psychopy 2024.1.0__py3-none-any.whl

psychopy/visual/textbox/__init__.py

@@ -0,0 +1,1280 @@
+#!/usr/bin/env python
+# -*- coding: utf-8 -*-
+
+"""
+Created on Thu Mar 21 18:38:35 2013
+
+@author: Sol
+"""
+
+import os
+import inspect
+import numbers
+from weakref import proxy
+import time
+import numpy as np
+from psychopy import core, misc, colors, logging
+import psychopy.tools.colorspacetools as colortools
+import psychopy.tools.arraytools as arraytools
+import pyglet
+pyglet.options['debug_gl'] = False
+from pyglet.gl import (glCallList, glFinish, glGenLists, glNewList, glViewport,
+                       glMatrixMode, glLoadIdentity, glDisable, glEnable, glColorMaterial,
+                       glBlendFunc, glTranslatef, glColor4f, glRectf, glLineWidth, glBegin,
+                       GL_LINES, glVertex2d, glEndList, glClearColor, gluOrtho2D, glOrtho,
+                       glDeleteLists, GL_COMPILE, GL_PROJECTION, GL_MODELVIEW, glEnd,
+                       GL_DEPTH_TEST, GL_BLEND, GL_COLOR_MATERIAL, GL_FRONT_AND_BACK,
+                       GL_AMBIENT_AND_DIFFUSE, GL_SRC_ALPHA, GL_ONE_MINUS_SRC_ALPHA,
+                       glIsEnabled, GL_LINE_SMOOTH, GLint, GLfloat, glGetIntegerv,
+                       GL_LINE_WIDTH, glGetFloatv, GL_ALIASED_LINE_WIDTH_RANGE,
+                       GL_SMOOTH_LINE_WIDTH_RANGE, GL_SMOOTH_LINE_WIDTH_GRANULARITY,
+                       GL_POLYGON_SMOOTH)
+
+from .fontmanager import FontManager
+from .textgrid import TextGrid
+
+
+def getTime():
+    return core.getTime()
+
+
+def is_sequence(arg):
+    return (  # not hasattr(arg, "strip") and
+        hasattr(arg, "__getitem__") or
+        hasattr(arg, "__iter__"))
+
+_system_font_manager = None
+
+
+def getFontManager(mono_only=True):
+    global _system_font_manager
+    if _system_font_manager is None:
+        _system_font_manager = FontManager(mono_only)
+    return _system_font_manager
+# check that font manager is working
+fm = getFontManager()
+font_names = fm.getFontFamilyNames()
+if len(font_names) == 0:
+    logging.warn("TextBox Font Manager Found No Fonts.")
+
+
+def getGLInfo():
+    gl_info = dict()
+    gl_info['GL_LINE_SMOOTH'] = glIsEnabled(GL_LINE_SMOOTH)
+    lwidth = GLint()
+    glGetIntegerv(GL_LINE_WIDTH, lwidth)
+    gl_info['GL_LINE_WIDTH'] = lwidth
+    awrange = (GLfloat * 2)(0.0, 0.0)
+    glGetFloatv(GL_ALIASED_LINE_WIDTH_RANGE, awrange)
+    gl_info['GL_ALIASED_LINE_WIDTH_RANGE'] = awrange[0], awrange[1]
+    swrange = (GLfloat * 2)(0.0, 0.0)
+    glGetFloatv(GL_SMOOTH_LINE_WIDTH_RANGE, swrange)
+    gl_info['GL_SMOOTH_LINE_WIDTH_RANGE'] = swrange[0], swrange[1]
+    swg = GLfloat()
+    glGetFloatv(GL_SMOOTH_LINE_WIDTH_GRANULARITY, swg)
+    gl_info['GL_SMOOTH_LINE_WIDTH_GRANULARITY'] = swg
+    return gl_info
+
+
+class TextBox:
+    """
+    Similar to the visual.TextStim component, TextBox can be used to display
+    text within a psychopy window. TextBox and TextStim each have different
+    strengths and weaknesses. You should select the most appropriate text
+    component type based on how it will be used within the experiment.
+
+    NOTE: As of PsychoPy 1.79, TextBox should be considered experimental.
+    The two TextBox demo scripts provided have been tested on
+    all PsychoPy supported OS's and run without exceptions. However there are
+    very likely bugs in the existing TextBox code and the TextBox API will
+    be further enhanced and improved (i.e. changed) over the next couple months.
+
+    **TextBox Features**
+
+    * Text character placement is very well defined, useful when the exact
+      positioning of each letter needs to be known.
+
+    * The text string that is displayed can be changed ( setText() ) and
+      drawn ( win.draw() ) **very** quickly. See the TextBox vs. TextStim
+      comparison table for details.
+
+    * Built-in font manager; providing easy access to the font family names
+      and styles that are available on the computer being used.
+
+    * TextBox is a composite stimulus type, with the following graphical
+      elements, many of which can be changed to control many aspects of how
+      the TextBox is displayed.:
+
+         - TextBox Border / Outline
+         - TextBox Fill Area
+         - Text Grid Cell Lines
+         - Text Glyphs
+
+    * When using 'rgb' or 'rgb255' color spaces, colors can be specified as
+      a list/tuple of 3 elements (red, green, blue), or with four elements
+      (reg, green, blue, alpha) which allows different elements of the
+      TextBox to use different opacity settings if desired. For colors that
+      include the alpha channel value, it will be applied instead of the
+      opacity setting of the TextBox, effectively overriding the stimulus
+      defined opacity for that part of the textbox graphics. Colors that
+      do not include an alpha channel use the opacity setting as normal.
+
+    * Text Line Spacing can be controlled.
+
+    **Textbox Limitations**
+
+    * Only Monospace Fonts are supported.
+
+    * TextBox component is not a completely **standard** psychopy visual
+      stim and has the following functional difference:
+
+          - TextBox attributes are never accessed directly; get* and set*
+            methods are always used (this will be changed to use class
+            properties in the future).
+          - Setting an attribute of a TextBox only supports value replacement,
+            ( textbox.setFontColor([1.0,1.0,1.0]) ) and does not support
+            specifying operators.
+
+    * Some key word arguments supported by other stimulus types in general,
+      or by TextStim itself, are not supported by TextBox. See the TextBox
+      class definition for the arguments that are supported.
+
+    * When a new font, style, and size are used it takes about 1 second to
+      load and process the font. This is a one time delay for a given
+      font name, style, and size. After first being loaded,
+      the same font style can be used or re-applied to multiple TextBox
+      components with no significant delay.
