calabash-android 0.0.1

data/test-server/instrumentation-backend/src/sh/calaba/org/codehaus/jackson/JsonLocation.java

@@ -0,0 +1,141 @@
+package sh.calaba.org.codehaus.jackson;
+
+import sh.calaba.org.codehaus.jackson.annotate.JsonCreator;
+import sh.calaba.org.codehaus.jackson.annotate.JsonProperty;
+
+/**
+ * Object that encapsulates Location information used for reporting
+ * parsing (or potentially generation) errors, as well as current location
+ * within input streams.
+ */
+public class JsonLocation
+    implements java.io.Serializable // as per [JACKSON-168]
+{
+    private static final long serialVersionUID = 1L;
+
+    /**
+     * Shared immutable "N/A location" that can be returned to indicate
+     * that no location information is available
+     *
+     * @since 1.3
+     */
+    public final static JsonLocation NA = new JsonLocation("N/A", -1L, -1L, -1, -1);
+
+    final long _totalBytes;
+    final long _totalChars;
+
+    final int _lineNr;
+    final int _columnNr;
+
+    /**
+     * Displayable description for input source: file path, url
+     */
+    final Object _sourceRef;
+
+    public JsonLocation(Object srcRef, long totalChars, int lineNr, int colNr)
+    {
+        /* Unfortunately, none of legal encodings are straight single-byte
+         * encodings. Could determine offset for UTF-16/UTF-32, but the
+         * most important one is UTF-8...
+         * so for now, we'll just not report any real byte count
+         */
+        this(srcRef, -1L, totalChars, lineNr, colNr);
+    }
+
+    @JsonCreator
+    public JsonLocation(@JsonProperty("sourceRef") Object sourceRef,
+                        @JsonProperty("byteOffset") long totalBytes,
+                        @JsonProperty("charOffset") long totalChars,
+                        @JsonProperty("lineNr") int lineNr,
+                        @JsonProperty("columnNr") int columnNr)
+    {
+        _sourceRef = sourceRef;
+        _totalBytes = totalBytes;
+        _totalChars = totalChars;
+        _lineNr = lineNr;
+        _columnNr = columnNr;
+    }
+
+    /**
+     * Reference to the original resource being read, if one available.
+     * For example, when a parser has been constructed by passing
+     * a {@link java.io.File} instance, this method would return
+     * that File. Will return null if no such reference is available,
+     * for example when {@link java.io.InputStream} was used to
+     * construct the parser instance.
+     */
+    public Object getSourceRef() { return _sourceRef; }
+
+    /**
+     * @return Line number of the location (1-based)
+     */
+    public int getLineNr() { return _lineNr; }
+
+    /**
+     * @return Column number of the location (1-based)
+     */
+    public int getColumnNr() { return _columnNr; }
+
+    /**
+     * @return Character offset within underlying stream, reader or writer,
+     *   if available; -1 if not.
+     */
+    public long getCharOffset() { return _totalChars; }
+
+    /**
+     * @return Byte offset within underlying stream, reader or writer,
+     *   if available; -1 if not.
+     */
+    public long getByteOffset()
+    {
+        return _totalBytes;
+    }
+
+    @Override
+    public String toString()
+    {
+        StringBuilder sb = new StringBuilder(80);
+        sb.append("[Source: ");
+        if (_sourceRef == null) {
+            sb.append("UNKNOWN");
+        } else {
+            sb.append(_sourceRef.toString());
+        }
+        sb.append("; line: ");
+        sb.append(_lineNr);
+        sb.append(", column: ");
+        sb.append(_columnNr);
+        sb.append(']');
+        return sb.toString();
+    }
+
+    @Override
+    public int hashCode()
+    {
+        int hash = (_sourceRef == null) ? 1 : _sourceRef.hashCode();
+        hash ^= _lineNr;
+        hash += _columnNr;
+        hash ^= (int) _totalChars;
+        hash += (int) _totalBytes;
+        return hash;
+    }
+
+    @Override
+    public boolean equals(Object other)
+    {
+        if (other == this) return true;
+        if (other == null) return false;
+        if (!(other instanceof JsonLocation)) return false;
+        JsonLocation otherLoc = (JsonLocation) other;
+
+        if (_sourceRef == null) {
+            if (otherLoc._sourceRef != null) return false;
+        } else if (!_sourceRef.equals(otherLoc._sourceRef)) return false;
+
+        return (_lineNr == otherLoc._lineNr)
+            && (_columnNr == otherLoc._columnNr)
+            && (_totalChars == otherLoc._totalChars)
+            && (getByteOffset() == otherLoc.getByteOffset())
+            ;
+    }
+}

data/test-server/instrumentation-backend/src/sh/calaba/org/codehaus/jackson/JsonNode.java

@@ -0,0 +1,879 @@
+package sh.calaba.org.codehaus.jackson;
+
+import java.io.IOException;
+import java.math.BigDecimal;
+import java.math.BigInteger;
+import java.util.*;
+
+/**
+ * Base class for all JSON nodes, which form the basis of JSON
+ * Tree Model that Jackson implements.
