printful_client 1.0.1

data/spec/models/profit_spec.rb

@@ -0,0 +1,40 @@
+=begin
+#API Documentation | Printful
+
+## About the Printful API  The Printful API is a RESTful API, that uses an HTTP protocol for communication. HTTP GET, POST, PUT and DELETE methods are used to access the API resources.  ## Requests and responses  ### Request endpoint All API requests have to be sent to this URL: ``` https://api.printful.com/ ``` If you are using a proxy, make sure that all requests have host header set to **api.printful.com**.  ### Request parameters Some mandatory parameters (like object identifiers) must be included in the request URL path ``` GET /orders/123 ``` Additional parameters can be passed as GET variables: ``` GET /orders?offset=10&limit=5 ``` For POST and PUT requests, a more complex data structure can be passed as JSON encoded data in the request body: ``` POST /orders  {\"recipient\":{...},\"items\":[...]} ```  ### Response body The response body is always a JSON object that contains a response status code (identical to the HTTP status code) and the result of the action. If the status code is 200, then the action was successful. ``` {    \"code\": 200, //Response status code    \"result\":{       //API method return data    //...    } } ```  Sometimes the response includes paging information to allow to browse larger result sets by adding offset and limit GET parameters to the request URL. ``` {    \"code\": 200, //Response status code    \"result\":[     {        //Item 11     },     {        //Item 12     }    ]    \"paging\": {       \"total\": 12,  //Total items available       \"offset\": 10, //Items skipped from the beginning       \"limit\": 20   //Number of items per page    } } ```  ## Error response If the API call is not successful, then the response code is not in the 2xx range and the `result` attribute contains an error description. ``` {     \"code\": 404,     \"result\": \"Not Found\",     \"error\": {         \"reason\": \"NotFound\",         \"message\": \"Not Found\"     } } ```  In general, response codes in the 4xx range indicate an error that resulted from the provided information (e.g. a required parameter was missing, etc.), and codes in the 5xx range indicate an error with Printful's servers.  ### Timestamps All timestamps from the API are returned as integers in UNIX timestamp format.  ### Rate Limits Printful API has a general rate limit of 120 API calls per minute. Additionally, endpoints that perform resource intensive operations (such as mockup generator) have a lower allowed request limit.  # Authentication  <!-- ReDoc-Inject: <security-definitions> -->
+
+The version of the OpenAPI document: 1.0
+Contact: devsupport@printful.com
+Generated by: https://openapi-generator.tech
+OpenAPI Generator version: 7.0.0-SNAPSHOT
+
+=end
+
+require 'spec_helper'
+require 'json'
+require 'date'
+
+# Unit tests for Printful::Profit
+# Automatically generated by openapi-generator (https://openapi-generator.tech)
+# Please update as you see appropriate
+describe Printful::Profit do
+  let(:instance) { Printful::Profit.new }
+
+  describe 'test an instance of Profit' do
+    it 'should create an instance of Profit' do
+      expect(instance).to be_instance_of(Printful::Profit)
+    end
+  end
+  describe 'test attribute "value"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "relative_difference"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+end