+
+    * Auto logging or auto drawing is not currently supported.
+
+    TextStim and TextBox Comparison:
+
+    ============================ ============= ===========
+    Feature                      TextBox       TextStim
+    ============================ ============= ===========
+    Change text + redraw time^   1.513 msec    28.537 msec
+    No change + redraw time^     0.240 msec    0.931 msec
+    Initial Creation time^       0.927 msec    0.194 msec
+    MonoSpace Font Support       Yes           Yes
+    Non MonoSpace Font Support   No            Yes
+    Adjustable Line Spacing      Yes           No
+    Precise Text Pos. Info       Yes           No
+    Auto logging Support         No            Yes
+    Rotation Support             No            Yes
+    Word Wrapping Support        Yes           Yes
+    ============================ ============= ===========
+
+    ^ Times are in msec.usec format. Tested using the textstim_vs_textbox.py
+      demo script provided with the PsychoPy distribution. Results are
+      dependent on text length, video card, and OS. Displayed results are
+      based on 120 character string with an average of 24 words. Test computer
+      used Windows 7 64 bit, PsychoPy 1.79, with a i7 3.4 Ghz CPU, 8 GB RAM,
+      and NVIDIA 480 GTX 2GB graphics card.
+
+    Example::
+
+        from psychopy import visual
+
+        win=visual.Window(...)
+
+        # A Textbox stim that will look similar to a TextStim component
+
+        textstimlike=visual.TextBox(
+            window=win,
+            text="This textbox looks most like a textstim.",
+            font_size=18,
+            font_color=[-1,-1,1],
+            color_space='rgb',
+            size=(1.8,.1),
+            pos=(0.0,.5),
+            units='norm')
+
+        # A Textbox stim that uses more of the supported graphical features
+        #
+        textboxloaded=visual.TextBox(
+            window=win
+            text='TextBox showing all supported graphical elements',
+            font_size=32,
+            font_color=[1,1,1],
+            border_color=[-1,-1,1], # draw a blue border around stim
+            border_stroke_width=4, # border width of 4 pix.
+            background_color=[-1,-1,-1], # fill the stim background
+            grid_color=[1,-1,-1,0.5], # draw a red line around each
+                                      # possible letter area,
+                                      # 50% transparent
+            grid_stroke_width=1,  # with a width of 1 pix
+            textgrid_shape=[20,2],  # specify area of text box
+                                    # by the number of cols x
+                                    # number of rows of text to support
+                                    # instead of by a screen
+                                    # units width x height.
+            pos=(0.0,-.5),
+            # If the text string length < num rows * num cols in
+            # textgrid_shape, how should text be justified?
+            #
+            grid_horz_justification='center',
+            grid_vert_justification='center')
+
+        textstimlike.draw()
+        textboxloaded.draw()
+        win.flip()
+
+    """
+    _textbox_instances = {}
+    _gl_info = None
+
+    def __init__(self,
+                 window=None,                    # PsychoPy Window instance
+                 text='Default Test Text.',      # Initial text to be displayed.
+                 font_name=None,                 # Family name of Font
+                 bold=False,                     # Bold and italics are used to
+                 italic=False,                   # determine style of font
+                 font_size=32,                   # Pt size to use for font.
+                 font_color=(0, 0, 0, 1),        # Color to draw the text with.
+                 dpi=72,                         # DPI used to create font bitmaps
+                 line_spacing=0,                 # Amount of extra spacing to add between
+                 line_spacing_units='pix',       # lines of text.
+                 background_color=None,          # Color to use to fill the entire area
+                                                 # on the screen TextBox is using.
+                 border_color=None,              # TextBox border color to use.
+                 border_stroke_width=1,          # Stroke width of TextBox boarder (in pix)
+                 size=None,                      # (width,height) desired for the TextBox
+                                                 # stim to use. Specify using the unit
+                                                 # type the textBox is using.
+                 textgrid_shape=None,            # (cols,rows) of characters to use when
+                                                 # creating the textgrid layout.
+                                                 # rows*cols = maximum number of chars
+                                                 # that can be displayed. If textgrid_shape
+                                                 # is not None, then the TextBox size
+                                                 # must be at least large enough to hold
+                                                 # the number of specified cols and rows.
+                                                 # If the size specified is less than
+                                                 # what is needed, the size will be increased
+                                                 # automatically.      
+                 pos=(0.0, 0.0),                 # (x,y) screen position for the TextBox
+                                                 # stim. Specify using the unit
+                                                 # type the textBox is using.
+                 align_horz='center',            # Determines how TextBox x pos is
+                                                 # should be interpreted to.
+                                                 # 'left', 'center', 'right' are valid options.
+                 align_vert='center',            # Determines how TextBox y pos is
+                                                 # should be interpreted to.
+                                                 # 'left', 'center', 'right' are valid options.
+                 units='norm',                   # Coordinate unit type to use for position
+                                                 # and size related attributes. Valid
+                                                 # options are 'pix', 'cm', 'deg', 'norm'
+                                                 # Only pix is currently working though.
+                 grid_color=None,                # Color to draw the TextBox text grid
+                                                 # lines with.        
+                 grid_stroke_width=1,            # Line thickness (in pix) to use when
+                                                 # displaying text grid lines.
+                 color_space='rgb',              # PsychoPy color space to use for any
+                                                 # color attributes of TextBox.
+                 opacity=1.0,                    # Opacity (transparency) to use for
+                                                 # TextBox graphics, assuming alpha
+                                                 # channel was not specified in the color
+                                                 # attribute.
+                 grid_horz_justification='left', # 'left', 'center', 'right'
+                 grid_vert_justification='top',  # 'top', 'bottom', 'center'
+                 autoLog=True,                   # Log each time stim is updated.
