@warp-ds/elements 2.2.0-next.1 → 2.2.0-next.10

package/dist/index.js.map

@@ -1,7 +1,7 @@
 {
   "version": 3,
-  "sources": ["../node_modules/.pnpm/unraw@3.0.0/node_modules/unraw/dist/errors.js", "../node_modules/.pnpm/unraw@3.0.0/node_modules/unraw/dist/index.js", "../node_modules/.pnpm/moo@0.5.2/node_modules/moo/moo.js", "../node_modules/.pnpm/@messageformat+parser@5.1.1/node_modules/@messageformat/parser/lib/lexer.js", "../node_modules/.pnpm/@messageformat+parser@5.1.1/node_modules/@messageformat/parser/lib/parser.js", "../packages/affix/index.js", "../node_modules/.pnpm/@chbphone55+classnames@2.0.0/node_modules/@chbphone55/classnames/dist/index.m.js", "../node_modules/.pnpm/@warp-ds+css@2.1.1_@warp-ds+uno@2.1.0_unocss@0.62.0_postcss@8.5.1_rollup@4.32.1_vite@5.3.3_@t_sgrraibu65gdmqpe655kfrpl6a/node_modules/@warp-ds/css/component-classes/index.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/elements/search-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/search/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/search/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/search/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/search/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/search/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../node_modules/.pnpm/@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-macros@3.1.0_typescri_qfhfd5z2jpd4amxt2golzdalsi/node_modules/@lingui/core/dist/index.mjs", "../node_modules/.pnpm/@lingui+message-utils@5.2.0/node_modules/@lingui/message-utils/dist/compileMessage.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/elements/close-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/close/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/close/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/close/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/close/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/close/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../packages/utils/index.js", "../packages/alert/index.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/elements/info-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/info/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/info/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/info/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/info/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/info/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/elements/warning-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/warning/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/warning/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/warning/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/warning/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/warning/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/elements/error-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/error/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/error/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/error/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/error/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/error/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/elements/success-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/success/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/success/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/success/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/success/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/success/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../packages/attention/index.js", "../node_modules/.pnpm/@floating-ui+utils@0.2.9/node_modules/@floating-ui/utils/dist/floating-ui.utils.mjs", "../node_modules/.pnpm/@floating-ui+core@1.6.9/node_modules/@floating-ui/core/dist/floating-ui.core.mjs", "../node_modules/.pnpm/@floating-ui+utils@0.2.9/node_modules/@floating-ui/utils/dist/floating-ui.utils.dom.mjs", "../node_modules/.pnpm/@floating-ui+dom@1.6.13/node_modules/@floating-ui/dom/dist/floating-ui.dom.mjs", "../node_modules/.pnpm/@warp-ds+core@1.1.8_@floating-ui+dom@1.6.13/node_modules/@warp-ds/core/dist/attention/utils/helpers.js", "../packages/i18n.ts", "../packages/attention/locales/da/messages.mjs", "../packages/attention/locales/en/messages.mjs", "../packages/attention/locales/fi/messages.mjs", "../packages/attention/locales/nb/messages.mjs", "../packages/attention/locales/sv/messages.mjs", "../packages/badge/index.js", "../packages/box/index.js", "../packages/breadcrumbs/index.js", "../node_modules/.pnpm/@warp-ds+core@1.1.8_@floating-ui+dom@1.6.13/node_modules/@warp-ds/core/dist/breadcrumbs/index.js", "../packages/breadcrumbs/locales/da/messages.mjs", "../packages/breadcrumbs/locales/en/messages.mjs", "../packages/breadcrumbs/locales/fi/messages.mjs", "../packages/breadcrumbs/locales/nb/messages.mjs", "../packages/breadcrumbs/locales/sv/messages.mjs", "../packages/button/index.js", "../packages/button/locales/da/messages.mjs", "../packages/button/locales/en/messages.mjs", "../packages/button/locales/fi/messages.mjs", "../packages/button/locales/nb/messages.mjs", "../packages/button/locales/sv/messages.mjs", "../packages/card/index.js", "../packages/card/locales/da/messages.mjs", "../packages/card/locales/en/messages.mjs", "../packages/card/locales/fi/messages.mjs", "../packages/card/locales/nb/messages.mjs", "../packages/card/locales/sv/messages.mjs", "../packages/expandable/index.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/elements/chevron-down-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/chevron-down/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/chevron-down/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/chevron-down/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/chevron-down/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/chevron-down/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/elements/chevron-up-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/chevron-up/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/chevron-up/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/chevron-up/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/chevron-up/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/chevron-up/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../packages/modal/modal-footer.js", "../packages/modal/util.js", "../packages/modal/modal-header.js", "../node_modules/.pnpm/@itsy+animate@0.0.9/node_modules/@itsy/animate/src/utility.js", "../node_modules/.pnpm/@itsy+animate@0.0.9/node_modules/@itsy/animate/src/reduce-motion.js", "../node_modules/.pnpm/@itsy+animate@0.0.9/node_modules/@itsy/animate/src/move.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/elements/arrow-left-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/arrow-left/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/arrow-left/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/arrow-left/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/arrow-left/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/raw/arrow-left/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-_hyhbgchrkasknlbocfng7geeci/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../packages/modal/locales/da/messages.mjs", "../packages/modal/locales/en/messages.mjs", "../packages/modal/locales/fi/messages.mjs", "../packages/modal/locales/nb/messages.mjs", "../packages/modal/locales/sv/messages.mjs", "../packages/modal/modal-main.js", "../node_modules/.pnpm/scroll-doctor@2.0.2/node_modules/scroll-doctor/dist/scroll-doctor.js", "../packages/modal/index.js", "../packages/pill/index.js", "../packages/pill/locales/da/messages.mjs", "../packages/pill/locales/en/messages.mjs", "../packages/pill/locales/fi/messages.mjs", "../packages/pill/locales/nb/messages.mjs", "../packages/pill/locales/sv/messages.mjs", "../packages/select/index.js", "../packages/select/locales/da/messages.mjs", "../packages/select/locales/en/messages.mjs", "../packages/select/locales/fi/messages.mjs", "../packages/select/locales/nb/messages.mjs", "../packages/select/locales/sv/messages.mjs", "../packages/textfield/index.js", "../packages/utils/window-exists.js", "../packages/toast/api.js", "../packages/toast/toast-container.js", "../packages/toast/toast.js", "../node_modules/.pnpm/element-collapse@1.1.0/node_modules/element-collapse/index.js", "../packages/toast/locales/da/messages.mjs", "../packages/toast/locales/en/messages.mjs", "../packages/toast/locales/fi/messages.mjs", "../packages/toast/locales/nb/messages.mjs", "../packages/toast/locales/sv/messages.mjs", "../packages/utils/expand-transition.js", "../packages/utils/unstyled-heading.js"],
-  "sourcesContent": ["\"use strict\";\n// NOTE: don't construct errors here or they'll have the wrong stack trace.\n// NOTE: don't make custom error class; the JS engines use `SyntaxError`\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.errorMessages = exports.ErrorType = void 0;\n/**\n * Keys for possible error messages used by `unraw`.\n * Note: These do _not_ map to actual error object types. All errors thrown\n * are `SyntaxError`.\n */\n// Don't use const enum or JS users won't be able to access the enum values\nvar ErrorType;\n(function (ErrorType) {\n    /**\n     * Thrown when a badly formed Unicode escape sequence is found. Possible\n     * reasons include the code being too short (`\"\\u25\"`) or having invalid\n     * characters (`\"\\u2$A5\"`).\n     */\n    ErrorType[\"MalformedUnicode\"] = \"MALFORMED_UNICODE\";\n    /**\n     * Thrown when a badly formed hexadecimal escape sequence is found. Possible\n     * reasons include the code being too short (`\"\\x2\"`) or having invalid\n     * characters (`\"\\x2$\"`).\n     */\n    ErrorType[\"MalformedHexadecimal\"] = \"MALFORMED_HEXADECIMAL\";\n    /**\n     * Thrown when a Unicode code point escape sequence has too high of a code\n     * point. The maximum code point allowed is `\\u{10FFFF}`, so `\\u{110000}` and\n     * higher will throw this error.\n     */\n    ErrorType[\"CodePointLimit\"] = \"CODE_POINT_LIMIT\";\n    /**\n     * Thrown when an octal escape sequences is encountered and `allowOctals` is\n     * `false`. For example, `unraw(\"\\234\", false)`.\n     */\n    ErrorType[\"OctalDeprecation\"] = \"OCTAL_DEPRECATION\";\n    /**\n     * Thrown only when a single backslash is found at the end of a string. For\n     * example, `\"\\\\\"` or `\"test\\\\x24\\\\\"`.\n     */\n    ErrorType[\"EndOfString\"] = \"END_OF_STRING\";\n})(ErrorType = exports.ErrorType || (exports.ErrorType = {}));\n/** Map of error message names to the full text of the message. */\nexports.errorMessages = new Map([\n    [ErrorType.MalformedUnicode, \"malformed Unicode character escape sequence\"],\n    [\n        ErrorType.MalformedHexadecimal,\n        \"malformed hexadecimal character escape sequence\"\n    ],\n    [\n        ErrorType.CodePointLimit,\n        \"Unicode codepoint must not be greater than 0x10FFFF in escape sequence\"\n    ],\n    [\n        ErrorType.OctalDeprecation,\n        '\"0\"-prefixed octal literals and octal escape sequences are deprecated; ' +\n            'for octal literals use the \"0o\" prefix instead'\n    ],\n    [ErrorType.EndOfString, \"malformed escape sequence at end of string\"]\n]);\n", "\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.unraw = exports.errorMessages = exports.ErrorType = void 0;\nconst errors_1 = require(\"./errors\");\nObject.defineProperty(exports, \"ErrorType\", { enumerable: true, get: function () { return errors_1.ErrorType; } });\nObject.defineProperty(exports, \"errorMessages\", { enumerable: true, get: function () { return errors_1.errorMessages; } });\n/**\n * Parse a string as a base-16 number. This is more strict than `parseInt` as it\n * will not allow any other characters, including (for example) \"+\", \"-\", and\n * \".\".\n * @param hex A string containing a hexadecimal number.\n * @returns The parsed integer, or `NaN` if the string is not a valid hex\n * number.\n */\nfunction parseHexToInt(hex) {\n    const isOnlyHexChars = !hex.match(/[^a-f0-9]/i);\n    return isOnlyHexChars ? parseInt(hex, 16) : NaN;\n}\n/**\n * Check the validity and length of a hexadecimal code and optionally enforces\n * a specific number of hex digits.\n * @param hex The string to validate and parse.\n * @param errorName The name of the error message to throw a `SyntaxError` with\n * if `hex` is invalid. This is used to index `errorMessages`.\n * @param enforcedLength If provided, will throw an error if `hex` is not\n * exactly this many characters.\n * @returns The parsed hex number as a normal number.\n * @throws {SyntaxError} If the code is not valid.\n */\nfunction validateAndParseHex(hex, errorName, enforcedLength) {\n    const parsedHex = parseHexToInt(hex);\n    if (Number.isNaN(parsedHex) ||\n        (enforcedLength !== undefined && enforcedLength !== hex.length)) {\n        throw new SyntaxError(errors_1.errorMessages.get(errorName));\n    }\n    return parsedHex;\n}\n/**\n * Parse a two-digit hexadecimal character escape code.\n * @param code The two-digit hexadecimal number that represents the character to\n * output.\n * @returns The single character represented by the code.\n * @throws {SyntaxError} If the code is not valid hex or is not the right\n * length.\n */\nfunction parseHexadecimalCode(code) {\n    const parsedCode = validateAndParseHex(code, errors_1.ErrorType.MalformedHexadecimal, 2);\n    return String.fromCharCode(parsedCode);\n}\n/**\n * Parse a four-digit Unicode character escape code.\n * @param code The four-digit unicode number that represents the character to\n * output.\n * @param surrogateCode Optional four-digit unicode surrogate that represents\n * the other half of the character to output.\n * @returns The single character represented by the code.\n * @throws {SyntaxError} If the codes are not valid hex or are not the right\n * length.\n */\nfunction parseUnicodeCode(code, surrogateCode) {\n    const parsedCode = validateAndParseHex(code, errors_1.ErrorType.MalformedUnicode, 4);\n    if (surrogateCode !== undefined) {\n        const parsedSurrogateCode = validateAndParseHex(surrogateCode, errors_1.ErrorType.MalformedUnicode, 4);\n        return String.fromCharCode(parsedCode, parsedSurrogateCode);\n    }\n    return String.fromCharCode(parsedCode);\n}\n/**\n * Test if the text is surrounded by curly braces (`{}`).\n * @param text Text to check.\n * @returns `true` if the text is in the form `{*}`.\n */\nfunction isCurlyBraced(text) {\n    return text.charAt(0) === \"{\" && text.charAt(text.length - 1) === \"}\";\n}\n/**\n * Parse a Unicode code point character escape code.\n * @param codePoint A unicode escape code point, including the surrounding curly\n * braces.\n * @returns The single character represented by the code.\n * @throws {SyntaxError} If the code is not valid hex or does not have the\n * surrounding curly braces.\n */\nfunction parseUnicodeCodePointCode(codePoint) {\n    if (!isCurlyBraced(codePoint)) {\n        throw new SyntaxError(errors_1.errorMessages.get(errors_1.ErrorType.MalformedUnicode));\n    }\n    const withoutBraces = codePoint.slice(1, -1);\n    const parsedCode = validateAndParseHex(withoutBraces, errors_1.ErrorType.MalformedUnicode);\n    try {\n        return String.fromCodePoint(parsedCode);\n    }\n    catch (err) {\n        throw err instanceof RangeError\n            ? new SyntaxError(errors_1.errorMessages.get(errors_1.ErrorType.CodePointLimit))\n            : err;\n    }\n}\n// Have to give overload that takes boolean for when compiler doesn't know if\n// true or false\nfunction parseOctalCode(code, error = false) {\n    if (error) {\n        throw new SyntaxError(errors_1.errorMessages.get(errors_1.ErrorType.OctalDeprecation));\n    }\n    // The original regex only allows digits so we don't need to have a strict\n    // octal parser like hexToInt. Length is not enforced for octals.\n    const parsedCode = parseInt(code, 8);\n    return String.fromCharCode(parsedCode);\n}\n/**\n * Map of unescaped letters to their corresponding special JS escape characters.\n * Intentionally does not include characters that map to themselves like \"\\'\".\n */\nconst singleCharacterEscapes = new Map([\n    [\"b\", \"\\b\"],\n    [\"f\", \"\\f\"],\n    [\"n\", \"\\n\"],\n    [\"r\", \"\\r\"],\n    [\"t\", \"\\t\"],\n    [\"v\", \"\\v\"],\n    [\"0\", \"\\0\"]\n]);\n/**\n * Parse a single character escape sequence and return the matching character.\n * If none is matched, defaults to `code`.\n * @param code A single character code.\n */\nfunction parseSingleCharacterCode(code) {\n    return singleCharacterEscapes.get(code) || code;\n}\n/**\n * Matches every escape sequence possible, including invalid ones.\n *\n * All capture groups (described below) are unique (only one will match), except\n * for 4, which can only potentially match if 3 does.\n *\n * **Capture Groups:**\n * 0. A single backslash\n * 1. Hexadecimal code\n * 2. Unicode code point code with surrounding curly braces\n * 3. Unicode escape code with surrogate\n * 4. Surrogate code\n * 5. Unicode escape code without surrogate\n * 6. Octal code _NOTE: includes \"0\"._\n * 7. A single character (will never be \\, x, u, or 0-3)\n */\nconst escapeMatch = /\\\\(?:(\\\\)|x([\\s\\S]{0,2})|u(\\{[^}]*\\}?)|u([\\s\\S]{4})\\\\u([^{][\\s\\S]{0,3})|u([\\s\\S]{0,4})|([0-3]?[0-7]{1,2})|([\\s\\S])|$)/g;\n/**\n * Replace raw escape character strings with their escape characters.\n * @param raw A string where escape characters are represented as raw string\n * values like `\\'` rather than `'`.\n * @param allowOctals If `true`, will process the now-deprecated octal escape\n * sequences (ie, `\\111`).\n * @returns The processed string, with escape characters replaced by their\n * respective actual Unicode characters.\n */\nfunction unraw(raw, allowOctals = false) {\n    return raw.replace(escapeMatch, function (_, backslash, hex, codePoint, unicodeWithSurrogate, surrogate, unicode, octal, singleCharacter) {\n        // Compare groups to undefined because empty strings mean different errors\n        // Otherwise, `\\u` would fail the same as `\\` which is wrong.\n        if (backslash !== undefined) {\n            return \"\\\\\";\n        }\n        if (hex !== undefined) {\n            return parseHexadecimalCode(hex);\n        }\n        if (codePoint !== undefined) {\n            return parseUnicodeCodePointCode(codePoint);\n        }\n        if (unicodeWithSurrogate !== undefined) {\n            return parseUnicodeCode(unicodeWithSurrogate, surrogate);\n        }\n        if (unicode !== undefined) {\n            return parseUnicodeCode(unicode);\n        }\n        if (octal === \"0\") {\n            return \"\\0\";\n        }\n        if (octal !== undefined) {\n            return parseOctalCode(octal, !allowOctals);\n        }\n        if (singleCharacter !== undefined) {\n            return parseSingleCharacterCode(singleCharacter);\n        }\n        throw new SyntaxError(errors_1.errorMessages.get(errors_1.ErrorType.EndOfString));\n    });\n}\nexports.unraw = unraw;\nexports.default = unraw;\n", "(function(root, factory) {\n  if (typeof define === 'function' && define.amd) {\n    define([], factory) /* global define */\n  } else if (typeof module === 'object' && module.exports) {\n    module.exports = factory()\n  } else {\n    root.moo = factory()\n  }\n}(this, function() {\n  'use strict';\n\n  var hasOwnProperty = Object.prototype.hasOwnProperty\n  var toString = Object.prototype.toString\n  var hasSticky = typeof new RegExp().sticky === 'boolean'\n\n  /***************************************************************************/\n\n  function isRegExp(o) { return o && toString.call(o) === '[object RegExp]' }\n  function isObject(o) { return o && typeof o === 'object' && !isRegExp(o) && !Array.isArray(o) }\n\n  function reEscape(s) {\n    return s.replace(/[-\\/\\\\^$*+?.()|[\\]{}]/g, '\\\\$&')\n  }\n  function reGroups(s) {\n    var re = new RegExp('|' + s)\n    return re.exec('').length - 1\n  }\n  function reCapture(s) {\n    return '(' + s + ')'\n  }\n  function reUnion(regexps) {\n    if (!regexps.length) return '(?!)'\n    var source =  regexps.map(function(s) {\n      return \"(?:\" + s + \")\"\n    }).join('|')\n    return \"(?:\" + source + \")\"\n  }\n\n  function regexpOrLiteral(obj) {\n    if (typeof obj === 'string') {\n      return '(?:' + reEscape(obj) + ')'\n\n    } else if (isRegExp(obj)) {\n      // TODO: consider /u support\n      if (obj.ignoreCase) throw new Error('RegExp /i flag not allowed')\n      if (obj.global) throw new Error('RegExp /g flag is implied')\n      if (obj.sticky) throw new Error('RegExp /y flag is implied')\n      if (obj.multiline) throw new Error('RegExp /m flag is implied')\n      return obj.source\n\n    } else {\n      throw new Error('Not a pattern: ' + obj)\n    }\n  }\n\n  function pad(s, length) {\n    if (s.length > length) {\n      return s\n    }\n    return Array(length - s.length + 1).join(\" \") + s\n  }\n\n  function lastNLines(string, numLines) {\n    var position = string.length\n    var lineBreaks = 0;\n    while (true) {\n      var idx = string.lastIndexOf(\"\\n\", position - 1)\n      if (idx === -1) {\n        break;\n      } else {\n        lineBreaks++\n      }\n      position = idx\n      if (lineBreaks === numLines) {\n        break;\n      }\n      if (position === 0) {\n        break;\n      }\n    }\n    var startPosition = \n      lineBreaks < numLines ?\n      0 : \n      position + 1\n    return string.substring(startPosition).split(\"\\n\")\n  }\n\n  function objectToRules(object) {\n    var keys = Object.getOwnPropertyNames(object)\n    var result = []\n    for (var i = 0; i < keys.length; i++) {\n      var key = keys[i]\n      var thing = object[key]\n      var rules = [].concat(thing)\n      if (key === 'include') {\n        for (var j = 0; j < rules.length; j++) {\n          result.push({include: rules[j]})\n        }\n        continue\n      }\n      var match = []\n      rules.forEach(function(rule) {\n        if (isObject(rule)) {\n          if (match.length) result.push(ruleOptions(key, match))\n          result.push(ruleOptions(key, rule))\n          match = []\n        } else {\n          match.push(rule)\n        }\n      })\n      if (match.length) result.push(ruleOptions(key, match))\n    }\n    return result\n  }\n\n  function arrayToRules(array) {\n    var result = []\n    for (var i = 0; i < array.length; i++) {\n      var obj = array[i]\n      if (obj.include) {\n        var include = [].concat(obj.include)\n        for (var j = 0; j < include.length; j++) {\n          result.push({include: include[j]})\n        }\n        continue\n      }\n      if (!obj.type) {\n        throw new Error('Rule has no type: ' + JSON.stringify(obj))\n      }\n      result.push(ruleOptions(obj.type, obj))\n    }\n    return result\n  }\n\n  function ruleOptions(type, obj) {\n    if (!isObject(obj)) {\n      obj = { match: obj }\n    }\n    if (obj.include) {\n      throw new Error('Matching rules cannot also include states')\n    }\n\n    // nb. error and fallback imply lineBreaks\n    var options = {\n      defaultType: type,\n      lineBreaks: !!obj.error || !!obj.fallback,\n      pop: false,\n      next: null,\n      push: null,\n      error: false,\n      fallback: false,\n      value: null,\n      type: null,\n      shouldThrow: false,\n    }\n\n    // Avoid Object.assign(), so we support IE9+\n    for (var key in obj) {\n      if (hasOwnProperty.call(obj, key)) {\n        options[key] = obj[key]\n      }\n    }\n\n    // type transform cannot be a string\n    if (typeof options.type === 'string' && type !== options.type) {\n      throw new Error(\"Type transform cannot be a string (type '\" + options.type + \"' for token '\" + type + \"')\")\n    }\n\n    // convert to array\n    var match = options.match\n    options.match = Array.isArray(match) ? match : match ? [match] : []\n    options.match.sort(function(a, b) {\n      return isRegExp(a) && isRegExp(b) ? 0\n           : isRegExp(b) ? -1 : isRegExp(a) ? +1 : b.length - a.length\n    })\n    return options\n  }\n\n  function toRules(spec) {\n    return Array.isArray(spec) ? arrayToRules(spec) : objectToRules(spec)\n  }\n\n  var defaultErrorRule = ruleOptions('error', {lineBreaks: true, shouldThrow: true})\n  function compileRules(rules, hasStates) {\n    var errorRule = null\n    var fast = Object.create(null)\n    var fastAllowed = true\n    var unicodeFlag = null\n    var groups = []\n    var parts = []\n\n    // If there is a fallback rule, then disable fast matching\n    for (var i = 0; i < rules.length; i++) {\n      if (rules[i].fallback) {\n        fastAllowed = false\n      }\n    }\n\n    for (var i = 0; i < rules.length; i++) {\n      var options = rules[i]\n\n      if (options.include) {\n        // all valid inclusions are removed by states() preprocessor\n        throw new Error('Inheritance is not allowed in stateless lexers')\n      }\n\n      if (options.error || options.fallback) {\n        // errorRule can only be set once\n        if (errorRule) {\n          if (!options.fallback === !errorRule.fallback) {\n            throw new Error(\"Multiple \" + (options.fallback ? \"fallback\" : \"error\") + \" rules not allowed (for token '\" + options.defaultType + \"')\")\n          } else {\n            throw new Error(\"fallback and error are mutually exclusive (for token '\" + options.defaultType + \"')\")\n          }\n        }\n        errorRule = options\n      }\n\n      var match = options.match.slice()\n      if (fastAllowed) {\n        while (match.length && typeof match[0] === 'string' && match[0].length === 1) {\n          var word = match.shift()\n          fast[word.charCodeAt(0)] = options\n        }\n      }\n\n      // Warn about inappropriate state-switching options\n      if (options.pop || options.push || options.next) {\n        if (!hasStates) {\n          throw new Error(\"State-switching options are not allowed in stateless lexers (for token '\" + options.defaultType + \"')\")\n        }\n        if (options.fallback) {\n          throw new Error(\"State-switching options are not allowed on fallback tokens (for token '\" + options.defaultType + \"')\")\n        }\n      }\n\n      // Only rules with a .match are included in the RegExp\n      if (match.length === 0) {\n        continue\n      }\n      fastAllowed = false\n\n      groups.push(options)\n\n      // Check unicode flag is used everywhere or nowhere\n      for (var j = 0; j < match.length; j++) {\n        var obj = match[j]\n        if (!isRegExp(obj)) {\n          continue\n        }\n\n        if (unicodeFlag === null) {\n          unicodeFlag = obj.unicode\n        } else if (unicodeFlag !== obj.unicode && options.fallback === false) {\n          throw new Error('If one rule is /u then all must be')\n        }\n      }\n\n      // convert to RegExp\n      var pat = reUnion(match.map(regexpOrLiteral))\n\n      // validate\n      var regexp = new RegExp(pat)\n      if (regexp.test(\"\")) {\n        throw new Error(\"RegExp matches empty string: \" + regexp)\n      }\n      var groupCount = reGroups(pat)\n      if (groupCount > 0) {\n        throw new Error(\"RegExp has capture groups: \" + regexp + \"\\nUse (?: \u2026 ) instead\")\n      }\n\n      // try and detect rules matching newlines\n      if (!options.lineBreaks && regexp.test('\\n')) {\n        throw new Error('Rule should declare lineBreaks: ' + regexp)\n      }\n\n      // store regex\n      parts.push(reCapture(pat))\n    }\n\n\n    // If there's no fallback rule, use the sticky flag so we only look for\n    // matches at the current index.\n    //\n    // If we don't support the sticky flag, then fake it using an irrefutable\n    // match (i.e. an empty pattern).\n    var fallbackRule = errorRule && errorRule.fallback\n    var flags = hasSticky && !fallbackRule ? 'ym' : 'gm'\n    var suffix = hasSticky || fallbackRule ? '' : '|'\n\n    if (unicodeFlag === true) flags += \"u\"\n    var combined = new RegExp(reUnion(parts) + suffix, flags)\n    return {regexp: combined, groups: groups, fast: fast, error: errorRule || defaultErrorRule}\n  }\n\n  function compile(rules) {\n    var result = compileRules(toRules(rules))\n    return new Lexer({start: result}, 'start')\n  }\n\n  function checkStateGroup(g, name, map) {\n    var state = g && (g.push || g.next)\n    if (state && !map[state]) {\n      throw new Error(\"Missing state '\" + state + \"' (in token '\" + g.defaultType + \"' of state '\" + name + \"')\")\n    }\n    if (g && g.pop && +g.pop !== 1) {\n      throw new Error(\"pop must be 1 (in token '\" + g.defaultType + \"' of state '\" + name + \"')\")\n    }\n  }\n  function compileStates(states, start) {\n    var all = states.$all ? toRules(states.$all) : []\n    delete states.$all\n\n    var keys = Object.getOwnPropertyNames(states)\n    if (!start) start = keys[0]\n\n    var ruleMap = Object.create(null)\n    for (var i = 0; i < keys.length; i++) {\n      var key = keys[i]\n      ruleMap[key] = toRules(states[key]).concat(all)\n    }\n    for (var i = 0; i < keys.length; i++) {\n      var key = keys[i]\n      var rules = ruleMap[key]\n      var included = Object.create(null)\n      for (var j = 0; j < rules.length; j++) {\n        var rule = rules[j]\n        if (!rule.include) continue\n        var splice = [j, 1]\n        if (rule.include !== key && !included[rule.include]) {\n          included[rule.include] = true\n          var newRules = ruleMap[rule.include]\n          if (!newRules) {\n            throw new Error(\"Cannot include nonexistent state '\" + rule.include + \"' (in state '\" + key + \"')\")\n          }\n          for (var k = 0; k < newRules.length; k++) {\n            var newRule = newRules[k]\n            if (rules.indexOf(newRule) !== -1) continue\n            splice.push(newRule)\n          }\n        }\n        rules.splice.apply(rules, splice)\n        j--\n      }\n    }\n\n    var map = Object.create(null)\n    for (var i = 0; i < keys.length; i++) {\n      var key = keys[i]\n      map[key] = compileRules(ruleMap[key], true)\n    }\n\n    for (var i = 0; i < keys.length; i++) {\n      var name = keys[i]\n      var state = map[name]\n      var groups = state.groups\n      for (var j = 0; j < groups.length; j++) {\n        checkStateGroup(groups[j], name, map)\n      }\n      var fastKeys = Object.getOwnPropertyNames(state.fast)\n      for (var j = 0; j < fastKeys.length; j++) {\n        checkStateGroup(state.fast[fastKeys[j]], name, map)\n      }\n    }\n\n    return new Lexer(map, start)\n  }\n\n  function keywordTransform(map) {\n\n    // Use a JavaScript Map to map keywords to their corresponding token type\n    // unless Map is unsupported, then fall back to using an Object:\n    var isMap = typeof Map !== 'undefined'\n    var reverseMap = isMap ? new Map : Object.create(null)\n\n    var types = Object.getOwnPropertyNames(map)\n    for (var i = 0; i < types.length; i++) {\n      var tokenType = types[i]\n      var item = map[tokenType]\n      var keywordList = Array.isArray(item) ? item : [item]\n      keywordList.forEach(function(keyword) {\n        if (typeof keyword !== 'string') {\n          throw new Error(\"keyword must be string (in keyword '\" + tokenType + \"')\")\n        }\n        if (isMap) {\n          reverseMap.set(keyword, tokenType)\n        } else {\n          reverseMap[keyword] = tokenType\n        }\n      })\n    }\n    return function(k) {\n      return isMap ? reverseMap.get(k) : reverseMap[k]\n    }\n  }\n\n  /***************************************************************************/\n\n  var Lexer = function(states, state) {\n    this.startState = state\n    this.states = states\n    this.buffer = ''\n    this.stack = []\n    this.reset()\n  }\n\n  Lexer.prototype.reset = function(data, info) {\n    this.buffer = data || ''\n    this.index = 0\n    this.line = info ? info.line : 1\n    this.col = info ? info.col : 1\n    this.queuedToken = info ? info.queuedToken : null\n    this.queuedText = info ? info.queuedText: \"\";\n    this.queuedThrow = info ? info.queuedThrow : null\n    this.setState(info ? info.state : this.startState)\n    this.stack = info && info.stack ? info.stack.slice() : []\n    return this\n  }\n\n  Lexer.prototype.save = function() {\n    return {\n      line: this.line,\n      col: this.col,\n      state: this.state,\n      stack: this.stack.slice(),\n      queuedToken: this.queuedToken,\n      queuedText: this.queuedText,\n      queuedThrow: this.queuedThrow,\n    }\n  }\n\n  Lexer.prototype.setState = function(state) {\n    if (!state || this.state === state) return\n    this.state = state\n    var info = this.states[state]\n    this.groups = info.groups\n    this.error = info.error\n    this.re = info.regexp\n    this.fast = info.fast\n  }\n\n  Lexer.prototype.popState = function() {\n    this.setState(this.stack.pop())\n  }\n\n  Lexer.prototype.pushState = function(state) {\n    this.stack.push(this.state)\n    this.setState(state)\n  }\n\n  var eat = hasSticky ? function(re, buffer) { // assume re is /y\n    return re.exec(buffer)\n  } : function(re, buffer) { // assume re is /g\n    var match = re.exec(buffer)\n    // will always match, since we used the |(?:) trick\n    if (match[0].length === 0) {\n      return null\n    }\n    return match\n  }\n\n  Lexer.prototype._getGroup = function(match) {\n    var groupCount = this.groups.length\n    for (var i = 0; i < groupCount; i++) {\n      if (match[i + 1] !== undefined) {\n        return this.groups[i]\n      }\n    }\n    throw new Error('Cannot find token type for matched text')\n  }\n\n  function tokenToString() {\n    return this.value\n  }\n\n  Lexer.prototype.next = function() {\n    var index = this.index\n\n    // If a fallback token matched, we don't need to re-run the RegExp\n    if (this.queuedGroup) {\n      var token = this._token(this.queuedGroup, this.queuedText, index)\n      this.queuedGroup = null\n      this.queuedText = \"\"\n      return token\n    }\n\n    var buffer = this.buffer\n    if (index === buffer.length) {\n      return // EOF\n    }\n\n    // Fast matching for single characters\n    var group = this.fast[buffer.charCodeAt(index)]\n    if (group) {\n      return this._token(group, buffer.charAt(index), index)\n    }\n\n    // Execute RegExp\n    var re = this.re\n    re.lastIndex = index\n    var match = eat(re, buffer)\n\n    // Error tokens match the remaining buffer\n    var error = this.error\n    if (match == null) {\n      return this._token(error, buffer.slice(index, buffer.length), index)\n    }\n\n    var group = this._getGroup(match)\n    var text = match[0]\n\n    if (error.fallback && match.index !== index) {\n      this.queuedGroup = group\n      this.queuedText = text\n\n      // Fallback tokens contain the unmatched portion of the buffer\n      return this._token(error, buffer.slice(index, match.index), index)\n    }\n\n    return this._token(group, text, index)\n  }\n\n  Lexer.prototype._token = function(group, text, offset) {\n    // count line breaks\n    var lineBreaks = 0\n    if (group.lineBreaks) {\n      var matchNL = /\\n/g\n      var nl = 1\n      if (text === '\\n') {\n        lineBreaks = 1\n      } else {\n        while (matchNL.exec(text)) { lineBreaks++; nl = matchNL.lastIndex }\n      }\n    }\n\n    var token = {\n      type: (typeof group.type === 'function' && group.type(text)) || group.defaultType,\n      value: typeof group.value === 'function' ? group.value(text) : text,\n      text: text,\n      toString: tokenToString,\n      offset: offset,\n      lineBreaks: lineBreaks,\n      line: this.line,\n      col: this.col,\n    }\n    // nb. adding more props to token object will make V8 sad!\n\n    var size = text.length\n    this.index += size\n    this.line += lineBreaks\n    if (lineBreaks !== 0) {\n      this.col = size - nl + 1\n    } else {\n      this.col += size\n    }\n\n    // throw, if no rule with {error: true}\n    if (group.shouldThrow) {\n      var err = new Error(this.formatError(token, \"invalid syntax\"))\n      throw err;\n    }\n\n    if (group.pop) this.popState()\n    else if (group.push) this.pushState(group.push)\n    else if (group.next) this.setState(group.next)\n\n    return token\n  }\n\n  if (typeof Symbol !== 'undefined' && Symbol.iterator) {\n    var LexerIterator = function(lexer) {\n      this.lexer = lexer\n    }\n\n    LexerIterator.prototype.next = function() {\n      var token = this.lexer.next()\n      return {value: token, done: !token}\n    }\n\n    LexerIterator.prototype[Symbol.iterator] = function() {\n      return this\n    }\n\n    Lexer.prototype[Symbol.iterator] = function() {\n      return new LexerIterator(this)\n    }\n  }\n\n  Lexer.prototype.formatError = function(token, message) {\n    if (token == null) {\n      // An undefined token indicates EOF\n      var text = this.buffer.slice(this.index)\n      var token = {\n        text: text,\n        offset: this.index,\n        lineBreaks: text.indexOf('\\n') === -1 ? 0 : 1,\n        line: this.line,\n        col: this.col,\n      }\n    }\n    \n    var numLinesAround = 2\n    var firstDisplayedLine = Math.max(token.line - numLinesAround, 1)\n    var lastDisplayedLine = token.line + numLinesAround\n    var lastLineDigits = String(lastDisplayedLine).length\n    var displayedLines = lastNLines(\n        this.buffer, \n        (this.line - token.line) + numLinesAround + 1\n      )\n      .slice(0, 5)\n    var errorLines = []\n    errorLines.push(message + \" at line \" + token.line + \" col \" + token.col + \":\")\n    errorLines.push(\"\")\n    for (var i = 0; i < displayedLines.length; i++) {\n      var line = displayedLines[i]\n      var lineNo = firstDisplayedLine + i\n      errorLines.push(pad(String(lineNo), lastLineDigits) + \"  \" + line);\n      if (lineNo === token.line) {\n        errorLines.push(pad(\"\", lastLineDigits + token.col + 1) + \"^\")\n      }\n    }\n    return errorLines.join(\"\\n\")\n  }\n\n  Lexer.prototype.clone = function() {\n    return new Lexer(this.states, this.state)\n  }\n\n  Lexer.prototype.has = function(tokenType) {\n    return true\n  }\n\n\n  return {\n    compile: compile,\n    states: compileStates,\n    error: Object.freeze({error: true}),\n    fallback: Object.freeze({fallback: true}),\n    keywords: keywordTransform,\n  }\n\n}));\n", "\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n    return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.lexer = exports.states = void 0;\nconst moo_1 = __importDefault(require(\"moo\"));\nexports.states = {\n    body: {\n        doubleapos: { match: \"''\", value: () => \"'\" },\n        quoted: {\n            lineBreaks: true,\n            match: /'[{}#](?:[^']|'')*'(?!')/u,\n            value: src => src.slice(1, -1).replace(/''/g, \"'\")\n        },\n        argument: {\n            lineBreaks: true,\n            match: /\\{\\s*[^\\p{Pat_Syn}\\p{Pat_WS}]+\\s*/u,\n            push: 'arg',\n            value: src => src.substring(1).trim()\n        },\n        octothorpe: '#',\n        end: { match: '}', pop: 1 },\n        content: { lineBreaks: true, match: /[^][^{}#']*/u }\n    },\n    arg: {\n        select: {\n            lineBreaks: true,\n            match: /,\\s*(?:plural|select|selectordinal)\\s*,\\s*/u,\n            next: 'select',\n            value: src => src.split(',')[1].trim()\n        },\n        'func-args': {\n            lineBreaks: true,\n            match: /,\\s*[^\\p{Pat_Syn}\\p{Pat_WS}]+\\s*,/u,\n            next: 'body',\n            value: src => src.split(',')[1].trim()\n        },\n        'func-simple': {\n            lineBreaks: true,\n            match: /,\\s*[^\\p{Pat_Syn}\\p{Pat_WS}]+\\s*/u,\n            value: src => src.substring(1).trim()\n        },\n        end: { match: '}', pop: 1 }\n    },\n    select: {\n        offset: {\n            lineBreaks: true,\n            match: /\\s*offset\\s*:\\s*\\d+\\s*/u,\n            value: src => src.split(':')[1].trim()\n        },\n        case: {\n            lineBreaks: true,\n            match: /\\s*(?:=\\d+|[^\\p{Pat_Syn}\\p{Pat_WS}]+)\\s*\\{/u,\n            push: 'body',\n            value: src => src.substring(0, src.indexOf('{')).trim()\n        },\n        end: { match: /\\s*\\}/u, pop: 1 }\n    }\n};\nexports.lexer = moo_1.default.states(exports.states);\n", "\"use strict\";\n/**\n * An AST parser for ICU MessageFormat strings\n *\n * @packageDocumentation\n * @example\n * ```\n * import { parse } from '@messageformat/parser\n *\n * parse('So {wow}.')\n * [ { type: 'content', value: 'So ' },\n *   { type: 'argument', arg: 'wow' },\n *   { type: 'content', value: '.' } ]\n *\n *\n * parse('Such { thing }. { count, selectordinal, one {First} two {Second}' +\n *       '                  few {Third} other {#th} } word.')\n * [ { type: 'content', value: 'Such ' },\n *   { type: 'argument', arg: 'thing' },\n *   { type: 'content', value: '. ' },\n *   { type: 'selectordinal',\n *     arg: 'count',\n *     cases: [\n *       { key: 'one', tokens: [ { type: 'content', value: 'First' } ] },\n *       { key: 'two', tokens: [ { type: 'content', value: 'Second' } ] },\n *       { key: 'few', tokens: [ { type: 'content', value: 'Third' } ] },\n *       { key: 'other',\n *         tokens: [ { type: 'octothorpe' }, { type: 'content', value: 'th' } ] }\n *     ] },\n *   { type: 'content', value: ' word.' } ]\n *\n *\n * parse('Many{type,select,plural{ numbers}selectordinal{ counting}' +\n *                          'select{ choices}other{ some {type}}}.')\n * [ { type: 'content', value: 'Many' },\n *   { type: 'select',\n *     arg: 'type',\n *     cases: [\n *       { key: 'plural', tokens: [ { type: 'content', value: 'numbers' } ] },\n *       { key: 'selectordinal', tokens: [ { type: 'content', value: 'counting' } ] },\n *       { key: 'select', tokens: [ { type: 'content', value: 'choices' } ] },\n *       { key: 'other',\n *         tokens: [ { type: 'content', value: 'some ' }, { type: 'argument', arg: 'type' } ] }\n *     ] },\n *   { type: 'content', value: '.' } ]\n *\n *\n * parse('{Such compliance')\n * // ParseError: invalid syntax at line 1 col 7:\n * //\n * //  {Such compliance\n * //        ^\n *\n *\n * const msg = '{words, plural, zero{No words} one{One word} other{# words}}'\n * parse(msg)\n * [ { type: 'plural',\n *     arg: 'words',\n *     cases: [\n *       { key: 'zero', tokens: [ { type: 'content', value: 'No words' } ] },\n *       { key: 'one', tokens: [ { type: 'content', value: 'One word' } ] },\n *       { key: 'other',\n *         tokens: [ { type: 'octothorpe' }, { type: 'content', value: ' words' } ] }\n *     ] } ]\n *\n *\n * parse(msg, { cardinal: [ 'one', 'other' ], ordinal: [ 'one', 'two', 'few', 'other' ] })\n * // ParseError: The plural case zero is not valid in this locale at line 1 col 17:\n * //\n * //   {words, plural, zero{\n * //                   ^\n * ```\n */\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.ParseError = void 0;\nexports.parse = parse;\nconst lexer_js_1 = require(\"./lexer.js\");\nconst getContext = (lt) => ({\n    offset: lt.offset,\n    line: lt.line,\n    col: lt.col,\n    text: lt.text,\n    lineBreaks: lt.lineBreaks\n});\nconst isSelectType = (type) => type === 'plural' || type === 'select' || type === 'selectordinal';\nfunction strictArgStyleParam(lt, param) {\n    let value = '';\n    let text = '';\n    for (const p of param) {\n        const pText = p.ctx.text;\n        text += pText;\n        switch (p.type) {\n            case 'content':\n                value += p.value;\n                break;\n            case 'argument':\n            case 'function':\n            case 'octothorpe':\n                value += pText;\n                break;\n            default:\n                throw new ParseError(lt, `Unsupported part in strict mode function arg style: ${pText}`);\n        }\n    }\n    const c = {\n        type: 'content',\n        value: value.trim(),\n        ctx: Object.assign({}, param[0].ctx, { text })\n    };\n    return [c];\n}\nconst strictArgTypes = [\n    'number',\n    'date',\n    'time',\n    'spellout',\n    'ordinal',\n    'duration'\n];\nconst defaultPluralKeys = ['zero', 'one', 'two', 'few', 'many', 'other'];\n/**\n * Thrown by {@link parse} on error\n *\n * @public\n */\nclass ParseError extends Error {\n    /** @internal */\n    constructor(lt, msg) {\n        super(lexer_js_1.lexer.formatError(lt, msg));\n    }\n}\nexports.ParseError = ParseError;\nclass Parser {\n    constructor(src, opt) {\n        var _a, _b, _c, _d;\n        this.lexer = lexer_js_1.lexer.reset(src);\n        this.cardinalKeys = (_a = opt === null || opt === void 0 ? void 0 : opt.cardinal) !== null && _a !== void 0 ? _a : defaultPluralKeys;\n        this.ordinalKeys = (_b = opt === null || opt === void 0 ? void 0 : opt.ordinal) !== null && _b !== void 0 ? _b : defaultPluralKeys;\n        this.strict = (_c = opt === null || opt === void 0 ? void 0 : opt.strict) !== null && _c !== void 0 ? _c : false;\n        this.strictPluralKeys = (_d = opt === null || opt === void 0 ? void 0 : opt.strictPluralKeys) !== null && _d !== void 0 ? _d : true;\n    }\n    parse() {\n        return this.parseBody(false, true);\n    }\n    checkSelectKey(lt, type, key) {\n        if (key[0] === '=') {\n            if (type === 'select') {\n                throw new ParseError(lt, `The case ${key} is not valid with select`);\n            }\n        }\n        else if (type !== 'select') {\n            const keys = type === 'plural' ? this.cardinalKeys : this.ordinalKeys;\n            if (this.strictPluralKeys && keys.length > 0 && !keys.includes(key)) {\n                const msg = `The ${type} case ${key} is not valid in this locale`;\n                throw new ParseError(lt, msg);\n            }\n        }\n    }\n    parseSelect({ value: arg }, inPlural, ctx, type) {\n        const sel = { type, arg, cases: [], ctx };\n        if (type === 'plural' || type === 'selectordinal')\n            inPlural = true;\n        else if (this.strict)\n            inPlural = false;\n        for (const lt of this.lexer) {\n            switch (lt.type) {\n                case 'offset':\n                    if (type === 'select') {\n                        throw new ParseError(lt, 'Unexpected plural offset for select');\n                    }\n                    if (sel.cases.length > 0) {\n                        throw new ParseError(lt, 'Plural offset must be set before cases');\n                    }\n                    sel.pluralOffset = Number(lt.value);\n                    ctx.text += lt.text;\n                    ctx.lineBreaks += lt.lineBreaks;\n                    break;\n                case 'case': {\n                    this.checkSelectKey(lt, type, lt.value);\n                    sel.cases.push({\n                        key: lt.value,\n                        tokens: this.parseBody(inPlural),\n                        ctx: getContext(lt)\n                    });\n                    break;\n                }\n                case 'end':\n                    return sel;\n                /* istanbul ignore next: never happens */\n                default:\n                    throw new ParseError(lt, `Unexpected lexer token: ${lt.type}`);\n            }\n        }\n        throw new ParseError(null, 'Unexpected message end');\n    }\n    parseArgToken(lt, inPlural) {\n        const ctx = getContext(lt);\n        const argType = this.lexer.next();\n        if (!argType)\n            throw new ParseError(null, 'Unexpected message end');\n        ctx.text += argType.text;\n        ctx.lineBreaks += argType.lineBreaks;\n        if (this.strict &&\n            (argType.type === 'func-simple' || argType.type === 'func-args') &&\n            !strictArgTypes.includes(argType.value)) {\n            const msg = `Invalid strict mode function arg type: ${argType.value}`;\n            throw new ParseError(lt, msg);\n        }\n        switch (argType.type) {\n            case 'end':\n                return { type: 'argument', arg: lt.value, ctx };\n            case 'func-simple': {\n                const end = this.lexer.next();\n                if (!end)\n                    throw new ParseError(null, 'Unexpected message end');\n                /* istanbul ignore if: never happens */\n                if (end.type !== 'end') {\n                    throw new ParseError(end, `Unexpected lexer token: ${end.type}`);\n                }\n                ctx.text += end.text;\n                if (isSelectType(argType.value.toLowerCase())) {\n                    throw new ParseError(argType, `Invalid type identifier: ${argType.value}`);\n                }\n                return {\n                    type: 'function',\n                    arg: lt.value,\n                    key: argType.value,\n                    ctx\n                };\n            }\n            case 'func-args': {\n                if (isSelectType(argType.value.toLowerCase())) {\n                    const msg = `Invalid type identifier: ${argType.value}`;\n                    throw new ParseError(argType, msg);\n                }\n                let param = this.parseBody(this.strict ? false : inPlural);\n                if (this.strict && param.length > 0) {\n                    param = strictArgStyleParam(lt, param);\n                }\n                return {\n                    type: 'function',\n                    arg: lt.value,\n                    key: argType.value,\n                    param,\n                    ctx\n                };\n            }\n            case 'select':\n                /* istanbul ignore else: never happens */\n                if (isSelectType(argType.value)) {\n                    return this.parseSelect(lt, inPlural, ctx, argType.value);\n                }\n                else {\n                    throw new ParseError(argType, `Unexpected select type ${argType.value}`);\n                }\n            /* istanbul ignore next: never happens */\n            default:\n                throw new ParseError(argType, `Unexpected lexer token: ${argType.type}`);\n        }\n    }\n    parseBody(inPlural, atRoot) {\n        const tokens = [];\n        let content = null;\n        for (const lt of this.lexer) {\n            if (lt.type === 'argument') {\n                if (content)\n                    content = null;\n                tokens.push(this.parseArgToken(lt, inPlural));\n            }\n            else if (lt.type === 'octothorpe' && inPlural) {\n                if (content)\n                    content = null;\n                tokens.push({ type: 'octothorpe', ctx: getContext(lt) });\n            }\n            else if (lt.type === 'end' && !atRoot) {\n                return tokens;\n            }\n            else {\n                let value = lt.value;\n                if (!inPlural && lt.type === 'quoted' && value[0] === '#') {\n                    if (value.includes('{')) {\n                        const errMsg = `Unsupported escape pattern: ${value}`;\n                        throw new ParseError(lt, errMsg);\n                    }\n                    value = lt.text;\n                }\n                if (content) {\n                    content.value += value;\n                    content.ctx.text += lt.text;\n                    content.ctx.lineBreaks += lt.lineBreaks;\n                }\n                else {\n                    content = { type: 'content', value, ctx: getContext(lt) };\n                    tokens.push(content);\n                }\n            }\n        }\n        if (atRoot)\n            return tokens;\n        throw new ParseError(null, 'Unexpected message end');\n    }\n}\n/**\n * Parse an input string into an array of tokens\n *\n * @public\n * @remarks\n * The parser only supports the default `DOUBLE_OPTIONAL`\n * {@link http://www.icu-project.org/apiref/icu4c/messagepattern_8h.html#af6e0757e0eb81c980b01ee5d68a9978b | apostrophe mode}.\n */\nfunction parse(src, options = {}) {\n    const parser = new Parser(src, options);\n    return parser.parse();\n}\n", "import { html } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { suffix as ccSuffix, prefix as ccPrefix } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\nimport { ifDefined } from 'lit/directives/if-defined.js';\nimport '@warp-ds/icons/elements/search-16';\nimport '@warp-ds/icons/elements/close-16';\n\nimport { kebabCaseAttributes } from '../utils';\n\nclass WarpAffix extends kebabCaseAttributes(WarpElement) {\n  static properties = {\n    ariaLabel: { type: String },\n    clear: { type: Boolean },\n    search: { type: Boolean },\n    label: { type: String },\n  };\n\n  static styles = [WarpElement.styles];\n\n  get _classBase() {\n    return this.slot === 'suffix' ? ccSuffix : ccPrefix;\n  }\n\n  get _classes() {\n    return classNames([this._classBase.wrapper, this.label ? this._classBase.wrapperWithLabel : this._classBase.wrapperWithIcon]);\n  }\n\n  get _searchButton() {\n    return html`\n      <button aria-label=\"${ifDefined(this.ariaLabel)}\" class=\"${this._classes}\" type=\"submit\">\n        <w-icon-search-16></w-icon-search-16>\n      </button>\n    `;\n  }\n\n  get _clearButton() {\n    return html`\n      <button aria-label=\"${ifDefined(this.ariaLabel)}\" class=\"${this._classes}\" type=\"reset\">\n        <w-icon-close-16></w-icon-close-16>\n      </button>\n    `;\n  }\n\n  get _text() {\n    return html`\n      <div class=\"${this._classes}\">\n        <span class=\"${this._classBase.label}\">${this.label}</span>\n      </div>\n    `;\n  }\n\n  get _markup() {\n    if (this.label) {\n      return this._text;\n    } else if (this.search) {\n      return this._searchButton;\n    } else if (this.clear) {\n      return this._clearButton;\n    }\n  }\n\n  render() {\n    return html`${this._markup}`;\n  }\n}\n\nif (!customElements.get('w-affix')) {\n  customElements.define('w-affix', WarpAffix);\n}\n\nexport { WarpAffix };\n", "var r=function(){for(var t=[],n=arguments.length;n--;)t[n]=arguments[n];return t.reduce(function(t,n){return t.concat(\"string\"==typeof n?n:Array.isArray(n)?r.apply(void 0,n):\"object\"==typeof n&&n?Object.keys(n).map(function(r){return n[r]?r:\"\"}):\"\")},[]).join(\" \")};export{r as classNames};\n", "export const pageIndicator = {\n  wrapper: 'flex space-x-8 p-8',\n  dot: 'h-8 w-8 rounded-full',\n  inactive: 's-bg-disabled-subtle hover:bg-[--w-s-icon-subtle]',\n  active: 'bg-[--w-s-icon-selected]',\n};\n\nexport const badge = {\n  base: 'py-4 px-8 border-0 rounded-4 text-xs inline-flex',\n  neutral: 'bg-[--w-color-badge-neutral-background] s-text',\n  info: 'bg-[--w-color-badge-info-background] s-text',\n  positive: 'bg-[--w-color-badge-positive-background] s-text',\n  warning: 'bg-[--w-color-badge-warning-background] s-text',\n  negative: 'bg-[--w-color-badge-negative-background] s-text',\n  disabled: 's-bg-disabled s-text',\n  price: 'bg-[--w-black/70] s-text-inverted-static',\n  sponsored: 'bg-[--w-color-badge-sponsored-background] s-text',\n  positionBase: 'absolute backdrop-blur',\n  positionTL: 'rounded-tl-0 rounded-tr-0 rounded-bl-0 top-0 left-0',\n  positionTR: 'rounded-tl-0 rounded-tr-0 rounded-br-0 top-0 right-0',\n  positionBR: 'rounded-tr-0 rounded-br-0 rounded-bl-0 bottom-0 right-0',\n  positionBL: 'rounded-tl-0 rounded-br-0 rounded-bl-0 bottom-0 left-0',\n};\n\nexport const slider = {\n  wrapper: 'touch-pan-y relative w-full h-44 py-2',\n  track: 'absolute s-bg-disabled-subtle h-4 top-20 rounded-4 w-full',\n  trackDisabled: 'pointer-events-none',\n  activeTrack: 'absolute h-6 top-[1.92rem] rounded-4',\n  activeTrackEnabled: 's-bg-primary',\n  activeTrackDisabled: 's-bg-disabled pointer-events-none',\n  thumb: 'absolute transition-shadow w-24 h-24 bottom-10 rounded-4 outline-none',\n  thumbEnabled:\n    'border-2 shadow-[--w-shadow-slider] cursor-pointer s-bg-primary s-border-primary hover:s-bg-primary-hover hover:s-border-primary-hover hover:shadow-[--w-shadow-slider-handle-hover] active:s-bg-primary-active active:s-border-primary-active active:shadow-[--w-shadow-slider-handle-active] focus:shadow-[--w-shadow-slider-handle-hover] focus:s-border-primary-hover focus:s-bg-primary-hover',\n  thumbDisabled: 's-bg-disabled cursor-disabled pointer-events-none',\n};\n\nexport const box = {\n  base: 'group block relative break-words last-child:mb-0 p-16 rounded-8', // Relative here enables w-clickable\n  bleed: '-mx-16 sm:mx-0 rounded-l-0 rounded-r-0 sm:rounded-8', // We target L and R to override the default rounded-8\n  info: 's-bg-info-subtle',\n  neutral: 's-surface-sunken',\n  bordered: 'border-2 s-border s-bg',\n};\n\nexport const pill = {\n  wrapper: 'flex items-center',\n  button: 'inline-flex items-center focusable text-xs transition-all',\n  suggestion:\n    'bg-[--w-color-pill-suggestion-background] hover:bg-[--w-color-pill-suggestion-background-hover] active:bg-[--w-color-pill-suggestion-background-active] s-text font-bold',\n  filter: 's-bg-primary hover:s-bg-primary-hover active:s-bg-primary-active s-text-inverted',\n  label: 'pl-12 py-8 rounded-l-full',\n  labelWithoutClose: 'pr-12 rounded-r-full',\n  labelWithClose: 'pr-2',\n  close: 'pr-12 pl-4 py-8 rounded-r-full',\n  a11y: 'sr-only',\n};\n\nexport const step = {\n  base: 'group/step',\n  vertical: 'group/stepv grid-rows-[20px_auto] grid grid-flow-col gap-x-16',\n  horizontal: 'group/steph grid-rows-[auto_20px] grid-cols-[1fr_20px_1fr] flex-1 grid gap-y-16 items-center',\n\n  alignLeft: 'grid-cols-[20px_1fr]',\n  alignRight: 'grid-cols-[1fr_20px] text-right',\n\n  dot: 'rounded-full border-2 h-20 w-20 transition-colors duration-300 s-icon-inverted',\n  dotAlignRight: 'col-start-2',\n  dotHorizontal: 'row-start-2 justify-self-end',\n  dotActive: 's-border-primary s-bg-primary',\n  dotIncomplete: 's-border s-bg',\n\n  line: 'group-last/stepv:hidden transition-colors duration-300',\n  lineVertical: 'w-2 h-full justify-self-center',\n  lineAlignRight: 'col-start-2',\n  lineHorizontal: 'h-2 w-full row-start-2',\n  lineHorizontalAlignRight: 'group-last/steph:bg-transparent',\n  lineHorizontalAlignLeft: 'group-first/steph:bg-transparent',\n\n  lineIncomplete: 's-bg-disabled',\n  lineComplete: 's-bg-primary',\n\n  content: 'last:mb-0 group-last/step:last:pb-0',\n  contentVertical: 'row-span-2 pb-32',\n  contentHorizontal: 'col-span-3 px-16 row-start-1 text-center',\n};\n\nexport const steps = {\n  wrapper: 'w-full',\n  horizontal: 'flex',\n};\n\nexport const card = {\n  base: 'cursor-pointer overflow-hidden relative transition-all',\n  shadow: 'group rounded-8 s-surface-elevated-200 hover:s-surface-elevated-200-hover active:s-surface-elevated-200-active',\n  selected: '!s-bg-selected !hover:s-bg-selected-hover !active:s-bg-selected-active',\n  outline: 'absolute border-2 rounded-8 inset-0 transition-all',\n  outlineUnselected: 'border-transparent group-active:s-border-active',\n  outlineSelected: 's-border-selected group-hover:s-border-selected-hover group-active:s-border-selected-active',\n  flat: 'border-2 rounded-4',\n  flatUnselected: 's-bg hover:s-bg-hover active:s-bg-active s-border hover:s-border-hover active:s-border-active',\n  flatSelected:\n    's-bg-selected hover:s-bg-selected-hover active:s-bg-selected-active s-border-selected hover:s-border-selected-hover active:s-border-selected-active',\n  a11y: 'sr-only',\n};\n\nexport const switchToggle = {\n  base: 'block relative h-24 w-44 cursor-pointer group focusable rounded-full',\n  disabled: 'pointer-events-none',\n  track: 'absolute top-0 left-0 h-full w-full rounded-full transition-colors',\n  trackActive: 's-bg-primary group-hover:s-bg-primary-hover',\n  trackInactive: 'bg-[--w-color-switch-track-background] group-hover:bg-[--w-color-switch-track-background-hover]',\n  trackDisabled: 's-bg-disabled-subtle',\n  handle: 'absolute transform-gpu h-16 w-16 top-4 left-4 rounded-full transition-transform',\n  handleSelected: 'translate-x-20',\n  handleNotDisabled: 's-bg shadow-s',\n  handleDisabled: 's-bg-disabled',\n  a11y: 'sr-only',\n};\n\nexport const toaster = {\n  wrapper: 'fixed transform translate-z-0 bottom-16 left-0 right-0 mx-8 sm:mx-16 z-50 pointer-events-none',\n  base: 'grid auto-rows-auto justify-items-center justify-center mx-auto pointer-events-none',\n  content: 'w-full',\n};\n\nexport const toast = {\n  wrapper: 'relative overflow-hidden w-full',\n  base: 'flex group p-8 mt-16 rounded-8 border-2 pointer-events-auto transition-all',\n  positive: 's-bg-positive-subtle s-border-positive-subtle s-text',\n  warning: 's-bg-warning-subtle s-border-warning-subtle s-text',\n  negative: 's-bg-negative-subtle s-border-negative-subtle s-text',\n  iconBase: 'shrink-0 rounded-full w-[16px] h-[16px] m-[8px]',\n  iconPositive: 's-icon-positive',\n  iconWarning: 's-icon-warning',\n  iconNegative: 's-icon-negative',\n  iconLoading: 'animate-bounce',\n  content: 'self-center mr-8 py-4 last-child:mb-0',\n  close: 'bg-transparent ml-auto p-[8px] s-icon hover:s-icon-hover active:s-icon-active',\n};\n\nexport const tabs = {\n  wrapper: 'inline-block border-b s-border mb-32',\n  base: 'inline-grid relative -mb-1',\n  selectionIndicator: 'absolute s-border-selected -bottom-0 border-b-4 transition-all',\n};\n\nexport const tab = {\n  base: 'grid items-center font-bold gap-8 focusable antialias p-16 pb-8 border-b-4 bg-transparent border-transparent hover:s-text-link hover:s-border-primary',\n  inactive: 's-text-subtle',\n  active: 's-text-link s-border-selected',\n  icon: 'mx-auto',\n  content: 'flex items-center justify-center gap-8',\n  contentUnderlined: 'content-underlined', // content-underlined is a no-op that prevents a quirk in how Vue handles class bindings\n};\n\n// Todo: Handle dynamic classnames\nexport const gridLayout = {\n  cols1: 'grid-cols-1',\n  cols2: 'grid-cols-2',\n  cols3: 'grid-cols-3',\n  cols4: 'grid-cols-4',\n  cols5: 'grid-cols-5',\n  cols6: 'grid-cols-6',\n  cols7: 'grid-cols-7',\n  cols8: 'grid-cols-8',\n  cols9: 'grid-cols-9',\n};\n\nexport const buttonReset = 'focus:outline-none appearance-none cursor-pointer bg-transparent border-0 m-0 p-0 inline-block';\n\nexport const expandable = {\n  wrapper: 'will-change-height s-text',\n  box: 's-surface-sunken hover:s-bg-hover active:s-bg-active py-0 px-0 group block relative break-words last-child:mb-0 rounded-8',\n  bleed: '-mx-16 rounded-l-0 rounded-r-0 sm:mx-0 sm:rounded-8',\n  chevron: 'inline-block align-middle s-icon',\n  chevronNonBox: 'ml-8',\n  chevronTransform: 'transform transition-transform transform-gpu ease-in-out',\n  chevronExpand: '-rotate-180',\n  chevronCollapse: 'rotate-180',\n\n  // These are web component specific classes, using the ::part-selector:\n  elementsChevronDownTransform:\n    'part-[w-icon-chevron-down-16-part]:transform part-[w-icon-chevron-down-16-part]:transition-transform part-[w-icon-chevron-down-16-part]:transform-gpu part-[w-icon-chevron-down-16-part]:ease-in-out',\n  elementsChevronUpTransform:\n    'part-[w-icon-chevron-up-16-part]:transform part-[w-icon-chevron-up-16-part]:transition-transform part-[w-icon-chevron-up-16-part]:transform-gpu part-[w-icon-chevron-up-16-part]:ease-in-out',\n  elementsChevronExpand: 'part-[w-icon-chevron-down-16-part]:-rotate-180',\n  elementsChevronCollapse: 'part-[w-icon-chevron-up-16-part]:rotate-180',\n\n  expansion: 'overflow-hidden',\n  expansionNotExpanded: 'h-0 invisible',\n  button: 'focus:outline-none appearance-none cursor-pointer bg-transparent border-0 m-0 hover:underline focus-visible:underline',\n  buttonBox: 'w-full text-left relative inline-flex items-center justify-between group relative break-words last-child:mb-0 p-16 rounded-8',\n  contentWithTitle: 'pt-0',\n  title: 'flex w-full justify-between items-center',\n  titleType: 't4',\n};\n\nconst buttonDefaultStyling = 'font-bold focusable justify-center transition-colors ease-in-out';\n\nconst buttonColors = {\n  primary:\n    's-text-inverted bg-[--w-color-button-primary-background] hover:bg-[--w-color-button-primary-background-hover] active:bg-[--w-color-button-primary-background-active]',\n  secondary: 's-text-link s-border s-bg hover:s-bg-hover hover:s-border-hover active:s-bg-active',\n  utility: 's-text s-bg hover:s-bg-hover active:s-bg-active s-border hover:s-border-hover active:s-border-active',\n  destructive: 's-bg-negative s-text-inverted hover:s-bg-negative-hover active:s-bg-negative-active',\n  pill: 's-icon hover:s-icon-hover active:s-icon-active bg-transparent hover:bg-[--w-color-button-pill-background-hover] active:bg-[--w-color-button-pill-background-active]',\n  disabled: 's-text-inverted s-bg-disabled',\n  quiet: 'bg-transparent s-text-link hover:s-bg-hover active:s-bg-active',\n  utilityQuiet: 's-text bg-transparent hover:s-bg-hover active:s-bg-active',\n  negativeQuiet: 'bg-transparent s-text-negative hover:s-bg-negative-subtle-hover active:s-bg-negative-subtle-active',\n  loading: 's-text s-bg-subtle',\n  link: 's-text-link',\n};\n\nconst buttonTypes = {\n  primary: `border-0 rounded-8 ${buttonDefaultStyling}`,\n  secondary: `border-2 rounded-8 ${buttonDefaultStyling}`,\n  utility: `border rounded-4 ${buttonDefaultStyling}`,\n  negative: `border-0 rounded-8 ${buttonDefaultStyling}`,\n  pill: `p-4 rounded-full border-0 inline-flex items-center justify-center hover:bg-clip-padding ${buttonDefaultStyling}`,\n  link: `bg-transparent focusable ease-in-out inline active:underline hover:underline focus:underline ${buttonColors.link}`,\n};\n\nconst buttonSizes = {\n  xsmall: 'py-6 px-16',\n  small: 'py-8 px-16',\n  medium: 'py-10 px-14',\n  large: 'py-12 px-16',\n  utility: 'py-[11px] px-[15px]',\n  smallUtility: 'py-[7px] px-[15px]',\n  pill: 'min-h-[44px] min-w-[44px]',\n  pillSmall: 'min-h-32 min-w-32',\n  link: 'p-0',\n};\n\nconst buttonTextSizes = {\n  medium: 'text-m leading-[24]',\n  xsmall: 'text-xs',\n};\n\nconst buttonVariants = {\n  inProgress: `border-transparent animate-inprogress pointer-events-none ${buttonColors.loading}`, // .button--in-progress, a.button--in-progress:visited\n  quiet: `border-0 rounded-8 ${buttonDefaultStyling}`,\n  utilityQuiet: `border-0 rounded-4 ${buttonDefaultStyling}`,\n  negativeQuiet: `border-0 rounded-8 ${buttonDefaultStyling}`,\n  isDisabled: `font-bold justify-center transition-colors ease-in-out cursor-default pointer-events-none ${buttonColors.disabled}`, // .button:disabled, .button--is-disabled\n};\n\nexport const button = {\n  // Buttontypes\n  secondary: `${buttonSizes.medium} ${buttonTextSizes.medium} ${buttonTypes.secondary} ${buttonColors.secondary}`, // .button--secondary, .button--default, .button\n  secondaryHref: `${buttonSizes.medium} ${buttonTextSizes.medium} ${buttonTypes.secondary} ${buttonColors.secondary}`,\n  secondaryDisabled: `${buttonSizes.medium} ${buttonTextSizes.medium} ${buttonTypes.secondary} ${buttonVariants.isDisabled}`,\n  secondarySmall: `${buttonTextSizes.xsmall} ${buttonSizes.xsmall} ${buttonTypes.secondary} ${buttonColors.secondary}`,\n  secondarySmallDisabled: `${buttonTextSizes.xsmall} ${buttonSizes.xsmall} ${buttonTypes.secondary} ${buttonVariants.isDisabled}`,\n  secondaryQuiet: `${buttonSizes.medium} ${buttonTextSizes.medium} ${buttonVariants.quiet} ${buttonColors.quiet}`,\n  secondaryQuietDisabled: `${buttonSizes.medium} ${buttonTextSizes.medium} ${buttonVariants.quiet} ${buttonVariants.isDisabled}`,\n  secondarySmallQuiet: `${buttonTextSizes.xsmall} ${buttonSizes.xsmall} ${buttonVariants.quiet} ${buttonColors.quiet}`,\n  secondarySmallQuietDisabled: `${buttonTextSizes.xsmall} ${buttonSizes.xsmall} ${buttonVariants.quiet} ${buttonVariants.isDisabled}`,\n  secondaryLoading: `${buttonSizes.medium} ${buttonTextSizes.medium} ${buttonTypes.secondary} ${buttonVariants.inProgress}`,\n  secondarySmallLoading: `${buttonTextSizes.xsmall} ${buttonSizes.xsmall}  ${buttonTypes.secondary} ${buttonVariants.inProgress}`,\n  secondarySmallQuietLoading: `${buttonTextSizes.xsmall} ${buttonSizes.xsmall} ${buttonVariants.quiet} ${buttonVariants.inProgress}`,\n  secondaryQuietLoading: `${buttonSizes.medium} ${buttonTextSizes.medium} ${buttonVariants.quiet} ${buttonVariants.inProgress}`,\n\n  primary: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonTypes.primary} ${buttonColors.primary}`, // .button--primary, .button--cta\n  primaryDisabled: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.isDisabled} ${buttonTypes.primary}`,\n  primarySmall: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonTypes.primary} ${buttonColors.primary}`,\n  primarySmallDisabled: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.isDisabled} ${buttonTypes.primary} `,\n  primaryQuiet: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.quiet} ${buttonColors.quiet}`,\n  primaryQuietDisabled: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.quiet} ${buttonVariants.isDisabled}`,\n  primarySmallQuiet: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.quiet} ${buttonColors.quiet}`,\n  primarySmallQuietDisabled: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.quiet} ${buttonVariants.isDisabled}`,\n  primaryLoading: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.inProgress} ${buttonTypes.primary}`,\n  primarySmallLoading: `${buttonSizes.small} ${buttonTextSizes.xsmall}  ${buttonVariants.inProgress} ${buttonTypes.primary}`,\n  primarySmallQuietLoading: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.quiet} ${buttonVariants.inProgress} ${buttonTypes.primary}`,\n  primaryQuietLoading: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.quiet} ${buttonVariants.inProgress}`,\n\n  utility: `${buttonSizes.utility} ${buttonTextSizes.medium} ${buttonTypes.utility} ${buttonColors.utility}`, // .button--utility\n  utilityDisabled: `${buttonSizes.utility} ${buttonTextSizes.medium} ${buttonTypes.utility} ${buttonVariants.isDisabled}`,\n  utilityQuiet: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.utilityQuiet} ${buttonColors.utilityQuiet}`, // .button--utility-flat\n  utilityQuietDisabled: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.utilityQuiet} ${buttonVariants.isDisabled}`,\n  utilitySmall: `${buttonSizes.smallUtility} ${buttonTextSizes.xsmall} ${buttonTypes.utility} ${buttonColors.utility}`,\n  utilitySmallDisabled: `${buttonSizes.smallUtility} ${buttonTextSizes.xsmall} ${buttonTypes.utility} ${buttonVariants.isDisabled}`,\n  utilitySmallQuiet: `${buttonSizes.smallUtility} ${buttonTextSizes.xsmall} ${buttonVariants.utilityQuiet} ${buttonColors.utilityQuiet}`,\n  utilitySmallQuietDisabled: `${buttonSizes.smallUtility} ${buttonTextSizes.xsmall} ${buttonVariants.utilityQuiet} ${buttonVariants.isDisabled}`,\n  utilityLoading: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonTypes.utility} ${buttonVariants.inProgress}`,\n  utilitySmallLoading: `${buttonSizes.smallUtility} ${buttonTextSizes.xsmall} ${buttonTypes.utility} ${buttonVariants.inProgress}`,\n  utilityQuietLoading: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.inProgress} ${buttonVariants.utilityQuiet}`,\n  utilitySmallQuietLoading: `${buttonSizes.smallUtility} ${buttonTextSizes.xsmall} ${buttonVariants.inProgress} ${buttonVariants.utilityQuiet}`,\n\n  negative: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonTypes.negative} ${buttonColors.destructive}`, // .button--destructive\n  negativeDisabled: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonTypes.negative} ${buttonVariants.isDisabled}`,\n  negativeQuiet: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.negativeQuiet} ${buttonColors.negativeQuiet}`, // .button--destructive-flat\n  negativeQuietDisabled: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.negativeQuiet}${buttonVariants.isDisabled}`,\n  negativeSmall: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonTypes.negative} ${buttonColors.destructive}`,\n  negativeSmallDisabled: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonTypes.negative} ${buttonVariants.isDisabled}`,\n  negativeSmallQuiet: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.negativeQuiet} ${buttonColors.negativeQuiet}`,\n  negativeSmallQuietDisabled: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.negativeQuiet} ${buttonVariants.isDisabled}`,\n  negativeLoading: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonTypes.negative} ${buttonVariants.inProgress}`,\n  negativeSmallLoading: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.inProgress} ${buttonTypes.negative}`,\n  negativeQuietLoading: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.negativeQuiet} ${buttonTypes.negative} ${buttonVariants.inProgress}`,\n  negativeSmallQuietLoading: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.negativeQuiet} ${buttonVariants.inProgress}`,\n\n  pill: `${buttonSizes.pill} ${buttonTextSizes.medium} ${buttonTypes.pill} ${buttonColors.pill}`, // .button--pill\n  pillSmall: `${buttonSizes.pillSmall} ${buttonTextSizes.xsmall} ${buttonTypes.pill} ${buttonColors.pill}`,\n  pillLoading: `${buttonSizes.pill} ${buttonTextSizes.medium} ${buttonTypes.pill} ${buttonVariants.inProgress}`,\n  pillSmallLoading: `${buttonSizes.pillSmall} ${buttonTextSizes.xsmall} ${buttonTypes.pill} ${buttonVariants.inProgress}`,\n\n  link: `${buttonSizes.link} ${buttonTextSizes.medium} ${buttonTypes.link}`,\n  linkSmall: `${buttonSizes.link} ${buttonTextSizes.xsmall} ${buttonTypes.link}`,\n  linkAsButton: 'inline-block active:no-underline hover:no-underline focus:no-underline text-center',\n  a11y: 'sr-only',\n  fullWidth: 'w-full max-w-full',\n  contentWidth: 'max-w-max',\n};\n\nexport const buttonGroup = {\n  wrapper: 'inline-flex rounded-4 overflow-hidden',\n  raised: 'shadow-s',\n  vertical: 'flex-col',\n  nonOutlinedVertical: 'divide-y',\n  nonOutlinedHorizontal: 'divide-x',\n};\n\nexport const buttonGroupItem = {\n  wrapper: 'relative s-text',\n  outlined: 'border hover:z-30',\n  outlinedVertical: '-mb-1 last:mb-0 first:rounded-lt-4 first:rounded-rt-4 last:rounded-lb-4 last:rounded-rb-4',\n  outlinedHorizontal: '-mr-1 last:mr-0 first:rounded-lt-4 first:rounded-lb-4 last:rounded-rt-4 last:rounded-rb-4',\n  outlinedVerticalResets: 'px-1 pt-1 last:pb-1 -mb-1 last:mb-0',\n  outlinedHorizontalResets: 'py-1 pl-1 last:pr-1 -mr-1 last:mr-0',\n  outlinedUnselected: 'border-[--w-color-buttongroup-utility-border] active:border-[--w-color-buttongroup-utility-border-selected]',\n  outlinedSelected: 'active:border-[--w-color-buttongroup-utility-border-selected]',\n  unselected:\n    's-bg hover:bg-[--w-color-buttongroup-utility-background-hover] active:s-text active:bg-[--w-color-buttongroup-utility-background-selected]',\n  selected: 'z-30 bg-[--w-color-buttongroup-utility-background-selected]',\n};\n\nexport const modal = {\n  backdrop:\n    'fixed inset-0 flex sm:place-content-center sm:place-items-center items-end z-30 [--w-modal-max-height:80%] [--w-modal-width:640px] bg-[--w-black/25]',\n  base: 'pb-safe-[32] shadow-m max-h-[--w-modal-max-height] min-h-[--w-modal-min-height] w-[--w-modal-width] h-[--w-modal-height] relative transition-300 ease-in-out backface-hidden will-change-height rounded-8 mx-0 sm:mx-16 bg-[--w-s-color-surface-elevated-100] flex flex-col overflow-hidden outline-none space-y-16 pt-8 sm:pt-32 sm:pb-32 rounded-b-0 sm:rounded-b-8',\n  content: 'block overflow-y-auto overflow-x-hidden last-child:mb-0 grow shrink px-16 sm:px-32 relative',\n  footer: 'flex justify-end shrink-0 px-16 sm:px-32',\n  transitionTitle: 'transition-all duration-300',\n  transitionTitleCenter: 'justify-self-center self-center',\n  transitionTitleColSpan: 'col-span-2',\n  title:\n    'py-8 sm:py-0 -mt-4 sm:-mt-8 min-h-40 sm:min-h-48 grid gap-8 sm:gap-16 grid-cols-[auto_1fr_auto] items-start px-16 sm:px-32 border-b sm:border-b-0 shrink-0',\n  titleText: 'mb-0 h4 sm:h3',\n  titleButton: `${buttonTextSizes.medium} ${buttonTypes.pill} ${buttonColors.pill} sm:min-h-[44px] sm:min-w-[44px] min-h-[32px] min-w-[32px]`,\n  titleButtonLeft: '-ml-8 sm:-ml-12 justify-self-start',\n  titleButtonRight: '-mr-8 sm:-mr-12 justify-self-end',\n  titleButtonIcon: 'h-16 w-16 sm:h-24 sm:w-24',\n  titleButtonIconRotated: 'transform rotate-90',\n};\n\nexport const modalElement = {\n  // several items in here are 'resets' for the <dialog> element\n  dialogEl:\n    'bg-transparent backface-hidden w-unset h-unset max-w-unset max-h-unset p-0 m-auto border-0 inset-0 open:flex open:fixed sm:place-content-center sm:place-items-center items-end [--w-modal-max-height:80%] [--w-modal-width:640px]',\n  dialogInner:\n    'transition-all relative pb-safe-[32] sm:pb-32 shadow-m max-h-[--w-modal-max-height] min-h-[--w-modal-min-height] w-[--w-modal-width] h-[--w-modal-height] ease-in-out backface-hidden will-change-height rounded-8 sm:mx-16 s-bg flex flex-col overflow-hidden lt-sm:rounded-b-0',\n  contentSlot: 'block overflow-y-auto overflow-x-hidden last-child:mb-0 grow shrink px-16 sm:px-32 relative',\n  header: 'relative pb-8',\n  headerTitleBar: 'pt-16 sm:pt-24 px-16 sm:px-32 grid gap-12 grid-cols-[auto_1fr_auto] items-start shrink-0!',\n  headerButton:\n    'sm:min-h-[32px] sm:min-w-[32px] min-h-[40px] min-w-[40px] text-m leading-[24] p-4 rounded-full border-0 inline-flex items-center justify-center hover:bg-clip-padding font-bold focusable transition-colors ease-in-out',\n  headerButtonLeft:\n    '-ml-8 s-icon bg-transparent hover:bg-[--w-color-button-pill-background-hover] active:bg-[--w-color-button-pill-background-active]',\n  headerCloseButton:\n    '-mr-8 s-icon bg-transparent hover:bg-[--w-color-button-pill-background-hover] active:bg-[--w-color-button-pill-background-active]',\n  headerCloseButtonOnImage: `absolute right-8 top-8 z-10 s-color-inverted bg-[var(--w-black)/70] hover:bg-[var(--w-black)/85] active:bg-[var(--w-black)] s-text-inverted`,\n  headerTitle: 'mb-0 t3 self-center',\n  headerTitleWithBackButton: 'justify-self-center',\n  headerTitleWithoutBackButton: 'col-span-2',\n  headerTitleWithTopArea: 'pt-16 px-16 sm:px-32',\n  footer: 'flex justify-end shrink-0 px-16 sm:px-32 pt-24',\n};\n\nexport const alert = {\n  wrapper: 'flex p-16 border border-l-4 rounded-4 s-text',\n  willChangeHeight: 'will-change-height',\n  textWrapper: 'last-child:mb-0 text-s',\n  title: 'text-s',\n  icon: 'w-16 mr-8 min-w-16',\n  negative: 's-border-negative-subtle s-border-l-negative s-bg-negative-subtle',\n  negativeIcon: 's-icon-negative',\n  positive: 's-border-positive-subtle s-border-l-positive s-bg-positive-subtle',\n  positiveIcon: 's-icon-positive',\n  warning: 's-border-warning-subtle s-border-l-warning s-bg-warning-subtle',\n  warningIcon: 's-icon-warning',\n  info: 's-border-info-subtle s-border-l-info s-bg-info-subtle',\n  infoIcon: 's-icon-info',\n};\n\nexport const input = {\n  // wrapper classes\n  wrapper: 'relative',\n  // input classes\n  base: 'block text-m leading-m mb-0 px-8 py-12 rounded-4 w-full focusable focus:[--w-outline-offset:-2px] caret-current', // true\n  default: 'border-1 s-text s-bg s-border hover:s-border-hover active:s-border-selected', // !isInvalid && !isDisabled && !isReadOnly\n  disabled: 'border-1 s-text-disabled s-bg-disabled-subtle s-border-disabled pointer-events-none', // !isInvalid && isDisabled && !isReadOnly\n  invalid: 'border-1 s-text-negative s-bg s-border-negative hover:s-border-negative-hover outline-[--w-s-color-border-negative]!', // isInvalid && !isDisabled && !isReadOnly\n  readOnly: 'pl-0 bg-transparent pointer-events-none', // !isInvalid && !isDisabled && isReadOnly\n  placeholder: 'placeholder:s-text-placeholder',\n  suffix: 'pr-40',\n  prefix: 'pl-[var(--w-prefix-width,_40px)]',\n  // textarea classes\n  textArea: 'min-h-[42] sm:min-h-[45]',\n};\n\nexport const select = {\n  base: 'block text-m mb-0 py-12 pr-32 rounded-4 w-full focusable focus:[--w-outline-offset:-2px] appearance-none cursor-pointer caret-current',\n  default: 's-text s-bg pl-8 border-1 s-border hover:s-border-hover active:s-border-active',\n  disabled:\n    's-text-disabled s-bg-disabled-subtle pl-8 border-1 s-border-disabled hover:s-border-disabled active:s-border-disabled pointer-events-none',\n  invalid:\n    's-text s-bg pl-8 border-1 s-border-negative hover:s-border-negative-hover active:s-border-active outline-[--w-s-color-border-negative]!',\n  readOnly: 's-text bg-transparent pl-0 border-0 pointer-events-none before:hidden',\n  wrapper: 'relative',\n  selectWrapper: `relative before:block before:absolute before:right-0 before:bottom-0 before:w-32 before:h-full before:pointer-events-none `,\n  chevron: 'block absolute top-[30%] right-0 bottom-0 w-32 h-full s-icon pointer-events-none cursor-pointer',\n  chevronDisabled: 'opacity-25',\n};\n\nexport const label = {\n  base: 'antialiased block relative text-s font-bold pb-4 cursor-pointer s-text',\n  optional: 'pl-8 font-normal text-s s-text-subtle',\n};\n\nexport const helpText = {\n  base: 'text-xs mt-4 block',\n  color: 's-text-subtle',\n  colorInvalid: 's-text-negative',\n};\n\nconst prefixSuffixWrapper =\n  'absolute top-0 bottom-0 flex justify-center items-center focusable rounded-4 focus:[--w-outline-offset:-2px] bg-transparent ';\n\nexport const suffix = {\n  wrapper: prefixSuffixWrapper + 'right-0',\n  wrapperWithLabel: 'w-max pr-12',\n  wrapperWithIcon: 'w-40',\n  label: 'antialiased block relative cursor-default pb-0 font-bold text-xs s-text',\n};\n\nexport const prefix = {\n  wrapper: prefixSuffixWrapper + 'left-0',\n  wrapperWithLabel: 'w-max pl-12',\n  wrapperWithIcon: 'w-40',\n  label: 'antialiased block relative cursor-default pb-0 font-bold text-xs s-text',\n};\n\nexport const breadcrumbs = {\n  wrapper: 'flex space-x-8',\n  text: 's-text',\n  link: 's-text-link',\n  separator: 'select-none s-icon',\n  a11y: 'sr-only',\n};\n\nexport const toggle = {\n  // wrapper classes\n  field: 'relative text-m', // true\n  wrapper: 'relative py-1', // true\n  wrapperRadioButtons: 'inline-flex font-bold rounded-8 focus-within:focusable', // isRadioButton && !isEqualWidth\n  wrapperRadioButtonsJustified: 'flex font-bold rounded-8 focus-within:focusable', // isRadioButton && isEqualWidth,\n\n  // group classes\n  radioButtonsGroup: 'group', // isRadioButton\n  radioButtonsGroupJustified: 'grow-1 shrink-0 basis-auto', // isRadioButton && isEqualWidth\n\n  // input classes\n  input: 'peer',\n  a11y: 'sr-only',\n\n  // label classes\n  label:\n    'peer-focus:focusable cursor-pointer text-m s-text s-border py-2 pl-28 select-none relative block before:border before:absolute before:transition-all before:left-0 before:w-20 before:h-20 before:top-2', // !isRadioButton\n  labelBefore: 'before:content-[\"\"] before:block', // !isRadioButton && !isIndeterminate\n  checkbox:\n    'before:s-bg before:rounded-2 hover:before:s-border-primary hover:before:s-bg-hover peer-checked:before:bg-center peer-checked:before:bg-[url(var(--w-icon-toggle-checked))] peer-checked:before:s-border-primary peer-checked:before:s-bg-primary peer-checked:peer-hover:before:s-border-primary-hover peer-checked:peer-hover:before:s-bg-primary-hover', // isCheckbox && !isIndeterminate && !isInvalid && !isDisabled\n  checkboxInvalid:\n    'before:s-bg before:s-border-negative before:rounded-2 hover:before:s-bg-negative-subtle-hover hover:before:s-border-negative-hover peer-checked:before:bg-center peer-checked:before:bg-[url(var(--w-icon-toggle-checked))] peer-checked:before:s-bg-negative peer-checked:before:s-border-negative peer-checked:peer-hover:before:s-bg-negative-hover peer-checked:peer-hover:before:s-border-negative-hover', // isCheckbox && !isIndeterminate && isInvalid && !isDisabled\n  checkboxDisabled:\n    'before:s-bg-disabled-subtle before:s-border-disabled pointer-events-none before:rounded-2 peer-checked:before:bg-center peer-checked:before:bg-[url(var(--w-icon-toggle-checked))] peer-checked:before:s-border-disabled peer-checked:before:s-bg-disabled', // isCheckbox && !isIndeterminate && !isInvalid && isDisabled\n  indeterminate:\n    'before:content-[\"\u2013\"] before:rounded-2 before:leading-xs before:text-center before:font-bold before:s-icon-inverted peer-indeterminate:before:s-border-primary peer-indeterminate:before:s-bg-primary peer-indeterminate:hover:before:s-border-primary-hover peer-indeterminate:hover:before:s-bg-primary-hover', // isCheckbox && isIndeterminate && !isInvalid && !isDisabled\n  indeterminateInvalid:\n    'before:content-[\"\u2013\"] before:rounded-2 before:leading-xs before:text-center before:font-bold before:s-icon-inverted peer-indeterminate:before:s-border-negative peer-indeterminate:before:s-bg-negative peer-indeterminate:hover:before:s-border-negative-hover peer-indeterminate:hover:before:s-bg-negative-hover', // isCheckbox && isIndeterminate && isInvalid && !isDisabled\n  indeterminateDisabled:\n    'before:content-[\"\u2013\"] before:rounded-2 before:leading-xs before:text-center before:font-bold pointer-events-none before:s-icon-inverted peer-indeterminate:before:s-border-disabled peer-indeterminate:before:s-bg-disabled', // isCheckbox && isIndeterminate && !isInvalid && isDisabled\n  radio:\n    'before:s-bg before:rounded-full peer-checked:before:border-[6] peer-checked:before:s-border-selected peer-checked:peer-hover:before:s-border-selected-hover peer-hover:before:s-border-primary peer-hover:before:s-bg-hover', // isRadio && !isDisabled && !isInvalid\n  radioInvalid:\n    'before:s-bg before:s-border-negative before:rounded-full peer-checked:before:border-[6] peer-hover:before:s-bg-negative-subtle peer-hover:before:s-border-negative-hover peer-checked:before:s-border-negative peer-checked:peer-hover:before:s-border-negative-hover', // isRadio && isInvalid && !isDisabled\n  radioDisabled:\n    'before:s-bg-disabled-subtle before:s-border-disabled pointer-events-none before:rounded-full peer-checked:before:border-[6]', // isRadio && !isInvalid && isDisabled\n  radioButtonsLabel:\n    'peer-hover:peer-not-checked:s-bg-hover peer-checked:s-text-inverted peer-checked:s-bg-primary peer-checked:s-border-primary block relative font-bold cursor-pointer s-text-link text-center s-bg border-2 s-border group-first-of-type:rounded-tl-8 group-first-of-type:rounded-bl-8 group-last-of-type:rounded-tr-8 group-last-of-type:rounded-br-8 group-not-last-of-type:border-r-0 peer-checked:z-10 group-not-first:-ml-2', // isRadioButtons\n  radioButtonsRegular: 'text-s py-8 pl-12 pr-14', // isRadioButtons && !isSmall\n  radioButtonsSmall: 'text-xs py-[5px] px-[8px]', // isRadioButtons && isSmall\n};\n\nexport const deadToggle = {\n  wrapper: `${toggle.wrapper} h-20 w-20 pointer-events-none`,\n  input: `${toggle.input} hidden`,\n  inputVue: 'hidden',\n  labelVue: '-mt-2',\n  labelRadio: `${toggle.label} ${toggle.labelBefore} ${toggle.radio}`,\n  labelCheckbox: `${toggle.label} ${toggle.labelBefore} ${toggle.checkbox}`,\n};\n\nexport const clickable = {\n  toggle: 'absolute inset-0 h-full w-full appearance-none cursor-pointer focusable focusable-inset',\n  label: 'antialiased block relative text-s font-bold s-text px-12 py-8 cursor-pointer focusable focusable-inset',\n  buttonOrLink: 'bg-transparent focusable',\n  buttonOrLinkStretch: 'inset-0 absolute',\n};\n\nexport const combobox = {\n  wrapper: 'relative',\n  base: 'absolute left-0 right-0 s-bg pb-4 rounded-8 overflow-hidden shadow-m',\n  listbox: 'm-0 p-0 select-none list-none',\n  option: 'block cursor-pointer p-8',\n  optionUnselected: 'hover:s-bg-hover',\n  optionSelected: 's-bg-selected hover:s-bg-selected-hover',\n  textMatch: 'font-bold',\n  a11y: 'sr-only',\n};\n\nexport const attention = {\n  base: 'border-2 relative flex items-start',\n  tooltip: 's-bg-inverted border-[--w-s-color-background-inverted] shadow-m s-text-inverted-static rounded-4 py-6 px-8',\n  callout: 'bg-[--w-color-callout-background] border-[--w-color-callout-border] s-text py-8 px-16 rounded-8',\n  highlight: 'bg-[--w-color-callout-background] border-[--w-color-callout-border] s-text py-8 px-16 rounded-8 drop-shadow-m translate-z-0',\n  popover:\n    'bg-[--w-s-color-surface-elevated-300] border-[--w-s-color-surface-elevated-300] s-text rounded-8 p-16 drop-shadow-m translate-z-0',\n\n  arrowBase: 'absolute h-[14px] w-[14px] border-2 border-b-0 border-r-0 rounded-tl-4 transform',\n  arrowDirectionLeftStart: '-left-[8px]',\n  arrowDirectionLeft: '-left-[8px]',\n  arrowDirectionLeftEnd: '-left-[8px]',\n  arrowDirectionRightStart: '-right-[8px]',\n  arrowDirectionRight: '-right-[8px]',\n  arrowDirectionRightEnd: '-right-[8px]',\n  arrowDirectionBottomStart: '-bottom-[8px]',\n  arrowDirectionBottom: '-bottom-[8px]',\n  arrowDirectionBottomEnd: '-bottom-[8px]',\n  arrowDirectionTopStart: '-top-[8px]',\n  arrowDirectionTop: '-top-[8px]',\n  arrowDirectionTopEnd: '-top-[8px]',\n  arrowTooltip: 's-bg-inverted border-[--w-s-color-background-inverted]',\n  arrowCallout: 'bg-[--w-color-callout-background] border-[--w-color-callout-border]',\n  arrowPopover: 'bg-[--w-s-color-surface-elevated-300] border-[--w-s-color-surface-elevated-300]',\n  arrowHighlight: 'bg-[--w-color-callout-background] border-[--w-color-callout-border]',\n\n  content: 'last-child:mb-0',\n  notCallout: 'absolute z-50',\n  closeBtn: `${buttonTextSizes.medium} ${buttonTypes.pill} ${buttonColors.pill} justify-self-end -mr-8 ml-8`,\n};\n\nexport const pagination = {\n  link: 'hover:no-underline focus:no-underline focusable inline-flex justify-center items-center transition-colors ease-in-out min-h-[44px] min-w-[44px] p-4 rounded-full border-0 hover:bg-clip-padding',\n  currentPage: 'block md:hidden p-8 font-bold',\n  icon: 's-icon hover:bg-[--w-color-button-pill-background-hover] active:bg-[--w-color-button-pill-background-active]',\n  containerNav: 'flex items-center justify-center p-8',\n  a11y: 'sr-only',\n  pages: 'hidden md:block s-text-link',\n  active: 's-bg-primary s-text-inverted',\n  notActive: 'hover:bg-[--w-color-button-pill-background-hover] active:bg-[--w-color-button-pill-background-active]',\n};\n\n// remove these in v3\nexport const backwardsCompatibleClasses = {\n  removedActiveTrack: 'top-[19px]',\n};\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/search/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/search/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/search/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/search/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/search/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconSearch16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Magnifying glass`, id: 'icon.title.search', comment: 'Title for search icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-search-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" d=\"M8.905 12.102A6.042 6.042 0 1 0 4.18.981a6.042 6.042 0 0 0 4.726 11.121Zm1.909-1.289L15.5 15.5\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-search-16')) {\n  customElements.define('w-icon-search-16', IconSearch16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.search\\\":[\\\"Forst\u00F8rrelsesglass\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.search\\\":[\\\"Magnifying glass\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.search\\\":[\\\"Suurennuslasi\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.search\\\":[\\\"Forst\u00F8rrelsesglas\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.search\\\":[\\\"F\u00F6rstoringsglas\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { unraw } from 'unraw';\nimport { compileMessage } from '@lingui/message-utils/compileMessage';\n\nconst isString = (s) => typeof s === \"string\";\nconst isFunction = (f) => typeof f === \"function\";\n\nconst cache = /* @__PURE__ */ new Map();\nconst defaultLocale = \"en\";\nfunction normalizeLocales(locales) {\n  const out = Array.isArray(locales) ? locales : [locales];\n  return [...out, defaultLocale];\n}\nfunction date(locales, value, format) {\n  const _locales = normalizeLocales(locales);\n  if (!format) {\n    format = \"default\";\n  }\n  let o;\n  if (typeof format === \"string\") {\n    o = {\n      day: \"numeric\",\n      month: \"short\",\n      year: \"numeric\"\n    };\n    switch (format) {\n      case \"full\":\n        o.weekday = \"long\";\n      case \"long\":\n        o.month = \"long\";\n        break;\n      case \"short\":\n        o.month = \"numeric\";\n        break;\n    }\n  } else {\n    o = format;\n  }\n  const formatter = getMemoized(\n    () => cacheKey(\"date\", _locales, format),\n    () => new Intl.DateTimeFormat(_locales, o)\n  );\n  return formatter.format(isString(value) ? new Date(value) : value);\n}\nfunction time(locales, value, format) {\n  let o;\n  if (!format) {\n    format = \"default\";\n  }\n  if (typeof format === \"string\") {\n    o = {\n      second: \"numeric\",\n      minute: \"numeric\",\n      hour: \"numeric\"\n    };\n    switch (format) {\n      case \"full\":\n      case \"long\":\n        o.timeZoneName = \"short\";\n        break;\n      case \"short\":\n        delete o.second;\n    }\n  } else {\n    o = format;\n  }\n  return date(locales, value, o);\n}\nfunction number(locales, value, format) {\n  const _locales = normalizeLocales(locales);\n  const formatter = getMemoized(\n    () => cacheKey(\"number\", _locales, format),\n    () => new Intl.NumberFormat(_locales, format)\n  );\n  return formatter.format(value);\n}\nfunction plural(locales, ordinal, value, { offset = 0, ...rules }) {\n  const _locales = normalizeLocales(locales);\n  const plurals = ordinal ? getMemoized(\n    () => cacheKey(\"plural-ordinal\", _locales),\n    () => new Intl.PluralRules(_locales, { type: \"ordinal\" })\n  ) : getMemoized(\n    () => cacheKey(\"plural-cardinal\", _locales),\n    () => new Intl.PluralRules(_locales, { type: \"cardinal\" })\n  );\n  return rules[value] ?? rules[plurals.select(value - offset)] ?? rules.other;\n}\nfunction getMemoized(getKey, construct) {\n  const key = getKey();\n  let formatter = cache.get(key);\n  if (!formatter) {\n    formatter = construct();\n    cache.set(key, formatter);\n  }\n  return formatter;\n}\nfunction cacheKey(type, locales, options) {\n  const localeKey = locales.join(\"-\");\n  return `${type}-${localeKey}-${JSON.stringify(options)}`;\n}\n\nconst formats = {\n  __proto__: null,\n  date: date,\n  defaultLocale: defaultLocale,\n  number: number,\n  plural: plural,\n  time: time\n};\n\nconst UNICODE_REGEX = /\\\\u[a-fA-F0-9]{4}|\\\\x[a-fA-F0-9]{2}/;\nconst OCTOTHORPE_PH = \"%__lingui_octothorpe__%\";\nconst getDefaultFormats = (locale, passedLocales, formats = {}) => {\n  const locales = passedLocales || locale;\n  const style = (format) => {\n    if (typeof format === \"object\")\n      return format;\n    return formats[format];\n  };\n  const replaceOctothorpe = (value, message) => {\n    const numberFormat = Object.keys(formats).length ? style(\"number\") : void 0;\n    const valueStr = number(locales, value, numberFormat);\n    return message.replace(new RegExp(OCTOTHORPE_PH, \"g\"), valueStr);\n  };\n  return {\n    plural: (value, cases) => {\n      const { offset = 0 } = cases;\n      const message = plural(locales, false, value, cases);\n      return replaceOctothorpe(value - offset, message);\n    },\n    selectordinal: (value, cases) => {\n      const { offset = 0 } = cases;\n      const message = plural(locales, true, value, cases);\n      return replaceOctothorpe(value - offset, message);\n    },\n    select: selectFormatter,\n    number: (value, format) => number(\n      locales,\n      value,\n      style(format) || { style: format }\n    ),\n    date: (value, format) => date(locales, value, style(format) || format),\n    time: (value, format) => time(locales, value, style(format) || format)\n  };\n};\nconst selectFormatter = (value, rules) => rules[value] ?? rules.other;\nfunction interpolate(translation, locale, locales) {\n  return (values = {}, formats) => {\n    const formatters = getDefaultFormats(locale, locales, formats);\n    const formatMessage = (tokens, replaceOctothorpe = false) => {\n      if (!Array.isArray(tokens))\n        return tokens;\n      return tokens.reduce((message, token) => {\n        if (token === \"#\" && replaceOctothorpe) {\n          return message + OCTOTHORPE_PH;\n        }\n        if (isString(token)) {\n          return message + token;\n        }\n        const [name, type, format] = token;\n        let interpolatedFormat = {};\n        if (type === \"plural\" || type === \"selectordinal\" || type === \"select\") {\n          Object.entries(format).forEach(\n            ([key, value2]) => {\n              interpolatedFormat[key] = formatMessage(\n                value2,\n                type === \"plural\" || type === \"selectordinal\"\n              );\n            }\n          );\n        } else {\n          interpolatedFormat = format;\n        }\n        let value;\n        if (type) {\n          const formatter = formatters[type];\n          value = formatter(values[name], interpolatedFormat);\n        } else {\n          value = values[name];\n        }\n        if (value == null) {\n          return message;\n        }\n        return message + value;\n      }, \"\");\n    };\n    const result = formatMessage(translation);\n    if (isString(result) && UNICODE_REGEX.test(result)) {\n      return unraw(result);\n    }\n    if (isString(result))\n      return result;\n    return result ? String(result) : \"\";\n  };\n}\n\nvar __defProp$1 = Object.defineProperty;\nvar __defNormalProp$1 = (obj, key, value) => key in obj ? __defProp$1(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;\nvar __publicField$1 = (obj, key, value) => {\n  __defNormalProp$1(obj, typeof key !== \"symbol\" ? key + \"\" : key, value);\n  return value;\n};\nclass EventEmitter {\n  constructor() {\n    __publicField$1(this, \"_events\", {});\n  }\n  on(event, listener) {\n    var _a;\n    (_a = this._events)[event] ?? (_a[event] = []);\n    this._events[event].push(listener);\n    return () => this.removeListener(event, listener);\n  }\n  removeListener(event, listener) {\n    const maybeListeners = this._getListeners(event);\n    if (!maybeListeners)\n      return;\n    const index = maybeListeners.indexOf(listener);\n    if (~index)\n      maybeListeners.splice(index, 1);\n  }\n  emit(event, ...args) {\n    const maybeListeners = this._getListeners(event);\n    if (!maybeListeners)\n      return;\n    maybeListeners.map((listener) => listener.apply(this, args));\n  }\n  _getListeners(event) {\n    const maybeListeners = this._events[event];\n    return Array.isArray(maybeListeners) ? maybeListeners : false;\n  }\n}\n\nvar __defProp = Object.defineProperty;\nvar __defNormalProp = (obj, key, value) => key in obj ? __defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;\nvar __publicField = (obj, key, value) => {\n  __defNormalProp(obj, typeof key !== \"symbol\" ? key + \"\" : key, value);\n  return value;\n};\nclass I18n extends EventEmitter {\n  constructor(params) {\n    super();\n    __publicField(this, \"_locale\", \"\");\n    __publicField(this, \"_locales\");\n    __publicField(this, \"_localeData\", {});\n    __publicField(this, \"_messages\", {});\n    __publicField(this, \"_missing\");\n    __publicField(this, \"_messageCompiler\");\n    /**\n     * Alias for {@see I18n._}\n     */\n    __publicField(this, \"t\", this._.bind(this));\n    if (process.env.NODE_ENV !== \"production\") {\n      this.setMessagesCompiler(compileMessage);\n    }\n    if (params.missing != null)\n      this._missing = params.missing;\n    if (params.messages != null)\n      this.load(params.messages);\n    if (params.localeData != null)\n      this.loadLocaleData(params.localeData);\n    if (typeof params.locale === \"string\" || params.locales) {\n      this.activate(params.locale ?? defaultLocale, params.locales);\n    }\n  }\n  get locale() {\n    return this._locale;\n  }\n  get locales() {\n    return this._locales;\n  }\n  get messages() {\n    return this._messages[this._locale] ?? {};\n  }\n  /**\n   * @deprecated this has no effect. Please remove this from the code. Deprecated in v4\n   */\n  get localeData() {\n    return this._localeData[this._locale] ?? {};\n  }\n  _loadLocaleData(locale, localeData) {\n    const maybeLocaleData = this._localeData[locale];\n    if (!maybeLocaleData) {\n      this._localeData[locale] = localeData;\n    } else {\n      Object.assign(maybeLocaleData, localeData);\n    }\n  }\n  /**\n   * Registers a `MessageCompiler` to enable the use of uncompiled catalogs at runtime.\n   *\n   * In production builds, the `MessageCompiler` is typically excluded to reduce bundle size.\n   * By default, message catalogs should be precompiled during the build process. However,\n   * if you need to compile catalogs at runtime, you can use this method to set a message compiler.\n   *\n   * Example usage:\n   *\n   * ```ts\n   * import { compileMessage } from \"@lingui/message-utils/compileMessage\";\n   *\n   * i18n.setMessagesCompiler(compileMessage);\n   * ```\n   */\n  setMessagesCompiler(compiler) {\n    this._messageCompiler = compiler;\n    return this;\n  }\n  /**\n   * @deprecated Plurals automatically used from Intl.PluralRules you can safely remove this call. Deprecated in v4\n   */\n  loadLocaleData(localeOrAllData, localeData) {\n    if (typeof localeOrAllData === \"string\") {\n      this._loadLocaleData(localeOrAllData, localeData);\n    } else {\n      Object.keys(localeOrAllData).forEach(\n        (locale) => this._loadLocaleData(locale, localeOrAllData[locale])\n      );\n    }\n    this.emit(\"change\");\n  }\n  _load(locale, messages) {\n    const maybeMessages = this._messages[locale];\n    if (!maybeMessages) {\n      this._messages[locale] = messages;\n    } else {\n      Object.assign(maybeMessages, messages);\n    }\n  }\n  load(localeOrMessages, messages) {\n    if (typeof localeOrMessages == \"string\" && typeof messages === \"object\") {\n      this._load(localeOrMessages, messages);\n    } else {\n      Object.entries(localeOrMessages).forEach(\n        ([locale, messages2]) => this._load(locale, messages2)\n      );\n    }\n    this.emit(\"change\");\n  }\n  /**\n   * @param options {@link LoadAndActivateOptions}\n   */\n  loadAndActivate({ locale, locales, messages }) {\n    this._locale = locale;\n    this._locales = locales || void 0;\n    this._messages[this._locale] = messages;\n    this.emit(\"change\");\n  }\n  activate(locale, locales) {\n    if (process.env.NODE_ENV !== \"production\") {\n      if (!this._messages[locale]) {\n        console.warn(`Messages for locale \"${locale}\" not loaded.`);\n      }\n    }\n    this._locale = locale;\n    this._locales = locales;\n    this.emit(\"change\");\n  }\n  _(id, values, options) {\n    if (!this.locale) {\n      throw new Error(\n        \"Lingui: Attempted to call a translation function without setting a locale.\\nMake sure to call `i18n.activate(locale)` before using Lingui functions.\\nThis issue may also occur due to a race condition in your initialization logic.\"\n      );\n    }\n    let message = options?.message;\n    if (!id) {\n      id = \"\";\n    }\n    if (!isString(id)) {\n      values = id.values || values;\n      message = id.message;\n      id = id.id;\n    }\n    const messageForId = this.messages[id];\n    const messageMissing = messageForId === void 0;\n    const missing = this._missing;\n    if (missing && messageMissing) {\n      return isFunction(missing) ? missing(this._locale, id) : missing;\n    }\n    if (messageMissing) {\n      this.emit(\"missing\", { id, locale: this._locale });\n    }\n    let translation = messageForId || message || id;\n    if (isString(translation)) {\n      if (this._messageCompiler) {\n        translation = this._messageCompiler(translation);\n      } else {\n        console.warn(`Uncompiled message detected! Message:\n\n> ${translation}\n\nThat means you use raw catalog or your catalog doesn't have a translation for the message and fallback was used.\nICU features such as interpolation and plurals will not work properly for that message. \n\nPlease compile your catalog first. \n`);\n      }\n    }\n    if (isString(translation) && UNICODE_REGEX.test(translation))\n      return JSON.parse(`\"${translation}\"`);\n    if (isString(translation))\n      return translation;\n    return interpolate(\n      translation,\n      this._locale,\n      this._locales\n    )(values, options?.formats);\n  }\n  date(value, format) {\n    return date(this._locales || this._locale, value, format);\n  }\n  number(value, format) {\n    return number(this._locales || this._locale, value, format);\n  }\n}\nfunction setupI18n(params = {}) {\n  return new I18n(params);\n}\n\nconst i18n = setupI18n();\n\nexport { I18n, formats, i18n, setupI18n };\n", "import { parse } from '@messageformat/parser';\n\n/**\n * Parent class for errors.\n *\n * @remarks\n * Errors with `type: \"warning\"` do not necessarily indicate that the parser\n * encountered an error. In addition to a human-friendly `message`, may also\n * includes the `token` at which the error was encountered.\n *\n * @public\n */\nclass DateFormatError extends Error {\n    /** @internal */\n    constructor(msg, token, type) {\n        super(msg);\n        this.token = token;\n        this.type = type || 'error';\n    }\n}\nconst alpha = (width) => width < 4 ? 'short' : width === 4 ? 'long' : 'narrow';\nconst numeric = (width) => (width % 2 === 0 ? '2-digit' : 'numeric');\nfunction yearOptions(token, onError) {\n    switch (token.char) {\n        case 'y':\n            return { year: numeric(token.width) };\n        case 'r':\n            return { calendar: 'gregory', year: 'numeric' };\n        case 'u':\n        case 'U':\n        case 'Y':\n        default:\n            onError(`${token.desc} is not supported; falling back to year:numeric`, DateFormatError.WARNING);\n            return { year: 'numeric' };\n    }\n}\nfunction monthStyle(token, onError) {\n    switch (token.width) {\n        case 1:\n            return 'numeric';\n        case 2:\n            return '2-digit';\n        case 3:\n            return 'short';\n        case 4:\n            return 'long';\n        case 5:\n            return 'narrow';\n        default:\n            onError(`${token.desc} is not supported with width ${token.width}`);\n            return undefined;\n    }\n}\nfunction dayStyle(token, onError) {\n    const { char, desc, width } = token;\n    if (char === 'd') {\n        return numeric(width);\n    }\n    else {\n        onError(`${desc} is not supported`);\n        return undefined;\n    }\n}\nfunction weekdayStyle(token, onError) {\n    const { char, desc, width } = token;\n    if ((char === 'c' || char === 'e') && width < 3) {\n        // ignoring stand-alone-ness\n        const msg = `Numeric value is not supported for ${desc}; falling back to weekday:short`;\n        onError(msg, DateFormatError.WARNING);\n    }\n    // merging narrow styles\n    return alpha(width);\n}\nfunction hourOptions(token) {\n    const hour = numeric(token.width);\n    let hourCycle;\n    switch (token.char) {\n        case 'h':\n            hourCycle = 'h12';\n            break;\n        case 'H':\n            hourCycle = 'h23';\n            break;\n        case 'k':\n            hourCycle = 'h24';\n            break;\n        case 'K':\n            hourCycle = 'h11';\n            break;\n    }\n    return hourCycle ? { hour, hourCycle } : { hour };\n}\nfunction timeZoneNameStyle(token, onError) {\n    // so much fallback behaviour here\n    const { char, desc, width } = token;\n    switch (char) {\n        case 'v':\n        case 'z':\n            return width === 4 ? 'long' : 'short';\n        case 'V':\n            if (width === 4)\n                return 'long';\n            onError(`${desc} is not supported with width ${width}`);\n            return undefined;\n        case 'X':\n            onError(`${desc} is not supported`);\n            return undefined;\n    }\n    return 'short';\n}\nfunction compileOptions(token, onError) {\n    switch (token.field) {\n        case 'era':\n            return { era: alpha(token.width) };\n        case 'year':\n            return yearOptions(token, onError);\n        case 'month':\n            return { month: monthStyle(token, onError) };\n        case 'day':\n            return { day: dayStyle(token, onError) };\n        case 'weekday':\n            return { weekday: weekdayStyle(token, onError) };\n        case 'period':\n            return undefined;\n        case 'hour':\n            return hourOptions(token);\n        case 'min':\n            return { minute: numeric(token.width) };\n        case 'sec':\n            return { second: numeric(token.width) };\n        case 'tz':\n            return { timeZoneName: timeZoneNameStyle(token, onError) };\n        case 'quarter':\n        case 'week':\n        case 'sec-frac':\n        case 'ms':\n            onError(`${token.desc} is not supported`);\n    }\n    return undefined;\n}\nfunction getDateFormatOptions(tokens, timeZone, onError = error => {\n    throw error;\n}) {\n    const options = {\n        timeZone\n    };\n    const fields = [];\n    for (const token of tokens) {\n        const { error, field, str } = token;\n        if (error) {\n            const dte = new DateFormatError(error.message, token);\n            dte.stack = error.stack;\n            onError(dte);\n        }\n        if (str) {\n            const msg = `Ignoring string part: ${str}`;\n            onError(new DateFormatError(msg, token, DateFormatError.WARNING));\n        }\n        if (field) {\n            if (fields.indexOf(field) === -1)\n                fields.push(field);\n            else\n                onError(new DateFormatError(`Duplicate ${field} token`, token));\n        }\n        const opt = compileOptions(token, (msg, isWarning) => onError(new DateFormatError(msg, token, isWarning)));\n        if (opt)\n            Object.assign(options, opt);\n    }\n    return options;\n}\n\nconst fields = {\n    G: { field: 'era', desc: 'Era' },\n    y: { field: 'year', desc: 'Year' },\n    Y: { field: 'year', desc: 'Year of \"Week of Year\"' },\n    u: { field: 'year', desc: 'Extended year' },\n    U: { field: 'year', desc: 'Cyclic year name' },\n    r: { field: 'year', desc: 'Related Gregorian year' },\n    Q: { field: 'quarter', desc: 'Quarter' },\n    q: { field: 'quarter', desc: 'Stand-alone quarter' },\n    M: { field: 'month', desc: 'Month in year' },\n    L: { field: 'month', desc: 'Stand-alone month in year' },\n    w: { field: 'week', desc: 'Week of year' },\n    W: { field: 'week', desc: 'Week of month' },\n    d: { field: 'day', desc: 'Day in month' },\n    D: { field: 'day', desc: 'Day of year' },\n    F: { field: 'day', desc: 'Day of week in month' },\n    g: { field: 'day', desc: 'Modified julian day' },\n    E: { field: 'weekday', desc: 'Day of week' },\n    e: { field: 'weekday', desc: 'Local day of week' },\n    c: { field: 'weekday', desc: 'Stand-alone local day of week' },\n    a: { field: 'period', desc: 'AM/PM marker' },\n    b: { field: 'period', desc: 'AM/PM/noon/midnight marker' },\n    B: { field: 'period', desc: 'Flexible day period' },\n    h: { field: 'hour', desc: 'Hour in AM/PM (1~12)' },\n    H: { field: 'hour', desc: 'Hour in day (0~23)' },\n    k: { field: 'hour', desc: 'Hour in day (1~24)' },\n    K: { field: 'hour', desc: 'Hour in AM/PM (0~11)' },\n    j: { field: 'hour', desc: 'Hour in preferred cycle' },\n    J: { field: 'hour', desc: 'Hour in preferred cycle without marker' },\n    C: { field: 'hour', desc: 'Hour in preferred cycle with flexible marker' },\n    m: { field: 'min', desc: 'Minute in hour' },\n    s: { field: 'sec', desc: 'Second in minute' },\n    S: { field: 'sec-frac', desc: 'Fractional second' },\n    A: { field: 'ms', desc: 'Milliseconds in day' },\n    z: { field: 'tz', desc: 'Time Zone: specific non-location' },\n    Z: { field: 'tz', desc: 'Time Zone' },\n    O: { field: 'tz', desc: 'Time Zone: localized' },\n    v: { field: 'tz', desc: 'Time Zone: generic non-location' },\n    V: { field: 'tz', desc: 'Time Zone: ID' },\n    X: { field: 'tz', desc: 'Time Zone: ISO8601 with Z' },\n    x: { field: 'tz', desc: 'Time Zone: ISO8601' }\n};\nconst isLetter = (char) => (char >= 'A' && char <= 'Z') || (char >= 'a' && char <= 'z');\nfunction readFieldToken(src, pos) {\n    const char = src[pos];\n    let width = 1;\n    while (src[++pos] === char)\n        ++width;\n    const field = fields[char];\n    if (!field) {\n        const msg = `The letter ${char} is not a valid field identifier`;\n        return { char, error: new Error(msg), width };\n    }\n    return { char, field: field.field, desc: field.desc, width };\n}\nfunction readQuotedToken(src, pos) {\n    let str = src[++pos];\n    let width = 2;\n    if (str === \"'\")\n        return { char: \"'\", str, width };\n    while (true) {\n        const next = src[++pos];\n        ++width;\n        if (next === undefined) {\n            const msg = `Unterminated quoted literal in pattern: ${str || src}`;\n            return { char: \"'\", error: new Error(msg), str, width };\n        }\n        else if (next === \"'\") {\n            if (src[++pos] !== \"'\")\n                return { char: \"'\", str, width };\n            else\n                ++width;\n        }\n        str += next;\n    }\n}\nfunction readToken(src, pos) {\n    const char = src[pos];\n    if (!char)\n        return null;\n    if (isLetter(char))\n        return readFieldToken(src, pos);\n    if (char === \"'\")\n        return readQuotedToken(src, pos);\n    let str = char;\n    let width = 1;\n    while (true) {\n        const next = src[++pos];\n        if (!next || isLetter(next) || next === \"'\")\n            return { char, str, width };\n        str += next;\n        width += 1;\n    }\n}\n/**\n * Parse an {@link http://userguide.icu-project.org/formatparse/datetime | ICU\n * DateFormat skeleton} string into a {@link DateToken} array.\n *\n * @remarks\n * Errors will not be thrown, but if encountered are included as the relevant\n * token's `error` value.\n *\n * @public\n * @param src - The skeleton string\n *\n * @example\n * ```js\n * import { parseDateTokens } from '@messageformat/date-skeleton'\n *\n * parseDateTokens('GrMMMdd', console.error)\n * // [\n * //   { char: 'G', field: 'era', desc: 'Era', width: 1 },\n * //   { char: 'r', field: 'year', desc: 'Related Gregorian year', width: 1 },\n * //   { char: 'M', field: 'month', desc: 'Month in year', width: 3 },\n * //   { char: 'd', field: 'day', desc: 'Day in month', width: 2 }\n * // ]\n * ```\n */\nfunction parseDateTokens(src) {\n    const tokens = [];\n    let pos = 0;\n    while (true) {\n        const token = readToken(src, pos);\n        if (!token)\n            return tokens;\n        tokens.push(token);\n        pos += token.width;\n    }\n}\n\nfunction processTokens(tokens, mapText) {\n  if (!tokens.filter((token) => token.type !== \"content\").length) {\n    return tokens.map((token) => mapText(token.value));\n  }\n  return tokens.map((token) => {\n    if (token.type === \"content\") {\n      return mapText(token.value);\n    } else if (token.type === \"octothorpe\") {\n      return \"#\";\n    } else if (token.type === \"argument\") {\n      return [token.arg];\n    } else if (token.type === \"function\") {\n      const _param = token?.param?.[0];\n      if (token.key === \"date\" && _param) {\n        const opts = compileDateExpression(_param.value.trim(), (e) => {\n          throw new Error(`Unable to compile date expression: ${e.message}`);\n        });\n        return [token.arg, token.key, opts];\n      }\n      if (_param) {\n        return [token.arg, token.key, _param.value.trim()];\n      } else {\n        return [token.arg, token.key];\n      }\n    }\n    const offset = token.pluralOffset;\n    const formatProps = {};\n    token.cases.forEach(({ key, tokens: tokens2 }) => {\n      const prop = key[0] === \"=\" ? key.slice(1) : key;\n      formatProps[prop] = processTokens(tokens2, mapText);\n    });\n    return [\n      token.arg,\n      token.type,\n      {\n        offset,\n        ...formatProps\n      }\n    ];\n  });\n}\nfunction compileDateExpression(format, onError) {\n  if (/^::/.test(format)) {\n    const tokens = parseDateTokens(format.substring(2));\n    return getDateFormatOptions(tokens, void 0, onError);\n  }\n  return format;\n}\nfunction compileMessage(message, mapText = (v) => v) {\n  try {\n    return processTokens(parse(message), mapText);\n  } catch (e) {\n    console.error(`${e.message} \n\nMessage: ${message}`);\n    return [message];\n  }\n}\n\nexport { compileMessage };\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/close/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/close/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/close/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/close/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/close/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconClose16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Cross`, id: 'icon.title.close', comment: 'Title for close icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-close-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" stroke-width=\"1.5\" d=\"m12.5 3.5-9 9m0-9 9 9\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-close-16')) {\n  customElements.define('w-icon-close-16', IconClose16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.close\\\":[\\\"Kryss\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.close\\\":[\\\"Cross\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.close\\\":[\\\"Rasti\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.close\\\":[\\\"Kryds\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.close\\\":[\\\"Kryss\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { classMap } from 'lit/directives/class-map.js';\n\nconst camelCaseToKebabCase = (str) => str.replace(/([a-z0-9])([A-Z])/g, '$1-$2').toLowerCase();\n\n// Source: https://medium.com/@dayton-bobbitt/generating-attributes-for-litelement-properties-f972ef658137\nexport function kebabCaseAttributes(constructor) {\n  return class extends constructor {\n    static createProperty(name, options) {\n      let customOptions = options;\n\n      // derive the attribute name if not already defined or disabled\n      if (typeof options?.attribute === 'undefined' || options?.attribute === true) {\n        customOptions = Object.assign({}, options, {\n          attribute: camelCaseToKebabCase(name.toString()),\n        });\n      }\n\n      super.createProperty(name, customOptions);\n    }\n  };\n}\n\nexport function classes(defn) {\n  const classes = [];\n  for (const [key, value] of Object.entries(defn)) {\n    if (value) classes.push(key);\n  }\n  return classes.join(' ');\n}\n\nexport function fclasses(definition) {\n  const defn = {};\n  for (const [key, value] of Object.entries(definition)) {\n    for (const className of key.split(' ')) {\n      defn[className] = value;\n    }\n  }\n  return classMap(defn);\n}\n\nexport function generateRandomId() {\n  return `m${Math.random().toString(36).slice(2)}`;\n}\n", "import { css, html } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { alert as ccAlert } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\nimport '@warp-ds/icons/elements/info-16';\nimport '@warp-ds/icons/elements/warning-16';\nimport '@warp-ds/icons/elements/error-16';\nimport '@warp-ds/icons/elements/success-16';\n\nconst variants = {\n  negative: 'negative',\n  positive: 'positive',\n  warning: 'warning',\n  info: 'info',\n};\n\nclass WarpAlert extends WarpElement {\n  static properties = {\n    variant: { type: String, reflect: true },\n    show: { type: Boolean, reflect: true },\n    role: { type: String, reflect: true },\n  };\n\n  constructor() {\n    super();\n    this.show = false;\n    this.role = 'alert';\n  }\n\n  connectedCallback() {\n    super.connectedCallback();\n    if (!this.variant || !variants[this.variant]) {\n      throw new Error('Invalid \"variant\" attribute. Set its value to one of the following:\\nnegative, positive, warning, info.');\n    }\n  }\n\n  get _wrapperClasses() {\n    return classNames([ccAlert.wrapper, ccAlert[this.variant]]);\n  }\n\n  get _iconClasses() {\n    const activeIconClassNames = ccAlert[`${this.variant}Icon`];\n\n    return classNames([ccAlert.icon, activeIconClassNames]);\n  }\n\n  // Slotted elements remain in lightDOM which allows for control of their style outside of shadowDOM.\n  // ::slotted([Simple Selector]) confirms to Specificity rules, but (being simple) does not add weight to lightDOM skin selectors,\n  // so never gets higher Specificity. Thus in order to overwrite style linked within shadowDOM, we need to use !important.\n  // https://stackoverflow.com/a/61631668\n  static styles = [\n    WarpElement.styles,\n    css`\n      :host {\n        display: block;\n      }\n      ::slotted(:first-child) {\n        margin-top: 0px;\n      }\n      ::slotted(:last-child) {\n        margin-bottom: 0px !important;\n      }\n    `,\n  ];\n\n  get _icon() {\n    if (this.variant === variants.info) {\n      return html`<w-icon-info-16></w-icon-info-16>`;\n    }\n    if (this.variant === variants.warning) {\n      return html`<w-icon-warning-16></w-icon-warning-16>`;\n    }\n    if (this.variant === variants.negative) {\n      return html`<w-icon-error-16></w-icon-error-16>`;\n    }\n    if (this.variant === variants.positive) {\n      return html`<w-icon-success-16></w-icon-success-16>`;\n    } else return '';\n  }\n\n  render() {\n    return html`\n      <w-expand-transition ?show=${this.show}>\n        <div role=${this.role} class=${this._wrapperClasses}>\n          <div class=${this._iconClasses}>${this._icon}</div>\n          <div class=${ccAlert.textWrapper}>\n            <slot></slot>\n          </div>\n        </div>\n      </w-expand-transition>\n    `;\n  }\n}\n\nif (!customElements.get('w-alert')) {\n  customElements.define('w-alert', WarpAlert);\n}\n\nexport { WarpAlert };\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/info/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/info/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/info/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/info/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/info/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconInfo16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Information circle`, id: 'icon.title.info', comment: 'Title for info icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-info-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-miterlimit=\"10\" d=\"M8 6.5v5\"></path><path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" d=\"M8 4v.5\"></path><path stroke=\"currentColor\" stroke-miterlimit=\"10\" d=\"M8 .5a7.5 7.5 0 1 1 0 15 7.5 7.5 0 0 1 0-15Z\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-info-16')) {\n  customElements.define('w-icon-info-16', IconInfo16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.info\\\":[\\\"Informasjonssirkel\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.info\\\":[\\\"Information circle\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.info\\\":[\\\"Ympyr\u00E4, jonka sis\u00E4ll\u00E4 on i-kirjain\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.info\\\":[\\\"Informationscirkel\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.info\\\":[\\\"Informationscirkel\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/warning/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/warning/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/warning/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/warning/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/warning/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconWarning16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Warning triangle with exclamation point`, id: 'icon.title.warning', comment: 'Title for warning icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-warning-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" d=\"m.712 14.07 6.25-12.994a1 1 0 0 1 1.792-.022l6.635 12.995a1 1 0 0 1-.89 1.455H1.613a1 1 0 0 1-.902-1.434Z\"></path><path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" d=\"M8 6v4.992M8 13v.333\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-warning-16')) {\n  customElements.define('w-icon-warning-16', IconWarning16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.warning\\\":[\\\"Varseltrekant med utropstegn\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.warning\\\":[\\\"Warning triangle with exclamation point\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.warning\\\":[\\\"Varoituskolmio, jonka sis\u00E4ll\u00E4 on huutomerkki\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.warning\\\":[\\\"Advarselstrekant med et udr\u00E5bstegn\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.warning\\\":[\\\"Varningstriangel med utropstecken\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/error/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/error/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/error/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/error/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/error/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconError16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Octagon with exclamation point`, id: 'icon.title.error', comment: 'Title for error icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-error-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" d=\"M.5 11.107 4.748 15.5h6.503l4.248-4.393V4.893L11.252.5H4.748L.5 4.893z\"></path><path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" d=\"M8 11.398a.25.25 0 1 1 0-.5m0 .5a.25.25 0 1 0 0-.5\"></path><path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" stroke-miterlimit=\"10\" d=\"M8 8.5V3\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-error-16')) {\n  customElements.define('w-icon-error-16', IconError16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.error\\\":[\\\"\u00C5ttekant med utropstegn\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.error\\\":[\\\"Octagon with exclamation point\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.error\\\":[\\\"Kahdeksankulmio, jonka sis\u00E4ll\u00E4 on huutomerkki\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.error\\\":[\\\"Ottekant med et udr\u00E5bstegn\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.error\\\":[\\\"Oktagon med utropstecken\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/success/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/success/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/success/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/success/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/success/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconSuccess16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Circle with checkmark`, id: 'icon.title.success', comment: 'Title for success icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-success-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" d=\"m4 8.815 1.633 2.318a.7.7 0 0 0 1.138.034l5.228-6.615\"></path><path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" d=\"M.5 7.999a7.5 7.5 0 1 0 15 0 7.5 7.5 0 0 0-15 0\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-success-16')) {\n  customElements.define('w-icon-success-16', IconSuccess16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.success\\\":[\\\"Sirkel med sjekkmerke\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.success\\\":[\\\"Circle with checkmark\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.success\\\":[\\\"Ympyr\u00E4, jonka sis\u00E4ll\u00E4 on valintamerkki\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.success\\\":[\\\"Cirkel med et flueben\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.success\\\":[\\\"Cirkel med bock\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { css, html, nothing } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { i18n } from '@lingui/core';\nimport { opposites, directions, arrowDirectionClassname, useRecompute as recompute } from '@warp-ds/core/attention';\nimport { attention as ccAttention } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\nimport { ifDefined } from 'lit/directives/if-defined.js';\n\nimport { activateI18n } from '../i18n';\nimport { kebabCaseAttributes, generateRandomId } from '../utils';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\n\nimport '@warp-ds/icons/elements/close-16';\n\nclass WarpAttention extends kebabCaseAttributes(WarpElement) {\n  static properties = {\n    // Whether Attention element should be visible.\n    show: { type: Boolean, reflect: true },\n    // Placement according to the target element\n    // Arrow would be on the opposite side of this position\n    placement: { type: String, reflect: true },\n    // Whether Attention element is rendered as a tooltip\n    tooltip: { type: Boolean, reflect: true },\n    // Whether Attention element is rendered as an inline callout\n    callout: { type: Boolean, reflect: true },\n    // Whether Attention element is rendered as a popover\n    popover: { type: Boolean, reflect: true },\n    // Whether Attention element is rendered as a highlight\n    highlight: { type: Boolean, reflect: true },\n    // Render Attention element with a close button\n    canClose: { type: Boolean, reflect: true },\n    // Render Attention element without an arrow\n    noArrow: { type: Boolean, reflect: true },\n    // Distance from which to offset the attentionEl from the targetEl vertically\n    distance: { type: Number, reflect: true },\n    // Distance from which to offset the attentionEl along its targetEl horizontally\n    skidding: { type: Number, reflect: true },\n    // Whether Attention element should flip its placement in order to keep it in view\n    flip: { type: Boolean, reflect: true },\n    // Whether Attention element should ignore cross axis overflow when flip is enabled\n    crossAxis: { type: Boolean, reflect: true },\n    // Choose which preferred placements the Attention element should flip to\n    fallbackPlacements: { type: Array, reflect: true },\n  };\n\n  static styles = [\n    WarpElement.styles,\n    css`\n      #attention {\n        position: absolute;\n        z-index: 50;\n        visibility: var(--attention-visibility);\n        display: var(--attention-display);\n      }\n\n      :host([popover]:not(:popover-open):not(dialog[open])) {\n        display: contents;\n      }\n    `,\n  ];\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n    this.handleDone = this.handleDone.bind(this);\n\n    this.show = false;\n    this.placement = 'bottom';\n    this.tooltip = false;\n    this.callout = false;\n    this.popover = false;\n    this.highlight = false;\n    this.canClose = false;\n    this.noArrow = false;\n    this.distance = 8;\n    this.skidding = 0;\n    this.flip = false;\n    this.crossAxis = false;\n    this._initialPlacement = this.placement;\n    this._actualDirection = this.placement;\n  }\n\n  connectedCallback() {\n    super.connectedCallback();\n    if (this.placement && !Object.keys(opposites).includes(this.placement)) {\n      throw new Error(`Invalid \"placement\" attribute. Set its value to one of the following:\\n${JSON.stringify(Object.keys(opposites))}`);\n    }\n\n    if (this.fallbackPlacements && !this.fallbackPlacements.every((fallbackPlacement) => directions.includes(fallbackPlacement))) {\n      throw new Error(\n        `Invalid \"fallbackPlacements\" attribute. Set its value to an array with one or more of the following:\\n${JSON.stringify(directions)}`,\n      );\n    }\n\n    // Fix FOUC effect issues\n    setTimeout(() => {\n      this.requestUpdate();\n      this.handleDone(); // Run handleDone initially, to compute correct arrow position etc. directly.\n    }, 0);\n\n    if (!this.callout) {\n      window.addEventListener('click', this.handleDone);\n      window.addEventListener('scroll', this.handleDone);\n      window.addEventListener('resize', this.handleDone);\n      window.addEventListener('touch', this.handleDone);\n    }\n\n    if (this.tooltip) {\n      window.addEventListener('mouseover', this.handleDone);\n      window.addEventListener('mouseout', this.handleDone);\n    }\n  }\n\n  disconnectedCallback() {\n    window.removeEventListener('click', this.handleDone);\n    window.removeEventListener('scroll', this.handleDone);\n    window.removeEventListener('resize', this.handleDone);\n    window.removeEventListener('touch', this.handleDone);\n    window.removeEventListener('mouseover', this.handleDone);\n    window.removeEventListener('mouseout', this.handleDone);\n\n    super.disconnectedCallback();\n  }\n\n  handleDone() {\n    window.requestAnimationFrame(() => {\n      if (this.show && this._targetEl && this._attentionEl) {\n        recompute(this.attentionState).then((state) => {\n          this._actualDirection = state?.actualDirection;\n        });\n      } else {\n        this._actualDirection = this._initialPlacement;\n      }\n    });\n  }\n\n  get _actualDirection() {\n    return this.placement;\n  }\n\n  set _actualDirection(v) {\n    this.placement = v;\n  }\n\n  get _arrowEl() {\n    return this.renderRoot.querySelector('#arrow');\n  }\n\n  get _arrowDirection() {\n    return opposites[this._actualDirection];\n  }\n\n  get _arrowClasses() {\n    return classNames([\n      ccAttention.arrowBase,\n      this._activeVariantClasses.arrow,\n      ccAttention[`arrowDirection${arrowDirectionClassname(this._arrowDirection)}`],\n    ]);\n  }\n\n  get _arrowHtml() {\n    return this.noArrow ? '' : html`<div id=\"arrow\" class=\"${this._arrowClasses}\"></div>`;\n  }\n\n  get _activeVariantClasses() {\n    const variantProps = {\n      callout: this.callout,\n      popover: this.popover,\n      tooltip: this.tooltip,\n      highlight: this.highlight,\n    };\n\n    const activeVariant = Object.keys(variantProps).find((b) => !!variantProps[b]) || '';\n\n    return {\n      wrapper: ccAttention[activeVariant],\n      arrow: ccAttention[`arrow${activeVariant.charAt(0).toUpperCase() + activeVariant.slice(1)}`],\n    };\n  }\n\n  get _attentionEl() {\n    return this.renderRoot.querySelector('#attention');\n  }\n\n  get _targetEl() {\n    const targetSlot = this.renderRoot?.querySelector(\"slot[name='target']\");\n    return targetSlot ? targetSlot.assignedNodes()[0] : null;\n  }\n\n  get _messageEl() {\n    const messageSlot = this.renderRoot.querySelector(\"slot[name='message']\");\n    return messageSlot ? messageSlot.assignedNodes()[0] : null;\n  }\n\n  get _wrapperClasses() {\n    return classNames([ccAttention.base, this._activeVariantClasses.wrapper]);\n  }\n\n  get _ariaClose() {\n    return i18n._({\n      id: 'attention.aria.close',\n      message: 'Close',\n      comment: 'Aria label for the close button in attention',\n    });\n  }\n\n  get _closeBtnHtml() {\n    return html`\n      <button aria-label=\"${this._ariaClose}\" @click=\"${this.close}\" @keydown=${this.keypressed} class=\"${ccAttention.closeBtn}\">\n        <w-icon-close-16></w-icon-close-16>\n      </button>\n    `;\n  }\n\n  updated() {\n    if (!this.callout) {\n      this._attentionEl.style.setProperty('--attention-visibility', this.show ? '' : 'hidden');\n    }\n\n    if (!this.tooltip) {\n      this._attentionEl.style.setProperty('--attention-display', this.show ? 'flex' : 'none');\n    }\n\n    this.attentionState = {\n      isShowing: this.show,\n      isCallout: this.callout,\n      actualDirection: this._actualDirection,\n      directionName: this.placement,\n      arrowEl: this._arrowEl,\n      attentionEl: this._attentionEl,\n      targetEl: this._targetEl,\n      noArrow: this.noArrow,\n      distance: this.distance,\n      skidding: this.skidding,\n      flip: this.flip,\n      crossAxis: this.crossAxis,\n      fallbackPlacements: this.fallbackPlacements,\n    };\n\n    // We need to recompute here as well if this._actualDirection gets updated immediately when this.show is true (in this.handleDone()).\n    // Otherwise this._arrowDirection will get this._initialPlacement's value and will only be updated on next click/scroll/resize\n    recompute(this.attentionState);\n  }\n\n  pointingAtDirection() {\n    switch (opposites[this._actualDirection]) {\n      case 'top-start':\n      case 'top':\n      case 'top-end':\n        return i18n._({\n          id: 'attention.aria.pointingUp',\n          message: 'pointing up',\n          comment: 'Default screenreader message for top direction in the attention component',\n        });\n      case 'right-start':\n      case 'right':\n      case 'right-end':\n        return i18n._({\n          id: 'attention.aria.pointingRight',\n          message: 'pointing right',\n          comment: 'Default screenreader message for right direction in the attention component',\n        });\n      case 'bottom-start':\n      case 'bottom':\n      case 'bottom-end':\n        return i18n._({\n          id: 'attention.aria.pointingDown',\n          message: 'pointing down',\n          comment: 'Default screenreader message for bottom direction in the attention component',\n        });\n      case 'left-start':\n      case 'left':\n      case 'left-end':\n        return i18n._({\n          id: 'attention.aria.pointingLeft',\n          message: 'pointing left',\n          comment: 'Default screenreader message for left direction in the attention component',\n        });\n      default:\n        return '';\n    }\n  }\n\n  activeAttentionType() {\n    switch (true) {\n      case this.tooltip:\n        return i18n._({\n          id: 'attention.aria.tooltip',\n          message: 'tooltip',\n          comment: 'Default screenreader message for tooltip in the attention component',\n        });\n      case this.callout:\n        return i18n._({\n          id: 'attention.aria.callout',\n          message: 'callout speech bubble',\n          comment: 'Default screenreader message for callout speech bubble in the attention component',\n        });\n      case this.popover:\n        return i18n._({\n          id: 'attention.aria.popover',\n          message: 'popover speech bubble',\n          comment: 'Default screenreader message for popover speech bubble in the attention component',\n        });\n      case this.highlight:\n        return i18n._({\n          id: 'attention.aria.highlight',\n          message: 'highlighted speech bubble',\n          comment: 'Default screenreader message for highlighted speech bubble in the attention component',\n        });\n      default:\n        return '';\n    }\n  }\n\n  defaultAriaLabel() {\n    return `${this.activeAttentionType()} ${!this.noArrow ? this.pointingAtDirection() : ''}`;\n  }\n  setAriaLabels() {\n    if (this._targetEl && !this._targetEl.getAttribute('aria-details')) {\n      const attentionMessageId = this._messageEl.id || (this._messageEl.id = generateRandomId());\n      this._targetEl.setAttribute('aria-details', attentionMessageId);\n    }\n  }\n\n  firstUpdated() {\n    this._initialPlacement = this.placement;\n    this.setAriaLabels();\n\n    // Attention of \"callout\" type should always be used inline\n    if (this.callout) {\n      this._attentionEl.style.position = 'relative';\n    }\n  }\n\n  close() {\n    const event = new CustomEvent('close', {\n      bubbles: true,\n      composed: true,\n    });\n    this.updateComplete.then(() => this.dispatchEvent(event));\n  }\n\n  keypressed(e) {\n    if (!this.canClose) return;\n    if (e.key === 'Escape') {\n      e.preventDefault();\n      this.close();\n    }\n  }\n\n  render() {\n    if (!this.callout && this._targetEl === undefined) return html``;\n    return html`\n      <div class=${ifDefined(this.className ? this.className : undefined)}>\n        ${this.placement === 'right-start' ||\n        this.placement === 'right' ||\n        this.placement === 'right-end' ||\n        this.placement === 'bottom-start' ||\n        this.placement === 'bottom' ||\n        this.placement === 'bottom-end' // Attention's and its arrow's visual position should be reflected in the DOM\n          ? html`\n              <slot name=\"target\"></slot>\n\n              <div id=\"attention\" class=\"${this._wrapperClasses}\">\n                <div role=\"${this.tooltip ? 'tooltip' : 'img'}\" aria-label=\"${this.defaultAriaLabel()}\">${this._arrowHtml}</div>\n                <slot name=\"message\"></slot>\n                ${this.canClose ? this._closeBtnHtml : nothing}\n              </div>\n            `\n          : html`\n              <div id=\"attention\" class=\"${this._wrapperClasses}\">\n                <slot name=\"message\"></slot>\n                <div role=\"${this.tooltip ? 'tooltip' : 'img'}\" aria-label=\"${this.defaultAriaLabel()}\">${this._arrowHtml}</div>\n                ${this.canClose ? this._closeBtnHtml : nothing}\n              </div>\n              <slot name=\"target\"></slot>\n            `}\n      </div>\n    `;\n  }\n}\n\nif (!customElements.get('w-attention')) {\n  customElements.define('w-attention', WarpAttention);\n}\n\nexport { WarpAttention };\n", "/**\n * Custom positioning reference element.\n * @see https://floating-ui.com/docs/virtual-elements\n */\n\nconst sides = ['top', 'right', 'bottom', 'left'];\nconst alignments = ['start', 'end'];\nconst placements = /*#__PURE__*/sides.reduce((acc, side) => acc.concat(side, side + \"-\" + alignments[0], side + \"-\" + alignments[1]), []);\nconst min = Math.min;\nconst max = Math.max;\nconst round = Math.round;\nconst floor = Math.floor;\nconst createCoords = v => ({\n  x: v,\n  y: v\n});\nconst oppositeSideMap = {\n  left: 'right',\n  right: 'left',\n  bottom: 'top',\n  top: 'bottom'\n};\nconst oppositeAlignmentMap = {\n  start: 'end',\n  end: 'start'\n};\nfunction clamp(start, value, end) {\n  return max(start, min(value, end));\n}\nfunction evaluate(value, param) {\n  return typeof value === 'function' ? value(param) : value;\n}\nfunction getSide(placement) {\n  return placement.split('-')[0];\n}\nfunction getAlignment(placement) {\n  return placement.split('-')[1];\n}\nfunction getOppositeAxis(axis) {\n  return axis === 'x' ? 'y' : 'x';\n}\nfunction getAxisLength(axis) {\n  return axis === 'y' ? 'height' : 'width';\n}\nfunction getSideAxis(placement) {\n  return ['top', 'bottom'].includes(getSide(placement)) ? 'y' : 'x';\n}\nfunction getAlignmentAxis(placement) {\n  return getOppositeAxis(getSideAxis(placement));\n}\nfunction getAlignmentSides(placement, rects, rtl) {\n  if (rtl === void 0) {\n    rtl = false;\n  }\n  const alignment = getAlignment(placement);\n  const alignmentAxis = getAlignmentAxis(placement);\n  const length = getAxisLength(alignmentAxis);\n  let mainAlignmentSide = alignmentAxis === 'x' ? alignment === (rtl ? 'end' : 'start') ? 'right' : 'left' : alignment === 'start' ? 'bottom' : 'top';\n  if (rects.reference[length] > rects.floating[length]) {\n    mainAlignmentSide = getOppositePlacement(mainAlignmentSide);\n  }\n  return [mainAlignmentSide, getOppositePlacement(mainAlignmentSide)];\n}\nfunction getExpandedPlacements(placement) {\n  const oppositePlacement = getOppositePlacement(placement);\n  return [getOppositeAlignmentPlacement(placement), oppositePlacement, getOppositeAlignmentPlacement(oppositePlacement)];\n}\nfunction getOppositeAlignmentPlacement(placement) {\n  return placement.replace(/start|end/g, alignment => oppositeAlignmentMap[alignment]);\n}\nfunction getSideList(side, isStart, rtl) {\n  const lr = ['left', 'right'];\n  const rl = ['right', 'left'];\n  const tb = ['top', 'bottom'];\n  const bt = ['bottom', 'top'];\n  switch (side) {\n    case 'top':\n    case 'bottom':\n      if (rtl) return isStart ? rl : lr;\n      return isStart ? lr : rl;\n    case 'left':\n    case 'right':\n      return isStart ? tb : bt;\n    default:\n      return [];\n  }\n}\nfunction getOppositeAxisPlacements(placement, flipAlignment, direction, rtl) {\n  const alignment = getAlignment(placement);\n  let list = getSideList(getSide(placement), direction === 'start', rtl);\n  if (alignment) {\n    list = list.map(side => side + \"-\" + alignment);\n    if (flipAlignment) {\n      list = list.concat(list.map(getOppositeAlignmentPlacement));\n    }\n  }\n  return list;\n}\nfunction getOppositePlacement(placement) {\n  return placement.replace(/left|right|bottom|top/g, side => oppositeSideMap[side]);\n}\nfunction expandPaddingObject(padding) {\n  return {\n    top: 0,\n    right: 0,\n    bottom: 0,\n    left: 0,\n    ...padding\n  };\n}\nfunction getPaddingObject(padding) {\n  return typeof padding !== 'number' ? expandPaddingObject(padding) : {\n    top: padding,\n    right: padding,\n    bottom: padding,\n    left: padding\n  };\n}\nfunction rectToClientRect(rect) {\n  const {\n    x,\n    y,\n    width,\n    height\n  } = rect;\n  return {\n    width,\n    height,\n    top: y,\n    left: x,\n    right: x + width,\n    bottom: y + height,\n    x,\n    y\n  };\n}\n\nexport { alignments, clamp, createCoords, evaluate, expandPaddingObject, floor, getAlignment, getAlignmentAxis, getAlignmentSides, getAxisLength, getExpandedPlacements, getOppositeAlignmentPlacement, getOppositeAxis, getOppositeAxisPlacements, getOppositePlacement, getPaddingObject, getSide, getSideAxis, max, min, placements, rectToClientRect, round, sides };\n", "import { getSideAxis, getAlignmentAxis, getAxisLength, getSide, getAlignment, evaluate, getPaddingObject, rectToClientRect, min, clamp, placements, getAlignmentSides, getOppositeAlignmentPlacement, getOppositePlacement, getExpandedPlacements, getOppositeAxisPlacements, sides, max, getOppositeAxis } from '@floating-ui/utils';\nexport { rectToClientRect } from '@floating-ui/utils';\n\nfunction computeCoordsFromPlacement(_ref, placement, rtl) {\n  let {\n    reference,\n    floating\n  } = _ref;\n  const sideAxis = getSideAxis(placement);\n  const alignmentAxis = getAlignmentAxis(placement);\n  const alignLength = getAxisLength(alignmentAxis);\n  const side = getSide(placement);\n  const isVertical = sideAxis === 'y';\n  const commonX = reference.x + reference.width / 2 - floating.width / 2;\n  const commonY = reference.y + reference.height / 2 - floating.height / 2;\n  const commonAlign = reference[alignLength] / 2 - floating[alignLength] / 2;\n  let coords;\n  switch (side) {\n    case 'top':\n      coords = {\n        x: commonX,\n        y: reference.y - floating.height\n      };\n      break;\n    case 'bottom':\n      coords = {\n        x: commonX,\n        y: reference.y + reference.height\n      };\n      break;\n    case 'right':\n      coords = {\n        x: reference.x + reference.width,\n        y: commonY\n      };\n      break;\n    case 'left':\n      coords = {\n        x: reference.x - floating.width,\n        y: commonY\n      };\n      break;\n    default:\n      coords = {\n        x: reference.x,\n        y: reference.y\n      };\n  }\n  switch (getAlignment(placement)) {\n    case 'start':\n      coords[alignmentAxis] -= commonAlign * (rtl && isVertical ? -1 : 1);\n      break;\n    case 'end':\n      coords[alignmentAxis] += commonAlign * (rtl && isVertical ? -1 : 1);\n      break;\n  }\n  return coords;\n}\n\n/**\n * Computes the `x` and `y` coordinates that will place the floating element\n * next to a given reference element.\n *\n * This export does not have any `platform` interface logic. You will need to\n * write one for the platform you are using Floating UI with.\n */\nconst computePosition = async (reference, floating, config) => {\n  const {\n    placement = 'bottom',\n    strategy = 'absolute',\n    middleware = [],\n    platform\n  } = config;\n  const validMiddleware = middleware.filter(Boolean);\n  const rtl = await (platform.isRTL == null ? void 0 : platform.isRTL(floating));\n  let rects = await platform.getElementRects({\n    reference,\n    floating,\n    strategy\n  });\n  let {\n    x,\n    y\n  } = computeCoordsFromPlacement(rects, placement, rtl);\n  let statefulPlacement = placement;\n  let middlewareData = {};\n  let resetCount = 0;\n  for (let i = 0; i < validMiddleware.length; i++) {\n    const {\n      name,\n      fn\n    } = validMiddleware[i];\n    const {\n      x: nextX,\n      y: nextY,\n      data,\n      reset\n    } = await fn({\n      x,\n      y,\n      initialPlacement: placement,\n      placement: statefulPlacement,\n      strategy,\n      middlewareData,\n      rects,\n      platform,\n      elements: {\n        reference,\n        floating\n      }\n    });\n    x = nextX != null ? nextX : x;\n    y = nextY != null ? nextY : y;\n    middlewareData = {\n      ...middlewareData,\n      [name]: {\n        ...middlewareData[name],\n        ...data\n      }\n    };\n    if (reset && resetCount <= 50) {\n      resetCount++;\n      if (typeof reset === 'object') {\n        if (reset.placement) {\n          statefulPlacement = reset.placement;\n        }\n        if (reset.rects) {\n          rects = reset.rects === true ? await platform.getElementRects({\n            reference,\n            floating,\n            strategy\n          }) : reset.rects;\n        }\n        ({\n          x,\n          y\n        } = computeCoordsFromPlacement(rects, statefulPlacement, rtl));\n      }\n      i = -1;\n    }\n  }\n  return {\n    x,\n    y,\n    placement: statefulPlacement,\n    strategy,\n    middlewareData\n  };\n};\n\n/**\n * Resolves with an object of overflow side offsets that determine how much the\n * element is overflowing a given clipping boundary on each side.\n * - positive = overflowing the boundary by that number of pixels\n * - negative = how many pixels left before it will overflow\n * - 0 = lies flush with the boundary\n * @see https://floating-ui.com/docs/detectOverflow\n */\nasync function detectOverflow(state, options) {\n  var _await$platform$isEle;\n  if (options === void 0) {\n    options = {};\n  }\n  const {\n    x,\n    y,\n    platform,\n    rects,\n    elements,\n    strategy\n  } = state;\n  const {\n    boundary = 'clippingAncestors',\n    rootBoundary = 'viewport',\n    elementContext = 'floating',\n    altBoundary = false,\n    padding = 0\n  } = evaluate(options, state);\n  const paddingObject = getPaddingObject(padding);\n  const altContext = elementContext === 'floating' ? 'reference' : 'floating';\n  const element = elements[altBoundary ? altContext : elementContext];\n  const clippingClientRect = rectToClientRect(await platform.getClippingRect({\n    element: ((_await$platform$isEle = await (platform.isElement == null ? void 0 : platform.isElement(element))) != null ? _await$platform$isEle : true) ? element : element.contextElement || (await (platform.getDocumentElement == null ? void 0 : platform.getDocumentElement(elements.floating))),\n    boundary,\n    rootBoundary,\n    strategy\n  }));\n  const rect = elementContext === 'floating' ? {\n    x,\n    y,\n    width: rects.floating.width,\n    height: rects.floating.height\n  } : rects.reference;\n  const offsetParent = await (platform.getOffsetParent == null ? void 0 : platform.getOffsetParent(elements.floating));\n  const offsetScale = (await (platform.isElement == null ? void 0 : platform.isElement(offsetParent))) ? (await (platform.getScale == null ? void 0 : platform.getScale(offsetParent))) || {\n    x: 1,\n    y: 1\n  } : {\n    x: 1,\n    y: 1\n  };\n  const elementClientRect = rectToClientRect(platform.convertOffsetParentRelativeRectToViewportRelativeRect ? await platform.convertOffsetParentRelativeRectToViewportRelativeRect({\n    elements,\n    rect,\n    offsetParent,\n    strategy\n  }) : rect);\n  return {\n    top: (clippingClientRect.top - elementClientRect.top + paddingObject.top) / offsetScale.y,\n    bottom: (elementClientRect.bottom - clippingClientRect.bottom + paddingObject.bottom) / offsetScale.y,\n    left: (clippingClientRect.left - elementClientRect.left + paddingObject.left) / offsetScale.x,\n    right: (elementClientRect.right - clippingClientRect.right + paddingObject.right) / offsetScale.x\n  };\n}\n\n/**\n * Provides data to position an inner element of the floating element so that it\n * appears centered to the reference element.\n * @see https://floating-ui.com/docs/arrow\n */\nconst arrow = options => ({\n  name: 'arrow',\n  options,\n  async fn(state) {\n    const {\n      x,\n      y,\n      placement,\n      rects,\n      platform,\n      elements,\n      middlewareData\n    } = state;\n    // Since `element` is required, we don't Partial<> the type.\n    const {\n      element,\n      padding = 0\n    } = evaluate(options, state) || {};\n    if (element == null) {\n      return {};\n    }\n    const paddingObject = getPaddingObject(padding);\n    const coords = {\n      x,\n      y\n    };\n    const axis = getAlignmentAxis(placement);\n    const length = getAxisLength(axis);\n    const arrowDimensions = await platform.getDimensions(element);\n    const isYAxis = axis === 'y';\n    const minProp = isYAxis ? 'top' : 'left';\n    const maxProp = isYAxis ? 'bottom' : 'right';\n    const clientProp = isYAxis ? 'clientHeight' : 'clientWidth';\n    const endDiff = rects.reference[length] + rects.reference[axis] - coords[axis] - rects.floating[length];\n    const startDiff = coords[axis] - rects.reference[axis];\n    const arrowOffsetParent = await (platform.getOffsetParent == null ? void 0 : platform.getOffsetParent(element));\n    let clientSize = arrowOffsetParent ? arrowOffsetParent[clientProp] : 0;\n\n    // DOM platform can return `window` as the `offsetParent`.\n    if (!clientSize || !(await (platform.isElement == null ? void 0 : platform.isElement(arrowOffsetParent)))) {\n      clientSize = elements.floating[clientProp] || rects.floating[length];\n    }\n    const centerToReference = endDiff / 2 - startDiff / 2;\n\n    // If the padding is large enough that it causes the arrow to no longer be\n    // centered, modify the padding so that it is centered.\n    const largestPossiblePadding = clientSize / 2 - arrowDimensions[length] / 2 - 1;\n    const minPadding = min(paddingObject[minProp], largestPossiblePadding);\n    const maxPadding = min(paddingObject[maxProp], largestPossiblePadding);\n\n    // Make sure the arrow doesn't overflow the floating element if the center\n    // point is outside the floating element's bounds.\n    const min$1 = minPadding;\n    const max = clientSize - arrowDimensions[length] - maxPadding;\n    const center = clientSize / 2 - arrowDimensions[length] / 2 + centerToReference;\n    const offset = clamp(min$1, center, max);\n\n    // If the reference is small enough that the arrow's padding causes it to\n    // to point to nothing for an aligned placement, adjust the offset of the\n    // floating element itself. To ensure `shift()` continues to take action,\n    // a single reset is performed when this is true.\n    const shouldAddOffset = !middlewareData.arrow && getAlignment(placement) != null && center !== offset && rects.reference[length] / 2 - (center < min$1 ? minPadding : maxPadding) - arrowDimensions[length] / 2 < 0;\n    const alignmentOffset = shouldAddOffset ? center < min$1 ? center - min$1 : center - max : 0;\n    return {\n      [axis]: coords[axis] + alignmentOffset,\n      data: {\n        [axis]: offset,\n        centerOffset: center - offset - alignmentOffset,\n        ...(shouldAddOffset && {\n          alignmentOffset\n        })\n      },\n      reset: shouldAddOffset\n    };\n  }\n});\n\nfunction getPlacementList(alignment, autoAlignment, allowedPlacements) {\n  const allowedPlacementsSortedByAlignment = alignment ? [...allowedPlacements.filter(placement => getAlignment(placement) === alignment), ...allowedPlacements.filter(placement => getAlignment(placement) !== alignment)] : allowedPlacements.filter(placement => getSide(placement) === placement);\n  return allowedPlacementsSortedByAlignment.filter(placement => {\n    if (alignment) {\n      return getAlignment(placement) === alignment || (autoAlignment ? getOppositeAlignmentPlacement(placement) !== placement : false);\n    }\n    return true;\n  });\n}\n/**\n * Optimizes the visibility of the floating element by choosing the placement\n * that has the most space available automatically, without needing to specify a\n * preferred placement. Alternative to `flip`.\n * @see https://floating-ui.com/docs/autoPlacement\n */\nconst autoPlacement = function (options) {\n  if (options === void 0) {\n    options = {};\n  }\n  return {\n    name: 'autoPlacement',\n    options,\n    async fn(state) {\n      var _middlewareData$autoP, _middlewareData$autoP2, _placementsThatFitOnE;\n      const {\n        rects,\n        middlewareData,\n        placement,\n        platform,\n        elements\n      } = state;\n      const {\n        crossAxis = false,\n        alignment,\n        allowedPlacements = placements,\n        autoAlignment = true,\n        ...detectOverflowOptions\n      } = evaluate(options, state);\n      const placements$1 = alignment !== undefined || allowedPlacements === placements ? getPlacementList(alignment || null, autoAlignment, allowedPlacements) : allowedPlacements;\n      const overflow = await detectOverflow(state, detectOverflowOptions);\n      const currentIndex = ((_middlewareData$autoP = middlewareData.autoPlacement) == null ? void 0 : _middlewareData$autoP.index) || 0;\n      const currentPlacement = placements$1[currentIndex];\n      if (currentPlacement == null) {\n        return {};\n      }\n      const alignmentSides = getAlignmentSides(currentPlacement, rects, await (platform.isRTL == null ? void 0 : platform.isRTL(elements.floating)));\n\n      // Make `computeCoords` start from the right place.\n      if (placement !== currentPlacement) {\n        return {\n          reset: {\n            placement: placements$1[0]\n          }\n        };\n      }\n      const currentOverflows = [overflow[getSide(currentPlacement)], overflow[alignmentSides[0]], overflow[alignmentSides[1]]];\n      const allOverflows = [...(((_middlewareData$autoP2 = middlewareData.autoPlacement) == null ? void 0 : _middlewareData$autoP2.overflows) || []), {\n        placement: currentPlacement,\n        overflows: currentOverflows\n      }];\n      const nextPlacement = placements$1[currentIndex + 1];\n\n      // There are more placements to check.\n      if (nextPlacement) {\n        return {\n          data: {\n            index: currentIndex + 1,\n            overflows: allOverflows\n          },\n          reset: {\n            placement: nextPlacement\n          }\n        };\n      }\n      const placementsSortedByMostSpace = allOverflows.map(d => {\n        const alignment = getAlignment(d.placement);\n        return [d.placement, alignment && crossAxis ?\n        // Check along the mainAxis and main crossAxis side.\n        d.overflows.slice(0, 2).reduce((acc, v) => acc + v, 0) :\n        // Check only the mainAxis.\n        d.overflows[0], d.overflows];\n      }).sort((a, b) => a[1] - b[1]);\n      const placementsThatFitOnEachSide = placementsSortedByMostSpace.filter(d => d[2].slice(0,\n      // Aligned placements should not check their opposite crossAxis\n      // side.\n      getAlignment(d[0]) ? 2 : 3).every(v => v <= 0));\n      const resetPlacement = ((_placementsThatFitOnE = placementsThatFitOnEachSide[0]) == null ? void 0 : _placementsThatFitOnE[0]) || placementsSortedByMostSpace[0][0];\n      if (resetPlacement !== placement) {\n        return {\n          data: {\n            index: currentIndex + 1,\n            overflows: allOverflows\n          },\n          reset: {\n            placement: resetPlacement\n          }\n        };\n      }\n      return {};\n    }\n  };\n};\n\n/**\n * Optimizes the visibility of the floating element by flipping the `placement`\n * in order to keep it in view when the preferred placement(s) will overflow the\n * clipping boundary. Alternative to `autoPlacement`.\n * @see https://floating-ui.com/docs/flip\n */\nconst flip = function (options) {\n  if (options === void 0) {\n    options = {};\n  }\n  return {\n    name: 'flip',\n    options,\n    async fn(state) {\n      var _middlewareData$arrow, _middlewareData$flip;\n      const {\n        placement,\n        middlewareData,\n        rects,\n        initialPlacement,\n        platform,\n        elements\n      } = state;\n      const {\n        mainAxis: checkMainAxis = true,\n        crossAxis: checkCrossAxis = true,\n        fallbackPlacements: specifiedFallbackPlacements,\n        fallbackStrategy = 'bestFit',\n        fallbackAxisSideDirection = 'none',\n        flipAlignment = true,\n        ...detectOverflowOptions\n      } = evaluate(options, state);\n\n      // If a reset by the arrow was caused due to an alignment offset being\n      // added, we should skip any logic now since `flip()` has already done its\n      // work.\n      // https://github.com/floating-ui/floating-ui/issues/2549#issuecomment-1719601643\n      if ((_middlewareData$arrow = middlewareData.arrow) != null && _middlewareData$arrow.alignmentOffset) {\n        return {};\n      }\n      const side = getSide(placement);\n      const initialSideAxis = getSideAxis(initialPlacement);\n      const isBasePlacement = getSide(initialPlacement) === initialPlacement;\n      const rtl = await (platform.isRTL == null ? void 0 : platform.isRTL(elements.floating));\n      const fallbackPlacements = specifiedFallbackPlacements || (isBasePlacement || !flipAlignment ? [getOppositePlacement(initialPlacement)] : getExpandedPlacements(initialPlacement));\n      const hasFallbackAxisSideDirection = fallbackAxisSideDirection !== 'none';\n      if (!specifiedFallbackPlacements && hasFallbackAxisSideDirection) {\n        fallbackPlacements.push(...getOppositeAxisPlacements(initialPlacement, flipAlignment, fallbackAxisSideDirection, rtl));\n      }\n      const placements = [initialPlacement, ...fallbackPlacements];\n      const overflow = await detectOverflow(state, detectOverflowOptions);\n      const overflows = [];\n      let overflowsData = ((_middlewareData$flip = middlewareData.flip) == null ? void 0 : _middlewareData$flip.overflows) || [];\n      if (checkMainAxis) {\n        overflows.push(overflow[side]);\n      }\n      if (checkCrossAxis) {\n        const sides = getAlignmentSides(placement, rects, rtl);\n        overflows.push(overflow[sides[0]], overflow[sides[1]]);\n      }\n      overflowsData = [...overflowsData, {\n        placement,\n        overflows\n      }];\n\n      // One or more sides is overflowing.\n      if (!overflows.every(side => side <= 0)) {\n        var _middlewareData$flip2, _overflowsData$filter;\n        const nextIndex = (((_middlewareData$flip2 = middlewareData.flip) == null ? void 0 : _middlewareData$flip2.index) || 0) + 1;\n        const nextPlacement = placements[nextIndex];\n        if (nextPlacement) {\n          // Try next placement and re-run the lifecycle.\n          return {\n            data: {\n              index: nextIndex,\n              overflows: overflowsData\n            },\n            reset: {\n              placement: nextPlacement\n            }\n          };\n        }\n\n        // First, find the candidates that fit on the mainAxis side of overflow,\n        // then find the placement that fits the best on the main crossAxis side.\n        let resetPlacement = (_overflowsData$filter = overflowsData.filter(d => d.overflows[0] <= 0).sort((a, b) => a.overflows[1] - b.overflows[1])[0]) == null ? void 0 : _overflowsData$filter.placement;\n\n        // Otherwise fallback.\n        if (!resetPlacement) {\n          switch (fallbackStrategy) {\n            case 'bestFit':\n              {\n                var _overflowsData$filter2;\n                const placement = (_overflowsData$filter2 = overflowsData.filter(d => {\n                  if (hasFallbackAxisSideDirection) {\n                    const currentSideAxis = getSideAxis(d.placement);\n                    return currentSideAxis === initialSideAxis ||\n                    // Create a bias to the `y` side axis due to horizontal\n                    // reading directions favoring greater width.\n                    currentSideAxis === 'y';\n                  }\n                  return true;\n                }).map(d => [d.placement, d.overflows.filter(overflow => overflow > 0).reduce((acc, overflow) => acc + overflow, 0)]).sort((a, b) => a[1] - b[1])[0]) == null ? void 0 : _overflowsData$filter2[0];\n                if (placement) {\n                  resetPlacement = placement;\n                }\n                break;\n              }\n            case 'initialPlacement':\n              resetPlacement = initialPlacement;\n              break;\n          }\n        }\n        if (placement !== resetPlacement) {\n          return {\n            reset: {\n              placement: resetPlacement\n            }\n          };\n        }\n      }\n      return {};\n    }\n  };\n};\n\nfunction getSideOffsets(overflow, rect) {\n  return {\n    top: overflow.top - rect.height,\n    right: overflow.right - rect.width,\n    bottom: overflow.bottom - rect.height,\n    left: overflow.left - rect.width\n  };\n}\nfunction isAnySideFullyClipped(overflow) {\n  return sides.some(side => overflow[side] >= 0);\n}\n/**\n * Provides data to hide the floating element in applicable situations, such as\n * when it is not in the same clipping context as the reference element.\n * @see https://floating-ui.com/docs/hide\n */\nconst hide = function (options) {\n  if (options === void 0) {\n    options = {};\n  }\n  return {\n    name: 'hide',\n    options,\n    async fn(state) {\n      const {\n        rects\n      } = state;\n      const {\n        strategy = 'referenceHidden',\n        ...detectOverflowOptions\n      } = evaluate(options, state);\n      switch (strategy) {\n        case 'referenceHidden':\n          {\n            const overflow = await detectOverflow(state, {\n              ...detectOverflowOptions,\n              elementContext: 'reference'\n            });\n            const offsets = getSideOffsets(overflow, rects.reference);\n            return {\n              data: {\n                referenceHiddenOffsets: offsets,\n                referenceHidden: isAnySideFullyClipped(offsets)\n              }\n            };\n          }\n        case 'escaped':\n          {\n            const overflow = await detectOverflow(state, {\n              ...detectOverflowOptions,\n              altBoundary: true\n            });\n            const offsets = getSideOffsets(overflow, rects.floating);\n            return {\n              data: {\n                escapedOffsets: offsets,\n                escaped: isAnySideFullyClipped(offsets)\n              }\n            };\n          }\n        default:\n          {\n            return {};\n          }\n      }\n    }\n  };\n};\n\nfunction getBoundingRect(rects) {\n  const minX = min(...rects.map(rect => rect.left));\n  const minY = min(...rects.map(rect => rect.top));\n  const maxX = max(...rects.map(rect => rect.right));\n  const maxY = max(...rects.map(rect => rect.bottom));\n  return {\n    x: minX,\n    y: minY,\n    width: maxX - minX,\n    height: maxY - minY\n  };\n}\nfunction getRectsByLine(rects) {\n  const sortedRects = rects.slice().sort((a, b) => a.y - b.y);\n  const groups = [];\n  let prevRect = null;\n  for (let i = 0; i < sortedRects.length; i++) {\n    const rect = sortedRects[i];\n    if (!prevRect || rect.y - prevRect.y > prevRect.height / 2) {\n      groups.push([rect]);\n    } else {\n      groups[groups.length - 1].push(rect);\n    }\n    prevRect = rect;\n  }\n  return groups.map(rect => rectToClientRect(getBoundingRect(rect)));\n}\n/**\n * Provides improved positioning for inline reference elements that can span\n * over multiple lines, such as hyperlinks or range selections.\n * @see https://floating-ui.com/docs/inline\n */\nconst inline = function (options) {\n  if (options === void 0) {\n    options = {};\n  }\n  return {\n    name: 'inline',\n    options,\n    async fn(state) {\n      const {\n        placement,\n        elements,\n        rects,\n        platform,\n        strategy\n      } = state;\n      // A MouseEvent's client{X,Y} coords can be up to 2 pixels off a\n      // ClientRect's bounds, despite the event listener being triggered. A\n      // padding of 2 seems to handle this issue.\n      const {\n        padding = 2,\n        x,\n        y\n      } = evaluate(options, state);\n      const nativeClientRects = Array.from((await (platform.getClientRects == null ? void 0 : platform.getClientRects(elements.reference))) || []);\n      const clientRects = getRectsByLine(nativeClientRects);\n      const fallback = rectToClientRect(getBoundingRect(nativeClientRects));\n      const paddingObject = getPaddingObject(padding);\n      function getBoundingClientRect() {\n        // There are two rects and they are disjoined.\n        if (clientRects.length === 2 && clientRects[0].left > clientRects[1].right && x != null && y != null) {\n          // Find the first rect in which the point is fully inside.\n          return clientRects.find(rect => x > rect.left - paddingObject.left && x < rect.right + paddingObject.right && y > rect.top - paddingObject.top && y < rect.bottom + paddingObject.bottom) || fallback;\n        }\n\n        // There are 2 or more connected rects.\n        if (clientRects.length >= 2) {\n          if (getSideAxis(placement) === 'y') {\n            const firstRect = clientRects[0];\n            const lastRect = clientRects[clientRects.length - 1];\n            const isTop = getSide(placement) === 'top';\n            const top = firstRect.top;\n            const bottom = lastRect.bottom;\n            const left = isTop ? firstRect.left : lastRect.left;\n            const right = isTop ? firstRect.right : lastRect.right;\n            const width = right - left;\n            const height = bottom - top;\n            return {\n              top,\n              bottom,\n              left,\n              right,\n              width,\n              height,\n              x: left,\n              y: top\n            };\n          }\n          const isLeftSide = getSide(placement) === 'left';\n          const maxRight = max(...clientRects.map(rect => rect.right));\n          const minLeft = min(...clientRects.map(rect => rect.left));\n          const measureRects = clientRects.filter(rect => isLeftSide ? rect.left === minLeft : rect.right === maxRight);\n          const top = measureRects[0].top;\n          const bottom = measureRects[measureRects.length - 1].bottom;\n          const left = minLeft;\n          const right = maxRight;\n          const width = right - left;\n          const height = bottom - top;\n          return {\n            top,\n            bottom,\n            left,\n            right,\n            width,\n            height,\n            x: left,\n            y: top\n          };\n        }\n        return fallback;\n      }\n      const resetRects = await platform.getElementRects({\n        reference: {\n          getBoundingClientRect\n        },\n        floating: elements.floating,\n        strategy\n      });\n      if (rects.reference.x !== resetRects.reference.x || rects.reference.y !== resetRects.reference.y || rects.reference.width !== resetRects.reference.width || rects.reference.height !== resetRects.reference.height) {\n        return {\n          reset: {\n            rects: resetRects\n          }\n        };\n      }\n      return {};\n    }\n  };\n};\n\n// For type backwards-compatibility, the `OffsetOptions` type was also\n// Derivable.\n\nasync function convertValueToCoords(state, options) {\n  const {\n    placement,\n    platform,\n    elements\n  } = state;\n  const rtl = await (platform.isRTL == null ? void 0 : platform.isRTL(elements.floating));\n  const side = getSide(placement);\n  const alignment = getAlignment(placement);\n  const isVertical = getSideAxis(placement) === 'y';\n  const mainAxisMulti = ['left', 'top'].includes(side) ? -1 : 1;\n  const crossAxisMulti = rtl && isVertical ? -1 : 1;\n  const rawValue = evaluate(options, state);\n\n  // eslint-disable-next-line prefer-const\n  let {\n    mainAxis,\n    crossAxis,\n    alignmentAxis\n  } = typeof rawValue === 'number' ? {\n    mainAxis: rawValue,\n    crossAxis: 0,\n    alignmentAxis: null\n  } : {\n    mainAxis: rawValue.mainAxis || 0,\n    crossAxis: rawValue.crossAxis || 0,\n    alignmentAxis: rawValue.alignmentAxis\n  };\n  if (alignment && typeof alignmentAxis === 'number') {\n    crossAxis = alignment === 'end' ? alignmentAxis * -1 : alignmentAxis;\n  }\n  return isVertical ? {\n    x: crossAxis * crossAxisMulti,\n    y: mainAxis * mainAxisMulti\n  } : {\n    x: mainAxis * mainAxisMulti,\n    y: crossAxis * crossAxisMulti\n  };\n}\n\n/**\n * Modifies the placement by translating the floating element along the\n * specified axes.\n * A number (shorthand for `mainAxis` or distance), or an axes configuration\n * object may be passed.\n * @see https://floating-ui.com/docs/offset\n */\nconst offset = function (options) {\n  if (options === void 0) {\n    options = 0;\n  }\n  return {\n    name: 'offset',\n    options,\n    async fn(state) {\n      var _middlewareData$offse, _middlewareData$arrow;\n      const {\n        x,\n        y,\n        placement,\n        middlewareData\n      } = state;\n      const diffCoords = await convertValueToCoords(state, options);\n\n      // If the placement is the same and the arrow caused an alignment offset\n      // then we don't need to change the positioning coordinates.\n      if (placement === ((_middlewareData$offse = middlewareData.offset) == null ? void 0 : _middlewareData$offse.placement) && (_middlewareData$arrow = middlewareData.arrow) != null && _middlewareData$arrow.alignmentOffset) {\n        return {};\n      }\n      return {\n        x: x + diffCoords.x,\n        y: y + diffCoords.y,\n        data: {\n          ...diffCoords,\n          placement\n        }\n      };\n    }\n  };\n};\n\n/**\n * Optimizes the visibility of the floating element by shifting it in order to\n * keep it in view when it will overflow the clipping boundary.\n * @see https://floating-ui.com/docs/shift\n */\nconst shift = function (options) {\n  if (options === void 0) {\n    options = {};\n  }\n  return {\n    name: 'shift',\n    options,\n    async fn(state) {\n      const {\n        x,\n        y,\n        placement\n      } = state;\n      const {\n        mainAxis: checkMainAxis = true,\n        crossAxis: checkCrossAxis = false,\n        limiter = {\n          fn: _ref => {\n            let {\n              x,\n              y\n            } = _ref;\n            return {\n              x,\n              y\n            };\n          }\n        },\n        ...detectOverflowOptions\n      } = evaluate(options, state);\n      const coords = {\n        x,\n        y\n      };\n      const overflow = await detectOverflow(state, detectOverflowOptions);\n      const crossAxis = getSideAxis(getSide(placement));\n      const mainAxis = getOppositeAxis(crossAxis);\n      let mainAxisCoord = coords[mainAxis];\n      let crossAxisCoord = coords[crossAxis];\n      if (checkMainAxis) {\n        const minSide = mainAxis === 'y' ? 'top' : 'left';\n        const maxSide = mainAxis === 'y' ? 'bottom' : 'right';\n        const min = mainAxisCoord + overflow[minSide];\n        const max = mainAxisCoord - overflow[maxSide];\n        mainAxisCoord = clamp(min, mainAxisCoord, max);\n      }\n      if (checkCrossAxis) {\n        const minSide = crossAxis === 'y' ? 'top' : 'left';\n        const maxSide = crossAxis === 'y' ? 'bottom' : 'right';\n        const min = crossAxisCoord + overflow[minSide];\n        const max = crossAxisCoord - overflow[maxSide];\n        crossAxisCoord = clamp(min, crossAxisCoord, max);\n      }\n      const limitedCoords = limiter.fn({\n        ...state,\n        [mainAxis]: mainAxisCoord,\n        [crossAxis]: crossAxisCoord\n      });\n      return {\n        ...limitedCoords,\n        data: {\n          x: limitedCoords.x - x,\n          y: limitedCoords.y - y,\n          enabled: {\n            [mainAxis]: checkMainAxis,\n            [crossAxis]: checkCrossAxis\n          }\n        }\n      };\n    }\n  };\n};\n/**\n * Built-in `limiter` that will stop `shift()` at a certain point.\n */\nconst limitShift = function (options) {\n  if (options === void 0) {\n    options = {};\n  }\n  return {\n    options,\n    fn(state) {\n      const {\n        x,\n        y,\n        placement,\n        rects,\n        middlewareData\n      } = state;\n      const {\n        offset = 0,\n        mainAxis: checkMainAxis = true,\n        crossAxis: checkCrossAxis = true\n      } = evaluate(options, state);\n      const coords = {\n        x,\n        y\n      };\n      const crossAxis = getSideAxis(placement);\n      const mainAxis = getOppositeAxis(crossAxis);\n      let mainAxisCoord = coords[mainAxis];\n      let crossAxisCoord = coords[crossAxis];\n      const rawOffset = evaluate(offset, state);\n      const computedOffset = typeof rawOffset === 'number' ? {\n        mainAxis: rawOffset,\n        crossAxis: 0\n      } : {\n        mainAxis: 0,\n        crossAxis: 0,\n        ...rawOffset\n      };\n      if (checkMainAxis) {\n        const len = mainAxis === 'y' ? 'height' : 'width';\n        const limitMin = rects.reference[mainAxis] - rects.floating[len] + computedOffset.mainAxis;\n        const limitMax = rects.reference[mainAxis] + rects.reference[len] - computedOffset.mainAxis;\n        if (mainAxisCoord < limitMin) {\n          mainAxisCoord = limitMin;\n        } else if (mainAxisCoord > limitMax) {\n          mainAxisCoord = limitMax;\n        }\n      }\n      if (checkCrossAxis) {\n        var _middlewareData$offse, _middlewareData$offse2;\n        const len = mainAxis === 'y' ? 'width' : 'height';\n        const isOriginSide = ['top', 'left'].includes(getSide(placement));\n        const limitMin = rects.reference[crossAxis] - rects.floating[len] + (isOriginSide ? ((_middlewareData$offse = middlewareData.offset) == null ? void 0 : _middlewareData$offse[crossAxis]) || 0 : 0) + (isOriginSide ? 0 : computedOffset.crossAxis);\n        const limitMax = rects.reference[crossAxis] + rects.reference[len] + (isOriginSide ? 0 : ((_middlewareData$offse2 = middlewareData.offset) == null ? void 0 : _middlewareData$offse2[crossAxis]) || 0) - (isOriginSide ? computedOffset.crossAxis : 0);\n        if (crossAxisCoord < limitMin) {\n          crossAxisCoord = limitMin;\n        } else if (crossAxisCoord > limitMax) {\n          crossAxisCoord = limitMax;\n        }\n      }\n      return {\n        [mainAxis]: mainAxisCoord,\n        [crossAxis]: crossAxisCoord\n      };\n    }\n  };\n};\n\n/**\n * Provides data that allows you to change the size of the floating element \u2014\n * for instance, prevent it from overflowing the clipping boundary or match the\n * width of the reference element.\n * @see https://floating-ui.com/docs/size\n */\nconst size = function (options) {\n  if (options === void 0) {\n    options = {};\n  }\n  return {\n    name: 'size',\n    options,\n    async fn(state) {\n      var _state$middlewareData, _state$middlewareData2;\n      const {\n        placement,\n        rects,\n        platform,\n        elements\n      } = state;\n      const {\n        apply = () => {},\n        ...detectOverflowOptions\n      } = evaluate(options, state);\n      const overflow = await detectOverflow(state, detectOverflowOptions);\n      const side = getSide(placement);\n      const alignment = getAlignment(placement);\n      const isYAxis = getSideAxis(placement) === 'y';\n      const {\n        width,\n        height\n      } = rects.floating;\n      let heightSide;\n      let widthSide;\n      if (side === 'top' || side === 'bottom') {\n        heightSide = side;\n        widthSide = alignment === ((await (platform.isRTL == null ? void 0 : platform.isRTL(elements.floating))) ? 'start' : 'end') ? 'left' : 'right';\n      } else {\n        widthSide = side;\n        heightSide = alignment === 'end' ? 'top' : 'bottom';\n      }\n      const maximumClippingHeight = height - overflow.top - overflow.bottom;\n      const maximumClippingWidth = width - overflow.left - overflow.right;\n      const overflowAvailableHeight = min(height - overflow[heightSide], maximumClippingHeight);\n      const overflowAvailableWidth = min(width - overflow[widthSide], maximumClippingWidth);\n      const noShift = !state.middlewareData.shift;\n      let availableHeight = overflowAvailableHeight;\n      let availableWidth = overflowAvailableWidth;\n      if ((_state$middlewareData = state.middlewareData.shift) != null && _state$middlewareData.enabled.x) {\n        availableWidth = maximumClippingWidth;\n      }\n      if ((_state$middlewareData2 = state.middlewareData.shift) != null && _state$middlewareData2.enabled.y) {\n        availableHeight = maximumClippingHeight;\n      }\n      if (noShift && !alignment) {\n        const xMin = max(overflow.left, 0);\n        const xMax = max(overflow.right, 0);\n        const yMin = max(overflow.top, 0);\n        const yMax = max(overflow.bottom, 0);\n        if (isYAxis) {\n          availableWidth = width - 2 * (xMin !== 0 || xMax !== 0 ? xMin + xMax : max(overflow.left, overflow.right));\n        } else {\n          availableHeight = height - 2 * (yMin !== 0 || yMax !== 0 ? yMin + yMax : max(overflow.top, overflow.bottom));\n        }\n      }\n      await apply({\n        ...state,\n        availableWidth,\n        availableHeight\n      });\n      const nextDimensions = await platform.getDimensions(elements.floating);\n      if (width !== nextDimensions.width || height !== nextDimensions.height) {\n        return {\n          reset: {\n            rects: true\n          }\n        };\n      }\n      return {};\n    }\n  };\n};\n\nexport { arrow, autoPlacement, computePosition, detectOverflow, flip, hide, inline, limitShift, offset, shift, size };\n", "function hasWindow() {\n  return typeof window !== 'undefined';\n}\nfunction getNodeName(node) {\n  if (isNode(node)) {\n    return (node.nodeName || '').toLowerCase();\n  }\n  // Mocked nodes in testing environments may not be instances of Node. By\n  // returning `#document` an infinite loop won't occur.\n  // https://github.com/floating-ui/floating-ui/issues/2317\n  return '#document';\n}\nfunction getWindow(node) {\n  var _node$ownerDocument;\n  return (node == null || (_node$ownerDocument = node.ownerDocument) == null ? void 0 : _node$ownerDocument.defaultView) || window;\n}\nfunction getDocumentElement(node) {\n  var _ref;\n  return (_ref = (isNode(node) ? node.ownerDocument : node.document) || window.document) == null ? void 0 : _ref.documentElement;\n}\nfunction isNode(value) {\n  if (!hasWindow()) {\n    return false;\n  }\n  return value instanceof Node || value instanceof getWindow(value).Node;\n}\nfunction isElement(value) {\n  if (!hasWindow()) {\n    return false;\n  }\n  return value instanceof Element || value instanceof getWindow(value).Element;\n}\nfunction isHTMLElement(value) {\n  if (!hasWindow()) {\n    return false;\n  }\n  return value instanceof HTMLElement || value instanceof getWindow(value).HTMLElement;\n}\nfunction isShadowRoot(value) {\n  if (!hasWindow() || typeof ShadowRoot === 'undefined') {\n    return false;\n  }\n  return value instanceof ShadowRoot || value instanceof getWindow(value).ShadowRoot;\n}\nfunction isOverflowElement(element) {\n  const {\n    overflow,\n    overflowX,\n    overflowY,\n    display\n  } = getComputedStyle(element);\n  return /auto|scroll|overlay|hidden|clip/.test(overflow + overflowY + overflowX) && !['inline', 'contents'].includes(display);\n}\nfunction isTableElement(element) {\n  return ['table', 'td', 'th'].includes(getNodeName(element));\n}\nfunction isTopLayer(element) {\n  return [':popover-open', ':modal'].some(selector => {\n    try {\n      return element.matches(selector);\n    } catch (e) {\n      return false;\n    }\n  });\n}\nfunction isContainingBlock(elementOrCss) {\n  const webkit = isWebKit();\n  const css = isElement(elementOrCss) ? getComputedStyle(elementOrCss) : elementOrCss;\n\n  // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block\n  // https://drafts.csswg.org/css-transforms-2/#individual-transforms\n  return ['transform', 'translate', 'scale', 'rotate', 'perspective'].some(value => css[value] ? css[value] !== 'none' : false) || (css.containerType ? css.containerType !== 'normal' : false) || !webkit && (css.backdropFilter ? css.backdropFilter !== 'none' : false) || !webkit && (css.filter ? css.filter !== 'none' : false) || ['transform', 'translate', 'scale', 'rotate', 'perspective', 'filter'].some(value => (css.willChange || '').includes(value)) || ['paint', 'layout', 'strict', 'content'].some(value => (css.contain || '').includes(value));\n}\nfunction getContainingBlock(element) {\n  let currentNode = getParentNode(element);\n  while (isHTMLElement(currentNode) && !isLastTraversableNode(currentNode)) {\n    if (isContainingBlock(currentNode)) {\n      return currentNode;\n    } else if (isTopLayer(currentNode)) {\n      return null;\n    }\n    currentNode = getParentNode(currentNode);\n  }\n  return null;\n}\nfunction isWebKit() {\n  if (typeof CSS === 'undefined' || !CSS.supports) return false;\n  return CSS.supports('-webkit-backdrop-filter', 'none');\n}\nfunction isLastTraversableNode(node) {\n  return ['html', 'body', '#document'].includes(getNodeName(node));\n}\nfunction getComputedStyle(element) {\n  return getWindow(element).getComputedStyle(element);\n}\nfunction getNodeScroll(element) {\n  if (isElement(element)) {\n    return {\n      scrollLeft: element.scrollLeft,\n      scrollTop: element.scrollTop\n    };\n  }\n  return {\n    scrollLeft: element.scrollX,\n    scrollTop: element.scrollY\n  };\n}\nfunction getParentNode(node) {\n  if (getNodeName(node) === 'html') {\n    return node;\n  }\n  const result =\n  // Step into the shadow DOM of the parent of a slotted node.\n  node.assignedSlot ||\n  // DOM Element detected.\n  node.parentNode ||\n  // ShadowRoot detected.\n  isShadowRoot(node) && node.host ||\n  // Fallback.\n  getDocumentElement(node);\n  return isShadowRoot(result) ? result.host : result;\n}\nfunction getNearestOverflowAncestor(node) {\n  const parentNode = getParentNode(node);\n  if (isLastTraversableNode(parentNode)) {\n    return node.ownerDocument ? node.ownerDocument.body : node.body;\n  }\n  if (isHTMLElement(parentNode) && isOverflowElement(parentNode)) {\n    return parentNode;\n  }\n  return getNearestOverflowAncestor(parentNode);\n}\nfunction getOverflowAncestors(node, list, traverseIframes) {\n  var _node$ownerDocument2;\n  if (list === void 0) {\n    list = [];\n  }\n  if (traverseIframes === void 0) {\n    traverseIframes = true;\n  }\n  const scrollableAncestor = getNearestOverflowAncestor(node);\n  const isBody = scrollableAncestor === ((_node$ownerDocument2 = node.ownerDocument) == null ? void 0 : _node$ownerDocument2.body);\n  const win = getWindow(scrollableAncestor);\n  if (isBody) {\n    const frameElement = getFrameElement(win);\n    return list.concat(win, win.visualViewport || [], isOverflowElement(scrollableAncestor) ? scrollableAncestor : [], frameElement && traverseIframes ? getOverflowAncestors(frameElement) : []);\n  }\n  return list.concat(scrollableAncestor, getOverflowAncestors(scrollableAncestor, [], traverseIframes));\n}\nfunction getFrameElement(win) {\n  return win.parent && Object.getPrototypeOf(win.parent) ? win.frameElement : null;\n}\n\nexport { getComputedStyle, getContainingBlock, getDocumentElement, getFrameElement, getNearestOverflowAncestor, getNodeName, getNodeScroll, getOverflowAncestors, getParentNode, getWindow, isContainingBlock, isElement, isHTMLElement, isLastTraversableNode, isNode, isOverflowElement, isShadowRoot, isTableElement, isTopLayer, isWebKit };\n", "import { rectToClientRect, detectOverflow as detectOverflow$1, offset as offset$1, autoPlacement as autoPlacement$1, shift as shift$1, flip as flip$1, size as size$1, hide as hide$1, arrow as arrow$1, inline as inline$1, limitShift as limitShift$1, computePosition as computePosition$1 } from '@floating-ui/core';\nimport { round, createCoords, max, min, floor } from '@floating-ui/utils';\nimport { getComputedStyle, isHTMLElement, isElement, getWindow, isWebKit, getFrameElement, getNodeScroll, getDocumentElement, isTopLayer, getNodeName, isOverflowElement, getOverflowAncestors, getParentNode, isLastTraversableNode, isContainingBlock, isTableElement, getContainingBlock } from '@floating-ui/utils/dom';\nexport { getOverflowAncestors } from '@floating-ui/utils/dom';\n\nfunction getCssDimensions(element) {\n  const css = getComputedStyle(element);\n  // In testing environments, the `width` and `height` properties are empty\n  // strings for SVG elements, returning NaN. Fallback to `0` in this case.\n  let width = parseFloat(css.width) || 0;\n  let height = parseFloat(css.height) || 0;\n  const hasOffset = isHTMLElement(element);\n  const offsetWidth = hasOffset ? element.offsetWidth : width;\n  const offsetHeight = hasOffset ? element.offsetHeight : height;\n  const shouldFallback = round(width) !== offsetWidth || round(height) !== offsetHeight;\n  if (shouldFallback) {\n    width = offsetWidth;\n    height = offsetHeight;\n  }\n  return {\n    width,\n    height,\n    $: shouldFallback\n  };\n}\n\nfunction unwrapElement(element) {\n  return !isElement(element) ? element.contextElement : element;\n}\n\nfunction getScale(element) {\n  const domElement = unwrapElement(element);\n  if (!isHTMLElement(domElement)) {\n    return createCoords(1);\n  }\n  const rect = domElement.getBoundingClientRect();\n  const {\n    width,\n    height,\n    $\n  } = getCssDimensions(domElement);\n  let x = ($ ? round(rect.width) : rect.width) / width;\n  let y = ($ ? round(rect.height) : rect.height) / height;\n\n  // 0, NaN, or Infinity should always fallback to 1.\n\n  if (!x || !Number.isFinite(x)) {\n    x = 1;\n  }\n  if (!y || !Number.isFinite(y)) {\n    y = 1;\n  }\n  return {\n    x,\n    y\n  };\n}\n\nconst noOffsets = /*#__PURE__*/createCoords(0);\nfunction getVisualOffsets(element) {\n  const win = getWindow(element);\n  if (!isWebKit() || !win.visualViewport) {\n    return noOffsets;\n  }\n  return {\n    x: win.visualViewport.offsetLeft,\n    y: win.visualViewport.offsetTop\n  };\n}\nfunction shouldAddVisualOffsets(element, isFixed, floatingOffsetParent) {\n  if (isFixed === void 0) {\n    isFixed = false;\n  }\n  if (!floatingOffsetParent || isFixed && floatingOffsetParent !== getWindow(element)) {\n    return false;\n  }\n  return isFixed;\n}\n\nfunction getBoundingClientRect(element, includeScale, isFixedStrategy, offsetParent) {\n  if (includeScale === void 0) {\n    includeScale = false;\n  }\n  if (isFixedStrategy === void 0) {\n    isFixedStrategy = false;\n  }\n  const clientRect = element.getBoundingClientRect();\n  const domElement = unwrapElement(element);\n  let scale = createCoords(1);\n  if (includeScale) {\n    if (offsetParent) {\n      if (isElement(offsetParent)) {\n        scale = getScale(offsetParent);\n      }\n    } else {\n      scale = getScale(element);\n    }\n  }\n  const visualOffsets = shouldAddVisualOffsets(domElement, isFixedStrategy, offsetParent) ? getVisualOffsets(domElement) : createCoords(0);\n  let x = (clientRect.left + visualOffsets.x) / scale.x;\n  let y = (clientRect.top + visualOffsets.y) / scale.y;\n  let width = clientRect.width / scale.x;\n  let height = clientRect.height / scale.y;\n  if (domElement) {\n    const win = getWindow(domElement);\n    const offsetWin = offsetParent && isElement(offsetParent) ? getWindow(offsetParent) : offsetParent;\n    let currentWin = win;\n    let currentIFrame = getFrameElement(currentWin);\n    while (currentIFrame && offsetParent && offsetWin !== currentWin) {\n      const iframeScale = getScale(currentIFrame);\n      const iframeRect = currentIFrame.getBoundingClientRect();\n      const css = getComputedStyle(currentIFrame);\n      const left = iframeRect.left + (currentIFrame.clientLeft + parseFloat(css.paddingLeft)) * iframeScale.x;\n      const top = iframeRect.top + (currentIFrame.clientTop + parseFloat(css.paddingTop)) * iframeScale.y;\n      x *= iframeScale.x;\n      y *= iframeScale.y;\n      width *= iframeScale.x;\n      height *= iframeScale.y;\n      x += left;\n      y += top;\n      currentWin = getWindow(currentIFrame);\n      currentIFrame = getFrameElement(currentWin);\n    }\n  }\n  return rectToClientRect({\n    width,\n    height,\n    x,\n    y\n  });\n}\n\n// If <html> has a CSS width greater than the viewport, then this will be\n// incorrect for RTL.\nfunction getWindowScrollBarX(element, rect) {\n  const leftScroll = getNodeScroll(element).scrollLeft;\n  if (!rect) {\n    return getBoundingClientRect(getDocumentElement(element)).left + leftScroll;\n  }\n  return rect.left + leftScroll;\n}\n\nfunction getHTMLOffset(documentElement, scroll, ignoreScrollbarX) {\n  if (ignoreScrollbarX === void 0) {\n    ignoreScrollbarX = false;\n  }\n  const htmlRect = documentElement.getBoundingClientRect();\n  const x = htmlRect.left + scroll.scrollLeft - (ignoreScrollbarX ? 0 :\n  // RTL <body> scrollbar.\n  getWindowScrollBarX(documentElement, htmlRect));\n  const y = htmlRect.top + scroll.scrollTop;\n  return {\n    x,\n    y\n  };\n}\n\nfunction convertOffsetParentRelativeRectToViewportRelativeRect(_ref) {\n  let {\n    elements,\n    rect,\n    offsetParent,\n    strategy\n  } = _ref;\n  const isFixed = strategy === 'fixed';\n  const documentElement = getDocumentElement(offsetParent);\n  const topLayer = elements ? isTopLayer(elements.floating) : false;\n  if (offsetParent === documentElement || topLayer && isFixed) {\n    return rect;\n  }\n  let scroll = {\n    scrollLeft: 0,\n    scrollTop: 0\n  };\n  let scale = createCoords(1);\n  const offsets = createCoords(0);\n  const isOffsetParentAnElement = isHTMLElement(offsetParent);\n  if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) {\n    if (getNodeName(offsetParent) !== 'body' || isOverflowElement(documentElement)) {\n      scroll = getNodeScroll(offsetParent);\n    }\n    if (isHTMLElement(offsetParent)) {\n      const offsetRect = getBoundingClientRect(offsetParent);\n      scale = getScale(offsetParent);\n      offsets.x = offsetRect.x + offsetParent.clientLeft;\n      offsets.y = offsetRect.y + offsetParent.clientTop;\n    }\n  }\n  const htmlOffset = documentElement && !isOffsetParentAnElement && !isFixed ? getHTMLOffset(documentElement, scroll, true) : createCoords(0);\n  return {\n    width: rect.width * scale.x,\n    height: rect.height * scale.y,\n    x: rect.x * scale.x - scroll.scrollLeft * scale.x + offsets.x + htmlOffset.x,\n    y: rect.y * scale.y - scroll.scrollTop * scale.y + offsets.y + htmlOffset.y\n  };\n}\n\nfunction getClientRects(element) {\n  return Array.from(element.getClientRects());\n}\n\n// Gets the entire size of the scrollable document area, even extending outside\n// of the `<html>` and `<body>` rect bounds if horizontally scrollable.\nfunction getDocumentRect(element) {\n  const html = getDocumentElement(element);\n  const scroll = getNodeScroll(element);\n  const body = element.ownerDocument.body;\n  const width = max(html.scrollWidth, html.clientWidth, body.scrollWidth, body.clientWidth);\n  const height = max(html.scrollHeight, html.clientHeight, body.scrollHeight, body.clientHeight);\n  let x = -scroll.scrollLeft + getWindowScrollBarX(element);\n  const y = -scroll.scrollTop;\n  if (getComputedStyle(body).direction === 'rtl') {\n    x += max(html.clientWidth, body.clientWidth) - width;\n  }\n  return {\n    width,\n    height,\n    x,\n    y\n  };\n}\n\nfunction getViewportRect(element, strategy) {\n  const win = getWindow(element);\n  const html = getDocumentElement(element);\n  const visualViewport = win.visualViewport;\n  let width = html.clientWidth;\n  let height = html.clientHeight;\n  let x = 0;\n  let y = 0;\n  if (visualViewport) {\n    width = visualViewport.width;\n    height = visualViewport.height;\n    const visualViewportBased = isWebKit();\n    if (!visualViewportBased || visualViewportBased && strategy === 'fixed') {\n      x = visualViewport.offsetLeft;\n      y = visualViewport.offsetTop;\n    }\n  }\n  return {\n    width,\n    height,\n    x,\n    y\n  };\n}\n\n// Returns the inner client rect, subtracting scrollbars if present.\nfunction getInnerBoundingClientRect(element, strategy) {\n  const clientRect = getBoundingClientRect(element, true, strategy === 'fixed');\n  const top = clientRect.top + element.clientTop;\n  const left = clientRect.left + element.clientLeft;\n  const scale = isHTMLElement(element) ? getScale(element) : createCoords(1);\n  const width = element.clientWidth * scale.x;\n  const height = element.clientHeight * scale.y;\n  const x = left * scale.x;\n  const y = top * scale.y;\n  return {\n    width,\n    height,\n    x,\n    y\n  };\n}\nfunction getClientRectFromClippingAncestor(element, clippingAncestor, strategy) {\n  let rect;\n  if (clippingAncestor === 'viewport') {\n    rect = getViewportRect(element, strategy);\n  } else if (clippingAncestor === 'document') {\n    rect = getDocumentRect(getDocumentElement(element));\n  } else if (isElement(clippingAncestor)) {\n    rect = getInnerBoundingClientRect(clippingAncestor, strategy);\n  } else {\n    const visualOffsets = getVisualOffsets(element);\n    rect = {\n      x: clippingAncestor.x - visualOffsets.x,\n      y: clippingAncestor.y - visualOffsets.y,\n      width: clippingAncestor.width,\n      height: clippingAncestor.height\n    };\n  }\n  return rectToClientRect(rect);\n}\nfunction hasFixedPositionAncestor(element, stopNode) {\n  const parentNode = getParentNode(element);\n  if (parentNode === stopNode || !isElement(parentNode) || isLastTraversableNode(parentNode)) {\n    return false;\n  }\n  return getComputedStyle(parentNode).position === 'fixed' || hasFixedPositionAncestor(parentNode, stopNode);\n}\n\n// A \"clipping ancestor\" is an `overflow` element with the characteristic of\n// clipping (or hiding) child elements. This returns all clipping ancestors\n// of the given element up the tree.\nfunction getClippingElementAncestors(element, cache) {\n  const cachedResult = cache.get(element);\n  if (cachedResult) {\n    return cachedResult;\n  }\n  let result = getOverflowAncestors(element, [], false).filter(el => isElement(el) && getNodeName(el) !== 'body');\n  let currentContainingBlockComputedStyle = null;\n  const elementIsFixed = getComputedStyle(element).position === 'fixed';\n  let currentNode = elementIsFixed ? getParentNode(element) : element;\n\n  // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block\n  while (isElement(currentNode) && !isLastTraversableNode(currentNode)) {\n    const computedStyle = getComputedStyle(currentNode);\n    const currentNodeIsContaining = isContainingBlock(currentNode);\n    if (!currentNodeIsContaining && computedStyle.position === 'fixed') {\n      currentContainingBlockComputedStyle = null;\n    }\n    const shouldDropCurrentNode = elementIsFixed ? !currentNodeIsContaining && !currentContainingBlockComputedStyle : !currentNodeIsContaining && computedStyle.position === 'static' && !!currentContainingBlockComputedStyle && ['absolute', 'fixed'].includes(currentContainingBlockComputedStyle.position) || isOverflowElement(currentNode) && !currentNodeIsContaining && hasFixedPositionAncestor(element, currentNode);\n    if (shouldDropCurrentNode) {\n      // Drop non-containing blocks.\n      result = result.filter(ancestor => ancestor !== currentNode);\n    } else {\n      // Record last containing block for next iteration.\n      currentContainingBlockComputedStyle = computedStyle;\n    }\n    currentNode = getParentNode(currentNode);\n  }\n  cache.set(element, result);\n  return result;\n}\n\n// Gets the maximum area that the element is visible in due to any number of\n// clipping ancestors.\nfunction getClippingRect(_ref) {\n  let {\n    element,\n    boundary,\n    rootBoundary,\n    strategy\n  } = _ref;\n  const elementClippingAncestors = boundary === 'clippingAncestors' ? isTopLayer(element) ? [] : getClippingElementAncestors(element, this._c) : [].concat(boundary);\n  const clippingAncestors = [...elementClippingAncestors, rootBoundary];\n  const firstClippingAncestor = clippingAncestors[0];\n  const clippingRect = clippingAncestors.reduce((accRect, clippingAncestor) => {\n    const rect = getClientRectFromClippingAncestor(element, clippingAncestor, strategy);\n    accRect.top = max(rect.top, accRect.top);\n    accRect.right = min(rect.right, accRect.right);\n    accRect.bottom = min(rect.bottom, accRect.bottom);\n    accRect.left = max(rect.left, accRect.left);\n    return accRect;\n  }, getClientRectFromClippingAncestor(element, firstClippingAncestor, strategy));\n  return {\n    width: clippingRect.right - clippingRect.left,\n    height: clippingRect.bottom - clippingRect.top,\n    x: clippingRect.left,\n    y: clippingRect.top\n  };\n}\n\nfunction getDimensions(element) {\n  const {\n    width,\n    height\n  } = getCssDimensions(element);\n  return {\n    width,\n    height\n  };\n}\n\nfunction getRectRelativeToOffsetParent(element, offsetParent, strategy) {\n  const isOffsetParentAnElement = isHTMLElement(offsetParent);\n  const documentElement = getDocumentElement(offsetParent);\n  const isFixed = strategy === 'fixed';\n  const rect = getBoundingClientRect(element, true, isFixed, offsetParent);\n  let scroll = {\n    scrollLeft: 0,\n    scrollTop: 0\n  };\n  const offsets = createCoords(0);\n  if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) {\n    if (getNodeName(offsetParent) !== 'body' || isOverflowElement(documentElement)) {\n      scroll = getNodeScroll(offsetParent);\n    }\n    if (isOffsetParentAnElement) {\n      const offsetRect = getBoundingClientRect(offsetParent, true, isFixed, offsetParent);\n      offsets.x = offsetRect.x + offsetParent.clientLeft;\n      offsets.y = offsetRect.y + offsetParent.clientTop;\n    } else if (documentElement) {\n      // If the <body> scrollbar appears on the left (e.g. RTL systems). Use\n      // Firefox with layout.scrollbar.side = 3 in about:config to test this.\n      offsets.x = getWindowScrollBarX(documentElement);\n    }\n  }\n  const htmlOffset = documentElement && !isOffsetParentAnElement && !isFixed ? getHTMLOffset(documentElement, scroll) : createCoords(0);\n  const x = rect.left + scroll.scrollLeft - offsets.x - htmlOffset.x;\n  const y = rect.top + scroll.scrollTop - offsets.y - htmlOffset.y;\n  return {\n    x,\n    y,\n    width: rect.width,\n    height: rect.height\n  };\n}\n\nfunction isStaticPositioned(element) {\n  return getComputedStyle(element).position === 'static';\n}\n\nfunction getTrueOffsetParent(element, polyfill) {\n  if (!isHTMLElement(element) || getComputedStyle(element).position === 'fixed') {\n    return null;\n  }\n  if (polyfill) {\n    return polyfill(element);\n  }\n  let rawOffsetParent = element.offsetParent;\n\n  // Firefox returns the <html> element as the offsetParent if it's non-static,\n  // while Chrome and Safari return the <body> element. The <body> element must\n  // be used to perform the correct calculations even if the <html> element is\n  // non-static.\n  if (getDocumentElement(element) === rawOffsetParent) {\n    rawOffsetParent = rawOffsetParent.ownerDocument.body;\n  }\n  return rawOffsetParent;\n}\n\n// Gets the closest ancestor positioned element. Handles some edge cases,\n// such as table ancestors and cross browser bugs.\nfunction getOffsetParent(element, polyfill) {\n  const win = getWindow(element);\n  if (isTopLayer(element)) {\n    return win;\n  }\n  if (!isHTMLElement(element)) {\n    let svgOffsetParent = getParentNode(element);\n    while (svgOffsetParent && !isLastTraversableNode(svgOffsetParent)) {\n      if (isElement(svgOffsetParent) && !isStaticPositioned(svgOffsetParent)) {\n        return svgOffsetParent;\n      }\n      svgOffsetParent = getParentNode(svgOffsetParent);\n    }\n    return win;\n  }\n  let offsetParent = getTrueOffsetParent(element, polyfill);\n  while (offsetParent && isTableElement(offsetParent) && isStaticPositioned(offsetParent)) {\n    offsetParent = getTrueOffsetParent(offsetParent, polyfill);\n  }\n  if (offsetParent && isLastTraversableNode(offsetParent) && isStaticPositioned(offsetParent) && !isContainingBlock(offsetParent)) {\n    return win;\n  }\n  return offsetParent || getContainingBlock(element) || win;\n}\n\nconst getElementRects = async function (data) {\n  const getOffsetParentFn = this.getOffsetParent || getOffsetParent;\n  const getDimensionsFn = this.getDimensions;\n  const floatingDimensions = await getDimensionsFn(data.floating);\n  return {\n    reference: getRectRelativeToOffsetParent(data.reference, await getOffsetParentFn(data.floating), data.strategy),\n    floating: {\n      x: 0,\n      y: 0,\n      width: floatingDimensions.width,\n      height: floatingDimensions.height\n    }\n  };\n};\n\nfunction isRTL(element) {\n  return getComputedStyle(element).direction === 'rtl';\n}\n\nconst platform = {\n  convertOffsetParentRelativeRectToViewportRelativeRect,\n  getDocumentElement,\n  getClippingRect,\n  getOffsetParent,\n  getElementRects,\n  getClientRects,\n  getDimensions,\n  getScale,\n  isElement,\n  isRTL\n};\n\nfunction rectsAreEqual(a, b) {\n  return a.x === b.x && a.y === b.y && a.width === b.width && a.height === b.height;\n}\n\n// https://samthor.au/2021/observing-dom/\nfunction observeMove(element, onMove) {\n  let io = null;\n  let timeoutId;\n  const root = getDocumentElement(element);\n  function cleanup() {\n    var _io;\n    clearTimeout(timeoutId);\n    (_io = io) == null || _io.disconnect();\n    io = null;\n  }\n  function refresh(skip, threshold) {\n    if (skip === void 0) {\n      skip = false;\n    }\n    if (threshold === void 0) {\n      threshold = 1;\n    }\n    cleanup();\n    const elementRectForRootMargin = element.getBoundingClientRect();\n    const {\n      left,\n      top,\n      width,\n      height\n    } = elementRectForRootMargin;\n    if (!skip) {\n      onMove();\n    }\n    if (!width || !height) {\n      return;\n    }\n    const insetTop = floor(top);\n    const insetRight = floor(root.clientWidth - (left + width));\n    const insetBottom = floor(root.clientHeight - (top + height));\n    const insetLeft = floor(left);\n    const rootMargin = -insetTop + \"px \" + -insetRight + \"px \" + -insetBottom + \"px \" + -insetLeft + \"px\";\n    const options = {\n      rootMargin,\n      threshold: max(0, min(1, threshold)) || 1\n    };\n    let isFirstUpdate = true;\n    function handleObserve(entries) {\n      const ratio = entries[0].intersectionRatio;\n      if (ratio !== threshold) {\n        if (!isFirstUpdate) {\n          return refresh();\n        }\n        if (!ratio) {\n          // If the reference is clipped, the ratio is 0. Throttle the refresh\n          // to prevent an infinite loop of updates.\n          timeoutId = setTimeout(() => {\n            refresh(false, 1e-7);\n          }, 1000);\n        } else {\n          refresh(false, ratio);\n        }\n      }\n      if (ratio === 1 && !rectsAreEqual(elementRectForRootMargin, element.getBoundingClientRect())) {\n        // It's possible that even though the ratio is reported as 1, the\n        // element is not actually fully within the IntersectionObserver's root\n        // area anymore. This can happen under performance constraints. This may\n        // be a bug in the browser's IntersectionObserver implementation. To\n        // work around this, we compare the element's bounding rect now with\n        // what it was at the time we created the IntersectionObserver. If they\n        // are not equal then the element moved, so we refresh.\n        refresh();\n      }\n      isFirstUpdate = false;\n    }\n\n    // Older browsers don't support a `document` as the root and will throw an\n    // error.\n    try {\n      io = new IntersectionObserver(handleObserve, {\n        ...options,\n        // Handle <iframe>s\n        root: root.ownerDocument\n      });\n    } catch (e) {\n      io = new IntersectionObserver(handleObserve, options);\n    }\n    io.observe(element);\n  }\n  refresh(true);\n  return cleanup;\n}\n\n/**\n * Automatically updates the position of the floating element when necessary.\n * Should only be called when the floating element is mounted on the DOM or\n * visible on the screen.\n * @returns cleanup function that should be invoked when the floating element is\n * removed from the DOM or hidden from the screen.\n * @see https://floating-ui.com/docs/autoUpdate\n */\nfunction autoUpdate(reference, floating, update, options) {\n  if (options === void 0) {\n    options = {};\n  }\n  const {\n    ancestorScroll = true,\n    ancestorResize = true,\n    elementResize = typeof ResizeObserver === 'function',\n    layoutShift = typeof IntersectionObserver === 'function',\n    animationFrame = false\n  } = options;\n  const referenceEl = unwrapElement(reference);\n  const ancestors = ancestorScroll || ancestorResize ? [...(referenceEl ? getOverflowAncestors(referenceEl) : []), ...getOverflowAncestors(floating)] : [];\n  ancestors.forEach(ancestor => {\n    ancestorScroll && ancestor.addEventListener('scroll', update, {\n      passive: true\n    });\n    ancestorResize && ancestor.addEventListener('resize', update);\n  });\n  const cleanupIo = referenceEl && layoutShift ? observeMove(referenceEl, update) : null;\n  let reobserveFrame = -1;\n  let resizeObserver = null;\n  if (elementResize) {\n    resizeObserver = new ResizeObserver(_ref => {\n      let [firstEntry] = _ref;\n      if (firstEntry && firstEntry.target === referenceEl && resizeObserver) {\n        // Prevent update loops when using the `size` middleware.\n        // https://github.com/floating-ui/floating-ui/issues/1740\n        resizeObserver.unobserve(floating);\n        cancelAnimationFrame(reobserveFrame);\n        reobserveFrame = requestAnimationFrame(() => {\n          var _resizeObserver;\n          (_resizeObserver = resizeObserver) == null || _resizeObserver.observe(floating);\n        });\n      }\n      update();\n    });\n    if (referenceEl && !animationFrame) {\n      resizeObserver.observe(referenceEl);\n    }\n    resizeObserver.observe(floating);\n  }\n  let frameId;\n  let prevRefRect = animationFrame ? getBoundingClientRect(reference) : null;\n  if (animationFrame) {\n    frameLoop();\n  }\n  function frameLoop() {\n    const nextRefRect = getBoundingClientRect(reference);\n    if (prevRefRect && !rectsAreEqual(prevRefRect, nextRefRect)) {\n      update();\n    }\n    prevRefRect = nextRefRect;\n    frameId = requestAnimationFrame(frameLoop);\n  }\n  update();\n  return () => {\n    var _resizeObserver2;\n    ancestors.forEach(ancestor => {\n      ancestorScroll && ancestor.removeEventListener('scroll', update);\n      ancestorResize && ancestor.removeEventListener('resize', update);\n    });\n    cleanupIo == null || cleanupIo();\n    (_resizeObserver2 = resizeObserver) == null || _resizeObserver2.disconnect();\n    resizeObserver = null;\n    if (animationFrame) {\n      cancelAnimationFrame(frameId);\n    }\n  };\n}\n\n/**\n * Resolves with an object of overflow side offsets that determine how much the\n * element is overflowing a given clipping boundary on each side.\n * - positive = overflowing the boundary by that number of pixels\n * - negative = how many pixels left before it will overflow\n * - 0 = lies flush with the boundary\n * @see https://floating-ui.com/docs/detectOverflow\n */\nconst detectOverflow = detectOverflow$1;\n\n/**\n * Modifies the placement by translating the floating element along the\n * specified axes.\n * A number (shorthand for `mainAxis` or distance), or an axes configuration\n * object may be passed.\n * @see https://floating-ui.com/docs/offset\n */\nconst offset = offset$1;\n\n/**\n * Optimizes the visibility of the floating element by choosing the placement\n * that has the most space available automatically, without needing to specify a\n * preferred placement. Alternative to `flip`.\n * @see https://floating-ui.com/docs/autoPlacement\n */\nconst autoPlacement = autoPlacement$1;\n\n/**\n * Optimizes the visibility of the floating element by shifting it in order to\n * keep it in view when it will overflow the clipping boundary.\n * @see https://floating-ui.com/docs/shift\n */\nconst shift = shift$1;\n\n/**\n * Optimizes the visibility of the floating element by flipping the `placement`\n * in order to keep it in view when the preferred placement(s) will overflow the\n * clipping boundary. Alternative to `autoPlacement`.\n * @see https://floating-ui.com/docs/flip\n */\nconst flip = flip$1;\n\n/**\n * Provides data that allows you to change the size of the floating element \u2014\n * for instance, prevent it from overflowing the clipping boundary or match the\n * width of the reference element.\n * @see https://floating-ui.com/docs/size\n */\nconst size = size$1;\n\n/**\n * Provides data to hide the floating element in applicable situations, such as\n * when it is not in the same clipping context as the reference element.\n * @see https://floating-ui.com/docs/hide\n */\nconst hide = hide$1;\n\n/**\n * Provides data to position an inner element of the floating element so that it\n * appears centered to the reference element.