ccxt-ir 4.3.46.0.1__py2.py3-none-any.whl

ccxt/async_support/btcalpha.py

@@ -0,0 +1,891 @@
+# -*- coding: utf-8 -*-
+
+# PLEASE DO NOT EDIT THIS FILE, IT IS GENERATED AND WILL BE OVERWRITTEN:
+# https://github.com/ccxt/ccxt/blob/master/CONTRIBUTING.md#how-to-contribute-code
+
+from ccxt.async_support.base.exchange import Exchange
+from ccxt.abstract.btcalpha import ImplicitAPI
+import hashlib
+from ccxt.base.types import Balances, Currency, IndexType, Int, Market, Num, Order, OrderBook, OrderSide, OrderType, Str, Strings, Ticker, Tickers, Trade, Transaction
+from typing import List
+from ccxt.base.errors import ExchangeError
+from ccxt.base.errors import AuthenticationError
+from ccxt.base.errors import InsufficientFunds
+from ccxt.base.errors import InvalidOrder
+from ccxt.base.errors import DDoSProtection
+from ccxt.base.decimal_to_precision import TICK_SIZE
+from ccxt.base.precise import Precise
+
+
+class btcalpha(Exchange, ImplicitAPI):
+
+    def describe(self):
+        return self.deep_extend(super(btcalpha, self).describe(), {
+            'id': 'btcalpha',
+            'name': 'BTC-Alpha',
+            'countries': ['US'],
+            'version': 'v1',
+            'has': {
+                'CORS': None,
+                'spot': True,
+                'margin': False,
+                'swap': False,
+                'future': False,
+                'option': False,
+                'addMargin': False,
+                'cancelOrder': True,
+                'closeAllPositions': False,
+                'closePosition': False,
+                'createDepositAddress': False,
+                'createOrder': True,
+                'createReduceOnlyOrder': False,
+                'createStopLimitOrder': False,
+                'createStopMarketOrder': False,
+                'createStopOrder': False,
+                'fetchBalance': True,
+                'fetchBorrowRateHistories': False,
+                'fetchBorrowRateHistory': False,
+                'fetchClosedOrders': True,
+                'fetchCrossBorrowRate': False,
+                'fetchCrossBorrowRates': False,
+                'fetchDeposit': False,
+                'fetchDepositAddress': False,
+                'fetchDepositAddresses': False,
+                'fetchDepositAddressesByNetwork': False,
+                'fetchDeposits': True,
+                'fetchFundingHistory': False,
+                'fetchFundingRate': False,
+                'fetchFundingRateHistory': False,
+                'fetchFundingRates': False,
+                'fetchIndexOHLCV': False,
+                'fetchIsolatedBorrowRate': False,
+                'fetchIsolatedBorrowRates': False,
+                'fetchL2OrderBook': True,
+                'fetchLeverage': False,
+                'fetchMarginMode': False,
+                'fetchMarkets': True,
+                'fetchMarkOHLCV': False,
+                'fetchMyTrades': True,
+                'fetchOHLCV': True,
+                'fetchOpenInterestHistory': False,
+                'fetchOpenOrders': True,
+                'fetchOrder': True,
+                'fetchOrderBook': True,
+                'fetchOrders': True,
+                'fetchPosition': False,
+                'fetchPositionHistory': False,
+                'fetchPositionMode': False,
+                'fetchPositions': False,
+                'fetchPositionsForSymbol': False,
+                'fetchPositionsHistory': False,
+                'fetchPositionsRisk': False,
+                'fetchPremiumIndexOHLCV': False,
+                'fetchTicker': True,
+                'fetchTickers': True,
+                'fetchTrades': True,
+                'fetchTradingFee': False,
+                'fetchTradingFees': False,
+                'fetchTransfer': False,
+                'fetchTransfers': False,
+                'fetchWithdrawal': False,
+                'fetchWithdrawals': True,
+                'reduceMargin': False,
+                'setLeverage': False,
+                'setMarginMode': False,
+                'setPositionMode': False,
+                'transfer': False,
+                'withdraw': False,
+            },
+            'timeframes': {
+                '5m': '5',
+                '15m': '15',
+                '30m': '30',
+                '1h': '60',
+                '4h': '240',
+                '1d': 'D',
+            },
+            'urls': {
+                'logo': 'https://user-images.githubusercontent.com/1294454/42625213-dabaa5da-85cf-11e8-8f99-aa8f8f7699f0.jpg',
+                'api': {
+                    'rest': 'https://btc-alpha.com/api',
+                },
