n          }\n          deltaTrans.setFrom(invTrans.multiplyTransformTransform(fwdTrans));\n        }\n        if (!firstClipShape)\n          firstClipShape = clip;\n        loopPoints[nLoops] = [];\n\n        if (clip.polygon !== undefined) {\n          clipM = ClipMaskXYZRangePlanes.XAndY;\n\n          if (clip.zHighValid) {\n            clipM = clipM | ClipMaskXYZRangePlanes.ZHigh;\n            zFront = clip.zHigh!;\n          }\n          if (clip.zLowValid) {\n            clipM = clipM | ClipMaskXYZRangePlanes.ZLow;\n            zBack = clip.zLow!;\n          }\n\n          for (const point of clip.polygon)\n            loopPoints[nLoops].push(point.clone());\n          deltaTrans.multiplyPoint3dArray(loopPoints[nLoops], loopPoints[nLoops]);\n          nLoops++;\n        }\n      }\n    }\n\n    retVal.push(clipM);\n    retVal.push(zBack);\n    retVal.push(zFront);\n\n    if (transform && firstClipShape)\n      transform.setFrom(firstClipShape.transformFromClip!);\n\n    return retVal;\n  }\n\n  /** Sets this ClipVector and all of its members to the visibility specified. */\n  public setInvisible(invisible: boolean) {\n    for (const clip of this._clips)\n      clip.setInvisible(invisible);\n  }\n\n  /** For every clip, parse the member point array into the member clip plane object (only for clipPlanes member, not the mask) */\n  public parseClipPlanes() {\n    for (const clip of this._clips)\n      clip.fetchClipPlanesRef();\n  }\n\n  /**\n   * Multiply all ClipPlanes DPoint4d by matrix.\n   * @param matrix matrix to apply.\n   * @param invert if true, use in verse of the matrix.\n   * @param transpose if true, use the transpose of the matrix (or inverse, per invert parameter)\n   * * Note that if matrixA is applied to all of space, the matrix to send to this method to get a corresponding effect on the plane is the inverse transpose of matrixA\n   * * Callers that will apply the same matrix to many planes should pre-invert the matrix for efficiency.\n   * * Both params default to true to get the full effect of transforming space.\n   * @param matrix matrix to apply\n   * @returns false if matrix inversion fails.\n   */\n  public multiplyPlanesByMatrix4d(matrix: Matrix4d, invert: boolean = true, transpose: boolean = true): boolean {\n    if (invert) {  // form inverse once here, reuse for all planes\n      const inverse = matrix.createInverse();\n      if (!inverse)\n        return false;\n      return this.multiplyPlanesByMatrix4d(inverse, false, transpose);\n    }\n    // no inverse necessary -- lower level cannot fail.\n    for (const clip of this._clips)\n      clip.multiplyPlanesByMatrix4d(matrix, false, transpose);\n    return true;\n  }\n\n  /**\n   * Determines whether the given points fall inside or outside this set of ClipShapes. If any set is defined by masking planes,\n   * checks the mask planes only, provided that ignoreMasks is false. Otherwise, checks the _clipplanes member.\n   */\n  public classifyPointContainment(points: Point3d[], ignoreMasks: boolean = false): ClipPlaneContainment {\n    let currentContainment = ClipPlaneContainment.Ambiguous;\n\n    for (const primitive of this._clips) {\n      const thisContainment = primitive.classifyPointContainment(points, ignoreMasks);\n\n      if (ClipPlaneContainment.Ambiguous === thisContainment)\n        return ClipPlaneContainment.Ambiguous;\n\n      if (ClipPlaneContainment.Ambiguous === currentContainment)\n        currentContainment = thisContainment;\n      else if (currentContainment !== thisContainment)\n        return ClipPlaneContainment.Ambiguous;\n    }\n    return currentContainment;\n  }\n\n  /**\n   * Determines whether a 3D range lies inside or outside this set of ClipShapes. If any set is defined by masking planes,\n   * checks the mask planes only, provided that ignoreMasks is false. Otherwise, checks the clip planes member.\n   */\n  public classifyRangeContainment(range: Range3d, ignoreMasks: boolean): ClipPlaneContainment {\n    const corners: Point3d[] = range.corners();\n    return this.classifyPointContainment(corners, ignoreMasks);\n  }\n\n  /**\n   * For an array of points (making up a LineString), tests whether the segment between each point lies inside the ClipVector.\n   * If true, returns true immediately.