\n * @see https://floating-ui.com/docs/arrow\n */\nconst arrow = arrow$1;\n\n/**\n * Provides improved positioning for inline reference elements that can span\n * over multiple lines, such as hyperlinks or range selections.\n * @see https://floating-ui.com/docs/inline\n */\nconst inline = inline$1;\n\n/**\n * Built-in `limiter` that will stop `shift()` at a certain point.\n */\nconst limitShift = limitShift$1;\n\n/**\n * Computes the `x` and `y` coordinates that will place the floating element\n * next to a given reference element.\n */\nconst computePosition = (reference, floating, options) => {\n  // This caches the expensive `getClippingElementAncestors` function so that\n  // multiple lifecycle resets re-use the same result. It only lives for a\n  // single call. If other functions become expensive, we can add them as well.\n  const cache = new Map();\n  const mergedOptions = {\n    platform,\n    ...options\n  };\n  const platformWithCache = {\n    ...mergedOptions.platform,\n    _c: cache\n  };\n  return computePosition$1(reference, floating, {\n    ...mergedOptions,\n    platform: platformWithCache\n  });\n};\n\nexport { arrow, autoPlacement, autoUpdate, computePosition, detectOverflow, flip, hide, inline, limitShift, offset, platform, shift, size };\n", "import { computePosition, flip, offset, arrow, autoUpdate, hide, shift, size } from '@floating-ui/dom';\nconst TOP_START = 'top-start';\nconst TOP = 'top';\nconst TOP_END = 'top-end';\nconst RIGHT_START = 'right-start';\nconst RIGHT = 'right';\nconst RIGHT_END = 'right-end';\nconst BOTTOM_START = 'bottom-start';\nconst BOTTOM = 'bottom';\nconst BOTTOM_END = 'bottom-end';\nconst LEFT_START = 'left-start';\nconst LEFT = 'left';\nconst LEFT_END = 'left-end';\nexport const directions = [\n    TOP_START,\n    TOP,\n    TOP_END,\n    RIGHT_START,\n    RIGHT,\n    RIGHT_END,\n    BOTTOM_START,\n    BOTTOM,\n    BOTTOM_END,\n    LEFT_START,\n    LEFT,\n    LEFT_END,\n];\nexport const opposites = {\n    [TOP_START]: BOTTOM_START,\n    [TOP]: BOTTOM,\n    [TOP_END]: BOTTOM_END,\n    [BOTTOM_START]: TOP_START,\n    [BOTTOM]: TOP,\n    [BOTTOM_END]: TOP_END,\n    [LEFT_START]: RIGHT_START,\n    [LEFT]: RIGHT,\n    [LEFT_END]: RIGHT_END,\n    [RIGHT_START]: LEFT_START,\n    [RIGHT]: LEFT,\n    [RIGHT_END]: LEFT_END,\n};\nconst rotation = {\n    [LEFT_START]: -45,\n    [LEFT]: -45,\n    [LEFT_END]: -45,\n    [TOP_START]: 45,\n    [TOP]: 45,\n    [TOP_END]: 45,\n    [RIGHT_START]: 135,\n    [RIGHT]: 135,\n    [RIGHT_END]: 135,\n    [BOTTOM_START]: -135,\n    [BOTTOM]: -135,\n    [BOTTOM_END]: -135,\n};\nexport const arrowDirectionClassname = (dir) => {\n    let direction;\n    if (/-/.test(dir)) {\n        direction = dir\n            .split('-')\n            .map((d) => d.charAt(0).toUpperCase() + d.slice(1))\n            .join('');\n    }\n    else {\n        direction = (dir.charAt(0).toUpperCase() + dir.slice(1));\n    }\n    return direction;\n};\nconst side = (dir) => dir.split('-')[0];\nconst staticSide = (dir) => opposites[side(dir)];\nconst arrowDirection = (dir) => opposites[dir];\nconst arrowRotation = (dir) => rotation[arrowDirection(dir)];\nconst applyArrowStyles = (arrowEl, arrowRotation, dir) => {\n    Object.assign(arrowEl?.style, {\n        borderTopLeftRadius: '4px',\n        zIndex: 1,\n        // border alignment is off by a fraction of a pixel, this fixes it\n        [`margin${arrowDirectionClassname(staticSide(dir))}`]: '-0.5px',\n        transform: `rotate(${arrowRotation}deg)`,\n    });\n};\nconst ELEMENT_PADDING = 8;\nconst ARROW_OFFSET = 24;\nexport async function useRecompute(state) {\n    if (!state?.isShowing)\n        return; // we're not currently showing the element, no reason to recompute\n    if (state?.waitForDOM) {\n        await state?.waitForDOM(); // wait for DOM to settle before computing\n    }\n    if (!state?.targetEl || !state?.attentionEl)\n        return;\n    let targetEl = state?.targetEl;\n    const attentionEl = state.attentionEl;\n    computePosition(targetEl, attentionEl, {\n        placement: state?.directionName ?? BOTTOM,\n        middleware: [\n            offset({ mainAxis: state?.distance ?? 8, crossAxis: state?.skidding ?? 0 }), // offers flexibility over how to place the attentionEl towards its targetEl both on the x and y axis (horizontally and vertically).\n            state?.flip &&\n                flip({\n                    // when flip is set to true it will move the attentionEl's placement to its opposite side or to the preferred placements if fallbackPlacements has a value\n                    crossAxis: state?.crossAxis, // checks overflow to trigger a flip. When disabled, it will ignore overflow\n                    fallbackPlacements: state?.fallbackPlacements,\n                }),\n            state?.flip && shift({ crossAxis: true }), // shifts the attentionEl to make sure that it stays in view\n            !state?.noArrow && state?.arrowEl && arrow({ element: state?.arrowEl }),\n            hide(), // will hide the attentionEl when it appears detached from the targetEl. Can be called multiple times in the middleware-array if you want to use several strategies. Default strategy is 'referenceHidden'.\n            size({\n                apply() {\n                    // Apply equal padding to the left and right sides of the attentionEl to prevent it from overflowing the viewport on smaller screens.\n                    Object.assign(attentionEl.style, {\n                        paddingRight: `${ELEMENT_PADDING}px`,\n                        paddingLeft: `${ELEMENT_PADDING}px`,\n                    });\n                },\n            }),\n        ],\n    }).then(({ x, y, middlewareData, placement }) => {\n        state.actualDirection = placement;\n        // We only want floating-ui to calculate the callout's arrow position and not the attention element's position, since the targetEl can be undefined if isCallout is true.\n        // Therefore, we only add this style to the attentionEl when isCallout is false.\n        if (!state?.isCallout) {\n            Object.assign(attentionEl.style, {\n                left: `${x}px`,\n                top: `${y}px`,\n            });\n        }\n        // Handle visibility based on hide middleware\n        if (middlewareData?.hide && !state?.isCallout) {\n            const { referenceHidden } = middlewareData.hide;\n            Object.assign(attentionEl.style, {\n                visibility: referenceHidden ? 'hidden' : '',\n            });\n        }\n        // Arrow position adjustment\n        if (middlewareData?.arrow && state?.arrowEl) {\n            const arrowEl = state?.arrowEl;\n            const { x: arrowX, y: arrowY } = middlewareData.arrow;\n            const isRtl = window.getComputedStyle(attentionEl).direction === 'rtl'; // Checks RTL for proper arrow alignment\n            const arrowPlacement = arrowDirection(placement).split('-')[1];\n            let top = '', right = '', bottom = '', left = '';\n            // Adjust based on 'start' or 'end' placements\n            if (arrowPlacement === 'start') {\n                const value = typeof arrowX === 'number' ? `calc(${ARROW_OFFSET}px - ${arrowEl.offsetWidth / 2}px)` : '';\n                top = typeof arrowY === 'number' ? `calc(${ARROW_OFFSET}px - ${arrowEl.offsetWidth / 2}px)` : '';\n                right = isRtl ? value : '';\n                left = isRtl ? '' : value;\n            }\n            else if (arrowPlacement === 'end') {\n                const value = typeof arrowX === 'number' ? `calc(${ARROW_OFFSET}px - ${arrowEl.offsetWidth / 2}px)` : '';\n                right = isRtl ? '' : value;\n                left = isRtl ? value : '';\n                bottom = typeof arrowY === 'number' ? `calc(${ARROW_OFFSET}px - ${arrowEl.offsetWidth / 2}px)` : '';\n            }\n            else {\n                // Default positioning with no 'start' or 'end'\n                left = typeof arrowX === 'number' ? `${arrowX}px` : '';\n                top = typeof arrowY === 'number' ? `${arrowY}px` : '';\n            }\n            // Apply the arrow styles\n            Object.assign(arrowEl.style, {\n                top,\n                right,\n                bottom,\n                left,\n            });\n            // Apply arrow rotation styles\n            applyArrowStyles(arrowEl, arrowRotation(placement), placement);\n        }\n    });\n    return state;\n}\nexport const autoUpdatePosition = (state) => {\n    // computePosition is only run once, so we need to wrap autoUpdate() around useRecompute() in order to recompute the attentionEl's position\n    // autoUpdate adds event listeners that are triggered on resize and on scroll and will keep calling the useRecompute().\n    // autoUpdate returns a cleanup() function that removes the event listeners.\n    if (!state?.targetEl || !state?.attentionEl || state?.isCallout)\n        return;\n    return autoUpdate(state?.targetEl, state?.attentionEl, () => {\n        useRecompute(state);\n    });\n};\n", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || defaultLocale\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g LANG environment variable to be set on the server.\n     */\n    const serverLocale =\n      process.env.NMP_LANGUAGE ||\n      Intl.DateTimeFormat().resolvedOptions().locale;\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document.documentElement.lang;\n    return getSupportedLocale(htmlLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages,\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages,\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"attention.aria.callout\\\":[\\\"En gr\u00F8n taleboble der introducerer noget nyt\\\"],\\\"attention.aria.close\\\":[\\\"Luk\\\"],\\\"attention.aria.highlight\\\":[\\\"En opm\u00E6rksomhedsskabende taleboble med vigtig information\\\"],\\\"attention.aria.pointingDown\\\":[\\\"peger nedad\\\"],\\\"attention.aria.pointingLeft\\\":[\\\"peger til venstre\\\"],\\\"attention.aria.pointingRight\\\":[\\\"peger til h\u00F8jre\\\"],\\\"attention.aria.pointingUp\\\":[\\\"peger opad\\\"],\\\"attention.aria.popover\\\":[\\\"En hvid taleboble med mere information\\\"],\\\"attention.aria.tooltip\\\":[\\\"En sort taleboble med flere oplysninger\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"attention.aria.callout\\\":[\\\"A green speech bubble introducing something new\\\"],\\\"attention.aria.close\\\":[\\\"Close\\\"],\\\"attention.aria.highlight\\\":[\\\"An attention speech bubble with important information\\\"],\\\"attention.aria.pointingDown\\\":[\\\"pointing down\\\"],\\\"attention.aria.pointingLeft\\\":[\\\"pointing left\\\"],\\\"attention.aria.pointingRight\\\":[\\\"pointing right\\\"],\\\"attention.aria.pointingUp\\\":[\\\"pointing up\\\"],\\\"attention.aria.popover\\\":[\\\"A white speech bubble providing additional information\\\"],\\\"attention.aria.tooltip\\\":[\\\"A black speech bubble providing complementary information\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"attention.aria.callout\\\":[\\\"Vihre\u00E4 puhekupla, joka esittelee jotain uutta\\\"],\\\"attention.aria.close\\\":[\\\"Sulje\\\"],\\\"attention.aria.highlight\\\":[\\\"Puhekupla, joka sis\u00E4lt\u00E4\u00E4 t\u00E4rke\u00E4\u00E4 tietoa\\\"],\\\"attention.aria.pointingDown\\\":[\\\"osoittaa alas\\\"],\\\"attention.aria.pointingLeft\\\":[\\\"osoittaa vasemmalle\\\"],\\\"attention.aria.pointingRight\\\":[\\\"osoittaa oikealle\\\"],\\\"attention.aria.pointingUp\\\":[\\\"osoittaa yl\u00F6s\\\"],\\\"attention.aria.popover\\\":[\\\"Valkoinen puhekupla, joka tarjoaa lis\u00E4tietoa\\\"],\\\"attention.aria.tooltip\\\":[\\\"Musta puhekupla, joka tarjoaa t\u00E4ydent\u00E4v\u00E4\u00E4 tietoa\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"attention.aria.callout\\\":[\\\"Gr\u00F8nn taleboble som introduserer noe nytt\\\"],\\\"attention.aria.close\\\":[\\\"Lukk\\\"],\\\"attention.aria.highlight\\\":[\\\"En uthevet taleboble med viktig informasjon\\\"],\\\"attention.aria.pointingDown\\\":[\\\"peker ned\\\"],\\\"attention.aria.pointingLeft\\\":[\\\"peker til venstre\\\"],\\\"attention.aria.pointingRight\\\":[\\\"peker til h\u00F8yre\\\"],\\\"attention.aria.pointingUp\\\":[\\\"peker opp\\\"],\\\"attention.aria.popover\\\":[\\\"En hvit taleboble som gir tilleggsinformasjon\\\"],\\\"attention.aria.tooltip\\\":[\\\"En svart taleboble som forklarer konteksten\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"attention.aria.callout\\\":[\\\"En gr\u00F6n pratbubbla som introducerar n\u00E5got nytt\\\"],\\\"attention.aria.close\\\":[\\\"St\u00E4ng\\\"],\\\"attention.aria.highlight\\\":[\\\"En pratbubbla med viktig information\\\"],\\\"attention.aria.pointingDown\\\":[\\\"pekar ned\\\"],\\\"attention.aria.pointingLeft\\\":[\\\"pekar v\u00E4nster\\\"],\\\"attention.aria.pointingRight\\\":[\\\"pekar h\u00F6ger\\\"],\\\"attention.aria.pointingUp\\\":[\\\"pekar upp\\\"],\\\"attention.aria.popover\\\":[\\\"En vit pratbubbla som ger ytterligare information\\\"],\\\"attention.aria.tooltip\\\":[\\\"En svart pratbubbla som ger kompletterande information\\\"]}\");", "import { html } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { badge as ccBadge } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\n\nclass WarpBadge extends WarpElement {\n  static properties = {\n    variant: {\n      type: 'neutral' | 'info' | 'positive' | 'warning' | 'negative' | 'disabled' | 'price',\n    },\n    position: {\n      type: 'top-left' | 'top-right' | 'bottom-right' | 'bottom-left',\n    },\n  };\n\n  static styles = [WarpElement.styles];\n\n  constructor() {\n    super();\n\n    this.variant = 'neutral';\n  }\n\n  get _class() {\n    return classNames([\n      ccBadge.base,\n      ccBadge[this.variant],\n      !!this.position && ccBadge.positionBase,\n      this.position === 'top-left' && ccBadge.positionTL,\n      this.position === 'top-right' && ccBadge.positionTR,\n      this.position === 'bottom-right' && ccBadge.positionBR,\n      this.position === 'bottom-left' && ccBadge.positionBL,\n    ]);\n  }\n\n  render() {\n    return html`\n      <div class=\"${this._class}\">\n        <slot></slot>\n      </div>\n    `;\n  }\n}\n\nif (!customElements.get('w-badge')) {\n  customElements.define('w-badge', WarpBadge);\n}\n\nexport { WarpBadge };\n", "import { css, html, nothing } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { box as ccBox } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\n\nclass WarpBox extends WarpElement {\n  static properties = {\n    bleed: { type: Boolean },\n    bordered: { type: Boolean },\n    info: { type: Boolean },\n    neutral: { type: Boolean },\n    role: { type: String },\n  };\n\n  // Slotted elements remain in lightDOM which allows for control of their style outside of shadowDOM.\n  // ::slotted([Simple Selector]) confirms to Specificity rules, but (being simple) does not add weight to lightDOM skin selectors,\n  // so never gets higher Specificity. Thus in order to overwrite style linked within shadowDOM, we need to use !important.\n  // https://stackoverflow.com/a/61631668\n  static styles = [\n    WarpElement.styles,\n    css`\n      :host {\n        display: block;\n      }\n      ::slotted(:last-child) {\n        margin-bottom: 0 !important;\n      }\n    `,\n  ];\n\n  get _class() {\n    return classNames([\n      ccBox.base,\n      this.bleed && ccBox.bleed,\n      this.info && ccBox.info,\n      this.neutral && ccBox.neutral,\n      this.bordered && ccBox.bordered,\n    ]);\n  }\n\n  get _optOutRoleWithDefault() {\n    return this.role === '' ? nothing : this.role ?? 'region';\n  }\n\n  render() {\n    return html`\n      <div role=\"${this._optOutRoleWithDefault}\" class=\"${this._class}\">\n        <slot></slot>\n      </div>\n    `;\n  }\n}\n\nif (!customElements.get('w-box')) {\n  customElements.define('w-box', WarpBox);\n}\n\nexport { WarpBox };\n", "import { html } from 'lit';\n\nimport { i18n } from '@lingui/core';\nimport { interleave } from '@warp-ds/core/breadcrumbs';\nimport { breadcrumbs as ccBreadcrumbs } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\n\nimport { activateI18n } from '../i18n';\nimport { kebabCaseAttributes } from '../utils';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\n\nconst separator = html`<span class=${ccBreadcrumbs.separator}>/</span>`;\n\nclass WarpBreadcrumbs extends kebabCaseAttributes(WarpElement) {\n  static styles = [WarpElement.styles];\n\n  static properties = {\n    ariaLabel: { type: String },\n  };\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n    this.ariaLabel = i18n._({\n      id: 'breadcrumbs.ariaLabel',\n      message: 'You are here',\n      comment: 'Default screenreader message for the breadcrumb component',\n    });\n  }\n\n  connectedCallback() {\n    super.connectedCallback();\n    // Grab existing children at the point that the component is added to the page\n    const flattenedChildren = Array.from(this.children)\n      .flat(Infinity)\n      .filter((child) => child);\n    const styledChildren = flattenedChildren.map((child, index) => {\n      if (typeof child === 'string') {\n        const isLastEl = index === children.length - 1;\n        return html`<span class=${ccBreadcrumbs.text} aria-current=${isLastEl ? 'page' : undefined}>${child}</span>`;\n      }\n      child.classList.add(child.tagName === 'A' ? ccBreadcrumbs.link : ccBreadcrumbs.text);\n      return child;\n    });\n\n    // Interleave '/' separator with breadcrumbs\n    this._children = interleave(styledChildren, separator);\n  }\n\n  render() {\n    return html`\n      <nav aria-labelledby=\"breadCrumbLabel\">\n        <h2 id=\"breadCrumbLabel\" class=${ccBreadcrumbs.a11y}>${this.ariaLabel}</h2>\n        <div class=${ccBreadcrumbs.wrapper}>${this._children}</div>\n      </nav>\n    `;\n  }\n}\n\nif (!customElements.get('w-breadcrumbs')) {\n  customElements.define('w-breadcrumbs', WarpBreadcrumbs);\n}\n\nexport { WarpBreadcrumbs };\n", "/**\n * Inject a separator between each item in a list\n * @param array List of items\n * @param separator Element to be interleaved between each item\n * @returns\n */\nexport function interleave(array, separator) {\n    return array.flatMap((el) => [el, separator]).slice(0, -1);\n}\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"breadcrumbs.ariaLabel\\\":[\\\"Du er her\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"breadcrumbs.ariaLabel\\\":[\\\"You are here\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"breadcrumbs.ariaLabel\\\":[\\\"Olet t\u00E4ss\u00E4\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"breadcrumbs.ariaLabel\\\":[\\\"Her er du\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"breadcrumbs.ariaLabel\\\":[\\\"Du \u00E4r h\u00E4r\\\"]}\");", "import { html } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { i18n } from '@lingui/core';\nimport { button as ccButton } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\n\nimport { activateI18n } from '../i18n';\nimport { kebabCaseAttributes } from '../utils';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\n\nconst buttonTypes = ['primary', 'secondary', 'negative', 'utility', 'pill', 'link'];\n\nclass WarpButton extends kebabCaseAttributes(WarpElement) {\n  static shadowRootOptions = {\n    ...WarpElement.shadowRootOptions,\n    delegatesFocus: true,\n  };\n\n  static properties = {\n    type: { type: 'button' | 'submit' | 'reset', reflect: true },\n    autofocus: { type: Boolean, reflect: true },\n    variant: { type: String, reflect: true },\n    quiet: { type: Boolean, reflect: true },\n    small: { type: Boolean, reflect: true },\n    loading: { type: Boolean, reflect: true },\n    href: { type: String, reflect: true },\n    target: { type: String, reflect: true },\n    rel: { type: String, reflect: true },\n    fullWidth: { type: Boolean, reflect: true },\n    buttonClass: { type: String, reflect: true },\n  };\n\n  static styles = [WarpElement.styles];\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n    this.variant = 'secondary';\n    this.ariaValueTextLoading = i18n._({\n      id: 'button.aria.loading',\n      message: 'Loading...',\n      comment: 'Screenreader message for buttons that are loading',\n    });\n  }\n\n  connectedCallback() {\n    super.connectedCallback();\n\n    if (!buttonTypes.includes(this.variant)) {\n      throw new Error(`Invalid \"variant\" attribute. Set its value to one of the following:\\n${buttonTypes.join(', ')}.`);\n    }\n  }\n\n  firstUpdated() {\n    if (this.autofocus) {\n      setTimeout(() => this.focus(), 0);\n    }\n  }\n\n  get _primaryClasses() {\n    return [\n      !this.small && !this.quiet && !this.loading && ccButton.primary,\n      this.small && !this.quiet && !this.loading && ccButton.primarySmall,\n      this.small && this.quiet && !this.loading && ccButton.primarySmallQuiet,\n      this.small && this.loading && (this.quiet ? ccButton.primarySmallQuietLoading : ccButton.primarySmallLoading),\n      !this.small && this.quiet && !this.loading && ccButton.primaryQuiet,\n      !this.small && this.loading && (this.quiet ? ccButton.primaryQuietLoading : ccButton.primaryLoading),\n    ];\n  }\n\n  get _secondaryClasses() {\n    return [\n      !this.small && !this.quiet && !this.loading && ccButton.secondary,\n      this.small && !this.quiet && !this.loading && ccButton.secondarySmall,\n      this.small && this.loading && (this.quiet ? ccButton.secondarySmallQuietLoading : ccButton.secondarySmallLoading),\n      this.small && this.quiet && !this.loading && ccButton.secondarySmallQuiet,\n      !this.small && this.quiet && !this.loading && ccButton.secondaryQuiet,\n      !this.small && this.loading && (this.quiet ? ccButton.secondaryQuietLoading : ccButton.secondaryLoading),\n    ];\n  }\n\n  get _utilityClasses() {\n    return [\n      !this.small && !this.quiet && !this.loading && ccButton.utility,\n      this.small && !this.quiet && !this.loading && ccButton.utilitySmall,\n      this.small && this.quiet && !this.loading && ccButton.utilitySmallQuiet,\n      this.small && this.loading && (this.quiet ? ccButton.utilitySmallQuietLoading : ccButton.utilitySmallLoading),\n      !this.small && this.quiet && !this.loading && ccButton.utilityQuiet,\n      !this.small && this.loading && (this.quiet ? ccButton.utilityQuietLoading : ccButton.utilityLoading),\n    ];\n  }\n\n  get _negativeClasses() {\n    return [\n      !this.small && !this.quiet && !this.loading && ccButton.negative,\n      this.small && !this.quiet && !this.loading && ccButton.negativeSmall,\n      this.small && this.quiet && !this.loading && ccButton.negativeSmallQuiet,\n      this.small && this.loading && (this.quiet ? ccButton.negativeSmallQuietLoading : ccButton.negativeSmallLoading),\n      !this.small && this.quiet && !this.loading && ccButton.negativeQuiet,\n      !this.small && this.loading && (this.quiet ? ccButton.negativeQuietLoading : ccButton.negativeLoading),\n    ];\n  }\n\n  get _pillClasses() {\n    return [\n      !this.loading && (this.small ? ccButton.pillSmall : ccButton.pill),\n      this.loading && (this.small ? ccButton.pillSmallLoading : ccButton.pillLoading),\n    ];\n  }\n\n  get _linkClasses() {\n    return [this.small ? ccButton.linkSmall : ccButton.link];\n  }\n  get _classes() {\n    return classNames(this.buttonClass, [\n      this.variant === 'primary' && this._primaryClasses,\n      this.variant === 'secondary' && this._secondaryClasses,\n      this.variant === 'utility' && this._utilityClasses,\n      this.variant === 'negative' && this._negativeClasses,\n      this.variant === 'pill' && this._pillClasses,\n      this.variant === 'link' && this._linkClasses,\n      this.href && ccButton.linkAsButton,\n      this.fullWidth ? ccButton.fullWidth : ccButton.contentWidth,\n    ]);\n  }\n\n  render() {\n    return html` ${this.href\n      ? html`<a\n          href=${this.href}\n          target=${this.target}\n          rel=${this.target === '_blank' ? this.rel || 'noopener' : undefined}\n          class=${this._classes}>\n          <slot></slot>\n        </a>`\n      : html`<button type=${this.type || 'button'} class=${this._classes}>\n          <slot></slot>\n        </button>`}\n    ${this.loading\n      ? html`<span class=\"sr-only\" role=\"progressbar\" aria-valuenow=\"{0}\" aria-valuetext=${this.ariaValueTextLoading}></span>`\n      : null}`;\n  }\n}\n\nif (!customElements.get('w-button')) {\n  customElements.define('w-button', WarpButton);\n}\n\nexport { WarpButton };\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"button.aria.loading\\\":[\\\"Indl\u00E6ser...\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"button.aria.loading\\\":[\\\"Loading...\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"button.aria.loading\\\":[\\\"Ladataan...\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"button.aria.loading\\\":[\\\"Laster...\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"button.aria.loading\\\":[\\\"Laddar ...\\\"]}\");", "import { html, css } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { i18n } from '@lingui/core';\nimport { card as ccCard } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\nimport { ifDefined } from 'lit/directives/if-defined.js';\n\nimport { activateI18n } from '../i18n';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\n\nconst keys = {\n  ENTER: 'Enter',\n  SPACE: ' ',\n};\n\nclass WarpCard extends WarpElement {\n  static properties = {\n    selected: { type: Boolean, reflect: true },\n    flat: { type: Boolean },\n    clickable: { type: Boolean },\n  };\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n    this.selected = false;\n    this.flat = false;\n    this.clickable = false;\n    this.buttonText = i18n._({\n      id: 'card.button.text',\n      message: 'Select',\n      comment: 'Screenreader message to indicate that the card is clickable',\n    });\n  }\n\n  static styles = [\n    WarpElement.styles,\n    css`\n      a::after {\n        content: '';\n        position: absolute;\n        top: 0;\n        right: 0;\n        bottom: 0;\n        left: 0;\n      }\n      :host {\n        display: block;\n      }\n    `,\n  ];\n\n  get _containerClasses() {\n    return classNames([\n      ccCard.base,\n      this.flat ? ccCard.flat : ccCard.shadow,\n      this.selected && !this.flat && ccCard.selected,\n      this.selected && this.flat ? ccCard.flatSelected : ccCard.flatUnselected,\n    ]);\n  }\n\n  get _outlineClasses() {\n    return classNames([ccCard.outline, this.selected ? ccCard.outlineSelected : ccCard.outlineUnselected]);\n  }\n\n  get _interactiveElement() {\n    const renderButton = () =>\n      html`<button class=\"${ccCard.a11y}\" aria-pressed=\"${this.selected}\" tabindex=\"-1\">${this.buttonText}</button>`;\n    const renderSpan = () => html`<span role=\"checkbox\" aria-checked=\"true\" aria-disabled=\"true\"></span>`;\n\n    return this.clickable ? renderButton() : this.selected ? renderSpan() : '';\n  }\n\n  keypressed(e) {\n    if (!this.clickable || e.altKey || e.ctrlKey) return;\n    if (e.key === keys.ENTER || e.key === keys.SPACE) {\n      e.preventDefault();\n      this.click();\n    }\n  }\n\n  render() {\n    return html`\n      <div tabindex=${ifDefined(this.clickable ? '0' : undefined)} class=\"${this._containerClasses}\" @keydown=${this.keypressed}>\n        ${this._interactiveElement} ${this.flat ? '' : html`<div class=\"${this._outlineClasses}\"></div>`}\n        <slot></slot>\n      </div>\n    `;\n  }\n}\n\nif (!customElements.get('w-card')) {\n  customElements.define('w-card', WarpCard);\n}\n\nexport { WarpCard };\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"card.button.text\\\":[\\\"V\u00E6lg\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"card.button.text\\\":[\\\"Select\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"card.button.text\\\":[\\\"Valitse\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"card.button.text\\\":[\\\"Velg\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"card.button.text\\\":[\\\"V\u00E4lj\\\"]}\");", "import { css, html } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { box as ccBox, expandable as ccExpandable } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\nimport { ifDefined } from 'lit/directives/if-defined.js';\n\nimport { kebabCaseAttributes } from '../utils';\n\nimport '@warp-ds/icons/elements/chevron-down-16';\nimport '@warp-ds/icons/elements/chevron-up-16';\n\nclass WarpExpandable extends kebabCaseAttributes(WarpElement) {\n  static properties = {\n    expanded: { type: Boolean, reflect: true },\n    title: { type: String },\n    box: { type: Boolean },\n    bleed: { type: Boolean },\n    buttonClass: { type: String },\n    contentClass: { type: String },\n    noChevron: { type: Boolean },\n    animated: { type: Boolean },\n    headingLevel: { type: Number },\n    _hasTitle: { type: Boolean, state: true },\n    _showChevronUp: { type: Boolean, state: true },\n  };\n\n  constructor() {\n    super();\n\n    this.expanded = false;\n    this.animated = false;\n    this.box = false;\n    this.bleed = false;\n    this.noChevron = false;\n    this._hasTitle = true;\n    this._showChevronUp = this.expanded;\n  }\n\n  // Slotted elements remain in lightDOM which allows for control of their style outside of shadowDOM.\n  // ::slotted([Simple Selector]) confirms to Specificity rules, but (being simple) does not add weight to lightDOM skin selectors,\n  // so never gets higher Specificity. Thus in order to overwrite style linked within shadowDOM, we need to use !important.\n  // https://stackoverflow.com/a/61631668\n  static styles = [\n    WarpElement.styles,\n    css`\n      :host {\n        display: block;\n      }\n      ::slotted(:last-child) {\n        margin-bottom: 0px !important;\n      }\n    `,\n  ];\n\n  updated(changedProperties) {\n    // We need a slight delay for the animation since it has a transition-duration of 150ms:\n    if (changedProperties.has('expanded')) {\n      setTimeout(() => {\n        this._showChevronUp = this.expanded;\n      }, 200);\n    }\n  }\n\n  firstUpdated() {\n    this._hasTitle = !!this.title || this.renderRoot.querySelector(\"slot[name='title']\").assignedNodes().length > 0;\n  }\n\n  get #wrapperClasses() {\n    return classNames([ccExpandable.wrapper, this.box && ccExpandable.box, this.bleed && ccExpandable.bleed]);\n  }\n\n  get #buttonClasses() {\n    return classNames(this.buttonClass, [ccExpandable.button, this.box && ccExpandable.buttonBox]);\n  }\n\n  get #chevronClasses() {\n    return classNames([ccExpandable.chevron, !this.box && ccExpandable.chevronNonBox]);\n  }\n\n  get #chevronIcon() {\n    const upClasses = classNames([\n      ccExpandable.elementsChevronUpTransform,\n      !this.expanded && this._showChevronUp && ccExpandable.elementsChevronCollapse,\n    ]);\n    const downClasses = classNames([\n      ccExpandable.elementsChevronDownTransform,\n      this.expanded && !this._showChevronUp && ccExpandable.elementsChevronExpand,\n    ]);\n\n    return this._showChevronUp\n      ? html`<w-icon-chevron-up-16 class=\"${upClasses}\"></w-icon-chevron-up-16>`\n      : html`<w-icon-chevron-down-16 class=\"${downClasses}\"></w-icon-chevron-down-16>`;\n  }\n\n  get #contentClasses() {\n    return classNames(this.contentClass, [this.box && ccBox.base, this._hasTitle && this.box && ccExpandable.contentWithTitle]);\n  }\n\n  get #expansionClasses() {\n    return classNames([ccExpandable.expansion, !this.expanded && ccExpandable.expansionNotExpanded]);\n  }\n\n  get _expandableSlot() {\n    return html`<div class=\"${this.#contentClasses}\">\n      <slot></slot>\n    </div>`;\n  }\n\n  render() {\n    return html` <div class=\"${this.#wrapperClasses}\">\n      ${this._hasTitle\n        ? html`<w-unstyled-heading level=${this.headingLevel}>\n            <button\n              type=\"button\"\n              aria-expanded=\"${this.expanded}\"\n              class=\"${this.#buttonClasses}\"\n              @click=${() => (this.expanded = !this.expanded)}>\n              <div class=\"${ccExpandable.title}\">\n                ${this.title ? html`<span class=\"${ccExpandable.titleType}\">${this.title}</span>` : html`<slot name=\"title\"></slot>`}\n                ${this.noChevron ? '' : html`<div class=\"${this.#chevronClasses}\">${this.#chevronIcon}</div>`}\n              </div>\n            </button>\n          </w-unstyled-heading>`\n        : ''}\n      ${this.animated\n        ? html`<w-expand-transition ?show=${this.expanded}> ${this._expandableSlot} </w-expand-transition>`\n        : html`<div class=\"${this.#expansionClasses}\" aria-hidden=${ifDefined(!this.expanded ? true : undefined)}>\n            ${this._expandableSlot}\n          </div>`}\n    </div>`;\n  }\n}\n\nif (!customElements.get('w-expandable')) {\n  customElements.define('w-expandable', WarpExpandable);\n}\n\nexport { WarpExpandable };\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/chevron-down/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/chevron-down/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/chevron-down/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/chevron-down/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/chevron-down/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconChevronDown16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Downward arrow`, id: 'icon.title.chevron-down', comment: 'Title for chevron-down icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-chevron-down-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" stroke-width=\"1.5\" d=\"m2.667 5.333 5.5 5.5 5.5-5.5\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-chevron-down-16')) {\n  customElements.define('w-icon-chevron-down-16', IconChevronDown16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-down\\\":[\\\"Nedoverpil\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-down\\\":[\\\"Downward arrow\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-down\\\":[\\\"Nuoli alasp\u00E4in\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-down\\\":[\\\"Pil nedad\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-down\\\":[\\\"Pil ned\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/chevron-up/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/chevron-up/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/chevron-up/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/chevron-up/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/chevron-up/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconChevronUp16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Upward arrow`, id: 'icon.title.chevron-up', comment: 'Title for chevron-up icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-chevron-up-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" stroke-width=\"1.5\" d=\"M2.5 11 8 5.5l5.5 5.5\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-chevron-up-16')) {\n  customElements.define('w-icon-chevron-up-16', IconChevronUp16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-up\\\":[\\\"Oppoverpil\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-up\\\":[\\\"Upward arrow\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-up\\\":[\\\"Nuoli yl\u00F6sp\u00E4in\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-up\\\":[\\\"Pil opad\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-up\\\":[\\\"Pil upp\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { html } from 'lit';\n\nimport { modalElement as ccModal } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\n\nimport { CanCloseMixin, ProvidesCanCloseToSlotsMixin } from './util';\n\nexport class ModalFooter extends CanCloseMixin(ProvidesCanCloseToSlotsMixin(WarpElement)) {\n  render() {\n    return html`\n      <div class=\"${ccModal.footer}\">\n        <slot @slotchange=\"${this.handleSlotChange}\"></slot>\n      </div>\n    `;\n  }\n  static styles = [WarpElement.styles];\n}\n", "export const CanCloseMixin = (superClass) =>\n  class extends superClass {\n    patchClose = true;\n    _close = null;\n    close() {\n      this._close();\n    }\n  };\n\nexport const ProvidesCanCloseToSlotsMixin = (superClass) =>\n  class extends superClass {\n    // HACK: slot-props don't seem to exist and neither does the context pattern for this\n    /** @param {Event} evt */\n    handleSlotChange(evt) {\n      const children = evt.target.assignedNodes({ flatten: true });\n      for (const child of children.filter((e) => e.patchClose)) {\n        child._close = () => this.close();\n      }\n    }\n  };\n", "import { html, nothing } from 'lit';\n\nimport { Move } from '@itsy/animate/move';\nimport { i18n } from '@lingui/core';\nimport { modalElement as ccModal } from '@warp-ds/css/component-classes';\nimport '@warp-ds/icons/elements/arrow-left-16';\nimport '@warp-ds/icons/elements/close-16';\nimport WarpElement from '@warp-ds/elements-core';\nimport { createRef, ref } from 'lit/directives/ref.js';\n\nimport { activateI18n } from '../i18n';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\nimport { CanCloseMixin } from './util.js';\n\nconst NO_CLOSE_BUTTON = 'no-close';\n\nexport class ModalHeader extends CanCloseMixin(WarpElement) {\n  titleEl = createRef();\n\n  static properties = {\n    title: { type: String },\n    back: { type: Boolean },\n    [NO_CLOSE_BUTTON]: { type: Boolean },\n    _hasTopContent: { state: true },\n  };\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n    this._hasTopContent = false;\n  }\n  render() {\n    return html`\n      <div class=\"${ccModal.header}\">\n        <slot name=\"top\" @slotchange=${this.handleTopSlotChange}></slot>\n        <div class=\"${this._hasTopContent ? '' : ccModal.headerTitleBar}\">\n          ${this.backButton}\n          <h1 ${ref(this.titleEl)} class=\"${this.titleClasses}\">${this.title}</h1>\n          ${this.closeButton}\n        </div>\n      </div>\n    `;\n  }\n\n  async willUpdate(changedProperties) {\n    if (changedProperties.has('back')) {\n      const move = new Move(this.titleEl.value);\n      move.when(async () => {\n        await this.updateComplete;\n      });\n    }\n  }\n  get titleClasses() {\n    return [\n      ccModal.headerTitle,\n      this.back ? ccModal.headerTitleWithBackButton : ccModal.headerTitleWithoutBackButton,\n      this._hasTopContent ? ccModal.headerTitleWithTopArea : '',\n    ].join(' ');\n  }\n\n  get backButton() {\n    return this.back && !this._hasTopContent // Not showing back button when there is a top image\n      ? html`<button\n          type=\"button\"\n          aria-label=\"${i18n._({\n            id: 'modal.aria.back',\n            message: 'Back',\n            comment: 'Aria label for the back button in modal',\n          })}\"\n          class=\"${ccModal.headerButton} ${ccModal.headerButtonLeft}\"\n          @click=\"${this.emitBack}\">\n          <w-icon-arrow-left-16></w-icon-arrow-left-16>\n        </button>`\n      : nothing;\n  }\n  get closeButton() {\n    if (this[NO_CLOSE_BUTTON]) return nothing;\n    return html`<button\n      type=\"button\"\n      aria-label=\"${i18n._({\n        id: 'modal.aria.close',\n        message: 'Close',\n        comment: 'Aria label for the close button in modal',\n      })}\"\n      class=\"${ccModal.headerButton} ${this._hasTopContent ? ccModal.headerCloseButtonOnImage : ccModal.headerCloseButton}\"\n      @click=\"${this.close}\">\n      <w-icon-close-16></w-icon-close-16>\n    </button>`;\n  }\n  emitBack() {\n    this.dispatchEvent(new CustomEvent('backClicked', { bubbles: true, composed: true }));\n  }\n  handleTopSlotChange(slotEvent) {\n    const topContent = slotEvent.target.assignedElements({ flatten: true });\n    this._hasTopContent = !!topContent.length;\n  }\n  static styles = [WarpElement.styles];\n}\n", "/** @typedef {import('./move.d.ts').Deltas} Deltas */\n\n/**\n  * @param {DOMRect} first\n  * @param {DOMRect} last\n  * @returns {Deltas}\n  */\nexport const computeDeltas = (first, last) => ({\n  dx: first.left - last.left,\n  dy: first.top - last.top,\n  dw: first.width / last.width,\n  dh: first.height / last.height,\n  first,\n  last,\n})\n\n/** @param {Deltas} deltas */\nexport const moveKeyframes = ({ dx, dy }) => ([\n  { transform: `translate(${dx}px, ${dy}px)` },\n  { transform: 'none' },\n])\n\n/** @type {KeyframeAnimationOptions} */\nexport const animationDefaults = { easing: 'ease', duration: 300 }\n", "export let reduceMotion = false\n\nconst windowExists = (typeof window !== 'undefined')\nif (windowExists) {\n  const query = window.matchMedia('(prefers-reduced-motion: reduce)')\n  const callback = ({ matches }) => reduceMotion = matches\n  // older browsers don't support the new API, and the old API is deprecated\n  if (query.addEventListener) query.addEventListener('change', callback)\n  callback(query)\n}\n\n", "import { moveKeyframes, computeDeltas, animationDefaults } from './utility.js'\nimport { reduceMotion } from './reduce-motion.js'\n\nexport class Move {\n  /** @type {DOMRect | {}} */\n  first;\n  /** @type {DOMRect | {}} */\n  last;\n  /** @type {HTMLElement} */\n  el;\n\n  constructor(el, { animation = {}, keyframes, respectReduceMotion = true } = {}) {\n    this.el = el\n    this.first = {}\n    this.last = {}\n    this.userAnimationOptions = animation\n    this.keyframeGenerator = keyframes || moveKeyframes\n    this.shouldReduceMotion = respectReduceMotion\n  }\n\n  async when(cb) {\n    this.prep()\n    const v = await cb()\n    await this.play()\n    return v\n  }\n\n  prep() {\n    this.first = this.el.getBoundingClientRect()\n  }\n\n  async play() {\n    this.last = this.el.getBoundingClientRect()\n    if (!this.el.animate) return\n    const animation = this.el.animate(this.keyframes, this.animationOptions)\n    await animation.finished\n  }\n\n  get keyframes() {\n    return this.keyframeGenerator(computeDeltas(this.first, this.last))\n  }\n\n  get defaults() {\n    return animationDefaults\n  }\n\n  get mergedOptions() {\n    return { ...this.defaults, ...this.userAnimationOptions }\n  }\n\n  get animationOptions() {\n    if (!this.shouldReduceMotion) return this.mergedOptions\n    if (!reduceMotion) return this.mergedOptions\n    return { ...this.mergedOptions, duration: 0 }\n  }\n}\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/arrow-left/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/arrow-left/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/arrow-left/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/arrow-left/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/arrow-left/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconArrowLeft16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Leftward-pointing arrow`, id: 'icon.title.arrow-left', comment: 'Title for table arrow left icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-arrow-left-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-width=\"1.5\" d=\"M5.222 8h6.667\"></path><path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" stroke-width=\"1.5\" d=\"M7.444 11.75 4.111 8l3.333-3.75\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-arrow-left-16')) {\n  customElements.define('w-icon-arrow-left-16', IconArrowLeft16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.arrow-left\\\":[\\\"Pil som peker mot venstre\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.arrow-left\\\":[\\\"Leftward-pointing arrow\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.arrow-left\\\":[\\\"Vasemmalle osoittava nuoli\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.arrow-left\\\":[\\\"Pil til venstre\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.arrow-left\\\":[\\\"Pil som pekar v\u00E4nster\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"modal.aria.back\\\":[\\\"Tilbage\\\"],\\\"modal.aria.close\\\":[\\\"Luk\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"modal.aria.back\\\":[\\\"Back\\\"],\\\"modal.aria.close\\\":[\\\"Close\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"modal.aria.back\\\":[\\\"Takaisin\\\"],\\\"modal.aria.close\\\":[\\\"Sulje\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"modal.aria.back\\\":[\\\"Tilbake\\\"],\\\"modal.aria.close\\\":[\\\"Lukk\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"modal.aria.back\\\":[\\\"Tillbaka\\\"],\\\"modal.aria.close\\\":[\\\"St\u00E4ng\\\"]}\");", "import { css, html } from 'lit';\n\nimport { modalElement as ccModal } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\nimport { createRef, ref } from 'lit/directives/ref.js';\nimport { setup as setupScrollLock, teardown as teardownScrollLock } from 'scroll-doctor';\n\nimport { ProvidesCanCloseToSlotsMixin } from './util.js';\n\nconst NO_BACKDROP_CLICKS = 'ignore-backdrop-clicks';\nconst CONTENT_ID = 'content-id';\n\nexport class ModalMain extends ProvidesCanCloseToSlotsMixin(WarpElement) {\n  dialogEl = createRef();\n  dialogInnerEl = createRef();\n  contentEl = createRef();\n\n  static properties = {\n    show: { type: Boolean },\n    [CONTENT_ID]: { type: String },\n    [NO_BACKDROP_CLICKS]: { type: Boolean },\n  };\n\n  constructor() {\n    super();\n    this.interceptEscape = this.interceptEscape.bind(this);\n    this.closeOnBackdropClick = this.closeOnBackdropClick.bind(this);\n    this.eventPreventer = this.eventPreventer.bind(this);\n    this.modifyBorderRadius = this.modifyBorderRadius.bind(this);\n  }\n\n  async open() {\n    this.dialogEl.value.showModal();\n    this.handleListeners();\n    setupScrollLock(this.contentEl.value);\n    await this.updateComplete;\n    this.dispatchEvent(new CustomEvent('shown', { bubbles: true, composed: true }));\n  }\n\n  close() {\n    this.handleListeners('removeEventListener');\n    this.dialogEl.value.classList.add('close');\n    this.dialogEl.value.addEventListener(\n      'animationend',\n      async () => {\n        this.dialogEl.value.classList.remove('close');\n        this.dialogEl.value.close();\n        teardownScrollLock();\n        await this.updateComplete;\n        this.dispatchEvent(new CustomEvent('hidden', { bubbles: true, composed: true }));\n      },\n      { once: true },\n    );\n  }\n\n  render() {\n    return html`\n      <dialog ${ref(this.dialogEl)} class=\"w-modal ${ccModal.dialogEl}\">\n        <div ${ref(this.dialogInnerEl)} class=\"${ccModal.dialogInner}\">\n          <slot name=\"header\" @slotchange=\"${this.handleSlotChange}\"></slot>\n          <div ${ref(this.contentEl)} class=\"${ccModal.contentSlot}\" id=${this[CONTENT_ID]}>\n            <slot name=\"content\" @slotchange=\"${this.handleSlotChange}\"></slot>\n          </div>\n          <slot name=\"footer\" @slotchange=\"${this.handleSlotChange}\"></slot>\n        </div>\n      </dialog>\n    `;\n  }\n\n  willUpdate(changedProperties) {\n    if (changedProperties.has('show')) this[this.show ? 'open' : 'close']();\n  }\n\n  handleListeners(verb = 'addEventListener') {\n    // HACK: escape normally fires 'cancel' but 'cancel' can only be intercepted once (browser bug/quirk)\n    document[verb]('keydown', this.interceptEscape);\n    // Using 'mousedown' instead of 'click' because mouse-up events on the backdrop also trigger 'click'\n    if (!this[NO_BACKDROP_CLICKS]) this.dialogEl.value[verb]('mousedown', this.closeOnBackdropClick);\n    // HACK: 'close' fires once the dialog is closed, thus it's cannot animate\n    this.dialogEl.value[verb]('close', this.eventPreventer);\n    // HACK: this might not be needed since escape is intercepted, but better to be safe\n    this.dialogEl.value[verb]('cancel', this.eventPreventer);\n\n    this.dialogInnerEl.value[verb]('transitionend', this.modifyBorderRadius);\n  }\n\n  /** @param {Event} evt */\n  eventPreventer(evt) {\n    evt.preventDefault();\n  }\n\n  /** @param {MouseEvent} evt */\n  closeOnBackdropClick(evt) {\n    if (this.dialogEl.value === evt.target) this.close();\n  }\n\n  /** @param {KeyboardEvent} evt */\n  interceptEscape(evt) {\n    if (evt.key === 'Escape') {\n      evt.preventDefault();\n      this.close();\n    }\n  }\n\n  modifyBorderRadius() {\n    if (this.dialogInnerEl.value.scrollHeight * 1.02 > innerHeight) this.dialogInnerEl.value.style.borderRadius = '0px';\n    else this.dialogInnerEl.value.style.borderRadius = null;\n  }\n\n  static styles = [\n    WarpElement.styles,\n    css`\n      .w-modal {\n        --w-modal-translate-distance: 100%;\n      }\n      @media (min-width: 480px) {\n        .w-modal {\n          --w-modal-translate-distance: 50%;\n        }\n      }\n      .w-modal[open] {\n        animation: w-modal-in 0.3s ease-in-out forwards;\n      }\n      .w-modal.close {\n        animation: w-modal-out 0.3s ease-in-out forwards;\n      }\n      .w-modal[open]::backdrop {\n        animation: backdrop-in 0.3s ease-in-out forwards;\n      }\n      .w-modal.close::backdrop {\n        animation: backdrop-out 0.3s ease-in-out forwards;\n      }\n      /* shouldn't need two (in/out) animations declared here, but reversing is being weird */\n      @keyframes w-modal-in {\n        from {\n          transform: translateY(var(--w-modal-translate-distance));\n          opacity: 0;\n        }\n        to {\n          transform: translateY(0);\n          opacity: 1;\n        }\n      }\n      @keyframes w-modal-out {\n        from {\n          transform: translateY(0);\n          opacity: 1;\n        }\n        to {\n          transform: translateY(var(--w-modal-translate-distance));\n          opacity: 0;\n        }\n      }\n      @keyframes backdrop-in {\n        from {\n          background: transparent;\n        }\n        to {\n          background: rgba(0, 0, 0, 0.25);\n        }\n      }\n      @keyframes backdrop-out {\n        from {\n          background: rgba(0, 0, 0, 0.25);\n        }\n        to {\n          background: transparent;\n        }\n      }\n    `,\n  ];\n}\n", "let n = [];\nconst c = { documentElement: {}, body: {} }, i = Object.freeze({\n  // html\n  documentElement: {\n    \"scrollbar-gutter\": \"stable\"\n  },\n  body: {\n    overflow: \"hidden\",\n    position: \"relative\",\n    height: \"100%\"\n  }\n}), r = (t) => {\n  t.touches.length > 1 || t.preventDefault?.();\n}, h = (t) => ([e, s]) => {\n  c[t][e] = document[t].style[e], document[t].style[e] = s;\n}, a = () => Object.entries(i).forEach(([t, e]) => {\n  Object.entries(e).forEach(h(t));\n}), d = (t) => ([e, s]) => {\n  document[t].style[e] = c[t][e];\n}, f = () => Object.entries(c).forEach(([t, e]) => {\n  Object.entries(e).forEach(d(t));\n}), m = (t) => t.scrollHeight - Math.abs(t.scrollTop) === t.clientHeight;\nfunction y(t) {\n  let e = -1;\n  const s = (o) => {\n    if (o.targetTouches.length !== 1)\n      return;\n    const l = o.targetTouches[0].clientY - e;\n    return t.scrollTop === 0 && l > 0 || m(t) && l < 0 ? r(o) : (o.stopPropagation(), !0);\n  };\n  t.ontouchstart = (o) => {\n    o.targetTouches.length === 1 && (e = o.targetTouches[0].clientY);\n  }, t.ontouchmove = s;\n}\nfunction p(t) {\n  t.ontouchstart = null, t.ontouchmove = null;\n}\nconst u = (t) => () => document[t ? \"addEventListener\" : \"removeEventListener\"](\"touchmove\", r, { passive: !1 }), b = u(!0), g = u();\nfunction E(t) {\n  if (!t)\n    throw Error(\"Could not run setup, an element must be provided\");\n  n.some((e) => e === t) || (n.length || (a(), b()), y(t), n.push(t));\n}\nfunction T() {\n  n.forEach(p), g(), f(), n = [];\n}\nexport {\n  f as resetStyles,\n  a as setStyles,\n  E as setup,\n  i as styleTargets,\n  T as teardown\n};\n", "import { ModalFooter } from './modal-footer.js';\nimport { ModalHeader } from './modal-header.js';\nimport { ModalMain } from './modal-main.js';\nimport { CanCloseMixin, ProvidesCanCloseToSlotsMixin } from './util.js';\n\nif (!customElements.get('w-modal')) {\n  customElements.define('w-modal', ModalMain);\n  customElements.define('w-modal-header', ModalHeader);\n  customElements.define('w-modal-footer', ModalFooter);\n}\n\nexport {\n  ModalMain as WarpModal,\n  ModalHeader as WarpModalHeader,\n  ModalFooter as WarpModalFooter,\n  CanCloseMixin as ModalCanCloseMixin,\n  ProvidesCanCloseToSlotsMixin as ModalProvidesCanCloseToSlotsMixin,\n};\n", "import '@warp-ds/icons/elements/close-16';\n\nimport { html } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { i18n } from '@lingui/core';\nimport { pill as ccPill } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\n\nimport { activateI18n } from '../i18n';\nimport { kebabCaseAttributes } from '../utils';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\n\nclass WarpPill extends kebabCaseAttributes(WarpElement) {\n  static styles = [WarpElement.styles];\n\n  static properties = {\n    canClose: { type: Boolean },\n    suggestion: { type: Boolean },\n    openSrLabel: { type: String },\n    closeSrLabel: { type: String },\n  };\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n    this.canClose = false;\n    this.suggestion = false;\n\n    this.openFilterSrText = i18n._({\n      id: 'pill.aria.openFilter',\n      message: 'Open filter',\n      comment: 'Fallback screenreader message for open filter',\n    });\n\n    this.removeFilterSrText = i18n._({\n      id: 'pill.aria.removeFilter',\n      message: 'Remove filter {label}',\n      comment: 'Fallback screenreader message for removal of the filter',\n    });\n  }\n\n  get _labelClasses() {\n    return classNames([\n      ccPill.button,\n      ccPill.label,\n      this.suggestion ? ccPill.suggestion : ccPill.filter,\n      this.canClose ? ccPill.labelWithClose : ccPill.labelWithoutClose,\n    ]);\n  }\n\n  get _closeClasses() {\n    return classNames([ccPill.button, ccPill.close, this.suggestion ? ccPill.suggestion : ccPill.filter]);\n  }\n\n  _onClick() {\n    this.dispatchEvent(new CustomEvent('w-pill-click', { bubbles: true, composed: true }));\n  }\n\n  _onClose() {\n    this.dispatchEvent(new CustomEvent('w-pill-close', { bubbles: true, composed: true }));\n  }\n\n  render() {\n    return html`\n      <div class=\"${ccPill.wrapper}\">\n        <button type=\"button\" class=\"${this._labelClasses}\" @click=\"${this._onClick}\">\n          <span class=\"${ccPill.a11y}\">${this.openSrLabel ? this.openSrLabel : this.openFilterSrText}</span>\n          <slot></slot>\n        </button>\n        ${this.canClose\n          ? html`<button type=\"button\" class=\"${this._closeClasses}\" @click=\"${this._onClose}\">\n              <span class=\"${ccPill.a11y}\">${this.closeSrLabel ? this.closeSrLabel : this.removeFilterSrText}</span>\n              <w-icon-close-16></w-icon-close-16>\n            </button>`\n          : null}\n      </div>\n    `;\n  }\n}\n\nif (!customElements.get('w-pill')) {\n  customElements.define('w-pill', WarpPill);\n}\n\nexport { WarpPill };\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"pill.aria.openFilter\\\":[\\\"\u00C5bn filter\\\"],\\\"pill.aria.removeFilter\\\":[\\\"Fjern filter \\\",[\\\"label\\\"]]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"pill.aria.openFilter\\\":[\\\"Open filter\\\"],\\\"pill.aria.removeFilter\\\":[\\\"Remove filter \\\",[\\\"label\\\"]]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"pill.aria.openFilter\\\":[\\\"Avaa suodatin\\\"],\\\"pill.aria.removeFilter\\\":[\\\"Tyhjenn\u00E4 suodatin \\\",[\\\"label\\\"]]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"pill.aria.openFilter\\\":[\\\"\u00C5pne filter\\\"],\\\"pill.aria.removeFilter\\\":[\\\"Fjern filter \\\",[\\\"label\\\"]]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"pill.aria.openFilter\\\":[\\\"\u00D6ppna filter\\\"],\\\"pill.aria.removeFilter\\\":[\\\"Ta bort filtret \\\",[\\\"label\\\"]]}\");", "import { html } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { i18n } from '@lingui/core';\nimport { select as ccSelect, helpText as ccHelpText, label as ccLabel } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\nimport { ifDefined } from 'lit/directives/if-defined.js';\nimport { unsafeHTML } from 'lit/directives/unsafe-html.js';\nimport { when } from 'lit/directives/when.js';\n\nimport { activateI18n } from '../i18n';\nimport { kebabCaseAttributes } from '../utils';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\n\nimport '@warp-ds/icons/elements/chevron-down-16';\n\nexport class WarpSelect extends kebabCaseAttributes(WarpElement) {\n  static properties = {\n    // Whether the element should receive focus on render\n    autoFocus: { type: Boolean, reflect: true },\n\n    // Renders the field in an invalid state. Often paired with `hint` to provide feedback about the error\n    invalid: { type: Boolean, reflect: true },\n\n    // Whether to always show a hint\n    always: { type: Boolean, reflect: true },\n\n    // The content displayed as the help text\n    hint: { type: String, reflect: true },\n\n    // The content to disply as the label\n    label: { type: String, reflect: true },\n\n    // Whether to show optional text\n    optional: { type: Boolean, reflect: true },\n\n    // Renders the field in a disabled state.\n    disabled: { type: Boolean, reflect: true },\n\n    // Renders the field in a readonly state.\n    readOnly: { type: Boolean, relfect: true },\n\n    _options: { state: true },\n  };\n\n  static styles = [WarpElement.styles];\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n    this._options = this.innerHTML;\n  }\n\n  firstUpdated() {\n    // autofocus doesn't seem to behave properly in Safari and FireFox, therefore we set the focus here:\n    this.autoFocus && this.shadowRoot.querySelector('select').focus();\n  }\n\n  handleKeyDown(event) {\n    if (this.readOnly && (event.key === ' ' || event.key === 'ArrowDown' || event.key === 'ArrowUp')) {\n      event.preventDefault();\n    }\n  }\n\n  get #classes() {\n    return classNames([\n      ccSelect.base,\n      !this.invalid && !this.disabled && !this.readOnly && ccSelect.default,\n      this.invalid && ccSelect.invalid,\n      this.disabled && ccSelect.disabled,\n      this.readOnly && ccSelect.readOnly,\n    ]);\n  }\n\n  get #helpTextClasses() {\n    return classNames([ccHelpText.base, this.invalid ? ccHelpText.colorInvalid : ccHelpText.color]);\n  }\n\n  get #chevronClasses() {\n    return classNames([ccSelect.chevron, this.disabled && ccSelect.chevronDisabled]);\n  }\n\n  get #id() {\n    return 'select_id';\n  }\n\n  get #helpId() {\n    return this.hint ? `${this.#id}__hint` : undefined;\n  }\n\n  // Fire a custom 'change' event, used when the dropdown changes state.\n  onChange({ target }) {\n    const event = new CustomEvent('change', { detail: target.value });\n\n    this.dispatchEvent(event);\n  }\n\n  render() {\n    return html`<div class=\"${ccSelect.wrapper}\">\n      ${when(\n        this.label,\n        () =>\n          html`<label class=\"${ccLabel.base}\" for=\"${this.#id}\">\n            ${this.label}\n            ${when(\n              this.optional,\n              () =>\n                html`<span class=\"${ccLabel.optional}\"\n                  >${i18n._({\n                    id: 'select.label.optional',\n                    message: '(optional)',\n                    comment: 'Shown behind label when marked as optional',\n                  })}</span\n                >`,\n            )}</label\n          >`,\n      )}\n      <div class=\"${ccSelect.selectWrapper}\">\n        <select\n          class=\"${this.#classes}\"\n          id=\"${this.#id}\"\n          ?disabled=${this.disabled}\n          aria-describedby=\"${ifDefined(this.#helpId)}\"\n          aria-invalid=\"${ifDefined(this.invalid)}\"\n          aria-errormessage=\"${ifDefined(this.invalid && this.#helpId)}\"\n          @keydown=${this.handleKeyDown}\n          @change=${this.onChange}>\n          ${unsafeHTML(this._options)}\n        </select>\n        <div class=\"${this.#chevronClasses}\">\n          <w-icon-chevron-down-16></w-icon-chevron-down-16>\n        </div>\n      </div>\n      ${when(this.always || this.invalid, () => html`<div id=\"${this.#helpId}\" class=\"${this.#helpTextClasses}\">${this.hint}</div>`)}\n    </div>`;\n  }\n}\n\nif (!customElements.get('w-select')) {\n  customElements.define('w-select', WarpSelect);\n}\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"select.label.optional\\\":[\\\"(valgfrit)\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"select.label.optional\\\":[\\\"(optional)\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"select.label.optional\\\":[\\\"(vapaaehtoinen)\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"select.label.optional\\\":[\\\"(valgfritt)\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"select.label.optional\\\":[\\\"(valfritt)\\\"]}\");", "import { css, html } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { input as ccInput, label as ccLabel, helpText as ccHelpText } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\nimport { ifDefined } from 'lit/directives/if-defined.js';\n\nimport { kebabCaseAttributes } from '../utils';\n\nclass WarpTextField extends kebabCaseAttributes(WarpElement) {\n  static properties = {\n    disabled: { type: Boolean },\n    invalid: { type: Boolean },\n    id: { type: String },\n    label: { type: String },\n    helpText: { type: String },\n    size: { type: String },\n    max: { type: Number },\n    min: { type: Number },\n    minLength: { type: Number },\n    maxLength: { type: Number },\n    name: { type: String },\n    pattern: { type: String },\n    placeholder: { type: String },\n    readOnly: { type: Boolean },\n    required: { type: Boolean },\n    type: { type: String },\n    value: { type: String },\n    _hasPrefix: { state: true },\n    _hasSuffix: { state: true },\n  };\n\n  // Slotted elements remain in lightDOM which allows for control of their style outside of shadowDOM.\n  // ::slotted([Simple Selector]) confirms to Specificity rules, but (being simple) does not add weight to lightDOM skin selectors,\n  // so never gets higher Specificity. Thus in order to overwrite style linked within shadowDOM, we need to use !important.\n  // https://stackoverflow.com/a/61631668\n  static styles = [\n    WarpElement.styles,\n    css`\n      :host {\n        display: block;\n      }\n      ::slotted(:last-child) {\n        margin-bottom: 0px !important;\n      }\n    `,\n  ];\n\n  constructor() {\n    super();\n    this.type = 'text';\n  }\n\n  get _inputStyles() {\n    return classNames([\n      ccInput.base,\n      this._hasSuffix && ccInput.suffix,\n      this._hasPrefix && ccInput.prefix,\n      !this.invalid && !this.disabled && !this.readOnly && ccInput.default,\n      this.invalid && !this.disabled && !this.readOnly && ccInput.invalid,\n      !this.invalid && this.disabled && !this.readOnly && ccInput.disabled,\n      !this.invalid && !this.disabled && this.readOnly && ccInput.readOnly,\n    ]);\n  }\n\n  get _helpTextStyles() {\n    return classNames([ccHelpText.base, this.invalid ? ccHelpText.colorInvalid : ccHelpText.color]);\n  }\n\n  get _label() {\n    if (this.label) {\n      return html`<label for=\"${this._id}\" class=${ccLabel.base}>${this.label}</label>`;\n    }\n  }\n\n  get _helpId() {\n    if (this.helpText) return `${this._id}__hint`;\n  }\n\n  get _id() {\n    return 'textfield';\n  }\n\n  get _error() {\n    if (this.invalid && this._helpId) return this._helpId;\n  }\n\n  handler(e) {\n    const { name, value } = e.target;\n    const event = new CustomEvent(e.type, {\n      detail: {\n        name,\n        value,\n        target: e.target,\n      },\n    });\n    this.dispatchEvent(event);\n  }\n\n  prefixSlotChange(e) {\n    const el = this.renderRoot.querySelector('slot[name=prefix]');\n    const affixes = el.assignedElements();\n    if (affixes.length) this._hasPrefix = true;\n  }\n\n  suffixSlotChange(e) {\n    const el = this.renderRoot.querySelector('slot[name=suffix]');\n    const affixes = el.assignedElements();\n    if (affixes.length) this._hasSuffix = true;\n  }\n\n  render() {\n    return html`\n      ${this._label}\n      <div class=\"${ccInput.wrapper}\">\n        <slot @slotchange=\"${this.prefixSlotChange}\" name=\"prefix\"></slot>\n        <input\n          class=\"${this._inputStyles}\"\n          type=\"${this.type}\"\n          min=\"${ifDefined(this.min)}\"\n          max=\"${ifDefined(this.max)}\"\n          size=\"${ifDefined(this.size)}\"\n          minlength=\"${ifDefined(this.minLength)}\"\n          maxlength=\"${ifDefined(this.maxLength)}\"\n          name=\"${ifDefined(this.name)}\"\n          pattern=\"${ifDefined(this.pattern)}\"\n          placeholder=\"${ifDefined(this.placeholder)}\"\n          value=\"${ifDefined(this.value)}\"\n          aria-describedby=\"${ifDefined(this._helpId)}\"\n          aria-errormessage=\"${ifDefined(this._error)}\"\n          aria-invalid=\"${ifDefined(this.invalid)}\"\n          id=\"${this._id}\"\n          ?disabled=\"${this.disabled}\"\n          ?readonly=\"${this.readOnly}\"\n          ?required=\"${this.required}\"\n          @blur=\"${this.handler}\"\n          @change=\"${this.handler}\"\n          @focus=\"${this.handler}\" />\n        <slot @slotchange=\"${this.suffixSlotChange}\" name=\"suffix\"></slot>\n      </div>\n      ${this.helpText && html`<div class=\"${this._helpTextStyles}\" id=\"${this._helpId}\">${this.helpText}</div>`}\n    `;\n  }\n}\n\nif (!customElements.get('w-textfield')) {\n  customElements.define('w-textfield', WarpTextField);\n}\n\nexport { WarpTextField };\n", "export const windowExists = typeof window !== 'undefined';\n", "import { windowExists } from '../utils/window-exists';\n\n/**\n * Toast helper function options\n * @typedef    {Object}                         ToastOptions\n * @property   {(number|string)}                [id]        Custom identifier\n * @property   {('success'|'error'|'warning')}  [type]      Type of toast\n * @property   {String}                         [text]      The toast message. Only needed when updating text on existing toast\n * @property   {(number|string)}                [duration]  Duration of toast in milliseconds. Defaults to 5000. For accessibility reasons, toasts should never be interactive and therefore need to auto remove. If you must disable auto remove, set duration to Number.POSITIVE_INFINITY.\n * @property   {Boolean}                        [canclose]  Whether the toast can be dismissed. Defaults to false. WARNING! For accessibility reasons, toasts should not be interactive and canclose should always be false. If the toast absolutely must be dismissable, set this to true.\n */\n\n/**\n * Creates a new toast\n * @param {String}        message  Message\n * @param {ToastOptions?} options  Toast options\n * @returns {ToastOptions} Toast details\n */\nexport function toast(message, options) {\n  if (!windowExists) return;\n  const toast = customElements.get('w-toast-container').init();\n\n  const data = {\n    id: Date.now().toString(36) + Math.random().toString(36).slice(2, 5),\n    text: message,\n    duration: 5000,\n    type: 'success',\n    ...options,\n  };\n\n  toast.set(data);\n  return data;\n}\n\n/**\n * Remove an existing toast\n * @param {String|Number} id Toast identifier\n * @return {Promise<Boolean>} Resolves to true if deleted, false if not found\n */\nexport function removeToast(id) {\n  if (!windowExists) return;\n  const toast = customElements.get('w-toast-container').init();\n  return toast.del(id);\n}\n\n/**\n * Update an existing toast\n * @param {String|Number}           id      Toast identifier\n * @param {ToastOptions?}           options Toast options\n * @returns {WarpToastContainer}          Toast details\n */\nexport function updateToast(id, options) {\n  if (!windowExists) return;\n  const toast = customElements.get('w-toast-container').init();\n  toast.set({ ...toast.get(id), ...options });\n  return toast.get(id);\n}\n", "import { css, html } from 'lit';\n\nimport { toaster as ccToastContainer } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\nimport { repeat } from 'lit/directives/repeat.js';\n\n/**\n * Toast helper function options\n * @typedef    {Object}                               ToastOptions\n * @property   {(number|string)}                      [id]        Custom identifier\n * @property   {('success'|'error'|'warning')}        [type]      Type of alert\n * @property   {String}                               [text]      The toast message. Only needed when updating text on existing toast\n * @property   {(number|string)}                      [duration]  Duration of toast in milliseconds. Defaults to 5000. For accessibility reasons, toasts should never be interactive and therefore need to auto remove. If you must disable auto remove, set duration to Number.POSITIVE_INFINITY.\n * @property   {Boolean}                              [canClose]  Whether the toast can be dismissed. Defaults to false. WARNING! For accessibility reasons, toasts should not be interactive and canclose should always be false. If the toast absolutely must be dismissble, set this to true.\n */\n\nexport class WarpToastContainer extends WarpElement {\n  static styles = [\n    WarpElement.styles,\n    css`\n      :host {\n        display: block;\n      }\n    `,\n  ];\n\n  static properties = {\n    _toasts: { state: true },\n  };\n\n  constructor() {\n    super();\n    this._toasts = new Map();\n  }\n\n  connectedCallback() {\n    super.connectedCallback();\n\n    // regularly check if any toasts have expired\n    this._interval = setInterval(() => {\n      // sort toasts into keep and remove\n      const keep = [];\n      const remove = [];\n      for (const toast of this._toasts) {\n        if (Date.now() <= toast[1].duration) keep.push(toast);\n        else remove.push(toast);\n      }\n      // collapse toasts that will be removed\n      const collapseTasks = [];\n      for (const [id] of remove) {\n        const el = this.renderRoot.querySelector(`#${id}`);\n        collapseTasks.push(el.collapse());\n      }\n      // once all toasts that should be removed have been collapsed, remove them from the map\n      Promise.all(collapseTasks).then(() => {\n        if (keep.length !== this._toasts.size) this._toasts = new Map(keep);\n      });\n    }, 500);\n  }\n\n  disconnectedCallback() {\n    super.disconnectedCallback();\n    if (this._interval) clearTimeout(this._interval);\n  }\n\n  static init() {\n    let el = document.querySelector('w-toast-container');\n    if (!el) {\n      el = document.createElement('w-toast-container');\n      document.body.appendChild(el);\n    }\n    return el;\n  }\n\n  get _toastsArray() {\n    return Array.from(this._toasts).map(([, toast]) => toast);\n  }\n\n  /**\n   *\n   * @param {String|Number} id\n   * @returns {ToastOptions}\n   */\n  get(id) {\n    if (!id) {\n      throw new Error('undefined \"id\" given when attempting to retrieve toast');\n    }\n    if (typeof id !== 'string' && !Number.isInteger(id)) throw new Error('\"id\" must be number or string when attempting to retrieve toast');\n    return this._toasts.get(id);\n  }\n\n  /**\n   *\n   * @param {Object} toast\n   * @returns {WarpToastContainer}\n   */\n  set(toast) {\n    if (!toast.id) throw new Error('invalid or undefined \"id\" on toast object');\n    const result = this._toasts.set(toast.id, {\n      ...toast,\n      duration: Date.now() + (toast.duration || 5000),\n    });\n    this._toasts = new Map(Array.from(this._toasts));\n    return result;\n  }\n\n  /**\n   *\n   * @param {String|Number} id\n   * @returns {ToastOptions | false}\n   */\n  async del(id) {\n    if (!id) {\n      throw new Error('undefined \"id\" given when attempting to retrieve toast');\n    }\n    if (typeof id !== 'string' && !Number.isInteger(id)) throw new Error('\"id\" must be number or string when attempting to retrieve toast');\n    const el = this.renderRoot.querySelector(`#${id}`);\n    if (!this._toasts.has(id)) return false;\n    await el.collapse();\n    const result = this._toasts.delete(id);\n    this._toasts = new Map(Array.from(this._toasts));\n    return result;\n  }\n\n  render() {\n    return html`\n      <aside class=\"${ccToastContainer.wrapper}\">\n        <div class=\"${ccToastContainer.base}\" id=\"w-toast-container-list\">\n          ${repeat(\n            this._toastsArray,\n            (toast) => toast.id,\n            (toast) =>\n              html` <w-toast\n                class=\"${ccToastContainer.content}\"\n                id=\"${toast.id}\"\n                type=\"${toast.type}\"\n                text=\"${toast.text}\"\n                ?canclose=${toast.canclose}\n                @close=${() => this.del(toast.id)}>\n              </w-toast>`,\n          )}\n        </div>\n      </aside>\n    `;\n  }\n}\n\nif (!customElements.get('w-toast-container')) {\n  customElements.define('w-toast-container', WarpToastContainer);\n}\n", "import { css, html } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { i18n } from '@lingui/core';\nimport { toast as ccToast } from '@warp-ds/css/component-classes';\nimport WarpElement from '@warp-ds/elements-core';\nimport { expand, collapse } from 'element-collapse';\nimport { when } from 'lit/directives/when.js';\nimport '@warp-ds/icons/elements/warning-16';\nimport '@warp-ds/icons/elements/error-16';\nimport '@warp-ds/icons/elements/success-16';\nimport '@warp-ds/icons/elements/close-16';\n\nimport { activateI18n } from '../i18n';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\n\nconst toastType = {\n  success: 'success',\n  error: 'error',\n  warning: 'warning',\n};\n\nexport class WarpToast extends WarpElement {\n  static styles = [\n    WarpElement.styles,\n    css`\n      :host {\n        display: block;\n      }\n    `,\n  ];\n\n  static properties = {\n    id: { type: String, attribute: true, reflect: true },\n    type: { type: String, attribute: true, reflect: true },\n    text: { type: String, attribute: true, reflect: true },\n    canclose: { type: Boolean, attribute: true, reflect: true },\n  };\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n    this.id = Date.now().toString(36) + Math.random().toString(36).slice(2, 5);\n    this.type = 'success';\n    this.text = '';\n    this.canclose = false;\n  }\n\n  connectedCallback() {\n    super.connectedCallback();\n  }\n\n  disconnectedCallback() {\n    super.disconnectedCallback();\n  }\n\n  updated() {\n    if (!this._expanded && this._wrapper) expand(this._wrapper, () => (this._expanded = true));\n  }\n\n  get #primaryClasses() {\n    return classNames([\n      ccToast.base,\n      this.type === toastType.success && ccToast.positive,\n      this.type === toastType.warning && ccToast.warning,\n      this.type === toastType.error && ccToast.negative,\n    ]);\n  }\n\n  get #iconClasses() {\n    return classNames([\n      ccToast.iconBase,\n      this.type === toastType.success && ccToast.iconPositive,\n      this.type === toastType.warning && ccToast.iconWarning,\n      this.type === toastType.error && ccToast.iconNegative,\n    ]);\n  }\n\n  get _wrapper() {\n    return this.renderRoot?.querySelector(`section`) ?? null;\n  }\n\n  get _warning() {\n    return this.type === toastType.warning;\n  }\n\n  get _error() {\n    return this.type === toastType.error;\n  }\n\n  get _role() {\n    return this._error || this._warning ? 'alert' : 'status';\n  }\n\n  get _typeLabel() {\n    if (this._warning) {\n      return i18n._({\n        id: 'toast.aria.warning',\n        message: 'Warning',\n        comment: 'Default screenreader message for warning in toast component',\n      });\n    }\n    if (this._error) {\n      return i18n._({\n        id: 'toast.aria.error',\n        message: 'Error',\n        comment: 'Default screenreader message for error in toast component',\n      });\n    } else {\n      return i18n._({\n        id: 'toast.aria.successful',\n        message: 'Successful',\n        comment: 'Default screenreader message for successful in toast component',\n      });\n    }\n  }\n\n  get _iconMarkup() {\n    if (this._warning) return html`<w-icon-warning-16></w-icon-warning-16>`;\n    if (this._error) return html`<w-icon-error-16></w-icon-error-16>`;\n    else return html`<w-icon-success-16></w-icon-success-16>`;\n  }\n\n  async collapse() {\n    return new Promise((resolve) => {\n      if (this._expanded && this._wrapper) collapse(this._wrapper, resolve);\n      else resolve();\n    });\n  }\n\n  close() {\n    const event = new CustomEvent('close', {\n      detail: { id: this.id },\n      bubbles: true,\n      composed: true,\n    });\n    this.updateComplete.then(() => this.dispatchEvent(event));\n  }\n\n  render() {\n    if (!this.text) return html``;\n    return html` <section class=\"${ccToast.wrapper}\" aria-label=\"${this._typeLabel}\">\n      <div class=\"${this.#primaryClasses}\">\n        <div class=\"${this.#iconClasses}\">${this._iconMarkup}</div>\n        <div role=\"${this._role}\" class=\"${ccToast.content}\">\n          <p>${this.text}</p>\n        </div>\n        ${when(\n          this.canclose === true,\n          () => html`\n            <button class=\"${ccToast.close}\" @click=\"${this.close}\">\n              <w-icon-close-16></w-icon-close-16>\n            </button>\n          `,\n        )}\n      </div>\n    </section>`;\n  }\n}\n\nif (!customElements.get('w-toast')) {\n  customElements.define('w-toast', WarpToast);\n}\n", "const windowExists = (typeof window !== 'undefined')\n\nlet prefersMotion = true\n\nif (windowExists) {\n  const query = window.matchMedia('(prefers-reduced-motion: reduce)')\n  const callback = ({ matches }) => prefersMotion = !matches\n  // older browsers don't support the new API, and the old API is deprecated\n  if (query.addEventListener) query.addEventListener('change', callback)\n  callback(query)\n}\n\nconst removeTransition = el => {\n  el.style.transition = null\n  el.style.backfaceVisibility = null\n  el.style.overflow = null\n}\n\nconst addTransition = (el) => {\n  // we set timing to something insanely short\n  // when reducing motion so the after-* hooks still fire\n  const timing = prefersMotion ? 'var(--f-expansion-duration, 0.3s)' : '0.01s'\n  el.style.transition = `height ${timing}`\n  el.style.backfaceVisibility = 'hidden'\n  el.style.overflow = 'hidden'\n}\n\nconst getAfterExpandCallback = (el, done) => () => {\n  el.style.height = 'auto'\n  el.style.overflow = null\n  if (done) done()\n}\n\nconst getAfterCollapseCallback = (done) => () => {\n  if (done) done()\n}\n\n/**\n * Transitions an element from 0 to a detected height\n * Will return a Promise when no 'done' callback is provided\n * @type {(el: HTMLElement, done?: function) => void | Promise<void>}\n */\nexport const expand = (el, done) => {\n  const returnPromise = (() => {\n    if (!done) return new Promise(r => { done = r })\n  })()\n  const afterExpandCallback = getAfterExpandCallback(el, done)\n  removeTransition(el)\n  el.style.height = 'auto'\n  let dest = el.scrollHeight\n  windowExists && requestAnimationFrame(() => {\n    el.addEventListener('transitionend', afterExpandCallback, { once: true })\n    el.style.height = '0px'\n    el.style.transitionTimingFunction = 'ease-out'\n    addTransition(el)\n    requestAnimationFrame(() => el.style.height = dest + 'px')\n  })\n  if (returnPromise) return returnPromise\n}\n\n/**\n * Transitions an element from a detected height to 0\n * Will return a Promise when no 'done' callback is provided\n * @type {(el: HTMLElement, done?: function) => void | Promise<void>}\n */\nexport const collapse = (el, done) => {\n  const returnPromise = (() => {\n    if (!done) return new Promise(r => { done = r })\n  })()\n  const afterCollapseCallback = getAfterCollapseCallback(done)\n  removeTransition(el)\n  let original = el.scrollHeight\n  windowExists && requestAnimationFrame(() => {\n    el.addEventListener('transitionend', afterCollapseCallback, { once: true })\n    el.style.height = original + 'px'\n    el.style.transitionTimingFunction = 'ease-in'\n    addTransition(el)\n    requestAnimationFrame(() => el.style.height = '0px')\n  })\n  if (returnPromise) return returnPromise\n}\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"toast.aria.error\\\":[\\\"Fejl\\\"],\\\"toast.aria.successful\\\":[\\\"Fuldf\u00F8rt\\\"],\\\"toast.aria.warning\\\":[\\\"Advarsel\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"toast.aria.error\\\":[\\\"Error\\\"],\\\"toast.aria.successful\\\":[\\\"Successful\\\"],\\\"toast.aria.warning\\\":[\\\"Warning\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"toast.aria.error\\\":[\\\"Virhe\\\"],\\\"toast.aria.successful\\\":[\\\"Onnistui\\\"],\\\"toast.aria.warning\\\":[\\\"Varoitus\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"toast.aria.error\\\":[\\\"Feil\\\"],\\\"toast.aria.successful\\\":[\\\"Vellykket\\\"],\\\"toast.aria.warning\\\":[\\\"Advarsel\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"toast.aria.error\\\":[\\\"Fel\\\"],\\\"toast.aria.successful\\\":[\\\"Genomf\u00F6rt\\\"],\\\"toast.aria.warning\\\":[\\\"Varning\\\"]}\");", "import { css, html } from 'lit';\n\nimport WarpElement from '@warp-ds/elements-core';\nimport { collapse, expand } from 'element-collapse';\nimport { ifDefined } from 'lit/directives/if-defined.js';\n\nclass ExpandTransition extends WarpElement {\n  static properties = {\n    show: {\n      type: Boolean,\n      reflect: true,\n    },\n    _removeElement: { type: Boolean, state: true },\n  };\n\n  constructor() {\n    super();\n\n    this.show = false;\n    this._mounted = false;\n    this._removeElement = false;\n  }\n\n  willUpdate() {\n    // Initialise state property with public property value\n    if (!this._mounted) {\n      this._removeElement = !this.show;\n    }\n\n    if (this.show && this._removeElement) {\n      this._removeElement = false;\n    }\n  }\n\n  updated() {\n    if (!this._wrapper) return;\n\n    if (!this._mounted) {\n      this._mounted = true;\n      return;\n    }\n\n    // If show is set to `true` by user, animate only after component is mount\n    if (this.show) {\n      expand(this._wrapper);\n    }\n\n    if (!this.show && !this._removeElement) {\n      collapse(this._wrapper, () => (this._removeElement = true));\n    }\n  }\n\n  get _wrapper() {\n    return this ?? null;\n  }\n\n  static styles = [\n    WarpElement.styles,\n    css`\n      :host {\n        display: block;\n      }\n    `,\n  ];\n\n  render() {\n    return html`<div aria-hidden=${ifDefined(!this.show ? 'true' : undefined)}>${this._removeElement ? html`` : html`<slot></slot>`}</div>`;\n  }\n}\n\nif (!customElements.get('w-expand-transition')) {\n  customElements.define('w-expand-transition', ExpandTransition);\n}\n\nexport { ExpandTransition };\n", "import { html } from 'lit';\n\nimport WarpElement from '@warp-ds/elements-core';\nimport { unsafeHTML } from 'lit/directives/unsafe-html.js';\n\nclass UnstyledHeading extends WarpElement {\n  static properties = {\n    level: { type: Number },\n  };\n\n  static styles = [WarpElement.styles];\n\n  get _markup() {\n    return `<h${this.level}\n    style=\"margin: 0; font-weight: unset; font-size: unset; line-height: unset;\"\n  >\n    <slot></slot>\n  </h${this.level}>\n`;\n  }\n\n  render() {\n    return !this.level ? html`<slot></slot>` : unsafeHTML(this._markup);\n  }\n}\n\nif (!customElements.get('w-unstyled-heading')) {\n  customElements.define('w-unstyled-heading', UnstyledHeading);\n}\n\nexport { UnstyledHeading };\n"],
-  "mappings": ";;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AAAA;AAAA;AAAA;AAGA,WAAO,eAAe,SAAS,cAAc,EAAE,OAAO,KAAK,CAAC;AAC5D,YAAQ,gBAAgB,QAAQ,YAAY;AAO5C,QAAI;AACJ,KAAC,SAAUA,YAAW;AAMlB,MAAAA,WAAU,kBAAkB,IAAI;AAMhC,MAAAA,WAAU,sBAAsB,IAAI;AAMpC,MAAAA,WAAU,gBAAgB,IAAI;AAK9B,MAAAA,WAAU,kBAAkB,IAAI;AAKhC,MAAAA,WAAU,aAAa,IAAI;AAAA,IAC/B,GAAG,YAAY,QAAQ,cAAc,QAAQ,YAAY,CAAC,EAAE;AAE5D,YAAQ,gBAAgB,oBAAI,IAAI;AAAA,MAC5B,CAAC,UAAU,kBAAkB,6CAA6C;AAAA,MAC1E;AAAA,QACI,UAAU;AAAA,QACV;AAAA,MACJ;AAAA,MACA;AAAA,QACI,UAAU;AAAA,QACV;AAAA,MACJ;AAAA,MACA;AAAA,QACI,UAAU;AAAA,QACV;AAAA,MAEJ;AAAA,MACA,CAAC,UAAU,aAAa,4CAA4C;AAAA,IACxE,CAAC;AAAA;AAAA;;;AC3DD;AAAA;AAAA;AACA,WAAO,eAAe,SAAS,cAAc,EAAE,OAAO,KAAK,CAAC;AAC5D,YAAQ,QAAQ,QAAQ,gBAAgB,QAAQ,YAAY;AAC5D,QAAM,WAAW;AACjB,WAAO,eAAe,SAAS,aAAa,EAAE,YAAY,MAAM,KAAK,WAAY;AAAE,aAAO,SAAS;AAAA,IAAW,EAAE,CAAC;AACjH,WAAO,eAAe,SAAS,iBAAiB,EAAE,YAAY,MAAM,KAAK,WAAY;AAAE,aAAO,SAAS;AAAA,IAAe,EAAE,CAAC;AASzH,aAAS,cAAc,KAAK;AACxB,YAAM,iBAAiB,CAAC,IAAI,MAAM,YAAY;AAC9C,aAAO,iBAAiB,SAAS,KAAK,EAAE,IAAI;AAAA,IAChD;AAYA,aAAS,oBAAoB,KAAK,WAAW,gBAAgB;AACzD,YAAM,YAAY,cAAc,GAAG;AACnC,UAAI,OAAO,MAAM,SAAS,KACrB,mBAAmB,UAAa,mBAAmB,IAAI,QAAS;AACjE,cAAM,IAAI,YAAY,SAAS,cAAc,IAAI,SAAS,CAAC;AAAA,MAC/D;AACA,aAAO;AAAA,IACX;AASA,aAAS,qBAAqB,MAAM;AAChC,YAAM,aAAa,oBAAoB,MAAM,SAAS,UAAU,sBAAsB,CAAC;AACvF,aAAO,OAAO,aAAa,UAAU;AAAA,IACzC;AAWA,aAAS,iBAAiB,MAAM,eAAe;AAC3C,YAAM,aAAa,oBAAoB,MAAM,SAAS,UAAU,kBAAkB,CAAC;AACnF,UAAI,kBAAkB,QAAW;AAC7B,cAAM,sBAAsB,oBAAoB,eAAe,SAAS,UAAU,kBAAkB,CAAC;AACrG,eAAO,OAAO,aAAa,YAAY,mBAAmB;AAAA,MAC9D;AACA,aAAO,OAAO,aAAa,UAAU;AAAA,IACzC;AAMA,aAAS,cAAc,MAAM;AACzB,aAAO,KAAK,OAAO,CAAC,MAAM,OAAO,KAAK,OAAO,KAAK,SAAS,CAAC,MAAM;AAAA,IACtE;AASA,aAAS,0BAA0B,WAAW;AAC1C,UAAI,CAAC,cAAc,SAAS,GAAG;AAC3B,cAAM,IAAI,YAAY,SAAS,cAAc,IAAI,SAAS,UAAU,gBAAgB,CAAC;AAAA,MACzF;AACA,YAAM,gBAAgB,UAAU,MAAM,GAAG,EAAE;AAC3C,YAAM,aAAa,oBAAoB,eAAe,SAAS,UAAU,gBAAgB;AACzF,UAAI;AACA,eAAO,OAAO,cAAc,UAAU;AAAA,MAC1C,SACO,KAAK;AACR,cAAM,eAAe,aACf,IAAI,YAAY,SAAS,cAAc,IAAI,SAAS,UAAU,cAAc,CAAC,IAC7E;AAAA,MACV;AAAA,IACJ;AAGA,aAAS,eAAe,MAAM,QAAQ,OAAO;AACzC,UAAI,OAAO;AACP,cAAM,IAAI,YAAY,SAAS,cAAc,IAAI,SAAS,UAAU,gBAAgB,CAAC;AAAA,MACzF;AAGA,YAAM,aAAa,SAAS,MAAM,CAAC;AACnC,aAAO,OAAO,aAAa,UAAU;AAAA,IACzC;AAKA,QAAM,yBAAyB,oBAAI,IAAI;AAAA,MACnC,CAAC,KAAK,IAAI;AAAA,MACV,CAAC,KAAK,IAAI;AAAA,MACV,CAAC,KAAK,IAAI;AAAA,MACV,CAAC,KAAK,IAAI;AAAA,MACV,CAAC,KAAK,GAAI;AAAA,MACV,CAAC,KAAK,IAAI;AAAA,MACV,CAAC,KAAK,IAAI;AAAA,IACd,CAAC;AAMD,aAAS,yBAAyB,MAAM;AACpC,aAAO,uBAAuB,IAAI,IAAI,KAAK;AAAA,IAC/C;AAiBA,QAAM,cAAc;AAUpB,aAASC,OAAM,KAAK,cAAc,OAAO;AACrC,aAAO,IAAI,QAAQ,aAAa,SAAU,GAAG,WAAW,KAAK,WAAW,sBAAsB,WAAW,SAAS,OAAO,iBAAiB;AAGtI,YAAI,cAAc,QAAW;AACzB,iBAAO;AAAA,QACX;AACA,YAAI,QAAQ,QAAW;AACnB,iBAAO,qBAAqB,GAAG;AAAA,QACnC;AACA,YAAI,cAAc,QAAW;AACzB,iBAAO,0BAA0B,SAAS;AAAA,QAC9C;AACA,YAAI,yBAAyB,QAAW;AACpC,iBAAO,iBAAiB,sBAAsB,SAAS;AAAA,QAC3D;AACA,YAAI,YAAY,QAAW;AACvB,iBAAO,iBAAiB,OAAO;AAAA,QACnC;AACA,YAAI,UAAU,KAAK;AACf,iBAAO;AAAA,QACX;AACA,YAAI,UAAU,QAAW;AACrB,iBAAO,eAAe,OAAO,CAAC,WAAW;AAAA,QAC7C;AACA,YAAI,oBAAoB,QAAW;AAC/B,iBAAO,yBAAyB,eAAe;AAAA,QACnD;AACA,cAAM,IAAI,YAAY,SAAS,cAAc,IAAI,SAAS,UAAU,WAAW,CAAC;AAAA,MACpF,CAAC;AAAA,IACL;AACA,YAAQ,QAAQA;AAChB,YAAQ,UAAUA;AAAA;AAAA;;;AC5LlB;AAAA;AAAA,KAAC,SAAS,MAAM,SAAS;AACvB,UAAI,OAAO,WAAW,cAAc,OAAO,KAAK;AAC9C,eAAO,CAAC,GAAG,OAAO;AAAA,MACpB,WAAW,OAAO,WAAW,YAAY,OAAO,SAAS;AACvD,eAAO,UAAU,QAAQ;AAAA,MAC3B,OAAO;AACL,aAAK,MAAM,QAAQ;AAAA,MACrB;AAAA,IACF,GAAE,SAAM,WAAW;AACjB;AAEA,UAAI,iBAAiB,OAAO,UAAU;AACtC,UAAI,WAAW,OAAO,UAAU;AAChC,UAAI,YAAY,OAAO,IAAI,OAAO,EAAE,WAAW;AAI/C,eAAS,SAAS,GAAG;AAAE,eAAO,KAAK,SAAS,KAAK,CAAC,MAAM;AAAA,MAAkB;AAC1E,eAAS,SAAS,GAAG;AAAE,eAAO,KAAK,OAAO,MAAM,YAAY,CAAC,SAAS,CAAC,KAAK,CAAC,MAAM,QAAQ,CAAC;AAAA,MAAE;AAE9F,eAAS,SAAS,GAAG;AACnB,eAAO,EAAE,QAAQ,0BAA0B,MAAM;AAAA,MACnD;AACA,eAAS,SAAS,GAAG;AACnB,YAAI,KAAK,IAAI,OAAO,MAAM,CAAC;AAC3B,eAAO,GAAG,KAAK,EAAE,EAAE,SAAS;AAAA,MAC9B;AACA,eAAS,UAAU,GAAG;AACpB,eAAO,MAAM,IAAI;AAAA,MACnB;AACA,eAAS,QAAQ,SAAS;AACxB,YAAI,CAAC,QAAQ,OAAQ,QAAO;AAC5B,YAAI,SAAU,QAAQ,IAAI,SAAS,GAAG;AACpC,iBAAO,QAAQ,IAAI;AAAA,QACrB,CAAC,EAAE,KAAK,GAAG;AACX,eAAO,QAAQ,SAAS;AAAA,MAC1B;AAEA,eAAS,gBAAgB,KAAK;AAC5B,YAAI,OAAO,QAAQ,UAAU;AAC3B,iBAAO,QAAQ,SAAS,GAAG,IAAI;AAAA,QAEjC,WAAW,SAAS,GAAG,GAAG;AAExB,cAAI,IAAI,WAAY,OAAM,IAAI,MAAM,4BAA4B;AAChE,cAAI,IAAI,OAAQ,OAAM,IAAI,MAAM,2BAA2B;AAC3D,cAAI,IAAI,OAAQ,OAAM,IAAI,MAAM,2BAA2B;AAC3D,cAAI,IAAI,UAAW,OAAM,IAAI,MAAM,2BAA2B;AAC9D,iBAAO,IAAI;AAAA,QAEb,OAAO;AACL,gBAAM,IAAI,MAAM,oBAAoB,GAAG;AAAA,QACzC;AAAA,MACF;AAEA,eAAS,IAAI,GAAG,QAAQ;AACtB,YAAI,EAAE,SAAS,QAAQ;AACrB,iBAAO;AAAA,QACT;AACA,eAAO,MAAM,SAAS,EAAE,SAAS,CAAC,EAAE,KAAK,GAAG,IAAI;AAAA,MAClD;AAEA,eAAS,WAAW,QAAQ,UAAU;AACpC,YAAI,WAAW,OAAO;AACtB,YAAI,aAAa;AACjB,eAAO,MAAM;AACX,cAAI,MAAM,OAAO,YAAY,MAAM,WAAW,CAAC;AAC/C,cAAI,QAAQ,IAAI;AACd;AAAA,UACF,OAAO;AACL;AAAA,UACF;AACA,qBAAW;AACX,cAAI,eAAe,UAAU;AAC3B;AAAA,UACF;AACA,cAAI,aAAa,GAAG;AAClB;AAAA,UACF;AAAA,QACF;AACA,YAAI,gBACF,aAAa,WACb,IACA,WAAW;AACb,eAAO,OAAO,UAAU,aAAa,EAAE,MAAM,IAAI;AAAA,MACnD;AAEA,eAAS,cAAc,QAAQ;AAC7B,YAAIC,QAAO,OAAO,oBAAoB,MAAM;AAC5C,YAAI,SAAS,CAAC;AACd,iBAASC,KAAI,GAAGA,KAAID,MAAK,QAAQC,MAAK;AACpC,cAAI,MAAMD,MAAKC,EAAC;AAChB,cAAI,QAAQ,OAAO,GAAG;AACtB,cAAI,QAAQ,CAAC,EAAE,OAAO,KAAK;AAC3B,cAAI,QAAQ,WAAW;AACrB,qBAAS,IAAI,GAAG,IAAI,MAAM,QAAQ,KAAK;AACrC,qBAAO,KAAK,EAAC,SAAS,MAAM,CAAC,EAAC,CAAC;AAAA,YACjC;AACA;AAAA,UACF;AACA,cAAI,QAAQ,CAAC;AACb,gBAAM,QAAQ,SAAS,MAAM;AAC3B,gBAAI,SAAS,IAAI,GAAG;AAClB,kBAAI,MAAM,OAAQ,QAAO,KAAK,YAAY,KAAK,KAAK,CAAC;AACrD,qBAAO,KAAK,YAAY,KAAK,IAAI,CAAC;AAClC,sBAAQ,CAAC;AAAA,YACX,OAAO;AACL,oBAAM,KAAK,IAAI;AAAA,YACjB;AAAA,UACF,CAAC;AACD,cAAI,MAAM,OAAQ,QAAO,KAAK,YAAY,KAAK,KAAK,CAAC;AAAA,QACvD;AACA,eAAO;AAAA,MACT;AAEA,eAAS,aAAa,OAAO;AAC3B,YAAI,SAAS,CAAC;AACd,iBAASA,KAAI,GAAGA,KAAI,MAAM,QAAQA,MAAK;AACrC,cAAI,MAAM,MAAMA,EAAC;AACjB,cAAI,IAAI,SAAS;AACf,gBAAI,UAAU,CAAC,EAAE,OAAO,IAAI,OAAO;AACnC,qBAAS,IAAI,GAAG,IAAI,QAAQ,QAAQ,KAAK;AACvC,qBAAO,KAAK,EAAC,SAAS,QAAQ,CAAC,EAAC,CAAC;AAAA,YACnC;AACA;AAAA,UACF;AACA,cAAI,CAAC,IAAI,MAAM;AACb,kBAAM,IAAI,MAAM,uBAAuB,KAAK,UAAU,GAAG,CAAC;AAAA,UAC5D;AACA,iBAAO,KAAK,YAAY,IAAI,MAAM,GAAG,CAAC;AAAA,QACxC;AACA,eAAO;AAAA,MACT;AAEA,eAAS,YAAY,MAAM,KAAK;AAC9B,YAAI,CAAC,SAAS,GAAG,GAAG;AAClB,gBAAM,EAAE,OAAO,IAAI;AAAA,QACrB;AACA,YAAI,IAAI,SAAS;AACf,gBAAM,IAAI,MAAM,2CAA2C;AAAA,QAC7D;AAGA,YAAI,UAAU;AAAA,UACZ,aAAa;AAAA,UACb,YAAY,CAAC,CAAC,IAAI,SAAS,CAAC,CAAC,IAAI;AAAA,UACjC,KAAK;AAAA,UACL,MAAM;AAAA,UACN,MAAM;AAAA,UACN,OAAO;AAAA,UACP,UAAU;AAAA,UACV,OAAO;AAAA,UACP,MAAM;AAAA,UACN,aAAa;AAAA,QACf;AAGA,iBAAS,OAAO,KAAK;AACnB,cAAI,eAAe,KAAK,KAAK,GAAG,GAAG;AACjC,oBAAQ,GAAG,IAAI,IAAI,GAAG;AAAA,UACxB;AAAA,QACF;AAGA,YAAI,OAAO,QAAQ,SAAS,YAAY,SAAS,QAAQ,MAAM;AAC7D,gBAAM,IAAI,MAAM,8CAA8C,QAAQ,OAAO,kBAAkB,OAAO,IAAI;AAAA,QAC5G;AAGA,YAAI,QAAQ,QAAQ;AACpB,gBAAQ,QAAQ,MAAM,QAAQ,KAAK,IAAI,QAAQ,QAAQ,CAAC,KAAK,IAAI,CAAC;AAClE,gBAAQ,MAAM,KAAK,SAASC,IAAGC,IAAG;AAChC,iBAAO,SAASD,EAAC,KAAK,SAASC,EAAC,IAAI,IAC7B,SAASA,EAAC,IAAI,KAAK,SAASD,EAAC,IAAI,IAAKC,GAAE,SAASD,GAAE;AAAA,QAC5D,CAAC;AACD,eAAO;AAAA,MACT;AAEA,eAAS,QAAQ,MAAM;AACrB,eAAO,MAAM,QAAQ,IAAI,IAAI,aAAa,IAAI,IAAI,cAAc,IAAI;AAAA,MACtE;AAEA,UAAI,mBAAmB,YAAY,SAAS,EAAC,YAAY,MAAM,aAAa,KAAI,CAAC;AACjF,eAAS,aAAa,OAAO,WAAW;AACtC,YAAI,YAAY;AAChB,YAAI,OAAO,uBAAO,OAAO,IAAI;AAC7B,YAAI,cAAc;AAClB,YAAI,cAAc;AAClB,YAAI,SAAS,CAAC;AACd,YAAI,QAAQ,CAAC;AAGb,iBAASD,KAAI,GAAGA,KAAI,MAAM,QAAQA,MAAK;AACrC,cAAI,MAAMA,EAAC,EAAE,UAAU;AACrB,0BAAc;AAAA,UAChB;AAAA,QACF;AAEA,iBAASA,KAAI,GAAGA,KAAI,MAAM,QAAQA,MAAK;AACrC,cAAI,UAAU,MAAMA,EAAC;AAErB,cAAI,QAAQ,SAAS;AAEnB,kBAAM,IAAI,MAAM,gDAAgD;AAAA,UAClE;AAEA,cAAI,QAAQ,SAAS,QAAQ,UAAU;AAErC,gBAAI,WAAW;AACb,kBAAI,CAAC,QAAQ,aAAa,CAAC,UAAU,UAAU;AAC7C,sBAAM,IAAI,MAAM,eAAe,QAAQ,WAAW,aAAa,WAAW,oCAAoC,QAAQ,cAAc,IAAI;AAAA,cAC1I,OAAO;AACL,sBAAM,IAAI,MAAM,2DAA2D,QAAQ,cAAc,IAAI;AAAA,cACvG;AAAA,YACF;AACA,wBAAY;AAAA,UACd;AAEA,cAAI,QAAQ,QAAQ,MAAM,MAAM;AAChC,cAAI,aAAa;AACf,mBAAO,MAAM,UAAU,OAAO,MAAM,CAAC,MAAM,YAAY,MAAM,CAAC,EAAE,WAAW,GAAG;AAC5E,kBAAI,OAAO,MAAM,MAAM;AACvB,mBAAK,KAAK,WAAW,CAAC,CAAC,IAAI;AAAA,YAC7B;AAAA,UACF;AAGA,cAAI,QAAQ,OAAO,QAAQ,QAAQ,QAAQ,MAAM;AAC/C,gBAAI,CAAC,WAAW;AACd,oBAAM,IAAI,MAAM,6EAA6E,QAAQ,cAAc,IAAI;AAAA,YACzH;AACA,gBAAI,QAAQ,UAAU;AACpB,oBAAM,IAAI,MAAM,4EAA4E,QAAQ,cAAc,IAAI;AAAA,YACxH;AAAA,UACF;AAGA,cAAI,MAAM,WAAW,GAAG;AACtB;AAAA,UACF;AACA,wBAAc;AAEd,iBAAO,KAAK,OAAO;AAGnB,mBAAS,IAAI,GAAG,IAAI,MAAM,QAAQ,KAAK;AACrC,gBAAI,MAAM,MAAM,CAAC;AACjB,gBAAI,CAAC,SAAS,GAAG,GAAG;AAClB;AAAA,YACF;AAEA,gBAAI,gBAAgB,MAAM;AACxB,4BAAc,IAAI;AAAA,YACpB,WAAW,gBAAgB,IAAI,WAAW,QAAQ,aAAa,OAAO;AACpE,oBAAM,IAAI,MAAM,oCAAoC;AAAA,YACtD;AAAA,UACF;AAGA,cAAI,MAAM,QAAQ,MAAM,IAAI,eAAe,CAAC;AAG5C,cAAI,SAAS,IAAI,OAAO,GAAG;AAC3B,cAAI,OAAO,KAAK,EAAE,GAAG;AACnB,kBAAM,IAAI,MAAM,kCAAkC,MAAM;AAAA,UAC1D;AACA,cAAI,aAAa,SAAS,GAAG;AAC7B,cAAI,aAAa,GAAG;AAClB,kBAAM,IAAI,MAAM,gCAAgC,SAAS,4BAAuB;AAAA,UAClF;AAGA,cAAI,CAAC,QAAQ,cAAc,OAAO,KAAK,IAAI,GAAG;AAC5C,kBAAM,IAAI,MAAM,qCAAqC,MAAM;AAAA,UAC7D;AAGA,gBAAM,KAAK,UAAU,GAAG,CAAC;AAAA,QAC3B;AAQA,YAAI,eAAe,aAAa,UAAU;AAC1C,YAAI,QAAQ,aAAa,CAAC,eAAe,OAAO;AAChD,YAAIG,UAAS,aAAa,eAAe,KAAK;AAE9C,YAAI,gBAAgB,KAAM,UAAS;AACnC,YAAI,WAAW,IAAI,OAAO,QAAQ,KAAK,IAAIA,SAAQ,KAAK;AACxD,eAAO,EAAC,QAAQ,UAAU,QAAgB,MAAY,OAAO,aAAa,iBAAgB;AAAA,MAC5F;AAEA,eAAS,QAAQ,OAAO;AACtB,YAAI,SAAS,aAAa,QAAQ,KAAK,CAAC;AACxC,eAAO,IAAI,MAAM,EAAC,OAAO,OAAM,GAAG,OAAO;AAAA,MAC3C;AAEA,eAAS,gBAAgBC,IAAG,MAAM,KAAK;AACrC,YAAI,QAAQA,OAAMA,GAAE,QAAQA,GAAE;AAC9B,YAAI,SAAS,CAAC,IAAI,KAAK,GAAG;AACxB,gBAAM,IAAI,MAAM,oBAAoB,QAAQ,kBAAkBA,GAAE,cAAc,iBAAiB,OAAO,IAAI;AAAA,QAC5G;AACA,YAAIA,MAAKA,GAAE,OAAO,CAACA,GAAE,QAAQ,GAAG;AAC9B,gBAAM,IAAI,MAAM,8BAA8BA,GAAE,cAAc,iBAAiB,OAAO,IAAI;AAAA,QAC5F;AAAA,MACF;AACA,eAAS,cAAc,QAAQ,OAAO;AACpC,YAAI,MAAM,OAAO,OAAO,QAAQ,OAAO,IAAI,IAAI,CAAC;AAChD,eAAO,OAAO;AAEd,YAAIL,QAAO,OAAO,oBAAoB,MAAM;AAC5C,YAAI,CAAC,MAAO,SAAQA,MAAK,CAAC;AAE1B,YAAI,UAAU,uBAAO,OAAO,IAAI;AAChC,iBAASC,KAAI,GAAGA,KAAID,MAAK,QAAQC,MAAK;AACpC,cAAI,MAAMD,MAAKC,EAAC;AAChB,kBAAQ,GAAG,IAAI,QAAQ,OAAO,GAAG,CAAC,EAAE,OAAO,GAAG;AAAA,QAChD;AACA,iBAASA,KAAI,GAAGA,KAAID,MAAK,QAAQC,MAAK;AACpC,cAAI,MAAMD,MAAKC,EAAC;AAChB,cAAI,QAAQ,QAAQ,GAAG;AACvB,cAAI,WAAW,uBAAO,OAAO,IAAI;AACjC,mBAAS,IAAI,GAAG,IAAI,MAAM,QAAQ,KAAK;AACrC,gBAAI,OAAO,MAAM,CAAC;AAClB,gBAAI,CAAC,KAAK,QAAS;AACnB,gBAAI,SAAS,CAAC,GAAG,CAAC;AAClB,gBAAI,KAAK,YAAY,OAAO,CAAC,SAAS,KAAK,OAAO,GAAG;AACnD,uBAAS,KAAK,OAAO,IAAI;AACzB,kBAAI,WAAW,QAAQ,KAAK,OAAO;AACnC,kBAAI,CAAC,UAAU;AACb,sBAAM,IAAI,MAAM,uCAAuC,KAAK,UAAU,kBAAkB,MAAM,IAAI;AAAA,cACpG;AACA,uBAAS,IAAI,GAAG,IAAI,SAAS,QAAQ,KAAK;AACxC,oBAAI,UAAU,SAAS,CAAC;AACxB,oBAAI,MAAM,QAAQ,OAAO,MAAM,GAAI;AACnC,uBAAO,KAAK,OAAO;AAAA,cACrB;AAAA,YACF;AACA,kBAAM,OAAO,MAAM,OAAO,MAAM;AAChC;AAAA,UACF;AAAA,QACF;AAEA,YAAI,MAAM,uBAAO,OAAO,IAAI;AAC5B,iBAASA,KAAI,GAAGA,KAAID,MAAK,QAAQC,MAAK;AACpC,cAAI,MAAMD,MAAKC,EAAC;AAChB,cAAI,GAAG,IAAI,aAAa,QAAQ,GAAG,GAAG,IAAI;AAAA,QAC5C;AAEA,iBAASA,KAAI,GAAGA,KAAID,MAAK,QAAQC,MAAK;AACpC,cAAI,OAAOD,MAAKC,EAAC;AACjB,cAAI,QAAQ,IAAI,IAAI;AACpB,cAAI,SAAS,MAAM;AACnB,mBAAS,IAAI,GAAG,IAAI,OAAO,QAAQ,KAAK;AACtC,4BAAgB,OAAO,CAAC,GAAG,MAAM,GAAG;AAAA,UACtC;AACA,cAAI,WAAW,OAAO,oBAAoB,MAAM,IAAI;AACpD,mBAAS,IAAI,GAAG,IAAI,SAAS,QAAQ,KAAK;AACxC,4BAAgB,MAAM,KAAK,SAAS,CAAC,CAAC,GAAG,MAAM,GAAG;AAAA,UACpD;AAAA,QACF;AAEA,eAAO,IAAI,MAAM,KAAK,KAAK;AAAA,MAC7B;AAEA,eAAS,iBAAiB,KAAK;AAI7B,YAAI,QAAQ,OAAO,QAAQ;AAC3B,YAAI,aAAa,QAAQ,oBAAI,QAAM,uBAAO,OAAO,IAAI;AAErD,YAAI,QAAQ,OAAO,oBAAoB,GAAG;AAC1C,iBAASA,KAAI,GAAGA,KAAI,MAAM,QAAQA,MAAK;AACrC,cAAI,YAAY,MAAMA,EAAC;AACvB,cAAI,OAAO,IAAI,SAAS;AACxB,cAAI,cAAc,MAAM,QAAQ,IAAI,IAAI,OAAO,CAAC,IAAI;AACpD,sBAAY,QAAQ,SAAS,SAAS;AACpC,gBAAI,OAAO,YAAY,UAAU;AAC/B,oBAAM,IAAI,MAAM,yCAAyC,YAAY,IAAI;AAAA,YAC3E;AACA,gBAAI,OAAO;AACT,yBAAW,IAAI,SAAS,SAAS;AAAA,YACnC,OAAO;AACL,yBAAW,OAAO,IAAI;AAAA,YACxB;AAAA,UACF,CAAC;AAAA,QACH;AACA,eAAO,SAAS,GAAG;AACjB,iBAAO,QAAQ,WAAW,IAAI,CAAC,IAAI,WAAW,CAAC;AAAA,QACjD;AAAA,MACF;AAIA,UAAI,QAAQ,SAAS,QAAQ,OAAO;AAClC,aAAK,aAAa;AAClB,aAAK,SAAS;AACd,aAAK,SAAS;AACd,aAAK,QAAQ,CAAC;AACd,aAAK,MAAM;AAAA,MACb;AAEA,YAAM,UAAU,QAAQ,SAAS,MAAM,MAAM;AAC3C,aAAK,SAAS,QAAQ;AACtB,aAAK,QAAQ;AACb,aAAK,OAAO,OAAO,KAAK,OAAO;AAC/B,aAAK,MAAM,OAAO,KAAK,MAAM;AAC7B,aAAK,cAAc,OAAO,KAAK,cAAc;AAC7C,aAAK,aAAa,OAAO,KAAK,aAAY;AAC1C,aAAK,cAAc,OAAO,KAAK,cAAc;AAC7C,aAAK,SAAS,OAAO,KAAK,QAAQ,KAAK,UAAU;AACjD,aAAK,QAAQ,QAAQ,KAAK,QAAQ,KAAK,MAAM,MAAM,IAAI,CAAC;AACxD,eAAO;AAAA,MACT;AAEA,YAAM,UAAU,OAAO,WAAW;AAChC,eAAO;AAAA,UACL,MAAM,KAAK;AAAA,UACX,KAAK,KAAK;AAAA,UACV,OAAO,KAAK;AAAA,UACZ,OAAO,KAAK,MAAM,MAAM;AAAA,UACxB,aAAa,KAAK;AAAA,UAClB,YAAY,KAAK;AAAA,UACjB,aAAa,KAAK;AAAA,QACpB;AAAA,MACF;AAEA,YAAM,UAAU,WAAW,SAAS,OAAO;AACzC,YAAI,CAAC,SAAS,KAAK,UAAU,MAAO;AACpC,aAAK,QAAQ;AACb,YAAI,OAAO,KAAK,OAAO,KAAK;AAC5B,aAAK,SAAS,KAAK;AACnB,aAAK,QAAQ,KAAK;AAClB,aAAK,KAAK,KAAK;AACf,aAAK,OAAO,KAAK;AAAA,MACnB;AAEA,YAAM,UAAU,WAAW,WAAW;AACpC,aAAK,SAAS,KAAK,MAAM,IAAI,CAAC;AAAA,MAChC;AAEA,YAAM,UAAU,YAAY,SAAS,OAAO;AAC1C,aAAK,MAAM,KAAK,KAAK,KAAK;AAC1B,aAAK,SAAS,KAAK;AAAA,MACrB;AAEA,UAAI,MAAM,YAAY,SAAS,IAAI,QAAQ;AACzC,eAAO,GAAG,KAAK,MAAM;AAAA,MACvB,IAAI,SAAS,IAAI,QAAQ;AACvB,YAAI,QAAQ,GAAG,KAAK,MAAM;AAE1B,YAAI,MAAM,CAAC,EAAE,WAAW,GAAG;AACzB,iBAAO;AAAA,QACT;AACA,eAAO;AAAA,MACT;AAEA,YAAM,UAAU,YAAY,SAAS,OAAO;AAC1C,YAAI,aAAa,KAAK,OAAO;AAC7B,iBAASA,KAAI,GAAGA,KAAI,YAAYA,MAAK;AACnC,cAAI,MAAMA,KAAI,CAAC,MAAM,QAAW;AAC9B,mBAAO,KAAK,OAAOA,EAAC;AAAA,UACtB;AAAA,QACF;AACA,cAAM,IAAI,MAAM,yCAAyC;AAAA,MAC3D;AAEA,eAAS,gBAAgB;AACvB,eAAO,KAAK;AAAA,MACd;AAEA,YAAM,UAAU,OAAO,WAAW;AAChC,YAAI,QAAQ,KAAK;AAGjB,YAAI,KAAK,aAAa;AACpB,cAAI,QAAQ,KAAK,OAAO,KAAK,aAAa,KAAK,YAAY,KAAK;AAChE,eAAK,cAAc;AACnB,eAAK,aAAa;AAClB,iBAAO;AAAA,QACT;AAEA,YAAI,SAAS,KAAK;AAClB,YAAI,UAAU,OAAO,QAAQ;AAC3B;AAAA,QACF;AAGA,YAAI,QAAQ,KAAK,KAAK,OAAO,WAAW,KAAK,CAAC;AAC9C,YAAI,OAAO;AACT,iBAAO,KAAK,OAAO,OAAO,OAAO,OAAO,KAAK,GAAG,KAAK;AAAA,QACvD;AAGA,YAAI,KAAK,KAAK;AACd,WAAG,YAAY;AACf,YAAI,QAAQ,IAAI,IAAI,MAAM;AAG1B,YAAI,QAAQ,KAAK;AACjB,YAAI,SAAS,MAAM;AACjB,iBAAO,KAAK,OAAO,OAAO,OAAO,MAAM,OAAO,OAAO,MAAM,GAAG,KAAK;AAAA,QACrE;AAEA,YAAI,QAAQ,KAAK,UAAU,KAAK;AAChC,YAAI,OAAO,MAAM,CAAC;AAElB,YAAI,MAAM,YAAY,MAAM,UAAU,OAAO;AAC3C,eAAK,cAAc;AACnB,eAAK,aAAa;AAGlB,iBAAO,KAAK,OAAO,OAAO,OAAO,MAAM,OAAO,MAAM,KAAK,GAAG,KAAK;AAAA,QACnE;AAEA,eAAO,KAAK,OAAO,OAAO,MAAM,KAAK;AAAA,MACvC;AAEA,YAAM,UAAU,SAAS,SAAS,OAAO,MAAMK,SAAQ;AAErD,YAAI,aAAa;AACjB,YAAI,MAAM,YAAY;AACpB,cAAI,UAAU;AACd,cAAI,KAAK;AACT,cAAI,SAAS,MAAM;AACjB,yBAAa;AAAA,UACf,OAAO;AACL,mBAAO,QAAQ,KAAK,IAAI,GAAG;AAAE;AAAc,mBAAK,QAAQ;AAAA,YAAU;AAAA,UACpE;AAAA,QACF;AAEA,YAAI,QAAQ;AAAA,UACV,MAAO,OAAO,MAAM,SAAS,cAAc,MAAM,KAAK,IAAI,KAAM,MAAM;AAAA,UACtE,OAAO,OAAO,MAAM,UAAU,aAAa,MAAM,MAAM,IAAI,IAAI;AAAA,UAC/D;AAAA,UACA,UAAU;AAAA,UACV,QAAQA;AAAA,UACR;AAAA,UACA,MAAM,KAAK;AAAA,UACX,KAAK,KAAK;AAAA,QACZ;AAGA,YAAIC,QAAO,KAAK;AAChB,aAAK,SAASA;AACd,aAAK,QAAQ;AACb,YAAI,eAAe,GAAG;AACpB,eAAK,MAAMA,QAAO,KAAK;AAAA,QACzB,OAAO;AACL,eAAK,OAAOA;AAAA,QACd;AAGA,YAAI,MAAM,aAAa;AACrB,cAAI,MAAM,IAAI,MAAM,KAAK,YAAY,OAAO,gBAAgB,CAAC;AAC7D,gBAAM;AAAA,QACR;AAEA,YAAI,MAAM,IAAK,MAAK,SAAS;AAAA,iBACpB,MAAM,KAAM,MAAK,UAAU,MAAM,IAAI;AAAA,iBACrC,MAAM,KAAM,MAAK,SAAS,MAAM,IAAI;AAE7C,eAAO;AAAA,MACT;AAEA,UAAI,OAAO,WAAW,eAAe,OAAO,UAAU;AACpD,YAAI,gBAAgB,SAAS,OAAO;AAClC,eAAK,QAAQ;AAAA,QACf;AAEA,sBAAc,UAAU,OAAO,WAAW;AACxC,cAAI,QAAQ,KAAK,MAAM,KAAK;AAC5B,iBAAO,EAAC,OAAO,OAAO,MAAM,CAAC,MAAK;AAAA,QACpC;AAEA,sBAAc,UAAU,OAAO,QAAQ,IAAI,WAAW;AACpD,iBAAO;AAAA,QACT;AAEA,cAAM,UAAU,OAAO,QAAQ,IAAI,WAAW;AAC5C,iBAAO,IAAI,cAAc,IAAI;AAAA,QAC/B;AAAA,MACF;AAEA,YAAM,UAAU,cAAc,SAAS,OAAO,SAAS;AACrD,YAAI,SAAS,MAAM;AAEjB,cAAI,OAAO,KAAK,OAAO,MAAM,KAAK,KAAK;AACvC,cAAI,QAAQ;AAAA,YACV;AAAA,YACA,QAAQ,KAAK;AAAA,YACb,YAAY,KAAK,QAAQ,IAAI,MAAM,KAAK,IAAI;AAAA,YAC5C,MAAM,KAAK;AAAA,YACX,KAAK,KAAK;AAAA,UACZ;AAAA,QACF;AAEA,YAAI,iBAAiB;AACrB,YAAI,qBAAqB,KAAK,IAAI,MAAM,OAAO,gBAAgB,CAAC;AAChE,YAAI,oBAAoB,MAAM,OAAO;AACrC,YAAI,iBAAiB,OAAO,iBAAiB,EAAE;AAC/C,YAAI,iBAAiB;AAAA,UACjB,KAAK;AAAA,UACJ,KAAK,OAAO,MAAM,OAAQ,iBAAiB;AAAA,QAC9C,EACC,MAAM,GAAG,CAAC;AACb,YAAI,aAAa,CAAC;AAClB,mBAAW,KAAK,UAAU,cAAc,MAAM,OAAO,UAAU,MAAM,MAAM,GAAG;AAC9E,mBAAW,KAAK,EAAE;AAClB,iBAASN,KAAI,GAAGA,KAAI,eAAe,QAAQA,MAAK;AAC9C,cAAI,OAAO,eAAeA,EAAC;AAC3B,cAAI,SAAS,qBAAqBA;AAClC,qBAAW,KAAK,IAAI,OAAO,MAAM,GAAG,cAAc,IAAI,OAAO,IAAI;AACjE,cAAI,WAAW,MAAM,MAAM;AACzB,uBAAW,KAAK,IAAI,IAAI,iBAAiB,MAAM,MAAM,CAAC,IAAI,GAAG;AAAA,UAC/D;AAAA,QACF;AACA,eAAO,WAAW,KAAK,IAAI;AAAA,MAC7B;AAEA,YAAM,UAAU,QAAQ,WAAW;AACjC,eAAO,IAAI,MAAM,KAAK,QAAQ,KAAK,KAAK;AAAA,MAC1C;AAEA,YAAM,UAAU,MAAM,SAAS,WAAW;AACxC,eAAO;AAAA,MACT;AAGA,aAAO;AAAA,QACL;AAAA,QACA,QAAQ;AAAA,QACR,OAAO,OAAO,OAAO,EAAC,OAAO,KAAI,CAAC;AAAA,QAClC,UAAU,OAAO,OAAO,EAAC,UAAU,KAAI,CAAC;AAAA,QACxC,UAAU;AAAA,MACZ;AAAA,IAEF,CAAC;AAAA;AAAA;;;ACjoBD;AAAA;AAAA;AACA,QAAI,kBAAmB,WAAQ,QAAK,mBAAoB,SAAU,KAAK;AACnE,aAAQ,OAAO,IAAI,aAAc,MAAM,EAAE,WAAW,IAAI;AAAA,IAC5D;AACA,WAAO,eAAe,SAAS,cAAc,EAAE,OAAO,KAAK,CAAC;AAC5D,YAAQ,QAAQ,QAAQ,SAAS;AACjC,QAAM,QAAQ,gBAAgB,aAAc;AAC5C,YAAQ,SAAS;AAAA,MACb,MAAM;AAAA,QACF,YAAY,EAAE,OAAO,MAAM,OAAO,MAAM,IAAI;AAAA,QAC5C,QAAQ;AAAA,UACJ,YAAY;AAAA,UACZ,OAAO;AAAA,UACP,OAAO,SAAO,IAAI,MAAM,GAAG,EAAE,EAAE,QAAQ,OAAO,GAAG;AAAA,QACrD;AAAA,QACA,UAAU;AAAA,UACN,YAAY;AAAA,UACZ,OAAO;AAAA,UACP,MAAM;AAAA,UACN,OAAO,SAAO,IAAI,UAAU,CAAC,EAAE,KAAK;AAAA,QACxC;AAAA,QACA,YAAY;AAAA,QACZ,KAAK,EAAE,OAAO,KAAK,KAAK,EAAE;AAAA,QAC1B,SAAS,EAAE,YAAY,MAAM,OAAO,eAAe;AAAA,MACvD;AAAA,MACA,KAAK;AAAA,QACD,QAAQ;AAAA,UACJ,YAAY;AAAA,UACZ,OAAO;AAAA,UACP,MAAM;AAAA,UACN,OAAO,SAAO,IAAI,MAAM,GAAG,EAAE,CAAC,EAAE,KAAK;AAAA,QACzC;AAAA,QACA,aAAa;AAAA,UACT,YAAY;AAAA,UACZ,OAAO;AAAA,UACP,MAAM;AAAA,UACN,OAAO,SAAO,IAAI,MAAM,GAAG,EAAE,CAAC,EAAE,KAAK;AAAA,QACzC;AAAA,QACA,eAAe;AAAA,UACX,YAAY;AAAA,UACZ,OAAO;AAAA,UACP,OAAO,SAAO,IAAI,UAAU,CAAC,EAAE,KAAK;AAAA,QACxC;AAAA,QACA,KAAK,EAAE,OAAO,KAAK,KAAK,EAAE;AAAA,MAC9B;AAAA,MACA,QAAQ;AAAA,QACJ,QAAQ;AAAA,UACJ,YAAY;AAAA,UACZ,OAAO;AAAA,UACP,OAAO,SAAO,IAAI,MAAM,GAAG,EAAE,CAAC,EAAE,KAAK;AAAA,QACzC;AAAA,QACA,MAAM;AAAA,UACF,YAAY;AAAA,UACZ,OAAO;AAAA,UACP,MAAM;AAAA,UACN,OAAO,SAAO,IAAI,UAAU,GAAG,IAAI,QAAQ,GAAG,CAAC,EAAE,KAAK;AAAA,QAC1D;AAAA,QACA,KAAK,EAAE,OAAO,UAAU,KAAK,EAAE;AAAA,MACnC;AAAA,IACJ;AACA,YAAQ,QAAQ,MAAM,QAAQ,OAAO,QAAQ,MAAM;AAAA;AAAA;;;AC5DnD;AAAA;AAAA;AAyEA,WAAO,eAAe,SAAS,cAAc,EAAE,OAAO,KAAK,CAAC;AAC5D,YAAQ,aAAa;AACrB,YAAQ,QAAQO;AAChB,QAAM,aAAa;AACnB,QAAM,aAAa,CAAC,QAAQ;AAAA,MACxB,QAAQ,GAAG;AAAA,MACX,MAAM,GAAG;AAAA,MACT,KAAK,GAAG;AAAA,MACR,MAAM,GAAG;AAAA,MACT,YAAY,GAAG;AAAA,IACnB;AACA,QAAM,eAAe,CAAC,SAAS,SAAS,YAAY,SAAS,YAAY,SAAS;AAClF,aAAS,oBAAoB,IAAI,OAAO;AACpC,UAAI,QAAQ;AACZ,UAAI,OAAO;AACX,iBAAWC,MAAK,OAAO;AACnB,cAAM,QAAQA,GAAE,IAAI;AACpB,gBAAQ;AACR,gBAAQA,GAAE,MAAM;AAAA,UACZ,KAAK;AACD,qBAASA,GAAE;AACX;AAAA,UACJ,KAAK;AAAA,UACL,KAAK;AAAA,UACL,KAAK;AACD,qBAAS;AACT;AAAA,UACJ;AACI,kBAAM,IAAI,WAAW,IAAI,uDAAuD,KAAK,EAAE;AAAA,QAC/F;AAAA,MACJ;AACA,YAAMC,KAAI;AAAA,QACN,MAAM;AAAA,QACN,OAAO,MAAM,KAAK;AAAA,QAClB,KAAK,OAAO,OAAO,CAAC,GAAG,MAAM,CAAC,EAAE,KAAK,EAAE,KAAK,CAAC;AAAA,MACjD;AACA,aAAO,CAACA,EAAC;AAAA,IACb;AACA,QAAM,iBAAiB;AAAA,MACnB;AAAA,MACA;AAAA,MACA;AAAA,MACA;AAAA,MACA;AAAA,MACA;AAAA,IACJ;AACA,QAAM,oBAAoB,CAAC,QAAQ,OAAO,OAAO,OAAO,QAAQ,OAAO;AAMvE,QAAM,aAAN,cAAyB,MAAM;AAAA;AAAA,MAE3B,YAAY,IAAI,KAAK;AACjB,cAAM,WAAW,MAAM,YAAY,IAAI,GAAG,CAAC;AAAA,MAC/C;AAAA,IACJ;AACA,YAAQ,aAAa;AACrB,QAAM,SAAN,MAAa;AAAA,MACT,YAAY,KAAK,KAAK;AAClB,YAAI,IAAI,IAAI,IAAI;AAChB,aAAK,QAAQ,WAAW,MAAM,MAAM,GAAG;AACvC,aAAK,gBAAgB,KAAK,QAAQ,QAAQ,QAAQ,SAAS,SAAS,IAAI,cAAc,QAAQ,OAAO,SAAS,KAAK;AACnH,aAAK,eAAe,KAAK,QAAQ,QAAQ,QAAQ,SAAS,SAAS,IAAI,aAAa,QAAQ,OAAO,SAAS,KAAK;AACjH,aAAK,UAAU,KAAK,QAAQ,QAAQ,QAAQ,SAAS,SAAS,IAAI,YAAY,QAAQ,OAAO,SAAS,KAAK;AAC3G,aAAK,oBAAoB,KAAK,QAAQ,QAAQ,QAAQ,SAAS,SAAS,IAAI,sBAAsB,QAAQ,OAAO,SAAS,KAAK;AAAA,MACnI;AAAA,MACA,QAAQ;AACJ,eAAO,KAAK,UAAU,OAAO,IAAI;AAAA,MACrC;AAAA,MACA,eAAe,IAAI,MAAM,KAAK;AAC1B,YAAI,IAAI,CAAC,MAAM,KAAK;AAChB,cAAI,SAAS,UAAU;AACnB,kBAAM,IAAI,WAAW,IAAI,YAAY,GAAG,2BAA2B;AAAA,UACvE;AAAA,QACJ,WACS,SAAS,UAAU;AACxB,gBAAMC,QAAO,SAAS,WAAW,KAAK,eAAe,KAAK;AAC1D,cAAI,KAAK,oBAAoBA,MAAK,SAAS,KAAK,CAACA,MAAK,SAAS,GAAG,GAAG;AACjE,kBAAM,MAAM,OAAO,IAAI,SAAS,GAAG;AACnC,kBAAM,IAAI,WAAW,IAAI,GAAG;AAAA,UAChC;AAAA,QACJ;AAAA,MACJ;AAAA,MACA,YAAY,EAAE,OAAO,IAAI,GAAG,UAAU,KAAK,MAAM;AAC7C,cAAM,MAAM,EAAE,MAAM,KAAK,OAAO,CAAC,GAAG,IAAI;AACxC,YAAI,SAAS,YAAY,SAAS;AAC9B,qBAAW;AAAA,iBACN,KAAK;AACV,qBAAW;AACf,mBAAW,MAAM,KAAK,OAAO;AACzB,kBAAQ,GAAG,MAAM;AAAA,YACb,KAAK;AACD,kBAAI,SAAS,UAAU;AACnB,sBAAM,IAAI,WAAW,IAAI,qCAAqC;AAAA,cAClE;AACA,kBAAI,IAAI,MAAM,SAAS,GAAG;AACtB,sBAAM,IAAI,WAAW,IAAI,wCAAwC;AAAA,cACrE;AACA,kBAAI,eAAe,OAAO,GAAG,KAAK;AAClC,kBAAI,QAAQ,GAAG;AACf,kBAAI,cAAc,GAAG;AACrB;AAAA,YACJ,KAAK,QAAQ;AACT,mBAAK,eAAe,IAAI,MAAM,GAAG,KAAK;AACtC,kBAAI,MAAM,KAAK;AAAA,gBACX,KAAK,GAAG;AAAA,gBACR,QAAQ,KAAK,UAAU,QAAQ;AAAA,gBAC/B,KAAK,WAAW,EAAE;AAAA,cACtB,CAAC;AACD;AAAA,YACJ;AAAA,YACA,KAAK;AACD,qBAAO;AAAA,YAEX;AACI,oBAAM,IAAI,WAAW,IAAI,2BAA2B,GAAG,IAAI,EAAE;AAAA,UACrE;AAAA,QACJ;AACA,cAAM,IAAI,WAAW,MAAM,wBAAwB;AAAA,MACvD;AAAA,MACA,cAAc,IAAI,UAAU;AACxB,cAAM,MAAM,WAAW,EAAE;AACzB,cAAM,UAAU,KAAK,MAAM,KAAK;AAChC,YAAI,CAAC;AACD,gBAAM,IAAI,WAAW,MAAM,wBAAwB;AACvD,YAAI,QAAQ,QAAQ;AACpB,YAAI,cAAc,QAAQ;AAC1B,YAAI,KAAK,WACJ,QAAQ,SAAS,iBAAiB,QAAQ,SAAS,gBACpD,CAAC,eAAe,SAAS,QAAQ,KAAK,GAAG;AACzC,gBAAM,MAAM,0CAA0C,QAAQ,KAAK;AACnE,gBAAM,IAAI,WAAW,IAAI,GAAG;AAAA,QAChC;AACA,gBAAQ,QAAQ,MAAM;AAAA,UAClB,KAAK;AACD,mBAAO,EAAE,MAAM,YAAY,KAAK,GAAG,OAAO,IAAI;AAAA,UAClD,KAAK,eAAe;AAChB,kBAAM,MAAM,KAAK,MAAM,KAAK;AAC5B,gBAAI,CAAC;AACD,oBAAM,IAAI,WAAW,MAAM,wBAAwB;AAEvD,gBAAI,IAAI,SAAS,OAAO;AACpB,oBAAM,IAAI,WAAW,KAAK,2BAA2B,IAAI,IAAI,EAAE;AAAA,YACnE;AACA,gBAAI,QAAQ,IAAI;AAChB,gBAAI,aAAa,QAAQ,MAAM,YAAY,CAAC,GAAG;AAC3C,oBAAM,IAAI,WAAW,SAAS,4BAA4B,QAAQ,KAAK,EAAE;AAAA,YAC7E;AACA,mBAAO;AAAA,cACH,MAAM;AAAA,cACN,KAAK,GAAG;AAAA,cACR,KAAK,QAAQ;AAAA,cACb;AAAA,YACJ;AAAA,UACJ;AAAA,UACA,KAAK,aAAa;AACd,gBAAI,aAAa,QAAQ,MAAM,YAAY,CAAC,GAAG;AAC3C,oBAAM,MAAM,4BAA4B,QAAQ,KAAK;AACrD,oBAAM,IAAI,WAAW,SAAS,GAAG;AAAA,YACrC;AACA,gBAAI,QAAQ,KAAK,UAAU,KAAK,SAAS,QAAQ,QAAQ;AACzD,gBAAI,KAAK,UAAU,MAAM,SAAS,GAAG;AACjC,sBAAQ,oBAAoB,IAAI,KAAK;AAAA,YACzC;AACA,mBAAO;AAAA,cACH,MAAM;AAAA,cACN,KAAK,GAAG;AAAA,cACR,KAAK,QAAQ;AAAA,cACb;AAAA,cACA;AAAA,YACJ;AAAA,UACJ;AAAA,UACA,KAAK;AAED,gBAAI,aAAa,QAAQ,KAAK,GAAG;AAC7B,qBAAO,KAAK,YAAY,IAAI,UAAU,KAAK,QAAQ,KAAK;AAAA,YAC5D,OACK;AACD,oBAAM,IAAI,WAAW,SAAS,0BAA0B,QAAQ,KAAK,EAAE;AAAA,YAC3E;AAAA,UAEJ;AACI,kBAAM,IAAI,WAAW,SAAS,2BAA2B,QAAQ,IAAI,EAAE;AAAA,QAC/E;AAAA,MACJ;AAAA,MACA,UAAU,UAAU,QAAQ;AACxB,cAAM,SAAS,CAAC;AAChB,YAAI,UAAU;AACd,mBAAW,MAAM,KAAK,OAAO;AACzB,cAAI,GAAG,SAAS,YAAY;AACxB,gBAAI;AACA,wBAAU;AACd,mBAAO,KAAK,KAAK,cAAc,IAAI,QAAQ,CAAC;AAAA,UAChD,WACS,GAAG,SAAS,gBAAgB,UAAU;AAC3C,gBAAI;AACA,wBAAU;AACd,mBAAO,KAAK,EAAE,MAAM,cAAc,KAAK,WAAW,EAAE,EAAE,CAAC;AAAA,UAC3D,WACS,GAAG,SAAS,SAAS,CAAC,QAAQ;AACnC,mBAAO;AAAA,UACX,OACK;AACD,gBAAI,QAAQ,GAAG;AACf,gBAAI,CAAC,YAAY,GAAG,SAAS,YAAY,MAAM,CAAC,MAAM,KAAK;AACvD,kBAAI,MAAM,SAAS,GAAG,GAAG;AACrB,sBAAM,SAAS,+BAA+B,KAAK;AACnD,sBAAM,IAAI,WAAW,IAAI,MAAM;AAAA,cACnC;AACA,sBAAQ,GAAG;AAAA,YACf;AACA,gBAAI,SAAS;AACT,sBAAQ,SAAS;AACjB,sBAAQ,IAAI,QAAQ,GAAG;AACvB,sBAAQ,IAAI,cAAc,GAAG;AAAA,YACjC,OACK;AACD,wBAAU,EAAE,MAAM,WAAW,OAAO,KAAK,WAAW,EAAE,EAAE;AACxD,qBAAO,KAAK,OAAO;AAAA,YACvB;AAAA,UACJ;AAAA,QACJ;AACA,YAAI;AACA,iBAAO;AACX,cAAM,IAAI,WAAW,MAAM,wBAAwB;AAAA,MACvD;AAAA,IACJ;AASA,aAASH,OAAM,KAAK,UAAU,CAAC,GAAG;AAC9B,YAAM,SAAS,IAAI,OAAO,KAAK,OAAO;AACtC,aAAO,OAAO,MAAM;AAAA,IACxB;AAAA;AAAA;;;ACzTA,SAAS,QAAAI,aAAY;;;ACArB,IAAI,IAAE,WAAU;AAAC,WAAQ,IAAE,CAAC,GAAEC,KAAE,UAAU,QAAOA,OAAK,GAAEA,EAAC,IAAE,UAAUA,EAAC;AAAE,SAAO,EAAE,OAAO,SAASC,IAAED,IAAE;AAAC,WAAOC,GAAE,OAAO,YAAU,OAAOD,KAAEA,KAAE,MAAM,QAAQA,EAAC,IAAE,EAAE,MAAM,QAAOA,EAAC,IAAE,YAAU,OAAOA,MAAGA,KAAE,OAAO,KAAKA,EAAC,EAAE,IAAI,SAASE,IAAE;AAAC,aAAOF,GAAEE,EAAC,IAAEA,KAAE;AAAA,IAAE,CAAC,IAAE,EAAE;AAAA,EAAC,GAAE,CAAC,CAAC,EAAE,KAAK,GAAG;AAAC;;;ACOjQ,IAAM,QAAQ;AAAA,EACnB,MAAM;AAAA,EACN,SAAS;AAAA,EACT,MAAM;AAAA,EACN,UAAU;AAAA,EACV,SAAS;AAAA,EACT,UAAU;AAAA,EACV,UAAU;AAAA,EACV,OAAO;AAAA,EACP,WAAW;AAAA,EACX,cAAc;AAAA,EACd,YAAY;AAAA,EACZ,YAAY;AAAA,EACZ,YAAY;AAAA,EACZ,YAAY;AACd;AAeO,IAAM,MAAM;AAAA,EACjB,MAAM;AAAA;AAAA,EACN,OAAO;AAAA;AAAA,EACP,MAAM;AAAA,EACN,SAAS;AAAA,EACT,UAAU;AACZ;AAEO,IAAM,OAAO;AAAA,EAClB,SAAS;AAAA,EACT,QAAQ;AAAA,EACR,YACE;AAAA,EACF,QAAQ;AAAA,EACR,OAAO;AAAA,EACP,mBAAmB;AAAA,EACnB,gBAAgB;AAAA,EAChB,OAAO;AAAA,EACP,MAAM;AACR;AAoCO,IAAM,OAAO;AAAA,EAClB,MAAM;AAAA,EACN,QAAQ;AAAA,EACR,UAAU;AAAA,EACV,SAAS;AAAA,EACT,mBAAmB;AAAA,EACnB,iBAAiB;AAAA,EACjB,MAAM;AAAA,EACN,gBAAgB;AAAA,EAChB,cACE;AAAA,EACF,MAAM;AACR;AAgBO,IAAM,UAAU;AAAA,EACrB,SAAS;AAAA,EACT,MAAM;AAAA,EACN,SAAS;AACX;AAEO,IAAM,QAAQ;AAAA,EACnB,SAAS;AAAA,EACT,MAAM;AAAA,EACN,UAAU;AAAA,EACV,SAAS;AAAA,EACT,UAAU;AAAA,EACV,UAAU;AAAA,EACV,cAAc;AAAA,EACd,aAAa;AAAA,EACb,cAAc;AAAA,EACd,aAAa;AAAA,EACb,SAAS;AAAA,EACT,OAAO;AACT;AAgCO,IAAM,aAAa;AAAA,EACxB,SAAS;AAAA,EACT,KAAK;AAAA,EACL,OAAO;AAAA,EACP,SAAS;AAAA,EACT,eAAe;AAAA,EACf,kBAAkB;AAAA,EAClB,eAAe;AAAA,EACf,iBAAiB;AAAA;AAAA,EAGjB,8BACE;AAAA,EACF,4BACE;AAAA,EACF,uBAAuB;AAAA,EACvB,yBAAyB;AAAA,EAEzB,WAAW;AAAA,EACX,sBAAsB;AAAA,EACtB,QAAQ;AAAA,EACR,WAAW;AAAA,EACX,kBAAkB;AAAA,EAClB,OAAO;AAAA,EACP,WAAW;AACb;AAEA,IAAM,uBAAuB;AAE7B,IAAM,eAAe;AAAA,EACnB,SACE;AAAA,EACF,WAAW;AAAA,EACX,SAAS;AAAA,EACT,aAAa;AAAA,EACb,MAAM;AAAA,EACN,UAAU;AAAA,EACV,OAAO;AAAA,EACP,cAAc;AAAA,EACd,eAAe;AAAA,EACf,SAAS;AAAA,EACT,MAAM;AACR;AAEA,IAAM,cAAc;AAAA,EAClB,SAAS,sBAAsB,oBAAoB;AAAA,EACnD,WAAW,sBAAsB,oBAAoB;AAAA,EACrD,SAAS,oBAAoB,oBAAoB;AAAA,EACjD,UAAU,sBAAsB,oBAAoB;AAAA,EACpD,MAAM,2FAA2F,oBAAoB;AAAA,EACrH,MAAM,gGAAgG,aAAa,IAAI;AACzH;AAEA,IAAM,cAAc;AAAA,EAClB,QAAQ;AAAA,EACR,OAAO;AAAA,EACP,QAAQ;AAAA,EACR,OAAO;AAAA,EACP,SAAS;AAAA,EACT,cAAc;AAAA,EACd,MAAM;AAAA,EACN,WAAW;AAAA,EACX,MAAM;AACR;AAEA,IAAM,kBAAkB;AAAA,EACtB,QAAQ;AAAA,EACR,QAAQ;AACV;AAEA,IAAM,iBAAiB;AAAA,EACrB,YAAY,6DAA6D,aAAa,OAAO;AAAA;AAAA,EAC7F,OAAO,sBAAsB,oBAAoB;AAAA,EACjD,cAAc,sBAAsB,oBAAoB;AAAA,EACxD,eAAe,sBAAsB,oBAAoB;AAAA,EACzD,YAAY,6FAA6F,aAAa,QAAQ;AAAA;AAChI;AAEO,IAAM,SAAS;AAAA;AAAA,EAEpB,WAAW,GAAG,YAAY,MAAM,IAAI,gBAAgB,MAAM,IAAI,YAAY,SAAS,IAAI,aAAa,SAAS;AAAA;AAAA,EAC7G,eAAe,GAAG,YAAY,MAAM,IAAI,gBAAgB,MAAM,IAAI,YAAY,SAAS,IAAI,aAAa,SAAS;AAAA,EACjH,mBAAmB,GAAG,YAAY,MAAM,IAAI,gBAAgB,MAAM,IAAI,YAAY,SAAS,IAAI,eAAe,UAAU;AAAA,EACxH,gBAAgB,GAAG,gBAAgB,MAAM,IAAI,YAAY,MAAM,IAAI,YAAY,SAAS,IAAI,aAAa,SAAS;AAAA,EAClH,wBAAwB,GAAG,gBAAgB,MAAM,IAAI,YAAY,MAAM,IAAI,YAAY,SAAS,IAAI,eAAe,UAAU;AAAA,EAC7H,gBAAgB,GAAG,YAAY,MAAM,IAAI,gBAAgB,MAAM,IAAI,eAAe,KAAK,IAAI,aAAa,KAAK;AAAA,EAC7G,wBAAwB,GAAG,YAAY,MAAM,IAAI,gBAAgB,MAAM,IAAI,eAAe,KAAK,IAAI,eAAe,UAAU;AAAA,EAC5H,qBAAqB,GAAG,gBAAgB,MAAM,IAAI,YAAY,MAAM,IAAI,eAAe,KAAK,IAAI,aAAa,KAAK;AAAA,EAClH,6BAA6B,GAAG,gBAAgB,MAAM,IAAI,YAAY,MAAM,IAAI,eAAe,KAAK,IAAI,eAAe,UAAU;AAAA,EACjI,kBAAkB,GAAG,YAAY,MAAM,IAAI,gBAAgB,MAAM,IAAI,YAAY,SAAS,IAAI,eAAe,UAAU;AAAA,EACvH,uBAAuB,GAAG,gBAAgB,MAAM,IAAI,YAAY,MAAM,KAAK,YAAY,SAAS,IAAI,eAAe,UAAU;AAAA,EAC7H,4BAA4B,GAAG,gBAAgB,MAAM,IAAI,YAAY,MAAM,IAAI,eAAe,KAAK,IAAI,eAAe,UAAU;AAAA,EAChI,uBAAuB,GAAG,YAAY,MAAM,IAAI,gBAAgB,MAAM,IAAI,eAAe,KAAK,IAAI,eAAe,UAAU;AAAA,EAE3H,SAAS,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,YAAY,OAAO,IAAI,aAAa,OAAO;AAAA;AAAA,EACtG,iBAAiB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,UAAU,IAAI,YAAY,OAAO;AAAA,EACnH,cAAc,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,YAAY,OAAO,IAAI,aAAa,OAAO;AAAA,EAC3G,sBAAsB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,UAAU,IAAI,YAAY,OAAO;AAAA,EACxH,cAAc,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,KAAK,IAAI,aAAa,KAAK;AAAA,EAC1G,sBAAsB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,KAAK,IAAI,eAAe,UAAU;AAAA,EACzH,mBAAmB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,KAAK,IAAI,aAAa,KAAK;AAAA,EAC/G,2BAA2B,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,KAAK,IAAI,eAAe,UAAU;AAAA,EAC9H,gBAAgB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,UAAU,IAAI,YAAY,OAAO;AAAA,EAClH,qBAAqB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,KAAK,eAAe,UAAU,IAAI,YAAY,OAAO;AAAA,EACxH,0BAA0B,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,KAAK,IAAI,eAAe,UAAU,IAAI,YAAY,OAAO;AAAA,EACpJ,qBAAqB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,KAAK,IAAI,eAAe,UAAU;AAAA,EAExH,SAAS,GAAG,YAAY,OAAO,IAAI,gBAAgB,MAAM,IAAI,YAAY,OAAO,IAAI,aAAa,OAAO;AAAA;AAAA,EACxG,iBAAiB,GAAG,YAAY,OAAO,IAAI,gBAAgB,MAAM,IAAI,YAAY,OAAO,IAAI,eAAe,UAAU;AAAA,EACrH,cAAc,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,YAAY,IAAI,aAAa,YAAY;AAAA;AAAA,EACxH,sBAAsB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,YAAY,IAAI,eAAe,UAAU;AAAA,EAChI,cAAc,GAAG,YAAY,YAAY,IAAI,gBAAgB,MAAM,IAAI,YAAY,OAAO,IAAI,aAAa,OAAO;AAAA,EAClH,sBAAsB,GAAG,YAAY,YAAY,IAAI,gBAAgB,MAAM,IAAI,YAAY,OAAO,IAAI,eAAe,UAAU;AAAA,EAC/H,mBAAmB,GAAG,YAAY,YAAY,IAAI,gBAAgB,MAAM,IAAI,eAAe,YAAY,IAAI,aAAa,YAAY;AAAA,EACpI,2BAA2B,GAAG,YAAY,YAAY,IAAI,gBAAgB,MAAM,IAAI,eAAe,YAAY,IAAI,eAAe,UAAU;AAAA,EAC5I,gBAAgB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,YAAY,OAAO,IAAI,eAAe,UAAU;AAAA,EAClH,qBAAqB,GAAG,YAAY,YAAY,IAAI,gBAAgB,MAAM,IAAI,YAAY,OAAO,IAAI,eAAe,UAAU;AAAA,EAC9H,qBAAqB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,UAAU,IAAI,eAAe,YAAY;AAAA,EAC/H,0BAA0B,GAAG,YAAY,YAAY,IAAI,gBAAgB,MAAM,IAAI,eAAe,UAAU,IAAI,eAAe,YAAY;AAAA,EAE3I,UAAU,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,YAAY,QAAQ,IAAI,aAAa,WAAW;AAAA;AAAA,EAC5G,kBAAkB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,YAAY,QAAQ,IAAI,eAAe,UAAU;AAAA,EACrH,eAAe,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,aAAa,IAAI,aAAa,aAAa;AAAA;AAAA,EAC3H,uBAAuB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,aAAa,GAAG,eAAe,UAAU;AAAA,EACjI,eAAe,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,YAAY,QAAQ,IAAI,aAAa,WAAW;AAAA,EACjH,uBAAuB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,YAAY,QAAQ,IAAI,eAAe,UAAU;AAAA,EAC1H,oBAAoB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,aAAa,IAAI,aAAa,aAAa;AAAA,EAChI,4BAA4B,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,aAAa,IAAI,eAAe,UAAU;AAAA,EACvI,iBAAiB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,YAAY,QAAQ,IAAI,eAAe,UAAU;AAAA,EACpH,sBAAsB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,UAAU,IAAI,YAAY,QAAQ;AAAA,EACzH,sBAAsB,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,aAAa,IAAI,YAAY,QAAQ,IAAI,eAAe,UAAU;AAAA,EACzJ,2BAA2B,GAAG,YAAY,KAAK,IAAI,gBAAgB,MAAM,IAAI,eAAe,aAAa,IAAI,eAAe,UAAU;AAAA,EAEtI,MAAM,GAAG,YAAY,IAAI,IAAI,gBAAgB,MAAM,IAAI,YAAY,IAAI,IAAI,aAAa,IAAI;AAAA;AAAA,EAC5F,WAAW,GAAG,YAAY,SAAS,IAAI,gBAAgB,MAAM,IAAI,YAAY,IAAI,IAAI,aAAa,IAAI;AAAA,EACtG,aAAa,GAAG,YAAY,IAAI,IAAI,gBAAgB,MAAM,IAAI,YAAY,IAAI,IAAI,eAAe,UAAU;AAAA,EAC3G,kBAAkB,GAAG,YAAY,SAAS,IAAI,gBAAgB,MAAM,IAAI,YAAY,IAAI,IAAI,eAAe,UAAU;AAAA,EAErH,MAAM,GAAG,YAAY,IAAI,IAAI,gBAAgB,MAAM,IAAI,YAAY,IAAI;AAAA,EACvE,WAAW,GAAG,YAAY,IAAI,IAAI,gBAAgB,MAAM,IAAI,YAAY,IAAI;AAAA,EAC5E,cAAc;AAAA,EACd,MAAM;AAAA,EACN,WAAW;AAAA,EACX,cAAc;AAChB;AAwBO,IAAM,QAAQ;AAAA,EACnB,UACE;AAAA,EACF,MAAM;AAAA,EACN,SAAS;AAAA,EACT,QAAQ;AAAA,EACR,iBAAiB;AAAA,EACjB,uBAAuB;AAAA,EACvB,wBAAwB;AAAA,EACxB,OACE;AAAA,EACF,WAAW;AAAA,EACX,aAAa,GAAG,gBAAgB,MAAM,IAAI,YAAY,IAAI,IAAI,aAAa,IAAI;AAAA,EAC/E,iBAAiB;AAAA,EACjB,kBAAkB;AAAA,EAClB,iBAAiB;AAAA,EACjB,wBAAwB;AAC1B;AAEO,IAAM,eAAe;AAAA;AAAA,EAE1B,UACE;AAAA,EACF,aACE;AAAA,EACF,aAAa;AAAA,EACb,QAAQ;AAAA,EACR,gBAAgB;AAAA,EAChB,cACE;AAAA,EACF,kBACE;AAAA,EACF,mBACE;AAAA,EACF,0BAA0B;AAAA,EAC1B,aAAa;AAAA,EACb,2BAA2B;AAAA,EAC3B,8BAA8B;AAAA,EAC9B,wBAAwB;AAAA,EACxB,QAAQ;AACV;AAEO,IAAM,QAAQ;AAAA,EACnB,SAAS;AAAA,EACT,kBAAkB;AAAA,EAClB,aAAa;AAAA,EACb,OAAO;AAAA,EACP,MAAM;AAAA,EACN,UAAU;AAAA,EACV,cAAc;AAAA,EACd,UAAU;AAAA,EACV,cAAc;AAAA,EACd,SAAS;AAAA,EACT,aAAa;AAAA,EACb,MAAM;AAAA,EACN,UAAU;AACZ;AAEO,IAAM,QAAQ;AAAA;AAAA,EAEnB,SAAS;AAAA;AAAA,EAET,MAAM;AAAA;AAAA,EACN,SAAS;AAAA;AAAA,EACT,UAAU;AAAA;AAAA,EACV,SAAS;AAAA;AAAA,EACT,UAAU;AAAA;AAAA,EACV,aAAa;AAAA,EACb,QAAQ;AAAA,EACR,QAAQ;AAAA;AAAA,EAER,UAAU;AACZ;AAEO,IAAM,SAAS;AAAA,EACpB,MAAM;AAAA,EACN,SAAS;AAAA,EACT,UACE;AAAA,EACF,SACE;AAAA,EACF,UAAU;AAAA,EACV,SAAS;AAAA,EACT,eAAe;AAAA,EACf,SAAS;AAAA,EACT,iBAAiB;AACnB;AAEO,IAAM,QAAQ;AAAA,EACnB,MAAM;AAAA,EACN,UAAU;AACZ;AAEO,IAAM,WAAW;AAAA,EACtB,MAAM;AAAA,EACN,OAAO;AAAA,EACP,cAAc;AAChB;AAEA,IAAM,sBACJ;AAEK,IAAM,SAAS;AAAA,EACpB,SAAS,sBAAsB;AAAA,EAC/B,kBAAkB;AAAA,EAClB,iBAAiB;AAAA,EACjB,OAAO;AACT;AAEO,IAAM,SAAS;AAAA,EACpB,SAAS,sBAAsB;AAAA,EAC/B,kBAAkB;AAAA,EAClB,iBAAiB;AAAA,EACjB,OAAO;AACT;AAEO,IAAM,cAAc;AAAA,EACzB,SAAS;AAAA,EACT,MAAM;AAAA,EACN,MAAM;AAAA,EACN,WAAW;AAAA,EACX,MAAM;AACR;AAEO,IAAM,SAAS;AAAA;AAAA,EAEpB,OAAO;AAAA;AAAA,EACP,SAAS;AAAA;AAAA,EACT,qBAAqB;AAAA;AAAA,EACrB,8BAA8B;AAAA;AAAA;AAAA,EAG9B,mBAAmB;AAAA;AAAA,EACnB,4BAA4B;AAAA;AAAA;AAAA,EAG5B,OAAO;AAAA,EACP,MAAM;AAAA;AAAA,EAGN,OACE;AAAA;AAAA,EACF,aAAa;AAAA;AAAA,EACb,UACE;AAAA;AAAA,EACF,iBACE;AAAA;AAAA,EACF,kBACE;AAAA;AAAA,EACF,eACE;AAAA;AAAA,EACF,sBACE;AAAA;AAAA,EACF,uBACE;AAAA;AAAA,EACF,OACE;AAAA;AAAA,EACF,cACE;AAAA;AAAA,EACF,eACE;AAAA;AAAA,EACF,mBACE;AAAA;AAAA,EACF,qBAAqB;AAAA;AAAA,EACrB,mBAAmB;AAAA;AACrB;AAEO,IAAM,aAAa;AAAA,EACxB,SAAS,GAAG,OAAO,OAAO;AAAA,EAC1B,OAAO,GAAG,OAAO,KAAK;AAAA,EACtB,UAAU;AAAA,EACV,UAAU;AAAA,EACV,YAAY,GAAG,OAAO,KAAK,IAAI,OAAO,WAAW,IAAI,OAAO,KAAK;AAAA,EACjE,eAAe,GAAG,OAAO,KAAK,IAAI,OAAO,WAAW,IAAI,OAAO,QAAQ;AACzE;AAoBO,IAAM,YAAY;AAAA,EACvB,MAAM;AAAA,EACN,SAAS;AAAA,EACT,SAAS;AAAA,EACT,WAAW;AAAA,EACX,SACE;AAAA,EAEF,WAAW;AAAA,EACX,yBAAyB;AAAA,EACzB,oBAAoB;AAAA,EACpB,uBAAuB;AAAA,EACvB,0BAA0B;AAAA,EAC1B,qBAAqB;AAAA,EACrB,wBAAwB;AAAA,EACxB,2BAA2B;AAAA,EAC3B,sBAAsB;AAAA,EACtB,yBAAyB;AAAA,EACzB,wBAAwB;AAAA,EACxB,mBAAmB;AAAA,EACnB,sBAAsB;AAAA,EACtB,cAAc;AAAA,EACd,cAAc;AAAA,EACd,cAAc;AAAA,EACd,gBAAgB;AAAA,EAEhB,SAAS;AAAA,EACT,YAAY;AAAA,EACZ,UAAU,GAAG,gBAAgB,MAAM,IAAI,YAAY,IAAI,IAAI,aAAa,IAAI;AAC9E;;;AF9iBA,OAAO,iBAAiB;AACxB,SAAS,iBAAiB;;;AGL1B,SAAS,kBAAkB;AAC3B,SAAS,cAAc,YAAY;;;AODnC,mBAAsB;;;ACAtB,oBAAsB;AAYtB,IAAM,kBAAN,cAA8B,MAAM;AAAA;AAAA,EAEhC,YAAY,KAAK,OAAO,MAAM;AAC1B,UAAM,GAAG;AACT,SAAK,QAAQ;AACb,SAAK,OAAO,QAAQ;AAAA,EACxB;AACJ;AACA,IAAM,QAAQ,CAAC,UAAU,QAAQ,IAAI,UAAU,UAAU,IAAI,SAAS;AACtE,IAAM,UAAU,CAAC,UAAW,QAAQ,MAAM,IAAI,YAAY;AAC1D,SAAS,YAAY,OAAO,SAAS;AACjC,UAAQ,MAAM,MAAM;AAAA,IAChB,KAAK;AACD,aAAO,EAAE,MAAM,QAAQ,MAAM,KAAK,EAAE;AAAA,IACxC,KAAK;AACD,aAAO,EAAE,UAAU,WAAW,MAAM,UAAU;AAAA,IAClD,KAAK;AAAA,IACL,KAAK;AAAA,IACL,KAAK;AAAA,IACL;AACI,cAAQ,GAAG,MAAM,IAAI,mDAAmD,gBAAgB,OAAO;AAC/F,aAAO,EAAE,MAAM,UAAU;AAAA,EACjC;AACJ;AACA,SAAS,WAAW,OAAO,SAAS;AAChC,UAAQ,MAAM,OAAO;AAAA,IACjB,KAAK;AACD,aAAO;AAAA,IACX,KAAK;AACD,aAAO;AAAA,IACX,KAAK;AACD,aAAO;AAAA,IACX,KAAK;AACD,aAAO;AAAA,IACX,KAAK;AACD,aAAO;AAAA,IACX;AACI,cAAQ,GAAG,MAAM,IAAI,gCAAgC,MAAM,KAAK,EAAE;AAClE,aAAO;AAAA,EACf;AACJ;AACA,SAAS,SAAS,OAAO,SAAS;AAC9B,QAAM,EAAE,MAAM,MAAM,MAAM,IAAI;AAC9B,MAAI,SAAS,KAAK;AACd,WAAO,QAAQ,KAAK;AAAA,EACxB,OACK;AACD,YAAQ,GAAG,IAAI,mBAAmB;AAClC,WAAO;AAAA,EACX;AACJ;AACA,SAAS,aAAa,OAAO,SAAS;AAClC,QAAM,EAAE,MAAM,MAAM,MAAM,IAAI;AAC9B,OAAK,SAAS,OAAO,SAAS,QAAQ,QAAQ,GAAG;AAE7C,UAAM,MAAM,sCAAsC,IAAI;AACtD,YAAQ,KAAK,gBAAgB,OAAO;AAAA,EACxC;AAEA,SAAO,MAAM,KAAK;AACtB;AACA,SAAS,YAAY,OAAO;AACxB,QAAM,OAAO,QAAQ,MAAM,KAAK;AAChC,MAAI;AACJ,UAAQ,MAAM,MAAM;AAAA,IAChB,KAAK;AACD,kBAAY;AACZ;AAAA,IACJ,KAAK;AACD,kBAAY;AACZ;AAAA,IACJ,KAAK;AACD,kBAAY;AACZ;AAAA,IACJ,KAAK;AACD,kBAAY;AACZ;AAAA,EACR;AACA,SAAO,YAAY,EAAE,MAAM,UAAU,IAAI,EAAE,KAAK;AACpD;AACA,SAAS,kBAAkB,OAAO,SAAS;AAEvC,QAAM,EAAE,MAAM,MAAM,MAAM,IAAI;AAC9B,UAAQ,MAAM;AAAA,IACV,KAAK;AAAA,IACL,KAAK;AACD,aAAO,UAAU,IAAI,SAAS;AAAA,IAClC,KAAK;AACD,UAAI,UAAU;AACV,eAAO;AACX,cAAQ,GAAG,IAAI,gCAAgC,KAAK,EAAE;AACtD,aAAO;AAAA,IACX,KAAK;AACD,cAAQ,GAAG,IAAI,mBAAmB;AAClC,aAAO;AAAA,EACf;AACA,SAAO;AACX;AACA,SAAS,eAAe,OAAO,SAAS;AACpC,UAAQ,MAAM,OAAO;AAAA,IACjB,KAAK;AACD,aAAO,EAAE,KAAK,MAAM,MAAM,KAAK,EAAE;AAAA,IACrC,KAAK;AACD,aAAO,YAAY,OAAO,OAAO;AAAA,IACrC,KAAK;AACD,aAAO,EAAE,OAAO,WAAW,OAAO,OAAO,EAAE;AAAA,IAC/C,KAAK;AACD,aAAO,EAAE,KAAK,SAAS,OAAO,OAAO,EAAE;AAAA,IAC3C,KAAK;AACD,aAAO,EAAE,SAAS,aAAa,OAAO,OAAO,EAAE;AAAA,IACnD,KAAK;AACD,aAAO;AAAA,IACX,KAAK;AACD,aAAO,YAAY,KAAK;AAAA,IAC5B,KAAK;AACD,aAAO,EAAE,QAAQ,QAAQ,MAAM,KAAK,EAAE;AAAA,IAC1C,KAAK;AACD,aAAO,EAAE,QAAQ,QAAQ,MAAM,KAAK,EAAE;AAAA,IAC1C,KAAK;AACD,aAAO,EAAE,cAAc,kBAAkB,OAAO,OAAO,EAAE;AAAA,IAC7D,KAAK;AAAA,IACL,KAAK;AAAA,IACL,KAAK;AAAA,IACL,KAAK;AACD,cAAQ,GAAG,MAAM,IAAI,mBAAmB;AAAA,EAChD;AACA,SAAO;AACX;AACA,SAAS,qBAAqB,QAAQ,UAAU,UAAU,WAAS;AAC/D,QAAM;AACV,GAAG;AACC,QAAM,UAAU;AAAA,IACZ;AAAA,EACJ;AACA,QAAMC,UAAS,CAAC;AAChB,aAAW,SAAS,QAAQ;AACxB,UAAM,EAAE,OAAO,OAAO,IAAI,IAAI;AAC9B,QAAI,OAAO;AACP,YAAM,MAAM,IAAI,gBAAgB,MAAM,SAAS,KAAK;AACpD,UAAI,QAAQ,MAAM;AAClB,cAAQ,GAAG;AAAA,IACf;AACA,QAAI,KAAK;AACL,YAAM,MAAM,yBAAyB,GAAG;AACxC,cAAQ,IAAI,gBAAgB,KAAK,OAAO,gBAAgB,OAAO,CAAC;AAAA,IACpE;AACA,QAAI,OAAO;AACP,UAAIA,QAAO,QAAQ,KAAK,MAAM;AAC1B,QAAAA,QAAO,KAAK,KAAK;AAAA;AAEjB,gBAAQ,IAAI,gBAAgB,aAAa,KAAK,UAAU,KAAK,CAAC;AAAA,IACtE;AACA,UAAM,MAAM,eAAe,OAAO,CAAC,KAAK,cAAc,QAAQ,IAAI,gBAAgB,KAAK,OAAO,SAAS,CAAC,CAAC;AACzG,QAAI;AACA,aAAO,OAAO,SAAS,GAAG;AAAA,EAClC;AACA,SAAO;AACX;AAEA,IAAM,SAAS;AAAA,EACX,GAAG,EAAE,OAAO,OAAO,MAAM,MAAM;AAAA,EAC/B,GAAG,EAAE,OAAO,QAAQ,MAAM,OAAO;AAAA,EACjC,GAAG,EAAE,OAAO,QAAQ,MAAM,yBAAyB;AAAA,EACnD,GAAG,EAAE,OAAO,QAAQ,MAAM,gBAAgB;AAAA,EAC1C,GAAG,EAAE,OAAO,QAAQ,MAAM,mBAAmB;AAAA,EAC7C,GAAG,EAAE,OAAO,QAAQ,MAAM,yBAAyB;AAAA,EACnD,GAAG,EAAE,OAAO,WAAW,MAAM,UAAU;AAAA,EACvC,GAAG,EAAE,OAAO,WAAW,MAAM,sBAAsB;AAAA,EACnD,GAAG,EAAE,OAAO,SAAS,MAAM,gBAAgB;AAAA,EAC3C,GAAG,EAAE,OAAO,SAAS,MAAM,4BAA4B;AAAA,EACvD,GAAG,EAAE,OAAO,QAAQ,MAAM,eAAe;AAAA,EACzC,GAAG,EAAE,OAAO,QAAQ,MAAM,gBAAgB;AAAA,EAC1C,GAAG,EAAE,OAAO,OAAO,MAAM,eAAe;AAAA,EACxC,GAAG,EAAE,OAAO,OAAO,MAAM,cAAc;AAAA,EACvC,GAAG,EAAE,OAAO,OAAO,MAAM,uBAAuB;AAAA,EAChD,GAAG,EAAE,OAAO,OAAO,MAAM,sBAAsB;AAAA,EAC/C,GAAG,EAAE,OAAO,WAAW,MAAM,cAAc;AAAA,EAC3C,GAAG,EAAE,OAAO,WAAW,MAAM,oBAAoB;AAAA,EACjD,GAAG,EAAE,OAAO,WAAW,MAAM,gCAAgC;AAAA,EAC7D,GAAG,EAAE,OAAO,UAAU,MAAM,eAAe;AAAA,EAC3C,GAAG,EAAE,OAAO,UAAU,MAAM,6BAA6B;AAAA,EACzD,GAAG,EAAE,OAAO,UAAU,MAAM,sBAAsB;AAAA,EAClD,GAAG,EAAE,OAAO,QAAQ,MAAM,uBAAuB;AAAA,EACjD,GAAG,EAAE,OAAO,QAAQ,MAAM,qBAAqB;AAAA,EAC/C,GAAG,EAAE,OAAO,QAAQ,MAAM,qBAAqB;AAAA,EAC/C,GAAG,EAAE,OAAO,QAAQ,MAAM,uBAAuB;AAAA,EACjD,GAAG,EAAE,OAAO,QAAQ,MAAM,0BAA0B;AAAA,EACpD,GAAG,EAAE,OAAO,QAAQ,MAAM,yCAAyC;AAAA,EACnE,GAAG,EAAE,OAAO,QAAQ,MAAM,+CAA+C;AAAA,EACzE,GAAG,EAAE,OAAO,OAAO,MAAM,iBAAiB;AAAA,EAC1C,GAAG,EAAE,OAAO,OAAO,MAAM,mBAAmB;AAAA,EAC5C,GAAG,EAAE,OAAO,YAAY,MAAM,oBAAoB;AAAA,EAClD,GAAG,EAAE,OAAO,MAAM,MAAM,sBAAsB;AAAA,EAC9C,GAAG,EAAE,OAAO,MAAM,MAAM,mCAAmC;AAAA,EAC3D,GAAG,EAAE,OAAO,MAAM,MAAM,YAAY;AAAA,EACpC,GAAG,EAAE,OAAO,MAAM,MAAM,uBAAuB;AAAA,EAC/C,GAAG,EAAE,OAAO,MAAM,MAAM,kCAAkC;AAAA,EAC1D,GAAG,EAAE,OAAO,MAAM,MAAM,gBAAgB;AAAA,EACxC,GAAG,EAAE,OAAO,MAAM,MAAM,4BAA4B;AAAA,EACpD,GAAG,EAAE,OAAO,MAAM,MAAM,qBAAqB;AACjD;AACA,IAAM,WAAW,CAAC,SAAU,QAAQ,OAAO,QAAQ,OAAS,QAAQ,OAAO,QAAQ;AACnF,SAAS,eAAe,KAAK,KAAK;AAC9B,QAAM,OAAO,IAAI,GAAG;AACpB,MAAI,QAAQ;AACZ,SAAO,IAAI,EAAE,GAAG,MAAM;AAClB,MAAE;AACN,QAAM,QAAQ,OAAO,IAAI;AACzB,MAAI,CAAC,OAAO;AACR,UAAM,MAAM,cAAc,IAAI;AAC9B,WAAO,EAAE,MAAM,OAAO,IAAI,MAAM,GAAG,GAAG,MAAM;AAAA,EAChD;AACA,SAAO,EAAE,MAAM,OAAO,MAAM,OAAO,MAAM,MAAM,MAAM,MAAM;AAC/D;AACA,SAAS,gBAAgB,KAAK,KAAK;AAC/B,MAAI,MAAM,IAAI,EAAE,GAAG;AACnB,MAAI,QAAQ;AACZ,MAAI,QAAQ;AACR,WAAO,EAAE,MAAM,KAAK,KAAK,MAAM;AACnC,SAAO,MAAM;AACT,UAAM,OAAO,IAAI,EAAE,GAAG;AACtB,MAAE;AACF,QAAI,SAAS,QAAW;AACpB,YAAM,MAAM,2CAA2C,OAAO,GAAG;AACjE,aAAO,EAAE,MAAM,KAAK,OAAO,IAAI,MAAM,GAAG,GAAG,KAAK,MAAM;AAAA,IAC1D,WACS,SAAS,KAAK;AACnB,UAAI,IAAI,EAAE,GAAG,MAAM;AACf,eAAO,EAAE,MAAM,KAAK,KAAK,MAAM;AAAA;AAE/B,UAAE;AAAA,IACV;AACA,WAAO;AAAA,EACX;AACJ;AACA,SAAS,UAAU,KAAK,KAAK;AACzB,QAAM,OAAO,IAAI,GAAG;AACpB,MAAI,CAAC;AACD,WAAO;AACX,MAAI,SAAS,IAAI;AACb,WAAO,eAAe,KAAK,GAAG;AAClC,MAAI,SAAS;AACT,WAAO,gBAAgB,KAAK,GAAG;AACnC,MAAI,MAAM;AACV,MAAI,QAAQ;AACZ,SAAO,MAAM;AACT,UAAM,OAAO,IAAI,EAAE,GAAG;AACtB,QAAI,CAAC,QAAQ,SAAS,IAAI,KAAK,SAAS;AACpC,aAAO,EAAE,MAAM,KAAK,MAAM;AAC9B,WAAO;AACP,aAAS;AAAA,EACb;AACJ;AAyBA,SAAS,gBAAgB,KAAK;AAC1B,QAAM,SAAS,CAAC;AAChB,MAAI,MAAM;AACV,SAAO,MAAM;AACT,UAAM,QAAQ,UAAU,KAAK,GAAG;AAChC,QAAI,CAAC;AACD,aAAO;AACX,WAAO,KAAK,KAAK;AACjB,WAAO,MAAM;AAAA,EACjB;AACJ;AAEA,SAAS,cAAc,QAAQ,SAAS;AACtC,MAAI,CAAC,OAAO,OAAO,CAAC,UAAU,MAAM,SAAS,SAAS,EAAE,QAAQ;AAC9D,WAAO,OAAO,IAAI,CAAC,UAAU,QAAQ,MAAM,KAAK,CAAC;AAAA,EACnD;AACA,SAAO,OAAO,IAAI,CAAC,UAAU;AAjT/B;AAkTI,QAAI,MAAM,SAAS,WAAW;AAC5B,aAAO,QAAQ,MAAM,KAAK;AAAA,IAC5B,WAAW,MAAM,SAAS,cAAc;AACtC,aAAO;AAAA,IACT,WAAW,MAAM,SAAS,YAAY;AACpC,aAAO,CAAC,MAAM,GAAG;AAAA,IACnB,WAAW,MAAM,SAAS,YAAY;AACpC,YAAM,UAAS,oCAAO,UAAP,mBAAe;AAC9B,UAAI,MAAM,QAAQ,UAAU,QAAQ;AAClC,cAAM,OAAO,sBAAsB,OAAO,MAAM,KAAK,GAAG,CAAC,MAAM;AAC7D,gBAAM,IAAI,MAAM,sCAAsC,EAAE,OAAO,EAAE;AAAA,QACnE,CAAC;AACD,eAAO,CAAC,MAAM,KAAK,MAAM,KAAK,IAAI;AAAA,MACpC;AACA,UAAI,QAAQ;AACV,eAAO,CAAC,MAAM,KAAK,MAAM,KAAK,OAAO,MAAM,KAAK,CAAC;AAAA,MACnD,OAAO;AACL,eAAO,CAAC,MAAM,KAAK,MAAM,GAAG;AAAA,MAC9B;AAAA,IACF;AACA,UAAMC,UAAS,MAAM;AACrB,UAAM,cAAc,CAAC;AACrB,UAAM,MAAM,QAAQ,CAAC,EAAE,KAAK,QAAQ,QAAQ,MAAM;AAChD,YAAM,OAAO,IAAI,CAAC,MAAM,MAAM,IAAI,MAAM,CAAC,IAAI;AAC7C,kBAAY,IAAI,IAAI,cAAc,SAAS,OAAO;AAAA,IACpD,CAAC;AACD,WAAO;AAAA,MACL,MAAM;AAAA,MACN,MAAM;AAAA,MACN;AAAA,QACE,QAAAA;AAAA,SACG;AAAA,IAEP;AAAA,EACF,CAAC;AACH;AACA,SAAS,sBAAsB,QAAQ,SAAS;AAC9C,MAAI,MAAM,KAAK,MAAM,GAAG;AACtB,UAAM,SAAS,gBAAgB,OAAO,UAAU,CAAC,CAAC;AAClD,WAAO,qBAAqB,QAAQ,QAAQ,OAAO;AAAA,EACrD;AACA,SAAO;AACT;AACA,SAAS,eAAe,SAAS,UAAU,CAAC,MAAM,GAAG;AACnD,MAAI;AACF,WAAO,kBAAc,qBAAM,OAAO,GAAG,OAAO;AAAA,EAC9C,SAAS,GAAG;AACV,YAAQ,MAAM,GAAG,EAAE,OAAO;AAAA;AAAA,WAEnB,OAAO,EAAE;AAChB,WAAO,CAAC,OAAO;AAAA,EACjB;AACF;;;ADnWA,IAAM,WAAW,CAAC,MAAM,OAAO,MAAM;AACrC,IAAM,aAAa,CAACC,OAAM,OAAOA,OAAM;AAEvC,IAAM,QAAwB,oBAAI,IAAI;AACtC,IAAM,gBAAgB;AACtB,SAAS,iBAAiB,SAAS;AACjC,QAAM,MAAM,MAAM,QAAQ,OAAO,IAAI,UAAU,CAAC,OAAO;AACvD,SAAO,CAAC,GAAG,KAAK,aAAa;AAC/B;AACA,SAAS,KAAK,SAAS,OAAO,QAAQ;AACpC,QAAM,WAAW,iBAAiB,OAAO;AACzC,MAAI,CAAC,QAAQ;AACX,aAAS;AAAA,EACX;AACA,MAAI;AACJ,MAAI,OAAO,WAAW,UAAU;AAC9B,QAAI;AAAA,MACF,KAAK;AAAA,MACL,OAAO;AAAA,MACP,MAAM;AAAA,IACR;AACA,YAAQ,QAAQ;AAAA,MACd,KAAK;AACH,UAAE,UAAU;AAAA,MACd,KAAK;AACH,UAAE,QAAQ;AACV;AAAA,MACF,KAAK;AACH,UAAE,QAAQ;AACV;AAAA,IACJ;AAAA,EACF,OAAO;AACL,QAAI;AAAA,EACN;AACA,QAAM,YAAY;AAAA,IAChB,MAAM,SAAS,QAAQ,UAAU,MAAM;AAAA,IACvC,MAAM,IAAI,KAAK,eAAe,UAAU,CAAC;AAAA,EAC3C;AACA,SAAO,UAAU,OAAO,SAAS,KAAK,IAAI,IAAI,KAAK,KAAK,IAAI,KAAK;AACnE;AACA,SAAS,KAAK,SAAS,OAAO,QAAQ;AACpC,MAAI;AACJ,MAAI,CAAC,QAAQ;AACX,aAAS;AAAA,EACX;AACA,MAAI,OAAO,WAAW,UAAU;AAC9B,QAAI;AAAA,MACF,QAAQ;AAAA,MACR,QAAQ;AAAA,MACR,MAAM;AAAA,IACR;AACA,YAAQ,QAAQ;AAAA,MACd,KAAK;AAAA,MACL,KAAK;AACH,UAAE,eAAe;AACjB;AAAA,MACF,KAAK;AACH,eAAO,EAAE;AAAA,IACb;AAAA,EACF,OAAO;AACL,QAAI;AAAA,EACN;AACA,SAAO,KAAK,SAAS,OAAO,CAAC;AAC/B;AACA,SAAS,OAAO,SAAS,OAAO,QAAQ;AACtC,QAAM,WAAW,iBAAiB,OAAO;AACzC,QAAM,YAAY;AAAA,IAChB,MAAM,SAAS,UAAU,UAAU,MAAM;AAAA,IACzC,MAAM,IAAI,KAAK,aAAa,UAAU,MAAM;AAAA,EAC9C;AACA,SAAO,UAAU,OAAO,KAAK;AAC/B;AACA,SAAS,OAAO,SAAS,SAAS,OAAO,IAA0B;AAA1B,eAAE,UAAAC,UAAS,EA3EpD,IA2EyC,IAAiB,kBAAjB,IAAiB,CAAf;AA3E3C,MAAAC,KAAAC;AA4EE,QAAM,WAAW,iBAAiB,OAAO;AACzC,QAAM,UAAU,UAAU;AAAA,IACxB,MAAM,SAAS,kBAAkB,QAAQ;AAAA,IACzC,MAAM,IAAI,KAAK,YAAY,UAAU,EAAE,MAAM,UAAU,CAAC;AAAA,EAC1D,IAAI;AAAA,IACF,MAAM,SAAS,mBAAmB,QAAQ;AAAA,IAC1C,MAAM,IAAI,KAAK,YAAY,UAAU,EAAE,MAAM,WAAW,CAAC;AAAA,EAC3D;AACA,UAAOA,OAAAD,MAAA,MAAM,KAAK,MAAX,OAAAA,MAAgB,MAAM,QAAQ,OAAO,QAAQD,OAAM,CAAC,MAApD,OAAAE,MAAyD,MAAM;AACxE;AACA,SAAS,YAAY,QAAQ,WAAW;AACtC,QAAM,MAAM,OAAO;AACnB,MAAI,YAAY,MAAM,IAAI,GAAG;AAC7B,MAAI,CAAC,WAAW;AACd,gBAAY,UAAU;AACtB,UAAM,IAAI,KAAK,SAAS;AAAA,EAC1B;AACA,SAAO;AACT;AACA,SAAS,SAAS,MAAM,SAAS,SAAS;AACxC,QAAM,YAAY,QAAQ,KAAK,GAAG;AAClC,SAAO,GAAG,IAAI,IAAI,SAAS,IAAI,KAAK,UAAU,OAAO,CAAC;AACxD;AAWA,IAAM,gBAAgB;AACtB,IAAM,gBAAgB;AACtB,IAAM,oBAAoB,CAAC,QAAQ,eAAe,UAAU,CAAC,MAAM;AACjE,QAAM,UAAU,iBAAiB;AACjC,QAAM,QAAQ,CAAC,WAAW;AACxB,QAAI,OAAO,WAAW;AACpB,aAAO;AACT,WAAO,QAAQ,MAAM;AAAA,EACvB;AACA,QAAM,oBAAoB,CAAC,OAAO,YAAY;AAC5C,UAAM,eAAe,OAAO,KAAK,OAAO,EAAE,SAAS,MAAM,QAAQ,IAAI;AACrE,UAAM,WAAW,OAAO,SAAS,OAAO,YAAY;AACpD,WAAO,QAAQ,QAAQ,IAAI,OAAO,eAAe,GAAG,GAAG,QAAQ;AAAA,EACjE;AACA,SAAO;AAAA,IACL,QAAQ,CAAC,OAAO,UAAU;AACxB,YAAM,EAAE,QAAAC,UAAS,EAAE,IAAI;AACvB,YAAM,UAAU,OAAO,SAAS,OAAO,OAAO,KAAK;AACnD,aAAO,kBAAkB,QAAQA,SAAQ,OAAO;AAAA,IAClD;AAAA,IACA,eAAe,CAAC,OAAO,UAAU;AAC/B,YAAM,EAAE,QAAAA,UAAS,EAAE,IAAI;AACvB,YAAM,UAAU,OAAO,SAAS,MAAM,OAAO,KAAK;AAClD,aAAO,kBAAkB,QAAQA,SAAQ,OAAO;AAAA,IAClD;AAAA,IACA,QAAQ;AAAA,IACR,QAAQ,CAAC,OAAO,WAAW;AAAA,MACzB;AAAA,MACA;AAAA,MACA,MAAM,MAAM,KAAK,EAAE,OAAO,OAAO;AAAA,IACnC;AAAA,IACA,MAAM,CAAC,OAAO,WAAW,KAAK,SAAS,OAAO,MAAM,MAAM,KAAK,MAAM;AAAA,IACrE,MAAM,CAAC,OAAO,WAAW,KAAK,SAAS,OAAO,MAAM,MAAM,KAAK,MAAM;AAAA,EACvE;AACF;AACA,IAAM,kBAAkB,CAAC,OAAO,UAAO;AAhJvC;AAgJ0C,qBAAM,KAAK,MAAX,YAAgB,MAAM;AAAA;AAChE,SAAS,YAAY,aAAa,QAAQ,SAAS;AACjD,SAAO,CAAC,SAAS,CAAC,GAAG,YAAY;AAC/B,UAAM,aAAa,kBAAkB,QAAQ,SAAS,OAAO;AAC7D,UAAM,gBAAgB,CAAC,QAAQ,oBAAoB,UAAU;AAC3D,UAAI,CAAC,MAAM,QAAQ,MAAM;AACvB,eAAO;AACT,aAAO,OAAO,OAAO,CAAC,SAAS,UAAU;AACvC,YAAI,UAAU,OAAO,mBAAmB;AACtC,iBAAO,UAAU;AAAA,QACnB;AACA,YAAI,SAAS,KAAK,GAAG;AACnB,iBAAO,UAAU;AAAA,QACnB;AACA,cAAM,CAAC,MAAM,MAAM,MAAM,IAAI;AAC7B,YAAI,qBAAqB,CAAC;AAC1B,YAAI,SAAS,YAAY,SAAS,mBAAmB,SAAS,UAAU;AACtE,iBAAO,QAAQ,MAAM,EAAE;AAAA,YACrB,CAAC,CAAC,KAAK,MAAM,MAAM;AACjB,iCAAmB,GAAG,IAAI;AAAA,gBACxB;AAAA,gBACA,SAAS,YAAY,SAAS;AAAA,cAChC;AAAA,YACF;AAAA,UACF;AAAA,QACF,OAAO;AACL,+BAAqB;AAAA,QACvB;AACA,YAAI;AACJ,YAAI,MAAM;AACR,gBAAM,YAAY,WAAW,IAAI;AACjC,kBAAQ,UAAU,OAAO,IAAI,GAAG,kBAAkB;AAAA,QACpD,OAAO;AACL,kBAAQ,OAAO,IAAI;AAAA,QACrB;AACA,YAAI,SAAS,MAAM;AACjB,iBAAO;AAAA,QACT;AACA,eAAO,UAAU;AAAA,MACnB,GAAG,EAAE;AAAA,IACP;AACA,UAAM,SAAS,cAAc,WAAW;AACxC,QAAI,SAAS,MAAM,KAAK,cAAc,KAAK,MAAM,GAAG;AAClD,iBAAO,oBAAM,MAAM;AAAA,IACrB;AACA,QAAI,SAAS,MAAM;AACjB,aAAO;AACT,WAAO,SAAS,OAAO,MAAM,IAAI;AAAA,EACnC;AACF;AAEA,IAAI,cAAc,OAAO;AACzB,IAAI,oBAAoB,CAAC,KAAK,KAAK,UAAU,OAAO,MAAM,YAAY,KAAK,KAAK,EAAE,YAAY,MAAM,cAAc,MAAM,UAAU,MAAM,MAAM,CAAC,IAAI,IAAI,GAAG,IAAI;AAC9J,IAAI,kBAAkB,CAAC,KAAK,KAAK,UAAU;AACzC,oBAAkB,KAAK,OAAO,QAAQ,WAAW,MAAM,KAAK,KAAK,KAAK;AACtE,SAAO;AACT;AACA,IAAM,eAAN,MAAmB;AAAA,EACjB,cAAc;AACZ,oBAAgB,MAAM,WAAW,CAAC,CAAC;AAAA,EACrC;AAAA,EACA,GAAG,OAAO,UAAU;AA7MtB,QAAAC;AA8MI,QAAI;AACJ,KAACA,OAAA,KAAK,KAAK,SAAS,KAAK,MAAxB,OAAAA,MAA8B,GAAG,KAAK,IAAI,CAAC;AAC5C,SAAK,QAAQ,KAAK,EAAE,KAAK,QAAQ;AACjC,WAAO,MAAM,KAAK,eAAe,OAAO,QAAQ;AAAA,EAClD;AAAA,EACA,eAAe,OAAO,UAAU;AAC9B,UAAM,iBAAiB,KAAK,cAAc,KAAK;AAC/C,QAAI,CAAC;AACH;AACF,UAAM,QAAQ,eAAe,QAAQ,QAAQ;AAC7C,QAAI,CAAC;AACH,qBAAe,OAAO,OAAO,CAAC;AAAA,EAClC;AAAA,EACA,KAAK,UAAU,MAAM;AACnB,UAAM,iBAAiB,KAAK,cAAc,KAAK;AAC/C,QAAI,CAAC;AACH;AACF,mBAAe,IAAI,CAAC,aAAa,SAAS,MAAM,MAAM,IAAI,CAAC;AAAA,EAC7D;AAAA,EACA,cAAc,OAAO;AACnB,UAAM,iBAAiB,KAAK,QAAQ,KAAK;AACzC,WAAO,MAAM,QAAQ,cAAc,IAAI,iBAAiB;AAAA,EAC1D;AACF;AAEA,IAAIC,aAAY,OAAO;AACvB,IAAIC,mBAAkB,CAAC,KAAK,KAAK,UAAU,OAAO,MAAMD,WAAU,KAAK,KAAK,EAAE,YAAY,MAAM,cAAc,MAAM,UAAU,MAAM,MAAM,CAAC,IAAI,IAAI,GAAG,IAAI;AAC1J,IAAIE,iBAAgB,CAAC,KAAK,KAAK,UAAU;AACvC,EAAAD,iBAAgB,KAAK,OAAO,QAAQ,WAAW,MAAM,KAAK,KAAK,KAAK;AACpE,SAAO;AACT;AACA,IAAM,OAAN,cAAmB,aAAa;AAAA,EAC9B,YAAY,QAAQ;AA9OtB;AA+OI,UAAM;AACN,IAAAC,eAAc,MAAM,WAAW,EAAE;AACjC,IAAAA,eAAc,MAAM,UAAU;AAC9B,IAAAA,eAAc,MAAM,eAAe,CAAC,CAAC;AACrC,IAAAA,eAAc,MAAM,aAAa,CAAC,CAAC;AACnC,IAAAA,eAAc,MAAM,UAAU;AAC9B,IAAAA,eAAc,MAAM,kBAAkB;AAItC,IAAAA,eAAc,MAAM,KAAK,KAAK,EAAE,KAAK,IAAI,CAAC;AAC1C,QAAI,MAAuC;AACzC,WAAK,oBAAoB,cAAc;AAAA,IACzC;AACA,QAAI,OAAO,WAAW;AACpB,WAAK,WAAW,OAAO;AACzB,QAAI,OAAO,YAAY;AACrB,WAAK,KAAK,OAAO,QAAQ;AAC3B,QAAI,OAAO,cAAc;AACvB,WAAK,eAAe,OAAO,UAAU;AACvC,QAAI,OAAO,OAAO,WAAW,YAAY,OAAO,SAAS;AACvD,WAAK,UAAS,YAAO,WAAP,YAAiB,eAAe,OAAO,OAAO;AAAA,IAC9D;AAAA,EACF;AAAA,EACA,IAAI,SAAS;AACX,WAAO,KAAK;AAAA,EACd;AAAA,EACA,IAAI,UAAU;AACZ,WAAO,KAAK;AAAA,EACd;AAAA,EACA,IAAI,WAAW;AA7QjB;AA8QI,YAAO,UAAK,UAAU,KAAK,OAAO,MAA3B,YAAgC,CAAC;AAAA,EAC1C;AAAA;AAAA;AAAA;AAAA,EAIA,IAAI,aAAa;AAnRnB;AAoRI,YAAO,UAAK,YAAY,KAAK,OAAO,MAA7B,YAAkC,CAAC;AAAA,EAC5C;AAAA,EACA,gBAAgB,QAAQ,YAAY;AAClC,UAAM,kBAAkB,KAAK,YAAY,MAAM;AAC/C,QAAI,CAAC,iBAAiB;AACpB,WAAK,YAAY,MAAM,IAAI;AAAA,IAC7B,OAAO;AACL,aAAO,OAAO,iBAAiB,UAAU;AAAA,IAC3C;AAAA,EACF;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,EAgBA,oBAAoB,UAAU;AAC5B,SAAK,mBAAmB;AACxB,WAAO;AAAA,EACT;AAAA;AAAA;AAAA;AAAA,EAIA,eAAe,iBAAiB,YAAY;AAC1C,QAAI,OAAO,oBAAoB,UAAU;AACvC,WAAK,gBAAgB,iBAAiB,UAAU;AAAA,IAClD,OAAO;AACL,aAAO,KAAK,eAAe,EAAE;AAAA,QAC3B,CAAC,WAAW,KAAK,gBAAgB,QAAQ,gBAAgB,MAAM,CAAC;AAAA,MAClE;AAAA,IACF;AACA,SAAK,KAAK,QAAQ;AAAA,EACpB;AAAA,EACA,MAAM,QAAQC,YAAU;AACtB,UAAM,gBAAgB,KAAK,UAAU,MAAM;AAC3C,QAAI,CAAC,eAAe;AAClB,WAAK,UAAU,MAAM,IAAIA;AAAA,IAC3B,OAAO;AACL,aAAO,OAAO,eAAeA,UAAQ;AAAA,IACvC;AAAA,EACF;AAAA,EACA,KAAK,kBAAkBA,YAAU;AAC/B,QAAI,OAAO,oBAAoB,YAAY,OAAOA,eAAa,UAAU;AACvE,WAAK,MAAM,kBAAkBA,UAAQ;AAAA,IACvC,OAAO;AACL,aAAO,QAAQ,gBAAgB,EAAE;AAAA,QAC/B,CAAC,CAAC,QAAQC,WAAS,MAAM,KAAK,MAAM,QAAQA,WAAS;AAAA,MACvD;AAAA,IACF;AACA,SAAK,KAAK,QAAQ;AAAA,EACpB;AAAA;AAAA;AAAA;AAAA,EAIA,gBAAgB,EAAE,QAAQ,SAAS,UAAAD,WAAS,GAAG;AAC7C,SAAK,UAAU;AACf,SAAK,WAAW,WAAW;AAC3B,SAAK,UAAU,KAAK,OAAO,IAAIA;AAC/B,SAAK,KAAK,QAAQ;AAAA,EACpB;AAAA,EACA,SAAS,QAAQ,SAAS;AACxB,QAAI,MAAuC;AACzC,UAAI,CAAC,KAAK,UAAU,MAAM,GAAG;AAC3B,gBAAQ,KAAK,wBAAwB,MAAM,eAAe;AAAA,MAC5D;AAAA,IACF;AACA,SAAK,UAAU;AACf,SAAK,WAAW;AAChB,SAAK,KAAK,QAAQ;AAAA,EACpB;AAAA,EACA,EAAE,IAAI,QAAQ,SAAS;AACrB,QAAI,CAAC,KAAK,QAAQ;AAChB,YAAM,IAAI;AAAA,QACR;AAAA,MACF;AAAA,IACF;AACA,QAAI,UAAU,mCAAS;AACvB,QAAI,CAAC,IAAI;AACP,WAAK;AAAA,IACP;AACA,QAAI,CAAC,SAAS,EAAE,GAAG;AACjB,eAAS,GAAG,UAAU;AACtB,gBAAU,GAAG;AACb,WAAK,GAAG;AAAA,IACV;AACA,UAAM,eAAe,KAAK,SAAS,EAAE;AACrC,UAAM,iBAAiB,iBAAiB;AACxC,UAAM,UAAU,KAAK;AACrB,QAAI,WAAW,gBAAgB;AAC7B,aAAO,WAAW,OAAO,IAAI,QAAQ,KAAK,SAAS,EAAE,IAAI;AAAA,IAC3D;AACA,QAAI,gBAAgB;AAClB,WAAK,KAAK,WAAW,EAAE,IAAI,QAAQ,KAAK,QAAQ,CAAC;AAAA,IACnD;AACA,QAAI,cAAc,gBAAgB,WAAW;AAC7C,QAAI,SAAS,WAAW,GAAG;AACzB,UAAI,KAAK,kBAAkB;AACzB,sBAAc,KAAK,iBAAiB,WAAW;AAAA,MACjD,OAAO;AACL,gBAAQ,KAAK;AAAA;AAAA,IAEjB,WAAW;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,CAMd;AAAA,MACK;AAAA,IACF;AACA,QAAI,SAAS,WAAW,KAAK,cAAc,KAAK,WAAW;AACzD,aAAO,KAAK,MAAM,IAAI,WAAW,GAAG;AACtC,QAAI,SAAS,WAAW;AACtB,aAAO;AACT,WAAO;AAAA,MACL;AAAA,MACA,KAAK;AAAA,MACL,KAAK;AAAA,IACP,EAAE,QAAQ,mCAAS,OAAO;AAAA,EAC5B;AAAA,EACA,KAAK,OAAO,QAAQ;AAClB,WAAO,KAAK,KAAK,YAAY,KAAK,SAAS,OAAO,MAAM;AAAA,EAC1D;AAAA,EACA,OAAO,OAAO,QAAQ;AACpB,WAAO,OAAO,KAAK,YAAY,KAAK,SAAS,OAAO,MAAM;AAAA,EAC5D;AACF;AACA,SAAS,UAAU,SAAS,CAAC,GAAG;AAC9B,SAAO,IAAI,KAAK,MAAM;AACxB;AAEA,IAAM,OAAO,UAAU;;;ANhaE,IAAM,WAAS,KAAK,MAAM,iDAAkD;ACA5E,IAAME,YAAS,KAAK,MAAM,4CAAgD;ACA1E,IAAMA,YAAS,KAAK,MAAM,yCAA6C;ACAvE,IAAMA,YAAS,KAAK,MAAM,gDAAiD;ACA3E,IAAMA,YAAS,KAAK,MAAM,8CAA+C;ACE3F,IAAM,mBAAmB,CAAC,MAAM,MAAM,MAAM,MAAM,IAAI;AAGtD,IAAMC,iBAAgB;AAE7B,IAAM,gBAAgB,MAAM;AAP5B,MAAA;AAQC,MAAI;AACH,WAAQ,KAAA,WAAA,OAAA,SAAA,QAAS,QAAT,OAAA,SAAA,GAAc,WAAW;IACjC,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD;AACC,cAAQ;EACV;AACA,SAAO;AACR;AAEA,IAAM,eAAe,MAAM;AA5B3B,MAAA;AA6BE,QAAM,YAAW,KAAA,YAAA,OAAA,SAAA,SAAU,aAAV,OAAA,SAAA,GAAoB;AACrC,MAAI,YAAA,OAAA,SAAA,SAAU,SAAS,MAAA,GAAS;AAC9B,WAAO;EACT,WAAW,SAAS,SAAS,MAAM,GAAG;AACpC,WAAO;EACT,WAAW,SAAS,SAAS,SAAS,GAAG;AACvC,WAAO;EACT,WAAW,SAAS,SAAS,KAAK,GAAG;AACnC,WAAO;EACT,OAAO;AACL,WAAOA;EACT;AACF;AAEO,IAAM,qBAAqB,CAAC,eAAuB;AACxD,SACE,iBAAiB;IACf,CAAC,WACC,eAAe,UAAU,WAAW,YAAY,EAAE,SAAS,MAAM;EACrE,KAAK,aAAa;AAEtB;AAEO,SAAS,eAAgC;AApDhD,MAAA;AAqDE,MAAI,OAAO,WAAW,aAAa;AAIjC,UAAM,eAAe,cAAc;AACnC,WAAO,mBAAmB,YAAY;EACxC;AAEA,MAAI;AAIF,UAAM,cAAa,KAAA,YAAA,OAAA,SAAA,SAAU,oBAAV,OAAA,SAAA,GAA2B;AAC9C,UAAM,aAAa,aAAa;AAEhC,QAAI,CAAC,iBAAiB,SAAS,UAA6B,GAAG;AAC7D,cAAQ,KAAK,gFAAgF;AAC7F,aAAO,mBAAmB,UAAU;IACtC;AACA,WAAO,mBAAmB,cAAA,OAAA,aAAc,UAAU;EACpD,SAAS,GAAG;AACV,YAAQ,KAAK,0DAA0D,CAAC;AACxE,WAAOA;EACT;AACF;AAEO,IAAM,cAAc,CACzB,QACA,OACA,OACA,OACA,OACA,UACG;AACH,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAE5B,SAAO;AACT;AAEO,IAAM,eAAe,CAC1B,YACA,YACA,YACA,YACA,eACG;AACH,QAAM,SAAS,aAAa;AAC5B,QAAMD,cAAW,YAAY,QAAQ,YAAY,YAAY,YAAY,YAAY,UAAU;AAC/F,OAAK,KAAK,QAAQA,WAAQ;AAC1B,OAAK,SAAS,MAAM;AACtB;ANjGA,aAAaA,WAAY,UAAYA,WAAYA,WAAYA,SAAU;AAGhE,IAAM,eAAN,cAA2B,WAAW;EAC3C,SAAS;AACL,UAAM,QAAQE,KAAK,EAAE,EAAE,SAAS,oBAAoB,IAAI,qBAAqB,SAAS,wBAAwB,CAAC;AAE/G,WAAO,+HAA+H,aAAa,UAAU,KAAK,UAAU,CAAC;EAA+L;AAClX;AACA,IAAI,CAAC,eAAe,IAAI,kBAAkB,GAAG;AAC3C,iBAAe,OAAO,oBAAoB,YAAY;AACxD;;;ASpBA,SAAS,cAAAC,mBAAkB;AAC3B,SAAS,gBAAAC,eAAc,QAAAC,aAAY;ACDV,IAAMC,YAAS,KAAK,MAAM,gCAAoC;ACA9D,IAAMA,aAAS,KAAK,MAAM,gCAAoC;ACA9D,IAAMA,aAAS,KAAK,MAAM,gCAAoC;ACA9D,IAAMA,aAAS,KAAK,MAAM,gCAAoC;ACA9D,IAAMA,aAAS,KAAK,MAAM,gCAAoC;ACEhF,IAAMC,oBAAmB,CAAC,MAAM,MAAM,MAAM,MAAM,IAAI;AAGtD,IAAMC,iBAAgB;AAE7B,IAAMC,iBAAgB,MAAM;AAP5B,MAAA;AAQC,MAAI;AACH,WAAQ,KAAA,WAAA,OAAA,SAAA,QAAS,QAAT,OAAA,SAAA,GAAc,WAAW;IACjC,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD;AACC,cAAQ;EACV;AACA,SAAO;AACR;AAEA,IAAMC,gBAAe,MAAM;AA5B3B,MAAA;AA6BE,QAAM,YAAW,KAAA,YAAA,OAAA,SAAA,SAAU,aAAV,OAAA,SAAA,GAAoB;AACrC,MAAI,YAAA,OAAA,SAAA,SAAU,SAAS,MAAA,GAAS;AAC9B,WAAO;EACT,WAAW,SAAS,SAAS,MAAM,GAAG;AACpC,WAAO;EACT,WAAW,SAAS,SAAS,SAAS,GAAG;AACvC,WAAO;EACT,WAAW,SAAS,SAAS,KAAK,GAAG;AACnC,WAAO;EACT,OAAO;AACL,WAAOF;EACT;AACF;AAEO,IAAMG,sBAAqB,CAAC,eAAuB;AACxD,SACEJ,kBAAiB;IACf,CAAC,WACC,eAAe,UAAU,WAAW,YAAY,EAAE,SAAS,MAAM;EACrE,KAAKG,cAAa;AAEtB;AAEO,SAASE,gBAAgC;AApDhD,MAAA;AAqDE,MAAI,OAAO,WAAW,aAAa;AAIjC,UAAM,eAAeH,eAAc;AACnC,WAAOE,oBAAmB,YAAY;EACxC;AAEA,MAAI;AAIF,UAAM,cAAa,KAAA,YAAA,OAAA,SAAA,SAAU,oBAAV,OAAA,SAAA,GAA2B;AAC9C,UAAM,aAAaD,cAAa;AAEhC,QAAI,CAACH,kBAAiB,SAAS,UAA6B,GAAG;AAC7D,cAAQ,KAAK,gFAAgF;AAC7F,aAAOI,oBAAmB,UAAU;IACtC;AACA,WAAOA,oBAAmB,cAAA,OAAA,aAAc,UAAU;EACpD,SAAS,GAAG;AACV,YAAQ,KAAK,0DAA0D,CAAC;AACxE,WAAOH;EACT;AACF;AAEO,IAAMK,eAAc,CACzB,QACA,OACA,OACA,OACA,OACA,UACG;AACH,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAE5B,SAAO;AACT;AAEO,IAAMC,gBAAe,CAC1B,YACA,YACA,YACA,YACA,eACG;AACH,QAAM,SAASF,cAAa;AAC5B,QAAMN,cAAWO,aAAY,QAAQ,YAAY,YAAY,YAAY,YAAY,UAAU;AAC/F,OAAK,KAAK,QAAQP,WAAQ;AAC1B,OAAK,SAAS,MAAM;AACtB;ANjGAQ,cAAaR,YAAYA,WAAYA,YAAYA,YAAYA,UAAU;AAGhE,IAAM,cAAN,cAA0BS,YAAW;EAC1C,SAAS;AACL,UAAM,QAAQC,KAAK,EAAE,EAAE,SAAS,SAAS,IAAI,oBAAoB,SAAS,uBAAuB,CAAC;AAElG,WAAOC,+HAA8HC,cAAa,UAAU,KAAK,UAAU,CAAC;EAAyI;AAC3T;AACA,IAAI,CAAC,eAAe,IAAI,iBAAiB,GAAG;AAC1C,iBAAe,OAAO,mBAAmB,WAAW;AACtD;;;AOpBA,SAAS,gBAAgB;AAEzB,IAAM,uBAAuB,CAAC,QAAQ,IAAI,QAAQ,sBAAsB,OAAO,EAAE,YAAY;AAGtF,SAAS,oBAAoB,aAAa;AAC/C,SAAO,cAAc,YAAY;AAAA,IAC/B,OAAO,eAAe,MAAM,SAAS;AACnC,UAAI,gBAAgB;AAGpB,UAAI,QAAO,mCAAS,eAAc,gBAAe,mCAAS,eAAc,MAAM;AAC5E,wBAAgB,OAAO,OAAO,CAAC,GAAG,SAAS;AAAA,UACzC,WAAW,qBAAqB,KAAK,SAAS,CAAC;AAAA,QACjD,CAAC;AAAA,MACH;AAEA,YAAM,eAAe,MAAM,aAAa;AAAA,IAC1C;AAAA,EACF;AACF;AAoBO,SAAS,mBAAmB;AACjC,SAAO,IAAI,KAAK,OAAO,EAAE,SAAS,EAAE,EAAE,MAAM,CAAC,CAAC;AAChD;;;AnB/BA,IAAM,YAAN,cAAwB,oBAAoB,WAAW,EAAE;AAAA,EAUvD,IAAI,aAAa;AACf,WAAO,KAAK,SAAS,WAAW,SAAW;AAAA,EAC7C;AAAA,EAEA,IAAI,WAAW;AACb,WAAO,EAAW,CAAC,KAAK,WAAW,SAAS,KAAK,QAAQ,KAAK,WAAW,mBAAmB,KAAK,WAAW,eAAe,CAAC;AAAA,EAC9H;AAAA,EAEA,IAAI,gBAAgB;AAClB,WAAOC;AAAA,4BACiB,UAAU,KAAK,SAAS,CAAC,YAAY,KAAK,QAAQ;AAAA;AAAA;AAAA;AAAA,EAI5E;AAAA,EAEA,IAAI,eAAe;AACjB,WAAOA;AAAA,4BACiB,UAAU,KAAK,SAAS,CAAC,YAAY,KAAK,QAAQ;AAAA;AAAA;AAAA;AAAA,EAI5E;AAAA,EAEA,IAAI,QAAQ;AACV,WAAOA;AAAA,oBACS,KAAK,QAAQ;AAAA,uBACV,KAAK,WAAW,KAAK,KAAK,KAAK,KAAK;AAAA;AAAA;AAAA,EAGzD;AAAA,EAEA,IAAI,UAAU;AACZ,QAAI,KAAK,OAAO;AACd,aAAO,KAAK;AAAA,IACd,WAAW,KAAK,QAAQ;AACtB,aAAO,KAAK;AAAA,IACd,WAAW,KAAK,OAAO;AACrB,aAAO,KAAK;AAAA,IACd;AAAA,EACF;AAAA,EAEA,SAAS;AACP,WAAOA,QAAO,KAAK,OAAO;AAAA,EAC5B;AACF;AAtDE,cADI,WACG,cAAa;AAAA,EAClB,WAAW,EAAE,MAAM,OAAO;AAAA,EAC1B,OAAO,EAAE,MAAM,QAAQ;AAAA,EACvB,QAAQ,EAAE,MAAM,QAAQ;AAAA,EACxB,OAAO,EAAE,MAAM,OAAO;AACxB;AAEA,cARI,WAQG,UAAS,CAAC,YAAY,MAAM;AAiDrC,IAAI,CAAC,eAAe,IAAI,SAAS,GAAG;AAClC,iBAAe,OAAO,WAAW,SAAS;AAC5C;;;AoBtEA,SAAS,KAAK,QAAAC,aAAY;AAI1B,OAAOC,kBAAiB;;;ACJxB,SAAS,cAAAC,mBAAkB;AAC3B,SAAS,gBAAAC,eAAc,QAAAC,aAAY;ACDV,IAAMC,YAAS,KAAK,MAAM,4CAAgD;ACA1E,IAAMA,aAAS,KAAK,MAAM,4CAAgD;ACA1E,IAAMA,aAAS,KAAK,MAAM,qEAAgE;ACA1F,IAAMA,aAAS,KAAK,MAAM,4CAAgD;ACA1E,IAAMA,aAAS,KAAK,MAAM,4CAAgD;ACE5F,IAAMC,oBAAmB,CAAC,MAAM,MAAM,MAAM,MAAM,IAAI;AAGtD,IAAMC,iBAAgB;AAE7B,IAAMC,iBAAgB,MAAM;AAP5B,MAAA;AAQC,MAAI;AACH,WAAQ,KAAA,WAAA,OAAA,SAAA,QAAS,QAAT,OAAA,SAAA,GAAc,WAAW;IACjC,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD;AACC,cAAQ;EACV;AACA,SAAO;AACR;AAEA,IAAMC,gBAAe,MAAM;AA5B3B,MAAA;AA6BE,QAAM,YAAW,KAAA,YAAA,OAAA,SAAA,SAAU,aAAV,OAAA,SAAA,GAAoB;AACrC,MAAI,YAAA,OAAA,SAAA,SAAU,SAAS,MAAA,GAAS;AAC9B,WAAO;EACT,WAAW,SAAS,SAAS,MAAM,GAAG;AACpC,WAAO;EACT,WAAW,SAAS,SAAS,SAAS,GAAG;AACvC,WAAO;EACT,WAAW,SAAS,SAAS,KAAK,GAAG;AACnC,WAAO;EACT,OAAO;AACL,WAAOF;EACT;AACF;AAEO,IAAMG,sBAAqB,CAAC,eAAuB;AACxD,SACEJ,kBAAiB;IACf,CAAC,WACC,eAAe,UAAU,WAAW,YAAY,EAAE,SAAS,MAAM;EACrE,KAAKG,cAAa;AAEtB;AAEO,SAASE,gBAAgC;AApDhD,MAAA;AAqDE,MAAI,OAAO,WAAW,aAAa;AAIjC,UAAM,eAAeH,eAAc;AACnC,WAAOE,oBAAmB,YAAY;EACxC;AAEA,MAAI;AAIF,UAAM,cAAa,KAAA,YAAA,OAAA,SAAA,SAAU,oBAAV,OAAA,SAAA,GAA2B;AAC9C,UAAM,aAAaD,cAAa;AAEhC,QAAI,CAACH,kBAAiB,SAAS,UAA6B,GAAG;AAC7D,cAAQ,KAAK,gFAAgF;AAC7F,aAAOI,oBAAmB,UAAU;IACtC;AACA,WAAOA,oBAAmB,cAAA,OAAA,aAAc,UAAU;EACpD,SAAS,GAAG;AACV,YAAQ,KAAK,0DAA0D,CAAC;AACxE,WAAOH;EACT;AACF;AAEO,IAAMK,eAAc,CACzB,QACA,OACA,OACA,OACA,OACA,UACG;AACH,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAE5B,SAAO;AACT;AAEO,IAAMC,gBAAe,CAC1B,YACA,YACA,YACA,YACA,eACG;AACH,QAAM,SAASF,cAAa;AAC5B,QAAMN,cAAWO,aAAY,QAAQ,YAAY,YAAY,YAAY,YAAY,UAAU;AAC/F,OAAK,KAAK,QAAQP,WAAQ;AAC1B,OAAK,SAAS,MAAM;AACtB;ANjGAQ,cAAaR,YAAYA,WAAYA,YAAYA,YAAYA,UAAU;AAGhE,IAAM,aAAN,cAAyBS,YAAW;EACzC,SAAS;AACL,UAAM,QAAQC,KAAK,EAAE,EAAE,SAAS,sBAAsB,IAAI,mBAAmB,SAAS,sBAAsB,CAAC;AAE7G,WAAOC,8HAA6HC,cAAa,UAAU,KAAK,UAAU,CAAC;EAAiT;AACle;AACA,IAAI,CAAC,eAAe,IAAI,gBAAgB,GAAG;AACzC,iBAAe,OAAO,kBAAkB,UAAU;AACpD;;;AOpBA,SAAS,cAAAC,mBAAkB;AAC3B,SAAS,gBAAAC,eAAc,QAAAC,aAAY;ACDV,IAAMC,YAAS,KAAK,MAAM,yDAA6D;ACAvF,IAAMA,aAAS,KAAK,MAAM,oEAAwE;ACAlG,IAAMA,aAAS,KAAK,MAAM,+EAA6E;ACAvG,IAAMA,aAAS,KAAK,MAAM,kEAAmE;ACA7F,IAAMA,aAAS,KAAK,MAAM,8DAAkE;ACE9G,IAAMC,oBAAmB,CAAC,MAAM,MAAM,MAAM,MAAM,IAAI;AAGtD,IAAMC,iBAAgB;AAE7B,IAAMC,iBAAgB,MAAM;AAP5B,MAAA;AAQC,MAAI;AACH,WAAQ,KAAA,WAAA,OAAA,SAAA,QAAS,QAAT,OAAA,SAAA,GAAc,WAAW;IACjC,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD;AACC,cAAQ;EACV;AACA,SAAO;AACR;AAEA,IAAMC,gBAAe,MAAM;AA5B3B,MAAA;AA6BE,QAAM,YAAW,KAAA,YAAA,OAAA,SAAA,SAAU,aAAV,OAAA,SAAA,GAAoB;AACrC,MAAI,YAAA,OAAA,SAAA,SAAU,SAAS,MAAA,GAAS;AAC9B,WAAO;EACT,WAAW,SAAS,SAAS,MAAM,GAAG;AACpC,WAAO;EACT,WAAW,SAAS,SAAS,SAAS,GAAG;AACvC,WAAO;EACT,WAAW,SAAS,SAAS,KAAK,GAAG;AACnC,WAAO;EACT,OAAO;AACL,WAAOF;EACT;AACF;AAEO,IAAMG,sBAAqB,CAAC,eAAuB;AACxD,SACEJ,kBAAiB;IACf,CAAC,WACC,eAAe,UAAU,WAAW,YAAY,EAAE,SAAS,MAAM;EACrE,KAAKG,cAAa;AAEtB;AAEO,SAASE,gBAAgC;AApDhD,MAAA;AAqDE,MAAI,OAAO,WAAW,aAAa;AAIjC,UAAM,eAAeH,eAAc;AACnC,WAAOE,oBAAmB,YAAY;EACxC;AAEA,MAAI;AAIF,UAAM,cAAa,KAAA,YAAA,OAAA,SAAA,SAAU,oBAAV,OAAA,SAAA,GAA2B;AAC9C,UAAM,aAAaD,cAAa;AAEhC,QAAI,CAACH,kBAAiB,SAAS,UAA6B,GAAG;AAC7D,cAAQ,KAAK,gFAAgF;AAC7F,aAAOI,oBAAmB,UAAU;IACtC;AACA,WAAOA,oBAAmB,cAAA,OAAA,aAAc,UAAU;EACpD,SAAS,GAAG;AACV,YAAQ,KAAK,0DAA0D,CAAC;AACxE,WAAOH;EACT;AACF;AAEO,IAAMK,eAAc,CACzB,QACA,OACA,OACA,OACA,OACA,UACG;AACH,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAE5B,SAAO;AACT;AAEO,IAAMC,gBAAe,CAC1B,YACA,YACA,YACA,YACA,eACG;AACH,QAAM,SAASF,cAAa;AAC5B,QAAMN,cAAWO,aAAY,QAAQ,YAAY,YAAY,YAAY,YAAY,UAAU;AAC/F,OAAK,KAAK,QAAQP,WAAQ;AAC1B,OAAK,SAAS,MAAM;AACtB;ANjGAQ,cAAaR,YAAYA,WAAYA,YAAYA,YAAYA,UAAU;AAGhE,IAAM,gBAAN,cAA4BS,YAAW;EAC5C,SAAS;AACL,UAAM,QAAQC,KAAK,EAAE,EAAE,SAAS,2CAA2C,IAAI,sBAAsB,SAAS,yBAAyB,CAAC;AAExI,WAAOC,iIAAgIC,cAAa,UAAU,KAAK,UAAU,CAAC;EAAsQ;AAC1b;AACA,IAAI,CAAC,eAAe,IAAI,mBAAmB,GAAG;AAC5C,iBAAe,OAAO,qBAAqB,aAAa;AAC1D;;;AOpBA,SAAS,cAAAC,mBAAkB;AAC3B,SAAS,gBAAAC,eAAc,QAAAC,aAAY;ACDV,IAAMC,YAAS,KAAK,MAAM,qDAAsD;ACAhF,IAAMA,aAAS,KAAK,MAAM,yDAA6D;ACAvF,IAAMA,aAAS,KAAK,MAAM,8EAA4E;ACAtG,IAAMA,aAAS,KAAK,MAAM,wDAAyD;ACAnF,IAAMA,aAAS,KAAK,MAAM,mDAAuD;ACEnG,IAAMC,oBAAmB,CAAC,MAAM,MAAM,MAAM,MAAM,IAAI;AAGtD,IAAMC,iBAAgB;AAE7B,IAAMC,iBAAgB,MAAM;AAP5B,MAAA;AAQC,MAAI;AACH,WAAQ,KAAA,WAAA,OAAA,SAAA,QAAS,QAAT,OAAA,SAAA,GAAc,WAAW;IACjC,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD;AACC,cAAQ;EACV;AACA,SAAO;AACR;AAEA,IAAMC,gBAAe,MAAM;AA5B3B,MAAA;AA6BE,QAAM,YAAW,KAAA,YAAA,OAAA,SAAA,SAAU,aAAV,OAAA,SAAA,GAAoB;AACrC,MAAI,YAAA,OAAA,SAAA,SAAU,SAAS,MAAA,GAAS;AAC9B,WAAO;EACT,WAAW,SAAS,SAAS,MAAM,GAAG;AACpC,WAAO;EACT,WAAW,SAAS,SAAS,SAAS,GAAG;AACvC,WAAO;EACT,WAAW,SAAS,SAAS,KAAK,GAAG;AACnC,WAAO;EACT,OAAO;AACL,WAAOF;EACT;AACF;AAEO,IAAMG,sBAAqB,CAAC,eAAuB;AACxD,SACEJ,kBAAiB;IACf,CAAC,WACC,eAAe,UAAU,WAAW,YAAY,EAAE,SAAS,MAAM;EACrE,KAAKG,cAAa;AAEtB;AAEO,SAASE,gBAAgC;AApDhD,MAAA;AAqDE,MAAI,OAAO,WAAW,aAAa;AAIjC,UAAM,eAAeH,eAAc;AACnC,WAAOE,oBAAmB,YAAY;EACxC;AAEA,MAAI;AAIF,UAAM,cAAa,KAAA,YAAA,OAAA,SAAA,SAAU,oBAAV,OAAA,SAAA,GAA2B;AAC9C,UAAM,aAAaD,cAAa;AAEhC,QAAI,CAACH,kBAAiB,SAAS,UAA6B,GAAG;AAC7D,cAAQ,KAAK,gFAAgF;AAC7F,aAAOI,oBAAmB,UAAU;IACtC;AACA,WAAOA,oBAAmB,cAAA,OAAA,aAAc,UAAU;EACpD,SAAS,GAAG;AACV,YAAQ,KAAK,0DAA0D,CAAC;AACxE,WAAOH;EACT;AACF;AAEO,IAAMK,eAAc,CACzB,QACA,OACA,OACA,OACA,OACA,UACG;AACH,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAE5B,SAAO;AACT;AAEO,IAAMC,gBAAe,CAC1B,YACA,YACA,YACA,YACA,eACG;AACH,QAAM,SAASF,cAAa;AAC5B,QAAMN,cAAWO,aAAY,QAAQ,YAAY,YAAY,YAAY,YAAY,UAAU;AAC/F,OAAK,KAAK,QAAQP,WAAQ;AAC1B,OAAK,SAAS,MAAM;AACtB;ANjGAQ,cAAaR,YAAYA,WAAYA,YAAYA,YAAYA,UAAU;AAGhE,IAAM,cAAN,cAA0BS,YAAW;EAC1C,SAAS;AACL,UAAM,QAAQC,KAAK,EAAE,EAAE,SAAS,kCAAkC,IAAI,oBAAoB,SAAS,uBAAuB,CAAC;AAE3H,WAAOC,+HAA8HC,cAAa,UAAU,KAAK,UAAU,CAAC;EAAsa;AACxlB;AACA,IAAI,CAAC,eAAe,IAAI,iBAAiB,GAAG;AAC1C,iBAAe,OAAO,mBAAmB,WAAW;AACtD;;;AOpBA,SAAS,cAAAC,mBAAkB;AAC3B,SAAS,gBAAAC,eAAc,QAAAC,aAAY;ACDV,IAAMC,aAAS,KAAK,MAAM,kDAAsD;ACAhF,IAAMA,aAAS,KAAK,MAAM,kDAAsD;ACAhF,IAAMA,aAAS,KAAK,MAAM,4EAAuE;ACAjG,IAAMA,aAAS,KAAK,MAAM,kDAAsD;ACAhF,IAAMA,aAAS,KAAK,MAAM,4CAAgD;ACE5F,IAAMC,oBAAmB,CAAC,MAAM,MAAM,MAAM,MAAM,IAAI;AAGtD,IAAMC,iBAAgB;AAE7B,IAAMC,iBAAgB,MAAM;AAP5B,MAAA;AAQC,MAAI;AACH,WAAQ,KAAA,WAAA,OAAA,SAAA,QAAS,QAAT,OAAA,SAAA,GAAc,WAAW;IACjC,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD;AACC,cAAQ;EACV;AACA,SAAO;AACR;AAEA,IAAMC,gBAAe,MAAM;AA5B3B,MAAA;AA6BE,QAAM,YAAW,KAAA,YAAA,OAAA,SAAA,SAAU,aAAV,OAAA,SAAA,GAAoB;AACrC,MAAI,YAAA,OAAA,SAAA,SAAU,SAAS,MAAA,GAAS;AAC9B,WAAO;EACT,WAAW,SAAS,SAAS,MAAM,GAAG;AACpC,WAAO;EACT,WAAW,SAAS,SAAS,SAAS,GAAG;AACvC,WAAO;EACT,WAAW,SAAS,SAAS,KAAK,GAAG;AACnC,WAAO;EACT,OAAO;AACL,WAAOF;EACT;AACF;AAEO,IAAMG,sBAAqB,CAAC,eAAuB;AACxD,SACEJ,kBAAiB;IACf,CAAC,WACC,eAAe,UAAU,WAAW,YAAY,EAAE,SAAS,MAAM;EACrE,KAAKG,cAAa;AAEtB;AAEO,SAASE,gBAAgC;AApDhD,MAAA;AAqDE,MAAI,OAAO,WAAW,aAAa;AAIjC,UAAM,eAAeH,eAAc;AACnC,WAAOE,oBAAmB,YAAY;EACxC;AAEA,MAAI;AAIF,UAAM,cAAa,KAAA,YAAA,OAAA,SAAA,SAAU,oBAAV,OAAA,SAAA,GAA2B;AAC9C,UAAM,aAAaD,cAAa;AAEhC,QAAI,CAACH,kBAAiB,SAAS,UAA6B,GAAG;AAC7D,cAAQ,KAAK,gFAAgF;AAC7F,aAAOI,oBAAmB,UAAU;IACtC;AACA,WAAOA,oBAAmB,cAAA,OAAA,aAAc,UAAU;EACpD,SAAS,GAAG;AACV,YAAQ,KAAK,0DAA0D,CAAC;AACxE,WAAOH;EACT;AACF;AAEO,IAAMK,eAAc,CACzB,QACA,OACA,OACA,OACA,OACA,UACG;AACH,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAE5B,SAAO;AACT;AAEO,IAAMC,gBAAe,CAC1B,YACA,YACA,YACA,YACA,eACG;AACH,QAAM,SAASF,cAAa;AAC5B,QAAMN,cAAWO,aAAY,QAAQ,YAAY,YAAY,YAAY,YAAY,UAAU;AAC/F,OAAK,KAAK,QAAQP,WAAQ;AAC1B,OAAK,SAAS,MAAM;AACtB;ANjGAQ,cAAaR,YAAYA,YAAYA,YAAYA,YAAYA,UAAU;AAGhE,IAAM,gBAAN,cAA4BS,YAAW;EAC5C,SAAS;AACL,UAAM,QAAQC,KAAK,EAAE,EAAE,SAAS,yBAAyB,IAAI,sBAAsB,SAAS,yBAAyB,CAAC;AAEtH,WAAOC,iIAAgIC,cAAa,UAAU,KAAK,UAAU,CAAC;EAA4R;AAChd;AACA,IAAI,CAAC,eAAe,IAAI,mBAAmB,GAAG;AAC5C,iBAAe,OAAO,qBAAqB,aAAa;AAC1D;;;AtBVA,IAAM,WAAW;AAAA,EACf,UAAU;AAAA,EACV,UAAU;AAAA,EACV,SAAS;AAAA,EACT,MAAM;AACR;AAEA,IAAM,YAAN,cAAwBC,aAAY;AAAA,EAOlC,cAAc;AACZ,UAAM;AACN,SAAK,OAAO;AACZ,SAAK,OAAO;AAAA,EACd;AAAA,EAEA,oBAAoB;AAClB,UAAM,kBAAkB;AACxB,QAAI,CAAC,KAAK,WAAW,CAAC,SAAS,KAAK,OAAO,GAAG;AAC5C,YAAM,IAAI,MAAM,yGAAyG;AAAA,IAC3H;AAAA,EACF;AAAA,EAEA,IAAI,kBAAkB;AACpB,WAAO,EAAW,CAAC,MAAQ,SAAS,MAAQ,KAAK,OAAO,CAAC,CAAC;AAAA,EAC5D;AAAA,EAEA,IAAI,eAAe;AACjB,UAAM,uBAAuB,MAAQ,GAAG,KAAK,OAAO,MAAM;AAE1D,WAAO,EAAW,CAAC,MAAQ,MAAM,oBAAoB,CAAC;AAAA,EACxD;AAAA,EAqBA,IAAI,QAAQ;AACV,QAAI,KAAK,YAAY,SAAS,MAAM;AAClC,aAAOC;AAAA,IACT;AACA,QAAI,KAAK,YAAY,SAAS,SAAS;AACrC,aAAOA;AAAA,IACT;AACA,QAAI,KAAK,YAAY,SAAS,UAAU;AACtC,aAAOA;AAAA,IACT;AACA,QAAI,KAAK,YAAY,SAAS,UAAU;AACtC,aAAOA;AAAA,IACT,MAAO,QAAO;AAAA,EAChB;AAAA,EAEA,SAAS;AACP,WAAOA;AAAA,mCACwB,KAAK,IAAI;AAAA,oBACxB,KAAK,IAAI,UAAU,KAAK,eAAe;AAAA,uBACpC,KAAK,YAAY,IAAI,KAAK,KAAK;AAAA,uBAC/B,MAAQ,WAAW;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,EAMxC;AACF;AA3EE,cADI,WACG,cAAa;AAAA,EAClB,SAAS,EAAE,MAAM,QAAQ,SAAS,KAAK;AAAA,EACvC,MAAM,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA,EACrC,MAAM,EAAE,MAAM,QAAQ,SAAS,KAAK;AACtC;AAAA;AAAA;AAAA;AAAA;AA6BA,cAlCI,WAkCG,UAAS;AAAA,EACdD,aAAY;AAAA,EACZ;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAWF;AA+BF,IAAI,CAAC,eAAe,IAAI,SAAS,GAAG;AAClC,iBAAe,OAAO,WAAW,SAAS;AAC5C;;;A6BjGA,SAAS,OAAAE,MAAK,QAAAC,OAAM,eAAe;;;ACKnC,IAAM,QAAQ,CAAC,OAAO,SAAS,UAAU,MAAM;AAG/C,IAAM,MAAM,KAAK;AACjB,IAAM,MAAM,KAAK;AACjB,IAAM,QAAQ,KAAK;AAEnB,IAAM,eAAe,QAAM;AAAA,EACzB,GAAG;AAAA,EACH,GAAG;AACL;AACA,IAAM,kBAAkB;AAAA,EACtB,MAAM;AAAA,EACN,OAAO;AAAA,EACP,QAAQ;AAAA,EACR,KAAK;AACP;AACA,IAAM,uBAAuB;AAAA,EAC3B,OAAO;AAAA,EACP,KAAK;AACP;AACA,SAAS,MAAM,OAAO,OAAO,KAAK;AAChC,SAAO,IAAI,OAAO,IAAI,OAAO,GAAG,CAAC;AACnC;AACA,SAAS,SAAS,OAAO,OAAO;AAC9B,SAAO,OAAO,UAAU,aAAa,MAAM,KAAK,IAAI;AACtD;AACA,SAAS,QAAQ,WAAW;AAC1B,SAAO,UAAU,MAAM,GAAG,EAAE,CAAC;AAC/B;AACA,SAAS,aAAa,WAAW;AAC/B,SAAO,UAAU,MAAM,GAAG,EAAE,CAAC;AAC/B;AACA,SAAS,gBAAgB,MAAM;AAC7B,SAAO,SAAS,MAAM,MAAM;AAC9B;AACA,SAAS,cAAc,MAAM;AAC3B,SAAO,SAAS,MAAM,WAAW;AACnC;AACA,SAAS,YAAY,WAAW;AAC9B,SAAO,CAAC,OAAO,QAAQ,EAAE,SAAS,QAAQ,SAAS,CAAC,IAAI,MAAM;AAChE;AACA,SAAS,iBAAiB,WAAW;AACnC,SAAO,gBAAgB,YAAY,SAAS,CAAC;AAC/C;AACA,SAAS,kBAAkB,WAAW,OAAO,KAAK;AAChD,MAAI,QAAQ,QAAQ;AAClB,UAAM;AAAA,EACR;AACA,QAAM,YAAY,aAAa,SAAS;AACxC,QAAM,gBAAgB,iBAAiB,SAAS;AAChD,QAAM,SAAS,cAAc,aAAa;AAC1C,MAAI,oBAAoB,kBAAkB,MAAM,eAAe,MAAM,QAAQ,WAAW,UAAU,SAAS,cAAc,UAAU,WAAW;AAC9I,MAAI,MAAM,UAAU,MAAM,IAAI,MAAM,SAAS,MAAM,GAAG;AACpD,wBAAoB,qBAAqB,iBAAiB;AAAA,EAC5D;AACA,SAAO,CAAC,mBAAmB,qBAAqB,iBAAiB,CAAC;AACpE;AACA,SAAS,sBAAsB,WAAW;AACxC,QAAM,oBAAoB,qBAAqB,SAAS;AACxD,SAAO,CAAC,8BAA8B,SAAS,GAAG,mBAAmB,8BAA8B,iBAAiB,CAAC;AACvH;AACA,SAAS,8BAA8B,WAAW;AAChD,SAAO,UAAU,QAAQ,cAAc,eAAa,qBAAqB,SAAS,CAAC;AACrF;AACA,SAAS,YAAYC,OAAM,SAAS,KAAK;AACvC,QAAM,KAAK,CAAC,QAAQ,OAAO;AAC3B,QAAM,KAAK,CAAC,SAAS,MAAM;AAC3B,QAAM,KAAK,CAAC,OAAO,QAAQ;AAC3B,QAAM,KAAK,CAAC,UAAU,KAAK;AAC3B,UAAQA,OAAM;AAAA,IACZ,KAAK;AAAA,IACL,KAAK;AACH,UAAI,IAAK,QAAO,UAAU,KAAK;AAC/B,aAAO,UAAU,KAAK;AAAA,IACxB,KAAK;AAAA,IACL,KAAK;AACH,aAAO,UAAU,KAAK;AAAA,IACxB;AACE,aAAO,CAAC;AAAA,EACZ;AACF;AACA,SAAS,0BAA0B,WAAW,eAAe,WAAW,KAAK;AAC3E,QAAM,YAAY,aAAa,SAAS;AACxC,MAAI,OAAO,YAAY,QAAQ,SAAS,GAAG,cAAc,SAAS,GAAG;AACrE,MAAI,WAAW;AACb,WAAO,KAAK,IAAI,CAAAA,UAAQA,QAAO,MAAM,SAAS;AAC9C,QAAI,eAAe;AACjB,aAAO,KAAK,OAAO,KAAK,IAAI,6BAA6B,CAAC;AAAA,IAC5D;AAAA,EACF;AACA,SAAO;AACT;AACA,SAAS,qBAAqB,WAAW;AACvC,SAAO,UAAU,QAAQ,0BAA0B,CAAAA,UAAQ,gBAAgBA,KAAI,CAAC;AAClF;AACA,SAAS,oBAAoB,SAAS;AACpC,SAAO;AAAA,IACL,KAAK;AAAA,IACL,OAAO;AAAA,IACP,QAAQ;AAAA,IACR,MAAM;AAAA,KACH;AAEP;AACA,SAAS,iBAAiB,SAAS;AACjC,SAAO,OAAO,YAAY,WAAW,oBAAoB,OAAO,IAAI;AAAA,IAClE,KAAK;AAAA,IACL,OAAO;AAAA,IACP,QAAQ;AAAA,IACR,MAAM;AAAA,EACR;AACF;AACA,SAAS,iBAAiB,MAAM;AAC9B,QAAM;AAAA,IACJ;AAAA,IACA,GAAAC;AAAA,IACA;AAAA,IACA;AAAA,EACF,IAAI;AACJ,SAAO;AAAA,IACL;AAAA,IACA;AAAA,IACA,KAAKA;AAAA,IACL,MAAM;AAAA,IACN,OAAO,IAAI;AAAA,IACX,QAAQA,KAAI;AAAA,IACZ;AAAA,IACA,GAAAA;AAAA,EACF;AACF;;;ACpIA,SAAS,2BAA2B,MAAM,WAAW,KAAK;AACxD,MAAI;AAAA,IACF;AAAA,IACA;AAAA,EACF,IAAI;AACJ,QAAM,WAAW,YAAY,SAAS;AACtC,QAAM,gBAAgB,iBAAiB,SAAS;AAChD,QAAM,cAAc,cAAc,aAAa;AAC/C,QAAMC,QAAO,QAAQ,SAAS;AAC9B,QAAM,aAAa,aAAa;AAChC,QAAM,UAAU,UAAU,IAAI,UAAU,QAAQ,IAAI,SAAS,QAAQ;AACrE,QAAM,UAAU,UAAU,IAAI,UAAU,SAAS,IAAI,SAAS,SAAS;AACvE,QAAM,cAAc,UAAU,WAAW,IAAI,IAAI,SAAS,WAAW,IAAI;AACzE,MAAI;AACJ,UAAQA,OAAM;AAAA,IACZ,KAAK;AACH,eAAS;AAAA,QACP,GAAG;AAAA,QACH,GAAG,UAAU,IAAI,SAAS;AAAA,MAC5B;AACA;AAAA,IACF,KAAK;AACH,eAAS;AAAA,QACP,GAAG;AAAA,QACH,GAAG,UAAU,IAAI,UAAU;AAAA,MAC7B;AACA;AAAA,IACF,KAAK;AACH,eAAS;AAAA,QACP,GAAG,UAAU,IAAI,UAAU;AAAA,QAC3B,GAAG;AAAA,MACL;AACA;AAAA,IACF,KAAK;AACH,eAAS;AAAA,QACP,GAAG,UAAU,IAAI,SAAS;AAAA,QAC1B,GAAG;AAAA,MACL;AACA;AAAA,IACF;AACE,eAAS;AAAA,QACP,GAAG,UAAU;AAAA,QACb,GAAG,UAAU;AAAA,MACf;AAAA,EACJ;AACA,UAAQ,aAAa,SAAS,GAAG;AAAA,IAC/B,KAAK;AACH,aAAO,aAAa,KAAK,eAAe,OAAO,aAAa,KAAK;AACjE;AAAA,IACF,KAAK;AACH,aAAO,aAAa,KAAK,eAAe,OAAO,aAAa,KAAK;AACjE;AAAA,EACJ;AACA,SAAO;AACT;AASA,IAAM,kBAAkB,OAAO,WAAW,UAAU,WAAW;AAC7D,QAAM;AAAA,IACJ,YAAY;AAAA,IACZ,WAAW;AAAA,IACX,aAAa,CAAC;AAAA,IACd,UAAAC;AAAA,EACF,IAAI;AACJ,QAAM,kBAAkB,WAAW,OAAO,OAAO;AACjD,QAAM,MAAM,OAAOA,UAAS,SAAS,OAAO,SAASA,UAAS,MAAM,QAAQ;AAC5E,MAAI,QAAQ,MAAMA,UAAS,gBAAgB;AAAA,IACzC;AAAA,IACA;AAAA,IACA;AAAA,EACF,CAAC;AACD,MAAI;AAAA,IACF;AAAA,IACA,GAAAC;AAAA,EACF,IAAI,2BAA2B,OAAO,WAAW,GAAG;AACpD,MAAI,oBAAoB;AACxB,MAAI,iBAAiB,CAAC;AACtB,MAAI,aAAa;AACjB,WAASC,KAAI,GAAGA,KAAI,gBAAgB,QAAQA,MAAK;AAC/C,UAAM;AAAA,MACJ;AAAA,MACA;AAAA,IACF,IAAI,gBAAgBA,EAAC;AACrB,UAAM;AAAA,MACJ,GAAG;AAAA,MACH,GAAG;AAAA,MACH;AAAA,MACA;AAAA,IACF,IAAI,MAAM,GAAG;AAAA,MACX;AAAA,MACA,GAAAD;AAAA,MACA,kBAAkB;AAAA,MAClB,WAAW;AAAA,MACX;AAAA,MACA;AAAA,MACA;AAAA,MACA,UAAAD;AAAA,MACA,UAAU;AAAA,QACR;AAAA,QACA;AAAA,MACF;AAAA,IACF,CAAC;AACD,QAAI,SAAS,OAAO,QAAQ;AAC5B,IAAAC,KAAI,SAAS,OAAO,QAAQA;AAC5B,qBAAiB,iCACZ,iBADY;AAAA,MAEf,CAAC,IAAI,GAAG,kCACH,eAAe,IAAI,IACnB;AAAA,IAEP;AACA,QAAI,SAAS,cAAc,IAAI;AAC7B;AACA,UAAI,OAAO,UAAU,UAAU;AAC7B,YAAI,MAAM,WAAW;AACnB,8BAAoB,MAAM;AAAA,QAC5B;AACA,YAAI,MAAM,OAAO;AACf,kBAAQ,MAAM,UAAU,OAAO,MAAMD,UAAS,gBAAgB;AAAA,YAC5D;AAAA,YACA;AAAA,YACA;AAAA,UACF,CAAC,IAAI,MAAM;AAAA,QACb;AACA,SAAC;AAAA,UACC;AAAA,UACA,GAAAC;AAAA,QACF,IAAI,2BAA2B,OAAO,mBAAmB,GAAG;AAAA,MAC9D;AACA,MAAAC,KAAI;AAAA,IACN;AAAA,EACF;AACA,SAAO;AAAA,IACL;AAAA,IACA,GAAAD;AAAA,IACA,WAAW;AAAA,IACX;AAAA,IACA;AAAA,EACF;AACF;AAUA,eAAe,eAAe,OAAO,SAAS;AAC5C,MAAI;AACJ,MAAI,YAAY,QAAQ;AACtB,cAAU,CAAC;AAAA,EACb;AACA,QAAM;AAAA,IACJ;AAAA,IACA,GAAAA;AAAA,IACA,UAAAD;AAAA,IACA;AAAA,IACA;AAAA,IACA;AAAA,EACF,IAAI;AACJ,QAAM;AAAA,IACJ,WAAW;AAAA,IACX,eAAe;AAAA,IACf,iBAAiB;AAAA,IACjB,cAAc;AAAA,IACd,UAAU;AAAA,EACZ,IAAI,SAAS,SAAS,KAAK;AAC3B,QAAM,gBAAgB,iBAAiB,OAAO;AAC9C,QAAM,aAAa,mBAAmB,aAAa,cAAc;AACjE,QAAM,UAAU,SAAS,cAAc,aAAa,cAAc;AAClE,QAAM,qBAAqB,iBAAiB,MAAMA,UAAS,gBAAgB;AAAA,IACzE,WAAW,wBAAwB,OAAOA,UAAS,aAAa,OAAO,SAASA,UAAS,UAAU,OAAO,OAAO,OAAO,wBAAwB,QAAQ,UAAU,QAAQ,kBAAmB,OAAOA,UAAS,sBAAsB,OAAO,SAASA,UAAS,mBAAmB,SAAS,QAAQ;AAAA,IAChS;AAAA,IACA;AAAA,IACA;AAAA,EACF,CAAC,CAAC;AACF,QAAM,OAAO,mBAAmB,aAAa;AAAA,IAC3C;AAAA,IACA,GAAAC;AAAA,IACA,OAAO,MAAM,SAAS;AAAA,IACtB,QAAQ,MAAM,SAAS;AAAA,EACzB,IAAI,MAAM;AACV,QAAM,eAAe,OAAOD,UAAS,mBAAmB,OAAO,SAASA,UAAS,gBAAgB,SAAS,QAAQ;AAClH,QAAM,cAAe,OAAOA,UAAS,aAAa,OAAO,SAASA,UAAS,UAAU,YAAY,KAAO,OAAOA,UAAS,YAAY,OAAO,SAASA,UAAS,SAAS,YAAY,MAAO;AAAA,IACvL,GAAG;AAAA,IACH,GAAG;AAAA,EACL,IAAI;AAAA,IACF,GAAG;AAAA,IACH,GAAG;AAAA,EACL;AACA,QAAM,oBAAoB,iBAAiBA,UAAS,wDAAwD,MAAMA,UAAS,sDAAsD;AAAA,IAC/K;AAAA,IACA;AAAA,IACA;AAAA,IACA;AAAA,EACF,CAAC,IAAI,IAAI;AACT,SAAO;AAAA,IACL,MAAM,mBAAmB,MAAM,kBAAkB,MAAM,cAAc,OAAO,YAAY;AAAA,IACxF,SAAS,kBAAkB,SAAS,mBAAmB,SAAS,cAAc,UAAU,YAAY;AAAA,IACpG,OAAO,mBAAmB,OAAO,kBAAkB,OAAO,cAAc,QAAQ,YAAY;AAAA,IAC5F,QAAQ,kBAAkB,QAAQ,mBAAmB,QAAQ,cAAc,SAAS,YAAY;AAAA,EAClG;AACF;AAOA,IAAM,QAAQ,cAAY;AAAA,EACxB,MAAM;AAAA,EACN;AAAA,EACA,MAAM,GAAG,OAAO;AACd,UAAM;AAAA,MACJ;AAAA,MACA,GAAAC;AAAA,MACA;AAAA,MACA;AAAA,MACA,UAAAD;AAAA,MACA;AAAA,MACA;AAAA,IACF,IAAI;AAEJ,UAAM;AAAA,MACJ;AAAA,MACA,UAAU;AAAA,IACZ,IAAI,SAAS,SAAS,KAAK,KAAK,CAAC;AACjC,QAAI,WAAW,MAAM;AACnB,aAAO,CAAC;AAAA,IACV;AACA,UAAM,gBAAgB,iBAAiB,OAAO;AAC9C,UAAM,SAAS;AAAA,MACb;AAAA,MACA,GAAAC;AAAA,IACF;AACA,UAAM,OAAO,iBAAiB,SAAS;AACvC,UAAM,SAAS,cAAc,IAAI;AACjC,UAAM,kBAAkB,MAAMD,UAAS,cAAc,OAAO;AAC5D,UAAM,UAAU,SAAS;AACzB,UAAM,UAAU,UAAU,QAAQ;AAClC,UAAM,UAAU,UAAU,WAAW;AACrC,UAAM,aAAa,UAAU,iBAAiB;AAC9C,UAAM,UAAU,MAAM,UAAU,MAAM,IAAI,MAAM,UAAU,IAAI,IAAI,OAAO,IAAI,IAAI,MAAM,SAAS,MAAM;AACtG,UAAM,YAAY,OAAO,IAAI,IAAI,MAAM,UAAU,IAAI;AACrD,UAAM,oBAAoB,OAAOA,UAAS,mBAAmB,OAAO,SAASA,UAAS,gBAAgB,OAAO;AAC7G,QAAI,aAAa,oBAAoB,kBAAkB,UAAU,IAAI;AAGrE,QAAI,CAAC,cAAc,CAAE,OAAOA,UAAS,aAAa,OAAO,SAASA,UAAS,UAAU,iBAAiB,IAAK;AACzG,mBAAa,SAAS,SAAS,UAAU,KAAK,MAAM,SAAS,MAAM;AAAA,IACrE;AACA,UAAM,oBAAoB,UAAU,IAAI,YAAY;AAIpD,UAAM,yBAAyB,aAAa,IAAI,gBAAgB,MAAM,IAAI,IAAI;AAC9E,UAAM,aAAa,IAAI,cAAc,OAAO,GAAG,sBAAsB;AACrE,UAAM,aAAa,IAAI,cAAc,OAAO,GAAG,sBAAsB;AAIrE,UAAM,QAAQ;AACd,UAAMG,OAAM,aAAa,gBAAgB,MAAM,IAAI;AACnD,UAAM,SAAS,aAAa,IAAI,gBAAgB,MAAM,IAAI,IAAI;AAC9D,UAAMC,UAAS,MAAM,OAAO,QAAQD,IAAG;AAMvC,UAAM,kBAAkB,CAAC,eAAe,SAAS,aAAa,SAAS,KAAK,QAAQ,WAAWC,WAAU,MAAM,UAAU,MAAM,IAAI,KAAK,SAAS,QAAQ,aAAa,cAAc,gBAAgB,MAAM,IAAI,IAAI;AAClN,UAAM,kBAAkB,kBAAkB,SAAS,QAAQ,SAAS,QAAQ,SAASD,OAAM;AAC3F,WAAO;AAAA,MACL,CAAC,IAAI,GAAG,OAAO,IAAI,IAAI;AAAA,MACvB,MAAM;AAAA,QACJ,CAAC,IAAI,GAAGC;AAAA,QACR,cAAc,SAASA,UAAS;AAAA,SAC5B,mBAAmB;AAAA,QACrB;AAAA,MACF;AAAA,MAEF,OAAO;AAAA,IACT;AAAA,EACF;AACF;AA+GA,IAAM,OAAO,SAAU,SAAS;AAC9B,MAAI,YAAY,QAAQ;AACtB,cAAU,CAAC;AAAA,EACb;AACA,SAAO;AAAA,IACL,MAAM;AAAA,IACN;AAAA,IACA,MAAM,GAAG,OAAO;AACd,UAAI,uBAAuB;AAC3B,YAAM;AAAA,QACJ;AAAA,QACA;AAAA,QACA;AAAA,QACA;AAAA,QACA,UAAAC;AAAA,QACA;AAAA,MACF,IAAI;AACJ,YAQI,cAAS,SAAS,KAAK,GAPzB;AAAA,kBAAU,gBAAgB;AAAA,QAC1B,WAAW,iBAAiB;AAAA,QAC5B,oBAAoB;AAAA,QACpB,mBAAmB;AAAA,QACnB,4BAA4B;AAAA,QAC5B,gBAAgB;AAAA,MA7axB,IA+aU,IADC,kCACD,IADC;AAAA,QANH;AAAA,QACA;AAAA,QACA;AAAA,QACA;AAAA,QACA;AAAA,QACA;AAAA;AAQF,WAAK,wBAAwB,eAAe,UAAU,QAAQ,sBAAsB,iBAAiB;AACnG,eAAO,CAAC;AAAA,MACV;AACA,YAAMC,QAAO,QAAQ,SAAS;AAC9B,YAAM,kBAAkB,YAAY,gBAAgB;AACpD,YAAM,kBAAkB,QAAQ,gBAAgB,MAAM;AACtD,YAAM,MAAM,OAAOD,UAAS,SAAS,OAAO,SAASA,UAAS,MAAM,SAAS,QAAQ;AACrF,YAAM,qBAAqB,gCAAgC,mBAAmB,CAAC,gBAAgB,CAAC,qBAAqB,gBAAgB,CAAC,IAAI,sBAAsB,gBAAgB;AAChL,YAAM,+BAA+B,8BAA8B;AACnE,UAAI,CAAC,+BAA+B,8BAA8B;AAChE,2BAAmB,KAAK,GAAG,0BAA0B,kBAAkB,eAAe,2BAA2B,GAAG,CAAC;AAAA,MACvH;AACA,YAAME,cAAa,CAAC,kBAAkB,GAAG,kBAAkB;AAC3D,YAAM,WAAW,MAAM,eAAe,OAAO,qBAAqB;AAClE,YAAM,YAAY,CAAC;AACnB,UAAI,kBAAkB,uBAAuB,eAAe,SAAS,OAAO,SAAS,qBAAqB,cAAc,CAAC;AACzH,UAAI,eAAe;AACjB,kBAAU,KAAK,SAASD,KAAI,CAAC;AAAA,MAC/B;AACA,UAAI,gBAAgB;AAClB,cAAME,SAAQ,kBAAkB,WAAW,OAAO,GAAG;AACrD,kBAAU,KAAK,SAASA,OAAM,CAAC,CAAC,GAAG,SAASA,OAAM,CAAC,CAAC,CAAC;AAAA,MACvD;AACA,sBAAgB,CAAC,GAAG,eAAe;AAAA,QACjC;AAAA,QACA;AAAA,MACF,CAAC;AAGD,UAAI,CAAC,UAAU,MAAM,CAAAF,UAAQA,SAAQ,CAAC,GAAG;AACvC,YAAI,uBAAuB;AAC3B,cAAM,eAAe,wBAAwB,eAAe,SAAS,OAAO,SAAS,sBAAsB,UAAU,KAAK;AAC1H,cAAM,gBAAgBC,YAAW,SAAS;AAC1C,YAAI,eAAe;AAEjB,iBAAO;AAAA,YACL,MAAM;AAAA,cACJ,OAAO;AAAA,cACP,WAAW;AAAA,YACb;AAAA,YACA,OAAO;AAAA,cACL,WAAW;AAAA,YACb;AAAA,UACF;AAAA,QACF;AAIA,YAAI,kBAAkB,wBAAwB,cAAc,OAAO,CAAAE,OAAKA,GAAE,UAAU,CAAC,KAAK,CAAC,EAAE,KAAK,CAACC,IAAGC,OAAMD,GAAE,UAAU,CAAC,IAAIC,GAAE,UAAU,CAAC,CAAC,EAAE,CAAC,MAAM,OAAO,SAAS,sBAAsB;AAG1L,YAAI,CAAC,gBAAgB;AACnB,kBAAQ,kBAAkB;AAAA,YACxB,KAAK,WACH;AACE,kBAAI;AACJ,oBAAMC,cAAa,yBAAyB,cAAc,OAAO,CAAAH,OAAK;AACpE,oBAAI,8BAA8B;AAChC,wBAAM,kBAAkB,YAAYA,GAAE,SAAS;AAC/C,yBAAO,oBAAoB;AAAA;AAAA,kBAG3B,oBAAoB;AAAA,gBACtB;AACA,uBAAO;AAAA,cACT,CAAC,EAAE,IAAI,CAAAA,OAAK,CAACA,GAAE,WAAWA,GAAE,UAAU,OAAO,CAAAI,cAAYA,YAAW,CAAC,EAAE,OAAO,CAAC,KAAKA,cAAa,MAAMA,WAAU,CAAC,CAAC,CAAC,EAAE,KAAK,CAACH,IAAGC,OAAMD,GAAE,CAAC,IAAIC,GAAE,CAAC,CAAC,EAAE,CAAC,MAAM,OAAO,SAAS,uBAAuB,CAAC;AACjM,kBAAIC,YAAW;AACb,iCAAiBA;AAAA,cACnB;AACA;AAAA,YACF;AAAA,YACF,KAAK;AACH,+BAAiB;AACjB;AAAA,UACJ;AAAA,QACF;AACA,YAAI,cAAc,gBAAgB;AAChC,iBAAO;AAAA,YACL,OAAO;AAAA,cACL,WAAW;AAAA,YACb;AAAA,UACF;AAAA,QACF;AAAA,MACF;AACA,aAAO,CAAC;AAAA,IACV;AAAA,EACF;AACF;AAEA,SAAS,eAAe,UAAU,MAAM;AACtC,SAAO;AAAA,IACL,KAAK,SAAS,MAAM,KAAK;AAAA,IACzB,OAAO,SAAS,QAAQ,KAAK;AAAA,IAC7B,QAAQ,SAAS,SAAS,KAAK;AAAA,IAC/B,MAAM,SAAS,OAAO,KAAK;AAAA,EAC7B;AACF;AACA,SAAS,sBAAsB,UAAU;AACvC,SAAO,MAAM,KAAK,CAAAN,UAAQ,SAASA,KAAI,KAAK,CAAC;AAC/C;AAMA,IAAM,OAAO,SAAU,SAAS;AAC9B,MAAI,YAAY,QAAQ;AACtB,cAAU,CAAC;AAAA,EACb;AACA,SAAO;AAAA,IACL,MAAM;AAAA,IACN;AAAA,IACA,MAAM,GAAG,OAAO;AACd,YAAM;AAAA,QACJ;AAAA,MACF,IAAI;AACJ,YAGI,cAAS,SAAS,KAAK,GAFzB;AAAA,mBAAW;AAAA,MA1iBnB,IA4iBU,IADC,kCACD,IADC;AAAA,QADH;AAAA;AAGF,cAAQ,UAAU;AAAA,QAChB,KAAK,mBACH;AACE,gBAAM,WAAW,MAAM,eAAe,OAAO,iCACxC,wBADwC;AAAA,YAE3C,gBAAgB;AAAA,UAClB,EAAC;AACD,gBAAM,UAAU,eAAe,UAAU,MAAM,SAAS;AACxD,iBAAO;AAAA,YACL,MAAM;AAAA,cACJ,wBAAwB;AAAA,cACxB,iBAAiB,sBAAsB,OAAO;AAAA,YAChD;AAAA,UACF;AAAA,QACF;AAAA,QACF,KAAK,WACH;AACE,gBAAM,WAAW,MAAM,eAAe,OAAO,iCACxC,wBADwC;AAAA,YAE3C,aAAa;AAAA,UACf,EAAC;AACD,gBAAM,UAAU,eAAe,UAAU,MAAM,QAAQ;AACvD,iBAAO;AAAA,YACL,MAAM;AAAA,cACJ,gBAAgB;AAAA,cAChB,SAAS,sBAAsB,OAAO;AAAA,YACxC;AAAA,UACF;AAAA,QACF;AAAA,QACF,SACE;AACE,iBAAO,CAAC;AAAA,QACV;AAAA,MACJ;AAAA,IACF;AAAA,EACF;AACF;AAwIA,eAAe,qBAAqB,OAAO,SAAS;AAClD,QAAM;AAAA,IACJ;AAAA,IACA,UAAAQ;AAAA,IACA;AAAA,EACF,IAAI;AACJ,QAAM,MAAM,OAAOA,UAAS,SAAS,OAAO,SAASA,UAAS,MAAM,SAAS,QAAQ;AACrF,QAAMC,QAAO,QAAQ,SAAS;AAC9B,QAAM,YAAY,aAAa,SAAS;AACxC,QAAM,aAAa,YAAY,SAAS,MAAM;AAC9C,QAAM,gBAAgB,CAAC,QAAQ,KAAK,EAAE,SAASA,KAAI,IAAI,KAAK;AAC5D,QAAM,iBAAiB,OAAO,aAAa,KAAK;AAChD,QAAM,WAAW,SAAS,SAAS,KAAK;AAGxC,MAAI;AAAA,IACF;AAAA,IACA;AAAA,IACA;AAAA,EACF,IAAI,OAAO,aAAa,WAAW;AAAA,IACjC,UAAU;AAAA,IACV,WAAW;AAAA,IACX,eAAe;AAAA,EACjB,IAAI;AAAA,IACF,UAAU,SAAS,YAAY;AAAA,IAC/B,WAAW,SAAS,aAAa;AAAA,IACjC,eAAe,SAAS;AAAA,EAC1B;AACA,MAAI,aAAa,OAAO,kBAAkB,UAAU;AAClD,gBAAY,cAAc,QAAQ,gBAAgB,KAAK;AAAA,EACzD;AACA,SAAO,aAAa;AAAA,IAClB,GAAG,YAAY;AAAA,IACf,GAAG,WAAW;AAAA,EAChB,IAAI;AAAA,IACF,GAAG,WAAW;AAAA,IACd,GAAG,YAAY;AAAA,EACjB;AACF;AASA,IAAM,SAAS,SAAU,SAAS;AAChC,MAAI,YAAY,QAAQ;AACtB,cAAU;AAAA,EACZ;AACA,SAAO;AAAA,IACL,MAAM;AAAA,IACN;AAAA,IACA,MAAM,GAAG,OAAO;AACd,UAAI,uBAAuB;AAC3B,YAAM;AAAA,QACJ;AAAA,QACA,GAAAC;AAAA,QACA;AAAA,QACA;AAAA,MACF,IAAI;AACJ,YAAM,aAAa,MAAM,qBAAqB,OAAO,OAAO;AAI5D,UAAI,gBAAgB,wBAAwB,eAAe,WAAW,OAAO,SAAS,sBAAsB,eAAe,wBAAwB,eAAe,UAAU,QAAQ,sBAAsB,iBAAiB;AACzN,eAAO,CAAC;AAAA,MACV;AACA,aAAO;AAAA,QACL,GAAG,IAAI,WAAW;AAAA,QAClB,GAAGA,KAAI,WAAW;AAAA,QAClB,MAAM,iCACD,aADC;AAAA,UAEJ;AAAA,QACF;AAAA,MACF;AAAA,IACF;AAAA,EACF;AACF;AAOA,IAAM,QAAQ,SAAU,SAAS;AAC/B,MAAI,YAAY,QAAQ;AACtB,cAAU,CAAC;AAAA,EACb;AACA,SAAO;AAAA,IACL,MAAM;AAAA,IACN;AAAA,IACA,MAAM,GAAG,OAAO;AACd,YAAM;AAAA,QACJ;AAAA,QACA,GAAAA;AAAA,QACA;AAAA,MACF,IAAI;AACJ,YAgBI,cAAS,SAAS,KAAK,GAfzB;AAAA,kBAAU,gBAAgB;AAAA,QAC1B,WAAW,iBAAiB;AAAA,QAC5B,UAAU;AAAA,UACR,IAAI,UAAQ;AACV,gBAAI;AAAA,cACF,GAAAC;AAAA,cACA,GAAAD;AAAA,YACF,IAAI;AACJ,mBAAO;AAAA,cACL,GAAAC;AAAA,cACA,GAAAD;AAAA,YACF;AAAA,UACF;AAAA,QACF;AAAA,MA10BR,IA40BU,IADC,kCACD,IADC;AAAA,QAdH;AAAA,QACA;AAAA,QACA;AAAA;AAcF,YAAM,SAAS;AAAA,QACb;AAAA,QACA,GAAAA;AAAA,MACF;AACA,YAAM,WAAW,MAAM,eAAe,OAAO,qBAAqB;AAClE,YAAM,YAAY,YAAY,QAAQ,SAAS,CAAC;AAChD,YAAM,WAAW,gBAAgB,SAAS;AAC1C,UAAI,gBAAgB,OAAO,QAAQ;AACnC,UAAI,iBAAiB,OAAO,SAAS;AACrC,UAAI,eAAe;AACjB,cAAM,UAAU,aAAa,MAAM,QAAQ;AAC3C,cAAM,UAAU,aAAa,MAAM,WAAW;AAC9C,cAAME,OAAM,gBAAgB,SAAS,OAAO;AAC5C,cAAMC,OAAM,gBAAgB,SAAS,OAAO;AAC5C,wBAAgB,MAAMD,MAAK,eAAeC,IAAG;AAAA,MAC/C;AACA,UAAI,gBAAgB;AAClB,cAAM,UAAU,cAAc,MAAM,QAAQ;AAC5C,cAAM,UAAU,cAAc,MAAM,WAAW;AAC/C,cAAMD,OAAM,iBAAiB,SAAS,OAAO;AAC7C,cAAMC,OAAM,iBAAiB,SAAS,OAAO;AAC7C,yBAAiB,MAAMD,MAAK,gBAAgBC,IAAG;AAAA,MACjD;AACA,YAAM,gBAAgB,QAAQ,GAAG,iCAC5B,QAD4B;AAAA,QAE/B,CAAC,QAAQ,GAAG;AAAA,QACZ,CAAC,SAAS,GAAG;AAAA,MACf,EAAC;AACD,aAAO,iCACF,gBADE;AAAA,QAEL,MAAM;AAAA,UACJ,GAAG,cAAc,IAAI;AAAA,UACrB,GAAG,cAAc,IAAIH;AAAA,UACrB,SAAS;AAAA,YACP,CAAC,QAAQ,GAAG;AAAA,YACZ,CAAC,SAAS,GAAG;AAAA,UACf;AAAA,QACF;AAAA,MACF;AAAA,IACF;AAAA,EACF;AACF;AA4EA,IAAM,OAAO,SAAU,SAAS;AAC9B,MAAI,YAAY,QAAQ;AACtB,cAAU,CAAC;AAAA,EACb;AACA,SAAO;AAAA,IACL,MAAM;AAAA,IACN;AAAA,IACA,MAAM,GAAG,OAAO;AACd,UAAI,uBAAuB;AAC3B,YAAM;AAAA,QACJ;AAAA,QACA;AAAA,QACA,UAAAI;AAAA,QACA;AAAA,MACF,IAAI;AACJ,YAGI,cAAS,SAAS,KAAK,GAFzB;AAAA,gBAAQ,MAAM;AAAA,QAAC;AAAA,MAl9BvB,IAo9BU,IADC,kCACD,IADC;AAAA,QADH;AAAA;AAGF,YAAM,WAAW,MAAM,eAAe,OAAO,qBAAqB;AAClE,YAAMC,QAAO,QAAQ,SAAS;AAC9B,YAAM,YAAY,aAAa,SAAS;AACxC,YAAM,UAAU,YAAY,SAAS,MAAM;AAC3C,YAAM;AAAA,QACJ;AAAA,QACA;AAAA,MACF,IAAI,MAAM;AACV,UAAI;AACJ,UAAI;AACJ,UAAIA,UAAS,SAASA,UAAS,UAAU;AACvC,qBAAaA;AACb,oBAAY,eAAgB,OAAOD,UAAS,SAAS,OAAO,SAASA,UAAS,MAAM,SAAS,QAAQ,KAAM,UAAU,SAAS,SAAS;AAAA,MACzI,OAAO;AACL,oBAAYC;AACZ,qBAAa,cAAc,QAAQ,QAAQ;AAAA,MAC7C;AACA,YAAM,wBAAwB,SAAS,SAAS,MAAM,SAAS;AAC/D,YAAM,uBAAuB,QAAQ,SAAS,OAAO,SAAS;AAC9D,YAAM,0BAA0B,IAAI,SAAS,SAAS,UAAU,GAAG,qBAAqB;AACxF,YAAM,yBAAyB,IAAI,QAAQ,SAAS,SAAS,GAAG,oBAAoB;AACpF,YAAM,UAAU,CAAC,MAAM,eAAe;AACtC,UAAI,kBAAkB;AACtB,UAAI,iBAAiB;AACrB,WAAK,wBAAwB,MAAM,eAAe,UAAU,QAAQ,sBAAsB,QAAQ,GAAG;AACnG,yBAAiB;AAAA,MACnB;AACA,WAAK,yBAAyB,MAAM,eAAe,UAAU,QAAQ,uBAAuB,QAAQ,GAAG;AACrG,0BAAkB;AAAA,MACpB;AACA,UAAI,WAAW,CAAC,WAAW;AACzB,cAAM,OAAO,IAAI,SAAS,MAAM,CAAC;AACjC,cAAM,OAAO,IAAI,SAAS,OAAO,CAAC;AAClC,cAAM,OAAO,IAAI,SAAS,KAAK,CAAC;AAChC,cAAM,OAAO,IAAI,SAAS,QAAQ,CAAC;AACnC,YAAI,SAAS;AACX,2BAAiB,QAAQ,KAAK,SAAS,KAAK,SAAS,IAAI,OAAO,OAAO,IAAI,SAAS,MAAM,SAAS,KAAK;AAAA,QAC1G,OAAO;AACL,4BAAkB,SAAS,KAAK,SAAS,KAAK,SAAS,IAAI,OAAO,OAAO,IAAI,SAAS,KAAK,SAAS,MAAM;AAAA,QAC5G;AAAA,MACF;AACA,YAAM,MAAM,iCACP,QADO;AAAA,QAEV;AAAA,QACA;AAAA,MACF,EAAC;AACD,YAAM,iBAAiB,MAAMD,UAAS,cAAc,SAAS,QAAQ;AACrE,UAAI,UAAU,eAAe,SAAS,WAAW,eAAe,QAAQ;AACtE,eAAO;AAAA,UACL,OAAO;AAAA,YACL,OAAO;AAAA,UACT;AAAA,QACF;AAAA,MACF;AACA,aAAO,CAAC;AAAA,IACV;AAAA,EACF;AACF;;;AC9gCA,SAAS,YAAY;AACnB,SAAO,OAAO,WAAW;AAC3B;AACA,SAAS,YAAY,MAAM;AACzB,MAAI,OAAO,IAAI,GAAG;AAChB,YAAQ,KAAK,YAAY,IAAI,YAAY;AAAA,EAC3C;AAIA,SAAO;AACT;AACA,SAAS,UAAU,MAAM;AACvB,MAAI;AACJ,UAAQ,QAAQ,SAAS,sBAAsB,KAAK,kBAAkB,OAAO,SAAS,oBAAoB,gBAAgB;AAC5H;AACA,SAAS,mBAAmB,MAAM;AAChC,MAAI;AACJ,UAAQ,QAAQ,OAAO,IAAI,IAAI,KAAK,gBAAgB,KAAK,aAAa,OAAO,aAAa,OAAO,SAAS,KAAK;AACjH;AACA,SAAS,OAAO,OAAO;AACrB,MAAI,CAAC,UAAU,GAAG;AAChB,WAAO;AAAA,EACT;AACA,SAAO,iBAAiB,QAAQ,iBAAiB,UAAU,KAAK,EAAE;AACpE;AACA,SAAS,UAAU,OAAO;AACxB,MAAI,CAAC,UAAU,GAAG;AAChB,WAAO;AAAA,EACT;AACA,SAAO,iBAAiB,WAAW,iBAAiB,UAAU,KAAK,EAAE;AACvE;AACA,SAAS,cAAc,OAAO;AAC5B,MAAI,CAAC,UAAU,GAAG;AAChB,WAAO;AAAA,EACT;AACA,SAAO,iBAAiB,eAAe,iBAAiB,UAAU,KAAK,EAAE;AAC3E;AACA,SAAS,aAAa,OAAO;AAC3B,MAAI,CAAC,UAAU,KAAK,OAAO,eAAe,aAAa;AACrD,WAAO;AAAA,EACT;AACA,SAAO,iBAAiB,cAAc,iBAAiB,UAAU,KAAK,EAAE;AAC1E;AACA,SAAS,kBAAkB,SAAS;AAClC,QAAM;AAAA,IACJ;AAAA,IACA;AAAA,IACA;AAAA,IACA;AAAA,EACF,IAAI,iBAAiB,OAAO;AAC5B,SAAO,kCAAkC,KAAK,WAAW,YAAY,SAAS,KAAK,CAAC,CAAC,UAAU,UAAU,EAAE,SAAS,OAAO;AAC7H;AACA,SAAS,eAAe,SAAS;AAC/B,SAAO,CAAC,SAAS,MAAM,IAAI,EAAE,SAAS,YAAY,OAAO,CAAC;AAC5D;AACA,SAAS,WAAW,SAAS;AAC3B,SAAO,CAAC,iBAAiB,QAAQ,EAAE,KAAK,cAAY;AAClD,QAAI;AACF,aAAO,QAAQ,QAAQ,QAAQ;AAAA,IACjC,SAAS,GAAG;AACV,aAAO;AAAA,IACT;AAAA,EACF,CAAC;AACH;AACA,SAAS,kBAAkB,cAAc;AACvC,QAAM,SAAS,SAAS;AACxB,QAAME,QAAM,UAAU,YAAY,IAAI,iBAAiB,YAAY,IAAI;AAIvE,SAAO,CAAC,aAAa,aAAa,SAAS,UAAU,aAAa,EAAE,KAAK,WAASA,MAAI,KAAK,IAAIA,MAAI,KAAK,MAAM,SAAS,KAAK,MAAMA,MAAI,gBAAgBA,MAAI,kBAAkB,WAAW,UAAU,CAAC,WAAWA,MAAI,iBAAiBA,MAAI,mBAAmB,SAAS,UAAU,CAAC,WAAWA,MAAI,SAASA,MAAI,WAAW,SAAS,UAAU,CAAC,aAAa,aAAa,SAAS,UAAU,eAAe,QAAQ,EAAE,KAAK,YAAUA,MAAI,cAAc,IAAI,SAAS,KAAK,CAAC,KAAK,CAAC,SAAS,UAAU,UAAU,SAAS,EAAE,KAAK,YAAUA,MAAI,WAAW,IAAI,SAAS,KAAK,CAAC;AACniB;AACA,SAAS,mBAAmB,SAAS;AACnC,MAAI,cAAc,cAAc,OAAO;AACvC,SAAO,cAAc,WAAW,KAAK,CAAC,sBAAsB,WAAW,GAAG;AACxE,QAAI,kBAAkB,WAAW,GAAG;AAClC,aAAO;AAAA,IACT,WAAW,WAAW,WAAW,GAAG;AAClC,aAAO;AAAA,IACT;AACA,kBAAc,cAAc,WAAW;AAAA,EACzC;AACA,SAAO;AACT;AACA,SAAS,WAAW;AAClB,MAAI,OAAO,QAAQ,eAAe,CAAC,IAAI,SAAU,QAAO;AACxD,SAAO,IAAI,SAAS,2BAA2B,MAAM;AACvD;AACA,SAAS,sBAAsB,MAAM;AACnC,SAAO,CAAC,QAAQ,QAAQ,WAAW,EAAE,SAAS,YAAY,IAAI,CAAC;AACjE;AACA,SAAS,iBAAiB,SAAS;AACjC,SAAO,UAAU,OAAO,EAAE,iBAAiB,OAAO;AACpD;AACA,SAAS,cAAc,SAAS;AAC9B,MAAI,UAAU,OAAO,GAAG;AACtB,WAAO;AAAA,MACL,YAAY,QAAQ;AAAA,MACpB,WAAW,QAAQ;AAAA,IACrB;AAAA,EACF;AACA,SAAO;AAAA,IACL,YAAY,QAAQ;AAAA,IACpB,WAAW,QAAQ;AAAA,EACrB;AACF;AACA,SAAS,cAAc,MAAM;AAC3B,MAAI,YAAY,IAAI,MAAM,QAAQ;AAChC,WAAO;AAAA,EACT;AACA,QAAM;AAAA;AAAA,IAEN,KAAK;AAAA,IAEL,KAAK;AAAA,IAEL,aAAa,IAAI,KAAK,KAAK;AAAA,IAE3B,mBAAmB,IAAI;AAAA;AACvB,SAAO,aAAa,MAAM,IAAI,OAAO,OAAO;AAC9C;AACA,SAAS,2BAA2B,MAAM;AACxC,QAAM,aAAa,cAAc,IAAI;AACrC,MAAI,sBAAsB,UAAU,GAAG;AACrC,WAAO,KAAK,gBAAgB,KAAK,cAAc,OAAO,KAAK;AAAA,EAC7D;AACA,MAAI,cAAc,UAAU,KAAK,kBAAkB,UAAU,GAAG;AAC9D,WAAO;AAAA,EACT;AACA,SAAO,2BAA2B,UAAU;AAC9C;AACA,SAAS,qBAAqB,MAAM,MAAM,iBAAiB;AACzD,MAAI;AACJ,MAAI,SAAS,QAAQ;AACnB,WAAO,CAAC;AAAA,EACV;AACA,MAAI,oBAAoB,QAAQ;AAC9B,sBAAkB;AAAA,EACpB;AACA,QAAM,qBAAqB,2BAA2B,IAAI;AAC1D,QAAM,SAAS,yBAAyB,uBAAuB,KAAK,kBAAkB,OAAO,SAAS,qBAAqB;AAC3H,QAAM,MAAM,UAAU,kBAAkB;AACxC,MAAI,QAAQ;AACV,UAAM,eAAe,gBAAgB,GAAG;AACxC,WAAO,KAAK,OAAO,KAAK,IAAI,kBAAkB,CAAC,GAAG,kBAAkB,kBAAkB,IAAI,qBAAqB,CAAC,GAAG,gBAAgB,kBAAkB,qBAAqB,YAAY,IAAI,CAAC,CAAC;AAAA,EAC9L;AACA,SAAO,KAAK,OAAO,oBAAoB,qBAAqB,oBAAoB,CAAC,GAAG,eAAe,CAAC;AACtG;AACA,SAAS,gBAAgB,KAAK;AAC5B,SAAO,IAAI,UAAU,OAAO,eAAe,IAAI,MAAM,IAAI,IAAI,eAAe;AAC9E;;;AClJA,SAAS,iBAAiB,SAAS;AACjC,QAAMC,QAAM,iBAAiB,OAAO;AAGpC,MAAI,QAAQ,WAAWA,MAAI,KAAK,KAAK;AACrC,MAAI,SAAS,WAAWA,MAAI,MAAM,KAAK;AACvC,QAAM,YAAY,cAAc,OAAO;AACvC,QAAM,cAAc,YAAY,QAAQ,cAAc;AACtD,QAAM,eAAe,YAAY,QAAQ,eAAe;AACxD,QAAM,iBAAiB,MAAM,KAAK,MAAM,eAAe,MAAM,MAAM,MAAM;AACzE,MAAI,gBAAgB;AAClB,YAAQ;AACR,aAAS;AAAA,EACX;AACA,SAAO;AAAA,IACL;AAAA,IACA;AAAA,IACA,GAAG;AAAA,EACL;AACF;AAEA,SAAS,cAAc,SAAS;AAC9B,SAAO,CAAC,UAAU,OAAO,IAAI,QAAQ,iBAAiB;AACxD;AAEA,SAAS,SAAS,SAAS;AACzB,QAAM,aAAa,cAAc,OAAO;AACxC,MAAI,CAAC,cAAc,UAAU,GAAG;AAC9B,WAAO,aAAa,CAAC;AAAA,EACvB;AACA,QAAM,OAAO,WAAW,sBAAsB;AAC9C,QAAM;AAAA,IACJ;AAAA,IACA;AAAA,IACA;AAAA,EACF,IAAI,iBAAiB,UAAU;AAC/B,MAAI,KAAK,IAAI,MAAM,KAAK,KAAK,IAAI,KAAK,SAAS;AAC/C,MAAIC,MAAK,IAAI,MAAM,KAAK,MAAM,IAAI,KAAK,UAAU;AAIjD,MAAI,CAAC,KAAK,CAAC,OAAO,SAAS,CAAC,GAAG;AAC7B,QAAI;AAAA,EACN;AACA,MAAI,CAACA,MAAK,CAAC,OAAO,SAASA,EAAC,GAAG;AAC7B,IAAAA,KAAI;AAAA,EACN;AACA,SAAO;AAAA,IACL;AAAA,IACA,GAAAA;AAAA,EACF;AACF;AAEA,IAAM,YAAyB,6BAAa,CAAC;AAC7C,SAAS,iBAAiB,SAAS;AACjC,QAAM,MAAM,UAAU,OAAO;AAC7B,MAAI,CAAC,SAAS,KAAK,CAAC,IAAI,gBAAgB;AACtC,WAAO;AAAA,EACT;AACA,SAAO;AAAA,IACL,GAAG,IAAI,eAAe;AAAA,IACtB,GAAG,IAAI,eAAe;AAAA,EACxB;AACF;AACA,SAAS,uBAAuB,SAAS,SAAS,sBAAsB;AACtE,MAAI,YAAY,QAAQ;AACtB,cAAU;AAAA,EACZ;AACA,MAAI,CAAC,wBAAwB,WAAW,yBAAyB,UAAU,OAAO,GAAG;AACnF,WAAO;AAAA,EACT;AACA,SAAO;AACT;AAEA,SAAS,sBAAsB,SAAS,cAAc,iBAAiB,cAAc;AACnF,MAAI,iBAAiB,QAAQ;AAC3B,mBAAe;AAAA,EACjB;AACA,MAAI,oBAAoB,QAAQ;AAC9B,sBAAkB;AAAA,EACpB;AACA,QAAM,aAAa,QAAQ,sBAAsB;AACjD,QAAM,aAAa,cAAc,OAAO;AACxC,MAAI,QAAQ,aAAa,CAAC;AAC1B,MAAI,cAAc;AAChB,QAAI,cAAc;AAChB,UAAI,UAAU,YAAY,GAAG;AAC3B,gBAAQ,SAAS,YAAY;AAAA,MAC/B;AAAA,IACF,OAAO;AACL,cAAQ,SAAS,OAAO;AAAA,IAC1B;AAAA,EACF;AACA,QAAM,gBAAgB,uBAAuB,YAAY,iBAAiB,YAAY,IAAI,iBAAiB,UAAU,IAAI,aAAa,CAAC;AACvI,MAAI,KAAK,WAAW,OAAO,cAAc,KAAK,MAAM;AACpD,MAAIA,MAAK,WAAW,MAAM,cAAc,KAAK,MAAM;AACnD,MAAI,QAAQ,WAAW,QAAQ,MAAM;AACrC,MAAI,SAAS,WAAW,SAAS,MAAM;AACvC,MAAI,YAAY;AACd,UAAM,MAAM,UAAU,UAAU;AAChC,UAAM,YAAY,gBAAgB,UAAU,YAAY,IAAI,UAAU,YAAY,IAAI;AACtF,QAAI,aAAa;AACjB,QAAI,gBAAgB,gBAAgB,UAAU;AAC9C,WAAO,iBAAiB,gBAAgB,cAAc,YAAY;AAChE,YAAM,cAAc,SAAS,aAAa;AAC1C,YAAM,aAAa,cAAc,sBAAsB;AACvD,YAAMD,QAAM,iBAAiB,aAAa;AAC1C,YAAM,OAAO,WAAW,QAAQ,cAAc,aAAa,WAAWA,MAAI,WAAW,KAAK,YAAY;AACtG,YAAM,MAAM,WAAW,OAAO,cAAc,YAAY,WAAWA,MAAI,UAAU,KAAK,YAAY;AAClG,WAAK,YAAY;AACjB,MAAAC,MAAK,YAAY;AACjB,eAAS,YAAY;AACrB,gBAAU,YAAY;AACtB,WAAK;AACL,MAAAA,MAAK;AACL,mBAAa,UAAU,aAAa;AACpC,sBAAgB,gBAAgB,UAAU;AAAA,IAC5C;AAAA,EACF;AACA,SAAO,iBAAiB;AAAA,IACtB;AAAA,IACA;AAAA,IACA;AAAA,IACA,GAAAA;AAAA,EACF,CAAC;AACH;AAIA,SAAS,oBAAoB,SAAS,MAAM;AAC1C,QAAM,aAAa,cAAc,OAAO,EAAE;AAC1C,MAAI,CAAC,MAAM;AACT,WAAO,sBAAsB,mBAAmB,OAAO,CAAC,EAAE,OAAO;AAAA,EACnE;AACA,SAAO,KAAK,OAAO;AACrB;AAEA,SAAS,cAAc,iBAAiB,QAAQ,kBAAkB;AAChE,MAAI,qBAAqB,QAAQ;AAC/B,uBAAmB;AAAA,EACrB;AACA,QAAM,WAAW,gBAAgB,sBAAsB;AACvD,QAAM,IAAI,SAAS,OAAO,OAAO,cAAc,mBAAmB;AAAA;AAAA,IAElE,oBAAoB,iBAAiB,QAAQ;AAAA;AAC7C,QAAMA,KAAI,SAAS,MAAM,OAAO;AAChC,SAAO;AAAA,IACL;AAAA,IACA,GAAAA;AAAA,EACF;AACF;AAEA,SAAS,sDAAsD,MAAM;AACnE,MAAI;AAAA,IACF;AAAA,IACA;AAAA,IACA;AAAA,IACA;AAAA,EACF,IAAI;AACJ,QAAM,UAAU,aAAa;AAC7B,QAAM,kBAAkB,mBAAmB,YAAY;AACvD,QAAM,WAAW,WAAW,WAAW,SAAS,QAAQ,IAAI;AAC5D,MAAI,iBAAiB,mBAAmB,YAAY,SAAS;AAC3D,WAAO;AAAA,EACT;AACA,MAAI,SAAS;AAAA,IACX,YAAY;AAAA,IACZ,WAAW;AAAA,EACb;AACA,MAAI,QAAQ,aAAa,CAAC;AAC1B,QAAM,UAAU,aAAa,CAAC;AAC9B,QAAM,0BAA0B,cAAc,YAAY;AAC1D,MAAI,2BAA2B,CAAC,2BAA2B,CAAC,SAAS;AACnE,QAAI,YAAY,YAAY,MAAM,UAAU,kBAAkB,eAAe,GAAG;AAC9E,eAAS,cAAc,YAAY;AAAA,IACrC;AACA,QAAI,cAAc,YAAY,GAAG;AAC/B,YAAM,aAAa,sBAAsB,YAAY;AACrD,cAAQ,SAAS,YAAY;AAC7B,cAAQ,IAAI,WAAW,IAAI,aAAa;AACxC,cAAQ,IAAI,WAAW,IAAI,aAAa;AAAA,IAC1C;AAAA,EACF;AACA,QAAM,aAAa,mBAAmB,CAAC,2BAA2B,CAAC,UAAU,cAAc,iBAAiB,QAAQ,IAAI,IAAI,aAAa,CAAC;AAC1I,SAAO;AAAA,IACL,OAAO,KAAK,QAAQ,MAAM;AAAA,IAC1B,QAAQ,KAAK,SAAS,MAAM;AAAA,IAC5B,GAAG,KAAK,IAAI,MAAM,IAAI,OAAO,aAAa,MAAM,IAAI,QAAQ,IAAI,WAAW;AAAA,IAC3E,GAAG,KAAK,IAAI,MAAM,IAAI,OAAO,YAAY,MAAM,IAAI,QAAQ,IAAI,WAAW;AAAA,EAC5E;AACF;AAEA,SAAS,eAAe,SAAS;AAC/B,SAAO,MAAM,KAAK,QAAQ,eAAe,CAAC;AAC5C;AAIA,SAAS,gBAAgB,SAAS;AAChC,QAAMC,SAAO,mBAAmB,OAAO;AACvC,QAAM,SAAS,cAAc,OAAO;AACpC,QAAM,OAAO,QAAQ,cAAc;AACnC,QAAM,QAAQ,IAAIA,OAAK,aAAaA,OAAK,aAAa,KAAK,aAAa,KAAK,WAAW;AACxF,QAAM,SAAS,IAAIA,OAAK,cAAcA,OAAK,cAAc,KAAK,cAAc,KAAK,YAAY;AAC7F,MAAI,IAAI,CAAC,OAAO,aAAa,oBAAoB,OAAO;AACxD,QAAMD,KAAI,CAAC,OAAO;AAClB,MAAI,iBAAiB,IAAI,EAAE,cAAc,OAAO;AAC9C,SAAK,IAAIC,OAAK,aAAa,KAAK,WAAW,IAAI;AAAA,EACjD;AACA,SAAO;AAAA,IACL;AAAA,IACA;AAAA,IACA;AAAA,IACA,GAAAD;AAAA,EACF;AACF;AAEA,SAAS,gBAAgB,SAAS,UAAU;AAC1C,QAAM,MAAM,UAAU,OAAO;AAC7B,QAAMC,SAAO,mBAAmB,OAAO;AACvC,QAAM,iBAAiB,IAAI;AAC3B,MAAI,QAAQA,OAAK;AACjB,MAAI,SAASA,OAAK;AAClB,MAAI,IAAI;AACR,MAAID,KAAI;AACR,MAAI,gBAAgB;AAClB,YAAQ,eAAe;AACvB,aAAS,eAAe;AACxB,UAAM,sBAAsB,SAAS;AACrC,QAAI,CAAC,uBAAuB,uBAAuB,aAAa,SAAS;AACvE,UAAI,eAAe;AACnB,MAAAA,KAAI,eAAe;AAAA,IACrB;AAAA,EACF;AACA,SAAO;AAAA,IACL;AAAA,IACA;AAAA,IACA;AAAA,IACA,GAAAA;AAAA,EACF;AACF;AAGA,SAAS,2BAA2B,SAAS,UAAU;AACrD,QAAM,aAAa,sBAAsB,SAAS,MAAM,aAAa,OAAO;AAC5E,QAAM,MAAM,WAAW,MAAM,QAAQ;AACrC,QAAM,OAAO,WAAW,OAAO,QAAQ;AACvC,QAAM,QAAQ,cAAc,OAAO,IAAI,SAAS,OAAO,IAAI,aAAa,CAAC;AACzE,QAAM,QAAQ,QAAQ,cAAc,MAAM;AAC1C,QAAM,SAAS,QAAQ,eAAe,MAAM;AAC5C,QAAM,IAAI,OAAO,MAAM;AACvB,QAAMA,KAAI,MAAM,MAAM;AACtB,SAAO;AAAA,IACL;AAAA,IACA;AAAA,IACA;AAAA,IACA,GAAAA;AAAA,EACF;AACF;AACA,SAAS,kCAAkC,SAAS,kBAAkB,UAAU;AAC9E,MAAI;AACJ,MAAI,qBAAqB,YAAY;AACnC,WAAO,gBAAgB,SAAS,QAAQ;AAAA,EAC1C,WAAW,qBAAqB,YAAY;AAC1C,WAAO,gBAAgB,mBAAmB,OAAO,CAAC;AAAA,EACpD,WAAW,UAAU,gBAAgB,GAAG;AACtC,WAAO,2BAA2B,kBAAkB,QAAQ;AAAA,EAC9D,OAAO;AACL,UAAM,gBAAgB,iBAAiB,OAAO;AAC9C,WAAO;AAAA,MACL,GAAG,iBAAiB,IAAI,cAAc;AAAA,MACtC,GAAG,iBAAiB,IAAI,cAAc;AAAA,MACtC,OAAO,iBAAiB;AAAA,MACxB,QAAQ,iBAAiB;AAAA,IAC3B;AAAA,EACF;AACA,SAAO,iBAAiB,IAAI;AAC9B;AACA,SAAS,yBAAyB,SAAS,UAAU;AACnD,QAAM,aAAa,cAAc,OAAO;AACxC,MAAI,eAAe,YAAY,CAAC,UAAU,UAAU,KAAK,sBAAsB,UAAU,GAAG;AAC1F,WAAO;AAAA,EACT;AACA,SAAO,iBAAiB,UAAU,EAAE,aAAa,WAAW,yBAAyB,YAAY,QAAQ;AAC3G;AAKA,SAAS,4BAA4B,SAASE,QAAO;AACnD,QAAM,eAAeA,OAAM,IAAI,OAAO;AACtC,MAAI,cAAc;AAChB,WAAO;AAAA,EACT;AACA,MAAI,SAAS,qBAAqB,SAAS,CAAC,GAAG,KAAK,EAAE,OAAO,QAAM,UAAU,EAAE,KAAK,YAAY,EAAE,MAAM,MAAM;AAC9G,MAAI,sCAAsC;AAC1C,QAAM,iBAAiB,iBAAiB,OAAO,EAAE,aAAa;AAC9D,MAAI,cAAc,iBAAiB,cAAc,OAAO,IAAI;AAG5D,SAAO,UAAU,WAAW,KAAK,CAAC,sBAAsB,WAAW,GAAG;AACpE,UAAM,gBAAgB,iBAAiB,WAAW;AAClD,UAAM,0BAA0B,kBAAkB,WAAW;AAC7D,QAAI,CAAC,2BAA2B,cAAc,aAAa,SAAS;AAClE,4CAAsC;AAAA,IACxC;AACA,UAAM,wBAAwB,iBAAiB,CAAC,2BAA2B,CAAC,sCAAsC,CAAC,2BAA2B,cAAc,aAAa,YAAY,CAAC,CAAC,uCAAuC,CAAC,YAAY,OAAO,EAAE,SAAS,oCAAoC,QAAQ,KAAK,kBAAkB,WAAW,KAAK,CAAC,2BAA2B,yBAAyB,SAAS,WAAW;AACzZ,QAAI,uBAAuB;AAEzB,eAAS,OAAO,OAAO,cAAY,aAAa,WAAW;AAAA,IAC7D,OAAO;AAEL,4CAAsC;AAAA,IACxC;AACA,kBAAc,cAAc,WAAW;AAAA,EACzC;AACA,EAAAA,OAAM,IAAI,SAAS,MAAM;AACzB,SAAO;AACT;AAIA,SAAS,gBAAgB,MAAM;AAC7B,MAAI;AAAA,IACF;AAAA,IACA;AAAA,IACA;AAAA,IACA;AAAA,EACF,IAAI;AACJ,QAAM,2BAA2B,aAAa,sBAAsB,WAAW,OAAO,IAAI,CAAC,IAAI,4BAA4B,SAAS,KAAK,EAAE,IAAI,CAAC,EAAE,OAAO,QAAQ;AACjK,QAAM,oBAAoB,CAAC,GAAG,0BAA0B,YAAY;AACpE,QAAM,wBAAwB,kBAAkB,CAAC;AACjD,QAAM,eAAe,kBAAkB,OAAO,CAAC,SAAS,qBAAqB;AAC3E,UAAM,OAAO,kCAAkC,SAAS,kBAAkB,QAAQ;AAClF,YAAQ,MAAM,IAAI,KAAK,KAAK,QAAQ,GAAG;AACvC,YAAQ,QAAQ,IAAI,KAAK,OAAO,QAAQ,KAAK;AAC7C,YAAQ,SAAS,IAAI,KAAK,QAAQ,QAAQ,MAAM;AAChD,YAAQ,OAAO,IAAI,KAAK,MAAM,QAAQ,IAAI;AAC1C,WAAO;AAAA,EACT,GAAG,kCAAkC,SAAS,uBAAuB,QAAQ,CAAC;AAC9E,SAAO;AAAA,IACL,OAAO,aAAa,QAAQ,aAAa;AAAA,IACzC,QAAQ,aAAa,SAAS,aAAa;AAAA,IAC3C,GAAG,aAAa;AAAA,IAChB,GAAG,aAAa;AAAA,EAClB;AACF;AAEA,SAAS,cAAc,SAAS;AAC9B,QAAM;AAAA,IACJ;AAAA,IACA;AAAA,EACF,IAAI,iBAAiB,OAAO;AAC5B,SAAO;AAAA,IACL;AAAA,IACA;AAAA,EACF;AACF;AAEA,SAAS,8BAA8B,SAAS,cAAc,UAAU;AACtE,QAAM,0BAA0B,cAAc,YAAY;AAC1D,QAAM,kBAAkB,mBAAmB,YAAY;AACvD,QAAM,UAAU,aAAa;AAC7B,QAAM,OAAO,sBAAsB,SAAS,MAAM,SAAS,YAAY;AACvE,MAAI,SAAS;AAAA,IACX,YAAY;AAAA,IACZ,WAAW;AAAA,EACb;AACA,QAAM,UAAU,aAAa,CAAC;AAC9B,MAAI,2BAA2B,CAAC,2BAA2B,CAAC,SAAS;AACnE,QAAI,YAAY,YAAY,MAAM,UAAU,kBAAkB,eAAe,GAAG;AAC9E,eAAS,cAAc,YAAY;AAAA,IACrC;AACA,QAAI,yBAAyB;AAC3B,YAAM,aAAa,sBAAsB,cAAc,MAAM,SAAS,YAAY;AAClF,cAAQ,IAAI,WAAW,IAAI,aAAa;AACxC,cAAQ,IAAI,WAAW,IAAI,aAAa;AAAA,IAC1C,WAAW,iBAAiB;AAG1B,cAAQ,IAAI,oBAAoB,eAAe;AAAA,IACjD;AAAA,EACF;AACA,QAAM,aAAa,mBAAmB,CAAC,2BAA2B,CAAC,UAAU,cAAc,iBAAiB,MAAM,IAAI,aAAa,CAAC;AACpI,QAAM,IAAI,KAAK,OAAO,OAAO,aAAa,QAAQ,IAAI,WAAW;AACjE,QAAMF,KAAI,KAAK,MAAM,OAAO,YAAY,QAAQ,IAAI,WAAW;AAC/D,SAAO;AAAA,IACL;AAAA,IACA,GAAAA;AAAA,IACA,OAAO,KAAK;AAAA,IACZ,QAAQ,KAAK;AAAA,EACf;AACF;AAEA,SAAS,mBAAmB,SAAS;AACnC,SAAO,iBAAiB,OAAO,EAAE,aAAa;AAChD;AAEA,SAAS,oBAAoB,SAAS,UAAU;AAC9C,MAAI,CAAC,cAAc,OAAO,KAAK,iBAAiB,OAAO,EAAE,aAAa,SAAS;AAC7E,WAAO;AAAA,EACT;AACA,MAAI,UAAU;AACZ,WAAO,SAAS,OAAO;AAAA,EACzB;AACA,MAAI,kBAAkB,QAAQ;AAM9B,MAAI,mBAAmB,OAAO,MAAM,iBAAiB;AACnD,sBAAkB,gBAAgB,cAAc;AAAA,EAClD;AACA,SAAO;AACT;AAIA,SAAS,gBAAgB,SAAS,UAAU;AAC1C,QAAM,MAAM,UAAU,OAAO;AAC7B,MAAI,WAAW,OAAO,GAAG;AACvB,WAAO;AAAA,EACT;AACA,MAAI,CAAC,cAAc,OAAO,GAAG;AAC3B,QAAI,kBAAkB,cAAc,OAAO;AAC3C,WAAO,mBAAmB,CAAC,sBAAsB,eAAe,GAAG;AACjE,UAAI,UAAU,eAAe,KAAK,CAAC,mBAAmB,eAAe,GAAG;AACtE,eAAO;AAAA,MACT;AACA,wBAAkB,cAAc,eAAe;AAAA,IACjD;AACA,WAAO;AAAA,EACT;AACA,MAAI,eAAe,oBAAoB,SAAS,QAAQ;AACxD,SAAO,gBAAgB,eAAe,YAAY,KAAK,mBAAmB,YAAY,GAAG;AACvF,mBAAe,oBAAoB,cAAc,QAAQ;AAAA,EAC3D;AACA,MAAI,gBAAgB,sBAAsB,YAAY,KAAK,mBAAmB,YAAY,KAAK,CAAC,kBAAkB,YAAY,GAAG;AAC/H,WAAO;AAAA,EACT;AACA,SAAO,gBAAgB,mBAAmB,OAAO,KAAK;AACxD;AAEA,IAAM,kBAAkB,eAAgB,MAAM;AAC5C,QAAM,oBAAoB,KAAK,mBAAmB;AAClD,QAAM,kBAAkB,KAAK;AAC7B,QAAM,qBAAqB,MAAM,gBAAgB,KAAK,QAAQ;AAC9D,SAAO;AAAA,IACL,WAAW,8BAA8B,KAAK,WAAW,MAAM,kBAAkB,KAAK,QAAQ,GAAG,KAAK,QAAQ;AAAA,IAC9G,UAAU;AAAA,MACR,GAAG;AAAA,MACH,GAAG;AAAA,MACH,OAAO,mBAAmB;AAAA,MAC1B,QAAQ,mBAAmB;AAAA,IAC7B;AAAA,EACF;AACF;AAEA,SAAS,MAAM,SAAS;AACtB,SAAO,iBAAiB,OAAO,EAAE,cAAc;AACjD;AAEA,IAAM,WAAW;AAAA,EACf;AAAA,EACA;AAAA,EACA;AAAA,EACA;AAAA,EACA;AAAA,EACA;AAAA,EACA;AAAA,EACA;AAAA,EACA;AAAA,EACA;AACF;AA8LA,IAAMG,UAAS;AAef,IAAMC,SAAQ;AAQd,IAAMC,QAAO;AAQb,IAAMC,QAAO;AAOb,IAAMC,QAAO;AAOb,IAAMC,SAAQ;AAkBd,IAAMC,mBAAkB,CAAC,WAAW,UAAU,YAAY;AAIxD,QAAMC,SAAQ,oBAAI,IAAI;AACtB,QAAM,gBAAgB;AAAA,IACpB;AAAA,KACG;AAEL,QAAM,oBAAoB,iCACrB,cAAc,WADO;AAAA,IAExB,IAAIA;AAAA,EACN;AACA,SAAO,gBAAkB,WAAW,UAAU,iCACzC,gBADyC;AAAA,IAE5C,UAAU;AAAA,EACZ,EAAC;AACH;;;AC5uBA,IAAM,YAAY;AAClB,IAAM,MAAM;AACZ,IAAM,UAAU;AAChB,IAAM,cAAc;AACpB,IAAM,QAAQ;AACd,IAAM,YAAY;AAClB,IAAM,eAAe;AACrB,IAAM,SAAS;AACf,IAAM,aAAa;AACnB,IAAM,aAAa;AACnB,IAAM,OAAO;AACb,IAAM,WAAW;AACV,IAAM,aAAa;AAAA,EACtB;AAAA,EACA;AAAA,EACA;AAAA,EACA;AAAA,EACA;AAAA,EACA;AAAA,EACA;AAAA,EACA;AAAA,EACA;AAAA,EACA;AAAA,EACA;AAAA,EACA;AACJ;AACO,IAAM,YAAY;AAAA,EACrB,CAAC,SAAS,GAAG;AAAA,EACb,CAAC,GAAG,GAAG;AAAA,EACP,CAAC,OAAO,GAAG;AAAA,EACX,CAAC,YAAY,GAAG;AAAA,EAChB,CAAC,MAAM,GAAG;AAAA,EACV,CAAC,UAAU,GAAG;AAAA,EACd,CAAC,UAAU,GAAG;AAAA,EACd,CAAC,IAAI,GAAG;AAAA,EACR,CAAC,QAAQ,GAAG;AAAA,EACZ,CAAC,WAAW,GAAG;AAAA,EACf,CAAC,KAAK,GAAG;AAAA,EACT,CAAC,SAAS,GAAG;AACjB;AACA,IAAM,WAAW;AAAA,EACb,CAAC,UAAU,GAAG;AAAA,EACd,CAAC,IAAI,GAAG;AAAA,EACR,CAAC,QAAQ,GAAG;AAAA,EACZ,CAAC,SAAS,GAAG;AAAA,EACb,CAAC,GAAG,GAAG;AAAA,EACP,CAAC,OAAO,GAAG;AAAA,EACX,CAAC,WAAW,GAAG;AAAA,EACf,CAAC,KAAK,GAAG;AAAA,EACT,CAAC,SAAS,GAAG;AAAA,EACb,CAAC,YAAY,GAAG;AAAA,EAChB,CAAC,MAAM,GAAG;AAAA,EACV,CAAC,UAAU,GAAG;AAClB;AACO,IAAM,0BAA0B,CAAC,QAAQ;AAC5C,MAAI;AACJ,MAAI,IAAI,KAAK,GAAG,GAAG;AACf,gBAAY,IACP,MAAM,GAAG,EACT,IAAI,CAACC,OAAMA,GAAE,OAAO,CAAC,EAAE,YAAY,IAAIA,GAAE,MAAM,CAAC,CAAC,EACjD,KAAK,EAAE;AAAA,EAChB,OACK;AACD,gBAAa,IAAI,OAAO,CAAC,EAAE,YAAY,IAAI,IAAI,MAAM,CAAC;AAAA,EAC1D;AACA,SAAO;AACX;AACA,IAAM,OAAO,CAAC,QAAQ,IAAI,MAAM,GAAG,EAAE,CAAC;AACtC,IAAM,aAAa,CAAC,QAAQ,UAAU,KAAK,GAAG,CAAC;AAC/C,IAAM,iBAAiB,CAAC,QAAQ,UAAU,GAAG;AAC7C,IAAM,gBAAgB,CAAC,QAAQ,SAAS,eAAe,GAAG,CAAC;AAC3D,IAAM,mBAAmB,CAAC,SAASC,gBAAe,QAAQ;AACtD,SAAO,OAAO,mCAAS,OAAO;AAAA,IAC1B,qBAAqB;AAAA,IACrB,QAAQ;AAAA;AAAA,IAER,CAAC,SAAS,wBAAwB,WAAW,GAAG,CAAC,CAAC,EAAE,GAAG;AAAA,IACvD,WAAW,UAAUA,cAAa;AAAA,EACtC,CAAC;AACL;AACA,IAAM,kBAAkB;AACxB,IAAM,eAAe;AACrB,eAAsB,aAAa,OAAO;AAnF1C;AAoFI,MAAI,EAAC,+BAAO;AACR;AACJ,MAAI,+BAAO,YAAY;AACnB,WAAM,+BAAO;AAAA,EACjB;AACA,MAAI,EAAC,+BAAO,aAAY,EAAC,+BAAO;AAC5B;AACJ,MAAI,WAAW,+BAAO;AACtB,QAAM,cAAc,MAAM;AAC1B,EAAAC,iBAAgB,UAAU,aAAa;AAAA,IACnC,YAAW,oCAAO,kBAAP,YAAwB;AAAA,IACnC,YAAY;AAAA,MACRC,QAAO,EAAE,WAAU,oCAAO,aAAP,YAAmB,GAAG,YAAW,oCAAO,aAAP,YAAmB,EAAE,CAAC;AAAA;AAAA,OAC1E,+BAAO,SACHC,MAAK;AAAA;AAAA,QAED,WAAW,+BAAO;AAAA;AAAA,QAClB,oBAAoB,+BAAO;AAAA,MAC/B,CAAC;AAAA,OACL,+BAAO,SAAQC,OAAM,EAAE,WAAW,KAAK,CAAC;AAAA;AAAA,MACxC,EAAC,+BAAO,aAAW,+BAAO,YAAWC,OAAM,EAAE,SAAS,+BAAO,QAAQ,CAAC;AAAA,MACtEC,MAAK;AAAA;AAAA,MACLC,MAAK;AAAA,QACD,QAAQ;AAEJ,iBAAO,OAAO,YAAY,OAAO;AAAA,YAC7B,cAAc,GAAG,eAAe;AAAA,YAChC,aAAa,GAAG,eAAe;AAAA,UACnC,CAAC;AAAA,QACL;AAAA,MACJ,CAAC;AAAA,IACL;AAAA,EACJ,CAAC,EAAE,KAAK,CAAC,EAAE,GAAG,GAAAC,IAAG,gBAAgB,UAAU,MAAM;AAC7C,UAAM,kBAAkB;AAGxB,QAAI,EAAC,+BAAO,YAAW;AACnB,aAAO,OAAO,YAAY,OAAO;AAAA,QAC7B,MAAM,GAAG,CAAC;AAAA,QACV,KAAK,GAAGA,EAAC;AAAA,MACb,CAAC;AAAA,IACL;AAEA,SAAI,iDAAgB,SAAQ,EAAC,+BAAO,YAAW;AAC3C,YAAM,EAAE,gBAAgB,IAAI,eAAe;AAC3C,aAAO,OAAO,YAAY,OAAO;AAAA,QAC7B,YAAY,kBAAkB,WAAW;AAAA,MAC7C,CAAC;AAAA,IACL;AAEA,SAAI,iDAAgB,WAAS,+BAAO,UAAS;AACzC,YAAM,UAAU,+BAAO;AACvB,YAAM,EAAE,GAAG,QAAQ,GAAG,OAAO,IAAI,eAAe;AAChD,YAAM,QAAQ,OAAO,iBAAiB,WAAW,EAAE,cAAc;AACjE,YAAM,iBAAiB,eAAe,SAAS,EAAE,MAAM,GAAG,EAAE,CAAC;AAC7D,UAAI,MAAM,IAAI,QAAQ,IAAI,SAAS,IAAI,OAAO;AAE9C,UAAI,mBAAmB,SAAS;AAC5B,cAAM,QAAQ,OAAO,WAAW,WAAW,QAAQ,YAAY,QAAQ,QAAQ,cAAc,CAAC,QAAQ;AACtG,cAAM,OAAO,WAAW,WAAW,QAAQ,YAAY,QAAQ,QAAQ,cAAc,CAAC,QAAQ;AAC9F,gBAAQ,QAAQ,QAAQ;AACxB,eAAO,QAAQ,KAAK;AAAA,MACxB,WACS,mBAAmB,OAAO;AAC/B,cAAM,QAAQ,OAAO,WAAW,WAAW,QAAQ,YAAY,QAAQ,QAAQ,cAAc,CAAC,QAAQ;AACtG,gBAAQ,QAAQ,KAAK;AACrB,eAAO,QAAQ,QAAQ;AACvB,iBAAS,OAAO,WAAW,WAAW,QAAQ,YAAY,QAAQ,QAAQ,cAAc,CAAC,QAAQ;AAAA,MACrG,OACK;AAED,eAAO,OAAO,WAAW,WAAW,GAAG,MAAM,OAAO;AACpD,cAAM,OAAO,WAAW,WAAW,GAAG,MAAM,OAAO;AAAA,MACvD;AAEA,aAAO,OAAO,QAAQ,OAAO;AAAA,QACzB;AAAA,QACA;AAAA,QACA;AAAA,QACA;AAAA,MACJ,CAAC;AAED,uBAAiB,SAAS,cAAc,SAAS,GAAG,SAAS;AAAA,IACjE;AAAA,EACJ,CAAC;AACD,SAAO;AACX;;;ALpKA,OAAOC,kBAAiB;AACxB,SAAS,aAAAC,kBAAiB;;;AMLnB,IAAMC,oBAAmB,CAAC,MAAM,MAAM,MAAM,MAAM,IAAI;AAGtD,IAAMC,iBAAgB;AAEtB,IAAMC,sBAAqB,CAAC,eAAuB;AACxD,SACEF,kBAAiB;AAAA,IACf,CAAC,WACC,eAAe,UAAU,WAAW,YAAY,EAAE,SAAS,MAAM;AAAA,EACrE,KAAKC;AAET;AAEO,SAASE,gBAAgC;AAC9C,MAAI,OAAO,WAAW,aAAa;AAIjC,UAAM,eACJ,QAAQ,IAAI,gBACZ,KAAK,eAAe,EAAE,gBAAgB,EAAE;AAC1C,WAAOD,oBAAmB,YAAY;AAAA,EACxC;AAEA,MAAI;AAIF,UAAM,aAAa,SAAS,gBAAgB;AAC5C,WAAOA,oBAAmB,UAAU;AAAA,EACtC,SAAS,GAAG;AACV,YAAQ,KAAK,0DAA0D,CAAC;AACxE,WAAOD;AAAA,EACT;AACF;AAEO,IAAMG,eAAc,CACzB,QACA,OACA,OACA,OACA,OACA,UACG;AACH,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAE5B,SAAO;AACT;AAEO,IAAMC,gBAAe,CAC1B,YACA,YACA,YACA,YACA,eACG;AACH,QAAM,SAASF,cAAa;AAC5B,QAAMG,aAAWF,aAAY,QAAQ,YAAY,YAAY,YAAY,YAAY,UAAU;AAC/F,OAAK,KAAK,QAAQE,UAAQ;AAC1B,OAAK,SAAS,MAAM;AACtB;;;AClEyB,IAAMC,aAAS,KAAK,MAAM,uhBAAkjB;;;ACA5kB,IAAMC,aAAS,KAAK,MAAM,+iBAAmlB;;;ACA7mB,IAAMC,aAAS,KAAK,MAAM,8jBAA2jB;;;ACArlB,IAAMC,aAAS,KAAK,MAAM,4gBAA0iB;;;ACApkB,IAAMC,aAAS,KAAK,MAAM,2hBAAgjB;;;AXoBnmB,IAAM,gBAAN,cAA4B,oBAAoBC,YAAW,EAAE;AAAA,EA+C3D,cAAc;AACZ,UAAM;AACN,IAAAC,cAAaC,YAAYA,YAAYA,YAAYA,YAAYA,UAAU;AAEvE,SAAK,aAAa,KAAK,WAAW,KAAK,IAAI;AAE3C,SAAK,OAAO;AACZ,SAAK,YAAY;AACjB,SAAK,UAAU;AACf,SAAK,UAAU;AACf,SAAK,UAAU;AACf,SAAK,YAAY;AACjB,SAAK,WAAW;AAChB,SAAK,UAAU;AACf,SAAK,WAAW;AAChB,SAAK,WAAW;AAChB,SAAK,OAAO;AACZ,SAAK,YAAY;AACjB,SAAK,oBAAoB,KAAK;AAC9B,SAAK,mBAAmB,KAAK;AAAA,EAC/B;AAAA,EAEA,oBAAoB;AAClB,UAAM,kBAAkB;AACxB,QAAI,KAAK,aAAa,CAAC,OAAO,KAAK,SAAS,EAAE,SAAS,KAAK,SAAS,GAAG;AACtE,YAAM,IAAI,MAAM;AAAA,EAA0E,KAAK,UAAU,OAAO,KAAK,SAAS,CAAC,CAAC,EAAE;AAAA,IACpI;AAEA,QAAI,KAAK,sBAAsB,CAAC,KAAK,mBAAmB,MAAM,CAAC,sBAAsB,WAAW,SAAS,iBAAiB,CAAC,GAAG;AAC5H,YAAM,IAAI;AAAA,QACR;AAAA,EAAyG,KAAK,UAAU,UAAU,CAAC;AAAA,MACrI;AAAA,IACF;AAGA,eAAW,MAAM;AACf,WAAK,cAAc;AACnB,WAAK,WAAW;AAAA,IAClB,GAAG,CAAC;AAEJ,QAAI,CAAC,KAAK,SAAS;AACjB,aAAO,iBAAiB,SAAS,KAAK,UAAU;AAChD,aAAO,iBAAiB,UAAU,KAAK,UAAU;AACjD,aAAO,iBAAiB,UAAU,KAAK,UAAU;AACjD,aAAO,iBAAiB,SAAS,KAAK,UAAU;AAAA,IAClD;AAEA,QAAI,KAAK,SAAS;AAChB,aAAO,iBAAiB,aAAa,KAAK,UAAU;AACpD,aAAO,iBAAiB,YAAY,KAAK,UAAU;AAAA,IACrD;AAAA,EACF;AAAA,EAEA,uBAAuB;AACrB,WAAO,oBAAoB,SAAS,KAAK,UAAU;AACnD,WAAO,oBAAoB,UAAU,KAAK,UAAU;AACpD,WAAO,oBAAoB,UAAU,KAAK,UAAU;AACpD,WAAO,oBAAoB,SAAS,KAAK,UAAU;AACnD,WAAO,oBAAoB,aAAa,KAAK,UAAU;AACvD,WAAO,oBAAoB,YAAY,KAAK,UAAU;AAEtD,UAAM,qBAAqB;AAAA,EAC7B;AAAA,EAEA,aAAa;AACX,WAAO,sBAAsB,MAAM;AACjC,UAAI,KAAK,QAAQ,KAAK,aAAa,KAAK,cAAc;AACpD,qBAAU,KAAK,cAAc,EAAE,KAAK,CAAC,UAAU;AAC7C,eAAK,mBAAmB,+BAAO;AAAA,QACjC,CAAC;AAAA,MACH,OAAO;AACL,aAAK,mBAAmB,KAAK;AAAA,MAC/B;AAAA,IACF,CAAC;AAAA,EACH;AAAA,EAEA,IAAI,mBAAmB;AACrB,WAAO,KAAK;AAAA,EACd;AAAA,EAEA,IAAI,iBAAiB,GAAG;AACtB,SAAK,YAAY;AAAA,EACnB;AAAA,EAEA,IAAI,WAAW;AACb,WAAO,KAAK,WAAW,cAAc,QAAQ;AAAA,EAC/C;AAAA,EAEA,IAAI,kBAAkB;AACpB,WAAO,UAAU,KAAK,gBAAgB;AAAA,EACxC;AAAA,EAEA,IAAI,gBAAgB;AAClB,WAAO,EAAW;AAAA,MAChB,UAAY;AAAA,MACZ,KAAK,sBAAsB;AAAA,MAC3B,UAAY,iBAAiB,wBAAwB,KAAK,eAAe,CAAC,EAAE;AAAA,IAC9E,CAAC;AAAA,EACH;AAAA,EAEA,IAAI,aAAa;AACf,WAAO,KAAK,UAAU,KAAKC,+BAA8B,KAAK,aAAa;AAAA,EAC7E;AAAA,EAEA,IAAI,wBAAwB;AAC1B,UAAM,eAAe;AAAA,MACnB,SAAS,KAAK;AAAA,MACd,SAAS,KAAK;AAAA,MACd,SAAS,KAAK;AAAA,MACd,WAAW,KAAK;AAAA,IAClB;AAEA,UAAM,gBAAgB,OAAO,KAAK,YAAY,EAAE,KAAK,CAACC,OAAM,CAAC,CAAC,aAAaA,EAAC,CAAC,KAAK;AAElF,WAAO;AAAA,MACL,SAAS,UAAY,aAAa;AAAA,MAClC,OAAO,UAAY,QAAQ,cAAc,OAAO,CAAC,EAAE,YAAY,IAAI,cAAc,MAAM,CAAC,CAAC,EAAE;AAAA,IAC7F;AAAA,EACF;AAAA,EAEA,IAAI,eAAe;AACjB,WAAO,KAAK,WAAW,cAAc,YAAY;AAAA,EACnD;AAAA,EAEA,IAAI,YAAY;AA/LlB;AAgMI,UAAM,cAAa,UAAK,eAAL,mBAAiB,cAAc;AAClD,WAAO,aAAa,WAAW,cAAc,EAAE,CAAC,IAAI;AAAA,EACtD;AAAA,EAEA,IAAI,aAAa;AACf,UAAM,cAAc,KAAK,WAAW,cAAc,sBAAsB;AACxE,WAAO,cAAc,YAAY,cAAc,EAAE,CAAC,IAAI;AAAA,EACxD;AAAA,EAEA,IAAI,kBAAkB;AACpB,WAAO,EAAW,CAAC,UAAY,MAAM,KAAK,sBAAsB,OAAO,CAAC;AAAA,EAC1E;AAAA,EAEA,IAAI,aAAa;AACf,WAAO,KAAK,EAAE;AAAA,MACZ,IAAI;AAAA,MACJ,SAAS;AAAA,MACT,SAAS;AAAA,IACX,CAAC;AAAA,EACH;AAAA,EAEA,IAAI,gBAAgB;AAClB,WAAOD;AAAA,4BACiB,KAAK,UAAU,aAAa,KAAK,KAAK,cAAc,KAAK,UAAU,WAAW,UAAY,QAAQ;AAAA;AAAA;AAAA;AAAA,EAI5H;AAAA,EAEA,UAAU;AACR,QAAI,CAAC,KAAK,SAAS;AACjB,WAAK,aAAa,MAAM,YAAY,0BAA0B,KAAK,OAAO,KAAK,QAAQ;AAAA,IACzF;AAEA,QAAI,CAAC,KAAK,SAAS;AACjB,WAAK,aAAa,MAAM,YAAY,uBAAuB,KAAK,OAAO,SAAS,MAAM;AAAA,IACxF;AAEA,SAAK,iBAAiB;AAAA,MACpB,WAAW,KAAK;AAAA,MAChB,WAAW,KAAK;AAAA,MAChB,iBAAiB,KAAK;AAAA,MACtB,eAAe,KAAK;AAAA,MACpB,SAAS,KAAK;AAAA,MACd,aAAa,KAAK;AAAA,MAClB,UAAU,KAAK;AAAA,MACf,SAAS,KAAK;AAAA,MACd,UAAU,KAAK;AAAA,MACf,UAAU,KAAK;AAAA,MACf,MAAM,KAAK;AAAA,MACX,WAAW,KAAK;AAAA,MAChB,oBAAoB,KAAK;AAAA,IAC3B;AAIA,iBAAU,KAAK,cAAc;AAAA,EAC/B;AAAA,EAEA,sBAAsB;AACpB,YAAQ,UAAU,KAAK,gBAAgB,GAAG;AAAA,MACxC,KAAK;AAAA,MACL,KAAK;AAAA,MACL,KAAK;AACH,eAAO,KAAK,EAAE;AAAA,UACZ,IAAI;AAAA,UACJ,SAAS;AAAA,UACT,SAAS;AAAA,QACX,CAAC;AAAA,MACH,KAAK;AAAA,MACL,KAAK;AAAA,MACL,KAAK;AACH,eAAO,KAAK,EAAE;AAAA,UACZ,IAAI;AAAA,UACJ,SAAS;AAAA,UACT,SAAS;AAAA,QACX,CAAC;AAAA,MACH,KAAK;AAAA,MACL,KAAK;AAAA,MACL,KAAK;AACH,eAAO,KAAK,EAAE;AAAA,UACZ,IAAI;AAAA,UACJ,SAAS;AAAA,UACT,SAAS;AAAA,QACX,CAAC;AAAA,MACH,KAAK;AAAA,MACL,KAAK;AAAA,MACL,KAAK;AACH,eAAO,KAAK,EAAE;AAAA,UACZ,IAAI;AAAA,UACJ,SAAS;AAAA,UACT,SAAS;AAAA,QACX,CAAC;AAAA,MACH;AACE,eAAO;AAAA,IACX;AAAA,EACF;AAAA,EAEA,sBAAsB;AACpB,YAAQ,MAAM;AAAA,MACZ,KAAK,KAAK;AACR,eAAO,KAAK,EAAE;AAAA,UACZ,IAAI;AAAA,UACJ,SAAS;AAAA,UACT,SAAS;AAAA,QACX,CAAC;AAAA,MACH,KAAK,KAAK;AACR,eAAO,KAAK,EAAE;AAAA,UACZ,IAAI;AAAA,UACJ,SAAS;AAAA,UACT,SAAS;AAAA,QACX,CAAC;AAAA,MACH,KAAK,KAAK;AACR,eAAO,KAAK,EAAE;AAAA,UACZ,IAAI;AAAA,UACJ,SAAS;AAAA,UACT,SAAS;AAAA,QACX,CAAC;AAAA,MACH,KAAK,KAAK;AACR,eAAO,KAAK,EAAE;AAAA,UACZ,IAAI;AAAA,UACJ,SAAS;AAAA,UACT,SAAS;AAAA,QACX,CAAC;AAAA,MACH;AACE,eAAO;AAAA,IACX;AAAA,EACF;AAAA,EAEA,mBAAmB;AACjB,WAAO,GAAG,KAAK,oBAAoB,CAAC,IAAI,CAAC,KAAK,UAAU,KAAK,oBAAoB,IAAI,EAAE;AAAA,EACzF;AAAA,EACA,gBAAgB;AACd,QAAI,KAAK,aAAa,CAAC,KAAK,UAAU,aAAa,cAAc,GAAG;AAClE,YAAM,qBAAqB,KAAK,WAAW,OAAO,KAAK,WAAW,KAAK,iBAAiB;AACxF,WAAK,UAAU,aAAa,gBAAgB,kBAAkB;AAAA,IAChE;AAAA,EACF;AAAA,EAEA,eAAe;AACb,SAAK,oBAAoB,KAAK;AAC9B,SAAK,cAAc;AAGnB,QAAI,KAAK,SAAS;AAChB,WAAK,aAAa,MAAM,WAAW;AAAA,IACrC;AAAA,EACF;AAAA,EAEA,QAAQ;AACN,UAAM,QAAQ,IAAI,YAAY,SAAS;AAAA,MACrC,SAAS;AAAA,MACT,UAAU;AAAA,IACZ,CAAC;AACD,SAAK,eAAe,KAAK,MAAM,KAAK,cAAc,KAAK,CAAC;AAAA,EAC1D;AAAA,EAEA,WAAW,GAAG;AACZ,QAAI,CAAC,KAAK,SAAU;AACpB,QAAI,EAAE,QAAQ,UAAU;AACtB,QAAE,eAAe;AACjB,WAAK,MAAM;AAAA,IACb;AAAA,EACF;AAAA,EAEA,SAAS;AACP,QAAI,CAAC,KAAK,WAAW,KAAK,cAAc,OAAW,QAAOA;AAC1D,WAAOA;AAAA,mBACQE,WAAU,KAAK,YAAY,KAAK,YAAY,MAAS,CAAC;AAAA,UAC/D,KAAK,cAAc,iBACrB,KAAK,cAAc,WACnB,KAAK,cAAc,eACnB,KAAK,cAAc,kBACnB,KAAK,cAAc,YACnB,KAAK,cAAc,eACfF;AAAA;AAAA;AAAA,2CAG+B,KAAK,eAAe;AAAA,6BAClC,KAAK,UAAU,YAAY,KAAK,iBAAiB,KAAK,iBAAiB,CAAC,KAAK,KAAK,UAAU;AAAA;AAAA,kBAEvG,KAAK,WAAW,KAAK,gBAAgB,OAAO;AAAA;AAAA,gBAGlDA;AAAA,2CAC+B,KAAK,eAAe;AAAA;AAAA,6BAElC,KAAK,UAAU,YAAY,KAAK,iBAAiB,KAAK,iBAAiB,CAAC,KAAK,KAAK,UAAU;AAAA,kBACvG,KAAK,WAAW,KAAK,gBAAgB,OAAO;AAAA;AAAA;AAAA,aAGjD;AAAA;AAAA;AAAA,EAGX;AACF;AA9WE,cADI,eACG,cAAa;AAAA;AAAA,EAElB,MAAM,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA;AAAA;AAAA,EAGrC,WAAW,EAAE,MAAM,QAAQ,SAAS,KAAK;AAAA;AAAA,EAEzC,SAAS,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA;AAAA,EAExC,SAAS,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA;AAAA,EAExC,SAAS,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA;AAAA,EAExC,WAAW,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA;AAAA,EAE1C,UAAU,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA;AAAA,EAEzC,SAAS,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA;AAAA,EAExC,UAAU,EAAE,MAAM,QAAQ,SAAS,KAAK;AAAA;AAAA,EAExC,UAAU,EAAE,MAAM,QAAQ,SAAS,KAAK;AAAA;AAAA,EAExC,MAAM,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA;AAAA,EAErC,WAAW,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA;AAAA,EAE1C,oBAAoB,EAAE,MAAM,OAAO,SAAS,KAAK;AACnD;AAEA,cA/BI,eA+BG,UAAS;AAAA,EACdH,aAAY;AAAA,EACZM;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAYF;AAoUF,IAAI,CAAC,eAAe,IAAI,aAAa,GAAG;AACtC,iBAAe,OAAO,eAAe,aAAa;AACpD;;;AYvYA,SAAS,QAAAC,cAAY;AAIrB,OAAOC,kBAAiB;AAExB,IAAM,YAAN,cAAwBC,aAAY;AAAA,EAYlC,cAAc;AACZ,UAAM;AAEN,SAAK,UAAU;AAAA,EACjB;AAAA,EAEA,IAAI,SAAS;AACX,WAAO,EAAW;AAAA,MAChB,MAAQ;AAAA,MACR,MAAQ,KAAK,OAAO;AAAA,MACpB,CAAC,CAAC,KAAK,YAAY,MAAQ;AAAA,MAC3B,KAAK,aAAa,cAAc,MAAQ;AAAA,MACxC,KAAK,aAAa,eAAe,MAAQ;AAAA,MACzC,KAAK,aAAa,kBAAkB,MAAQ;AAAA,MAC5C,KAAK,aAAa,iBAAiB,MAAQ;AAAA,IAC7C,CAAC;AAAA,EACH;AAAA,EAEA,SAAS;AACP,WAAOC;AAAA,oBACS,KAAK,MAAM;AAAA;AAAA;AAAA;AAAA,EAI7B;AACF;AApCE,cADI,WACG,cAAa;AAAA,EAClB,SAAS;AAAA,IACP,MAAM,YAAY,SAAS,aAAa,YAAY,aAAa,aAAa;AAAA,EAChF;AAAA,EACA,UAAU;AAAA,IACR,MAAM,aAAa,cAAc,iBAAiB;AAAA,EACpD;AACF;AAEA,cAVI,WAUG,UAAS,CAACD,aAAY,MAAM;AA6BrC,IAAI,CAAC,eAAe,IAAI,SAAS,GAAG;AAClC,iBAAe,OAAO,WAAW,SAAS;AAC5C;;;AC/CA,SAAS,OAAAE,MAAK,QAAAC,QAAM,WAAAC,gBAAe;AAInC,OAAOC,kBAAiB;AAExB,IAAM,UAAN,cAAsBC,aAAY;AAAA,EAyBhC,IAAI,SAAS;AACX,WAAO,EAAW;AAAA,MAChB,IAAM;AAAA,MACN,KAAK,SAAS,IAAM;AAAA,MACpB,KAAK,QAAQ,IAAM;AAAA,MACnB,KAAK,WAAW,IAAM;AAAA,MACtB,KAAK,YAAY,IAAM;AAAA,IACzB,CAAC;AAAA,EACH;AAAA,EAEA,IAAI,yBAAyB;AAzC/B;AA0CI,WAAO,KAAK,SAAS,KAAKC,YAAU,UAAK,SAAL,YAAa;AAAA,EACnD;AAAA,EAEA,SAAS;AACP,WAAOC;AAAA,mBACQ,KAAK,sBAAsB,YAAY,KAAK,MAAM;AAAA;AAAA;AAAA;AAAA,EAInE;AACF;AA7CE,cADI,SACG,cAAa;AAAA,EAClB,OAAO,EAAE,MAAM,QAAQ;AAAA,EACvB,UAAU,EAAE,MAAM,QAAQ;AAAA,EAC1B,MAAM,EAAE,MAAM,QAAQ;AAAA,EACtB,SAAS,EAAE,MAAM,QAAQ;AAAA,EACzB,MAAM,EAAE,MAAM,OAAO;AACvB;AAAA;AAAA;AAAA;AAAA;AAMA,cAbI,SAaG,UAAS;AAAA,EACdF,aAAY;AAAA,EACZG;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAQF;AAyBF,IAAI,CAAC,eAAe,IAAI,OAAO,GAAG;AAChC,iBAAe,OAAO,SAAS,OAAO;AACxC;;;ACxDA,SAAS,QAAAC,cAAY;;;ACMd,SAAS,WAAW,OAAOC,YAAW;AACzC,SAAO,MAAM,QAAQ,CAAC,OAAO,CAAC,IAAIA,UAAS,CAAC,EAAE,MAAM,GAAG,EAAE;AAC7D;;;ADHA,OAAOC,kBAAiB;;;AELC,IAAMC,aAAS,KAAK,MAAM,yCAA6C;;;ACAvE,IAAMC,aAAS,KAAK,MAAM,4CAAgD;;;ACA1E,IAAMC,aAAS,KAAK,MAAM,gDAA8C;;;ACAxE,IAAMC,aAAS,KAAK,MAAM,yCAA6C;;;ACAvE,IAAMC,aAAS,KAAK,MAAM,+CAA6C;;;ANgBhG,IAAM,YAAYC,qBAAmB,YAAc,SAAS;AAE5D,IAAM,kBAAN,cAA8B,oBAAoBC,YAAW,EAAE;AAAA,EAO7D,cAAc;AACZ,UAAM;AACN,IAAAC,cAAaC,YAAYA,YAAYA,YAAYA,YAAYA,UAAU;AAEvE,SAAK,YAAY,KAAK,EAAE;AAAA,MACtB,IAAI;AAAA,MACJ,SAAS;AAAA,MACT,SAAS;AAAA,IACX,CAAC;AAAA,EACH;AAAA,EAEA,oBAAoB;AAClB,UAAM,kBAAkB;AAExB,UAAM,oBAAoB,MAAM,KAAK,KAAK,QAAQ,EAC/C,KAAK,QAAQ,EACb,OAAO,CAAC,UAAU,KAAK;AAC1B,UAAM,iBAAiB,kBAAkB,IAAI,CAAC,OAAO,UAAU;AAC7D,UAAI,OAAO,UAAU,UAAU;AAC7B,cAAM,WAAW,UAAU,SAAS,SAAS;AAC7C,eAAOH,qBAAmB,YAAc,IAAI,iBAAiB,WAAW,SAAS,MAAS,IAAI,KAAK;AAAA,MACrG;AACA,YAAM,UAAU,IAAI,MAAM,YAAY,MAAM,YAAc,OAAO,YAAc,IAAI;AACnF,aAAO;AAAA,IACT,CAAC;AAGD,SAAK,YAAY,WAAW,gBAAgB,SAAS;AAAA,EACvD;AAAA,EAEA,SAAS;AACP,WAAOA;AAAA;AAAA,yCAE8B,YAAc,IAAI,IAAI,KAAK,SAAS;AAAA,qBACxD,YAAc,OAAO,IAAI,KAAK,SAAS;AAAA;AAAA;AAAA,EAG1D;AACF;AA5CE,cADI,iBACG,UAAS,CAACC,aAAY,MAAM;AAEnC,cAHI,iBAGG,cAAa;AAAA,EAClB,WAAW,EAAE,MAAM,OAAO;AAC5B;AA0CF,IAAI,CAAC,eAAe,IAAI,eAAe,GAAG;AACxC,iBAAe,OAAO,iBAAiB,eAAe;AACxD;;;AOnEA,SAAS,QAAAG,cAAY;AAKrB,OAAOC,kBAAiB;;;ACLC,IAAMC,aAAS,KAAK,MAAM,4CAA6C;;;ACAvE,IAAMC,aAAS,KAAK,MAAM,wCAA4C;;;ACAtE,IAAMC,aAAS,KAAK,MAAM,yCAA6C;;;ACAvE,IAAMC,aAAS,KAAK,MAAM,uCAA2C;;;ACArE,IAAMC,aAAS,KAAK,MAAM,wCAA4C;;;ALgB/F,IAAMC,eAAc,CAAC,WAAW,aAAa,YAAY,WAAW,QAAQ,MAAM;AAElF,IAAM,aAAN,cAAyB,oBAAoBC,YAAW,EAAE;AAAA,EAsBxD,cAAc;AACZ,UAAM;AACN,IAAAC,cAAaC,YAAYA,YAAYA,YAAYA,YAAYA,UAAU;AAEvE,SAAK,UAAU;AACf,SAAK,uBAAuB,KAAK,EAAE;AAAA,MACjC,IAAI;AAAA,MACJ,SAAS;AAAA,MACT,SAAS;AAAA,IACX,CAAC;AAAA,EACH;AAAA,EAEA,oBAAoB;AAClB,UAAM,kBAAkB;AAExB,QAAI,CAACH,aAAY,SAAS,KAAK,OAAO,GAAG;AACvC,YAAM,IAAI,MAAM;AAAA,EAAwEA,aAAY,KAAK,IAAI,CAAC,GAAG;AAAA,IACnH;AAAA,EACF;AAAA,EAEA,eAAe;AACb,QAAI,KAAK,WAAW;AAClB,iBAAW,MAAM,KAAK,MAAM,GAAG,CAAC;AAAA,IAClC;AAAA,EACF;AAAA,EAEA,IAAI,kBAAkB;AACpB,WAAO;AAAA,MACL,CAAC,KAAK,SAAS,CAAC,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACxD,KAAK,SAAS,CAAC,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACvD,KAAK,SAAS,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACtD,KAAK,SAAS,KAAK,YAAY,KAAK,QAAQ,OAAS,2BAA2B,OAAS;AAAA,MACzF,CAAC,KAAK,SAAS,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACvD,CAAC,KAAK,SAAS,KAAK,YAAY,KAAK,QAAQ,OAAS,sBAAsB,OAAS;AAAA,IACvF;AAAA,EACF;AAAA,EAEA,IAAI,oBAAoB;AACtB,WAAO;AAAA,MACL,CAAC,KAAK,SAAS,CAAC,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACxD,KAAK,SAAS,CAAC,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACvD,KAAK,SAAS,KAAK,YAAY,KAAK,QAAQ,OAAS,6BAA6B,OAAS;AAAA,MAC3F,KAAK,SAAS,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACtD,CAAC,KAAK,SAAS,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACvD,CAAC,KAAK,SAAS,KAAK,YAAY,KAAK,QAAQ,OAAS,wBAAwB,OAAS;AAAA,IACzF;AAAA,EACF;AAAA,EAEA,IAAI,kBAAkB;AACpB,WAAO;AAAA,MACL,CAAC,KAAK,SAAS,CAAC,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACxD,KAAK,SAAS,CAAC,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACvD,KAAK,SAAS,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACtD,KAAK,SAAS,KAAK,YAAY,KAAK,QAAQ,OAAS,2BAA2B,OAAS;AAAA,MACzF,CAAC,KAAK,SAAS,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACvD,CAAC,KAAK,SAAS,KAAK,YAAY,KAAK,QAAQ,OAAS,sBAAsB,OAAS;AAAA,IACvF;AAAA,EACF;AAAA,EAEA,IAAI,mBAAmB;AACrB,WAAO;AAAA,MACL,CAAC,KAAK,SAAS,CAAC,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACxD,KAAK,SAAS,CAAC,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACvD,KAAK,SAAS,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACtD,KAAK,SAAS,KAAK,YAAY,KAAK,QAAQ,OAAS,4BAA4B,OAAS;AAAA,MAC1F,CAAC,KAAK,SAAS,KAAK,SAAS,CAAC,KAAK,WAAW,OAAS;AAAA,MACvD,CAAC,KAAK,SAAS,KAAK,YAAY,KAAK,QAAQ,OAAS,uBAAuB,OAAS;AAAA,IACxF;AAAA,EACF;AAAA,EAEA,IAAI,eAAe;AACjB,WAAO;AAAA,MACL,CAAC,KAAK,YAAY,KAAK,QAAQ,OAAS,YAAY,OAAS;AAAA,MAC7D,KAAK,YAAY,KAAK,QAAQ,OAAS,mBAAmB,OAAS;AAAA,IACrE;AAAA,EACF;AAAA,EAEA,IAAI,eAAe;AACjB,WAAO,CAAC,KAAK,QAAQ,OAAS,YAAY,OAAS,IAAI;AAAA,EACzD;AAAA,EACA,IAAI,WAAW;AACb,WAAO,EAAW,KAAK,aAAa;AAAA,MAClC,KAAK,YAAY,aAAa,KAAK;AAAA,MACnC,KAAK,YAAY,eAAe,KAAK;AAAA,MACrC,KAAK,YAAY,aAAa,KAAK;AAAA,MACnC,KAAK,YAAY,cAAc,KAAK;AAAA,MACpC,KAAK,YAAY,UAAU,KAAK;AAAA,MAChC,KAAK,YAAY,UAAU,KAAK;AAAA,MAChC,KAAK,QAAQ,OAAS;AAAA,MACtB,KAAK,YAAY,OAAS,YAAY,OAAS;AAAA,IACjD,CAAC;AAAA,EACH;AAAA,EAEA,SAAS;AACP,WAAOI,UAAQ,KAAK,OAChBA;AAAA,iBACS,KAAK,IAAI;AAAA,mBACP,KAAK,MAAM;AAAA,gBACd,KAAK,WAAW,WAAW,KAAK,OAAO,aAAa,MAAS;AAAA,kBAC3D,KAAK,QAAQ;AAAA;AAAA,gBAGvBA,sBAAoB,KAAK,QAAQ,QAAQ,UAAU,KAAK,QAAQ;AAAA;AAAA,kBAEtD;AAAA,MACZ,KAAK,UACHA,qFAAmF,KAAK,oBAAoB,aAC5G,IAAI;AAAA,EACV;AACF;AAlIE,cADI,YACG,qBAAoB,iCACtBH,aAAY,oBADU;AAAA,EAEzB,gBAAgB;AAClB;AAEA,cANI,YAMG,cAAa;AAAA,EAClB,MAAM,EAAE,MAAM,WAAW,WAAW,SAAS,SAAS,KAAK;AAAA,EAC3D,WAAW,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA,EAC1C,SAAS,EAAE,MAAM,QAAQ,SAAS,KAAK;AAAA,EACvC,OAAO,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA,EACtC,OAAO,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA,EACtC,SAAS,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA,EACxC,MAAM,EAAE,MAAM,QAAQ,SAAS,KAAK;AAAA,EACpC,QAAQ,EAAE,MAAM,QAAQ,SAAS,KAAK;AAAA,EACtC,KAAK,EAAE,MAAM,QAAQ,SAAS,KAAK;AAAA,EACnC,WAAW,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA,EAC1C,aAAa,EAAE,MAAM,QAAQ,SAAS,KAAK;AAC7C;AAEA,cApBI,YAoBG,UAAS,CAACA,aAAY,MAAM;AAiHrC,IAAI,CAAC,eAAe,IAAI,UAAU,GAAG;AACnC,iBAAe,OAAO,YAAY,UAAU;AAC9C;;;AMzJA,SAAS,QAAAI,QAAM,OAAAC,YAAW;AAK1B,OAAOC,kBAAiB;AACxB,SAAS,aAAAC,kBAAiB;;;ACND,IAAMC,aAAS,KAAK,MAAM,kCAAmC;;;ACA7D,IAAMC,aAAS,KAAK,MAAM,iCAAqC;;;ACA/D,IAAMC,aAAS,KAAK,MAAM,kCAAsC;;;ACAhE,IAAMC,aAAS,KAAK,MAAM,+BAAmC;;;ACA7D,IAAMC,aAAS,KAAK,MAAM,kCAAmC;;;ALgBtF,IAAM,OAAO;AAAA,EACX,OAAO;AAAA,EACP,OAAO;AACT;AAEA,IAAM,WAAN,cAAuBC,aAAY;AAAA,EAOjC,cAAc;AACZ,UAAM;AACN,IAAAC,cAAaC,YAAYA,YAAYA,YAAYA,YAAYA,UAAU;AAEvE,SAAK,WAAW;AAChB,SAAK,OAAO;AACZ,SAAK,YAAY;AACjB,SAAK,aAAa,KAAK,EAAE;AAAA,MACvB,IAAI;AAAA,MACJ,SAAS;AAAA,MACT,SAAS;AAAA,IACX,CAAC;AAAA,EACH;AAAA,EAmBA,IAAI,oBAAoB;AACtB,WAAO,EAAW;AAAA,MAChB,KAAO;AAAA,MACP,KAAK,OAAO,KAAO,OAAO,KAAO;AAAA,MACjC,KAAK,YAAY,CAAC,KAAK,QAAQ,KAAO;AAAA,MACtC,KAAK,YAAY,KAAK,OAAO,KAAO,eAAe,KAAO;AAAA,IAC5D,CAAC;AAAA,EACH;AAAA,EAEA,IAAI,kBAAkB;AACpB,WAAO,EAAW,CAAC,KAAO,SAAS,KAAK,WAAW,KAAO,kBAAkB,KAAO,iBAAiB,CAAC;AAAA,EACvG;AAAA,EAEA,IAAI,sBAAsB;AACxB,UAAM,eAAe,MACnBC,wBAAsB,KAAO,IAAI,mBAAmB,KAAK,QAAQ,mBAAmB,KAAK,UAAU;AACrG,UAAM,aAAa,MAAMA;AAEzB,WAAO,KAAK,YAAY,aAAa,IAAI,KAAK,WAAW,WAAW,IAAI;AAAA,EAC1E;AAAA,EAEA,WAAW,GAAG;AACZ,QAAI,CAAC,KAAK,aAAa,EAAE,UAAU,EAAE,QAAS;AAC9C,QAAI,EAAE,QAAQ,KAAK,SAAS,EAAE,QAAQ,KAAK,OAAO;AAChD,QAAE,eAAe;AACjB,WAAK,MAAM;AAAA,IACb;AAAA,EACF;AAAA,EAEA,SAAS;AACP,WAAOA;AAAA,sBACWC,WAAU,KAAK,YAAY,MAAM,MAAS,CAAC,WAAW,KAAK,iBAAiB,cAAc,KAAK,UAAU;AAAA,UACrH,KAAK,mBAAmB,IAAI,KAAK,OAAO,KAAKD,qBAAmB,KAAK,eAAe,UAAU;AAAA;AAAA;AAAA;AAAA,EAItG;AACF;AA1EE,cADI,UACG,cAAa;AAAA,EAClB,UAAU,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA,EACzC,MAAM,EAAE,MAAM,QAAQ;AAAA,EACtB,WAAW,EAAE,MAAM,QAAQ;AAC7B;AAgBA,cArBI,UAqBG,UAAS;AAAA,EACdH,aAAY;AAAA,EACZK;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAaF;AAyCF,IAAI,CAAC,eAAe,IAAI,QAAQ,GAAG;AACjC,iBAAe,OAAO,UAAU,QAAQ;AAC1C;;;AMpGA,SAAS,OAAAC,MAAK,QAAAC,cAAY;AAI1B,OAAOC,kBAAiB;AACxB,SAAS,aAAAC,kBAAiB;;;ACL1B,SAAS,cAAAC,mBAAkB;AAC3B,SAAS,gBAAAC,eAAc,QAAAC,cAAY;ACDV,IAAMC,aAAS,KAAK,MAAM,4CAAgD;ACA1E,IAAMA,cAAS,KAAK,MAAM,gDAAoD;ACA9E,IAAMA,cAAS,KAAK,MAAM,mDAAoD;ACA9E,IAAMA,aAAS,KAAK,MAAM,2CAA+C;ACAzE,IAAMA,aAAS,KAAK,MAAM,yCAA6C;ACEzF,IAAMC,oBAAmB,CAAC,MAAM,MAAM,MAAM,MAAM,IAAI;AAGtD,IAAMC,iBAAgB;AAE7B,IAAMC,iBAAgB,MAAM;AAP5B,MAAA;AAQC,MAAI;AACH,WAAQ,KAAA,WAAA,OAAA,SAAA,QAAS,QAAT,OAAA,SAAA,GAAc,WAAW;IACjC,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD;AACC,cAAQ;EACV;AACA,SAAO;AACR;AAEA,IAAMC,gBAAe,MAAM;AA5B3B,MAAA;AA6BE,QAAM,YAAW,KAAA,YAAA,OAAA,SAAA,SAAU,aAAV,OAAA,SAAA,GAAoB;AACrC,MAAI,YAAA,OAAA,SAAA,SAAU,SAAS,MAAA,GAAS;AAC9B,WAAO;EACT,WAAW,SAAS,SAAS,MAAM,GAAG;AACpC,WAAO;EACT,WAAW,SAAS,SAAS,SAAS,GAAG;AACvC,WAAO;EACT,WAAW,SAAS,SAAS,KAAK,GAAG;AACnC,WAAO;EACT,OAAO;AACL,WAAOF;EACT;AACF;AAEO,IAAMG,sBAAqB,CAAC,eAAuB;AACxD,SACEJ,kBAAiB;IACf,CAAC,WACC,eAAe,UAAU,WAAW,YAAY,EAAE,SAAS,MAAM;EACrE,KAAKG,cAAa;AAEtB;AAEO,SAASE,gBAAgC;AApDhD,MAAA;AAqDE,MAAI,OAAO,WAAW,aAAa;AAIjC,UAAM,eAAeH,eAAc;AACnC,WAAOE,oBAAmB,YAAY;EACxC;AAEA,MAAI;AAIF,UAAM,cAAa,KAAA,YAAA,OAAA,SAAA,SAAU,oBAAV,OAAA,SAAA,GAA2B;AAC9C,UAAM,aAAaD,cAAa;AAEhC,QAAI,CAACH,kBAAiB,SAAS,UAA6B,GAAG;AAC7D,cAAQ,KAAK,gFAAgF;AAC7F,aAAOI,oBAAmB,UAAU;IACtC;AACA,WAAOA,oBAAmB,cAAA,OAAA,aAAc,UAAU;EACpD,SAAS,GAAG;AACV,YAAQ,KAAK,0DAA0D,CAAC;AACxE,WAAOH;EACT;AACF;AAEO,IAAMK,eAAc,CACzB,QACA,OACA,OACA,OACA,OACA,UACG;AACH,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAE5B,SAAO;AACT;AAEO,IAAMC,gBAAe,CAC1B,YACA,YACA,YACA,YACA,eACG;AACH,QAAM,SAASF,cAAa;AAC5B,QAAMN,cAAWO,aAAY,QAAQ,YAAY,YAAY,YAAY,YAAY,UAAU;AAC/F,OAAK,KAAK,QAAQP,WAAQ;AAC1B,OAAK,SAAS,MAAM;AACtB;ANjGAQ,cAAaR,aAAYA,YAAYA,aAAYA,YAAYA,UAAU;AAGhE,IAAM,oBAAN,cAAgCS,YAAW;EAChD,SAAS;AACL,UAAM,QAAQC,KAAK,EAAE,EAAE,SAAS,kBAAkB,IAAI,2BAA2B,SAAS,8BAA8B,CAAC;AAEzH,WAAOC,uIAAqIC,cAAa,UAAU,KAAK,UAAU,CAAC;EAAgJ;AACzU;AACA,IAAI,CAAC,eAAe,IAAI,wBAAwB,GAAG;AACjD,iBAAe,OAAO,0BAA0B,iBAAiB;AACnE;;;AOpBA,SAAS,cAAAC,mBAAkB;AAC3B,SAAS,gBAAAC,eAAc,QAAAC,cAAY;ACDV,IAAMC,aAAS,KAAK,MAAM,0CAA8C;ACAxE,IAAMA,cAAS,KAAK,MAAM,4CAAgD;ACA1E,IAAMA,cAAS,KAAK,MAAM,oDAAkD;ACA5E,IAAMA,aAAS,KAAK,MAAM,wCAA4C;ACAtE,IAAMA,aAAS,KAAK,MAAM,uCAA2C;ACEvF,IAAMC,oBAAmB,CAAC,MAAM,MAAM,MAAM,MAAM,IAAI;AAGtD,IAAMC,kBAAgB;AAE7B,IAAMC,iBAAgB,MAAM;AAP5B,MAAA;AAQC,MAAI;AACH,WAAQ,KAAA,WAAA,OAAA,SAAA,QAAS,QAAT,OAAA,SAAA,GAAc,WAAW;IACjC,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD;AACC,cAAQ;EACV;AACA,SAAO;AACR;AAEA,IAAMC,gBAAe,MAAM;AA5B3B,MAAA;AA6BE,QAAM,YAAW,KAAA,YAAA,OAAA,SAAA,SAAU,aAAV,OAAA,SAAA,GAAoB;AACrC,MAAI,YAAA,OAAA,SAAA,SAAU,SAAS,MAAA,GAAS;AAC9B,WAAO;EACT,WAAW,SAAS,SAAS,MAAM,GAAG;AACpC,WAAO;EACT,WAAW,SAAS,SAAS,SAAS,GAAG;AACvC,WAAO;EACT,WAAW,SAAS,SAAS,KAAK,GAAG;AACnC,WAAO;EACT,OAAO;AACL,WAAOF;EACT;AACF;AAEO,IAAMG,sBAAqB,CAAC,eAAuB;AACxD,SACEJ,kBAAiB;IACf,CAAC,WACC,eAAe,UAAU,WAAW,YAAY,EAAE,SAAS,MAAM;EACrE,KAAKG,cAAa;AAEtB;AAEO,SAASE,gBAAgC;AApDhD,MAAA;AAqDE,MAAI,OAAO,WAAW,aAAa;AAIjC,UAAM,eAAeH,eAAc;AACnC,WAAOE,oBAAmB,YAAY;EACxC;AAEA,MAAI;AAIF,UAAM,cAAa,KAAA,YAAA,OAAA,SAAA,SAAU,oBAAV,OAAA,SAAA,GAA2B;AAC9C,UAAM,aAAaD,cAAa;AAEhC,QAAI,CAACH,kBAAiB,SAAS,UAA6B,GAAG;AAC7D,cAAQ,KAAK,gFAAgF;AAC7F,aAAOI,oBAAmB,UAAU;IACtC;AACA,WAAOA,oBAAmB,cAAA,OAAA,aAAc,UAAU;EACpD,SAAS,GAAG;AACV,YAAQ,KAAK,0DAA0D,CAAC;AACxE,WAAOH;EACT;AACF;AAEO,IAAMK,eAAc,CACzB,QACA,OACA,OACA,OACA,OACA,UACG;AACH,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAE5B,SAAO;AACT;AAEO,IAAMC,gBAAe,CAC1B,YACA,YACA,YACA,YACA,eACG;AACH,QAAM,SAASF,cAAa;AAC5B,QAAMN,cAAWO,aAAY,QAAQ,YAAY,YAAY,YAAY,YAAY,UAAU;AAC/F,OAAK,KAAK,QAAQP,WAAQ;AAC1B,OAAK,SAAS,MAAM;AACtB;ANjGAQ,cAAaR,aAAYA,YAAYA,aAAYA,YAAYA,UAAU;AAGhE,IAAM,kBAAN,cAA8BS,YAAW;EAC9C,SAAS;AACL,UAAM,QAAQC,KAAK,EAAE,EAAE,SAAS,gBAAgB,IAAI,yBAAyB,SAAS,4BAA4B,CAAC;AAEnH,WAAOC,qIAAmIC,cAAa,UAAU,KAAK,UAAU,CAAC;EAAyI;AAChU;AACA,IAAI,CAAC,eAAe,IAAI,sBAAsB,GAAG;AAC/C,iBAAe,OAAO,wBAAwB,eAAe;AAC/D;;;ARpBA;AAYA,IAAM,iBAAN,cAA6B,oBAAoBC,YAAW,EAAE;AAAA,EAe5D,cAAc;AACZ,UAAM;AAhBV;AAkBI,SAAK,WAAW;AAChB,SAAK,WAAW;AAChB,SAAK,MAAM;AACX,SAAK,QAAQ;AACb,SAAK,YAAY;AACjB,SAAK,YAAY;AACjB,SAAK,iBAAiB,KAAK;AAAA,EAC7B;AAAA,EAkBA,QAAQ,mBAAmB;AAEzB,QAAI,kBAAkB,IAAI,UAAU,GAAG;AACrC,iBAAW,MAAM;AACf,aAAK,iBAAiB,KAAK;AAAA,MAC7B,GAAG,GAAG;AAAA,IACR;AAAA,EACF;AAAA,EAEA,eAAe;AACb,SAAK,YAAY,CAAC,CAAC,KAAK,SAAS,KAAK,WAAW,cAAc,oBAAoB,EAAE,cAAc,EAAE,SAAS;AAAA,EAChH;AAAA,EAqCA,IAAI,kBAAkB;AACpB,WAAOC,qBAAmB,mBAAK,8CAAe;AAAA;AAAA;AAAA,EAGhD;AAAA,EAEA,SAAS;AACP,WAAOA,sBAAoB,mBAAK,8CAAe;AAAA,QAC3C,KAAK,YACHA,mCAAiC,KAAK,YAAY;AAAA;AAAA;AAAA,+BAG7B,KAAK,QAAQ;AAAA,uBACrB,mBAAK,6CAAc;AAAA,uBACnB,MAAO,KAAK,WAAW,CAAC,KAAK,QAAS;AAAA,4BACjC,WAAa,KAAK;AAAA,kBAC5B,KAAK,QAAQA,sBAAoB,WAAa,SAAS,KAAK,KAAK,KAAK,YAAYA,kCAAgC;AAAA,kBAClH,KAAK,YAAY,KAAKA,qBAAmB,mBAAK,8CAAe,KAAK,mBAAK,2CAAY,QAAQ;AAAA;AAAA;AAAA,mCAInG,EAAE;AAAA,QACJ,KAAK,WACHA,oCAAkC,KAAK,QAAQ,KAAK,KAAK,eAAe,4BACxEA,qBAAmB,mBAAK,gDAAiB,iBAAiBC,WAAU,CAAC,KAAK,WAAW,OAAO,MAAS,CAAC;AAAA,cAClG,KAAK,eAAe;AAAA,iBACjB;AAAA;AAAA,EAEf;AACF;AAxHA;AAwDM,qBAAe,WAAG;AACpB,SAAO,EAAW,CAAC,WAAa,SAAS,KAAK,OAAO,WAAa,KAAK,KAAK,SAAS,WAAa,KAAK,CAAC;AAC1G;AAEI,oBAAc,WAAG;AACnB,SAAO,EAAW,KAAK,aAAa,CAAC,WAAa,QAAQ,KAAK,OAAO,WAAa,SAAS,CAAC;AAC/F;AAEI,qBAAe,WAAG;AACpB,SAAO,EAAW,CAAC,WAAa,SAAS,CAAC,KAAK,OAAO,WAAa,aAAa,CAAC;AACnF;AAEI,kBAAY,WAAG;AACjB,QAAM,YAAY,EAAW;AAAA,IAC3B,WAAa;AAAA,IACb,CAAC,KAAK,YAAY,KAAK,kBAAkB,WAAa;AAAA,EACxD,CAAC;AACD,QAAM,cAAc,EAAW;AAAA,IAC7B,WAAa;AAAA,IACb,KAAK,YAAY,CAAC,KAAK,kBAAkB,WAAa;AAAA,EACxD,CAAC;AAED,SAAO,KAAK,iBACRD,sCAAoC,SAAS,8BAC7CA,wCAAsC,WAAW;AACvD;AAEI,qBAAe,WAAG;AACpB,SAAO,EAAW,KAAK,cAAc,CAAC,KAAK,OAAO,IAAM,MAAM,KAAK,aAAa,KAAK,OAAO,WAAa,gBAAgB,CAAC;AAC5H;AAEI,uBAAiB,WAAG;AACtB,SAAO,EAAW,CAAC,WAAa,WAAW,CAAC,KAAK,YAAY,WAAa,oBAAoB,CAAC;AACjG;AAxFA,cADI,gBACG,cAAa;AAAA,EAClB,UAAU,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA,EACzC,OAAO,EAAE,MAAM,OAAO;AAAA,EACtB,KAAK,EAAE,MAAM,QAAQ;AAAA,EACrB,OAAO,EAAE,MAAM,QAAQ;AAAA,EACvB,aAAa,EAAE,MAAM,OAAO;AAAA,EAC5B,cAAc,EAAE,MAAM,OAAO;AAAA,EAC7B,WAAW,EAAE,MAAM,QAAQ;AAAA,EAC3B,UAAU,EAAE,MAAM,QAAQ;AAAA,EAC1B,cAAc,EAAE,MAAM,OAAO;AAAA,EAC7B,WAAW,EAAE,MAAM,SAAS,OAAO,KAAK;AAAA,EACxC,gBAAgB,EAAE,MAAM,SAAS,OAAO,KAAK;AAC/C;AAAA;AAAA;AAAA;AAAA;AAkBA,cA/BI,gBA+BG,UAAS;AAAA,EACdD,aAAY;AAAA,EACZG;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAQF;AAiFF,IAAI,CAAC,eAAe,IAAI,cAAc,GAAG;AACvC,iBAAe,OAAO,gBAAgB,cAAc;AACtD;;;AexIA,SAAS,QAAAC,cAAY;AAGrB,OAAOC,mBAAiB;;;ACHjB,IAAM,gBAAgB,CAAC,eAC5B,cAAc,WAAW;AAAA,EAAzB;AAAA;AACE,sCAAa;AACb,kCAAS;AAAA;AAAA,EACT,QAAQ;AACN,SAAK,OAAO;AAAA,EACd;AACF;AAEK,IAAM,+BAA+B,CAAC,eAC3C,cAAc,WAAW;AAAA;AAAA;AAAA,EAGvB,iBAAiB,KAAK;AACpB,UAAMC,YAAW,IAAI,OAAO,cAAc,EAAE,SAAS,KAAK,CAAC;AAC3D,eAAW,SAASA,UAAS,OAAO,CAAC,MAAM,EAAE,UAAU,GAAG;AACxD,YAAM,SAAS,MAAM,KAAK,MAAM;AAAA,IAClC;AAAA,EACF;AACF;;;ADZK,IAAM,cAAN,cAA0B,cAAc,6BAA6BC,aAAW,CAAC,EAAE;AAAA,EACxF,SAAS;AACP,WAAOC;AAAA,oBACS,aAAQ,MAAM;AAAA,6BACL,KAAK,gBAAgB;AAAA;AAAA;AAAA,EAGhD;AAEF;AADE,cARW,aAQJ,UAAS,CAACD,cAAY,MAAM;;;AEfrC,SAAS,QAAAE,QAAM,WAAAC,gBAAe;;;ACOvB,IAAM,gBAAgB,CAAC,OAAO,UAAU;AAAA,EAC7C,IAAI,MAAM,OAAO,KAAK;AAAA,EACtB,IAAI,MAAM,MAAM,KAAK;AAAA,EACrB,IAAI,MAAM,QAAQ,KAAK;AAAA,EACvB,IAAI,MAAM,SAAS,KAAK;AAAA,EACxB;AAAA,EACA;AACF;AAGO,IAAM,gBAAgB,CAAC,EAAE,IAAI,GAAG,MAAO;AAAA,EAC5C,EAAE,WAAW,aAAa,EAAE,OAAO,EAAE,MAAM;AAAA,EAC3C,EAAE,WAAW,OAAO;AACtB;AAGO,IAAM,oBAAoB,EAAE,QAAQ,QAAQ,UAAU,IAAI;;;ACvB1D,IAAI,eAAe;AAE1B,IAAM,eAAgB,OAAO,WAAW;AACxC,IAAI,cAAc;AAChB,QAAM,QAAQ,OAAO,WAAW,kCAAkC;AAClE,QAAM,WAAW,CAAC,EAAE,QAAQ,MAAM,eAAe;AAEjD,MAAI,MAAM,iBAAkB,OAAM,iBAAiB,UAAU,QAAQ;AACrE,WAAS,KAAK;AAChB;;;ACNO,IAAM,OAAN,MAAW;AAAA,EAQhB,YAAY,IAAI,EAAE,YAAY,CAAC,GAAG,WAAW,sBAAsB,KAAK,IAAI,CAAC,GAAG;AANhF;AAAA;AAEA;AAAA;AAEA;AAAA;AAGE,SAAK,KAAK;AACV,SAAK,QAAQ,CAAC;AACd,SAAK,OAAO,CAAC;AACb,SAAK,uBAAuB;AAC5B,SAAK,oBAAoB,aAAa;AACtC,SAAK,qBAAqB;AAAA,EAC5B;AAAA,EAEA,MAAM,KAAK,IAAI;AACb,SAAK,KAAK;AACV,UAAM,IAAI,MAAM,GAAG;AACnB,UAAM,KAAK,KAAK;AAChB,WAAO;AAAA,EACT;AAAA,EAEA,OAAO;AACL,SAAK,QAAQ,KAAK,GAAG,sBAAsB;AAAA,EAC7C;AAAA,EAEA,MAAM,OAAO;AACX,SAAK,OAAO,KAAK,GAAG,sBAAsB;AAC1C,QAAI,CAAC,KAAK,GAAG,QAAS;AACtB,UAAM,YAAY,KAAK,GAAG,QAAQ,KAAK,WAAW,KAAK,gBAAgB;AACvE,UAAM,UAAU;AAAA,EAClB;AAAA,EAEA,IAAI,YAAY;AACd,WAAO,KAAK,kBAAkB,cAAc,KAAK,OAAO,KAAK,IAAI,CAAC;AAAA,EACpE;AAAA,EAEA,IAAI,WAAW;AACb,WAAO;AAAA,EACT;AAAA,EAEA,IAAI,gBAAgB;AAClB,WAAO,kCAAK,KAAK,WAAa,KAAK;AAAA,EACrC;AAAA,EAEA,IAAI,mBAAmB;AACrB,QAAI,CAAC,KAAK,mBAAoB,QAAO,KAAK;AAC1C,QAAI,CAAC,aAAc,QAAO,KAAK;AAC/B,WAAO,iCAAK,KAAK,gBAAV,EAAyB,UAAU,EAAE;AAAA,EAC9C;AACF;;;ACvDA,SAAS,cAAAC,mBAAkB;AAC3B,SAAS,gBAAAC,eAAc,QAAAC,cAAY;ACDV,IAAMC,aAAS,KAAK,MAAM,yDAA6D;ACAvF,IAAMA,cAAS,KAAK,MAAM,uDAA2D;ACArF,IAAMA,cAAS,KAAK,MAAM,0DAA8D;ACAxF,IAAMA,cAAS,KAAK,MAAM,+CAAmD;ACA7E,IAAMA,aAAS,KAAK,MAAM,wDAAyD;ACErG,IAAMC,qBAAmB,CAAC,MAAM,MAAM,MAAM,MAAM,IAAI;AAGtD,IAAMC,kBAAgB;AAE7B,IAAMC,iBAAgB,MAAM;AAP5B,MAAA;AAQC,MAAI;AACH,WAAQ,KAAA,WAAA,OAAA,SAAA,QAAS,QAAT,OAAA,SAAA,GAAc,WAAW;IACjC,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD,KAAK;AACJ,cAAQ;AACR;IACD;AACC,cAAQ;EACV;AACA,SAAO;AACR;AAEA,IAAMC,gBAAe,MAAM;AA5B3B,MAAA;AA6BE,QAAM,YAAW,KAAA,YAAA,OAAA,SAAA,SAAU,aAAV,OAAA,SAAA,GAAoB;AACrC,MAAI,YAAA,OAAA,SAAA,SAAU,SAAS,MAAA,GAAS;AAC9B,WAAO;EACT,WAAW,SAAS,SAAS,MAAM,GAAG;AACpC,WAAO;EACT,WAAW,SAAS,SAAS,SAAS,GAAG;AACvC,WAAO;EACT,WAAW,SAAS,SAAS,KAAK,GAAG;AACnC,WAAO;EACT,OAAO;AACL,WAAOF;EACT;AACF;AAEO,IAAMG,uBAAqB,CAAC,eAAuB;AACxD,SACEJ,mBAAiB;IACf,CAAC,WACC,eAAe,UAAU,WAAW,YAAY,EAAE,SAAS,MAAM;EACrE,KAAKG,cAAa;AAEtB;AAEO,SAASE,iBAAgC;AApDhD,MAAA;AAqDE,MAAI,OAAO,WAAW,aAAa;AAIjC,UAAM,eAAeH,eAAc;AACnC,WAAOE,qBAAmB,YAAY;EACxC;AAEA,MAAI;AAIF,UAAM,cAAa,KAAA,YAAA,OAAA,SAAA,SAAU,oBAAV,OAAA,SAAA,GAA2B;AAC9C,UAAM,aAAaD,cAAa;AAEhC,QAAI,CAACH,mBAAiB,SAAS,UAA6B,GAAG;AAC7D,cAAQ,KAAK,gFAAgF;AAC7F,aAAOI,qBAAmB,UAAU;IACtC;AACA,WAAOA,qBAAmB,cAAA,OAAA,aAAc,UAAU;EACpD,SAAS,GAAG;AACV,YAAQ,KAAK,0DAA0D,CAAC;AACxE,WAAOH;EACT;AACF;AAEO,IAAMK,gBAAc,CACzB,QACA,OACA,OACA,OACA,OACA,UACG;AACH,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAC5B,MAAI,WAAW,KAAM,QAAO;AAE5B,SAAO;AACT;AAEO,IAAMC,iBAAe,CAC1B,YACA,YACA,YACA,YACA,eACG;AACH,QAAM,SAASF,eAAa;AAC5B,QAAMN,cAAWO,cAAY,QAAQ,YAAY,YAAY,YAAY,YAAY,UAAU;AAC/F,OAAK,KAAK,QAAQP,WAAQ;AAC1B,OAAK,SAAS,MAAM;AACtB;ANjGAQ,eAAaR,aAAYA,YAAYA,aAAYA,aAAYA,UAAU;AAGhE,IAAM,kBAAN,cAA8BS,YAAW;EAC9C,SAAS;AACL,UAAM,QAAQC,KAAK,EAAE,EAAE,SAAS,2BAA2B,IAAI,yBAAyB,SAAS,kCAAkC,CAAC;AAEpI,WAAOC,qIAAmIC,cAAa,UAAU,KAAK,UAAU,CAAC;EAAmP;AAC1a;AACA,IAAI,CAAC,eAAe,IAAI,sBAAsB,GAAG;AAC/C,iBAAe,OAAO,wBAAwB,eAAe;AAC/D;;;AJbA,OAAOC,mBAAiB;AACxB,SAAS,WAAW,WAAW;;;AWRN,IAAMC,aAAS,KAAK,MAAM,4DAAoE;;;ACA9F,IAAMC,aAAS,KAAK,MAAM,2DAAmE;;;ACA7F,IAAMC,aAAS,KAAK,MAAM,+DAAuE;;;ACAjG,IAAMC,aAAS,KAAK,MAAM,6DAAqE;;;ACA/F,IAAMC,aAAS,KAAK,MAAM,kEAAuE;;;AfmB1H,IAAM,kBAAkB;AAEjB,IAAM,cAAN,cAA0B,cAAcC,aAAW,EAAE;AAAA,EAS1D,cAAc;AACZ,UAAM;AATR,mCAAU,UAAU;AAUlB,IAAAC,cAAaC,YAAYA,YAAYA,YAAYA,YAAYA,UAAU;AAEvE,SAAK,iBAAiB;AAAA,EACxB;AAAA,EACA,SAAS;AACP,WAAOC;AAAA,oBACS,aAAQ,MAAM;AAAA,uCACK,KAAK,mBAAmB;AAAA,sBACzC,KAAK,iBAAiB,KAAK,aAAQ,cAAc;AAAA,YAC3D,KAAK,UAAU;AAAA,gBACX,IAAI,KAAK,OAAO,CAAC,WAAW,KAAK,YAAY,KAAK,KAAK,KAAK;AAAA,YAChE,KAAK,WAAW;AAAA;AAAA;AAAA;AAAA,EAI1B;AAAA,EAEA,MAAM,WAAW,mBAAmB;AAClC,QAAI,kBAAkB,IAAI,MAAM,GAAG;AACjC,YAAM,OAAO,IAAI,KAAK,KAAK,QAAQ,KAAK;AACxC,WAAK,KAAK,YAAY;AACpB,cAAM,KAAK;AAAA,MACb,CAAC;AAAA,IACH;AAAA,EACF;AAAA,EACA,IAAI,eAAe;AACjB,WAAO;AAAA,MACL,aAAQ;AAAA,MACR,KAAK,OAAO,aAAQ,4BAA4B,aAAQ;AAAA,MACxD,KAAK,iBAAiB,aAAQ,yBAAyB;AAAA,IACzD,EAAE,KAAK,GAAG;AAAA,EACZ;AAAA,EAEA,IAAI,aAAa;AACf,WAAO,KAAK,QAAQ,CAAC,KAAK,iBACtBA;AAAA;AAAA,wBAEgB,KAAK,EAAE;AAAA,MACnB,IAAI;AAAA,MACJ,SAAS;AAAA,MACT,SAAS;AAAA,IACX,CAAC,CAAC;AAAA,mBACO,aAAQ,YAAY,IAAI,aAAQ,gBAAgB;AAAA,oBAC/C,KAAK,QAAQ;AAAA;AAAA,qBAGzBC;AAAA,EACN;AAAA,EACA,IAAI,cAAc;AAChB,QAAI,KAAK,eAAe,EAAG,QAAOA;AAClC,WAAOD;AAAA;AAAA,oBAES,KAAK,EAAE;AAAA,MACnB,IAAI;AAAA,MACJ,SAAS;AAAA,MACT,SAAS;AAAA,IACX,CAAC,CAAC;AAAA,eACO,aAAQ,YAAY,IAAI,KAAK,iBAAiB,aAAQ,2BAA2B,aAAQ,iBAAiB;AAAA,gBACzG,KAAK,KAAK;AAAA;AAAA;AAAA,EAGxB;AAAA,EACA,WAAW;AACT,SAAK,cAAc,IAAI,YAAY,eAAe,EAAE,SAAS,MAAM,UAAU,KAAK,CAAC,CAAC;AAAA,EACtF;AAAA,EACA,oBAAoB,WAAW;AAC7B,UAAM,aAAa,UAAU,OAAO,iBAAiB,EAAE,SAAS,KAAK,CAAC;AACtE,SAAK,iBAAiB,CAAC,CAAC,WAAW;AAAA,EACrC;AAEF;AA9EE,cAHW,aAGJ,cAAa;AAAA,EAClB,OAAO,EAAE,MAAM,OAAO;AAAA,EACtB,MAAM,EAAE,MAAM,QAAQ;AAAA,EACtB,CAAC,eAAe,GAAG,EAAE,MAAM,QAAQ;AAAA,EACnC,gBAAgB,EAAE,OAAO,KAAK;AAChC;AAwEA,cAhFW,aAgFJ,UAAS,CAACH,cAAY,MAAM;;;AgBrGrC,SAAS,OAAAK,MAAK,QAAAC,cAAY;AAG1B,OAAOC,mBAAiB;AACxB,SAAS,aAAAC,YAAW,OAAAC,YAAW;;;ACJ/B,IAAI,IAAI,CAAC;AACT,IAAM,IAAI,EAAE,iBAAiB,CAAC,GAAG,MAAM,CAAC,EAAE;AAA1C,IAA6C,IAAI,OAAO,OAAO;AAAA;AAAA,EAE7D,iBAAiB;AAAA,IACf,oBAAoB;AAAA,EACtB;AAAA,EACA,MAAM;AAAA,IACJ,UAAU;AAAA,IACV,UAAU;AAAA,IACV,QAAQ;AAAA,EACV;AACF,CAAC;AAVD,IAUIC,KAAI,CAAC,MAAM;AAXf;AAYE,IAAE,QAAQ,SAAS,OAAK,OAAE,mBAAF;AAC1B;AAZA,IAYG,IAAI,CAAC,MAAM,CAAC,CAAC,GAAG,CAAC,MAAM;AACxB,IAAE,CAAC,EAAE,CAAC,IAAI,SAAS,CAAC,EAAE,MAAM,CAAC,GAAG,SAAS,CAAC,EAAE,MAAM,CAAC,IAAI;AACzD;AAdA,IAcG,IAAI,MAAM,OAAO,QAAQ,CAAC,EAAE,QAAQ,CAAC,CAAC,GAAG,CAAC,MAAM;AACjD,SAAO,QAAQ,CAAC,EAAE,QAAQ,EAAE,CAAC,CAAC;AAChC,CAAC;AAhBD,IAgBI,IAAI,CAAC,MAAM,CAAC,CAAC,GAAG,CAAC,MAAM;AACzB,WAAS,CAAC,EAAE,MAAM,CAAC,IAAI,EAAE,CAAC,EAAE,CAAC;AAC/B;AAlBA,IAkBG,IAAI,MAAM,OAAO,QAAQ,CAAC,EAAE,QAAQ,CAAC,CAAC,GAAG,CAAC,MAAM;AACjD,SAAO,QAAQ,CAAC,EAAE,QAAQ,EAAE,CAAC,CAAC;AAChC,CAAC;AApBD,IAoBI,IAAI,CAAC,MAAM,EAAE,eAAe,KAAK,IAAI,EAAE,SAAS,MAAM,EAAE;AAC5D,SAAS,EAAE,GAAG;AACZ,MAAI,IAAI;AACR,QAAM,IAAI,CAAC,MAAM;AACf,QAAI,EAAE,cAAc,WAAW;AAC7B;AACF,UAAM,IAAI,EAAE,cAAc,CAAC,EAAE,UAAU;AACvC,WAAO,EAAE,cAAc,KAAK,IAAI,KAAK,EAAE,CAAC,KAAK,IAAI,IAAIA,GAAE,CAAC,KAAK,EAAE,gBAAgB,GAAG;AAAA,EACpF;AACA,IAAE,eAAe,CAAC,MAAM;AACtB,MAAE,cAAc,WAAW,MAAM,IAAI,EAAE,cAAc,CAAC,EAAE;AAAA,EAC1D,GAAG,EAAE,cAAc;AACrB;AACA,SAAS,EAAE,GAAG;AACZ,IAAE,eAAe,MAAM,EAAE,cAAc;AACzC;AACA,IAAM,IAAI,CAAC,MAAM,MAAM,SAAS,IAAI,qBAAqB,qBAAqB,EAAE,aAAaA,IAAG,EAAE,SAAS,MAAG,CAAC;AAA/G,IAAkH,IAAI,EAAE,IAAE;AAA1H,IAA6H,IAAI,EAAE;AACnI,SAAS,EAAE,GAAG;AACZ,MAAI,CAAC;AACH,UAAM,MAAM,kDAAkD;AAChE,IAAE,KAAK,CAAC,MAAM,MAAM,CAAC,MAAM,EAAE,WAAW,EAAE,GAAG,EAAE,IAAI,EAAE,CAAC,GAAG,EAAE,KAAK,CAAC;AACnE;AACA,SAAS,IAAI;AACX,IAAE,QAAQ,CAAC,GAAG,EAAE,GAAG,EAAE,GAAG,IAAI,CAAC;AAC/B;;;ADpCA,IAAM,qBAAqB;AAC3B,IAAM,aAAa;AAEZ,IAAM,YAAN,cAAwB,6BAA6BC,aAAW,EAAE;AAAA,EAWvE,cAAc;AACZ,UAAM;AAXR,oCAAWC,WAAU;AACrB,yCAAgBA,WAAU;AAC1B,qCAAYA,WAAU;AAUpB,SAAK,kBAAkB,KAAK,gBAAgB,KAAK,IAAI;AACrD,SAAK,uBAAuB,KAAK,qBAAqB,KAAK,IAAI;AAC/D,SAAK,iBAAiB,KAAK,eAAe,KAAK,IAAI;AACnD,SAAK,qBAAqB,KAAK,mBAAmB,KAAK,IAAI;AAAA,EAC7D;AAAA,EAEA,MAAM,OAAO;AACX,SAAK,SAAS,MAAM,UAAU;AAC9B,SAAK,gBAAgB;AACrB,MAAgB,KAAK,UAAU,KAAK;AACpC,UAAM,KAAK;AACX,SAAK,cAAc,IAAI,YAAY,SAAS,EAAE,SAAS,MAAM,UAAU,KAAK,CAAC,CAAC;AAAA,EAChF;AAAA,EAEA,QAAQ;AACN,SAAK,gBAAgB,qBAAqB;AAC1C,SAAK,SAAS,MAAM,UAAU,IAAI,OAAO;AACzC,SAAK,SAAS,MAAM;AAAA,MAClB;AAAA,MACA,YAAY;AACV,aAAK,SAAS,MAAM,UAAU,OAAO,OAAO;AAC5C,aAAK,SAAS,MAAM,MAAM;AAC1B,UAAmB;AACnB,cAAM,KAAK;AACX,aAAK,cAAc,IAAI,YAAY,UAAU,EAAE,SAAS,MAAM,UAAU,KAAK,CAAC,CAAC;AAAA,MACjF;AAAA,MACA,EAAE,MAAM,KAAK;AAAA,IACf;AAAA,EACF;AAAA,EAEA,SAAS;AACP,WAAOC;AAAA,gBACKC,KAAI,KAAK,QAAQ,CAAC,mBAAmB,aAAQ,QAAQ;AAAA,eACtDA,KAAI,KAAK,aAAa,CAAC,WAAW,aAAQ,WAAW;AAAA,6CACvB,KAAK,gBAAgB;AAAA,iBACjDA,KAAI,KAAK,SAAS,CAAC,WAAW,aAAQ,WAAW,QAAQ,KAAK,UAAU,CAAC;AAAA,gDAC1C,KAAK,gBAAgB;AAAA;AAAA,6CAExB,KAAK,gBAAgB;AAAA;AAAA;AAAA;AAAA,EAIhE;AAAA,EAEA,WAAW,mBAAmB;AAC5B,QAAI,kBAAkB,IAAI,MAAM,EAAG,MAAK,KAAK,OAAO,SAAS,OAAO,EAAE;AAAA,EACxE;AAAA,EAEA,gBAAgB,OAAO,oBAAoB;AAEzC,aAAS,IAAI,EAAE,WAAW,KAAK,eAAe;AAE9C,QAAI,CAAC,KAAK,kBAAkB,EAAG,MAAK,SAAS,MAAM,IAAI,EAAE,aAAa,KAAK,oBAAoB;AAE/F,SAAK,SAAS,MAAM,IAAI,EAAE,SAAS,KAAK,cAAc;AAEtD,SAAK,SAAS,MAAM,IAAI,EAAE,UAAU,KAAK,cAAc;AAEvD,SAAK,cAAc,MAAM,IAAI,EAAE,iBAAiB,KAAK,kBAAkB;AAAA,EACzE;AAAA;AAAA,EAGA,eAAe,KAAK;AAClB,QAAI,eAAe;AAAA,EACrB;AAAA;AAAA,EAGA,qBAAqB,KAAK;AACxB,QAAI,KAAK,SAAS,UAAU,IAAI,OAAQ,MAAK,MAAM;AAAA,EACrD;AAAA;AAAA,EAGA,gBAAgB,KAAK;AACnB,QAAI,IAAI,QAAQ,UAAU;AACxB,UAAI,eAAe;AACnB,WAAK,MAAM;AAAA,IACb;AAAA,EACF;AAAA,EAEA,qBAAqB;AACnB,QAAI,KAAK,cAAc,MAAM,eAAe,OAAO,YAAa,MAAK,cAAc,MAAM,MAAM,eAAe;AAAA,QACzG,MAAK,cAAc,MAAM,MAAM,eAAe;AAAA,EACrD;AAgEF;AA1JE,cALW,WAKJ,cAAa;AAAA,EAClB,MAAM,EAAE,MAAM,QAAQ;AAAA,EACtB,CAAC,UAAU,GAAG,EAAE,MAAM,OAAO;AAAA,EAC7B,CAAC,kBAAkB,GAAG,EAAE,MAAM,QAAQ;AACxC;AAwFA,cAjGW,WAiGJ,UAAS;AAAA,EACdH,cAAY;AAAA,EACZI;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AA2DF;;;AErKF,IAAI,CAAC,eAAe,IAAI,SAAS,GAAG;AAClC,iBAAe,OAAO,WAAW,SAAS;AAC1C,iBAAe,OAAO,kBAAkB,WAAW;AACnD,iBAAe,OAAO,kBAAkB,WAAW;AACrD;;;ACPA,SAAS,QAAAC,cAAY;AAKrB,OAAOC,mBAAiB;;;ACPC,IAAMC,aAAS,KAAK,MAAM,iGAAwG;;;ACAlI,IAAMC,aAAS,KAAK,MAAM,gGAA0G;;;ACApI,IAAMC,aAAS,KAAK,MAAM,yGAAgH;;;ACA1I,IAAMC,aAAS,KAAK,MAAM,kGAAyG;;;ACAnI,IAAMC,aAAS,KAAK,MAAM,sGAA6G;;;ALkBhK,IAAM,WAAN,cAAuB,oBAAoBC,aAAW,EAAE;AAAA,EAUtD,cAAc;AACZ,UAAM;AACN,IAAAC,cAAaC,YAAYA,YAAYA,YAAYA,YAAYA,UAAU;AACvE,SAAK,WAAW;AAChB,SAAK,aAAa;AAElB,SAAK,mBAAmB,KAAK,EAAE;AAAA,MAC7B,IAAI;AAAA,MACJ,SAAS;AAAA,MACT,SAAS;AAAA,IACX,CAAC;AAED,SAAK,qBAAqB,KAAK,EAAE;AAAA,MAC/B,IAAI;AAAA,MACJ,SAAS;AAAA,MACT,SAAS;AAAA,IACX,CAAC;AAAA,EACH;AAAA,EAEA,IAAI,gBAAgB;AAClB,WAAO,EAAW;AAAA,MAChB,KAAO;AAAA,MACP,KAAO;AAAA,MACP,KAAK,aAAa,KAAO,aAAa,KAAO;AAAA,MAC7C,KAAK,WAAW,KAAO,iBAAiB,KAAO;AAAA,IACjD,CAAC;AAAA,EACH;AAAA,EAEA,IAAI,gBAAgB;AAClB,WAAO,EAAW,CAAC,KAAO,QAAQ,KAAO,OAAO,KAAK,aAAa,KAAO,aAAa,KAAO,MAAM,CAAC;AAAA,EACtG;AAAA,EAEA,WAAW;AACT,SAAK,cAAc,IAAI,YAAY,gBAAgB,EAAE,SAAS,MAAM,UAAU,KAAK,CAAC,CAAC;AAAA,EACvF;AAAA,EAEA,WAAW;AACT,SAAK,cAAc,IAAI,YAAY,gBAAgB,EAAE,SAAS,MAAM,UAAU,KAAK,CAAC,CAAC;AAAA,EACvF;AAAA,EAEA,SAAS;AACP,WAAOC;AAAA,oBACS,KAAO,OAAO;AAAA,uCACK,KAAK,aAAa,aAAa,KAAK,QAAQ;AAAA,yBAC1D,KAAO,IAAI,KAAK,KAAK,cAAc,KAAK,cAAc,KAAK,gBAAgB;AAAA;AAAA;AAAA,UAG1F,KAAK,WACHA,sCAAoC,KAAK,aAAa,aAAa,KAAK,QAAQ;AAAA,6BAC/D,KAAO,IAAI,KAAK,KAAK,eAAe,KAAK,eAAe,KAAK,kBAAkB;AAAA;AAAA,yBAGhG,IAAI;AAAA;AAAA;AAAA,EAGd;AACF;AAjEE,cADI,UACG,UAAS,CAACH,cAAY,MAAM;AAEnC,cAHI,UAGG,cAAa;AAAA,EAClB,UAAU,EAAE,MAAM,QAAQ;AAAA,EAC1B,YAAY,EAAE,MAAM,QAAQ;AAAA,EAC5B,aAAa,EAAE,MAAM,OAAO;AAAA,EAC5B,cAAc,EAAE,MAAM,OAAO;AAC/B;AA4DF,IAAI,CAAC,eAAe,IAAI,QAAQ,GAAG;AACjC,iBAAe,OAAO,UAAU,QAAQ;AAC1C;;;AMxFA,SAAS,QAAAI,cAAY;AAKrB,OAAOC,mBAAiB;AACxB,SAAS,aAAAC,kBAAiB;AAC1B,SAAS,kBAAkB;AAC3B,SAAS,YAAY;;;ACRI,IAAMC,aAAS,KAAK,MAAM,0CAA8C;;;ACAxE,IAAMC,aAAS,KAAK,MAAM,0CAA8C;;;ACAxE,IAAMC,aAAS,KAAK,MAAM,+CAAmD;;;ACA7E,IAAMC,aAAS,KAAK,MAAM,2CAA+C;;;ACAzE,IAAMC,aAAS,KAAK,MAAM,0CAA8C;;;ALAjG,6DAAAC,qBAAA;AAqBO,IAAM,aAAN,cAAyB,oBAAoBC,aAAW,EAAE;AAAA,EA+B/D,cAAc;AACZ,UAAM;AAhCH;AAiCH,IAAAC,cAAaC,YAAYA,YAAYA,YAAYA,YAAYA,UAAU;AAEvE,SAAK,WAAW,KAAK;AAAA,EACvB;AAAA,EAEA,eAAe;AAEb,SAAK,aAAa,KAAK,WAAW,cAAc,QAAQ,EAAE,MAAM;AAAA,EAClE;AAAA,EAEA,cAAc,OAAO;AACnB,QAAI,KAAK,aAAa,MAAM,QAAQ,OAAO,MAAM,QAAQ,eAAe,MAAM,QAAQ,YAAY;AAChG,YAAM,eAAe;AAAA,IACvB;AAAA,EACF;AAAA;AAAA,EA6BA,SAAS,EAAE,OAAO,GAAG;AACnB,UAAM,QAAQ,IAAI,YAAY,UAAU,EAAE,QAAQ,OAAO,MAAM,CAAC;AAEhE,SAAK,cAAc,KAAK;AAAA,EAC1B;AAAA,EAEA,SAAS;AACP,WAAOC,qBAAmB,OAAS,OAAO;AAAA,QACtC;AAAA,MACA,KAAK;AAAA,MACL,MACEA,uBAAqB,MAAQ,IAAI,UAAU,mBAAK,8BAAG;AAAA,cAC/C,KAAK,KAAK;AAAA,cACV;AAAA,QACA,KAAK;AAAA,QACL,MACEA,sBAAoB,MAAQ,QAAQ;AAAA,qBAC/B,KAAK,EAAE;AAAA,UACR,IAAI;AAAA,UACJ,SAAS;AAAA,UACT,SAAS;AAAA,QACX,CAAC,CAAC;AAAA;AAAA,MAER,CAAC;AAAA;AAAA,IAEP,CAAC;AAAA,oBACa,OAAS,aAAa;AAAA;AAAA,mBAEvB,mBAAK,mCAAQ;AAAA,gBAChB,mBAAK,8BAAG;AAAA,sBACF,KAAK,QAAQ;AAAA,8BACLC,WAAU,mBAAK,kCAAO,CAAC;AAAA,0BAC3BA,WAAU,KAAK,OAAO,CAAC;AAAA,+BAClBA,WAAU,KAAK,WAAW,mBAAK,kCAAO,CAAC;AAAA,qBACjD,KAAK,aAAa;AAAA,oBACnB,KAAK,QAAQ;AAAA,YACrB,WAAW,KAAK,QAAQ,CAAC;AAAA;AAAA,sBAEf,mBAAK,uBAAAL,oBAAe;AAAA;AAAA;AAAA;AAAA,QAIlC,KAAK,KAAK,UAAU,KAAK,SAAS,MAAMI,kBAAgB,mBAAK,kCAAO,YAAY,mBAAK,2CAAgB,KAAK,KAAK,IAAI,QAAQ,CAAC;AAAA;AAAA,EAElI;AACF;AAzHO;AAiDD,cAAQ,WAAG;AACb,SAAO,EAAW;AAAA,IAChB,OAAS;AAAA,IACT,CAAC,KAAK,WAAW,CAAC,KAAK,YAAY,CAAC,KAAK,YAAY,OAAS;AAAA,IAC9D,KAAK,WAAW,OAAS;AAAA,IACzB,KAAK,YAAY,OAAS;AAAA,IAC1B,KAAK,YAAY,OAAS;AAAA,EAC5B,CAAC;AACH;AAEI,sBAAgB,WAAG;AACrB,SAAO,EAAW,CAAC,SAAW,MAAM,KAAK,UAAU,SAAW,eAAe,SAAW,KAAK,CAAC;AAChG;AAEIJ,sBAAe,WAAG;AACpB,SAAO,EAAW,CAAC,OAAS,SAAS,KAAK,YAAY,OAAS,eAAe,CAAC;AACjF;AAEI,SAAG,WAAG;AACR,SAAO;AACT;AAEI,aAAO,WAAG;AACZ,SAAO,KAAK,OAAO,GAAG,mBAAK,8BAAG,WAAW;AAC3C;AAxEA,cADW,YACJ,cAAa;AAAA;AAAA,EAElB,WAAW,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA;AAAA,EAG1C,SAAS,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA;AAAA,EAGxC,QAAQ,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA;AAAA,EAGvC,MAAM,EAAE,MAAM,QAAQ,SAAS,KAAK;AAAA;AAAA,EAGpC,OAAO,EAAE,MAAM,QAAQ,SAAS,KAAK;AAAA;AAAA,EAGrC,UAAU,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA;AAAA,EAGzC,UAAU,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA;AAAA,EAGzC,UAAU,EAAE,MAAM,SAAS,SAAS,KAAK;AAAA,EAEzC,UAAU,EAAE,OAAO,KAAK;AAC1B;AAEA,cA7BW,YA6BJ,UAAS,CAACC,cAAY,MAAM;AA8FrC,IAAI,CAAC,eAAe,IAAI,UAAU,GAAG;AACnC,iBAAe,OAAO,YAAY,UAAU;AAC9C;;;AMlJA,SAAS,OAAAK,MAAK,QAAAC,cAAY;AAI1B,OAAOC,mBAAiB;AACxB,SAAS,aAAAC,kBAAiB;AAI1B,IAAM,gBAAN,cAA4B,oBAAoBC,aAAW,EAAE;AAAA,EAuC3D,cAAc;AACZ,UAAM;AACN,SAAK,OAAO;AAAA,EACd;AAAA,EAEA,IAAI,eAAe;AACjB,WAAO,EAAW;AAAA,MAChB,MAAQ;AAAA,MACR,KAAK,cAAc,MAAQ;AAAA,MAC3B,KAAK,cAAc,MAAQ;AAAA,MAC3B,CAAC,KAAK,WAAW,CAAC,KAAK,YAAY,CAAC,KAAK,YAAY,MAAQ;AAAA,MAC7D,KAAK,WAAW,CAAC,KAAK,YAAY,CAAC,KAAK,YAAY,MAAQ;AAAA,MAC5D,CAAC,KAAK,WAAW,KAAK,YAAY,CAAC,KAAK,YAAY,MAAQ;AAAA,MAC5D,CAAC,KAAK,WAAW,CAAC,KAAK,YAAY,KAAK,YAAY,MAAQ;AAAA,IAC9D,CAAC;AAAA,EACH;AAAA,EAEA,IAAI,kBAAkB;AACpB,WAAO,EAAW,CAAC,SAAW,MAAM,KAAK,UAAU,SAAW,eAAe,SAAW,KAAK,CAAC;AAAA,EAChG;AAAA,EAEA,IAAI,SAAS;AACX,QAAI,KAAK,OAAO;AACd,aAAOC,qBAAmB,KAAK,GAAG,WAAW,MAAQ,IAAI,IAAI,KAAK,KAAK;AAAA,IACzE;AAAA,EACF;AAAA,EAEA,IAAI,UAAU;AACZ,QAAI,KAAK,SAAU,QAAO,GAAG,KAAK,GAAG;AAAA,EACvC;AAAA,EAEA,IAAI,MAAM;AACR,WAAO;AAAA,EACT;AAAA,EAEA,IAAI,SAAS;AACX,QAAI,KAAK,WAAW,KAAK,QAAS,QAAO,KAAK;AAAA,EAChD;AAAA,EAEA,QAAQ,GAAG;AACT,UAAM,EAAE,MAAM,MAAM,IAAI,EAAE;AAC1B,UAAM,QAAQ,IAAI,YAAY,EAAE,MAAM;AAAA,MACpC,QAAQ;AAAA,QACN;AAAA,QACA;AAAA,QACA,QAAQ,EAAE;AAAA,MACZ;AAAA,IACF,CAAC;AACD,SAAK,cAAc,KAAK;AAAA,EAC1B;AAAA,EAEA,iBAAiB,GAAG;AAClB,UAAM,KAAK,KAAK,WAAW,cAAc,mBAAmB;AAC5D,UAAM,UAAU,GAAG,iBAAiB;AACpC,QAAI,QAAQ,OAAQ,MAAK,aAAa;AAAA,EACxC;AAAA,EAEA,iBAAiB,GAAG;AAClB,UAAM,KAAK,KAAK,WAAW,cAAc,mBAAmB;AAC5D,UAAM,UAAU,GAAG,iBAAiB;AACpC,QAAI,QAAQ,OAAQ,MAAK,aAAa;AAAA,EACxC;AAAA,EAEA,SAAS;AACP,WAAOA;AAAA,QACH,KAAK,MAAM;AAAA,oBACC,MAAQ,OAAO;AAAA,6BACN,KAAK,gBAAgB;AAAA;AAAA,mBAE/B,KAAK,YAAY;AAAA,kBAClB,KAAK,IAAI;AAAA,iBACVC,WAAU,KAAK,GAAG,CAAC;AAAA,iBACnBA,WAAU,KAAK,GAAG,CAAC;AAAA,kBAClBA,WAAU,KAAK,IAAI,CAAC;AAAA,uBACfA,WAAU,KAAK,SAAS,CAAC;AAAA,uBACzBA,WAAU,KAAK,SAAS,CAAC;AAAA,kBAC9BA,WAAU,KAAK,IAAI,CAAC;AAAA,qBACjBA,WAAU,KAAK,OAAO,CAAC;AAAA,yBACnBA,WAAU,KAAK,WAAW,CAAC;AAAA,mBACjCA,WAAU,KAAK,KAAK,CAAC;AAAA,8BACVA,WAAU,KAAK,OAAO,CAAC;AAAA,+BACtBA,WAAU,KAAK,MAAM,CAAC;AAAA,0BAC3BA,WAAU,KAAK,OAAO,CAAC;AAAA,gBACjC,KAAK,GAAG;AAAA,uBACD,KAAK,QAAQ;AAAA,uBACb,KAAK,QAAQ;AAAA,uBACb,KAAK,QAAQ;AAAA,mBACjB,KAAK,OAAO;AAAA,qBACV,KAAK,OAAO;AAAA,oBACb,KAAK,OAAO;AAAA,6BACH,KAAK,gBAAgB;AAAA;AAAA,QAE1C,KAAK,YAAYD,qBAAmB,KAAK,eAAe,SAAS,KAAK,OAAO,KAAK,KAAK,QAAQ,QAAQ;AAAA;AAAA,EAE7G;AACF;AArIE,cADI,eACG,cAAa;AAAA,EAClB,UAAU,EAAE,MAAM,QAAQ;AAAA,EAC1B,SAAS,EAAE,MAAM,QAAQ;AAAA,EACzB,IAAI,EAAE,MAAM,OAAO;AAAA,EACnB,OAAO,EAAE,MAAM,OAAO;AAAA,EACtB,UAAU,EAAE,MAAM,OAAO;AAAA,EACzB,MAAM,EAAE,MAAM,OAAO;AAAA,EACrB,KAAK,EAAE,MAAM,OAAO;AAAA,EACpB,KAAK,EAAE,MAAM,OAAO;AAAA,EACpB,WAAW,EAAE,MAAM,OAAO;AAAA,EAC1B,WAAW,EAAE,MAAM,OAAO;AAAA,EAC1B,MAAM,EAAE,MAAM,OAAO;AAAA,EACrB,SAAS,EAAE,MAAM,OAAO;AAAA,EACxB,aAAa,EAAE,MAAM,OAAO;AAAA,EAC5B,UAAU,EAAE,MAAM,QAAQ;AAAA,EAC1B,UAAU,EAAE,MAAM,QAAQ;AAAA,EAC1B,MAAM,EAAE,MAAM,OAAO;AAAA,EACrB,OAAO,EAAE,MAAM,OAAO;AAAA,EACtB,YAAY,EAAE,OAAO,KAAK;AAAA,EAC1B,YAAY,EAAE,OAAO,KAAK;AAC5B;AAAA;AAAA;AAAA;AAAA;AAMA,cA3BI,eA2BG,UAAS;AAAA,EACdD,cAAY;AAAA,EACZG;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAQF;AAmGF,IAAI,CAAC,eAAe,IAAI,aAAa,GAAG;AACtC,iBAAe,OAAO,eAAe,aAAa;AACpD;;;ACnJO,IAAMC,gBAAe,OAAO,WAAW;;;ACkBvC,SAASC,OAAM,SAAS,SAAS;AACtC,MAAI,CAACC,cAAc;AACnB,QAAMD,SAAQ,eAAe,IAAI,mBAAmB,EAAE,KAAK;AAE3D,QAAM,OAAO;AAAA,IACX,IAAI,KAAK,IAAI,EAAE,SAAS,EAAE,IAAI,KAAK,OAAO,EAAE,SAAS,EAAE,EAAE,MAAM,GAAG,CAAC;AAAA,IACnE,MAAM;AAAA,IACN,UAAU;AAAA,IACV,MAAM;AAAA,KACH;AAGL,EAAAA,OAAM,IAAI,IAAI;AACd,SAAO;AACT;AAOO,SAAS,YAAY,IAAI;AAC9B,MAAI,CAACC,cAAc;AACnB,QAAMD,SAAQ,eAAe,IAAI,mBAAmB,EAAE,KAAK;AAC3D,SAAOA,OAAM,IAAI,EAAE;AACrB;AAQO,SAAS,YAAY,IAAI,SAAS;AACvC,MAAI,CAACC,cAAc;AACnB,QAAMD,SAAQ,eAAe,IAAI,mBAAmB,EAAE,KAAK;AAC3D,EAAAA,OAAM,IAAI,kCAAKA,OAAM,IAAI,EAAE,IAAM,QAAS;AAC1C,SAAOA,OAAM,IAAI,EAAE;AACrB;;;ACxDA,SAAS,OAAAE,MAAK,QAAAC,cAAY;AAG1B,OAAOC,mBAAiB;AACxB,SAAS,cAAc;AAYhB,IAAM,qBAAN,cAAiCC,cAAY;AAAA,EAclD,cAAc;AACZ,UAAM;AACN,SAAK,UAAU,oBAAI,IAAI;AAAA,EACzB;AAAA,EAEA,oBAAoB;AAClB,UAAM,kBAAkB;AAGxB,SAAK,YAAY,YAAY,MAAM;AAEjC,YAAM,OAAO,CAAC;AACd,YAAM,SAAS,CAAC;AAChB,iBAAWC,UAAS,KAAK,SAAS;AAChC,YAAI,KAAK,IAAI,KAAKA,OAAM,CAAC,EAAE,SAAU,MAAK,KAAKA,MAAK;AAAA,YAC/C,QAAO,KAAKA,MAAK;AAAA,MACxB;AAEA,YAAM,gBAAgB,CAAC;AACvB,iBAAW,CAAC,EAAE,KAAK,QAAQ;AACzB,cAAM,KAAK,KAAK,WAAW,cAAc,IAAI,EAAE,EAAE;AACjD,sBAAc,KAAK,GAAG,SAAS,CAAC;AAAA,MAClC;AAEA,cAAQ,IAAI,aAAa,EAAE,KAAK,MAAM;AACpC,YAAI,KAAK,WAAW,KAAK,QAAQ,KAAM,MAAK,UAAU,IAAI,IAAI,IAAI;AAAA,MACpE,CAAC;AAAA,IACH,GAAG,GAAG;AAAA,EACR;AAAA,EAEA,uBAAuB;AACrB,UAAM,qBAAqB;AAC3B,QAAI,KAAK,UAAW,cAAa,KAAK,SAAS;AAAA,EACjD;AAAA,EAEA,OAAO,OAAO;AACZ,QAAI,KAAK,SAAS,cAAc,mBAAmB;AACnD,QAAI,CAAC,IAAI;AACP,WAAK,SAAS,cAAc,mBAAmB;AAC/C,eAAS,KAAK,YAAY,EAAE;AAAA,IAC9B;AACA,WAAO;AAAA,EACT;AAAA,EAEA,IAAI,eAAe;AACjB,WAAO,MAAM,KAAK,KAAK,OAAO,EAAE,IAAI,CAAC,CAAC,EAAEA,MAAK,MAAMA,MAAK;AAAA,EAC1D;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,EAOA,IAAI,IAAI;AACN,QAAI,CAAC,IAAI;AACP,YAAM,IAAI,MAAM,wDAAwD;AAAA,IAC1E;AACA,QAAI,OAAO,OAAO,YAAY,CAAC,OAAO,UAAU,EAAE,EAAG,OAAM,IAAI,MAAM,iEAAiE;AACtI,WAAO,KAAK,QAAQ,IAAI,EAAE;AAAA,EAC5B;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,EAOA,IAAIA,QAAO;AACT,QAAI,CAACA,OAAM,GAAI,OAAM,IAAI,MAAM,2CAA2C;AAC1E,UAAM,SAAS,KAAK,QAAQ,IAAIA,OAAM,IAAI,iCACrCA,SADqC;AAAA,MAExC,UAAU,KAAK,IAAI,KAAKA,OAAM,YAAY;AAAA,IAC5C,EAAC;AACD,SAAK,UAAU,IAAI,IAAI,MAAM,KAAK,KAAK,OAAO,CAAC;AAC/C,WAAO;AAAA,EACT;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,EAOA,MAAM,IAAI,IAAI;AACZ,QAAI,CAAC,IAAI;AACP,YAAM,IAAI,MAAM,wDAAwD;AAAA,IAC1E;AACA,QAAI,OAAO,OAAO,YAAY,CAAC,OAAO,UAAU,EAAE,EAAG,OAAM,IAAI,MAAM,iEAAiE;AACtI,UAAM,KAAK,KAAK,WAAW,cAAc,IAAI,EAAE,EAAE;AACjD,QAAI,CAAC,KAAK,QAAQ,IAAI,EAAE,EAAG,QAAO;AAClC,UAAM,GAAG,SAAS;AAClB,UAAM,SAAS,KAAK,QAAQ,OAAO,EAAE;AACrC,SAAK,UAAU,IAAI,IAAI,MAAM,KAAK,KAAK,OAAO,CAAC;AAC/C,WAAO;AAAA,EACT;AAAA,EAEA,SAAS;AACP,WAAOC;AAAA,sBACW,QAAiB,OAAO;AAAA,sBACxB,QAAiB,IAAI;AAAA,YAC/B;AAAA,MACA,KAAK;AAAA,MACL,CAACD,WAAUA,OAAM;AAAA,MACjB,CAACA,WACCC;AAAA,yBACW,QAAiB,OAAO;AAAA,sBAC3BD,OAAM,EAAE;AAAA,wBACNA,OAAM,IAAI;AAAA,wBACVA,OAAM,IAAI;AAAA,4BACNA,OAAM,QAAQ;AAAA,yBACjB,MAAM,KAAK,IAAIA,OAAM,EAAE,CAAC;AAAA;AAAA,IAEvC,CAAC;AAAA;AAAA;AAAA;AAAA,EAIT;AACF;AAhIE,cADW,oBACJ,UAAS;AAAA,EACdD,cAAY;AAAA,EACZG;AAAA;AAAA;AAAA;AAAA;AAKF;AAEA,cAVW,oBAUJ,cAAa;AAAA,EAClB,SAAS,EAAE,OAAO,KAAK;AACzB;AAuHF,IAAI,CAAC,eAAe,IAAI,mBAAmB,GAAG;AAC5C,iBAAe,OAAO,qBAAqB,kBAAkB;AAC/D;;;ACrJA,SAAS,OAAAC,MAAK,QAAAC,cAAY;AAK1B,OAAOC,mBAAiB;;;ACLxB,IAAMC,gBAAgB,OAAO,WAAW;AAExC,IAAI,gBAAgB;AAEpB,IAAIA,eAAc;AAChB,QAAM,QAAQ,OAAO,WAAW,kCAAkC;AAClE,QAAM,WAAW,CAAC,EAAE,QAAQ,MAAM,gBAAgB,CAAC;AAEnD,MAAI,MAAM,iBAAkB,OAAM,iBAAiB,UAAU,QAAQ;AACrE,WAAS,KAAK;AAChB;AAEA,IAAM,mBAAmB,QAAM;AAC7B,KAAG,MAAM,aAAa;AACtB,KAAG,MAAM,qBAAqB;AAC9B,KAAG,MAAM,WAAW;AACtB;AAEA,IAAM,gBAAgB,CAAC,OAAO;AAG5B,QAAM,SAAS,gBAAgB,sCAAsC;AACrE,KAAG,MAAM,aAAa,UAAU,MAAM;AACtC,KAAG,MAAM,qBAAqB;AAC9B,KAAG,MAAM,WAAW;AACtB;AAEA,IAAM,yBAAyB,CAAC,IAAI,SAAS,MAAM;AACjD,KAAG,MAAM,SAAS;AAClB,KAAG,MAAM,WAAW;AACpB,MAAI,KAAM,MAAK;AACjB;AAEA,IAAM,2BAA2B,CAAC,SAAS,MAAM;AAC/C,MAAI,KAAM,MAAK;AACjB;AAOO,IAAM,SAAS,CAAC,IAAI,SAAS;AAClC,QAAM,iBAAiB,MAAM;AAC3B,QAAI,CAAC,KAAM,QAAO,IAAI,QAAQ,CAAAC,OAAK;AAAE,aAAOA;AAAA,IAAE,CAAC;AAAA,EACjD,GAAG;AACH,QAAM,sBAAsB,uBAAuB,IAAI,IAAI;AAC3D,mBAAiB,EAAE;AACnB,KAAG,MAAM,SAAS;AAClB,MAAI,OAAO,GAAG;AACd,EAAAD,iBAAgB,sBAAsB,MAAM;AAC1C,OAAG,iBAAiB,iBAAiB,qBAAqB,EAAE,MAAM,KAAK,CAAC;AACxE,OAAG,MAAM,SAAS;AAClB,OAAG,MAAM,2BAA2B;AACpC,kBAAc,EAAE;AAChB,0BAAsB,MAAM,GAAG,MAAM,SAAS,OAAO,IAAI;AAAA,EAC3D,CAAC;AACD,MAAI,cAAe,QAAO;AAC5B;AAOO,IAAM,WAAW,CAAC,IAAI,SAAS;AACpC,QAAM,iBAAiB,MAAM;AAC3B,QAAI,CAAC,KAAM,QAAO,IAAI,QAAQ,CAAAC,OAAK;AAAE,aAAOA;AAAA,IAAE,CAAC;AAAA,EACjD,GAAG;AACH,QAAM,wBAAwB,yBAAyB,IAAI;AAC3D,mBAAiB,EAAE;AACnB,MAAI,WAAW,GAAG;AAClB,EAAAD,iBAAgB,sBAAsB,MAAM;AAC1C,OAAG,iBAAiB,iBAAiB,uBAAuB,EAAE,MAAM,KAAK,CAAC;AAC1E,OAAG,MAAM,SAAS,WAAW;AAC7B,OAAG,MAAM,2BAA2B;AACpC,kBAAc,EAAE;AAChB,0BAAsB,MAAM,GAAG,MAAM,SAAS,KAAK;AAAA,EACrD,CAAC;AACD,MAAI,cAAe,QAAO;AAC5B;;;ADzEA,SAAS,QAAAE,aAAY;;;AEPI,IAAMC,aAAS,KAAK,MAAM,yGAAkH;;;ACA5I,IAAMC,aAAS,KAAK,MAAM,wGAAoH;;;ACA9I,IAAMC,aAAS,KAAK,MAAM,uGAAmH;;;ACA7I,IAAMC,aAAS,KAAK,MAAM,uGAAmH;;;ACA7I,IAAMC,aAAS,KAAK,MAAM,wGAAiH;;;ANqBpK,IAAM,YAAY;AAAA,EAChB,SAAS;AAAA,EACT,OAAO;AAAA,EACP,SAAS;AACX;AAzBA;AA2BO,IAAM,YAAN,cAAwBC,cAAY;AAAA,EAiBzC,cAAc;AACZ,UAAM;AAlBH;AAmBH,IAAAC,cAAaC,YAAYA,YAAYA,YAAYA,YAAYA,UAAU;AAEvE,SAAK,KAAK,KAAK,IAAI,EAAE,SAAS,EAAE,IAAI,KAAK,OAAO,EAAE,SAAS,EAAE,EAAE,MAAM,GAAG,CAAC;AACzE,SAAK,OAAO;AACZ,SAAK,OAAO;AACZ,SAAK,WAAW;AAAA,EAClB;AAAA,EAEA,oBAAoB;AAClB,UAAM,kBAAkB;AAAA,EAC1B;AAAA,EAEA,uBAAuB;AACrB,UAAM,qBAAqB;AAAA,EAC7B;AAAA,EAEA,UAAU;AACR,QAAI,CAAC,KAAK,aAAa,KAAK,SAAU,QAAO,KAAK,UAAU,MAAO,KAAK,YAAY,IAAK;AAAA,EAC3F;AAAA,EAoBA,IAAI,WAAW;AApFjB;AAqFI,YAAO,gBAAK,eAAL,mBAAiB,cAAc,eAA/B,YAA6C;AAAA,EACtD;AAAA,EAEA,IAAI,WAAW;AACb,WAAO,KAAK,SAAS,UAAU;AAAA,EACjC;AAAA,EAEA,IAAI,SAAS;AACX,WAAO,KAAK,SAAS,UAAU;AAAA,EACjC;AAAA,EAEA,IAAI,QAAQ;AACV,WAAO,KAAK,UAAU,KAAK,WAAW,UAAU;AAAA,EAClD;AAAA,EAEA,IAAI,aAAa;AACf,QAAI,KAAK,UAAU;AACjB,aAAO,KAAK,EAAE;AAAA,QACZ,IAAI;AAAA,QACJ,SAAS;AAAA,QACT,SAAS;AAAA,MACX,CAAC;AAAA,IACH;AACA,QAAI,KAAK,QAAQ;AACf,aAAO,KAAK,EAAE;AAAA,QACZ,IAAI;AAAA,QACJ,SAAS;AAAA,QACT,SAAS;AAAA,MACX,CAAC;AAAA,IACH,OAAO;AACL,aAAO,KAAK,EAAE;AAAA,QACZ,IAAI;AAAA,QACJ,SAAS;AAAA,QACT,SAAS;AAAA,MACX,CAAC;AAAA,IACH;AAAA,EACF;AAAA,EAEA,IAAI,cAAc;AAChB,QAAI,KAAK,SAAU,QAAOC;AAC1B,QAAI,KAAK,OAAQ,QAAOA;AAAA,QACnB,QAAOA;AAAA,EACd;AAAA,EAEA,MAAM,WAAW;AACf,WAAO,IAAI,QAAQ,CAAC,YAAY;AAC9B,UAAI,KAAK,aAAa,KAAK,SAAU,UAAS,KAAK,UAAU,OAAO;AAAA,UAC/D,SAAQ;AAAA,IACf,CAAC;AAAA,EACH;AAAA,EAEA,QAAQ;AACN,UAAM,QAAQ,IAAI,YAAY,SAAS;AAAA,MACrC,QAAQ,EAAE,IAAI,KAAK,GAAG;AAAA,MACtB,SAAS;AAAA,MACT,UAAU;AAAA,IACZ,CAAC;AACD,SAAK,eAAe,KAAK,MAAM,KAAK,cAAc,KAAK,CAAC;AAAA,EAC1D;AAAA,EAEA,SAAS;AACP,QAAI,CAAC,KAAK,KAAM,QAAOA;AACvB,WAAOA,0BAAwB,MAAQ,OAAO,iBAAiB,KAAK,UAAU;AAAA,oBAC9D,mBAAK,yCAAe;AAAA,sBAClB,mBAAK,sCAAY,KAAK,KAAK,WAAW;AAAA,qBACvC,KAAK,KAAK,YAAY,MAAQ,OAAO;AAAA,eAC3C,KAAK,IAAI;AAAA;AAAA,UAEdC;AAAA,MACA,KAAK,aAAa;AAAA,MAClB,MAAMD;AAAA,6BACa,MAAQ,KAAK,aAAa,KAAK,KAAK;AAAA;AAAA;AAAA;AAAA,IAIzD,CAAC;AAAA;AAAA;AAAA,EAGP;AACF;AAzIO;AAuCD,qBAAe,WAAG;AACpB,SAAO,EAAW;AAAA,IAChB,MAAQ;AAAA,IACR,KAAK,SAAS,UAAU,WAAW,MAAQ;AAAA,IAC3C,KAAK,SAAS,UAAU,WAAW,MAAQ;AAAA,IAC3C,KAAK,SAAS,UAAU,SAAS,MAAQ;AAAA,EAC3C,CAAC;AACH;AAEI,kBAAY,WAAG;AACjB,SAAO,EAAW;AAAA,IAChB,MAAQ;AAAA,IACR,KAAK,SAAS,UAAU,WAAW,MAAQ;AAAA,IAC3C,KAAK,SAAS,UAAU,WAAW,MAAQ;AAAA,IAC3C,KAAK,SAAS,UAAU,SAAS,MAAQ;AAAA,EAC3C,CAAC;AACH;AAtDA,cADW,WACJ,UAAS;AAAA,EACdH,cAAY;AAAA,EACZK;AAAA;AAAA;AAAA;AAAA;AAKF;AAEA,cAVW,WAUJ,cAAa;AAAA,EAClB,IAAI,EAAE,MAAM,QAAQ,WAAW,MAAM,SAAS,KAAK;AAAA,EACnD,MAAM,EAAE,MAAM,QAAQ,WAAW,MAAM,SAAS,KAAK;AAAA,EACrD,MAAM,EAAE,MAAM,QAAQ,WAAW,MAAM,SAAS,KAAK;AAAA,EACrD,UAAU,EAAE,MAAM,SAAS,WAAW,MAAM,SAAS,KAAK;AAC5D;AA4HF,IAAI,CAAC,eAAe,IAAI,SAAS,GAAG;AAClC,iBAAe,OAAO,WAAW,SAAS;AAC5C;;;AOxKA,SAAS,OAAAC,OAAK,QAAAC,cAAY;AAE1B,OAAOC,mBAAiB;AAExB,SAAS,aAAAC,kBAAiB;AAE1B,IAAM,mBAAN,cAA+BC,cAAY;AAAA,EASzC,cAAc;AACZ,UAAM;AAEN,SAAK,OAAO;AACZ,SAAK,WAAW;AAChB,SAAK,iBAAiB;AAAA,EACxB;AAAA,EAEA,aAAa;AAEX,QAAI,CAAC,KAAK,UAAU;AAClB,WAAK,iBAAiB,CAAC,KAAK;AAAA,IAC9B;AAEA,QAAI,KAAK,QAAQ,KAAK,gBAAgB;AACpC,WAAK,iBAAiB;AAAA,IACxB;AAAA,EACF;AAAA,EAEA,UAAU;AACR,QAAI,CAAC,KAAK,SAAU;AAEpB,QAAI,CAAC,KAAK,UAAU;AAClB,WAAK,WAAW;AAChB;AAAA,IACF;AAGA,QAAI,KAAK,MAAM;AACb,aAAO,KAAK,QAAQ;AAAA,IACtB;AAEA,QAAI,CAAC,KAAK,QAAQ,CAAC,KAAK,gBAAgB;AACtC,eAAS,KAAK,UAAU,MAAO,KAAK,iBAAiB,IAAK;AAAA,IAC5D;AAAA,EACF;AAAA,EAEA,IAAI,WAAW;AACb,WAAO,sBAAQ;AAAA,EACjB;AAAA,EAWA,SAAS;AACP,WAAOC,0BAAwBC,WAAU,CAAC,KAAK,OAAO,SAAS,MAAS,CAAC,IAAI,KAAK,iBAAiBD,WAASA,qBAAmB;AAAA,EACjI;AACF;AA7DE,cADI,kBACG,cAAa;AAAA,EAClB,MAAM;AAAA,IACJ,MAAM;AAAA,IACN,SAAS;AAAA,EACX;AAAA,EACA,gBAAgB,EAAE,MAAM,SAAS,OAAO,KAAK;AAC/C;AA2CA,cAlDI,kBAkDG,UAAS;AAAA,EACdD,cAAY;AAAA,EACZG;AAAA;AAAA;AAAA;AAAA;AAKF;AAOF,IAAI,CAAC,eAAe,IAAI,qBAAqB,GAAG;AAC9C,iBAAe,OAAO,uBAAuB,gBAAgB;AAC/D;;;ACxEA,SAAS,QAAAC,cAAY;AAErB,OAAOC,mBAAiB;AACxB,SAAS,cAAAC,mBAAkB;AAE3B,IAAM,kBAAN,cAA8BC,cAAY;AAAA,EAOxC,IAAI,UAAU;AACZ,WAAO,KAAK,KAAK,KAAK;AAAA;AAAA;AAAA;AAAA,OAInB,KAAK,KAAK;AAAA;AAAA,EAEf;AAAA,EAEA,SAAS;AACP,WAAO,CAAC,KAAK,QAAQC,wBAAsBC,YAAW,KAAK,OAAO;AAAA,EACpE;AACF;AAlBE,cADI,iBACG,cAAa;AAAA,EAClB,OAAO,EAAE,MAAM,OAAO;AACxB;AAEA,cALI,iBAKG,UAAS,CAACF,cAAY,MAAM;AAgBrC,IAAI,CAAC,eAAe,IAAI,oBAAoB,GAAG;AAC7C,iBAAe,OAAO,sBAAsB,eAAe;AAC7D;",
