claude-mpm 3.7.8__py3-none-any.whl → 3.9.0__py3-none-any.whl
This diff represents the content of publicly available package versions that have been released to one of the supported registries. The information contained in this diff is provided for informational purposes only and reflects changes between package versions as they appear in their respective public registries.
- claude_mpm/VERSION +1 -1
- claude_mpm/agents/BASE_PM.md +0 -106
- claude_mpm/agents/INSTRUCTIONS.md +0 -96
- claude_mpm/agents/MEMORY.md +94 -0
- claude_mpm/agents/WORKFLOW.md +86 -0
- claude_mpm/agents/templates/code_analyzer.json +2 -2
- claude_mpm/agents/templates/data_engineer.json +1 -1
- claude_mpm/agents/templates/documentation.json +1 -1
- claude_mpm/agents/templates/engineer.json +1 -1
- claude_mpm/agents/templates/ops.json +1 -1
- claude_mpm/agents/templates/qa.json +1 -1
- claude_mpm/agents/templates/research.json +1 -1
- claude_mpm/agents/templates/security.json +1 -1
- claude_mpm/agents/templates/ticketing.json +3 -8
- claude_mpm/agents/templates/version_control.json +1 -1
- claude_mpm/agents/templates/web_qa.json +2 -2
- claude_mpm/agents/templates/web_ui.json +2 -2
- claude_mpm/cli/__init__.py +2 -2
- claude_mpm/cli/commands/__init__.py +2 -1
- claude_mpm/cli/commands/agents.py +8 -3
- claude_mpm/cli/commands/tickets.py +596 -19
- claude_mpm/cli/parser.py +217 -5
- claude_mpm/config/__init__.py +30 -39
- claude_mpm/config/socketio_config.py +8 -5
- claude_mpm/constants.py +13 -0
- claude_mpm/core/__init__.py +8 -18
- claude_mpm/core/cache.py +596 -0
- claude_mpm/core/claude_runner.py +166 -622
- claude_mpm/core/config.py +7 -3
- claude_mpm/core/constants.py +339 -0
- claude_mpm/core/container.py +548 -38
- claude_mpm/core/exceptions.py +392 -0
- claude_mpm/core/framework_loader.py +249 -93
- claude_mpm/core/interactive_session.py +479 -0
- claude_mpm/core/interfaces.py +424 -0
- claude_mpm/core/lazy.py +467 -0
- claude_mpm/core/logging_config.py +444 -0
- claude_mpm/core/oneshot_session.py +465 -0
- claude_mpm/core/optimized_agent_loader.py +485 -0
- claude_mpm/core/optimized_startup.py +490 -0
- claude_mpm/core/service_registry.py +52 -26
- claude_mpm/core/socketio_pool.py +162 -5
- claude_mpm/core/types.py +292 -0
- claude_mpm/core/typing_utils.py +477 -0
- claude_mpm/hooks/claude_hooks/hook_handler.py +213 -99
- claude_mpm/init.py +2 -1
- claude_mpm/services/__init__.py +78 -14
- claude_mpm/services/agent/__init__.py +24 -0
- claude_mpm/services/agent/deployment.py +2548 -0
- claude_mpm/services/agent/management.py +598 -0
- claude_mpm/services/agent/registry.py +813 -0
- claude_mpm/services/agents/deployment/agent_deployment.py +728 -308
- claude_mpm/services/agents/memory/agent_memory_manager.py +160 -4
- claude_mpm/services/async_session_logger.py +8 -3
- claude_mpm/services/communication/__init__.py +21 -0
- claude_mpm/services/communication/socketio.py +1933 -0
- claude_mpm/services/communication/websocket.py +479 -0
- claude_mpm/services/core/__init__.py +123 -0
- claude_mpm/services/core/base.py +247 -0
- claude_mpm/services/core/interfaces.py +951 -0
- claude_mpm/services/framework_claude_md_generator/__init__.py +10 -3
- claude_mpm/services/framework_claude_md_generator/deployment_manager.py +14 -11
- claude_mpm/services/framework_claude_md_generator/section_generators/todo_task_tools.py +23 -23
- claude_mpm/services/framework_claude_md_generator.py +3 -2
- claude_mpm/services/health_monitor.py +4 -3
- claude_mpm/services/hook_service.py +64 -4
- claude_mpm/services/infrastructure/__init__.py +21 -0
- claude_mpm/services/infrastructure/logging.py +202 -0
- claude_mpm/services/infrastructure/monitoring.py +893 -0
- claude_mpm/services/memory/indexed_memory.py +648 -0
- claude_mpm/services/project/__init__.py +21 -0
- claude_mpm/services/project/analyzer.py +864 -0
- claude_mpm/services/project/registry.py +608 -0
- claude_mpm/services/project_analyzer.py +95 -2
- claude_mpm/services/recovery_manager.py +15 -9
- claude_mpm/services/response_tracker.py +3 -5
- claude_mpm/services/socketio/__init__.py +25 -0
- claude_mpm/services/socketio/handlers/__init__.py +25 -0
- claude_mpm/services/socketio/handlers/base.py +121 -0
- claude_mpm/services/socketio/handlers/connection.py +198 -0
- claude_mpm/services/socketio/handlers/file.py +213 -0
- claude_mpm/services/socketio/handlers/git.py +723 -0
- claude_mpm/services/socketio/handlers/memory.py +27 -0
- claude_mpm/services/socketio/handlers/project.py +25 -0
- claude_mpm/services/socketio/handlers/registry.py +145 -0
- claude_mpm/services/socketio_client_manager.py +12 -7
- claude_mpm/services/socketio_server.py +156 -30
- claude_mpm/services/ticket_manager.py +172 -9
- claude_mpm/services/ticket_manager_di.py +1 -1
- claude_mpm/services/version_control/semantic_versioning.py +80 -7
- claude_mpm/services/version_control/version_parser.py +528 -0
- claude_mpm/utils/error_handler.py +1 -1
- claude_mpm/validation/agent_validator.py +27 -14
- claude_mpm/validation/frontmatter_validator.py +231 -0
- {claude_mpm-3.7.8.dist-info → claude_mpm-3.9.0.dist-info}/METADATA +38 -128
- {claude_mpm-3.7.8.dist-info → claude_mpm-3.9.0.dist-info}/RECORD +100 -59
- {claude_mpm-3.7.8.dist-info → claude_mpm-3.9.0.dist-info}/WHEEL +0 -0
- {claude_mpm-3.7.8.dist-info → claude_mpm-3.9.0.dist-info}/entry_points.txt +0 -0
- {claude_mpm-3.7.8.dist-info → claude_mpm-3.9.0.dist-info}/licenses/LICENSE +0 -0
- {claude_mpm-3.7.8.dist-info → claude_mpm-3.9.0.dist-info}/top_level.txt +0 -0
| @@ -0,0 +1,477 @@ | |
| 1 | 
            +
            """Type definitions and utilities for Claude MPM.
         | 
| 2 | 
            +
             | 
| 3 | 
            +
            This module provides common type aliases, protocols, and TypedDict definitions
         | 
| 4 | 
            +
            used throughout the codebase to ensure consistent type safety.
         | 
| 5 | 
            +
             | 
| 6 | 
            +
            WHY: Centralizing type definitions reduces duplication, improves IDE support,
         | 
| 7 | 
            +
            and makes the codebase more maintainable by providing a single source of truth
         | 
| 8 | 
            +
            for complex type definitions.
         | 
| 9 | 
            +
             | 
| 10 | 
            +