+                 interpolate=False,
+                 name=None
+                 ):
+        self._window = proxy(window)
+
+        self._font_name = font_name
+        if self.getWindow().useRetina:
+            self._font_size = font_size*2
+        else:
+            self._font_size = font_size
+        self._dpi = dpi
+        self._bold = bold
+        self._italic = italic
+
+        self._text = text
+        self._label = name
+        self._line_spacing = line_spacing
+        self._line_spacing_units = line_spacing_units
+        self._border_color = border_color
+        self._background_color = background_color
+        self._border_stroke_width = border_stroke_width
+        self._grid_horz_justification = grid_horz_justification
+        self._grid_vert_justification = grid_vert_justification
+        self._align_horz = align_horz
+        self._align_vert = align_vert
+        self._size = size
+        self._position = pos
+        self._textgrid_shape = textgrid_shape
+        self._interpolate = interpolate
+
+        self._draw_start_dlist = None
+        self._draw_end_dlist = None
+        self._draw_te_background_dlist = None
+
+        if TextBox._gl_info is None:
+            TextBox._gl_info = getGLInfo()
+
+        aliased_wrange = TextBox._gl_info['GL_ALIASED_LINE_WIDTH_RANGE']
+        antia_wrange = TextBox._gl_info['GL_SMOOTH_LINE_WIDTH_RANGE']
+        if grid_stroke_width and grid_color:
+            if interpolate:
+                if grid_stroke_width < antia_wrange[0]:
+                    self._grid_stroke_width = antia_wrange[0]
+                if grid_stroke_width > antia_wrange[1]:
+                    self._grid_stroke_width = antia_wrange[1]
+            else:
+                if grid_stroke_width < aliased_wrange[0]:
+                    self._grid_stroke_width = aliased_wrange[0]
+                if grid_stroke_width > aliased_wrange[1]:
+                    self._grid_stroke_width = aliased_wrange[1]
+        if border_stroke_width and border_color:
+            if interpolate:
+                if border_stroke_width < antia_wrange[0]:
+                    self._border_stroke_width = antia_wrange[0]
+                if border_stroke_width > antia_wrange[1]:
+                    self._border_stroke_width = antia_wrange[1]
+            else:
+                if border_stroke_width < aliased_wrange[0]:
+                    self._border_stroke_width = aliased_wrange[0]
+                if border_stroke_width > aliased_wrange[1]:
+                    self._border_stroke_width = aliased_wrange[1]
+
+        self._units = units
+        if self._units is None:
+            self._units = self._window.units
+
+        self._opacity = opacity
+        if opacity is None:
+            self._opacity = 1.0
+        elif float(opacity) and float(opacity) >= 0 and float(opacity) <= 1.0:
+            self._opacity = float(opacity)
+        else:
+            raise ValueError(
+                "Text Box: opacity must be a number between 0.0 and 1.0, or None (which == 1.0). %s is not valid" % (str(opacity)))
+
+        self._color_space = color_space
+        if self._color_space is None:
+            self._color_space = self._window.colorSpace
+
+        # TODO: Implement support for autoLog
+        self._auto_log = autoLog
+
+        self._current_glfont = None
+        self._text_grid = None
+
+        if self._label is None:
+            self._label = 'TextBox_%s' % (str(int(time.time())))
+
+        fm = getFontManager()
+        if self._font_name is None:
+            self._font_name = fm.getFontFamilyStyles()[0][0]
+        gl_font = fm.getGLFont(
+            self._font_name, self._font_size, self._bold, self._italic, self._dpi)
+        self._current_glfont = gl_font
+
+        if size is None and textgrid_shape is None:
+            print('WARNING (TextBox) - No `size` or `textgrid_shape` given. Defaulting to displaying all text in a single row.')
+            textgrid_shape = (len(text), 1)
+
+        self._text_grid = TextGrid(self, line_color=grid_color,
+                                   line_width=grid_stroke_width, font_color=list(
+                                       font_color),
+                                   shape=textgrid_shape,
+                                   grid_horz_justification=grid_horz_justification,
+                                   grid_vert_justification=grid_vert_justification)
+        self._text_grid.setCurrentFontDisplayLists(
+            gl_font.charcode2displaylist)
+
+        self._text = self._text.replace('\r\n', '\n')
+        self._text_grid._createParsedTextDocument(self._text)
+
+        self._textbox_instances[self.getLabel()] = proxy(self)
+
+    def getWindow(self):
+        """
+        Returns the psychopy window that the textBox is associated with.
+        """
+        return self._window
+
+    def getText(self):
+        """
+        Return the text to display.
+        """
+        return self._text
+
+    def setText(self, text_source):
+        """
+        Set the text to be displayed within the Textbox.
+
+        Note that once a TextBox has been created, the number of character
+        rows and columns is static. To change the size of a TextBox,
+        a new TextBox stim must be created to replace the current Textbox stim.
+        Therefore ensure that the textbox is large enough to display
+        the largest length string to be presented in the TextBox. Characters
+        that do not fit within the TextBox will not be displayed.
+
+        Color value must be valid for the color space being used by the TextBox.
+        """
+        if not self._text:
+            raise ValueError(
+                "TextBox.setText only accepts strings with a length > 0")
+
+        self._text = text_source.replace('\r\n', '\n')
+        return self._text_grid._setText(self._text)
+
+    def getDisplayedText(self):
+        """
+        Return the text that fits within the TextBox and therefore is actually
+        seen. This is equal to::
+
+            text_length=len(self.getText())
+            cols,rows=self.getTextGridShape()
+
+            displayed_text=self.getText()[0:min(text_length,rows*cols]
+
+        """
+        return self._getTextWrappedDoc().getDisplayedText()
+
+    def getTextGridCellPlacement(self):
+        """Returns a 3D numpy array containing position information for each
+        text grid cell in the TextBox. The array has the shape (`num_cols`,
+        `num_rows`, `cell_bounds`), where num_cols is the number of `textgrid`
+        columns in the TextBox. `num_rows` is the number of `textgrid` rows in
+        the `TextBox`. `cell_bounds` is a 4 element array containing the (x pos,
+        y pos, width, height) data for the given cell. Position fields are for
+        the top left hand corner of the cell box. Column and Row indices start
+        at 0.
