v-sistec-features 1.6.2 → 1.7.1

package/dist/index.js

@@ -1,4 +1,4 @@
-import { S as r } from "./plugin-CS5DnmVr.js";
+import { S as r } from "./plugin-BWcXrGKi.js";
 import { u as a, a as s } from "./useThemeFromParent-CYvPb79h.js";
 export * from "@tabler/icons-vue";
 export {

package/dist/{plugin-CS5DnmVr.js → plugin-BWcXrGKi.js}

@@ -1,22 +1,23 @@
 import Wr from "v-required";
-function Rr(R, Ye) {
+import { s as Rr } from "./index-SOrsDdYZ.js";
+function Br(F, Ye) {
   for (var $ = 0; $ < Ye.length; $++) {
     const Z = Ye[$];
     if (typeof Z != "string" && !Array.isArray(Z)) {
       for (const he in Z)
-        if (he !== "default" && !(he in R)) {
+        if (he !== "default" && !(he in F)) {
           const D = Object.getOwnPropertyDescriptor(Z, he);
-          D && Object.defineProperty(R, he, D.get ? D : {
+          D && Object.defineProperty(F, he, D.get ? D : {
             enumerable: !0,
             get: () => Z[he]
           });
         }
     }
   }
-  return Object.freeze(Object.defineProperty(R, Symbol.toStringTag, { value: "Module" }));
+  return Object.freeze(Object.defineProperty(F, Symbol.toStringTag, { value: "Module" }));
 }
-function Br(R) {
-  return R && R.__esModule && Object.prototype.hasOwnProperty.call(R, "default") ? R.default : R;
+function Vr(F) {
+  return F && F.__esModule && Object.prototype.hasOwnProperty.call(F, "default") ? F.default : F;
 }
 var ot = { exports: {} };
 /*!
@@ -25,12 +26,12 @@ var ot = { exports: {} };
  * Copyright 2018-2025 codecalm.net Paweł Kuna
  * Licensed under MIT (https://github.com/tabler/tabler/blob/master/LICENSE)
  */
-var Vr = ot.exports, hs;
-function Ur() {
-  return hs || (hs = 1, (function(R, Ye) {
+var Ur = ot.exports, hs;
+function Kr() {
+  return hs || (hs = 1, (function(F, Ye) {
     (function($, Z) {
       Z(Ye);
-    })(Vr, function($) {
+    })(Ur, function($) {
       const Z = document.querySelectorAll('[data-bs-toggle="autosize"]');
       Z.length && Z.forEach(function(i) {
         window.autosize && window.autosize(i);
@@ -51,7 +52,7 @@ function Ur() {
       }), [].slice.call(document.querySelectorAll("[data-mask]")).map(function(i) {
         window.IMask && new window.IMask(i, { mask: i.dataset.mask, lazy: i.dataset["mask-visible"] === "true" });
       });
-      var D = "top", F = "bottom", H = "right", P = "left", rt = "auto", $e = [D, F, H, P], ye = "start", De = "end", gi = "clippingParents", xt = "viewport", Ie = "popper", _i = "reference", kt = $e.reduce(function(i, e) {
+      var D = "top", H = "bottom", q = "right", P = "left", rt = "auto", $e = [D, H, q, P], ye = "start", De = "end", gi = "clippingParents", xt = "viewport", Ie = "popper", _i = "reference", kt = $e.reduce(function(i, e) {
         return i.concat([e + "-" + ye, e + "-" + De]);
       }, []), St = [].concat($e, [rt]).reduce(function(i, e) {
         return i.concat([e, e + "-" + ye, e + "-" + De]);
@@ -59,7 +60,7 @@ function Ur() {
       function ee(i) {
         return i ? (i.nodeName || "").toLowerCase() : null;
       }
-      function q(i) {
+      function z(i) {
         if (i == null) return window;
         if (i.toString() !== "[object Window]") {
           var e = i.ownerDocument;
@@ -68,13 +69,13 @@ function Ur() {
         return i;
       }
       function we(i) {
-        return i instanceof q(i).Element || i instanceof Element;
+        return i instanceof z(i).Element || i instanceof Element;
       }
       function B(i) {
-        return i instanceof q(i).HTMLElement || i instanceof HTMLElement;
+        return i instanceof z(i).HTMLElement || i instanceof HTMLElement;
       }
       function Lt(i) {
-        return typeof ShadowRoot < "u" && (i instanceof q(i).ShadowRoot || i instanceof ShadowRoot);
+        return typeof ShadowRoot < "u" && (i instanceof z(i).ShadowRoot || i instanceof ShadowRoot);
       }
       const $t = { name: "applyStyles", enabled: !0, phase: "write", fn: function(i) {
         var e = i.state;
@@ -115,7 +116,7 @@ function Ur() {
         e === void 0 && (e = !1), t === void 0 && (t = !1);
         var n = i.getBoundingClientRect(), s = 1, o = 1;
         e && B(i) && (s = i.offsetWidth > 0 && Pe(n.width) / i.offsetWidth || 1, o = i.offsetHeight > 0 && Pe(n.height) / i.offsetHeight || 1);
-        var r = (we(i) ? q(i) : window).visualViewport, a = !ki() && t, c = (n.left + (a && r ? r.offsetLeft : 0)) / s, h = (n.top + (a && r ? r.offsetTop : 0)) / o, d = n.width / s, u = n.height / o;
+        var r = (we(i) ? z(i) : window).visualViewport, a = !ki() && t, c = (n.left + (a && r ? r.offsetLeft : 0)) / s, h = (n.top + (a && r ? r.offsetTop : 0)) / o, d = n.width / s, u = n.height / o;
         return { width: d, height: u, top: h, right: c + d, bottom: h + u, left: c, x: c, y: h };
       }
       function It(i) {
@@ -135,7 +136,7 @@ function Ur() {
         return !1;
       }
       function oe(i) {
-        return q(i).getComputedStyle(i);
+        return z(i).getComputedStyle(i);
       }
       function fs(i) {
         return ["table", "td", "th"].indexOf(ee(i)) >= 0;
@@ -150,7 +151,7 @@ function Ur() {
         return B(i) && oe(i).position !== "fixed" ? i.offsetParent : null;
       }
       function Je(i) {
-        for (var e = q(i), t = Li(i); t && fs(t) && oe(t).position === "static"; ) t = Li(t);
+        for (var e = z(i), t = Li(i); t && fs(t) && oe(t).position === "static"; ) t = Li(t);
         return t && (ee(t) === "html" || ee(t) === "body" && oe(t).position === "static") ? e : t || (function(n) {
           var s = /firefox/i.test(Dt());
           if (/Trident/i.test(Dt()) && B(n) && oe(n).position === "fixed") return null;
@@ -178,11 +179,11 @@ function Ur() {
         }, {});
       }
       const Ii = { name: "arrow", enabled: !0, phase: "main", fn: function(i) {
-        var e, t = i.state, n = i.name, s = i.options, o = t.elements.arrow, r = t.modifiersData.popperOffsets, a = te(t.placement), c = Pt(a), h = [P, H].indexOf(a) >= 0 ? "height" : "width";
+        var e, t = i.state, n = i.name, s = i.options, o = t.elements.arrow, r = t.modifiersData.popperOffsets, a = te(t.placement), c = Pt(a), h = [P, q].indexOf(a) >= 0 ? "height" : "width";
         if (o && r) {
           var d = (function(O, T) {
             return $i(typeof (O = typeof O == "function" ? O(Object.assign({}, T.rects, { placement: T.placement })) : O) != "number" ? O : Di(O, $e));
-          })(s.padding, t), u = It(o), b = c === "y" ? D : P, p = c === "y" ? F : H, g = t.rects.reference[h] + t.rects.reference[c] - r[c] - t.rects.popper[h], m = r[c] - t.rects.reference[c], _ = Je(o), C = _ ? c === "y" ? _.clientHeight || 0 : _.clientWidth || 0 : 0, k = g / 2 - m / 2, y = d[b], A = C - u[h] - d[p], v = C / 2 - u[h] / 2 + k, w = Ge(y, v, A), E = c;
+          })(s.padding, t), u = It(o), b = c === "y" ? D : P, p = c === "y" ? H : q, g = t.rects.reference[h] + t.rects.reference[c] - r[c] - t.rects.popper[h], m = r[c] - t.rects.reference[c], _ = Je(o), C = _ ? c === "y" ? _.clientHeight || 0 : _.clientWidth || 0 : 0, k = g / 2 - m / 2, y = d[b], A = C - u[h] - d[p], v = C / 2 - u[h] / 2 + k, w = Ge(y, v, A), E = c;
           t.modifiersData[n] = ((e = {})[E] = w, e.centerOffset = w - v, e);
         }
       }, effect: function(i) {
@@ -199,13 +200,13 @@ function Ur() {
         var C = r.hasOwnProperty("x"), k = r.hasOwnProperty("y"), y = P, A = D, v = window;
         if (h) {
           var w = Je(t), E = "clientHeight", O = "clientWidth";