data/spec/models/response200_paginated_spec.rb

@@ -0,0 +1,40 @@
+=begin
+#API Documentation | Printful
+
+## About the Printful API  The Printful API is a RESTful API, that uses an HTTP protocol for communication. HTTP GET, POST, PUT and DELETE methods are used to access the API resources.  ## Requests and responses  ### Request endpoint All API requests have to be sent to this URL: ``` https://api.printful.com/ ``` If you are using a proxy, make sure that all requests have host header set to **api.printful.com**.  ### Request parameters Some mandatory parameters (like object identifiers) must be included in the request URL path ``` GET /orders/123 ``` Additional parameters can be passed as GET variables: ``` GET /orders?offset=10&limit=5 ``` For POST and PUT requests, a more complex data structure can be passed as JSON encoded data in the request body: ``` POST /orders  {\"recipient\":{...},\"items\":[...]} ```  ### Response body The response body is always a JSON object that contains a response status code (identical to the HTTP status code) and the result of the action. If the status code is 200, then the action was successful. ``` {    \"code\": 200, //Response status code    \"result\":{       //API method return data    //...    } } ```  Sometimes the response includes paging information to allow to browse larger result sets by adding offset and limit GET parameters to the request URL. ``` {    \"code\": 200, //Response status code    \"result\":[     {        //Item 11     },     {        //Item 12     }    ]    \"paging\": {       \"total\": 12,  //Total items available       \"offset\": 10, //Items skipped from the beginning       \"limit\": 20   //Number of items per page    } } ```  ## Error response If the API call is not successful, then the response code is not in the 2xx range and the `result` attribute contains an error description. ``` {     \"code\": 404,     \"result\": \"Not Found\",     \"error\": {         \"reason\": \"NotFound\",         \"message\": \"Not Found\"     } } ```  In general, response codes in the 4xx range indicate an error that resulted from the provided information (e.g. a required parameter was missing, etc.), and codes in the 5xx range indicate an error with Printful's servers.  ### Timestamps All timestamps from the API are returned as integers in UNIX timestamp format.  ### Rate Limits Printful API has a general rate limit of 120 API calls per minute. Additionally, endpoints that perform resource intensive operations (such as mockup generator) have a lower allowed request limit.  # Authentication  <!-- ReDoc-Inject: <security-definitions> -->
+
+The version of the OpenAPI document: 1.0
+Contact: devsupport@printful.com
+Generated by: https://openapi-generator.tech
+OpenAPI Generator version: 7.0.0-SNAPSHOT
+
+=end
+
+require 'spec_helper'
+require 'json'
+require 'date'
+
+# Unit tests for Printful::Response200Paginated
+# Automatically generated by openapi-generator (https://openapi-generator.tech)
+# Please update as you see appropriate
+describe Printful::Response200Paginated do
+  let(:instance) { Printful::Response200Paginated.new }
+
+  describe 'test an instance of Response200Paginated' do
+    it 'should create an instance of Response200Paginated' do
+      expect(instance).to be_instance_of(Printful::Response200Paginated)
+    end
+  end
+  describe 'test attribute "code"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "paging"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+end

data/spec/models/response200_spec.rb

@@ -0,0 +1,34 @@
+=begin
+#API Documentation | Printful
+
+## About the Printful API  The Printful API is a RESTful API, that uses an HTTP protocol for communication. HTTP GET, POST, PUT and DELETE methods are used to access the API resources.  ## Requests and responses  ### Request endpoint All API requests have to be sent to this URL: ``` https://api.printful.com/ ``` If you are using a proxy, make sure that all requests have host header set to **api.printful.com**.  ### Request parameters Some mandatory parameters (like object identifiers) must be included in the request URL path ``` GET /orders/123 ``` Additional parameters can be passed as GET variables: ``` GET /orders?offset=10&limit=5 ``` For POST and PUT requests, a more complex data structure can be passed as JSON encoded data in the request body: ``` POST /orders  {\"recipient\":{...},\"items\":[...]} ```  ### Response body The response body is always a JSON object that contains a response status code (identical to the HTTP status code) and the result of the action. If the status code is 200, then the action was successful. ``` {    \"code\": 200, //Response status code    \"result\":{       //API method return data    //...    } } ```  Sometimes the response includes paging information to allow to browse larger result sets by adding offset and limit GET parameters to the request URL. ``` {    \"code\": 200, //Response status code    \"result\":[     {        //Item 11     },     {        //Item 12     }    ]    \"paging\": {       \"total\": 12,  //Total items available       \"offset\": 10, //Items skipped from the beginning       \"limit\": 20   //Number of items per page    } } ```  ## Error response If the API call is not successful, then the response code is not in the 2xx range and the `result` attribute contains an error description. ``` {     \"code\": 404,     \"result\": \"Not Found\",     \"error\": {         \"reason\": \"NotFound\",         \"message\": \"Not Found\"     } } ```  In general, response codes in the 4xx range indicate an error that resulted from the provided information (e.g. a required parameter was missing, etc.), and codes in the 5xx range indicate an error with Printful's servers.  ### Timestamps All timestamps from the API are returned as integers in UNIX timestamp format.  ### Rate Limits Printful API has a general rate limit of 120 API calls per minute. Additionally, endpoints that perform resource intensive operations (such as mockup generator) have a lower allowed request limit.  # Authentication  <!-- ReDoc-Inject: <security-definitions> -->
+
+The version of the OpenAPI document: 1.0
+Contact: devsupport@printful.com
+Generated by: https://openapi-generator.tech
+OpenAPI Generator version: 7.0.0-SNAPSHOT
+
+=end
+
+require 'spec_helper'
+require 'json'
+require 'date'
+
+# Unit tests for Printful::Response200
+# Automatically generated by openapi-generator (https://openapi-generator.tech)
+# Please update as you see appropriate
+describe Printful::Response200 do
+  let(:instance) { Printful::Response200.new }
+
+  describe 'test an instance of Response200' do
+    it 'should create an instance of Response200' do
+      expect(instance).to be_instance_of(Printful::Response200)
+    end
+  end
+  describe 'test attribute "code"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+end