+
+        To get the shape of the textgrid in terms of columns and rows, use::
+
+            cell_pos_array=textbox.getTextGridCellPlacement()
+            col_row_count=cell_pos_array.shape[:2]
+
+        To access the position, width, and height for textgrid cell at
+        column 0 and row 0 (so the top left cell in the textgrid)::
+
+            cell00=cell_pos_array[0,0,:]
+
+        For the cell at col 3, row 1 (so 4th cell on second row)::
+
+            cell41=cell_pos_array[4,1,:]
+
+        """
+        col_lines = self._text_grid._col_lines
+        row_lines = self._text_grid._row_lines
+
+        cellinfo = np.zeros(
+            (len(col_lines[:-1]), len(row_lines[:-1]), 4), dtype=np.float32)
+
+        tb_tl = self._getTopLeftPixPos()
+        tg_tl = self._text_grid._position
+        starting_x, starting_y = tb_tl[0] + tg_tl[0], tb_tl[1] - tg_tl[1]
+
+        for i, x in enumerate(col_lines[:-1]):
+            for j, y in enumerate(row_lines[:-1]):
+                px, py = starting_x + x, starting_y + y
+                w, h = col_lines[i + 1] - px, -(row_lines[j + 1] - py)
+                cellinfo[i, j, 0] = px
+                cellinfo[i, j, 1] = py
+                cellinfo[i, j, 2] = w
+                cellinfo[i, j, 3] = h
+
+        for i, x in enumerate(col_lines[:-1]):
+            for j, y in enumerate(row_lines[:-1]):
+                x, y = self._pix2units(
+                    (float(cellinfo[i, j, 0]), float(cellinfo[i, j, 1])))
+                w, h = self._pix2units(
+                    (float(cellinfo[i, j, 2]), float(cellinfo[i, j, 3])), False)
+                cellinfo[i, j, 0] = x
+                cellinfo[i, j, 1] = y
+                cellinfo[i, j, 2] = w
+                cellinfo[i, j, 3] = h
+
+        return cellinfo
+
+    def getTextGridCellForCharIndex(self, char_index):
+        return self._getTextWrappedDoc().getTextGridCellForCharIndex(char_index)
+
+    def getGlyphPositionForTextIndex(self, char_index):
+        """For the provided char_index, which is the index of one character in
+        the current text being displayed by the TextBox ( getDisplayedText() ),
+        return the bounding box position, width, and height for the associated
+        glyph drawn to the screen. This factors in the glyphs position within
+        the textgrid cell it is being drawn in, so the returned bounding box is
+        for the actual glyph itself, not the textgrid cell. For textgrid cell
+        placement information, see the getTextGridCellPlacement() method.
+
+        The glyph position for the given text index is returned as a tuple
+        (x,y,width,height), where x,y is the top left hand corner of the
+        bounding box.
+
+        Special Cases:
+
+            * If the index provided is out of bounds for the currently displayed
+              text, None is returned.
+            * For u' ' (space) characters, the full textgrid cell bounding box
+              is returned.
+            * For u'\n' ( new line ) characters,the textgrid cell bounding box
+              is returned, but with the box width set to 0.
+
+        """
+
+        if char_index < 0 or char_index >= len(self.getDisplayedText()):
+            raise IndexError(
+                "The provided index of %d is out of range for the currently displayed text." % (char_index))
+
+        # Get the Glyph info for the char in question:
+        gl_font = getFontManager().getGLFont(self._font_name, self._font_size,
+                                             self._bold, self._italic, self._dpi)
+        glyph_data = gl_font.charcode2glyph.get(ord(self._text[char_index]))
+        ox, oy = glyph_data['offset'][
+            0], gl_font.max_ascender - glyph_data['offset'][1]
+        gw, gh = glyph_data['size']
+
+        # get the col,row for the xhar index provided
+        col_row = self._getTextWrappedDoc().getTextGridCellForCharIndex(char_index)
+        if col_row is None:
+            return None
+        cline = self._getTextWrappedDoc().getParsedLine(col_row[1])
+        c = col_row[0] + cline._trans_left
+        r = col_row[1] + cline._trans_top
+        x, y, width, height = self.getTextGridCellPlacement()[c, r, :]
+        ox, oy = self._pix2units((ox, oy), False)
+        gw, gh = self._pix2units((gw, gh), False)
+        return x + ox, y - oy, gw, gh
+
+    def _getTextWrappedDoc(self):
+        return self._text_grid._text_document
+
+    def getPosition(self):
+        """Return the x,y position of the textbox, in getUnitType() coord space.
+
+        """
+        return self._position
+
+    def setPosition(self, pos):
+        """
+        Set the (x,y) position of the TextBox on the Monitor. The position must
+        be given using the unit coord type used by the stim.
+
+        The TextBox position is interpreted differently depending on the
+        Horizontal and Vertical Alignment settings of the stim. See
+        getHorzAlignment() and getVertAlignment() for more information.
+
+
+        For example,
+        if the TextBox alignment is specified as left, top, then the position
+        specifies the top left hand corner of where the stim will be drawn.
+        An alignment of bottom,right indicates that the position value will
+        define where the bottom right corner of the TextBox will be drawn.
+        A horz., vert. alignment of center, center will place the center of
+        the TextBox at pos.
+
+        """
+        if pos[0] != self._position[0] or pos[1] != self._position[1]:
+            self._position = pos[0], pos[1]
+            self._deleteBackgroundDL()
+            self._deleteStartDL()
+
+    def getUnitType(self):
+        """
+        Returns which of the psychopy coordinate systems are used by the
+        TextBox. Position and size related attributes mush be specified
+        relative to the unit type being used. Valid options are:
+
+            * pix
+            * norm
+            * cm
+
+        """
+        return self._units
+
+    def getHorzAlign(self):
+        """
+        Return what textbox x position should be interpreted as. Valid options
+        are 'left', 'center', or 'right' .
+        """
+        return self._align_horz
+
+    def setHorzAlign(self, v):
+        """
+        Specify how the horizontal (x) component of the TextBox position
+        is to be interpreted. left = x position is the left edge, right =
+        x position is the right edge x position, and center = the x position
+        is used to center the stim horizontally.
+
+        """
+        if v != self._align_horz:
+            self._align_horz = v
+            self._deleteBackgroundDL()
+            self._deleteStartDL()
+
+    def getVertAlign(self):
+        """
+        Return what textbox y position should be interpreted as. Valid options
+        are 'top', 'center', or 'bottom' .
+
+        """
+        return self._align_vert
+
+    def setVertAlign(self, v):
+        """
+        Specify how the vertical (y) component of the TextBox position
+        is to be interpreted. top = y position is the top edge, bottom =
+        y position is the bottom edge y position, and center = the y position
+        is used to center the stim vertically.
+
+        """
+        if v != self._align_vert:
+            self._align_vert = v
+            self._deleteBackgroundDL()
+            self._deleteStartDL()
+
+    def getSize(self):
+        """
+        Return the width,height of the TextBox, using the unit type being
+        used by the stimulus.
+
+        """
+        return self._size
+
+    def getFontSize(self):
+        if self.getWindow().useRetina:
+            return self._font_size//2
+        return self._font_size
+        
+    def getFontColor(self):
+        """
+        Return the color used when drawing text glyphs.