-          w === q(t) && oe(w = de(t)).position !== "static" && a === "absolute" && (E = "scrollHeight", O = "scrollWidth"), (s === D || (s === P || s === H) && o === De) && (A = F, m -= (u && w === v && v.visualViewport ? v.visualViewport.height : w[E]) - n.height, m *= c ? 1 : -1), s !== P && (s !== D && s !== F || o !== De) || (y = H, p -= (u && w === v && v.visualViewport ? v.visualViewport.width : w[O]) - n.width, p *= c ? 1 : -1);
+          w === z(t) && oe(w = de(t)).position !== "static" && a === "absolute" && (E = "scrollHeight", O = "scrollWidth"), (s === D || (s === P || s === q) && o === De) && (A = H, m -= (u && w === v && v.visualViewport ? v.visualViewport.height : w[E]) - n.height, m *= c ? 1 : -1), s !== P && (s !== D && s !== H || o !== De) || (y = q, p -= (u && w === v && v.visualViewport ? v.visualViewport.width : w[O]) - n.width, p *= c ? 1 : -1);
         }
-        var T, L = Object.assign({ position: a }, h && ps), W = d === !0 ? (function(G, N) {
+        var T, L = Object.assign({ position: a }, h && ps), R = d === !0 ? (function(G, N) {
           var Q = G.x, X = G.y, S = N.devicePixelRatio || 1;
           return { x: Pe(Q * S) / S || 0, y: Pe(X * S) / S || 0 };
-        })({ x: p, y: m }, q(t)) : { x: p, y: m };
-        return p = W.x, m = W.y, c ? Object.assign({}, L, ((T = {})[A] = k ? "0" : "", T[y] = C ? "0" : "", T.transform = (v.devicePixelRatio || 1) <= 1 ? "translate(" + p + "px, " + m + "px)" : "translate3d(" + p + "px, " + m + "px, 0)", T)) : Object.assign({}, L, ((e = {})[A] = k ? m + "px" : "", e[y] = C ? p + "px" : "", e.transform = "", e));
+        })({ x: p, y: m }, z(t)) : { x: p, y: m };
+        return p = R.x, m = R.y, c ? Object.assign({}, L, ((T = {})[A] = k ? "0" : "", T[y] = C ? "0" : "", T.transform = (v.devicePixelRatio || 1) <= 1 ? "translate(" + p + "px, " + m + "px)" : "translate3d(" + p + "px, " + m + "px, 0)", T)) : Object.assign({}, L, ((e = {})[A] = k ? m + "px" : "", e[y] = C ? p + "px" : "", e.transform = "", e));
       }
       const Nt = { name: "computeStyles", enabled: !0, phase: "beforeWrite", fn: function(i) {
         var e = i.state, t = i.options, n = t.gpuAcceleration, s = n === void 0 || n, o = t.adaptive, r = o === void 0 || o, a = t.roundOffsets, c = a === void 0 || a, h = { placement: te(e.placement), variation: je(e.placement), popper: e.elements.popper, popperRect: e.rects.popper, gpuAcceleration: s, isFixed: e.options.strategy === "fixed" };
@@ -214,7 +215,7 @@ function Ur() {
       var ct = { passive: !0 };
       const jt = { name: "eventListeners", enabled: !0, phase: "write", fn: function() {
       }, effect: function(i) {
-        var e = i.state, t = i.instance, n = i.options, s = n.scroll, o = s === void 0 || s, r = n.resize, a = r === void 0 || r, c = q(e.elements.popper), h = [].concat(e.scrollParents.reference, e.scrollParents.popper);
+        var e = i.state, t = i.instance, n = i.options, s = n.scroll, o = s === void 0 || s, r = n.resize, a = r === void 0 || r, c = z(e.elements.popper), h = [].concat(e.scrollParents.reference, e.scrollParents.popper);
         return o && h.forEach(function(d) {
           d.addEventListener("scroll", t.update, ct);
         }), a && c.addEventListener("resize", t.update, ct), function() {
@@ -236,7 +237,7 @@ function Ur() {
         });
       }
       function Mt(i) {
-        var e = q(i);
+        var e = z(i);
         return { scrollLeft: e.pageXOffset, scrollTop: e.pageYOffset };
       }
       function Ft(i) {
@@ -252,7 +253,7 @@ function Ur() {
       function Ze(i, e) {
         var t;
         e === void 0 && (e = []);
-        var n = ji(i), s = n === ((t = i.ownerDocument) == null ? void 0 : t.body), o = q(n), r = s ? [o].concat(o.visualViewport || [], Ht(n) ? n : []) : n, a = e.concat(r);
+        var n = ji(i), s = n === ((t = i.ownerDocument) == null ? void 0 : t.body), o = z(n), r = s ? [o].concat(o.visualViewport || [], Ht(n) ? n : []) : n, a = e.concat(r);
         return s ? a : a.concat(Ze(lt(r)));
       }
       function qt(i) {
@@ -260,7 +261,7 @@ function Ur() {
       }
       function Mi(i, e, t) {
         return e === xt ? qt((function(n, s) {
-          var o = q(n), r = de(n), a = o.visualViewport, c = r.clientWidth, h = r.clientHeight, d = 0, u = 0;
+          var o = z(n), r = de(n), a = o.visualViewport, c = r.clientWidth, h = r.clientHeight, d = 0, u = 0;
           if (a) {
             c = a.width, h = a.height;
             var b = ki();
@@ -281,10 +282,10 @@ function Ur() {
           case D:
             e = { x: a, y: t.y - n.height };
             break;
-          case F:
+          case H:
             e = { x: a, y: t.y + t.height };
             break;
-          case H:
+          case q:
             e = { x: t.x + t.width, y: c };
             break;
           case P:
@@ -319,11 +320,11 @@ function Ur() {
             return x.top = Ae(Y.top, x.top), x.right = at(Y.right, x.right), x.bottom = at(Y.bottom, x.bottom), x.left = Ae(Y.left, x.left), x;
           }, Mi(N, Xe, S));
           return I.width = I.right - I.left, I.height = I.bottom - I.top, I.x = I.left, I.y = I.top, I;
-        })(we(A) ? A : A.contextElement || de(i.elements.popper), c, d, r), w = Ne(i.elements.reference), E = Fi({ reference: w, element: y, placement: s }), O = qt(Object.assign({}, y, E)), T = b === Ie ? O : w, L = { top: v.top - T.top + C.top, bottom: T.bottom - v.bottom + C.bottom, left: v.left - T.left + C.left, right: T.right - v.right + C.right }, W = i.modifiersData.offset;
-        if (b === Ie && W) {
-          var G = W[s];
+        })(we(A) ? A : A.contextElement || de(i.elements.popper), c, d, r), w = Ne(i.elements.reference), E = Fi({ reference: w, element: y, placement: s }), O = qt(Object.assign({}, y, E)), T = b === Ie ? O : w, L = { top: v.top - T.top + C.top, bottom: T.bottom - v.bottom + C.bottom, left: v.left - T.left + C.left, right: T.right - v.right + C.right }, R = i.modifiersData.offset;
+        if (b === Ie && R) {
+          var G = R[s];
           Object.keys(L).forEach(function(N) {
-            var Q = [H, F].indexOf(N) >= 0 ? 1 : -1, X = [D, F].indexOf(N) >= 0 ? "y" : "x";
+            var Q = [q, H].indexOf(N) >= 0 ? 1 : -1, X = [D, H].indexOf(N) >= 0 ? "y" : "x";
             L[N] += G[X] * Q;
           });
         }
@@ -354,10 +355,10 @@ function Ur() {
           })(_) : [ut(_)]), y = [_].concat(k).reduce(function(x, j) {
             return x.concat(te(j) === rt ? _s(e, { placement: j, boundary: d, rootBoundary: u, padding: h, flipVariations: g, allowedAutoPlacements: m }) : j);
           }, []), A = e.rects.reference, v = e.rects.popper, w = /* @__PURE__ */ new Map(), E = !0, O = y[0], T = 0; T < y.length; T++) {
-            var L = y[T], W = te(L), G = je(L) === ye, N = [D, F].indexOf(W) >= 0, Q = N ? "width" : "height", X = Me(e, { placement: L, boundary: d, rootBoundary: u, altBoundary: b, padding: h }), S = N ? G ? H : P : G ? F : D;
+            var L = y[T], R = te(L), G = je(L) === ye, N = [D, H].indexOf(R) >= 0, Q = N ? "width" : "height", X = Me(e, { placement: L, boundary: d, rootBoundary: u, altBoundary: b, padding: h }), S = N ? G ? q : P : G ? H : D;
             A[Q] > v[Q] && (S = ut(S));
             var ne = ut(S), se = [];
-            if (o && se.push(X[W] <= 0), a && se.push(X[S] <= 0, X[ne] <= 0), se.every(function(x) {
+            if (o && se.push(X[R] <= 0), a && se.push(X[S] <= 0, X[ne] <= 0), se.every(function(x) {
               return x;
             })) {
               O = L, E = !1;
@@ -381,7 +382,7 @@ function Ur() {
         return t === void 0 && (t = { x: 0, y: 0 }), { top: i.top - e.height - t.y, right: i.right - e.width + t.x, bottom: i.bottom - e.height + t.y, left: i.left - e.width - t.x };
       }
       function zi(i) {
-        return [D, H, F, P].some(function(e) {
+        return [D, q, H, P].some(function(e) {
           return i[e] >= 0;
         });