data/spec/models/retail_costs_spec.rb

@@ -0,0 +1,70 @@
+=begin
+#API Documentation | Printful
+
+## About the Printful API  The Printful API is a RESTful API, that uses an HTTP protocol for communication. HTTP GET, POST, PUT and DELETE methods are used to access the API resources.  ## Requests and responses  ### Request endpoint All API requests have to be sent to this URL: ``` https://api.printful.com/ ``` If you are using a proxy, make sure that all requests have host header set to **api.printful.com**.  ### Request parameters Some mandatory parameters (like object identifiers) must be included in the request URL path ``` GET /orders/123 ``` Additional parameters can be passed as GET variables: ``` GET /orders?offset=10&limit=5 ``` For POST and PUT requests, a more complex data structure can be passed as JSON encoded data in the request body: ``` POST /orders  {\"recipient\":{...},\"items\":[...]} ```  ### Response body The response body is always a JSON object that contains a response status code (identical to the HTTP status code) and the result of the action. If the status code is 200, then the action was successful. ``` {    \"code\": 200, //Response status code    \"result\":{       //API method return data    //...    } } ```  Sometimes the response includes paging information to allow to browse larger result sets by adding offset and limit GET parameters to the request URL. ``` {    \"code\": 200, //Response status code    \"result\":[     {        //Item 11     },     {        //Item 12     }    ]    \"paging\": {       \"total\": 12,  //Total items available       \"offset\": 10, //Items skipped from the beginning       \"limit\": 20   //Number of items per page    } } ```  ## Error response If the API call is not successful, then the response code is not in the 2xx range and the `result` attribute contains an error description. ``` {     \"code\": 404,     \"result\": \"Not Found\",     \"error\": {         \"reason\": \"NotFound\",         \"message\": \"Not Found\"     } } ```  In general, response codes in the 4xx range indicate an error that resulted from the provided information (e.g. a required parameter was missing, etc.), and codes in the 5xx range indicate an error with Printful's servers.  ### Timestamps All timestamps from the API are returned as integers in UNIX timestamp format.  ### Rate Limits Printful API has a general rate limit of 120 API calls per minute. Additionally, endpoints that perform resource intensive operations (such as mockup generator) have a lower allowed request limit.  # Authentication  <!-- ReDoc-Inject: <security-definitions> -->
+
+The version of the OpenAPI document: 1.0
+Contact: devsupport@printful.com
+Generated by: https://openapi-generator.tech
+OpenAPI Generator version: 7.0.0-SNAPSHOT
+
+=end
+
+require 'spec_helper'
+require 'json'
+require 'date'
+
+# Unit tests for Printful::RetailCosts
+# Automatically generated by openapi-generator (https://openapi-generator.tech)
+# Please update as you see appropriate
+describe Printful::RetailCosts do
+  let(:instance) { Printful::RetailCosts.new }
+
+  describe 'test an instance of RetailCosts' do
+    it 'should create an instance of RetailCosts' do
+      expect(instance).to be_instance_of(Printful::RetailCosts)
+    end
+  end
+  describe 'test attribute "currency"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "subtotal"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "discount"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "shipping"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "tax"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "vat"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "total"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+end