+ * One way to think of these nodes is to consider them
+ * similar to DOM nodes in XML DOM trees.
+ *<p>
+ * As a general design rule, most accessors ("getters") are included
+ * in this base class, to allow for traversing structure without
+ * type casts. Most mutators, however, need to be accessed through
+ * specific sub-classes (such as <code>sh.calaba.org.codehaus.jackson.node.ObjectNode</code>
+ * and <code>sh.calaba.org.codehaus.jackson.node.ArrayNode</code>).
+ * This seems sensible because proper type
+ * information is generally available when building or modifying
+ * trees, but less often when reading a tree (newly built from
+ * parsed JSON content).
+ *<p>
+ * Actual concrete sub-classes can be found from package
+ * {@link sh.calaba.org.codehaus.jackson.node}, which is in 'mapper' jar
+ * (whereas this class is in 'core' jar, since it is declared as
+ * nominal type for operations in {@link ObjectCodec})
+ */
+public abstract class JsonNode
+    implements Iterable<JsonNode>
+{
+    protected final static List<JsonNode> NO_NODES = Collections.emptyList();
+    protected final static List<String> NO_STRINGS = Collections.emptyList();
+
+    protected JsonNode() { }
+
+    /*
+    /**********************************************************
+    /* Public API, type introspection
+    /**********************************************************
+     */
+
+    // // First high-level division between values, containers and "missing"
+
+    /**
+     * Method that returns true for all value nodes: ones that 
+     * are not containers, and that do not represent "missing" nodes
+     * in the path. Such value nodes represent String, Number, Boolean
+     * and null values from JSON.
+     *<p>
+     * Note: one and only one of methods {@link #isValueNode},
+     * {@link #isContainerNode} and {@link #isMissingNode} ever
+     * returns true for any given node.
+     */
+    public boolean isValueNode() { return false; }
+
+    /**
+     * Method that returns true for container nodes: Arrays and Objects.
+     *<p>
+     * Note: one and only one of methods {@link #isValueNode},
+     * {@link #isContainerNode} and {@link #isMissingNode} ever
+     * returns true for any given node.
+     */
+    public boolean isContainerNode() { return false; }
+
+    /**
+     * Method that returns true for "virtual" nodes which represent
+     * missing entries constructed by path accessor methods when
+     * there is no actual node matching given criteria.
+     *<p>
+     * Note: one and only one of methods {@link #isValueNode},
+     * {@link #isContainerNode} and {@link #isMissingNode} ever
+     * returns true for any given node.
+     */
+    public boolean isMissingNode() { return false; }
+
+    // // Then more specific type introspection
+    // // (along with defaults to be overridden)
+
+    /**
+     * @return True if this node represents Json Array
+     */
+    public boolean isArray() { return false; }
+
+    /**
+     * @return True if this node represents Json Object
+     */
+    public boolean isObject() { return false; }
+
+    /**
+     * Method that can be used to check if the node is a wrapper
+     * for a POJO ("Plain Old Java Object" aka "bean".
+     * Returns true only for
+     * instances of {@link sh.calaba.org.codehaus.jackson.node.POJONode}.
