tt-pdf-generator 1.3.1 → 1.4.0

package/dist/pdf-generator.esm.js.map

@@ -1,7 +1,7 @@
 {
   "version": 3,
-  "sources": ["../node_modules/media-engine/src/queries.js", "../node_modules/media-engine/src/operators.js", "../node_modules/media-engine/src/parser.js", "../node_modules/media-engine/src/index.js", "../node_modules/hsl-to-rgb-for-reals/converter.js", "../node_modules/hsl-to-hex/index.js", "../node_modules/color-name/index.js", "../node_modules/is-arrayish/index.js", "../node_modules/simple-swizzle/index.js", "../node_modules/color-string/index.js", "../node_modules/postcss-value-parser/lib/parse.js", "../node_modules/postcss-value-parser/lib/unit.js", "../node_modules/qrcode/lib/can-promise.js", "../node_modules/qrcode/lib/core/utils.js", "../node_modules/qrcode/lib/core/error-correction-level.js", "../node_modules/qrcode/lib/core/bit-buffer.js", "../node_modules/qrcode/lib/core/bit-matrix.js", "../node_modules/qrcode/lib/core/alignment-pattern.js", "../node_modules/qrcode/lib/core/finder-pattern.js", "../node_modules/qrcode/lib/core/mask-pattern.js", "../node_modules/qrcode/lib/core/error-correction-code.js", "../node_modules/qrcode/lib/core/galois-field.js", "../node_modules/qrcode/lib/core/polynomial.js", "../node_modules/qrcode/lib/core/reed-solomon-encoder.js", "../node_modules/qrcode/lib/core/version-check.js", "../node_modules/qrcode/lib/core/regex.js", "../node_modules/qrcode/lib/core/mode.js", "../node_modules/qrcode/lib/core/version.js", "../node_modules/qrcode/lib/core/format-info.js", "../node_modules/qrcode/lib/core/numeric-data.js", "../node_modules/qrcode/lib/core/alphanumeric-data.js", "../node_modules/qrcode/lib/core/byte-data.js", "../node_modules/qrcode/lib/core/kanji-data.js", "../node_modules/dijkstrajs/dijkstra.js", "../node_modules/qrcode/lib/core/segments.js", "../node_modules/qrcode/lib/core/qrcode.js", "../node_modules/qrcode/lib/renderer/utils.js", "../node_modules/qrcode/lib/renderer/canvas.js", "../node_modules/qrcode/lib/renderer/svg-tag.js", "../node_modules/qrcode/lib/browser.js", "../src/index.ts", "../src/components/PdfGenerator.tsx", "../node_modules/@react-pdf/fns/lib/index.js", "../node_modules/@react-pdf/stylesheet/lib/index.js", "../node_modules/@ag-media/react-pdf-table/node_modules/tslib/tslib.es6.js", "../node_modules/@ag-media/react-pdf-table/src/Table.tsx", "../node_modules/@ag-media/react-pdf-table/src/TableRow.tsx", "../node_modules/@ag-media/react-pdf-table/src/TableHeader.tsx", "../node_modules/@ag-media/react-pdf-table/src/TableCell.tsx", "../src/utils/pdf-components.ts", "../src/utils/helpers.ts", "../src/components/react-pdf/Map.tsx", "../src/components/react-pdf/QrCode.tsx"],
-  "sourcesContent": ["function MaxHeight(value) {\n  this.value = value;\n\n  this.match = function(options) {\n    return this.value >= options.height;\n  };\n}\n\nfunction MinHeight(value) {\n  this.value = value;\n\n  this.match = function(options) {\n    return this.value < options.height;\n  };\n}\n\nfunction MaxWidth(value) {\n  this.value = value;\n\n  this.match = function(options) {\n    return this.value >= options.width;\n  };\n}\n\nfunction MinWidth(value) {\n  this.value = value;\n\n  this.match = function(options) {\n    return this.value < options.width;\n  };\n}\n\nfunction Orientation(value) {\n  this.value = value;\n\n  this.match = function(options) {\n    return this.value === options.orientation;\n  };\n}\n\nmodule.exports = function Query(type, value) {\n  switch (type) {\n    case 'max-height':\n      return new MaxHeight(value);\n    case 'min-height':\n      return new MinHeight(value);\n    case 'max-width':\n      return new MaxWidth(value);\n    case 'min-width':\n      return new MinWidth(value);\n    case 'orientation':\n      return new Orientation(value);\n    default:\n      throw new Error(value);\n  }\n};\n", "function And(left, right) {\n  this.left = left;\n  this.right = right;\n\n  this.match = function(options) {\n    return left.match(options) && right.match(options);\n  };\n}\n\nfunction Or(left, right) {\n  this.left = left;\n  this.right = right;\n\n  this.match = function(options) {\n    return left.match(options) || right.match(options);\n  };\n}\n\nmodule.exports = function Operator(type, left, right) {\n  switch (type) {\n    case 'and':\n      return new And(left, right);\n    case ',':\n      return new Or(left, right);\n    default:\n      throw new Error(value);\n  }\n};\n", "var Query = require('./queries');\nvar Operator = require('./operators');\n\nvar NUMBERS = /[0-9]/;\nvar LETTERS = /[a-z|\\-]/i;\nvar WHITESPACE = /\\s/;\nvar COLON = /:/;\nvar COMMA = /,/;\nvar AND = /and$/;\nvar AT = /@/;\n\nfunction tokenizer(input) {\n  var current = 0;\n  var tokens = [];\n\n  while (current < input.length) {\n    var char = input[current];\n\n    if (AT.test(char)) {\n      char = input[++current];\n      while (LETTERS.test(char) && char !== undefined) {\n        char = input[++current];\n      }\n    }\n\n    if (WHITESPACE.test(char) || char === ')' || char === '(') {\n      current++;\n      continue;\n    }\n\n    if (COLON.test(char) || COMMA.test(char)) {\n      current++;\n      tokens.push({ type: 'operator', value: char });\n      continue;\n    }\n\n    if (NUMBERS.test(char)) {\n      var value = '';\n      while (NUMBERS.test(char)) {\n        value += char;\n        char = input[++current];\n      }\n\n      tokens.push({ type: 'number', value: value });\n      continue;\n    }\n\n    if (LETTERS.test(char)) {\n      var value = '';\n      while (LETTERS.test(char) && char !== undefined) {\n        value += char;\n        char = input[++current];\n      }\n      if (AND.test(value)) {\n        tokens.push({ type: 'operator', value: value });\n      } else {\n        tokens.push({ type: 'literal', value: value });\n      }\n\n      continue;\n    }\n\n    throw new TypeError(\n      'Tokenizer: I dont know what this character is: ' + char\n    );\n  }\n\n  return tokens;\n}\n\nfunction parser(tokens) {\n  var output = [];\n  var stack = [];\n\n  while (tokens.length > 0) {\n    var token = tokens.shift();\n\n    if (token.type === 'number' || token.type === 'literal') {\n      output.push(token);\n      continue;\n    }\n\n    if (token.type === 'operator') {\n      if (COLON.test(token.value)) {\n        token = { type: 'query', key: output.pop(), value: tokens.shift() };\n        output.push(token);\n        continue;\n      }\n\n      while (stack.length > 0) {\n        output.unshift(stack.pop());\n      }\n      stack.push(token);\n    }\n  }\n\n  while (stack.length > 0) {\n    output.unshift(stack.pop());\n  }\n\n  function walk() {\n    var head = output.shift();\n\n    if (head.type === 'number') {\n      return parseInt(head.value);\n    }\n\n    if (head.type === 'literal') {\n      return head.value;\n    }\n\n    if (head.type === 'operator') {\n      var l = walk();\n      var r = walk();\n\n      return Operator(head.value, l, r);\n    }\n\n    if (head.type === 'query') {\n      var l = head.key.value;\n      var r = head.value.value;\n\n      return Query(l, r);\n    }\n  }\n\n  return walk();\n}\n\nmodule.exports = {\n  parse: function(query) {\n    var tokens = tokenizer(query);\n    var ast = parser(tokens);\n    return ast;\n  }\n};\n", "var Parser = require('./parser');\n\nmodule.exports = function(queries, options) {\n  var result = {};\n\n  Object.keys(queries).forEach(function(query) {\n    if (Parser.parse(query).match(options)) {\n      Object.assign(result, queries[query]);\n    }\n  });\n\n  return result;\n};\n", "// expected hue range: [0, 360)\n// expected saturation range: [0, 1]\n// expected lightness range: [0, 1]\nvar hslToRgb = function(hue, saturation, lightness){\n  // based on algorithm from http://en.wikipedia.org/wiki/HSL_and_HSV#Converting_to_RGB\n  if( hue == undefined ){\n    return [0, 0, 0];\n  }\n\n  var chroma = (1 - Math.abs((2 * lightness) - 1)) * saturation;\n  var huePrime = hue / 60;\n  var secondComponent = chroma * (1 - Math.abs((huePrime % 2) - 1));\n\n  huePrime = Math.floor(huePrime);\n  var red;\n  var green;\n  var blue;\n\n  if( huePrime === 0 ){\n    red = chroma;\n    green = secondComponent;\n    blue = 0;\n  }else if( huePrime === 1 ){\n    red = secondComponent;\n    green = chroma;\n    blue = 0;\n  }else if( huePrime === 2 ){\n    red = 0;\n    green = chroma;\n    blue = secondComponent;\n  }else if( huePrime === 3 ){\n    red = 0;\n    green = secondComponent;\n    blue = chroma;\n  }else if( huePrime === 4 ){\n    red = secondComponent;\n    green = 0;\n    blue = chroma;\n  }else if( huePrime === 5 ){\n    red = chroma;\n    green = 0;\n    blue = secondComponent;\n  }\n\n  var lightnessAdjustment = lightness - (chroma / 2);\n  red += lightnessAdjustment;\n  green += lightnessAdjustment;\n  blue += lightnessAdjustment;\n\n  return [\n      Math.abs(Math.round(red * 255)),\n      Math.abs(Math.round(green * 255)),\n      Math.abs(Math.round(blue * 255))\n  ];\n\n};\n\nmodule.exports = hslToRgb;\n", "// In our case, there's only one dependency\n\nvar toRgb = require('hsl-to-rgb-for-reals')\n\n// Typically all dependencies should be declared at the top of the file.\n\n// Now let's define an API for our module, we're taking hue, saturation and luminosity values and outputting a CSS compatible hex string.\n// Hue is in degrees, between 0 and 359. Since degrees a cyclical in nature, we'll support numbers greater than 359 or less than 0 by \"spinning\" them around until they fall within the 0 to 359 range.\n// Saturation and luminosity are both percentages, we'll represent these percentages with whole numbers between 0 and 100. For these numbers we'll need to enforce a maximum and a minimum, anything below 0 will become 0, anything above 100 will become 100.\n// Let's write some utility functions to handle this logic:\n\nfunction max (val, n) {\n  return (val > n) ? n : val\n}\n\nfunction min (val, n) {\n  return (val < n) ? n : val\n}\n\nfunction cycle (val) {\n  // for safety:\n  val = max(val, 1e7)\n  val = min(val, -1e7)\n  // cycle value:\n  while (val < 0) { val += 360 }\n  while (val > 359) { val -= 360 }\n  return val\n}\n\n// Now for the main piece, the `hsl` function:\n\nfunction hsl (hue, saturation, luminosity) {\n  // resolve degrees to 0 - 359 range\n  hue = cycle(hue)\n\n  // enforce constraints\n  saturation = min(max(saturation, 100), 0)\n  luminosity = min(max(luminosity, 100), 0)\n\n  // convert to 0 to 1 range used by hsl-to-rgb-for-reals\n  saturation /= 100\n  luminosity /= 100\n\n  // let hsl-to-rgb-for-reals do the hard work\n  var rgb = toRgb(hue, saturation, luminosity)\n\n  // convert each value in the returned RGB array\n  // to a 2 character hex value, join the array into\n  // a string, prefixed with a hash\n  return '#' + rgb\n    .map(function (n) {\n      return (256 + n).toString(16).substr(-2)\n    })\n    .join('')\n}\n\n// In order to make our code into a bona fide module we have to export it:\n\nmodule.exports = hsl\n", "'use strict'\r\n\r\nmodule.exports = {\r\n\t\"aliceblue\": [240, 248, 255],\r\n\t\"antiquewhite\": [250, 235, 215],\r\n\t\"aqua\": [0, 255, 255],\r\n\t\"aquamarine\": [127, 255, 212],\r\n\t\"azure\": [240, 255, 255],\r\n\t\"beige\": [245, 245, 220],\r\n\t\"bisque\": [255, 228, 196],\r\n\t\"black\": [0, 0, 0],\r\n\t\"blanchedalmond\": [255, 235, 205],\r\n\t\"blue\": [0, 0, 255],\r\n\t\"blueviolet\": [138, 43, 226],\r\n\t\"brown\": [165, 42, 42],\r\n\t\"burlywood\": [222, 184, 135],\r\n\t\"cadetblue\": [95, 158, 160],\r\n\t\"chartreuse\": [127, 255, 0],\r\n\t\"chocolate\": [210, 105, 30],\r\n\t\"coral\": [255, 127, 80],\r\n\t\"cornflowerblue\": [100, 149, 237],\r\n\t\"cornsilk\": [255, 248, 220],\r\n\t\"crimson\": [220, 20, 60],\r\n\t\"cyan\": [0, 255, 255],\r\n\t\"darkblue\": [0, 0, 139],\r\n\t\"darkcyan\": [0, 139, 139],\r\n\t\"darkgoldenrod\": [184, 134, 11],\r\n\t\"darkgray\": [169, 169, 169],\r\n\t\"darkgreen\": [0, 100, 0],\r\n\t\"darkgrey\": [169, 169, 169],\r\n\t\"darkkhaki\": [189, 183, 107],\r\n\t\"darkmagenta\": [139, 0, 139],\r\n\t\"darkolivegreen\": [85, 107, 47],\r\n\t\"darkorange\": [255, 140, 0],\r\n\t\"darkorchid\": [153, 50, 204],\r\n\t\"darkred\": [139, 0, 0],\r\n\t\"darksalmon\": [233, 150, 122],\r\n\t\"darkseagreen\": [143, 188, 143],\r\n\t\"darkslateblue\": [72, 61, 139],\r\n\t\"darkslategray\": [47, 79, 79],\r\n\t\"darkslategrey\": [47, 79, 79],\r\n\t\"darkturquoise\": [0, 206, 209],\r\n\t\"darkviolet\": [148, 0, 211],\r\n\t\"deeppink\": [255, 20, 147],\r\n\t\"deepskyblue\": [0, 191, 255],\r\n\t\"dimgray\": [105, 105, 105],\r\n\t\"dimgrey\": [105, 105, 105],\r\n\t\"dodgerblue\": [30, 144, 255],\r\n\t\"firebrick\": [178, 34, 34],\r\n\t\"floralwhite\": [255, 250, 240],\r\n\t\"forestgreen\": [34, 139, 34],\r\n\t\"fuchsia\": [255, 0, 255],\r\n\t\"gainsboro\": [220, 220, 220],\r\n\t\"ghostwhite\": [248, 248, 255],\r\n\t\"gold\": [255, 215, 0],\r\n\t\"goldenrod\": [218, 165, 32],\r\n\t\"gray\": [128, 128, 128],\r\n\t\"green\": [0, 128, 0],\r\n\t\"greenyellow\": [173, 255, 47],\r\n\t\"grey\": [128, 128, 128],\r\n\t\"honeydew\": [240, 255, 240],\r\n\t\"hotpink\": [255, 105, 180],\r\n\t\"indianred\": [205, 92, 92],\r\n\t\"indigo\": [75, 0, 130],\r\n\t\"ivory\": [255, 255, 240],\r\n\t\"khaki\": [240, 230, 140],\r\n\t\"lavender\": [230, 230, 250],\r\n\t\"lavenderblush\": [255, 240, 245],\r\n\t\"lawngreen\": [124, 252, 0],\r\n\t\"lemonchiffon\": [255, 250, 205],\r\n\t\"lightblue\": [173, 216, 230],\r\n\t\"lightcoral\": [240, 128, 128],\r\n\t\"lightcyan\": [224, 255, 255],\r\n\t\"lightgoldenrodyellow\": [250, 250, 210],\r\n\t\"lightgray\": [211, 211, 211],\r\n\t\"lightgreen\": [144, 238, 144],\r\n\t\"lightgrey\": [211, 211, 211],\r\n\t\"lightpink\": [255, 182, 193],\r\n\t\"lightsalmon\": [255, 160, 122],\r\n\t\"lightseagreen\": [32, 178, 170],\r\n\t\"lightskyblue\": [135, 206, 250],\r\n\t\"lightslategray\": [119, 136, 153],\r\n\t\"lightslategrey\": [119, 136, 153],\r\n\t\"lightsteelblue\": [176, 196, 222],\r\n\t\"lightyellow\": [255, 255, 224],\r\n\t\"lime\": [0, 255, 0],\r\n\t\"limegreen\": [50, 205, 50],\r\n\t\"linen\": [250, 240, 230],\r\n\t\"magenta\": [255, 0, 255],\r\n\t\"maroon\": [128, 0, 0],\r\n\t\"mediumaquamarine\": [102, 205, 170],\r\n\t\"mediumblue\": [0, 0, 205],\r\n\t\"mediumorchid\": [186, 85, 211],\r\n\t\"mediumpurple\": [147, 112, 219],\r\n\t\"mediumseagreen\": [60, 179, 113],\r\n\t\"mediumslateblue\": [123, 104, 238],\r\n\t\"mediumspringgreen\": [0, 250, 154],\r\n\t\"mediumturquoise\": [72, 209, 204],\r\n\t\"mediumvioletred\": [199, 21, 133],\r\n\t\"midnightblue\": [25, 25, 112],\r\n\t\"mintcream\": [245, 255, 250],\r\n\t\"mistyrose\": [255, 228, 225],\r\n\t\"moccasin\": [255, 228, 181],\r\n\t\"navajowhite\": [255, 222, 173],\r\n\t\"navy\": [0, 0, 128],\r\n\t\"oldlace\": [253, 245, 230],\r\n\t\"olive\": [128, 128, 0],\r\n\t\"olivedrab\": [107, 142, 35],\r\n\t\"orange\": [255, 165, 0],\r\n\t\"orangered\": [255, 69, 0],\r\n\t\"orchid\": [218, 112, 214],\r\n\t\"palegoldenrod\": [238, 232, 170],\r\n\t\"palegreen\": [152, 251, 152],\r\n\t\"paleturquoise\": [175, 238, 238],\r\n\t\"palevioletred\": [219, 112, 147],\r\n\t\"papayawhip\": [255, 239, 213],\r\n\t\"peachpuff\": [255, 218, 185],\r\n\t\"peru\": [205, 133, 63],\r\n\t\"pink\": [255, 192, 203],\r\n\t\"plum\": [221, 160, 221],\r\n\t\"powderblue\": [176, 224, 230],\r\n\t\"purple\": [128, 0, 128],\r\n\t\"rebeccapurple\": [102, 51, 153],\r\n\t\"red\": [255, 0, 0],\r\n\t\"rosybrown\": [188, 143, 143],\r\n\t\"royalblue\": [65, 105, 225],\r\n\t\"saddlebrown\": [139, 69, 19],\r\n\t\"salmon\": [250, 128, 114],\r\n\t\"sandybrown\": [244, 164, 96],\r\n\t\"seagreen\": [46, 139, 87],\r\n\t\"seashell\": [255, 245, 238],\r\n\t\"sienna\": [160, 82, 45],\r\n\t\"silver\": [192, 192, 192],\r\n\t\"skyblue\": [135, 206, 235],\r\n\t\"slateblue\": [106, 90, 205],\r\n\t\"slategray\": [112, 128, 144],\r\n\t\"slategrey\": [112, 128, 144],\r\n\t\"snow\": [255, 250, 250],\r\n\t\"springgreen\": [0, 255, 127],\r\n\t\"steelblue\": [70, 130, 180],\r\n\t\"tan\": [210, 180, 140],\r\n\t\"teal\": [0, 128, 128],\r\n\t\"thistle\": [216, 191, 216],\r\n\t\"tomato\": [255, 99, 71],\r\n\t\"turquoise\": [64, 224, 208],\r\n\t\"violet\": [238, 130, 238],\r\n\t\"wheat\": [245, 222, 179],\r\n\t\"white\": [255, 255, 255],\r\n\t\"whitesmoke\": [245, 245, 245],\r\n\t\"yellow\": [255, 255, 0],\r\n\t\"yellowgreen\": [154, 205, 50]\r\n};\r\n", "module.exports = function isArrayish(obj) {\n\tif (!obj || typeof obj === 'string') {\n\t\treturn false;\n\t}\n\n\treturn obj instanceof Array || Array.isArray(obj) ||\n\t\t(obj.length >= 0 && (obj.splice instanceof Function ||\n\t\t\t(Object.getOwnPropertyDescriptor(obj, (obj.length - 1)) && obj.constructor.name !== 'String')));\n};\n", "'use strict';\n\nvar isArrayish = require('is-arrayish');\n\nvar concat = Array.prototype.concat;\nvar slice = Array.prototype.slice;\n\nvar swizzle = module.exports = function swizzle(args) {\n\tvar results = [];\n\n\tfor (var i = 0, len = args.length; i < len; i++) {\n\t\tvar arg = args[i];\n\n\t\tif (isArrayish(arg)) {\n\t\t\t// http://jsperf.com/javascript-array-concat-vs-push/98\n\t\t\tresults = concat.call(results, slice.call(arg));\n\t\t} else {\n\t\t\tresults.push(arg);\n\t\t}\n\t}\n\n\treturn results;\n};\n\nswizzle.wrap = function (fn) {\n\treturn function () {\n\t\treturn fn(swizzle(arguments));\n\t};\n};\n", "/* MIT license */\nvar colorNames = require('color-name');\nvar swizzle = require('simple-swizzle');\nvar hasOwnProperty = Object.hasOwnProperty;\n\nvar reverseNames = Object.create(null);\n\n// create a list of reverse color names\nfor (var name in colorNames) {\n\tif (hasOwnProperty.call(colorNames, name)) {\n\t\treverseNames[colorNames[name]] = name;\n\t}\n}\n\nvar cs = module.exports = {\n\tto: {},\n\tget: {}\n};\n\ncs.get = function (string) {\n\tvar prefix = string.substring(0, 3).toLowerCase();\n\tvar val;\n\tvar model;\n\tswitch (prefix) {\n\t\tcase 'hsl':\n\t\t\tval = cs.get.hsl(string);\n\t\t\tmodel = 'hsl';\n\t\t\tbreak;\n\t\tcase 'hwb':\n\t\t\tval = cs.get.hwb(string);\n\t\t\tmodel = 'hwb';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tval = cs.get.rgb(string);\n\t\t\tmodel = 'rgb';\n\t\t\tbreak;\n\t}\n\n\tif (!val) {\n\t\treturn null;\n\t}\n\n\treturn {model: model, value: val};\n};\n\ncs.get.rgb = function (string) {\n\tif (!string) {\n\t\treturn null;\n\t}\n\n\tvar abbr = /^#([a-f0-9]{3,4})$/i;\n\tvar hex = /^#([a-f0-9]{6})([a-f0-9]{2})?$/i;\n\tvar rgba = /^rgba?\\(\\s*([+-]?\\d+)(?=[\\s,])\\s*(?:,\\s*)?([+-]?\\d+)(?=[\\s,])\\s*(?:,\\s*)?([+-]?\\d+)\\s*(?:[,|\\/]\\s*([+-]?[\\d\\.]+)(%?)\\s*)?\\)$/;\n\tvar per = /^rgba?\\(\\s*([+-]?[\\d\\.]+)\\%\\s*,?\\s*([+-]?[\\d\\.]+)\\%\\s*,?\\s*([+-]?[\\d\\.]+)\\%\\s*(?:[,|\\/]\\s*([+-]?[\\d\\.]+)(%?)\\s*)?\\)$/;\n\tvar keyword = /^(\\w+)$/;\n\n\tvar rgb = [0, 0, 0, 1];\n\tvar match;\n\tvar i;\n\tvar hexAlpha;\n\n\tif (match = string.match(hex)) {\n\t\thexAlpha = match[2];\n\t\tmatch = match[1];\n\n\t\tfor (i = 0; i < 3; i++) {\n\t\t\t// https://jsperf.com/slice-vs-substr-vs-substring-methods-long-string/19\n\t\t\tvar i2 = i * 2;\n\t\t\trgb[i] = parseInt(match.slice(i2, i2 + 2), 16);\n\t\t}\n\n\t\tif (hexAlpha) {\n\t\t\trgb[3] = parseInt(hexAlpha, 16) / 255;\n\t\t}\n\t} else if (match = string.match(abbr)) {\n\t\tmatch = match[1];\n\t\thexAlpha = match[3];\n\n\t\tfor (i = 0; i < 3; i++) {\n\t\t\trgb[i] = parseInt(match[i] + match[i], 16);\n\t\t}\n\n\t\tif (hexAlpha) {\n\t\t\trgb[3] = parseInt(hexAlpha + hexAlpha, 16) / 255;\n\t\t}\n\t} else if (match = string.match(rgba)) {\n\t\tfor (i = 0; i < 3; i++) {\n\t\t\trgb[i] = parseInt(match[i + 1], 0);\n\t\t}\n\n\t\tif (match[4]) {\n\t\t\tif (match[5]) {\n\t\t\t\trgb[3] = parseFloat(match[4]) * 0.01;\n\t\t\t} else {\n\t\t\t\trgb[3] = parseFloat(match[4]);\n\t\t\t}\n\t\t}\n\t} else if (match = string.match(per)) {\n\t\tfor (i = 0; i < 3; i++) {\n\t\t\trgb[i] = Math.round(parseFloat(match[i + 1]) * 2.55);\n\t\t}\n\n\t\tif (match[4]) {\n\t\t\tif (match[5]) {\n\t\t\t\trgb[3] = parseFloat(match[4]) * 0.01;\n\t\t\t} else {\n\t\t\t\trgb[3] = parseFloat(match[4]);\n\t\t\t}\n\t\t}\n\t} else if (match = string.match(keyword)) {\n\t\tif (match[1] === 'transparent') {\n\t\t\treturn [0, 0, 0, 0];\n\t\t}\n\n\t\tif (!hasOwnProperty.call(colorNames, match[1])) {\n\t\t\treturn null;\n\t\t}\n\n\t\trgb = colorNames[match[1]];\n\t\trgb[3] = 1;\n\n\t\treturn rgb;\n\t} else {\n\t\treturn null;\n\t}\n\n\tfor (i = 0; i < 3; i++) {\n\t\trgb[i] = clamp(rgb[i], 0, 255);\n\t}\n\trgb[3] = clamp(rgb[3], 0, 1);\n\n\treturn rgb;\n};\n\ncs.get.hsl = function (string) {\n\tif (!string) {\n\t\treturn null;\n\t}\n\n\tvar hsl = /^hsla?\\(\\s*([+-]?(?:\\d{0,3}\\.)?\\d+)(?:deg)?\\s*,?\\s*([+-]?[\\d\\.]+)%\\s*,?\\s*([+-]?[\\d\\.]+)%\\s*(?:[,|\\/]\\s*([+-]?(?=\\.\\d|\\d)(?:0|[1-9]\\d*)?(?:\\.\\d*)?(?:[eE][+-]?\\d+)?)\\s*)?\\)$/;\n\tvar match = string.match(hsl);\n\n\tif (match) {\n\t\tvar alpha = parseFloat(match[4]);\n\t\tvar h = ((parseFloat(match[1]) % 360) + 360) % 360;\n\t\tvar s = clamp(parseFloat(match[2]), 0, 100);\n\t\tvar l = clamp(parseFloat(match[3]), 0, 100);\n\t\tvar a = clamp(isNaN(alpha) ? 1 : alpha, 0, 1);\n\n\t\treturn [h, s, l, a];\n\t}\n\n\treturn null;\n};\n\ncs.get.hwb = function (string) {\n\tif (!string) {\n\t\treturn null;\n\t}\n\n\tvar hwb = /^hwb\\(\\s*([+-]?\\d{0,3}(?:\\.\\d+)?)(?:deg)?\\s*,\\s*([+-]?[\\d\\.]+)%\\s*,\\s*([+-]?[\\d\\.]+)%\\s*(?:,\\s*([+-]?(?=\\.\\d|\\d)(?:0|[1-9]\\d*)?(?:\\.\\d*)?(?:[eE][+-]?\\d+)?)\\s*)?\\)$/;\n\tvar match = string.match(hwb);\n\n\tif (match) {\n\t\tvar alpha = parseFloat(match[4]);\n\t\tvar h = ((parseFloat(match[1]) % 360) + 360) % 360;\n\t\tvar w = clamp(parseFloat(match[2]), 0, 100);\n\t\tvar b = clamp(parseFloat(match[3]), 0, 100);\n\t\tvar a = clamp(isNaN(alpha) ? 1 : alpha, 0, 1);\n\t\treturn [h, w, b, a];\n\t}\n\n\treturn null;\n};\n\ncs.to.hex = function () {\n\tvar rgba = swizzle(arguments);\n\n\treturn (\n\t\t'#' +\n\t\thexDouble(rgba[0]) +\n\t\thexDouble(rgba[1]) +\n\t\thexDouble(rgba[2]) +\n\t\t(rgba[3] < 1\n\t\t\t? (hexDouble(Math.round(rgba[3] * 255)))\n\t\t\t: '')\n\t);\n};\n\ncs.to.rgb = function () {\n\tvar rgba = swizzle(arguments);\n\n\treturn rgba.length < 4 || rgba[3] === 1\n\t\t? 'rgb(' + Math.round(rgba[0]) + ', ' + Math.round(rgba[1]) + ', ' + Math.round(rgba[2]) + ')'\n\t\t: 'rgba(' + Math.round(rgba[0]) + ', ' + Math.round(rgba[1]) + ', ' + Math.round(rgba[2]) + ', ' + rgba[3] + ')';\n};\n\ncs.to.rgb.percent = function () {\n\tvar rgba = swizzle(arguments);\n\n\tvar r = Math.round(rgba[0] / 255 * 100);\n\tvar g = Math.round(rgba[1] / 255 * 100);\n\tvar b = Math.round(rgba[2] / 255 * 100);\n\n\treturn rgba.length < 4 || rgba[3] === 1\n\t\t? 'rgb(' + r + '%, ' + g + '%, ' + b + '%)'\n\t\t: 'rgba(' + r + '%, ' + g + '%, ' + b + '%, ' + rgba[3] + ')';\n};\n\ncs.to.hsl = function () {\n\tvar hsla = swizzle(arguments);\n\treturn hsla.length < 4 || hsla[3] === 1\n\t\t? 'hsl(' + hsla[0] + ', ' + hsla[1] + '%, ' + hsla[2] + '%)'\n\t\t: 'hsla(' + hsla[0] + ', ' + hsla[1] + '%, ' + hsla[2] + '%, ' + hsla[3] + ')';\n};\n\n// hwb is a bit different than rgb(a) & hsl(a) since there is no alpha specific syntax\n// (hwb have alpha optional & 1 is default value)\ncs.to.hwb = function () {\n\tvar hwba = swizzle(arguments);\n\n\tvar a = '';\n\tif (hwba.length >= 4 && hwba[3] !== 1) {\n\t\ta = ', ' + hwba[3];\n\t}\n\n\treturn 'hwb(' + hwba[0] + ', ' + hwba[1] + '%, ' + hwba[2] + '%' + a + ')';\n};\n\ncs.to.keyword = function (rgb) {\n\treturn reverseNames[rgb.slice(0, 3)];\n};\n\n// helpers\nfunction clamp(num, min, max) {\n\treturn Math.min(Math.max(min, num), max);\n}\n\nfunction hexDouble(num) {\n\tvar str = Math.round(num).toString(16).toUpperCase();\n\treturn (str.length < 2) ? '0' + str : str;\n}\n", "var openParentheses = \"(\".charCodeAt(0);\nvar closeParentheses = \")\".charCodeAt(0);\nvar singleQuote = \"'\".charCodeAt(0);\nvar doubleQuote = '\"'.charCodeAt(0);\nvar backslash = \"\\\\\".charCodeAt(0);\nvar slash = \"/\".charCodeAt(0);\nvar comma = \",\".charCodeAt(0);\nvar colon = \":\".charCodeAt(0);\nvar star = \"*\".charCodeAt(0);\nvar uLower = \"u\".charCodeAt(0);\nvar uUpper = \"U\".charCodeAt(0);\nvar plus = \"+\".charCodeAt(0);\nvar isUnicodeRange = /^[a-f0-9?-]+$/i;\n\nmodule.exports = function(input) {\n  var tokens = [];\n  var value = input;\n\n  var next,\n    quote,\n    prev,\n    token,\n    escape,\n    escapePos,\n    whitespacePos,\n    parenthesesOpenPos;\n  var pos = 0;\n  var code = value.charCodeAt(pos);\n  var max = value.length;\n  var stack = [{ nodes: tokens }];\n  var balanced = 0;\n  var parent;\n\n  var name = \"\";\n  var before = \"\";\n  var after = \"\";\n\n  while (pos < max) {\n    // Whitespaces\n    if (code <= 32) {\n      next = pos;\n      do {\n        next += 1;\n        code = value.charCodeAt(next);\n      } while (code <= 32);\n      token = value.slice(pos, next);\n\n      prev = tokens[tokens.length - 1];\n      if (code === closeParentheses && balanced) {\n        after = token;\n      } else if (prev && prev.type === \"div\") {\n        prev.after = token;\n        prev.sourceEndIndex += token.length;\n      } else if (\n        code === comma ||\n        code === colon ||\n        (code === slash &&\n          value.charCodeAt(next + 1) !== star &&\n          (!parent ||\n            (parent && parent.type === \"function\" && parent.value !== \"calc\")))\n      ) {\n        before = token;\n      } else {\n        tokens.push({\n          type: \"space\",\n          sourceIndex: pos,\n          sourceEndIndex: next,\n          value: token\n        });\n      }\n\n      pos = next;\n\n      // Quotes\n    } else if (code === singleQuote || code === doubleQuote) {\n      next = pos;\n      quote = code === singleQuote ? \"'\" : '\"';\n      token = {\n        type: \"string\",\n        sourceIndex: pos,\n        quote: quote\n      };\n      do {\n        escape = false;\n        next = value.indexOf(quote, next + 1);\n        if (~next) {\n          escapePos = next;\n          while (value.charCodeAt(escapePos - 1) === backslash) {\n            escapePos -= 1;\n            escape = !escape;\n          }\n        } else {\n          value += quote;\n          next = value.length - 1;\n          token.unclosed = true;\n        }\n      } while (escape);\n      token.value = value.slice(pos + 1, next);\n      token.sourceEndIndex = token.unclosed ? next : next + 1;\n      tokens.push(token);\n      pos = next + 1;\n      code = value.charCodeAt(pos);\n\n      // Comments\n    } else if (code === slash && value.charCodeAt(pos + 1) === star) {\n      next = value.indexOf(\"*/\", pos);\n\n      token = {\n        type: \"comment\",\n        sourceIndex: pos,\n        sourceEndIndex: next + 2\n      };\n\n      if (next === -1) {\n        token.unclosed = true;\n        next = value.length;\n        token.sourceEndIndex = next;\n      }\n\n      token.value = value.slice(pos + 2, next);\n      tokens.push(token);\n\n      pos = next + 2;\n      code = value.charCodeAt(pos);\n\n      // Operation within calc\n    } else if (\n      (code === slash || code === star) &&\n      parent &&\n      parent.type === \"function\" &&\n      parent.value === \"calc\"\n    ) {\n      token = value[pos];\n      tokens.push({\n        type: \"word\",\n        sourceIndex: pos - before.length,\n        sourceEndIndex: pos + token.length,\n        value: token\n      });\n      pos += 1;\n      code = value.charCodeAt(pos);\n\n      // Dividers\n    } else if (code === slash || code === comma || code === colon) {\n      token = value[pos];\n\n      tokens.push({\n        type: \"div\",\n        sourceIndex: pos - before.length,\n        sourceEndIndex: pos + token.length,\n        value: token,\n        before: before,\n        after: \"\"\n      });\n      before = \"\";\n\n      pos += 1;\n      code = value.charCodeAt(pos);\n\n      // Open parentheses\n    } else if (openParentheses === code) {\n      // Whitespaces after open parentheses\n      next = pos;\n      do {\n        next += 1;\n        code = value.charCodeAt(next);\n      } while (code <= 32);\n      parenthesesOpenPos = pos;\n      token = {\n        type: \"function\",\n        sourceIndex: pos - name.length,\n        value: name,\n        before: value.slice(parenthesesOpenPos + 1, next)\n      };\n      pos = next;\n\n      if (name === \"url\" && code !