passagemath-symbolics 10.8.1a1__cp311-cp311-macosx_13_0_arm64.whl

sage/manifolds/utilities.py

@@ -0,0 +1,1348 @@
+# sage_setup: distribution = sagemath-symbolics
+r"""
+Utilities for Calculus
+
+This module defines helper functions which are used for simplifications
+and display of symbolic expressions.
+
+AUTHORS:
+
+- Michal Bejger (2015) : class :class:`ExpressionNice`
+- Eric Gourgoulhon (2015, 2017) : simplification functions
+- Travis Scrimshaw (2016): review tweaks
+- Marius Gerbershagen (2022) : skip simplification of expressions with a single
+  number or symbolic variable
+"""
+
+# *****************************************************************************
+#
+#       Copyright (C) 2015 Michal Bejger <bejger@camk.edu.pl>
+#       Copyright (C) 2015, 2017 Eric Gourgoulhon <eric.gourgoulhon@obspm.fr>
+#       Copyright (C) 2016 Travis Scrimshaw <tscrimsh@umn.edu>
+#
+# This program is free software: you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation, either version 2 of the License, or
+# (at your option) any later version.
+#                  https://www.gnu.org/licenses/
+# ****************************************************************************
+
+from operator import pow as _pow
+
+from sage.functions.other import abs_symbolic
+from sage.functions.trig import cos, sin
+from sage.misc.functional import sqrt
+from sage.rings.rational import Rational
+from sage.symbolic.constants import pi
+from sage.symbolic.expression import Expression
+from sage.symbolic.expression_conversions import ExpressionTreeWalker
+from sage.symbolic.ring import SR
+
+
+class SimplifySqrtReal(ExpressionTreeWalker):
+    r"""
+    Class for simplifying square roots in the real domain, by walking the
+    expression tree.
+
+    The end user interface is the function :func:`simplify_sqrt_real`.
+
+    INPUT:
+
+    - ``ex`` -- a symbolic expression
+
+    EXAMPLES:
+
+    Let us consider the square root of an exact square under some assumption::
+
+        sage: assume(x<1)
+        sage: a = sqrt(x^2-2*x+1)
+
+    The method :meth:`~sage.symbolic.expression.Expression.simplify_full()`
+    is ineffective on such an expression::
+
+        sage: a.simplify_full()
+        sqrt(x^2 - 2*x + 1)
+
+    and the more aggressive method :meth:`~sage.symbolic.expression.Expression.canonicalize_radical()`
+    yields a wrong result, given that `x<1`::
+
+        sage: a.canonicalize_radical()  # wrong output!
+        x - 1
+
+    We construct a :class:`SimplifySqrtReal` object ``s`` from the symbolic
+    expression ``a``::
+
+        sage: from sage.manifolds.utilities import SimplifySqrtReal
+        sage: s = SimplifySqrtReal(a)
+
+    We use the ``__call__`` method to walk the expression tree and produce a
+    correctly simplified expression::
+
+        sage: s()
+        -x + 1
+
+    Calling the simplifier ``s`` with an expression actually simplifies this
+    expression::
+
+        sage: s(a)  # same as s() since s is built from a
+        -x + 1
+        sage: s(sqrt(x^2))
+        abs(x)
+        sage: s(sqrt(1+sqrt(x^2-2*x+1)))  # nested sqrt's
+        sqrt(-x + 2)
+
+    Another example where both
+    :meth:`~sage.symbolic.expression.Expression.simplify_full()` and
+    :meth:`~sage.symbolic.expression.Expression.canonicalize_radical()`
+    fail::
+
+        sage: b = sqrt((x-1)/(x-2))*sqrt(1-x)
+        sage: b.simplify_full()  # does not simplify
+        sqrt(-x + 1)*sqrt((x - 1)/(x - 2))
+        sage: b.canonicalize_radical()  # wrong output, given that x<1
+        (I*x - I)/sqrt(x - 2)
+        sage: SimplifySqrtReal(b)()  # OK, given that x<1
+        -(x - 1)/sqrt(-x + 2)
+
+    TESTS:
+
+    We check that the inverse of a square root is well simplified; this is a
+    a non-trivial test since ``1/sqrt(x)`` is represented by ``pow(x,-1/2)``
+    in the expression tree::
+
+        sage: SimplifySqrtReal(1/sqrt(x^2-4*x+4))()
+        -1/(x - 2)
+        sage: SimplifySqrtReal(sqrt((x-2)/((x-3)*(x^2-2*x+1))))()
+        -sqrt(-x + 2)/((x - 1)*sqrt(-x + 3))
+        sage: forget()  # for doctests below
+
+    .. SEEALSO::
+
+        :func:`simplify_sqrt_real` for more examples with
+        :class:`SimplifySqrtReal` at work.
+    """
+    def arithmetic(self, ex, operator):
+        r"""
+        This is the only method of the base class
+        :class:`~sage.symbolic.expression_conversions.ExpressionTreeWalker`
+        that is reimplemented, since square roots are considered as
+        arithmetic operations with ``operator`` = ``pow`` and
+        ``ex.operands()[1]`` = ``1/2`` or ``-1/2``.