+     *
+     * @return True if this node wraps a POJO
+     */
+    public boolean isPojo() { return false; }
+
+    /**
+     * @return True if this node represents a numeric Json
+     *   value
+     */
+    public boolean isNumber() { return false; }
+
+    /**
+     * @return True if this node represents an integral (integer)
+     *   numeric Json value
+     */
+    public boolean isIntegralNumber() { return false; }
+
+    /**
+     * @return True if this node represents a non-integral
+     *   numeric Json value
+     */
+    public boolean isFloatingPointNumber() { return false; }
+
+    /**
+     * @return True if this node represents an integral
+     *   numeric Json value that withs in Java int value space
+     */
+    public boolean isInt() { return false; }
+
+    /**
+     * @return True if this node represents an integral
+     *   numeric Json value that fits in Java long value space
+     *   (but not int value space, i.e. {@link #isInt} returns false)
+     */
+    public boolean isLong() { return false; }
+
+    public boolean isDouble() { return false; }
+    public boolean isBigDecimal() { return false; }
+    public boolean isBigInteger() { return false; }
+
+    public boolean isTextual() { return false; }
+
+    /**
+     * Method that can be used to check if this node was created from
+     * Json boolean value (literals "true" and "false").
+     */
+    public boolean isBoolean() { return false; }
+
+    /**
+     * Method that can be used to check if this node was created from
+     * Json liternal null value.
+     */
+    public boolean isNull() { return false; }
+
+    /**
+     * Method that can be used to check if this node represents
+     * binary data (Base64 encoded). Although this will be externally
+     * written as Json String value, {@link #isTextual} will
+     * return false if this method returns true.
+     *
+     * @return True if this node represents base64 encoded binary data
+     */
+    public boolean isBinary() { return false; }
+
+    /**
+     * Method that can be used for efficient type detection
+     * when using stream abstraction for traversing nodes.
+     * Will return the first {@link JsonToken} that equivalent
+     * stream event would produce (for most nodes there is just
+     * one token but for structured/container types multiple)
+     *
+     * @since 1.3
+     */
+    public abstract JsonToken asToken();
+
+    /**
+     * If this node is a numeric type (as per {@link #isNumber}),
+     * returns native type that node uses to store the numeric
+     * value.
+     */
+    public abstract JsonParser.NumberType getNumberType();
+
+    /*
+    /**********************************************************
+    /* Public API, straight value access
+    /**********************************************************
+     */
+
+    /**
+     * Method to use for accessing String values.
+     * Does <b>NOT</b> do any conversions for non-String value nodes;
+     * for non-String values (ones for which {@link #isTextual} returns
+     * false) null will be returned.
+     * For String values, null is never returned (but empty Strings may be)
+     *
+     * @return Textual value this node contains, iff it is a textual
+     *   json node (comes from Json String value entry)
+     */
+    public String getTextValue() { return null; }
+
+    /**
+     * Method to use for accessing binary content of binary nodes (nodes
+     * for which {@link #isBinary} returns true); or for Text Nodes
+     * (ones for which {@link #getTextValue} returns non-null value),
+     * to read decoded base64 data.
+     * For other types of nodes, returns null.
+     *
+     * @return Binary data this node contains, iff it is a binary
+     *   node; null otherwise
+     */
+    public byte[] getBinaryValue() throws IOException
+    {
+        return null;
+    }
+
+    /**
+     * Method to use for accessing JSON boolean values (value
+     * literals 'true' and 'false').
+     * For other types, always returns false.
+     *
+     * @return Textual value this node contains, iff it is a textual
+     *   json node (comes from Json String value entry)
+     */
+    public boolean getBooleanValue() { return false; }
+
+    /**
+     * Returns numeric value for this node, <b>if and only if</b>
+     * this node is numeric ({@link #isNumber} returns true); otherwise
+     * returns null
+     *
+     * @return Number value this node contains, if any (null for non-number
+     *   nodes).
+     */
+    public Number getNumberValue() { return null; }
+
+    /**
+     * Returns integer value for this node, <b>if and only if</b>
+     * this node is numeric ({@link #isNumber} returns true). For other
+     * types returns 0.
+     * For floating-point numbers, value is truncated using default
+     * Java coercion, similar to how cast from double to int operates.
+     *
+     * @return Integer value this node contains, if any; 0 for non-number
+     *   nodes.