== singleQuote && code !== doubleQuote) {\n        next -= 1;\n        do {\n          escape = false;\n          next = value.indexOf(\")\", next + 1);\n          if (~next) {\n            escapePos = next;\n            while (value.charCodeAt(escapePos - 1) === backslash) {\n              escapePos -= 1;\n              escape = !escape;\n            }\n          } else {\n            value += \")\";\n            next = value.length - 1;\n            token.unclosed = true;\n          }\n        } while (escape);\n        // Whitespaces before closed\n        whitespacePos = next;\n        do {\n          whitespacePos -= 1;\n          code = value.charCodeAt(whitespacePos);\n        } while (code <= 32);\n        if (parenthesesOpenPos < whitespacePos) {\n          if (pos !== whitespacePos + 1) {\n            token.nodes = [\n              {\n                type: \"word\",\n                sourceIndex: pos,\n                sourceEndIndex: whitespacePos + 1,\n                value: value.slice(pos, whitespacePos + 1)\n              }\n            ];\n          } else {\n            token.nodes = [];\n          }\n          if (token.unclosed && whitespacePos + 1 !== next) {\n            token.after = \"\";\n            token.nodes.push({\n              type: \"space\",\n              sourceIndex: whitespacePos + 1,\n              sourceEndIndex: next,\n              value: value.slice(whitespacePos + 1, next)\n            });\n          } else {\n            token.after = value.slice(whitespacePos + 1, next);\n            token.sourceEndIndex = next;\n          }\n        } else {\n          token.after = \"\";\n          token.nodes = [];\n        }\n        pos = next + 1;\n        token.sourceEndIndex = token.unclosed ? next : pos;\n        code = value.charCodeAt(pos);\n        tokens.push(token);\n      } else {\n        balanced += 1;\n        token.after = \"\";\n        token.sourceEndIndex = pos + 1;\n        tokens.push(token);\n        stack.push(token);\n        tokens = token.nodes = [];\n        parent = token;\n      }\n      name = \"\";\n\n      // Close parentheses\n    } else if (closeParentheses === code && balanced) {\n      pos += 1;\n      code = value.charCodeAt(pos);\n\n      parent.after = after;\n      parent.sourceEndIndex += after.length;\n      after = \"\";\n      balanced -= 1;\n      stack[stack.length - 1].sourceEndIndex = pos;\n      stack.pop();\n      parent = stack[balanced];\n      tokens = parent.nodes;\n\n      // Words\n    } else {\n      next = pos;\n      do {\n        if (code === backslash) {\n          next += 1;\n        }\n        next += 1;\n        code = value.charCodeAt(next);\n      } while (\n        next < max &&\n        !(\n          code <= 32 ||\n          code === singleQuote ||\n          code === doubleQuote ||\n          code === comma ||\n          code === colon ||\n          code === slash ||\n          code === openParentheses ||\n          (code === star &&\n            parent &&\n            parent.type === \"function\" &&\n            parent.value === \"calc\") ||\n          (code === slash &&\n            parent.type === \"function\" &&\n            parent.value === \"calc\") ||\n          (code === closeParentheses && balanced)\n        )\n      );\n      token = value.slice(pos, next);\n\n      if (openParentheses === code) {\n        name = token;\n      } else if (\n        (uLower === token.charCodeAt(0) || uUpper === token.charCodeAt(0)) &&\n        plus === token.charCodeAt(1) &&\n        isUnicodeRange.test(token.slice(2))\n      ) {\n        tokens.push({\n          type: \"unicode-range\",\n          sourceIndex: pos,\n          sourceEndIndex: next,\n          value: token\n        });\n      } else {\n        tokens.push({\n          type: \"word\",\n          sourceIndex: pos,\n          sourceEndIndex: next,\n          value: token\n        });\n      }\n\n      pos = next;\n    }\n  }\n\n  for (pos = stack.length - 1; pos; pos -= 1) {\n    stack[pos].unclosed = true;\n    stack[pos].sourceEndIndex = value.length;\n  }\n\n  return stack[0].nodes;\n};\n", "var minus = \"-\".charCodeAt(0);\nvar plus = \"+\".charCodeAt(0);\nvar dot = \".\".charCodeAt(0);\nvar exp = \"e\".charCodeAt(0);\nvar EXP = \"E\".charCodeAt(0);\n\n// Check if three code points would start a number\n// https://www.w3.org/TR/css-syntax-3/#starts-with-a-number\nfunction likeNumber(value) {\n  var code = value.charCodeAt(0);\n  var nextCode;\n\n  if (code === plus || code === minus) {\n    nextCode = value.charCodeAt(1);\n\n    if (nextCode >= 48 && nextCode <= 57) {\n      return true;\n    }\n\n    var nextNextCode = value.charCodeAt(2);\n\n    if (nextCode === dot && nextNextCode >= 48 && nextNextCode <= 57) {\n      return true;\n    }\n\n    return false;\n  }\n\n  if (code === dot) {\n    nextCode = value.charCodeAt(1);\n\n    if (nextCode >= 48 && nextCode <= 57) {\n      return true;\n    }\n\n    return false;\n  }\n\n  if (code >= 48 && code <= 57) {\n    return true;\n  }\n\n  return false;\n}\n\n// Consume a number\n// https://www.w3.org/TR/css-syntax-3/#consume-number\nmodule.exports = function(value) {\n  var pos = 0;\n  var length = value.length;\n  var code;\n  var nextCode;\n  var nextNextCode;\n\n  if (length === 0 || !likeNumber(value)) {\n    return false;\n  }\n\n  code = value.charCodeAt(pos);\n\n  if (code === plus || code === minus) {\n    pos++;\n  }\n\n  while (pos < length) {\n    code = value.charCodeAt(pos);\n\n    if (code < 48 || code > 57) {\n      break;\n    }\n\n    pos += 1;\n  }\n\n  code = value.charCodeAt(pos);\n  nextCode = value.charCodeAt(pos + 1);\n\n  if (code === dot && nextCode >= 48 && nextCode <= 57) {\n    pos += 2;\n\n    while (pos < length) {\n      code = value.charCodeAt(pos);\n\n      if (code < 48 || code > 57) {\n        break;\n      }\n\n      pos += 1;\n    }\n  }\n\n  code = value.charCodeAt(pos);\n  nextCode = value.charCodeAt(pos + 1);\n  nextNextCode = value.charCodeAt(pos + 2);\n\n  if (\n    (code === exp || code === EXP) &&\n    ((nextCode >= 48 && nextCode <= 57) ||\n      ((nextCode === plus || nextCode === minus) &&\n        nextNextCode >= 48 &&\n        nextNextCode <= 57))\n  ) {\n    pos += nextCode === plus || nextCode === minus ? 3 : 2;\n\n    while (pos < length) {\n      code = value.charCodeAt(pos);\n\n      if (code < 48 || code > 57) {\n        break;\n      }\n\n      pos += 1;\n    }\n  }\n\n  return {\n    number: value.slice(0, pos),\n    unit: value.slice(pos)\n  };\n};\n", "// can-promise has a crash in some versions of react native that dont have\n// standard global objects\n// https://github.com/soldair/node-qrcode/issues/157\n\nmodule.exports = function () {\n  return typeof Promise === 'function' && Promise.prototype && Promise.prototype.then\n}\n", "let toSJISFunction\nconst CODEWORDS_COUNT = [\n  0, // Not used\n  26, 44, 70, 100, 134, 172, 196, 242, 292, 346,\n  404, 466, 532, 581, 655, 733, 815, 901, 991, 1085,\n  1156, 1258, 1364, 1474, 1588, 1706, 1828, 1921, 2051, 2185,\n  2323, 2465, 2611, 2761, 2876, 3034, 3196, 3362, 3532, 3706\n]\n\n/**\n * Returns the QR Code size for the specified version\n *\n * @param  {Number} version QR Code version\n * @return {Number}         size of QR code\n */\nexports.getSymbolSize = function getSymbolSize (version) {\n  if (!version) throw new Error('\"version\" cannot be null or undefined')\n  if (version < 1 || version > 40) throw new Error('\"version\" should be in range from 1 to 40')\n  return version * 4 + 17\n}\n\n/**\n * Returns the total number of codewords used to store data and EC information.\n *\n * @param  {Number} version QR Code version\n * @return {Number}         Data length in bits\n */\nexports.getSymbolTotalCodewords = function getSymbolTotalCodewords (version) {\n  return CODEWORDS_COUNT[version]\n}\n\n/**\n * Encode data with Bose-Chaudhuri-Hocquenghem\n *\n * @param  {Number} data Value to encode\n * @return {Number}      Encoded value\n */\nexports.getBCHDigit = function (data) {\n  let digit = 0\n\n  while (data !== 0) {\n    digit++\n    data >>>= 1\n  }\n\n  return digit\n}\n\nexports.setToSJISFunction = function setToSJISFunction (f) {\n  if (typeof f !== 'function') {\n    throw new Error('\"toSJISFunc\" is not a valid function.')\n  }\n\n  toSJISFunction = f\n}\n\nexports.isKanjiModeEnabled = function () {\n  return typeof toSJISFunction !== 'undefined'\n}\n\nexports.toSJIS = function toSJIS (kanji) {\n  return toSJISFunction(kanji)\n}\n", "exports.L = { bit: 1 }\nexports.M = { bit: 0 }\nexports.Q = { bit: 3 }\nexports.H = { bit: 2 }\n\nfunction fromString (string) {\n  if (typeof string !== 'string') {\n    throw new Error('Param is not a string')\n  }\n\n  const lcStr = string.toLowerCase()\n\n  switch (lcStr) {\n    case 'l':\n    case 'low':\n      return exports.L\n\n    case 'm':\n    case 'medium':\n      return exports.M\n\n    case 'q':\n    case 'quartile':\n      return exports.Q\n\n    case 'h':\n    case 'high':\n      return exports.H\n\n    default:\n      throw new Error('Unknown EC Level: ' + string)\n  }\n}\n\nexports.isValid = function isValid (level) {\n  return level && typeof level.bit !== 'undefined' &&\n    level.bit >= 0 && level.bit < 4\n}\n\nexports.from = function from (value, defaultValue) {\n  if (exports.isValid(value)) {\n    return value\n  }\n\n  try {\n    return fromString(value)\n  } catch (e) {\n    return defaultValue\n  }\n}\n", "function BitBuffer () {\n  this.buffer = []\n  this.length = 0\n}\n\nBitBuffer.prototype = {\n\n  get: function (index) {\n    const bufIndex = Math.floor(index / 8)\n    return ((this.buffer[bufIndex] >>> (7 - index % 8)) & 1) === 1\n  },\n\n  put: function (num, length) {\n    for (let i = 0; i < length; i++) {\n      this.putBit(((num >>> (length - i - 1)) & 1) === 1)\n    }\n  },\n\n  getLengthInBits: function () {\n    return this.length\n  },\n\n  putBit: function (bit) {\n    const bufIndex = Math.floor(this.length / 8)\n    if (this.buffer.length <= bufIndex) {\n      this.buffer.push(0)\n    }\n\n    if (bit) {\n      this.buffer[bufIndex] |= (0x80 >>> (this.length % 8))\n    }\n\n    this.length++\n  }\n}\n\nmodule.exports = BitBuffer\n", "/**\n * Helper class to handle QR Code symbol modules\n *\n * @param {Number} size Symbol size\n */\nfunction BitMatrix (size) {\n  if (!size || size < 1) {\n    throw new Error('BitMatrix size must be defined and greater than 0')\n  }\n\n  this.size = size\n  this.data = new Uint8Array(size * size)\n  this.reservedBit = new Uint8Array(size * size)\n}\n\n/**\n * Set bit value at specified location\n * If reserved flag is set, this bit will be ignored during masking process\n *\n * @param {Number}  row\n * @param {Number}  col\n * @param {Boolean} value\n * @param {Boolean} reserved\n */\nBitMatrix.prototype.set = function (row, col, value, reserved) {\n  const index = row * this.size + col\n  this.data[index] = value\n  if (reserved) this.reservedBit[index] = true\n}\n\n/**\n * Returns bit value at specified location\n *\n * @param  {Number}  row\n * @param  {Number}  col\n * @return {Boolean}\n */\nBitMatrix.prototype.get = function (row, col) {\n  return this.data[row * this.size + col]\n}\n\n/**\n * Applies xor operator at specified location\n * (used during masking process)\n *\n * @param {Number}  row\n * @param {Number}  col\n * @param {Boolean} value\n */\nBitMatrix.prototype.xor = function (row, col, value) {\n  this.data[row * this.size + col] ^= value\n}\n\n/**\n * Check if bit at specified location is reserved\n *\n * @param {Number}   row\n * @param {Number}   col\n * @return {Boolean}\n */\nBitMatrix.prototype.isReserved = function (row, col) {\n  return this.reservedBit[row * this.size + col]\n}\n\nmodule.exports = BitMatrix\n", "/**\n * Alignment pattern are fixed reference pattern in defined positions\n * in a matrix symbology, which enables the decode software to re-synchronise\n * the coordinate mapping of the image modules in the event of moderate amounts\n * of distortion of the image.\n *\n * Alignment patterns are present only in QR Code symbols of version 2 or larger\n * and their number depends on the symbol version.\n */\n\nconst getSymbolSize = require('./utils').getSymbolSize\n\n/**\n * Calculate the row/column coordinates of the center module of each alignment pattern\n * for the specified QR Code version.\n *\n * The alignment patterns are positioned symmetrically on either side of the diagonal\n * running from the top left corner of the symbol to the bottom right corner.\n *\n * Since positions are simmetrical only half of the coordinates are returned.\n * Each item of the array will represent in turn the x and y coordinate.\n * @see {@link getPositions}\n *\n * @param  {Number} version QR Code version\n * @return {Array}          Array of coordinate\n */\nexports.getRowColCoords = function getRowColCoords (version) {\n  if (version === 1) return []\n\n  const posCount = Math.floor(version / 7) + 2\n  const size = getSymbolSize(version)\n  const intervals = size === 145 ? 26 : Math.ceil((size - 13) / (2 * posCount - 2)) * 2\n  const positions = [size - 7] // Last coord is always (size - 7)\n\n  for (let i = 1; i < posCount - 1; i++) {\n    positions[i] = positions[i - 1] - intervals\n  }\n\n  positions.push(6) // First coord is always 6\n\n  return positions.reverse()\n}\n\n/**\n * Returns an array containing the positions of each alignment pattern.\n * Each array's element represent the center point of the pattern as (x, y) coordinates\n *\n * Coordinates are calculated expanding the row/column coordinates returned by {@link getRowColCoords}\n * and filtering out the items that overlaps with finder pattern\n *\n * @example\n * For a Version 7 symbol {@link getRowColCoords} returns values 6, 22 and 38.\n * The alignment patterns, therefore, are to be centered on (row, column)\n * positions (6,22), (22,6), (22,22), (22,38), (38,22), (38,38).\n * Note that the coordinates (6,6), (6,38), (38,6) are occupied by finder patterns\n * and are not therefore used for alignment patterns.\n *\n * let pos = getPositions(7)\n * // [[6,22], [22,6], [22,22], [22,38], [38,22], [38,38]]\n *\n * @param  {Number} version QR Code version\n * @return {Array}          Array of coordinates\n */\nexports.getPositions = function getPositions (version) {\n  const coords = []\n  const pos = exports.getRowColCoords(version)\n  const posLength = pos.length\n\n  for (let i = 0; i < posLength; i++) {\n    for (let j = 0; j < posLength; j++) {\n      // Skip if position is occupied by finder patterns\n      if ((i === 0 && j === 0) || // top-left\n          (i === 0 && j === posLength - 1) || // bottom-left\n          (i === posLength - 1 && j === 0)) { // top-right\n        continue\n      }\n\n      coords.push([pos[i], pos[j]])\n    }\n  }\n\n  return coords\n}\n", "const getSymbolSize = require('./utils').getSymbolSize\nconst FINDER_PATTERN_SIZE = 7\n\n/**\n * Returns an array containing the positions of each finder pattern.\n * Each array's element represent the top-left point of the pattern as (x, y) coordinates\n *\n * @param  {Number} version QR Code version\n * @return {Array}          Array of coordinates\n */\nexports.getPositions = function getPositions (version) {\n  const size = getSymbolSize(version)\n\n  return [\n    // top-left\n    [0, 0],\n    // top-right\n    [size - FINDER_PATTERN_SIZE, 0],\n    // bottom-left\n    [0, size - FINDER_PATTERN_SIZE]\n  ]\n}\n", "/**\n * Data mask pattern reference\n * @type {Object}\n */\nexports.Patterns = {\n  PATTERN000: 0,\n  PATTERN001: 1,\n  PATTERN010: 2,\n  PATTERN011: 3,\n  PATTERN100: 4,\n  PATTERN101: 5,\n  PATTERN110: 6,\n  PATTERN111: 7\n}\n\n/**\n * Weighted penalty scores for the undesirable features\n * @type {Object}\n */\nconst PenaltyScores = {\n  N1: 3,\n  N2: 3,\n  N3: 40,\n  N4: 10\n}\n\n/**\n * Check if mask pattern value is valid\n *\n * @param  {Number}  mask    Mask pattern\n * @return {Boolean}         true if valid, false otherwise\n */\nexports.isValid = function isValid (mask) {\n  return mask != null && mask !== '' && !isNaN(mask) && mask >= 0 && mask <= 7\n}\n\n/**\n * Returns mask pattern from a value.\n * If value is not valid, returns undefined\n *\n * @param  {Number|String} value        Mask pattern value\n * @return {Number}                     Valid mask pattern or undefined\n */\nexports.from = function from (value) {\n  return exports.isValid(value) ? parseInt(value, 10) : undefined\n}\n\n/**\n* Find adjacent modules in row/column with the same color\n* and assign a penalty value.\n*\n* Points: N1 + i\n* i is the amount by which the number of adjacent modules of the same color exceeds 5\n*/\nexports.getPenaltyN1 = function getPenaltyN1 (data) {\n  const size = data.size\n  let points = 0\n  let sameCountCol = 0\n  let sameCountRow = 0\n  let lastCol = null\n  let lastRow = null\n\n  for (let row = 0; row < size; row++) {\n    sameCountCol = sameCountRow = 0\n    lastCol = lastRow = null\n\n    for (let col = 0; col < size; col++) {\n      let module = data.get(row, col)\n      if (module === lastCol) {\n        sameCountCol++\n      } else {\n        if (sameCountCol >= 5) points += PenaltyScores.N1 + (sameCountCol - 5)\n        lastCol = module\n        sameCountCol = 1\n      }\n\n      module = data.get(col, row)\n      if (module === lastRow) {\n        sameCountRow++\n      } else {\n        if (sameCountRow >= 5) points += PenaltyScores.N1 + (sameCountRow - 5)\n        lastRow = module\n        sameCountRow = 1\n      }\n    }\n\n    if (sameCountCol >= 5) points += PenaltyScores.N1 + (sameCountCol - 5)\n    if (sameCountRow >= 5) points += PenaltyScores.N1 + (sameCountRow - 5)\n  }\n\n  return points\n}\n\n/**\n * Find 2x2 blocks with the same color and assign a penalty value\n *\n * Points: N2 * (m - 1) * (n - 1)\n */\nexports.getPenaltyN2 = function getPenaltyN2 (data) {\n  const size = data.size\n  let points = 0\n\n  for (let row = 0; row < size - 1; row++) {\n    for (let col = 0; col < size - 1; col++) {\n      const last = data.get(row, col) +\n        data.get(row, col + 1) +\n        data.get(row + 1, col) +\n        data.get(row + 1, col + 1)\n\n      if (last === 4 || last === 0) points++\n    }\n  }\n\n  return points * PenaltyScores.N2\n}\n\n/**\n * Find 1:1:3:1:1 ratio (dark:light:dark:light:dark) pattern in row/column,\n * preceded or followed by light area 4 modules wide\n *\n * Points: N3 * number of pattern found\n */\nexports.getPenaltyN3 = function getPenaltyN3 (data) {\n  const size = data.size\n  let points = 0\n  let bitsCol = 0\n  let bitsRow = 0\n\n  for (let row = 0; row < size; row++) {\n    bitsCol = bitsRow = 0\n    for (let col = 0; col < size; col++) {\n      bitsCol = ((bitsCol << 1) & 0x7FF) | data.get(row, col)\n      if (col >= 10 && (bitsCol === 0x5D0 || bitsCol === 0x05D)) points++\n\n      bitsRow = ((bitsRow << 1) & 0x7FF) | data.get(col, row)\n      if (col >= 10 && (bitsRow === 0x5D0 || bitsRow === 0x05D)) points++\n    }\n  }\n\n  return points * PenaltyScores.N3\n}\n\n/**\n * Calculate proportion of dark modules in entire symbol\n *\n * Points: N4 * k\n *\n * k is the rating of the deviation of the proportion of dark modules\n * in the symbol from 50% in steps of 5%\n */\nexports.getPenaltyN4 = function getPenaltyN4 (data) {\n  let darkCount = 0\n  const modulesCount = data.data.length\n\n  for (let i = 0; i < modulesCount; i++) darkCount += data.data[i]\n\n  const k = Math.abs(Math.ceil((darkCount * 100 / modulesCount) / 5) - 10)\n\n  return k * PenaltyScores.N4\n}\n\n/**\n * Return mask value at given position\n *\n * @param  {Number} maskPattern Pattern reference value\n * @param  {Number} i           Row\n * @param  {Number} j           Column\n * @return {Boolean}            Mask value\n */\nfunction getMaskAt (maskPattern, i, j) {\n  switch (maskPattern) {\n    case exports.Patterns.PATTERN000: return (i + j) % 2 === 0\n    case exports.Patterns.PATTERN001: return i % 2 === 0\n    case exports.Patterns.PATTERN010: return j % 3 === 0\n    case exports.Patterns.PATTERN011: return (i + j) % 3 === 0\n    case exports.Patterns.PATTERN100: return (Math.floor(i / 2) + Math.floor(j / 3)) % 2 === 0\n    case exports.Patterns.PATTERN101: return (i * j) % 2 + (i * j) % 3 === 0\n    case exports.Patterns.PATTERN110: return ((i * j) % 2 + (i * j) % 3) % 2 === 0\n    case exports.Patterns.PATTERN111: return ((i * j) % 3 + (i + j) % 2) % 2 === 0\n\n    default: throw new Error('bad maskPattern:' + maskPattern)\n  }\n}\n\n/**\n * Apply a mask pattern to a BitMatrix\n *\n * @param  {Number}    pattern Pattern reference number\n * @param  {BitMatrix} data    BitMatrix data\n */\nexports.applyMask = function applyMask (pattern, data) {\n  const size = data.size\n\n  for (let col = 0; col < size; col++) {\n    for (let row = 0; row < size; row++) {\n      if (data.isReserved(row, col)) continue\n      data.xor(row, col, getMaskAt(pattern, row, col))\n    }\n  }\n}\n\n/**\n * Returns the best mask pattern for data\n *\n * @param  {BitMatrix} data\n * @return {Number} Mask pattern reference number\n */\nexports.getBestMask = function getBestMask (data, setupFormatFunc) {\n  const numPatterns = Object.keys(exports.Patterns).length\n  let bestPattern = 0\n  let lowerPenalty = Infinity\n\n  for (let p = 0; p < numPatterns; p++) {\n    setupFormatFunc(p)\n    exports.applyMask(p, data)\n\n    // Calculate penalty\n    const penalty =\n      exports.getPenaltyN1(data) +\n      exports.getPenaltyN2(data) +\n      exports.getPenaltyN3(data) +\n      exports.getPenaltyN4(data)\n\n    // Undo previously applied mask\n    exports.applyMask(p, data)\n\n    if (penalty < lowerPenalty) {\n      lowerPenalty = penalty\n      bestPattern = p\n    }\n  }\n\n  return bestPattern\n}\n", "const ECLevel = require('./error-correction-level')\r\n\r\nconst EC_BLOCKS_TABLE = [\r\n// L  M  Q  H\r\n  1, 1, 1, 1,\r\n  1, 1, 1, 1,\r\n  1, 1, 2, 2,\r\n  1, 2, 2, 4,\r\n  1, 2, 4, 4,\r\n  2, 4, 4, 4,\r\n  2, 4, 6, 5,\r\n  2, 4, 6, 6,\r\n  2, 5, 8, 8,\r\n  4, 5, 8, 8,\r\n  4, 5, 8, 11,\r\n  4, 8, 10, 11,\r\n  4, 9, 12, 16,\r\n  4, 9, 16, 16,\r\n  6, 10, 12, 18,\r\n  6, 10, 17, 16,\r\n  6, 11, 16, 19,\r\n  6, 13, 18, 21,\r\n  7, 14, 21, 25,\r\n  8, 16, 20, 25,\r\n  8, 17, 23, 25,\r\n  9, 17, 23, 34,\r\n  9, 18, 25, 30,\r\n  10, 20, 27, 32,\r\n  12, 21, 29, 35,\r\n  12, 23, 34, 37,\r\n  12, 25, 34, 40,\r\n  13, 26, 35, 42,\r\n  14, 28, 38, 45,\r\n  15, 29, 40, 48,\r\n  16, 31, 43, 51,\r\n  17, 33, 45, 54,\r\n  18, 35, 48, 57,\r\n  19, 37, 51, 60,\r\n  19, 38, 53, 63,\r\n  20, 40, 56, 66,\r\n  21, 43, 59, 70,\r\n  22, 45, 62, 74,\r\n  24, 47, 65, 77,\r\n  25, 49, 68, 81\r\n]\r\n\r\nconst EC_CODEWORDS_TABLE = [\r\n// L  M  Q  H\r\n  7, 10, 13, 17,\r\n  10, 16, 22, 28,\r\n  15, 26, 36, 44,\r\n  20, 36, 52, 64,\r\n  26, 48, 72, 88,\r\n  36, 64, 96, 112,\r\n  40, 72, 108, 130,\r\n  48, 88, 132, 156,\r\n  60, 110, 160, 192,\r\n  72, 130, 192, 224,\r\n  80, 150, 224, 264,\r\n  96, 176, 260, 308,\r\n  104, 198, 288, 352,\r\n  120, 216, 320, 384,\r\n  132, 240, 360, 432,\r\n  144, 280, 408, 480,\r\n  168, 308, 448, 532,\r\n  180, 338, 504, 588,\r\n  196, 364, 546, 650,\r\n  224, 416, 600, 700,\r\n  224, 442, 644, 750,\r\n  252, 476, 690, 816,\r\n  270, 504, 750, 900,\r\n  300, 560, 810, 960,\r\n  312, 588, 870, 1050,\r\n  336, 644, 952, 1110,\r\n  360, 700, 1020, 1200,\r\n  390, 728, 1050, 1260,\r\n  420, 784, 1140, 1350,\r\n  450, 812, 1200, 1440,\r\n  480, 868, 1290, 1530,\r\n  510, 924, 1350, 1620,\r\n  540, 980, 1440, 1710,\r\n  570, 1036, 1530, 1800,\r\n  570, 1064, 1590, 1890,\r\n  600, 1120, 1680, 1980,\r\n  630, 1204, 1770, 2100,\r\n  660, 1260, 1860, 2220,\r\n  720, 1316, 1950, 2310,\r\n  750, 1372, 2040, 2430\r\n]\r\n\r\n/**\r\n * Returns the number of error correction block that the QR Code should contain\r\n * for the specified version and error correction level.\r\n *\r\n * @param  {Number} version              QR Code version\r\n * @param  {Number} errorCorrectionLevel Error correction level\r\n * @return {Number}                      Number of error correction blocks\r\n */\r\nexports.getBlocksCount = function getBlocksCount (version, errorCorrectionLevel) {\r\n  switch (errorCorrectionLevel) {\r\n    case ECLevel.L:\r\n      return EC_BLOCKS_TABLE[(version - 1) * 4 + 0]\r\n    case ECLevel.M:\r\n      return EC_BLOCKS_TABLE[(version - 1) * 4 + 1]\r\n    case ECLevel.Q:\r\n      return EC_BLOCKS_TABLE[(version - 1) * 4 + 2]\r\n    case ECLevel.H:\r\n      return EC_BLOCKS_TABLE[(version - 1) * 4 + 3]\r\n    default:\r\n      return undefined\r\n  }\r\n}\r\n\r\n/**\r\n * Returns the number of error correction codewords to use for the specified\r\n * version and error correction level.