+
+        INPUT:
+
+        - ``ex`` -- a symbolic expression
+        - ``operator`` -- an arithmetic operator
+
+        OUTPUT:
+
+        - a symbolic expression, equivalent to ``ex`` with square roots
+          simplified
+
+        EXAMPLES::
+
+            sage: from sage.manifolds.utilities import SimplifySqrtReal
+            sage: a = sqrt(x^2+2*x+1)
+            sage: s = SimplifySqrtReal(a)
+            sage: a.operator()
+            <built-in function pow>
+            sage: s.arithmetic(a, a.operator())
+            abs(x + 1)
+
+        ::
+
+            sage: a = x + 1  # no square root
+            sage: s.arithmetic(a, a.operator())
+            x + 1
+
+        ::
+
+            sage: a = x + 1 + sqrt(function('f')(x)^2)
+            sage: s.arithmetic(a, a.operator())
+            x + abs(f(x)) + 1
+        """
+        if operator is _pow:
+            operands = ex.operands()
+            power = operands[1]
+            one_half = Rational((1,2))
+            minus_one_half = -one_half
+            if (power == one_half) or (power == minus_one_half):
+                # This is a square root or the inverse of a square root
+                w0 = SR.wild(0)
+                w1 = SR.wild(1)
+                sqrt_pattern = w0**one_half
+                inv_sqrt_pattern = w0**minus_one_half
+                sqrt_ratio_pattern1 = w0**one_half * w1**minus_one_half
+                sqrt_ratio_pattern2 = w0**minus_one_half * w1**one_half
+                argum = operands[0]  # the argument of sqrt
+                if argum.has(sqrt_pattern) or argum.has(inv_sqrt_pattern):
+                    argum = self(argum)  # treatment of nested sqrt's
+                den = argum.denominator()
+                if not (den == 1):  # the argument of sqrt is a fraction
+                    # NB: after #19312 (integrated in Sage 6.10.beta7), the
+                    # above test cannot be written as "if den != 1:"
+                    num = argum.numerator()
+                    if num < 0 or den < 0:
+                        ex = sqrt(-num) / sqrt(-den)
+                    else:
+                        ex = sqrt(argum)
+                else:
+                    ex = sqrt(argum)
+                simpl = SR(ex._maxima_().radcan())
+                if (not simpl.match(sqrt_pattern) and
+                    not simpl.match(inv_sqrt_pattern) and
+                    not simpl.match(sqrt_ratio_pattern1) and
+                    not simpl.match(sqrt_ratio_pattern2)):
+                    # radcan transformed substantially the expression,
+                    # possibly getting rid of some sqrt; in order to ensure a
+                    # positive result, the absolute value of radcan's output
+                    # is taken, the call to simplify() taking care of possible
+                    # assumptions regarding signs of subexpression of simpl:
+                    simpl = abs(simpl).simplify()
+                if power == minus_one_half:
+                    simpl = SR(1)/simpl
+                return simpl
+        # If operator is not a square root, we default to ExpressionTreeWalker:
+        return super().arithmetic(ex, operator)
+
+
+class SimplifyAbsTrig(ExpressionTreeWalker):
+    r"""
+    Class for simplifying absolute values of cosines or sines (in the real
+    domain), by walking the expression tree.
+
+    The end user interface is the function :func:`simplify_abs_trig`.
+
+    INPUT:
+
+    - ``ex`` -- a symbolic expression
+
+    EXAMPLES:
+
+    Let us consider the following symbolic expression with some assumption
+    on the range of the variable `x`::
+
+        sage: assume(pi/2<x, x<pi)
+        sage: a = abs(cos(x)) + abs(sin(x))
+
+    The method :meth:`~sage.symbolic.expression.Expression.simplify_full()`
+    is ineffective on such an expression::
+
+        sage: a.simplify_full()
+        abs(cos(x)) + abs(sin(x))
+
+    We construct a :class:`SimplifyAbsTrig` object ``s`` from the symbolic
+    expression ``a``::
+
+        sage: from sage.manifolds.utilities import SimplifyAbsTrig
+        sage: s = SimplifyAbsTrig(a)
+
+    We use the ``__call__`` method to walk the expression tree and produce a
+    correctly simplified expression, given that `x\in(\pi/2, \pi)`::
+
+        sage: s()
+        -cos(x) + sin(x)
+
+    Calling the simplifier ``s`` with an expression actually simplifies this
+    expression::
+
+        sage: s(a)  # same as s() since s is built from a
+        -cos(x) + sin(x)
+        sage: s(abs(cos(x/2)) + abs(sin(x/2)))  #  pi/4 < x/2 < pi/2
+        cos(1/2*x) + sin(1/2*x)
+        sage: s(abs(cos(2*x)) + abs(sin(2*x)))  #  pi < 2 x < 2*pi
+        abs(cos(2*x)) - sin(2*x)
+        sage: s(abs(sin(2+abs(cos(x)))))  # nested abs(sin_or_cos(...))
+        sin(-cos(x) + 2)
+
+    TESTS::
+
+        sage: forget()  # for doctests below
+
+    .. SEEALSO::
+
+        :func:`simplify_abs_trig` for more examples with
+        :class:`SimplifyAbsTrig` at work.
+    """
+    def composition(self, ex, operator):
+        r"""
+        This is the only method of the base class
+        :class:`~sage.symbolic.expression_conversions.ExpressionTreeWalker`
+        that is reimplemented, since it manages the composition of
+        ``abs`` with ``cos`` or ``sin``.
+
+        INPUT:
+
+        - ``ex`` -- a symbolic expression
+        - ``operator`` -- an operator
+
+        OUTPUT:
+
+        - a symbolic expression, equivalent to ``ex`` with ``abs(cos(...))``
+          and ``abs(sin(...))`` simplified, according to the range of their
+          argument.
+
+        EXAMPLES::
+
+            sage: from sage.manifolds.utilities import SimplifyAbsTrig
+            sage: assume(-pi/2 < x, x<0)
+            sage: a = abs(sin(x))
+            sage: s = SimplifyAbsTrig(a)
+            sage: a.operator()
+            abs
+            sage: s.composition(a, a.operator())
+            sin(-x)
+
+        ::
+
+            sage: a = exp(function('f')(x))  # no abs(sin_or_cos(...))
+            sage: a.operator()
+            exp
+            sage: s.composition(a, a.operator())
+            e^f(x)
+
+        ::
+
+            sage: forget()  # no longer any assumption on x
+            sage: a = abs(cos(sin(x)))  # simplifiable since -1 <= sin(x) <= 1
+            sage: s.composition(a, a.operator())
+            cos(sin(x))
+            sage: a = abs(sin(cos(x)))  # not simplifiable
+            sage: s.composition(a, a.operator())
+            abs(sin(cos(x)))
+        """
+        if operator is abs_symbolic:
+            argum = ex.operands()[0]  # argument of abs
+            if argum.operator() is sin:
+                # Case of abs(sin(...))
+                x = argum.operands()[0]  # argument of sin
+                w0 = SR.wild()
+                if x.has(abs_symbolic(sin(w0))) or x.has(abs_symbolic(cos(w0))):
+                    x = self(x)  # treatment of nested abs(sin_or_cos(...))
+                # Simplifications for values of x in the range [-pi, 2*pi]:
+                if x >= 0 and x <= pi:
+                    ex = sin(x)
+                elif (x > pi and x <= 2*pi) or (x >= -pi and x < 0):
+                    ex = -sin(x)
+                return ex
+            if argum.operator() is cos:
+                # Case of abs(cos(...))
+                x = argum.operands()[0]  # argument of cos
+                w0 = SR.wild()
+                if x.has(abs_symbolic(sin(w0))) or x.has(abs_symbolic(cos(w0))):
+                    x = self(x)  # treatment of nested abs(sin_or_cos(...))