+     */
+    public int getIntValue() { return 0; }
+
+    public long getLongValue() { return 0L; }
+    public double getDoubleValue() { return 0.0; }
+    public BigDecimal getDecimalValue() { return BigDecimal.ZERO; }
+    public BigInteger getBigIntegerValue() { return BigInteger.ZERO; }
+
+    /**
+     * Method for accessing value of the specified element of
+     * an array node. For other nodes, null is always returned.
+     *<p>
+     * For array nodes, index specifies
+     * exact location within array and allows for efficient iteration
+     * over child elements (underlying storage is guaranteed to
+     * be efficiently indexable, i.e. has random-access to elements).
+     * If index is less than 0, or equal-or-greater than
+     * <code>node.size()</code>, null is returned; no exception is
+     * thrown for any index.
+     *
+     * @return Node that represent value of the specified element,
+     *   if this node is an array and has specified element.
+     *   Null otherwise.
+     */
+    public JsonNode get(int index) { return null; }
+
+    /**
+     * Method for accessing value of the specified field of
+     * an object node. If this node is not an object (or it
+     * does not have a value for specified field name), or
+     * if there is no field with such name, null is returned.
+     *
+     * @return Node that represent value of the specified field,
+     *   if this node is an object and has value for the specified
+     *   field. Null otherwise.
+     */
+    public JsonNode get(String fieldName) { return null; }
+    
+    /*
+    /**********************************************************
+    /* Public API, value access with conversion(s)/coercion(s)
+    /**********************************************************
+     */
+
+    /**
+     * Method that will return valid String representation of
+     * the container value, if the node is a value node
+     * (method {@link #isValueNode} returns true), otherwise
+     * empty String.
+     * 
+     * @since 1.9 (replaces <code>getValueAsText</code>)
+     */
+    public abstract String asText();
+
+    /**
+     * Method that will try to convert value of this node to a Java <b>int</b>.
+     * Numbers are coerced using default Java rules; booleans convert to 0 (false)
+     * and 1 (true), and Strings are parsed using default Java language integer
+     * parsing rules.
+     *<p>
+     * If representation can not be converted to an int (including structured types
+     * like Objects and Arrays),
+     * default value of <b>0</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.9 (replaces <code>getValueAsInt</code>)
+     */
+    public int asInt() {
+        return asInt(0);
+    }
+    
+    /**
+     * Method that will try to convert value of this node to a Java <b>int</b>.
+     * Numbers are coerced using default Java rules; booleans convert to 0 (false)
+     * and 1 (true), and Strings are parsed using default Java language integer
+     * parsing rules.
+     *<p>
+     * If representation can not be converted to an int (including structured types
+     * like Objects and Arrays),
+     * specified <b>defaultValue</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.9 (replaces <code>getValueAsInt</code>)
+     */
+    public int asInt(int defaultValue) {
+        return defaultValue;
+    }
+
+    /**
+     * Method that will try to convert value of this node to a Java <b>long</b>.
+     * Numbers are coerced using default Java rules; booleans convert to 0 (false)
+     * and 1 (true), and Strings are parsed using default Java language integer
+     * parsing rules.
+     *<p>
+     * If representation can not be converted to an long (including structured types
+     * like Objects and Arrays),
+     * default value of <b>0</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.9 (replaces <code>getValueAsLong</code>)
+     */
+    public long asLong() {
+        return asLong(0L);
+    }
+    
+    /**
+     * Method that will try to convert value of this node to a Java <b>long</b>.
+     * Numbers are coerced using default Java rules; booleans convert to 0 (false)
+     * and 1 (true), and Strings are parsed using default Java language integer
+     * parsing rules.
+     *<p>
+     * If representation can not be converted to an long (including structured types
+     * like Objects and Arrays),
+     * specified <b>defaultValue</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.9 (replaces <code>getValueAsLong</code>)
+     */
+    public long asLong(long defaultValue) {
+        return defaultValue;
+    }
+    
+    /**
+     * Method that will try to convert value of this node to a Java <b>double</b>.
+     * Numbers are coerced using default Java rules; booleans convert to 0.0 (false)
+     * and 1.0 (true), and Strings are parsed using default Java language integer
+     * parsing rules.