\r\n *\r\n * @param  {Number} version              QR Code version\r\n * @param  {Number} errorCorrectionLevel Error correction level\r\n * @return {Number}                      Number of error correction codewords\r\n */\r\nexports.getTotalCodewordsCount = function getTotalCodewordsCount (version, errorCorrectionLevel) {\r\n  switch (errorCorrectionLevel) {\r\n    case ECLevel.L:\r\n      return EC_CODEWORDS_TABLE[(version - 1) * 4 + 0]\r\n    case ECLevel.M:\r\n      return EC_CODEWORDS_TABLE[(version - 1) * 4 + 1]\r\n    case ECLevel.Q:\r\n      return EC_CODEWORDS_TABLE[(version - 1) * 4 + 2]\r\n    case ECLevel.H:\r\n      return EC_CODEWORDS_TABLE[(version - 1) * 4 + 3]\r\n    default:\r\n      return undefined\r\n  }\r\n}\r\n", "const EXP_TABLE = new Uint8Array(512)\nconst LOG_TABLE = new Uint8Array(256)\n/**\n * Precompute the log and anti-log tables for faster computation later\n *\n * For each possible value in the galois field 2^8, we will pre-compute\n * the logarithm and anti-logarithm (exponential) of this value\n *\n * ref {@link https://en.wikiversity.org/wiki/Reed%E2%80%93Solomon_codes_for_coders#Introduction_to_mathematical_fields}\n */\n;(function initTables () {\n  let x = 1\n  for (let i = 0; i < 255; i++) {\n    EXP_TABLE[i] = x\n    LOG_TABLE[x] = i\n\n    x <<= 1 // multiply by 2\n\n    // The QR code specification says to use byte-wise modulo 100011101 arithmetic.\n    // This means that when a number is 256 or larger, it should be XORed with 0x11D.\n    if (x & 0x100) { // similar to x >= 256, but a lot faster (because 0x100 == 256)\n      x ^= 0x11D\n    }\n  }\n\n  // Optimization: double the size of the anti-log table so that we don't need to mod 255 to\n  // stay inside the bounds (because we will mainly use this table for the multiplication of\n  // two GF numbers, no more).\n  // @see {@link mul}\n  for (let i = 255; i < 512; i++) {\n    EXP_TABLE[i] = EXP_TABLE[i - 255]\n  }\n}())\n\n/**\n * Returns log value of n inside Galois Field\n *\n * @param  {Number} n\n * @return {Number}\n */\nexports.log = function log (n) {\n  if (n < 1) throw new Error('log(' + n + ')')\n  return LOG_TABLE[n]\n}\n\n/**\n * Returns anti-log value of n inside Galois Field\n *\n * @param  {Number} n\n * @return {Number}\n */\nexports.exp = function exp (n) {\n  return EXP_TABLE[n]\n}\n\n/**\n * Multiplies two number inside Galois Field\n *\n * @param  {Number} x\n * @param  {Number} y\n * @return {Number}\n */\nexports.mul = function mul (x, y) {\n  if (x === 0 || y === 0) return 0\n\n  // should be EXP_TABLE[(LOG_TABLE[x] + LOG_TABLE[y]) % 255] if EXP_TABLE wasn't oversized\n  // @see {@link initTables}\n  return EXP_TABLE[LOG_TABLE[x] + LOG_TABLE[y]]\n}\n", "const GF = require('./galois-field')\n\n/**\n * Multiplies two polynomials inside Galois Field\n *\n * @param  {Uint8Array} p1 Polynomial\n * @param  {Uint8Array} p2 Polynomial\n * @return {Uint8Array}    Product of p1 and p2\n */\nexports.mul = function mul (p1, p2) {\n  const coeff = new Uint8Array(p1.length + p2.length - 1)\n\n  for (let i = 0; i < p1.length; i++) {\n    for (let j = 0; j < p2.length; j++) {\n      coeff[i + j] ^= GF.mul(p1[i], p2[j])\n    }\n  }\n\n  return coeff\n}\n\n/**\n * Calculate the remainder of polynomials division\n *\n * @param  {Uint8Array} divident Polynomial\n * @param  {Uint8Array} divisor  Polynomial\n * @return {Uint8Array}          Remainder\n */\nexports.mod = function mod (divident, divisor) {\n  let result = new Uint8Array(divident)\n\n  while ((result.length - divisor.length) >= 0) {\n    const coeff = result[0]\n\n    for (let i = 0; i < divisor.length; i++) {\n      result[i] ^= GF.mul(divisor[i], coeff)\n    }\n\n    // remove all zeros from buffer head\n    let offset = 0\n    while (offset < result.length && result[offset] === 0) offset++\n    result = result.slice(offset)\n  }\n\n  return result\n}\n\n/**\n * Generate an irreducible generator polynomial of specified degree\n * (used by Reed-Solomon encoder)\n *\n * @param  {Number} degree Degree of the generator polynomial\n * @return {Uint8Array}    Buffer containing polynomial coefficients\n */\nexports.generateECPolynomial = function generateECPolynomial (degree) {\n  let poly = new Uint8Array([1])\n  for (let i = 0; i < degree; i++) {\n    poly = exports.mul(poly, new Uint8Array([1, GF.exp(i)]))\n  }\n\n  return poly\n}\n", "const Polynomial = require('./polynomial')\n\nfunction ReedSolomonEncoder (degree) {\n  this.genPoly = undefined\n  this.degree = degree\n\n  if (this.degree) this.initialize(this.degree)\n}\n\n/**\n * Initialize the encoder.\n * The input param should correspond to the number of error correction codewords.\n *\n * @param  {Number} degree\n */\nReedSolomonEncoder.prototype.initialize = function initialize (degree) {\n  // create an irreducible generator polynomial\n  this.degree = degree\n  this.genPoly = Polynomial.generateECPolynomial(this.degree)\n}\n\n/**\n * Encodes a chunk of data\n *\n * @param  {Uint8Array} data Buffer containing input data\n * @return {Uint8Array}      Buffer containing encoded data\n */\nReedSolomonEncoder.prototype.encode = function encode (data) {\n  if (!this.genPoly) {\n    throw new Error('Encoder not initialized')\n  }\n\n  // Calculate EC for this data block\n  // extends data size to data+genPoly size\n  const paddedData = new Uint8Array(data.length + this.degree)\n  paddedData.set(data)\n\n  // The error correction codewords are the remainder after dividing the data codewords\n  // by a generator polynomial\n  const remainder = Polynomial.mod(paddedData, this.genPoly)\n\n  // return EC data blocks (last n byte, where n is the degree of genPoly)\n  // If coefficients number in remainder are less than genPoly degree,\n  // pad with 0s to the left to reach the needed number of coefficients\n  const start = this.degree - remainder.length\n  if (start > 0) {\n    const buff = new Uint8Array(this.degree)\n    buff.set(remainder, start)\n\n    return buff\n  }\n\n  return remainder\n}\n\nmodule.exports = ReedSolomonEncoder\n", "/**\n * Check if QR Code version is valid\n *\n * @param  {Number}  version QR Code version\n * @return {Boolean}         true if valid version, false otherwise\n */\nexports.isValid = function isValid (version) {\n  return !isNaN(version) && version >= 1 && version <= 40\n}\n", "const numeric = '[0-9]+'\nconst alphanumeric = '[A-Z $%*+\\\\-./:]+'\nlet kanji = '(?:[u3000-u303F]|[u3040-u309F]|[u30A0-u30FF]|' +\n  '[uFF00-uFFEF]|[u4E00-u9FAF]|[u2605-u2606]|[u2190-u2195]|u203B|' +\n  '[u2010u2015u2018u2019u2025u2026u201Cu201Du2225u2260]|' +\n  '[u0391-u0451]|[u00A7u00A8u00B1u00B4u00D7u00F7])+'\nkanji = kanji.replace(/u/g, '\\\\u')\n\nconst byte = '(?:(?![A-Z0-9 $%*+\\\\-./:]|' + kanji + ')(?:.|[\\r\\n]))+'\n\nexports.KANJI = new RegExp(kanji, 'g')\nexports.BYTE_KANJI = new RegExp('[^A-Z0-9 $%*+\\\\-./:]+', 'g')\nexports.BYTE = new RegExp(byte, 'g')\nexports.NUMERIC = new RegExp(numeric, 'g')\nexports.ALPHANUMERIC = new RegExp(alphanumeric, 'g')\n\nconst TEST_KANJI = new RegExp('^' + kanji + '$')\nconst TEST_NUMERIC = new RegExp('^' + numeric + '$')\nconst TEST_ALPHANUMERIC = new RegExp('^[A-Z0-9 $%*+\\\\-./:]+$')\n\nexports.testKanji = function testKanji (str) {\n  return TEST_KANJI.test(str)\n}\n\nexports.testNumeric = function testNumeric (str) {\n  return TEST_NUMERIC.test(str)\n}\n\nexports.testAlphanumeric = function testAlphanumeric (str) {\n  return TEST_ALPHANUMERIC.test(str)\n}\n", "const VersionCheck = require('./version-check')\nconst Regex = require('./regex')\n\n/**\n * Numeric mode encodes data from the decimal digit set (0 - 9)\n * (byte values 30HEX to 39HEX).\n * Normally, 3 data characters are represented by 10 bits.\n *\n * @type {Object}\n */\nexports.NUMERIC = {\n  id: 'Numeric',\n  bit: 1 << 0,\n  ccBits: [10, 12, 14]\n}\n\n/**\n * Alphanumeric mode encodes data from a set of 45 characters,\n * i.e. 10 numeric digits (0 - 9),\n *      26 alphabetic characters (A - Z),\n *   and 9 symbols (SP, $, %, *, +, -, ., /, :).\n * Normally, two input characters are represented by 11 bits.\n *\n * @type {Object}\n */\nexports.ALPHANUMERIC = {\n  id: 'Alphanumeric',\n  bit: 1 << 1,\n  ccBits: [9, 11, 13]\n}\n\n/**\n * In byte mode, data is encoded at 8 bits per character.\n *\n * @type {Object}\n */\nexports.BYTE = {\n  id: 'Byte',\n  bit: 1 << 2,\n  ccBits: [8, 16, 16]\n}\n\n/**\n * The Kanji mode efficiently encodes Kanji characters in accordance with\n * the Shift JIS system based on JIS X 0208.\n * The Shift JIS values are shifted from the JIS X 0208 values.\n * JIS X 0208 gives details of the shift coded representation.\n * Each two-byte character value is compacted to a 13-bit binary codeword.\n *\n * @type {Object}\n */\nexports.KANJI = {\n  id: 'Kanji',\n  bit: 1 << 3,\n  ccBits: [8, 10, 12]\n}\n\n/**\n * Mixed mode will contain a sequences of data in a combination of any of\n * the modes described above\n *\n * @type {Object}\n */\nexports.MIXED = {\n  bit: -1\n}\n\n/**\n * Returns the number of bits needed to store the data length\n * according to QR Code specifications.\n *\n * @param  {Mode}   mode    Data mode\n * @param  {Number} version QR Code version\n * @return {Number}         Number of bits\n */\nexports.getCharCountIndicator = function getCharCountIndicator (mode, version) {\n  if (!mode.ccBits) throw new Error('Invalid mode: ' + mode)\n\n  if (!VersionCheck.isValid(version)) {\n    throw new Error('Invalid version: ' + version)\n  }\n\n  if (version >= 1 && version < 10) return mode.ccBits[0]\n  else if (version < 27) return mode.ccBits[1]\n  return mode.ccBits[2]\n}\n\n/**\n * Returns the most efficient mode to store the specified data\n *\n * @param  {String} dataStr Input data string\n * @return {Mode}           Best mode\n */\nexports.getBestModeForData = function getBestModeForData (dataStr) {\n  if (Regex.testNumeric(dataStr)) return exports.NUMERIC\n  else if (Regex.testAlphanumeric(dataStr)) return exports.ALPHANUMERIC\n  else if (Regex.testKanji(dataStr)) return exports.KANJI\n  else return exports.BYTE\n}\n\n/**\n * Return mode name as string\n *\n * @param {Mode} mode Mode object\n * @returns {String}  Mode name\n */\nexports.toString = function toString (mode) {\n  if (mode && mode.id) return mode.id\n  throw new Error('Invalid mode')\n}\n\n/**\n * Check if input param is a valid mode object\n *\n * @param   {Mode}    mode Mode object\n * @returns {Boolean} True if valid mode, false otherwise\n */\nexports.isValid = function isValid (mode) {\n  return mode && mode.bit && mode.ccBits\n}\n\n/**\n * Get mode object from its name\n *\n * @param   {String} string Mode name\n * @returns {Mode}          Mode object\n */\nfunction fromString (string) {\n  if (typeof string !== 'string') {\n    throw new Error('Param is not a string')\n  }\n\n  const lcStr = string.toLowerCase()\n\n  switch (lcStr) {\n    case 'numeric':\n      return exports.NUMERIC\n    case 'alphanumeric':\n      return exports.ALPHANUMERIC\n    case 'kanji':\n      return exports.KANJI\n    case 'byte':\n      return exports.BYTE\n    default:\n      throw new Error('Unknown mode: ' + string)\n  }\n}\n\n/**\n * Returns mode from a value.\n * If value is not a valid mode, returns defaultValue\n *\n * @param  {Mode|String} value        Encoding mode\n * @param  {Mode}        defaultValue Fallback value\n * @return {Mode}                     Encoding mode\n */\nexports.from = function from (value, defaultValue) {\n  if (exports.isValid(value)) {\n    return value\n  }\n\n  try {\n    return fromString(value)\n  } catch (e) {\n    return defaultValue\n  }\n}\n", "const Utils = require('./utils')\nconst ECCode = require('./error-correction-code')\nconst ECLevel = require('./error-correction-level')\nconst Mode = require('./mode')\nconst VersionCheck = require('./version-check')\n\n// Generator polynomial used to encode version information\nconst G18 = (1 << 12) | (1 << 11) | (1 << 10) | (1 << 9) | (1 << 8) | (1 << 5) | (1 << 2) | (1 << 0)\nconst G18_BCH = Utils.getBCHDigit(G18)\n\nfunction getBestVersionForDataLength (mode, length, errorCorrectionLevel) {\n  for (let currentVersion = 1; currentVersion <= 40; currentVersion++) {\n    if (length <= exports.getCapacity(currentVersion, errorCorrectionLevel, mode)) {\n      return currentVersion\n    }\n  }\n\n  return undefined\n}\n\nfunction getReservedBitsCount (mode, version) {\n  // Character count indicator + mode indicator bits\n  return Mode.getCharCountIndicator(mode, version) + 4\n}\n\nfunction getTotalBitsFromDataArray (segments, version) {\n  let totalBits = 0\n\n  segments.forEach(function (data) {\n    const reservedBits = getReservedBitsCount(data.mode, version)\n    totalBits += reservedBits + data.getBitsLength()\n  })\n\n  return totalBits\n}\n\nfunction getBestVersionForMixedData (segments, errorCorrectionLevel) {\n  for (let currentVersion = 1; currentVersion <= 40; currentVersion++) {\n    const length = getTotalBitsFromDataArray(segments, currentVersion)\n    if (length <= exports.getCapacity(currentVersion, errorCorrectionLevel, Mode.MIXED)) {\n      return currentVersion\n    }\n  }\n\n  return undefined\n}\n\n/**\n * Returns version number from a value.\n * If value is not a valid version, returns defaultValue\n *\n * @param  {Number|String} value        QR Code version\n * @param  {Number}        defaultValue Fallback value\n * @return {Number}                     QR Code version number\n */\nexports.from = function from (value, defaultValue) {\n  if (VersionCheck.isValid(value)) {\n    return parseInt(value, 10)\n  }\n\n  return defaultValue\n}\n\n/**\n * Returns how much data can be stored with the specified QR code version\n * and error correction level\n *\n * @param  {Number} version              QR Code version (1-40)\n * @param  {Number} errorCorrectionLevel Error correction level\n * @param  {Mode}   mode                 Data mode\n * @return {Number}                      Quantity of storable data\n */\nexports.getCapacity = function getCapacity (version, errorCorrectionLevel, mode) {\n  if (!VersionCheck.isValid(version)) {\n    throw new Error('Invalid QR Code version')\n  }\n\n  // Use Byte mode as default\n  if (typeof mode === 'undefined') mode = Mode.BYTE\n\n  // Total codewords for this QR code version (Data + Error correction)\n  const totalCodewords = Utils.getSymbolTotalCodewords(version)\n\n  // Total number of error correction codewords\n  const ecTotalCodewords = ECCode.getTotalCodewordsCount(version, errorCorrectionLevel)\n\n  // Total number of data codewords\n  const dataTotalCodewordsBits = (totalCodewords - ecTotalCodewords) * 8\n\n  if (mode === Mode.MIXED) return dataTotalCodewordsBits\n\n  const usableBits = dataTotalCodewordsBits - getReservedBitsCount(mode, version)\n\n  // Return max number of storable codewords\n  switch (mode) {\n    case Mode.NUMERIC:\n      return Math.floor((usableBits / 10) * 3)\n\n    case Mode.ALPHANUMERIC:\n      return Math.floor((usableBits / 11) * 2)\n\n    case Mode.KANJI:\n      return Math.floor(usableBits / 13)\n\n    case Mode.BYTE:\n    default:\n      return Math.floor(usableBits / 8)\n  }\n}\n\n/**\n * Returns the minimum version needed to contain the amount of data\n *\n * @param  {Segment} data                    Segment of data\n * @param  {Number} [errorCorrectionLevel=H] Error correction level\n * @param  {Mode} mode                       Data mode\n * @return {Number}                          QR Code version\n */\nexports.getBestVersionForData = function getBestVersionForData (data, errorCorrectionLevel) {\n  let seg\n\n  const ecl = ECLevel.from(errorCorrectionLevel, ECLevel.M)\n\n  if (Array.isArray(data)) {\n    if (data.length > 1) {\n      return getBestVersionForMixedData(data, ecl)\n    }\n\n    if (data.length === 0) {\n      return 1\n    }\n\n    seg = data[0]\n  } else {\n    seg = data\n  }\n\n  return getBestVersionForDataLength(seg.mode, seg.getLength(), ecl)\n}\n\n/**\n * Returns version information with relative error correction bits\n *\n * The version information is included in QR Code symbols of version 7 or larger.\n * It consists of an 18-bit sequence containing 6 data bits,\n * with 12 error correction bits calculated using the (18, 6) Golay code.\n *\n * @param  {Number} version QR Code version\n * @return {Number}         Encoded version info bits\n */\nexports.getEncodedBits = function getEncodedBits (version) {\n  if (!VersionCheck.isValid(version) || version < 7) {\n    throw new Error('Invalid QR Code version')\n  }\n\n  let d = version << 12\n\n  while (Utils.getBCHDigit(d) - G18_BCH >= 0) {\n    d ^= (G18 << (Utils.getBCHDigit(d) - G18_BCH))\n  }\n\n  return (version << 12) | d\n}\n", "const Utils = require('./utils')\n\nconst G15 = (1 << 10) | (1 << 8) | (1 << 5) | (1 << 4) | (1 << 2) | (1 << 1) | (1 << 0)\nconst G15_MASK = (1 << 14) | (1 << 12) | (1 << 10) | (1 << 4) | (1 << 1)\nconst G15_BCH = Utils.getBCHDigit(G15)\n\n/**\n * Returns format information with relative error correction bits\n *\n * The format information is a 15-bit sequence containing 5 data bits,\n * with 10 error correction bits calculated using the (15, 5) BCH code.\n *\n * @param  {Number} errorCorrectionLevel Error correction level\n * @param  {Number} mask                 Mask pattern\n * @return {Number}                      Encoded format information bits\n */\nexports.getEncodedBits = function getEncodedBits (errorCorrectionLevel, mask) {\n  const data = ((errorCorrectionLevel.bit << 3) | mask)\n  let d = data << 10\n\n  while (Utils.getBCHDigit(d) - G15_BCH >= 0) {\n    d ^= (G15 << (Utils.getBCHDigit(d) - G15_BCH))\n  }\n\n  // xor final data with mask pattern in order to ensure that\n  // no combination of Error Correction Level and data mask pattern\n  // will result in an all-zero data string\n  return ((data << 10) | d) ^ G15_MASK\n}\n", "const Mode = require('./mode')\n\nfunction NumericData (data) {\n  this.mode = Mode.NUMERIC\n  this.data = data.toString()\n}\n\nNumericData.getBitsLength = function getBitsLength (length) {\n  return 10 * Math.floor(length / 3) + ((length % 3) ? ((length % 3) * 3 + 1) : 0)\n}\n\nNumericData.prototype.getLength = function getLength () {\n  return this.data.length\n}\n\nNumericData.prototype.getBitsLength = function getBitsLength () {\n  return NumericData.getBitsLength(this.data.length)\n}\n\nNumericData.prototype.write = function write (bitBuffer) {\n  let i, group, value\n\n  // The input data string is divided into groups of three digits,\n  // and each group is converted to its 10-bit binary equivalent.\n  for (i = 0; i + 3 <= this.data.length; i += 3) {\n    group = this.data.substr(i, 3)\n    value = parseInt(group, 10)\n\n    bitBuffer.put(value, 10)\n  }\n\n  // If the number of input digits is not an exact multiple of three,\n  // the final one or two digits are converted to 4 or 7 bits respectively.\n  const remainingNum = this.data.length - i\n  if (remainingNum > 0) {\n    group = this.data.substr(i)\n    value = parseInt(group, 10)\n\n    bitBuffer.put(value, remainingNum * 3 + 1)\n  }\n}\n\nmodule.exports = NumericData\n", "const Mode = require('./mode')\n\n/**\n * Array of characters available in alphanumeric mode\n *\n * As per QR Code specification, to each character\n * is assigned a value from 0 to 44 which in this case coincides\n * with the array index\n *\n * @type {Array}\n */\nconst ALPHA_NUM_CHARS = [\n  '0', '1', '2', '3', '4', '5', '6', '7', '8', '9',\n  'A', 'B', 'C', 'D', 'E', 'F', 'G', 'H', 'I', 'J', 'K', 'L', 'M',\n  'N', 'O', 'P', 'Q', 'R', 'S', 'T', 'U', 'V', 'W', 'X', 'Y', 'Z',\n  ' ', '$', '%', '*', '+', '-', '.', '/', ':'\n]\n\nfunction AlphanumericData (data) {\n  this.mode = Mode.ALPHANUMERIC\n  this.data = data\n}\n\nAlphanumericData.getBitsLength = function getBitsLength (length) {\n  return 11 * Math.floor(length / 2) + 6 * (length % 2)\n}\n\nAlphanumericData.prototype.getLength = function getLength () {\n  return this.data.length\n}\n\nAlphanumericData.prototype.getBitsLength = function getBitsLength () {\n  return AlphanumericData.getBitsLength(this.data.length)\n}\n\nAlphanumericData.prototype.write = function write (bitBuffer) {\n  let i\n\n  // Input data characters are divided into groups of two characters\n  // and encoded as 11-bit binary codes.\n  for (i = 0; i + 2 <= this.data.length; i += 2) {\n    // The character value of the first character is multiplied by 45\n    let value = ALPHA_NUM_CHARS.indexOf(this.data[i]) * 45\n\n    // The character value of the second digit is added to the product\n    value += ALPHA_NUM_CHARS.indexOf(this.data[i + 1])\n\n    // The sum is then stored as 11-bit binary number\n    bitBuffer.put(value, 11)\n  }\n\n  // If the number of input data characters is not a multiple of two,\n  // the character value of the final character is encoded as a 6-bit binary number.\n  if (this.data.length % 2) {\n    bitBuffer.put(ALPHA_NUM_CHARS.indexOf(this.data[i]), 6)\n  }\n}\n\nmodule.exports = AlphanumericData\n", "const Mode = require('./mode')\n\nfunction ByteData (data) {\n  this.mode = Mode.BYTE\n  if (typeof (data) === 'string') {\n    this.data = new TextEncoder().encode(data)\n  } else {\n    this.data = new Uint8Array(data)\n  }\n}\n\nByteData.getBitsLength = function getBitsLength (length) {\n  return length * 8\n}\n\nByteData.prototype.getLength = function getLength () {\n  return this.data.length\n}\n\nByteData.prototype.getBitsLength = function getBitsLength () {\n  return ByteData.getBitsLength(this.data.length)\n}\n\nByteData.prototype.write = function (bitBuffer) {\n  for (let i = 0, l = this.data.length; i < l; i++) {\n    bitBuffer.put(this.data[i], 8)\n  }\n}\n\nmodule.exports = ByteData\n", "const Mode = require('./mode')\nconst Utils = require('./utils')\n\nfunction KanjiData (data) {\n  this.mode = Mode.KANJI\n  this.data = data\n}\n\nKanjiData.getBitsLength = function getBitsLength (length) {\n  return length * 13\n}\n\nKanjiData.prototype.getLength = function getLength () {\n  return this.data.length\n}\n\nKanjiData.prototype.getBitsLength = function getBitsLength () {\n  return KanjiData.getBitsLength(this.data.length)\n}\n\nKanjiData.prototype.write = function (bitBuffer) {\n  let i\n\n  // In the Shift JIS system, Kanji characters are represented by a two byte combination.\n  // These byte values are shifted from the JIS X 0208 values.\n  // JIS X 0208 gives details of the shift coded representation.\n  for (i = 0; i < this.data.length; i++) {\n    let value = Utils.toSJIS(this.data[i])\n\n    // For characters with Shift JIS values from 0x8140 to 0x9FFC:\n    if (value >= 0x8140 && value <= 0x9FFC) {\n      // Subtract 0x8140 from Shift JIS value\n      value -= 0x8140\n\n    // For characters with Shift JIS values from 0xE040 to 0xEBBF\n    } else if (value >= 0xE040 && value <= 0xEBBF) {\n      // Subtract 0xC140 from Shift JIS value\n      value -= 0xC140\n    } else {\n      throw new Error(\n        'Invalid SJIS character: ' + this.data[i] + '\\n' +\n        'Make sure your charset is UTF-8')\n    }\n\n    // Multiply most significant byte of result by 0xC0\n    // and add least significant byte to product\n    value = (((value >>> 8) & 0xff) * 0xC0) + (value & 0xff)\n\n    // Convert result to a 13-bit binary string\n    bitBuffer.put(value, 13)\n  }\n}\n\nmodule.exports = KanjiData\n", "'use strict';\n\n/******************************************************************************\n * Created 2008-08-19.\n *\n * Dijkstra path-finding functions. Adapted from the Dijkstar Python project.\n *\n * Copyright (C) 2008\n *   Wyatt Baldwin <self@wyattbaldwin.com>\n *   All rights reserved\n *\n * Licensed under the MIT license.\n *\n *   http://www.opensource.org/licenses/mit-license.php\n *\n * THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\n * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,\n * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE\n * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER\n * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,\n * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN\n * THE SOFTWARE.\n *****************************************************************************/\nvar dijkstra = {\n  single_source_shortest_paths: function(graph, s, d) {\n    // Predecessor map for each node that has been encountered.\n    // node ID => predecessor node ID\n    var predecessors = {};\n\n    // Costs of shortest paths from s to all nodes encountered.\n    // node ID => cost\n    var costs = {};\n    costs[s] = 0;\n\n    // Costs of shortest paths from s to all nodes encountered; differs from\n    // `costs` in that it provides easy access to the node that currently has\n    // the known shortest path from s.\n    // XXX: Do we actually need both `costs` and `open`?\n    var open = dijkstra.PriorityQueue.make();\n    open.push(s, 0);\n\n    var closest,\n        u, v,\n        cost_of_s_to_u,\n        adjacent_nodes,\n        cost_of_e,\n        cost_of_s_to_u_plus_cost_of_e,\n        cost_of_s_to_v,\n        first_visit;\n    while (!open.empty()) {\n      // In the nodes remaining in graph that have a known cost from s,\n      // find the node, u, that currently has the shortest path from s.\n      closest = open.pop();\n      u = closest.value;\n      cost_of_s_to_u = closest.cost;\n\n      // Get nodes adjacent to u...\n      adjacent_nodes = graph[u] || {};\n\n      // ...and explore the edges that connect u to those nodes, updating\n      // the cost of the shortest paths to any or all of those nodes as\n      // necessary. v is the node across the current edge from u.\n      for (v in adjacent_nodes) {\n        if (adjacent_nodes.hasOwnProperty(v)) {\n          // Get the cost of the edge running from u to v.\n          cost_of_e = adjacent_nodes[v];\n\n          // Cost of s to u plus the cost of u to v across e--this is *a*\n          // cost from s to v that may or may not be less than the current\n          // known cost to v.\n          cost_of_s_to_u_plus_cost_of_e = cost_of_s_to_u + cost_of_e;\n\n          // If we haven't visited v yet OR if the current known cost from s to\n          // v is greater than the new cost we just found (cost of s to u plus\n          // cost of u to v across e), update v's cost in the cost list and\n          // update v's predecessor in the predecessor list (it's now u).\n          cost_of_s_to_v = costs[v];\n          first_visit = (typeof costs[v] === 'undefined');\n          if (first_visit || cost_of_s_to_v > cost_of_s_to_u_plus_cost_of_e) {\n            costs[v] = cost_of_s_to_u_plus_cost_of_e;\n            open.push(v, cost_of_s_to_u_plus_cost_of_e);\n            predecessors[v] = u;\n          }\n        }\n      }\n    }\n\n    if (typeof d !== 'undefined' && typeof costs[d] === 'undefined') {\n      var msg = ['Could not find a path from ', s, ' to ', d, '.'].join('');\n      throw new Error(msg);\n    }\n\n    return predecessors;\n  },\n\n  extract_shortest_path_from_predecessor_list: function(predecessors, d) {\n    var nodes = [];\n    var u = d;\n    var predecessor;\n    while (u) {\n      nodes.push(u);\n      predecessor = predecessors[u];\n      u = predecessors[u];\n    }\n    nodes.reverse();\n    return nodes;\n  },\n\n  find_path: function(graph, s, d) {\n    var predecessors = dijkstra.single_source_shortest_paths(graph, s, d);\n    return dijkstra.extract_shortest_path_from_predecessor_list(\n      predecessors, d);\n  },\n\n  /**\n   * A very naive priority queue implementation.