-  "names": ["ErrorType", "unraw", "keys", "i", "a", "b", "suffix", "g", "offset", "size", "parse", "p", "c", "keys", "html", "n", "t", "r", "fields", "offset", "f", "offset", "_a", "_b", "offset", "_a", "__defProp", "__defNormalProp", "__publicField", "messages", "messages2", "messages", "defaultLocale", "i18n", "LitElement", "unsafeStatic", "html", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "detectByHost", "getSupportedLocale", "detectLocale", "getMessages", "activateI18n", "LitElement", "i18n", "html", "unsafeStatic", "html", "html", "WarpElement", "LitElement", "unsafeStatic", "html", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "detectByHost", "getSupportedLocale", "detectLocale", "getMessages", "activateI18n", "LitElement", "i18n", "html", "unsafeStatic", "LitElement", "unsafeStatic", "html", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "detectByHost", "getSupportedLocale", "detectLocale", "getMessages", "activateI18n", "LitElement", "i18n", "html", "unsafeStatic", "LitElement", "unsafeStatic", "html", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "detectByHost", "getSupportedLocale", "detectLocale", "getMessages", "activateI18n", "LitElement", "i18n", "html", "unsafeStatic", "LitElement", "unsafeStatic", "html", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "detectByHost", "getSupportedLocale", "detectLocale", "getMessages", "activateI18n", "LitElement", "i18n", "html", "unsafeStatic", "WarpElement", "html", "css", "html", "side", "y", "side", "platform", "y", "i", "max", "offset", "platform", "side", "placements", "sides", "d", "a", "b", "placement", "overflow", "platform", "side", "y", "x", "min", "max", "platform", "side", "css", "css", "y", "html", "cache", "offset", "shift", "flip", "size", "hide", "arrow", "computePosition", "cache", "d", "arrowRotation", "computePosition", "offset", "flip", "shift", "arrow", "hide", "size", "y", "WarpElement", "ifDefined", "supportedLocales", "defaultLocale", "getSupportedLocale", "detectLocale", "getMessages", "activateI18n", "messages", "messages", "messages", "messages", "messages", "messages", "WarpElement", "activateI18n", "messages", "html", "b", "ifDefined", "css", "html", "WarpElement", "WarpElement", "html", "css", "html", "nothing", "WarpElement", "WarpElement", "nothing", "html", "css", "html", "separator", "WarpElement", "messages", "messages", "messages", "messages", "messages", "html", "WarpElement", "activateI18n", "messages", "html", "WarpElement", "messages", "messages", "messages", "messages", "messages", "buttonTypes", "WarpElement", "activateI18n", "messages", "html", "html", "css", "WarpElement", "ifDefined", "messages", "messages", "messages", "messages", "messages", "WarpElement", "activateI18n", "messages", "html", "ifDefined", "css", "css", "html", "WarpElement", "ifDefined", "LitElement", "unsafeStatic", "html", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "detectByHost", "getSupportedLocale", "detectLocale", "getMessages", "activateI18n", "LitElement", "i18n", "html", "unsafeStatic", "LitElement", "unsafeStatic", "html", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "detectByHost", "getSupportedLocale", "detectLocale", "getMessages", "activateI18n", "LitElement", "i18n", "html", "unsafeStatic", "WarpElement", "html", "ifDefined", "css", "html", "WarpElement", "children", "WarpElement", "html", "html", "nothing", "LitElement", "unsafeStatic", "html", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "detectByHost", "getSupportedLocale", "detectLocale", "getMessages", "activateI18n", "LitElement", "i18n", "html", "unsafeStatic", "WarpElement", "messages", "messages", "messages", "messages", "messages", "WarpElement", "activateI18n", "messages", "html", "nothing", "css", "html", "WarpElement", "createRef", "ref", "r", "WarpElement", "createRef", "html", "ref", "css", "html", "WarpElement", "messages", "messages", "messages", "messages", "messages", "WarpElement", "activateI18n", "messages", "html", "html", "WarpElement", "ifDefined", "messages", "messages", "messages", "messages", "messages", "chevronClasses_get", "WarpElement", "activateI18n", "messages", "html", "ifDefined", "css", "html", "WarpElement", "ifDefined", "WarpElement", "html", "ifDefined", "css", "windowExists", "toast", "windowExists", "css", "html", "WarpElement", "WarpElement", "toast", "html", "css", "css", "html", "WarpElement", "windowExists", "r", "when", "messages", "messages", "messages", "messages", "messages", "WarpElement", "activateI18n", "messages", "html", "when", "css", "css", "html", "WarpElement", "ifDefined", "WarpElement", "html", "ifDefined", "css", "html", "WarpElement", "unsafeHTML", "WarpElement", "html", "unsafeHTML"]
+  "sources": ["../node_modules/.pnpm/unraw@3.0.0/node_modules/unraw/dist/errors.js", "../node_modules/.pnpm/unraw@3.0.0/node_modules/unraw/dist/index.js", "../node_modules/.pnpm/@lit+reactive-element@2.1.1/node_modules/@lit/reactive-element/src/css-tag.ts", "../node_modules/.pnpm/@lit+reactive-element@2.1.1/node_modules/@lit/reactive-element/src/reactive-element.ts", "../node_modules/.pnpm/lit-html@3.3.1/node_modules/lit-html/src/lit-html.ts", "../node_modules/.pnpm/lit-element@4.2.1/node_modules/lit-element/src/lit-element.ts", "../node_modules/.pnpm/@chbphone55+classnames@2.0.0/node_modules/@chbphone55/classnames/dist/index.m.js", "../node_modules/.pnpm/@lit+reactive-element@2.1.1/node_modules/@lit/reactive-element/src/decorators/property.ts", "../node_modules/.pnpm/@lit+reactive-element@2.1.1/node_modules/@lit/reactive-element/src/decorators/state.ts", "../node_modules/.pnpm/@lit+reactive-element@2.1.1/node_modules/@lit/reactive-element/src/decorators/base.ts", "../node_modules/.pnpm/@lit+reactive-element@2.1.1/node_modules/@lit/reactive-element/src/decorators/query.ts", "../node_modules/.pnpm/lit-html@3.3.1/node_modules/lit-html/src/directives/if-defined.ts", "../packages/styles.ts", "../packages/affix/styles.ts", "../node_modules/.pnpm/lit-html@3.3.1/node_modules/lit-html/src/static.ts", "../node_modules/.pnpm/@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-macros@3.1.0_ty_33a2537ce57a59324989ce8020998d0e/node_modules/@lingui/core/dist/index.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/elements/search-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/search/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/search/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/search/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/search/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/search/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/elements/close-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/close/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/close/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/close/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/close/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/close/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../packages/affix/index.ts", "../node_modules/.pnpm/lit-html@3.3.1/node_modules/lit-html/src/directive.ts", "../node_modules/.pnpm/lit-html@3.3.1/node_modules/lit-html/src/directives/class-map.ts", "../packages/utils/index.js", "../node_modules/.pnpm/@floating-ui+utils@0.2.10/node_modules/@floating-ui/utils/dist/floating-ui.utils.mjs", "../node_modules/.pnpm/@floating-ui+core@1.7.3/node_modules/@floating-ui/core/dist/floating-ui.core.mjs", "../node_modules/.pnpm/@floating-ui+utils@0.2.10/node_modules/@floating-ui/utils/dist/floating-ui.utils.dom.mjs", "../node_modules/.pnpm/@floating-ui+dom@1.6.13/node_modules/@floating-ui/dom/dist/floating-ui.dom.mjs", "../node_modules/.pnpm/@warp-ds+core@1.1.8_@floating-ui+dom@1.6.13/node_modules/@warp-ds/core/dist/attention/utils/helpers.js", "../packages/i18n.ts", "../packages/attention/layout-styles.ts", "../packages/attention/locales/da/messages.mjs", "../packages/attention/locales/en/messages.mjs", "../packages/attention/locales/fi/messages.mjs", "../packages/attention/locales/nb/messages.mjs", "../packages/attention/locales/sv/messages.mjs", "../packages/attention/styles.ts", "../packages/attention/index.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/elements/info-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/info/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/info/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/info/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/info/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/info/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/elements/warning-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/warning/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/warning/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/warning/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/warning/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/warning/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/elements/error-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/error/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/error/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/error/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/error/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/error/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/elements/success-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/success/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/success/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/success/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/success/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/success/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../packages/alert/styles.ts", "../packages/alert/index.ts", "../packages/badge/styles.ts", "../packages/badge/index.ts", "../packages/box/styles.ts", "../packages/box/index.ts", "../node_modules/.pnpm/@warp-ds+core@1.1.8_@floating-ui+dom@1.6.13/node_modules/@warp-ds/core/dist/breadcrumbs/index.js", "../packages/breadcrumbs/locales/da/messages.mjs", "../packages/breadcrumbs/locales/en/messages.mjs", "../packages/breadcrumbs/locales/fi/messages.mjs", "../packages/breadcrumbs/locales/nb/messages.mjs", "../packages/breadcrumbs/locales/sv/messages.mjs", "../packages/breadcrumbs/styles.ts", "../packages/breadcrumbs/index.ts", "../node_modules/.pnpm/@open-wc+form-control@1.0.0/node_modules/@open-wc/form-control/src/FormControlMixin.ts", "../packages/link/index.ts", "../packages/link/styles.ts", "../packages/button/index.ts", "../packages/button/locales/da/messages.mjs", "../packages/button/locales/en/messages.mjs", "../packages/button/locales/fi/messages.mjs", "../packages/button/locales/nb/messages.mjs", "../packages/button/locales/sv/messages.mjs", "../packages/button/styles.ts", "../packages/card/locales/da/messages.mjs", "../packages/card/locales/en/messages.mjs", "../packages/card/locales/fi/messages.mjs", "../packages/card/locales/nb/messages.mjs", "../packages/card/locales/sv/messages.mjs", "../packages/card/styles.ts", "../packages/card/index.ts", "../packages/datepicker/datepicker.ts", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/constants.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/constructFrom.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/toDate.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addDays.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addMonths.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/defaultOptions.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfWeek.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfISOWeek.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getISOWeekYear.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/getTimezoneOffsetInMilliseconds.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/normalizeDates.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfDay.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInCalendarDays.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfISOWeekYear.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addWeeks.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/constructNow.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameDay.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isDate.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isValid.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/normalizeInterval.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachDayOfInterval.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachWeekOfInterval.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfMonth.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfYear.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfWeek.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US/_lib/formatDistance.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/_lib/buildFormatLongFn.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US/_lib/formatLong.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US/_lib/formatRelative.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/_lib/buildLocalizeFn.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US/_lib/localize.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/_lib/buildMatchFn.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/_lib/buildMatchPatternFn.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US/_lib/match.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDayOfYear.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getISOWeek.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getWeekYear.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfWeekYear.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getWeek.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/addLeadingZeros.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/format/lightFormatters.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/format/formatters.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/format/longFormatters.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/protectedTokens.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/format.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatISO.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDate.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDay.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getWeekOfMonth.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lastDayOfMonth.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameMonth.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isToday.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subDays.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfToday.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subMonths.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/da/_lib/formatDistance.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/da/_lib/formatLong.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/da/_lib/formatRelative.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/da/_lib/localize.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/da/_lib/match.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/da.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-GB/_lib/formatLong.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-GB.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/fi/_lib/formatDistance.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/fi/_lib/formatLong.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/fi/_lib/formatRelative.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/fi/_lib/localize.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/fi/_lib/match.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/fi.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/nb/_lib/formatDistance.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/nb/_lib/formatLong.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/nb/_lib/formatRelative.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/nb/_lib/localize.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/nb/_lib/match.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/nb.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/sv/_lib/formatDistance.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/sv/_lib/formatLong.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/sv/_lib/formatRelative.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/sv/_lib/localize.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/sv/_lib/match.js", "../node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/sv.js", "../node_modules/.pnpm/lit-html@3.3.1/node_modules/lit-html/src/directives/style-map.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/elements/calendar-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/calendar/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/calendar/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/calendar/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/calendar/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/calendar/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/elements/chevron-left-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-left/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-left/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-left/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-left/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-left/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/elements/chevron-right-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-right/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-right/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-right/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-right/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-right/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../packages/datepicker/locales/da/messages.mjs", "../packages/datepicker/locales/en/messages.mjs", "../packages/datepicker/locales/fi/messages.mjs", "../packages/datepicker/locales/nb/messages.mjs", "../packages/datepicker/locales/sv/messages.mjs", "../packages/datepicker/styles/w-datepicker-calendar.styles.ts", "../packages/datepicker/styles/w-datepicker-day.styles.ts", "../packages/datepicker/styles/w-datepicker-month.styles.ts", "../packages/datepicker/styles/w-datepicker.styles.ts", "../packages/datepicker/utils.ts", "../packages/dead-toggle/index.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/elements/chevron-down-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-down/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-down/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-down/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-down/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-down/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/elements/chevron-up-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-up/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-up/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-up/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-up/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-up/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../packages/expandable/styles.ts", "../packages/expandable/index.ts", "../packages/modal/util.ts", "../packages/modal/modal-footer.ts", "../node_modules/.pnpm/@itsy+animate@0.0.9/node_modules/@itsy/animate/src/utility.js", "../node_modules/.pnpm/@itsy+animate@0.0.9/node_modules/@itsy/animate/src/reduce-motion.js", "../node_modules/.pnpm/@itsy+animate@0.0.9/node_modules/@itsy/animate/src/move.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/elements/arrow-left-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/arrow-left/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/arrow-left/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/arrow-left/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/arrow-left/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/arrow-left/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../packages/modal/locales/da/messages.mjs", "../packages/modal/locales/en/messages.mjs", "../packages/modal/locales/fi/messages.mjs", "../packages/modal/locales/nb/messages.mjs", "../packages/modal/locales/sv/messages.mjs", "../packages/modal/modal-header.ts", "../node_modules/.pnpm/scroll-doctor@2.0.2/node_modules/scroll-doctor/dist/scroll-doctor.js", "../packages/modal/modal-main.ts", "../node_modules/.pnpm/lit-html@3.3.1/node_modules/lit-html/src/directives/map.ts", "../node_modules/.pnpm/lit-html@3.3.1/node_modules/lit-html/src/directives/range.ts", "../packages/pageindicator/style.ts", "../packages/pageindicator/index.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/elements/chevron-double-left-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-double-left/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-double-left/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-double-left/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-double-left/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/chevron-double-left/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../packages/pagination/locales/da/messages.mjs", "../packages/pagination/locales/en/messages.mjs", "../packages/pagination/locales/fi/messages.mjs", "../packages/pagination/locales/nb/messages.mjs", "../packages/pagination/locales/sv/messages.mjs", "../packages/pagination/styles.ts", "../packages/pagination/index.ts", "../packages/pill/locales/da/messages.mjs", "../packages/pill/locales/en/messages.mjs", "../packages/pill/locales/fi/messages.mjs", "../packages/pill/locales/nb/messages.mjs", "../packages/pill/locales/sv/messages.mjs", "../packages/pill/styles.ts", "../packages/pill/index.ts", "../node_modules/.pnpm/lit-html@3.3.1/node_modules/lit-html/src/directive-helpers.ts", "../node_modules/.pnpm/lit-html@3.3.1/node_modules/lit-html/src/directives/live.ts", "../packages/rip-and-tear-radio/host.css", "../packages/rip-and-tear-radio/base-element.ts", "../packages/rip-and-tear-radio/custom-error-validator.ts", "../packages/rip-and-tear-radio/invalid.ts", "../packages/rip-and-tear-radio/form-associated-element.ts", "../packages/rip-and-tear-radio/required-validator.ts", "../packages/rip-and-tear-radio/slot.ts", "../packages/rip-and-tear-radio/watch.ts", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/elements/check-16.js", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/check/locales/nb/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/check/locales/en/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/check/locales/fi/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/check/locales/da/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/raw/check/locales/sv/messages.mjs", "../node_modules/.pnpm/@warp-ds+icons@2.5.0_@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-p_f73b1d3c5bd9121d6f30248535f1f172/node_modules/@warp-ds/icons/src/utils/i18n.ts", "../packages/rip-and-tear-checkbox/checkbox.css", "../packages/rip-and-tear-checkbox/checkbox.ts", "../packages/rip-and-tear-checkbox/index.ts", "../packages/rip-and-tear-radio/radio.css", "../packages/rip-and-tear-radio/radio.ts", "../node_modules/.pnpm/nanoid@5.1.5/node_modules/nanoid/url-alphabet/index.js", "../node_modules/.pnpm/nanoid@5.1.5/node_modules/nanoid/index.browser.js", "../packages/rip-and-tear-radio/math.ts", "../packages/rip-and-tear-radio/radio-group.css", "../packages/rip-and-tear-radio/radio-group.ts", "../packages/rip-and-tear-radio/index.ts", "../node_modules/.pnpm/lit-html@3.3.1/node_modules/lit-html/src/directives/unsafe-html.ts", "../node_modules/.pnpm/lit-html@3.3.1/node_modules/lit-html/src/directives/when.ts", "../packages/select/locales/da/messages.mjs", "../packages/select/locales/en/messages.mjs", "../packages/select/locales/fi/messages.mjs", "../packages/select/locales/nb/messages.mjs", "../packages/select/locales/sv/messages.mjs", "../packages/select/styles.ts", "../packages/select/index.ts", "../packages/steps/locales/da/messages.mjs", "../packages/steps/locales/en/messages.mjs", "../packages/steps/locales/fi/messages.mjs", "../packages/steps/locales/nb/messages.mjs", "../packages/steps/locales/sv/messages.mjs", "../packages/steps/styles.ts", "../packages/steps/index.ts", "../packages/switch/styles.ts", "../packages/switch/index.ts", "../packages/tabs/styles.ts", "../packages/tabs/tabs.ts", "../packages/tabs/tab.ts", "../packages/tabs/tab-panel.ts", "../packages/textfield/index.ts", "../packages/textfield/styles.ts", "../node_modules/.pnpm/element-collapse@1.1.0/node_modules/element-collapse/index.js", "../packages/toast/locales/da/messages.mjs", "../packages/toast/locales/en/messages.mjs", "../packages/toast/locales/fi/messages.mjs", "../packages/toast/locales/nb/messages.mjs", "../packages/toast/locales/sv/messages.mjs", "../packages/toast/styles.ts", "../packages/toast/toast.ts", "../node_modules/.pnpm/lit-html@3.3.1/node_modules/lit-html/src/directives/repeat.ts", "../packages/toast/toast-container.ts", "../packages/utils/window-exists.js", "../packages/toast/api.ts"],
+  "sourcesContent": ["\"use strict\";\n// NOTE: don't construct errors here or they'll have the wrong stack trace.\n// NOTE: don't make custom error class; the JS engines use `SyntaxError`\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.errorMessages = exports.ErrorType = void 0;\n/**\n * Keys for possible error messages used by `unraw`.\n * Note: These do _not_ map to actual error object types. All errors thrown\n * are `SyntaxError`.\n */\n// Don't use const enum or JS users won't be able to access the enum values\nvar ErrorType;\n(function (ErrorType) {\n    /**\n     * Thrown when a badly formed Unicode escape sequence is found. Possible\n     * reasons include the code being too short (`\"\\u25\"`) or having invalid\n     * characters (`\"\\u2$A5\"`).\n     */\n    ErrorType[\"MalformedUnicode\"] = \"MALFORMED_UNICODE\";\n    /**\n     * Thrown when a badly formed hexadecimal escape sequence is found. Possible\n     * reasons include the code being too short (`\"\\x2\"`) or having invalid\n     * characters (`\"\\x2$\"`).\n     */\n    ErrorType[\"MalformedHexadecimal\"] = \"MALFORMED_HEXADECIMAL\";\n    /**\n     * Thrown when a Unicode code point escape sequence has too high of a code\n     * point. The maximum code point allowed is `\\u{10FFFF}`, so `\\u{110000}` and\n     * higher will throw this error.\n     */\n    ErrorType[\"CodePointLimit\"] = \"CODE_POINT_LIMIT\";\n    /**\n     * Thrown when an octal escape sequences is encountered and `allowOctals` is\n     * `false`. For example, `unraw(\"\\234\", false)`.\n     */\n    ErrorType[\"OctalDeprecation\"] = \"OCTAL_DEPRECATION\";\n    /**\n     * Thrown only when a single backslash is found at the end of a string. For\n     * example, `\"\\\\\"` or `\"test\\\\x24\\\\\"`.\n     */\n    ErrorType[\"EndOfString\"] = \"END_OF_STRING\";\n})(ErrorType = exports.ErrorType || (exports.ErrorType = {}));\n/** Map of error message names to the full text of the message. */\nexports.errorMessages = new Map([\n    [ErrorType.MalformedUnicode, \"malformed Unicode character escape sequence\"],\n    [\n        ErrorType.MalformedHexadecimal,\n        \"malformed hexadecimal character escape sequence\"\n    ],\n    [\n        ErrorType.CodePointLimit,\n        \"Unicode codepoint must not be greater than 0x10FFFF in escape sequence\"\n    ],\n    [\n        ErrorType.OctalDeprecation,\n        '\"0\"-prefixed octal literals and octal escape sequences are deprecated; ' +\n            'for octal literals use the \"0o\" prefix instead'\n    ],\n    [ErrorType.EndOfString, \"malformed escape sequence at end of string\"]\n]);\n", "\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.unraw = exports.errorMessages = exports.ErrorType = void 0;\nconst errors_1 = require(\"./errors\");\nObject.defineProperty(exports, \"ErrorType\", { enumerable: true, get: function () { return errors_1.ErrorType; } });\nObject.defineProperty(exports, \"errorMessages\", { enumerable: true, get: function () { return errors_1.errorMessages; } });\n/**\n * Parse a string as a base-16 number. This is more strict than `parseInt` as it\n * will not allow any other characters, including (for example) \"+\", \"-\", and\n * \".\".\n * @param hex A string containing a hexadecimal number.\n * @returns The parsed integer, or `NaN` if the string is not a valid hex\n * number.\n */\nfunction parseHexToInt(hex) {\n    const isOnlyHexChars = !hex.match(/[^a-f0-9]/i);\n    return isOnlyHexChars ? parseInt(hex, 16) : NaN;\n}\n/**\n * Check the validity and length of a hexadecimal code and optionally enforces\n * a specific number of hex digits.\n * @param hex The string to validate and parse.\n * @param errorName The name of the error message to throw a `SyntaxError` with\n * if `hex` is invalid. This is used to index `errorMessages`.\n * @param enforcedLength If provided, will throw an error if `hex` is not\n * exactly this many characters.\n * @returns The parsed hex number as a normal number.\n * @throws {SyntaxError} If the code is not valid.\n */\nfunction validateAndParseHex(hex, errorName, enforcedLength) {\n    const parsedHex = parseHexToInt(hex);\n    if (Number.isNaN(parsedHex) ||\n        (enforcedLength !== undefined && enforcedLength !== hex.length)) {\n        throw new SyntaxError(errors_1.errorMessages.get(errorName));\n    }\n    return parsedHex;\n}\n/**\n * Parse a two-digit hexadecimal character escape code.\n * @param code The two-digit hexadecimal number that represents the character to\n * output.\n * @returns The single character represented by the code.\n * @throws {SyntaxError} If the code is not valid hex or is not the right\n * length.\n */\nfunction parseHexadecimalCode(code) {\n    const parsedCode = validateAndParseHex(code, errors_1.ErrorType.MalformedHexadecimal, 2);\n    return String.fromCharCode(parsedCode);\n}\n/**\n * Parse a four-digit Unicode character escape code.\n * @param code The four-digit unicode number that represents the character to\n * output.\n * @param surrogateCode Optional four-digit unicode surrogate that represents\n * the other half of the character to output.\n * @returns The single character represented by the code.\n * @throws {SyntaxError} If the codes are not valid hex or are not the right\n * length.\n */\nfunction parseUnicodeCode(code, surrogateCode) {\n    const parsedCode = validateAndParseHex(code, errors_1.ErrorType.MalformedUnicode, 4);\n    if (surrogateCode !== undefined) {\n        const parsedSurrogateCode = validateAndParseHex(surrogateCode, errors_1.ErrorType.MalformedUnicode, 4);\n        return String.fromCharCode(parsedCode, parsedSurrogateCode);\n    }\n    return String.fromCharCode(parsedCode);\n}\n/**\n * Test if the text is surrounded by curly braces (`{}`).\n * @param text Text to check.\n * @returns `true` if the text is in the form `{*}`.\n */\nfunction isCurlyBraced(text) {\n    return text.charAt(0) === \"{\" && text.charAt(text.length - 1) === \"}\";\n}\n/**\n * Parse a Unicode code point character escape code.\n * @param codePoint A unicode escape code point, including the surrounding curly\n * braces.\n * @returns The single character represented by the code.\n * @throws {SyntaxError} If the code is not valid hex or does not have the\n * surrounding curly braces.\n */\nfunction parseUnicodeCodePointCode(codePoint) {\n    if (!isCurlyBraced(codePoint)) {\n        throw new SyntaxError(errors_1.errorMessages.get(errors_1.ErrorType.MalformedUnicode));\n    }\n    const withoutBraces = codePoint.slice(1, -1);\n    const parsedCode = validateAndParseHex(withoutBraces, errors_1.ErrorType.MalformedUnicode);\n    try {\n        return String.fromCodePoint(parsedCode);\n    }\n    catch (err) {\n        throw err instanceof RangeError\n            ? new SyntaxError(errors_1.errorMessages.get(errors_1.ErrorType.CodePointLimit))\n            : err;\n    }\n}\n// Have to give overload that takes boolean for when compiler doesn't know if\n// true or false\nfunction parseOctalCode(code, error = false) {\n    if (error) {\n        throw new SyntaxError(errors_1.errorMessages.get(errors_1.ErrorType.OctalDeprecation));\n    }\n    // The original regex only allows digits so we don't need to have a strict\n    // octal parser like hexToInt. Length is not enforced for octals.\n    const parsedCode = parseInt(code, 8);\n    return String.fromCharCode(parsedCode);\n}\n/**\n * Map of unescaped letters to their corresponding special JS escape characters.\n * Intentionally does not include characters that map to themselves like \"\\'\".\n */\nconst singleCharacterEscapes = new Map([\n    [\"b\", \"\\b\"],\n    [\"f\", \"\\f\"],\n    [\"n\", \"\\n\"],\n    [\"r\", \"\\r\"],\n    [\"t\", \"\\t\"],\n    [\"v\", \"\\v\"],\n    [\"0\", \"\\0\"]\n]);\n/**\n * Parse a single character escape sequence and return the matching character.\n * If none is matched, defaults to `code`.\n * @param code A single character code.\n */\nfunction parseSingleCharacterCode(code) {\n    return singleCharacterEscapes.get(code) || code;\n}\n/**\n * Matches every escape sequence possible, including invalid ones.\n *\n * All capture groups (described below) are unique (only one will match), except\n * for 4, which can only potentially match if 3 does.\n *\n * **Capture Groups:**\n * 0. A single backslash\n * 1. Hexadecimal code\n * 2. Unicode code point code with surrounding curly braces\n * 3. Unicode escape code with surrogate\n * 4. Surrogate code\n * 5. Unicode escape code without surrogate\n * 6. Octal code _NOTE: includes \"0\"._\n * 7. A single character (will never be \\, x, u, or 0-3)\n */\nconst escapeMatch = /\\\\(?:(\\\\)|x([\\s\\S]{0,2})|u(\\{[^}]*\\}?)|u([\\s\\S]{4})\\\\u([^{][\\s\\S]{0,3})|u([\\s\\S]{0,4})|([0-3]?[0-7]{1,2})|([\\s\\S])|$)/g;\n/**\n * Replace raw escape character strings with their escape characters.\n * @param raw A string where escape characters are represented as raw string\n * values like `\\'` rather than `'`.\n * @param allowOctals If `true`, will process the now-deprecated octal escape\n * sequences (ie, `\\111`).\n * @returns The processed string, with escape characters replaced by their\n * respective actual Unicode characters.\n */\nfunction unraw(raw, allowOctals = false) {\n    return raw.replace(escapeMatch, function (_, backslash, hex, codePoint, unicodeWithSurrogate, surrogate, unicode, octal, singleCharacter) {\n        // Compare groups to undefined because empty strings mean different errors\n        // Otherwise, `\\u` would fail the same as `\\` which is wrong.\n        if (backslash !== undefined) {\n            return \"\\\\\";\n        }\n        if (hex !== undefined) {\n            return parseHexadecimalCode(hex);\n        }\n        if (codePoint !== undefined) {\n            return parseUnicodeCodePointCode(codePoint);\n        }\n        if (unicodeWithSurrogate !== undefined) {\n            return parseUnicodeCode(unicodeWithSurrogate, surrogate);\n        }\n        if (unicode !== undefined) {\n            return parseUnicodeCode(unicode);\n        }\n        if (octal === \"0\") {\n            return \"\\0\";\n        }\n        if (octal !== undefined) {\n            return parseOctalCode(octal, !allowOctals);\n        }\n        if (singleCharacter !== undefined) {\n            return parseSingleCharacterCode(singleCharacter);\n        }\n        throw new SyntaxError(errors_1.errorMessages.get(errors_1.ErrorType.EndOfString));\n    });\n}\nexports.unraw = unraw;\nexports.default = unraw;\n", "/**\n * @license\n * Copyright 2019 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\nconst NODE_MODE = false;\n\n// Allows minifiers to rename references to globalThis\nconst global = globalThis;\n\n/**\n * Whether the current browser supports `adoptedStyleSheets`.\n */\nexport const supportsAdoptingStyleSheets: boolean =\n  global.ShadowRoot &&\n  (global.ShadyCSS === undefined || global.ShadyCSS.nativeShadow) &&\n  'adoptedStyleSheets' in Document.prototype &&\n  'replace' in CSSStyleSheet.prototype;\n\n/**\n * A CSSResult or native CSSStyleSheet.\n *\n * In browsers that support constructible CSS style sheets, CSSStyleSheet\n * object can be used for styling along side CSSResult from the `css`\n * template tag.\n */\nexport type CSSResultOrNative = CSSResult | CSSStyleSheet;\n\nexport type CSSResultArray = Array<CSSResultOrNative | CSSResultArray>;\n\n/**\n * A single CSSResult, CSSStyleSheet, or an array or nested arrays of those.\n */\nexport type CSSResultGroup = CSSResultOrNative | CSSResultArray;\n\nconst constructionToken = Symbol();\n\nconst cssTagCache = new WeakMap<TemplateStringsArray, CSSStyleSheet>();\n\n/**\n * A container for a string of CSS text, that may be used to create a CSSStyleSheet.\n *\n * CSSResult is the return value of `css`-tagged template literals and\n * `unsafeCSS()`. In order to ensure that CSSResults are only created via the\n * `css` tag and `unsafeCSS()`, CSSResult cannot be constructed directly.\n */\nexport class CSSResult {\n  // This property needs to remain unminified.\n  ['_$cssResult$'] = true;\n  readonly cssText: string;\n  private _styleSheet?: CSSStyleSheet;\n  private _strings: TemplateStringsArray | undefined;\n\n  private constructor(\n    cssText: string,\n    strings: TemplateStringsArray | undefined,\n    safeToken: symbol\n  ) {\n    if (safeToken !== constructionToken) {\n      throw new Error(\n        'CSSResult is not constructable. Use `unsafeCSS` or `css` instead.'\n      );\n    }\n    this.cssText = cssText;\n    this._strings = strings;\n  }\n\n  // This is a getter so that it's lazy. In practice, this means stylesheets\n  // are not created until the first element instance is made.\n  get styleSheet(): CSSStyleSheet | undefined {\n    // If `supportsAdoptingStyleSheets` is true then we assume CSSStyleSheet is\n    // constructable.\n    let styleSheet = this._styleSheet;\n    const strings = this._strings;\n    if (supportsAdoptingStyleSheets && styleSheet === undefined) {\n      const cacheable = strings !== undefined && strings.length === 1;\n      if (cacheable) {\n        styleSheet = cssTagCache.get(strings);\n      }\n      if (styleSheet === undefined) {\n        (this._styleSheet = styleSheet = new CSSStyleSheet()).replaceSync(\n          this.cssText\n        );\n        if (cacheable) {\n          cssTagCache.set(strings, styleSheet);\n        }\n      }\n    }\n    return styleSheet;\n  }\n\n  toString(): string {\n    return this.cssText;\n  }\n}\n\ntype ConstructableCSSResult = CSSResult & {\n  new (\n    cssText: string,\n    strings: TemplateStringsArray | undefined,\n    safeToken: symbol\n  ): CSSResult;\n};\n\nconst textFromCSSResult = (value: CSSResultGroup | number) => {\n  // This property needs to remain unminified.\n  if ((value as CSSResult)['_$cssResult$'] === true) {\n    return (value as CSSResult).cssText;\n  } else if (typeof value === 'number') {\n    return value;\n  } else {\n    throw new Error(\n      `Value passed to 'css' function must be a 'css' function result: ` +\n        `${value}. Use 'unsafeCSS' to pass non-literal values, but take care ` +\n        `to ensure page security.`\n    );\n  }\n};\n\n/**\n * Wrap a value for interpolation in a {@linkcode css} tagged template literal.\n *\n * This is unsafe because untrusted CSS text can be used to phone home\n * or exfiltrate data to an attacker controlled site. Take care to only use\n * this with trusted input.\n */\nexport const unsafeCSS = (value: unknown) =>\n  new (CSSResult as ConstructableCSSResult)(\n    typeof value === 'string' ? value : String(value),\n    undefined,\n    constructionToken\n  );\n\n/**\n * A template literal tag which can be used with LitElement's\n * {@linkcode LitElement.styles} property to set element styles.\n *\n * For security reasons, only literal string values and number may be used in\n * embedded expressions. To incorporate non-literal values {@linkcode unsafeCSS}\n * may be used inside an expression.\n */\nexport const css = (\n  strings: TemplateStringsArray,\n  ...values: (CSSResultGroup | number)[]\n): CSSResult => {\n  const cssText =\n    strings.length === 1\n      ? strings[0]\n      : values.reduce(\n          (acc, v, idx) => acc + textFromCSSResult(v) + strings[idx + 1],\n          strings[0]\n        );\n  return new (CSSResult as ConstructableCSSResult)(\n    cssText,\n    strings,\n    constructionToken\n  );\n};\n\n/**\n * Applies the given styles to a `shadowRoot`. When Shadow DOM is\n * available but `adoptedStyleSheets` is not, styles are appended to the\n * `shadowRoot` to [mimic the native feature](https://developer.mozilla.org/en-US/docs/Web/API/ShadowRoot/adoptedStyleSheets).\n * Note, when shimming is used, any styles that are subsequently placed into\n * the shadowRoot should be placed *before* any shimmed adopted styles. This\n * will match spec behavior that gives adopted sheets precedence over styles in\n * shadowRoot.\n */\nexport const adoptStyles = (\n  renderRoot: ShadowRoot,\n  styles: Array<CSSResultOrNative>\n) => {\n  if (supportsAdoptingStyleSheets) {\n    (renderRoot as ShadowRoot).adoptedStyleSheets = styles.map((s) =>\n      s instanceof CSSStyleSheet ? s : s.styleSheet!\n    );\n  } else {\n    for (const s of styles) {\n      const style = document.createElement('style');\n      // eslint-disable-next-line @typescript-eslint/no-explicit-any\n      const nonce = (global as any)['litNonce'];\n      if (nonce !== undefined) {\n        style.setAttribute('nonce', nonce);\n      }\n      style.textContent = (s as CSSResult).cssText;\n      renderRoot.appendChild(style);\n    }\n  }\n};\n\nconst cssResultFromStyleSheet = (sheet: CSSStyleSheet) => {\n  let cssText = '';\n  for (const rule of sheet.cssRules) {\n    cssText += rule.cssText;\n  }\n  return unsafeCSS(cssText);\n};\n\nexport const getCompatibleStyle =\n  supportsAdoptingStyleSheets ||\n  (NODE_MODE && global.CSSStyleSheet === undefined)\n    ? (s: CSSResultOrNative) => s\n    : (s: CSSResultOrNative) =>\n        s instanceof CSSStyleSheet ? cssResultFromStyleSheet(s) : s;\n", "/**\n * @license\n * Copyright 2017 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\n/**\n * Use this module if you want to create your own base class extending\n * {@link ReactiveElement}.\n * @packageDocumentation\n */\n\nimport {\n  getCompatibleStyle,\n  adoptStyles,\n  CSSResultGroup,\n  CSSResultOrNative,\n} from './css-tag.js';\nimport type {\n  ReactiveController,\n  ReactiveControllerHost,\n} from './reactive-controller.js';\n\n// In the Node build, this import will be injected by Rollup:\n// import {HTMLElement, customElements} from '@lit-labs/ssr-dom-shim';\n\nexport * from './css-tag.js';\nexport type {\n  ReactiveController,\n  ReactiveControllerHost,\n} from './reactive-controller.js';\n\n/**\n * Removes the `readonly` modifier from properties in the union K.\n *\n * This is a safer way to cast a value to a type with a mutable version of a\n * readonly field, than casting to an interface with the field re-declared\n * because it preserves the type of all the fields and warns on typos.\n */\ntype Mutable<T, K extends keyof T> = Omit<T, K> & {\n  -readonly [P in keyof Pick<T, K>]: P extends K ? T[P] : never;\n};\n\n// TODO (justinfagnani): Add `hasOwn` here when we ship ES2022\nconst {\n  is,\n  defineProperty,\n  getOwnPropertyDescriptor,\n  getOwnPropertyNames,\n  getOwnPropertySymbols,\n  getPrototypeOf,\n} = Object;\n\nconst NODE_MODE = false;\n\n// Lets a minifier replace globalThis references with a minified name\nconst global = globalThis;\n\nif (NODE_MODE) {\n  global.customElements ??= customElements;\n}\n\nconst DEV_MODE = true;\n\nlet issueWarning: (code: string, warning: string) => void;\n\nconst trustedTypes = (global as unknown as {trustedTypes?: {emptyScript: ''}})\n  .trustedTypes;\n\n// Temporary workaround for https://crbug.com/993268\n// Currently, any attribute starting with \"on\" is considered to be a\n// TrustedScript source. Such boolean attributes must be set to the equivalent\n// trusted emptyScript value.\nconst emptyStringForBooleanAttribute = trustedTypes\n  ? (trustedTypes.emptyScript as unknown as '')\n  : '';\n\nconst polyfillSupport = DEV_MODE\n  ? global.reactiveElementPolyfillSupportDevMode\n  : global.reactiveElementPolyfillSupport;\n\nif (DEV_MODE) {\n  // Ensure warnings are issued only 1x, even if multiple versions of Lit\n  // are loaded.\n  global.litIssuedWarnings ??= new Set();\n\n  /**\n   * Issue a warning if we haven't already, based either on `code` or `warning`.\n   * Warnings are disabled automatically only by `warning`; disabling via `code`\n   * can be done by users.\n   */\n  issueWarning = (code: string, warning: string) => {\n    warning += ` See https://lit.dev/msg/${code} for more information.`;\n    if (\n      !global.litIssuedWarnings!.has(warning) &&\n      !global.litIssuedWarnings!.has(code)\n    ) {\n      console.warn(warning);\n      global.litIssuedWarnings!.add(warning);\n    }\n  };\n\n  queueMicrotask(() => {\n    issueWarning(\n      'dev-mode',\n      `Lit is in dev mode. Not recommended for production!`\n    );\n\n    // Issue polyfill support warning.\n    if (global.ShadyDOM?.inUse && polyfillSupport === undefined) {\n      issueWarning(\n        'polyfill-support-missing',\n        `Shadow DOM is being polyfilled via \\`ShadyDOM\\` but ` +\n          `the \\`polyfill-support\\` module has not been loaded.`\n      );\n    }\n  });\n}\n\n/**\n * Contains types that are part of the unstable debug API.\n *\n * Everything in this API is not stable and may change or be removed in the future,\n * even on patch releases.\n */\n// eslint-disable-next-line @typescript-eslint/no-namespace\nexport namespace ReactiveUnstable {\n  /**\n   * When Lit is running in dev mode and `window.emitLitDebugLogEvents` is true,\n   * we will emit 'lit-debug' events to window, with live details about the update and render\n   * lifecycle. These can be useful for writing debug tooling and visualizations.\n   *\n   * Please be aware that running with window.emitLitDebugLogEvents has performance overhead,\n   * making certain operations that are normally very cheap (like a no-op render) much slower,\n   * because we must copy data and dispatch events.\n   */\n  // eslint-disable-next-line @typescript-eslint/no-namespace\n  export namespace DebugLog {\n    export type Entry = Update;\n    export interface Update {\n      kind: 'update';\n    }\n  }\n}\n\ninterface DebugLoggingWindow {\n  // Even in dev mode, we generally don't want to emit these events, as that's\n  // another level of cost, so only emit them when DEV_MODE is true _and_ when\n  // window.emitLitDebugEvents is true.\n  emitLitDebugLogEvents?: boolean;\n}\n\n/**\n * Useful for visualizing and logging insights into what the Lit template system is doing.\n *\n * Compiled out of prod mode builds.\n */\nconst debugLogEvent = DEV_MODE\n  ? (event: ReactiveUnstable.DebugLog.Entry) => {\n      const shouldEmit = (global as unknown as DebugLoggingWindow)\n        .emitLitDebugLogEvents;\n      if (!shouldEmit) {\n        return;\n      }\n      global.dispatchEvent(\n        new CustomEvent<ReactiveUnstable.DebugLog.Entry>('lit-debug', {\n          detail: event,\n        })\n      );\n    }\n  : undefined;\n\n/*\n * When using Closure Compiler, JSCompiler_renameProperty(property, object) is\n * replaced at compile time by the munged name for object[property]. We cannot\n * alias this function, so we have to use a small shim that has the same\n * behavior when not compiling.\n */\n/*@__INLINE__*/\nconst JSCompiler_renameProperty = <P extends PropertyKey>(\n  prop: P,\n  _obj: unknown\n): P => prop;\n\n/**\n * Converts property values to and from attribute values.\n */\nexport interface ComplexAttributeConverter<Type = unknown, TypeHint = unknown> {\n  /**\n   * Called to convert an attribute value to a property\n   * value.\n   */\n  fromAttribute?(value: string | null, type?: TypeHint): Type;\n\n  /**\n   * Called to convert a property value to an attribute\n   * value.\n   *\n   * It returns unknown instead of string, to be compatible with\n   * https://github.com/WICG/trusted-types (and similar efforts).\n   */\n  toAttribute?(value: Type, type?: TypeHint): unknown;\n}\n\ntype AttributeConverter<Type = unknown, TypeHint = unknown> =\n  | ComplexAttributeConverter<Type>\n  | ((value: string | null, type?: TypeHint) => Type);\n\n/**\n * Defines options for a property accessor.\n */\nexport interface PropertyDeclaration<Type = unknown, TypeHint = unknown> {\n  /**\n   * When set to `true`, indicates the property is internal private state. The\n   * property should not be set by users. When using TypeScript, this property\n   * should be marked as `private` or `protected`, and it is also a common\n   * practice to use a leading `_` in the name. The property is not added to\n   * `observedAttributes`.\n   */\n  readonly state?: boolean;\n\n  /**\n   * Indicates how and whether the property becomes an observed attribute.\n   * If the value is `false`, the property is not added to `observedAttributes`.\n   * If true or absent, the lowercased property name is observed (e.g. `fooBar`\n   * becomes `foobar`). If a string, the string value is observed (e.g\n   * `attribute: 'foo-bar'`).\n   */\n  readonly attribute?: boolean | string;\n\n  /**\n   * Indicates the type of the property. This is used only as a hint for the\n   * `converter` to determine how to convert the attribute\n   * to/from a property.\n   */\n  readonly type?: TypeHint;\n\n  /**\n   * Indicates how to convert the attribute to/from a property. If this value\n   * is a function, it is used to convert the attribute value a the property\n   * value. If it's an object, it can have keys for `fromAttribute` and\n   * `toAttribute`. If no `toAttribute` function is provided and\n   * `reflect` is set to `true`, the property value is set directly to the\n   * attribute. A default `converter` is used if none is provided; it supports\n   * `Boolean`, `String`, `Number`, `Object`, and `Array`. Note,\n   * when a property changes and the converter is used to update the attribute,\n   * the property is never updated again as a result of the attribute changing,\n   * and vice versa.\n   */\n  readonly converter?: AttributeConverter<Type, TypeHint>;\n\n  /**\n   * Indicates if the property should reflect to an attribute.\n   * If `true`, when the property is set, the attribute is set using the\n   * attribute name determined according to the rules for the `attribute`\n   * property option and the value of the property converted using the rules\n   * from the `converter` property option.\n   */\n  readonly reflect?: boolean;\n\n  /**\n   * A function that indicates if a property should be considered changed when\n   * it is set. The function should take the `newValue` and `oldValue` and\n   * return `true` if an update should be requested.\n   */\n  hasChanged?(value: Type, oldValue: Type): boolean;\n\n  /**\n   * Indicates whether an accessor will be created for this property. By\n   * default, an accessor will be generated for this property that requests an\n   * update when set. If this flag is `true`, no accessor will be created, and\n   * it will be the user's responsibility to call\n   * `this.requestUpdate(propertyName, oldValue)` to request an update when\n   * the property changes.\n   */\n  readonly noAccessor?: boolean;\n\n  /**\n   * Whether this property is wrapping accessors. This is set by `@property`\n   * to control the initial value change and reflection logic.\n   *\n   * @internal\n   */\n  wrapped?: boolean;\n\n  /**\n   * When `true`, uses the initial value of the property as the default value,\n   * which changes how attributes are handled:\n   *  - The initial value does *not* reflect, even if the `reflect` option is `true`.\n   *    Subsequent changes to the property will reflect, even if they are equal to the\n   *     default value.\n   *  - When the attribute is removed, the property is set to the default value\n   *  - The initial value will not trigger an old value in the `changedProperties` map\n   *    argument to update lifecycle methods.\n   *\n   * When set, properties must be initialized, either with a field initializer, or an\n   * assignment in the constructor. Not initializing the property may lead to\n   * improper handling of subsequent property assignments.\n   *\n   * While this behavior is opt-in, most properties that reflect to attributes should\n   * use `useDefault: true` so that their initial values do not reflect.\n   */\n  useDefault?: boolean;\n}\n\n/**\n * Map of properties to PropertyDeclaration options. For each property an\n * accessor is made, and the property is processed according to the\n * PropertyDeclaration options.\n */\nexport interface PropertyDeclarations {\n  readonly [key: string]: PropertyDeclaration;\n}\n\ntype PropertyDeclarationMap = Map<PropertyKey, PropertyDeclaration>;\n\ntype AttributeMap = Map<string, PropertyKey>;\n\n/**\n * A Map of property keys to values.\n *\n * Takes an optional type parameter T, which when specified as a non-any,\n * non-unknown type, will make the Map more strongly-typed, associating the map\n * keys with their corresponding value type on T.\n *\n * Use `PropertyValues<this>` when overriding ReactiveElement.update() and\n * other lifecycle methods in order to get stronger type-checking on keys\n * and values.\n */\n// This type is conditional so that if the parameter T is not specified, or\n// is `any`, the type will include `Map<PropertyKey, unknown>`. Since T is not\n// given in the uses of PropertyValues in this file, all uses here fallback to\n// meaning `Map<PropertyKey, unknown>`, but if a developer uses\n// `PropertyValues<this>` (or any other value for T) they will get a\n// strongly-typed Map type.\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nexport type PropertyValues<T = any> = T extends object\n  ? PropertyValueMap<T>\n  : Map<PropertyKey, unknown>;\n\n/**\n * Do not use, instead prefer {@linkcode PropertyValues}.\n */\n// This type must be exported such that JavaScript generated by the Google\n// Closure Compiler can import a type reference.\nexport interface PropertyValueMap<T> extends Map<PropertyKey, unknown> {\n  get<K extends keyof T>(k: K): T[K] | undefined;\n  set<K extends keyof T>(key: K, value: T[K]): this;\n  has<K extends keyof T>(k: K): boolean;\n  delete<K extends keyof T>(k: K): boolean;\n}\n\nexport const defaultConverter: ComplexAttributeConverter = {\n  toAttribute(value: unknown, type?: unknown): unknown {\n    switch (type) {\n      case Boolean:\n        value = value ? emptyStringForBooleanAttribute : null;\n        break;\n      case Object:\n      case Array:\n        // if the value is `null` or `undefined` pass this through\n        // to allow removing/no change behavior.\n        value = value == null ? value : JSON.stringify(value);\n        break;\n    }\n    return value;\n  },\n\n  fromAttribute(value: string | null, type?: unknown) {\n    let fromValue: unknown = value;\n    switch (type) {\n      case Boolean:\n        fromValue = value !== null;\n        break;\n      case Number:\n        fromValue = value === null ? null : Number(value);\n        break;\n      case Object:\n      case Array:\n        // Do *not* generate exception when invalid JSON is set as elements\n        // don't normally complain on being mis-configured.\n        // TODO(sorvell): Do generate exception in *dev mode*.\n        try {\n          // Assert to adhere to Bazel's \"must type assert JSON parse\" rule.\n          fromValue = JSON.parse(value!) as unknown;\n        } catch (e) {\n          fromValue = null;\n        }\n        break;\n    }\n    return fromValue;\n  },\n};\n\nexport interface HasChanged {\n  (value: unknown, old: unknown): boolean;\n}\n\n/**\n * Change function that returns true if `value` is different from `oldValue`.\n * This method is used as the default for a property's `hasChanged` function.\n */\nexport const notEqual: HasChanged = (value: unknown, old: unknown): boolean =>\n  !is(value, old);\n\nconst defaultPropertyDeclaration: PropertyDeclaration = {\n  attribute: true,\n  type: String,\n  converter: defaultConverter,\n  reflect: false,\n  useDefault: false,\n  hasChanged: notEqual,\n};\n\n/**\n * A string representing one of the supported dev mode warning categories.\n */\nexport type WarningKind =\n  | 'change-in-update'\n  | 'migration'\n  | 'async-perform-update';\n\nexport type Initializer = (element: ReactiveElement) => void;\n\n// Temporary, until google3 is on TypeScript 5.2\ndeclare global {\n  interface SymbolConstructor {\n    readonly metadata: unique symbol;\n  }\n}\n\n// Ensure metadata is enabled. TypeScript does not polyfill\n// Symbol.metadata, so we must ensure that it exists.\n(Symbol as {metadata: symbol}).metadata ??= Symbol('metadata');\n\ndeclare global {\n  // This is public global API, do not change!\n  // eslint-disable-next-line no-var\n  var litPropertyMetadata: WeakMap<\n    object,\n    Map<PropertyKey, PropertyDeclaration>\n  >;\n}\n\n// Map from a class's metadata object to property options\n// Note that we must use nullish-coalescing assignment so that we only use one\n// map even if we load multiple version of this module.\nglobal.litPropertyMetadata ??= new WeakMap<\n  object,\n  Map<PropertyKey, PropertyDeclaration>\n>();\n\n/**\n * Base element class which manages element properties and attributes. When\n * properties change, the `update` method is asynchronously called. This method\n * should be supplied by subclasses to render updates as desired.\n * @noInheritDoc\n */\nexport abstract class ReactiveElement\n  // In the Node build, this `extends` clause will be substituted with\n  // `(globalThis.HTMLElement ?? HTMLElement)`.\n  //\n  // This way, we will first prefer any global `HTMLElement` polyfill that the\n  // user has assigned, and then fall back to the `HTMLElement` shim which has\n  // been imported (see note at the top of this file about how this import is\n  // generated by Rollup). Note that the `HTMLElement` variable has been\n  // shadowed by this import, so it no longer refers to the global.\n  extends HTMLElement\n  implements ReactiveControllerHost\n{\n  // Note: these are patched in only in DEV_MODE.\n  /**\n   * Read or set all the enabled warning categories for this class.\n   *\n   * This property is only used in development builds.\n   *\n   * @nocollapse\n   * @category dev-mode\n   */\n  static enabledWarnings?: WarningKind[];\n\n  /**\n   * Enable the given warning category for this class.\n   *\n   * This method only exists in development builds, so it should be accessed\n   * with a guard like:\n   *\n   * ```ts\n   * // Enable for all ReactiveElement subclasses\n   * ReactiveElement.enableWarning?.('migration');\n   *\n   * // Enable for only MyElement and subclasses\n   * MyElement.enableWarning?.('migration');\n   * ```\n   *\n   * @nocollapse\n   * @category dev-mode\n   */\n  static enableWarning?: (warningKind: WarningKind) => void;\n\n  /**\n   * Disable the given warning category for this class.\n   *\n   * This method only exists in development builds, so it should be accessed\n   * with a guard like:\n   *\n   * ```ts\n   * // Disable for all ReactiveElement subclasses\n   * ReactiveElement.disableWarning?.('migration');\n   *\n   * // Disable for only MyElement and subclasses\n   * MyElement.disableWarning?.('migration');\n   * ```\n   *\n   * @nocollapse\n   * @category dev-mode\n   */\n  static disableWarning?: (warningKind: WarningKind) => void;\n\n  /**\n   * Adds an initializer function to the class that is called during instance\n   * construction.\n   *\n   * This is useful for code that runs against a `ReactiveElement`\n   * subclass, such as a decorator, that needs to do work for each\n   * instance, such as setting up a `ReactiveController`.\n   *\n   * ```ts\n   * const myDecorator = (target: typeof ReactiveElement, key: string) => {\n   *   target.addInitializer((instance: ReactiveElement) => {\n   *     // This is run during construction of the element\n   *     new MyController(instance);\n   *   });\n   * }\n   * ```\n   *\n   * Decorating a field will then cause each instance to run an initializer\n   * that adds a controller:\n   *\n   * ```ts\n   * class MyElement extends LitElement {\n   *   @myDecorator foo;\n   * }\n   * ```\n   *\n   * Initializers are stored per-constructor. Adding an initializer to a\n   * subclass does not add it to a superclass. Since initializers are run in\n   * constructors, initializers will run in order of the class hierarchy,\n   * starting with superclasses and progressing to the instance's class.\n   *\n   * @nocollapse\n   */\n  static addInitializer(initializer: Initializer) {\n    this.__prepare();\n    (this._initializers ??= []).push(initializer);\n  }\n\n  static _initializers?: Initializer[];\n\n  /*\n   * Due to closure compiler ES6 compilation bugs, @nocollapse is required on\n   * all static methods and properties with initializers.  Reference:\n   * - https://github.com/google/closure-compiler/issues/1776\n   */\n\n  /**\n   * Maps attribute names to properties; for example `foobar` attribute to\n   * `fooBar` property. Created lazily on user subclasses when finalizing the\n   * class.\n   * @nocollapse\n   */\n  private static __attributeToPropertyMap: AttributeMap;\n\n  /**\n   * Marks class as having been finalized, which includes creating properties\n   * from `static properties`, but does *not* include all properties created\n   * from decorators.\n   * @nocollapse\n   */\n  protected static finalized: true | undefined;\n\n  /**\n   * Memoized list of all element properties, including any superclass\n   * properties. Created lazily on user subclasses when finalizing the class.\n   *\n   * @nocollapse\n   * @category properties\n   */\n  static elementProperties: PropertyDeclarationMap;\n\n  /**\n   * User-supplied object that maps property names to `PropertyDeclaration`\n   * objects containing options for configuring reactive properties. When\n   * a reactive property is set the element will update and render.\n   *\n   * By default properties are public fields, and as such, they should be\n   * considered as primarily settable by element users, either via attribute or\n   * the property itself.\n   *\n   * Generally, properties that are changed by the element should be private or\n   * protected fields and should use the `state: true` option. Properties\n   * marked as `state` do not reflect from the corresponding attribute\n   *\n   * However, sometimes element code does need to set a public property. This\n   * should typically only be done in response to user interaction, and an event\n   * should be fired informing the user; for example, a checkbox sets its\n   * `checked` property when clicked and fires a `changed` event. Mutating\n   * public properties should typically not be done for non-primitive (object or\n   * array) properties. In other cases when an element needs to manage state, a\n   * private property set with the `state: true` option should be used. When\n   * needed, state properties can be initialized via public properties to\n   * facilitate complex interactions.\n   * @nocollapse\n   * @category properties\n   */\n  static properties: PropertyDeclarations;\n\n  /**\n   * Memoized list of all element styles.\n   * Created lazily on user subclasses when finalizing the class.\n   * @nocollapse\n   * @category styles\n   */\n  static elementStyles: Array<CSSResultOrNative> = [];\n\n  /**\n   * Array of styles to apply to the element. The styles should be defined\n   * using the {@linkcode css} tag function, via constructible stylesheets, or\n   * imported from native CSS module scripts.\n   *\n   * Note on Content Security Policy:\n   *\n   * Element styles are implemented with `<style>` tags when the browser doesn't\n   * support adopted StyleSheets. To use such `<style>` tags with the style-src\n   * CSP directive, the style-src value must either include 'unsafe-inline' or\n   * `nonce-<base64-value>` with `<base64-value>` replaced be a server-generated\n   * nonce.\n   *\n   * To provide a nonce to use on generated `<style>` elements, set\n   * `window.litNonce` to a server-generated nonce in your page's HTML, before\n   * loading application code:\n   *\n   * ```html\n   * <script>\n   *   // Generated and unique per request:\n   *   window.litNonce = 'a1b2c3d4';\n   * </script>\n   * ```\n   * @nocollapse\n   * @category styles\n   */\n  static styles?: CSSResultGroup;\n\n  /**\n   * Returns a list of attributes corresponding to the registered properties.\n   * @nocollapse\n   * @category attributes\n   */\n  static get observedAttributes() {\n    // Ensure we've created all properties\n    this.finalize();\n    // this.__attributeToPropertyMap is only undefined after finalize() in\n    // ReactiveElement itself. ReactiveElement.observedAttributes is only\n    // accessed with ReactiveElement as the receiver when a subclass or mixin\n    // calls super.observedAttributes\n    return (\n      this.__attributeToPropertyMap && [...this.__attributeToPropertyMap.keys()]\n    );\n  }\n\n  private __instanceProperties?: PropertyValues = undefined;\n\n  /**\n   * Creates a property accessor on the element prototype if one does not exist\n   * and stores a {@linkcode PropertyDeclaration} for the property with the\n   * given options. The property setter calls the property's `hasChanged`\n   * property option or uses a strict identity check to determine whether or not\n   * to request an update.\n   *\n   * This method may be overridden to customize properties; however,\n   * when doing so, it's important to call `super.createProperty` to ensure\n   * the property is setup correctly. This method calls\n   * `getPropertyDescriptor` internally to get a descriptor to install.\n   * To customize what properties do when they are get or set, override\n   * `getPropertyDescriptor`. To customize the options for a property,\n   * implement `createProperty` like this:\n   *\n   * ```ts\n   * static createProperty(name, options) {\n   *   options = Object.assign(options, {myOption: true});\n   *   super.createProperty(name, options);\n   * }\n   * ```\n   *\n   * @nocollapse\n   * @category properties\n   */\n  static createProperty(\n    name: PropertyKey,\n    options: PropertyDeclaration = defaultPropertyDeclaration\n  ) {\n    // If this is a state property, force the attribute to false.\n    if (options.state) {\n      (options as Mutable<PropertyDeclaration, 'attribute'>).attribute = false;\n    }\n    this.__prepare();\n    // Whether this property is wrapping accessors.\n    // Helps control the initial value change and reflection logic.\n    if (this.prototype.hasOwnProperty(name)) {\n      options = Object.create(options);\n      options.wrapped = true;\n    }\n    this.elementProperties.set(name, options);\n    if (!options.noAccessor) {\n      const key = DEV_MODE\n        ? // Use Symbol.for in dev mode to make it easier to maintain state\n          // when doing HMR.\n          Symbol.for(`${String(name)} (@property() cache)`)\n        : Symbol();\n      const descriptor = this.getPropertyDescriptor(name, key, options);\n      if (descriptor !== undefined) {\n        defineProperty(this.prototype, name, descriptor);\n      }\n    }\n  }\n\n  /**\n   * Returns a property descriptor to be defined on the given named property.\n   * If no descriptor is returned, the property will not become an accessor.\n   * For example,\n   *\n   * ```ts\n   * class MyElement extends LitElement {\n   *   static getPropertyDescriptor(name, key, options) {\n   *     const defaultDescriptor =\n   *         super.getPropertyDescriptor(name, key, options);\n   *     const setter = defaultDescriptor.set;\n   *     return {\n   *       get: defaultDescriptor.get,\n   *       set(value) {\n   *         setter.call(this, value);\n   *         // custom action.\n   *       },\n   *       configurable: true,\n   *       enumerable: true\n   *     }\n   *   }\n   * }\n   * ```\n   *\n   * @nocollapse\n   * @category properties\n   */\n  protected static getPropertyDescriptor(\n    name: PropertyKey,\n    key: string | symbol,\n    options: PropertyDeclaration\n  ): PropertyDescriptor | undefined {\n    const {get, set} = getOwnPropertyDescriptor(this.prototype, name) ?? {\n      get(this: ReactiveElement) {\n        return this[key as keyof typeof this];\n      },\n      set(this: ReactiveElement, v: unknown) {\n        (this as unknown as Record<string | symbol, unknown>)[key] = v;\n      },\n    };\n    if (DEV_MODE && get == null) {\n      if ('value' in (getOwnPropertyDescriptor(this.prototype, name) ?? {})) {\n        throw new Error(\n          `Field ${JSON.stringify(String(name))} on ` +\n            `${this.name} was declared as a reactive property ` +\n            `but it's actually declared as a value on the prototype. ` +\n            `Usually this is due to using @property or @state on a method.`\n        );\n      }\n      issueWarning(\n        'reactive-property-without-getter',\n        `Field ${JSON.stringify(String(name))} on ` +\n          `${this.name} was declared as a reactive property ` +\n          `but it does not have a getter. This will be an error in a ` +\n          `future version of Lit.`\n      );\n    }\n    return {\n      get,\n      set(this: ReactiveElement, value: unknown) {\n        const oldValue = get?.call(this);\n        set?.call(this, value);\n        this.requestUpdate(name, oldValue, options);\n      },\n      configurable: true,\n      enumerable: true,\n    };\n  }\n\n  /**\n   * Returns the property options associated with the given property.\n   * These options are defined with a `PropertyDeclaration` via the `properties`\n   * object or the `@property` decorator and are registered in\n   * `createProperty(...)`.\n   *\n   * Note, this method should be considered \"final\" and not overridden. To\n   * customize the options for a given property, override\n   * {@linkcode createProperty}.\n   *\n   * @nocollapse\n   * @final\n   * @category properties\n   */\n  static getPropertyOptions(name: PropertyKey) {\n    return this.elementProperties.get(name) ?? defaultPropertyDeclaration;\n  }\n\n  // Temporary, until google3 is on TypeScript 5.2\n  declare static [Symbol.metadata]: object & Record<PropertyKey, unknown>;\n\n  /**\n   * Initializes static own properties of the class used in bookkeeping\n   * for element properties, initializers, etc.\n   *\n   * Can be called multiple times by code that needs to ensure these\n   * properties exist before using them.\n   *\n   * This method ensures the superclass is finalized so that inherited\n   * property metadata can be copied down.\n   * @nocollapse\n   */\n  private static __prepare() {\n    if (\n      this.hasOwnProperty(JSCompiler_renameProperty('elementProperties', this))\n    ) {\n      // Already prepared\n      return;\n    }\n    // Finalize any superclasses\n    const superCtor = getPrototypeOf(this) as typeof ReactiveElement;\n    superCtor.finalize();\n\n    // Create own set of initializers for this class if any exist on the\n    // superclass and copy them down. Note, for a small perf boost, avoid\n    // creating initializers unless needed.\n    if (superCtor._initializers !== undefined) {\n      this._initializers = [...superCtor._initializers];\n    }\n    // Initialize elementProperties from the superclass\n    this.elementProperties = new Map(superCtor.elementProperties);\n  }\n\n  /**\n   * Finishes setting up the class so that it's ready to be registered\n   * as a custom element and instantiated.\n   *\n   * This method is called by the ReactiveElement.observedAttributes getter.\n   * If you override the observedAttributes getter, you must either call\n   * super.observedAttributes to trigger finalization, or call finalize()\n   * yourself.\n   *\n   * @nocollapse\n   */\n  protected static finalize() {\n    if (this.hasOwnProperty(JSCompiler_renameProperty('finalized', this))) {\n      return;\n    }\n    this.finalized = true;\n    this.__prepare();\n\n    // Create properties from the static properties block:\n    if (this.hasOwnProperty(JSCompiler_renameProperty('properties', this))) {\n      const props = this.properties;\n      const propKeys = [\n        ...getOwnPropertyNames(props),\n        ...getOwnPropertySymbols(props),\n      ] as Array<keyof typeof props>;\n      for (const p of propKeys) {\n        this.createProperty(p, props[p]);\n      }\n    }\n\n    // Create properties from standard decorator metadata:\n    const metadata = this[Symbol.metadata];\n    if (metadata !== null) {\n      const properties = litPropertyMetadata.get(metadata);\n      if (properties !== undefined) {\n        for (const [p, options] of properties) {\n          this.elementProperties.set(p, options);\n        }\n      }\n    }\n\n    // Create the attribute-to-property map\n    this.__attributeToPropertyMap = new Map();\n    for (const [p, options] of this.elementProperties) {\n      const attr = this.__attributeNameForProperty(p, options);\n      if (attr !== undefined) {\n        this.__attributeToPropertyMap.set(attr, p);\n      }\n    }\n\n    this.elementStyles = this.finalizeStyles(this.styles);\n\n    if (DEV_MODE) {\n      if (this.hasOwnProperty('createProperty')) {\n        issueWarning(\n          'no-override-create-property',\n          'Overriding ReactiveElement.createProperty() is deprecated. ' +\n            'The override will not be called with standard decorators'\n        );\n      }\n      if (this.hasOwnProperty('getPropertyDescriptor')) {\n        issueWarning(\n          'no-override-get-property-descriptor',\n          'Overriding ReactiveElement.getPropertyDescriptor() is deprecated. ' +\n            'The override will not be called with standard decorators'\n        );\n      }\n    }\n  }\n\n  /**\n   * Options used when calling `attachShadow`. Set this property to customize\n   * the options for the shadowRoot; for example, to create a closed\n   * shadowRoot: `{mode: 'closed'}`.\n   *\n   * Note, these options are used in `createRenderRoot`. If this method\n   * is customized, options should be respected if possible.\n   * @nocollapse\n   * @category rendering\n   */\n  static shadowRootOptions: ShadowRootInit = {mode: 'open'};\n\n  /**\n   * Takes the styles the user supplied via the `static styles` property and\n   * returns the array of styles to apply to the element.\n   * Override this method to integrate into a style management system.\n   *\n   * Styles are deduplicated preserving the _last_ instance in the list. This\n   * is a performance optimization to avoid duplicated styles that can occur\n   * especially when composing via subclassing. The last item is kept to try\n   * to preserve the cascade order with the assumption that it's most important\n   * that last added styles override previous styles.\n   *\n   * @nocollapse\n   * @category styles\n   */\n  protected static finalizeStyles(\n    styles?: CSSResultGroup\n  ): Array<CSSResultOrNative> {\n    const elementStyles = [];\n    if (Array.isArray(styles)) {\n      // Dedupe the flattened array in reverse order to preserve the last items.\n      // Casting to Array<unknown> works around TS error that\n      // appears to come from trying to flatten a type CSSResultArray.\n      const set = new Set((styles as Array<unknown>).flat(Infinity).reverse());\n      // Then preserve original order by adding the set items in reverse order.\n      for (const s of set) {\n        elementStyles.unshift(getCompatibleStyle(s as CSSResultOrNative));\n      }\n    } else if (styles !== undefined) {\n      elementStyles.push(getCompatibleStyle(styles));\n    }\n    return elementStyles;\n  }\n\n  /**\n   * Node or ShadowRoot into which element DOM should be rendered. Defaults\n   * to an open shadowRoot.\n   * @category rendering\n   */\n  readonly renderRoot!: HTMLElement | DocumentFragment;\n\n  /**\n   * Returns the property name for the given attribute `name`.\n   * @nocollapse\n   */\n  private static __attributeNameForProperty(\n    name: PropertyKey,\n    options: PropertyDeclaration\n  ) {\n    const attribute = options.attribute;\n    return attribute === false\n      ? undefined\n      : typeof attribute === 'string'\n        ? attribute\n        : typeof name === 'string'\n          ? name.toLowerCase()\n          : undefined;\n  }\n\n  // Initialize to an unresolved Promise so we can make sure the element has\n  // connected before first update.\n  private __updatePromise!: Promise<boolean>;\n\n  /**\n   * True if there is a pending update as a result of calling `requestUpdate()`.\n   * Should only be read.\n   * @category updates\n   */\n  isUpdatePending = false;\n\n  /**\n   * Is set to `true` after the first update. The element code cannot assume\n   * that `renderRoot` exists before the element `hasUpdated`.\n   * @category updates\n   */\n  hasUpdated = false;\n\n  /**\n   * Map with keys for any properties that have changed since the last\n   * update cycle with previous values.\n   *\n   * @internal\n   */\n  _$changedProperties!: PropertyValues;\n\n  /**\n   * Records property default values when the\n   * `useDefault` option is used.\n   */\n  private __defaultValues?: Map<PropertyKey, unknown>;\n\n  /**\n   * Properties that should be reflected when updated.\n   */\n  private __reflectingProperties?: Set<PropertyKey>;\n\n  /**\n   * Name of currently reflecting property\n   */\n  private __reflectingProperty: PropertyKey | null = null;\n\n  /**\n   * Set of controllers.\n   */\n  private __controllers?: Set<ReactiveController>;\n\n  constructor() {\n    super();\n    this.__initialize();\n  }\n\n  /**\n   * Internal only override point for customizing work done when elements\n   * are constructed.\n   */\n  private __initialize() {\n    this.__updatePromise = new Promise<boolean>(\n      (res) => (this.enableUpdating = res)\n    );\n    this._$changedProperties = new Map();\n    // This enqueues a microtask that must run before the first update, so it\n    // must be called before requestUpdate()\n    this.__saveInstanceProperties();\n    // ensures first update will be caught by an early access of\n    // `updateComplete`\n    this.requestUpdate();\n    (this.constructor as typeof ReactiveElement)._initializers?.forEach((i) =>\n      i(this)\n    );\n  }\n\n  /**\n   * Registers a `ReactiveController` to participate in the element's reactive\n   * update cycle. The element automatically calls into any registered\n   * controllers during its lifecycle callbacks.\n   *\n   * If the element is connected when `addController()` is called, the\n   * controller's `hostConnected()` callback will be immediately called.\n   * @category controllers\n   */\n  addController(controller: ReactiveController) {\n    (this.__controllers ??= new Set()).add(controller);\n    // If a controller is added after the element has been connected,\n    // call hostConnected. Note, re-using existence of `renderRoot` here\n    // (which is set in connectedCallback) to avoid the need to track a\n    // first connected state.\n    if (this.renderRoot !== undefined && this.isConnected) {\n      controller.hostConnected?.();\n    }\n  }\n\n  /**\n   * Removes a `ReactiveController` from the element.\n   * @category controllers\n   */\n  removeController(controller: ReactiveController) {\n    this.__controllers?.delete(controller);\n  }\n\n  /**\n   * Fixes any properties set on the instance before upgrade time.\n   * Otherwise these would shadow the accessor and break these properties.\n   * The properties are stored in a Map which is played back after the\n   * constructor runs.\n   */\n  private __saveInstanceProperties() {\n    const instanceProperties = new Map<PropertyKey, unknown>();\n    const elementProperties = (this.constructor as typeof ReactiveElement)\n      .elementProperties;\n    for (const p of elementProperties.keys() as IterableIterator<keyof this>) {\n      if (this.hasOwnProperty(p)) {\n        instanceProperties.set(p, this[p]);\n        delete this[p];\n      }\n    }\n    if (instanceProperties.size > 0) {\n      this.__instanceProperties = instanceProperties;\n    }\n  }\n\n  /**\n   * Returns the node into which the element should render and by default\n   * creates and returns an open shadowRoot. Implement to customize where the\n   * element's DOM is rendered. For example, to render into the element's\n   * childNodes, return `this`.\n   *\n   * @return Returns a node into which to render.\n   * @category rendering\n   */\n  protected createRenderRoot(): HTMLElement | DocumentFragment {\n    const renderRoot =\n      this.shadowRoot ??\n      this.attachShadow(\n        (this.constructor as typeof ReactiveElement).shadowRootOptions\n      );\n    adoptStyles(\n      renderRoot,\n      (this.constructor as typeof ReactiveElement).elementStyles\n    );\n    return renderRoot;\n  }\n\n  /**\n   * On first connection, creates the element's renderRoot, sets up\n   * element styling, and enables updating.\n   * @category lifecycle\n   */\n  connectedCallback() {\n    // Create renderRoot before controllers `hostConnected`\n    (this as Mutable<typeof this, 'renderRoot'>).renderRoot ??=\n      this.createRenderRoot();\n    this.enableUpdating(true);\n    this.__controllers?.forEach((c) => c.hostConnected?.());\n  }\n\n  /**\n   * Note, this method should be considered final and not overridden. It is\n   * overridden on the element instance with a function that triggers the first\n   * update.\n   * @category updates\n   */\n  protected enableUpdating(_requestedUpdate: boolean) {}\n\n  /**\n   * Allows for `super.disconnectedCallback()` in extensions while\n   * reserving the possibility of making non-breaking feature additions\n   * when disconnecting at some point in the future.\n   * @category lifecycle\n   */\n  disconnectedCallback() {\n    this.__controllers?.forEach((c) => c.hostDisconnected?.());\n  }\n\n  /**\n   * Synchronizes property values when attributes change.\n   *\n   * Specifically, when an attribute is set, the corresponding property is set.\n   * You should rarely need to implement this callback. If this method is\n   * overridden, `super.attributeChangedCallback(name, _old, value)` must be\n   * called.\n   *\n   * See [responding to attribute changes](https://developer.mozilla.org/en-US/docs/Web/API/Web_components/Using_custom_elements#responding_to_attribute_changes)\n   * on MDN for more information about the `attributeChangedCallback`.\n   * @category attributes\n   */\n  attributeChangedCallback(\n    name: string,\n    _old: string | null,\n    value: string | null\n  ) {\n    this._$attributeToProperty(name, value);\n  }\n\n  private __propertyToAttribute(name: PropertyKey, value: unknown) {\n    const elemProperties: PropertyDeclarationMap = (\n      this.constructor as typeof ReactiveElement\n    ).elementProperties;\n    const options = elemProperties.get(name)!;\n    const attr = (\n      this.constructor as typeof ReactiveElement\n    ).__attributeNameForProperty(name, options);\n    if (attr !== undefined && options.reflect === true) {\n      const converter =\n        (options.converter as ComplexAttributeConverter)?.toAttribute !==\n        undefined\n          ? (options.converter as ComplexAttributeConverter)\n          : defaultConverter;\n      const attrValue = converter.toAttribute!(value, options.type);\n      if (\n        DEV_MODE &&\n        (this.constructor as typeof ReactiveElement).enabledWarnings!.includes(\n          'migration'\n        ) &&\n        attrValue === undefined\n      ) {\n        issueWarning(\n          'undefined-attribute-value',\n          `The attribute value for the ${name as string} property is ` +\n            `undefined on element ${this.localName}. The attribute will be ` +\n            `removed, but in the previous version of \\`ReactiveElement\\`, ` +\n            `the attribute would not have changed.`\n        );\n      }\n      // Track if the property is being reflected to avoid\n      // setting the property again via `attributeChangedCallback`. Note:\n      // 1. this takes advantage of the fact that the callback is synchronous.\n      // 2. will behave incorrectly if multiple attributes are in the reaction\n      // stack at time of calling. However, since we process attributes\n      // in `update` this should not be possible (or an extreme corner case\n      // that we'd like to discover).\n      // mark state reflecting\n      this.__reflectingProperty = name;\n      if (attrValue == null) {\n        this.removeAttribute(attr);\n      } else {\n        this.setAttribute(attr, attrValue as string);\n      }\n      // mark state not reflecting\n      this.__reflectingProperty = null;\n    }\n  }\n\n  /** @internal */\n  _$attributeToProperty(name: string, value: string | null) {\n    const ctor = this.constructor as typeof ReactiveElement;\n    // Note, hint this as an `AttributeMap` so closure clearly understands\n    // the type; it has issues with tracking types through statics\n    const propName = (ctor.__attributeToPropertyMap as AttributeMap).get(name);\n    // Use tracking info to avoid reflecting a property value to an attribute\n    // if it was just set because the attribute changed.\n    if (propName !== undefined && this.__reflectingProperty !== propName) {\n      const options = ctor.getPropertyOptions(propName);\n      const converter =\n        typeof options.converter === 'function'\n          ? {fromAttribute: options.converter}\n          : options.converter?.fromAttribute !== undefined\n            ? options.converter\n            : defaultConverter;\n      // mark state reflecting\n      this.__reflectingProperty = propName;\n      const convertedValue = converter.fromAttribute!(value, options.type);\n      this[propName as keyof this] =\n        convertedValue ??\n        this.__defaultValues?.get(propName) ??\n        // eslint-disable-next-line @typescript-eslint/no-explicit-any\n        (convertedValue as any);\n      // mark state not reflecting\n      this.__reflectingProperty = null;\n    }\n  }\n\n  /**\n   * Requests an update which is processed asynchronously. This should be called\n   * when an element should update based on some state not triggered by setting\n   * a reactive property. In this case, pass no arguments. It should also be\n   * called when manually implementing a property setter. In this case, pass the\n   * property `name` and `oldValue` to ensure that any configured property\n   * options are honored.\n   *\n   * @param name name of requesting property\n   * @param oldValue old value of requesting property\n   * @param options property options to use instead of the previously\n   *     configured options\n   * @category updates\n   */\n  requestUpdate(\n    name?: PropertyKey,\n    oldValue?: unknown,\n    options?: PropertyDeclaration\n  ): void {\n    // If we have a property key, perform property update steps.\n    if (name !== undefined) {\n      if (DEV_MODE && (name as unknown) instanceof Event) {\n        issueWarning(\n          ``,\n          `The requestUpdate() method was called with an Event as the property name. This is probably a mistake caused by binding this.requestUpdate as an event listener. Instead bind a function that will call it with no arguments: () => this.requestUpdate()`\n        );\n      }\n      const ctor = this.constructor as typeof ReactiveElement;\n      const newValue = this[name as keyof this];\n      options ??= ctor.getPropertyOptions(name);\n      const changed =\n        (options.hasChanged ?? notEqual)(newValue, oldValue) ||\n        // When there is no change, check a corner case that can occur when\n        // 1. there's a initial value which was not reflected\n        // 2. the property is subsequently set to this value.\n        // For example, `prop: {useDefault: true, reflect: true}`\n        // and el.prop = 'foo'. This should be considered a change if the\n        // attribute is not set because we will now reflect the property to the attribute.\n        (options.useDefault &&\n          options.reflect &&\n          newValue === this.__defaultValues?.get(name) &&\n          !this.hasAttribute(ctor.__attributeNameForProperty(name, options)!));\n      if (changed) {\n        this._$changeProperty(name, oldValue, options);\n      } else {\n        // Abort the request if the property should not be considered changed.\n        return;\n      }\n    }\n    if (this.isUpdatePending === false) {\n      this.__updatePromise = this.__enqueueUpdate();\n    }\n  }\n\n  /**\n   * @internal\n   */\n  _$changeProperty(\n    name: PropertyKey,\n    oldValue: unknown,\n    {useDefault, reflect, wrapped}: PropertyDeclaration,\n    initializeValue?: unknown\n  ) {\n    // Record default value when useDefault is used. This allows us to\n    // restore this value when the attribute is removed.\n    if (useDefault && !(this.__defaultValues ??= new Map()).has(name)) {\n      this.__defaultValues.set(\n        name,\n        initializeValue ?? oldValue ?? this[name as keyof this]\n      );\n      // if this is not wrapping an accessor, it must be an initial setting\n      // and in this case we do not want to record the change or reflect.\n      if (wrapped !== true || initializeValue !== undefined) {\n        return;\n      }\n    }\n    // TODO (justinfagnani): Create a benchmark of Map.has() + Map.set(\n    // vs just Map.set()\n    if (!this._$changedProperties.has(name)) {\n      // On the initial change, the old value should be `undefined`, except\n      // with `useDefault`\n      if (!this.hasUpdated && !useDefault) {\n        oldValue = undefined;\n      }\n      this._$changedProperties.set(name, oldValue);\n    }\n    // Add to reflecting properties set.\n    // Note, it's important that every change has a chance to add the\n    // property to `__reflectingProperties`. This ensures setting\n    // attribute + property reflects correctly.\n    if (reflect === true && this.__reflectingProperty !== name) {\n      (this.__reflectingProperties ??= new Set<PropertyKey>()).add(name);\n    }\n  }\n\n  /**\n   * Sets up the element to asynchronously update.\n   */\n  private async __enqueueUpdate() {\n    this.isUpdatePending = true;\n    try {\n      // Ensure any previous update has resolved before updating.\n      // This `await` also ensures that property changes are batched.\n      await this.__updatePromise;\n    } catch (e) {\n      // Refire any previous errors async so they do not disrupt the update\n      // cycle. Errors are refired so developers have a chance to observe\n      // them, and this can be done by implementing\n      // `window.onunhandledrejection`.\n      Promise.reject(e);\n    }\n    const result = this.scheduleUpdate();\n    // If `scheduleUpdate` returns a Promise, we await it. This is done to\n    // enable coordinating updates with a scheduler. Note, the result is\n    // checked to avoid delaying an additional microtask unless we need to.\n    if (result != null) {\n      await result;\n    }\n    return !this.isUpdatePending;\n  }\n\n  /**\n   * Schedules an element update. You can override this method to change the\n   * timing of updates by returning a Promise. The update will await the\n   * returned Promise, and you should resolve the Promise to allow the update\n   * to proceed. If this method is overridden, `super.scheduleUpdate()`\n   * must be called.\n   *\n   * For instance, to schedule updates to occur just before the next frame:\n   *\n   * ```ts\n   * override protected async scheduleUpdate(): Promise<unknown> {\n   *   await new Promise((resolve) => requestAnimationFrame(() => resolve()));\n   *   super.scheduleUpdate();\n   * }\n   * ```\n   * @category updates\n   */\n  protected scheduleUpdate(): void | Promise<unknown> {\n    const result = this.performUpdate();\n    if (\n      DEV_MODE &&\n      (this.constructor as typeof ReactiveElement).enabledWarnings!.includes(\n        'async-perform-update'\n      ) &&\n      typeof (result as unknown as Promise<unknown> | undefined)?.then ===\n        'function'\n    ) {\n      issueWarning(\n        'async-perform-update',\n        `Element ${this.localName} returned a Promise from performUpdate(). ` +\n          `This behavior is deprecated and will be removed in a future ` +\n          `version of ReactiveElement.`\n      );\n    }\n    return result;\n  }\n\n  /**\n   * Performs an element update. Note, if an exception is thrown during the\n   * update, `firstUpdated` and `updated` will not be called.\n   *\n   * Call `performUpdate()` to immediately process a pending update. This should\n   * generally not be needed, but it can be done in rare cases when you need to\n   * update synchronously.\n   *\n   * @category updates\n   */\n  protected performUpdate(): void {\n    // Abort any update if one is not pending when this is called.\n    // This can happen if `performUpdate` is called early to \"flush\"\n    // the update.\n    if (!this.isUpdatePending) {\n      return;\n    }\n    debugLogEvent?.({kind: 'update'});\n    if (!this.hasUpdated) {\n      // Create renderRoot before first update. This occurs in `connectedCallback`\n      // but is done here to support out of tree calls to `enableUpdating`/`performUpdate`.\n      (this as Mutable<typeof this, 'renderRoot'>).renderRoot ??=\n        this.createRenderRoot();\n      if (DEV_MODE) {\n        // Produce warning if any reactive properties on the prototype are\n        // shadowed by class fields. Instance fields set before upgrade are\n        // deleted by this point, so any own property is caused by class field\n        // initialization in the constructor.\n        const ctor = this.constructor as typeof ReactiveElement;\n        const shadowedProperties = [...ctor.elementProperties.keys()].filter(\n          (p) => this.hasOwnProperty(p) && p in getPrototypeOf(this)\n        );\n        if (shadowedProperties.length) {\n          throw new Error(\n            `The following properties on element ${this.localName} will not ` +\n              `trigger updates as expected because they are set using class ` +\n              `fields: ${shadowedProperties.join(', ')}. ` +\n              `Native class fields and some compiled output will overwrite ` +\n              `accessors used for detecting changes. See ` +\n              `https://lit.dev/msg/class-field-shadowing ` +\n              `for more information.`\n          );\n        }\n      }\n      // Mixin instance properties once, if they exist.\n      if (this.__instanceProperties) {\n        // TODO (justinfagnani): should we use the stored value? Could a new value\n        // have been set since we stored the own property value?\n        for (const [p, value] of this.__instanceProperties) {\n          this[p as keyof this] = value as this[keyof this];\n        }\n        this.__instanceProperties = undefined;\n      }\n      // Trigger initial value reflection and populate the initial\n      // `changedProperties` map, but only for the case of properties created\n      // via `createProperty` on accessors, which will not have already\n      // populated the `changedProperties` map since they are not set.\n      // We can't know if these accessors had initializers, so we just set\n      // them anyway - a difference from experimental decorators on fields and\n      // standard decorators on auto-accessors.\n      // For context see:\n      // https://github.com/lit/lit/pull/4183#issuecomment-1711959635\n      const elementProperties = (this.constructor as typeof ReactiveElement)\n        .elementProperties;\n      if (elementProperties.size > 0) {\n        for (const [p, options] of elementProperties) {\n          const {wrapped} = options;\n          const value = this[p as keyof this];\n          if (\n            wrapped === true &&\n            !this._$changedProperties.has(p) &&\n            value !== undefined\n          ) {\n            this._$changeProperty(p, undefined, options, value);\n          }\n        }\n      }\n    }\n    let shouldUpdate = false;\n    const changedProperties = this._$changedProperties;\n    try {\n      shouldUpdate = this.shouldUpdate(changedProperties);\n      if (shouldUpdate) {\n        this.willUpdate(changedProperties);\n        this.__controllers?.forEach((c) => c.hostUpdate?.());\n        this.update(changedProperties);\n      } else {\n        this.__markUpdated();\n      }\n    } catch (e) {\n      // Prevent `firstUpdated` and `updated` from running when there's an\n      // update exception.\n      shouldUpdate = false;\n      // Ensure element can accept additional updates after an exception.\n      this.__markUpdated();\n      throw e;\n    }\n    // The update is no longer considered pending and further updates are now allowed.\n    if (shouldUpdate) {\n      this._$didUpdate(changedProperties);\n    }\n  }\n\n  /**\n   * Invoked before `update()` to compute values needed during the update.\n   *\n   * Implement `willUpdate` to compute property values that depend on other\n   * properties and are used in the rest of the update process.\n   *\n   * ```ts\n   * willUpdate(changedProperties) {\n   *   // only need to check changed properties for an expensive computation.\n   *   if (changedProperties.has('firstName') || changedProperties.has('lastName')) {\n   *     this.sha = computeSHA(`${this.firstName} ${this.lastName}`);\n   *   }\n   * }\n   *\n   * render() {\n   *   return html`SHA: ${this.sha}`;\n   * }\n   * ```\n   *\n   * @category updates\n   */\n  protected willUpdate(_changedProperties: PropertyValues): void {}\n\n  // Note, this is an override point for polyfill-support.\n  // @internal\n  _$didUpdate(changedProperties: PropertyValues) {\n    this.__controllers?.forEach((c) => c.hostUpdated?.());\n    if (!this.hasUpdated) {\n      this.hasUpdated = true;\n      this.firstUpdated(changedProperties);\n    }\n    this.updated(changedProperties);\n    if (\n      DEV_MODE &&\n      this.isUpdatePending &&\n      (this.constructor as typeof ReactiveElement).enabledWarnings!.includes(\n        'change-in-update'\n      )\n    ) {\n      issueWarning(\n        'change-in-update',\n        `Element ${this.localName} scheduled an update ` +\n          `(generally because a property was set) ` +\n          `after an update completed, causing a new update to be scheduled. ` +\n          `This is inefficient and should be avoided unless the next update ` +\n          `can only be scheduled as a side effect of the previous update.`\n      );\n    }\n  }\n\n  private __markUpdated() {\n    this._$changedProperties = new Map();\n    this.isUpdatePending = false;\n  }\n\n  /**\n   * Returns a Promise that resolves when the element has completed updating.\n   * The Promise value is a boolean that is `true` if the element completed the\n   * update without triggering another update. The Promise result is `false` if\n   * a property was set inside `updated()`. If the Promise is rejected, an\n   * exception was thrown during the update.\n   *\n   * To await additional asynchronous work, override the `getUpdateComplete`\n   * method. For example, it is sometimes useful to await a rendered element\n   * before fulfilling this Promise. To do this, first await\n   * `super.getUpdateComplete()`, then any subsequent state.\n   *\n   * @return A promise of a boolean that resolves to true if the update completed\n   *     without triggering another update.\n   * @category updates\n   */\n  get updateComplete(): Promise<boolean> {\n    return this.getUpdateComplete();\n  }\n\n  /**\n   * Override point for the `updateComplete` promise.\n   *\n   * It is not safe to override the `updateComplete` getter directly due to a\n   * limitation in TypeScript which means it is not possible to call a\n   * superclass getter (e.g. `super.updateComplete.then(...)`) when the target\n   * language is ES5 (https://github.com/microsoft/TypeScript/issues/338).\n   * This method should be overridden instead. For example:\n   *\n   * ```ts\n   * class MyElement extends LitElement {\n   *   override async getUpdateComplete() {\n   *     const result = await super.getUpdateComplete();\n   *     await this._myChild.updateComplete;\n   *     return result;\n   *   }\n   * }\n   * ```\n   *\n   * @return A promise of a boolean that resolves to true if the update completed\n   *     without triggering another update.\n   * @category updates\n   */\n  protected getUpdateComplete(): Promise<boolean> {\n    return this.__updatePromise;\n  }\n\n  /**\n   * Controls whether or not `update()` should be called when the element requests\n   * an update. By default, this method always returns `true`, but this can be\n   * customized to control when to update.\n   *\n   * @param _changedProperties Map of changed properties with old values\n   * @category updates\n   */\n  protected shouldUpdate(_changedProperties: PropertyValues): boolean {\n    return true;\n  }\n\n  /**\n   * Updates the element. This method reflects property values to attributes.\n   * It can be overridden to render and keep updated element DOM.\n   * Setting properties inside this method will *not* trigger\n   * another update.\n   *\n   * @param _changedProperties Map of changed properties with old values\n   * @category updates\n   */\n  protected update(_changedProperties: PropertyValues) {\n    // The forEach() expression will only run when __reflectingProperties is\n    // defined, and it returns undefined, setting __reflectingProperties to\n    // undefined\n    this.__reflectingProperties &&= this.__reflectingProperties.forEach((p) =>\n      this.__propertyToAttribute(p, this[p as keyof this])\n    ) as undefined;\n    this.__markUpdated();\n  }\n\n  /**\n   * Invoked whenever the element is updated. Implement to perform\n   * post-updating tasks via DOM APIs, for example, focusing an element.\n   *\n   * Setting properties inside this method will trigger the element to update\n   * again after this update cycle completes.\n   *\n   * @param _changedProperties Map of changed properties with old values\n   * @category updates\n   */\n  protected updated(_changedProperties: PropertyValues) {}\n\n  /**\n   * Invoked when the element is first updated. Implement to perform one time\n   * work on the element after update.\n   *\n   * ```ts\n   * firstUpdated() {\n   *   this.renderRoot.getElementById('my-text-area').focus();\n   * }\n   * ```\n   *\n   * Setting properties inside this method will trigger the element to update\n   * again after this update cycle completes.\n   *\n   * @param _changedProperties Map of changed properties with old values\n   * @category updates\n   */\n  protected firstUpdated(_changedProperties: PropertyValues) {}\n}\n// Assigned here to work around a jscompiler bug with static fields\n// when compiling to ES5.\n// https://github.com/google/closure-compiler/issues/3177\n(ReactiveElement as unknown as Record<string, unknown>)[\n  JSCompiler_renameProperty('elementProperties', ReactiveElement)\n] = new Map();\n(ReactiveElement as unknown as Record<string, unknown>)[\n  JSCompiler_renameProperty('finalized', ReactiveElement)\n] = new Map();\n\n// Apply polyfills if available\npolyfillSupport?.({ReactiveElement});\n\n// Dev mode warnings...\nif (DEV_MODE) {\n  // Default warning set.\n  ReactiveElement.enabledWarnings = [\n    'change-in-update',\n    'async-perform-update',\n  ];\n  const ensureOwnWarnings = function (ctor: typeof ReactiveElement) {\n    if (\n      !ctor.hasOwnProperty(JSCompiler_renameProperty('enabledWarnings', ctor))\n    ) {\n      ctor.enabledWarnings = ctor.enabledWarnings!.slice();\n    }\n  };\n  ReactiveElement.enableWarning = function (\n    this: typeof ReactiveElement,\n    warning: WarningKind\n  ) {\n    ensureOwnWarnings(this);\n    if (!this.enabledWarnings!.includes(warning)) {\n      this.enabledWarnings!.push(warning);\n    }\n  };\n  ReactiveElement.disableWarning = function (\n    this: typeof ReactiveElement,\n    warning: WarningKind\n  ) {\n    ensureOwnWarnings(this);\n    const i = this.enabledWarnings!.indexOf(warning);\n    if (i >= 0) {\n      this.enabledWarnings!.splice(i, 1);\n    }\n  };\n}\n\n// IMPORTANT: do not change the property name or the assignment expression.\n// This line will be used in regexes to search for ReactiveElement usage.\n(global.reactiveElementVersions ??= []).push('2.1.1');\nif (DEV_MODE && global.reactiveElementVersions.length > 1) {\n  queueMicrotask(() => {\n    issueWarning!(\n      'multiple-versions',\n      `Multiple versions of Lit loaded. Loading multiple versions ` +\n        `is not recommended.`\n    );\n  });\n}\n", "/**\n * @license\n * Copyright 2017 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\n// IMPORTANT: these imports must be type-only\nimport type {Directive, DirectiveResult, PartInfo} from './directive.js';\nimport type {TrustedHTML, TrustedTypesWindow} from 'trusted-types/lib/index.js';\n\nconst DEV_MODE = true;\nconst ENABLE_EXTRA_SECURITY_HOOKS = true;\nconst ENABLE_SHADYDOM_NOPATCH = true;\nconst NODE_MODE = false;\n\n// Allows minifiers to rename references to globalThis\nconst global = globalThis;\n\n/**\n * Contains types that are part of the unstable debug API.\n *\n * Everything in this API is not stable and may change or be removed in the future,\n * even on patch releases.\n */\n// eslint-disable-next-line @typescript-eslint/no-namespace\nexport namespace LitUnstable {\n  /**\n   * When Lit is running in dev mode and `window.emitLitDebugLogEvents` is true,\n   * we will emit 'lit-debug' events to window, with live details about the update and render\n   * lifecycle. These can be useful for writing debug tooling and visualizations.\n   *\n   * Please be aware that running with window.emitLitDebugLogEvents has performance overhead,\n   * making certain operations that are normally very cheap (like a no-op render) much slower,\n   * because we must copy data and dispatch events.\n   */\n  // eslint-disable-next-line @typescript-eslint/no-namespace\n  export namespace DebugLog {\n    export type Entry =\n      | TemplatePrep\n      | TemplateInstantiated\n      | TemplateInstantiatedAndUpdated\n      | TemplateUpdating\n      | BeginRender\n      | EndRender\n      | CommitPartEntry\n      | SetPartValue;\n    export interface TemplatePrep {\n      kind: 'template prep';\n      template: Template;\n      strings: TemplateStringsArray;\n      clonableTemplate: HTMLTemplateElement;\n      parts: TemplatePart[];\n    }\n    export interface BeginRender {\n      kind: 'begin render';\n      id: number;\n      value: unknown;\n      container: HTMLElement | DocumentFragment;\n      options: RenderOptions | undefined;\n      part: ChildPart | undefined;\n    }\n    export interface EndRender {\n      kind: 'end render';\n      id: number;\n      value: unknown;\n      container: HTMLElement | DocumentFragment;\n      options: RenderOptions | undefined;\n      part: ChildPart;\n    }\n    export interface TemplateInstantiated {\n      kind: 'template instantiated';\n      template: Template | CompiledTemplate;\n      instance: TemplateInstance;\n      options: RenderOptions | undefined;\n      fragment: Node;\n      parts: Array<Part | undefined>;\n      values: unknown[];\n    }\n    export interface TemplateInstantiatedAndUpdated {\n      kind: 'template instantiated and updated';\n      template: Template | CompiledTemplate;\n      instance: TemplateInstance;\n      options: RenderOptions | undefined;\n      fragment: Node;\n      parts: Array<Part | undefined>;\n      values: unknown[];\n    }\n    export interface TemplateUpdating {\n      kind: 'template updating';\n      template: Template | CompiledTemplate;\n      instance: TemplateInstance;\n      options: RenderOptions | undefined;\n      parts: Array<Part | undefined>;\n      values: unknown[];\n    }\n    export interface SetPartValue {\n      kind: 'set part';\n      part: Part;\n      value: unknown;\n      valueIndex: number;\n      values: unknown[];\n      templateInstance: TemplateInstance;\n    }\n\n    export type CommitPartEntry =\n      | CommitNothingToChildEntry\n      | CommitText\n      | CommitNode\n      | CommitAttribute\n      | CommitProperty\n      | CommitBooleanAttribute\n      | CommitEventListener\n      | CommitToElementBinding;\n\n    export interface CommitNothingToChildEntry {\n      kind: 'commit nothing to child';\n      start: ChildNode;\n      end: ChildNode | null;\n      parent: Disconnectable | undefined;\n      options: RenderOptions | undefined;\n    }\n\n    export interface CommitText {\n      kind: 'commit text';\n      node: Text;\n      value: unknown;\n      options: RenderOptions | undefined;\n    }\n\n    export interface CommitNode {\n      kind: 'commit node';\n      start: Node;\n      parent: Disconnectable | undefined;\n      value: Node;\n      options: RenderOptions | undefined;\n    }\n\n    export interface CommitAttribute {\n      kind: 'commit attribute';\n      element: Element;\n      name: string;\n      value: unknown;\n      options: RenderOptions | undefined;\n    }\n\n    export interface CommitProperty {\n      kind: 'commit property';\n      element: Element;\n      name: string;\n      value: unknown;\n      options: RenderOptions | undefined;\n    }\n\n    export interface CommitBooleanAttribute {\n      kind: 'commit boolean attribute';\n      element: Element;\n      name: string;\n      value: boolean;\n      options: RenderOptions | undefined;\n    }\n\n    export interface CommitEventListener {\n      kind: 'commit event listener';\n      element: Element;\n      name: string;\n      value: unknown;\n      oldListener: unknown;\n      options: RenderOptions | undefined;\n      // True if we're removing the old event listener (e.g. because settings changed, or value is nothing)\n      removeListener: boolean;\n      // True if we're adding a new event listener (e.g. because first render, or settings changed)\n      addListener: boolean;\n    }\n\n    export interface CommitToElementBinding {\n      kind: 'commit to element binding';\n      element: Element;\n      value: unknown;\n      options: RenderOptions | undefined;\n    }\n  }\n}\n\ninterface DebugLoggingWindow {\n  // Even in dev mode, we generally don't want to emit these events, as that's\n  // another level of cost, so only emit them when DEV_MODE is true _and_ when\n  // window.emitLitDebugEvents is true.\n  emitLitDebugLogEvents?: boolean;\n}\n\n/**\n * Useful for visualizing and logging insights into what the Lit template system is doing.\n *\n * Compiled out of prod mode builds.\n */\nconst debugLogEvent = DEV_MODE\n  ? (event: LitUnstable.DebugLog.Entry) => {\n      const shouldEmit = (global as unknown as DebugLoggingWindow)\n        .emitLitDebugLogEvents;\n      if (!shouldEmit) {\n        return;\n      }\n      global.dispatchEvent(\n        new CustomEvent<LitUnstable.DebugLog.Entry>('lit-debug', {\n          detail: event,\n        })\n      );\n    }\n  : undefined;\n// Used for connecting beginRender and endRender events when there are nested\n// renders when errors are thrown preventing an endRender event from being\n// called.\nlet debugLogRenderId = 0;\n\nlet issueWarning: (code: string, warning: string) => void;\n\nif (DEV_MODE) {\n  global.litIssuedWarnings ??= new Set();\n\n  /**\n   * Issue a warning if we haven't already, based either on `code` or `warning`.\n   * Warnings are disabled automatically only by `warning`; disabling via `code`\n   * can be done by users.\n   */\n  issueWarning = (code: string, warning: string) => {\n    warning += code\n      ? ` See https://lit.dev/msg/${code} for more information.`\n      : '';\n    if (\n      !global.litIssuedWarnings!.has(warning) &&\n      !global.litIssuedWarnings!.has(code)\n    ) {\n      console.warn(warning);\n      global.litIssuedWarnings!.add(warning);\n    }\n  };\n\n  queueMicrotask(() => {\n    issueWarning(\n      'dev-mode',\n      `Lit is in dev mode. Not recommended for production!`\n    );\n  });\n}\n\nconst wrap =\n  ENABLE_SHADYDOM_NOPATCH &&\n  global.ShadyDOM?.inUse &&\n  global.ShadyDOM?.noPatch === true\n    ? (global.ShadyDOM!.wrap as <T extends Node>(node: T) => T)\n    : <T extends Node>(node: T) => node;\n\nconst trustedTypes = (global as unknown as TrustedTypesWindow).trustedTypes;\n\n/**\n * Our TrustedTypePolicy for HTML which is declared using the html template\n * tag function.\n *\n * That HTML is a developer-authored constant, and is parsed with innerHTML\n * before any untrusted expressions have been mixed in. Therefor it is\n * considered safe by construction.\n */\nconst policy = trustedTypes\n  ? trustedTypes.createPolicy('lit-html', {\n      createHTML: (s) => s,\n    })\n  : undefined;\n\n/**\n * Used to sanitize any value before it is written into the DOM. This can be\n * used to implement a security policy of allowed and disallowed values in\n * order to prevent XSS attacks.\n *\n * One way of using this callback would be to check attributes and properties\n * against a list of high risk fields, and require that values written to such\n * fields be instances of a class which is safe by construction. Closure's Safe\n * HTML Types is one implementation of this technique (\n * https://github.com/google/safe-html-types/blob/master/doc/safehtml-types.md).\n * The TrustedTypes polyfill in API-only mode could also be used as a basis\n * for this technique (https://github.com/WICG/trusted-types).\n *\n * @param node The HTML node (usually either a #text node or an Element) that\n *     is being written to. Note that this is just an exemplar node, the write\n *     may take place against another instance of the same class of node.\n * @param name The name of an attribute or property (for example, 'href').\n * @param type Indicates whether the write that's about to be performed will\n *     be to a property or a node.\n * @return A function that will sanitize this class of writes.\n */\nexport type SanitizerFactory = (\n  node: Node,\n  name: string,\n  type: 'property' | 'attribute'\n) => ValueSanitizer;\n\n/**\n * A function which can sanitize values that will be written to a specific kind\n * of DOM sink.\n *\n * See SanitizerFactory.\n *\n * @param value The value to sanitize. Will be the actual value passed into\n *     the lit-html template literal, so this could be of any type.\n * @return The value to write to the DOM. Usually the same as the input value,\n *     unless sanitization is needed.\n */\nexport type ValueSanitizer = (value: unknown) => unknown;\n\nconst identityFunction: ValueSanitizer = (value: unknown) => value;\nconst noopSanitizer: SanitizerFactory = (\n  _node: Node,\n  _name: string,\n  _type: 'property' | 'attribute'\n) => identityFunction;\n\n/** Sets the global sanitizer factory. */\nconst setSanitizer = (newSanitizer: SanitizerFactory) => {\n  if (!ENABLE_EXTRA_SECURITY_HOOKS) {\n    return;\n  }\n  if (sanitizerFactoryInternal !== noopSanitizer) {\n    throw new Error(\n      `Attempted to overwrite existing lit-html security policy.` +\n        ` setSanitizeDOMValueFactory should be called at most once.`\n    );\n  }\n  sanitizerFactoryInternal = newSanitizer;\n};\n\n/**\n * Only used in internal tests, not a part of the public API.\n */\nconst _testOnlyClearSanitizerFactoryDoNotCallOrElse = () => {\n  sanitizerFactoryInternal = noopSanitizer;\n};\n\nconst createSanitizer: SanitizerFactory = (node, name, type) => {\n  return sanitizerFactoryInternal(node, name, type);\n};\n\n// Added to an attribute name to mark the attribute as bound so we can find\n// it easily.\nconst boundAttributeSuffix = '$lit$';\n\n// This marker is used in many syntactic positions in HTML, so it must be\n// a valid element name and attribute name. We don't support dynamic names (yet)\n// but this at least ensures that the parse tree is closer to the template\n// intention.\nconst marker = `lit$${Math.random().toFixed(9).slice(2)}$`;\n\n// String used to tell if a comment is a marker comment\nconst markerMatch = '?' + marker;\n\n// Text used to insert a comment marker node. We use processing instruction\n// syntax because it's slightly smaller, but parses as a comment node.\nconst nodeMarker = `<${markerMatch}>`;\n\nconst d =\n  NODE_MODE && global.document === undefined\n    ? ({\n        createTreeWalker() {\n          return {};\n        },\n      } as unknown as Document)\n    : document;\n\n// Creates a dynamic marker. We never have to search for these in the DOM.\nconst createMarker = () => d.createComment('');\n\n// https://tc39.github.io/ecma262/#sec-typeof-operator\ntype Primitive = null | undefined | boolean | number | string | symbol | bigint;\nconst isPrimitive = (value: unknown): value is Primitive =>\n  value === null || (typeof value != 'object' && typeof value != 'function');\nconst isArray = Array.isArray;\nconst isIterable = (value: unknown): value is Iterable<unknown> =>\n  isArray(value) ||\n  // eslint-disable-next-line @typescript-eslint/no-explicit-any\n  typeof (value as any)?.[Symbol.iterator] === 'function';\n\nconst SPACE_CHAR = `[ \\t\\n\\f\\r]`;\nconst ATTR_VALUE_CHAR = `[^ \\t\\n\\f\\r\"'\\`<>=]`;\nconst NAME_CHAR = `[^\\\\s\"'>=/]`;\n\n// These regexes represent the five parsing states that we care about in the\n// Template's HTML scanner. They match the *end* of the state they're named\n// after.\n// Depending on the match, we transition to a new state. If there's no match,\n// we stay in the same state.\n// Note that the regexes are stateful. We utilize lastIndex and sync it\n// across the multiple regexes used. In addition to the five regexes below\n// we also dynamically create a regex to find the matching end tags for raw\n// text elements.\n\n/**\n * End of text is: `<` followed by:\n *   (comment start) or (tag) or (dynamic tag binding)\n */\nconst textEndRegex = /<(?:(!--|\\/[^a-zA-Z])|(\\/?[a-zA-Z][^>\\s]*)|(\\/?$))/g;\nconst COMMENT_START = 1;\nconst TAG_NAME = 2;\nconst DYNAMIC_TAG_NAME = 3;\n\nconst commentEndRegex = /-->/g;\n/**\n * Comments not started with <!--, like </{, can be ended by a single `>`\n */\nconst comment2EndRegex = />/g;\n\n/**\n * The tagEnd regex matches the end of the \"inside an opening\" tag syntax\n * position. It either matches a `>`, an attribute-like sequence, or the end\n * of the string after a space (attribute-name position ending).\n *\n * See attributes in the HTML spec:\n * https://www.w3.org/TR/html5/syntax.html#elements-attributes\n *\n * \" \\t\\n\\f\\r\" are HTML space characters:\n * https://infra.spec.whatwg.org/#ascii-whitespace\n *\n * So an attribute is:\n *  * The name: any character except a whitespace character, (\"), ('), \">\",\n *    \"=\", or \"/\". Note: this is different from the HTML spec which also excludes control characters.\n *  * Followed by zero or more space characters\n *  * Followed by \"=\"\n *  * Followed by zero or more space characters\n *  * Followed by:\n *    * Any character except space, ('), (\"), \"<\", \">\", \"=\", (`), or\n *    * (\") then any non-(\"), or\n *    * (') then any non-(')\n */\nconst tagEndRegex = new RegExp(\n  `>|${SPACE_CHAR}(?:(${NAME_CHAR}+)(${SPACE_CHAR}*=${SPACE_CHAR}*(?:${ATTR_VALUE_CHAR}|(\"|')|))|$)`,\n  'g'\n);\nconst ENTIRE_MATCH = 0;\nconst ATTRIBUTE_NAME = 1;\nconst SPACES_AND_EQUALS = 2;\nconst QUOTE_CHAR = 3;\n\nconst singleQuoteAttrEndRegex = /'/g;\nconst doubleQuoteAttrEndRegex = /\"/g;\n/**\n * Matches the raw text elements.\n *\n * Comments are not parsed within raw text elements, so we need to search their\n * text content for marker strings.\n */\nconst rawTextElement = /^(?:script|style|textarea|title)$/i;\n\n/** TemplateResult types */\nconst HTML_RESULT = 1;\nconst SVG_RESULT = 2;\nconst MATHML_RESULT = 3;\n\ntype ResultType = typeof HTML_RESULT | typeof SVG_RESULT | typeof MATHML_RESULT;\n\n// TemplatePart types\n// IMPORTANT: these must match the values in PartType\nconst ATTRIBUTE_PART = 1;\nconst CHILD_PART = 2;\nconst PROPERTY_PART = 3;\nconst BOOLEAN_ATTRIBUTE_PART = 4;\nconst EVENT_PART = 5;\nconst ELEMENT_PART = 6;\nconst COMMENT_PART = 7;\n\n/**\n * The return type of the template tag functions, {@linkcode html} and\n * {@linkcode svg} when it hasn't been compiled by @lit-labs/compiler.\n *\n * A `TemplateResult` object holds all the information about a template\n * expression required to render it: the template strings, expression values,\n * and type of template (html or svg).\n *\n * `TemplateResult` objects do not create any DOM on their own. To create or\n * update DOM you need to render the `TemplateResult`. See\n * [Rendering](https://lit.dev/docs/components/rendering) for more information.\n *\n */\nexport type UncompiledTemplateResult<T extends ResultType = ResultType> = {\n  // This property needs to remain unminified.\n  ['_$litType$']: T;\n  strings: TemplateStringsArray;\n  values: unknown[];\n};\n\n/**\n * This is a template result that may be either uncompiled or compiled.\n *\n * In the future, TemplateResult will be this type. If you want to explicitly\n * note that a template result is potentially compiled, you can reference this\n * type and it will continue to behave the same through the next major version\n * of Lit. This can be useful for code that wants to prepare for the next\n * major version of Lit.\n */\nexport type MaybeCompiledTemplateResult<T extends ResultType = ResultType> =\n  | UncompiledTemplateResult<T>\n  | CompiledTemplateResult;\n\n/**\n * The return type of the template tag functions, {@linkcode html} and\n * {@linkcode svg}.\n *\n * A `TemplateResult` object holds all the information about a template\n * expression required to render it: the template strings, expression values,\n * and type of template (html or svg).\n *\n * `TemplateResult` objects do not create any DOM on their own. To create or\n * update DOM you need to render the `TemplateResult`. See\n * [Rendering](https://lit.dev/docs/components/rendering) for more information.\n *\n * In Lit 4, this type will be an alias of\n * MaybeCompiledTemplateResult, so that code will get type errors if it assumes\n * that Lit templates are not compiled. When deliberately working with only\n * one, use either {@linkcode CompiledTemplateResult} or\n * {@linkcode UncompiledTemplateResult} explicitly.\n */\nexport type TemplateResult<T extends ResultType = ResultType> =\n  UncompiledTemplateResult<T>;\n\nexport type HTMLTemplateResult = TemplateResult<typeof HTML_RESULT>;\n\nexport type SVGTemplateResult = TemplateResult<typeof SVG_RESULT>;\n\nexport type MathMLTemplateResult = TemplateResult<typeof MATHML_RESULT>;\n\n/**\n * A TemplateResult that has been compiled by @lit-labs/compiler, skipping the\n * prepare step.\n */\nexport interface CompiledTemplateResult {\n  // This is a factory in order to make template initialization lazy\n  // and allow ShadyRenderOptions scope to be passed in.\n  // This property needs to remain unminified.\n  ['_$litType$']: CompiledTemplate;\n  values: unknown[];\n}\n\nexport interface CompiledTemplate extends Omit<Template, 'el'> {\n  // el is overridden to be optional. We initialize it on first render\n  el?: HTMLTemplateElement;\n\n  // The prepared HTML string to create a template element from.\n  // The type is a TemplateStringsArray to guarantee that the value came from\n  // source code, preventing a JSON injection attack.\n  h: TemplateStringsArray;\n}\n\n/**\n * Generates a template literal tag function that returns a TemplateResult with\n * the given result type.\n */\nconst tag =\n  <T extends ResultType>(type: T) =>\n  (strings: TemplateStringsArray, ...values: unknown[]): TemplateResult<T> => {\n    // Warn against templates octal escape sequences\n    // We do this here rather than in render so that the warning is closer to the\n    // template definition.\n    if (DEV_MODE && strings.some((s) => s === undefined)) {\n      console.warn(\n        'Some template strings are undefined.\\n' +\n          'This is probably caused by illegal octal escape sequences.'\n      );\n    }\n    if (DEV_MODE) {\n      // Import static-html.js results in a circular dependency which g3 doesn't\n      // handle. Instead we know that static values must have the field\n      // `_$litStatic$`.\n      if (\n        values.some((val) => (val as {_$litStatic$: unknown})?.['_$litStatic$'])\n      ) {\n        issueWarning(\n          '',\n          `Static values 'literal' or 'unsafeStatic' cannot be used as values to non-static templates.\\n` +\n            `Please use the static 'html' tag function. See https://lit.dev/docs/templates/expressions/#static-expressions`\n        );\n      }\n    }\n    return {\n      // This property needs to remain unminified.\n      ['_$litType$']: type,\n      strings,\n      values,\n    };\n  };\n\n/**\n * Interprets a template literal as an HTML template that can efficiently\n * render to and update a container.\n *\n * ```ts\n * const header = (title: string) => html`<h1>${title}</h1>`;\n * ```\n *\n * The `html` tag returns a description of the DOM to render as a value. It is\n * lazy, meaning no work is done until the template is rendered. When rendering,\n * if a template comes from the same expression as a previously rendered result,\n * it's efficiently updated instead of replaced.\n */\nexport const html = tag(HTML_RESULT);\n\n/**\n * Interprets a template literal as an SVG fragment that can efficiently render\n * to and update a container.\n *\n * ```ts\n * const rect = svg`<rect width=\"10\" height=\"10\"></rect>`;\n *\n * const myImage = html`\n *   <svg viewBox=\"0 0 10 10\" xmlns=\"http://www.w3.org/2000/svg\">\n *     ${rect}\n *   </svg>`;\n * ```\n *\n * The `svg` *tag function* should only be used for SVG fragments, or elements\n * that would be contained **inside** an `<svg>` HTML element. A common error is\n * placing an `<svg>` *element* in a template tagged with the `svg` tag\n * function. The `<svg>` element is an HTML element and should be used within a\n * template tagged with the {@linkcode html} tag function.\n *\n * In LitElement usage, it's invalid to return an SVG fragment from the\n * `render()` method, as the SVG fragment will be contained within the element's\n * shadow root and thus not be properly contained within an `<svg>` HTML\n * element.\n */\nexport const svg = tag(SVG_RESULT);\n\n/**\n * Interprets a template literal as MathML fragment that can efficiently render\n * to and update a container.\n *\n * ```ts\n * const num = mathml`<mn>1</mn>`;\n *\n * const eq = html`\n *   <math>\n *     ${num}\n *   </math>`;\n * ```\n *\n * The `mathml` *tag function* should only be used for MathML fragments, or\n * elements that would be contained **inside** a `<math>` HTML element. A common\n * error is placing a `<math>` *element* in a template tagged with the `mathml`\n * tag function. The `<math>` element is an HTML element and should be used\n * within a template tagged with the {@linkcode html} tag function.\n *\n * In LitElement usage, it's invalid to return an MathML fragment from the\n * `render()` method, as the MathML fragment will be contained within the\n * element's shadow root and thus not be properly contained within a `<math>`\n * HTML element.\n */\nexport const mathml = tag(MATHML_RESULT);\n\n/**\n * A sentinel value that signals that a value was handled by a directive and\n * should not be written to the DOM.\n */\nexport const noChange = Symbol.for('lit-noChange');\n\n/**\n * A sentinel value that signals a ChildPart to fully clear its content.\n *\n * ```ts\n * const button = html`${\n *  user.isAdmin\n *    ? html`<button>DELETE</button>`\n *    : nothing\n * }`;\n * ```\n *\n * Prefer using `nothing` over other falsy values as it provides a consistent\n * behavior between various expression binding contexts.\n *\n * In child expressions, `undefined`, `null`, `''`, and `nothing` all behave the\n * same and render no nodes. In attribute expressions, `nothing` _removes_ the\n * attribute, while `undefined` and `null` will render an empty string. In\n * property expressions `nothing` becomes `undefined`.\n */\nexport const nothing = Symbol.for('lit-nothing');\n\n/**\n * The cache of prepared templates, keyed by the tagged TemplateStringsArray\n * and _not_ accounting for the specific template tag used. This means that\n * template tags cannot be dynamic - they must statically be one of html, svg,\n * or attr. This restriction simplifies the cache lookup, which is on the hot\n * path for rendering.\n */\nconst templateCache = new WeakMap<TemplateStringsArray, Template>();\n\n/**\n * Object specifying options for controlling lit-html rendering. Note that\n * while `render` may be called multiple times on the same `container` (and\n * `renderBefore` reference node) to efficiently update the rendered content,\n * only the options passed in during the first render are respected during\n * the lifetime of renders to that unique `container` + `renderBefore`\n * combination.\n */\nexport interface RenderOptions {\n  /**\n   * An object to use as the `this` value for event listeners. It's often\n   * useful to set this to the host component rendering a template.\n   */\n  host?: object;\n  /**\n   * A DOM node before which to render content in the container.\n   */\n  renderBefore?: ChildNode | null;\n  /**\n   * Node used for cloning the template (`importNode` will be called on this\n   * node). This controls the `ownerDocument` of the rendered DOM, along with\n   * any inherited context. Defaults to the global `document`.\n   */\n  creationScope?: {importNode(node: Node, deep?: boolean): Node};\n  /**\n   * The initial connected state for the top-level part being rendered. If no\n   * `isConnected` option is set, `AsyncDirective`s will be connected by\n   * default. Set to `false` if the initial render occurs in a disconnected tree\n   * and `AsyncDirective`s should see `isConnected === false` for their initial\n   * render. The `part.setConnected()` method must be used subsequent to initial\n   * render to change the connected state of the part.\n   */\n  isConnected?: boolean;\n}\n\nconst walker = d.createTreeWalker(\n  d,\n  129 /* NodeFilter.SHOW_{ELEMENT|COMMENT} */\n);\n\nlet sanitizerFactoryInternal: SanitizerFactory = noopSanitizer;\n\n//\n// Classes only below here, const variable declarations only above here...\n//\n// Keeping variable declarations and classes together improves minification.\n// Interfaces and type aliases can be interleaved freely.\n//\n\n// Type for classes that have a `_directive` or `_directives[]` field, used by\n// `resolveDirective`\nexport interface DirectiveParent {\n  _$parent?: DirectiveParent;\n  _$isConnected: boolean;\n  __directive?: Directive;\n  __directives?: Array<Directive | undefined>;\n}\n\nfunction trustFromTemplateString(\n  tsa: TemplateStringsArray,\n  stringFromTSA: string\n): TrustedHTML {\n  // A security check to prevent spoofing of Lit template results.\n  // In the future, we may be able to replace this with Array.isTemplateObject,\n  // though we might need to make that check inside of the html and svg\n  // functions, because precompiled templates don't come in as\n  // TemplateStringArray objects.\n  if (!isArray(tsa) || !tsa.hasOwnProperty('raw')) {\n    let message = 'invalid template strings array';\n    if (DEV_MODE) {\n      message = `\n          Internal Error: expected template strings to be an array\n          with a 'raw' field. Faking a template strings array by\n          calling html or svg like an ordinary function is effectively\n          the same as calling unsafeHtml and can lead to major security\n          issues, e.g. opening your code up to XSS attacks.\n          If you're using the html or svg tagged template functions normally\n          and still seeing this error, please file a bug at\n          https://github.com/lit/lit/issues/new?template=bug_report.md\n          and include information about your build tooling, if any.\n        `\n        .trim()\n        .replace(/\\n */g, '\\n');\n    }\n    throw new Error(message);\n  }\n  return policy !== undefined\n    ? policy.createHTML(stringFromTSA)\n    : (stringFromTSA as unknown as TrustedHTML);\n}\n\n/**\n * Returns an HTML string for the given TemplateStringsArray and result type\n * (HTML or SVG), along with the case-sensitive bound attribute names in\n * template order. The HTML contains comment markers denoting the `ChildPart`s\n * and suffixes on bound attributes denoting the `AttributeParts`.\n *\n * @param strings template strings array\n * @param type HTML or SVG\n * @return Array containing `[html, attrNames]` (array returned for terseness,\n *     to avoid object fields since this code is shared with non-minified SSR\n *     code)\n */\nconst getTemplateHtml = (\n  strings: TemplateStringsArray,\n  type: ResultType\n): [TrustedHTML, Array<string>] => {\n  // Insert makers into the template HTML to represent the position of\n  // bindings. The following code scans the template strings to determine the\n  // syntactic position of the bindings. They can be in text position, where\n  // we insert an HTML comment, attribute value position, where we insert a\n  // sentinel string and re-write the attribute name, or inside a tag where\n  // we insert the sentinel string.\n  const l = strings.length - 1;\n  // Stores the case-sensitive bound attribute names in the order of their\n  // parts. ElementParts are also reflected in this array as undefined\n  // rather than a string, to disambiguate from attribute bindings.\n  const attrNames: Array<string> = [];\n  let html =\n    type === SVG_RESULT ? '<svg>' : type === MATHML_RESULT ? '<math>' : '';\n\n  // When we're inside a raw text tag (not it's text content), the regex\n  // will still be tagRegex so we can find attributes, but will switch to\n  // this regex when the tag ends.\n  let rawTextEndRegex: RegExp | undefined;\n\n  // The current parsing state, represented as a reference to one of the\n  // regexes\n  let regex = textEndRegex;\n\n  for (let i = 0; i < l; i++) {\n    const s = strings[i];\n    // The index of the end of the last attribute name. When this is\n    // positive at end of a string, it means we're in an attribute value\n    // position and need to rewrite the attribute name.\n    // We also use a special value of -2 to indicate that we encountered\n    // the end of a string in attribute name position.\n    let attrNameEndIndex = -1;\n    let attrName: string | undefined;\n    let lastIndex = 0;\n    let match!: RegExpExecArray | null;\n\n    // The conditions in this loop handle the current parse state, and the\n    // assignments to the `regex` variable are the state transitions.\n    while (lastIndex < s.length) {\n      // Make sure we start searching from where we previously left off\n      regex.lastIndex = lastIndex;\n      match = regex.exec(s);\n      if (match === null) {\n        break;\n      }\n      lastIndex = regex.lastIndex;\n      if (regex === textEndRegex) {\n        if (match[COMMENT_START] === '!--') {\n          regex = commentEndRegex;\n        } else if (match[COMMENT_START] !== undefined) {\n          // We started a weird comment, like </{\n          regex = comment2EndRegex;\n        } else if (match[TAG_NAME] !== undefined) {\n          if (rawTextElement.test(match[TAG_NAME])) {\n            // Record if we encounter a raw-text element. We'll switch to\n            // this regex at the end of the tag.\n            rawTextEndRegex = new RegExp(`</${match[TAG_NAME]}`, 'g');\n          }\n          regex = tagEndRegex;\n        } else if (match[DYNAMIC_TAG_NAME] !== undefined) {\n          if (DEV_MODE) {\n            throw new Error(\n              'Bindings in tag names are not supported. Please use static templates instead. ' +\n                'See https://lit.dev/docs/templates/expressions/#static-expressions'\n            );\n          }\n          regex = tagEndRegex;\n        }\n      } else if (regex === tagEndRegex) {\n        if (match[ENTIRE_MATCH] === '>') {\n          // End of a tag. If we had started a raw-text element, use that\n          // regex\n          regex = rawTextEndRegex ?? textEndRegex;\n          // We may be ending an unquoted attribute value, so make sure we\n          // clear any pending attrNameEndIndex\n          attrNameEndIndex = -1;\n        } else if (match[ATTRIBUTE_NAME] === undefined) {\n          // Attribute name position\n          attrNameEndIndex = -2;\n        } else {\n          attrNameEndIndex = regex.lastIndex - match[SPACES_AND_EQUALS].length;\n          attrName = match[ATTRIBUTE_NAME];\n          regex =\n            match[QUOTE_CHAR] === undefined\n              ? tagEndRegex\n              : match[QUOTE_CHAR] === '\"'\n                ? doubleQuoteAttrEndRegex\n                : singleQuoteAttrEndRegex;\n        }\n      } else if (\n        regex === doubleQuoteAttrEndRegex ||\n        regex === singleQuoteAttrEndRegex\n      ) {\n        regex = tagEndRegex;\n      } else if (regex === commentEndRegex || regex === comment2EndRegex) {\n        regex = textEndRegex;\n      } else {\n        // Not one of the five state regexes, so it must be the dynamically\n        // created raw text regex and we're at the close of that element.\n        regex = tagEndRegex;\n        rawTextEndRegex = undefined;\n      }\n    }\n\n    if (DEV_MODE) {\n      // If we have a attrNameEndIndex, which indicates that we should\n      // rewrite the attribute name, assert that we're in a valid attribute\n      // position - either in a tag, or a quoted attribute value.\n      console.assert(\n        attrNameEndIndex === -1 ||\n          regex === tagEndRegex ||\n          regex === singleQuoteAttrEndRegex ||\n          regex === doubleQuoteAttrEndRegex,\n        'unexpected parse state B'\n      );\n    }\n\n    // We have four cases:\n    //  1. We're in text position, and not in a raw text element\n    //     (regex === textEndRegex): insert a comment marker.\n    //  2. We have a non-negative attrNameEndIndex which means we need to\n    //     rewrite the attribute name to add a bound attribute suffix.\n    //  3. We're at the non-first binding in a multi-binding attribute, use a\n    //     plain marker.\n    //  4. We're somewhere else inside the tag. If we're in attribute name\n    //     position (attrNameEndIndex === -2), add a sequential suffix to\n    //     generate a unique attribute name.\n\n    // Detect a binding next to self-closing tag end and insert a space to\n    // separate the marker from the tag end:\n    const end =\n      regex === tagEndRegex && strings[i + 1].startsWith('/>') ? ' ' : '';\n    html +=\n      regex === textEndRegex\n        ? s + nodeMarker\n        : attrNameEndIndex >= 0\n          ? (attrNames.push(attrName!),\n            s.slice(0, attrNameEndIndex) +\n              boundAttributeSuffix +\n              s.slice(attrNameEndIndex)) +\n            marker +\n            end\n          : s + marker + (attrNameEndIndex === -2 ? i : end);\n  }\n\n  const htmlResult: string | TrustedHTML =\n    html +\n    (strings[l] || '<?>') +\n    (type === SVG_RESULT ? '</svg>' : type === MATHML_RESULT ? '</math>' : '');\n\n  // Returned as an array for terseness\n  return [trustFromTemplateString(strings, htmlResult), attrNames];\n};\n\n/** @internal */\nexport type {Template};\nclass Template {\n  /** @internal */\n  el!: HTMLTemplateElement;\n\n  parts: Array<TemplatePart> = [];\n\n  constructor(\n    // This property needs to remain unminified.\n    {strings, ['_$litType$']: type}: UncompiledTemplateResult,\n    options?: RenderOptions\n  ) {\n    let node: Node | null;\n    let nodeIndex = 0;\n    let attrNameIndex = 0;\n    const partCount = strings.length - 1;\n    const parts = this.parts;\n\n    // Create template element\n    const [html, attrNames] = getTemplateHtml(strings, type);\n    this.el = Template.createElement(html, options);\n    walker.currentNode = this.el.content;\n\n    // Re-parent SVG or MathML nodes into template root\n    if (type === SVG_RESULT || type === MATHML_RESULT) {\n      const wrapper = this.el.content.firstChild!;\n      wrapper.replaceWith(...wrapper.childNodes);\n    }\n\n    // Walk the template to find binding markers and create TemplateParts\n    while ((node = walker.nextNode()) !== null && parts.length < partCount) {\n      if (node.nodeType === 1) {\n        if (DEV_MODE) {\n          const tag = (node as Element).localName;\n          // Warn if `textarea` includes an expression and throw if `template`\n          // does since these are not supported. We do this by checking\n          // innerHTML for anything that looks like a marker. This catches\n          // cases like bindings in textarea there markers turn into text nodes.\n          if (\n            /^(?:textarea|template)$/i!.test(tag) &&\n            (node as Element).innerHTML.includes(marker)\n          ) {\n            const m =\n              `Expressions are not supported inside \\`${tag}\\` ` +\n              `elements. See https://lit.dev/msg/expression-in-${tag} for more ` +\n              `information.`;\n            if (tag === 'template') {\n              throw new Error(m);\n            } else issueWarning('', m);\n          }\n        }\n        // TODO (justinfagnani): for attempted dynamic tag names, we don't\n        // increment the bindingIndex, and it'll be off by 1 in the element\n        // and off by two after it.\n        if ((node as Element).hasAttributes()) {\n          for (const name of (node as Element).getAttributeNames()) {\n            if (name.endsWith(boundAttributeSuffix)) {\n              const realName = attrNames[attrNameIndex++];\n              const value = (node as Element).getAttribute(name)!;\n              const statics = value.split(marker);\n              const m = /([.?@])?(.*)/.exec(realName)!;\n              parts.push({\n                type: ATTRIBUTE_PART,\n                index: nodeIndex,\n                name: m[2],\n                strings: statics,\n                ctor:\n                  m[1] === '.'\n                    ? PropertyPart\n                    : m[1] === '?'\n                      ? BooleanAttributePart\n                      : m[1] === '@'\n                        ? EventPart\n                        : AttributePart,\n              });\n              (node as Element).removeAttribute(name);\n            } else if (name.startsWith(marker)) {\n              parts.push({\n                type: ELEMENT_PART,\n                index: nodeIndex,\n              });\n              (node as Element).removeAttribute(name);\n            }\n          }\n        }\n        // TODO (justinfagnani): benchmark the regex against testing for each\n        // of the 3 raw text element names.\n        if (rawTextElement.test((node as Element).tagName)) {\n          // For raw text elements we need to split the text content on\n          // markers, create a Text node for each segment, and create\n          // a TemplatePart for each marker.\n          const strings = (node as Element).textContent!.split(marker);\n          const lastIndex = strings.length - 1;\n          if (lastIndex > 0) {\n            (node as Element).textContent = trustedTypes\n              ? (trustedTypes.emptyScript as unknown as '')\n              : '';\n            // Generate a new text node for each literal section\n            // These nodes are also used as the markers for child parts\n            for (let i = 0; i < lastIndex; i++) {\n              (node as Element).append(strings[i], createMarker());\n              // Walk past the marker node we just added\n              walker.nextNode();\n              parts.push({type: CHILD_PART, index: ++nodeIndex});\n            }\n            // Note because this marker is added after the walker's current\n            // node, it will be walked to in the outer loop (and ignored), so\n            // we don't need to adjust nodeIndex here\n            (node as Element).append(strings[lastIndex], createMarker());\n          }\n        }\n      } else if (node.nodeType === 8) {\n        const data = (node as Comment).data;\n        if (data === markerMatch) {\n          parts.push({type: CHILD_PART, index: nodeIndex});\n        } else {\n          let i = -1;\n          while ((i = (node as Comment).data.indexOf(marker, i + 1)) !== -1) {\n            // Comment node has a binding marker inside, make an inactive part\n            // The binding won't work, but subsequent bindings will\n            parts.push({type: COMMENT_PART, index: nodeIndex});\n            // Move to the end of the match\n            i += marker.length - 1;\n          }\n        }\n      }\n      nodeIndex++;\n    }\n\n    if (DEV_MODE) {\n      // If there was a duplicate attribute on a tag, then when the tag is\n      // parsed into an element the attribute gets de-duplicated. We can detect\n      // this mismatch if we haven't precisely consumed every attribute name\n      // when preparing the template. This works because `attrNames` is built\n      // from the template string and `attrNameIndex` comes from processing the\n      // resulting DOM.\n      if (attrNames.length !== attrNameIndex) {\n        throw new Error(\n          `Detected duplicate attribute bindings. This occurs if your template ` +\n            `has duplicate attributes on an element tag. For example ` +\n            `\"<input ?disabled=\\${true} ?disabled=\\${false}>\" contains a ` +\n            `duplicate \"disabled\" attribute. The error was detected in ` +\n            `the following template: \\n` +\n            '`' +\n            strings.join('${...}') +\n            '`'\n        );\n      }\n    }\n\n    // We could set walker.currentNode to another node here to prevent a memory\n    // leak, but every time we prepare a template, we immediately render it\n    // and re-use the walker in new TemplateInstance._clone().\n    debugLogEvent &&\n      debugLogEvent({\n        kind: 'template prep',\n        template: this,\n        clonableTemplate: this.el,\n        parts: this.parts,\n        strings,\n      });\n  }\n\n  // Overridden via `litHtmlPolyfillSupport` to provide platform support.\n  /** @nocollapse */\n  static createElement(html: TrustedHTML, _options?: RenderOptions) {\n    const el = d.createElement('template');\n    el.innerHTML = html as unknown as string;\n    return el;\n  }\n}\n\nexport interface Disconnectable {\n  _$parent?: Disconnectable;\n  _$disconnectableChildren?: Set<Disconnectable>;\n  // Rather than hold connection state on instances, Disconnectables recursively\n  // fetch the connection state from the RootPart they are connected in via\n  // getters up the Disconnectable tree via _$parent references. This pushes the\n  // cost of tracking the isConnected state to `AsyncDirectives`, and avoids\n  // needing to pass all Disconnectables (parts, template instances, and\n  // directives) their connection state each time it changes, which would be\n  // costly for trees that have no AsyncDirectives.\n  _$isConnected: boolean;\n}\n\nfunction resolveDirective(\n  part: ChildPart | AttributePart | ElementPart,\n  value: unknown,\n  parent: DirectiveParent = part,\n  attributeIndex?: number\n): unknown {\n  // Bail early if the value is explicitly noChange. Note, this means any\n  // nested directive is still attached and is not run.\n  if (value === noChange) {\n    return value;\n  }\n  let currentDirective =\n    attributeIndex !== undefined\n      ? (parent as AttributePart).__directives?.[attributeIndex]\n      : (parent as ChildPart | ElementPart | Directive).__directive;\n  const nextDirectiveConstructor = isPrimitive(value)\n    ? undefined\n    : // This property needs to remain unminified.\n      (value as DirectiveResult)['_$litDirective$'];\n  if (currentDirective?.constructor !== nextDirectiveConstructor) {\n    // This property needs to remain unminified.\n    currentDirective?.['_$notifyDirectiveConnectionChanged']?.(false);\n    if (nextDirectiveConstructor === undefined) {\n      currentDirective = undefined;\n    } else {\n      currentDirective = new nextDirectiveConstructor(part as PartInfo);\n      currentDirective._$initialize(part, parent, attributeIndex);\n    }\n    if (attributeIndex !== undefined) {\n      ((parent as AttributePart).__directives ??= [])[attributeIndex] =\n        currentDirective;\n    } else {\n      (parent as ChildPart | Directive).__directive = currentDirective;\n    }\n  }\n  if (currentDirective !== undefined) {\n    value = resolveDirective(\n      part,\n      currentDirective._$resolve(part, (value as DirectiveResult).values),\n      currentDirective,\n      attributeIndex\n    );\n  }\n  return value;\n}\n\nexport type {TemplateInstance};\n/**\n * An updateable instance of a Template. Holds references to the Parts used to\n * update the template instance.\n */\nclass TemplateInstance implements Disconnectable {\n  _$template: Template;\n  _$parts: Array<Part | undefined> = [];\n\n  /** @internal */\n  _$parent: ChildPart;\n  /** @internal */\n  _$disconnectableChildren?: Set<Disconnectable> = undefined;\n\n  constructor(template: Template, parent: ChildPart) {\n    this._$template = template;\n    this._$parent = parent;\n  }\n\n  // Called by ChildPart parentNode getter\n  get parentNode() {\n    return this._$parent.parentNode;\n  }\n\n  // See comment in Disconnectable interface for why this is a getter\n  get _$isConnected() {\n    return this._$parent._$isConnected;\n  }\n\n  // This method is separate from the constructor because we need to return a\n  // DocumentFragment and we don't want to hold onto it with an instance field.\n  _clone(options: RenderOptions | undefined) {\n    const {\n      el: {content},\n      parts: parts,\n    } = this._$template;\n    const fragment = (options?.creationScope ?? d).importNode(content, true);\n    walker.currentNode = fragment;\n\n    let node = walker.nextNode()!;\n    let nodeIndex = 0;\n    let partIndex = 0;\n    let templatePart = parts[0];\n\n    while (templatePart !== undefined) {\n      if (nodeIndex === templatePart.index) {\n        let part: Part | undefined;\n        if (templatePart.type === CHILD_PART) {\n          part = new ChildPart(\n            node as HTMLElement,\n            node.nextSibling,\n            this,\n            options\n          );\n        } else if (templatePart.type === ATTRIBUTE_PART) {\n          part = new templatePart.ctor(\n            node as HTMLElement,\n            templatePart.name,\n            templatePart.strings,\n            this,\n            options\n          );\n        } else if (templatePart.type === ELEMENT_PART) {\n          part = new ElementPart(node as HTMLElement, this, options);\n        }\n        this._$parts.push(part);\n        templatePart = parts[++partIndex];\n      }\n      if (nodeIndex !== templatePart?.index) {\n        node = walker.nextNode()!;\n        nodeIndex++;\n      }\n    }\n    // We need to set the currentNode away from the cloned tree so that we\n    // don't hold onto the tree even if the tree is detached and should be\n    // freed.\n    walker.currentNode = d;\n    return fragment;\n  }\n\n  _update(values: Array<unknown>) {\n    let i = 0;\n    for (const part of this._$parts) {\n      if (part !== undefined) {\n        debugLogEvent &&\n          debugLogEvent({\n            kind: 'set part',\n            part,\n            value: values[i],\n            valueIndex: i,\n            values,\n            templateInstance: this,\n          });\n        if ((part as AttributePart).strings !== undefined) {\n          (part as AttributePart)._$setValue(values, part as AttributePart, i);\n          // The number of values the part consumes is part.strings.length - 1\n          // since values are in between template spans. We increment i by 1\n          // later in the loop, so increment it by part.strings.length - 2 here\n          i += (part as AttributePart).strings!.length - 2;\n        } else {\n          part._$setValue(values[i]);\n        }\n      }\n      i++;\n    }\n  }\n}\n\n/*\n * Parts\n */\ntype AttributeTemplatePart = {\n  readonly type: typeof ATTRIBUTE_PART;\n  readonly index: number;\n  readonly name: string;\n  readonly ctor: typeof AttributePart;\n  readonly strings: ReadonlyArray<string>;\n};\ntype ChildTemplatePart = {\n  readonly type: typeof CHILD_PART;\n  readonly index: number;\n};\ntype ElementTemplatePart = {\n  readonly type: typeof ELEMENT_PART;\n  readonly index: number;\n};\ntype CommentTemplatePart = {\n  readonly type: typeof COMMENT_PART;\n  readonly index: number;\n};\n\n/**\n * A TemplatePart represents a dynamic part in a template, before the template\n * is instantiated. When a template is instantiated Parts are created from\n * TemplateParts.\n */\ntype TemplatePart =\n  | ChildTemplatePart\n  | AttributeTemplatePart\n  | ElementTemplatePart\n  | CommentTemplatePart;\n\nexport type Part =\n  | ChildPart\n  | AttributePart\n  | PropertyPart\n  | BooleanAttributePart\n  | ElementPart\n  | EventPart;\n\nexport type {ChildPart};\nclass ChildPart implements Disconnectable {\n  readonly type = CHILD_PART;\n  readonly options: RenderOptions | undefined;\n  _$committedValue: unknown = nothing;\n  /** @internal */\n  __directive?: Directive;\n  /** @internal */\n  _$startNode: ChildNode;\n  /** @internal */\n  _$endNode: ChildNode | null;\n  private _textSanitizer: ValueSanitizer | undefined;\n  /** @internal */\n  _$parent: Disconnectable | undefined;\n  /**\n   * Connection state for RootParts only (i.e. ChildPart without _$parent\n   * returned from top-level `render`). This field is unused otherwise. The\n   * intention would be clearer if we made `RootPart` a subclass of `ChildPart`\n   * with this field (and a different _$isConnected getter), but the subclass\n   * caused a perf regression, possibly due to making call sites polymorphic.\n   * @internal\n   */\n  __isConnected: boolean;\n\n  // See comment in Disconnectable interface for why this is a getter\n  get _$isConnected() {\n    // ChildParts that are not at the root should always be created with a\n    // parent; only RootChildNode's won't, so they return the local isConnected\n    // state\n    return this._$parent?._$isConnected ?? this.__isConnected;\n  }\n\n  // The following fields will be patched onto ChildParts when required by\n  // AsyncDirective\n  /** @internal */\n  _$disconnectableChildren?: Set<Disconnectable> = undefined;\n  /** @internal */\n  _$notifyConnectionChanged?(\n    isConnected: boolean,\n    removeFromParent?: boolean,\n    from?: number\n  ): void;\n  /** @internal */\n  _$reparentDisconnectables?(parent: Disconnectable): void;\n\n  constructor(\n    startNode: ChildNode,\n    endNode: ChildNode | null,\n    parent: TemplateInstance | ChildPart | undefined,\n    options: RenderOptions | undefined\n  ) {\n    this._$startNode = startNode;\n    this._$endNode = endNode;\n    this._$parent = parent;\n    this.options = options;\n    // Note __isConnected is only ever accessed on RootParts (i.e. when there is\n    // no _$parent); the value on a non-root-part is \"don't care\", but checking\n    // for parent would be more code\n    this.__isConnected = options?.isConnected ?? true;\n    if (ENABLE_EXTRA_SECURITY_HOOKS) {\n      // Explicitly initialize for consistent class shape.\n      this._textSanitizer = undefined;\n    }\n  }\n\n  /**\n   * The parent node into which the part renders its content.\n   *\n   * A ChildPart's content consists of a range of adjacent child nodes of\n   * `.parentNode`, possibly bordered by 'marker nodes' (`.startNode` and\n   * `.endNode`).\n   *\n   * - If both `.startNode` and `.endNode` are non-null, then the part's content\n   * consists of all siblings between `.startNode` and `.endNode`, exclusively.\n   *\n   * - If `.startNode` is non-null but `.endNode` is null, then the part's\n   * content consists of all siblings following `.startNode`, up to and\n   * including the last child of `.parentNode`. If `.endNode` is non-null, then\n   * `.startNode` will always be non-null.\n   *\n   * - If both `.endNode` and `.startNode` are null, then the part's content\n   * consists of all child nodes of `.parentNode`.\n   */\n  get parentNode(): Node {\n    let parentNode: Node = wrap(this._$startNode).parentNode!;\n    const parent = this._$parent;\n    if (\n      parent !== undefined &&\n      parentNode?.nodeType === 11 /* Node.DOCUMENT_FRAGMENT */\n    ) {\n      // If the parentNode is a DocumentFragment, it may be because the DOM is\n      // still in the cloned fragment during initial render; if so, get the real\n      // parentNode the part will be committed into by asking the parent.\n      parentNode = (parent as ChildPart | TemplateInstance).parentNode;\n    }\n    return parentNode;\n  }\n\n  /**\n   * The part's leading marker node, if any. See `.parentNode` for more\n   * information.\n   */\n  get startNode(): Node | null {\n    return this._$startNode;\n  }\n\n  /**\n   * The part's trailing marker node, if any. See `.parentNode` for more\n   * information.\n   */\n  get endNode(): Node | null {\n    return this._$endNode;\n  }\n\n  _$setValue(value: unknown, directiveParent: DirectiveParent = this): void {\n    if (DEV_MODE && this.parentNode === null) {\n      throw new Error(\n        `This \\`ChildPart\\` has no \\`parentNode\\` and therefore cannot accept a value. This likely means the element containing the part was manipulated in an unsupported way outside of Lit's control such that the part's marker nodes were ejected from DOM. For example, setting the element's \\`innerHTML\\` or \\`textContent\\` can do this.`\n      );\n    }\n    value = resolveDirective(this, value, directiveParent);\n    if (isPrimitive(value)) {\n      // Non-rendering child values. It's important that these do not render\n      // empty text nodes to avoid issues with preventing default <slot>\n      // fallback content.\n      if (value === nothing || value == null || value === '') {\n        if (this._$committedValue !== nothing) {\n          debugLogEvent &&\n            debugLogEvent({\n              kind: 'commit nothing to child',\n              start: this._$startNode,\n              end: this._$endNode,\n              parent: this._$parent,\n              options: this.options,\n            });\n          this._$clear();\n        }\n        this._$committedValue = nothing;\n      } else if (value !== this._$committedValue && value !== noChange) {\n        this._commitText(value);\n      }\n      // This property needs to remain unminified.\n    } else if ((value as TemplateResult)['_$litType$'] !== undefined) {\n      this._commitTemplateResult(value as TemplateResult);\n    } else if ((value as Node).nodeType !== undefined) {\n      if (DEV_MODE && this.options?.host === value) {\n        this._commitText(\n          `[probable mistake: rendered a template's host in itself ` +\n            `(commonly caused by writing \\${this} in a template]`\n        );\n        console.warn(\n          `Attempted to render the template host`,\n          value,\n          `inside itself. This is almost always a mistake, and in dev mode `,\n          `we render some warning text. In production however, we'll `,\n          `render it, which will usually result in an error, and sometimes `,\n          `in the element disappearing from the DOM.`\n        );\n        return;\n      }\n      this._commitNode(value as Node);\n    } else if (isIterable(value)) {\n      this._commitIterable(value);\n    } else {\n      // Fallback, will render the string representation\n      this._commitText(value);\n    }\n  }\n\n  private _insert<T extends Node>(node: T) {\n    return wrap(wrap(this._$startNode).parentNode!).insertBefore(\n      node,\n      this._$endNode\n    );\n  }\n\n  private _commitNode(value: Node): void {\n    if (this._$committedValue !== value) {\n      this._$clear();\n      if (\n        ENABLE_EXTRA_SECURITY_HOOKS &&\n        sanitizerFactoryInternal !== noopSanitizer\n      ) {\n        const parentNodeName = this._$startNode.parentNode?.nodeName;\n        if (parentNodeName === 'STYLE' || parentNodeName === 'SCRIPT') {\n          let message = 'Forbidden';\n          if (DEV_MODE) {\n            if (parentNodeName === 'STYLE') {\n              message =\n                `Lit does not support binding inside style nodes. ` +\n                `This is a security risk, as style injection attacks can ` +\n                `exfiltrate data and spoof UIs. ` +\n                `Consider instead using css\\`...\\` literals ` +\n                `to compose styles, and do dynamic styling with ` +\n                `css custom properties, ::parts, <slot>s, ` +\n                `and by mutating the DOM rather than stylesheets.`;\n            } else {\n              message =\n                `Lit does not support binding inside script nodes. ` +\n                `This is a security risk, as it could allow arbitrary ` +\n                `code execution.`;\n            }\n          }\n          throw new Error(message);\n        }\n      }\n      debugLogEvent &&\n        debugLogEvent({\n          kind: 'commit node',\n          start: this._$startNode,\n          parent: this._$parent,\n          value: value,\n          options: this.options,\n        });\n      this._$committedValue = this._insert(value);\n    }\n  }\n\n  private _commitText(value: unknown): void {\n    // If the committed value is a primitive it means we called _commitText on\n    // the previous render, and we know that this._$startNode.nextSibling is a\n    // Text node. We can now just replace the text content (.data) of the node.\n    if (\n      this._$committedValue !== nothing &&\n      isPrimitive(this._$committedValue)\n    ) {\n      const node = wrap(this._$startNode).nextSibling as Text;\n      if (ENABLE_EXTRA_SECURITY_HOOKS) {\n        if (this._textSanitizer === undefined) {\n          this._textSanitizer = createSanitizer(node, 'data', 'property');\n        }\n        value = this._textSanitizer(value);\n      }\n      debugLogEvent &&\n        debugLogEvent({\n          kind: 'commit text',\n          node,\n          value,\n          options: this.options,\n        });\n      (node as Text).data = value as string;\n    } else {\n      if (ENABLE_EXTRA_SECURITY_HOOKS) {\n        const textNode = d.createTextNode('');\n        this._commitNode(textNode);\n        // When setting text content, for security purposes it matters a lot\n        // what the parent is. For example, <style> and <script> need to be\n        // handled with care, while <span> does not. So first we need to put a\n        // text node into the document, then we can sanitize its content.\n        if (this._textSanitizer === undefined) {\n          this._textSanitizer = createSanitizer(textNode, 'data', 'property');\n        }\n        value = this._textSanitizer(value);\n        debugLogEvent &&\n          debugLogEvent({\n            kind: 'commit text',\n            node: textNode,\n            value,\n            options: this.options,\n          });\n        textNode.data = value as string;\n      } else {\n        this._commitNode(d.createTextNode(value as string));\n        debugLogEvent &&\n          debugLogEvent({\n            kind: 'commit text',\n            node: wrap(this._$startNode).nextSibling as Text,\n            value,\n            options: this.options,\n          });\n      }\n    }\n    this._$committedValue = value;\n  }\n\n  private _commitTemplateResult(\n    result: TemplateResult | CompiledTemplateResult\n  ): void {\n    // This property needs to remain unminified.\n    const {values, ['_$litType$']: type} = result;\n    // If $litType$ is a number, result is a plain TemplateResult and we get\n    // the template from the template cache. If not, result is a\n    // CompiledTemplateResult and _$litType$ is a CompiledTemplate and we need\n    // to create the <template> element the first time we see it.\n    const template: Template | CompiledTemplate =\n      typeof type === 'number'\n        ? this._$getTemplate(result as UncompiledTemplateResult)\n        : (type.el === undefined &&\n            (type.el = Template.createElement(\n              trustFromTemplateString(type.h, type.h[0]),\n              this.options\n            )),\n          type);\n\n    if ((this._$committedValue as TemplateInstance)?._$template === template) {\n      debugLogEvent &&\n        debugLogEvent({\n          kind: 'template updating',\n          template,\n          instance: this._$committedValue as TemplateInstance,\n          parts: (this._$committedValue as TemplateInstance)._$parts,\n          options: this.options,\n          values,\n        });\n      (this._$committedValue as TemplateInstance)._update(values);\n    } else {\n      const instance = new TemplateInstance(template as Template, this);\n      const fragment = instance._clone(this.options);\n      debugLogEvent &&\n        debugLogEvent({\n          kind: 'template instantiated',\n          template,\n          instance,\n          parts: instance._$parts,\n          options: this.options,\n          fragment,\n          values,\n        });\n      instance._update(values);\n      debugLogEvent &&\n        debugLogEvent({\n          kind: 'template instantiated and updated',\n          template,\n          instance,\n          parts: instance._$parts,\n          options: this.options,\n          fragment,\n          values,\n        });\n      this._commitNode(fragment);\n      this._$committedValue = instance;\n    }\n  }\n\n  // Overridden via `litHtmlPolyfillSupport` to provide platform support.\n  /** @internal */\n  _$getTemplate(result: UncompiledTemplateResult) {\n    let template = templateCache.get(result.strings);\n    if (template === undefined) {\n      templateCache.set(result.strings, (template = new Template(result)));\n    }\n    return template;\n  }\n\n  private _commitIterable(value: Iterable<unknown>): void {\n    // For an Iterable, we create a new InstancePart per item, then set its\n    // value to the item. This is a little bit of overhead for every item in\n    // an Iterable, but it lets us recurse easily and efficiently update Arrays\n    // of TemplateResults that will be commonly returned from expressions like:\n    // array.map((i) => html`${i}`), by reusing existing TemplateInstances.\n\n    // If value is an array, then the previous render was of an\n    // iterable and value will contain the ChildParts from the previous\n    // render. If value is not an array, clear this part and make a new\n    // array for ChildParts.\n    if (!isArray(this._$committedValue)) {\n      this._$committedValue = [];\n      this._$clear();\n    }\n\n    // Lets us keep track of how many items we stamped so we can clear leftover\n    // items from a previous render\n    const itemParts = this._$committedValue as ChildPart[];\n    let partIndex = 0;\n    let itemPart: ChildPart | undefined;\n\n    for (const item of value) {\n      if (partIndex === itemParts.length) {\n        // If no existing part, create a new one\n        // TODO (justinfagnani): test perf impact of always creating two parts\n        // instead of sharing parts between nodes\n        // https://github.com/lit/lit/issues/1266\n        itemParts.push(\n          (itemPart = new ChildPart(\n            this._insert(createMarker()),\n            this._insert(createMarker()),\n            this,\n            this.options\n          ))\n        );\n      } else {\n        // Reuse an existing part\n        itemPart = itemParts[partIndex];\n      }\n      itemPart._$setValue(item);\n      partIndex++;\n    }\n\n    if (partIndex < itemParts.length) {\n      // itemParts always have end nodes\n      this._$clear(\n        itemPart && wrap(itemPart._$endNode!).nextSibling,\n        partIndex\n      );\n      // Truncate the parts array so _value reflects the current state\n      itemParts.length = partIndex;\n    }\n  }\n\n  /**\n   * Removes the nodes contained within this Part from the DOM.\n   *\n   * @param start Start node to clear from, for clearing a subset of the part's\n   *     DOM (used when truncating iterables)\n   * @param from  When `start` is specified, the index within the iterable from\n   *     which ChildParts are being removed, used for disconnecting directives\n   *     in those Parts.\n   *\n   * @internal\n   */\n  _$clear(\n    start: ChildNode | null = wrap(this._$startNode).nextSibling,\n    from?: number\n  ) {\n    this._$notifyConnectionChanged?.(false, true, from);\n    while (start !== this._$endNode) {\n      // The non-null assertion is safe because if _$startNode.nextSibling is\n      // null, then _$endNode is also null, and we would not have entered this\n      // loop.\n      const n = wrap(start!).nextSibling;\n      wrap(start!).remove();\n      start = n;\n    }\n  }\n\n  /**\n   * Implementation of RootPart's `isConnected`. Note that this method\n   * should only be called on `RootPart`s (the `ChildPart` returned from a\n   * top-level `render()` call). It has no effect on non-root ChildParts.\n   * @param isConnected Whether to set\n   * @internal\n   */\n  setConnected(isConnected: boolean) {\n    if (this._$parent === undefined) {\n      this.__isConnected = isConnected;\n      this._$notifyConnectionChanged?.(isConnected);\n    } else if (DEV_MODE) {\n      throw new Error(\n        'part.setConnected() may only be called on a ' +\n          'RootPart returned from render().'\n      );\n    }\n  }\n}\n\n/**\n * A top-level `ChildPart` returned from `render` that manages the connected\n * state of `AsyncDirective`s created throughout the tree below it.\n */\nexport interface RootPart extends ChildPart {\n  /**\n   * Sets the connection state for `AsyncDirective`s contained within this root\n   * ChildPart.\n   *\n   * lit-html does not automatically monitor the connectedness of DOM rendered;\n   * as such, it is the responsibility of the caller to `render` to ensure that\n   * `part.setConnected(false)` is called before the part object is potentially\n   * discarded, to ensure that `AsyncDirective`s have a chance to dispose of\n   * any resources being held. If a `RootPart` that was previously\n   * disconnected is subsequently re-connected (and its `AsyncDirective`s should\n   * re-connect), `setConnected(true)` should be called.\n   *\n   * @param isConnected Whether directives within this tree should be connected\n   * or not\n   */\n  setConnected(isConnected: boolean): void;\n}\n\nexport type {AttributePart};\nclass AttributePart implements Disconnectable {\n  readonly type:\n    | typeof ATTRIBUTE_PART\n    | typeof PROPERTY_PART\n    | typeof BOOLEAN_ATTRIBUTE_PART\n    | typeof EVENT_PART = ATTRIBUTE_PART;\n  readonly element: HTMLElement;\n  readonly name: string;\n  readonly options: RenderOptions | undefined;\n\n  /**\n   * If this attribute part represents an interpolation, this contains the\n   * static strings of the interpolation. For single-value, complete bindings,\n   * this is undefined.\n   */\n  readonly strings?: ReadonlyArray<string>;\n  /** @internal */\n  _$committedValue: unknown | Array<unknown> = nothing;\n  /** @internal */\n  __directives?: Array<Directive | undefined>;\n  /** @internal */\n  _$parent: Disconnectable;\n  /** @internal */\n  _$disconnectableChildren?: Set<Disconnectable> = undefined;\n\n  protected _sanitizer: ValueSanitizer | undefined;\n\n  get tagName() {\n    return this.element.tagName;\n  }\n\n  // See comment in Disconnectable interface for why this is a getter\n  get _$isConnected() {\n    return this._$parent._$isConnected;\n  }\n\n  constructor(\n    element: HTMLElement,\n    name: string,\n    strings: ReadonlyArray<string>,\n    parent: Disconnectable,\n    options: RenderOptions | undefined\n  ) {\n    this.element = element;\n    this.name = name;\n    this._$parent = parent;\n    this.options = options;\n    if (strings.length > 2 || strings[0] !== '' || strings[1] !== '') {\n      this._$committedValue = new Array(strings.length - 1).fill(new String());\n      this.strings = strings;\n    } else {\n      this._$committedValue = nothing;\n    }\n    if (ENABLE_EXTRA_SECURITY_HOOKS) {\n      this._sanitizer = undefined;\n    }\n  }\n\n  /**\n   * Sets the value of this part by resolving the value from possibly multiple\n   * values and static strings and committing it to the DOM.\n   * If this part is single-valued, `this._strings` will be undefined, and the\n   * method will be called with a single value argument. If this part is\n   * multi-value, `this._strings` will be defined, and the method is called\n   * with the value array of the part's owning TemplateInstance, and an offset\n   * into the value array from which the values should be read.\n   * This method is overloaded this way to eliminate short-lived array slices\n   * of the template instance values, and allow a fast-path for single-valued\n   * parts.\n   *\n   * @param value The part value, or an array of values for multi-valued parts\n   * @param valueIndex the index to start reading values from. `undefined` for\n   *   single-valued parts\n   * @param noCommit causes the part to not commit its value to the DOM. Used\n   *   in hydration to prime attribute parts with their first-rendered value,\n   *   but not set the attribute, and in SSR to no-op the DOM operation and\n   *   capture the value for serialization.\n   *\n   * @internal\n   */\n  _$setValue(\n    value: unknown | Array<unknown>,\n    directiveParent: DirectiveParent = this,\n    valueIndex?: number,\n    noCommit?: boolean\n  ) {\n    const strings = this.strings;\n\n    // Whether any of the values has changed, for dirty-checking\n    let change = false;\n\n    if (strings === undefined) {\n      // Single-value binding case\n      value = resolveDirective(this, value, directiveParent, 0);\n      change =\n        !isPrimitive(value) ||\n        (value !== this._$committedValue && value !== noChange);\n      if (change) {\n        this._$committedValue = value;\n      }\n    } else {\n      // Interpolation case\n      const values = value as Array<unknown>;\n      value = strings[0];\n\n      let i, v;\n      for (i = 0; i < strings.length - 1; i++) {\n        v = resolveDirective(this, values[valueIndex! + i], directiveParent, i);\n\n        if (v === noChange) {\n          // If the user-provided value is `noChange`, use the previous value\n          v = (this._$committedValue as Array<unknown>)[i];\n        }\n        change ||=\n          !isPrimitive(v) || v !== (this._$committedValue as Array<unknown>)[i];\n        if (v === nothing) {\n          value = nothing;\n        } else if (value !== nothing) {\n          value += (v ?? '') + strings[i + 1];\n        }\n        // We always record each value, even if one is `nothing`, for future\n        // change detection.\n        (this._$committedValue as Array<unknown>)[i] = v;\n      }\n    }\n    if (change && !noCommit) {\n      this._commitValue(value);\n    }\n  }\n\n  /** @internal */\n  _commitValue(value: unknown) {\n    if (value === nothing) {\n      (wrap(this.element) as Element).removeAttribute(this.name);\n    } else {\n      if (ENABLE_EXTRA_SECURITY_HOOKS) {\n        if (this._sanitizer === undefined) {\n          this._sanitizer = sanitizerFactoryInternal(\n            this.element,\n            this.name,\n            'attribute'\n          );\n        }\n        value = this._sanitizer(value ?? '');\n      }\n      debugLogEvent &&\n        debugLogEvent({\n          kind: 'commit attribute',\n          element: this.element,\n          name: this.name,\n          value,\n          options: this.options,\n        });\n      (wrap(this.element) as Element).setAttribute(\n        this.name,\n        (value ?? '') as string\n      );\n    }\n  }\n}\n\nexport type {PropertyPart};\nclass PropertyPart extends AttributePart {\n  override readonly type = PROPERTY_PART;\n\n  /** @internal */\n  override _commitValue(value: unknown) {\n    if (ENABLE_EXTRA_SECURITY_HOOKS) {\n      if (this._sanitizer === undefined) {\n        this._sanitizer = sanitizerFactoryInternal(\n          this.element,\n          this.name,\n          'property'\n        );\n      }\n      value = this._sanitizer(value);\n    }\n    debugLogEvent &&\n      debugLogEvent({\n        kind: 'commit property',\n        element: this.element,\n        name: this.name,\n        value,\n        options: this.options,\n      });\n    // eslint-disable-next-line @typescript-eslint/no-explicit-any\n    (this.element as any)[this.name] = value === nothing ? undefined : value;\n  }\n}\n\nexport type {BooleanAttributePart};\nclass BooleanAttributePart extends AttributePart {\n  override readonly type = BOOLEAN_ATTRIBUTE_PART;\n\n  /** @internal */\n  override _commitValue(value: unknown) {\n    debugLogEvent &&\n      debugLogEvent({\n        kind: 'commit boolean attribute',\n        element: this.element,\n        name: this.name,\n        value: !!(value && value !== nothing),\n        options: this.options,\n      });\n    (wrap(this.element) as Element).toggleAttribute(\n      this.name,\n      !!value && value !== nothing\n    );\n  }\n}\n\ntype EventListenerWithOptions = EventListenerOrEventListenerObject &\n  Partial<AddEventListenerOptions>;\n\n/**\n * An AttributePart that manages an event listener via add/removeEventListener.\n *\n * This part works by adding itself as the event listener on an element, then\n * delegating to the value passed to it. This reduces the number of calls to\n * add/removeEventListener if the listener changes frequently, such as when an\n * inline function is used as a listener.\n *\n * Because event options are passed when adding listeners, we must take case\n * to add and remove the part as a listener when the event options change.\n */\nexport type {EventPart};\nclass EventPart extends AttributePart {\n  override readonly type = EVENT_PART;\n\n  constructor(\n    element: HTMLElement,\n    name: string,\n    strings: ReadonlyArray<string>,\n    parent: Disconnectable,\n    options: RenderOptions | undefined\n  ) {\n    super(element, name, strings, parent, options);\n\n    if (DEV_MODE && this.strings !== undefined) {\n      throw new Error(\n        `A \\`<${element.localName}>\\` has a \\`@${name}=...\\` listener with ` +\n          'invalid content. Event listeners in templates must have exactly ' +\n          'one expression and no surrounding text.'\n      );\n    }\n  }\n\n  // EventPart does not use the base _$setValue/_resolveValue implementation\n  // since the dirty checking is more complex\n  /** @internal */\n  override _$setValue(\n    newListener: unknown,\n    directiveParent: DirectiveParent = this\n  ) {\n    newListener =\n      resolveDirective(this, newListener, directiveParent, 0) ?? nothing;\n    if (newListener === noChange) {\n      return;\n    }\n    const oldListener = this._$committedValue;\n\n    // If the new value is nothing or any options change we have to remove the\n    // part as a listener.\n    const shouldRemoveListener =\n      (newListener === nothing && oldListener !== nothing) ||\n      (newListener as EventListenerWithOptions).capture !==\n        (oldListener as EventListenerWithOptions).capture ||\n      (newListener as EventListenerWithOptions).once !==\n        (oldListener as EventListenerWithOptions).once ||\n      (newListener as EventListenerWithOptions).passive !==\n        (oldListener as EventListenerWithOptions).passive;\n\n    // If the new value is not nothing and we removed the listener, we have\n    // to add the part as a listener.\n    const shouldAddListener =\n      newListener !== nothing &&\n      (oldListener === nothing || shouldRemoveListener);\n\n    debugLogEvent &&\n      debugLogEvent({\n        kind: 'commit event listener',\n        element: this.element,\n        name: this.name,\n        value: newListener,\n        options: this.options,\n        removeListener: shouldRemoveListener,\n        addListener: shouldAddListener,\n        oldListener,\n      });\n    if (shouldRemoveListener) {\n      this.element.removeEventListener(\n        this.name,\n        this,\n        oldListener as EventListenerWithOptions\n      );\n    }\n    if (shouldAddListener) {\n      this.element.addEventListener(\n        this.name,\n        this,\n        newListener as EventListenerWithOptions\n      );\n    }\n    this._$committedValue = newListener;\n  }\n\n  handleEvent(event: Event) {\n    if (typeof this._$committedValue === 'function') {\n      this._$committedValue.call(this.options?.host ?? this.element, event);\n    } else {\n      (this._$committedValue as EventListenerObject).handleEvent(event);\n    }\n  }\n}\n\nexport type {ElementPart};\nclass ElementPart implements Disconnectable {\n  readonly type = ELEMENT_PART;\n\n  /** @internal */\n  __directive?: Directive;\n\n  // This is to ensure that every Part has a _$committedValue\n  _$committedValue: undefined;\n\n  /** @internal */\n  _$parent!: Disconnectable;\n\n  /** @internal */\n  _$disconnectableChildren?: Set<Disconnectable> = undefined;\n\n  options: RenderOptions | undefined;\n\n  constructor(\n    public element: Element,\n    parent: Disconnectable,\n    options: RenderOptions | undefined\n  ) {\n    this._$parent = parent;\n    this.options = options;\n  }\n\n  // See comment in Disconnectable interface for why this is a getter\n  get _$isConnected() {\n    return this._$parent._$isConnected;\n  }\n\n  _$setValue(value: unknown): void {\n    debugLogEvent &&\n      debugLogEvent({\n        kind: 'commit to element binding',\n        element: this.element,\n        value,\n        options: this.options,\n      });\n    resolveDirective(this, value);\n  }\n}\n\n/**\n * END USERS SHOULD NOT RELY ON THIS OBJECT.\n *\n * Private exports for use by other Lit packages, not intended for use by\n * external users.\n *\n * We currently do not make a mangled rollup build of the lit-ssr code. In order\n * to keep a number of (otherwise private) top-level exports mangled in the\n * client side code, we export a _$LH object containing those members (or\n * helper methods for accessing private fields of those members), and then\n * re-export them for use in lit-ssr. This keeps lit-ssr agnostic to whether the\n * client-side code is being used in `dev` mode or `prod` mode.\n *\n * This has a unique name, to disambiguate it from private exports in\n * lit-element, which re-exports all of lit-html.\n *\n * @private\n */\nexport const _$LH = {\n  // Used in lit-ssr\n  _boundAttributeSuffix: boundAttributeSuffix,\n  _marker: marker,\n  _markerMatch: markerMatch,\n  _HTML_RESULT: HTML_RESULT,\n  _getTemplateHtml: getTemplateHtml,\n  // Used in tests and private-ssr-support\n  _TemplateInstance: TemplateInstance,\n  _isIterable: isIterable,\n  _resolveDirective: resolveDirective,\n  _ChildPart: ChildPart,\n  _AttributePart: AttributePart,\n  _BooleanAttributePart: BooleanAttributePart,\n  _EventPart: EventPart,\n  _PropertyPart: PropertyPart,\n  _ElementPart: ElementPart,\n};\n\n// Apply polyfills if available\nconst polyfillSupport = DEV_MODE\n  ? global.litHtmlPolyfillSupportDevMode\n  : global.litHtmlPolyfillSupport;\npolyfillSupport?.(Template, ChildPart);\n\n// IMPORTANT: do not change the property name or the assignment expression.\n// This line will be used in regexes to search for lit-html usage.\n(global.litHtmlVersions ??= []).push('3.3.1');\nif (DEV_MODE && global.litHtmlVersions.length > 1) {\n  queueMicrotask(() => {\n    issueWarning!(\n      'multiple-versions',\n      `Multiple versions of Lit loaded. ` +\n        `Loading multiple versions is not recommended.`\n    );\n  });\n}\n\n/**\n * Renders a value, usually a lit-html TemplateResult, to the container.\n *\n * This example renders the text \"Hello, Zoe!\" inside a paragraph tag, appending\n * it to the container `document.body`.\n *\n * ```js\n * import {html, render} from 'lit';\n *\n * const name = \"Zoe\";\n * render(html`<p>Hello, ${name}!</p>`, document.body);\n * ```\n *\n * @param value Any [renderable\n *   value](https://lit.dev/docs/templates/expressions/#child-expressions),\n *   typically a {@linkcode TemplateResult} created by evaluating a template tag\n *   like {@linkcode html} or {@linkcode svg}.\n * @param container A DOM container to render to. The first render will append\n *   the rendered value to the container, and subsequent renders will\n *   efficiently update the rendered value if the same result type was\n *   previously rendered there.\n * @param options See {@linkcode RenderOptions} for options documentation.\n * @see\n * {@link https://lit.dev/docs/libraries/standalone-templates/#rendering-lit-html-templates| Rendering Lit HTML Templates}\n */\nexport const render = (\n  value: unknown,\n  container: HTMLElement | DocumentFragment,\n  options?: RenderOptions\n): RootPart => {\n  if (DEV_MODE && container == null) {\n    // Give a clearer error message than\n    //     Uncaught TypeError: Cannot read properties of null (reading\n    //     '_$litPart$')\n    // which reads like an internal Lit error.\n    throw new TypeError(`The container to render into may not be ${container}`);\n  }\n  const renderId = DEV_MODE ? debugLogRenderId++ : 0;\n  const partOwnerNode = options?.renderBefore ?? container;\n  // This property needs to remain unminified.\n  // eslint-disable-next-line @typescript-eslint/no-explicit-any\n  let part: ChildPart = (partOwnerNode as any)['_$litPart$'];\n  debugLogEvent &&\n    debugLogEvent({\n      kind: 'begin render',\n      id: renderId,\n      value,\n      container,\n      options,\n      part,\n    });\n  if (part === undefined) {\n    const endNode = options?.renderBefore ?? null;\n    // This property needs to remain unminified.\n    // eslint-disable-next-line @typescript-eslint/no-explicit-any\n    (partOwnerNode as any)['_$litPart$'] = part = new ChildPart(\n      container.insertBefore(createMarker(), endNode),\n      endNode,\n      undefined,\n      options ?? {}\n    );\n  }\n  part._$setValue(value);\n  debugLogEvent &&\n    debugLogEvent({\n      kind: 'end render',\n      id: renderId,\n      value,\n      container,\n      options,\n      part,\n    });\n  return part as RootPart;\n};\n\nif (ENABLE_EXTRA_SECURITY_HOOKS) {\n  render.setSanitizer = setSanitizer;\n  render.createSanitizer = createSanitizer;\n  if (DEV_MODE) {\n    render._testOnlyClearSanitizerFactoryDoNotCallOrElse =\n      _testOnlyClearSanitizerFactoryDoNotCallOrElse;\n  }\n}\n", "/**\n * @license\n * Copyright 2017 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\n/**\n * The main LitElement module, which defines the {@linkcode LitElement} base\n * class and related APIs.\n *\n * LitElement components can define a template and a set of observed\n * properties. Changing an observed property triggers a re-render of the\n * element.\n *\n * Import {@linkcode LitElement} and {@linkcode html} from this module to\n * create a component:\n *\n *  ```js\n * import {LitElement, html} from 'lit-element';\n *\n * class MyElement extends LitElement {\n *\n *   // Declare observed properties\n *   static get properties() {\n *     return {\n *       adjective: {}\n *     }\n *   }\n *\n *   constructor() {\n *     this.adjective = 'awesome';\n *   }\n *\n *   // Define the element's template\n *   render() {\n *     return html`<p>your ${adjective} template here</p>`;\n *   }\n * }\n *\n * customElements.define('my-element', MyElement);\n * ```\n *\n * `LitElement` extends {@linkcode ReactiveElement} and adds lit-html\n * templating. The `ReactiveElement` class is provided for users that want to\n * build their own custom element base classes that don't use lit-html.\n *\n * @packageDocumentation\n */\nimport {PropertyValues, ReactiveElement} from '@lit/reactive-element';\nimport {render, RenderOptions, noChange, RootPart} from 'lit-html';\nexport * from '@lit/reactive-element';\nexport * from 'lit-html';\n\nimport {LitUnstable} from 'lit-html';\nimport {ReactiveUnstable} from '@lit/reactive-element';\n\n/**\n * Contains types that are part of the unstable debug API.\n *\n * Everything in this API is not stable and may change or be removed in the future,\n * even on patch releases.\n */\n// eslint-disable-next-line @typescript-eslint/no-namespace\nexport namespace Unstable {\n  /**\n   * When Lit is running in dev mode and `window.emitLitDebugLogEvents` is true,\n   * we will emit 'lit-debug' events to window, with live details about the update and render\n   * lifecycle. These can be useful for writing debug tooling and visualizations.\n   *\n   * Please be aware that running with window.emitLitDebugLogEvents has performance overhead,\n   * making certain operations that are normally very cheap (like a no-op render) much slower,\n   * because we must copy data and dispatch events.\n   */\n  // eslint-disable-next-line @typescript-eslint/no-namespace\n  export namespace DebugLog {\n    export type Entry =\n      | LitUnstable.DebugLog.Entry\n      | ReactiveUnstable.DebugLog.Entry;\n  }\n}\n/*\n * When using Closure Compiler, JSCompiler_renameProperty(property, object) is\n * replaced at compile time by the munged name for object[property]. We cannot\n * alias this function, so we have to use a small shim that has the same\n * behavior when not compiling.\n */\n/*@__INLINE__*/\nconst JSCompiler_renameProperty = <P extends PropertyKey>(\n  prop: P,\n  _obj: unknown\n): P => prop;\n\nconst DEV_MODE = true;\n// Allows minifiers to rename references to globalThis\nconst global = globalThis;\n\nlet issueWarning: (code: string, warning: string) => void;\n\nif (DEV_MODE) {\n  // Ensure warnings are issued only 1x, even if multiple versions of Lit\n  // are loaded.\n  global.litIssuedWarnings ??= new Set();\n\n  /**\n   * Issue a warning if we haven't already, based either on `code` or `warning`.\n   * Warnings are disabled automatically only by `warning`; disabling via `code`\n   * can be done by users.\n   */\n  issueWarning = (code: string, warning: string) => {\n    warning += ` See https://lit.dev/msg/${code} for more information.`;\n    if (\n      !global.litIssuedWarnings!.has(warning) &&\n      !global.litIssuedWarnings!.has(code)\n    ) {\n      console.warn(warning);\n      global.litIssuedWarnings!.add(warning);\n    }\n  };\n}\n\n/**\n * Base element class that manages element properties and attributes, and\n * renders a lit-html template.\n *\n * To define a component, subclass `LitElement` and implement a\n * `render` method to provide the component's template. Define properties\n * using the {@linkcode LitElement.properties properties} property or the\n * {@linkcode property} decorator.\n */\nexport class LitElement extends ReactiveElement {\n  // This property needs to remain unminified.\n  static ['_$litElement$'] = true;\n\n  /**\n   * @category rendering\n   */\n  readonly renderOptions: RenderOptions = {host: this};\n\n  private __childPart: RootPart | undefined = undefined;\n\n  /**\n   * @category rendering\n   */\n  protected override createRenderRoot() {\n    const renderRoot = super.createRenderRoot();\n    // When adoptedStyleSheets are shimmed, they are inserted into the\n    // shadowRoot by createRenderRoot. Adjust the renderBefore node so that\n    // any styles in Lit content render before adoptedStyleSheets. This is\n    // important so that adoptedStyleSheets have precedence over styles in\n    // the shadowRoot.\n    this.renderOptions.renderBefore ??= renderRoot!.firstChild as ChildNode;\n    return renderRoot;\n  }\n\n  /**\n   * Updates the element. This method reflects property values to attributes\n   * and calls `render` to render DOM via lit-html. Setting properties inside\n   * this method will *not* trigger another update.\n   * @param changedProperties Map of changed properties with old values\n   * @category updates\n   */\n  protected override update(changedProperties: PropertyValues) {\n    // Setting properties in `render` should not trigger an update. Since\n    // updates are allowed after super.update, it's important to call `render`\n    // before that.\n    const value = this.render();\n    if (!this.hasUpdated) {\n      this.renderOptions.isConnected = this.isConnected;\n    }\n    super.update(changedProperties);\n    this.__childPart = render(value, this.renderRoot, this.renderOptions);\n  }\n\n  /**\n   * Invoked when the component is added to the document's DOM.\n   *\n   * In `connectedCallback()` you should setup tasks that should only occur when\n   * the element is connected to the document. The most common of these is\n   * adding event listeners to nodes external to the element, like a keydown\n   * event handler added to the window.\n   *\n   * ```ts\n   * connectedCallback() {\n   *   super.connectedCallback();\n   *   addEventListener('keydown', this._handleKeydown);\n   * }\n   * ```\n   *\n   * Typically, anything done in `connectedCallback()` should be undone when the\n   * element is disconnected, in `disconnectedCallback()`.\n   *\n   * @category lifecycle\n   */\n  override connectedCallback() {\n    super.connectedCallback();\n    this.__childPart?.setConnected(true);\n  }\n\n  /**\n   * Invoked when the component is removed from the document's DOM.\n   *\n   * This callback is the main signal to the element that it may no longer be\n   * used. `disconnectedCallback()` should ensure that nothing is holding a\n   * reference to the element (such as event listeners added to nodes external\n   * to the element), so that it is free to be garbage collected.\n   *\n   * ```ts\n   * disconnectedCallback() {\n   *   super.disconnectedCallback();\n   *   window.removeEventListener('keydown', this._handleKeydown);\n   * }\n   * ```\n   *\n   * An element may be re-connected after being disconnected.\n   *\n   * @category lifecycle\n   */\n  override disconnectedCallback() {\n    super.disconnectedCallback();\n    this.__childPart?.setConnected(false);\n  }\n\n  /**\n   * Invoked on each update to perform rendering tasks. This method may return\n   * any value renderable by lit-html's `ChildPart` - typically a\n   * `TemplateResult`. Setting properties inside this method will *not* trigger\n   * the element to update.\n   * @category rendering\n   */\n  protected render(): unknown {\n    return noChange;\n  }\n}\n\n/**\n * Ensure this class is marked as `finalized` as an optimization ensuring\n * it will not needlessly try to `finalize`.\n *\n * Note this property name is a string to prevent breaking Closure JS Compiler\n * optimizations. See @lit/reactive-element for more information.\n */\n(LitElement as unknown as Record<string, unknown>)[\n  JSCompiler_renameProperty('finalized', LitElement)\n] = true;\n\n// Install hydration if available\nglobal.litElementHydrateSupport?.({LitElement});\n\n// Apply polyfills if available\nconst polyfillSupport = DEV_MODE\n  ? global.litElementPolyfillSupportDevMode\n  : global.litElementPolyfillSupport;\npolyfillSupport?.({LitElement});\n\n/**\n * END USERS SHOULD NOT RELY ON THIS OBJECT.\n *\n * Private exports for use by other Lit packages, not intended for use by\n * external users.\n *\n * We currently do not make a mangled rollup build of the lit-ssr code. In order\n * to keep a number of (otherwise private) top-level exports  mangled in the\n * client side code, we export a _$LE object containing those members (or\n * helper methods for accessing private fields of those members), and then\n * re-export them for use in lit-ssr. This keeps lit-ssr agnostic to whether the\n * client-side code is being used in `dev` mode or `prod` mode.\n *\n * This has a unique name, to disambiguate it from private exports in\n * lit-html, since this module re-exports all of lit-html.\n *\n * @private\n */\nexport const _$LE = {\n  _$attributeToProperty: (\n    el: LitElement,\n    name: string,\n    value: string | null\n  ) => {\n    // eslint-disable-next-line\n    (el as any)._$attributeToProperty(name, value);\n  },\n  // eslint-disable-next-line\n  _$changedProperties: (el: LitElement) => (el as any)._$changedProperties,\n};\n\n// IMPORTANT: do not change the property name or the assignment expression.\n// This line will be used in regexes to search for LitElement usage.\n(global.litElementVersions ??= []).push('4.2.1');\nif (DEV_MODE && global.litElementVersions.length > 1) {\n  queueMicrotask(() => {\n    issueWarning!(\n      'multiple-versions',\n      `Multiple versions of Lit loaded. Loading multiple versions ` +\n        `is not recommended.`\n    );\n  });\n}\n", "var r=function(){for(var t=[],n=arguments.length;n--;)t[n]=arguments[n];return t.reduce(function(t,n){return t.concat(\"string\"==typeof n?n:Array.isArray(n)?r.apply(void 0,n):\"object\"==typeof n&&n?Object.keys(n).map(function(r){return n[r]?r:\"\"}):\"\")},[]).join(\" \")};export{r as classNames};\n", "/**\n * @license\n * Copyright 2017 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\n/*\n * IMPORTANT: For compatibility with tsickle and the Closure JS compiler, all\n * property decorators (but not class decorators) in this file that have\n * an @ExportDecoratedItems annotation must be defined as a regular function,\n * not an arrow function.\n */\n\nimport {\n  type PropertyDeclaration,\n  type ReactiveElement,\n  defaultConverter,\n  notEqual,\n} from '../reactive-element.js';\nimport type {Interface} from './base.js';\n\nconst DEV_MODE = true;\n\nlet issueWarning: (code: string, warning: string) => void;\n\nif (DEV_MODE) {\n  // Ensure warnings are issued only 1x, even if multiple versions of Lit\n  // are loaded.\n  globalThis.litIssuedWarnings ??= new Set();\n\n  /**\n   * Issue a warning if we haven't already, based either on `code` or `warning`.