+                'www': 'https://btc-alpha.com',
+                'doc': 'https://btc-alpha.github.io/api-docs',
+                'fees': 'https://btc-alpha.com/fees/',
+                'referral': 'https://btc-alpha.com/?r=123788',
+            },
+            'api': {
+                'public': {
+                    'get': [
+                        'currencies/',
+                        'pairs/',
+                        'orderbook/{pair_name}',
+                        'exchanges/',
+                        'charts/{pair}/{type}/chart/',
+                        'ticker/',
+                    ],
+                },
+                'private': {
+                    'get': [
+                        'wallets/',
+                        'orders/own/',
+                        'order/{id}/',
+                        'exchanges/own/',
+                        'deposits/',
+                        'withdraws/',
+                    ],
+                    'post': [
+                        'order/',
+                        'order-cancel/',
+                    ],
+                },
+            },
+            'fees': {
+                'trading': {
+                    'maker': self.parse_number('0.002'),
+                    'taker': self.parse_number('0.002'),
+                },
+                'funding': {
+                    'withdraw': {},
+                },
+            },
+            'commonCurrencies': {
+                'CBC': 'Cashbery',
+            },
+            'precisionMode': TICK_SIZE,
+            'exceptions': {
+                'exact': {},
+                'broad': {
+                    'Out of balance': InsufficientFunds,  # {"date":1570599531.4814300537,"error":"Out of balance -9.99243661 BTC"}
+                },
+            },
+        })
+
+    async def fetch_markets(self, params={}) -> List[Market]:
+        """
+        retrieves data on all markets for btcalpha
+        :see: https://btc-alpha.github.io/api-docs/#list-all-currencies
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns dict[]: an array of objects representing market data
+        """
+        response = await self.publicGetPairs(params)
+        #
+        #    [
+        #        {
+        #            "name": "1INCH_USDT",
+        #            "currency1": "1INCH",
+        #            "currency2": "USDT",
+        #            "price_precision": 4,
+        #            "amount_precision": 2,
+        #            "minimum_order_size": "0.01000000",
+        #            "maximum_order_size": "900000.00000000",
+        #            "minimum_order_value": "10.00000000",
+        #            "liquidity_type": 10
+        #        },
+        #    ]
+        #
+        return self.parse_markets(response)
+
+    def parse_market(self, market: dict) -> Market:
+        id = self.safe_string(market, 'name')
+        baseId = self.safe_string(market, 'currency1')
+        quoteId = self.safe_string(market, 'currency2')
+        base = self.safe_currency_code(baseId)
+        quote = self.safe_currency_code(quoteId)
+        pricePrecision = self.safe_string(market, 'price_precision')
+        priceLimit = self.parse_precision(pricePrecision)
+        amountLimit = self.safe_string(market, 'minimum_order_size')
+        return {
+            'id': id,
+            'symbol': base + '/' + quote,
+            'base': base,
+            'quote': quote,
+            'settle': None,
+            'baseId': baseId,
+            'quoteId': quoteId,
+            'settleId': None,
+            'type': 'spot',
+            'spot': True,
+            'margin': False,
+            'swap': False,
+            'future': False,
+            'option': False,
+            'active': True,
+            'contract': False,
+            'linear': None,
+            'inverse': None,
+            'contractSize': None,
+            'expiry': None,
+            'expiryDatetime': None,
+            'strike': None,
+            'optionType': None,
+            'precision': {
+                'amount': self.parse_number(self.parse_precision(self.safe_string(market, 'amount_precision'))),
+                'price': self.parse_number(self.parse_precision((pricePrecision))),
+            },
+            'limits': {
+                'leverage': {
+                    'min': None,
+                    'max': None,
+                },
+                'amount': {
+                    'min': self.parse_number(amountLimit),
+                    'max': self.safe_number(market, 'maximum_order_size'),
+                },
+                'price': {
+                    'min': self.parse_number(priceLimit),
+                    'max': None,