+                # Simplifications for values of x in the range [-pi, 2*pi]:
+                if (x >= -pi/2 and x <= pi/2) or (x >= 3*pi/2 and x <= 2*pi):
+                    ex = cos(x)
+                elif (x > pi/2 and x <= 3*pi/2) or (x >= -pi and x < -pi/2):
+                    ex = -cos(x)
+                return ex
+        # If no pattern is found, we default to ExpressionTreeWalker:
+        return super().composition(ex, operator)
+
+
+def simplify_sqrt_real(expr):
+    r"""
+    Simplify ``sqrt`` in symbolic expressions in the real domain.
+
+    EXAMPLES:
+
+    Simplifications of basic expressions::
+
+        sage: from sage.manifolds.utilities import simplify_sqrt_real
+        sage: simplify_sqrt_real( sqrt(x^2) )
+        abs(x)
+        sage: assume(x<0)
+        sage: simplify_sqrt_real( sqrt(x^2) )
+        -x
+        sage: simplify_sqrt_real( sqrt(x^2-2*x+1) )
+        -x + 1
+        sage: simplify_sqrt_real( sqrt(x^2) + sqrt(x^2-2*x+1) )
+        -2*x + 1
+
+    This improves over
+    :meth:`~sage.symbolic.expression.Expression.canonicalize_radical`,
+    which yields incorrect results when ``x < 0``::
+
+        sage: forget()  # removes the assumption x<0
+        sage: sqrt(x^2).canonicalize_radical()
+        x
+        sage: assume(x<0)
+        sage: sqrt(x^2).canonicalize_radical()
+        -x
+        sage: sqrt(x^2-2*x+1).canonicalize_radical() # wrong output
+        x - 1
+        sage: ( sqrt(x^2) + sqrt(x^2-2*x+1) ).canonicalize_radical() # wrong output
+        -1
+
+    Simplification of nested ``sqrt``'s::
+
+        sage: forget()  # removes the assumption x<0
+        sage: simplify_sqrt_real( sqrt(1 + sqrt(x^2)) )
+        sqrt(abs(x) + 1)
+        sage: assume(x<0)
+        sage: simplify_sqrt_real( sqrt(1 + sqrt(x^2)) )
+        sqrt(-x + 1)
+        sage: simplify_sqrt_real( sqrt(x^2 + sqrt(4*x^2) + 1) )
+        -x + 1
+
+    Again, :meth:`~sage.symbolic.expression.Expression.canonicalize_radical`
+    fails on the last one::
+
+        sage: (sqrt(x^2 + sqrt(4*x^2) + 1)).canonicalize_radical()
+        x - 1
+
+    TESTS:
+
+    Simplification of expressions involving some symbolic derivatives::
+
+        sage: f = function('f')
+        sage: simplify_sqrt_real( diff(f(x), x)/sqrt(x^2-2*x+1) )  # x<0 => x-1<0
+        -diff(f(x), x)/(x - 1)
+        sage: g = function('g')
+        sage: simplify_sqrt_real( sqrt(x^3*diff(f(g(x)), x)^2) )  # x<0
+        (-x)^(3/2)*abs(D[0](f)(g(x)))*abs(diff(g(x), x))
+        sage: forget()  # for doctests below
+    """
+    w0 = SR.wild()
+    one_half = Rational((1,2))
+    if expr.has(w0**one_half) or expr.has(w0**(-one_half)):
+        return SimplifySqrtReal(expr)()
+    return expr
+
+
+def simplify_abs_trig(expr):
+    r"""
+    Simplify ``abs(sin(...))`` and ``abs(cos(...))`` in symbolic expressions.
+
+    EXAMPLES::
+
+        sage: M = Manifold(3, 'M', structure='topological')
+        sage: X.<x,y,z> = M.chart(r'x y:(0,pi) z:(-pi/3,0)')
+        sage: X.coord_range()
+        x: (-oo, +oo); y: (0, pi); z: (-1/3*pi, 0)
+
+    Since `x` spans all `\RR`, no simplification of ``abs(sin(x))``
+    occurs, while ``abs(sin(y))`` and ``abs(sin(3*z))`` are correctly
+    simplified, given that `y \in (0,\pi)` and `z \in (-\pi/3,0)`::
+
+        sage: from sage.manifolds.utilities import simplify_abs_trig
+        sage: simplify_abs_trig( abs(sin(x)) + abs(sin(y)) + abs(sin(3*z)) )
+        abs(sin(x)) + sin(y) + sin(-3*z)
+
+    Note that neither
+    :meth:`~sage.symbolic.expression.Expression.simplify_trig` nor
+    :meth:`~sage.symbolic.expression.Expression.simplify_full`
+    works in this case::
+
+        sage: s = abs(sin(x)) + abs(sin(y)) + abs(sin(3*z))
+        sage: s.simplify_trig()
+        abs(4*cos(-z)^2 - 1)*abs(sin(-z)) + abs(sin(x)) + abs(sin(y))
+        sage: s.simplify_full()
+        abs(4*cos(-z)^2 - 1)*abs(sin(-z)) + abs(sin(x)) + abs(sin(y))
+
+    despite the following assumptions hold::
+
+        sage: assumptions()
+        [x is real, y is real, y > 0, y < pi, z is real, z > -1/3*pi, z < 0]
+
+    Additional checks are::
+
+        sage: simplify_abs_trig( abs(sin(y/2)) )  # shall simplify
+        sin(1/2*y)
+        sage: simplify_abs_trig( abs(sin(2*y)) )  # must not simplify
+        abs(sin(2*y))
+        sage: simplify_abs_trig( abs(sin(z/2)) )  # shall simplify
+        sin(-1/2*z)
+        sage: simplify_abs_trig( abs(sin(4*z)) )  # must not simplify
+        abs(sin(-4*z))
+
+    Simplification of ``abs(cos(...))``::
+
+        sage: forget()
+        sage: M = Manifold(3, 'M', structure='topological')
+        sage: X.<x,y,z> = M.chart(r'x y:(0,pi/2) z:(pi/4,3*pi/4)')
+        sage: X.coord_range()
+        x: (-oo, +oo); y: (0, 1/2*pi); z: (1/4*pi, 3/4*pi)
+        sage: simplify_abs_trig( abs(cos(x)) + abs(cos(y)) + abs(cos(2*z)) )
+        abs(cos(x)) + cos(y) - cos(2*z)
+
+    Additional tests::
+
+        sage: simplify_abs_trig(abs(cos(y-pi/2)))  # shall simplify
+        cos(-1/2*pi + y)
+        sage: simplify_abs_trig(abs(cos(y+pi/2)))  # shall simplify
+        -cos(1/2*pi + y)
+        sage: simplify_abs_trig(abs(cos(y-pi)))  # shall simplify
+        -cos(-pi + y)
+        sage: simplify_abs_trig(abs(cos(2*y)))  # must not simplify
+        abs(cos(2*y))
+        sage: simplify_abs_trig(abs(cos(y/2)) * abs(sin(z)))  # shall simplify
+        cos(1/2*y)*sin(z)
+
+    TESTS:
+
+    Simplification of expressions involving some symbolic derivatives::
+
+        sage: f = function('f')
+        sage: s = abs(cos(x)) + abs(cos(y))*diff(f(x),x) + abs(cos(2*z))
+        sage: simplify_abs_trig(s)
+        cos(y)*diff(f(x), x) + abs(cos(x)) - cos(2*z)
+        sage: s = abs(sin(x))*diff(f(x),x).subs(x=y^2) + abs(cos(y))
+        sage: simplify_abs_trig(s)
+        abs(sin(x))*D[0](f)(y^2) + cos(y)
+        sage: forget()  # for doctests below
+    """
+    w0 = SR.wild()
+    if expr.has(abs_symbolic(sin(w0))) or expr.has(abs_symbolic(cos(w0))):
+        return SimplifyAbsTrig(expr)()
+    return expr
+
+
+def simplify_chain_real(expr):
+    r"""
+    Apply a chain of simplifications to a symbolic expression, assuming the
+    real domain.