+        """
+        return self._text_grid._font_color
+
+    def setFontColor(self, c):
+        """
+        Set the color to use when drawing text glyphs within the TextBox.
+        Color value must be valid for the color space being used by the TextBox.
+        For 'rgb', 'rgb255', and 'norm' based colors, three or four element lists
+        are valid. Three element colors use the TextBox getOpacity() value to
+        determine the alpha channel for the color. Four element colors use the
+        value of the fourth element to set the alpha value for the color.
+
+        """
+        if c != self._text_grid._font_color:
+            self._text_grid._font_color = c
+            self._text_grid._deleteTextDL()
+
+    def getBorderColor(self):
+        """
+        A border can be drawn around the perimeter of the TextBox. This method
+        sets the color of that border.
+        """
+        return self._border_color
+
+    def setBorderColor(self, c):
+        """
+        Set the color to use for the border of the textBox. The TextBox border
+        is a rectangular outline drawn around the edges of the TextBox stim.
+        Color value must be valid for the color space being used by the TextBox.
+
+        A value of None will disable drawing of the border.
+        """
+        if c != self._border_color:
+            self._border_color = c
+            self._deleteBackgroundDL()
+
+    def getBackgroundColor(self):
+        """
+        Get the color used to fill the rectangular area of the TextBox stim.
+        All other graphical elements of the TextBox are drawn on top of the
+        background.
+        """
+        return self._background_color
+
+    def setBackgroundColor(self, c):
+        """
+        Set the fill color used to fill the rectangular area of the TextBox stim.
+        Color value must be valid for the color space being used by the TextBox.
+
+        A value of None will disable drawing of the TextBox background.
+        """
+        if c != self._background_color:
+            self._background_color = c
+            self._deleteBackgroundDL()
+
+    def getTextGridLineColor(self):
+        """
+        Return the color used when drawing the outline of the text grid cells.
+        Each letter displayed in a TextBox populates one of the text cells
+        defined by the shape of the TextBox text grid.
+        Color value must be valid for the color space being used by the TextBox.
+
+        A value of None indicates drawing of the textgrid lines is disabled.
+        """
+        return self._text_grid._line_color
+
+    def setTextGridLineColor(self, c):
+        """
+        Set the color used when drawing text grid lines.
+        These are lines that can be drawn which mark the bounding box for
+        each character within the TextBox text grid.
+        Color value must be valid for the color space being used by the TextBox.
+
+        Provide a value of None to disable drawing of textgrid lines.
+        """
+        if c != self._text_grid._line_color:
+            self._text_grid._line_color = c
+            self._text_grid._deleteGridLinesDL()
+
+    def getColorSpace(self):
+        """Returns the psychopy color space used when specifying colors for
+        the TextBox. Supported values are:
+
+            * 'rgb'
+            * 'rbg255'
+            * 'norm'
+            * hex (implicit)
+            * html name (implicit)
+
+        See the Color Space section of the PsychoPy docs for details.
+
+        """
+        return self._color_space
+
+    def getHorzJust(self):
+        """Return how text should laid out horizontally when the number of
+        columns of each text grid row is greater than the number needed to
+        display the text for that text row.
+
+        """
+        return self._text_grid._horz_justification
+
+    def setHorzJust(self, v):
+        """
+        Specify how text within the TextBox should be aligned horizontally.
+        For example, if a text grid has 10 columns, and the text being displayed
+        is 6 characters in length, the horizontal justification determines
+        if the text should be draw starting at the left of the text columns (left),
+        or should be centered on the columns ('center', in this example
+        there would be two empty text cells to the left and right of the text.),
+        or should be drawn such that the last letter of text is drawn in the
+        last column of the text row ('right').
+        """
+        if v != self._text_grid._horz_justification:
+            self._text_grid.setHorzJust(v)
+            self._text_grid._deleteTextDL()
+
+    def getVertJust(self):
+        """
+        Return how text should laid out vertically when the
+        number of text grid rows is greater than the number
+        needed to display the current text
+        """
+        return self._text_grid._vert_justification
+
+    def setVertJust(self, v):
+        """
+        Specify how text within the TextBox should be aligned vertically.
+        For example, if a text grid has 3 rows for text, and the text being
+        displayed all fits on one row, the vertical justification determines
+        if the text should be draw on the top row of the text grid (top),
+        or should be centered on the rows ('center', in this example
+        there would be one row  above and below the row used to draw the text),
+        or should be drawn on the last row of the text grid, ('bottom').
+        """
+        if v != self._text_grid._vert_justification:
+            self._text_grid.setVertJust(v)
+            self._text_grid._deleteTextDL()
+
+    def getBorderWidth(self):
+        """
+        Get the stroke width of the optional TextBox area outline. This is always
+        given in pixel units.
+        """
+        return self._border_stroke_width
+
+    def setBorderWidth(self, c):
+        """
+        Set the stroke width (in pixels) to use for the border of the TextBox
+        stim. Border values must be within the range of stroke widths supported
+        by the OpenGL driver used by the graphics. Setting the
+        width outside the valid range will result in the stroke width being
+        clamped to the nearest end of the valid range.
+
+        Use the TextBox.getValidStrokeWidths() to access the minimum -
+        maximum range of valid line widths.
+        """
+        if c != self._border_stroke_width:
+            if self._interpolate:
+                lrange = TextBox._gl_info['GL_SMOOTH_LINE_WIDTH_RANGE']
+            else:
+                lrange = TextBox._gl_info['GL_ALIASED_LINE_WIDTH_RANGE']
+
+            if c < lrange[0]:
+                c = lrange[0]
+            elif c > lrange[1]:
+                c = lrange[1]
+
+            self._border_stroke_width = c
+            self._deleteBackgroundDL()
+
+    def getTextGridLineWidth(self):
+        """
+        Return the stroke width (in pixels) of the optional lines drawn around
+        the text grid cell areas.
+        """
+        return self._text_grid._line_width
+
+    def setTextGridLineWidth(self, c):
+        """
+        Set the stroke width (in pixels) to use for the text grid character
+        bounding boxes. Border values must be within the range of stroke
+        widths supported by the OpenGL driver used by the computer graphics
+        card. Setting the width outside the valid range will result in the
+        stroke width being clamped to the nearest end of the valid range.
+
+        Use the TextBox.getGLineRanges() to access a dict containing some
+        OpenGL parameters which provide the minimum, maximum, and resolution
+        of valid line widths.