data/spec/models/sales_and_costs_inner_spec.rb

@@ -0,0 +1,76 @@
+=begin
+#API Documentation | Printful
+
+## About the Printful API  The Printful API is a RESTful API, that uses an HTTP protocol for communication. HTTP GET, POST, PUT and DELETE methods are used to access the API resources.  ## Requests and responses  ### Request endpoint All API requests have to be sent to this URL: ``` https://api.printful.com/ ``` If you are using a proxy, make sure that all requests have host header set to **api.printful.com**.  ### Request parameters Some mandatory parameters (like object identifiers) must be included in the request URL path ``` GET /orders/123 ``` Additional parameters can be passed as GET variables: ``` GET /orders?offset=10&limit=5 ``` For POST and PUT requests, a more complex data structure can be passed as JSON encoded data in the request body: ``` POST /orders  {\"recipient\":{...},\"items\":[...]} ```  ### Response body The response body is always a JSON object that contains a response status code (identical to the HTTP status code) and the result of the action. If the status code is 200, then the action was successful. ``` {    \"code\": 200, //Response status code    \"result\":{       //API method return data    //...    } } ```  Sometimes the response includes paging information to allow to browse larger result sets by adding offset and limit GET parameters to the request URL. ``` {    \"code\": 200, //Response status code    \"result\":[     {        //Item 11     },     {        //Item 12     }    ]    \"paging\": {       \"total\": 12,  //Total items available       \"offset\": 10, //Items skipped from the beginning       \"limit\": 20   //Number of items per page    } } ```  ## Error response If the API call is not successful, then the response code is not in the 2xx range and the `result` attribute contains an error description. ``` {     \"code\": 404,     \"result\": \"Not Found\",     \"error\": {         \"reason\": \"NotFound\",         \"message\": \"Not Found\"     } } ```  In general, response codes in the 4xx range indicate an error that resulted from the provided information (e.g. a required parameter was missing, etc.), and codes in the 5xx range indicate an error with Printful's servers.  ### Timestamps All timestamps from the API are returned as integers in UNIX timestamp format.  ### Rate Limits Printful API has a general rate limit of 120 API calls per minute. Additionally, endpoints that perform resource intensive operations (such as mockup generator) have a lower allowed request limit.  # Authentication  <!-- ReDoc-Inject: <security-definitions> -->
+
+The version of the OpenAPI document: 1.0
+Contact: devsupport@printful.com
+Generated by: https://openapi-generator.tech
+OpenAPI Generator version: 7.0.0-SNAPSHOT
+
+=end
+
+require 'spec_helper'
+require 'json'
+require 'date'
+
+# Unit tests for Printful::SalesAndCostsInner
+# Automatically generated by openapi-generator (https://openapi-generator.tech)
+# Please update as you see appropriate
+describe Printful::SalesAndCostsInner do
+  let(:instance) { Printful::SalesAndCostsInner.new }
+
+  describe 'test an instance of SalesAndCostsInner' do
+    it 'should create an instance of SalesAndCostsInner' do
+      expect(instance).to be_instance_of(Printful::SalesAndCostsInner)
+    end
+  end
+  describe 'test attribute "date"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "sales"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "fulfillment"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "profit"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "sales_discount"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "fulfillment_discount"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "sales_shipping"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "fulfillment_shipping"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+end