\n   * Warnings are disabled automatically only by `warning`; disabling via `code`\n   * can be done by users.\n   */\n  issueWarning = (code: string, warning: string) => {\n    warning += ` See https://lit.dev/msg/${code} for more information.`;\n    if (\n      !globalThis.litIssuedWarnings!.has(warning) &&\n      !globalThis.litIssuedWarnings!.has(code)\n    ) {\n      console.warn(warning);\n      globalThis.litIssuedWarnings!.add(warning);\n    }\n  };\n}\n\n// Overloads for property decorator so that TypeScript can infer the correct\n// return type when a decorator is used as an accessor decorator or a setter\n// decorator.\nexport type PropertyDecorator = {\n  // accessor decorator signature\n  <C extends Interface<ReactiveElement>, V>(\n    target: ClassAccessorDecoratorTarget<C, V>,\n    context: ClassAccessorDecoratorContext<C, V>\n  ): ClassAccessorDecoratorResult<C, V>;\n\n  // setter decorator signature\n  <C extends Interface<ReactiveElement>, V>(\n    target: (value: V) => void,\n    context: ClassSetterDecoratorContext<C, V>\n  ): (this: C, value: V) => void;\n\n  // legacy decorator signature\n  (\n    protoOrDescriptor: Object,\n    name: PropertyKey,\n    descriptor?: PropertyDescriptor\n    // eslint-disable-next-line @typescript-eslint/no-explicit-any\n  ): any;\n};\n\nconst legacyProperty = (\n  options: PropertyDeclaration | undefined,\n  proto: Object,\n  name: PropertyKey\n) => {\n  const hasOwnProperty = proto.hasOwnProperty(name);\n  (proto.constructor as typeof ReactiveElement).createProperty(name, options);\n  // For accessors (which have a descriptor on the prototype) we need to\n  // return a descriptor, otherwise TypeScript overwrites the descriptor we\n  // define in createProperty() with the original descriptor. We don't do this\n  // for fields, which don't have a descriptor, because this could overwrite\n  // descriptor defined by other decorators.\n  return hasOwnProperty\n    ? Object.getOwnPropertyDescriptor(proto, name)\n    : undefined;\n};\n\n// This is duplicated from a similar variable in reactive-element.ts, but\n// actually makes sense to have this default defined with the decorator, so\n// that different decorators could have different defaults.\nconst defaultPropertyDeclaration: PropertyDeclaration = {\n  attribute: true,\n  type: String,\n  converter: defaultConverter,\n  reflect: false,\n  hasChanged: notEqual,\n};\n\n// Temporary type, until google3 is on TypeScript 5.2\ntype StandardPropertyContext<C, V> = (\n  | ClassAccessorDecoratorContext<C, V>\n  | ClassSetterDecoratorContext<C, V>\n) & {metadata: object};\n\n/**\n * Wraps a class accessor or setter so that `requestUpdate()` is called with the\n * property name and old value when the accessor is set.\n */\nexport const standardProperty = <C extends Interface<ReactiveElement>, V>(\n  options: PropertyDeclaration = defaultPropertyDeclaration,\n  target: ClassAccessorDecoratorTarget<C, V> | ((value: V) => void),\n  context: StandardPropertyContext<C, V>\n): ClassAccessorDecoratorResult<C, V> | ((this: C, value: V) => void) => {\n  const {kind, metadata} = context;\n\n  if (DEV_MODE && metadata == null) {\n    issueWarning(\n      'missing-class-metadata',\n      `The class ${target} is missing decorator metadata. This ` +\n        `could mean that you're using a compiler that supports decorators ` +\n        `but doesn't support decorator metadata, such as TypeScript 5.1. ` +\n        `Please update your compiler.`\n    );\n  }\n\n  // Store the property options\n  let properties = globalThis.litPropertyMetadata.get(metadata);\n  if (properties === undefined) {\n    globalThis.litPropertyMetadata.set(metadata, (properties = new Map()));\n  }\n  if (kind === 'setter') {\n    options = Object.create(options);\n    options.wrapped = true;\n  }\n  properties.set(context.name, options);\n\n  if (kind === 'accessor') {\n    // Standard decorators cannot dynamically modify the class, so we can't\n    // replace a field with accessors. The user must use the new `accessor`\n    // keyword instead.\n    const {name} = context;\n    return {\n      set(this: ReactiveElement, v: V) {\n        const oldValue = (\n          target as ClassAccessorDecoratorTarget<C, V>\n        ).get.call(this as unknown as C);\n        (target as ClassAccessorDecoratorTarget<C, V>).set.call(\n          this as unknown as C,\n          v\n        );\n        this.requestUpdate(name, oldValue, options);\n      },\n      init(this: ReactiveElement, v: V): V {\n        if (v !== undefined) {\n          this._$changeProperty(name, undefined, options, v);\n        }\n        return v;\n      },\n    } as unknown as ClassAccessorDecoratorResult<C, V>;\n  } else if (kind === 'setter') {\n    const {name} = context;\n    return function (this: ReactiveElement, value: V) {\n      const oldValue = this[name as keyof ReactiveElement];\n      (target as (value: V) => void).call(this, value);\n      this.requestUpdate(name, oldValue, options);\n    } as unknown as (this: C, value: V) => void;\n  }\n  throw new Error(`Unsupported decorator location: ${kind}`);\n};\n\n/**\n * A class field or accessor decorator which creates a reactive property that\n * reflects a corresponding attribute value. When a decorated property is set\n * the element will update and render. A {@linkcode PropertyDeclaration} may\n * optionally be supplied to configure property features.\n *\n * This decorator should only be used for public fields. As public fields,\n * properties should be considered as primarily settable by element users,\n * either via attribute or the property itself.\n *\n * Generally, properties that are changed by the element should be private or\n * protected fields and should use the {@linkcode state} decorator.\n *\n * However, sometimes element code does need to set a public property. This\n * should typically only be done in response to user interaction, and an event\n * should be fired informing the user; for example, a checkbox sets its\n * `checked` property when clicked and fires a `changed` event. Mutating public\n * properties should typically not be done for non-primitive (object or array)\n * properties. In other cases when an element needs to manage state, a private\n * property decorated via the {@linkcode state} decorator should be used. When\n * needed, state properties can be initialized via public properties to\n * facilitate complex interactions.\n *\n * ```ts\n * class MyElement {\n *   @property({ type: Boolean })\n *   clicked = false;\n * }\n * ```\n * @category Decorator\n * @ExportDecoratedItems\n */\nexport function property(options?: PropertyDeclaration): PropertyDecorator {\n  return <C extends Interface<ReactiveElement>, V>(\n    protoOrTarget:\n      | object\n      | ClassAccessorDecoratorTarget<C, V>\n      | ((value: V) => void),\n    nameOrContext:\n      | PropertyKey\n      | ClassAccessorDecoratorContext<C, V>\n      | ClassSetterDecoratorContext<C, V>\n    // eslint-disable-next-line @typescript-eslint/no-explicit-any\n  ): any => {\n    return (\n      typeof nameOrContext === 'object'\n        ? standardProperty<C, V>(\n            options,\n            protoOrTarget as\n              | ClassAccessorDecoratorTarget<C, V>\n              | ((value: V) => void),\n            nameOrContext as StandardPropertyContext<C, V>\n          )\n        : legacyProperty(\n            options,\n            protoOrTarget as Object,\n            nameOrContext as PropertyKey\n          )\n    ) as PropertyDecorator;\n  };\n}\n", "/**\n * @license\n * Copyright 2017 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\n/*\n * IMPORTANT: For compatibility with tsickle and the Closure JS compiler, all\n * property decorators (but not class decorators) in this file that have\n * an @ExportDecoratedItems annotation must be defined as a regular function,\n * not an arrow function.\n */\n\nimport {property} from './property.js';\n\nexport interface StateDeclaration<Type = unknown> {\n  /**\n   * A function that indicates if a property should be considered changed when\n   * it is set. The function should take the `newValue` and `oldValue` and\n   * return `true` if an update should be requested.\n   */\n  hasChanged?(value: Type, oldValue: Type): boolean;\n}\n\n/**\n * @deprecated use StateDeclaration\n */\nexport type InternalPropertyDeclaration<Type = unknown> =\n  StateDeclaration<Type>;\n\n/**\n * Declares a private or protected reactive property that still triggers\n * updates to the element when it changes. It does not reflect from the\n * corresponding attribute.\n *\n * Properties declared this way must not be used from HTML or HTML templating\n * systems, they're solely for properties internal to the element. These\n * properties may be renamed by optimization tools like closure compiler.\n * @category Decorator\n */\nexport function state(options?: StateDeclaration) {\n  return property({\n    ...options,\n    // Add both `state` and `attribute` because we found a third party\n    // controller that is keying off of PropertyOptions.state to determine\n    // whether a field is a private internal property or not.\n    state: true,\n    attribute: false,\n  });\n}\n", "/**\n * @license\n * Copyright 2017 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\n/**\n * Generates a public interface type that removes private and protected fields.\n * This allows accepting otherwise incompatible versions of the type (e.g. from\n * multiple copies of the same package in `node_modules`).\n */\nexport type Interface<T> = {\n  [K in keyof T]: T[K];\n};\n\nexport type Constructor<T> = {\n  // eslint-disable-next-line @typescript-eslint/no-explicit-any\n  new (...args: any[]): T;\n};\n\n/**\n * Wraps up a few best practices when returning a property descriptor from a\n * decorator.\n *\n * Marks the defined property as configurable, and enumerable, and handles\n * the case where we have a busted Reflect.decorate zombiefill (e.g. in Angular\n * apps).\n *\n * @internal\n */\nexport const desc = (\n  obj: object,\n  name: PropertyKey | ClassAccessorDecoratorContext<unknown, unknown>,\n  descriptor: PropertyDescriptor\n) => {\n  // For backwards compatibility, we keep them configurable and enumerable.\n  descriptor.configurable = true;\n  descriptor.enumerable = true;\n  if (\n    // We check for Reflect.decorate each time, in case the zombiefill\n    // is applied via lazy loading some Angular code.\n    (Reflect as typeof Reflect & {decorate?: unknown}).decorate &&\n    typeof name !== 'object'\n  ) {\n    // If we're called as a legacy decorator, and Reflect.decorate is present\n    // then we have no guarantees that the returned descriptor will be\n    // defined on the class, so we must apply it directly ourselves.\n\n    Object.defineProperty(obj, name, descriptor);\n  }\n  return descriptor;\n};\n", "/**\n * @license\n * Copyright 2017 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\n/*\n * IMPORTANT: For compatibility with tsickle and the Closure JS compiler, all\n * property decorators (but not class decorators) in this file that have\n * an @ExportDecoratedItems annotation must be defined as a regular function,\n * not an arrow function.\n */\nimport type {ReactiveElement} from '../reactive-element.js';\nimport {desc, type Interface} from './base.js';\n\nconst DEV_MODE = true;\n\nlet issueWarning: (code: string, warning: string) => void;\n\nif (DEV_MODE) {\n  // Ensure warnings are issued only 1x, even if multiple versions of Lit\n  // are loaded.\n  globalThis.litIssuedWarnings ??= new Set();\n\n  /**\n   * Issue a warning if we haven't already, based either on `code` or `warning`.\n   * Warnings are disabled automatically only by `warning`; disabling via `code`\n   * can be done by users.\n   */\n  issueWarning = (code: string, warning: string) => {\n    warning += code\n      ? ` See https://lit.dev/msg/${code} for more information.`\n      : '';\n    if (\n      !globalThis.litIssuedWarnings!.has(warning) &&\n      !globalThis.litIssuedWarnings!.has(code)\n    ) {\n      console.warn(warning);\n      globalThis.litIssuedWarnings!.add(warning);\n    }\n  };\n}\n\nexport type QueryDecorator = {\n  // legacy\n  (\n    proto: Interface<ReactiveElement>,\n    name: PropertyKey,\n    descriptor?: PropertyDescriptor\n    // Note TypeScript requires the return type to be `void|any`\n    // eslint-disable-next-line @typescript-eslint/no-explicit-any\n  ): void | any;\n\n  // standard\n  <C extends Interface<ReactiveElement>, V extends Element | null>(\n    value: ClassAccessorDecoratorTarget<C, V>,\n    context: ClassAccessorDecoratorContext<C, V>\n  ): ClassAccessorDecoratorResult<C, V>;\n};\n\n/**\n * A property decorator that converts a class property into a getter that\n * executes a querySelector on the element's renderRoot.\n *\n * @param selector A DOMString containing one or more selectors to match.\n * @param cache An optional boolean which when true performs the DOM query only\n *     once and caches the result.\n *\n * See: https://developer.mozilla.org/en-US/docs/Web/API/Document/querySelector\n *\n * ```ts\n * class MyElement {\n *   @query('#first')\n *   first: HTMLDivElement;\n *\n *   render() {\n *     return html`\n *       <div id=\"first\"></div>\n *       <div id=\"second\"></div>\n *     `;\n *   }\n * }\n * ```\n * @category Decorator\n */\nexport function query(selector: string, cache?: boolean): QueryDecorator {\n  return (<C extends Interface<ReactiveElement>, V extends Element | null>(\n    protoOrTarget: ClassAccessorDecoratorTarget<C, V>,\n    nameOrContext: PropertyKey | ClassAccessorDecoratorContext<C, V>,\n    descriptor?: PropertyDescriptor\n  ) => {\n    const doQuery = (el: Interface<ReactiveElement>): V => {\n      const result = (el.renderRoot?.querySelector(selector) ?? null) as V;\n      if (DEV_MODE && result === null && cache && !el.hasUpdated) {\n        const name =\n          typeof nameOrContext === 'object'\n            ? nameOrContext.name\n            : nameOrContext;\n        issueWarning(\n          '',\n          `@query'd field ${JSON.stringify(String(name))} with the 'cache' ` +\n            `flag set for selector '${selector}' has been accessed before ` +\n            `the first update and returned null. This is expected if the ` +\n            `renderRoot tree has not been provided beforehand (e.g. via ` +\n            `Declarative Shadow DOM). Therefore the value hasn't been cached.`\n        );\n      }\n      // TODO: if we want to allow users to assert that the query will never\n      // return null, we need a new option and to throw here if the result\n      // is null.\n      return result;\n    };\n    if (cache) {\n      // Accessors to wrap from either:\n      //   1. The decorator target, in the case of standard decorators\n      //   2. The property descriptor, in the case of experimental decorators\n      //      on auto-accessors.\n      //   3. Functions that access our own cache-key property on the instance,\n      //      in the case of experimental decorators on fields.\n      const {get, set} =\n        typeof nameOrContext === 'object'\n          ? protoOrTarget\n          : descriptor ??\n            (() => {\n              const key = DEV_MODE\n                ? Symbol(`${String(nameOrContext)} (@query() cache)`)\n                : Symbol();\n              type WithCache = ReactiveElement & {\n                [key: symbol]: Element | null;\n              };\n              return {\n                get() {\n                  return (this as WithCache)[key];\n                },\n                set(v) {\n                  (this as WithCache)[key] = v;\n                },\n              };\n            })();\n      return desc(protoOrTarget, nameOrContext, {\n        get(this: ReactiveElement): V {\n          let result: V = get!.call(this);\n          if (result === undefined) {\n            result = doQuery(this);\n            if (result !== null || this.hasUpdated) {\n              set!.call(this, result);\n            }\n          }\n          return result;\n        },\n      });\n    } else {\n      // This object works as the return type for both standard and\n      // experimental decorators.\n      return desc(protoOrTarget, nameOrContext, {\n        get(this: ReactiveElement) {\n          return doQuery(this);\n        },\n      });\n    }\n  }) as QueryDecorator;\n}\n", "/**\n * @license\n * Copyright 2018 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\nimport {nothing} from '../lit-html.js';\n\n/**\n * For AttributeParts, sets the attribute if the value is defined and removes\n * the attribute if the value is undefined.\n *\n * For other part types, this directive is a no-op.\n */\nexport const ifDefined = <T>(value: T) => value ?? nothing;\n", "import { css } from 'lit';\n\nexport const reset = css`\n  *,\n  :before,\n  :after {\n    box-sizing: border-box;\n    border-style: solid;\n    border-width: 0;\n    border-color: var(--w-s-color-border);\n  }\n  html {\n    font-size: 62.5%;\n  }\n  body {\n    background-color: var(--w-s-color-background);\n    min-height: 100%;\n    margin: 0;\n    overflow-y: scroll;\n  }\n  body,\n  :host {\n    -webkit-text-size-adjust: 100%;\n    tab-size: 4;\n    -webkit-tap-highlight-color: transparent;\n    font-family: var(--w-font-family);\n    font-size: var(--w-font-size-m);\n    line-height: var(--w-line-height-m);\n    color: var(--w-s-color-text);\n  }\n  hr {\n    color: inherit;\n    border-top-width: 1px;\n    height: 0;\n  }\n  abbr:where([title]) {\n    -webkit-text-decoration: underline dotted;\n    text-decoration: underline dotted;\n  }\n  h1,\n  h2,\n  h3,\n  h4,\n  h5,\n  h6 {\n    font-size: inherit;\n    font-weight: 700;\n  }\n  a {\n    cursor: pointer;\n    color: var(--w-s-color-text-link);\n    text-decoration: none;\n  }\n  a:hover,\n  a:focus,\n  a:active {\n    text-decoration: underline;\n  }\n  a:focus-visible {\n    outline: 2px solid var(--w-s-color-border-focus);\n    outline-offset: 1px;\n  }\n  b,\n  strong {\n    font-weight: 700;\n  }\n  code,\n  kbd,\n  samp,\n  pre {\n    font-family:\n      ui-monospace,\n      SFMono-Regular,\n      Menlo,\n      Monaco,\n      Consolas,\n      Liberation Mono,\n      Courier New,\n      monospace;\n    font-size: 1em;\n  }\n  sub,\n  sup {\n    vertical-align: baseline;\n    font-size: 75%;\n    line-height: 0;\n    position: relative;\n  }\n  sub {\n    bottom: -0.25em;\n  }\n  sup {\n    top: -0.5em;\n  }\n  table {\n    text-indent: 0;\n    border-color: inherit;\n    border-collapse: collapse;\n  }\n  button,\n  input,\n  optgroup,\n  select,\n  textarea {\n    font-family: inherit;\n    font-size: 100%;\n    font-weight: inherit;\n    line-height: inherit;\n    color: inherit;\n    margin: 0;\n    padding: 0;\n  }\n  button,\n  select {\n    text-transform: none;\n  }\n  button,\n  [type='button'],\n  [type='reset'],\n  [type='submit'] {\n    -webkit-appearance: button;\n  }\n  :-moz-focusring {\n    outline: auto;\n  }\n  :-moz-ui-invalid {\n    box-shadow: none;\n  }\n  progress {\n    vertical-align: baseline;\n  }\n  ::-webkit-inner-spin-button {\n    height: auto;\n  }\n  ::-webkit-outer-spin-button {\n    height: auto;\n  }\n  [type='search'] {\n    -webkit-appearance: textfield;\n    outline-offset: -2px;\n  }\n  ::-webkit-search-decoration {\n    -webkit-appearance: none;\n  }\n  ::-webkit-file-upload-button {\n    -webkit-appearance: button;\n    font: inherit;\n  }\n  summary {\n    display: list-item;\n  }\n  blockquote,\n  dl,\n  dd,\n  h1,\n  h2,\n  h3,\n  h4,\n  h5,\n  h6,\n  hr,\n  figure,\n  p,\n  pre {\n    margin: 0;\n  }\n  fieldset {\n    margin: 0;\n    padding: 0;\n  }\n  legend {\n    padding: 0;\n  }\n  ol,\n  ul,\n  menu {\n    margin: 0;\n    padding: 0;\n    list-style: none;\n  }\n  textarea {\n    resize: vertical;\n  }\n  input::placeholder,\n  textarea::placeholder {\n    opacity: 1;\n    color: var(--w-s-color-text-placeholder);\n  }\n  button,\n  [role='button'] {\n    cursor: pointer;\n  }\n  :disabled {\n    cursor: default;\n  }\n  img,\n  svg,\n  video,\n  canvas,\n  audio,\n  iframe,\n  embed,\n  object {\n    vertical-align: middle;\n    display: block;\n  }\n  img,\n  video {\n    max-width: 100%;\n    height: auto;\n  }\n  h1 {\n    font-size: var(--w-font-size-xxl);\n    line-height: var(--w-line-height-xxl);\n  }\n  h2 {\n    font-size: var(--w-font-size-xl);\n    line-height: var(--w-line-height-xl);\n  }\n  h3 {\n    font-size: var(--w-font-size-l);\n    line-height: var(--w-line-height-l);\n  }\n  h4 {\n    font-size: var(--w-font-size-m);\n    line-height: var(--w-line-height-m);\n  }\n  h5 {\n    font-size: var(--w-font-size-s);\n    line-height: var(--w-line-height-s);\n  }\n  dt,\n  dd {\n    margin: 0 16px;\n  }\n  h1,\n  h2,\n  h3,\n  h4,\n  h5,\n  ul,\n  ol,\n  dl,\n  p,\n  blockquote {\n    margin: 0 0 8px;\n  }\n  [hidden] {\n    display: none !important;\n  }\n  [tabindex='-1']:focus:not(:focus-visible) {\n    outline: none;\n  }\n  legend {\n    float: left;\n    width: 100%;\n    margin: 0;\n    padding: 0;\n    display: table;\n  }\n  legend + * {\n    clear: both;\n  }\n  fieldset {\n    border: 0;\n    min-width: 0;\n    margin: 0;\n    padding: 0.01em 0 0;\n  }\n  body:not(:-moz-handler-blocked) fieldset {\n    display: table-cell;\n  }\n  svg {\n    pointer-events: none;\n  }\n`;\nexport const components = css`*, :before, :after {\n            --w-rotate: 0;\n            --w-rotate-x: 0;\n            --w-rotate-y: 0;\n            --w-rotate-z: 0;\n            --w-scale-x: 1;\n            --w-scale-y: 1;\n            --w-scale-z: 1;\n            --w-skew-x: 0;\n            --w-skew-y: 0;\n            --w-translate-x: 0;\n            --w-translate-y: 0;\n            --w-translate-z: 0\n        }\n\n            .h4, .t4 {\n                font-weight: 700;\n                font-size: var(--w-font-size-m);\n                line-height: var(--w-line-height-m)\n            }\n\n            .t3 {\n                font-weight: 700;\n                font-size: var(--w-font-size-l);\n                line-height: var(--w-line-height-l)\n            }\n\n            @media (min-width: 480px) {\n                .sm\\\\:h3 {\n                    font-weight: 700;\n                    font-size: var(--w-font-size-l);\n                    line-height: var(--w-line-height-l)\n                }\n            }\n\n            .text-center {\n                text-align: center\n            }\n\n            .before\\\\:text-center:before {\n                text-align: center\n            }\n\n            .text-left {\n                text-align: left\n            }\n\n            .text-right {\n                text-align: right\n            }\n\n            .align-middle {\n                vertical-align: middle\n            }\n\n            .animate-inprogress {\n                background-image: linear-gradient(135deg, rgba(0, 0, 0, .05) 25%, transparent 0, transparent 50%, rgba(0, 0, 0, .05) 0, rgba(0, 0, 0, .05) 75%, transparent 0, transparent) !important;\n                background-size: 30px 30px;\n                animation: animate-inprogress 3s linear infinite\n            }\n\n            @keyframes animate-inprogress {\n                0% {\n                    background-position: 0 0\n                }\n                to {\n                    background-position: 60px 0\n                }\n            }\n\n            .\\\\[--w-modal-max-height\\\\:80\\\\%\\\\] {\n                --w-modal-max-height: 80%\n            }\n\n            .\\\\[--w-modal-width\\\\:640px\\\\] {\n                --w-modal-width: 640px\n            }\n\n            .focus\\\\:\\\\[--w-outline-offset\\\\:-2px\\\\]:focus {\n                --w-outline-offset: -2px\n            }\n\n            .backdrop-blur {\n                -webkit-backdrop-filter: blur(4px);\n                backdrop-filter: blur(4px)\n            }\n\n            .peer:checked ~ .peer-checked\\\\:before\\\\:bg-center:before {\n                background-position: center\n            }\n\n            .hover\\\\:bg-clip-padding:hover {\n                -webkit-background-clip: padding-box;\n                background-clip: padding-box\n            }\n\n            .bg-transparent, .group\\\\/steph:first-child .group-first\\\\/steph\\\\:bg-transparent, .group\\\\/steph:last-child .group-last\\\\/steph\\\\:bg-transparent {\n                background-color: transparent\n            }\n\n            .bg-\\\\[--w-black\\\\/25\\\\] {\n                background-color: rgba(var(--w-rgb-black), .25)\n            }\n\n            .bg-\\\\[--w-black\\\\/70\\\\], .bg-\\\\[var\\\\(--w-black\\\\)\\\\/70\\\\] {\n                background-color: rgba(var(--w-rgb-black), .7)\n            }\n\n            .bg-\\\\[--w-color-badge-info-background\\\\] {\n                background-color: var(--w-color-badge-info-background)\n            }\n\n            .bg-\\\\[--w-color-badge-negative-background\\\\] {\n                background-color: var(--w-color-badge-negative-background)\n            }\n\n            .bg-\\\\[--w-color-badge-neutral-background\\\\] {\n                background-color: var(--w-color-badge-neutral-background)\n            }\n\n            .bg-\\\\[--w-color-badge-positive-background\\\\] {\n                background-color: var(--w-color-badge-positive-background)\n            }\n\n            .bg-\\\\[--w-color-badge-sponsored-background\\\\] {\n                background-color: var(--w-color-badge-sponsored-background)\n            }\n\n            .bg-\\\\[--w-color-badge-warning-background\\\\] {\n                background-color: var(--w-color-badge-warning-background)\n            }\n\n            .bg-\\\\[--w-color-button-primary-background\\\\] {\n                background-color: var(--w-color-button-primary-background)\n            }\n\n            .bg-\\\\[--w-color-buttongroup-utility-background-selected\\\\] {\n                background-color: var(--w-color-buttongroup-utility-background-selected)\n            }\n\n            .bg-\\\\[--w-color-callout-background\\\\] {\n                background-color: var(--w-color-callout-background)\n            }\n\n            .bg-\\\\[--w-color-pill-suggestion-background\\\\] {\n                background-color: var(--w-color-pill-suggestion-background)\n            }\n\n            .bg-\\\\[--w-color-switch-track-background\\\\] {\n                background-color: var(--w-color-switch-track-background)\n            }\n\n            .bg-\\\\[--w-s-color-surface-elevated-100\\\\] {\n                background-color: var(--w-s-color-surface-elevated-100)\n            }\n\n            .bg-\\\\[--w-s-color-surface-elevated-300\\\\] {\n                background-color: var(--w-s-color-surface-elevated-300)\n            }\n\n            .bg-\\\\[--w-s-icon-selected\\\\] {\n                background-color: var(--w-s-icon-selected)\n            }\n\n            .group:hover .group-hover\\\\:bg-\\\\[--w-color-switch-track-background-hover\\\\] {\n                background-color: var(--w-color-switch-track-background-hover)\n            }\n\n            .hover\\\\:bg-\\\\[--w-color-button-pill-background-hover\\\\]:hover {\n                background-color: var(--w-color-button-pill-background-hover)\n            }\n\n            .hover\\\\:bg-\\\\[--w-color-button-primary-background-hover\\\\]:hover {\n                background-color: var(--w-color-button-primary-background-hover)\n            }\n\n            .hover\\\\:bg-\\\\[--w-color-buttongroup-utility-background-hover\\\\]:hover {\n                background-color: var(--w-color-buttongroup-utility-background-hover)\n            }\n\n            .hover\\\\:bg-\\\\[--w-color-pill-suggestion-background-hover\\\\]:hover {\n                background-color: var(--w-color-pill-suggestion-background-hover)\n            }\n\n            .hover\\\\:bg-\\\\[--w-s-icon-subtle\\\\]:hover {\n                background-color: var(--w-s-icon-subtle)\n            }\n\n            .hover\\\\:bg-\\\\[var\\\\(--w-black\\\\)\\\\/85\\\\]:hover {\n                background-color: rgba(var(--w-rgb-black), .85)\n            }\n\n            .active\\\\:bg-\\\\[--w-color-button-pill-background-active\\\\]:active {\n                background-color: var(--w-color-button-pill-background-active)\n            }\n\n            .active\\\\:bg-\\\\[--w-color-button-primary-background-active\\\\]:active {\n                background-color: var(--w-color-button-primary-background-active)\n            }\n\n            .active\\\\:bg-\\\\[--w-color-buttongroup-utility-background-selected\\\\]:active {\n                background-color: var(--w-color-buttongroup-utility-background-selected)\n            }\n\n            .active\\\\:bg-\\\\[--w-color-pill-suggestion-background-active\\\\]:active {\n                background-color: var(--w-color-pill-suggestion-background-active)\n            }\n\n            .active\\\\:bg-\\\\[var\\\\(--w-black\\\\)\\\\]:active {\n                background-color: var(--w-black)\n            }\n\n            .peer:checked ~ .peer-checked\\\\:before\\\\:bg-\\\\[url\\\\(var\\\\(--w-icon-toggle-checked\\\\)\\\\)\\\\]:before {\n                background-image: var(--w-icon-toggle-checked)\n            }\n\n            .appearance-none {\n                -moz-appearance: none;\n                appearance: none;\n                -webkit-appearance: none\n            }\n\n            .will-change-height {\n                will-change: height\n            }\n\n            .border, .border-1 {\n                border-width: 1px\n            }\n\n            .border-b {\n                border-bottom-width: 1px\n            }\n\n            .before\\\\:border:before {\n                border-width: 1px\n            }\n\n            .border-0 {\n                border-width: 0\n            }\n\n            .border-2 {\n                border-width: 2px\n            }\n\n            .border-b-0 {\n                border-bottom-width: 0\n            }\n\n            .border-b-4 {\n                border-bottom-width: 4px\n            }\n\n            .border-l-4 {\n                border-left-width: 4px\n            }\n\n            .border-r-0, .group:not(:last-of-type) .group-not-last-of-type\\\\:border-r-0 {\n                border-right-width: 0\n            }\n\n            .peer:checked ~ .peer-checked\\\\:before\\\\:border-\\\\[6\\\\]:before {\n                border-width: .6rem\n            }\n\n            .border-transparent {\n                border-color: transparent\n            }\n\n            .border-\\\\[--w-color-buttongroup-utility-border\\\\] {\n                border-color: var(--w-color-buttongroup-utility-border)\n            }\n\n            .border-\\\\[--w-color-callout-border\\\\] {\n                border-color: var(--w-color-callout-border)\n            }\n\n            .border-\\\\[--w-s-color-background-inverted\\\\] {\n                border-color: var(--w-s-color-background-inverted)\n            }\n\n            .border-\\\\[--w-s-color-surface-elevated-300\\\\] {\n                border-color: var(--w-s-color-surface-elevated-300)\n            }\n\n            .active\\\\:border-\\\\[--w-color-buttongroup-utility-border-selected\\\\]:active {\n                border-color: var(--w-color-buttongroup-utility-border-selected)\n            }\n\n            .divide-x > * + * {\n                --w-divide-x-reverse: 0;\n                border-left-width: calc(1px * calc(1 - var(--w-divide-x-reverse)));\n                border-right-width: calc(1px * var(--w-divide-x-reverse))\n            }\n\n            .divide-y > * + * {\n                --w-divide-y-reverse: 0;\n                border-top-width: calc(1px * calc(1 - var(--w-divide-y-reverse)));\n                border-bottom-width: calc(1px * var(--w-divide-y-reverse))\n            }\n\n            .rounded-4 {\n                border-radius: 4px\n            }\n\n            .rounded-8 {\n                border-radius: 8px\n            }\n\n            .rounded-full {\n                border-radius: 9999px\n            }\n\n            .before\\\\:rounded-2:before {\n                border-radius: 2px\n            }\n\n            .before\\\\:rounded-full:before {\n                border-radius: 9999px\n            }\n\n            .rounded-b-0 {\n                border-bottom-left-radius: 0;\n                border-bottom-right-radius: 0\n            }\n\n            .rounded-bl-0 {\n                border-bottom-left-radius: 0\n            }\n\n            .rounded-br-0 {\n                border-bottom-right-radius: 0\n            }\n\n            .rounded-l-0 {\n                border-top-left-radius: 0;\n                border-bottom-left-radius: 0\n            }\n\n            .rounded-l-full {\n                border-top-left-radius: 9999px;\n                border-bottom-left-radius: 9999px\n            }\n\n            .rounded-r-0 {\n                border-top-right-radius: 0;\n                border-bottom-right-radius: 0\n            }\n\n            .rounded-r-full {\n                border-top-right-radius: 9999px;\n                border-bottom-right-radius: 9999px\n            }\n\n            .rounded-tl-0 {\n                border-top-left-radius: 0\n            }\n\n            .rounded-tl-4 {\n                border-top-left-radius: 4px\n            }\n\n            .rounded-tr-0 {\n                border-top-right-radius: 0\n            }\n\n            .group:first-of-type .group-first-of-type\\\\:rounded-bl-8 {\n                border-bottom-left-radius: 8px\n            }\n\n            .group:first-of-type .group-first-of-type\\\\:rounded-tl-8 {\n                border-top-left-radius: 8px\n            }\n\n            .first\\\\:rounded-lb-4:first-child {\n                border-bottom-left-radius: 4px\n            }\n\n            .first\\\\:rounded-lt-4:first-child {\n                border-top-left-radius: 4px\n            }\n\n            .first\\\\:rounded-rt-4:first-child {\n                border-top-right-radius: 4px\n            }\n\n            .group:last-of-type .group-last-of-type\\\\:rounded-br-8 {\n                border-bottom-right-radius: 8px\n            }\n\n            .group:last-of-type .group-last-of-type\\\\:rounded-tr-8 {\n                border-top-right-radius: 8px\n            }\n\n            .last\\\\:rounded-lb-4:last-child {\n                border-bottom-left-radius: 4px\n            }\n\n            .last\\\\:rounded-rb-4:last-child {\n                border-bottom-right-radius: 4px\n            }\n\n            .last\\\\:rounded-rt-4:last-child {\n                border-top-right-radius: 4px\n            }\n\n            .caret-current {\n                caret-color: currentColor\n            }\n\n            .opacity-25 {\n                opacity: 25%\n            }\n\n            .block {\n                display: block\n            }\n\n            .before\\\\:block:before {\n                display: block\n            }\n\n            .inline-block {\n                display: inline-block\n            }\n\n            .inline {\n                display: inline\n            }\n\n            .flex, .open\\\\:flex[open] {\n                display: flex\n            }\n\n            .inline-flex {\n                display: inline-flex\n            }\n\n            .grid {\n                display: grid\n            }\n\n            .inline-grid {\n                display: inline-grid\n            }\n\n            .hidden, .group\\\\/stepv:last-child .group-last\\\\/stepv\\\\:hidden {\n                display: none\n            }\n\n            .before\\\\:hidden:before {\n                display: none\n            }\n\n            .hover\\\\:underline:hover {\n                text-decoration-line: underline\n            }\n\n            .focus\\\\:underline:focus {\n                text-decoration-line: underline\n            }\n\n            .focus-visible\\\\:underline:focus-visible {\n                text-decoration-line: underline\n            }\n\n            .active\\\\:underline:active {\n                text-decoration-line: underline\n            }\n\n            .hover\\\\:no-underline:hover {\n                text-decoration: none\n            }\n\n            .focus\\\\:no-underline:focus {\n                text-decoration: none\n            }\n\n            .active\\\\:no-underline:active {\n                text-decoration: none\n            }\n\n            .flex-1 {\n                flex: 1 1 0%\n            }\n\n            .shrink {\n                flex-shrink: 1\n            }\n\n            .shrink-0 {\n                flex-shrink: 0\n            }\n\n            .shrink-0\\\\! {\n                flex-shrink: 0 !important\n            }\n\n            .grow, .grow-1 {\n                flex-grow: 1\n            }\n\n            .basis-auto {\n                flex-basis: auto\n            }\n\n            .flex-col {\n                flex-direction: column\n            }\n\n            .focus-within\\\\:focusable:focus-within {\n                outline: 2px solid var(--w-s-color-border-focus);\n                outline-offset: var(--w-outline-offset, 1px)\n            }\n\n            .focusable:focus, .focusable:focus-visible {\n                outline: 2px solid var(--w-s-color-border-focus);\n                outline-offset: var(--w-outline-offset, 1px)\n            }\n\n            .focusable:not(:focus-visible) {\n                outline: none\n            }\n\n            .peer:focus ~ .peer-focus\\\\:focusable, .peer:focus-visible ~ .peer-focus\\\\:focusable {\n                outline: 2px solid var(--w-s-color-border-focus);\n                outline-offset: var(--w-outline-offset, 1px)\n            }\n\n            .peer:not(:focus-visible) ~ .peer-focus\\\\:focusable {\n                outline: none\n            }\n\n            .focusable-inset {\n                --w-outline-offset: -3px\n            }\n\n            .gap-12 {\n                gap: 1.2rem\n            }\n\n            .gap-8 {\n                gap: .8rem\n            }\n\n            .gap-x-16 {\n                column-gap: 1.6rem\n            }\n\n            .gap-y-16 {\n                row-gap: 1.6rem\n            }\n\n            .row-span-2 {\n                grid-row: span 2/span 2\n            }\n\n            .col-span-2 {\n                grid-column: span 2/span 2\n            }\n\n            .col-span-3 {\n                grid-column: span 3/span 3\n            }\n\n            .row-start-1 {\n                grid-row-start: 1\n            }\n\n            .row-start-2 {\n                grid-row-start: 2\n            }\n\n            .col-start-2 {\n                grid-column-start: 2\n            }\n\n            .auto-rows-auto {\n                grid-auto-rows: auto\n            }\n\n            .grid-flow-col {\n                grid-auto-flow: column\n            }\n\n            .grid-rows-\\\\[20px_auto\\\\] {\n                grid-template-rows:20px auto\n            }\n\n            .grid-rows-\\\\[auto_20px\\\\] {\n                grid-template-rows:auto 20px\n            }\n\n            .grid-cols-\\\\[1fr_20px_1fr\\\\] {\n                grid-template-columns:1fr 20px 1fr\n            }\n\n            .grid-cols-\\\\[1fr_20px\\\\] {\n                grid-template-columns:1fr 20px\n            }\n\n            .grid-cols-\\\\[20px_1fr\\\\] {\n                grid-template-columns:20px 1fr\n            }\n\n            .grid-cols-\\\\[auto_1fr_auto\\\\] {\n                grid-template-columns:auto 1fr auto\n            }\n\n            .grid-cols-1 {\n                grid-template-columns:repeat(1, minmax(0, 1fr))\n            }\n\n            .grid-cols-2 {\n                grid-template-columns:repeat(2, minmax(0, 1fr))\n            }\n\n            .grid-cols-3 {\n                grid-template-columns:repeat(3, minmax(0, 1fr))\n            }\n\n            .grid-cols-4 {\n                grid-template-columns:repeat(4, minmax(0, 1fr))\n            }\n\n            .grid-cols-5 {\n                grid-template-columns:repeat(5, minmax(0, 1fr))\n            }\n\n            .grid-cols-6 {\n                grid-template-columns:repeat(6, minmax(0, 1fr))\n            }\n\n            .grid-cols-7 {\n                grid-template-columns:repeat(7, minmax(0, 1fr))\n            }\n\n            .grid-cols-8 {\n                grid-template-columns:repeat(8, minmax(0, 1fr))\n            }\n\n            .grid-cols-9 {\n                grid-template-columns:repeat(9, minmax(0, 1fr))\n            }\n\n            .overflow-hidden {\n                overflow: hidden\n            }\n\n            .overflow-x-hidden {\n                overflow-x: hidden\n            }\n\n            .overflow-y-auto {\n                overflow-y: auto\n            }\n\n            .list-none {\n                list-style-type: none\n            }\n\n            .outline-\\\\[--w-s-color-border-negative\\\\]\\\\! {\n                outline-color: var(--w-s-color-border-negative) !important\n            }\n\n            .outline-none {\n                outline: 2px solid transparent;\n                outline-offset: 2px\n            }\n\n            .focus\\\\:outline-none:focus {\n                outline: 2px solid transparent;\n                outline-offset: 2px\n            }\n\n            .items-start {\n                align-items: flex-start\n            }\n\n            .items-end {\n                align-items: flex-end\n            }\n\n            .items-center {\n                align-items: center\n            }\n\n            .self-center {\n                align-self: center\n            }\n\n            .inset-0 {\n                top: 0rem;\n                right: 0rem;\n                bottom: 0rem;\n                left: 0rem\n            }\n\n            .-bottom-0 {\n                bottom: -0rem\n            }\n\n            .bottom-0 {\n                bottom: 0rem\n            }\n\n            .bottom-10 {\n                bottom: 1rem\n            }\n\n            .bottom-16 {\n                bottom: 1.6rem\n            }\n\n            .left-0 {\n                left: 0rem\n            }\n\n            .left-4 {\n                left: .4rem\n            }\n\n            .right-0 {\n                right: 0rem\n            }\n\n            .right-8 {\n                right: .8rem\n            }\n\n            .top-\\\\[1\\\\.92rem\\\\] {\n                top: 1.92rem\n            }\n\n            .top-0 {\n                top: 0rem\n            }\n\n            .top-20 {\n                top: 2rem\n            }\n\n            .top-4 {\n                top: .4rem\n            }\n\n            .top-8 {\n                top: .8rem\n            }\n\n            .before\\\\:bottom-0:before {\n                bottom: 0rem\n            }\n\n            .before\\\\:left-0:before {\n                left: 0rem\n            }\n\n            .before\\\\:right-0:before {\n                right: 0rem\n            }\n\n            .before\\\\:top-2:before {\n                top: .2rem\n            }\n\n            .-bottom-\\\\[8px\\\\] {\n                bottom: -8px\n            }\n\n            .-left-\\\\[8px\\\\] {\n                left: -8px\n            }\n\n            .-right-\\\\[8px\\\\] {\n                right: -8px\n            }\n\n            .-top-\\\\[8px\\\\] {\n                top: -8px\n            }\n\n            .top-\\\\[19px\\\\] {\n                top: 19px\n            }\n\n            .top-\\\\[30\\\\%\\\\] {\n                top: 30%\n            }\n\n            .justify-end {\n                justify-content: flex-end\n            }\n\n            .justify-center {\n                justify-content: center\n            }\n\n            .justify-between {\n                justify-content: space-between\n            }\n\n            .justify-items-center {\n                justify-items: center\n            }\n\n            .justify-self-start {\n                justify-self: start\n            }\n\n            .justify-self-end {\n                justify-self: end\n            }\n\n            .justify-self-center {\n                justify-self: center\n            }\n\n            .absolute {\n                position: absolute\n            }\n\n            .fixed {\n                position: fixed\n            }\n\n            .relative {\n                position: relative\n            }\n\n            .open\\\\:fixed[open] {\n                position: fixed\n            }\n\n            .before\\\\:absolute:before {\n                position: absolute\n            }\n\n            .z-10, .peer:checked ~ .peer-checked\\\\:z-10 {\n                z-index: 10\n            }\n\n            .z-30 {\n                z-index: 30\n            }\n\n            .z-50 {\n                z-index: 50\n            }\n\n            .hover\\\\:z-30:hover {\n                z-index: 30\n            }\n\n            .\\\\!s-bg-selected {\n                background-color: var(--w-s-color-background-selected) !important\n            }\n\n            .s-bg {\n                background-color: var(--w-s-color-background)\n            }\n\n            .s-bg-disabled {\n                background-color: var(--w-s-color-background-disabled)\n            }\n\n            .s-bg-disabled-subtle {\n                background-color: var(--w-s-color-background-disabled-subtle)\n            }\n\n            .s-bg-info-subtle {\n                background-color: var(--w-s-color-background-info-subtle)\n            }\n\n            .s-bg-inverted {\n                background-color: var(--w-s-color-background-inverted)\n            }\n\n            .s-bg-negative {\n                background-color: var(--w-s-color-background-negative)\n            }\n\n            .s-bg-negative-subtle {\n                background-color: var(--w-s-color-background-negative-subtle)\n            }\n\n            .s-bg-positive-subtle {\n                background-color: var(--w-s-color-background-positive-subtle)\n            }\n\n            .s-bg-primary, .peer:checked ~ .peer-checked\\\\:s-bg-primary {\n                background-color: var(--w-s-color-background-primary)\n            }\n\n            .s-bg-selected {\n                background-color: var(--w-s-color-background-selected)\n            }\n\n            .s-bg-subtle {\n                background-color: var(--w-s-color-background-subtle)\n            }\n\n            .s-bg-warning-subtle {\n                background-color: var(--w-s-color-background-warning-subtle)\n            }\n\n            .peer:checked:hover ~ .peer-checked\\\\:peer-hover\\\\:before\\\\:s-bg-negative-hover:before {\n                background-color: var(--w-s-color-background-negative-hover)\n            }\n\n            .peer:checked:hover ~ .peer-checked\\\\:peer-hover\\\\:before\\\\:s-bg-primary-hover:before {\n                background-color: var(--w-s-color-background-primary-hover)\n            }\n\n            .peer:checked ~ .peer-checked\\\\:before\\\\:s-bg-disabled:before {\n                background-color: var(--w-s-color-background-disabled)\n            }\n\n            .peer:checked ~ .peer-checked\\\\:before\\\\:s-bg-negative:before {\n                background-color: var(--w-s-color-background-negative)\n            }\n\n            .peer:checked ~ .peer-checked\\\\:before\\\\:s-bg-primary:before {\n                background-color: var(--w-s-color-background-primary)\n            }\n\n            .peer:indeterminate ~ .peer-indeterminate\\\\:before\\\\:s-bg-disabled:before {\n                background-color: var(--w-s-color-background-disabled)\n            }\n\n            .peer:indeterminate ~ .peer-indeterminate\\\\:before\\\\:s-bg-negative:before {\n                background-color: var(--w-s-color-background-negative)\n            }\n\n            .peer:indeterminate ~ .peer-indeterminate\\\\:before\\\\:s-bg-primary:before {\n                background-color: var(--w-s-color-background-primary)\n            }\n\n            .peer:indeterminate ~ .peer-indeterminate\\\\:hover\\\\:before\\\\:s-bg-negative-hover:hover:before {\n                background-color: var(--w-s-color-background-negative-hover)\n            }\n\n            .peer:indeterminate ~ .peer-indeterminate\\\\:hover\\\\:before\\\\:s-bg-primary-hover:hover:before {\n                background-color: var(--w-s-color-background-primary-hover)\n            }\n\n            .\\\\!hover\\\\:s-bg-selected-hover:hover {\n                background-color: var(--w-s-color-background-selected-hover) !important\n            }\n\n            .group:hover .group-hover\\\\:s-bg-primary-hover {\n                background-color: var(--w-s-color-background-primary-hover)\n            }\n\n            .hover\\\\:before\\\\:s-bg-hover:hover:before {\n                background-color: var(--w-s-color-background-hover)\n            }\n\n            .hover\\\\:before\\\\:s-bg-negative-subtle-hover:hover:before {\n                background-color: var(--w-s-color-background-negative-subtle-hover)\n            }\n\n            .hover\\\\:s-bg-hover:hover {\n                background-color: var(--w-s-color-background-hover)\n            }\n\n            .hover\\\\:s-bg-negative-hover:hover {\n                background-color: var(--w-s-color-background-negative-hover)\n            }\n\n            .hover\\\\:s-bg-negative-subtle-hover:hover {\n                background-color: var(--w-s-color-background-negative-subtle-hover)\n            }\n\n            .hover\\\\:s-bg-primary-hover:hover {\n                background-color: var(--w-s-color-background-primary-hover)\n            }\n\n            .hover\\\\:s-bg-selected-hover:hover {\n                background-color: var(--w-s-color-background-selected-hover)\n            }\n\n            .peer:hover:not(:checked) ~ .peer-hover\\\\:peer-not-checked\\\\:s-bg-hover {\n                background-color: var(--w-s-color-background-hover)\n            }\n\n            .peer:hover ~ .peer-hover\\\\:before\\\\:s-bg-hover:before {\n                background-color: var(--w-s-color-background-hover)\n            }\n\n            .peer:hover ~ .peer-hover\\\\:before\\\\:s-bg-negative-subtle:before {\n                background-color: var(--w-s-color-background-negative-subtle)\n            }\n\n            .focus\\\\:s-bg-primary-hover:focus {\n                background-color: var(--w-s-color-background-primary-hover)\n            }\n\n            .\\\\!active\\\\:s-bg-selected-active:active {\n                background-color: var(--w-s-color-background-selected-active) !important\n            }\n\n            .active\\\\:s-bg-active:active {\n                background-color: var(--w-s-color-background-active)\n            }\n\n            .active\\\\:s-bg-negative-active:active {\n                background-color: var(--w-s-color-background-negative-active)\n            }\n\n            .active\\\\:s-bg-negative-subtle-active:active {\n                background-color: var(--w-s-color-background-negative-subtle-active)\n            }\n\n            .active\\\\:s-bg-primary-active:active {\n                background-color: var(--w-s-color-background-primary-active)\n            }\n\n            .active\\\\:s-bg-selected-active:active {\n                background-color: var(--w-s-color-background-selected-active)\n            }\n\n            .before\\\\:s-bg-disabled-subtle:before {\n                background-color: var(--w-s-color-background-disabled-subtle)\n            }\n\n            .before\\\\:s-bg:before {\n                background-color: var(--w-s-color-background)\n            }\n\n            .s-text {\n                color: var(--w-s-color-text)\n            }\n\n            .s-text-disabled {\n                color: var(--w-s-color-text-disabled)\n            }\n\n            .s-text-inverted, .peer:checked ~ .peer-checked\\\\:s-text-inverted {\n                color: var(--w-s-color-text-inverted)\n            }\n\n            .s-text-inverted-static {\n                color: var(--w-s-color-text-inverted-static)\n            }\n\n            .s-text-link {\n                color: var(--w-s-color-text-link)\n            }\n\n            .s-text-negative {\n                color: var(--w-s-color-text-negative)\n            }\n\n            .s-text-subtle {\n                color: var(--w-s-color-text-subtle)\n            }\n\n            .hover\\\\:s-text-link:hover {\n                color: var(--w-s-color-text-link)\n            }\n\n            .active\\\\:s-text:active {\n                color: var(--w-s-color-text)\n            }\n\n            .placeholder\\\\:s-text-placeholder::placeholder {\n                color: var(--w-s-color-text-placeholder)\n            }\n\n            .s-icon {\n                color: var(--w-s-color-icon)\n            }\n\n            .s-icon-info {\n                color: var(--w-s-color-icon-info)\n            }\n\n            .s-icon-inverted {\n                color: var(--w-s-color-icon-inverted)\n            }\n\n            .s-icon-negative {\n                color: var(--w-s-color-icon-negative)\n            }\n\n            .s-icon-positive {\n                color: var(--w-s-color-icon-positive)\n            }\n\n            .s-icon-warning {\n                color: var(--w-s-color-icon-warning)\n            }\n\n            .hover\\\\:s-icon-hover:hover {\n                color: var(--w-s-color-icon-hover)\n            }\n\n            .active\\\\:s-icon-active:active {\n                color: var(--w-s-color-icon-active)\n            }\n\n            .before\\\\:s-icon-inverted:before {\n                color: var(--w-s-color-icon-inverted)\n            }\n\n            .s-border {\n                border-color: var(--w-s-color-border)\n            }\n\n            .s-border-disabled {\n                border-color: var(--w-s-color-border-disabled)\n            }\n\n            .s-border-info-subtle {\n                border-color: var(--w-s-color-border-info-subtle)\n            }\n\n            .s-border-l-info {\n                border-left-color: var(--w-s-color-border-info)\n            }\n\n            .s-border-l-negative {\n                border-left-color: var(--w-s-color-border-negative)\n            }\n\n            .s-border-l-positive {\n                border-left-color: var(--w-s-color-border-positive)\n            }\n\n            .s-border-l-warning {\n                border-left-color: var(--w-s-color-border-warning)\n            }\n\n            .s-border-negative {\n                border-color: var(--w-s-color-border-negative)\n            }\n\n            .s-border-negative-subtle {\n                border-color: var(--w-s-color-border-negative-subtle)\n            }\n\n            .s-border-positive-subtle {\n                border-color: var(--w-s-color-border-positive-subtle)\n            }\n\n            .s-border-primary, .peer:checked ~ .peer-checked\\\\:s-border-primary {\n                border-color: var(--w-s-color-border-primary)\n            }\n\n            .s-border-selected {\n                border-color: var(--w-s-color-border-selected)\n            }\n\n            .s-border-warning-subtle {\n                border-color: var(--w-s-color-border-warning-subtle)\n            }\n\n            .peer:checked:hover ~ .peer-checked\\\\:peer-hover\\\\:before\\\\:s-border-negative-hover:before {\n                border-color: var(--w-s-color-border-negative-hover)\n            }\n\n            .peer:checked:hover ~ .peer-checked\\\\:peer-hover\\\\:before\\\\:s-border-primary-hover:before {\n                border-color: var(--w-s-color-border-primary-hover)\n            }\n\n            .peer:checked:hover ~ .peer-checked\\\\:peer-hover\\\\:before\\\\:s-border-selected-hover:before {\n                border-color: var(--w-s-color-border-selected-hover)\n            }\n\n            .peer:checked ~ .peer-checked\\\\:before\\\\:s-border-disabled:before {\n                border-color: var(--w-s-color-border-disabled)\n            }\n\n            .peer:checked ~ .peer-checked\\\\:before\\\\:s-border-negative:before {\n                border-color: var(--w-s-color-border-negative)\n            }\n\n            .peer:checked ~ .peer-checked\\\\:before\\\\:s-border-primary:before {\n                border-color: var(--w-s-color-border-primary)\n            }\n\n            .peer:checked ~ .peer-checked\\\\:before\\\\:s-border-selected:before {\n                border-color: var(--w-s-color-border-selected)\n            }\n\n            .peer:indeterminate ~ .peer-indeterminate\\\\:before\\\\:s-border-disabled:before {\n                border-color: var(--w-s-color-border-disabled)\n            }\n\n            .peer:indeterminate ~ .peer-indeterminate\\\\:before\\\\:s-border-negative:before {\n                border-color: var(--w-s-color-border-negative)\n            }\n\n            .peer:indeterminate ~ .peer-indeterminate\\\\:before\\\\:s-border-primary:before {\n                border-color: var(--w-s-color-border-primary)\n            }\n\n            .peer:indeterminate ~ .peer-indeterminate\\\\:hover\\\\:before\\\\:s-border-negative-hover:hover:before {\n                border-color: var(--w-s-color-border-negative-hover)\n            }\n\n            .peer:indeterminate ~ .peer-indeterminate\\\\:hover\\\\:before\\\\:s-border-primary-hover:hover:before {\n                border-color: var(--w-s-color-border-primary-hover)\n            }\n\n            .group:hover .group-hover\\\\:s-border-selected-hover {\n                border-color: var(--w-s-color-border-selected-hover)\n            }\n\n            .hover\\\\:before\\\\:s-border-negative-hover:hover:before {\n                border-color: var(--w-s-color-border-negative-hover)\n            }\n\n            .hover\\\\:before\\\\:s-border-primary:hover:before {\n                border-color: var(--w-s-color-border-primary)\n            }\n\n            .hover\\\\:s-border-disabled:hover {\n                border-color: var(--w-s-color-border-disabled)\n            }\n\n            .hover\\\\:s-border-hover:hover {\n                border-color: var(--w-s-color-border-hover)\n            }\n\n            .hover\\\\:s-border-negative-hover:hover {\n                border-color: var(--w-s-color-border-negative-hover)\n            }\n\n            .hover\\\\:s-border-primary-hover:hover {\n                border-color: var(--w-s-color-border-primary-hover)\n            }\n\n            .hover\\\\:s-border-primary:hover {\n                border-color: var(--w-s-color-border-primary)\n            }\n\n            .hover\\\\:s-border-selected-hover:hover {\n                border-color: var(--w-s-color-border-selected-hover)\n            }\n\n            .peer:hover ~ .peer-hover\\\\:before\\\\:s-border-negative-hover:before {\n                border-color: var(--w-s-color-border-negative-hover)\n            }\n\n            .peer:hover ~ .peer-hover\\\\:before\\\\:s-border-primary:before {\n                border-color: var(--w-s-color-border-primary)\n            }\n\n            .focus\\\\:s-border-primary-hover:focus {\n                border-color: var(--w-s-color-border-primary-hover)\n            }\n\n            .active\\\\:s-border-active:active {\n                border-color: var(--w-s-color-border-active)\n            }\n\n            .active\\\\:s-border-disabled:active {\n                border-color: var(--w-s-color-border-disabled)\n            }\n\n            .active\\\\:s-border-primary-active:active {\n                border-color: var(--w-s-color-border-primary-active)\n            }\n\n            .active\\\\:s-border-selected-active:active {\n                border-color: var(--w-s-color-border-selected-active)\n            }\n\n            .active\\\\:s-border-selected:active {\n                border-color: var(--w-s-color-border-selected)\n            }\n\n            .group:active .group-active\\\\:s-border-active {\n                border-color: var(--w-s-color-border-active)\n            }\n\n            .group:active .group-active\\\\:s-border-selected-active {\n                border-color: var(--w-s-color-border-selected-active)\n            }\n\n            .before\\\\:s-border-disabled:before {\n                border-color: var(--w-s-color-border-disabled)\n            }\n\n            .before\\\\:s-border-negative:before {\n                border-color: var(--w-s-color-border-negative)\n            }\n\n            .s-surface-sunken {\n                background-color: var(--w-s-color-surface-sunken)\n            }\n\n            .s-surface-elevated-200 {\n                background-color: var(--w-s-color-surface-elevated-200);\n                box-shadow: var(--w-s-shadow-surface-elevated-200)\n            }\n\n            .hover\\\\:s-surface-elevated-200-hover:hover {\n                background-color: var(--w-s-color-surface-elevated-200-hover);\n                box-shadow: var(--w-s-shadow-surface-elevated-200-hover)\n            }\n\n            .active\\\\:s-surface-elevated-200-active:active {\n                background-color: var(--w-s-color-surface-elevated-200-active);\n                box-shadow: var(--w-s-shadow-surface-elevated-200-active)\n            }\n\n            .drop-shadow-m {\n                filter: drop-shadow(rgba(64, 64, 64, .24) 0 3px 8px) drop-shadow(rgba(64, 64, 64, .16) 0 3px 6px)\n            }\n\n            .shadow-m {\n                box-shadow: var(--w-shadow-m)\n            }\n\n            .shadow-s {\n                box-shadow: var(--w-shadow-s)\n            }\n\n            .shadow-\\\\[--w-shadow-slider\\\\] {\n                box-shadow: var(--w-shadow-slider)\n            }\n\n            .hover\\\\:shadow-\\\\[--w-shadow-slider-handle-hover\\\\]:hover {\n                box-shadow: var(--w-shadow-slider-handle-hover)\n            }\n\n            .focus\\\\:shadow-\\\\[--w-shadow-slider-handle-hover\\\\]:focus {\n                box-shadow: var(--w-shadow-slider-handle-hover)\n            }\n\n            .active\\\\:shadow-\\\\[--w-shadow-slider-handle-active\\\\]:active {\n                box-shadow: var(--w-shadow-slider-handle-active)\n            }\n\n            .h-0 {\n                height: 0rem\n            }\n\n            .h-16 {\n                height: 1.6rem\n            }\n\n            .h-2 {\n                height: .2rem\n            }\n\n            .h-20 {\n                height: 2rem\n            }\n\n            .h-24 {\n                height: 2.4rem\n            }\n\n            .h-4 {\n                height: .4rem\n            }\n\n            .h-44 {\n                height: 4.4rem\n            }\n\n            .h-6 {\n                height: .6rem\n            }\n\n            .h-8 {\n                height: .8rem\n            }\n\n            .h-full {\n                height: 100%\n            }\n\n            .h-unset {\n                height: unset\n            }\n\n            .max-h-unset {\n                max-height: unset\n            }\n\n            .max-w-full {\n                max-width: 100%\n            }\n\n            .max-w-max {\n                max-width: max-content\n            }\n\n            .max-w-unset {\n                max-width: unset\n            }\n\n            .min-h-32 {\n                min-height: 3.2rem\n            }\n\n            .min-h-40 {\n                min-height: 4rem\n            }\n\n            .min-w-16 {\n                min-width: 1.6rem\n            }\n\n            .min-w-32 {\n                min-width: 3.2rem\n            }\n\n            .w-16 {\n                width: 1.6rem\n            }\n\n            .w-2 {\n                width: .2rem\n            }\n\n            .w-20 {\n                width: 2rem\n            }\n\n            .w-24 {\n                width: 2.4rem\n            }\n\n            .w-32 {\n                width: 3.2rem\n            }\n\n            .w-40 {\n                width: 4rem\n            }\n\n            .w-44 {\n                width: 4.4rem\n            }\n\n            .w-8 {\n                width: .8rem\n            }\n\n            .w-full {\n                width: 100%\n            }\n\n            .w-max {\n                width: max-content\n            }\n\n            .w-unset {\n                width: unset\n            }\n\n            .before\\\\:h-20:before {\n                height: 2rem\n            }\n\n            .before\\\\:h-full:before {\n                height: 100%\n            }\n\n            .before\\\\:w-20:before {\n                width: 2rem\n            }\n\n            .before\\\\:w-32:before {\n                width: 3.2rem\n            }\n\n            .h-\\\\[--w-modal-height\\\\] {\n                height: var(--w-modal-height)\n            }\n\n            .h-\\\\[14px\\\\] {\n                height: 14px\n            }\n\n            .h-\\\\[16px\\\\] {\n                height: 16px\n            }\n\n            .max-h-\\\\[--w-modal-max-height\\\\] {\n                max-height: var(--w-modal-max-height)\n            }\n\n            .min-h-\\\\[--w-modal-min-height\\\\] {\n                min-height: var(--w-modal-min-height)\n            }\n\n            .min-h-\\\\[32px\\\\] {\n                min-height: 32px\n            }\n\n            .min-h-\\\\[40px\\\\] {\n                min-height: 40px\n            }\n\n            .min-h-\\\\[42\\\\] {\n                min-height: 4.2rem\n            }\n\n            .min-h-\\\\[44px\\\\] {\n                min-height: 44px\n            }\n\n            .min-w-\\\\[32px\\\\] {\n                min-width: 32px\n            }\n\n            .min-w-\\\\[40px\\\\] {\n                min-width: 40px\n            }\n\n            .min-w-\\\\[44px\\\\] {\n                min-width: 44px\n            }\n\n            .w-\\\\[--w-modal-width\\\\] {\n                width: var(--w-modal-width)\n            }\n\n            .w-\\\\[14px\\\\] {\n                width: 14px\n            }\n\n            .w-\\\\[16px\\\\] {\n                width: 16px\n            }\n\n            .space-x-8 > :not([hidden]) ~ :not([hidden]) {\n                --w-space-x-reverse: 0;\n                margin-left: calc(.8rem * calc(1 - var(--w-space-x-reverse)));\n                margin-right: calc(.8rem * var(--w-space-x-reverse))\n            }\n\n            .space-y-16 > :not([hidden]) ~ :not([hidden]) {\n                --w-space-y-reverse: 0;\n                margin-top: calc(1.6rem * calc(1 - var(--w-space-y-reverse)));\n                margin-bottom: calc(1.6rem * var(--w-space-y-reverse))\n            }\n\n            .m-0 {\n                margin: 0rem\n            }\n\n            .m-auto {\n                margin: auto\n            }\n\n            .-mx-16 {\n                margin-left: -1.6rem;\n                margin-right: -1.6rem\n            }\n\n            .mx-0 {\n                margin-left: 0rem;\n                margin-right: 0rem\n            }\n\n            .mx-8 {\n                margin-left: .8rem;\n                margin-right: .8rem\n            }\n\n            .mx-auto {\n                margin-left: auto;\n                margin-right: auto\n            }\n\n            .-mb-1 {\n                margin-bottom: -.1rem\n            }\n\n            .-ml-8 {\n                margin-left: -.8rem\n            }\n\n            .-mr-1 {\n                margin-right: -.1rem\n            }\n\n            .-mr-8 {\n                margin-right: -.8rem\n            }\n\n            .-mt-2 {\n                margin-top: -.2rem\n            }\n\n            .-mt-4 {\n                margin-top: -.4rem\n            }\n\n            .last-child\\\\:mb-0 > :last-child, .mb-0 {\n                margin-bottom: 0rem\n            }\n\n            .mb-32 {\n                margin-bottom: 3.2rem\n            }\n\n            .ml-8 {\n                margin-left: .8rem\n            }\n\n            .ml-auto {\n                margin-left: auto\n            }\n\n            .mr-8 {\n                margin-right: .8rem\n            }\n\n            .mt-16 {\n                margin-top: 1.6rem\n            }\n\n            .mt-4 {\n                margin-top: .4rem\n            }\n\n            .group:not(:first-child) .group-not-first\\\\:-ml-2 {\n                margin-left: -.2rem\n            }\n\n            .last\\\\:mb-0:last-child {\n                margin-bottom: 0rem\n            }\n\n            .last\\\\:mr-0:last-child {\n                margin-right: 0rem\n            }\n\n            .m-\\\\[8px\\\\] {\n                margin: 8px\n            }\n\n            .p-0 {\n                padding: 0rem\n            }\n\n            .p-16 {\n                padding: 1.6rem\n            }\n\n            .p-4 {\n                padding: .4rem\n            }\n\n            .p-8 {\n                padding: .8rem\n            }\n\n            .px-0 {\n                padding-left: 0rem;\n                padding-right: 0rem\n            }\n\n            .px-1 {\n                padding-left: .1rem;\n                padding-right: .1rem\n            }\n\n            .px-12 {\n                padding-left: 1.2rem;\n                padding-right: 1.2rem\n            }\n\n            .px-14 {\n                padding-left: 1.4rem;\n                padding-right: 1.4rem\n            }\n\n            .px-16 {\n                padding-left: 1.6rem;\n                padding-right: 1.6rem\n            }\n\n            .px-8 {\n                padding-left: .8rem;\n                padding-right: .8rem\n            }\n\n            .py-0 {\n                padding-top: 0rem;\n                padding-bottom: 0rem\n            }\n\n            .py-1 {\n                padding-top: .1rem;\n                padding-bottom: .1rem\n            }\n\n            .py-10 {\n                padding-top: 1rem;\n                padding-bottom: 1rem\n            }\n\n            .py-12 {\n                padding-top: 1.2rem;\n                padding-bottom: 1.2rem\n            }\n\n            .py-2 {\n                padding-top: .2rem;\n                padding-bottom: .2rem\n            }\n\n            .py-4 {\n                padding-top: .4rem;\n                padding-bottom: .4rem\n            }\n\n            .py-6 {\n                padding-top: .6rem;\n                padding-bottom: .6rem\n            }\n\n            .py-8 {\n                padding-top: .8rem;\n                padding-bottom: .8rem\n            }\n\n            .pb-0 {\n                padding-bottom: 0rem\n            }\n\n            .pb-32 {\n                padding-bottom: 3.2rem\n            }\n\n            .pb-4 {\n                padding-bottom: .4rem\n            }\n\n            .pb-8 {\n                padding-bottom: .8rem\n            }\n\n            .pl-0 {\n                padding-left: 0rem\n            }\n\n            .pl-1 {\n                padding-left: .1rem\n            }\n\n            .pl-12 {\n                padding-left: 1.2rem\n            }\n\n            .pl-28 {\n                padding-left: 2.8rem\n            }\n\n            .pl-4 {\n                padding-left: .4rem\n            }\n\n            .pl-8 {\n                padding-left: .8rem\n            }\n\n            .pr-12 {\n                padding-right: 1.2rem\n            }\n\n            .pr-14 {\n                padding-right: 1.4rem\n            }\n\n            .pr-2 {\n                padding-right: .2rem\n            }\n\n            .pr-32 {\n                padding-right: 3.2rem\n            }\n\n            .pr-40 {\n                padding-right: 4rem\n            }\n\n            .pt-0 {\n                padding-top: 0rem\n            }\n\n            .pt-1 {\n                padding-top: .1rem\n            }\n\n            .pt-16 {\n                padding-top: 1.6rem\n            }\n\n            .pt-24 {\n                padding-top: 2.4rem\n            }\n\n            .pt-8 {\n                padding-top: .8rem\n            }\n\n            .group\\\\/step:last-child .group-last\\\\/step\\\\:last\\\\:pb-0:last-child {\n                padding-bottom: 0rem\n            }\n\n            .last\\\\:pb-1:last-child {\n                padding-bottom: .1rem\n            }\n\n            .last\\\\:pr-1:last-child {\n                padding-right: .1rem\n            }\n\n            .p-\\\\[8px\\\\] {\n                padding: 8px\n            }\n\n            .px-\\\\[15px\\\\] {\n                padding-left: 15px;\n                padding-right: 15px\n            }\n\n            .px-\\\\[8px\\\\] {\n                padding-left: 8px;\n                padding-right: 8px\n            }\n\n            .py-\\\\[11px\\\\] {\n                padding-top: 11px;\n                padding-bottom: 11px\n            }\n\n            .py-\\\\[5px\\\\] {\n                padding-top: 5px;\n                padding-bottom: 5px\n            }\n\n            .py-\\\\[7px\\\\] {\n                padding-top: 7px;\n                padding-bottom: 7px\n            }\n\n            .pl-\\\\[var\\\\(--w-prefix-width\\\\,_40px\\\\)\\\\] {\n                padding-left: var(--w-prefix-width, 40px)\n            }\n\n            .invisible {\n                visibility: hidden\n            }\n\n            .backface-hidden {\n                backface-visibility: hidden\n            }\n\n            .break-words {\n                overflow-wrap: break-word\n            }\n\n            .before\\\\:content-\\\\[\\\\\"\u00E2\u20AC\u201C\\\\\"\\\\]:before {\n                content: \"\u00E2\u20AC\u201C\"\n            }\n\n            .before\\\\:content-\\\\[\\\\\"\\\\\"\\\\]:before {\n                content: \"\"\n            }\n\n            .cursor-default {\n                cursor: default\n            }\n\n            .cursor-pointer {\n                cursor: pointer\n            }\n\n            .antialiased {\n                -webkit-font-smoothing: antialiased;\n                -moz-osx-font-smoothing: grayscale;\n                font-smoothing: grayscale\n            }\n\n            .font-bold {\n                font-weight: 700\n            }\n\n            .before\\\\:font-bold:before {\n                font-weight: 700\n            }\n\n            .font-normal {\n                font-weight: 400\n            }\n\n            .pointer-events-auto {\n                pointer-events: auto\n            }\n\n            .pointer-events-none {\n                pointer-events: none\n            }\n\n            .before\\\\:pointer-events-none:before {\n                pointer-events: none\n            }\n\n            .pb-safe-\\\\[32\\\\] {\n                padding-bottom: calc(32px + env(safe-area-inset-bottom, 0px))\n            }\n\n            .sr-only {\n                position: absolute;\n                width: 1px;\n                height: 1px;\n                padding: 0;\n                margin: -1px;\n                overflow: hidden;\n                clip: rect(0, 0, 0, 0);\n                white-space: nowrap;\n                border-width: 0\n            }\n\n            .touch-pan-y {\n                touch-action: pan-y\n            }\n\n            .select-none {\n                -webkit-user-select: none;\n                user-select: none\n            }\n\n            .translate-x-20 {\n                --w-translate-x: 2rem;\n                transform: translate(var(--w-translate-x)) translateY(var(--w-translate-y)) translateZ(var(--w-translate-z)) rotate(var(--w-rotate)) rotateX(var(--w-rotate-x)) rotateY(var(--w-rotate-y)) rotate(var(--w-rotate-z)) skew(var(--w-skew-x)) skewY(var(--w-skew-y)) scaleX(var(--w-scale-x)) scaleY(var(--w-scale-y)) scaleZ(var(--w-scale-z))\n            }\n\n            .translate-z-0 {\n                --w-translate-z: 0rem;\n                transform: translate(var(--w-translate-x)) translateY(var(--w-translate-y)) translateZ(var(--w-translate-z)) rotate(var(--w-rotate)) rotateX(var(--w-rotate-x)) rotateY(var(--w-rotate-y)) rotate(var(--w-rotate-z)) skew(var(--w-skew-x)) skewY(var(--w-skew-y)) scaleX(var(--w-scale-x)) scaleY(var(--w-scale-y)) scaleZ(var(--w-scale-z))\n            }\n\n            .-rotate-180, .part-\\\\[w-icon-chevron-down-16-part\\\\]\\\\:-rotate-180::part(w-icon-chevron-down-16-part) {\n                --w-rotate-x: 0;\n                --w-rotate-y: 0;\n                --w-rotate-z: 0;\n                --w-rotate: -180deg;\n                transform: translate(var(--w-translate-x)) translateY(var(--w-translate-y)) translateZ(var(--w-translate-z)) rotate(var(--w-rotate)) rotateX(var(--w-rotate-x)) rotateY(var(--w-rotate-y)) rotate(var(--w-rotate-z)) skew(var(--w-skew-x)) skewY(var(--w-skew-y)) scaleX(var(--w-scale-x)) scaleY(var(--w-scale-y)) scaleZ(var(--w-scale-z))\n            }\n\n            .part-\\\\[w-icon-chevron-up-16-part\\\\]\\\\:rotate-180::part(w-icon-chevron-up-16-part), .rotate-180 {\n                --w-rotate-x: 0;\n                --w-rotate-y: 0;\n                --w-rotate-z: 0;\n                --w-rotate: 180deg;\n                transform: translate(var(--w-translate-x)) translateY(var(--w-translate-y)) translateZ(var(--w-translate-z)) rotate(var(--w-rotate)) rotateX(var(--w-rotate-x)) rotateY(var(--w-rotate-y)) rotate(var(--w-rotate-z)) skew(var(--w-skew-x)) skewY(var(--w-skew-y)) scaleX(var(--w-scale-x)) scaleY(var(--w-scale-y)) scaleZ(var(--w-scale-z))\n            }\n\n            .rotate-90 {\n                --w-rotate-x: 0;\n                --w-rotate-y: 0;\n                --w-rotate-z: 0;\n                --w-rotate: 90deg;\n                transform: translate(var(--w-translate-x)) translateY(var(--w-translate-y)) translateZ(var(--w-translate-z)) rotate(var(--w-rotate)) rotateX(var(--w-rotate-x)) rotateY(var(--w-rotate-y)) rotate(var(--w-rotate-z)) skew(var(--w-skew-x)) skewY(var(--w-skew-y)) scaleX(var(--w-scale-x)) scaleY(var(--w-scale-y)) scaleZ(var(--w-scale-z))\n            }\n\n            .part-\\\\[w-icon-chevron-down-16-part\\\\]\\\\:transform::part(w-icon-chevron-down-16-part), .part-\\\\[w-icon-chevron-up-16-part\\\\]\\\\:transform::part(w-icon-chevron-up-16-part), .transform {\n                transform: translate(var(--w-translate-x)) translateY(var(--w-translate-y)) translateZ(var(--w-translate-z)) rotate(var(--w-rotate)) rotateX(var(--w-rotate-x)) rotateY(var(--w-rotate-y)) rotate(var(--w-rotate-z)) skew(var(--w-skew-x)) skewY(var(--w-skew-y)) scaleX(var(--w-scale-x)) scaleY(var(--w-scale-y)) scaleZ(var(--w-scale-z))\n            }\n\n            .part-\\\\[w-icon-chevron-down-16-part\\\\]\\\\:transform-gpu::part(w-icon-chevron-down-16-part), .part-\\\\[w-icon-chevron-up-16-part\\\\]\\\\:transform-gpu::part(w-icon-chevron-up-16-part), .transform-gpu {\n                transform: translate3d(var(--w-translate-x), var(--w-translate-y), var(--w-translate-z)) rotate(var(--w-rotate)) rotateX(var(--w-rotate-x)) rotateY(var(--w-rotate-y)) rotate(var(--w-rotate-z)) skew(var(--w-skew-x)) skewY(var(--w-skew-y)) scaleX(var(--w-scale-x)) scaleY(var(--w-scale-y)) scaleZ(var(--w-scale-z))\n            }\n\n            .part-\\\\[w-icon-chevron-down-16-part\\\\]\\\\:transition-transform::part(w-icon-chevron-down-16-part), .part-\\\\[w-icon-chevron-up-16-part\\\\]\\\\:transition-transform::part(w-icon-chevron-up-16-part), .transition-transform {\n                transition-property: transform;\n                transition-timing-function: cubic-bezier(.4, 0, .2, 1);\n                transition-duration: .15s\n            }\n\n            .transition-300 {\n                transition-property: color, background-color, border-color, text-decoration-color, fill, stroke, opacity, box-shadow, transform, filter, backdrop-filter;\n                transition-timing-function: cubic-bezier(.4, 0, .2, 1);\n                transition-duration: .3s\n            }\n\n            .transition-all {\n                transition-property: all;\n                transition-timing-function: cubic-bezier(.4, 0, .2, 1);\n                transition-duration: .15s\n            }\n\n            .transition-colors {\n                transition-property: color, background-color, border-color, text-decoration-color, fill, stroke;\n                transition-timing-function: cubic-bezier(.4, 0, .2, 1);\n                transition-duration: .15s\n            }\n\n            .transition-shadow {\n                transition-property: box-shadow;\n                transition-timing-function: cubic-bezier(.4, 0, .2, 1);\n                transition-duration: .15s\n            }\n\n            .before\\\\:transition-all:before {\n                transition-property: all;\n                transition-timing-function: cubic-bezier(.4, 0, .2, 1);\n                transition-duration: .15s\n            }\n\n            .duration-300 {\n                transition-duration: .3s\n            }\n\n            .ease-in-out, .part-\\\\[w-icon-chevron-down-16-part\\\\]\\\\:ease-in-out::part(w-icon-chevron-down-16-part), .part-\\\\[w-icon-chevron-up-16-part\\\\]\\\\:ease-in-out::part(w-icon-chevron-up-16-part) {\n                transition-timing-function: cubic-bezier(.4, 0, .2, 1)\n            }\n\n            .text-m {\n                font-size: var(--w-font-size-m);\n                line-height: var(--w-line-height-m)\n            }\n\n            .text-s {\n                font-size: var(--w-font-size-s);\n                line-height: var(--w-line-height-s)\n            }\n\n            .text-xs {\n                font-size: var(--w-font-size-xs);\n                line-height: var(--w-line-height-xs)\n            }\n\n            .leading-m {\n                line-height: var(--w-line-height-m)\n            }\n\n            .before\\\\:leading-xs:before {\n                line-height: var(--w-line-height-xs)\n            }\n\n            .leading-\\\\[24\\\\] {\n                line-height: 2.4rem\n            }\n\n            @media (max-width: 479.9px) {\n                .lt-sm\\\\:rounded-b-0 {\n                    border-bottom-left-radius: 0;\n                    border-bottom-right-radius: 0\n                }\n            }\n            @media (min-width: 480px) {\n                .sm\\\\:border-b-0 {\n                    border-bottom-width: 0\n                }\n\n                .sm\\\\:rounded-8 {\n                    border-radius: 8px\n                }\n\n                .sm\\\\:rounded-b-8 {\n                    border-bottom-left-radius: 8px;\n                    border-bottom-right-radius: 8px\n                }\n\n                .sm\\\\:gap-16 {\n                    gap: 1.6rem\n                }\n\n                .sm\\\\:place-content-center {\n                    place-content: center\n                }\n\n                .sm\\\\:place-items-center {\n                    place-items: center\n                }\n\n                .sm\\\\:h-24 {\n                    height: 2.4rem\n                }\n\n                .sm\\\\:min-h-48 {\n                    min-height: 4.8rem\n                }\n\n                .sm\\\\:w-24 {\n                    width: 2.4rem\n                }\n\n                .sm\\\\:min-h-\\\\[32px\\\\] {\n                    min-height: 32px\n                }\n\n                .sm\\\\:min-h-\\\\[44px\\\\] {\n                    min-height: 44px\n                }\n\n                .sm\\\\:min-h-\\\\[45\\\\] {\n                    min-height: 4.5rem\n                }\n\n                .sm\\\\:min-w-\\\\[32px\\\\] {\n                    min-width: 32px\n                }\n\n                .sm\\\\:min-w-\\\\[44px\\\\] {\n                    min-width: 44px\n                }\n\n                .sm\\\\:mx-0 {\n                    margin-left: 0rem;\n                    margin-right: 0rem\n                }\n\n                .sm\\\\:mx-16 {\n                    margin-left: 1.6rem;\n                    margin-right: 1.6rem\n                }\n\n                .sm\\\\:-ml-12 {\n                    margin-left: -1.2rem\n                }\n\n                .sm\\\\:-mr-12 {\n                    margin-right: -1.2rem\n                }\n\n                .sm\\\\:-mt-8 {\n                    margin-top: -.8rem\n                }\n\n                .sm\\\\:px-32 {\n                    padding-left: 3.2rem;\n                    padding-right: 3.2rem\n                }\n\n                .sm\\\\:py-0 {\n                    padding-top: 0rem;\n                    padding-bottom: 0rem\n                }\n\n                .sm\\\\:pb-32 {\n                    padding-bottom: 3.2rem\n                }\n\n                .sm\\\\:pt-24 {\n                    padding-top: 2.4rem\n                }\n\n                .sm\\\\:pt-32 {\n                    padding-top: 3.2rem\n                }\n            }\n            @media (min-width: 768px) {\n                .md\\\\:block {\n                    display: block\n                }\n\n                .md\\\\:hidden {\n                    display: none\n                }\n            }\n        `;\n", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.focus\\\\:\\\\[--w-outline-offset\\\\:-2px\\\\]:focus{--w-outline-offset:-2px}.bg-transparent{background-color:#0000}.rounded-4{border-radius:4px}.block{display:block}.flex{display:flex}.focusable:focus{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:focus-visible{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:not(:focus-visible){outline:none}.items-center{align-items:center}.bottom-0{bottom:0}.left-0{left:0}.right-0{right:0}.top-0{top:0}.justify-center{justify-content:center}.absolute{position:absolute}.relative{position:relative}.static{position:static}.s-text{color:var(--w-s-color-text)}.w-40{width:4rem}.w-max{width:max-content}.pb-0{padding-bottom:0}.pl-12{padding-left:1.2rem}.pr-12{padding-right:1.2rem}.cursor-default{cursor:default}.antialiased{-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;font-smoothing:grayscale}.font-bold{font-weight:700}.text-xs{font-size:var(--w-font-size-xs);line-height:var(--w-line-height-xs)}`;\n", "/**\n * @license\n * Copyright 2020 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\n// Any new exports need to be added to the export statement in\n// `packages/lit/src/index.all.ts`.\n\nimport {\n  html as coreHtml,\n  svg as coreSvg,\n  mathml as coreMathml,\n  TemplateResult,\n} from './lit-html.js';\n\nexport interface StaticValue {\n  /** The value to interpolate as-is into the template. */\n  _$litStatic$: string;\n\n  /**\n   * A value that can't be decoded from ordinary JSON, make it harder for\n   * an attacker-controlled data that goes through JSON.parse to produce a valid\n   * StaticValue.\n   */\n  r: typeof brand;\n}\n\n/**\n * Prevents JSON injection attacks.\n *\n * The goals of this brand:\n *   1) fast to check\n *   2) code is small on the wire\n *   3) multiple versions of Lit in a single page will all produce mutually\n *      interoperable StaticValues\n *   4) normal JSON.parse (without an unusual reviver) can not produce a\n *      StaticValue\n *\n * Symbols satisfy (1), (2), and (4). We use Symbol.for to satisfy (3), but\n * we don't care about the key, so we break ties via (2) and use the empty\n * string.\n */\nconst brand = Symbol.for('');\n\n/** Safely extracts the string part of a StaticValue. */\nconst unwrapStaticValue = (value: unknown): string | undefined => {\n  if ((value as Partial<StaticValue>)?.r !== brand) {\n    return undefined;\n  }\n  return (value as Partial<StaticValue>)?.['_$litStatic$'];\n};\n\n/**\n * Wraps a string so that it behaves like part of the static template\n * strings instead of a dynamic value.\n *\n * Users must take care to ensure that adding the static string to the template\n * results in well-formed HTML, or else templates may break unexpectedly.\n *\n * Note that this function is unsafe to use on untrusted content, as it will be\n * directly parsed into HTML. Do not pass user input to this function\n * without sanitizing it.\n *\n * Static values can be changed, but they will cause a complete re-render\n * since they effectively create a new template.\n */\nexport const unsafeStatic = (value: string): StaticValue => ({\n  ['_$litStatic$']: value,\n  r: brand,\n});\n\nconst textFromStatic = (value: StaticValue) => {\n  if (value['_$litStatic$'] !== undefined) {\n    return value['_$litStatic$'];\n  } else {\n    throw new Error(\n      `Value passed to 'literal' function must be a 'literal' result: ${value}. Use 'unsafeStatic' to pass non-literal values, but\n            take care to ensure page security.`\n    );\n  }\n};\n\n/**\n * Tags a string literal so that it behaves like part of the static template\n * strings instead of a dynamic value.\n *\n * The only values that may be used in template expressions are other tagged\n * `literal` results or `unsafeStatic` values (note that untrusted content\n * should never be passed to `unsafeStatic`).\n *\n * Users must take care to ensure that adding the static string to the template\n * results in well-formed HTML, or else templates may break unexpectedly.\n *\n * Static values can be changed, but they will cause a complete re-render since\n * they effectively create a new template.\n */\nexport const literal = (\n  strings: TemplateStringsArray,\n  ...values: unknown[]\n): StaticValue => ({\n  ['_$litStatic$']: values.reduce(\n    (acc, v, idx) => acc + textFromStatic(v as StaticValue) + strings[idx + 1],\n    strings[0]\n  ) as string,\n  r: brand,\n});\n\nconst stringsCache = new Map<string, TemplateStringsArray>();\n\n/**\n * Wraps a lit-html template tag (`html` or `svg`) to add static value support.\n */\nexport const withStatic =\n  (coreTag: typeof coreHtml | typeof coreSvg | typeof coreMathml) =>\n  (strings: TemplateStringsArray, ...values: unknown[]): TemplateResult => {\n    const l = values.length;\n    let staticValue: string | undefined;\n    let dynamicValue: unknown;\n    const staticStrings: Array<string> = [];\n    const dynamicValues: Array<unknown> = [];\n    let i = 0;\n    let hasStatics = false;\n    let s: string;\n\n    while (i < l) {\n      s = strings[i];\n      // Collect any unsafeStatic values, and their following template strings\n      // so that we treat a run of template strings and unsafe static values as\n      // a single template string.\n      while (\n        i < l &&\n        ((dynamicValue = values[i]),\n        (staticValue = unwrapStaticValue(dynamicValue))) !== undefined\n      ) {\n        s += staticValue + strings[++i];\n        hasStatics = true;\n      }\n      // If the last value is static, we don't need to push it.\n      if (i !== l) {\n        dynamicValues.push(dynamicValue);\n      }\n      staticStrings.push(s);\n      i++;\n    }\n    // If the last value isn't static (which would have consumed the last\n    // string), then we need to add the last string.\n    if (i === l) {\n      staticStrings.push(strings[l]);\n    }\n\n    if (hasStatics) {\n      const key = staticStrings.join('$$lit$$');\n      strings = stringsCache.get(key)!;\n      if (strings === undefined) {\n        // Beware: in general this pattern is unsafe, and doing so may bypass\n        // lit's security checks and allow an attacker to execute arbitrary\n        // code and inject arbitrary content.\n        // eslint-disable-next-line @typescript-eslint/no-explicit-any\n        (staticStrings as any).raw = staticStrings;\n        stringsCache.set(\n          key,\n          (strings = staticStrings as unknown as TemplateStringsArray)\n        );\n      }\n      values = dynamicValues;\n    }\n    return coreTag(strings, ...values);\n  };\n\n/**\n * Interprets a template literal as an HTML template that can efficiently\n * render to and update a container.\n *\n * Includes static value support from `lit-html/static.js`.\n */\nexport const html = withStatic(coreHtml);\n\n/**\n * Interprets a template literal as an SVG template that can efficiently\n * render to and update a container.\n *\n * Includes static value support from `lit-html/static.js`.\n */\nexport const svg = withStatic(coreSvg);\n\n/**\n * Interprets a template literal as MathML fragment that can efficiently render\n * to and update a container.\n *\n * Includes static value support from `lit-html/static.js`.\n */\nexport const mathml = withStatic(coreMathml);\n", "import { unraw } from 'unraw';\nimport { compileMessage } from '@lingui/message-utils/compileMessage';\n\nconst isString = (s) => typeof s === \"string\";\nconst isFunction = (f) => typeof f === \"function\";\n\nconst cache = /* @__PURE__ */ new Map();\nconst defaultLocale = \"en\";\nfunction normalizeLocales(locales) {\n  const out = Array.isArray(locales) ? locales : [locales];\n  return [...out, defaultLocale];\n}\nfunction date(locales, value, format) {\n  const _locales = normalizeLocales(locales);\n  if (!format) {\n    format = \"default\";\n  }\n  let o;\n  if (typeof format === \"string\") {\n    o = {\n      day: \"numeric\",\n      month: \"short\",\n      year: \"numeric\"\n    };\n    switch (format) {\n      case \"full\":\n        o.weekday = \"long\";\n      case \"long\":\n        o.month = \"long\";\n        break;\n      case \"short\":\n        o.month = \"numeric\";\n        break;\n    }\n  } else {\n    o = format;\n  }\n  const formatter = getMemoized(\n    () => cacheKey(\"date\", _locales, format),\n    () => new Intl.DateTimeFormat(_locales, o)\n  );\n  return formatter.format(isString(value) ? new Date(value) : value);\n}\nfunction time(locales, value, format) {\n  let o;\n  if (!format) {\n    format = \"default\";\n  }\n  if (typeof format === \"string\") {\n    o = {\n      second: \"numeric\",\n      minute: \"numeric\",\n      hour: \"numeric\"\n    };\n    switch (format) {\n      case \"full\":\n      case \"long\":\n        o.timeZoneName = \"short\";\n        break;\n      case \"short\":\n        delete o.second;\n    }\n  } else {\n    o = format;\n  }\n  return date(locales, value, o);\n}\nfunction number(locales, value, format) {\n  const _locales = normalizeLocales(locales);\n  const formatter = getMemoized(\n    () => cacheKey(\"number\", _locales, format),\n    () => new Intl.NumberFormat(_locales, format)\n  );\n  return formatter.format(value);\n}\nfunction plural(locales, ordinal, value, { offset = 0, ...rules }) {\n  const _locales = normalizeLocales(locales);\n  const plurals = ordinal ? getMemoized(\n    () => cacheKey(\"plural-ordinal\", _locales),\n    () => new Intl.PluralRules(_locales, { type: \"ordinal\" })\n  ) : getMemoized(\n    () => cacheKey(\"plural-cardinal\", _locales),\n    () => new Intl.PluralRules(_locales, { type: \"cardinal\" })\n  );\n  return rules[value] ?? rules[plurals.select(value - offset)] ?? rules.other;\n}\nfunction getMemoized(getKey, construct) {\n  const key = getKey();\n  let formatter = cache.get(key);\n  if (!formatter) {\n    formatter = construct();\n    cache.set(key, formatter);\n  }\n  return formatter;\n}\nfunction cacheKey(type, locales, options) {\n  const localeKey = locales.join(\"-\");\n  return `${type}-${localeKey}-${JSON.stringify(options)}`;\n}\n\nconst formats = {\n  __proto__: null,\n  date: date,\n  defaultLocale: defaultLocale,\n  number: number,\n  plural: plural,\n  time: time\n};\n\nconst UNICODE_REGEX = /\\\\u[a-fA-F0-9]{4}|\\\\x[a-fA-F0-9]{2}/;\nconst OCTOTHORPE_PH = \"%__lingui_octothorpe__%\";\nconst getDefaultFormats = (locale, passedLocales, formats = {}) => {\n  const locales = passedLocales || locale;\n  const style = (format) => {\n    if (typeof format === \"object\")\n      return format;\n    return formats[format];\n  };\n  const replaceOctothorpe = (value, message) => {\n    const numberFormat = Object.keys(formats).length ? style(\"number\") : void 0;\n    const valueStr = number(locales, value, numberFormat);\n    return message.replace(new RegExp(OCTOTHORPE_PH, \"g\"), valueStr);\n  };\n  return {\n    plural: (value, cases) => {\n      const { offset = 0 } = cases;\n      const message = plural(locales, false, value, cases);\n      return replaceOctothorpe(value - offset, message);\n    },\n    selectordinal: (value, cases) => {\n      const { offset = 0 } = cases;\n      const message = plural(locales, true, value, cases);\n      return replaceOctothorpe(value - offset, message);\n    },\n    select: selectFormatter,\n    number: (value, format) => number(\n      locales,\n      value,\n      style(format) || { style: format }\n    ),\n    date: (value, format) => date(locales, value, style(format) || format),\n    time: (value, format) => time(locales, value, style(format) || format)\n  };\n};\nconst selectFormatter = (value, rules) => rules[value] ?? rules.other;\nfunction interpolate(translation, locale, locales) {\n  return (values = {}, formats) => {\n    const formatters = getDefaultFormats(locale, locales, formats);\n    const formatMessage = (tokens, replaceOctothorpe = false) => {\n      if (!Array.isArray(tokens))\n        return tokens;\n      return tokens.reduce((message, token) => {\n        if (token === \"#\" && replaceOctothorpe) {\n          return message + OCTOTHORPE_PH;\n        }\n        if (isString(token)) {\n          return message + token;\n        }\n        const [name, type, format] = token;\n        let interpolatedFormat = {};\n        if (type === \"plural\" || type === \"selectordinal\" || type === \"select\") {\n          Object.entries(format).forEach(\n            ([key, value2]) => {\n              interpolatedFormat[key] = formatMessage(\n                value2,\n                type === \"plural\" || type === \"selectordinal\"\n              );\n            }\n          );\n        } else {\n          interpolatedFormat = format;\n        }\n        let value;\n        if (type) {\n          const formatter = formatters[type];\n          value = formatter(values[name], interpolatedFormat);\n        } else {\n          value = values[name];\n        }\n        if (value == null) {\n          return message;\n        }\n        return message + value;\n      }, \"\");\n    };\n    const result = formatMessage(translation);\n    if (isString(result) && UNICODE_REGEX.test(result)) {\n      return unraw(result);\n    }\n    if (isString(result))\n      return result;\n    return result ? String(result) : \"\";\n  };\n}\n\nvar __defProp$1 = Object.defineProperty;\nvar __defNormalProp$1 = (obj, key, value) => key in obj ? __defProp$1(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;\nvar __publicField$1 = (obj, key, value) => {\n  __defNormalProp$1(obj, typeof key !== \"symbol\" ? key + \"\" : key, value);\n  return value;\n};\nclass EventEmitter {\n  constructor() {\n    __publicField$1(this, \"_events\", {});\n  }\n  on(event, listener) {\n    var _a;\n    (_a = this._events)[event] ?? (_a[event] = []);\n    this._events[event].push(listener);\n    return () => this.removeListener(event, listener);\n  }\n  removeListener(event, listener) {\n    const maybeListeners = this._getListeners(event);\n    if (!maybeListeners)\n      return;\n    const index = maybeListeners.indexOf(listener);\n    if (~index)\n      maybeListeners.splice(index, 1);\n  }\n  emit(event, ...args) {\n    const maybeListeners = this._getListeners(event);\n    if (!maybeListeners)\n      return;\n    maybeListeners.map((listener) => listener.apply(this, args));\n  }\n  _getListeners(event) {\n    const maybeListeners = this._events[event];\n    return Array.isArray(maybeListeners) ? maybeListeners : false;\n  }\n}\n\nvar __defProp = Object.defineProperty;\nvar __defNormalProp = (obj, key, value) => key in obj ? __defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;\nvar __publicField = (obj, key, value) => {\n  __defNormalProp(obj, typeof key !== \"symbol\" ? key + \"\" : key, value);\n  return value;\n};\nclass I18n extends EventEmitter {\n  constructor(params) {\n    super();\n    __publicField(this, \"_locale\", \"\");\n    __publicField(this, \"_locales\");\n    __publicField(this, \"_localeData\", {});\n    __publicField(this, \"_messages\", {});\n    __publicField(this, \"_missing\");\n    __publicField(this, \"_messageCompiler\");\n    /**\n     * Alias for {@see I18n._}\n     */\n    __publicField(this, \"t\", this._.bind(this));\n    if (process.env.NODE_ENV !== \"production\") {\n      this.setMessagesCompiler(compileMessage);\n    }\n    if (params.missing != null)\n      this._missing = params.missing;\n    if (params.messages != null)\n      this.load(params.messages);\n    if (params.localeData != null)\n      this.loadLocaleData(params.localeData);\n    if (typeof params.locale === \"string\" || params.locales) {\n      this.activate(params.locale ?? defaultLocale, params.locales);\n    }\n  }\n  get locale() {\n    return this._locale;\n  }\n  get locales() {\n    return this._locales;\n  }\n  get messages() {\n    return this._messages[this._locale] ?? {};\n  }\n  /**\n   * @deprecated this has no effect. Please remove this from the code. Deprecated in v4\n   */\n  get localeData() {\n    return this._localeData[this._locale] ?? {};\n  }\n  _loadLocaleData(locale, localeData) {\n    const maybeLocaleData = this._localeData[locale];\n    if (!maybeLocaleData) {\n      this._localeData[locale] = localeData;\n    } else {\n      Object.assign(maybeLocaleData, localeData);\n    }\n  }\n  /**\n   * Registers a `MessageCompiler` to enable the use of uncompiled catalogs at runtime.\n   *\n   * In production builds, the `MessageCompiler` is typically excluded to reduce bundle size.\n   * By default, message catalogs should be precompiled during the build process. However,\n   * if you need to compile catalogs at runtime, you can use this method to set a message compiler.\n   *\n   * Example usage:\n   *\n   * ```ts\n   * import { compileMessage } from \"@lingui/message-utils/compileMessage\";\n   *\n   * i18n.setMessagesCompiler(compileMessage);\n   * ```\n   */\n  setMessagesCompiler(compiler) {\n    this._messageCompiler = compiler;\n    return this;\n  }\n  /**\n   * @deprecated Plurals automatically used from Intl.PluralRules you can safely remove this call. Deprecated in v4\n   */\n  loadLocaleData(localeOrAllData, localeData) {\n    if (typeof localeOrAllData === \"string\") {\n      this._loadLocaleData(localeOrAllData, localeData);\n    } else {\n      Object.keys(localeOrAllData).forEach(\n        (locale) => this._loadLocaleData(locale, localeOrAllData[locale])\n      );\n    }\n    this.emit(\"change\");\n  }\n  _load(locale, messages) {\n    const maybeMessages = this._messages[locale];\n    if (!maybeMessages) {\n      this._messages[locale] = messages;\n    } else {\n      Object.assign(maybeMessages, messages);\n    }\n  }\n  load(localeOrMessages, messages) {\n    if (typeof localeOrMessages == \"string\" && typeof messages === \"object\") {\n      this._load(localeOrMessages, messages);\n    } else {\n      Object.entries(localeOrMessages).forEach(\n        ([locale, messages2]) => this._load(locale, messages2)\n      );\n    }\n    this.emit(\"change\");\n  }\n  /**\n   * @param options {@link LoadAndActivateOptions}\n   */\n  loadAndActivate({ locale, locales, messages }) {\n    this._locale = locale;\n    this._locales = locales || void 0;\n    this._messages[this._locale] = messages;\n    this.emit(\"change\");\n  }\n  activate(locale, locales) {\n    if (process.env.NODE_ENV !== \"production\") {\n      if (!this._messages[locale]) {\n        console.warn(`Messages for locale \"${locale}\" not loaded.`);\n      }\n    }\n    this._locale = locale;\n    this._locales = locales;\n    this.emit(\"change\");\n  }\n  _(id, values, options) {\n    if (!this.locale) {\n      throw new Error(\n        \"Lingui: Attempted to call a translation function without setting a locale.\\nMake sure to call `i18n.activate(locale)` before using Lingui functions.\\nThis issue may also occur due to a race condition in your initialization logic.\"\n      );\n    }\n    let message = options?.message;\n    if (!id) {\n      id = \"\";\n    }\n    if (!isString(id)) {\n      values = id.values || values;\n      message = id.message;\n      id = id.id;\n    }\n    const messageForId = this.messages[id];\n    const messageMissing = messageForId === void 0;\n    const missing = this._missing;\n    if (missing && messageMissing) {\n      return isFunction(missing) ? missing(this._locale, id) : missing;\n    }\n    if (messageMissing) {\n      this.emit(\"missing\", { id, locale: this._locale });\n    }\n    let translation = messageForId || message || id;\n    if (isString(translation)) {\n      if (this._messageCompiler) {\n        translation = this._messageCompiler(translation);\n      } else {\n        console.warn(`Uncompiled message detected! Message:\n\n> ${translation}\n\nThat means you use raw catalog or your catalog doesn't have a translation for the message and fallback was used.\nICU features such as interpolation and plurals will not work properly for that message. \n\nPlease compile your catalog first. \n`);\n      }\n    }\n    if (isString(translation) && UNICODE_REGEX.test(translation))\n      return JSON.parse(`\"${translation}\"`);\n    if (isString(translation))\n      return translation;\n    return interpolate(\n      translation,\n      this._locale,\n      this._locales\n    )(values, options?.formats);\n  }\n  date(value, format) {\n    return date(this._locales || this._locale, value, format);\n  }\n  number(value, format) {\n    return number(this._locales || this._locale, value, format);\n  }\n}\nfunction setupI18n(params = {}) {\n  return new I18n(params);\n}\n\nconst i18n = setupI18n();\n\nexport { I18n, formats, i18n, setupI18n };\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/search/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/search/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/search/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/search/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/search/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconSearch16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Magnifying glass`, id: 'icon.title.search', comment: 'Title for search icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-search-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" d=\"M8.905 12.102A6.042 6.042 0 1 0 4.18.981a6.042 6.042 0 0 0 4.726 11.121Zm1.909-1.289L15.5 15.5\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-search-16')) {\n  customElements.define('w-icon-search-16', IconSearch16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.search\\\":[\\\"Forst\u00F8rrelsesglass\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.search\\\":[\\\"Magnifying glass\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.search\\\":[\\\"Suurennuslasi\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.search\\\":[\\\"Forst\u00F8rrelsesglas\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.search\\\":[\\\"F\u00F6rstoringsglas\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/close/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/close/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/close/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/close/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/close/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconClose16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Cross`, id: 'icon.title.close', comment: 'Title for close icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-close-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" stroke-width=\"1.5\" d=\"m12.5 3.5-9 9m0-9 9 9\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-close-16')) {\n  customElements.define('w-icon-close-16', IconClose16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.close\\\":[\\\"Kryss\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.close\\\":[\\\"Cross\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.close\\\":[\\\"Rasti\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.close\\\":[\\\"Kryds\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.close\\\":[\\\"Kryss\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "// @warp-css;\n\nimport { html, LitElement } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { property } from 'lit/decorators.js';\nimport { ifDefined } from 'lit/directives/if-defined.js';\n\nimport { reset } from '../styles.js';\n\nimport { styles } from './styles.js';\nimport '@warp-ds/icons/elements/search-16';\nimport '@warp-ds/icons/elements/close-16';\n\nconst prefixSuffixWrapper =\n  'absolute top-0 bottom-0 flex justify-center items-center focusable rounded-4 focus:[--w-outline-offset:-2px] bg-transparent ';\n\nexport const ccSuffix = {\n  wrapper: prefixSuffixWrapper + 'right-0',\n  wrapperWithLabel: 'w-max pr-12',\n  wrapperWithIcon: 'w-40',\n  label: 'antialiased block relative cursor-default pb-0 font-bold text-xs s-text',\n};\n\nexport const ccPrefix = {\n  wrapper: prefixSuffixWrapper + 'left-0',\n  wrapperWithLabel: 'w-max pl-12',\n  wrapperWithIcon: 'w-40',\n  label: 'antialiased block relative cursor-default pb-0 font-bold text-xs s-text',\n};\n\n/**\n * This component is usually used in other components like form elements to show a prefix or suffix. See for example `w-textfield`.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/forms-affix--docs)\n */\nclass WarpAffix extends LitElement {\n  @property({ attribute: 'aria-label' }) ariaLabel: string;\n\n  /**\n   * Add this property to render a clickable Warp close icon.\n   *\n   * Set an `aria-label` that explains the action when using this.\n   */\n  @property({ type: Boolean }) clear = false;\n\n  /**\n   * Add this property to render a clickable Warp search icon.\n   *\n   * Set an `aria-label` that explains the action when using this.\n   */\n  @property({ type: Boolean }) search = false;\n\n  @property() label: string;\n\n  static styles = [reset, styles];\n\n  /** @internal */\n  get _classBase() {\n    return this.slot === 'suffix' ? ccSuffix : ccPrefix;\n  }\n\n  /** @internal */\n  get _classes() {\n    return classNames([this._classBase.wrapper, this.label ? this._classBase.wrapperWithLabel : this._classBase.wrapperWithIcon]);\n  }\n\n  /** @internal */\n  get _searchButton() {\n    return html`\n      <button aria-label=\"${ifDefined(this.ariaLabel)}\" class=\"${this._classes}\" type=\"submit\">\n        <w-icon-search-16></w-icon-search-16>\n      </button>\n    `;\n  }\n\n  /** @internal */\n  get _clearButton() {\n    return html`\n      <button aria-label=\"${ifDefined(this.ariaLabel)}\" class=\"${this._classes}\" type=\"reset\">\n        <w-icon-close-16></w-icon-close-16>\n      </button>\n    `;\n  }\n\n  /** @internal */\n  get _text() {\n    return html`\n      <div class=\"${this._classes}\">\n        <span class=\"${this._classBase.label}\">${this.label}</span>\n      </div>\n    `;\n  }\n\n  /** @internal */\n  get _markup() {\n    if (this.label) {\n      return this._text;\n    } else if (this.search) {\n      return this._searchButton;\n    } else if (this.clear) {\n      return this._clearButton;\n    }\n    return undefined;\n  }\n\n  render() {\n    return html`${this._markup}`;\n  }\n}\n\nif (!customElements.get('w-affix')) {\n  customElements.define('w-affix', WarpAffix);\n}\n\nexport { WarpAffix };\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-affix': WarpAffix;\n  }\n}\n", "/**\n * @license\n * Copyright 2017 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\nimport {Disconnectable, Part} from './lit-html.js';\n\nexport {\n  AttributePart,\n  BooleanAttributePart,\n  ChildPart,\n  ElementPart,\n  EventPart,\n  Part,\n  PropertyPart,\n} from './lit-html.js';\n\nexport interface DirectiveClass {\n  new (part: PartInfo): Directive;\n}\n\n/**\n * This utility type extracts the signature of a directive class's render()\n * method so we can use it for the type of the generated directive function.\n */\nexport type DirectiveParameters<C extends Directive> = Parameters<C['render']>;\n\n/**\n * A generated directive function doesn't evaluate the directive, but just\n * returns a DirectiveResult object that captures the arguments.\n */\nexport interface DirectiveResult<C extends DirectiveClass = DirectiveClass> {\n  /**\n   * This property needs to remain unminified.\n   * @internal\n   */\n  ['_$litDirective$']: C;\n  /** @internal */\n  values: DirectiveParameters<InstanceType<C>>;\n}\n\nexport const PartType = {\n  ATTRIBUTE: 1,\n  CHILD: 2,\n  PROPERTY: 3,\n  BOOLEAN_ATTRIBUTE: 4,\n  EVENT: 5,\n  ELEMENT: 6,\n} as const;\n\nexport type PartType = (typeof PartType)[keyof typeof PartType];\n\nexport interface ChildPartInfo {\n  readonly type: typeof PartType.CHILD;\n}\n\nexport interface AttributePartInfo {\n  readonly type:\n    | typeof PartType.ATTRIBUTE\n    | typeof PartType.PROPERTY\n    | typeof PartType.BOOLEAN_ATTRIBUTE\n    | typeof PartType.EVENT;\n  readonly strings?: ReadonlyArray<string>;\n  readonly name: string;\n  readonly tagName: string;\n}\n\nexport interface ElementPartInfo {\n  readonly type: typeof PartType.ELEMENT;\n}\n\n/**\n * Information about the part a directive is bound to.\n *\n * This is useful for checking that a directive is attached to a valid part,\n * such as with directive that can only be used on attribute bindings.\n */\nexport type PartInfo = ChildPartInfo | AttributePartInfo | ElementPartInfo;\n\n/**\n * Creates a user-facing directive function from a Directive class. This\n * function has the same parameters as the directive's render() method.\n */\nexport const directive =\n  <C extends DirectiveClass>(c: C) =>\n  (...values: DirectiveParameters<InstanceType<C>>): DirectiveResult<C> => ({\n    // This property needs to remain unminified.\n    ['_$litDirective$']: c,\n    values,\n  });\n\n/**\n * Base class for creating custom directives. Users should extend this class,\n * implement `render` and/or `update`, and then pass their subclass to\n * `directive`.\n */\nexport abstract class Directive implements Disconnectable {\n  //@internal\n  __part!: Part;\n  //@internal\n  __attributeIndex: number | undefined;\n  //@internal\n  __directive?: Directive;\n\n  //@internal\n  _$parent!: Disconnectable;\n\n  // These will only exist on the AsyncDirective subclass\n  //@internal\n  _$disconnectableChildren?: Set<Disconnectable>;\n  // This property needs to remain unminified.\n  //@internal\n  ['_$notifyDirectiveConnectionChanged']?(isConnected: boolean): void;\n\n  constructor(_partInfo: PartInfo) {}\n\n  // See comment in Disconnectable interface for why this is a getter\n  get _$isConnected() {\n    return this._$parent._$isConnected;\n  }\n\n  /** @internal */\n  _$initialize(\n    part: Part,\n    parent: Disconnectable,\n    attributeIndex: number | undefined\n  ) {\n    this.__part = part;\n    this._$parent = parent;\n    this.__attributeIndex = attributeIndex;\n  }\n  /** @internal */\n  _$resolve(part: Part, props: Array<unknown>): unknown {\n    return this.update(part, props);\n  }\n\n  abstract render(...props: Array<unknown>): unknown;\n\n  update(_part: Part, props: Array<unknown>): unknown {\n    return this.render(...props);\n  }\n}\n", "/**\n * @license\n * Copyright 2018 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\nimport {AttributePart, noChange} from '../lit-html.js';\nimport {\n  directive,\n  Directive,\n  DirectiveParameters,\n  PartInfo,\n  PartType,\n} from '../directive.js';\n\n/**\n * A key-value set of class names to truthy values.\n */\nexport interface ClassInfo {\n  readonly [name: string]: string | boolean | number;\n}\n\nclass ClassMapDirective extends Directive {\n  /**\n   * Stores the ClassInfo object applied to a given AttributePart.\n   * Used to unset existing values when a new ClassInfo object is applied.\n   */\n  private _previousClasses?: Set<string>;\n  private _staticClasses?: Set<string>;\n\n  constructor(partInfo: PartInfo) {\n    super(partInfo);\n    if (\n      partInfo.type !== PartType.ATTRIBUTE ||\n      partInfo.name !== 'class' ||\n      (partInfo.strings?.length as number) > 2\n    ) {\n      throw new Error(\n        '`classMap()` can only be used in the `class` attribute ' +\n          'and must be the only part in the attribute.'\n      );\n    }\n  }\n\n  render(classInfo: ClassInfo) {\n    // Add spaces to ensure separation from static classes\n    return (\n      ' ' +\n      Object.keys(classInfo)\n        .filter((key) => classInfo[key])\n        .join(' ') +\n      ' '\n    );\n  }\n\n  override update(part: AttributePart, [classInfo]: DirectiveParameters<this>) {\n    // Remember dynamic classes on the first render\n    if (this._previousClasses === undefined) {\n      this._previousClasses = new Set();\n      if (part.strings !== undefined) {\n        this._staticClasses = new Set(\n          part.strings\n            .join(' ')\n            .split(/\\s/)\n            .filter((s) => s !== '')\n        );\n      }\n      for (const name in classInfo) {\n        if (classInfo[name] && !this._staticClasses?.has(name)) {\n          this._previousClasses.add(name);\n        }\n      }\n      return this.render(classInfo);\n    }\n\n    const classList = part.element.classList;\n\n    // Remove old classes that no longer apply\n    for (const name of this._previousClasses) {\n      if (!(name in classInfo)) {\n        classList.remove(name);\n        this._previousClasses!.delete(name);\n      }\n    }\n\n    // Add or remove classes based on their classMap value\n    for (const name in classInfo) {\n      // We explicitly want a loose truthy check of `value` because it seems\n      // more convenient that '' and 0 are skipped.\n      const value = !!classInfo[name];\n      if (\n        value !== this._previousClasses.has(name) &&\n        !this._staticClasses?.has(name)\n      ) {\n        if (value) {\n          classList.add(name);\n          this._previousClasses.add(name);\n        } else {\n          classList.remove(name);\n          this._previousClasses.delete(name);\n        }\n      }\n    }\n    return noChange;\n  }\n}\n\n/**\n * A directive that applies dynamic CSS classes.\n *\n * This must be used in the `class` attribute and must be the only part used in\n * the attribute. It takes each property in the `classInfo` argument and adds\n * the property name to the element's `classList` if the property value is\n * truthy; if the property value is falsy, the property name is removed from\n * the element's `class`.\n *\n * For example `{foo: bar}` applies the class `foo` if the value of `bar` is\n * truthy.\n *\n * @param classInfo\n */\nexport const classMap = directive(ClassMapDirective);\n\n/**\n * The type of the class that powers this directive. Necessary for naming the\n * directive's return type.\n */\nexport type {ClassMapDirective};\n", "import { classMap } from 'lit/directives/class-map.js';\n\nconst camelCaseToKebabCase = (str) => str.replace(/([a-z0-9])([A-Z])/g, '$1-$2').toLowerCase();\n\n// Source: https://medium.com/@dayton-bobbitt/generating-attributes-for-litelement-properties-f972ef658137\nexport function kebabCaseAttributes(constructor) {\n  return class extends constructor {\n    static createProperty(name, options) {\n      let customOptions = options;\n\n      // derive the attribute name if not already defined or disabled\n      if (typeof options?.attribute === 'undefined' || options?.attribute === true) {\n        customOptions = Object.assign({}, options, {\n          attribute: camelCaseToKebabCase(name.toString()),\n        });\n      }\n\n      super.createProperty(name, customOptions);\n    }\n  };\n}\n\nexport function classes(defn) {\n  const classes = [];\n  for (const [key, value] of Object.entries(defn)) {\n    if (value) classes.push(key);\n  }\n  return classes.join(' ');\n}\n\nexport function fclasses(definition) {\n  const defn = {};\n  for (const [key, value] of Object.entries(definition)) {\n    for (const className of key.split(' ')) {\n      defn[className] = value;\n    }\n  }\n  return classMap(defn);\n}\n\nexport function generateRandomId() {\n  return `m${Math.random().toString(36).slice(2)}`;\n}\n", "/**\n * Custom positioning reference element.\n * @see https://floating-ui.com/docs/virtual-elements\n */\n\nconst sides = ['top', 'right', 'bottom', 'left'];\nconst alignments = ['start', 'end'];\nconst placements = /*#__PURE__*/sides.reduce((acc, side) => acc.concat(side, side + \"-\" + alignments[0], side + \"-\" + alignments[1]), []);\nconst min = Math.min;\nconst max = Math.max;\nconst round = Math.round;\nconst floor = Math.floor;\nconst createCoords = v => ({\n  x: v,\n  y: v\n});\nconst oppositeSideMap = {\n  left: 'right',\n  right: 'left',\n  bottom: 'top',\n  top: 'bottom'\n};\nconst oppositeAlignmentMap = {\n  start: 'end',\n  end: 'start'\n};\nfunction clamp(start, value, end) {\n  return max(start, min(value, end));\n}\nfunction evaluate(value, param) {\n  return typeof value === 'function' ? value(param) : value;\n}\nfunction getSide(placement) {\n  return placement.split('-')[0];\n}\nfunction getAlignment(placement) {\n  return placement.split('-')[1];\n}\nfunction getOppositeAxis(axis) {\n  return axis === 'x' ? 'y' : 'x';\n}\nfunction getAxisLength(axis) {\n  return axis === 'y' ? 'height' : 'width';\n}\nconst yAxisSides = /*#__PURE__*/new Set(['top', 'bottom']);\nfunction getSideAxis(placement) {\n  return yAxisSides.has(getSide(placement)) ? 'y' : 'x';\n}\nfunction getAlignmentAxis(placement) {\n  return getOppositeAxis(getSideAxis(placement));\n}\nfunction getAlignmentSides(placement, rects, rtl) {\n  if (rtl === void 0) {\n    rtl = false;\n  }\n  const alignment = getAlignment(placement);\n  const alignmentAxis = getAlignmentAxis(placement);\n  const length = getAxisLength(alignmentAxis);\n  let mainAlignmentSide = alignmentAxis === 'x' ? alignment === (rtl ? 'end' : 'start') ? 'right' : 'left' : alignment === 'start' ? 'bottom' : 'top';\n  if (rects.reference[length] > rects.floating[length]) {\n    mainAlignmentSide = getOppositePlacement(mainAlignmentSide);\n  }\n  return [mainAlignmentSide, getOppositePlacement(mainAlignmentSide)];\n}\nfunction getExpandedPlacements(placement) {\n  const oppositePlacement = getOppositePlacement(placement);\n  return [getOppositeAlignmentPlacement(placement), oppositePlacement, getOppositeAlignmentPlacement(oppositePlacement)];\n}\nfunction getOppositeAlignmentPlacement(placement) {\n  return placement.replace(/start|end/g, alignment => oppositeAlignmentMap[alignment]);\n}\nconst lrPlacement = ['left', 'right'];\nconst rlPlacement = ['right', 'left'];\nconst tbPlacement = ['top', 'bottom'];\nconst btPlacement = ['bottom', 'top'];\nfunction getSideList(side, isStart, rtl) {\n  switch (side) {\n    case 'top':\n    case 'bottom':\n      if (rtl) return isStart ? rlPlacement : lrPlacement;\n      return isStart ? lrPlacement : rlPlacement;\n    case 'left':\n    case 'right':\n      return isStart ? tbPlacement : btPlacement;\n    default:\n      return [];\n  }\n}\nfunction getOppositeAxisPlacements(placement, flipAlignment, direction, rtl) {\n  const alignment = getAlignment(placement);\n  let list = getSideList(getSide(placement), direction === 'start', rtl);\n  if (alignment) {\n    list = list.map(side => side + \"-\" + alignment);\n    if (flipAlignment) {\n      list = list.concat(list.map(getOppositeAlignmentPlacement));\n    }\n  }\n  return list;\n}\nfunction getOppositePlacement(placement) {\n  return placement.replace(/left|right|bottom|top/g, side => oppositeSideMap[side]);\n}\nfunction expandPaddingObject(padding) {\n  return {\n    top: 0,\n    right: 0,\n    bottom: 0,\n    left: 0,\n    ...padding\n  };\n}\nfunction getPaddingObject(padding) {\n  return typeof padding !== 'number' ? expandPaddingObject(padding) : {\n    top: padding,\n    right: padding,\n    bottom: padding,\n    left: padding\n  };\n}\nfunction rectToClientRect(rect) {\n  const {\n    x,\n    y,\n    width,\n    height\n  } = rect;\n  return {\n    width,\n    height,\n    top: y,\n    left: x,\n    right: x + width,\n    bottom: y + height,\n    x,\n    y\n  };\n}\n\nexport { alignments, clamp, createCoords, evaluate, expandPaddingObject, floor, getAlignment, getAlignmentAxis, getAlignmentSides, getAxisLength, getExpandedPlacements, getOppositeAlignmentPlacement, getOppositeAxis, getOppositeAxisPlacements, getOppositePlacement, getPaddingObject, getSide, getSideAxis, max, min, placements, rectToClientRect, round, sides };\n", "import { getSideAxis, getAlignmentAxis, getAxisLength, getSide, getAlignment, evaluate, getPaddingObject, rectToClientRect, min, clamp, placements, getAlignmentSides, getOppositeAlignmentPlacement, getOppositePlacement, getExpandedPlacements, getOppositeAxisPlacements, sides, max, getOppositeAxis } from '@floating-ui/utils';\nexport { rectToClientRect } from '@floating-ui/utils';\n\nfunction computeCoordsFromPlacement(_ref, placement, rtl) {\n  let {\n    reference,\n    floating\n  } = _ref;\n  const sideAxis = getSideAxis(placement);\n  const alignmentAxis = getAlignmentAxis(placement);\n  const alignLength = getAxisLength(alignmentAxis);\n  const side = getSide(placement);\n  const isVertical = sideAxis === 'y';\n  const commonX = reference.x + reference.width / 2 - floating.width / 2;\n  const commonY = reference.y + reference.height / 2 - floating.height / 2;\n  const commonAlign = reference[alignLength] / 2 - floating[alignLength] / 2;\n  let coords;\n  switch (side) {\n    case 'top':\n      coords = {\n        x: commonX,\n        y: reference.y - floating.height\n      };\n      break;\n    case 'bottom':\n      coords = {\n        x: commonX,\n        y: reference.y + reference.height\n      };\n      break;\n    case 'right':\n      coords = {\n        x: reference.x + reference.width,\n        y: commonY\n      };\n      break;\n    case 'left':\n      coords = {\n        x: reference.x - floating.width,\n        y: commonY\n      };\n      break;\n    default:\n      coords = {\n        x: reference.x,\n        y: reference.y\n      };\n  }\n  switch (getAlignment(placement)) {\n    case 'start':\n      coords[alignmentAxis] -= commonAlign * (rtl && isVertical ? -1 : 1);\n      break;\n    case 'end':\n      coords[alignmentAxis] += commonAlign * (rtl && isVertical ? -1 : 1);\n      break;\n  }\n  return coords;\n}\n\n/**\n * Computes the `x` and `y` coordinates that will place the floating element\n * next to a given reference element.\n *\n * This export does not have any `platform` interface logic. You will need to\n * write one for the platform you are using Floating UI with.\n */\nconst computePosition = async (reference, floating, config) => {\n  const {\n    placement = 'bottom',\n    strategy = 'absolute',\n    middleware = [],\n    platform\n  } = config;\n  const validMiddleware = middleware.filter(Boolean);\n  const rtl = await (platform.isRTL == null ? void 0 : platform.isRTL(floating));\n  let rects = await platform.getElementRects({\n    reference,\n    floating,\n    strategy\n  });\n  let {\n    x,\n    y\n  } = computeCoordsFromPlacement(rects, placement, rtl);\n  let statefulPlacement = placement;\n  let middlewareData = {};\n  let resetCount = 0;\n  for (let i = 0; i < validMiddleware.length; i++) {\n    const {\n      name,\n      fn\n    } = validMiddleware[i];\n    const {\n      x: nextX,\n      y: nextY,\n      data,\n      reset\n    } = await fn({\n      x,\n      y,\n      initialPlacement: placement,\n      placement: statefulPlacement,\n      strategy,\n      middlewareData,\n      rects,\n      platform,\n      elements: {\n        reference,\n        floating\n      }\n    });\n    x = nextX != null ? nextX : x;\n    y = nextY != null ? nextY : y;\n    middlewareData = {\n      ...middlewareData,\n      [name]: {\n        ...middlewareData[name],\n        ...data\n      }\n    };\n    if (reset && resetCount <= 50) {\n      resetCount++;\n      if (typeof reset === 'object') {\n        if (reset.placement) {\n          statefulPlacement = reset.placement;\n        }\n        if (reset.rects) {\n          rects = reset.rects === true ? await platform.getElementRects({\n            reference,\n            floating,\n            strategy\n          }) : reset.rects;\n        }\n        ({\n          x,\n          y\n        } = computeCoordsFromPlacement(rects, statefulPlacement, rtl));\n      }\n      i = -1;\n    }\n  }\n  return {\n    x,\n    y,\n    placement: statefulPlacement,\n    strategy,\n    middlewareData\n  };\n};\n\n/**\n * Resolves with an object of overflow side offsets that determine how much the\n * element is overflowing a given clipping boundary on each side.\n * - positive = overflowing the boundary by that number of pixels\n * - negative = how many pixels left before it will overflow\n * - 0 = lies flush with the boundary\n * @see https://floating-ui.com/docs/detectOverflow\n */\nasync function detectOverflow(state, options) {\n  var _await$platform$isEle;\n  if (options === void 0) {\n    options = {};\n  }\n  const {\n    x,\n    y,\n    platform,\n    rects,\n    elements,\n    strategy\n  } = state;\n  const {\n    boundary = 'clippingAncestors',\n    rootBoundary = 'viewport',\n    elementContext = 'floating',\n    altBoundary = false,\n    padding = 0\n  } = evaluate(options, state);\n  const paddingObject = getPaddingObject(padding);\n  const altContext = elementContext === 'floating' ? 'reference' : 'floating';\n  const element = elements[altBoundary ? altContext : elementContext];\n  const clippingClientRect = rectToClientRect(await platform.getClippingRect({\n    element: ((_await$platform$isEle = await (platform.isElement == null ? void 0 : platform.isElement(element))) != null ? _await$platform$isEle : true) ? element : element.contextElement || (await (platform.getDocumentElement == null ? void 0 : platform.getDocumentElement(elements.floating))),\n    boundary,\n    rootBoundary,\n    strategy\n  }));\n  const rect = elementContext === 'floating' ? {\n    x,\n    y,\n    width: rects.floating.width,\n    height: rects.floating.height\n  } : rects.reference;\n  const offsetParent = await (platform.getOffsetParent == null ? void 0 : platform.getOffsetParent(elements.floating));\n  const offsetScale = (await (platform.isElement == null ? void 0 : platform.isElement(offsetParent))) ? (await (platform.getScale == null ? void 0 : platform.getScale(offsetParent))) || {\n    x: 1,\n    y: 1\n  } : {\n    x: 1,\n    y: 1\n  };\n  const elementClientRect = rectToClientRect(platform.convertOffsetParentRelativeRectToViewportRelativeRect ? await platform.convertOffsetParentRelativeRectToViewportRelativeRect({\n    elements,\n    rect,\n    offsetParent,\n    strategy\n  }) : rect);\n  return {\n    top: (clippingClientRect.top - elementClientRect.top + paddingObject.top) / offsetScale.y,\n    bottom: (elementClientRect.bottom - clippingClientRect.bottom + paddingObject.bottom) / offsetScale.y,\n    left: (clippingClientRect.left - elementClientRect.left + paddingObject.left) / offsetScale.x,\n    right: (elementClientRect.right - clippingClientRect.right + paddingObject.right) / offsetScale.x\n  };\n}\n\n/**\n * Provides data to position an inner element of the floating element so that it\n * appears centered to the reference element.\n * @see https://floating-ui.com/docs/arrow\n */\nconst arrow = options => ({\n  name: 'arrow',\n  options,\n  async fn(state) {\n    const {\n      x,\n      y,\n      placement,\n      rects,\n      platform,\n      elements,\n      middlewareData\n    } = state;\n    // Since `element` is required, we don't Partial<> the type.\n    const {\n      element,\n      padding = 0\n    } = evaluate(options, state) || {};\n    if (element == null) {\n      return {};\n    }\n    const paddingObject = getPaddingObject(padding);\n    const coords = {\n      x,\n      y\n    };\n    const axis = getAlignmentAxis(placement);\n    const length = getAxisLength(axis);\n    const arrowDimensions = await platform.getDimensions(element);\n    const isYAxis = axis === 'y';\n    const minProp = isYAxis ? 'top' : 'left';\n    const maxProp = isYAxis ? 'bottom' : 'right';\n    const clientProp = isYAxis ? 'clientHeight' : 'clientWidth';\n    const endDiff = rects.reference[length] + rects.reference[axis] - coords[axis] - rects.floating[length];\n    const startDiff = coords[axis] - rects.reference[axis];\n    const arrowOffsetParent = await (platform.getOffsetParent == null ? void 0 : platform.getOffsetParent(element));\n    let clientSize = arrowOffsetParent ? arrowOffsetParent[clientProp] : 0;\n\n    // DOM platform can return `window` as the `offsetParent`.\n    if (!clientSize || !(await (platform.isElement == null ? void 0 : platform.isElement(arrowOffsetParent)))) {\n      clientSize = elements.floating[clientProp] || rects.floating[length];\n    }\n    const centerToReference = endDiff / 2 - startDiff / 2;\n\n    // If the padding is large enough that it causes the arrow to no longer be\n    // centered, modify the padding so that it is centered.\n    const largestPossiblePadding = clientSize / 2 - arrowDimensions[length] / 2 - 1;\n    const minPadding = min(paddingObject[minProp], largestPossiblePadding);\n    const maxPadding = min(paddingObject[maxProp], largestPossiblePadding);\n\n    // Make sure the arrow doesn't overflow the floating element if the center\n    // point is outside the floating element's bounds.\n    const min$1 = minPadding;\n    const max = clientSize - arrowDimensions[length] - maxPadding;\n    const center = clientSize / 2 - arrowDimensions[length] / 2 + centerToReference;\n    const offset = clamp(min$1, center, max);\n\n    // If the reference is small enough that the arrow's padding causes it to\n    // to point to nothing for an aligned placement, adjust the offset of the\n    // floating element itself. To ensure `shift()` continues to take action,\n    // a single reset is performed when this is true.\n    const shouldAddOffset = !middlewareData.arrow && getAlignment(placement) != null && center !== offset && rects.reference[length] / 2 - (center < min$1 ? minPadding : maxPadding) - arrowDimensions[length] / 2 < 0;\n    const alignmentOffset = shouldAddOffset ? center < min$1 ? center - min$1 : center - max : 0;\n    return {\n      [axis]: coords[axis] + alignmentOffset,\n      data: {\n        [axis]: offset,\n        centerOffset: center - offset - alignmentOffset,\n        ...(shouldAddOffset && {\n          alignmentOffset\n        })\n      },\n      reset: shouldAddOffset\n    };\n  }\n});\n\nfunction getPlacementList(alignment, autoAlignment, allowedPlacements) {\n  const allowedPlacementsSortedByAlignment = alignment ? [...allowedPlacements.filter(placement => getAlignment(placement) === alignment), ...allowedPlacements.filter(placement => getAlignment(placement) !== alignment)] : allowedPlacements.filter(placement => getSide(placement) === placement);\n  return allowedPlacementsSortedByAlignment.filter(placement => {\n    if (alignment) {\n      return getAlignment(placement) === alignment || (autoAlignment ? getOppositeAlignmentPlacement(placement) !== placement : false);\n    }\n    return true;\n  });\n}\n/**\n * Optimizes the visibility of the floating element by choosing the placement\n * that has the most space available automatically, without needing to specify a\n * preferred placement. Alternative to `flip`.\n * @see https://floating-ui.com/docs/autoPlacement\n */\nconst autoPlacement = function (options) {\n  if (options === void 0) {\n    options = {};\n  }\n  return {\n    name: 'autoPlacement',\n    options,\n    async fn(state) {\n      var _middlewareData$autoP, _middlewareData$autoP2, _placementsThatFitOnE;\n      const {\n        rects,\n        middlewareData,\n        placement,\n        platform,\n        elements\n      } = state;\n      const {\n        crossAxis = false,\n        alignment,\n        allowedPlacements = placements,\n        autoAlignment = true,\n        ...detectOverflowOptions\n      } = evaluate(options, state);\n      const placements$1 = alignment !== undefined || allowedPlacements === placements ? getPlacementList(alignment || null, autoAlignment, allowedPlacements) : allowedPlacements;\n      const overflow = await detectOverflow(state, detectOverflowOptions);\n      const currentIndex = ((_middlewareData$autoP = middlewareData.autoPlacement) == null ? void 0 : _middlewareData$autoP.index) || 0;\n      const currentPlacement = placements$1[currentIndex];\n      if (currentPlacement == null) {\n        return {};\n      }\n      const alignmentSides = getAlignmentSides(currentPlacement, rects, await (platform.isRTL == null ? void 0 : platform.isRTL(elements.floating)));\n\n      // Make `computeCoords` start from the right place.\n      if (placement !== currentPlacement) {\n        return {\n          reset: {\n            placement: placements$1[0]\n          }\n        };\n      }\n      const currentOverflows = [overflow[getSide(currentPlacement)], overflow[alignmentSides[0]], overflow[alignmentSides[1]]];\n      const allOverflows = [...(((_middlewareData$autoP2 = middlewareData.autoPlacement) == null ? void 0 : _middlewareData$autoP2.overflows) || []), {\n        placement: currentPlacement,\n        overflows: currentOverflows\n      }];\n      const nextPlacement = placements$1[currentIndex + 1];\n\n      // There are more placements to check.\n      if (nextPlacement) {\n        return {\n          data: {\n            index: currentIndex + 1,\n            overflows: allOverflows\n          },\n          reset: {\n            placement: nextPlacement\n          }\n        };\n      }\n      const placementsSortedByMostSpace = allOverflows.map(d => {\n        const alignment = getAlignment(d.placement);\n        return [d.placement, alignment && crossAxis ?\n        // Check along the mainAxis and main crossAxis side.\n        d.overflows.slice(0, 2).reduce((acc, v) => acc + v, 0) :\n        // Check only the mainAxis.\n        d.overflows[0], d.overflows];\n      }).sort((a, b) => a[1] - b[1]);\n      const placementsThatFitOnEachSide = placementsSortedByMostSpace.filter(d => d[2].slice(0,\n      // Aligned placements should not check their opposite crossAxis\n      // side.\n      getAlignment(d[0]) ? 2 : 3).every(v => v <= 0));\n      const resetPlacement = ((_placementsThatFitOnE = placementsThatFitOnEachSide[0]) == null ? void 0 : _placementsThatFitOnE[0]) || placementsSortedByMostSpace[0][0];\n      if (resetPlacement !== placement) {\n        return {\n          data: {\n            index: currentIndex + 1,\n            overflows: allOverflows\n          },\n          reset: {\n            placement: resetPlacement\n          }\n        };\n      }\n      return {};\n    }\n  };\n};\n\n/**\n * Optimizes the visibility of the floating element by flipping the `placement`\n * in order to keep it in view when the preferred placement(s) will overflow the\n * clipping boundary. Alternative to `autoPlacement`.\n * @see https://floating-ui.com/docs/flip\n */\nconst flip = function (options) {\n  if (options === void 0) {\n    options = {};\n  }\n  return {\n    name: 'flip',\n    options,\n    async fn(state) {\n      var _middlewareData$arrow, _middlewareData$flip;\n      const {\n        placement,\n        middlewareData,\n        rects,\n        initialPlacement,\n        platform,\n        elements\n      } = state;\n      const {\n        mainAxis: checkMainAxis = true,\n        crossAxis: checkCrossAxis = true,\n        fallbackPlacements: specifiedFallbackPlacements,\n        fallbackStrategy = 'bestFit',\n        fallbackAxisSideDirection = 'none',\n        flipAlignment = true,\n        ...detectOverflowOptions\n      } = evaluate(options, state);\n\n      // If a reset by the arrow was caused due to an alignment offset being\n      // added, we should skip any logic now since `flip()` has already done its\n      // work.\n      // https://github.com/floating-ui/floating-ui/issues/2549#issuecomment-1719601643\n      if ((_middlewareData$arrow = middlewareData.arrow) != null && _middlewareData$arrow.alignmentOffset) {\n        return {};\n      }\n      const side = getSide(placement);\n      const initialSideAxis = getSideAxis(initialPlacement);\n      const isBasePlacement = getSide(initialPlacement) === initialPlacement;\n      const rtl = await (platform.isRTL == null ? void 0 : platform.isRTL(elements.floating));\n      const fallbackPlacements = specifiedFallbackPlacements || (isBasePlacement || !flipAlignment ? [getOppositePlacement(initialPlacement)] : getExpandedPlacements(initialPlacement));\n      const hasFallbackAxisSideDirection = fallbackAxisSideDirection !== 'none';\n      if (!specifiedFallbackPlacements && hasFallbackAxisSideDirection) {\n        fallbackPlacements.push(...getOppositeAxisPlacements(initialPlacement, flipAlignment, fallbackAxisSideDirection, rtl));\n      }\n      const placements = [initialPlacement, ...fallbackPlacements];\n      const overflow = await detectOverflow(state, detectOverflowOptions);\n      const overflows = [];\n      let overflowsData = ((_middlewareData$flip = middlewareData.flip) == null ? void 0 : _middlewareData$flip.overflows) || [];\n      if (checkMainAxis) {\n        overflows.push(overflow[side]);\n      }\n      if (checkCrossAxis) {\n        const sides = getAlignmentSides(placement, rects, rtl);\n        overflows.push(overflow[sides[0]], overflow[sides[1]]);\n      }\n      overflowsData = [...overflowsData, {\n        placement,\n        overflows\n      }];\n\n      // One or more sides is overflowing.\n      if (!overflows.every(side => side <= 0)) {\n        var _middlewareData$flip2, _overflowsData$filter;\n        const nextIndex = (((_middlewareData$flip2 = middlewareData.flip) == null ? void 0 : _middlewareData$flip2.index) || 0) + 1;\n        const nextPlacement = placements[nextIndex];\n        if (nextPlacement) {\n          const ignoreCrossAxisOverflow = checkCrossAxis === 'alignment' ? initialSideAxis !== getSideAxis(nextPlacement) : false;\n          if (!ignoreCrossAxisOverflow ||\n          // We leave the current main axis only if every placement on that axis\n          // overflows the main axis.\n          overflowsData.every(d => getSideAxis(d.placement) === initialSideAxis ? d.overflows[0] > 0 : true)) {\n            // Try next placement and re-run the lifecycle.\n            return {\n              data: {\n                index: nextIndex,\n                overflows: overflowsData\n              },\n              reset: {\n                placement: nextPlacement\n              }\n            };\n          }\n        }\n\n        // First, find the candidates that fit on the mainAxis side of overflow,\n        // then find the placement that fits the best on the main crossAxis side.\n        let resetPlacement = (_overflowsData$filter = overflowsData.filter(d => d.overflows[0] <= 0).sort((a, b) => a.overflows[1] - b.overflows[1])[0]) == null ? void 0 : _overflowsData$filter.placement;\n\n        // Otherwise fallback.\n        if (!resetPlacement) {\n          switch (fallbackStrategy) {\n            case 'bestFit':\n              {\n                var _overflowsData$filter2;\n                const placement = (_overflowsData$filter2 = overflowsData.filter(d => {\n                  if (hasFallbackAxisSideDirection) {\n                    const currentSideAxis = getSideAxis(d.placement);\n                    return currentSideAxis === initialSideAxis ||\n                    // Create a bias to the `y` side axis due to horizontal\n                    // reading directions favoring greater width.\n                    currentSideAxis === 'y';\n                  }\n                  return true;\n                }).map(d => [d.placement, d.overflows.filter(overflow => overflow > 0).reduce((acc, overflow) => acc + overflow, 0)]).sort((a, b) => a[1] - b[1])[0]) == null ? void 0 : _overflowsData$filter2[0];\n                if (placement) {\n                  resetPlacement = placement;\n                }\n                break;\n              }\n            case 'initialPlacement':\n              resetPlacement = initialPlacement;\n              break;\n          }\n        }\n        if (placement !== resetPlacement) {\n          return {\n            reset: {\n              placement: resetPlacement\n            }\n          };\n        }\n      }\n      return {};\n    }\n  };\n};\n\nfunction getSideOffsets(overflow, rect) {\n  return {\n    top: overflow.top - rect.height,\n    right: overflow.right - rect.width,\n    bottom: overflow.bottom - rect.height,\n    left: overflow.left - rect.width\n  };\n}\nfunction isAnySideFullyClipped(overflow) {\n  return sides.some(side => overflow[side] >= 0);\n}\n/**\n * Provides data to hide the floating element in applicable situations, such as\n * when it is not in the same clipping context as the reference element.\n * @see https://floating-ui.com/docs/hide\n */\nconst hide = function (options) {\n  if (options === void 0) {\n    options = {};\n  }\n  return {\n    name: 'hide',\n    options,\n    async fn(state) {\n      const {\n        rects\n      } = state;\n      const {\n        strategy = 'referenceHidden',\n        ...detectOverflowOptions\n      } = evaluate(options, state);\n      switch (strategy) {\n        case 'referenceHidden':\n          {\n            const overflow = await detectOverflow(state, {\n              ...detectOverflowOptions,\n              elementContext: 'reference'\n            });\n            const offsets = getSideOffsets(overflow, rects.reference);\n            return {\n              data: {\n                referenceHiddenOffsets: offsets,\n                referenceHidden: isAnySideFullyClipped(offsets)\n              }\n            };\n          }\n        case 'escaped':\n          {\n            const overflow = await detectOverflow(state, {\n              ...detectOverflowOptions,\n              altBoundary: true\n            });\n            const offsets = getSideOffsets(overflow, rects.floating);\n            return {\n              data: {\n                escapedOffsets: offsets,\n                escaped: isAnySideFullyClipped(offsets)\n              }\n            };\n          }\n        default:\n          {\n            return {};\n          }\n      }\n    }\n  };\n};\n\nfunction getBoundingRect(rects) {\n  const minX = min(...rects.map(rect => rect.left));\n  const minY = min(...rects.map(rect => rect.top));\n  const maxX = max(...rects.map(rect => rect.right));\n  const maxY = max(...rects.map(rect => rect.bottom));\n  return {\n    x: minX,\n    y: minY,\n    width: maxX - minX,\n    height: maxY - minY\n  };\n}\nfunction getRectsByLine(rects) {\n  const sortedRects = rects.slice().sort((a, b) => a.y - b.y);\n  const groups = [];\n  let prevRect = null;\n  for (let i = 0; i < sortedRects.length; i++) {\n    const rect = sortedRects[i];\n    if (!prevRect || rect.y - prevRect.y > prevRect.height / 2) {\n      groups.push([rect]);\n    } else {\n      groups[groups.length - 1].push(rect);\n    }\n    prevRect = rect;\n  }\n  return groups.map(rect => rectToClientRect(getBoundingRect(rect)));\n}\n/**\n * Provides improved positioning for inline reference elements that can span\n * over multiple lines, such as hyperlinks or range selections.\n * @see https://floating-ui.com/docs/inline\n */\nconst inline = function (options) {\n  if (options === void 0) {\n    options = {};\n  }\n  return {\n    name: 'inline',\n    options,\n    async fn(state) {\n      const {\n        placement,\n        elements,\n        rects,\n        platform,\n        strategy\n      } = state;\n      // A MouseEvent's client{X,Y} coords can be up to 2 pixels off a\n      // ClientRect's bounds, despite the event listener being triggered. A\n      // padding of 2 seems to handle this issue.\n      const {\n        padding = 2,\n        x,\n        y\n      } = evaluate(options, state);\n      const nativeClientRects = Array.from((await (platform.getClientRects == null ? void 0 : platform.getClientRects(elements.reference))) || []);\n      const clientRects = getRectsByLine(nativeClientRects);\n      const fallback = rectToClientRect(getBoundingRect(nativeClientRects));\n      const paddingObject = getPaddingObject(padding);\n      function getBoundingClientRect() {\n        // There are two rects and they are disjoined.\n        if (clientRects.length === 2 && clientRects[0].left > clientRects[1].right && x != null && y != null) {\n          // Find the first rect in which the point is fully inside.\n          return clientRects.find(rect => x > rect.left - paddingObject.left && x < rect.right + paddingObject.right && y > rect.top - paddingObject.top && y < rect.bottom + paddingObject.bottom) || fallback;\n        }\n\n        // There are 2 or more connected rects.\n        if (clientRects.length >= 2) {\n          if (getSideAxis(placement) === 'y') {\n            const firstRect = clientRects[0];\n            const lastRect = clientRects[clientRects.length - 1];\n            const isTop = getSide(placement) === 'top';\n            const top = firstRect.top;\n            const bottom = lastRect.bottom;\n            const left = isTop ? firstRect.left : lastRect.left;\n            const right = isTop ? firstRect.right : lastRect.right;\n            const width = right - left;\n            const height = bottom - top;\n            return {\n              top,\n              bottom,\n              left,\n              right,\n              width,\n              height,\n              x: left,\n              y: top\n            };\n          }\n          const isLeftSide = getSide(placement) === 'left';\n          const maxRight = max(...clientRects.map(rect => rect.right));\n          const minLeft = min(...clientRects.map(rect => rect.left));\n          const measureRects = clientRects.filter(rect => isLeftSide ? rect.left === minLeft : rect.right === maxRight);\n          const top = measureRects[0].top;\n          const bottom = measureRects[measureRects.length - 1].bottom;\n          const left = minLeft;\n          const right = maxRight;\n          const width = right - left;\n          const height = bottom - top;\n          return {\n            top,\n            bottom,\n            left,\n            right,\n            width,\n            height,\n            x: left,\n            y: top\n          };\n        }\n        return fallback;\n      }\n      const resetRects = await platform.getElementRects({\n        reference: {\n          getBoundingClientRect\n        },\n        floating: elements.floating,\n        strategy\n      });\n      if (rects.reference.x !== resetRects.reference.x || rects.reference.y !== resetRects.reference.y || rects.reference.width !== resetRects.reference.width || rects.reference.height !== resetRects.reference.height) {\n        return {\n          reset: {\n            rects: resetRects\n          }\n        };\n      }\n      return {};\n    }\n  };\n};\n\nconst originSides = /*#__PURE__*/new Set(['left', 'top']);\n\n// For type backwards-compatibility, the `OffsetOptions` type was also\n// Derivable.\n\nasync function convertValueToCoords(state, options) {\n  const {\n    placement,\n    platform,\n    elements\n  } = state;\n  const rtl = await (platform.isRTL == null ? void 0 : platform.isRTL(elements.floating));\n  const side = getSide(placement);\n  const alignment = getAlignment(placement);\n  const isVertical = getSideAxis(placement) === 'y';\n  const mainAxisMulti = originSides.has(side) ? -1 : 1;\n  const crossAxisMulti = rtl && isVertical ? -1 : 1;\n  const rawValue = evaluate(options, state);\n\n  // eslint-disable-next-line prefer-const\n  let {\n    mainAxis,\n    crossAxis,\n    alignmentAxis\n  } = typeof rawValue === 'number' ? {\n    mainAxis: rawValue,\n    crossAxis: 0,\n    alignmentAxis: null\n  } : {\n    mainAxis: rawValue.mainAxis || 0,\n    crossAxis: rawValue.crossAxis || 0,\n    alignmentAxis: rawValue.alignmentAxis\n  };\n  if (alignment && typeof alignmentAxis === 'number') {\n    crossAxis = alignment === 'end' ? alignmentAxis * -1 : alignmentAxis;\n  }\n  return isVertical ? {\n    x: crossAxis * crossAxisMulti,\n    y: mainAxis * mainAxisMulti\n  } : {\n    x: mainAxis * mainAxisMulti,\n    y: crossAxis * crossAxisMulti\n  };\n}\n\n/**\n * Modifies the placement by translating the floating element along the\n * specified axes.\n * A number (shorthand for `mainAxis` or distance), or an axes configuration\n * object may be passed.\n * @see https://floating-ui.com/docs/offset\n */\nconst offset = function (options) {\n  if (options === void 0) {\n    options = 0;\n  }\n  return {\n    name: 'offset',\n    options,\n    async fn(state) {\n      var _middlewareData$offse, _middlewareData$arrow;\n      const {\n        x,\n        y,\n        placement,\n        middlewareData\n      } = state;\n      const diffCoords = await convertValueToCoords(state, options);\n\n      // If the placement is the same and the arrow caused an alignment offset\n      // then we don't need to change the positioning coordinates.\n      if (placement === ((_middlewareData$offse = middlewareData.offset) == null ? void 0 : _middlewareData$offse.placement) && (_middlewareData$arrow = middlewareData.arrow) != null && _middlewareData$arrow.alignmentOffset) {\n        return {};\n      }\n      return {\n        x: x + diffCoords.x,\n        y: y + diffCoords.y,\n        data: {\n          ...diffCoords,\n          placement\n        }\n      };\n    }\n  };\n};\n\n/**\n * Optimizes the visibility of the floating element by shifting it in order to\n * keep it in view when it will overflow the clipping boundary.\n * @see https://floating-ui.com/docs/shift\n */\nconst shift = function (options) {\n  if (options === void 0) {\n    options = {};\n  }\n  return {\n    name: 'shift',\n    options,\n    async fn(state) {\n      const {\n        x,\n        y,\n        placement\n      } = state;\n      const {\n        mainAxis: checkMainAxis = true,\n        crossAxis: checkCrossAxis = false,\n        limiter = {\n          fn: _ref => {\n            let {\n              x,\n              y\n            } = _ref;\n            return {\n              x,\n              y\n            };\n          }\n        },\n        ...detectOverflowOptions\n      } = evaluate(options, state);\n      const coords = {\n        x,\n        y\n      };\n      const overflow = await detectOverflow(state, detectOverflowOptions);\n      const crossAxis = getSideAxis(getSide(placement));\n      const mainAxis = getOppositeAxis(crossAxis);\n      let mainAxisCoord = coords[mainAxis];\n      let crossAxisCoord = coords[crossAxis];\n      if (checkMainAxis) {\n        const minSide = mainAxis === 'y' ? 'top' : 'left';\n        const maxSide = mainAxis === 'y' ? 'bottom' : 'right';\n        const min = mainAxisCoord + overflow[minSide];\n        const max = mainAxisCoord - overflow[maxSide];\n        mainAxisCoord = clamp(min, mainAxisCoord, max);\n      }\n      if (checkCrossAxis) {\n        const minSide = crossAxis === 'y' ? 'top' : 'left';\n        const maxSide = crossAxis === 'y' ? 'bottom' : 'right';\n        const min = crossAxisCoord + overflow[minSide];\n        const max = crossAxisCoord - overflow[maxSide];\n        crossAxisCoord = clamp(min, crossAxisCoord, max);\n      }\n      const limitedCoords = limiter.fn({\n        ...state,\n        [mainAxis]: mainAxisCoord,\n        [crossAxis]: crossAxisCoord\n      });\n      return {\n        ...limitedCoords,\n        data: {\n          x: limitedCoords.x - x,\n          y: limitedCoords.y - y,\n          enabled: {\n            [mainAxis]: checkMainAxis,\n            [crossAxis]: checkCrossAxis\n          }\n        }\n      };\n    }\n  };\n};\n/**\n * Built-in `limiter` that will stop `shift()` at a certain point.\n */\nconst limitShift = function (options) {\n  if (options === void 0) {\n    options = {};\n  }\n  return {\n    options,\n    fn(state) {\n      const {\n        x,\n        y,\n        placement,\n        rects,\n        middlewareData\n      } = state;\n      const {\n        offset = 0,\n        mainAxis: checkMainAxis = true,\n        crossAxis: checkCrossAxis = true\n      } = evaluate(options, state);\n      const coords = {\n        x,\n        y\n      };\n      const crossAxis = getSideAxis(placement);\n      const mainAxis = getOppositeAxis(crossAxis);\n      let mainAxisCoord = coords[mainAxis];\n      let crossAxisCoord = coords[crossAxis];\n      const rawOffset = evaluate(offset, state);\n      const computedOffset = typeof rawOffset === 'number' ? {\n        mainAxis: rawOffset,\n        crossAxis: 0\n      } : {\n        mainAxis: 0,\n        crossAxis: 0,\n        ...rawOffset\n      };\n      if (checkMainAxis) {\n        const len = mainAxis === 'y' ? 'height' : 'width';\n        const limitMin = rects.reference[mainAxis] - rects.floating[len] + computedOffset.mainAxis;\n        const limitMax = rects.reference[mainAxis] + rects.reference[len] - computedOffset.mainAxis;\n        if (mainAxisCoord < limitMin) {\n          mainAxisCoord = limitMin;\n        } else if (mainAxisCoord > limitMax) {\n          mainAxisCoord = limitMax;\n        }\n      }\n      if (checkCrossAxis) {\n        var _middlewareData$offse, _middlewareData$offse2;\n        const len = mainAxis === 'y' ? 'width' : 'height';\n        const isOriginSide = originSides.has(getSide(placement));\n        const limitMin = rects.reference[crossAxis] - rects.floating[len] + (isOriginSide ? ((_middlewareData$offse = middlewareData.offset) == null ? void 0 : _middlewareData$offse[crossAxis]) || 0 : 0) + (isOriginSide ? 0 : computedOffset.crossAxis);\n        const limitMax = rects.reference[crossAxis] + rects.reference[len] + (isOriginSide ? 0 : ((_middlewareData$offse2 = middlewareData.offset) == null ? void 0 : _middlewareData$offse2[crossAxis]) || 0) - (isOriginSide ? computedOffset.crossAxis : 0);\n        if (crossAxisCoord < limitMin) {\n          crossAxisCoord = limitMin;\n        } else if (crossAxisCoord > limitMax) {\n          crossAxisCoord = limitMax;\n        }\n      }\n      return {\n        [mainAxis]: mainAxisCoord,\n        [crossAxis]: crossAxisCoord\n      };\n    }\n  };\n};\n\n/**\n * Provides data that allows you to change the size of the floating element \u2014\n * for instance, prevent it from overflowing the clipping boundary or match the\n * width of the reference element.\n * @see https://floating-ui.com/docs/size\n */\nconst size = function (options) {\n  if (options === void 0) {\n    options = {};\n  }\n  return {\n    name: 'size',\n    options,\n    async fn(state) {\n      var _state$middlewareData, _state$middlewareData2;\n      const {\n        placement,\n        rects,\n        platform,\n        elements\n      } = state;\n      const {\n        apply = () => {},\n        ...detectOverflowOptions\n      } = evaluate(options, state);\n      const overflow = await detectOverflow(state, detectOverflowOptions);\n      const side = getSide(placement);\n      const alignment = getAlignment(placement);\n      const isYAxis = getSideAxis(placement) === 'y';\n      const {\n        width,\n        height\n      } = rects.floating;\n      let heightSide;\n      let widthSide;\n      if (side === 'top' || side === 'bottom') {\n        heightSide = side;\n        widthSide = alignment === ((await (platform.isRTL == null ? void 0 : platform.isRTL(elements.floating))) ? 'start' : 'end') ? 'left' : 'right';\n      } else {\n        widthSide = side;\n        heightSide = alignment === 'end' ? 'top' : 'bottom';\n      }\n      const maximumClippingHeight = height - overflow.top - overflow.bottom;\n      const maximumClippingWidth = width - overflow.left - overflow.right;\n      const overflowAvailableHeight = min(height - overflow[heightSide], maximumClippingHeight);\n      const overflowAvailableWidth = min(width - overflow[widthSide], maximumClippingWidth);\n      const noShift = !state.middlewareData.shift;\n      let availableHeight = overflowAvailableHeight;\n      let availableWidth = overflowAvailableWidth;\n      if ((_state$middlewareData = state.middlewareData.shift) != null && _state$middlewareData.enabled.x) {\n        availableWidth = maximumClippingWidth;\n      }\n      if ((_state$middlewareData2 = state.middlewareData.shift) != null && _state$middlewareData2.enabled.y) {\n        availableHeight = maximumClippingHeight;\n      }\n      if (noShift && !alignment) {\n        const xMin = max(overflow.left, 0);\n        const xMax = max(overflow.right, 0);\n        const yMin = max(overflow.top, 0);\n        const yMax = max(overflow.bottom, 0);\n        if (isYAxis) {\n          availableWidth = width - 2 * (xMin !== 0 || xMax !== 0 ? xMin + xMax : max(overflow.left, overflow.right));\n        } else {\n          availableHeight = height - 2 * (yMin !== 0 || yMax !== 0 ? yMin + yMax : max(overflow.top, overflow.bottom));\n        }\n      }\n      await apply({\n        ...state,\n        availableWidth,\n        availableHeight\n      });\n      const nextDimensions = await platform.getDimensions(elements.floating);\n      if (width !== nextDimensions.width || height !== nextDimensions.height) {\n        return {\n          reset: {\n            rects: true\n          }\n        };\n      }\n      return {};\n    }\n  };\n};\n\nexport { arrow, autoPlacement, computePosition, detectOverflow, flip, hide, inline, limitShift, offset, shift, size };\n", "function hasWindow() {\n  return typeof window !== 'undefined';\n}\nfunction getNodeName(node) {\n  if (isNode(node)) {\n    return (node.nodeName || '').toLowerCase();\n  }\n  // Mocked nodes in testing environments may not be instances of Node. By\n  // returning `#document` an infinite loop won't occur.\n  // https://github.com/floating-ui/floating-ui/issues/2317\n  return '#document';\n}\nfunction getWindow(node) {\n  var _node$ownerDocument;\n  return (node == null || (_node$ownerDocument = node.ownerDocument) == null ? void 0 : _node$ownerDocument.defaultView) || window;\n}\nfunction getDocumentElement(node) {\n  var _ref;\n  return (_ref = (isNode(node) ? node.ownerDocument : node.document) || window.document) == null ? void 0 : _ref.documentElement;\n}\nfunction isNode(value) {\n  if (!hasWindow()) {\n    return false;\n  }\n  return value instanceof Node || value instanceof getWindow(value).Node;\n}\nfunction isElement(value) {\n  if (!hasWindow()) {\n    return false;\n  }\n  return value instanceof Element || value instanceof getWindow(value).Element;\n}\nfunction isHTMLElement(value) {\n  if (!hasWindow()) {\n    return false;\n  }\n  return value instanceof HTMLElement || value instanceof getWindow(value).HTMLElement;\n}\nfunction isShadowRoot(value) {\n  if (!hasWindow() || typeof ShadowRoot === 'undefined') {\n    return false;\n  }\n  return value instanceof ShadowRoot || value instanceof getWindow(value).ShadowRoot;\n}\nconst invalidOverflowDisplayValues = /*#__PURE__*/new Set(['inline', 'contents']);\nfunction isOverflowElement(element) {\n  const {\n    overflow,\n    overflowX,\n    overflowY,\n    display\n  } = getComputedStyle(element);\n  return /auto|scroll|overlay|hidden|clip/.test(overflow + overflowY + overflowX) && !invalidOverflowDisplayValues.has(display);\n}\nconst tableElements = /*#__PURE__*/new Set(['table', 'td', 'th']);\nfunction isTableElement(element) {\n  return tableElements.has(getNodeName(element));\n}\nconst topLayerSelectors = [':popover-open', ':modal'];\nfunction isTopLayer(element) {\n  return topLayerSelectors.some(selector => {\n    try {\n      return element.matches(selector);\n    } catch (_e) {\n      return false;\n    }\n  });\n}\nconst transformProperties = ['transform', 'translate', 'scale', 'rotate', 'perspective'];\nconst willChangeValues = ['transform', 'translate', 'scale', 'rotate', 'perspective', 'filter'];\nconst containValues = ['paint', 'layout', 'strict', 'content'];\nfunction isContainingBlock(elementOrCss) {\n  const webkit = isWebKit();\n  const css = isElement(elementOrCss) ? getComputedStyle(elementOrCss) : elementOrCss;\n\n  // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block\n  // https://drafts.csswg.org/css-transforms-2/#individual-transforms\n  return transformProperties.some(value => css[value] ? css[value] !== 'none' : false) || (css.containerType ? css.containerType !== 'normal' : false) || !webkit && (css.backdropFilter ? css.backdropFilter !== 'none' : false) || !webkit && (css.filter ? css.filter !== 'none' : false) || willChangeValues.some(value => (css.willChange || '').includes(value)) || containValues.some(value => (css.contain || '').includes(value));\n}\nfunction getContainingBlock(element) {\n  let currentNode = getParentNode(element);\n  while (isHTMLElement(currentNode) && !isLastTraversableNode(currentNode)) {\n    if (isContainingBlock(currentNode)) {\n      return currentNode;\n    } else if (isTopLayer(currentNode)) {\n      return null;\n    }\n    currentNode = getParentNode(currentNode);\n  }\n  return null;\n}\nfunction isWebKit() {\n  if (typeof CSS === 'undefined' || !CSS.supports) return false;\n  return CSS.supports('-webkit-backdrop-filter', 'none');\n}\nconst lastTraversableNodeNames = /*#__PURE__*/new Set(['html', 'body', '#document']);\nfunction isLastTraversableNode(node) {\n  return lastTraversableNodeNames.has(getNodeName(node));\n}\nfunction getComputedStyle(element) {\n  return getWindow(element).getComputedStyle(element);\n}\nfunction getNodeScroll(element) {\n  if (isElement(element)) {\n    return {\n      scrollLeft: element.scrollLeft,\n      scrollTop: element.scrollTop\n    };\n  }\n  return {\n    scrollLeft: element.scrollX,\n    scrollTop: element.scrollY\n  };\n}\nfunction getParentNode(node) {\n  if (getNodeName(node) === 'html') {\n    return node;\n  }\n  const result =\n  // Step into the shadow DOM of the parent of a slotted node.\n  node.assignedSlot ||\n  // DOM Element detected.\n  node.parentNode ||\n  // ShadowRoot detected.\n  isShadowRoot(node) && node.host ||\n  // Fallback.\n  getDocumentElement(node);\n  return isShadowRoot(result) ? result.host : result;\n}\nfunction getNearestOverflowAncestor(node) {\n  const parentNode = getParentNode(node);\n  if (isLastTraversableNode(parentNode)) {\n    return node.ownerDocument ? node.ownerDocument.body : node.body;\n  }\n  if (isHTMLElement(parentNode) && isOverflowElement(parentNode)) {\n    return parentNode;\n  }\n  return getNearestOverflowAncestor(parentNode);\n}\nfunction getOverflowAncestors(node, list, traverseIframes) {\n  var _node$ownerDocument2;\n  if (list === void 0) {\n    list = [];\n  }\n  if (traverseIframes === void 0) {\n    traverseIframes = true;\n  }\n  const scrollableAncestor = getNearestOverflowAncestor(node);\n  const isBody = scrollableAncestor === ((_node$ownerDocument2 = node.ownerDocument) == null ? void 0 : _node$ownerDocument2.body);\n  const win = getWindow(scrollableAncestor);\n  if (isBody) {\n    const frameElement = getFrameElement(win);\n    return list.concat(win, win.visualViewport || [], isOverflowElement(scrollableAncestor) ? scrollableAncestor : [], frameElement && traverseIframes ? getOverflowAncestors(frameElement) : []);\n  }\n  return list.concat(scrollableAncestor, getOverflowAncestors(scrollableAncestor, [], traverseIframes));\n}\nfunction getFrameElement(win) {\n  return win.parent && Object.getPrototypeOf(win.parent) ? win.frameElement : null;\n}\n\nexport { getComputedStyle, getContainingBlock, getDocumentElement, getFrameElement, getNearestOverflowAncestor, getNodeName, getNodeScroll, getOverflowAncestors, getParentNode, getWindow, isContainingBlock, isElement, isHTMLElement, isLastTraversableNode, isNode, isOverflowElement, isShadowRoot, isTableElement, isTopLayer, isWebKit };\n", "import { rectToClientRect, detectOverflow as detectOverflow$1, offset as offset$1, autoPlacement as autoPlacement$1, shift as shift$1, flip as flip$1, size as size$1, hide as hide$1, arrow as arrow$1, inline as inline$1, limitShift as limitShift$1, computePosition as computePosition$1 } from '@floating-ui/core';\nimport { round, createCoords, max, min, floor } from '@floating-ui/utils';\nimport { getComputedStyle, isHTMLElement, isElement, getWindow, isWebKit, getFrameElement, getNodeScroll, getDocumentElement, isTopLayer, getNodeName, isOverflowElement, getOverflowAncestors, getParentNode, isLastTraversableNode, isContainingBlock, isTableElement, getContainingBlock } from '@floating-ui/utils/dom';\nexport { getOverflowAncestors } from '@floating-ui/utils/dom';\n\nfunction getCssDimensions(element) {\n  const css = getComputedStyle(element);\n  // In testing environments, the `width` and `height` properties are empty\n  // strings for SVG elements, returning NaN. Fallback to `0` in this case.\n  let width = parseFloat(css.width) || 0;\n  let height = parseFloat(css.height) || 0;\n  const hasOffset = isHTMLElement(element);\n  const offsetWidth = hasOffset ? element.offsetWidth : width;\n  const offsetHeight = hasOffset ? element.offsetHeight : height;\n  const shouldFallback = round(width) !== offsetWidth || round(height) !== offsetHeight;\n  if (shouldFallback) {\n    width = offsetWidth;\n    height = offsetHeight;\n  }\n  return {\n    width,\n    height,\n    $: shouldFallback\n  };\n}\n\nfunction unwrapElement(element) {\n  return !isElement(element) ? element.contextElement : element;\n}\n\nfunction getScale(element) {\n  const domElement = unwrapElement(element);\n  if (!isHTMLElement(domElement)) {\n    return createCoords(1);\n  }\n  const rect = domElement.getBoundingClientRect();\n  const {\n    width,\n    height,\n    $\n  } = getCssDimensions(domElement);\n  let x = ($ ? round(rect.width) : rect.width) / width;\n  let y = ($ ? round(rect.height) : rect.height) / height;\n\n  // 0, NaN, or Infinity should always fallback to 1.\n\n  if (!x || !Number.isFinite(x)) {\n    x = 1;\n  }\n  if (!y || !Number.isFinite(y)) {\n    y = 1;\n  }\n  return {\n    x,\n    y\n  };\n}\n\nconst noOffsets = /*#__PURE__*/createCoords(0);\nfunction getVisualOffsets(element) {\n  const win = getWindow(element);\n  if (!isWebKit() || !win.visualViewport) {\n    return noOffsets;\n  }\n  return {\n    x: win.visualViewport.offsetLeft,\n    y: win.visualViewport.offsetTop\n  };\n}\nfunction shouldAddVisualOffsets(element, isFixed, floatingOffsetParent) {\n  if (isFixed === void 0) {\n    isFixed = false;\n  }\n  if (!floatingOffsetParent || isFixed && floatingOffsetParent !== getWindow(element)) {\n    return false;\n  }\n  return isFixed;\n}\n\nfunction getBoundingClientRect(element, includeScale, isFixedStrategy, offsetParent) {\n  if (includeScale === void 0) {\n    includeScale = false;\n  }\n  if (isFixedStrategy === void 0) {\n    isFixedStrategy = false;\n  }\n  const clientRect = element.getBoundingClientRect();\n  const domElement = unwrapElement(element);\n  let scale = createCoords(1);\n  if (includeScale) {\n    if (offsetParent) {\n      if (isElement(offsetParent)) {\n        scale = getScale(offsetParent);\n      }\n    } else {\n      scale = getScale(element);\n    }\n  }\n  const visualOffsets = shouldAddVisualOffsets(domElement, isFixedStrategy, offsetParent) ? getVisualOffsets(domElement) : createCoords(0);\n  let x = (clientRect.left + visualOffsets.x) / scale.x;\n  let y = (clientRect.top + visualOffsets.y) / scale.y;\n  let width = clientRect.width / scale.x;\n  let height = clientRect.height / scale.y;\n  if (domElement) {\n    const win = getWindow(domElement);\n    const offsetWin = offsetParent && isElement(offsetParent) ? getWindow(offsetParent) : offsetParent;\n    let currentWin = win;\n    let currentIFrame = getFrameElement(currentWin);\n    while (currentIFrame && offsetParent && offsetWin !== currentWin) {\n      const iframeScale = getScale(currentIFrame);\n      const iframeRect = currentIFrame.getBoundingClientRect();\n      const css = getComputedStyle(currentIFrame);\n      const left = iframeRect.left + (currentIFrame.clientLeft + parseFloat(css.paddingLeft)) * iframeScale.x;\n      const top = iframeRect.top + (currentIFrame.clientTop + parseFloat(css.paddingTop)) * iframeScale.y;\n      x *= iframeScale.x;\n      y *= iframeScale.y;\n      width *= iframeScale.x;\n      height *= iframeScale.y;\n      x += left;\n      y += top;\n      currentWin = getWindow(currentIFrame);\n      currentIFrame = getFrameElement(currentWin);\n    }\n  }\n  return rectToClientRect({\n    width,\n    height,\n    x,\n    y\n  });\n}\n\n// If <html> has a CSS width greater than the viewport, then this will be\n// incorrect for RTL.\nfunction getWindowScrollBarX(element, rect) {\n  const leftScroll = getNodeScroll(element).scrollLeft;\n  if (!rect) {\n    return getBoundingClientRect(getDocumentElement(element)).left + leftScroll;\n  }\n  return rect.left + leftScroll;\n}\n\nfunction getHTMLOffset(documentElement, scroll, ignoreScrollbarX) {\n  if (ignoreScrollbarX === void 0) {\n    ignoreScrollbarX = false;\n  }\n  const htmlRect = documentElement.getBoundingClientRect();\n  const x = htmlRect.left + scroll.scrollLeft - (ignoreScrollbarX ? 0 :\n  // RTL <body> scrollbar.\n  getWindowScrollBarX(documentElement, htmlRect));\n  const y = htmlRect.top + scroll.scrollTop;\n  return {\n    x,\n    y\n  };\n}\n\nfunction convertOffsetParentRelativeRectToViewportRelativeRect(_ref) {\n  let {\n    elements,\n    rect,\n    offsetParent,\n    strategy\n  } = _ref;\n  const isFixed = strategy === 'fixed';\n  const documentElement = getDocumentElement(offsetParent);\n  const topLayer = elements ? isTopLayer(elements.floating) : false;\n  if (offsetParent === documentElement || topLayer && isFixed) {\n    return rect;\n  }\n  let scroll = {\n    scrollLeft: 0,\n    scrollTop: 0\n  };\n  let scale = createCoords(1);\n  const offsets = createCoords(0);\n  const isOffsetParentAnElement = isHTMLElement(offsetParent);\n  if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) {\n    if (getNodeName(offsetParent) !== 'body' || isOverflowElement(documentElement)) {\n      scroll = getNodeScroll(offsetParent);\n    }\n    if (isHTMLElement(offsetParent)) {\n      const offsetRect = getBoundingClientRect(offsetParent);\n      scale = getScale(offsetParent);\n      offsets.x = offsetRect.x + offsetParent.clientLeft;\n      offsets.y = offsetRect.y + offsetParent.clientTop;\n    }\n  }\n  const htmlOffset = documentElement && !isOffsetParentAnElement && !isFixed ? getHTMLOffset(documentElement, scroll, true) : createCoords(0);\n  return {\n    width: rect.width * scale.x,\n    height: rect.height * scale.y,\n    x: rect.x * scale.x - scroll.scrollLeft * scale.x + offsets.x + htmlOffset.x,\n    y: rect.y * scale.y - scroll.scrollTop * scale.y + offsets.y + htmlOffset.y\n  };\n}\n\nfunction getClientRects(element) {\n  return Array.from(element.getClientRects());\n}\n\n// Gets the entire size of the scrollable document area, even extending outside\n// of the `<html>` and `<body>` rect bounds if horizontally scrollable.\nfunction getDocumentRect(element) {\n  const html = getDocumentElement(element);\n  const scroll = getNodeScroll(element);\n  const body = element.ownerDocument.body;\n  const width = max(html.scrollWidth, html.clientWidth, body.scrollWidth, body.clientWidth);\n  const height = max(html.scrollHeight, html.clientHeight, body.scrollHeight, body.clientHeight);\n  let x = -scroll.scrollLeft + getWindowScrollBarX(element);\n  const y = -scroll.scrollTop;\n  if (getComputedStyle(body).direction === 'rtl') {\n    x += max(html.clientWidth, body.clientWidth) - width;\n  }\n  return {\n    width,\n    height,\n    x,\n    y\n  };\n}\n\nfunction getViewportRect(element, strategy) {\n  const win = getWindow(element);\n  const html = getDocumentElement(element);\n  const visualViewport = win.visualViewport;\n  let width = html.clientWidth;\n  let height = html.clientHeight;\n  let x = 0;\n  let y = 0;\n  if (visualViewport) {\n    width = visualViewport.width;\n    height = visualViewport.height;\n    const visualViewportBased = isWebKit();\n    if (!visualViewportBased || visualViewportBased && strategy === 'fixed') {\n      x = visualViewport.offsetLeft;\n      y = visualViewport.offsetTop;\n    }\n  }\n  return {\n    width,\n    height,\n    x,\n    y\n  };\n}\n\n// Returns the inner client rect, subtracting scrollbars if present.\nfunction getInnerBoundingClientRect(element, strategy) {\n  const clientRect = getBoundingClientRect(element, true, strategy === 'fixed');\n  const top = clientRect.top + element.clientTop;\n  const left = clientRect.left + element.clientLeft;\n  const scale = isHTMLElement(element) ? getScale(element) : createCoords(1);\n  const width = element.clientWidth * scale.x;\n  const height = element.clientHeight * scale.y;\n  const x = left * scale.x;\n  const y = top * scale.y;\n  return {\n    width,\n    height,\n    x,\n    y\n  };\n}\nfunction getClientRectFromClippingAncestor(element, clippingAncestor, strategy) {\n  let rect;\n  if (clippingAncestor === 'viewport') {\n    rect = getViewportRect(element, strategy);\n  } else if (clippingAncestor === 'document') {\n    rect = getDocumentRect(getDocumentElement(element));\n  } else if (isElement(clippingAncestor)) {\n    rect = getInnerBoundingClientRect(clippingAncestor, strategy);\n  } else {\n    const visualOffsets = getVisualOffsets(element);\n    rect = {\n      x: clippingAncestor.x - visualOffsets.x,\n      y: clippingAncestor.y - visualOffsets.y,\n      width: clippingAncestor.width,\n      height: clippingAncestor.height\n    };\n  }\n  return rectToClientRect(rect);\n}\nfunction hasFixedPositionAncestor(element, stopNode) {\n  const parentNode = getParentNode(element);\n  if (parentNode === stopNode || !isElement(parentNode) || isLastTraversableNode(parentNode)) {\n    return false;\n  }\n  return getComputedStyle(parentNode).position === 'fixed' || hasFixedPositionAncestor(parentNode, stopNode);\n}\n\n// A \"clipping ancestor\" is an `overflow` element with the characteristic of\n// clipping (or hiding) child elements. This returns all clipping ancestors\n// of the given element up the tree.\nfunction getClippingElementAncestors(element, cache) {\n  const cachedResult = cache.get(element);\n  if (cachedResult) {\n    return cachedResult;\n  }\n  let result = getOverflowAncestors(element, [], false).filter(el => isElement(el) && getNodeName(el) !== 'body');\n  let currentContainingBlockComputedStyle = null;\n  const elementIsFixed = getComputedStyle(element).position === 'fixed';\n  let currentNode = elementIsFixed ? getParentNode(element) : element;\n\n  // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block\n  while (isElement(currentNode) && !isLastTraversableNode(currentNode)) {\n    const computedStyle = getComputedStyle(currentNode);\n    const currentNodeIsContaining = isContainingBlock(currentNode);\n    if (!currentNodeIsContaining && computedStyle.position === 'fixed') {\n      currentContainingBlockComputedStyle = null;\n    }\n    const shouldDropCurrentNode = elementIsFixed ? !currentNodeIsContaining && !currentContainingBlockComputedStyle : !currentNodeIsContaining && computedStyle.position === 'static' && !!currentContainingBlockComputedStyle && ['absolute', 'fixed'].includes(currentContainingBlockComputedStyle.position) || isOverflowElement(currentNode) && !currentNodeIsContaining && hasFixedPositionAncestor(element, currentNode);\n    if (shouldDropCurrentNode) {\n      // Drop non-containing blocks.\n      result = result.filter(ancestor => ancestor !== currentNode);\n    } else {\n      // Record last containing block for next iteration.\n      currentContainingBlockComputedStyle = computedStyle;\n    }\n    currentNode = getParentNode(currentNode);\n  }\n  cache.set(element, result);\n  return result;\n}\n\n// Gets the maximum area that the element is visible in due to any number of\n// clipping ancestors.\nfunction getClippingRect(_ref) {\n  let {\n    element,\n    boundary,\n    rootBoundary,\n    strategy\n  } = _ref;\n  const elementClippingAncestors = boundary === 'clippingAncestors' ? isTopLayer(element) ? [] : getClippingElementAncestors(element, this._c) : [].concat(boundary);\n  const clippingAncestors = [...elementClippingAncestors, rootBoundary];\n  const firstClippingAncestor = clippingAncestors[0];\n  const clippingRect = clippingAncestors.reduce((accRect, clippingAncestor) => {\n    const rect = getClientRectFromClippingAncestor(element, clippingAncestor, strategy);\n    accRect.top = max(rect.top, accRect.top);\n    accRect.right = min(rect.right, accRect.right);\n    accRect.bottom = min(rect.bottom, accRect.bottom);\n    accRect.left = max(rect.left, accRect.left);\n    return accRect;\n  }, getClientRectFromClippingAncestor(element, firstClippingAncestor, strategy));\n  return {\n    width: clippingRect.right - clippingRect.left,\n    height: clippingRect.bottom - clippingRect.top,\n    x: clippingRect.left,\n    y: clippingRect.top\n  };\n}\n\nfunction getDimensions(element) {\n  const {\n    width,\n    height\n  } = getCssDimensions(element);\n  return {\n    width,\n    height\n  };\n}\n\nfunction getRectRelativeToOffsetParent(element, offsetParent, strategy) {\n  const isOffsetParentAnElement = isHTMLElement(offsetParent);\n  const documentElement = getDocumentElement(offsetParent);\n  const isFixed = strategy === 'fixed';\n  const rect = getBoundingClientRect(element, true, isFixed, offsetParent);\n  let scroll = {\n    scrollLeft: 0,\n    scrollTop: 0\n  };\n  const offsets = createCoords(0);\n  if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) {\n    if (getNodeName(offsetParent) !== 'body' || isOverflowElement(documentElement)) {\n      scroll = getNodeScroll(offsetParent);\n    }\n    if (isOffsetParentAnElement) {\n      const offsetRect = getBoundingClientRect(offsetParent, true, isFixed, offsetParent);\n      offsets.x = offsetRect.x + offsetParent.clientLeft;\n      offsets.y = offsetRect.y + offsetParent.clientTop;\n    } else if (documentElement) {\n      // If the <body> scrollbar appears on the left (e.g. RTL systems). Use\n      // Firefox with layout.scrollbar.side = 3 in about:config to test this.\n      offsets.x = getWindowScrollBarX(documentElement);\n    }\n  }\n  const htmlOffset = documentElement && !isOffsetParentAnElement && !isFixed ? getHTMLOffset(documentElement, scroll) : createCoords(0);\n  const x = rect.left + scroll.scrollLeft - offsets.x - htmlOffset.x;\n  const y = rect.top + scroll.scrollTop - offsets.y - htmlOffset.y;\n  return {\n    x,\n    y,\n    width: rect.width,\n    height: rect.height\n  };\n}\n\nfunction isStaticPositioned(element) {\n  return getComputedStyle(element).position === 'static';\n}\n\nfunction getTrueOffsetParent(element, polyfill) {\n  if (!isHTMLElement(element) || getComputedStyle(element).position === 'fixed') {\n    return null;\n  }\n  if (polyfill) {\n    return polyfill(element);\n  }\n  let rawOffsetParent = element.offsetParent;\n\n  // Firefox returns the <html> element as the offsetParent if it's non-static,\n  // while Chrome and Safari return the <body> element. The <body> element must\n  // be used to perform the correct calculations even if the <html> element is\n  // non-static.\n  if (getDocumentElement(element) === rawOffsetParent) {\n    rawOffsetParent = rawOffsetParent.ownerDocument.body;\n  }\n  return rawOffsetParent;\n}\n\n// Gets the closest ancestor positioned element. Handles some edge cases,\n// such as table ancestors and cross browser bugs.\nfunction getOffsetParent(element, polyfill) {\n  const win = getWindow(element);\n  if (isTopLayer(element)) {\n    return win;\n  }\n  if (!isHTMLElement(element)) {\n    let svgOffsetParent = getParentNode(element);\n    while (svgOffsetParent && !isLastTraversableNode(svgOffsetParent)) {\n      if (isElement(svgOffsetParent) && !isStaticPositioned(svgOffsetParent)) {\n        return svgOffsetParent;\n      }\n      svgOffsetParent = getParentNode(svgOffsetParent);\n    }\n    return win;\n  }\n  let offsetParent = getTrueOffsetParent(element, polyfill);\n  while (offsetParent && isTableElement(offsetParent) && isStaticPositioned(offsetParent)) {\n    offsetParent = getTrueOffsetParent(offsetParent, polyfill);\n  }\n  if (offsetParent && isLastTraversableNode(offsetParent) && isStaticPositioned(offsetParent) && !isContainingBlock(offsetParent)) {\n    return win;\n  }\n  return offsetParent || getContainingBlock(element) || win;\n}\n\nconst getElementRects = async function (data) {\n  const getOffsetParentFn = this.getOffsetParent || getOffsetParent;\n  const getDimensionsFn = this.getDimensions;\n  const floatingDimensions = await getDimensionsFn(data.floating);\n  return {\n    reference: getRectRelativeToOffsetParent(data.reference, await getOffsetParentFn(data.floating), data.strategy),\n    floating: {\n      x: 0,\n      y: 0,\n      width: floatingDimensions.width,\n      height: floatingDimensions.height\n    }\n  };\n};\n\nfunction isRTL(element) {\n  return getComputedStyle(element).direction === 'rtl';\n}\n\nconst platform = {\n  convertOffsetParentRelativeRectToViewportRelativeRect,\n  getDocumentElement,\n  getClippingRect,\n  getOffsetParent,\n  getElementRects,\n  getClientRects,\n  getDimensions,\n  getScale,\n  isElement,\n  isRTL\n};\n\nfunction rectsAreEqual(a, b) {\n  return a.x === b.x && a.y === b.y && a.width === b.width && a.height === b.height;\n}\n\n// https://samthor.au/2021/observing-dom/\nfunction observeMove(element, onMove) {\n  let io = null;\n  let timeoutId;\n  const root = getDocumentElement(element);\n  function cleanup() {\n    var _io;\n    clearTimeout(timeoutId);\n    (_io = io) == null || _io.disconnect();\n    io = null;\n  }\n  function refresh(skip, threshold) {\n    if (skip === void 0) {\n      skip = false;\n    }\n    if (threshold === void 0) {\n      threshold = 1;\n    }\n    cleanup();\n    const elementRectForRootMargin = element.getBoundingClientRect();\n    const {\n      left,\n      top,\n      width,\n      height\n    } = elementRectForRootMargin;\n    if (!skip) {\n      onMove();\n    }\n    if (!width || !height) {\n      return;\n    }\n    const insetTop = floor(top);\n    const insetRight = floor(root.clientWidth - (left + width));\n    const insetBottom = floor(root.clientHeight - (top + height));\n    const insetLeft = floor(left);\n    const rootMargin = -insetTop + \"px \" + -insetRight + \"px \" + -insetBottom + \"px \" + -insetLeft + \"px\";\n    const options = {\n      rootMargin,\n      threshold: max(0, min(1, threshold)) || 1\n    };\n    let isFirstUpdate = true;\n    function handleObserve(entries) {\n      const ratio = entries[0].intersectionRatio;\n      if (ratio !== threshold) {\n        if (!isFirstUpdate) {\n          return refresh();\n        }\n        if (!ratio) {\n          // If the reference is clipped, the ratio is 0. Throttle the refresh\n          // to prevent an infinite loop of updates.\n          timeoutId = setTimeout(() => {\n            refresh(false, 1e-7);\n          }, 1000);\n        } else {\n          refresh(false, ratio);\n        }\n      }\n      if (ratio === 1 && !rectsAreEqual(elementRectForRootMargin, element.getBoundingClientRect())) {\n        // It's possible that even though the ratio is reported as 1, the\n        // element is not actually fully within the IntersectionObserver's root\n        // area anymore. This can happen under performance constraints. This may\n        // be a bug in the browser's IntersectionObserver implementation. To\n        // work around this, we compare the element's bounding rect now with\n        // what it was at the time we created the IntersectionObserver. If they\n        // are not equal then the element moved, so we refresh.\n        refresh();\n      }\n      isFirstUpdate = false;\n    }\n\n    // Older browsers don't support a `document` as the root and will throw an\n    // error.\n    try {\n      io = new IntersectionObserver(handleObserve, {\n        ...options,\n        // Handle <iframe>s\n        root: root.ownerDocument\n      });\n    } catch (e) {\n      io = new IntersectionObserver(handleObserve, options);\n    }\n    io.observe(element);\n  }\n  refresh(true);\n  return cleanup;\n}\n\n/**\n * Automatically updates the position of the floating element when necessary.\n * Should only be called when the floating element is mounted on the DOM or\n * visible on the screen.\n * @returns cleanup function that should be invoked when the floating element is\n * removed from the DOM or hidden from the screen.\n * @see https://floating-ui.com/docs/autoUpdate\n */\nfunction autoUpdate(reference, floating, update, options) {\n  if (options === void 0) {\n    options = {};\n  }\n  const {\n    ancestorScroll = true,\n    ancestorResize = true,\n    elementResize = typeof ResizeObserver === 'function',\n    layoutShift = typeof IntersectionObserver === 'function',\n    animationFrame = false\n  } = options;\n  const referenceEl = unwrapElement(reference);\n  const ancestors = ancestorScroll || ancestorResize ? [...(referenceEl ? getOverflowAncestors(referenceEl) : []), ...getOverflowAncestors(floating)] : [];\n  ancestors.forEach(ancestor => {\n    ancestorScroll && ancestor.addEventListener('scroll', update, {\n      passive: true\n    });\n    ancestorResize && ancestor.addEventListener('resize', update);\n  });\n  const cleanupIo = referenceEl && layoutShift ? observeMove(referenceEl, update) : null;\n  let reobserveFrame = -1;\n  let resizeObserver = null;\n  if (elementResize) {\n    resizeObserver = new ResizeObserver(_ref => {\n      let [firstEntry] = _ref;\n      if (firstEntry && firstEntry.target === referenceEl && resizeObserver) {\n        // Prevent update loops when using the `size` middleware.\n        // https://github.com/floating-ui/floating-ui/issues/1740\n        resizeObserver.unobserve(floating);\n        cancelAnimationFrame(reobserveFrame);\n        reobserveFrame = requestAnimationFrame(() => {\n          var _resizeObserver;\n          (_resizeObserver = resizeObserver) == null || _resizeObserver.observe(floating);\n        });\n      }\n      update();\n    });\n    if (referenceEl && !animationFrame) {\n      resizeObserver.observe(referenceEl);\n    }\n    resizeObserver.observe(floating);\n  }\n  let frameId;\n  let prevRefRect = animationFrame ? getBoundingClientRect(reference) : null;\n  if (animationFrame) {\n    frameLoop();\n  }\n  function frameLoop() {\n    const nextRefRect = getBoundingClientRect(reference);\n    if (prevRefRect && !rectsAreEqual(prevRefRect, nextRefRect)) {\n      update();\n    }\n    prevRefRect = nextRefRect;\n    frameId = requestAnimationFrame(frameLoop);\n  }\n  update();\n  return () => {\n    var _resizeObserver2;\n    ancestors.forEach(ancestor => {\n      ancestorScroll && ancestor.removeEventListener('scroll', update);\n      ancestorResize && ancestor.removeEventListener('resize', update);\n    });\n    cleanupIo == null || cleanupIo();\n    (_resizeObserver2 = resizeObserver) == null || _resizeObserver2.disconnect();\n    resizeObserver = null;\n    if (animationFrame) {\n      cancelAnimationFrame(frameId);\n    }\n  };\n}\n\n/**\n * Resolves with an object of overflow side offsets that determine how much the\n * element is overflowing a given clipping boundary on each side.\n * - positive = overflowing the boundary by that number of pixels\n * - negative = how many pixels left before it will overflow\n * - 0 = lies flush with the boundary\n * @see https://floating-ui.com/docs/detectOverflow\n */\nconst detectOverflow = detectOverflow$1;\n\n/**\n * Modifies the placement by translating the floating element along the\n * specified axes.\n * A number (shorthand for `mainAxis` or distance), or an axes configuration\n * object may be passed.\n * @see https://floating-ui.com/docs/offset\n */\nconst offset = offset$1;\n\n/**\n * Optimizes the visibility of the floating element by choosing the placement\n * that has the most space available automatically, without needing to specify a\n * preferred placement. Alternative to `flip`.\n * @see https://floating-ui.com/docs/autoPlacement\n */\nconst autoPlacement = autoPlacement$1;\n\n/**\n * Optimizes the visibility of the floating element by shifting it in order to\n * keep it in view when it will overflow the clipping boundary.\n * @see https://floating-ui.com/docs/shift\n */\nconst shift = shift$1;\n\n/**\n * Optimizes the visibility of the floating element by flipping the `placement`\n * in order to keep it in view when the preferred placement(s) will overflow the\n * clipping boundary. Alternative to `autoPlacement`.\n * @see https://floating-ui.com/docs/flip\n */\nconst flip = flip$1;\n\n/**\n * Provides data that allows you to change the size of the floating element \u2014\n * for instance, prevent it from overflowing the clipping boundary or match the\n * width of the reference element.\n * @see https://floating-ui.com/docs/size\n */\nconst size = size$1;\n\n/**\n * Provides data to hide the floating element in applicable situations, such as\n * when it is not in the same clipping context as the reference element.\n * @see https://floating-ui.com/docs/hide\n */\nconst hide = hide$1;\n\n/**\n * Provides data to position an inner element of the floating element so that it\n * appears centered to the reference element.\n * @see https://floating-ui.com/docs/arrow\n */\nconst arrow = arrow$1;\n\n/**\n * Provides improved positioning for inline reference elements that can span\n * over multiple lines, such as hyperlinks or range selections.\n * @see https://floating-ui.com/docs/inline\n */\nconst inline = inline$1;\n\n/**\n * Built-in `limiter` that will stop `shift()` at a certain point.\n */\nconst limitShift = limitShift$1;\n\n/**\n * Computes the `x` and `y` coordinates that will place the floating element\n * next to a given reference element.\n */\nconst computePosition = (reference, floating, options) => {\n  // This caches the expensive `getClippingElementAncestors` function so that\n  // multiple lifecycle resets re-use the same result. It only lives for a\n  // single call. If other functions become expensive, we can add them as well.\n  const cache = new Map();\n  const mergedOptions = {\n    platform,\n    ...options\n  };\n  const platformWithCache = {\n    ...mergedOptions.platform,\n    _c: cache\n  };\n  return computePosition$1(reference, floating, {\n    ...mergedOptions,\n    platform: platformWithCache\n  });\n};\n\nexport { arrow, autoPlacement, autoUpdate, computePosition, detectOverflow, flip, hide, inline, limitShift, offset, platform, shift, size };\n", "import { computePosition, flip, offset, arrow, autoUpdate, hide, shift, size } from '@floating-ui/dom';\nconst TOP_START = 'top-start';\nconst TOP = 'top';\nconst TOP_END = 'top-end';\nconst RIGHT_START = 'right-start';\nconst RIGHT = 'right';\nconst RIGHT_END = 'right-end';\nconst BOTTOM_START = 'bottom-start';\nconst BOTTOM = 'bottom';\nconst BOTTOM_END = 'bottom-end';\nconst LEFT_START = 'left-start';\nconst LEFT = 'left';\nconst LEFT_END = 'left-end';\nexport const directions = [\n    TOP_START,\n    TOP,\n    TOP_END,\n    RIGHT_START,\n    RIGHT,\n    RIGHT_END,\n    BOTTOM_START,\n    BOTTOM,\n    BOTTOM_END,\n    LEFT_START,\n    LEFT,\n    LEFT_END,\n];\nexport const opposites = {\n    [TOP_START]: BOTTOM_START,\n    [TOP]: BOTTOM,\n    [TOP_END]: BOTTOM_END,\n    [BOTTOM_START]: TOP_START,\n    [BOTTOM]: TOP,\n    [BOTTOM_END]: TOP_END,\n    [LEFT_START]: RIGHT_START,\n    [LEFT]: RIGHT,\n    [LEFT_END]: RIGHT_END,\n    [RIGHT_START]: LEFT_START,\n    [RIGHT]: LEFT,\n    [RIGHT_END]: LEFT_END,\n};\nconst rotation = {\n    [LEFT_START]: -45,\n    [LEFT]: -45,\n    [LEFT_END]: -45,\n    [TOP_START]: 45,\n    [TOP]: 45,\n    [TOP_END]: 45,\n    [RIGHT_START]: 135,\n    [RIGHT]: 135,\n    [RIGHT_END]: 135,\n    [BOTTOM_START]: -135,\n    [BOTTOM]: -135,\n    [BOTTOM_END]: -135,\n};\nexport const arrowDirectionClassname = (dir) => {\n    let direction;\n    if (/-/.test(dir)) {\n        direction = dir\n            .split('-')\n            .map((d) => d.charAt(0).toUpperCase() + d.slice(1))\n            .join('');\n    }\n    else {\n        direction = (dir.charAt(0).toUpperCase() + dir.slice(1));\n    }\n    return direction;\n};\nconst side = (dir) => dir.split('-')[0];\nconst staticSide = (dir) => opposites[side(dir)];\nconst arrowDirection = (dir) => opposites[dir];\nconst arrowRotation = (dir) => rotation[arrowDirection(dir)];\nconst applyArrowStyles = (arrowEl, arrowRotation, dir) => {\n    Object.assign(arrowEl?.style, {\n        borderTopLeftRadius: '4px',\n        zIndex: 1,\n        // border alignment is off by a fraction of a pixel, this fixes it\n        [`margin${arrowDirectionClassname(staticSide(dir))}`]: '-0.5px',\n        transform: `rotate(${arrowRotation}deg)`,\n    });\n};\nconst ELEMENT_PADDING = 8;\nconst ARROW_OFFSET = 24;\nexport async function useRecompute(state) {\n    if (!state?.isShowing)\n        return; // we're not currently showing the element, no reason to recompute\n    if (state?.waitForDOM) {\n        await state?.waitForDOM(); // wait for DOM to settle before computing\n    }\n    if (!state?.targetEl || !state?.attentionEl)\n        return;\n    let targetEl = state?.targetEl;\n    const attentionEl = state.attentionEl;\n    computePosition(targetEl, attentionEl, {\n        placement: state?.directionName ?? BOTTOM,\n        middleware: [\n            offset({ mainAxis: state?.distance ?? 8, crossAxis: state?.skidding ?? 0 }), // offers flexibility over how to place the attentionEl towards its targetEl both on the x and y axis (horizontally and vertically).\n            state?.flip &&\n                flip({\n                    // when flip is set to true it will move the attentionEl's placement to its opposite side or to the preferred placements if fallbackPlacements has a value\n                    crossAxis: state?.crossAxis, // checks overflow to trigger a flip. When disabled, it will ignore overflow\n                    fallbackPlacements: state?.fallbackPlacements,\n                }),\n            state?.flip && shift({ crossAxis: true }), // shifts the attentionEl to make sure that it stays in view\n            !state?.noArrow && state?.arrowEl && arrow({ element: state?.arrowEl }),\n            hide(), // will hide the attentionEl when it appears detached from the targetEl. Can be called multiple times in the middleware-array if you want to use several strategies. Default strategy is 'referenceHidden'.\n            size({\n                apply() {\n                    // Apply equal padding to the left and right sides of the attentionEl to prevent it from overflowing the viewport on smaller screens.\n                    Object.assign(attentionEl.style, {\n                        paddingRight: `${ELEMENT_PADDING}px`,\n                        paddingLeft: `${ELEMENT_PADDING}px`,\n                    });\n                },\n            }),\n        ],\n    }).then(({ x, y, middlewareData, placement }) => {\n        state.actualDirection = placement;\n        // We only want floating-ui to calculate the callout's arrow position and not the attention element's position, since the targetEl can be undefined if isCallout is true.\n        // Therefore, we only add this style to the attentionEl when isCallout is false.\n        if (!state?.isCallout) {\n            Object.assign(attentionEl.style, {\n                left: `${x}px`,\n                top: `${y}px`,\n            });\n        }\n        // Handle visibility based on hide middleware\n        if (middlewareData?.hide && !state?.isCallout) {\n            const { referenceHidden } = middlewareData.hide;\n            Object.assign(attentionEl.style, {\n                visibility: referenceHidden ? 'hidden' : '',\n            });\n        }\n        // Arrow position adjustment\n        if (middlewareData?.arrow && state?.arrowEl) {\n            const arrowEl = state?.arrowEl;\n            const { x: arrowX, y: arrowY } = middlewareData.arrow;\n            const isRtl = window.getComputedStyle(attentionEl).direction === 'rtl'; // Checks RTL for proper arrow alignment\n            const arrowPlacement = arrowDirection(placement).split('-')[1];\n            let top = '', right = '', bottom = '', left = '';\n            // Adjust based on 'start' or 'end' placements\n            if (arrowPlacement === 'start') {\n                const value = typeof arrowX === 'number' ? `calc(${ARROW_OFFSET}px - ${arrowEl.offsetWidth / 2}px)` : '';\n                top = typeof arrowY === 'number' ? `calc(${ARROW_OFFSET}px - ${arrowEl.offsetWidth / 2}px)` : '';\n                right = isRtl ? value : '';\n                left = isRtl ? '' : value;\n            }\n            else if (arrowPlacement === 'end') {\n                const value = typeof arrowX === 'number' ? `calc(${ARROW_OFFSET}px - ${arrowEl.offsetWidth / 2}px)` : '';\n                right = isRtl ? '' : value;\n                left = isRtl ? value : '';\n                bottom = typeof arrowY === 'number' ? `calc(${ARROW_OFFSET}px - ${arrowEl.offsetWidth / 2}px)` : '';\n            }\n            else {\n                // Default positioning with no 'start' or 'end'\n                left = typeof arrowX === 'number' ? `${arrowX}px` : '';\n                top = typeof arrowY === 'number' ? `${arrowY}px` : '';\n            }\n            // Apply the arrow styles\n            Object.assign(arrowEl.style, {\n                top,\n                right,\n                bottom,\n                left,\n            });\n            // Apply arrow rotation styles\n            applyArrowStyles(arrowEl, arrowRotation(placement), placement);\n        }\n    });\n    return state;\n}\nexport const autoUpdatePosition = (state) => {\n    // computePosition is only run once, so we need to wrap autoUpdate() around useRecompute() in order to recompute the attentionEl's position\n    // autoUpdate adds event listeners that are triggered on resize and on scroll and will keep calling the useRecompute().\n    // autoUpdate returns a cleanup() function that removes the event listeners.\n    if (!state?.targetEl || !state?.attentionEl || state?.isCallout)\n        return;\n    return autoUpdate(state?.targetEl, state?.attentionEl, () => {\n        useRecompute(state);\n    });\n};\n", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return supportedLocales.find((locale) => usedLocale === locale || usedLocale.toLowerCase().includes(locale)) || defaultLocale;\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g LANG environment variable to be set on the server.\n     */\n    const serverLocale = process.env.NMP_LANGUAGE || Intl.DateTimeFormat().resolvedOptions().locale;\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document.documentElement.lang;\n    return getSupportedLocale(htmlLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages,\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages,\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { css } from 'lit';\n\n/*\n * Layout classes that needs to be included for the positioning of the callout to work.\n */\nexport const styles = css`\n  .place-self-auto {\n    place-self: auto;\n  }\n  .place-self-start {\n    place-self: start;\n  }\n  .place-self-end {\n    place-self: end;\n  }\n  .place-self-center {\n    place-self: center;\n  }\n  .place-self-stretch {\n    place-self: stretch;\n  }\n\n  .place-items-start {\n    place-items: start;\n  }\n  .place-items-end {\n    place-items: end;\n  }\n  .place-items-center {\n    place-items: center;\n  }\n  .place-items-stretch {\n    place-items: stretch;\n  }\n\n  .place-content-center {\n    place-content: center;\n  }\n  .place-content-start {\n    place-content: start;\n  }\n  .place-content-end {\n    place-content: end;\n  }\n  .place-content-between {\n    place-content: space-between;\n  }\n  .place-content-around {\n    place-content: space-around;\n  }\n  .place-content-evenly {\n    place-content: space-evenly;\n  }\n\n  .self-auto {\n    align-self: auto;\n  }\n  .self-start {\n    align-self: flex-start;\n  }\n  .self-center {\n    align-self: center;\n  }\n  .self-end {\n    align-self: flex-end;\n  }\n  .self-stretch {\n    align-self: stretch;\n  }\n\n  .items-baseline {\n    align-items: baseline;\n  }\n  .items-stretch {\n    align-items: stretch;\n  }\n  .items-start {\n    align-items: flex-start;\n  }\n  .items-center {\n    align-items: center;\n  }\n  .items-end {\n    align-items: flex-end;\n  }\n\n  .content-start {\n    align-content: flex-start;\n  }\n  .content-center {\n    align-content: center;\n  }\n  .content-end {\n    align-content: flex-end;\n  }\n  .content-between {\n    align-content: space-between;\n  }\n  .content-around {\n    align-content: space-around;\n  }\n  .content-evenly {\n    align-content: space-evenly;\n  }\n\n  .justify-self-auto {\n    justify-self: auto;\n  }\n  .justify-self-start {\n    justify-self: start;\n  }\n  .justify-self-center {\n    justify-self: center;\n  }\n  .justify-self-end {\n    justify-self: end;\n  }\n  .justify-self-stretch {\n    justify-self: stretch;\n  }\n\n  .justify-items-start {\n    justify-items: start;\n  }\n  .justify-items-center {\n    justify-items: center;\n  }\n  .justify-items-end {\n    justify-items: end;\n  }\n  .justify-items-stretch {\n    justify-items: stretch;\n  }\n\n  .justify-start {\n    justify-content: flex-start;\n  }\n  .justify-center {\n    justify-content: center;\n  }\n  .justify-end {\n    justify-content: flex-end;\n  }\n  .justify-between {\n    justify-content: space-between;\n  }\n  .justify-around {\n    justify-content: space-around;\n  }\n  .justify-evenly {\n    justify-content: space-evenly;\n  }\n\n  .gap-0 {\n    gap: 0;\n  }\n  .gap-1 {\n    gap: 0.25rem;\n  }\n  .gap-2 {\n    gap: 0.5rem;\n  }\n  .gap-4 {\n    gap: 1rem;\n  }\n  .gap-6 {\n    gap: 1.5rem;\n  }\n  .gap-8 {\n    gap: 2rem;\n  }\n  .gap-10 {\n    gap: 2.5rem;\n  }\n  .gap-12 {\n    gap: 3rem;\n  }\n  .gap-14 {\n    gap: 3.5rem;\n  }\n  .gap-16 {\n    gap: 4rem;\n  }\n\n  .gap-x-0 {\n    column-gap: 0;\n  }\n  .gap-x-1 {\n    column-gap: 0.25rem;\n  }\n  .gap-x-2 {\n    column-gap: 0.5rem;\n  }\n  .gap-x-4 {\n    column-gap: 1rem;\n  }\n  .gap-x-6 {\n    column-gap: 1.5rem;\n  }\n  .gap-x-8 {\n    column-gap: 2rem;\n  }\n  .gap-x-10 {\n    column-gap: 2.5rem;\n  }\n  .gap-x-12 {\n    column-gap: 3rem;\n  }\n  .gap-x-14 {\n    column-gap: 3.5rem;\n  }\n  .gap-x-16 {\n    column-gap: 4rem;\n  }\n\n  .gap-y-0 {\n    row-gap: 0;\n  }\n  .gap-y-1 {\n    row-gap: 0.25rem;\n  }\n  .gap-y-2 {\n    row-gap: 0.5rem;\n  }\n  .gap-y-4 {\n    row-gap: 1rem;\n  }\n  .gap-y-6 {\n    row-gap: 1.5rem;\n  }\n  .gap-y-8 {\n    row-gap: 2rem;\n  }\n  .gap-y-10 {\n    row-gap: 2.5rem;\n  }\n  .gap-y-12 {\n    row-gap: 3rem;\n  }\n  .gap-y-14 {\n    row-gap: 3.5rem;\n  }\n  .gap-y-16 {\n    row-gap: 4rem;\n  }\n\n  .order-1 {\n    order: 1;\n  }\n  .order-2 {\n    order: 2;\n  }\n  .order-3 {\n    order: 3;\n  }\n  .order-4 {\n    order: 4;\n  }\n  .order-5 {\n    order: 5;\n  }\n  .order-6 {\n    order: 6;\n  }\n  .order-7 {\n    order: 7;\n  }\n  .order-8 {\n    order: 8;\n  }\n  .order-9 {\n    order: 9;\n  }\n  .order-10 {\n    order: 10;\n  }\n  .order-11 {\n    order: 11;\n  }\n  .order-12 {\n    order: 12;\n  }\n  .order-none {\n    order: 0;\n  }\n  .order-first {\n    order: -9999;\n  }\n  .order-last {\n    order: 9999;\n  }\n\n  .flex-nowrap {\n    flex-wrap: nowrap;\n  }\n  .flex-wrap {\n    flex-wrap: wrap;\n  }\n  .flex-wrap-reverse {\n    flex-wrap: wrap-reverse;\n  }\n\n  .shrink {\n    flex-shrink: 1;\n  }\n  .shrink-0 {\n    flex-shrink: 0;\n  }\n\n  .grow {\n    flex-grow: 1;\n  }\n  .grow-0 {\n    flex-grow: 0;\n  }\n\n  .flex-row {\n    flex-direction: row;\n  }\n  .flex-row-reverse {\n    flex-direction: row-reverse;\n  }\n  .flex-col {\n    flex-direction: column;\n  }\n  .flex-col-reverse {\n    flex-direction: column-reverse;\n  }\n\n  .basis-1 {\n    flex-basis: 0.25rem;\n  }\n  .basis-2 {\n    flex-basis: 0.5rem;\n  }\n  .basis-4 {\n    flex-basis: 1rem;\n  }\n  .basis-8 {\n    flex-basis: 2rem;\n  }\n  .basis-16 {\n    flex-basis: 4rem;\n  }\n  .basis-1\\/5 {\n    flex-basis: 20%;\n  }\n\n  .flex-initial {\n    flex: 0 1 auto;\n  }\n  .flex-1 {\n    flex: 1 1 0%;\n  }\n  .flex-auto {\n    flex: 1 1 auto;\n  }\n  .flex-none {\n    flex: none;\n  }\n\n  .space-x-0 > * + * {\n    margin-left: 0;\n  }\n  .space-x-1 > * + * {\n    margin-left: 0.25rem;\n  }\n  .space-x-2 > * + * {\n    margin-left: 0.5rem;\n  }\n  .space-x-4 > * + * {\n    margin-left: 1rem;\n  }\n  .space-x-6 > * + * {\n    margin-left: 1.5rem;\n  }\n  .space-x-8 > * + * {\n    margin-left: 2rem;\n  }\n  .space-x-10 > * + * {\n    margin-left: 2.5rem;\n  }\n  .space-x-12 > * + * {\n    margin-left: 3rem;\n  }\n  .space-x-14 > * + * {\n    margin-left: 3.5rem;\n  }\n  .space-x-16 > * + * {\n    margin-left: 4rem;\n  }\n\n  .space-y-0 > * + * {\n    margin-top: 0;\n  }\n  .space-y-1 > * + * {\n    margin-top: 0.25rem;\n  }\n  .space-y-2 > * + * {\n    margin-top: 0.5rem;\n  }\n  .space-y-4 > * + * {\n    margin-top: 1rem;\n  }\n  .space-y-6 > * + * {\n    margin-top: 1.5rem;\n  }\n  .space-y-8 > * + * {\n    margin-top: 2rem;\n  }\n  .space-y-10 > * + * {\n    margin-top: 2.5rem;\n  }\n  .space-y-12 > * + * {\n    margin-top: 3rem;\n  }\n  .space-y-14 > * + * {\n    margin-top: 3.5rem;\n  }\n  .space-y-16 > * + * {\n    margin-top: 4rem;\n  }\n\n  .space-x-reverse > * + * {\n    margin-right: 0;\n    margin-left: 0;\n  }\n  .space-y-reverse > * + * {\n    margin-bottom: 0;\n    margin-top: 0;\n  }\n\n  .m-0 {\n    margin: 0;\n  }\n  .m-1 {\n    margin: 0.25rem;\n  }\n  .m-2 {\n    margin: 0.5rem;\n  }\n  .m-4 {\n    margin: 1rem;\n  }\n  .m-6 {\n    margin: 1.5rem;\n  }\n  .m-8 {\n    margin: 2rem;\n  }\n  .m-10 {\n    margin: 2.5rem;\n  }\n  .m-12 {\n    margin: 3rem;\n  }\n  .m-14 {\n    margin: 3.5rem;\n  }\n  .m-16 {\n    margin: 4rem;\n  }\n\n  .mt-0 {\n    margin-top: 0;\n  }\n  .mt-1 {\n    margin-top: 0.25rem;\n  }\n  .mt-2 {\n    margin-top: 0.5rem;\n  }\n  .mt-4 {\n    margin-top: 1rem;\n  }\n  .mt-6 {\n    margin-top: 1.5rem;\n  }\n  .mt-8 {\n    margin-top: 2rem;\n  }\n  .mt-10 {\n    margin-top: 2.5rem;\n  }\n  .mt-12 {\n    margin-top: 3rem;\n  }\n  .mt-14 {\n    margin-top: 3.5rem;\n  }\n  .mt-16 {\n    margin-top: 4rem;\n  }\n\n  .mr-0 {\n    margin-right: 0;\n  }\n  .mr-1 {\n    margin-right: 0.25rem;\n  }\n  .mr-2 {\n    margin-right: 0.5rem;\n  }\n  .mr-4 {\n    margin-right: 1rem;\n  }\n  .mr-6 {\n    margin-right: 1.5rem;\n  }\n  .mr-8 {\n    margin-right: 2rem;\n  }\n  .mr-10 {\n    margin-right: 2.5rem;\n  }\n  .mr-12 {\n    margin-right: 3rem;\n  }\n  .mr-14 {\n    margin-right: 3.5rem;\n  }\n  .mr-16 {\n    margin-right: 4rem;\n  }\n\n  .mb-0 {\n    margin-bottom: 0;\n  }\n  .mb-1 {\n    margin-bottom: 0.25rem;\n  }\n  .mb-2 {\n    margin-bottom: 0.5rem;\n  }\n  .mb-4 {\n    margin-bottom: 1rem;\n  }\n  .mb-6 {\n    margin-bottom: 1.5rem;\n  }\n  .mb-8 {\n    margin-bottom: 2rem;\n  }\n  .mb-10 {\n    margin-bottom: 2.5rem;\n  }\n  .mb-12 {\n    margin-bottom: 3rem;\n  }\n  .mb-14 {\n    margin-bottom: 3.5rem;\n  }\n  .mb-16 {\n    margin-bottom: 4rem;\n  }\n\n  .ml-0 {\n    margin-left: 0;\n  }\n  .ml-1 {\n    margin-left: 0.25rem;\n  }\n  .ml-2 {\n    margin-left: 0.5rem;\n  }\n  .ml-4 {\n    margin-left: 1rem;\n  }\n  .ml-6 {\n    margin-left: 1.5rem;\n  }\n  .ml-8 {\n    margin-left: 2rem;\n  }\n  .ml-10 {\n    margin-left: 2.5rem;\n  }\n  .ml-12 {\n    margin-left: 3rem;\n  }\n  .ml-14 {\n    margin-left: 3.5rem;\n  }\n  .ml-16 {\n    margin-left: 4rem;\n  }\n\n  .mx-0 {\n    margin-left: 0;\n    margin-right: 0;\n  }\n  .mx-1 {\n    margin-left: 0.25rem;\n    margin-right: 0.25rem;\n  }\n  .mx-2 {\n    margin-left: 0.5rem;\n    margin-right: 0.5rem;\n  }\n  .mx-4 {\n    margin-left: 1rem;\n    margin-right: 1rem;\n  }\n  .mx-6 {\n    margin-left: 1.5rem;\n    margin-right: 1.5rem;\n  }\n  .mx-8 {\n    margin-left: 2rem;\n    margin-right: 2rem;\n  }\n  .mx-10 {\n    margin-left: 2.5rem;\n    margin-right: 2.5rem;\n  }\n  .mx-12 {\n    margin-left: 3rem;\n    margin-right: 3rem;\n  }\n  .mx-14 {\n    margin-left: 3.5rem;\n    margin-right: 3.5rem;\n  }\n  .mx-16 {\n    margin-left: 4rem;\n    margin-right: 4rem;\n  }\n\n  .my-0 {\n    margin-top: 0;\n    margin-bottom: 0;\n  }\n  .my-1 {\n    margin-top: 0.25rem;\n    margin-bottom: 0.25rem;\n  }\n  .my-2 {\n    margin-top: 0.5rem;\n    margin-bottom: 0.5rem;\n  }\n  .my-4 {\n    margin-top: 1rem;\n    margin-bottom: 1rem;\n  }\n  .my-6 {\n    margin-top: 1.5rem;\n    margin-bottom: 1.5rem;\n  }\n  .my-8 {\n    margin-top: 2rem;\n    margin-bottom: 2rem;\n  }\n  .my-10 {\n    margin-top: 2.5rem;\n    margin-bottom: 2.5rem;\n  }\n  .my-12 {\n    margin-top: 3rem;\n    margin-bottom: 3rem;\n  }\n  .my-14 {\n    margin-top: 3.5rem;\n    margin-bottom: 3.5rem;\n  }\n  .my-16 {\n    margin-top: 4rem;\n    margin-bottom: 4rem;\n  }\n\n  .p-0 {\n    padding: 0;\n  }\n  .p-1 {\n    padding: 0.25rem;\n  }\n  .p-2 {\n    padding: 0.5rem;\n  }\n  .p-4 {\n    padding: 1rem;\n  }\n  .p-6 {\n    padding: 1.5rem;\n  }\n  .p-8 {\n    padding: 2rem;\n  }\n  .p-10 {\n    padding: 2.5rem;\n  }\n  .p-12 {\n    padding: 3rem;\n  }\n  .p-14 {\n    padding: 3.5rem;\n  }\n  .p-16 {\n    padding: 4rem;\n  }\n\n  .pt-0 {\n    padding-top: 0;\n  }\n  .pt-1 {\n    padding-top: 0.25rem;\n  }\n  .pt-2 {\n    padding-top: 0.5rem;\n  }\n  .pt-4 {\n    padding-top: 1rem;\n  }\n  .pt-6 {\n    padding-top: 1.5rem;\n  }\n  .pt-8 {\n    padding-top: 2rem;\n  }\n  .pt-10 {\n    padding-top: 2.5rem;\n  }\n  .pt-12 {\n    padding-top: 3rem;\n  }\n  .pt-14 {\n    padding-top: 3.5rem;\n  }\n  .pt-16 {\n    padding-top: 4rem;\n  }\n\n  .pr-0 {\n    padding-right: 0;\n  }\n  .pr-1 {\n    padding-right: 0.25rem;\n  }\n  .pr-2 {\n    padding-right: 0.5rem;\n  }\n  .pr-4 {\n    padding-right: 1rem;\n  }\n  .pr-6 {\n    padding-right: 1.5rem;\n  }\n  .pr-8 {\n    padding-right: 2rem;\n  }\n  .pr-10 {\n    padding-right: 2.5rem;\n  }\n  .pr-12 {\n    padding-right: 3rem;\n  }\n  .pr-14 {\n    padding-right: 3.5rem;\n  }\n  .pr-16 {\n    padding-right: 4rem;\n  }\n\n  .pb-0 {\n    padding-bottom: 0;\n  }\n  .pb-1 {\n    padding-bottom: 0.25rem;\n  }\n  .pb-2 {\n    padding-bottom: 0.5rem;\n  }\n  .pb-4 {\n    padding-bottom: 1rem;\n  }\n  .pb-6 {\n    padding-bottom: 1.5rem;\n  }\n  .pb-8 {\n    padding-bottom: 2rem;\n  }\n  .pb-10 {\n    padding-bottom: 2.5rem;\n  }\n  .pb-12 {\n    padding-bottom: 3rem;\n  }\n  .pb-14 {\n    padding-bottom: 3.5rem;\n  }\n  .pb-16 {\n    padding-bottom: 4rem;\n  }\n\n  .pl-0 {\n    padding-left: 0;\n  }\n  .pl-1 {\n    padding-left: 0.25rem;\n  }\n  .pl-2 {\n    padding-left: 0.5rem;\n  }\n  .pl-4 {\n    padding-left: 1rem;\n  }\n  .pl-6 {\n    padding-left: 1.5rem;\n  }\n  .pl-8 {\n    padding-left: 2rem;\n  }\n  .pl-10 {\n    padding-left: 2.5rem;\n  }\n  .pl-12 {\n    padding-left: 3rem;\n  }\n  .pl-14 {\n    padding-left: 3.5rem;\n  }\n  .pl-16 {\n    padding-left: 4rem;\n  }\n\n  .px-0 {\n    padding-left: 0;\n    padding-right: 0;\n  }\n  .px-1 {\n    padding-left: 0.25rem;\n    padding-right: 0.25rem;\n  }\n  .px-2 {\n    padding-left: 0.5rem;\n    padding-right: 0.5rem;\n  }\n  .px-4 {\n    padding-left: 1rem;\n    padding-right: 1rem;\n  }\n  .px-6 {\n    padding-left: 1.5rem;\n    padding-right: 1.5rem;\n  }\n  .px-8 {\n    padding-left: 2rem;\n    padding-right: 2rem;\n  }\n  .px-10 {\n    padding-left: 2.5rem;\n    padding-right: 2.5rem;\n  }\n  .px-12 {\n    padding-left: 3rem;\n    padding-right: 3rem;\n  }\n  .px-14 {\n    padding-left: 3.5rem;\n    padding-right: 3.5rem;\n  }\n  .px-16 {\n    padding-left: 4rem;\n    padding-right: 4rem;\n  }\n\n  .py-0 {\n    padding-top: 0;\n    padding-bottom: 0;\n  }\n  .py-1 {\n    padding-top: 0.25rem;\n    padding-bottom: 0.25rem;\n  }\n  .py-2 {\n    padding-top: 0.5rem;\n    padding-bottom: 0.5rem;\n  }\n  .py-4 {\n    padding-top: 1rem;\n    padding-bottom: 1rem;\n  }\n  .py-6 {\n    padding-top: 1.5rem;\n    padding-bottom: 1.5rem;\n  }\n  .py-8 {\n    padding-top: 2rem;\n    padding-bottom: 2rem;\n  }\n  .py-10 {\n    padding-top: 2.5rem;\n    padding-bottom: 2.5rem;\n  }\n  .py-12 {\n    padding-top: 3rem;\n    padding-bottom: 3rem;\n  }\n  .py-14 {\n    padding-top: 3.5rem;\n    padding-bottom: 3.5rem;\n  }\n  .py-16 {\n    padding-top: 4rem;\n    padding-bottom: 4rem;\n  }\n`;\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"attention.aria.callout\\\":[\\\"En gr\u00F8n taleboble der introducerer noget nyt\\\"],\\\"attention.aria.close\\\":[\\\"Luk\\\"],\\\"attention.aria.highlight\\\":[\\\"En opm\u00E6rksomhedsskabende taleboble med vigtig information\\\"],\\\"attention.aria.pointingDown\\\":[\\\"peger nedad\\\"],\\\"attention.aria.pointingLeft\\\":[\\\"peger til venstre\\\"],\\\"attention.aria.pointingRight\\\":[\\\"peger til h\u00F8jre\\\"],\\\"attention.aria.pointingUp\\\":[\\\"peger opad\\\"],\\\"attention.aria.popover\\\":[\\\"En hvid taleboble med mere information\\\"],\\\"attention.aria.tooltip\\\":[\\\"En sort taleboble med flere oplysninger\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"attention.aria.callout\\\":[\\\"A green speech bubble introducing something new\\\"],\\\"attention.aria.close\\\":[\\\"Close\\\"],\\\"attention.aria.highlight\\\":[\\\"An attention speech bubble with important information\\\"],\\\"attention.aria.pointingDown\\\":[\\\"pointing down\\\"],\\\"attention.aria.pointingLeft\\\":[\\\"pointing left\\\"],\\\"attention.aria.pointingRight\\\":[\\\"pointing right\\\"],\\\"attention.aria.pointingUp\\\":[\\\"pointing up\\\"],\\\"attention.aria.popover\\\":[\\\"A white speech bubble providing additional information\\\"],\\\"attention.aria.tooltip\\\":[\\\"A black speech bubble providing complementary information\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"attention.aria.callout\\\":[\\\"Vihre\u00E4 puhekupla, joka esittelee jotain uutta\\\"],\\\"attention.aria.close\\\":[\\\"Sulje\\\"],\\\"attention.aria.highlight\\\":[\\\"Puhekupla, joka sis\u00E4lt\u00E4\u00E4 t\u00E4rke\u00E4\u00E4 tietoa\\\"],\\\"attention.aria.pointingDown\\\":[\\\"osoittaa alas\\\"],\\\"attention.aria.pointingLeft\\\":[\\\"osoittaa vasemmalle\\\"],\\\"attention.aria.pointingRight\\\":[\\\"osoittaa oikealle\\\"],\\\"attention.aria.pointingUp\\\":[\\\"osoittaa yl\u00F6s\\\"],\\\"attention.aria.popover\\\":[\\\"Valkoinen puhekupla, joka tarjoaa lis\u00E4tietoa\\\"],\\\"attention.aria.tooltip\\\":[\\\"Musta puhekupla, joka tarjoaa t\u00E4ydent\u00E4v\u00E4\u00E4 tietoa\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"attention.aria.callout\\\":[\\\"Gr\u00F8nn taleboble som introduserer noe nytt\\\"],\\\"attention.aria.close\\\":[\\\"Lukk\\\"],\\\"attention.aria.highlight\\\":[\\\"En uthevet taleboble med viktig informasjon\\\"],\\\"attention.aria.pointingDown\\\":[\\\"peker ned\\\"],\\\"attention.aria.pointingLeft\\\":[\\\"peker til venstre\\\"],\\\"attention.aria.pointingRight\\\":[\\\"peker til h\u00F8yre\\\"],\\\"attention.aria.pointingUp\\\":[\\\"peker opp\\\"],\\\"attention.aria.popover\\\":[\\\"En hvit taleboble som gir tilleggsinformasjon\\\"],\\\"attention.aria.tooltip\\\":[\\\"En svart taleboble som forklarer konteksten\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"attention.aria.callout\\\":[\\\"En gr\u00F6n pratbubbla som introducerar n\u00E5got nytt\\\"],\\\"attention.aria.close\\\":[\\\"St\u00E4ng\\\"],\\\"attention.aria.highlight\\\":[\\\"En pratbubbla med viktig information\\\"],\\\"attention.aria.pointingDown\\\":[\\\"pekar ned\\\"],\\\"attention.aria.pointingLeft\\\":[\\\"pekar v\u00E4nster\\\"],\\\"attention.aria.pointingRight\\\":[\\\"pekar h\u00F6ger\\\"],\\\"attention.aria.pointingUp\\\":[\\\"pekar upp\\\"],\\\"attention.aria.popover\\\":[\\\"En vit pratbubbla som ger ytterligare information\\\"],\\\"attention.aria.tooltip\\\":[\\\"En svart pratbubbla som ger kompletterande information\\\"]}\");", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.hover\\\\:bg-clip-padding:hover{-webkit-background-clip:padding-box;background-clip:padding-box}.bg-transparent{background-color:#0000}.bg-\\\\[--w-color-button-primary-background\\\\]{background-color:var(--w-color-button-primary-background)}.bg-\\\\[--w-color-callout-background\\\\]{background-color:var(--w-color-callout-background)}.bg-\\\\[--w-s-color-surface-elevated-300\\\\]{background-color:var(--w-s-color-surface-elevated-300)}.hover\\\\:bg-\\\\[--w-color-button-pill-background-hover\\\\]:hover{background-color:var(--w-color-button-pill-background-hover)}.hover\\\\:bg-\\\\[--w-color-button-primary-background-hover\\\\]:hover{background-color:var(--w-color-button-primary-background-hover)}.active\\\\:bg-\\\\[--w-color-button-pill-background-active\\\\]:active{background-color:var(--w-color-button-pill-background-active)}.active\\\\:bg-\\\\[--w-color-button-primary-background-active\\\\]:active{background-color:var(--w-color-button-primary-background-active)}.border{border-width:1px}.border-0{border-width:0}.border-2{border-width:2px}.border-b-0{border-bottom-width:0}.border-r-0{border-right-width:0}.border-\\\\[--w-color-callout-border\\\\]{border-color:var(--w-color-callout-border)}.border-\\\\[--w-s-color-background-inverted\\\\]{border-color:var(--w-s-color-background-inverted)}.border-\\\\[--w-s-color-surface-elevated-300\\\\]{border-color:var(--w-s-color-surface-elevated-300)}.border-solid{border-style:solid}.rounded-4{border-radius:4px}.rounded-8{border-radius:8px}.rounded-full{border-radius:9999px}.rounded-tl-4{border-top-left-radius:4px}.inline{display:inline}.flex{display:flex}.inline-flex{display:inline-flex}.contents{display:contents}.hidden{display:none}.hover\\\\:underline:hover,.focus\\\\:underline:focus,.active\\\\:underline:active{text-decoration-line:underline}.focusable:focus{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:focus-visible{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:not(:focus-visible){outline:none}.items-start{align-items:flex-start}.items-center{align-items:center}.