+                },
+                'cost': {
+                    'min': self.parse_number(Precise.string_mul(priceLimit, amountLimit)),
+                    'max': None,
+                },
+            },
+            'created': None,
+            'info': market,
+        }
+
+    async def fetch_tickers(self, symbols: Strings = None, params={}) -> Tickers:
+        """
+        :see: https://btc-alpha.github.io/api-docs/#tickers
+        fetches price tickers for multiple markets, statistical information calculated over the past 24 hours for each market
+        :param str[]|None symbols: unified symbols of the markets to fetch the ticker for, all market tickers are returned if not assigned
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns dict: a dictionary of `ticker structures <https://docs.ccxt.com/#/?id=ticker-structure>`
+        """
+        await self.load_markets()
+        response = await self.publicGetTicker(params)
+        #
+        #    [
+        #        {
+        #            "timestamp": "1674658.445272",
+        #            "pair": "BTC_USDT",
+        #            "last": "22476.85",
+        #            "diff": "458.96",
+        #            "vol": "6660.847784",
+        #            "high": "23106.08",
+        #            "low": "22348.29",
+        #            "buy": "22508.46",
+        #            "sell": "22521.11"
+        #        },
+        #        ...
+        #    ]
+        #
+        return self.parse_tickers(response, symbols)
+
+    async def fetch_ticker(self, symbol: str, params={}) -> Ticker:
+        """
+        :see: https://btc-alpha.github.io/api-docs/#tickers
+        fetches a price ticker, a statistical calculation with the information calculated over the past 24 hours for a specific market
+        :param str symbol: unified symbol of the market to fetch the ticker for
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns dict: a `ticker structure <https://docs.ccxt.com/#/?id=ticker-structure>`
+        """
+        await self.load_markets()
+        market = self.market(symbol)
+        request: dict = {
+            'pair': market['id'],
+        }
+        response = await self.publicGetTicker(self.extend(request, params))
+        #
+        #    {
+        #        "timestamp": "1674658.445272",
+        #        "pair": "BTC_USDT",
+        #        "last": "22476.85",
+        #        "diff": "458.96",
+        #        "vol": "6660.847784",
+        #        "high": "23106.08",
+        #        "low": "22348.29",
+        #        "buy": "22508.46",
+        #        "sell": "22521.11"
+        #    }
+        #
+        return self.parse_ticker(response, market)
+
+    def parse_ticker(self, ticker: dict, market: Market = None) -> Ticker:
+        #
+        #    {
+        #        "timestamp": "1674658.445272",
+        #        "pair": "BTC_USDT",
+        #        "last": "22476.85",
+        #        "diff": "458.96",
+        #        "vol": "6660.847784",
+        #        "high": "23106.08",
+        #        "low": "22348.29",
+        #        "buy": "22508.46",
+        #        "sell": "22521.11"
+        #    }
+        #
+        timestampStr = self.safe_string(ticker, 'timestamp')
+        timestamp = int(Precise.string_mul(timestampStr, '1000000'))
+        marketId = self.safe_string(ticker, 'pair')
+        market = self.safe_market(marketId, market, '_')
+        last = self.safe_string(ticker, 'last')
+        return self.safe_ticker({
+            'info': ticker,
+            'symbol': market['symbol'],
+            'timestamp': timestamp,
+            'datetime': self.iso8601(timestamp),
+            'high': self.safe_string(ticker, 'high'),
+            'low': self.safe_string(ticker, 'low'),
+            'bid': self.safe_string(ticker, 'buy'),
+            'bidVolume': None,
+            'ask': self.safe_string(ticker, 'sell'),
+            'askVolume': None,
+            'vwap': None,
+            'open': None,
+            'close': last,
+            'last': last,
+            'previousClose': None,
+            'change': self.safe_string(ticker, 'diff'),
+            'percentage': None,
+            'average': None,
+            'baseVolume': None,
+            'quoteVolume': self.safe_string(ticker, 'vol'),
+        }, market)
+
+    async def fetch_order_book(self, symbol: str, limit: Int = None, params={}) -> OrderBook:
+        """
+        :see: https://btc-alpha.github.io/api-docs/#get-orderbook
+        fetches information on open orders with bid(buy) and ask(sell) prices, volumes and other data
+        :param str symbol: unified symbol of the market to fetch the order book for