            DESIGN DECISION: Uses protocols and TypedDict to provide structural typing
         | 
| 11 | 
            +
            that allows for more flexible and maintainable type checking while maintaining
         | 
| 12 | 
            +
            strict type safety.
         | 
| 13 | 
            +
            """
         | 
| 14 | 
            +
             | 
| 15 | 
            +
            from typing import (
         | 
| 16 | 
            +
                Any, Callable, Dict, List, Optional, Union, TypeVar, Protocol,
         | 
| 17 | 
            +
                TYPE_CHECKING, Literal, Tuple, Set, Awaitable, Iterator, AsyncIterator
         | 
| 18 | 
            +
            )
         | 
| 19 | 
            +
            from typing_extensions import TypedDict, NotRequired, TypeAlias
         | 
| 20 | 
            +
            from pathlib import Path
         | 
| 21 | 
            +
            from datetime import datetime
         | 
| 22 | 
            +
            from enum import Enum
         | 
| 23 | 
            +
            import logging
         | 
| 24 | 
            +
             | 
| 25 | 
            +
            if TYPE_CHECKING:
         | 
| 26 | 
            +
                from claude_mpm.core.claude_runner import ClaudeRunner
         | 
| 27 | 
            +
                from claude_mpm.services.socketio_server import SocketIOClientProxy
         | 
| 28 | 
            +
             | 
| 29 | 
            +
             | 
| 30 | 
            +
            # Generic type variables
         | 
| 31 | 
            +
            T = TypeVar('T')
         | 
| 32 | 
            +
            TSession = TypeVar('TSession')  # Generic session type
         | 
| 33 | 
            +
            TAgent = TypeVar('TAgent')  # Generic agent type
         | 
| 34 | 
            +
            TService = TypeVar('TService')  # Generic service type
         | 
| 35 | 
            +
             | 
| 36 | 
            +
            # Basic type aliases
         | 
| 37 | 
            +
            PathLike: TypeAlias = Union[str, Path]
         | 
| 38 | 
            +
            JSONValue: TypeAlias = Union[str, int, float, bool, None, Dict[str, Any], List[Any]]
         | 
| 39 | 
            +
            JSONDict: TypeAlias = Dict[str, JSONValue]
         | 
| 40 | 
            +
            Headers: TypeAlias = Dict[str, str]
         | 
| 41 | 
            +
            ErrorCode: TypeAlias = Union[int, str]
         | 
| 42 | 
            +
            LogLevel: TypeAlias = Literal["DEBUG", "INFO", "WARNING", "ERROR", "CRITICAL"]
         | 
| 43 | 
            +
             | 
| 44 | 
            +
            # Session types
         | 
| 45 | 
            +
            SessionId: TypeAlias = str
         | 
| 46 | 
            +
            SessionStatus: TypeAlias = Literal["initializing", "running", "stopped", "error", "completed"]
         | 
| 47 | 
            +
            LaunchMethod: TypeAlias = Literal["exec", "subprocess", "oneshot"]
         | 
| 48 | 
            +
             | 
| 49 | 
            +
             | 
| 50 | 
            +
            class SessionConfig(TypedDict):
         | 
| 51 | 
            +
                """Configuration for a Claude session."""
         | 
| 52 | 
            +
                session_id: SessionId
         | 
| 53 | 
            +
                launch_method: LaunchMethod
         | 
| 54 | 
            +
                working_dir: str
         | 
| 55 | 
            +
                enable_websocket: NotRequired[bool]
         | 
| 56 | 
            +
                websocket_port: NotRequired[int]
         | 
| 57 | 
            +
                enable_tickets: NotRequired[bool]
         | 
| 58 | 
            +
                claude_args: NotRequired[List[str]]
         | 
| 59 | 
            +
                context: NotRequired[str]
         | 
| 60 | 
            +
                system_prompt: NotRequired[str]
         | 
| 61 | 
            +
             | 
| 62 | 
            +
             | 
| 63 | 
            +
            class SessionResult(TypedDict):
         | 
| 64 | 
            +
                """Result from a session execution."""
         | 
| 65 | 
            +
                success: bool
         | 
| 66 | 
            +
                session_id: SessionId
         | 
| 67 | 
            +
                response: NotRequired[str]
         | 
| 68 | 
            +
                error: NotRequired[str]
         | 
| 69 | 
            +
                execution_time: NotRequired[float]
         | 
| 70 | 
            +
                exit_code: NotRequired[int]
         | 
| 71 | 
            +
                metadata: NotRequired[Dict[str, Any]]
         | 
| 72 | 
            +
             | 
| 73 | 
            +
             | 
| 74 | 
            +
            class SessionEvent(TypedDict):
         | 
| 75 | 
            +
                """Event logged during session execution."""
         | 
| 76 | 
            +
                event: str
         | 
| 77 | 
            +
                timestamp: datetime
         | 
| 78 | 
            +
                session_id: NotRequired[SessionId]
         | 
| 79 | 
            +
                success: NotRequired[bool]
         | 
| 80 | 
            +
                error: NotRequired[str]
         | 
| 81 | 
            +
                exception_type: NotRequired[str]
         | 
| 82 | 
            +
                metadata: NotRequired[Dict[str, Any]]
         | 
| 83 | 
            +
             | 
| 84 | 
            +
             | 
| 85 | 
            +
            # Agent types
         | 
| 86 | 
            +
            AgentId: TypeAlias = str
         | 
| 87 | 
            +
            AgentVersion: TypeAlias = str
         | 
| 88 | 
            +
            AgentTier: TypeAlias = Literal["SYSTEM", "USER", "PROJECT"]
         | 
| 89 | 
            +
            ModelName: TypeAlias = str
         | 
| 90 | 
            +
            ResourceTier: TypeAlias = Literal["standard", "premium", "enterprise"]
         | 
| 91 | 
            +
             | 
| 92 | 
            +
             | 
| 93 | 
            +
            class AgentCapabilities(TypedDict):
         | 
| 94 | 
            +