+
+    This is the simplification chain used in calculus involving coordinate
+    functions on real manifolds, as implemented in
+    :class:`~sage.manifolds.chart_func.ChartFunction`.
+
+    The chain is formed by the following functions, called
+    successively:
+
+    #. :meth:`~sage.symbolic.expression.Expression.simplify_factorial`
+    #. :meth:`~sage.symbolic.expression.Expression.simplify_trig`
+    #. :meth:`~sage.symbolic.expression.Expression.simplify_rational`
+    #. :func:`simplify_sqrt_real`
+    #. :func:`simplify_abs_trig`
+    #. :meth:`~sage.symbolic.expression.Expression.canonicalize_radical`
+    #. :meth:`~sage.symbolic.expression.Expression.simplify_log`
+    #. :meth:`~sage.symbolic.expression.Expression.simplify_rational`
+    #. :meth:`~sage.symbolic.expression.Expression.simplify_trig`
+
+    EXAMPLES:
+
+    We consider variables that are coordinates of a chart on a real manifold::
+
+        sage: M = Manifold(2, 'M', structure='topological')
+        sage: X.<x,y> = M.chart('x:(0,1) y')
+
+    The following assumptions then hold::
+
+        sage: assumptions()
+        [x is real, x > 0, x < 1, y is real]
+
+    and we have::
+
+        sage: from sage.manifolds.utilities import simplify_chain_real
+        sage: s = sqrt(y^2)
+        sage: simplify_chain_real(s)
+        abs(y)
+
+    The above result is correct since ``y`` is real. It is obtained by
+    :meth:`~sage.symbolic.expression.Expression.simplify_real` as well::
+
+        sage: s.simplify_real()
+        abs(y)
+        sage: s.simplify_full()
+        abs(y)
+
+    Furthermore, we have::
+
+        sage: s = sqrt(x^2-2*x+1)
+        sage: simplify_chain_real(s)
+        -x + 1
+
+    which is correct since `x \in (0,1)`. On this example, neither
+    :meth:`~sage.symbolic.expression.Expression.simplify_real`
+    nor :meth:`~sage.symbolic.expression.Expression.simplify_full`,
+    nor :meth:`~sage.symbolic.expression.Expression.canonicalize_radical`
+    give satisfactory results::
+
+        sage: s.simplify_real()  # unsimplified output
+        sqrt(x^2 - 2*x + 1)
+        sage: s.simplify_full()  # unsimplified output
+        sqrt(x^2 - 2*x + 1)
+        sage: s.canonicalize_radical()  # wrong output since x in (0,1)
+        x - 1
+
+    Other simplifications::
+
+        sage: s = abs(sin(pi*x))
+        sage: simplify_chain_real(s)  # correct output since x in (0,1)
+        sin(pi*x)
+        sage: s.simplify_real()  # unsimplified output
+        abs(sin(pi*x))
+        sage: s.simplify_full()  # unsimplified output
+        abs(sin(pi*x))
+
+    ::
+
+        sage: s = cos(y)^2 + sin(y)^2
+        sage: simplify_chain_real(s)
+        1
+        sage: s.simplify_real()  # unsimplified output
+        cos(y)^2 + sin(y)^2
+        sage: s.simplify_full()  # OK
+        1
+
+    TESTS::
+
+        sage: forget()  # for doctests below
+    """
+    if expr.number_of_operands() == 0:
+        return expr
+    expr = expr.simplify_factorial()
+    expr = expr.simplify_trig()
+    expr = expr.simplify_rational()
+    expr = simplify_sqrt_real(expr)
+    expr = simplify_abs_trig(expr)
+    expr = expr.canonicalize_radical()
+    expr = expr.simplify_log('one')
+    expr = expr.simplify_rational()
+    expr = expr.simplify_trig()
+    return expr
+
+
+def simplify_chain_generic(expr):
+    r"""
+    Apply a chain of simplifications to a symbolic expression.
+
+    This is the simplification chain used in calculus involving coordinate
+    functions on manifolds over fields different from `\RR`, as implemented in
+    :class:`~sage.manifolds.chart_func.ChartFunction`.
+
+    The chain is formed by the following functions, called
+    successively:
+
+    #. :meth:`~sage.symbolic.expression.Expression.simplify_factorial`
+    #. :meth:`~sage.symbolic.expression.Expression.simplify_rectform`
+    #. :meth:`~sage.symbolic.expression.Expression.simplify_trig`
+    #. :meth:`~sage.symbolic.expression.Expression.simplify_rational`
+    #. :meth:`~sage.symbolic.expression.Expression.expand_sum`
+
+    NB: for the time being, this is identical to
+    :meth:`~sage.symbolic.expression.Expression.simplify_full`.