+     *<p>
+     * If representation can not be converted to an int (including structured types
+     * like Objects and Arrays),
+     * default value of <b>0.0</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.9 (replaces <code>getValueAsDouble</code>)
+     */
+    public double asDouble() {
+        return asDouble(0.0);
+    }
+    
+    /**
+     * Method that will try to convert value of this node to a Java <b>double</b>.
+     * Numbers are coerced using default Java rules; booleans convert to 0.0 (false)
+     * and 1.0 (true), and Strings are parsed using default Java language integer
+     * parsing rules.
+     *<p>
+     * If representation can not be converted to an int (including structured types
+     * like Objects and Arrays),
+     * specified <b>defaultValue</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.9 (replaces <code>getValueAsLong</code>)
+     */
+    public double asDouble(double defaultValue) {
+        return defaultValue;
+    }
+
+    /**
+     * Method that will try to convert value of this node to a Java <b>boolean</b>.
+     * JSON booleans map naturally; integer numbers other than 0 map to true, and
+     * 0 maps to false
+     * and Strings 'true' and 'false' map to corresponding values.
+     *<p>
+     * If representation can not be converted to a boolean value (including structured types
+     * like Objects and Arrays),
+     * default value of <b>false</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.9 (replaces <code>getValueAsBoolean</code>)
+     */
+    public boolean asBoolean() {
+        return asBoolean(false);
+    }
+    
+    /**
+     * Method that will try to convert value of this node to a Java <b>boolean</b>.
+     * JSON booleans map naturally; integer numbers other than 0 map to true, and
+     * 0 maps to false
+     * and Strings 'true' and 'false' map to corresponding values.
+     *<p>
+     * If representation can not be converted to a boolean value (including structured types
+     * like Objects and Arrays),
+     * specified <b>defaultValue</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.9 (replaces <code>getValueAsBoolean</code>)
+     */
+    public boolean asBoolean(boolean defaultValue) {
+        return defaultValue;
+    }
+    
+    /*
+    /**********************************************************
+    /* Public API, value access with conversion(s)/coercion(s)
+    /**********************************************************
+     */
+    
+    /**
+     * Method that will return valid String representation of
+     * the container value, if the node is a value node
+     * (method {@link #isValueNode} returns true), otherwise null.
+     *<p>
+     * Note: to serialize nodes of any type, you should call
+     * {@link #toString} instead.
+     * 
+     * @deprecated Since 1.9, use {@link #asText} instead
+     */
+    @Deprecated
+    public String getValueAsText() { return asText(); }
+
+    /**
+     * Method that will try to convert value of this node to a Java <b>int</b>.
+     * Numbers are coerced using default Java rules; booleans convert to 0 (false)
+     * and 1 (true), and Strings are parsed using default Java language integer
+     * parsing rules.
+     *<p>
+     * If representation can not be converted to an int (including structured types
+     * like Objects and Arrays),
+     * default value of <b>0</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.6
+     * 
+     * @deprecated Since 1.9, use {@link #asInt} instead
+     */
+    @Deprecated
+    public int getValueAsInt() { return asInt(0); }
+    
+    /**
+     * Method that will try to convert value of this node to a Java <b>int</b>.
+     * Numbers are coerced using default Java rules; booleans convert to 0 (false)
+     * and 1 (true), and Strings are parsed using default Java language integer
+     * parsing rules.
+     *<p>
+     * If representation can not be converted to an int (including structured types
+     * like Objects and Arrays),
+     * specified <b>defaultValue</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.6
+     * 
+     * @deprecated Since 1.9, use {@link #asInt} instead
+     */
+    @Deprecated
+    public int getValueAsInt(int defaultValue) { return asInt(defaultValue); }
+
+    /**
+     * Method that will try to convert value of this node to a Java <b>long</b>.
+     * Numbers are coerced using default Java rules; booleans convert to 0 (false)
+     * and 1 (true), and Strings are parsed using default Java language integer
+     * parsing rules.
+     *<p>
+     * If representation can not be converted to an long (including structured types
+     * like Objects and Arrays),
+     * default value of <b>0</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.6
+     * 
+     * @deprecated Since 1.9, use {@link #asLong} instead
+     */
+    @Deprecated
+    public long getValueAsLong() { return asLong(0L); }
+    
+    /**
+     * Method that will try to convert value of this node to a Java <b>long</b>.