                """Capabilities of an agent."""
         | 
| 95 | 
            +
                model: ModelName
         | 
| 96 | 
            +
                tools: NotRequired[List[str]]
         | 
| 97 | 
            +
                resource_tier: NotRequired[ResourceTier]
         | 
| 98 | 
            +
                max_tokens: NotRequired[int]
         | 
| 99 | 
            +
                temperature: NotRequired[float]
         | 
| 100 | 
            +
                system_prompt: NotRequired[str]
         | 
| 101 | 
            +
             | 
| 102 | 
            +
             | 
| 103 | 
            +
            class AgentMetadata(TypedDict):
         | 
| 104 | 
            +
                """Metadata for an agent."""
         | 
| 105 | 
            +
                name: str
         | 
| 106 | 
            +
                description: str
         | 
| 107 | 
            +
                tags: NotRequired[List[str]]
         | 
| 108 | 
            +
                author: NotRequired[str]
         | 
| 109 | 
            +
                created_at: NotRequired[str]
         | 
| 110 | 
            +
                updated_at: NotRequired[str]
         | 
| 111 | 
            +
             | 
| 112 | 
            +
             | 
| 113 | 
            +
            class AgentDefinition(TypedDict):
         | 
| 114 | 
            +
                """Complete agent definition."""
         | 
| 115 | 
            +
                agent_id: AgentId
         | 
| 116 | 
            +
                version: AgentVersion
         | 
| 117 | 
            +
                metadata: AgentMetadata
         | 
| 118 | 
            +
                capabilities: AgentCapabilities
         | 
| 119 | 
            +
                instructions: str
         | 
| 120 | 
            +
                tier: NotRequired[AgentTier]
         | 
| 121 | 
            +
                file_path: NotRequired[PathLike]
         | 
| 122 | 
            +
             | 
| 123 | 
            +
             | 
| 124 | 
            +
            # WebSocket/SocketIO types
         | 
| 125 | 
            +
            EventName: TypeAlias = str
         | 
| 126 | 
            +
            EventData: TypeAlias = Dict[str, Any]
         | 
| 127 | 
            +
            SocketId: TypeAlias = str
         | 
| 128 | 
            +
             | 
| 129 | 
            +
             | 
| 130 | 
            +
            class WebSocketMessage(TypedDict):
         | 
| 131 | 
            +
                """WebSocket message structure."""
         | 
| 132 | 
            +
                event: EventName
         | 
| 133 | 
            +
                data: EventData
         | 
| 134 | 
            +
                timestamp: NotRequired[datetime]
         | 
| 135 | 
            +
                session_id: NotRequired[SessionId]
         | 
| 136 | 
            +
             | 
| 137 | 
            +
             | 
| 138 | 
            +
            class ClaudeStatus(TypedDict):
         | 
| 139 | 
            +
                """Claude process status."""
         | 
| 140 | 
            +
                status: Literal["starting", "running", "stopped", "error"]
         | 
| 141 | 
            +
                message: str
         | 
| 142 | 
            +
                timestamp: NotRequired[datetime]
         | 
| 143 | 
            +
                pid: NotRequired[int]
         | 
| 144 | 
            +
             | 
| 145 | 
            +
             | 
| 146 | 
            +
            class DelegationInfo(TypedDict):
         | 
| 147 | 
            +
                """Agent delegation information."""
         | 
| 148 | 
            +
                agent: AgentId
         | 
| 149 | 
            +
                task: str
         | 
| 150 | 
            +
                status: Literal["detected", "started", "completed", "failed"]
         | 
| 151 | 
            +
                timestamp: NotRequired[datetime]
         | 
| 152 | 
            +
                result: NotRequired[str]
         | 
| 153 | 
            +
             | 
| 154 | 
            +
             | 
| 155 | 
            +
            # Hook types
         | 
| 156 | 
            +
            HookName: TypeAlias = str
         | 
| 157 | 
            +
            HookPriority: TypeAlias = int
         | 
| 158 | 
            +
            HookResult: TypeAlias = Any
         | 
| 159 | 
            +
             | 
| 160 | 
            +
             | 
| 161 | 
            +
            class HookConfig(TypedDict):
         | 
| 162 | 
            +
                """Hook configuration."""
         | 
| 163 | 
            +
                name: HookName
         | 
| 164 | 
            +
                enabled: NotRequired[bool]
         | 
| 165 | 
            +
                priority: NotRequired[HookPriority]
         | 
| 166 | 
            +
                config: NotRequired[Dict[str, Any]]
         | 
| 167 | 
            +
             | 
| 168 | 
            +
             | 
| 169 | 
            +
            class HookContext(TypedDict):
         | 
| 170 | 
            +
                """Context passed to hook handlers."""
         | 
| 171 | 
            +
                hook_name: HookName
         | 
| 172 | 
            +
                session_id: NotRequired[SessionId]
         | 
| 173 | 
            +
                agent_id: NotRequired[AgentId]
         | 
| 174 | 
            +
                data: NotRequired[Dict[str, Any]]
         | 
| 175 | 
            +
             | 
| 176 | 
            +
             | 
| 177 | 
            +
            # Service types
         | 
| 178 | 
            +
            ServiceName: TypeAlias = str
         | 
| 179 | 
            +
            ServiceStatus: TypeAlias = Literal["idle", "running", "stopped", "error"]
         | 
| 180 | 
            +
             | 
| 181 | 
            +
             | 
| 182 | 
            +
            class ServiceConfig(TypedDict):
         | 
| 183 | 
            +
                """Service configuration."""
         | 
| 184 | 
            +
                name: ServiceName
         | 
| 185 | 
            +
                enabled: NotRequired[bool]
         | 