-bottom-\\\\[8px\\\\]{bottom:-8px}.-left-\\\\[8px\\\\]{left:-8px}.-right-\\\\[8px\\\\]{right:-8px}.-top-\\\\[8px\\\\]{top:-8px}.justify-center{justify-content:center}.justify-self-end{justify-self:end}.absolute{position:absolute}.relative{position:relative}.static{position:static}.z-50{z-index:50}.s-bg{background-color:var(--w-s-color-background)}.s-bg-disabled{background-color:var(--w-s-color-background-disabled)}.s-bg-inverted{background-color:var(--w-s-color-background-inverted)}.s-bg-negative{background-color:var(--w-s-color-background-negative)}.s-bg-subtle{background-color:var(--w-s-color-background-subtle)}.hover\\\\:s-bg-hover:hover{background-color:var(--w-s-color-background-hover)}.hover\\\\:s-bg-negative-hover:hover{background-color:var(--w-s-color-background-negative-hover)}.hover\\\\:s-bg-negative-subtle-hover:hover{background-color:var(--w-s-color-background-negative-subtle-hover)}.active\\\\:s-bg-active:active{background-color:var(--w-s-color-background-active)}.active\\\\:s-bg-negative-active:active{background-color:var(--w-s-color-background-negative-active)}.active\\\\:s-bg-negative-subtle-active:active{background-color:var(--w-s-color-background-negative-subtle-active)}.s-text{color:var(--w-s-color-text)}.s-text-inverted{color:var(--w-s-color-text-inverted)}.s-text-inverted-static{color:var(--w-s-color-text-inverted-static)}.s-text-link{color:var(--w-s-color-text-link)}.s-text-negative{color:var(--w-s-color-text-negative)}.s-icon{color:var(--w-s-color-icon)}.hover\\\\:s-icon-hover:hover{color:var(--w-s-color-icon-hover)}.active\\\\:s-icon-active:active{color:var(--w-s-color-icon-active)}.s-border{border-color:var(--w-s-color-border)}.hover\\\\:s-border-hover:hover{border-color:var(--w-s-color-border-hover)}.active\\\\:s-border-active:active{border-color:var(--w-s-color-border-active)}.drop-shadow-m{filter:drop-shadow(0 3px 8px #4040403d)drop-shadow(0 3px 6px #40404029)}.shadow-m{box-shadow:var(--w-shadow-m)}.h-\\\\[14px\\\\]{height:14px}.w-\\\\[14px\\\\]{width:14px}.-mr-8{margin-right:-.8rem}.last-child\\\\:mb-0>:last-child{margin-bottom:0}.ml-8{margin-left:.8rem}.p-16{padding:1.6rem}.p-4{padding:.4rem}.px-16{padding-left:1.6rem;padding-right:1.6rem}.px-8{padding-left:.8rem;padding-right:.8rem}.py-6{padding-top:.6rem;padding-bottom:.6rem}.py-8{padding-top:.8rem;padding-bottom:.8rem}.font-bold{font-weight:700}.resize{resize:both}.translate-z-0{--w-translate-z:0rem;transform:translateX(var(--w-translate-x))translateY(var(--w-translate-y))translateZ(var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.transform{transform:translateX(var(--w-translate-x))translateY(var(--w-translate-y))translateZ(var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.transition-colors{transition-property:color,background-color,border-color,text-decoration-color,fill,stroke;transition-duration:.15s;transition-timing-function:cubic-bezier(.4,0,.2,1)}.ease-in-out{transition-timing-function:cubic-bezier(.4,0,.2,1)}.text-m{font-size:var(--w-font-size-m);line-height:var(--w-line-height-m)}.text-xs{font-size:var(--w-font-size-xs);line-height:var(--w-line-height-xs)}.leading-\\\\[24\\\\]{line-height:2.4rem}`;\n", "// @warp-css;\nimport { css, html, LitElement, nothing } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { i18n } from '@lingui/core';\nimport { opposites, directions, arrowDirectionClassname, useRecompute as recompute, Directions } from '@warp-ds/core/attention';\nimport { property } from 'lit/decorators.js';\nimport { ifDefined } from 'lit/directives/if-defined.js';\n\nimport { activateI18n } from '../i18n';\nimport { reset } from '../styles';\nimport { generateRandomId } from '../utils/index.js';\n\nimport { styles as layoutStyles } from './layout-styles';\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\nimport { styles } from './styles';\n\nimport '@warp-ds/icons/elements/close-16';\n\nconst buttonTextSizes = {\n  medium: 'text-m leading-[24]',\n  xsmall: 'text-xs',\n};\n\nconst buttonColors = {\n  primary:\n    's-text-inverted bg-[--w-color-button-primary-background] hover:bg-[--w-color-button-primary-background-hover] active:bg-[--w-color-button-primary-background-active]',\n  secondary: 's-text-link s-border s-bg hover:s-bg-hover hover:s-border-hover active:s-bg-active',\n  utility: 's-text s-bg hover:s-bg-hover active:s-bg-active s-border hover:s-border-hover active:s-border-active',\n  destructive: 's-bg-negative s-text-inverted hover:s-bg-negative-hover active:s-bg-negative-active',\n  pill: 's-icon hover:s-icon-hover active:s-icon-active bg-transparent hover:bg-[--w-color-button-pill-background-hover] active:bg-[--w-color-button-pill-background-active]',\n  disabled: 's-text-inverted s-bg-disabled',\n  quiet: 'bg-transparent s-text-link hover:s-bg-hover active:s-bg-active',\n  utilityQuiet: 's-text bg-transparent hover:s-bg-hover active:s-bg-active',\n  negativeQuiet: 'bg-transparent s-text-negative hover:s-bg-negative-subtle-hover active:s-bg-negative-subtle-active',\n  loading: 's-text s-bg-subtle',\n  link: 's-text-link',\n};\n\nconst buttonDefaultStyling = 'font-bold focusable justify-center transition-colors ease-in-out';\nconst buttonTypes = {\n  primary: `border-0 rounded-8 ${buttonDefaultStyling}`,\n  secondary: `border-2 rounded-8 ${buttonDefaultStyling}`,\n  utility: `border rounded-4 ${buttonDefaultStyling}`,\n  negative: `border-0 rounded-8 ${buttonDefaultStyling}`,\n  pill: `p-4 rounded-full border-0 inline-flex items-center justify-center hover:bg-clip-padding ${buttonDefaultStyling}`,\n  link: `bg-transparent focusable ease-in-out inline active:underline hover:underline focus:underline ${buttonColors.link}`,\n};\n\nexport const ccAttention = {\n  base: 'border-2 relative flex items-start',\n  tooltip: 's-bg-inverted border-[--w-s-color-background-inverted] shadow-m s-text-inverted-static rounded-4 py-6 px-8',\n  callout: 'bg-[--w-color-callout-background] border-[--w-color-callout-border] s-text py-8 px-16 rounded-8',\n  highlight: 'bg-[--w-color-callout-background] border-[--w-color-callout-border] s-text py-8 px-16 rounded-8 drop-shadow-m translate-z-0',\n  popover:\n    'bg-[--w-s-color-surface-elevated-300] border-[--w-s-color-surface-elevated-300] s-text rounded-8 p-16 drop-shadow-m translate-z-0',\n\n  arrowBase: 'absolute h-[14px] w-[14px] border-2 border-b-0 border-r-0 rounded-tl-4 transform',\n  arrowDirectionLeftStart: '-left-[8px]',\n  arrowDirectionLeft: '-left-[8px]',\n  arrowDirectionLeftEnd: '-left-[8px]',\n  arrowDirectionRightStart: '-right-[8px]',\n  arrowDirectionRight: '-right-[8px]',\n  arrowDirectionRightEnd: '-right-[8px]',\n  arrowDirectionBottomStart: '-bottom-[8px]',\n  arrowDirectionBottom: '-bottom-[8px]',\n  arrowDirectionBottomEnd: '-bottom-[8px]',\n  arrowDirectionTopStart: '-top-[8px]',\n  arrowDirectionTop: '-top-[8px]',\n  arrowDirectionTopEnd: '-top-[8px]',\n  arrowTooltip: 's-bg-inverted border-[--w-s-color-background-inverted]',\n  arrowCallout: 'bg-[--w-color-callout-background] border-[--w-color-callout-border]',\n  arrowPopover: 'bg-[--w-s-color-surface-elevated-300] border-[--w-s-color-surface-elevated-300]',\n  arrowHighlight: 'bg-[--w-color-callout-background] border-[--w-color-callout-border]',\n\n  content: 'last-child:mb-0',\n  notCallout: 'absolute z-50',\n  closeBtn: `${buttonTextSizes.medium} ${buttonTypes.pill} ${buttonColors.pill} justify-self-end -mr-8 ml-8`,\n};\n\nclass WarpAttention extends LitElement {\n  @property({ type: Boolean, reflect: true })\n  show: boolean;\n\n  @property({ type: String, reflect: true })\n  placement: Directions;\n\n  @property({ type: Boolean, reflect: true })\n  tooltip: boolean;\n\n  @property({ type: Boolean, reflect: true })\n  callout: boolean;\n\n  @property({ type: Boolean, reflect: true })\n  // @ts-expect-error This was introduced before native HTML popover\n  popover: boolean;\n\n  @property({ type: Boolean, reflect: true })\n  highlight: boolean;\n\n  @property({ attribute: 'can-close', type: Boolean, reflect: true })\n  canClose: boolean;\n\n  @property({ attribute: 'no-arrow', type: Boolean, reflect: true })\n  noArrow: boolean;\n\n  @property({ type: Number, reflect: true })\n  distance: number;\n\n  @property({ type: Number, reflect: true })\n  skidding: number;\n\n  @property({ type: Boolean, reflect: true })\n  flip: boolean;\n\n  @property({ attribute: 'cross-axis', type: Boolean, reflect: true })\n  crossAxis: boolean;\n\n  @property({ attribute: 'fallback-placements', type: Array, reflect: true })\n  fallbackPlacements: Directions[];\n\n  /** @internal */\n  attentionState;\n\n  // To store the initial placement value for reference when computing the actual direction\n  /** @internal */\n  _initialPlacement: Directions;\n\n  static styles = [\n    reset,\n    layoutStyles,\n    styles,\n    css`\n      #attention {\n        position: absolute;\n        z-index: 50;\n        visibility: var(--attention-visibility);\n        display: var(--attention-display);\n      }\n      :host([popover]:not(:popover-open):not(dialog[open])) {\n        display: contents;\n      }\n    `,\n  ];\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n    this.handleDone = this.handleDone.bind(this);\n\n    this.show = false;\n    this.placement = 'bottom';\n    this.tooltip = false;\n    this.callout = false;\n    this.popover = false;\n    this.highlight = false;\n    this.canClose = false;\n    this.noArrow = false;\n    this.distance = 8;\n    this.skidding = 0;\n    this.flip = false;\n    this.crossAxis = false;\n    this._initialPlacement = this.placement;\n    this._actualDirection = this.placement;\n  }\n\n  connectedCallback() {\n    super.connectedCallback();\n    if (this.placement && !Object.keys(opposites).includes(this.placement)) {\n      throw new Error(`Invalid \"placement\" attribute. Set its value to one of the following:\\n${JSON.stringify(Object.keys(opposites))}`);\n    }\n\n    if (this.fallbackPlacements && !this.fallbackPlacements.every((fallbackPlacement) => directions.includes(fallbackPlacement))) {\n      throw new Error(\n        `Invalid \"fallbackPlacements\" attribute. Set its value to an array with one or more of the following:\\n${JSON.stringify(directions)}`,\n      );\n    }\n\n    // Fix FOUC effect issues\n    setTimeout(() => {\n      this.requestUpdate();\n      this.handleDone(); // Run handleDone initially, to compute correct arrow position etc. directly.\n    }, 0);\n\n    if (!this.callout) {\n      window.addEventListener('click', this.handleDone);\n      window.addEventListener('scroll', this.handleDone);\n      window.addEventListener('resize', this.handleDone);\n      window.addEventListener('touch', this.handleDone);\n    }\n\n    if (this.tooltip) {\n      window.addEventListener('mouseover', this.handleDone);\n      window.addEventListener('mouseout', this.handleDone);\n    }\n  }\n\n  disconnectedCallback() {\n    window.removeEventListener('click', this.handleDone);\n    window.removeEventListener('scroll', this.handleDone);\n    window.removeEventListener('resize', this.handleDone);\n    window.removeEventListener('touch', this.handleDone);\n    window.removeEventListener('mouseover', this.handleDone);\n    window.removeEventListener('mouseout', this.handleDone);\n\n    super.disconnectedCallback();\n  }\n\n  handleDone() {\n    window.requestAnimationFrame(() => {\n      if (this.show && this._targetEl && this._attentionEl) {\n        recompute(this.attentionState).then((state) => {\n          this._actualDirection = state?.actualDirection;\n        });\n      } else {\n        this._actualDirection = this._initialPlacement;\n      }\n    });\n  }\n\n  /** @internal */\n  get _actualDirection() {\n    return this.placement;\n  }\n\n  /** @internal */\n  set _actualDirection(v) {\n    this.placement = v;\n  }\n\n  /** @internal */\n  get _arrowEl() {\n    return this.renderRoot.querySelector('#arrow');\n  }\n\n  /** @internal */\n  get _arrowDirection() {\n    return opposites[this._actualDirection];\n  }\n\n  /** @internal */\n  get _arrowClasses() {\n    return classNames([\n      ccAttention.arrowBase,\n      this._activeVariantClasses.arrow,\n      ccAttention[`arrowDirection${arrowDirectionClassname(this._arrowDirection)}`],\n    ]);\n  }\n\n  /** @internal */\n  get _arrowHtml() {\n    return this.noArrow ? '' : html`<div id=\"arrow\" class=\"${this._arrowClasses}\"></div>`;\n  }\n\n  /** @internal */\n  get _activeVariantClasses() {\n    const variantProps = {\n      callout: this.callout,\n      popover: this.popover,\n      tooltip: this.tooltip,\n      highlight: this.highlight,\n    };\n\n    const activeVariant = Object.keys(variantProps).find((b) => !!variantProps[b]) || '';\n\n    return {\n      wrapper: ccAttention[activeVariant],\n      arrow: ccAttention[`arrow${activeVariant.charAt(0).toUpperCase() + activeVariant.slice(1)}`],\n    };\n  }\n\n  /** @internal */\n  get _attentionEl(): HTMLDivElement {\n    return this.renderRoot.querySelector('#attention');\n  }\n\n  /** @internal */\n  get _targetEl(): Element | null {\n    const targetSlot: HTMLSlotElement = this.renderRoot?.querySelector(\"slot[name='target']\");\n    return targetSlot ? targetSlot.assignedElements()[0] : null;\n  }\n\n  /** @internal */\n  get _messageEl(): Element | null {\n    const messageSlot: HTMLSlotElement = this.renderRoot.querySelector(\"slot[name='message']\");\n    return messageSlot ? messageSlot.assignedElements()[0] : null;\n  }\n\n  /** @internal */\n  get _wrapperClasses() {\n    return classNames([ccAttention.base, this._activeVariantClasses.wrapper]);\n  }\n\n  /** @internal */\n  get _ariaClose() {\n    return i18n._({\n      id: 'attention.aria.close',\n      message: 'Close',\n      comment: 'Aria label for the close button in attention',\n    });\n  }\n\n  /** @internal */\n  get _closeBtnHtml() {\n    return html`\n      <button aria-label=\"${this._ariaClose}\" @click=\"${this.close}\" @keydown=${this.keypressed} class=\"${ccAttention.closeBtn}\">\n        <w-icon-close-16 style=\"height: 16px; width: 16px; display: flex;\"></w-icon-close-16>\n      </button>\n    `;\n  }\n\n  updated() {\n    if (!this.callout) {\n      this._attentionEl.style.setProperty('--attention-visibility', this.show ? '' : 'hidden');\n    }\n\n    if (!this.tooltip) {\n      this._attentionEl.style.setProperty('--attention-display', this.show ? 'flex' : 'none');\n    }\n\n    this.attentionState = {\n      isShowing: this.show,\n      isCallout: this.callout,\n      actualDirection: this._actualDirection,\n      directionName: this.placement,\n      arrowEl: this._arrowEl,\n      attentionEl: this._attentionEl,\n      targetEl: this._targetEl,\n      noArrow: this.noArrow,\n      distance: this.distance,\n      skidding: this.skidding,\n      flip: this.flip,\n      crossAxis: this.crossAxis,\n      fallbackPlacements: this.fallbackPlacements,\n    };\n\n    // We need to recompute here as well if this._actualDirection gets updated immediately when this.show is true (in this.handleDone()).\n    // Otherwise this._arrowDirection will get this._initialPlacement's value and will only be updated on next click/scroll/resize\n    recompute(this.attentionState);\n  }\n\n  pointingAtDirection() {\n    switch (opposites[this._actualDirection]) {\n      case 'top-start':\n      case 'top':\n      case 'top-end':\n        return i18n._({\n          id: 'attention.aria.pointingUp',\n          message: 'pointing up',\n          comment: 'Default screenreader message for top direction in the attention component',\n        });\n      case 'right-start':\n      case 'right':\n      case 'right-end':\n        return i18n._({\n          id: 'attention.aria.pointingRight',\n          message: 'pointing right',\n          comment: 'Default screenreader message for right direction in the attention component',\n        });\n      case 'bottom-start':\n      case 'bottom':\n      case 'bottom-end':\n        return i18n._({\n          id: 'attention.aria.pointingDown',\n          message: 'pointing down',\n          comment: 'Default screenreader message for bottom direction in the attention component',\n        });\n      case 'left-start':\n      case 'left':\n      case 'left-end':\n        return i18n._({\n          id: 'attention.aria.pointingLeft',\n          message: 'pointing left',\n          comment: 'Default screenreader message for left direction in the attention component',\n        });\n      default:\n        return '';\n    }\n  }\n\n  activeAttentionType() {\n    switch (true) {\n      case this.tooltip:\n        return i18n._({\n          id: 'attention.aria.tooltip',\n          message: 'tooltip',\n          comment: 'Default screenreader message for tooltip in the attention component',\n        });\n      case this.callout:\n        return i18n._({\n          id: 'attention.aria.callout',\n          message: 'callout speech bubble',\n          comment: 'Default screenreader message for callout speech bubble in the attention component',\n        });\n      case this.popover:\n        return i18n._({\n          id: 'attention.aria.popover',\n          message: 'popover speech bubble',\n          comment: 'Default screenreader message for popover speech bubble in the attention component',\n        });\n      case this.highlight:\n        return i18n._({\n          id: 'attention.aria.highlight',\n          message: 'highlighted speech bubble',\n          comment: 'Default screenreader message for highlighted speech bubble in the attention component',\n        });\n      default:\n        return '';\n    }\n  }\n\n  defaultAriaLabel() {\n    return `${this.activeAttentionType()} ${!this.noArrow ? this.pointingAtDirection() : ''}`;\n  }\n  setAriaLabels() {\n    if (this._targetEl && !this._targetEl.getAttribute('aria-details')) {\n      const attentionMessageId = this._messageEl.id || (this._messageEl.id = generateRandomId());\n      this._targetEl.setAttribute('aria-details', attentionMessageId);\n    }\n  }\n\n  firstUpdated() {\n    this._initialPlacement = this.placement;\n    this.setAriaLabels();\n\n    // Attention of \"callout\" type should always be used inline\n    if (this.callout) {\n      this._attentionEl.style.position = 'relative';\n    }\n  }\n\n  close() {\n    const event = new CustomEvent('close', {\n      bubbles: true,\n      composed: true,\n    });\n    this.updateComplete.then(() => this.dispatchEvent(event));\n  }\n\n  keypressed(e: KeyboardEvent) {\n    if (!this.canClose) return;\n    if (e.key === 'Escape') {\n      e.preventDefault();\n      this.close();\n    }\n  }\n\n  render() {\n    if (!this.callout && this._targetEl === undefined) return html``;\n    return html`\n      <div class=${ifDefined(this.className ? this.className : undefined)}>\n        ${this.placement === 'right-start' ||\n        this.placement === 'right' ||\n        this.placement === 'right-end' ||\n        this.placement === 'bottom-start' ||\n        this.placement === 'bottom' ||\n        this.placement === 'bottom-end' // Attention's and its arrow's visual position should be reflected in the DOM\n          ? html`\n              <slot name=\"target\"></slot>\n\n              <div id=\"attention\" class=\"${this._wrapperClasses}\">\n                <div role=\"${this.tooltip ? 'tooltip' : 'img'}\" aria-label=\"${this.defaultAriaLabel()}\">${this._arrowHtml}</div>\n                <slot name=\"message\"></slot>\n                ${this.canClose ? this._closeBtnHtml : nothing}\n              </div>\n            `\n          : html`\n              <div id=\"attention\" class=\"${this._wrapperClasses}\">\n                <slot name=\"message\"></slot>\n                <div role=\"${this.tooltip ? 'tooltip' : 'img'}\" aria-label=\"${this.defaultAriaLabel()}\">${this._arrowHtml}</div>\n                ${this.canClose ? this._closeBtnHtml : nothing}\n              </div>\n              <slot name=\"target\"></slot>\n            `}\n      </div>\n    `;\n  }\n}\n\nif (!customElements.get('w-attention')) {\n  // @ts-expect-error Overriding native HTML popover global attribute\n  customElements.define('w-attention', WarpAttention);\n}\n\nexport { WarpAttention };\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/info/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/info/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/info/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/info/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/info/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconInfo16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Information circle`, id: 'icon.title.info', comment: 'Title for info icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-info-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-miterlimit=\"10\" d=\"M8 6.5v5\"></path><path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" d=\"M8 4v.5\"></path><path stroke=\"currentColor\" stroke-miterlimit=\"10\" d=\"M8 .5a7.5 7.5 0 1 1 0 15 7.5 7.5 0 0 1 0-15Z\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-info-16')) {\n  customElements.define('w-icon-info-16', IconInfo16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.info\\\":[\\\"Informasjonssirkel\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.info\\\":[\\\"Information circle\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.info\\\":[\\\"Ympyr\u00E4, jonka sis\u00E4ll\u00E4 on i-kirjain\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.info\\\":[\\\"Informationscirkel\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.info\\\":[\\\"Informationscirkel\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/warning/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/warning/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/warning/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/warning/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/warning/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconWarning16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Warning triangle with exclamation point`, id: 'icon.title.warning', comment: 'Title for warning icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-warning-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" d=\"m.712 14.07 6.25-12.994a1 1 0 0 1 1.792-.022l6.635 12.995a1 1 0 0 1-.89 1.455H1.613a1 1 0 0 1-.902-1.434Z\"></path><path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" d=\"M8 6v4.992M8 13v.333\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-warning-16')) {\n  customElements.define('w-icon-warning-16', IconWarning16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.warning\\\":[\\\"Varseltrekant med utropstegn\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.warning\\\":[\\\"Warning triangle with exclamation point\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.warning\\\":[\\\"Varoituskolmio, jonka sis\u00E4ll\u00E4 on huutomerkki\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.warning\\\":[\\\"Advarselstrekant med et udr\u00E5bstegn\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.warning\\\":[\\\"Varningstriangel med utropstecken\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/error/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/error/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/error/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/error/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/error/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconError16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Octagon with exclamation point`, id: 'icon.title.error', comment: 'Title for error icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-error-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" d=\"M.5 11.107 4.748 15.5h6.503l4.248-4.393V4.893L11.252.5H4.748L.5 4.893z\"></path><path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" d=\"M8 11.398a.25.25 0 1 1 0-.5m0 .5a.25.25 0 1 0 0-.5\"></path><path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" stroke-miterlimit=\"10\" d=\"M8 8.5V3\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-error-16')) {\n  customElements.define('w-icon-error-16', IconError16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.error\\\":[\\\"\u00C5ttekant med utropstegn\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.error\\\":[\\\"Octagon with exclamation point\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.error\\\":[\\\"Kahdeksankulmio, jonka sis\u00E4ll\u00E4 on huutomerkki\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.error\\\":[\\\"Ottekant med et udr\u00E5bstegn\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.error\\\":[\\\"Oktagon med utropstecken\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/success/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/success/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/success/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/success/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/success/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconSuccess16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Circle with checkmark`, id: 'icon.title.success', comment: 'Title for success icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-success-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" d=\"m4 8.815 1.633 2.318a.7.7 0 0 0 1.138.034l5.228-6.615\"></path><path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" d=\"M.5 7.999a7.5 7.5 0 1 0 15 0 7.5 7.5 0 0 0-15 0\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-success-16')) {\n  customElements.define('w-icon-success-16', IconSuccess16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.success\\\":[\\\"Sirkel med sjekkmerke\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.success\\\":[\\\"Circle with checkmark\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.success\\\":[\\\"Ympyr\u00E4, jonka sis\u00E4ll\u00E4 on valintamerkki\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.success\\\":[\\\"Cirkel med et flueben\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.success\\\":[\\\"Cirkel med bock\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.will-change-height{will-change:height}.border{border-width:1px}.border-l-4{border-left-width:4px}.rounded-4{border-radius:4px}.block{display:block}.flex{display:flex}.static{position:static}.s-bg-info-subtle{background-color:var(--w-s-color-background-info-subtle)}.s-bg-negative-subtle{background-color:var(--w-s-color-background-negative-subtle)}.s-bg-positive-subtle{background-color:var(--w-s-color-background-positive-subtle)}.s-bg-warning-subtle{background-color:var(--w-s-color-background-warning-subtle)}.s-text{color:var(--w-s-color-text)}.s-icon-info{color:var(--w-s-color-icon-info)}.s-icon-negative{color:var(--w-s-color-icon-negative)}.s-icon-positive{color:var(--w-s-color-icon-positive)}.s-icon-warning{color:var(--w-s-color-icon-warning)}.s-border-info-subtle{border-color:var(--w-s-color-border-info-subtle)}.s-border-l-info{border-left-color:var(--w-s-color-border-info)}.s-border-l-negative{border-left-color:var(--w-s-color-border-negative)}.s-border-l-positive{border-left-color:var(--w-s-color-border-positive)}.s-border-l-warning{border-left-color:var(--w-s-color-border-warning)}.s-border-negative-subtle{border-color:var(--w-s-color-border-negative-subtle)}.s-border-positive-subtle{border-color:var(--w-s-color-border-positive-subtle)}.s-border-warning-subtle{border-color:var(--w-s-color-border-warning-subtle)}.min-w-16{min-width:1.6rem}.w-16{width:1.6rem}.last-child\\\\:mb-0>:last-child{margin-bottom:0}.mr-8{margin-right:.8rem}.p-16{padding:1.6rem}.text-s{font-size:var(--w-font-size-s);line-height:var(--w-line-height-s)}`;", "// @warp-css;\n\nimport { css, html, LitElement } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { property } from 'lit/decorators.js';\n\nimport '@warp-ds/icons/elements/info-16';\nimport '@warp-ds/icons/elements/warning-16';\nimport '@warp-ds/icons/elements/error-16';\nimport '@warp-ds/icons/elements/success-16';\nimport { reset } from '../styles.js';\n\nimport { styles } from './styles.js';\n\nconst ccAlert = {\n  wrapper: 'flex p-16 border border-l-4 rounded-4 s-text',\n  willChangeHeight: 'will-change-height',\n  textWrapper: 'last-child:mb-0 text-s',\n  title: 'text-s',\n  icon: 'w-16 mr-8 min-w-16',\n  negative: 's-border-negative-subtle s-border-l-negative s-bg-negative-subtle',\n  negativeIcon: 's-icon-negative',\n  positive: 's-border-positive-subtle s-border-l-positive s-bg-positive-subtle',\n  positiveIcon: 's-icon-positive',\n  warning: 's-border-warning-subtle s-border-l-warning s-bg-warning-subtle',\n  warningIcon: 's-icon-warning',\n  info: 's-border-info-subtle s-border-l-info s-bg-info-subtle',\n  infoIcon: 's-icon-info',\n};\n\ntype AlertVariants = 'negative' | 'positive' | 'warning' | 'info';\n\nconst alertVariants = {\n  negative: 'negative',\n  positive: 'positive',\n  warning: 'warning',\n  info: 'info',\n};\n\n/**\n * Alert is an inline component used for displaying different types of messages.\n *\n * For accessibility reasons, alert should appear close to the element that triggered it.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/feedback-alert--docs)\n */\nclass WarpAlert extends LitElement {\n  @property({ reflect: true })\n  variant: AlertVariants = 'info';\n\n  @property({ type: Boolean, reflect: true })\n  show: boolean = true;\n\n  @property({ reflect: true })\n  role: string = 'alert';\n\n  constructor() {\n    super();\n    this.show = false;\n    this.role = 'alert';\n  }\n\n  connectedCallback() {\n    super.connectedCallback();\n    if (!this.variant || !alertVariants[this.variant]) {\n      throw new Error(`Invalid 'variant' attribute. Set its value to one of the following:\\nnegative, positive, warning, info.`);\n    }\n  }\n\n  /** @internal */\n  get _wrapperClasses() {\n    return classNames([ccAlert.wrapper, ccAlert[this.variant]]);\n  }\n\n  /** @internal */\n  get _iconClasses() {\n    const activeIconClassNames = ccAlert[`${this.variant}Icon`];\n\n    return classNames([ccAlert.icon, activeIconClassNames]);\n  }\n\n  // Slotted elements remain in lightDOM which allows for control of their style outside of shadowDOM.\n  // ::slotted([Simple Selector]) confirms to Specificity rules, but (being simple) does not add weight to lightDOM skin selectors,\n  // so never gets higher Specificity. Thus in order to overwrite style linked within shadowDOM, we need to use !important.\n  // https://stackoverflow.com/a/61631668\n  static styles = [\n    reset,\n    styles,\n    css`\n      :host {\n        display: block;\n      }\n\n      ::slotted(:first-child) {\n        margin-top: 0px;\n      }\n\n      ::slotted(:last-child) {\n        margin-bottom: 0px !important;\n      }\n    `,\n  ];\n\n  /** @internal */\n  get _icon() {\n    if (this.variant === alertVariants.info) {\n      return html` <w-icon-info-16></w-icon-info-16>`;\n    }\n    if (this.variant === alertVariants.warning) {\n      return html` <w-icon-warning-16></w-icon-warning-16>`;\n    }\n    if (this.variant === alertVariants.negative) {\n      return html` <w-icon-error-16></w-icon-error-16>`;\n    }\n    if (this.variant === alertVariants.positive) {\n      return html` <w-icon-success-16></w-icon-success-16>`;\n    } else return '';\n  }\n\n  render() {\n    return html`\n      <w-expand-transition ?show=${this.show}>\n        <div role=${this.role} class=${this._wrapperClasses}>\n          <div class=${this._iconClasses}>${this._icon}</div>\n          <div class=${ccAlert.textWrapper}>\n            <slot></slot>\n          </div>\n        </div>\n      </w-expand-transition>\n    `;\n  }\n}\n\nif (!customElements.get('w-alert')) {\n  customElements.define('w-alert', WarpAlert);\n}\n\nexport { WarpAlert };\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-alert': WarpAlert;\n  }\n}\n", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.backdrop-blur{-webkit-backdrop-filter:blur(4px);backdrop-filter:blur(4px)}.bg-\\\\[--w-black\\\\/70\\\\]{background-color:rgba(var(--w-rgb-black),.7)}.bg-\\\\[--w-color-badge-info-background\\\\]{background-color:var(--w-color-badge-info-background)}.bg-\\\\[--w-color-badge-negative-background\\\\]{background-color:var(--w-color-badge-negative-background)}.bg-\\\\[--w-color-badge-neutral-background\\\\]{background-color:var(--w-color-badge-neutral-background)}.bg-\\\\[--w-color-badge-positive-background\\\\]{background-color:var(--w-color-badge-positive-background)}.bg-\\\\[--w-color-badge-sponsored-background\\\\]{background-color:var(--w-color-badge-sponsored-background)}.bg-\\\\[--w-color-badge-warning-background\\\\]{background-color:var(--w-color-badge-warning-background)}.border-0{border-width:0}.rounded-4{border-radius:4px}.rounded-bl-0{border-bottom-left-radius:0}.rounded-br-0{border-bottom-right-radius:0}.rounded-tl-0{border-top-left-radius:0}.rounded-tr-0{border-top-right-radius:0}.inline-flex{display:inline-flex}.bottom-0{bottom:0}.left-0{left:0}.right-0{right:0}.top-0{top:0}.absolute{position:absolute}.static{position:static}.s-bg-disabled{background-color:var(--w-s-color-background-disabled)}.s-text{color:var(--w-s-color-text)}.s-text-inverted-static{color:var(--w-s-color-text-inverted-static)}.px-8{padding-left:.8rem;padding-right:.8rem}.py-4{padding-top:.4rem;padding-bottom:.4rem}.text-xs{font-size:var(--w-font-size-xs);line-height:var(--w-line-height-xs)}`;\n", "// @warp-css;\nimport { html, LitElement } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { property } from 'lit/decorators.js';\n\nimport { reset } from '../styles';\n\nimport { styles } from './styles';\n\n/**\n * `w-badge` is used for showing a small amount of non-interactive color-categorized metadata, like a status or count.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/layout-badge--docs)\n */\nclass WarpBadge extends LitElement {\n  @property({ type: String, reflect: true })\n  variant: 'neutral' | 'info' | 'positive' | 'warning' | 'negative' | 'disabled' | 'price' | 'sponsored' = 'neutral';\n\n  @property({ type: String, reflect: true })\n  position: 'top-left' | 'top-right' | 'bottom-right' | 'bottom-left';\n\n  static styles = [reset, styles];\n\n  /** @internal */\n  get _class() {\n    return classNames([\n      'py-4 px-8 border-0 rounded-4 text-xs inline-flex',\n      this.variant === 'neutral' && 'bg-[--w-color-badge-neutral-background] s-text',\n      this.variant === 'info' && 'bg-[--w-color-badge-info-background] s-text',\n      this.variant === 'positive' && 'bg-[--w-color-badge-positive-background] s-text',\n      this.variant === 'warning' && 'bg-[--w-color-badge-warning-background] s-text',\n      this.variant === 'negative' && 'bg-[--w-color-badge-negative-background] s-text',\n      this.variant === 'disabled' && 's-bg-disabled s-text',\n      this.variant === 'price' && 'bg-[--w-black/70] s-text-inverted-static',\n      this.variant === 'sponsored' && 'bg-[--w-color-badge-sponsored-background] s-text',\n      !!this.position && 'absolute backdrop-blur',\n      this.position === 'top-left' && 'rounded-tl-0 rounded-tr-0 rounded-bl-0 top-0 left-0',\n      this.position === 'top-right' && 'rounded-tl-0 rounded-tr-0 rounded-br-0 top-0 right-0',\n      this.position === 'bottom-right' && 'rounded-tr-0 rounded-br-0 rounded-bl-0 bottom-0 right-0',\n      this.position === 'bottom-left' && 'rounded-tl-0 rounded-br-0 rounded-bl-0 bottom-0 left-0',\n    ]);\n  }\n\n  render() {\n    return html`\n      <div class=\"${this._class}\">\n        <slot></slot>\n      </div>\n    `;\n  }\n}\n\nif (!customElements.get('w-badge')) {\n  customElements.define('w-badge', WarpBadge);\n}\n\nexport { WarpBadge };\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-badge': WarpBadge;\n  }\n}\n", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.border-2{border-width:2px}.rounded-8{border-radius:8px}.rounded-l-0{border-top-left-radius:0;border-bottom-left-radius:0}.rounded-r-0{border-top-right-radius:0;border-bottom-right-radius:0}.block{display:block}.relative{position:relative}.static{position:static}.s-bg{background-color:var(--w-s-color-background)}.s-bg-info-subtle{background-color:var(--w-s-color-background-info-subtle)}.s-border{border-color:var(--w-s-color-border)}.s-surface-sunken{background-color:var(--w-s-color-surface-sunken)}.-mx-16{margin-left:-1.6rem;margin-right:-1.6rem}.last-child\\\\:mb-0>:last-child{margin-bottom:0}.p-16{padding:1.6rem}.break-words{overflow-wrap:break-word}@media (min-width:480px){.sm\\\\:rounded-8{border-radius:8px}.sm\\\\:mx-0{margin-left:0;margin-right:0}}`;\n", "// @warp-css;\nimport { html, LitElement, nothing } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { property } from 'lit/decorators.js';\n\nimport { reset } from '../styles';\n\nimport { styles } from './styles';\n\n/**\n * Box is a layout component used for separating content areas on a page.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/layout-box--docs)\n */\nclass WarpBox extends LitElement {\n  @property({ type: Boolean, reflect: true })\n  bleed: boolean;\n\n  @property({ type: Boolean, reflect: true })\n  bordered: boolean;\n\n  @property({ type: Boolean, reflect: true })\n  info: boolean;\n\n  @property({ type: Boolean, reflect: true })\n  neutral: boolean;\n\n  @property({ type: String, reflect: true })\n  role: string;\n\n  // Slotted elements remain in lightDOM which allows for control of their style outside of shadowDOM.\n  // ::slotted([Simple Selector]) confirms to Specificity rules, but (being simple) does not add weight to lightDOM skin selectors,\n  // so never gets higher Specificity. Thus in order to overwrite style linked within shadowDOM, we need to use !important.\n  // https://stackoverflow.com/a/61631668\n  static styles = [reset, styles];\n\n  /** @internal */\n  get _class() {\n    return classNames([\n      'group block relative break-words last-child:mb-0 p-16 rounded-8',\n      this.bleed && '-mx-16 sm:mx-0 rounded-l-0 rounded-r-0 sm:rounded-8',\n      this.info && 's-bg-info-subtle',\n      this.neutral && 's-surface-sunken',\n      this.bordered && 'border-2 s-border s-bg',\n    ]);\n  }\n\n  /** @internal */\n  get _optOutRoleWithDefault() {\n    return this.role === '' ? nothing : this.role ?? 'region';\n  }\n\n  render() {\n    return html`\n      <div role=\"${this._optOutRoleWithDefault}\" class=\"${this._class}\">\n        <slot></slot>\n      </div>\n    `;\n  }\n}\n\nif (!customElements.get('w-box')) {\n  customElements.define('w-box', WarpBox);\n}\n\nexport { WarpBox };\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-box': WarpBox;\n  }\n}\n", "/**\n * Inject a separator between each item in a list\n * @param array List of items\n * @param separator Element to be interleaved between each item\n * @returns\n */\nexport function interleave(array, separator) {\n    return array.flatMap((el) => [el, separator]).slice(0, -1);\n}\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"breadcrumbs.ariaLabel\\\":[\\\"Du er her\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"breadcrumbs.ariaLabel\\\":[\\\"You are here\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"breadcrumbs.ariaLabel\\\":[\\\"Olet t\u00E4ss\u00E4\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"breadcrumbs.ariaLabel\\\":[\\\"Her er du\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"breadcrumbs.ariaLabel\\\":[\\\"Du \u00E4r h\u00E4r\\\"]}\");", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.flex{display:flex}.static{position:static}.s-text{color:var(--w-s-color-text)}.s-text-link{color:var(--w-s-color-text-link)}.s-icon{color:var(--w-s-color-icon)}.space-x-8>:not([hidden])~:not([hidden]){--w-space-x-reverse:0;margin-left:calc(.8rem*calc(1 - var(--w-space-x-reverse)));margin-right:calc(.8rem*var(--w-space-x-reverse))}.sr-only{clip:rect(0,0,0,0);white-space:nowrap;border-width:0;width:1px;height:1px;margin:-1px;padding:0;position:absolute;overflow:hidden}.select-none{-webkit-user-select:none;user-select:none}`;\n", "// @warp-css;\n\nimport { html, LitElement, TemplateResult } from 'lit';\n\nimport { i18n } from '@lingui/core';\nimport { interleave } from '@warp-ds/core/breadcrumbs';\nimport { property } from 'lit/decorators.js';\n\nimport { activateI18n } from '../i18n';\nimport { reset } from '../styles.js';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\nimport { styles } from './styles.js';\n\nexport const ccBreadcrumbs = {\n  wrapper: 'flex space-x-8',\n  text: 's-text',\n  link: 's-text-link',\n  separator: 'select-none s-icon',\n  a11y: 'sr-only',\n};\n\nconst separator = html`<span class=${ccBreadcrumbs.separator}>/</span>`;\n\n/**\n * Breadcrumbs show the navigation structure for the current location.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/navigation-breadcrumbs--docs)\n */\nclass WarpBreadcrumbs extends LitElement {\n  @property({ attribute: 'aria-label', type: String })\n  ariaLabel: string;\n\n  static styles = [reset, styles];\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n    this.ariaLabel = i18n._({\n      id: 'breadcrumbs.ariaLabel',\n      message: 'You are here',\n      comment: 'Default screen reader message for the breadcrumb component',\n    });\n  }\n\n  /** @internal */\n  _children: Array<Element | TemplateResult>;\n\n  connectedCallback() {\n    super.connectedCallback();\n    // Grab existing children at the point that the component is added to the page\n    const flattenedChildren = Array.from(this.children)\n      .flat(Infinity)\n      .filter((child) => child);\n    const styledChildren = flattenedChildren.map((child, index) => {\n      if (typeof child === 'string') {\n        const isLastEl = index === this.children.length - 1;\n        return html`<span class=${ccBreadcrumbs.text} aria-current=${isLastEl ? 'page' : undefined}>${child}</span>`;\n      }\n      child.classList.add(child.tagName === 'A' ? ccBreadcrumbs.link : ccBreadcrumbs.text);\n      return child;\n    });\n\n    // Interleave '/' separator with breadcrumbs\n    this._children = interleave(styledChildren, separator);\n  }\n\n  render() {\n    return html`\n      <nav aria-labelledby=\"breadCrumbLabel\">\n        <h2 id=\"breadCrumbLabel\" class=${ccBreadcrumbs.a11y}>${this.ariaLabel}</h2>\n        <div class=${ccBreadcrumbs.wrapper}>${this._children}</div>\n      </nav>\n    `;\n  }\n}\n\nif (!customElements.get('w-breadcrumbs')) {\n  customElements.define('w-breadcrumbs', WarpBreadcrumbs);\n}\n\nexport { WarpBreadcrumbs };\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-breadcrumbs': WarpBreadcrumbs;\n  }\n}\n", "import { Constructor, CustomValidityState, FormControlInterface, FormValue, IControlHost, validationMessageCallback, Validator } from './types.js';\n\nexport function FormControlMixin<\n  TBase extends Constructor<HTMLElement & IControlHost> & { observedAttributes?: string [] }\n>(SuperClass: TBase) {\n  class FormControl extends SuperClass {\n    /** Wires up control instances to be form associated */\n    static get formAssociated(): boolean {\n      return true;\n    }\n\n    /**\n     * A list of Validator objects that will be evaluated when a control's form\n     * value is modified or optionally when a given attribute changes.\n     *\n     * When a Validator's callback returns false, the entire form control will\n     * be set to an invalid state.\n     */\n    declare static formControlValidators: Validator[];\n\n     /**\n     * If set to true the control described should be evaluated and validated\n     * as part of a group. Like a radio, if any member of the group's validity\n     * changes the the other members should update as well.\n     */\n    declare static formControlValidationGroup: boolean;\n\n    private static get validators(): Validator[] {\n      return this.formControlValidators || [];\n    }\n\n    /**\n     * Allows the FormControl instance to respond to Validator attributes.\n     * For instance, if a given Validator has a `required` attribute, that\n     * validator will be evaluated whenever the host's required attribute\n     * is updated.\n     */\n     static get observedAttributes(): string[] {\n      const validatorAttributes = this.validators.map((validator) => validator.attribute).flat();\n\n      const observedAttributes = super.observedAttributes || [];\n\n      /** Make sure there are no duplicates inside the attributes list */\n      const attributeSet = new Set([...observedAttributes, ...validatorAttributes]);\n      return [...attributeSet] as string[];\n    }\n\n    /**\n     * Return the validator associated with a given attribute. If no\n     * Validator is associated with the attribute, it will return null.\n     */\n    static getValidator(attribute: string): Validator | null {\n      return this.validators.find((validator) => validator.attribute === attribute) || null;\n    }\n\n    /**\n     * Get all validators that are set to react to a given attribute\n     * @param {string} attribute - The attribute that has changed\n     * @returns {Validator[]}\n     */\n    static getValidators(attribute: string): Validator[] | null {\n      return this.validators.filter(validator => {\n        if (validator.attribute === attribute || validator.attribute?.includes(attribute)) {\n          return true;\n        }\n      });\n    }\n\n    /** The ElementInternals instance for the control. */\n    internals = this.attachInternals();\n\n    /**\n     * Keep track of if the control has focus\n     * @private\n     */\n    #focused = false;\n\n    /**\n     * Exists to control when an error should be displayed\n     * @private\n     */\n    #forceError = false;\n\n    /**\n     * Toggles to true whenever the element has been focused. This property\n     * will reset whenever the control's formResetCallback is called.\n     * @private\n     */\n    #touched = false;\n\n    /** An internal abort controller for cancelling pending async validation */\n    #abortController?: AbortController;\n    #previousAbortController?: AbortController;\n\n    /**\n     * Used for tracking if a validation target has been set to manage focus\n     * when the control's validity is reported\n     */\n    #awaitingValidationTarget = true;\n\n    /** All of the controls within a root with a matching local name and form name */\n    get #formValidationGroup(): NodeListOf<FormControl> {\n      const rootNode = this.getRootNode() as HTMLElement;\n      const selector = `${this.localName}[name=\"${this.getAttribute('name')}\"]`;\n      return rootNode.querySelectorAll<FormControl>(selector);\n    }\n\n    /**\n     * Acts as a cache for the current value so the value can be re-evaluated\n     * whenever an attribute changes or on some other event.\n     */\n    #value: FormValue = '';\n\n    /**\n     * Set this[touched] and this[focused]\n     * to true when the element is focused\n     * @private\n     */\n    #onFocus = (): void => {\n      this.#touched = true;\n      this.#focused = true;\n      this.#shouldShowError();\n    };\n\n    /**\n     * Reset this[focused] on blur\n     * @private\n     */\n    #onBlur = (): void => {\n      this.#focused = false;\n\n      this.#runValidators(this.shouldFormValueUpdate() ? this.#value : '');\n\n      /**\n       * Set forceError to ensure error messages persist until\n       * the value is changed.\n       */\n      if (!this.validity.valid && this.#touched) {\n        this.#forceError = true;\n      }\n      const showError = this.#shouldShowError();\n      if (this.validationMessageCallback) {\n        this.validationMessageCallback(showError ? this.internals.validationMessage : '');\n      }\n    };\n\n    /**\n     * For the show error state on invalid\n     * @private\n     */\n    #onInvalid = (): void => {\n      if (this.#awaitingValidationTarget && this.validationTarget) {\n        this.internals.setValidity(\n          this.validity,\n          this.validationMessage,\n          this.validationTarget\n        );\n        this.#awaitingValidationTarget = false;\n      }\n      this.#touched = true;\n      this.#forceError = true;\n      this.#shouldShowError();\n      this?.validationMessageCallback?.(this.showError ? this.internals.validationMessage : '');\n    };\n\n    /** Return a reference to the control's form */\n    get form(): HTMLFormElement {\n      return this.internals.form;\n    }\n\n    /**\n     * Will return true if it is recommended that the control shows an internal\n     * error. If using this property, it is wise to listen for 'invalid' events\n     * on the element host and call preventDefault on the event. Doing this will\n     * prevent browsers from showing a validation popup.\n     */\n    get showError(): boolean {\n      return this.#shouldShowError();\n    }\n\n    /**\n     * Forward the internals checkValidity method\n     * will return the valid state of the control.\n     */\n    checkValidity(): boolean {\n      return this.internals.checkValidity();\n    }\n\n    /** The element's validity state */\n    get validity(): ValidityState {\n      return this.internals.validity;\n    }\n\n    /**\n     * The validation message shown by a given Validator object. If the control\n     * is in a valid state this should be falsy.\n     */\n    get validationMessage(): string {\n      return this.internals.validationMessage;\n    }\n\n    /* eslint-disable  @typescript-eslint/no-explicit-any */\n    constructor(...args: any[]) {\n      super(...args);\n      this.addEventListener?.('focus', this.#onFocus);\n      this.addEventListener?.('blur', this.#onBlur);\n      this.addEventListener?.('invalid', this.#onInvalid);\n      this.setValue(null);\n    }\n\n    attributeChangedCallback(name: string, oldValue: string, newValue: string): void {\n      super.attributeChangedCallback?.(name, oldValue, newValue);\n\n      /**\n       * Check to see if a Validator is associated with the changed attribute.\n       * If one exists, call control's validate function which will perform\n       * control validation.\n       */\n      const proto = this.constructor as typeof FormControl;\n      const validators = proto.getValidators(name);\n\n      if (validators?.length && this.validationTarget) {\n        this.setValue(this.#value);\n      }\n    }\n\n    /** PUBLIC LIFECYCLE METHODS */\n\n    /**\n     * Sets the control's form value if the call to `shouldFormValueUpdate`\n     * returns `true`.\n     * @param value {FormValue} - The value to pass to the form\n     */\n    setValue(value: FormValue): void {\n      this.#forceError = false;\n      this.validationMessageCallback?.('');\n      this.#value = value;\n      const valueShouldUpdate = this.shouldFormValueUpdate();\n      const valueToUpdate = valueShouldUpdate ? value : null;\n      this.internals.setFormValue(valueToUpdate as string);\n      this.#runValidators(valueToUpdate);\n      if (this.valueChangedCallback) {\n        this.valueChangedCallback(valueToUpdate);\n      }\n      this.#shouldShowError();\n    }\n\n    /**\n     * This method can be overridden to determine if the control's form value\n     * should be set on a call to `setValue`. An example of when a user might want\n     * to skip this step is when implementing checkbox-like behavior, first checking\n     * to see if `this.checked` is set to a truthy value. By default this returns\n     * `true`.\n     */\n    shouldFormValueUpdate(): boolean {\n      return true;\n    }\n\n    /** Save a reference to the validation complete resolver */\n    #validationCompleteResolver?: (value: void | PromiseLike<void>) => void;\n\n    /** When true validation will be pending */\n    #isValidationPending = false;\n\n    #validationComplete = Promise.resolve();\n\n    /** A promise that will resolve when all pending validations are complete */\n    get validationComplete(): Promise<void> {\n      return new Promise(resolve => resolve(this.#validationComplete));\n    }\n\n    /** DECLARED INSTANCE METHODS AND PROPERTIES*/\n\n    /**\n     * Resets a form control to its initial state\n     */\n    declare resetFormControl: () => void;\n\n    /**\n     * This method is used to override the controls' validity message\n     * for a given Validator key. This has the highest level of priority when\n     * setting a validationMessage, so use this method wisely.\n     *\n     * The returned value will be used as the validationMessage for the given key.\n     * @param validationKey {string} - The key that has returned invalid\n     */\n    declare validityCallback: (validationKey: string) => string | void;\n\n     /**\n      * Called when the control's validationMessage should be changed\n      * @param message { string } - The new validation message\n      */\n    declare validationMessageCallback: (message: string) => void;\n\n    /**\n     * A callback for when the controls' form value changes. The value\n     * passed to this function should not be confused with the control's\n     * value property, this is the value that will appear on the form.\n     *\n     * In cases where `checked` did not exist on the control's prototype\n     * upon initialization, this value and the value property will be identical;\n     * in cases where `checked` is present upon initialization, this will be\n     * effectively `this.checked && this.value`.\n     */\n    declare valueChangedCallback: (value: FormValue) => void;\n\n    /**\n     * The element that will receive focus when the control's validity\n     * state is reported either by a form submission or via API\n     *\n     * We use declare since this is optional and we don't particularly\n     * care how the consuming component implements this (as a field, member\n     * or getter/setter)\n     */\n    declare validationTarget: HTMLElement | null;\n\n    /** PRIVATE LIFECYCLE METHODS */\n\n    /**\n     * Check to see if an error should be shown. This method will also\n     * update the internals state object with the --show-error state\n     * if necessary.\n     * @private\n     */\n    #shouldShowError(): boolean {\n      if (this.hasAttribute('disabled')) {\n        return false;\n      }\n\n      const showError = this.#forceError || (this.#touched && !this.validity.valid && !this.#focused);\n\n      /**\n       * At the time of writing Firefox doesn't support states\n       * TODO: Remove when check for states when fully support is in place\n       */\n      if (showError && this.internals.states) {\n        this.internals.states.add('--show-error');\n      } else if (this.internals.states) {\n        this.internals.states.delete('--show-error');\n      }\n\n      return showError;\n    }\n\n    #runValidators(value: FormValue): void {\n      const proto = this.constructor as typeof FormControl;\n      const validity: CustomValidityState = {};\n      const validators = proto.validators;\n      const asyncValidators: Promise<boolean|void>[] = [];\n      const hasAsyncValidators = validators.some((validator) => validator.isValid instanceof Promise)\n\n      if (!this.#isValidationPending) {\n        this.#validationComplete = new Promise(resolve => {\n          this.#validationCompleteResolver = resolve\n        });\n        this.#isValidationPending = true;\n      }\n\n      /**\n       * If an abort controller exists from a previous validation step\n       * notify still-running async validators that we are requesting they\n       * discontinue any work.\n       */\n      if (this.#abortController) {\n        this.#abortController.abort();\n        this.#previousAbortController = this.#abortController;\n      }\n\n      /**\n       * Create a new abort controller and replace the instance reference\n       * so we can clean it up for next time\n       */\n      const abortController = new AbortController();\n      this.#abortController = abortController;\n      let validationMessage: string | undefined = undefined;\n\n      /** Track to see if any validity key has changed */\n      let hasChange = false;\n\n      if (!validators.length) {\n        return;\n      }\n\n      validators.forEach(validator => {\n        const key = validator.key || 'customError';\n        const isValid = validator.isValid(this, value, abortController.signal);\n        const isAsyncValidator = isValid instanceof Promise;\n\n        if (isAsyncValidator) {\n          asyncValidators.push(isValid);\n\n          isValid.then(isValidatorValid => {\n            if (isValidatorValid === undefined || isValidatorValid === null) {\n              return;\n            }\n            /** Invert the validity state to correspond to the ValidityState API */\n            validity[key] = !isValidatorValid;\n\n            validationMessage = this.#getValidatorMessageForValue(validator, value);\n            this.#setValidityWithOptionalTarget(validity, validationMessage);\n          });\n        } else {\n          /** Invert the validity state to correspond to the ValidityState API */\n          validity[key] = !isValid;\n\n          if (this.validity[key] !== !isValid) {\n            hasChange = true;\n          }\n\n          // only update the validationMessage for the first invalid scenario\n          // so that earlier invalid validators dont get their messages overwritten by later ones\n          // in the validators array\n          if (!isValid && !validationMessage) {\n            validationMessage = this.#getValidatorMessageForValue(validator, value);\n          }\n        }\n      });\n\n      /** Once all the async validators have settled, resolve validationComplete */\n      Promise.allSettled(asyncValidators)\n        .then(() => {\n          /** Don't resolve validations if the signal is aborted */\n          if (!abortController?.signal.aborted) {\n            this.#isValidationPending = false;\n            this.#validationCompleteResolver?.();\n          }\n        });\n\n      /**\n       * If async validators are present:\n       * Only run updates when a sync validator has a change. This is to prevent\n       * situations where running sync validators can override async validators\n       * that are still in progress\n       *\n       * If async validators are not present, always update validity\n       */\n      if (hasChange || !hasAsyncValidators) {\n        this.#setValidityWithOptionalTarget(validity, validationMessage);\n      }\n    }\n\n    /**\n     * If the validationTarget is not set, the user can decide how they would\n     * prefer to handle focus when the field is validated.\n     */\n    #setValidityWithOptionalTarget(validity: Partial<ValidityState>, validationMessage: string|undefined): void {\n      if (this.validationTarget) {\n        this.internals.setValidity(validity, validationMessage, this.validationTarget);\n        this.#awaitingValidationTarget = false;\n      } else {\n        this.internals.setValidity(validity, validationMessage);\n\n        if (this.internals.validity.valid) {\n          return;\n        }\n\n        /**\n         * Sets mark the component as awaiting a validation target\n         * if the element dispatches an invalid event, the #onInvalid listener\n         * will check to see if the validation target has been set since this call\n         * has run. This useful in cases like Lit's use of the query\n         * decorator for setting the validationTarget or any scenario\n         * where the validationTarget isn't available upon construction\n         */\n        this.#awaitingValidationTarget = true;\n      }\n    }\n\n    /** Process the validator message attribute */\n    #getValidatorMessageForValue(validator: Validator, value: FormValue): string {\n      /** If the validity callback exists and returns, use that as the result */\n      if (this.validityCallback) {\n        const message = this.validityCallback(validator.key || 'customError');\n\n        if (message) {\n          return message;\n        }\n      }\n\n      if (validator.message instanceof Function) {\n        return (validator.message as validationMessageCallback)(this, value);\n      } else {\n        return validator.message as string;\n      }\n    }\n\n     /** Reset control state when the form is reset */\n    formResetCallback() {\n      this.#touched = false;\n      this.#forceError = false;\n      this.#shouldShowError();\n      this.resetFormControl?.();\n\n      this.validationMessageCallback?.(\n        this.#shouldShowError() ? this.validationMessage : ''\n      );\n    }\n  }\n\n  return FormControl as Constructor<FormControlInterface> & TBase;\n}\n", "import { html, LitElement } from 'lit';\n\nimport { FormControlMixin } from '@open-wc/form-control';\nimport WarpElement from '@warp-ds/elements-core';\nimport { property } from 'lit/decorators.js';\nimport { classMap } from 'lit/directives/class-map.js';\n\nimport { reset } from '../styles.js';\n\nimport { styles } from './styles.js';\n\ntype ButtonVariant = 'primary' | 'secondary' | 'negative' | 'negativeQuiet' | 'utility' | 'pill' | 'link' | 'quiet' | 'utilityQuiet';\n\nconst variants = ['primary', 'secondary', 'negative', 'negativeQuiet', 'utility', 'utilityQuiet', 'pill', 'link'];\n\n/**\n * Buttons are used to perform actions, with different visuals for different needs.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/buttons-link--docs)\n */\nclass WarpLink extends FormControlMixin(LitElement) {\n  static shadowRootOptions = {\n    ...WarpElement.shadowRootOptions,\n    delegatesFocus: true,\n  };\n\n  @property({ type: Boolean, reflect: true })\n  autofocus: boolean;\n\n  @property({ reflect: true })\n  variant: ButtonVariant;\n\n  @property({ type: Boolean, reflect: true })\n  quiet: boolean;\n\n  @property({ type: Boolean, reflect: true })\n  small: boolean;\n\n  @property({ reflect: true })\n  href: string;\n\n  @property({ type: Boolean, reflect: true })\n  disabled: boolean;\n\n  @property({ reflect: true })\n  target: string;\n\n  @property({ reflect: true })\n  rel: string;\n\n  @property({ attribute: 'full-width', type: Boolean, reflect: true })\n  fullWidth: boolean;\n\n  @property({ attribute: 'button-class', reflect: true })\n  buttonClass: string;\n\n  @property({ reflect: true })\n  name: string;\n\n  classes: string;\n\n  static styles = [reset, styles];\n\n  constructor() {\n    super();\n    this.variant = 'secondary';\n  }\n\n  connectedCallback() {\n    super.connectedCallback();\n\n    if (!variants.includes(this.variant)) {\n      throw new Error(`Invalid \"variant\" attribute. Set its value to one of the following:\\n${variants.join(', ')}.`);\n    }\n  }\n\n  firstUpdated() {\n    if (this.autofocus) {\n      setTimeout(() => this.focus(), 0);\n    }\n  }\n\n  render() {\n    const classes = {\n      'w-button': this.variant !== 'link',\n      'w-button--primary': this.variant === 'primary',\n      'w-button--secondary': this.variant === 'secondary',\n      'w-button--negative': this.variant === 'negative',\n      'w-button--utility': this.variant === 'utility',\n      'w-button--quiet': this.variant === 'quiet',\n      'w-button--negative-quiet': this.variant === 'negativeQuiet',\n      'w-button--utility-quiet': this.variant === 'utilityQuiet',\n      'w-button--small': this.small,\n      'w-button--full-width': this.fullWidth,\n      'w-button--disabled': this.disabled,\n    };\n    return html`<a\n      href=${this.href}\n      target=${this.target}\n      rel=${this.target === '_blank' ? this.rel || 'noopener' : undefined}\n      class=${classMap(classes)}>\n      <slot></slot>\n    </a>`;\n  }\n}\n\nif (!customElements.get('w-link')) {\n  customElements.define('w-link', WarpLink);\n}\n\nexport { WarpLink };\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-link': WarpLink;\n  }\n}\n", "import { css } from 'lit';\n\nexport const styles = css`.w-button,\n.w-button--secondary {\n    /* Local scoped variables, given the default button (the secondary variant) as a default */\n    --_background: var(--background, var(--w-s-color-background));\n    --_background-hover: var(--background-hover, var(--w-s-color-background-hover));\n    --_background-active: var(--background-active, var(--w-s-color-background-active));\n    --_text-color: var(--color, var(--w-s-color-text-link));\n    --_border-width: var(--border-width, 2px);\n    --_border: var(--border, var(--w-s-color-border));\n    --_border-hover: var(--border-hover, var(--w-s-color-border-hover));\n    --_border-active: var(--border-active, var(--w-s-color-border-active));\n    --_border-radius: var(--border-radius, 8px);\n    --_font-size: var(--font-size, var(--w-font-size-m));\n    --_line-height: var(--line-height, var(--w-line-height-m));\n    --_font-weight: var(--font-weight, bold);\n    --_padding-x: var(--padding-x, 16px);\n    --_padding-y: var(--padding-y, 13px);\n\n    /* Base setup for all buttons */\n    display: inline-flex;\n    justify-content: center;\n    align-items: center;\n    text-align: center;\n    cursor: pointer;\n    transition:\n            color 150ms cubic-bezier(0.4, 0, 0.2, 1),\n            background-color 150ms cubic-bezier(0.4, 0, 0.2, 1),\n            border-color 150ms cubic-bezier(0.4, 0, 0.2, 1),\n            fill 150ms cubic-bezier(0.4, 0, 0.2, 1),\n            stroke 150ms cubic-bezier(0.4, 0, 0.2, 1);\n\n    /* Hook the local vars up to the button stuff  */\n    background-color: var(--_background);\n    color: var(--_text-color);\n    border: var(--_border-width) solid var(--_border);\n    border-radius: var(--_border-radius);\n    padding: calc(var(--_padding-y) - var(--_border-width)) calc(var(--_padding-x) - var(--_border-width));\n    font-size: var(--_font-size);\n    line-height: var(--_line-height);\n    font-weight: var(--_font-weight);\n}\n\n    .w-button:hover {\n        background-color: var(--_background-hover);\n        border-color: var(--_border-hover);\n    }\n\n    .w-button:active {\n        background-color: var(--_background-active);\n        border-color: var(--_border-active);\n    }\n\n    .w-button:focus-visible {\n        outline: 2px solid var(--w-s-color-border-focus);\n        outline-offset: var(--w-outline-offset, 1px);\n    }\n\n    /* Variants config */\n    .w-button--primary {\n        --background: var(--w-s-color-background-primary);\n        --background-hover: var(--w-s-color-background-primary-hover);\n        --background-active: var(--w-s-color-background-primary-active);\n        --color: var(--w-s-color-text-inverted);\n        --border-width: 0px;\n    }\n    .w-button--negative {\n        --background: var(--w-s-color-background-negative);\n        --background-hover: var(--w-s-color-background-negative-hover);\n        --background-active: var(--w-s-color-background-negative-active);\n        --color: var(--w-s-color-text-inverted);\n        --border-width: 0px;\n    }\n    .w-button--negative-quiet {\n        --background: transparent;\n        --background-hover: var(--w-s-color-background-negative-subtle-hover);\n        --background-active: var(--w-s-color-background-negative-subtle-active);\n        --color: var(--w-s-color-text-negative);\n        --border-width: 0px;\n    }\n    .w-button--utility {\n        --background: var(--w-s-color-background);\n        --background-hover: var(--w-s-color-background-hover);\n        --background-active: var(--w-s-color-background-active);\n        --color: var(--w-s-color-text);\n        --border-radius: 4px;\n        --border-width: 1px;\n    }\n    .w-button--utility-quiet {\n        --background: transparent;\n        --color: var(--w-s-color-text);\n        --border-width: 0px;\n    }\n    .w-button--overlay {\n        --background: var(--w-color-background);\n        --background-hover: var(--w-color-background-hover);\n        --background-active: var(--w-color-background-active);\n        --color: var(--w-s-color-text);\n        --border-radius: 9999px;\n        --border-width: 0px;\n    }\n    .w-button--overlay-quiet {\n        --background: transparent;\n        --background-hover: var(--w-s-color-background-hover);\n        --background-active: var(--w-s-color-background-active);\n        --color: var(--w-s-color-text);\n        --border-radius: 9999px;\n        --border-width: 0px;\n    }\n    .w-button--overlay-inverted {\n        --background: var(--w-s-color-background-inverted);\n        --background-hover: var(--w-s-color-background-inverted-hover);\n        --background-active: var(--w-s-color-background-inverted-active);\n        --color: var(--w-s-color-text-inverted);\n        --border-radius: 9999px;\n        --border-width: 0px;\n    }\n    .w-button--overlay-inverted-quiet {\n        --background: transparent;\n        --background-hover: var(--w-s-color-background-inverted-hover);\n        --background-active: var(--w-s-color-background-inverted-active);\n        --color: var(--w-s-color-text-inverted);\n        --border-radius: 9999px;\n        --border-width: 0px;\n    }\n\n    .w-button--link {\n        --background: none;\n        --background-hover: none;\n        --background-active: none;\n        --border-width: 0;\n        --font-weight: normal;\n        display: inline;\n    }\n\n    /* States config,  selects --loading as well since loading is always supposed to be disabled */\n    .w-button:disabled,\n    .w-button--disabled,\n    .w-button--loading {\n        --background: var(--w-s-color-background-disabled);\n        --background-hover: var(--w-s-color-background-disabled);\n        --background-active: var(--w-s-color-background-disabled);\n        --color: var(--w-s-color-text-inverted);\n        --border-width: 0px;\n        pointer-events: none;\n    }\n\n    .w-button--link:hover {\n        text-decoration: underline;\n    }\n\n    /* Sizes config */\n    .w-button--small {\n        --padding-x: 12px;\n        --padding-y: 8px;\n        --font-size: var(--w-font-size-xs);\n        --line-height: var(--w-line-height-xs);\n    }\n\n    /* Width config */\n    .w-button--full-width {\n        width: 100%;\n        max-width: 100%;\n    }\n\n    .w-button--has-icon-only {\n        width: auto;\n        max-width: none;\n        --_padding-x: var(--_padding-y);\n        aspect-ratio: 1 / 1;\n    }\n\n    a.w-button {\n        text-decoration: none !important;\n    }\n\n    /* Copy of loading animation from warp  */\n    .w-button--loading {\n        background-image: linear-gradient(\n                135deg,\n                rgba(0, 0, 0, 0.05) 25%,\n                transparent 25%,\n                transparent 50%,\n                rgba(0, 0, 0, 0.05) 50%,\n                rgba(0, 0, 0, 0.05) 75%,\n                transparent 75%,\n                transparent\n        );\n        background-size: 30px 30px;\n        animation: animate-inprogress 3s linear infinite;\n    }\n\n    @keyframes animate-inprogress {\n        0% {\n            background-position: 0 0;\n        }\n        100% {\n            background-position: 60px 0;\n        }\n    }`;\n", "// @warp-css;\n\nimport { html, LitElement, PropertyValues } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { i18n } from '@lingui/core';\nimport { FormControlMixin } from '@open-wc/form-control';\nimport WarpElement from '@warp-ds/elements-core';\nimport { property } from 'lit/decorators.js';\n\nimport { activateI18n } from '../i18n';\nimport '../link';\nimport { reset } from '../styles.js';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\nimport { styles } from './styles.js';\n\ntype ButtonVariant = 'primary' | 'secondary' | 'negative' | 'utility' | 'pill' | 'link';\n\nconst variants = ['primary', 'secondary', 'negative', 'utility', 'pill', 'link'];\n\ntype ButtonType = 'button' | 'submit' | 'reset';\n\nconst buttonDefaultStyling = 'font-bold focusable justify-center transition-colors ease-in-out';\n\nconst buttonColors = {\n  primary:\n    's-text-inverted bg-[--w-color-button-primary-background] hover:bg-[--w-color-button-primary-background-hover] active:bg-[--w-color-button-primary-background-active]',\n  secondary: 's-text-link s-border s-bg hover:s-bg-hover hover:s-border-hover active:s-bg-active',\n  utility: 's-text s-bg hover:s-bg-hover active:s-bg-active s-border hover:s-border-hover active:s-border-active',\n  destructive: 's-bg-negative s-text-inverted hover:s-bg-negative-hover active:s-bg-negative-active',\n  pill: 's-icon hover:s-icon-hover active:s-icon-active bg-transparent hover:bg-[--w-color-button-pill-background-hover] active:bg-[--w-color-button-pill-background-active]',\n  disabled: 's-text-inverted s-bg-disabled',\n  quiet: 'bg-transparent s-text-link hover:s-bg-hover active:s-bg-active',\n  utilityQuiet: 's-text bg-transparent hover:s-bg-hover active:s-bg-active',\n  negativeQuiet: 'bg-transparent s-text-negative hover:s-bg-negative-subtle-hover active:s-bg-negative-subtle-active',\n  loading: 's-text s-bg-subtle',\n  link: 's-text-link',\n};\n\nconst buttonTypes = {\n  primary: `border-0 rounded-8 ${buttonDefaultStyling}`,\n  secondary: `border-2 rounded-8 ${buttonDefaultStyling}`,\n  utility: `border rounded-4 ${buttonDefaultStyling}`,\n  negative: `border-0 rounded-8 ${buttonDefaultStyling}`,\n  pill: `p-4 rounded-full border-0 inline-flex items-center justify-center hover:bg-clip-padding ${buttonDefaultStyling}`,\n  link: `bg-transparent focusable ease-in-out inline active:underline hover:underline focus:underline ${buttonColors.link}`,\n};\n\nconst buttonSizes = {\n  xsmall: 'py-6 px-16',\n  small: 'py-8 px-16',\n  medium: 'py-10 px-14',\n  large: 'py-12 px-16',\n  utility: 'py-[11px] px-[15px]',\n  smallUtility: 'py-[7px] px-[15px]',\n  pill: 'min-h-[44px] min-w-[44px]',\n  pillSmall: 'min-h-32 min-w-32',\n  link: 'p-0',\n};\n\nconst buttonTextSizes = {\n  medium: 'text-m leading-[24]',\n  xsmall: 'text-xs',\n};\n\nconst buttonVariants = {\n  inProgress: `border-transparent animate-inprogress pointer-events-none ${buttonColors.loading}`, // .button--in-progress, a.button--in-progress:visited\n  quiet: `border-0 rounded-8 ${buttonDefaultStyling}`,\n  utilityQuiet: `border-0 rounded-4 ${buttonDefaultStyling}`,\n  negativeQuiet: `border-0 rounded-8 ${buttonDefaultStyling}`,\n  isDisabled: `font-bold justify-center transition-colors ease-in-out cursor-default pointer-events-none ${buttonColors.disabled}`, // .button:disabled, .button--is-disabled\n};\n\nexport const ccButton = {\n  // Buttontypes\n  secondary: `${buttonSizes.medium} ${buttonTextSizes.medium} ${buttonTypes.secondary} ${buttonColors.secondary}`, // .button--secondary, .button--default, .button\n  secondaryHref: `${buttonSizes.medium} ${buttonTextSizes.medium} ${buttonTypes.secondary} ${buttonColors.secondary}`,\n  secondaryDisabled: `${buttonSizes.medium} ${buttonTextSizes.medium} ${buttonTypes.secondary} ${buttonVariants.isDisabled}`,\n  secondarySmall: `${buttonTextSizes.xsmall} ${buttonSizes.xsmall} ${buttonTypes.secondary} ${buttonColors.secondary}`,\n  secondarySmallDisabled: `${buttonTextSizes.xsmall} ${buttonSizes.xsmall} ${buttonTypes.secondary} ${buttonVariants.isDisabled}`,\n  secondaryQuiet: `${buttonSizes.medium} ${buttonTextSizes.medium} ${buttonVariants.quiet} ${buttonColors.quiet}`,\n  secondaryQuietDisabled: `${buttonSizes.medium} ${buttonTextSizes.medium} ${buttonVariants.quiet} ${buttonVariants.isDisabled}`,\n  secondarySmallQuiet: `${buttonTextSizes.xsmall} ${buttonSizes.xsmall} ${buttonVariants.quiet} ${buttonColors.quiet}`,\n  secondarySmallQuietDisabled: `${buttonTextSizes.xsmall} ${buttonSizes.xsmall} ${buttonVariants.quiet} ${buttonVariants.isDisabled}`,\n  secondaryLoading: `${buttonSizes.medium} ${buttonTextSizes.medium} ${buttonTypes.secondary} ${buttonVariants.inProgress}`,\n  secondarySmallLoading: `${buttonTextSizes.xsmall} ${buttonSizes.xsmall}  ${buttonTypes.secondary} ${buttonVariants.inProgress}`,\n  secondarySmallQuietLoading: `${buttonTextSizes.xsmall} ${buttonSizes.xsmall} ${buttonVariants.quiet} ${buttonVariants.inProgress}`,\n  secondaryQuietLoading: `${buttonSizes.medium} ${buttonTextSizes.medium} ${buttonVariants.quiet} ${buttonVariants.inProgress}`,\n\n  primary: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonTypes.primary} ${buttonColors.primary}`, // .button--primary, .button--cta\n  primaryDisabled: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.isDisabled} ${buttonTypes.primary}`,\n  primarySmall: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonTypes.primary} ${buttonColors.primary}`,\n  primarySmallDisabled: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.isDisabled} ${buttonTypes.primary} `,\n  primaryQuiet: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.quiet} ${buttonColors.quiet}`,\n  primaryQuietDisabled: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.quiet} ${buttonVariants.isDisabled}`,\n  primarySmallQuiet: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.quiet} ${buttonColors.quiet}`,\n  primarySmallQuietDisabled: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.quiet} ${buttonVariants.isDisabled}`,\n  primaryLoading: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.inProgress} ${buttonTypes.primary}`,\n  primarySmallLoading: `${buttonSizes.small} ${buttonTextSizes.xsmall}  ${buttonVariants.inProgress} ${buttonTypes.primary}`,\n  primarySmallQuietLoading: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.quiet} ${buttonVariants.inProgress} ${buttonTypes.primary}`,\n  primaryQuietLoading: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.quiet} ${buttonVariants.inProgress}`,\n\n  utility: `${buttonSizes.utility} ${buttonTextSizes.medium} ${buttonTypes.utility} ${buttonColors.utility}`, // .button--utility\n  utilityDisabled: `${buttonSizes.utility} ${buttonTextSizes.medium} ${buttonTypes.utility} ${buttonVariants.isDisabled}`,\n  utilityQuiet: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.utilityQuiet} ${buttonColors.utilityQuiet}`, // .button--utility-flat\n  utilityQuietDisabled: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.utilityQuiet} ${buttonVariants.isDisabled}`,\n  utilitySmall: `${buttonSizes.smallUtility} ${buttonTextSizes.xsmall} ${buttonTypes.utility} ${buttonColors.utility}`,\n  utilitySmallDisabled: `${buttonSizes.smallUtility} ${buttonTextSizes.xsmall} ${buttonTypes.utility} ${buttonVariants.isDisabled}`,\n  utilitySmallQuiet: `${buttonSizes.smallUtility} ${buttonTextSizes.xsmall} ${buttonVariants.utilityQuiet} ${buttonColors.utilityQuiet}`,\n  utilitySmallQuietDisabled: `${buttonSizes.smallUtility} ${buttonTextSizes.xsmall} ${buttonVariants.utilityQuiet} ${buttonVariants.isDisabled}`,\n  utilityLoading: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonTypes.utility} ${buttonVariants.inProgress}`,\n  utilitySmallLoading: `${buttonSizes.smallUtility} ${buttonTextSizes.xsmall} ${buttonTypes.utility} ${buttonVariants.inProgress}`,\n  utilityQuietLoading: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.inProgress} ${buttonVariants.utilityQuiet}`,\n  utilitySmallQuietLoading: `${buttonSizes.smallUtility} ${buttonTextSizes.xsmall} ${buttonVariants.inProgress} ${buttonVariants.utilityQuiet}`,\n\n  negative: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonTypes.negative} ${buttonColors.destructive}`, // .button--destructive\n  negativeDisabled: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonTypes.negative} ${buttonVariants.isDisabled}`,\n  negativeQuiet: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.negativeQuiet} ${buttonColors.negativeQuiet}`, // .button--destructive-flat\n  negativeQuietDisabled: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.negativeQuiet}${buttonVariants.isDisabled}`,\n  negativeSmall: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonTypes.negative} ${buttonColors.destructive}`,\n  negativeSmallDisabled: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonTypes.negative} ${buttonVariants.isDisabled}`,\n  negativeSmallQuiet: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.negativeQuiet} ${buttonColors.negativeQuiet}`,\n  negativeSmallQuietDisabled: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.negativeQuiet} ${buttonVariants.isDisabled}`,\n  negativeLoading: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonTypes.negative} ${buttonVariants.inProgress}`,\n  negativeSmallLoading: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.inProgress} ${buttonTypes.negative}`,\n  negativeQuietLoading: `${buttonSizes.large} ${buttonTextSizes.medium} ${buttonVariants.negativeQuiet} ${buttonTypes.negative} ${buttonVariants.inProgress}`,\n  negativeSmallQuietLoading: `${buttonSizes.small} ${buttonTextSizes.xsmall} ${buttonVariants.negativeQuiet} ${buttonVariants.inProgress}`,\n\n  pill: `${buttonSizes.pill} ${buttonTextSizes.medium} ${buttonTypes.pill} ${buttonColors.pill}`, // .button--pill\n  pillSmall: `${buttonSizes.pillSmall} ${buttonTextSizes.xsmall} ${buttonTypes.pill} ${buttonColors.pill}`,\n  pillLoading: `${buttonSizes.pill} ${buttonTextSizes.medium} ${buttonTypes.pill} ${buttonVariants.inProgress}`,\n  pillSmallLoading: `${buttonSizes.pillSmall} ${buttonTextSizes.xsmall} ${buttonTypes.pill} ${buttonVariants.inProgress}`,\n\n  link: `${buttonSizes.link} ${buttonTextSizes.medium} ${buttonTypes.link}`,\n  linkSmall: `${buttonSizes.link} ${buttonTextSizes.xsmall} ${buttonTypes.link}`,\n  linkAsButton: 'inline-block active:no-underline hover:no-underline focus:no-underline text-center',\n  a11y: 'sr-only',\n  fullWidth: 'w-full max-w-full',\n  contentWidth: 'max-w-max',\n};\n\n/**\n * Buttons are used to perform actions, widh different visuals for different needs.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/buttons-button--docs)\n */\nclass WarpButton extends FormControlMixin(LitElement) {\n  static shadowRootOptions = {\n    ...WarpElement.shadowRootOptions,\n    delegatesFocus: true,\n  };\n\n  @property({ reflect: true })\n  type: ButtonType = 'button';\n\n  @property({ type: Boolean, reflect: true })\n  autofocus: boolean;\n\n  @property({ reflect: true })\n  variant: ButtonVariant;\n\n  /**\n   * @type {boolean}\n   */\n  @property({ type: Boolean, reflect: true })\n  quiet: boolean;\n\n  @property({ type: Boolean, reflect: true })\n  small: boolean;\n\n  @property({ type: Boolean, reflect: true })\n  loading: boolean;\n\n  @property({ reflect: true })\n  href: string;\n\n  @property({ reflect: true })\n  target: string;\n\n  @property({ reflect: true })\n  rel: string;\n\n  @property({ attribute: 'full-width', type: Boolean, reflect: true })\n  fullWidth: boolean;\n\n  @property({ attribute: 'button-class', reflect: true })\n  buttonClass: string;\n\n  @property({ reflect: true })\n  name: string;\n\n  @property({ reflect: true })\n  value: string;\n\n  /** @internal */\n  ariaValueTextLoading: string;\n\n  static styles = [reset, styles];\n\n  updated(changedProperties: PropertyValues<this>) {\n    if (changedProperties.has('value')) {\n      this.setValue(this.value);\n    }\n  }\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n    this.variant = 'secondary';\n    this.ariaValueTextLoading = i18n._({\n      id: 'button.aria.loading',\n      message: 'Loading...',\n      comment: 'Screen reader message for buttons that are loading',\n    });\n  }\n\n  connectedCallback() {\n    super.connectedCallback();\n\n    if (!variants.includes(this.variant)) {\n      throw new Error(`Invalid \"variant\" attribute. Set its value to one of the following:\\n${variants.join(', ')}.`);\n    }\n  }\n\n  firstUpdated() {\n    if (this.autofocus) {\n      setTimeout(() => this.focus(), 0);\n    }\n  }\n\n  /** @internal */\n  get _primaryClasses() {\n    return [\n      !this.small && !this.quiet && !this.loading && ccButton.primary,\n      this.small && !this.quiet && !this.loading && ccButton.primarySmall,\n      this.small && this.quiet && !this.loading && ccButton.primarySmallQuiet,\n      this.small && this.loading && (this.quiet ? ccButton.primarySmallQuietLoading : ccButton.primarySmallLoading),\n      !this.small && this.quiet && !this.loading && ccButton.primaryQuiet,\n      !this.small && this.loading && (this.quiet ? ccButton.primaryQuietLoading : ccButton.primaryLoading),\n    ];\n  }\n\n  /** @internal */\n  get _secondaryClasses() {\n    return [\n      !this.small && !this.quiet && !this.loading && ccButton.secondary,\n      this.small && !this.quiet && !this.loading && ccButton.secondarySmall,\n      this.small && this.loading && (this.quiet ? ccButton.secondarySmallQuietLoading : ccButton.secondarySmallLoading),\n      this.small && this.quiet && !this.loading && ccButton.secondarySmallQuiet,\n      !this.small && this.quiet && !this.loading && ccButton.secondaryQuiet,\n      !this.small && this.loading && (this.quiet ? ccButton.secondaryQuietLoading : ccButton.secondaryLoading),\n    ];\n  }\n\n  /** @internal */\n  get _utilityClasses() {\n    return [\n      !this.small && !this.quiet && !this.loading && ccButton.utility,\n      this.small && !this.quiet && !this.loading && ccButton.utilitySmall,\n      this.small && this.quiet && !this.loading && ccButton.utilitySmallQuiet,\n      this.small && this.loading && (this.quiet ? ccButton.utilitySmallQuietLoading : ccButton.utilitySmallLoading),\n      !this.small && this.quiet && !this.loading && ccButton.utilityQuiet,\n      !this.small && this.loading && (this.quiet ? ccButton.utilityQuietLoading : ccButton.utilityLoading),\n    ];\n  }\n\n  /** @internal */\n  get _negativeClasses() {\n    return [\n      !this.small && !this.quiet && !this.loading && ccButton.negative,\n      this.small && !this.quiet && !this.loading && ccButton.negativeSmall,\n      this.small && this.quiet && !this.loading && ccButton.negativeSmallQuiet,\n      this.small && this.loading && (this.quiet ? ccButton.negativeSmallQuietLoading : ccButton.negativeSmallLoading),\n      !this.small && this.quiet && !this.loading && ccButton.negativeQuiet,\n      !this.small && this.loading && (this.quiet ? ccButton.negativeQuietLoading : ccButton.negativeLoading),\n    ];\n  }\n\n  /** @internal */\n  get _pillClasses() {\n    return [\n      !this.loading && (this.small ? ccButton.pillSmall : ccButton.pill),\n      this.loading && (this.small ? ccButton.pillSmallLoading : ccButton.pillLoading),\n    ];\n  }\n\n  /** @internal */\n  get _linkClasses() {\n    return [this.small ? ccButton.linkSmall : ccButton.link];\n  }\n  /** @internal */\n  get _classes() {\n    return classNames(this.buttonClass, [\n      this.variant === 'primary' && this._primaryClasses,\n      this.variant === 'secondary' && this._secondaryClasses,\n      this.variant === 'utility' && this._utilityClasses,\n      this.variant === 'negative' && this._negativeClasses,\n      this.variant === 'pill' && this._pillClasses,\n      this.variant === 'link' && this._linkClasses,\n      this.href && ccButton.linkAsButton,\n      this.fullWidth ? ccButton.fullWidth : ccButton.contentWidth,\n    ]);\n  }\n\n  /** @internal */\n  _handleButtonClick() {\n    if (this.type === 'submit') this.internals.form.requestSubmit();\n    else if (this.type === 'reset') this.internals.form.reset();\n  }\n\n  render() {\n    return html` ${this.href\n      ? html`<w-link\n          href=${this.href}\n          target=${this.target}\n          rel=${this.target === '_blank' ? this.rel || 'noopener' : undefined}\n          class=${this._classes}>\n          <slot></slot>\n        </w-link>`\n      : html`<button type=${this.type || 'button'} class=${this._classes} @click=\"${this._handleButtonClick}\">\n          <slot></slot>\n        </button>`}\n    ${this.loading\n      ? html`<span class=\"sr-only\" role=\"progressbar\" aria-valuenow=\"{0}\" aria-valuetext=${this.ariaValueTextLoading}></span>`\n      : null}`;\n  }\n}\n\nif (!customElements.get('w-button')) {\n  customElements.define('w-button', WarpButton);\n}\n\nexport { WarpButton };\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-button': WarpButton;\n  }\n}\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"button.aria.loading\\\":[\\\"Indl\u00E6ser...\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"button.aria.loading\\\":[\\\"Loading...\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"button.aria.loading\\\":[\\\"Ladataan...\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"button.aria.loading\\\":[\\\"Laster...\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"button.aria.loading\\\":[\\\"Laddar ...\\\"]}\");", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.text-center{text-align:center}.animate-inprogress{background-size:30px 30px;animation:3s linear infinite animate-inprogress;background-image:linear-gradient(135deg,#0000000d 25%,#0000 0 50%,#0000000d 0 75%,#0000 0,#0000)!important}@keyframes animate-inprogress{0%{background-position:0 0}to{background-position:60px 0}}.hover\\\\:bg-clip-padding:hover{-webkit-background-clip:padding-box;background-clip:padding-box}.bg-transparent{background-color:#0000}.bg-\\\\[--w-color-button-primary-background\\\\]{background-color:var(--w-color-button-primary-background)}.hover\\\\:bg-\\\\[--w-color-button-pill-background-hover\\\\]:hover{background-color:var(--w-color-button-pill-background-hover)}.hover\\\\:bg-\\\\[--w-color-button-primary-background-hover\\\\]:hover{background-color:var(--w-color-button-primary-background-hover)}.active\\\\:bg-\\\\[--w-color-button-pill-background-active\\\\]:active{background-color:var(--w-color-button-pill-background-active)}.active\\\\:bg-\\\\[--w-color-button-primary-background-active\\\\]:active{background-color:var(--w-color-button-primary-background-active)}.border{border-width:1px}.border-0{border-width:0}.border-2{border-width:2px}.border-transparent{border-color:#0000}.rounded-4{border-radius:4px}.rounded-8{border-radius:8px}.rounded-full{border-radius:9999px}.inline-block{display:inline-block}.inline{display:inline}.inline-flex{display:inline-flex}.hover\\\\:underline:hover,.focus\\\\:underline:focus,.active\\\\:underline:active{text-decoration-line:underline}.hover\\\\:no-underline:hover,.focus\\\\:no-underline:focus,.active\\\\:no-underline:active{text-decoration:none}.focusable:focus{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:focus-visible{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:not(:focus-visible){outline:none}.items-center{align-items:center}.justify-center{justify-content:center}.static{position:static}.s-bg{background-color:var(--w-s-color-background)}.s-bg-disabled{background-color:var(--w-s-color-background-disabled)}.s-bg-negative{background-color:var(--w-s-color-background-negative)}.s-bg-subtle{background-color:var(--w-s-color-background-subtle)}.hover\\\\:s-bg-hover:hover{background-color:var(--w-s-color-background-hover)}.hover\\\\:s-bg-negative-hover:hover{background-color:var(--w-s-color-background-negative-hover)}.hover\\\\:s-bg-negative-subtle-hover:hover{background-color:var(--w-s-color-background-negative-subtle-hover)}.active\\\\:s-bg-active:active{background-color:var(--w-s-color-background-active)}.active\\\\:s-bg-negative-active:active{background-color:var(--w-s-color-background-negative-active)}.active\\\\:s-bg-negative-subtle-active:active{background-color:var(--w-s-color-background-negative-subtle-active)}.s-text{color:var(--w-s-color-text)}.s-text-inverted{color:var(--w-s-color-text-inverted)}.s-text-link{color:var(--w-s-color-text-link)}.s-text-negative{color:var(--w-s-color-text-negative)}.s-icon{color:var(--w-s-color-icon)}.hover\\\\:s-icon-hover:hover{color:var(--w-s-color-icon-hover)}.active\\\\:s-icon-active:active{color:var(--w-s-color-icon-active)}.s-border{border-color:var(--w-s-color-border)}.hover\\\\:s-border-hover:hover{border-color:var(--w-s-color-border-hover)}.active\\\\:s-border-active:active{border-color:var(--w-s-color-border-active)}.max-w-full{max-width:100%}.max-w-max{max-width:max-content}.min-h-32{min-height:3.2rem}.min-w-32{min-width:3.2rem}.w-full{width:100%}.min-h-\\\\[44px\\\\]{min-height:44px}.min-w-\\\\[44px\\\\]{min-width:44px}.p-0{padding:0}.p-4{padding:.4rem}.px-14{padding-left:1.4rem;padding-right:1.4rem}.px-16{padding-left:1.6rem;padding-right:1.6rem}.py-10{padding-top:1rem;padding-bottom:1rem}.py-12{padding-top:1.2rem;padding-bottom:1.2rem}.py-6{padding-top:.6rem;padding-bottom:.6rem}.py-8{padding-top:.8rem;padding-bottom:.8rem}.px-\\\\[15px\\\\]{padding-left:15px;padding-right:15px}.py-\\\\[11px\\\\]{padding-top:11px;padding-bottom:11px}.py-\\\\[7px\\\\]{padding-top:7px;padding-bottom:7px}.cursor-default{cursor:default}.font-bold{font-weight:700}.pointer-events-none{pointer-events:none}.sr-only{clip:rect(0,0,0,0);white-space:nowrap;border-width:0;width:1px;height:1px;margin:-1px;padding:0;position:absolute;overflow:hidden}.transition-colors{transition-property:color,background-color,border-color,text-decoration-color,fill,stroke;transition-duration:.15s;transition-timing-function:cubic-bezier(.4,0,.2,1)}.ease-in-out{transition-timing-function:cubic-bezier(.4,0,.2,1)}.text-m{font-size:var(--w-font-size-m);line-height:var(--w-line-height-m)}.text-xs{font-size:var(--w-font-size-xs);line-height:var(--w-line-height-xs)}.leading-\\\\[24\\\\]{line-height:2.4rem}`;\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"card.button.text\\\":[\\\"V\u00E6lg\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"card.button.text\\\":[\\\"Select\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"card.button.text\\\":[\\\"Valitse\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"card.button.text\\\":[\\\"Velg\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"card.button.text\\\":[\\\"V\u00E4lj\\\"]}\");", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.border-2{border-width:2px}.border-transparent{border-color:#0000}.rounded-4{border-radius:4px}.rounded-8{border-radius:8px}.block{display:block}.overflow-hidden{overflow:hidden}.outline{outline-style:solid}.inset-0{top:0;bottom:0;left:0;right:0}.absolute{position:absolute}.relative{position:relative}.static{position:static}.\\\\!s-bg-selected{background-color:var(--w-s-color-background-selected)!important}.s-bg{background-color:var(--w-s-color-background)}.s-bg-selected{background-color:var(--w-s-color-background-selected)}.\\\\!hover\\\\:s-bg-selected-hover:hover{background-color:var(--w-s-color-background-selected-hover)!important}.hover\\\\:s-bg-hover:hover{background-color:var(--w-s-color-background-hover)}.hover\\\\:s-bg-selected-hover:hover{background-color:var(--w-s-color-background-selected-hover)}.\\\\!active\\\\:s-bg-selected-active:active{background-color:var(--w-s-color-background-selected-active)!important}.active\\\\:s-bg-active:active{background-color:var(--w-s-color-background-active)}.active\\\\:s-bg-selected-active:active{background-color:var(--w-s-color-background-selected-active)}.s-border{border-color:var(--w-s-color-border)}.s-border-selected{border-color:var(--w-s-color-border-selected)}.group:hover .group-hover\\\\:s-border-selected-hover{border-color:var(--w-s-color-border-selected-hover)}.hover\\\\:s-border-hover:hover{border-color:var(--w-s-color-border-hover)}.hover\\\\:s-border-selected-hover:hover{border-color:var(--w-s-color-border-selected-hover)}.active\\\\:s-border-active:active{border-color:var(--w-s-color-border-active)}.active\\\\:s-border-selected-active:active{border-color:var(--w-s-color-border-selected-active)}.group:active .group-active\\\\:s-border-active{border-color:var(--w-s-color-border-active)}.group:active .group-active\\\\:s-border-selected-active{border-color:var(--w-s-color-border-selected-active)}.s-surface-elevated-200{background-color:var(--w-s-color-surface-elevated-200);box-shadow:var(--w-s-shadow-surface-elevated-200)}.hover\\\\:s-surface-elevated-200-hover:hover{background-color:var(--w-s-color-surface-elevated-200-hover);box-shadow:var(--w-s-shadow-surface-elevated-200-hover)}.active\\\\:s-surface-elevated-200-active:active{background-color:var(--w-s-color-surface-elevated-200-active);box-shadow:var(--w-s-shadow-surface-elevated-200-active)}.cursor-pointer{cursor:pointer}.sr-only{clip:rect(0,0,0,0);white-space:nowrap;border-width:0;width:1px;height:1px;margin:-1px;padding:0;position:absolute;overflow:hidden}.transition-all{transition-property:all;transition-duration:.15s;transition-timing-function:cubic-bezier(.4,0,.2,1)}`;\n", "// @warp-css;\n\nimport { html, css, LitElement } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { i18n } from '@lingui/core';\nimport { property } from 'lit/decorators.js';\nimport { ifDefined } from 'lit/directives/if-defined.js';\n\nimport { activateI18n } from '../i18n.js';\nimport { reset } from '../styles.js';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\nimport { styles } from './styles.js';\n\nexport const ccCard = {\n  base: 'cursor-pointer overflow-hidden relative transition-all',\n  shadow: 'group rounded-8 s-surface-elevated-200 hover:s-surface-elevated-200-hover active:s-surface-elevated-200-active',\n  selected: '!s-bg-selected !hover:s-bg-selected-hover !active:s-bg-selected-active',\n  outline: 'absolute border-2 rounded-8 inset-0 transition-all',\n  outlineUnselected: 'border-transparent group-active:s-border-active',\n  outlineSelected: 's-border-selected group-hover:s-border-selected-hover group-active:s-border-selected-active',\n  flat: 'border-2 rounded-4',\n  flatUnselected: 's-bg hover:s-bg-hover active:s-bg-active s-border hover:s-border-hover active:s-border-active',\n  flatSelected:\n    's-bg-selected hover:s-bg-selected-hover active:s-bg-selected-active s-border-selected hover:s-border-selected-hover active:s-border-selected-active',\n  a11y: 'sr-only',\n};\n\nconst keys = {\n  ENTER: 'Enter',\n  SPACE: ' ',\n};\n\n/**\n * Card is a layout component used for separating content areas on a page.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/navigation-card--docs)\n */\nclass WarpCard extends LitElement {\n  static styles = [\n    reset,\n    styles,\n    css`\n      a::after {\n        content: '';\n        position: absolute;\n        top: 0;\n        right: 0;\n        bottom: 0;\n        left: 0;\n      }\n      :host {\n        display: block;\n      }\n    `,\n  ];\n\n  @property({ type: Boolean, reflect: true })\n  selected: boolean = false;\n\n  @property({ type: Boolean })\n  flat: boolean = false;\n\n  @property({ type: Boolean })\n  clickable: boolean = false;\n\n  /** @internal */\n  buttonText: string;\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n    this.buttonText = i18n._({\n      id: 'card.button.text',\n      message: 'Select',\n      comment: 'Screenreader message to indicate that the card is clickable',\n    });\n  }\n\n  /** @internal */\n  get _containerClasses() {\n    return classNames([\n      ccCard.base,\n      this.flat ? ccCard.flat : ccCard.shadow,\n      this.selected && !this.flat && ccCard.selected,\n      this.selected && this.flat ? ccCard.flatSelected : ccCard.flatUnselected,\n    ]);\n  }\n\n  /** @internal */\n  get _outlineClasses() {\n    return classNames([ccCard.outline, this.selected ? ccCard.outlineSelected : ccCard.outlineUnselected]);\n  }\n\n  /** @internal */\n  get _interactiveElement() {\n    const renderButton = () =>\n      html`<button class=\"${ccCard.a11y}\" aria-pressed=\"${this.selected}\" tabindex=\"-1\">${this.buttonText}</button>`;\n    const renderSpan = () => html`<span role=\"checkbox\" aria-checked=\"true\" aria-disabled=\"true\"></span>`;\n\n    return this.clickable ? renderButton() : this.selected ? renderSpan() : '';\n  }\n\n  keypressed(e: KeyboardEvent) {\n    if (!this.clickable || e.altKey || e.ctrlKey) return;\n    if (e.key === keys.ENTER || e.key === keys.SPACE) {\n      e.preventDefault();\n      this.click();\n    }\n  }\n\n  render() {\n    return html`\n      <div tabindex=${ifDefined(this.clickable ? '0' : undefined)} class=\"${this._containerClasses}\" @keydown=${this.keypressed}>\n        ${this._interactiveElement} ${this.flat ? '' : html`<div class=\"${this._outlineClasses}\"></div>`}\n        <slot></slot>\n      </div>\n    `;\n  }\n}\n\nif (!customElements.get('w-card')) {\n  customElements.define('w-card', WarpCard);\n}\n\nexport { WarpCard };\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-card': WarpCard;\n  }\n}\n", "import { LitElement, html } from 'lit';\n\nimport { i18n } from '@lingui/core';\nimport { FormControlMixin } from '@open-wc/form-control';\nimport WarpElement from '@warp-ds/elements-core';\nimport {\n  addDays,\n  addMonths,\n  differenceInCalendarDays,\n  eachDayOfInterval,\n  eachWeekOfInterval,\n  endOfWeek,\n  format,\n  formatISO,\n  getDate,\n  getWeekOfMonth,\n  isSameDay,\n  isSameMonth,\n  isToday,\n  lastDayOfMonth,\n  Locale,\n  startOfMonth,\n  startOfToday,\n  startOfWeek,\n  subDays,\n  subMonths,\n} from 'date-fns';\nimport { enGB, nb, sv, da, fi } from 'date-fns/locale';\nimport { property, query, state } from 'lit/decorators.js';\nimport { classMap } from 'lit/directives/class-map.js';\nimport { ifDefined } from 'lit/directives/if-defined.js';\nimport { styleMap } from 'lit/directives/style-map.js';\n\nimport '@warp-ds/icons/elements/calendar-16';\nimport '@warp-ds/icons/elements/chevron-left-16';\nimport '@warp-ds/icons/elements/chevron-right-16';\n\nimport { activateI18n, detectLocale } from '../i18n.js';\nimport { reset } from '../styles.js';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\nimport { wDatepickerCalendarStyles } from './styles/w-datepicker-calendar.styles.js';\nimport { wDatepickerDayStyles } from './styles/w-datepicker-day.styles.js';\nimport { wDatepickerMonthStyles } from './styles/w-datepicker-month.styles.js';\nimport { wDatepickerStyles } from './styles/w-datepicker.styles.js';\nimport { fromISOToDate } from './utils.js';\n\nconst ua = typeof navigator !== 'undefined' ? navigator.userAgent : '';\nconst isIOS = /iP(hone|od|ad)/.test(ua);\nconst inputType = isIOS ? 'text' : 'date';\n\nconst calendarId = 'calendar';\nconst inputId = 'input';\nconst toggleButtonId = 'toggle';\nconst wrapperId = 'wrapper';\nconst previousMonthButtonId = 'previous';\n\n// Convenience to support the common locales of our users.\n// For other locales either add to this list or point users\n// to https://date-fns.org/v4.1.0/docs/setDefaultOptions\nconst datefnsLocale = {\n  en: enGB,\n  nb,\n  sv,\n  da,\n  fi,\n};\n\n/**\n * An input for dates.\n *\n * Uses the `lang` attribute on either the element or on `<html>` to determine the locale options.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/forms-datepicker--docs)\n */\nclass WarpDatepicker extends FormControlMixin(LitElement) {\n  static shadowRootOptions = {\n    ...WarpElement.shadowRootOptions,\n    delegatesFocus: true,\n  };\n\n  static styles = [reset, wDatepickerStyles, wDatepickerCalendarStyles, wDatepickerDayStyles, wDatepickerMonthStyles];\n\n  @property({ reflect: true })\n  label: string;\n\n  /** Takes precedence over the `<html>` lang attribute. */\n  @property({ reflect: true })\n  lang: string;\n\n  @property({ reflect: true })\n  name: string;\n\n  @property({ reflect: true })\n  value: string;\n\n  /**\n   * Decides the format of the date as shown in the calendar header.\n   *\n   * The syntax is defined by [date-fns/format](https://date-fns.org/v4.1.0/docs/format).\n   */\n  @property({ attribute: 'header-format' })\n  headerFormat = 'MMMM yyyy';\n\n  /**\n   * Decides the format of the weekday as shown above the grid of dates in the calendar.\n   *\n   * The syntax is defined by [date-fns/format](https://date-fns.org/v4.1.0/docs/format).\n   */\n  @property({ attribute: 'weekday-format' })\n  weekdayFormat = 'EEEEEE';\n\n  /**\n   * Lets you control if a date in the calendar should be disabled.\n   *\n   * This needs to be set on the element instance in JavaScript, not as an HTML attribute.\n   *\n   * @example\n   * ```ts\n   * import type { WarpDatepicker } from \"@warp-ds/elements\";\n   * import { isBefore, startOfDay } from 'date-fns';\n   *\n   * const today = startOfDay(new Date());\n   * const datePicker = document.querySelector('w-datepicker') as WarpDatepicker;\n   * datePicker.isDayDisabled = (day: Date) => isBefore(startOfDay(day), today);\n   * ```\n   */\n  isDayDisabled: (day: Date) => boolean;\n\n  /**\n   * Decides the format of the day in the calendar as read to screen readers.\n   *\n   * The syntax is defined by [date-fns/format](https://date-fns.org/v4.1.0/docs/format).\n   */\n  @property({ attribute: 'day-format' })\n  dayFormat = 'PPPP';\n\n  @state()\n  isCalendarOpen = false;\n\n  @state()\n  navigationDate: Date = startOfToday();\n\n  /** @internal This gets picked up by the custom element manifest analyzer as a property for some reason */\n  @state()\n  locale: Locale = enGB;\n\n  @state()\n  get selectedDate(): Date | null {\n    return fromISOToDate(this.value) ?? null;\n  }\n\n  @state()\n  get month() {\n    return startOfMonth(this.navigationDate);\n  }\n\n  @state()\n  get weeks() {\n    const month = this.month;\n    const navigationDate = this.navigationDate;\n    const weekStarts = eachWeekOfInterval(\n      {\n        start: startOfMonth(month),\n        end: lastDayOfMonth(month),\n      },\n      { locale: this.locale },\n    );\n    const weekIntervals = weekStarts\n      .map((weekStart) => ({\n        start: weekStart,\n        end: endOfWeek(weekStart, { locale: this.locale }),\n      }))\n      .map((week) => eachDayOfInterval(week));\n\n    // Inserts the navigation date into the date matrix\n    if (isSameMonth(navigationDate, month)) {\n      const weekOfMonth = getWeekOfMonth(navigationDate, { locale: this.locale }) - 1;\n\n      // we need to get the day of the week to index into the correct day after we've gotten the week\n      // getDay() however isn't locale aware. This is a good replacement\n      const day = differenceInCalendarDays(navigationDate, startOfWeek(navigationDate, { locale: this.locale }));\n\n      weekIntervals[weekOfMonth][day] = navigationDate;\n    }\n    return weekIntervals;\n  }\n\n  @query(`#${calendarId}`)\n  calendar: HTMLDivElement;\n\n  @query(`#${inputId}`, true)\n  input: HTMLInputElement;\n\n  @query(`#${toggleButtonId}`, true)\n  toggleButton: HTMLButtonElement;\n\n  @query(`#${wrapperId}`, true)\n  wrapper: HTMLDivElement;\n\n  /**\n   * This is the first focusable element, needed for the modal focus trap.\n   *\n   * Don't cache this and other `@query` fields from inside the calendar modal.\n   * They work the first time, but once the calendar is closed and reopened\n   * the query will point to an element that doesn't exist anymore.\n   */\n  @query(`#${previousMonthButtonId}`)\n  previousMonthButton: HTMLButtonElement;\n\n  @query('[aria-current=\"date\"]')\n  todayCell: HTMLTableCellElement;\n\n  @query('[data-navigation=\"true\"]')\n  selectedCell: HTMLTableCellElement;\n\n  async #toggleCalendarOpen(e: MouseEvent | KeyboardEvent) {\n    e.preventDefault();\n    this.isCalendarOpen = !this.isCalendarOpen;\n    if (this.isCalendarOpen) {\n      // Move into the calendar and announce the availability\n      // of the calendar grid to screen reader users.\n      await this.updateComplete;\n      (this.selectedCell || this.todayCell).focus();\n    }\n  }\n\n  #nextMonth() {\n    this.navigationDate = addMonths(this.month, 1);\n  }\n\n  #previousMonth() {\n    this.navigationDate = subMonths(this.month, 1);\n  }\n\n  async #dispatchChangeEvent() {\n    // Let Lit finish rendering the updated value for the input field so\n    // the `event.target.value` is correct.\n    await this.updateComplete;\n    this.input.dispatchEvent(new Event('change', { bubbles: true, composed: true }));\n  }\n\n  /**\n   * We can't use private fields (`#` prefix) for this method\n   * since we can't overwrite private field methods. We need\n   * to `.bind(this)` in the constructor because we need one\n   * stable method handler we can register and unregister on\n   * `document`, that has access to this specific instance\n   * of WarpDatepicker to control the calendar.\n   * @internal\n   */\n  private _onClickOutside(e: MouseEvent | FocusEvent) {\n    if (!this.isCalendarOpen) {\n      return;\n    }\n\n    const isInsideDatePicker = this.contains(e.target as Node);\n    if (isInsideDatePicker) {\n      return;\n    }\n\n    this.isCalendarOpen = false;\n  }\n\n  #onInput(e: InputEvent) {\n    this.value = (e.target as HTMLInputElement).value;\n  }\n\n  #onInputClick(e: PointerEvent) {\n    // stop Safari on macOS from showing the native calendar\n    e.preventDefault();\n    this.isCalendarOpen = true;\n  }\n\n  #onInputKeyDown(e: KeyboardEvent) {\n    if (e.key === ' ') return this.#toggleCalendarOpen(e);\n    if (e.key === ',' || e.key === 'Enter') {\n      e.preventDefault();\n    }\n  }\n\n  async #onCalendarKeyDown(e: KeyboardEvent) {\n    const navigationDate = this.navigationDate;\n    let newNavigationDate: Date;\n\n    switch (e.key) {\n      case 'ArrowUp':\n        newNavigationDate = subDays(navigationDate, 7);\n        break;\n      case 'ArrowLeft':\n        newNavigationDate = subDays(navigationDate, 1);\n        break;\n      case 'Home':\n        newNavigationDate = startOfWeek(navigationDate, { locale: this.locale });\n        break;\n      case 'PageUp':\n        newNavigationDate = subMonths(navigationDate, 1);\n        break;\n      case 'ArrowDown':\n        newNavigationDate = addDays(navigationDate, 7);\n        break;\n      case 'ArrowRight':\n        newNavigationDate = addDays(navigationDate, 1);\n        break;\n      case 'End':\n        newNavigationDate = endOfWeek(navigationDate, { locale: this.locale });\n        break;\n      case 'PageDown':\n        newNavigationDate = addMonths(navigationDate, 1);\n        break;\n      case 'Escape':\n        this.isCalendarOpen = false;\n        break;\n      case 'Tab':\n        if ((e.target as HTMLElement).tagName === 'TD' && !e.shiftKey) {\n          // If Tab and no Shift we are about to leave the modal and should move focus\n          // to the Previous month button. If Shift is held, proceed as normal.\n          e.preventDefault();\n          this.previousMonthButton.focus();\n        } else if ((e.target as HTMLElement).id === previousMonthButtonId && e.shiftKey) {\n          // If we're holding Shift and pressing Tab we are moving back in the focus\n          // order. If we're about to leave the previous month button (the first focusable\n          // element in the modal), move the focus to the last focusable element, which\n          // is the current navigation date in the calendar grid.\n          e.preventDefault();\n          (this.selectedCell || this.todayCell).focus();\n        }\n        break;\n    }\n\n    if (newNavigationDate) {\n      // prevent scrolling the viewport\n      e.preventDefault();\n      this.navigationDate = newNavigationDate;\n\n      // move keyboard focus once Lit has rendered an updated `data-navigation`\n      // based on this.navigationDate\n      await this.updateComplete;\n      this.selectedCell.focus();\n    }\n  }\n\n  #onCalendarSelect(event: MouseEvent | KeyboardEvent) {\n    // Clicks can hit the `<div>` inside the `<td>`, so look at\n    // currentTarget (where the listener is registered) to get\n    // the `<td>` consistently.\n    const isoDate = (event.currentTarget as HTMLTableCellElement).dataset.date;\n\n    if ('key' in event) {\n      if (event.key === 'Enter' || event.key === ' ') {\n        // Prevents whitespace from being added to the input field\n        event.preventDefault();\n        this.value = isoDate;\n        this.isCalendarOpen = false;\n        this.toggleButton.focus();\n        this.#dispatchChangeEvent();\n      }\n    } else {\n      this.value = isoDate;\n      this.isCalendarOpen = false;\n      this.#dispatchChangeEvent();\n    }\n  }\n\n  constructor() {\n    super();\n\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n    const lang = detectLocale();\n    if (lang && datefnsLocale[lang]) {\n      this.locale = datefnsLocale[lang];\n    }\n\n    this._onClickOutside = this._onClickOutside.bind(this);\n  }\n\n  connectedCallback(): void {\n    super.connectedCallback();\n\n    // Local lang attribute takes precedence\n    const lang = this.lang;\n    if (lang && datefnsLocale[lang]) {\n      this.locale = datefnsLocale[lang];\n    }\n\n    if (this.value) {\n      const iso = fromISOToDate(this.value);\n      if (iso) {\n        this.navigationDate = iso;\n      }\n    }\n\n    document.addEventListener('mousedown', this._onClickOutside);\n    document.addEventListener('touchend', this._onClickOutside);\n    document.addEventListener('focusin', this._onClickOutside);\n  }\n\n  disconnectedCallback(): void {\n    super.disconnectedCallback();\n\n    document.removeEventListener('mousedown', this._onClickOutside);\n    document.removeEventListener('touchend', this._onClickOutside);\n    document.removeEventListener('focusin', this._onClickOutside);\n  }\n\n  updated(changedProperties: Map<string, unknown>): void {\n    if (changedProperties.has('value')) {\n      // https://www.npmjs.com/package/@open-wc/form-control#setvalue\n      this.setValue(this.value);\n    }\n  }\n\n  render() {\n    return html`\n      <div class=\"w-datepicker-wrapper\" id=\"${wrapperId}\">\n        <label class=\"w-datepicker-input-label\" for=\"${inputId}\">${this.label}</label>\n        <div class=\"w-datepicker-input-wrapper\">\n          <input\n            id=\"${inputId}\"\n            type=\"${inputType}\"\n            name=\"${ifDefined(this.name)}\"\n            value=\"${ifDefined(this.value)}\"\n            class=\"w-datepicker-input\"\n            @click=\"${this.#onInputClick}\"\n            @input=\"${this.#onInput}\"\n            @keydown=\"${this.#onInputKeyDown}\" />\n          <w-button\n            aria-label=\"${this.value\n              ? i18n.t({\n                  id: 'datepicker.toggle.changeDate',\n                  values: { currentDate: format(this.value, this.dayFormat) },\n                  message: `Change date, {currentDate}`,\n                  comment:\n                    'Used by screen readers to describe the button that toggles open the calendar in a date picker when there is a selected date',\n                })\n              : i18n.t({\n                  id: 'datepicker.toggle.chooseDate',\n                  message: `Choose date`,\n                  comment:\n                    'Used by screen readers to describe the button that toggles open the calendar in a date picker when there is no selected date',\n                })}\"\n            aria-controls=\"${calendarId}\"\n            class=\"w-datepicker-button\"\n            data-testid=\"${toggleButtonId}\"\n            id=\"${toggleButtonId}\"\n            variant=\"utility\"\n            quiet\n            type=\"button\"\n            @click=\"${this.#toggleCalendarOpen}\">\n            <w-icon-calendar-16></w-icon-calendar-16>\n          </w-button>\n        </div>\n      </div>\n      <div class=\"w-dropdown__popover w-dropdown__popover--open\" style=\"${styleMap({ display: this.isCalendarOpen ? undefined : 'none' })}\">\n        <div\n          aria-label=\"${i18n.t({\n            id: 'datepicker.calendar.roleDescription',\n            message: `Date picker`,\n            comment: 'Used by screen readers to announce that the calendar element is a date picker.',\n          })}\"\n          aria-modal=\"true\"\n          role=\"dialog\"\n          class=\"w-datepicker__calendar\"\n          data-testid=\"${calendarId}\"\n          id=\"${calendarId}\"\n          @keydown=\"${this.#onCalendarKeyDown}\">\n          <div class=\"w-datepicker__month-nav\">\n            <w-button\n              aria-label=\"${i18n.t({\n                id: 'datepicker.calendar.previousMonth',\n                message: `Previous month`,\n                comment: 'Screen reader label for the previous month button.',\n              })}\"\n              class=\"w-datepicker__month__nav__button\"\n              id=\"${previousMonthButtonId}\"\n              data-testid=\"${previousMonthButtonId}\"\n              variant=\"utility\"\n              quiet\n              small\n              @click=\"${this.#previousMonth}\">\n              <w-icon-chevron-left-16></w-icon-chevron-left-16>\n            </w-button>\n            <div aria-live=\"polite\" class=\"w-datepicker__month__nav__header\">\n              ${format(this.month, this.headerFormat, { locale: this.locale })}\n            </div>\n            <w-button\n              aria-label=\"${i18n.t({\n                id: 'datepicker.calendar.nextMonth',\n                message: `Next month`,\n                comment: 'Screen reader label for the next month button.',\n              })}\"\n              class=\"w-datepicker__month__nav__button\"\n              data-testid=\"${calendarId}-next\"\n              variant=\"utility\"\n              quiet\n              small\n              @click=\"${this.#nextMonth}\">\n              <w-icon-chevron-right-16></w-icon-chevron-right-16>\n            </w-button>\n          </div>\n          <div class=\"w-datepicker__month\">\n            <table class=\"w-datepicker__table\" role=\"grid\">\n              <thead class=\"w-datepicker__weekdays\">\n                <tr>\n                  ${this.weeks[0].map(\n                    (day) => html`<th class=\"w-datepicker__weekday\">${format(day, this.weekdayFormat, { locale: this.locale })}</th> `,\n                  )}\n                </tr>\n              </thead>\n              <tbody>\n                ${this.weeks.map(\n                  (week) =>\n                    html`<tr>\n                      ${week.map((day) => {\n                        if (!isSameMonth(this.month, day)) {\n                          return html`<td></td>`;\n                        }\n\n                        const isDisabled = this.isDayDisabled ? this.isDayDisabled(day) : false;\n                        const isSelected = isSameDay(day, this.selectedDate);\n                        const isNavigationDate = day === this.navigationDate;\n\n                        return html`<td\n                          aria-current=\"${ifDefined(isToday(day) ? 'date' : undefined)}\"\n                          aria-disabled=\"${isDisabled}\"\n                          aria-label=\"${format(day, this.dayFormat, { locale: this.locale })}\"\n                          aria-selected=\"${isSelected}\"\n                          class=\"${classMap({\n                            'w-datepicker__day': true,\n                            'w-datepicker__day--today': isToday(day),\n                            'w-datepicker__day--selected': isSelected,\n                            'w-datepicker__day--disabled': isDisabled,\n                            'w-datepicker__day--navigation': isNavigationDate,\n                          })}\"\n                          data-navigation=\"${isNavigationDate}\"\n                          data-date=\"${formatISO(day, { representation: 'date' })}\"\n                          role=\"gridcell\"\n                          tabindex=\"${isNavigationDate ? 0 : -1}\"\n                          @click=\"${isDisabled ? undefined : this.#onCalendarSelect}\"\n                          @keydown=\"${isDisabled ? undefined : this.#onCalendarSelect}\">\n                          <div>${getDate(day)}</div>\n                        </td>`;\n                      })}\n                    </tr>`,\n                )}\n              </tbody>\n            </table>\n          </div>\n        </div>\n      </div>\n    `;\n  }\n}\n\nif (!customElements.get('w-datepicker')) {\n  customElements.define('w-datepicker', WarpDatepicker);\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-datepicker': WarpDatepicker;\n  }\n}\n\nexport { WarpDatepicker };\n", "/**\n * @module constants\n * @summary Useful constants\n * @description\n * Collection of useful date constants.\n *\n * The constants could be imported from `date-fns/constants`:\n *\n * ```ts\n * import { maxTime, minTime } from \"./constants/date-fns/constants\";\n *\n * function isAllowedTime(time) {\n *   return time <= maxTime && time >= minTime;\n * }\n * ```\n */\n\n/**\n * @constant\n * @name daysInWeek\n * @summary Days in 1 week.\n */\nexport const daysInWeek = 7;\n\n/**\n * @constant\n * @name daysInYear\n * @summary Days in 1 year.\n *\n * @description\n * How many days in a year.\n *\n * One years equals 365.2425 days according to the formula:\n *\n * > Leap year occurs every 4 years, except for years that are divisible by 100 and not divisible by 400.\n * > 1 mean year = (365+1/4-1/100+1/400) days = 365.2425 days\n */\nexport const daysInYear = 365.2425;\n\n/**\n * @constant\n * @name maxTime\n * @summary Maximum allowed time.\n *\n * @example\n * import { maxTime } from \"./constants/date-fns/constants\";\n *\n * const isValid = 8640000000000001 <= maxTime;\n * //=> false\n *\n * new Date(8640000000000001);\n * //=> Invalid Date\n */\nexport const maxTime = Math.pow(10, 8) * 24 * 60 * 60 * 1000;\n\n/**\n * @constant\n * @name minTime\n * @summary Minimum allowed time.\n *\n * @example\n * import { minTime } from \"./constants/date-fns/constants\";\n *\n * const isValid = -8640000000000001 >= minTime;\n * //=> false\n *\n * new Date(-8640000000000001)\n * //=> Invalid Date\n */\nexport const minTime = -maxTime;\n\n/**\n * @constant\n * @name millisecondsInWeek\n * @summary Milliseconds in 1 week.\n */\nexport const millisecondsInWeek = 604800000;\n\n/**\n * @constant\n * @name millisecondsInDay\n * @summary Milliseconds in 1 day.\n */\nexport const millisecondsInDay = 86400000;\n\n/**\n * @constant\n * @name millisecondsInMinute\n * @summary Milliseconds in 1 minute\n */\nexport const millisecondsInMinute = 60000;\n\n/**\n * @constant\n * @name millisecondsInHour\n * @summary Milliseconds in 1 hour\n */\nexport const millisecondsInHour = 3600000;\n\n/**\n * @constant\n * @name millisecondsInSecond\n * @summary Milliseconds in 1 second\n */\nexport const millisecondsInSecond = 1000;\n\n/**\n * @constant\n * @name minutesInYear\n * @summary Minutes in 1 year.\n */\nexport const minutesInYear = 525600;\n\n/**\n * @constant\n * @name minutesInMonth\n * @summary Minutes in 1 month.\n */\nexport const minutesInMonth = 43200;\n\n/**\n * @constant\n * @name minutesInDay\n * @summary Minutes in 1 day.\n */\nexport const minutesInDay = 1440;\n\n/**\n * @constant\n * @name minutesInHour\n * @summary Minutes in 1 hour.\n */\nexport const minutesInHour = 60;\n\n/**\n * @constant\n * @name monthsInQuarter\n * @summary Months in 1 quarter.\n */\nexport const monthsInQuarter = 3;\n\n/**\n * @constant\n * @name monthsInYear\n * @summary Months in 1 year.\n */\nexport const monthsInYear = 12;\n\n/**\n * @constant\n * @name quartersInYear\n * @summary Quarters in 1 year\n */\nexport const quartersInYear = 4;\n\n/**\n * @constant\n * @name secondsInHour\n * @summary Seconds in 1 hour.\n */\nexport const secondsInHour = 3600;\n\n/**\n * @constant\n * @name secondsInMinute\n * @summary Seconds in 1 minute.\n */\nexport const secondsInMinute = 60;\n\n/**\n * @constant\n * @name secondsInDay\n * @summary Seconds in 1 day.\n */\nexport const secondsInDay = secondsInHour * 24;\n\n/**\n * @constant\n * @name secondsInWeek\n * @summary Seconds in 1 week.\n */\nexport const secondsInWeek = secondsInDay * 7;\n\n/**\n * @constant\n * @name secondsInYear\n * @summary Seconds in 1 year.\n */\nexport const secondsInYear = secondsInDay * daysInYear;\n\n/**\n * @constant\n * @name secondsInMonth\n * @summary Seconds in 1 month\n */\nexport const secondsInMonth = secondsInYear / 12;\n\n/**\n * @constant\n * @name secondsInQuarter\n * @summary Seconds in 1 quarter.\n */\nexport const secondsInQuarter = secondsInMonth * 3;\n\n/**\n * @constant\n * @name constructFromSymbol\n * @summary Symbol enabling Date extensions to inherit properties from the reference date.\n *\n * The symbol is used to enable the `constructFrom` function to construct a date\n * using a reference date and a value. It allows to transfer extra properties\n * from the reference date to the new date. It's useful for extensions like\n * [`TZDate`](https://github.com/date-fns/tz) that accept a time zone as\n * a constructor argument.\n */\nexport const constructFromSymbol = Symbol.for(\"constructDateFrom\");\n", "import { constructFromSymbol } from \"./constants.js\";\n\n/**\n * @name constructFrom\n * @category Generic Helpers\n * @summary Constructs a date using the reference date and the value\n *\n * @description\n * The function constructs a new date using the constructor from the reference\n * date and the given value. It helps to build generic functions that accept\n * date extensions.\n *\n * It defaults to `Date` if the passed reference date is a number or a string.\n *\n * Starting from v3.7.0, it allows to construct a date using `[Symbol.for(\"constructDateFrom\")]`\n * enabling to transfer extra properties from the reference date to the new date.\n * It's useful for extensions like [`TZDate`](https://github.com/date-fns/tz)\n * that accept a time zone as a constructor argument.\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments. Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n *\n * @param date - The reference date to take constructor from\n * @param value - The value to create the date\n *\n * @returns Date initialized using the given date and value\n *\n * @example\n * import { constructFrom } from \"./constructFrom/date-fns\";\n *\n * // A function that clones a date preserving the original type\n * function cloneDate<DateType extends Date>(date: DateType): DateType {\n *   return constructFrom(\n *     date, // Use constructor from the given date\n *     date.getTime() // Use the date value to create a new date\n *   );\n * }\n */\nexport function constructFrom(date, value) {\n  if (typeof date === \"function\") return date(value);\n\n  if (date && typeof date === \"object\" && constructFromSymbol in date)\n    return date[constructFromSymbol](value);\n\n  if (date instanceof Date) return new date.constructor(value);\n\n  return new Date(value);\n}\n\n// Fallback for modularized imports:\nexport default constructFrom;\n", "import { constructFrom } from \"./constructFrom.js\";\n\n/**\n * @name toDate\n * @category Common Helpers\n * @summary Convert the given argument to an instance of Date.\n *\n * @description\n * Convert the given argument to an instance of Date.\n *\n * If the argument is an instance of Date, the function returns its clone.\n *\n * If the argument is a number, it is treated as a timestamp.\n *\n * If the argument is none of the above, the function returns Invalid Date.\n *\n * Starting from v3.7.0, it clones a date using `[Symbol.for(\"constructDateFrom\")]`\n * enabling to transfer extra properties from the reference date to the new date.\n * It's useful for extensions like [`TZDate`](https://github.com/date-fns/tz)\n * that accept a time zone as a constructor argument.\n *\n * **Note**: *all* Date arguments passed to any *date-fns* function is processed by `toDate`.\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments. Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n * @typeParam ResultDate - The result `Date` type, it is the type returned from the context function if it is passed, or inferred from the arguments.\n *\n * @param argument - The value to convert\n *\n * @returns The parsed date in the local time zone\n *\n * @example\n * // Clone the date:\n * const result = toDate(new Date(2014, 1, 11, 11, 30, 30))\n * //=> Tue Feb 11 2014 11:30:30\n *\n * @example\n * // Convert the timestamp to date:\n * const result = toDate(1392098430000)\n * //=> Tue Feb 11 2014 11:30:30\n */\nexport function toDate(argument, context) {\n  // [TODO] Get rid of `toDate` or `constructFrom`?\n  return constructFrom(context || argument, argument);\n}\n\n// Fallback for modularized imports:\nexport default toDate;\n", "import { constructFrom } from \"./constructFrom.js\";\nimport { toDate } from \"./toDate.js\";\n\n/**\n * The {@link addDays} function options.\n */\n\n/**\n * @name addDays\n * @category Day Helpers\n * @summary Add the specified number of days to the given date.\n *\n * @description\n * Add the specified number of days to the given date.\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments. Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n * @typeParam ResultDate - The result `Date` type, it is the type returned from the context function if it is passed, or inferred from the arguments.\n *\n * @param date - The date to be changed\n * @param amount - The amount of days to be added.\n * @param options - An object with options\n *\n * @returns The new date with the days added\n *\n * @example\n * // Add 10 days to 1 September 2014:\n * const result = addDays(new Date(2014, 8, 1), 10)\n * //=> Thu Sep 11 2014 00:00:00\n */\nexport function addDays(date, amount, options) {\n  const _date = toDate(date, options?.in);\n  if (isNaN(amount)) return constructFrom(options?.in || date, NaN);\n\n  // If 0 days, no-op to avoid changing times in the hour before end of DST\n  if (!amount) return _date;\n\n  _date.setDate(_date.getDate() + amount);\n  return _date;\n}\n\n// Fallback for modularized imports:\nexport default addDays;\n", "import { constructFrom } from \"./constructFrom.js\";\nimport { toDate } from \"./toDate.js\";\n\n/**\n * The {@link addMonths} function options.\n */\n\n/**\n * @name addMonths\n * @category Month Helpers\n * @summary Add the specified number of months to the given date.\n *\n * @description\n * Add the specified number of months to the given date.\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments. Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n * @typeParam ResultDate - The result `Date` type, it is the type returned from the context function if it is passed, or inferred from the arguments.\n *\n * @param date - The date to be changed\n * @param amount - The amount of months to be added.\n * @param options - The options object\n *\n * @returns The new date with the months added\n *\n * @example\n * // Add 5 months to 1 September 2014:\n * const result = addMonths(new Date(2014, 8, 1), 5)\n * //=> Sun Feb 01 2015 00:00:00\n *\n * // Add one month to 30 January 2023:\n * const result = addMonths(new Date(2023, 0, 30), 1)\n * //=> Tue Feb 28 2023 00:00:00\n */\nexport function addMonths(date, amount, options) {\n  const _date = toDate(date, options?.in);\n  if (isNaN(amount)) return constructFrom(options?.in || date, NaN);\n  if (!amount) {\n    // If 0 months, no-op to avoid changing times in the hour before end of DST\n    return _date;\n  }\n  const dayOfMonth = _date.getDate();\n\n  // The JS Date object supports date math by accepting out-of-bounds values for\n  // month, day, etc. For example, new Date(2020, 0, 0) returns 31 Dec 2019 and\n  // new Date(2020, 13, 1) returns 1 Feb 2021.  This is *almost* the behavior we\n  // want except that dates will wrap around the end of a month, meaning that\n  // new Date(2020, 13, 31) will return 3 Mar 2021 not 28 Feb 2021 as desired. So\n  // we'll default to the end of the desired month by adding 1 to the desired\n  // month and using a date of 0 to back up one day to the end of the desired\n  // month.\n  const endOfDesiredMonth = constructFrom(options?.in || date, _date.getTime());\n  endOfDesiredMonth.setMonth(_date.getMonth() + amount + 1, 0);\n  const daysInMonth = endOfDesiredMonth.getDate();\n  if (dayOfMonth >= daysInMonth) {\n    // If we're already at the end of the month, then this is the correct date\n    // and we're done.\n    return endOfDesiredMonth;\n  } else {\n    // Otherwise, we now know that setting the original day-of-month value won't\n    // cause an overflow, so set the desired day-of-month. Note that we can't\n    // just set the date of `endOfDesiredMonth` because that object may have had\n    // its time changed in the unusual case where where a DST transition was on\n    // the last day of the month and its local time was in the hour skipped or\n    // repeated next to a DST transition.  So we use `date` instead which is\n    // guaranteed to still have the original time.\n    _date.setFullYear(\n      endOfDesiredMonth.getFullYear(),\n      endOfDesiredMonth.getMonth(),\n      dayOfMonth,\n    );\n    return _date;\n  }\n}\n\n// Fallback for modularized imports:\nexport default addMonths;\n", "let defaultOptions = {};\n\nexport function getDefaultOptions() {\n  return defaultOptions;\n}\n\nexport function setDefaultOptions(newOptions) {\n  defaultOptions = newOptions;\n}\n", "import { getDefaultOptions } from \"./_lib/defaultOptions.js\";\nimport { toDate } from \"./toDate.js\";\n\n/**\n * The {@link startOfWeek} function options.\n */\n\n/**\n * @name startOfWeek\n * @category Week Helpers\n * @summary Return the start of a week for the given date.\n *\n * @description\n * Return the start of a week for the given date.\n * The result will be in the local timezone.\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments. Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n * @typeParam ResultDate - The result `Date` type, it is the type returned from the context function if it is passed, or inferred from the arguments.\n *\n * @param date - The original date\n * @param options - An object with options\n *\n * @returns The start of a week\n *\n * @example\n * // The start of a week for 2 September 2014 11:55:00:\n * const result = startOfWeek(new Date(2014, 8, 2, 11, 55, 0))\n * //=> Sun Aug 31 2014 00:00:00\n *\n * @example\n * // If the week starts on Monday, the start of the week for 2 September 2014 11:55:00:\n * const result = startOfWeek(new Date(2014, 8, 2, 11, 55, 0), { weekStartsOn: 1 })\n * //=> Mon Sep 01 2014 00:00:00\n */\nexport function startOfWeek(date, options) {\n  const defaultOptions = getDefaultOptions();\n  const weekStartsOn =\n    options?.weekStartsOn ??\n    options?.locale?.options?.weekStartsOn ??\n    defaultOptions.weekStartsOn ??\n    defaultOptions.locale?.options?.weekStartsOn ??\n    0;\n\n  const _date = toDate(date, options?.in);\n  const day = _date.getDay();\n  const diff = (day < weekStartsOn ? 7 : 0) + day - weekStartsOn;\n\n  _date.setDate(_date.getDate() - diff);\n  _date.setHours(0, 0, 0, 0);\n  return _date;\n}\n\n// Fallback for modularized imports:\nexport default startOfWeek;\n", "import { startOfWeek } from \"./startOfWeek.js\";\n\n/**\n * The {@link startOfISOWeek} function options.\n */\n\n/**\n * @name startOfISOWeek\n * @category ISO Week Helpers\n * @summary Return the start of an ISO week for the given date.\n *\n * @description\n * Return the start of an ISO week for the given date.\n * The result will be in the local timezone.\n *\n * ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments. Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n * @typeParam ResultDate - The result `Date` type, it is the type returned from the context function if it is passed, or inferred from the arguments.\n *\n * @param date - The original date\n * @param options - An object with options\n *\n * @returns The start of an ISO week\n *\n * @example\n * // The start of an ISO week for 2 September 2014 11:55:00:\n * const result = startOfISOWeek(new Date(2014, 8, 2, 11, 55, 0))\n * //=> Mon Sep 01 2014 00:00:00\n */\nexport function startOfISOWeek(date, options) {\n  return startOfWeek(date, { ...options, weekStartsOn: 1 });\n}\n\n// Fallback for modularized imports:\nexport default startOfISOWeek;\n", "import { constructFrom } from \"./constructFrom.js\";\nimport { startOfISOWeek } from \"./startOfISOWeek.js\";\nimport { toDate } from \"./toDate.js\";\n\n/**\n * The {@link getISOWeekYear} function options.\n */\n\n/**\n * @name getISOWeekYear\n * @category ISO Week-Numbering Year Helpers\n * @summary Get the ISO week-numbering year of the given date.\n *\n * @description\n * Get the ISO week-numbering year of the given date,\n * which always starts 3 days before the year's first Thursday.\n *\n * ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date\n *\n * @param date - The given date\n *\n * @returns The ISO week-numbering year\n *\n * @example\n * // Which ISO-week numbering year is 2 January 2005?\n * const result = getISOWeekYear(new Date(2005, 0, 2))\n * //=> 2004\n */\nexport function getISOWeekYear(date, options) {\n  const _date = toDate(date, options?.in);\n  const year = _date.getFullYear();\n\n  const fourthOfJanuaryOfNextYear = constructFrom(_date, 0);\n  fourthOfJanuaryOfNextYear.setFullYear(year + 1, 0, 4);\n  fourthOfJanuaryOfNextYear.setHours(0, 0, 0, 0);\n  const startOfNextYear = startOfISOWeek(fourthOfJanuaryOfNextYear);\n\n  const fourthOfJanuaryOfThisYear = constructFrom(_date, 0);\n  fourthOfJanuaryOfThisYear.setFullYear(year, 0, 4);\n  fourthOfJanuaryOfThisYear.setHours(0, 0, 0, 0);\n  const startOfThisYear = startOfISOWeek(fourthOfJanuaryOfThisYear);\n\n  if (_date.getTime() >= startOfNextYear.getTime()) {\n    return year + 1;\n  } else if (_date.getTime() >= startOfThisYear.getTime()) {\n    return year;\n  } else {\n    return year - 1;\n  }\n}\n\n// Fallback for modularized imports:\nexport default getISOWeekYear;\n", "import { toDate } from \"../toDate.js\";\n\n/**\n * Google Chrome as of 67.0.3396.87 introduced timezones with offset that includes seconds.\n * They usually appear for dates that denote time before the timezones were introduced\n * (e.g. for 'Europe/Prague' timezone the offset is GMT+00:57:44 before 1 October 1891\n * and GMT+01:00:00 after that date)\n *\n * Date#getTimezoneOffset returns the offset in minutes and would return 57 for the example above,\n * which would lead to incorrect calculations.\n *\n * This function returns the timezone offset in milliseconds that takes seconds in account.\n */\nexport function getTimezoneOffsetInMilliseconds(date) {\n  const _date = toDate(date);\n  const utcDate = new Date(\n    Date.UTC(\n      _date.getFullYear(),\n      _date.getMonth(),\n      _date.getDate(),\n      _date.getHours(),\n      _date.getMinutes(),\n      _date.getSeconds(),\n      _date.getMilliseconds(),\n    ),\n  );\n  utcDate.setUTCFullYear(_date.getFullYear());\n  return +date - +utcDate;\n}\n", "import { constructFrom } from \"../constructFrom.js\";\n\nexport function normalizeDates(context, ...dates) {\n  const normalize = constructFrom.bind(\n    null,\n    context || dates.find((date) => typeof date === \"object\"),\n  );\n  return dates.map(normalize);\n}\n", "import { toDate } from \"./toDate.js\";\n\n/**\n * The {@link startOfDay} function options.\n */\n\n/**\n * @name startOfDay\n * @category Day Helpers\n * @summary Return the start of a day for the given date.\n *\n * @description\n * Return the start of a day for the given date.\n * The result will be in the local timezone.\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments. Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n * @typeParam ResultDate - The result `Date` type, it is the type returned from the context function if it is passed, or inferred from the arguments.\n *\n * @param date - The original date\n * @param options - The options\n *\n * @returns The start of a day\n *\n * @example\n * // The start of a day for 2 September 2014 11:55:00:\n * const result = startOfDay(new Date(2014, 8, 2, 11, 55, 0))\n * //=> Tue Sep 02 2014 00:00:00\n */\nexport function startOfDay(date, options) {\n  const _date = toDate(date, options?.in);\n  _date.setHours(0, 0, 0, 0);\n  return _date;\n}\n\n// Fallback for modularized imports:\nexport default startOfDay;\n", "import { getTimezoneOffsetInMilliseconds } from \"./_lib/getTimezoneOffsetInMilliseconds.js\";\nimport { normalizeDates } from \"./_lib/normalizeDates.js\";\nimport { millisecondsInDay } from \"./constants.js\";\nimport { startOfDay } from \"./startOfDay.js\";\n\n/**\n * The {@link differenceInCalendarDays} function options.\n */\n\n/**\n * @name differenceInCalendarDays\n * @category Day Helpers\n * @summary Get the number of calendar days between the given dates.\n *\n * @description\n * Get the number of calendar days between the given dates. This means that the times are removed\n * from the dates and then the difference in days is calculated.\n *\n * @param laterDate - The later date\n * @param earlierDate - The earlier date\n * @param options - The options object\n *\n * @returns The number of calendar days\n *\n * @example\n * // How many calendar days are between\n * // 2 July 2011 23:00:00 and 2 July 2012 00:00:00?\n * const result = differenceInCalendarDays(\n *   new Date(2012, 6, 2, 0, 0),\n *   new Date(2011, 6, 2, 23, 0)\n * )\n * //=> 366\n * // How many calendar days are between\n * // 2 July 2011 23:59:00 and 3 July 2011 00:01:00?\n * const result = differenceInCalendarDays(\n *   new Date(2011, 6, 3, 0, 1),\n *   new Date(2011, 6, 2, 23, 59)\n * )\n * //=> 1\n */\nexport function differenceInCalendarDays(laterDate, earlierDate, options) {\n  const [laterDate_, earlierDate_] = normalizeDates(\n    options?.in,\n    laterDate,\n    earlierDate,\n  );\n\n  const laterStartOfDay = startOfDay(laterDate_);\n  const earlierStartOfDay = startOfDay(earlierDate_);\n\n  const laterTimestamp =\n    +laterStartOfDay - getTimezoneOffsetInMilliseconds(laterStartOfDay);\n  const earlierTimestamp =\n    +earlierStartOfDay - getTimezoneOffsetInMilliseconds(earlierStartOfDay);\n\n  // Round the number of days to the nearest integer because the number of\n  // milliseconds in a day is not constant (e.g. it's different in the week of\n  // the daylight saving time clock shift).\n  return Math.round((laterTimestamp - earlierTimestamp) / millisecondsInDay);\n}\n\n// Fallback for modularized imports:\nexport default differenceInCalendarDays;\n", "import { constructFrom } from \"./constructFrom.js\";\nimport { getISOWeekYear } from \"./getISOWeekYear.js\";\nimport { startOfISOWeek } from \"./startOfISOWeek.js\";\n\n/**\n * The {@link startOfISOWeekYear} function options.\n */\n\n/**\n * @name startOfISOWeekYear\n * @category ISO Week-Numbering Year Helpers\n * @summary Return the start of an ISO week-numbering year for the given date.\n *\n * @description\n * Return the start of an ISO week-numbering year,\n * which always starts 3 days before the year's first Thursday.\n * The result will be in the local timezone.\n *\n * ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments. Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n * @typeParam ResultDate - The result `Date` type, it is the type returned from the context function if it is passed, or inferred from the arguments.\n *\n * @param date - The original date\n * @param options - An object with options\n *\n * @returns The start of an ISO week-numbering year\n *\n * @example\n * // The start of an ISO week-numbering year for 2 July 2005:\n * const result = startOfISOWeekYear(new Date(2005, 6, 2))\n * //=> Mon Jan 03 2005 00:00:00\n */\nexport function startOfISOWeekYear(date, options) {\n  const year = getISOWeekYear(date, options);\n  const fourthOfJanuary = constructFrom(options?.in || date, 0);\n  fourthOfJanuary.setFullYear(year, 0, 4);\n  fourthOfJanuary.setHours(0, 0, 0, 0);\n  return startOfISOWeek(fourthOfJanuary);\n}\n\n// Fallback for modularized imports:\nexport default startOfISOWeekYear;\n", "import { addDays } from \"./addDays.js\";\n\n/**\n * The {@link addWeeks} function options.\n */\n\n/**\n * @name addWeeks\n * @category Week Helpers\n * @summary Add the specified number of weeks to the given date.\n *\n * @description\n * Add the specified number of weeks to the given date.\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments. Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n * @typeParam ResultDate - The result `Date` type, it is the type returned from the context function if it is passed, or inferred from the arguments.\n *\n * @param date - The date to be changed\n * @param amount - The amount of weeks to be added.\n * @param options - An object with options\n *\n * @returns The new date with the weeks added\n *\n * @example\n * // Add 4 weeks to 1 September 2014:\n * const result = addWeeks(new Date(2014, 8, 1), 4)\n * //=> Mon Sep 29 2014 00:00:00\n */\nexport function addWeeks(date, amount, options) {\n  return addDays(date, amount * 7, options);\n}\n\n// Fallback for modularized imports:\nexport default addWeeks;\n", "import { constructFrom } from \"./constructFrom.js\";\n\n/**\n * @name constructNow\n * @category Generic Helpers\n * @summary Constructs a new current date using the passed value constructor.\n * @pure false\n *\n * @description\n * The function constructs a new current date using the constructor from\n * the reference date. It helps to build generic functions that accept date\n * extensions and use the current date.\n *\n * It defaults to `Date` if the passed reference date is a number or a string.\n *\n * @param date - The reference date to take constructor from\n *\n * @returns Current date initialized using the given date constructor\n *\n * @example\n * import { constructNow, isSameDay } from 'date-fns'\n *\n * function isToday<DateType extends Date>(\n *   date: DateArg<DateType>,\n * ): boolean {\n *   // If we were to use `new Date()` directly, the function would  behave\n *   // differently in different timezones and return false for the same date.\n *   return isSameDay(date, constructNow(date));\n * }\n */\nexport function constructNow(date) {\n  return constructFrom(date, Date.now());\n}\n\n// Fallback for modularized imports:\nexport default constructNow;\n", "import { normalizeDates } from \"./_lib/normalizeDates.js\";\nimport { startOfDay } from \"./startOfDay.js\";\n\n/**\n * The {@link isSameDay} function options.\n */\n\n/**\n * @name isSameDay\n * @category Day Helpers\n * @summary Are the given dates in the same day (and year and month)?\n *\n * @description\n * Are the given dates in the same day (and year and month)?\n *\n * @param laterDate - The first date to check\n * @param earlierDate - The second date to check\n * @param options - An object with options\n *\n * @returns The dates are in the same day (and year and month)\n *\n * @example\n * // Are 4 September 06:00:00 and 4 September 18:00:00 in the same day?\n * const result = isSameDay(new Date(2014, 8, 4, 6, 0), new Date(2014, 8, 4, 18, 0))\n * //=> true\n *\n * @example\n * // Are 4 September and 4 October in the same day?\n * const result = isSameDay(new Date(2014, 8, 4), new Date(2014, 9, 4))\n * //=> false\n *\n * @example\n * // Are 4 September, 2014 and 4 September, 2015 in the same day?\n * const result = isSameDay(new Date(2014, 8, 4), new Date(2015, 8, 4))\n * //=> false\n */\nexport function isSameDay(laterDate, earlierDate, options) {\n  const [dateLeft_, dateRight_] = normalizeDates(\n    options?.in,\n    laterDate,\n    earlierDate,\n  );\n  return +startOfDay(dateLeft_) === +startOfDay(dateRight_);\n}\n\n// Fallback for modularized imports:\nexport default isSameDay;\n", "/**\n * @name isDate\n * @category Common Helpers\n * @summary Is the given value a date?\n *\n * @description\n * Returns true if the given value is an instance of Date. The function works for dates transferred across iframes.\n *\n * @param value - The value to check\n *\n * @returns True if the given value is a date\n *\n * @example\n * // For a valid date:\n * const result = isDate(new Date())\n * //=> true\n *\n * @example\n * // For an invalid date:\n * const result = isDate(new Date(NaN))\n * //=> true\n *\n * @example\n * // For some value:\n * const result = isDate('2014-02-31')\n * //=> false\n *\n * @example\n * // For an object:\n * const result = isDate({})\n * //=> false\n */\nexport function isDate(value) {\n  return (\n    value instanceof Date ||\n    (typeof value === \"object\" &&\n      Object.prototype.toString.call(value) === \"[object Date]\")\n  );\n}\n\n// Fallback for modularized imports:\nexport default isDate;\n", "import { isDate } from \"./isDate.js\";\nimport { toDate } from \"./toDate.js\";\n\n/**\n * @name isValid\n * @category Common Helpers\n * @summary Is the given date valid?\n *\n * @description\n * Returns false if argument is Invalid Date and true otherwise.\n * Argument is converted to Date using `toDate`. See [toDate](https://date-fns.org/docs/toDate)\n * Invalid Date is a Date, whose time value is NaN.\n *\n * Time value of Date: http://es5.github.io/#x15.9.1.1\n *\n * @param date - The date to check\n *\n * @returns The date is valid\n *\n * @example\n * // For the valid date:\n * const result = isValid(new Date(2014, 1, 31))\n * //=> true\n *\n * @example\n * // For the value, convertible into a date:\n * const result = isValid(1393804800000)\n * //=> true\n *\n * @example\n * // For the invalid date:\n * const result = isValid(new Date(''))\n * //=> false\n */\nexport function isValid(date) {\n  return !((!isDate(date) && typeof date !== \"number\") || isNaN(+toDate(date)));\n}\n\n// Fallback for modularized imports:\nexport default isValid;\n", "import { normalizeDates } from \"./normalizeDates.js\";\n\nexport function normalizeInterval(context, interval) {\n  const [start, end] = normalizeDates(context, interval.start, interval.end);\n  return { start, end };\n}\n", "import { normalizeInterval } from \"./_lib/normalizeInterval.js\";\nimport { constructFrom } from \"./constructFrom.js\";\n\n/**\n * The {@link eachDayOfInterval} function options.\n */\n\n/**\n * The {@link eachDayOfInterval} function result type. It resolves the proper data type.\n * It uses the first argument date object type, starting from the date argument,\n * then the start interval date, and finally the end interval date. If\n * a context function is passed, it uses the context function return type.\n */\n\n/**\n * @name eachDayOfInterval\n * @category Interval Helpers\n * @summary Return the array of dates within the specified time interval.\n *\n * @description\n * Return the array of dates within the specified time interval.\n *\n * @typeParam IntervalType - Interval type.\n * @typeParam Options - Options type.\n *\n * @param interval - The interval.\n * @param options - An object with options.\n *\n * @returns The array with starts of days from the day of the interval start to the day of the interval end\n *\n * @example\n * // Each day between 6 October 2014 and 10 October 2014:\n * const result = eachDayOfInterval({\n *   start: new Date(2014, 9, 6),\n *   end: new Date(2014, 9, 10)\n * })\n * //=> [\n * //   Mon Oct 06 2014 00:00:00,\n * //   Tue Oct 07 2014 00:00:00,\n * //   Wed Oct 08 2014 00:00:00,\n * //   Thu Oct 09 2014 00:00:00,\n * //   Fri Oct 10 2014 00:00:00\n * // ]\n */\nexport function eachDayOfInterval(interval, options) {\n  const { start, end } = normalizeInterval(options?.in, interval);\n\n  let reversed = +start > +end;\n  const endTime = reversed ? +start : +end;\n  const date = reversed ? end : start;\n  date.setHours(0, 0, 0, 0);\n\n  let step = options?.step ?? 1;\n  if (!step) return [];\n  if (step < 0) {\n    step = -step;\n    reversed = !reversed;\n  }\n\n  const dates = [];\n\n  while (+date <= endTime) {\n    dates.push(constructFrom(start, date));\n    date.setDate(date.getDate() + step);\n    date.setHours(0, 0, 0, 0);\n  }\n\n  return reversed ? dates.reverse() : dates;\n}\n\n// Fallback for modularized imports:\nexport default eachDayOfInterval;\n", "import { normalizeInterval } from \"./_lib/normalizeInterval.js\";\nimport { addWeeks } from \"./addWeeks.js\";\nimport { constructFrom } from \"./constructFrom.js\";\nimport { startOfWeek } from \"./startOfWeek.js\";\n\n/**\n * The {@link eachWeekOfInterval} function options.\n */\n\n/**\n * The {@link eachWeekOfInterval} function result type. It resolves the proper data type.\n * It uses the first argument date object type, starting from the interval start date,\n * then the end interval date. If a context function is passed, it uses the context function return type.\n */\n\n/**\n * @name eachWeekOfInterval\n * @category Interval Helpers\n * @summary Return the array of weeks within the specified time interval.\n *\n * @description\n * Return the array of weeks within the specified time interval.\n *\n * @param interval - The interval.\n * @param options - An object with options.\n *\n * @returns The array with starts of weeks from the week of the interval start to the week of the interval end\n *\n * @example\n * // Each week within interval 6 October 2014 - 23 November 2014:\n * const result = eachWeekOfInterval({\n *   start: new Date(2014, 9, 6),\n *   end: new Date(2014, 10, 23)\n * })\n * //=> [\n * //   Sun Oct 05 2014 00:00:00,\n * //   Sun Oct 12 2014 00:00:00,\n * //   Sun Oct 19 2014 00:00:00,\n * //   Sun Oct 26 2014 00:00:00,\n * //   Sun Nov 02 2014 00:00:00,\n * //   Sun Nov 09 2014 00:00:00,\n * //   Sun Nov 16 2014 00:00:00,\n * //   Sun Nov 23 2014 00:00:00\n * // ]\n */\nexport function eachWeekOfInterval(interval, options) {\n  const { start, end } = normalizeInterval(options?.in, interval);\n\n  let reversed = +start > +end;\n  const startDateWeek = reversed\n    ? startOfWeek(end, options)\n    : startOfWeek(start, options);\n  const endDateWeek = reversed\n    ? startOfWeek(start, options)\n    : startOfWeek(end, options);\n\n  startDateWeek.setHours(15);\n  endDateWeek.setHours(15);\n\n  const endTime = +endDateWeek.getTime();\n  let currentDate = startDateWeek;\n\n  let step = options?.step ?? 1;\n  if (!step) return [];\n  if (step < 0) {\n    step = -step;\n    reversed = !reversed;\n  }\n\n  const dates = [];\n\n  while (+currentDate <= endTime) {\n    currentDate.setHours(0);\n    dates.push(constructFrom(start, currentDate));\n    currentDate = addWeeks(currentDate, step);\n    currentDate.setHours(15);\n  }\n\n  return reversed ? dates.reverse() : dates;\n}\n\n// Fallback for modularized imports:\nexport default eachWeekOfInterval;\n", "import { toDate } from \"./toDate.js\";\n\n/**\n * The {@link startOfMonth} function options.\n */\n\n/**\n * @name startOfMonth\n * @category Month Helpers\n * @summary Return the start of a month for the given date.\n *\n * @description\n * Return the start of a month for the given date. The result will be in the local timezone.\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments.\n * Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n * @typeParam ResultDate - The result `Date` type, it is the type returned from the context function if it is passed,\n * or inferred from the arguments.\n *\n * @param date - The original date\n * @param options - An object with options\n *\n * @returns The start of a month\n *\n * @example\n * // The start of a month for 2 September 2014 11:55:00:\n * const result = startOfMonth(new Date(2014, 8, 2, 11, 55, 0))\n * //=> Mon Sep 01 2014 00:00:00\n */\nexport function startOfMonth(date, options) {\n  const _date = toDate(date, options?.in);\n  _date.setDate(1);\n  _date.setHours(0, 0, 0, 0);\n  return _date;\n}\n\n// Fallback for modularized imports:\nexport default startOfMonth;\n", "import { toDate } from \"./toDate.js\";\n\n/**\n * The {@link startOfYear} function options.\n */\n\n/**\n * @name startOfYear\n * @category Year Helpers\n * @summary Return the start of a year for the given date.\n *\n * @description\n * Return the start of a year for the given date.\n * The result will be in the local timezone.\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments. Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n * @typeParam ResultDate - The result `Date` type, it is the type returned from the context function if it is passed, or inferred from the arguments.\n *\n * @param date - The original date\n * @param options - The options\n *\n * @returns The start of a year\n *\n * @example\n * // The start of a year for 2 September 2014 11:55:00:\n * const result = startOfYear(new Date(2014, 8, 2, 11, 55, 00))\n * //=> Wed Jan 01 2014 00:00:00\n */\nexport function startOfYear(date, options) {\n  const date_ = toDate(date, options?.in);\n  date_.setFullYear(date_.getFullYear(), 0, 1);\n  date_.setHours(0, 0, 0, 0);\n  return date_;\n}\n\n// Fallback for modularized imports:\nexport default startOfYear;\n", "import { getDefaultOptions } from \"./_lib/defaultOptions.js\";\nimport { toDate } from \"./toDate.js\";\n\n/**\n * The {@link endOfWeek} function options.\n */\n\n/**\n * @name endOfWeek\n * @category Week Helpers\n * @summary Return the end of a week for the given date.\n *\n * @description\n * Return the end of a week for the given date.\n * The result will be in the local timezone.\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments. Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n * @typeParam ResultDate - The result `Date` type, it is the type returned from the context function if it is passed, or inferred from the arguments.\n *\n * @param date - The original date\n * @param options - An object with options\n *\n * @returns The end of a week\n *\n * @example\n * // The end of a week for 2 September 2014 11:55:00:\n * const result = endOfWeek(new Date(2014, 8, 2, 11, 55, 0))\n * //=> Sat Sep 06 2014 23:59:59.999\n *\n * @example\n * // If the week starts on Monday, the end of the week for 2 September 2014 11:55:00:\n * const result = endOfWeek(new Date(2014, 8, 2, 11, 55, 0), { weekStartsOn: 1 })\n * //=> Sun Sep 07 2014 23:59:59.999\n */\nexport function endOfWeek(date, options) {\n  const defaultOptions = getDefaultOptions();\n  const weekStartsOn =\n    options?.weekStartsOn ??\n    options?.locale?.options?.weekStartsOn ??\n    defaultOptions.weekStartsOn ??\n    defaultOptions.locale?.options?.weekStartsOn ??\n    0;\n\n  const _date = toDate(date, options?.in);\n  const day = _date.getDay();\n  const diff = (day < weekStartsOn ? -7 : 0) + 6 - (day - weekStartsOn);\n\n  _date.setDate(_date.getDate() + diff);\n  _date.setHours(23, 59, 59, 999);\n  return _date;\n}\n\n// Fallback for modularized imports:\nexport default endOfWeek;\n", "const formatDistanceLocale = {\n  lessThanXSeconds: {\n    one: \"less than a second\",\n    other: \"less than {{count}} seconds\",\n  },\n\n  xSeconds: {\n    one: \"1 second\",\n    other: \"{{count}} seconds\",\n  },\n\n  halfAMinute: \"half a minute\",\n\n  lessThanXMinutes: {\n    one: \"less than a minute\",\n    other: \"less than {{count}} minutes\",\n  },\n\n  xMinutes: {\n    one: \"1 minute\",\n    other: \"{{count}} minutes\",\n  },\n\n  aboutXHours: {\n    one: \"about 1 hour\",\n    other: \"about {{count}} hours\",\n  },\n\n  xHours: {\n    one: \"1 hour\",\n    other: \"{{count}} hours\",\n  },\n\n  xDays: {\n    one: \"1 day\",\n    other: \"{{count}} days\",\n  },\n\n  aboutXWeeks: {\n    one: \"about 1 week\",\n    other: \"about {{count}} weeks\",\n  },\n\n  xWeeks: {\n    one: \"1 week\",\n    other: \"{{count}} weeks\",\n  },\n\n  aboutXMonths: {\n    one: \"about 1 month\",\n    other: \"about {{count}} months\",\n  },\n\n  xMonths: {\n    one: \"1 month\",\n    other: \"{{count}} months\",\n  },\n\n  aboutXYears: {\n    one: \"about 1 year\",\n    other: \"about {{count}} years\",\n  },\n\n  xYears: {\n    one: \"1 year\",\n    other: \"{{count}} years\",\n  },\n\n  overXYears: {\n    one: \"over 1 year\",\n    other: \"over {{count}} years\",\n  },\n\n  almostXYears: {\n    one: \"almost 1 year\",\n    other: \"almost {{count}} years\",\n  },\n};\n\nexport const formatDistance = (token, count, options) => {\n  let result;\n\n  const tokenValue = formatDistanceLocale[token];\n  if (typeof tokenValue === \"string\") {\n    result = tokenValue;\n  } else if (count === 1) {\n    result = tokenValue.one;\n  } else {\n    result = tokenValue.other.replace(\"{{count}}\", count.toString());\n  }\n\n  if (options?.addSuffix) {\n    if (options.comparison && options.comparison > 0) {\n      return \"in \" + result;\n    } else {\n      return result + \" ago\";\n    }\n  }\n\n  return result;\n};\n", "export function buildFormatLongFn(args) {\n  return (options = {}) => {\n    // TODO: Remove String()\n    const width = options.width ? String(options.width) : args.defaultWidth;\n    const format = args.formats[width] || args.formats[args.defaultWidth];\n    return format;\n  };\n}\n", "import { buildFormatLongFn } from \"../../_lib/buildFormatLongFn.js\";\n\nconst dateFormats = {\n  full: \"EEEE, MMMM do, y\",\n  long: \"MMMM do, y\",\n  medium: \"MMM d, y\",\n  short: \"MM/dd/yyyy\",\n};\n\nconst timeFormats = {\n  full: \"h:mm:ss a zzzz\",\n  long: \"h:mm:ss a z\",\n  medium: \"h:mm:ss a\",\n  short: \"h:mm a\",\n};\n\nconst dateTimeFormats = {\n  full: \"{{date}} 'at' {{time}}\",\n  long: \"{{date}} 'at' {{time}}\",\n  medium: \"{{date}}, {{time}}\",\n  short: \"{{date}}, {{time}}\",\n};\n\nexport const formatLong = {\n  date: buildFormatLongFn({\n    formats: dateFormats,\n    defaultWidth: \"full\",\n  }),\n\n  time: buildFormatLongFn({\n    formats: timeFormats,\n    defaultWidth: \"full\",\n  }),\n\n  dateTime: buildFormatLongFn({\n    formats: dateTimeFormats,\n    defaultWidth: \"full\",\n  }),\n};\n", "const formatRelativeLocale = {\n  lastWeek: \"'last' eeee 'at' p\",\n  yesterday: \"'yesterday at' p\",\n  today: \"'today at' p\",\n  tomorrow: \"'tomorrow at' p\",\n  nextWeek: \"eeee 'at' p\",\n  other: \"P\",\n};\n\nexport const formatRelative = (token, _date, _baseDate, _options) =>\n  formatRelativeLocale[token];\n", "/**\n * The localize function argument callback which allows to convert raw value to\n * the actual type.\n *\n * @param value - The value to convert\n *\n * @returns The converted value\n */\n\n/**\n * The map of localized values for each width.\n */\n\n/**\n * The index type of the locale unit value. It types conversion of units of\n * values that don't start at 0 (i.e. quarters).\n */\n\n/**\n * Converts the unit value to the tuple of values.\n */\n\n/**\n * The tuple of localized era values. The first element represents BC,\n * the second element represents AD.\n */\n\n/**\n * The tuple of localized quarter values. The first element represents Q1.\n */\n\n/**\n * The tuple of localized day values. The first element represents Sunday.\n */\n\n/**\n * The tuple of localized month values. The first element represents January.\n */\n\nexport function buildLocalizeFn(args) {\n  return (value, options) => {\n    const context = options?.context ? String(options.context) : \"standalone\";\n\n    let valuesArray;\n    if (context === \"formatting\" && args.formattingValues) {\n      const defaultWidth = args.defaultFormattingWidth || args.defaultWidth;\n      const width = options?.width ? String(options.width) : defaultWidth;\n\n      valuesArray =\n        args.formattingValues[width] || args.formattingValues[defaultWidth];\n    } else {\n      const defaultWidth = args.defaultWidth;\n      const width = options?.width ? String(options.width) : args.defaultWidth;\n\n      valuesArray = args.values[width] || args.values[defaultWidth];\n    }\n    const index = args.argumentCallback ? args.argumentCallback(value) : value;\n\n    // @ts-expect-error - For some reason TypeScript just don't want to match it, no matter how hard we try. I challenge you to try to remove it!\n    return valuesArray[index];\n  };\n}\n", "import { buildLocalizeFn } from \"../../_lib/buildLocalizeFn.js\";\n\nconst eraValues = {\n  narrow: [\"B\", \"A\"],\n  abbreviated: [\"BC\", \"AD\"],\n  wide: [\"Before Christ\", \"Anno Domini\"],\n};\n\nconst quarterValues = {\n  narrow: [\"1\", \"2\", \"3\", \"4\"],\n  abbreviated: [\"Q1\", \"Q2\", \"Q3\", \"Q4\"],\n  wide: [\"1st quarter\", \"2nd quarter\", \"3rd quarter\", \"4th quarter\"],\n};\n\n// Note: in English, the names of days of the week and months are capitalized.\n// If you are making a new locale based on this one, check if the same is true for the language you're working on.\n// Generally, formatted dates should look like they are in the middle of a sentence,\n// e.g. in Spanish language the weekdays and months should be in the lowercase.\nconst monthValues = {\n  narrow: [\"J\", \"F\", \"M\", \"A\", \"M\", \"J\", \"J\", \"A\", \"S\", \"O\", \"N\", \"D\"],\n  abbreviated: [\n    \"Jan\",\n    \"Feb\",\n    \"Mar\",\n    \"Apr\",\n    \"May\",\n    \"Jun\",\n    \"Jul\",\n    \"Aug\",\n    \"Sep\",\n    \"Oct\",\n    \"Nov\",\n    \"Dec\",\n  ],\n\n  wide: [\n    \"January\",\n    \"February\",\n    \"March\",\n    \"April\",\n    \"May\",\n    \"June\",\n    \"July\",\n    \"August\",\n    \"September\",\n    \"October\",\n    \"November\",\n    \"December\",\n  ],\n};\n\nconst dayValues = {\n  narrow: [\"S\", \"M\", \"T\", \"W\", \"T\", \"F\", \"S\"],\n  short: [\"Su\", \"Mo\", \"Tu\", \"We\", \"Th\", \"Fr\", \"Sa\"],\n  abbreviated: [\"Sun\", \"Mon\", \"Tue\", \"Wed\", \"Thu\", \"Fri\", \"Sat\"],\n  wide: [\n    \"Sunday\",\n    \"Monday\",\n    \"Tuesday\",\n    \"Wednesday\",\n    \"Thursday\",\n    \"Friday\",\n    \"Saturday\",\n  ],\n};\n\nconst dayPeriodValues = {\n  narrow: {\n    am: \"a\",\n    pm: \"p\",\n    midnight: \"mi\",\n    noon: \"n\",\n    morning: \"morning\",\n    afternoon: \"afternoon\",\n    evening: \"evening\",\n    night: \"night\",\n  },\n  abbreviated: {\n    am: \"AM\",\n    pm: \"PM\",\n    midnight: \"midnight\",\n    noon: \"noon\",\n    morning: \"morning\",\n    afternoon: \"afternoon\",\n    evening: \"evening\",\n    night: \"night\",\n  },\n  wide: {\n    am: \"a.m.\",\n    pm: \"p.m.\",\n    midnight: \"midnight\",\n    noon: \"noon\",\n    morning: \"morning\",\n    afternoon: \"afternoon\",\n    evening: \"evening\",\n    night: \"night\",\n  },\n};\n\nconst formattingDayPeriodValues = {\n  narrow: {\n    am: \"a\",\n    pm: \"p\",\n    midnight: \"mi\",\n    noon: \"n\",\n    morning: \"in the morning\",\n    afternoon: \"in the afternoon\",\n    evening: \"in the evening\",\n    night: \"at night\",\n  },\n  abbreviated: {\n    am: \"AM\",\n    pm: \"PM\",\n    midnight: \"midnight\",\n    noon: \"noon\",\n    morning: \"in the morning\",\n    afternoon: \"in the afternoon\",\n    evening: \"in the evening\",\n    night: \"at night\",\n  },\n  wide: {\n    am: \"a.m.\",\n    pm: \"p.m.\",\n    midnight: \"midnight\",\n    noon: \"noon\",\n    morning: \"in the morning\",\n    afternoon: \"in the afternoon\",\n    evening: \"in the evening\",\n    night: \"at night\",\n  },\n};\n\nconst ordinalNumber = (dirtyNumber, _options) => {\n  const number = Number(dirtyNumber);\n\n  // If ordinal numbers depend on context, for example,\n  // if they are different for different grammatical genders,\n  // use `options.unit`.\n  //\n  // `unit` can be 'year', 'quarter', 'month', 'week', 'date', 'dayOfYear',\n  // 'day', 'hour', 'minute', 'second'.\n\n  const rem100 = number % 100;\n  if (rem100 > 20 || rem100 < 10) {\n    switch (rem100 % 10) {\n      case 1:\n        return number + \"st\";\n      case 2:\n        return number + \"nd\";\n      case 3:\n        return number + \"rd\";\n    }\n  }\n  return number + \"th\";\n};\n\nexport const localize = {\n  ordinalNumber,\n\n  era: buildLocalizeFn({\n    values: eraValues,\n    defaultWidth: \"wide\",\n  }),\n\n  quarter: buildLocalizeFn({\n    values: quarterValues,\n    defaultWidth: \"wide\",\n    argumentCallback: (quarter) => quarter - 1,\n  }),\n\n  month: buildLocalizeFn({\n    values: monthValues,\n    defaultWidth: \"wide\",\n  }),\n\n  day: buildLocalizeFn({\n    values: dayValues,\n    defaultWidth: \"wide\",\n  }),\n\n  dayPeriod: buildLocalizeFn({\n    values: dayPeriodValues,\n    defaultWidth: \"wide\",\n    formattingValues: formattingDayPeriodValues,\n    defaultFormattingWidth: \"wide\",\n  }),\n};\n", "export function buildMatchFn(args) {\n  return (string, options = {}) => {\n    const width = options.width;\n\n    const matchPattern =\n      (width && args.matchPatterns[width]) ||\n      args.matchPatterns[args.defaultMatchWidth];\n    const matchResult = string.match(matchPattern);\n\n    if (!matchResult) {\n      return null;\n    }\n    const matchedString = matchResult[0];\n\n    const parsePatterns =\n      (width && args.parsePatterns[width]) ||\n      args.parsePatterns[args.defaultParseWidth];\n\n    const key = Array.isArray(parsePatterns)\n      ? findIndex(parsePatterns, (pattern) => pattern.test(matchedString))\n      : // [TODO] -- I challenge you to fix the type\n        findKey(parsePatterns, (pattern) => pattern.test(matchedString));\n\n    let value;\n\n    value = args.valueCallback ? args.valueCallback(key) : key;\n    value = options.valueCallback\n      ? // [TODO] -- I challenge you to fix the type\n        options.valueCallback(value)\n      : value;\n\n    const rest = string.slice(matchedString.length);\n\n    return { value, rest };\n  };\n}\n\nfunction findKey(object, predicate) {\n  for (const key in object) {\n    if (\n      Object.prototype.hasOwnProperty.call(object, key) &&\n      predicate(object[key])\n    ) {\n      return key;\n    }\n  }\n  return undefined;\n}\n\nfunction findIndex(array, predicate) {\n  for (let key = 0; key < array.length; key++) {\n    if (predicate(array[key])) {\n      return key;\n    }\n  }\n  return undefined;\n}\n", "export function buildMatchPatternFn(args) {\n  return (string, options = {}) => {\n    const matchResult = string.match(args.matchPattern);\n    if (!matchResult) return null;\n    const matchedString = matchResult[0];\n\n    const parseResult = string.match(args.parsePattern);\n    if (!parseResult) return null;\n    let value = args.valueCallback\n      ? args.valueCallback(parseResult[0])\n      : parseResult[0];\n\n    // [TODO] I challenge you to fix the type\n    value = options.valueCallback ? options.valueCallback(value) : value;\n\n    const rest = string.slice(matchedString.length);\n\n    return { value, rest };\n  };\n}\n", "import { buildMatchFn } from \"../../_lib/buildMatchFn.js\";\nimport { buildMatchPatternFn } from \"../../_lib/buildMatchPatternFn.js\";\n\nconst matchOrdinalNumberPattern = /^(\\d+)(th|st|nd|rd)?/i;\nconst parseOrdinalNumberPattern = /\\d+/i;\n\nconst matchEraPatterns = {\n  narrow: /^(b|a)/i,\n  abbreviated: /^(b\\.?\\s?c\\.?|b\\.?\\s?c\\.?\\s?e\\.?|a\\.?\\s?d\\.?|c\\.?\\s?e\\.?)/i,\n  wide: /^(before christ|before common era|anno domini|common era)/i,\n};\nconst parseEraPatterns = {\n  any: [/^b/i, /^(a|c)/i],\n};\n\nconst matchQuarterPatterns = {\n  narrow: /^[1234]/i,\n  abbreviated: /^q[1234]/i,\n  wide: /^[1234](th|st|nd|rd)? quarter/i,\n};\nconst parseQuarterPatterns = {\n  any: [/1/i, /2/i, /3/i, /4/i],\n};\n\nconst matchMonthPatterns = {\n  narrow: /^[jfmasond]/i,\n  abbreviated: /^(jan|feb|mar|apr|may|jun|jul|aug|sep|oct|nov|dec)/i,\n  wide: /^(january|february|march|april|may|june|july|august|september|october|november|december)/i,\n};\nconst parseMonthPatterns = {\n  narrow: [\n    /^j/i,\n    /^f/i,\n    /^m/i,\n    /^a/i,\n    /^m/i,\n    /^j/i,\n    /^j/i,\n    /^a/i,\n    /^s/i,\n    /^o/i,\n    /^n/i,\n    /^d/i,\n  ],\n\n  any: [\n    /^ja/i,\n    /^f/i,\n    /^mar/i,\n    /^ap/i,\n    /^may/i,\n    /^jun/i,\n    /^jul/i,\n    /^au/i,\n    /^s/i,\n    /^o/i,\n    /^n/i,\n    /^d/i,\n  ],\n};\n\nconst matchDayPatterns = {\n  narrow: /^[smtwf]/i,\n  short: /^(su|mo|tu|we|th|fr|sa)/i,\n  abbreviated: /^(sun|mon|tue|wed|thu|fri|sat)/i,\n  wide: /^(sunday|monday|tuesday|wednesday|thursday|friday|saturday)/i,\n};\nconst parseDayPatterns = {\n  narrow: [/^s/i, /^m/i, /^t/i, /^w/i, /^t/i, /^f/i, /^s/i],\n  any: [/^su/i, /^m/i, /^tu/i, /^w/i, /^th/i, /^f/i, /^sa/i],\n};\n\nconst matchDayPeriodPatterns = {\n  narrow: /^(a|p|mi|n|(in the|at) (morning|afternoon|evening|night))/i,\n  any: /^([ap]\\.?\\s?m\\.?|midnight|noon|(in the|at) (morning|afternoon|evening|night))/i,\n};\nconst parseDayPeriodPatterns = {\n  any: {\n    am: /^a/i,\n    pm: /^p/i,\n    midnight: /^mi/i,\n    noon: /^no/i,\n    morning: /morning/i,\n    afternoon: /afternoon/i,\n    evening: /evening/i,\n    night: /night/i,\n  },\n};\n\nexport const match = {\n  ordinalNumber: buildMatchPatternFn({\n    matchPattern: matchOrdinalNumberPattern,\n    parsePattern: parseOrdinalNumberPattern,\n    valueCallback: (value) => parseInt(value, 10),\n  }),\n\n  era: buildMatchFn({\n    matchPatterns: matchEraPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseEraPatterns,\n    defaultParseWidth: \"any\",\n  }),\n\n  quarter: buildMatchFn({\n    matchPatterns: matchQuarterPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseQuarterPatterns,\n    defaultParseWidth: \"any\",\n    valueCallback: (index) => index + 1,\n  }),\n\n  month: buildMatchFn({\n    matchPatterns: matchMonthPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseMonthPatterns,\n    defaultParseWidth: \"any\",\n  }),\n\n  day: buildMatchFn({\n    matchPatterns: matchDayPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseDayPatterns,\n    defaultParseWidth: \"any\",\n  }),\n\n  dayPeriod: buildMatchFn({\n    matchPatterns: matchDayPeriodPatterns,\n    defaultMatchWidth: \"any\",\n    parsePatterns: parseDayPeriodPatterns,\n    defaultParseWidth: \"any\",\n  }),\n};\n", "import { formatDistance } from \"./en-US/_lib/formatDistance.js\";\nimport { formatLong } from \"./en-US/_lib/formatLong.js\";\nimport { formatRelative } from \"./en-US/_lib/formatRelative.js\";\nimport { localize } from \"./en-US/_lib/localize.js\";\nimport { match } from \"./en-US/_lib/match.js\";\n\n/**\n * @category Locales\n * @summary English locale (United States).\n * @language English\n * @iso-639-2 eng\n * @author Sasha Koss [@kossnocorp](https://github.com/kossnocorp)\n * @author Lesha Koss [@leshakoss](https://github.com/leshakoss)\n */\nexport const enUS = {\n  code: \"en-US\",\n  formatDistance: formatDistance,\n  formatLong: formatLong,\n  formatRelative: formatRelative,\n  localize: localize,\n  match: match,\n  options: {\n    weekStartsOn: 0 /* Sunday */,\n    firstWeekContainsDate: 1,\n  },\n};\n\n// Fallback for modularized imports:\nexport default enUS;\n", "import { differenceInCalendarDays } from \"./differenceInCalendarDays.js\";\nimport { startOfYear } from \"./startOfYear.js\";\nimport { toDate } from \"./toDate.js\";\n\n/**\n * The {@link getDayOfYear} function options.\n */\n\n/**\n * @name getDayOfYear\n * @category Day Helpers\n * @summary Get the day of the year of the given date.\n *\n * @description\n * Get the day of the year of the given date.\n *\n * @param date - The given date\n * @param options - The options\n *\n * @returns The day of year\n *\n * @example\n * // Which day of the year is 2 July 2014?\n * const result = getDayOfYear(new Date(2014, 6, 2))\n * //=> 183\n */\nexport function getDayOfYear(date, options) {\n  const _date = toDate(date, options?.in);\n  const diff = differenceInCalendarDays(_date, startOfYear(_date));\n  const dayOfYear = diff + 1;\n  return dayOfYear;\n}\n\n// Fallback for modularized imports:\nexport default getDayOfYear;\n", "import { millisecondsInWeek } from \"./constants.js\";\nimport { startOfISOWeek } from \"./startOfISOWeek.js\";\nimport { startOfISOWeekYear } from \"./startOfISOWeekYear.js\";\nimport { toDate } from \"./toDate.js\";\n\n/**\n * The {@link getISOWeek} function options.\n */\n\n/**\n * @name getISOWeek\n * @category ISO Week Helpers\n * @summary Get the ISO week of the given date.\n *\n * @description\n * Get the ISO week of the given date.\n *\n * ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date\n *\n * @param date - The given date\n * @param options - The options\n *\n * @returns The ISO week\n *\n * @example\n * // Which week of the ISO-week numbering year is 2 January 2005?\n * const result = getISOWeek(new Date(2005, 0, 2))\n * //=> 53\n */\nexport function getISOWeek(date, options) {\n  const _date = toDate(date, options?.in);\n  const diff = +startOfISOWeek(_date) - +startOfISOWeekYear(_date);\n\n  // Round the number of weeks to the nearest integer because the number of\n  // milliseconds in a week is not constant (e.g. it's different in the week of\n  // the daylight saving time clock shift).\n  return Math.round(diff / millisecondsInWeek) + 1;\n}\n\n// Fallback for modularized imports:\nexport default getISOWeek;\n", "import { getDefaultOptions } from \"./_lib/defaultOptions.js\";\nimport { constructFrom } from \"./constructFrom.js\";\nimport { startOfWeek } from \"./startOfWeek.js\";\nimport { toDate } from \"./toDate.js\";\n\n/**\n * The {@link getWeekYear} function options.\n */\n\n/**\n * @name getWeekYear\n * @category Week-Numbering Year Helpers\n * @summary Get the local week-numbering year of the given date.\n *\n * @description\n * Get the local week-numbering year of the given date.\n * The exact calculation depends on the values of\n * `options.weekStartsOn` (which is the index of the first day of the week)\n * and `options.firstWeekContainsDate` (which is the day of January, which is always in\n * the first week of the week-numbering year)\n *\n * Week numbering: https://en.wikipedia.org/wiki/Week#The_ISO_week_date_system\n *\n * @param date - The given date\n * @param options - An object with options.\n *\n * @returns The local week-numbering year\n *\n * @example\n * // Which week numbering year is 26 December 2004 with the default settings?\n * const result = getWeekYear(new Date(2004, 11, 26))\n * //=> 2005\n *\n * @example\n * // Which week numbering year is 26 December 2004 if week starts on Saturday?\n * const result = getWeekYear(new Date(2004, 11, 26), { weekStartsOn: 6 })\n * //=> 2004\n *\n * @example\n * // Which week numbering year is 26 December 2004 if the first week contains 4 January?\n * const result = getWeekYear(new Date(2004, 11, 26), { firstWeekContainsDate: 4 })\n * //=> 2004\n */\nexport function getWeekYear(date, options) {\n  const _date = toDate(date, options?.in);\n  const year = _date.getFullYear();\n\n  const defaultOptions = getDefaultOptions();\n  const firstWeekContainsDate =\n    options?.firstWeekContainsDate ??\n    options?.locale?.options?.firstWeekContainsDate ??\n    defaultOptions.firstWeekContainsDate ??\n    defaultOptions.locale?.options?.firstWeekContainsDate ??\n    1;\n\n  const firstWeekOfNextYear = constructFrom(options?.in || date, 0);\n  firstWeekOfNextYear.setFullYear(year + 1, 0, firstWeekContainsDate);\n  firstWeekOfNextYear.setHours(0, 0, 0, 0);\n  const startOfNextYear = startOfWeek(firstWeekOfNextYear, options);\n\n  const firstWeekOfThisYear = constructFrom(options?.in || date, 0);\n  firstWeekOfThisYear.setFullYear(year, 0, firstWeekContainsDate);\n  firstWeekOfThisYear.setHours(0, 0, 0, 0);\n  const startOfThisYear = startOfWeek(firstWeekOfThisYear, options);\n\n  if (+_date >= +startOfNextYear) {\n    return year + 1;\n  } else if (+_date >= +startOfThisYear) {\n    return year;\n  } else {\n    return year - 1;\n  }\n}\n\n// Fallback for modularized imports:\nexport default getWeekYear;\n", "import { getDefaultOptions } from \"./_lib/defaultOptions.js\";\nimport { constructFrom } from \"./constructFrom.js\";\nimport { getWeekYear } from \"./getWeekYear.js\";\nimport { startOfWeek } from \"./startOfWeek.js\";\n\n/**\n * The {@link startOfWeekYear} function options.\n */\n\n/**\n * @name startOfWeekYear\n * @category Week-Numbering Year Helpers\n * @summary Return the start of a local week-numbering year for the given date.\n *\n * @description\n * Return the start of a local week-numbering year.\n * The exact calculation depends on the values of\n * `options.weekStartsOn` (which is the index of the first day of the week)\n * and `options.firstWeekContainsDate` (which is the day of January, which is always in\n * the first week of the week-numbering year)\n *\n * Week numbering: https://en.wikipedia.org/wiki/Week#The_ISO_week_date_system\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments. Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n * @typeParam ResultDate - The result `Date` type.\n *\n * @param date - The original date\n * @param options - An object with options\n *\n * @returns The start of a week-numbering year\n *\n * @example\n * // The start of an a week-numbering year for 2 July 2005 with default settings:\n * const result = startOfWeekYear(new Date(2005, 6, 2))\n * //=> Sun Dec 26 2004 00:00:00\n *\n * @example\n * // The start of a week-numbering year for 2 July 2005\n * // if Monday is the first day of week\n * // and 4 January is always in the first week of the year:\n * const result = startOfWeekYear(new Date(2005, 6, 2), {\n *   weekStartsOn: 1,\n *   firstWeekContainsDate: 4\n * })\n * //=> Mon Jan 03 2005 00:00:00\n */\nexport function startOfWeekYear(date, options) {\n  const defaultOptions = getDefaultOptions();\n  const firstWeekContainsDate =\n    options?.firstWeekContainsDate ??\n    options?.locale?.options?.firstWeekContainsDate ??\n    defaultOptions.firstWeekContainsDate ??\n    defaultOptions.locale?.options?.firstWeekContainsDate ??\n    1;\n\n  const year = getWeekYear(date, options);\n  const firstWeek = constructFrom(options?.in || date, 0);\n  firstWeek.setFullYear(year, 0, firstWeekContainsDate);\n  firstWeek.setHours(0, 0, 0, 0);\n  const _date = startOfWeek(firstWeek, options);\n  return _date;\n}\n\n// Fallback for modularized imports:\nexport default startOfWeekYear;\n", "import { millisecondsInWeek } from \"./constants.js\";\nimport { startOfWeek } from \"./startOfWeek.js\";\nimport { startOfWeekYear } from \"./startOfWeekYear.js\";\nimport { toDate } from \"./toDate.js\";\n\n/**\n * The {@link getWeek} function options.\n */\n\n/**\n * @name getWeek\n * @category Week Helpers\n * @summary Get the local week index of the given date.\n *\n * @description\n * Get the local week index of the given date.\n * The exact calculation depends on the values of\n * `options.weekStartsOn` (which is the index of the first day of the week)\n * and `options.firstWeekContainsDate` (which is the day of January, which is always in\n * the first week of the week-numbering year)\n *\n * Week numbering: https://en.wikipedia.org/wiki/Week#The_ISO_week_date_system\n *\n * @param date - The given date\n * @param options - An object with options\n *\n * @returns The week\n *\n * @example\n * // Which week of the local week numbering year is 2 January 2005 with default options?\n * const result = getWeek(new Date(2005, 0, 2))\n * //=> 2\n *\n * @example\n * // Which week of the local week numbering year is 2 January 2005,\n * // if Monday is the first day of the week,\n * // and the first week of the year always contains 4 January?\n * const result = getWeek(new Date(2005, 0, 2), {\n *   weekStartsOn: 1,\n *   firstWeekContainsDate: 4\n * })\n * //=> 53\n */\nexport function getWeek(date, options) {\n  const _date = toDate(date, options?.in);\n  const diff = +startOfWeek(_date, options) - +startOfWeekYear(_date, options);\n\n  // Round the number of weeks to the nearest integer because the number of\n  // milliseconds in a week is not constant (e.g. it's different in the week of\n  // the daylight saving time clock shift).\n  return Math.round(diff / millisecondsInWeek) + 1;\n}\n\n// Fallback for modularized imports:\nexport default getWeek;\n", "export function addLeadingZeros(number, targetLength) {\n  const sign = number < 0 ? \"-\" : \"\";\n  const output = Math.abs(number).toString().padStart(targetLength, \"0\");\n  return sign + output;\n}\n", "import { addLeadingZeros } from \"../addLeadingZeros.js\";\n\n/*\n * |     | Unit                           |     | Unit                           |\n * |-----|--------------------------------|-----|--------------------------------|\n * |  a  | AM, PM                         |  A* |                                |\n * |  d  | Day of month                   |  D  |                                |\n * |  h  | Hour [1-12]                    |  H  | Hour [0-23]                    |\n * |  m  | Minute                         |  M  | Month                          |\n * |  s  | Second                         |  S  | Fraction of second             |\n * |  y  | Year (abs)                     |  Y  |                                |\n *\n * Letters marked by * are not implemented but reserved by Unicode standard.\n */\n\nexport const lightFormatters = {\n  // Year\n  y(date, token) {\n    // From http://www.unicode.org/reports/tr35/tr35-31/tr35-dates.html#Date_Format_tokens\n    // | Year     |     y | yy |   yyy |  yyyy | yyyyy |\n    // |----------|-------|----|-------|-------|-------|\n    // | AD 1     |     1 | 01 |   001 |  0001 | 00001 |\n    // | AD 12    |    12 | 12 |   012 |  0012 | 00012 |\n    // | AD 123   |   123 | 23 |   123 |  0123 | 00123 |\n    // | AD 1234  |  1234 | 34 |  1234 |  1234 | 01234 |\n    // | AD 12345 | 12345 | 45 | 12345 | 12345 | 12345 |\n\n    const signedYear = date.getFullYear();\n    // Returns 1 for 1 BC (which is year 0 in JavaScript)\n    const year = signedYear > 0 ? signedYear : 1 - signedYear;\n    return addLeadingZeros(token === \"yy\" ? year % 100 : year, token.length);\n  },\n\n  // Month\n  M(date, token) {\n    const month = date.getMonth();\n    return token === \"M\" ? String(month + 1) : addLeadingZeros(month + 1, 2);\n  },\n\n  // Day of the month\n  d(date, token) {\n    return addLeadingZeros(date.getDate(), token.length);\n  },\n\n  // AM or PM\n  a(date, token) {\n    const dayPeriodEnumValue = date.getHours() / 12 >= 1 ? \"pm\" : \"am\";\n\n    switch (token) {\n      case \"a\":\n      case \"aa\":\n        return dayPeriodEnumValue.toUpperCase();\n      case \"aaa\":\n        return dayPeriodEnumValue;\n      case \"aaaaa\":\n        return dayPeriodEnumValue[0];\n      case \"aaaa\":\n      default:\n        return dayPeriodEnumValue === \"am\" ? \"a.m.\" : \"p.m.\";\n    }\n  },\n\n  // Hour [1-12]\n  h(date, token) {\n    return addLeadingZeros(date.getHours() % 12 || 12, token.length);\n  },\n\n  // Hour [0-23]\n  H(date, token) {\n    return addLeadingZeros(date.getHours(), token.length);\n  },\n\n  // Minute\n  m(date, token) {\n    return addLeadingZeros(date.getMinutes(), token.length);\n  },\n\n  // Second\n  s(date, token) {\n    return addLeadingZeros(date.getSeconds(), token.length);\n  },\n\n  // Fraction of second\n  S(date, token) {\n    const numberOfDigits = token.length;\n    const milliseconds = date.getMilliseconds();\n    const fractionalSeconds = Math.trunc(\n      milliseconds * Math.pow(10, numberOfDigits - 3),\n    );\n    return addLeadingZeros(fractionalSeconds, token.length);\n  },\n};\n", "import { getDayOfYear } from \"../../getDayOfYear.js\";\nimport { getISOWeek } from \"../../getISOWeek.js\";\nimport { getISOWeekYear } from \"../../getISOWeekYear.js\";\nimport { getWeek } from \"../../getWeek.js\";\nimport { getWeekYear } from \"../../getWeekYear.js\";\n\nimport { addLeadingZeros } from \"../addLeadingZeros.js\";\nimport { lightFormatters } from \"./lightFormatters.js\";\n\nconst dayPeriodEnum = {\n  am: \"am\",\n  pm: \"pm\",\n  midnight: \"midnight\",\n  noon: \"noon\",\n  morning: \"morning\",\n  afternoon: \"afternoon\",\n  evening: \"evening\",\n  night: \"night\",\n};\n\n/*\n * |     | Unit                           |     | Unit                           |\n * |-----|--------------------------------|-----|--------------------------------|\n * |  a  | AM, PM                         |  A* | Milliseconds in day            |\n * |  b  | AM, PM, noon, midnight         |  B  | Flexible day period            |\n * |  c  | Stand-alone local day of week  |  C* | Localized hour w/ day period   |\n * |  d  | Day of month                   |  D  | Day of year                    |\n * |  e  | Local day of week              |  E  | Day of week                    |\n * |  f  |                                |  F* | Day of week in month           |\n * |  g* | Modified Julian day            |  G  | Era                            |\n * |  h  | Hour [1-12]                    |  H  | Hour [0-23]                    |\n * |  i! | ISO day of week                |  I! | ISO week of year               |\n * |  j* | Localized hour w/ day period   |  J* | Localized hour w/o day period  |\n * |  k  | Hour [1-24]                    |  K  | Hour [0-11]                    |\n * |  l* | (deprecated)                   |  L  | Stand-alone month              |\n * |  m  | Minute                         |  M  | Month                          |\n * |  n  |                                |  N  |                                |\n * |  o! | Ordinal number modifier        |  O  | Timezone (GMT)                 |\n * |  p! | Long localized time            |  P! | Long localized date            |\n * |  q  | Stand-alone quarter            |  Q  | Quarter                        |\n * |  r* | Related Gregorian year         |  R! | ISO week-numbering year        |\n * |  s  | Second                         |  S  | Fraction of second             |\n * |  t! | Seconds timestamp              |  T! | Milliseconds timestamp         |\n * |  u  | Extended year                  |  U* | Cyclic year                    |\n * |  v* | Timezone (generic non-locat.)  |  V* | Timezone (location)            |\n * |  w  | Local week of year             |  W* | Week of month                  |\n * |  x  | Timezone (ISO-8601 w/o Z)      |  X  | Timezone (ISO-8601)            |\n * |  y  | Year (abs)                     |  Y  | Local week-numbering year      |\n * |  z  | Timezone (specific non-locat.) |  Z* | Timezone (aliases)             |\n *\n * Letters marked by * are not implemented but reserved by Unicode standard.\n *\n * Letters marked by ! are non-standard, but implemented by date-fns:\n * - `o` modifies the previous token to turn it into an ordinal (see `format` docs)\n * - `i` is ISO day of week. For `i` and `ii` is returns numeric ISO week days,\n *   i.e. 7 for Sunday, 1 for Monday, etc.\n * - `I` is ISO week of year, as opposed to `w` which is local week of year.\n * - `R` is ISO week-numbering year, as opposed to `Y` which is local week-numbering year.\n *   `R` is supposed to be used in conjunction with `I` and `i`\n *   for universal ISO week-numbering date, whereas\n *   `Y` is supposed to be used in conjunction with `w` and `e`\n *   for week-numbering date specific to the locale.\n * - `P` is long localized date format\n * - `p` is long localized time format\n */\n\nexport const formatters = {\n  // Era\n  G: function (date, token, localize) {\n    const era = date.getFullYear() > 0 ? 1 : 0;\n    switch (token) {\n      // AD, BC\n      case \"G\":\n      case \"GG\":\n      case \"GGG\":\n        return localize.era(era, { width: \"abbreviated\" });\n      // A, B\n      case \"GGGGG\":\n        return localize.era(era, { width: \"narrow\" });\n      // Anno Domini, Before Christ\n      case \"GGGG\":\n      default:\n        return localize.era(era, { width: \"wide\" });\n    }\n  },\n\n  // Year\n  y: function (date, token, localize) {\n    // Ordinal number\n    if (token === \"yo\") {\n      const signedYear = date.getFullYear();\n      // Returns 1 for 1 BC (which is year 0 in JavaScript)\n      const year = signedYear > 0 ? signedYear : 1 - signedYear;\n      return localize.ordinalNumber(year, { unit: \"year\" });\n    }\n\n    return lightFormatters.y(date, token);\n  },\n\n  // Local week-numbering year\n  Y: function (date, token, localize, options) {\n    const signedWeekYear = getWeekYear(date, options);\n    // Returns 1 for 1 BC (which is year 0 in JavaScript)\n    const weekYear = signedWeekYear > 0 ? signedWeekYear : 1 - signedWeekYear;\n\n    // Two digit year\n    if (token === \"YY\") {\n      const twoDigitYear = weekYear % 100;\n      return addLeadingZeros(twoDigitYear, 2);\n    }\n\n    // Ordinal number\n    if (token === \"Yo\") {\n      return localize.ordinalNumber(weekYear, { unit: \"year\" });\n    }\n\n    // Padding\n    return addLeadingZeros(weekYear, token.length);\n  },\n\n  // ISO week-numbering year\n  R: function (date, token) {\n    const isoWeekYear = getISOWeekYear(date);\n\n    // Padding\n    return addLeadingZeros(isoWeekYear, token.length);\n  },\n\n  // Extended year. This is a single number designating the year of this calendar system.\n  // The main difference between `y` and `u` localizers are B.C. years:\n  // | Year | `y` | `u` |\n  // |------|-----|-----|\n  // | AC 1 |   1 |   1 |\n  // | BC 1 |   1 |   0 |\n  // | BC 2 |   2 |  -1 |\n  // Also `yy` always returns the last two digits of a year,\n  // while `uu` pads single digit years to 2 characters and returns other years unchanged.\n  u: function (date, token) {\n    const year = date.getFullYear();\n    return addLeadingZeros(year, token.length);\n  },\n\n  // Quarter\n  Q: function (date, token, localize) {\n    const quarter = Math.ceil((date.getMonth() + 1) / 3);\n    switch (token) {\n      // 1, 2, 3, 4\n      case \"Q\":\n        return String(quarter);\n      // 01, 02, 03, 04\n      case \"QQ\":\n        return addLeadingZeros(quarter, 2);\n      // 1st, 2nd, 3rd, 4th\n      case \"Qo\":\n        return localize.ordinalNumber(quarter, { unit: \"quarter\" });\n      // Q1, Q2, Q3, Q4\n      case \"QQQ\":\n        return localize.quarter(quarter, {\n          width: \"abbreviated\",\n          context: \"formatting\",\n        });\n      // 1, 2, 3, 4 (narrow quarter; could be not numerical)\n      case \"QQQQQ\":\n        return localize.quarter(quarter, {\n          width: \"narrow\",\n          context: \"formatting\",\n        });\n      // 1st quarter, 2nd quarter, ...\n      case \"QQQQ\":\n      default:\n        return localize.quarter(quarter, {\n          width: \"wide\",\n          context: \"formatting\",\n        });\n    }\n  },\n\n  // Stand-alone quarter\n  q: function (date, token, localize) {\n    const quarter = Math.ceil((date.getMonth() + 1) / 3);\n    switch (token) {\n      // 1, 2, 3, 4\n      case \"q\":\n        return String(quarter);\n      // 01, 02, 03, 04\n      case \"qq\":\n        return addLeadingZeros(quarter, 2);\n      // 1st, 2nd, 3rd, 4th\n      case \"qo\":\n        return localize.ordinalNumber(quarter, { unit: \"quarter\" });\n      // Q1, Q2, Q3, Q4\n      case \"qqq\":\n        return localize.quarter(quarter, {\n          width: \"abbreviated\",\n          context: \"standalone\",\n        });\n      // 1, 2, 3, 4 (narrow quarter; could be not numerical)\n      case \"qqqqq\":\n        return localize.quarter(quarter, {\n          width: \"narrow\",\n          context: \"standalone\",\n        });\n      // 1st quarter, 2nd quarter, ...\n      case \"qqqq\":\n      default:\n        return localize.quarter(quarter, {\n          width: \"wide\",\n          context: \"standalone\",\n        });\n    }\n  },\n\n  // Month\n  M: function (date, token, localize) {\n    const month = date.getMonth();\n    switch (token) {\n      case \"M\":\n      case \"MM\":\n        return lightFormatters.M(date, token);\n      // 1st, 2nd, ..., 12th\n      case \"Mo\":\n        return localize.ordinalNumber(month + 1, { unit: \"month\" });\n      // Jan, Feb, ..., Dec\n      case \"MMM\":\n        return localize.month(month, {\n          width: \"abbreviated\",\n          context: \"formatting\",\n        });\n      // J, F, ..., D\n      case \"MMMMM\":\n        return localize.month(month, {\n          width: \"narrow\",\n          context: \"formatting\",\n        });\n      // January, February, ..., December\n      case \"MMMM\":\n      default:\n        return localize.month(month, { width: \"wide\", context: \"formatting\" });\n    }\n  },\n\n  // Stand-alone month\n  L: function (date, token, localize) {\n    const month = date.getMonth();\n    switch (token) {\n      // 1, 2, ..., 12\n      case \"L\":\n        return String(month + 1);\n      // 01, 02, ..., 12\n      case \"LL\":\n        return addLeadingZeros(month + 1, 2);\n      // 1st, 2nd, ..., 12th\n      case \"Lo\":\n        return localize.ordinalNumber(month + 1, { unit: \"month\" });\n      // Jan, Feb, ..., Dec\n      case \"LLL\":\n        return localize.month(month, {\n          width: \"abbreviated\",\n          context: \"standalone\",\n        });\n      // J, F, ..., D\n      case \"LLLLL\":\n        return localize.month(month, {\n          width: \"narrow\",\n          context: \"standalone\",\n        });\n      // January, February, ..., December\n      case \"LLLL\":\n      default:\n        return localize.month(month, { width: \"wide\", context: \"standalone\" });\n    }\n  },\n\n  // Local week of year\n  w: function (date, token, localize, options) {\n    const week = getWeek(date, options);\n\n    if (token === \"wo\") {\n      return localize.ordinalNumber(week, { unit: \"week\" });\n    }\n\n    return addLeadingZeros(week, token.length);\n  },\n\n  // ISO week of year\n  I: function (date, token, localize) {\n    const isoWeek = getISOWeek(date);\n\n    if (token === \"Io\") {\n      return localize.ordinalNumber(isoWeek, { unit: \"week\" });\n    }\n\n    return addLeadingZeros(isoWeek, token.length);\n  },\n\n  // Day of the month\n  d: function (date, token, localize) {\n    if (token === \"do\") {\n      return localize.ordinalNumber(date.getDate(), { unit: \"date\" });\n    }\n\n    return lightFormatters.d(date, token);\n  },\n\n  // Day of year\n  D: function (date, token, localize) {\n    const dayOfYear = getDayOfYear(date);\n\n    if (token === \"Do\") {\n      return localize.ordinalNumber(dayOfYear, { unit: \"dayOfYear\" });\n    }\n\n    return addLeadingZeros(dayOfYear, token.length);\n  },\n\n  // Day of week\n  E: function (date, token, localize) {\n    const dayOfWeek = date.getDay();\n    switch (token) {\n      // Tue\n      case \"E\":\n      case \"EE\":\n      case \"EEE\":\n        return localize.day(dayOfWeek, {\n          width: \"abbreviated\",\n          context: \"formatting\",\n        });\n      // T\n      case \"EEEEE\":\n        return localize.day(dayOfWeek, {\n          width: \"narrow\",\n          context: \"formatting\",\n        });\n      // Tu\n      case \"EEEEEE\":\n        return localize.day(dayOfWeek, {\n          width: \"short\",\n          context: \"formatting\",\n        });\n      // Tuesday\n      case \"EEEE\":\n      default:\n        return localize.day(dayOfWeek, {\n          width: \"wide\",\n          context: \"formatting\",\n        });\n    }\n  },\n\n  // Local day of week\n  e: function (date, token, localize, options) {\n    const dayOfWeek = date.getDay();\n    const localDayOfWeek = (dayOfWeek - options.weekStartsOn + 8) % 7 || 7;\n    switch (token) {\n      // Numerical value (Nth day of week with current locale or weekStartsOn)\n      case \"e\":\n        return String(localDayOfWeek);\n      // Padded numerical value\n      case \"ee\":\n        return addLeadingZeros(localDayOfWeek, 2);\n      // 1st, 2nd, ..., 7th\n      case \"eo\":\n        return localize.ordinalNumber(localDayOfWeek, { unit: \"day\" });\n      case \"eee\":\n        return localize.day(dayOfWeek, {\n          width: \"abbreviated\",\n          context: \"formatting\",\n        });\n      // T\n      case \"eeeee\":\n        return localize.day(dayOfWeek, {\n          width: \"narrow\",\n          context: \"formatting\",\n        });\n      // Tu\n      case \"eeeeee\":\n        return localize.day(dayOfWeek, {\n          width: \"short\",\n          context: \"formatting\",\n        });\n      // Tuesday\n      case \"eeee\":\n      default:\n        return localize.day(dayOfWeek, {\n          width: \"wide\",\n          context: \"formatting\",\n        });\n    }\n  },\n\n  // Stand-alone local day of week\n  c: function (date, token, localize, options) {\n    const dayOfWeek = date.getDay();\n    const localDayOfWeek = (dayOfWeek - options.weekStartsOn + 8) % 7 || 7;\n    switch (token) {\n      // Numerical value (same as in `e`)\n      case \"c\":\n        return String(localDayOfWeek);\n      // Padded numerical value\n      case \"cc\":\n        return addLeadingZeros(localDayOfWeek, token.length);\n      // 1st, 2nd, ..., 7th\n      case \"co\":\n        return localize.ordinalNumber(localDayOfWeek, { unit: \"day\" });\n      case \"ccc\":\n        return localize.day(dayOfWeek, {\n          width: \"abbreviated\",\n          context: \"standalone\",\n        });\n      // T\n      case \"ccccc\":\n        return localize.day(dayOfWeek, {\n          width: \"narrow\",\n          context: \"standalone\",\n        });\n      // Tu\n      case \"cccccc\":\n        return localize.day(dayOfWeek, {\n          width: \"short\",\n          context: \"standalone\",\n        });\n      // Tuesday\n      case \"cccc\":\n      default:\n        return localize.day(dayOfWeek, {\n          width: \"wide\",\n          context: \"standalone\",\n        });\n    }\n  },\n\n  // ISO day of week\n  i: function (date, token, localize) {\n    const dayOfWeek = date.getDay();\n    const isoDayOfWeek = dayOfWeek === 0 ? 