data/spec/models/sales_and_costs_summary_inner_spec.rb

@@ -0,0 +1,52 @@
+=begin
+#API Documentation | Printful
+
+## About the Printful API  The Printful API is a RESTful API, that uses an HTTP protocol for communication. HTTP GET, POST, PUT and DELETE methods are used to access the API resources.  ## Requests and responses  ### Request endpoint All API requests have to be sent to this URL: ``` https://api.printful.com/ ``` If you are using a proxy, make sure that all requests have host header set to **api.printful.com**.  ### Request parameters Some mandatory parameters (like object identifiers) must be included in the request URL path ``` GET /orders/123 ``` Additional parameters can be passed as GET variables: ``` GET /orders?offset=10&limit=5 ``` For POST and PUT requests, a more complex data structure can be passed as JSON encoded data in the request body: ``` POST /orders  {\"recipient\":{...},\"items\":[...]} ```  ### Response body The response body is always a JSON object that contains a response status code (identical to the HTTP status code) and the result of the action. If the status code is 200, then the action was successful. ``` {    \"code\": 200, //Response status code    \"result\":{       //API method return data    //...    } } ```  Sometimes the response includes paging information to allow to browse larger result sets by adding offset and limit GET parameters to the request URL. ``` {    \"code\": 200, //Response status code    \"result\":[     {        //Item 11     },     {        //Item 12     }    ]    \"paging\": {       \"total\": 12,  //Total items available       \"offset\": 10, //Items skipped from the beginning       \"limit\": 20   //Number of items per page    } } ```  ## Error response If the API call is not successful, then the response code is not in the 2xx range and the `result` attribute contains an error description. ``` {     \"code\": 404,     \"result\": \"Not Found\",     \"error\": {         \"reason\": \"NotFound\",         \"message\": \"Not Found\"     } } ```  In general, response codes in the 4xx range indicate an error that resulted from the provided information (e.g. a required parameter was missing, etc.), and codes in the 5xx range indicate an error with Printful's servers.  ### Timestamps All timestamps from the API are returned as integers in UNIX timestamp format.  ### Rate Limits Printful API has a general rate limit of 120 API calls per minute. Additionally, endpoints that perform resource intensive operations (such as mockup generator) have a lower allowed request limit.  # Authentication  <!-- ReDoc-Inject: <security-definitions> -->
+
+The version of the OpenAPI document: 1.0
+Contact: devsupport@printful.com
+Generated by: https://openapi-generator.tech
+OpenAPI Generator version: 7.0.0-SNAPSHOT
+
+=end
+
+require 'spec_helper'
+require 'json'
+require 'date'
+
+# Unit tests for Printful::SalesAndCostsSummaryInner
+# Automatically generated by openapi-generator (https://openapi-generator.tech)
+# Please update as you see appropriate
+describe Printful::SalesAndCostsSummaryInner do
+  let(:instance) { Printful::SalesAndCostsSummaryInner.new }
+
+  describe 'test an instance of SalesAndCostsSummaryInner' do
+    it 'should create an instance of SalesAndCostsSummaryInner' do
+      expect(instance).to be_instance_of(Printful::SalesAndCostsSummaryInner)
+    end
+  end
+  describe 'test attribute "date"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "order_count"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "costs"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "profit"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+end