\n   */\n  PriorityQueue: {\n    make: function (opts) {\n      var T = dijkstra.PriorityQueue,\n          t = {},\n          key;\n      opts = opts || {};\n      for (key in T) {\n        if (T.hasOwnProperty(key)) {\n          t[key] = T[key];\n        }\n      }\n      t.queue = [];\n      t.sorter = opts.sorter || T.default_sorter;\n      return t;\n    },\n\n    default_sorter: function (a, b) {\n      return a.cost - b.cost;\n    },\n\n    /**\n     * Add a new item to the queue and ensure the highest priority element\n     * is at the front of the queue.\n     */\n    push: function (value, cost) {\n      var item = {value: value, cost: cost};\n      this.queue.push(item);\n      this.queue.sort(this.sorter);\n    },\n\n    /**\n     * Return the highest priority element in the queue.\n     */\n    pop: function () {\n      return this.queue.shift();\n    },\n\n    empty: function () {\n      return this.queue.length === 0;\n    }\n  }\n};\n\n\n// node.js module exports\nif (typeof module !== 'undefined') {\n  module.exports = dijkstra;\n}\n", "const Mode = require('./mode')\nconst NumericData = require('./numeric-data')\nconst AlphanumericData = require('./alphanumeric-data')\nconst ByteData = require('./byte-data')\nconst KanjiData = require('./kanji-data')\nconst Regex = require('./regex')\nconst Utils = require('./utils')\nconst dijkstra = require('dijkstrajs')\n\n/**\n * Returns UTF8 byte length\n *\n * @param  {String} str Input string\n * @return {Number}     Number of byte\n */\nfunction getStringByteLength (str) {\n  return unescape(encodeURIComponent(str)).length\n}\n\n/**\n * Get a list of segments of the specified mode\n * from a string\n *\n * @param  {Mode}   mode Segment mode\n * @param  {String} str  String to process\n * @return {Array}       Array of object with segments data\n */\nfunction getSegments (regex, mode, str) {\n  const segments = []\n  let result\n\n  while ((result = regex.exec(str)) !== null) {\n    segments.push({\n      data: result[0],\n      index: result.index,\n      mode: mode,\n      length: result[0].length\n    })\n  }\n\n  return segments\n}\n\n/**\n * Extracts a series of segments with the appropriate\n * modes from a string\n *\n * @param  {String} dataStr Input string\n * @return {Array}          Array of object with segments data\n */\nfunction getSegmentsFromString (dataStr) {\n  const numSegs = getSegments(Regex.NUMERIC, Mode.NUMERIC, dataStr)\n  const alphaNumSegs = getSegments(Regex.ALPHANUMERIC, Mode.ALPHANUMERIC, dataStr)\n  let byteSegs\n  let kanjiSegs\n\n  if (Utils.isKanjiModeEnabled()) {\n    byteSegs = getSegments(Regex.BYTE, Mode.BYTE, dataStr)\n    kanjiSegs = getSegments(Regex.KANJI, Mode.KANJI, dataStr)\n  } else {\n    byteSegs = getSegments(Regex.BYTE_KANJI, Mode.BYTE, dataStr)\n    kanjiSegs = []\n  }\n\n  const segs = numSegs.concat(alphaNumSegs, byteSegs, kanjiSegs)\n\n  return segs\n    .sort(function (s1, s2) {\n      return s1.index - s2.index\n    })\n    .map(function (obj) {\n      return {\n        data: obj.data,\n        mode: obj.mode,\n        length: obj.length\n      }\n    })\n}\n\n/**\n * Returns how many bits are needed to encode a string of\n * specified length with the specified mode\n *\n * @param  {Number} length String length\n * @param  {Mode} mode     Segment mode\n * @return {Number}        Bit length\n */\nfunction getSegmentBitsLength (length, mode) {\n  switch (mode) {\n    case Mode.NUMERIC:\n      return NumericData.getBitsLength(length)\n    case Mode.ALPHANUMERIC:\n      return AlphanumericData.getBitsLength(length)\n    case Mode.KANJI:\n      return KanjiData.getBitsLength(length)\n    case Mode.BYTE:\n      return ByteData.getBitsLength(length)\n  }\n}\n\n/**\n * Merges adjacent segments which have the same mode\n *\n * @param  {Array} segs Array of object with segments data\n * @return {Array}      Array of object with segments data\n */\nfunction mergeSegments (segs) {\n  return segs.reduce(function (acc, curr) {\n    const prevSeg = acc.length - 1 >= 0 ? acc[acc.length - 1] : null\n    if (prevSeg && prevSeg.mode === curr.mode) {\n      acc[acc.length - 1].data += curr.data\n      return acc\n    }\n\n    acc.push(curr)\n    return acc\n  }, [])\n}\n\n/**\n * Generates a list of all possible nodes combination which\n * will be used to build a segments graph.\n *\n * Nodes are divided by groups. Each group will contain a list of all the modes\n * in which is possible to encode the given text.\n *\n * For example the text '12345' can be encoded as Numeric, Alphanumeric or Byte.\n * The group for '12345' will contain then 3 objects, one for each\n * possible encoding mode.\n *\n * Each node represents a possible segment.\n *\n * @param  {Array} segs Array of object with segments data\n * @return {Array}      Array of object with segments data\n */\nfunction buildNodes (segs) {\n  const nodes = []\n  for (let i = 0; i < segs.length; i++) {\n    const seg = segs[i]\n\n    switch (seg.mode) {\n      case Mode.NUMERIC:\n        nodes.push([seg,\n          { data: seg.data, mode: Mode.ALPHANUMERIC, length: seg.length },\n          { data: seg.data, mode: Mode.BYTE, length: seg.length }\n        ])\n        break\n      case Mode.ALPHANUMERIC:\n        nodes.push([seg,\n          { data: seg.data, mode: Mode.BYTE, length: seg.length }\n        ])\n        break\n      case Mode.KANJI:\n        nodes.push([seg,\n          { data: seg.data, mode: Mode.BYTE, length: getStringByteLength(seg.data) }\n        ])\n        break\n      case Mode.BYTE:\n        nodes.push([\n          { data: seg.data, mode: Mode.BYTE, length: getStringByteLength(seg.data) }\n        ])\n    }\n  }\n\n  return nodes\n}\n\n/**\n * Builds a graph from a list of nodes.\n * All segments in each node group will be connected with all the segments of\n * the next group and so on.\n *\n * At each connection will be assigned a weight depending on the\n * segment's byte length.\n *\n * @param  {Array} nodes    Array of object with segments data\n * @param  {Number} version QR Code version\n * @return {Object}         Graph of all possible segments\n */\nfunction buildGraph (nodes, version) {\n  const table = {}\n  const graph = { start: {} }\n  let prevNodeIds = ['start']\n\n  for (let i = 0; i < nodes.length; i++) {\n    const nodeGroup = nodes[i]\n    const currentNodeIds = []\n\n    for (let j = 0; j < nodeGroup.length; j++) {\n      const node = nodeGroup[j]\n      const key = '' + i + j\n\n      currentNodeIds.push(key)\n      table[key] = { node: node, lastCount: 0 }\n      graph[key] = {}\n\n      for (let n = 0; n < prevNodeIds.length; n++) {\n        const prevNodeId = prevNodeIds[n]\n\n        if (table[prevNodeId] && table[prevNodeId].node.mode === node.mode) {\n          graph[prevNodeId][key] =\n            getSegmentBitsLength(table[prevNodeId].lastCount + node.length, node.mode) -\n            getSegmentBitsLength(table[prevNodeId].lastCount, node.mode)\n\n          table[prevNodeId].lastCount += node.length\n        } else {\n          if (table[prevNodeId]) table[prevNodeId].lastCount = node.length\n\n          graph[prevNodeId][key] = getSegmentBitsLength(node.length, node.mode) +\n            4 + Mode.getCharCountIndicator(node.mode, version) // switch cost\n        }\n      }\n    }\n\n    prevNodeIds = currentNodeIds\n  }\n\n  for (let n = 0; n < prevNodeIds.length; n++) {\n    graph[prevNodeIds[n]].end = 0\n  }\n\n  return { map: graph, table: table }\n}\n\n/**\n * Builds a segment from a specified data and mode.\n * If a mode is not specified, the more suitable will be used.\n *\n * @param  {String} data             Input data\n * @param  {Mode | String} modesHint Data mode\n * @return {Segment}                 Segment\n */\nfunction buildSingleSegment (data, modesHint) {\n  let mode\n  const bestMode = Mode.getBestModeForData(data)\n\n  mode = Mode.from(modesHint, bestMode)\n\n  // Make sure data can be encoded\n  if (mode !== Mode.BYTE && mode.bit < bestMode.bit) {\n    throw new Error('\"' + data + '\"' +\n      ' cannot be encoded with mode ' + Mode.toString(mode) +\n      '.\\n Suggested mode is: ' + Mode.toString(bestMode))\n  }\n\n  // Use Mode.BYTE if Kanji support is disabled\n  if (mode === Mode.KANJI && !Utils.isKanjiModeEnabled()) {\n    mode = Mode.BYTE\n  }\n\n  switch (mode) {\n    case Mode.NUMERIC:\n      return new NumericData(data)\n\n    case Mode.ALPHANUMERIC:\n      return new AlphanumericData(data)\n\n    case Mode.KANJI:\n      return new KanjiData(data)\n\n    case Mode.BYTE:\n      return new ByteData(data)\n  }\n}\n\n/**\n * Builds a list of segments from an array.\n * Array can contain Strings or Objects with segment's info.\n *\n * For each item which is a string, will be generated a segment with the given\n * string and the more appropriate encoding mode.\n *\n * For each item which is an object, will be generated a segment with the given\n * data and mode.\n * Objects must contain at least the property \"data\".\n * If property \"mode\" is not present, the more suitable mode will be used.\n *\n * @param  {Array} array Array of objects with segments data\n * @return {Array}       Array of Segments\n */\nexports.fromArray = function fromArray (array) {\n  return array.reduce(function (acc, seg) {\n    if (typeof seg === 'string') {\n      acc.push(buildSingleSegment(seg, null))\n    } else if (seg.data) {\n      acc.push(buildSingleSegment(seg.data, seg.mode))\n    }\n\n    return acc\n  }, [])\n}\n\n/**\n * Builds an optimized sequence of segments from a string,\n * which will produce the shortest possible bitstream.\n *\n * @param  {String} data    Input string\n * @param  {Number} version QR Code version\n * @return {Array}          Array of segments\n */\nexports.fromString = function fromString (data, version) {\n  const segs = getSegmentsFromString(data, Utils.isKanjiModeEnabled())\n\n  const nodes = buildNodes(segs)\n  const graph = buildGraph(nodes, version)\n  const path = dijkstra.find_path(graph.map, 'start', 'end')\n\n  const optimizedSegs = []\n  for (let i = 1; i < path.length - 1; i++) {\n    optimizedSegs.push(graph.table[path[i]].node)\n  }\n\n  return exports.fromArray(mergeSegments(optimizedSegs))\n}\n\n/**\n * Splits a string in various segments with the modes which\n * best represent their content.\n * The produced segments are far from being optimized.\n * The output of this function is only used to estimate a QR Code version\n * which may contain the data.\n *\n * @param  {string} data Input string\n * @return {Array}       Array of segments\n */\nexports.rawSplit = function rawSplit (data) {\n  return exports.fromArray(\n    getSegmentsFromString(data, Utils.isKanjiModeEnabled())\n  )\n}\n", "const Utils = require('./utils')\nconst ECLevel = require('./error-correction-level')\nconst BitBuffer = require('./bit-buffer')\nconst BitMatrix = require('./bit-matrix')\nconst AlignmentPattern = require('./alignment-pattern')\nconst FinderPattern = require('./finder-pattern')\nconst MaskPattern = require('./mask-pattern')\nconst ECCode = require('./error-correction-code')\nconst ReedSolomonEncoder = require('./reed-solomon-encoder')\nconst Version = require('./version')\nconst FormatInfo = require('./format-info')\nconst Mode = require('./mode')\nconst Segments = require('./segments')\n\n/**\n * QRCode for JavaScript\n *\n * modified by Ryan Day for nodejs support\n * Copyright (c) 2011 Ryan Day\n *\n * Licensed under the MIT license:\n *   http://www.opensource.org/licenses/mit-license.php\n *\n//---------------------------------------------------------------------\n// QRCode for JavaScript\n//\n// Copyright (c) 2009 Kazuhiko Arase\n//\n// URL: http://www.d-project.com/\n//\n// Licensed under the MIT license:\n//   http://www.opensource.org/licenses/mit-license.php\n//\n// The word \"QR Code\" is registered trademark of\n// DENSO WAVE INCORPORATED\n//   http://www.denso-wave.com/qrcode/faqpatent-e.html\n//\n//---------------------------------------------------------------------\n*/\n\n/**\n * Add finder patterns bits to matrix\n *\n * @param  {BitMatrix} matrix  Modules matrix\n * @param  {Number}    version QR Code version\n */\nfunction setupFinderPattern (matrix, version) {\n  const size = matrix.size\n  const pos = FinderPattern.getPositions(version)\n\n  for (let i = 0; i < pos.length; i++) {\n    const row = pos[i][0]\n    const col = pos[i][1]\n\n    for (let r = -1; r <= 7; r++) {\n      if (row + r <= -1 || size <= row + r) continue\n\n      for (let c = -1; c <= 7; c++) {\n        if (col + c <= -1 || size <= col + c) continue\n\n        if ((r >= 0 && r <= 6 && (c === 0 || c === 6)) ||\n          (c >= 0 && c <= 6 && (r === 0 || r === 6)) ||\n          (r >= 2 && r <= 4 && c >= 2 && c <= 4)) {\n          matrix.set(row + r, col + c, true, true)\n        } else {\n          matrix.set(row + r, col + c, false, true)\n        }\n      }\n    }\n  }\n}\n\n/**\n * Add timing pattern bits to matrix\n *\n * Note: this function must be called before {@link setupAlignmentPattern}\n *\n * @param  {BitMatrix} matrix Modules matrix\n */\nfunction setupTimingPattern (matrix) {\n  const size = matrix.size\n\n  for (let r = 8; r < size - 8; r++) {\n    const value = r % 2 === 0\n    matrix.set(r, 6, value, true)\n    matrix.set(6, r, value, true)\n  }\n}\n\n/**\n * Add alignment patterns bits to matrix\n *\n * Note: this function must be called after {@link setupTimingPattern}\n *\n * @param  {BitMatrix} matrix  Modules matrix\n * @param  {Number}    version QR Code version\n */\nfunction setupAlignmentPattern (matrix, version) {\n  const pos = AlignmentPattern.getPositions(version)\n\n  for (let i = 0; i < pos.length; i++) {\n    const row = pos[i][0]\n    const col = pos[i][1]\n\n    for (let r = -2; r <= 2; r++) {\n      for (let c = -2; c <= 2; c++) {\n        if (r === -2 || r === 2 || c === -2 || c === 2 ||\n          (r === 0 && c === 0)) {\n          matrix.set(row + r, col + c, true, true)\n        } else {\n          matrix.set(row + r, col + c, false, true)\n        }\n      }\n    }\n  }\n}\n\n/**\n * Add version info bits to matrix\n *\n * @param  {BitMatrix} matrix  Modules matrix\n * @param  {Number}    version QR Code version\n */\nfunction setupVersionInfo (matrix, version) {\n  const size = matrix.size\n  const bits = Version.getEncodedBits(version)\n  let row, col, mod\n\n  for (let i = 0; i < 18; i++) {\n    row = Math.floor(i / 3)\n    col = i % 3 + size - 8 - 3\n    mod = ((bits >> i) & 1) === 1\n\n    matrix.set(row, col, mod, true)\n    matrix.set(col, row, mod, true)\n  }\n}\n\n/**\n * Add format info bits to matrix\n *\n * @param  {BitMatrix} matrix               Modules matrix\n * @param  {ErrorCorrectionLevel}    errorCorrectionLevel Error correction level\n * @param  {Number}    maskPattern          Mask pattern reference value\n */\nfunction setupFormatInfo (matrix, errorCorrectionLevel, maskPattern) {\n  const size = matrix.size\n  const bits = FormatInfo.getEncodedBits(errorCorrectionLevel, maskPattern)\n  let i, mod\n\n  for (i = 0; i < 15; i++) {\n    mod = ((bits >> i) & 1) === 1\n\n    // vertical\n    if (i < 6) {\n      matrix.set(i, 8, mod, true)\n    } else if (i < 8) {\n      matrix.set(i + 1, 8, mod, true)\n    } else {\n      matrix.set(size - 15 + i, 8, mod, true)\n    }\n\n    // horizontal\n    if (i < 8) {\n      matrix.set(8, size - i - 1, mod, true)\n    } else if (i < 9) {\n      matrix.set(8, 15 - i - 1 + 1, mod, true)\n    } else {\n      matrix.set(8, 15 - i - 1, mod, true)\n    }\n  }\n\n  // fixed module\n  matrix.set(size - 8, 8, 1, true)\n}\n\n/**\n * Add encoded data bits to matrix\n *\n * @param  {BitMatrix}  matrix Modules matrix\n * @param  {Uint8Array} data   Data codewords\n */\nfunction setupData (matrix, data) {\n  const size = matrix.size\n  let inc = -1\n  let row = size - 1\n  let bitIndex = 7\n  let byteIndex = 0\n\n  for (let col = size - 1; col > 0; col -= 2) {\n    if (col === 6) col--\n\n    while (true) {\n      for (let c = 0; c < 2; c++) {\n        if (!matrix.isReserved(row, col - c)) {\n          let dark = false\n\n          if (byteIndex < data.length) {\n            dark = (((data[byteIndex] >>> bitIndex) & 1) === 1)\n          }\n\n          matrix.set(row, col - c, dark)\n          bitIndex--\n\n          if (bitIndex === -1) {\n            byteIndex++\n            bitIndex = 7\n          }\n        }\n      }\n\n      row += inc\n\n      if (row < 0 || size <= row) {\n        row -= inc\n        inc = -inc\n        break\n      }\n    }\n  }\n}\n\n/**\n * Create encoded codewords from data input\n *\n * @param  {Number}   version              QR Code version\n * @param  {ErrorCorrectionLevel}   errorCorrectionLevel Error correction level\n * @param  {ByteData} data                 Data input\n * @return {Uint8Array}                    Buffer containing encoded codewords\n */\nfunction createData (version, errorCorrectionLevel, segments) {\n  // Prepare data buffer\n  const buffer = new BitBuffer()\n\n  segments.forEach(function (data) {\n    // prefix data with mode indicator (4 bits)\n    buffer.put(data.mode.bit, 4)\n\n    // Prefix data with character count indicator.\n    // The character count indicator is a string of bits that represents the\n    // number of characters that are being encoded.\n    // The character count indicator must be placed after the mode indicator\n    // and must be a certain number of bits long, depending on the QR version\n    // and data mode\n    // @see {@link Mode.getCharCountIndicator}.\n    buffer.put(data.getLength(), Mode.getCharCountIndicator(data.mode, version))\n\n    // add binary data sequence to buffer\n    data.write(buffer)\n  })\n\n  // Calculate required number of bits\n  const totalCodewords = Utils.getSymbolTotalCodewords(version)\n  const ecTotalCodewords = ECCode.getTotalCodewordsCount(version, errorCorrectionLevel)\n  const dataTotalCodewordsBits = (totalCodewords - ecTotalCodewords) * 8\n\n  // Add a terminator.\n  // If the bit string is shorter than the total number of required bits,\n  // a terminator of up to four 0s must be added to the right side of the string.\n  // If the bit string is more than four bits shorter than the required number of bits,\n  // add four 0s to the end.\n  if (buffer.getLengthInBits() + 4 <= dataTotalCodewordsBits) {\n    buffer.put(0, 4)\n  }\n\n  // If the bit string is fewer than four bits shorter, add only the number of 0s that\n  // are needed to reach the required number of bits.\n\n  // After adding the terminator, if the number of bits in the string is not a multiple of 8,\n  // pad the string on the right with 0s to make the string's length a multiple of 8.\n  while (buffer.getLengthInBits() % 8 !== 0) {\n    buffer.putBit(0)\n  }\n\n  // Add pad bytes if the string is still shorter than the total number of required bits.\n  // Extend the buffer to fill the data capacity of the symbol corresponding to\n  // the Version and Error Correction Level by adding the Pad Codewords 11101100 (0xEC)\n  // and 00010001 (0x11) alternately.\n  const remainingByte = (dataTotalCodewordsBits - buffer.getLengthInBits()) / 8\n  for (let i = 0; i < remainingByte; i++) {\n    buffer.put(i % 2 ? 0x11 : 0xEC, 8)\n  }\n\n  return createCodewords(buffer, version, errorCorrectionLevel)\n}\n\n/**\n * Encode input data with Reed-Solomon and return codewords with\n * relative error correction bits\n *\n * @param  {BitBuffer} bitBuffer            Data to encode\n * @param  {Number}    version              QR Code version\n * @param  {ErrorCorrectionLevel} errorCorrectionLevel Error correction level\n * @return {Uint8Array}                     Buffer containing encoded codewords\n */\nfunction createCodewords (bitBuffer, version, errorCorrectionLevel) {\n  // Total codewords for this QR code version (Data + Error correction)\n  const totalCodewords = Utils.getSymbolTotalCodewords(version)\n\n  // Total number of error correction codewords\n  const ecTotalCodewords = ECCode.getTotalCodewordsCount(version, errorCorrectionLevel)\n\n  // Total number of data codewords\n  const dataTotalCodewords = totalCodewords - ecTotalCodewords\n\n  // Total number of blocks\n  const ecTotalBlocks = ECCode.getBlocksCount(version, errorCorrectionLevel)\n\n  // Calculate how many blocks each group should contain\n  const blocksInGroup2 = totalCodewords % ecTotalBlocks\n  const blocksInGroup1 = ecTotalBlocks - blocksInGroup2\n\n  const totalCodewordsInGroup1 = Math.floor(totalCodewords / ecTotalBlocks)\n\n  const dataCodewordsInGroup1 = Math.floor(dataTotalCodewords / ecTotalBlocks)\n  const dataCodewordsInGroup2 = dataCodewordsInGroup1 + 1\n\n  // Number of EC codewords is the same for both groups\n  const ecCount = totalCodewordsInGroup1 - dataCodewordsInGroup1\n\n  // Initialize a Reed-Solomon encoder with a generator polynomial of degree ecCount\n  const rs = new ReedSolomonEncoder(ecCount)\n\n  let offset = 0\n  const dcData = new Array(ecTotalBlocks)\n  const ecData = new Array(ecTotalBlocks)\n  let maxDataSize = 0\n  const buffer = new Uint8Array(bitBuffer.buffer)\n\n  // Divide the buffer into the required number of blocks\n  for (let b = 0; b < ecTotalBlocks; b++) {\n    const dataSize = b < blocksInGroup1 ? dataCodewordsInGroup1 : dataCodewordsInGroup2\n\n    // extract a block of data from buffer\n    dcData[b] = buffer.slice(offset, offset + dataSize)\n\n    // Calculate EC codewords for this data block\n    ecData[b] = rs.encode(dcData[b])\n\n    offset += dataSize\n    maxDataSize = Math.max(maxDataSize, dataSize)\n  }\n\n  // Create final data\n  // Interleave the data and error correction codewords from each block\n  const data = new Uint8Array(totalCodewords)\n  let index = 0\n  let i, r\n\n  // Add data codewords\n  for (i = 0; i < maxDataSize; i++) {\n    for (r = 0; r < ecTotalBlocks; r++) {\n      if (i < dcData[r].length) {\n        data[index++] = dcData[r][i]\n      }\n    }\n  }\n\n  // Apped EC codewords\n  for (i = 0; i < ecCount; i++) {\n    for (r = 0; r < ecTotalBlocks; r++) {\n      data[index++] = ecData[r][i]\n    }\n  }\n\n  return data\n}\n\n/**\n * Build QR Code symbol\n *\n * @param  {String} data                 Input string\n * @param  {Number} version              QR Code version\n * @param  {ErrorCorretionLevel} errorCorrectionLevel Error level\n * @param  {MaskPattern} maskPattern     Mask pattern\n * @return {Object}                      Object containing symbol data\n */\nfunction createSymbol (data, version, errorCorrectionLevel, maskPattern) {\n  let segments\n\n  if (Array.isArray(data)) {\n    segments = Segments.fromArray(data)\n  } else if (typeof data === 'string') {\n    let estimatedVersion = version\n\n    if (!estimatedVersion) {\n      const rawSegments = Segments.rawSplit(data)\n\n      // Estimate best version that can contain raw splitted segments\n      estimatedVersion = Version.getBestVersionForData(rawSegments, errorCorrectionLevel)\n    }\n\n    // Build optimized segments\n    // If estimated version is undefined, try with the highest version\n    segments = Segments.fromString(data, estimatedVersion || 40)\n  } else {\n    throw new Error('Invalid data')\n  }\n\n  // Get the min version that can contain data\n  const bestVersion = Version.getBestVersionForData(segments, errorCorrectionLevel)\n\n  // If no version is found, data cannot be stored\n  if (!bestVersion) {\n    throw new Error('The amount of data is too big to be stored in a QR Code')\n  }\n\n  // If not specified, use min version as default\n  if (!version) {\n    version = bestVersion\n\n  // Check if the specified version can contain the data\n  } else if (version < bestVersion) {\n    throw new Error('\\n' +\n      'The chosen QR Code version cannot contain this amount of data.\\n' +\n      'Minimum version required to store current data is: ' + bestVersion + '.\\n'\n    )\n  }\n\n  const dataBits = createData(version, errorCorrectionLevel, segments)\n\n  // Allocate matrix buffer\n  const moduleCount = Utils.getSymbolSize(version)\n  const modules = new BitMatrix(moduleCount)\n\n  // Add function modules\n  setupFinderPattern(modules, version)\n  setupTimingPattern(modules)\n  setupAlignmentPattern(modules, version)\n\n  // Add temporary dummy bits for format info just to set them as reserved.\n  // This is needed to prevent these bits from being masked by {@link MaskPattern.applyMask}\n  // since the masking operation must be performed only on the encoding region.\n  // These blocks will be replaced with correct values later in code.\n  setupFormatInfo(modules, errorCorrectionLevel, 0)\n\n  if (version >= 7) {\n    setupVersionInfo(modules, version)\n  }\n\n  // Add data codewords\n  setupData(modules, dataBits)\n\n  if (isNaN(maskPattern)) {\n    // Find best mask pattern\n    maskPattern = MaskPattern.getBestMask(modules,\n      setupFormatInfo.bind(null, modules, errorCorrectionLevel))\n  }\n\n  // Apply mask pattern\n  MaskPattern.applyMask(maskPattern, modules)\n\n  // Replace format info bits with correct values\n  setupFormatInfo(modules, errorCorrectionLevel, maskPattern)\n\n  return {\n    modules: modules,\n    version: version,\n    errorCorrectionLevel: errorCorrectionLevel,\n    maskPattern: maskPattern,\n    segments: segments\n  }\n}\n\n/**\n * QR Code\n *\n * @param {String | Array} data                 Input data\n * @param {Object} options                      Optional configurations\n * @param {Number} options.version              QR Code version\n * @param {String} options.errorCorrectionLevel Error correction level\n * @param {Function} options.toSJISFunc         Helper func to convert utf8 to sjis\n */\nexports.create = function create (data, options) {\n  if (typeof data === 'undefined' || data === '') {\n    throw new Error('No input text')\n  }\n\n  let errorCorrectionLevel = ECLevel.M\n  let version\n  let mask\n\n  if (typeof options !== 'undefined') {\n    // Use higher error correction level as default\n    errorCorrectionLevel = ECLevel.from(options.errorCorrectionLevel, ECLevel.M)\n    version = Version.from(options.version)\n    mask = MaskPattern.from(options.maskPattern)\n\n    if (options.toSJISFunc) {\n      Utils.setToSJISFunction(options.toSJISFunc)\n    }\n  }\n\n  return createSymbol(data, version, errorCorrectionLevel, mask)\n}\n", "function hex2rgba (hex) {\n  if (typeof hex === 'number') {\n    hex = hex.toString()\n  }\n\n  if (typeof hex !