7 : dayOfWeek;\n    switch (token) {\n      // 2\n      case \"i\":\n        return String(isoDayOfWeek);\n      // 02\n      case \"ii\":\n        return addLeadingZeros(isoDayOfWeek, token.length);\n      // 2nd\n      case \"io\":\n        return localize.ordinalNumber(isoDayOfWeek, { unit: \"day\" });\n      // Tue\n      case \"iii\":\n        return localize.day(dayOfWeek, {\n          width: \"abbreviated\",\n          context: \"formatting\",\n        });\n      // T\n      case \"iiiii\":\n        return localize.day(dayOfWeek, {\n          width: \"narrow\",\n          context: \"formatting\",\n        });\n      // Tu\n      case \"iiiiii\":\n        return localize.day(dayOfWeek, {\n          width: \"short\",\n          context: \"formatting\",\n        });\n      // Tuesday\n      case \"iiii\":\n      default:\n        return localize.day(dayOfWeek, {\n          width: \"wide\",\n          context: \"formatting\",\n        });\n    }\n  },\n\n  // AM or PM\n  a: function (date, token, localize) {\n    const hours = date.getHours();\n    const dayPeriodEnumValue = hours / 12 >= 1 ? \"pm\" : \"am\";\n\n    switch (token) {\n      case \"a\":\n      case \"aa\":\n        return localize.dayPeriod(dayPeriodEnumValue, {\n          width: \"abbreviated\",\n          context: \"formatting\",\n        });\n      case \"aaa\":\n        return localize\n          .dayPeriod(dayPeriodEnumValue, {\n            width: \"abbreviated\",\n            context: \"formatting\",\n          })\n          .toLowerCase();\n      case \"aaaaa\":\n        return localize.dayPeriod(dayPeriodEnumValue, {\n          width: \"narrow\",\n          context: \"formatting\",\n        });\n      case \"aaaa\":\n      default:\n        return localize.dayPeriod(dayPeriodEnumValue, {\n          width: \"wide\",\n          context: \"formatting\",\n        });\n    }\n  },\n\n  // AM, PM, midnight, noon\n  b: function (date, token, localize) {\n    const hours = date.getHours();\n    let dayPeriodEnumValue;\n    if (hours === 12) {\n      dayPeriodEnumValue = dayPeriodEnum.noon;\n    } else if (hours === 0) {\n      dayPeriodEnumValue = dayPeriodEnum.midnight;\n    } else {\n      dayPeriodEnumValue = hours / 12 >= 1 ? \"pm\" : \"am\";\n    }\n\n    switch (token) {\n      case \"b\":\n      case \"bb\":\n        return localize.dayPeriod(dayPeriodEnumValue, {\n          width: \"abbreviated\",\n          context: \"formatting\",\n        });\n      case \"bbb\":\n        return localize\n          .dayPeriod(dayPeriodEnumValue, {\n            width: \"abbreviated\",\n            context: \"formatting\",\n          })\n          .toLowerCase();\n      case \"bbbbb\":\n        return localize.dayPeriod(dayPeriodEnumValue, {\n          width: \"narrow\",\n          context: \"formatting\",\n        });\n      case \"bbbb\":\n      default:\n        return localize.dayPeriod(dayPeriodEnumValue, {\n          width: \"wide\",\n          context: \"formatting\",\n        });\n    }\n  },\n\n  // in the morning, in the afternoon, in the evening, at night\n  B: function (date, token, localize) {\n    const hours = date.getHours();\n    let dayPeriodEnumValue;\n    if (hours >= 17) {\n      dayPeriodEnumValue = dayPeriodEnum.evening;\n    } else if (hours >= 12) {\n      dayPeriodEnumValue = dayPeriodEnum.afternoon;\n    } else if (hours >= 4) {\n      dayPeriodEnumValue = dayPeriodEnum.morning;\n    } else {\n      dayPeriodEnumValue = dayPeriodEnum.night;\n    }\n\n    switch (token) {\n      case \"B\":\n      case \"BB\":\n      case \"BBB\":\n        return localize.dayPeriod(dayPeriodEnumValue, {\n          width: \"abbreviated\",\n          context: \"formatting\",\n        });\n      case \"BBBBB\":\n        return localize.dayPeriod(dayPeriodEnumValue, {\n          width: \"narrow\",\n          context: \"formatting\",\n        });\n      case \"BBBB\":\n      default:\n        return localize.dayPeriod(dayPeriodEnumValue, {\n          width: \"wide\",\n          context: \"formatting\",\n        });\n    }\n  },\n\n  // Hour [1-12]\n  h: function (date, token, localize) {\n    if (token === \"ho\") {\n      let hours = date.getHours() % 12;\n      if (hours === 0) hours = 12;\n      return localize.ordinalNumber(hours, { unit: \"hour\" });\n    }\n\n    return lightFormatters.h(date, token);\n  },\n\n  // Hour [0-23]\n  H: function (date, token, localize) {\n    if (token === \"Ho\") {\n      return localize.ordinalNumber(date.getHours(), { unit: \"hour\" });\n    }\n\n    return lightFormatters.H(date, token);\n  },\n\n  // Hour [0-11]\n  K: function (date, token, localize) {\n    const hours = date.getHours() % 12;\n\n    if (token === \"Ko\") {\n      return localize.ordinalNumber(hours, { unit: \"hour\" });\n    }\n\n    return addLeadingZeros(hours, token.length);\n  },\n\n  // Hour [1-24]\n  k: function (date, token, localize) {\n    let hours = date.getHours();\n    if (hours === 0) hours = 24;\n\n    if (token === \"ko\") {\n      return localize.ordinalNumber(hours, { unit: \"hour\" });\n    }\n\n    return addLeadingZeros(hours, token.length);\n  },\n\n  // Minute\n  m: function (date, token, localize) {\n    if (token === \"mo\") {\n      return localize.ordinalNumber(date.getMinutes(), { unit: \"minute\" });\n    }\n\n    return lightFormatters.m(date, token);\n  },\n\n  // Second\n  s: function (date, token, localize) {\n    if (token === \"so\") {\n      return localize.ordinalNumber(date.getSeconds(), { unit: \"second\" });\n    }\n\n    return lightFormatters.s(date, token);\n  },\n\n  // Fraction of second\n  S: function (date, token) {\n    return lightFormatters.S(date, token);\n  },\n\n  // Timezone (ISO-8601. If offset is 0, output is always `'Z'`)\n  X: function (date, token, _localize) {\n    const timezoneOffset = date.getTimezoneOffset();\n\n    if (timezoneOffset === 0) {\n      return \"Z\";\n    }\n\n    switch (token) {\n      // Hours and optional minutes\n      case \"X\":\n        return formatTimezoneWithOptionalMinutes(timezoneOffset);\n\n      // Hours, minutes and optional seconds without `:` delimiter\n      // Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets\n      // so this token always has the same output as `XX`\n      case \"XXXX\":\n      case \"XX\": // Hours and minutes without `:` delimiter\n        return formatTimezone(timezoneOffset);\n\n      // Hours, minutes and optional seconds with `:` delimiter\n      // Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets\n      // so this token always has the same output as `XXX`\n      case \"XXXXX\":\n      case \"XXX\": // Hours and minutes with `:` delimiter\n      default:\n        return formatTimezone(timezoneOffset, \":\");\n    }\n  },\n\n  // Timezone (ISO-8601. If offset is 0, output is `'+00:00'` or equivalent)\n  x: function (date, token, _localize) {\n    const timezoneOffset = date.getTimezoneOffset();\n\n    switch (token) {\n      // Hours and optional minutes\n      case \"x\":\n        return formatTimezoneWithOptionalMinutes(timezoneOffset);\n\n      // Hours, minutes and optional seconds without `:` delimiter\n      // Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets\n      // so this token always has the same output as `xx`\n      case \"xxxx\":\n      case \"xx\": // Hours and minutes without `:` delimiter\n        return formatTimezone(timezoneOffset);\n\n      // Hours, minutes and optional seconds with `:` delimiter\n      // Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets\n      // so this token always has the same output as `xxx`\n      case \"xxxxx\":\n      case \"xxx\": // Hours and minutes with `:` delimiter\n      default:\n        return formatTimezone(timezoneOffset, \":\");\n    }\n  },\n\n  // Timezone (GMT)\n  O: function (date, token, _localize) {\n    const timezoneOffset = date.getTimezoneOffset();\n\n    switch (token) {\n      // Short\n      case \"O\":\n      case \"OO\":\n      case \"OOO\":\n        return \"GMT\" + formatTimezoneShort(timezoneOffset, \":\");\n      // Long\n      case \"OOOO\":\n      default:\n        return \"GMT\" + formatTimezone(timezoneOffset, \":\");\n    }\n  },\n\n  // Timezone (specific non-location)\n  z: function (date, token, _localize) {\n    const timezoneOffset = date.getTimezoneOffset();\n\n    switch (token) {\n      // Short\n      case \"z\":\n      case \"zz\":\n      case \"zzz\":\n        return \"GMT\" + formatTimezoneShort(timezoneOffset, \":\");\n      // Long\n      case \"zzzz\":\n      default:\n        return \"GMT\" + formatTimezone(timezoneOffset, \":\");\n    }\n  },\n\n  // Seconds timestamp\n  t: function (date, token, _localize) {\n    const timestamp = Math.trunc(+date / 1000);\n    return addLeadingZeros(timestamp, token.length);\n  },\n\n  // Milliseconds timestamp\n  T: function (date, token, _localize) {\n    return addLeadingZeros(+date, token.length);\n  },\n};\n\nfunction formatTimezoneShort(offset, delimiter = \"\") {\n  const sign = offset > 0 ? \"-\" : \"+\";\n  const absOffset = Math.abs(offset);\n  const hours = Math.trunc(absOffset / 60);\n  const minutes = absOffset % 60;\n  if (minutes === 0) {\n    return sign + String(hours);\n  }\n  return sign + String(hours) + delimiter + addLeadingZeros(minutes, 2);\n}\n\nfunction formatTimezoneWithOptionalMinutes(offset, delimiter) {\n  if (offset % 60 === 0) {\n    const sign = offset > 0 ? \"-\" : \"+\";\n    return sign + addLeadingZeros(Math.abs(offset) / 60, 2);\n  }\n  return formatTimezone(offset, delimiter);\n}\n\nfunction formatTimezone(offset, delimiter = \"\") {\n  const sign = offset > 0 ? \"-\" : \"+\";\n  const absOffset = Math.abs(offset);\n  const hours = addLeadingZeros(Math.trunc(absOffset / 60), 2);\n  const minutes = addLeadingZeros(absOffset % 60, 2);\n  return sign + hours + delimiter + minutes;\n}\n", "const dateLongFormatter = (pattern, formatLong) => {\n  switch (pattern) {\n    case \"P\":\n      return formatLong.date({ width: \"short\" });\n    case \"PP\":\n      return formatLong.date({ width: \"medium\" });\n    case \"PPP\":\n      return formatLong.date({ width: \"long\" });\n    case \"PPPP\":\n    default:\n      return formatLong.date({ width: \"full\" });\n  }\n};\n\nconst timeLongFormatter = (pattern, formatLong) => {\n  switch (pattern) {\n    case \"p\":\n      return formatLong.time({ width: \"short\" });\n    case \"pp\":\n      return formatLong.time({ width: \"medium\" });\n    case \"ppp\":\n      return formatLong.time({ width: \"long\" });\n    case \"pppp\":\n    default:\n      return formatLong.time({ width: \"full\" });\n  }\n};\n\nconst dateTimeLongFormatter = (pattern, formatLong) => {\n  const matchResult = pattern.match(/(P+)(p+)?/) || [];\n  const datePattern = matchResult[1];\n  const timePattern = matchResult[2];\n\n  if (!timePattern) {\n    return dateLongFormatter(pattern, formatLong);\n  }\n\n  let dateTimeFormat;\n\n  switch (datePattern) {\n    case \"P\":\n      dateTimeFormat = formatLong.dateTime({ width: \"short\" });\n      break;\n    case \"PP\":\n      dateTimeFormat = formatLong.dateTime({ width: \"medium\" });\n      break;\n    case \"PPP\":\n      dateTimeFormat = formatLong.dateTime({ width: \"long\" });\n      break;\n    case \"PPPP\":\n    default:\n      dateTimeFormat = formatLong.dateTime({ width: \"full\" });\n      break;\n  }\n\n  return dateTimeFormat\n    .replace(\"{{date}}\", dateLongFormatter(datePattern, formatLong))\n    .replace(\"{{time}}\", timeLongFormatter(timePattern, formatLong));\n};\n\nexport const longFormatters = {\n  p: timeLongFormatter,\n  P: dateTimeLongFormatter,\n};\n", "const dayOfYearTokenRE = /^D+$/;\nconst weekYearTokenRE = /^Y+$/;\n\nconst throwTokens = [\"D\", \"DD\", \"YY\", \"YYYY\"];\n\nexport function isProtectedDayOfYearToken(token) {\n  return dayOfYearTokenRE.test(token);\n}\n\nexport function isProtectedWeekYearToken(token) {\n  return weekYearTokenRE.test(token);\n}\n\nexport function warnOrThrowProtectedError(token, format, input) {\n  const _message = message(token, format, input);\n  console.warn(_message);\n  if (throwTokens.includes(token)) throw new RangeError(_message);\n}\n\nfunction message(token, format, input) {\n  const subject = token[0] === \"Y\" ? \"years\" : \"days of the month\";\n  return `Use \\`${token.toLowerCase()}\\` instead of \\`${token}\\` (in \\`${format}\\`) for formatting ${subject} to the input \\`${input}\\`; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md`;\n}\n", "import { defaultLocale } from \"./_lib/defaultLocale.js\";\nimport { getDefaultOptions } from \"./_lib/defaultOptions.js\";\nimport { formatters } from \"./_lib/format/formatters.js\";\nimport { longFormatters } from \"./_lib/format/longFormatters.js\";\nimport {\n  isProtectedDayOfYearToken,\n  isProtectedWeekYearToken,\n  warnOrThrowProtectedError,\n} from \"./_lib/protectedTokens.js\";\nimport { isValid } from \"./isValid.js\";\nimport { toDate } from \"./toDate.js\";\n\n// Rexports of internal for libraries to use.\n// See: https://github.com/date-fns/date-fns/issues/3638#issuecomment-1877082874\nexport { formatters, longFormatters };\n\n// This RegExp consists of three parts separated by `|`:\n// - [yYQqMLwIdDecihHKkms]o matches any available ordinal number token\n//   (one of the certain letters followed by `o`)\n// - (\\w)\\1* matches any sequences of the same letter\n// - '' matches two quote characters in a row\n// - '(''|[^'])+('|$) matches anything surrounded by two quote characters ('),\n//   except a single quote symbol, which ends the sequence.\n//   Two quote characters do not end the sequence.\n//   If there is no matching single quote\n//   then the sequence will continue until the end of the string.\n// - . matches any single character unmatched by previous parts of the RegExps\nconst formattingTokensRegExp =\n  /[yYQqMLwIdDecihHKkms]o|(\\w)\\1*|''|'(''|[^'])+('|$)|./g;\n\n// This RegExp catches symbols escaped by quotes, and also\n// sequences of symbols P, p, and the combinations like `PPPPPPPppppp`\nconst longFormattingTokensRegExp = /P+p+|P+|p+|''|'(''|[^'])+('|$)|./g;\n\nconst escapedStringRegExp = /^'([^]*?)'?$/;\nconst doubleQuoteRegExp = /''/g;\nconst unescapedLatinCharacterRegExp = /[a-zA-Z]/;\n\nexport { format as formatDate };\n\n/**\n * The {@link format} function options.\n */\n\n/**\n * @name format\n * @alias formatDate\n * @category Common Helpers\n * @summary Format the date.\n *\n * @description\n * Return the formatted date string in the given format. The result may vary by locale.\n *\n * > \u26A0\uFE0F Please note that the `format` tokens differ from Moment.js and other libraries.\n * > See: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n *\n * The characters wrapped between two single quotes characters (') are escaped.\n * Two single quotes in a row, whether inside or outside a quoted sequence, represent a 'real' single quote.\n * (see the last example)\n *\n * Format of the string is based on Unicode Technical Standard #35:\n * https://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n * with a few additions (see note 7 below the table).\n *\n * Accepted patterns:\n * | Unit                            | Pattern | Result examples                   | Notes |\n * |---------------------------------|---------|-----------------------------------|-------|\n * | Era                             | G..GGG  | AD, BC                            |       |\n * |                                 | GGGG    | Anno Domini, Before Christ        | 2     |\n * |                                 | GGGGG   | A, B                              |       |\n * | Calendar year                   | y       | 44, 1, 1900, 2017                 | 5     |\n * |                                 | yo      | 44th, 1st, 0th, 17th              | 5,7   |\n * |                                 | yy      | 44, 01, 00, 17                    | 5     |\n * |                                 | yyy     | 044, 001, 1900, 2017              | 5     |\n * |                                 | yyyy    | 0044, 0001, 1900, 2017            | 5     |\n * |                                 | yyyyy   | ...                               | 3,5   |\n * | Local week-numbering year       | Y       | 44, 1, 1900, 2017                 | 5     |\n * |                                 | Yo      | 44th, 1st, 1900th, 2017th         | 5,7   |\n * |                                 | YY      | 44, 01, 00, 17                    | 5,8   |\n * |                                 | YYY     | 044, 001, 1900, 2017              | 5     |\n * |                                 | YYYY    | 0044, 0001, 1900, 2017            | 5,8   |\n * |                                 | YYYYY   | ...                               | 3,5   |\n * | ISO week-numbering year         | R       | -43, 0, 1, 1900, 2017             | 5,7   |\n * |                                 | RR      | -43, 00, 01, 1900, 2017           | 5,7   |\n * |                                 | RRR     | -043, 000, 001, 1900, 2017        | 5,7   |\n * |                                 | RRRR    | -0043, 0000, 0001, 1900, 2017     | 5,7   |\n * |                                 | RRRRR   | ...                               | 3,5,7 |\n * | Extended year                   | u       | -43, 0, 1, 1900, 2017             | 5     |\n * |                                 | uu      | -43, 01, 1900, 2017               | 5     |\n * |                                 | uuu     | -043, 001, 1900, 2017             | 5     |\n * |                                 | uuuu    | -0043, 0001, 1900, 2017           | 5     |\n * |                                 | uuuuu   | ...                               | 3,5   |\n * | Quarter (formatting)            | Q       | 1, 2, 3, 4                        |       |\n * |                                 | Qo      | 1st, 2nd, 3rd, 4th                | 7     |\n * |                                 | QQ      | 01, 02, 03, 04                    |       |\n * |                                 | QQQ     | Q1, Q2, Q3, Q4                    |       |\n * |                                 | QQQQ    | 1st quarter, 2nd quarter, ...     | 2     |\n * |                                 | QQQQQ   | 1, 2, 3, 4                        | 4     |\n * | Quarter (stand-alone)           | q       | 1, 2, 3, 4                        |       |\n * |                                 | qo      | 1st, 2nd, 3rd, 4th                | 7     |\n * |                                 | qq      | 01, 02, 03, 04                    |       |\n * |                                 | qqq     | Q1, Q2, Q3, Q4                    |       |\n * |                                 | qqqq    | 1st quarter, 2nd quarter, ...     | 2     |\n * |                                 | qqqqq   | 1, 2, 3, 4                        | 4     |\n * | Month (formatting)              | M       | 1, 2, ..., 12                     |       |\n * |                                 | Mo      | 1st, 2nd, ..., 12th               | 7     |\n * |                                 | MM      | 01, 02, ..., 12                   |       |\n * |                                 | MMM     | Jan, Feb, ..., Dec                |       |\n * |                                 | MMMM    | January, February, ..., December  | 2     |\n * |                                 | MMMMM   | J, F, ..., D                      |       |\n * | Month (stand-alone)             | L       | 1, 2, ..., 12                     |       |\n * |                                 | Lo      | 1st, 2nd, ..., 12th               | 7     |\n * |                                 | LL      | 01, 02, ..., 12                   |       |\n * |                                 | LLL     | Jan, Feb, ..., Dec                |       |\n * |                                 | LLLL    | January, February, ..., December  | 2     |\n * |                                 | LLLLL   | J, F, ..., D                      |       |\n * | Local week of year              | w       | 1, 2, ..., 53                     |       |\n * |                                 | wo      | 1st, 2nd, ..., 53th               | 7     |\n * |                                 | ww      | 01, 02, ..., 53                   |       |\n * | ISO week of year                | I       | 1, 2, ..., 53                     | 7     |\n * |                                 | Io      | 1st, 2nd, ..., 53th               | 7     |\n * |                                 | II      | 01, 02, ..., 53                   | 7     |\n * | Day of month                    | d       | 1, 2, ..., 31                     |       |\n * |                                 | do      | 1st, 2nd, ..., 31st               | 7     |\n * |                                 | dd      | 01, 02, ..., 31                   |       |\n * | Day of year                     | D       | 1, 2, ..., 365, 366               | 9     |\n * |                                 | Do      | 1st, 2nd, ..., 365th, 366th       | 7     |\n * |                                 | DD      | 01, 02, ..., 365, 366             | 9     |\n * |                                 | DDD     | 001, 002, ..., 365, 366           |       |\n * |                                 | DDDD    | ...                               | 3     |\n * | Day of week (formatting)        | E..EEE  | Mon, Tue, Wed, ..., Sun           |       |\n * |                                 | EEEE    | Monday, Tuesday, ..., Sunday      | 2     |\n * |                                 | EEEEE   | M, T, W, T, F, S, S               |       |\n * |                                 | EEEEEE  | Mo, Tu, We, Th, Fr, Sa, Su        |       |\n * | ISO day of week (formatting)    | i       | 1, 2, 3, ..., 7                   | 7     |\n * |                                 | io      | 1st, 2nd, ..., 7th                | 7     |\n * |                                 | ii      | 01, 02, ..., 07                   | 7     |\n * |                                 | iii     | Mon, Tue, Wed, ..., Sun           | 7     |\n * |                                 | iiii    | Monday, Tuesday, ..., Sunday      | 2,7   |\n * |                                 | iiiii   | M, T, W, T, F, S, S               | 7     |\n * |                                 | iiiiii  | Mo, Tu, We, Th, Fr, Sa, Su        | 7     |\n * | Local day of week (formatting)  | e       | 2, 3, 4, ..., 1                   |       |\n * |                                 | eo      | 2nd, 3rd, ..., 1st                | 7     |\n * |                                 | ee      | 02, 03, ..., 01                   |       |\n * |                                 | eee     | Mon, Tue, Wed, ..., Sun           |       |\n * |                                 | eeee    | Monday, Tuesday, ..., Sunday      | 2     |\n * |                                 | eeeee   | M, T, W, T, F, S, S               |       |\n * |                                 | eeeeee  | Mo, Tu, We, Th, Fr, Sa, Su        |       |\n * | Local day of week (stand-alone) | c       | 2, 3, 4, ..., 1                   |       |\n * |                                 | co      | 2nd, 3rd, ..., 1st                | 7     |\n * |                                 | cc      | 02, 03, ..., 01                   |       |\n * |                                 | ccc     | Mon, Tue, Wed, ..., Sun           |       |\n * |                                 | cccc    | Monday, Tuesday, ..., Sunday      | 2     |\n * |                                 | ccccc   | M, T, W, T, F, S, S               |       |\n * |                                 | cccccc  | Mo, Tu, We, Th, Fr, Sa, Su        |       |\n * | AM, PM                          | a..aa   | AM, PM                            |       |\n * |                                 | aaa     | am, pm                            |       |\n * |                                 | aaaa    | a.m., p.m.                        | 2     |\n * |                                 | aaaaa   | a, p                              |       |\n * | AM, PM, noon, midnight          | b..bb   | AM, PM, noon, midnight            |       |\n * |                                 | bbb     | am, pm, noon, midnight            |       |\n * |                                 | bbbb    | a.m., p.m., noon, midnight        | 2     |\n * |                                 | bbbbb   | a, p, n, mi                       |       |\n * | Flexible day period             | B..BBB  | at night, in the morning, ...     |       |\n * |                                 | BBBB    | at night, in the morning, ...     | 2     |\n * |                                 | BBBBB   | at night, in the morning, ...     |       |\n * | Hour [1-12]                     | h       | 1, 2, ..., 11, 12                 |       |\n * |                                 | ho      | 1st, 2nd, ..., 11th, 12th         | 7     |\n * |                                 | hh      | 01, 02, ..., 11, 12               |       |\n * | Hour [0-23]                     | H       | 0, 1, 2, ..., 23                  |       |\n * |                                 | Ho      | 0th, 1st, 2nd, ..., 23rd          | 7     |\n * |                                 | HH      | 00, 01, 02, ..., 23               |       |\n * | Hour [0-11]                     | K       | 1, 2, ..., 11, 0                  |       |\n * |                                 | Ko      | 1st, 2nd, ..., 11th, 0th          | 7     |\n * |                                 | KK      | 01, 02, ..., 11, 00               |       |\n * | Hour [1-24]                     | k       | 24, 1, 2, ..., 23                 |       |\n * |                                 | ko      | 24th, 1st, 2nd, ..., 23rd         | 7     |\n * |                                 | kk      | 24, 01, 02, ..., 23               |       |\n * | Minute                          | m       | 0, 1, ..., 59                     |       |\n * |                                 | mo      | 0th, 1st, ..., 59th               | 7     |\n * |                                 | mm      | 00, 01, ..., 59                   |       |\n * | Second                          | s       | 0, 1, ..., 59                     |       |\n * |                                 | so      | 0th, 1st, ..., 59th               | 7     |\n * |                                 | ss      | 00, 01, ..., 59                   |       |\n * | Fraction of second              | S       | 0, 1, ..., 9                      |       |\n * |                                 | SS      | 00, 01, ..., 99                   |       |\n * |                                 | SSS     | 000, 001, ..., 999                |       |\n * |                                 | SSSS    | ...                               | 3     |\n * | Timezone (ISO-8601 w/ Z)        | X       | -08, +0530, Z                     |       |\n * |                                 | XX      | -0800, +0530, Z                   |       |\n * |                                 | XXX     | -08:00, +05:30, Z                 |       |\n * |                                 | XXXX    | -0800, +0530, Z, +123456          | 2     |\n * |                                 | XXXXX   | -08:00, +05:30, Z, +12:34:56      |       |\n * | Timezone (ISO-8601 w/o Z)       | x       | -08, +0530, +00                   |       |\n * |                                 | xx      | -0800, +0530, +0000               |       |\n * |                                 | xxx     | -08:00, +05:30, +00:00            | 2     |\n * |                                 | xxxx    | -0800, +0530, +0000, +123456      |       |\n * |                                 | xxxxx   | -08:00, +05:30, +00:00, +12:34:56 |       |\n * | Timezone (GMT)                  | O...OOO | GMT-8, GMT+5:30, GMT+0            |       |\n * |                                 | OOOO    | GMT-08:00, GMT+05:30, GMT+00:00   | 2     |\n * | Timezone (specific non-locat.)  | z...zzz | GMT-8, GMT+5:30, GMT+0            | 6     |\n * |                                 | zzzz    | GMT-08:00, GMT+05:30, GMT+00:00   | 2,6   |\n * | Seconds timestamp               | t       | 512969520                         | 7     |\n * |                                 | tt      | ...                               | 3,7   |\n * | Milliseconds timestamp          | T       | 512969520900                      | 7     |\n * |                                 | TT      | ...                               | 3,7   |\n * | Long localized date             | P       | 04/29/1453                        | 7     |\n * |                                 | PP      | Apr 29, 1453                      | 7     |\n * |                                 | PPP     | April 29th, 1453                  | 7     |\n * |                                 | PPPP    | Friday, April 29th, 1453          | 2,7   |\n * | Long localized time             | p       | 12:00 AM                          | 7     |\n * |                                 | pp      | 12:00:00 AM                       | 7     |\n * |                                 | ppp     | 12:00:00 AM GMT+2                 | 7     |\n * |                                 | pppp    | 12:00:00 AM GMT+02:00             | 2,7   |\n * | Combination of date and time    | Pp      | 04/29/1453, 12:00 AM              | 7     |\n * |                                 | PPpp    | Apr 29, 1453, 12:00:00 AM         | 7     |\n * |                                 | PPPppp  | April 29th, 1453 at ...           | 7     |\n * |                                 | PPPPpppp| Friday, April 29th, 1453 at ...   | 2,7   |\n * Notes:\n * 1. \"Formatting\" units (e.g. formatting quarter) in the default en-US locale\n *    are the same as \"stand-alone\" units, but are different in some languages.\n *    \"Formatting\" units are declined according to the rules of the language\n *    in the context of a date. \"Stand-alone\" units are always nominative singular:\n *\n *    `format(new Date(2017, 10, 6), 'do LLLL', {locale: cs}) //=> '6. listopad'`\n *\n *    `format(new Date(2017, 10, 6), 'do MMMM', {locale: cs}) //=> '6. listopadu'`\n *\n * 2. Any sequence of the identical letters is a pattern, unless it is escaped by\n *    the single quote characters (see below).\n *    If the sequence is longer than listed in table (e.g. `EEEEEEEEEEE`)\n *    the output will be the same as default pattern for this unit, usually\n *    the longest one (in case of ISO weekdays, `EEEE`). Default patterns for units\n *    are marked with \"2\" in the last column of the table.\n *\n *    `format(new Date(2017, 10, 6), 'MMM') //=> 'Nov'`\n *\n *    `format(new Date(2017, 10, 6), 'MMMM') //=> 'November'`\n *\n *    `format(new Date(2017, 10, 6), 'MMMMM') //=> 'N'`\n *\n *    `format(new Date(2017, 10, 6), 'MMMMMM') //=> 'November'`\n *\n *    `format(new Date(2017, 10, 6), 'MMMMMMM') //=> 'November'`\n *\n * 3. Some patterns could be unlimited length (such as `yyyyyyyy`).\n *    The output will be padded with zeros to match the length of the pattern.\n *\n *    `format(new Date(2017, 10, 6), 'yyyyyyyy') //=> '00002017'`\n *\n * 4. `QQQQQ` and `qqqqq` could be not strictly numerical in some locales.\n *    These tokens represent the shortest form of the quarter.\n *\n * 5. The main difference between `y` and `u` patterns are B.C. years:\n *\n *    | Year | `y` | `u` |\n *    |------|-----|-----|\n *    | AC 1 |   1 |   1 |\n *    | BC 1 |   1 |   0 |\n *    | BC 2 |   2 |  -1 |\n *\n *    Also `yy` always returns the last two digits of a year,\n *    while `uu` pads single digit years to 2 characters and returns other years unchanged:\n *\n *    | Year | `yy` | `uu` |\n *    |------|------|------|\n *    | 1    |   01 |   01 |\n *    | 14   |   14 |   14 |\n *    | 376  |   76 |  376 |\n *    | 1453 |   53 | 1453 |\n *\n *    The same difference is true for local and ISO week-numbering years (`Y` and `R`),\n *    except local week-numbering years are dependent on `options.weekStartsOn`\n *    and `options.firstWeekContainsDate` (compare [getISOWeekYear](https://date-fns.org/docs/getISOWeekYear)\n *    and [getWeekYear](https://date-fns.org/docs/getWeekYear)).\n *\n * 6. Specific non-location timezones are currently unavailable in `date-fns`,\n *    so right now these tokens fall back to GMT timezones.\n *\n * 7. These patterns are not in the Unicode Technical Standard #35:\n *    - `i`: ISO day of week\n *    - `I`: ISO week of year\n *    - `R`: ISO week-numbering year\n *    - `t`: seconds timestamp\n *    - `T`: milliseconds timestamp\n *    - `o`: ordinal number modifier\n *    - `P`: long localized date\n *    - `p`: long localized time\n *\n * 8. `YY` and `YYYY` tokens represent week-numbering years but they are often confused with years.\n *    You should enable `options.useAdditionalWeekYearTokens` to use them. See: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n *\n * 9. `D` and `DD` tokens represent days of the year but they are often confused with days of the month.\n *    You should enable `options.useAdditionalDayOfYearTokens` to use them. See: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n *\n * @param date - The original date\n * @param format - The string of tokens\n * @param options - An object with options\n *\n * @returns The formatted date string\n *\n * @throws `date` must not be Invalid Date\n * @throws `options.locale` must contain `localize` property\n * @throws `options.locale` must contain `formatLong` property\n * @throws use `yyyy` instead of `YYYY` for formatting years using [format provided] to the input [input provided]; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @throws use `yy` instead of `YY` for formatting years using [format provided] to the input [input provided]; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @throws use `d` instead of `D` for formatting days of the month using [format provided] to the input [input provided]; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @throws use `dd` instead of `DD` for formatting days of the month using [format provided] to the input [input provided]; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md\n * @throws format string contains an unescaped latin alphabet character\n *\n * @example\n * // Represent 11 February 2014 in middle-endian format:\n * const result = format(new Date(2014, 1, 11), 'MM/dd/yyyy')\n * //=> '02/11/2014'\n *\n * @example\n * // Represent 2 July 2014 in Esperanto:\n * import { eoLocale } from 'date-fns/locale/eo'\n * const result = format(new Date(2014, 6, 2), \"do 'de' MMMM yyyy\", {\n *   locale: eoLocale\n * })\n * //=> '2-a de julio 2014'\n *\n * @example\n * // Escape string by single quote characters:\n * const result = format(new Date(2014, 6, 2, 15), \"h 'o''clock'\")\n * //=> \"3 o'clock\"\n */\nexport function format(date, formatStr, options) {\n  const defaultOptions = getDefaultOptions();\n  const locale = options?.locale ?? defaultOptions.locale ?? defaultLocale;\n\n  const firstWeekContainsDate =\n    options?.firstWeekContainsDate ??\n    options?.locale?.options?.firstWeekContainsDate ??\n    defaultOptions.firstWeekContainsDate ??\n    defaultOptions.locale?.options?.firstWeekContainsDate ??\n    1;\n\n  const weekStartsOn =\n    options?.weekStartsOn ??\n    options?.locale?.options?.weekStartsOn ??\n    defaultOptions.weekStartsOn ??\n    defaultOptions.locale?.options?.weekStartsOn ??\n    0;\n\n  const originalDate = toDate(date, options?.in);\n\n  if (!isValid(originalDate)) {\n    throw new RangeError(\"Invalid time value\");\n  }\n\n  let parts = formatStr\n    .match(longFormattingTokensRegExp)\n    .map((substring) => {\n      const firstCharacter = substring[0];\n      if (firstCharacter === \"p\" || firstCharacter === \"P\") {\n        const longFormatter = longFormatters[firstCharacter];\n        return longFormatter(substring, locale.formatLong);\n      }\n      return substring;\n    })\n    .join(\"\")\n    .match(formattingTokensRegExp)\n    .map((substring) => {\n      // Replace two single quote characters with one single quote character\n      if (substring === \"''\") {\n        return { isToken: false, value: \"'\" };\n      }\n\n      const firstCharacter = substring[0];\n      if (firstCharacter === \"'\") {\n        return { isToken: false, value: cleanEscapedString(substring) };\n      }\n\n      if (formatters[firstCharacter]) {\n        return { isToken: true, value: substring };\n      }\n\n      if (firstCharacter.match(unescapedLatinCharacterRegExp)) {\n        throw new RangeError(\n          \"Format string contains an unescaped latin alphabet character `\" +\n            firstCharacter +\n            \"`\",\n        );\n      }\n\n      return { isToken: false, value: substring };\n    });\n\n  // invoke localize preprocessor (only for french locales at the moment)\n  if (locale.localize.preprocessor) {\n    parts = locale.localize.preprocessor(originalDate, parts);\n  }\n\n  const formatterOptions = {\n    firstWeekContainsDate,\n    weekStartsOn,\n    locale,\n  };\n\n  return parts\n    .map((part) => {\n      if (!part.isToken) return part.value;\n\n      const token = part.value;\n\n      if (\n        (!options?.useAdditionalWeekYearTokens &&\n          isProtectedWeekYearToken(token)) ||\n        (!options?.useAdditionalDayOfYearTokens &&\n          isProtectedDayOfYearToken(token))\n      ) {\n        warnOrThrowProtectedError(token, formatStr, String(date));\n      }\n\n      const formatter = formatters[token[0]];\n      return formatter(originalDate, token, locale.localize, formatterOptions);\n    })\n    .join(\"\");\n}\n\nfunction cleanEscapedString(input) {\n  const matched = input.match(escapedStringRegExp);\n\n  if (!matched) {\n    return input;\n  }\n\n  return matched[1].replace(doubleQuoteRegExp, \"'\");\n}\n\n// Fallback for modularized imports:\nexport default format;\n", "import { addLeadingZeros } from \"./_lib/addLeadingZeros.js\";\nimport { toDate } from \"./toDate.js\";\n\n/**\n * The {@link formatISO} function options.\n */\n\n/**\n * @name formatISO\n * @category Common Helpers\n * @summary Format the date according to the ISO 8601 standard (https://support.sas.com/documentation/cdl/en/lrdict/64316/HTML/default/viewer.htm#a003169814.htm).\n *\n * @description\n * Return the formatted date string in ISO 8601 format. Options may be passed to control the parts and notations of the date.\n *\n * @param date - The original date\n * @param options - An object with options.\n *\n * @returns The formatted date string (in local time zone)\n *\n * @throws `date` must not be Invalid Date\n *\n * @example\n * // Represent 18 September 2019 in ISO 8601 format (local time zone is UTC):\n * const result = formatISO(new Date(2019, 8, 18, 19, 0, 52))\n * //=> '2019-09-18T19:00:52Z'\n *\n * @example\n * // Represent 18 September 2019 in ISO 8601, short format (local time zone is UTC):\n * const result = formatISO(new Date(2019, 8, 18, 19, 0, 52), { format: 'basic' })\n * //=> '20190918T190052'\n *\n * @example\n * // Represent 18 September 2019 in ISO 8601 format, date only:\n * const result = formatISO(new Date(2019, 8, 18, 19, 0, 52), { representation: 'date' })\n * //=> '2019-09-18'\n *\n * @example\n * // Represent 18 September 2019 in ISO 8601 format, time only (local time zone is UTC):\n * const result = formatISO(new Date(2019, 8, 18, 19, 0, 52), { representation: 'time' })\n * //=> '19:00:52Z'\n */\nexport function formatISO(date, options) {\n  const date_ = toDate(date, options?.in);\n\n  if (isNaN(+date_)) {\n    throw new RangeError(\"Invalid time value\");\n  }\n\n  const format = options?.format ?? \"extended\";\n  const representation = options?.representation ?? \"complete\";\n\n  let result = \"\";\n  let tzOffset = \"\";\n\n  const dateDelimiter = format === \"extended\" ? \"-\" : \"\";\n  const timeDelimiter = format === \"extended\" ? \":\" : \"\";\n\n  // Representation is either 'date' or 'complete'\n  if (representation !== \"time\") {\n    const day = addLeadingZeros(date_.getDate(), 2);\n    const month = addLeadingZeros(date_.getMonth() + 1, 2);\n    const year = addLeadingZeros(date_.getFullYear(), 4);\n\n    // yyyyMMdd or yyyy-MM-dd.\n    result = `${year}${dateDelimiter}${month}${dateDelimiter}${day}`;\n  }\n\n  // Representation is either 'time' or 'complete'\n  if (representation !== \"date\") {\n    // Add the timezone.\n    const offset = date_.getTimezoneOffset();\n\n    if (offset !== 0) {\n      const absoluteOffset = Math.abs(offset);\n      const hourOffset = addLeadingZeros(Math.trunc(absoluteOffset / 60), 2);\n      const minuteOffset = addLeadingZeros(absoluteOffset % 60, 2);\n      // If less than 0, the sign is +, because it is ahead of time.\n      const sign = offset < 0 ? \"+\" : \"-\";\n\n      tzOffset = `${sign}${hourOffset}:${minuteOffset}`;\n    } else {\n      tzOffset = \"Z\";\n    }\n\n    const hour = addLeadingZeros(date_.getHours(), 2);\n    const minute = addLeadingZeros(date_.getMinutes(), 2);\n    const second = addLeadingZeros(date_.getSeconds(), 2);\n\n    // If there's also date, separate it with time with 'T'\n    const separator = result === \"\" ? \"\" : \"T\";\n\n    // Creates a time string consisting of hour, minute, and second, separated by delimiters, if defined.\n    const time = [hour, minute, second].join(timeDelimiter);\n\n    // HHmmss or HH:mm:ss.\n    result = `${result}${separator}${time}${tzOffset}`;\n  }\n\n  return result;\n}\n\n// Fallback for modularized imports:\nexport default formatISO;\n", "import { toDate } from \"./toDate.js\";\n\n/**\n * The {@link getDate} function options.\n */\n\n/**\n * @name getDate\n * @category Day Helpers\n * @summary Get the day of the month of the given date.\n *\n * @description\n * Get the day of the month of the given date.\n *\n * @param date - The given date\n * @param options - An object with options.\n *\n * @returns The day of month\n *\n * @example\n * // Which day of the month is 29 February 2012?\n * const result = getDate(new Date(2012, 1, 29))\n * //=> 29\n */\nexport function getDate(date, options) {\n  return toDate(date, options?.in).getDate();\n}\n\n// Fallback for modularized imports:\nexport default getDate;\n", "import { toDate } from \"./toDate.js\";\n\n/**\n * The {@link getDay} function options.\n */\n\n/**\n * @name getDay\n * @category Weekday Helpers\n * @summary Get the day of the week of the given date.\n *\n * @description\n * Get the day of the week of the given date.\n *\n * @param date - The given date\n * @param options - The options\n *\n * @returns The day of week, 0 represents Sunday\n *\n * @example\n * // Which day of the week is 29 February 2012?\n * const result = getDay(new Date(2012, 1, 29))\n * //=> 3\n */\nexport function getDay(date, options) {\n  return toDate(date, options?.in).getDay();\n}\n\n// Fallback for modularized imports:\nexport default getDay;\n", "import { getDefaultOptions } from \"./_lib/defaultOptions.js\";\nimport { getDate } from \"./getDate.js\";\nimport { getDay } from \"./getDay.js\";\nimport { startOfMonth } from \"./startOfMonth.js\";\nimport { toDate } from \"./toDate.js\";\n\n/**\n * The {@link getWeekOfMonth} function options.\n */\n\n/**\n * @name getWeekOfMonth\n * @category Week Helpers\n * @summary Get the week of the month of the given date.\n *\n * @description\n * Get the week of the month of the given date.\n *\n * @param date - The given date\n * @param options - An object with options.\n *\n * @returns The week of month\n *\n * @example\n * // Which week of the month is 9 November 2017?\n * const result = getWeekOfMonth(new Date(2017, 10, 9))\n * //=> 2\n */\nexport function getWeekOfMonth(date, options) {\n  const defaultOptions = getDefaultOptions();\n  const weekStartsOn =\n    options?.weekStartsOn ??\n    options?.locale?.options?.weekStartsOn ??\n    defaultOptions.weekStartsOn ??\n    defaultOptions.locale?.options?.weekStartsOn ??\n    0;\n\n  const currentDayOfMonth = getDate(toDate(date, options?.in));\n  if (isNaN(currentDayOfMonth)) return NaN;\n\n  const startWeekDay = getDay(startOfMonth(date, options));\n\n  let lastDayOfFirstWeek = weekStartsOn - startWeekDay;\n  if (lastDayOfFirstWeek <= 0) lastDayOfFirstWeek += 7;\n\n  const remainingDaysAfterFirstWeek = currentDayOfMonth - lastDayOfFirstWeek;\n  return Math.ceil(remainingDaysAfterFirstWeek / 7) + 1;\n}\n\n// Fallback for modularized imports:\nexport default getWeekOfMonth;\n", "import { toDate } from \"./toDate.js\";\n\n/**\n * The {@link lastDayOfMonth} function options.\n */\n\n/**\n * @name lastDayOfMonth\n * @category Month Helpers\n * @summary Return the last day of a month for the given date.\n *\n * @description\n * Return the last day of a month for the given date.\n * The result will be in the local timezone.\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments. Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n * @typeParam ResultDate - The result `Date` type, it is the type returned from the context function if it is passed, or inferred from the arguments.\n *\n * @param date - The original date\n * @param options - An object with options\n *\n * @returns The last day of a month\n *\n * @example\n * // The last day of a month for 2 September 2014 11:55:00:\n * const result = lastDayOfMonth(new Date(2014, 8, 2, 11, 55, 0))\n * //=> Tue Sep 30 2014 00:00:00\n */\nexport function lastDayOfMonth(date, options) {\n  const _date = toDate(date, options?.in);\n  const month = _date.getMonth();\n  _date.setFullYear(_date.getFullYear(), month + 1, 0);\n  _date.setHours(0, 0, 0, 0);\n  return toDate(_date, options?.in);\n}\n\n// Fallback for modularized imports:\nexport default lastDayOfMonth;\n", "import { normalizeDates } from \"./_lib/normalizeDates.js\";\n\n/**\n * The {@link isSameMonth} function options.\n */\n\n/**\n * @name isSameMonth\n * @category Month Helpers\n * @summary Are the given dates in the same month (and year)?\n *\n * @description\n * Are the given dates in the same month (and year)?\n *\n * @param laterDate - The first date to check\n * @param earlierDate - The second date to check\n * @param options - An object with options\n *\n * @returns The dates are in the same month (and year)\n *\n * @example\n * // Are 2 September 2014 and 25 September 2014 in the same month?\n * const result = isSameMonth(new Date(2014, 8, 2), new Date(2014, 8, 25))\n * //=> true\n *\n * @example\n * // Are 2 September 2014 and 25 September 2015 in the same month?\n * const result = isSameMonth(new Date(2014, 8, 2), new Date(2015, 8, 25))\n * //=> false\n */\nexport function isSameMonth(laterDate, earlierDate, options) {\n  const [laterDate_, earlierDate_] = normalizeDates(\n    options?.in,\n    laterDate,\n    earlierDate,\n  );\n  return (\n    laterDate_.getFullYear() === earlierDate_.getFullYear() &&\n    laterDate_.getMonth() === earlierDate_.getMonth()\n  );\n}\n\n// Fallback for modularized imports:\nexport default isSameMonth;\n", "import { constructFrom } from \"./constructFrom.js\";\nimport { constructNow } from \"./constructNow.js\";\nimport { isSameDay } from \"./isSameDay.js\";\n\n/**\n * The {@link isToday} function options.\n */\n\n/**\n * @name isToday\n * @category Day Helpers\n * @summary Is the given date today?\n * @pure false\n *\n * @description\n * Is the given date today?\n *\n * @param date - The date to check\n * @param options - An object with options\n *\n * @returns The date is today\n *\n * @example\n * // If today is 6 October 2014, is 6 October 14:00:00 today?\n * const result = isToday(new Date(2014, 9, 6, 14, 0))\n * //=> true\n */\nexport function isToday(date, options) {\n  return isSameDay(\n    constructFrom(options?.in || date, date),\n    constructNow(options?.in || date),\n  );\n}\n\n// Fallback for modularized imports:\nexport default isToday;\n", "import { addDays } from \"./addDays.js\";\n\n/**\n * The {@link subDays} function options.\n */\n\n/**\n * @name subDays\n * @category Day Helpers\n * @summary Subtract the specified number of days from the given date.\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments. Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n * @typeParam ResultDate - The result `Date` type, it is the type returned from the context function if it is passed, or inferred from the arguments.\n *\n * @param date - The date to be changed\n * @param amount - The amount of days to be subtracted.\n * @param options - An object with options\n *\n * @returns The new date with the days subtracted\n *\n * @example\n * // Subtract 10 days from 1 September 2014:\n * const result = subDays(new Date(2014, 8, 1), 10)\n * //=> Fri Aug 22 2014 00:00:00\n */\nexport function subDays(date, amount, options) {\n  return addDays(date, -amount, options);\n}\n\n// Fallback for modularized imports:\nexport default subDays;\n", "import { startOfDay } from \"./startOfDay.js\";\n\n/**\n * The {@link startOfToday} function options.\n */\n\n/**\n * @name startOfToday\n * @category Day Helpers\n * @summary Return the start of today.\n * @pure false\n *\n * @description\n * Return the start of today.\n *\n * @typeParam ContextDate - The `Date` type of the context function.\n *\n * @param options - An object with options\n *\n * @returns The start of today\n *\n * @example\n * // If today is 6 October 2014:\n * const result = startOfToday()\n * //=> Mon Oct 6 2014 00:00:00\n */\nexport function startOfToday(options) {\n  return startOfDay(Date.now(), options);\n}\n\n// Fallback for modularized imports:\nexport default startOfToday;\n", "import { addMonths } from \"./addMonths.js\";\n\n/**\n * The subMonths function options.\n */\n\n/**\n * @name subMonths\n * @category Month Helpers\n * @summary Subtract the specified number of months from the given date.\n *\n * @description\n * Subtract the specified number of months from the given date.\n *\n * @typeParam DateType - The `Date` type, the function operates on. Gets inferred from passed arguments. Allows to use extensions like [`UTCDate`](https://github.com/date-fns/utc).\n * @typeParam ResultDate - The result `Date` type, it is the type returned from the context function if it is passed, or inferred from the arguments.\n *\n * @param date - The date to be changed\n * @param amount - The amount of months to be subtracted.\n * @param options - An object with options\n *\n * @returns The new date with the months subtracted\n *\n * @example\n * // Subtract 5 months from 1 February 2015:\n * const result = subMonths(new Date(2015, 1, 1), 5)\n * //=> Mon Sep 01 2014 00:00:00\n */\nexport function subMonths(date, amount, options) {\n  return addMonths(date, -amount, options);\n}\n\n// Fallback for modularized imports:\nexport default subMonths;\n", "const formatDistanceLocale = {\n  lessThanXSeconds: {\n    one: \"mindre end \u00E9t sekund\",\n    other: \"mindre end {{count}} sekunder\",\n  },\n\n  xSeconds: {\n    one: \"1 sekund\",\n    other: \"{{count}} sekunder\",\n  },\n\n  halfAMinute: \"\u00E9t halvt minut\",\n\n  lessThanXMinutes: {\n    one: \"mindre end \u00E9t minut\",\n    other: \"mindre end {{count}} minutter\",\n  },\n\n  xMinutes: {\n    one: \"1 minut\",\n    other: \"{{count}} minutter\",\n  },\n\n  aboutXHours: {\n    one: \"cirka 1 time\",\n    other: \"cirka {{count}} timer\",\n  },\n\n  xHours: {\n    one: \"1 time\",\n    other: \"{{count}} timer\",\n  },\n\n  xDays: {\n    one: \"1 dag\",\n    other: \"{{count}} dage\",\n  },\n\n  aboutXWeeks: {\n    one: \"cirka 1 uge\",\n    other: \"cirka {{count}} uger\",\n  },\n\n  xWeeks: {\n    one: \"1 uge\",\n    other: \"{{count}} uger\",\n  },\n\n  aboutXMonths: {\n    one: \"cirka 1 m\u00E5ned\",\n    other: \"cirka {{count}} m\u00E5neder\",\n  },\n\n  xMonths: {\n    one: \"1 m\u00E5ned\",\n    other: \"{{count}} m\u00E5neder\",\n  },\n\n  aboutXYears: {\n    one: \"cirka 1 \u00E5r\",\n    other: \"cirka {{count}} \u00E5r\",\n  },\n\n  xYears: {\n    one: \"1 \u00E5r\",\n    other: \"{{count}} \u00E5r\",\n  },\n\n  overXYears: {\n    one: \"over 1 \u00E5r\",\n    other: \"over {{count}} \u00E5r\",\n  },\n\n  almostXYears: {\n    one: \"n\u00E6sten 1 \u00E5r\",\n    other: \"n\u00E6sten {{count}} \u00E5r\",\n  },\n};\n\nexport const formatDistance = (token, count, options) => {\n  let result;\n\n  const tokenValue = formatDistanceLocale[token];\n  if (typeof tokenValue === \"string\") {\n    result = tokenValue;\n  } else if (count === 1) {\n    result = tokenValue.one;\n  } else {\n    result = tokenValue.other.replace(\"{{count}}\", String(count));\n  }\n\n  if (options?.addSuffix) {\n    if (options.comparison && options.comparison > 0) {\n      return \"om \" + result;\n    } else {\n      return result + \" siden\";\n    }\n  }\n\n  return result;\n};\n", "import { buildFormatLongFn } from \"../../_lib/buildFormatLongFn.js\";\n\nconst dateFormats = {\n  full: \"EEEE 'den' d. MMMM y\",\n  long: \"d. MMMM y\",\n  medium: \"d. MMM y\",\n  short: \"dd/MM/y\",\n};\n\nconst timeFormats = {\n  full: \"HH:mm:ss zzzz\",\n  long: \"HH:mm:ss z\",\n  medium: \"HH:mm:ss\",\n  short: \"HH:mm\",\n};\n\nconst dateTimeFormats = {\n  full: \"{{date}} 'kl'. {{time}}\",\n  long: \"{{date}} 'kl'. {{time}}\",\n  medium: \"{{date}} {{time}}\",\n  short: \"{{date}} {{time}}\",\n};\n\nexport const formatLong = {\n  date: buildFormatLongFn({\n    formats: dateFormats,\n    defaultWidth: \"full\",\n  }),\n\n  time: buildFormatLongFn({\n    formats: timeFormats,\n    defaultWidth: \"full\",\n  }),\n\n  dateTime: buildFormatLongFn({\n    formats: dateTimeFormats,\n    defaultWidth: \"full\",\n  }),\n};\n", "const formatRelativeLocale = {\n  lastWeek: \"'sidste' eeee 'kl.' p\",\n  yesterday: \"'i g\u00E5r kl.' p\",\n  today: \"'i dag kl.' p\",\n  tomorrow: \"'i morgen kl.' p\",\n  nextWeek: \"'p\u00E5' eeee 'kl.' p\",\n  other: \"P\",\n};\n\nexport const formatRelative = (token, _date, _baseDate, _options) =>\n  formatRelativeLocale[token];\n", "import { buildLocalizeFn } from \"../../_lib/buildLocalizeFn.js\";\n\nconst eraValues = {\n  narrow: [\"fvt\", \"vt\"],\n  abbreviated: [\"f.v.t.\", \"v.t.\"],\n  wide: [\"f\u00F8r vesterlandsk tidsregning\", \"vesterlandsk tidsregning\"],\n};\n\nconst quarterValues = {\n  narrow: [\"1\", \"2\", \"3\", \"4\"],\n  abbreviated: [\"1. kvt.\", \"2. kvt.\", \"3. kvt.\", \"4. kvt.\"],\n  wide: [\"1. kvartal\", \"2. kvartal\", \"3. kvartal\", \"4. kvartal\"],\n};\n\nconst monthValues = {\n  narrow: [\"J\", \"F\", \"M\", \"A\", \"M\", \"J\", \"J\", \"A\", \"S\", \"O\", \"N\", \"D\"],\n  abbreviated: [\n    \"jan.\",\n    \"feb.\",\n    \"mar.\",\n    \"apr.\",\n    \"maj\",\n    \"jun.\",\n    \"jul.\",\n    \"aug.\",\n    \"sep.\",\n    \"okt.\",\n    \"nov.\",\n    \"dec.\",\n  ],\n\n  wide: [\n    \"januar\",\n    \"februar\",\n    \"marts\",\n    \"april\",\n    \"maj\",\n    \"juni\",\n    \"juli\",\n    \"august\",\n    \"september\",\n    \"oktober\",\n    \"november\",\n    \"december\",\n  ],\n};\n\n// Note that 'Days - abbreviated - Formatting' has periods at the end.\n// https://www.unicode.org/cldr/charts/32/summary/da.html#1760\n// This makes grammatical sense in danish, as most abbreviations have periods.\nconst dayValues = {\n  narrow: [\"S\", \"M\", \"T\", \"O\", \"T\", \"F\", \"L\"],\n  short: [\"s\u00F8\", \"ma\", \"ti\", \"on\", \"to\", \"fr\", \"l\u00F8\"],\n  abbreviated: [\"s\u00F8n.\", \"man.\", \"tir.\", \"ons.\", \"tor.\", \"fre.\", \"l\u00F8r.\"],\n\n  wide: [\n    \"s\u00F8ndag\",\n    \"mandag\",\n    \"tirsdag\",\n    \"onsdag\",\n    \"torsdag\",\n    \"fredag\",\n    \"l\u00F8rdag\",\n  ],\n};\n\nconst dayPeriodValues = {\n  narrow: {\n    am: \"a\",\n    pm: \"p\",\n    midnight: \"midnat\",\n    noon: \"middag\",\n    morning: \"morgen\",\n    afternoon: \"eftermiddag\",\n    evening: \"aften\",\n    night: \"nat\",\n  },\n  abbreviated: {\n    am: \"AM\",\n    pm: \"PM\",\n    midnight: \"midnat\",\n    noon: \"middag\",\n    morning: \"morgen\",\n    afternoon: \"eftermiddag\",\n    evening: \"aften\",\n    night: \"nat\",\n  },\n  wide: {\n    am: \"a.m.\",\n    pm: \"p.m.\",\n    midnight: \"midnat\",\n    noon: \"middag\",\n    morning: \"morgen\",\n    afternoon: \"eftermiddag\",\n    evening: \"aften\",\n    night: \"nat\",\n  },\n};\n\nconst formattingDayPeriodValues = {\n  narrow: {\n    am: \"a\",\n    pm: \"p\",\n    midnight: \"midnat\",\n    noon: \"middag\",\n    morning: \"om morgenen\",\n    afternoon: \"om eftermiddagen\",\n    evening: \"om aftenen\",\n    night: \"om natten\",\n  },\n  abbreviated: {\n    am: \"AM\",\n    pm: \"PM\",\n    midnight: \"midnat\",\n    noon: \"middag\",\n    morning: \"om morgenen\",\n    afternoon: \"om eftermiddagen\",\n    evening: \"om aftenen\",\n    night: \"om natten\",\n  },\n  wide: {\n    am: \"a.m.\",\n    pm: \"p.m.\",\n    midnight: \"midnat\",\n    noon: \"middag\",\n    morning: \"om morgenen\",\n    afternoon: \"om eftermiddagen\",\n    evening: \"om aftenen\",\n    night: \"om natten\",\n  },\n};\n\nconst ordinalNumber = (dirtyNumber, _options) => {\n  const number = Number(dirtyNumber);\n  return number + \".\";\n};\n\nexport const localize = {\n  ordinalNumber,\n\n  era: buildLocalizeFn({\n    values: eraValues,\n    defaultWidth: \"wide\",\n  }),\n\n  quarter: buildLocalizeFn({\n    values: quarterValues,\n    defaultWidth: \"wide\",\n    argumentCallback: (quarter) => quarter - 1,\n  }),\n\n  month: buildLocalizeFn({\n    values: monthValues,\n    defaultWidth: \"wide\",\n  }),\n\n  day: buildLocalizeFn({\n    values: dayValues,\n    defaultWidth: \"wide\",\n  }),\n\n  dayPeriod: buildLocalizeFn({\n    values: dayPeriodValues,\n    defaultWidth: \"wide\",\n    formattingValues: formattingDayPeriodValues,\n    defaultFormattingWidth: \"wide\",\n  }),\n};\n", "import { buildMatchFn } from \"../../_lib/buildMatchFn.js\";\nimport { buildMatchPatternFn } from \"../../_lib/buildMatchPatternFn.js\";\n\nconst matchOrdinalNumberPattern = /^(\\d+)(\\.)?/i;\nconst parseOrdinalNumberPattern = /\\d+/i;\n\nconst matchEraPatterns = {\n  narrow: /^(fKr|fvt|eKr|vt)/i,\n  abbreviated: /^(f\\.Kr\\.?|f\\.v\\.t\\.?|e\\.Kr\\.?|v\\.t\\.)/i,\n  wide: /^(f.Kr.|f\u00F8r vesterlandsk tidsregning|e.Kr.|vesterlandsk tidsregning)/i,\n};\nconst parseEraPatterns = {\n  any: [/^f/i, /^(v|e)/i],\n};\n\nconst matchQuarterPatterns = {\n  narrow: /^[1234]/i,\n  abbreviated: /^[1234]. kvt\\./i,\n  wide: /^[1234]\\.? kvartal/i,\n};\nconst parseQuarterPatterns = {\n  any: [/1/i, /2/i, /3/i, /4/i],\n};\n\nconst matchMonthPatterns = {\n  narrow: /^[jfmasond]/i,\n  abbreviated: /^(jan.|feb.|mar.|apr.|maj|jun.|jul.|aug.|sep.|okt.|nov.|dec.)/i,\n  wide: /^(januar|februar|marts|april|maj|juni|juli|august|september|oktober|november|december)/i,\n};\nconst parseMonthPatterns = {\n  narrow: [\n    /^j/i,\n    /^f/i,\n    /^m/i,\n    /^a/i,\n    /^m/i,\n    /^j/i,\n    /^j/i,\n    /^a/i,\n    /^s/i,\n    /^o/i,\n    /^n/i,\n    /^d/i,\n  ],\n\n  any: [\n    /^ja/i,\n    /^f/i,\n    /^mar/i,\n    /^ap/i,\n    /^maj/i,\n    /^jun/i,\n    /^jul/i,\n    /^au/i,\n    /^s/i,\n    /^o/i,\n    /^n/i,\n    /^d/i,\n  ],\n};\n\nconst matchDayPatterns = {\n  narrow: /^[smtofl]/i,\n  short: /^(s\u00F8n.|man.|tir.|ons.|tor.|fre.|l\u00F8r.)/i,\n  abbreviated: /^(s\u00F8n|man|tir|ons|tor|fre|l\u00F8r)/i,\n  wide: /^(s\u00F8ndag|mandag|tirsdag|onsdag|torsdag|fredag|l\u00F8rdag)/i,\n};\nconst parseDayPatterns = {\n  narrow: [/^s/i, /^m/i, /^t/i, /^o/i, /^t/i, /^f/i, /^l/i],\n  any: [/^s/i, /^m/i, /^ti/i, /^o/i, /^to/i, /^f/i, /^l/i],\n};\n\nconst matchDayPeriodPatterns = {\n  narrow: /^(a|p|midnat|middag|(om) (morgenen|eftermiddagen|aftenen|natten))/i,\n  any: /^([ap]\\.?\\s?m\\.?|midnat|middag|(om) (morgenen|eftermiddagen|aftenen|natten))/i,\n};\nconst parseDayPeriodPatterns = {\n  any: {\n    am: /^a/i,\n    pm: /^p/i,\n    midnight: /midnat/i,\n    noon: /middag/i,\n    morning: /morgen/i,\n    afternoon: /eftermiddag/i,\n    evening: /aften/i,\n    night: /nat/i,\n  },\n};\n\nexport const match = {\n  ordinalNumber: buildMatchPatternFn({\n    matchPattern: matchOrdinalNumberPattern,\n    parsePattern: parseOrdinalNumberPattern,\n    valueCallback: (value) => parseInt(value, 10),\n  }),\n\n  era: buildMatchFn({\n    matchPatterns: matchEraPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseEraPatterns,\n    defaultParseWidth: \"any\",\n  }),\n\n  quarter: buildMatchFn({\n    matchPatterns: matchQuarterPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseQuarterPatterns,\n    defaultParseWidth: \"any\",\n    valueCallback: (index) => index + 1,\n  }),\n\n  month: buildMatchFn({\n    matchPatterns: matchMonthPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseMonthPatterns,\n    defaultParseWidth: \"any\",\n  }),\n\n  day: buildMatchFn({\n    matchPatterns: matchDayPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseDayPatterns,\n    defaultParseWidth: \"any\",\n  }),\n\n  dayPeriod: buildMatchFn({\n    matchPatterns: matchDayPeriodPatterns,\n    defaultMatchWidth: \"any\",\n    parsePatterns: parseDayPeriodPatterns,\n    defaultParseWidth: \"any\",\n  }),\n};\n", "import { formatDistance } from \"./da/_lib/formatDistance.js\";\nimport { formatLong } from \"./da/_lib/formatLong.js\";\nimport { formatRelative } from \"./da/_lib/formatRelative.js\";\nimport { localize } from \"./da/_lib/localize.js\";\nimport { match } from \"./da/_lib/match.js\";\n\n/**\n * @category Locales\n * @summary Danish locale.\n * @language Danish\n * @iso-639-2 dan\n * @author Mathias W\u00F8bbe [@MathiasKandelborg](https://github.com/MathiasKandelborg)\n * @author Anders B. Hansen [@Andersbiha](https://github.com/Andersbiha)\n * @author [@kgram](https://github.com/kgram)\n * @author [@stefanbugge](https://github.com/stefanbugge)\n */\nexport const da = {\n  code: \"da\",\n  formatDistance: formatDistance,\n  formatLong: formatLong,\n  formatRelative: formatRelative,\n  localize: localize,\n  match: match,\n  options: {\n    weekStartsOn: 1 /* Monday */,\n    firstWeekContainsDate: 4,\n  },\n};\n\n// Fallback for modularized imports:\nexport default da;\n", "import { buildFormatLongFn } from \"../../_lib/buildFormatLongFn.js\";\n\nconst dateFormats = {\n  full: \"EEEE, d MMMM yyyy\",\n  long: \"d MMMM yyyy\",\n  medium: \"d MMM yyyy\",\n  short: \"dd/MM/yyyy\",\n};\n\nconst timeFormats = {\n  full: \"HH:mm:ss zzzz\",\n  long: \"HH:mm:ss z\",\n  medium: \"HH:mm:ss\",\n  short: \"HH:mm\",\n};\n\nconst dateTimeFormats = {\n  full: \"{{date}} 'at' {{time}}\",\n  long: \"{{date}} 'at' {{time}}\",\n  medium: \"{{date}}, {{time}}\",\n  short: \"{{date}}, {{time}}\",\n};\n\nexport const formatLong = {\n  date: buildFormatLongFn({\n    formats: dateFormats,\n    defaultWidth: \"full\",\n  }),\n\n  time: buildFormatLongFn({\n    formats: timeFormats,\n    defaultWidth: \"full\",\n  }),\n\n  dateTime: buildFormatLongFn({\n    formats: dateTimeFormats,\n    defaultWidth: \"full\",\n  }),\n};\n", "import { formatDistance } from \"./en-US/_lib/formatDistance.js\";\nimport { formatRelative } from \"./en-US/_lib/formatRelative.js\";\nimport { localize } from \"./en-US/_lib/localize.js\";\nimport { match } from \"./en-US/_lib/match.js\";\n\nimport { formatLong } from \"./en-GB/_lib/formatLong.js\";\n\n/**\n * @category Locales\n * @summary English locale (United Kingdom).\n * @language English\n * @iso-639-2 eng\n * @author Alex [@glintik](https://github.com/glintik)\n */\nexport const enGB = {\n  code: \"en-GB\",\n  formatDistance: formatDistance,\n  formatLong: formatLong,\n  formatRelative: formatRelative,\n  localize: localize,\n  match: match,\n  options: {\n    weekStartsOn: 1 /* Monday */,\n    firstWeekContainsDate: 4,\n  },\n};\n\n// Fallback for modularized imports:\nexport default enGB;\n", "function futureSeconds(text) {\n  return text.replace(/sekuntia?/, \"sekunnin\");\n}\n\nfunction futureMinutes(text) {\n  return text.replace(/minuuttia?/, \"minuutin\");\n}\n\nfunction futureHours(text) {\n  return text.replace(/tuntia?/, \"tunnin\");\n}\n\nfunction futureDays(text) {\n  return text.replace(/p\u00E4iv\u00E4\u00E4?/, \"p\u00E4iv\u00E4n\");\n}\n\nfunction futureWeeks(text) {\n  return text.replace(/(viikko|viikkoa)/, \"viikon\");\n}\n\nfunction futureMonths(text) {\n  return text.replace(/(kuukausi|kuukautta)/, \"kuukauden\");\n}\n\nfunction futureYears(text) {\n  return text.replace(/(vuosi|vuotta)/, \"vuoden\");\n}\n\nconst formatDistanceLocale = {\n  lessThanXSeconds: {\n    one: \"alle sekunti\",\n    other: \"alle {{count}} sekuntia\",\n    futureTense: futureSeconds,\n  },\n\n  xSeconds: {\n    one: \"sekunti\",\n    other: \"{{count}} sekuntia\",\n    futureTense: futureSeconds,\n  },\n\n  halfAMinute: {\n    one: \"puoli minuuttia\",\n    other: \"puoli minuuttia\",\n    futureTense: (_text) => \"puolen minuutin\",\n  },\n\n  lessThanXMinutes: {\n    one: \"alle minuutti\",\n    other: \"alle {{count}} minuuttia\",\n    futureTense: futureMinutes,\n  },\n\n  xMinutes: {\n    one: \"minuutti\",\n    other: \"{{count}} minuuttia\",\n    futureTense: futureMinutes,\n  },\n\n  aboutXHours: {\n    one: \"noin tunti\",\n    other: \"noin {{count}} tuntia\",\n    futureTense: futureHours,\n  },\n\n  xHours: {\n    one: \"tunti\",\n    other: \"{{count}} tuntia\",\n    futureTense: futureHours,\n  },\n\n  xDays: {\n    one: \"p\u00E4iv\u00E4\",\n    other: \"{{count}} p\u00E4iv\u00E4\u00E4\",\n    futureTense: futureDays,\n  },\n\n  aboutXWeeks: {\n    one: \"noin viikko\",\n    other: \"noin {{count}} viikkoa\",\n    futureTense: futureWeeks,\n  },\n\n  xWeeks: {\n    one: \"viikko\",\n    other: \"{{count}} viikkoa\",\n    futureTense: futureWeeks,\n  },\n\n  aboutXMonths: {\n    one: \"noin kuukausi\",\n    other: \"noin {{count}} kuukautta\",\n    futureTense: futureMonths,\n  },\n\n  xMonths: {\n    one: \"kuukausi\",\n    other: \"{{count}} kuukautta\",\n    futureTense: futureMonths,\n  },\n\n  aboutXYears: {\n    one: \"noin vuosi\",\n    other: \"noin {{count}} vuotta\",\n    futureTense: futureYears,\n  },\n\n  xYears: {\n    one: \"vuosi\",\n    other: \"{{count}} vuotta\",\n    futureTense: futureYears,\n  },\n\n  overXYears: {\n    one: \"yli vuosi\",\n    other: \"yli {{count}} vuotta\",\n    futureTense: futureYears,\n  },\n\n  almostXYears: {\n    one: \"l\u00E4hes vuosi\",\n    other: \"l\u00E4hes {{count}} vuotta\",\n    futureTense: futureYears,\n  },\n};\n\nexport const formatDistance = (token, count, options) => {\n  const tokenValue = formatDistanceLocale[token];\n  const result =\n    count === 1\n      ? tokenValue.one\n      : tokenValue.other.replace(\"{{count}}\", String(count));\n\n  if (options?.addSuffix) {\n    if (options.comparison && options.comparison > 0) {\n      return tokenValue.futureTense(result) + \" kuluttua\";\n    } else {\n      return result + \" sitten\";\n    }\n  }\n\n  return result;\n};\n", "import { buildFormatLongFn } from \"../../_lib/buildFormatLongFn.js\";\n\nconst dateFormats = {\n  full: \"eeee d. MMMM y\",\n  long: \"d. MMMM y\",\n  medium: \"d. MMM y\",\n  short: \"d.M.y\",\n};\n\nconst timeFormats = {\n  full: \"HH.mm.ss zzzz\",\n  long: \"HH.mm.ss z\",\n  medium: \"HH.mm.ss\",\n  short: \"HH.mm\",\n};\n\nconst dateTimeFormats = {\n  full: \"{{date}} 'klo' {{time}}\",\n  long: \"{{date}} 'klo' {{time}}\",\n  medium: \"{{date}} {{time}}\",\n  short: \"{{date}} {{time}}\",\n};\n\nexport const formatLong = {\n  date: buildFormatLongFn({\n    formats: dateFormats,\n    defaultWidth: \"full\",\n  }),\n\n  time: buildFormatLongFn({\n    formats: timeFormats,\n    defaultWidth: \"full\",\n  }),\n\n  dateTime: buildFormatLongFn({\n    formats: dateTimeFormats,\n    defaultWidth: \"full\",\n  }),\n};\n", "const formatRelativeLocale = {\n  lastWeek: \"'viime' eeee 'klo' p\",\n  yesterday: \"'eilen klo' p\",\n  today: \"'t\u00E4n\u00E4\u00E4n klo' p\",\n  tomorrow: \"'huomenna klo' p\",\n  nextWeek: \"'ensi' eeee 'klo' p\",\n  other: \"P\",\n};\n\nexport const formatRelative = (token, _date, _baseDate, _options) =>\n  formatRelativeLocale[token];\n", "import { buildLocalizeFn } from \"../../_lib/buildLocalizeFn.js\";\n\nconst eraValues = {\n  narrow: [\"eaa.\", \"jaa.\"],\n  abbreviated: [\"eaa.\", \"jaa.\"],\n  wide: [\"ennen ajanlaskun alkua\", \"j\u00E4lkeen ajanlaskun alun\"],\n};\n\nconst quarterValues = {\n  narrow: [\"1\", \"2\", \"3\", \"4\"],\n  abbreviated: [\"Q1\", \"Q2\", \"Q3\", \"Q4\"],\n  wide: [\"1. kvartaali\", \"2. kvartaali\", \"3. kvartaali\", \"4. kvartaali\"],\n};\n\nconst monthValues = {\n  narrow: [\"T\", \"H\", \"M\", \"H\", \"T\", \"K\", \"H\", \"E\", \"S\", \"L\", \"M\", \"J\"],\n  abbreviated: [\n    \"tammi\",\n    \"helmi\",\n    \"maalis\",\n    \"huhti\",\n    \"touko\",\n    \"kes\u00E4\",\n    \"hein\u00E4\",\n    \"elo\",\n    \"syys\",\n    \"loka\",\n    \"marras\",\n    \"joulu\",\n  ],\n\n  wide: [\n    \"tammikuu\",\n    \"helmikuu\",\n    \"maaliskuu\",\n    \"huhtikuu\",\n    \"toukokuu\",\n    \"kes\u00E4kuu\",\n    \"hein\u00E4kuu\",\n    \"elokuu\",\n    \"syyskuu\",\n    \"lokakuu\",\n    \"marraskuu\",\n    \"joulukuu\",\n  ],\n};\n\nconst formattingMonthValues = {\n  narrow: monthValues.narrow,\n  abbreviated: monthValues.abbreviated,\n  wide: [\n    \"tammikuuta\",\n    \"helmikuuta\",\n    \"maaliskuuta\",\n    \"huhtikuuta\",\n    \"toukokuuta\",\n    \"kes\u00E4kuuta\",\n    \"hein\u00E4kuuta\",\n    \"elokuuta\",\n    \"syyskuuta\",\n    \"lokakuuta\",\n    \"marraskuuta\",\n    \"joulukuuta\",\n  ],\n};\n\nconst dayValues = {\n  narrow: [\"S\", \"M\", \"T\", \"K\", \"T\", \"P\", \"L\"],\n  short: [\"su\", \"ma\", \"ti\", \"ke\", \"to\", \"pe\", \"la\"],\n  abbreviated: [\"sunn.\", \"maan.\", \"tiis.\", \"kesk.\", \"torst.\", \"perj.\", \"la\"],\n\n  wide: [\n    \"sunnuntai\",\n    \"maanantai\",\n    \"tiistai\",\n    \"keskiviikko\",\n    \"torstai\",\n    \"perjantai\",\n    \"lauantai\",\n  ],\n};\n\nconst formattingDayValues = {\n  narrow: dayValues.narrow,\n  short: dayValues.short,\n  abbreviated: dayValues.abbreviated,\n  wide: [\n    \"sunnuntaina\",\n    \"maanantaina\",\n    \"tiistaina\",\n    \"keskiviikkona\",\n    \"torstaina\",\n    \"perjantaina\",\n    \"lauantaina\",\n  ],\n};\n\nconst dayPeriodValues = {\n  narrow: {\n    am: \"ap\",\n    pm: \"ip\",\n    midnight: \"keskiy\u00F6\",\n    noon: \"keskip\u00E4iv\u00E4\",\n    morning: \"ap\",\n    afternoon: \"ip\",\n    evening: \"illalla\",\n    night: \"y\u00F6ll\u00E4\",\n  },\n  abbreviated: {\n    am: \"ap\",\n    pm: \"ip\",\n    midnight: \"keskiy\u00F6\",\n    noon: \"keskip\u00E4iv\u00E4\",\n    morning: \"ap\",\n    afternoon: \"ip\",\n    evening: \"illalla\",\n    night: \"y\u00F6ll\u00E4\",\n  },\n  wide: {\n    am: \"ap\",\n    pm: \"ip\",\n    midnight: \"keskiy\u00F6ll\u00E4\",\n    noon: \"keskip\u00E4iv\u00E4ll\u00E4\",\n    morning: \"aamup\u00E4iv\u00E4ll\u00E4\",\n    afternoon: \"iltap\u00E4iv\u00E4ll\u00E4\",\n    evening: \"illalla\",\n    night: \"y\u00F6ll\u00E4\",\n  },\n};\n\nconst ordinalNumber = (dirtyNumber, _options) => {\n  const number = Number(dirtyNumber);\n  return number + \".\";\n};\n\nexport const localize = {\n  ordinalNumber,\n\n  era: buildLocalizeFn({\n    values: eraValues,\n    defaultWidth: \"wide\",\n  }),\n\n  quarter: buildLocalizeFn({\n    values: quarterValues,\n    defaultWidth: \"wide\",\n    argumentCallback: (quarter) => quarter - 1,\n  }),\n\n  month: buildLocalizeFn({\n    values: monthValues,\n    defaultWidth: \"wide\",\n    formattingValues: formattingMonthValues,\n    defaultFormattingWidth: \"wide\",\n  }),\n\n  day: buildLocalizeFn({\n    values: dayValues,\n    defaultWidth: \"wide\",\n    formattingValues: formattingDayValues,\n    defaultFormattingWidth: \"wide\",\n  }),\n\n  dayPeriod: buildLocalizeFn({\n    values: dayPeriodValues,\n    defaultWidth: \"wide\",\n  }),\n};\n", "import { buildMatchFn } from \"../../_lib/buildMatchFn.js\";\nimport { buildMatchPatternFn } from \"../../_lib/buildMatchPatternFn.js\";\n\nconst matchOrdinalNumberPattern = /^(\\d+)(\\.)/i;\nconst parseOrdinalNumberPattern = /\\d+/i;\n\nconst matchEraPatterns = {\n  narrow: /^(e|j)/i,\n  abbreviated: /^(eaa.|jaa.)/i,\n  wide: /^(ennen ajanlaskun alkua|j\u00E4lkeen ajanlaskun alun)/i,\n};\nconst parseEraPatterns = {\n  any: [/^e/i, /^j/i],\n};\n\nconst matchQuarterPatterns = {\n  narrow: /^[1234]/i,\n  abbreviated: /^q[1234]/i,\n  wide: /^[1234]\\.? kvartaali/i,\n};\nconst parseQuarterPatterns = {\n  any: [/1/i, /2/i, /3/i, /4/i],\n};\n\nconst matchMonthPatterns = {\n  narrow: /^[thmkeslj]/i,\n  abbreviated:\n    /^(tammi|helmi|maalis|huhti|touko|kes\u00E4|hein\u00E4|elo|syys|loka|marras|joulu)/i,\n  wide: /^(tammikuu|helmikuu|maaliskuu|huhtikuu|toukokuu|kes\u00E4kuu|hein\u00E4kuu|elokuu|syyskuu|lokakuu|marraskuu|joulukuu)(ta)?/i,\n};\nconst parseMonthPatterns = {\n  narrow: [\n    /^t/i,\n    /^h/i,\n    /^m/i,\n    /^h/i,\n    /^t/i,\n    /^k/i,\n    /^h/i,\n    /^e/i,\n    /^s/i,\n    /^l/i,\n    /^m/i,\n    /^j/i,\n  ],\n\n  any: [\n    /^ta/i,\n    /^hel/i,\n    /^maa/i,\n    /^hu/i,\n    /^to/i,\n    /^k/i,\n    /^hei/i,\n    /^e/i,\n    /^s/i,\n    /^l/i,\n    /^mar/i,\n    /^j/i,\n  ],\n};\n\nconst matchDayPatterns = {\n  narrow: /^[smtkpl]/i,\n  short: /^(su|ma|ti|ke|to|pe|la)/i,\n  abbreviated: /^(sunn.|maan.|tiis.|kesk.|torst.|perj.|la)/i,\n  wide: /^(sunnuntai|maanantai|tiistai|keskiviikko|torstai|perjantai|lauantai)(na)?/i,\n};\nconst parseDayPatterns = {\n  narrow: [/^s/i, /^m/i, /^t/i, /^k/i, /^t/i, /^p/i, /^l/i],\n  any: [/^s/i, /^m/i, /^ti/i, /^k/i, /^to/i, /^p/i, /^l/i],\n};\n\nconst matchDayPeriodPatterns = {\n  narrow:\n    /^(ap|ip|keskiy\u00F6|keskip\u00E4iv\u00E4|aamup\u00E4iv\u00E4ll\u00E4|iltap\u00E4iv\u00E4ll\u00E4|illalla|y\u00F6ll\u00E4)/i,\n  any: /^(ap|ip|keskiy\u00F6ll\u00E4|keskip\u00E4iv\u00E4ll\u00E4|aamup\u00E4iv\u00E4ll\u00E4|iltap\u00E4iv\u00E4ll\u00E4|illalla|y\u00F6ll\u00E4)/i,\n};\nconst parseDayPeriodPatterns = {\n  any: {\n    am: /^ap/i,\n    pm: /^ip/i,\n    midnight: /^keskiy\u00F6/i,\n    noon: /^keskip\u00E4iv\u00E4/i,\n    morning: /aamup\u00E4iv\u00E4ll\u00E4/i,\n    afternoon: /iltap\u00E4iv\u00E4ll\u00E4/i,\n    evening: /illalla/i,\n    night: /y\u00F6ll\u00E4/i,\n  },\n};\n\nexport const match = {\n  ordinalNumber: buildMatchPatternFn({\n    matchPattern: matchOrdinalNumberPattern,\n    parsePattern: parseOrdinalNumberPattern,\n    valueCallback: (value) => parseInt(value, 10),\n  }),\n\n  era: buildMatchFn({\n    matchPatterns: matchEraPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseEraPatterns,\n    defaultParseWidth: \"any\",\n  }),\n\n  quarter: buildMatchFn({\n    matchPatterns: matchQuarterPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseQuarterPatterns,\n    defaultParseWidth: \"any\",\n    valueCallback: (index) => index + 1,\n  }),\n\n  month: buildMatchFn({\n    matchPatterns: matchMonthPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseMonthPatterns,\n    defaultParseWidth: \"any\",\n  }),\n\n  day: buildMatchFn({\n    matchPatterns: matchDayPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseDayPatterns,\n    defaultParseWidth: \"any\",\n  }),\n\n  dayPeriod: buildMatchFn({\n    matchPatterns: matchDayPeriodPatterns,\n    defaultMatchWidth: \"any\",\n    parsePatterns: parseDayPeriodPatterns,\n    defaultParseWidth: \"any\",\n  }),\n};\n", "import { formatDistance } from \"./fi/_lib/formatDistance.js\";\nimport { formatLong } from \"./fi/_lib/formatLong.js\";\nimport { formatRelative } from \"./fi/_lib/formatRelative.js\";\nimport { localize } from \"./fi/_lib/localize.js\";\nimport { match } from \"./fi/_lib/match.js\";\n\n/**\n * @category Locales\n * @summary Finnish locale.\n * @language Finnish\n * @iso-639-2 fin\n * @author Pyry-Samuli Lahti [@Pyppe](https://github.com/Pyppe)\n * @author Edo Rivai [@mikolajgrzyb](https://github.com/mikolajgrzyb)\n * @author Samu Juvonen [@sjuvonen](https://github.com/sjuvonen)\n */\nexport const fi = {\n  code: \"fi\",\n  formatDistance: formatDistance,\n  formatLong: formatLong,\n  formatRelative: formatRelative,\n  localize: localize,\n  match: match,\n  options: {\n    weekStartsOn: 1 /* Monday */,\n    firstWeekContainsDate: 4,\n  },\n};\n\n// Fallback for modularized imports:\nexport default fi;\n", "const formatDistanceLocale = {\n  lessThanXSeconds: {\n    one: \"mindre enn ett sekund\",\n    other: \"mindre enn {{count}} sekunder\",\n  },\n\n  xSeconds: {\n    one: \"ett sekund\",\n    other: \"{{count}} sekunder\",\n  },\n\n  halfAMinute: \"et halvt minutt\",\n\n  lessThanXMinutes: {\n    one: \"mindre enn ett minutt\",\n    other: \"mindre enn {{count}} minutter\",\n  },\n\n  xMinutes: {\n    one: \"ett minutt\",\n    other: \"{{count}} minutter\",\n  },\n\n  aboutXHours: {\n    one: \"omtrent en time\",\n    other: \"omtrent {{count}} timer\",\n  },\n\n  xHours: {\n    one: \"en time\",\n    other: \"{{count}} timer\",\n  },\n\n  xDays: {\n    one: \"en dag\",\n    other: \"{{count}} dager\",\n  },\n\n  aboutXWeeks: {\n    one: \"omtrent en uke\",\n    other: \"omtrent {{count}} uker\",\n  },\n\n  xWeeks: {\n    one: \"en uke\",\n    other: \"{{count}} uker\",\n  },\n\n  aboutXMonths: {\n    one: \"omtrent en m\u00E5ned\",\n    other: \"omtrent {{count}} m\u00E5neder\",\n  },\n\n  xMonths: {\n    one: \"en m\u00E5ned\",\n    other: \"{{count}} m\u00E5neder\",\n  },\n\n  aboutXYears: {\n    one: \"omtrent ett \u00E5r\",\n    other: \"omtrent {{count}} \u00E5r\",\n  },\n\n  xYears: {\n    one: \"ett \u00E5r\",\n    other: \"{{count}} \u00E5r\",\n  },\n\n  overXYears: {\n    one: \"over ett \u00E5r\",\n    other: \"over {{count}} \u00E5r\",\n  },\n\n  almostXYears: {\n    one: \"nesten ett \u00E5r\",\n    other: \"nesten {{count}} \u00E5r\",\n  },\n};\n\nexport const formatDistance = (token, count, options) => {\n  let result;\n\n  const tokenValue = formatDistanceLocale[token];\n  if (typeof tokenValue === \"string\") {\n    result = tokenValue;\n  } else if (count === 1) {\n    result = tokenValue.one;\n  } else {\n    result = tokenValue.other.replace(\"{{count}}\", String(count));\n  }\n\n  if (options?.addSuffix) {\n    if (options.comparison && options.comparison > 0) {\n      return \"om \" + result;\n    } else {\n      return result + \" siden\";\n    }\n  }\n\n  return result;\n};\n", "import { buildFormatLongFn } from \"../../_lib/buildFormatLongFn.js\";\n\nconst dateFormats = {\n  full: \"EEEE d. MMMM y\",\n  long: \"d. MMMM y\",\n  medium: \"d. MMM y\",\n  short: \"dd.MM.y\",\n};\n\nconst timeFormats = {\n  full: \"'kl'. HH:mm:ss zzzz\",\n  long: \"HH:mm:ss z\",\n  medium: \"HH:mm:ss\",\n  short: \"HH:mm\",\n};\n\nconst dateTimeFormats = {\n  full: \"{{date}} 'kl.' {{time}}\",\n  long: \"{{date}} 'kl.' {{time}}\",\n  medium: \"{{date}} {{time}}\",\n  short: \"{{date}} {{time}}\",\n};\n\nexport const formatLong = {\n  date: buildFormatLongFn({\n    formats: dateFormats,\n    defaultWidth: \"full\",\n  }),\n\n  time: buildFormatLongFn({\n    formats: timeFormats,\n    defaultWidth: \"full\",\n  }),\n\n  dateTime: buildFormatLongFn({\n    formats: dateTimeFormats,\n    defaultWidth: \"full\",\n  }),\n};\n", "const formatRelativeLocale = {\n  lastWeek: \"'forrige' eeee 'kl.' p\",\n  yesterday: \"'i g\u00E5r kl.' p\",\n  today: \"'i dag kl.' p\",\n  tomorrow: \"'i morgen kl.' p\",\n  nextWeek: \"EEEE 'kl.' p\",\n  other: \"P\",\n};\n\nexport const formatRelative = (token, _date, _baseDate, _options) =>\n  formatRelativeLocale[token];\n", "import { buildLocalizeFn } from \"../../_lib/buildLocalizeFn.js\";\n\nconst eraValues = {\n  narrow: [\"f.Kr.\", \"e.Kr.\"],\n  abbreviated: [\"f.Kr.\", \"e.Kr.\"],\n  wide: [\"f\u00F8r Kristus\", \"etter Kristus\"],\n};\n\nconst quarterValues = {\n  narrow: [\"1\", \"2\", \"3\", \"4\"],\n  abbreviated: [\"Q1\", \"Q2\", \"Q3\", \"Q4\"],\n  wide: [\"1. kvartal\", \"2. kvartal\", \"3. kvartal\", \"4. kvartal\"],\n};\n\nconst monthValues = {\n  narrow: [\"J\", \"F\", \"M\", \"A\", \"M\", \"J\", \"J\", \"A\", \"S\", \"O\", \"N\", \"D\"],\n  abbreviated: [\n    \"jan.\",\n    \"feb.\",\n    \"mars\",\n    \"apr.\",\n    \"mai\",\n    \"juni\",\n    \"juli\",\n    \"aug.\",\n    \"sep.\",\n    \"okt.\",\n    \"nov.\",\n    \"des.\",\n  ],\n\n  wide: [\n    \"januar\",\n    \"februar\",\n    \"mars\",\n    \"april\",\n    \"mai\",\n    \"juni\",\n    \"juli\",\n    \"august\",\n    \"september\",\n    \"oktober\",\n    \"november\",\n    \"desember\",\n  ],\n};\n\nconst dayValues = {\n  narrow: [\"S\", \"M\", \"T\", \"O\", \"T\", \"F\", \"L\"],\n  short: [\"s\u00F8\", \"ma\", \"ti\", \"on\", \"to\", \"fr\", \"l\u00F8\"],\n  abbreviated: [\"s\u00F8n\", \"man\", \"tir\", \"ons\", \"tor\", \"fre\", \"l\u00F8r\"],\n  wide: [\n    \"s\u00F8ndag\",\n    \"mandag\",\n    \"tirsdag\",\n    \"onsdag\",\n    \"torsdag\",\n    \"fredag\",\n    \"l\u00F8rdag\",\n  ],\n};\n\nconst dayPeriodValues = {\n  narrow: {\n    am: \"a\",\n    pm: \"p\",\n    midnight: \"midnatt\",\n    noon: \"middag\",\n    morning: \"p\u00E5 morg.\",\n    afternoon: \"p\u00E5 etterm.\",\n    evening: \"p\u00E5 kvelden\",\n    night: \"p\u00E5 natten\",\n  },\n  abbreviated: {\n    am: \"a.m.\",\n    pm: \"p.m.\",\n    midnight: \"midnatt\",\n    noon: \"middag\",\n    morning: \"p\u00E5 morg.\",\n    afternoon: \"p\u00E5 etterm.\",\n    evening: \"p\u00E5 kvelden\",\n    night: \"p\u00E5 natten\",\n  },\n  wide: {\n    am: \"a.m.\",\n    pm: \"p.m.\",\n    midnight: \"midnatt\",\n    noon: \"middag\",\n    morning: \"p\u00E5 morgenen\",\n    afternoon: \"p\u00E5 ettermiddagen\",\n    evening: \"p\u00E5 kvelden\",\n    night: \"p\u00E5 natten\",\n  },\n};\n\nconst ordinalNumber = (dirtyNumber, _options) => {\n  const number = Number(dirtyNumber);\n  return number + \".\";\n};\n\nexport const localize = {\n  ordinalNumber,\n\n  era: buildLocalizeFn({\n    values: eraValues,\n    defaultWidth: \"wide\",\n  }),\n\n  quarter: buildLocalizeFn({\n    values: quarterValues,\n    defaultWidth: \"wide\",\n    argumentCallback: (quarter) => quarter - 1,\n  }),\n\n  month: buildLocalizeFn({\n    values: monthValues,\n    defaultWidth: \"wide\",\n  }),\n\n  day: buildLocalizeFn({\n    values: dayValues,\n    defaultWidth: \"wide\",\n  }),\n\n  dayPeriod: buildLocalizeFn({\n    values: dayPeriodValues,\n    defaultWidth: \"wide\",\n  }),\n};\n", "import { buildMatchFn } from \"../../_lib/buildMatchFn.js\";\nimport { buildMatchPatternFn } from \"../../_lib/buildMatchPatternFn.js\";\n\nconst matchOrdinalNumberPattern = /^(\\d+)\\.?/i;\nconst parseOrdinalNumberPattern = /\\d+/i;\n\nconst matchEraPatterns = {\n  narrow: /^(f\\.? ?Kr\\.?|fvt\\.?|e\\.? ?Kr\\.?|evt\\.?)/i,\n  abbreviated: /^(f\\.? ?Kr\\.?|fvt\\.?|e\\.? ?Kr\\.?|evt\\.?)/i,\n  wide: /^(f\u00F8r Kristus|f\u00F8r v\u00E5r tid|etter Kristus|v\u00E5r tid)/i,\n};\nconst parseEraPatterns = {\n  any: [/^f/i, /^e/i],\n};\n\nconst matchQuarterPatterns = {\n  narrow: /^[1234]/i,\n  abbreviated: /^q[1234]/i,\n  wide: /^[1234](\\.)? kvartal/i,\n};\nconst parseQuarterPatterns = {\n  any: [/1/i, /2/i, /3/i, /4/i],\n};\n\nconst matchMonthPatterns = {\n  narrow: /^[jfmasond]/i,\n  abbreviated: /^(jan|feb|mars?|apr|mai|juni?|juli?|aug|sep|okt|nov|des)\\.?/i,\n  wide: /^(januar|februar|mars|april|mai|juni|juli|august|september|oktober|november|desember)/i,\n};\nconst parseMonthPatterns = {\n  narrow: [\n    /^j/i,\n    /^f/i,\n    /^m/i,\n    /^a/i,\n    /^m/i,\n    /^j/i,\n    /^j/i,\n    /^a/i,\n    /^s/i,\n    /^o/i,\n    /^n/i,\n    /^d/i,\n  ],\n\n  any: [\n    /^ja/i,\n    /^f/i,\n    /^mar/i,\n    /^ap/i,\n    /^mai/i,\n    /^jun/i,\n    /^jul/i,\n    /^aug/i,\n    /^s/i,\n    /^o/i,\n    /^n/i,\n    /^d/i,\n  ],\n};\n\nconst matchDayPatterns = {\n  narrow: /^[smtofl]/i,\n  short: /^(s\u00F8|ma|ti|on|to|fr|l\u00F8)/i,\n  abbreviated: /^(s\u00F8n|man|tir|ons|tor|fre|l\u00F8r)/i,\n  wide: /^(s\u00F8ndag|mandag|tirsdag|onsdag|torsdag|fredag|l\u00F8rdag)/i,\n};\nconst parseDayPatterns = {\n  any: [/^s/i, /^m/i, /^ti/i, /^o/i, /^to/i, /^f/i, /^l/i],\n};\n\nconst matchDayPeriodPatterns = {\n  narrow:\n    /^(midnatt|middag|(p\u00E5) (morgenen|ettermiddagen|kvelden|natten)|[ap])/i,\n  any: /^([ap]\\.?\\s?m\\.?|midnatt|middag|(p\u00E5) (morgenen|ettermiddagen|kvelden|natten))/i,\n};\nconst parseDayPeriodPatterns = {\n  any: {\n    am: /^a(\\.?\\s?m\\.?)?$/i,\n    pm: /^p(\\.?\\s?m\\.?)?$/i,\n    midnight: /^midn/i,\n    noon: /^midd/i,\n    morning: /morgen/i,\n    afternoon: /ettermiddag/i,\n    evening: /kveld/i,\n    night: /natt/i,\n  },\n};\n\nexport const match = {\n  ordinalNumber: buildMatchPatternFn({\n    matchPattern: matchOrdinalNumberPattern,\n    parsePattern: parseOrdinalNumberPattern,\n    valueCallback: (value) => parseInt(value, 10),\n  }),\n\n  era: buildMatchFn({\n    matchPatterns: matchEraPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseEraPatterns,\n    defaultParseWidth: \"any\",\n  }),\n\n  quarter: buildMatchFn({\n    matchPatterns: matchQuarterPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseQuarterPatterns,\n    defaultParseWidth: \"any\",\n    valueCallback: (index) => index + 1,\n  }),\n\n  month: buildMatchFn({\n    matchPatterns: matchMonthPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseMonthPatterns,\n    defaultParseWidth: \"any\",\n  }),\n\n  day: buildMatchFn({\n    matchPatterns: matchDayPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseDayPatterns,\n    defaultParseWidth: \"any\",\n  }),\n\n  dayPeriod: buildMatchFn({\n    matchPatterns: matchDayPeriodPatterns,\n    defaultMatchWidth: \"any\",\n    parsePatterns: parseDayPeriodPatterns,\n    defaultParseWidth: \"any\",\n  }),\n};\n", "import { formatDistance } from \"./nb/_lib/formatDistance.js\";\nimport { formatLong } from \"./nb/_lib/formatLong.js\";\nimport { formatRelative } from \"./nb/_lib/formatRelative.js\";\nimport { localize } from \"./nb/_lib/localize.js\";\nimport { match } from \"./nb/_lib/match.js\";\n\n/**\n * @category Locales\n * @summary Norwegian Bokm\u00E5l locale.\n * @language Norwegian Bokm\u00E5l\n * @iso-639-2 nob\n * @author Hans-Kristian Koren [@Hanse](https://github.com/Hanse)\n * @author Mikolaj Grzyb [@mikolajgrzyb](https://github.com/mikolajgrzyb)\n * @author Dag Stuan [@dagstuan](https://github.com/dagstuan)\n */\nexport const nb = {\n  code: \"nb\",\n  formatDistance: formatDistance,\n  formatLong: formatLong,\n  formatRelative: formatRelative,\n  localize: localize,\n  match: match,\n  options: {\n    weekStartsOn: 1 /* Monday */,\n    firstWeekContainsDate: 4,\n  },\n};\n\n// Fallback for modularized imports:\nexport default nb;\n", "const formatDistanceLocale = {\n  lessThanXSeconds: {\n    one: \"mindre \u00E4n en sekund\",\n    other: \"mindre \u00E4n {{count}} sekunder\",\n  },\n\n  xSeconds: {\n    one: \"en sekund\",\n    other: \"{{count}} sekunder\",\n  },\n\n  halfAMinute: \"en halv minut\",\n\n  lessThanXMinutes: {\n    one: \"mindre \u00E4n en minut\",\n    other: \"mindre \u00E4n {{count}} minuter\",\n  },\n\n  xMinutes: {\n    one: \"en minut\",\n    other: \"{{count}} minuter\",\n  },\n\n  aboutXHours: {\n    one: \"ungef\u00E4r en timme\",\n    other: \"ungef\u00E4r {{count}} timmar\",\n  },\n\n  xHours: {\n    one: \"en timme\",\n    other: \"{{count}} timmar\",\n  },\n\n  xDays: {\n    one: \"en dag\",\n    other: \"{{count}} dagar\",\n  },\n\n  aboutXWeeks: {\n    one: \"ungef\u00E4r en vecka\",\n    other: \"ungef\u00E4r {{count}} veckor\",\n  },\n\n  xWeeks: {\n    one: \"en vecka\",\n    other: \"{{count}} veckor\",\n  },\n\n  aboutXMonths: {\n    one: \"ungef\u00E4r en m\u00E5nad\",\n    other: \"ungef\u00E4r {{count}} m\u00E5nader\",\n  },\n\n  xMonths: {\n    one: \"en m\u00E5nad\",\n    other: \"{{count}} m\u00E5nader\",\n  },\n\n  aboutXYears: {\n    one: \"ungef\u00E4r ett \u00E5r\",\n    other: \"ungef\u00E4r {{count}} \u00E5r\",\n  },\n\n  xYears: {\n    one: \"ett \u00E5r\",\n    other: \"{{count}} \u00E5r\",\n  },\n\n  overXYears: {\n    one: \"\u00F6ver ett \u00E5r\",\n    other: \"\u00F6ver {{count}} \u00E5r\",\n  },\n\n  almostXYears: {\n    one: \"n\u00E4stan ett \u00E5r\",\n    other: \"n\u00E4stan {{count}} \u00E5r\",\n  },\n};\n\nconst wordMapping = [\n  \"noll\",\n  \"en\",\n  \"tv\u00E5\",\n  \"tre\",\n  \"fyra\",\n  \"fem\",\n  \"sex\",\n  \"sju\",\n  \"\u00E5tta\",\n  \"nio\",\n  \"tio\",\n  \"elva\",\n  \"tolv\",\n];\n\nexport const formatDistance = (token, count, options) => {\n  let result;\n\n  const tokenValue = formatDistanceLocale[token];\n  if (typeof tokenValue === \"string\") {\n    result = tokenValue;\n  } else if (count === 1) {\n    result = tokenValue.one;\n  } else {\n    result = tokenValue.other.replace(\n      \"{{count}}\",\n      count < 13 ? wordMapping[count] : String(count),\n    );\n  }\n\n  if (options?.addSuffix) {\n    if (options.comparison && options.comparison > 0) {\n      return \"om \" + result;\n    } else {\n      return result + \" sedan\";\n    }\n  }\n\n  return result;\n};\n", "import { buildFormatLongFn } from \"../../_lib/buildFormatLongFn.js\";\n\nconst dateFormats = {\n  full: \"EEEE d MMMM y\",\n  long: \"d MMMM y\",\n  medium: \"d MMM y\",\n  short: \"y-MM-dd\",\n};\n\nconst timeFormats = {\n  full: \"'kl'. HH:mm:ss zzzz\",\n  long: \"HH:mm:ss z\",\n  medium: \"HH:mm:ss\",\n  short: \"HH:mm\",\n};\n\nconst dateTimeFormats = {\n  full: \"{{date}} 'kl.' {{time}}\",\n  long: \"{{date}} 'kl.' {{time}}\",\n  medium: \"{{date}} {{time}}\",\n  short: \"{{date}} {{time}}\",\n};\n\nexport const formatLong = {\n  date: buildFormatLongFn({\n    formats: dateFormats,\n    defaultWidth: \"full\",\n  }),\n\n  time: buildFormatLongFn({\n    formats: timeFormats,\n    defaultWidth: \"full\",\n  }),\n\n  dateTime: buildFormatLongFn({\n    formats: dateTimeFormats,\n    defaultWidth: \"full\",\n  }),\n};\n", "const formatRelativeLocale = {\n  lastWeek: \"'i' EEEE's kl.' p\",\n  yesterday: \"'ig\u00E5r kl.' p\",\n  today: \"'idag kl.' p\",\n  tomorrow: \"'imorgon kl.' p\",\n  nextWeek: \"EEEE 'kl.' p\",\n  other: \"P\",\n};\n\nexport const formatRelative = (token, _date, _baseDate, _options) =>\n  formatRelativeLocale[token];\n", "import { buildLocalizeFn } from \"../../_lib/buildLocalizeFn.js\";\n\nconst eraValues = {\n  narrow: [\"f.Kr.\", \"e.Kr.\"],\n  abbreviated: [\"f.Kr.\", \"e.Kr.\"],\n  wide: [\"f\u00F6re Kristus\", \"efter Kristus\"],\n};\n\nconst quarterValues = {\n  narrow: [\"1\", \"2\", \"3\", \"4\"],\n  abbreviated: [\"Q1\", \"Q2\", \"Q3\", \"Q4\"],\n  wide: [\"1:a kvartalet\", \"2:a kvartalet\", \"3:e kvartalet\", \"4:e kvartalet\"],\n};\n\nconst monthValues = {\n  narrow: [\"J\", \"F\", \"M\", \"A\", \"M\", \"J\", \"J\", \"A\", \"S\", \"O\", \"N\", \"D\"],\n  abbreviated: [\n    \"jan.\",\n    \"feb.\",\n    \"mars\",\n    \"apr.\",\n    \"maj\",\n    \"juni\",\n    \"juli\",\n    \"aug.\",\n    \"sep.\",\n    \"okt.\",\n    \"nov.\",\n    \"dec.\",\n  ],\n\n  wide: [\n    \"januari\",\n    \"februari\",\n    \"mars\",\n    \"april\",\n    \"maj\",\n    \"juni\",\n    \"juli\",\n    \"augusti\",\n    \"september\",\n    \"oktober\",\n    \"november\",\n    \"december\",\n  ],\n};\n\nconst dayValues = {\n  narrow: [\"S\", \"M\", \"T\", \"O\", \"T\", \"F\", \"L\"],\n  short: [\"s\u00F6\", \"m\u00E5\", \"ti\", \"on\", \"to\", \"fr\", \"l\u00F6\"],\n  abbreviated: [\"s\u00F6n\", \"m\u00E5n\", \"tis\", \"ons\", \"tors\", \"fre\", \"l\u00F6r\"],\n  wide: [\"s\u00F6ndag\", \"m\u00E5ndag\", \"tisdag\", \"onsdag\", \"torsdag\", \"fredag\", \"l\u00F6rdag\"],\n};\n\n// https://www.unicode.org/cldr/charts/32/summary/sv.html#1888\nconst dayPeriodValues = {\n  narrow: {\n    am: \"fm\",\n    pm: \"em\",\n    midnight: \"midnatt\",\n    noon: \"middag\",\n    morning: \"morg.\",\n    afternoon: \"efterm.\",\n    evening: \"kv\u00E4ll\",\n    night: \"natt\",\n  },\n  abbreviated: {\n    am: \"f.m.\",\n    pm: \"e.m.\",\n    midnight: \"midnatt\",\n    noon: \"middag\",\n    morning: \"morgon\",\n    afternoon: \"efterm.\",\n    evening: \"kv\u00E4ll\",\n    night: \"natt\",\n  },\n  wide: {\n    am: \"f\u00F6rmiddag\",\n    pm: \"eftermiddag\",\n    midnight: \"midnatt\",\n    noon: \"middag\",\n    morning: \"morgon\",\n    afternoon: \"eftermiddag\",\n    evening: \"kv\u00E4ll\",\n    night: \"natt\",\n  },\n};\n\nconst formattingDayPeriodValues = {\n  narrow: {\n    am: \"fm\",\n    pm: \"em\",\n    midnight: \"midnatt\",\n    noon: \"middag\",\n    morning: \"p\u00E5 morg.\",\n    afternoon: \"p\u00E5 efterm.\",\n    evening: \"p\u00E5 kv\u00E4llen\",\n    night: \"p\u00E5 natten\",\n  },\n  abbreviated: {\n    am: \"fm\",\n    pm: \"em\",\n    midnight: \"midnatt\",\n    noon: \"middag\",\n    morning: \"p\u00E5 morg.\",\n    afternoon: \"p\u00E5 efterm.\",\n    evening: \"p\u00E5 kv\u00E4llen\",\n    night: \"p\u00E5 natten\",\n  },\n  wide: {\n    am: \"fm\",\n    pm: \"em\",\n    midnight: \"midnatt\",\n    noon: \"middag\",\n    morning: \"p\u00E5 morgonen\",\n    afternoon: \"p\u00E5 eftermiddagen\",\n    evening: \"p\u00E5 kv\u00E4llen\",\n    night: \"p\u00E5 natten\",\n  },\n};\n\nconst ordinalNumber = (dirtyNumber, _options) => {\n  const number = Number(dirtyNumber);\n\n  const rem100 = number % 100;\n  if (rem100 > 20 || rem100 < 10) {\n    switch (rem100 % 10) {\n      case 1:\n      case 2:\n        return number + \":a\";\n    }\n  }\n  return number + \":e\";\n};\n\nexport const localize = {\n  ordinalNumber,\n\n  era: buildLocalizeFn({\n    values: eraValues,\n    defaultWidth: \"wide\",\n  }),\n\n  quarter: buildLocalizeFn({\n    values: quarterValues,\n    defaultWidth: \"wide\",\n    argumentCallback: (quarter) => quarter - 1,\n  }),\n\n  month: buildLocalizeFn({\n    values: monthValues,\n    defaultWidth: \"wide\",\n  }),\n\n  day: buildLocalizeFn({\n    values: dayValues,\n    defaultWidth: \"wide\",\n  }),\n\n  dayPeriod: buildLocalizeFn({\n    values: dayPeriodValues,\n    defaultWidth: \"wide\",\n    formattingValues: formattingDayPeriodValues,\n    defaultFormattingWidth: \"wide\",\n  }),\n};\n", "import { buildMatchFn } from \"../../_lib/buildMatchFn.js\";\nimport { buildMatchPatternFn } from \"../../_lib/buildMatchPatternFn.js\";\n\nconst matchOrdinalNumberPattern = /^(\\d+)(:a|:e)?/i;\nconst parseOrdinalNumberPattern = /\\d+/i;\n\nconst matchEraPatterns = {\n  narrow: /^(f\\.? ?Kr\\.?|f\\.? ?v\\.? ?t\\.?|e\\.? ?Kr\\.?|v\\.? ?t\\.?)/i,\n  abbreviated: /^(f\\.? ?Kr\\.?|f\\.? ?v\\.? ?t\\.?|e\\.? ?Kr\\.?|v\\.? ?t\\.?)/i,\n  wide: /^(f\u00F6re Kristus|f\u00F6re v\u00E5r tid|efter Kristus|v\u00E5r tid)/i,\n};\nconst parseEraPatterns = {\n  any: [/^f/i, /^[ev]/i],\n};\n\nconst matchQuarterPatterns = {\n  narrow: /^[1234]/i,\n  abbreviated: /^q[1234]/i,\n  wide: /^[1234](:a|:e)? kvartalet/i,\n};\nconst parseQuarterPatterns = {\n  any: [/1/i, /2/i, /3/i, /4/i],\n};\n\nconst matchMonthPatterns = {\n  narrow: /^[jfmasond]/i,\n  abbreviated:\n    /^(jan|feb|mar[s]?|apr|maj|jun[i]?|jul[i]?|aug|sep|okt|nov|dec)\\.?/i,\n  wide: /^(januari|februari|mars|april|maj|juni|juli|augusti|september|oktober|november|december)/i,\n};\nconst parseMonthPatterns = {\n  narrow: [\n    /^j/i,\n    /^f/i,\n    /^m/i,\n    /^a/i,\n    /^m/i,\n    /^j/i,\n    /^j/i,\n    /^a/i,\n    /^s/i,\n    /^o/i,\n    /^n/i,\n    /^d/i,\n  ],\n\n  any: [\n    /^ja/i,\n    /^f/i,\n    /^mar/i,\n    /^ap/i,\n    /^maj/i,\n    /^jun/i,\n    /^jul/i,\n    /^au/i,\n    /^s/i,\n    /^o/i,\n    /^n/i,\n    /^d/i,\n  ],\n};\n\nconst matchDayPatterns = {\n  narrow: /^[smtofl]/i,\n  short: /^(s\u00F6|m\u00E5|ti|on|to|fr|l\u00F6)/i,\n  abbreviated: /^(s\u00F6n|m\u00E5n|tis|ons|tors|fre|l\u00F6r)/i,\n  wide: /^(s\u00F6ndag|m\u00E5ndag|tisdag|onsdag|torsdag|fredag|l\u00F6rdag)/i,\n};\nconst parseDayPatterns = {\n  any: [/^s/i, /^m/i, /^ti/i, /^o/i, /^to/i, /^f/i, /^l/i],\n};\n\nconst matchDayPeriodPatterns = {\n  any: /^([fe]\\.?\\s?m\\.?|midn(att)?|midd(ag)?|(p\u00E5) (morgonen|eftermiddagen|kv\u00E4llen|natten))/i,\n};\nconst parseDayPeriodPatterns = {\n  any: {\n    am: /^f/i,\n    pm: /^e/i,\n    midnight: /^midn/i,\n    noon: /^midd/i,\n    morning: /morgon/i,\n    afternoon: /eftermiddag/i,\n    evening: /kv\u00E4ll/i,\n    night: /natt/i,\n  },\n};\n\nexport const match = {\n  ordinalNumber: buildMatchPatternFn({\n    matchPattern: matchOrdinalNumberPattern,\n    parsePattern: parseOrdinalNumberPattern,\n    valueCallback: (value) => parseInt(value, 10),\n  }),\n\n  era: buildMatchFn({\n    matchPatterns: matchEraPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseEraPatterns,\n    defaultParseWidth: \"any\",\n  }),\n\n  quarter: buildMatchFn({\n    matchPatterns: matchQuarterPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseQuarterPatterns,\n    defaultParseWidth: \"any\",\n    valueCallback: (index) => index + 1,\n  }),\n\n  month: buildMatchFn({\n    matchPatterns: matchMonthPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseMonthPatterns,\n    defaultParseWidth: \"any\",\n  }),\n\n  day: buildMatchFn({\n    matchPatterns: matchDayPatterns,\n    defaultMatchWidth: \"wide\",\n    parsePatterns: parseDayPatterns,\n    defaultParseWidth: \"any\",\n  }),\n\n  dayPeriod: buildMatchFn({\n    matchPatterns: matchDayPeriodPatterns,\n    defaultMatchWidth: \"any\",\n    parsePatterns: parseDayPeriodPatterns,\n    defaultParseWidth: \"any\",\n  }),\n};\n", "import { formatDistance } from \"./sv/_lib/formatDistance.js\";\nimport { formatLong } from \"./sv/_lib/formatLong.js\";\nimport { formatRelative } from \"./sv/_lib/formatRelative.js\";\nimport { localize } from \"./sv/_lib/localize.js\";\nimport { match } from \"./sv/_lib/match.js\";\n\n/**\n * @category Locales\n * @summary Swedish locale.\n * @language Swedish\n * @iso-639-2 swe\n * @author Johannes Ul\u00E9n [@ejulen](https://github.com/ejulen)\n * @author Alexander Nanberg [@alexandernanberg](https://github.com/alexandernanberg)\n * @author Henrik Andersson [@limelights](https://github.com/limelights)\n */\nexport const sv = {\n  code: \"sv\",\n  formatDistance: formatDistance,\n  formatLong: formatLong,\n  formatRelative: formatRelative,\n  localize: localize,\n  match: match,\n  options: {\n    weekStartsOn: 1 /* Monday */,\n    firstWeekContainsDate: 4,\n  },\n};\n\n// Fallback for modularized imports:\nexport default sv;\n", "/**\n * @license\n * Copyright 2018 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\nimport {AttributePart, noChange} from '../lit-html.js';\nimport {\n  directive,\n  Directive,\n  DirectiveParameters,\n  PartInfo,\n  PartType,\n} from '../directive.js';\n\n/**\n * A key-value set of CSS properties and values.\n *\n * The key should be either a valid CSS property name string, like\n * `'background-color'`, or a valid JavaScript camel case property name\n * for CSSStyleDeclaration like `backgroundColor`.\n */\nexport interface StyleInfo {\n  [name: string]: string | number | undefined | null;\n}\n\nconst important = 'important';\n// The leading space is important\nconst importantFlag = ' !' + important;\n// How many characters to remove from a value, as a negative number\nconst flagTrim = 0 - importantFlag.length;\n\nclass StyleMapDirective extends Directive {\n  private _previousStyleProperties?: Set<string>;\n\n  constructor(partInfo: PartInfo) {\n    super(partInfo);\n    if (\n      partInfo.type !== PartType.ATTRIBUTE ||\n      partInfo.name !== 'style' ||\n      (partInfo.strings?.length as number) > 2\n    ) {\n      throw new Error(\n        'The `styleMap` directive must be used in the `style` attribute ' +\n          'and must be the only part in the attribute.'\n      );\n    }\n  }\n\n  render(styleInfo: Readonly<StyleInfo>) {\n    return Object.keys(styleInfo).reduce((style, prop) => {\n      const value = styleInfo[prop];\n      if (value == null) {\n        return style;\n      }\n      // Convert property names from camel-case to dash-case, i.e.:\n      //  `backgroundColor` -> `background-color`\n      // Vendor-prefixed names need an extra `-` appended to front:\n      //  `webkitAppearance` -> `-webkit-appearance`\n      // Exception is any property name containing a dash, including\n      // custom properties; we assume these are already dash-cased i.e.:\n      //  `--my-button-color` --> `--my-button-color`\n      prop = prop.includes('-')\n        ? prop\n        : prop\n            .replace(/(?:^(webkit|moz|ms|o)|)(?=[A-Z])/g, '-$&')\n            .toLowerCase();\n      return style + `${prop}:${value};`;\n    }, '');\n  }\n\n  override update(part: AttributePart, [styleInfo]: DirectiveParameters<this>) {\n    const {style} = part.element as HTMLElement;\n\n    if (this._previousStyleProperties === undefined) {\n      this._previousStyleProperties = new Set(Object.keys(styleInfo));\n      return this.render(styleInfo);\n    }\n\n    // Remove old properties that no longer exist in styleInfo\n    for (const name of this._previousStyleProperties) {\n      // If the name isn't in styleInfo or it's null/undefined\n      if (styleInfo[name] == null) {\n        this._previousStyleProperties!.delete(name);\n        if (name.includes('-')) {\n          style.removeProperty(name);\n        } else {\n          // eslint-disable-next-line @typescript-eslint/no-explicit-any\n          (style as any)[name] = null;\n        }\n      }\n    }\n\n    // Add or update properties\n    for (const name in styleInfo) {\n      const value = styleInfo[name];\n      if (value != null) {\n        this._previousStyleProperties.add(name);\n        const isImportant =\n          typeof value === 'string' && value.endsWith(importantFlag);\n        if (name.includes('-') || isImportant) {\n          style.setProperty(\n            name,\n            isImportant\n              ? (value as string).slice(0, flagTrim)\n              : (value as string),\n            isImportant ? important : ''\n          );\n        } else {\n          // eslint-disable-next-line @typescript-eslint/no-explicit-any\n          (style as any)[name] = value;\n        }\n      }\n    }\n    return noChange;\n  }\n}\n\n/**\n * A directive that applies CSS properties to an element.\n *\n * `styleMap` can only be used in the `style` attribute and must be the only\n * expression in the attribute. It takes the property names in the\n * {@link StyleInfo styleInfo} object and adds the properties to the inline\n * style of the element.\n *\n * Property names with dashes (`-`) are assumed to be valid CSS\n * property names and set on the element's style object using `setProperty()`.\n * Names without dashes are assumed to be camelCased JavaScript property names\n * and set on the element's style object using property assignment, allowing the\n * style object to translate JavaScript-style names to CSS property names.\n *\n * For example `styleMap({backgroundColor: 'red', 'border-top': '5px', '--size':\n * '0'})` sets the `background-color`, `border-top` and `--size` properties.\n *\n * @param styleInfo\n * @see {@link https://lit.dev/docs/templates/directives/#stylemap styleMap code samples on Lit.dev}\n */\nexport const styleMap = directive(StyleMapDirective);\n\n/**\n * The type of the class that powers this directive. Necessary for naming the\n * directive's return type.\n */\nexport type {StyleMapDirective};\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/calendar/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/calendar/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/calendar/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/calendar/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/calendar/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconCalendar16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Calendar`, id: 'icon.title.calendar', comment: 'Title for calendar icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-calendar-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" d=\"M14.5 2.5h-13a1 1 0 0 0-1 1v11a1 1 0 0 0 1 1h13a1 1 0 0 0 1-1v-11a1 1 0 0 0-1-1m-14 4h15M8 12.666V9.333m1 3.333H7m1-3.333-1 .333M4.5 3.333V.667m7 2.666V.667\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-calendar-16')) {\n  customElements.define('w-icon-calendar-16', IconCalendar16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.calendar\\\":[\\\"Kalender\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.calendar\\\":[\\\"Calendar\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.calendar\\\":[\\\"Kalenteri\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.calendar\\\":[\\\"Kalender\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.calendar\\\":[\\\"Kalender\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/chevron-left/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/chevron-left/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/chevron-left/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/chevron-left/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/chevron-left/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconChevronLeft16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Leftward arrow`, id: 'icon.title.chevron-left', comment: 'Title for chevron-left icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-chevron-left-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" stroke-width=\"1.5\" d=\"M10.5 13.75 5 8.25l5.5-5.5\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-chevron-left-16')) {\n  customElements.define('w-icon-chevron-left-16', IconChevronLeft16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-left\\\":[\\\"Pil til venstre\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-left\\\":[\\\"Leftward arrow\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-left\\\":[\\\"Nuoli vasemmalle\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-left\\\":[\\\"Pil til venstre\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-left\\\":[\\\"Pil v\u00E4nster\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/chevron-right/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/chevron-right/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/chevron-right/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/chevron-right/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/chevron-right/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconChevronRight16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Rightward arrow`, id: 'icon.title.chevron-right', comment: 'Title for chevron-right icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-chevron-right-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" stroke-width=\"1.5\" d=\"m5.5 13.75 5.5-5.5-5.5-5.5\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-chevron-right-16')) {\n  customElements.define('w-icon-chevron-right-16', IconChevronRight16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-right\\\":[\\\"Pil til h\u00F8yre\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-right\\\":[\\\"Rightward arrow\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-right\\\":[\\\"Nuoli oikealle\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-right\\\":[\\\"Pil til h\u00F8jre\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-right\\\":[\\\"Pil h\u00F6ger\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"datepicker.toggle.changeDate\\\":[\\\"Change date, \\\",[\\\"currentDate\\\"]],\\\"datepicker.toggle.chooseDate\\\":[\\\"Choose date\\\"],\\\"datepicker.calendar.roleDescription\\\":[\\\"Date picker\\\"],\\\"datepicker.calendar.nextMonth\\\":[\\\"Next month\\\"],\\\"datepicker.calendar.previousMonth\\\":[\\\"Previous month\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"datepicker.toggle.changeDate\\\":[\\\"Change date, \\\",[\\\"currentDate\\\"]],\\\"datepicker.toggle.chooseDate\\\":[\\\"Choose date\\\"],\\\"datepicker.calendar.roleDescription\\\":[\\\"Date picker\\\"],\\\"datepicker.calendar.nextMonth\\\":[\\\"Next month\\\"],\\\"datepicker.calendar.previousMonth\\\":[\\\"Previous month\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"datepicker.toggle.changeDate\\\":[\\\"Change date, \\\",[\\\"currentDate\\\"]],\\\"datepicker.toggle.chooseDate\\\":[\\\"Choose date\\\"],\\\"datepicker.calendar.roleDescription\\\":[\\\"Date picker\\\"],\\\"datepicker.calendar.nextMonth\\\":[\\\"Next month\\\"],\\\"datepicker.calendar.previousMonth\\\":[\\\"Previous month\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"datepicker.toggle.changeDate\\\":[\\\"Endre dato, \\\",[\\\"currentDate\\\"]],\\\"datepicker.toggle.chooseDate\\\":[\\\"Velg dato\\\"],\\\"datepicker.calendar.roleDescription\\\":[\\\"datovelger\\\"],\\\"datepicker.calendar.nextMonth\\\":[\\\"G\u00E5 til neste m\u00E5ned\\\"],\\\"datepicker.calendar.previousMonth\\\":[\\\"G\u00E5 til forrige m\u00E5ned\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"datepicker.toggle.changeDate\\\":[\\\"Change date, \\\",[\\\"currentDate\\\"]],\\\"datepicker.toggle.chooseDate\\\":[\\\"Choose date\\\"],\\\"datepicker.calendar.roleDescription\\\":[\\\"Date picker\\\"],\\\"datepicker.calendar.nextMonth\\\":[\\\"Next month\\\"],\\\"datepicker.calendar.previousMonth\\\":[\\\"Previous month\\\"]}\");", "import { css } from 'lit';\n\nexport const wDatepickerCalendarStyles = css`\n  .w-datepicker__calendar {\n    --_calendar-border-color: var(--calendar-border-color, initial);\n    --_calendar-border-style: var(--calendar-border-style, none);\n    --_calendar-border-width: var(--calendar-border-width, 0);\n    --_calendar-border-radius: var(--calendar-border-radius, 0);\n    position: relative;\n    z-index: 30;\n\n    border: var(--_calendar-border-width) var(--_calendar-border-style) var(--_calendar-border-color);\n    border-radius: var(--_calendar-border-radius);\n    padding: 16px;\n  }\n`;\n", "import { css } from 'lit';\n\nexport const wDatepickerDayStyles = css`\n  /* === Day Cell === */\n  .w-datepicker__day {\n    /* No longer in use? */\n    --_day-in-range-background: var(--day-in-range-background, var(--w-s-color-background-primary-subtle-active));\n\n    text-align: center;\n    cursor: pointer;\n    outline: none;\n    position: relative;\n\n    color: var(--day-color, var(--w-s-color-text));\n    background-color: var(--day-background, transparent);\n    width: var(--day-width, 40px);\n    height: var(--day-height, 40px);\n    padding: var(--day-padding, 0);\n    font-weight: var(--day-font-weight, normal);\n    font-size: var(--w-font-size-s);\n    line-height: var(--w-line-height-s);\n    border-radius: var(--day-border-radius, 50%);\n  }\n\n  .w-datepicker__day:hover {\n    --day-color: var(--w-s-color-text);\n    --day-background: var(--w-s-color-background-hover);\n    --day-border-radius: 50%;\n  }\n  .w-datepicker__day:active {\n    --day-color: var(--w-s-color-text);\n    --day-background: var(--w-s-color-background-active);\n    --day-border-radius: 50%;\n  }\n\n  .w-datepicker__day:focus-visible {\n    text-decoration: none;\n    outline: 2px solid var(--w-s-color-border-focus);\n    outline-offset: var(--w-outline-offset, -2px);\n  }\n\n  /* === Day variants === */\n  .w-datepicker__day--today {\n    --day-font-weight: bold;\n  }\n\n  .w-datepicker__day--selected {\n    --day-background: var(--w-s-color-background-primary);\n    --day-color: var(--w-s-color-text-inverted);\n    --day-font-weight: bold;\n  }\n  .w-datepicker__day--selected:hover,\n  .w-datepicker__day--selected:focus-visible {\n    --day-background: var(--w-s-color-background-primary-hover);\n    --day-color: var(--w-s-color-text-inverted);\n    --day-font-weight: bold;\n  }\n\n  .w-datepicker__day--disabled,\n  .w-datepicker__day--disabled:hover {\n    --day-color: var(--w-s-color-text-disabled);\n    cursor: not-allowed;\n    pointer-events: none;\n  }\n`;\n", "import { css } from 'lit';\n\nexport const wDatepickerMonthStyles = css`\n  .w-datepicker__month {\n    /* Sets default used in the day fragment */\n    --day-width: 40px;\n\n    --_month-color: var(--month-color, var(--w-s-color-text));\n    --_month-font-size: var(--month-font-size, var(--w-font-size-m));\n    --_month-line-height: var(--month-line-height, var(--w-line-height-m));\n\n    --_month-table-min-width: var(--month-table-min-width, calc(var(--day-width) * 7));\n\n    --_weekdays-font-size: var(--weekdays-font-size, var(--w-font-size-xs));\n    --_weekdays-line-height: var(--weekdays-font-size, var(--w-line-height-xs));\n    --_weekdays-font-weight: var(--weekdays-font-weight, bold);\n\n    --_weekdays-padding: var(--weekdays-padding, 8px 0 4px 0);\n\n    text-align: center;\n    user-select: none;\n    display: inline-block;\n\n    color: var(--_month-color);\n    font-size: var(--_month-font-size);\n    line-height: var(--_month-line-height);\n  }\n\n  .w-datepicker__month__nav {\n    margin: 0 0 8px 0;\n  }\n\n  .w-datepicker__month__nav__header {\n    text-align: center;\n    font-weight: Bold;\n  }\n\n  .w-datepicker__table {\n    width: 100%;\n    border-spacing: 0;\n    border-collapse: collapse;\n    display: block;\n    min-width: var(--_month-table-min-width);\n    padding-top: 8px;\n  }\n\n  .w-datepicker__weekday {\n    text-align: center;\n    font-size: var(--_weekdays-font-size);\n    line-height: var(--_weekdays-line-height);\n    font-weight: var(--_weekdays-font-weight);\n    padding: var(--_weekdays-padding);\n  }\n\n  .w-datepicker__month-nav {\n    display: flex;\n    align-items: center;\n    justify-content: space-between;\n    width: 100%;\n  }\n\n  .w-datepicker__month__nav__button {\n    flex-shrink: 0;\n  }\n\n  .w-datepicker__month__nav__header {\n    flex: 1;\n    display: flex;\n    align-items: center;\n    justify-content: center;\n    text-align: center;\n  }\n`;\n", "import { css } from 'lit';\n\nexport const wDatepickerStyles = css`\n  /* CustomDatePicker.css */\n\n  /* container */\n  .w-datepicker-wrapper {\n    position: relative;\n    display: inline-block;\n    width: 100%;\n    font-size: var(--w-font-size-m);\n    line-height: var(--w-line-height-m);\n  }\n  .w-datepicker-input-wrapper {\n    position: relative;\n  }\n  /* hide the browser\u2019s calendar icon, and prevent the native popup */\n  .w-datepicker-input {\n    /* remove default arrows/appearance */\n    -webkit-appearance: none;\n    -moz-appearance: textfield;\n    appearance: none;\n\n    /* basic styling */\n    display: block;\n    padding: 1.2rem 0.8rem;\n    border: 1px solid #ccc;\n    border-radius: 4px;\n    width: 100%;\n    height: 48px;\n    cursor: pointer;\n    font-size: var(--w-font-size-m);\n    line-height: var(--w-line-height-m);\n    background-color: var(--w-s-color-background);\n  }\n  .w-datepicker-input:hover {\n    border-color: var(--w-s-color-border-hover);\n  }\n  .w-datepicker-input:active {\n    border-color: var(--w-s-color-border-selected);\n  }\n\n  .w-datepicker-input:focus,\n  .w-datepicker-input:focus-visible {\n    outline: 2px solid var(--w-s-color-border-focus);\n    outline-offset: -2px;\n  }\n\n  .w-datepicker-input-label {\n    font-size: var(--w-font-size-s);\n    line-height: var(--w-line-height-s);\n    font-weight: 700;\n    cursor: pointer;\n    padding-bottom: 0.4rem;\n    color: var(--w-s-color-text);\n    display: block;\n  }\n\n  /* custom calendar button */\n  .w-datepicker-button {\n    position: absolute;\n    right: 2px;\n    top: 2px;\n    height: 44px;\n    width: 44px !important;\n    border-radius: 2px !important;\n    border: none;\n    cursor: pointer;\n    pointer-events: auto; /* override parent\u2019s none */\n  }\n\n  .w-datepicker-button:not(:hover) {\n    background-color: var(--w-s-color-background) !important;\n  }\n\n  input[type='date']::-webkit-inner-spin-button,\n  input[type='date']::-webkit-calendar-picker-indicator {\n    display: none;\n    -webkit-appearance: none;\n  }\n  input[type='date'],\n  input[type='time'],\n  input[type='datetime-local'],\n  input[type='month'] {\n    -webkit-appearance: none;\n    -moz-appearance: none;\n    appearance: none;\n  }\n  /* Temporary dropdown, should probably use the appropriate component when it is done */\n  .w-dropdown__popover {\n    position: absolute;\n    width: max-content;\n    background-color: var(--w-s-color-background);\n    box-shadow: var(--w-shadow-s);\n    z-index: 100;\n    border-radius: 8px;\n    visibility: hidden;\n  }\n  .w-dropdown__popover--open {\n    visibility: visible;\n  }\n`;\n", "const dateOnlyRe = /^\\d{4}-\\d{2}-\\d{2}$/;\n\n/**\n * Parses an ISO-8601 string into a JS Date.\n *\n * Supports:\n *  - YYYY-MM-DD\n *  - YYYY-MM-DDThh:mm:ss(.sss)?(Z|\u00B1hh:mm)?\n *\n * @param {string} isoString\n * @returns {Date}\n * @throws {TypeError} if input isn\u2019t a string\n * @throws {Error} if string is not a valid ISO-8601 date\n */\nexport function fromISOToDate(isoString: string): Date | null {\n  if (typeof isoString !== 'string') {\n    return null;\n  }\n\n  // If it's a bare date (YYYY-MM-DD), treat it as UTC midnight\n  let normalized = isoString;\n  if (dateOnlyRe.test(isoString)) {\n    normalized = `${isoString}T00:00:00Z`;\n  }\n\n  const timestamp = Date.parse(normalized);\n  if (Number.isNaN(timestamp)) {\n    return null;\n  }\n\n  return new Date(timestamp);\n}\n", "import { css, CSSResultGroup, html, LitElement } from 'lit';\n\nimport { property } from 'lit/decorators.js';\nimport { classMap } from 'lit/directives/class-map.js';\n\nimport { reset } from '../styles';\n\n/**\n * Dead toggle can be used where the appearance of a checkbox or radio is needed - but for accessibility purposes an actual input element should not be present.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/forms-dead-toggle--docs)\n */\nexport class WarpDeadToggle extends LitElement {\n  @property({ type: String }) type: 'radio' | 'checkbox' = 'radio';\n  @property({ type: Boolean, reflect: true }) checked: boolean = false;\n  @property({ type: Boolean, reflect: true }) indeterminate: boolean = false;\n  @property({ type: Boolean, reflect: true }) invalid: boolean = false;\n\n  /** @internal */\n  get indeterminateMarker() {\n    return !this.checked && this.indeterminate ? '\u2013' : '';\n  }\n\n  render() {\n    const classes = classMap({\n      checkbox: this.type === 'checkbox',\n      radio: this.type === 'radio',\n      checked: this.checked,\n    });\n    return html` <div class=\"${classes}\">${this.indeterminateMarker}</div> `;\n  }\n\n  static styles?: CSSResultGroup | undefined = [\n    reset,\n    css`\n      div {\n        display: block;\n        border-width: 1px;\n        transition-property: all;\n        transition-timing-function: cubic-bezier(0.4, 0, 0.2, 1);\n        transition-duration: 150ms;\n        cursor: pointer;\n        appearance: none;\n        user-select: none;\n        flex-shrink: 0;\n        height: 2rem;\n        width: 2rem;\n        background-color: var(--w-s-color-background);\n        border-color: var(--w-s-color-border);\n        color: var(--w-s-color-icon-inverted);\n        font-weight: 700;\n        text-align: center;\n        line-height: var(--w-line-height-xs);\n        font-size: var(--w-font-size-m);\n      }\n      :host([type='checkbox']) div {\n        border-radius: 2px;\n      }\n      :host([type='checkbox'][checked]) div,\n      :host([type='checkbox'][indeterminate]) div {\n        background-color: var(--w-s-color-background-primary);\n        border-color: var(--w-s-color-border-primary);\n      }\n      :host([type='checkbox'][checked]) div {\n        background-image: var(--w-icon-toggle-checked);\n      }\n      :host([type='radio']) div {\n        border-radius: 50%;\n      }\n      :host([type='radio'][checked]) div {\n        border-color: var(--w-s-color-border-selected);\n        border-width: 0.6rem;\n      }\n      :host([invalid]) div {\n        border-color: var(--w-s-color-border-negative) !important;\n      }\n      :host([type='checkbox'][invalid][checked]) div,\n      :host([type='checkbox'][invalid][indeterminate]) div {\n        background-color: var(--w-s-color-background-negative);\n      }\n    `,\n  ];\n}\n\nif (!customElements.get('w-dead-toggle')) {\n  customElements.define('w-dead-toggle', WarpDeadToggle);\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-dead-toggle': WarpDeadToggle;\n  }\n}\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/chevron-down/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/chevron-down/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/chevron-down/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/chevron-down/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/chevron-down/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconChevronDown16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Downward arrow`, id: 'icon.title.chevron-down', comment: 'Title for chevron-down icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-chevron-down-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" stroke-width=\"1.5\" d=\"m2.667 5.333 5.5 5.5 5.5-5.5\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-chevron-down-16')) {\n  customElements.define('w-icon-chevron-down-16', IconChevronDown16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-down\\\":[\\\"Nedoverpil\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-down\\\":[\\\"Downward arrow\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-down\\\":[\\\"Nuoli alasp\u00E4in\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-down\\\":[\\\"Pil nedad\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-down\\\":[\\\"Pil ned\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/chevron-up/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/chevron-up/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/chevron-up/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/chevron-up/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/chevron-up/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconChevronUp16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Upward arrow`, id: 'icon.title.chevron-up', comment: 'Title for chevron-up icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-chevron-up-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" stroke-width=\"1.5\" d=\"M2.5 11 8 5.5l5.5 5.5\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-chevron-up-16')) {\n  customElements.define('w-icon-chevron-up-16', IconChevronUp16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-up\\\":[\\\"Oppoverpil\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-up\\\":[\\\"Upward arrow\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-up\\\":[\\\"Nuoli yl\u00F6sp\u00E4in\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-up\\\":[\\\"Pil opad\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-up\\\":[\\\"Pil upp\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.t4{font-weight:700;font-size:var(--w-font-size-m);line-height:var(--w-line-height-m)}.text-left{text-align:left}.align-middle{vertical-align:middle}.bg-transparent{background-color:#0000}.appearance-none{-webkit-appearance:none;appearance:none}.will-change-height{will-change:height}.border-0{border-width:0}.border-2{border-width:2px}.rounded-8{border-radius:8px}.rounded-l-0{border-top-left-radius:0;border-bottom-left-radius:0}.rounded-r-0{border-top-right-radius:0;border-bottom-right-radius:0}.block{display:block}.inline-block{display:inline-block}.flex{display:flex}.inline-flex{display:inline-flex}.hover\\\\:underline:hover{text-decoration-line:underline}.focus-visible\\\\:underline:focus-visible{text-decoration-line:underline}.overflow-hidden{overflow:hidden}.focus\\\\:outline-none:focus{outline-offset:2px;outline:2px solid #0000}.items-center{align-items:center}.justify-between{justify-content:space-between}.relative{position:relative}.static{position:static}.s-bg{background-color:var(--w-s-color-background)}.s-bg-info-subtle{background-color:var(--w-s-color-background-info-subtle)}.hover\\\\:s-bg-hover:hover{background-color:var(--w-s-color-background-hover)}.active\\\\:s-bg-active:active{background-color:var(--w-s-color-background-active)}.s-text{color:var(--w-s-color-text)}.s-icon{color:var(--w-s-color-icon)}.s-border{border-color:var(--w-s-color-border)}.s-surface-sunken{background-color:var(--w-s-color-surface-sunken)}.h-0{height:0}.w-full{width:100%}.m-0{margin:0}.-mx-16{margin-left:-1.6rem;margin-right:-1.6rem}.last-child\\\\:mb-0>:last-child{margin-bottom:0}.ml-8{margin-left:.8rem}.p-16{padding:1.6rem}.px-0{padding-left:0;padding-right:0}.py-0{padding-top:0;padding-bottom:0}.pt-0{padding-top:0}.invisible{visibility:hidden}.break-words{overflow-wrap:break-word}.cursor-pointer{cursor:pointer}.-rotate-180{--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-rotate:-180deg;transform:translateX(var(--w-translate-x))translateY(var(--w-translate-y))translateZ(var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.part-\\\\[w-icon-chevron-down-16-part\\\\]\\\\:-rotate-180::part(w-icon-chevron-down-16-part){--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-rotate:-180deg;transform:translateX(var(--w-translate-x))translateY(var(--w-translate-y))translateZ(var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.rotate-180{--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-rotate:180deg;transform:translateX(var(--w-translate-x))translateY(var(--w-translate-y))translateZ(var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.part-\\\\[w-icon-chevron-up-16-part\\\\]\\\\:rotate-180::part(w-icon-chevron-up-16-part){--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-rotate:180deg;transform:translateX(var(--w-translate-x))translateY(var(--w-translate-y))translateZ(var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.transform{transform:translateX(var(--w-translate-x))translateY(var(--w-translate-y))translateZ(var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.part-\\\\[w-icon-chevron-down-16-part\\\\]\\\\:transform::part(w-icon-chevron-down-16-part){transform:translateX(var(--w-translate-x))translateY(var(--w-translate-y))translateZ(var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.part-\\\\[w-icon-chevron-up-16-part\\\\]\\\\:transform::part(w-icon-chevron-up-16-part){transform:translateX(var(--w-translate-x))translateY(var(--w-translate-y))translateZ(var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.transform-gpu{transform:translate3d(var(--w-translate-x),var(--w-translate-y),var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.part-\\\\[w-icon-chevron-down-16-part\\\\]\\\\:transform-gpu::part(w-icon-chevron-down-16-part){transform:translate3d(var(--w-translate-x),var(--w-translate-y),var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.part-\\\\[w-icon-chevron-up-16-part\\\\]\\\\:transform-gpu::part(w-icon-chevron-up-16-part){transform:translate3d(var(--w-translate-x),var(--w-translate-y),var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.transition-transform{transition-property:transform;transition-duration:.15s;transition-timing-function:cubic-bezier(.4,0,.2,1)}.part-\\\\[w-icon-chevron-down-16-part\\\\]\\\\:transition-transform::part(w-icon-chevron-down-16-part){transition-property:transform;transition-duration:.15s;transition-timing-function:cubic-bezier(.4,0,.2,1)}.part-\\\\[w-icon-chevron-up-16-part\\\\]\\\\:transition-transform::part(w-icon-chevron-up-16-part){transition-property:transform;transition-duration:.15s;transition-timing-function:cubic-bezier(.4,0,.2,1)}.ease-in-out{transition-timing-function:cubic-bezier(.4,0,.2,1)}.part-\\\\[w-icon-chevron-down-16-part\\\\]\\\\:ease-in-out::part(w-icon-chevron-down-16-part){transition-timing-function:cubic-bezier(.4,0,.2,1)}.part-\\\\[w-icon-chevron-up-16-part\\\\]\\\\:ease-in-out::part(w-icon-chevron-up-16-part){transition-timing-function:cubic-bezier(.4,0,.2,1)}@media (min-width:480px){.sm\\\\:rounded-8{border-radius:8px}.sm\\\\:mx-0{margin-left:0;margin-right:0}}`;\n", "// @warp-css;\n\nimport { css, html, LitElement, PropertyValues } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { property } from 'lit/decorators.js';\nimport { ifDefined } from 'lit/directives/if-defined.js';\nimport '@warp-ds/icons/elements/chevron-down-16';\nimport '@warp-ds/icons/elements/chevron-up-16';\n\nimport { reset } from '../styles.js';\n\nimport { styles } from './styles.js';\n\nexport const ccBox = {\n  base: 'group block relative break-words last-child:mb-0 p-16 rounded-8', // Relative here enables w-clickable\n  bleed: '-mx-16 sm:mx-0 rounded-l-0 rounded-r-0 sm:rounded-8', // We target L and R to override the default rounded-8\n  info: 's-bg-info-subtle',\n  neutral: 's-surface-sunken',\n  bordered: 'border-2 s-border s-bg',\n};\n\nexport const ccExpandable = {\n  wrapper: 'will-change-height s-text',\n  box: 's-surface-sunken hover:s-bg-hover active:s-bg-active py-0 px-0 group block relative break-words last-child:mb-0 rounded-8',\n  bleed: '-mx-16 rounded-l-0 rounded-r-0 sm:mx-0 sm:rounded-8',\n  chevron: 'inline-block align-middle s-icon',\n  chevronNonBox: 'ml-8',\n  chevronTransform: 'transform transition-transform transform-gpu ease-in-out',\n  chevronExpand: '-rotate-180',\n  chevronCollapse: 'rotate-180',\n\n  // These are web component specific classes, using the ::part-selector:\n  elementsChevronDownTransform:\n    'part-[w-icon-chevron-down-16-part]:transform part-[w-icon-chevron-down-16-part]:transition-transform part-[w-icon-chevron-down-16-part]:transform-gpu part-[w-icon-chevron-down-16-part]:ease-in-out',\n  elementsChevronUpTransform:\n    'part-[w-icon-chevron-up-16-part]:transform part-[w-icon-chevron-up-16-part]:transition-transform part-[w-icon-chevron-up-16-part]:transform-gpu part-[w-icon-chevron-up-16-part]:ease-in-out',\n  elementsChevronExpand: 'part-[w-icon-chevron-down-16-part]:-rotate-180',\n  elementsChevronCollapse: 'part-[w-icon-chevron-up-16-part]:rotate-180',\n\n  expansion: 'overflow-hidden',\n  expansionNotExpanded: 'h-0 invisible',\n  button: 'focus:outline-none appearance-none cursor-pointer bg-transparent border-0 m-0 hover:underline focus-visible:underline',\n  buttonBox: 'w-full text-left relative inline-flex items-center justify-between group relative break-words last-child:mb-0 p-16 rounded-8',\n  contentWithTitle: 'pt-0',\n  title: 'flex w-full justify-between items-center',\n  titleType: 't4',\n};\n\n/**\n * Expandable is a layout component used for creating expandable content areas on a page.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/layout-expandable--docs)\n *\n * @slot title - Alternative to the `title` attribute should you need to provide some additional markup.\n */\nclass WarpExpandable extends LitElement {\n  @property({ type: Boolean, reflect: true })\n  expanded: boolean = false;\n\n  @property({ type: String })\n  title: string;\n\n  @property({ type: Boolean })\n  box: boolean = false;\n\n  @property({ type: Boolean })\n  bleed: boolean = false;\n\n  @property({ attribute: 'button-class', type: String })\n  buttonClass: string;\n\n  @property({ attribute: 'content-class', type: String })\n  contentClass: string;\n\n  @property({ attribute: 'no-chevron', type: Boolean })\n  noChevron: boolean = false;\n\n  @property({ type: Boolean })\n  animated: boolean = false;\n\n  @property({ attribute: 'heading-level', type: Number })\n  headingLevel: number;\n\n  @property({ type: Boolean, state: true })\n  /** @internal */\n  _hasTitle: boolean = true;\n\n  @property({ type: Boolean, state: true })\n  /** @internal */\n  _showChevronUp: boolean = false;\n\n  // Slotted elements remain in lightDOM which allows for control of their style outside of shadowDOM.\n  // ::slotted([Simple Selector]) confirms to Specificity rules, but (being simple) does not add weight to lightDOM skin selectors,\n  // so never gets higher Specificity. Thus in order to overwrite style linked within shadowDOM, we need to use !important.\n  // https://stackoverflow.com/a/61631668\n  static styles = [\n    reset,\n    styles,\n    css`\n      :host {\n        display: block;\n      }\n      ::slotted(:last-child) {\n        margin-bottom: 0px !important;\n      }\n    `,\n  ];\n\n  updated(changedProperties: PropertyValues<this>) {\n    // We need a slight delay for the animation since it has a transition-duration of 150ms:\n    if (changedProperties.has('expanded')) {\n      setTimeout(() => {\n        this._showChevronUp = this.expanded;\n      }, 200);\n    }\n  }\n\n  firstUpdated() {\n    const hasTitleProp = Boolean(this.title);\n    const hasTitleSlot = (this.renderRoot.querySelector(\"slot[name='title']\") as HTMLSlotElement)?.assignedNodes().length > 0;\n\n    this._hasTitle = hasTitleProp || hasTitleSlot;\n  }\n\n  get #wrapperClasses() {\n    return classNames([ccExpandable.wrapper, this.box && ccExpandable.box, this.bleed && ccExpandable.bleed]);\n  }\n\n  get #buttonClasses() {\n    return classNames(this.buttonClass, [ccExpandable.button, this.box && ccExpandable.buttonBox]);\n  }\n\n  get #chevronClasses() {\n    return classNames([ccExpandable.chevron, !this.box && ccExpandable.chevronNonBox]);\n  }\n\n  get #chevronIcon() {\n    const upClasses = classNames([\n      ccExpandable.elementsChevronUpTransform,\n      !this.expanded && this._showChevronUp && ccExpandable.elementsChevronCollapse,\n    ]);\n    const downClasses = classNames([\n      ccExpandable.elementsChevronDownTransform,\n      this.expanded && !this._showChevronUp && ccExpandable.elementsChevronExpand,\n    ]);\n\n    return this._showChevronUp\n      ? html`<w-icon-chevron-up-16 class=\"${upClasses}\"></w-icon-chevron-up-16>`\n      : html`<w-icon-chevron-down-16 class=\"${downClasses}\"></w-icon-chevron-down-16>`;\n  }\n\n  get #contentClasses() {\n    return classNames(this.contentClass, [this.box && ccBox.base, this._hasTitle && this.box && ccExpandable.contentWithTitle]);\n  }\n\n  get #expansionClasses() {\n    return classNames([ccExpandable.expansion, !this.expanded && ccExpandable.expansionNotExpanded]);\n  }\n\n  /** @internal */\n  get _expandableSlot() {\n    return html`<div class=\"${this.#contentClasses}\">\n      <slot></slot>\n    </div>`;\n  }\n\n  render() {\n    return html` <div class=\"${this.#wrapperClasses}\">\n      ${this._hasTitle\n        ? html`<w-unstyled-heading level=${this.headingLevel}>\n            <button\n              type=\"button\"\n              aria-expanded=\"${this.expanded}\"\n              class=\"${this.#buttonClasses}\"\n              @click=${() => (this.expanded = !this.expanded)}>\n              <div class=\"${ccExpandable.title}\">\n                ${this.title ? html`<span class=\"${ccExpandable.titleType}\">${this.title}</span>` : html`<slot name=\"title\"></slot>`}\n                ${this.noChevron ? '' : html`<div class=\"${this.#chevronClasses}\">${this.#chevronIcon}</div>`}\n              </div>\n            </button>\n          </w-unstyled-heading>`\n        : ''}\n      ${this.animated\n        ? html`<w-expand-transition ?show=${this.expanded}> ${this._expandableSlot} </w-expand-transition>`\n        : html`<div class=\"${this.#expansionClasses}\" aria-hidden=${ifDefined(!this.expanded ? true : undefined)}>\n            ${this._expandableSlot}\n          </div>`}\n    </div>`;\n  }\n}\n\nif (!customElements.get('w-expandable')) {\n  customElements.define('w-expandable', WarpExpandable);\n}\n\nexport { WarpExpandable };\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-expandable': WarpExpandable;\n  }\n}\n", "// eslint-disable-next-line\nexport declare type Constructor<T = Record<string, unknown>> = new (...args: any[]) => T;\n\nexport const CanCloseMixin: <TBase extends Constructor<HTMLElement>>(SuperClass: TBase) => Constructor<{ close: () => void }> & TBase = (\n  superClass,\n) =>\n  class extends superClass {\n    patchClose = true;\n    _close = null;\n    close() {\n      this._close();\n    }\n  };\n\nexport const ProvidesCanCloseToSlotsMixin: <TBase extends Constructor<HTMLElement>>(\n  SuperClass: TBase,\n) => Constructor<{ handleSlotChange: (evt: Event) => void }> & TBase = (superClass) =>\n  class extends superClass {\n    // HACK: slot-props don't seem to exist and neither does the context pattern for this\n    /** @param {Event} evt */\n    handleSlotChange(evt) {\n      const children = evt.target.assignedNodes({ flatten: true });\n      for (const child of children.filter((e) => e.patchClose)) {\n        // @ts-expect-error users have to implement the close method\n        child._close = () => this.close();\n      }\n    }\n  };\n", "import { html, css, LitElement } from 'lit';\n\nimport { reset } from '../styles.js';\n\nimport { CanCloseMixin, ProvidesCanCloseToSlotsMixin } from './util';\n\n/**\n * The footer section of a modal, typically where you place actions.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/overlays-modal--docs)\n */\nexport class ModalFooter extends CanCloseMixin(ProvidesCanCloseToSlotsMixin(LitElement)) {\n  render() {\n    return html`\n      <div class=\"footer\">\n        <slot @slotchange=\"${this.handleSlotChange}\"></slot>\n      </div>\n    `;\n  }\n  static styles = [\n    reset,\n    css`\n      .footer {\n        display: flex;\n        flex-shrink: 0;\n        justify-content: flex-end;\n        padding-left: 1.6rem;\n        padding-right: 1.6rem;\n        padding-top: 2.4rem;\n      }\n      @media (min-width: 480px) {\n        .footer {\n          padding-left: 3.2rem;\n          padding-right: 3.2rem;\n        }\n      }\n    `,\n  ];\n}\n\nif (!customElements.get('w-modal-footer')) {\n  customElements.define('w-modal-footer', ModalFooter);\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-modal-footer': ModalFooter;\n  }\n}\n", "/** @typedef {import('./move.d.ts').Deltas} Deltas */\n\n/**\n  * @param {DOMRect} first\n  * @param {DOMRect} last\n  * @returns {Deltas}\n  */\nexport const computeDeltas = (first, last) => ({\n  dx: first.left - last.left,\n  dy: first.top - last.top,\n  dw: first.width / last.width,\n  dh: first.height / last.height,\n  first,\n  last,\n})\n\n/** @param {Deltas} deltas */\nexport const moveKeyframes = ({ dx, dy }) => ([\n  { transform: `translate(${dx}px, ${dy}px)` },\n  { transform: 'none' },\n])\n\n/** @type {KeyframeAnimationOptions} */\nexport const animationDefaults = { easing: 'ease', duration: 300 }\n", "export let reduceMotion = false\n\nconst windowExists = (typeof window !== 'undefined')\nif (windowExists) {\n  const query = window.matchMedia('(prefers-reduced-motion: reduce)')\n  const callback = ({ matches }) => reduceMotion = matches\n  // older browsers don't support the new API, and the old API is deprecated\n  if (query.addEventListener) query.addEventListener('change', callback)\n  callback(query)\n}\n\n", "import { moveKeyframes, computeDeltas, animationDefaults } from './utility.js'\nimport { reduceMotion } from './reduce-motion.js'\n\nexport class Move {\n  /** @type {DOMRect | {}} */\n  first;\n  /** @type {DOMRect | {}} */\n  last;\n  /** @type {HTMLElement} */\n  el;\n\n  constructor(el, { animation = {}, keyframes, respectReduceMotion = true } = {}) {\n    this.el = el\n    this.first = {}\n    this.last = {}\n    this.userAnimationOptions = animation\n    this.keyframeGenerator = keyframes || moveKeyframes\n    this.shouldReduceMotion = respectReduceMotion\n  }\n\n  async when(cb) {\n    this.prep()\n    const v = await cb()\n    await this.play()\n    return v\n  }\n\n  prep() {\n    this.first = this.el.getBoundingClientRect()\n  }\n\n  async play() {\n    this.last = this.el.getBoundingClientRect()\n    if (!this.el.animate) return\n    const animation = this.el.animate(this.keyframes, this.animationOptions)\n    await animation.finished\n  }\n\n  get keyframes() {\n    return this.keyframeGenerator(computeDeltas(this.first, this.last))\n  }\n\n  get defaults() {\n    return animationDefaults\n  }\n\n  get mergedOptions() {\n    return { ...this.defaults, ...this.userAnimationOptions }\n  }\n\n  get animationOptions() {\n    if (!this.shouldReduceMotion) return this.mergedOptions\n    if (!reduceMotion) return this.mergedOptions\n    return { ...this.mergedOptions, duration: 0 }\n  }\n}\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/arrow-left/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/arrow-left/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/arrow-left/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/arrow-left/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/arrow-left/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconArrowLeft16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Leftward-pointing arrow`, id: 'icon.title.arrow-left', comment: 'Title for table arrow left icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-arrow-left-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-width=\"1.5\" d=\"M5.222 8h6.667\"></path><path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" stroke-width=\"1.5\" d=\"M7.444 11.75 4.111 8l3.333-3.75\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-arrow-left-16')) {\n  customElements.define('w-icon-arrow-left-16', IconArrowLeft16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.arrow-left\\\":[\\\"Pil som peker mot venstre\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.arrow-left\\\":[\\\"Leftward-pointing arrow\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.arrow-left\\\":[\\\"Vasemmalle osoittava nuoli\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.arrow-left\\\":[\\\"Pil til venstre\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.arrow-left\\\":[\\\"Pil som pekar v\u00E4nster\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"modal.aria.back\\\":[\\\"Tilbage\\\"],\\\"modal.aria.close\\\":[\\\"Luk\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"modal.aria.back\\\":[\\\"Back\\\"],\\\"modal.aria.close\\\":[\\\"Close\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"modal.aria.back\\\":[\\\"Takaisin\\\"],\\\"modal.aria.close\\\":[\\\"Sulje\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"modal.aria.back\\\":[\\\"Tilbake\\\"],\\\"modal.aria.close\\\":[\\\"Lukk\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"modal.aria.back\\\":[\\\"Tillbaka\\\"],\\\"modal.aria.close\\\":[\\\"St\u00E4ng\\\"]}\");", "import { css, html, LitElement, nothing, PropertyValues } from 'lit';\n\nimport { Move } from '@itsy/animate/move';\nimport { i18n } from '@lingui/core';\nimport { property, query, state } from 'lit/decorators.js';\nimport '@warp-ds/icons/elements/arrow-left-16';\nimport '@warp-ds/icons/elements/close-16';\n\nimport { activateI18n } from '../i18n';\nimport { reset } from '../styles';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\nimport { CanCloseMixin } from './util.js';\n\n/**\n * The header section of a modal, typically where you place the title and a close button.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/overlays-modal--docs)\n *\n * @slot top - Customize the title bar, for example to have a header image that reaches the modal's edges. See the With Image story for an example.\n */\nexport class ModalHeader extends CanCloseMixin(LitElement) {\n  @property({ type: String }) title: string;\n  @property({ type: Boolean }) back: boolean;\n  @property({ type: Boolean, attribute: 'no-close' }) noClose: boolean;\n  /** @internal */\n  @state() private _hasTopContent = false;\n\n  @query('.title-el') titleEl: HTMLElement;\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  }\n  render() {\n    return html`\n      <div class=\"header\">\n        <slot name=\"top\" @slotchange=${this.handleTopSlotChange}></slot>\n        <div class=\"${this._hasTopContent ? '' : 'header-title-bar'}\">\n          ${this.backButton}\n          <h1 class=\"title-el ${this.titleClasses}\">${this.title}</h1>\n          ${this.closeButton}\n        </div>\n      </div>\n    `;\n  }\n\n  async willUpdate(changedProperties: PropertyValues<this>) {\n    if (changedProperties.has('back')) {\n      const move = new Move(this.titleEl);\n      move.when(async () => {\n        await this.updateComplete;\n      });\n    }\n  }\n  get titleClasses() {\n    return [\n      'header-title',\n      this.back ? 'header-title-with-back-button' : 'header-title-without-back-button',\n      this._hasTopContent ? 'header-title-with-top-area' : '',\n    ].join(' ');\n  }\n\n  get backButton() {\n    return this.back && !this._hasTopContent // Not showing back button when there is a top image\n      ? html`<button\n          type=\"button\"\n          aria-label=\"${i18n._({\n            id: 'modal.aria.back',\n            message: 'Back',\n            comment: 'Aria label for the back button in modal',\n          })}\"\n          class=\"header-button header-button-left\"\n          @click=\"${this.emitBack}\">\n          <w-icon-arrow-left-16></w-icon-arrow-left-16>\n        </button>`\n      : nothing;\n  }\n  get closeButton() {\n    if (this.noClose) return nothing;\n    return html`<button\n      type=\"button\"\n      aria-label=\"${i18n._({\n        id: 'modal.aria.close',\n        message: 'Close',\n        comment: 'Aria label for the close button in modal',\n      })}\"\n      class=\"header-button ${this._hasTopContent ? 'header-close-button-on-image' : 'header-close-button'}\"\n      @click=\"${this.close}\">\n      <w-icon-close-16></w-icon-close-16>\n    </button>`;\n  }\n  emitBack() {\n    this.dispatchEvent(new CustomEvent('backClicked', { bubbles: true, composed: true }));\n  }\n  handleTopSlotChange(slotEvent) {\n    const topContent = slotEvent.target.assignedElements({ flatten: true });\n    this._hasTopContent = !!topContent.length;\n  }\n  static styles = [\n    reset,\n    css`\n      .header {\n        position: relative;\n        padding-bottom: 0.8rem;\n      }\n      .header-title-bar {\n        display: grid;\n        flex-shrink: 0 !important;\n        gap: 1.2rem;\n        grid-template-columns: auto 1fr auto;\n        align-items: flex-start;\n        padding-left: 1.6rem;\n        padding-right: 1.6rem;\n        padding-top: 1.6rem;\n      }\n      .header-title {\n        font-weight: 700;\n        font-size: var(--w-font-size-l);\n        line-height: var(--w-line-height-l);\n        align-self: center;\n        margin: 0;\n      }\n      .header-title-with-back-button {\n        justify-self: center;\n      }\n      .header-title-without-back-button {\n        grid-column: span 2 / span 2;\n      }\n      .header-title-with-top-area {\n        padding-left: 1.6rem;\n        padding-right: 1.6rem;\n        padding-top: 1.6rem;\n      }\n      .header-button:hover {\n        -webkit-background-clip: padding-box;\n        background-clip: padding-box;\n      }\n      .header-button:focus,\n      .header-button:focus-visible {\n        outline: 2px solid var(--w-s-color-border-focus);\n        outline-offset: var(--w-outline-offset, 1px);\n      }\n      .header-button:not(:focus-visible) {\n        outline: none;\n      }\n      .header-button {\n        border-width: 0;\n        border-radius: 9999px;\n        display: inline-flex;\n        align-items: center;\n        justify-content: center;\n        min-height: 40px;\n        min-width: 40px;\n        padding: 0.4rem;\n        font-weight: 700;\n        transition-property: color, background-color, border-color, text-decoration-color, fill, stroke;\n        transition-timing-function: cubic-bezier(0.4, 0, 0.2, 1);\n        transition-duration: 150ms;\n        font-size: var(--w-font-size-m);\n        line-height: var(--w-line-height-m);\n        line-height: 2.4rem;\n      }\n      .header-button-left {\n        background-color: transparent;\n        color: var(--w-s-color-icon);\n        margin-left: -0.8rem;\n      }\n      .header-button-left:hover {\n        background-color: var(--w-color-button-pill-background-hover);\n      }\n      .header-button-left:active {\n        background-color: var(--w-color-button-pill-background-active);\n      }\n      .header-close-button {\n        background-color: transparent;\n        color: var(--w-s-color-icon);\n        margin-right: -0.8rem;\n      }\n      .header-close-button:hover {\n        background-color: var(--w-color-button-pill-background-hover);\n      }\n      .header-close-button:active {\n        background-color: var(--w-color-button-pill-background-active);\n      }\n      .header-close-button-on-image {\n        background-color: rgba(var(--w-rgb-black), 0.7);\n        right: 0.8rem;\n        top: 0.8rem;\n        position: absolute;\n        z-index: 10;\n        color: var(--w-s-color-text-inverted);\n      }\n      .header-close-button-on-image:hover {\n        background-color: rgba(var(--w-rgb-black), 0.85);\n      }\n      .header-close-button-on-image:active {\n        background-color: var(--w-black);\n      }\n      @media (min-width: 480px) {\n        .header-title-bar {\n          padding-left: 3.2rem;\n          padding-right: 3.2rem;\n          padding-top: 2.4rem;\n        }\n        .header-title-with-top-area {\n          padding-left: 3.2rem;\n          padding-right: 3.2rem;\n        }\n        .header-button {\n          min-height: 32px;\n          min-width: 32px;\n        }\n      }\n    `,\n  ];\n}\n\nif (!customElements.get('w-modal-header')) {\n  customElements.define('w-modal-header', ModalHeader);\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-modal-header': ModalHeader;\n  }\n}\n", "let n = [];\nconst c = { documentElement: {}, body: {} }, i = Object.freeze({\n  // html\n  documentElement: {\n    \"scrollbar-gutter\": \"stable\"\n  },\n  body: {\n    overflow: \"hidden\",\n    position: \"relative\",\n    height: \"100%\"\n  }\n}), r = (t) => {\n  t.touches.length > 1 || t.preventDefault?.();\n}, h = (t) => ([e, s]) => {\n  c[t][e] = document[t].style[e], document[t].style[e] = s;\n}, a = () => Object.entries(i).forEach(([t, e]) => {\n  Object.entries(e).forEach(h(t));\n}), d = (t) => ([e, s]) => {\n  document[t].style[e] = c[t][e];\n}, f = () => Object.entries(c).forEach(([t, e]) => {\n  Object.entries(e).forEach(d(t));\n}), m = (t) => t.scrollHeight - Math.abs(t.scrollTop) === t.clientHeight;\nfunction y(t) {\n  let e = -1;\n  const s = (o) => {\n    if (o.targetTouches.length !== 1)\n      return;\n    const l = o.targetTouches[0].clientY - e;\n    return t.scrollTop === 0 && l > 0 || m(t) && l < 0 ? r(o) : (o.stopPropagation(), !0);\n  };\n  t.ontouchstart = (o) => {\n    o.targetTouches.length === 1 && (e = o.targetTouches[0].clientY);\n  }, t.ontouchmove = s;\n}\nfunction p(t) {\n  t.ontouchstart = null, t.ontouchmove = null;\n}\nconst u = (t) => () => document[t ? \"addEventListener\" : \"removeEventListener\"](\"touchmove\", r, { passive: !1 }), b = u(!0), g = u();\nfunction E(t) {\n  if (!t)\n    throw Error(\"Could not run setup, an element must be provided\");\n  n.some((e) => e === t) || (n.length || (a(), b()), y(t), n.push(t));\n}\nfunction T() {\n  n.forEach(p), g(), f(), n = [];\n}\nexport {\n  f as resetStyles,\n  a as setStyles,\n  E as setup,\n  i as styleTargets,\n  T as teardown\n};\n", "import { css, html, LitElement } from 'lit';\n\nimport { property, query } from 'lit/decorators.js';\nimport { setup as setupScrollLock, teardown as teardownScrollLock } from 'scroll-doctor';\n\nimport { reset } from '../styles.js';\n\nimport { ProvidesCanCloseToSlotsMixin } from './util.js';\n\n/**\n * Modals (or dialogs) display important information that users need to acknowledge.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/overlays-modal--docs)\n *\n * @slot header - Typically where you would use the `w-modal-header` component.\n * @slot content - The main content of the modal.\n * @slot footer - Typically where you would use the `w-modal-footer` component, for things like actions.\n */\nexport class ModalMain extends ProvidesCanCloseToSlotsMixin(LitElement) {\n  @property({ type: Boolean }) show: boolean;\n  @property({ type: String, attribute: 'content-id' }) contentId: string;\n  @property({ type: Boolean, attribute: 'ignore-backdrop-clicks' }) ignoreBackdropClicks: boolean;\n\n  @query('.dialog-el') dialogEl: HTMLDialogElement;\n  @query('.dialog-inner-el') dialogInnerEl: HTMLElement;\n  @query('.content-el') contentEl: HTMLElement;\n\n  constructor() {\n    super();\n    this.interceptEscape = this.interceptEscape.bind(this);\n    this.closeOnBackdropClick = this.closeOnBackdropClick.bind(this);\n    this.eventPreventer = this.eventPreventer.bind(this);\n    this.modifyBorderRadius = this.modifyBorderRadius.bind(this);\n  }\n\n  async open() {\n    this.dialogEl.showModal();\n    this.handleListeners();\n    setupScrollLock(this.contentEl);\n    await this.updateComplete;\n    this.dispatchEvent(new CustomEvent('shown', { bubbles: true, composed: true }));\n  }\n\n  close() {\n    this.handleListeners('removeEventListener');\n    this.dialogEl.classList.add('close');\n    this.dialogEl.addEventListener(\n      'animationend',\n      async () => {\n        this.dialogEl.classList.remove('close');\n        this.dialogEl.close();\n        teardownScrollLock();\n        await this.updateComplete;\n        this.dispatchEvent(new CustomEvent('hidden', { bubbles: true, composed: true }));\n      },\n      { once: true },\n    );\n  }\n\n  render() {\n    return html`\n      <dialog class=\"dialog-el\">\n        <div class=\"dialog-inner-el\">\n          <slot name=\"header\" @slotchange=\"${this.handleSlotChange}\"></slot>\n          <div class=\"content-el\" id=${this.contentId}>\n            <slot name=\"content\" @slotchange=\"${this.handleSlotChange}\"></slot>\n          </div>\n          <slot name=\"footer\" @slotchange=\"${this.handleSlotChange}\"></slot>\n        </div>\n      </dialog>\n    `;\n  }\n\n  updated(changedProperties: Map<string, unknown>) {\n    if (changedProperties.has('show')) this[this.show ? 'open' : 'close']();\n  }\n\n  handleListeners(verb = 'addEventListener') {\n    // HACK: escape normally fires 'cancel' but 'cancel' can only be intercepted once (browser bug/quirk)\n    document[verb]('keydown', this.interceptEscape);\n    // Using 'mousedown' instead of 'click' because mouse-up events on the backdrop also trigger 'click'\n    if (!this.ignoreBackdropClicks) this.dialogEl[verb]('mousedown', this.closeOnBackdropClick);\n    // HACK: 'close' fires once the dialog is closed, thus it's cannot animate\n    this.dialogEl[verb]('close', this.eventPreventer);\n    // HACK: this might not be needed since escape is intercepted, but better to be safe\n    this.dialogEl[verb]('cancel', this.eventPreventer);\n\n    this.dialogInnerEl[verb]('transitionend', this.modifyBorderRadius);\n  }\n\n  eventPreventer(evt: Event) {\n    evt.preventDefault();\n  }\n\n  closeOnBackdropClick(evt: MouseEvent) {\n    if (this.dialogEl === evt.target) this.close();\n  }\n\n  interceptEscape(evt: KeyboardEvent) {\n    if (evt.key === 'Escape') {\n      evt.preventDefault();\n      this.close();\n    }\n  }\n\n  modifyBorderRadius() {\n    if (this.dialogInnerEl.scrollHeight * 1.02 > innerHeight) this.dialogInnerEl.style.borderRadius = '0px';\n    else this.dialogInnerEl.style.borderRadius = null;\n  }\n\n  static styles = [\n    reset,\n    css`\n      .dialog-el {\n        --w-modal-translate-distance: 100%;\n        --w-modal-max-height: 80%;\n        --w-modal-width: 640px;\n        background-color: transparent;\n        border-width: 0;\n        align-items: flex-end;\n        inset: 0rem;\n        height: unset;\n        max-height: unset;\n        max-width: unset;\n        width: unset;\n        margin: auto;\n        padding: 0rem;\n        backface-visibility: hidden;\n      }\n      .dialog-inner-el {\n        will-change: height;\n        border-radius: 8px;\n        display: flex;\n        flex-direction: column;\n        overflow: hidden;\n        position: relative;\n        background-color: var(--w-s-color-background);\n        box-shadow: var(--w-shadow-m);\n        height: var(--w-modal-height);\n        max-height: var(--w-modal-max-height);\n        min-height: var(--w-modal-min-height);\n        width: var(--w-modal-width);\n        backface-visibility: hidden;\n        padding-bottom: calc(32px + env(safe-area-inset-bottom, 0px));\n        transition-property: all;\n        transition-timing-function: cubic-bezier(0.4, 0, 0.2, 1);\n        transition-duration: 150ms;\n        transition-timing-function: cubic-bezier(0.4, 0, 0.2, 1);\n      }\n      .content-el {\n        display: block;\n        flex-shrink: 1;\n        flex-grow: 1;\n        overflow-x: hidden;\n        overflow-y: auto;\n        position: relative;\n        margin-bottom: 0rem;\n        padding-left: 1.6rem;\n        padding-right: 1.6rem;\n      }\n      @media (min-width: 480px) {\n        .dialog-el {\n          --w-modal-translate-distance: 50%;\n          place-content: center;\n          place-items: center;\n        }\n        .dialog-inner-el {\n          margin-left: 1.6rem;\n          margin-right: 1.6rem;\n          padding-bottom: 3.2rem;\n        }\n        .content-el {\n          padding-left: 3.2rem;\n          padding-right: 3.2rem;\n        }\n      }\n      @media (max-width: 479.9px) {\n        .dialog-inner-el {\n          border-bottom-left-radius: 0;\n          border-bottom-right-radius: 0;\n        }\n      }\n      .dialog-el[open] {\n        animation: w-modal-in 0.3s ease-in-out forwards;\n        display: flex;\n        position: fixed;\n      }\n      .dialog-el.close {\n        animation: w-modal-out 0.3s ease-in-out forwards;\n      }\n      .dialog-el[open]::backdrop {\n        animation: backdrop-in 0.3s ease-in-out forwards;\n      }\n      .dialog-el.close::backdrop {\n        animation: backdrop-out 0.3s ease-in-out forwards;\n      }\n      /* shouldn't need two (in/out) animations declared here, but reversing is being weird */\n      @keyframes w-modal-in {\n        from {\n          transform: translateY(var(--w-modal-translate-distance));\n          opacity: 0;\n        }\n        to {\n          transform: translateY(0);\n          opacity: 1;\n        }\n      }\n      @keyframes w-modal-out {\n        from {\n          transform: translateY(0);\n          opacity: 1;\n        }\n        to {\n          transform: translateY(var(--w-modal-translate-distance));\n          opacity: 0;\n        }\n      }\n      @keyframes backdrop-in {\n        from {\n          background: transparent;\n        }\n        to {\n          background: rgba(0, 0, 0, 0.25);\n        }\n      }\n      @keyframes backdrop-out {\n        from {\n          background: rgba(0, 0, 0, 0.25);\n        }\n        to {\n          background: transparent;\n        }\n      }\n    `,\n  ];\n}\n\nif (!customElements.get('w-modal')) {\n  customElements.define('w-modal', ModalMain);\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-modal': ModalMain;\n  }\n}\n", "/**\n * @license\n * Copyright 2021 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\n/**\n * Returns an iterable containing the result of calling `f(value)` on each\n * value in `items`.\n *\n * @example\n *\n * ```ts\n * render() {\n *   return html`\n *     <ul>\n *       ${map(items, (i) => html`<li>${i}</li>`)}\n *     </ul>\n *   `;\n * }\n * ```\n */\nexport function* map<T>(\n  items: Iterable<T> | undefined,\n  f: (value: T, index: number) => unknown\n) {\n  if (items !== undefined) {\n    let i = 0;\n    for (const value of items) {\n      yield f(value, i++);\n    }\n  }\n}\n", "/**\n * @license\n * Copyright 2021 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\n/**\n * Returns an iterable of integers from `start` to `end` (exclusive)\n * incrementing by `step`.\n *\n * If `start` is omitted, the range starts at `0`. `step` defaults to `1`.\n *\n * @example\n *\n * ```ts\n * render() {\n *   return html`\n *     ${map(range(8), () => html`<div class=\"cell\"></div>`)}\n *   `;\n * }\n * ```\n */\nexport function range(end: number): Iterable<number>;\nexport function range(\n  start: number,\n  end: number,\n  step?: number\n): Iterable<number>;\nexport function* range(startOrEnd: number, end?: number, step = 1) {\n  const start = end === undefined ? 0 : startOrEnd;\n  end ??= startOrEnd;\n  for (let i = start; step > 0 ? i < end : end < i; i += step) {\n    yield i;\n  }\n}\n", "import { css } from 'lit';\n\nexport const styles = css`\n  .w-pageindicator {\n    display: grid;\n    justify-content: center;\n    height: max-content;\n    pointer-events: none;\n  }\n\n  .w-pageindicator--container {\n    display: grid;\n    grid-auto-flow: column;\n    gap: 8px;\n  }\n\n  .w-pageindicator--dot {\n    background-color: var(--w-s-color-background-disabled);\n    border-radius: 5px;\n    width: 10px;\n    height: 10px;\n  }\n\n  .w-pageindicator--selecteddot {\n    background-color: var(--w-s-color-icon-selected);\n  }\n`;\n", "import { html, LitElement, TemplateResult } from 'lit';\n\nimport { property } from 'lit/decorators.js';\nimport { classMap } from 'lit/directives/class-map.js';\nimport { map } from 'lit/directives/map.js';\nimport { range } from 'lit/directives/range.js';\n\nimport { styles } from './style.js';\n\nexport class WarpPageIndicator extends LitElement {\n  static styles = [styles];\n\n  /** Currently selected page (1-based index) */\n  @property({ type: Number, attribute: 'selected-page' })\n  selectedPage = 1;\n\n  /** Total number of pages */\n  @property({ type: Number, attribute: 'page-count' })\n  pageCount = 1;\n\n  render(): TemplateResult {\n    return html`\n      <div class=\"w-pageindicator\">\n        <div class=\"w-pageindicator--container\">\n          ${map(range(this.pageCount), (i) => {\n            const isSelected = i === this.selectedPage - 1;\n            const classes = {\n              'w-pageindicator--dot': true,\n              'w-pageindicator--selecteddot': isSelected,\n            };\n            return html`<div class=\"${classMap(classes)}\"></div>`;\n          })}\n        </div>\n      </div>\n    `;\n  }\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-pageindicator': WarpPageIndicator;\n  }\n}\n\nif (!customElements.get('w-pageindicator')) {\n  customElements.define('w-pageindicator', WarpPageIndicator);\n}\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/chevron-double-left/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/chevron-double-left/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/chevron-double-left/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/chevron-double-left/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/chevron-double-left/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconChevronDoubleLeft16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Double leftward arrow`, id: 'icon.title.chevron-double-left', comment: 'Title for chevron-double-left icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-chevron-double-left-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" stroke-width=\"1.5\" d=\"M7 13 2 8l5-5m7 10L9 8l5-5\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-chevron-double-left-16')) {\n  customElements.define('w-icon-chevron-double-left-16', IconChevronDoubleLeft16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-double-left\\\":[\\\"Dobbel pil til venstre\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-double-left\\\":[\\\"Double leftward arrow\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-double-left\\\":[\\\"Kaksi nuolta vasemmalle\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-double-left\\\":[\\\"Dobbelt venstrepil\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.chevron-double-left\\\":[\\\"Dubbel v\u00E4nsterpil\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"pagination.aria.first-page\\\":[\\\"F\u00F8rste side\\\"],\\\"pagination.aria.icon-suffix\\\":[\\\"ikon\\\"],\\\"pagination.aria.next-page\\\":[\\\"N\u00E6ste side\\\"],\\\"pagination.aria.page\\\":[\\\"Side \\\",[\\\"currentPage\\\"]],\\\"pagination.aria.pagination\\\":[\\\"Sider\\\"],\\\"pagination.aria.prev-page\\\":[\\\"Forrige side\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"pagination.aria.first-page\\\":[\\\"First page\\\"],\\\"pagination.aria.icon-suffix\\\":[\\\"icon\\\"],\\\"pagination.aria.next-page\\\":[\\\"Next page\\\"],\\\"pagination.aria.page\\\":[\\\"Page \\\",[\\\"currentPage\\\"]],\\\"pagination.aria.pagination\\\":[\\\"Pages\\\"],\\\"pagination.aria.prev-page\\\":[\\\"Previous page\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"pagination.aria.first-page\\\":[\\\"Ensimm\u00E4inen sivu\\\"],\\\"pagination.aria.icon-suffix\\\":[\\\"kuvake\\\"],\\\"pagination.aria.next-page\\\":[\\\"Seuraava sivu\\\"],\\\"pagination.aria.page\\\":[\\\"Sivu \\\",[\\\"currentPage\\\"]],\\\"pagination.aria.pagination\\\":[\\\"Sivut\\\"],\\\"pagination.aria.prev-page\\\":[\\\"Edellinen sivu\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"pagination.aria.first-page\\\":[\\\"F\u00F8rste side\\\"],\\\"pagination.aria.icon-suffix\\\":[\\\"ikon\\\"],\\\"pagination.aria.next-page\\\":[\\\"Neste side\\\"],\\\"pagination.aria.page\\\":[\\\"Side \\\",[\\\"currentPage\\\"]],\\\"pagination.aria.pagination\\\":[\\\"Sider\\\"],\\\"pagination.aria.prev-page\\\":[\\\"Forrige side\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"pagination.aria.first-page\\\":[\\\"F\u00F6rsta sidan\\\"],\\\"pagination.aria.icon-suffix\\\":[\\\"ikon\\\"],\\\"pagination.aria.next-page\\\":[\\\"N\u00E4sta sida\\\"],\\\"pagination.aria.page\\\":[\\\"Sida \\\",[\\\"currentPage\\\"]],\\\"pagination.aria.pagination\\\":[\\\"Sidor\\\"],\\\"pagination.aria.prev-page\\\":[\\\"F\u00F6reg\u00E5ende sida\\\"]}\");", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.hover\\\\:bg-clip-padding:hover{-webkit-background-clip:padding-box;background-clip:padding-box}.hover\\\\:bg-\\\\[--w-color-button-pill-background-hover\\\\]:hover{background-color:var(--w-color-button-pill-background-hover)}.active\\\\:bg-\\\\[--w-color-button-pill-background-active\\\\]:active{background-color:var(--w-color-button-pill-background-active)}.border-0{border-width:0}.rounded-full{border-radius:9999px}.flex{display:flex}.inline-flex{display:inline-flex}.hover\\\\:no-underline:hover,.focus\\\\:no-underline:focus{text-decoration:none}.focusable:focus{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:focus-visible{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:not(:focus-visible){outline:none}.items-center{align-items:center}.justify-center{justify-content:center}.static{position:static}.s-bg-primary{background-color:var(--w-s-color-background-primary)}.s-text-inverted{color:var(--w-s-color-text-inverted)}.s-text-link{color:var(--w-s-color-text-link)}.s-icon{color:var(--w-s-color-icon)}.min-h-\\\\[44px\\\\]{min-height:44px}.min-w-\\\\[44px\\\\]{min-width:44px}.p-4{padding:.4rem}.p-8{padding:.8rem}.visible{visibility:visible}.sr-only{clip:rect(0,0,0,0);white-space:nowrap;border-width:0;width:1px;height:1px;margin:-1px;padding:0;position:absolute;overflow:hidden}.transition-colors{transition-property:color,background-color,border-color,text-decoration-color,fill,stroke;transition-duration:.15s;transition-timing-function:cubic-bezier(.4,0,.2,1)}.ease-in-out{transition-timing-function:cubic-bezier(.4,0,.2,1)}@media (min-width:768px){.md\\\\:block{display:block}}`;\n", "// @warp-css;\nimport { html, LitElement, nothing } from 'lit';\n\nimport { i18n } from '@lingui/core';\nimport { property } from 'lit/decorators.js';\n\nimport '@warp-ds/icons/elements/chevron-double-left-16';\nimport '@warp-ds/icons/elements/chevron-left-16';\nimport '@warp-ds/icons/elements/chevron-right-16';\nimport { activateI18n } from '../i18n.js';\nimport { reset } from '../styles.js';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\nimport { styles } from './styles';\n\nconst iconSuffix = i18n._({\n  id: 'pagination.aria.icon-suffix',\n  message: 'icon',\n  comment: 'Suffix added at the end of icon titles when img semantics are lost on an html element',\n});\n\nconst baseItemStyles =\n  'hover:no-underline focus:no-underline focusable inline-flex justify-center items-center transition-colors ease-in-out min-h-[44px] min-w-[44px] p-4 rounded-full border-0 hover:bg-clip-padding';\n\n/**\n * Pagination allows users to navigate through multiple pages of content by providing navigation controls with page numbers and directional arrows.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/navigation-pagination--docs)\n *\n * @fires {CustomEvent} page-click - Triggered when a link button in the pagination is clicked. Contains the page number in `string` form.\n */\nclass WarpPagination extends LitElement {\n  @property({ type: String, reflect: true, attribute: 'base-url' })\n  baseUrl: string;\n\n  @property({ type: Number, reflect: true })\n  pages: number;\n\n  @property({ type: Number, reflect: true, attribute: 'current-page' })\n  currentPageNumber = 1;\n\n  @property({ type: Number, reflect: true, attribute: 'visible-pages' })\n  visiblePages = 7;\n\n  static styles = [reset, styles];\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  }\n\n  /** @internal */\n  get shouldShowShowFirstPageButton() {\n    return this.currentPageNumber - 2 > 0;\n  }\n\n  /** @internal */\n  get shouldShowPreviousPageButton() {\n    return this.currentPageNumber - 1 > 0;\n  }\n\n  /** @internal */\n  get shouldShowNextPageButton() {\n    return this.currentPageNumber < this.pages;\n  }\n\n  /** @internal */\n  get currentPageIndex() {\n    return this.currentPageNumber - 1;\n  }\n\n  /** @internal */\n  get visiblePageNumbers() {\n    if (this.pages <= this.visiblePages) {\n      // Show all pages if total pages is less than or equal to visible pages\n      return Array.from({ length: this.pages }, (_, i) => i + 1);\n    }\n\n    const half = Math.floor(this.visiblePages / 2);\n    let start = Math.max(1, this.currentPageNumber - half);\n    const end = Math.min(this.pages, start + this.visiblePages - 1);\n\n    // Adjust start if we're near the end\n    if (end - start + 1 < this.visiblePages) {\n      start = Math.max(1, end - this.visiblePages + 1);\n    }\n\n    return Array.from({ length: end - start + 1 }, (_, i) => start + i);\n  }\n\n  #dispatchClickPage(e: PointerEvent) {\n    const clickedPage = (e.target as Element).getAttribute('data-page-number');\n\n    this.dispatchEvent(\n      new CustomEvent('page-click', {\n        detail: { clickedPage },\n        bubbles: true,\n        composed: true,\n      }),\n    );\n  }\n\n  render() {\n    const visiblePages = this.visiblePageNumbers;\n\n    return html`<nav class=\"flex items-center justify-center p-8\" @click=\"${this.#dispatchClickPage}\">\n      <h1 class=\"sr-only\">\n        ${i18n._({\n          id: 'pagination.aria.pagination',\n          message: 'Pages',\n          comment: 'Default screenreader message for pagination container in the pagination component',\n        })}\n      </h1>\n      <div class=\"md:block s-text-link\">\n        ${this.shouldShowShowFirstPageButton\n          ? html`<a\n              data-page-number=\"1\"\n              href=\"${this.baseUrl}1\"\n              class=\"${baseItemStyles +\n              ' s-icon hover:bg-[--w-color-button-pill-background-hover] active:bg-[--w-color-button-pill-background-active]'}\">\n              <span class=\"sr-only\"\n                >${i18n._({\n                  id: 'pagination.aria.first-page',\n                  message: 'First page',\n                  comment: 'Default screenreader message for first page link in the pagination component',\n                })},</span\n              >\n              <w-icon-chevron-double-left-16></w-icon-chevron-double-left-16>\n              <span class=\"sr-only\">${iconSuffix}</span>\n            </a>`\n          : nothing}\n        ${this.shouldShowPreviousPageButton\n          ? html`<a\n              data-page-number=\"${this.currentPageNumber - 1}\"\n              href=\"${this.baseUrl}${this.currentPageNumber - 1}\"\n              class=\"${baseItemStyles +\n              ' s-icon hover:bg-[--w-color-button-pill-background-hover] active:bg-[--w-color-button-pill-background-active]'}\">\n              <span class=\"sr-only\"\n                >${i18n._({\n                  id: 'pagination.aria.prev-page',\n                  message: 'Previous page',\n                  comment: 'Default screenreader message for previous page link in the pagination component',\n                })},</span\n              >\n              <w-icon-chevron-left-16></w-icon-chevron-left-16>\n              <span class=\"sr-only\">${iconSuffix}</span>\n            </a>`\n          : nothing}\n        ${visiblePages.map((pageNumber) => {\n          const isCurrentPage = pageNumber === this.currentPageNumber;\n          const url = `${this.baseUrl}${pageNumber}`;\n\n          let styles = baseItemStyles;\n\n          if (isCurrentPage) {\n            styles += ' s-bg-primary s-text-inverted';\n          } else {\n            styles += ' hover:bg-[--w-color-button-pill-background-hover] active:bg-[--w-color-button-pill-background-active]';\n          }\n\n          const ariaLabel = i18n._({\n            id: 'pagination.aria.page',\n            message: 'Page {currentPage}',\n            values: { currentPage: pageNumber },\n            comment: 'Default screenreader message for page link in the pagination component',\n          });\n\n          return html`<a\n            data-page-number=\"${pageNumber}\"\n            aria-label=\"${ariaLabel}\"\n            href=\"${url}\"\n            class=\"${styles}\"\n            aria-current=\"${isCurrentPage ? 'page' : ''}\"\n            >${pageNumber}</a\n          >`;\n        })}\n        ${this.shouldShowNextPageButton\n          ? html`<a\n              data-page-number=\"${this.currentPageNumber + 1}\"\n              href=\"${this.baseUrl}${this.currentPageNumber + 1}\"\n              class=\"${baseItemStyles +\n              ' s-icon hover:bg-[--w-color-button-pill-background-hover] active:bg-[--w-color-button-pill-background-active]'}\">\n              <span class=\"sr-only\">\n                ${i18n._({\n                  id: 'pagination.aria.next-page',\n                  message: 'Next page',\n                  comment: 'Default screenreader message for next page link in the pagination component',\n                })},</span\n              >\n              <w-icon-chevron-right-16></w-icon-chevron-right-16>\n              <span class=\"sr-only\">${iconSuffix}</span>\n            </a>`\n          : nothing}\n      </div>\n    </nav>`;\n  }\n}\n\nif (!customElements.get('w-pagination')) {\n  customElements.define('w-pagination', WarpPagination);\n}\n\nexport { WarpPagination };\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-pagination': WarpPagination;\n  }\n}\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"pill.aria.openFilter\\\":[\\\"\u00C5bn filter\\\"],\\\"pill.aria.removeFilter\\\":[\\\"Fjern filter \\\",[\\\"label\\\"]]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"pill.aria.openFilter\\\":[\\\"Open filter\\\"],\\\"pill.aria.removeFilter\\\":[\\\"Remove filter \\\",[\\\"label\\\"]]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"pill.aria.openFilter\\\":[\\\"Avaa suodatin\\\"],\\\"pill.aria.removeFilter\\\":[\\\"Tyhjenn\u00E4 suodatin \\\",[\\\"label\\\"]]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"pill.aria.openFilter\\\":[\\\"\u00C5pne filter\\\"],\\\"pill.aria.removeFilter\\\":[\\\"Fjern filter \\\",[\\\"label\\\"]]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"pill.aria.openFilter\\\":[\\\"\u00D6ppna filter\\\"],\\\"pill.aria.removeFilter\\\":[\\\"Ta bort filtret \\\",[\\\"label\\\"]]}\");", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.bg-\\\\[--w-color-pill-suggestion-background\\\\]{background-color:var(--w-color-pill-suggestion-background)}.hover\\\\:bg-\\\\[--w-color-pill-suggestion-background-hover\\\\]:hover{background-color:var(--w-color-pill-suggestion-background-hover)}.active\\\\:bg-\\\\[--w-color-pill-suggestion-background-active\\\\]:active{background-color:var(--w-color-pill-suggestion-background-active)}.rounded-l-full{border-top-left-radius:9999px;border-bottom-left-radius:9999px}.rounded-r-full{border-top-right-radius:9999px;border-bottom-right-radius:9999px}.flex{display:flex}.inline-flex{display:inline-flex}.focusable:focus{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:focus-visible{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:not(:focus-visible){outline:none}.items-center{align-items:center}.static{position:static}.s-bg-primary{background-color:var(--w-s-color-background-primary)}.hover\\\\:s-bg-primary-hover:hover{background-color:var(--w-s-color-background-primary-hover)}.active\\\\:s-bg-primary-active:active{background-color:var(--w-s-color-background-primary-active)}.s-text{color:var(--w-s-color-text)}.s-text-inverted{color:var(--w-s-color-text-inverted)}.h-16{height:1.6rem}.py-8{padding-top:.8rem;padding-bottom:.8rem}.pl-12{padding-left:1.2rem}.pl-4{padding-left:.4rem}.pr-12{padding-right:1.2rem}.pr-2{padding-right:.2rem}.font-bold{font-weight:700}.sr-only{clip:rect(0,0,0,0);white-space:nowrap;border-width:0;width:1px;height:1px;margin:-1px;padding:0;position:absolute;overflow:hidden}.transition-all{transition-property:all;transition-duration:.15s;transition-timing-function:cubic-bezier(.4,0,.2,1)}.text-xs{font-size:var(--w-font-size-xs);line-height:var(--w-line-height-xs)}`;\n", "// @warp-css;\n\nimport { html, LitElement } from 'lit';\nimport '@warp-ds/icons/elements/close-16';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { i18n } from '@lingui/core';\nimport { property } from 'lit/decorators.js';\n\nimport { activateI18n } from '../i18n';\nimport { reset } from '../styles.js';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\nimport { styles } from './styles.js';\n\nexport const pillStyles = {\n  wrapper: 'flex items-center',\n  button: 'inline-flex items-center focusable text-xs transition-all',\n  suggestion:\n    'bg-[--w-color-pill-suggestion-background] hover:bg-[--w-color-pill-suggestion-background-hover] active:bg-[--w-color-pill-suggestion-background-active] s-text font-bold',\n  filter: 's-bg-primary hover:s-bg-primary-hover active:s-bg-primary-active s-text-inverted',\n  label: 'pl-12 py-8 rounded-l-full',\n  labelWithoutClose: 'pr-12 rounded-r-full',\n  labelWithClose: 'pr-2',\n  close: 'pr-12 pl-4 py-8 rounded-r-full',\n  closeIcon: 'h-16',\n  a11y: 'sr-only',\n};\n\n/**\n * Pill is a type of button that is often used as a filter, but can also be used as a rounded button for overlays, etc.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/buttons-pill--docs)\n */\nclass WarpPill extends LitElement {\n  @property({ attribute: 'can-close', type: Boolean }) canClose: boolean;\n  @property({ attribute: 'suggestion', type: Boolean }) suggestion: boolean;\n  /**\n   * @deprecated Used \"open-arial-label\" instead.\n   */\n  @property({ attribute: 'open-sr-label', type: String }) openSrLabel: string;\n  @property({ attribute: 'open-aria-label', type: String }) openAriaLabel: string;\n  /**\n   * @deprecated Used \"close-arial-label\" instead.\n   */\n  @property({ attribute: 'close-sr-label', type: String }) closeSrLabel: string;\n  @property({ attribute: 'close-aria-label', type: String }) closeAriaLabel: string;\n\n  /** @internal */\n  openFilterSrText: string;\n  /** @internal */\n  removeFilterSrText: string;\n\n  static styles = [reset, styles];\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n    this.canClose = false;\n    this.suggestion = false;\n\n    this.openFilterSrText = i18n._({\n      id: 'pill.aria.openFilter',\n      message: 'Open filter',\n      comment: 'Fallback screen reader message for open filter',\n    });\n\n    this.removeFilterSrText = i18n._({\n      id: 'pill.aria.removeFilter',\n      message: 'Remove filter {label}',\n      comment: 'Fallback screen reader message for removal of the filter',\n    });\n  }\n\n  /** @internal */\n  get _labelClasses() {\n    return classNames([\n      pillStyles.button,\n      pillStyles.label,\n      this.suggestion ? pillStyles.suggestion : pillStyles.filter,\n      this.canClose ? pillStyles.labelWithClose : pillStyles.labelWithoutClose,\n    ]);\n  }\n\n  /** @internal */\n  get _closeClasses() {\n    return classNames([pillStyles.button, pillStyles.close, this.suggestion ? pillStyles.suggestion : pillStyles.filter]);\n  }\n\n  /** @internal */\n  _onClick() {\n    this.dispatchEvent(new CustomEvent('w-pill-click', { bubbles: true, composed: true }));\n  }\n\n  /** @internal */\n  _onClose() {\n    this.dispatchEvent(new CustomEvent('w-pill-close', { bubbles: true, composed: true }));\n  }\n\n  connectedCallback() {\n    super.connectedCallback();\n    if (this.openSrLabel) {\n      this.openAriaLabel = this.openSrLabel;\n    }\n    if (this.closeSrLabel) {\n      this.closeAriaLabel = this.closeSrLabel;\n    }\n  }\n\n  render() {\n    return html`\n      <div class=\"${pillStyles.wrapper}\">\n        <button type=\"button\" class=\"${this._labelClasses}\" @click=\"${this._onClick}\">\n          <span class=\"${pillStyles.a11y}\">${this.openAriaLabel ? this.openAriaLabel : this.openFilterSrText}</span>\n          <slot></slot>\n        </button>\n        ${this.canClose\n          ? html` <button type=\"button\" class=\"${this._closeClasses}\" @click=\"${this._onClose}\">\n              <span class=\"${pillStyles.a11y}\">${this.closeAriaLabel ? this.closeAriaLabel : this.removeFilterSrText}</span>\n              <w-icon-close-16 class=\"${pillStyles.closeIcon}\"></w-icon-close-16>\n            </button>`\n          : null}\n      </div>\n    `;\n  }\n}\n\nif (!customElements.get('w-pill')) {\n  customElements.define('w-pill', WarpPill);\n}\n\nexport { WarpPill };\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-pill': WarpPill;\n  }\n}\n", "/**\n * @license\n * Copyright 2020 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\nimport {\n  _$LH,\n  Part,\n  DirectiveParent,\n  CompiledTemplateResult,\n  MaybeCompiledTemplateResult,\n  UncompiledTemplateResult,\n} from './lit-html.js';\nimport {\n  DirectiveResult,\n  DirectiveClass,\n  PartInfo,\n  AttributePartInfo,\n} from './directive.js';\ntype Primitive = null | undefined | boolean | number | string | symbol | bigint;\n\nconst {_ChildPart: ChildPart} = _$LH;\n\ntype ChildPart = InstanceType<typeof ChildPart>;\n\nconst ENABLE_SHADYDOM_NOPATCH = true;\n\nconst wrap =\n  ENABLE_SHADYDOM_NOPATCH &&\n  window.ShadyDOM?.inUse &&\n  window.ShadyDOM?.noPatch === true\n    ? window.ShadyDOM!.wrap\n    : (node: Node) => node;\n\n/**\n * Tests if a value is a primitive value.\n *\n * See https://tc39.github.io/ecma262/#sec-typeof-operator\n */\nexport const isPrimitive = (value: unknown): value is Primitive =>\n  value === null || (typeof value != 'object' && typeof value != 'function');\n\nexport const TemplateResultType = {\n  HTML: 1,\n  SVG: 2,\n  MATHML: 3,\n} as const;\n\nexport type TemplateResultType =\n  (typeof TemplateResultType)[keyof typeof TemplateResultType];\n\ntype IsTemplateResult = {\n  (val: unknown): val is MaybeCompiledTemplateResult;\n  <T extends TemplateResultType>(\n    val: unknown,\n    type: T\n  ): val is UncompiledTemplateResult<T>;\n};\n\n/**\n * Tests if a value is a TemplateResult or a CompiledTemplateResult.\n */\nexport const isTemplateResult: IsTemplateResult = (\n  value: unknown,\n  type?: TemplateResultType\n): value is UncompiledTemplateResult =>\n  type === undefined\n    ? // This property needs to remain unminified.\n      (value as UncompiledTemplateResult)?.['_$litType$'] !== undefined\n    : (value as UncompiledTemplateResult)?.['_$litType$'] === type;\n\n/**\n * Tests if a value is a CompiledTemplateResult.\n */\nexport const isCompiledTemplateResult = (\n  value: unknown\n): value is CompiledTemplateResult => {\n  return (value as CompiledTemplateResult)?.['_$litType$']?.h != null;\n};\n\n/**\n * Tests if a value is a DirectiveResult.\n */\nexport const isDirectiveResult = (value: unknown): value is DirectiveResult =>\n  // This property needs to remain unminified.\n  (value as DirectiveResult)?.['_$litDirective$'] !== undefined;\n\n/**\n * Retrieves the Directive class for a DirectiveResult\n */\nexport const getDirectiveClass = (value: unknown): DirectiveClass | undefined =>\n  // This property needs to remain unminified.\n  (value as DirectiveResult)?.['_$litDirective$'];\n\n/**\n * Tests whether a part has only a single-expression with no strings to\n * interpolate between.\n *\n * Only AttributePart and PropertyPart can have multiple expressions.\n * Multi-expression parts have a `strings` property and single-expression\n * parts do not.\n */\nexport const isSingleExpression = (part: PartInfo) =>\n  (part as AttributePartInfo).strings === undefined;\n\nconst createMarker = () => document.createComment('');\n\n/**\n * Inserts a ChildPart into the given container ChildPart's DOM, either at the\n * end of the container ChildPart, or before the optional `refPart`.\n *\n * This does not add the part to the containerPart's committed value. That must\n * be done by callers.\n *\n * @param containerPart Part within which to add the new ChildPart\n * @param refPart Part before which to add the new ChildPart; when omitted the\n *     part added to the end of the `containerPart`\n * @param part Part to insert, or undefined to create a new part\n */\nexport const insertPart = (\n  containerPart: ChildPart,\n  refPart?: ChildPart,\n  part?: ChildPart\n): ChildPart => {\n  const container = wrap(containerPart._$startNode).parentNode!;\n\n  const refNode =\n    refPart === undefined ? containerPart._$endNode : refPart._$startNode;\n\n  if (part === undefined) {\n    const startNode = wrap(container).insertBefore(createMarker(), refNode);\n    const endNode = wrap(container).insertBefore(createMarker(), refNode);\n    part = new ChildPart(\n      startNode,\n      endNode,\n      containerPart,\n      containerPart.options\n    );\n  } else {\n    const endNode = wrap(part._$endNode!).nextSibling;\n    const oldParent = part._$parent;\n    const parentChanged = oldParent !== containerPart;\n    if (parentChanged) {\n      part._$reparentDisconnectables?.(containerPart);\n      // Note that although `_$reparentDisconnectables` updates the part's\n      // `_$parent` reference after unlinking from its current parent, that\n      // method only exists if Disconnectables are present, so we need to\n      // unconditionally set it here\n      part._$parent = containerPart;\n      // Since the _$isConnected getter is somewhat costly, only\n      // read it once we know the subtree has directives that need\n      // to be notified\n      let newConnectionState;\n      if (\n        part._$notifyConnectionChanged !== undefined &&\n        (newConnectionState = containerPart._$isConnected) !==\n          oldParent!._$isConnected\n      ) {\n        part._$notifyConnectionChanged(newConnectionState);\n      }\n    }\n    if (endNode !== refNode || parentChanged) {\n      let start: Node | null = part._$startNode;\n      while (start !== endNode) {\n        const n: Node | null = wrap(start!).nextSibling;\n        wrap(container).insertBefore(start!, refNode);\n        start = n;\n      }\n    }\n  }\n\n  return part;\n};\n\n/**\n * Sets the value of a Part.\n *\n * Note that this should only be used to set/update the value of user-created\n * parts (i.e. those created using `insertPart`); it should not be used\n * by directives to set the value of the directive's container part. Directives\n * should return a value from `update`/`render` to update their part state.\n *\n * For directives that require setting their part value asynchronously, they\n * should extend `AsyncDirective` and call `this.setValue()`.\n *\n * @param part Part to set\n * @param value Value to set\n * @param index For `AttributePart`s, the index to set\n * @param directiveParent Used internally; should not be set by user\n */\nexport const setChildPartValue = <T extends ChildPart>(\n  part: T,\n  value: unknown,\n  directiveParent: DirectiveParent = part\n): T => {\n  part._$setValue(value, directiveParent);\n  return part;\n};\n\n// A sentinel value that can never appear as a part value except when set by\n// live(). Used to force a dirty-check to fail and cause a re-render.\nconst RESET_VALUE = {};\n\n/**\n * Sets the committed value of a ChildPart directly without triggering the\n * commit stage of the part.\n *\n * This is useful in cases where a directive needs to update the part such\n * that the next update detects a value change or not. When value is omitted,\n * the next update will be guaranteed to be detected as a change.\n *\n * @param part\n * @param value\n */\nexport const setCommittedValue = (part: Part, value: unknown = RESET_VALUE) =>\n  (part._$committedValue = value);\n\n/**\n * Returns the committed value of a ChildPart.\n *\n * The committed value is used for change detection and efficient updates of\n * the part. It can differ from the value set by the template or directive in\n * cases where the template value is transformed before being committed.\n *\n * - `TemplateResult`s are committed as a `TemplateInstance`\n * - Iterables are committed as `Array<ChildPart>`\n * - All other types are committed as the template value or value returned or\n *   set by a directive.\n *\n * @param part\n */\nexport const getCommittedValue = (part: ChildPart) => part._$committedValue;\n\n/**\n * Removes a ChildPart from the DOM, including any of its content and markers.\n *\n * Note: The only difference between this and clearPart() is that this also\n * removes the part's start node. This means that the ChildPart must own its\n * start node, ie it must be a marker node specifically for this part and not an\n * anchor from surrounding content.\n *\n * @param part The Part to remove\n */\nexport const removePart = (part: ChildPart) => {\n  part._$clear();\n  part._$startNode.remove();\n};\n\nexport const clearPart = (part: ChildPart) => {\n  part._$clear();\n};\n", "/**\n * @license\n * Copyright 2020 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\nimport {AttributePart, noChange, nothing} from '../lit-html.js';\nimport {\n  directive,\n  Directive,\n  DirectiveParameters,\n  PartInfo,\n  PartType,\n} from '../directive.js';\nimport {isSingleExpression, setCommittedValue} from '../directive-helpers.js';\n\nclass LiveDirective extends Directive {\n  constructor(partInfo: PartInfo) {\n    super(partInfo);\n    if (\n      !(\n        partInfo.type === PartType.PROPERTY ||\n        partInfo.type === PartType.ATTRIBUTE ||\n        partInfo.type === PartType.BOOLEAN_ATTRIBUTE\n      )\n    ) {\n      throw new Error(\n        'The `live` directive is not allowed on child or event bindings'\n      );\n    }\n    if (!isSingleExpression(partInfo)) {\n      throw new Error('`live` bindings can only contain a single expression');\n    }\n  }\n\n  render(value: unknown) {\n    return value;\n  }\n\n  override update(part: AttributePart, [value]: DirectiveParameters<this>) {\n    if (value === noChange || value === nothing) {\n      return value;\n    }\n    const element = part.element;\n    const name = part.name;\n\n    if (part.type === PartType.PROPERTY) {\n      // eslint-disable-next-line @typescript-eslint/no-explicit-any\n      if (value === (element as any)[name]) {\n        return noChange;\n      }\n    } else if (part.type === PartType.BOOLEAN_ATTRIBUTE) {\n      if (!!value === element.hasAttribute(name)) {\n        return noChange;\n      }\n    } else if (part.type === PartType.ATTRIBUTE) {\n      if (element.getAttribute(name) === String(value)) {\n        return noChange;\n      }\n    }\n    // Resets the part's value, causing its dirty-check to fail so that it\n    // always sets the value.\n    setCommittedValue(part);\n    return value;\n  }\n}\n\n/**\n * Checks binding values against live DOM values, instead of previously bound\n * values, when determining whether to update the value.\n *\n * This is useful for cases where the DOM value may change from outside of\n * lit-html, such as with a binding to an `<input>` element's `value` property,\n * a content editable elements text, or to a custom element that changes it's\n * own properties or attributes.\n *\n * In these cases if the DOM value changes, but the value set through lit-html\n * bindings hasn't, lit-html won't know to update the DOM value and will leave\n * it alone. If this is not what you want--if you want to overwrite the DOM\n * value with the bound value no matter what--use the `live()` directive:\n *\n * ```js\n * html`<input .value=${live(x)}>`\n * ```\n *\n * `live()` performs a strict equality check against the live DOM value, and if\n * the new value is equal to the live value, does nothing. This means that\n * `live()` should not be used when the binding will cause a type conversion. If\n * you use `live()` with an attribute binding, make sure that only strings are\n * passed in, or the binding will update every render.\n */\nexport const live = directive(LiveDirective);\n\n/**\n * The type of the class that powers this directive. Necessary for naming the\n * directive's return type.\n */\nexport type {LiveDirective};\n", ":host {\n  box-sizing: border-box !important;\n}\n\n:host *,\n:host *::before,\n:host *::after {\n  box-sizing: inherit !important;\n}\n\n", "// eslint-disable-next-line\n// @ts-nocheck\nimport type { CSSResult, CSSResultGroup } from 'lit';\nimport { LitElement, unsafeCSS } from 'lit';\n\nimport { property } from 'lit/decorators.js';\n\nimport hostStyles from './host.css?inline';\n\n// Augment Lit's module\ndeclare module 'lit' {\n  interface PropertyDeclaration {\n    /**\n     * Specifies the property\u2019s default value\n     */\n    /* eslint-disable */\n    default?: any;\n    /* eslint-disable */\n    initial?: any;\n  }\n}\n\nexport default class BaseElement extends LitElement {\n  /**\n   * One or more CSS files to include in the component's shadow root. Host styles are automatically prepended. We use\n   * this instead of Lit's styles property because we're importing CSS files as strings and need to convert them using\n   * unsafeCSS.\n   */\n  static css?: CSSResultGroup | CSSResult | string | (CSSResult | string)[];\n\n  /**\n   * Override the default styles property to fetch and convert string CSS files. Components can override this behavior\n   * by setting their own `static styles = []` property.\n   */\n  static get styles(): CSSResultGroup {\n    const styles = Array.isArray(this.css) ? this.css : this.css ? [this.css] : [];\n    return [hostStyles, ...styles].map((style) => (typeof style === 'string' ? unsafeCSS(style) : style));\n  }\n\n  #hasRecordedInitialProperties = false;\n  initialReflectedProperties: Map<string, unknown> = new Map();\n  internals: ElementInternals;\n\n  // Make localization attributes reactive\n  @property() dir: string;\n  @property() lang: string;\n\n  constructor() {\n    super();\n\n    try {\n      this.internals = this.attachInternals();\n    } catch {\n      /* Need to tell people if they need a polyfill. */\n\n      console.error('Element internals are not supported in your browser. Consider using a polyfill');\n    }\n\n    this.customStates.set('wa-defined', true);\n\n    const Self = this.constructor as typeof BaseElement;\n    for (const [property, spec] of Self.elementProperties) {\n      if (spec.default === 'inherit' && spec.initial !== undefined && typeof property === 'string') {\n        this.customStates.set(`initial-${property}-${spec.initial}`, true);\n      }\n    }\n  }\n\n  attributeChangedCallback(name: string, oldValue: string | null, newValue: string | null) {\n    if (!this.#hasRecordedInitialProperties) {\n      (this.constructor as typeof BaseElement).elementProperties.forEach((obj, prop: keyof typeof this & string) => {\n\n          if (obj.reflect && this[prop] != null) {\n          this.initialReflectedProperties.set(prop, this[prop]);\n        }\n      });\n\n      this.#hasRecordedInitialProperties = true;\n    }\n\n    super.attributeChangedCallback(name, oldValue, newValue);\n  }\n\n  protected willUpdate(changedProperties: Parameters<LitElement['willUpdate']>[0]): void {\n    super.willUpdate(changedProperties);\n\n    // Run the morph fixing *after* willUpdate.\n    this.initialReflectedProperties.forEach((value, prop: string & keyof typeof this) => {\n      // If a prop changes to `null`, we assume this happens via an attribute changing to `null`.\n\n      if (changedProperties.has(prop) && this[prop] == null) {\n        // Silly type gymnastics to appease the compiler.\n        (this as Record<string, unknown>)[prop] = value;\n      }\n    });\n  }\n\n  /**\n   * Methods for setting and checking custom states.\n   */\n  public customStates = {\n    /** Adds or removes the specified custom state. */\n    set: (customState: string, active: boolean) => {\n      if (!this.internals?.states) return;\n      if (active) {\n        this.internals.states.add(customState);\n      } else {\n        this.internals.states.delete(customState);\n      }\n    },\n\n    /** Determines whether or not the element currently has the specified state. */\n    has: (customState: string) => {\n      if (!this.internals?.states) return false;\n      return this.internals.states.has(customState);\n    },\n  };\n\n  /**\n   * Given a native event, this function cancels it and dispatches it again from the host element using the desired\n   * event options.\n   */\n  relayNativeEvent(event: Event, eventOptions?: EventInit) {\n    event.stopImmediatePropagation();\n\n    this.dispatchEvent(\n      new (event.constructor as typeof Event)(event.type, {\n        ...event,\n        ...eventOptions,\n      }),\n    );\n  }\n}\n", "import type { Validator } from './form-associated-element';\n\n/**\n * This validator is for if you have an exact copy of your element in the shadow DOM. Rather than needing\n * custom translations and error messages, you can simply rely on the element \"formControl\" in your shadow dom.\n */\nexport const CustomErrorValidator = (): Validator => {\n  return {\n    observedAttributes: ['custom-error'],\n    checkValidity(element) {\n      const validity: ReturnType<Validator['checkValidity']> = {\n        message: '',\n        isValid: true,\n        invalidKeys: [],\n      };\n\n      if (element.customError) {\n        validity.message = element.customError;\n        validity.isValid = false;\n        validity.invalidKeys = ['customError'];\n      }\n\n      return validity;\n    },\n  };\n};\n", "export class WInvalidEvent extends Event {\n  constructor() {\n    super('w-invalid', { bubbles: true, cancelable: false, composed: true });\n  }\n}\n\ndeclare global {\n  interface GlobalEventHandlersEventMap {\n    'wa-invalid': WInvalidEvent;\n  }\n}\n", "import { LitElement, isServer } from 'lit';\n\nimport { property } from 'lit/decorators.js';\n\nimport BaseElement from './base-element.js';\nimport { CustomErrorValidator } from './custom-error-validator.js';\nimport { WInvalidEvent } from './invalid';\n\nexport interface Validator<T extends BaseFormAssociatedElement = BaseFormAssociatedElement> {\n  observedAttributes?: string[];\n  checkValidity: (element: T) => {\n    message: string;\n    isValid: boolean;\n    invalidKeys: Exclude<keyof ValidityState, 'valid'>[];\n  };\n  message?: string | ((element: T) => string);\n}\n\nexport interface BaseFormControl extends BaseElement {\n  // Form attributes\n  name: null | string;\n  disabled?: boolean;\n  defaultValue?: unknown;\n  defaultChecked?: boolean;\n  checked?: boolean;\n  defaultSelected?: boolean;\n  selected?: boolean;\n  form?: string | null;\n\n  value?: unknown;\n\n  // Constraint validation attributes\n  pattern?: string;\n  min?: number | string | Date;\n  max?: number | string | Date;\n  step?: number | 'any';\n  required?: boolean;\n  minlength?: number;\n  maxlength?: number;\n\n  // Form validation properties\n  readonly validity: ValidityState;\n  readonly validationMessage: string;\n\n  // Form validation methods\n  checkValidity: () => boolean;\n  getForm: () => HTMLFormElement | null;\n  reportValidity: () => boolean;\n  setCustomValidity: (message: string) => void;\n\n  // Form properties\n  hasInteracted: boolean;\n  valueHasChanged?: boolean;\n\n  /** Convenience API for `setCustomValidity()` */\n  customError: null | string;\n}\n\n// setFormValue omitted so that we can use `setValue`\nexport class BaseFormAssociatedElement extends BaseElement implements Omit<ElementInternals, 'form' | 'setFormValue'>, BaseFormControl {\n  static formAssociated = true;\n\n  /**\n   * Validators are static because they have `observedAttributes`, essentially attributes to \"watch\"\n   * for changes. Whenever these attributes change, we want to be notified and update the validator.\n   */\n  static get validators(): Validator[] {\n    return [CustomErrorValidator()];\n  }\n\n  // Append all Validator \"observedAttributes\" into the \"observedAttributes\" so they can run.\n  static get observedAttributes() {\n    const parentAttrs = new Set(super.observedAttributes || []);\n\n    for (const validator of this.validators) {\n      if (!validator.observedAttributes) {\n        continue;\n      }\n\n      for (const attr of validator.observedAttributes) {\n        parentAttrs.add(attr);\n      }\n    }\n\n    return [...parentAttrs];\n  }\n\n  // Form attributes\n  /** The name of the input, submitted as a name/value pair with form data. */\n  @property({ reflect: true }) name: string | null = null;\n\n  /** Disables the form control. */\n  @property({ type: Boolean }) disabled = false;\n\n  required: boolean = false;\n\n  assumeInteractionOn: string[] = ['input'];\n\n  // Additional\n  input?: (HTMLElement & { value: unknown }) | HTMLInputElement | HTMLTextAreaElement;\n\n  validators: Validator[] = [];\n\n  // Should these be private?\n  @property({ state: true, attribute: false }) valueHasChanged: boolean = false;\n  @property({ state: true, attribute: false }) hasInteracted: boolean = false;\n\n  // This works around a limitation in Safari. It is a hacky way for us to preserve custom errors generated by the user.\n  @property({ attribute: 'custom-error', reflect: true }) customError: string | null = null;\n\n  private emittedEvents: string[] = [];\n\n  constructor() {\n    super();\n\n    if (!isServer) {\n      this.addEventListener('invalid', this.emitInvalid);\n    }\n  }\n  // this bullshit makes no sense but tsc is angry about it\n  // this needs both 'private' and 'typeof' or it will be angry and we don't know why\n  // eslint-disable-next-line\n  // @ts-ignore\n  private states: typeof CustomStateSet;\n\n  connectedCallback() {\n    super.connectedCallback();\n    this.updateValidity();\n\n    // Lazily evaluate after the constructor to allow people to override the `assumeInteractionOn`\n    this.assumeInteractionOn.forEach((event) => {\n      this.addEventListener(event, this.handleInteraction);\n    });\n  }\n\n  firstUpdated(...args: Parameters<LitElement['firstUpdated']>) {\n    super.firstUpdated(...args);\n    this.updateValidity();\n  }\n\n  emitInvalid = (e: Event) => {\n    if (e.target !== this) return;\n\n    // An \"invalid\" event counts as interacted, this is usually triggered by a button \"submitting\"\n    this.hasInteracted = true;\n    this.dispatchEvent(new WInvalidEvent());\n  };\n\n  protected willUpdate(changedProperties: Parameters<LitElement['willUpdate']>[0]) {\n    if (!isServer && changedProperties.has('customError')) {\n      // We use null because it we really don't want it to show up in the attributes because `custom-error` does reflect\n      if (!this.customError) {\n        this.customError = null;\n      }\n      this.setCustomValidity(this.customError || '');\n    }\n\n    if (changedProperties.has('value') || changedProperties.has('disabled')) {\n      // @ts-expect-error Some components will use an accessors, other use a property, so we don't want to limit them.\n      const value = this.value as unknown;\n\n      // Accounts for the snowflake case on `<wa-select>`\n      if (Array.isArray(value)) {\n        if (this.name) {\n          const formData = new FormData();\n          for (const val of value) {\n            formData.append(this.name, val as string);\n          }\n          this.setValue(formData, formData);\n        }\n      } else {\n        this.setValue(value as FormData | string | File | null, value as FormData | string | File | null);\n      }\n    }\n\n    if (changedProperties.has('disabled')) {\n      this.customStates.set('disabled', this.disabled);\n\n      if (this.hasAttribute('disabled') || (!isServer && !this.matches(':disabled'))) {\n        this.toggleAttribute('disabled', this.disabled);\n      }\n    }\n\n    this.updateValidity();\n    super.willUpdate(changedProperties);\n  }\n\n  private handleInteraction = (event: Event) => {\n    const emittedEvents = this.emittedEvents;\n    if (!emittedEvents.includes(event.type)) {\n      emittedEvents.push(event.type);\n    }\n\n    // Mark it as user-interacted as soon as all associated events have been emitted\n    if (emittedEvents.length === this.assumeInteractionOn?.length) {\n      this.hasInteracted = true;\n    }\n  };\n\n  get labels() {\n    return this.internals.labels;\n  }\n\n  getForm() {\n    return this.internals.form;\n  }\n\n  @property({ attribute: false, state: true, type: Object })\n  get validity() {\n    return this.internals.validity;\n  }\n\n  // Not sure if this supports `novalidate`. Will need to test.\n  get willValidate() {\n    return this.internals.willValidate;\n  }\n\n  get validationMessage() {\n    return this.internals.validationMessage;\n  }\n\n  checkValidity() {\n    this.updateValidity();\n    return this.internals.checkValidity();\n  }\n\n  reportValidity() {\n    this.updateValidity();\n    // This seems reasonable. `reportValidity()` is kind of like \"we expect you to have interacted\"\n    this.hasInteracted = true;\n    return this.internals.reportValidity();\n  }\n\n  /**\n   * Override this to change where constraint validation popups are anchored.\n   */\n  get validationTarget(): undefined | HTMLElement {\n    return (this.input || undefined) as undefined | HTMLElement;\n  }\n\n  setValidity(...args: Parameters<typeof this.internals.setValidity>) {\n    const flags = args[0];\n    const message = args[1];\n    let anchor = args[2];\n\n    if (!anchor) {\n      anchor = this.validationTarget;\n    }\n\n    this.internals.setValidity(flags, message, anchor || undefined);\n    this.requestUpdate('validity');\n    this.setCustomStates();\n  }\n\n  setCustomStates() {\n    const required = Boolean(this.required);\n    const isValid = this.internals.validity.valid;\n    const hasInteracted = this.hasInteracted;\n\n    this.customStates.set('required', required);\n    this.customStates.set('optional', !required);\n    this.customStates.set('invalid', !isValid);\n    this.customStates.set('valid', isValid);\n    this.customStates.set('user-invalid', !isValid && hasInteracted);\n    this.customStates.set('user-valid', isValid && hasInteracted);\n  }\n\n  /**\n   * Do not use this when creating a \"Validator\". This is intended for end users of components.\n   * We track manually defined custom errors so we don't clear them on accident in our validators.\n   *\n   */\n  setCustomValidity(message: string) {\n    if (!message) {\n      // We use null because it we really don't want it to show up in the attributes because `custom-error` does reflect\n      this.customError = null;\n      this.setValidity({});\n      return;\n    }\n\n    this.customError = message;\n    this.setValidity({ customError: true }, message, this.validationTarget);\n  }\n\n  formResetCallback() {\n    this.resetValidity();\n    this.hasInteracted = false;\n    this.valueHasChanged = false;\n    this.emittedEvents = [];\n    this.updateValidity();\n  }\n\n  formDisabledCallback(isDisabled: boolean) {\n    this.disabled = isDisabled;\n\n    this.updateValidity();\n  }\n\n  /**\n   * Called when the browser is trying to restore element\u2019s state to state in which case reason is \"restore\", or when\n   * the browser is trying to fulfill autofill on behalf of user in which case reason is \"autocomplete\". In the case of\n   * \"restore\", state is a string, File, or FormData object previously set as the second argument to setFormValue.\n   */\n  formStateRestoreCallback(state: string | File | FormData | null, reason: 'autocomplete' | 'restore') {\n    // @ts-expect-error We purposely do not have a value property. It makes things hard to extend.\n    this.value = state;\n\n    if (reason === 'restore') {\n      this.resetValidity();\n    }\n\n    this.updateValidity();\n  }\n\n  setValue(...args: Parameters<typeof this.internals.setFormValue>) {\n    const [value, state] = args;\n\n    this.internals.setFormValue(value, state);\n  }\n\n  get allValidators() {\n    const staticValidators = (this.constructor as typeof BaseFormAssociatedElement).validators || [];\n\n    const validators = this.validators || [];\n    return [...staticValidators, ...validators];\n  }\n\n  /**\n   * Reset validity is a way of removing manual custom errors and native validation.\n   */\n  resetValidity() {\n    this.setCustomValidity('');\n    this.setValidity({});\n  }\n\n  updateValidity() {\n    if (\n      this.disabled ||\n      this.hasAttribute('disabled') ||\n      !this.willValidate //\n    ) {\n      this.resetValidity();\n\n      return;\n    }\n\n    const validators = this.allValidators;\n\n    if (!validators?.length) {\n      // If there's no validators, we do nothing. We also don't want to mess with custom errors, so we just stop here.\n      return;\n    }\n\n    type ValidityKey = { -readonly [P in keyof ValidityState]: ValidityState[P] };\n\n    const flags: Partial<ValidityKey> = {\n      // Don't trust custom errors from the Browser. Safari breaks the spec.\n      customError: Boolean(this.customError),\n    };\n\n    const formControl = this.validationTarget || this.input || undefined;\n\n    let finalMessage = '';\n\n    for (const validator of validators) {\n      const { isValid, message, invalidKeys } = validator.checkValidity(this);\n\n      if (isValid) {\n        continue;\n      }\n\n      if (!finalMessage) {\n        finalMessage = message;\n      }\n\n      if (invalidKeys?.length >= 0) {\n        (invalidKeys as (keyof ValidityState)[]).forEach((str) => (flags[str] = true));\n      }\n    }\n\n    // This is a workaround for preserving custom errors\n    if (!finalMessage) {\n      finalMessage = this.validationMessage;\n    }\n\n    this.setValidity(flags, finalMessage, formControl);\n  }\n}\n", "import type { Validator } from './form-associated-element';\n\nexport interface RequiredValidatorOptions {\n  /** This is a cheap way for us to get translation strings for the user without having proper translations. */\n  validationElement?: HTMLSelectElement | HTMLInputElement;\n\n  /**\n   * The property to check if its not null-ish. For most elements this will be \"value\".\n   * For \"checkbox\" for example it will be \"checked\"\n   */\n  validationProperty?: string;\n}\n\nexport const RequiredValidator = (options: RequiredValidatorOptions = {}): Validator => {\n  let { validationElement, validationProperty } = options;\n\n  if (!validationElement) {\n    validationElement = Object.assign(document.createElement('input'), { required: true });\n  }\n\n  if (!validationProperty) {\n    validationProperty = 'value';\n  }\n\n  const obj: Validator = {\n    observedAttributes: ['required'],\n    message: validationElement.validationMessage, // @TODO: Add a translation.\n    checkValidity(element) {\n      const validity: ReturnType<Validator['checkValidity']> = {\n        message: '',\n        isValid: true,\n        invalidKeys: [],\n      };\n\n      const isRequired = element.required ?? element.hasAttribute('required');\n\n      // Always true if the element isn't required.\n      if (!isRequired) {\n        return validity;\n      }\n\n      const value = element[validationProperty as keyof typeof element];\n\n      const isEmpty = !value;\n\n      if (isEmpty) {\n        validity.message = typeof obj.message === 'function' ? obj.message(element) : obj.message || '';\n        validity.isValid = false;\n        validity.invalidKeys.push('valueMissing');\n      }\n\n      return validity;\n    },\n  };\n\n  return obj;\n};\n", "import type { ReactiveController, ReactiveControllerHost } from 'lit';\n\n/** A reactive controller that determines when slots exist. */\nexport class HasSlotController implements ReactiveController {\n  host: ReactiveControllerHost & Element;\n  slotNames: string[] = [];\n\n  constructor(host: ReactiveControllerHost & Element, ...slotNames: string[]) {\n    (this.host = host).addController(this);\n    this.slotNames = slotNames;\n  }\n\n  private hasDefaultSlot() {\n    return [...this.host.childNodes].some((node) => {\n      if (node.nodeType === Node.TEXT_NODE && node.textContent!.trim() !== '') {\n        return true;\n      }\n\n      if (node.nodeType === Node.ELEMENT_NODE) {\n        const el = node as HTMLElement;\n        const tagName = el.tagName.toLowerCase();\n\n        // Ignore visually hidden elements since they aren't rendered\n        if (tagName === 'w-visually-hidden') {\n          return false;\n        }\n\n        // If it doesn't have a slot attribute, it's part of the default slot\n        if (!el.hasAttribute('slot')) {\n          return true;\n        }\n      }\n\n      return false;\n    });\n  }\n\n  private hasNamedSlot(name: string) {\n    return this.host.querySelector(`:scope > [slot=\"${name}\"]`) !== null;\n  }\n\n  test(slotName: string) {\n    return slotName === '[default]' ? this.hasDefaultSlot() : this.hasNamedSlot(slotName);\n  }\n\n  hostConnected() {\n    this.host.shadowRoot!.addEventListener('slotchange', this.handleSlotChange);\n  }\n\n  hostDisconnected() {\n    this.host.shadowRoot!.removeEventListener('slotchange', this.handleSlotChange);\n  }\n\n  private handleSlotChange = (event: Event) => {\n    const slot = event.target as HTMLSlotElement;\n\n    if ((this.slotNames.includes('[default]') && !slot.name) || (slot.name && this.slotNames.includes(slot.name))) {\n      this.host.requestUpdate();\n    }\n  };\n}\n\n/**\n * Given a list of nodes, this function iterates over all of them and returns the concatenated\n * HTML as a string. This is useful for getting the HTML that corresponds to a slot\u2019s assigned nodes (since we can't use slot.innerHTML as an alternative).\n * @param nodes - The list of nodes to iterate over.\n * @param callback - A function that can be used to customize the HTML output for specific types of nodes. If the function returns undefined, the default HTML output will be used.\n */\nexport function getInnerHTML(nodes: Iterable<Node>, callback?: (node: Node) => string | undefined): string {\n  let html = '';\n\n  for (const node of nodes) {\n    if (callback) {\n      const customHTML = callback(node);\n\n      if (customHTML !== undefined) {\n        html += customHTML;\n        continue;\n      }\n    }\n\n    if (node.nodeType === Node.ELEMENT_NODE) {\n      html += (node as HTMLElement).outerHTML;\n    }\n\n    if (node.nodeType === Node.TEXT_NODE) {\n      html += node.textContent;\n    }\n  }\n\n  return html;\n}\n", "import type { LitElement } from 'lit';\n\ntype UpdateHandler = (prev?: unknown, next?: unknown) => void;\n\ntype NonUndefined<A> = A extends undefined ? never : A;\n\ntype UpdateHandlerFunctionKeys<T extends object> = {\n  [K in keyof T]-?: NonUndefined<T[K]> extends UpdateHandler ? K : never;\n}[keyof T];\n\ninterface WatchOptions {\n  /**\n   * If true, will only start watching after the initial update/render\n   */\n  waitUntilFirstUpdate?: boolean;\n}\n\n/**\n * Runs when observed properties change, e.g. @property or @state, but before the component updates. To wait for an\n * update to complete after a change occurs, use `await this.updateComplete` in the handler. To start watching after the\n * initial update/render, use `{ waitUntilFirstUpdate: true }` or `this.hasUpdated` in the handler.\n *\n * Usage:\n *\n * @watch('propName')\n * handlePropChange(oldValue, newValue) {\n *   ...\n * }\n */\nexport function watch(propertyName: string | string[], options?: WatchOptions) {\n  const resolvedOptions: Required<WatchOptions> = {\n    waitUntilFirstUpdate: false,\n    ...options,\n  };\n  return <ElemClass extends LitElement>(proto: ElemClass, decoratedFnName: UpdateHandlerFunctionKeys<ElemClass>) => {\n    // @ts-expect-error - update is a protected property\n    const { update } = proto;\n    const watchedProperties = Array.isArray(propertyName) ? propertyName : [propertyName];\n\n    // @ts-expect-error - update is a protected property\n    proto.update = function (this: ElemClass, changedProps: Map<keyof ElemClass, ElemClass[keyof ElemClass]>) {\n      watchedProperties.forEach((property) => {\n        const key = property as keyof ElemClass;\n        if (changedProps.has(key)) {\n          const oldValue = changedProps.get(key);\n          const newValue = this[key];\n\n          if (oldValue !