data/spec/models/shipment_spec.rb

@@ -0,0 +1,88 @@
+=begin
+#API Documentation | Printful
+
+## About the Printful API  The Printful API is a RESTful API, that uses an HTTP protocol for communication. HTTP GET, POST, PUT and DELETE methods are used to access the API resources.  ## Requests and responses  ### Request endpoint All API requests have to be sent to this URL: ``` https://api.printful.com/ ``` If you are using a proxy, make sure that all requests have host header set to **api.printful.com**.  ### Request parameters Some mandatory parameters (like object identifiers) must be included in the request URL path ``` GET /orders/123 ``` Additional parameters can be passed as GET variables: ``` GET /orders?offset=10&limit=5 ``` For POST and PUT requests, a more complex data structure can be passed as JSON encoded data in the request body: ``` POST /orders  {\"recipient\":{...},\"items\":[...]} ```  ### Response body The response body is always a JSON object that contains a response status code (identical to the HTTP status code) and the result of the action. If the status code is 200, then the action was successful. ``` {    \"code\": 200, //Response status code    \"result\":{       //API method return data    //...    } } ```  Sometimes the response includes paging information to allow to browse larger result sets by adding offset and limit GET parameters to the request URL. ``` {    \"code\": 200, //Response status code    \"result\":[     {        //Item 11     },     {        //Item 12     }    ]    \"paging\": {       \"total\": 12,  //Total items available       \"offset\": 10, //Items skipped from the beginning       \"limit\": 20   //Number of items per page    } } ```  ## Error response If the API call is not successful, then the response code is not in the 2xx range and the `result` attribute contains an error description. ``` {     \"code\": 404,     \"result\": \"Not Found\",     \"error\": {         \"reason\": \"NotFound\",         \"message\": \"Not Found\"     } } ```  In general, response codes in the 4xx range indicate an error that resulted from the provided information (e.g. a required parameter was missing, etc.), and codes in the 5xx range indicate an error with Printful's servers.  ### Timestamps All timestamps from the API are returned as integers in UNIX timestamp format.  ### Rate Limits Printful API has a general rate limit of 120 API calls per minute. Additionally, endpoints that perform resource intensive operations (such as mockup generator) have a lower allowed request limit.  # Authentication  <!-- ReDoc-Inject: <security-definitions> -->
+
+The version of the OpenAPI document: 1.0
+Contact: devsupport@printful.com
+Generated by: https://openapi-generator.tech
+OpenAPI Generator version: 7.0.0-SNAPSHOT
+
+=end
+
+require 'spec_helper'
+require 'json'
+require 'date'
+
+# Unit tests for Printful::Shipment
+# Automatically generated by openapi-generator (https://openapi-generator.tech)
+# Please update as you see appropriate
+describe Printful::Shipment do
+  let(:instance) { Printful::Shipment.new }
+
+  describe 'test an instance of Shipment' do
+    it 'should create an instance of Shipment' do
+      expect(instance).to be_instance_of(Printful::Shipment)
+    end
+  end
+  describe 'test attribute "id"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "carrier"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "service"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "tracking_number"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "tracking_url"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "created"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "ship_date"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "shipped_at"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "reshipment"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "items"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+end

data/spec/models/shipping_info_spec.rb

@@ -0,0 +1,76 @@
+=begin
+#API Documentation | Printful
+
+## About the Printful API  The Printful API is a RESTful API, that uses an HTTP protocol for communication. HTTP GET, POST, PUT and DELETE methods are used to access the API resources.  ## Requests and responses  ### Request endpoint All API requests have to be sent to this URL: ``` https://api.printful.com/ ``` If you are using a proxy, make sure that all requests have host header set to **api.printful.com**.  ### Request parameters Some mandatory parameters (like object identifiers) must be included in the request URL path ``` GET /orders/123 ``` Additional parameters can be passed as GET variables: ``` GET /orders?offset=10&limit=5 ``` For POST and PUT requests, a more complex data structure can be passed as JSON encoded data in the request body: ``` POST /orders  {\"recipient\":{...},\"items\":[...]} ```  ### Response body The response body is always a JSON object that contains a response status code (identical to the HTTP status code) and the result of the action. If the status code is 200, then the action was successful. ``` {    \"code\": 200, //Response status code    \"result\":{       //API method return data    //...    } } ```  Sometimes the response includes paging information to allow to browse larger result sets by adding offset and limit GET parameters to the request URL. ``` {    \"code\": 200, //Response status code    \"result\":[     {        //Item 11     },     {        //Item 12     }    ]    \"paging\": {       \"total\": 12,  //Total items available       \"offset\": 10, //Items skipped from the beginning       \"limit\": 20   //Number of items per page    } } ```  ## Error response If the API call is not successful, then the response code is not in the 2xx range and the `result` attribute contains an error description. ``` {     \"code\": 404,     \"result\": \"Not Found\",     \"error\": {         \"reason\": \"NotFound\",         \"message\": \"Not Found\"     } } ```  In general, response codes in the 4xx range indicate an error that resulted from the provided information (e.g. a required parameter was missing, etc.), and codes in the 5xx range indicate an error with Printful's servers.  ### Timestamps All timestamps from the API are returned as integers in UNIX timestamp format.  ### Rate Limits Printful API has a general rate limit of 120 API calls per minute. Additionally, endpoints that perform resource intensive operations (such as mockup generator) have a lower allowed request limit.  # Authentication  <!-- ReDoc-Inject: <security-definitions> -->
+
+The version of the OpenAPI document: 1.0
+Contact: devsupport@printful.com
+Generated by: https://openapi-generator.tech
+OpenAPI Generator version: 7.0.0-SNAPSHOT
+
+=end
+
+require 'spec_helper'
+require 'json'
+require 'date'
+
+# Unit tests for Printful::ShippingInfo
+# Automatically generated by openapi-generator (https://openapi-generator.tech)
+# Please update as you see appropriate
+describe Printful::ShippingInfo do
+  let(:instance) { Printful::ShippingInfo.new }
+
+  describe 'test an instance of ShippingInfo' do
+    it 'should create an instance of ShippingInfo' do
+      expect(instance).to be_instance_of(Printful::ShippingInfo)
+    end
+  end
+  describe 'test attribute "id"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "name"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "rate"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "currency"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "min_delivery_days"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "max_delivery_days"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "min_delivery_date"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "max_delivery_date"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+end