+
+    EXAMPLES:
+
+    We consider variables that are coordinates of a chart on a complex
+    manifold::
+
+        sage: M = Manifold(2, 'M', structure='topological', field='complex')
+        sage: X.<x,y> = M.chart()
+
+    Then neither ``x`` nor ``y`` is assumed to be real::
+
+        sage: assumptions()
+        []
+
+    Accordingly, ``simplify_chain_generic`` does not simplify
+    ``sqrt(x^2)`` to ``abs(x)``::
+
+        sage: from sage.manifolds.utilities import simplify_chain_generic
+        sage: s = sqrt(x^2)
+        sage: simplify_chain_generic(s)
+        sqrt(x^2)
+
+    This contrasts with the behavior of
+    :func:`~sage.manifolds.utilities.simplify_chain_real`.
+
+    Other simplifications::
+
+        sage: s = (x+y)^2 - x^2 -2*x*y - y^2
+        sage: simplify_chain_generic(s)
+        0
+        sage: s = (x^2 - 2*x + 1) / (x^2 -1)
+        sage: simplify_chain_generic(s)
+        (x - 1)/(x + 1)
+        sage: s = cos(2*x) - 2*cos(x)^2 + 1
+        sage: simplify_chain_generic(s)
+        0
+
+    TESTS::
+
+        sage: forget()  # for doctests below
+    """
+    if expr.number_of_operands() == 0:
+        return expr
+    expr = expr.simplify_factorial()
+    expr = expr.simplify_rectform()
+    expr = expr.simplify_trig()
+    expr = expr.simplify_rational()
+    expr = expr.expand_sum()
+    return expr
+
+
+def simplify_chain_generic_sympy(expr):
+    r"""
+    Apply a chain of simplifications to a sympy expression.
+
+    This is the simplification chain used in calculus involving coordinate
+    functions on manifolds over fields different from `\RR`, as implemented in
+    :class:`~sage.manifolds.chart_func.ChartFunction`.
+
+    The chain is formed by the following functions, called
+    successively:
+
+    #. :meth:`~sympy.simplify.combsimp`
+    #. :meth:`~sympy.simplify.trigsimp`
+    #. :meth:`~sympy.core.expand`
+    #. :meth:`~sympy.simplify.simplify`
+
+    EXAMPLES:
+
+    We consider variables that are coordinates of a chart on a complex
+    manifold::
+
+        sage: forget()  # for doctest only
+        sage: M = Manifold(2, 'M', structure='topological', field='complex', calc_method='sympy')
+        sage: X.<x,y> = M.chart()
+
+    Then neither ``x`` nor ``y`` is assumed to be real::
+
+        sage: assumptions()
+        []
+
+    Accordingly, ``simplify_chain_generic_sympy`` does not simplify
+    ``sqrt(x^2)`` to ``abs(x)``::
+
+        sage: from sage.manifolds.utilities import simplify_chain_generic_sympy
+        sage: s = (sqrt(x^2))._sympy_()
+        sage: simplify_chain_generic_sympy(s)
+        sqrt(x**2)
+
+    This contrasts with the behavior of
+    :func:`~sage.manifolds.utilities.simplify_chain_real_sympy`.
+
+    Other simplifications::
+
+        sage: s = ((x+y)^2 - x^2 -2*x*y - y^2)._sympy_()
+        sage: simplify_chain_generic_sympy(s)
+        0
+        sage: s = ((x^2 - 2*x + 1) / (x^2 -1))._sympy_()
+        sage: simplify_chain_generic_sympy(s)
+        (x - 1)/(x + 1)
+        sage: s = (cos(2*x) - 2*cos(x)^2 + 1)._sympy_()
+        sage: simplify_chain_generic_sympy(s)
+        0
+    """
+    expr = expr.combsimp()
+    expr = expr.trigsimp()
+    expr = expr.expand()
+    expr = expr.simplify()
+    return expr
+
+
+def simplify_chain_real_sympy(expr):
+    r"""
+    Apply a chain of simplifications to a sympy expression, assuming the
+    real domain.
+
+    This is the simplification chain used in calculus involving coordinate
+    functions on real manifolds, as implemented in
+    :class:`~sage.manifolds.chart_func.ChartFunction`.
+
+    The chain is formed by the following functions, called
+    successively:
+
+    #. :meth:`~sympy.simplify.combsimp`
+    #. :meth:`~sympy.simplify.trigsimp`
+    #. :func:`simplify_sqrt_real`
+    #. :func:`simplify_abs_trig`
+    #. :meth:`~sympy.core.expand`
+    #. :meth:`~sympy.simplify.simplify`
+
+    EXAMPLES:
+
+    We consider variables that are coordinates of a chart on a real manifold::
+
+        sage: forget()  # for doctest only
+        sage: M = Manifold(2, 'M', structure='topological',calc_method='sympy')
+        sage: X.<x,y> = M.chart('x:(0,1) y')
+
+    The following assumptions then hold::
+
+        sage: assumptions()
+        [x is real, x > 0, x < 1, y is real]
+
+    and we have::
+
+        sage: from sage.manifolds.utilities import simplify_chain_real_sympy
+        sage: s = (sqrt(y^2))._sympy_()
+        sage: simplify_chain_real_sympy(s)
+        Abs(y)
+
+    Furthermore, we have::
+
+        sage: s = (sqrt(x^2-2*x+1))._sympy_()
+        sage: simplify_chain_real_sympy(s)
+        1 - x
+
+    Other simplifications::
+
+        sage: s = (abs(sin(pi*x)))._sympy_()
+        sage: simplify_chain_real_sympy(s)  # correct output since x in (0,1)
+        sin(pi*x)
+
+    ::
+
+        sage: s = (cos(y)^2 + sin(y)^2)._sympy_()
+        sage: simplify_chain_real_sympy(s)
+        1
+    """
+    # TODO: introduce pure SymPy functions instead of simplify_sqrt_real and
+    #       simplify_abs_trig
+    if 'sqrt(' in str(expr):
+        expr = simplify_sqrt_real(expr._sage_())._sympy_()
+    expr = expr.combsimp()
+    expr = expr.trigsimp()
+    if 'sqrt(' in str(expr):
+        expr = simplify_sqrt_real(expr._sage_())._sympy_()
+    if 'Abs(sin(' in str(expr):
+        expr = simplify_abs_trig(expr._sage_())._sympy_()
+    expr = expr.expand()
+    expr = expr.simplify()
+    return expr
+
+#******************************************************************************
+
+
+class ExpressionNice(Expression):
+    r"""
+    Subclass of :class:`~sage.symbolic.expression.Expression` for a
+    "human-friendly" display of partial derivatives and the possibility to
+    shorten the display by skipping the arguments of symbolic functions.