       }
@@ -392,7 +393,7 @@ function Ur() {
         var e = i.state, t = i.options, n = i.name, s = t.offset, o = s === void 0 ? [0, 0] : s, r = St.reduce(function(d, u) {
           return d[u] = (function(b, p, g) {
             var m = te(b), _ = [P, D].indexOf(m) >= 0 ? -1 : 1, C = typeof g == "function" ? g(Object.assign({}, p, { placement: b })) : g, k = C[0], y = C[1];
-            return k = k || 0, y = (y || 0) * _, [P, H].indexOf(m) >= 0 ? { x: y, y: k } : { x: k, y };
+            return k = k || 0, y = (y || 0) * _, [P, q].indexOf(m) >= 0 ? { x: y, y: k } : { x: k, y };
           })(u, e.rects, o), d;
         }, {}), a = r[e.placement], c = a.x, h = a.y;
         e.modifiersData.popperOffsets != null && (e.modifiersData.popperOffsets.x += c, e.modifiersData.popperOffsets.y += h), e.modifiersData[n] = r;
@@ -400,14 +401,14 @@ function Ur() {
         var e = i.state, t = i.name;
         e.modifiersData[t] = Fi({ reference: e.rects.reference, element: e.rects.popper, placement: e.placement });
       }, data: {} }, Bi = { name: "preventOverflow", enabled: !0, phase: "main", fn: function(i) {
-        var e = i.state, t = i.options, n = i.name, s = t.mainAxis, o = s === void 0 || s, r = t.altAxis, a = r !== void 0 && r, c = t.boundary, h = t.rootBoundary, d = t.altBoundary, u = t.padding, b = t.tether, p = b === void 0 || b, g = t.tetherOffset, m = g === void 0 ? 0 : g, _ = Me(e, { boundary: c, rootBoundary: h, padding: u, altBoundary: d }), C = te(e.placement), k = je(e.placement), y = !k, A = Pt(C), v = A === "x" ? "y" : "x", w = e.modifiersData.popperOffsets, E = e.rects.reference, O = e.rects.popper, T = typeof m == "function" ? m(Object.assign({}, e.rects, { placement: e.placement })) : m, L = typeof T == "number" ? { mainAxis: T, altAxis: T } : Object.assign({ mainAxis: 0, altAxis: 0 }, T), W = e.modifiersData.offset ? e.modifiersData.offset[e.placement] : null, G = { x: 0, y: 0 };
+        var e = i.state, t = i.options, n = i.name, s = t.mainAxis, o = s === void 0 || s, r = t.altAxis, a = r !== void 0 && r, c = t.boundary, h = t.rootBoundary, d = t.altBoundary, u = t.padding, b = t.tether, p = b === void 0 || b, g = t.tetherOffset, m = g === void 0 ? 0 : g, _ = Me(e, { boundary: c, rootBoundary: h, padding: u, altBoundary: d }), C = te(e.placement), k = je(e.placement), y = !k, A = Pt(C), v = A === "x" ? "y" : "x", w = e.modifiersData.popperOffsets, E = e.rects.reference, O = e.rects.popper, T = typeof m == "function" ? m(Object.assign({}, e.rects, { placement: e.placement })) : m, L = typeof T == "number" ? { mainAxis: T, altAxis: T } : Object.assign({ mainAxis: 0, altAxis: 0 }, T), R = e.modifiersData.offset ? e.modifiersData.offset[e.placement] : null, G = { x: 0, y: 0 };
         if (w) {
           if (o) {
-            var N, Q = A === "y" ? D : P, X = A === "y" ? F : H, S = A === "y" ? "height" : "width", ne = w[A], se = ne + _[Q], Xe = ne - _[X], I = p ? -O[S] / 2 : 0, x = k === ye ? E[S] : O[S], j = k === ye ? -O[S] : -E[S], Y = e.elements.arrow, ve = p && Y ? It(Y) : { width: 0, height: 0 }, Tt = e.modifiersData["arrow#persistent"] ? e.modifiersData["arrow#persistent"].padding : { top: 0, right: 0, bottom: 0, left: 0 }, Zn = Tt[Q], es = Tt[X], Ct = Ge(0, E[S], ve[S]), Pr = y ? E[S] / 2 - I - Ct - Zn - L.mainAxis : x - Ct - Zn - L.mainAxis, Nr = y ? -E[S] / 2 + I + Ct + es + L.mainAxis : j + Ct + es + L.mainAxis, fi = e.elements.arrow && Je(e.elements.arrow), jr = fi ? A === "y" ? fi.clientTop || 0 : fi.clientLeft || 0 : 0, ts = (N = W?.[A]) != null ? N : 0, Mr = ne + Nr - ts, is = Ge(p ? at(se, ne + Pr - ts - jr) : se, ne, p ? Ae(Xe, Mr) : Xe);
+            var N, Q = A === "y" ? D : P, X = A === "y" ? H : q, S = A === "y" ? "height" : "width", ne = w[A], se = ne + _[Q], Xe = ne - _[X], I = p ? -O[S] / 2 : 0, x = k === ye ? E[S] : O[S], j = k === ye ? -O[S] : -E[S], Y = e.elements.arrow, ve = p && Y ? It(Y) : { width: 0, height: 0 }, Tt = e.modifiersData["arrow#persistent"] ? e.modifiersData["arrow#persistent"].padding : { top: 0, right: 0, bottom: 0, left: 0 }, Zn = Tt[Q], es = Tt[X], Ct = Ge(0, E[S], ve[S]), Pr = y ? E[S] / 2 - I - Ct - Zn - L.mainAxis : x - Ct - Zn - L.mainAxis, Nr = y ? -E[S] / 2 + I + Ct + es + L.mainAxis : j + Ct + es + L.mainAxis, fi = e.elements.arrow && Je(e.elements.arrow), jr = fi ? A === "y" ? fi.clientTop || 0 : fi.clientLeft || 0 : 0, ts = (N = R?.[A]) != null ? N : 0, Mr = ne + Nr - ts, is = Ge(p ? at(se, ne + Pr - ts - jr) : se, ne, p ? Ae(Xe, Mr) : Xe);
             w[A] = is, G[A] = is - ne;
           }
           if (a) {
-            var ns, Fr = A === "x" ? D : P, Hr = A === "x" ? F : H, Le = w[v], Ot = v === "y" ? "height" : "width", ss = Le + _[Fr], os = Le - _[Hr], pi = [D, P].indexOf(C) !== -1, rs = (ns = W?.[v]) != null ? ns : 0, as = pi ? ss : Le - E[Ot] - O[Ot] - rs + L.altAxis, ls = pi ? Le + E[Ot] + O[Ot] - rs - L.altAxis : os, cs = p && pi ? (function(qr, zr, mi) {
+            var ns, Fr = A === "x" ? D : P, Hr = A === "x" ? H : q, Le = w[v], Ot = v === "y" ? "height" : "width", ss = Le + _[Fr], os = Le - _[Hr], pi = [D, P].indexOf(C) !== -1, rs = (ns = R?.[v]) != null ? ns : 0, as = pi ? ss : Le - E[Ot] - O[Ot] - rs + L.altAxis, ls = pi ? Le + E[Ot] + O[Ot] - rs - L.altAxis : os, cs = p && pi ? (function(qr, zr, mi) {
               var us = Ge(qr, zr, mi);
               return us > mi ? mi : us;
             })(as, Le, ls) : Ge(p ? as : ss, Le, p ? ls : os);
@@ -422,7 +423,7 @@ function Ur() {
           var b = u.getBoundingClientRect(), p = Pe(b.width) / u.offsetWidth || 1, g = Pe(b.height) / u.offsetHeight || 1;
           return p !== 1 || g !== 1;
         })(e), a = de(e), c = Ne(i, r, t), h = { scrollLeft: 0, scrollTop: 0 }, d = { x: 0, y: 0 };
-        return (o || !o && !t) && ((ee(e) !== "body" || Ht(a)) && (h = (n = e) !== q(n) && B(n) ? { scrollLeft: (s = n).scrollLeft, scrollTop: s.scrollTop } : Mt(n)), B(e) ? ((d = Ne(e, !0)).x += e.clientLeft, d.y += e.clientTop) : a && (d.x = Ft(a))), { x: c.left + h.scrollLeft - d.x, y: c.top + h.scrollTop - d.y, width: c.width, height: c.height };
+        return (o || !o && !t) && ((ee(e) !== "body" || Ht(a)) && (h = (n = e) !== z(n) && B(n) ? { scrollLeft: (s = n).scrollLeft, scrollTop: s.scrollTop } : Mt(n)), B(e) ? ((d = Ne(e, !0)).x += e.clientLeft, d.y += e.clientTop) : a && (d.x = Ft(a))), { x: c.left + h.scrollLeft - d.x, y: c.top + h.scrollTop - d.y, width: c.width, height: c.height };
       }
       function vs(i) {
         var e = /* @__PURE__ */ new Map(), t = /* @__PURE__ */ new Set(), n = [];
@@ -516,7 +517,7 @@ function Ur() {
         };
       }
       var ys = ht(), ws = ht({ defaultModifiers: [jt, zt, Nt, $t] }), Wt = ht({ defaultModifiers: [jt, zt, Nt, $t, Ri, Hi, Bi, Ii, Wi] });
-      const Ki = Object.freeze(Object.defineProperty({ __proto__: null, afterMain: Ei, afterRead: yi, afterWrite: Oi, applyStyles: $t, arrow: Ii, auto: rt, basePlacements: $e, beforeMain: wi, beforeRead: bi, beforeWrite: Ti, bottom: F, clippingParents: gi, computeStyles: Nt, createPopper: Wt, createPopperBase: ys, createPopperLite: ws, detectOverflow: Me, end: De, eventListeners: jt, flip: Hi, hide: Wi, left: P, main: Ai, modifierPhases: xi, offset: Ri, placements: St, popper: Ie, popperGenerator: ht, popperOffsets: zt, preventOverflow: Bi, read: vi, reference: _i, right: H, start: ye, top: D, variationPlacements: kt, viewport: xt, write: Ci }, Symbol.toStringTag, { value: "Module" })), fe = /* @__PURE__ */ new Map(), Rt = { set(i, e, t) {