+        """
+        if c != self._text_grid._line_width:
+            if self._interpolate:
+                lrange = TextBox._gl_info['GL_SMOOTH_LINE_WIDTH_RANGE']
+            else:
+                lrange = TextBox._gl_info['GL_ALIASED_LINE_WIDTH_RANGE']
+
+            if c < lrange[0]:
+                c = lrange[0]
+            elif c > lrange[1]:
+                c = lrange[1]
+
+            self._text_grid._line_width = c
+            self._text_grid._deleteGridLinesDL()
+
+    def getValidStrokeWidths(self):
+        """
+        Returns the stroke width range supported by the graphics card being
+        used. If the TextBox is Interpolated, a tuple is returns using
+        float values, with the following structure:
+
+        ((min_line_width, max_line_width), line_width_granularity)
+
+        If Interpolation is disabled for the TextBox, the returned tuple elements
+        are int values, with the following structure:
+
+        (min_line_width, max_line_width)
+
+        """
+        if self._interpolate:
+            return (TextBox._gl_info['GL_SMOOTH_LINE_WIDTH_RANGE'],
+                    TextBox._gl_info['GL_SMOOTH_LINE_WIDTH_GRANULARITY'])
+        else:
+            return self._gl_info['GL_ALIASED_LINE_WIDTH_RANGE']
+
+    def getOpacity(self):
+        """
+        Get the default TextBox transparency level used for color related
+        attributes. 0.0 equals fully transparent, 1.0 equals fully opaque.
+        """
+        return self._opacity
+
+    def setOpacity(self, o):
+        """
+        Sets the TextBox transparency level to use for color related
+        attributes of the Textbox. 0.0 equals fully transparent, 1.0 equals
+        fully opaque.
+
+        If opacity is set to None, it is assumed to have a default value of 1.0.
+
+        When a color is defined with a 4th element in the colors element list,
+        then this opacity value is ignored and the alpha value provided in the
+        color itself is used for that TextGrid element instead.
+        """
+        if o != self._opacity and o >= 0.0 and o <= 1.0:
+            self._text_grid._deleteTextDL()
+            self._deleteBackgroundDL()
+            self._text_grid._deleteGridLinesDL()
+            self._deleteStartDL()
+            self._deleteEndDL()
+            self._opacity = o
+
+    def getInterpolated(self):
+        """
+        Returns whether interpolation is enabled for the TextBox
+        when it is drawn. When True, GL_LINE_SMOOTH and GL_POLYGON_SMOOTH
+        are enabled within OpenGL; otherwise they are disabled.
+        """
+        return self._interpolate
+
+    def setInterpolated(self, interpolate):
+        """
+        Specify whether interpolation should be enabled for the TextBox
+        when it is drawn. When interpolate == True, GL_LINE_SMOOTH and
+        GL_POLYGON_SMOOTH are enabled within OpenGL. When interpolate is set
+        to False, GL_POLYGON_SMOOTH and GL_LINE_SMOOTH are disabled.
+        """
+        if interpolate != self._interpolate:
+            self._deleteStartDL()
+            self._interpolate = interpolate
+
+    def getLabel(self):
+        """
+        Return the label / name assigned to the textbox. This does not impact
+        how the stimulus looks when drawn, and instead is used for internal
+        purposes only.
+        """
+        return self._label
+
+    def getName(self):
+        """
+        Same as the GetLabel method.
+        """
+        return self._label
+
+    def getAutoLog(self):
+        """
+        Indicates if changes to textBox attribute values should be logged
+        automatically by PsychoPy. *Currently not supported by TextBox.*
+        """
+        return self._auto_log
+
+    def setAutoLog(self, v):
+        """
+        Specify if changes to textBox attribute values should be logged
+        automatically by PsychoPy. True enables auto logging; False disables it.
+        *Currently not supported by TextBox.*
+        """
+        self._auto_log = v
+
+    def getLineSpacing(self):
+        """
+        Return the additional spacing being applied between rows of text.
+        The value is in units specified by the textbox getUnits() method.
+        """
+        return self._line_spacing
+
+    def draw(self):
+        """
+        Draws the TextBox to the back buffer of the graphics card. Then call
+        win.flip() to display the changes drawn. If draw() is not called prior
+        to a call to win.flip(), the textBox will not be displayed for that
+        retrace.
+        """
+        self._te_start_gl()
+        self._te_bakground_dlist()
+        self._text_grid._text_glyphs_gl()
+        self._text_grid._textgrid_lines_gl()
+        self._te_end_gl()
+
+    def _te_start_gl(self):
+        if not self._draw_start_dlist:
+            dl_index = glGenLists(1)
+            glNewList(dl_index, GL_COMPILE)
+            glViewport(0, 0, self._window.size[0],
+                       self._window.size[1])
+            glMatrixMode(GL_PROJECTION)
+            glLoadIdentity()
+            glOrtho(0, self._window.size[0], 0,
+                    self._window.size[1], -1, 1)
+            glMatrixMode(GL_MODELVIEW)
+            glLoadIdentity()
+            self._window.depthTest = False
+            glEnable(GL_BLEND)
+            glEnable(GL_COLOR_MATERIAL)
+            glColorMaterial(GL_FRONT_AND_BACK, GL_AMBIENT_AND_DIFFUSE)
+            glBlendFunc(GL_SRC_ALPHA, GL_ONE_MINUS_SRC_ALPHA)
+            if self._interpolate:
+                glEnable(GL_LINE_SMOOTH)
+                glEnable(GL_POLYGON_SMOOTH)