\n   */\n  public isAnyLineStringPointInside(points: Point3d[]): boolean {\n    for (const clip of this._clips) {\n      const clipPlaneSet = clip.fetchClipPlanesRef();\n      if (clipPlaneSet !== undefined) {\n        for (let i = 0; i + 1 < points.length; i++) {\n          const segment = LineSegment3d.create(points[i], points[i + 1]);\n          if (clipPlaneSet.isAnyPointInOrOnFromSegment(segment))\n            return true;\n        }\n      }\n    }\n    return false;\n  }\n\n  /** Note: Line segments are used to represent 1 dimensional intervals here, rather than segments. */\n  public sumSizes(intervals: Segment1d[], begin: number, end: number): number {\n    let s = 0.0;\n    for (let i = begin; i < end; i++)\n      s += (intervals[i].x1 - intervals[i].x0);\n    return s;\n  }\n\n  private static readonly _TARGET_FRACTION_SUM = 0.99999999;\n  /**\n   * For an array of points that make up a LineString, develops a line segment between each point pair,\n   * and returns true if all segments lie inside this ClipVector.\n   */\n  public isLineStringCompletelyContained(points: Point3d[]): boolean {\n    const clipIntervals: Segment1d[] = [];\n\n    for (let i = 0; i + 1 < points.length; i++) {\n      const segment = LineSegment3d.create(points[i], points[i + 1]);\n      let fractionSum = 0.0;\n      let index0 = 0;\n\n      for (const clip of this._clips) {\n        const clipPlaneSet = clip.fetchClipPlanesRef();\n        if (clipPlaneSet !== undefined) {\n          clipPlaneSet.appendIntervalsFromSegment(segment, clipIntervals);\n          const index1 = clipIntervals.length;\n          fractionSum += this.sumSizes(clipIntervals, index0, index1);\n          index0 = index1;\n          // ASSUME primitives are non-overlapping...\n          if (fractionSum >= ClipVector._TARGET_FRACTION_SUM)\n            break;\n        }\n      }\n      if (fractionSum < ClipVector._TARGET_FRACTION_SUM)\n        return false;\n    }\n    return true;\n  }\n\n  /** Serializes this ClipVector to a compact string representation appropriate for transmission as part of a URL.\n   * Chiefly used for requesting [Tile]($frontend)s with section cut facets.\n   * UnionOfConvexClipPlaneSets is obtained for each ClipPrimitive. The encoding is as follows:\n   *  ClipVector:\n   *    ClipPrimitive[]\n   *    _\n   *  ClipPrimitive:\n   *    invisible: 0|1\n   *    ConvexClipPlaneSet[]\n   *    _\n   *  ConvexClipPlaneSet:\n   *    ClipPlane[]\n   *    _\n   *  ClipPlane:\n   *    flags: 0|1|2|3, where 1=invisible and 2=interior\n   *    inwardNormal: Number[3]\n   *    distance: Number\n   *  Number:\n   *    number\n   *    _\n   * @alpha\n   */\n  public toCompactString(): string {\n    function formatNumber(num: number) {\n      return `${num.toString()}_`;\n    }\n\n    function formatVector3d(vec: Vector3d) {\n      return `${formatNumber(vec.x)}${formatNumber(vec.y)}${formatNumber(vec.z)}`;\n    }\n\n    function formatFlags(flags: number) {\n      const f = flags.toString();\n      assert(1 === f.length);\n      return f;\n    }\n\n    function formatPlane(plane: ClipPlane) {\n      let flags = plane.invisible ? 1 : 0;\n      flags |= (plane.interior ? 2 : 0);\n      return `${formatFlags(flags)}${formatVector3d(plane.inwardNormalRef)}${formatNumber(plane.distance)}`;\n    }\n\n    function formatPlaneSet(set: ConvexClipPlaneSet) {\n      let planes = \"\";\n      for (const plane of set.planes)\n        planes = `${planes}${formatPlane(plane)}`;\n\n      return `${planes}_`;\n    }\n\n    function formatPrimitive(prim: ClipPrimitive) {\n      const flags = prim.invisible ? 1 : 0;\n      let str = flags.toString();\n      assert(1 === str.length);\n\n      const union = prim.fetchClipPlanesRef();\n      if (union) {\n        for (const s of union.convexSets)\n          str = `${str}${formatPlaneSet(s)}`;\n      }\n\n      return `${str}_`;\n    }\n\n    let result = \"\";\n    for (const primitive of this.clips)\n      result = `${result}${formatPrimitive(primitive)}`;\n\n    return `${result}_`;\n  }\n}\n\n/** Bundles a [[ClipVector]] with its compact string representation.\n * @note The string representation is computed once; the ClipVector is assumed not to be subsequently modified.\n * @see [[StringifiedClipVector.fromClipVector]] to create from a ClipVector.\n * @see [[ClipVector.toCompactString]] for a description of the string representation.