+      const Ki = Object.freeze(Object.defineProperty({ __proto__: null, afterMain: Ei, afterRead: yi, afterWrite: Oi, applyStyles: $t, arrow: Ii, auto: rt, basePlacements: $e, beforeMain: wi, beforeRead: bi, beforeWrite: Ti, bottom: H, clippingParents: gi, computeStyles: Nt, createPopper: Wt, createPopperBase: ys, createPopperLite: ws, detectOverflow: Me, end: De, eventListeners: jt, flip: Hi, hide: Wi, left: P, main: Ai, modifierPhases: xi, offset: Ri, placements: St, popper: Ie, popperGenerator: ht, popperOffsets: zt, preventOverflow: Bi, read: vi, reference: _i, right: q, start: ye, top: D, variationPlacements: kt, viewport: xt, write: Ci }, Symbol.toStringTag, { value: "Module" })), fe = /* @__PURE__ */ new Map(), Rt = { set(i, e, t) {
         fe.has(i) || fe.set(i, /* @__PURE__ */ new Map());
         const n = fe.get(i);
         n.has(e) || n.size === 0 ? n.set(e, t) : console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(n.keys())[0]}.`);
@@ -1101,7 +1102,7 @@ function Ur() {
         for (const e of f.getMultipleElementsFromSelector(this)) Te.getOrCreateInstance(e, { toggle: !1 }).toggle();
       }), U(Te);
       const mn = "dropdown", Ce = ".bs.dropdown", ti = ".data-api", so = "ArrowUp", gn = "ArrowDown", oo = `hide${Ce}`, ro = `hidden${Ce}`, ao = `show${Ce}`, lo = `shown${Ce}`, _n = `click${Ce}${ti}`, bn = `keydown${Ce}${ti}`, co = `keyup${Ce}${ti}`, Ve = "show", Oe = '[data-bs-toggle="dropdown"]:not(.disabled):not(:disabled)', uo = `${Oe}.${Ve}`, bt = ".dropdown-menu", ho = V() ? "top-end" : "top-start", fo = V() ? "top-start" : "top-end", po = V() ? "bottom-end" : "bottom-start", mo = V() ? "bottom-start" : "bottom-end", go = V() ? "left-start" : "right-start", _o = V() ? "right-start" : "left-start", bo = { autoClose: !0, boundary: "clippingParents", display: "dynamic", offset: [0, 2], popperConfig: null, reference: "toggle" }, vo = { autoClose: "(boolean|string)", boundary: "(string|element)", display: "string", offset: "(array|string|function)", popperConfig: "(null|object|function)", reference: "(string|element|object)" };
-      class z extends J {
+      class W extends J {
         constructor(e, t) {
           super(e, t), this._popper = null, this._parent = this._element.parentNode, this._menu = f.next(this._element, bt)[0] || f.prev(this._element, bt)[0] || f.findOne(bt, this._parent), this._inNavbar = this._detectNavbar();
         }
@@ -1182,7 +1183,7 @@ function Ur() {
         }
         static jQueryInterface(e) {
           return this.each(function() {
-            const t = z.getOrCreateInstance(this, e);
+            const t = W.getOrCreateInstance(this, e);
             if (typeof e == "string") {
               if (t[e] === void 0) throw new TypeError(`No method named "${e}"`);
               t[e]();
@@ -1193,7 +1194,7 @@ function Ur() {
           if (e.button === 2 || e.type === "keyup" && e.key !== "Tab") return;
           const t = f.find(uo);
           for (const n of t) {
-            const s = z.getInstance(n);
+            const s = W.getInstance(n);
             if (!s || s._config.autoClose === !1) continue;
             const o = e.composedPath(), r = o.includes(s._menu);
             if (o.includes(s._element) || s._config.autoClose === "inside" && !r || s._config.autoClose === "outside" && r || s._menu.contains(e.target) && (e.type === "keyup" && e.key === "Tab" || /input|select|option|textarea|form/i.test(e.target.tagName))) continue;
@@ -1205,14 +1206,14 @@ function Ur() {
           const t = /input|textarea/i.test(e.target.tagName), n = e.key === "Escape", s = [so, gn].includes(e.key);
           if (!s && !n || t && !n) return;
           e.preventDefault();
-          const o = this.matches(Oe) ? this : f.prev(this, Oe)[0] || f.next(this, Oe)[0] || f.findOne(Oe, e.delegateTarget.parentNode), r = z.getOrCreateInstance(o);
+          const o = this.matches(Oe) ? this : f.prev(this, Oe)[0] || f.next(this, Oe)[0] || f.findOne(Oe, e.delegateTarget.parentNode), r = W.getOrCreateInstance(o);
           if (s) return e.stopPropagation(), r.show(), void r._selectMenuItem(e);
           r._isShown() && (e.stopPropagation(), r.hide(), o.focus());
         }
       }
-      l.on(document, bn, Oe, z.dataApiKeydownHandler), l.on(document, bn, bt, z.dataApiKeydownHandler), l.on(document, _n, z.clearMenus), l.on(document, co, z.clearMenus), l.on(document, _n, Oe, function(i) {
-        i.preventDefault(), z.getOrCreateInstance(this).toggle();
-      }), U(z);
+      l.on(document, bn, Oe, W.dataApiKeydownHandler), l.on(document, bn, bt, W.dataApiKeydownHandler), l.on(document, _n, W.clearMenus), l.on(document, co, W.clearMenus), l.on(document, _n, Oe, function(i) {
+        i.preventDefault(), W.getOrCreateInstance(this).toggle();
+      }), U(W);
       const vn = "backdrop", yn = "show", wn = `mousedown.bs.${vn}`, yo = { className: "modal-backdrop", clickCallback: null, isAnimated: !1, isVisible: !0, rootElement: "body" }, wo = { className: "string", clickCallback: "(function|null)", isAnimated: "boolean", isVisible: "boolean", rootElement: "(element|string)" };
       class An extends tt {
         constructor(e) {
@@ -2034,10 +2035,10 @@ function Ur() {
         }
       }
       ft(Se), U(Se);
-      const Dr = Object.freeze(Object.defineProperty({ __proto__: null, Alert: He, Button: qe, Carousel: Ee, Collapse: Te, Dropdown: z, Modal: _e, Offcanvas: ie, Popover: Ue, ScrollSpy: Qe, Tab: ue, Toast: Se, Tooltip: ce }, Symbol.toStringTag, { value: "Module" }));
+      const Dr = Object.freeze(Object.defineProperty({ __proto__: null, Alert: He, Button: qe, Carousel: Ee, Collapse: Te, Dropdown: W, Modal: _e, Offcanvas: ie, Popover: Ue, ScrollSpy: Qe, Tab: ue, Toast: Se, Tooltip: ce }, Symbol.toStringTag, { value: "Module" }));
       [].slice.call(document.querySelectorAll('[data-bs-toggle="dropdown"]')).map(function(i) {
         let e = { boundary: i.getAttribute("data-bs-boundary") === "viewport" ? document.querySelector(".btn") : "clippingParents" };
-        return new z(i, e);
+        return new W(i, e);
       }), [].slice.call(document.querySelectorAll('[data-bs-toggle="tooltip"]')).map(function(i) {
         let e = { delay: { show: 50, hide: 50 }, html: i.getAttribute("data-bs-html") === "true", placement: i.getAttribute("data-bs-placement") ?? "auto" };
         return new ce(i, e);
@@ -2067,20 +2068,25 @@ function Ur() {
         const t = getComputedStyle(document.body).getPropertyValue(`--${Jn}${i}`).trim();
         return e !== 1 ? Gn(t, e) : t;
       }, hexToRgba: Gn, prefix: Jn }, Symbol.toStringTag, { value: "Module" }));
-      $.Alert = He, $.Button = qe, $.Carousel = Ee, $.Collapse = Te, $.Dropdown = z, $.Modal = _e, $.Offcanvas = ie, $.Popover = Ue, $.ScrollSpy = Qe, $.Tab = ue, $.Toast = Se, $.Tooltip = ce, $.bootstrap = Dr, $.tabler = Ir, Object.defineProperty($, Symbol.toStringTag, { value: "Module" });
+      $.Alert = He, $.Button = qe, $.Carousel = Ee, $.Collapse = Te, $.Dropdown = W, $.Modal = _e, $.Offcanvas = ie, $.Popover = Ue, $.ScrollSpy = Qe, $.Tab = ue, $.Toast = Se, $.Tooltip = ce, $.bootstrap = Dr, $.tabler = Ir, Object.defineProperty($, Symbol.toStringTag, { value: "Module" });
     });
   })(ot, ot.exports)), ot.exports;
 }
-var ds = Ur();
-const Kr = /* @__PURE__ */ Br(ds), Qr = /* @__PURE__ */ Rr({
+var ds = Kr();
+const Qr = /* @__PURE__ */ Vr(ds), Xr = /* @__PURE__ */ Br({
   __proto__: null,
-  default: Kr
+  default: Qr
 }, [ds]), Yr = {
+  transition: "Vue-Toastification__bounce",
+  maxToasts: 20,
+  newestOnTop: !0,
+  toastClassName: "custom-toast-class"
+}, Zr = {
   // até o momento não usamos opções nem o app, mas deixei aqui caso precise no futuro
-  install: (R, Ye) => {
-    window.bootstrap = Qr, R.directive("required", Wr);
+  install: (F, Ye) => {
+    window.bootstrap = Xr, F.directive("required", Wr), F.use(Rr, Yr);
   }
 };
 export {
-  Yr as S
+  Zr as S
 };