+            else:
+                glDisable(GL_LINE_SMOOTH)
+                glDisable(GL_POLYGON_SMOOTH)
+            t, l = self._getTopLeftPixPos()
+            glTranslatef(t, l, 0)
+            glEndList()
+            self._draw_start_dlist = dl_index
+        glCallList(self._draw_start_dlist)
+
+    def _deleteStartDL(self):
+        if self._draw_start_dlist:
+            glDeleteLists(self._draw_start_dlist, 1)
+            self._draw_start_dlist = None
+
+    def _te_bakground_dlist(self):
+        if not self._draw_te_background_dlist and (self._background_color or self._border_color):
+            dl_index = glGenLists(1)
+            glNewList(dl_index, GL_COMPILE)
+
+            # draw textbox_background and outline
+            border_thickness = self._border_stroke_width
+            size = self._getPixelSize()
+            if self._border_stroke_width is None:
+                border_thickness = 0
+            if self._background_color:
+                bcolor = self._toRGBA(self._background_color)
+                glColor4f(*bcolor)
+                glRectf(0, 0, size[0], -size[1])
+            if self._border_color:
+                glLineWidth(border_thickness)
+                bcolor = self._toRGBA(self._border_color)
+                glColor4f(*bcolor)
+                glBegin(GL_LINES)
+                x1 = 0
+                y1 = 0
+                x2, y2 = size
+                x2, y2 = x2, y2
+                hbthick = border_thickness // 2
+                if hbthick < 1:
+                    hbthick = 1
+                glVertex2d(x1 - border_thickness, y1 + hbthick)
+                glVertex2d(x2 + border_thickness, y1 + hbthick)
+                glVertex2d(x2 + hbthick, y1)
+                glVertex2d(x2 + hbthick, -y2)
+                glVertex2d(x2 + border_thickness, -y2 - hbthick)
+                glVertex2d(x1 - border_thickness, -y2 - hbthick)
+                glVertex2d(x1 - hbthick, -y2)
+                glVertex2d(x1 - hbthick, y1)
+                glEnd()
+            glColor4f(0.0, 0.0, 0.0, 1.0)
+            glEndList()
+            self._draw_te_background_dlist = dl_index
+        if (self._background_color or self._border_color):
+            glCallList(self._draw_te_background_dlist)
+
+    def _deleteBackgroundDL(self):
+        if self._draw_te_background_dlist:
+            glDeleteLists(self._draw_te_background_dlist, 1)
+            self._draw_te_background_dlist = None
+
+    def _te_end_gl(self):
+        if not self._draw_end_dlist:
+            dl_index = glGenLists(1)
+            glNewList(dl_index, GL_COMPILE)
+
+            rgb = self._window.rgb
+            rgb = TextBox._toRGBA2(
+                rgb, 1, self._window.colorSpace, self._window)
+            glClearColor(rgb[0], rgb[1], rgb[2], 1.0)
+            glViewport(0, 0, int(self._window.size[0]), int(
+                self._window.size[1]))
+            glMatrixMode(GL_PROJECTION)  # Reset The Projection Matrix
+            glLoadIdentity()
+            gluOrtho2D(-1, 1, -1, 1)
+            glMatrixMode(GL_MODELVIEW)  # Reset The Projection Matrix
+            glLoadIdentity()
+
+            glEndList()
+            self._draw_end_dlist = dl_index
+        glCallList(self._draw_end_dlist)
+
+    def _deleteEndDL(self):
+        if self._draw_end_dlist:
+            glDeleteLists(self._draw_end_dlist, 1)
+            self._draw_end_dlist = None
+
+    @staticmethod
+    def _toPix(xy, units, window):
+        if isinstance(xy, numbers.Number):
+            xy = xy, xy
+        elif is_sequence(xy):
+            if len(xy) == 1:
+                xy = xy[0], xy[0]
+            else:
+                xy = xy[:2]
+        else:
+            return ValueError("TextBox: coord variables must be array-like or a single number. Invalid: %s" % (str(xy)))
+
+        if not isinstance(xy[0], numbers.Number) or not isinstance(xy[1], numbers.Number):
+            return ValueError("TextBox: coord variables must only contain numbers. Invalid: %s" % (str(xy)))
+
+        if units in ('pix', 'pixs'):
+            return xy
+        if units in ['deg', 'degs']:
+            return misc.deg2pix(xy[0], window.monitor), misc.deg2pix(xy[1], window.monitor)
+        if units in ['cm']:
+            return misc.cm2pix(xy[0], window.monitor), misc.cm2pix(xy[1], window.monitor)
+        if units in ['norm']:
+            # -1.0 to 1.0
+            if xy[0] <= 1.0 and xy[0] >= -1.0 and xy[1] <= 1.0 and xy[1] >= -1.0:
+                return xy[0] * window.size[0] / 2.0, xy[1] * window.size[1] / 2.0
+
+        return ValueError("TextBox: %s, %s could not be converted to pix units" % (str(xy), str(units)))
+
+    def _pix2units(self, xy, is_position=True):
+        units = self._units
+        window = self._window
+        ww, wh = float(window.size[0]), float(window.size[1])
+
+        if isinstance(xy, numbers.Number):
+            xy = xy, xy
+        elif is_sequence(xy):
+            if len(xy) == 1:
+                xy = xy[0], xy[0]
+            else:
+                xy = xy[:2]
+        else:
+            raise ValueError(
+                "TextBox: coord variables must be array-like or a single number. Invalid: %s" % (str(xy)))
+
+        if not isinstance(xy[0], numbers.Number) or not isinstance(xy[1], numbers.Number):
+            raise ValueError("TextBox: coord variables must only contain numbers. Invalid: %s, %s, %s" % (
+                str(xy), str(type(xy[0])), str(type(xy[1]))))
+
+        x, y = xy
+        if is_position:
+            # convert to psychopy pix, origin is center of monitor.
