claude-mpm 3.7.4__py3-none-any.whl → 3.8.1__py3-none-any.whl

claude_mpm/core/typing_utils.py

@@ -0,0 +1,477 @@
+"""Type definitions and utilities for Claude MPM.
+
+This module provides common type aliases, protocols, and TypedDict definitions
+used throughout the codebase to ensure consistent type safety.
+
+WHY: Centralizing type definitions reduces duplication, improves IDE support,
+and makes the codebase more maintainable by providing a single source of truth
+for complex type definitions.
+
+DESIGN DECISION: Uses protocols and TypedDict to provide structural typing
+that allows for more flexible and maintainable type checking while maintaining
+strict type safety.
+"""
+
+from typing import (
+    Any, Callable, Dict, List, Optional, Union, TypeVar, Protocol,
+    TYPE_CHECKING, Literal, Tuple, Set, Awaitable, Iterator, AsyncIterator
+)
+from typing_extensions import TypedDict, NotRequired, TypeAlias
+from pathlib import Path
+from datetime import datetime
+from enum import Enum
+import logging
+
+if TYPE_CHECKING:
+    from claude_mpm.core.claude_runner import ClaudeRunner
+    from claude_mpm.services.socketio_server import SocketIOClientProxy
+
+
+# Generic type variables
+T = TypeVar('T')
+TSession = TypeVar('TSession')  # Generic session type
+TAgent = TypeVar('TAgent')  # Generic agent type
+TService = TypeVar('TService')  # Generic service type
+
+# Basic type aliases
+PathLike: TypeAlias = Union[str, Path]
+JSONValue: TypeAlias = Union[str, int, float, bool, None, Dict[str, Any], List[Any]]
+JSONDict: TypeAlias = Dict[str, JSONValue]
+Headers: TypeAlias = Dict[str, str]
+ErrorCode: TypeAlias = Union[int, str]
+LogLevel: TypeAlias = Literal["DEBUG", "INFO", "WARNING", "ERROR", "CRITICAL"]
+
+# Session types
+SessionId: TypeAlias = str
+SessionStatus: TypeAlias = Literal["initializing", "running", "stopped", "error", "completed"]
+LaunchMethod: TypeAlias = Literal["exec", "subprocess", "oneshot"]
+
+
+class SessionConfig(TypedDict):
+    """Configuration for a Claude session."""
+    session_id: SessionId
+    launch_method: LaunchMethod
+    working_dir: str
+    enable_websocket: NotRequired[bool]
+    websocket_port: NotRequired[int]
+    enable_tickets: NotRequired[bool]
+    claude_args: NotRequired[List[str]]
+    context: NotRequired[str]
+    system_prompt: NotRequired[str]
+
+
+class SessionResult(TypedDict):
+    """Result from a session execution."""
+    success: bool
+    session_id: SessionId
+    response: NotRequired[str]
+    error: NotRequired[str]
+    execution_time: NotRequired[float]
+    exit_code: NotRequired[int]
+    metadata: NotRequired[Dict[str, Any]]
+
+
+class SessionEvent(TypedDict):
+    """Event logged during session execution."""
+    event: str
+    timestamp: datetime
+    session_id: NotRequired[SessionId]
+    success: NotRequired[bool]
+    error: NotRequired[str]
+    exception_type: NotRequired[str]
+    metadata: NotRequired[Dict[str, Any]]
+
+
+# Agent types
+AgentId: TypeAlias = str
+AgentVersion: TypeAlias = str
+AgentTier: TypeAlias = Literal["SYSTEM", "USER", "PROJECT"]
+ModelName: TypeAlias = str
+ResourceTier: TypeAlias = Literal["standard", "premium", "enterprise"]
+
+
+class AgentCapabilities(TypedDict):
+    """Capabilities of an agent."""
+    model: ModelName
+    tools: NotRequired[List[str]]
+    resource_tier: NotRequired[ResourceTier]
+    max_tokens: NotRequired[int]
+    temperature: NotRequired[float]
+    system_prompt: NotRequired[str]
+
+