== 'string') {\n    throw new Error('Color should be defined as hex string')\n  }\n\n  let hexCode = hex.slice().replace('#', '').split('')\n  if (hexCode.length < 3 || hexCode.length === 5 || hexCode.length > 8) {\n    throw new Error('Invalid hex color: ' + hex)\n  }\n\n  // Convert from short to long form (fff -> ffffff)\n  if (hexCode.length === 3 || hexCode.length === 4) {\n    hexCode = Array.prototype.concat.apply([], hexCode.map(function (c) {\n      return [c, c]\n    }))\n  }\n\n  // Add default alpha value\n  if (hexCode.length === 6) hexCode.push('F', 'F')\n\n  const hexValue = parseInt(hexCode.join(''), 16)\n\n  return {\n    r: (hexValue >> 24) & 255,\n    g: (hexValue >> 16) & 255,\n    b: (hexValue >> 8) & 255,\n    a: hexValue & 255,\n    hex: '#' + hexCode.slice(0, 6).join('')\n  }\n}\n\nexports.getOptions = function getOptions (options) {\n  if (!options) options = {}\n  if (!options.color) options.color = {}\n\n  const margin = typeof options.margin === 'undefined' ||\n    options.margin === null ||\n    options.margin < 0\n    ? 4\n    : options.margin\n\n  const width = options.width && options.width >= 21 ? options.width : undefined\n  const scale = options.scale || 4\n\n  return {\n    width: width,\n    scale: width ? 4 : scale,\n    margin: margin,\n    color: {\n      dark: hex2rgba(options.color.dark || '#000000ff'),\n      light: hex2rgba(options.color.light || '#ffffffff')\n    },\n    type: options.type,\n    rendererOpts: options.rendererOpts || {}\n  }\n}\n\nexports.getScale = function getScale (qrSize, opts) {\n  return opts.width && opts.width >= qrSize + opts.margin * 2\n    ? opts.width / (qrSize + opts.margin * 2)\n    : opts.scale\n}\n\nexports.getImageWidth = function getImageWidth (qrSize, opts) {\n  const scale = exports.getScale(qrSize, opts)\n  return Math.floor((qrSize + opts.margin * 2) * scale)\n}\n\nexports.qrToImageData = function qrToImageData (imgData, qr, opts) {\n  const size = qr.modules.size\n  const data = qr.modules.data\n  const scale = exports.getScale(size, opts)\n  const symbolSize = Math.floor((size + opts.margin * 2) * scale)\n  const scaledMargin = opts.margin * scale\n  const palette = [opts.color.light, opts.color.dark]\n\n  for (let i = 0; i < symbolSize; i++) {\n    for (let j = 0; j < symbolSize; j++) {\n      let posDst = (i * symbolSize + j) * 4\n      let pxColor = opts.color.light\n\n      if (i >= scaledMargin && j >= scaledMargin &&\n        i < symbolSize - scaledMargin && j < symbolSize - scaledMargin) {\n        const iSrc = Math.floor((i - scaledMargin) / scale)\n        const jSrc = Math.floor((j - scaledMargin) / scale)\n        pxColor = palette[data[iSrc * size + jSrc] ? 1 : 0]\n      }\n\n      imgData[posDst++] = pxColor.r\n      imgData[posDst++] = pxColor.g\n      imgData[posDst++] = pxColor.b\n      imgData[posDst] = pxColor.a\n    }\n  }\n}\n", "const Utils = require('./utils')\n\nfunction clearCanvas (ctx, canvas, size) {\n  ctx.clearRect(0, 0, canvas.width, canvas.height)\n\n  if (!canvas.style) canvas.style = {}\n  canvas.height = size\n  canvas.width = size\n  canvas.style.height = size + 'px'\n  canvas.style.width = size + 'px'\n}\n\nfunction getCanvasElement () {\n  try {\n    return document.createElement('canvas')\n  } catch (e) {\n    throw new Error('You need to specify a canvas element')\n  }\n}\n\nexports.render = function render (qrData, canvas, options) {\n  let opts = options\n  let canvasEl = canvas\n\n  if (typeof opts === 'undefined' && (!canvas || !canvas.getContext)) {\n    opts = canvas\n    canvas = undefined\n  }\n\n  if (!canvas) {\n    canvasEl = getCanvasElement()\n  }\n\n  opts = Utils.getOptions(opts)\n  const size = Utils.getImageWidth(qrData.modules.size, opts)\n\n  const ctx = canvasEl.getContext('2d')\n  const image = ctx.createImageData(size, size)\n  Utils.qrToImageData(image.data, qrData, opts)\n\n  clearCanvas(ctx, canvasEl, size)\n  ctx.putImageData(image, 0, 0)\n\n  return canvasEl\n}\n\nexports.renderToDataURL = function renderToDataURL (qrData, canvas, options) {\n  let opts = options\n\n  if (typeof opts === 'undefined' && (!canvas || !canvas.getContext)) {\n    opts = canvas\n    canvas = undefined\n  }\n\n  if (!opts) opts = {}\n\n  const canvasEl = exports.render(qrData, canvas, opts)\n\n  const type = opts.type || 'image/png'\n  const rendererOpts = opts.rendererOpts || {}\n\n  return canvasEl.toDataURL(type, rendererOpts.quality)\n}\n", "const Utils = require('./utils')\n\nfunction getColorAttrib (color, attrib) {\n  const alpha = color.a / 255\n  const str = attrib + '=\"' + color.hex + '\"'\n\n  return alpha < 1\n    ? str + ' ' + attrib + '-opacity=\"' + alpha.toFixed(2).slice(1) + '\"'\n    : str\n}\n\nfunction svgCmd (cmd, x, y) {\n  let str = cmd + x\n  if (typeof y !== 'undefined') str += ' ' + y\n\n  return str\n}\n\nfunction qrToPath (data, size, margin) {\n  let path = ''\n  let moveBy = 0\n  let newRow = false\n  let lineLength = 0\n\n  for (let i = 0; i < data.length; i++) {\n    const col = Math.floor(i % size)\n    const row = Math.floor(i / size)\n\n    if (!col && !newRow) newRow = true\n\n    if (data[i]) {\n      lineLength++\n\n      if (!(i > 0 && col > 0 && data[i - 1])) {\n        path += newRow\n          ? svgCmd('M', col + margin, 0.5 + row + margin)\n          : svgCmd('m', moveBy, 0)\n\n        moveBy = 0\n        newRow = false\n      }\n\n      if (!(col + 1 < size && data[i + 1])) {\n        path += svgCmd('h', lineLength)\n        lineLength = 0\n      }\n    } else {\n      moveBy++\n    }\n  }\n\n  return path\n}\n\nexports.render = function render (qrData, options, cb) {\n  const opts = Utils.getOptions(options)\n  const size = qrData.modules.size\n  const data = qrData.modules.data\n  const qrcodesize = size + opts.margin * 2\n\n  const bg = !opts.color.light.a\n    ? ''\n    : '<path ' + getColorAttrib(opts.color.light, 'fill') +\n      ' d=\"M0 0h' + qrcodesize + 'v' + qrcodesize + 'H0z\"/>'\n\n  const path =\n    '<path ' + getColorAttrib(opts.color.dark, 'stroke') +\n    ' d=\"' + qrToPath(data, size, opts.margin) + '\"/>'\n\n  const viewBox = 'viewBox=\"' + '0 0 ' + qrcodesize + ' ' + qrcodesize + '\"'\n\n  const width = !opts.width ? '' : 'width=\"' + opts.width + '\" height=\"' + opts.width + '\" '\n\n  const svgTag = '<svg xmlns=\"http://www.w3.org/2000/svg\" ' + width + viewBox + ' shape-rendering=\"crispEdges\">' + bg + path + '</svg>\\n'\n\n  if (typeof cb === 'function') {\n    cb(null, svgTag)\n  }\n\n  return svgTag\n}\n", "\nconst canPromise = require('./can-promise')\n\nconst QRCode = require('./core/qrcode')\nconst CanvasRenderer = require('./renderer/canvas')\nconst SvgRenderer = require('./renderer/svg-tag.js')\n\nfunction renderCanvas (renderFunc, canvas, text, opts, cb) {\n  const args = [].slice.call(arguments, 1)\n  const argsNum = args.length\n  const isLastArgCb = typeof args[argsNum - 1] === 'function'\n\n  if (!isLastArgCb && !canPromise()) {\n    throw new Error('Callback required as last argument')\n  }\n\n  if (isLastArgCb) {\n    if (argsNum < 2) {\n      throw new Error('Too few arguments provided')\n    }\n\n    if (argsNum === 2) {\n      cb = text\n      text = canvas\n      canvas = opts = undefined\n    } else if (argsNum === 3) {\n      if (canvas.getContext && typeof cb === 'undefined') {\n        cb = opts\n        opts = undefined\n      } else {\n        cb = opts\n        opts = text\n        text = canvas\n        canvas = undefined\n      }\n    }\n  } else {\n    if (argsNum < 1) {\n      throw new Error('Too few arguments provided')\n    }\n\n    if (argsNum === 1) {\n      text = canvas\n      canvas = opts = undefined\n    } else if (argsNum === 2 && !canvas.getContext) {\n      opts = text\n      text = canvas\n      canvas = undefined\n    }\n\n    return new Promise(function (resolve, reject) {\n      try {\n        const data = QRCode.create(text, opts)\n        resolve(renderFunc(data, canvas, opts))\n      } catch (e) {\n        reject(e)\n      }\n    })\n  }\n\n  try {\n    const data = QRCode.create(text, opts)\n    cb(null, renderFunc(data, canvas, opts))\n  } catch (e) {\n    cb(e)\n  }\n}\n\nexports.create = QRCode.create\nexports.toCanvas = renderCanvas.bind(null, CanvasRenderer.render)\nexports.toDataURL = renderCanvas.bind(null, CanvasRenderer.renderToDataURL)\n\n// only svg for now.\nexports.toString = renderCanvas.bind(null, function (data, _, opts) {\n  return SvgRenderer.render(data, opts)\n})\n", "import { pdf } from '@react-pdf/renderer';\nimport React, { ReactElement } from 'react';\nimport { PdfGenerator } from '~/components/PdfGenerator';\nimport {\n  GeneratePdfFunction,\n  PdfResult,\n  PdfGenerationError,\n  PdfComponentElement,\n  Template,\n  TemplateData,\n} from '~/types';\n\nexport const generatePdf: GeneratePdfFunction = async (\n  template: string,\n  data: string,\n): Promise<PdfResult> => {\n  try {\n    // Validate inputs\n    if (!template || !data) {\n      throw new Error('Template and data are required');\n    }\n\n    // Parse and validate template\n    let templateObj: Template;\n    try {\n      templateObj = JSON.parse(template);\n      if (!templateObj.components || !Array.isArray(templateObj.components)) {\n        throw new Error(\n          'Invalid template structure: missing or invalid components array',\n        );\n      }\n    } catch (parseError) {\n      throw new Error(\n        `Invalid template JSON: ${parseError instanceof Error ? parseError.message : 'Unknown parsing error'}`,\n      );\n    }\n\n    // Parse and validate data\n    let dataObj: TemplateData;\n    try {\n      dataObj = JSON.parse(data);\n      if (typeof dataObj !== 'object' || dataObj === null) {\n        throw new Error('Data must be a valid JSON object');\n      }\n    } catch (parseError) {\n      throw new Error(\n        `Invalid data JSON: ${parseError instanceof Error ? parseError.message : 'Unknown parsing error'}`,\n      );\n    }\n\n    // Create the PDF document element\n    const document: PdfComponentElement = React.createElement(PdfGenerator, {\n      data,\n      template,\n    });\n\n    // Generate PDF blob\n    const pdfBuffer: PdfResult = await pdf(\n      document as ReactElement<any>,\n    ).toBlob();\n\n    return pdfBuffer;\n  } catch (error) {\n    // Create a custom error with additional context\n    const pdfError: PdfGenerationError = new Error(\n      `PDF generation failed: ${error instanceof Error ? error.message : 'Unknown error'}`,\n    ) as PdfGenerationError;\n\n    pdfError.originalError = error instanceof Error ? error : undefined;\n    pdfError.template = template;\n    pdfError.data = data;\n\n    throw pdfError;\n  }\n};\n", "import { FontStyle } from '@react-pdf/font';\nimport { Document, Font } from '@react-pdf/renderer';\nimport { PDF_COMPONENTS } from '~/utils/pdf-components';\nimport { parseJson, renderPdfComponent } from '~/utils/helpers';\nimport {\n  PdfGeneratorProps,\n  FontConfig,\n  ComponentData,\n  TemplateData,\n} from '~/types';\n\nexport const PdfGenerator: React.FC<PdfGeneratorProps> = ({\n  data,\n  template,\n}) => {\n  const templateObject = parseJson(template) as TemplateData;\n  const dataObject = parseJson(data) as TemplateData;\n\n  const fonts = (templateObject?.fonts as FontConfig[]) || [];\n  fonts.forEach((font: FontConfig) => {\n    Font.register(font);\n  });\n\n  const componentData = (templateObject?.components as ComponentData[]) || [];\n  const images = templateObject?.images || {};\n\n  const renderedComponents = renderPdfComponent({\n    componentData,\n    components: PDF_COMPONENTS,\n    data: dataObject || {},\n    allProps: {},\n    images,\n  });\n\n  return <Document>{renderedComponents}</Document>;\n};\n", "/**\n * Applies a function to the value at the given index of an array\n *\n * @param index\n * @param fn\n * @param collection\n * @returns Copy of the array with the element at the given index replaced with the result of the function application.\n */\nconst adjust = (index, fn, collection) => {\n    if (index >= 0 && index >= collection.length)\n        return collection;\n    if (index < 0 && Math.abs(index) > collection.length)\n        return collection;\n    const i = index < 0 ? collection.length + index : index;\n    return Object.assign([], collection, { [i]: fn(collection[i]) });\n};\n\n/* eslint-disable no-await-in-loop */\n/**\n * Performs right-to-left function composition with async functions support\n *\n * @param fns - Functions\n * @returns Composed function\n */\nconst asyncCompose = (...fns) => async (value, ...args) => {\n    let result = value;\n    const reversedFns = fns.slice().reverse();\n    for (let i = 0; i < reversedFns.length; i += 1) {\n        const fn = reversedFns[i];\n        result = await fn(result, ...args);\n    }\n    return result;\n};\n\n/**\n * Capitalize first letter of each word\n *\n * @param value - Any string\n * @returns Capitalized string\n */\nconst capitalize = (value) => {\n    if (!value)\n        return value;\n    return value.replace(/(^|\\s)\\S/g, (l) => l.toUpperCase());\n};\n\n/**\n * Casts value to array\n *\n * @template T - The type of the value.\n * @param value - The value to cast into an array.\n * @returns An array containing the given value.\n */\nconst castArray = (value) => {\n    return Array.isArray(value) ? value : [value];\n};\n\n/**\n * Performs right-to-left function composition\n *\n * @param fns - Functions\n * @returns Composed function\n */\nconst compose = (...fns) => (value, ...args) => {\n    let result = value;\n    const reversedFns = fns.slice().reverse();\n    for (let i = 0; i < reversedFns.length; i += 1) {\n        const fn = reversedFns[i];\n        result = fn(result, ...args);\n    }\n    return result;\n};\n\n/**\n * Drops the last element from an array.\n *\n * @template T\n * @param  array - The array to drop the last element from\n * @returns - The new array with the last element dropped\n */\nconst dropLast = (array) => array.slice(0, array.length - 1);\n\n/**\n * Applies a set of transformations to an object and returns a new object with the transformed values.\n *\n * @template T\n * @param transformations - The transformations to apply.\n * @param object - The object to transform.\n * @returns The transformed object.\n */\nfunction evolve(transformations, object) {\n    const result = {};\n    const keys = Object.keys(object);\n    for (let i = 0; i < keys.length; i += 1) {\n        const key = keys[i];\n        const transformation = transformations[key];\n        if (typeof transformation === 'function') {\n            result[key] = transformation(object[key]);\n        }\n        else {\n            result[key] = object[key];\n        }\n    }\n    return result;\n}\n\n/**\n * Checks if a value is null or undefined.\n *\n * @template T - The type of the value.\n * @param value - The value to check\n * @returns True if the value is null or undefined, false otherwise\n */\nconst isNil = (value) => value === null || value === undefined;\n\n/**\n * Retrieves the value at a given path from an object.\n *\n * @param target - The object to retrieve the value from.\n * @param path - The path of the value to retrieve.\n * @param defaultValue - The default value to return if the path does not exist.\n * @returns The value at the given path, or the default value if the path does not exist.\n */\nconst get = (target, path, defaultValue) => {\n    if (isNil(target))\n        return defaultValue;\n    const _path = castArray(path);\n    let result = target;\n    for (let i = 0; i < _path.length; i += 1) {\n        if (isNil(result))\n            return undefined;\n        result = result[_path[i]];\n    }\n    return isNil(result) ? defaultValue : result;\n};\n\nfunction last(value) {\n    return value === '' ? '' : value[value.length - 1];\n}\n\n/**\n * Maps over the values of an object and applies a function to each value.\n *\n * @param object - The object to map over\n * @param fn - The function to apply to each value\n * @returns A new object with the mapped values\n */\nconst mapValues = (object, fn) => {\n    const entries = Object.entries(object);\n    const acc = {};\n    return entries.reduce((acc, [key, value], index) => {\n        acc[key] = fn(value, key, index);\n        return acc;\n    }, acc);\n};\n\nconst isPercent = (value) => /((-)?\\d+\\.?\\d*)%/g.exec(`${value}`);\n/**\n * Get percentage value of input\n *\n * @param value\n * @returns Percent value (if matches)\n */\nconst matchPercent = (value) => {\n    const match = isPercent(value);\n    if (match) {\n        const f = parseFloat(match[1]);\n        const percent = f / 100;\n        return { percent, value: f };\n    }\n    return null;\n};\n\n/**\n * Creates a new object by omitting specified keys from the original object.\n *\n * @param keys - The key or keys to omit\n * @param object - The original object\n * @returns The new object without the omitted keys\n */\nconst omit = (keys, object) => {\n    const _keys = castArray(keys);\n    const copy = Object.assign({}, object);\n    _keys.forEach((key) => {\n        delete copy[key];\n    });\n    return copy;\n};\n\n/**\n * Picks the specified keys from an object and returns a new object with only those keys.\n *\n * @param keys - The keys to pick from the object\n * @param object - The object to pick the keys from\n * @returns A new object with only the picked keys\n */\nconst pick = (keys, obj) => {\n    const result = {};\n    for (let i = 0; i < keys.length; i += 1) {\n        const key = keys[i];\n        if (key in obj)\n            result[key] = obj[key];\n    }\n    return result;\n};\n\n/**\n * Repeats an element a specified number of times.\n *\n * @template T\n * @param element - Element to be repeated\n * @param length - Number of times to repeat element\n * @returns Repeated elements\n */\nconst repeat = (element, length = 0) => {\n    const result = new Array(length);\n    for (let i = 0; i < length; i += 1) {\n        result[i] = element;\n    }\n    return result;\n};\n\n/**\n * Reverses the list\n *\n * @template T\n * @param list - List to be reversed\n * @returns Reversed list\n */\nconst reverse = (list) => Array.prototype.slice.call(list, 0).reverse();\n\n/**\n * Capitalize first letter of string\n *\n * @param value - String\n * @returns Capitalized string\n */\nconst upperFirst = (value) => {\n    if (!value)\n        return value;\n    return value.charAt(0).toUpperCase() + value.slice(1);\n};\n\n/**\n * Returns a new array with all the values from the original array that are not present in the keys array.\n *\n * @param keys - The keys to pick from the object\n * @param array - Array to filter the values from\n * @returns A new array with without the omitted values\n */\nconst without = (keys, array) => {\n    const result = [];\n    for (let i = 0; i < array.length; i += 1) {\n        const value = array[i];\n        if (!keys.includes(value))\n            result.push(value);\n    }\n    return result;\n};\n\n/**\n * Parse a string or number to a float\n *\n * @param value - String or number\n * @returns Parsed float\n */\nconst parseFloat$1 = (value) => {\n    return typeof value === 'string' ? Number.parseFloat(value) : value;\n};\n\nexport { adjust, asyncCompose, capitalize, castArray, compose, dropLast, evolve, get, isNil, last, mapValues, matchPercent, omit, parseFloat$1 as parseFloat, pick, repeat, reverse, upperFirst, without };\n", "import { compose, castArray, parseFloat as parseFloat$1, matchPercent } from '@react-pdf/fns';\nimport matchMedia from 'media-engine';\nimport hlsToHex from 'hsl-to-hex';\nimport colorString from 'color-string';\nimport parse$1 from 'postcss-value-parser/lib/parse.js';\nimport parseUnit from 'postcss-value-parser/lib/unit.js';\n\n/**\n * Remove nil values from array\n *\n * @param array - Style array\n * @returns Style array without nils\n */\nconst compact = (array) => array.filter(Boolean);\n/**\n * Merges style objects array\n *\n * @param styles - Style array\n * @returns Merged style object\n */\nconst mergeStyles = (styles) => styles.reduce((acc, style) => {\n    const s = Array.isArray(style) ? flatten(style) : style;\n    Object.keys(s).forEach((key) => {\n        if (s[key] !== null && s[key] !== undefined) {\n            acc[key] = s[key];\n        }\n    });\n    return acc;\n}, {});\n/**\n * Flattens an array of style objects, into one aggregated style object.\n *\n * @param styles - Style or style array\n * @returns Flattened style object\n */\nconst flatten = compose(mergeStyles, compact, (castArray));\n\n/**\n * Resolves media queries in styles object\n *\n * @param container - Container for which styles are resolved\n * @param style - Style description\n * @returns Resolved style object\n */\nconst resolveMediaQueries = (container, style) => {\n    return Object.keys(style).reduce((acc, key) => {\n        if (/@media/.test(key)) {\n            return {\n                ...acc,\n                ...matchMedia({ [key]: style[key] }, container),\n            };\n        }\n        return { ...acc, [key]: style[key] };\n    }, {});\n};\n\nconst isRgb = (value) => /rgba?/g.test(value);\nconst isHsl = (value) => /hsla?/g.test(value);\n/**\n * Transform rgb color to hexa\n *\n * @param value - Styles value\n * @returns Transformed value\n */\nconst parseRgb = (value) => {\n    const rgb = colorString.get.rgb(value);\n    return colorString.to.hex(rgb);\n};\n/**\n * Transform Hsl color to hexa\n *\n * @param value - Styles value\n * @returns Transformed value\n */\nconst parseHsl = (value) => {\n    const hsl = colorString.get.hsl(value).map(Math.round);\n    const hex = hlsToHex(...hsl);\n    return hex.toUpperCase();\n};\n/**\n * Transform given color to hexa\n *\n * @param value - Styles value\n * @returns Transformed value\n */\nconst transformColor = (value) => {\n    if (isRgb(value))\n        return parseRgb(value);\n    if (isHsl(value))\n        return parseHsl(value);\n    return value;\n};\n\n/**\n * Parses scalar value in value and unit pairs\n *\n * @param value - Scalar value\n * @returns Parsed value\n */\nconst parseValue = (value) => {\n    if (typeof value === 'number')\n        return { value, unit: undefined };\n    const match = /^(-?\\d*\\.?\\d+)(in|mm|cm|pt|vh|vw|px|rem)?$/g.exec(value);\n    return match\n        ? { value: parseFloat(match[1]), unit: match[2] || 'pt' }\n        : { value, unit: undefined };\n};\n/**\n * Transform given scalar value\n *\n * @param container\n * @param value - Styles value\n * @returns Transformed value\n */\nconst transformUnit = (container, value) => {\n    const scalar = parseValue(value);\n    const outputDpi = 72;\n    const inputDpi = container.dpi || 72;\n    const mmFactor = (1 / 25.4) * outputDpi;\n    const cmFactor = (1 / 2.54) * outputDpi;\n    if (typeof scalar.value !== 'number')\n        return scalar.value;\n    switch (scalar.unit) {\n        case 'rem':\n            return scalar.value * (container.remBase || 18);\n        case 'in':\n            return scalar.value * outputDpi;\n        case 'mm':\n            return scalar.value * mmFactor;\n        case 'cm':\n            return scalar.value * cmFactor;\n        case 'vh':\n            return scalar.value * (container.height / 100);\n        case 'vw':\n            return scalar.value * (container.width / 100);\n        case 'px':\n            return Math.round(scalar.value * (outputDpi / inputDpi));\n        default:\n            return scalar.value;\n    }\n};\n\nconst processNumberValue = (key, value) => ({\n    [key]: parseFloat$1(value),\n});\nconst processUnitValue = (key, value, container) => ({\n    [key]: transformUnit(container, value),\n});\nconst processColorValue = (key, value) => {\n    const result = { [key]: transformColor(value) };\n    return result;\n};\nconst processNoopValue = (key, value) => ({\n    [key]: value,\n});\n\nconst BORDER_SHORTHAND_REGEX = /(-?\\d+(\\.\\d+)?(in|mm|cm|pt|vw|vh|px|rem)?)\\s(\\S+)\\s(.+)/;\nconst matchBorderShorthand = (value) => value.match(BORDER_SHORTHAND_REGEX) || [];\nconst resolveBorderShorthand = (key, value, container) => {\n    const match = matchBorderShorthand(`${value}`);\n    if (match) {\n        const widthMatch = match[1] || value;\n        const styleMatch = match[4] || value;\n        const colorMatch = match[5] || value;\n        const style = styleMatch;\n        const color = colorMatch ? transformColor(colorMatch) : undefined;\n        const width = widthMatch ? transformUnit(container, widthMatch) : undefined;\n        if (key.match(/(Top|Right|Bottom|Left)$/)) {\n            return {\n                [`${key}Color`]: color,\n                [`${key}Style`]: style,\n                [`${key}Width`]: width,\n            };\n        }\n        if (key.match(/Color$/)) {\n            return {\n                borderTopColor: color,\n                borderRightColor: color,\n                borderBottomColor: color,\n                borderLeftColor: color,\n            };\n        }\n        if (key.match(/Style$/)) {\n            if (typeof style === 'number')\n                throw new Error(`Invalid border style: ${style}`);\n            return {\n                borderTopStyle: style,\n                borderRightStyle: style,\n                borderBottomStyle: style,\n                borderLeftStyle: style,\n            };\n        }\n        if (key.match(/Width$/)) {\n            if (typeof width !== 'number')\n                throw new Error(`Invalid border width: ${width}`);\n            return {\n                borderTopWidth: width,\n                borderRightWidth: width,\n                borderBottomWidth: width,\n                borderLeftWidth: width,\n            };\n        }\n        if (key.match(/Radius$/)) {\n            const radius = value ? transformUnit(container, value) : undefined;\n            if (typeof radius !== 'number')\n                throw new Error(`Invalid border radius: ${radius}`);\n            return {\n                borderTopLeftRadius: radius,\n                borderTopRightRadius: radius,\n                borderBottomRightRadius: radius,\n                borderBottomLeftRadius: radius,\n            };\n        }\n        if (typeof width !