+            x, y = int(x - ww / 2), int(y - wh / 2)
+        if units in ('pix', 'pixs'):
+            return x, y
+        if units in ['deg', 'degs']:
+            return misc.pix2deg(x, window.monitor), misc.deg2pix(y, window.monitor)
+        if units in ['cm']:
+            return misc.pix2cm(x, window.monitor), misc.cm2pix(y, window.monitor)
+        if units in ['norm']:
+            return x / ww * 2.0, y / wh * 2.0
+
+        raise ValueError(
+            "TextBox: %s, %s could not be converted to pix units" % (str(xy), str(units)))
+
+    def _toRGBA(self, color):
+        return self.__class__._toRGBA2(color, self._opacity, self._color_space, self._window)
+
+    @classmethod
+    def _toRGBA2(cls, color, opacity=None, color_space=None, window=None):
+
+        if color is None:
+            raise ValueError("TextBox: None is not a valid color input")
+        #if not colors.isValidColor(color):
+        #    raise ValueError(
+        #        "TextBox: %s is not a valid color." % (str(color)))
+
+        valid_opacity = opacity >= 0.0 and opacity <= 1.0
+        if isinstance(color, str):
+            if color[0] == '#' or color[0:2].lower() == '0x':
+                rgb255color = colors.hex2rgb255(color)
+                if rgb255color and valid_opacity:
+                    return rgb255color[0] / 255.0, rgb255color[1] / 255.0, rgb255color[2] / 255.0, opacity
+                else:
+                    raise ValueError(
+                        "TextBox: %s is not a valid hex color." % (str(color)))
+
+            named_color = colors.colors.get(color.lower())
+            if named_color and valid_opacity:
+                return (named_color[0] + 1.0) / 2.0, (named_color[1] + 1.0) / 2.0, (named_color[2] + 1.0) / 2.0, opacity
+            raise ValueError(
+                "TextBox: String color value could not be translated: %s" % (str(color)))
+
+        if isinstance(color, (float, int, int)) or (is_sequence(color) and len(color) == 3):
+            color = arraytools.val2array(color, length=3)
+            if color_space == 'dkl' and valid_opacity:
+                dkl_rgb = None
+                if window:
+                    dkl_rgb = window.dkl_rgb
+                rgb = colortools.dkl2rgb(color, dkl_rgb)
+                return (rgb[0] + 1.0) / 2.0, (rgb[1] + 1.0) / 2.0, (rgb[2] + 1.0) / 2.0, opacity
+            if color_space == 'lms' and valid_opacity:
+                lms_rgb = None
+                if window:
+                    lms_rgb = window.lms_rgb
+                rgb = colortools.lms2rgb(color, lms_rgb)
+                return (rgb[0] + 1.0) / 2.0, (rgb[1] + 1.0) / 2.0, (rgb[2] + 1.0) / 2.0, opacity
+            if color_space == 'hsv' and valid_opacity:
+                rgb = colortools.hsv2rgb(color)
+                return (rgb[0] + 1.0) / 2.0, (rgb[1] + 1.0) / 2.0, (rgb[2] + 1.0) / 2.0, opacity
+            if color_space == 'rgb255' and valid_opacity:
+                rgb = color
+                if [cc for cc in color if cc < 0 or cc > 255]:
+                    raise ValueError(
+                        'TextBox: rgb255 colors must contain elements between 0 and 255. Value: ' + str(rgb))
+                return rgb[0] / 255.0, rgb[1] / 255.0, rgb[2] / 255.0, opacity
+            if color_space == 'rgb' and valid_opacity:
+                rgb = color
+                if [cc for cc in color if cc < -1.0 or cc > 1.0]:
+                    raise ValueError(
+                        'TextBox: rgb colors must contain elements between -1.0 and 1.0. Value: ' + str(rgb))
+                return (rgb[0] + 1.0) / 2.0, (rgb[1] + 1.0) / 2.0, (rgb[2] + 1.0) / 2.0, opacity
+
+        if is_sequence(color) and len(color) == 4:
+            if color_space == 'rgb255':
+                if [cc for cc in color if cc < 0 or cc > 255]:
+                    raise ValueError(
+                        'TextBox: rgb255 colors must contain elements between 0 and 255. Value: ' + str(color))
+                return color[0] / 255.0, color[1] / 255.0, color[2] / 255.0, color[3] / 255.0
+            if color_space == 'rgb':
+                if [cc for cc in color if cc < -1.0 or cc > 1.0]:
+                    raise ValueError(
+                        'TextBox: rgb colors must contain elements between -1.0 and 1.0. Value: ' + str(color))
+                return (color[0] + 1.0) / 2.0, (color[1] + 1.0) / 2.0, (color[2] + 1.0) / 2.0, (color[3] + 1.0) / 2.0
+
+        raise ValueError("TextBox: color: %s, opacity: %s, is not a valid color for color space %s." % (
+            str(color), str(opacity), color_space))
+
+    def _reset(self):
+        self._text_grid.reset()
+
+    def _getPixelSize(self):
+        if self._units == 'norm':
+            r = self._toPix(
+                (self._size[0] - 1.0, self._size[1] - 1.0), self._units, self._window)
+            return int(r[0] + self._window.size[0] / 2), int(r[1] + self._window.size[1] / 2)
+        return [int(x) for x in self._toPix(self._size, self._units, self._window)]
+
+    def _setSize(self, pix_sz):
+        units = self._units
+        if units in ('pix', 'pixs'):
+            self._size = list(pix_sz)
+        if units in ['deg', 'degs']:
+            self._size = misc.pix2deg(pix_sz[0], self._window.monitor), misc.pix2deg(
+                pix_sz[1], self._window.monitor)
+        if units in ['cm']:
+            self._size = misc.pix2cm(pix_sz[0], self._window.monitor), misc.pix2cm(
+                pix_sz[1], self._window.monitor)
+        if units in ['norm']:
+            pw, ph = pix_sz
+            dw, dh = self._window.size
+            nw = (pw / float(dw)) * 2.0
+            nh = (ph / float(dh)) * 2.0
+            self._size = nw, nh
+
+    def _getPixelPosition(self):
+        ppos = self._toPix(self._position, self._units, self._window)
+        return int(ppos[0]), int(ppos[1])
+
+    def _getPixelTextLineSpacing(self):
+        if self._line_spacing:
+            max_size = self._current_glfont.max_tile_width, self._current_glfont.max_tile_height
+            line_spacing_units = self._line_spacing_units
+            line_spacing_height = self._line_spacing
+
+            if line_spacing_units == 'ratio':
+                # run though _toPix to validate line_spacing value type only
+                r = self._toPix(line_spacing_height, 'pix', self._window)[0]
+                return int(max_size[1] * r)
+
+            return self._toPix(line_spacing_height, line_spacing_units, self._window)
+        return 0
+
+    def _getTopLeftPixPos(self):
+        # Create a window position based on the window size, alignment types,
+        #   TextBox size, etc...
+        win_w, win_h = self._window.size
+        te_w, te_h = self._getPixelSize()
+        te_x, te_y = self._getPixelPosition()
+        # convert te_x,te_y from psychopy pix coord to gl pix coord
+        te_x, te_y = te_x + win_w // 2, te_y + win_h // 2
+        # convert from alignment to top left
+        horz_align, vert_align = self._align_horz, self._align_vert
+        if horz_align.lower() == u'center':
+            te_x = te_x - te_w // 2
+        elif horz_align.lower() == u'right':
+            te_x = te_x - te_w
+        if vert_align.lower() == u'center':
+            te_y = te_y + te_h // 2
+        if vert_align.lower() == u'bottom':
+            te_y = te_y + te_h
+        return te_x, te_y
+
+    def __del__(self):
+        if hasattr(self, '_textbox_instance') and self.getName() in self._textbox_instance:
+            del self._textbox_instances[self.getName()]
+        del self._current_glfont
+        del self._text_grid