\n * @alpha\n */\nexport type StringifiedClipVector = ClipVector & { readonly clipString: string };\n\n/** Bundles a ClipVector with its compact string representation.\n * @note The string representation is computed once; the ClipVector is assumed not to be subsequently modified.\n * @alpha\n */\nexport namespace StringifiedClipVector { // eslint-disable-line @typescript-eslint/no-redeclare\n  /** Create from a ClipVector.\n   * @param clip The ClipVector to stringify.\n   * @returns The input ClipVector with its compact string representation, or undefined if the input is undefined or empty.\n   * @note The string representation is computed once; the ClipVector is assumed not to be subsequently modified.\n   */\n  export function fromClipVector(clip?: ClipVector): StringifiedClipVector | undefined {\n    if (!clip || !clip.isValid)\n      return undefined;\n\n    const ret = clip as any;\n    if (undefined === ret.clipString)\n      ret.clipString = clip.toCompactString();\n\n    const stringified = ret as StringifiedClipVector;\n    assert(undefined !== stringified.clipString);\n    return stringified;\n  }\n}\n"]}

package/lib/esm/clipping/ConvexClipPlaneSet.d.ts

@@ -0,0 +1,250 @@
+/** @packageDocumentation
+ * @module CartesianGeometry
+ */
+import { Arc3d } from "../curve/Arc3d";
+import { AnnounceNumberNumber, AnnounceNumberNumberCurvePrimitive } from "../curve/CurvePrimitive";
+import { Angle } from "../geometry3d/Angle";
+import { GrowableXYZArray } from "../geometry3d/GrowableXYZArray";
+import { Point3d, Vector3d } from "../geometry3d/Point3dVector3d";
+import { Range1d, Range3d } from "../geometry3d/Range";
+import { Ray3d } from "../geometry3d/Ray3d";
+import { GrowableXYZArrayCache } from "../geometry3d/ReusableObjectCache";
+import { Transform } from "../geometry3d/Transform";
+import { Matrix4d } from "../geometry4d/Matrix4d";
+import { ClipPlane, ClipPlaneProps } from "./ClipPlane";
+import { Clipper, ClipPlaneContainment, PolygonClipper } from "./ClipUtils";
+/** Wire format describing a [[ConvexClipPlaneSet]].
+ * @public
+ */
+export declare type ConvexClipPlaneSetProps = ClipPlaneProps[];
+/**
+ * A ConvexClipPlaneSet is a collection of ClipPlanes, often used for bounding regions of space.
+ * @public
+ */
+export declare class ConvexClipPlaneSet implements Clipper, PolygonClipper {
+    /** Value acting as "at infinity" for coordinates along a ray. */
+    static readonly hugeVal = 1e+37;
+    private _planes;
+    private constructor();
+    /** Return an array containing all the planes of the convex set.
+     * * Note that this has no leading keyword identifying it as a ConvexClipPlaneSet.
+     */
+    toJSON(): ConvexClipPlaneSetProps;
+    /** Extract clip planes from a json array `[  clipPlane, clipPlane ]`.
+     * * Non-clipPlane members are ignored.
+     */
+    static fromJSON(json: ConvexClipPlaneSetProps | undefined, result?: ConvexClipPlaneSet): ConvexClipPlaneSet;
+    /**
+     * Return true if all members are almostEqual to corresponding members of other.  This includes identical order in array.
+     * @param other clip plane to compare
+     */
+    isAlmostEqual(other: ConvexClipPlaneSet): boolean;
+    /** create from an array of planes.
+     * * Each plane reference in the `planes` array is taken into the result.
+     * * The input array itself is NOT taken into the result.
+     */
+    static createPlanes(planes: ClipPlane[], result?: ConvexClipPlaneSet): ConvexClipPlaneSet;
+    /**
+     * Create new convex set using selected planes of a Range3d.
+     * @param range range with coordinates
+     * @param lowX true to clip at the low x plane
+     * @param highX true to clip at the high x plane
+     * @param lowY true to clip at the low y plane
+     * @param highY true to clip at the high z plane
+     * @param lowZ true to clip at the low z plane
+     * @param highZ true to clip at the high z plane
+     */
+    static createRange3dPlanes(range: Range3d, lowX?: boolean, highX?: boolean, lowY?: boolean, highY?: boolean, lowZ?: boolean, highZ?: boolean): ConvexClipPlaneSet;
+    /** create an empty `ConvexClipPlaneSet` */
+    static createEmpty(result?: ConvexClipPlaneSet): ConvexClipPlaneSet;
+    /** negate all planes of the set. */
+    negateAllPlanes(): void;
+    /** Create a convex clip plane set that clips to `x0 <= x <= x1` and `y0 <= y <= y1`.