== 'number')\n            throw new Error(`Invalid border width: ${width}`);\n        if (typeof style === 'number')\n            throw new Error(`Invalid border style: ${style}`);\n        return {\n            borderTopColor: color,\n            borderTopStyle: style,\n            borderTopWidth: width,\n            borderRightColor: color,\n            borderRightStyle: style,\n            borderRightWidth: width,\n            borderBottomColor: color,\n            borderBottomStyle: style,\n            borderBottomWidth: width,\n            borderLeftColor: color,\n            borderLeftStyle: style,\n            borderLeftWidth: width,\n        };\n    }\n    return { [key]: value };\n};\nconst handlers$b = {\n    border: (resolveBorderShorthand),\n    borderBottom: (resolveBorderShorthand),\n    borderBottomColor: (processColorValue),\n    borderBottomLeftRadius: (processUnitValue),\n    borderBottomRightRadius: (processUnitValue),\n    borderBottomStyle: (processNoopValue),\n    borderBottomWidth: (processUnitValue),\n    borderColor: (resolveBorderShorthand),\n    borderLeft: (resolveBorderShorthand),\n    borderLeftColor: (processColorValue),\n    borderLeftStyle: (processNoopValue),\n    borderLeftWidth: (processUnitValue),\n    borderRadius: (resolveBorderShorthand),\n    borderRight: (resolveBorderShorthand),\n    borderRightColor: (processColorValue),\n    borderRightStyle: (processNoopValue),\n    borderRightWidth: (processUnitValue),\n    borderStyle: (resolveBorderShorthand),\n    borderTop: (resolveBorderShorthand),\n    borderTopColor: (processColorValue),\n    borderTopLeftRadius: (processUnitValue),\n    borderTopRightRadius: (processUnitValue),\n    borderTopStyle: (processNoopValue),\n    borderTopWidth: (processUnitValue),\n    borderWidth: (resolveBorderShorthand),\n};\n\nconst handlers$a = {\n    backgroundColor: (processColorValue),\n    color: (processColorValue),\n    opacity: (processNumberValue),\n};\n\nconst handlers$9 = {\n    height: (processUnitValue),\n    maxHeight: (processUnitValue),\n    maxWidth: (processUnitValue),\n    minHeight: (processUnitValue),\n    minWidth: (processUnitValue),\n    width: (processUnitValue),\n};\n\n// https://developer.mozilla.org/en-US/docs/Web/CSS/flex#values\n// TODO: change flex defaults to [0, 1, 'auto'] as in spec in next major release\nconst flexDefaults = [1, 1, 0];\nconst flexAuto = [1, 1, 'auto'];\nconst processFlexShorthand = (key, value, container) => {\n    let defaults = flexDefaults;\n    let matches = [];\n    if (value === 'auto') {\n        defaults = flexAuto;\n    }\n    else {\n        matches = `${value}`.split(' ');\n    }\n    const flexGrow = parseFloat$1(matches[0] || defaults[0]);\n    const flexShrink = parseFloat$1(matches[1] || defaults[1]);\n    const flexBasis = transformUnit(container, matches[2] || defaults[2]);\n    return { flexGrow, flexShrink, flexBasis };\n};\nconst handlers$8 = {\n    alignContent: (processNoopValue),\n    alignItems: (processNoopValue),\n    alignSelf: (processNoopValue),\n    flex: (processFlexShorthand),\n    flexBasis: (processUnitValue),\n    flexDirection: (processNoopValue),\n    flexFlow: (processNoopValue),\n    flexGrow: (processNumberValue),\n    flexShrink: (processNumberValue),\n    flexWrap: (processNoopValue),\n    justifyContent: (processNoopValue),\n    justifySelf: (processNoopValue),\n};\n\nconst processGapShorthand = (key, value, container) => {\n    const match = `${value}`.split(' ');\n    const rowGap = transformUnit(container, match?.[0] || value);\n    const columnGap = transformUnit(container, match?.[1] || value);\n    return { rowGap, columnGap };\n};\nconst handlers$7 = {\n    gap: (processGapShorthand),\n    columnGap: (processUnitValue),\n    rowGap: (processUnitValue),\n};\n\nconst handlers$6 = {\n    aspectRatio: (processNumberValue),\n    bottom: (processUnitValue),\n    display: (processNoopValue),\n    left: (processUnitValue),\n    position: (processNoopValue),\n    right: (processUnitValue),\n    top: (processUnitValue),\n    overflow: (processNoopValue),\n    zIndex: (processNumberValue),\n};\n\nconst BOX_MODEL_UNITS = 'px,in,mm,cm,pt,%,vw,vh';\nconst logError = (style, value) => {\n    const name = style.toString();\n    // eslint-disable-next-line no-console\n    console.error(`\n    @react-pdf/stylesheet parsing error:\n    ${name}: ${value},\n    ${' '.repeat(name.length + 2)}^\n    Unsupported ${name} value format\n  `);\n};\n/**\n * @param options\n * @param [options.expandsTo]\n * @param [options.maxValues]\n * @param [options.autoSupported]\n */\nconst expandBoxModel = ({ expandsTo, maxValues = 1, autoSupported = false, } = {}) => (model, value, container) => {\n    const nodes = parse$1(`${value}`);\n    const parts = [];\n    for (let i = 0; i < nodes.length; i++) {\n        const node = nodes[i];\n        // value contains `calc`, `url` or other css function\n        // `,`, `/` or strings that unsupported by margin and padding\n        if (node.type === 'function' ||\n            node.type === 'string' ||\n            node.type === 'div') {\n            logError(model, value);\n            return {};\n        }\n        if (node.type === 'word') {\n            if (node.value === 'auto' && autoSupported) {\n                parts.push(node.value);\n            }\n            else {\n                const result = parseUnit(node.value);\n                // when unit isn't specified this condition is true\n                if (result && BOX_MODEL_UNITS.includes(result.unit)) {\n                    parts.push(node.value);\n                }\n                else {\n                    logError(model, value);\n                    return {};\n                }\n            }\n        }\n    }\n    // checks that we have enough parsed values\n    if (parts.length > maxValues) {\n        logError(model, value);\n        return {};\n    }\n    const first = transformUnit(container, parts[0]);\n    if (expandsTo) {\n        const second = transformUnit(container, parts[1] || parts[0]);\n        const third = transformUnit(container, parts[2] || parts[0]);\n        const fourth = transformUnit(container, parts[3] || parts[1] || parts[0]);\n        return expandsTo({ first, second, third, fourth });\n    }\n    return {\n        [model]: first,\n    };\n};\n\nconst processMargin = expandBoxModel({\n    expandsTo: ({ first, second, third, fourth }) => ({\n        marginTop: first,\n        marginRight: second,\n        marginBottom: third,\n        marginLeft: fourth,\n    }),\n    maxValues: 4,\n    autoSupported: true,\n});\nconst processMarginVertical = expandBoxModel({\n    expandsTo: ({ first, second }) => ({\n        marginTop: first,\n        marginBottom: second,\n    }),\n    maxValues: 2,\n    autoSupported: true,\n});\nconst processMarginHorizontal = expandBoxModel({\n    expandsTo: ({ first, second }) => ({\n        marginRight: first,\n        marginLeft: second,\n    }),\n    maxValues: 2,\n    autoSupported: true,\n});\nconst processMarginSingle = expandBoxModel({\n    autoSupported: true,\n});\nconst handlers$5 = {\n    margin: (processMargin),\n    marginBottom: (processMarginSingle),\n    marginHorizontal: (processMarginHorizontal),\n    marginLeft: (processMarginSingle),\n    marginRight: (processMarginSingle),\n    marginTop: (processMarginSingle),\n    marginVertical: (processMarginVertical),\n};\n\nconst processPadding = expandBoxModel({\n    expandsTo: ({ first, second, third, fourth }) => ({\n        paddingTop: first,\n        paddingRight: second,\n        paddingBottom: third,\n        paddingLeft: fourth,\n    }),\n    maxValues: 4,\n});\nconst processPaddingVertical = expandBoxModel({\n    expandsTo: ({ first, second }) => ({\n        paddingTop: first,\n        paddingBottom: second,\n    }),\n    maxValues: 2,\n});\nconst processPaddingHorizontal = expandBoxModel({\n    expandsTo: ({ first, second }) => ({\n        paddingRight: first,\n        paddingLeft: second,\n    }),\n    maxValues: 2,\n});\nconst processPaddingSingle = expandBoxModel();\nconst handlers$4 = {\n    padding: (processPadding),\n    paddingBottom: (processPaddingSingle),\n    paddingHorizontal: (processPaddingHorizontal),\n    paddingLeft: (processPaddingSingle),\n    paddingRight: (processPaddingSingle),\n    paddingTop: (processPaddingSingle),\n    paddingVertical: (processPaddingVertical),\n};\n\nconst offsetKeyword = (value) => {\n    switch (value) {\n        case 'top':\n        case 'left':\n            return '0%';\n        case 'right':\n        case 'bottom':\n            return '100%';\n        case 'center':\n            return '50%';\n        default:\n            return value;\n    }\n};\n\nconst processObjectPosition = (key, value, container) => {\n    const match = `${value}`.split(' ');\n    const objectPositionX = offsetKeyword(transformUnit(container, match?.[0] || value));\n    const objectPositionY = offsetKeyword(transformUnit(container, match?.[1] || value));\n    return { objectPositionX, objectPositionY };\n};\nconst processObjectPositionValue = (key, value, container) => ({\n    [key]: offsetKeyword(transformUnit(container, value)),\n});\nconst handlers$3 = {\n    objectPosition: (processObjectPosition),\n    objectPositionX: (processObjectPositionValue),\n    objectPositionY: (processObjectPositionValue),\n    objectFit: (processNoopValue),\n};\n\nconst castInt = (value) => {\n    if (typeof value === 'number')\n        return value;\n    return parseInt(value, 10);\n};\n\nconst FONT_WEIGHTS = {\n    thin: 100,\n    hairline: 100,\n    ultralight: 200,\n    extralight: 200,\n    light: 300,\n    normal: 400,\n    medium: 500,\n    semibold: 600,\n    demibold: 600,\n    bold: 700,\n    ultrabold: 800,\n    extrabold: 800,\n    heavy: 900,\n    black: 900,\n};\nconst transformFontWeight = (value) => {\n    if (!value)\n        return FONT_WEIGHTS.normal;\n    if (typeof value === 'number')\n        return value;\n    const lv = value.toLowerCase();\n    if (FONT_WEIGHTS[lv])\n        return FONT_WEIGHTS[lv];\n    return castInt(value);\n};\nconst processFontWeight = (key, value) => {\n    return { [key]: transformFontWeight(value) };\n};\nconst transformLineHeight = (value, styles, container) => {\n    if (value === '')\n        return value;\n    const fontSize = transformUnit(container, styles.fontSize || 18);\n    const lineHeight = transformUnit(container, value);\n    // Percent values: use this number multiplied by the element's font size\n    const { percent } = matchPercent(lineHeight) || {};\n    if (percent)\n        return percent * fontSize;\n    // Unitless values: use this number multiplied by the element's font size\n    return isNaN(value) ? lineHeight : lineHeight * fontSize;\n};\nconst processLineHeight = (key, value, container, styles) => {\n    return {\n        [key]: transformLineHeight(value, styles, container),\n    };\n};\nconst handlers$2 = {\n    direction: (processNoopValue),\n    fontFamily: (processNoopValue),\n    fontSize: (processUnitValue),\n    fontStyle: (processNoopValue),\n    fontWeight: (processFontWeight),\n    letterSpacing: (processUnitValue),\n    lineHeight: (processLineHeight),\n    maxLines: (processNumberValue),\n    textAlign: (processNoopValue),\n    textDecoration: (processNoopValue),\n    textDecorationColor: (processColorValue),\n    textDecorationStyle: (processNoopValue),\n    textIndent: (processNoopValue),\n    textOverflow: (processNoopValue),\n    textTransform: (processNoopValue),\n    verticalAlign: (processNoopValue),\n};\n\nconst matchNumber = (value) => typeof value === 'string' && /^-?\\d*\\.?\\d*$/.test(value);\nconst castFloat = (value) => {\n    if (typeof value !== 'string')\n        return value;\n    if (matchNumber(value))\n        return parseFloat(value);\n    return value;\n};\n\nconst parse = (transformString) => {\n    const transforms = transformString.trim().split(/\\)[ ,]|\\)/);\n    // Handle \"initial\", \"inherit\", \"unset\".\n    if (transforms.length === 1) {\n        return [[transforms[0], true]];\n    }\n    const parsed = [];\n    for (let i = 0; i < transforms.length; i += 1) {\n        const transform = transforms[i];\n        if (transform) {\n            const [name, rawValue] = transform.split('(');\n            const splitChar = rawValue.indexOf(',') >= 0 ? ',' : ' ';\n            const value = rawValue.split(splitChar).map((val) => val.trim());\n            parsed.push({ operation: name.trim(), value });\n        }\n    }\n    return parsed;\n};\nconst parseAngle = (value) => {\n    const unitsRegexp = /(-?\\d*\\.?\\d*)(\\w*)?/i;\n    const [, angle, unit] = unitsRegexp.exec(value);\n    const number = Number.parseFloat(angle);\n    return unit === 'rad' ? (number * 180) / Math.PI : number;\n};\nconst normalizeTransformOperation = ({ operation, value }) => {\n    switch (operation) {\n        case 'scale': {\n            const [scaleX, scaleY = scaleX] = value.map((num) => Number.parseFloat(num));\n            return { operation: 'scale', value: [scaleX, scaleY] };\n        }\n        case 'scaleX': {\n            return { operation: 'scale', value: [Number.parseFloat(value), 1] };\n        }\n        case 'scaleY': {\n            return { operation: 'scale', value: [1, Number.parseFloat(value)] };\n        }\n        case 'rotate': {\n            return { operation: 'rotate', value: [parseAngle(value)] };\n        }\n        case 'translate': {\n            return {\n                operation: 'translate',\n                value: value.map((num) => Number.parseFloat(num)),\n            };\n        }\n        case 'translateX': {\n            return {\n                operation: 'translate',\n                value: [Number.parseFloat(value), 0],\n            };\n        }\n        case 'translateY': {\n            return { operation: 'translate', value: [0, Number.parseFloat(value)] };\n        }\n        case 'skew': {\n            return { operation: 'skew', value: value.map(parseAngle) };\n        }\n        case 'skewX': {\n            return { operation: 'skew', value: [parseAngle(value), 0] };\n        }\n        case 'skewY': {\n            return { operation: 'skew', value: [0, parseAngle(value)] };\n        }\n        default: {\n            return { operation, value: value.map((num) => Number.parseFloat(num)) };\n        }\n    }\n};\nconst normalize = (operations) => {\n    return operations.map((operation) => normalizeTransformOperation(operation));\n};\nconst processTransform = (key, value) => {\n    if (typeof value !== 'string')\n        return { [key]: value };\n    return { [key]: normalize(parse(value)) };\n};\nconst Y_AXIS_SHORTHANDS = { top: true, bottom: true };\nconst sortTransformOriginPair = (a, b) => {\n    if (Y_AXIS_SHORTHANDS[a])\n        return 1;\n    if (Y_AXIS_SHORTHANDS[b])\n        return -1;\n    return 0;\n};\nconst getTransformOriginPair = (values) => {\n    if (!values || values.length === 0)\n        return ['center', 'center'];\n    const pair = values.length === 1 ? [values[0], 'center'] : values;\n    return pair.sort(sortTransformOriginPair);\n};\n// Transforms shorthand transformOrigin values\nconst processTransformOriginShorthand = (key, value, container) => {\n    const match = `${value}`.split(' ');\n    const pair = getTransformOriginPair(match);\n    const transformOriginX = transformUnit(container, pair[0]);\n    const transformOriginY = transformUnit(container, pair[1]);\n    return {\n        transformOriginX: offsetKeyword(transformOriginX) || castFloat(transformOriginX),\n        transformOriginY: offsetKeyword(transformOriginY) || castFloat(transformOriginY),\n    };\n};\nconst processTransformOriginValue = (key, value, container) => {\n    const v = transformUnit(container, value);\n    return { [key]: offsetKeyword(v) || castFloat(v) };\n};\nconst handlers$1 = {\n    transform: processTransform,\n    gradientTransform: processTransform,\n    transformOrigin: (processTransformOriginShorthand),\n    transformOriginX: (processTransformOriginValue),\n    transformOriginY: (processTransformOriginValue),\n};\n\nconst handlers = {\n    fill: (processColorValue),\n    stroke: (processColorValue),\n    strokeDasharray: (processNoopValue),\n    strokeWidth: (processUnitValue),\n    fillOpacity: (processNumberValue),\n    strokeOpacity: (processNumberValue),\n    fillRule: (processNoopValue),\n    textAnchor: (processNoopValue),\n    strokeLinecap: (processNoopValue),\n    strokeLinejoin: (processNoopValue),\n    visibility: (processNoopValue),\n    clipPath: (processNoopValue),\n    dominantBaseline: (processNoopValue),\n};\n\nconst shorthands = {\n    ...handlers$b,\n    ...handlers$a,\n    ...handlers$9,\n    ...handlers$8,\n    ...handlers$7,\n    ...handlers$6,\n    ...handlers$5,\n    ...handlers$4,\n    ...handlers$3,\n    ...handlers$2,\n    ...handlers$1,\n    ...handlers,\n};\n/**\n * Expand the shorthand properties.\n *\n * @param style - Style object\n * @returns Expanded style object\n */\nconst resolve = (container) => (style) => {\n    const propsArray = Object.keys(style);\n    const resolvedStyle = {};\n    for (let i = 0; i < propsArray.length; i += 1) {\n        const key = propsArray[i];\n        const value = style[key];\n        if (!shorthands[key]) {\n            resolvedStyle[key] = value;\n            continue;\n        }\n        const resolved = shorthands[key](key, value, container, style);\n        const keys = Object.keys(resolved);\n        for (let j = 0; j < keys.length; j += 1) {\n            const propName = keys[j];\n            const propValue = resolved[propName];\n            resolvedStyle[propName] = propValue;\n        }\n    }\n    return resolvedStyle;\n};\n\n/**\n * Resolves styles\n *\n * @param container\n * @param style - Style\n * @returns Resolved style\n */\nconst resolveStyles = (container, style) => {\n    const computeMediaQueries = (value) => resolveMediaQueries(container, value);\n    return compose(resolve(container), computeMediaQueries, flatten)(style);\n};\n\nexport { resolveStyles as default, flatten, transformColor };\n", "/******************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise, SuppressedError, Symbol, Iterator */\r\n\r\nvar extendStatics = function(d, b) {\r\n    extendStatics = Object.setPrototypeOf ||\r\n        ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n        function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; };\r\n    return extendStatics(d, b);\r\n};\r\n\r\nexport function __extends(d, b) {\r\n    if (typeof b !== \"function\" && b !== null)\r\n        throw new TypeError(\"Class extends value \" + String(b) + \" is not a constructor or null\");\r\n    extendStatics(d, b);\r\n    function __() { this.constructor = d; }\r\n    d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nexport var __assign = function() {\r\n    __assign = Object.assign || function __assign(t) {\r\n        for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n            s = arguments[i];\r\n            for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n        }\r\n        return t;\r\n    }\r\n    return __assign.apply(this, arguments);\r\n}\r\n\r\nexport function __rest(s, e) {\r\n    var t = {};\r\n    for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n        t[p] = s[p];\r\n    if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n        for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n            if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n                t[p[i]] = s[p[i]];\r\n        }\r\n    return t;\r\n}\r\n\r\nexport function __decorate(decorators, target, key, desc) {\r\n    var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n    if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n    else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n    return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nexport function __param(paramIndex, decorator) {\r\n    return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nexport function __esDecorate(ctor, descriptorIn, decorators, contextIn, initializers, extraInitializers) {\r\n    function accept(f) { if (f !== void 0 && typeof f !== \"function\") throw new TypeError(\"Function expected\"); return f; }\r\n    var kind = contextIn.kind, key = kind === \"getter\" ? \"get\" : kind === \"setter\" ? \"set\" : \"value\";\r\n    var target = !descriptorIn && ctor ? contextIn[\"static\"] ? ctor : ctor.prototype : null;\r\n    var descriptor = descriptorIn || (target ? Object.getOwnPropertyDescriptor(target, contextIn.name) : {});\r\n    var _, done = false;\r\n    for (var i = decorators.length - 1; i >= 0; i--) {\r\n        var context = {};\r\n        for (var p in contextIn) context[p] = p === \"access\" ? {} : contextIn[p];\r\n        for (var p in contextIn.access) context.access[p] = contextIn.access[p];\r\n        context.addInitializer = function (f) { if (done) throw new TypeError(\"Cannot add initializers after decoration has completed\"); extraInitializers.push(accept(f || null)); };\r\n        var result = (0, decorators[i])(kind === \"accessor\" ? { get: descriptor.get, set: descriptor.set } : descriptor[key], context);\r\n        if (kind === \"accessor\") {\r\n            if (result === void 0) continue;\r\n            if (result === null || typeof result !== \"object\") throw new TypeError(\"Object expected\");\r\n            if (_ = accept(result.get)) descriptor.get = _;\r\n            if (_ = accept(result.set)) descriptor.set = _;\r\n            if (_ = accept(result.init)) initializers.unshift(_);\r\n        }\r\n        else if (_ = accept(result)) {\r\n            if (kind === \"field\") initializers.unshift(_);\r\n            else descriptor[key] = _;\r\n        }\r\n    }\r\n    if (target) Object.defineProperty(target, contextIn.name, descriptor);\r\n    done = true;\r\n};\r\n\r\nexport function __runInitializers(thisArg, initializers, value) {\r\n    var useValue = arguments.length > 2;\r\n    for (var i = 0; i < initializers.length; i++) {\r\n        value = useValue ? initializers[i].call(thisArg, value) : initializers[i].call(thisArg);\r\n    }\r\n    return useValue ? value : void 0;\r\n};\r\n\r\nexport function __propKey(x) {\r\n    return typeof x === \"symbol\" ? x : \"\".concat(x);\r\n};\r\n\r\nexport function __setFunctionName(f, name, prefix) {\r\n    if (typeof name === \"symbol\") name = name.description ? \"[\".concat(name.description, \"]\") : \"\";\r\n    return Object.defineProperty(f, \"name\", { configurable: true, value: prefix ? \"\".concat(prefix, \" \", name) : name });\r\n};\r\n\r\nexport function __metadata(metadataKey, metadataValue) {\r\n    if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nexport function __awaiter(thisArg, _arguments, P, generator) {\r\n    function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n    return new (P || (P = Promise))(function (resolve, reject) {\r\n        function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n        function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n        function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n        step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n    });\r\n}\r\n\r\nexport function __generator(thisArg, body) {\r\n    var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g = Object.create((typeof Iterator === \"function\" ? Iterator : Object).prototype);\r\n    return g.next = verb(0), g[\"throw\"] = verb(1), g[\"return\"] = verb(2), typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n    function verb(n) { return function (v) { return step([n, v]); }; }\r\n    function step(op) {\r\n        if (f) throw new TypeError(\"Generator is already executing.\");\r\n        while (g && (g = 0, op[0] && (_ = 0)), _) try {\r\n            if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n            if (y = 0, t) op = [op[0] & 2, t.value];\r\n            switch (op[0]) {\r\n                case 0: case 1: t = op; break;\r\n                case 4: _.label++; return { value: op[1], done: false };\r\n                case 5: _.label++; y = op[1]; op = [0]; continue;\r\n                case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n                default:\r\n                    if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n                    if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n                    if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n                    if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n                    if (t[2]) _.ops.pop();\r\n                    _.trys.pop(); continue;\r\n            }\r\n            op = body.call(thisArg, _);\r\n        } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n        if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n    }\r\n}\r\n\r\nexport var __createBinding = Object.create ? (function(o, m, k, k2) {\r\n    if (k2 === undefined) k2 = k;\r\n    var desc = Object.getOwnPropertyDescriptor(m, k);\r\n    if (!desc || (\"get\" in desc ? !m.__esModule : desc.writable || desc.configurable)) {\r\n        desc = { enumerable: true, get: function() { return m[k]; } };\r\n    }\r\n    Object.defineProperty(o, k2, desc);\r\n}) : (function(o, m, k, k2) {\r\n    if (k2 === undefined) k2 = k;\r\n    o[k2] = m[k];\r\n});\r\n\r\nexport function __exportStar(m, o) {\r\n    for (var p in m) if (p !== \"default\" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p);\r\n}\r\n\r\nexport function __values(o) {\r\n    var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n    if (m) return m.call(o);\r\n    if (o && typeof o.length === \"number\") return {\r\n        next: function () {\r\n            if (o && i >= o.length) o = void 0;\r\n            return { value: o && o[i++], done: !o };\r\n        }\r\n    };\r\n    throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nexport function __read(o, n) {\r\n    var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n    if (!m) return o;\r\n    var i = m.call(o), r, ar = [], e;\r\n    try {\r\n        while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n    }\r\n    catch (error) { e = { error: error }; }\r\n    finally {\r\n        try {\r\n            if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n        }\r\n        finally { if (e) throw e.error; }\r\n    }\r\n    return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spread() {\r\n    for (var ar = [], i = 0; i < arguments.length; i++)\r\n        ar = ar.concat(__read(arguments[i]));\r\n    return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spreadArrays() {\r\n    for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n    for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n        for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n            r[k] = a[j];\r\n    return r;\r\n}\r\n\r\nexport function __spreadArray(to, from, pack) {\r\n    if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) {\r\n        if (ar || !