package/dist/toast/components/ToastComponent.vue.d.ts

@@ -0,0 +1,6 @@
+declare const _default: import('vue').DefineComponent<{
+    content?: any;
+}, {}, {}, {}, {}, import('vue').ComponentOptionsMixin, import('vue').ComponentOptionsMixin, {}, string, import('vue').PublicProps, Readonly<{
+    content?: any;
+}> & Readonly<{}>, {}, {}, {}, {}, string, import('vue').ComponentProvideOptions, true, {}, HTMLDivElement>;
+export default _default;

package/dist/toast/index.d.ts

@@ -0,0 +1 @@
+export { useToastStore } from './useToastStore';

package/dist/toast/useToastStore.d.ts

@@ -0,0 +1,15 @@
+/**
+ * Define os tipos de toast aceitos.
+ * 1 = success
+ * 2 = error
+ * 3 = info
+ */
+type ToastStoreType = 1 | 2 | 3;
+export declare const useToastStore: import('pinia').StoreDefinition<"toastStore", Pick<{
+    showToast: (title: string, body: string, type: ToastStoreType) => void;
+}, never>, Pick<{
+    showToast: (title: string, body: string, type: ToastStoreType) => void;
+}, never>, Pick<{
+    showToast: (title: string, body: string, type: ToastStoreType) => void;
+}, "showToast">>;
+export {};

package/dist/toast.js

@@ -0,0 +1,50 @@
+import { u as a } from "./index-SOrsDdYZ.js";
+import { defineComponent as i, createElementBlock as p, openBlock as l, createElementVNode as n, toDisplayString as m } from "vue";
+import { defineStore as d } from "pinia";
+const _ = { class: "t-container" }, f = { class: "d-flex flex-column gap-1" }, u = { class: "m-0 p-0 fs-3 bold" }, h = ["innerHTML"], T = /* @__PURE__ */ i({
+  __name: "ToastComponent",
+  props: ["content"],
+  setup(s) {
+    const t = s;
+    return (c, r) => (l(), p("div", _, [
+      n("div", f, [
+        n("h1", u, m(t.content.title), 1),
+        n("p", {
+          class: "m-0 p-0 text-white",
+          innerHTML: t.content.body
+        }, null, 8, h)
+      ])
+    ]));
+  }
+}), w = d("toastStore", () => ({
+  showToast: (t, c, r) => {
+    const o = a(), e = {
+      component: T,
+      props: {
+        content: {
+          title: t,
+          body: c
+        }
+      }
+    };
+    switch (r) {
+      case 1:
+        o.success(e, {});
+        break;
+      case 2:
+        o.error(e, {
+          timeout: 7e3
+        });
+        break;
+      case 3:
+        o.info(e, {});
+        break;
+      default:
+        console.info("Tipo de toast não encontrado");
+        break;
+    }
+  }
+}));
+export {
+  w as useToastStore
+};