+     * * Note that there is no test for the usual ordering `x0 <= x1` or `y0 <= y1`.
+     *    * if the usual ordering is violated, the convex set is an empty set.
+     */
+    static createXYBox(x0: number, y0: number, x1: number, y1: number, result?: ConvexClipPlaneSet): ConvexClipPlaneSet;
+    /** Create a convex set containing a half space for each edge between points of a polyline.
+     * * Caller is responsible for assuring the polyline is convex.
+     * @param points array of points.  Only xy parts are considered.
+     * @param interior array whose boolean value is used as both the `interior` and `invisible` bits of the plane for the succeeding segment.   If this array is not provided, both are false.
+     * @param leftIsInside if true, the interior is "to the left" of the segments.  If false, interior is "to the right"
+     */
+    static createXYPolyLine(points: Point3d[], interior: boolean[] | undefined, leftIsInside: boolean, result?: ConvexClipPlaneSet): ConvexClipPlaneSet;
+    /**
+     * Create a convexClipPlaneSet with planes whose "inside" normal is to the left of each segment.
+     * @param points array of points.
+     */
+    static createXYPolyLineInsideLeft(points: Point3d[], result?: ConvexClipPlaneSet): ConvexClipPlaneSet;
+    /**
+     * (re)set a plane and ConvexClipPlaneSet for a convex array, such as a convex facet used for xy clip.
+     * * The planeOfPolygon is (re)initialized with the normal from 3 points, but not otherwise referenced.
+     * * The ConvexClipPlaneSet is filled with outward normals of the facet edges as viewed to xy plane.
+     * @param points
+     * @param result
+     */
+    static setPlaneAndXYLoopCCW(points: GrowableXYZArray, planeOfPolygon: ClipPlane, frustum: ConvexClipPlaneSet): void;
+    /** Deep clone of all planes. */
+    clone(result?: ConvexClipPlaneSet): ConvexClipPlaneSet;
+    /** Return the (reference to the) array of `ClipPlane` */
+    get planes(): ClipPlane[];
+    /** Test if there is any intersection with a ray defined by origin and direction.
+     * * Optionally record the range (null or otherwise) in caller-allocated result.
+     * * If the ray is unbounded inside the clip, result can contain positive or negative "Geometry.hugeCoordinate" values
+     * * If no result is provide, there are no object allocations.
+     * @param result optional Range1d to receive parameters along the ray.
+     */
+    hasIntersectionWithRay(ray: Ray3d, result?: Range1d): boolean;
+    /**
+     * Multiply all the ClipPlanes DPoint4d by matrix.
+     * @param matrix matrix to apply.
+     * @param invert if true, use in verse of the matrix.
+     * @param transpose if true, use the transpose of the matrix (or inverse, per invert parameter)
+     * * Note that if matrixA is applied to all of space, the matrix to send to this method to get a corresponding effect on the plane is the inverse transpose of matrixA
+     * * Callers that will apply the same matrix to many planes should pre-invert the matrix for efficiency.
+     * * Both params default to true to get the full effect of transforming space.
+     * @param matrix matrix to apply
+     */
+    multiplyPlanesByMatrix4d(matrix: Matrix4d, invert?: boolean, transpose?: boolean): boolean;
+    /** Return true if `point` satisfies `point.isPointInside` for all planes */
+    isPointInside(point: Point3d): boolean;
+    /** Return true if `point` satisfies `point.isPointOnOrInside` for all planes */
+    isPointOnOrInside(point: Point3d, tolerance: number): boolean;
+    /**
+     * Test if a sphere is completely inside the convex set.
+     * @param centerPoint center of sphere
+     * @param radius radius of sphere.
+     */
+    isSphereInside(centerPoint: Point3d, radius: number): boolean;
+    /** Find the parts of the line segment  (if any) that is within the convex clip volume.
+     * * The input fractional interval from fraction0 to fraction1 (increasing!!) is the active part to consider.
+     * * To clip to the usual bounded line segment, starts with fractions (0,1).
+     * If the clip volume is unbounded, the line interval may also be unbounded.
+     * * An unbounded line portion will have fraction coordinates positive or negative Number.MAX_VALUE.