| 186 | 
            +
                port: NotRequired[int]
         | 
| 187 | 
            +
                host: NotRequired[str]
         | 
| 188 | 
            +
                config: NotRequired[Dict[str, Any]]
         | 
| 189 | 
            +
             | 
| 190 | 
            +
             | 
| 191 | 
            +
            class ServiceInfo(TypedDict):
         | 
| 192 | 
            +
                """Service information."""
         | 
| 193 | 
            +
                name: ServiceName
         | 
| 194 | 
            +
                status: ServiceStatus
         | 
| 195 | 
            +
                uptime: NotRequired[float]
         | 
| 196 | 
            +
                requests_handled: NotRequired[int]
         | 
| 197 | 
            +
                errors: NotRequired[int]
         | 
| 198 | 
            +
                last_error: NotRequired[str]
         | 
| 199 | 
            +
             | 
| 200 | 
            +
             | 
| 201 | 
            +
            # Memory types
         | 
| 202 | 
            +
            MemoryType: TypeAlias = Literal[
         | 
| 203 | 
            +
                "pattern", "architecture", "guideline", "mistake", 
         | 
| 204 | 
            +
                "strategy", "integration", "performance", "context"
         | 
| 205 | 
            +
            ]
         | 
| 206 | 
            +
            MemoryId: TypeAlias = str
         | 
| 207 | 
            +
             | 
| 208 | 
            +
             | 
| 209 | 
            +
            class Memory(TypedDict):
         | 
| 210 | 
            +
                """Agent memory entry."""
         | 
| 211 | 
            +
                id: MemoryId
         | 
| 212 | 
            +
                type: MemoryType
         | 
| 213 | 
            +
                content: str
         | 
| 214 | 
            +
                agent_id: AgentId
         | 
| 215 | 
            +
                timestamp: datetime
         | 
| 216 | 
            +
                relevance_score: NotRequired[float]
         | 
| 217 | 
            +
                usage_count: NotRequired[int]
         | 
| 218 | 
            +
                tags: NotRequired[List[str]]
         | 
| 219 | 
            +
             | 
| 220 | 
            +
             | 
| 221 | 
            +
            class MemorySearchResult(TypedDict):
         | 
| 222 | 
            +
                """Result from memory search."""
         | 
| 223 | 
            +
                memory: Memory
         | 
| 224 | 
            +
                score: float
         | 
| 225 | 
            +
                matches: NotRequired[List[str]]
         | 
| 226 | 
            +
             | 
| 227 | 
            +
             | 
| 228 | 
            +
            # Project and deployment types
         | 
| 229 | 
            +
            class ProjectConfig(TypedDict):
         | 
| 230 | 
            +
                """Project-specific configuration."""
         | 
| 231 | 
            +
                project_name: NotRequired[str]
         | 
| 232 | 
            +
                agent_deployment: NotRequired[Dict[str, Any]]
         | 
| 233 | 
            +
                excluded_agents: NotRequired[List[AgentId]]
         | 
| 234 | 
            +
                included_agents: NotRequired[List[AgentId]]
         | 
| 235 | 
            +
                custom_agents_path: NotRequired[PathLike]
         | 
| 236 | 
            +
                memory_enabled: NotRequired[bool]
         | 
| 237 | 
            +
                websocket_enabled: NotRequired[bool]
         | 
| 238 | 
            +
             | 
| 239 | 
            +
             | 
| 240 | 
            +
            class DeploymentResult(TypedDict):
         | 
| 241 | 
            +
                """Result from agent deployment."""
         | 
| 242 | 
            +
                deployed: List[AgentId]
         | 
| 243 | 
            +
                failed: List[Tuple[AgentId, str]]
         | 
| 244 | 
            +
                skipped: List[AgentId]
         | 
| 245 | 
            +
                total_time: float
         | 
| 246 | 
            +
             | 
| 247 | 
            +
             | 
| 248 | 
            +
            # Response logging types
         | 
| 249 | 
            +
            class ResponseLogEntry(TypedDict):
         | 
| 250 | 
            +
                """Entry in response log."""
         | 
| 251 | 
            +
                timestamp: datetime
         | 
| 252 | 
            +
                request_summary: str
         | 
| 253 | 
            +
                response_content: str
         | 
| 254 | 
            +
                metadata: Dict[str, Any]
         | 
| 255 | 
            +
                agent: AgentId
         | 
| 256 | 
            +
                session_id: NotRequired[SessionId]
         | 
| 257 | 
            +
                execution_time: NotRequired[float]
         | 
| 258 | 
            +
             | 
| 259 | 
            +
             | 
| 260 | 
            +
            # Command/CLI types
         | 
| 261 | 
            +
            CommandName: TypeAlias = str
         | 
| 262 | 
            +
            CommandArgs: TypeAlias = List[str]
         | 
| 263 | 
            +
             | 
| 264 | 
            +
             | 
| 265 | 
            +
            class CommandResult(TypedDict):
         | 
| 266 | 
            +
                """Result from command execution."""
         | 
| 267 | 
            +
                success: bool
         | 
| 268 | 
            +
                output: NotRequired[str]
         | 
| 269 | 
            +
                error: NotRequired[str]
         | 
| 270 | 
            +
                exit_code: int
         | 
| 271 | 
            +
             | 
| 272 | 
            +
             | 
| 273 | 
            +
            # Protocols for structural typing
         | 
| 274 | 
            +
             | 
| 275 | 
            +
            class SessionProtocol(Protocol):
         | 
| 276 | 
            +
                """Protocol for session handlers."""
         | 
| 277 | 
            +
                