package/dist/v-sistec-features.css

@@ -8,4 +8,4 @@
 * Copyright 2018-2025 The Tabler Authors
 * Copyright 2018-2025 codecalm.net Paweł Kuna
 * Licensed under MIT (https://github.com/tabler/tabler/blob/master/LICENSE)
-*/[data-bs-theme-base=slate]{--tblr-gray-50:#f8fafc;--tblr-gray-100:#f1f5f9;--tblr-gray-200:#e2e8f0;--tblr-gray-300:#cbd5e1;--tblr-gray-400:#94a3b8;--tblr-gray-500:#64748b;--tblr-gray-600:#475569;--tblr-gray-700:#334155;--tblr-gray-800:#1e293b;--tblr-gray-900:#0f172a;--tblr-gray-950:#020617}[data-bs-theme-base=gray]{--tblr-gray-50:#f9fafb;--tblr-gray-100:#f3f4f6;--tblr-gray-200:#e5e7eb;--tblr-gray-300:#d1d5db;--tblr-gray-400:#9ca3af;--tblr-gray-500:#6b7280;--tblr-gray-600:#4b5563;--tblr-gray-700:#374151;--tblr-gray-800:#1f2937;--tblr-gray-900:#111827;--tblr-gray-950:#030712}[data-bs-theme-base=zinc]{--tblr-gray-50:#fafafa;--tblr-gray-100:#f4f4f5;--tblr-gray-200:#e4e4e7;--tblr-gray-300:#d4d4d8;--tblr-gray-400:#a1a1aa;--tblr-gray-500:#71717a;--tblr-gray-600:#52525b;--tblr-gray-700:#3f3f46;--tblr-gray-800:#27272a;--tblr-gray-900:#18181b;--tblr-gray-950:#09090b}[data-bs-theme-base=neutral]{--tblr-gray-50:#fafafa;--tblr-gray-100:#f5f5f5;--tblr-gray-200:#e5e5e5;--tblr-gray-300:#d4d4d4;--tblr-gray-400:#a3a3a3;--tblr-gray-500:#737373;--tblr-gray-600:#525252;--tblr-gray-700:#404040;--tblr-gray-800:#262626;--tblr-gray-900:#171717;--tblr-gray-950:#0a0a0a}[data-bs-theme-base=stone]{--tblr-gray-50:#fafaf9;--tblr-gray-100:#f5f5f4;--tblr-gray-200:#e7e5e4;--tblr-gray-300:#d6d3d1;--tblr-gray-400:#a8a29e;--tblr-gray-500:#78716c;--tblr-gray-600:#57534e;--tblr-gray-700:#44403c;--tblr-gray-800:#292524;--tblr-gray-900:#1c1917;--tblr-gray-950:#0c0a09}[data-bs-theme-base=pink]{--tblr-gray-50:#fdf2f8;--tblr-gray-100:#fce7f3;--tblr-gray-200:#fbcfe8;--tblr-gray-300:#f9a8d4;--tblr-gray-400:#f472b6;--tblr-gray-500:#ec4899;--tblr-gray-600:#db2777;--tblr-gray-700:#be185d;--tblr-gray-800:#9d174d;--tblr-gray-900:#831843;--tblr-gray-950:#500724}[data-bs-theme-primary=blue]{--tblr-primary:#066fd1;--tblr-primary-rgb:6,111,209}[data-bs-theme-primary=azure]{--tblr-primary:#4299e1;--tblr-primary-rgb:66,153,225}[data-bs-theme-primary=indigo]{--tblr-primary:#4263eb;--tblr-primary-rgb:66,99,235}[data-bs-theme-primary=purple]{--tblr-primary:#ae3ec9;--tblr-primary-rgb:174,62,201}[data-bs-theme-primary=pink]{--tblr-primary:#d6336c;--tblr-primary-rgb:214,51,108}[data-bs-theme-primary=red]{--tblr-primary:#d63939;--tblr-primary-rgb:214,57,57}[data-bs-theme-primary=orange]{--tblr-primary:#f76707;--tblr-primary-rgb:247,103,7}[data-bs-theme-primary=yellow]{--tblr-primary:#f59f00;--tblr-primary-rgb:245,159,0}[data-bs-theme-primary=lime]{--tblr-primary:#74b816;--tblr-primary-rgb:116,184,22}[data-bs-theme-primary=green]{--tblr-primary:#2fb344;--tblr-primary-rgb:47,179,68}[data-bs-theme-primary=teal]{--tblr-primary:#0ca678;--tblr-primary-rgb:12,166,120}[data-bs-theme-primary=cyan]{--tblr-primary:#17a2b8;--tblr-primary-rgb:23,162,184}[data-bs-theme-radius="0"]{--tblr-border-radius-scale:0}[data-bs-theme-radius="0.5"]{--tblr-border-radius-scale:.5}[data-bs-theme-radius="1"]{--tblr-border-radius-scale:1}[data-bs-theme-radius="1.5"]{--tblr-border-radius-scale:1.5}[data-bs-theme-radius="2"]{--tblr-border-radius-scale:2}[data-bs-theme-primary=inverted]{--tblr-primary:var(--tblr-gray-800);--tblr-primary-fg:var(--tblr-light);--tblr-primary-rgb:31,41,55}[data-bs-theme-primary=inverted] [data-bs-theme=dark],[data-bs-theme-primary=inverted][data-bs-theme=dark]{--tblr-primary:#f9fafb;--tblr-primary-fg:var(--tblr-dark);--tblr-primary-rgb:249,250,251}[data-bs-theme-font=monospace]{--tblr-body-font-family:var(--tblr-font-monospace);--tblr-body-font-size:80%}[data-bs-theme-font=sans-serif]{--tblr-body-font-family:var(--tblr-font-sans-serif)}[data-bs-theme-font=serif]{--tblr-body-font-family:var(--tblr-font-serif)}[data-bs-theme-font=comic]{--tblr-body-font-family:var(--tblr-font-comic)}:root{--color-error-inputs: red}[data-bs-theme=dark]{--color-error-inputs: oklch(.666 .179 58.318)}.style-custom-v-required-default{display:flex!important;justify-content:center!important;flex-direction:column!important;gap:2px}.style-custom-v-required-error .v-required-span{color:var(--color-error-inputs)!important;white-space:pre-wrap}.multiselect__tags{background-color:var(--cor-bg-inputs);border:var(--border-inputs);border-radius:5px!important;font-size:.875rem;line-height:1.4285714286}.multiselect__placeholder{color:var(--color-text-multiselect)!important}.style-custom-v-required-error input,.style-custom-v-required-error select,.style-custom-v-required-error textarea{border:2px solid var(--color-error-inputs)!important;color:var(--color-error-inputs)!important}.style-custom-v-required-error .multiselect__tags{border:2px solid var(--color-error-inputs)!important}.style-custom-v-required-error .multiselect__input{border:none!important}.style-custom-v-required-error .multiselect__placeholder{color:var(--color-error-inputs)!important}.style-custom-v-required-error .image-drop-zone{border-color:var(--color-error-inputs)!important}.style-custom-v-required-error .quillWrapper{border:2px solid var(--color-error-inputs)!important}.style-custom-v-required-error input::placeholder{color:var(--color-error-inputs)!important}.rotate-180[data-v-df81be49] svg{transform:rotate(180deg)}.page-select[data-v-df81be49]{background-color:var(--tblr-primary)!important;color:#fff!important;border:none!important}.page-estilo[data-v-df81be49]{border:none;--cor-escurecida: color-mix(in srgb, var(--tblr-primary), #000 25%);background:transparent;padding:1px 10px;border-radius:7px;margin:0!important;transition:color .15s ease-in-out,background-color .15s ease-in-out}.page-estilo[data-v-df81be49]:hover{background:var(--cor-escurecida);color:#fff}.btn[data-v-df81be49]{padding:0!important;margin:0!important;background:transparent!important;border:none!important;box-shadow:none!important}[data-v-df81be49] .btn-estilo svg{padding:0!important;margin:0!important}[data-v-df81be49] .btn-estilo:hover svg{stroke:var(--tblr-primary)}.icon-tabler[data-v-df81be49]{margin:0!important;padding:0!important}.scroll-finish-style[data-v-08efb648]{color:#6c757d;display:block;text-align:center;margin-top:1rem;margin-bottom:1rem}.rotate-180[data-v-78d23729] svg{transform:rotate(180deg)}.page-select[data-v-78d23729]{background-color:var(--tblr-primary)!important;color:#fff!important;border:none!important}.page-estilo[data-v-78d23729]{border:none;--cor-escurecida: color-mix(in srgb, var(--tblr-primary), #000 25%);background:transparent;padding:1px 10px;border-radius:7px;margin:0!important;transition:color .15s ease-in-out,background-color .15s ease-in-out}.page-estilo[data-v-78d23729]:hover{background:var(--cor-escurecida);color:#fff}.btn[data-v-78d23729]{padding:0!important;margin:0!important;background:transparent!important;border:none!important;box-shadow:none!important}[data-v-78d23729] .btn-estilo svg{padding:0!important;margin:0!important}[data-v-78d23729] .btn-estilo:hover svg{stroke:var(--tblr-primary)}.icon-tabler[data-v-78d23729]{margin:0!important;padding:0!important}.inputClose[data-v-dc655be7]{color:var(--tblr-icon-color);z-index:10;position:absolute;top:50%;right:0;transform:translateY(-50%);font-size:1.2em;min-width:2.5rem;display:flex;justify-content:center}.inputClose[data-v-dc655be7]:hover{cursor:pointer}.selected[data-v-dc655be7]:hover{background-color:#b02a2a!important;color:#fff!important}.table-responsive[data-v-f75d7012]{overflow-x:auto}.state-feedback[data-v-f75d7012]{padding:1rem;text-align:center}.state-feedback.error[data-v-f75d7012]{color:red}.pagination-controls[data-v-f75d7012]{margin-top:1rem;display:flex;justify-content:space-between}.placeholder-img[data-v-f75d7012]{width:40px;height:40px;border-radius:4px}.container-img[data-v-f75d7012]{aspect-ratio:1;display:flex;justify-content:center;overflow:hidden;position:relative;max-width:40px;min-width:40px}.container-img .img-tamanho-cover[data-v-f75d7012]{position:absolute;top:0;width:100%;height:100%;object-fit:cover;z-index:0;opacity:.5;filter:blur(4px)}.container-img .img-tamanho[data-v-f75d7012]{object-fit:contain;width:100%;height:100%;z-index:2}.container-img.container-img-preview[data-v-f75d7012]{cursor:pointer}.container-img.container-img-preview[data-v-f75d7012]:hover{border-style:dashed;border-color:var(--tblr-primary);border-width:2px;transition:border-width .15s ease-in-out}.container-img.container-img-preview:hover .img-tamanho[data-v-f75d7012]{opacity:.3}.erro-custom-container[data-v-f75d7012]{display:inline-block;padding:.2em .6em;border-radius:4px;background-color:#fff;font-weight:700;text-transform:uppercase}.erro-custom-text[data-v-f75d7012]{font-size:.8em;text-transform:uppercase;font-weight:700}.bg-img[data-v-f75d7012]{background-color:#0000004d;position:absolute;top:0;width:100%;height:100%;z-index:1}.image-preview-container[data-v-f75d7012]{position:fixed;z-index:9999;background-color:#fff;border-radius:8px;box-shadow:0 4px 12px #0003;padding:5px;pointer-events:none;transition:opacity .2s ease-in-out}.image-preview-container .image-preview-large[data-v-f75d7012]{display:block;max-width:250px;max-height:250px;border-radius:4px}.form-check-input[data-v-f75d7012]{border-width:1px!important;border-color:#00000064!important;width:17px;height:17px}[data-bs-theme=dark] .form-check-input[data-v-f75d7012]{border-color:#ffffff5f!important}.ghost-item[data-v-f75d7012]{opacity:.5;background:var(--tblr-primary-lt, #e6f0ff);border-radius:8px}.dragging-item[data-v-f75d7012]{cursor:grabbing;background:var(--tblr-primary);box-shadow:0 10px 15px -3px #0000001a,0 4px 6px -2px #0000000d;opacity:.5;background-color:var(--tblr-primary-bg-subtle);filter:grayscale(0) invert(0)}.header-draggable[data-v-f75d7012]{cursor:grab}.column-move-move[data-v-f75d7012]{transition:transform .4s ease}.column-move-enter-active[data-v-f75d7012],.column-move-leave-active[data-v-f75d7012]{transition:all .4s ease}.header-ordering[data-v-f75d7012]{display:flex;justify-content:space-between}