+        :param int [limit]: the maximum amount of order book entries to return
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns dict: A dictionary of `order book structures <https://docs.ccxt.com/#/?id=order-book-structure>` indexed by market symbols
+        """
+        await self.load_markets()
+        market = self.market(symbol)
+        request: dict = {
+            'pair_name': market['id'],
+        }
+        if limit:
+            request['limit_sell'] = limit
+            request['limit_buy'] = limit
+        response = await self.publicGetOrderbookPairName(self.extend(request, params))
+        return self.parse_order_book(response, market['symbol'], None, 'buy', 'sell', 'price', 'amount')
+
+    def parse_bids_asks(self, bidasks, priceKey: IndexType = 0, amountKey: IndexType = 1, countOrIdKey: IndexType = 2):
+        result = []
+        for i in range(0, len(bidasks)):
+            bidask = bidasks[i]
+            if bidask:
+                result.append(self.parse_bid_ask(bidask, priceKey, amountKey))
+        return result
+
+    def parse_trade(self, trade: dict, market: Market = None) -> Trade:
+        #
+        # fetchTrades(public)
+        #
+        #      {
+        #          "id": "202203440",
+        #          "timestamp": "1637856276.264215",
+        #          "pair": "AAVE_USDT",
+        #          "price": "320.79900000",
+        #          "amount": "0.05000000",
+        #          "type": "buy"
+        #      }
+        #
+        # fetchMyTrades(private)
+        #
+        #      {
+        #          "id": "202203440",
+        #          "timestamp": "1637856276.264215",
+        #          "pair": "AAVE_USDT",
+        #          "price": "320.79900000",
+        #          "amount": "0.05000000",
+        #          "type": "buy",
+        #          "my_side": "buy"
+        #      }
+        #
+        marketId = self.safe_string(trade, 'pair')
+        market = self.safe_market(marketId, market, '_')
+        timestampRaw = self.safe_string(trade, 'timestamp')
+        timestamp = self.parse_to_int(Precise.string_mul(timestampRaw, '1000000'))
+        priceString = self.safe_string(trade, 'price')
+        amountString = self.safe_string(trade, 'amount')
+        id = self.safe_string(trade, 'id')
+        side = self.safe_string_2(trade, 'my_side', 'type')
+        return self.safe_trade({
+            'id': id,
+            'info': trade,
+            'timestamp': timestamp,
+            'datetime': self.iso8601(timestamp),
+            'symbol': market['symbol'],
+            'order': id,
+            'type': 'limit',
+            'side': side,
+            'takerOrMaker': None,
+            'price': priceString,
+            'amount': amountString,
+            'cost': None,
+            'fee': None,
+        }, market)
+
+    async def fetch_trades(self, symbol: str, since: Int = None, limit: Int = None, params={}) -> List[Trade]:
+        """
+        get the list of most recent trades for a particular symbol
+        :see: https://btc-alpha.github.io/api-docs/#list-all-exchanges
+        :param str symbol: unified symbol of the market to fetch trades for
+        :param int [since]: timestamp in ms of the earliest trade to fetch
+        :param int [limit]: the maximum amount of trades to fetch
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns Trade[]: a list of `trade structures <https://docs.ccxt.com/#/?id=public-trades>`
+        """
+        await self.load_markets()
+        market = None
+        request: dict = {}
+        if symbol is not None:
+            market = self.market(symbol)
+            request['pair'] = market['id']
+        if limit is not None:
+            request['limit'] = limit
+        trades = await self.publicGetExchanges(self.extend(request, params))
+        return self.parse_trades(trades, market, since, limit)
+
+    async def fetch_deposits(self, code: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Transaction]:
+        """
+        fetch all deposits made to an account
+        :see: https://btc-alpha.github.io/api-docs/#list-own-deposits
+        :param str code: unified currency code
+        :param int [since]: the earliest time in ms to fetch deposits for
+        :param int [limit]: the maximum number of deposits structures to retrieve
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns dict[]: a list of `transaction structures <https://docs.ccxt.com/#/?id=transaction-structure>`
+        """
+        await self.load_markets()
+        currency = None
+        if code is not None:
+            currency = self.currency(code)