+     * @param fraction0 fraction that is the initial lower fraction of the active interval. (e.g. 0.0 for bounded segment)
+     * @param fraction1 fraction that is the initial upper fraction of the active interval.  (e.g. 1.0 for bounded segment)
+     * @param pointA segment start (fraction 0)
+     * @param pointB segment end (fraction 1)
+     * @param announce function to be called to announce a fraction interval that is within the convex clip volume.
+     * @returns true if a segment was announced, false if entirely outside.
+     */
+    announceClippedSegmentIntervals(f0: number, f1: number, pointA: Point3d, pointB: Point3d, announce?: AnnounceNumberNumber): boolean;
+    private static _clipArcFractionArray;
+    /** Find fractional parts of the arc that are within this ClipPlaneSet, and announce each as
+     * * `announce(fraction, fraction, curve)`
+     */
+    announceClippedArcIntervals(arc: Arc3d, announce?: AnnounceNumberNumberCurvePrimitive): boolean;
+    /** Find the parts of the (unbounded) line segment  (if any) that is within the convex clip volume.
+     * @param pointA segment start (fraction 0)
+     * @param pointB segment end (fraction 1)
+     * @param announce function to be called to announce a fraction interval that is within the convex clip volume.
+     * @returns true if a segment was announced, false if entirely outside.
+     */
+    clipUnboundedSegment(pointA: Point3d, pointB: Point3d, announce?: AnnounceNumberNumber): boolean;
+    /** transform each plane in place. */
+    transformInPlace(transform: Transform): void;
+    /**
+     * Clip a polygon to the inside of the convex set.
+     * * Results with 2 or fewer points are ignored.
+     * * Other than ensuring capacity in the arrays, there are no object allocations during execution of this function.
+     * @param xyz input points.
+     * @param work work buffer
+     * @param tolerance tolerance for "on plane" decision.
+     */
+    clipConvexPolygonInPlace(xyz: GrowableXYZArray, work: GrowableXYZArray, tolerance?: number): void;
+    /** Clip a convex polygon to (a single) inside part and (possibly many) outside parts.
+     * @param xyz input polygon.
+     * @param outsideFragments an array to receive (via push, with no preliminary clear) outside fragments
+     * @param arrayCache cache for work arrays.
+     * @return the surviving inside part (if any)
+     */
+    clipInsidePushOutside(xyz: GrowableXYZArray, outsideFragments: GrowableXYZArray[] | undefined, arrayCache: GrowableXYZArrayCache): GrowableXYZArray | undefined;
+    /** Returns 1, 2, or 3 based on whether point array is strongly inside, ambiguous, or strongly outside respectively.
+     * * This has a peculiar expected use case as a very fast pre-filter for more precise clipping.
+     * * The expected point set is for a polygon.
+     * * Hence any clipping will eventually have to consider the lines between the points.
+     * * This method looks for the special case of a single clip plane that has all the points outside.
+     * * In this case the whole polygon must be outside.
+     * * Note that this does not detect a polygon that is outside but "crosses a corner" -- it is mixed with respect to
+     *     multiple planes.
+     */
+    classifyPointContainment(points: Point3d[], onIsOutside: boolean): ClipPlaneContainment;
+    /**
+     * * Create a convex clip set for a polygon swept with possible tilt angle.
+     * * planes are constructed by ClipPlane.createEdgeAndUpVector, using successive points from the array.
+     * * If the first and last points match, the polygon area is checked.  If the area is negative, points are used in reverse order.
+     * * If first and last points do not match, points are used in order given
+     * @param points polygon points. (Closure point optional)
+     * @param upVector primary sweep direction, as applied by ClipPlane.createEdgeAndUpVector
+     * @param tiltAngle angle to tilt sweep planes away from the sweep direction.
+     */
+    static createSweptPolyline(points: Point3d[], upVector: Vector3d, tiltAngle?: Angle): ConvexClipPlaneSet | undefined;
+    /**
+     * Add a plane to the convex set.
+     * @param plane plane to add
+     */
+    addPlaneToConvexSet(plane: ClipPlane | undefined): void;
+    /**
+     * test many points.  Distribute them to arrays depending on in/out result.
+     * @param points points to test
+     * @param inOrOn points that are in or on the set
+     * @param out points that are out.
+     */
+    clipPointsOnOrInside(points: Point3d[], inOrOn: Point3d[], out: Point3d[]): void;
+    /**
+     * Clip a polygon to the planes of the clip plane set.
+     * * For a convex input polygon, the output is another convex polygon.
+     * * For a non-convex input, the output may have double-back edges along plane intersections.  This is still a valid clip in a parity sense.