(i in from)) {\r\n            if (!ar) ar = Array.prototype.slice.call(from, 0, i);\r\n            ar[i] = from[i];\r\n        }\r\n    }\r\n    return to.concat(ar || Array.prototype.slice.call(from));\r\n}\r\n\r\nexport function __await(v) {\r\n    return this instanceof __await ? (this.v = v, this) : new __await(v);\r\n}\r\n\r\nexport function __asyncGenerator(thisArg, _arguments, generator) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n    return i = Object.create((typeof AsyncIterator === \"function\" ? AsyncIterator : Object).prototype), verb(\"next\"), verb(\"throw\"), verb(\"return\", awaitReturn), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n    function awaitReturn(f) { return function (v) { return Promise.resolve(v).then(f, reject); }; }\r\n    function verb(n, f) { if (g[n]) { i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; if (f) i[n] = f(i[n]); } }\r\n    function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n    function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n    function fulfill(value) { resume(\"next\", value); }\r\n    function reject(value) { resume(\"throw\", value); }\r\n    function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nexport function __asyncDelegator(o) {\r\n    var i, p;\r\n    return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n    function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: false } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nexport function __asyncValues(o) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var m = o[Symbol.asyncIterator], i;\r\n    return m ? m.call(o) : (o = typeof __values === \"function\" ? __values(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n    function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n    function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nexport function __makeTemplateObject(cooked, raw) {\r\n    if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n    return cooked;\r\n};\r\n\r\nvar __setModuleDefault = Object.create ? (function(o, v) {\r\n    Object.defineProperty(o, \"default\", { enumerable: true, value: v });\r\n}) : function(o, v) {\r\n    o[\"default\"] = v;\r\n};\r\n\r\nvar ownKeys = function(o) {\r\n    ownKeys = Object.getOwnPropertyNames || function (o) {\r\n        var ar = [];\r\n        for (var k in o) if (Object.prototype.hasOwnProperty.call(o, k)) ar[ar.length] = k;\r\n        return ar;\r\n    };\r\n    return ownKeys(o);\r\n};\r\n\r\nexport function __importStar(mod) {\r\n    if (mod && mod.__esModule) return mod;\r\n    var result = {};\r\n    if (mod != null) for (var k = ownKeys(mod), i = 0; i < k.length; i++) if (k[i] !== \"default\") __createBinding(result, mod, k[i]);\r\n    __setModuleDefault(result, mod);\r\n    return result;\r\n}\r\n\r\nexport function __importDefault(mod) {\r\n    return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nexport function __classPrivateFieldGet(receiver, state, kind, f) {\r\n    if (kind === \"a\" && !f) throw new TypeError(\"Private accessor was defined without a getter\");\r\n    if (typeof state === \"function\" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError(\"Cannot read private member from an object whose class did not declare it\");\r\n    return kind === \"m\" ? f : kind === \"a\" ? f.call(receiver) : f ? f.value : state.get(receiver);\r\n}\r\n\r\nexport function __classPrivateFieldSet(receiver, state, value, kind, f) {\r\n    if (kind === \"m\") throw new TypeError(\"Private method is not writable\");\r\n    if (kind === \"a\" && !f) throw new TypeError(\"Private accessor was defined without a setter\");\r\n    if (typeof state === \"function\" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError(\"Cannot write private member to an object whose class did not declare it\");\r\n    return (kind === \"a\" ? f.call(receiver, value) : f ? f.value = value : state.set(receiver, value)), value;\r\n}\r\n\r\nexport function __classPrivateFieldIn(state, receiver) {\r\n    if (receiver === null || (typeof receiver !== \"object\" && typeof receiver !== \"function\")) throw new TypeError(\"Cannot use 'in' operator on non-object\");\r\n    return typeof state === \"function\" ? receiver === state : state.has(receiver);\r\n}\r\n\r\nexport function __addDisposableResource(env, value, async) {\r\n    if (value !== null && value !== void 0) {\r\n        if (typeof value !== \"object\" && typeof value !== \"function\") throw new TypeError(\"Object expected.\");\r\n        var dispose, inner;\r\n        if (async) {\r\n            if (!Symbol.asyncDispose) throw new TypeError(\"Symbol.asyncDispose is not defined.\");\r\n            dispose = value[Symbol.asyncDispose];\r\n        }\r\n        if (dispose === void 0) {\r\n            if (!Symbol.dispose) throw new TypeError(\"Symbol.dispose is not defined.\");\r\n            dispose = value[Symbol.dispose];\r\n            if (async) inner = dispose;\r\n        }\r\n        if (typeof dispose !== \"function\") throw new TypeError(\"Object not disposable.\");\r\n        if (inner) dispose = function() { try { inner.call(this); } catch (e) { return Promise.reject(e); } };\r\n        env.stack.push({ value: value, dispose: dispose, async: async });\r\n    }\r\n    else if (async) {\r\n        env.stack.push({ async: true });\r\n    }\r\n    return value;\r\n\r\n}\r\n\r\nvar _SuppressedError = typeof SuppressedError === \"function\" ? SuppressedError : function (error, suppressed, message) {\r\n    var e = new Error(message);\r\n    return e.name = \"SuppressedError\", e.error = error, e.suppressed = suppressed, e;\r\n};\r\n\r\nexport function __disposeResources(env) {\r\n    function fail(e) {\r\n        env.error = env.hasError ? new _SuppressedError(e, env.error, \"An error was suppressed during disposal.\") : e;\r\n        env.hasError = true;\r\n    }\r\n    var r, s = 0;\r\n    function next() {\r\n        while (r = env.stack.pop()) {\r\n            try {\r\n                if (!r.async && s === 1) return s = 0, env.stack.push(r), Promise.resolve().then(next);\r\n                if (r.dispose) {\r\n                    var result = r.dispose.call(r.value);\r\n                    if (r.async) return s |= 2, Promise.resolve(result).then(next, function(e) { fail(e); return next(); });\r\n                }\r\n                else s |= 1;\r\n            }\r\n            catch (e) {\r\n                fail(e);\r\n            }\r\n        }\r\n        if (s === 1) return env.hasError ? Promise.reject(env.error) : Promise.resolve();\r\n        if (env.hasError) throw env.error;\r\n    }\r\n    return next();\r\n}\r\n\r\nexport function __rewriteRelativeImportExtension(path, preserveJsx) {\r\n    if (typeof path === \"string\" && /^\\.\\.?\\//.test(path)) {\r\n        return path.replace(/\\.(tsx)$|((?:\\.d)?)((?:\\.[^./]+?)?)\\.([cm]?)ts$/i, function (m, tsx, d, ext, cm) {\r\n            return tsx ? preserveJsx ? \".jsx\" : \".js\" : d && (!ext || !cm) ? m : (d + ext + \".\" + cm.toLowerCase() + \"js\");\r\n        });\r\n    }\r\n    return path;\r\n}\r\n\r\nexport default {\r\n    __extends: __extends,\r\n    __assign: __assign,\r\n    __rest: __rest,\r\n    __decorate: __decorate,\r\n    __param: __param,\r\n    __esDecorate: __esDecorate,\r\n    __runInitializers: __runInitializers,\r\n    __propKey: __propKey,\r\n    __setFunctionName: __setFunctionName,\r\n    __metadata: __metadata,\r\n    __awaiter: __awaiter,\r\n    __generator: __generator,\r\n    __createBinding: __createBinding,\r\n    __exportStar: __exportStar,\r\n    __values: __values,\r\n    __read: __read,\r\n    __spread: __spread,\r\n    __spreadArrays: __spreadArrays,\r\n    __spreadArray: __spreadArray,\r\n    __await: __await,\r\n    __asyncGenerator: __asyncGenerator,\r\n    __asyncDelegator: __asyncDelegator,\r\n    __asyncValues: __asyncValues,\r\n    __makeTemplateObject: __makeTemplateObject,\r\n    __importStar: __importStar,\r\n    __importDefault: __importDefault,\r\n    __classPrivateFieldGet: __classPrivateFieldGet,\r\n    __classPrivateFieldSet: __classPrivateFieldSet,\r\n    __classPrivateFieldIn: __classPrivateFieldIn,\r\n    __addDisposableResource: __addDisposableResource,\r\n    __disposeResources: __disposeResources,\r\n    __rewriteRelativeImportExtension: __rewriteRelativeImportExtension,\r\n};\r\n", "import {View} from '@react-pdf/renderer';\nimport {flatten} from '@react-pdf/stylesheet';\nimport {Style} from '@react-pdf/types';\nimport React, {useMemo} from 'react';\n\nexport interface TableProps extends Omit<React.ComponentProps<typeof View>, 'children'> {\n    weightings?: number[],\n    tdStyle?: Style | Style[],\n    trStyle?: Style | Style[],\n    children: React.ReactElement | React.ReactElement[] | React.ReactFragment | React.ReactFragment[],\n}\n\nexport interface TableContextType {\n    weightings?: number[],\n    style: Omit<Style, 'borderWidth'> & {\n        borderWidth: number,\n    },\n    tdStyle?: TableProps['tdStyle'],\n    trStyle?: TableProps['trStyle'],\n}\n\nexport const tableContext = React.createContext<TableContextType>({\n    style: {\n        borderWidth: 1,\n    },\n});\n\nexport default function Table({\n    children,\n    weightings,\n    style: styleProps,\n    tdStyle,\n    trStyle,\n    ...rest\n}: TableProps) {\n    const tableStyle = useMemo(() => {\n        const style = flatten([\n            {\n                borderColor: '#000000',\n                borderWidth: '1px',\n                borderStyle: 'solid',\n            },\n            ...(Array.isArray(styleProps) ? styleProps : [styleProps]),\n        ]) as TableContextType['style'];\n\n        if (typeof style.border === 'string') {\n            const [borderWidth, borderStyle, borderColor] = style.border.split(/\\s+/);\n\n            style.borderWidth = Number.parseFloat(borderWidth);\n            style.borderStyle = borderStyle as Style['borderStyle'];\n            style.borderColor = borderColor;\n        }\n        else if (typeof style.border === 'number') {\n            style.borderWidth = style.border;\n        }\n        if (typeof style.borderWidth === 'string') {\n            style.borderWidth = Number.parseFloat(style.borderWidth);\n        }\n\n        return style;\n    }, [styleProps]);\n\n    const rows = useMemo(() => {\n        const output: React.ReactElement[] = [];\n\n        const flattenChildren = (elem: typeof children) => {\n            React.Children.forEach(elem, (child) => {\n                if (!React.isValidElement(child)) {\n                    return;\n                }\n\n                if (child.type === React.Fragment) {\n                    flattenChildren((child.props as {children?: React.ReactNode}).children);\n                }\n                else {\n                    output.push(child);\n                }\n            });\n        };\n        flattenChildren(children);\n\n        return (\n            output.map((tr, rowIndex) => (\n                React.cloneElement(tr, {\n                    key: `table_row_${rowIndex}`,\n                    _firstRow: rowIndex === 0,\n                    _lastRow: rowIndex === output.length - 1,\n                })\n            ))\n        );\n    }, [children]);\n\n    const style = useMemo(() => [\n        {\n            width: '100%',\n        },\n        ...(Array.isArray(styleProps) ? styleProps : [styleProps]),\n        tableStyle.borderStyle === 'solid' ? {\n            border: '0px',\n        } : undefined,\n    ].filter(Boolean), [styleProps]);\n\n    const tableContextValue = useMemo<TableContextType>(() => ({\n        style: tableStyle,\n        weightings,\n        tdStyle,\n        trStyle,\n    }), [tableStyle, weightings, tdStyle, trStyle]);\n\n    return (\n        <tableContext.Provider value={tableContextValue}>\n            <View {...rest} style={style}>\n                {rows}\n            </View>\n        </tableContext.Provider>\n    );\n}\n", "import {View} from '@react-pdf/renderer';\nimport React, {useContext, useMemo} from 'react';\n\nimport {tableContext} from './Table';\n\nexport interface TableRowProps extends Omit<React.ComponentProps<typeof View>, 'children'> {\n    _firstRow?: boolean,\n    _lastRow?: boolean,\n\n    children?: React.ReactElement | React.ReactElement[] | React.ReactFragment | React.ReactFragment[],\n}\n\nexport default function TableRow({children, style: styleProps, _firstRow, _lastRow, ...rest}: TableRowProps) {\n    const {trStyle, weightings: tableWeightings} = useContext(tableContext);\n\n    const cells = useMemo(() => {\n        const output: React.ReactElement[] = [];\n\n        const flattenChildren = (elem: typeof children) => {\n            React.Children.forEach(elem, (child) => {\n                if (!React.isValidElement(child)) {\n                    return;\n                }\n\n                if (child.type === React.Fragment) {\n                    flattenChildren((child.props as {children?: React.ReactNode}).children);\n                }\n                else {\n                    output.push(child);\n                }\n            });\n        };\n        flattenChildren(children);\n\n        let weightings: (number | undefined)[] = [];\n\n        for (const [index, row] of output.entries()) {\n            if (row.props?.weighting) {\n                weightings.push(row.props?.weighting);\n            }\n            else {\n                weightings.push(tableWeightings?.[index]);\n            }\n        }\n\n        const remainingWeighting = 1 - weightings.reduce((acc, val) => acc + (val || 0), 0);\n        const weightingPerNotSpecified = remainingWeighting / (output.length - weightings.filter(e => typeof e === 'number').length);\n\n        weightings = weightings.map(e => e === undefined ? weightingPerNotSpecified : e);\n\n        return (\n            output.map((td, columnIndex) => (\n                React.cloneElement(td, {\n                    weighting: weightings[columnIndex],\n                    key: `table_col_${columnIndex}_cell`,\n                    _firstColumn: columnIndex === 0,\n                    _lastColumn: columnIndex === output.length - 1,\n                    _firstRow,\n                    _lastRow,\n                })\n            ))\n        );\n    }, [children, tableWeightings, _firstRow, _lastRow]);\n\n    return (\n        <View\n            {...rest}\n            style={[\n                {\n                    display: 'flex',\n                    flexDirection: 'row',\n                },\n                ...(Array.isArray(trStyle) ? trStyle : [trStyle]),\n                ...(Array.isArray(styleProps) ? styleProps : [styleProps]),\n            ]}\n        >\n            {cells}\n        </View>\n    );\n}\n", "import React from 'react';\n\nimport TableRow, {TableRowProps} from './TableRow';\n\nexport type TableHeaderProps = TableRowProps;\n\nexport default function TableHeader({children, style, ...rest}: TableHeaderProps) {\n    return (\n        <TableRow\n            {...rest}\n            style={[\n                {\n                    fontWeight: 'bold',\n                },\n                ...(Array.isArray(style) ? style : [style]),\n            ]}\n        >\n            {children}\n        </TableRow>\n    );\n}\n", "import {Text, View} from '@react-pdf/renderer';\nimport React, {useContext, useMemo} from 'react';\n\nimport {tableContext} from './Table';\n\nexport interface TableCellProps extends Omit<React.ComponentProps<typeof View>, 'children'> {\n    /**\n     * The weighting of a cell based on the flex layout style.\n     * This value is between 0..1, if not specified 1 is assumed, this will take up the remaining available space.\n     */\n    weighting?: number,\n\n    _firstColumn?: boolean,\n    _lastColumn?: boolean,\n    _firstRow?: boolean,\n    _lastRow?: boolean,\n\n    children?: React.ReactNode | React.ReactNode[],\n}\n\nexport default function TableCell({\n    children, weighting,\n    _firstColumn, _lastColumn,\n    _firstRow, _lastRow,\n    ...rest\n}: TableCellProps) {\n    const content = useMemo(() => {\n        const output: JSX.Element[] = [];\n\n        const flattenChildren = (elem: typeof children) => {\n            React.Children.forEach(elem, (child) => {\n                if (React.isValidElement(child) && child?.type === React.Fragment) {\n                    flattenChildren((child.props as {children?: React.ReactNode}).children);\n                }\n                else {\n                    output.push(child as JSX.Element);\n                }\n            });\n        };\n        flattenChildren(children);\n\n        return (\n            output.map((child, index) => {\n                const key = `table_cell_${index}_content`;\n\n                if (typeof child === 'string' || typeof child === 'number') {\n                    return (\n                        <Text key={key}>{child}</Text>\n                    );\n                }\n                else {\n                    return child;\n                }\n            })\n        );\n    }, [children]);\n\n    const {tdStyle, style: tableStyle} = useContext(tableContext);\n    const borderMargin = `${(tableStyle['borderWidth'] || 0) * -1}px`;\n\n    // all this fuckery is to ensure no micro-gaps in the solid borders (1000x zoom to see)\n    const borders = useMemo(() => {\n        if (tableStyle.borderStyle === 'solid') {\n            return {\n                borderTop: `${tableStyle['borderWidth'] || 0}px ${tableStyle.borderStyle} ${tableStyle.borderColor}`,\n                borderRight: `${tableStyle['borderWidth'] || 0}px ${tableStyle.borderStyle} ${tableStyle.borderColor}`,\n                borderBottom: `${tableStyle['borderWidth'] || 0}px ${tableStyle.borderStyle} ${tableStyle.borderColor}`,\n                borderLeft: `${tableStyle['borderWidth'] || 0}px ${tableStyle.borderStyle} ${tableStyle.borderColor}`,\n                margin: `${borderMargin} ${_lastColumn ? borderMargin : '0'} ${_lastRow ? borderMargin : 0} ${borderMargin}`,\n            };\n        }\n        else {\n            return {\n                borderTop: _firstRow ? undefined : `${tableStyle['borderWidth'] || 0}px ${tableStyle.borderStyle} ${tableStyle.borderColor}`,\n                borderLeft: _firstColumn ? undefined : `${tableStyle['borderWidth'] || 0}px ${tableStyle.borderStyle} ${tableStyle.borderColor}`,\n            };\n        }\n    }, [tableStyle, _firstColumn, _lastColumn, _firstRow, _firstRow]);\n\n    return (\n        <View\n            wrap={true}\n            {...rest}\n            style={[\n                {\n                    ...borders,\n                    flex: weighting ?? 1,\n                    display: 'flex',\n                    flexDirection: 'row',\n                    alignItems: 'center',\n                },\n                ...(Array.isArray(tdStyle) ? tdStyle : [tdStyle]),\n                ...(Array.isArray(rest.style) ? rest.style : [rest.style]),\n            ]}\n        >\n            {content}\n        </View>\n    );\n}\n", "import { Table, TD, TH, TR } from '@ag-media/react-pdf-table';\nimport { Image, Page, Text, View } from '@react-pdf/renderer';\nimport { Map } from '~/components/react-pdf/Map';\nimport QrCode from '~/components/react-pdf/QrCode';\n// import { Bullet } from '~/components/react-pdf/Bullet';\n\nexport const PDF_COMPONENTS = {\n  Page: Page,\n  View: View,\n  Text: Text,\n  Image: Image,\n  Table: Table,\n  TH: TH,\n  TR: TR,\n  TD: TD,\n  QrCode: QrCode,\n  Map: Map,\n  // Bullet: Bullet,\n};\n", "import QRCode, { QRCodeToDataURLOptions } from 'qrcode';\nimport React from 'react';\nimport {\n  ComponentData,\n  ComponentMap,\n  RenderPdfComponentArgs,\n  TemplateData,\n} from '~/types';\n\nexport const generateQrCode = async (text: string) => {\n  const options: QRCodeToDataURLOptions = {\n    margin: 0,\n    width: 300,\n    color: {\n      dark: '#000',\n      light: '#fff',\n    },\n  };\n  return QRCode.toDataURL(text, options);\n};\n\n// Recursive function to render components from nested data structure\nexport function renderPdfComponent(args: RenderPdfComponentArgs): any {\n  const { componentData, components, data, allProps = {}, images = {} } = args;\n\n  if (allProps.key) delete allProps.key;\n  if (allProps.styles) delete allProps.styles;\n  if (allProps.index) delete allProps.index;\n  if (allProps.className) delete allProps.className;\n  if (allProps.children) delete allProps.children;\n\n  // Handle array of components\n  if (Array.isArray(componentData) && componentData.length > 0) {\n    return componentData.map((item, index) =>\n      renderPdfComponent({\n        componentData: { ...item, props: { ...item.props, index } },\n        components,\n        data,\n        allProps: {},\n        images,\n      }),\n    );\n  }\n\n  // Handle single component object\n  if (\n    typeof componentData === 'object' &&\n    componentData !== null &&\n    'type' in componentData &&\n    Object.keys(components).includes(componentData.type)\n  ) {\n    const { type, props = {}, children, visible = 'true' } = componentData;\n    const mergedProps = { ...allProps, ...props };\n\n    // Get the component constructor/function from the components object\n    const Component = components[type];\n\n    if (!Component) {\n      console.warn(`Component type \"${type}\" not found in components object`);\n      return null;\n    }\n\n    // Process children recursively\n    let processedChildren: any = null;\n\n    if (children !== undefined) {\n      if (Array.isArray(children)) {\n        // If children is an array, recursively process each child\n        processedChildren = children.map((child, index) =>\n          renderPdfComponent({\n            componentData: child,\n            components,\n            data,\n            allProps: mergedProps,\n            images,\n          }),\n        );\n      } else if (\n        typeof children === 'object' &&\n        children !== null &&\n        'type' in children\n      ) {\n        // If children is a single component object, process it\n        processedChildren = renderPdfComponent({\n          componentData: children,\n          components,\n          data,\n          allProps: mergedProps,\n          images,\n        });\n      } else {\n        // If children is a string or other primitive, use it directly\n        processedChildren = children;\n      }\n    }\n\n    // Return the component with processed children\n    const propsWithKey: Record<string, any> = {\n      ...mergedProps,\n      key: crypto.randomUUID(),\n    };\n\n    if (type === 'Map') {\n      propsWithKey.data = data;\n      propsWithKey.images = images;\n    }\n\n    // const mappedProps = mapDataProps(propsWithKey, data);\n    const { mappedChild, mappedIsVisible, ...mappedProps } = mapDataProps(\n      {\n        ...propsWithKey,\n        mappedChild: processedChildren,\n        mappedIsVisible: visible,\n      },\n      data,\n      images,\n    );\n\n    const canRender = safeBooleanEval(mappedIsVisible);\n    return canRender\n      ? React.createElement(Component, mappedProps, mappedChild)\n      : null;\n  }\n\n  // Handle primitive values (strings, numbers, etc.)\n  return componentData;\n}\n\nexport function renderHtmlComponent(args: RenderPdfComponentArgs): any {\n  const { componentData, components, data, allProps = {}, images = {} } = args;\n\n  if (allProps.key) delete allProps.key;\n  if (allProps.styles) delete allProps.styles;\n  if (allProps.index) delete allProps.index;\n  if (allProps.className) delete allProps.className;\n  if (allProps.children) delete allProps.children;\n\n  // Handle array of components\n  if (Array.isArray(componentData) && componentData.length > 0) {\n    return componentData.map((item, index) =>\n      renderHtmlComponent({\n        componentData: { ...item, props: { ...item.props, index } },\n        components,\n        data,\n        allProps: {},\n        images,\n      }),\n    );\n  }\n\n  // Handle single component object\n  if (\n    typeof componentData === 'object' &&\n    componentData !== null &&\n    'type' in componentData &&\n    Object.keys(components).includes(componentData.type)\n  ) {\n    const { type, props = {}, children, visible = 'true' } = componentData;\n    const mergedProps = { ...allProps, ...props };\n\n    // Get the component constructor/function from the components object\n    const Component = components[type];\n\n    if (!Component) {\n      console.warn(`Component type \"${type}\" not found in components object`);\n      return null;\n    }\n\n    // Process children recursively\n    let processedChildren: any = null;\n\n    if (children !== undefined) {\n      if (Array.isArray(children)) {\n        // If children is an array, recursively process each child\n        processedChildren = children.map((child, index) =>\n          renderHtmlComponent({\n            componentData: child,\n            components,\n            data,\n            allProps: mergedProps,\n            images,\n          }),\n        );\n      } else if (\n        typeof children === 'object' &&\n        children !== null &&\n        'type' in children\n      ) {\n        // If children is a single component object, process it\n        processedChildren = renderHtmlComponent({\n          componentData: children,\n          components,\n          data,\n          allProps: mergedProps,\n          images,\n        });\n      } else {\n        // If children is a string or other primitive, use it directly\n        processedChildren = children;\n      }\n    }\n\n    // Return the component with processed children\n    const propsWithKey: Record<string, any> = {\n      ...mergedProps,\n      key: crypto.randomUUID(),\n    };\n\n    if (type === 'Map') {\n      propsWithKey.data = data;\n      propsWithKey.images = images;\n    }\n\n    // const mappedProps = mapDataProps(propsWithKey, data);\n    const { mappedChild, mappedIsVisible, ...mappedProps } = mapDataProps(\n      {\n        ...propsWithKey,\n        mappedChild: processedChildren,\n        mappedIsVisible: visible,\n      },\n      data,\n      images,\n    );\n\n    const canRender = safeBooleanEval(mappedIsVisible);\n    return canRender\n      ? React.createElement(Component, mappedProps, mappedChild)\n      : null;\n  }\n\n  // Handle primitive values (strings, numbers, etc.)\n  return componentData;\n}\n\nexport const mapDataProps = (\n  props: Record<string, any>,\n  data: any,\n  images: any,\n) => {\n  const context = { $data: data, $props: props, $images: images };\n  const templateRegex = /\\{\\{([^}]+)\\}\\}/g;\n\n  const processStringValue = (value: string): any => {\n    const matches = Array.from(value.matchAll(templateRegex));\n\n    if (matches.length === 0) {\n      return value;\n    }\n\n    // Single template that spans the entire string - return the actual value\n    if (matches.length === 1 && matches[0][0] === value) {\n      const path = matches[0][1].trim();\n      const resolvedValue = getNestedProperty({ obj: context, path });\n      return resolvedValue !== undefined ? resolvedValue : value;\n    }\n\n    // Multiple templates or partial string replacement - always return string\n    return matches.reduce((result, match) => {\n      const path = match[1].trim();\n      const resolvedValue = getNestedProperty({ obj: context, path });\n      const replacement =\n        resolvedValue !== undefined ? String(resolvedValue) : match[0];\n      return result.replace(match[0], replacement);\n    }, value);\n  };\n\n  return Object.fromEntries(\n    Object.entries(props).map(([key, value]) => [\n      key,\n      typeof value === 'string' ? processStringValue(value) : value,\n    ]),\n  );\n};\n\nexport const parseJson = (jsonString: string): TemplateData | null => {\n  try {\n    const obj = JSON.parse(jsonString);\n    return obj;\n  } catch (e) {\n    return null;\n  }\n};\n\nexport function getNestedProperty({\n  obj,\n  path,\n}: {\n  obj?: any;\n  path: string;\n}): any {\n  // Split the path by dots and filter out empty strings\n  const keys = path.split('.').filter((key) => key.length > 0);\n\n  // Start with the root object\n  let current = obj;\n\n  // Traverse through each key in the path\n  for (const key of keys) {\n    // Check if current is null/undefined or if the key doesn't exist\n    if (current == null || !(key in current)) {\n      return undefined;\n    }\n    current = current[key];\n  }\n\n  if (typeof current === 'object') {\n    return JSON.stringify(current);\n  }\n  return current;\n}\n\nexport function safeBooleanEval(code: string) {\n  try {\n    const result = eval(code);\n    return typeof result === 'boolean' ? result : false;\n  } catch (error) {\n    console.error(`Error evaluating code \"${code}\":`, error);\n    return false;\n  }\n}\n\nexport function convertFileToBase64(file: File): Promise<string> {\n  return new Promise((resolve, reject) => {\n    const reader = new FileReader();\n\n    reader.onload = function (event) {\n      const content = event.target?.result;\n      if (typeof content === 'string') {\n        resolve(content);\n      } else {\n        reject(new Error('File content is not a string'));\n      }\n    };\n\n    reader.onerror = function (error) {\n      reject(error);\n    };\n\n    reader.readAsDataURL(file);\n  });\n}\n", "import React from 'react';\nimport { PDF_COMPONENTS } from '~/utils/pdf-components';\nimport { renderPdfComponent } from '~/utils/helpers';\n\ninterface MapProps {\n  items: string;\n  itemKeyWord?: string;\n  component: any;\n  data: any;\n  images: any;\n}\n\nexport const Map: React.FC<MapProps> = ({\n  items,\n  component,\n  data = {},\n  images = {},\n  itemKeyWord = 'item',\n}) => {\n  const parsedItems = JSON.parse(items);\n\n  if (!Array.isArray(parsedItems)) return null;\n\n  const mappedItems = parsedItems.map((item, index) => ({\n    ...component,\n    props: {\n      ...component.props,\n      [itemKeyWord]: item,\n      [`${itemKeyWord}Index`]: index,\n    },\n  }));\n\n  return renderPdfComponent({\n    componentData: mappedItems,\n    components: PDF_COMPONENTS,\n    data,\n    allProps: {},\n    images,\n  });\n};\n", "import { Image, ImageProps } from '@react-pdf/renderer';\nimport React from 'react';\nimport { generateQrCode } from '~/utils/helpers';\n\nconst QrCode: React.FC<ImageProps & { qrCodeText: string }> = (props) => {\n  const { qrCodeText, ...imageProps } = props;\n  const qrCodeURL = React.useMemo(\n    async () => await generateQrCode(qrCodeText),\n    [qrCodeText],\n  );\n\n  return <Image src={qrCodeURL} {...imageProps} />;\n};\n\nexport default QrCode;\n"],