+class AgentMetadata(TypedDict):
+    """Metadata for an agent."""
+    name: str
+    description: str
+    tags: NotRequired[List[str]]
+    author: NotRequired[str]
+    created_at: NotRequired[str]
+    updated_at: NotRequired[str]
+
+
+class AgentDefinition(TypedDict):
+    """Complete agent definition."""
+    agent_id: AgentId
+    version: AgentVersion
+    metadata: AgentMetadata
+    capabilities: AgentCapabilities
+    instructions: str
+    tier: NotRequired[AgentTier]
+    file_path: NotRequired[PathLike]
+
+
+# WebSocket/SocketIO types
+EventName: TypeAlias = str
+EventData: TypeAlias = Dict[str, Any]
+SocketId: TypeAlias = str
+
+
+class WebSocketMessage(TypedDict):
+    """WebSocket message structure."""
+    event: EventName
+    data: EventData
+    timestamp: NotRequired[datetime]
+    session_id: NotRequired[SessionId]
+
+
+class ClaudeStatus(TypedDict):
+    """Claude process status."""
+    status: Literal["starting", "running", "stopped", "error"]
+    message: str
+    timestamp: NotRequired[datetime]
+    pid: NotRequired[int]
+
+
+class DelegationInfo(TypedDict):
+    """Agent delegation information."""
+    agent: AgentId
+    task: str
+    status: Literal["detected", "started", "completed", "failed"]
+    timestamp: NotRequired[datetime]
+    result: NotRequired[str]
+
+
+# Hook types
+HookName: TypeAlias = str
+HookPriority: TypeAlias = int
+HookResult: TypeAlias = Any
+
+
+class HookConfig(TypedDict):
+    """Hook configuration."""
+    name: HookName
+    enabled: NotRequired[bool]
+    priority: NotRequired[HookPriority]
+    config: NotRequired[Dict[str, Any]]
+
+
+class HookContext(TypedDict):
+    """Context passed to hook handlers."""
+    hook_name: HookName
+    session_id: NotRequired[SessionId]
+    agent_id: NotRequired[AgentId]
+    data: NotRequired[Dict[str, Any]]
+
+
+# Service types
+ServiceName: TypeAlias = str
+ServiceStatus: TypeAlias = Literal["idle", "running", "stopped", "error"]
+
+
+class ServiceConfig(TypedDict):
+    """Service configuration."""
+    name: ServiceName
+    enabled: NotRequired[bool]
+    port: NotRequired[int]
+    host: NotRequired[str]
+    config: NotRequired[Dict[str, Any]]
+
+
+class ServiceInfo(TypedDict):
+    """Service information."""
+    name: ServiceName
+    status: ServiceStatus
+    uptime: NotRequired[float]
+    requests_handled: NotRequired[int]
+    errors: NotRequired[int]
+    last_error: NotRequired[str]
+
+
+# Memory types
+MemoryType: TypeAlias = Literal[
+    "pattern", "architecture", "guideline", "mistake", 
+    "strategy", "integration", "performance", "context"
+]
+MemoryId: TypeAlias = str
+
+
+class Memory(TypedDict):
+    """Agent memory entry."""
+    id: MemoryId
+    type: MemoryType
+    content: str
+    agent_id: AgentId
+    timestamp: datetime
+    relevance_score: NotRequired[float]
+    usage_count: NotRequired[int]
+    tags: NotRequired[List[str]]
+
+
+class MemorySearchResult(TypedDict):
+    """Result from memory search."""
+    memory: Memory
+    score: float
+    matches: NotRequired[List[str]]
+
+
+# Project and deployment types
+class ProjectConfig(TypedDict):
+    """Project-specific configuration."""
+    project_name: NotRequired[str]
+    agent_deployment: NotRequired[Dict[str, Any]]
+    excluded_agents: NotRequired[List[AgentId]]
+    included_agents: NotRequired[List[AgentId]]
+    custom_agents_path: NotRequired[PathLike]
+    memory_enabled: NotRequired[bool]
+    websocket_enabled: NotRequired[bool]
+
+