data/spec/models/size_table_spec.rb

@@ -0,0 +1,72 @@
+=begin
+#API Documentation | Printful
+
+## About the Printful API  The Printful API is a RESTful API, that uses an HTTP protocol for communication. HTTP GET, POST, PUT and DELETE methods are used to access the API resources.  ## Requests and responses  ### Request endpoint All API requests have to be sent to this URL: ``` https://api.printful.com/ ``` If you are using a proxy, make sure that all requests have host header set to **api.printful.com**.  ### Request parameters Some mandatory parameters (like object identifiers) must be included in the request URL path ``` GET /orders/123 ``` Additional parameters can be passed as GET variables: ``` GET /orders?offset=10&limit=5 ``` For POST and PUT requests, a more complex data structure can be passed as JSON encoded data in the request body: ``` POST /orders  {\"recipient\":{...},\"items\":[...]} ```  ### Response body The response body is always a JSON object that contains a response status code (identical to the HTTP status code) and the result of the action. If the status code is 200, then the action was successful. ``` {    \"code\": 200, //Response status code    \"result\":{       //API method return data    //...    } } ```  Sometimes the response includes paging information to allow to browse larger result sets by adding offset and limit GET parameters to the request URL. ``` {    \"code\": 200, //Response status code    \"result\":[     {        //Item 11     },     {        //Item 12     }    ]    \"paging\": {       \"total\": 12,  //Total items available       \"offset\": 10, //Items skipped from the beginning       \"limit\": 20   //Number of items per page    } } ```  ## Error response If the API call is not successful, then the response code is not in the 2xx range and the `result` attribute contains an error description. ``` {     \"code\": 404,     \"result\": \"Not Found\",     \"error\": {         \"reason\": \"NotFound\",         \"message\": \"Not Found\"     } } ```  In general, response codes in the 4xx range indicate an error that resulted from the provided information (e.g. a required parameter was missing, etc.), and codes in the 5xx range indicate an error with Printful's servers.  ### Timestamps All timestamps from the API are returned as integers in UNIX timestamp format.  ### Rate Limits Printful API has a general rate limit of 120 API calls per minute. Additionally, endpoints that perform resource intensive operations (such as mockup generator) have a lower allowed request limit.  # Authentication  <!-- ReDoc-Inject: <security-definitions> -->
+
+The version of the OpenAPI document: 1.0
+Contact: devsupport@printful.com
+Generated by: https://openapi-generator.tech
+OpenAPI Generator version: 7.0.0-SNAPSHOT
+
+=end
+
+require 'spec_helper'
+require 'json'
+require 'date'
+
+# Unit tests for Printful::SizeTable
+# Automatically generated by openapi-generator (https://openapi-generator.tech)
+# Please update as you see appropriate
+describe Printful::SizeTable do
+  let(:instance) { Printful::SizeTable.new }
+
+  describe 'test an instance of SizeTable' do
+    it 'should create an instance of SizeTable' do
+      expect(instance).to be_instance_of(Printful::SizeTable)
+    end
+  end
+  describe 'test attribute "type"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+      # validator = Petstore::EnumTest::EnumAttributeValidator.new('String', ["measure_yourself", "product_measure", "international"])
+      # validator.allowable_values.each do |value|
+      #   expect { instance.type = value }.not_to raise_error
+      # end
+    end
+  end
+
+  describe 'test attribute "unit"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+      # validator = Petstore::EnumTest::EnumAttributeValidator.new('String', ["inches", "cm"])
+      # validator.allowable_values.each do |value|
+      #   expect { instance.unit = value }.not_to raise_error
+      # end
+    end
+  end
+
+  describe 'test attribute "description"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "image_url"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "image_description"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "measurements"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+end