         | 
| 278 | 
            +
                def initialize_session(self, prompt: str) -> Tuple[bool, Optional[str]]:
         | 
| 279 | 
            +
                    """Initialize the session."""
         | 
| 280 | 
            +
                    ...
         | 
| 281 | 
            +
                
         | 
| 282 | 
            +
                def execute_command(self, prompt: str, context: Optional[str], 
         | 
| 283 | 
            +
                                    infrastructure: Dict[str, Any]) -> Tuple[bool, Optional[str]]:
         | 
| 284 | 
            +
                    """Execute a command."""
         | 
| 285 | 
            +
                    ...
         | 
| 286 | 
            +
                
         | 
| 287 | 
            +
                def cleanup_session(self) -> None:
         | 
| 288 | 
            +
                    """Clean up the session."""
         | 
| 289 | 
            +
                    ...
         | 
| 290 | 
            +
             | 
| 291 | 
            +
             | 
| 292 | 
            +
            class LoggerProtocol(Protocol):
         | 
| 293 | 
            +
                """Protocol for loggers."""
         | 
| 294 | 
            +
                
         | 
| 295 | 
            +
                def log_system(self, message: str, level: LogLevel = "INFO", 
         | 
| 296 | 
            +
                               component: Optional[str] = None) -> None:
         | 
| 297 | 
            +
                    """Log a system message."""
         | 
| 298 | 
            +
                    ...
         | 
| 299 | 
            +
                