+        response = await self.privateGetDeposits(params)
+        #
+        #     [
+        #         {
+        #             "timestamp": 1485363039.18359,
+        #             "id": 317,
+        #             "currency": "BTC",
+        #             "amount": 530.00000000
+        #         }
+        #     ]
+        #
+        return self.parse_transactions(response, currency, since, limit, {'type': 'deposit'})
+
+    async def fetch_withdrawals(self, code: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Transaction]:
+        """
+        fetch all withdrawals made from an account
+        :see: https://btc-alpha.github.io/api-docs/#list-own-made-withdraws
+        :param str code: unified currency code
+        :param int [since]: the earliest time in ms to fetch withdrawals for
+        :param int [limit]: the maximum number of withdrawals structures to retrieve
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns dict[]: a list of `transaction structures <https://docs.ccxt.com/#/?id=transaction-structure>`
+        """
+        await self.load_markets()
+        currency = None
+        request: dict = {}
+        if code is not None:
+            currency = self.currency(code)
+            request['currency_id'] = currency['id']
+        response = await self.privateGetWithdraws(self.extend(request, params))
+        #
+        #     [
+        #         {
+        #             "id": 403,
+        #             "timestamp": 1485363466.868539,
+        #             "currency": "BTC",
+        #             "amount": 0.53000000,
+        #             "status": 20
+        #         }
+        #     ]
+        #
+        return self.parse_transactions(response, currency, since, limit, {'type': 'withdrawal'})
+
+    def parse_transaction(self, transaction: dict, currency: Currency = None) -> Transaction:
+        #
+        #  deposit
+        #      {
+        #          "timestamp": 1485363039.18359,
+        #          "id": 317,
+        #          "currency": "BTC",
+        #          "amount": 530.00000000
+        #      }
+        #
+        #  withdrawal
+        #      {
+        #          "id": 403,
+        #          "timestamp": 1485363466.868539,
+        #          "currency": "BTC",
+        #          "amount": 0.53000000,
+        #          "status": 20
+        #      }
+        #
+        timestamp = self.safe_timestamp(transaction, 'timestamp')
+        currencyId = self.safe_string(transaction, 'currency')
+        statusId = self.safe_string(transaction, 'status')
+        return {
+            'id': self.safe_string(transaction, 'id'),
+            'info': transaction,
+            'timestamp': timestamp,
+            'datetime': self.iso8601(timestamp),
+            'network': None,
+            'address': None,
+            'addressTo': None,
+            'addressFrom': None,
+            'tag': None,
+            'tagTo': None,
+            'tagFrom': None,
+            'currency': self.safe_currency_code(currencyId, currency),
+            'amount': self.safe_number(transaction, 'amount'),
+            'txid': None,
+            'type': None,
+            'status': self.parse_transaction_status(statusId),
+            'comment': None,
+            'internal': None,
+            'fee': None,
+            'updated': None,
+        }
+
+    def parse_transaction_status(self, status: Str):
+        statuses: dict = {
+            '10': 'pending',  # New
+            '20': 'pending',  # Verified, waiting for approving
+            '30': 'ok',       # Approved by moderator
+            '40': 'failed',   # Refused by moderator. See your email for more details
+            '50': 'canceled',  # Cancelled by user
+        }
+        return self.safe_string(statuses, status, status)
+
+    def parse_ohlcv(self, ohlcv, market: Market = None) -> list:
+        #
+        #     {
+        #         "time":1591296000,
+        #         "open":0.024746,
+        #         "close":0.024728,
+        #         "low":0.024728,
+        #         "high":0.024753,
+        #         "volume":16.624
+        #     }
+        #
+        return [
+            self.safe_timestamp(ohlcv, 'time'),
+            self.safe_number(ohlcv, 'open'),
+            self.safe_number(ohlcv, 'high'),
+            self.safe_number(ohlcv, 'low'),
+            self.safe_number(ohlcv, 'close'),
+            self.safe_number(ohlcv, 'volume'),
+        ]
+
+    async def fetch_ohlcv(self, symbol: str, timeframe='5m', since: Int = None, limit: Int = None, params={}) -> List[list]:
+        """
+        fetches historical candlestick data containing the open, high, low, and close price, and the volume of a market