+
+    INPUT:
+
+    - ``ex`` -- symbolic expression
+
+    EXAMPLES:
+
+    An expression formed with callable symbolic expressions::
+
+        sage: var('x y z')
+        (x, y, z)
+        sage: f = function('f')(x, y)
+        sage: g = f.diff(y).diff(x)
+        sage: h = function('h')(y, z)
+        sage: k = h.diff(z)
+        sage: fun = x*g + y*(k-z)^2
+
+    The standard Pynac display of partial derivatives::
+
+        sage: fun
+        y*(z - diff(h(y, z), z))^2 + x*diff(f(x, y), x, y)
+        sage: latex(fun)
+        y {\left(z - \frac{\partial}{\partial z}h\left(y, z\right)\right)}^{2} + x \frac{\partial^{2}}{\partial x\partial y}f\left(x, y\right)
+
+    With :class:`ExpressionNice`, the Pynac notation ``D[...]`` is replaced
+    by textbook-like notation::
+
+        sage: from sage.manifolds.utilities import ExpressionNice
+        sage: ExpressionNice(fun)
+        y*(z - d(h)/dz)^2 + x*d^2(f)/dxdy
+        sage: latex(ExpressionNice(fun))
+        y {\left(z - \frac{\partial\,h}{\partial z}\right)}^{2}
+         + x \frac{\partial^2\,f}{\partial x\partial y}
+
+    An example when function variables are themselves functions::
+
+        sage: f = function('f')(x, y)
+        sage: g = function('g')(x, f)  # the second variable is the function f
+        sage: fun = (g.diff(x))*x - x^2*f.diff(x,y)
+        sage: fun
+        -x^2*diff(f(x, y), x, y) + (diff(f(x, y), x)*D[1](g)(x, f(x, y)) + D[0](g)(x, f(x, y)))*x
+        sage: ExpressionNice(fun)
+        -x^2*d^2(f)/dxdy + (d(f)/dx*d(g)/d(f(x, y)) + d(g)/dx)*x
+        sage: latex(ExpressionNice(fun))
+        -x^{2} \frac{\partial^2\,f}{\partial x\partial y}
+         + {\left(\frac{\partial\,f}{\partial x}
+           \frac{\partial\,g}{\partial \left( f\left(x, y\right) \right)}
+         + \frac{\partial\,g}{\partial x}\right)} x
+
+    Note that ``D[1](g)(x, f(x,y))`` is rendered as ``d(g)/d(f(x, y))``.
+
+    An example with multiple differentiations::
+
+        sage: fun = f.diff(x,x,y,y,x)*x
+        sage: fun
+        x*diff(f(x, y), x, x, x, y, y)
+        sage: ExpressionNice(fun)
+        x*d^5(f)/dx^3dy^2
+        sage: latex(ExpressionNice(fun))
+        x \frac{\partial^5\,f}{\partial x ^ 3\partial y ^ 2}
+
+    Parentheses are added around powers of partial derivatives to avoid any
+    confusion::
+
+        sage: fun = f.diff(y)^2
+        sage: fun
+        diff(f(x, y), y)^2
+        sage: ExpressionNice(fun)
+        (d(f)/dy)^2
+        sage: latex(ExpressionNice(fun))
+        \left(\frac{\partial\,f}{\partial y}\right)^{2}
+
+    The explicit mention of function arguments can be omitted for the sake of
+    brevity::
+
+        sage: fun = fun*f
+        sage: ExpressionNice(fun)
+        f(x, y)*(d(f)/dy)^2
+        sage: Manifold.options.omit_function_arguments=True
+        sage: ExpressionNice(fun)
+        f*(d(f)/dy)^2
+        sage: latex(ExpressionNice(fun))
+        f \left(\frac{\partial\,f}{\partial y}\right)^{2}
+        sage: Manifold.options._reset()
+        sage: ExpressionNice(fun)
+        f(x, y)*(d(f)/dy)^2
+        sage: latex(ExpressionNice(fun))
+        f\left(x, y\right) \left(\frac{\partial\,f}{\partial y}\right)^{2}
+    """
+    def __init__(self, ex):
+        r"""
+        Initialize ``self``.
+
+        TESTS::
+
+            sage: f = function('f')(x)
+            sage: df = f.diff(x)
+            sage: df
+            diff(f(x), x)
+            sage: from sage.manifolds.utilities import ExpressionNice
+            sage: df_nice = ExpressionNice(df)
+            sage: df_nice
+            d(f)/dx
+        """
+        from sage.symbolic.ring import SR
+        self._parent = SR
+        Expression.__init__(self, SR, x=ex)
+
+    def _repr_(self):
+        r"""
+        String representation of the object.
+
+        EXAMPLES::
+
+            sage: var('x y z')
+            (x, y, z)
+            sage: f = function('f')(x, y)
+            sage: g = f.diff(y).diff(x)
+            sage: h = function('h')(y, z)
+            sage: k = h.diff(z)
+            sage: fun = x*g + y*(k-z)^2
+            sage: fun
+            y*(z - diff(h(y, z), z))^2 + x*diff(f(x, y), x, y)
+            sage: from sage.manifolds.utilities import ExpressionNice
+            sage: ExpressionNice(fun)
+            y*(z - d(h)/dz)^2 + x*d^2(f)/dxdy
+
+        Check that :issue:`33399` is fixed::
+
+            sage: ExpressionNice(function('f')(x+y, x-y).diff(y))
+            d(f)/d(x + y) - d(f)/d(x - y)
+        """
+        d = self._parent._repr_element_(self)
+
+        # find all occurrences of diff
+        list_d = []
+        _list_derivatives(self, list_d)
+
+        # process the list
+        for m in list_d:
+            funcname = m[1]
+            diffargs = m[3]
+            numargs = len(diffargs)
+
+            if numargs > 1:
+                numargs = "^" + str(numargs)
+            else:
+                numargs = ""
+
+            variables = m[4]
+            strv = [str(v) for v in variables]
+
+            # checking if the variable is composite
+            comp_chars = ['+', '-', '*', '/', '^', '(']
+            for i, sv in enumerate(strv):
+                if any(c in sv for c in comp_chars):
+                    strv[i] = "(" + sv + ")"
+
+            # dictionary to group multiple occurrences of differentiation: d/dxdx -> d/dx^2 etc.