+class DeploymentResult(TypedDict):
+    """Result from agent deployment."""
+    deployed: List[AgentId]
+    failed: List[Tuple[AgentId, str]]
+    skipped: List[AgentId]
+    total_time: float
+
+
+# Response logging types
+class ResponseLogEntry(TypedDict):
+    """Entry in response log."""
+    timestamp: datetime
+    request_summary: str
+    response_content: str
+    metadata: Dict[str, Any]
+    agent: AgentId
+    session_id: NotRequired[SessionId]
+    execution_time: NotRequired[float]
+
+
+# Command/CLI types
+CommandName: TypeAlias = str
+CommandArgs: TypeAlias = List[str]
+
+
+class CommandResult(TypedDict):
+    """Result from command execution."""
+    success: bool
+    output: NotRequired[str]
+    error: NotRequired[str]
+    exit_code: int
+
+
+# Protocols for structural typing
+
+class SessionProtocol(Protocol):
+    """Protocol for session handlers."""
+    
+    def initialize_session(self, prompt: str) -> Tuple[bool, Optional[str]]:
+        """Initialize the session."""
+        ...
+    
+    def execute_command(self, prompt: str, context: Optional[str], 
+                        infrastructure: Dict[str, Any]) -> Tuple[bool, Optional[str]]:
+        """Execute a command."""
+        ...
+    
+    def cleanup_session(self) -> None:
+        """Clean up the session."""
+        ...
+
+
+class LoggerProtocol(Protocol):
+    """Protocol for loggers."""
+    
+    def log_system(self, message: str, level: LogLevel = "INFO", 
+                   component: Optional[str] = None) -> None:
+        """Log a system message."""
+        ...
+    
+    def log_agent(self, agent: AgentId, message: str, 
+                  level: LogLevel = "INFO") -> None:
+        """Log an agent message."""
+        ...
+    
+    def get_session_summary(self) -> Dict[str, Any]:
+        """Get session summary."""
+        ...
+
+
+class WebSocketServerProtocol(Protocol):
+    """Protocol for WebSocket server."""
+    
+    def start(self) -> None:
+        """Start the server."""
+        ...
+    
+    def session_started(self, session_id: SessionId, launch_method: LaunchMethod,
+                       working_dir: str) -> None:
+        """Notify session start."""
+        ...
+    
+    def session_ended(self) -> None:
+        """Notify session end."""
+        ...
+    
+    def claude_status_changed(self, status: str, message: str) -> None:
+        """Update Claude status."""
+        ...
+    
+    def claude_output(self, output: str, stream: Literal["stdout", "stderr"]) -> None:
+        """Send Claude output."""
+        ...
+    
+    def agent_delegated(self, agent: AgentId, task: str, status: str) -> None:
+        """Notify agent delegation."""
+        ...
+
+
+class AgentServiceProtocol(Protocol):
+    """Protocol for agent service."""
+    
+    def deploy_agents(self, agents: List[AgentDefinition], 
+                     target_dir: PathLike) -> DeploymentResult:
+        """Deploy agents to target directory."""
+        ...
+    
+    def discover_agents(self, tier: AgentTier) -> List[AgentDefinition]:
+        """Discover agents at specified tier."""
+        ...
+    
+    def get_agent(self, agent_id: AgentId, tier: Optional[AgentTier] = None) -> Optional[AgentDefinition]:
+        """Get specific agent."""
+        ...
+
+
+class MemoryServiceProtocol(Protocol):
+    """Protocol for memory service."""
+    
+    def add_memory(self, memory: Memory) -> bool:
+        """Add a memory entry."""
+        ...
+    