+     * Numbers are coerced using default Java rules; booleans convert to 0 (false)
+     * and 1 (true), and Strings are parsed using default Java language integer
+     * parsing rules.
+     *<p>
+     * If representation can not be converted to an long (including structured types
+     * like Objects and Arrays),
+     * specified <b>defaultValue</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.6
+     * 
+     * @deprecated Since 1.9, use {@link #asLong} instead
+     */
+    @Deprecated
+    public long getValueAsLong(long defaultValue) { return asLong(defaultValue); }
+    
+    /**
+     * Method that will try to convert value of this node to a Java <b>double</b>.
+     * Numbers are coerced using default Java rules; booleans convert to 0.0 (false)
+     * and 1.0 (true), and Strings are parsed using default Java language integer
+     * parsing rules.
+     *<p>
+     * If representation can not be converted to an int (including structured types
+     * like Objects and Arrays),
+     * default value of <b>0.0</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.6
+     * 
+     * @deprecated Since 1.9, use {@link #asDouble} instead
+     */
+    @Deprecated
+    public double getValueAsDouble() { return asDouble(0.0); }
+    
+    /**
+     * Method that will try to convert value of this node to a Java <b>double</b>.
+     * Numbers are coerced using default Java rules; booleans convert to 0.0 (false)
+     * and 1.0 (true), and Strings are parsed using default Java language integer
+     * parsing rules.
+     *<p>
+     * If representation can not be converted to an int (including structured types
+     * like Objects and Arrays),
+     * specified <b>defaultValue</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.6
+     * 
+     * @deprecated Since 1.9, use {@link #asDouble} instead
+     */
+    @Deprecated
+    public double getValueAsDouble(double defaultValue) { return asDouble(defaultValue); }
+
+    /**
+     * Method that will try to convert value of this node to a Java <b>boolean</b>.
+     * JSON booleans map naturally; integer numbers other than 0 map to true, and
+     * 0 maps to false
+     * and Strings 'true' and 'false' map to corresponding values.
+     *<p>
+     * If representation can not be converted to a boolean value (including structured types
+     * like Objects and Arrays),
+     * default value of <b>false</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.7
+     * 
+     * @deprecated Since 1.9, use {@link #asBoolean} instead
+     */
+    @Deprecated
+    public boolean getValueAsBoolean() { return asBoolean(false); }
+    
+    /**
+     * Method that will try to convert value of this node to a Java <b>boolean</b>.
+     * JSON booleans map naturally; integer numbers other than 0 map to true, and
+     * 0 maps to false
+     * and Strings 'true' and 'false' map to corresponding values.
+     *<p>
+     * If representation can not be converted to a boolean value (including structured types
+     * like Objects and Arrays),
+     * specified <b>defaultValue</b> will be returned; no exceptions are thrown.
+     * 
+     * @since 1.7
+     * 
+     * @deprecated Since 1.9, use {@link #asBoolean} instead
+     */
+    @Deprecated
+    public boolean getValueAsBoolean(boolean defaultValue) { return asBoolean(defaultValue); }
+    
+    /*
+    /**********************************************************
+    /* Public API, value find / existence check methods
+    /**********************************************************
+     */
+    
+    /**
+     * Method that allows checking whether this node is JSON Object node
+     * and contains value for specified property. If this is the case
+     * (including properties with explicit null values), returns true;
+     * otherwise returns false.
+     *<p>
+     * This method is equivalent to:
+     *<pre>
+     *   node.get(fieldName) != null
+     *</pre>
+     * (since return value of get() is node, not value node contains)
+     *
+     * @param fieldName Name of element to check
+     * 
+     * @return True if this node is a JSON Object node, and has a property
+     *   entry with specified name (with any value, including null value)
+     *   
+     * @since 1.6
+     */
+    public boolean has(String fieldName) {
+        return get(fieldName) != null;
+    }
+
+    /**
+     * Method that allows checking whether this node is JSON Array node
+     * and contains a value for specified index
+     * If this is the case
+     * (including case of specified indexing having null as value), returns true;
+     * otherwise returns false.