data/spec/models/state_spec.rb

@@ -0,0 +1,40 @@
+=begin
+#API Documentation | Printful
+
+## About the Printful API  The Printful API is a RESTful API, that uses an HTTP protocol for communication. HTTP GET, POST, PUT and DELETE methods are used to access the API resources.  ## Requests and responses  ### Request endpoint All API requests have to be sent to this URL: ``` https://api.printful.com/ ``` If you are using a proxy, make sure that all requests have host header set to **api.printful.com**.  ### Request parameters Some mandatory parameters (like object identifiers) must be included in the request URL path ``` GET /orders/123 ``` Additional parameters can be passed as GET variables: ``` GET /orders?offset=10&limit=5 ``` For POST and PUT requests, a more complex data structure can be passed as JSON encoded data in the request body: ``` POST /orders  {\"recipient\":{...},\"items\":[...]} ```  ### Response body The response body is always a JSON object that contains a response status code (identical to the HTTP status code) and the result of the action. If the status code is 200, then the action was successful. ``` {    \"code\": 200, //Response status code    \"result\":{       //API method return data    //...    } } ```  Sometimes the response includes paging information to allow to browse larger result sets by adding offset and limit GET parameters to the request URL. ``` {    \"code\": 200, //Response status code    \"result\":[     {        //Item 11     },     {        //Item 12     }    ]    \"paging\": {       \"total\": 12,  //Total items available       \"offset\": 10, //Items skipped from the beginning       \"limit\": 20   //Number of items per page    } } ```  ## Error response If the API call is not successful, then the response code is not in the 2xx range and the `result` attribute contains an error description. ``` {     \"code\": 404,     \"result\": \"Not Found\",     \"error\": {         \"reason\": \"NotFound\",         \"message\": \"Not Found\"     } } ```  In general, response codes in the 4xx range indicate an error that resulted from the provided information (e.g. a required parameter was missing, etc.), and codes in the 5xx range indicate an error with Printful's servers.  ### Timestamps All timestamps from the API are returned as integers in UNIX timestamp format.  ### Rate Limits Printful API has a general rate limit of 120 API calls per minute. Additionally, endpoints that perform resource intensive operations (such as mockup generator) have a lower allowed request limit.  # Authentication  <!-- ReDoc-Inject: <security-definitions> -->
+
+The version of the OpenAPI document: 1.0
+Contact: devsupport@printful.com
+Generated by: https://openapi-generator.tech
+OpenAPI Generator version: 7.0.0-SNAPSHOT
+
+=end
+
+require 'spec_helper'
+require 'json'
+require 'date'
+
+# Unit tests for Printful::State
+# Automatically generated by openapi-generator (https://openapi-generator.tech)
+# Please update as you see appropriate
+describe Printful::State do
+  let(:instance) { Printful::State.new }
+
+  describe 'test an instance of State' do
+    it 'should create an instance of State' do
+      expect(instance).to be_instance_of(Printful::State)
+    end
+  end
+  describe 'test attribute "code"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+  describe 'test attribute "name"' do
+    it 'should work' do
+      # assertion here. ref: https://rspec.info/features/3-12/rspec-expectations/built-in-matchers/
+    end
+  end
+
+end