         | 
| 300 | 
            +
                def log_agent(self, agent: AgentId, message: str, 
         | 
| 301 | 
            +
                              level: LogLevel = "INFO") -> None:
         | 
| 302 | 
            +
                    """Log an agent message."""
         | 
| 303 | 
            +
                    ...
         | 
| 304 | 
            +
                
         | 
| 305 | 
            +
                def get_session_summary(self) -> Dict[str, Any]:
         | 
| 306 | 
            +
                    """Get session summary."""
         | 
| 307 | 
            +
                    ...
         | 
| 308 | 
            +
             | 
| 309 | 
            +
             | 
| 310 | 
            +
            class WebSocketServerProtocol(Protocol):
         | 
| 311 | 
            +
                """Protocol for WebSocket server."""
         | 
| 312 | 
            +
                
         | 
| 313 | 
            +
                def start(self) -> None:
         | 
| 314 | 
            +
                    """Start the server."""
         | 
| 315 | 
            +
                    ...
         | 
| 316 | 
            +
                
         | 
| 317 | 
            +
                def session_started(self, session_id: SessionId, launch_method: LaunchMethod,
         | 
| 318 | 
            +
                                   working_dir: str) -> None:
         | 
| 319 | 
            +
                    """Notify session start."""
         | 
| 320 | 
            +
                    ...
         | 
| 321 | 
            +
                
         | 
| 322 | 
            +
                def session_ended(self) -> None:
         | 
| 323 | 
            +
                    """Notify session end."""
         | 
| 324 | 
            +
                    ...
         | 
| 325 | 
            +
                
         | 
| 326 | 
            +
                def claude_status_changed(self, status: str, message: str) -> None:
         | 
| 327 | 
            +
                    """Update Claude status."""
         | 
| 328 | 
            +
                    ...
         | 
| 329 | 
            +
                
         | 
| 330 | 
            +
                def claude_output(self, output: str, stream: Literal["stdout", "stderr"]) -> None:
         | 
| 331 | 
            +
                    """Send Claude output."""
         | 
| 332 | 
            +
                    ...
         | 
| 333 | 
            +
                