+     * * The containingPlane parameter allows callers within ConvexClipPlane set to bypass planes known to contain the polygon
+     * @param input input polygon, usually convex.
+     * @param output output polygon
+     * @param work work array.
+     * @param containingPlane if this plane is found in the convex set, it is NOT applied.
+     */
+    polygonClip(input: GrowableXYZArray | Point3d[], output: GrowableXYZArray, work: GrowableXYZArray, planeToSkip?: ClipPlane): void;
+    /**
+     * * Define new planes in this ConvexClipPlaneSet so it clips to the inside of a polygon.
+     * * always create planes for the swept edges of the polygon
+     * * optionally (with nonzero sideSelect) create a cap plane using the polygon normal.
+     * @param points Points of a bounding polygon
+     * @param sweepDirection direction to sweep.
+     * @param sideSelect 0 to have no cap polygon, 1 if the sweep vector side is in, -1 if sweep vector side is out.
+     */
+    reloadSweptPolygon(points: Point3d[], sweepDirection: Vector3d, sideSelect: number): number;
+    /**
+     * Compute intersections among all combinations of 3 planes in the convex set.
+     * * optionally throw out points that are not in the set.
+     * * optionally push the points in the caller-supplied point array.
+     * * optionally extend a caller supplied range.
+     * * In the common case where the convex set is (a) a slab or (b) a view frustum, there will be 8 points and the range is the range of the convex set.
+     * * If the convex set is unbounded, the range only contains the range of the accepted (corner) points, and the range is not a representative of the "range of all points in the set" .
+     * @param transform (optional) transform to apply to the points.
+     * @param points (optional) array to which computed points are to be added.
+     * @param range (optional) range to be extended by the computed points
+     * @param transform (optional) transform to apply to the accepted points.
+     * @param testContainment if true, test each point to see if it is within the convex set.  (Send false if confident that the convex set is rectilinear set such as a slab.  Send true if chiseled corners are possible)
+     * @returns number of points.
+     */
+    computePlanePlanePlaneIntersections(points: Point3d[] | undefined, rangeToExtend: Range3d | undefined, transform?: Transform, testContainment?: boolean): number;
+    /**
+     * Set the `invisible` property on each plane of the convex set.
+     * @param invisible value to store
+     */
+    setInvisible(invisible: boolean): void;
+    /**