+    def search_memories(self, query: str, agent_id: Optional[AgentId] = None,
+                        memory_type: Optional[MemoryType] = None,
+                        limit: int = 10) -> List[MemorySearchResult]:
+        """Search memories."""
+        ...
+    
+    def get_relevant_memories(self, context: str, agent_id: AgentId,
+                             limit: int = 5) -> List[Memory]:
+        """Get relevant memories for context."""
+        ...
+
+
+# Factory function types
+SessionFactory = Callable[[Any], SessionProtocol]
+ServiceFactory = Callable[[ServiceConfig], Any]
+LoggerFactory = Callable[[str], logging.Logger]
+
+
+# Validation function types
+Validator = Callable[[Any], bool]
+Transformer = Callable[[T], T]
+ErrorHandler = Callable[[Exception], None]
+
+
+# Async types for future use
+AsyncSessionResult = Awaitable[SessionResult]
+AsyncCommandResult = Awaitable[CommandResult]
+AsyncDeploymentResult = Awaitable[DeploymentResult]
+
+
+# Container/Dependency injection types
+class ServiceContainer(Protocol):
+    """Protocol for service container."""
+    
+    def register(self, name: str, factory: ServiceFactory) -> None:
+        """Register a service."""
+        ...
+    
+    def get(self, name: str) -> Any:
+        """Get a service instance."""
+        ...
+    
+    def has(self, name: str) -> bool:
+        """Check if service is registered."""
+        ...
+
+
+# Event system types
+EventHandler = Callable[[EventData], None]
+EventFilter = Callable[[EventData], bool]
+
+
+class EventSubscription(TypedDict):
+    """Event subscription details."""
+    event: EventName
+    handler: EventHandler
+    filter: NotRequired[EventFilter]
+    priority: NotRequired[int]
+
+
+# Testing types (for test files)
+class TestFixture(TypedDict):
+    """Test fixture data."""
+    name: str
+    data: Any
+    setup: NotRequired[Callable[[], None]]
+    teardown: NotRequired[Callable[[], None]]
+
+
+# Export commonly used type combinations
+CommonTypes = Union[str, int, float, bool, None, List[Any], Dict[str, Any]]
+ConfigDict = Dict[str, CommonTypes]
+ErrorResult = Tuple[bool, Optional[str]]
+SuccessResult = Tuple[bool, Any]
+
+
+__all__ = [
+    # Basic type aliases
+    'PathLike', 'JSONValue', 'JSONDict', 'Headers', 'ErrorCode', 'LogLevel',
+    
+    # Session types
+    'SessionId', 'SessionStatus', 'LaunchMethod', 'SessionConfig', 
+    'SessionResult', 'SessionEvent',
+    
+    # Agent types
+    'AgentId', 'AgentVersion', 'AgentTier', 'ModelName', 'ResourceTier',
+    'AgentCapabilities', 'AgentMetadata', 'AgentDefinition',
+    
+    # WebSocket types
+    'EventName', 'EventData', 'SocketId', 'WebSocketMessage', 
+    'ClaudeStatus', 'DelegationInfo',
+    
+    # Hook types
+    'HookName', 'HookPriority', 'HookResult', 'HookConfig', 'HookContext',
+    
+    # Service types
+    'ServiceName', 'ServiceStatus', 'ServiceConfig', 'ServiceInfo',
+    
+    # Memory types
+    'MemoryType', 'MemoryId', 'Memory', 'MemorySearchResult',
+    
+    # Other types
+    'ProjectConfig', 'DeploymentResult', 'ResponseLogEntry',
+    'CommandName', 'CommandArgs', 'CommandResult',
+    
+    # Protocols
+    'SessionProtocol', 'LoggerProtocol', 'WebSocketServerProtocol',
+    'AgentServiceProtocol', 'MemoryServiceProtocol', 'ServiceContainer',
+    
+    # Generic type variables
+    'T', 'TSession', 'TAgent', 'TService',
+    
+    # Common combinations
+    'CommonTypes', 'ConfigDict', 'ErrorResult', 'SuccessResult',
+]