+            occ = {i: strv[i] + "^" + str(D) if (D := diffargs.count(i)) > 1
+                   else strv[i] for i in diffargs}
+
+            res = f"d{numargs}({funcname})/d" + "d".join(occ.values())
+
+            # str representation of the operator
+            s = self._parent._repr_element_(m[0])
+
+            # if diff operator is raised to some power (m[5]), put brackets around
+            if m[5]:
+                res = "(" + res + ")^" + str(m[5])
+                o = s + "^" + str(m[5])
+            else:
+                o = s
+
+            d = d.replace(o, res)
+
+        import re
+
+        from sage.manifolds.manifold import TopologicalManifold
+        if TopologicalManifold.options.omit_function_arguments:
+            list_f = []
+            _list_functions(self, list_f)
+
+            for m in list_f:
+                d = re.sub(m[1] + r'\([^)]+\)', m[1], d)
+
+        return d
+
+    def _latex_(self):
+        r"""
+        LaTeX representation of the object.
+
+        EXAMPLES::
+
+            sage: var('x y z')
+            (x, y, z)
+            sage: f = function('f')(x, y)
+            sage: g = f.diff(y).diff(x)
+            sage: h = function('h')(y, z)
+            sage: k = h.diff(z)
+            sage: fun = x*g + y*(k-z)^2
+            sage: fun
+            y*(z - diff(h(y, z), z))^2 + x*diff(f(x, y), x, y)
+            sage: from sage.manifolds.utilities import ExpressionNice
+            sage: ExpressionNice(fun)
+            y*(z - d(h)/dz)^2 + x*d^2(f)/dxdy
+            sage: latex(ExpressionNice(fun))
+            y {\left(z - \frac{\partial\,h}{\partial z}\right)}^{2} + x \frac{\partial^2\,f}{\partial x\partial y}
+
+        Testing the behavior if no latex_name of the function is given::
+
+            sage: f = function('f_x')(x, y)
+            sage: fun = f.diff(y)
+            sage: latex(ExpressionNice(fun))
+            \frac{\partial\,f_{x}}{\partial y}
+
+        If latex_name, it should be used in LaTeX output::
+
+            sage: f = function('f_x', latex_name=r"{\cal F}")(x,y)
+            sage: fun = f.diff(y)
+            sage: latex(ExpressionNice(fun))
+            \frac{\partial\,{\cal F}}{\partial y}
+
+        Check that :issue:`33399` is fixed::
+
+            sage: latex(ExpressionNice(function('f')(x+y, x-y).diff(y)))
+            \frac{\partial\,f}{\partial \left( x + y \right)}
+             - \frac{\partial\,f}{\partial \left( x - y \right)}
+        """
+        from sage.misc.latex import latex
+
+        d = self._parent._latex_element_(self)
+
+        # find all occurrences of diff
+        list_d = []
+        _list_derivatives(self, list_d)
+
+        for m in list_d:
+            if str(m[1]) == str(m[2]):
+                funcname = str(m[1])
+            else:
+                funcname = str(m[2])
+
+            diffargs = m[3]
+            numargs = len(diffargs)
+
+            if numargs > 1:
+                numargs = "^" + str(numargs)
+            else:
+                numargs = ""
+
+            variables = m[4]
+
+            strv = [str(v) for v in variables]
+            latv = [latex(v) for v in variables]
+
+            # checking if the variable is composite
+            comp_chars = ['+', '-', '*', '/', '^', '(']
+            for i, sv in enumerate(strv):
+                if any(c in sv for c in comp_chars):
+                    latv[i] = r"\left(" + latv[i] + r"\right)"
+
+            # dictionary to group multiple occurrences of differentiation: d/dxdx -> d/dx^2 etc.
+            occ = {i: (latv[i] + "^" + latex(diffargs.count(i))
+                       if diffargs.count(i) > 1 else latv[i])
+                   for i in diffargs}
+
+            res = r"\frac{\partial" + numargs + r"\," + funcname + \
+                  r"}{\partial " + r"\partial ".join(i for i in occ.values()) + "}"
+
+            # representation of the operator
+            s = self._parent._latex_element_(m[0])
+
+            # if diff operator is raised to some power (m[5]), put brackets around
+            if m[5]:
+                res = r"\left(" + res + r"\right)^{" + str(m[5]) + "}"
+                o = s + "^{" + str(m[5]) + "}"
+            else:
+                o = s
+
+            d = d.replace(o, res)
+
+        from sage.manifolds.manifold import TopologicalManifold
+        if TopologicalManifold.options.omit_function_arguments:
+            list_f = []
+            _list_functions(self, list_f)
+
+            for m in list_f:
+                d = d.replace(str(m[3]) + str(m[4]), str(m[3]))
+
+        return d
+
+
+def _list_derivatives(ex, list_d, exponent=0):
+    r"""
+    Function to find the occurrences of ``FDerivativeOperator`` in a symbolic
+    expression; inspired by
+    http://ask.sagemath.org/question/10256/how-can-extract-different-terms-from-a-symbolic-expression/?answer=26136#post-id-26136
+
+    INPUT:
+
+    - ``ex`` -- symbolic expression to be analyzed
+    - ``exponent`` -- (optional) exponent of ``FDerivativeOperator``,
+      passed to a next level in the expression tree
+
+    OUTPUT:
+
+    - ``list_d`` -- tuple containing the details of ``FDerivativeOperator``
+      found, in the following order:
+
+      1. operator
+      2. function name
+      3. LaTeX function name
+      4. parameter set
+      5. operands
+      6. exponent (if found, else 0)
+
+    TESTS::
+
+        sage: f = function('f_x', latex_name=r"{\cal F}")(x)
+        sage: df = f.diff(x)^2
+        sage: from sage.manifolds.utilities import _list_derivatives
+        sage: list_d = []
+        sage: _list_derivatives(df, list_d)
+        sage: list_d
+        [(diff(f_x(x), x), 'f_x', {\cal F}, [0], [x], 2)]
+    """
+    op = ex.operator()
+    operands = ex.operands()
+
+    import operator
+
+    from sage.misc.latex import latex, latex_variable_name
+    from sage.symbolic.operators import FDerivativeOperator
+
+    if op:
+        if op is operator.pow:
+            if isinstance(operands[0].operator(), FDerivativeOperator):
+                exponent = operands[1]
+
+        if isinstance(op, FDerivativeOperator):
+            parameter_set = op.parameter_set()
+            function = repr(op.function())
+            latex_function = latex(op.function())
+
+            # case when no latex_name given
+            if function == latex_function:
+                latex_function = latex_variable_name(str(op.function()))
+
+            list_d.append((ex, function, latex_function, parameter_set,
+                           operands, exponent))
+
+        for operand in operands:
+            _list_derivatives(operand, list_d, exponent)
+
+
+def _list_functions(ex, list_f):
+    r"""
+    Function to find the occurrences of symbolic functions in a symbolic
+    expression.