+*/[data-bs-theme-base=slate]{--tblr-gray-50:#f8fafc;--tblr-gray-100:#f1f5f9;--tblr-gray-200:#e2e8f0;--tblr-gray-300:#cbd5e1;--tblr-gray-400:#94a3b8;--tblr-gray-500:#64748b;--tblr-gray-600:#475569;--tblr-gray-700:#334155;--tblr-gray-800:#1e293b;--tblr-gray-900:#0f172a;--tblr-gray-950:#020617}[data-bs-theme-base=gray]{--tblr-gray-50:#f9fafb;--tblr-gray-100:#f3f4f6;--tblr-gray-200:#e5e7eb;--tblr-gray-300:#d1d5db;--tblr-gray-400:#9ca3af;--tblr-gray-500:#6b7280;--tblr-gray-600:#4b5563;--tblr-gray-700:#374151;--tblr-gray-800:#1f2937;--tblr-gray-900:#111827;--tblr-gray-950:#030712}[data-bs-theme-base=zinc]{--tblr-gray-50:#fafafa;--tblr-gray-100:#f4f4f5;--tblr-gray-200:#e4e4e7;--tblr-gray-300:#d4d4d8;--tblr-gray-400:#a1a1aa;--tblr-gray-500:#71717a;--tblr-gray-600:#52525b;--tblr-gray-700:#3f3f46;--tblr-gray-800:#27272a;--tblr-gray-900:#18181b;--tblr-gray-950:#09090b}[data-bs-theme-base=neutral]{--tblr-gray-50:#fafafa;--tblr-gray-100:#f5f5f5;--tblr-gray-200:#e5e5e5;--tblr-gray-300:#d4d4d4;--tblr-gray-400:#a3a3a3;--tblr-gray-500:#737373;--tblr-gray-600:#525252;--tblr-gray-700:#404040;--tblr-gray-800:#262626;--tblr-gray-900:#171717;--tblr-gray-950:#0a0a0a}[data-bs-theme-base=stone]{--tblr-gray-50:#fafaf9;--tblr-gray-100:#f5f5f4;--tblr-gray-200:#e7e5e4;--tblr-gray-300:#d6d3d1;--tblr-gray-400:#a8a29e;--tblr-gray-500:#78716c;--tblr-gray-600:#57534e;--tblr-gray-700:#44403c;--tblr-gray-800:#292524;--tblr-gray-900:#1c1917;--tblr-gray-950:#0c0a09}[data-bs-theme-base=pink]{--tblr-gray-50:#fdf2f8;--tblr-gray-100:#fce7f3;--tblr-gray-200:#fbcfe8;--tblr-gray-300:#f9a8d4;--tblr-gray-400:#f472b6;--tblr-gray-500:#ec4899;--tblr-gray-600:#db2777;--tblr-gray-700:#be185d;--tblr-gray-800:#9d174d;--tblr-gray-900:#831843;--tblr-gray-950:#500724}[data-bs-theme-primary=blue]{--tblr-primary:#066fd1;--tblr-primary-rgb:6,111,209}[data-bs-theme-primary=azure]{--tblr-primary:#4299e1;--tblr-primary-rgb:66,153,225}[data-bs-theme-primary=indigo]{--tblr-primary:#4263eb;--tblr-primary-rgb:66,99,235}[data-bs-theme-primary=purple]{--tblr-primary:#ae3ec9;--tblr-primary-rgb:174,62,201}[data-bs-theme-primary=pink]{--tblr-primary:#d6336c;--tblr-primary-rgb:214,51,108}[data-bs-theme-primary=red]{--tblr-primary:#d63939;--tblr-primary-rgb:214,57,57}[data-bs-theme-primary=orange]{--tblr-primary:#f76707;--tblr-primary-rgb:247,103,7}[data-bs-theme-primary=yellow]{--tblr-primary:#f59f00;--tblr-primary-rgb:245,159,0}[data-bs-theme-primary=lime]{--tblr-primary:#74b816;--tblr-primary-rgb:116,184,22}[data-bs-theme-primary=green]{--tblr-primary:#2fb344;--tblr-primary-rgb:47,179,68}[data-bs-theme-primary=teal]{--tblr-primary:#0ca678;--tblr-primary-rgb:12,166,120}[data-bs-theme-primary=cyan]{--tblr-primary:#17a2b8;--tblr-primary-rgb:23,162,184}[data-bs-theme-radius="0"]{--tblr-border-radius-scale:0}[data-bs-theme-radius="0.5"]{--tblr-border-radius-scale:.5}[data-bs-theme-radius="1"]{--tblr-border-radius-scale:1}[data-bs-theme-radius="1.5"]{--tblr-border-radius-scale:1.5}[data-bs-theme-radius="2"]{--tblr-border-radius-scale:2}[data-bs-theme-primary=inverted]{--tblr-primary:var(--tblr-gray-800);--tblr-primary-fg:var(--tblr-light);--tblr-primary-rgb:31,41,55}[data-bs-theme-primary=inverted] [data-bs-theme=dark],[data-bs-theme-primary=inverted][data-bs-theme=dark]{--tblr-primary:#f9fafb;--tblr-primary-fg:var(--tblr-dark);--tblr-primary-rgb:249,250,251}[data-bs-theme-font=monospace]{--tblr-body-font-family:var(--tblr-font-monospace);--tblr-body-font-size:80%}[data-bs-theme-font=sans-serif]{--tblr-body-font-family:var(--tblr-font-sans-serif)}[data-bs-theme-font=serif]{--tblr-body-font-family:var(--tblr-font-serif)}[data-bs-theme-font=comic]{--tblr-body-font-family:var(--tblr-font-comic)}:root{--color-error-inputs: red}[data-bs-theme=dark]{--color-error-inputs: oklch(.666 .179 58.318)}.style-custom-v-required-default{display:flex!important;justify-content:center!important;flex-direction:column!important;gap:2px}.style-custom-v-required-error .v-required-span{color:var(--color-error-inputs)!important;white-space:pre-wrap}.multiselect__tags{background-color:var(--cor-bg-inputs);border:var(--border-inputs);border-radius:5px!important;font-size:.875rem;line-height:1.4285714286}.multiselect__placeholder{color:var(--color-text-multiselect)!important}.style-custom-v-required-error input,.style-custom-v-required-error select,.style-custom-v-required-error textarea{border:2px solid var(--color-error-inputs)!important;color:var(--color-error-inputs)!important}.style-custom-v-required-error .multiselect__tags{border:2px solid var(--color-error-inputs)!important}.style-custom-v-required-error .multiselect__input{border:none!important}.style-custom-v-required-error .multiselect__placeholder{color:var(--color-error-inputs)!important}.style-custom-v-required-error .image-drop-zone{border-color:var(--color-error-inputs)!important}.style-custom-v-required-error .quillWrapper{border:2px solid var(--color-error-inputs)!important}.style-custom-v-required-error input::placeholder{color:var(--color-error-inputs)!important}.t-container{width:100%;display:flex;justify-content:space-between;align-items:center;color:#fff}.rotate-180[data-v-df81be49] svg{transform:rotate(180deg)}.page-select[data-v-df81be49]{background-color:var(--tblr-primary)!important;color:#fff!important;border:none!important}.page-estilo[data-v-df81be49]{border:none;--cor-escurecida: color-mix(in srgb, var(--tblr-primary), #000 25%);background:transparent;padding:1px 10px;border-radius:7px;margin:0!important;transition:color .15s ease-in-out,background-color .15s ease-in-out}.page-estilo[data-v-df81be49]:hover{background:var(--cor-escurecida);color:#fff}.btn[data-v-df81be49]{padding:0!important;margin:0!important;background:transparent!important;border:none!important;box-shadow:none!important}[data-v-df81be49] .btn-estilo svg{padding:0!important;margin:0!important}[data-v-df81be49] .btn-estilo:hover svg{stroke:var(--tblr-primary)}.icon-tabler[data-v-df81be49]{margin:0!important;padding:0!important}.scroll-finish-style[data-v-08efb648]{color:#6c757d;display:block;text-align:center;margin-top:1rem;margin-bottom:1rem}.rotate-180[data-v-78d23729] svg{transform:rotate(180deg)}.page-select[data-v-78d23729]{background-color:var(--tblr-primary)!important;color:#fff!important;border:none!important}.page-estilo[data-v-78d23729]{border:none;--cor-escurecida: color-mix(in srgb, var(--tblr-primary), #000 25%);background:transparent;padding:1px 10px;border-radius:7px;margin:0!important;transition:color .15s ease-in-out,background-color .15s ease-in-out}.page-estilo[data-v-78d23729]:hover{background:var(--cor-escurecida);color:#fff}.btn[data-v-78d23729]{padding:0!important;margin:0!important;background:transparent!important;border:none!important;box-shadow:none!important}[data-v-78d23729] .btn-estilo svg{padding:0!important;margin:0!important}[data-v-78d23729] .btn-estilo:hover svg{stroke:var(--tblr-primary)}.icon-tabler[data-v-78d23729]{margin:0!important;padding:0!important}.inputClose[data-v-dc655be7]{color:var(--tblr-icon-color);z-index:10;position:absolute;top:50%;right:0;transform:translateY(-50%);font-size:1.2em;min-width:2.5rem;display:flex;justify-content:center}.inputClose[data-v-dc655be7]:hover{cursor:pointer}.selected[data-v-dc655be7]:hover{background-color:#b02a2a!important;color:#fff!important}.table-responsive[data-v-f75d7012]{overflow-x:auto}.state-feedback[data-v-f75d7012]{padding:1rem;text-align:center}.state-feedback.error[data-v-f75d7012]{color:red}.pagination-controls[data-v-f75d7012]{margin-top:1rem;display:flex;justify-content:space-between}.placeholder-img[data-v-f75d7012]{width:40px;height:40px;border-radius:4px}.container-img[data-v-f75d7012]{aspect-ratio:1;display:flex;justify-content:center;overflow:hidden;position:relative;max-width:40px;min-width:40px}.container-img .img-tamanho-cover[data-v-f75d7012]{position:absolute;top:0;width:100%;height:100%;object-fit:cover;z-index:0;opacity:.5;filter:blur(4px)}.container-img .img-tamanho[data-v-f75d7012]{object-fit:contain;width:100%;height:100%;z-index:2}.container-img.container-img-preview[data-v-f75d7012]{cursor:pointer}.container-img.container-img-preview[data-v-f75d7012]:hover{border-style:dashed;border-color:var(--tblr-primary);border-width:2px;transition:border-width .15s ease-in-out}.container-img.container-img-preview:hover .img-tamanho[data-v-f75d7012]{opacity:.3}.erro-custom-container[data-v-f75d7012]{display:inline-block;padding:.2em .6em;border-radius:4px;background-color:#fff;font-weight:700;text-transform:uppercase}.erro-custom-text[data-v-f75d7012]{font-size:.8em;text-transform:uppercase;font-weight:700}.bg-img[data-v-f75d7012]{background-color:#0000004d;position:absolute;top:0;width:100%;height:100%;z-index:1}.image-preview-container[data-v-f75d7012]{position:fixed;z-index:9999;background-color:#fff;border-radius:8px;box-shadow:0 4px 12px #0003;padding:5px;pointer-events:none;transition:opacity .2s ease-in-out}.image-preview-container .image-preview-large[data-v-f75d7012]{display:block;max-width:250px;max-height:250px;border-radius:4px}.form-check-input[data-v-f75d7012]{border-width:1px!important;border-color:#00000064!important;width:17px;height:17px}[data-bs-theme=dark] .form-check-input[data-v-f75d7012]{border-color:#ffffff5f!important}.ghost-item[data-v-f75d7012]{opacity:.5;background:var(--tblr-primary-lt, #e6f0ff);border-radius:8px}.dragging-item[data-v-f75d7012]{cursor:grabbing;background:var(--tblr-primary);box-shadow:0 10px 15px -3px #0000001a,0 4px 6px -2px #0000000d;opacity:.5;background-color:var(--tblr-primary-bg-subtle);filter:grayscale(0) invert(0)}.header-draggable[data-v-f75d7012]{cursor:grab}.column-move-move[data-v-f75d7012]{transition:transform .4s ease}.column-move-enter-active[data-v-f75d7012],.column-move-leave-active[data-v-f75d7012]{transition:all .4s ease}.header-ordering[data-v-f75d7012]{display:flex;justify-content:space-between}