claude_mpm/dashboard/static/js/components/file-tool-tracker.js

@@ -328,8 +328,20 @@ class FileToolTracker {
      */
     isFileOperation(event) {
         // File operations are tool events with tools that operate on files
-        const fileTools = ['Read', 'Write', 'Edit', 'Grep', 'MultiEdit'];
-        return event.tool_name && fileTools.includes(event.tool_name);
+        // Check case-insensitively since tool names can come in different cases
+        const fileTools = ['read', 'write', 'edit', 'grep', 'multiedit', 'glob', 'ls', 'bash', 'notebookedit'];
+        const toolName = event.tool_name ? event.tool_name.toLowerCase() : '';
+        
+        // Also check if Bash commands involve file operations
+        if (toolName === 'bash' && event.tool_parameters) {
+            const command = event.tool_parameters.command || '';
+            // Check for common file operations in bash commands
+            if (command.match(/\b(cat|less|more|head|tail|touch|mv|cp|rm|mkdir|ls|find)\b/)) {
+                return true;
+            }
+        }
+        
+        return toolName && fileTools.includes(toolName);
     }
 
     /**
@@ -341,11 +353,28 @@ class FileToolTracker {
         // Try various locations where file path might be stored
         if (event.tool_parameters?.file_path) return event.tool_parameters.file_path;
         if (event.tool_parameters?.path) return event.tool_parameters.path;
+        if (event.tool_parameters?.notebook_path) return event.tool_parameters.notebook_path;
         if (event.data?.tool_parameters?.file_path) return event.data.tool_parameters.file_path;
         if (event.data?.tool_parameters?.path) return event.data.tool_parameters.path;
+        if (event.data?.tool_parameters?.notebook_path) return event.data.tool_parameters.notebook_path;
         if (event.file_path) return event.file_path;
         if (event.path) return event.path;
         
+        // For Glob tool, use the pattern as a pseudo-path
+        if (event.tool_name?.toLowerCase() === 'glob' && event.tool_parameters?.pattern) {
+            return `[glob] ${event.tool_parameters.pattern}`;
+        }
+        
+        // For Bash commands, try to extract file paths from the command
+        if (event.tool_name?.toLowerCase() === 'bash' && event.tool_parameters?.command) {
+            const command = event.tool_parameters.command;
+            // Try to extract file paths from common patterns
+            const fileMatch = command.match(/(?:cat|less|more|head|tail|touch|mv|cp|rm|mkdir|ls|find|echo.*>|sed|awk|grep)\s+([^\s;|&]+)/);
+            if (fileMatch && fileMatch[1]) {
+                return fileMatch[1];
+            }
+        }
+        
         return null;
     }
 
@@ -383,7 +412,22 @@ class FileToolTracker {
             case 'write': return 'write';
             case 'edit': return 'edit';
             case 'multiedit': return 'edit';
+            case 'notebookedit': return 'edit';
             case 'grep': return 'search';
+            case 'glob': return 'search';
+            case 'ls': return 'list';
+            case 'bash': 
+                // Check bash command for file operation type
+                const command = event.tool_parameters?.command || '';
+                if (command.match(/\b(cat|less|more|head|tail)\b/)) return 'read';
+                if (command.match(/\b(touch|echo.*>|tee)\b/)) return 'write';
+                if (command.match(/\b(sed|awk)\b/)) return 'edit';
+                if (command.match(/\b(grep|find)\b/)) return 'search';
+                if (command.match(/\b(ls|dir)\b/)) return 'list';
+                if (command.match(/\b(mv|cp)\b/)) return 'copy/move';
+                if (command.match(/\b(rm|rmdir)\b/)) return 'delete';
+                if (command.match(/\b(mkdir)\b/)) return 'create';
+                return 'bash';
             default: return toolName;
         }
     }

claude_mpm/dashboard/templates/index.html

@@ -334,11 +334,11 @@
     <!-- New modular components -->
     <script src="/static/js/components/socket-manager.js"></script>
     <script src="/static/js/components/agent-inference.js"></script>
-    <script src="/static/js/components/ui-state-manager.js"></script>
-    <script src="/static/js/components/working-directory.js"></script>
-    <script src="/static/js/components/file-tool-tracker.js"></script>
-    <script src="/static/js/components/event-processor.js"></script>
-    <script src="/static/js/components/export-manager.js"></script>
+    <script src="/static/js/components/ui-state-manager.js?v=1.0"></script>
+    <script src="/static/js/components/working-directory.js?v=1.0"></script>
+    <script src="/static/js/components/file-tool-tracker.js?v=1.1"></script>
+    <script src="/static/js/components/event-processor.js?v=1.0"></script>
+    <script src="/static/js/components/export-manager.js?v=1.0"></script>
     
     <!-- Main dashboard coordinator -->
     <script src="/static/js/dashboard.js"></script>