+        :see: https://btc-alpha.github.io/api-docs/#charts
+        :param str symbol: unified symbol of the market to fetch OHLCV data for
+        :param str timeframe: the length of time each candle represents
+        :param int [since]: timestamp in ms of the earliest candle to fetch
+        :param int [limit]: the maximum amount of candles to fetch
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns int[][]: A list of candles ordered, open, high, low, close, volume
+        """
+        await self.load_markets()
+        market = self.market(symbol)
+        request: dict = {
+            'pair': market['id'],
+            'type': self.safe_string(self.timeframes, timeframe, timeframe),
+        }
+        if limit is not None:
+            request['limit'] = limit
+        if since is not None:
+            request['since'] = self.parse_to_int(since / 1000)
+        response = await self.publicGetChartsPairTypeChart(self.extend(request, params))
+        #
+        #     [
+        #         {"time":1591296000,"open":0.024746,"close":0.024728,"low":0.024728,"high":0.024753,"volume":16.624},
+        #         {"time":1591295700,"open":0.024718,"close":0.02475,"low":0.024711,"high":0.02475,"volume":31.645},
+        #         {"time":1591295400,"open":0.024721,"close":0.024717,"low":0.024711,"high":0.02473,"volume":65.071}
+        #     ]
+        #
+        return self.parse_ohlcvs(response, market, timeframe, since, limit)
+
+    def parse_balance(self, response) -> Balances:
+        result: dict = {'info': response}
+        for i in range(0, len(response)):
+            balance = response[i]
+            currencyId = self.safe_string(balance, 'currency')
+            code = self.safe_currency_code(currencyId)
+            account = self.account()
+            account['used'] = self.safe_string(balance, 'reserve')
+            account['total'] = self.safe_string(balance, 'balance')
+            result[code] = account
+        return self.safe_balance(result)
+
+    async def fetch_balance(self, params={}) -> Balances:
+        """
+        query for balance and get the amount of funds available for trading or funds locked in orders
+        :see: https://btc-alpha.github.io/api-docs/#list-own-wallets
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns dict: a `balance structure <https://docs.ccxt.com/#/?id=balance-structure>`
+        """
+        await self.load_markets()
+        response = await self.privateGetWallets(params)
+        return self.parse_balance(response)
+
+    def parse_order_status(self, status: Str):
+        statuses: dict = {
+            '1': 'open',
+            '2': 'canceled',
+            '3': 'closed',
+        }
+        return self.safe_string(statuses, status, status)
+
+    def parse_order(self, order: dict, market: Market = None) -> Order:
+        #
+        # fetchClosedOrders / fetchOrder
+        #     {
+        #       "id": "923763073",
+        #       "date": "1635451090368",
+        #       "type": "sell",
+        #       "pair": "XRP_USDT",
+        #       "price": "1.00000000",
+        #       "amount": "0.00000000",
+        #       "status": "3",
+        #       "amount_filled": "10.00000000",
+        #       "amount_original": "10.0"
+        #       "trades": [],
+        #     }
+        #
+        # createOrder
+        #     {
+        #       "success": True,
+        #       "date": "1635451754.497541",
+        #       "type": "sell",
+        #       "oid": "923776755",
+        #       "price": "1.0",
+        #       "amount": "10.0",
+        #       "amount_filled": "0.0",
+        #       "amount_original": "10.0",
+        #       "trades": []
+        #     }
+        #
+        marketId = self.safe_string(order, 'pair')
+        market = self.safe_market(marketId, market, '_')
+        symbol = market['symbol']
+        success = self.safe_bool(order, 'success', False)
+        timestamp = None
+        if success:
+            timestamp = self.safe_timestamp(order, 'date')
+        else:
+            timestamp = self.safe_integer(order, 'date')
+        price = self.safe_string(order, 'price')
+        remaining = self.safe_string(order, 'amount')
+        filled = self.safe_string(order, 'amount_filled')
+        amount = self.safe_string(order, 'amount_original')
+        status = self.parse_order_status(self.safe_string(order, 'status'))
+        id = self.safe_string_n(order, ['oid', 'id', 'order'])
+        trades = self.safe_value(order, 'trades')
+        side = self.safe_string_2(order, 'my_side', 'type')
+        return self.safe_order({
+            'id': id,