package/package.json

@@ -1,7 +1,7 @@
 {
   "name": "v-sistec-features",
   "private": false,
-  "version": "1.6.2",
+  "version": "1.7.1",
   "author": "Márlon Bento Azevedo (https://github.com/marlon-bento)",
   "repository": {
     "type": "git",
@@ -34,6 +34,10 @@
     "./style.css": {
       "import": "./dist/v-sistec-features.css",
       "require": "./dist/v-sistec-features.css"
+    },
+    "./toast": {
+      "import": "./dist/toast.js",
+      "types": "./dist/toast.d.ts"
     }
   },
   "files": [
@@ -70,7 +74,9 @@
   "dependencies": {
     "@formkit/drag-and-drop": "^0.5.3",
     "@tabler/core": "^1.4.0",
-    "v-required": "^2.0.3",
-    "v3-infinite-loading": "^1.3.2"
+    "v-required": "^2.1.0",
+    "vue-toastification": "^2.0.0-rc.5",
+    "v3-infinite-loading": "^1.3.2",
+    "pinia": "^2.1.0 || ^3.0.0"
   }
 }

package/src/core/plugin.ts

@@ -26,6 +26,14 @@ import '@tabler/core/dist/css/tabler-themes.min.css'
 import * as Tabler from '@tabler/core/dist/js/tabler.min.js';
 import vRequired from "v-required"
 import '../assets/v-required-style.css'
+import Toast from "vue-toastification";
+
+const options_toast = {
+  transition: "Vue-Toastification__bounce",
+  maxToasts: 20,
+  newestOnTop: true,
+  toastClassName: "custom-toast-class",
+};
 
 const SistecPlugin = {
   // até o momento não usamos opções nem o app, mas deixei aqui caso precise no futuro
@@ -36,6 +44,7 @@ const SistecPlugin = {
     // futuros upgrades podem ser feitos aqui
     // Ex: app.component('MeuComponente', MeuComponente);
     app.directive('required', vRequired);
+    app.use(Toast, options_toast);
   }
 };
 export { SistecPlugin };

package/src/toast/components/ToastComponent.vue

@@ -0,0 +1,20 @@
+<template>
+  <div class="t-container">
+    <div class="d-flex flex-column gap-1">
+      <h1 class="m-0 p-0 fs-3 bold">{{ props.content.title }}</h1>
+      <p class="m-0 p-0 text-white" v-html="props.content.body"></p>
+    </div>
+  </div>
+</template>
+<script setup lang="ts">
+const props = defineProps(["content"]);
+</script>
+<style>
+.t-container {
+  width: 100%;
+  display: flex;
+  justify-content: space-between;
+  align-items: center;
+  color: white;
+}
+</style>

package/src/toast/index.ts

@@ -0,0 +1,2 @@
+
+export {useToastStore} from "./useToastStore";