+     * Add planes for z-direction clip between low and high z levels.
+     * @param invisible value to apply to the `invisible` bit for the new planes
+     * @param zLow low z value.  The plane clips out points with z below this.
+     * @param zHigh high z value.  The plane clips out points with z above this.
+     */
+    addZClipPlanes(invisible: boolean, zLow?: number, zHigh?: number): void;
+    /** Implement appendPolygonClip, as defined in interface PolygonClipper.  /**
+     *
+     * @param xyz input polygon.  This is not changed.
+     * @param insideFragments Array to receive "inside" fragments.  Each fragment is a GrowableXYZArray grabbed from the cache.  This is NOT cleared.
+     * @param outsideFragments Array to receive "outside" fragments.  Each fragment is a GrowableXYZArray grabbed from the cache.  This is NOT cleared.
+     * @param arrayCache cache for reusable GrowableXYZArray.
+     */
+    appendPolygonClip(xyz: GrowableXYZArray, insideFragments: GrowableXYZArray[], outsideFragments: GrowableXYZArray[], arrayCache: GrowableXYZArrayCache): void;
+}
+//# sourceMappingURL=ConvexClipPlaneSet.d.ts.map

package/lib/esm/clipping/ConvexClipPlaneSet.d.ts.map

@@ -0,0 +1 @@
+{"version":3,"file":"ConvexClipPlaneSet.d.ts","sourceRoot":"","sources":["../../../src/clipping/ConvexClipPlaneSet.ts"],"names":[],"mappings":"AAKA;;GAEG;AAEH,OAAO,EAAE,KAAK,EAAE,MAAM,gBAAgB,CAAC;AACvC,OAAO,EAAE,oBAAoB,EAAE,kCAAkC,EAAE,MAAM,yBAAyB,CAAC;AAEnG,OAAO,EAAE,KAAK,EAAE,MAAM,qBAAqB,CAAC;AAE5C,OAAO,EAAE,gBAAgB,EAAE,MAAM,gCAAgC,CAAC;AAElE,OAAO,EAAE,OAAO,EAAE,QAAQ,EAAE,MAAM,+BAA+B,CAAC;AAElE,OAAO,EAAE,OAAO,EAAE,OAAO,EAAE,MAAM,qBAAqB,CAAC;AACvD,OAAO,EAAE,KAAK,EAAE,MAAM,qBAAqB,CAAC;AAC5C,OAAO,EAAE,qBAAqB,EAAE,MAAM,mCAAmC,CAAC;AAC1E,OAAO,EAAE,SAAS,EAAE,MAAM,yBAAyB,CAAC;AACpD,OAAO,EAAE,QAAQ,EAAE,MAAM,wBAAwB,CAAC;AAClD,OAAO,EAAE,SAAS,EAAE,cAAc,EAAE,MAAM,aAAa,CAAC;AACxD,OAAO,EAAE,OAAO,EAAE,oBAAoB,EAAiB,cAAc,EAAE,MAAM,aAAa,CAAC;AAE3F;;GAEG;AACH,oBAAY,uBAAuB,GAAG,cAAc,EAAE,CAAC;AAEvD;;;GAGG;AACH,qBAAa,kBAAmB,YAAW,OAAO,EAAE,cAAc;IAChE,iEAAiE;IACjE,gBAAuB,OAAO,SAAQ;IACtC,OAAO,CAAC,OAAO,CAAc;IAI7B,OAAO;IAIP;;OAEG;IACI,MAAM,IAAI,uBAAuB;IAQxC;;OAEG;WACW,QAAQ,CAAC,IAAI,EAAE,uBAAuB,GAAG,SAAS,EAAE,MAAM,CAAC,EAAE,kBAAkB,GAAG,kBAAkB;IAclH;;;OAGG;IACI,aAAa,CAAC,KAAK,EAAE,kBAAkB,GAAG,OAAO;IAQxD;;;OAGG;WACW,YAAY,CAAC,MAAM,EAAE,SAAS,EAAE,EAAE,MAAM,CAAC,EAAE,kBAAkB,GAAG,kBAAkB;IAOhG;;;;;;;;;OASG;WACW,mBAAmB,CAAC,KAAK,EAAE,OAAO,EAC9C,IAAI,GAAE,OAAc,EAAE,KAAK,GAAE,OAAc,EAC3C,IAAI,GAAE,OAAc,EAAE,KAAK,GAAE,OAAc,EAC3C,IAAI,GAAE,OAAc,EAAE,KAAK,GAAE,OAAc,GAAG,kBAAkB;IAoBlE,2CAA2C;WAC7B,WAAW,CAAC,MAAM,CAAC,EAAE,kBAAkB,GAAG,kBAAkB;IAO1E,oCAAoC;IAC7B,eAAe,IAAI,IAAI;IAI9B;;;OAGG;WACW