+     *<p>
+     * Note: array element indexes are 0-based.
+     *<p>
+     * This method is equivalent to:
+     *<pre>
+     *   node.get(index) != null
+     *</pre>
+     *
+     * @param index Index to check
+     * 
+     * @return True if this node is a JSON Object node, and has a property
+     *   entry with specified name (with any value, including null value)
+     *   
+     * @since 1.6
+     */
+    public boolean has(int index) {
+        return get(index) != null;
+    }
+
+    /**
+     * Method for finding a JSON Object field with specified name in this
+     * node or its child nodes, and returning value it has.
+     * If no matching field is found in this node or its descendants, returns null.
+     * 
+     * @param fieldName Name of field to look for
+     * 
+     * @return Value of first matching node found, if any; null if none
+     * 
+     * @since 1.6
+     */
+    public abstract JsonNode findValue(String fieldName);
+
+    /**
+     * Method for finding JSON Object fields with specified name, and returning
+     * found ones as a List. Note that sub-tree search ends if a field is found,
+     * so possible children of result nodes are <b>not</b> included.
+     * If no matching fields are found in this node or its descendants, returns
+     * an empty List.
+     * 
+     * @param fieldName Name of field to look for
+     * 
+     * @since 1.6
+     */
+    public final List<JsonNode> findValues(String fieldName)
+    {
+        List<JsonNode> result = findValues(fieldName, null);
+        if (result == null) {
+            return Collections.emptyList();
+        }
+        return result;
+    }
+
+    /**
+     * Similar to {@link #findValues}, but will additionally convert
+     * values into Strings, calling {@link #getValueAsText}.
+     * 
+     * @since 1.6
+     */
+    public final List<String> findValuesAsText(String fieldName)
+    {
+        List<String> result = findValuesAsText(fieldName, null);
+        if (result == null) {
+            return Collections.emptyList();
+        }
+        return result;
+    }
+    
+    /**
+     * Method similar to {@link #findValue}, but that will return a
+     * "missing node" instead of null if no field is found. Missing node
+     * is a specific kind of node for which {@link #isMissingNode}
+     * returns true; and all value access methods return empty or
+     * missing value.
+     * 
+     * @param fieldName Name of field to look for
+     * 
+     * @return Value of first matching node found; or if not found, a
+     *    "missing node" (non-null instance that has no value)
+     * 
+     * @since 1.6
+     */
+    public abstract JsonNode findPath(String fieldName);
+    
+    /**
+     * Method for finding a JSON Object that contains specified field,
+     * within this node or its descendants.
+     * If no matching field is found in this node or its descendants, returns null.
+     * 
+     * @param fieldName Name of field to look for
+     * 
+     * @return Value of first matching node found, if any; null if none
+     * 
+     * @since 1.6
+     */
+    public abstract JsonNode findParent(String fieldName);
+
+    /**
+     * Method for finding a JSON Object that contains specified field,
+     * within this node or its descendants.
+     * If no matching field is found in this node or its descendants, returns null.
+     * 
+     * @param fieldName Name of field to look for
+     * 
+     * @return Value of first matching node found, if any; null if none
+     * 
+     * @since 1.6
+     */
+    public final List<JsonNode> findParents(String fieldName)
+    {
+        List<JsonNode> result = findParents(fieldName, null);
+        if (result == null) {
+            return Collections.emptyList();
+        }
+        return result;
+    }
+
+    public abstract List<JsonNode> findValues(String fieldName, List<JsonNode> foundSoFar);
+    public abstract List<String> findValuesAsText(String fieldName, List<String> foundSoFar);
+    public abstract List<JsonNode> findParents(String fieldName, List<JsonNode> foundSoFar);
+
+    /*
+    /**********************************************************
+    /* Public API, container access
+    /**********************************************************
+     */
+
+    /**
+     * Method that returns number of child nodes this node contains:
+     * for Array nodes, number of child elements, for Object nodes,
+     * number of fields, and for all other nodes 0.
+     *
+     * @return For non-container nodes returns 0; for arrays number of
+     *   contained elements, and for objects number of fields.