== newValue) {\n            if (!resolvedOptions.waitUntilFirstUpdate || this.hasUpdated) {\n              (this[decoratedFnName] as unknown as UpdateHandler)(oldValue, newValue);\n            }\n          }\n        }\n      });\n\n      update.call(this, changedProps);\n    };\n  };\n}\n", "import { LitElement } from 'lit';\nimport { unsafeStatic, html } from \"lit/static-html.js\";\nimport { i18n } from '@lingui/core';\nimport { messages as nbMessages} from '../src/raw/check/locales/nb/messages.mjs';\nimport { messages as enMessages} from '../src/raw/check/locales/en/messages.mjs';\nimport { messages as fiMessages} from '../src/raw/check/locales/fi/messages.mjs';\nimport { messages as daMessages} from '../src/raw/check/locales/da/messages.mjs';\nimport { messages as svMessages} from '../src/raw/check/locales/sv/messages.mjs';\nimport { activateI18n } from '../src/utils/i18n';\nactivateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n\nexport class IconCheck16 extends LitElement {\n  render() {\n      const title = i18n.t({ message: `Checkmark`, id: 'icon.title.check', comment: 'Title for check icon' });\n      \n      return html`<svg xmlns=\"http://www.w3.org/2000/svg\"width=\"16\"height=\"16\"fill=\"none\"viewBox=\"0 0 16 16\" part=\"w-icon-check-16-part\">${unsafeStatic(`<title>${title}</title>`)}<path stroke=\"currentColor\" stroke-linecap=\"round\" stroke-linejoin=\"round\" stroke-width=\"1.5\" d=\"M3.83 7.667 7.163 11l5.334-6\"></path></svg>`; }\n}\nif (!customElements.get('w-icon-check-16')) {\n  customElements.define('w-icon-check-16', IconCheck16);\n}", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.check\\\":[\\\"Sjekkmerke\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.check\\\":[\\\"Checkmark\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.check\\\":[\\\"Valintamerkki\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.check\\\":[\\\"Flueben\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"icon.title.check\\\":[\\\"Bock\\\"]}\");", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nconst detectByBrand = () => {\n\tlet value;\n  switch (process?.env?.NMP_BRAND) {\n\t\tcase 'FINN':\n\t\t\tvalue = 'nb';\n\t\t\tbreak;\n\t\tcase 'TORI':\n\t\t\tvalue = 'fi';\n\t\t\tbreak;\n\t\tcase 'BLOCKET':\n\t\t\tvalue = 'sv';\n\t\t\tbreak;\n\t\tcase 'DBA':\n\t\t\tvalue = 'da';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tvalue = 'en';\n\t}\n\treturn value;\n};\n\nconst detectByHost = () => {\n  const hostname = document?.location?.hostname;\n  if (hostname?.includes('finn')) {\n    return 'nb';\n  } else if (hostname.includes('tori')) {\n    return 'fi';\n  } else if (hostname.includes('blocket')) {\n    return 'sv';\n  } else if (hostname.includes('dba')) {\n    return 'da';\n  } else {\n    return defaultLocale;\n  }\n}\n\nexport const getSupportedLocale = (usedLocale: string) => {\n  return (\n    supportedLocales.find(\n      (locale) =>\n        usedLocale === locale || usedLocale.toLowerCase().includes(locale)\n    ) || detectByHost()\n  );\n};\n\nexport function detectLocale(): SupportedLocale {\n  if (typeof window === 'undefined') {\n    /**\n     * Server locale detection. This requires e.g NMP_BRAND environment variable to be set on the server.\n     */\n    const serverLocale = detectByBrand();\n    return getSupportedLocale(serverLocale);\n  }\n\n  try {\n    /**\n     * Client locale detection. Expects the lang attribute to be defined.\n     */\n    const htmlLocale = document?.documentElement?.lang;\n    const hostLocale = detectByHost();\n    \n    if (!supportedLocales.includes(htmlLocale as SupportedLocale)) {\n      console.warn('Unsupported locale set in html lang tag, falling back to detection by hostname');\n      return getSupportedLocale(hostLocale);\n    }\n    return getSupportedLocale(htmlLocale ?? hostLocale);\n  } catch (e) {\n    console.warn('could not detect locale, falling back to source locale', e);\n    return defaultLocale;\n  }\n}\n\nexport const getMessages = (\n  locale: SupportedLocale,\n  enMsg: Messages,\n  nbMsg: Messages,\n  fiMsg: Messages,\n  daMsg: Messages,\n  svMsg: Messages\n) => {\n  if (locale === 'nb') return nbMsg;\n  if (locale === 'fi') return fiMsg;\n  if (locale === 'da') return daMsg;\n  if (locale === 'sv') return svMsg;\n  // Default to English\n  return enMsg;\n};\n\nexport const activateI18n = (\n  enMessages: Messages,\n  nbMessages: Messages,\n  fiMessages: Messages,\n  daMessages: Messages,\n  svMessages: Messages\n) => {\n  const locale = detectLocale();\n  const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  i18n.load(locale, messages);\n  i18n.activate(locale);\n};\n", ":host {\n  display: block;\n  user-select: none;\n  -webkit-user-select: none;\n}\n\n[part~='control'] {\n  position: relative;\n  width: 2rem;\n  height: 2rem;\n  border-color: var(--w-s-color-border);\n  border-radius: 2px;\n  border-style: solid;\n  border-width: 1px;\n  background-color: var(--w-s-color-background);\n  transition-property: all;\n  transition-timing-function: cubic-bezier(0.4, 0, 0.2, 1);\n  transition-duration: 150ms;\n  margin-right: 0.8rem;\n  text-align: center;\n  line-height: var(--w-line-height-xs);\n  font-size: var(--w-font-size-m);\n}\n\n[part~='base'] {\n  display: flex;\n  align-items: center;\n  position: relative;\n  color: currentColor;\n  vertical-align: middle;\n  cursor: pointer;\n}\n\n[part~='label'] {\n  display: block;\n  font-size: var(--w-font-size-m);\n  line-height: var(--w-line-height-m);\n  user-select: none;\n  cursor: pointer;\n  padding: 0.2rem 0;\n}\n\nlabel:hover [part~='control']:not(:has(:checked, :indeterminate)) {\n  background-color: var(--w-s-color-background-hover);\n  border-color: var(--w-s-color-border-primary);\n}\n\nlabel:hover [part~='control']:has(:checked, :indeterminate) {\n  border-color: var(--w-s-color-border-primary-hover);\n  background-color: var(--w-s-color-background-primary-hover);\n}\n\n[part~='control']:has(:checked, :indeterminate) {\n  color: var(--checked-icon-color, white);\n  border-color: var(--w-s-color-border-primary);\n  background-color: var(--w-s-color-background-primary);\n}\n\n[part~='control']:has(:indeterminate) {\n  font-weight: 700;\n}\n\n[part~='control']:has(:invalid) {\n  border-color: var(--w-s-color-border-negative);\n}\n\n[part~='control']:has(:invalid):hover {\n  background-color: var(--w-s-color-background-negative-subtle-hover);\n}\n\n[part~='control']:has(:checked):has(:invalid) {\n  background-color: var(--w-s-color-background-negative);\n}\n\n[part~='control']:has(:checked) {\n  background-image: var(--w-icon-toggle-checked);\n  background-position: center;\n}\n\n/* Focus */\n[part~='control']:has(> input:focus-visible:not(:disabled)) {\n  outline: var(--wa-focus-ring);\n  outline-offset: var(--wa-focus-ring-offset);\n}\n\n/* Disabled */\n:host [part~='base']:has(input:disabled) {\n  opacity: 0.5;\n  cursor: not-allowed;\n}\n\ninput {\n  position: absolute;\n  padding: 0;\n  margin: 0;\n  height: 100%;\n  width: 100%;\n  opacity: 0;\n  pointer-events: none;\n}\n\n[part~='icon'] {\n  display: flex;\n\n  input:not(:checked, :indeterminate) + & {\n    visibility: hidden;\n  }\n}\n\n:host([required]) [part~='label']::after {\n  content: var(--wa-form-control-required-content);\n  color: var(--wa-form-control-required-content-color);\n  margin-inline-start: var(--wa-form-control-required-content-offset);\n}\n\n", "import type { PropertyValues } from 'lit';\nimport { html } from 'lit';\n\nimport { property, query } from 'lit/decorators.js';\nimport { classMap } from 'lit/directives/class-map.js';\nimport { ifDefined } from 'lit/directives/if-defined.js';\nimport { live } from 'lit/directives/live.js';\n\nimport { BaseFormAssociatedElement } from '../rip-and-tear-radio/form-associated-element';\nimport { RequiredValidator } from '../rip-and-tear-radio/required-validator';\nimport { HasSlotController } from '../rip-and-tear-radio/slot';\nimport { watch } from '../rip-and-tear-radio/watch';\nimport '@warp-ds/icons/elements/check-16';\n\n// eslint-disable-next-line\n// @ts-ignore\nimport styles from './checkbox.css?inline';\n\nexport class WCheckbox extends BaseFormAssociatedElement {\n  static css = [styles];\n\n  static shadowRootOptions = { ...BaseFormAssociatedElement.shadowRootOptions, delegatesFocus: true };\n\n  static get validators() {\n    const validators = [\n      RequiredValidator({\n        validationProperty: 'checked',\n        // Use a checkbox so we get \"free\" translation strings.\n        validationElement: Object.assign(document.createElement('input'), {\n          type: 'checkbox',\n          required: true,\n        }),\n      }),\n    ];\n    return [...super.validators, ...validators];\n  }\n\n  private readonly hasSlotController = new HasSlotController(this, 'hint');\n\n  @query('input[type=\"checkbox\"]') input: HTMLInputElement;\n\n  @property() title = ''; // make reactive to pass through\n\n  /** The name of the checkbox, submitted as a name/value pair with form data. */\n  @property({ reflect: true }) name = '';\n\n  private _value: string | null = this.getAttribute('value') ?? null;\n\n  /** The value of the checkbox, submitted as a name/value pair with form data. */\n  get value(): string | null {\n    return this._value ?? 'on';\n  }\n\n  @property({ reflect: true })\n  set value(val: string | null) {\n    this._value = val;\n  }\n\n  /** The checkbox's size. */\n  @property({ reflect: true }) size: 'small' | 'medium' | 'large' = 'medium';\n\n  /** Disables the checkbox. */\n  @property({ type: Boolean }) disabled = false;\n\n  /**\n   * Draws the checkbox in an indeterminate state. This is usually applied to checkboxes that represents a \"select\n   * all/none\" behavior when associated checkboxes have a mix of checked and unchecked states.\n   */\n  @property({ type: Boolean, reflect: true }) indeterminate = false;\n\n  /** Draws the checkbox in a checked state. */\n  @property({ type: Boolean, attribute: false }) checked: boolean = this.hasAttribute('checked');\n\n  /** The default value of the form control. Primarily used for resetting the form control. */\n  @property({ type: Boolean, reflect: true, attribute: 'checked' }) defaultChecked: boolean = this.hasAttribute('checked');\n\n  /**\n   * By default, form controls are associated with the nearest containing `<form>` element. This attribute allows you\n   * to place the form control outside of a form and associate it with the form that has this `id`. The form must be in\n   * the same document or shadow root for this to work.\n   */\n  @property({ reflect: true }) form = null;\n\n  /** Makes the checkbox a required field. */\n  @property({ type: Boolean, reflect: true }) required = false;\n\n  /** The checkbox's hint. If you need to display HTML, use the `hint` slot instead. */\n  @property() hint = '';\n\n  private handleClick() {\n    this.hasInteracted = true;\n    this.checked = !this.checked;\n    this.indeterminate = false;\n    this.updateComplete.then(() => {\n      this.dispatchEvent(new Event('change', { bubbles: true, composed: true }));\n    });\n  }\n\n  @watch('defaultChecked')\n  handleDefaultCheckedChange() {\n    if (!this.hasInteracted && this.checked !== this.defaultChecked) {\n      this.checked = this.defaultChecked;\n      this.handleValueOrCheckedChange();\n    }\n  }\n\n  handleValueOrCheckedChange() {\n    // These @watch() commands seem to override the base element checks for changes, so we need to setValue for the form and and updateValidity()\n    this.setValue(this.checked ? this.value : null, this._value);\n    this.updateValidity();\n  }\n\n  @watch(['checked', 'indeterminate'])\n  handleStateChange() {\n    if (this.hasUpdated) {\n      this.input.checked = this.checked; // force a sync update\n      this.input.indeterminate = this.indeterminate; // force a sync update\n    }\n\n    this.customStates.set('checked', this.checked);\n    this.customStates.set('indeterminate', this.indeterminate);\n    this.updateValidity();\n  }\n\n  @watch('disabled')\n  handleDisabledChange() {\n    this.customStates.set('disabled', this.disabled);\n  }\n\n  protected willUpdate(changedProperties: PropertyValues<this>): void {\n    super.willUpdate(changedProperties);\n\n    if (changedProperties.has('defaultChecked')) {\n      if (!this.hasInteracted) {\n        this.checked = this.defaultChecked;\n      }\n    }\n\n    if (changedProperties.has('value') || changedProperties.has('checked')) {\n      this.handleValueOrCheckedChange();\n    }\n  }\n\n  formResetCallback() {\n    // Evaluate checked before the super call because of our watcher on value.\n    this.checked = this.defaultChecked;\n    super.formResetCallback();\n    this.handleValueOrCheckedChange();\n  }\n\n  /** Simulates a click on the checkbox. */\n  click() {\n    this.input.click();\n  }\n\n  /** Sets focus on the checkbox. */\n  focus(options?: FocusOptions) {\n    this.input.focus(options);\n  }\n\n  /** Removes focus from the checkbox. */\n  blur() {\n    this.input.blur();\n  }\n\n  render() {\n    const hasHintSlot = this.hasSlotController.test('hint');\n    const hasHint = this.hint ? true : !!hasHintSlot;\n    const isIndeterminate = !this.checked && this.indeterminate;\n\n    return html`\n      <label part=\"base\">\n        <span part=\"control\">\n          <input\n            class=\"input\"\n            type=\"checkbox\"\n            title=${this.title /* An empty title prevents browser validation tooltips from appearing on hover */}\n            name=${this.name}\n            value=${ifDefined(this._value)}\n            .indeterminate=${live(this.indeterminate)}\n            .checked=${live(this.checked)}\n            .disabled=${this.disabled}\n            .required=${this.required}\n            aria-checked=${this.checked ? 'true' : 'false'}\n            aria-describedby=\"hint\"\n            @click=${this.handleClick} />\n          ${isIndeterminate ? '\u2013' : ''}\n        </span>\n\n        <slot part=\"label\"></slot>\n      </label>\n\n      <slot id=\"hint\" part=\"hint\" name=\"hint\" aria-hidden=${hasHint ? 'false' : 'true'} class=\"${classMap({ 'has-slotted': hasHint })}\">\n        ${this.hint}\n      </slot>\n    `;\n  }\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-checkbox': WCheckbox;\n  }\n}\n", "import { WCheckbox } from './checkbox';\n\nif (!customElements.get('w-checkbox')) {\n  customElements.define('w-checkbox', WCheckbox);\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-checkbox': WCheckbox;\n  }\n}\n", ":host {\n  color: var(--wa-form-control-value-color);\n  display: inline-flex;\n  flex-direction: row;\n  align-items: top;\n  font-family: inherit;\n  font-weight: var(--wa-form-control-value-font-weight);\n  line-height: var(--wa-form-control-value-line-height);\n  cursor: pointer;\n  user-select: none;\n  -webkit-user-select: none;\n}\n\n:host(:focus) {\n  outline: none;\n}\n\n[part~='label'] {\n  display: inline;\n}\n\n[part~='hint'] {\n  margin-block-start: 0.5em;\n}\n\n/* Default appearance */\n:host([appearance='default']) {\n  .control {\n    flex: 0 0 auto;\n    position: relative;\n    display: inline-flex;\n    align-items: center;\n    justify-content: center;\n    width: var(--wa-form-control-toggle-size, 2rem);\n    height: var(--wa-form-control-toggle-size, 2rem);\n    border-color: var(--wa-form-control-border-color, gray);\n    border-radius: 50%;\n    border-style: var(--wa-form-control-border-style, solid);\n    border-width: var(--wa-form-control-border-width, 1px);\n    background-color: var(--wa-form-control-background-color, white);\n    color: transparent;\n    transition-property: all;\n    transition-timing-function: cubic-bezier(0.4, 0, 0.2, 1);\n    transition-duration: 150ms;\n\n    margin-inline-end: 0.5em;\n  }\n}\n\n:host([appearance='clickable']) .control {\n  position: absolute;\n  inset: 0;\n  height: 100%;\n  width: 100%;\n  cursor: pointer;\n}\n\n/* Checked */\n:host(:state(checked)):not(:host([appearance='clickable'])) .control {\n  /* color: var(--checked-icon-color, white); */\n  border-color: var(--wa-form-control-activated-color, blue);\n  background-color: var(--wa-form-control-background-color, white);\n  border-width: 0.6rem;\n}\n\n/* Focus */\n:host(:focus-visible) .control {\n  outline: 2px solid var(--w-s-color-border-focus);\n  outline-offset: var(--w-outline-offset, 1px);\n}\n\n:host([appearance='clickable']:focus-visible) .control {\n  outline-offset: -4px;\n  border-radius: 8px;\n}\n\n/* Disabled */\n:host(:state(disabled)) {\n  opacity: 0.5;\n  cursor: not-allowed;\n}\n\n/* Button appearance */\n:host([appearance='button']) {\n  align-items: center;\n  min-height: var(--wa-form-control-height);\n  background-color: var(--wa-color-surface-default);\n  border: var(--wa-form-control-border-width) var(--wa-form-control-border-style) var(--wa-form-control-border-color);\n  border-radius: var(--wa-border-radius-m);\n  padding: 0 var(--wa-form-control-padding-inline);\n  transition:\n    background-color var(--wa-transition-fast),\n    border-color var(--wa-transition-fast);\n\n  .control {\n    display: none;\n  }\n}\n\n/* Horizontal grouping - remove inner border radius */\n:host([appearance='button'][data-wa-radio-horizontal][data-wa-radio-inner]) {\n  border-radius: 0;\n}\n\n:host([appearance='button'][data-wa-radio-horizontal][data-wa-radio-first]) {\n  border-start-end-radius: 0;\n  border-end-end-radius: 0;\n}\n\n:host([appearance='button'][data-wa-radio-horizontal][data-wa-radio-last]) {\n  border-start-start-radius: 0;\n  border-end-start-radius: 0;\n}\n\n/* Vertical grouping - remove inner border radius */\n:host([appearance='button'][data-wa-radio-vertical][data-wa-radio-inner]) {\n  border-radius: 0;\n}\n\n:host([appearance='button'][data-wa-radio-vertical][data-wa-radio-first]) {\n  border-end-start-radius: 0;\n  border-end-end-radius: 0;\n}\n\n:host([appearance='button'][data-wa-radio-vertical][data-wa-radio-last]) {\n  border-start-start-radius: 0;\n  border-start-end-radius: 0;\n}\n\n@media (hover: hover) {\n  :host([appearance='button']:hover:not(:state(disabled), :state(checked))) {\n    background-color: color-mix(in srgb, var(--wa-color-surface-default) 95%, var(--wa-color-mix-hover));\n  }\n}\n\n:host([appearance='button']:focus-visible) {\n  outline: var(--wa-focus-ring);\n  outline-offset: var(--wa-focus-ring-offset);\n}\n\n:host([appearance='button']:state(checked)) {\n  border-color: var(--wa-form-control-activated-color);\n  background-color: var(--wa-color-brand-fill-quiet);\n}\n\n:host([appearance='button']:state(checked):focus-visible) {\n  outline: var(--wa-focus-ring-style) var(--wa-focus-ring-width) var(--wa-color-brand-border-loud);\n  outline-offset: var(--wa-focus-ring-offset);\n}\n\n/* Remove inner borders and handle overlap */\n:host([appearance='button'][data-wa-radio-horizontal]:not([data-wa-radio-first])) {\n  margin-inline-start: calc(-1 * var(--wa-form-control-border-width));\n}\n\n:host([appearance='button'][data-wa-radio-vertical]:not([data-wa-radio-first])) {\n  margin-block-start: calc(-1 * var(--wa-form-control-border-width));\n}\n\n/* Ensure interactive states are visible above adjacent buttons */\n:host([appearance='button']:hover),\n:host([appearance='button']:state(checked)) {\n  position: relative;\n  z-index: 1;\n}\n\n:host([appearance='button']:focus-visible) {\n  z-index: 2;\n}\n\n", "import type { PropertyValues } from 'lit';\nimport { html } from 'lit';\n\nimport { property, state } from 'lit/decorators.js';\n\nimport { BaseFormAssociatedElement } from './form-associated-element';\n// eslint-disable-next-line\n// @ts-ignore\nimport styles from './radio.css?inline';\n\nexport class WRadio extends BaseFormAssociatedElement {\n  static css = [styles];\n\n  @state() checked = false;\n\n  /** @internal Used by radio group to force disable radios while preserving their original disabled state. */\n  @state() forceDisabled = false;\n\n  /**\n   * The string pointing to a form's id.\n   */\n  @property({ reflect: true }) form: string | null = null;\n\n  /** The radio's value. When selected, the radio group will receive this value. */\n  @property({ reflect: true }) value: string;\n\n  /** The radio's value. When selected, the radio group will receive this value. */\n  @property({ reflect: true }) appearance: 'default' | 'button' | 'clickable' = 'default';\n\n  /**\n   * The radio's size. When used inside a radio group, the size will be determined by the radio group's size so this\n   * attribute can typically be omitted.\n   */\n  @property({ reflect: true }) size: 'small' | 'medium' | 'large' = 'medium';\n\n  /** Disables the radio. */\n  @property({ type: Boolean }) disabled = false;\n\n  constructor() {\n    super();\n    this.addEventListener('click', this.handleClick);\n  }\n\n  connectedCallback() {\n    super.connectedCallback();\n    this.setInitialAttributes();\n  }\n\n  private setInitialAttributes() {\n    this.setAttribute('role', 'radio');\n    this.tabIndex = 0;\n    this.setAttribute('aria-disabled', this.disabled || this.forceDisabled ? 'true' : 'false');\n  }\n\n  updated(changedProperties: PropertyValues<this>) {\n    super.updated(changedProperties);\n\n    if (changedProperties.has('checked')) {\n      this.customStates.set('checked', this.checked);\n      this.setAttribute('aria-checked', this.checked ? 'true' : 'false');\n      // Only set tabIndex if not disabled\n      if (!this.disabled && !this.forceDisabled) {\n        this.tabIndex = this.checked ? 0 : -1;\n      }\n    }\n\n    if (changedProperties.has('disabled') || changedProperties.has('forceDisabled')) {\n      const effectivelyDisabled = this.disabled || this.forceDisabled;\n      this.customStates.set('disabled', effectivelyDisabled);\n      this.setAttribute('aria-disabled', effectivelyDisabled ? 'true' : 'false');\n\n      // Set tabIndex based on disabled state\n      if (effectivelyDisabled) {\n        this.tabIndex = -1;\n      } else {\n        // Restore proper tabIndex - this will be managed by the radio group\n        this.tabIndex = this.checked ? 0 : -1;\n      }\n    }\n  }\n\n  /**\n   * @override\n   */\n  setValue(): void {\n    // We override `setValue` because we don't want to set form values from here. We want to do that in \"RadioGroup\" itself.\n  }\n\n  // Update the handleClick method (around line 75)\n  private handleClick = () => {\n    if (!this.disabled && !this.forceDisabled) {\n      this.checked = true;\n    }\n  };\n\n  render() {\n    return html`\n      <span part=\"control\" class=\"control\"></span>\n      <slot part=\"label\" class=\"label\"></slot>\n    `;\n  }\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-radio': WRadio;\n  }\n}\n", "export const urlAlphabet =\n  'useandom-26T198340PX75pxJACKVERYMINDBUSHWOLF_GQZbfghjklqvwyzrict'\n", "/* @ts-self-types=\"./index.d.ts\" */\nimport { urlAlphabet as scopedUrlAlphabet } from './url-alphabet/index.js'\nexport { urlAlphabet } from './url-alphabet/index.js'\nexport let random = bytes => crypto.getRandomValues(new Uint8Array(bytes))\nexport let customRandom = (alphabet, defaultSize, getRandom) => {\n  let mask = (2 << Math.log2(alphabet.length - 1)) - 1\n  let step = -~((1.6 * mask * defaultSize) / alphabet.length)\n  return (size = defaultSize) => {\n    let id = ''\n    while (true) {\n      let bytes = getRandom(step)\n      let j = step | 0\n      while (j--) {\n        id += alphabet[bytes[j] & mask] || ''\n        if (id.length >= size) return id\n      }\n    }\n  }\n}\nexport let customAlphabet = (alphabet, size = 21) =>\n  customRandom(alphabet, size | 0, random)\nexport let nanoid = (size = 21) => {\n  let id = ''\n  let bytes = crypto.getRandomValues(new Uint8Array((size |= 0)))\n  while (size--) {\n    id += scopedUrlAlphabet[bytes[size] & 63]\n  }\n  return id\n}\n", "import { nanoid } from 'nanoid';\n\nexport function uniqueId(prefix = '') {\n  return `${prefix}${nanoid()}`;\n}\n", ":host {\n  display: block;\n}\n\n.form-control {\n  position: relative;\n  border: none;\n  padding: 0;\n  margin: 0;\n}\n\n.label {\n  font-size: var(--w-font-size-s);\n  line-height: var(--w-line-height-s);\n  font-weight: 700;\n  -webkit-font-smoothing: antialiased;\n  -moz-osx-font-smoothing: grayscale;\n  font-smoothing: grayscale;\n  cursor: pointer;\n  padding-bottom: 0.4rem;\n  color: var(--w-s-color-text);\n  display: block;\n}\n\n.radio-group-required .label::after {\n  content: var(--wa-form-control-required-content);\n  margin-inline-start: var(--wa-form-control-required-content-offset);\n}\n\n.button-group {\n  display: flex;\n}\n\n[part~='form-control-input'] {\n  display: flex;\n  flex-direction: column;\n  flex-wrap: wrap;\n  gap: 0.75em;\n}\n\n/* Horizontal */\n:host([orientation='horizontal']) [part~='form-control-input'] {\n  flex-direction: row;\n  gap: 1em;\n}\n\n/* Help text */\n[part~='hint'] {\n  margin-block-start: 0.5em;\n}\n\n/* Radios have the \"button\" appearance */\n:host fieldset.has-radio-buttons {\n  [part~='form-control-input'] {\n    gap: 0;\n  }\n}\n\n", "import type { PropertyValues } from 'lit';\nimport { html } from 'lit';\n\nimport { property, query, state } from 'lit/decorators.js';\nimport { classMap } from 'lit/directives/class-map.js';\n\nimport { BaseFormAssociatedElement } from './form-associated-element';\nimport { uniqueId } from './math';\nimport './radio';\nimport type { WRadio } from './radio';\n// eslint-disable-next-line\n// @ts-ignore\nimport styles from './radio-group.css?inline';\nimport { RequiredValidator } from './required-validator';\nimport { HasSlotController } from './slot';\n\n/**\n * @slot label - Alternative to the `label` attribute should you need custom HTML.\n */\nexport class WRadioGroup extends BaseFormAssociatedElement {\n  static css = [styles];\n\n  static get validators() {\n    const validators = [\n      RequiredValidator({\n        validationElement: Object.assign(document.createElement('input'), {\n          required: true,\n          type: 'radio',\n          // we need an id that's guaranteed to be unique; users will never see this\n          name: uniqueId('__w-radio'),\n        }),\n      }),\n    ];\n    return [...super.validators, ...validators];\n  }\n\n  private readonly hasSlotController = new HasSlotController(this, 'hint', 'label');\n\n  @state() hasRadioButtons = false;\n\n  @query('slot:not([name])') defaultSlot: HTMLSlotElement;\n\n  /**\n   * The radio group's label. Required for proper accessibility. If you need to display HTML, use the `label` slot\n   * instead.\n   */\n  @property() label = '';\n\n  /** The radio groups's hint. If you need to display HTML, use the `hint` slot instead. */\n  @property({ attribute: 'hint' }) hint = '';\n\n  /** The name of the radio group, submitted as a name/value pair with form data. */\n  @property({ reflect: true }) name: string | null = null;\n\n  /** Disables the radio group and all child radios. */\n  @property({ type: Boolean, reflect: true }) disabled = false;\n\n  /** The orientation in which to show radio items. */\n  @property({ reflect: true }) orientation: 'horizontal' | 'vertical' = 'vertical';\n\n  private _value: string | null = null;\n\n  get value() {\n    if (this.valueHasChanged) {\n      return this._value;\n    }\n\n    return this._value ?? this.defaultValue;\n  }\n\n  /** The current value of the radio group, submitted as a name/value pair with form data. */\n  @state()\n  set value(val: string | number | null) {\n    if (typeof val === 'number') val = String(val);\n    this.valueHasChanged = true;\n    this._value = val;\n  }\n\n  /** The default value of the form control. Primarily used for resetting the form control. */\n  @property({ attribute: 'value', reflect: true }) defaultValue: string | null = this.getAttribute('value') || null;\n\n  /** The radio group's size. This size will be applied to all child radios and radio buttons, except when explicitly overridden. */\n  @property({ reflect: true }) size: 'small' | 'medium' | 'large' = 'medium';\n\n  /** Ensures a child radio is checked before allowing the containing form to submit. */\n  @property({ type: Boolean, reflect: true }) required = false;\n\n  /**\n   * Used for SSR. if true, will show slotted label on initial render.\n   */\n  @property({ type: Boolean, attribute: 'with-label' }) withLabel = false;\n\n  /**\n   * Used for SSR. if true, will show slotted hint on initial render.\n   */\n  @property({ type: Boolean, attribute: 'with-hint' }) withHint = false;\n\n  //\n  // We need this because if we don't have it, FormValidation yells at us that it's \"not focusable\".\n  //   If we use `this.tabIndex = -1` we can't focus the radio inside.\n  //\n  static shadowRootOptions = { ...BaseFormAssociatedElement.shadowRootOptions, delegatesFocus: true };\n\n  constructor() {\n    super();\n    this.addEventListener('keydown', this.handleKeyDown);\n    this.addEventListener('click', this.handleRadioClick);\n  }\n\n  /**\n   * We use the first available radio as the validationTarget similar to native HTML that shows the validation popup on\n   * the first radio element.\n   */\n  get validationTarget() {\n    const radio = this.querySelector<WRadio>(':is(w-radio):not([disabled])');\n    if (!radio) return undefined;\n\n    return radio;\n  }\n\n  updated(changedProperties: PropertyValues<this>) {\n    if (changedProperties.has('disabled') || changedProperties.has('value')) {\n      this.syncRadioElements();\n    }\n  }\n\n  formResetCallback(...args: Parameters<BaseFormAssociatedElement['formResetCallback']>) {\n    this.value = this.defaultValue;\n\n    super.formResetCallback(...args);\n\n    this.syncRadioElements();\n  }\n\n  private handleRadioClick = (e: Event) => {\n    const clickedRadio = (e.target as HTMLElement).closest<WRadio>('w-radio');\n    /* eslint-disable */\n    if (!clickedRadio || clickedRadio.disabled || (clickedRadio as any).forceDisabled || this.disabled) {\n      return;\n    }\n\n    const oldValue = this.value;\n    this.value = clickedRadio.value;\n    clickedRadio.checked = true;\n\n    const radios = this.getAllRadios();\n    for (const radio of radios) {\n      if (clickedRadio === radio) {\n        continue;\n      }\n\n      radio.checked = false;\n      radio.setAttribute('tabindex', '-1');\n    }\n\n    if (this.value !== oldValue) {\n      this.updateComplete.then(() => {\n        this.dispatchEvent(new InputEvent('input', { bubbles: true, composed: true }));\n        this.dispatchEvent(new Event('change', { bubbles: true, composed: true }));\n      });\n    }\n  };\n\n  private getAllRadios() {\n    return [...this.querySelectorAll<WRadio>('w-radio')];\n  }\n\n  private handleLabelClick() {\n    this.focus();\n  }\n\n  private async syncRadioElements() {\n    const radios = this.getAllRadios();\n    let hasRadioButtons = false;\n\n    // Add data attributes to support styling\n    radios.forEach((radio, index) => {\n      if (radio.appearance === 'button') hasRadioButtons = true;\n      radio.setAttribute('size', this.size);\n      radio.toggleAttribute('data-w-radio-horizontal', this.orientation !== 'vertical');\n      radio.toggleAttribute('data-w-radio-vertical', this.orientation === 'vertical');\n      radio.toggleAttribute('data-w-radio-first', index === 0);\n      radio.toggleAttribute('data-w-radio-inner', index !== 0 && index !== radios.length - 1);\n      radio.toggleAttribute('data-w-radio-last', index === radios.length - 1);\n\n      // Set forceDisabled state based on radio group's disabled state\n      (radio as WRadio).forceDisabled = this.disabled;\n    });\n\n    // If at least one radio button exists, we assume it's a radio button group\n    this.hasRadioButtons = hasRadioButtons;\n\n    await Promise.all(\n      radios.map(async (radio) => {\n        await radio.updateComplete;\n\n        if (!radio.disabled && radio.value === this.value) {\n          radio.checked = true;\n        } else {\n          radio.checked = false;\n        }\n      }),\n    );\n\n    // Manage tabIndex based on disabled state and checked status\n    if (this.disabled) {\n      // If radio group is disabled, all radios should not be tabbable\n      radios.forEach((radio) => {\n        radio.tabIndex = -1;\n      });\n    } else {\n      // Normal tabbing behavior\n      const enabledRadios = radios.filter((radio) => !radio.disabled);\n      const checkedRadio = enabledRadios.find((radio) => radio.checked);\n\n      if (enabledRadios.length > 0) {\n        if (checkedRadio) {\n          // If there's a checked radio, it should be tabbable\n          enabledRadios.forEach((radio) => {\n            radio.tabIndex = radio.checked ? 0 : -1;\n          });\n        } else {\n          // If no radio is checked, first enabled radio should be tabbable\n          enabledRadios.forEach((radio, index) => {\n            radio.tabIndex = index === 0 ? 0 : -1;\n          });\n        }\n      }\n\n      // Disabled radios should never be tabbable\n      radios\n        .filter((radio) => radio.disabled)\n        .forEach((radio) => {\n          radio.tabIndex = -1;\n        });\n    }\n  }\n\n  private handleKeyDown(event: KeyboardEvent) {\n    if (!['ArrowUp', 'ArrowDown', 'ArrowLeft', 'ArrowRight', ' '].includes(event.key) || this.disabled) {\n      return;\n    }\n\n    const radios = this.getAllRadios().filter((radio) => !radio.disabled);\n\n    if (radios.length <= 0) {\n      return;\n    }\n\n    event.preventDefault();\n\n    const oldValue = this.value;\n\n    const checkedRadio = radios.find((radio) => radio.checked) ?? radios[0];\n    const incr = event.key === ' ' ? 0 : ['ArrowUp', 'ArrowLeft'].includes(event.key) ? -1 : 1;\n    let index = radios.indexOf(checkedRadio) + incr;\n\n    if (!index) index = 0;\n\n    if (index < 0) {\n      index = radios.length - 1;\n    }\n\n    if (index > radios.length - 1) {\n      index = 0;\n    }\n\n    const hasRadioButtons = radios.some((radio) => radio.tagName.toLowerCase() === 'w-radio-button');\n\n    this.getAllRadios().forEach((radio) => {\n      radio.checked = false;\n\n      if (!hasRadioButtons) {\n        radio.setAttribute('tabindex', '-1');\n      }\n    });\n\n    this.value = radios[index].value;\n    radios[index].checked = true;\n\n    if (!hasRadioButtons) {\n      radios[index].setAttribute('tabindex', '0');\n      radios[index].focus();\n    } else {\n      radios[index].shadowRoot!.querySelector('button')!.focus();\n    }\n\n    if (this.value !== oldValue) {\n      this.updateComplete.then(() => {\n        this.dispatchEvent(new InputEvent('input', { bubbles: true, composed: true }));\n        this.dispatchEvent(new Event('change', { bubbles: true, composed: true }));\n      });\n    }\n\n    event.preventDefault();\n  }\n\n  /** Sets focus on the radio group. */\n  public focus(options?: FocusOptions) {\n    if (this.disabled) return;\n\n    const radios = this.getAllRadios();\n    const checked = radios.find((radio) => radio.checked);\n    const firstEnabledRadio = radios.find((radio) => !radio.disabled);\n    const radioToFocus = checked || firstEnabledRadio;\n\n    // Call focus for the checked radio. If no radio is checked, focus the first one that isn't disabled.\n    if (radioToFocus) {\n      radioToFocus.focus(options);\n    }\n  }\n\n  render() {\n    const hasLabelSlot = this.hasUpdated ? this.hasSlotController.test('label') : this.withLabel;\n    const hasHintSlot = this.hasUpdated ? this.hasSlotController.test('hint') : this.withHint;\n    const hasLabel = this.label ? true : !!hasLabelSlot;\n    const hasHint = this.hint ? true : !!hasHintSlot;\n\n    return html`\n      <fieldset\n        part=\"form-control\"\n        class=${classMap({\n          'form-control': true,\n          'form-control-radio-group': true,\n          'form-control-has-label': hasLabel,\n          'has-radio-buttons': this.hasRadioButtons,\n        })}\n        role=\"radiogroup\"\n        aria-labelledby=\"label\"\n        aria-describedby=\"hint\"\n        aria-errormessage=\"error-message\"\n        aria-orientation=${this.orientation}>\n        <label\n          part=\"form-control-label\"\n          id=\"label\"\n          class=\"label\"\n          aria-hidden=${hasLabel ? 'false' : 'true'}\n          @click=${this.handleLabelClick}>\n          <slot name=\"label\">${this.label}</slot>\n        </label>\n\n        <slot part=\"form-control-input\" @slotchange=${this.syncRadioElements}></slot>\n\n        <slot\n          id=\"hint\"\n          name=\"hint\"\n          part=\"hint\"\n          class=${classMap({\n            'has-slotted': hasHint,\n          })}\n          aria-hidden=${hasHint ? 'false' : 'true'}\n          >${this.hint}</slot\n        >\n      </fieldset>\n    `;\n  }\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-radio-group': WRadioGroup;\n  }\n}\n", "import { WRadio } from './radio';\nimport { WRadioGroup } from './radio-group';\n\nif (!customElements.get('w-radio')) {\n  customElements.define('w-radio', WRadio);\n  customElements.define('w-radio-group', WRadioGroup);\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-radio': WRadio;\n    'w-radio-group': WRadioGroup;\n  }\n}\n", "/**\n * @license\n * Copyright 2017 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\nimport {nothing, TemplateResult, noChange} from '../lit-html.js';\nimport {directive, Directive, PartInfo, PartType} from '../directive.js';\n\nconst HTML_RESULT = 1;\n\nexport class UnsafeHTMLDirective extends Directive {\n  static directiveName = 'unsafeHTML';\n  static resultType = HTML_RESULT;\n\n  private _value: unknown = nothing;\n  private _templateResult?: TemplateResult;\n\n  constructor(partInfo: PartInfo) {\n    super(partInfo);\n    if (partInfo.type !== PartType.CHILD) {\n      throw new Error(\n        `${\n          (this.constructor as typeof UnsafeHTMLDirective).directiveName\n        }() can only be used in child bindings`\n      );\n    }\n  }\n\n  render(value: string | typeof nothing | typeof noChange | undefined | null) {\n    if (value === nothing || value == null) {\n      this._templateResult = undefined;\n      return (this._value = value);\n    }\n    if (value === noChange) {\n      return value;\n    }\n    if (typeof value != 'string') {\n      throw new Error(\n        `${\n          (this.constructor as typeof UnsafeHTMLDirective).directiveName\n        }() called with a non-string value`\n      );\n    }\n    if (value === this._value) {\n      return this._templateResult;\n    }\n    this._value = value;\n    const strings = [value] as unknown as TemplateStringsArray;\n    // eslint-disable-next-line @typescript-eslint/no-explicit-any\n    (strings as any).raw = strings;\n    // WARNING: impersonating a TemplateResult like this is extremely\n    // dangerous. Third-party directives should not do this.\n    return (this._templateResult = {\n      // Cast to a known set of integers that satisfy ResultType so that we\n      // don't have to export ResultType and possibly encourage this pattern.\n      // This property needs to remain unminified.\n      ['_$litType$']: (this.constructor as typeof UnsafeHTMLDirective)\n        .resultType as 1 | 2,\n      strings,\n      values: [],\n    });\n  }\n}\n\n/**\n * Renders the result as HTML, rather than text.\n *\n * The values `undefined`, `null`, and `nothing`, will all result in no content\n * (empty string) being rendered.\n *\n * Note, this is unsafe to use with any user-provided input that hasn't been\n * sanitized or escaped, as it may lead to cross-site-scripting\n * vulnerabilities.\n */\nexport const unsafeHTML = directive(UnsafeHTMLDirective);\n", "/**\n * @license\n * Copyright 2021 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\ntype Falsy = null | undefined | false | 0 | -0 | 0n | '';\n\n/**\n * When `condition` is true, returns the result of calling `trueCase()`, else\n * returns the result of calling `falseCase()` if `falseCase` is defined.\n *\n * This is a convenience wrapper around a ternary expression that makes it a\n * little nicer to write an inline conditional without an else.\n *\n * @example\n *\n * ```ts\n * render() {\n *   return html`\n *     ${when(this.user, () => html`User: ${this.user.username}`, () => html`Sign In...`)}\n *   `;\n * }\n * ```\n */\nexport function when<C extends Falsy, T, F = undefined>(\n  condition: C,\n  trueCase: (c: C) => T,\n  falseCase?: (c: C) => F\n): F;\nexport function when<C, T, F>(\n  condition: C extends Falsy ? never : C,\n  trueCase: (c: C) => T,\n  falseCase?: (c: C) => F\n): T;\nexport function when<C, T, F = undefined>(\n  condition: C,\n  trueCase: (c: Exclude<C, Falsy>) => T,\n  falseCase?: (c: Extract<C, Falsy>) => F\n): C extends Falsy ? F : T;\nexport function when(\n  condition: unknown,\n  trueCase: (c: unknown) => unknown,\n  falseCase?: (c: unknown) => unknown\n): unknown {\n  return condition ? trueCase(condition) : falseCase?.(condition);\n}\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"select.label.optional\\\":[\\\"(valgfrit)\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"select.label.optional\\\":[\\\"(optional)\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"select.label.optional\\\":[\\\"(vapaaehtoinen)\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"select.label.optional\\\":[\\\"(valgfritt)\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"select.label.optional\\\":[\\\"(valfritt)\\\"]}\");", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.focus\\\\:\\\\[--w-outline-offset\\\\:-2px\\\\]:focus{--w-outline-offset:-2px}.bg-transparent{background-color:#0000}.appearance-none{-webkit-appearance:none;appearance:none}.border-0{border-width:0}.border-1{border-width:1px}.rounded-4{border-radius:4px}.caret-current{caret-color:currentColor}.opacity-25{opacity:.25}.block,.before\\\\:block:before{display:block}.before\\\\:hidden:before{display:none}.focusable:focus{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:focus-visible{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:not(:focus-visible){outline:none}.outline-\\\\[--w-s-color-border-negative\\\\]\\\\!{outline-color:var(--w-s-color-border-negative)!important}.bottom-0{bottom:0}.right-0{right:0}.before\\\\:bottom-0:before{bottom:0}.before\\\\:right-0:before{right:0}.top-\\\\[30\\\\%\\\\]{top:30%}.absolute{position:absolute}.relative{position:relative}.static{position:static}.before\\\\:absolute:before{position:absolute}.s-bg{background-color:var(--w-s-color-background)}.s-bg-disabled-subtle{background-color:var(--w-s-color-background-disabled-subtle)}.s-text{color:var(--w-s-color-text)}.s-text-disabled{color:var(--w-s-color-text-disabled)}.s-text-negative{color:var(--w-s-color-text-negative)}.s-text-subtle{color:var(--w-s-color-text-subtle)}.s-icon{color:var(--w-s-color-icon)}.s-border{border-color:var(--w-s-color-border)}.s-border-disabled{border-color:var(--w-s-color-border-disabled)}.s-border-negative{border-color:var(--w-s-color-border-negative)}.hover\\\\:s-border-disabled:hover{border-color:var(--w-s-color-border-disabled)}.hover\\\\:s-border-hover:hover{border-color:var(--w-s-color-border-hover)}.hover\\\\:s-border-negative-hover:hover{border-color:var(--w-s-color-border-negative-hover)}.active\\\\:s-border-active:active{border-color:var(--w-s-color-border-active)}.active\\\\:s-border-disabled:active{border-color:var(--w-s-color-border-disabled)}.h-full{height:100%}.w-32{width:3.2rem}.w-full{width:100%}.before\\\\:h-full:before{height:100%}.before\\\\:w-32:before{width:3.2rem}.mb-0{margin-bottom:0}.mt-4{margin-top:.4rem}.py-12{padding-top:1.2rem;padding-bottom:1.2rem}.pb-4{padding-bottom:.4rem}.pl-0{padding-left:0}.pl-8{padding-left:.8rem}.pr-32{padding-right:3.2rem}.cursor-pointer{cursor:pointer}.antialiased{-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;font-smoothing:grayscale}.font-bold{font-weight:700}.font-normal{font-weight:400}.pointer-events-none,.before\\\\:pointer-events-none:before{pointer-events:none}.text-m{font-size:var(--w-font-size-m);line-height:var(--w-line-height-m)}.text-s{font-size:var(--w-font-size-s);line-height:var(--w-line-height-s)}.text-xs{font-size:var(--w-font-size-xs);line-height:var(--w-line-height-xs)}`;\n", "// @warp-css;\nimport { html, LitElement } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { i18n } from '@lingui/core';\nimport { FormControlMixin } from '@open-wc/form-control';\nimport { property } from 'lit/decorators.js';\nimport { ifDefined } from 'lit/directives/if-defined.js';\nimport { unsafeHTML } from 'lit/directives/unsafe-html.js';\nimport { when } from 'lit/directives/when.js';\n\nimport { activateI18n } from '../i18n.js';\nimport { reset } from '../styles.js';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\nimport { styles } from './styles.js';\n\nimport '@warp-ds/icons/elements/chevron-down-16';\n\nexport const ccSelect = {\n  base: 'block text-m mb-0 py-12 pr-32 rounded-4 w-full focusable focus:[--w-outline-offset:-2px] appearance-none cursor-pointer caret-current',\n  default: 's-text s-bg pl-8 border-1 s-border hover:s-border-hover active:s-border-active',\n  disabled:\n    's-text-disabled s-bg-disabled-subtle pl-8 border-1 s-border-disabled hover:s-border-disabled active:s-border-disabled pointer-events-none',\n  invalid:\n    's-text s-bg pl-8 border-1 s-border-negative hover:s-border-negative-hover active:s-border-active outline-[--w-s-color-border-negative]!',\n  readOnly: 's-text bg-transparent pl-0 border-0 pointer-events-none before:hidden',\n  wrapper: 'relative',\n  selectWrapper: `relative before:block before:absolute before:right-0 before:bottom-0 before:w-32 before:h-full before:pointer-events-none `,\n  chevron: 'block absolute top-[30%] right-0 bottom-0 w-32 h-full s-icon pointer-events-none cursor-pointer',\n  chevronDisabled: 'opacity-25',\n};\n\nexport const ccLabel = {\n  base: 'antialiased block relative text-s font-bold pb-4 cursor-pointer s-text',\n  optional: 'pl-8 font-normal text-s s-text-subtle',\n};\n\nexport const ccHelpText = {\n  base: 'text-xs mt-4 block',\n  color: 's-text-subtle',\n  colorInvalid: 's-text-negative',\n};\n\n/**\n * A dropdown component for selecting a single value.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/forms-select--docs)\n */\nexport class WarpSelect extends FormControlMixin(LitElement) {\n  /** Whether the element should receive focus on render */\n  @property({ attribute: 'auto-focus', type: Boolean, reflect: true })\n  autoFocus: boolean;\n\n  /** Renders the field in an invalid state. Often paired with `hint` to provide feedback about the error */\n  @property({ type: Boolean, reflect: true })\n  invalid: boolean;\n\n  /** Whether to always show a hint */\n  @property({ type: Boolean, reflect: true })\n  always: boolean;\n\n  /** The content displayed as the help text */\n  @property({ reflect: true })\n  hint: string;\n\n  /** The content to disply as the label */\n  @property({ reflect: true })\n  label: string;\n\n  /** Whether to show optional text */\n  @property({ type: Boolean, reflect: true })\n  optional: boolean;\n\n  /** Renders the field in a disabled state. */\n  @property({ type: Boolean, reflect: true })\n  disabled: boolean;\n\n  /** Renders the field in a readonly state. */\n  @property({ attribute: 'read-only', type: Boolean, reflect: true })\n  readOnly: boolean;\n\n  /** @internal */\n  @property({ state: true })\n  _options: string;\n\n  @property({ reflect: true })\n  name: string;\n\n  @property({ reflect: true })\n  value: string;\n\n  static styles = [reset, styles];\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n    this._options = this.innerHTML;\n  }\n\n  /** @internal */\n  _setValue = (value: string) => {\n    this.value = value;\n    this.setValue(value);\n  };\n\n  firstUpdated() {\n    // autofocus doesn't seem to behave properly in Safari and FireFox, therefore we set the focus here:\n    if (this.autoFocus) this.shadowRoot.querySelector('select').focus();\n\n    // Set initial value based on any slotted options that are selected\n    Array.from(this.children).map((child: HTMLOptionElement) => {\n      if (child.selected) {\n        this._setValue(child.value);\n      }\n    });\n  }\n\n  handleKeyDown(event: KeyboardEvent) {\n    if (this.readOnly && (event.key === ' ' || event.key === 'ArrowDown' || event.key === 'ArrowUp')) {\n      event.preventDefault();\n    }\n  }\n\n  get #classes() {\n    return classNames([\n      ccSelect.base,\n      !this.invalid && !this.disabled && !this.readOnly && ccSelect.default,\n      this.invalid && ccSelect.invalid,\n      this.disabled && ccSelect.disabled,\n      this.readOnly && ccSelect.readOnly,\n    ]);\n  }\n\n  get #helpTextClasses() {\n    return classNames([ccHelpText.base, this.invalid ? ccHelpText.colorInvalid : ccHelpText.color]);\n  }\n\n  get #chevronClasses() {\n    return classNames([ccSelect.chevron, this.disabled && ccSelect.chevronDisabled]);\n  }\n\n  get #id() {\n    return 'select_id';\n  }\n\n  get #helpId() {\n    return this.hint ? `${this.#id}__hint` : undefined;\n  }\n\n  // // Fire a custom 'change' event, used when the dropdown changes state.\n  onChange({ target }) {\n    this._setValue(target.value);\n    const event = new CustomEvent('change', { detail: target.value });\n    this.dispatchEvent(event);\n  }\n\n  render() {\n    return html`<div class=\"${ccSelect.wrapper}\">\n      ${when(\n        this.label,\n        () =>\n          html`<label class=\"${ccLabel.base}\" for=\"${this.#id}\">\n            ${this.label}\n            ${when(\n              this.optional,\n              () =>\n                html`<span class=\"${ccLabel.optional}\"\n                  >${i18n._({\n                    id: 'select.label.optional',\n                    message: '(optional)',\n                    comment: 'Shown behind label when marked as optional',\n                  })}</span\n                >`,\n            )}</label\n          >`,\n      )}\n      <div class=\"${ccSelect.selectWrapper}\">\n        <select\n          class=\"${this.#classes}\"\n          id=\"${this.#id}\"\n          ?disabled=${this.disabled}\n          aria-describedby=\"${ifDefined(this.#helpId)}\"\n          aria-invalid=\"${ifDefined(this.invalid)}\"\n          aria-errormessage=\"${ifDefined(this.invalid && this.#helpId)}\"\n          @keydown=${this.handleKeyDown}\n          @change=${this.onChange}>\n          ${unsafeHTML(this._options)}\n        </select>\n        <div class=\"${this.#chevronClasses}\">\n          <w-icon-chevron-down-16></w-icon-chevron-down-16>\n        </div>\n      </div>\n      ${when(this.always || this.invalid, () => html`<div id=\"${this.#helpId}\" class=\"${this.#helpTextClasses}\">${this.hint}</div>`)}\n    </div>`;\n  }\n}\n\nif (!customElements.get('w-select')) {\n  customElements.define('w-select', WarpSelect);\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-select': WarpSelect;\n  }\n}\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"steps.aria.emptyCircle\\\":[\\\"Tom cirkel\\\"],\\\"steps.aria.active\\\":[\\\"Trinindikator aktiv cirkel\\\"],\\\"steps.aria.completed\\\":[\\\"Trinindikator fuldf\u00F8rt cirkel\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"steps.aria.emptyCircle\\\":[\\\"Empty circle\\\"],\\\"steps.aria.active\\\":[\\\"Step indicator active circle\\\"],\\\"steps.aria.completed\\\":[\\\"Step indicator completed circle\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"steps.aria.emptyCircle\\\":[\\\"Tyhj\u00E4 ympyr\u00E4\\\"],\\\"steps.aria.active\\\":[\\\"Vaiheilmaisin aktiivinen ympyr\u00E4\\\"],\\\"steps.aria.completed\\\":[\\\"Vaiheilmaisin valmis ympyr\u00E4\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"steps.aria.emptyCircle\\\":[\\\"Tom sirkel\\\"],\\\"steps.aria.active\\\":[\\\"Stegindikator aktiv sirkel\\\"],\\\"steps.aria.completed\\\":[\\\"Stegindikator hel sirkel\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"steps.aria.emptyCircle\\\":[\\\"Tom cirkel\\\"],\\\"steps.aria.active\\\":[\\\"Stegindikator aktiv cirkel\\\"],\\\"steps.aria.completed\\\":[\\\"Stegindikator full\u00E4ndad cirkel\\\"]}\");", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.text-center{text-align:center}.text-right{text-align:right}.border-2{border-width:2px}.rounded-full{border-radius:9999px}.flex{display:flex}.grid{display:grid}.flex-1{flex:1}.gap-x-16{column-gap:1.6rem}.gap-y-16{row-gap:1.6rem}.row-span-2{grid-row:span 2/span 2}.col-span-3{grid-column:span 3/span 3}.row-start-1{grid-row-start:1}.row-start-2{grid-row-start:2}.col-start-2{grid-column-start:2}.grid-flow-col{grid-auto-flow:column}.grid-rows-\\\\[20px_auto\\\\]{grid-template-rows:20px auto}.grid-rows-\\\\[auto_20px\\\\]{grid-template-rows:auto 20px}.grid-cols-\\\\[1fr_20px_1fr\\\\]{grid-template-columns:1fr 20px 1fr}.grid-cols-\\\\[1fr_20px\\\\]{grid-template-columns:1fr 20px}.grid-cols-\\\\[20px_1fr\\\\]{grid-template-columns:20px 1fr}.items-center{align-items:center}.justify-self-end{justify-self:end}.justify-self-center{justify-self:center}.static{position:static}.s-bg{background-color:var(--w-s-color-background)}.s-bg-disabled{background-color:var(--w-s-color-background-disabled)}.s-bg-primary{background-color:var(--w-s-color-background-primary)}.s-icon-inverted{color:var(--w-s-color-icon-inverted)}.s-border{border-color:var(--w-s-color-border)}.s-border-primary{border-color:var(--w-s-color-border-primary)}.h-2{height:.2rem}.h-20{height:2rem}.h-full{height:100%}.w-2{width:.2rem}.w-20{width:2rem}.w-full{width:100%}.last\\\\:mb-0:last-child{margin-bottom:0}.px-16{padding-left:1.6rem;padding-right:1.6rem}.pb-0{padding-bottom:0}.pb-32{padding-bottom:3.2rem}.invisible{visibility:hidden}.transition-colors{transition-property:color,background-color,border-color,text-decoration-color,fill,stroke;transition-duration:.15s;transition-timing-function:cubic-bezier(.4,0,.2,1)}.duration-300{transition-duration:.3s}`;\n", "// @warp-css;\n\nimport { html, LitElement } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { i18n } from '@lingui/core';\nimport { property, state } from 'lit/decorators.js';\n\nimport '@warp-ds/icons/elements/check-16';\n\nimport { activateI18n } from '../i18n';\nimport { reset } from '../styles.js';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\nimport { styles } from './styles.js';\n\nconst ccSteps = {\n  wrapper: 'w-full',\n  horizontal: 'flex',\n};\n\nconst ccStep = {\n  base: 'group/step',\n  vertical: 'group/stepv grid-rows-[20px_auto] grid grid-flow-col gap-x-16',\n  horizontal: 'group/steph grid-rows-[auto_20px] grid-cols-[1fr_20px_1fr] flex-1 grid gap-y-16 items-center',\n\n  alignLeft: 'grid-cols-[20px_1fr]',\n  alignRight: 'grid-cols-[1fr_20px] text-right',\n\n  dot: 'rounded-full border-2 h-20 w-20 transition-colors duration-300 s-icon-inverted',\n  dotAlignRight: 'col-start-2',\n  dotHorizontal: 'row-start-2 justify-self-end',\n  dotActive: 's-border-primary s-bg-primary',\n  dotIncomplete: 's-border s-bg',\n\n  line: 'transition-colors duration-300',\n  lineVertical: 'w-2 h-full justify-self-center',\n  lineAlignRight: 'col-start-2',\n  lineHorizontal: 'h-2 w-full row-start-2',\n\n  lineIncomplete: 's-bg-disabled',\n  lineComplete: 's-bg-primary',\n\n  content: 'last:mb-0',\n  contentVertical: 'row-span-2 pb-32',\n  contentHorizontal: 'col-span-3 px-16 row-start-1 text-center',\n};\n\n/**\n * Steps are used to show progress through a process or to guide users through a multi-step task.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/components-steps--docs)\n */\nclass WarpSteps extends LitElement {\n  @property({ type: Boolean, reflect: true })\n  horizontal = false;\n\n  @property({ type: Boolean, reflect: true })\n  right = false;\n\n  static styles = [reset, styles];\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  }\n\n  connectedCallback() {\n    super.connectedCallback();\n    this.updateStepsContext();\n  }\n\n  updated() {\n    this.updateStepsContext();\n  }\n\n  updateStepsContext() {\n    // Provide context to child step elements\n    const steps = this.querySelectorAll('w-step');\n    steps.forEach((step: WarpStep, index: number) => {\n      step.setContext({\n        horizontal: this.horizontal,\n        right: this.right,\n        isLast: index === steps.length - 1,\n        isFirst: index === 0,\n      });\n    });\n  }\n\n  render() {\n    const classes = classNames([ccSteps.wrapper, this.horizontal && ccSteps.horizontal]);\n\n    return html`\n      <ul class=${classes}>\n        <slot></slot>\n      </ul>\n    `;\n  }\n}\n\nconst availableAriaLabels = {\n  completed: i18n._({\n    id: 'steps.aria.completed',\n    message: 'Step indicator completed circle',\n    comment: 'Completed circle',\n  }),\n  active: i18n._({\n    id: 'steps.aria.active',\n    message: 'Step indicator active circle',\n    comment: 'Active circle',\n  }),\n  default: i18n._({\n    id: 'steps.aria.emptyCircle',\n    message: 'Empty circle',\n    comment: 'Empty circle',\n  }),\n};\n\ninterface StepsContext {\n  horizontal?: boolean;\n  right?: boolean;\n  isLast?: boolean;\n  isFirst?: boolean;\n}\n\n/**\n * Individual step component that shows a single step in a process\n */\nclass WarpStep extends LitElement {\n  @property({ type: Boolean, reflect: true })\n  active = false;\n\n  @property({ type: Boolean, reflect: true })\n  completed = false;\n\n  @state()\n  private _context: StepsContext = { horizontal: false, right: false, isLast: false, isFirst: false };\n\n  static styles = [reset, styles];\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  }\n\n  setContext(context: StepsContext) {\n    this._context = context;\n    this.requestUpdate();\n  }\n\n  getAriaLabel() {\n    if (this.completed) return availableAriaLabels.completed;\n    if (this.active) return availableAriaLabels.active;\n    return availableAriaLabels.default;\n  }\n\n  render() {\n    const vertical = !this._context.horizontal;\n    const left = !this._context.right;\n    const isFirst = this._context.isFirst;\n    const isLast = this._context.isLast;\n\n    const stepClasses = classNames([\n      ccStep.base,\n      vertical ? ccStep.vertical : ccStep.horizontal,\n      vertical ? (left ? ccStep.alignLeft : ccStep.alignRight) : '',\n    ]);\n\n    const lineHorizontalClasses = classNames([\n      ccStep.line,\n      ccStep.lineHorizontal,\n      this.active || this.completed ? ccStep.lineComplete : ccStep.lineIncomplete,\n      isFirst ? 'invisible' : '',\n    ]);\n\n    const dotClasses = classNames([\n      ccStep.dot,\n      vertical ? (!left ? ccStep.dotAlignRight : '') : ccStep.dotHorizontal,\n      this.active || this.completed ? ccStep.dotActive : ccStep.dotIncomplete,\n    ]);\n\n    const lineClasses = classNames([\n      ccStep.line,\n      vertical ? ccStep.lineVertical : ccStep.lineHorizontal,\n      vertical && !left ? ccStep.lineAlignRight : '',\n      this.completed ? ccStep.lineComplete : ccStep.lineIncomplete,\n      isLast ? 'invisible' : '',\n    ]);\n\n    const contentClasses = classNames([ccStep.content, vertical ? ccStep.contentVertical : ccStep.contentHorizontal, isLast ? 'pb-0' : '']);\n\n    return html`\n      <li class=${stepClasses}>\n        ${!vertical ? html`<div class=${lineHorizontalClasses}></div>` : ''}\n        <div class=${dotClasses} role=\"img\" aria-label=${this.getAriaLabel()} ${this.active ? 'aria-current=\"step\"' : ''}>\n          ${this.completed ? html`<w-icon-check-16 data-testid=\"completed-icon\"></w-icon-check-16>` : ''}\n        </div>\n        <div class=${lineClasses}></div>\n        <div class=${contentClasses}>\n          <slot></slot>\n        </div>\n      </li>\n    `;\n  }\n}\n\nif (!customElements.get('w-steps')) {\n  customElements.define('w-steps', WarpSteps);\n}\n\nif (!customElements.get('w-step')) {\n  customElements.define('w-step', WarpStep);\n}\n\nexport { WarpSteps, WarpStep };\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-steps': WarpSteps;\n    'w-step': WarpStep;\n  }\n}\n", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.bg-\\\\[--w-color-switch-track-background\\\\]{background-color:var(--w-color-switch-track-background)}.group:hover .group-hover\\\\:bg-\\\\[--w-color-switch-track-background-hover\\\\]{background-color:var(--w-color-switch-track-background-hover)}.rounded-full{border-radius:9999px}.block{display:block}.focusable:focus{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:focus-visible{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:not(:focus-visible){outline:none}.left-0{left:0}.left-4{left:.4rem}.top-0{top:0}.top-4{top:.4rem}.absolute{position:absolute}.relative{position:relative}.static{position:static}.s-bg{background-color:var(--w-s-color-background)}.s-bg-disabled{background-color:var(--w-s-color-background-disabled)}.s-bg-disabled-subtle{background-color:var(--w-s-color-background-disabled-subtle)}.s-bg-primary{background-color:var(--w-s-color-background-primary)}.group:hover .group-hover\\\\:s-bg-primary-hover{background-color:var(--w-s-color-background-primary-hover)}.shadow-s{box-shadow:var(--w-shadow-s)}.h-16{height:1.6rem}.h-24{height:2.4rem}.h-full{height:100%}.w-16{width:1.6rem}.w-44{width:4.4rem}.w-full{width:100%}.cursor-pointer{cursor:pointer}.pointer-events-none{pointer-events:none}.sr-only{clip:rect(0,0,0,0);white-space:nowrap;border-width:0;width:1px;height:1px;margin:-1px;padding:0;position:absolute;overflow:hidden}.translate-x-20{--w-translate-x:2rem;transform:translateX(var(--w-translate-x))translateY(var(--w-translate-y))translateZ(var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.transform-gpu{transform:translate3d(var(--w-translate-x),var(--w-translate-y),var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.transition-colors{transition-property:color,background-color,border-color,text-decoration-color,fill,stroke;transition-duration:.15s;transition-timing-function:cubic-bezier(.4,0,.2,1)}.transition-transform{transition-property:transform;transition-duration:.15s;transition-timing-function:cubic-bezier(.4,0,.2,1)}`;\n", "// @warp-css;\n\nimport { html, LitElement } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { property } from 'lit/decorators.js';\n\nimport { reset } from '../styles';\n\nimport { styles } from './styles.js';\n\nconst ccSwitch = {\n  base: 'block relative h-24 w-44 cursor-pointer group focusable rounded-full',\n  disabled: 'pointer-events-none',\n  track: 'absolute top-0 left-0 h-full w-full rounded-full transition-colors',\n  trackActive: 's-bg-primary group-hover:s-bg-primary-hover',\n  trackInactive: 'bg-[--w-color-switch-track-background] group-hover:bg-[--w-color-switch-track-background-hover]',\n  trackDisabled: 's-bg-disabled-subtle',\n  handle: 'absolute transform-gpu h-16 w-16 top-4 left-4 rounded-full transition-transform',\n  handleSelected: 'translate-x-20',\n  handleNotDisabled: 's-bg shadow-s',\n  handleDisabled: 's-bg-disabled',\n  a11y: 'sr-only',\n};\n\nexport class WarpSwitch extends LitElement {\n  @property({ type: Boolean, reflect: true })\n  value: boolean = false;\n\n  @property({ type: Boolean, reflect: true })\n  disabled: boolean = false;\n\n  static styles = [reset, styles];\n\n  /** @internal */\n  get _baseClasses() {\n    return classNames([ccSwitch.base, this.disabled && ccSwitch.disabled]);\n  }\n\n  /** @internal */\n  get _trackClasses() {\n    return classNames([\n      ccSwitch.track,\n      this.disabled && ccSwitch.trackDisabled,\n      !this.disabled && (this.value ? ccSwitch.trackActive : ccSwitch.trackInactive),\n    ]);\n  }\n\n  /** @internal */\n  get _handleClasses() {\n    return classNames([\n      ccSwitch.handle,\n      this.value && ccSwitch.handleSelected,\n      this.disabled ? ccSwitch.handleDisabled : ccSwitch.handleNotDisabled,\n    ]);\n  }\n\n  /** @internal */\n  _handleClick() {\n    if (!this.disabled) {\n      this.value = !this.value;\n      this.dispatchEvent(\n        new CustomEvent('change', {\n          detail: { value: this.value },\n          bubbles: true,\n          composed: true,\n        }),\n      );\n    }\n  }\n\n  render() {\n    return html`\n      <div>\n        <button\n          type=\"button\"\n          role=\"switch\"\n          aria-checked=${this.value}\n          class=${this._baseClasses}\n          aria-disabled=${this.disabled}\n          ?disabled=${this.disabled}\n          @click=${this._handleClick}>\n          <span data-testid=\"track\" class=${this._trackClasses}></span>\n          <span data-testid=\"handle\" class=${this._handleClasses}></span>\n        </button>\n      </div>\n    `;\n  }\n}\n\nif (!customElements.get('w-switch')) {\n  customElements.define('w-switch', WarpSwitch);\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-switch': WarpSwitch;\n  }\n}\n", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.border-b{border-bottom-width:1px}.border-b-4{border-bottom-width:4px}.inline-block{display:inline-block}.inline-grid{display:inline-grid}.hidden{display:none}.grid-cols-1{grid-template-columns:repeat(1,minmax(0,1fr))}.grid-cols-2{grid-template-columns:repeat(2,minmax(0,1fr))}.grid-cols-3{grid-template-columns:repeat(3,minmax(0,1fr))}.grid-cols-4{grid-template-columns:repeat(4,minmax(0,1fr))}.grid-cols-5{grid-template-columns:repeat(5,minmax(0,1fr))}.grid-cols-6{grid-template-columns:repeat(6,minmax(0,1fr))}.grid-cols-7{grid-template-columns:repeat(7,minmax(0,1fr))}.grid-cols-8{grid-template-columns:repeat(8,minmax(0,1fr))}.grid-cols-9{grid-template-columns:repeat(9,minmax(0,1fr))}.-bottom-0{bottom:0}.absolute{position:absolute}.relative{position:relative}.static{position:static}.s-border{border-color:var(--w-s-color-border)}.s-border-selected{border-color:var(--w-s-color-border-selected)}.-mb-1{margin-bottom:-.1rem}.mb-32{margin-bottom:3.2rem}.resize{resize:both}.transition-all{transition-property:all;transition-duration:.15s;transition-timing-function:cubic-bezier(.4,0,.2,1)}.bg-transparent{background-color:#0000}.appearance-none{-webkit-appearance:none;appearance:none}.border-0{border-width:0}.border-b-4{border-bottom-width:4px}.border-transparent{border-color:#0000}.inline-block{display:inline-block}.flex{display:flex}.grid{display:grid}.focusable:focus{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:focus-visible{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:not(:focus-visible){outline:none}.gap-8{gap:.8rem}.focus\\\\:outline-none:focus{outline-offset:2px;outline:2px solid #0000}.items-center{align-items:center}.justify-center{justify-content:center}.static{position:static}.s-text-link{color:var(--w-s-color-text-link)}.s-text-subtle{color:var(--w-s-color-text-subtle)}.hover\\\\:s-text-link:hover{color:var(--w-s-color-text-link)}.s-border-selected{border-color:var(--w-s-color-border-selected)}.hover\\\\:s-border-primary:hover{border-color:var(--w-s-color-border-primary)}.m-0{margin:0}.mx-auto{margin-left:auto;margin-right:auto}.p-0{padding:0}.p-16{padding:1.6rem}.pb-8{padding-bottom:.8rem}.cursor-pointer{cursor:pointer}.font-bold{font-weight:700}.w-full{width: 100%;}`;", "// @warp-css;\n\nimport { html, LitElement, PropertyValues } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { property, query } from 'lit/decorators.js';\n\nimport { reset } from '../styles.js';\n\nimport { styles } from './styles.js';\n\nconst ccTabs = {\n  wrapper: 'inline-block border-b s-border mb-32',\n  base: 'inline-grid relative -mb-1',\n  selectionIndicator: 'absolute s-border-selected -bottom-0 border-b-4 transition-all',\n};\n\nconst ccGridLayout = {\n  cols1: 'grid-cols-1',\n  cols2: 'grid-cols-2',\n  cols3: 'grid-cols-3',\n  cols4: 'grid-cols-4',\n  cols5: 'grid-cols-5',\n  cols6: 'grid-cols-6',\n  cols7: 'grid-cols-7',\n  cols8: 'grid-cols-8',\n  cols9: 'grid-cols-9',\n};\n\n// Simple debounce utility\nfunction debounce<T extends (...args: unknown[]) => unknown>(func: T, wait: number = 200, immediate: boolean = false): T {\n  let timeout: NodeJS.Timeout | null;\n  return ((...args: unknown[]) => {\n    const later = () => {\n      timeout = null;\n      if (!immediate) func(...args);\n    };\n    const callNow = immediate && !timeout;\n    if (timeout) clearTimeout(timeout);\n    timeout = setTimeout(later, wait);\n    if (callNow) func(...args);\n  }) as T;\n}\n\nexport interface TabChangeEvent {\n  name: string;\n}\n\n/**\n * Tabs are used to organize content by grouping similar information on the same page.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/tabs--docs)\n */\nexport class WarpTabs extends LitElement {\n  static styles = [reset, styles];\n\n  @property({ reflect: true })\n  active: string = '';\n\n  @property({ attribute: 'tab-class', reflect: true })\n  tabClass: string = '';\n\n  @query('[role=\"tablist\"]')\n  private tabList!: HTMLElement;\n\n  @query('.selection-indicator')\n  private selectionIndicator!: HTMLElement;\n\n  private _activeTab: string = '';\n  private _resizeObserver?: ResizeObserver;\n  private _updateSelectionIndicatorDebounced = debounce(this.updateSelectionIndicator.bind(this), 100);\n\n  constructor() {\n    super();\n    this.addEventListener('tab-click', this._handleTabClick);\n  }\n\n  connectedCallback() {\n    super.connectedCallback();\n\n    // Set up resize observer for selection indicator updates\n    if (typeof ResizeObserver !== 'undefined') {\n      this._resizeObserver = new ResizeObserver(() => {\n        this._updateSelectionIndicatorDebounced();\n      });\n      this._resizeObserver.observe(this);\n    }\n\n    // Fallback for older browsers\n    window.addEventListener('resize', this._updateSelectionIndicatorDebounced);\n  }\n\n  disconnectedCallback() {\n    super.disconnectedCallback();\n\n    if (this._resizeObserver) {\n      this._resizeObserver.disconnect();\n    }\n    window.removeEventListener('resize', this._updateSelectionIndicatorDebounced);\n    this.removeEventListener('tab-click', this._handleTabClick);\n  }\n\n  firstUpdated() {\n    this._initializeActiveTab();\n    this.updateSelectionIndicator();\n    this.updatePanels();\n  }\n\n  updated(changedProperties: PropertyValues<this>) {\n    if (changedProperties.has('active') && this.active !== this._activeTab) {\n      this._activeTab = this.active;\n      this.updateSelectionIndicator();\n      this.updatePanels();\n      this._notifyTabChange();\n    }\n  }\n\n  private _initializeActiveTab() {\n    const tabs = Array.from(this.querySelectorAll('w-tab'));\n    const activeTab = tabs.find((tab) => tab.hasAttribute('active'));\n\n    if (activeTab) {\n      this._activeTab = activeTab.getAttribute('name') || '';\n    } else if (tabs.length > 0) {\n      this._activeTab = tabs[0].getAttribute('name') || '';\n    }\n\n    if (this._activeTab) {\n      this.active = this._activeTab;\n    }\n  }\n\n  private _handleTabClick = (event: CustomEvent<TabChangeEvent>) => {\n    const newActiveTab = event.detail.name;\n    if (newActiveTab !== this._activeTab) {\n      this.active = newActiveTab;\n      this._activeTab = newActiveTab;\n      this.updateSelectionIndicator();\n      this.updatePanels();\n      this._notifyTabChange();\n    }\n  };\n\n  private _notifyTabChange() {\n    this.dispatchEvent(\n      new CustomEvent('change', {\n        detail: { name: this._activeTab },\n        bubbles: true,\n        composed: true,\n      }),\n    );\n  }\n\n  private updateSelectionIndicator() {\n    requestAnimationFrame(() => {\n      if (!this.tabList || !this.selectionIndicator) return;\n\n      const activeTab = this.tabList.querySelector(`w-tab[name=\"${this._activeTab}\"]`) as HTMLElement;\n      if (!activeTab) return;\n\n      const tabListRect = this.tabList.getBoundingClientRect();\n      const activeTabRect = activeTab.getBoundingClientRect();\n\n      const left = activeTabRect.left - tabListRect.left;\n      const width = activeTabRect.width;\n\n      this.selectionIndicator.style.left = `${left}px`;\n      this.selectionIndicator.style.width = `${width}px`;\n    });\n  }\n\n  private updatePanels() {\n    // Update tab panels visibility\n    const panels = document.querySelectorAll('w-tab-panel');\n    panels.forEach((panel) => {\n      const panelName = panel.getAttribute('name');\n      if (panelName === this._activeTab) {\n        panel.removeAttribute('hidden');\n        // Also explicitly set hidden property to false for web components\n        (panel as HTMLElement).hidden = false;\n      } else {\n        panel.setAttribute('hidden', '');\n        (panel as HTMLElement).hidden = true;\n      }\n    });\n\n    // Update tab active states\n    const tabs = this.querySelectorAll('w-tab');\n    tabs.forEach((tab) => {\n      const tabName = tab.getAttribute('name');\n      if (tabName === this._activeTab) {\n        tab.setAttribute('active', '');\n      } else {\n        tab.removeAttribute('active');\n      }\n    });\n  }\n\n  private _handleKeyDown = (event: KeyboardEvent) => {\n    if (event.altKey || event.ctrlKey || event.shiftKey || !['ArrowLeft', 'ArrowRight', 'Home', 'End'].includes(event.key)) {\n      return;\n    }\n\n    const tabs = Array.from(this.querySelectorAll('w-tab'));\n    const currentIndex = tabs.findIndex((tab) => tab.getAttribute('name') === this._activeTab);\n\n    if (currentIndex === -1) return;\n\n    let nextIndex = currentIndex;\n\n    switch (event.key) {\n      case 'Home':\n        nextIndex = 0;\n        break;\n      case 'End':\n        nextIndex = tabs.length - 1;\n        break;\n      case 'ArrowLeft':\n        nextIndex = Math.max(0, currentIndex - 1);\n        break;\n      case 'ArrowRight':\n        nextIndex = Math.min(tabs.length - 1, currentIndex + 1);\n        break;\n    }\n\n    if (nextIndex !== currentIndex) {\n      event.preventDefault();\n      const nextTab = tabs[nextIndex];\n      const nextTabName = nextTab.getAttribute('name');\n\n      if (nextTabName) {\n        this.active = nextTabName;\n        this._activeTab = nextTabName;\n        this.updateSelectionIndicator();\n        this.updatePanels();\n        this._notifyTabChange();\n\n        // Focus the next tab\n        (nextTab as HTMLElement).focus();\n      }\n    }\n  };\n\n  private get _tabCount() {\n    return this.querySelectorAll('w-tab').length;\n  }\n\n  private get _gridClass() {\n    const count = Math.min(this._tabCount, 9);\n    return ccGridLayout[`cols${count}` as keyof typeof ccGridLayout] || ccGridLayout.cols1;\n  }\n\n  render() {\n    const navClasses = classNames(this.tabClass, ccTabs.wrapper);\n    const divClasses = classNames([ccTabs.base, this._gridClass]);\n\n    return html`\n      <div class=\"${navClasses}\">\n        <div role=\"tablist\" class=\"${divClasses}\" @keydown=\"${this._handleKeyDown}\">\n          <slot></slot>\n          <span class=\"selection-indicator ${ccTabs.selectionIndicator}\" data-testid=\"selection-indicator\"></span>\n        </div>\n      </div>\n    `;\n  }\n}\n\nif (!customElements.get('w-tabs')) {\n  customElements.define('w-tabs', WarpTabs);\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-tabs': WarpTabs;\n  }\n}\n", "import { html, LitElement } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { property } from 'lit/decorators.js';\n\nimport { reset } from '../styles.js';\n\nimport { styles } from './styles.js';\n\nconst ccTab = {\n  base: 'grid w-full items-center font-bold gap-8 focusable antialias p-16 pb-8 border-b-4 bg-transparent border-transparent hover:s-text-link hover:s-border-primary',\n  inactive: 's-text-subtle',\n  active: 's-text-link s-border-selected',\n  icon: 'mx-auto',\n  content: 'flex items-center justify-center gap-8',\n  contentUnderlined: 'content-underlined', // content-underlined is a no-op that prevents a quirk in how Vue handles class bindings\n};\n\nconst ccButtonReset = 'focus:outline-none appearance-none cursor-pointer bg-transparent border-0 m-0 p-0 inline-block';\n\n/**\n * Individual tab component used within w-tabs container.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/tabs--docs)\n */\nexport class WarpTab extends LitElement {\n  static styles = [reset, styles];\n\n  @property({ reflect: true })\n  name!: string;\n\n  @property({ reflect: true })\n  label: string = '';\n\n  @property({ type: Boolean, reflect: true })\n  active: boolean = false;\n\n  @property({ type: Boolean, reflect: true })\n  over: boolean = false;\n\n  @property({ attribute: 'tab-class', reflect: true })\n  tabClass: string = '';\n\n  private _handleClick = (event: MouseEvent) => {\n    // Dispatch a custom event that the parent tabs component can listen to\n    this.dispatchEvent(\n      new CustomEvent('tab-click', {\n        detail: { name: this.name },\n        bubbles: true,\n        composed: true,\n      }),\n    );\n\n    // Also dispatch a generic click event for any click handlers\n    this.dispatchEvent(\n      new CustomEvent('click', {\n        detail: { name: this.name, originalEvent: event },\n        bubbles: true,\n        composed: true,\n      }),\n    );\n  };\n\n  private get _classes() {\n    return classNames(this.tabClass, [ccButtonReset, ccTab.base, this.active ? ccTab.active : ccTab.inactive]);\n  }\n\n  private get _hasChildren() {\n    return this.querySelector('[slot=\"icon\"]') !== null || this.innerHTML.trim() !== this.label;\n  }\n\n  render() {\n    const hasChildren = this._hasChildren;\n\n    return html`\n      <button\n        type=\"button\"\n        role=\"tab\"\n        aria-selected=\"${this.active ? 'true' : 'false'}\"\n        aria-controls=\"${this.active ? `warp-tabpanel-${this.name}` : ''}\"\n        id=\"warp-tab-${this.name}\"\n        tabindex=\"${this.active ? '0' : '-1'}\"\n        class=\"${this._classes}\"\n        @click=\"${this._handleClick}\">\n        ${!hasChildren\n          ? html`<span class=\"${ccTab.contentUnderlined}\">${this.label}</span>`\n          : this.over\n            ? html`\n                <span class=\"${ccTab.icon}\">\n                  <slot name=\"icon\"></slot>\n                </span>\n                <span class=\"${ccTab.contentUnderlined}\">${this.label}</span>\n              `\n            : html`\n                <div class=\"${ccTab.content}\">\n                  <slot name=\"icon\"></slot>\n                  ${this.label}\n                </div>\n              `}\n      </button>\n    `;\n  }\n}\n\nif (!customElements.get('w-tab')) {\n  customElements.define('w-tab', WarpTab);\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-tab': WarpTab;\n  }\n}\n", "import { html, LitElement, PropertyValues } from 'lit';\n\nimport { property } from 'lit/decorators.js';\n\nimport { reset } from '../styles.js';\n\nimport { styles } from './styles.js';\n\n/**\n * Tab panel component that holds content for individual tabs.\n * Each tab panel should have a name that matches a corresponding tab.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/tabs--docs)\n */\nexport class WarpTabPanel extends LitElement {\n  static styles = [reset, styles];\n\n  @property({ reflect: true })\n  name!: string;\n\n  @property({ type: Boolean, reflect: true })\n  hidden: boolean = true;\n\n  connectedCallback() {\n    super.connectedCallback();\n    this.setAttribute('tabindex', '-1');\n    this.setAttribute('role', 'tabpanel');\n\n    // Set aria-labelledby to reference the corresponding tab\n    if (this.name) {\n      this.setAttribute('aria-labelledby', `warp-tab-${this.name}`);\n      this.setAttribute('id', `warp-tabpanel-${this.name}`);\n    }\n  }\n\n  updated(changedProperties: PropertyValues<this>) {\n    if (changedProperties.has('name') && this.name) {\n      this.setAttribute('aria-labelledby', `warp-tab-${this.name}`);\n      this.setAttribute('id', `warp-tabpanel-${this.name}`);\n    }\n  }\n\n  render() {\n    return html`<slot></slot>`;\n  }\n}\n\nif (!customElements.get('w-tab-panel')) {\n  customElements.define('w-tab-panel', WarpTabPanel);\n}\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-tab-panel': WarpTabPanel;\n  }\n}\n", "// @warp-css;\n\nimport { LitElement, html, PropertyValues } from 'lit';\n\nimport { classNames as classnames } from '@chbphone55/classnames';\nimport { FormControlMixin } from '@open-wc/form-control';\nimport WarpElement from '@warp-ds/elements-core';\nimport { property } from 'lit/decorators.js';\nimport { ifDefined } from 'lit/directives/if-defined.js';\n\nimport { reset } from '../styles.js';\n\nimport { styles } from './styles.js';\n\nexport const ccinput = {\n  // wrapper classes\n  wrapper: 'relative',\n  // input classes\n  base: 'block text-m leading-m mb-0 px-8 py-12 rounded-4 w-full focusable focus:[--w-outline-offset:-2px] caret-current', // true\n  default: 'border-1 s-text s-bg s-border hover:s-border-hover active:s-border-selected', // !isInvalid && !isDisabled && !isReadOnly\n  disabled: 'border-1 s-text-disabled s-bg-disabled-subtle s-border-disabled pointer-events-none', // !isInvalid && isDisabled && !isReadOnly\n  invalid: 'border-1 s-text-negative s-bg s-border-negative hover:s-border-negative-hover outline-[--w-s-color-border-negative]!', // isInvalid && !isDisabled && !isReadOnly\n  readOnly: 'pl-0 bg-transparent pointer-events-none', // !isInvalid && !isDisabled && isReadOnly\n  placeholder: 'placeholder:s-text-placeholder',\n  suffix: 'pr-40',\n  prefix: 'pl-[var(--w-prefix-width,_40px)]',\n  // textarea classes\n  textArea: 'min-h-[42] sm:min-h-[45]',\n};\n\nexport const ccLabel = {\n  base: 'antialiased block relative text-s font-bold pb-4 cursor-pointer s-text',\n  optional: 'pl-8 font-normal text-s s-text-subtle',\n};\n\nexport const ccHelpText = {\n  base: 'text-xs mt-4 block',\n  color: 's-text-subtle',\n  colorInvalid: 's-text-negative',\n};\n\n/**\n * A single line text input element.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/forms-textfield--docs)\n */\nclass WarpTextField extends FormControlMixin(LitElement) {\n  static shadowRootOptions = {\n    ...WarpElement.shadowRootOptions,\n    delegatesFocus: true,\n  };\n\n  @property({ type: Boolean, reflect: true })\n  disabled: boolean;\n\n  @property({ type: Boolean, reflect: true })\n  invalid: boolean;\n\n  @property({ type: String, reflect: true })\n  id: string;\n\n  @property({ type: String, reflect: true })\n  label: string;\n\n  @property({ type: String, reflect: true, attribute: 'help-text' })\n  helpText: string;\n\n  @property({ type: String, reflect: true })\n  size: string;\n\n  @property({ type: Number, reflect: true })\n  max: number;\n\n  @property({ type: Number, reflect: true })\n  min: number;\n\n  @property({ type: Number, reflect: true, attribute: 'min-length' })\n  minLength: number;\n\n  @property({ type: Number, reflect: true, attribute: 'max-length' })\n  maxLength: number;\n\n  @property({ type: String, reflect: true })\n  pattern: string;\n\n  @property({ type: String, reflect: true })\n  placeholder: string;\n\n  @property({ type: Boolean, reflect: true, attribute: 'read-only' })\n  readOnly: boolean;\n\n  @property({ type: Boolean, reflect: true })\n  required: boolean;\n\n  @property({ type: String, reflect: true })\n  type = 'text';\n\n  @property({ type: String, reflect: true })\n  value: string;\n\n  @property({ type: String, reflect: true })\n  name: string;\n\n  /** @internal */\n  @property({ type: Boolean })\n  _hasPrefix = false;\n\n  /** @internal */\n  @property({ type: Boolean })\n  _hasSuffix = false;\n\n  updated(changedProperties: PropertyValues<this>) {\n    if (changedProperties.has('value')) {\n      this.setValue(this.value);\n    }\n  }\n\n  // Note about styling slotted elements:\n  // https://developer.mozilla.org/en-US/docs/Web/CSS/::slotted\n  // https://developer.mozilla.org/en-US/docs/Web/Web_Components/Using_shadow_DOM#styling_slotted_elements\n  // Slotted elements remain in lightDOM which allows for control of their style outside of shadowDOM.\n  // ::slotted([Simple Selector]) confirms to Specificity rules, but (being simple) does not add weight to lightDOM skin selectors,\n  // so never gets higher Specificity. Thus in order to overwrite style linked within shadowDOM, we need to use !important.\n  // https://stackoverflow.com/a/61631668\n  static styles = [reset, styles];\n\n  /** @internal */\n  get _inputstyles() {\n    return classnames([\n      ccinput.base,\n      this._hasSuffix && ccinput.suffix,\n      this._hasPrefix && ccinput.prefix,\n      !this.invalid && !this.disabled && !this.readOnly && ccinput.default,\n      this.invalid && !this.disabled && !this.readOnly && ccinput.invalid,\n      !this.invalid && this.disabled && !this.readOnly && ccinput.disabled,\n      !this.invalid && !this.disabled && this.readOnly && ccinput.readOnly,\n    ]);\n  }\n\n  /** @internal */\n  get _helptextstyles() {\n    return classnames([ccHelpText.base, this.invalid ? ccHelpText.colorInvalid : ccHelpText.color]);\n  }\n\n  /** @internal */\n  get _label() {\n    if (this.label) {\n      return html`<label for=\"${this._id}\" class=${ccLabel.base}>${this.label}</label>`;\n    }\n    return undefined;\n  }\n\n  /** @internal */\n  get _helpId() {\n    if (this.helpText) return `${this._id}__hint`;\n    return undefined;\n  }\n\n  /** @internal */\n  get _id() {\n    return 'textfield';\n  }\n\n  /** @internal */\n  get _error() {\n    if (this.invalid && this._helpId) return this._helpId;\n    return undefined;\n  }\n\n  handler(e: Event) {\n    const { name, value } = e.currentTarget as HTMLInputElement;\n    this.setValue(value);\n    const event = new CustomEvent(e.type, {\n      detail: {\n        name,\n        value,\n        target: e.target,\n      },\n    });\n    this.dispatchEvent(event);\n  }\n\n  prefixSlotChange() {\n    const el: HTMLSlotElement = this.renderRoot.querySelector('slot[name=prefix]');\n    const affixes = el.assignedElements();\n    if (affixes.length) this._hasPrefix = true;\n  }\n\n  suffixSlotChange() {\n    const el: HTMLSlotElement = this.renderRoot.querySelector('slot[name=suffix]');\n    const affixes = el.assignedElements();\n    if (affixes.length) this._hasSuffix = true;\n  }\n\n  render() {\n    return html`\n      ${this._label}\n      <div class=\"${ccinput.wrapper}\">\n        <slot @slotchange=\"${this.prefixSlotChange}\" name=\"prefix\"></slot>\n        <input\n          class=\"${this._inputstyles}\"\n          type=\"${this.type}\"\n          min=\"${ifDefined(this.min)}\"\n          max=\"${ifDefined(this.max)}\"\n          size=\"${ifDefined(this.size)}\"\n          minlength=\"${ifDefined(this.minLength)}\"\n          maxlength=\"${ifDefined(this.maxLength)}\"\n          name=\"${ifDefined(this.name)}\"\n          pattern=\"${ifDefined(this.pattern)}\"\n          placeholder=\"${ifDefined(this.placeholder)}\"\n          value=\"${ifDefined(this.value)}\"\n          aria-describedby=\"${ifDefined(this._helpId)}\"\n          aria-errormessage=\"${ifDefined(this._error)}\"\n          aria-invalid=\"${ifDefined(this.invalid)}\"\n          id=\"${this._id}\"\n          ?disabled=\"${this.disabled}\"\n          ?readonly=\"${this.readOnly}\"\n          ?required=\"${this.required}\"\n          @blur=\"${this.handler}\"\n          @change=\"${this.handler}\"\n          @focus=\"${this.handler}\" />\n        <slot @slotchange=\"${this.suffixSlotChange}\" name=\"suffix\"></slot>\n      </div>\n      ${this.helpText && html`<div class=\"${this._helptextstyles}\" id=\"${this._helpId}\">${this.helpText}</div>`}\n    `;\n  }\n}\n\nif (!customElements.get('w-textfield')) {\n  customElements.define('w-textfield', WarpTextField);\n}\n\nexport { WarpTextField };\n\ndeclare global {\n  interface HTMLElementTagNameMap {\n    'w-textfield': WarpTextField;\n  }\n}\n", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.focus\\\\:\\\\[--w-outline-offset\\\\:-2px\\\\]:focus{--w-outline-offset:-2px}.bg-transparent{background-color:#0000}.border-1{border-width:1px}.rounded-4{border-radius:4px}.caret-current{caret-color:currentColor}.block{display:block}.focusable:focus{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:focus-visible{outline:2px solid var(--w-s-color-border-focus);outline-offset:var(--w-outline-offset,1px)}.focusable:not(:focus-visible){outline:none}.outline-\\\\[--w-s-color-border-negative\\\\]\\\\!{outline-color:var(--w-s-color-border-negative)!important}.relative{position:relative}.static{position:static}.s-bg{background-color:var(--w-s-color-background)}.s-bg-disabled-subtle{background-color:var(--w-s-color-background-disabled-subtle)}.s-text{color:var(--w-s-color-text)}.s-text-disabled{color:var(--w-s-color-text-disabled)}.s-text-negative{color:var(--w-s-color-text-negative)}.s-text-subtle{color:var(--w-s-color-text-subtle)}.placeholder\\\\:s-text-placeholder::placeholder{color:var(--w-s-color-text-placeholder)}.s-border{border-color:var(--w-s-color-border)}.s-border-disabled{border-color:var(--w-s-color-border-disabled)}.s-border-negative{border-color:var(--w-s-color-border-negative)}.hover\\\\:s-border-hover:hover{border-color:var(--w-s-color-border-hover)}.hover\\\\:s-border-negative-hover:hover{border-color:var(--w-s-color-border-negative-hover)}.active\\\\:s-border-selected:active{border-color:var(--w-s-color-border-selected)}.w-full{width:100%}.min-h-\\\\[42\\\\]{min-height:4.2rem}.mb-0{margin-bottom:0}.mt-4{margin-top:.4rem}.px-8{padding-left:.8rem;padding-right:.8rem}.py-12{padding-top:1.2rem;padding-bottom:1.2rem}.pb-4{padding-bottom:.4rem}.pl-0{padding-left:0}.pl-8{padding-left:.8rem}.pr-40{padding-right:4rem}.pl-\\\\[var\\\\(--w-prefix-width\\\\,_40px\\\\)\\\\]{padding-left:var(--w-prefix-width,40px)}.cursor-pointer{cursor:pointer}.antialiased{-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;font-smoothing:grayscale}.font-bold{font-weight:700}.font-normal{font-weight:400}.pointer-events-none{pointer-events:none}.text-m{font-size:var(--w-font-size-m);line-height:var(--w-line-height-m)}.text-s{font-size:var(--w-font-size-s);line-height:var(--w-line-height-s)}.text-xs{font-size:var(--w-font-size-xs);line-height:var(--w-line-height-xs)}.leading-m{line-height:var(--w-line-height-m)}@media (min-width:480px){.sm\\\\:min-h-\\\\[45\\\\]{min-height:4.5rem}}`;\n", "const windowExists = (typeof window !== 'undefined')\n\nlet prefersMotion = true\n\nif (windowExists) {\n  const query = window.matchMedia('(prefers-reduced-motion: reduce)')\n  const callback = ({ matches }) => prefersMotion = !matches\n  // older browsers don't support the new API, and the old API is deprecated\n  if (query.addEventListener) query.addEventListener('change', callback)\n  callback(query)\n}\n\nconst removeTransition = el => {\n  el.style.transition = null\n  el.style.backfaceVisibility = null\n  el.style.overflow = null\n}\n\nconst addTransition = (el) => {\n  // we set timing to something insanely short\n  // when reducing motion so the after-* hooks still fire\n  const timing = prefersMotion ? 'var(--f-expansion-duration, 0.3s)' : '0.01s'\n  el.style.transition = `height ${timing}`\n  el.style.backfaceVisibility = 'hidden'\n  el.style.overflow = 'hidden'\n}\n\nconst getAfterExpandCallback = (el, done) => () => {\n  el.style.height = 'auto'\n  el.style.overflow = null\n  if (done) done()\n}\n\nconst getAfterCollapseCallback = (done) => () => {\n  if (done) done()\n}\n\n/**\n * Transitions an element from 0 to a detected height\n * Will return a Promise when no 'done' callback is provided\n * @type {(el: HTMLElement, done?: function) => void | Promise<void>}\n */\nexport const expand = (el, done) => {\n  const returnPromise = (() => {\n    if (!done) return new Promise(r => { done = r })\n  })()\n  const afterExpandCallback = getAfterExpandCallback(el, done)\n  removeTransition(el)\n  el.style.height = 'auto'\n  let dest = el.scrollHeight\n  windowExists && requestAnimationFrame(() => {\n    el.addEventListener('transitionend', afterExpandCallback, { once: true })\n    el.style.height = '0px'\n    el.style.transitionTimingFunction = 'ease-out'\n    addTransition(el)\n    requestAnimationFrame(() => el.style.height = dest + 'px')\n  })\n  if (returnPromise) return returnPromise\n}\n\n/**\n * Transitions an element from a detected height to 0\n * Will return a Promise when no 'done' callback is provided\n * @type {(el: HTMLElement, done?: function) => void | Promise<void>}\n */\nexport const collapse = (el, done) => {\n  const returnPromise = (() => {\n    if (!done) return new Promise(r => { done = r })\n  })()\n  const afterCollapseCallback = getAfterCollapseCallback(done)\n  removeTransition(el)\n  let original = el.scrollHeight\n  windowExists && requestAnimationFrame(() => {\n    el.addEventListener('transitionend', afterCollapseCallback, { once: true })\n    el.style.height = original + 'px'\n    el.style.transitionTimingFunction = 'ease-in'\n    addTransition(el)\n    requestAnimationFrame(() => el.style.height = '0px')\n  })\n  if (returnPromise) return returnPromise\n}\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"toast.aria.error\\\":[\\\"Fejl\\\"],\\\"toast.aria.successful\\\":[\\\"Fuldf\u00F8rt\\\"],\\\"toast.aria.warning\\\":[\\\"Advarsel\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"toast.aria.error\\\":[\\\"Error\\\"],\\\"toast.aria.successful\\\":[\\\"Successful\\\"],\\\"toast.aria.warning\\\":[\\\"Warning\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"toast.aria.error\\\":[\\\"Virhe\\\"],\\\"toast.aria.successful\\\":[\\\"Onnistui\\\"],\\\"toast.aria.warning\\\":[\\\"Varoitus\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"toast.aria.error\\\":[\\\"Feil\\\"],\\\"toast.aria.successful\\\":[\\\"Vellykket\\\"],\\\"toast.aria.warning\\\":[\\\"Advarsel\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"toast.aria.error\\\":[\\\"Fel\\\"],\\\"toast.aria.successful\\\":[\\\"Genomf\u00F6rt\\\"],\\\"toast.aria.warning\\\":[\\\"Varning\\\"]}\");", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.bg-transparent{background-color:#0000}.border-2{border-width:2px}.rounded-8{border-radius:8px}.rounded-full{border-radius:9999px}.block{display:block}.flex{display:flex}.grid{display:grid}.shrink-0{flex-shrink:0}.auto-rows-auto{grid-auto-rows:auto}.overflow-hidden{overflow:hidden}.self-center{align-self:center}.bottom-16{bottom:1.6rem}.left-0{left:0}.right-0{right:0}.justify-center{justify-content:center}.justify-items-center{justify-items:center}.fixed{position:fixed}.relative{position:relative}.static{position:static}.z-50{z-index:50}.s-bg-negative-subtle{background-color:var(--w-s-color-background-negative-subtle)}.s-bg-positive-subtle{background-color:var(--w-s-color-background-positive-subtle)}.s-bg-warning-subtle{background-color:var(--w-s-color-background-warning-subtle)}.s-text{color:var(--w-s-color-text)}.s-icon{color:var(--w-s-color-icon)}.s-icon-negative{color:var(--w-s-color-icon-negative)}.s-icon-positive{color:var(--w-s-color-icon-positive)}.s-icon-warning{color:var(--w-s-color-icon-warning)}.hover\\\\:s-icon-hover:hover{color:var(--w-s-color-icon-hover)}.active\\\\:s-icon-active:active{color:var(--w-s-color-icon-active)}.s-border-negative-subtle{border-color:var(--w-s-color-border-negative-subtle)}.s-border-positive-subtle{border-color:var(--w-s-color-border-positive-subtle)}.s-border-warning-subtle{border-color:var(--w-s-color-border-warning-subtle)}.w-full{width:100%}.h-\\\\[16px\\\\]{height:16px}.w-\\\\[16px\\\\]{width:16px}.mx-8{margin-left:.8rem;margin-right:.8rem}.mx-auto{margin-left:auto;margin-right:auto}.last-child\\\\:mb-0>:last-child{margin-bottom:0}.ml-auto{margin-left:auto}.mr-8{margin-right:.8rem}.mt-16{margin-top:1.6rem}.m-\\\\[8px\\\\]{margin:8px}.p-8{padding:.8rem}.py-4{padding-top:.4rem;padding-bottom:.4rem}.p-\\\\[8px\\\\]{padding:8px}.pointer-events-auto{pointer-events:auto}.pointer-events-none{pointer-events:none}.translate-z-0{--w-translate-z:0rem;transform:translateX(var(--w-translate-x))translateY(var(--w-translate-y))translateZ(var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.transform{transform:translateX(var(--w-translate-x))translateY(var(--w-translate-y))translateZ(var(--w-translate-z))rotate(var(--w-rotate))rotateX(var(--w-rotate-x))rotateY(var(--w-rotate-y))rotateZ(var(--w-rotate-z))skewX(var(--w-skew-x))skewY(var(--w-skew-y))scaleX(var(--w-scale-x))scaleY(var(--w-scale-y))scaleZ(var(--w-scale-z))}.transition-all{transition-property:all;transition-duration:.15s;transition-timing-function:cubic-bezier(.4,0,.2,1)}@media (min-width:480px){.sm\\\\:mx-16{margin-left:1.6rem;margin-right:1.6rem}}`;\n", "import { css, html, LitElement } from 'lit';\n\nimport { classNames } from '@chbphone55/classnames';\nimport { i18n } from '@lingui/core';\nimport { expand, collapse } from 'element-collapse';\nimport { property, state } from 'lit/decorators.js';\nimport { when } from 'lit/directives/when.js';\n\nimport '@warp-ds/icons/elements/warning-16';\nimport '@warp-ds/icons/elements/error-16';\nimport '@warp-ds/icons/elements/success-16';\nimport '@warp-ds/icons/elements/close-16';\n\nimport { activateI18n } from '../i18n';\nimport { reset } from '../styles';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\nimport { styles } from './styles';\nimport type { ToastType } from './types';\n\nconst ccToast = {\n  wrapper: 'relative overflow-hidden w-full',\n  base: 'flex group p-8 mt-16 rounded-8 border-2 pointer-events-auto transition-all',\n  positive: 's-bg-positive-subtle s-border-positive-subtle s-text',\n  warning: 's-bg-warning-subtle s-border-warning-subtle s-text',\n  negative: 's-bg-negative-subtle s-border-negative-subtle s-text',\n  iconBase: 'shrink-0 rounded-full w-[16px] h-[16px] m-[8px]',\n  iconPositive: 's-icon-positive',\n  iconWarning: 's-icon-warning',\n  iconNegative: 's-icon-negative',\n  iconLoading: 'animate-bounce',\n  content: 'self-center mr-8 py-4 last-child:mb-0',\n  close: 'bg-transparent ml-auto p-[8px] s-icon hover:s-icon-hover active:s-icon-active',\n};\n\n/**\n * You should probably not include this component in HTML markup.\n *\n * As long as the element definition is imported in your application you can use the toast JS API to create toasts.\n *\n * ```js\n * import from '@warp-ds/elements/components/toast';\n * import { toast, removeToast, updateToast } from '@warp-ds/elements/toast';\n * ```\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/overlays-toast--docs)\n *\n * @internal\n */\n\nexport class WarpToast extends LitElement {\n  static styles = [\n    reset,\n    styles,\n    css`\n      :host {\n        display: block;\n      }\n    `,\n  ];\n\n  @property({ type: String, attribute: true, reflect: true })\n  id: string = Date.now().toString(36) + Math.random().toString(36).slice(2, 5);\n\n  @property({ type: String, attribute: true, reflect: true })\n  type: ToastType = 'success';\n\n  @property({ type: String, attribute: true, reflect: true })\n  text: string = '';\n\n  @property({ type: Boolean, attribute: true, reflect: true })\n  canclose: boolean = false;\n\n  @state()\n  private _expanded: boolean = false;\n\n  constructor() {\n    super();\n    activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n  }\n\n  connectedCallback() {\n    super.connectedCallback();\n  }\n\n  disconnectedCallback() {\n    super.disconnectedCallback();\n  }\n\n  updated() {\n    if (!this._expanded && this._wrapper) expand(this._wrapper, () => (this._expanded = true));\n  }\n\n  get #primaryClasses() {\n    return classNames([\n      ccToast.base,\n      this.type === 'success' && ccToast.positive,\n      this.type === 'warning' && ccToast.warning,\n      this.type === 'error' && ccToast.negative,\n    ]);\n  }\n\n  get #iconClasses() {\n    return classNames([\n      ccToast.iconBase,\n      this.type === 'success' && ccToast.iconPositive,\n      this.type === 'warning' && ccToast.iconWarning,\n      this.type === 'error' && ccToast.iconNegative,\n    ]);\n  }\n\n  /** @internal */\n  get _wrapper() {\n    return this.renderRoot?.querySelector(`section`) ?? null;\n  }\n\n  /** @internal */\n  get _warning() {\n    return this.type === 'warning';\n  }\n\n  /** @internal */\n  get _error() {\n    return this.type === 'error';\n  }\n\n  /** @internal */\n  get _role() {\n    return this._error || this._warning ? 'alert' : 'status';\n  }\n\n  /** @internal */\n  get _typeLabel() {\n    if (this._warning) {\n      return i18n._({\n        id: 'toast.aria.warning',\n        message: 'Warning',\n        comment: 'Default screenreader message for warning in toast component',\n      });\n    }\n    if (this._error) {\n      return i18n._({\n        id: 'toast.aria.error',\n        message: 'Error',\n        comment: 'Default screenreader message for error in toast component',\n      });\n    } else {\n      return i18n._({\n        id: 'toast.aria.successful',\n        message: 'Successful',\n        comment: 'Default screenreader message for successful in toast component',\n      });\n    }\n  }\n\n  /** @internal */\n  get _iconMarkup() {\n    if (this._warning) return html`<w-icon-warning-16></w-icon-warning-16>`;\n    if (this._error) return html`<w-icon-error-16></w-icon-error-16>`;\n    else return html`<w-icon-success-16></w-icon-success-16>`;\n  }\n\n  async collapse() {\n    return new Promise<void>((resolve) => {\n      if (this._expanded && this._wrapper) {\n        collapse(this._wrapper, resolve);\n      } else {\n        resolve();\n      }\n    });\n  }\n\n  close() {\n    const event = new CustomEvent('close', {\n      detail: { id: this.id },\n      bubbles: true,\n      composed: true,\n    });\n    this.updateComplete.then(() => this.dispatchEvent(event));\n  }\n\n  render() {\n    if (!this.text) return html``;\n\n    return html` <section class=\"${ccToast.wrapper}\" aria-label=\"${this._typeLabel}\">\n      <div class=\"${this.#primaryClasses}\">\n        <div class=\"${this.#iconClasses}\">${this._iconMarkup}</div>\n        <div role=\"${this._role}\" class=\"${ccToast.content}\">\n          <p>${this.text}</p>\n        </div>\n        ${when(\n          this.canclose === true,\n          () => html`\n            <button class=\"${ccToast.close}\" @click=\"${this.close}\">\n              <w-icon-close-16></w-icon-close-16>\n            </button>\n          `,\n        )}\n      </div>\n    </section>`;\n  }\n}\n\nif (!customElements.get('w-toast')) {\n  customElements.define('w-toast', WarpToast);\n}\n", "/**\n * @license\n * Copyright 2017 Google LLC\n * SPDX-License-Identifier: BSD-3-Clause\n */\n\nimport {ChildPart, noChange} from '../lit-html.js';\nimport {directive, Directive, PartInfo, PartType} from '../directive.js';\nimport {\n  insertPart,\n  getCommittedValue,\n  removePart,\n  setCommittedValue,\n  setChildPartValue,\n} from '../directive-helpers.js';\n\nexport type KeyFn<T> = (item: T, index: number) => unknown;\nexport type ItemTemplate<T> = (item: T, index: number) => unknown;\n\n// Helper for generating a map of array item to its index over a subset\n// of an array (used to lazily generate `newKeyToIndexMap` and\n// `oldKeyToIndexMap`)\nconst generateMap = (list: unknown[], start: number, end: number) => {\n  const map = new Map<unknown, number>();\n  for (let i = start; i <= end; i++) {\n    map.set(list[i], i);\n  }\n  return map;\n};\n\nclass RepeatDirective extends Directive {\n  private _itemKeys?: unknown[];\n\n  constructor(partInfo: PartInfo) {\n    super(partInfo);\n    if (partInfo.type !== PartType.CHILD) {\n      throw new Error('repeat() can only be used in text expressions');\n    }\n  }\n\n  private _getValuesAndKeys<T>(\n    items: Iterable<T>,\n    keyFnOrTemplate: KeyFn<T> | ItemTemplate<T>,\n    template?: ItemTemplate<T>\n  ) {\n    let keyFn: KeyFn<T> | undefined;\n    if (template === undefined) {\n      template = keyFnOrTemplate;\n    } else if (keyFnOrTemplate !== undefined) {\n      keyFn = keyFnOrTemplate as KeyFn<T>;\n    }\n    const keys = [];\n    const values = [];\n    let index = 0;\n    for (const item of items) {\n      keys[index] = keyFn ? keyFn(item, index) : index;\n      values[index] = template!(item, index);\n      index++;\n    }\n    return {\n      values,\n      keys,\n    };\n  }\n\n  render<T>(items: Iterable<T>, template: ItemTemplate<T>): Array<unknown>;\n  render<T>(\n    items: Iterable<T>,\n    keyFn: KeyFn<T> | ItemTemplate<T>,\n    template: ItemTemplate<T>\n  ): Array<unknown>;\n  render<T>(\n    items: Iterable<T>,\n    keyFnOrTemplate: KeyFn<T> | ItemTemplate<T>,\n    template?: ItemTemplate<T>\n  ) {\n    return this._getValuesAndKeys(items, keyFnOrTemplate, template).values;\n  }\n\n  override update<T>(\n    containerPart: ChildPart,\n    [items, keyFnOrTemplate, template]: [\n      Iterable<T>,\n      KeyFn<T> | ItemTemplate<T>,\n      ItemTemplate<T>,\n    ]\n  ) {\n    // Old part & key lists are retrieved from the last update (which may\n    // be primed by hydration)\n    const oldParts = getCommittedValue(\n      containerPart\n    ) as Array<ChildPart | null>;\n    const {values: newValues, keys: newKeys} = this._getValuesAndKeys(\n      items,\n      keyFnOrTemplate,\n      template\n    );\n\n    // We check that oldParts, the committed value, is an Array as an\n    // indicator that the previous value came from a repeat() call. If\n    // oldParts is not an Array then this is the first render and we return\n    // an array for lit-html's array handling to render, and remember the\n    // keys.\n    if (!Array.isArray(oldParts)) {\n      this._itemKeys = newKeys;\n      return newValues;\n    }\n\n    // In SSR hydration it's possible for oldParts to be an array but for us\n    // to not have item keys because the update() hasn't run yet. We set the\n    // keys to an empty array. This will cause all oldKey/newKey comparisons\n    // to fail and execution to fall to the last nested brach below which\n    // reuses the oldPart.\n    const oldKeys = (this._itemKeys ??= []);\n\n    // New part list will be built up as we go (either reused from\n    // old parts or created for new keys in this update). This is\n    // saved in the above cache at the end of the update.\n    const newParts: ChildPart[] = [];\n\n    // Maps from key to index for current and previous update; these\n    // are generated lazily only when needed as a performance\n    // optimization, since they are only required for multiple\n    // non-contiguous changes in the list, which are less common.\n    let newKeyToIndexMap!: Map<unknown, number>;\n    let oldKeyToIndexMap!: Map<unknown, number>;\n\n    // Head and tail pointers to old parts and new values\n    let oldHead = 0;\n    let oldTail = oldParts.length - 1;\n    let newHead = 0;\n    let newTail = newValues.length - 1;\n\n    // Overview of O(n) reconciliation algorithm (general approach\n    // based on ideas found in ivi, vue, snabbdom, etc.):\n    //\n    // * We start with the list of old parts and new values (and\n    //   arrays of their respective keys), head/tail pointers into\n    //   each, and we build up the new list of parts by updating\n    //   (and when needed, moving) old parts or creating new ones.\n    //   The initial scenario might look like this (for brevity of\n    //   the diagrams, the numbers in the array reflect keys\n    //   associated with the old parts or new values, although keys\n    //   and parts/values are actually stored in parallel arrays\n    //   indexed using the same head/tail pointers):\n    //\n    //      oldHead v                 v oldTail\n    //   oldKeys:  [0, 1, 2, 3, 4, 5, 6]\n    //   newParts: [ ,  ,  ,  ,  ,  ,  ]\n    //   newKeys:  [0, 2, 1, 4, 3, 7, 6] <- reflects the user's new\n    //                                      item order\n    //      newHead ^                 ^ newTail\n    //\n    // * Iterate old & new lists from both sides, updating,\n    //   swapping, or removing parts at the head/tail locations\n    //   until neither head nor tail can move.\n    //\n    // * Example below: keys at head pointers match, so update old\n    //   part 0 in-place (no need to move it) and record part 0 in\n    //   the `newParts` list. The last thing we do is advance the\n    //   `oldHead` and `newHead` pointers (will be reflected in the\n    //   next diagram).\n    //\n    //      oldHead v                 v oldTail\n    //   oldKeys:  [0, 1, 2, 3, 4, 5, 6]\n    //   newParts: [0,  ,  ,  ,  ,  ,  ] <- heads matched: update 0\n    //   newKeys:  [0, 2, 1, 4, 3, 7, 6]    and advance both oldHead\n    //                                      & newHead\n    //      newHead ^                 ^ newTail\n    //\n    // * Example below: head pointers don't match, but tail\n    //   pointers do, so update part 6 in place (no need to move\n    //   it), and record part 6 in the `newParts` list. Last,\n    //   advance the `oldTail` and `oldHead` pointers.\n    //\n    //         oldHead v              v oldTail\n    //   oldKeys:  [0, 1, 2, 3, 4, 5, 6]\n    //   newParts: [0,  ,  ,  ,  ,  , 6] <- tails matched: update 6\n    //   newKeys:  [0, 2, 1, 4, 3, 7, 6]    and advance both oldTail\n    //                                      & newTail\n    //         newHead ^              ^ newTail\n    //\n    // * If neither head nor tail match; next check if one of the\n    //   old head/tail items was removed. We first need to generate\n    //   the reverse map of new keys to index (`newKeyToIndexMap`),\n    //   which is done once lazily as a performance optimization,\n    //   since we only hit this case if multiple non-contiguous\n    //   changes were made. Note that for contiguous removal\n    //   anywhere in the list, the head and tails would advance\n    //   from either end and pass each other before we get to this\n    //   case and removals would be handled in the final while loop\n    //   without needing to generate the map.\n    //\n    // * Example below: The key at `oldTail` was removed (no longer\n    //   in the `newKeyToIndexMap`), so remove that part from the\n    //   DOM and advance just the `oldTail` pointer.\n    //\n    //         oldHead v           v oldTail\n    //   oldKeys:  [0, 1, 2, 3, 4, 5, 6]\n    //   newParts: [0,  ,  ,  ,  ,  , 6] <- 5 not in new map: remove\n    //   newKeys:  [0, 2, 1, 4, 3, 7, 6]    5 and advance oldTail\n    //         newHead ^           ^ newTail\n    //\n    // * Once head and tail cannot move, any mismatches are due to\n    //   either new or moved items; if a new key is in the previous\n    //   \"old key to old index\" map, move the old part to the new\n    //   location, otherwise create and insert a new part. Note\n    //   that when moving an old part we null its position in the\n    //   oldParts array if it lies between the head and tail so we\n    //   know to skip it when the pointers get there.\n    //\n    // * Example below: neither head nor tail match, and neither\n    //   were removed; so find the `newHead` key in the\n    //   `oldKeyToIndexMap`, and move that old part's DOM into the\n    //   next head position (before `oldParts[oldHead]`). Last,\n    //   null the part in the `oldPart` array since it was\n    //   somewhere in the remaining oldParts still to be scanned\n    //   (between the head and tail pointers) so that we know to\n    //   skip that old part on future iterations.\n    //\n    //         oldHead v        v oldTail\n    //   oldKeys:  [0, 1, -, 3, 4, 5, 6]\n    //   newParts: [0, 2,  ,  ,  ,  , 6] <- stuck: update & move 2\n    //   newKeys:  [0, 2, 1, 4, 3, 7, 6]    into place and advance\n    //                                      newHead\n    //         newHead ^           ^ newTail\n    //\n    // * Note that for moves/insertions like the one above, a part\n    //   inserted at the head pointer is inserted before the\n    //   current `oldParts[oldHead]`, and a part inserted at the\n    //   tail pointer is inserted before `newParts[newTail+1]`. The\n    //   seeming asymmetry lies in the fact that new parts are\n    //   moved into place outside in, so to the right of the head\n    //   pointer are old parts, and to the right of the tail\n    //   pointer are new parts.\n    //\n    // * We always restart back from the top of the algorithm,\n    //   allowing matching and simple updates in place to\n    //   continue...\n    //\n    // * Example below: the head pointers once again match, so\n    //   simply update part 1 and record it in the `newParts`\n    //   array.  Last, advance both head pointers.\n    //\n    //         oldHead v        v oldTail\n    //   oldKeys:  [0, 1, -, 3, 4, 5, 6]\n    //   newParts: [0, 2, 1,  ,  ,  , 6] <- heads matched: update 1\n    //   newKeys:  [0, 2, 1, 4, 3, 7, 6]    and advance both oldHead\n    //                                      & newHead\n    //            newHead ^        ^ newTail\n    //\n    // * As mentioned above, items that were moved as a result of\n    //   being stuck (the final else clause in the code below) are\n    //   marked with null, so we always advance old pointers over\n    //   these so we're comparing the next actual old value on\n    //   either end.\n    //\n    // * Example below: `oldHead` is null (already placed in\n    //   newParts), so advance `oldHead`.\n    //\n    //            oldHead v     v oldTail\n    //   oldKeys:  [0, 1, -, 3, 4, 5, 6] <- old head already used:\n    //   newParts: [0, 2, 1,  ,  ,  , 6]    advance oldHead\n    //   newKeys:  [0, 2, 1, 4, 3, 7, 6]\n    //               newHead ^     ^ newTail\n    //\n    // * Note it's not critical to mark old parts as null when they\n    //   are moved from head to tail or tail to head, since they\n    //   will be outside the pointer range and never visited again.\n    //\n    // * Example below: Here the old tail key matches the new head\n    //   key, so the part at the `oldTail` position and move its\n    //   DOM to the new head position (before `oldParts[oldHead]`).\n    //   Last, advance `oldTail` and `newHead` pointers.\n    //\n    //               oldHead v  v oldTail\n    //   oldKeys:  [0, 1, -, 3, 4, 5, 6]\n    //   newParts: [0, 2, 1, 4,  ,  , 6] <- old tail matches new\n    //   newKeys:  [0, 2, 1, 4, 3, 7, 6]   head: update & move 4,\n    //                                     advance oldTail & newHead\n    //               newHead ^     ^ newTail\n    //\n    // * Example below: Old and new head keys match, so update the\n    //   old head part in place, and advance the `oldHead` and\n    //   `newHead` pointers.\n    //\n    //               oldHead v oldTail\n    //   oldKeys:  [0, 1, -, 3, 4, 5, 6]\n    //   newParts: [0, 2, 1, 4, 3,   ,6] <- heads match: update 3\n    //   newKeys:  [0, 2, 1, 4, 3, 7, 6]    and advance oldHead &\n    //                                      newHead\n    //                  newHead ^  ^ newTail\n    //\n    // * Once the new or old pointers move past each other then all\n    //   we have left is additions (if old list exhausted) or\n    //   removals (if new list exhausted). Those are handled in the\n    //   final while loops at the end.\n    //\n    // * Example below: `oldHead` exceeded `oldTail`, so we're done\n    //   with the main loop.  Create the remaining part and insert\n    //   it at the new head position, and the update is complete.\n    //\n    //                   (oldHead > oldTail)\n    //   oldKeys:  [0, 1, -, 3, 4, 5, 6]\n    //   newParts: [0, 2, 1, 4, 3, 7 ,6] <- create and insert 7\n    //   newKeys:  [0, 2, 1, 4, 3, 7, 6]\n    //                     newHead ^ newTail\n    //\n    // * Note that the order of the if/else clauses is not\n    //   important to the algorithm, as long as the null checks\n    //   come first (to ensure we're always working on valid old\n    //   parts) and that the final else clause comes last (since\n    //   that's where the expensive moves occur). The order of\n    //   remaining clauses is just a simple guess at which cases\n    //   will be most common.\n    //\n    // * Note, we could calculate the longest\n    //   increasing subsequence (LIS) of old items in new position,\n    //   and only move those not in the LIS set. However that costs\n    //   O(nlogn) time and adds a bit more code, and only helps\n    //   make rare types of mutations require fewer moves. The\n    //   above handles removes, adds, reversal, swaps, and single\n    //   moves of contiguous items in linear time, in the minimum\n    //   number of moves. As the number of multiple moves where LIS\n    //   might help approaches a random shuffle, the LIS\n    //   optimization becomes less helpful, so it seems not worth\n    //   the code at this point. Could reconsider if a compelling\n    //   case arises.\n\n    while (oldHead <= oldTail && newHead <= newTail) {\n      if (oldParts[oldHead] === null) {\n        // `null` means old part at head has already been used\n        // below; skip\n        oldHead++;\n      } else if (oldParts[oldTail] === null) {\n        // `null` means old part at tail has already been used\n        // below; skip\n        oldTail--;\n      } else if (oldKeys[oldHead] === newKeys[newHead]) {\n        // Old head matches new head; update in place\n        newParts[newHead] = setChildPartValue(\n          oldParts[oldHead]!,\n          newValues[newHead]\n        );\n        oldHead++;\n        newHead++;\n      } else if (oldKeys[oldTail] === newKeys[newTail]) {\n        // Old tail matches new tail; update in place\n        newParts[newTail] = setChildPartValue(\n          oldParts[oldTail]!,\n          newValues[newTail]\n        );\n        oldTail--;\n        newTail--;\n      } else if (oldKeys[oldHead] === newKeys[newTail]) {\n        // Old head matches new tail; update and move to new tail\n        newParts[newTail] = setChildPartValue(\n          oldParts[oldHead]!,\n          newValues[newTail]\n        );\n        insertPart(containerPart, newParts[newTail + 1], oldParts[oldHead]!);\n        oldHead++;\n        newTail--;\n      } else if (oldKeys[oldTail] === newKeys[newHead]) {\n        // Old tail matches new head; update and move to new head\n        newParts[newHead] = setChildPartValue(\n          oldParts[oldTail]!,\n          newValues[newHead]\n        );\n        insertPart(containerPart, oldParts[oldHead]!, oldParts[oldTail]!);\n        oldTail--;\n        newHead++;\n      } else {\n        if (newKeyToIndexMap === undefined) {\n          // Lazily generate key-to-index maps, used for removals &\n          // moves below\n          newKeyToIndexMap = generateMap(newKeys, newHead, newTail);\n          oldKeyToIndexMap = generateMap(oldKeys, oldHead, oldTail);\n        }\n        if (!newKeyToIndexMap.has(oldKeys[oldHead])) {\n          // Old head is no longer in new list; remove\n          removePart(oldParts[oldHead]!);\n          oldHead++;\n        } else if (!newKeyToIndexMap.has(oldKeys[oldTail])) {\n          // Old tail is no longer in new list; remove\n          removePart(oldParts[oldTail]!);\n          oldTail--;\n        } else {\n          // Any mismatches at this point are due to additions or\n          // moves; see if we have an old part we can reuse and move\n          // into place\n          const oldIndex = oldKeyToIndexMap.get(newKeys[newHead]);\n          const oldPart = oldIndex !== undefined ? oldParts[oldIndex] : null;\n          if (oldPart === null) {\n            // No old part for this value; create a new one and\n            // insert it\n            const newPart = insertPart(containerPart, oldParts[oldHead]!);\n            setChildPartValue(newPart, newValues[newHead]);\n            newParts[newHead] = newPart;\n          } else {\n            // Reuse old part\n            newParts[newHead] = setChildPartValue(oldPart, newValues[newHead]);\n            insertPart(containerPart, oldParts[oldHead]!, oldPart);\n            // This marks the old part as having been used, so that\n            // it will be skipped in the first two checks above\n            oldParts[oldIndex as number] = null;\n          }\n          newHead++;\n        }\n      }\n    }\n    // Add parts for any remaining new values\n    while (newHead <= newTail) {\n      // For all remaining additions, we insert before last new\n      // tail, since old pointers are no longer valid\n      const newPart = insertPart(containerPart, newParts[newTail + 1]);\n      setChildPartValue(newPart, newValues[newHead]);\n      newParts[newHead++] = newPart;\n    }\n    // Remove any remaining unused old parts\n    while (oldHead <= oldTail) {\n      const oldPart = oldParts[oldHead++];\n      if (oldPart !== null) {\n        removePart(oldPart);\n      }\n    }\n\n    // Save order of new parts for next round\n    this._itemKeys = newKeys;\n    // Directly set part value, bypassing it's dirty-checking\n    setCommittedValue(containerPart, newParts);\n    return noChange;\n  }\n}\n\nexport interface RepeatDirectiveFn {\n  <T>(\n    items: Iterable<T>,\n    keyFnOrTemplate: KeyFn<T> | ItemTemplate<T>,\n    template?: ItemTemplate<T>\n  ): unknown;\n  <T>(items: Iterable<T>, template: ItemTemplate<T>): unknown;\n  <T>(\n    items: Iterable<T>,\n    keyFn: KeyFn<T> | ItemTemplate<T>,\n    template: ItemTemplate<T>\n  ): unknown;\n}\n\n/**\n * A directive that repeats a series of values (usually `TemplateResults`)\n * generated from an iterable, and updates those items efficiently when the\n * iterable changes based on user-provided `keys` associated with each item.\n *\n * Note that if a `keyFn` is provided, strict key-to-DOM mapping is maintained,\n * meaning previous DOM for a given key is moved into the new position if\n * needed, and DOM will never be reused with values for different keys (new DOM\n * will always be created for new keys). This is generally the most efficient\n * way to use `repeat` since it performs minimum unnecessary work for insertions\n * and removals.\n *\n * The `keyFn` takes two parameters, the item and its index, and returns a unique key value.\n *\n * ```js\n * html`\n *   <ol>\n *     ${repeat(this.items, (item) => item.id, (item, index) => {\n *       return html`<li>${index}: ${item.name}</li>`;\n *     })}\n *   </ol>\n * `\n * ```\n *\n * **Important**: If providing a `keyFn`, keys *must* be unique for all items in a\n * given call to `repeat`. The behavior when two or more items have the same key\n * is undefined.\n *\n * If no `keyFn` is provided, this directive will perform similar to mapping\n * items to values, and DOM will be reused against potentially different items.\n */\nexport const repeat = directive(RepeatDirective) as RepeatDirectiveFn;\n\n/**\n * The type of the class that powers this directive. Necessary for naming the\n * directive's return type.\n */\nexport type {RepeatDirective};\n", "// @warp-css;\nimport { css, html, LitElement } from 'lit';\n\nimport { state } from 'lit/decorators.js';\nimport { repeat } from 'lit/directives/repeat.js';\n\nimport { reset } from '../styles';\n\nimport { styles } from './styles';\nimport type { WarpToast } from './toast';\nimport type { ToastOptions, ToastInternal } from './types';\n\n/**\n * You should probably not include this component in HTML markup.\n *\n * As long as the element definition is imported in your application you can use the toast JS API to create toasts.\n *\n * ```js\n * import from '@warp-ds/elements/components/toast';\n * import { toast, removeToast, updateToast } from '@warp-ds/elements/toast';\n * ```\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/overlays-toast--docs)\n *\n * @internal\n */\n\n// all class objects have to be in this file when generating\nconst ccToastContainer = {\n  wrapper: 'fixed transform translate-z-0 bottom-16 left-0 right-0 mx-8 sm:mx-16 z-50 pointer-events-none',\n  base: 'grid auto-rows-auto justify-items-center justify-center mx-auto pointer-events-none',\n  content: 'w-full',\n};\n\nexport class WarpToastContainer extends LitElement {\n  static styles = [\n    reset,\n    styles,\n    css`\n      :host {\n        display: block;\n      }\n    `,\n  ];\n\n  @state()\n  private _toasts: Map<string | number, ToastInternal> = new Map();\n\n  private _interval: NodeJS.Timeout | undefined;\n\n  connectedCallback() {\n    super.connectedCallback();\n\n    // regularly check if any toasts have expired\n    this._interval = setInterval(() => {\n      // sort toasts into keep and remove\n      const keep = [];\n      const remove = [];\n      for (const toast of this._toasts) {\n        if (Date.now() <= toast[1].duration) keep.push(toast);\n        else remove.push(toast);\n      }\n\n      // collapse toasts that will be removed\n      const collapseTasks = [];\n      for (const [id] of remove) {\n        const el = this.renderRoot.querySelector(`#${id}`) as unknown as WarpToast | null;\n        collapseTasks.push(el.collapse());\n      }\n\n      // once all toasts that should be removed have been collapsed, remove them from the map\n      Promise.all(collapseTasks).then(() => {\n        if (keep.length !== this._toasts.size) {\n          this._toasts = new Map(keep);\n        }\n      });\n    }, 500);\n  }\n\n  disconnectedCallback() {\n    super.disconnectedCallback();\n\n    if (this._interval) {\n      clearTimeout(this._interval);\n    }\n  }\n\n  public static init() {\n    let el = document.querySelector('w-toast-container');\n\n    if (!el) {\n      el = document.createElement('w-toast-container');\n      document.body.appendChild(el);\n    }\n\n    return el;\n  }\n\n  /** @internal */\n  get _toastsArray() {\n    return Array.from(this._toasts).map(([, toast]) => toast);\n  }\n\n  get(id: string | number): ToastInternal | undefined {\n    if (!id) {\n      throw new Error('undefined \"id\" given when attempting to retrieve toast');\n    }\n\n    if (typeof id !== 'string' && !Number.isInteger(id)) {\n      throw new Error('\"id\" must be number or string when attempting to retrieve toast');\n    }\n\n    return this._toasts.get(id);\n  }\n\n  set(toast: ToastOptions): Map<string | number, ToastInternal> {\n    if (!toast.id) {\n      throw new Error('invalid or undefined \"id\" on toast object');\n    }\n\n    const result = this._toasts.set(toast.id, {\n      id: toast.id,\n      type: toast.type ?? 'success',\n      text: toast.text ?? '',\n      canclose: toast.canclose ?? false,\n      duration: Date.now() + (toast.duration || 5000),\n    });\n\n    this._toasts = new Map(Array.from(this._toasts));\n    return result;\n  }\n\n  async del(id: string | number): Promise<boolean> {\n    if (!id) {\n      throw new Error('undefined \"id\" given when attempting to retrieve toast');\n    }\n\n    if (typeof id !== 'string' && !Number.isInteger(id)) {\n      throw new Error('\"id\" must be number or string when attempting to retrieve toast');\n    }\n\n    const el = this.renderRoot.querySelector(`#${id}`) as unknown as WarpToast | null;\n\n    if (!this._toasts.has(id)) {\n      return false;\n    }\n\n    await el.collapse();\n    const result = this._toasts.delete(id);\n\n    this._toasts = new Map(Array.from(this._toasts));\n    return result;\n  }\n\n  render() {\n    return html`\n      <aside class=\"${ccToastContainer.wrapper}\">\n        <div class=\"${ccToastContainer.base}\" id=\"w-toast-container-list\">\n          ${repeat(\n            this._toastsArray,\n            (toast) => toast.id,\n            (toast) =>\n              html` <w-toast\n                class=\"${ccToastContainer.content}\"\n                id=\"${toast.id}\"\n                type=\"${toast.type}\"\n                text=\"${toast.text}\"\n                ?canclose=${toast.canclose}\n                @close=${() => this.del(toast.id)}>\n              </w-toast>`,\n          )}\n        </div>\n      </aside>\n    `;\n  }\n}\n\nif (!customElements.get('w-toast-container')) {\n  customElements.define('w-toast-container', WarpToastContainer);\n}\n", "export const windowExists = typeof window !== 'undefined';\n", "import { windowExists } from '../utils/window-exists';\n\nimport { WarpToastContainer } from './toast-container';\nimport type { ToastOptions, ToastInternal } from './types';\n\nfunction getToastContainer() {\n  const container = customElements.get('w-toast-container');\n  return container as typeof WarpToastContainer;\n}\n\n/**\n * Creates a new toast\n */\nexport function toast(message: string, options?: ToastOptions) {\n  if (!windowExists) return;\n\n  const toast = getToastContainer().init() as WarpToastContainer;\n\n  const data: ToastOptions = {\n    id: Date.now().toString(36) + Math.random().toString(36).slice(2, 5),\n    text: message,\n    duration: 5000,\n    type: 'success',\n    ...options,\n  };\n\n  toast.set(data);\n  return data;\n}\n\n/**\n * Remove an existing toast\n */\nexport function removeToast(id: string | number): Promise<boolean> | undefined {\n  if (!windowExists) return;\n\n  const toast = getToastContainer().init() as WarpToastContainer;\n  return toast.del(id);\n}\n\n/**\n * Update an existing toast\n */\nexport function updateToast(id: string | number, options?: ToastOptions): ToastInternal | undefined {\n  if (!windowExists) return;\n\n  const toast = getToastContainer().init() as WarpToastContainer;\n  toast.set({ ...toast.get(id), ...options });\n  return toast.get(id);\n}\n"],
+  "mappings": "8qCAAA,IAAAA,GAAAC,GAAAC,IAAA,cAGA,OAAO,eAAeA,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5DA,GAAQ,cAAgBA,GAAQ,UAAY,OAO5C,IAAIC,IACH,SAAUA,EAAW,CAMlBA,EAAU,iBAAsB,oBAMhCA,EAAU,qBAA0B,wBAMpCA,EAAU,eAAoB,mBAK9BA,EAAU,iBAAsB,oBAKhCA,EAAU,YAAiB,eAC/B,GAAGA,GAAYD,GAAQ,YAAcA,GAAQ,UAAY,CAAC,EAAE,EAE5DA,GAAQ,cAAgB,IAAI,IAAI,CAC5B,CAACC,GAAU,iBAAkB,6CAA6C,EAC1E,CACIA,GAAU,qBACV,iDACJ,EACA,CACIA,GAAU,eACV,wEACJ,EACA,CACIA,GAAU,iBACV,uHAEJ,EACA,CAACA,GAAU,YAAa,4CAA4C,CACxE,CAAC,IC3DD,IAAAC,GAAAC,GAAAC,IAAA,cACA,OAAO,eAAeA,GAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5DA,GAAQ,MAAQA,GAAQ,cAAgBA,GAAQ,UAAY,OAC5D,IAAMC,GAAW,KACjB,OAAO,eAAeD,GAAS,YAAa,CAAE,WAAY,GAAM,IAAK,UAAY,CAAE,OAAOC,GAAS,SAAW,CAAE,CAAC,EACjH,OAAO,eAAeD,GAAS,gBAAiB,CAAE,WAAY,GAAM,IAAK,UAAY,CAAE,OAAOC,GAAS,aAAe,CAAE,CAAC,EASzH,SAASC,GAAcC,EAAK,CAExB,MADuB,CAACA,EAAI,MAAM,YAAY,EACtB,SAASA,EAAK,EAAE,EAAI,GAChD,CAYA,SAASC,GAAoBD,EAAKE,EAAWC,EAAgB,CACzD,IAAMC,EAAYL,GAAcC,CAAG,EACnC,GAAI,OAAO,MAAMI,CAAS,GACrBD,IAAmB,QAAaA,IAAmBH,EAAI,OACxD,MAAM,IAAI,YAAYF,GAAS,cAAc,IAAII,CAAS,CAAC,EAE/D,OAAOE,CACX,CASA,SAASC,GAAqBC,EAAM,CAChC,IAAMC,EAAaN,GAAoBK,EAAMR,GAAS,UAAU,qBAAsB,CAAC,EACvF,OAAO,OAAO,aAAaS,CAAU,CACzC,CAWA,SAASC,GAAiBF,EAAMG,EAAe,CAC3C,IAAMF,EAAaN,GAAoBK,EAAMR,GAAS,UAAU,iBAAkB,CAAC,EACnF,GAAIW,IAAkB,OAAW,CAC7B,IAAMC,EAAsBT,GAAoBQ,EAAeX,GAAS,UAAU,iBAAkB,CAAC,EACrG,OAAO,OAAO,aAAaS,EAAYG,CAAmB,CAC9D,CACA,OAAO,OAAO,aAAaH,CAAU,CACzC,CAMA,SAASI,GAAcC,EAAM,CACzB,OAAOA,EAAK,OAAO,CAAC,IAAM,KAAOA,EAAK,OAAOA,EAAK,OAAS,CAAC,IAAM,GACtE,CASA,SAASC,GAA0BC,EAAW,CAC1C,GAAI,CAACH,GAAcG,CAAS,EACxB,MAAM,IAAI,YAAYhB,GAAS,cAAc,IAAIA,GAAS,UAAU,gBAAgB,CAAC,EAEzF,IAAMiB,EAAgBD,EAAU,MAAM,EAAG,EAAE,EACrCP,EAAaN,GAAoBc,EAAejB,GAAS,UAAU,gBAAgB,EACzF,GAAI,CACA,OAAO,OAAO,cAAcS,CAAU,CAC1C,OACOS,EAAK,CACR,MAAMA,aAAe,WACf,IAAI,YAAYlB,GAAS,cAAc,IAAIA,GAAS,UAAU,cAAc,CAAC,EAC7EkB,CACV,CACJ,CAGA,SAASC,GAAeX,EAAMY,EAAQ,GAAO,CACzC,GAAIA,EACA,MAAM,IAAI,YAAYpB,GAAS,cAAc,IAAIA,GAAS,UAAU,gBAAgB,CAAC,EAIzF,IAAMS,EAAa,SAASD,EAAM,CAAC,EACnC,OAAO,OAAO,aAAaC,CAAU,CACzC,CAKA,IAAMY,GAAyB,IAAI,IAAI,CACnC,CAAC,IAAK,IAAI,EACV,CAAC,IAAK,IAAI,EACV,CAAC,IAAK;AAAA,CAAI,EACV,CAAC,IAAK,IAAI,EACV,CAAC,IAAK,GAAI,EACV,CAAC,IAAK,IAAI,EACV,CAAC,IAAK,IAAI,CACd,CAAC,EAMD,SAASC,GAAyBd,EAAM,CACpC,OAAOa,GAAuB,IAAIb,CAAI,GAAKA,CAC/C,CAiBA,IAAMe,GAAc,yHAUpB,SAASC,GAAMC,EAAKC,EAAc,GAAO,CACrC,OAAOD,EAAI,QAAQF,GAAa,SAAUI,EAAGC,EAAW1B,EAAKc,EAAWa,EAAsBC,EAAWC,EAASC,EAAOC,EAAiB,CAGtI,GAAIL,IAAc,OACd,MAAO,KAEX,GAAI1B,IAAQ,OACR,OAAOK,GAAqBL,CAAG,EAEnC,GAAIc,IAAc,OACd,OAAOD,GAA0BC,CAAS,EAE9C,GAAIa,IAAyB,OACzB,OAAOnB,GAAiBmB,EAAsBC,CAAS,EAE3D,GAAIC,IAAY,OACZ,OAAOrB,GAAiBqB,CAAO,EAEnC,GAAIC,IAAU,IACV,MAAO,KAEX,GAAIA,IAAU,OACV,OAAOb,GAAea,EAAO,CAACN,CAAW,EAE7C,GAAIO,IAAoB,OACpB,OAAOX,GAAyBW,CAAe,EAEnD,MAAM,IAAI,YAAYjC,GAAS,cAAc,IAAIA,GAAS,UAAU,WAAW,CAAC,CACpF,CAAC,CACL,CACAD,GAAQ,MAAQyB,GAChBzB,GAAQ,QAAUyB,KCtLlB,IAGMU,GAASC,WAKFC,GACXF,GAAOG,aACNH,GAAOI,WADDD,QAC2BH,GAAOI,SAASC,eAClD,uBAAwBC,SAASC,WACjC,YAAaC,cAAcD,UAkBvBE,GAAoBC,OAAAA,EAEpBC,GAAc,IAAIC,QASXC,GATWD,KASXC,CAOX,YACEC,EACAC,EACAC,EAAAA,CAEA,GAVFC,KAAe,aAAA,GAUTD,IAAcP,GAChB,MAAUS,MACR,mEAAA,EAGJD,KAAKH,QAAUA,EACfG,KAAKE,EAAWJ,CACjB,CAID,IAAA,YAAIK,CAGF,IAAIA,EAAaH,KAAKI,EAChBN,EAAUE,KAAKE,EACrB,GAAIjB,IAA+BkB,IAA/BlB,OAAyD,CAC3D,IAAMoB,EAAYP,IAAZO,QAAqCP,EAAQQ,SAAW,EAC1DD,IACFF,EAAaT,GAAYa,IAAIT,CAAAA,GAE3BK,IAF2BL,UAG5BE,KAAKI,EAAcD,EAAa,IAAIZ,eAAiBiB,YACpDR,KAAKH,OAAAA,EAEHQ,GACFX,GAAYe,IAAIX,EAASK,CAAAA,EAG9B,CACD,OAAOA,CACR,CAED,UAAAO,CACE,OAAOV,KAAKH,OACb,CAAA,EAiCUc,GAAaC,GACxB,IAAKhB,GACc,OAAVgB,GAAU,SAAWA,EAAeA,EAAPC,GAAAA,OAEpCrB,EAAAA,EAWSsB,EAAM,CACjBhB,KACGiB,IAAAA,CAEH,IAAMlB,EACJC,EAAQQ,SAAW,EACfR,EAAQ,CAAA,EACRiB,EAAOC,OACL,CAACC,EAAKC,EAAGC,IAAQF,GA7CAL,GAAAA,CAEzB,GAAKA,EAAkC,eAAvC,GACE,OAAQA,EAAoBf,QACvB,GAAqB,OAAVe,GAAU,SAC1B,OAAOA,EAEP,MAAUX,MACR,mEACKW,EADL,sFAAA,CAIH,GAiCgDM,CAAAA,EAAKpB,EAAQqB,EAAM,CAAA,EAC5DrB,EAAQ,CAAA,CAAA,EAEhB,OAAO,IAAKF,GACVC,EACAC,EACAN,EAAAA,CACD,EAYU4B,GAAc,CACzBC,EACAC,IAAAA,CAEA,GAAIrC,GACDoC,EAA0BE,mBAAqBD,EAAOE,IAAKC,GAC1DA,aAAalC,cAAgBkC,EAAIA,EAAEtB,UAAAA,MAGrC,SAAWsB,KAAKH,EAAQ,CACtB,IAAMI,EAAQC,SAASC,cAAc,OAAA,EAE/BC,EAAS9C,GAAyB,SACpC8C,IADoC,QAEtCH,EAAMI,aAAa,QAASD,CAAAA,EAE9BH,EAAMK,YAAeN,EAAgB5B,QACrCwB,EAAWW,YAAYN,CAAAA,CACxB,CACF,EAWUO,GACXhD,GAEKwC,GAAyBA,EACzBA,GACCA,aAAalC,eAbY2C,GAAAA,CAC/B,IAAIrC,EAAU,GACd,QAAWsC,KAAQD,EAAME,SACvBvC,GAAWsC,EAAKtC,QAElB,OAAOc,GAAUd,CAAAA,CAAQ,GAQkC4B,CAAAA,EAAKA,EChKlE,GAAA,CAAMY,GACJA,GAAEC,eACFA,GAAcC,yBACdA,GAAwBC,oBACxBA,GAAmBC,sBACnBA,GAAqBC,eACrBA,EAAAA,EACEC,OAKEC,GAASC,WAUTC,GAAgBF,GACnBE,aAMGC,GAAiCD,GAClCA,GAAaE,YACd,GAEEC,GAEFL,GAAOM,+BAoGLC,GAA4B,CAChCC,EACAC,IACMD,EA0KKE,GAA8C,CACzD,YAAYC,EAAgBC,EAAAA,CAC1B,OAAQA,EAAAA,CACN,KAAKC,QACHF,EAAQA,EAAQR,GAAiC,KACjD,MACF,KAAKJ,OACL,KAAKe,MAGHH,EAAQA,GAAS,KAAOA,EAAQI,KAAKC,UAAUL,CAAAA,CAAAA,CAGnD,OAAOA,CACR,EAED,cAAcA,EAAsBC,EAAAA,CAClC,IAAIK,EAAqBN,EACzB,OAAQC,EAAAA,CACN,KAAKC,QACHI,EAAYN,IAAU,KACtB,MACF,KAAKO,OACHD,EAAYN,IAAU,KAAO,KAAOO,OAAOP,CAAAA,EAC3C,MACF,KAAKZ,OACL,KAAKe,MAIH,GAAA,CAEEG,EAAYF,KAAKI,MAAMR,CAAAA,CACxB,OAAQS,EAAAA,CACPH,EAAY,IACb,CAAA,CAGL,OAAOA,CACR,CAAA,EAWUI,GAAuB,CAACV,EAAgBW,IAAAA,CAClD7B,GAAGkB,EAAOW,CAAAA,EAEPC,GAAkD,CACtDC,UAAAA,GACAZ,KAAMa,OACNC,UAAWhB,GACXiB,QAAAA,GACAC,WAAAA,GACAC,WAAYR,EAAAA,SAsBbS,GAAAA,OAA8BC,WAA9BD,cAA8BC,SAAaD,OAAO,UAAA,IAcnD9B,GAAAA,GAAOgC,sBAAPhC,OAAAA,GAAOgC,oBAAwB,IAAIC,SAAAA,IAWbC,GAXaD,cAoBzBE,WAAAA,CAqFR,OAAA,eAAsBC,EAAAA,OACpBC,KAAKC,KAAAA,IACJD,EAAAA,KAAKE,IAALF,KAAAA,EAAAA,KAAKE,EAAkB,CAAA,GAAIC,KAAKJ,CAAAA,CAClC,CAuGD,WAAA,oBAAWK,CAOT,OALAJ,KAAKK,SAAAA,EAMHL,KAAKM,MAA4B,CAAA,GAAIN,KAAKM,KAAyBC,KAAAA,CAAAA,CAEtE,CA6BD,OAAA,eACEC,EACAC,EAA+BvB,GAAAA,CAc/B,GAXIuB,EAAQC,QACTD,EAAsDtB,UAAAA,IAEzDa,KAAKC,KAAAA,EAGDD,KAAKW,UAAUC,eAAeJ,CAAAA,KAChCC,EAAU/C,OAAOmD,OAAOJ,CAAAA,GAChBK,QAAAA,IAEVd,KAAKe,kBAAkBC,IAAIR,EAAMC,CAAAA,EAAAA,CAC5BA,EAAQQ,WAAY,CACvB,IAAMC,EAIFzB,OAAAA,EACE0B,EAAanB,KAAKoB,sBAAsBZ,EAAMU,EAAKT,CAAAA,EACrDU,IADqDV,QAEvDpD,GAAe2C,KAAKW,UAAWH,EAAMW,CAAAA,CAExC,CACF,CA6BS,OAAA,sBACRX,EACAU,EACAT,EAAAA,OAEA,GAAA,CAAMY,IAACA,EAAGL,IAAEA,CAAAA,GAAO1D,EAAAA,GAAyB0C,KAAKW,UAAWH,CAAAA,IAAzClD,KAAAA,EAAkD,CACnE,KAAA+D,CACE,OAAOrB,KAAKkB,CAAAA,CACb,EACD,IAA2BI,EAAAA,CACxBtB,KAAqDkB,CAAAA,EAAOI,CAC9D,CAAA,EAmBH,MAAO,CACLD,IAAAA,EACA,IAA2B/C,EAAAA,CACzB,IAAMiD,EAAWF,GAAAA,YAAAA,EAAKG,KAAKxB,MAC3BgB,GAAAA,MAAAA,EAAKQ,KAAKxB,KAAM1B,GAChB0B,KAAKyB,cAAcjB,EAAMe,EAAUd,CAAAA,CACpC,EACDiB,aAAAA,GACAC,WAAAA,EAAY,CAEf,CAgBD,OAAA,mBAA0BnB,EAAAA,OACxB,OAAOR,EAAAA,KAAKe,kBAAkBM,IAAIb,CAAAA,IAA3BR,KAAAA,EAAoCd,EAC5C,CAgBO,OAAA,MAAOe,CACb,GACED,KAAKY,eAAe1C,GAA0B,mBAAA,CAAA,EAG9C,OAGF,IAAM0D,EAAYnE,GAAeuC,IAAAA,EACjC4B,EAAUvB,SAAAA,EAKNuB,EAAU1B,IALJG,SAMRL,KAAKE,EAAgB,CAAA,GAAI0B,EAAU1B,CAAAA,GAGrCF,KAAKe,kBAAoB,IAAIc,IAAID,EAAUb,iBAAAA,CAC5C,CAaS,OAAA,UAAOV,CACf,GAAIL,KAAKY,eAAe1C,GAA0B,WAAA,CAAA,EAChD,OAMF,GAJA8B,KAAK8B,UAAAA,GACL9B,KAAKC,KAAAA,EAGDD,KAAKY,eAAe1C,GAA0B,YAAA,CAAA,EAAsB,CACtE,IAAM6D,EAAQ/B,KAAKgC,WACbC,EAAW,CAAA,GACZ1E,GAAoBwE,CAAAA,EAAAA,GACpBvE,GAAsBuE,CAAAA,CAAAA,EAE3B,QAAWG,KAAKD,EACdjC,KAAKmC,eAAeD,EAAGH,EAAMG,CAAAA,CAAAA,CAEhC,CAGD,IAAMxC,EAAWM,KAAKP,OAAOC,QAAAA,EAC7B,GAAIA,IAAa,KAAM,CACrB,IAAMsC,EAAarC,oBAAoB0B,IAAI3B,CAAAA,EAC3C,GAAIsC,IAAJ,OACE,OAAK,CAAOE,EAAGzB,CAAAA,IAAYuB,EACzBhC,KAAKe,kBAAkBC,IAAIkB,EAAGzB,CAAAA,CAGnC,CAGDT,KAAKM,KAA2B,IAAIuB,IACpC,OAAK,CAAOK,EAAGzB,CAAAA,IAAYT,KAAKe,kBAAmB,CACjD,IAAMqB,EAAOpC,KAAKqC,KAA2BH,EAAGzB,CAAAA,EAC5C2B,IAD4C3B,QAE9CT,KAAKM,KAAyBU,IAAIoB,EAAMF,CAAAA,CAE3C,CAEDlC,KAAKsC,cAAgBtC,KAAKuC,eAAevC,KAAKwC,MAAAA,CAkB/C,CA4BS,OAAA,eACRA,EAAAA,CAEA,IAAMF,EAAgB,CAAA,EACtB,GAAI7D,MAAMgE,QAAQD,CAAAA,EAAS,CAIzB,IAAMxB,EAAM,IAAI0B,IAAKF,EAA0BG,KAAKC,GAAAA,EAAUC,QAAAA,CAAAA,EAE9D,QAAWC,KAAK9B,EACdsB,EAAcS,QAAQC,GAAmBF,CAAAA,CAAAA,CAE5C,MAAUN,IAAV,QACCF,EAAcnC,KAAK6C,GAAmBR,CAAAA,CAAAA,EAExC,OAAOF,CACR,CAaO,OAAA,KACN9B,EACAC,EAAAA,CAEA,IAAMtB,EAAYsB,EAAQtB,UAC1B,OAAOA,IAAP,GAAOA,OAEkB,OAAdA,GAAc,SACnBA,EACgB,OAATqB,GAAS,SACdA,EAAKyC,YAAAA,EAAAA,MAEd,CAiDD,aAAAC,CACEC,MAAAA,EA9WMnD,KAAoBoD,KAAAA,OAuU5BpD,KAAeqD,gBAAAA,GAOfrD,KAAUsD,WAAAA,GAwBFtD,KAAoBuD,KAAuB,KASjDvD,KAAKwD,KAAAA,CACN,CAMO,MAAAA,OACNxD,KAAKyD,KAAkB,IAAIC,QACxBC,GAAS3D,KAAK4D,eAAiBD,CAAAA,EAElC3D,KAAK6D,KAAsB,IAAIhC,IAG/B7B,KAAK8D,KAAAA,EAGL9D,KAAKyB,cAAAA,GACJzB,EAAAA,KAAKkD,YAAuChD,IAA5CF,MAAAA,EAA2D+D,QAASC,GACnEA,EAAEhE,IAAAA,EAEL,CAWD,cAAciE,EAAAA,WACXjE,EAAAA,KAAKkE,OAALlE,KAAAA,EAAAA,KAAKkE,KAAkB,IAAIxB,KAAOyB,IAAIF,CAAAA,EAKnCjE,KAAKoE,aAL8BH,QAKFjE,KAAKqE,eACxCJ,EAAAA,EAAWK,gBAAXL,MAAAA,EAAAA,KAAAA,GAEH,CAMD,iBAAiBA,EAAAA,QACfjE,EAAAA,KAAKkE,OAALlE,MAAAA,EAAoBuE,OAAON,EAC5B,CAQO,MAAAH,CACN,IAAMU,EAAqB,IAAI3C,IACzBd,EAAqBf,KAAKkD,YAC7BnC,kBACH,QAAWmB,KAAKnB,EAAkBR,KAAAA,EAC5BP,KAAKY,eAAesB,CAAAA,IACtBsC,EAAmBxD,IAAIkB,EAAGlC,KAAKkC,CAAAA,CAAAA,EAAAA,OACxBlC,KAAKkC,CAAAA,GAGZsC,EAAmBC,KAAO,IAC5BzE,KAAKoD,KAAuBoB,EAE/B,CAWS,kBAAAE,OACR,IAAMN,GACJpE,EAAAA,KAAK2E,aAAL3E,KAAAA,EACAA,KAAK4E,aACF5E,KAAKkD,YAAuC2B,iBAAAA,EAMjD,OAJAC,GACEV,EACCpE,KAAKkD,YAAuCZ,aAAAA,EAExC8B,CACR,CAOD,mBAAAW,UAEG/E,EAAAA,KAA4CoE,aAA5CpE,YAA4CoE,WAC3CpE,KAAK0E,iBAAAA,GACP1E,KAAK4D,eAAAA,EAAe,GACpB5D,EAAAA,KAAKkE,OAALlE,MAAAA,EAAoB+D,QAASiB,GAAAA,OAAMA,OAAAA,EAAAA,EAAEV,gBAAFU,YAAAA,EAAAA,KAAAA,IACpC,CAQS,eAAeC,EAAAA,CAA6B,CAQtD,sBAAAC,QACElF,EAAAA,KAAKkE,OAALlE,MAAAA,EAAoB+D,QAASiB,GAAAA,OAAMA,OAAAA,EAAAA,EAAEG,mBAAFH,YAAAA,EAAAA,KAAAA,IACpC,CAcD,yBACExE,EACA4E,EACA9G,EAAAA,CAEA0B,KAAKqF,KAAsB7E,EAAMlC,CAAAA,CAClC,CAEO,KAAsBkC,EAAmBlC,EAAAA,OAC/C,IAGMmC,EAFJT,KAAKkD,YACLnC,kBAC6BM,IAAIb,CAAAA,EAC7B4B,EACJpC,KAAKkD,YACLb,KAA2B7B,EAAMC,CAAAA,EACnC,GAAI2B,IAAJ,QAA0B3B,EAAQnB,UAA9B8C,GAAgD,CAClD,IAKMkD,KAJH7E,EAAAA,EAAQpB,YAARoB,YAAAA,EAAiD8E,eAI9CD,OAFC7E,EAAQpB,UACThB,IACsBkH,YAAajH,EAAOmC,EAAQlC,IAAAA,EAwBxDyB,KAAKuD,KAAuB/C,EACxB8E,GAAa,KACftF,KAAKwF,gBAAgBpD,CAAAA,EAErBpC,KAAKyF,aAAarD,EAAMkD,CAAAA,EAG1BtF,KAAKuD,KAAuB,IAC7B,CACF,CAGD,KAAsB/C,EAAclC,EAAAA,WAClC,IAAMoH,EAAO1F,KAAKkD,YAGZyC,EAAYD,EAAKpF,KAA0Ce,IAAIb,CAAAA,EAGrE,GAAImF,IAAJ,QAA8B3F,KAAKuD,OAAyBoC,EAAU,CACpE,IAAMlF,EAAUiF,EAAKE,mBAAmBD,CAAAA,EAClCtG,EACyB,OAAtBoB,EAAQpB,WAAc,WACzB,CAACwG,cAAepF,EAAQpB,SAAAA,IACxBoB,EAAAA,EAAQpB,YAARoB,YAAAA,EAAmBoF,iBADKxG,OAEtBoB,EAAQpB,UACRhB,GAER2B,KAAKuD,KAAuBoC,EAC5B,IAAMG,EAAiBzG,EAAUwG,cAAevH,EAAOmC,EAAQlC,IAAAA,EAC/DyB,KAAK2F,CAAAA,GACHG,EAAAA,GAAAA,KAAAA,GACA9F,EAAAA,KAAK+F,OAAL/F,YAAAA,EAAsBqB,IAAIsE,KAD1BG,KAAAA,EAGCA,EAEH9F,KAAKuD,KAAuB,IAC7B,CACF,CAgBD,cACE/C,EACAe,EACAd,EAAAA,SAGA,GAAID,IAAJ,OAAwB,CAOtB,IAAMkF,EAAO1F,KAAKkD,YACZ8C,EAAWhG,KAAKQ,CAAAA,EActB,GAbAC,GAAAA,OAAAA,EAAYiF,EAAKE,mBAAmBpF,CAAAA,GAAAA,IAEjCC,EAAAA,EAAQjB,aAARiB,KAAAA,EAAsBzB,IAAUgH,EAAUzE,CAAAA,GAO1Cd,EAAQlB,YACPkB,EAAQnB,SACR0G,MAAahG,EAAAA,KAAK+F,OAAL/F,YAAAA,EAAsBqB,IAAIb,KAAAA,CACtCR,KAAKiG,aAAaP,EAAKrD,KAA2B7B,EAAMC,CAAAA,CAAAA,GAK3D,OAHAT,KAAKkG,EAAiB1F,EAAMe,EAAUd,CAAAA,CAKzC,CACGT,KAAKqD,kBADR,KAECrD,KAAKyD,KAAkBzD,KAAKmG,KAAAA,EAE/B,CAKD,EACE3F,EACAe,EAAAA,CACAhC,WAACA,EAAUD,QAAEA,EAAOwB,QAAEA,CAAAA,EACtBsF,EAAAA,WAII7G,GAAAA,GAAgBS,EAAAA,KAAK+F,OAAL/F,KAAAA,EAAAA,KAAK+F,KAAoB,IAAIlE,KAAOwE,IAAI7F,CAAAA,IAC1DR,KAAK+F,KAAgB/E,IACnBR,GACA4F,EAAAA,GAAAA,KAAAA,EAAmB7E,IAAnB6E,KAAAA,EAA+BpG,KAAKQ,CAAAA,CAAAA,EAIlCM,IAJkCN,IAId4F,IAApBtF,UAMDd,KAAK6D,KAAoBwC,IAAI7F,CAAAA,IAG3BR,KAAKsD,YAAe/D,IACvBgC,EAAAA,QAEFvB,KAAK6D,KAAoB7C,IAAIR,EAAMe,CAAAA,GAMjCjC,IANiCiC,IAMbvB,KAAKuD,OAAyB/C,KACnDR,EAAAA,KAAKsG,OAALtG,KAAAA,EAAAA,KAAKsG,KAA2B,IAAI5D,KAAoByB,IAAI3D,CAAAA,EAEhE,CAKO,MAAA,MAAM2F,CACZnG,KAAKqD,gBAAAA,GACL,GAAA,CAAA,MAGQrD,KAAKyD,IACZ,OAAQ1E,EAAAA,CAKP2E,QAAQ6C,OAAOxH,CAAAA,CAChB,CACD,IAAMyH,EAASxG,KAAKyG,eAAAA,EAOpB,OAHID,GAAU,MAAVA,MACIA,EAAAA,CAEAxG,KAAKqD,eACd,CAmBS,gBAAAoD,CAiBR,OAhBezG,KAAK0G,cAAAA,CAiBrB,CAYS,eAAAA,SAIR,GAAA,CAAK1G,KAAKqD,gBACR,OAGF,GAAA,CAAKrD,KAAKsD,WAAY,CA2BpB,IAxBCtD,EAAAA,KAA4CoE,aAA5CpE,YAA4CoE,WAC3CpE,KAAK0E,iBAAAA,GAuBH1E,KAAKoD,KAAsB,CAG7B,OAAK,CAAOlB,EAAG5D,CAAAA,IAAU0B,KAAKoD,KAC5BpD,KAAKkC,CAAAA,EAAmB5D,EAE1B0B,KAAKoD,KAAAA,MACN,CAUD,IAAMrC,EAAqBf,KAAKkD,YAC7BnC,kBACH,GAAIA,EAAkB0D,KAAO,EAC3B,OAAK,CAAOvC,EAAGzB,CAAAA,IAAYM,EAAmB,CAC5C,GAAA,CAAMD,QAACA,CAAAA,EAAWL,EACZnC,EAAQ0B,KAAKkC,CAAAA,EAEjBpB,IAFiBoB,IAGhBlC,KAAK6D,KAAoBwC,IAAInE,CAAAA,GAC9B5D,IAD8B4D,QAG9BlC,KAAKkG,EAAiBhE,EAAAA,OAAczB,EAASnC,CAAAA,CAEhD,CAEJ,CACD,IAAIqI,EAAAA,GACEC,EAAoB5G,KAAK6D,KAC/B,GAAA,CACE8C,EAAe3G,KAAK2G,aAAaC,CAAAA,EAC7BD,GACF3G,KAAK6G,WAAWD,CAAAA,GAChB5G,EAAAA,KAAKkE,OAALlE,MAAAA,EAAoB+D,QAASiB,GAAAA,OAAMA,OAAAA,EAAAA,EAAE8B,aAAF9B,YAAAA,EAAAA,KAAAA,KACnChF,KAAK+G,OAAOH,CAAAA,GAEZ5G,KAAKgH,KAAAA,CAER,OAAQjI,EAAAA,CAMP,MAHA4H,EAAAA,GAEA3G,KAAKgH,KAAAA,EACCjI,CACP,CAEG4H,GACF3G,KAAKiH,KAAYL,CAAAA,CAEpB,CAuBS,WAAWM,EAAAA,CAA4C,CAIjE,KAAYN,EAAAA,QACV5G,EAAAA,KAAKkE,OAALlE,MAAAA,EAAoB+D,QAASiB,GAAAA,OAAMA,OAAAA,EAAAA,EAAEmC,cAAFnC,YAAAA,EAAAA,KAAAA,KAC9BhF,KAAKsD,aACRtD,KAAKsD,WAAAA,GACLtD,KAAKoH,aAAaR,CAAAA,GAEpB5G,KAAKqH,QAAQT,CAAAA,CAiBd,CAEO,MAAAI,CACNhH,KAAK6D,KAAsB,IAAIhC,IAC/B7B,KAAKqD,gBAAAA,EACN,CAkBD,IAAA,gBAAIiE,CACF,OAAOtH,KAAKuH,kBAAAA,CACb,CAyBS,mBAAAA,CACR,OAAOvH,KAAKyD,IACb,CAUS,aAAayD,EAAAA,CACrB,MAAA,EACD,CAWS,OAAOA,EAAAA,CAIflH,KAAKsG,OAALtG,KAAKsG,KAA2BtG,KAAKsG,KAAuBvC,QAAS7B,GACnElC,KAAKwH,KAAsBtF,EAAGlC,KAAKkC,CAAAA,CAAAA,CAAAA,GAErClC,KAAKgH,KAAAA,CACN,CAYS,QAAQE,EAAAA,CAAsC,CAkB9C,aAAaA,EAAAA,CAAsC,CAAA,KAniCtDrH,GAAayC,cAA6B,CAAA,EAiT1CzC,GAAAgF,kBAAoC,CAAC4C,KAAM,MAAA,EAuvBnD5H,GACC3B,GAA0B,mBAAA,CAAA,EACxB,IAAI2D,IACPhC,GACC3B,GAA0B,WAAA,CAAA,EACxB,IAAI2D,IAGR7D,IAAAA,MAAAA,GAAkB,CAAC6B,gBAAAA,EAAAA,KAuClBlC,GAAAA,GAAO+J,0BAAP/J,KAAAA,GAAAA,GAAO+J,wBAA4B,CAAA,GAAIvH,KAAK,OAAA,ECtrD7C,IAAMwH,GAASC,WA4OTC,GAAgBF,GAAyCE,aAUzDC,GAASD,GACXA,GAAaE,aAAa,WAAY,CACpCC,WAAaC,GAAMA,CAAAA,CAAAA,EAAAA,OA8EnBC,GAAuB,QAMvBC,GAAS,OAAOC,KAAKC,OAAAA,EAASC,QAAQ,CAAA,EAAGC,MAAM,CAAA,CAAA,IAG/CC,GAAc,IAAML,GAIpBM,GAAa,IAAID,EAAAA,IAEjBE,GAOAC,SAGAC,GAAe,IAAMF,GAAEG,cAAc,EAAA,EAIrCC,GAAeC,GACnBA,IAAU,MAAyB,OAATA,GAAS,UAA4B,OAATA,GAAS,WAC3DC,GAAUC,MAAMD,QAChBE,GAAcH,GAClBC,GAAQD,CAAAA,GAEqC,OAArCA,iBAAgBI,OAAOC,YAAc,WAEzCC,GAAa;OAkBbC,GAAe,sDAKfC,GAAkB,OAIlBC,GAAmB,KAwBnBC,GAAkBC,OACtB,KAAKL,EAAAA,qBAAgCA,EAAAA,KAAeA,EAAAA;0BACpD,GAAA,EAOIM,GAA0B,KAC1BC,GAA0B,KAO1BC,GAAiB,qCAyGjBC,GACmBC,GACvB,CAACC,KAAkCC,KAwB1B,CAELC,WAAgBH,EAChBC,QAAAA,EACAC,OAAAA,CAAAA,GAiBOE,EAAOL,GArJA,CAAA,EA+KPM,GAAMN,GA9KA,CAAA,EAwMNO,GAASP,GAvMA,CAAA,EA6MTQ,GAAWnB,OAAOoB,IAAI,cAAA,EAqBtBC,EAAUrB,OAAOoB,IAAI,aAAA,EAS5BE,GAAgB,IAAIC,QAqCpBC,GAASjC,GAAEkC,iBACflC,GACA,GAAA,EAqBF,SAASmC,GACPC,EACAC,EAAAA,CAOA,GAAA,CAAK/B,GAAQ8B,CAAAA,GAAAA,CAASA,EAAIE,eAAe,KAAA,EAiBvC,MAAUC,MAhBI,gCAAA,EAkBhB,OAAOnD,KAAP,OACIA,GAAOE,WAAW+C,CAAAA,EACjBA,CACP,CAcA,IAAMG,GAAkB,CACtBlB,EACAD,IAAAA,CAQA,IAAMoB,EAAInB,EAAQoB,OAAS,EAIrBC,EAA2B,CAAA,EAO7BC,EANAnB,EACFJ,IArWe,EAqWO,QAAUA,IApWd,EAoWuC,SAAW,GASlEwB,EAAQjC,GAEZ,QAASkC,EAAI,EAAGA,EAAIL,EAAGK,IAAK,CAC1B,IAAMvD,EAAI+B,EAAQwB,CAAAA,EAOdC,EAEAC,EAHAC,EAAAA,GAEAC,EAAY,EAKhB,KAAOA,EAAY3D,EAAEmD,SAEnBG,EAAMK,UAAYA,EAClBF,EAAQH,EAAMM,KAAK5D,CAAAA,EACfyD,IAAU,OAGdE,EAAYL,EAAMK,UACdL,IAAUjC,GACRoC,EA5bU,CAAA,IA4be,MAC3BH,EAAQhC,GACCmC,EA9bG,CAAA,IA6bJnC,OAGRgC,EAAQ/B,GACCkC,EAhcF,CAAA,IA+bClC,QAEJK,GAAeiC,KAAKJ,EAjcjB,CAAA,CAAA,IAocLJ,EAAsB5B,OAAO,KAAKgC,EApc7B,CAAA,EAocgD,GAAA,GAEvDH,EAAQ9B,IACCiC,EAtcM,CAAA,IAqcPjC,SAQR8B,EAAQ9B,IAED8B,IAAU9B,GACfiC,EA9aS,CAAA,IA8ae,KAG1BH,EAAQD,GAAAA,KAAAA,EAAmBhC,GAG3BqC,EAAAA,IACSD,EApbI,CAAA,IAmbO,OAGpBC,EAAAA,IAEAA,EAAmBJ,EAAMK,UAAYF,EAvbrB,CAAA,EAub8CN,OAC9DK,EAAWC,EAzbE,CAAA,EA0bbH,EACEG,EAzbO,CAAA,IAwbTH,OAEM9B,GACAiC,EA3bG,CAAA,IA2bmB,IACpB9B,GACAD,IAGV4B,IAAU3B,IACV2B,IAAU5B,GAEV4B,EAAQ9B,GACC8B,IAAUhC,IAAmBgC,IAAU/B,GAChD+B,EAAQjC,IAIRiC,EAAQ9B,GACR6B,EAAAA,QA8BJ,IAAMS,EACJR,IAAU9B,IAAeO,EAAQwB,EAAI,CAAA,EAAGQ,WAAW,IAAA,EAAQ,IAAM,GACnE7B,GACEoB,IAAUjC,GACNrB,EAAIQ,GACJkD,GAAoB,GACjBN,EAAUY,KAAKR,CAAAA,EAChBxD,EAAEM,MAAM,EAAGoD,CAAAA,EACTzD,GACAD,EAAEM,MAAMoD,CAAAA,EACVxD,GACA4D,GACA9D,EAAIE,IAAUwD,IAAVxD,GAAoCqD,EAAIO,EACrD,CAQD,MAAO,CAAClB,GAAwBb,EAL9BG,GACCH,EAAQmB,CAAAA,GAAM,QACdpB,IA5ec,EA4eQ,SAAWA,IA3ehB,EA2eyC,UAAY,GAAA,EAGnBsB,CAAAA,CAAU,EAK5Da,GAAN,MAAMA,CAAAA,CAMJ,YAAAC,CAEEnC,QAACA,EAASE,WAAgBH,CAAAA,EAC1BqC,EAAAA,CAEA,IAAIC,EAPNC,KAAKC,MAAwB,CAAA,EAQ3B,IAAIC,EAAY,EACZC,EAAgB,EACdC,EAAY1C,EAAQoB,OAAS,EAC7BmB,EAAQD,KAAKC,MAAAA,CAGZpC,EAAMkB,CAAAA,EAAaH,GAAgBlB,EAASD,CAAAA,EAKnD,GAJAuC,KAAKK,GAAKT,EAASU,cAAczC,EAAMiC,CAAAA,EACvCzB,GAAOkC,YAAcP,KAAKK,GAAGG,QAGzB/C,IA3gBW,GA2gBYA,IA1gBT,EA0gBiC,CACjD,IAAMgD,EAAUT,KAAKK,GAAGG,QAAQE,WAChCD,EAAQE,YAAAA,GAAeF,EAAQG,UAAAA,CAChC,CAGD,MAAQb,EAAO1B,GAAOwC,SAAAA,KAAgB,MAAQZ,EAAMnB,OAASsB,GAAW,CACtE,GAAIL,EAAKe,WAAa,EAAG,CAuBvB,GAAKf,EAAiBgB,cAAAA,EACpB,QAAWC,KAASjB,EAAiBkB,kBAAAA,EACnC,GAAID,EAAKE,SAAStF,EAAAA,EAAuB,CACvC,IAAMuF,EAAWpC,EAAUoB,GAAAA,EAErBiB,EADSrB,EAAiBsB,aAAaL,CAAAA,EACvBM,MAAMzF,EAAAA,EACtB0F,EAAI,eAAehC,KAAK4B,CAAAA,EAC9BlB,EAAMN,KAAK,CACTlC,KA1iBO,EA2iBP+D,MAAOtB,EACPc,KAAMO,EAAE,CAAA,EACR7D,QAAS0D,EACTK,KACEF,EAAE,CAAA,IAAO,IACLG,GACAH,EAAE,CAAA,IAAO,IACPI,GACAJ,EAAE,CAAA,IAAO,IACPK,GACAC,EAAAA,CAAAA,EAEX9B,EAAiB+B,gBAAgBd,CAAAA,CACnC,MAAUA,EAAKtB,WAAW7D,EAAAA,IACzBoE,EAAMN,KAAK,CACTlC,KArjBK,EAsjBL+D,MAAOtB,CAAAA,CAAAA,EAERH,EAAiB+B,gBAAgBd,CAAAA,GAMxC,GAAIzD,GAAeiC,KAAMO,EAAiBgC,OAAAA,EAAU,CAIlD,IAAMrE,EAAWqC,EAAiBiC,YAAaV,MAAMzF,EAAAA,EAC/CyD,EAAY5B,EAAQoB,OAAS,EACnC,GAAIQ,EAAY,EAAG,CAChBS,EAAiBiC,YAAczG,GAC3BA,GAAa0G,YACd,GAGJ,QAAS/C,EAAI,EAAGA,EAAII,EAAWJ,IAC5Ba,EAAiBmC,OAAOxE,EAAQwB,CAAAA,EAAI5C,GAAAA,CAAAA,EAErC+B,GAAOwC,SAAAA,EACPZ,EAAMN,KAAK,CAAClC,KAllBP,EAklByB+D,MAAAA,EAAStB,CAAAA,CAAAA,EAKxCH,EAAiBmC,OAAOxE,EAAQ4B,CAAAA,EAAYhD,GAAAA,CAAAA,CAC9C,CACF,CACF,SAAUyD,EAAKe,WAAa,EAE3B,GADcf,EAAiBoC,OAClBjG,GACX+D,EAAMN,KAAK,CAAClC,KA7lBH,EA6lBqB+D,MAAOtB,CAAAA,CAAAA,MAChC,CACL,IAAIhB,EAAAA,GACJ,MAAQA,EAAKa,EAAiBoC,KAAKC,QAAQvG,GAAQqD,EAAI,CAAA,KAAvD,IAGEe,EAAMN,KAAK,CAAClC,KA9lBH,EA8lBuB+D,MAAOtB,CAAAA,CAAAA,EAEvChB,GAAKrD,GAAOiD,OAAS,CAExB,CAEHoB,GACD,CAkCF,CAID,OAAA,cAAqBrC,EAAmBwE,EAAAA,CACtC,IAAMhC,EAAKjE,GAAEkE,cAAc,UAAA,EAE3B,OADAD,EAAGiC,UAAYzE,EACRwC,CACR,CAAA,EAgBH,SAASkC,GACPC,EACA/F,EACAgG,EAA0BD,EAC1BE,EAAAA,WAIA,GAAIjG,IAAUuB,GACZ,OAAOvB,EAET,IAAIkG,EACFD,IADEC,QAEGF,EAAAA,EAAyBG,OAAzBH,YAAAA,EAAwCC,GACxCD,EAA+CI,KAChDC,EAA2BtG,GAAYC,CAAAA,EAAAA,OAGxCA,EAA2C,gBAyBhD,OAxBIkG,GAAAA,YAAAA,EAAkB9C,eAAgBiD,KAEpCH,EAAAA,GAAAA,YAAAA,EAAuD,OAAvDA,MAAAA,EAAAA,KAAAA,EAAuD,IACnDG,IADuD,OAEzDH,EAAAA,QAEAA,EAAmB,IAAIG,EAAyBN,CAAAA,EAChDG,EAAiBI,KAAaP,EAAMC,EAAQC,CAAAA,GAE1CA,IAF0CA,SAG1CD,EAAAA,EAAyBG,OAAzBH,KAAAA,EAAAA,EAAyBG,KAAiB,CAAA,GAAIF,CAAAA,EAC9CC,EAEDF,EAAiCI,KAAcF,GAGhDA,IAHgDA,SAIlDlG,EAAQ8F,GACNC,EACAG,EAAiBK,KAAUR,EAAO/F,EAA0BkB,MAAAA,EAC5DgF,EACAD,CAAAA,GAGGjG,CACT,CAOA,IAAMwG,GAAN,KAAMA,CASJ,YAAYC,EAAoBT,EAAAA,CAPhCzC,KAAOmD,KAA4B,CAAA,EAKnCnD,KAAwBoD,KAAAA,OAGtBpD,KAAKqD,KAAaH,EAClBlD,KAAKsD,KAAWb,CACjB,CAGD,IAAA,YAAIc,CACF,OAAOvD,KAAKsD,KAASC,UACtB,CAGD,IAAA,MAAIC,CACF,OAAOxD,KAAKsD,KAASE,IACtB,CAID,EAAO1D,EAAAA,OACL,GAAA,CACEO,GAAAA,CAAIG,QAACA,CAAAA,EACLP,MAAOA,CAAAA,EACLD,KAAKqD,KACHI,IAAY3D,EAAAA,GAAAA,YAAAA,EAAS4D,gBAAT5D,KAAAA,EAA0B1D,IAAGuH,WAAWnD,EAAAA,EAAS,EACnEnC,GAAOkC,YAAckD,EAErB,IAAI1D,EAAO1B,GAAOwC,SAAAA,EACdX,EAAY,EACZ0D,EAAY,EACZC,EAAe5D,EAAM,CAAA,EAEzB,KAAO4D,IAAP,QAAmC,CACjC,GAAI3D,IAAc2D,EAAarC,MAAO,CACpC,IAAIgB,EACAqB,EAAapG,OAjwBN,EAkwBT+E,EAAO,IAAIsB,GACT/D,EACAA,EAAKgE,YACL/D,KACAF,CAAAA,EAEO+D,EAAapG,OAzwBT,EA0wBb+E,EAAO,IAAIqB,EAAapC,KACtB1B,EACA8D,EAAa7C,KACb6C,EAAanG,QACbsC,KACAF,CAAAA,EAEO+D,EAAapG,OA5wBX,IA6wBX+E,EAAO,IAAIwB,GAAYjE,EAAqBC,KAAMF,CAAAA,GAEpDE,KAAKmD,KAAQxD,KAAK6C,CAAAA,EAClBqB,EAAe5D,EAAAA,EAAQ2D,CAAAA,CACxB,CACG1D,KAAc2D,GAAAA,YAAAA,EAAcrC,SAC9BzB,EAAO1B,GAAOwC,SAAAA,EACdX,IAEH,CAKD,OADA7B,GAAOkC,YAAcnE,GACdqH,CACR,CAED,EAAQ9F,EAAAA,CACN,IAAIuB,EAAI,EACR,QAAWsD,KAAQxC,KAAKmD,KAClBX,IADkBW,SAWfX,EAAuB9E,UAV1B8E,QAWCA,EAAuByB,KAAWtG,EAAQ6E,EAAuBtD,CAAAA,EAIlEA,GAAMsD,EAAuB9E,QAASoB,OAAS,GAE/C0D,EAAKyB,KAAWtG,EAAOuB,CAAAA,CAAAA,GAG3BA,GAEH,CAAA,EA8CG4E,GAAN,MAAMA,CAAAA,CAwBJ,IAAA,MAAIN,SAIF,OAAOxD,GAAAA,EAAAA,KAAKsD,OAALtD,YAAAA,EAAewD,OAAfxD,KAAAA,EAAgCA,KAAKkE,IAC7C,CAeD,YACEC,EACAC,EACA3B,EACA3C,EAAAA,OA/COE,KAAIvC,KA12BI,EA42BjBuC,KAAgBqE,KAAYnG,EA+B5B8B,KAAwBoD,KAAAA,OAgBtBpD,KAAKsE,KAAcH,EACnBnE,KAAKuE,KAAYH,EACjBpE,KAAKsD,KAAWb,EAChBzC,KAAKF,QAAUA,EAIfE,KAAKkE,MAAgBpE,EAAAA,GAAAA,YAAAA,EAAS0E,cAAT1E,KAAAA,EAAS0E,EAK/B,CAoBD,IAAA,YAAIjB,CACF,IAAIA,EAAwBvD,KAAKsE,KAAaf,WACxCd,EAASzC,KAAKsD,KAUpB,OAREb,IAQF,SAPEc,GAAAA,YAAAA,EAAYzC,YAAa,KAKzByC,EAAcd,EAAwCc,YAEjDA,CACR,CAMD,IAAA,WAAIY,CACF,OAAOnE,KAAKsE,IACb,CAMD,IAAA,SAAIF,CACF,OAAOpE,KAAKuE,IACb,CAED,KAAW9H,EAAgBgI,EAAmCzE,KAAAA,CAM5DvD,EAAQ8F,GAAiBvC,KAAMvD,EAAOgI,CAAAA,EAClCjI,GAAYC,CAAAA,EAIVA,IAAUyB,GAAWzB,GAAS,MAAQA,IAAU,IAC9CuD,KAAKqE,OAAqBnG,GAS5B8B,KAAK0E,KAAAA,EAEP1E,KAAKqE,KAAmBnG,GACfzB,IAAUuD,KAAKqE,MAAoB5H,IAAUuB,IACtDgC,KAAK2E,EAAYlI,CAAAA,EAGTA,EAAqC,aAH5BA,OAInBuD,KAAK4E,EAAsBnI,CAAAA,EACjBA,EAAeqE,WADErE,OAiB3BuD,KAAK6E,EAAYpI,CAAAA,EACRG,GAAWH,CAAAA,EACpBuD,KAAK8E,EAAgBrI,CAAAA,EAGrBuD,KAAK2E,EAAYlI,CAAAA,CAEpB,CAEO,EAAwBsD,EAAAA,CAC9B,OAAiBC,KAAKsE,KAAaf,WAAawB,aAC9ChF,EACAC,KAAKuE,IAAAA,CAER,CAEO,EAAY9H,EAAAA,CACduD,KAAKqE,OAAqB5H,IAC5BuD,KAAK0E,KAAAA,EAoCL1E,KAAKqE,KAAmBrE,KAAKgF,EAAQvI,CAAAA,EAExC,CAEO,EAAYA,EAAAA,CAKhBuD,KAAKqE,OAAqBnG,GAC1B1B,GAAYwD,KAAKqE,IAAAA,EAECrE,KAAKsE,KAAaP,YAcrB5B,KAAO1F,EAsBpBuD,KAAK6E,EAAYzI,GAAE6I,eAAexI,CAAAA,CAAAA,EAUtCuD,KAAKqE,KAAmB5H,CACzB,CAEO,EACNyI,EAAAA,OAGA,GAAA,CAAMvH,OAACA,EAAQC,WAAgBH,CAAAA,EAAQyH,EAKjChC,EACY,OAATzF,GAAS,SACZuC,KAAKmF,KAAcD,CAAAA,GAClBzH,EAAK4C,KADa6E,SAEhBzH,EAAK4C,GAAKT,GAASU,cAClB/B,GAAwBd,EAAK2H,EAAG3H,EAAK2H,EAAE,CAAA,CAAA,EACvCpF,KAAKF,OAAAA,GAETrC,GAEN,KAAKuC,EAAAA,KAAKqE,OAALrE,YAAAA,EAA4CqD,QAAeH,EAU7DlD,KAAKqE,KAAsCgB,EAAQ1H,CAAAA,MAC/C,CACL,IAAM2H,EAAW,IAAIrC,GAAiBC,EAAsBlD,IAAAA,EACtDyD,EAAW6B,EAASC,EAAOvF,KAAKF,OAAAA,EAWtCwF,EAASD,EAAQ1H,CAAAA,EAWjBqC,KAAK6E,EAAYpB,CAAAA,EACjBzD,KAAKqE,KAAmBiB,CACzB,CACF,CAID,KAAcJ,EAAAA,CACZ,IAAIhC,EAAW/E,GAAcqH,IAAIN,EAAOxH,OAAAA,EAIxC,OAHIwF,IAGJ,QAFE/E,GAAcsH,IAAIP,EAAOxH,QAAUwF,EAAW,IAAItD,GAASsF,CAAAA,CAAAA,EAEtDhC,CACR,CAEO,EAAgBzG,EAAAA,CAWjBC,GAAQsD,KAAKqE,IAAAA,IAChBrE,KAAKqE,KAAmB,CAAA,EACxBrE,KAAK0E,KAAAA,GAKP,IAAMgB,EAAY1F,KAAKqE,KAEnBsB,EADA/B,EAAY,EAGhB,QAAWgC,KAAQnJ,EACbmH,IAAc8B,EAAU5G,OAK1B4G,EAAU/F,KACPgG,EAAW,IAAI7B,EACd9D,KAAKgF,EAAQ1I,GAAAA,CAAAA,EACb0D,KAAKgF,EAAQ1I,GAAAA,CAAAA,EACb0D,KACAA,KAAKF,OAAAA,CAAAA,EAKT6F,EAAWD,EAAU9B,CAAAA,EAEvB+B,EAAS1B,KAAW2B,CAAAA,EACpBhC,IAGEA,EAAY8B,EAAU5G,SAExBkB,KAAK0E,KACHiB,GAAiBA,EAASpB,KAAYR,YACtCH,CAAAA,EAGF8B,EAAU5G,OAAS8E,EAEtB,CAaD,KACEiC,EAA+B7F,KAAKsE,KAAaP,YACjD+B,EAAAA,OAGA,KADA9F,EAAAA,KAAK+F,OAAL/F,YAAAA,EAAAA,UAAK+F,GAA4B,GAAaD,GACvCD,IAAU7F,KAAKuE,MAAW,CAI/B,IAAMyB,EAASH,EAAQ9B,YAClB8B,EAAQI,OAAAA,EACbJ,EAAQG,CACT,CACF,CASD,aAAaxB,EAAAA,OACPxE,KAAKsD,OADEkB,SAETxE,KAAKkE,KAAgBM,GACrBxE,EAAAA,KAAK+F,OAAL/F,MAAAA,EAAAA,UAAiCwE,GAOpC,CAAA,EA2BG3C,GAAN,KAAMA,CA2BJ,IAAA,SAAIE,CACF,OAAO/B,KAAKkG,QAAQnE,OACrB,CAGD,IAAA,MAAIyB,CACF,OAAOxD,KAAKsD,KAASE,IACtB,CAED,YACE0C,EACAlF,EACAtD,EACA+E,EACA3C,EAAAA,CAxCOE,KAAIvC,KA/zCQ,EA+0CrBuC,KAAgBqE,KAA6BnG,EAM7C8B,KAAwBoD,KAAAA,OAoBtBpD,KAAKkG,QAAUA,EACflG,KAAKgB,KAAOA,EACZhB,KAAKsD,KAAWb,EAChBzC,KAAKF,QAAUA,EACXpC,EAAQoB,OAAS,GAAKpB,EAAQ,CAAA,IAAO,IAAMA,EAAQ,CAAA,IAAO,IAC5DsC,KAAKqE,KAAuB1H,MAAMe,EAAQoB,OAAS,CAAA,EAAGqH,KAAK,IAAIC,MAAAA,EAC/DpG,KAAKtC,QAAUA,GAEfsC,KAAKqE,KAAmBnG,CAK3B,CAwBD,KACEzB,EACAgI,EAAmCzE,KACnCqG,EACAC,EAAAA,CAEA,IAAM5I,EAAUsC,KAAKtC,QAGjB6I,EAAAA,GAEJ,GAAI7I,IAAJ,OAEEjB,EAAQ8F,GAAiBvC,KAAMvD,EAAOgI,EAAiB,CAAA,EACvD8B,EAAAA,CACG/J,GAAYC,CAAAA,GACZA,IAAUuD,KAAKqE,MAAoB5H,IAAUuB,GAC5CuI,IACFvG,KAAKqE,KAAmB5H,OAErB,CAEL,IAAMkB,EAASlB,EAGXyC,EAAGsH,EACP,IAHA/J,EAAQiB,EAAQ,CAAA,EAGXwB,EAAI,EAAGA,EAAIxB,EAAQoB,OAAS,EAAGI,IAClCsH,EAAIjE,GAAiBvC,KAAMrC,EAAO0I,EAAcnH,CAAAA,EAAIuF,EAAiBvF,CAAAA,EAEjEsH,IAAMxI,KAERwI,EAAKxG,KAAKqE,KAAoCnF,CAAAA,GAEhDqH,MAAAA,CACG/J,GAAYgK,CAAAA,GAAMA,IAAOxG,KAAKqE,KAAoCnF,CAAAA,GACjEsH,IAAMtI,EACRzB,EAAQyB,EACCzB,IAAUyB,IACnBzB,IAAU+J,GAAAA,KAAAA,EAAK,IAAM9I,EAAQwB,EAAI,CAAA,GAIlCc,KAAKqE,KAAoCnF,CAAAA,EAAKsH,CAElD,CACGD,GAAAA,CAAWD,GACbtG,KAAKyG,EAAahK,CAAAA,CAErB,CAGD,EAAaA,EAAAA,CACPA,IAAUyB,EACN8B,KAAKkG,QAAqBpE,gBAAgB9B,KAAKgB,IAAAA,EAoB/ChB,KAAKkG,QAAqBQ,aAC9B1G,KAAKgB,KACJvE,GAAAA,KAAAA,EAAS,EAAA,CAGf,CAAA,EAIGiF,GAAN,cAA2BG,EAAAA,CAA3B,aAAAhC,CAAAA,MAAAA,GAAAA,SAAAA,EACoBG,KAAIvC,KA/9CF,CAw/CrB,CAtBU,EAAahB,EAAAA,CAoBnBuD,KAAKkG,QAAgBlG,KAAKgB,IAAAA,EAAQvE,IAAUyB,EAAAA,OAAsBzB,CACpE,CAAA,EAIGkF,GAAN,cAAmCE,EAAAA,CAAnC,aAAAhC,CAAAA,MAAAA,GAAAA,SAAAA,EACoBG,KAAIvC,KA3/CO,CA4gD9B,CAdU,EAAahB,EAAAA,CASduD,KAAKkG,QAAqBS,gBAC9B3G,KAAKgB,KAAAA,CAAAA,CACHvE,GAASA,IAAUyB,CAAAA,CAExB,CAAA,EAkBG0D,GAAN,cAAwBC,EAAAA,CAGtB,YACEqE,EACAlF,EACAtD,EACA+E,EACA3C,EAAAA,CAEA8G,MAAMV,EAASlF,EAAMtD,EAAS+E,EAAQ3C,CAAAA,EATtBE,KAAIvC,KA7hDL,CA+iDhB,CAKQ,KACPoJ,EACApC,EAAmCzE,KAAAA,OAInC,IAFA6G,GACEtE,EAAAA,GAAiBvC,KAAM6G,EAAapC,EAAiB,CAAA,IAArDlC,KAAAA,EAA2DrE,KACzCF,GAClB,OAEF,IAAM8I,EAAc9G,KAAKqE,KAInB0C,EACHF,IAAgB3I,GAAW4I,IAAgB5I,GAC3C2I,EAAyCG,UACvCF,EAAyCE,SAC3CH,EAAyCI,OACvCH,EAAyCG,MAC3CJ,EAAyCK,UACvCJ,EAAyCI,QAIxCC,EACJN,IAAgB3I,IACf4I,IAAgB5I,GAAW6I,GAa1BA,GACF/G,KAAKkG,QAAQkB,oBACXpH,KAAKgB,KACLhB,KACA8G,CAAAA,EAGAK,GACFnH,KAAKkG,QAAQmB,iBACXrH,KAAKgB,KACLhB,KACA6G,CAAAA,EAGJ7G,KAAKqE,KAAmBwC,CACzB,CAED,YAAYS,EAAAA,SAC2B,OAA1BtH,KAAKqE,MAAqB,WACnCrE,KAAKqE,KAAiBkD,MAAKvH,GAAAA,EAAAA,KAAKF,UAALE,YAAAA,EAAcwH,OAAdxH,KAAAA,EAAsBA,KAAKkG,QAASoB,CAAAA,EAE9DtH,KAAKqE,KAAyCoD,YAAYH,CAAAA,CAE9D,CAAA,EAIGtD,GAAN,KAAMA,CAiBJ,YACSkC,EACPzD,EACA3C,EAAAA,CAFOE,KAAOkG,QAAPA,EAjBAlG,KAAIvC,KAtnDM,EAkoDnBuC,KAAwBoD,KAAAA,OAStBpD,KAAKsD,KAAWb,EAChBzC,KAAKF,QAAUA,CAChB,CAGD,IAAA,MAAI0D,CACF,OAAOxD,KAAKsD,KAASE,IACtB,CAED,KAAW/G,EAAAA,CAQT8F,GAAiBvC,KAAMvD,CAAAA,CACxB,CAAA,EAqBUiL,GAAO,CAElBC,EAAuB/L,GACvBgM,EAAS/L,GACTgM,EAAc3L,GACd4L,EApsDkB,EAqsDlBC,EAAkBnJ,GAElBoJ,EAAmB/E,GACnBgF,EAAarL,GACbsL,EAAmB3F,GACnB4F,EAAYrE,GACZsE,EAAgBvG,GAChBwG,EAAuB1G,GACvB2G,EAAY1G,GACZ2G,EAAe7G,GACf8G,EAAcxE,EAAAA,EAIVyE,GAEFpN,GAAOqN,0BACXD,IAAAA,MAAAA,GAAkB7I,GAAUkE,MAI3BzI,GAAAA,GAAOsN,kBAAPtN,KAAAA,GAAAA,GAAOsN,gBAAoB,CAAA,GAAIhJ,KAAK,OAAA,EAoCxB,IAAAiJ,GAAS,CACpBnM,EACAoM,EACA/I,IAAAA,SAUA,IAAMgJ,GAAgBhJ,EAAAA,GAAAA,YAAAA,EAASiJ,eAATjJ,KAAAA,EAAyB+I,EAG3CrG,EAAmBsG,EAAkC,WAUzD,GAAItG,IAAJ,OAAwB,CACtB,IAAM4B,GAAUtE,EAAAA,GAAAA,YAAAA,EAASiJ,eAATjJ,KAAAA,EAAyB,KAGxCgJ,EAAkC,WAAItG,EAAO,IAAIsB,GAChD+E,EAAU9D,aAAazI,GAAAA,EAAgB8H,CAAAA,EACvCA,EAAAA,OAEAtE,GAAAA,KAAAA,EAAW,CAAE,CAAA,CAEhB,CAWD,OAVA0C,EAAKyB,KAAWxH,CAAAA,EAUT+F,CAAgB,ECxpEzB,IAOMwG,GAASC,WAmCFC,EAAP,cAA0BC,EAAAA,CAAhC,aAAAC,CAAAA,MAAAA,GAAAA,SAAAA,EAOWC,KAAAC,cAA+B,CAACC,KAAMF,IAAAA,EAEvCA,KAAWG,KAAAA,MA8FpB,CAzFoB,kBAAAC,SACjB,IAAMC,EAAaC,MAAMF,iBAAAA,EAOzB,OADAJ,GAAAA,EAAAA,KAAKC,eAAcM,eAAnBP,OAAAA,EAAmBO,aAAiBF,EAAYG,YACzCH,CACR,CASkB,OAAOI,EAAAA,CAIxB,IAAMC,EAAQV,KAAKW,OAAAA,EACdX,KAAKY,aACRZ,KAAKC,cAAcY,YAAcb,KAAKa,aAExCP,MAAMQ,OAAOL,CAAAA,EACbT,KAAKG,KAAcQ,GAAOD,EAAOV,KAAKK,WAAYL,KAAKC,aAAAA,CACxD,CAsBQ,mBAAAc,OACPT,MAAMS,kBAAAA,GACNf,EAAAA,KAAKG,OAALH,MAAAA,EAAkBgB,aAAAA,GACnB,CAqBQ,sBAAAC,OACPX,MAAMW,qBAAAA,GACNjB,EAAAA,KAAKG,OAALH,MAAAA,EAAkBgB,aAAAA,GACnB,CASS,QAAAL,CACR,OAAOO,EACR,CAAA,KApGMrB,EAAgB,cAAA,GA8GxBA,EAC2B,UAAA,IAI5BF,GAAAA,GAAOwB,2BAAPxB,MAAAA,GAAAA,KAAAA,GAAkC,CAACE,WAAAA,CAAAA,GAGnC,IAAMuB,GAEFzB,GAAO0B,0BACXD,IAAAA,MAAAA,GAAkB,CAACvB,WAAAA,CAAAA,YAmClByB,GAAAA,GAAOC,qBAAPD,KAAAA,GAAAA,GAAOC,mBAAuB,CAAA,GAAIC,KAAK,OAAA,EC/RxC,IAAIC,EAAE,UAAU,CAAC,QAAQ,EAAE,CAAC,EAAEC,EAAE,UAAU,OAAOA,KAAK,EAAEA,CAAC,EAAE,UAAUA,CAAC,EAAE,OAAO,EAAE,OAAO,SAASC,EAAED,EAAE,CAAC,OAAOC,EAAE,OAAiB,OAAOD,GAAjB,SAAmBA,EAAE,MAAM,QAAQA,CAAC,EAAED,EAAE,MAAM,OAAOC,CAAC,EAAY,OAAOA,GAAjB,UAAoBA,EAAE,OAAO,KAAKA,CAAC,EAAE,IAAI,SAASD,EAAE,CAAC,OAAOC,EAAED,CAAC,EAAEA,EAAE,EAAE,CAAC,EAAE,EAAE,CAAC,EAAE,CAAC,CAAC,EAAE,KAAK,GAAG,CAAC,ECwExQ,IAoBMG,GAAkD,CACtDC,UAAAA,GACAC,KAAMC,OACNC,UAAWC,GACXC,QAAAA,GACAC,WAAYC,EAAAA,EAaDC,GAAmB,CAC9BC,EAA+BV,GAC/BW,EACAC,IAAAA,CAEA,GAAA,CAAMC,KAACA,EAAIC,SAAEA,CAAAA,EAAYF,EAarBG,EAAaC,WAAWC,oBAAoBC,IAAIJ,CAAAA,EAUpD,GATIC,IASJ,QAREC,WAAWC,oBAAoBE,IAAIL,EAAWC,EAAa,IAAIK,GAAAA,EAE7DP,IAAS,YACXH,EAAUW,OAAOC,OAAOZ,CAAAA,GAChBa,QAAAA,IAEVR,EAAWI,IAAIP,EAAQY,KAAMd,CAAAA,EAEzBG,IAAS,WAAY,CAIvB,GAAA,CAAMW,KAACA,CAAAA,EAAQZ,EACf,MAAO,CACL,IAA2Ba,EAAAA,CACzB,IAAMC,EACJf,EACAO,IAAIS,KAAKC,IAAAA,EACVjB,EAA8CQ,IAAIQ,KACjDC,KACAH,CAAAA,EAEFG,KAAKC,cAAcL,EAAME,EAAUhB,CAAAA,CACpC,EACD,KAA4Be,EAAAA,CAI1B,OAHIA,IAGJ,QAFEG,KAAKE,EAAiBN,EAAAA,OAAiBd,EAASe,CAAAA,EAE3CA,CACR,CAAA,CAEJ,CAAM,GAAIZ,IAAS,SAAU,CAC5B,GAAA,CAAMW,KAACA,CAAAA,EAAQZ,EACf,OAAO,SAAiCmB,EAAAA,CACtC,IAAML,EAAWE,KAAKJ,CAAAA,EACrBb,EAA8BgB,KAAKC,KAAMG,CAAAA,EAC1CH,KAAKC,cAAcL,EAAME,EAAUhB,CAAAA,CACrC,CACD,CACD,MAAUsB,MAAM,mCAAmCnB,CAAAA,CAAO,EAmCtD,SAAUoB,EAASvB,EAAAA,CACvB,MAAO,CACLwB,EAIAC,IAO2B,OAAlBA,GAAkB,SACrB1B,GACEC,EACAwB,EAGAC,CAAAA,GAvJW,CACrBzB,EACA0B,EACAZ,IAAAA,CAEA,IAAMa,EAAiBD,EAAMC,eAAeb,CAAAA,EAO5C,OANCY,EAAME,YAAuCC,eAAef,EAAMd,CAAAA,EAM5D2B,EACHhB,OAAOmB,yBAAyBJ,EAAOZ,CAAAA,EAAAA,MAC9B,GA4IHd,EACAwB,EACAC,CAAAA,CAIZ,CChMM,SAAUM,GAAMC,EAAAA,CACpB,OAAOC,EAAS,CAAA,GACXD,EAIHD,MAAAA,GACAG,UAAAA,EAAW,CAAA,CAEf,CCnBa,IAAAC,GAAO,CAClBC,EACAC,EACAC,KAGAA,EAAWC,aAAAA,GACXD,EAAWE,WAAAA,GAIRC,QAAkDC,UACnC,OAATL,GAAS,UAMhBM,OAAOC,eAAeR,EAAKC,EAAMC,CAAAA,EAE5BA,GCmCO,SAAAO,GAAMC,EAAkBC,EAAAA,CACtC,MAAA,CACEC,EACAC,EACAC,IAAAA,CAEA,IAAMC,EAAWC,GAAAA,SACCA,OAAAA,GAAAA,EAAAA,EAAGC,aAAHD,YAAAA,EAAeE,cAAcR,KAA7BM,KAAAA,EAA0C,MAoB5D,GAAIL,EAAO,CAOT,GAAA,CAAMQ,IAACA,EAAGC,IAAEA,CAAAA,EACe,OAAlBP,GAAkB,SACrBD,EACAE,GAAAA,KAAAA,GACA,IAAA,CACE,IAAMO,EAEFC,OAAAA,EAIJ,MAAO,CACL,KAAAH,CACE,OAAQI,KAAmBF,CAAAA,CAC5B,EACD,IAAIG,EAAAA,CACDD,KAAmBF,CAAAA,EAAOG,CAC5B,CAAA,CAEJ,GAfD,EAgBN,OAAOC,GAAKb,EAAeC,EAAe,CACxC,KAAAM,CACE,IAAIO,EAAYP,EAAKQ,KAAKJ,IAAAA,EAO1B,OANIG,IAMJ,SALEA,EAASX,EAAQQ,IAAAA,GACbG,IAAW,MAAQH,KAAKK,aAC1BR,EAAKO,KAAKJ,KAAMG,CAAAA,GAGbA,CACR,CAAA,CAAA,CAEJ,CAGC,OAAOD,GAAKb,EAAeC,EAAe,CACxC,KAAAM,CACE,OAAOJ,EAAQQ,IAAAA,CAChB,CAAA,CAAA,CAGN,CACH,CCnJO,IAAMM,EAAgBC,GAAaA,GAAAA,KAAAA,EAASC,ECZ5C,IAAMC,EAAQC;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,EAkRRC,GAAaD;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;UCpRQ,IAAME,GAASC,8uCC2CjD,IAAMC,GAAQC,OAAOC,IAAI,EAAA,EAGnBC,GAAqBC,GAAAA,CACzB,IAAKA,iBAAgCC,KAAML,GAG3C,OAAQI,iBAA+C,YAAC,EAiB7CE,EAAgBF,IAAgC,CAC3DG,aAAkBH,EAClBC,EAAGL,EAAAA,GA1BL,IAiEMQ,GAAe,IAAIC,IAKZC,GACVC,GACD,CAACC,KAAkCC,IAAAA,CACjC,IAAMC,EAAID,EAAOE,OACbC,EACAC,EACEC,EAA+B,CAAA,EAC/BC,EAAgC,CAAA,EAGlCC,EAFAC,EAAI,EACJC,EAAAA,GAGJ,KAAOD,EAAIP,GAAG,CAKZ,IAJAM,EAAIR,EAAQS,CAAAA,EAKVA,EAAIP,IACFG,EAAeJ,EAAOQ,CAAAA,GACvBL,EAAcO,GAAkBN,CAAAA,KAF7BH,SAIJM,GAAKJ,EAAcJ,EAAAA,EAAUS,CAAAA,EAC7BC,EAAAA,GAGED,IAAMP,GACRK,EAAcK,KAAKP,CAAAA,EAErBC,EAAcM,KAAKJ,CAAAA,EACnBC,GACD,CAOD,GAJIA,IAAMP,GACRI,EAAcM,KAAKZ,EAAQE,CAAAA,CAAAA,EAGzBQ,EAAY,CACd,IAAMG,EAAMP,EAAcQ,KAAK,SAAA,GAC/Bd,EAAUJ,GAAamB,IAAIF,CAAAA,KADI,SAO5BP,EAAsBU,IAAMV,EAC7BV,GAAaqB,IACXJ,EACCb,EAAUM,CAAAA,GAGfL,EAASM,CACV,CACD,OAAOR,EAAQC,EAAAA,GAAYC,CAAAA,CAAO,EASzBiB,EAAOpB,GAAWqB,CAAAA,EAQlBC,GAAMtB,GAAWuB,EAAAA,EAQjBC,GAASxB,GAAWyB,EAAAA,EChMjC,IAAAC,GAAsB,WAGtB,IAAMC,GAAYC,GAAM,OAAOA,GAAM,SAC/BC,GAAcC,GAAM,OAAOA,GAAM,WAEjCC,GAAwB,IAAI,IAC5BC,GAAgB,KACtB,SAASC,GAAiBC,EAAS,CAEjC,MAAO,CAAC,GADI,MAAM,QAAQA,CAAO,EAAIA,EAAU,CAACA,CAAO,EACvCF,EAAa,CAC/B,CACA,SAASG,GAAKD,EAASE,EAAOC,EAAQ,CACpC,IAAMC,EAAWL,GAAiBC,CAAO,EACpCG,IACHA,EAAS,WAEX,IAAIE,EACJ,GAAI,OAAOF,GAAW,SAMpB,OALAE,EAAI,CACF,IAAK,UACL,MAAO,QACP,KAAM,SACR,EACQF,EAAQ,CACd,IAAK,OACHE,EAAE,QAAU,OACd,IAAK,OACHA,EAAE,MAAQ,OACV,MACF,IAAK,QACHA,EAAE,MAAQ,UACV,KACJ,MAEAA,EAAIF,EAMN,OAJkBG,GAChB,IAAMC,GAAS,OAAQH,EAAUD,CAAM,EACvC,IAAM,IAAI,KAAK,eAAeC,EAAUC,CAAC,CAC3C,EACiB,OAAOZ,GAASS,CAAK,EAAI,IAAI,KAAKA,CAAK,EAAIA,CAAK,CACnE,CACA,SAASM,GAAKR,EAASE,EAAOC,EAAQ,CACpC,IAAI,EAIJ,GAHKA,IACHA,EAAS,WAEP,OAAOA,GAAW,SAMpB,OALA,EAAI,CACF,OAAQ,UACR,OAAQ,UACR,KAAM,SACR,EACQA,EAAQ,CACd,IAAK,OACL,IAAK,OACH,EAAE,aAAe,QACjB,MACF,IAAK,QACH,OAAO,EAAE,MACb,MAEA,EAAIA,EAEN,OAAOF,GAAKD,EAASE,EAAO,CAAC,CAC/B,CACA,SAASO,GAAOT,EAASE,EAAOC,EAAQ,CACtC,IAAMC,EAAWL,GAAiBC,CAAO,EAKzC,OAJkBM,GAChB,IAAMC,GAAS,SAAUH,EAAUD,CAAM,EACzC,IAAM,IAAI,KAAK,aAAaC,EAAUD,CAAM,CAC9C,EACiB,OAAOD,CAAK,CAC/B,CACA,SAASQ,GAAOV,EAASW,EAAST,EAAO,CAAE,OAAAU,EAAS,EAAG,GAAGC,CAAM,EAAG,CA3EnE,IAAAC,EAAAC,EA4EE,IAAMX,EAAWL,GAAiBC,CAAO,EACnCgB,EAAUL,EAAUL,GACxB,IAAMC,GAAS,iBAAkBH,CAAQ,EACzC,IAAM,IAAI,KAAK,YAAYA,EAAU,CAAE,KAAM,SAAU,CAAC,CAC1D,EAAIE,GACF,IAAMC,GAAS,kBAAmBH,CAAQ,EAC1C,IAAM,IAAI,KAAK,YAAYA,EAAU,CAAE,KAAM,UAAW,CAAC,CAC3D,EACA,OAAOW,GAAAD,EAAAD,EAAMX,CAAK,IAAX,KAAAY,EAAgBD,EAAMG,EAAQ,OAAOd,EAAQU,CAAM,CAAC,IAApD,KAAAG,EAAyDF,EAAM,KACxE,CACA,SAASP,GAAYW,EAAQC,EAAW,CACtC,IAAMC,EAAMF,EAAO,EACfG,EAAYvB,GAAM,IAAIsB,CAAG,EAC7B,OAAKC,IACHA,EAAYF,EAAU,EACtBrB,GAAM,IAAIsB,EAAKC,CAAS,GAEnBA,CACT,CACA,SAASb,GAASc,EAAMrB,EAASsB,EAAS,CACxC,IAAMC,EAAYvB,EAAQ,KAAK,GAAG,EAClC,MAAO,GAAGqB,CAAI,IAAIE,CAAS,IAAI,KAAK,UAAUD,CAAO,CAAC,EACxD,CAWA,IAAME,GAAgB,sCAChBC,GAAgB,0BAChBC,GAAoB,CAACC,EAAQC,EAAeC,EAAU,CAAC,IAAM,CACjE,IAAMC,EAAUF,GAAiBD,EAC3BI,EAASC,GACT,OAAOA,GAAW,SACbA,EACFH,EAAQG,CAAM,EAEjBC,EAAoB,CAACC,EAAOC,IAAY,CAC5C,IAAMC,EAAe,OAAO,KAAKP,CAAO,EAAE,OAASE,EAAM,QAAQ,EAAI,OAC/DM,EAAWC,GAAOR,EAASI,EAAOE,CAAY,EACpD,OAAOD,EAAQ,QAAQ,IAAI,OAAOV,GAAe,GAAG,EAAGY,CAAQ,CACjE,EACA,MAAO,CACL,OAAQ,CAACH,EAAOK,IAAU,CACxB,GAAM,CAAE,OAAAC,EAAS,CAAE,EAAID,EACjBJ,EAAUM,GAAOX,EAAS,GAAOI,EAAOK,CAAK,EACnD,OAAON,EAAkBC,EAAQM,EAAQL,CAAO,CAClD,EACA,cAAe,CAACD,EAAOK,IAAU,CAC/B,GAAM,CAAE,OAAAC,EAAS,CAAE,EAAID,EACjBJ,EAAUM,GAAOX,EAAS,GAAMI,EAAOK,CAAK,EAClD,OAAON,EAAkBC,EAAQM,EAAQL,CAAO,CAClD,EACA,OAAQO,GACR,OAAQ,CAACR,EAAOF,IAAWM,GACzBR,EACAI,EACAH,EAAMC,CAAM,GAAK,CAAE,MAAOA,CAAO,CACnC,EACA,KAAM,CAACE,EAAOF,IAAWW,GAAKb,EAASI,EAAOH,EAAMC,CAAM,GAAKA,CAAM,EACrE,KAAM,CAACE,EAAOF,IAAWY,GAAKd,EAASI,EAAOH,EAAMC,CAAM,GAAKA,CAAM,CACvE,CACF,EACMU,GAAkB,CAACR,EAAOW,IAAO,CAhJvC,IAAAC,EAgJ0C,OAAAA,EAAAD,EAAMX,CAAK,IAAX,KAAAY,EAAgBD,EAAM,OAChE,SAASE,GAAYC,EAAarB,EAAQG,EAAS,CACjD,MAAO,CAACmB,EAAS,CAAC,EAAGpB,IAAY,CAC/B,IAAMqB,EAAaxB,GAAkBC,EAAQG,EAASD,CAAO,EACvDsB,EAAgB,CAACC,EAAQnB,EAAoB,KAC5C,MAAM,QAAQmB,CAAM,EAElBA,EAAO,OAAO,CAACjB,EAASkB,IAAU,CACvC,GAAIA,IAAU,KAAOpB,EACnB,OAAOE,EAAUV,GAEnB,GAAI6B,GAASD,CAAK,EAChB,OAAOlB,EAAUkB,EAEnB,GAAM,CAACE,EAAMC,EAAMxB,CAAM,EAAIqB,EACzBI,EAAqB,CAAC,EACtBD,IAAS,UAAYA,IAAS,iBAAmBA,IAAS,SAC5D,OAAO,QAAQxB,CAAM,EAAE,QACrB,CAAC,CAAC0B,EAAKC,CAAM,IAAM,CACjBF,EAAmBC,CAAG,EAAIP,EACxBQ,EACAH,IAAS,UAAYA,IAAS,eAChC,CACF,CACF,EAEAC,EAAqBzB,EAEvB,IAAIE,EACJ,GAAIsB,EAAM,CACR,IAAMI,EAAYV,EAAWM,CAAI,EACjCtB,EAAQ0B,EAAUX,EAAOM,CAAI,EAAGE,CAAkB,CACpD,MACEvB,EAAQe,EAAOM,CAAI,EAErB,OAAIrB,GAAS,KACJC,EAEFA,EAAUD,CACnB,EAAG,EAAE,EAjCIkB,EAmCLS,EAASV,EAAcH,CAAW,EACxC,OAAIM,GAASO,CAAM,GAAKrC,GAAc,KAAKqC,CAAM,KACxC,UAAMA,CAAM,EAEjBP,GAASO,CAAM,EACVA,EACFA,EAAS,OAAOA,CAAM,EAAI,EACnC,CACF,CAEA,IAAIC,GAAc,OAAO,eACrBC,GAAoB,CAACC,EAAKN,EAAKxB,IAAUwB,KAAOM,EAAMF,GAAYE,EAAKN,EAAK,CAAE,WAAY,GAAM,aAAc,GAAM,SAAU,GAAM,MAAAxB,CAAM,CAAC,EAAI8B,EAAIN,CAAG,EAAIxB,EAC1J+B,GAAkB,CAACD,EAAKN,EAAKxB,KAC/B6B,GAAkBC,EAAK,OAAON,GAAQ,SAAWA,EAAM,GAAKA,EAAKxB,CAAK,EAC/DA,GAEHgC,GAAN,KAAmB,CACjB,aAAc,CACZD,GAAgB,KAAM,UAAW,CAAC,CAAC,CACrC,CACA,GAAGE,EAAOC,EAAU,CA7MtB,IAAAtB,EA8MI,IAAIA,EACJ,OAACA,KAAK,KAAK,SAASqB,CAAK,IAAxB,OAA8BrB,EAAGqB,CAAK,EAAI,CAAC,GAC5C,KAAK,QAAQA,CAAK,EAAE,KAAKC,CAAQ,EAC1B,IAAM,KAAK,eAAeD,EAAOC,CAAQ,CAClD,CACA,eAAeD,EAAOC,EAAU,CAC9B,IAAMC,EAAiB,KAAK,cAAcF,CAAK,EAC/C,GAAI,CAACE,EACH,OACF,IAAMC,EAAQD,EAAe,QAAQD,CAAQ,EACzC,CAACE,GACHD,EAAe,OAAOC,EAAO,CAAC,CAClC,CACA,KAAKH,KAAUI,EAAM,CACnB,IAAMF,EAAiB,KAAK,cAAcF,CAAK,EAC1CE,GAELA,EAAe,IAAKD,GAAaA,EAAS,MAAM,KAAMG,CAAI,CAAC,CAC7D,CACA,cAAcJ,EAAO,CACnB,IAAME,EAAiB,KAAK,QAAQF,CAAK,EACzC,OAAO,MAAM,QAAQE,CAAc,EAAIA,EAAiB,EAC1D,CACF,EAEIG,GAAY,OAAO,eACnBC,GAAkB,CAACT,EAAKN,EAAKxB,IAAUwB,KAAOM,EAAMQ,GAAUR,EAAKN,EAAK,CAAE,WAAY,GAAM,aAAc,GAAM,SAAU,GAAM,MAAAxB,CAAM,CAAC,EAAI8B,EAAIN,CAAG,EAAIxB,EACtJwC,GAAgB,CAACV,EAAKN,EAAKxB,KAC7BuC,GAAgBT,EAAK,OAAON,GAAQ,SAAWA,EAAM,GAAKA,EAAKxB,CAAK,EAC7DA,GAEHyC,GAAN,cAAmBT,EAAa,CAC9B,YAAYU,EAAQ,CA9OtB,IAAA9B,EA+OI,MAAM,EACN4B,GAAc,KAAM,UAAW,EAAE,EACjCA,GAAc,KAAM,UAAU,EAC9BA,GAAc,KAAM,cAAe,CAAC,CAAC,EACrCA,GAAc,KAAM,YAAa,CAAC,CAAC,EACnCA,GAAc,KAAM,UAAU,EAC9BA,GAAc,KAAM,kBAAkB,EAItCA,GAAc,KAAM,IAAK,KAAK,EAAE,KAAK,IAAI,CAAC,EAItCE,EAAO,SAAW,OACpB,KAAK,SAAWA,EAAO,SACrBA,EAAO,UAAY,MACrB,KAAK,KAAKA,EAAO,QAAQ,EACvBA,EAAO,YAAc,MACvB,KAAK,eAAeA,EAAO,UAAU,GACnC,OAAOA,EAAO,QAAW,UAAYA,EAAO,UAC9C,KAAK,UAAS9B,EAAA8B,EAAO,SAAP,KAAA9B,EAAiB+B,GAAeD,EAAO,OAAO,CAEhE,CACA,IAAI,QAAS,CACX,OAAO,KAAK,OACd,CACA,IAAI,SAAU,CACZ,OAAO,KAAK,QACd,CACA,IAAI,UAAW,CA7QjB,IAAA9B,EA8QI,OAAOA,EAAA,KAAK,UAAU,KAAK,OAAO,IAA3B,KAAAA,EAAgC,CAAC,CAC1C,CAIA,IAAI,YAAa,CAnRnB,IAAAA,EAoRI,OAAOA,EAAA,KAAK,YAAY,KAAK,OAAO,IAA7B,KAAAA,EAAkC,CAAC,CAC5C,CACA,gBAAgBnB,EAAQmD,EAAY,CAClC,IAAMC,EAAkB,KAAK,YAAYpD,CAAM,EAC1CoD,EAGH,OAAO,OAAOA,EAAiBD,CAAU,EAFzC,KAAK,YAAYnD,CAAM,EAAImD,CAI/B,CAgBA,oBAAoBE,EAAU,CAC5B,YAAK,iBAAmBA,EACjB,IACT,CAIA,eAAeC,EAAiBH,EAAY,CACtC,OAAOG,GAAoB,SAC7B,KAAK,gBAAgBA,EAAiBH,CAAU,EAEhD,OAAO,KAAKG,CAAe,EAAE,QAC1BtD,GAAW,KAAK,gBAAgBA,EAAQsD,EAAgBtD,CAAM,CAAC,CAClE,EAEF,KAAK,KAAK,QAAQ,CACpB,CACA,MAAMA,EAAQuD,EAAU,CACtB,IAAMC,EAAgB,KAAK,UAAUxD,CAAM,EACtCwD,EAGH,OAAO,OAAOA,EAAeD,CAAQ,EAFrC,KAAK,UAAUvD,CAAM,EAAIuD,CAI7B,CACA,KAAKE,EAAkBF,EAAU,CAC3B,OAAOE,GAAoB,UAAY,OAAOF,GAAa,SAC7D,KAAK,MAAME,EAAkBF,CAAQ,EAErC,OAAO,QAAQE,CAAgB,EAAE,QAC/B,CAAC,CAACzD,EAAQ0D,CAAS,IAAM,KAAK,MAAM1D,EAAQ0D,CAAS,CACvD,EAEF,KAAK,KAAK,QAAQ,CACpB,CAIA,gBAAgB,CAAE,OAAA1D,EAAQ,QAAAG,EAAS,SAAAoD,CAAS,EAAG,CAC7C,KAAK,QAAUvD,EACf,KAAK,SAAWG,GAAW,OAC3B,KAAK,UAAU,KAAK,OAAO,EAAIoD,EAC/B,KAAK,KAAK,QAAQ,CACpB,CACA,SAASvD,EAAQG,EAAS,CAMxB,KAAK,QAAUH,EACf,KAAK,SAAWG,EAChB,KAAK,KAAK,QAAQ,CACpB,CACA,EAAEwD,EAAIrC,EAAQsC,EAAS,CACrB,GAAI,CAAC,KAAK,OACR,MAAM,IAAI,MACR,uOACF,EAEF,IAAIpD,EAAUoD,GAAA,YAAAA,EAAS,QAClBD,IACHA,EAAK,IAEFhC,GAASgC,CAAE,IACdrC,EAASqC,EAAG,QAAUrC,EACtBd,EAAUmD,EAAG,QACbA,EAAKA,EAAG,IAEV,IAAME,EAAe,KAAK,SAASF,CAAE,EAC/BG,EAAiBD,IAAiB,OAClCE,EAAU,KAAK,SACrB,GAAIA,GAAWD,EACb,OAAOE,GAAWD,CAAO,EAAIA,EAAQ,KAAK,QAASJ,CAAE,EAAII,EAEvDD,GACF,KAAK,KAAK,UAAW,CAAE,GAAAH,EAAI,OAAQ,KAAK,OAAQ,CAAC,EAEnD,IAAItC,EAAcwC,GAAgBrD,GAAWmD,EAgB7C,OAfIhC,GAASN,CAAW,IAClB,KAAK,iBACPA,EAAc,KAAK,iBAAiBA,CAAW,EAE/C,QAAQ,KAAK;AAAA;AAAA,IAEjBA,CAAW;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,CAMd,GAGOM,GAASN,CAAW,GAAKxB,GAAc,KAAKwB,CAAW,EAClD,KAAK,MAAM,IAAIA,CAAW,GAAG,EAClCM,GAASN,CAAW,EACfA,EACFD,GACLC,EACA,KAAK,QACL,KAAK,QACP,EAAEC,EAAQsC,GAAA,YAAAA,EAAS,OAAO,CAC5B,CACA,KAAKrD,EAAOF,EAAQ,CAClB,OAAOW,GAAK,KAAK,UAAY,KAAK,QAAST,EAAOF,CAAM,CAC1D,CACA,OAAOE,EAAOF,EAAQ,CACpB,OAAOM,GAAO,KAAK,UAAY,KAAK,QAASJ,EAAOF,CAAM,CAC5D,CACF,EACA,SAAS4D,GAAUhB,EAAS,CAAC,EAAG,CAC9B,OAAO,IAAID,GAAKC,CAAM,CACxB,CAEA,IAAMiB,EAAOD,GAAU,EEhaE,IAAME,GAAS,KAAK,MAAM,iDAAkD,ECAtEA,GAAS,KAAK,MAAM,4CAAgD,ECApEA,GAAS,KAAK,MAAM,yCAA6C,ECAjEA,GAAS,KAAK,MAAM,gDAAiD,ECArEA,GAAS,KAAK,MAAM,8CAA+C,ECErFC,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,GAAgB,KAEvBC,GAAgB,IAAM,CAP5B,IAAAC,EAQC,IAAIC,EACH,QAAQD,EAAA,SAAA,KAAA,OAAA,QAAS,MAAT,KAAA,OAAAA,EAAc,UAAW,CACjC,IAAK,OACJC,EAAQ,KACR,MACD,IAAK,OACJA,EAAQ,KACR,MACD,IAAK,UACJA,EAAQ,KACR,MACD,IAAK,MACJA,EAAQ,KACR,MACD,QACCA,EAAQ,IACV,CACA,OAAOA,CACR,EAEMC,GAAe,IAAM,CA5B3B,IAAAF,EA6BE,IAAMG,GAAWH,EAAA,UAAA,KAAA,OAAA,SAAU,WAAV,KAAA,OAAAA,EAAoB,SACrC,OAAIG,GAAA,MAAAA,EAAU,SAAS,MAAA,EACd,KACEA,EAAS,SAAS,MAAM,EAC1B,KACEA,EAAS,SAAS,SAAS,EAC7B,KACEA,EAAS,SAAS,KAAK,EACzB,KAEAL,EAEX,EAEaM,GAAsBC,GAE/BR,GAAiB,KACdS,GACCD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CACrE,GAAKJ,GAAa,EAIf,SAASK,IAAgC,CApDhD,IAAAP,EAqDE,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMQ,EAAeT,GAAc,EACnC,OAAOK,GAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,GAAaT,EAAA,UAAA,KAAA,OAAA,SAAU,kBAAV,KAAA,OAAAA,EAA2B,KACxCU,EAAaR,GAAa,EAEhC,OAAKL,GAAiB,SAASY,CAA6B,EAIrDL,GAAmBK,GAAA,KAAAA,EAAcC,CAAU,GAHhD,QAAQ,KAAK,gFAAgF,EACtFN,GAAmBM,CAAU,EAGxC,OAAS,EAAG,CACV,eAAQ,KAAK,yDAA0D,CAAC,EACjEZ,EACT,CACF,CAEO,IAAMa,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,GAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBX,EAAWe,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FC,EAAK,KAAKjB,EAAQV,CAAQ,EAC1B2B,EAAK,SAASjB,CAAM,CACtB,ENjGAW,GAAarB,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAGhE,IAAM4B,GAAN,cAA2BC,CAAW,CAC3C,QAAS,CACL,IAAMC,EAAQH,EAAK,EAAE,CAAE,QAAS,mBAAoB,GAAI,oBAAqB,QAAS,uBAAwB,CAAC,EAE/G,OAAOI,4HAA+HC,EAAa,UAAUF,CAAK,UAAU,CAAC,6LAA+L,CAClX,EACK,eAAe,IAAI,kBAAkB,GACxC,eAAe,OAAO,mBAAoBF,EAAY,EQnB/B,IAAMK,GAAS,KAAK,MAAM,gCAAoC,ECAxDA,GAAS,KAAK,MAAM,gCAAoC,ECAxDA,GAAS,KAAK,MAAM,gCAAoC,ECAxDA,GAAS,KAAK,MAAM,gCAAoC,ECAxDA,GAAS,KAAK,MAAM,gCAAoC,ECE1EC,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,GAAgB,KAEvBC,GAAgB,IAAM,CAP5B,IAAAC,EAQC,IAAIC,EACH,QAAQD,EAAA,SAAA,KAAA,OAAA,QAAS,MAAT,KAAA,OAAAA,EAAc,UAAW,CACjC,IAAK,OACJC,EAAQ,KACR,MACD,IAAK,OACJA,EAAQ,KACR,MACD,IAAK,UACJA,EAAQ,KACR,MACD,IAAK,MACJA,EAAQ,KACR,MACD,QACCA,EAAQ,IACV,CACA,OAAOA,CACR,EAEMC,GAAe,IAAM,CA5B3B,IAAAF,EA6BE,IAAMG,GAAWH,EAAA,UAAA,KAAA,OAAA,SAAU,WAAV,KAAA,OAAAA,EAAoB,SACrC,OAAIG,GAAA,MAAAA,EAAU,SAAS,MAAA,EACd,KACEA,EAAS,SAAS,MAAM,EAC1B,KACEA,EAAS,SAAS,SAAS,EAC7B,KACEA,EAAS,SAAS,KAAK,EACzB,KAEAL,EAEX,EAEaM,GAAsBC,GAE/BR,GAAiB,KACdS,GACCD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CACrE,GAAKJ,GAAa,EAIf,SAASK,IAAgC,CApDhD,IAAAP,EAqDE,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMQ,EAAeT,GAAc,EACnC,OAAOK,GAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,GAAaT,EAAA,UAAA,KAAA,OAAA,SAAU,kBAAV,KAAA,OAAAA,EAA2B,KACxCU,EAAaR,GAAa,EAEhC,OAAKL,GAAiB,SAASY,CAA6B,EAIrDL,GAAmBK,GAAA,KAAAA,EAAcC,CAAU,GAHhD,QAAQ,KAAK,gFAAgF,EACtFN,GAAmBM,CAAU,EAGxC,OAAS,EAAG,CACV,eAAQ,KAAK,yDAA0D,CAAC,EACjEZ,EACT,CACF,CAEO,IAAMa,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,GAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBX,EAAWe,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FC,EAAK,KAAKjB,EAAQV,CAAQ,EAC1B2B,EAAK,SAASjB,CAAM,CACtB,ENjGAW,GAAarB,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAGhE,IAAM4B,GAAN,cAA0BC,CAAW,CAC1C,QAAS,CACL,IAAMC,EAAQH,EAAK,EAAE,CAAE,QAAS,QAAS,GAAI,mBAAoB,QAAS,sBAAuB,CAAC,EAElG,OAAOI,2HAA8HC,EAAa,UAAUF,CAAK,UAAU,CAAC,uIAAyI,CAC3T,EACK,eAAe,IAAI,iBAAiB,GACvC,eAAe,OAAO,kBAAmBF,EAAW,EOLtD,IAAMK,GACJ,+HAEWC,GAAW,CACtB,QAASD,GAAsB,UAC/B,iBAAkB,cAClB,gBAAiB,OACjB,MAAO,yEACT,EAEaE,GAAW,CACtB,QAASF,GAAsB,SAC/B,iBAAkB,cAClB,gBAAiB,OACjB,MAAO,yEACT,EAOMG,GAAN,cAAwBC,CAAW,CAAnC,kCAQ+B,WAAQ,GAOR,YAAS,GAOtC,IAAI,YAAa,CACf,OAAO,KAAK,OAAS,SAAWH,GAAWC,EAC7C,CAGA,IAAI,UAAW,CACb,OAAOG,EAAW,CAAC,KAAK,WAAW,QAAS,KAAK,MAAQ,KAAK,WAAW,iBAAmB,KAAK,WAAW,eAAe,CAAC,CAC9H,CAGA,IAAI,eAAgB,CAClB,OAAOC;AAAA,4BACiBC,EAAU,KAAK,SAAS,CAAC,YAAY,KAAK,QAAQ;AAAA;AAAA;AAAA,KAI5E,CAGA,IAAI,cAAe,CACjB,OAAOD;AAAA,4BACiBC,EAAU,KAAK,SAAS,CAAC,YAAY,KAAK,QAAQ;AAAA;AAAA;AAAA,KAI5E,CAGA,IAAI,OAAQ,CACV,OAAOD;AAAA,oBACS,KAAK,QAAQ;AAAA,uBACV,KAAK,WAAW,KAAK,KAAK,KAAK,KAAK;AAAA;AAAA,KAGzD,CAGA,IAAI,SAAU,CACZ,GAAI,KAAK,MACP,OAAO,KAAK,MACP,GAAI,KAAK,OACd,OAAO,KAAK,cACP,GAAI,KAAK,MACd,OAAO,KAAK,YAGhB,CAEA,QAAS,CACP,OAAOA,IAAO,KAAK,OAAO,EAC5B,CACF,EAzEMH,GAmBG,OAAS,CAACK,EAAOC,EAAM,EAlBSC,EAAA,CAAtCC,EAAS,CAAE,UAAW,YAAa,CAAC,GADjCR,GACmC,yBAOVO,EAAA,CAA5BC,EAAS,CAAE,KAAM,OAAQ,CAAC,GARvBR,GAQyB,qBAOAO,EAAA,CAA5BC,EAAS,CAAE,KAAM,OAAQ,CAAC,GAfvBR,GAeyB,sBAEjBO,EAAA,CAAXC,EAAS,GAjBNR,GAiBQ,qBA0DT,eAAe,IAAI,SAAS,GAC/B,eAAe,OAAO,UAAWA,EAAS,ECtE/B,IAAAS,GAAW,CACtBC,UAAW,EACXC,MAAO,EACPC,SAAU,EACVC,kBAAmB,EACnBC,MAAO,EACPC,QAAS,CAAA,EAoCEC,GACgBC,GAC3B,IAAIC,KAAsE,CAExEC,gBAAqBF,EACrBC,OAAAA,CAAAA,GAQkBE,GARlBF,KAQkBE,CAkBpB,YAAYC,EAAAA,CAAuB,CAGnC,IAAA,MAAIC,CACF,OAAOC,KAAKC,KAASF,IACtB,CAGD,KACEG,EACAC,EACAC,EAAAA,CAEAJ,KAAKK,KAASH,EACdF,KAAKC,KAAWE,EAChBH,KAAKM,KAAmBF,CACzB,CAED,KAAUF,EAAYK,EAAAA,CACpB,OAAOP,KAAKQ,OAAON,EAAMK,CAAAA,CAC1B,CAID,OAAOE,EAAaF,EAAAA,CAClB,OAAOP,KAAKU,OAAAA,GAAUH,CAAAA,CACvB,CAAA,MCpBUI,GAAWC,GAnGxB,cAAgCC,EAAAA,CAQ9B,YAAYC,EAAAA,OAEV,GADAC,MAAMD,CAAAA,EAEJA,EAASE,OAASC,GAASC,WAC3BJ,EAASK,OAAS,WACjBL,EAAAA,EAASM,UAATN,YAAAA,EAAkBO,QAAoB,EAEvC,MAAUC,MACR,oGAAA,CAIL,CAED,OAAOC,EAAAA,CAEL,MACE,IACAC,OAAOC,KAAKF,CAAAA,EACTG,OAAQC,GAAQJ,EAAUI,CAAAA,CAAAA,EAC1BC,KAAK,GAAA,EACR,GAEH,CAEQ,OAAOC,EAAAA,CAAsBN,CAAAA,EAAAA,SAEpC,GAAIO,KAAKC,KAAT,OAAyC,CACvCD,KAAKC,GAAmB,IAAIC,IACxBH,EAAKT,UADmBY,SAE1BF,KAAKG,GAAiB,IAAID,IACxBH,EAAKT,QACFQ,KAAK,GAAA,EACLM,MAAM,IAAA,EACNR,OAAQS,GAAMA,IAAM,EAANA,CAAAA,GAGrB,QAAWhB,KAAQI,EACbA,EAAUJ,CAAAA,GAAAA,GAAUW,EAAAA,KAAKG,KAALH,MAAAA,EAAqBM,IAAIjB,KAC/CW,KAAKC,GAAiBM,IAAIlB,CAAAA,EAG9B,OAAOW,KAAKQ,OAAOf,CAAAA,CACpB,CAED,IAAMgB,EAAYV,EAAKW,QAAQD,UAG/B,QAAWpB,KAAQW,KAAKC,GAChBZ,KAAQI,IACZgB,EAAUE,OAAOtB,CAAAA,EACjBW,KAAKC,GAAkBW,OAAOvB,CAAAA,GAKlC,QAAWA,KAAQI,EAAW,CAG5B,IAAMoB,EAAAA,CAAAA,CAAUpB,EAAUJ,CAAAA,EAExBwB,IAAUb,KAAKC,GAAiBK,IAAIjB,CAAAA,IACnCW,EAAAA,KAAKG,KAALH,MAAAA,EAAqBM,IAAIjB,KAEtBwB,GACFJ,EAAUF,IAAIlB,CAAAA,EACdW,KAAKC,GAAiBM,IAAIlB,CAAAA,IAE1BoB,EAAUE,OAAOtB,CAAAA,EACjBW,KAAKC,GAAiBW,OAAOvB,CAAAA,GAGlC,CACD,OAAOyB,EACR,CAAA,CAAA,ECtGH,IAAMC,GAAwBC,GAAQA,EAAI,QAAQ,qBAAsB,OAAO,EAAE,YAAY,EAGtF,SAASC,GAAoBC,EAAa,CAC/C,OAAO,cAAcA,CAAY,CAC/B,OAAO,eAAeC,EAAMC,EAAS,CACnC,IAAIC,EAAgBD,GAGhB,OAAOA,GAAA,YAAAA,EAAS,YAAc,cAAeA,GAAA,YAAAA,EAAS,aAAc,MACtEC,EAAgB,OAAO,OAAO,CAAC,EAAGD,EAAS,CACzC,UAAWL,GAAqBI,EAAK,SAAS,CAAC,CACjD,CAAC,GAGH,MAAM,eAAeA,EAAME,CAAa,CAC1C,CACF,CACF,CAEO,SAASC,GAAQC,EAAM,CAC5B,IAAMD,EAAU,CAAC,EACjB,OAAW,CAACE,EAAKC,CAAK,IAAK,OAAO,QAAQF,CAAI,EACxCE,GAAOH,EAAQ,KAAKE,CAAG,EAE7B,OAAOF,EAAQ,KAAK,GAAG,CACzB,CAEO,SAASI,GAASC,EAAY,CACnC,IAAMJ,EAAO,CAAC,EACd,OAAW,CAACC,EAAKC,CAAK,IAAK,OAAO,QAAQE,CAAU,EAClD,QAAWC,KAAaJ,EAAI,MAAM,GAAG,EACnCD,EAAKK,CAAS,EAAIH,EAGtB,OAAOI,GAASN,CAAI,CACtB,CAEO,SAASO,IAAmB,CACjC,MAAO,IAAI,KAAK,OAAO,EAAE,SAAS,EAAE,EAAE,MAAM,CAAC,CAAC,EAChD,CCrCA,IAAMC,GAAQ,CAAC,MAAO,QAAS,SAAU,MAAM,EAG/C,IAAMC,GAAM,KAAK,IACXC,GAAM,KAAK,IACXC,GAAQ,KAAK,MAEnB,IAAMC,GAAeC,IAAM,CACzB,EAAGA,EACH,EAAGA,CACL,GACMC,GAAkB,CACtB,KAAM,QACN,MAAO,OACP,OAAQ,MACR,IAAK,QACP,EACMC,GAAuB,CAC3B,MAAO,MACP,IAAK,OACP,EACA,SAASC,GAAMC,EAAOC,EAAOC,EAAK,CAChC,OAAOC,GAAIH,EAAOI,GAAIH,EAAOC,CAAG,CAAC,CACnC,CACA,SAASG,GAASJ,EAAOK,EAAO,CAC9B,OAAO,OAAOL,GAAU,WAAaA,EAAMK,CAAK,EAAIL,CACtD,CACA,SAASM,GAAQC,EAAW,CAC1B,OAAOA,EAAU,MAAM,GAAG,EAAE,CAAC,CAC/B,CACA,SAASC,GAAaD,EAAW,CAC/B,OAAOA,EAAU,MAAM,GAAG,EAAE,CAAC,CAC/B,CACA,SAASE,GAAgBC,EAAM,CAC7B,OAAOA,IAAS,IAAM,IAAM,GAC9B,CACA,SAASC,GAAcD,EAAM,CAC3B,OAAOA,IAAS,IAAM,SAAW,OACnC,CACA,IAAME,GAA0B,IAAI,IAAI,CAAC,MAAO,QAAQ,CAAC,EACzD,SAASC,GAAYN,EAAW,CAC9B,OAAOK,GAAW,IAAIN,GAAQC,CAAS,CAAC,EAAI,IAAM,GACpD,CACA,SAASO,GAAiBP,EAAW,CACnC,OAAOE,GAAgBI,GAAYN,CAAS,CAAC,CAC/C,CACA,SAASQ,GAAkBR,EAAWS,EAAOC,EAAK,CAC5CA,IAAQ,SACVA,EAAM,IAER,IAAMC,EAAYV,GAAaD,CAAS,EAClCY,EAAgBL,GAAiBP,CAAS,EAC1Ca,EAAST,GAAcQ,CAAa,EACtCE,EAAoBF,IAAkB,IAAMD,KAAeD,EAAM,MAAQ,SAAW,QAAU,OAASC,IAAc,QAAU,SAAW,MAC9I,OAAIF,EAAM,UAAUI,CAAM,EAAIJ,EAAM,SAASI,CAAM,IACjDC,EAAoBC,GAAqBD,CAAiB,GAErD,CAACA,EAAmBC,GAAqBD,CAAiB,CAAC,CACpE,CACA,SAASE,GAAsBhB,EAAW,CACxC,IAAMiB,EAAoBF,GAAqBf,CAAS,EACxD,MAAO,CAACkB,GAA8BlB,CAAS,EAAGiB,EAAmBC,GAA8BD,CAAiB,CAAC,CACvH,CACA,SAASC,GAA8BlB,EAAW,CAChD,OAAOA,EAAU,QAAQ,aAAcW,GAAarB,GAAqBqB,CAAS,CAAC,CACrF,CACA,IAAMQ,GAAc,CAAC,OAAQ,OAAO,EAC9BC,GAAc,CAAC,QAAS,MAAM,EAC9BC,GAAc,CAAC,MAAO,QAAQ,EAC9BC,GAAc,CAAC,SAAU,KAAK,EACpC,SAASC,GAAYC,EAAMC,EAASf,EAAK,CACvC,OAAQc,EAAM,CACZ,IAAK,MACL,IAAK,SACH,OAAId,EAAYe,EAAUL,GAAcD,GACjCM,EAAUN,GAAcC,GACjC,IAAK,OACL,IAAK,QACH,OAAOK,EAAUJ,GAAcC,GACjC,QACE,MAAO,CAAC,CACZ,CACF,CACA,SAASI,GAA0B1B,EAAW2B,EAAeC,EAAWlB,EAAK,CAC3E,IAAMC,EAAYV,GAAaD,CAAS,EACpC6B,EAAON,GAAYxB,GAAQC,CAAS,EAAG4B,IAAc,QAASlB,CAAG,EACrE,OAAIC,IACFkB,EAAOA,EAAK,IAAIL,GAAQA,EAAO,IAAMb,CAAS,EAC1CgB,IACFE,EAAOA,EAAK,OAAOA,EAAK,IAAIX,EAA6B,CAAC,IAGvDW,CACT,CACA,SAASd,GAAqBf,EAAW,CACvC,OAAOA,EAAU,QAAQ,yBAA0BwB,GAAQnC,GAAgBmC,CAAI,CAAC,CAClF,CACA,SAASM,GAAoBC,EAAS,CACpC,MAAO,CACL,IAAK,EACL,MAAO,EACP,OAAQ,EACR,KAAM,EACN,GAAGA,CACL,CACF,CACA,SAASC,GAAiBD,EAAS,CACjC,OAAO,OAAOA,GAAY,SAAWD,GAAoBC,CAAO,EAAI,CAClE,IAAKA,EACL,MAAOA,EACP,OAAQA,EACR,KAAMA,CACR,CACF,CACA,SAASE,GAAiBC,EAAM,CAC9B,GAAM,CACJ,EAAAC,EACA,EAAAC,EACA,MAAAC,EACA,OAAAC,CACF,EAAIJ,EACJ,MAAO,CACL,MAAAG,EACA,OAAAC,EACA,IAAKF,EACL,KAAMD,EACN,MAAOA,EAAIE,EACX,OAAQD,EAAIE,EACZ,EAAAH,EACA,EAAAC,CACF,CACF,CCrIA,SAASG,GAA2BC,EAAMC,EAAWC,EAAK,CACxD,GAAI,CACF,UAAAC,EACA,SAAAC,CACF,EAAIJ,EACEK,EAAWC,GAAYL,CAAS,EAChCM,EAAgBC,GAAiBP,CAAS,EAC1CQ,EAAcC,GAAcH,CAAa,EACzCI,EAAOC,GAAQX,CAAS,EACxBY,EAAaR,IAAa,IAC1BS,EAAUX,EAAU,EAAIA,EAAU,MAAQ,EAAIC,EAAS,MAAQ,EAC/DW,EAAUZ,EAAU,EAAIA,EAAU,OAAS,EAAIC,EAAS,OAAS,EACjEY,EAAcb,EAAUM,CAAW,EAAI,EAAIL,EAASK,CAAW,EAAI,EACrEQ,EACJ,OAAQN,EAAM,CACZ,IAAK,MACHM,EAAS,CACP,EAAGH,EACH,EAAGX,EAAU,EAAIC,EAAS,MAC5B,EACA,MACF,IAAK,SACHa,EAAS,CACP,EAAGH,EACH,EAAGX,EAAU,EAAIA,EAAU,MAC7B,EACA,MACF,IAAK,QACHc,EAAS,CACP,EAAGd,EAAU,EAAIA,EAAU,MAC3B,EAAGY,CACL,EACA,MACF,IAAK,OACHE,EAAS,CACP,EAAGd,EAAU,EAAIC,EAAS,MAC1B,EAAGW,CACL,EACA,MACF,QACEE,EAAS,CACP,EAAGd,EAAU,EACb,EAAGA,EAAU,CACf,CACJ,CACA,OAAQe,GAAajB,CAAS,EAAG,CAC/B,IAAK,QACHgB,EAAOV,CAAa,GAAKS,GAAed,GAAOW,EAAa,GAAK,GACjE,MACF,IAAK,MACHI,EAAOV,CAAa,GAAKS,GAAed,GAAOW,EAAa,GAAK,GACjE,KACJ,CACA,OAAOI,CACT,CASA,IAAME,GAAkB,MAAOhB,EAAWC,EAAUgB,IAAW,CAC7D,GAAM,CACJ,UAAAnB,EAAY,SACZ,SAAAoB,EAAW,WACX,WAAAC,EAAa,CAAC,EACd,SAAAC,CACF,EAAIH,EACEI,EAAkBF,EAAW,OAAO,OAAO,EAC3CpB,EAAM,MAAOqB,EAAS,OAAS,KAAO,OAASA,EAAS,MAAMnB,CAAQ,GACxEqB,EAAQ,MAAMF,EAAS,gBAAgB,CACzC,UAAApB,EACA,SAAAC,EACA,SAAAiB,CACF,CAAC,EACG,CACF,EAAAK,EACA,EAAAC,CACF,EAAI5B,GAA2B0B,EAAOxB,EAAWC,CAAG,EAChD0B,EAAoB3B,EACpB4B,EAAiB,CAAC,EAClBC,EAAa,EACjB,QAASC,EAAI,EAAGA,EAAIP,EAAgB,OAAQO,IAAK,CAC/C,GAAM,CACJ,KAAAC,EACA,GAAAC,CACF,EAAIT,EAAgBO,CAAC,EACf,CACJ,EAAGG,EACH,EAAGC,EACH,KAAAC,GACA,MAAAC,CACF,EAAI,MAAMJ,EAAG,CACX,EAAAP,EACA,EAAAC,EACA,iBAAkB1B,EAClB,UAAW2B,EACX,SAAAP,EACA,eAAAQ,EACA,MAAAJ,EACA,SAAAF,EACA,SAAU,CACR,UAAApB,EACA,SAAAC,CACF,CACF,CAAC,EACDsB,EAAIQ,GAAS,KAAOA,EAAQR,EAC5BC,EAAIQ,GAAS,KAAOA,EAAQR,EAC5BE,EAAiB,CACf,GAAGA,EACH,CAACG,CAAI,EAAG,CACN,GAAGH,EAAeG,CAAI,EACtB,GAAGI,EACL,CACF,EACIC,GAASP,GAAc,KACzBA,IACI,OAAOO,GAAU,WACfA,EAAM,YACRT,EAAoBS,EAAM,WAExBA,EAAM,QACRZ,EAAQY,EAAM,QAAU,GAAO,MAAMd,EAAS,gBAAgB,CAC5D,UAAApB,EACA,SAAAC,EACA,SAAAiB,CACF,CAAC,EAAIgB,EAAM,OAEZ,CACC,EAAAX,EACA,EAAAC,CACF,EAAI5B,GAA2B0B,EAAOG,EAAmB1B,CAAG,GAE9D6B,EAAI,GAER,CACA,MAAO,CACL,EAAAL,EACA,EAAAC,EACA,UAAWC,EACX,SAAAP,EACA,eAAAQ,CACF,CACF,EAUA,eAAeS,GAAeC,EAAOC,EAAS,CAC5C,IAAIC,EACAD,IAAY,SACdA,EAAU,CAAC,GAEb,GAAM,CACJ,EAAAd,EACA,EAAAC,EACA,SAAAJ,EACA,MAAAE,EACA,SAAAiB,EACA,SAAArB,CACF,EAAIkB,EACE,CACJ,SAAAI,EAAW,oBACX,aAAAC,EAAe,WACf,eAAAC,EAAiB,WACjB,YAAAC,EAAc,GACd,QAAAC,EAAU,CACZ,EAAIC,GAASR,EAASD,CAAK,EACrBU,EAAgBC,GAAiBH,CAAO,EAExCI,EAAUT,EAASI,EADND,IAAmB,WAAa,YAAc,WACbA,CAAc,EAC5DO,EAAqBC,GAAiB,MAAM9B,EAAS,gBAAgB,CACzE,SAAWkB,EAAwB,MAAOlB,EAAS,WAAa,KAAO,OAASA,EAAS,UAAU4B,CAAO,KAAO,MAAOV,EAAgCU,EAAUA,EAAQ,gBAAmB,MAAO5B,EAAS,oBAAsB,KAAO,OAASA,EAAS,mBAAmBmB,EAAS,QAAQ,GAChS,SAAAC,EACA,aAAAC,EACA,SAAAvB,CACF,CAAC,CAAC,EACIiC,EAAOT,IAAmB,WAAa,CAC3C,EAAAnB,EACA,EAAAC,EACA,MAAOF,EAAM,SAAS,MACtB,OAAQA,EAAM,SAAS,MACzB,EAAIA,EAAM,UACJ8B,EAAe,MAAOhC,EAAS,iBAAmB,KAAO,OAASA,EAAS,gBAAgBmB,EAAS,QAAQ,GAC5Gc,GAAe,MAAOjC,EAAS,WAAa,KAAO,OAASA,EAAS,UAAUgC,CAAY,GAAO,MAAOhC,EAAS,UAAY,KAAO,OAASA,EAAS,SAASgC,CAAY,IAAO,CACvL,EAAG,EACH,EAAG,CACL,EAAI,CACF,EAAG,EACH,EAAG,CACL,EACME,EAAoBJ,GAAiB9B,EAAS,sDAAwD,MAAMA,EAAS,sDAAsD,CAC/K,SAAAmB,EACA,KAAAY,EACA,aAAAC,EACA,SAAAlC,CACF,CAAC,EAAIiC,CAAI,EACT,MAAO,CACL,KAAMF,EAAmB,IAAMK,EAAkB,IAAMR,EAAc,KAAOO,GAAY,EACxF,QAASC,EAAkB,OAASL,EAAmB,OAASH,EAAc,QAAUO,GAAY,EACpG,MAAOJ,EAAmB,KAAOK,EAAkB,KAAOR,EAAc,MAAQO,GAAY,EAC5F,OAAQC,EAAkB,MAAQL,EAAmB,MAAQH,EAAc,OAASO,GAAY,CAClG,CACF,CAOA,IAAME,GAAQlB,IAAY,CACxB,KAAM,QACN,QAAAA,EACA,MAAM,GAAGD,EAAO,CACd,GAAM,CACJ,EAAAb,EACA,EAAAC,EACA,UAAA1B,EACA,MAAAwB,EACA,SAAAF,EACA,SAAAmB,EACA,eAAAb,CACF,EAAIU,EAEE,CACJ,QAAAY,EACA,QAAAJ,EAAU,CACZ,EAAIC,GAASR,EAASD,CAAK,GAAK,CAAC,EACjC,GAAIY,GAAW,KACb,MAAO,CAAC,EAEV,IAAMF,EAAgBC,GAAiBH,CAAO,EACxC9B,EAAS,CACb,EAAAS,EACA,EAAAC,CACF,EACMgC,EAAOnD,GAAiBP,CAAS,EACjC2D,EAASlD,GAAciD,CAAI,EAC3BE,EAAkB,MAAMtC,EAAS,cAAc4B,CAAO,EACtDW,EAAUH,IAAS,IACnBI,EAAUD,EAAU,MAAQ,OAC5BE,EAAUF,EAAU,SAAW,QAC/BG,EAAaH,EAAU,eAAiB,cACxCI,GAAUzC,EAAM,UAAUmC,CAAM,EAAInC,EAAM,UAAUkC,CAAI,EAAI1C,EAAO0C,CAAI,EAAIlC,EAAM,SAASmC,CAAM,EAChGO,EAAYlD,EAAO0C,CAAI,EAAIlC,EAAM,UAAUkC,CAAI,EAC/CS,EAAoB,MAAO7C,EAAS,iBAAmB,KAAO,OAASA,EAAS,gBAAgB4B,CAAO,GACzGkB,EAAaD,EAAoBA,EAAkBH,CAAU,EAAI,GAGjE,CAACI,GAAc,CAAE,MAAO9C,EAAS,WAAa,KAAO,OAASA,EAAS,UAAU6C,CAAiB,MACpGC,EAAa3B,EAAS,SAASuB,CAAU,GAAKxC,EAAM,SAASmC,CAAM,GAErE,IAAMU,EAAoBJ,GAAU,EAAIC,EAAY,EAI9CI,EAAyBF,EAAa,EAAIR,EAAgBD,CAAM,EAAI,EAAI,EACxEY,EAAaC,GAAIxB,EAAcc,CAAO,EAAGQ,CAAsB,EAC/DG,GAAaD,GAAIxB,EAAce,CAAO,EAAGO,CAAsB,EAI/DI,EAAQH,EACRI,EAAMP,EAAaR,EAAgBD,CAAM,EAAIc,GAC7CG,GAASR,EAAa,EAAIR,EAAgBD,CAAM,EAAI,EAAIU,EACxDQ,GAASC,GAAMJ,EAAOE,GAAQD,CAAG,EAMjCI,GAAkB,CAACnD,EAAe,OAASX,GAAajB,CAAS,GAAK,MAAQ4E,KAAWC,IAAUrD,EAAM,UAAUmC,CAAM,EAAI,GAAKiB,GAASF,EAAQH,EAAaE,IAAcb,EAAgBD,CAAM,EAAI,EAAI,EAC5MqB,GAAkBD,GAAkBH,GAASF,EAAQE,GAASF,EAAQE,GAASD,EAAM,EAC3F,MAAO,CACL,CAACjB,CAAI,EAAG1C,EAAO0C,CAAI,EAAIsB,GACvB,KAAM,CACJ,CAACtB,CAAI,EAAGmB,GACR,aAAcD,GAASC,GAASG,GAChC,GAAID,IAAmB,CACrB,gBAAAC,EACF,CACF,EACA,MAAOD,EACT,CACF,CACF,GA+GA,IAAME,GAAO,SAAUC,EAAS,CAC9B,OAAIA,IAAY,SACdA,EAAU,CAAC,GAEN,CACL,KAAM,OACN,QAAAA,EACA,MAAM,GAAGC,EAAO,CACd,IAAIC,EAAuBC,EAC3B,GAAM,CACJ,UAAAC,EACA,eAAAC,EACA,MAAAC,EACA,iBAAAC,EACA,SAAAC,EACA,SAAAC,CACF,EAAIR,EACE,CACJ,SAAUS,EAAgB,GAC1B,UAAWC,EAAiB,GAC5B,mBAAoBC,EACpB,iBAAAC,EAAmB,UACnB,0BAAAC,EAA4B,OAC5B,cAAAC,EAAgB,GAChB,GAAGC,CACL,EAAIC,GAASjB,EAASC,CAAK,EAM3B,IAAKC,EAAwBG,EAAe,QAAU,MAAQH,EAAsB,gBAClF,MAAO,CAAC,EAEV,IAAMgB,EAAOC,GAAQf,CAAS,EACxBgB,EAAkBC,GAAYd,CAAgB,EAC9Ce,EAAkBH,GAAQZ,CAAgB,IAAMA,EAChDgB,GAAM,MAAOf,EAAS,OAAS,KAAO,OAASA,EAAS,MAAMC,EAAS,QAAQ,GAC/Ee,EAAqBZ,IAAgCU,GAAmB,CAACP,EAAgB,CAACU,GAAqBlB,CAAgB,CAAC,EAAImB,GAAsBnB,CAAgB,GAC1KoB,EAA+Bb,IAA8B,OAC/D,CAACF,GAA+Be,GAClCH,EAAmB,KAAK,GAAGI,GAA0BrB,EAAkBQ,EAAeD,EAA2BS,EAAG,CAAC,EAEvH,IAAMM,EAAa,CAACtB,EAAkB,GAAGiB,CAAkB,EACrDM,EAAW,MAAMC,GAAe9B,EAAOe,CAAqB,EAC5DgB,EAAY,CAAC,EACfC,IAAkB9B,EAAuBE,EAAe,OAAS,KAAO,OAASF,EAAqB,YAAc,CAAC,EAIzH,GAHIO,GACFsB,EAAU,KAAKF,EAASZ,CAAI,CAAC,EAE3BP,EAAgB,CAClB,IAAMuB,GAAQC,GAAkB/B,EAAWE,EAAOiB,EAAG,EACrDS,EAAU,KAAKF,EAASI,GAAM,CAAC,CAAC,EAAGJ,EAASI,GAAM,CAAC,CAAC,CAAC,CACvD,CAOA,GANAD,EAAgB,CAAC,GAAGA,EAAe,CACjC,UAAA7B,EACA,UAAA4B,CACF,CAAC,EAGG,CAACA,EAAU,MAAMd,IAAQA,IAAQ,CAAC,EAAG,CACvC,IAAIkB,GAAuBC,EAC3B,IAAMC,MAAeF,GAAwB/B,EAAe,OAAS,KAAO,OAAS+B,GAAsB,QAAU,GAAK,EACpHG,GAAgBV,EAAWS,EAAS,EAC1C,GAAIC,KAEE,EAD4B5B,IAAmB,YAAcS,IAAoBC,GAAYkB,EAAa,EAAI,KAIlHN,EAAc,MAAMO,IAAKnB,GAAYmB,GAAE,SAAS,IAAMpB,EAAkBoB,GAAE,UAAU,CAAC,EAAI,EAAI,EAAI,GAE/F,MAAO,CACL,KAAM,CACJ,MAAOF,GACP,UAAWL,CACb,EACA,MAAO,CACL,UAAWM,EACb,CACF,EAMJ,IAAIE,IAAkBJ,EAAwBJ,EAAc,OAAOO,IAAKA,GAAE,UAAU,CAAC,GAAK,CAAC,EAAE,KAAK,CAACE,GAAGC,KAAMD,GAAE,UAAU,CAAC,EAAIC,GAAE,UAAU,CAAC,CAAC,EAAE,CAAC,IAAM,KAAO,OAASN,EAAsB,UAG1L,GAAI,CAACI,GACH,OAAQ5B,EAAkB,CACxB,IAAK,UACH,CACE,IAAI+B,EACJ,IAAMxC,IAAawC,EAAyBX,EAAc,OAAOO,IAAK,CACpE,GAAIb,EAA8B,CAChC,IAAMkB,GAAkBxB,GAAYmB,GAAE,SAAS,EAC/C,OAAOK,KAAoBzB,GAG3ByB,KAAoB,GACtB,CACA,MAAO,EACT,CAAC,EAAE,IAAIL,IAAK,CAACA,GAAE,UAAWA,GAAE,UAAU,OAAOV,IAAYA,GAAW,CAAC,EAAE,OAAO,CAACgB,GAAKhB,KAAagB,GAAMhB,GAAU,CAAC,CAAC,CAAC,EAAE,KAAK,CAACY,GAAGC,KAAMD,GAAE,CAAC,EAAIC,GAAE,CAAC,CAAC,EAAE,CAAC,IAAM,KAAO,OAASC,EAAuB,CAAC,EAC7LxC,KACFqC,GAAiBrC,IAEnB,KACF,CACF,IAAK,mBACHqC,GAAiBlC,EACjB,KACJ,CAEF,GAAIH,IAAcqC,GAChB,MAAO,CACL,MAAO,CACL,UAAWA,EACb,CACF,CAEJ,CACA,MAAO,CAAC,CACV,CACF,CACF,EAEA,SAASM,GAAejB,EAAUkB,EAAM,CACtC,MAAO,CACL,IAAKlB,EAAS,IAAMkB,EAAK,OACzB,MAAOlB,EAAS,MAAQkB,EAAK,MAC7B,OAAQlB,EAAS,OAASkB,EAAK,OAC/B,KAAMlB,EAAS,KAAOkB,EAAK,KAC7B,CACF,CACA,SAASC,GAAsBnB,EAAU,CACvC,OAAOI,GAAM,KAAKhB,GAAQY,EAASZ,CAAI,GAAK,CAAC,CAC/C,CAMA,IAAMgC,GAAO,SAAUlD,EAAS,CAC9B,OAAIA,IAAY,SACdA,EAAU,CAAC,GAEN,CACL,KAAM,OACN,QAAAA,EACA,MAAM,GAAGC,EAAO,CACd,GAAM,CACJ,MAAAK,CACF,EAAIL,EACE,CACJ,SAAAkD,EAAW,kBACX,GAAGnC,CACL,EAAIC,GAASjB,EAASC,CAAK,EAC3B,OAAQkD,EAAU,CAChB,IAAK,kBACH,CACE,IAAMrB,EAAW,MAAMC,GAAe9B,EAAO,CAC3C,GAAGe,EACH,eAAgB,WAClB,CAAC,EACKoC,EAAUL,GAAejB,EAAUxB,EAAM,SAAS,EACxD,MAAO,CACL,KAAM,CACJ,uBAAwB8C,EACxB,gBAAiBH,GAAsBG,CAAO,CAChD,CACF,CACF,CACF,IAAK,UACH,CACE,IAAMtB,EAAW,MAAMC,GAAe9B,EAAO,CAC3C,GAAGe,EACH,YAAa,EACf,CAAC,EACKoC,EAAUL,GAAejB,EAAUxB,EAAM,QAAQ,EACvD,MAAO,CACL,KAAM,CACJ,eAAgB8C,EAChB,QAASH,GAAsBG,CAAO,CACxC,CACF,CACF,CACF,QAEI,MAAO,CAAC,CAEd,CACF,CACF,CACF,EAqIA,IAAMC,GAA2B,IAAI,IAAI,CAAC,OAAQ,KAAK,CAAC,EAKxD,eAAeC,GAAqBC,EAAOC,EAAS,CAClD,GAAM,CACJ,UAAAC,EACA,SAAAC,EACA,SAAAC,CACF,EAAIJ,EACEK,EAAM,MAAOF,EAAS,OAAS,KAAO,OAASA,EAAS,MAAMC,EAAS,QAAQ,GAC/EE,EAAOC,GAAQL,CAAS,EACxBM,EAAYC,GAAaP,CAAS,EAClCQ,EAAaC,GAAYT,CAAS,IAAM,IACxCU,EAAgBd,GAAY,IAAIQ,CAAI,EAAI,GAAK,EAC7CO,EAAiBR,GAAOK,EAAa,GAAK,EAC1CI,EAAWC,GAASd,EAASD,CAAK,EAGpC,CACF,SAAAgB,EACA,UAAAC,EACA,cAAAC,CACF,EAAI,OAAOJ,GAAa,SAAW,CACjC,SAAUA,EACV,UAAW,EACX,cAAe,IACjB,EAAI,CACF,SAAUA,EAAS,UAAY,EAC/B,UAAWA,EAAS,WAAa,EACjC,cAAeA,EAAS,aAC1B,EACA,OAAIN,GAAa,OAAOU,GAAkB,WACxCD,EAAYT,IAAc,MAAQU,EAAgB,GAAKA,GAElDR,EAAa,CAClB,EAAGO,EAAYJ,EACf,EAAGG,EAAWJ,CAChB,EAAI,CACF,EAAGI,EAAWJ,EACd,EAAGK,EAAYJ,CACjB,CACF,CASA,IAAMM,GAAS,SAAUlB,EAAS,CAChC,OAAIA,IAAY,SACdA,EAAU,GAEL,CACL,KAAM,SACN,QAAAA,EACA,MAAM,GAAGD,EAAO,CACd,IAAIoB,EAAuBC,EAC3B,GAAM,CACJ,EAAAC,EACA,EAAAC,EACA,UAAArB,EACA,eAAAsB,CACF,EAAIxB,EACEyB,EAAa,MAAM1B,GAAqBC,EAAOC,CAAO,EAI5D,OAAIC,MAAgBkB,EAAwBI,EAAe,SAAW,KAAO,OAASJ,EAAsB,aAAeC,EAAwBG,EAAe,QAAU,MAAQH,EAAsB,gBACjM,CAAC,EAEH,CACL,EAAGC,EAAIG,EAAW,EAClB,EAAGF,EAAIE,EAAW,EAClB,KAAM,CACJ,GAAGA,EACH,UAAAvB,CACF,CACF,CACF,CACF,CACF,EAOMwB,GAAQ,SAAUzB,EAAS,CAC/B,OAAIA,IAAY,SACdA,EAAU,CAAC,GAEN,CACL,KAAM,QACN,QAAAA,EACA,MAAM,GAAGD,EAAO,CACd,GAAM,CACJ,EAAAsB,EACA,EAAAC,EACA,UAAArB,CACF,EAAIF,EACE,CACJ,SAAU2B,EAAgB,GAC1B,UAAWC,EAAiB,GAC5B,QAAAC,EAAU,CACR,GAAIC,GAAQ,CACV,GAAI,CACF,EAAAR,EACA,EAAAC,CACF,EAAIO,EACJ,MAAO,CACL,EAAAR,EACA,EAAAC,CACF,CACF,CACF,EACA,GAAGQ,CACL,EAAIhB,GAASd,EAASD,CAAK,EACrBgC,EAAS,CACb,EAAAV,EACA,EAAAC,CACF,EACMU,EAAW,MAAMC,GAAelC,EAAO+B,CAAqB,EAC5Dd,EAAYN,GAAYJ,GAAQL,CAAS,CAAC,EAC1Cc,EAAWmB,GAAgBlB,CAAS,EACtCmB,EAAgBJ,EAAOhB,CAAQ,EAC/BqB,EAAiBL,EAAOf,CAAS,EACrC,GAAIU,EAAe,CACjB,IAAMW,EAAUtB,IAAa,IAAM,MAAQ,OACrCuB,EAAUvB,IAAa,IAAM,SAAW,QACxCwB,EAAMJ,EAAgBH,EAASK,CAAO,EACtCG,EAAML,EAAgBH,EAASM,CAAO,EAC5CH,EAAgBM,GAAMF,EAAKJ,EAAeK,CAAG,CAC/C,CACA,GAAIb,EAAgB,CAClB,IAAMU,EAAUrB,IAAc,IAAM,MAAQ,OACtCsB,EAAUtB,IAAc,IAAM,SAAW,QACzCuB,EAAMH,EAAiBJ,EAASK,CAAO,EACvCG,EAAMJ,EAAiBJ,EAASM,CAAO,EAC7CF,EAAiBK,GAAMF,EAAKH,EAAgBI,CAAG,CACjD,CACA,IAAME,EAAgBd,EAAQ,GAAG,CAC/B,GAAG7B,EACH,CAACgB,CAAQ,EAAGoB,EACZ,CAACnB,CAAS,EAAGoB,CACf,CAAC,EACD,MAAO,CACL,GAAGM,EACH,KAAM,CACJ,EAAGA,EAAc,EAAIrB,EACrB,EAAGqB,EAAc,EAAIpB,EACrB,QAAS,CACP,CAACP,CAAQ,EAAGW,EACZ,CAACV,CAAS,EAAGW,CACf,CACF,CACF,CACF,CACF,CACF,EA4EA,IAAMgB,GAAO,SAAUC,EAAS,CAC9B,OAAIA,IAAY,SACdA,EAAU,CAAC,GAEN,CACL,KAAM,OACN,QAAAA,EACA,MAAM,GAAGC,EAAO,CACd,IAAIC,EAAuBC,EAC3B,GAAM,CACJ,UAAAC,EACA,MAAAC,EACA,SAAAC,EACA,SAAAC,CACF,EAAIN,EACE,CACJ,MAAAO,EAAQ,IAAM,CAAC,EACf,GAAGC,CACL,EAAIC,GAASV,EAASC,CAAK,EACrBU,EAAW,MAAMC,GAAeX,EAAOQ,CAAqB,EAC5DI,EAAOC,GAAQV,CAAS,EACxBW,EAAYC,GAAaZ,CAAS,EAClCa,EAAUC,GAAYd,CAAS,IAAM,IACrC,CACJ,MAAAe,EACA,OAAAC,CACF,EAAIf,EAAM,SACNgB,EACAC,EACAT,IAAS,OAASA,IAAS,UAC7BQ,EAAaR,EACbS,EAAYP,KAAgB,MAAOT,EAAS,OAAS,KAAO,OAASA,EAAS,MAAMC,EAAS,QAAQ,GAAM,QAAU,OAAS,OAAS,UAEvIe,EAAYT,EACZQ,EAAaN,IAAc,MAAQ,MAAQ,UAE7C,IAAMQ,EAAwBH,EAAST,EAAS,IAAMA,EAAS,OACzDa,EAAuBL,EAAQR,EAAS,KAAOA,EAAS,MACxDc,GAA0BC,GAAIN,EAAST,EAASU,CAAU,EAAGE,CAAqB,EAClFI,EAAyBD,GAAIP,EAAQR,EAASW,CAAS,EAAGE,CAAoB,EAC9EI,EAAU,CAAC3B,EAAM,eAAe,MAClC4B,EAAkBJ,GAClBK,EAAiBH,EAOrB,IANKzB,EAAwBD,EAAM,eAAe,QAAU,MAAQC,EAAsB,QAAQ,IAChG4B,EAAiBN,IAEdrB,EAAyBF,EAAM,eAAe,QAAU,MAAQE,EAAuB,QAAQ,IAClG0B,EAAkBN,GAEhBK,GAAW,CAACb,EAAW,CACzB,IAAMgB,EAAOC,GAAIrB,EAAS,KAAM,CAAC,EAC3BsB,GAAOD,GAAIrB,EAAS,MAAO,CAAC,EAC5BuB,EAAOF,GAAIrB,EAAS,IAAK,CAAC,EAC1BwB,EAAOH,GAAIrB,EAAS,OAAQ,CAAC,EAC/BM,EACFa,EAAiBX,EAAQ,GAAKY,IAAS,GAAKE,KAAS,EAAIF,EAAOE,GAAOD,GAAIrB,EAAS,KAAMA,EAAS,KAAK,GAExGkB,EAAkBT,EAAS,GAAKc,IAAS,GAAKC,IAAS,EAAID,EAAOC,EAAOH,GAAIrB,EAAS,IAAKA,EAAS,MAAM,EAE9G,CACA,MAAMH,EAAM,CACV,GAAGP,EACH,eAAA6B,EACA,gBAAAD,CACF,CAAC,EACD,IAAMO,EAAiB,MAAM9B,EAAS,cAAcC,EAAS,QAAQ,EACrE,OAAIY,IAAUiB,EAAe,OAAShB,IAAWgB,EAAe,OACvD,CACL,MAAO,CACL,MAAO,EACT,CACF,EAEK,CAAC,CACV,CACF,CACF,ECthCA,SAASC,IAAY,CACnB,OAAO,OAAO,QAAW,WAC3B,CACA,SAASC,GAAYC,EAAM,CACzB,OAAIC,GAAOD,CAAI,GACLA,EAAK,UAAY,IAAI,YAAY,EAKpC,WACT,CACA,SAASE,GAAUF,EAAM,CACvB,IAAIG,EACJ,OAAQH,GAAQ,OAASG,EAAsBH,EAAK,gBAAkB,KAAO,OAASG,EAAoB,cAAgB,MAC5H,CACA,SAASC,GAAmBJ,EAAM,CAChC,IAAIK,EACJ,OAAQA,GAAQJ,GAAOD,CAAI,EAAIA,EAAK,cAAgBA,EAAK,WAAa,OAAO,WAAa,KAAO,OAASK,EAAK,eACjH,CACA,SAASJ,GAAOK,EAAO,CACrB,OAAKR,GAAU,EAGRQ,aAAiB,MAAQA,aAAiBJ,GAAUI,CAAK,EAAE,KAFzD,EAGX,CACA,SAASC,GAAUD,EAAO,CACxB,OAAKR,GAAU,EAGRQ,aAAiB,SAAWA,aAAiBJ,GAAUI,CAAK,EAAE,QAF5D,EAGX,CACA,SAASE,GAAcF,EAAO,CAC5B,OAAKR,GAAU,EAGRQ,aAAiB,aAAeA,aAAiBJ,GAAUI,CAAK,EAAE,YAFhE,EAGX,CACA,SAASG,GAAaH,EAAO,CAC3B,MAAI,CAACR,GAAU,GAAK,OAAO,YAAe,YACjC,GAEFQ,aAAiB,YAAcA,aAAiBJ,GAAUI,CAAK,EAAE,UAC1E,CACA,IAAMI,GAA4C,IAAI,IAAI,CAAC,SAAU,UAAU,CAAC,EAChF,SAASC,GAAkBC,EAAS,CAClC,GAAM,CACJ,SAAAC,EACA,UAAAC,EACA,UAAAC,EACA,QAAAC,CACF,EAAIC,GAAiBL,CAAO,EAC5B,MAAO,kCAAkC,KAAKC,EAAWE,EAAYD,CAAS,GAAK,CAACJ,GAA6B,IAAIM,CAAO,CAC9H,CACA,IAAME,GAA6B,IAAI,IAAI,CAAC,QAAS,KAAM,IAAI,CAAC,EAChE,SAASC,GAAeP,EAAS,CAC/B,OAAOM,GAAc,IAAInB,GAAYa,CAAO,CAAC,CAC/C,CACA,IAAMQ,GAAoB,CAAC,gBAAiB,QAAQ,EACpD,SAASC,GAAWT,EAAS,CAC3B,OAAOQ,GAAkB,KAAKE,GAAY,CACxC,GAAI,CACF,OAAOV,EAAQ,QAAQU,CAAQ,CACjC,OAASC,EAAI,CACX,MAAO,EACT,CACF,CAAC,CACH,CACA,IAAMC,GAAsB,CAAC,YAAa,YAAa,QAAS,SAAU,aAAa,EACjFC,GAAmB,CAAC,YAAa,YAAa,QAAS,SAAU,cAAe,QAAQ,EACxFC,GAAgB,CAAC,QAAS,SAAU,SAAU,SAAS,EAC7D,SAASC,GAAkBC,EAAc,CACvC,IAAMC,EAASC,GAAS,EAClBC,EAAMxB,GAAUqB,CAAY,EAAIX,GAAiBW,CAAY,EAAIA,EAIvE,OAAOJ,GAAoB,KAAKlB,GAASyB,EAAIzB,CAAK,EAAIyB,EAAIzB,CAAK,IAAM,OAAS,EAAK,IAAMyB,EAAI,cAAgBA,EAAI,gBAAkB,SAAW,KAAU,CAACF,IAAWE,EAAI,eAAiBA,EAAI,iBAAmB,OAAS,KAAU,CAACF,IAAWE,EAAI,OAASA,EAAI,SAAW,OAAS,KAAUN,GAAiB,KAAKnB,IAAUyB,EAAI,YAAc,IAAI,SAASzB,CAAK,CAAC,GAAKoB,GAAc,KAAKpB,IAAUyB,EAAI,SAAW,IAAI,SAASzB,CAAK,CAAC,CACza,CACA,SAAS0B,GAAmBpB,EAAS,CACnC,IAAIqB,EAAcC,GAActB,CAAO,EACvC,KAAOJ,GAAcyB,CAAW,GAAK,CAACE,GAAsBF,CAAW,GAAG,CACxE,GAAIN,GAAkBM,CAAW,EAC/B,OAAOA,EACF,GAAIZ,GAAWY,CAAW,EAC/B,OAAO,KAETA,EAAcC,GAAcD,CAAW,CACzC,CACA,OAAO,IACT,CACA,SAASH,IAAW,CAClB,OAAI,OAAO,KAAQ,aAAe,CAAC,IAAI,SAAiB,GACjD,IAAI,SAAS,0BAA2B,MAAM,CACvD,CACA,IAAMM,GAAwC,IAAI,IAAI,CAAC,OAAQ,OAAQ,WAAW,CAAC,EACnF,SAASD,GAAsBnC,EAAM,CACnC,OAAOoC,GAAyB,IAAIrC,GAAYC,CAAI,CAAC,CACvD,CACA,SAASiB,GAAiBL,EAAS,CACjC,OAAOV,GAAUU,CAAO,EAAE,iBAAiBA,CAAO,CACpD,CACA,SAASyB,GAAczB,EAAS,CAC9B,OAAIL,GAAUK,CAAO,EACZ,CACL,WAAYA,EAAQ,WACpB,UAAWA,EAAQ,SACrB,EAEK,CACL,WAAYA,EAAQ,QACpB,UAAWA,EAAQ,OACrB,CACF,CACA,SAASsB,GAAclC,EAAM,CAC3B,GAAID,GAAYC,CAAI,IAAM,OACxB,OAAOA,EAET,IAAMsC,EAENtC,EAAK,cAELA,EAAK,YAELS,GAAaT,CAAI,GAAKA,EAAK,MAE3BI,GAAmBJ,CAAI,EACvB,OAAOS,GAAa6B,CAAM,EAAIA,EAAO,KAAOA,CAC9C,CACA,SAASC,GAA2BvC,EAAM,CACxC,IAAMwC,EAAaN,GAAclC,CAAI,EACrC,OAAImC,GAAsBK,CAAU,EAC3BxC,EAAK,cAAgBA,EAAK,cAAc,KAAOA,EAAK,KAEzDQ,GAAcgC,CAAU,GAAK7B,GAAkB6B,CAAU,EACpDA,EAEFD,GAA2BC,CAAU,CAC9C,CACA,SAASC,GAAqBzC,EAAM0C,EAAMC,EAAiB,CACzD,IAAIC,EACAF,IAAS,SACXA,EAAO,CAAC,GAENC,IAAoB,SACtBA,EAAkB,IAEpB,IAAME,EAAqBN,GAA2BvC,CAAI,EACpD8C,EAASD,MAAyBD,EAAuB5C,EAAK,gBAAkB,KAAO,OAAS4C,EAAqB,MACrHG,EAAM7C,GAAU2C,CAAkB,EACxC,GAAIC,EAAQ,CACV,IAAME,EAAeC,GAAgBF,CAAG,EACxC,OAAOL,EAAK,OAAOK,EAAKA,EAAI,gBAAkB,CAAC,EAAGpC,GAAkBkC,CAAkB,EAAIA,EAAqB,CAAC,EAAGG,GAAgBL,EAAkBF,GAAqBO,CAAY,EAAI,CAAC,CAAC,CAC9L,CACA,OAAON,EAAK,OAAOG,EAAoBJ,GAAqBI,EAAoB,CAAC,EAAGF,CAAe,CAAC,CACtG,CACA,SAASM,GAAgBF,EAAK,CAC5B,OAAOA,EAAI,QAAU,OAAO,eAAeA,EAAI,MAAM,EAAIA,EAAI,aAAe,IAC9E,CCzJA,SAASG,GAAiBC,EAAS,CACjC,IAAMC,EAAMC,GAAiBF,CAAO,EAGhCG,EAAQ,WAAWF,EAAI,KAAK,GAAK,EACjCG,EAAS,WAAWH,EAAI,MAAM,GAAK,EACjCI,EAAYC,GAAcN,CAAO,EACjCO,EAAcF,EAAYL,EAAQ,YAAcG,EAChDK,EAAeH,EAAYL,EAAQ,aAAeI,EAClDK,EAAiBC,GAAMP,CAAK,IAAMI,GAAeG,GAAMN,CAAM,IAAMI,EACzE,OAAIC,IACFN,EAAQI,EACRH,EAASI,GAEJ,CACL,MAAAL,EACA,OAAAC,EACA,EAAGK,CACL,CACF,CAEA,SAASE,GAAcX,EAAS,CAC9B,OAAQY,GAAUZ,CAAO,EAA6BA,EAAzBA,EAAQ,cACvC,CAEA,SAASa,GAASb,EAAS,CACzB,IAAMc,EAAaH,GAAcX,CAAO,EACxC,GAAI,CAACM,GAAcQ,CAAU,EAC3B,OAAOC,GAAa,CAAC,EAEvB,IAAMC,EAAOF,EAAW,sBAAsB,EACxC,CACJ,MAAAX,EACA,OAAAC,EACA,EAAAa,CACF,EAAIlB,GAAiBe,CAAU,EAC3BI,GAAKD,EAAIP,GAAMM,EAAK,KAAK,EAAIA,EAAK,OAASb,EAC3CgB,GAAKF,EAAIP,GAAMM,EAAK,MAAM,EAAIA,EAAK,QAAUZ,EAIjD,OAAI,CAACc,GAAK,CAAC,OAAO,SAASA,CAAC,KAC1BA,EAAI,IAEF,CAACC,GAAK,CAAC,OAAO,SAASA,CAAC,KAC1BA,EAAI,GAEC,CACL,EAAAD,EACA,EAAAC,CACF,CACF,CAEA,IAAMC,GAAyBL,GAAa,CAAC,EAC7C,SAASM,GAAiBrB,EAAS,CACjC,IAAMsB,EAAMC,GAAUvB,CAAO,EAC7B,MAAI,CAACwB,GAAS,GAAK,CAACF,EAAI,eACfF,GAEF,CACL,EAAGE,EAAI,eAAe,WACtB,EAAGA,EAAI,eAAe,SACxB,CACF,CACA,SAASG,GAAuBzB,EAAS0B,EAASC,EAAsB,CAItE,OAHID,IAAY,SACdA,EAAU,IAER,CAACC,GAAwBD,GAAWC,IAAyBJ,GAAUvB,CAAO,EACzE,GAEF0B,CACT,CAEA,SAASE,GAAsB5B,EAAS6B,EAAcC,EAAiBC,EAAc,CAC/EF,IAAiB,SACnBA,EAAe,IAEbC,IAAoB,SACtBA,EAAkB,IAEpB,IAAME,EAAahC,EAAQ,sBAAsB,EAC3Cc,EAAaH,GAAcX,CAAO,EACpCiC,EAAQlB,GAAa,CAAC,EACtBc,IACEE,EACEnB,GAAUmB,CAAY,IACxBE,EAAQpB,GAASkB,CAAY,GAG/BE,EAAQpB,GAASb,CAAO,GAG5B,IAAMkC,EAAgBT,GAAuBX,EAAYgB,EAAiBC,CAAY,EAAIV,GAAiBP,CAAU,EAAIC,GAAa,CAAC,EACnIG,GAAKc,EAAW,KAAOE,EAAc,GAAKD,EAAM,EAChDd,GAAKa,EAAW,IAAME,EAAc,GAAKD,EAAM,EAC/C9B,EAAQ6B,EAAW,MAAQC,EAAM,EACjC7B,EAAS4B,EAAW,OAASC,EAAM,EACvC,GAAInB,EAAY,CACd,IAAMQ,EAAMC,GAAUT,CAAU,EAC1BqB,EAAYJ,GAAgBnB,GAAUmB,CAAY,EAAIR,GAAUQ,CAAY,EAAIA,EAClFK,EAAad,EACbe,EAAgBC,GAAgBF,CAAU,EAC9C,KAAOC,GAAiBN,GAAgBI,IAAcC,GAAY,CAChE,IAAMG,EAAc1B,GAASwB,CAAa,EACpCG,EAAaH,EAAc,sBAAsB,EACjDpC,EAAMC,GAAiBmC,CAAa,EACpCI,EAAOD,EAAW,MAAQH,EAAc,WAAa,WAAWpC,EAAI,WAAW,GAAKsC,EAAY,EAChGG,GAAMF,EAAW,KAAOH,EAAc,UAAY,WAAWpC,EAAI,UAAU,GAAKsC,EAAY,EAClGrB,GAAKqB,EAAY,EACjBpB,GAAKoB,EAAY,EACjBpC,GAASoC,EAAY,EACrBnC,GAAUmC,EAAY,EACtBrB,GAAKuB,EACLtB,GAAKuB,GACLN,EAAab,GAAUc,CAAa,EACpCA,EAAgBC,GAAgBF,CAAU,CAC5C,CACF,CACA,OAAOO,GAAiB,CACtB,MAAAxC,EACA,OAAAC,EACA,EAAAc,EACA,EAAAC,CACF,CAAC,CACH,CAIA,SAASyB,GAAoB5C,EAASgB,EAAM,CAC1C,IAAM6B,EAAaC,GAAc9C,CAAO,EAAE,WAC1C,OAAKgB,EAGEA,EAAK,KAAO6B,EAFVjB,GAAsBmB,GAAmB/C,CAAO,CAAC,EAAE,KAAO6C,CAGrE,CAEA,SAASG,GAAcC,EAAiBC,EAAQC,EAAkB,CAC5DA,IAAqB,SACvBA,EAAmB,IAErB,IAAMC,EAAWH,EAAgB,sBAAsB,EACjD/B,EAAIkC,EAAS,KAAOF,EAAO,YAAcC,EAAmB,EAElEP,GAAoBK,EAAiBG,CAAQ,GACvCjC,EAAIiC,EAAS,IAAMF,EAAO,UAChC,MAAO,CACL,EAAAhC,EACA,EAAAC,CACF,CACF,CAEA,SAASkC,GAAsDC,EAAM,CACnE,GAAI,CACF,SAAAC,EACA,KAAAvC,EACA,aAAAe,EACA,SAAAyB,CACF,EAAIF,EACE5B,EAAU8B,IAAa,QACvBP,EAAkBF,GAAmBhB,CAAY,EACjD0B,EAAWF,EAAWG,GAAWH,EAAS,QAAQ,EAAI,GAC5D,GAAIxB,IAAiBkB,GAAmBQ,GAAY/B,EAClD,OAAOV,EAET,IAAIkC,EAAS,CACX,WAAY,EACZ,UAAW,CACb,EACIjB,EAAQlB,GAAa,CAAC,EACpB4C,EAAU5C,GAAa,CAAC,EACxB6C,EAA0BtD,GAAcyB,CAAY,EAC1D,IAAI6B,GAA2B,CAACA,GAA2B,CAAClC,MACtDmC,GAAY9B,CAAY,IAAM,QAAU+B,GAAkBb,CAAe,KAC3EC,EAASJ,GAAcf,CAAY,GAEjCzB,GAAcyB,CAAY,GAAG,CAC/B,IAAMgC,EAAanC,GAAsBG,CAAY,EACrDE,EAAQpB,GAASkB,CAAY,EAC7B4B,EAAQ,EAAII,EAAW,EAAIhC,EAAa,WACxC4B,EAAQ,EAAII,EAAW,EAAIhC,EAAa,SAC1C,CAEF,IAAMiC,EAAaf,GAAmB,CAACW,GAA2B,CAAClC,EAAUsB,GAAcC,EAAiBC,EAAQ,EAAI,EAAInC,GAAa,CAAC,EAC1I,MAAO,CACL,MAAOC,EAAK,MAAQiB,EAAM,EAC1B,OAAQjB,EAAK,OAASiB,EAAM,EAC5B,EAAGjB,EAAK,EAAIiB,EAAM,EAAIiB,EAAO,WAAajB,EAAM,EAAI0B,EAAQ,EAAIK,EAAW,EAC3E,EAAGhD,EAAK,EAAIiB,EAAM,EAAIiB,EAAO,UAAYjB,EAAM,EAAI0B,EAAQ,EAAIK,EAAW,CAC5E,CACF,CAEA,SAASC,GAAejE,EAAS,CAC/B,OAAO,MAAM,KAAKA,EAAQ,eAAe,CAAC,CAC5C,CAIA,SAASkE,GAAgBlE,EAAS,CAChC,IAAMmE,EAAOpB,GAAmB/C,CAAO,EACjCkD,EAASJ,GAAc9C,CAAO,EAC9BoE,EAAOpE,EAAQ,cAAc,KAC7BG,EAAQkE,GAAIF,EAAK,YAAaA,EAAK,YAAaC,EAAK,YAAaA,EAAK,WAAW,EAClFhE,EAASiE,GAAIF,EAAK,aAAcA,EAAK,aAAcC,EAAK,aAAcA,EAAK,YAAY,EACzFlD,EAAI,CAACgC,EAAO,WAAaN,GAAoB5C,CAAO,EAClDmB,EAAI,CAAC+B,EAAO,UAClB,OAAIhD,GAAiBkE,CAAI,EAAE,YAAc,QACvClD,GAAKmD,GAAIF,EAAK,YAAaC,EAAK,WAAW,EAAIjE,GAE1C,CACL,MAAAA,EACA,OAAAC,EACA,EAAAc,EACA,EAAAC,CACF,CACF,CAEA,SAASmD,GAAgBtE,EAASwD,EAAU,CAC1C,IAAMlC,EAAMC,GAAUvB,CAAO,EACvBmE,EAAOpB,GAAmB/C,CAAO,EACjCuE,EAAiBjD,EAAI,eACvBnB,EAAQgE,EAAK,YACb/D,EAAS+D,EAAK,aACdjD,EAAI,EACJC,EAAI,EACR,GAAIoD,EAAgB,CAClBpE,EAAQoE,EAAe,MACvBnE,EAASmE,EAAe,OACxB,IAAMC,EAAsBhD,GAAS,GACjC,CAACgD,GAAuBA,GAAuBhB,IAAa,WAC9DtC,EAAIqD,EAAe,WACnBpD,EAAIoD,EAAe,UAEvB,CACA,MAAO,CACL,MAAApE,EACA,OAAAC,EACA,EAAAc,EACA,EAAAC,CACF,CACF,CAGA,SAASsD,GAA2BzE,EAASwD,EAAU,CACrD,IAAMxB,EAAaJ,GAAsB5B,EAAS,GAAMwD,IAAa,OAAO,EACtEd,EAAMV,EAAW,IAAMhC,EAAQ,UAC/ByC,EAAOT,EAAW,KAAOhC,EAAQ,WACjCiC,EAAQ3B,GAAcN,CAAO,EAAIa,GAASb,CAAO,EAAIe,GAAa,CAAC,EACnEZ,EAAQH,EAAQ,YAAciC,EAAM,EACpC7B,EAASJ,EAAQ,aAAeiC,EAAM,EACtCf,EAAIuB,EAAOR,EAAM,EACjBd,EAAIuB,EAAMT,EAAM,EACtB,MAAO,CACL,MAAA9B,EACA,OAAAC,EACA,EAAAc,EACA,EAAAC,CACF,CACF,CACA,SAASuD,GAAkC1E,EAAS2E,EAAkBnB,EAAU,CAC9E,IAAIxC,EACJ,GAAI2D,IAAqB,WACvB3D,EAAOsD,GAAgBtE,EAASwD,CAAQ,UAC/BmB,IAAqB,WAC9B3D,EAAOkD,GAAgBnB,GAAmB/C,CAAO,CAAC,UACzCY,GAAU+D,CAAgB,EACnC3D,EAAOyD,GAA2BE,EAAkBnB,CAAQ,MACvD,CACL,IAAMtB,EAAgBb,GAAiBrB,CAAO,EAC9CgB,EAAO,CACL,EAAG2D,EAAiB,EAAIzC,EAAc,EACtC,EAAGyC,EAAiB,EAAIzC,EAAc,EACtC,MAAOyC,EAAiB,MACxB,OAAQA,EAAiB,MAC3B,CACF,CACA,OAAOhC,GAAiB3B,CAAI,CAC9B,CACA,SAAS4D,GAAyB5E,EAAS6E,EAAU,CACnD,IAAMC,EAAaC,GAAc/E,CAAO,EACxC,OAAI8E,IAAeD,GAAY,CAACjE,GAAUkE,CAAU,GAAKE,GAAsBF,CAAU,EAChF,GAEF5E,GAAiB4E,CAAU,EAAE,WAAa,SAAWF,GAAyBE,EAAYD,CAAQ,CAC3G,CAKA,SAASI,GAA4BjF,EAASkF,EAAO,CACnD,IAAMC,EAAeD,EAAM,IAAIlF,CAAO,EACtC,GAAImF,EACF,OAAOA,EAET,IAAIC,EAASC,GAAqBrF,EAAS,CAAC,EAAG,EAAK,EAAE,OAAOsF,GAAM1E,GAAU0E,CAAE,GAAKzB,GAAYyB,CAAE,IAAM,MAAM,EAC1GC,EAAsC,KACpCC,EAAiBtF,GAAiBF,CAAO,EAAE,WAAa,QAC1DyF,EAAcD,EAAiBT,GAAc/E,CAAO,EAAIA,EAG5D,KAAOY,GAAU6E,CAAW,GAAK,CAACT,GAAsBS,CAAW,GAAG,CACpE,IAAMC,EAAgBxF,GAAiBuF,CAAW,EAC5CE,EAA0BC,GAAkBH,CAAW,EACzD,CAACE,GAA2BD,EAAc,WAAa,UACzDH,EAAsC,OAEVC,EAAiB,CAACG,GAA2B,CAACJ,EAAsC,CAACI,GAA2BD,EAAc,WAAa,UAAY,CAAC,CAACH,GAAuC,CAAC,WAAY,OAAO,EAAE,SAASA,EAAoC,QAAQ,GAAKzB,GAAkB2B,CAAW,GAAK,CAACE,GAA2Bf,GAAyB5E,EAASyF,CAAW,GAGvZL,EAASA,EAAO,OAAOS,GAAYA,IAAaJ,CAAW,EAG3DF,EAAsCG,EAExCD,EAAcV,GAAcU,CAAW,CACzC,CACA,OAAAP,EAAM,IAAIlF,EAASoF,CAAM,EAClBA,CACT,CAIA,SAASU,GAAgBxC,EAAM,CAC7B,GAAI,CACF,QAAAtD,EACA,SAAA+F,EACA,aAAAC,EACA,SAAAxC,CACF,EAAIF,EAEE2C,EAAoB,CAAC,GADMF,IAAa,oBAAsBrC,GAAW1D,CAAO,EAAI,CAAC,EAAIiF,GAA4BjF,EAAS,KAAK,EAAE,EAAI,CAAC,EAAE,OAAO+F,CAAQ,EACzGC,CAAY,EAC9DE,EAAwBD,EAAkB,CAAC,EAC3CE,EAAeF,EAAkB,OAAO,CAACG,EAASzB,IAAqB,CAC3E,IAAM3D,EAAO0D,GAAkC1E,EAAS2E,EAAkBnB,CAAQ,EAClF,OAAA4C,EAAQ,IAAM/B,GAAIrD,EAAK,IAAKoF,EAAQ,GAAG,EACvCA,EAAQ,MAAQC,GAAIrF,EAAK,MAAOoF,EAAQ,KAAK,EAC7CA,EAAQ,OAASC,GAAIrF,EAAK,OAAQoF,EAAQ,MAAM,EAChDA,EAAQ,KAAO/B,GAAIrD,EAAK,KAAMoF,EAAQ,IAAI,EACnCA,CACT,EAAG1B,GAAkC1E,EAASkG,EAAuB1C,CAAQ,CAAC,EAC9E,MAAO,CACL,MAAO2C,EAAa,MAAQA,EAAa,KACzC,OAAQA,EAAa,OAASA,EAAa,IAC3C,EAAGA,EAAa,KAChB,EAAGA,EAAa,GAClB,CACF,CAEA,SAASG,GAActG,EAAS,CAC9B,GAAM,CACJ,MAAAG,EACA,OAAAC,CACF,EAAIL,GAAiBC,CAAO,EAC5B,MAAO,CACL,MAAAG,EACA,OAAAC,CACF,CACF,CAEA,SAASmG,GAA8BvG,EAAS+B,EAAcyB,EAAU,CACtE,IAAMI,EAA0BtD,GAAcyB,CAAY,EACpDkB,EAAkBF,GAAmBhB,CAAY,EACjDL,EAAU8B,IAAa,QACvBxC,EAAOY,GAAsB5B,EAAS,GAAM0B,EAASK,CAAY,EACnEmB,EAAS,CACX,WAAY,EACZ,UAAW,CACb,EACMS,EAAU5C,GAAa,CAAC,EAC9B,GAAI6C,GAA2B,CAACA,GAA2B,CAAClC,EAI1D,IAHImC,GAAY9B,CAAY,IAAM,QAAU+B,GAAkBb,CAAe,KAC3EC,EAASJ,GAAcf,CAAY,GAEjC6B,EAAyB,CAC3B,IAAMG,EAAanC,GAAsBG,EAAc,GAAML,EAASK,CAAY,EAClF4B,EAAQ,EAAII,EAAW,EAAIhC,EAAa,WACxC4B,EAAQ,EAAII,EAAW,EAAIhC,EAAa,SAC1C,MAAWkB,IAGTU,EAAQ,EAAIf,GAAoBK,CAAe,GAGnD,IAAMe,EAAaf,GAAmB,CAACW,GAA2B,CAAClC,EAAUsB,GAAcC,EAAiBC,CAAM,EAAInC,GAAa,CAAC,EAC9HG,EAAIF,EAAK,KAAOkC,EAAO,WAAaS,EAAQ,EAAIK,EAAW,EAC3D7C,EAAIH,EAAK,IAAMkC,EAAO,UAAYS,EAAQ,EAAIK,EAAW,EAC/D,MAAO,CACL,EAAA9C,EACA,EAAAC,EACA,MAAOH,EAAK,MACZ,OAAQA,EAAK,MACf,CACF,CAEA,SAASwF,GAAmBxG,EAAS,CACnC,OAAOE,GAAiBF,CAAO,EAAE,WAAa,QAChD,CAEA,SAASyG,GAAoBzG,EAAS0G,EAAU,CAC9C,GAAI,CAACpG,GAAcN,CAAO,GAAKE,GAAiBF,CAAO,EAAE,WAAa,QACpE,OAAO,KAET,GAAI0G,EACF,OAAOA,EAAS1G,CAAO,EAEzB,IAAI2G,EAAkB3G,EAAQ,aAM9B,OAAI+C,GAAmB/C,CAAO,IAAM2G,IAClCA,EAAkBA,EAAgB,cAAc,MAE3CA,CACT,CAIA,SAASC,GAAgB5G,EAAS0G,EAAU,CAC1C,IAAMpF,EAAMC,GAAUvB,CAAO,EAC7B,GAAI0D,GAAW1D,CAAO,EACpB,OAAOsB,EAET,GAAI,CAAChB,GAAcN,CAAO,EAAG,CAC3B,IAAI6G,EAAkB9B,GAAc/E,CAAO,EAC3C,KAAO6G,GAAmB,CAAC7B,GAAsB6B,CAAe,GAAG,CACjE,GAAIjG,GAAUiG,CAAe,GAAK,CAACL,GAAmBK,CAAe,EACnE,OAAOA,EAETA,EAAkB9B,GAAc8B,CAAe,CACjD,CACA,OAAOvF,CACT,CACA,IAAIS,EAAe0E,GAAoBzG,EAAS0G,CAAQ,EACxD,KAAO3E,GAAgB+E,GAAe/E,CAAY,GAAKyE,GAAmBzE,CAAY,GACpFA,EAAe0E,GAAoB1E,EAAc2E,CAAQ,EAE3D,OAAI3E,GAAgBiD,GAAsBjD,CAAY,GAAKyE,GAAmBzE,CAAY,GAAK,CAAC6D,GAAkB7D,CAAY,EACrHT,EAEFS,GAAgBgF,GAAmB/G,CAAO,GAAKsB,CACxD,CAEA,IAAM0F,GAAkB,eAAgBC,EAAM,CAC5C,IAAMC,EAAoB,KAAK,iBAAmBN,GAC5CO,EAAkB,KAAK,cACvBC,EAAqB,MAAMD,EAAgBF,EAAK,QAAQ,EAC9D,MAAO,CACL,UAAWV,GAA8BU,EAAK,UAAW,MAAMC,EAAkBD,EAAK,QAAQ,EAAGA,EAAK,QAAQ,EAC9G,SAAU,CACR,EAAG,EACH,EAAG,EACH,MAAOG,EAAmB,MAC1B,OAAQA,EAAmB,MAC7B,CACF,CACF,EAEA,SAASC,GAAMrH,EAAS,CACtB,OAAOE,GAAiBF,CAAO,EAAE,YAAc,KACjD,CAEA,IAAMsH,GAAW,CACf,sDAAAjE,GACA,mBAAAN,GACA,gBAAA+C,GACA,gBAAAc,GACA,gBAAAI,GACA,eAAA/C,GACA,cAAAqC,GACA,SAAAzF,GACA,UAAAD,GACA,MAAAyG,EACF,EA8LA,IAAME,GAASA,GAef,IAAMC,GAAQA,GAQRC,GAAOA,GAQPC,GAAOA,GAOPC,GAAOA,GAOPC,GAAQA,GAkBd,IAAMC,GAAkB,CAACC,EAAWC,EAAUC,IAAY,CAIxD,IAAMC,EAAQ,IAAI,IACZC,EAAgB,CACpB,SAAAC,GACA,GAAGH,CACL,EACMI,EAAoB,CACxB,GAAGF,EAAc,SACjB,GAAID,CACN,EACA,OAAOJ,GAAkBC,EAAWC,EAAU,CAC5C,GAAGG,EACH,SAAUE,CACZ,CAAC,CACH,EC5uBA,IAAMC,GAAY,YACZC,GAAM,MACNC,GAAU,UACVC,GAAc,cACdC,GAAQ,QACRC,GAAY,YACZC,GAAe,eACfC,GAAS,SACTC,GAAa,aACbC,GAAa,aACbC,GAAO,OACPC,GAAW,WACJC,GAAa,CACtBZ,GACAC,GACAC,GACAC,GACAC,GACAC,GACAC,GACAC,GACAC,GACAC,GACAC,GACAC,EACJ,EACaE,GAAY,CACrB,CAACb,EAAS,EAAGM,GACb,CAACL,EAAG,EAAGM,GACP,CAACL,EAAO,EAAGM,GACX,CAACF,EAAY,EAAGN,GAChB,CAACO,EAAM,EAAGN,GACV,CAACO,EAAU,EAAGN,GACd,CAACO,EAAU,EAAGN,GACd,CAACO,EAAI,EAAGN,GACR,CAACO,EAAQ,EAAGN,GACZ,CAACF,EAAW,EAAGM,GACf,CAACL,EAAK,EAAGM,GACT,CAACL,EAAS,EAAGM,EACjB,EACMG,GAAW,CACb,CAACL,EAAU,EAAG,IACd,CAACC,EAAI,EAAG,IACR,CAACC,EAAQ,EAAG,IACZ,CAACX,EAAS,EAAG,GACb,CAACC,EAAG,EAAG,GACP,CAACC,EAAO,EAAG,GACX,CAACC,EAAW,EAAG,IACf,CAACC,EAAK,EAAG,IACT,CAACC,EAAS,EAAG,IACb,CAACC,EAAY,EAAG,KAChB,CAACC,EAAM,EAAG,KACV,CAACC,EAAU,EAAG,IAClB,EACaO,GAA2BC,GAAQ,CAC5C,IAAIC,EACJ,MAAI,IAAI,KAAKD,CAAG,EACZC,EAAYD,EACP,MAAM,GAAG,EACT,IAAKE,GAAMA,EAAE,OAAO,CAAC,EAAE,YAAY,EAAIA,EAAE,MAAM,CAAC,CAAC,EACjD,KAAK,EAAE,EAGZD,EAAaD,EAAI,OAAO,CAAC,EAAE,YAAY,EAAIA,EAAI,MAAM,CAAC,EAEnDC,CACX,EACME,GAAQH,GAAQA,EAAI,MAAM,GAAG,EAAE,CAAC,EAChCI,GAAcJ,GAAQH,GAAUM,GAAKH,CAAG,CAAC,EACzCK,GAAkBL,GAAQH,GAAUG,CAAG,EACvCM,GAAiBN,GAAQF,GAASO,GAAeL,CAAG,CAAC,EACrDO,GAAmB,CAACC,EAASF,EAAeN,IAAQ,CACtD,OAAO,OAAOQ,GAAA,YAAAA,EAAS,MAAO,CAC1B,oBAAqB,MACrB,OAAQ,EAER,CAAC,SAAST,GAAwBK,GAAWJ,CAAG,CAAC,CAAC,EAAE,EAAG,SACvD,UAAW,UAAUM,CAAa,MACtC,CAAC,CACL,EACMG,GAAkB,EAClBC,GAAe,GACrB,eAAsBC,GAAaC,EAAO,CAnF1C,IAAAC,EAAAC,EAAAC,EAyFI,GALI,EAACH,GAAA,MAAAA,EAAO,aAERA,GAAA,MAAAA,EAAO,YACP,MAAMA,GAAA,YAAAA,EAAO,cAEb,EAACA,GAAA,MAAAA,EAAO,WAAY,EAACA,GAAA,MAAAA,EAAO,cAC5B,OACJ,IAAII,EAAWJ,GAAA,YAAAA,EAAO,SAChBK,EAAcL,EAAM,YAC1B,OAAAM,GAAgBF,EAAUC,EAAa,CACnC,WAAWJ,EAAAD,GAAA,YAAAA,EAAO,gBAAP,KAAAC,EAAwBtB,GACnC,WAAY,CACR4B,GAAO,CAAE,UAAUL,EAAAF,GAAA,YAAAA,EAAO,WAAP,KAAAE,EAAmB,EAAG,WAAWC,EAAAH,GAAA,YAAAA,EAAO,WAAP,KAAAG,EAAmB,CAAE,CAAC,GAC1EH,GAAA,YAAAA,EAAO,OACHQ,GAAK,CAED,UAAWR,GAAA,YAAAA,EAAO,UAClB,mBAAoBA,GAAA,YAAAA,EAAO,kBAC/B,CAAC,GACLA,GAAA,YAAAA,EAAO,OAAQS,GAAM,CAAE,UAAW,EAAK,CAAC,EACxC,EAACT,GAAA,MAAAA,EAAO,WAAWA,GAAA,YAAAA,EAAO,UAAWU,GAAM,CAAE,QAASV,GAAA,YAAAA,EAAO,OAAQ,CAAC,EACtEW,GAAK,EACLC,GAAK,CACD,OAAQ,CAEJ,OAAO,OAAOP,EAAY,MAAO,CAC7B,aAAc,GAAGR,EAAe,KAChC,YAAa,GAAGA,EAAe,IACnC,CAAC,CACL,CACJ,CAAC,CACL,CACJ,CAAC,EAAE,KAAK,CAAC,CAAE,EAAAgB,EAAG,EAAAC,EAAG,eAAAC,EAAgB,UAAAC,CAAU,IAAM,CAW7C,GAVAhB,EAAM,gBAAkBgB,EAGnBhB,GAAA,MAAAA,EAAO,WACR,OAAO,OAAOK,EAAY,MAAO,CAC7B,KAAM,GAAGQ,CAAC,KACV,IAAK,GAAGC,CAAC,IACb,CAAC,EAGDC,GAAA,MAAAA,EAAgB,MAAQ,EAACf,GAAA,MAAAA,EAAO,WAAW,CAC3C,GAAM,CAAE,gBAAAiB,CAAgB,EAAIF,EAAe,KAC3C,OAAO,OAAOV,EAAY,MAAO,CAC7B,WAAYY,EAAkB,SAAW,EAC7C,CAAC,CACL,CAEA,GAAIF,GAAA,MAAAA,EAAgB,QAASf,GAAA,MAAAA,EAAO,SAAS,CACzC,IAAMJ,EAAUI,GAAA,YAAAA,EAAO,QACjB,CAAE,EAAGkB,EAAQ,EAAGC,CAAO,EAAIJ,EAAe,MAC1CK,EAAQ,OAAO,iBAAiBf,CAAW,EAAE,YAAc,MAC3DgB,EAAiB5B,GAAeuB,CAAS,EAAE,MAAM,GAAG,EAAE,CAAC,EACzDM,EAAM,GAAIC,EAAQ,GAAIC,EAAS,GAAIC,EAAO,GAE9C,GAAIJ,IAAmB,QAAS,CAC5B,IAAMK,EAAQ,OAAOR,GAAW,SAAW,QAAQpB,EAAY,QAAQF,EAAQ,YAAc,CAAC,MAAQ,GACtG0B,EAAM,OAAOH,GAAW,SAAW,QAAQrB,EAAY,QAAQF,EAAQ,YAAc,CAAC,MAAQ,GAC9F2B,EAAQH,EAAQM,EAAQ,GACxBD,EAAOL,EAAQ,GAAKM,CACxB,SACSL,IAAmB,MAAO,CAC/B,IAAMK,EAAQ,OAAOR,GAAW,SAAW,QAAQpB,EAAY,QAAQF,EAAQ,YAAc,CAAC,MAAQ,GACtG2B,EAAQH,EAAQ,GAAKM,EACrBD,EAAOL,EAAQM,EAAQ,GACvBF,EAAS,OAAOL,GAAW,SAAW,QAAQrB,EAAY,QAAQF,EAAQ,YAAc,CAAC,MAAQ,EACrG,MAGI6B,EAAO,OAAOP,GAAW,SAAW,GAAGA,CAAM,KAAO,GACpDI,EAAM,OAAOH,GAAW,SAAW,GAAGA,CAAM,KAAO,GAGvD,OAAO,OAAOvB,EAAQ,MAAO,CACzB,IAAA0B,EACA,MAAAC,EACA,OAAAC,EACA,KAAAC,CACJ,CAAC,EAED9B,GAAiBC,EAASF,GAAcsB,CAAS,EAAGA,CAAS,CACjE,CACJ,CAAC,EACMhB,CACX,CCxKO,IAAM2B,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,GAAgB,KAEhBC,GAAsBC,GAC1BH,GAAiB,KAAMI,GAAWD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CAAC,GAAKH,GAG3G,SAASI,IAAgC,CAC9C,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMC,EAAe,QAAQ,IAAI,cAAgB,KAAK,eAAe,EAAE,gBAAgB,EAAE,OACzF,OAAOJ,GAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,EAAa,SAAS,gBAAgB,KAC5C,OAAOL,GAAmBK,CAAU,CACtC,OAASC,EAAG,CACV,eAAQ,KAAK,yDAA0DA,CAAC,EACjEP,EACT,CACF,CAEO,IAAMQ,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,GAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBgB,EAAWZ,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FE,EAAK,KAAKlB,EAAQiB,CAAQ,EAC1BC,EAAK,SAASlB,CAAM,CACtB,ECtDO,IAAMmB,GAASC;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;ECLG,IAAMC,GAAS,KAAK,MAAM,uhBAAkjB,ECA5kB,IAAMC,GAAS,KAAK,MAAM,+iBAAmlB,ECA7mB,IAAMC,GAAS,KAAK,MAAM,8jBAA2jB,ECArlB,IAAMC,GAAS,KAAK,MAAM,4gBAA0iB,ECApkB,IAAMC,GAAS,KAAK,MAAM,2hBAAgjB,ECAjkB,IAAMC,GAASC,8oLCuBjD,IAAMC,GAAkB,CACtB,OAAQ,sBACR,OAAQ,SACV,EAEMC,GAAe,CACnB,QACE,uKACF,UAAW,qFACX,QAAS,uGACT,YAAa,sFACb,KAAM,sKACN,SAAU,gCACV,MAAO,iEACP,aAAc,4DACd,cAAe,qGACf,QAAS,qBACT,KAAM,aACR,EAEMC,GAAuB,mEACvBC,GAAc,CAClB,QAAS,sBAAsBD,EAAoB,GACnD,UAAW,sBAAsBA,EAAoB,GACrD,QAAS,oBAAoBA,EAAoB,GACjD,SAAU,sBAAsBA,EAAoB,GACpD,KAAM,2FAA2FA,EAAoB,GACrH,KAAM,gGAAgGD,GAAa,IAAI,EACzH,EAEaG,GAAc,CACzB,KAAM,qCACN,QAAS,6GACT,QAAS,kGACT,UAAW,8HACX,QACE,oIAEF,UAAW,mFACX,wBAAyB,cACzB,mBAAoB,cACpB,sBAAuB,cACvB,yBAA0B,eAC1B,oBAAqB,eACrB,uBAAwB,eACxB,0BAA2B,gBAC3B,qBAAsB,gBACtB,wBAAyB,gBACzB,uBAAwB,aACxB,kBAAmB,aACnB,qBAAsB,aACtB,aAAc,yDACd,aAAc,sEACd,aAAc,kFACd,eAAgB,sEAEhB,QAAS,kBACT,WAAY,gBACZ,SAAU,GAAGJ,GAAgB,MAAM,IAAIG,GAAY,IAAI,IAAIF,GAAa,IAAI,8BAC9E,EAEMI,GAAN,cAA4BC,CAAW,CAiErC,aAAc,CACZ,MAAM,EACNC,GAAaC,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAEvE,KAAK,WAAa,KAAK,WAAW,KAAK,IAAI,EAE3C,KAAK,KAAO,GACZ,KAAK,UAAY,SACjB,KAAK,QAAU,GACf,KAAK,QAAU,GACf,KAAK,QAAU,GACf,KAAK,UAAY,GACjB,KAAK,SAAW,GAChB,KAAK,QAAU,GACf,KAAK,SAAW,EAChB,KAAK,SAAW,EAChB,KAAK,KAAO,GACZ,KAAK,UAAY,GACjB,KAAK,kBAAoB,KAAK,UAC9B,KAAK,iBAAmB,KAAK,SAC/B,CAEA,mBAAoB,CAElB,GADA,MAAM,kBAAkB,EACpB,KAAK,WAAa,CAAC,OAAO,KAAKC,EAAS,EAAE,SAAS,KAAK,SAAS,EACnE,MAAM,IAAI,MAAM;AAAA,EAA0E,KAAK,UAAU,OAAO,KAAKA,EAAS,CAAC,CAAC,EAAE,EAGpI,GAAI,KAAK,oBAAsB,CAAC,KAAK,mBAAmB,MAAOC,GAAsBC,GAAW,SAASD,CAAiB,CAAC,EACzH,MAAM,IAAI,MACR;AAAA,EAAyG,KAAK,UAAUC,EAAU,CAAC,EACrI,EAIF,WAAW,IAAM,CACf,KAAK,cAAc,EACnB,KAAK,WAAW,CAClB,EAAG,CAAC,EAEC,KAAK,UACR,OAAO,iBAAiB,QAAS,KAAK,UAAU,EAChD,OAAO,iBAAiB,SAAU,KAAK,UAAU,EACjD,OAAO,iBAAiB,SAAU,KAAK,UAAU,EACjD,OAAO,iBAAiB,QAAS,KAAK,UAAU,GAG9C,KAAK,UACP,OAAO,iBAAiB,YAAa,KAAK,UAAU,EACpD,OAAO,iBAAiB,WAAY,KAAK,UAAU,EAEvD,CAEA,sBAAuB,CACrB,OAAO,oBAAoB,QAAS,KAAK,UAAU,EACnD,OAAO,oBAAoB,SAAU,KAAK,UAAU,EACpD,OAAO,oBAAoB,SAAU,KAAK,UAAU,EACpD,OAAO,oBAAoB,QAAS,KAAK,UAAU,EACnD,OAAO,oBAAoB,YAAa,KAAK,UAAU,EACvD,OAAO,oBAAoB,WAAY,KAAK,UAAU,EAEtD,MAAM,qBAAqB,CAC7B,CAEA,YAAa,CACX,OAAO,sBAAsB,IAAM,CAC7B,KAAK,MAAQ,KAAK,WAAa,KAAK,aACtCC,GAAU,KAAK,cAAc,EAAE,KAAMC,GAAU,CAC7C,KAAK,iBAAmBA,GAAA,YAAAA,EAAO,eACjC,CAAC,EAED,KAAK,iBAAmB,KAAK,iBAEjC,CAAC,CACH,CAGA,IAAI,kBAAmB,CACrB,OAAO,KAAK,SACd,CAGA,IAAI,iBAAiBC,EAAG,CACtB,KAAK,UAAYA,CACnB,CAGA,IAAI,UAAW,CACb,OAAO,KAAK,WAAW,cAAc,QAAQ,CAC/C,CAGA,IAAI,iBAAkB,CACpB,OAAOL,GAAU,KAAK,gBAAgB,CACxC,CAGA,IAAI,eAAgB,CAClB,OAAOM,EAAW,CAChBX,GAAY,UACZ,KAAK,sBAAsB,MAC3BA,GAAY,iBAAiBY,GAAwB,KAAK,eAAe,CAAC,EAAE,CAC9E,CAAC,CACH,CAGA,IAAI,YAAa,CACf,OAAO,KAAK,QAAU,GAAKC,2BAA8B,KAAK,aAAa,UAC7E,CAGA,IAAI,uBAAwB,CAC1B,IAAMC,EAAe,CACnB,QAAS,KAAK,QACd,QAAS,KAAK,QACd,QAAS,KAAK,QACd,UAAW,KAAK,SAClB,EAEMC,EAAgB,OAAO,KAAKD,CAAY,EAAE,KAAME,GAAM,CAAC,CAACF,EAAaE,CAAC,CAAC,GAAK,GAElF,MAAO,CACL,QAAShB,GAAYe,CAAa,EAClC,MAAOf,GAAY,QAAQe,EAAc,OAAO,CAAC,EAAE,YAAY,EAAIA,EAAc,MAAM,CAAC,CAAC,EAAE,CAC7F,CACF,CAGA,IAAI,cAA+B,CACjC,OAAO,KAAK,WAAW,cAAc,YAAY,CACnD,CAGA,IAAI,WAA4B,CA1RlC,IAAAE,EA2RI,IAAMC,GAA8BD,EAAA,KAAK,aAAL,YAAAA,EAAiB,cAAc,uBACnE,OAAOC,EAAaA,EAAW,iBAAiB,EAAE,CAAC,EAAI,IACzD,CAGA,IAAI,YAA6B,CAC/B,IAAMC,EAA+B,KAAK,WAAW,cAAc,sBAAsB,EACzF,OAAOA,EAAcA,EAAY,iBAAiB,EAAE,CAAC,EAAI,IAC3D,CAGA,IAAI,iBAAkB,CACpB,OAAOR,EAAW,CAACX,GAAY,KAAM,KAAK,sBAAsB,OAAO,CAAC,CAC1E,CAGA,IAAI,YAAa,CACf,OAAOoB,EAAK,EAAE,CACZ,GAAI,uBACJ,QAAS,QACT,QAAS,8CACX,CAAC,CACH,CAGA,IAAI,eAAgB,CAClB,OAAOP;AAAA,4BACiB,KAAK,UAAU,aAAa,KAAK,KAAK,cAAc,KAAK,UAAU,WAAWb,GAAY,QAAQ;AAAA;AAAA;AAAA,KAI5H,CAEA,SAAU,CACH,KAAK,SACR,KAAK,aAAa,MAAM,YAAY,yBAA0B,KAAK,KAAO,GAAK,QAAQ,EAGpF,KAAK,SACR,KAAK,aAAa,MAAM,YAAY,sBAAuB,KAAK,KAAO,OAAS,MAAM,EAGxF,KAAK,eAAiB,CACpB,UAAW,KAAK,KAChB,UAAW,KAAK,QAChB,gBAAiB,KAAK,iBACtB,cAAe,KAAK,UACpB,QAAS,KAAK,SACd,YAAa,KAAK,aAClB,SAAU,KAAK,UACf,QAAS,KAAK,QACd,SAAU,KAAK,SACf,SAAU,KAAK,SACf,KAAM,KAAK,KACX,UAAW,KAAK,UAChB,mBAAoB,KAAK,kBAC3B,EAIAQ,GAAU,KAAK,cAAc,CAC/B,CAEA,qBAAsB,CACpB,OAAQH,GAAU,KAAK,gBAAgB,EAAG,CACxC,IAAK,YACL,IAAK,MACL,IAAK,UACH,OAAOe,EAAK,EAAE,CACZ,GAAI,4BACJ,QAAS,cACT,QAAS,2EACX,CAAC,EACH,IAAK,cACL,IAAK,QACL,IAAK,YACH,OAAOA,EAAK,EAAE,CACZ,GAAI,+BACJ,QAAS,iBACT,QAAS,6EACX,CAAC,EACH,IAAK,eACL,IAAK,SACL,IAAK,aACH,OAAOA,EAAK,EAAE,CACZ,GAAI,8BACJ,QAAS,gBACT,QAAS,8EACX,CAAC,EACH,IAAK,aACL,IAAK,OACL,IAAK,WACH,OAAOA,EAAK,EAAE,CACZ,GAAI,8BACJ,QAAS,gBACT,QAAS,4EACX,CAAC,EACH,QACE,MAAO,EACX,CACF,CAEA,qBAAsB,CACpB,OAAQ,GAAM,CACZ,KAAK,KAAK,QACR,OAAOA,EAAK,EAAE,CACZ,GAAI,yBACJ,QAAS,UACT,QAAS,qEACX,CAAC,EACH,KAAK,KAAK,QACR,OAAOA,EAAK,EAAE,CACZ,GAAI,yBACJ,QAAS,wBACT,QAAS,mFACX,CAAC,EACH,KAAK,KAAK,QACR,OAAOA,EAAK,EAAE,CACZ,GAAI,yBACJ,QAAS,wBACT,QAAS,mFACX,CAAC,EACH,KAAK,KAAK,UACR,OAAOA,EAAK,EAAE,CACZ,GAAI,2BACJ,QAAS,4BACT,QAAS,uFACX,CAAC,EACH,QACE,MAAO,EACX,CACF,CAEA,kBAAmB,CACjB,MAAO,GAAG,KAAK,oBAAoB,CAAC,IAAK,KAAK,QAAuC,GAA7B,KAAK,oBAAoB,CAAM,EACzF,CACA,eAAgB,CACd,GAAI,KAAK,WAAa,CAAC,KAAK,UAAU,aAAa,cAAc,EAAG,CAClE,IAAMC,EAAqB,KAAK,WAAW,KAAO,KAAK,WAAW,GAAKC,GAAiB,GACxF,KAAK,UAAU,aAAa,eAAgBD,CAAkB,CAChE,CACF,CAEA,cAAe,CACb,KAAK,kBAAoB,KAAK,UAC9B,KAAK,cAAc,EAGf,KAAK,UACP,KAAK,aAAa,MAAM,SAAW,WAEvC,CAEA,OAAQ,CACN,IAAME,EAAQ,IAAI,YAAY,QAAS,CACrC,QAAS,GACT,SAAU,EACZ,CAAC,EACD,KAAK,eAAe,KAAK,IAAM,KAAK,cAAcA,CAAK,CAAC,CAC1D,CAEA,WAAW,EAAkB,CACtB,KAAK,UACN,EAAE,MAAQ,WACZ,EAAE,eAAe,EACjB,KAAK,MAAM,EAEf,CAEA,QAAS,CACP,MAAI,CAAC,KAAK,SAAW,KAAK,YAAc,OAAkBV,IACnDA;AAAA,mBACQW,EAAU,KAAK,UAAY,KAAK,UAAY,MAAS,CAAC;AAAA,UAC/D,KAAK,YAAc,eACrB,KAAK,YAAc,SACnB,KAAK,YAAc,aACnB,KAAK,YAAc,gBACnB,KAAK,YAAc,UACnB,KAAK,YAAc,aACfX;AAAA;AAAA;AAAA,2CAG+B,KAAK,eAAe;AAAA,6BAClC,KAAK,QAAU,UAAY,KAAK,iBAAiB,KAAK,iBAAiB,CAAC,KAAK,KAAK,UAAU;AAAA;AAAA,kBAEvG,KAAK,SAAW,KAAK,cAAgBY,CAAO;AAAA;AAAA,cAGlDZ;AAAA,2CAC+B,KAAK,eAAe;AAAA;AAAA,6BAElC,KAAK,QAAU,UAAY,KAAK,iBAAiB,KAAK,iBAAiB,CAAC,KAAK,KAAK,UAAU;AAAA,kBACvG,KAAK,SAAW,KAAK,cAAgBY,CAAO;AAAA;AAAA;AAAA,aAGjD;AAAA;AAAA,KAGX,CACF,EA9YMxB,GAgDG,OAAS,CACdyB,EACAC,GACAA,GACAzB;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,KAWF,EA7DA0B,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GADtC5B,GAEJ,oBAGA2B,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GAJrC5B,GAKJ,yBAGA2B,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAPtC5B,GAQJ,uBAGA2B,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAVtC5B,GAWJ,uBAIA2B,EAAA,CAFCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAbtC5B,GAeJ,uBAGA2B,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAjBtC5B,GAkBJ,yBAGA2B,EAAA,CADCC,EAAS,CAAE,UAAW,YAAa,KAAM,QAAS,QAAS,EAAK,CAAC,GApB9D5B,GAqBJ,wBAGA2B,EAAA,CADCC,EAAS,CAAE,UAAW,WAAY,KAAM,QAAS,QAAS,EAAK,CAAC,GAvB7D5B,GAwBJ,uBAGA2B,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GA1BrC5B,GA2BJ,wBAGA2B,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GA7BrC5B,GA8BJ,wBAGA2B,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAhCtC5B,GAiCJ,oBAGA2B,EAAA,CADCC,EAAS,CAAE,UAAW,aAAc,KAAM,QAAS,QAAS,EAAK,CAAC,GAnC/D5B,GAoCJ,yBAGA2B,EAAA,CADCC,EAAS,CAAE,UAAW,sBAAuB,KAAM,MAAO,QAAS,EAAK,CAAC,GAtCtE5B,GAuCJ,kCAyWG,eAAe,IAAI,aAAa,GAEnC,eAAe,OAAO,cAAeA,EAAa,EEte3B,IAAM6B,GAAS,KAAK,MAAM,4CAAgD,ECApEA,GAAS,KAAK,MAAM,4CAAgD,ECApEA,GAAS,KAAK,MAAM,qEAAgE,ECApFA,GAAS,KAAK,MAAM,4CAAgD,ECApEA,GAAS,KAAK,MAAM,4CAAgD,ECEtFC,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,GAAgB,KAEvBC,GAAgB,IAAM,CAP5B,IAAAC,EAQC,IAAIC,EACH,QAAQD,EAAA,SAAA,KAAA,OAAA,QAAS,MAAT,KAAA,OAAAA,EAAc,UAAW,CACjC,IAAK,OACJC,EAAQ,KACR,MACD,IAAK,OACJA,EAAQ,KACR,MACD,IAAK,UACJA,EAAQ,KACR,MACD,IAAK,MACJA,EAAQ,KACR,MACD,QACCA,EAAQ,IACV,CACA,OAAOA,CACR,EAEMC,GAAe,IAAM,CA5B3B,IAAAF,EA6BE,IAAMG,GAAWH,EAAA,UAAA,KAAA,OAAA,SAAU,WAAV,KAAA,OAAAA,EAAoB,SACrC,OAAIG,GAAA,MAAAA,EAAU,SAAS,MAAA,EACd,KACEA,EAAS,SAAS,MAAM,EAC1B,KACEA,EAAS,SAAS,SAAS,EAC7B,KACEA,EAAS,SAAS,KAAK,EACzB,KAEAL,EAEX,EAEaM,GAAsBC,GAE/BR,GAAiB,KACdS,GACCD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CACrE,GAAKJ,GAAa,EAIf,SAASK,IAAgC,CApDhD,IAAAP,EAqDE,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMQ,EAAeT,GAAc,EACnC,OAAOK,GAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,GAAaT,EAAA,UAAA,KAAA,OAAA,SAAU,kBAAV,KAAA,OAAAA,EAA2B,KACxCU,EAAaR,GAAa,EAEhC,OAAKL,GAAiB,SAASY,CAA6B,EAIrDL,GAAmBK,GAAA,KAAAA,EAAcC,CAAU,GAHhD,QAAQ,KAAK,gFAAgF,EACtFN,GAAmBM,CAAU,EAGxC,OAAS,EAAG,CACV,eAAQ,KAAK,yDAA0D,CAAC,EACjEZ,EACT,CACF,CAEO,IAAMa,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,GAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBX,EAAWe,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FC,EAAK,KAAKjB,EAAQV,CAAQ,EAC1B2B,EAAK,SAASjB,CAAM,CACtB,ENjGAW,GAAarB,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAGhE,IAAM4B,GAAN,cAAyBC,CAAW,CACzC,QAAS,CACL,IAAMC,EAAQH,EAAK,EAAE,CAAE,QAAS,qBAAsB,GAAI,kBAAmB,QAAS,qBAAsB,CAAC,EAE7G,OAAOI,0HAA6HC,EAAa,UAAUF,CAAK,UAAU,CAAC,+SAAiT,CACle,EACK,eAAe,IAAI,