,WAAW,CAAC,EAAE,EAAE,MAAM,EAAE,EAAE,EAAE,MAAM,EAAE,EAAE,EAAE,MAAM,EAAE,EAAE,EAAE,MAAM,EAAE,MAAM,CAAC,EAAE,kBAAkB,GAAG,kBAAkB;IAY1H;;;;;OAKG;WACW,gBAAgB,CAAC,MAAM,EAAE,OAAO,EAAE,EAAE,QAAQ,EAAE,OAAO,EAAE,GAAG,SAAS,EAAE,YAAY,EAAE,OAAO,EAAE,MAAM,CAAC,EAAE,kBAAkB,GAAG,kBAAkB;IAwB1J;;;OAGG;WACW,0BAA0B,CAAC,MAAM,EAAE,OAAO,EAAE,EAAE,MAAM,CAAC,EAAE,kBAAkB,GAAG,kBAAkB;IAgB5G;;;;;;OAMG;WACW,oBAAoB,CAAC,MAAM,EAAE,gBAAgB,EAAE,cAAc,EAAE,SAAS,EAAE,OAAO,EAAE,kBAAkB;IAuBnH,gCAAgC;IACzB,KAAK,CAAC,MAAM,CAAC,EAAE,kBAAkB,GAAG,kBAAkB;IAO7D,yDAAyD;IACzD,IAAW,MAAM,IAAI,SAAS,EAAE,CAE/B;IAED;;;;;OAKG;IACI,sBAAsB,CAAC,GAAG,EAAE,KAAK,EAAE,MAAM,CAAC,EAAE,OAAO,GAAG,OAAO;IAkCpE;;;;;;;;;OASG;IACI,wBAAwB,CAAC,MAAM,EAAE,QAAQ,EAAE,MAAM,GAAE,OAAc,EAAE,SAAS,GAAE,OAAc,GAAG,OAAO;IAY7G,4EAA4E;IACrE,aAAa,CAAC,KAAK,EAAE,OAAO,GAAG,OAAO;IAQ7C,gFAAgF;IACzE,iBAAiB,CAAC,KAAK,EAAE,OAAO,EAAE,SAAS,EAAE,MAAM,GAAG,OAAO;IAQpE;;;;OAIG;IACI,cAAc,CAAC,WAAW,EAAE,OAAO,EAAE,MAAM,EAAE,MAAM,GAAG,OAAO;IAUpE;;;;;;;;;;;OAWG;IACI,+BAA+B,CAAC,EAAE,EAAE,MAAM,EAAE,EAAE,EAAE,MAAM,EAAE,MAAM,EAAE,OAAO,EAAE,MAAM,EAAE,OAAO,EAAE,QAAQ,CAAC,EAAE,oBAAoB,GAAG,OAAO;IAoC1I,OAAO,CAAC,MAAM,CAAC,qBAAqB,CAA8B;IAClE;;OAEG;IACI,2BAA2B,CAAC,GAAG,EAAE,KAAK,EAAE,QAAQ,CAAC,EAAE,kCAAkC,GAAG,OAAO;IAStG;;;;;OAKG;IACI,oBAAoB,CAAC,MAAM,EAAE,OAAO,EAAE,MAAM,EAAE,OAAO,EAAE,QAAQ,CAAC,EAAE,oBAAoB,GAAG,OAAO;IAGvG,qCAAqC;IAC9B,gBAAgB,CAAC,SAAS,EAAE,SAAS;IAM5C;;;;;;;OAOG;IACI,wBAAwB,CAAC,GAAG,EAAE,gBAAgB,EAAE,IAAI,EAAE,gBAAgB,EAAE,SAAS,GAAE,MAAqC;IAO/H;;;;;OAKG;IACI,qBAAqB,CAAC,GAAG,EAAE,gBAAgB,EAChD,gBAAgB,EAAE,gBAAgB,EAAE,GAAG,SAAS,EAChD,UAAU,EAAE,qBAAqB,GAAG,gBAAgB,GAAG,SAAS;IAqClE;;;;;;;;OAQG;IACI,wBAAwB,CAAC,MAAM,EAAE,OAAO,EAAE,EAAE,WAAW,EAAE,OAAO,GAAG,oBAAoB;IAqB9F;;;;;;;;OAQG;WACW,mBAAmB,CAAC,MAAM,EAAE,OAAO,EAAE,EAAE,QAAQ,EAAE,QAAQ,EAAE,SAAS,CAAC,EAAE,KAAK,GAAG,kBAAkB,GAAG,SAAS;IA4B3H;;;OAGG;IACI,mBAAmB,CAAC,KAAK,EAAE,SAAS,GAAG,SAAS;IAIvD;;;;;OAKG;IACI,oBAAoB,CAAC,MAAM,EAAE,OAAO,EAAE,EAAE,MAAM,EAAE,OAAO,EAAE,EAAE,GAAG,EAAE,OAAO,EAAE;IAWhF;;;;;;;;;OASG;IACI,WAAW,CAAC,KAAK,EAAE,gBAAgB,GAAG,OAAO,EAAE,EAAE,MAAM,EAAE,gBAAgB,EAAE,IAAI,EAAE,gBAAgB,EAAE,WAAW,CAAC,EAAE,SAAS;IAcjI;;;;;;;OAOG;IACI,kBAAkB,CAAC,MAAM,EAAE,OAAO,EAAE,EAAE,cAAc,EAAE,QAAQ,EAAE,UAAU,EAAE,MAAM,GAAG,MAAM;IA0ClG;;;;;;;;;;;;;OAaG;IACI,mCAAmC,CAAC,MAAM,EAAE,OAAO,EAAE,GAAG,SAAS,EAAE,aAAa,EAAE,OAAO,GAAG,SAAS,EAAE,SAAS,CAAC,EAAE,SAAS,EAAE,eAAe,GAAE,OAAc,GAAG,MAAM;IA8B7K;;;OAGG;IACI,YAAY,CAAC,SAAS,EAAE,OAAO;IAKtC;;;;;OAKG;IACI,cAAc,CAAC,SAAS,EAAE,OAAO,EAAE,IAAI,CAAC,EAAE,MAAM,EAAE,KAAK,CAAC,EAAE,MAAM;IAMvE;;;;;;OAMG;IACI,iBAAiB,CACtB,GAAG,EAAE,gBAAgB,EACrB,eAAe,EAAE,gBAAgB,EAAE,EACnC,gBAAgB,EAAE,gBAAgB,EAAE,EACpC,UAAU,EAAE,qBAAqB,GAAG,IAAI;CAc3C"}