+     */
+    public int size() { return 0; }
+
+    /**
+     * Same as calling {@link #getElements}; implemented so that
+     * convenience "for-each" loop can be used for looping over elements
+     * of JSON Array constructs.
+     */
+    @Override
+    public final Iterator<JsonNode> iterator() { return getElements(); }
+
+    /**
+     * Method for accessing all value nodes of this Node, iff
+     * this node is a JSON Array or Object node. In case of Object node,
+     * field names (keys) are not included, only values.
+     * For other types of nodes, returns empty iterator.
+     */
+    public Iterator<JsonNode> getElements() { return NO_NODES.iterator(); }
+
+    /**
+     * Method for accessing names of all fields for this Node, iff
+     * this node is a JSON Object node.
+     */
+    public Iterator<String> getFieldNames() { return NO_STRINGS.iterator(); }
+
+    /**
+     * @return Iterator that can be used to traverse all key/value pairs for
+     *   object nodes; empty iterator (no contents) for other types
+     * 
+     * @since 1.8 (although existed in ObjectNode since 1.0 or so)
+     */
+    public Iterator<Map.Entry<String, JsonNode>> getFields() {
+        Collection<Map.Entry<String, JsonNode>> coll = Collections.emptyList();
+        return coll.iterator();
+    }
+    
+    /*
+    /**********************************************************
+    /* Public API, path handling
+    /**********************************************************
+     */
+
+    /**
+     * This method is similar to {@link #get(String)}, except
+     * that instead of returning null if no such value exists (due
+     * to this node not being an object, or object not having value
+     * for the specified field),
+     * a "missing node" (node that returns true for
+     * {@link #isMissingNode}) will be returned. This allows for
+     * convenient and safe chained access via path calls.
+     */
+    public abstract JsonNode path(String fieldName);
+
+    /**
+     * Alias of {@link #path(String)}.
+     *
+     * @deprecated Use {@link #path(String)} instead
+     */
+    @Deprecated
+    public final JsonNode getPath(String fieldName) { return path(fieldName); }
+
+    /**
+     * This method is similar to {@link #get(int)}, except
+     * that instead of returning null if no such element exists (due
+     * to index being out of range, or this node not being an array),
+     * a "missing node" (node that returns true for
+     * {@link #isMissingNode}) will be returned. This allows for
+     * convenient and safe chained access via path calls.
+     */
+    public abstract JsonNode path(int index);
+
+    /**
+     * Alias of {@link #path(int)}.
+     *
+     * @deprecated Use {@link #path(int)} instead
+     */
+    @Deprecated
+    public final JsonNode getPath(int index) { return path(index); }
+
+    /**
+     * Method that can be called on object nodes, to access a property
+     * that has object value; or if no such property exists, to create and
+     * return such object node.
+     * If node method is called on is not Object node,
+     * or if property exists and has value that is not object node,
+     * {@link UnsupportedOperationException} is thrown
+     * 
+     * @since 1.8
+     */
+    public JsonNode with(String propertyName) {
+        throw new UnsupportedOperationException("JsonNode not of type ObjectNode (but "
+                +getClass().getName()+"), can not call with() on it");
+    }
+
+    /*
+    /**********************************************************
+    /* Public API: converting to/from Streaming API
+    /**********************************************************
+     */
+
+    /**
+     * Method for constructing a {@link JsonParser} instance for
+     * iterating over contents of the tree that this
+     * node is root of.
+     * Functionally equivalent to first serializing tree using
+     * {@link ObjectCodec} and then re-parsing but
+     * more efficient.
+     */
+    public abstract JsonParser traverse();
+
+    /*
+    /**********************************************************
+    /* Overridden standard methods
+    /**********************************************************
+     */
+    
+    /**
+     *<p>
+     * Note: marked as abstract to ensure all implementation
+     * classes define it properly.
+     */
+    @Override
+    public abstract String toString();
+
+    /**
+     * Equality for node objects is defined as full (deep) value
+     * equality. This means that it is possible to compare complete
+     * JSON trees for equality by comparing equality of root nodes.
+     *<p>
+     * Note: marked as abstract to ensure all implementation
+     * classes define it properly and not rely on definition
+     * from {@link java.lang.Object}.
+     */
+    @Override
+    public abstract boolean equals(Object o);
+}