+
+    INPUT:
+
+    - ``ex`` -- symbolic expression to be analyzed
+
+    OUTPUT:
+
+    - ``list_f`` -- tuple containing the details of a symbolic function found,
+      in the following order:
+
+      1. operator
+      2. function name
+      3. arguments
+      4. LaTeX version of function name
+      5. LaTeX version of arguments
+
+    TESTS::
+
+        sage: var('x y z')
+        (x, y, z)
+        sage: f = function('f', latex_name=r"{\cal F}")(x, y)
+        sage: g = function('g_x')(x, y)
+        sage: d = sin(x)*g.diff(x)*x*f - x^2*f.diff(x,y)/g
+        sage: from sage.manifolds.utilities import _list_functions
+        sage: list_f = []
+        sage: _list_functions(d, list_f)
+        sage: list_f
+        [(f, 'f', '(x, y)', {\cal F}, \left(x, y\right)),
+         (g_x, 'g_x', '(x, y)', 'g_{x}', \left(x, y\right))]
+    """
+    op = ex.operator()
+    operands = ex.operands()
+
+    from sage.misc.latex import latex, latex_variable_name
+
+    if op:
+        # FIXME: This hack is needed because the NewSymbolicFunction is
+        #   a class defined inside of the *function* function_factory().
+        if "NewSymbolicFunction" in str(type(op)):
+            repr_function = repr(op)
+            latex_function = latex(op)
+
+            # case when no latex_name given
+            if repr_function == latex_function:
+                latex_function = latex_variable_name(str(op))
+
+            repr_args = repr(ex.arguments())
+            # remove comma in case of singleton
+            if len(ex.arguments()) == 1:
+                repr_args = repr_args.replace(",","")
+
+            latex_args = latex(ex.arguments())
+
+            list_f.append((op, repr_function, repr_args, latex_function, latex_args))
+
+        for operand in operands:
+            _list_functions(operand, list_f)
+
+#******************************************************************************
+
+
+def set_axes_labels(graph, xlabel, ylabel, zlabel, **kwds):
+    r"""
+    Set axes labels for a 3D graphics object ``graph``.
+
+    This is a workaround for the lack of axes labels in 3D plots.
+    This sets the labels as :func:`~sage.plot.plot3d.shapes2.text3d`
+    objects at locations determined from the bounding box of the
+    graphic object ``graph``.
+
+    INPUT:
+
+    - ``graph`` -- :class:`~sage.plot.plot3d.base.Graphics3d`;
+      a 3D graphic object
+    - ``xlabel`` -- string for the x-axis label
+    - ``ylabel`` -- string for the y-axis label
+    - ``zlabel`` -- string for the z-axis label
+    - ``**kwds`` -- options (e.g. color) for text3d
+
+    OUTPUT: the 3D graphic object with text3d labels added
+
+    EXAMPLES::
+
+        sage: # needs sage.plot
+        sage: g = sphere()
+        sage: g.all
+        [Graphics3d Object]
+        sage: from sage.manifolds.utilities import set_axes_labels
+        sage: ga = set_axes_labels(g, 'X', 'Y', 'Z', color='red')
+        sage: ga.all  # the 3D frame has now axes labels
+        [Graphics3d Object, Graphics3d Object,
+         Graphics3d Object, Graphics3d Object]
+    """
+    from sage.plot.plot3d.shapes2 import text3d
+    xmin, ymin, zmin = graph.bounding_box()[0]
+    xmax, ymax, zmax = graph.bounding_box()[1]
+    dx = xmax - xmin
+    dy = ymax - ymin
+    dz = zmax - zmin
+    x1 = xmin + dx / 2
+    y1 = ymin + dy / 2
+    z1 = zmin + dz / 2
+    xmin1 = xmin - dx / 20
+    ymin1 = ymin - dy / 20
+    zmin1 = zmin - dz / 20
+    graph += text3d('  ' + xlabel, (x1, ymin1, zmin1), **kwds)
+    graph += text3d('  ' + ylabel, (xmin1, y1, zmin1), **kwds)
+    graph += text3d('  ' + zlabel, (xmin1, ymin1, z1), **kwds)
+    return graph
+
+
+def exterior_derivative(form):
+    r"""
+    Exterior derivative of a differential form.
+
+    INPUT:
+
+    - ``form`` -- a differential form; this must an instance of either
+
+      * :class:`~sage.manifolds.differentiable.scalarfield.DiffScalarField`
+        for a 0-form (scalar field)
+      * :class:`~sage.manifolds.differentiable.diff_form.DiffFormParal` for
+        a `p`-form (`p\geq 1`) on a parallelizable manifold
+      * :class:`~sage.manifolds.differentiable.diff_form.DiffForm` for a
+        a `p`-form (`p\geq 1`) on a non-parallelizable manifold
+
+    OUTPUT:
+
+    - the `(p+1)`-form that is the exterior derivative of ``form``
+
+    EXAMPLES:
+
+    Exterior derivative of a scalar field (0-form)::
+
+        sage: from sage.manifolds.utilities import exterior_derivative
+        sage: M = Manifold(3, 'M')
+        sage: X.<x,y,z> = M.chart()
+        sage: f = M.scalar_field({X: x+y^2+z^3}, name='f')
+        sage: df = exterior_derivative(f); df
+        1-form df on the 3-dimensional differentiable manifold M
+        sage: df.display()
+        df = dx + 2*y dy + 3*z^2 dz
+
+    An alias is ``xder``::
+
+        sage: from sage.manifolds.utilities import xder
+        sage: df == xder(f)
+        True
+
+    Exterior derivative of a 1-form::
+
+        sage: a = M.one_form(name='a')
+        sage: a[:] = [x+y*z, x-y*z, x*y*z]
+        sage: da = xder(a); da
+        2-form da on the 3-dimensional differentiable manifold M
+        sage: da.display()
+        da = (-z + 1) dx∧dy + (y*z - y) dx∧dz + (x*z + y) dy∧dz
+        sage: dda = xder(da); dda
+        3-form dda on the 3-dimensional differentiable manifold M
+        sage: dda.display()
+        dda = 0
+
+    .. SEEALSO::
+
+        :class:`sage.manifolds.differentiable.diff_form.DiffFormParal.exterior_derivative`
+        or :class:`sage.manifolds.differentiable.diff_form.DiffForm.exterior_derivative`
+        for more examples.
+    """
+    return form.exterior_derivative()
+
+
+xder = exterior_derivative