         | 
| 334 | 
            +
                def agent_delegated(self, agent: AgentId, task: str, status: str) -> None:
         | 
| 335 | 
            +
                    """Notify agent delegation."""
         | 
| 336 | 
            +
                    ...
         | 
| 337 | 
            +
             | 
| 338 | 
            +
             | 
| 339 | 
            +
            class AgentServiceProtocol(Protocol):
         | 
| 340 | 
            +
                """Protocol for agent service."""
         | 
| 341 | 
            +
                
         | 
| 342 | 
            +
                def deploy_agents(self, agents: List[AgentDefinition], 
         | 
| 343 | 
            +
                                 target_dir: PathLike) -> DeploymentResult:
         | 
| 344 | 
            +
                    """Deploy agents to target directory."""
         | 
| 345 | 
            +
                    ...
         | 
| 346 | 
            +
                
         | 
| 347 | 
            +
                def discover_agents(self, tier: AgentTier) -> List[AgentDefinition]:
         | 
| 348 | 
            +
                    """Discover agents at specified tier."""
         | 
| 349 | 
            +
                    ...
         | 
| 350 | 
            +
                
         | 
| 351 | 
            +
                def get_agent(self, agent_id: AgentId, tier: Optional[AgentTier] = None) -> Optional[AgentDefinition]:
         | 
| 352 | 
            +
                    """Get specific agent."""
         | 
| 353 | 
            +
                    ...
         | 
| 354 | 
            +
             | 
| 355 | 
            +
             | 
| 356 | 
            +
            class MemoryServiceProtocol(Protocol):
         | 
| 357 | 
            +
                """Protocol for memory service."""
         | 
| 358 | 
            +
                
         | 
| 359 | 
            +
                def add_memory(self, memory: Memory) -> bool:
         | 
| 360 | 
            +
                    """Add a memory entry."""
         | 
| 361 | 
            +
                    ...
         | 
| 362 | 
            +
                
         | 
| 363 | 
            +
                def search_memories(self, query: str, agent_id: Optional[AgentId] = None,
         | 
| 364 | 
            +
                                    memory_type: Optional[MemoryType] = None,
         | 
| 365 | 
            +
                                    limit: int = 10) -> List[MemorySearchResult]:
         | 
| 366 | 
            +
                    """Search memories."""
         | 
| 367 | 
            +
                    ...
         | 
| 368 | 
            +
                
         | 
| 369 | 
            +
                def get_relevant_memories(self, context: str, agent_id: AgentId,
         | 
| 370 | 
            +
                                         limit: int = 5) -> List[Memory]:
         | 
| 371 | 
            +
                    """Get relevant memories for context."""
         | 
| 372 | 
            +
                    ...
         | 
| 373 | 
            +
             | 
| 374 | 
            +
             | 
| 375 | 
            +
            # Factory function types
         | 
| 376 | 
            +
            SessionFactory = Callable[[Any], SessionProtocol]
         | 
| 377 | 
            +
            ServiceFactory = Callable[[ServiceConfig], Any]
         | 
| 378 | 
            +
            LoggerFactory = Callable[[str], logging.Logger]
         | 
| 379 | 
            +
             | 
| 380 | 
            +
             | 
| 381 | 
            +
            # Validation function types
         | 
| 382 | 
            +
            Validator = Callable[[Any], bool]
         | 
| 383 | 
            +
            Transformer = Callable[[T], T]
         | 
| 384 | 
            +
            ErrorHandler = Callable[[Exception], None]
         | 
| 385 | 
            +
             | 
| 386 | 
            +
             | 
| 387 | 
            +
            # Async types for future use
         | 
| 388 | 
            +
            AsyncSessionResult = Awaitable[SessionResult]
         | 
| 389 | 
            +
            AsyncCommandResult = Awaitable[CommandResult]
         | 
| 390 | 
            +
            AsyncDeploymentResult = Awaitable[DeploymentResult]
         | 
| 391 | 
            +
             | 
| 392 | 
            +
             | 
| 393 | 
            +
            # Container/Dependency injection types
         | 
| 394 | 
            +
            class ServiceContainer(Protocol):
         | 
| 395 | 
            +
                """Protocol for service container."""
         | 
| 396 | 
            +
                
         | 
| 397 | 
            +
                def register(self, name: str, factory: ServiceFactory) -> None:
         | 
| 398 | 
            +
                    """Register a service."""
         | 
| 399 | 
            +
                    ...
         | 
| 400 | 
            +
                
         | 
| 401 | 
            +
                def get(self, name: str) -> Any:
         | 
| 402 | 
            +
                    """Get a service instance."""
         | 
| 403 | 
            +
                    ...
         | 
| 404 | 
            +
                