+            'clientOrderId': None,
+            'datetime': self.iso8601(timestamp),
+            'timestamp': timestamp,
+            'status': status,
+            'symbol': symbol,
+            'type': 'limit',
+            'timeInForce': None,
+            'postOnly': None,
+            'side': side,
+            'price': price,
+            'stopPrice': None,
+            'triggerPrice': None,
+            'cost': None,
+            'amount': amount,
+            'filled': filled,
+            'remaining': remaining,
+            'trades': trades,
+            'fee': None,
+            'info': order,
+            'lastTradeTimestamp': None,
+            'average': None,
+        }, market)
+
+    async def create_order(self, symbol: str, type: OrderType, side: OrderSide, amount: float, price: Num = None, params={}):
+        """
+        :see: https://btc-alpha.github.io/api-docs/#create-order
+        create a trade order
+        :param str symbol: unified symbol of the market to create an order in
+        :param str type: 'limit'
+        :param str side: 'buy' or 'sell'
+        :param float amount: how much of currency you want to trade in units of base currency
+        :param float [price]: the price at which the order is to be fullfilled, in units of the quote currency, ignored in market orders
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns dict: an `order structure <https://docs.ccxt.com/#/?id=order-structure>`
+        """
+        if type == 'market':
+            raise InvalidOrder(self.id + ' only limits orders are supported')
+        await self.load_markets()
+        market = self.market(symbol)
+        request: dict = {
+            'pair': market['id'],
+            'type': side,
+            'amount': amount,
+            'price': self.price_to_precision(symbol, price),
+        }
+        response = await self.privatePostOrder(self.extend(request, params))
+        if not response['success']:
+            raise InvalidOrder(self.id + ' ' + self.json(response))
+        order = self.parse_order(response, market)
+        orderAmount = str(order['amount'])
+        amount = order['amount'] if Precise.string_gt(orderAmount, '0') else amount
+        order['amount'] = self.parse_number(amount)
+        return order
+
+    async def cancel_order(self, id: str, symbol: Str = None, params={}):
+        """
+        :see: https://btc-alpha.github.io/api-docs/#cancel-order
+        cancels an open order
+        :param str id: order id
+        :param str symbol: unified symbol of the market the order was made in
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns dict: An `order structure <https://docs.ccxt.com/#/?id=order-structure>`
+        """
+        request: dict = {
+            'order': id,
+        }
+        response = await self.privatePostOrderCancel(self.extend(request, params))
+        #
+        #    {
+        #        "order": 63568
+        #    }
+        #
+        return self.parse_order(response)
+
+    async def fetch_order(self, id: str, symbol: Str = None, params={}):
+        """
+        :see: https://btc-alpha.github.io/api-docs/#retrieve-single-order
+        fetches information on an order made by the user
+        :param str symbol: not used by btcalpha fetchOrder
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns dict: An `order structure <https://docs.ccxt.com/#/?id=order-structure>`
+        """
+        await self.load_markets()
+        request: dict = {
+            'id': id,
+        }
+        order = await self.privateGetOrderId(self.extend(request, params))
+        return self.parse_order(order)
+
+    async def fetch_orders(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Order]:
+        """
+        :see: https://btc-alpha.github.io/api-docs/#list-own-orders
+        fetches information on multiple orders made by the user
+        :param str symbol: unified market symbol of the market orders were made in
+        :param int [since]: the earliest time in ms to fetch orders for
+        :param int [limit]: the maximum number of order structures to retrieve
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns Order[]: a list of `order structures <https://docs.ccxt.com/#/?id=order-structure>`
+        """
+        await self.load_markets()
+        request: dict = {}
+        market = None
+        if symbol is not None:
+            market = self.market(symbol)
+            request['pair'] = market['id']
+        if limit is not None:
+            request['limit'] = limit
+        orders = await self.privateGetOrdersOwn(self.extend(request, params))
+        return self.parse_orders(orders, market, since, limit)