gBAAgB,GACtC,eAAe,OAAO,iBAAkBF,EAAU,EQnB3B,IAAMK,GAAS,KAAK,MAAM,yDAA6D,ECAjFA,GAAS,KAAK,MAAM,oEAAwE,ECA5FA,GAAS,KAAK,MAAM,+EAA6E,ECAjGA,GAAS,KAAK,MAAM,kEAAmE,ECAvFA,GAAS,KAAK,MAAM,8DAAkE,ECExGC,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,GAAgB,KAEvBC,GAAgB,IAAM,CAP5B,IAAAC,EAQC,IAAIC,EACH,QAAQD,EAAA,SAAA,KAAA,OAAA,QAAS,MAAT,KAAA,OAAAA,EAAc,UAAW,CACjC,IAAK,OACJC,EAAQ,KACR,MACD,IAAK,OACJA,EAAQ,KACR,MACD,IAAK,UACJA,EAAQ,KACR,MACD,IAAK,MACJA,EAAQ,KACR,MACD,QACCA,EAAQ,IACV,CACA,OAAOA,CACR,EAEMC,GAAe,IAAM,CA5B3B,IAAAF,EA6BE,IAAMG,GAAWH,EAAA,UAAA,KAAA,OAAA,SAAU,WAAV,KAAA,OAAAA,EAAoB,SACrC,OAAIG,GAAA,MAAAA,EAAU,SAAS,MAAA,EACd,KACEA,EAAS,SAAS,MAAM,EAC1B,KACEA,EAAS,SAAS,SAAS,EAC7B,KACEA,EAAS,SAAS,KAAK,EACzB,KAEAL,EAEX,EAEaM,GAAsBC,GAE/BR,GAAiB,KACdS,GACCD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CACrE,GAAKJ,GAAa,EAIf,SAASK,IAAgC,CApDhD,IAAAP,EAqDE,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMQ,EAAeT,GAAc,EACnC,OAAOK,GAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,GAAaT,EAAA,UAAA,KAAA,OAAA,SAAU,kBAAV,KAAA,OAAAA,EAA2B,KACxCU,EAAaR,GAAa,EAEhC,OAAKL,GAAiB,SAASY,CAA6B,EAIrDL,GAAmBK,GAAA,KAAAA,EAAcC,CAAU,GAHhD,QAAQ,KAAK,gFAAgF,EACtFN,GAAmBM,CAAU,EAGxC,OAAS,EAAG,CACV,eAAQ,KAAK,yDAA0D,CAAC,EACjEZ,EACT,CACF,CAEO,IAAMa,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,GAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBX,EAAWe,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FC,EAAK,KAAKjB,EAAQV,CAAQ,EAC1B2B,EAAK,SAASjB,CAAM,CACtB,ENjGAW,GAAarB,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAGhE,IAAM4B,GAAN,cAA4BC,CAAW,CAC5C,QAAS,CACL,IAAMC,EAAQH,EAAK,EAAE,CAAE,QAAS,0CAA2C,GAAI,qBAAsB,QAAS,wBAAyB,CAAC,EAExI,OAAOI,6HAAgIC,EAAa,UAAUF,CAAK,UAAU,CAAC,oQAAsQ,CAC1b,EACK,eAAe,IAAI,mBAAmB,GACzC,eAAe,OAAO,oBAAqBF,EAAa,EQnBjC,IAAMK,GAAS,KAAK,MAAM,qDAAsD,ECA1EA,GAAS,KAAK,MAAM,yDAA6D,ECAjFA,GAAS,KAAK,MAAM,8EAA4E,ECAhGA,GAAS,KAAK,MAAM,wDAAyD,ECA7EA,GAAS,KAAK,MAAM,mDAAuD,ECE7FC,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,GAAgB,KAEvBC,GAAgB,IAAM,CAP5B,IAAAC,EAQC,IAAIC,EACH,QAAQD,EAAA,SAAA,KAAA,OAAA,QAAS,MAAT,KAAA,OAAAA,EAAc,UAAW,CACjC,IAAK,OACJC,EAAQ,KACR,MACD,IAAK,OACJA,EAAQ,KACR,MACD,IAAK,UACJA,EAAQ,KACR,MACD,IAAK,MACJA,EAAQ,KACR,MACD,QACCA,EAAQ,IACV,CACA,OAAOA,CACR,EAEMC,GAAe,IAAM,CA5B3B,IAAAF,EA6BE,IAAMG,GAAWH,EAAA,UAAA,KAAA,OAAA,SAAU,WAAV,KAAA,OAAAA,EAAoB,SACrC,OAAIG,GAAA,MAAAA,EAAU,SAAS,MAAA,EACd,KACEA,EAAS,SAAS,MAAM,EAC1B,KACEA,EAAS,SAAS,SAAS,EAC7B,KACEA,EAAS,SAAS,KAAK,EACzB,KAEAL,EAEX,EAEaM,GAAsBC,GAE/BR,GAAiB,KACdS,GACCD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CACrE,GAAKJ,GAAa,EAIf,SAASK,IAAgC,CApDhD,IAAAP,EAqDE,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMQ,EAAeT,GAAc,EACnC,OAAOK,GAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,GAAaT,EAAA,UAAA,KAAA,OAAA,SAAU,kBAAV,KAAA,OAAAA,EAA2B,KACxCU,EAAaR,GAAa,EAEhC,OAAKL,GAAiB,SAASY,CAA6B,EAIrDL,GAAmBK,GAAA,KAAAA,EAAcC,CAAU,GAHhD,QAAQ,KAAK,gFAAgF,EACtFN,GAAmBM,CAAU,EAGxC,OAAS,EAAG,CACV,eAAQ,KAAK,yDAA0D,CAAC,EACjEZ,EACT,CACF,CAEO,IAAMa,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,GAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBX,EAAWe,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FC,EAAK,KAAKjB,EAAQV,CAAQ,EAC1B2B,EAAK,SAASjB,CAAM,CACtB,ENjGAW,GAAarB,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAGhE,IAAM4B,GAAN,cAA0BC,CAAW,CAC1C,QAAS,CACL,IAAMC,EAAQH,EAAK,EAAE,CAAE,QAAS,iCAAkC,GAAI,mBAAoB,QAAS,sBAAuB,CAAC,EAE3H,OAAOI,2HAA8HC,EAAa,UAAUF,CAAK,UAAU,CAAC,oaAAsa,CACxlB,EACK,eAAe,IAAI,iBAAiB,GACvC,eAAe,OAAO,kBAAmBF,EAAW,EQnB7B,IAAMK,GAAS,KAAK,MAAM,kDAAsD,ECA1EA,GAAS,KAAK,MAAM,kDAAsD,ECA1EA,GAAS,KAAK,MAAM,4EAAuE,ECA3FA,GAAS,KAAK,MAAM,kDAAsD,ECA1EA,GAAS,KAAK,MAAM,4CAAgD,ECEtFC,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,GAAgB,KAEvBC,GAAgB,IAAM,CAP5B,IAAAC,EAQC,IAAIC,EACH,QAAQD,EAAA,SAAA,KAAA,OAAA,QAAS,MAAT,KAAA,OAAAA,EAAc,UAAW,CACjC,IAAK,OACJC,EAAQ,KACR,MACD,IAAK,OACJA,EAAQ,KACR,MACD,IAAK,UACJA,EAAQ,KACR,MACD,IAAK,MACJA,EAAQ,KACR,MACD,QACCA,EAAQ,IACV,CACA,OAAOA,CACR,EAEMC,GAAe,IAAM,CA5B3B,IAAAF,EA6BE,IAAMG,GAAWH,EAAA,UAAA,KAAA,OAAA,SAAU,WAAV,KAAA,OAAAA,EAAoB,SACrC,OAAIG,GAAA,MAAAA,EAAU,SAAS,MAAA,EACd,KACEA,EAAS,SAAS,MAAM,EAC1B,KACEA,EAAS,SAAS,SAAS,EAC7B,KACEA,EAAS,SAAS,KAAK,EACzB,KAEAL,EAEX,EAEaM,GAAsBC,GAE/BR,GAAiB,KACdS,GACCD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CACrE,GAAKJ,GAAa,EAIf,SAASK,IAAgC,CApDhD,IAAAP,EAqDE,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMQ,EAAeT,GAAc,EACnC,OAAOK,GAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,GAAaT,EAAA,UAAA,KAAA,OAAA,SAAU,kBAAV,KAAA,OAAAA,EAA2B,KACxCU,EAAaR,GAAa,EAEhC,OAAKL,GAAiB,SAASY,CAA6B,EAIrDL,GAAmBK,GAAA,KAAAA,EAAcC,CAAU,GAHhD,QAAQ,KAAK,gFAAgF,EACtFN,GAAmBM,CAAU,EAGxC,OAAS,EAAG,CACV,eAAQ,KAAK,yDAA0D,CAAC,EACjEZ,EACT,CACF,CAEO,IAAMa,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,GAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBX,EAAWe,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FC,EAAK,KAAKjB,EAAQV,CAAQ,EAC1B2B,EAAK,SAASjB,CAAM,CACtB,ENjGAW,GAAarB,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAGhE,IAAM4B,GAAN,cAA4BC,CAAW,CAC5C,QAAS,CACL,IAAMC,EAAQH,EAAK,EAAE,CAAE,QAAS,wBAAyB,GAAI,qBAAsB,QAAS,wBAAyB,CAAC,EAEtH,OAAOI,6HAAgIC,EAAa,UAAUF,CAAK,UAAU,CAAC,0RAA4R,CAChd,EACK,eAAe,IAAI,mBAAmB,GACzC,eAAe,OAAO,oBAAqBF,EAAa,EOnBxB,IAAMK,GAASC,ytDCejD,IAAMC,GAAU,CACd,QAAS,+CACT,iBAAkB,qBAClB,YAAa,yBACb,MAAO,SACP,KAAM,qBACN,SAAU,oEACV,aAAc,kBACd,SAAU,oEACV,aAAc,kBACd,QAAS,iEACT,YAAa,iBACb,KAAM,wDACN,SAAU,aACZ,EAIMC,GAAgB,CACpB,SAAU,WACV,SAAU,WACV,QAAS,UACT,KAAM,MACR,EASMC,GAAN,cAAwBC,CAAW,CAUjC,aAAc,CACZ,MAAM,EATR,aAAyB,OAGzB,UAAgB,GAGhB,UAAe,QAIb,KAAK,KAAO,GACZ,KAAK,KAAO,OACd,CAEA,mBAAoB,CAElB,GADA,MAAM,kBAAkB,EACpB,CAAC,KAAK,SAAW,CAACF,GAAc,KAAK,OAAO,EAC9C,MAAM,IAAI,MAAM;AAAA,mCAAyG,CAE7H,CAGA,IAAI,iBAAkB,CACpB,OAAOG,EAAW,CAACJ,GAAQ,QAASA,GAAQ,KAAK,OAAO,CAAC,CAAC,CAC5D,CAGA,IAAI,cAAe,CACjB,IAAMK,EAAuBL,GAAQ,GAAG,KAAK,OAAO,MAAM,EAE1D,OAAOI,EAAW,CAACJ,GAAQ,KAAMK,CAAoB,CAAC,CACxD,CAyBA,IAAI,OAAQ,CACV,OAAI,KAAK,UAAYJ,GAAc,KAC1BK,sCAEL,KAAK,UAAYL,GAAc,QAC1BK,4CAEL,KAAK,UAAYL,GAAc,SAC1BK,wCAEL,KAAK,UAAYL,GAAc,SAC1BK,4CACK,EAChB,CAEA,QAAS,CACP,OAAOA;AAAA,mCACwB,KAAK,IAAI;AAAA,oBACxB,KAAK,IAAI,UAAU,KAAK,eAAe;AAAA,uBACpC,KAAK,YAAY,IAAI,KAAK,KAAK;AAAA,uBAC/BN,GAAQ,WAAW;AAAA;AAAA;AAAA;AAAA;AAAA,KAMxC,CACF,EArFME,GAuCG,OAAS,CACdK,EACAC,GACAL;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,KAaF,EArDAM,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GADvBR,GAEJ,uBAGAO,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAJtCR,GAKJ,oBAGAO,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GAPvBR,GAQJ,oBA+EG,eAAe,IAAI,SAAS,GAC/B,eAAe,OAAO,UAAWA,EAAS,ECvIV,IAAMS,GAASC,moDCejD,IAAMC,GAAN,cAAwBC,CAAW,CAAnC,kCAEE,aAAyG,UAQzG,IAAI,QAAS,CACX,OAAOC,EAAW,CAChB,mDACA,KAAK,UAAY,WAAa,iDAC9B,KAAK,UAAY,QAAU,8CAC3B,KAAK,UAAY,YAAc,kDAC/B,KAAK,UAAY,WAAa,iDAC9B,KAAK,UAAY,YAAc,kDAC/B,KAAK,UAAY,YAAc,uBAC/B,KAAK,UAAY,SAAW,2CAC5B,KAAK,UAAY,aAAe,mDAChC,CAAC,CAAC,KAAK,UAAY,yBACnB,KAAK,WAAa,YAAc,sDAChC,KAAK,WAAa,aAAe,uDACjC,KAAK,WAAa,gBAAkB,0DACpC,KAAK,WAAa,eAAiB,wDACrC,CAAC,CACH,CAEA,QAAS,CACP,OAAOC;AAAA,oBACS,KAAK,MAAM;AAAA;AAAA;AAAA,KAI7B,CACF,EApCMH,GAOG,OAAS,CAACI,EAAOC,EAAM,EAL9BC,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GADrCP,GAEJ,uBAGAM,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GAJrCP,GAKJ,wBAiCG,eAAe,IAAI,SAAS,GAC/B,eAAe,OAAO,UAAWA,EAAS,ECtDV,IAAMQ,GAASC,+7BCejD,IAAMC,GAAN,cAAsBC,CAAW,CAuB/B,IAAI,QAAS,CACX,OAAOC,EAAW,CAChB,kEACA,KAAK,OAAS,sDACd,KAAK,MAAQ,mBACb,KAAK,SAAW,mBAChB,KAAK,UAAY,wBACnB,CAAC,CACH,CAGA,IAAI,wBAAyB,CAjD/B,IAAAC,EAkDI,OAAO,KAAK,OAAS,GAAKC,GAAUD,EAAA,KAAK,OAAL,KAAAA,EAAa,QACnD,CAEA,QAAS,CACP,OAAOE;AAAA,mBACQ,KAAK,sBAAsB,YAAY,KAAK,MAAM;AAAA;AAAA;AAAA,KAInE,CACF,EA7CML,GAoBG,OAAS,CAACM,EAAOC,EAAM,EAlB9BC,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GADtCT,GAEJ,qBAGAQ,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAJtCT,GAKJ,wBAGAQ,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAPtCT,GAQJ,oBAGAQ,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAVtCT,GAWJ,uBAGAQ,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GAbrCT,GAcJ,oBAiCG,eAAe,IAAI,OAAO,GAC7B,eAAe,OAAO,QAASA,EAAO,ECzDjC,SAASU,GAAWC,EAAOC,EAAW,CACzC,OAAOD,EAAM,QAASE,GAAO,CAACA,EAAID,CAAS,CAAC,EAAE,MAAM,EAAG,EAAE,CAC7D,CCRyB,IAAME,GAAS,KAAK,MAAM,yCAA6C,ECAvE,IAAMC,GAAS,KAAK,MAAM,4CAAgD,ECA1E,IAAMC,GAAS,KAAK,MAAM,gDAA8C,ECAxE,IAAMC,GAAS,KAAK,MAAM,yCAA6C,ECAvE,IAAMC,GAAS,KAAK,MAAM,+CAA6C,ECA9D,IAAMC,GAASC,wtBCkB1C,IAAMC,GAAgB,CAC3B,QAAS,iBACT,KAAM,SACN,KAAM,cACN,UAAW,qBACX,KAAM,SACR,EAEMC,GAAYC,gBAAmBF,GAAc,SAAS,YAOtDG,GAAN,cAA8BC,CAAW,CAMvC,aAAc,CACZ,MAAM,EACNC,GAAaC,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAEvE,KAAK,UAAYC,EAAK,EAAE,CACtB,GAAI,wBACJ,QAAS,eACT,QAAS,4DACX,CAAC,CACH,CAKA,mBAAoB,CAClB,MAAM,kBAAkB,EAKxB,IAAMC,EAHoB,MAAM,KAAK,KAAK,QAAQ,EAC/C,KAAK,GAAQ,EACb,OAAQC,GAAUA,CAAK,EACe,IAAI,CAACA,EAAOC,IAAU,CAC7D,GAAI,OAAOD,GAAU,SAAU,CAC7B,IAAME,EAAWD,IAAU,KAAK,SAAS,OAAS,EAClD,OAAOR,gBAAmBF,GAAc,IAAI,iBAAiBW,EAAW,OAAS,MAAS,IAAIF,CAAK,SACrG,CACA,OAAAA,EAAM,UAAU,IAAIA,EAAM,UAAY,IAAMT,GAAc,KAAOA,GAAc,IAAI,EAC5ES,CACT,CAAC,EAGD,KAAK,UAAYG,GAAWJ,EAAgBP,EAAS,CACvD,CAEA,QAAS,CACP,OAAOC;AAAA;AAAA,yCAE8BF,GAAc,IAAI,IAAI,KAAK,SAAS;AAAA,qBACxDA,GAAc,OAAO,IAAI,KAAK,SAAS;AAAA;AAAA,KAG1D,CACF,EA/CMG,GAIG,OAAS,CAACU,EAAOC,EAAM,EAF9BC,EAAA,CADCC,EAAS,CAAE,UAAW,aAAc,KAAM,MAAO,CAAC,GAD/Cb,GAEJ,yBA+CG,eAAe,IAAI,eAAe,GACrC,eAAe,OAAO,gBAAiBA,EAAe,6pBCjFlD,SAAUc,GAEdC,EAAiB,2CACjB,MAAMC,WAAoBD,CAAU,CAqMlC,eAAeE,EAAW,WACxB,MAAM,GAAGA,CAAI,cAtIf,KAAA,UAAY,KAAK,gBAAe,EAMhCC,EAAA,IAAA,KAAW,EAAK,EAMhBC,EAAA,IAAA,KAAc,EAAK,EAOnBC,EAAA,IAAA,KAAW,EAAK,EAGhBC,EAAA,IAAA,KAAA,MAAA,EACAC,EAAA,IAAA,KAAA,MAAA,EAMAC,EAAA,IAAA,KAA4B,EAAI,EAahCC,EAAA,IAAA,KAAoB,EAAE,EAOtBC,EAAA,IAAA,KAAW,IAAW,CACpBC,GAAA,KAAIN,EAAY,GAAI,GAAA,EACpBM,GAAA,KAAIR,EAAY,GAAI,GAAA,EACpBS,EAAA,KAAIC,EAAA,IAAAC,CAAA,EAAiB,KAArB,IAAI,CACN,CAAC,EAMDC,EAAA,IAAA,KAAU,IAAW,CACnBJ,GAAA,KAAIR,EAAY,GAAK,GAAA,EAErBS,EAAA,KAAIC,EAAA,IAAAG,CAAA,EAAe,KAAnB,KAAoB,KAAK,sBAAqB,EAAKJ,EAAA,KAAIH,EAAA,GAAA,EAAU,EAAE,EAM/D,CAAC,KAAK,SAAS,OAASG,EAAA,KAAIP,EAAA,GAAA,GAC9BM,GAAA,KAAIP,EAAe,GAAI,GAAA,EAEzB,IAAMa,EAAYL,EAAA,KAAIC,EAAA,IAAAC,CAAA,EAAiB,KAArB,IAAI,EAClB,KAAK,2BACP,KAAK,0BAA0BG,EAAY,KAAK,UAAU,kBAAoB,EAAE,CAEpF,CAAC,EAMDC,EAAA,IAAA,KAAa,IAAW,OAClBN,EAAA,KAAIJ,EAAA,GAAA,GAA8B,KAAK,mBACzC,KAAK,UAAU,YACb,KAAK,SACL,KAAK,kBACL,KAAK,gBAAgB,EAEvBG,GAAA,KAAIH,EAA6B,GAAK,GAAA,GAExCG,GAAA,KAAIN,EAAY,GAAI,GAAA,EACpBM,GAAA,KAAIP,EAAe,GAAI,GAAA,EACvBQ,EAAA,KAAIC,EAAA,IAAAC,CAAA,EAAiB,KAArB,IAAI,GACJK,EAAA,OAAI,MAAJ,OAAI,OAAA,OAAJ,KAAM,6BAAyB,MAAAA,IAAA,QAAAA,EAAA,KAA/B,KAAkC,KAAK,UAAY,KAAK,UAAU,kBAAoB,EAAE,CAC1F,CAAC,EAgGDC,EAAA,IAAA,KAAA,MAAA,EAGAC,EAAA,IAAA,KAAuB,EAAK,EAE5BC,EAAA,IAAA,KAAsB,QAAQ,QAAO,CAAE,GA5DrCH,EAAA,KAAK,oBAAgB,MAAAA,IAAA,QAAAA,EAAA,KAArB,KAAwB,QAASP,EAAA,KAAIF,EAAA,GAAA,CAAS,GAC9Ca,EAAA,KAAK,oBAAgB,MAAAA,IAAA,QAAAA,EAAA,KAArB,KAAwB,OAAQX,EAAA,KAAIG,EAAA,GAAA,CAAQ,GAC5CS,EAAA,KAAK,oBAAgB,MAAAA,IAAA,QAAAA,EAAA,KAArB,KAAwB,UAAWZ,EAAA,KAAIM,EAAA,GAAA,CAAW,EAClD,KAAK,SAAS,IAAI,CACpB,CAzMA,WAAW,gBAAc,CACvB,MAAO,EACT,CAkBQ,WAAW,YAAU,CAC3B,OAAO,KAAK,uBAAyB,CAAA,CACvC,CAQC,WAAW,oBAAkB,CAC5B,IAAMO,EAAsB,KAAK,WAAW,IAAKC,GAAcA,EAAU,SAAS,EAAE,KAAI,EAElFC,EAAqB,MAAM,oBAAsB,CAAA,EAIvD,MAAO,CAAC,GADa,IAAI,IAAI,CAAC,GAAGA,EAAoB,GAAGF,CAAmB,CAAC,CACrD,CACzB,CAMA,OAAO,aAAaG,EAAiB,CACnC,OAAO,KAAK,WAAW,KAAMF,GAAcA,EAAU,YAAcE,CAAS,GAAK,IACnF,CAOA,OAAO,cAAcA,EAAiB,CACpC,OAAO,KAAK,WAAW,OAAOF,GAAY,OACxC,GAAIA,EAAU,YAAcE,GAAa,GAAAT,EAAAO,EAAU,aAAS,MAAAP,IAAA,SAAAA,EAAE,SAASS,CAAS,EAC9E,MAAO,EAEX,CAAC,CACH,CAoGA,IAAI,MAAI,CACN,OAAO,KAAK,UAAU,IACxB,CAQA,IAAI,WAAS,CACX,OAAOhB,EAAA,KAAIC,EAAA,IAAAC,CAAA,EAAiB,KAArB,IAAI,CACb,CAMA,eAAa,CACX,OAAO,KAAK,UAAU,cAAa,CACrC,CAGA,IAAI,UAAQ,CACV,OAAO,KAAK,UAAU,QACxB,CAMA,IAAI,mBAAiB,CACnB,OAAO,KAAK,UAAU,iBACxB,CAWA,yBAAyBe,EAAcC,EAAkBC,EAAgB,QACvEZ,EAAA,MAAM,4BAAwB,MAAAA,IAAA,QAAAA,EAAA,KAAA,KAAGU,EAAMC,EAAUC,CAAQ,EAQzD,IAAMC,GADQ,KAAK,YACM,cAAcH,CAAI,EAEvCG,IAAU,MAAVA,GAAY,QAAU,KAAK,kBAC7B,KAAK,SAASpB,EAAA,KAAIH,EAAA,GAAA,CAAO,CAE7B,CASA,SAASwB,EAAgB,OACvBtB,GAAA,KAAIP,EAAe,GAAK,GAAA,GACxBe,EAAA,KAAK,6BAAyB,MAAAA,IAAA,QAAAA,EAAA,KAA9B,KAAiC,EAAE,EACnCR,GAAA,KAAIF,EAAUwB,EAAK,GAAA,EAEnB,IAAMC,EADoB,KAAK,sBAAqB,EACVD,EAAQ,KAClD,KAAK,UAAU,aAAaC,CAAuB,EACnDtB,EAAA,KAAIC,EAAA,IAAAG,CAAA,EAAe,KAAnB,KAAoBkB,CAAa,EAC7B,KAAK,sBACP,KAAK,qBAAqBA,CAAa,EAEzCtB,EAAA,KAAIC,EAAA,IAAAC,CAAA,EAAiB,KAArB,IAAI,CACN,CASA,uBAAqB,CACnB,MAAO,EACT,CAWA,IAAI,oBAAkB,CACpB,OAAO,IAAI,QAAQqB,GAAWA,EAAQvB,EAAA,KAAIU,EAAA,GAAA,CAAoB,CAAC,CACjE,CA0NA,mBAAiB,SACfX,GAAA,KAAIN,EAAY,GAAK,GAAA,EACrBM,GAAA,KAAIP,EAAe,GAAK,GAAA,EACxBQ,EAAA,KAAIC,EAAA,IAAAC,CAAA,EAAiB,KAArB,IAAI,GACJK,EAAA,KAAK,oBAAgB,MAAAA,IAAA,QAAAA,EAAA,KAArB,IAAI,GAEJI,EAAA,KAAK,6BAAyB,MAAAA,IAAA,QAAAA,EAAA,KAA9B,KACEX,EAAA,KAAIC,EAAA,IAAAC,CAAA,EAAiB,KAArB,IAAI,EAAsB,KAAK,kBAAoB,EAAE,CAEzD,0NA1YE,IAAMsB,EAAW,KAAK,YAAW,EAC3BC,EAAW,GAAG,KAAK,SAAS,UAAU,KAAK,aAAa,MAAM,CAAC,KACrE,OAAOD,EAAS,iBAA8BC,CAAQ,CACxD,EAACvB,EAAA,UAAA,CA4NC,GAAI,KAAK,aAAa,UAAU,EAC9B,MAAO,GAGT,IAAMG,EAAYL,EAAA,KAAIR,EAAA,GAAA,GAAiBQ,EAAA,KAAIP,EAAA,GAAA,GAAa,CAAC,KAAK,SAAS,OAAS,CAACO,EAAA,KAAIT,EAAA,GAAA,EAMrF,OAAIc,GAAa,KAAK,UAAU,OAC9B,KAAK,UAAU,OAAO,IAAI,cAAc,EAC/B,KAAK,UAAU,QACxB,KAAK,UAAU,OAAO,OAAO,cAAc,EAGtCA,CACT,EAACD,EAAA,SAEciB,EAAgB,CAC7B,IAAMK,EAAQ,KAAK,YACbC,EAAgC,CAAA,EAChCP,EAAaM,EAAM,WACnBE,EAA2C,CAAA,EAC3CC,GAAqBT,EAAW,KAAMN,IAAcA,GAAU,mBAAmB,OAAO,EAEzFd,EAAA,KAAIS,EAAA,GAAA,IACPV,GAAA,KAAIW,EAAuB,IAAI,QAAQa,IAAU,CAC/CxB,GAAA,KAAIS,EAA+Be,GAAO,GAAA,CAC5C,CAAC,EAAC,GAAA,EACFxB,GAAA,KAAIU,EAAwB,GAAI,GAAA,GAQ9BT,EAAA,KAAIN,EAAA,GAAA,IACNM,EAAA,KAAIN,EAAA,GAAA,EAAkB,MAAK,EAC3BK,GAAA,KAAIJ,EAA4BK,EAAA,KAAIN,EAAA,GAAA,EAAiB,GAAA,GAOvD,IAAMoC,EAAkB,IAAI,gBAC5B/B,GAAA,KAAIL,EAAoBoC,EAAe,GAAA,EACvC,IAAIC,EAGAC,GAAY,GAEXZ,EAAW,SAIhBA,EAAW,QAAQN,IAAY,CAC7B,IAAMmB,GAAMnB,GAAU,KAAO,cACvBoB,GAAUpB,GAAU,QAAQ,KAAMO,EAAOS,EAAgB,MAAM,EAC5CI,cAAmB,SAG1CN,EAAgB,KAAKM,EAAO,EAE5BA,GAAQ,KAAKC,IAAmB,CACQA,IAAqB,OAI3DR,EAASM,EAAG,EAAI,CAACE,GAEjBJ,EAAoB/B,EAAA,KAAIC,EAAA,IAAAmC,CAAA,EAA6B,KAAjC,KAAkCtB,GAAWO,CAAK,EACtErB,EAAA,KAAIC,EAAA,IAAAoC,CAAA,EAA+B,KAAnC,KAAoCV,EAAUI,CAAiB,EACjE,CAAC,IAGDJ,EAASM,EAAG,EAAI,CAACC,GAEb,KAAK,SAASD,EAAG,IAAM,CAACC,KAC1BF,GAAY,IAMV,CAACE,IAAW,CAACH,IACfA,EAAoB/B,EAAA,KAAIC,EAAA,IAAAmC,CAAA,EAA6B,KAAjC,KAAkCtB,GAAWO,CAAK,GAG5E,CAAC,EAGD,QAAQ,WAAWO,CAAe,EAC/B,KAAK,IAAK,QAEJE,GAAe,MAAfA,EAAiB,OAAO,UAC3B/B,GAAA,KAAIU,EAAwB,GAAK,GAAA,GACjCF,GAAAP,EAAA,KAAIQ,EAAA,GAAA,KAA4B,MAAAD,KAAA,QAAAA,GAAA,KAAhC,IAAI,EAER,CAAC,GAUCyB,IAAa,CAACH,KAChB7B,EAAA,KAAIC,EAAA,IAAAoC,CAAA,EAA+B,KAAnC,KAAoCV,EAAUI,CAAiB,EAEnE,EAACM,EAAA,SAM8BV,EAAkCI,EAAmC,CAClG,GAAI,KAAK,iBACP,KAAK,UAAU,YAAYJ,EAAUI,EAAmB,KAAK,gBAAgB,EAC7EhC,GAAA,KAAIH,EAA6B,GAAK,GAAA,MACjC,CAGL,GAFA,KAAK,UAAU,YAAY+B,EAAUI,CAAiB,EAElD,KAAK,UAAU,SAAS,MAC1B,OAWFhC,GAAA,KAAIH,EAA6B,GAAI,GAAA,EAEzC,EAACwC,EAAA,SAG4BtB,EAAsBO,EAAgB,CAEjE,GAAI,KAAK,iBAAkB,CACzB,IAAMiB,EAAU,KAAK,iBAAiBxB,EAAU,KAAO,aAAa,EAEpE,GAAIwB,EACF,OAAOA,EAIX,OAAIxB,EAAU,mBAAmB,SACvBA,EAAU,QAAsC,KAAMO,CAAK,EAE5DP,EAAU,OAErB,EAeKzB,EACT,CCjfA,OAAOkD,OAAiB,yBCDjB,IAAMC,GAASC;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;ODWtB,IAAMC,GAAW,CAAC,UAAW,YAAa,WAAY,gBAAiB,UAAW,eAAgB,OAAQ,MAAM,EAO1GC,GAAN,cAAuBC,GAAiBC,CAAU,CAAE,CA2ClD,aAAc,CACZ,MAAM,EACN,KAAK,QAAU,WACjB,CAEA,mBAAoB,CAGlB,GAFA,MAAM,kBAAkB,EAEpB,CAACH,GAAS,SAAS,KAAK,OAAO,EACjC,MAAM,IAAI,MAAM;AAAA,EAAwEA,GAAS,KAAK,IAAI,CAAC,GAAG,CAElH,CAEA,cAAe,CACT,KAAK,WACP,WAAW,IAAM,KAAK,MAAM,EAAG,CAAC,CAEpC,CAEA,QAAS,CACP,IAAMI,EAAU,CACd,WAAY,KAAK,UAAY,OAC7B,oBAAqB,KAAK,UAAY,UACtC,sBAAuB,KAAK,UAAY,YACxC,qBAAsB,KAAK,UAAY,WACvC,oBAAqB,KAAK,UAAY,UACtC,kBAAmB,KAAK,UAAY,QACpC,2BAA4B,KAAK,UAAY,gBAC7C,0BAA2B,KAAK,UAAY,eAC5C,kBAAmB,KAAK,MACxB,uBAAwB,KAAK,UAC7B,qBAAsB,KAAK,QAC7B,EACA,OAAOC;AAAA,aACE,KAAK,IAAI;AAAA,eACP,KAAK,MAAM;AAAA,YACd,KAAK,SAAW,SAAW,KAAK,KAAO,WAAa,MAAS;AAAA,cAC3DC,GAASF,CAAO,CAAC;AAAA;AAAA,SAG7B,CACF,EApFMH,GACG,kBAAoB,CACzB,GAAGM,GAAY,kBACf,eAAgB,EAClB,EAJIN,GAyCG,OAAS,CAACO,EAAOC,EAAM,EAlC9BC,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GANtCV,GAOJ,yBAGAS,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GATvBV,GAUJ,uBAGAS,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAZtCV,GAaJ,qBAGAS,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAftCV,GAgBJ,qBAGAS,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GAlBvBV,GAmBJ,oBAGAS,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GArBtCV,GAsBJ,wBAGAS,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GAxBvBV,GAyBJ,sBAGAS,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GA3BvBV,GA4BJ,mBAGAS,EAAA,CADCC,EAAS,CAAE,UAAW,aAAc,KAAM,QAAS,QAAS,EAAK,CAAC,GA9B/DV,GA+BJ,yBAGAS,EAAA,CADCC,EAAS,CAAE,UAAW,eAAgB,QAAS,EAAK,CAAC,GAjClDV,GAkCJ,2BAGAS,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GApCvBV,GAqCJ,oBAiDG,eAAe,IAAI,QAAQ,GAC9B,eAAe,OAAO,SAAUA,EAAQ,EEpG1C,OAAOW,OAAiB,yBCPC,IAAMC,GAAS,KAAK,MAAM,4CAA6C,ECAvE,IAAMC,GAAS,KAAK,MAAM,wCAA4C,ECAtE,IAAMC,GAAS,KAAK,MAAM,yCAA6C,ECAvE,IAAMC,GAAS,KAAK,MAAM,uCAA2C,ECArE,IAAMC,GAAS,KAAK,MAAM,wCAA4C,ECA7D,IAAMC,GAASC,0wJNuBjD,IAAMC,GAAW,CAAC,UAAW,YAAa,WAAY,UAAW,OAAQ,MAAM,EAIzEC,GAAuB,mEAEvBC,GAAe,CACnB,QACE,uKACF,UAAW,qFACX,QAAS,uGACT,YAAa,sFACb,KAAM,sKACN,SAAU,gCACV,MAAO,iEACP,aAAc,4DACd,cAAe,qGACf,QAAS,qBACT,KAAM,aACR,EAEMC,EAAc,CAClB,QAAS,sBAAsBF,EAAoB,GACnD,UAAW,sBAAsBA,EAAoB,GACrD,QAAS,oBAAoBA,EAAoB,GACjD,SAAU,sBAAsBA,EAAoB,GACpD,KAAM,2FAA2FA,EAAoB,GACrH,KAAM,gGAAgGC,GAAa,IAAI,EACzH,EAEME,EAAc,CAClB,OAAQ,aACR,MAAO,aACP,OAAQ,cACR,MAAO,cACP,QAAS,sBACT,aAAc,qBACd,KAAM,4BACN,UAAW,oBACX,KAAM,KACR,EAEMC,EAAkB,CACtB,OAAQ,sBACR,OAAQ,SACV,EAEMC,EAAiB,CACrB,WAAY,6DAA6DJ,GAAa,OAAO,GAC7F,MAAO,sBAAsBD,EAAoB,GACjD,aAAc,sBAAsBA,EAAoB,GACxD,cAAe,sBAAsBA,EAAoB,GACzD,WAAY,6FAA6FC,GAAa,QAAQ,EAChI,EAEaK,EAAW,CAEtB,UAAW,GAAGH,EAAY,MAAM,IAAIC,EAAgB,MAAM,IAAIF,EAAY,SAAS,IAAID,GAAa,SAAS,GAC7G,cAAe,GAAGE,EAAY,MAAM,IAAIC,EAAgB,MAAM,IAAIF,EAAY,SAAS,IAAID,GAAa,SAAS,GACjH,kBAAmB,GAAGE,EAAY,MAAM,IAAIC,EAAgB,MAAM,IAAIF,EAAY,SAAS,IAAIG,EAAe,UAAU,GACxH,eAAgB,GAAGD,EAAgB,MAAM,IAAID,EAAY,MAAM,IAAID,EAAY,SAAS,IAAID,GAAa,SAAS,GAClH,uBAAwB,GAAGG,EAAgB,MAAM,IAAID,EAAY,MAAM,IAAID,EAAY,SAAS,IAAIG,EAAe,UAAU,GAC7H,eAAgB,GAAGF,EAAY,MAAM,IAAIC,EAAgB,MAAM,IAAIC,EAAe,KAAK,IAAIJ,GAAa,KAAK,GAC7G,uBAAwB,GAAGE,EAAY,MAAM,IAAIC,EAAgB,MAAM,IAAIC,EAAe,KAAK,IAAIA,EAAe,UAAU,GAC5H,oBAAqB,GAAGD,EAAgB,MAAM,IAAID,EAAY,MAAM,IAAIE,EAAe,KAAK,IAAIJ,GAAa,KAAK,GAClH,4BAA6B,GAAGG,EAAgB,MAAM,IAAID,EAAY,MAAM,IAAIE,EAAe,KAAK,IAAIA,EAAe,UAAU,GACjI,iBAAkB,GAAGF,EAAY,MAAM,IAAIC,EAAgB,MAAM,IAAIF,EAAY,SAAS,IAAIG,EAAe,UAAU,GACvH,sBAAuB,GAAGD,EAAgB,MAAM,IAAID,EAAY,MAAM,KAAKD,EAAY,SAAS,IAAIG,EAAe,UAAU,GAC7H,2BAA4B,GAAGD,EAAgB,MAAM,IAAID,EAAY,MAAM,IAAIE,EAAe,KAAK,IAAIA,EAAe,UAAU,GAChI,sBAAuB,GAAGF,EAAY,MAAM,IAAIC,EAAgB,MAAM,IAAIC,EAAe,KAAK,IAAIA,EAAe,UAAU,GAE3H,QAAS,GAAGF,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIF,EAAY,OAAO,IAAID,GAAa,OAAO,GACtG,gBAAiB,GAAGE,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,UAAU,IAAIH,EAAY,OAAO,GACnH,aAAc,GAAGC,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIF,EAAY,OAAO,IAAID,GAAa,OAAO,GAC3G,qBAAsB,GAAGE,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,UAAU,IAAIH,EAAY,OAAO,IACxH,aAAc,GAAGC,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,KAAK,IAAIJ,GAAa,KAAK,GAC1G,qBAAsB,GAAGE,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,KAAK,IAAIA,EAAe,UAAU,GACzH,kBAAmB,GAAGF,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,KAAK,IAAIJ,GAAa,KAAK,GAC/G,0BAA2B,GAAGE,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,KAAK,IAAIA,EAAe,UAAU,GAC9H,eAAgB,GAAGF,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,UAAU,IAAIH,EAAY,OAAO,GAClH,oBAAqB,GAAGC,EAAY,KAAK,IAAIC,EAAgB,MAAM,KAAKC,EAAe,UAAU,IAAIH,EAAY,OAAO,GACxH,yBAA0B,GAAGC,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,KAAK,IAAIA,EAAe,UAAU,IAAIH,EAAY,OAAO,GACpJ,oBAAqB,GAAGC,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,KAAK,IAAIA,EAAe,UAAU,GAExH,QAAS,GAAGF,EAAY,OAAO,IAAIC,EAAgB,MAAM,IAAIF,EAAY,OAAO,IAAID,GAAa,OAAO,GACxG,gBAAiB,GAAGE,EAAY,OAAO,IAAIC,EAAgB,MAAM,IAAIF,EAAY,OAAO,IAAIG,EAAe,UAAU,GACrH,aAAc,GAAGF,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,YAAY,IAAIJ,GAAa,YAAY,GACxH,qBAAsB,GAAGE,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,YAAY,IAAIA,EAAe,UAAU,GAChI,aAAc,GAAGF,EAAY,YAAY,IAAIC,EAAgB,MAAM,IAAIF,EAAY,OAAO,IAAID,GAAa,OAAO,GAClH,qBAAsB,GAAGE,EAAY,YAAY,IAAIC,EAAgB,MAAM,IAAIF,EAAY,OAAO,IAAIG,EAAe,UAAU,GAC/H,kBAAmB,GAAGF,EAAY,YAAY,IAAIC,EAAgB,MAAM,IAAIC,EAAe,YAAY,IAAIJ,GAAa,YAAY,GACpI,0BAA2B,GAAGE,EAAY,YAAY,IAAIC,EAAgB,MAAM,IAAIC,EAAe,YAAY,IAAIA,EAAe,UAAU,GAC5I,eAAgB,GAAGF,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIF,EAAY,OAAO,IAAIG,EAAe,UAAU,GAClH,oBAAqB,GAAGF,EAAY,YAAY,IAAIC,EAAgB,MAAM,IAAIF,EAAY,OAAO,IAAIG,EAAe,UAAU,GAC9H,oBAAqB,GAAGF,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,UAAU,IAAIA,EAAe,YAAY,GAC/H,yBAA0B,GAAGF,EAAY,YAAY,IAAIC,EAAgB,MAAM,IAAIC,EAAe,UAAU,IAAIA,EAAe,YAAY,GAE3I,SAAU,GAAGF,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIF,EAAY,QAAQ,IAAID,GAAa,WAAW,GAC5G,iBAAkB,GAAGE,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIF,EAAY,QAAQ,IAAIG,EAAe,UAAU,GACrH,cAAe,GAAGF,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,aAAa,IAAIJ,GAAa,aAAa,GAC3H,sBAAuB,GAAGE,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,aAAa,GAAGA,EAAe,UAAU,GACjI,cAAe,GAAGF,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIF,EAAY,QAAQ,IAAID,GAAa,WAAW,GACjH,sBAAuB,GAAGE,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIF,EAAY,QAAQ,IAAIG,EAAe,UAAU,GAC1H,mBAAoB,GAAGF,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,aAAa,IAAIJ,GAAa,aAAa,GAChI,2BAA4B,GAAGE,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,aAAa,IAAIA,EAAe,UAAU,GACvI,gBAAiB,GAAGF,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIF,EAAY,QAAQ,IAAIG,EAAe,UAAU,GACpH,qBAAsB,GAAGF,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,UAAU,IAAIH,EAAY,QAAQ,GACzH,qBAAsB,GAAGC,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,aAAa,IAAIH,EAAY,QAAQ,IAAIG,EAAe,UAAU,GACzJ,0BAA2B,GAAGF,EAAY,KAAK,IAAIC,EAAgB,MAAM,IAAIC,EAAe,aAAa,IAAIA,EAAe,UAAU,GAEtI,KAAM,GAAGF,EAAY,IAAI,IAAIC,EAAgB,MAAM,IAAIF,EAAY,IAAI,IAAID,GAAa,IAAI,GAC5F,UAAW,GAAGE,EAAY,SAAS,IAAIC,EAAgB,MAAM,IAAIF,EAAY,IAAI,IAAID,GAAa,IAAI,GACtG,YAAa,GAAGE,EAAY,IAAI,IAAIC,EAAgB,MAAM,IAAIF,EAAY,IAAI,IAAIG,EAAe,UAAU,GAC3G,iBAAkB,GAAGF,EAAY,SAAS,IAAIC,EAAgB,MAAM,IAAIF,EAAY,IAAI,IAAIG,EAAe,UAAU,GAErH,KAAM,GAAGF,EAAY,IAAI,IAAIC,EAAgB,MAAM,IAAIF,EAAY,IAAI,GACvE,UAAW,GAAGC,EAAY,IAAI,IAAIC,EAAgB,MAAM,IAAIF,EAAY,IAAI,GAC5E,aAAc,qFACd,KAAM,UACN,UAAW,oBACX,aAAc,WAChB,EAOMK,GAAN,cAAyBC,GAAiBC,CAAU,CAAE,CA2DpD,aAAc,CACZ,MAAM,EArDR,UAAmB,SAsDjBC,GAAaC,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAEvE,KAAK,QAAU,YACf,KAAK,qBAAuBC,EAAK,EAAE,CACjC,GAAI,sBACJ,QAAS,aACT,QAAS,oDACX,CAAC,CACH,CAhBA,QAAQC,EAAyC,CAC3CA,EAAkB,IAAI,OAAO,GAC/B,KAAK,SAAS,KAAK,KAAK,CAE5B,CAcA,mBAAoB,CAGlB,GAFA,MAAM,kBAAkB,EAEpB,CAACd,GAAS,SAAS,KAAK,OAAO,EACjC,MAAM,IAAI,MAAM;AAAA,EAAwEA,GAAS,KAAK,IAAI,CAAC,GAAG,CAElH,CAEA,cAAe,CACT,KAAK,WACP,WAAW,IAAM,KAAK,MAAM,EAAG,CAAC,CAEpC,CAGA,IAAI,iBAAkB,CACpB,MAAO,CACL,CAAC,KAAK,OAAS,CAAC,KAAK,OAAS,CAAC,KAAK,SAAWO,EAAS,QACxD,KAAK,OAAS,CAAC,KAAK,OAAS,CAAC,KAAK,SAAWA,EAAS,aACvD,KAAK,OAAS,KAAK,OAAS,CAAC,KAAK,SAAWA,EAAS,kBACtD,KAAK,OAAS,KAAK,UAAY,KAAK,MAAQA,EAAS,yBAA2BA,EAAS,qBACzF,CAAC,KAAK,OAAS,KAAK,OAAS,CAAC,KAAK,SAAWA,EAAS,aACvD,CAAC,KAAK,OAAS,KAAK,UAAY,KAAK,MAAQA,EAAS,oBAAsBA,EAAS,eACvF,CACF,CAGA,IAAI,mBAAoB,CACtB,MAAO,CACL,CAAC,KAAK,OAAS,CAAC,KAAK,OAAS,CAAC,KAAK,SAAWA,EAAS,UACxD,KAAK,OAAS,CAAC,KAAK,OAAS,CAAC,KAAK,SAAWA,EAAS,eACvD,KAAK,OAAS,KAAK,UAAY,KAAK,MAAQA,EAAS,2BAA6BA,EAAS,uBAC3F,KAAK,OAAS,KAAK,OAAS,CAAC,KAAK,SAAWA,EAAS,oBACtD,CAAC,KAAK,OAAS,KAAK,OAAS,CAAC,KAAK,SAAWA,EAAS,eACvD,CAAC,KAAK,OAAS,KAAK,UAAY,KAAK,MAAQA,EAAS,sBAAwBA,EAAS,iBACzF,CACF,CAGA,IAAI,iBAAkB,CACpB,MAAO,CACL,CAAC,KAAK,OAAS,CAAC,KAAK,OAAS,CAAC,KAAK,SAAWA,EAAS,QACxD,KAAK,OAAS,CAAC,KAAK,OAAS,CAAC,KAAK,SAAWA,EAAS,aACvD,KAAK,OAAS,KAAK,OAAS,CAAC,KAAK,SAAWA,EAAS,kBACtD,KAAK,OAAS,KAAK,UAAY,KAAK,MAAQA,EAAS,yBAA2BA,EAAS,qBACzF,CAAC,KAAK,OAAS,KAAK,OAAS,CAAC,KAAK,SAAWA,EAAS,aACvD,CAAC,KAAK,OAAS,KAAK,UAAY,KAAK,MAAQA,EAAS,oBAAsBA,EAAS,eACvF,CACF,CAGA,IAAI,kBAAmB,CACrB,MAAO,CACL,CAAC,KAAK,OAAS,CAAC,KAAK,OAAS,CAAC,KAAK,SAAWA,EAAS,SACxD,KAAK,OAAS,CAAC,KAAK,OAAS,CAAC,KAAK,SAAWA,EAAS,cACvD,KAAK,OAAS,KAAK,OAAS,CAAC,KAAK,SAAWA,EAAS,mBACtD,KAAK,OAAS,KAAK,UAAY,KAAK,MAAQA,EAAS,0BAA4BA,EAAS,sBAC1F,CAAC,KAAK,OAAS,KAAK,OAAS,CAAC,KAAK,SAAWA,EAAS,cACvD,CAAC,KAAK,OAAS,KAAK,UAAY,KAAK,MAAQA,EAAS,qBAAuBA,EAAS,gBACxF,CACF,CAGA,IAAI,cAAe,CACjB,MAAO,CACL,CAAC,KAAK,UAAY,KAAK,MAAQA,EAAS,UAAYA,EAAS,MAC7D,KAAK,UAAY,KAAK,MAAQA,EAAS,iBAAmBA,EAAS,YACrE,CACF,CAGA,IAAI,cAAe,CACjB,MAAO,CAAC,KAAK,MAAQA,EAAS,UAAYA,EAAS,IAAI,CACzD,CAEA,IAAI,UAAW,CACb,OAAOQ,EAAW,KAAK,YAAa,CAClC,KAAK,UAAY,WAAa,KAAK,gBACnC,KAAK,UAAY,aAAe,KAAK,kBACrC,KAAK,UAAY,WAAa,KAAK,gBACnC,KAAK,UAAY,YAAc,KAAK,iBACpC,KAAK,UAAY,QAAU,KAAK,aAChC,KAAK,UAAY,QAAU,KAAK,aAChC,KAAK,MAAQR,EAAS,aACtB,KAAK,UAAYA,EAAS,UAAYA,EAAS,YACjD,CAAC,CACH,CAGA,oBAAqB,CACf,KAAK,OAAS,SAAU,KAAK,UAAU,KAAK,cAAc,EACrD,KAAK,OAAS,SAAS,KAAK,UAAU,KAAK,MAAM,CAC5D,CAEA,QAAS,CACP,OAAOS,KAAQ,KAAK,KAChBA;AAAA,iBACS,KAAK,IAAI;AAAA,mBACP,KAAK,MAAM;AAAA,gBACd,KAAK,SAAW,SAAW,KAAK,KAAO,WAAa,MAAS;AAAA,kBAC3D,KAAK,QAAQ;AAAA;AAAA,mBAGvBA,iBAAoB,KAAK,MAAQ,QAAQ,UAAU,KAAK,QAAQ,YAAY,KAAK,kBAAkB;AAAA;AAAA,kBAEzF;AAAA,MACZ,KAAK,QACHA,gFAAmF,KAAK,oBAAoB,WAC5G,IAAI,EACV,CACF,EArLMR,GACG,kBAAoB,CACzB,GAAGS,GAAY,kBACf,eAAgB,EAClB,EAJIT,GAmDG,OAAS,CAACU,EAAOC,EAAM,EA5C9BC,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GANvBb,GAOJ,oBAGAY,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GATtCb,GAUJ,yBAGAY,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GAZvBb,GAaJ,uBAMAY,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAlBtCb,GAmBJ,qBAGAY,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GArBtCb,GAsBJ,qBAGAY,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAxBtCb,GAyBJ,uBAGAY,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GA3BvBb,GA4BJ,oBAGAY,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GA9BvBb,GA+BJ,sBAGAY,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GAjCvBb,GAkCJ,mBAGAY,EAAA,CADCC,EAAS,CAAE,UAAW,aAAc,KAAM,QAAS,QAAS,EAAK,CAAC,GApC/Db,GAqCJ,yBAGAY,EAAA,CADCC,EAAS,CAAE,UAAW,eAAgB,QAAS,EAAK,CAAC,GAvClDb,GAwCJ,2BAGAY,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GA1CvBb,GA2CJ,oBAGAY,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GA7CvBb,GA8CJ,qBAyIG,eAAe,IAAI,UAAU,GAChC,eAAe,OAAO,WAAYA,EAAU,EO/UrB,IAAMc,GAAS,KAAK,MAAM,kCAAmC,ECA7D,IAAMC,GAAS,KAAK,MAAM,iCAAqC,ECA/D,IAAMC,GAAS,KAAK,MAAM,kCAAsC,ECAhE,IAAMC,GAAS,KAAK,MAAM,+BAAmC,ECA7D,IAAMC,GAAS,KAAK,MAAM,kCAAmC,ECApD,IAAMC,GAASC,yuFCmB1C,IAAMC,GAAS,CACpB,KAAM,yDACN,OAAQ,iHACR,SAAU,yEACV,QAAS,qDACT,kBAAmB,kDACnB,gBAAiB,8FACjB,KAAM,qBACN,eAAgB,gGAChB,aACE,sJACF,KAAM,SACR,EAEMC,GAAO,CACX,MAAO,QACP,MAAO,GACT,EAOMC,GAAN,cAAuBC,CAAW,CA+BhC,aAAc,CACZ,MAAM,EAZR,cAAoB,GAGpB,UAAgB,GAGhB,eAAqB,GAOnBC,GAAaC,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAEvE,KAAK,WAAaC,EAAK,EAAE,CACvB,GAAI,mBACJ,QAAS,SACT,QAAS,6DACX,CAAC,CACH,CAGA,IAAI,mBAAoB,CACtB,OAAOC,EAAW,CAChBP,GAAO,KACP,KAAK,KAAOA,GAAO,KAAOA,GAAO,OACjC,KAAK,UAAY,CAAC,KAAK,MAAQA,GAAO,SACtC,KAAK,UAAY,KAAK,KAAOA,GAAO,aAAeA,GAAO,cAC5D,CAAC,CACH,CAGA,IAAI,iBAAkB,CACpB,OAAOO,EAAW,CAACP,GAAO,QAAS,KAAK,SAAWA,GAAO,gBAAkBA,GAAO,iBAAiB,CAAC,CACvG,CAGA,IAAI,qBAAsB,CACxB,IAAMQ,EAAe,IACnBC,mBAAsBT,GAAO,IAAI,mBAAmB,KAAK,QAAQ,mBAAmB,KAAK,UAAU,YAC/FU,EAAa,IAAMD,0EAEzB,OAAO,KAAK,UAAYD,EAAa,EAAI,KAAK,SAAWE,EAAW,EAAI,EAC1E,CAEA,WAAWC,EAAkB,CACvB,CAAC,KAAK,WAAaA,EAAE,QAAUA,EAAE,UACjCA,EAAE,MAAQV,GAAK,OAASU,EAAE,MAAQV,GAAK,SACzCU,EAAE,eAAe,EACjB,KAAK,MAAM,EAEf,CAEA,QAAS,CACP,OAAOF;AAAA,sBACWG,EAAU,KAAK,UAAY,IAAM,MAAS,CAAC,WAAW,KAAK,iBAAiB,cAAc,KAAK,UAAU;AAAA,UACrH,KAAK,mBAAmB,IAAI,KAAK,KAAO,GAAKH,gBAAmB,KAAK,eAAe,UAAU;AAAA;AAAA;AAAA,KAItG,CACF,EAlFMP,GACG,OAAS,CACdW,EACAC,GACAX;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,KAaF,EAGAY,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAnBtCd,GAoBJ,wBAGAa,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,CAAC,GAtBvBd,GAuBJ,oBAGAa,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,CAAC,GAzBvBd,GA0BJ,yBA0DG,eAAe,IAAI,QAAQ,GAC9B,eAAe,OAAO,SAAUA,EAAQ,EC5H1C,OAAOe,OAAiB,yBCiDjB,IAAMC,GAAU,KAAK,IAAI,GAAI,CAAC,EAAI,GAAK,GAAK,GAAK,IAgB3CC,GAAU,CAACD,GAOXE,GAAqB,OAOrBC,GAAoB,MA6E1B,IAAMC,GAAgB,KActB,IAAMC,GAAeC,GAAgB,GAO/BC,GAAgBF,GAAe,EAO/BG,GAAgBH,GAAe,SAO/BI,GAAiBD,GAAgB,GAOjCE,GAAmBD,GAAiB,EAapCE,GAAsB,OAAO,IAAI,mBAAmB,EClL1D,SAASC,EAAcC,EAAMC,EAAO,CACzC,OAAI,OAAOD,GAAS,WAAmBA,EAAKC,CAAK,EAE7CD,GAAQ,OAAOA,GAAS,UAAYE,MAAuBF,EACtDA,EAAKE,EAAmB,EAAED,CAAK,EAEpCD,aAAgB,KAAa,IAAIA,EAAK,YAAYC,CAAK,EAEpD,IAAI,KAAKA,CAAK,CACvB,CCNO,SAASE,EAAOC,EAAUC,EAAS,CAExC,OAAOC,EAAcD,GAAWD,EAAUA,CAAQ,CACpD,CCdO,SAASG,GAAQC,EAAMC,EAAQC,EAAS,CAC7C,IAAMC,EAAQC,EAAOJ,EAAME,GAAA,YAAAA,EAAS,EAAE,EACtC,OAAI,MAAMD,CAAM,EAAUI,GAAcH,GAAA,YAAAA,EAAS,KAAMF,EAAM,GAAG,GAG3DC,GAELE,EAAM,QAAQA,EAAM,QAAQ,EAAIF,CAAM,EAC/BE,EACT,CCLO,SAASG,GAAUC,EAAMC,EAAQC,EAAS,CAC/C,IAAMC,EAAQC,EAAOJ,EAAME,GAAA,YAAAA,EAAS,EAAE,EACtC,GAAI,MAAMD,CAAM,EAAG,OAAOI,GAAcH,GAAA,YAAAA,EAAS,KAAMF,EAAM,GAAG,EAChE,GAAI,CAACC,EAEH,OAAOE,EAET,IAAMG,EAAaH,EAAM,QAAQ,EAU3BI,EAAoBF,GAAcH,GAAA,YAAAA,EAAS,KAAMF,EAAMG,EAAM,QAAQ,CAAC,EAC5EI,EAAkB,SAASJ,EAAM,SAAS,EAAIF,EAAS,EAAG,CAAC,EAC3D,IAAMO,EAAcD,EAAkB,QAAQ,EAC9C,OAAID,GAAcE,EAGTD,GASPJ,EAAM,YACJI,EAAkB,YAAY,EAC9BA,EAAkB,SAAS,EAC3BD,CACF,EACOH,EAEX,CCxEA,IAAIM,GAAiB,CAAC,EAEf,SAASC,IAAoB,CAClC,OAAOD,EACT,CC8BO,SAASE,GAAYC,EAAMC,EAAS,CAlC3C,IAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAmCE,IAAMC,EAAiBC,GAAkB,EACnCC,GACJH,GAAAD,GAAAH,GAAAD,EAAAH,GAAA,YAAAA,EAAS,eAAT,KAAAG,GACAD,GAAAD,EAAAD,GAAA,YAAAA,EAAS,SAAT,YAAAC,EAAiB,UAAjB,YAAAC,EAA0B,eAD1B,KAAAE,EAEAK,EAAe,eAFf,KAAAF,GAGAD,GAAAD,EAAAI,EAAe,SAAf,YAAAJ,EAAuB,UAAvB,YAAAC,EAAgC,eAHhC,KAAAE,EAIA,EAEII,EAAQC,EAAOd,EAAMC,GAAA,YAAAA,EAAS,EAAE,EAChCc,EAAMF,EAAM,OAAO,EACnBG,GAAQD,EAAMH,EAAe,EAAI,GAAKG,EAAMH,EAElD,OAAAC,EAAM,QAAQA,EAAM,QAAQ,EAAIG,CAAI,EACpCH,EAAM,SAAS,EAAG,EAAG,EAAG,CAAC,EAClBA,CACT,CCpBO,SAASI,GAAeC,EAAMC,EAAS,CAC5C,OAAOC,GAAYF,EAAM,CAAE,GAAGC,EAAS,aAAc,CAAE,CAAC,CAC1D,CCJO,SAASE,GAAeC,EAAMC,EAAS,CAC5C,IAAMC,EAAQC,EAAOH,EAAMC,GAAA,YAAAA,EAAS,EAAE,EAChCG,EAAOF,EAAM,YAAY,EAEzBG,EAA4BC,EAAcJ,EAAO,CAAC,EACxDG,EAA0B,YAAYD,EAAO,EAAG,EAAG,CAAC,EACpDC,EAA0B,SAAS,EAAG,EAAG,EAAG,CAAC,EAC7C,IAAME,EAAkBC,GAAeH,CAAyB,EAE1DI,EAA4BH,EAAcJ,EAAO,CAAC,EACxDO,EAA0B,YAAYL,EAAM,EAAG,CAAC,EAChDK,EAA0B,SAAS,EAAG,EAAG,EAAG,CAAC,EAC7C,IAAMC,EAAkBF,GAAeC,CAAyB,EAEhE,OAAIP,EAAM,QAAQ,GAAKK,EAAgB,QAAQ,EACtCH,EAAO,EACLF,EAAM,QAAQ,GAAKQ,EAAgB,QAAQ,EAC7CN,EAEAA,EAAO,CAElB,CCpCO,SAASO,GAAgCC,EAAM,CACpD,IAAMC,EAAQC,EAAOF,CAAI,EACnBG,EAAU,IAAI,KAClB,KAAK,IACHF,EAAM,YAAY,EAClBA,EAAM,SAAS,EACfA,EAAM,QAAQ,EACdA,EAAM,SAAS,EACfA,EAAM,WAAW,EACjBA,EAAM,WAAW,EACjBA,EAAM,gBAAgB,CACxB,CACF,EACA,OAAAE,EAAQ,eAAeF,EAAM,YAAY,CAAC,EACnC,CAACD,EAAO,CAACG,CAClB,CC1BO,SAASC,GAAeC,KAAYC,EAAO,CAChD,IAAMC,EAAYC,EAAc,KAC9B,KACAH,GAAWC,EAAM,KAAMG,GAAS,OAAOA,GAAS,QAAQ,CAC1D,EACA,OAAOH,EAAM,IAAIC,CAAS,CAC5B,CCoBO,SAASG,GAAWC,EAAMC,EAAS,CACxC,IAAMC,EAAQC,EAAOH,EAAMC,GAAA,YAAAA,EAAS,EAAE,EACtC,OAAAC,EAAM,SAAS,EAAG,EAAG,EAAG,CAAC,EAClBA,CACT,CCQO,SAASE,GAAyBC,EAAWC,EAAaC,EAAS,CACxE,GAAM,CAACC,EAAYC,CAAY,EAAIC,GACjCH,GAAA,YAAAA,EAAS,GACTF,EACAC,CACF,EAEMK,EAAkBC,GAAWJ,CAAU,EACvCK,EAAoBD,GAAWH,CAAY,EAE3CK,EACJ,CAACH,EAAkBI,GAAgCJ,CAAe,EAC9DK,EACJ,CAACH,EAAoBE,GAAgCF,CAAiB,EAKxE,OAAO,KAAK,OAAOC,EAAiBE,GAAoBC,EAAiB,CAC3E,CC1BO,SAASC,GAAmBC,EAAMC,EAAS,CAChD,IAAMC,EAAOC,GAAeH,EAAMC,CAAO,EACnCG,EAAkBC,GAAcJ,GAAA,YAAAA,EAAS,KAAMD,EAAM,CAAC,EAC5D,OAAAI,EAAgB,YAAYF,EAAM,EAAG,CAAC,EACtCE,EAAgB,SAAS,EAAG,EAAG,EAAG,CAAC,EAC5BE,GAAeF,CAAe,CACvC,CCXO,SAASG,GAASC,EAAMC,EAAQC,EAAS,CAC9C,OAAOC,GAAQH,EAAMC,EAAS,EAAGC,CAAO,CAC1C,CCAO,SAASE,GAAaC,EAAM,CACjC,OAAOC,EAAcD,EAAM,KAAK,IAAI,CAAC,CACvC,CCIO,SAASE,GAAUC,EAAWC,EAAaC,EAAS,CACzD,GAAM,CAACC,EAAWC,CAAU,EAAIC,GAC9BH,GAAA,YAAAA,EAAS,GACTF,EACAC,CACF,EACA,MAAO,CAACK,GAAWH,CAAS,GAAM,CAACG,GAAWF,CAAU,CAC1D,CCXO,SAASG,GAAOC,EAAO,CAC5B,OACEA,aAAiB,MAChB,OAAOA,GAAU,UAChB,OAAO,UAAU,SAAS,KAAKA,CAAK,IAAM,eAEhD,CCJO,SAASC,GAAQC,EAAM,CAC5B,MAAO,EAAG,CAACC,GAAOD,CAAI,GAAK,OAAOA,GAAS,UAAa,MAAM,CAACE,EAAOF,CAAI,CAAC,EAC7E,CClCO,SAASG,GAAkBC,EAASC,EAAU,CACnD,GAAM,CAACC,EAAOC,CAAG,EAAIC,GAAeJ,EAASC,EAAS,MAAOA,EAAS,GAAG,EACzE,MAAO,CAAE,MAAAC,EAAO,IAAAC,CAAI,CACtB,CCuCO,SAASE,GAAkBC,EAAUC,EAAS,CA5CrD,IAAAC,EA6CE,GAAM,CAAE,MAAAC,EAAO,IAAAC,CAAI,EAAIC,GAAkBJ,GAAA,YAAAA,EAAS,GAAID,CAAQ,EAE1DM,EAAW,CAACH,EAAQ,CAACC,EACnBG,EAAUD,EAAW,CAACH,EAAQ,CAACC,EAC/BI,EAAOF,EAAWF,EAAMD,EAC9BK,EAAK,SAAS,EAAG,EAAG,EAAG,CAAC,EAExB,IAAIC,GAAOP,EAAAD,GAAA,YAAAA,EAAS,OAAT,KAAAC,EAAiB,EAC5B,GAAI,CAACO,EAAM,MAAO,CAAC,EACfA,EAAO,IACTA,EAAO,CAACA,EACRH,EAAW,CAACA,GAGd,IAAMI,EAAQ,CAAC,EAEf,KAAO,CAACF,GAAQD,GACdG,EAAM,KAAKC,EAAcR,EAAOK,CAAI,CAAC,EACrCA,EAAK,QAAQA,EAAK,QAAQ,EAAIC,CAAI,EAClCD,EAAK,SAAS,EAAG,EAAG,EAAG,CAAC,EAG1B,OAAOF,EAAWI,EAAM,QAAQ,EAAIA,CACtC,CCvBO,SAASE,GAAmBC,EAAUC,EAAS,CA7CtD,IAAAC,EA8CE,GAAM,CAAE,MAAAC,EAAO,IAAAC,CAAI,EAAIC,GAAkBJ,GAAA,YAAAA,EAAS,GAAID,CAAQ,EAE1DM,EAAW,CAACH,EAAQ,CAACC,EACnBG,EAAgBD,EAClBE,GAAYJ,EAAKH,CAAO,EACxBO,GAAYL,EAAOF,CAAO,EACxBQ,EAAcH,EAChBE,GAAYL,EAAOF,CAAO,EAC1BO,GAAYJ,EAAKH,CAAO,EAE5BM,EAAc,SAAS,EAAE,EACzBE,EAAY,SAAS,EAAE,EAEvB,IAAMC,EAAU,CAACD,EAAY,QAAQ,EACjCE,EAAcJ,EAEdK,GAAOV,EAAAD,GAAA,YAAAA,EAAS,OAAT,KAAAC,EAAiB,EAC5B,GAAI,CAACU,EAAM,MAAO,CAAC,EACfA,EAAO,IACTA,EAAO,CAACA,EACRN,EAAW,CAACA,GAGd,IAAMO,EAAQ,CAAC,EAEf,KAAO,CAACF,GAAeD,GACrBC,EAAY,SAAS,CAAC,EACtBE,EAAM,KAAKC,EAAcX,EAAOQ,CAAW,CAAC,EAC5CA,EAAcI,GAASJ,EAAaC,CAAI,EACxCD,EAAY,SAAS,EAAE,EAGzB,OAAOL,EAAWO,EAAM,QAAQ,EAAIA,CACtC,CClDO,SAASG,GAAaC,EAAMC,EAAS,CAC1C,IAAMC,EAAQC,EAAOH,EAAMC,GAAA,YAAAA,EAAS,EAAE,EACtC,OAAAC,EAAM,QAAQ,CAAC,EACfA,EAAM,SAAS,EAAG,EAAG,EAAG,CAAC,EAClBA,CACT,CCNO,SAASE,GAAYC,EAAMC,EAAS,CACzC,IAAMC,EAAQC,EAAOH,EAAMC,GAAA,YAAAA,EAAS,EAAE,EACtC,OAAAC,EAAM,YAAYA,EAAM,YAAY,EAAG,EAAG,CAAC,EAC3CA,EAAM,SAAS,EAAG,EAAG,EAAG,CAAC,EAClBA,CACT,CCCO,SAASE,GAAUC,EAAMC,EAAS,CAlCzC,IAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAmCE,IAAMC,EAAiBC,GAAkB,EACnCC,GACJH,GAAAD,GAAAH,GAAAD,EAAAH,GAAA,YAAAA,EAAS,eAAT,KAAAG,GACAD,GAAAD,EAAAD,GAAA,YAAAA,EAAS,SAAT,YAAAC,EAAiB,UAAjB,YAAAC,EAA0B,eAD1B,KAAAE,EAEAK,EAAe,eAFf,KAAAF,GAGAD,GAAAD,EAAAI,EAAe,SAAf,YAAAJ,EAAuB,UAAvB,YAAAC,EAAgC,eAHhC,KAAAE,EAIA,EAEII,EAAQC,EAAOd,EAAMC,GAAA,YAAAA,EAAS,EAAE,EAChCc,EAAMF,EAAM,OAAO,EACnBG,GAAQD,EAAMH,EAAe,GAAK,GAAK,GAAKG,EAAMH,GAExD,OAAAC,EAAM,QAAQA,EAAM,QAAQ,EAAIG,CAAI,EACpCH,EAAM,SAAS,GAAI,GAAI,GAAI,GAAG,EACvBA,CACT,CClDA,IAAMI,GAAuB,CAC3B,iBAAkB,CAChB,IAAK,qBACL,MAAO,6BACT,EAEA,SAAU,CACR,IAAK,WACL,MAAO,mBACT,EAEA,YAAa,gBAEb,iBAAkB,CAChB,IAAK,qBACL,MAAO,6BACT,EAEA,SAAU,CACR,IAAK,WACL,MAAO,mBACT,EAEA,YAAa,CACX,IAAK,eACL,MAAO,uBACT,EAEA,OAAQ,CACN,IAAK,SACL,MAAO,iBACT,EAEA,MAAO,CACL,IAAK,QACL,MAAO,gBACT,EAEA,YAAa,CACX,IAAK,eACL,MAAO,uBACT,EAEA,OAAQ,CACN,IAAK,SACL,MAAO,iBACT,EAEA,aAAc,CACZ,IAAK,gBACL,MAAO,wBACT,EAEA,QAAS,CACP,IAAK,UACL,MAAO,kBACT,EAEA,YAAa,CACX,IAAK,eACL,MAAO,uBACT,EAEA,OAAQ,CACN,IAAK,SACL,MAAO,iBACT,EAEA,WAAY,CACV,IAAK,cACL,MAAO,sBACT,EAEA,aAAc,CACZ,IAAK,gBACL,MAAO,wBACT,CACF,EAEaC,GAAiB,CAACC,EAAOC,EAAOC,IAAY,CACvD,IAAIC,EAEEC,EAAaN,GAAqBE,CAAK,EAS7C,OARI,OAAOI,GAAe,SACxBD,EAASC,EACAH,IAAU,EACnBE,EAASC,EAAW,IAEpBD,EAASC,EAAW,MAAM,QAAQ,YAAaH,EAAM,SAAS,CAAC,EAG7DC,GAAA,MAAAA,EAAS,UACPA,EAAQ,YAAcA,EAAQ,WAAa,EACtC,MAAQC,EAERA,EAAS,OAIbA,CACT,ECpGO,SAASE,EAAkBC,EAAM,CACtC,MAAO,CAACC,EAAU,CAAC,IAAM,CAEvB,IAAMC,EAAQD,EAAQ,MAAQ,OAAOA,EAAQ,KAAK,EAAID,EAAK,aAE3D,OADeA,EAAK,QAAQE,CAAK,GAAKF,EAAK,QAAQA,EAAK,YAAY,CAEtE,CACF,CCLA,IAAMG,GAAc,CAClB,KAAM,mBACN,KAAM,aACN,OAAQ,WACR,MAAO,YACT,EAEMC,GAAc,CAClB,KAAM,iBACN,KAAM,cACN,OAAQ,YACR,MAAO,QACT,EAEMC,GAAkB,CACtB,KAAM,yBACN,KAAM,yBACN,OAAQ,qBACR,MAAO,oBACT,EAEaC,GAAa,CACxB,KAAMC,EAAkB,CACtB,QAASJ,GACT,aAAc,MAChB,CAAC,EAED,KAAMI,EAAkB,CACtB,QAASH,GACT,aAAc,MAChB,CAAC,EAED,SAAUG,EAAkB,CAC1B,QAASF,GACT,aAAc,MAChB,CAAC,CACH,ECtCA,IAAMG,GAAuB,CAC3B,SAAU,qBACV,UAAW,mBACX,MAAO,eACP,SAAU,kBACV,SAAU,cACV,MAAO,GACT,EAEaC,GAAiB,CAACC,EAAOC,EAAOC,EAAWC,IACtDL,GAAqBE,CAAK,EC6BrB,SAASI,EAAgBC,EAAM,CACpC,MAAO,CAACC,EAAOC,IAAY,CACzB,IAAMC,EAAUD,GAAA,MAAAA,EAAS,QAAU,OAAOA,EAAQ,OAAO,EAAI,aAEzDE,EACJ,GAAID,IAAY,cAAgBH,EAAK,iBAAkB,CACrD,IAAMK,EAAeL,EAAK,wBAA0BA,EAAK,aACnDM,EAAQJ,GAAA,MAAAA,EAAS,MAAQ,OAAOA,EAAQ,KAAK,EAAIG,EAEvDD,EACEJ,EAAK,iBAAiBM,CAAK,GAAKN,EAAK,iBAAiBK,CAAY,CACtE,KAAO,CACL,IAAMA,EAAeL,EAAK,aACpBM,EAAQJ,GAAA,MAAAA,EAAS,MAAQ,OAAOA,EAAQ,KAAK,EAAIF,EAAK,aAE5DI,EAAcJ,EAAK,OAAOM,CAAK,GAAKN,EAAK,OAAOK,CAAY,CAC9D,CACA,IAAME,EAAQP,EAAK,iBAAmBA,EAAK,iBAAiBC,CAAK,EAAIA,EAGrE,OAAOG,EAAYG,CAAK,CAC1B,CACF,CC3DA,IAAMC,GAAY,CAChB,OAAQ,CAAC,IAAK,GAAG,EACjB,YAAa,CAAC,KAAM,IAAI,EACxB,KAAM,CAAC,gBAAiB,aAAa,CACvC,EAEMC,GAAgB,CACpB,OAAQ,CAAC,IAAK,IAAK,IAAK,GAAG,EAC3B,YAAa,CAAC,KAAM,KAAM,KAAM,IAAI,EACpC,KAAM,CAAC,cAAe,cAAe,cAAe,aAAa,CACnE,EAMMC,GAAc,CAClB,OAAQ,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAAG,EACnE,YAAa,CACX,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,KACF,EAEA,KAAM,CACJ,UACA,WACA,QACA,QACA,MACA,OACA,OACA,SACA,YACA,UACA,WACA,UACF,CACF,EAEMC,GAAY,CAChB,OAAQ,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAAG,EAC1C,MAAO,CAAC,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,IAAI,EAChD,YAAa,CAAC,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,KAAK,EAC7D,KAAM,CACJ,SACA,SACA,UACA,YACA,WACA,SACA,UACF,CACF,EAEMC,GAAkB,CACtB,OAAQ,CACN,GAAI,IACJ,GAAI,IACJ,SAAU,KACV,KAAM,IACN,QAAS,UACT,UAAW,YACX,QAAS,UACT,MAAO,OACT,EACA,YAAa,CACX,GAAI,KACJ,GAAI,KACJ,SAAU,WACV,KAAM,OACN,QAAS,UACT,UAAW,YACX,QAAS,UACT,MAAO,OACT,EACA,KAAM,CACJ,GAAI,OACJ,GAAI,OACJ,SAAU,WACV,KAAM,OACN,QAAS,UACT,UAAW,YACX,QAAS,UACT,MAAO,OACT,CACF,EAEMC,GAA4B,CAChC,OAAQ,CACN,GAAI,IACJ,GAAI,IACJ,SAAU,KACV,KAAM,IACN,QAAS,iBACT,UAAW,mBACX,QAAS,iBACT,MAAO,UACT,EACA,YAAa,CACX,GAAI,KACJ,GAAI,KACJ,SAAU,WACV,KAAM,OACN,QAAS,iBACT,UAAW,mBACX,QAAS,iBACT,MAAO,UACT,EACA,KAAM,CACJ,GAAI,OACJ,GAAI,OACJ,SAAU,WACV,KAAM,OACN,QAAS,iBACT,UAAW,mBACX,QAAS,iBACT,MAAO,UACT,CACF,EAEMC,GAAgB,CAACC,EAAaC,IAAa,CAC/C,IAAMC,EAAS,OAAOF,CAAW,EAS3BG,EAASD,EAAS,IACxB,GAAIC,EAAS,IAAMA,EAAS,GAC1B,OAAQA,EAAS,GAAI,CACnB,IAAK,GACH,OAAOD,EAAS,KAClB,IAAK,GACH,OAAOA,EAAS,KAClB,IAAK,GACH,OAAOA,EAAS,IACpB,CAEF,OAAOA,EAAS,IAClB,EAEaE,GAAW,CACtB,cAAAL,GAEA,IAAKM,EAAgB,CACnB,OAAQZ,GACR,aAAc,MAChB,CAAC,EAED,QAASY,EAAgB,CACvB,OAAQX,GACR,aAAc,OACd,iBAAmBY,GAAYA,EAAU,CAC3C,CAAC,EAED,MAAOD,EAAgB,CACrB,OAAQV,GACR,aAAc,MAChB,CAAC,EAED,IAAKU,EAAgB,CACnB,OAAQT,GACR,aAAc,MAChB,CAAC,EAED,UAAWS,EAAgB,CACzB,OAAQR,GACR,aAAc,OACd,iBAAkBC,GAClB,uBAAwB,MAC1B,CAAC,CACH,EC1LO,SAASS,EAAaC,EAAM,CACjC,MAAO,CAACC,EAAQC,EAAU,CAAC,IAAM,CAC/B,IAAMC,EAAQD,EAAQ,MAEhBE,EACHD,GAASH,EAAK,cAAcG,CAAK,GAClCH,EAAK,cAAcA,EAAK,iBAAiB,EACrCK,EAAcJ,EAAO,MAAMG,CAAY,EAE7C,GAAI,CAACC,EACH,OAAO,KAET,IAAMC,EAAgBD,EAAY,CAAC,EAE7BE,EACHJ,GAASH,EAAK,cAAcG,CAAK,GAClCH,EAAK,cAAcA,EAAK,iBAAiB,EAErCQ,EAAM,MAAM,QAAQD,CAAa,EACnCE,GAAUF,EAAgBG,GAAYA,EAAQ,KAAKJ,CAAa,CAAC,EAEjEK,GAAQJ,EAAgBG,GAAYA,EAAQ,KAAKJ,CAAa,CAAC,EAE/DM,EAEJA,EAAQZ,EAAK,cAAgBA,EAAK,cAAcQ,CAAG,EAAIA,EACvDI,EAAQV,EAAQ,cAEZA,EAAQ,cAAcU,CAAK,EAC3BA,EAEJ,IAAMC,EAAOZ,EAAO,MAAMK,EAAc,MAAM,EAE9C,MAAO,CAAE,MAAAM,EAAO,KAAAC,CAAK,CACvB,CACF,CAEA,SAASF,GAAQG,EAAQC,EAAW,CAClC,QAAWP,KAAOM,EAChB,GACE,OAAO,UAAU,eAAe,KAAKA,EAAQN,CAAG,GAChDO,EAAUD,EAAON,CAAG,CAAC,EAErB,OAAOA,CAIb,CAEA,SAASC,GAAUO,EAAOD,EAAW,CACnC,QAASP,EAAM,EAAGA,EAAMQ,EAAM,OAAQR,IACpC,GAAIO,EAAUC,EAAMR,CAAG,CAAC,EACtB,OAAOA,CAIb,CCxDO,SAASS,GAAoBC,EAAM,CACxC,MAAO,CAACC,EAAQC,EAAU,CAAC,IAAM,CAC/B,IAAMC,EAAcF,EAAO,MAAMD,EAAK,YAAY,EAClD,GAAI,CAACG,EAAa,OAAO,KACzB,IAAMC,EAAgBD,EAAY,CAAC,EAE7BE,EAAcJ,EAAO,MAAMD,EAAK,YAAY,EAClD,GAAI,CAACK,EAAa,OAAO,KACzB,IAAIC,EAAQN,EAAK,cACbA,EAAK,cAAcK,EAAY,CAAC,CAAC,EACjCA,EAAY,CAAC,EAGjBC,EAAQJ,EAAQ,cAAgBA,EAAQ,cAAcI,CAAK,EAAIA,EAE/D,IAAMC,EAAON,EAAO,MAAMG,EAAc,MAAM,EAE9C,MAAO,CAAE,MAAAE,EAAO,KAAAC,CAAK,CACvB,CACF,CChBA,IAAMC,GAA4B,wBAC5BC,GAA4B,OAE5BC,GAAmB,CACvB,OAAQ,UACR,YAAa,6DACb,KAAM,4DACR,EACMC,GAAmB,CACvB,IAAK,CAAC,MAAO,SAAS,CACxB,EAEMC,GAAuB,CAC3B,OAAQ,WACR,YAAa,YACb,KAAM,gCACR,EACMC,GAAuB,CAC3B,IAAK,CAAC,KAAM,KAAM,KAAM,IAAI,CAC9B,EAEMC,GAAqB,CACzB,OAAQ,eACR,YAAa,sDACb,KAAM,2FACR,EACMC,GAAqB,CACzB,OAAQ,CACN,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,KACF,EAEA,IAAK,CACH,OACA,MACA,QACA,OACA,QACA,QACA,QACA,OACA,MACA,MACA,MACA,KACF,CACF,EAEMC,GAAmB,CACvB,OAAQ,YACR,MAAO,2BACP,YAAa,kCACb,KAAM,8DACR,EACMC,GAAmB,CACvB,OAAQ,CAAC,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,KAAK,EACxD,IAAK,CAAC,OAAQ,MAAO,OAAQ,MAAO,OAAQ,MAAO,MAAM,CAC3D,EAEMC,GAAyB,CAC7B,OAAQ,6DACR,IAAK,gFACP,EACMC,GAAyB,CAC7B,IAAK,CACH,GAAI,MACJ,GAAI,MACJ,SAAU,OACV,KAAM,OACN,QAAS,WACT,UAAW,aACX,QAAS,WACT,MAAO,QACT,CACF,EAEaC,GAAQ,CACnB,cAAeC,GAAoB,CACjC,aAAcb,GACd,aAAcC,GACd,cAAgBa,GAAU,SAASA,EAAO,EAAE,CAC9C,CAAC,EAED,IAAKC,EAAa,CAChB,cAAeb,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EAED,QAASY,EAAa,CACpB,cAAeX,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,MACnB,cAAgBW,GAAUA,EAAQ,CACpC,CAAC,EAED,MAAOD,EAAa,CAClB,cAAeT,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EAED,IAAKQ,EAAa,CAChB,cAAeP,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EAED,UAAWM,EAAa,CACtB,cAAeL,GACf,kBAAmB,MACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,CACH,ECrHO,IAAMM,GAAO,CAClB,KAAM,QACN,eAAgBC,GAChB,WAAYC,GACZ,eAAgBC,GAChB,SAAUC,GACV,MAAOC,GACP,QAAS,CACP,aAAc,EACd,sBAAuB,CACzB,CACF,ECCO,SAASC,GAAaC,EAAMC,EAAS,CAC1C,IAAMC,EAAQC,EAAOH,EAAMC,GAAA,YAAAA,EAAS,EAAE,EAGtC,OAFaG,GAAyBF,EAAOG,GAAYH,CAAK,CAAC,EACtC,CAE3B,CCFO,SAASI,GAAWC,EAAMC,EAAS,CACxC,IAAMC,EAAQC,EAAOH,EAAMC,GAAA,YAAAA,EAAS,EAAE,EAChCG,EAAO,CAACC,GAAeH,CAAK,EAAI,CAACI,GAAmBJ,CAAK,EAK/D,OAAO,KAAK,MAAME,EAAOG,EAAkB,EAAI,CACjD,CCMO,SAASC,GAAYC,EAAMC,EAAS,CA3C3C,IAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EA4CE,IAAMC,EAAQC,EAAOX,EAAMC,GAAA,YAAAA,EAAS,EAAE,EAChCW,EAAOF,EAAM,YAAY,EAEzBG,EAAiBC,GAAkB,EACnCC,GACJN,GAAAD,GAAAH,GAAAD,EAAAH,GAAA,YAAAA,EAAS,wBAAT,KAAAG,GACAD,GAAAD,EAAAD,GAAA,YAAAA,EAAS,SAAT,YAAAC,EAAiB,UAAjB,YAAAC,EAA0B,wBAD1B,KAAAE,EAEAQ,EAAe,wBAFf,KAAAL,GAGAD,GAAAD,EAAAO,EAAe,SAAf,YAAAP,EAAuB,UAAvB,YAAAC,EAAgC,wBAHhC,KAAAE,EAIA,EAEIO,EAAsBC,GAAchB,GAAA,YAAAA,EAAS,KAAMD,EAAM,CAAC,EAChEgB,EAAoB,YAAYJ,EAAO,EAAG,EAAGG,CAAqB,EAClEC,EAAoB,SAAS,EAAG,EAAG,EAAG,CAAC,EACvC,IAAME,EAAkBC,GAAYH,EAAqBf,CAAO,EAE1DmB,EAAsBH,GAAchB,GAAA,YAAAA,EAAS,KAAMD,EAAM,CAAC,EAChEoB,EAAoB,YAAYR,EAAM,EAAGG,CAAqB,EAC9DK,EAAoB,SAAS,EAAG,EAAG,EAAG,CAAC,EACvC,IAAMC,EAAkBF,GAAYC,EAAqBnB,CAAO,EAEhE,MAAI,CAACS,GAAS,CAACQ,EACNN,EAAO,EACL,CAACF,GAAS,CAACW,EACbT,EAEAA,EAAO,CAElB,CC1BO,SAASU,GAAgBC,EAAMC,EAAS,CA9C/C,IAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EA+CE,IAAMC,EAAiBC,GAAkB,EACnCC,GACJH,GAAAD,GAAAH,GAAAD,EAAAH,GAAA,YAAAA,EAAS,wBAAT,KAAAG,GACAD,GAAAD,EAAAD,GAAA,YAAAA,EAAS,SAAT,YAAAC,EAAiB,UAAjB,YAAAC,EAA0B,wBAD1B,KAAAE,EAEAK,EAAe,wBAFf,KAAAF,GAGAD,GAAAD,EAAAI,EAAe,SAAf,YAAAJ,EAAuB,UAAvB,YAAAC,EAAgC,wBAHhC,KAAAE,EAIA,EAEII,EAAOC,GAAYd,EAAMC,CAAO,EAChCc,EAAYC,GAAcf,GAAA,YAAAA,EAAS,KAAMD,EAAM,CAAC,EACtD,OAAAe,EAAU,YAAYF,EAAM,EAAGD,CAAqB,EACpDG,EAAU,SAAS,EAAG,EAAG,EAAG,CAAC,EACfE,GAAYF,EAAWd,CAAO,CAE9C,CClBO,SAASiB,GAAQC,EAAMC,EAAS,CACrC,IAAMC,EAAQC,EAAOH,EAAMC,GAAA,YAAAA,EAAS,EAAE,EAChCG,EAAO,CAACC,GAAYH,EAAOD,CAAO,EAAI,CAACK,GAAgBJ,EAAOD,CAAO,EAK3E,OAAO,KAAK,MAAMG,EAAOG,EAAkB,EAAI,CACjD,CCnDO,SAASC,EAAgBC,EAAQC,EAAc,CACpD,IAAMC,EAAOF,EAAS,EAAI,IAAM,GAC1BG,EAAS,KAAK,IAAIH,CAAM,EAAE,SAAS,EAAE,SAASC,EAAc,GAAG,EACrE,OAAOC,EAAOC,CAChB,CCWO,IAAMC,GAAkB,CAE7B,EAAEC,EAAMC,EAAO,CAUb,IAAMC,EAAaF,EAAK,YAAY,EAE9BG,EAAOD,EAAa,EAAIA,EAAa,EAAIA,EAC/C,OAAOE,EAAgBH,IAAU,KAAOE,EAAO,IAAMA,EAAMF,EAAM,MAAM,CACzE,EAGA,EAAED,EAAMC,EAAO,CACb,IAAMI,EAAQL,EAAK,SAAS,EAC5B,OAAOC,IAAU,IAAM,OAAOI,EAAQ,CAAC,EAAID,EAAgBC,EAAQ,EAAG,CAAC,CACzE,EAGA,EAAEL,EAAMC,EAAO,CACb,OAAOG,EAAgBJ,EAAK,QAAQ,EAAGC,EAAM,MAAM,CACrD,EAGA,EAAED,EAAMC,EAAO,CACb,IAAMK,EAAqBN,EAAK,SAAS,EAAI,IAAM,EAAI,KAAO,KAE9D,OAAQC,EAAO,CACb,IAAK,IACL,IAAK,KACH,OAAOK,EAAmB,YAAY,EACxC,IAAK,MACH,OAAOA,EACT,IAAK,QACH,OAAOA,EAAmB,CAAC,EAC7B,IAAK,OACL,QACE,OAAOA,IAAuB,KAAO,OAAS,MAClD,CACF,EAGA,EAAEN,EAAMC,EAAO,CACb,OAAOG,EAAgBJ,EAAK,SAAS,EAAI,IAAM,GAAIC,EAAM,MAAM,CACjE,EAGA,EAAED,EAAMC,EAAO,CACb,OAAOG,EAAgBJ,EAAK,SAAS,EAAGC,EAAM,MAAM,CACtD,EAGA,EAAED,EAAMC,EAAO,CACb,OAAOG,EAAgBJ,EAAK,WAAW,EAAGC,EAAM,MAAM,CACxD,EAGA,EAAED,EAAMC,EAAO,CACb,OAAOG,EAAgBJ,EAAK,WAAW,EAAGC,EAAM,MAAM,CACxD,EAGA,EAAED,EAAMC,EAAO,CACb,IAAMM,EAAiBN,EAAM,OACvBO,EAAeR,EAAK,gBAAgB,EACpCS,EAAoB,KAAK,MAC7BD,EAAe,KAAK,IAAI,GAAID,EAAiB,CAAC,CAChD,EACA,OAAOH,EAAgBK,EAAmBR,EAAM,MAAM,CACxD,CACF,EClFA,IAAMS,GAAgB,CACpB,GAAI,KACJ,GAAI,KACJ,SAAU,WACV,KAAM,OACN,QAAS,UACT,UAAW,YACX,QAAS,UACT,MAAO,OACT,EAgDaC,GAAa,CAExB,EAAG,SAAUC,EAAMC,EAAOC,EAAU,CAClC,IAAMC,EAAMH,EAAK,YAAY,EAAI,EAAI,EAAI,EACzC,OAAQC,EAAO,CAEb,IAAK,IACL,IAAK,KACL,IAAK,MACH,OAAOC,EAAS,IAAIC,EAAK,CAAE,MAAO,aAAc,CAAC,EAEnD,IAAK,QACH,OAAOD,EAAS,IAAIC,EAAK,CAAE,MAAO,QAAS,CAAC,EAE9C,IAAK,OACL,QACE,OAAOD,EAAS,IAAIC,EAAK,CAAE,MAAO,MAAO,CAAC,CAC9C,CACF,EAGA,EAAG,SAAUH,EAAMC,EAAOC,EAAU,CAElC,GAAID,IAAU,KAAM,CAClB,IAAMG,EAAaJ,EAAK,YAAY,EAE9BK,EAAOD,EAAa,EAAIA,EAAa,EAAIA,EAC/C,OAAOF,EAAS,cAAcG,EAAM,CAAE,KAAM,MAAO,CAAC,CACtD,CAEA,OAAOC,GAAgB,EAAEN,EAAMC,CAAK,CACtC,EAGA,EAAG,SAAUD,EAAMC,EAAOC,EAAUK,EAAS,CAC3C,IAAMC,EAAiBC,GAAYT,EAAMO,CAAO,EAE1CG,EAAWF,EAAiB,EAAIA,EAAiB,EAAIA,EAG3D,GAAIP,IAAU,KAAM,CAClB,IAAMU,EAAeD,EAAW,IAChC,OAAOE,EAAgBD,EAAc,CAAC,CACxC,CAGA,OAAIV,IAAU,KACLC,EAAS,cAAcQ,EAAU,CAAE,KAAM,MAAO,CAAC,EAInDE,EAAgBF,EAAUT,EAAM,MAAM,CAC/C,EAGA,EAAG,SAAUD,EAAMC,EAAO,CACxB,IAAMY,EAAcC,GAAed,CAAI,EAGvC,OAAOY,EAAgBC,EAAaZ,EAAM,MAAM,CAClD,EAWA,EAAG,SAAUD,EAAMC,EAAO,CACxB,IAAMI,EAAOL,EAAK,YAAY,EAC9B,OAAOY,EAAgBP,EAAMJ,EAAM,MAAM,CAC3C,EAGA,EAAG,SAAUD,EAAMC,EAAOC,EAAU,CAClC,IAAMa,EAAU,KAAK,MAAMf,EAAK,SAAS,EAAI,GAAK,CAAC,EACnD,OAAQC,EAAO,CAEb,IAAK,IACH,OAAO,OAAOc,CAAO,EAEvB,IAAK,KACH,OAAOH,EAAgBG,EAAS,CAAC,EAEnC,IAAK,KACH,OAAOb,EAAS,cAAca,EAAS,CAAE,KAAM,SAAU,CAAC,EAE5D,IAAK,MACH,OAAOb,EAAS,QAAQa,EAAS,CAC/B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOb,EAAS,QAAQa,EAAS,CAC/B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOb,EAAS,QAAQa,EAAS,CAC/B,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAGA,EAAG,SAAUf,EAAMC,EAAOC,EAAU,CAClC,IAAMa,EAAU,KAAK,MAAMf,EAAK,SAAS,EAAI,GAAK,CAAC,EACnD,OAAQC,EAAO,CAEb,IAAK,IACH,OAAO,OAAOc,CAAO,EAEvB,IAAK,KACH,OAAOH,EAAgBG,EAAS,CAAC,EAEnC,IAAK,KACH,OAAOb,EAAS,cAAca,EAAS,CAAE,KAAM,SAAU,CAAC,EAE5D,IAAK,MACH,OAAOb,EAAS,QAAQa,EAAS,CAC/B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOb,EAAS,QAAQa,EAAS,CAC/B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOb,EAAS,QAAQa,EAAS,CAC/B,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAGA,EAAG,SAAUf,EAAMC,EAAOC,EAAU,CAClC,IAAMc,EAAQhB,EAAK,SAAS,EAC5B,OAAQC,EAAO,CACb,IAAK,IACL,IAAK,KACH,OAAOK,GAAgB,EAAEN,EAAMC,CAAK,EAEtC,IAAK,KACH,OAAOC,EAAS,cAAcc,EAAQ,EAAG,CAAE,KAAM,OAAQ,CAAC,EAE5D,IAAK,MACH,OAAOd,EAAS,MAAMc,EAAO,CAC3B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOd,EAAS,MAAMc,EAAO,CAC3B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOd,EAAS,MAAMc,EAAO,CAAE,MAAO,OAAQ,QAAS,YAAa,CAAC,CACzE,CACF,EAGA,EAAG,SAAUhB,EAAMC,EAAOC,EAAU,CAClC,IAAMc,EAAQhB,EAAK,SAAS,EAC5B,OAAQC,EAAO,CAEb,IAAK,IACH,OAAO,OAAOe,EAAQ,CAAC,EAEzB,IAAK,KACH,OAAOJ,EAAgBI,EAAQ,EAAG,CAAC,EAErC,IAAK,KACH,OAAOd,EAAS,cAAcc,EAAQ,EAAG,CAAE,KAAM,OAAQ,CAAC,EAE5D,IAAK,MACH,OAAOd,EAAS,MAAMc,EAAO,CAC3B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOd,EAAS,MAAMc,EAAO,CAC3B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOd,EAAS,MAAMc,EAAO,CAAE,MAAO,OAAQ,QAAS,YAAa,CAAC,CACzE,CACF,EAGA,EAAG,SAAUhB,EAAMC,EAAOC,EAAUK,EAAS,CAC3C,IAAMU,EAAOC,GAAQlB,EAAMO,CAAO,EAElC,OAAIN,IAAU,KACLC,EAAS,cAAce,EAAM,CAAE,KAAM,MAAO,CAAC,EAG/CL,EAAgBK,EAAMhB,EAAM,MAAM,CAC3C,EAGA,EAAG,SAAUD,EAAMC,EAAOC,EAAU,CAClC,IAAMiB,EAAUC,GAAWpB,CAAI,EAE/B,OAAIC,IAAU,KACLC,EAAS,cAAciB,EAAS,CAAE,KAAM,MAAO,CAAC,EAGlDP,EAAgBO,EAASlB,EAAM,MAAM,CAC9C,EAGA,EAAG,SAAUD,EAAMC,EAAOC,EAAU,CAClC,OAAID,IAAU,KACLC,EAAS,cAAcF,EAAK,QAAQ,EAAG,CAAE,KAAM,MAAO,CAAC,EAGzDM,GAAgB,EAAEN,EAAMC,CAAK,CACtC,EAGA,EAAG,SAAUD,EAAMC,EAAOC,EAAU,CAClC,IAAMmB,EAAYC,GAAatB,CAAI,EAEnC,OAAIC,IAAU,KACLC,EAAS,cAAcmB,EAAW,CAAE,KAAM,WAAY,CAAC,EAGzDT,EAAgBS,EAAWpB,EAAM,MAAM,CAChD,EAGA,EAAG,SAAUD,EAAMC,EAAOC,EAAU,CAClC,IAAMqB,EAAYvB,EAAK,OAAO,EAC9B,OAAQC,EAAO,CAEb,IAAK,IACL,IAAK,KACL,IAAK,MACH,OAAOC,EAAS,IAAIqB,EAAW,CAC7B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,SACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,QACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAGA,EAAG,SAAUvB,EAAMC,EAAOC,EAAUK,EAAS,CAC3C,IAAMgB,EAAYvB,EAAK,OAAO,EACxBwB,GAAkBD,EAAYhB,EAAQ,aAAe,GAAK,GAAK,EACrE,OAAQN,EAAO,CAEb,IAAK,IACH,OAAO,OAAOuB,CAAc,EAE9B,IAAK,KACH,OAAOZ,EAAgBY,EAAgB,CAAC,EAE1C,IAAK,KACH,OAAOtB,EAAS,cAAcsB,EAAgB,CAAE,KAAM,KAAM,CAAC,EAC/D,IAAK,MACH,OAAOtB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,SACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,QACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAGA,EAAG,SAAUvB,EAAMC,EAAOC,EAAUK,EAAS,CAC3C,IAAMgB,EAAYvB,EAAK,OAAO,EACxBwB,GAAkBD,EAAYhB,EAAQ,aAAe,GAAK,GAAK,EACrE,OAAQN,EAAO,CAEb,IAAK,IACH,OAAO,OAAOuB,CAAc,EAE9B,IAAK,KACH,OAAOZ,EAAgBY,EAAgBvB,EAAM,MAAM,EAErD,IAAK,KACH,OAAOC,EAAS,cAAcsB,EAAgB,CAAE,KAAM,KAAM,CAAC,EAC/D,IAAK,MACH,OAAOtB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,SACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,QACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAGA,EAAG,SAAUvB,EAAMC,EAAOC,EAAU,CAClC,IAAMqB,EAAYvB,EAAK,OAAO,EACxByB,EAAeF,IAAc,EAAI,EAAIA,EAC3C,OAAQtB,EAAO,CAEb,IAAK,IACH,OAAO,OAAOwB,CAAY,EAE5B,IAAK,KACH,OAAOb,EAAgBa,EAAcxB,EAAM,MAAM,EAEnD,IAAK,KACH,OAAOC,EAAS,cAAcuB,EAAc,CAAE,KAAM,KAAM,CAAC,EAE7D,IAAK,MACH,OAAOvB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,cACP,QAAS,YACX,CAAC,EAEH,IAAK,QACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,SACP,QAAS,YACX,CAAC,EAEH,IAAK,SACH,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,QACP,QAAS,YACX,CAAC,EAEH,IAAK,OACL,QACE,OAAOrB,EAAS,IAAIqB,EAAW,CAC7B,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAGA,EAAG,SAAUvB,EAAMC,EAAOC,EAAU,CAElC,IAAMwB,EADQ1B,EAAK,SAAS,EACO,IAAM,EAAI,KAAO,KAEpD,OAAQC,EAAO,CACb,IAAK,IACL,IAAK,KACH,OAAOC,EAAS,UAAUwB,EAAoB,CAC5C,MAAO,cACP,QAAS,YACX,CAAC,EACH,IAAK,MACH,OAAOxB,EACJ,UAAUwB,EAAoB,CAC7B,MAAO,cACP,QAAS,YACX,CAAC,EACA,YAAY,EACjB,IAAK,QACH,OAAOxB,EAAS,UAAUwB,EAAoB,CAC5C,MAAO,SACP,QAAS,YACX,CAAC,EACH,IAAK,OACL,QACE,OAAOxB,EAAS,UAAUwB,EAAoB,CAC5C,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAGA,EAAG,SAAU1B,EAAMC,EAAOC,EAAU,CAClC,IAAMyB,EAAQ3B,EAAK,SAAS,EACxB0B,EASJ,OARIC,IAAU,GACZD,EAAqB5B,GAAc,KAC1B6B,IAAU,EACnBD,EAAqB5B,GAAc,SAEnC4B,EAAqBC,EAAQ,IAAM,EAAI,KAAO,KAGxC1B,EAAO,CACb,IAAK,IACL,IAAK,KACH,OAAOC,EAAS,UAAUwB,EAAoB,CAC5C,MAAO,cACP,QAAS,YACX,CAAC,EACH,IAAK,MACH,OAAOxB,EACJ,UAAUwB,EAAoB,CAC7B,MAAO,cACP,QAAS,YACX,CAAC,EACA,YAAY,EACjB,IAAK,QACH,OAAOxB,EAAS,UAAUwB,EAAoB,CAC5C,MAAO,SACP,QAAS,YACX,CAAC,EACH,IAAK,OACL,QACE,OAAOxB,EAAS,UAAUwB,EAAoB,CAC5C,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAGA,EAAG,SAAU1B,EAAMC,EAAOC,EAAU,CAClC,IAAMyB,EAAQ3B,EAAK,SAAS,EACxB0B,EAWJ,OAVIC,GAAS,GACXD,EAAqB5B,GAAc,QAC1B6B,GAAS,GAClBD,EAAqB5B,GAAc,UAC1B6B,GAAS,EAClBD,EAAqB5B,GAAc,QAEnC4B,EAAqB5B,GAAc,MAG7BG,EAAO,CACb,IAAK,IACL,IAAK,KACL,IAAK,MACH,OAAOC,EAAS,UAAUwB,EAAoB,CAC5C,MAAO,cACP,QAAS,YACX,CAAC,EACH,IAAK,QACH,OAAOxB,EAAS,UAAUwB,EAAoB,CAC5C,MAAO,SACP,QAAS,YACX,CAAC,EACH,IAAK,OACL,QACE,OAAOxB,EAAS,UAAUwB,EAAoB,CAC5C,MAAO,OACP,QAAS,YACX,CAAC,CACL,CACF,EAGA,EAAG,SAAU1B,EAAMC,EAAOC,EAAU,CAClC,GAAID,IAAU,KAAM,CAClB,IAAI0B,EAAQ3B,EAAK,SAAS,EAAI,GAC9B,OAAI2B,IAAU,IAAGA,EAAQ,IAClBzB,EAAS,cAAcyB,EAAO,CAAE,KAAM,MAAO,CAAC,CACvD,CAEA,OAAOrB,GAAgB,EAAEN,EAAMC,CAAK,CACtC,EAGA,EAAG,SAAUD,EAAMC,EAAOC,EAAU,CAClC,OAAID,IAAU,KACLC,EAAS,cAAcF,EAAK,SAAS,EAAG,CAAE,KAAM,MAAO,CAAC,EAG1DM,GAAgB,EAAEN,EAAMC,CAAK,CACtC,EAGA,EAAG,SAAUD,EAAMC,EAAOC,EAAU,CAClC,IAAMyB,EAAQ3B,EAAK,SAAS,EAAI,GAEhC,OAAIC,IAAU,KACLC,EAAS,cAAcyB,EAAO,CAAE,KAAM,MAAO,CAAC,EAGhDf,EAAgBe,EAAO1B,EAAM,MAAM,CAC5C,EAGA,EAAG,SAAUD,EAAMC,EAAOC,EAAU,CAClC,IAAIyB,EAAQ3B,EAAK,SAAS,EAG1B,OAFI2B,IAAU,IAAGA,EAAQ,IAErB1B,IAAU,KACLC,EAAS,cAAcyB,EAAO,CAAE,KAAM,MAAO,CAAC,EAGhDf,EAAgBe,EAAO1B,EAAM,MAAM,CAC5C,EAGA,EAAG,SAAUD,EAAMC,EAAOC,EAAU,CAClC,OAAID,IAAU,KACLC,EAAS,cAAcF,EAAK,WAAW,EAAG,CAAE,KAAM,QAAS,CAAC,EAG9DM,GAAgB,EAAEN,EAAMC,CAAK,CACtC,EAGA,EAAG,SAAUD,EAAMC,EAAOC,EAAU,CAClC,OAAID,IAAU,KACLC,EAAS,cAAcF,EAAK,WAAW,EAAG,CAAE,KAAM,QAAS,CAAC,EAG9DM,GAAgB,EAAEN,EAAMC,CAAK,CACtC,EAGA,EAAG,SAAUD,EAAMC,EAAO,CACxB,OAAOK,GAAgB,EAAEN,EAAMC,CAAK,CACtC,EAGA,EAAG,SAAUD,EAAMC,EAAO2B,EAAW,CACnC,IAAMC,EAAiB7B,EAAK,kBAAkB,EAE9C,GAAI6B,IAAmB,EACrB,MAAO,IAGT,OAAQ5B,EAAO,CAEb,IAAK,IACH,OAAO6B,GAAkCD,CAAc,EAKzD,IAAK,OACL,IAAK,KACH,OAAOE,GAAeF,CAAc,EAKtC,IAAK,QACL,IAAK,MACL,QACE,OAAOE,GAAeF,EAAgB,GAAG,CAC7C,CACF,EAGA,EAAG,SAAU7B,EAAMC,EAAO2B,EAAW,CACnC,IAAMC,EAAiB7B,EAAK,kBAAkB,EAE9C,OAAQC,EAAO,CAEb,IAAK,IACH,OAAO6B,GAAkCD,CAAc,EAKzD,IAAK,OACL,IAAK,KACH,OAAOE,GAAeF,CAAc,EAKtC,IAAK,QACL,IAAK,MACL,QACE,OAAOE,GAAeF,EAAgB,GAAG,CAC7C,CACF,EAGA,EAAG,SAAU7B,EAAMC,EAAO2B,EAAW,CACnC,IAAMC,EAAiB7B,EAAK,kBAAkB,EAE9C,OAAQC,EAAO,CAEb,IAAK,IACL,IAAK,KACL,IAAK,MACH,MAAO,MAAQ+B,GAAoBH,EAAgB,GAAG,EAExD,IAAK,OACL,QACE,MAAO,MAAQE,GAAeF,EAAgB,GAAG,CACrD,CACF,EAGA,EAAG,SAAU7B,EAAMC,EAAO2B,EAAW,CACnC,IAAMC,EAAiB7B,EAAK,kBAAkB,EAE9C,OAAQC,EAAO,CAEb,IAAK,IACL,IAAK,KACL,IAAK,MACH,MAAO,MAAQ+B,GAAoBH,EAAgB,GAAG,EAExD,IAAK,OACL,QACE,MAAO,MAAQE,GAAeF,EAAgB,GAAG,CACrD,CACF,EAGA,EAAG,SAAU7B,EAAMC,EAAO2B,EAAW,CACnC,IAAMK,EAAY,KAAK,MAAM,CAACjC,EAAO,GAAI,EACzC,OAAOY,EAAgBqB,EAAWhC,EAAM,MAAM,CAChD,EAGA,EAAG,SAAUD,EAAMC,EAAO2B,EAAW,CACnC,OAAOhB,EAAgB,CAACZ,EAAMC,EAAM,MAAM,CAC5C,CACF,EAEA,SAAS+B,GAAoBE,EAAQC,EAAY,GAAI,CACnD,IAAMC,EAAOF,EAAS,EAAI,IAAM,IAC1BG,EAAY,KAAK,IAAIH,CAAM,EAC3BP,EAAQ,KAAK,MAAMU,EAAY,EAAE,EACjCC,EAAUD,EAAY,GAC5B,OAAIC,IAAY,EACPF,EAAO,OAAOT,CAAK,EAErBS,EAAO,OAAOT,CAAK,EAAIQ,EAAYvB,EAAgB0B,EAAS,CAAC,CACtE,CAEA,SAASR,GAAkCI,EAAQC,EAAW,CAC5D,OAAID,EAAS,KAAO,GACLA,EAAS,EAAI,IAAM,KAClBtB,EAAgB,KAAK,IAAIsB,CAAM,EAAI,GAAI,CAAC,EAEjDH,GAAeG,EAAQC,CAAS,CACzC,CAEA,SAASJ,GAAeG,EAAQC,EAAY,GAAI,CAC9C,IAAMC,EAAOF,EAAS,EAAI,IAAM,IAC1BG,EAAY,KAAK,IAAIH,CAAM,EAC3BP,EAAQf,EAAgB,KAAK,MAAMyB,EAAY,EAAE,EAAG,CAAC,EACrDC,EAAU1B,EAAgByB,EAAY,GAAI,CAAC,EACjD,OAAOD,EAAOT,EAAQQ,EAAYG,CACpC,CCvwBA,IAAMC,GAAoB,CAACC,EAASC,IAAe,CACjD,OAAQD,EAAS,CACf,IAAK,IACH,OAAOC,EAAW,KAAK,CAAE,MAAO,OAAQ,CAAC,EAC3C,IAAK,KACH,OAAOA,EAAW,KAAK,CAAE,MAAO,QAAS,CAAC,EAC5C,IAAK,MACH,OAAOA,EAAW,KAAK,CAAE,MAAO,MAAO,CAAC,EAC1C,IAAK,OACL,QACE,OAAOA,EAAW,KAAK,CAAE,MAAO,MAAO,CAAC,CAC5C,CACF,EAEMC,GAAoB,CAACF,EAASC,IAAe,CACjD,OAAQD,EAAS,CACf,IAAK,IACH,OAAOC,EAAW,KAAK,CAAE,MAAO,OAAQ,CAAC,EAC3C,IAAK,KACH,OAAOA,EAAW,KAAK,CAAE,MAAO,QAAS,CAAC,EAC5C,IAAK,MACH,OAAOA,EAAW,KAAK,CAAE,MAAO,MAAO,CAAC,EAC1C,IAAK,OACL,QACE,OAAOA,EAAW,KAAK,CAAE,MAAO,MAAO,CAAC,CAC5C,CACF,EAEME,GAAwB,CAACH,EAASC,IAAe,CACrD,IAAMG,EAAcJ,EAAQ,MAAM,WAAW,GAAK,CAAC,EAC7CK,EAAcD,EAAY,CAAC,EAC3BE,EAAcF,EAAY,CAAC,EAEjC,GAAI,CAACE,EACH,OAAOP,GAAkBC,EAASC,CAAU,EAG9C,IAAIM,EAEJ,OAAQF,EAAa,CACnB,IAAK,IACHE,EAAiBN,EAAW,SAAS,CAAE,MAAO,OAAQ,CAAC,EACvD,MACF,IAAK,KACHM,EAAiBN,EAAW,SAAS,CAAE,MAAO,QAAS,CAAC,EACxD,MACF,IAAK,MACHM,EAAiBN,EAAW,SAAS,CAAE,MAAO,MAAO,CAAC,EACtD,MACF,IAAK,OACL,QACEM,EAAiBN,EAAW,SAAS,CAAE,MAAO,MAAO,CAAC,EACtD,KACJ,CAEA,OAAOM,EACJ,QAAQ,WAAYR,GAAkBM,EAAaJ,CAAU,CAAC,EAC9D,QAAQ,WAAYC,GAAkBI,EAAaL,CAAU,CAAC,CACnE,EAEaO,GAAiB,CAC5B,EAAGN,GACH,EAAGC,EACL,EC/DA,IAAMM,GAAmB,OACnBC,GAAkB,OAElBC,GAAc,CAAC,IAAK,KAAM,KAAM,MAAM,EAErC,SAASC,GAA0BC,EAAO,CAC/C,OAAOJ,GAAiB,KAAKI,CAAK,CACpC,CAEO,SAASC,GAAyBD,EAAO,CAC9C,OAAOH,GAAgB,KAAKG,CAAK,CACnC,CAEO,SAASE,GAA0BF,EAAOG,EAAQC,EAAO,CAC9D,IAAMC,EAAWC,GAAQN,EAAOG,EAAQC,CAAK,EAE7C,GADA,QAAQ,KAAKC,CAAQ,EACjBP,GAAY,SAASE,CAAK,EAAG,MAAM,IAAI,WAAWK,CAAQ,CAChE,CAEA,SAASC,GAAQN,EAAOG,EAAQC,EAAO,CACrC,IAAMG,EAAUP,EAAM,CAAC,IAAM,IAAM,QAAU,oBAC7C,MAAO,SAASA,EAAM,YAAY,CAAC,mBAAmBA,CAAK,YAAYG,CAAM,sBAAsBI,CAAO,mBAAmBH,CAAK,iFACpI,CCKA,IAAMI,GACJ,wDAIIC,GAA6B,oCAE7BC,GAAsB,eACtBC,GAAoB,MACpBC,GAAgC,WAoS/B,SAASC,GAAOC,EAAMC,EAAWC,EAAS,CAxUjD,IAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,GAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,GAyUE,IAAMC,EAAiBC,GAAkB,EACnCC,GAASnB,GAAAD,EAAAD,GAAA,YAAAA,EAAS,SAAT,KAAAC,EAAmBkB,EAAe,SAAlC,KAAAjB,EAA4CoB,GAErDC,GACJb,GAAAD,GAAAH,GAAAD,EAAAL,GAAA,YAAAA,EAAS,wBAAT,KAAAK,GACAD,GAAAD,EAAAH,GAAA,YAAAA,EAAS,SAAT,YAAAG,EAAiB,UAAjB,YAAAC,EAA0B,wBAD1B,KAAAE,EAEAa,EAAe,wBAFf,KAAAV,GAGAD,GAAAD,EAAAY,EAAe,SAAf,YAAAZ,EAAuB,UAAvB,YAAAC,EAAgC,wBAHhC,KAAAE,EAIA,EAEIc,GACJN,IAAAD,GAAAH,GAAAD,EAAAb,GAAA,YAAAA,EAAS,eAAT,KAAAa,GACAD,GAAAD,GAAAX,GAAA,YAAAA,EAAS,SAAT,YAAAW,GAAiB,UAAjB,YAAAC,EAA0B,eAD1B,KAAAE,EAEAK,EAAe,eAFf,KAAAF,GAGAD,GAAAD,EAAAI,EAAe,SAAf,YAAAJ,EAAuB,UAAvB,YAAAC,EAAgC,eAHhC,KAAAE,GAIA,EAEIO,EAAeC,EAAO5B,EAAME,GAAA,YAAAA,EAAS,EAAE,EAE7C,GAAI,CAAC2B,GAAQF,CAAY,EACvB,MAAM,IAAI,WAAW,oBAAoB,EAG3C,IAAIG,EAAQ7B,EACT,MAAM8B,EAA0B,EAChC,IAAKC,GAAc,CAClB,IAAMC,EAAiBD,EAAU,CAAC,EAClC,GAAIC,IAAmB,KAAOA,IAAmB,IAAK,CACpD,IAAMC,GAAgBC,GAAeF,CAAc,EACnD,OAAOC,GAAcF,EAAWT,EAAO,UAAU,CACnD,CACA,OAAOS,CACT,CAAC,EACA,KAAK,EAAE,EACP,MAAMI,EAAsB,EAC5B,IAAKJ,GAAc,CAElB,GAAIA,IAAc,KAChB,MAAO,CAAE,QAAS,GAAO,MAAO,GAAI,EAGtC,IAAMC,EAAiBD,EAAU,CAAC,EAClC,GAAIC,IAAmB,IACrB,MAAO,CAAE,QAAS,GAAO,MAAOI,GAAmBL,CAAS,CAAE,EAGhE,GAAIM,GAAWL,CAAc,EAC3B,MAAO,CAAE,QAAS,GAAM,MAAOD,CAAU,EAG3C,GAAIC,EAAe,MAAMM,EAA6B,EACpD,MAAM,IAAI,WACR,iEACEN,EACA,GACJ,EAGF,MAAO,CAAE,QAAS,GAAO,MAAOD,CAAU,CAC5C,CAAC,EAGCT,EAAO,SAAS,eAClBO,EAAQP,EAAO,SAAS,aAAaI,EAAcG,CAAK,GAG1D,IAAMU,EAAmB,CACvB,sBAAAf,EACA,aAAAC,EACA,OAAAH,CACF,EAEA,OAAOO,EACJ,IAAKW,GAAS,CACb,GAAI,CAACA,EAAK,QAAS,OAAOA,EAAK,MAE/B,IAAMC,EAAQD,EAAK,OAGhB,EAACvC,GAAA,MAAAA,EAAS,8BACTyC,GAAyBD,CAAK,GAC/B,EAACxC,GAAA,MAAAA,EAAS,+BACT0C,GAA0BF,CAAK,IAEjCG,GAA0BH,EAAOzC,EAAW,OAAOD,CAAI,CAAC,EAG1D,IAAM8C,GAAYR,GAAWI,EAAM,CAAC,CAAC,EACrC,OAAOI,GAAUnB,EAAce,EAAOnB,EAAO,SAAUiB,CAAgB,CACzE,CAAC,EACA,KAAK,EAAE,CACZ,CAEA,SAASH,GAAmBU,EAAO,CACjC,IAAMC,EAAUD,EAAM,MAAME,EAAmB,EAE/C,OAAKD,EAIEA,EAAQ,CAAC,EAAE,QAAQE,GAAmB,GAAG,EAHvCH,CAIX,CCpYO,SAASI,GAAUC,EAAMC,EAAS,CA1CzC,IAAAC,EAAAC,EA2CE,IAAMC,EAAQC,EAAOL,EAAMC,GAAA,YAAAA,EAAS,EAAE,EAEtC,GAAI,MAAM,CAACG,CAAK,EACd,MAAM,IAAI,WAAW,oBAAoB,EAG3C,IAAME,GAASJ,EAAAD,GAAA,YAAAA,EAAS,SAAT,KAAAC,EAAmB,WAC5BK,GAAiBJ,EAAAF,GAAA,YAAAA,EAAS,iBAAT,KAAAE,EAA2B,WAE9CK,EAAS,GACTC,EAAW,GAETC,EAAgBJ,IAAW,WAAa,IAAM,GAC9CK,EAAgBL,IAAW,WAAa,IAAM,GAGpD,GAAIC,IAAmB,OAAQ,CAC7B,IAAMK,EAAMC,EAAgBT,EAAM,QAAQ,EAAG,CAAC,EACxCU,EAAQD,EAAgBT,EAAM,SAAS,EAAI,EAAG,CAAC,EAIrDI,EAAS,GAHIK,EAAgBT,EAAM,YAAY,EAAG,CAAC,CAGnC,GAAGM,CAAa,GAAGI,CAAK,GAAGJ,CAAa,GAAGE,CAAG,EAChE,CAGA,GAAIL,IAAmB,OAAQ,CAE7B,IAAMQ,EAASX,EAAM,kBAAkB,EAEvC,GAAIW,IAAW,EAAG,CAChB,IAAMC,EAAiB,KAAK,IAAID,CAAM,EAChCE,EAAaJ,EAAgB,KAAK,MAAMG,EAAiB,EAAE,EAAG,CAAC,EAC/DE,EAAeL,EAAgBG,EAAiB,GAAI,CAAC,EAI3DP,EAAW,GAFEM,EAAS,EAAI,IAAM,GAEd,GAAGE,CAAU,IAAIC,CAAY,EACjD,MACET,EAAW,IAGb,IAAMU,EAAON,EAAgBT,EAAM,SAAS,EAAG,CAAC,EAC1CgB,EAASP,EAAgBT,EAAM,WAAW,EAAG,CAAC,EAC9CiB,EAASR,EAAgBT,EAAM,WAAW,EAAG,CAAC,EAG9CkB,EAAYd,IAAW,GAAK,GAAK,IAGjCe,EAAO,CAACJ,EAAMC,EAAQC,CAAM,EAAE,KAAKV,CAAa,EAGtDH,EAAS,GAAGA,CAAM,GAAGc,CAAS,GAAGC,CAAI,GAAGd,CAAQ,EAClD,CAEA,OAAOD,CACT,CC5EO,SAASgB,GAAQC,EAAMC,EAAS,CACrC,OAAOC,EAAOF,EAAMC,GAAA,YAAAA,EAAS,EAAE,EAAE,QAAQ,CAC3C,CCFO,SAASE,GAAOC,EAAMC,EAAS,CACpC,OAAOC,EAAOF,EAAMC,GAAA,YAAAA,EAAS,EAAE,EAAE,OAAO,CAC1C,CCEO,SAASE,GAAeC,EAAMC,EAAS,CA5B9C,IAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EAAAC,EA6BE,IAAMC,EAAiBC,GAAkB,EACnCC,GACJH,GAAAD,GAAAH,GAAAD,EAAAH,GAAA,YAAAA,EAAS,eAAT,KAAAG,GACAD,GAAAD,EAAAD,GAAA,YAAAA,EAAS,SAAT,YAAAC,EAAiB,UAAjB,YAAAC,EAA0B,eAD1B,KAAAE,EAEAK,EAAe,eAFf,KAAAF,GAGAD,GAAAD,EAAAI,EAAe,SAAf,YAAAJ,EAAuB,UAAvB,YAAAC,EAAgC,eAHhC,KAAAE,EAIA,EAEII,EAAoBC,GAAQC,EAAOf,EAAMC,GAAA,YAAAA,EAAS,EAAE,CAAC,EAC3D,GAAI,MAAMY,CAAiB,EAAG,MAAO,KAErC,IAAMG,EAAeC,GAAOC,GAAalB,EAAMC,CAAO,CAAC,EAEnDkB,EAAqBP,EAAeI,EACpCG,GAAsB,IAAGA,GAAsB,GAEnD,IAAMC,EAA8BP,EAAoBM,EACxD,OAAO,KAAK,KAAKC,EAA8B,CAAC,EAAI,CACtD,CCnBO,SAASC,GAAeC,EAAMC,EAAS,CAC5C,IAAMC,EAAQC,EAAOH,EAAMC,GAAA,YAAAA,EAAS,EAAE,EAChCG,EAAQF,EAAM,SAAS,EAC7B,OAAAA,EAAM,YAAYA,EAAM,YAAY,EAAGE,EAAQ,EAAG,CAAC,EACnDF,EAAM,SAAS,EAAG,EAAG,EAAG,CAAC,EAClBC,EAAOD,EAAOD,GAAA,YAAAA,EAAS,EAAE,CAClC,CCJO,SAASI,GAAYC,EAAWC,EAAaC,EAAS,CAC3D,GAAM,CAACC,EAAYC,CAAY,EAAIC,GACjCH,GAAA,YAAAA,EAAS,GACTF,EACAC,CACF,EACA,OACEE,EAAW,YAAY,IAAMC,EAAa,YAAY,GACtDD,EAAW,SAAS,IAAMC,EAAa,SAAS,CAEpD,CCbO,SAASE,GAAQC,EAAMC,EAAS,CACrC,OAAOC,GACLC,GAAcF,GAAA,YAAAA,EAAS,KAAMD,EAAMA,CAAI,EACvCI,IAAaH,GAAA,YAAAA,EAAS,KAAMD,CAAI,CAClC,CACF,CCPO,SAASK,GAAQC,EAAMC,EAAQC,EAAS,CAC7C,OAAOC,GAAQH,EAAM,CAACC,EAAQC,CAAO,CACvC,CCDO,SAASE,GAAaC,EAAS,CACpC,OAAOC,GAAW,KAAK,IAAI,EAAGD,CAAO,CACvC,CCAO,SAASE,GAAUC,EAAMC,EAAQC,EAAS,CAC/C,OAAOC,GAAUH,EAAM,CAACC,EAAQC,CAAO,CACzC,CC9BA,IAAME,GAAuB,CAC3B,iBAAkB,CAChB,IAAK,0BACL,MAAO,+BACT,EAEA,SAAU,CACR,IAAK,WACL,MAAO,oBACT,EAEA,YAAa,oBAEb,iBAAkB,CAChB,IAAK,yBACL,MAAO,+BACT,EAEA,SAAU,CACR,IAAK,UACL,MAAO,oBACT,EAEA,YAAa,CACX,IAAK,eACL,MAAO,uBACT,EAEA,OAAQ,CACN,IAAK,SACL,MAAO,iBACT,EAEA,MAAO,CACL,IAAK,QACL,MAAO,gBACT,EAEA,YAAa,CACX,IAAK,cACL,MAAO,sBACT,EAEA,OAAQ,CACN,IAAK,QACL,MAAO,gBACT,EAEA,aAAc,CACZ,IAAK,mBACL,MAAO,4BACT,EAEA,QAAS,CACP,IAAK,aACL,MAAO,sBACT,EAEA,YAAa,CACX,IAAK,gBACL,MAAO,uBACT,EAEA,OAAQ,CACN,IAAK,UACL,MAAO,iBACT,EAEA,WAAY,CACV,IAAK,eACL,MAAO,sBACT,EAEA,aAAc,CACZ,IAAK,oBACL,MAAO,2BACT,CACF,EAEaC,GAAiB,CAACC,EAAOC,EAAOC,IAAY,CACvD,IAAIC,EAEEC,EAAaN,GAAqBE,CAAK,EAS7C,OARI,OAAOI,GAAe,SACxBD,EAASC,EACAH,IAAU,EACnBE,EAASC,EAAW,IAEpBD,EAASC,EAAW,MAAM,QAAQ,YAAa,OAAOH,CAAK,CAAC,EAG1DC,GAAA,MAAAA,EAAS,UACPA,EAAQ,YAAcA,EAAQ,WAAa,EACtC,MAAQC,EAERA,EAAS,SAIbA,CACT,EClGA,IAAME,GAAc,CAClB,KAAM,uBACN,KAAM,YACN,OAAQ,WACR,MAAO,SACT,EAEMC,GAAc,CAClB,KAAM,gBACN,KAAM,aACN,OAAQ,WACR,MAAO,OACT,EAEMC,GAAkB,CACtB,KAAM,0BACN,KAAM,0BACN,OAAQ,oBACR,MAAO,mBACT,EAEaC,GAAa,CACxB,KAAMC,EAAkB,CACtB,QAASJ,GACT,aAAc,MAChB,CAAC,EAED,KAAMI,EAAkB,CACtB,QAASH,GACT,aAAc,MAChB,CAAC,EAED,SAAUG,EAAkB,CAC1B,QAASF,GACT,aAAc,MAChB,CAAC,CACH,ECtCA,IAAMG,GAAuB,CAC3B,SAAU,wBACV,UAAW,mBACX,MAAO,gBACP,SAAU,mBACV,SAAU,uBACV,MAAO,GACT,EAEaC,GAAiB,CAACC,EAAOC,EAAOC,EAAWC,IACtDL,GAAqBE,CAAK,ECR5B,IAAMI,GAAY,CAChB,OAAQ,CAAC,MAAO,IAAI,EACpB,YAAa,CAAC,SAAU,MAAM,EAC9B,KAAM,CAAC,kCAAgC,0BAA0B,CACnE,EAEMC,GAAgB,CACpB,OAAQ,CAAC,IAAK,IAAK,IAAK,GAAG,EAC3B,YAAa,CAAC,UAAW,UAAW,UAAW,SAAS,EACxD,KAAM,CAAC,aAAc,aAAc,aAAc,YAAY,CAC/D,EAEMC,GAAc,CAClB,OAAQ,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAAG,EACnE,YAAa,CACX,OACA,OACA,OACA,OACA,MACA,OACA,OACA,OACA,OACA,OACA,OACA,MACF,EAEA,KAAM,CACJ,SACA,UACA,QACA,QACA,MACA,OACA,OACA,SACA,YACA,UACA,WACA,UACF,CACF,EAKMC,GAAY,CAChB,OAAQ,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAAG,EAC1C,MAAO,CAAC,QAAM,KAAM,KAAM,KAAM,KAAM,KAAM,OAAI,EAChD,YAAa,CAAC,UAAQ,OAAQ,OAAQ,OAAQ,OAAQ,OAAQ,SAAM,EAEpE,KAAM,CACJ,YACA,SACA,UACA,SACA,UACA,SACA,WACF,CACF,EAEMC,GAAkB,CACtB,OAAQ,CACN,GAAI,IACJ,GAAI,IACJ,SAAU,SACV,KAAM,SACN,QAAS,SACT,UAAW,cACX,QAAS,QACT,MAAO,KACT,EACA,YAAa,CACX,GAAI,KACJ,GAAI,KACJ,SAAU,SACV,KAAM,SACN,QAAS,SACT,UAAW,cACX,QAAS,QACT,MAAO,KACT,EACA,KAAM,CACJ,GAAI,OACJ,GAAI,OACJ,SAAU,SACV,KAAM,SACN,QAAS,SACT,UAAW,cACX,QAAS,QACT,MAAO,KACT,CACF,EAEMC,GAA4B,CAChC,OAAQ,CACN,GAAI,IACJ,GAAI,IACJ,SAAU,SACV,KAAM,SACN,QAAS,cACT,UAAW,mBACX,QAAS,aACT,MAAO,WACT,EACA,YAAa,CACX,GAAI,KACJ,GAAI,KACJ,SAAU,SACV,KAAM,SACN,QAAS,cACT,UAAW,mBACX,QAAS,aACT,MAAO,WACT,EACA,KAAM,CACJ,GAAI,OACJ,GAAI,OACJ,SAAU,SACV,KAAM,SACN,QAAS,cACT,UAAW,mBACX,QAAS,aACT,MAAO,WACT,CACF,EAEMC,GAAgB,CAACC,EAAaC,IACnB,OAAOD,CAAW,EACjB,IAGLE,GAAW,CACtB,cAAAH,GAEA,IAAKI,EAAgB,CACnB,OAAQV,GACR,aAAc,MAChB,CAAC,EAED,QAASU,EAAgB,CACvB,OAAQT,GACR,aAAc,OACd,iBAAmBU,GAAYA,EAAU,CAC3C,CAAC,EAED,MAAOD,EAAgB,CACrB,OAAQR,GACR,aAAc,MAChB,CAAC,EAED,IAAKQ,EAAgB,CACnB,OAAQP,GACR,aAAc,MAChB,CAAC,EAED,UAAWO,EAAgB,CACzB,OAAQN,GACR,aAAc,OACd,iBAAkBC,GAClB,uBAAwB,MAC1B,CAAC,CACH,ECpKA,IAAMO,GAA4B,eAC5BC,GAA4B,OAE5BC,GAAmB,CACvB,OAAQ,qBACR,YAAa,0CACb,KAAM,uEACR,EACMC,GAAmB,CACvB,IAAK,CAAC,MAAO,SAAS,CACxB,EAEMC,GAAuB,CAC3B,OAAQ,WACR,YAAa,kBACb,KAAM,qBACR,EACMC,GAAuB,CAC3B,IAAK,CAAC,KAAM,KAAM,KAAM,IAAI,CAC9B,EAEMC,GAAqB,CACzB,OAAQ,eACR,YAAa,iEACb,KAAM,yFACR,EACMC,GAAqB,CACzB,OAAQ,CACN,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,KACF,EAEA,IAAK,CACH,OACA,MACA,QACA,OACA,QACA,QACA,QACA,OACA,MACA,MACA,MACA,KACF,CACF,EAEMC,GAAmB,CACvB,OAAQ,aACR,MAAO,yCACP,YAAa,kCACb,KAAM,wDACR,EACMC,GAAmB,CACvB,OAAQ,CAAC,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,KAAK,EACxD,IAAK,CAAC,MAAO,MAAO,OAAQ,MAAO,OAAQ,MAAO,KAAK,CACzD,EAEMC,GAAyB,CAC7B,OAAQ,qEACR,IAAK,+EACP,EACMC,GAAyB,CAC7B,IAAK,CACH,GAAI,MACJ,GAAI,MACJ,SAAU,UACV,KAAM,UACN,QAAS,UACT,UAAW,eACX,QAAS,SACT,MAAO,MACT,CACF,EAEaC,GAAQ,CACnB,cAAeC,GAAoB,CACjC,aAAcb,GACd,aAAcC,GACd,cAAgBa,GAAU,SAASA,EAAO,EAAE,CAC9C,CAAC,EAED,IAAKC,EAAa,CAChB,cAAeb,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EAED,QAASY,EAAa,CACpB,cAAeX,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,MACnB,cAAgBW,GAAUA,EAAQ,CACpC,CAAC,EAED,MAAOD,EAAa,CAClB,cAAeT,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EAED,IAAKQ,EAAa,CAChB,cAAeP,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EAED,UAAWM,EAAa,CACtB,cAAeL,GACf,kBAAmB,MACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,CACH,ECnHO,IAAMM,GAAK,CAChB,KAAM,KACN,eAAgBC,GAChB,WAAYC,GACZ,eAAgBC,GAChB,SAAUC,GACV,MAAOC,GACP,QAAS,CACP,aAAc,EACd,sBAAuB,CACzB,CACF,ECzBA,IAAMC,GAAc,CAClB,KAAM,oBACN,KAAM,cACN,OAAQ,aACR,MAAO,YACT,EAEMC,GAAc,CAClB,KAAM,gBACN,KAAM,aACN,OAAQ,WACR,MAAO,OACT,EAEMC,GAAkB,CACtB,KAAM,yBACN,KAAM,yBACN,OAAQ,qBACR,MAAO,oBACT,EAEaC,GAAa,CACxB,KAAMC,EAAkB,CACtB,QAASJ,GACT,aAAc,MAChB,CAAC,EAED,KAAMI,EAAkB,CACtB,QAASH,GACT,aAAc,MAChB,CAAC,EAED,SAAUG,EAAkB,CAC1B,QAASF,GACT,aAAc,MAChB,CAAC,CACH,ECxBO,IAAMG,GAAO,CAClB,KAAM,QACN,eAAgBC,GAChB,WAAYC,GACZ,eAAgBC,GAChB,SAAUC,GACV,MAAOC,GACP,QAAS,CACP,aAAc,EACd,sBAAuB,CACzB,CACF,ECzBA,SAASC,GAAcC,EAAM,CAC3B,OAAOA,EAAK,QAAQ,YAAa,UAAU,CAC7C,CAEA,SAASC,GAAcD,EAAM,CAC3B,OAAOA,EAAK,QAAQ,aAAc,UAAU,CAC9C,CAEA,SAASE,GAAYF,EAAM,CACzB,OAAOA,EAAK,QAAQ,UAAW,QAAQ,CACzC,CAEA,SAASG,GAAWH,EAAM,CACxB,OAAOA,EAAK,QAAQ,UAAW,cAAQ,CACzC,CAEA,SAASI,GAAYJ,EAAM,CACzB,OAAOA,EAAK,QAAQ,mBAAoB,QAAQ,CAClD,CAEA,SAASK,GAAaL,EAAM,CAC1B,OAAOA,EAAK,QAAQ,uBAAwB,WAAW,CACzD,CAEA,SAASM,GAAYN,EAAM,CACzB,OAAOA,EAAK,QAAQ,iBAAkB,QAAQ,CAChD,CAEA,IAAMO,GAAuB,CAC3B,iBAAkB,CAChB,IAAK,eACL,MAAO,0BACP,YAAaR,EACf,EAEA,SAAU,CACR,IAAK,UACL,MAAO,qBACP,YAAaA,EACf,EAEA,YAAa,CACX,IAAK,kBACL,MAAO,kBACP,YAAcS,GAAU,iBAC1B,EAEA,iBAAkB,CAChB,IAAK,gBACL,MAAO,2BACP,YAAaP,EACf,EAEA,SAAU,CACR,IAAK,WACL,MAAO,sBACP,YAAaA,EACf,EAEA,YAAa,CACX,IAAK,aACL,MAAO,wBACP,YAAaC,EACf,EAEA,OAAQ,CACN,IAAK,QACL,MAAO,mBACP,YAAaA,EACf,EAEA,MAAO,CACL,IAAK,cACL,MAAO,4BACP,YAAaC,EACf,EAEA,YAAa,CACX,IAAK,cACL,MAAO,yBACP,YAAaC,EACf,EAEA,OAAQ,CACN,IAAK,SACL,MAAO,oBACP,YAAaA,EACf,EAEA,aAAc,CACZ,IAAK,gBACL,MAAO,2BACP,YAAaC,EACf,EAEA,QAAS,CACP,IAAK,WACL,MAAO,sBACP,YAAaA,EACf,EAEA,YAAa,CACX,IAAK,aACL,MAAO,wBACP,YAAaC,EACf,EAEA,OAAQ,CACN,IAAK,QACL,MAAO,mBACP,YAAaA,EACf,EAEA,WAAY,CACV,IAAK,YACL,MAAO,uBACP,YAAaA,EACf,EAEA,aAAc,CACZ,IAAK,iBACL,MAAO,4BACP,YAAaA,EACf,CACF,EAEaG,GAAiB,CAACC,EAAOC,EAAOC,IAAY,CACvD,IAAMC,EAAaN,GAAqBG,CAAK,EACvCI,EACJH,IAAU,EACNE,EAAW,IACXA,EAAW,MAAM,QAAQ,YAAa,OAAOF,CAAK,CAAC,EAEzD,OAAIC,GAAA,MAAAA,EAAS,UACPA,EAAQ,YAAcA,EAAQ,WAAa,EACtCC,EAAW,YAAYC,CAAM,EAAI,YAEjCA,EAAS,UAIbA,CACT,EC5IA,IAAMC,GAAc,CAClB,KAAM,iBACN,KAAM,YACN,OAAQ,WACR,MAAO,OACT,EAEMC,GAAc,CAClB,KAAM,gBACN,KAAM,aACN,OAAQ,WACR,MAAO,OACT,EAEMC,GAAkB,CACtB,KAAM,0BACN,KAAM,0BACN,OAAQ,oBACR,MAAO,mBACT,EAEaC,GAAa,CACxB,KAAMC,EAAkB,CACtB,QAASJ,GACT,aAAc,MAChB,CAAC,EAED,KAAMI,EAAkB,CACtB,QAASH,GACT,aAAc,MAChB,CAAC,EAED,SAAUG,EAAkB,CAC1B,QAASF,GACT,aAAc,MAChB,CAAC,CACH,ECtCA,IAAMG,GAAuB,CAC3B,SAAU,uBACV,UAAW,gBACX,MAAO,0BACP,SAAU,mBACV,SAAU,sBACV,MAAO,GACT,EAEaC,GAAiB,CAACC,EAAOC,EAAOC,EAAWC,IACtDL,GAAqBE,CAAK,ECR5B,IAAMI,GAAY,CAChB,OAAQ,CAAC,OAAQ,MAAM,EACvB,YAAa,CAAC,OAAQ,MAAM,EAC5B,KAAM,CAAC,yBAA0B,4BAAyB,CAC5D,EAEMC,GAAgB,CACpB,OAAQ,CAAC,IAAK,IAAK,IAAK,GAAG,EAC3B,YAAa,CAAC,KAAM,KAAM,KAAM,IAAI,EACpC,KAAM,CAAC,eAAgB,eAAgB,eAAgB,cAAc,CACvE,EAEMC,GAAc,CAClB,OAAQ,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAAG,EACnE,YAAa,CACX,QACA,QACA,SACA,QACA,QACA,UACA,WACA,MACA,OACA,OACA,SACA,OACF,EAEA,KAAM,CACJ,WACA,WACA,YACA,WACA,WACA,aACA,cACA,SACA,UACA,UACA,YACA,UACF,CACF,EAEMC,GAAwB,CAC5B,OAAQD,GAAY,OACpB,YAAaA,GAAY,YACzB,KAAM,CACJ,aACA,aACA,cACA,aACA,aACA,eACA,gBACA,WACA,YACA,YACA,cACA,YACF,CACF,EAEME,GAAY,CAChB,OAAQ,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAAG,EAC1C,MAAO,CAAC,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,IAAI,EAChD,YAAa,CAAC,QAAS,QAAS,QAAS,QAAS,SAAU,QAAS,IAAI,EAEzE,KAAM,CACJ,YACA,YACA,UACA,cACA,UACA,YACA,UACF,CACF,EAEMC,GAAsB,CAC1B,OAAQD,GAAU,OAClB,MAAOA,GAAU,MACjB,YAAaA,GAAU,YACvB,KAAM,CACJ,cACA,cACA,YACA,gBACA,YACA,cACA,YACF,CACF,EAEME,GAAkB,CACtB,OAAQ,CACN,GAAI,KACJ,GAAI,KACJ,SAAU,aACV,KAAM,mBACN,QAAS,KACT,UAAW,KACX,QAAS,UACT,MAAO,aACT,EACA,YAAa,CACX,GAAI,KACJ,GAAI,KACJ,SAAU,aACV,KAAM,mBACN,QAAS,KACT,UAAW,KACX,QAAS,UACT,MAAO,aACT,EACA,KAAM,CACJ,GAAI,KACJ,GAAI,KACJ,SAAU,mBACV,KAAM,yBACN,QAAS,wBACT,UAAW,wBACX,QAAS,UACT,MAAO,aACT,CACF,EAEMC,GAAgB,CAACC,EAAaC,IACnB,OAAOD,CAAW,EACjB,IAGLE,GAAW,CACtB,cAAAH,GAEA,IAAKI,EAAgB,CACnB,OAAQX,GACR,aAAc,MAChB,CAAC,EAED,QAASW,EAAgB,CACvB,OAAQV,GACR,aAAc,OACd,iBAAmBW,GAAYA,EAAU,CAC3C,CAAC,EAED,MAAOD,EAAgB,CACrB,OAAQT,GACR,aAAc,OACd,iBAAkBC,GAClB,uBAAwB,MAC1B,CAAC,EAED,IAAKQ,EAAgB,CACnB,OAAQP,GACR,aAAc,OACd,iBAAkBC,GAClB,uBAAwB,MAC1B,CAAC,EAED,UAAWM,EAAgB,CACzB,OAAQL,GACR,aAAc,MAChB,CAAC,CACH,ECpKA,IAAMO,GAA4B,cAC5BC,GAA4B,OAE5BC,GAAmB,CACvB,OAAQ,UACR,YAAa,gBACb,KAAM,oDACR,EACMC,GAAmB,CACvB,IAAK,CAAC,MAAO,KAAK,CACpB,EAEMC,GAAuB,CAC3B,OAAQ,WACR,YAAa,YACb,KAAM,uBACR,EACMC,GAAuB,CAC3B,IAAK,CAAC,KAAM,KAAM,KAAM,IAAI,CAC9B,EAEMC,GAAqB,CACzB,OAAQ,eACR,YACE,2EACF,KAAM,mHACR,EACMC,GAAqB,CACzB,OAAQ,CACN,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,KACF,EAEA,IAAK,CACH,OACA,QACA,QACA,OACA,OACA,MACA,QACA,MACA,MACA,MACA,QACA,KACF,CACF,EAEMC,GAAmB,CACvB,OAAQ,aACR,MAAO,2BACP,YAAa,8CACb,KAAM,6EACR,EACMC,GAAmB,CACvB,OAAQ,CAAC,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,KAAK,EACxD,IAAK,CAAC,MAAO,MAAO,OAAQ,MAAO,OAAQ,MAAO,KAAK,CACzD,EAEMC,GAAyB,CAC7B,OACE,uEACF,IAAK,4EACP,EACMC,GAAyB,CAC7B,IAAK,CACH,GAAI,OACJ,GAAI,OACJ,SAAU,YACV,KAAM,eACN,QAAS,gBACT,UAAW,gBACX,QAAS,WACT,MAAO,QACT,CACF,EAEaC,GAAQ,CACnB,cAAeC,GAAoB,CACjC,aAAcb,GACd,aAAcC,GACd,cAAgBa,GAAU,SAASA,EAAO,EAAE,CAC9C,CAAC,EAED,IAAKC,EAAa,CAChB,cAAeb,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EAED,QAASY,EAAa,CACpB,cAAeX,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,MACnB,cAAgBW,GAAUA,EAAQ,CACpC,CAAC,EAED,MAAOD,EAAa,CAClB,cAAeT,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EAED,IAAKQ,EAAa,CAChB,cAAeP,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EAED,UAAWM,EAAa,CACtB,cAAeL,GACf,kBAAmB,MACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,CACH,ECtHO,IAAMM,GAAK,CAChB,KAAM,KACN,eAAgBC,GAChB,WAAYC,GACZ,eAAgBC,GAChB,SAAUC,GACV,MAAOC,GACP,QAAS,CACP,aAAc,EACd,sBAAuB,CACzB,CACF,EC1BA,IAAMC,GAAuB,CAC3B,iBAAkB,CAChB,IAAK,wBACL,MAAO,+BACT,EAEA,SAAU,CACR,IAAK,aACL,MAAO,oBACT,EAEA,YAAa,kBAEb,iBAAkB,CAChB,IAAK,wBACL,MAAO,+BACT,EAEA,SAAU,CACR,IAAK,aACL,MAAO,oBACT,EAEA,YAAa,CACX,IAAK,kBACL,MAAO,yBACT,EAEA,OAAQ,CACN,IAAK,UACL,MAAO,iBACT,EAEA,MAAO,CACL,IAAK,SACL,MAAO,iBACT,EAEA,YAAa,CACX,IAAK,iBACL,MAAO,wBACT,EAEA,OAAQ,CACN,IAAK,SACL,MAAO,gBACT,EAEA,aAAc,CACZ,IAAK,sBACL,MAAO,8BACT,EAEA,QAAS,CACP,IAAK,cACL,MAAO,sBACT,EAEA,YAAa,CACX,IAAK,oBACL,MAAO,yBACT,EAEA,OAAQ,CACN,IAAK,YACL,MAAO,iBACT,EAEA,WAAY,CACV,IAAK,iBACL,MAAO,sBACT,EAEA,aAAc,CACZ,IAAK,mBACL,MAAO,wBACT,CACF,EAEaC,GAAiB,CAACC,EAAOC,EAAOC,IAAY,CACvD,IAAIC,EAEEC,EAAaN,GAAqBE,CAAK,EAS7C,OARI,OAAOI,GAAe,SACxBD,EAASC,EACAH,IAAU,EACnBE,EAASC,EAAW,IAEpBD,EAASC,EAAW,MAAM,QAAQ,YAAa,OAAOH,CAAK,CAAC,EAG1DC,GAAA,MAAAA,EAAS,UACPA,EAAQ,YAAcA,EAAQ,WAAa,EACtC,MAAQC,EAERA,EAAS,SAIbA,CACT,EClGA,IAAME,GAAc,CAClB,KAAM,iBACN,KAAM,YACN,OAAQ,WACR,MAAO,SACT,EAEMC,GAAc,CAClB,KAAM,sBACN,KAAM,aACN,OAAQ,WACR,MAAO,OACT,EAEMC,GAAkB,CACtB,KAAM,0BACN,KAAM,0BACN,OAAQ,oBACR,MAAO,mBACT,EAEaC,GAAa,CACxB,KAAMC,EAAkB,CACtB,QAASJ,GACT,aAAc,MAChB,CAAC,EAED,KAAMI,EAAkB,CACtB,QAASH,GACT,aAAc,MAChB,CAAC,EAED,SAAUG,EAAkB,CAC1B,QAASF,GACT,aAAc,MAChB,CAAC,CACH,ECtCA,IAAMG,GAAuB,CAC3B,SAAU,yBACV,UAAW,mBACX,MAAO,gBACP,SAAU,mBACV,SAAU,eACV,MAAO,GACT,EAEaC,GAAiB,CAACC,EAAOC,EAAOC,EAAWC,IACtDL,GAAqBE,CAAK,ECR5B,IAAMI,GAAY,CAChB,OAAQ,CAAC,QAAS,OAAO,EACzB,YAAa,CAAC,QAAS,OAAO,EAC9B,KAAM,CAAC,iBAAe,eAAe,CACvC,EAEMC,GAAgB,CACpB,OAAQ,CAAC,IAAK,IAAK,IAAK,GAAG,EAC3B,YAAa,CAAC,KAAM,KAAM,KAAM,IAAI,EACpC,KAAM,CAAC,aAAc,aAAc,aAAc,YAAY,CAC/D,EAEMC,GAAc,CAClB,OAAQ,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAAG,EACnE,YAAa,CACX,OACA,OACA,OACA,OACA,MACA,OACA,OACA,OACA,OACA,OACA,OACA,MACF,EAEA,KAAM,CACJ,SACA,UACA,OACA,QACA,MACA,OACA,OACA,SACA,YACA,UACA,WACA,UACF,CACF,EAEMC,GAAY,CAChB,OAAQ,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAAG,EAC1C,MAAO,CAAC,QAAM,KAAM,KAAM,KAAM,KAAM,KAAM,OAAI,EAChD,YAAa,CAAC,SAAO,MAAO,MAAO,MAAO,MAAO,MAAO,QAAK,EAC7D,KAAM,CACJ,YACA,SACA,UACA,SACA,UACA,SACA,WACF,CACF,EAEMC,GAAkB,CACtB,OAAQ,CACN,GAAI,IACJ,GAAI,IACJ,SAAU,UACV,KAAM,SACN,QAAS,cACT,UAAW,gBACX,QAAS,gBACT,MAAO,cACT,EACA,YAAa,CACX,GAAI,OACJ,GAAI,OACJ,SAAU,UACV,KAAM,SACN,QAAS,cACT,UAAW,gBACX,QAAS,gBACT,MAAO,cACT,EACA,KAAM,CACJ,GAAI,OACJ,GAAI,OACJ,SAAU,UACV,KAAM,SACN,QAAS,iBACT,UAAW,sBACX,QAAS,gBACT,MAAO,cACT,CACF,EAEMC,GAAgB,CAACC,EAAaC,IACnB,OAAOD,CAAW,EACjB,IAGLE,GAAW,CACtB,cAAAH,GAEA,IAAKI,EAAgB,CACnB,OAAQT,GACR,aAAc,MAChB,CAAC,EAED,QAASS,EAAgB,CACvB,OAAQR,GACR,aAAc,OACd,iBAAmBS,GAAYA,EAAU,CAC3C,CAAC,EAED,MAAOD,EAAgB,CACrB,OAAQP,GACR,aAAc,MAChB,CAAC,EAED,IAAKO,EAAgB,CACnB,OAAQN,GACR,aAAc,MAChB,CAAC,EAED,UAAWM,EAAgB,CACzB,OAAQL,GACR,aAAc,MAChB,CAAC,CACH,EC7HA,IAAMO,GAA4B,aAC5BC,GAA4B,OAE5BC,GAAmB,CACvB,OAAQ,4CACR,YAAa,4CACb,KAAM,mDACR,EACMC,GAAmB,CACvB,IAAK,CAAC,MAAO,KAAK,CACpB,EAEMC,GAAuB,CAC3B,OAAQ,WACR,YAAa,YACb,KAAM,uBACR,EACMC,GAAuB,CAC3B,IAAK,CAAC,KAAM,KAAM,KAAM,IAAI,CAC9B,EAEMC,GAAqB,CACzB,OAAQ,eACR,YAAa,+DACb,KAAM,wFACR,EACMC,GAAqB,CACzB,OAAQ,CACN,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,KACF,EAEA,IAAK,CACH,OACA,MACA,QACA,OACA,QACA,QACA,QACA,QACA,MACA,MACA,MACA,KACF,CACF,EAEMC,GAAmB,CACvB,OAAQ,aACR,MAAO,2BACP,YAAa,kCACb,KAAM,wDACR,EACMC,GAAmB,CACvB,IAAK,CAAC,MAAO,MAAO,OAAQ,MAAO,OAAQ,MAAO,KAAK,CACzD,EAEMC,GAAyB,CAC7B,OACE,uEACF,IAAK,gFACP,EACMC,GAAyB,CAC7B,IAAK,CACH,GAAI,oBACJ,GAAI,oBACJ,SAAU,SACV,KAAM,SACN,QAAS,UACT,UAAW,eACX,QAAS,SACT,MAAO,OACT,CACF,EAEaC,GAAQ,CACnB,cAAeC,GAAoB,CACjC,aAAcb,GACd,aAAcC,GACd,cAAgBa,GAAU,SAASA,EAAO,EAAE,CAC9C,CAAC,EAED,IAAKC,EAAa,CAChB,cAAeb,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EAED,QAASY,EAAa,CACpB,cAAeX,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,MACnB,cAAgBW,GAAUA,EAAQ,CACpC,CAAC,EAED,MAAOD,EAAa,CAClB,cAAeT,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EAED,IAAKQ,EAAa,CAChB,cAAeP,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EAED,UAAWM,EAAa,CACtB,cAAeL,GACf,kBAAmB,MACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,CACH,ECpHO,IAAMM,GAAK,CAChB,KAAM,KACN,eAAgBC,GAChB,WAAYC,GACZ,eAAgBC,GAChB,SAAUC,GACV,MAAOC,GACP,QAAS,CACP,aAAc,EACd,sBAAuB,CACzB,CACF,EC1BA,IAAMC,GAAuB,CAC3B,iBAAkB,CAChB,IAAK,yBACL,MAAO,iCACT,EAEA,SAAU,CACR,IAAK,YACL,MAAO,oBACT,EAEA,YAAa,gBAEb,iBAAkB,CAChB,IAAK,wBACL,MAAO,gCACT,EAEA,SAAU,CACR,IAAK,WACL,MAAO,mBACT,EAEA,YAAa,CACX,IAAK,sBACL,MAAO,6BACT,EAEA,OAAQ,CACN,IAAK,WACL,MAAO,kBACT,EAEA,MAAO,CACL,IAAK,SACL,MAAO,iBACT,EAEA,YAAa,CACX,IAAK,sBACL,MAAO,6BACT,EAEA,OAAQ,CACN,IAAK,WACL,MAAO,kBACT,EAEA,aAAc,CACZ,IAAK,yBACL,MAAO,iCACT,EAEA,QAAS,CACP,IAAK,cACL,MAAO,sBACT,EAEA,YAAa,CACX,IAAK,uBACL,MAAO,4BACT,EAEA,OAAQ,CACN,IAAK,YACL,MAAO,iBACT,EAEA,WAAY,CACV,IAAK,oBACL,MAAO,yBACT,EAEA,aAAc,CACZ,IAAK,sBACL,MAAO,2BACT,CACF,EAEMC,GAAc,CAClB,OACA,KACA,SACA,MACA,OACA,MACA,MACA,MACA,UACA,MACA,MACA,OACA,MACF,EAEaC,GAAiB,CAACC,EAAOC,EAAOC,IAAY,CACvD,IAAIC,EAEEC,EAAaP,GAAqBG,CAAK,EAY7C,OAXI,OAAOI,GAAe,SACxBD,EAASC,EACAH,IAAU,EACnBE,EAASC,EAAW,IAEpBD,EAASC,EAAW,MAAM,QACxB,YACAH,EAAQ,GAAKH,GAAYG,CAAK,EAAI,OAAOA,CAAK,CAChD,EAGEC,GAAA,MAAAA,EAAS,UACPA,EAAQ,YAAcA,EAAQ,WAAa,EACtC,MAAQC,EAERA,EAAS,SAIbA,CACT,ECrHA,IAAME,GAAc,CAClB,KAAM,gBACN,KAAM,WACN,OAAQ,UACR,MAAO,SACT,EAEMC,GAAc,CAClB,KAAM,sBACN,KAAM,aACN,OAAQ,WACR,MAAO,OACT,EAEMC,GAAkB,CACtB,KAAM,0BACN,KAAM,0BACN,OAAQ,oBACR,MAAO,mBACT,EAEaC,GAAa,CACxB,KAAMC,EAAkB,CACtB,QAASJ,GACT,aAAc,MAChB,CAAC,EAED,KAAMI,EAAkB,CACtB,QAASH,GACT,aAAc,MAChB,CAAC,EAED,SAAUG,EAAkB,CAC1B,QAASF,GACT,aAAc,MAChB,CAAC,CACH,ECtCA,IAAMG,GAAuB,CAC3B,SAAU,oBACV,UAAW,kBACX,MAAO,eACP,SAAU,kBACV,SAAU,eACV,MAAO,GACT,EAEaC,GAAiB,CAACC,EAAOC,EAAOC,EAAWC,IACtDL,GAAqBE,CAAK,ECR5B,IAAMI,GAAY,CAChB,OAAQ,CAAC,QAAS,OAAO,EACzB,YAAa,CAAC,QAAS,OAAO,EAC9B,KAAM,CAAC,kBAAgB,eAAe,CACxC,EAEMC,GAAgB,CACpB,OAAQ,CAAC,IAAK,IAAK,IAAK,GAAG,EAC3B,YAAa,CAAC,KAAM,KAAM,KAAM,IAAI,EACpC,KAAM,CAAC,gBAAiB,gBAAiB,gBAAiB,eAAe,CAC3E,EAEMC,GAAc,CAClB,OAAQ,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAAG,EACnE,YAAa,CACX,OACA,OACA,OACA,OACA,MACA,OACA,OACA,OACA,OACA,OACA,OACA,MACF,EAEA,KAAM,CACJ,UACA,WACA,OACA,QACA,MACA,OACA,OACA,UACA,YACA,UACA,WACA,UACF,CACF,EAEMC,GAAY,CAChB,OAAQ,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAAG,EAC1C,MAAO,CAAC,QAAM,QAAM,KAAM,KAAM,KAAM,KAAM,OAAI,EAChD,YAAa,CAAC,SAAO,SAAO,MAAO,MAAO,OAAQ,MAAO,QAAK,EAC9D,KAAM,CAAC,YAAU,YAAU,SAAU,SAAU,UAAW,SAAU,WAAQ,CAC9E,EAGMC,GAAkB,CACtB,OAAQ,CACN,GAAI,KACJ,GAAI,KACJ,SAAU,UACV,KAAM,SACN,QAAS,QACT,UAAW,UACX,QAAS,WACT,MAAO,MACT,EACA,YAAa,CACX,GAAI,OACJ,GAAI,OACJ,SAAU,UACV,KAAM,SACN,QAAS,SACT,UAAW,UACX,QAAS,WACT,MAAO,MACT,EACA,KAAM,CACJ,GAAI,eACJ,GAAI,cACJ,SAAU,UACV,KAAM,SACN,QAAS,SACT,UAAW,cACX,QAAS,WACT,MAAO,MACT,CACF,EAEMC,GAA4B,CAChC,OAAQ,CACN,GAAI,KACJ,GAAI,KACJ,SAAU,UACV,KAAM,SACN,QAAS,cACT,UAAW,gBACX,QAAS,mBACT,MAAO,cACT,EACA,YAAa,CACX,GAAI,KACJ,GAAI,KACJ,SAAU,UACV,KAAM,SACN,QAAS,cACT,UAAW,gBACX,QAAS,mBACT,MAAO,cACT,EACA,KAAM,CACJ,GAAI,KACJ,GAAI,KACJ,SAAU,UACV,KAAM,SACN,QAAS,iBACT,UAAW,sBACX,QAAS,mBACT,MAAO,cACT,CACF,EAEMC,GAAgB,CAACC,EAAaC,IAAa,CAC/C,IAAMC,EAAS,OAAOF,CAAW,EAE3BG,EAASD,EAAS,IACxB,GAAIC,EAAS,IAAMA,EAAS,GAC1B,OAAQA,EAAS,GAAI,CACnB,IAAK,GACL,IAAK,GACH,OAAOD,EAAS,IACpB,CAEF,OAAOA,EAAS,IAClB,EAEaE,GAAW,CACtB,cAAAL,GAEA,IAAKM,EAAgB,CACnB,OAAQZ,GACR,aAAc,MAChB,CAAC,EAED,QAASY,EAAgB,CACvB,OAAQX,GACR,aAAc,OACd,iBAAmBY,GAAYA,EAAU,CAC3C,CAAC,EAED,MAAOD,EAAgB,CACrB,OAAQV,GACR,aAAc,MAChB,CAAC,EAED,IAAKU,EAAgB,CACnB,OAAQT,GACR,aAAc,MAChB,CAAC,EAED,UAAWS,EAAgB,CACzB,OAAQR,GACR,aAAc,OACd,iBAAkBC,GAClB,uBAAwB,MAC1B,CAAC,CACH,EClKA,IAAMS,GAA4B,kBAC5BC,GAA4B,OAE5BC,GAAmB,CACvB,OAAQ,0DACR,YAAa,0DACb,KAAM,qDACR,EACMC,GAAmB,CACvB,IAAK,CAAC,MAAO,QAAQ,CACvB,EAEMC,GAAuB,CAC3B,OAAQ,WACR,YAAa,YACb,KAAM,4BACR,EACMC,GAAuB,CAC3B,IAAK,CAAC,KAAM,KAAM,KAAM,IAAI,CAC9B,EAEMC,GAAqB,CACzB,OAAQ,eACR,YACE,qEACF,KAAM,2FACR,EACMC,GAAqB,CACzB,OAAQ,CACN,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,MACA,KACF,EAEA,IAAK,CACH,OACA,MACA,QACA,OACA,QACA,QACA,QACA,OACA,MACA,MACA,MACA,KACF,CACF,EAEMC,GAAmB,CACvB,OAAQ,aACR,MAAO,2BACP,YAAa,mCACb,KAAM,uDACR,EACMC,GAAmB,CACvB,IAAK,CAAC,MAAO,MAAO,OAAQ,MAAO,OAAQ,MAAO,KAAK,CACzD,EAEMC,GAAyB,CAC7B,IAAK,sFACP,EACMC,GAAyB,CAC7B,IAAK,CACH,GAAI,MACJ,GAAI,MACJ,SAAU,SACV,KAAM,SACN,QAAS,UACT,UAAW,eACX,QAAS,SACT,MAAO,OACT,CACF,EAEaC,GAAQ,CACnB,cAAeC,GAAoB,CACjC,aAAcb,GACd,aAAcC,GACd,cAAgBa,GAAU,SAASA,EAAO,EAAE,CAC9C,CAAC,EAED,IAAKC,EAAa,CAChB,cAAeb,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EAED,QAASY,EAAa,CACpB,cAAeX,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,MACnB,cAAgBW,GAAUA,EAAQ,CACpC,CAAC,EAED,MAAOD,EAAa,CAClB,cAAeT,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EAED,IAAKQ,EAAa,CAChB,cAAeP,GACf,kBAAmB,OACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,EAED,UAAWM,EAAa,CACtB,cAAeL,GACf,kBAAmB,MACnB,cAAeC,GACf,kBAAmB,KACrB,CAAC,CACH,ECnHO,IAAMM,GAAK,CAChB,KAAM,KACN,eAAgBC,GAChB,WAAYC,GACZ,eAAgBC,GAChB,SAAUC,GACV,MAAOC,GACP,QAAS,CACP,aAAc,EACd,sBAAuB,CACzB,CACF,ECAA,IAAMC,GAAY,YAEZC,GAAgB,KAAOD,GA8GhBE,GAAWC,GA1GxB,cAAgCC,EAAAA,CAG9B,YAAYC,EAAAA,OAEV,GADAC,MAAMD,CAAAA,EAEJA,EAASE,OAASC,GAASC,WAC3BJ,EAASK,OAAS,WACjBL,EAAAA,EAASM,UAATN,YAAAA,EAAkBO,QAAoB,EAEvC,MAAUC,MACR,4GAAA,CAIL,CAED,OAAOC,EAAAA,CACL,OAAOC,OAAOC,KAAKF,CAAAA,EAAWG,OAAO,CAACC,EAAOC,IAAAA,CAC3C,IAAMC,EAAQN,EAAUK,CAAAA,EACxB,OAAIC,GAAS,KACJF,EAcFA,EAAQ,GALfC,EAAOA,EAAKE,SAAS,GAAA,EACjBF,EACAA,EACGG,QAAQ,oCAAqC,KAAA,EAC7CC,YAAAA,CAAAA,IACmBH,CAAAA,GAAQ,EACjC,EAAA,CACJ,CAEQ,OAAOI,EAAAA,CAAsBV,CAAAA,EAAAA,CACpC,GAAA,CAAMI,MAACA,CAAAA,EAASM,EAAKC,QAErB,GAAIC,KAAKC,KAAT,OAEE,OADAD,KAAKC,GAA2B,IAAIC,IAAIb,OAAOC,KAAKF,CAAAA,CAAAA,EAC7CY,KAAKG,OAAOf,CAAAA,EAIrB,QAAWJ,KAAQgB,KAAKC,GAElBb,EAAUJ,CAAAA,GAAS,OACrBgB,KAAKC,GAA0BG,OAAOpB,CAAAA,EAClCA,EAAKW,SAAS,GAAA,EAChBH,EAAMa,eAAerB,CAAAA,EAGpBQ,EAAcR,CAAAA,EAAQ,MAM7B,QAAWA,KAAQI,EAAW,CAC5B,IAAMM,EAAQN,EAAUJ,CAAAA,EACxB,GAAIU,GAAS,KAAM,CACjBM,KAAKC,GAAyBK,IAAItB,CAAAA,EAClC,IAAMuB,EACa,OAAVb,GAAU,UAAYA,EAAMc,SAASjC,EAAAA,EAC1CS,EAAKW,SAAS,GAAA,GAAQY,EACxBf,EAAMiB,YACJzB,EACAuB,EACKb,EAAiBgB,MAAM,EAAA,GA1EvB,EA2EAhB,EACLa,EAAcjC,GAAY,EAAA,EAI3BkB,EAAcR,CAAAA,EAAQU,CAE1B,CACF,CACD,OAAOiB,EACR,CAAA,CAAA,EEnHsB,IAAMC,GAAS,KAAK,MAAM,sCAA0C,ECA9DA,GAAS,KAAK,MAAM,sCAA0C,ECA9DA,GAAS,KAAK,MAAM,uCAA2C,ECA/DA,GAAS,KAAK,MAAM,sCAA0C,ECA9DA,GAAS,KAAK,MAAM,sCAA0C,ECEhFC,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,GAAgB,KAEvBC,GAAgB,IAAM,CAP5B,IAAAC,EAQC,IAAIC,EACH,QAAQD,EAAA,SAAA,KAAA,OAAA,QAAS,MAAT,KAAA,OAAAA,EAAc,UAAW,CACjC,IAAK,OACJC,EAAQ,KACR,MACD,IAAK,OACJA,EAAQ,KACR,MACD,IAAK,UACJA,EAAQ,KACR,MACD,IAAK,MACJA,EAAQ,KACR,MACD,QACCA,EAAQ,IACV,CACA,OAAOA,CACR,EAEMC,GAAe,IAAM,CA5B3B,IAAAF,EA6BE,IAAMG,GAAWH,EAAA,UAAA,KAAA,OAAA,SAAU,WAAV,KAAA,OAAAA,EAAoB,SACrC,OAAIG,GAAA,MAAAA,EAAU,SAAS,MAAA,EACd,KACEA,EAAS,SAAS,MAAM,EAC1B,KACEA,EAAS,SAAS,SAAS,EAC7B,KACEA,EAAS,SAAS,KAAK,EACzB,KAEAL,EAEX,EAEaM,GAAsBC,GAE/BR,GAAiB,KACdS,GACCD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CACrE,GAAKJ,GAAa,EAIf,SAASK,IAAgC,CApDhD,IAAAP,EAqDE,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMQ,EAAeT,GAAc,EACnC,OAAOK,GAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,GAAaT,EAAA,UAAA,KAAA,OAAA,SAAU,kBAAV,KAAA,OAAAA,EAA2B,KACxCU,EAAaR,GAAa,EAEhC,OAAKL,GAAiB,SAASY,CAA6B,EAIrDL,GAAmBK,GAAA,KAAAA,EAAcC,CAAU,GAHhD,QAAQ,KAAK,gFAAgF,EACtFN,GAAmBM,CAAU,EAGxC,OAAS,EAAG,CACV,eAAQ,KAAK,yDAA0D,CAAC,EACjEZ,EACT,CACF,CAEO,IAAMa,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,GAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBX,EAAWe,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FC,EAAK,KAAKjB,EAAQV,CAAQ,EAC1B2B,EAAK,SAASjB,CAAM,CACtB,ENjGAW,GAAarB,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAGhE,IAAM4B,GAAN,cAA6BC,CAAW,CAC7C,QAAS,CACL,IAAMC,EAAQH,EAAK,EAAE,CAAE,QAAS,WAAY,GAAI,sBAAuB,QAAS,yBAA0B,CAAC,EAE3G,OAAOI,8HAAiIC,EAAa,UAAUF,CAAK,UAAU,CAAC,2PAA6P,CAClb,EACK,eAAe,IAAI,oBAAoB,GAC1C,eAAe,OAAO,qBAAsBF,EAAc,EQnBnC,IAAMK,GAAS,KAAK,MAAM,iDAAqD,ECAzEA,GAAS,KAAK,MAAM,gDAAoD,ECAxEA,GAAS,KAAK,MAAM,kDAAsD,ECA1EA,GAAS,KAAK,MAAM,iDAAqD,ECAzEA,GAAS,KAAK,MAAM,gDAAiD,ECEvFC,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,GAAgB,KAEvBC,GAAgB,IAAM,CAP5B,IAAAC,EAQC,IAAIC,EACH,QAAQD,EAAA,SAAA,KAAA,OAAA,QAAS,MAAT,KAAA,OAAAA,EAAc,UAAW,CACjC,IAAK,OACJC,EAAQ,KACR,MACD,IAAK,OACJA,EAAQ,KACR,MACD,IAAK,UACJA,EAAQ,KACR,MACD,IAAK,MACJA,EAAQ,KACR,MACD,QACCA,EAAQ,IACV,CACA,OAAOA,CACR,EAEMC,GAAe,IAAM,CA5B3B,IAAAF,EA6BE,IAAMG,GAAWH,EAAA,UAAA,KAAA,OAAA,SAAU,WAAV,KAAA,OAAAA,EAAoB,SACrC,OAAIG,GAAA,MAAAA,EAAU,SAAS,MAAA,EACd,KACEA,EAAS,SAAS,MAAM,EAC1B,KACEA,EAAS,SAAS,SAAS,EAC7B,KACEA,EAAS,SAAS,KAAK,EACzB,KAEAL,EAEX,EAEaM,GAAsBC,GAE/BR,GAAiB,KACdS,GACCD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CACrE,GAAKJ,GAAa,EAIf,SAASK,IAAgC,CApDhD,IAAAP,EAqDE,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMQ,EAAeT,GAAc,EACnC,OAAOK,GAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,GAAaT,EAAA,UAAA,KAAA,OAAA,SAAU,kBAAV,KAAA,OAAAA,EAA2B,KACxCU,EAAaR,GAAa,EAEhC,OAAKL,GAAiB,SAASY,CAA6B,EAIrDL,GAAmBK,GAAA,KAAAA,EAAcC,CAAU,GAHhD,QAAQ,KAAK,gFAAgF,EACtFN,GAAmBM,CAAU,EAGxC,OAAS,EAAG,CACV,eAAQ,KAAK,yDAA0D,CAAC,EACjEZ,EACT,CACF,CAEO,IAAMa,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,GAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBX,EAAWe,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FC,EAAK,KAAKjB,EAAQV,CAAQ,EAC1B2B,EAAK,SAASjB,CAAM,CACtB,ENjGAW,GAAarB,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAGhE,IAAM4B,GAAN,cAAgCC,CAAW,CAChD,QAAS,CACL,IAAMC,EAAQH,EAAK,EAAE,CAAE,QAAS,iBAAkB,GAAI,0BAA2B,QAAS,6BAA8B,CAAC,EAEzH,OAAOI,kIAAqIC,EAAa,UAAUF,CAAK,UAAU,CAAC,4IAA8I,CACvU,EACK,eAAe,IAAI,wBAAwB,GAC9C,eAAe,OAAO,yBAA0BF,EAAiB,EQnB1C,IAAMK,GAAS,KAAK,MAAM,mDAAoD,ECAxEA,GAAS,KAAK,MAAM,kDAAsD,ECA1EA,GAAS,KAAK,MAAM,iDAAqD,ECAzEA,GAAS,KAAK,MAAM,mDAAoD,ECAxEA,GAAS,KAAK,MAAM,+CAAgD,ECEtFC,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,GAAgB,KAEvBC,GAAgB,IAAM,CAP5B,IAAAC,EAQC,IAAIC,EACH,QAAQD,EAAA,SAAA,KAAA,OAAA,QAAS,MAAT,KAAA,OAAAA,EAAc,UAAW,CACjC,IAAK,OACJC,EAAQ,KACR,MACD,IAAK,OACJA,EAAQ,KACR,MACD,IAAK,UACJA,EAAQ,KACR,MACD,IAAK,MACJA,EAAQ,KACR,MACD,QACCA,EAAQ,IACV,CACA,OAAOA,CACR,EAEMC,GAAe,IAAM,CA5B3B,IAAAF,EA6BE,IAAMG,GAAWH,EAAA,UAAA,KAAA,OAAA,SAAU,WAAV,KAAA,OAAAA,EAAoB,SACrC,OAAIG,GAAA,MAAAA,EAAU,SAAS,MAAA,EACd,KACEA,EAAS,SAAS,MAAM,EAC1B,KACEA,EAAS,SAAS,SAAS,EAC7B,KACEA,EAAS,SAAS,KAAK,EACzB,KAEAL,EAEX,EAEaM,GAAsBC,GAE/BR,GAAiB,KACdS,GACCD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CACrE,GAAKJ,GAAa,EAIf,SAASK,IAAgC,CApDhD,IAAAP,EAqDE,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMQ,EAAeT,GAAc,EACnC,OAAOK,GAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,GAAaT,EAAA,UAAA,KAAA,OAAA,SAAU,kBAAV,KAAA,OAAAA,EAA2B,KACxCU,EAAaR,GAAa,EAEhC,OAAKL,GAAiB,SAASY,CAA6B,EAIrDL,GAAmBK,GAAA,KAAAA,EAAcC,CAAU,GAHhD,QAAQ,KAAK,gFAAgF,EACtFN,GAAmBM,CAAU,EAGxC,OAAS,EAAG,CACV,eAAQ,KAAK,yDAA0D,CAAC,EACjEZ,EACT,CACF,CAEO,IAAMa,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,GAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBX,EAAWe,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FC,EAAK,KAAKjB,EAAQV,CAAQ,EAC1B2B,EAAK,SAASjB,CAAM,CACtB,ENjGAW,GAAarB,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAGhE,IAAM4B,GAAN,cAAiCC,CAAW,CACjD,QAAS,CACL,IAAMC,EAAQH,EAAK,EAAE,CAAE,QAAS,kBAAmB,GAAI,2BAA4B,QAAS,8BAA+B,CAAC,EAE5H,OAAOI,mIAAsIC,EAAa,UAAUF,CAAK,UAAU,CAAC,4IAA8I,CACxU,EACK,eAAe,IAAI,yBAAyB,GAC/C,eAAe,OAAO,0BAA2BF,EAAkB,EOnB5C,IAAMK,GAAS,KAAK,MAAM,+QAAqS,ECA/T,IAAMC,GAAS,KAAK,MAAM,+QAAqS,ECA/T,IAAMC,GAAS,KAAK,MAAM,+QAAqS,ECA/T,IAAMC,GAAS,KAAK,MAAM,qSAA+S,ECAzU,IAAMC,GAAS,KAAK,MAAM,+QAAqS,ECEjV,IAAMC,GAA4BC;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;ECAlC,IAAMC,GAAuBC;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;ECA7B,IAAMC,GAAyBC;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;ECA/B,IAAMC,GAAoBC;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;ECFjC,IAAMC,GAAa,sBAcZ,SAASC,GAAcC,EAAgC,CAC5D,GAAI,OAAOA,GAAc,SACvB,OAAO,KAIT,IAAIC,EAAaD,EACbF,GAAW,KAAKE,CAAS,IAC3BC,EAAa,GAAGD,CAAS,cAG3B,IAAME,EAAY,KAAK,MAAMD,CAAU,EACvC,OAAI,OAAO,MAAMC,CAAS,EACjB,KAGF,IAAI,KAAKA,CAAS,CAC3B,ClHoBA,IAAMC,GAAK,OAAO,WAAc,YAAc,UAAU,UAAY,GAC9DC,GAAQ,iBAAiB,KAAKD,EAAE,EAChCE,GAAYD,GAAQ,OAAS,OAE7BE,GAAa,WACbC,GAAU,QACVC,GAAiB,SACjBC,GAAY,UACZC,GAAwB,WAKxBC,GAAgB,CACpB,GAAIC,GACJ,GAAAC,GACA,GAAAC,GACA,GAAAC,GACA,GAAAC,EACF,EAtEAC,GAAAC,GAAAC,GAAAC,GAAAC,GAAAC,GAAAC,GAAAC,GAAAC,GAAAC,GA+EMC,EAAN,cAA6BC,GAAiBC,CAAU,CAAE,CAiSxD,aAAc,CACZ,MAAM,EAlSVC,GAAA,KAAAb,IA2BE,kBAAe,YAQf,mBAAgB,SAyBhB,eAAY,OAGZ,oBAAiB,GAGjB,oBAAuBc,GAAa,EAIpC,YAAiBnB,GA8NfoB,GAAaC,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAEvE,IAAMC,EAAOC,GAAa,EACtBD,GAAQvB,GAAcuB,CAAI,IAC5B,KAAK,OAASvB,GAAcuB,CAAI,GAGlC,KAAK,gBAAkB,KAAK,gBAAgB,KAAK,IAAI,CACvD,CAnOA,IAAI,cAA4B,CAxJlC,IAAAE,EAyJI,OAAOA,EAAAC,GAAc,KAAK,KAAK,IAAxB,KAAAD,EAA6B,IACtC,CAGA,IAAI,OAAQ,CACV,OAAOE,GAAa,KAAK,cAAc,CACzC,CAGA,IAAI,OAAQ,CACV,IAAMC,EAAQ,KAAK,MACbC,EAAiB,KAAK,eAQtBC,EAPaC,GACjB,CACE,MAAOJ,GAAaC,CAAK,EACzB,IAAKI,GAAeJ,CAAK,CAC3B,EACA,CAAE,OAAQ,KAAK,MAAO,CACxB,EAEG,IAAKK,IAAe,CACnB,MAAOA,EACP,IAAKC,GAAUD,EAAW,CAAE,OAAQ,KAAK,MAAO,CAAC,CACnD,EAAE,EACD,IAAKE,GAASC,GAAkBD,CAAI,CAAC,EAGxC,GAAIE,GAAYR,EAAgBD,CAAK,EAAG,CACtC,IAAMU,EAAcC,GAAeV,EAAgB,CAAE,OAAQ,KAAK,MAAO,CAAC,EAAI,EAIxEW,EAAMC,GAAyBZ,EAAgBa,GAAYb,EAAgB,CAAE,OAAQ,KAAK,MAAO,CAAC,CAAC,EAEzGC,EAAcQ,CAAW,EAAEE,CAAG,EAAIX,CACpC,CACA,OAAOC,CACT,CAiEQ,gBAAgBa,EAA4B,CAC9C,CAAC,KAAK,gBAIiB,KAAK,SAASA,EAAE,MAAc,IAKzD,KAAK,eAAiB,GACxB,CAmHA,mBAA0B,CACxB,MAAM,kBAAkB,EAGxB,IAAMpB,EAAO,KAAK,KAKlB,GAJIA,GAAQvB,GAAcuB,CAAI,IAC5B,KAAK,OAASvB,GAAcuB,CAAI,GAG9B,KAAK,MAAO,CACd,IAAMqB,EAAMlB,GAAc,KAAK,KAAK,EAChCkB,IACF,KAAK,eAAiBA,EAE1B,CAEA,SAAS,iBAAiB,YAAa,KAAK,eAAe,EAC3D,SAAS,iBAAiB,WAAY,KAAK,eAAe,EAC1D,SAAS,iBAAiB,UAAW,KAAK,eAAe,CAC3D,CAEA,sBAA6B,CAC3B,MAAM,qBAAqB,EAE3B,SAAS,oBAAoB,YAAa,KAAK,eAAe,EAC9D,SAAS,oBAAoB,WAAY,KAAK,eAAe,EAC7D,SAAS,oBAAoB,UAAW,KAAK,eAAe,CAC9D,CAEA,QAAQC,EAA+C,CACjDA,EAAkB,IAAI,OAAO,GAE/B,KAAK,SAAS,KAAK,KAAK,CAE5B,CAEA,QAAS,CACP,OAAOC;AAAA,8CACmChD,EAAS;AAAA,uDACAF,EAAO,KAAK,KAAK,KAAK;AAAA;AAAA;AAAA,kBAG3DA,EAAO;AAAA,oBACLF,EAAS;AAAA,oBACTqD,EAAU,KAAK,IAAI,CAAC;AAAA,qBACnBA,EAAU,KAAK,KAAK,CAAC;AAAA;AAAA,sBAEpBC,GAAA,KAAK1C,GAAAM,GAAa;AAAA,sBAClBoC,GAAA,KAAK1C,GAAAK,GAAQ;AAAA,wBACXqC,GAAA,KAAK1C,GAAAO,GAAe;AAAA;AAAA,0BAElB,KAAK,MACfoC,EAAK,EAAE,CACL,GAAI,+BACJ,OAAQ,CAAE,YAAaC,GAAO,KAAK,MAAO,KAAK,SAAS,CAAE,EAC1D,QAAS,6BACT,QACE,6HACJ,CAAC,EACDD,EAAK,EAAE,CACL,GAAI,+BACJ,QAAS,cACT,QACE,8HACJ,CAAC,CAAC;AAAA,6BACWtD,EAAU;AAAA;AAAA,2BAEZE,EAAc;AAAA,kBACvBA,EAAc;AAAA;AAAA;AAAA;AAAA,sBAIVmD,GAAA,KAAK1C,GAAAC,GAAmB;AAAA;AAAA;AAAA;AAAA;AAAA,0EAK4BwC,GAAS,CAAE,QAAS,KAAK,eAAiB,OAAY,MAAO,CAAC,CAAC;AAAA;AAAA,wBAEjHE,EAAK,EAAE,CACnB,GAAI,sCACJ,QAAS,cACT,QAAS,gFACX,CAAC,CAAC;AAAA;AAAA;AAAA;AAAA,yBAIatD,EAAU;AAAA,gBACnBA,EAAU;AAAA,sBACJqD,GAAA,KAAK1C,GAAAQ,GAAkB;AAAA;AAAA;AAAA,4BAGjBmC,EAAK,EAAE,CACnB,GAAI,oCACJ,QAAS,iBACT,QAAS,oDACX,CAAC,CAAC;AAAA;AAAA,oBAEIlD,EAAqB;AAAA,6BACZA,EAAqB;AAAA;AAAA;AAAA;AAAA,wBAI1BiD,GAAA,KAAK1C,GAAAG,GAAc;AAAA;AAAA;AAAA;AAAA,gBAI3ByC,GAAO,KAAK,MAAO,KAAK,aAAc,CAAE,OAAQ,KAAK,MAAO,CAAC,CAAC;AAAA;AAAA;AAAA,4BAGlDD,EAAK,EAAE,CACnB,GAAI,gCACJ,QAAS,aACT,QAAS,gDACX,CAAC,CAAC;AAAA;AAAA,6BAEatD,EAAU;AAAA;AAAA;AAAA;AAAA,wBAIfqD,GAAA,KAAK1C,GAAAE,GAAU;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,oBAQnB,KAAK,MAAM,CAAC,EAAE,IACbgC,GAAQM,sCAAyCI,GAAOV,EAAK,KAAK,cAAe,CAAE,OAAQ,KAAK,MAAO,CAAC,CAAC,QAC5G,CAAC;AAAA;AAAA;AAAA;AAAA,kBAID,KAAK,MAAM,IACVL,GACCW;AAAA,wBACIX,EAAK,IAAKK,GAAQ,CAClB,GAAI,CAACH,GAAY,KAAK,MAAOG,CAAG,EAC9B,OAAOM,aAGT,IAAMK,EAAa,KAAK,cAAgB,KAAK,cAAcX,CAAG,EAAI,GAC5DY,EAAaC,GAAUb,EAAK,KAAK,YAAY,EAC7Cc,EAAmBd,IAAQ,KAAK,eAEtC,OAAOM;AAAA,0CACWC,EAAUQ,GAAQf,CAAG,EAAI,OAAS,MAAS,CAAC;AAAA,2CAC3CW,CAAU;AAAA,wCACbD,GAAOV,EAAK,KAAK,UAAW,CAAE,OAAQ,KAAK,MAAO,CAAC,CAAC;AAAA,2CACjDY,CAAU;AAAA,mCAClBT,GAAS,CAChB,oBAAqB,GACrB,2BAA4BY,GAAQf,CAAG,EACvC,8BAA+BY,EAC/B,8BAA+BD,EAC/B,gCAAiCG,CACnC,CAAC,CAAC;AAAA,6CACiBA,CAAgB;AAAA,uCACtBE,GAAUhB,EAAK,CAAE,eAAgB,MAAO,CAAC,CAAC;AAAA;AAAA,sCAE3Cc,EAAmB,EAAI,EAAE;AAAA,oCAC3BH,EAAa,OAAYH,GAAA,KAAK1C,GAAAS,GAAiB;AAAA,sCAC7CoC,EAAa,OAAYH,GAAA,KAAK1C,GAAAS,GAAiB;AAAA,iCACpD0C,GAAQjB,CAAG,CAAC;AAAA,8BAEvB,CAAC,CAAC;AAAA,0BAER,CAAC;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,KAOf,CACF,EA9dAlC,GAAA,YA6IQC,GAAmB,eAACoC,EAA+B,CACvDA,EAAE,eAAe,EACjB,KAAK,eAAiB,CAAC,KAAK,eACxB,KAAK,iBAGP,MAAM,KAAK,gBACV,KAAK,cAAgB,KAAK,WAAW,MAAM,EAEhD,EAEAnC,GAAU,UAAG,CACX,KAAK,eAAiBkD,GAAU,KAAK,MAAO,CAAC,CAC/C,EAEAjD,GAAc,UAAG,CACf,KAAK,eAAiBkD,GAAU,KAAK,MAAO,CAAC,CAC/C,EAEMjD,GAAoB,gBAAG,CAG3B,MAAM,KAAK,eACX,KAAK,MAAM,cAAc,IAAI,MAAM,SAAU,CAAE,QAAS,GAAM,SAAU,EAAK,CAAC,CAAC,CACjF,EAwBAC,GAAQ,SAACgC,EAAe,CACtB,KAAK,MAASA,EAAE,OAA4B,KAC9C,EAEA/B,GAAa,SAAC+B,EAAiB,CAE7BA,EAAE,eAAe,EACjB,KAAK,eAAiB,EACxB,EAEA9B,GAAe,SAAC8B,EAAkB,CAChC,GAAIA,EAAE,MAAQ,IAAK,OAAOK,GAAA,KAAK1C,GAAAC,IAAL,UAAyBoC,IAC/CA,EAAE,MAAQ,KAAOA,EAAE,MAAQ,UAC7BA,EAAE,eAAe,CAErB,EAEM7B,GAAkB,eAAC6B,EAAkB,CACzC,IAAMd,EAAiB,KAAK,eACxB+B,EAEJ,OAAQjB,EAAE,IAAK,CACb,IAAK,UACHiB,EAAoBC,GAAQhC,EAAgB,CAAC,EAC7C,MACF,IAAK,YACH+B,EAAoBC,GAAQhC,EAAgB,CAAC,EAC7C,MACF,IAAK,OACH+B,EAAoBlB,GAAYb,EAAgB,CAAE,OAAQ,KAAK,MAAO,CAAC,EACvE,MACF,IAAK,SACH+B,EAAoBD,GAAU9B,EAAgB,CAAC,EAC/C,MACF,IAAK,YACH+B,EAAoBE,GAAQjC,EAAgB,CAAC,EAC7C,MACF,IAAK,aACH+B,EAAoBE,GAAQjC,EAAgB,CAAC,EAC7C,MACF,IAAK,MACH+B,EAAoB1B,GAAUL,EAAgB,CAAE,OAAQ,KAAK,MAAO,CAAC,EACrE,MACF,IAAK,WACH+B,EAAoBF,GAAU7B,EAAgB,CAAC,EAC/C,MACF,IAAK,SACH,KAAK,eAAiB,GACtB,MACF,IAAK,MACEc,EAAE,OAAuB,UAAY,MAAQ,CAACA,EAAE,UAGnDA,EAAE,eAAe,EACjB,KAAK,oBAAoB,MAAM,GACrBA,EAAE,OAAuB,KAAO5C,IAAyB4C,EAAE,WAKrEA,EAAE,eAAe,GAChB,KAAK,cAAgB,KAAK,WAAW,MAAM,GAE9C,KACJ,CAEIiB,IAEFjB,EAAE,eAAe,EACjB,KAAK,eAAiBiB,EAItB,MAAM,KAAK,eACX,KAAK,aAAa,MAAM,EAE5B,EAEA7C,GAAiB,SAACgD,EAAmC,CAInD,IAAMC,EAAWD,EAAM,cAAuC,QAAQ,KAElE,QAASA,GACPA,EAAM,MAAQ,SAAWA,EAAM,MAAQ,OAEzCA,EAAM,eAAe,EACrB,KAAK,MAAQC,EACb,KAAK,eAAiB,GACtB,KAAK,aAAa,MAAM,EACxBhB,GAAA,KAAK1C,GAAAI,IAAL,aAGF,KAAK,MAAQsD,EACb,KAAK,eAAiB,GACtBhB,GAAA,KAAK1C,GAAAI,IAAL,WAEJ,EA/RIM,EACG,kBAAoB,CACzB,GAAGiD,GAAY,kBACf,eAAgB,EAClB,EAJIjD,EAMG,OAAS,CAACkD,EAAOC,GAAmBC,GAA2BC,GAAsBC,EAAsB,EAGlHC,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GARvBxD,EASJ,qBAIAuD,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GAZvBxD,EAaJ,oBAGAuD,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GAfvBxD,EAgBJ,oBAGAuD,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GAlBvBxD,EAmBJ,qBAQAuD,EAAA,CADCC,EAAS,CAAE,UAAW,eAAgB,CAAC,GA1BpCxD,EA2BJ,4BAQAuD,EAAA,CADCC,EAAS,CAAE,UAAW,gBAAiB,CAAC,GAlCrCxD,EAmCJ,6BAyBAuD,EAAA,CADCC,EAAS,CAAE,UAAW,YAAa,CAAC,GA3DjCxD,EA4DJ,yBAGAuD,EAAA,CADCE,GAAM,GA9DHzD,EA+DJ,8BAGAuD,EAAA,CADCE,GAAM,GAjEHzD,EAkEJ,8BAIAuD,EAAA,CADCE,GAAM,GArEHzD,EAsEJ,sBAGIuD,EAAA,CADHE,GAAM,GAxEHzD,EAyEA,4BAKAuD,EAAA,CADHE,GAAM,GA7EHzD,EA8EA,qBAKAuD,EAAA,CADHE,GAAM,GAlFHzD,EAmFA,qBA+BJuD,EAAA,CADC5B,GAAM,IAAIhD,EAAU,EAAE,GAjHnBqB,EAkHJ,wBAGAuD,EAAA,CADC5B,GAAM,IAAI/C,EAAO,GAAI,EAAI,GApHtBoB,EAqHJ,qBAGAuD,EAAA,CADC5B,GAAM,IAAI9C,EAAc,GAAI,EAAI,GAvH7BmB,EAwHJ,4BAGAuD,EAAA,CADC5B,GAAM,IAAI7C,EAAS,GAAI,EAAI,GA1HxBkB,EA2HJ,uBAUAuD,EAAA,CADC5B,GAAM,IAAI5C,EAAqB,EAAE,GApI9BiB,EAqIJ,mCAGAuD,EAAA,CADC5B,GAAM,uBAAuB,GAvI1B3B,EAwIJ,yBAGAuD,EAAA,CADC5B,GAAM,0BAA0B,GA1I7B3B,EA2IJ,4BAqVG,eAAe,IAAI,cAAc,GACpC,eAAe,OAAO,eAAgBA,CAAc,EmHpiB/C,IAAM0D,GAAN,cAA6BC,CAAW,CAAxC,kCACuB,UAA6B,QACb,aAAmB,GACnB,mBAAyB,GACzB,aAAmB,GAG/D,IAAI,qBAAsB,CACxB,MAAO,CAAC,KAAK,SAAW,KAAK,cAAgB,SAAM,EACrD,CAEA,QAAS,CACP,IAAMC,EAAUC,GAAS,CACvB,SAAU,KAAK,OAAS,WACxB,MAAO,KAAK,OAAS,QACrB,QAAS,KAAK,OAChB,CAAC,EACD,OAAOC,iBAAoBF,CAAO,KAAK,KAAK,mBAAmB,SACjE,CAoDF,EAtEaF,GAoBJ,OAAsC,CAC3CK,EACAJ;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,KA+CF,EApE4BK,EAAA,CAA3BC,EAAS,CAAE,KAAM,MAAO,CAAC,GADfP,GACiB,oBACgBM,EAAA,CAA3CC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAF/BP,GAEiC,uBACAM,EAAA,CAA3CC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAH/BP,GAGiC,6BACAM,EAAA,CAA3CC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAJ/BP,GAIiC,uBAoEzC,eAAe,IAAI,eAAe,GACrC,eAAe,OAAO,gBAAiBA,EAAc,EErF9B,IAAMQ,GAAS,KAAK,MAAM,4CAAgD,ECApEA,GAAS,KAAK,MAAM,gDAAoD,ECAxEA,GAAS,KAAK,MAAM,mDAAoD,ECAxEA,GAAS,KAAK,MAAM,2CAA+C,ECAnEA,GAAS,KAAK,MAAM,yCAA6C,ECEnFC,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,GAAgB,KAEvBC,GAAgB,IAAM,CAP5B,IAAAC,EAQC,IAAIC,EACH,QAAQD,EAAA,SAAA,KAAA,OAAA,QAAS,MAAT,KAAA,OAAAA,EAAc,UAAW,CACjC,IAAK,OACJC,EAAQ,KACR,MACD,IAAK,OACJA,EAAQ,KACR,MACD,IAAK,UACJA,EAAQ,KACR,MACD,IAAK,MACJA,EAAQ,KACR,MACD,QACCA,EAAQ,IACV,CACA,OAAOA,CACR,EAEMC,GAAe,IAAM,CA5B3B,IAAAF,EA6BE,IAAMG,GAAWH,EAAA,UAAA,KAAA,OAAA,SAAU,WAAV,KAAA,OAAAA,EAAoB,SACrC,OAAIG,GAAA,MAAAA,EAAU,SAAS,MAAA,EACd,KACEA,EAAS,SAAS,MAAM,EAC1B,KACEA,EAAS,SAAS,SAAS,EAC7B,KACEA,EAAS,SAAS,KAAK,EACzB,KAEAL,EAEX,EAEaM,GAAsBC,GAE/BR,GAAiB,KACdS,GACCD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CACrE,GAAKJ,GAAa,EAIf,SAASK,IAAgC,CApDhD,IAAAP,EAqDE,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMQ,EAAeT,GAAc,EACnC,OAAOK,GAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,GAAaT,EAAA,UAAA,KAAA,OAAA,SAAU,kBAAV,KAAA,OAAAA,EAA2B,KACxCU,EAAaR,GAAa,EAEhC,OAAKL,GAAiB,SAASY,CAA6B,EAIrDL,GAAmBK,GAAA,KAAAA,EAAcC,CAAU,GAHhD,QAAQ,KAAK,gFAAgF,EACtFN,GAAmBM,CAAU,EAGxC,OAAS,EAAG,CACV,eAAQ,KAAK,yDAA0D,CAAC,EACjEZ,EACT,CACF,CAEO,IAAMa,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,GAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBX,EAAWe,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FC,EAAK,KAAKjB,EAAQV,CAAQ,EAC1B2B,EAAK,SAASjB,CAAM,CACtB,ENjGAW,GAAarB,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAGhE,IAAM4B,GAAN,cAAgCC,CAAW,CAChD,QAAS,CACL,IAAMC,EAAQH,EAAK,EAAE,CAAE,QAAS,iBAAkB,GAAI,0BAA2B,QAAS,6BAA8B,CAAC,EAEzH,OAAOI,kIAAqIC,EAAa,UAAUF,CAAK,UAAU,CAAC,8IAAgJ,CACzU,EACK,eAAe,IAAI,wBAAwB,GAC9C,eAAe,OAAO,yBAA0BF,EAAiB,EQnB1C,IAAMK,GAAS,KAAK,MAAM,0CAA8C,ECAlEA,GAAS,KAAK,MAAM,4CAAgD,ECApEA,GAAS,KAAK,MAAM,oDAAkD,ECAtEA,GAAS,KAAK,MAAM,wCAA4C,ECAhEA,GAAS,KAAK,MAAM,uCAA2C,ECEjFC,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,GAAgB,KAEvBC,GAAgB,IAAM,CAP5B,IAAAC,EAQC,IAAIC,EACH,QAAQD,EAAA,SAAA,KAAA,OAAA,QAAS,MAAT,KAAA,OAAAA,EAAc,UAAW,CACjC,IAAK,OACJC,EAAQ,KACR,MACD,IAAK,OACJA,EAAQ,KACR,MACD,IAAK,UACJA,EAAQ,KACR,MACD,IAAK,MACJA,EAAQ,KACR,MACD,QACCA,EAAQ,IACV,CACA,OAAOA,CACR,EAEMC,GAAe,IAAM,CA5B3B,IAAAF,EA6BE,IAAMG,GAAWH,EAAA,UAAA,KAAA,OAAA,SAAU,WAAV,KAAA,OAAAA,EAAoB,SACrC,OAAIG,GAAA,MAAAA,EAAU,SAAS,MAAA,EACd,KACEA,EAAS,SAAS,MAAM,EAC1B,KACEA,EAAS,SAAS,SAAS,EAC7B,KACEA,EAAS,SAAS,KAAK,EACzB,KAEAL,EAEX,EAEaM,GAAsBC,GAE/BR,GAAiB,KACdS,GACCD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CACrE,GAAKJ,GAAa,EAIf,SAASK,IAAgC,CApDhD,IAAAP,EAqDE,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMQ,EAAeT,GAAc,EACnC,OAAOK,GAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,GAAaT,EAAA,UAAA,KAAA,OAAA,SAAU,kBAAV,KAAA,OAAAA,EAA2B,KACxCU,EAAaR,GAAa,EAEhC,OAAKL,GAAiB,SAASY,CAA6B,EAIrDL,GAAmBK,GAAA,KAAAA,EAAcC,CAAU,GAHhD,QAAQ,KAAK,gFAAgF,EACtFN,GAAmBM,CAAU,EAGxC,OAAS,EAAG,CACV,eAAQ,KAAK,yDAA0D,CAAC,EACjEZ,EACT,CACF,CAEO,IAAMa,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,GAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBX,EAAWe,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FC,EAAK,KAAKjB,EAAQV,CAAQ,EAC1B2B,EAAK,SAASjB,CAAM,CACtB,ENjGAW,GAAarB,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAGhE,IAAM4B,GAAN,cAA8BC,CAAW,CAC9C,QAAS,CACL,IAAMC,EAAQH,EAAK,EAAE,CAAE,QAAS,eAAgB,GAAI,wBAAyB,QAAS,2BAA4B,CAAC,EAEnH,OAAOI,gIAAmIC,EAAa,UAAUF,CAAK,UAAU,CAAC,uIAAyI,CAChU,EACK,eAAe,IAAI,sBAAsB,GAC5C,eAAe,OAAO,uBAAwBF,EAAe,EOnB7B,IAAMK,GAASC,q1NCc1C,IAAMC,GAAQ,CACnB,KAAM,kEACN,MAAO,sDACP,KAAM,mBACN,QAAS,mBACT,SAAU,wBACZ,EAEaC,GAAe,CAC1B,QAAS,4BACT,IAAK,4HACL,MAAO,sDACP,QAAS,mCACT,cAAe,OACf,iBAAkB,2DAClB,cAAe,cACf,gBAAiB,aAGjB,6BACE,uMACF,2BACE,+LACF,sBAAuB,iDACvB,wBAAyB,8CAEzB,UAAW,kBACX,qBAAsB,gBACtB,OAAQ,wHACR,UAAW,+HACX,iBAAkB,OAClB,MAAO,2CACP,UAAW,IACb,EA/CAC,GAAAC,GAAAC,GAAAC,GAAAC,GAAAC,GAAAC,GAwDMC,GAAN,cAA6BC,CAAW,CAAxC,kCAAAC,GAAA,KAAAT,IAEE,cAAoB,GAMpB,SAAe,GAGf,WAAiB,GASjB,eAAqB,GAGrB,cAAoB,GAOpB,eAAqB,GAIrB,oBAA0B,GAmB1B,QAAQU,EAAyC,CAE3CA,EAAkB,IAAI,UAAU,GAClC,WAAW,IAAM,CACf,KAAK,eAAiB,KAAK,QAC7B,EAAG,GAAG,CAEV,CAEA,cAAe,CAtHjB,IAAAC,EAuHI,IAAMC,EAAe,EAAQ,KAAK,MAC5BC,IAAgBF,EAAA,KAAK,WAAW,cAAc,oBAAoB,IAAlD,YAAAA,EAAyE,gBAAgB,QAAS,EAExH,KAAK,UAAYC,GAAgBC,CACnC,CAsCA,IAAI,iBAAkB,CACpB,OAAOC,gBAAmBC,GAAA,KAAKf,GAAAK,GAAe;AAAA;AAAA,WAGhD,CAEA,QAAS,CACP,OAAOS,iBAAoBC,GAAA,KAAKf,GAAAC,GAAe;AAAA,QAC3C,KAAK,UACHa,8BAAiC,KAAK,YAAY;AAAA;AAAA;AAAA,+BAG7B,KAAK,QAAQ;AAAA,uBACrBC,GAAA,KAAKf,GAAAE,GAAc;AAAA,uBACnB,IAAO,KAAK,SAAW,CAAC,KAAK,QAAS;AAAA,4BACjCH,GAAa,KAAK;AAAA,kBAC5B,KAAK,MAAQe,iBAAoBf,GAAa,SAAS,KAAK,KAAK,KAAK,UAAYe,6BAAgC;AAAA,kBAClH,KAAK,UAAY,GAAKA,gBAAmBC,GAAA,KAAKf,GAAAG,GAAe,KAAKY,GAAA,KAAKf,GAAAI,GAAY,QAAQ;AAAA;AAAA;AAAA,iCAInG,EAAE;AAAA,QACJ,KAAK,SACHU,+BAAkC,KAAK,QAAQ,KAAK,KAAK,eAAe,0BACxEA,gBAAmBC,GAAA,KAAKf,GAAAM,GAAiB,iBAAiBU,EAAW,KAAK,SAAkB,OAAP,EAAgB,CAAC;AAAA,cAClG,KAAK,eAAe;AAAA,iBACjB;AAAA,WAEf,CACF,EAtIAhB,GAAA,YAqEMC,GAAe,UAAG,CACpB,OAAOgB,EAAW,CAAClB,GAAa,QAAS,KAAK,KAAOA,GAAa,IAAK,KAAK,OAASA,GAAa,KAAK,CAAC,CAC1G,EAEIG,GAAc,UAAG,CACnB,OAAOe,EAAW,KAAK,YAAa,CAAClB,GAAa,OAAQ,KAAK,KAAOA,GAAa,SAAS,CAAC,CAC/F,EAEII,GAAe,UAAG,CACpB,OAAOc,EAAW,CAAClB,GAAa,QAAS,CAAC,KAAK,KAAOA,GAAa,aAAa,CAAC,CACnF,EAEIK,GAAY,UAAG,CACjB,IAAMc,EAAYD,EAAW,CAC3BlB,GAAa,2BACb,CAAC,KAAK,UAAY,KAAK,gBAAkBA,GAAa,uBACxD,CAAC,EACKoB,EAAcF,EAAW,CAC7BlB,GAAa,6BACb,KAAK,UAAY,CAAC,KAAK,gBAAkBA,GAAa,qBACxD,CAAC,EAED,OAAO,KAAK,eACRe,iCAAoCI,CAAS,4BAC7CJ,mCAAsCK,CAAW,6BACvD,EAEId,GAAe,UAAG,CACpB,OAAOY,EAAW,KAAK,aAAc,CAAC,KAAK,KAAOnB,GAAM,KAAM,KAAK,WAAa,KAAK,KAAOC,GAAa,gBAAgB,CAAC,CAC5H,EAEIO,GAAiB,UAAG,CACtB,OAAOW,EAAW,CAAClB,GAAa,UAAW,CAAC,KAAK,UAAYA,GAAa,oBAAoB,CAAC,CACjG,EAtGIQ,GAwCG,OAAS,CACda,EACAC,GACAb;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,KAQF,EAjDAc,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GADtChB,GAEJ,wBAGAe,EAAA,CADCC,EAAS,CAAE,KAAM,MAAO,CAAC,GAJtBhB,GAKJ,qBAGAe,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,CAAC,GAPvBhB,GAQJ,mBAGAe,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,CAAC,GAVvBhB,GAWJ,qBAGAe,EAAA,CADCC,EAAS,CAAE,UAAW,eAAgB,KAAM,MAAO,CAAC,GAbjDhB,GAcJ,2BAGAe,EAAA,CADCC,EAAS,CAAE,UAAW,gBAAiB,KAAM,MAAO,CAAC,GAhBlDhB,GAiBJ,4BAGAe,EAAA,CADCC,EAAS,CAAE,UAAW,aAAc,KAAM,OAAQ,CAAC,GAnBhDhB,GAoBJ,yBAGAe,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,CAAC,GAtBvBhB,GAuBJ,wBAGAe,EAAA,CADCC,EAAS,CAAE,UAAW,gBAAiB,KAAM,MAAO,CAAC,GAzBlDhB,GA0BJ,4BAIAe,EAAA,CAFCC,EAAS,CAAE,KAAM,QAAS,MAAO,EAAK,CAAC,GA5BpChB,GA8BJ,yBAIAe,EAAA,CAFCC,EAAS,CAAE,KAAM,QAAS,MAAO,EAAK,CAAC,GAhCpChB,GAkCJ,8BAsGG,eAAe,IAAI,cAAc,GACpC,eAAe,OAAO,eAAgBA,EAAc,EC9L/C,IAAMiB,GACXC,GAEA,cAAcA,CAAW,CAAzB,kCACE,gBAAa,GACb,YAAS,KACT,OAAQ,CACN,KAAK,OAAO,CACd,CACF,EAEWC,GAE2DD,GACtE,cAAcA,CAAW,CAGvB,iBAAiBE,EAAK,CACpB,IAAMC,EAAWD,EAAI,OAAO,cAAc,CAAE,QAAS,EAAK,CAAC,EAC3D,QAAWE,KAASD,EAAS,OAAQE,GAAMA,EAAE,UAAU,EAErDD,EAAM,OAAS,IAAM,KAAK,MAAM,CAEpC,CACF,EChBK,IAAME,GAAN,cAA0BC,GAAcC,GAA6BC,CAAU,CAAC,CAAE,CACvF,QAAS,CACP,OAAOC;AAAA;AAAA,6BAEkB,KAAK,gBAAgB;AAAA;AAAA,KAGhD,CAoBF,EA3BaJ,GAQJ,OAAS,CACdK,EACAF;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,KAgBF,EAGG,eAAe,IAAI,gBAAgB,GACtC,eAAe,OAAO,iBAAkBH,EAAW,EClC9C,IAAMM,GAAgB,CAACC,EAAOC,KAAU,CAC7C,GAAID,EAAM,KAAOC,EAAK,KACtB,GAAID,EAAM,IAAMC,EAAK,IACrB,GAAID,EAAM,MAAQC,EAAK,MACvB,GAAID,EAAM,OAASC,EAAK,OACxB,MAAAD,EACA,KAAAC,CACF,GAGaC,GAAgB,CAAC,CAAE,GAAAC,EAAI,GAAAC,CAAG,IAAO,CAC5C,CAAE,UAAW,aAAaD,CAAE,OAAOC,CAAE,KAAM,EAC3C,CAAE,UAAW,MAAO,CACtB,EAGaC,GAAoB,CAAE,OAAQ,OAAQ,SAAU,GAAI,ECvB1D,IAAIC,GAAe,GAEpBC,GAAgB,OAAO,QAAW,YACxC,GAAIA,GAAc,CAChB,IAAMC,EAAQ,OAAO,WAAW,kCAAkC,EAC5DC,EAAW,CAAC,CAAE,QAAAC,CAAQ,IAAMJ,GAAeI,EAE7CF,EAAM,kBAAkBA,EAAM,iBAAiB,SAAUC,CAAQ,EACrEA,EAASD,CAAK,CAChB,CCNO,IAAMG,GAAN,KAAW,CAQhB,YAAYC,EAAI,CAAE,UAAAC,EAAY,CAAC,EAAG,UAAAC,EAAW,oBAAAC,EAAsB,EAAK,EAAI,CAAC,EAAG,CANhFC,GAAA,cAEAA,GAAA,aAEAA,GAAA,WAGE,KAAK,GAAKJ,EACV,KAAK,MAAQ,CAAC,EACd,KAAK,KAAO,CAAC,EACb,KAAK,qBAAuBC,EAC5B,KAAK,kBAAoBC,GAAaG,GACtC,KAAK,mBAAqBF,CAC5B,CAEA,MAAM,KAAKG,EAAI,CACb,KAAK,KAAK,EACV,IAAMC,EAAI,MAAMD,EAAG,EACnB,aAAM,KAAK,KAAK,EACTC,CACT,CAEA,MAAO,CACL,KAAK,MAAQ,KAAK,GAAG,sBAAsB,CAC7C,CAEA,MAAM,MAAO,CAEX,GADA,KAAK,KAAO,KAAK,GAAG,sBAAsB,EACtC,CAAC,KAAK,GAAG,QAAS,OAEtB,MADkB,KAAK,GAAG,QAAQ,KAAK,UAAW,KAAK,gBAAgB,EACvD,QAClB,CAEA,IAAI,WAAY,CACd,OAAO,KAAK,kBAAkBC,GAAc,KAAK,MAAO,KAAK,IAAI,CAAC,CACpE,CAEA,IAAI,UAAW,CACb,OAAOC,EACT,CAEA,IAAI,eAAgB,CAClB,MAAO,CAAE,GAAG,KAAK,SAAU,GAAG,KAAK,oBAAqB,CAC1D,CAEA,IAAI,kBAAmB,CACrB,OAAK,KAAK,mBACLC,GACE,CAAE,GAAG,KAAK,cAAe,SAAU,CAAE,EADlB,KAAK,cADM,KAAK,aAG5C,CACF,EEvDyB,IAAMC,GAAS,KAAK,MAAM,yDAA6D,ECAjFA,GAAS,KAAK,MAAM,uDAA2D,ECA/EA,GAAS,KAAK,MAAM,0DAA8D,ECAlFA,GAAS,KAAK,MAAM,+CAAmD,ECAvEA,GAAS,KAAK,MAAM,wDAAyD,ECE/FC,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,GAAgB,KAEvBC,GAAgB,IAAM,CAP5B,IAAAC,EAQC,IAAIC,EACH,QAAQD,EAAA,SAAA,KAAA,OAAA,QAAS,MAAT,KAAA,OAAAA,EAAc,UAAW,CACjC,IAAK,OACJC,EAAQ,KACR,MACD,IAAK,OACJA,EAAQ,KACR,MACD,IAAK,UACJA,EAAQ,KACR,MACD,IAAK,MACJA,EAAQ,KACR,MACD,QACCA,EAAQ,IACV,CACA,OAAOA,CACR,EAEMC,GAAe,IAAM,CA5B3B,IAAAF,EA6BE,IAAMG,GAAWH,EAAA,UAAA,KAAA,OAAA,SAAU,WAAV,KAAA,OAAAA,EAAoB,SACrC,OAAIG,GAAA,MAAAA,EAAU,SAAS,MAAA,EACd,KACEA,EAAS,SAAS,MAAM,EAC1B,KACEA,EAAS,SAAS,SAAS,EAC7B,KACEA,EAAS,SAAS,KAAK,EACzB,KAEAL,EAEX,EAEaM,GAAsBC,GAE/BR,GAAiB,KACdS,GACCD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CACrE,GAAKJ,GAAa,EAIf,SAASK,IAAgC,CApDhD,IAAAP,EAqDE,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMQ,EAAeT,GAAc,EACnC,OAAOK,GAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,GAAaT,EAAA,UAAA,KAAA,OAAA,SAAU,kBAAV,KAAA,OAAAA,EAA2B,KACxCU,EAAaR,GAAa,EAEhC,OAAKL,GAAiB,SAASY,CAA6B,EAIrDL,GAAmBK,GAAA,KAAAA,EAAcC,CAAU,GAHhD,QAAQ,KAAK,gFAAgF,EACtFN,GAAmBM,CAAU,EAGxC,OAAS,EAAG,CACV,eAAQ,KAAK,yDAA0D,CAAC,EACjEZ,EACT,CACF,CAEO,IAAMa,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,GAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBX,EAAWe,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FC,EAAK,KAAKjB,EAAQV,CAAQ,EAC1B2B,EAAK,SAASjB,CAAM,CACtB,ENjGAW,GAAarB,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAGhE,IAAM4B,GAAN,cAA8BC,CAAW,CAC9C,QAAS,CACL,IAAMC,EAAQH,EAAK,EAAE,CAAE,QAAS,0BAA2B,GAAI,wBAAyB,QAAS,iCAAkC,CAAC,EAEpI,OAAOI,gIAAmIC,EAAa,UAAUF,CAAK,UAAU,CAAC,iPAAmP,CAC1a,EACK,eAAe,IAAI,sBAAsB,GAC5C,eAAe,OAAO,uBAAwBF,EAAe,EOnBtC,IAAMK,GAAS,KAAK,MAAM,4DAAoE,ECA9F,IAAMC,GAAS,KAAK,MAAM,2DAAmE,ECA7F,IAAMC,GAAS,KAAK,MAAM,+DAAuE,ECAjG,IAAMC,GAAS,KAAK,MAAM,6DAAqE,ECA/F,IAAMC,GAAS,KAAK,MAAM,kEAAuE,ECyBnH,IAAMC,GAAN,cAA0BC,GAAcC,CAAU,CAAE,CASzD,aAAc,CACZ,MAAM,EALC,KAAQ,eAAiB,GAMhCC,GAAaC,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,CACzE,CACA,QAAS,CACP,OAAOC;AAAA;AAAA,uCAE4B,KAAK,mBAAmB;AAAA,sBACzC,KAAK,eAAiB,GAAK,kBAAkB;AAAA,YACvD,KAAK,UAAU;AAAA,gCACK,KAAK,YAAY,KAAK,KAAK,KAAK;AAAA,YACpD,KAAK,WAAW;AAAA;AAAA;AAAA,KAI1B,CAEA,MAAM,WAAWC,EAAyC,CACpDA,EAAkB,IAAI,MAAM,GACjB,IAAIC,GAAK,KAAK,OAAO,EAC7B,KAAK,SAAY,CACpB,MAAM,KAAK,cACb,CAAC,CAEL,CACA,IAAI,cAAe,CACjB,MAAO,CACL,eACA,KAAK,KAAO,gCAAkC,mCAC9C,KAAK,eAAiB,6BAA+B,EACvD,EAAE,KAAK,GAAG,CACZ,CAEA,IAAI,YAAa,CACf,OAAO,KAAK,MAAQ,CAAC,KAAK,eACtBF;AAAA;AAAA,wBAEgBG,EAAK,EAAE,CACnB,GAAI,kBACJ,QAAS,OACT,QAAS,yCACX,CAAC,CAAC;AAAA;AAAA,oBAEQ,KAAK,QAAQ;AAAA;AAAA,mBAGzBC,CACN,CACA,IAAI,aAAc,CAChB,OAAI,KAAK,QAAgBA,EAClBJ;AAAA;AAAA,oBAESG,EAAK,EAAE,CACnB,GAAI,mBACJ,QAAS,QACT,QAAS,0CACX,CAAC,CAAC;AAAA,6BACqB,KAAK,eAAiB,+BAAiC,qBAAqB;AAAA,gBACzF,KAAK,KAAK;AAAA;AAAA,cAGxB,CACA,UAAW,CACT,KAAK,cAAc,IAAI,YAAY,cAAe,CAAE,QAAS,GAAM,SAAU,EAAK,CAAC,CAAC,CACtF,CACA,oBAAoBE,EAAW,CAC7B,IAAMC,EAAaD,EAAU,OAAO,iBAAiB,CAAE,QAAS,EAAK,CAAC,EACtE,KAAK,eAAiB,CAAC,CAACC,EAAW,MACrC,CAsHF,EAnMaX,GA8EJ,OAAS,CACdY,EACAV;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,KAkHF,EAjM4BW,EAAA,CAA3BC,EAAS,CAAE,KAAM,MAAO,CAAC,GADfd,GACiB,qBACCa,EAAA,CAA5BC,EAAS,CAAE,KAAM,OAAQ,CAAC,GAFhBd,GAEkB,oBACuBa,EAAA,CAAnDC,EAAS,CAAE,KAAM,QAAS,UAAW,UAAW,CAAC,GAHvCd,GAGyC,uBAEnCa,EAAA,CAAhBE,GAAM,GALIf,GAKM,8BAEGa,EAAA,CAAnBG,GAAM,WAAW,GAPPhB,GAOS,uBA8LjB,eAAe,IAAI,gBAAgB,GACtC,eAAe,OAAO,iBAAkBA,EAAW,EC/NrD,IAAIiB,GAAI,CAAC,EACHC,GAAI,CAAE,gBAAiB,CAAC,EAAG,KAAM,CAAC,CAAE,EAAGC,GAAI,OAAO,OAAO,CAE7D,gBAAiB,CACf,mBAAoB,QACtB,EACA,KAAM,CACJ,SAAU,SACV,SAAU,WACV,OAAQ,MACV,CACF,CAAC,EAAGC,GAAK,GAAM,CAXf,IAAAC,EAYE,EAAE,QAAQ,OAAS,KAAKA,EAAA,EAAE,iBAAF,MAAAA,EAAA,QAC1B,EAAGC,GAAK,GAAM,CAAC,CAAC,EAAGC,CAAC,IAAM,CACxBL,GAAE,CAAC,EAAE,CAAC,EAAI,SAAS,CAAC,EAAE,MAAM,CAAC,EAAG,SAAS,CAAC,EAAE,MAAM,CAAC,EAAIK,CACzD,EAAGC,GAAI,IAAM,OAAO,QAAQL,EAAC,EAAE,QAAQ,CAAC,CAAC,EAAG,CAAC,IAAM,CACjD,OAAO,QAAQ,CAAC,EAAE,QAAQG,GAAE,CAAC,CAAC,CAChC,CAAC,EAAGG,GAAK,GAAM,CAAC,CAAC,EAAGF,CAAC,IAAM,CACzB,SAAS,CAAC,EAAE,MAAM,CAAC,EAAIL,GAAE,CAAC,EAAE,CAAC,CAC/B,EAAGQ,GAAI,IAAM,OAAO,QAAQR,EAAC,EAAE,QAAQ,CAAC,CAAC,EAAG,CAAC,IAAM,CACjD,OAAO,QAAQ,CAAC,EAAE,QAAQO,GAAE,CAAC,CAAC,CAChC,CAAC,EAAGE,GAAK,GAAM,EAAE,aAAe,KAAK,IAAI,EAAE,SAAS,IAAM,EAAE,aAC5D,SAASC,GAAE,EAAG,CACZ,IAAI,EAAI,GACFL,EAAK,GAAM,CACf,GAAI,EAAE,cAAc,SAAW,EAC7B,OACF,IAAMM,EAAI,EAAE,cAAc,CAAC,EAAE,QAAU,EACvC,OAAO,EAAE,YAAc,GAAKA,EAAI,GAAKF,GAAE,CAAC,GAAKE,EAAI,EAAIT,GAAE,CAAC,GAAK,EAAE,gBAAgB,EAAG,GACpF,EACA,EAAE,aAAgB,GAAM,CACtB,EAAE,cAAc,SAAW,IAAM,EAAI,EAAE,cAAc,CAAC,EAAE,QAC1D,EAAG,EAAE,YAAcG,CACrB,CACA,SAASO,GAAE,EAAG,CACZ,EAAE,aAAe,KAAM,EAAE,YAAc,IACzC,CACA,IAAMC,GAAK,GAAM,IAAM,SAAS,EAAI,mBAAqB,qBAAqB,EAAE,YAAaX,GAAG,CAAE,QAAS,EAAG,CAAC,EAAGY,GAAID,GAAE,EAAE,EAAGE,GAAIF,GAAE,EACnI,SAASG,GAAE,EAAG,CACZ,GAAI,CAAC,EACH,MAAM,MAAM,kDAAkD,EAChEjB,GAAE,KAAM,GAAM,IAAM,CAAC,IAAMA,GAAE,SAAWO,GAAE,EAAGQ,GAAE,GAAIJ,GAAE,CAAC,EAAGX,GAAE,KAAK,CAAC,EACnE,CACA,SAASkB,IAAI,CACXlB,GAAE,QAAQa,EAAC,EAAGG,GAAE,EAAGP,GAAE,EAAGT,GAAI,CAAC,CAC/B,CC3BO,IAAMmB,GAAN,cAAwBC,GAA6BC,CAAU,CAAE,CAStE,aAAc,CACZ,MAAM,EACN,KAAK,gBAAkB,KAAK,gBAAgB,KAAK,IAAI,EACrD,KAAK,qBAAuB,KAAK,qBAAqB,KAAK,IAAI,EAC/D,KAAK,eAAiB,KAAK,eAAe,KAAK,IAAI,EACnD,KAAK,mBAAqB,KAAK,mBAAmB,KAAK,IAAI,CAC7D,CAEA,MAAM,MAAO,CACX,KAAK,SAAS,UAAU,EACxB,KAAK,gBAAgB,EACrBC,GAAgB,KAAK,SAAS,EAC9B,MAAM,KAAK,eACX,KAAK,cAAc,IAAI,YAAY,QAAS,CAAE,QAAS,GAAM,SAAU,EAAK,CAAC,CAAC,CAChF,CAEA,OAAQ,CACN,KAAK,gBAAgB,qBAAqB,EAC1C,KAAK,SAAS,UAAU,IAAI,OAAO,EACnC,KAAK,SAAS,iBACZ,eACA,SAAY,CACV,KAAK,SAAS,UAAU,OAAO,OAAO,EACtC,KAAK,SAAS,MAAM,EACpBC,GAAmB,EACnB,MAAM,KAAK,eACX,KAAK,cAAc,IAAI,YAAY,SAAU,CAAE,QAAS,GAAM,SAAU,EAAK,CAAC,CAAC,CACjF,EACA,CAAE,KAAM,EAAK,CACf,CACF,CAEA,QAAS,CACP,OAAOC;AAAA;AAAA;AAAA,6CAGkC,KAAK,gBAAgB;AAAA,uCAC3B,KAAK,SAAS;AAAA,gDACL,KAAK,gBAAgB;AAAA;AAAA,6CAExB,KAAK,gBAAgB;AAAA;AAAA;AAAA,KAIhE,CAEA,QAAQC,EAAyC,CAC3CA,EAAkB,IAAI,MAAM,GAAG,KAAK,KAAK,KAAO,OAAS,OAAO,EAAE,CACxE,CAEA,gBAAgBC,EAAO,mBAAoB,CAEzC,SAASA,CAAI,EAAE,UAAW,KAAK,eAAe,EAEzC,KAAK,sBAAsB,KAAK,SAASA,CAAI,EAAE,YAAa,KAAK,oBAAoB,EAE1F,KAAK,SAASA,CAAI,EAAE,QAAS,KAAK,cAAc,EAEhD,KAAK,SAASA,CAAI,EAAE,SAAU,KAAK,cAAc,EAEjD,KAAK,cAAcA,CAAI,EAAE,gBAAiB,KAAK,kBAAkB,CACnE,CAEA,eAAeC,EAAY,CACzBA,EAAI,eAAe,CACrB,CAEA,qBAAqBA,EAAiB,CAChC,KAAK,WAAaA,EAAI,QAAQ,KAAK,MAAM,CAC/C,CAEA,gBAAgBA,EAAoB,CAC9BA,EAAI,MAAQ,WACdA,EAAI,eAAe,EACnB,KAAK,MAAM,EAEf,CAEA,oBAAqB,CACf,KAAK,cAAc,aAAe,KAAO,YAAa,KAAK,cAAc,MAAM,aAAe,MAC7F,KAAK,cAAc,MAAM,aAAe,IAC/C,CA+HF,EAzNaR,GA4FJ,OAAS,CACdS,EACAP;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,KA0HF,EAvN6BQ,EAAA,CAA5BC,EAAS,CAAE,KAAM,OAAQ,CAAC,GADhBX,GACkB,oBACwBU,EAAA,CAApDC,EAAS,CAAE,KAAM,OAAQ,UAAW,YAAa,CAAC,GAFxCX,GAE0C,yBACaU,EAAA,CAAjEC,EAAS,CAAE,KAAM,QAAS,UAAW,wBAAyB,CAAC,GAHrDX,GAGuD,oCAE7CU,EAAA,CAApBE,GAAM,YAAY,GALRZ,GAKU,wBACMU,EAAA,CAA1BE,GAAM,kBAAkB,GANdZ,GAMgB,6BACLU,EAAA,CAArBE,GAAM,aAAa,GAPTZ,GAOW,yBAoNnB,eAAe,IAAI,SAAS,GAC/B,eAAe,OAAO,UAAWA,EAAS,WCxN3Ba,GACfC,EACAC,EAAAA,CAEA,GAAID,IAAJ,OAAyB,CACvB,IAAIE,EAAI,EACR,QAAWC,KAASH,EAAAA,MACZC,EAAEE,EAAOD,GAAAA,CAElB,CACH,CCJM,SAAWE,GAAMC,EAAoBC,EAAcC,EAAO,EAAA,CAC9D,IAAMC,EAAQF,IAARE,OAA4B,EAAIH,EACtCC,GAAAA,OAAAA,EAAQD,GACR,QAASI,EAAID,EAAOD,EAAO,EAAIE,EAAIH,EAAMA,EAAMG,EAAGA,GAAKF,EAAAA,MAC/CE,CAEV,CChCO,IAAMC,GAASC;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;ECOf,IAAMC,GAAN,cAAgCC,CAAW,CAA3C,kCAKL,kBAAe,EAIf,eAAY,EAEZ,QAAyB,CACvB,OAAOC;AAAA;AAAA;AAAA,YAGCC,GAAIA,GAAM,KAAK,SAAS,EAAIF,GAAM,CAElC,IAAMG,EAAU,CACd,uBAAwB,GACxB,+BAHiBH,IAAM,KAAK,aAAe,CAI7C,EACA,OAAOC,gBAAmBG,GAASD,CAAO,CAAC,UAC7C,CAAC,CAAC;AAAA;AAAA;AAAA,KAIV,CACF,EA3BaJ,GACJ,OAAS,CAACM,EAAM,EAIvBC,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,UAAW,eAAgB,CAAC,GAJ3CR,GAKX,4BAIAO,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,UAAW,YAAa,CAAC,GARxCR,GASX,yBA0BG,eAAe,IAAI,iBAAiB,GACvC,eAAe,OAAO,kBAAmBA,EAAiB,EE7CnC,IAAMS,GAAS,KAAK,MAAM,+DAAmE,ECAvFA,GAAS,KAAK,MAAM,8DAAkE,ECAtFA,GAAS,KAAK,MAAM,gEAAoE,ECAxFA,GAAS,KAAK,MAAM,2DAA+D,ECAnFA,GAAS,KAAK,MAAM,6DAA8D,ECEpGC,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,GAAgB,KAEvBC,GAAgB,IAAM,CAP5B,IAAAC,EAQC,IAAIC,EACH,QAAQD,EAAA,SAAA,KAAA,OAAA,QAAS,MAAT,KAAA,OAAAA,EAAc,UAAW,CACjC,IAAK,OACJC,EAAQ,KACR,MACD,IAAK,OACJA,EAAQ,KACR,MACD,IAAK,UACJA,EAAQ,KACR,MACD,IAAK,MACJA,EAAQ,KACR,MACD,QACCA,EAAQ,IACV,CACA,OAAOA,CACR,EAEMC,GAAe,IAAM,CA5B3B,IAAAF,EA6BE,IAAMG,GAAWH,EAAA,UAAA,KAAA,OAAA,SAAU,WAAV,KAAA,OAAAA,EAAoB,SACrC,OAAIG,GAAA,MAAAA,EAAU,SAAS,MAAA,EACd,KACEA,EAAS,SAAS,MAAM,EAC1B,KACEA,EAAS,SAAS,SAAS,EAC7B,KACEA,EAAS,SAAS,KAAK,EACzB,KAEAL,EAEX,EAEaM,GAAsBC,GAE/BR,GAAiB,KACdS,GACCD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CACrE,GAAKJ,GAAa,EAIf,SAASK,IAAgC,CApDhD,IAAAP,EAqDE,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMQ,EAAeT,GAAc,EACnC,OAAOK,GAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,GAAaT,EAAA,UAAA,KAAA,OAAA,SAAU,kBAAV,KAAA,OAAAA,EAA2B,KACxCU,EAAaR,GAAa,EAEhC,OAAKL,GAAiB,SAASY,CAA6B,EAIrDL,GAAmBK,GAAA,KAAAA,EAAcC,CAAU,GAHhD,QAAQ,KAAK,gFAAgF,EACtFN,GAAmBM,CAAU,EAGxC,OAAS,EAAG,CACV,eAAQ,KAAK,yDAA0D,CAAC,EACjEZ,EACT,CACF,CAEO,IAAMa,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,GAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBX,EAAWe,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FC,EAAK,KAAKjB,EAAQV,CAAQ,EAC1B2B,EAAK,SAASjB,CAAM,CACtB,ENjGAW,GAAarB,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAGhE,IAAM4B,GAAN,cAAsCC,CAAW,CACtD,QAAS,CACL,IAAMC,EAAQH,EAAK,EAAE,CAAE,QAAS,wBAAyB,GAAI,iCAAkC,QAAS,oCAAqC,CAAC,EAE9I,OAAOI,yIAA4IC,EAAa,UAAUF,CAAK,UAAU,CAAC,4IAA8I,CAC9U,EACK,eAAe,IAAI,+BAA+B,GACrD,eAAe,OAAO,gCAAiCF,EAAuB,EOnBvD,IAAMK,GAAS,KAAK,MAAM,6QAAiS,ECA3T,IAAMC,GAAS,KAAK,MAAM,sQAAgS,ECA1T,IAAMC,GAAS,KAAK,MAAM,sRAA6S,ECAvU,IAAMC,GAAS,KAAK,MAAM,0QAAiS,ECA3T,IAAMC,GAAS,KAAK,MAAM,uRAAqS,ECAtT,IAAMC,GAASC,q1DCmBjD,IAAMC,GAAaC,EAAK,EAAE,CACxB,GAAI,8BACJ,QAAS,OACT,QAAS,uFACX,CAAC,EAEKC,GACJ,kMA1BFC,GAAAC,GAmCMC,GAAN,cAA6BC,CAAW,CAetC,aAAc,CACZ,MAAM,EAhBVC,GAAA,KAAAJ,IAQE,uBAAoB,EAGpB,kBAAe,EAMbK,GAAaC,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,CACzE,CAGA,IAAI,+BAAgC,CAClC,OAAO,KAAK,kBAAoB,EAAI,CACtC,CAGA,IAAI,8BAA+B,CACjC,OAAO,KAAK,kBAAoB,EAAI,CACtC,CAGA,IAAI,0BAA2B,CAC7B,OAAO,KAAK,kBAAoB,KAAK,KACvC,CAGA,IAAI,kBAAmB,CACrB,OAAO,KAAK,kBAAoB,CAClC,CAGA,IAAI,oBAAqB,CACvB,GAAI,KAAK,OAAS,KAAK,aAErB,OAAO,MAAM,KAAK,CAAE,OAAQ,KAAK,KAAM,EAAG,CAACC,EAAGJ,IAAMA,EAAI,CAAC,EAG3D,IAAMK,EAAO,KAAK,MAAM,KAAK,aAAe,CAAC,EACzCC,EAAQ,KAAK,IAAI,EAAG,KAAK,kBAAoBD,CAAI,EAC/CE,EAAM,KAAK,IAAI,KAAK,MAAOD,EAAQ,KAAK,aAAe,CAAC,EAG9D,OAAIC,EAAMD,EAAQ,EAAI,KAAK,eACzBA,EAAQ,KAAK,IAAI,EAAGC,EAAM,KAAK,aAAe,CAAC,GAG1C,MAAM,KAAK,CAAE,OAAQA,EAAMD,EAAQ,CAAE,EAAG,CAACF,EAAGJ,IAAMM,EAAQN,CAAC,CACpE,CAcA,QAAS,CACP,IAAMQ,EAAe,KAAK,mBAE1B,OAAOC,8DAAiEC,GAAA,KAAKb,GAAAC,GAAkB;AAAA;AAAA,UAEzFH,EAAK,EAAE,CACP,GAAI,6BACJ,QAAS,QACT,QAAS,mFACX,CAAC,CAAC;AAAA;AAAA;AAAA,UAGA,KAAK,8BACHc;AAAA;AAAA,sBAEU,KAAK,OAAO;AAAA,uBACXb,GACT,+GAA+G;AAAA;AAAA,mBAE1GD,EAAK,EAAE,CACR,GAAI,6BACJ,QAAS,aACT,QAAS,8EACX,CAAC,CAAC;AAAA;AAAA;AAAA,sCAGoBD,EAAU;AAAA,kBAEpCiB,CAAO;AAAA,UACT,KAAK,6BACHF;AAAA,kCACsB,KAAK,kBAAoB,CAAC;AAAA,sBACtC,KAAK,OAAO,GAAG,KAAK,kBAAoB,CAAC;AAAA,uBACxCb,GACT,+GAA+G;AAAA;AAAA,mBAE1GD,EAAK,EAAE,CACR,GAAI,4BACJ,QAAS,gBACT,QAAS,iFACX,CAAC,CAAC;AAAA;AAAA;AAAA,sCAGoBD,EAAU;AAAA,kBAEpCiB,CAAO;AAAA,UACTH,EAAa,IAAKI,GAAe,CACjC,IAAMC,EAAgBD,IAAe,KAAK,kBACpCE,EAAM,GAAG,KAAK,OAAO,GAAGF,CAAU,GAEpCG,EAASnB,GAETiB,EACFE,GAAU,gCAEVA,GAAU,yGAGZ,IAAMC,EAAYrB,EAAK,EAAE,CACvB,GAAI,uBACJ,QAAS,qBACT,OAAQ,CAAE,YAAaiB,CAAW,EAClC,QAAS,wEACX,CAAC,EAED,OAAOH;AAAA,gCACeG,CAAU;AAAA,0BAChBI,CAAS;AAAA,oBACfF,CAAG;AAAA,qBACFC,CAAM;AAAA,4BACCF,EAAgB,OAAS,EAAE;AAAA,eACxCD,CAAU;AAAA,YAEjB,CAAC,CAAC;AAAA,UACA,KAAK,yBACHH;AAAA,kCACsB,KAAK,kBAAoB,CAAC;AAAA,sBACtC,KAAK,OAAO,GAAG,KAAK,kBAAoB,CAAC;AAAA,uBACxCb,GACT,+GAA+G;AAAA;AAAA,kBAE3GD,EAAK,EAAE,CACP,GAAI,4BACJ,QAAS,YACT,QAAS,6EACX,CAAC,CAAC;AAAA;AAAA;AAAA,sCAGoBD,EAAU;AAAA,kBAEpCiB,CAAO;AAAA;AAAA,WAGjB,CACF,EArKAd,GAAA,YA2DEC,GAAkB,SAACmB,EAAiB,CAClC,IAAMC,EAAeD,EAAE,OAAmB,aAAa,kBAAkB,EAEzE,KAAK,cACH,IAAI,YAAY,aAAc,CAC5B,OAAQ,CAAE,YAAAC,CAAY,EACtB,QAAS,GACT,SAAU,EACZ,CAAC,CACH,CACF,EArEInB,GAaG,OAAS,CAACoB,EAAOJ,EAAM,EAX9BK,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,GAAM,UAAW,UAAW,CAAC,GAD5DtB,GAEJ,uBAGAqB,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GAJrCtB,GAKJ,qBAGAqB,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,GAAM,UAAW,cAAe,CAAC,GAPhEtB,GAQJ,iCAGAqB,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,GAAM,UAAW,eAAgB,CAAC,GAVjEtB,GAWJ,4BA4JG,eAAe,IAAI,cAAc,GACpC,eAAe,OAAO,eAAgBA,EAAc,EC3M7B,IAAMuB,GAAS,KAAK,MAAM,iGAAwG,ECAlI,IAAMC,GAAS,KAAK,MAAM,gGAA0G,ECApI,IAAMC,GAAS,KAAK,MAAM,yGAAgH,ECA1I,IAAMC,GAAS,KAAK,MAAM,kGAAyG,ECAnI,IAAMC,GAAS,KAAK,MAAM,sGAA6G,ECA9H,IAAMC,GAASC,q8DCmB1C,IAAMC,GAAa,CACxB,QAAS,oBACT,OAAQ,4DACR,WACE,2KACF,OAAQ,mFACR,MAAO,4BACP,kBAAmB,uBACnB,eAAgB,OAChB,MAAO,iCACP,UAAW,OACX,KAAM,SACR,EAOMC,GAAN,cAAuBC,CAAW,CAqBhC,aAAc,CACZ,MAAM,EACNC,GAAaC,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EACvE,KAAK,SAAW,GAChB,KAAK,WAAa,GAElB,KAAK,iBAAmBC,EAAK,EAAE,CAC7B,GAAI,uBACJ,QAAS,cACT,QAAS,gDACX,CAAC,EAED,KAAK,mBAAqBA,EAAK,EAAE,CAC/B,GAAI,yBACJ,QAAS,wBACT,QAAS,0DACX,CAAC,CACH,CAGA,IAAI,eAAgB,CAClB,OAAOC,EAAW,CAChBN,GAAW,OACXA,GAAW,MACX,KAAK,WAAaA,GAAW,WAAaA,GAAW,OACrD,KAAK,SAAWA,GAAW,eAAiBA,GAAW,iBACzD,CAAC,CACH,CAGA,IAAI,eAAgB,CAClB,OAAOM,EAAW,CAACN,GAAW,OAAQA,GAAW,MAAO,KAAK,WAAaA,GAAW,WAAaA,GAAW,MAAM,CAAC,CACtH,CAGA,UAAW,CACT,KAAK,cAAc,IAAI,YAAY,eAAgB,CAAE,QAAS,GAAM,SAAU,EAAK,CAAC,CAAC,CACvF,CAGA,UAAW,CACT,KAAK,cAAc,IAAI,YAAY,eAAgB,CAAE,QAAS,GAAM,SAAU,EAAK,CAAC,CAAC,CACvF,CAEA,mBAAoB,CAClB,MAAM,kBAAkB,EACpB,KAAK,cACP,KAAK,cAAgB,KAAK,aAExB,KAAK,eACP,KAAK,eAAiB,KAAK,aAE/B,CAEA,QAAS,CACP,OAAOO;AAAA,oBACSP,GAAW,OAAO;AAAA,uCACC,KAAK,aAAa,aAAa,KAAK,QAAQ;AAAA,yBAC1DA,GAAW,IAAI,KAAK,KAAK,cAAgB,KAAK,cAAgB,KAAK,gBAAgB;AAAA;AAAA;AAAA,UAGlG,KAAK,SACHO,kCAAqC,KAAK,aAAa,aAAa,KAAK,QAAQ;AAAA,6BAChEP,GAAW,IAAI,KAAK,KAAK,eAAiB,KAAK,eAAiB,KAAK,kBAAkB;AAAA,wCAC5EA,GAAW,SAAS;AAAA,uBAEhD,IAAI;AAAA;AAAA,KAGd,CACF,EA3FMC,GAmBG,OAAS,CAACO,EAAOC,EAAM,EAlBuBC,EAAA,CAApDC,EAAS,CAAE,UAAW,YAAa,KAAM,OAAQ,CAAC,GAD/CV,GACiD,wBACCS,EAAA,CAArDC,EAAS,CAAE,UAAW,aAAc,KAAM,OAAQ,CAAC,GAFhDV,GAEkD,0BAIES,EAAA,CAAvDC,EAAS,CAAE,UAAW,gBAAiB,KAAM,MAAO,CAAC,GANlDV,GAMoD,2BACES,EAAA,CAAzDC,EAAS,CAAE,UAAW,kBAAmB,KAAM,MAAO,CAAC,GAPpDV,GAOsD,6BAIDS,EAAA,CAAxDC,EAAS,CAAE,UAAW,iBAAkB,KAAM,MAAO,CAAC,GAXnDV,GAWqD,4BACES,EAAA,CAA1DC,EAAS,CAAE,UAAW,mBAAoB,KAAM,MAAO,CAAC,GAZrDV,GAYuD,8BAiFxD,eAAe,IAAI,QAAQ,GAC9B,eAAe,OAAO,SAAUA,EAAQ,EC9G1C,GAAA,CAAOW,EAAYC,EAAAA,EAAaC,GAAhC,IAiFaC,GAAsBC,GAChCA,EAA2BC,UADKD,OAG7BE,GAAe,IAAMC,SAASC,cAAc,EAAA,EAcrCC,GAAa,CACxBC,EACAC,EACAP,IAAAA,OAEA,IAAMQ,EAAiBF,EAAcG,KAAaC,WAE5CC,EACJJ,IADII,OACoBL,EAAcM,KAAYL,EAAQE,KAE5D,GAAIT,IAAJ,OAAwB,CACtB,IAAMa,EAAiBL,EAAWM,aAAaZ,GAAAA,EAAgBS,CAAAA,EACzDI,EAAeP,EAAWM,aAAaZ,GAAAA,EAAgBS,CAAAA,EAC7DX,EAAO,IAAIgB,GACTH,EACAE,EACAT,EACAA,EAAcW,OAAAA,CAEjB,KAAM,CACL,IAAMF,EAAef,EAAKY,KAAYM,YAChCC,EAAYnB,EAAKoB,KACjBC,EAAgBF,IAAcb,EACpC,GAAIe,EAAe,CAUjB,IAAIC,GATJtB,EAAAA,EAAKuB,OAALvB,MAAAA,EAAAA,KAAAA,EAAiCM,GAKjCN,EAAKoB,KAAWd,EAMdN,EAAKwB,OANSlB,SAObgB,EAAqBhB,EAAcmB,QAClCN,EAAWM,MAEbzB,EAAKwB,KAA0BF,CAAAA,CAElC,CACD,GAAIP,IAAYJ,GAAWU,EAAe,CACxC,IAAIK,EAAqB1B,EAAKS,KAC9B,KAAOiB,IAAUX,GAAS,CACxB,IAAMY,EAAsBD,EAAQR,YAC/BV,EAAWM,aAAaY,EAAQf,CAAAA,EACrCe,EAAQC,CACT,CACF,CACF,CAED,OAAO3B,CAAI,EAmBA4B,GAAoB,CAC/B5B,EACA6B,EACAC,EAAmC9B,KAEnCA,EAAK+B,KAAWF,EAAOC,CAAAA,EAChB9B,GAKHgC,GAAc,CAAA,EAaPC,GAAoB,CAACjC,EAAY6B,EAAiBG,KAC5DhC,EAAKkC,KAAmBL,EAgBdM,GAAqBnC,GAAoBA,EAAKkC,KAY9CE,GAAcpC,GAAAA,CACzBA,EAAKqC,KAAAA,EACLrC,EAAKS,KAAY6B,OAAAA,CAAQ,MC3JdC,GAAOC,GA3EpB,cAA4BC,EAAAA,CAC1B,YAAYC,EAAAA,CAEV,GADAC,MAAMD,CAAAA,EAGFA,EAASE,OAASC,GAASC,UAC3BJ,EAASE,OAASC,GAASE,WAC3BL,EAASE,OAASC,GAASG,kBAG7B,MAAUC,MACR,gEAAA,EAGJ,GAAA,CAAKC,GAAmBR,CAAAA,EACtB,MAAUO,MAAM,sDAAA,CAEnB,CAED,OAAOE,EAAAA,CACL,OAAOA,CACR,CAEQ,OAAOC,EAAAA,CAAsBD,CAAAA,EAAAA,CACpC,GAAIA,IAAUE,IAAYF,IAAUG,EAClC,OAAOH,EAET,IAAMI,EAAUH,EAAKG,QACfC,EAAOJ,EAAKI,KAElB,GAAIJ,EAAKR,OAASC,GAASC,UAEzB,GAAIK,IAAWI,EAAgBC,CAAAA,EAC7B,OAAOH,WAEAD,EAAKR,OAASC,GAASG,mBAChC,GAAA,CAAA,CAAMG,IAAUI,EAAQE,aAAaD,CAAAA,EACnC,OAAOH,WAEAD,EAAKR,OAASC,GAASE,WAC5BQ,EAAQG,aAAaF,CAAAA,IAAiBL,EAAPQ,GACjC,OAAON,GAMX,OADAO,GAAkBR,CAAAA,EACXD,CACR,CAAA,CAAA,EChEH,IAAAU,GAAA,GCAA,IAAAC,GAsBqBC,GAArB,cAAyCC,CAAW,CAyBlD,aAAc,CACZ,MAAM,EATRC,GAAA,KAAAH,GAAgC,IAChC,gCAAmD,IAAI,IA4DvD,KAAO,aAAe,CAEpB,IAAK,CAACI,EAAqBC,IAAoB,CAtGnD,IAAAC,GAuGWA,EAAA,KAAK,YAAL,MAAAA,EAAgB,SACjBD,EACF,KAAK,UAAU,OAAO,IAAID,CAAW,EAErC,KAAK,UAAU,OAAO,OAAOA,CAAW,EAE5C,EAGA,IAAMA,GAAwB,CAhHlC,IAAAE,EAiHM,OAAKA,EAAA,KAAK,YAAL,MAAAA,EAAgB,OACd,KAAK,UAAU,OAAO,IAAIF,CAAW,EADR,EAEtC,CACF,EAlEE,GAAI,CACF,KAAK,UAAY,KAAK,gBAAgB,CACxC,OAAQG,EAAA,CAGN,QAAQ,MAAM,gFAAgF,CAChG,CAEA,KAAK,aAAa,IAAI,aAAc,EAAI,EAExC,IAAMC,EAAO,KAAK,YAClB,OAAW,CAACC,EAAUC,CAAI,IAAKF,EAAK,kBAC9BE,EAAK,UAAY,WAAaA,EAAK,UAAY,QAAa,OAAOD,GAAa,UAClF,KAAK,aAAa,IAAI,WAAWA,CAAQ,IAAIC,EAAK,OAAO,GAAI,EAAI,CAGvE,CAhCA,WAAW,QAAyB,CAClC,IAAMC,EAAS,MAAM,QAAQ,KAAK,GAAG,EAAI,KAAK,IAAM,KAAK,IAAM,CAAC,KAAK,GAAG,EAAI,CAAC,EAC7E,MAAO,CAACC,GAAY,GAAGD,CAAM,EAAE,IAAKE,GAAW,OAAOA,GAAU,SAAWC,GAAUD,CAAK,EAAIA,CAAM,CACtG,CA+BA,yBAAyBE,EAAcC,EAAyBC,EAAyB,CAClFC,GAAA,KAAKlB,MACP,KAAK,YAAmC,kBAAkB,QAAQ,CAACmB,EAAKC,IAAqC,CAEtGD,EAAI,SAAW,KAAKC,CAAI,GAAK,MACjC,KAAK,2BAA2B,IAAIA,EAAM,KAAKA,CAAI,CAAC,CAExD,CAAC,EAEDC,GAAA,KAAKrB,GAAgC,KAGvC,MAAM,yBAAyBe,EAAMC,EAAUC,CAAQ,CACzD,CAEU,WAAWK,EAAkE,CACrF,MAAM,WAAWA,CAAiB,EAGlC,KAAK,2BAA2B,QAAQ,CAACC,EAAOH,IAAqC,CAG/EE,EAAkB,IAAIF,CAAI,GAAK,KAAKA,CAAI,GAAK,OAE9C,KAAiCA,CAAI,EAAIG,EAE9C,CAAC,CACH,CA2BA,iBAAiBC,EAAcC,EAA0B,CACvDD,EAAM,yBAAyB,EAE/B,KAAK,cACH,IAAKA,EAAM,YAA6BA,EAAM,KAAM,CAClD,GAAGA,EACH,GAAGC,CACL,CAAC,CACH,CACF,CACF,EA7FEzB,GAAA,YAKY0B,EAAA,CAAXC,EAAS,GAtBS1B,GAsBP,mBACAyB,EAAA,CAAXC,EAAS,GAvBS1B,GAuBP,oBCvCP,IAAM2B,GAAuB,KAC3B,CACL,mBAAoB,CAAC,cAAc,EACnC,cAAcC,EAAS,CACrB,IAAMC,EAAmD,CACvD,QAAS,GACT,QAAS,GACT,YAAa,CAAC,CAChB,EAEA,OAAID,EAAQ,cACVC,EAAS,QAAUD,EAAQ,YAC3BC,EAAS,QAAU,GACnBA,EAAS,YAAc,CAAC,aAAa,GAGhCA,CACT,CACF,GCxBK,IAAMC,GAAN,cAA4B,KAAM,CACvC,aAAc,CACZ,MAAM,YAAa,CAAE,QAAS,GAAM,WAAY,GAAO,SAAU,EAAK,CAAC,CACzE,CACF,ECuDO,IAAMC,GAAN,cAAwCC,EAAwF,CAqDrI,aAAc,CACZ,MAAM,EAxBqB,UAAsB,KAGtB,cAAW,GAExC,cAAoB,GAEpB,yBAAgC,CAAC,OAAO,EAKxC,gBAA0B,CAAC,EAGkB,qBAA2B,GAC3B,mBAAyB,GAGd,iBAA6B,KAErF,KAAQ,cAA0B,CAAC,EA8BnC,iBAAeC,GAAa,CACtBA,EAAE,SAAW,OAGjB,KAAK,cAAgB,GACrB,KAAK,cAAc,IAAIC,EAAe,EACxC,EAyCA,KAAQ,kBAAqBC,GAAiB,CA3LhD,IAAAC,EA4LI,IAAMC,EAAgB,KAAK,cACtBA,EAAc,SAASF,EAAM,IAAI,GACpCE,EAAc,KAAKF,EAAM,IAAI,EAI3BE,EAAc,WAAWD,EAAA,KAAK,sBAAL,YAAAA,EAA0B,UACrD,KAAK,cAAgB,GAEzB,EAjFI,KAAK,iBAAiB,UAAW,KAAK,WAAW,CAErD,CApDA,WAAW,YAA0B,CACnC,MAAO,CAACE,GAAqB,CAAC,CAChC,CAGA,WAAW,oBAAqB,CAC9B,IAAMC,EAAc,IAAI,IAAI,MAAM,oBAAsB,CAAC,CAAC,EAE1D,QAAWC,KAAa,KAAK,WAC3B,GAAKA,EAAU,mBAIf,QAAWC,KAAQD,EAAU,mBAC3BD,EAAY,IAAIE,CAAI,EAIxB,MAAO,CAAC,GAAGF,CAAW,CACxB,CAwCA,mBAAoB,CAClB,MAAM,kBAAkB,EACxB,KAAK,eAAe,EAGpB,KAAK,oBAAoB,QAASJ,GAAU,CAC1C,KAAK,iBAAiBA,EAAO,KAAK,iBAAiB,CACrD,CAAC,CACH,CAEA,gBAAgBO,EAA8C,CAC5D,MAAM,aAAa,GAAGA,CAAI,EAC1B,KAAK,eAAe,CACtB,CAUU,WAAWC,EAA4D,CAS/E,GARI,CAAC,IAAYA,EAAkB,IAAI,aAAa,IAE7C,KAAK,cACR,KAAK,YAAc,MAErB,KAAK,kBAAkB,KAAK,aAAe,EAAE,GAG3CA,EAAkB,IAAI,OAAO,GAAKA,EAAkB,IAAI,UAAU,EAAG,CAEvE,IAAMC,EAAQ,KAAK,MAGnB,GAAI,MAAM,QAAQA,CAAK,GACrB,GAAI,KAAK,KAAM,CACb,IAAMC,EAAW,IAAI,SACrB,QAAWC,KAAOF,EAChBC,EAAS,OAAO,KAAK,KAAMC,CAAa,EAE1C,KAAK,SAASD,EAAUA,CAAQ,CAClC,OAEA,KAAK,SAASD,EAA0CA,CAAwC,CAEpG,CAEID,EAAkB,IAAI,UAAU,IAClC,KAAK,aAAa,IAAI,WAAY,KAAK,QAAQ,GAE3C,KAAK,aAAa,UAAU,GAAM,CAAC,IAAY,CAAC,KAAK,QAAQ,WAAW,IAC1E,KAAK,gBAAgB,WAAY,KAAK,QAAQ,GAIlD,KAAK,eAAe,EACpB,MAAM,WAAWA,CAAiB,CACpC,CAcA,IAAI,QAAS,CACX,OAAO,KAAK,UAAU,MACxB,CAEA,SAAU,CACR,OAAO,KAAK,UAAU,IACxB,CAGA,IAAI,UAAW,CACb,OAAO,KAAK,UAAU,QACxB,CAGA,IAAI,cAAe,CACjB,OAAO,KAAK,UAAU,YACxB,CAEA,IAAI,mBAAoB,CACtB,OAAO,KAAK,UAAU,iBACxB,CAEA,eAAgB,CACd,YAAK,eAAe,EACb,KAAK,UAAU,cAAc,CACtC,CAEA,gBAAiB,CACf,YAAK,eAAe,EAEpB,KAAK,cAAgB,GACd,KAAK,UAAU,eAAe,CACvC,CAKA,IAAI,kBAA4C,CAC9C,OAAQ,KAAK,OAAS,MACxB,CAEA,eAAeD,EAAqD,CAClE,IAAMK,EAAQL,EAAK,CAAC,EACdM,EAAUN,EAAK,CAAC,EAClBO,EAASP,EAAK,CAAC,EAEdO,IACHA,EAAS,KAAK,kBAGhB,KAAK,UAAU,YAAYF,EAAOC,EAASC,GAAU,MAAS,EAC9D,KAAK,cAAc,UAAU,EAC7B,KAAK,gBAAgB,CACvB,CAEA,iBAAkB,CAChB,IAAMC,EAAW,EAAQ,KAAK,SACxBC,EAAU,KAAK,UAAU,SAAS,MAClCC,EAAgB,KAAK,cAE3B,KAAK,aAAa,IAAI,WAAYF,CAAQ,EAC1C,KAAK,aAAa,IAAI,WAAY,CAACA,CAAQ,EAC3C,KAAK,aAAa,IAAI,UAAW,CAACC,CAAO,EACzC,KAAK,aAAa,IAAI,QAASA,CAAO,EACtC,KAAK,aAAa,IAAI,eAAgB,CAACA,GAAWC,CAAa,EAC/D,KAAK,aAAa,IAAI,aAAcD,GAAWC,CAAa,CAC9D,CAOA,kBAAkBJ,EAAiB,CACjC,GAAI,CAACA,EAAS,CAEZ,KAAK,YAAc,KACnB,KAAK,YAAY,CAAC,CAAC,EACnB,MACF,CAEA,KAAK,YAAcA,EACnB,KAAK,YAAY,CAAE,YAAa,EAAK,EAAGA,EAAS,KAAK,gBAAgB,CACxE,CAEA,mBAAoB,CAClB,KAAK,cAAc,EACnB,KAAK,cAAgB,GACrB,KAAK,gBAAkB,GACvB,KAAK,cAAgB,CAAC,EACtB,KAAK,eAAe,CACtB,CAEA,qBAAqBK,EAAqB,CACxC,KAAK,SAAWA,EAEhB,KAAK,eAAe,CACtB,CAOA,yBAAyBC,EAAwCC,EAAoC,CAEnG,KAAK,MAAQD,EAETC,IAAW,WACb,KAAK,cAAc,EAGrB,KAAK,eAAe,CACtB,CAEA,YAAYb,EAAsD,CAChE,GAAM,CAACE,EAAOU,CAAK,EAAIZ,EAEvB,KAAK,UAAU,aAAaE,EAAOU,CAAK,CAC1C,CAEA,IAAI,eAAgB,CAClB,IAAME,EAAoB,KAAK,YAAiD,YAAc,CAAC,EAEzFC,EAAa,KAAK,YAAc,CAAC,EACvC,MAAO,CAAC,GAAGD,EAAkB,GAAGC,CAAU,CAC5C,CAKA,eAAgB,CACd,KAAK,kBAAkB,EAAE,EACzB,KAAK,YAAY,CAAC,CAAC,CACrB,CAEA,gBAAiB,CACf,GACE,KAAK,UACL,KAAK,aAAa,UAAU,GAC5B,CAAC,KAAK,aACN,CACA,KAAK,cAAc,EAEnB,MACF,CAEA,IAAMA,EAAa,KAAK,cAExB,GAAI,EAACA,GAAA,MAAAA,EAAY,QAEf,OAKF,IAAMV,EAA8B,CAElC,YAAa,EAAQ,KAAK,WAC5B,EAEMW,EAAc,KAAK,kBAAoB,KAAK,OAAS,OAEvDC,EAAe,GAEnB,QAAWnB,KAAaiB,EAAY,CAClC,GAAM,CAAE,QAAAN,EAAS,QAAAH,EAAS,YAAAY,CAAY,EAAIpB,EAAU,cAAc,IAAI,EAElEW,IAICQ,IACHA,EAAeX,IAGbY,GAAA,YAAAA,EAAa,SAAU,GACxBA,EAAwC,QAASC,GAASd,EAAMc,CAAG,EAAI,EAAK,EAEjF,CAGKF,IACHA,EAAe,KAAK,mBAGtB,KAAK,YAAYZ,EAAOY,EAAcD,CAAW,CACnD,CACF,EAxUa3B,GACJ,eAAiB,GA6BK+B,EAAA,CAA5BC,EAAS,CAAE,QAAS,EAAK,CAAC,GA9BhBhC,GA8BkB,oBAGA+B,EAAA,CAA5BC,EAAS,CAAE,KAAM,OAAQ,CAAC,GAjChBhC,GAiCkB,wBAYgB+B,EAAA,CAA5CC,EAAS,CAAE,MAAO,GAAM,UAAW,EAAM,CAAC,GA7ChChC,GA6CkC,+BACA+B,EAAA,CAA5CC,EAAS,CAAE,MAAO,GAAM,UAAW,EAAM,CAAC,GA9ChChC,GA8CkC,6BAGW+B,EAAA,CAAvDC,EAAS,CAAE,UAAW,eAAgB,QAAS,EAAK,CAAC,GAjD3ChC,GAiD6C,2BAoGpD+B,EAAA,CADHC,EAAS,CAAE,UAAW,GAAO,MAAO,GAAM,KAAM,MAAO,CAAC,GApJ9ChC,GAqJP,wBCnMC,IAAMiC,GAAoB,CAACC,EAAoC,CAAC,IAAiB,CACtF,GAAI,CAAE,kBAAAC,EAAmB,mBAAAC,CAAmB,EAAIF,EAE3CC,IACHA,EAAoB,OAAO,OAAO,SAAS,cAAc,OAAO,EAAG,CAAE,SAAU,EAAK,CAAC,GAGlFC,IACHA,EAAqB,SAGvB,IAAMC,EAAiB,CACrB,mBAAoB,CAAC,UAAU,EAC/B,QAASF,EAAkB,kBAC3B,cAAcG,EAAS,CA3B3B,IAAAC,EA4BM,IAAMC,EAAmD,CACvD,QAAS,GACT,QAAS,GACT,YAAa,CAAC,CAChB,EAKA,QAHmBD,EAAAD,EAAQ,WAAR,KAAAC,EAAoBD,EAAQ,aAAa,UAAU,IAStD,CAFFA,EAAQF,CAA0C,IAK9DI,EAAS,QAAU,OAAOH,EAAI,SAAY,WAAaA,EAAI,QAAQC,CAAO,EAAID,EAAI,SAAW,GAC7FG,EAAS,QAAU,GACnBA,EAAS,YAAY,KAAK,cAAc,GAGnCA,CACT,CACF,EAEA,OAAOH,CACT,ECrDO,IAAMI,GAAN,KAAsD,CAI3D,YAAYC,KAA2CC,EAAqB,CAF5E,eAAsB,CAAC,EAgDvB,KAAQ,iBAAoBC,GAAiB,CAC3C,IAAMC,EAAOD,EAAM,QAEd,KAAK,UAAU,SAAS,WAAW,GAAK,CAACC,EAAK,MAAUA,EAAK,MAAQ,KAAK,UAAU,SAASA,EAAK,IAAI,IACzG,KAAK,KAAK,cAAc,CAE5B,GAnDG,KAAK,KAAOH,GAAM,cAAc,IAAI,EACrC,KAAK,UAAYC,CACnB,CAEQ,gBAAiB,CACvB,MAAO,CAAC,GAAG,KAAK,KAAK,UAAU,EAAE,KAAMG,GAAS,CAC9C,GAAIA,EAAK,WAAa,KAAK,WAAaA,EAAK,YAAa,KAAK,IAAM,GACnE,MAAO,GAGT,GAAIA,EAAK,WAAa,KAAK,aAAc,CACvC,IAAMC,EAAKD,EAIX,GAHgBC,EAAG,QAAQ,YAAY,IAGvB,oBACd,MAAO,GAIT,GAAI,CAACA,EAAG,aAAa,MAAM,EACzB,MAAO,EAEX,CAEA,MAAO,EACT,CAAC,CACH,CAEQ,aAAaC,EAAc,CACjC,OAAO,KAAK,KAAK,cAAc,mBAAmBA,CAAI,IAAI,IAAM,IAClE,CAEA,KAAKC,EAAkB,CACrB,OAAOA,IAAa,YAAc,KAAK,eAAe,EAAI,KAAK,aAAaA,CAAQ,CACtF,CAEA,eAAgB,CACd,KAAK,KAAK,WAAY,iBAAiB,aAAc,KAAK,gBAAgB,CAC5E,CAEA,kBAAmB,CACjB,KAAK,KAAK,WAAY,oBAAoB,aAAc,KAAK,gBAAgB,CAC/E,CASF,EC/BO,SAASC,GAAMC,EAAiCC,EAAwB,CAC7E,IAAMC,EAA0C,CAC9C,qBAAsB,GACtB,GAAGD,CACL,EACA,MAAO,CAA+BE,EAAkBC,IAA0D,CAEhH,GAAM,CAAE,OAAAC,CAAO,EAAIF,EACbG,EAAoB,MAAM,QAAQN,CAAY,EAAIA,EAAe,CAACA,CAAY,EAGpFG,EAAM,OAAS,SAA2BI,EAAgE,CACxGD,EAAkB,QAASE,GAAa,CACtC,IAAMC,EAAMD,EACZ,GAAID,EAAa,IAAIE,CAAG,EAAG,CACzB,IAAMC,EAAWH,EAAa,IAAIE,CAAG,EAC/BE,EAAW,KAAKF,CAAG,EAErBC,IAAaC,IACX,CAACT,EAAgB,sBAAwB,KAAK,aAC/C,KAAKE,CAAe,EAA+BM,EAAUC,CAAQ,CAG5E,CACF,CAAC,EAEDN,EAAO,KAAK,KAAME,CAAY,CAChC,CACF,CACF,CE1DyB,IAAMK,GAAS,KAAK,MAAM,qCAAyC,ECA7DA,GAAS,KAAK,MAAM,oCAAwC,ECA5DA,GAAS,KAAK,MAAM,wCAA4C,ECAhEA,GAAS,KAAK,MAAM,kCAAsC,ECA1DA,GAAS,KAAK,MAAM,+BAAmC,ECEzEC,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,GAAgB,KAEvBC,GAAgB,IAAM,CAP5B,IAAAC,EAQC,IAAIC,EACH,QAAQD,EAAA,SAAA,KAAA,OAAA,QAAS,MAAT,KAAA,OAAAA,EAAc,UAAW,CACjC,IAAK,OACJC,EAAQ,KACR,MACD,IAAK,OACJA,EAAQ,KACR,MACD,IAAK,UACJA,EAAQ,KACR,MACD,IAAK,MACJA,EAAQ,KACR,MACD,QACCA,EAAQ,IACV,CACA,OAAOA,CACR,EAEMC,GAAe,IAAM,CA5B3B,IAAAF,EA6BE,IAAMG,GAAWH,EAAA,UAAA,KAAA,OAAA,SAAU,WAAV,KAAA,OAAAA,EAAoB,SACrC,OAAIG,GAAA,MAAAA,EAAU,SAAS,MAAA,EACd,KACEA,EAAS,SAAS,MAAM,EAC1B,KACEA,EAAS,SAAS,SAAS,EAC7B,KACEA,EAAS,SAAS,KAAK,EACzB,KAEAL,EAEX,EAEaM,GAAsBC,GAE/BR,GAAiB,KACdS,GACCD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CACrE,GAAKJ,GAAa,EAIf,SAASK,IAAgC,CApDhD,IAAAP,EAqDE,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMQ,EAAeT,GAAc,EACnC,OAAOK,GAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,GAAaT,EAAA,UAAA,KAAA,OAAA,SAAU,kBAAV,KAAA,OAAAA,EAA2B,KACxCU,EAAaR,GAAa,EAEhC,OAAKL,GAAiB,SAASY,CAA6B,EAIrDL,GAAmBK,GAAA,KAAAA,EAAcC,CAAU,GAHhD,QAAQ,KAAK,gFAAgF,EACtFN,GAAmBM,CAAU,EAGxC,OAAS,EAAG,CACV,eAAQ,KAAK,yDAA0D,CAAC,EACjEZ,EACT,CACF,CAEO,IAAMa,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,GAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBX,EAAWe,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FC,EAAK,KAAKjB,EAAQV,CAAQ,EAC1B2B,EAAK,SAASjB,CAAM,CACtB,ENjGAW,GAAarB,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAGhE,IAAM4B,GAAN,cAA0BC,CAAW,CAC1C,QAAS,CACL,IAAMC,EAAQH,EAAK,EAAE,CAAE,QAAS,YAAa,GAAI,mBAAoB,QAAS,sBAAuB,CAAC,EAEtG,OAAOI,2HAA8HC,EAAa,UAAUF,CAAK,UAAU,CAAC,8IAAgJ,CAClU,EACK,eAAe,IAAI,iBAAiB,GACvC,eAAe,OAAO,kBAAmBF,EAAW,EOnBtD,IAAAK,GAAA,GCAA,IAAAC,GAkBaC,GAAN,cAAwBC,EAA0B,CAAlD,kCAmBL,KAAiB,kBAAoB,IAAIC,GAAkB,KAAM,MAAM,EAI3D,WAAQ,GAGS,UAAO,GAEpC,KAAQ,QAAwBH,GAAA,KAAK,aAAa,OAAO,IAAzB,KAAAA,GAA8B,KAajC,UAAqC,SAGrC,cAAW,GAMI,mBAAgB,GAGb,aAAmB,KAAK,aAAa,SAAS,EAG3B,oBAA0B,KAAK,aAAa,SAAS,EAO1F,UAAO,KAGQ,cAAW,GAG3C,UAAO,GAhEnB,WAAW,YAAa,CACtB,IAAMI,EAAa,CACjBC,GAAkB,CAChB,mBAAoB,UAEpB,kBAAmB,OAAO,OAAO,SAAS,cAAc,OAAO,EAAG,CAChE,KAAM,WACN,SAAU,EACZ,CAAC,CACH,CAAC,CACH,EACA,MAAO,CAAC,GAAG,MAAM,WAAY,GAAGD,CAAU,CAC5C,CAcA,IAAI,OAAuB,CAjD7B,IAAAJ,EAkDI,OAAOA,EAAA,KAAK,SAAL,KAAAA,EAAe,IACxB,CAGA,IAAI,MAAMM,EAAoB,CAC5B,KAAK,OAASA,CAChB,CAiCQ,aAAc,CACpB,KAAK,cAAgB,GACrB,KAAK,QAAU,CAAC,KAAK,QACrB,KAAK,cAAgB,GACrB,KAAK,eAAe,KAAK,IAAM,CAC7B,KAAK,cAAc,IAAI,MAAM,SAAU,CAAE,QAAS,GAAM,SAAU,EAAK,CAAC,CAAC,CAC3E,CAAC,CACH,CAGA,4BAA6B,CACvB,CAAC,KAAK,eAAiB,KAAK,UAAY,KAAK,iBAC/C,KAAK,QAAU,KAAK,eACpB,KAAK,2BAA2B,EAEpC,CAEA,4BAA6B,CAE3B,KAAK,SAAS,KAAK,QAAU,KAAK,MAAQ,KAAM,KAAK,MAAM,EAC3D,KAAK,eAAe,CACtB,CAGA,mBAAoB,CACd,KAAK,aACP,KAAK,MAAM,QAAU,KAAK,QAC1B,KAAK,MAAM,cAAgB,KAAK,eAGlC,KAAK,aAAa,IAAI,UAAW,KAAK,OAAO,EAC7C,KAAK,aAAa,IAAI,gBAAiB,KAAK,aAAa,EACzD,KAAK,eAAe,CACtB,CAGA,sBAAuB,CACrB,KAAK,aAAa,IAAI,WAAY,KAAK,QAAQ,CACjD,CAEU,WAAWC,EAA+C,CAClE,MAAM,WAAWA,CAAiB,EAE9BA,EAAkB,IAAI,gBAAgB,IACnC,KAAK,gBACR,KAAK,QAAU,KAAK,kBAIpBA,EAAkB,IAAI,OAAO,GAAKA,EAAkB,IAAI,SAAS,IACnE,KAAK,2BAA2B,CAEpC,CAEA,mBAAoB,CAElB,KAAK,QAAU,KAAK,eACpB,MAAM,kBAAkB,EACxB,KAAK,2BAA2B,CAClC,CAGA,OAAQ,CACN,KAAK,MAAM,MAAM,CACnB,CAGA,MAAMC,EAAwB,CAC5B,KAAK,MAAM,MAAMA,CAAO,CAC1B,CAGA,MAAO,CACL,KAAK,MAAM,KAAK,CAClB,CAEA,QAAS,CACP,IAAMC,EAAc,KAAK,kBAAkB,KAAK,MAAM,EAChDC,EAAU,KAAK,KAAO,GAAO,CAAC,CAACD,EAC/BE,EAAkB,CAAC,KAAK,SAAW,KAAK,cAE9C,OAAOC;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,oBAMS,KAAK,KAAuF;AAAA,mBAC7F,KAAK,IAAI;AAAA,oBACRC,EAAU,KAAK,MAAM,CAAC;AAAA,6BACbC,GAAK,KAAK,aAAa,CAAC;AAAA,uBAC9BA,GAAK,KAAK,OAAO,CAAC;AAAA,wBACjB,KAAK,QAAQ;AAAA,wBACb,KAAK,QAAQ;AAAA,2BACV,KAAK,QAAU,OAAS,OAAO;AAAA;AAAA,qBAErC,KAAK,WAAW;AAAA,YACzBH,EAAkB,SAAM,EAAE;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,4DAMsBD,EAAU,QAAU,MAAM,WAAWK,GAAS,CAAE,cAAeL,CAAQ,CAAC,CAAC;AAAA,UAC3H,KAAK,IAAI;AAAA;AAAA,KAGjB,CACF,EAnLaT,GACJ,IAAM,CAACe,EAAM,EADTf,GAGJ,kBAAoB,CAAE,GAAGC,GAA0B,kBAAmB,eAAgB,EAAK,EAkBjEe,EAAA,CAAhCF,GAAM,wBAAwB,GArBpBd,GAqBsB,qBAErBgB,EAAA,CAAXC,EAAS,GAvBCjB,GAuBC,qBAGiBgB,EAAA,CAA5BC,EAAS,CAAE,QAAS,EAAK,CAAC,GA1BhBjB,GA0BkB,oBAUzBgB,EAAA,CADHC,EAAS,CAAE,QAAS,EAAK,CAAC,GAnChBjB,GAoCP,qBAKyBgB,EAAA,CAA5BC,EAAS,CAAE,QAAS,EAAK,CAAC,GAzChBjB,GAyCkB,oBAGAgB,EAAA,CAA5BC,EAAS,CAAE,KAAM,OAAQ,CAAC,GA5ChBjB,GA4CkB,wBAMegB,EAAA,CAA3CC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAlD/BjB,GAkDiC,6BAGGgB,EAAA,CAA9CC,EAAS,CAAE,KAAM,QAAS,UAAW,EAAM,CAAC,GArDlCjB,GAqDoC,uBAGmBgB,EAAA,CAAjEC,EAAS,CAAE,KAAM,QAAS,QAAS,GAAM,UAAW,SAAU,CAAC,GAxDrDjB,GAwDuD,8BAOrCgB,EAAA,CAA5BC,EAAS,CAAE,QAAS,EAAK,CAAC,GA/DhBjB,GA+DkB,oBAGegB,EAAA,CAA3CC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAlE/BjB,GAkEiC,wBAGhCgB,EAAA,CAAXC,EAAS,GArECjB,GAqEC,oBAYZgB,EAAA,CADCE,GAAM,gBAAgB,GAhFZlB,GAiFX,0CAcAgB,EAAA,CADCE,GAAM,CAAC,UAAW,eAAe,CAAC,GA9FxBlB,GA+FX,iCAYAgB,EAAA,CADCE,GAAM,UAAU,GA1GNlB,GA2GX,oCC3HG,eAAe,IAAI,YAAY,GAClC,eAAe,OAAO,aAAcmB,EAAS,ECH/C,IAAAC,GAAA,GCUO,IAAMC,GAAN,cAAqBC,EAA0B,CA4BpD,aAAc,CACZ,MAAM,EA1BC,aAAU,GAGV,mBAAgB,GAKI,UAAsB,KAMtB,gBAAiD,UAMjD,UAAqC,SAGrC,cAAW,GAqDxC,KAAQ,YAAc,IAAM,CACtB,CAAC,KAAK,UAAY,CAAC,KAAK,gBAC1B,KAAK,QAAU,GAEnB,EArDE,KAAK,iBAAiB,QAAS,KAAK,WAAW,CACjD,CAEA,mBAAoB,CAClB,MAAM,kBAAkB,EACxB,KAAK,qBAAqB,CAC5B,CAEQ,sBAAuB,CAC7B,KAAK,aAAa,OAAQ,OAAO,EACjC,KAAK,SAAW,EAChB,KAAK,aAAa,gBAAiB,KAAK,UAAY,KAAK,cAAgB,OAAS,OAAO,CAC3F,CAEA,QAAQC,EAAyC,CAY/C,GAXA,MAAM,QAAQA,CAAiB,EAE3BA,EAAkB,IAAI,SAAS,IACjC,KAAK,aAAa,IAAI,UAAW,KAAK,OAAO,EAC7C,KAAK,aAAa,eAAgB,KAAK,QAAU,OAAS,OAAO,EAE7D,CAAC,KAAK,UAAY,CAAC,KAAK,gBAC1B,KAAK,SAAW,KAAK,QAAU,EAAI,KAInCA,EAAkB,IAAI,UAAU,GAAKA,EAAkB,IAAI,eAAe,EAAG,CAC/E,IAAMC,EAAsB,KAAK,UAAY,KAAK,cAClD,KAAK,aAAa,IAAI,WAAYA,CAAmB,EACrD,KAAK,aAAa,gBAAiBA,EAAsB,OAAS,OAAO,EAGrEA,EACF,KAAK,SAAW,GAGhB,KAAK,SAAW,KAAK,QAAU,EAAI,EAEvC,CACF,CAKA,UAAiB,CAEjB,CASA,QAAS,CACP,OAAOC;AAAA;AAAA;AAAA,KAIT,CACF,EA3FaJ,GACJ,IAAM,CAACK,EAAM,EAEXC,EAAA,CAARC,GAAM,GAHIP,GAGF,uBAGAM,EAAA,CAARC,GAAM,GANIP,GAMF,6BAKoBM,EAAA,CAA5BE,EAAS,CAAE,QAAS,EAAK,CAAC,GAXhBR,GAWkB,oBAGAM,EAAA,CAA5BE,EAAS,CAAE,QAAS,EAAK,CAAC,GAdhBR,GAckB,qBAGAM,EAAA,CAA5BE,EAAS,CAAE,QAAS,EAAK,CAAC,GAjBhBR,GAiBkB,0BAMAM,EAAA,CAA5BE,EAAS,CAAE,QAAS,EAAK,CAAC,GAvBhBR,GAuBkB,oBAGAM,EAAA,CAA5BE,EAAS,CAAE,KAAM,OAAQ,CAAC,GA1BhBR,GA0BkB,wBCpCxB,IAAMS,GACX,mECoBK,IAAIC,GAAS,CAACC,EAAO,KAAO,CACjC,IAAIC,EAAK,GACLC,EAAQ,OAAO,gBAAgB,IAAI,WAAYF,GAAQ,CAAE,CAAC,EAC9D,KAAOA,KACLC,GAAME,GAAkBD,EAAMF,CAAI,EAAI,EAAE,EAE1C,OAAOC,CACT,EC1BO,SAASG,GAASC,EAAS,GAAI,CACpC,MAAO,GAAGA,CAAM,GAAGC,GAAO,CAAC,EAC7B,CCJA,IAAAC,GAAA,GCmBO,IAAMC,GAAN,cAA0BC,EAA0B,CAoFzD,aAAc,CACZ,MAAM,EApER,KAAiB,kBAAoB,IAAIC,GAAkB,KAAM,OAAQ,OAAO,EAEvE,qBAAkB,GAQf,WAAQ,GAGa,UAAO,GAGX,UAAsB,KAGP,cAAW,GAG1B,iBAAyC,WAEtE,KAAQ,OAAwB,KAmBiB,kBAA8B,KAAK,aAAa,OAAO,GAAK,KAGhF,UAAqC,SAGtB,cAAW,GAKD,eAAY,GAKb,cAAW,GAuChE,KAAQ,iBAAoBC,GAAa,CACvC,IAAMC,EAAgBD,EAAE,OAAuB,QAAgB,SAAS,EAExE,GAAI,CAACC,GAAgBA,EAAa,UAAaA,EAAqB,eAAiB,KAAK,SACxF,OAGF,IAAMC,EAAW,KAAK,MACtB,KAAK,MAAQD,EAAa,MAC1BA,EAAa,QAAU,GAEvB,IAAME,EAAS,KAAK,aAAa,EACjC,QAAWC,KAASD,EACdF,IAAiBG,IAIrBA,EAAM,QAAU,GAChBA,EAAM,aAAa,WAAY,IAAI,GAGjC,KAAK,QAAUF,GACjB,KAAK,eAAe,KAAK,IAAM,CAC7B,KAAK,cAAc,IAAI,WAAW,QAAS,CAAE,QAAS,GAAM,SAAU,EAAK,CAAC,CAAC,EAC7E,KAAK,cAAc,IAAI,MAAM,SAAU,CAAE,QAAS,GAAM,SAAU,EAAK,CAAC,CAAC,CAC3E,CAAC,CAEL,EAxDE,KAAK,iBAAiB,UAAW,KAAK,aAAa,EACnD,KAAK,iBAAiB,QAAS,KAAK,gBAAgB,CACtD,CArFA,WAAW,YAAa,CACtB,IAAMG,EAAa,CACjBC,GAAkB,CAChB,kBAAmB,OAAO,OAAO,SAAS,cAAc,OAAO,EAAG,CAChE,SAAU,GACV,KAAM,QAEN,KAAMC,GAAS,WAAW,CAC5B,CAAC,CACH,CAAC,CACH,EACA,MAAO,CAAC,GAAG,MAAM,WAAY,GAAGF,CAAU,CAC5C,CA4BA,IAAI,OAAQ,CA9Dd,IAAAG,EA+DI,OAAI,KAAK,gBACA,KAAK,QAGPA,EAAA,KAAK,SAAL,KAAAA,EAAe,KAAK,YAC7B,CAIA,IAAI,MAAMC,EAA6B,CACjC,OAAOA,GAAQ,WAAUA,EAAM,OAAOA,CAAG,GAC7C,KAAK,gBAAkB,GACvB,KAAK,OAASA,CAChB,CAqCA,IAAI,kBAAmB,CACrB,IAAML,EAAQ,KAAK,cAAsB,8BAA8B,EACvE,GAAKA,EAEL,OAAOA,CACT,CAEA,QAAQM,EAAyC,EAC3CA,EAAkB,IAAI,UAAU,GAAKA,EAAkB,IAAI,OAAO,IACpE,KAAK,kBAAkB,CAE3B,CAEA,qBAAqBC,EAAkE,CACrF,KAAK,MAAQ,KAAK,aAElB,MAAM,kBAAkB,GAAGA,CAAI,EAE/B,KAAK,kBAAkB,CACzB,CA+BQ,cAAe,CACrB,MAAO,CAAC,GAAG,KAAK,iBAAyB,SAAS,CAAC,CACrD,CAEQ,kBAAmB,CACzB,KAAK,MAAM,CACb,CAEA,MAAc,mBAAoB,CAChC,IAAMR,EAAS,KAAK,aAAa,EAC7BS,EAAkB,GAgCtB,GA7BAT,EAAO,QAAQ,CAACC,EAAOS,IAAU,CAC3BT,EAAM,aAAe,WAAUQ,EAAkB,IACrDR,EAAM,aAAa,OAAQ,KAAK,IAAI,EACpCA,EAAM,gBAAgB,0BAA2B,KAAK,cAAgB,UAAU,EAChFA,EAAM,gBAAgB,wBAAyB,KAAK,cAAgB,UAAU,EAC9EA,EAAM,gBAAgB,qBAAsBS,IAAU,CAAC,EACvDT,EAAM,gBAAgB,qBAAsBS,IAAU,GAAKA,IAAUV,EAAO,OAAS,CAAC,EACtFC,EAAM,gBAAgB,oBAAqBS,IAAUV,EAAO,OAAS,CAAC,EAGrEC,EAAiB,cAAgB,KAAK,QACzC,CAAC,EAGD,KAAK,gBAAkBQ,EAEvB,MAAM,QAAQ,IACZT,EAAO,IAAI,MAAOC,GAAU,CAC1B,MAAMA,EAAM,eAER,CAACA,EAAM,UAAYA,EAAM,QAAU,KAAK,MAC1CA,EAAM,QAAU,GAEhBA,EAAM,QAAU,EAEpB,CAAC,CACH,EAGI,KAAK,SAEPD,EAAO,QAASC,GAAU,CACxBA,EAAM,SAAW,EACnB,CAAC,MACI,CAEL,IAAMU,EAAgBX,EAAO,OAAQC,GAAU,CAACA,EAAM,QAAQ,EACxDW,EAAeD,EAAc,KAAMV,GAAUA,EAAM,OAAO,EAE5DU,EAAc,OAAS,IACrBC,EAEFD,EAAc,QAASV,GAAU,CAC/BA,EAAM,SAAWA,EAAM,QAAU,EAAI,EACvC,CAAC,EAGDU,EAAc,QAAQ,CAACV,EAAOS,IAAU,CACtCT,EAAM,SAAWS,IAAU,EAAI,EAAI,EACrC,CAAC,GAKLV,EACG,OAAQC,GAAUA,EAAM,QAAQ,EAChC,QAASA,GAAU,CAClBA,EAAM,SAAW,EACnB,CAAC,CACL,CACF,CAEQ,cAAcY,EAAsB,CA9O9C,IAAAR,EA+OI,GAAI,CAAC,CAAC,UAAW,YAAa,YAAa,aAAc,GAAG,EAAE,SAASQ,EAAM,GAAG,GAAK,KAAK,SACxF,OAGF,IAAMb,EAAS,KAAK,aAAa,EAAE,OAAQC,GAAU,CAACA,EAAM,QAAQ,EAEpE,GAAID,EAAO,QAAU,EACnB,OAGFa,EAAM,eAAe,EAErB,IAAMd,EAAW,KAAK,MAEhBa,GAAeP,EAAAL,EAAO,KAAMC,GAAUA,EAAM,OAAO,IAApC,KAAAI,EAAyCL,EAAO,CAAC,EAChEc,EAAOD,EAAM,MAAQ,IAAM,EAAI,CAAC,UAAW,WAAW,EAAE,SAASA,EAAM,GAAG,EAAI,GAAK,EACrFH,EAAQV,EAAO,QAAQY,CAAY,EAAIE,EAEtCJ,IAAOA,EAAQ,GAEhBA,EAAQ,IACVA,EAAQV,EAAO,OAAS,GAGtBU,EAAQV,EAAO,OAAS,IAC1BU,EAAQ,GAGV,IAAMD,EAAkBT,EAAO,KAAMC,GAAUA,EAAM,QAAQ,YAAY,IAAM,gBAAgB,EAE/F,KAAK,aAAa,EAAE,QAASA,GAAU,CACrCA,EAAM,QAAU,GAEXQ,GACHR,EAAM,aAAa,WAAY,IAAI,CAEvC,CAAC,EAED,KAAK,MAAQD,EAAOU,CAAK,EAAE,MAC3BV,EAAOU,CAAK,EAAE,QAAU,GAEnBD,EAIHT,EAAOU,CAAK,EAAE,WAAY,cAAc,QAAQ,EAAG,MAAM,GAHzDV,EAAOU,CAAK,EAAE,aAAa,WAAY,GAAG,EAC1CV,EAAOU,CAAK,EAAE,MAAM,GAKlB,KAAK,QAAUX,GACjB,KAAK,eAAe,KAAK,IAAM,CAC7B,KAAK,cAAc,IAAI,WAAW,QAAS,CAAE,QAAS,GAAM,SAAU,EAAK,CAAC,CAAC,EAC7E,KAAK,cAAc,IAAI,MAAM,SAAU,CAAE,QAAS,GAAM,SAAU,EAAK,CAAC,CAAC,CAC3E,CAAC,EAGHc,EAAM,eAAe,CACvB,CAGO,MAAME,EAAwB,CACnC,GAAI,KAAK,SAAU,OAEnB,IAAMf,EAAS,KAAK,aAAa,EAC3BgB,EAAUhB,EAAO,KAAMC,GAAUA,EAAM,OAAO,EAC9CgB,EAAoBjB,EAAO,KAAMC,GAAU,CAACA,EAAM,QAAQ,EAC1DiB,EAAeF,GAAWC,EAG5BC,GACFA,EAAa,MAAMH,CAAO,CAE9B,CAEA,QAAS,CACP,IAAMI,EAAe,KAAK,WAAa,KAAK,kBAAkB,KAAK,OAAO,EAAI,KAAK,UAC7EC,EAAc,KAAK,WAAa,KAAK,kBAAkB,KAAK,MAAM,EAAI,KAAK,SAC3EC,EAAW,KAAK,MAAQ,GAAO,CAAC,CAACF,EACjCG,EAAU,KAAK,KAAO,GAAO,CAAC,CAACF,EAErC,OAAOG;AAAA;AAAA;AAAA,gBAGK1B,GAAS,CACf,eAAgB,GAChB,2BAA4B,GAC5B,yBAA0BwB,EAC1B,oBAAqB,KAAK,eAC5B,CAAC,CAAC;AAAA;AAAA;AAAA;AAAA;AAAA,2BAKiB,KAAK,WAAW;AAAA;AAAA;AAAA;AAAA;AAAA,wBAKnBA,EAAW,QAAU,MAAM;AAAA,mBAChC,KAAK,gBAAgB;AAAA,+BACT,KAAK,KAAK;AAAA;AAAA;AAAA,sDAGa,KAAK,iBAAiB;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,kBAM1DxB,GAAS,CACf,cAAeyB,CACjB,CAAC,CAAC;AAAA,wBACYA,EAAU,QAAU,MAAM;AAAA,aACrC,KAAK,IAAI;AAAA;AAAA;AAAA,KAIpB,CACF,EAjVa5B,GACJ,IAAM,CAAC8B,EAAM,EADT9B,GAkFJ,kBAAoB,CAAE,GAAGC,GAA0B,kBAAmB,eAAgB,EAAK,EA/DzF8B,EAAA,CAARC,GAAM,GAnBIhC,GAmBF,+BAEkB+B,EAAA,CAA1B5B,GAAM,kBAAkB,GArBdH,GAqBgB,2BAMf+B,EAAA,CAAXE,EAAS,GA3BCjC,GA2BC,qBAGqB+B,EAAA,CAAhCE,EAAS,CAAE,UAAW,MAAO,CAAC,GA9BpBjC,GA8BsB,oBAGJ+B,EAAA,CAA5BE,EAAS,CAAE,QAAS,EAAK,CAAC,GAjChBjC,GAiCkB,oBAGe+B,EAAA,CAA3CE,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GApC/BjC,GAoCiC,wBAGf+B,EAAA,CAA5BE,EAAS,CAAE,QAAS,EAAK,CAAC,GAvChBjC,GAuCkB,2BAczB+B,EAAA,CADHC,GAAM,GApDIhC,GAqDP,qBAO6C+B,EAAA,CAAhDE,EAAS,CAAE,UAAW,QAAS,QAAS,EAAK,CAAC,GA5DpCjC,GA4DsC,4BAGpB+B,EAAA,CAA5BE,EAAS,CAAE,QAAS,EAAK,CAAC,GA/DhBjC,GA+DkB,oBAGe+B,EAAA,CAA3CE,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAlE/BjC,GAkEiC,wBAKU+B,EAAA,CAArDE,EAAS,CAAE,KAAM,QAAS,UAAW,YAAa,CAAC,GAvEzCjC,GAuE2C,yBAKD+B,EAAA,CAApDE,EAAS,CAAE,KAAM,QAAS,UAAW,WAAY,CAAC,GA5ExCjC,GA4E0C,wBC5FlD,eAAe,IAAI,SAAS,IAC/B,eAAe,OAAO,UAAWkC,EAAM,EACvC,eAAe,OAAO,gBAAiBC,EAAW,GCM9C,IAAOC,GAAP,cAAmCC,EAAAA,CAOvC,YAAYC,EAAAA,CAEV,GADAC,MAAMD,CAAAA,EAJAE,KAAMC,GAAYC,EAKpBJ,EAASK,OAASC,GAASC,MAC7B,MAAUC,MAELN,KAAKO,YAA2CC,cADnD,uCAAA,CAKL,CAED,OAAOC,EAAAA,CACL,GAAIA,IAAUP,GAAWO,GAAS,KAEhC,OADAT,KAAKU,GAAAA,OACGV,KAAKC,GAASQ,EAExB,GAAIA,IAAUE,GACZ,OAAOF,EAET,GAAoB,OAATA,GAAS,SAClB,MAAUH,MAELN,KAAKO,YAA2CC,cADnD,mCAAA,EAKJ,GAAIC,IAAUT,KAAKC,GACjB,OAAOD,KAAKU,GAEdV,KAAKC,GAASQ,EACd,IAAMG,EAAU,CAACH,CAAAA,EAKjB,OAHCG,EAAgBC,IAAMD,EAGfZ,KAAKU,GAAkB,CAI7BI,WAAiBd,KAAKO,YACnBQ,WACHH,QAAAA,EACAI,OAAQ,CAAA,CAAA,CAEX,CAAA,EAlDMpB,GAAaY,cAAG,aAChBZ,GAAUmB,WAJC,EAAA,IAkEPE,GAAaC,GAAUtB,EAAAA,WCnCpBuB,GACdC,EACAC,EACAC,EAAAA,CAEA,OAAOF,EAAYC,EAASD,CAAAA,EAAaE,GAAAA,YAAAA,EAAYF,EACvD,CC9CyB,IAAMG,GAAS,KAAK,MAAM,0CAA8C,ECAxE,IAAMC,GAAS,KAAK,MAAM,0CAA8C,ECAxE,IAAMC,GAAS,KAAK,MAAM,+CAAmD,ECA7E,IAAMC,GAAS,KAAK,MAAM,2CAA+C,ECAzE,IAAMC,GAAS,KAAK,MAAM,0CAA8C,ECA/D,IAAMC,GAASC,o6FCuB1C,IAAMC,GAAW,CACtB,KAAM,wIACN,QAAS,iFACT,SACE,4IACF,QACE,0IACF,SAAU,wEACV,QAAS,WACT,cAAe,6HACf,QAAS,kGACT,gBAAiB,YACnB,EAEaC,GAAU,CACrB,KAAM,yEACN,SAAU,uCACZ,EAEaC,GAAa,CACxB,KAAM,qBACN,MAAO,gBACP,aAAc,iBAChB,EA9CAC,GAAAC,GAAAC,GAAAC,GAAAC,GAAAC,GAqDaC,GAAN,cAAyBC,GAAiBC,CAAU,CAAE,CA6C3D,aAAc,CACZ,MAAM,EA9CHC,GAAA,KAAAT,IAoDL,eAAaU,GAAkB,CAC7B,KAAK,MAAQA,EACb,KAAK,SAASA,CAAK,CACrB,EAREC,GAAaC,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EACvE,KAAK,SAAW,KAAK,SACvB,CAQA,cAAe,CAET,KAAK,WAAW,KAAK,WAAW,cAAc,QAAQ,EAAE,MAAM,EAGlE,MAAM,KAAK,KAAK,QAAQ,EAAE,IAAKC,GAA6B,CACtDA,EAAM,UACR,KAAK,UAAUA,EAAM,KAAK,CAE9B,CAAC,CACH,CAEA,cAAcC,EAAsB,CAC9B,KAAK,WAAaA,EAAM,MAAQ,KAAOA,EAAM,MAAQ,aAAeA,EAAM,MAAQ,YACpFA,EAAM,eAAe,CAEzB,CA6BA,SAAS,CAAE,OAAAC,CAAO,EAAG,CACnB,KAAK,UAAUA,EAAO,KAAK,EAC3B,IAAMD,EAAQ,IAAI,YAAY,SAAU,CAAE,OAAQC,EAAO,KAAM,CAAC,EAChE,KAAK,cAAcD,CAAK,CAC1B,CAEA,QAAS,CACP,OAAOE,gBAAmBnB,GAAS,OAAO;AAAA,QACtCoB,GACA,KAAK,MACL,IACED,kBAAqBlB,GAAQ,IAAI,UAAUoB,GAAA,KAAKlB,GAAAI,GAAG;AAAA,cAC/C,KAAK,KAAK;AAAA,cACVa,GACA,KAAK,SACL,IACED,iBAAoBlB,GAAQ,QAAQ;AAAA,qBAC/BqB,EAAK,EAAE,CACR,GAAI,wBACJ,QAAS,aACT,QAAS,4CACX,CAAC,CAAC;AAAA,kBAER,CAAC;AAAA,YAEP,CAAC;AAAA,oBACatB,GAAS,aAAa;AAAA;AAAA,mBAEvBqB,GAAA,KAAKlB,GAAAC,GAAQ;AAAA,gBAChBiB,GAAA,KAAKlB,GAAAI,GAAG;AAAA,sBACF,KAAK,QAAQ;AAAA,8BACLgB,EAAUF,GAAA,KAAKlB,GAAAK,GAAO,CAAC;AAAA,0BAC3Be,EAAU,KAAK,OAAO,CAAC;AAAA,+BAClBA,EAAU,KAAK,SAAWF,GAAA,KAAKlB,GAAAK,GAAO,CAAC;AAAA,qBACjD,KAAK,aAAa;AAAA,oBACnB,KAAK,QAAQ;AAAA,YACrBe,GAAW,KAAK,QAAQ,CAAC;AAAA;AAAA,sBAEfF,GAAA,KAAKlB,GAAAG,GAAe;AAAA;AAAA;AAAA;AAAA,QAIlCc,GAAK,KAAK,QAAU,KAAK,QAAS,IAAMD,aAAgBE,GAAA,KAAKlB,GAAAK,GAAO,YAAYa,GAAA,KAAKlB,GAAAE,GAAgB,KAAK,KAAK,IAAI,QAAQ,CAAC;AAAA,WAElI,CACF,EAnJOF,GAAA,YA2EDC,GAAQ,UAAG,CACb,OAAOoB,EAAW,CAChBxB,GAAS,KACT,CAAC,KAAK,SAAW,CAAC,KAAK,UAAY,CAAC,KAAK,UAAYA,GAAS,QAC9D,KAAK,SAAWA,GAAS,QACzB,KAAK,UAAYA,GAAS,SAC1B,KAAK,UAAYA,GAAS,QAC5B,CAAC,CACH,EAEIK,GAAgB,UAAG,CACrB,OAAOmB,EAAW,CAACtB,GAAW,KAAM,KAAK,QAAUA,GAAW,aAAeA,GAAW,KAAK,CAAC,CAChG,EAEII,GAAe,UAAG,CACpB,OAAOkB,EAAW,CAACxB,GAAS,QAAS,KAAK,UAAYA,GAAS,eAAe,CAAC,CACjF,EAEIO,GAAG,UAAG,CACR,MAAO,WACT,EAEIC,GAAO,UAAG,CACZ,OAAO,KAAK,KAAO,GAAGa,GAAA,KAAKlB,GAAAI,GAAG,SAAW,MAC3C,EAnGWE,GA2CJ,OAAS,CAACgB,EAAOC,EAAM,EAxC9BC,EAAA,CADCP,EAAS,CAAE,UAAW,aAAc,KAAM,QAAS,QAAS,EAAK,CAAC,GAFxDX,GAGX,yBAIAkB,EAAA,CADCP,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAN/BX,GAOX,uBAIAkB,EAAA,CADCP,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAV/BX,GAWX,sBAIAkB,EAAA,CADCP,EAAS,CAAE,QAAS,EAAK,CAAC,GAdhBX,GAeX,oBAIAkB,EAAA,CADCP,EAAS,CAAE,QAAS,EAAK,CAAC,GAlBhBX,GAmBX,qBAIAkB,EAAA,CADCP,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAtB/BX,GAuBX,wBAIAkB,EAAA,CADCP,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GA1B/BX,GA2BX,wBAIAkB,EAAA,CADCP,EAAS,CAAE,UAAW,YAAa,KAAM,QAAS,QAAS,EAAK,CAAC,GA9BvDX,GA+BX,wBAIAkB,EAAA,CADCP,EAAS,CAAE,MAAO,EAAK,CAAC,GAlCdX,GAmCX,wBAGAkB,EAAA,CADCP,EAAS,CAAE,QAAS,EAAK,CAAC,GArChBX,GAsCX,oBAGAkB,EAAA,CADCP,EAAS,CAAE,QAAS,EAAK,CAAC,GAxChBX,GAyCX,qBA4GG,eAAe,IAAI,UAAU,GAChC,eAAe,OAAO,WAAYA,EAAU,EC3MrB,IAAMmB,GAAS,KAAK,MAAM,0JAAmK,ECA7L,IAAMC,GAAS,KAAK,MAAM,6JAAyK,ECAnM,IAAMC,GAAS,KAAK,MAAM,wKAAwK,ECAlM,IAAMC,GAAS,KAAK,MAAM,kJAA8J,ECAxL,IAAMC,GAAS,KAAK,MAAM,2JAAoK,ECArL,IAAMC,GAASC,o3DCoBjD,IAAMC,GAAU,CACd,QAAS,SACT,WAAY,MACd,EAEMC,GAAS,CACb,KAAM,aACN,SAAU,gEACV,WAAY,+FAEZ,UAAW,uBACX,WAAY,kCAEZ,IAAK,iFACL,cAAe,cACf,cAAe,+BACf,UAAW,gCACX,cAAe,gBAEf,KAAM,iCACN,aAAc,iCACd,eAAgB,cAChB,eAAgB,yBAEhB,eAAgB,gBAChB,aAAc,eAEd,QAAS,YACT,gBAAiB,mBACjB,kBAAmB,0CACrB,EAOMC,GAAN,cAAwBC,CAAW,CASjC,aAAc,CACZ,MAAM,EARR,gBAAa,GAGb,WAAQ,GAMNC,GAAaC,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,CACzE,CAEA,mBAAoB,CAClB,MAAM,kBAAkB,EACxB,KAAK,mBAAmB,CAC1B,CAEA,SAAU,CACR,KAAK,mBAAmB,CAC1B,CAEA,oBAAqB,CAEnB,IAAMC,EAAQ,KAAK,iBAAiB,QAAQ,EAC5CA,EAAM,QAAQ,CAACC,EAAgBC,IAAkB,CAC/CD,EAAK,WAAW,CACd,WAAY,KAAK,WACjB,MAAO,KAAK,MACZ,OAAQC,IAAUF,EAAM,OAAS,EACjC,QAASE,IAAU,CACrB,CAAC,CACH,CAAC,CACH,CAEA,QAAS,CACP,IAAMC,EAAUC,EAAW,CAACV,GAAQ,QAAS,KAAK,YAAcA,GAAQ,UAAU,CAAC,EAEnF,OAAOW;AAAA,kBACOF,CAAO;AAAA;AAAA;AAAA,KAIvB,CACF,EA7CMP,GAOG,OAAS,CAACU,EAAOC,EAAM,EAL9BC,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GADtCb,GAEJ,0BAGAY,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAJtCb,GAKJ,qBA0CF,IAAMc,GAAsB,CAC1B,UAAWC,EAAK,EAAE,CAChB,GAAI,uBACJ,QAAS,kCACT,QAAS,kBACX,CAAC,EACD,OAAQA,EAAK,EAAE,CACb,GAAI,oBACJ,QAAS,+BACT,QAAS,eACX,CAAC,EACD,QAASA,EAAK,EAAE,CACd,GAAI,yBACJ,QAAS,eACT,QAAS,cACX,CAAC,CACH,EAYMC,GAAN,cAAuBf,CAAW,CAYhC,aAAc,CACZ,MAAM,EAXR,YAAS,GAGT,eAAY,GAGZ,KAAQ,SAAyB,CAAE,WAAY,GAAO,MAAO,GAAO,OAAQ,GAAO,QAAS,EAAM,EAMhGC,GAAaC,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,CACzE,CAEA,WAAWc,EAAuB,CAChC,KAAK,SAAWA,EAChB,KAAK,cAAc,CACrB,CAEA,cAAe,CACb,OAAI,KAAK,UAAkBH,GAAoB,UAC3C,KAAK,OAAeA,GAAoB,OACrCA,GAAoB,OAC7B,CAEA,QAAS,CACP,IAAMI,EAAW,CAAC,KAAK,SAAS,WAC1BC,EAAO,CAAC,KAAK,SAAS,MACtBC,EAAU,KAAK,SAAS,QACxBC,EAAS,KAAK,SAAS,OAEvBC,EAAcd,EAAW,CAC7BT,GAAO,KACPmB,EAAWnB,GAAO,SAAWA,GAAO,WACpCmB,EAAYC,EAAOpB,GAAO,UAAYA,GAAO,WAAc,EAC7D,CAAC,EAEKwB,EAAwBf,EAAW,CACvCT,GAAO,KACPA,GAAO,eACP,KAAK,QAAU,KAAK,UAAYA,GAAO,aAAeA,GAAO,eAC7DqB,EAAU,YAAc,EAC1B,CAAC,EAEKI,EAAahB,EAAW,CAC5BT,GAAO,IACPmB,EAAaC,EAA8B,GAAvBpB,GAAO,cAAsBA,GAAO,cACxD,KAAK,QAAU,KAAK,UAAYA,GAAO,UAAYA,GAAO,aAC5D,CAAC,EAEK0B,EAAcjB,EAAW,CAC7BT,GAAO,KACPmB,EAAWnB,GAAO,aAAeA,GAAO,eACxCmB,GAAY,CAACC,EAAOpB,GAAO,eAAiB,GAC5C,KAAK,UAAYA,GAAO,aAAeA,GAAO,eAC9CsB,EAAS,YAAc,EACzB,CAAC,EAEKK,EAAiBlB,EAAW,CAACT,GAAO,QAASmB,EAAWnB,GAAO,gBAAkBA,GAAO,kBAAmBsB,EAAS,OAAS,EAAE,CAAC,EAEtI,OAAOZ;AAAA,kBACOa,CAAW;AAAA,UAClBJ,EAA8D,GAAnDT,eAAkBc,CAAqB,SAAc;AAAA,qBACtDC,CAAU,0BAA0B,KAAK,aAAa,CAAC,IAAI,KAAK,OAAS,sBAAwB,EAAE;AAAA,YAC5G,KAAK,UAAYf,oEAAyE,EAAE;AAAA;AAAA,qBAEnFgB,CAAW;AAAA,qBACXC,CAAc;AAAA;AAAA;AAAA;AAAA,KAKjC,CACF,EA5EMV,GAUG,OAAS,CAACN,EAAOC,EAAM,EAR9BC,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GADtCG,GAEJ,sBAGAJ,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAJtCG,GAKJ,yBAGQJ,EAAA,CADPJ,GAAM,GAPHQ,GAQI,wBAsEL,eAAe,IAAI,SAAS,GAC/B,eAAe,OAAO,UAAWhB,EAAS,EAGvC,eAAe,IAAI,QAAQ,GAC9B,eAAe,OAAO,SAAUgB,EAAQ,ECvNR,IAAMW,GAASC,mlFCWjD,IAAMC,GAAW,CACf,KAAM,uEACN,SAAU,sBACV,MAAO,qEACP,YAAa,8CACb,cAAe,kGACf,cAAe,uBACf,OAAQ,kFACR,eAAgB,iBAChB,kBAAmB,gBACnB,eAAgB,gBAChB,KAAM,SACR,EAEaC,GAAN,cAAyBC,CAAW,CAApC,kCAEL,WAAiB,GAGjB,cAAoB,GAKpB,IAAI,cAAe,CACjB,OAAOC,EAAW,CAACH,GAAS,KAAM,KAAK,UAAYA,GAAS,QAAQ,CAAC,CACvE,CAGA,IAAI,eAAgB,CAClB,OAAOG,EAAW,CAChBH,GAAS,MACT,KAAK,UAAYA,GAAS,cAC1B,CAAC,KAAK,WAAa,KAAK,MAAQA,GAAS,YAAcA,GAAS,cAClE,CAAC,CACH,CAGA,IAAI,gBAAiB,CACnB,OAAOG,EAAW,CAChBH,GAAS,OACT,KAAK,OAASA,GAAS,eACvB,KAAK,SAAWA,GAAS,eAAiBA,GAAS,iBACrD,CAAC,CACH,CAGA,cAAe,CACR,KAAK,WACR,KAAK,MAAQ,CAAC,KAAK,MACnB,KAAK,cACH,IAAI,YAAY,SAAU,CACxB,OAAQ,CAAE,MAAO,KAAK,KAAM,EAC5B,QAAS,GACT,SAAU,EACZ,CAAC,CACH,EAEJ,CAEA,QAAS,CACP,OAAOI;AAAA;AAAA;AAAA;AAAA;AAAA,yBAKc,KAAK,KAAK;AAAA,kBACjB,KAAK,YAAY;AAAA,0BACT,KAAK,QAAQ;AAAA,sBACjB,KAAK,QAAQ;AAAA,mBAChB,KAAK,YAAY;AAAA,4CACQ,KAAK,aAAa;AAAA,6CACjB,KAAK,cAAc;AAAA;AAAA;AAAA,KAI9D,CACF,EA/DaH,GAOJ,OAAS,CAACI,EAAOC,EAAM,EAL9BC,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAD/BP,GAEX,qBAGAM,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAJ/BP,GAKX,wBA4DG,eAAe,IAAI,UAAU,GAChC,eAAe,OAAO,WAAYA,EAAU,EC3FZ,IAAMQ,GAASC,k9ECWjD,IAAMC,GAAS,CACb,QAAS,uCACT,KAAM,6BACN,mBAAoB,gEACtB,EAEMC,GAAe,CACnB,MAAO,cACP,MAAO,cACP,MAAO,cACP,MAAO,cACP,MAAO,cACP,MAAO,cACP,MAAO,cACP,MAAO,cACP,MAAO,aACT,EAGA,SAASC,GAAoDC,EAASC,EAAe,IAAKC,EAAqB,GAAU,CACvH,IAAIC,EACJ,MAAQ,IAAIC,IAAoB,CAC9B,IAAMC,EAAQ,IAAM,CAClBF,EAAU,KACLD,GAAWF,EAAK,GAAGI,CAAI,CAC9B,EACME,EAAUJ,GAAa,CAACC,EAC1BA,GAAS,aAAaA,CAAO,EACjCA,EAAU,WAAWE,EAAOJ,CAAI,EAC5BK,GAASN,EAAK,GAAGI,CAAI,CAC3B,CACF,CAWO,IAAMG,GAAN,cAAuBC,CAAW,CAmBvC,aAAc,CACZ,MAAM,EAhBR,YAAiB,GAGjB,cAAmB,GAQnB,KAAQ,WAAqB,GAE7B,KAAQ,mCAAqCT,GAAS,KAAK,yBAAyB,KAAK,IAAI,EAAG,GAAG,EA8DnG,KAAQ,gBAAmBU,GAAuC,CAChE,IAAMC,EAAeD,EAAM,OAAO,KAC9BC,IAAiB,KAAK,aACxB,KAAK,OAASA,EACd,KAAK,WAAaA,EAClB,KAAK,yBAAyB,EAC9B,KAAK,aAAa,EAClB,KAAK,iBAAiB,EAE1B,EAyDA,KAAQ,eAAkBD,GAAyB,CACjD,GAAIA,EAAM,QAAUA,EAAM,SAAWA,EAAM,UAAY,CAAC,CAAC,YAAa,aAAc,OAAQ,KAAK,EAAE,SAASA,EAAM,GAAG,EACnH,OAGF,IAAME,EAAO,MAAM,KAAK,KAAK,iBAAiB,OAAO,CAAC,EAChDC,EAAeD,EAAK,UAAWE,GAAQA,EAAI,aAAa,MAAM,IAAM,KAAK,UAAU,EAEzF,GAAID,IAAiB,GAAI,OAEzB,IAAIE,EAAYF,EAEhB,OAAQH,EAAM,IAAK,CACjB,IAAK,OACHK,EAAY,EACZ,MACF,IAAK,MACHA,EAAYH,EAAK,OAAS,EAC1B,MACF,IAAK,YACHG,EAAY,KAAK,IAAI,EAAGF,EAAe,CAAC,EACxC,MACF,IAAK,aACHE,EAAY,KAAK,IAAIH,EAAK,OAAS,EAAGC,EAAe,CAAC,EACtD,KACJ,CAEA,GAAIE,IAAcF,EAAc,CAC9BH,EAAM,eAAe,EACrB,IAAMM,EAAUJ,EAAKG,CAAS,EACxBE,EAAcD,EAAQ,aAAa,MAAM,EAE3CC,IACF,KAAK,OAASA,EACd,KAAK,WAAaA,EAClB,KAAK,yBAAyB,EAC9B,KAAK,aAAa,EAClB,KAAK,iBAAiB,EAGrBD,EAAwB,MAAM,EAEnC,CACF,EAvKE,KAAK,iBAAiB,YAAa,KAAK,eAAe,CACzD,CAEA,mBAAoB,CAClB,MAAM,kBAAkB,EAGpB,OAAO,gBAAmB,cAC5B,KAAK,gBAAkB,IAAI,eAAe,IAAM,CAC9C,KAAK,mCAAmC,CAC1C,CAAC,EACD,KAAK,gBAAgB,QAAQ,IAAI,GAInC,OAAO,iBAAiB,SAAU,KAAK,kCAAkC,CAC3E,CAEA,sBAAuB,CACrB,MAAM,qBAAqB,EAEvB,KAAK,iBACP,KAAK,gBAAgB,WAAW,EAElC,OAAO,oBAAoB,SAAU,KAAK,kCAAkC,EAC5E,KAAK,oBAAoB,YAAa,KAAK,eAAe,CAC5D,CAEA,cAAe,CACb,KAAK,qBAAqB,EAC1B,KAAK,yBAAyB,EAC9B,KAAK,aAAa,CACpB,CAEA,QAAQE,EAAyC,CAC3CA,EAAkB,IAAI,QAAQ,GAAK,KAAK,SAAW,KAAK,aAC1D,KAAK,WAAa,KAAK,OACvB,KAAK,yBAAyB,EAC9B,KAAK,aAAa,EAClB,KAAK,iBAAiB,EAE1B,CAEQ,sBAAuB,CAC7B,IAAMN,EAAO,MAAM,KAAK,KAAK,iBAAiB,OAAO,CAAC,EAChDO,EAAYP,EAAK,KAAME,GAAQA,EAAI,aAAa,QAAQ,CAAC,EAE3DK,EACF,KAAK,WAAaA,EAAU,aAAa,MAAM,GAAK,GAC3CP,EAAK,OAAS,IACvB,KAAK,WAAaA,EAAK,CAAC,EAAE,aAAa,MAAM,GAAK,IAGhD,KAAK,aACP,KAAK,OAAS,KAAK,WAEvB,CAaQ,kBAAmB,CACzB,KAAK,cACH,IAAI,YAAY,SAAU,CACxB,OAAQ,CAAE,KAAM,KAAK,UAAW,EAChC,QAAS,GACT,SAAU,EACZ,CAAC,CACH,CACF,CAEQ,0BAA2B,CACjC,sBAAsB,IAAM,CAC1B,GAAI,CAAC,KAAK,SAAW,CAAC,KAAK,mBAAoB,OAE/C,IAAMO,EAAY,KAAK,QAAQ,cAAc,eAAe,KAAK,UAAU,IAAI,EAC/E,GAAI,CAACA,EAAW,OAEhB,IAAMC,EAAc,KAAK,QAAQ,sBAAsB,EACjDC,EAAgBF,EAAU,sBAAsB,EAEhDG,EAAOD,EAAc,KAAOD,EAAY,KACxCG,EAAQF,EAAc,MAE5B,KAAK,mBAAmB,MAAM,KAAO,GAAGC,CAAI,KAC5C,KAAK,mBAAmB,MAAM,MAAQ,GAAGC,CAAK,IAChD,CAAC,CACH,CAEQ,cAAe,CAEN,SAAS,iBAAiB,aAAa,EAC/C,QAASC,GAAU,CACNA,EAAM,aAAa,MAAM,IACzB,KAAK,YACrBA,EAAM,gBAAgB,QAAQ,EAE7BA,EAAsB,OAAS,KAEhCA,EAAM,aAAa,SAAU,EAAE,EAC9BA,EAAsB,OAAS,GAEpC,CAAC,EAGY,KAAK,iBAAiB,OAAO,EACrC,QAASV,GAAQ,CACJA,EAAI,aAAa,MAAM,IACvB,KAAK,WACnBA,EAAI,aAAa,SAAU,EAAE,EAE7BA,EAAI,gBAAgB,QAAQ,CAEhC,CAAC,CACH,CA+CA,IAAY,WAAY,CACtB,OAAO,KAAK,iBAAiB,OAAO,EAAE,MACxC,CAEA,IAAY,YAAa,CACvB,IAAMW,EAAQ,KAAK,IAAI,KAAK,UAAW,CAAC,EACxC,OAAO1B,GAAa,OAAO0B,CAAK,EAA+B,GAAK1B,GAAa,KACnF,CAEA,QAAS,CACP,IAAM2B,EAAaC,EAAW,KAAK,SAAU7B,GAAO,OAAO,EACrD8B,EAAaD,EAAW,CAAC7B,GAAO,KAAM,KAAK,UAAU,CAAC,EAE5D,OAAO+B;AAAA,oBACSH,CAAU;AAAA,qCACOE,CAAU,eAAe,KAAK,cAAc;AAAA;AAAA,6CAEpC9B,GAAO,kBAAkB;AAAA;AAAA;AAAA,KAIpE,CACF,EApNaU,GACJ,OAAS,CAACsB,EAAOC,EAAM,EAG9BC,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GAHhBzB,GAIX,sBAGAwB,EAAA,CADCC,EAAS,CAAE,UAAW,YAAa,QAAS,EAAK,CAAC,GANxCzB,GAOX,wBAGQwB,EAAA,CADPE,GAAM,kBAAkB,GATd1B,GAUH,uBAGAwB,EAAA,CADPE,GAAM,sBAAsB,GAZlB1B,GAaH,kCAyML,eAAe,IAAI,QAAQ,GAC9B,eAAe,OAAO,SAAUA,EAAQ,ECnQ1C,IAAM2B,GAAQ,CACZ,KAAM,+JACN,SAAU,gBACV,OAAQ,gCACR,KAAM,UACN,QAAS,yCACT,kBAAmB,oBACrB,EAEMC,GAAgB,iGAOTC,GAAN,cAAsBC,CAAW,CAAjC,kCAOL,WAAgB,GAGhB,YAAkB,GAGlB,UAAgB,GAGhB,cAAmB,GAEnB,KAAQ,aAAgBC,GAAsB,CAE5C,KAAK,cACH,IAAI,YAAY,YAAa,CAC3B,OAAQ,CAAE,KAAM,KAAK,IAAK,EAC1B,QAAS,GACT,SAAU,EACZ,CAAC,CACH,EAGA,KAAK,cACH,IAAI,YAAY,QAAS,CACvB,OAAQ,CAAE,KAAM,KAAK,KAAM,cAAeA,CAAM,EAChD,QAAS,GACT,SAAU,EACZ,CAAC,CACH,CACF,EAEA,IAAY,UAAW,CACrB,OAAOC,EAAW,KAAK,SAAU,CAACJ,GAAeD,GAAM,KAAM,KAAK,OAASA,GAAM,OAASA,GAAM,QAAQ,CAAC,CAC3G,CAEA,IAAY,cAAe,CACzB,OAAO,KAAK,cAAc,eAAe,IAAM,MAAQ,KAAK,UAAU,KAAK,IAAM,KAAK,KACxF,CAEA,QAAS,CACP,IAAMM,EAAc,KAAK,aAEzB,OAAOC;AAAA;AAAA;AAAA;AAAA,yBAIc,KAAK,OAAS,OAAS,OAAO;AAAA,yBAC9B,KAAK,OAAS,iBAAiB,KAAK,IAAI,GAAK,EAAE;AAAA,uBACjD,KAAK,IAAI;AAAA,oBACZ,KAAK,OAAS,IAAM,IAAI;AAAA,iBAC3B,KAAK,QAAQ;AAAA,kBACZ,KAAK,YAAY;AAAA,UACxBD,EAEC,KAAK,KACHC;AAAA,+BACiBP,GAAM,IAAI;AAAA;AAAA;AAAA,+BAGVA,GAAM,iBAAiB,KAAK,KAAK,KAAK;AAAA,gBAEvDO;AAAA,8BACgBP,GAAM,OAAO;AAAA;AAAA,oBAEvB,KAAK,KAAK;AAAA;AAAA,gBAXlBO,iBAAoBP,GAAM,iBAAiB,KAAK,KAAK,KAAK,SAavD;AAAA;AAAA,KAGb,CACF,EA7EaE,GACJ,OAAS,CAACM,EAAOC,EAAM,EAG9BC,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GAHhBT,GAIX,oBAGAQ,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GANhBT,GAOX,qBAGAQ,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAT/BT,GAUX,sBAGAQ,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAZ/BT,GAaX,oBAGAQ,EAAA,CADCC,EAAS,CAAE,UAAW,YAAa,QAAS,EAAK,CAAC,GAfxCT,GAgBX,wBA+DG,eAAe,IAAI,OAAO,GAC7B,eAAe,OAAO,QAASA,EAAO,EC3FjC,IAAMU,GAAN,cAA2BC,CAAW,CAAtC,kCAOL,YAAkB,GAElB,mBAAoB,CAClB,MAAM,kBAAkB,EACxB,KAAK,aAAa,WAAY,IAAI,EAClC,KAAK,aAAa,OAAQ,UAAU,EAGhC,KAAK,OACP,KAAK,aAAa,kBAAmB,YAAY,KAAK,IAAI,EAAE,EAC5D,KAAK,aAAa,KAAM,iBAAiB,KAAK,IAAI,EAAE,EAExD,CAEA,QAAQC,EAAyC,CAC3CA,EAAkB,IAAI,MAAM,GAAK,KAAK,OACxC,KAAK,aAAa,kBAAmB,YAAY,KAAK,IAAI,EAAE,EAC5D,KAAK,aAAa,KAAM,iBAAiB,KAAK,IAAI,EAAE,EAExD,CAEA,QAAS,CACP,OAAOC,gBACT,CACF,EA/BaH,GACJ,OAAS,CAACI,EAAOC,EAAM,EAG9BC,EAAA,CADCC,EAAS,CAAE,QAAS,EAAK,CAAC,GAHhBP,GAIX,oBAGAM,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GAN/BP,GAOX,sBA0BG,eAAe,IAAI,aAAa,GACnC,eAAe,OAAO,cAAeA,EAAY,EC1CnD,OAAOQ,OAAiB,yBCNU,IAAMC,GAASC,ykFDc1C,IAAMC,GAAU,CAErB,QAAS,WAET,KAAM,kHACN,QAAS,8EACT,SAAU,sFACV,QAAS,uHACT,SAAU,0CACV,YAAa,iCACb,OAAQ,QACR,OAAQ,mCAER,SAAU,0BACZ,EAEaC,GAAU,CACrB,KAAM,yEACN,SAAU,uCACZ,EAEaC,GAAa,CACxB,KAAM,qBACN,MAAO,gBACP,aAAc,iBAChB,EAOMC,EAAN,cAA4BC,GAAiBC,CAAU,CAAE,CAAzD,kCAiDE,UAAO,OAUP,gBAAa,GAIb,gBAAa,GAEb,QAAQC,EAAyC,CAC3CA,EAAkB,IAAI,OAAO,GAC/B,KAAK,SAAS,KAAK,KAAK,CAE5B,CAYA,IAAI,cAAe,CACjB,OAAOC,EAAW,CAChBP,GAAQ,KACR,KAAK,YAAcA,GAAQ,OAC3B,KAAK,YAAcA,GAAQ,OAC3B,CAAC,KAAK,SAAW,CAAC,KAAK,UAAY,CAAC,KAAK,UAAYA,GAAQ,QAC7D,KAAK,SAAW,CAAC,KAAK,UAAY,CAAC,KAAK,UAAYA,GAAQ,QAC5D,CAAC,KAAK,SAAW,KAAK,UAAY,CAAC,KAAK,UAAYA,GAAQ,SAC5D,CAAC,KAAK,SAAW,CAAC,KAAK,UAAY,KAAK,UAAYA,GAAQ,QAC9D,CAAC,CACH,CAGA,IAAI,iBAAkB,CACpB,OAAOO,EAAW,CAACL,GAAW,KAAM,KAAK,QAAUA,GAAW,aAAeA,GAAW,KAAK,CAAC,CAChG,CAGA,IAAI,QAAS,CACX,GAAI,KAAK,MACP,OAAOM,gBAAmB,KAAK,GAAG,WAAWP,GAAQ,IAAI,IAAI,KAAK,KAAK,UAG3E,CAGA,IAAI,SAAU,CACZ,GAAI,KAAK,SAAU,MAAO,GAAG,KAAK,GAAG,QAEvC,CAGA,IAAI,KAAM,CACR,MAAO,WACT,CAGA,IAAI,QAAS,CACX,GAAI,KAAK,SAAW,KAAK,QAAS,OAAO,KAAK,OAEhD,CAEA,QAAQQ,EAAU,CAChB,GAAM,CAAE,KAAAC,EAAM,MAAAC,CAAM,EAAIF,EAAE,cAC1B,KAAK,SAASE,CAAK,EACnB,IAAMC,EAAQ,IAAI,YAAYH,EAAE,KAAM,CACpC,OAAQ,CACN,KAAAC,EACA,MAAAC,EACA,OAAQF,EAAE,MACZ,CACF,CAAC,EACD,KAAK,cAAcG,CAAK,CAC1B,CAEA,kBAAmB,CACW,KAAK,WAAW,cAAc,mBAAmB,EAC1D,iBAAiB,EACxB,SAAQ,KAAK,WAAa,GACxC,CAEA,kBAAmB,CACW,KAAK,WAAW,cAAc,mBAAmB,EAC1D,iBAAiB,EACxB,SAAQ,KAAK,WAAa,GACxC,CAEA,QAAS,CACP,OAAOJ;AAAA,QACH,KAAK,MAAM;AAAA,oBACCR,GAAQ,OAAO;AAAA,6BACN,KAAK,gBAAgB;AAAA;AAAA,mBAE/B,KAAK,YAAY;AAAA,kBAClB,KAAK,IAAI;AAAA,iBACVa,EAAU,KAAK,GAAG,CAAC;AAAA,iBACnBA,EAAU,KAAK,GAAG,CAAC;AAAA,kBAClBA,EAAU,KAAK,IAAI,CAAC;AAAA,uBACfA,EAAU,KAAK,SAAS,CAAC;AAAA,uBACzBA,EAAU,KAAK,SAAS,CAAC;AAAA,kBAC9BA,EAAU,KAAK,IAAI,CAAC;AAAA,qBACjBA,EAAU,KAAK,OAAO,CAAC;AAAA,yBACnBA,EAAU,KAAK,WAAW,CAAC;AAAA,mBACjCA,EAAU,KAAK,KAAK,CAAC;AAAA,8BACVA,EAAU,KAAK,OAAO,CAAC;AAAA,+BACtBA,EAAU,KAAK,MAAM,CAAC;AAAA,0BAC3BA,EAAU,KAAK,OAAO,CAAC;AAAA,gBACjC,KAAK,GAAG;AAAA,uBACD,KAAK,QAAQ;AAAA,uBACb,KAAK,QAAQ;AAAA,uBACb,KAAK,QAAQ;AAAA,mBACjB,KAAK,OAAO;AAAA,qBACV,KAAK,OAAO;AAAA,oBACb,KAAK,OAAO;AAAA,6BACH,KAAK,gBAAgB;AAAA;AAAA,QAE1C,KAAK,UAAYL,gBAAmB,KAAK,eAAe,SAAS,KAAK,OAAO,KAAK,KAAK,QAAQ,QAAQ;AAAA,KAE7G,CACF,EApLML,EACG,kBAAoB,CACzB,GAAGW,GAAY,kBACf,eAAgB,EAClB,EAJIX,EA8EG,OAAS,CAACY,EAAOC,EAAM,EAvE9BC,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GANtCf,EAOJ,wBAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GATtCf,EAUJ,uBAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GAZrCf,EAaJ,kBAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GAfrCf,EAgBJ,qBAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,GAAM,UAAW,WAAY,CAAC,GAlB7Df,EAmBJ,wBAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GArBrCf,EAsBJ,oBAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GAxBrCf,EAyBJ,mBAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GA3BrCf,EA4BJ,mBAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,GAAM,UAAW,YAAa,CAAC,GA9B9Df,EA+BJ,yBAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,GAAM,UAAW,YAAa,CAAC,GAjC9Df,EAkCJ,yBAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GApCrCf,EAqCJ,uBAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GAvCrCf,EAwCJ,2BAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,GAAM,UAAW,WAAY,CAAC,GA1C9Df,EA2CJ,wBAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,QAAS,QAAS,EAAK,CAAC,GA7CtCf,EA8CJ,wBAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GAhDrCf,EAiDJ,oBAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GAnDrCf,EAoDJ,qBAGAc,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,QAAS,EAAK,CAAC,GAtDrCf,EAuDJ,oBAIAc,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,CAAC,GA1DvBf,EA2DJ,0BAIAc,EAAA,CADCC,EAAS,CAAE,KAAM,OAAQ,CAAC,GA9DvBf,EA+DJ,0BAuHG,eAAe,IAAI,aAAa,GACnC,eAAe,OAAO,cAAeA,CAAa,EErOpD,IAAMgB,GAAgB,OAAO,QAAW,YAEpCC,GAAgB,GAEpB,GAAID,GAAc,CAChB,IAAME,EAAQ,OAAO,WAAW,kCAAkC,EAC5DC,EAAW,CAAC,CAAE,QAAAC,CAAQ,IAAMH,GAAgB,CAACG,EAE/CF,EAAM,kBAAkBA,EAAM,iBAAiB,SAAUC,CAAQ,EACrEA,EAASD,CAAK,CAChB,CAEA,IAAMG,GAAmBC,GAAM,CAC7BA,EAAG,MAAM,WAAa,KACtBA,EAAG,MAAM,mBAAqB,KAC9BA,EAAG,MAAM,SAAW,IACtB,EAEMC,GAAiBD,GAAO,CAG5B,IAAME,EAASP,GAAgB,oCAAsC,QACrEK,EAAG,MAAM,WAAa,UAAUE,CAAM,GACtCF,EAAG,MAAM,mBAAqB,SAC9BA,EAAG,MAAM,SAAW,QACtB,EAEMG,GAAyB,CAACH,EAAII,IAAS,IAAM,CACjDJ,EAAG,MAAM,OAAS,OAClBA,EAAG,MAAM,SAAW,KAChBI,GAAMA,EAAK,CACjB,EAEMC,GAA4BD,GAAS,IAAM,CAC3CA,GAAMA,EAAK,CACjB,EAOaE,GAAS,CAACN,EAAII,IAAS,CAClC,IAAMG,GAAiB,IAAM,CAC3B,GAAI,CAACH,EAAM,OAAO,IAAI,QAAQI,GAAK,CAAEJ,EAAOI,CAAE,CAAC,CACjD,GAAG,EACGC,EAAsBN,GAAuBH,EAAII,CAAI,EAC3DL,GAAiBC,CAAE,EACnBA,EAAG,MAAM,OAAS,OAClB,IAAIU,EAAOV,EAAG,aAQd,GAPAN,IAAgB,sBAAsB,IAAM,CAC1CM,EAAG,iBAAiB,gBAAiBS,EAAqB,CAAE,KAAM,EAAK,CAAC,EACxET,EAAG,MAAM,OAAS,MAClBA,EAAG,MAAM,yBAA2B,WACpCC,GAAcD,CAAE,EAChB,sBAAsB,IAAMA,EAAG,MAAM,OAASU,EAAO,IAAI,CAC3D,CAAC,EACGH,EAAe,OAAOA,CAC5B,EAOaI,GAAW,CAACX,EAAII,IAAS,CACpC,IAAMG,GAAiB,IAAM,CAC3B,GAAI,CAACH,EAAM,OAAO,IAAI,QAAQI,GAAK,CAAEJ,EAAOI,CAAE,CAAC,CACjD,GAAG,EACGI,EAAwBP,GAAyBD,CAAI,EAC3DL,GAAiBC,CAAE,EACnB,IAAIa,EAAWb,EAAG,aAQlB,GAPAN,IAAgB,sBAAsB,IAAM,CAC1CM,EAAG,iBAAiB,gBAAiBY,EAAuB,CAAE,KAAM,EAAK,CAAC,EAC1EZ,EAAG,MAAM,OAASa,EAAW,KAC7Bb,EAAG,MAAM,yBAA2B,UACpCC,GAAcD,CAAE,EAChB,sBAAsB,IAAMA,EAAG,MAAM,OAAS,KAAK,CACrD,CAAC,EACGO,EAAe,OAAOA,CAC5B,EChFyB,IAAMO,GAAS,KAAK,MAAM,yGAAkH,ECA5I,IAAMC,GAAS,KAAK,MAAM,wGAAoH,ECA9I,IAAMC,GAAS,KAAK,MAAM,uGAAmH,ECA7I,IAAMC,GAAS,KAAK,MAAM,uGAAmH,ECA7I,IAAMC,GAAS,KAAK,MAAM,wGAAiH,ECAlI,IAAMC,GAASC,q4FCwBjD,IAAMC,GAAU,CACd,QAAS,kCACT,KAAM,6EACN,SAAU,uDACV,QAAS,qDACT,SAAU,uDACV,SAAU,kDACV,aAAc,kBACd,YAAa,iBACb,aAAc,kBACd,YAAa,iBACb,QAAS,wCACT,MAAO,+EACT,EArCAC,GAAAC,GAAAC,GAsDaC,GAAN,cAAwBC,CAAW,CA0BxC,aAAc,CACZ,MAAM,EA3BHC,GAAA,KAAAL,IAYL,QAAa,KAAK,IAAI,EAAE,SAAS,EAAE,EAAI,KAAK,OAAO,EAAE,SAAS,EAAE,EAAE,MAAM,EAAG,CAAC,EAG5E,UAAkB,UAGlB,UAAe,GAGf,cAAoB,GAGpB,KAAQ,UAAqB,GAI3BM,GAAaC,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,CACzE,CAEA,mBAAoB,CAClB,MAAM,kBAAkB,CAC1B,CAEA,sBAAuB,CACrB,MAAM,qBAAqB,CAC7B,CAEA,SAAU,CACJ,CAAC,KAAK,WAAa,KAAK,UAAUC,GAAO,KAAK,SAAU,IAAO,KAAK,UAAY,EAAK,CAC3F,CAqBA,IAAI,UAAW,CApHjB,IAAAC,EAAAC,EAqHI,OAAOA,GAAAD,EAAA,KAAK,aAAL,YAAAA,EAAiB,cAAc,aAA/B,KAAAC,EAA6C,IACtD,CAGA,IAAI,UAAW,CACb,OAAO,KAAK,OAAS,SACvB,CAGA,IAAI,QAAS,CACX,OAAO,KAAK,OAAS,OACvB,CAGA,IAAI,OAAQ,CACV,OAAO,KAAK,QAAU,KAAK,SAAW,QAAU,QAClD,CAGA,IAAI,YAAa,CACf,OAAI,KAAK,SACAC,EAAK,EAAE,CACZ,GAAI,qBACJ,QAAS,UACT,QAAS,6DACX,CAAC,EAEC,KAAK,OACAA,EAAK,EAAE,CACZ,GAAI,mBACJ,QAAS,QACT,QAAS,2DACX,CAAC,EAEMA,EAAK,EAAE,CACZ,GAAI,wBACJ,QAAS,aACT,QAAS,gEACX,CAAC,CAEL,CAGA,IAAI,aAAc,CAChB,OAAI,KAAK,SAAiBC,2CACtB,KAAK,OAAeA,uCACZA,0CACd,CAEA,MAAM,UAAW,CACf,OAAO,IAAI,QAAeC,GAAY,CAChC,KAAK,WAAa,KAAK,SACzBC,GAAS,KAAK,SAAUD,CAAO,EAE/BA,EAAQ,CAEZ,CAAC,CACH,CAEA,OAAQ,CACN,IAAME,EAAQ,IAAI,YAAY,QAAS,CACrC,OAAQ,CAAE,GAAI,KAAK,EAAG,EACtB,QAAS,GACT,SAAU,EACZ,CAAC,EACD,KAAK,eAAe,KAAK,IAAM,KAAK,cAAcA,CAAK,CAAC,CAC1D,CAEA,QAAS,CACP,OAAK,KAAK,KAEHH,qBAAwBb,GAAQ,OAAO,iBAAiB,KAAK,UAAU;AAAA,oBAC9DiB,GAAA,KAAKhB,GAAAC,GAAe;AAAA,sBAClBe,GAAA,KAAKhB,GAAAE,GAAY,KAAK,KAAK,WAAW;AAAA,qBACvC,KAAK,KAAK,YAAYH,GAAQ,OAAO;AAAA,eAC3C,KAAK,IAAI;AAAA;AAAA,UAEdkB,GACA,KAAK,WAAa,GAClB,IAAML;AAAA,6BACab,GAAQ,KAAK,aAAa,KAAK,KAAK;AAAA;AAAA;AAAA,WAIzD,CAAC;AAAA;AAAA,gBAfkBa,GAkBzB,CACF,EAvJOZ,GAAA,YA2CDC,GAAe,UAAG,CACpB,OAAOiB,EAAW,CAChBnB,GAAQ,KACR,KAAK,OAAS,WAAaA,GAAQ,SACnC,KAAK,OAAS,WAAaA,GAAQ,QACnC,KAAK,OAAS,SAAWA,GAAQ,QACnC,CAAC,CACH,EAEIG,GAAY,UAAG,CACjB,OAAOgB,EAAW,CAChBnB,GAAQ,SACR,KAAK,OAAS,WAAaA,GAAQ,aACnC,KAAK,OAAS,WAAaA,GAAQ,YACnC,KAAK,OAAS,SAAWA,GAAQ,YACnC,CAAC,CACH,EA3DWI,GACJ,OAAS,CACdgB,EACAC,GACAhB;AAAA;AAAA;AAAA;AAAA,KAKF,EAGAiB,EAAA,CADCJ,EAAS,CAAE,KAAM,OAAQ,UAAW,GAAM,QAAS,EAAK,CAAC,GAX/Cd,GAYX,kBAGAkB,EAAA,CADCJ,EAAS,CAAE,KAAM,OAAQ,UAAW,GAAM,QAAS,EAAK,CAAC,GAd/Cd,GAeX,oBAGAkB,EAAA,CADCJ,EAAS,CAAE,KAAM,OAAQ,UAAW,GAAM,QAAS,EAAK,CAAC,GAjB/Cd,GAkBX,oBAGAkB,EAAA,CADCJ,EAAS,CAAE,KAAM,QAAS,UAAW,GAAM,QAAS,EAAK,CAAC,GApBhDd,GAqBX,wBAGQkB,EAAA,CADPH,GAAM,GAvBIf,GAwBH,yBAiIL,eAAe,IAAI,SAAS,GAC/B,eAAe,OAAO,UAAWA,EAAS,EC1L5C,IAAMmB,GAAc,CAACC,EAAiBC,EAAeC,IAAAA,CACnD,IAAMC,EAAM,IAAIC,IAChB,QAASC,EAAIJ,EAAOI,GAAKH,EAAKG,IAC5BF,EAAIG,IAAIN,EAAKK,CAAAA,EAAIA,CAAAA,EAEnB,OAAOF,CAAG,EAqcCI,GAASC,GAlctB,cAA8BC,EAAAA,CAG5B,YAAYC,EAAAA,CAEV,GADAC,MAAMD,CAAAA,EACFA,EAASE,OAASC,GAASC,MAC7B,MAAUC,MAAM,+CAAA,CAEnB,CAEO,GACNC,EACAC,EACAC,EAAAA,CAEA,IAAIC,EACAD,IADAC,OAEFD,EAAWD,EACFA,IADEA,SAEXE,EAAQF,GAEV,IAAMG,EAAO,CAAA,EACPC,EAAS,CAAA,EACXC,EAAQ,EACZ,QAAWC,KAAQP,EACjBI,EAAKE,CAAAA,EAASH,EAAQA,EAAMI,EAAMD,CAAAA,EAASA,EAC3CD,EAAOC,CAAAA,EAASJ,EAAUK,EAAMD,CAAAA,EAChCA,IAEF,MAAO,CACLD,OAAAA,EACAD,KAAAA,CAAAA,CAEH,CAQD,OACEJ,EACAC,EACAC,EAAAA,CAEA,OAAOM,KAAKC,GAAkBT,EAAOC,EAAiBC,CAAAA,EAAUG,MACjE,CAEQ,OACPK,EAAAA,CACCV,EAAOC,EAAiBC,CAAAA,EAAAA,OAQzB,IAAMS,EAAWC,GACfF,CAAAA,EAAAA,CAEKL,OAAQQ,EAAWT,KAAMU,CAAAA,EAAWN,KAAKC,GAC9CT,EACAC,EACAC,CAAAA,EAQF,GAAA,CAAKa,MAAMC,QAAQL,CAAAA,EAEjB,OADAH,KAAKS,GAAYH,EACVD,EAQT,IAAMK,GAAWV,EAAAA,KAAKS,KAALT,KAAAA,EAAAA,KAAKS,GAAc,CAAA,EAK9BE,EAAwB,CAAA,EAM1BC,EACAC,EAGAC,EAAU,EACVC,EAAUZ,EAASa,OAAS,EAC5BC,EAAU,EACVC,EAAUb,EAAUW,OAAS,EAsMjC,KAAOF,GAAWC,GAAWE,GAAWC,GACtC,GAAIf,EAASW,CAAAA,IAAa,KAGxBA,YACSX,EAASY,CAAAA,IAAa,KAG/BA,YACSL,EAAQI,CAAAA,IAAaR,EAAQW,CAAAA,EAEtCN,EAASM,CAAAA,EAAWE,GAClBhB,EAASW,CAAAA,EACTT,EAAUY,CAAAA,CAAAA,EAEZH,IACAG,YACSP,EAAQK,CAAAA,IAAaT,EAAQY,CAAAA,EAEtCP,EAASO,CAAAA,EAAWC,GAClBhB,EAASY,CAAAA,EACTV,EAAUa,CAAAA,CAAAA,EAEZH,IACAG,YACSR,EAAQI,CAAAA,IAAaR,EAAQY,CAAAA,EAEtCP,EAASO,CAAAA,EAAWC,GAClBhB,EAASW,CAAAA,EACTT,EAAUa,CAAAA,CAAAA,EAEZE,GAAWlB,EAAeS,EAASO,EAAU,CAAA,EAAIf,EAASW,CAAAA,CAAAA,EAC1DA,IACAI,YACSR,EAAQK,CAAAA,IAAaT,EAAQW,CAAAA,EAEtCN,EAASM,CAAAA,EAAWE,GAClBhB,EAASY,CAAAA,EACTV,EAAUY,CAAAA,CAAAA,EAEZG,GAAWlB,EAAeC,EAASW,CAAAA,EAAWX,EAASY,CAAAA,CAAAA,EACvDA,IACAE,YAEIL,IAMJ,SAHEA,EAAmBrC,GAAY+B,EAASW,EAASC,CAAAA,EACjDL,EAAmBtC,GAAYmC,EAASI,EAASC,CAAAA,GAE9CH,EAAiBS,IAAIX,EAAQI,CAAAA,CAAAA,EAI3B,GAAKF,EAAiBS,IAAIX,EAAQK,CAAAA,CAAAA,EAIlC,CAIL,IAAMO,EAAWT,EAAiBU,IAAIjB,EAAQW,CAAAA,CAAAA,EACxCO,EAAUF,IAAVE,OAAmCrB,EAASmB,CAAAA,EAAY,KAC9D,GAAIE,IAAY,KAAM,CAGpB,IAAMC,EAAUL,GAAWlB,EAAeC,EAASW,CAAAA,CAAAA,EACnDK,GAAkBM,EAASpB,EAAUY,CAAAA,CAAAA,EACrCN,EAASM,CAAAA,EAAWQ,CACrB,MAECd,EAASM,CAAAA,EAAWE,GAAkBK,EAASnB,EAAUY,CAAAA,CAAAA,EACzDG,GAAWlB,EAAeC,EAASW,CAAAA,EAAWU,CAAAA,EAG9CrB,EAASmB,CAAAA,EAAsB,KAEjCL,GACD,MAvBCS,GAAWvB,EAASY,CAAAA,CAAAA,EACpBA,SALAW,GAAWvB,EAASW,CAAAA,CAAAA,EACpBA,IA8BN,KAAOG,GAAWC,GAAS,CAGzB,IAAMO,EAAUL,GAAWlB,EAAeS,EAASO,EAAU,CAAA,CAAA,EAC7DC,GAAkBM,EAASpB,EAAUY,CAAAA,CAAAA,EACrCN,EAASM,GAAAA,EAAaQ,CACvB,CAED,KAAOX,GAAWC,GAAS,CACzB,IAAMS,EAAUrB,EAASW,GAAAA,EACrBU,IAAY,MACdE,GAAWF,CAAAA,CAEd,CAMD,OAHAxB,KAAKS,GAAYH,EAEjBqB,GAAkBzB,EAAeS,CAAAA,EAC1BiB,EACR,CAAA,CAAA,ECpZH,IAAMC,GAAmB,CACvB,QAAS,gGACT,KAAM,sFACN,QAAS,QACX,EAEaC,GAAN,cAAiCC,CAAW,CAA5C,kCAYL,KAAQ,QAA+C,IAAI,IAI3D,mBAAoB,CAClB,MAAM,kBAAkB,EAGxB,KAAK,UAAY,YAAY,IAAM,CAEjC,IAAMC,EAAO,CAAC,EACRC,EAAS,CAAC,EAChB,QAAWC,KAAS,KAAK,QACnB,KAAK,IAAI,GAAKA,EAAM,CAAC,EAAE,SAAUF,EAAK,KAAKE,CAAK,EAC/CD,EAAO,KAAKC,CAAK,EAIxB,IAAMC,EAAgB,CAAC,EACvB,OAAW,CAACC,CAAE,IAAKH,EAAQ,CACzB,IAAMI,EAAK,KAAK,WAAW,cAAc,IAAID,CAAE,EAAE,EACjDD,EAAc,KAAKE,EAAG,SAAS,CAAC,CAClC,CAGA,QAAQ,IAAIF,CAAa,EAAE,KAAK,IAAM,CAChCH,EAAK,SAAW,KAAK,QAAQ,OAC/B,KAAK,QAAU,IAAI,IAAIA,CAAI,EAE/B,CAAC,CACH,EAAG,GAAG,CACR,CAEA,sBAAuB,CACrB,MAAM,qBAAqB,EAEvB,KAAK,WACP,aAAa,KAAK,SAAS,CAE/B,CAEA,OAAc,MAAO,CACnB,IAAIK,EAAK,SAAS,cAAc,mBAAmB,EAEnD,OAAKA,IACHA,EAAK,SAAS,cAAc,mBAAmB,EAC/C,SAAS,KAAK,YAAYA,CAAE,GAGvBA,CACT,CAGA,IAAI,cAAe,CACjB,OAAO,MAAM,KAAK,KAAK,OAAO,EAAE,IAAI,CAAC,CAAC,CAAEH,CAAK,IAAMA,CAAK,CAC1D,CAEA,IAAIE,EAAgD,CAClD,GAAI,CAACA,EACH,MAAM,IAAI,MAAM,wDAAwD,EAG1E,GAAI,OAAOA,GAAO,UAAY,CAAC,OAAO,UAAUA,CAAE,EAChD,MAAM,IAAI,MAAM,iEAAiE,EAGnF,OAAO,KAAK,QAAQ,IAAIA,CAAE,CAC5B,CAEA,IAAIF,EAA0D,CAnHhE,IAAAI,EAAAC,EAAAC,EAoHI,GAAI,CAACN,EAAM,GACT,MAAM,IAAI,MAAM,2CAA2C,EAG7D,IAAMO,EAAS,KAAK,QAAQ,IAAIP,EAAM,GAAI,CACxC,GAAIA,EAAM,GACV,MAAMI,EAAAJ,EAAM,OAAN,KAAAI,EAAc,UACpB,MAAMC,EAAAL,EAAM,OAAN,KAAAK,EAAc,GACpB,UAAUC,EAAAN,EAAM,WAAN,KAAAM,EAAkB,GAC5B,SAAU,KAAK,IAAI,GAAKN,EAAM,UAAY,IAC5C,CAAC,EAED,YAAK,QAAU,IAAI,IAAI,MAAM,KAAK,KAAK,OAAO,CAAC,EACxCO,CACT,CAEA,MAAM,IAAIL,EAAuC,CAC/C,GAAI,CAACA,EACH,MAAM,IAAI,MAAM,wDAAwD,EAG1E,GAAI,OAAOA,GAAO,UAAY,CAAC,OAAO,UAAUA,CAAE,EAChD,MAAM,IAAI,MAAM,iEAAiE,EAGnF,IAAMC,EAAK,KAAK,WAAW,cAAc,IAAID,CAAE,EAAE,EAEjD,GAAI,CAAC,KAAK,QAAQ,IAAIA,CAAE,EACtB,MAAO,GAGT,MAAMC,EAAG,SAAS,EAClB,IAAMI,EAAS,KAAK,QAAQ,OAAOL,CAAE,EAErC,YAAK,QAAU,IAAI,IAAI,MAAM,KAAK,KAAK,OAAO,CAAC,EACxCK,CACT,CAEA,QAAS,CACP,OAAOC;AAAA,sBACWb,GAAiB,OAAO;AAAA,sBACxBA,GAAiB,IAAI;AAAA,YAC/Bc,GACA,KAAK,aACJT,GAAUA,EAAM,GAChBA,GACCQ;AAAA,yBACWb,GAAiB,OAAO;AAAA,sBAC3BK,EAAM,EAAE;AAAA,wBACNA,EAAM,IAAI;AAAA,wBACVA,EAAM,IAAI;AAAA,4BACNA,EAAM,QAAQ;AAAA,yBACjB,IAAM,KAAK,IAAIA,EAAM,EAAE,CAAC;AAAA,yBAEvC,CAAC;AAAA;AAAA;AAAA,KAIT,CACF,EA7IaJ,GACJ,OAAS,CACdc,EACAC,GACAd;AAAA;AAAA;AAAA;AAAA,KAKF,EAGQe,EAAA,CADPC,GAAM,GAXIjB,GAYH,uBAmIL,eAAe,IAAI,mBAAmB,GACzC,eAAe,OAAO,oBAAqBA,EAAkB,EClLxD,IAAMkB,GAAe,OAAO,QAAW,YCK9C,SAASC,IAAoB,CAE3B,OADkB,eAAe,IAAI,mBAAmB,CAE1D,CAKO,SAASC,GAAMC,EAAiBC,EAAwB,CAC7D,GAAI,CAACC,GAAc,OAEnB,IAAMH,EAAQD,GAAkB,EAAE,KAAK,EAEjCK,EAAqB,CACzB,GAAI,KAAK,IAAI,EAAE,SAAS,EAAE,EAAI,KAAK,OAAO,EAAE,SAAS,EAAE,EAAE,MAAM,EAAG,CAAC,EACnE,KAAMH,EACN,SAAU,IACV,KAAM,UACN,GAAGC,CACL,EAEA,OAAAF,EAAM,IAAII,CAAI,EACPA,CACT,CAKO,SAASC,GAAYC,EAAmD,CAC7E,OAAKH,GAESJ,GAAkB,EAAE,KAAK,EAC1B,IAAIO,CAAE,EAHA,MAIrB,CAKO,SAASC,GAAYD,EAAqBJ,EAAmD,CAClG,GAAI,CAACC,GAAc,OAEnB,IAAMH,EAAQD,GAAkB,EAAE,KAAK,EACvC,OAAAC,EAAM,IAAI,CAAE,GAAGA,EAAM,IAAIM,CAAE,EAAG,GAAGJ,CAAQ,CAAC,EACnCF,EAAM,IAAIM,CAAE,CACrB",
+  "names": ["require_errors", "__commonJSMin", "exports", "ErrorType", "require_dist", "__commonJSMin", "exports", "errors_1", "parseHexToInt", "hex", "validateAndParseHex", "errorName", "enforcedLength", "parsedHex", "parseHexadecimalCode", "code", "parsedCode", "parseUnicodeCode", "surrogateCode", "parsedSurrogateCode", "isCurlyBraced", "text", "parseUnicodeCodePointCode", "codePoint", "withoutBraces", "err", "parseOctalCode", "error", "singleCharacterEscapes", "parseSingleCharacterCode", "escapeMatch", "unraw", "raw", "allowOctals", "_", "backslash", "unicodeWithSurrogate", "surrogate", "unicode", "octal", "singleCharacter", "global", "globalThis", "supportsAdoptingStyleSheets", "ShadowRoot", "ShadyCSS", "nativeShadow", "Document", "prototype", "CSSStyleSheet", "constructionToken", "Symbol", "cssTagCache", "WeakMap", "CSSResult", "cssText", "strings", "safeToken", "this", "Error", "_strings", "styleSheet", "_styleSheet", "cacheable", "length", "get", "replaceSync", "set", "toString", "unsafeCSS", "value", "String", "css", "values", "reduce", "acc", "v", "idx", "adoptStyles", "renderRoot", "styles", "adoptedStyleSheets", "map", "s", "style", "document", "createElement", "nonce", "setAttribute", "textContent", "appendChild", "getCompatibleStyle", "sheet", "rule", "cssRules", "is", "defineProperty", "getOwnPropertyDescriptor", "getOwnPropertyNames", "getOwnPropertySymbols", "getPrototypeOf", "Object", "global", "globalThis", "trustedTypes", "emptyStringForBooleanAttribute", "emptyScript", "polyfillSupport", "reactiveElementPolyfillSupport", "JSCompiler_renameProperty", "prop", "_obj", "defaultConverter", "value", "type", "Boolean", "Array", "JSON", "stringify", "fromValue", "Number", "parse", "e", "notEqual", "old", "defaultPropertyDeclaration", "attribute", "String", "converter", "reflect", "useDefault", "hasChanged", "Symbol", "metadata", "litPropertyMetadata", "WeakMap", "ReactiveElement", "HTMLElement", "initializer", "this", "__prepare", "_initializers", "push", "observedAttributes", "finalize", "__attributeToPropertyMap", "keys", "name", "options", "state", "prototype", "hasOwnProperty", "create", "wrapped", "elementProperties", "set", "noAccessor", "key", "descriptor", "getPropertyDescriptor", "get", "v", "oldValue", "call", "requestUpdate", "configurable", "enumerable", "superCtor", "Map", "finalized", "props", "properties", "propKeys", "p", "createProperty", "attr", "__attributeNameForProperty", "elementStyles", "finalizeStyles", "styles", "isArray", "Set", "flat", "Infinity", "reverse", "s", "unshift", "getCompatibleStyle", "toLowerCase", "constructor", "super", "__instanceProperties", "isUpdatePending", "hasUpdated", "__reflectingProperty", "__initialize", "__updatePromise", "Promise", "res", "enableUpdating", "_$changedProperties", "__saveInstanceProperties", "forEach", "i", "controller", "__controllers", "add", "renderRoot", "isConnected", "hostConnected", "delete", "instanceProperties", "size", "createRenderRoot", "shadowRoot", "attachShadow", "shadowRootOptions", "adoptStyles", "connectedCallback", "c", "_requestedUpdate", "disconnectedCallback", "hostDisconnected", "_old", "_$attributeToProperty", "attrValue", "toAttribute", "removeAttribute", "setAttribute", "ctor", "propName", "getPropertyOptions", "fromAttribute", "convertedValue", "__defaultValues", "newValue", "hasAttribute", "_$changeProperty", "__enqueueUpdate", "initializeValue", "has", "__reflectingProperties", "reject", "result", "scheduleUpdate", "performUpdate", "shouldUpdate", "changedProperties", "willUpdate", "hostUpdate", "update", "__markUpdated", "_$didUpdate", "_changedProperties", "hostUpdated", "firstUpdated", "updated", "updateComplete", "getUpdateComplete", "__propertyToAttribute", "mode", "reactiveElementVersions", "global", "globalThis", "trustedTypes", "policy", "createPolicy", "createHTML", "s", "boundAttributeSuffix", "marker", "Math", "random", "toFixed", "slice", "markerMatch", "nodeMarker", "d", "document", "createMarker", "createComment", "isPrimitive", "value", "isArray", "Array", "isIterable", "Symbol", "iterator", "SPACE_CHAR", "textEndRegex", "commentEndRegex", "comment2EndRegex", "tagEndRegex", "RegExp", "singleQuoteAttrEndRegex", "doubleQuoteAttrEndRegex", "rawTextElement", "tag", "type", "strings", "values", "_$litType$", "html", "svg", "mathml", "noChange", "for", "nothing", "templateCache", "WeakMap", "walker", "createTreeWalker", "trustFromTemplateString", "tsa", "stringFromTSA", "hasOwnProperty", "Error", "getTemplateHtml", "l", "length", "attrNames", "rawTextEndRegex", "regex", "i", "attrName", "match", "attrNameEndIndex", "lastIndex", "exec", "test", "end", "startsWith", "push", "Template", "constructor", "options", "node", "this", "parts", "nodeIndex", "attrNameIndex", "partCount", "el", "createElement", "currentNode", "content", "wrapper", "firstChild", "replaceWith", "childNodes", "nextNode", "nodeType", "hasAttributes", "name", "getAttributeNames", "endsWith", "realName", "statics", "getAttribute", "split", "m", "index", "ctor", "PropertyPart", "BooleanAttributePart", "EventPart", "AttributePart", "removeAttribute", "tagName", "textContent", "emptyScript", "append", "data", "indexOf", "_options", "innerHTML", "resolveDirective", "part", "parent", "attributeIndex", "currentDirective", "__directives", "__directive", "nextDirectiveConstructor", "_$initialize", "_$resolve", "TemplateInstance", "template", "_$parts", "_$disconnectableChildren", "_$template", "_$parent", "parentNode", "_$isConnected", "fragment", "creationScope", "importNode", "partIndex", "templatePart", "ChildPart", "nextSibling", "ElementPart", "_$setValue", "__isConnected", "startNode", "endNode", "_$committedValue", "_$startNode", "_$endNode", "isConnected", "directiveParent", "_$clear", "_commitText", "_commitTemplateResult", "_commitNode", "_commitIterable", "insertBefore", "_insert", "createTextNode", "result", "_$getTemplate", "h", "_update", "instance", "_clone", "get", "set", "itemParts", "itemPart", "item", "start", "from", "_$notifyConnectionChanged", "n", "remove", "element", "fill", "String", "valueIndex", "noCommit", "change", "v", "_commitValue", "setAttribute", "toggleAttribute", "super", "newListener", "oldListener", "shouldRemoveListener", "capture", "once", "passive", "shouldAddListener", "removeEventListener", "addEventListener", "event", "call", "host", "handleEvent", "_$LH", "_boundAttributeSuffix", "_marker", "_markerMatch", "_HTML_RESULT", "_getTemplateHtml", "_TemplateInstance", "_isIterable", "_resolveDirective", "_ChildPart", "_AttributePart", "_BooleanAttributePart", "_EventPart", "_PropertyPart", "_ElementPart", "polyfillSupport", "litHtmlPolyfillSupport", "litHtmlVersions", "render", "container", "partOwnerNode", "renderBefore", "global", "globalThis", "LitElement", "ReactiveElement", "constructor", "this", "renderOptions", "host", "__childPart", "createRenderRoot", "renderRoot", "super", "renderBefore", "firstChild", "changedProperties", "value", "render", "hasUpdated", "isConnected", "update", "connectedCallback", "setConnected", "disconnectedCallback", "noChange", "litElementHydrateSupport", "polyfillSupport", "litElementPolyfillSupport", "global", "litElementVersions", "push", "r", "n", "t", "defaultPropertyDeclaration", "attribute", "type", "String", "converter", "defaultConverter", "reflect", "hasChanged", "notEqual", "standardProperty", "options", "target", "context", "kind", "metadata", "properties", "globalThis", "litPropertyMetadata", "get", "set", "Map", "Object", "create", "wrapped", "name", "v", "oldValue", "call", "this", "requestUpdate", "_$changeProperty", "value", "Error", "property", "protoOrTarget", "nameOrContext", "proto", "hasOwnProperty", "constructor", "createProperty", "getOwnPropertyDescriptor", "state", "options", "property", "attribute", "desc", "obj", "name", "descriptor", "configurable", "enumerable", "Reflect", "decorate", "Object", "defineProperty", "query", "selector", "cache", "protoOrTarget", "nameOrContext", "descriptor", "doQuery", "el", "renderRoot", "querySelector", "get", "set", "key", "Symbol", "this", "v", "desc", "result", "call", "hasUpdated", "ifDefined", "value", "nothing", "reset", "i", "components", "styles", "i", "brand", "Symbol", "for", "unwrapStaticValue", "value", "r", "unsafeStatic", "_$litStatic$", "stringsCache", "Map", "withStatic", "coreTag", "strings", "values", "l", "length", "staticValue", "dynamicValue", "staticStrings", "dynamicValues", "s", "i", "hasStatics", "unwrapStaticValue", "push", "key", "join", "get", "raw", "set", "html", "coreHtml", "svg", "coreSvg", "mathml", "coreMathml", "import_unraw", "isString", "s", "isFunction", "f", "cache", "defaultLocale", "normalizeLocales", "locales", "date", "value", "format", "_locales", "o", "getMemoized", "cacheKey", "time", "number", "plural", "ordinal", "offset", "rules", "_a", "_b", "plurals", "getKey", "construct", "key", "formatter", "type", "options", "localeKey", "UNICODE_REGEX", "OCTOTHORPE_PH", "getDefaultFormats", "locale", "passedLocales", "formats", "locales", "style", "format", "replaceOctothorpe", "value", "message", "numberFormat", "valueStr", "number", "cases", "offset", "plural", "selectFormatter", "date", "time", "rules", "_a", "interpolate", "translation", "values", "formatters", "formatMessage", "tokens", "token", "isString", "name", "type", "interpolatedFormat", "key", "value2", "formatter", "result", "__defProp$1", "__defNormalProp$1", "obj", "__publicField$1", "EventEmitter", "event", "listener", "maybeListeners", "index", "args", "__defProp", "__defNormalProp", "__publicField", "I18n", "params", "defaultLocale", "localeData", "maybeLocaleData", "compiler", "localeOrAllData", "messages", "maybeMessages", "localeOrMessages", "messages2", "id", "options", "messageForId", "messageMissing", "missing", "isFunction", "setupI18n", "i18n", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "_a", "value", "detectByHost", "hostname", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "hostLocale", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "i18n", "IconSearch16", "i", "title", "u", "s", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "_a", "value", "detectByHost", "hostname", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "hostLocale", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "i18n", "IconClose16", "i", "title", "u", "s", "prefixSuffixWrapper", "ccSuffix", "ccPrefix", "WarpAffix", "i", "r", "x", "o", "reset", "styles", "__decorateClass", "n", "PartType", "ATTRIBUTE", "CHILD", "PROPERTY", "BOOLEAN_ATTRIBUTE", "EVENT", "ELEMENT", "directive", "c", "values", "_$litDirective$", "Directive", "_partInfo", "_$isConnected", "this", "_$parent", "part", "parent", "attributeIndex", "__part", "__attributeIndex", "props", "update", "_part", "render", "classMap", "directive", "Directive", "partInfo", "super", "type", "PartType", "ATTRIBUTE", "name", "strings", "length", "Error", "classInfo", "Object", "keys", "filter", "key", "join", "part", "this", "_previousClasses", "Set", "_staticClasses", "split", "s", "has", "add", "render", "classList", "element", "remove", "delete", "value", "noChange", "camelCaseToKebabCase", "str", "kebabCaseAttributes", "constructor", "name", "options", "customOptions", "classes", "defn", "key", "value", "fclasses", "definition", "className", "e", "generateRandomId", "sides", "min", "max", "round", "createCoords", "v", "oppositeSideMap", "oppositeAlignmentMap", "clamp", "start", "value", "end", "max", "min", "evaluate", "param", "getSide", "placement", "getAlignment", "getOppositeAxis", "axis", "getAxisLength", "yAxisSides", "getSideAxis", "getAlignmentAxis", "getAlignmentSides", "rects", "rtl", "alignment", "alignmentAxis", "length", "mainAlignmentSide", "getOppositePlacement", "getExpandedPlacements", "oppositePlacement", "getOppositeAlignmentPlacement", "lrPlacement", "rlPlacement", "tbPlacement", "btPlacement", "getSideList", "side", "isStart", "getOppositeAxisPlacements", "flipAlignment", "direction", "list", "expandPaddingObject", "padding", "getPaddingObject", "rectToClientRect", "rect", "x", "y", "width", "height", "computeCoordsFromPlacement", "_ref", "placement", "rtl", "reference", "floating", "sideAxis", "getSideAxis", "alignmentAxis", "getAlignmentAxis", "alignLength", "getAxisLength", "side", "getSide", "isVertical", "commonX", "commonY", "commonAlign", "coords", "getAlignment", "computePosition", "config", "strategy", "middleware", "platform", "validMiddleware", "rects", "x", "y", "statefulPlacement", "middlewareData", "resetCount", "i", "name", "fn", "nextX", "nextY", "data", "reset", "detectOverflow", "state", "options", "_await$platform$isEle", "elements", "boundary", "rootBoundary", "elementContext", "altBoundary", "padding", "evaluate", "paddingObject", "getPaddingObject", "element", "clippingClientRect", "rectToClientRect", "rect", "offsetParent", "offsetScale", "elementClientRect", "arrow", "axis", "length", "arrowDimensions", "isYAxis", "minProp", "maxProp", "clientProp", "endDiff", "startDiff", "arrowOffsetParent", "clientSize", "centerToReference", "largestPossiblePadding", "minPadding", "min", "maxPadding", "min$1", "max", "center", "offset", "clamp", "shouldAddOffset", "alignmentOffset", "flip", "options", "state", "_middlewareData$arrow", "_middlewareData$flip", "placement", "middlewareData", "rects", "initialPlacement", "platform", "elements", "checkMainAxis", "checkCrossAxis", "specifiedFallbackPlacements", "fallbackStrategy", "fallbackAxisSideDirection", "flipAlignment", "detectOverflowOptions", "evaluate", "side", "getSide", "initialSideAxis", "getSideAxis", "isBasePlacement", "rtl", "fallbackPlacements", "getOppositePlacement", "getExpandedPlacements", "hasFallbackAxisSideDirection", "getOppositeAxisPlacements", "placements", "overflow", "detectOverflow", "overflows", "overflowsData", "sides", "getAlignmentSides", "_middlewareData$flip2", "_overflowsData$filter", "nextIndex", "nextPlacement", "d", "resetPlacement", "a", "b", "_overflowsData$filter2", "currentSideAxis", "acc", "getSideOffsets", "rect", "isAnySideFullyClipped", "hide", "strategy", "offsets", "originSides", "convertValueToCoords", "state", "options", "placement", "platform", "elements", "rtl", "side", "getSide", "alignment", "getAlignment", "isVertical", "getSideAxis", "mainAxisMulti", "crossAxisMulti", "rawValue", "evaluate", "mainAxis", "crossAxis", "alignmentAxis", "offset", "_middlewareData$offse", "_middlewareData$arrow", "x", "y", "middlewareData", "diffCoords", "shift", "checkMainAxis", "checkCrossAxis", "limiter", "_ref", "detectOverflowOptions", "coords", "overflow", "detectOverflow", "getOppositeAxis", "mainAxisCoord", "crossAxisCoord", "minSide", "maxSide", "min", "max", "clamp", "limitedCoords", "size", "options", "state", "_state$middlewareData", "_state$middlewareData2", "placement", "rects", "platform", "elements", "apply", "detectOverflowOptions", "evaluate", "overflow", "detectOverflow", "side", "getSide", "alignment", "getAlignment", "isYAxis", "getSideAxis", "width", "height", "heightSide", "widthSide", "maximumClippingHeight", "maximumClippingWidth", "overflowAvailableHeight", "min", "overflowAvailableWidth", "noShift", "availableHeight", "availableWidth", "xMin", "max", "xMax", "yMin", "yMax", "nextDimensions", "hasWindow", "getNodeName", "node", "isNode", "getWindow", "_node$ownerDocument", "getDocumentElement", "_ref", "value", "isElement", "isHTMLElement", "isShadowRoot", "invalidOverflowDisplayValues", "isOverflowElement", "element", "overflow", "overflowX", "overflowY", "display", "getComputedStyle", "tableElements", "isTableElement", "topLayerSelectors", "isTopLayer", "selector", "_e", "transformProperties", "willChangeValues", "containValues", "isContainingBlock", "elementOrCss", "webkit", "isWebKit", "css", "getContainingBlock", "currentNode", "getParentNode", "isLastTraversableNode", "lastTraversableNodeNames", "getNodeScroll", "result", "getNearestOverflowAncestor", "parentNode", "getOverflowAncestors", "list", "traverseIframes", "_node$ownerDocument2", "scrollableAncestor", "isBody", "win", "frameElement", "getFrameElement", "getCssDimensions", "element", "css", "getComputedStyle", "width", "height", "hasOffset", "isHTMLElement", "offsetWidth", "offsetHeight", "shouldFallback", "round", "unwrapElement", "isElement", "getScale", "domElement", "createCoords", "rect", "$", "x", "y", "noOffsets", "getVisualOffsets", "win", "getWindow", "isWebKit", "shouldAddVisualOffsets", "isFixed", "floatingOffsetParent", "getBoundingClientRect", "includeScale", "isFixedStrategy", "offsetParent", "clientRect", "scale", "visualOffsets", "offsetWin", "currentWin", "currentIFrame", "getFrameElement", "iframeScale", "iframeRect", "left", "top", "rectToClientRect", "getWindowScrollBarX", "leftScroll", "getNodeScroll", "getDocumentElement", "getHTMLOffset", "documentElement", "scroll", "ignoreScrollbarX", "htmlRect", "convertOffsetParentRelativeRectToViewportRelativeRect", "_ref", "elements", "strategy", "topLayer", "isTopLayer", "offsets", "isOffsetParentAnElement", "getNodeName", "isOverflowElement", "offsetRect", "htmlOffset", "getClientRects", "getDocumentRect", "html", "body", "max", "getViewportRect", "visualViewport", "visualViewportBased", "getInnerBoundingClientRect", "getClientRectFromClippingAncestor", "clippingAncestor", "hasFixedPositionAncestor", "stopNode", "parentNode", "getParentNode", "isLastTraversableNode", "getClippingElementAncestors", "cache", "cachedResult", "result", "getOverflowAncestors", "el", "currentContainingBlockComputedStyle", "elementIsFixed", "currentNode", "computedStyle", "currentNodeIsContaining", "isContainingBlock", "ancestor", "getClippingRect", "boundary", "rootBoundary", "clippingAncestors", "firstClippingAncestor", "clippingRect", "accRect", "min", "getDimensions", "getRectRelativeToOffsetParent", "isStaticPositioned", "getTrueOffsetParent", "polyfill", "rawOffsetParent", "getOffsetParent", "svgOffsetParent", "isTableElement", "getContainingBlock", "getElementRects", "data", "getOffsetParentFn", "getDimensionsFn", "floatingDimensions", "isRTL", "platform", "offset", "shift", "flip", "size", "hide", "arrow", "computePosition", "reference", "floating", "options", "cache", "mergedOptions", "platform", "platformWithCache", "TOP_START", "TOP", "TOP_END", "RIGHT_START", "RIGHT", "RIGHT_END", "BOTTOM_START", "BOTTOM", "BOTTOM_END", "LEFT_START", "LEFT", "LEFT_END", "directions", "opposites", "rotation", "arrowDirectionClassname", "dir", "direction", "d", "side", "staticSide", "arrowDirection", "arrowRotation", "applyArrowStyles", "arrowEl", "ELEMENT_PADDING", "ARROW_OFFSET", "useRecompute", "state", "_a", "_b", "_c", "targetEl", "attentionEl", "computePosition", "offset", "flip", "shift", "arrow", "hide", "size", "x", "y", "middlewareData", "placement", "referenceHidden", "arrowX", "arrowY", "isRtl", "arrowPlacement", "top", "right", "bottom", "left", "value", "supportedLocales", "defaultLocale", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "e", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "messages", "i18n", "styles", "i", "messages", "messages", "messages", "messages", "messages", "styles", "i", "buttonTextSizes", "buttonColors", "buttonDefaultStyling", "buttonTypes", "ccAttention", "WarpAttention", "i", "activateI18n", "messages", "opposites", "fallbackPlacement", "directions", "useRecompute", "state", "v", "r", "arrowDirectionClassname", "x", "variantProps", "activeVariant", "b", "_a", "targetSlot", "messageSlot", "i18n", "attentionMessageId", "generateRandomId", "event", "o", "E", "reset", "styles", "__decorateClass", "n", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "_a", "value", "detectByHost", "hostname", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "hostLocale", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "i18n", "IconInfo16", "i", "title", "u", "s", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "_a", "value", "detectByHost", "hostname", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "hostLocale", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "i18n", "IconWarning16", "i", "title", "u", "s", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "_a", "value", "detectByHost", "hostname", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "hostLocale", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "i18n", "IconError16", "i", "title", "u", "s", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "_a", "value", "detectByHost", "hostname", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "hostLocale", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "i18n", "IconSuccess16", "i", "title", "u", "s", "styles", "i", "ccAlert", "alertVariants", "WarpAlert", "i", "r", "activeIconClassNames", "x", "reset", "styles", "__decorateClass", "n", "styles", "i", "WarpBadge", "i", "r", "x", "reset", "styles", "__decorateClass", "n", "styles", "i", "WarpBox", "i", "r", "_a", "E", "x", "reset", "styles", "__decorateClass", "n", "interleave", "array", "separator", "el", "messages", "messages", "messages", "messages", "messages", "styles", "i", "ccBreadcrumbs", "separator", "x", "WarpBreadcrumbs", "i", "activateI18n", "messages", "i18n", "styledChildren", "child", "index", "isLastEl", "interleave", "reset", "styles", "__decorateClass", "n", "FormControlMixin", "SuperClass", "FormControl", "args", "_FormControl_focused", "_FormControl_forceError", "_FormControl_touched", "_FormControl_abortController", "_FormControl_previousAbortController", "_FormControl_awaitingValidationTarget", "_FormControl_value", "_FormControl_onFocus", "__classPrivateFieldSet", "__classPrivateFieldGet", "_FormControl_instances", "_FormControl_shouldShowError", "_FormControl_onBlur", "_FormControl_runValidators", "showError", "_FormControl_onInvalid", "_a", "_FormControl_validationCompleteResolver", "_FormControl_isValidationPending", "_FormControl_validationComplete", "_b", "_c", "validatorAttributes", "validator", "observedAttributes", "attribute", "name", "oldValue", "newValue", "validators", "value", "valueToUpdate", "resolve", "rootNode", "selector", "proto", "validity", "asyncValidators", "hasAsyncValidators", "abortController", "validationMessage", "hasChange", "key", "isValid", "isValidatorValid", "_FormControl_getValidatorMessageForValue", "_FormControl_setValidityWithOptionalTarget", "message", "WarpElement", "styles", "i", "variants", "WarpLink", "FormControlMixin", "i", "classes", "x", "e", "WarpElement", "reset", "styles", "__decorateClass", "n", "WarpElement", "messages", "messages", "messages", "messages", "messages", "styles", "i", "variants", "buttonDefaultStyling", "buttonColors", "buttonTypes", "buttonSizes", "buttonTextSizes", "buttonVariants", "ccButton", "WarpButton", "FormControlMixin", "i", "activateI18n", "messages", "i18n", "changedProperties", "r", "x", "WarpElement", "reset", "styles", "__decorateClass", "n", "messages", "messages", "messages", "messages", "messages", "styles", "i", "ccCard", "keys", "WarpCard", "i", "activateI18n", "messages", "i18n", "r", "renderButton", "x", "renderSpan", "e", "o", "reset", "styles", "__decorateClass", "n", "WarpElement", "maxTime", "minTime", "millisecondsInWeek", "millisecondsInDay", "secondsInHour", "secondsInDay", "secondsInHour", "secondsInWeek", "secondsInYear", "secondsInMonth", "secondsInQuarter", "constructFromSymbol", "constructFrom", "date", "value", "constructFromSymbol", "toDate", "argument", "context", "constructFrom", "addDays", "date", "amount", "options", "_date", "toDate", "constructFrom", "addMonths", "date", "amount", "options", "_date", "toDate", "constructFrom", "dayOfMonth", "endOfDesiredMonth", "daysInMonth", "defaultOptions", "getDefaultOptions", "startOfWeek", "date", "options", "_a", "_b", "_c", "_d", "_e", "_f", "_g", "_h", "defaultOptions", "getDefaultOptions", "weekStartsOn", "_date", "toDate", "day", "diff", "startOfISOWeek", "date", "options", "startOfWeek", "getISOWeekYear", "date", "options", "_date", "toDate", "year", "fourthOfJanuaryOfNextYear", "constructFrom", "startOfNextYear", "startOfISOWeek", "fourthOfJanuaryOfThisYear", "startOfThisYear", "getTimezoneOffsetInMilliseconds", "date", "_date", "toDate", "utcDate", "normalizeDates", "context", "dates", "normalize", "constructFrom", "date", "startOfDay", "date", "options", "_date", "toDate", "differenceInCalendarDays", "laterDate", "earlierDate", "options", "laterDate_", "earlierDate_", "normalizeDates", "laterStartOfDay", "startOfDay", "earlierStartOfDay", "laterTimestamp", "getTimezoneOffsetInMilliseconds", "earlierTimestamp", "millisecondsInDay", "startOfISOWeekYear", "date", "options", "year", "getISOWeekYear", "fourthOfJanuary", "constructFrom", "startOfISOWeek", "addWeeks", "date", "amount", "options", "addDays", "constructNow", "date", "constructFrom", "isSameDay", "laterDate", "earlierDate", "options", "dateLeft_", "dateRight_", "normalizeDates", "startOfDay", "isDate", "value", "isValid", "date", "isDate", "toDate", "normalizeInterval", "context", "interval", "start", "end", "normalizeDates", "eachDayOfInterval", "interval", "options", "_a", "start", "end", "normalizeInterval", "reversed", "endTime", "date", "step", "dates", "constructFrom", "eachWeekOfInterval", "interval", "options", "_a", "start", "end", "normalizeInterval", "reversed", "startDateWeek", "startOfWeek", "endDateWeek", "endTime", "currentDate", "step", "dates", "constructFrom", "addWeeks", "startOfMonth", "date", "options", "_date", "toDate", "startOfYear", "date", "options", "date_", "toDate", "endOfWeek", "date", "options", "_a", "_b", "_c", "_d", "_e", "_f", "_g", "_h", "defaultOptions", "getDefaultOptions", "weekStartsOn", "_date", "toDate", "day", "diff", "formatDistanceLocale", "formatDistance", "token", "count", "options", "result", "tokenValue", "buildFormatLongFn", "args", "options", "width", "dateFormats", "timeFormats", "dateTimeFormats", "formatLong", "buildFormatLongFn", "formatRelativeLocale", "formatRelative", "token", "_date", "_baseDate", "_options", "buildLocalizeFn", "args", "value", "options", "context", "valuesArray", "defaultWidth", "width", "index", "eraValues", "quarterValues", "monthValues", "dayValues", "dayPeriodValues", "formattingDayPeriodValues", "ordinalNumber", "dirtyNumber", "_options", "number", "rem100", "localize", "buildLocalizeFn", "quarter", "buildMatchFn", "args", "string", "options", "width", "matchPattern", "matchResult", "matchedString", "parsePatterns", "key", "findIndex", "pattern", "findKey", "value", "rest", "object", "predicate", "array", "buildMatchPatternFn", "args", "string", "options", "matchResult", "matchedString", "parseResult", "value", "rest", "matchOrdinalNumberPattern", "parseOrdinalNumberPattern", "matchEraPatterns", "parseEraPatterns", "matchQuarterPatterns", "parseQuarterPatterns", "matchMonthPatterns", "parseMonthPatterns", "matchDayPatterns", "parseDayPatterns", "matchDayPeriodPatterns", "parseDayPeriodPatterns", "match", "buildMatchPatternFn", "value", "buildMatchFn", "index", "enUS", "formatDistance", "formatLong", "formatRelative", "localize", "match", "getDayOfYear", "date", "options", "_date", "toDate", "differenceInCalendarDays", "startOfYear", "getISOWeek", "date", "options", "_date", "toDate", "diff", "startOfISOWeek", "startOfISOWeekYear", "millisecondsInWeek", "getWeekYear", "date", "options", "_a", "_b", "_c", "_d", "_e", "_f", "_g", "_h", "_date", "toDate", "year", "defaultOptions", "getDefaultOptions", "firstWeekContainsDate", "firstWeekOfNextYear", "constructFrom", "startOfNextYear", "startOfWeek", "firstWeekOfThisYear", "startOfThisYear", "startOfWeekYear", "date", "options", "_a", "_b", "_c", "_d", "_e", "_f", "_g", "_h", "defaultOptions", "getDefaultOptions", "firstWeekContainsDate", "year", "getWeekYear", "firstWeek", "constructFrom", "startOfWeek", "getWeek", "date", "options", "_date", "toDate", "diff", "startOfWeek", "startOfWeekYear", "millisecondsInWeek", "addLeadingZeros", "number", "targetLength", "sign", "output", "lightFormatters", "date", "token", "signedYear", "year", "addLeadingZeros", "month", "dayPeriodEnumValue", "numberOfDigits", "milliseconds", "fractionalSeconds", "dayPeriodEnum", "formatters", "date", "token", "localize", "era", "signedYear", "year", "lightFormatters", "options", "signedWeekYear", "getWeekYear", "weekYear", "twoDigitYear", "addLeadingZeros", "isoWeekYear", "getISOWeekYear", "quarter", "month", "week", "getWeek", "isoWeek", "getISOWeek", "dayOfYear", "getDayOfYear", "dayOfWeek", "localDayOfWeek", "isoDayOfWeek", "dayPeriodEnumValue", "hours", "_localize", "timezoneOffset", "formatTimezoneWithOptionalMinutes", "formatTimezone", "formatTimezoneShort", "timestamp", "offset", "delimiter", "sign", "absOffset", "minutes", "dateLongFormatter", "pattern", "formatLong", "timeLongFormatter", "dateTimeLongFormatter", "matchResult", "datePattern", "timePattern", "dateTimeFormat", "longFormatters", "dayOfYearTokenRE", "weekYearTokenRE", "throwTokens", "isProtectedDayOfYearToken", "token", "isProtectedWeekYearToken", "warnOrThrowProtectedError", "format", "input", "_message", "message", "subject", "formattingTokensRegExp", "longFormattingTokensRegExp", "escapedStringRegExp", "doubleQuoteRegExp", "unescapedLatinCharacterRegExp", "format", "date", "formatStr", "options", "_a", "_b", "_c", "_d", "_e", "_f", "_g", "_h", "_i", "_j", "_k", "_l", "_m", "_n", "_o", "_p", "_q", "_r", "defaultOptions", "getDefaultOptions", "locale", "enUS", "firstWeekContainsDate", "weekStartsOn", "originalDate", "toDate", "isValid", "parts", "longFormattingTokensRegExp", "substring", "firstCharacter", "longFormatter", "longFormatters", "formattingTokensRegExp", "cleanEscapedString", "formatters", "unescapedLatinCharacterRegExp", "formatterOptions", "part", "token", "isProtectedWeekYearToken", "isProtectedDayOfYearToken", "warnOrThrowProtectedError", "formatter", "input", "matched", "escapedStringRegExp", "doubleQuoteRegExp", "formatISO", "date", "options", "_a", "_b", "date_", "toDate", "format", "representation", "result", "tzOffset", "dateDelimiter", "timeDelimiter", "day", "addLeadingZeros", "month", "offset", "absoluteOffset", "hourOffset", "minuteOffset", "hour", "minute", "second", "separator", "time", "getDate", "date", "options", "toDate", "getDay", "date", "options", "toDate", "getWeekOfMonth", "date", "options", "_a", "_b", "_c", "_d", "_e", "_f", "_g", "_h", "defaultOptions", "getDefaultOptions", "weekStartsOn", "currentDayOfMonth", "getDate", "toDate", "startWeekDay", "getDay", "startOfMonth", "lastDayOfFirstWeek", "remainingDaysAfterFirstWeek", "lastDayOfMonth", "date", "options", "_date", "toDate", "month", "isSameMonth", "laterDate", "earlierDate", "options", "laterDate_", "earlierDate_", "normalizeDates", "isToday", "date", "options", "isSameDay", "constructFrom", "constructNow", "subDays", "date", "amount", "options", "addDays", "startOfToday", "options", "startOfDay", "subMonths", "date", "amount", "options", "addMonths", "formatDistanceLocale", "formatDistance", "token", "count", "options", "result", "tokenValue", "dateFormats", "timeFormats", "dateTimeFormats", "formatLong", "buildFormatLongFn", "formatRelativeLocale", "formatRelative", "token", "_date", "_baseDate", "_options", "eraValues", "quarterValues", "monthValues", "dayValues", "dayPeriodValues", "formattingDayPeriodValues", "ordinalNumber", "dirtyNumber", "_options", "localize", "buildLocalizeFn", "quarter", "matchOrdinalNumberPattern", "parseOrdinalNumberPattern", "matchEraPatterns", "parseEraPatterns", "matchQuarterPatterns", "parseQuarterPatterns", "matchMonthPatterns", "parseMonthPatterns", "matchDayPatterns", "parseDayPatterns", "matchDayPeriodPatterns", "parseDayPeriodPatterns", "match", "buildMatchPatternFn", "value", "buildMatchFn", "index", "da", "formatDistance", "formatLong", "formatRelative", "localize", "match", "dateFormats", "timeFormats", "dateTimeFormats", "formatLong", "buildFormatLongFn", "enGB", "formatDistance", "formatLong", "formatRelative", "localize", "match", "futureSeconds", "text", "futureMinutes", "futureHours", "futureDays", "futureWeeks", "futureMonths", "futureYears", "formatDistanceLocale", "_text", "formatDistance", "token", "count", "options", "tokenValue", "result", "dateFormats", "timeFormats", "dateTimeFormats", "formatLong", "buildFormatLongFn", "formatRelativeLocale", "formatRelative", "token", "_date", "_baseDate", "_options", "eraValues", "quarterValues", "monthValues", "formattingMonthValues", "dayValues", "formattingDayValues", "dayPeriodValues", "ordinalNumber", "dirtyNumber", "_options", "localize", "buildLocalizeFn", "quarter", "matchOrdinalNumberPattern", "parseOrdinalNumberPattern", "matchEraPatterns", "parseEraPatterns", "matchQuarterPatterns", "parseQuarterPatterns", "matchMonthPatterns", "parseMonthPatterns", "matchDayPatterns", "parseDayPatterns", "matchDayPeriodPatterns", "parseDayPeriodPatterns", "match", "buildMatchPatternFn", "value", "buildMatchFn", "index", "fi", "formatDistance", "formatLong", "formatRelative", "localize", "match", "formatDistanceLocale", "formatDistance", "token", "count", "options", "result", "tokenValue", "dateFormats", "timeFormats", "dateTimeFormats", "formatLong", "buildFormatLongFn", "formatRelativeLocale", "formatRelative", "token", "_date", "_baseDate", "_options", "eraValues", "quarterValues", "monthValues", "dayValues", "dayPeriodValues", "ordinalNumber", "dirtyNumber", "_options", "localize", "buildLocalizeFn", "quarter", "matchOrdinalNumberPattern", "parseOrdinalNumberPattern", "matchEraPatterns", "parseEraPatterns", "matchQuarterPatterns", "parseQuarterPatterns", "matchMonthPatterns", "parseMonthPatterns", "matchDayPatterns", "parseDayPatterns", "matchDayPeriodPatterns", "parseDayPeriodPatterns", "match", "buildMatchPatternFn", "value", "buildMatchFn", "index", "nb", "formatDistance", "formatLong", "formatRelative", "localize", "match", "formatDistanceLocale", "wordMapping", "formatDistance", "token", "count", "options", "result", "tokenValue", "dateFormats", "timeFormats", "dateTimeFormats", "formatLong", "buildFormatLongFn", "formatRelativeLocale", "formatRelative", "token", "_date", "_baseDate", "_options", "eraValues", "quarterValues", "monthValues", "dayValues", "dayPeriodValues", "formattingDayPeriodValues", "ordinalNumber", "dirtyNumber", "_options", "number", "rem100", "localize", "buildLocalizeFn", "quarter", "matchOrdinalNumberPattern", "parseOrdinalNumberPattern", "matchEraPatterns", "parseEraPatterns", "matchQuarterPatterns", "parseQuarterPatterns", "matchMonthPatterns", "parseMonthPatterns", "matchDayPatterns", "parseDayPatterns", "matchDayPeriodPatterns", "parseDayPeriodPatterns", "match", "buildMatchPatternFn", "value", "buildMatchFn", "index", "sv", "formatDistance", "formatLong", "formatRelative", "localize", "match", "important", "importantFlag", "styleMap", "directive", "Directive", "partInfo", "super", "type", "PartType", "ATTRIBUTE", "name", "strings", "length", "Error", "styleInfo", "Object", "keys", "reduce", "style", "prop", "value", "includes", "replace", "toLowerCase", "part", "element", "this", "_previousStyleProperties", "Set", "render", "delete", "removeProperty", "add", "isImportant", "endsWith", "setProperty", "slice", "noChange", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "_a", "value", "detectByHost", "hostname", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "hostLocale", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "i18n", "IconCalendar16", "i", "title", "u", "s", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "_a", "value", "detectByHost", "hostname", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "hostLocale", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "i18n", "IconChevronLeft16", "i", "title", "u", "s", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "_a", "value", "detectByHost", "hostname", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "hostLocale", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "i18n", "IconChevronRight16", "i", "title", "u", "s", "messages", "messages", "messages", "messages", "messages", "wDatepickerCalendarStyles", "i", "wDatepickerDayStyles", "i", "wDatepickerMonthStyles", "i", "wDatepickerStyles", "i", "dateOnlyRe", "fromISOToDate", "isoString", "normalized", "timestamp", "ua", "isIOS", "inputType", "calendarId", "inputId", "toggleButtonId", "wrapperId", "previousMonthButtonId", "datefnsLocale", "enGB", "nb", "sv", "da", "fi", "_WarpDatepicker_instances", "toggleCalendarOpen_fn", "nextMonth_fn", "previousMonth_fn", "dispatchChangeEvent_fn", "onInput_fn", "onInputClick_fn", "onInputKeyDown_fn", "onCalendarKeyDown_fn", "onCalendarSelect_fn", "WarpDatepicker", "FormControlMixin", "i", "__privateAdd", "startOfToday", "activateI18n", "messages", "lang", "detectLocale", "_a", "fromISOToDate", "startOfMonth", "month", "navigationDate", "weekIntervals", "eachWeekOfInterval", "lastDayOfMonth", "weekStart", "endOfWeek", "week", "eachDayOfInterval", "isSameMonth", "weekOfMonth", "getWeekOfMonth", "day", "differenceInCalendarDays", "startOfWeek", "e", "iso", "changedProperties", "x", "o", "__privateMethod", "i18n", "format", "isDisabled", "isSelected", "isSameDay", "isNavigationDate", "isToday", "formatISO", "getDate", "addMonths", "subMonths", "newNavigationDate", "subDays", "addDays", "event", "isoDate", "WarpElement", "reset", "wDatepickerStyles", "wDatepickerCalendarStyles", "wDatepickerDayStyles", "wDatepickerMonthStyles", "__decorateClass", "n", "r", "WarpDeadToggle", "i", "classes", "e", "x", "reset", "__decorateClass", "n", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "_a", "value", "detectByHost", "hostname", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "hostLocale", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "i18n", "IconChevronDown16", "i", "title", "u", "s", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "_a", "value", "detectByHost", "hostname", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "hostLocale", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "i18n", "IconChevronUp16", "i", "title", "u", "s", "styles", "i", "ccBox", "ccExpandable", "_WarpExpandable_instances", "wrapperClasses_get", "buttonClasses_get", "chevronClasses_get", "chevronIcon_get", "contentClasses_get", "expansionClasses_get", "WarpExpandable", "i", "__privateAdd", "changedProperties", "_a", "hasTitleProp", "hasTitleSlot", "x", "__privateGet", "o", "r", "upClasses", "downClasses", "reset", "styles", "__decorateClass", "n", "CanCloseMixin", "superClass", "ProvidesCanCloseToSlotsMixin", "evt", "children", "child", "e", "ModalFooter", "CanCloseMixin", "ProvidesCanCloseToSlotsMixin", "i", "x", "reset", "computeDeltas", "first", "last", "moveKeyframes", "dx", "dy", "animationDefaults", "reduceMotion", "windowExists", "query", "callback", "matches", "Move", "el", "animation", "keyframes", "respectReduceMotion", "__publicField", "moveKeyframes", "cb", "v", "computeDeltas", "animationDefaults", "reduceMotion", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "_a", "value", "detectByHost", "hostname", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "hostLocale", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "i18n", "IconArrowLeft16", "i", "title", "u", "s", "messages", "messages", "messages", "messages", "messages", "ModalHeader", "CanCloseMixin", "i", "activateI18n", "messages", "x", "changedProperties", "Move", "i18n", "E", "slotEvent", "topContent", "reset", "__decorateClass", "n", "r", "e", "n", "c", "i", "r", "_a", "h", "s", "a", "d", "f", "m", "y", "l", "p", "u", "b", "g", "E", "T", "ModalMain", "ProvidesCanCloseToSlotsMixin", "i", "E", "T", "x", "changedProperties", "verb", "evt", "reset", "__decorateClass", "n", "e", "map", "items", "f", "i", "value", "range", "startOrEnd", "end", "step", "start", "i", "styles", "i", "WarpPageIndicator", "i", "x", "o", "classes", "e", "styles", "__decorateClass", "n", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "_a", "value", "detectByHost", "hostname", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "hostLocale", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "i18n", "IconChevronDoubleLeft16", "i", "title", "u", "s", "messages", "messages", "messages", "messages", "messages", "styles", "i", "iconSuffix", "i18n", "baseItemStyles", "_WarpPagination_instances", "dispatchClickPage_fn", "WarpPagination", "i", "__privateAdd", "activateI18n", "messages", "_", "half", "start", "end", "visiblePages", "x", "__privateMethod", "E", "pageNumber", "isCurrentPage", "url", "styles", "ariaLabel", "e", "clickedPage", "reset", "__decorateClass", "n", "messages", "messages", "messages", "messages", "messages", "styles", "i", "pillStyles", "WarpPill", "i", "activateI18n", "messages", "i18n", "r", "x", "reset", "styles", "__decorateClass", "n", "_ChildPart", "ChildPart", "_$LH", "isSingleExpression", "part", "strings", "createMarker", "document", "createComment", "insertPart", "containerPart", "refPart", "container", "_$startNode", "parentNode", "refNode", "_$endNode", "startNode", "insertBefore", "endNode", "ChildPart", "options", "nextSibling", "oldParent", "_$parent", "parentChanged", "newConnectionState", "_$reparentDisconnectables", "_$notifyConnectionChanged", "_$isConnected", "start", "n", "setChildPartValue", "value", "directiveParent", "_$setValue", "RESET_VALUE", "setCommittedValue", "_$committedValue", "getCommittedValue", "removePart", "_$clear", "remove", "live", "directive", "Directive", "partInfo", "super", "type", "PartType", "PROPERTY", "ATTRIBUTE", "BOOLEAN_ATTRIBUTE", "Error", "isSingleExpression", "value", "part", "noChange", "nothing", "element", "name", "hasAttribute", "getAttribute", "String", "setCommittedValue", "host_default", "_hasRecordedInitialProperties", "BaseElement", "i", "__privateAdd", "customState", "active", "_a", "e", "Self", "property", "spec", "styles", "host_default", "style", "r", "name", "oldValue", "newValue", "__privateGet", "obj", "prop", "__privateSet", "changedProperties", "value", "event", "eventOptions", "__decorateClass", "n", "CustomErrorValidator", "element", "validity", "WInvalidEvent", "BaseFormAssociatedElement", "BaseElement", "e", "WInvalidEvent", "event", "_a", "emittedEvents", "CustomErrorValidator", "parentAttrs", "validator", "attr", "args", "changedProperties", "value", "formData", "val", "flags", "message", "anchor", "required", "isValid", "hasInteracted", "isDisabled", "state", "reason", "staticValidators", "validators", "formControl", "finalMessage", "invalidKeys", "str", "__decorateClass", "n", "RequiredValidator", "options", "validationElement", "validationProperty", "obj", "element", "_a", "validity", "HasSlotController", "host", "slotNames", "event", "slot", "node", "el", "name", "slotName", "watch", "propertyName", "options", "resolvedOptions", "proto", "decoratedFnName", "update", "watchedProperties", "changedProps", "property", "key", "oldValue", "newValue", "messages", "supportedLocales", "defaultLocale", "detectByBrand", "_a", "value", "detectByHost", "hostname", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "hostLocale", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "i18n", "IconCheck16", "i", "title", "u", "s", "checkbox_default", "_a", "WCheckbox", "BaseFormAssociatedElement", "HasSlotController", "validators", "RequiredValidator", "val", "changedProperties", "options", "hasHintSlot", "hasHint", "isIndeterminate", "x", "o", "l", "e", "checkbox_default", "__decorateClass", "n", "watch", "WCheckbox", "radio_default", "WRadio", "BaseFormAssociatedElement", "changedProperties", "effectivelyDisabled", "x", "radio_default", "__decorateClass", "r", "n", "urlAlphabet", "nanoid", "size", "id", "bytes", "urlAlphabet", "uniqueId", "prefix", "nanoid", "radio_group_default", "WRadioGroup", "BaseFormAssociatedElement", "HasSlotController", "e", "clickedRadio", "oldValue", "radios", "radio", "validators", "RequiredValidator", "uniqueId", "_a", "val", "changedProperties", "args", "hasRadioButtons", "index", "enabledRadios", "checkedRadio", "event", "incr", "options", "checked", "firstEnabledRadio", "radioToFocus", "hasLabelSlot", "hasHintSlot", "hasLabel", "hasHint", "x", "radio_group_default", "__decorateClass", "r", "n", "WRadio", "WRadioGroup", "UnsafeHTMLDirective", "Directive", "partInfo", "super", "this", "_value", "nothing", "type", "PartType", "CHILD", "Error", "constructor", "directiveName", "value", "_templateResult", "noChange", "strings", "raw", "_$litType$", "resultType", "values", "unsafeHTML", "directive", "when", "condition", "trueCase", "falseCase", "messages", "messages", "messages", "messages", "messages", "styles", "i", "ccSelect", "ccLabel", "ccHelpText", "_WarpSelect_instances", "classes_get", "helpTextClasses_get", "chevronClasses_get", "id_get", "helpId_get", "WarpSelect", "FormControlMixin", "i", "__privateAdd", "value", "activateI18n", "messages", "child", "event", "target", "x", "n", "__privateGet", "i18n", "o", "r", "reset", "styles", "__decorateClass", "messages", "messages", "messages", "messages", "messages", "styles", "i", "ccSteps", "ccStep", "WarpSteps", "i", "activateI18n", "messages", "steps", "step", "index", "classes", "r", "x", "reset", "styles", "__decorateClass", "n", "availableAriaLabels", "i18n", "WarpStep", "context", "vertical", "left", "isFirst", "isLast", "stepClasses", "lineHorizontalClasses", "dotClasses", "lineClasses", "contentClasses", "styles", "i", "ccSwitch", "WarpSwitch", "i", "r", "x", "reset", "styles", "__decorateClass", "n", "styles", "i", "ccTabs", "ccGridLayout", "debounce", "func", "wait", "immediate", "timeout", "args", "later", "callNow", "WarpTabs", "i", "event", "newActiveTab", "tabs", "currentIndex", "tab", "nextIndex", "nextTab", "nextTabName", "changedProperties", "activeTab", "tabListRect", "activeTabRect", "left", "width", "panel", "count", "navClasses", "r", "divClasses", "x", "reset", "styles", "__decorateClass", "n", "e", "ccTab", "ccButtonReset", "WarpTab", "i", "event", "r", "hasChildren", "x", "reset", "styles", "__decorateClass", "n", "WarpTabPanel", "i", "changedProperties", "x", "reset", "styles", "__decorateClass", "n", "WarpElement", "styles", "i", "ccinput", "ccLabel", "ccHelpText", "WarpTextField", "FormControlMixin", "i", "changedProperties", "r", "x", "e", "name", "value", "event", "o", "WarpElement", "reset", "styles", "__decorateClass", "n", "windowExists", "prefersMotion", "query", "callback", "matches", "removeTransition", "el", "addTransition", "timing", "getAfterExpandCallback", "done", "getAfterCollapseCallback", "expand", "returnPromise", "r", "afterExpandCallback", "dest", "collapse", "afterCollapseCallback", "original", "messages", "messages", "messages", "messages", "messages", "styles", "i", "ccToast", "_WarpToast_instances", "primaryClasses_get", "iconClasses_get", "WarpToast", "i", "__privateAdd", "activateI18n", "messages", "expand", "_a", "_b", "i18n", "x", "resolve", "collapse", "event", "__privateGet", "n", "r", "reset", "styles", "__decorateClass", "generateMap", "list", "start", "end", "map", "Map", "i", "set", "repeat", "directive", "Directive", "partInfo", "super", "type", "PartType", "CHILD", "Error", "items", "keyFnOrTemplate", "template", "keyFn", "keys", "values", "index", "item", "this", "_getValuesAndKeys", "containerPart", "oldParts", "getCommittedValue", "newValues", "newKeys", "Array", "isArray", "_itemKeys", "oldKeys", "newParts", "newKeyToIndexMap", "oldKeyToIndexMap", "oldHead", "oldTail", "length", "newHead", "newTail", "setChildPartValue", "insertPart", "has", "oldIndex", "get", "oldPart", "newPart", "removePart", "setCommittedValue", "noChange", "ccToastContainer", "WarpToastContainer", "i", "keep", "remove", "toast", "collapseTasks", "id", "el", "_a", "_b", "_c", "result", "x", "c", "reset", "styles", "__decorateClass", "r", "windowExists", "getToastContainer", "toast", "message", "options", "windowExists", "data", "removeToast", "id", "updateToast"]
 }