         | 
| 405 | 
            +
                def has(self, name: str) -> bool:
         | 
| 406 | 
            +
                    """Check if service is registered."""
         | 
| 407 | 
            +
                    ...
         | 
| 408 | 
            +
             | 
| 409 | 
            +
             | 
| 410 | 
            +
            # Event system types
         | 
| 411 | 
            +
            EventHandler = Callable[[EventData], None]
         | 
| 412 | 
            +
            EventFilter = Callable[[EventData], bool]
         | 
| 413 | 
            +
             | 
| 414 | 
            +
             | 
| 415 | 
            +
            class EventSubscription(TypedDict):
         | 
| 416 | 
            +
                """Event subscription details."""
         | 
| 417 | 
            +
                event: EventName
         | 
| 418 | 
            +
                handler: EventHandler
         | 
| 419 | 
            +
                filter: NotRequired[EventFilter]
         | 
| 420 | 
            +
                priority: NotRequired[int]
         | 
| 421 | 
            +
             | 
| 422 | 
            +
             | 
| 423 | 
            +
            # Testing types (for test files)
         | 
| 424 | 
            +
            class TestFixture(TypedDict):
         | 
| 425 | 
            +
                """Test fixture data."""
         | 
| 426 | 
            +
                name: str
         | 
| 427 | 
            +
                data: Any
         | 
| 428 | 
            +
                setup: NotRequired[Callable[[], None]]
         | 
| 429 | 
            +
                teardown: NotRequired[Callable[[], None]]
         | 
| 430 | 
            +
             | 
| 431 | 
            +
             | 
| 432 | 
            +
            # Export commonly used type combinations
         | 
| 433 | 
            +
            CommonTypes = Union[str, int, float, bool, None, List[Any], Dict[str, Any]]
         | 
| 434 | 
            +
            ConfigDict = Dict[str, CommonTypes]
         | 
| 435 | 
            +
            ErrorResult = Tuple[bool, Optional[str]]
         | 
| 436 | 
            +
            SuccessResult = Tuple[bool, Any]
         | 
| 437 | 
            +
             | 
| 438 | 
            +
             | 
| 439 | 
            +
            __all__ = [
         | 
| 440 | 
            +
                # Basic type aliases
         | 
| 441 | 
            +
                'PathLike', 'JSONValue', 'JSONDict', 'Headers', 'ErrorCode', 'LogLevel',
         | 
| 442 | 
            +
                
         | 
| 443 | 
            +
                # Session types
         | 
| 444 | 
            +
                'SessionId', 'SessionStatus', 'LaunchMethod', 'SessionConfig', 
         | 
| 445 | 
            +
                'SessionResult', 'SessionEvent',
         | 
| 446 | 
            +
                
         | 
| 447 | 
            +
                # Agent types
         | 
| 448 | 
            +
                'AgentId', 'AgentVersion', 'AgentTier', 'ModelName', 'ResourceTier',
         | 
| 449 | 
            +
                'AgentCapabilities', 'AgentMetadata', 'AgentDefinition',
         | 
| 450 | 
            +
                
         | 
| 451 | 
            +
                # WebSocket types
         | 
| 452 | 
            +
                'EventName', 'EventData', 'SocketId', 'WebSocketMessage', 
         | 
| 453 | 
            +
                'ClaudeStatus', 'DelegationInfo',
         | 
| 454 | 
            +
                
         | 
| 455 | 
            +
                # Hook types
         | 
| 456 | 
            +
                'HookName', 'HookPriority', 'HookResult', 'HookConfig', 'HookContext',
         | 
| 457 | 
            +
                
         | 
| 458 | 
            +
                # Service types
         | 
| 459 | 
            +
                'ServiceName', 'ServiceStatus', 'ServiceConfig', 'ServiceInfo',
         | 
| 460 | 
            +
                
         | 
| 461 | 
            +
                # Memory types
         | 
| 462 | 
            +
                'MemoryType', 'MemoryId', 'Memory', 'MemorySearchResult',
         | 
| 463 | 
            +
                
         | 
| 464 | 
            +
                # Other types
         | 
| 465 | 
            +
                'ProjectConfig', 'DeploymentResult', 'ResponseLogEntry',
         | 
| 466 | 
            +
                'CommandName', 'CommandArgs', 'CommandResult',
         | 
| 467 | 
            +
                
         | 
| 468 | 
            +
                # Protocols
         | 
| 469 | 
            +
                'SessionProtocol', 'LoggerProtocol', 'WebSocketServerProtocol',
         | 
| 470 | 
            +
                'AgentServiceProtocol', 'MemoryServiceProtocol', 'ServiceContainer',
         | 
| 471 | 
            +
                
         | 
| 472 | 
            +
                # Generic type variables
         | 
| 473 | 
            +
                'T', 'TSession', 'TAgent', 'TService',
         | 
| 474 | 
            +
                
         | 
| 475 | 
            +
                # Common combinations
         | 
| 476 | 
            +
                'CommonTypes', 'ConfigDict', 'ErrorResult', 'SuccessResult',
         | 
| 477 | 
            +
            ]
         |