+
+    async def fetch_open_orders(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Order]:
+        """
+        fetch all unfilled currently open orders
+        :see: https://btc-alpha.github.io/api-docs/#list-own-orders
+        :param str symbol: unified market symbol
+        :param int [since]: the earliest time in ms to fetch open orders for
+        :param int [limit]: the maximum number of  open orders structures to retrieve
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns Order[]: a list of `order structures <https://docs.ccxt.com/#/?id=order-structure>`
+        """
+        request: dict = {
+            'status': '1',
+        }
+        return await self.fetch_orders(symbol, since, limit, self.extend(request, params))
+
+    async def fetch_closed_orders(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Order]:
+        """
+        fetches information on multiple closed orders made by the user
+        :see: https://btc-alpha.github.io/api-docs/#list-own-orders
+        :param str symbol: unified market symbol of the market orders were made in
+        :param int [since]: the earliest time in ms to fetch orders for
+        :param int [limit]: the maximum number of order structures to retrieve
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns Order[]: a list of `order structures <https://docs.ccxt.com/#/?id=order-structure>`
+        """
+        request: dict = {
+            'status': '3',
+        }
+        return await self.fetch_orders(symbol, since, limit, self.extend(request, params))
+
+    async def fetch_my_trades(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}):
+        """
+        fetch all trades made by the user
+        :see: https://btc-alpha.github.io/api-docs/#list-own-exchanges
+        :param str symbol: unified market symbol
+        :param int [since]: the earliest time in ms to fetch trades for
+        :param int [limit]: the maximum number of trades structures to retrieve
+        :param dict [params]: extra parameters specific to the exchange API endpoint
+        :returns Trade[]: a list of `trade structures <https://docs.ccxt.com/#/?id=trade-structure>`
+        """
+        await self.load_markets()
+        request: dict = {}
+        if symbol is not None:
+            market = self.market(symbol)
+            request['pair'] = market['id']
+        if limit is not None:
+            request['limit'] = limit
+        trades = await self.privateGetExchangesOwn(self.extend(request, params))
+        return self.parse_trades(trades, None, since, limit)
+
+    def nonce(self):
+        return self.milliseconds()
+
+    def sign(self, path, api='public', method='GET', params={}, headers=None, body=None):
+        query = self.urlencode(self.keysort(self.omit(params, self.extract_params(path))))
+        url = self.urls['api']['rest'] + '/'
+        if path != 'charts/{pair}/{type}/chart/':
+            url += 'v1/'
+        url += self.implode_params(path, params)
+        headers = {'Accept': 'application/json'}
+        if api == 'public':
+            if len(query):
+                url += '?' + query
+        else:
+            self.check_required_credentials()
+            payload = self.apiKey
+            if method == 'POST':
+                headers['Content-Type'] = 'application/x-www-form-urlencoded'
+                body = query
+                payload += body
+            elif len(query):
+                url += '?' + query
+            headers['X-KEY'] = self.apiKey
+            headers['X-SIGN'] = self.hmac(self.encode(payload), self.encode(self.secret), hashlib.sha256)
+            headers['X-NONCE'] = str(self.nonce())
+        return {'url': url, 'method': method, 'body': body, 'headers': headers}
+
+    def handle_errors(self, code: int, reason: str, url: str, method: str, headers: dict, body: str, response, requestHeaders, requestBody):
+        if response is None:
+            return None  # fallback to default error handler
+        #
+        #     {"date":1570599531.4814300537,"error":"Out of balance -9.99243661 BTC"}
+        #
+        error = self.safe_string(response, 'error')
+        feedback = self.id + ' ' + body
+        if error is not None:
+            self.throw_exactly_matched_exception(self.exceptions['exact'], error, feedback)
+            self.throw_broadly_matched_exception(self.exceptions['broad'], error, feedback)
+        if code == 401 or code == 403:
+            raise AuthenticationError(feedback)
+        elif code == 429:
+            raise DDoSProtection(feedback)
+        if code < 400:
+            return None
+        raise ExchangeError(feedback)