-  "mappings": "whBAAA,IAAAA,GAAAC,EAAA,CAAAC,GAAAC,KAAA,UAASC,GAAUC,EAAO,CACxB,KAAK,MAAQA,EAEb,KAAK,MAAQ,SAASC,EAAS,CAC7B,OAAO,KAAK,OAASA,EAAQ,MAC/B,CACF,CAEA,SAASC,GAAUF,EAAO,CACxB,KAAK,MAAQA,EAEb,KAAK,MAAQ,SAASC,EAAS,CAC7B,OAAO,KAAK,MAAQA,EAAQ,MAC9B,CACF,CAEA,SAASE,GAASH,EAAO,CACvB,KAAK,MAAQA,EAEb,KAAK,MAAQ,SAASC,EAAS,CAC7B,OAAO,KAAK,OAASA,EAAQ,KAC/B,CACF,CAEA,SAASG,GAASJ,EAAO,CACvB,KAAK,MAAQA,EAEb,KAAK,MAAQ,SAASC,EAAS,CAC7B,OAAO,KAAK,MAAQA,EAAQ,KAC9B,CACF,CAEA,SAASI,GAAYL,EAAO,CAC1B,KAAK,MAAQA,EAEb,KAAK,MAAQ,SAASC,EAAS,CAC7B,OAAO,KAAK,QAAUA,EAAQ,WAChC,CACF,CAEAH,GAAO,QAAU,SAAeQ,EAAMN,EAAO,CAC3C,OAAQM,EAAM,CACZ,IAAK,aACH,OAAO,IAAIP,GAAUC,CAAK,EAC5B,IAAK,aACH,OAAO,IAAIE,GAAUF,CAAK,EAC5B,IAAK,YACH,OAAO,IAAIG,GAASH,CAAK,EAC3B,IAAK,YACH,OAAO,IAAII,GAASJ,CAAK,EAC3B,IAAK,cACH,OAAO,IAAIK,GAAYL,CAAK,EAC9B,QACE,MAAM,IAAI,MAAMA,CAAK,CACzB,CACF,ICvDA,IAAAO,GAAAC,EAAA,CAAAC,GAAAC,KAAA,UAASC,GAAIC,EAAMC,EAAO,CACxB,KAAK,KAAOD,EACZ,KAAK,MAAQC,EAEb,KAAK,MAAQ,SAASC,EAAS,CAC7B,OAAOF,EAAK,MAAME,CAAO,GAAKD,EAAM,MAAMC,CAAO,CACnD,CACF,CAEA,SAASC,GAAGH,EAAMC,EAAO,CACvB,KAAK,KAAOD,EACZ,KAAK,MAAQC,EAEb,KAAK,MAAQ,SAASC,EAAS,CAC7B,OAAOF,EAAK,MAAME,CAAO,GAAKD,EAAM,MAAMC,CAAO,CACnD,CACF,CAEAJ,GAAO,QAAU,SAAkBM,EAAMJ,EAAMC,EAAO,CACpD,OAAQG,EAAM,CACZ,IAAK,MACH,OAAO,IAAIL,GAAIC,EAAMC,CAAK,EAC5B,IAAK,IACH,OAAO,IAAIE,GAAGH,EAAMC,CAAK,EAC3B,QACE,MAAM,IAAI,MAAM,KAAK,CACzB,CACF,IC3BA,IAAAI,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAIC,GAAQ,KACRC,GAAW,KAEXC,GAAU,QACVC,GAAU,YACVC,GAAa,KACbC,GAAQ,IACRC,GAAQ,IACRC,GAAM,OACNC,GAAK,IAET,SAASC,GAAUC,EAAO,CAIxB,QAHIC,EAAU,EACVC,EAAS,CAAC,EAEPD,EAAUD,EAAM,QAAQ,CAC7B,IAAIG,EAAOH,EAAMC,CAAO,EAExB,GAAIH,GAAG,KAAKK,CAAI,EAEd,IADAA,EAAOH,EAAM,EAAEC,CAAO,EACfR,GAAQ,KAAKU,CAAI,GAAKA,IAAS,QACpCA,EAAOH,EAAM,EAAEC,CAAO,EAI1B,GAAIP,GAAW,KAAKS,CAAI,GAAKA,IAAS,KAAOA,IAAS,IAAK,CACzDF,IACA,QACF,CAEA,GAAIN,GAAM,KAAKQ,CAAI,GAAKP,GAAM,KAAKO,CAAI,EAAG,CACxCF,IACAC,EAAO,KAAK,CAAE,KAAM,WAAY,MAAOC,CAAK,CAAC,EAC7C,QACF,CAEA,GAAIX,GAAQ,KAAKW,CAAI,EAAG,CAEtB,QADIC,EAAQ,GACLZ,GAAQ,KAAKW,CAAI,GACtBC,GAASD,EACTA,EAAOH,EAAM,EAAEC,CAAO,EAGxBC,EAAO,KAAK,CAAE,KAAM,SAAU,MAAOE,CAAM,CAAC,EAC5C,QACF,CAEA,GAAIX,GAAQ,KAAKU,CAAI,EAAG,CAEtB,QADIC,EAAQ,GACLX,GAAQ,KAAKU,CAAI,GAAKA,IAAS,QACpCC,GAASD,EACTA,EAAOH,EAAM,EAAEC,CAAO,EAEpBJ,GAAI,KAAKO,CAAK,EAChBF,EAAO,KAAK,CAAE,KAAM,WAAY,MAAOE,CAAM,CAAC,EAE9CF,EAAO,KAAK,CAAE,KAAM,UAAW,MAAOE,CAAM,CAAC,EAG/C,QACF,CAEA,MAAM,IAAI,UACR,kDAAoDD,CACtD,CACF,CAEA,OAAOD,CACT,CAEA,SAASG,GAAOH,EAAQ,CAItB,QAHII,EAAS,CAAC,EACVC,EAAQ,CAAC,EAENL,EAAO,OAAS,GAAG,CACxB,IAAIM,EAAQN,EAAO,MAAM,EAEzB,GAAIM,EAAM,OAAS,UAAYA,EAAM,OAAS,UAAW,CACvDF,EAAO,KAAKE,CAAK,EACjB,QACF,CAEA,GAAIA,EAAM,OAAS,WAAY,CAC7B,GAAIb,GAAM,KAAKa,EAAM,KAAK,EAAG,CAC3BA,EAAQ,CAAE,KAAM,QAAS,IAAKF,EAAO,IAAI,EAAG,MAAOJ,EAAO,MAAM,CAAE,EAClEI,EAAO,KAAKE,CAAK,EACjB,QACF,CAEA,KAAOD,EAAM,OAAS,GACpBD,EAAO,QAAQC,EAAM,IAAI,CAAC,EAE5BA,EAAM,KAAKC,CAAK,CAClB,CACF,CAEA,KAAOD,EAAM,OAAS,GACpBD,EAAO,QAAQC,EAAM,IAAI,CAAC,EAG5B,SAASE,GAAO,CACd,IAAIC,EAAOJ,EAAO,MAAM,EAExB,GAAII,EAAK,OAAS,SAChB,OAAO,SAASA,EAAK,KAAK,EAG5B,GAAIA,EAAK,OAAS,UAChB,OAAOA,EAAK,MAGd,GAAIA,EAAK,OAAS,WAAY,CAC5B,IAAIC,EAAIF,EAAK,EACTG,EAAIH,EAAK,EAEb,OAAOlB,GAASmB,EAAK,MAAOC,EAAGC,CAAC,CAClC,CAEA,GAAIF,EAAK,OAAS,QAAS,CACzB,IAAIC,EAAID,EAAK,IAAI,MACbE,EAAIF,EAAK,MAAM,MAEnB,OAAOpB,GAAMqB,EAAGC,CAAC,CACnB,CACF,CAEA,OAAOH,EAAK,CACd,CAEApB,GAAO,QAAU,CACf,MAAO,SAASwB,EAAO,CACrB,IAAIX,EAASH,GAAUc,CAAK,EACxBC,EAAMT,GAAOH,CAAM,EACvB,OAAOY,CACT,CACF,ICvIA,IAAAC,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAIC,GAAS,KAEbD,GAAO,QAAU,SAASE,EAASC,EAAS,CAC1C,IAAIC,EAAS,CAAC,EAEd,cAAO,KAAKF,CAAO,EAAE,QAAQ,SAASG,EAAO,CACvCJ,GAAO,MAAMI,CAAK,EAAE,MAAMF,CAAO,GACnC,OAAO,OAAOC,EAAQF,EAAQG,CAAK,CAAC,CAExC,CAAC,EAEMD,CACT,ICZA,IAAAE,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CAGA,IAAIC,GAAW,SAASC,EAAKC,EAAYC,EAAU,CAEjD,GAAIF,GAAO,KACT,MAAO,CAAC,EAAG,EAAG,CAAC,EAGjB,IAAIG,GAAU,EAAI,KAAK,IAAK,EAAID,EAAa,CAAC,GAAKD,EAC/CG,EAAWJ,EAAM,GACjBK,EAAkBF,GAAU,EAAI,KAAK,IAAKC,EAAW,EAAK,CAAC,GAE/DA,EAAW,KAAK,MAAMA,CAAQ,EAC9B,IAAIE,EACAC,EACAC,EAEAJ,IAAa,GACfE,EAAMH,EACNI,EAAQF,EACRG,EAAO,GACCJ,IAAa,GACrBE,EAAMD,EACNE,EAAQJ,EACRK,EAAO,GACCJ,IAAa,GACrBE,EAAM,EACNC,EAAQJ,EACRK,EAAOH,GACCD,IAAa,GACrBE,EAAM,EACNC,EAAQF,EACRG,EAAOL,GACCC,IAAa,GACrBE,EAAMD,EACNE,EAAQ,EACRC,EAAOL,GACCC,IAAa,IACrBE,EAAMH,EACNI,EAAQ,EACRC,EAAOH,GAGT,IAAII,EAAsBP,EAAaC,EAAS,EAChD,OAAAG,GAAOG,EACPF,GAASE,EACTD,GAAQC,EAED,CACH,KAAK,IAAI,KAAK,MAAMH,EAAM,GAAG,CAAC,EAC9B,KAAK,IAAI,KAAK,MAAMC,EAAQ,GAAG,CAAC,EAChC,KAAK,IAAI,KAAK,MAAMC,EAAO,GAAG,CAAC,CACnC,CAEF,EAEAV,GAAO,QAAUC,KCzDjB,IAAAW,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CAEA,IAAIC,GAAQ,KASZ,SAASC,GAAKC,EAAKC,EAAG,CACpB,OAAQD,EAAMC,EAAKA,EAAID,CACzB,CAEA,SAASE,GAAKF,EAAKC,EAAG,CACpB,OAAQD,EAAMC,EAAKA,EAAID,CACzB,CAEA,SAASG,GAAOH,EAAK,CAKnB,IAHAA,EAAMD,GAAIC,EAAK,GAAG,EAClBA,EAAME,GAAIF,EAAK,IAAI,EAEZA,EAAM,GAAKA,GAAO,IACzB,KAAOA,EAAM,KAAOA,GAAO,IAC3B,OAAOA,CACT,CAIA,SAASI,GAAKC,EAAKC,EAAYC,EAAY,CAEzCF,EAAMF,GAAME,CAAG,EAGfC,EAAaJ,GAAIH,GAAIO,EAAY,GAAG,EAAG,CAAC,EACxCC,EAAaL,GAAIH,GAAIQ,EAAY,GAAG,EAAG,CAAC,EAGxCD,GAAc,IACdC,GAAc,IAGd,IAAIC,EAAMV,GAAMO,EAAKC,EAAYC,CAAU,EAK3C,MAAO,IAAMC,EACV,IAAI,SAAUP,EAAG,CAChB,OAAQ,IAAMA,GAAG,SAAS,EAAE,EAAE,OAAO,EAAE,CACzC,CAAC,EACA,KAAK,EAAE,CACZ,CAIAJ,GAAO,QAAUO,KC1DjB,IAAAK,GAAAC,EAAA,CAAAC,GAAAC,KAAA,cAEAA,GAAO,QAAU,CAChB,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,aAAgB,CAAC,IAAK,IAAK,GAAG,EAC9B,KAAQ,CAAC,EAAG,IAAK,GAAG,EACpB,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,MAAS,CAAC,IAAK,IAAK,GAAG,EACvB,MAAS,CAAC,IAAK,IAAK,GAAG,EACvB,OAAU,CAAC,IAAK,IAAK,GAAG,EACxB,MAAS,CAAC,EAAG,EAAG,CAAC,EACjB,eAAkB,CAAC,IAAK,IAAK,GAAG,EAChC,KAAQ,CAAC,EAAG,EAAG,GAAG,EAClB,WAAc,CAAC,IAAK,GAAI,GAAG,EAC3B,MAAS,CAAC,IAAK,GAAI,EAAE,EACrB,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,UAAa,CAAC,GAAI,IAAK,GAAG,EAC1B,WAAc,CAAC,IAAK,IAAK,CAAC,EAC1B,UAAa,CAAC,IAAK,IAAK,EAAE,EAC1B,MAAS,CAAC,IAAK,IAAK,EAAE,EACtB,eAAkB,CAAC,IAAK,IAAK,GAAG,EAChC,SAAY,CAAC,IAAK,IAAK,GAAG,EAC1B,QAAW,CAAC,IAAK,GAAI,EAAE,EACvB,KAAQ,CAAC,EAAG,IAAK,GAAG,EACpB,SAAY,CAAC,EAAG,EAAG,GAAG,EACtB,SAAY,CAAC,EAAG,IAAK,GAAG,EACxB,cAAiB,CAAC,IAAK,IAAK,EAAE,EAC9B,SAAY,CAAC,IAAK,IAAK,GAAG,EAC1B,UAAa,CAAC,EAAG,IAAK,CAAC,EACvB,SAAY,CAAC,IAAK,IAAK,GAAG,EAC1B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,YAAe,CAAC,IAAK,EAAG,GAAG,EAC3B,eAAkB,CAAC,GAAI,IAAK,EAAE,EAC9B,WAAc,CAAC,IAAK,IAAK,CAAC,EAC1B,WAAc,CAAC,IAAK,GAAI,GAAG,EAC3B,QAAW,CAAC,IAAK,EAAG,CAAC,EACrB,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,aAAgB,CAAC,IAAK,IAAK,GAAG,EAC9B,cAAiB,CAAC,GAAI,GAAI,GAAG,EAC7B,cAAiB,CAAC,GAAI,GAAI,EAAE,EAC5B,cAAiB,CAAC,GAAI,GAAI,EAAE,EAC5B,cAAiB,CAAC,EAAG,IAAK,GAAG,EAC7B,WAAc,CAAC,IAAK,EAAG,GAAG,EAC1B,SAAY,CAAC,IAAK,GAAI,GAAG,EACzB,YAAe,CAAC,EAAG,IAAK,GAAG,EAC3B,QAAW,CAAC,IAAK,IAAK,GAAG,EACzB,QAAW,CAAC,IAAK,IAAK,GAAG,EACzB,WAAc,CAAC,GAAI,IAAK,GAAG,EAC3B,UAAa,CAAC,IAAK,GAAI,EAAE,EACzB,YAAe,CAAC,IAAK,IAAK,GAAG,EAC7B,YAAe,CAAC,GAAI,IAAK,EAAE,EAC3B,QAAW,CAAC,IAAK,EAAG,GAAG,EACvB,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,KAAQ,CAAC,IAAK,IAAK,CAAC,EACpB,UAAa,CAAC,IAAK,IAAK,EAAE,EAC1B,KAAQ,CAAC,IAAK,IAAK,GAAG,EACtB,MAAS,CAAC,EAAG,IAAK,CAAC,EACnB,YAAe,CAAC,IAAK,IAAK,EAAE,EAC5B,KAAQ,CAAC,IAAK,IAAK,GAAG,EACtB,SAAY,CAAC,IAAK,IAAK,GAAG,EAC1B,QAAW,CAAC,IAAK,IAAK,GAAG,EACzB,UAAa,CAAC,IAAK,GAAI,EAAE,EACzB,OAAU,CAAC,GAAI,EAAG,GAAG,EACrB,MAAS,CAAC,IAAK,IAAK,GAAG,EACvB,MAAS,CAAC,IAAK,IAAK,GAAG,EACvB,SAAY,CAAC,IAAK,IAAK,GAAG,EAC1B,cAAiB,CAAC,IAAK,IAAK,GAAG,EAC/B,UAAa,CAAC,IAAK,IAAK,CAAC,EACzB,aAAgB,CAAC,IAAK,IAAK,GAAG,EAC9B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,qBAAwB,CAAC,IAAK,IAAK,GAAG,EACtC,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,YAAe,CAAC,IAAK,IAAK,GAAG,EAC7B,cAAiB,CAAC,GAAI,IAAK,GAAG,EAC9B,aAAgB,CAAC,IAAK,IAAK,GAAG,EAC9B,eAAkB,CAAC,IAAK,IAAK,GAAG,EAChC,eAAkB,CAAC,IAAK,IAAK,GAAG,EAChC,eAAkB,CAAC,IAAK,IAAK,GAAG,EAChC,YAAe,CAAC,IAAK,IAAK,GAAG,EAC7B,KAAQ,CAAC,EAAG,IAAK,CAAC,EAClB,UAAa,CAAC,GAAI,IAAK,EAAE,EACzB,MAAS,CAAC,IAAK,IAAK,GAAG,EACvB,QAAW,CAAC,IAAK,EAAG,GAAG,EACvB,OAAU,CAAC,IAAK,EAAG,CAAC,EACpB,iBAAoB,CAAC,IAAK,IAAK,GAAG,EAClC,WAAc,CAAC,EAAG,EAAG,GAAG,EACxB,aAAgB,CAAC,IAAK,GAAI,GAAG,EAC7B,aAAgB,CAAC,IAAK,IAAK,GAAG,EAC9B,eAAkB,CAAC,GAAI,IAAK,GAAG,EAC/B,gBAAmB,CAAC,IAAK,IAAK,GAAG,EACjC,kBAAqB,CAAC,EAAG,IAAK,GAAG,EACjC,gBAAmB,CAAC,GAAI,IAAK,GAAG,EAChC,gBAAmB,CAAC,IAAK,GAAI,GAAG,EAChC,aAAgB,CAAC,GAAI,GAAI,GAAG,EAC5B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,SAAY,CAAC,IAAK,IAAK,GAAG,EAC1B,YAAe,CAAC,IAAK,IAAK,GAAG,EAC7B,KAAQ,CAAC,EAAG,EAAG,GAAG,EAClB,QAAW,CAAC,IAAK,IAAK,GAAG,EACzB,MAAS,CAAC,IAAK,IAAK,CAAC,EACrB,UAAa,CAAC,IAAK,IAAK,EAAE,EAC1B,OAAU,CAAC,IAAK,IAAK,CAAC,EACtB,UAAa,CAAC,IAAK,GAAI,CAAC,EACxB,OAAU,CAAC,IAAK,IAAK,GAAG,EACxB,cAAiB,CAAC,IAAK,IAAK,GAAG,EAC/B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,cAAiB,CAAC,IAAK,IAAK,GAAG,EAC/B,cAAiB,CAAC,IAAK,IAAK,GAAG,EAC/B,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,KAAQ,CAAC,IAAK,IAAK,EAAE,EACrB,KAAQ,CAAC,IAAK,IAAK,GAAG,EACtB,KAAQ,CAAC,IAAK,IAAK,GAAG,EACtB,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,OAAU,CAAC,IAAK,EAAG,GAAG,EACtB,cAAiB,CAAC,IAAK,GAAI,GAAG,EAC9B,IAAO,CAAC,IAAK,EAAG,CAAC,EACjB,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,UAAa,CAAC,GAAI,IAAK,GAAG,EAC1B,YAAe,CAAC,IAAK,GAAI,EAAE,EAC3B,OAAU,CAAC,IAAK,IAAK,GAAG,EACxB,WAAc,CAAC,IAAK,IAAK,EAAE,EAC3B,SAAY,CAAC,GAAI,IAAK,EAAE,EACxB,SAAY,CAAC,IAAK,IAAK,GAAG,EAC1B,OAAU,CAAC,IAAK,GAAI,EAAE,EACtB,OAAU,CAAC,IAAK,IAAK,GAAG,EACxB,QAAW,CAAC,IAAK,IAAK,GAAG,EACzB,UAAa,CAAC,IAAK,GAAI,GAAG,EAC1B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,KAAQ,CAAC,IAAK,IAAK,GAAG,EACtB,YAAe,CAAC,EAAG,IAAK,GAAG,EAC3B,UAAa,CAAC,GAAI,IAAK,GAAG,EAC1B,IAAO,CAAC,IAAK,IAAK,GAAG,EACrB,KAAQ,CAAC,EAAG,IAAK,GAAG,EACpB,QAAW,CAAC,IAAK,IAAK,GAAG,EACzB,OAAU,CAAC,IAAK,GAAI,EAAE,EACtB,UAAa,CAAC,GAAI,IAAK,GAAG,EAC1B,OAAU,CAAC,IAAK,IAAK,GAAG,EACxB,MAAS,CAAC,IAAK,IAAK,GAAG,EACvB,MAAS,CAAC,IAAK,IAAK,GAAG,EACvB,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,OAAU,CAAC,IAAK,IAAK,CAAC,EACtB,YAAe,CAAC,IAAK,IAAK,EAAE,CAC7B,ICvJA,IAAAC,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CAAAA,GAAO,QAAU,SAAoBC,EAAK,CACzC,MAAI,CAACA,GAAO,OAAOA,GAAQ,SACnB,GAGDA,aAAe,OAAS,MAAM,QAAQA,CAAG,GAC9CA,EAAI,QAAU,IAAMA,EAAI,kBAAkB,UACzC,OAAO,yBAAyBA,EAAMA,EAAI,OAAS,CAAE,GAAKA,EAAI,YAAY,OAAS,SACvF,ICRA,IAAAC,GAAAC,EAAA,CAAAC,GAAAC,KAAA,cAEA,IAAIC,GAAa,KAEbC,GAAS,MAAM,UAAU,OACzBC,GAAQ,MAAM,UAAU,MAExBC,GAAUJ,GAAO,QAAU,SAAiBK,EAAM,CAGrD,QAFIC,EAAU,CAAC,EAENC,EAAI,EAAGC,EAAMH,EAAK,OAAQE,EAAIC,EAAKD,IAAK,CAChD,IAAIE,EAAMJ,EAAKE,CAAC,EAEZN,GAAWQ,CAAG,EAEjBH,EAAUJ,GAAO,KAAKI,EAASH,GAAM,KAAKM,CAAG,CAAC,EAE9CH,EAAQ,KAAKG,CAAG,CAElB,CAEA,OAAOH,CACR,EAEAF,GAAQ,KAAO,SAAUM,EAAI,CAC5B,OAAO,UAAY,CAClB,OAAOA,EAAGN,GAAQ,SAAS,CAAC,CAC7B,CACD,IC5BA,IAAAO,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CACA,IAAIC,GAAa,KACbC,GAAU,KACVC,GAAiB,OAAO,eAExBC,GAAe,OAAO,OAAO,IAAI,EAGrC,IAASC,MAAQJ,GACZE,GAAe,KAAKF,GAAYI,EAAI,IACvCD,GAAaH,GAAWI,EAAI,CAAC,EAAIA,IAF1B,IAAAA,GAMLC,EAAKN,GAAO,QAAU,CACzB,GAAI,CAAC,EACL,IAAK,CAAC,CACP,EAEAM,EAAG,IAAM,SAAUC,EAAQ,CAC1B,IAAIC,EAASD,EAAO,UAAU,EAAG,CAAC,EAAE,YAAY,EAC5CE,EACAC,EACJ,OAAQF,EAAQ,CACf,IAAK,MACJC,EAAMH,EAAG,IAAI,IAAIC,CAAM,EACvBG,EAAQ,MACR,MACD,IAAK,MACJD,EAAMH,EAAG,IAAI,IAAIC,CAAM,EACvBG,EAAQ,MACR,MACD,QACCD,EAAMH,EAAG,IAAI,IAAIC,CAAM,EACvBG,EAAQ,MACR,KACF,CAEA,OAAKD,EAIE,CAAC,MAAOC,EAAO,MAAOD,CAAG,EAHxB,IAIT,EAEAH,EAAG,IAAI,IAAM,SAAUC,EAAQ,CAC9B,GAAI,CAACA,EACJ,OAAO,KAGR,IAAII,EAAO,sBACPC,EAAM,kCACNC,EAAO,+HACPC,EAAM,uHACNC,EAAU,UAEVC,EAAM,CAAC,EAAG,EAAG,EAAG,CAAC,EACjBC,EACAC,EACAC,EAEJ,GAAIF,EAAQV,EAAO,MAAMK,CAAG,EAAG,CAI9B,IAHAO,EAAWF,EAAM,CAAC,EAClBA,EAAQA,EAAM,CAAC,EAEVC,EAAI,EAAGA,EAAI,EAAGA,IAAK,CAEvB,IAAIE,EAAKF,EAAI,EACbF,EAAIE,CAAC,EAAI,SAASD,EAAM,MAAMG,EAAIA,EAAK,CAAC,EAAG,EAAE,CAC9C,CAEID,IACHH,EAAI,CAAC,EAAI,SAASG,EAAU,EAAE,EAAI,IAEpC,SAAWF,EAAQV,EAAO,MAAMI,CAAI,EAAG,CAItC,IAHAM,EAAQA,EAAM,CAAC,EACfE,EAAWF,EAAM,CAAC,EAEbC,EAAI,EAAGA,EAAI,EAAGA,IAClBF,EAAIE,CAAC,EAAI,SAASD,EAAMC,CAAC,EAAID,EAAMC,CAAC,EAAG,EAAE,EAGtCC,IACHH,EAAI,CAAC,EAAI,SAASG,EAAWA,EAAU,EAAE,EAAI,IAE/C,SAAWF,EAAQV,EAAO,MAAMM,CAAI,EAAG,CACtC,IAAKK,EAAI,EAAGA,EAAI,EAAGA,IAClBF,EAAIE,CAAC,EAAI,SAASD,EAAMC,EAAI,CAAC,EAAG,CAAC,EAG9BD,EAAM,CAAC,IACNA,EAAM,CAAC,EACVD,EAAI,CAAC,EAAI,WAAWC,EAAM,CAAC,CAAC,EAAI,IAEhCD,EAAI,CAAC,EAAI,WAAWC,EAAM,CAAC,CAAC,EAG/B,SAAWA,EAAQV,EAAO,MAAMO,CAAG,EAAG,CACrC,IAAKI,EAAI,EAAGA,EAAI,EAAGA,IAClBF,EAAIE,CAAC,EAAI,KAAK,MAAM,WAAWD,EAAMC,EAAI,CAAC,CAAC,EAAI,IAAI,EAGhDD,EAAM,CAAC,IACNA,EAAM,CAAC,EACVD,EAAI,CAAC,EAAI,WAAWC,EAAM,CAAC,CAAC,EAAI,IAEhCD,EAAI,CAAC,EAAI,WAAWC,EAAM,CAAC,CAAC,EAG/B,KAAO,QAAIA,EAAQV,EAAO,MAAMQ,CAAO,GAClCE,EAAM,CAAC,IAAM,cACT,CAAC,EAAG,EAAG,EAAG,CAAC,EAGdd,GAAe,KAAKF,GAAYgB,EAAM,CAAC,CAAC,GAI7CD,EAAMf,GAAWgB,EAAM,CAAC,CAAC,EACzBD,EAAI,CAAC,EAAI,EAEFA,GANC,KAQD,KAGR,IAAKE,EAAI,EAAGA,EAAI,EAAGA,IAClBF,EAAIE,CAAC,EAAIG,EAAML,EAAIE,CAAC,EAAG,EAAG,GAAG,EAE9B,OAAAF,EAAI,CAAC,EAAIK,EAAML,EAAI,CAAC,EAAG,EAAG,CAAC,EAEpBA,CACR,EAEAV,EAAG,IAAI,IAAM,SAAUC,EAAQ,CAC9B,GAAI,CAACA,EACJ,OAAO,KAGR,IAAIe,EAAM,+KACNL,EAAQV,EAAO,MAAMe,CAAG,EAE5B,GAAIL,EAAO,CACV,IAAIM,EAAQ,WAAWN,EAAM,CAAC,CAAC,EAC3BO,GAAM,WAAWP,EAAM,CAAC,CAAC,EAAI,IAAO,KAAO,IAC3CQ,EAAIJ,EAAM,WAAWJ,EAAM,CAAC,CAAC,EAAG,EAAG,GAAG,EACtCS,EAAIL,EAAM,WAAWJ,EAAM,CAAC,CAAC,EAAG,EAAG,GAAG,EACtC,EAAII,EAAM,MAAME,CAAK,EAAI,EAAIA,EAAO,EAAG,CAAC,EAE5C,MAAO,CAACC,EAAGC,EAAGC,EAAG,CAAC,CACnB,CAEA,OAAO,IACR,EAEApB,EAAG,IAAI,IAAM,SAAUC,EAAQ,CAC9B,GAAI,CAACA,EACJ,OAAO,KAGR,IAAIoB,EAAM,sKACNV,EAAQV,EAAO,MAAMoB,CAAG,EAE5B,GAAIV,EAAO,CACV,IAAIM,EAAQ,WAAWN,EAAM,CAAC,CAAC,EAC3BO,GAAM,WAAWP,EAAM,CAAC,CAAC,EAAI,IAAO,KAAO,IAC3CW,EAAIP,EAAM,WAAWJ,EAAM,CAAC,CAAC,EAAG,EAAG,GAAG,EACtCY,EAAIR,EAAM,WAAWJ,EAAM,CAAC,CAAC,EAAG,EAAG,GAAG,EACtC,EAAII,EAAM,MAAME,CAAK,EAAI,EAAIA,EAAO,EAAG,CAAC,EAC5C,MAAO,CAACC,EAAGI,EAAGC,EAAG,CAAC,CACnB,CAEA,OAAO,IACR,EAEAvB,EAAG,GAAG,IAAM,UAAY,CACvB,IAAIO,EAAOX,GAAQ,SAAS,EAE5B,MACC,IACA4B,GAAUjB,EAAK,CAAC,CAAC,EACjBiB,GAAUjB,EAAK,CAAC,CAAC,EACjBiB,GAAUjB,EAAK,CAAC,CAAC,GAChBA,EAAK,CAAC,EAAI,EACPiB,GAAU,KAAK,MAAMjB,EAAK,CAAC,EAAI,GAAG,CAAC,EACpC,GAEL,EAEAP,EAAG,GAAG,IAAM,UAAY,CACvB,IAAIO,EAAOX,GAAQ,SAAS,EAE5B,OAAOW,EAAK,OAAS,GAAKA,EAAK,CAAC,IAAM,EACnC,OAAS,KAAK,MAAMA,EAAK,CAAC,CAAC,EAAI,KAAO,KAAK,MAAMA,EAAK,CAAC,CAAC,EAAI,KAAO,KAAK,MAAMA,EAAK,CAAC,CAAC,EAAI,IACzF,QAAU,KAAK,MAAMA,EAAK,CAAC,CAAC,EAAI,KAAO,KAAK,MAAMA,EAAK,CAAC,CAAC,EAAI,KAAO,KAAK,MAAMA,EAAK,CAAC,CAAC,EAAI,KAAOA,EAAK,CAAC,EAAI,GAC/G,EAEAP,EAAG,GAAG,IAAI,QAAU,UAAY,CAC/B,IAAIO,EAAOX,GAAQ,SAAS,EAExB6B,EAAI,KAAK,MAAMlB,EAAK,CAAC,EAAI,IAAM,GAAG,EAClCmB,EAAI,KAAK,MAAMnB,EAAK,CAAC,EAAI,IAAM,GAAG,EAClCgB,EAAI,KAAK,MAAMhB,EAAK,CAAC,EAAI,IAAM,GAAG,EAEtC,OAAOA,EAAK,OAAS,GAAKA,EAAK,CAAC,IAAM,EACnC,OAASkB,EAAI,MAAQC,EAAI,MAAQH,EAAI,KACrC,QAAUE,EAAI,MAAQC,EAAI,MAAQH,EAAI,MAAQhB,EAAK,CAAC,EAAI,GAC5D,EAEAP,EAAG,GAAG,IAAM,UAAY,CACvB,IAAI2B,EAAO/B,GAAQ,SAAS,EAC5B,OAAO+B,EAAK,OAAS,GAAKA,EAAK,CAAC,IAAM,EACnC,OAASA,EAAK,CAAC,EAAI,KAAOA,EAAK,CAAC,EAAI,MAAQA,EAAK,CAAC,EAAI,KACtD,QAAUA,EAAK,CAAC,EAAI,KAAOA,EAAK,CAAC,EAAI,MAAQA,EAAK,CAAC,EAAI,MAAQA,EAAK,CAAC,EAAI,GAC7E,EAIA3B,EAAG,GAAG,IAAM,UAAY,CACvB,IAAI4B,EAAOhC,GAAQ,SAAS,EAExBiC,EAAI,GACR,OAAID,EAAK,QAAU,GAAKA,EAAK,CAAC,IAAM,IACnCC,EAAI,KAAOD,EAAK,CAAC,GAGX,OAASA,EAAK,CAAC,EAAI,KAAOA,EAAK,CAAC,EAAI,MAAQA,EAAK,CAAC,EAAI,IAAMC,EAAI,GACxE,EAEA7B,EAAG,GAAG,QAAU,SAAUU,EAAK,CAC9B,OAAOZ,GAAaY,EAAI,MAAM,EAAG,CAAC,CAAC,CACpC,EAGA,SAASK,EAAMe,EAAKC,EAAKC,EAAK,CAC7B,OAAO,KAAK,IAAI,KAAK,IAAID,EAAKD,CAAG,EAAGE,CAAG,CACxC,CAEA,SAASR,GAAUM,EAAK,CACvB,IAAIG,EAAM,KAAK,MAAMH,CAAG,EAAE,SAAS,EAAE,EAAE,YAAY,EACnD,OAAQG,EAAI,OAAS,EAAK,IAAMA,EAAMA,CACvC,ICjPA,IAAAC,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAIC,GAAkB,GAClBC,GAAmB,GACnBC,GAAc,GACdC,GAAc,GACdC,GAAY,GACZC,EAAQ,GACRC,GAAQ,GACRC,GAAQ,GACRC,GAAO,GACPC,GAAS,IACTC,GAAS,GACTC,GAAO,GACPC,GAAiB,iBAErBb,GAAO,QAAU,SAASc,EAAO,CAuB/B,QAtBIC,EAAS,CAAC,EACVC,EAAQF,EAERG,EACFC,EACAC,EACAC,EACAC,EACAC,EACAC,EACAC,EACEC,EAAM,EACNC,EAAOV,EAAM,WAAWS,CAAG,EAC3BE,EAAMX,EAAM,OACZY,EAAQ,CAAC,CAAE,MAAOb,CAAO,CAAC,EAC1Bc,EAAW,EACXC,EAEAC,EAAO,GACPC,EAAS,GACTC,EAAQ,GAELR,EAAME,GAEX,GAAID,GAAQ,GAAI,CACdT,EAAOQ,EACP,GACER,GAAQ,EACRS,EAAOV,EAAM,WAAWC,CAAI,QACrBS,GAAQ,IACjBN,EAAQJ,EAAM,MAAMS,EAAKR,CAAI,EAE7BE,EAAOJ,EAAOA,EAAO,OAAS,CAAC,EAC3BW,IAASxB,IAAoB2B,EAC/BI,EAAQb,EACCD,GAAQA,EAAK,OAAS,OAC/BA,EAAK,MAAQC,EACbD,EAAK,gBAAkBC,EAAM,QAE7BM,IAASnB,IACTmB,IAASlB,IACRkB,IAASpB,GACRU,EAAM,WAAWC,EAAO,CAAC,IAAMR,KAC9B,CAACqB,GACCA,GAAUA,EAAO,OAAS,YAAcA,EAAO,QAAU,QAE9DE,EAASZ,EAETL,EAAO,KAAK,CACV,KAAM,QACN,YAAaU,EACb,eAAgBR,EAChB,MAAOG,CACT,CAAC,EAGHK,EAAMR,CAGR,SAAWS,IAASvB,IAAeuB,IAAStB,GAAa,CACvDa,EAAOQ,EACPP,EAAQQ,IAASvB,GAAc,IAAM,IACrCiB,EAAQ,CACN,KAAM,SACN,YAAaK,EACb,MAAOP,CACT,EACA,EAGE,IAFAG,EAAS,GACTJ,EAAOD,EAAM,QAAQE,EAAOD,EAAO,CAAC,EAChC,CAACA,EAEH,IADAK,EAAYL,EACLD,EAAM,WAAWM,EAAY,CAAC,IAAMjB,IACzCiB,GAAa,EACbD,EAAS,CAACA,OAGZL,GAASE,EACTD,EAAOD,EAAM,OAAS,EACtBI,EAAM,SAAW,SAEZC,GACTD,EAAM,MAAQJ,EAAM,MAAMS,EAAM,EAAGR,CAAI,EACvCG,EAAM,eAAiBA,EAAM,SAAWH,EAAOA,EAAO,EACtDF,EAAO,KAAKK,CAAK,EACjBK,EAAMR,EAAO,EACbS,EAAOV,EAAM,WAAWS,CAAG,CAG7B,SAAWC,IAASpB,GAASU,EAAM,WAAWS,EAAM,CAAC,IAAMhB,GACzDQ,EAAOD,EAAM,QAAQ,KAAMS,CAAG,EAE9BL,EAAQ,CACN,KAAM,UACN,YAAaK,EACb,eAAgBR,EAAO,CACzB,EAEIA,IAAS,KACXG,EAAM,SAAW,GACjBH,EAAOD,EAAM,OACbI,EAAM,eAAiBH,GAGzBG,EAAM,MAAQJ,EAAM,MAAMS,EAAM,EAAGR,CAAI,EACvCF,EAAO,KAAKK,CAAK,EAEjBK,EAAMR,EAAO,EACbS,EAAOV,EAAM,WAAWS,CAAG,WAI1BC,IAASpB,GAASoB,IAASjB,KAC5BqB,GACAA,EAAO,OAAS,YAChBA,EAAO,QAAU,OAEjBV,EAAQJ,EAAMS,CAAG,EACjBV,EAAO,KAAK,CACV,KAAM,OACN,YAAaU,EAAMO,EAAO,OAC1B,eAAgBP,EAAML,EAAM,OAC5B,MAAOA,CACT,CAAC,EACDK,GAAO,EACPC,EAAOV,EAAM,WAAWS,CAAG,UAGlBC,IAASpB,GAASoB,IAASnB,IAASmB,IAASlB,GACtDY,EAAQJ,EAAMS,CAAG,EAEjBV,EAAO,KAAK,CACV,KAAM,MACN,YAAaU,EAAMO,EAAO,OAC1B,eAAgBP,EAAML,EAAM,OAC5B,MAAOA,EACP,OAAQY,EACR,MAAO,EACT,CAAC,EACDA,EAAS,GAETP,GAAO,EACPC,EAAOV,EAAM,WAAWS,CAAG,UAGlBxB,KAAoByB,EAAM,CAEnCT,EAAOQ,EACP,GACER,GAAQ,EACRS,EAAOV,EAAM,WAAWC,CAAI,QACrBS,GAAQ,IAUjB,GATAF,EAAqBC,EACrBL,EAAQ,CACN,KAAM,WACN,YAAaK,EAAMM,EAAK,OACxB,MAAOA,EACP,OAAQf,EAAM,MAAMQ,EAAqB,EAAGP,CAAI,CAClD,EACAQ,EAAMR,EAEFc,IAAS,OAASL,IAASvB,IAAeuB,IAAStB,GAAa,CAClEa,GAAQ,EACR,EAGE,IAFAI,EAAS,GACTJ,EAAOD,EAAM,QAAQ,IAAKC,EAAO,CAAC,EAC9B,CAACA,EAEH,IADAK,EAAYL,EACLD,EAAM,WAAWM,EAAY,CAAC,IAAMjB,IACzCiB,GAAa,EACbD,EAAS,CAACA,OAGZL,GAAS,IACTC,EAAOD,EAAM,OAAS,EACtBI,EAAM,SAAW,SAEZC,GAETE,EAAgBN,EAChB,GACEM,GAAiB,EACjBG,EAAOV,EAAM,WAAWO,CAAa,QAC9BG,GAAQ,IACbF,EAAqBD,GACnBE,IAAQF,EAAgB,EAC1BH,EAAM,MAAQ,CACZ,CACE,KAAM,OACN,YAAaK,EACb,eAAgBF,EAAgB,EAChC,MAAOP,EAAM,MAAMS,EAAKF,EAAgB,CAAC,CAC3C,CACF,EAEAH,EAAM,MAAQ,CAAC,EAEbA,EAAM,UAAYG,EAAgB,IAAMN,GAC1CG,EAAM,MAAQ,GACdA,EAAM,MAAM,KAAK,CACf,KAAM,QACN,YAAaG,EAAgB,EAC7B,eAAgBN,EAChB,MAAOD,EAAM,MAAMO,EAAgB,EAAGN,CAAI,CAC5C,CAAC,IAEDG,EAAM,MAAQJ,EAAM,MAAMO,EAAgB,EAAGN,CAAI,EACjDG,EAAM,eAAiBH,KAGzBG,EAAM,MAAQ,GACdA,EAAM,MAAQ,CAAC,GAEjBK,EAAMR,EAAO,EACbG,EAAM,eAAiBA,EAAM,SAAWH,EAAOQ,EAC/CC,EAAOV,EAAM,WAAWS,CAAG,EAC3BV,EAAO,KAAKK,CAAK,CACnB,MACES,GAAY,EACZT,EAAM,MAAQ,GACdA,EAAM,eAAiBK,EAAM,EAC7BV,EAAO,KAAKK,CAAK,EACjBQ,EAAM,KAAKR,CAAK,EAChBL,EAASK,EAAM,MAAQ,CAAC,EACxBU,EAASV,EAEXW,EAAO,EAGT,SAAW7B,KAAqBwB,GAAQG,EACtCJ,GAAO,EACPC,EAAOV,EAAM,WAAWS,CAAG,EAE3BK,EAAO,MAAQG,EACfH,EAAO,gBAAkBG,EAAM,OAC/BA,EAAQ,GACRJ,GAAY,EACZD,EAAMA,EAAM,OAAS,CAAC,EAAE,eAAiBH,EACzCG,EAAM,IAAI,EACVE,EAASF,EAAMC,CAAQ,EACvBd,EAASe,EAAO,UAGX,CACLb,EAAOQ,EACP,GACMC,IAASrB,KACXY,GAAQ,GAEVA,GAAQ,EACRS,EAAOV,EAAM,WAAWC,CAAI,QAE5BA,EAAOU,GACP,EACED,GAAQ,IACRA,IAASvB,IACTuB,IAAStB,IACTsB,IAASnB,IACTmB,IAASlB,IACTkB,IAASpB,GACToB,IAASzB,IACRyB,IAASjB,IACRqB,GACAA,EAAO,OAAS,YAChBA,EAAO,QAAU,QAClBJ,IAASpB,GACRwB,EAAO,OAAS,YAChBA,EAAO,QAAU,QAClBJ,IAASxB,IAAoB2B,IAGlCT,EAAQJ,EAAM,MAAMS,EAAKR,CAAI,EAEzBhB,KAAoByB,EACtBK,EAAOX,GAENV,KAAWU,EAAM,WAAW,CAAC,GAAKT,KAAWS,EAAM,WAAW,CAAC,IAChER,KAASQ,EAAM,WAAW,CAAC,GAC3BP,GAAe,KAAKO,EAAM,MAAM,CAAC,CAAC,EAElCL,EAAO,KAAK,CACV,KAAM,gBACN,YAAaU,EACb,eAAgBR,EAChB,MAAOG,CACT,CAAC,EAEDL,EAAO,KAAK,CACV,KAAM,OACN,YAAaU,EACb,eAAgBR,EAChB,MAAOG,CACT,CAAC,EAGHK,EAAMR,CACR,CAGF,IAAKQ,EAAMG,EAAM,OAAS,EAAGH,EAAKA,GAAO,EACvCG,EAAMH,CAAG,EAAE,SAAW,GACtBG,EAAMH,CAAG,EAAE,eAAiBT,EAAM,OAGpC,OAAOY,EAAM,CAAC,EAAE,KAClB,IChUA,IAAAM,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAIC,GAAQ,GACRC,GAAO,GACPC,GAAM,GACNC,GAAM,IACNC,GAAM,GAIV,SAASC,GAAWC,EAAO,CACzB,IAAIC,EAAOD,EAAM,WAAW,CAAC,EACzBE,EAEJ,GAAID,IAASN,IAAQM,IAASP,GAAO,CAGnC,GAFAQ,EAAWF,EAAM,WAAW,CAAC,EAEzBE,GAAY,IAAMA,GAAY,GAChC,MAAO,GAGT,IAAIC,EAAeH,EAAM,WAAW,CAAC,EAErC,OAAIE,IAAaN,IAAOO,GAAgB,IAAMA,GAAgB,EAKhE,CAEA,OAAIF,IAASL,IACXM,EAAWF,EAAM,WAAW,CAAC,EAEzBE,GAAY,IAAMA,GAAY,IAOhCD,GAAQ,IAAMA,GAAQ,EAK5B,CAIAR,GAAO,QAAU,SAASO,EAAO,CAC/B,IAAII,EAAM,EACNC,EAASL,EAAM,OACfC,EACAC,EACAC,EAEJ,GAAIE,IAAW,GAAK,CAACN,GAAWC,CAAK,EACnC,MAAO,GAST,IANAC,EAAOD,EAAM,WAAWI,CAAG,GAEvBH,IAASN,IAAQM,IAASP,KAC5BU,IAGKA,EAAMC,IACXJ,EAAOD,EAAM,WAAWI,CAAG,EAEvB,EAAAH,EAAO,IAAMA,EAAO,MAIxBG,GAAO,EAMT,GAHAH,EAAOD,EAAM,WAAWI,CAAG,EAC3BF,EAAWF,EAAM,WAAWI,EAAM,CAAC,EAE/BH,IAASL,IAAOM,GAAY,IAAMA,GAAY,GAGhD,IAFAE,GAAO,EAEAA,EAAMC,IACXJ,EAAOD,EAAM,WAAWI,CAAG,EAEvB,EAAAH,EAAO,IAAMA,EAAO,MAIxBG,GAAO,EAQX,GAJAH,EAAOD,EAAM,WAAWI,CAAG,EAC3BF,EAAWF,EAAM,WAAWI,EAAM,CAAC,EACnCD,EAAeH,EAAM,WAAWI,EAAM,CAAC,GAGpCH,IAASJ,IAAOI,IAASH,MACxBI,GAAY,IAAMA,GAAY,KAC5BA,IAAaP,IAAQO,IAAaR,KAClCS,GAAgB,IAChBA,GAAgB,IAIpB,IAFAC,GAAOF,IAAaP,IAAQO,IAAaR,GAAQ,EAAI,EAE9CU,EAAMC,IACXJ,EAAOD,EAAM,WAAWI,CAAG,EAEvB,EAAAH,EAAO,IAAMA,EAAO,MAIxBG,GAAO,EAIX,MAAO,CACL,OAAQJ,EAAM,MAAM,EAAGI,CAAG,EAC1B,KAAMJ,EAAM,MAAMI,CAAG,CACvB,CACF,ICvHA,IAAAE,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CAIAA,GAAO,QAAU,UAAY,CAC3B,OAAO,OAAO,SAAY,YAAc,QAAQ,WAAa,QAAQ,UAAU,IACjF,ICNA,IAAAC,EAAAC,EAAAC,GAAA,KAAIC,GACEC,GAAkB,CACtB,EACA,GAAI,GAAI,GAAI,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAC1C,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,KAC7C,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KACtD,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,IACxD,EAQAF,EAAQ,cAAgB,SAAwBG,EAAS,CACvD,GAAI,CAACA,EAAS,MAAM,IAAI,MAAM,uCAAuC,EACrE,GAAIA,EAAU,GAAKA,EAAU,GAAI,MAAM,IAAI,MAAM,2CAA2C,EAC5F,OAAOA,EAAU,EAAI,EACvB,EAQAH,EAAQ,wBAA0B,SAAkCG,EAAS,CAC3E,OAAOD,GAAgBC,CAAO,CAChC,EAQAH,EAAQ,YAAc,SAAUI,EAAM,CACpC,IAAIC,EAAQ,EAEZ,KAAOD,IAAS,GACdC,IACAD,KAAU,EAGZ,OAAOC,CACT,EAEAL,EAAQ,kBAAoB,SAA4BM,EAAG,CACzD,GAAI,OAAOA,GAAM,WACf,MAAM,IAAI,MAAM,uCAAuC,EAGzDL,GAAiBK,CACnB,EAEAN,EAAQ,mBAAqB,UAAY,CACvC,OAAO,OAAOC,GAAmB,GACnC,EAEAD,EAAQ,OAAS,SAAiBO,EAAO,CACvC,OAAON,GAAeM,CAAK,CAC7B,IC9DA,IAAAC,GAAAC,EAAAC,GAAA,CAAAA,EAAQ,EAAI,CAAE,IAAK,CAAE,EACrBA,EAAQ,EAAI,CAAE,IAAK,CAAE,EACrBA,EAAQ,EAAI,CAAE,IAAK,CAAE,EACrBA,EAAQ,EAAI,CAAE,IAAK,CAAE,EAErB,SAASC,GAAYC,EAAQ,CAC3B,GAAI,OAAOA,GAAW,SACpB,MAAM,IAAI,MAAM,uBAAuB,EAKzC,OAFcA,EAAO,YAAY,EAElB,CACb,IAAK,IACL,IAAK,MACH,OAAOF,EAAQ,EAEjB,IAAK,IACL,IAAK,SACH,OAAOA,EAAQ,EAEjB,IAAK,IACL,IAAK,WACH,OAAOA,EAAQ,EAEjB,IAAK,IACL,IAAK,OACH,OAAOA,EAAQ,EAEjB,QACE,MAAM,IAAI,MAAM,qBAAuBE,CAAM,CACjD,CACF,CAEAF,EAAQ,QAAU,SAAkBG,EAAO,CACzC,OAAOA,GAAS,OAAOA,EAAM,IAAQ,KACnCA,EAAM,KAAO,GAAKA,EAAM,IAAM,CAClC,EAEAH,EAAQ,KAAO,SAAeI,EAAOC,EAAc,CACjD,GAAIL,EAAQ,QAAQI,CAAK,EACvB,OAAOA,EAGT,GAAI,CACF,OAAOH,GAAWG,CAAK,CACzB,MAAY,CACV,OAAOC,CACT,CACF,ICjDA,IAAAC,GAAAC,EAAA,CAAAC,GAAAC,KAAA,UAASC,IAAa,CACpB,KAAK,OAAS,CAAC,EACf,KAAK,OAAS,CAChB,CAEAA,GAAU,UAAY,CAEpB,IAAK,SAAUC,EAAO,CACpB,IAAMC,EAAW,KAAK,MAAMD,EAAQ,CAAC,EACrC,OAAS,KAAK,OAAOC,CAAQ,IAAO,EAAID,EAAQ,EAAM,KAAO,CAC/D,EAEA,IAAK,SAAUE,EAAKC,EAAQ,CAC1B,QAASC,EAAI,EAAGA,EAAID,EAAQC,IAC1B,KAAK,QAASF,IAASC,EAASC,EAAI,EAAM,KAAO,CAAC,CAEtD,EAEA,gBAAiB,UAAY,CAC3B,OAAO,KAAK,MACd,EAEA,OAAQ,SAAUC,EAAK,CACrB,IAAMJ,EAAW,KAAK,MAAM,KAAK,OAAS,CAAC,EACvC,KAAK,OAAO,QAAUA,GACxB,KAAK,OAAO,KAAK,CAAC,EAGhBI,IACF,KAAK,OAAOJ,CAAQ,GAAM,MAAU,KAAK,OAAS,GAGpD,KAAK,QACP,CACF,EAEAH,GAAO,QAAUC,KCpCjB,IAAAO,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CAKA,SAASC,GAAWC,EAAM,CACxB,GAAI,CAACA,GAAQA,EAAO,EAClB,MAAM,IAAI,MAAM,mDAAmD,EAGrE,KAAK,KAAOA,EACZ,KAAK,KAAO,IAAI,WAAWA,EAAOA,CAAI,EACtC,KAAK,YAAc,IAAI,WAAWA,EAAOA,CAAI,CAC/C,CAWAD,GAAU,UAAU,IAAM,SAAUE,EAAKC,EAAKC,EAAOC,EAAU,CAC7D,IAAMC,EAAQJ,EAAM,KAAK,KAAOC,EAChC,KAAK,KAAKG,CAAK,EAAIF,EACfC,IAAU,KAAK,YAAYC,CAAK,EAAI,GAC1C,EASAN,GAAU,UAAU,IAAM,SAAUE,EAAKC,EAAK,CAC5C,OAAO,KAAK,KAAKD,EAAM,KAAK,KAAOC,CAAG,CACxC,EAUAH,GAAU,UAAU,IAAM,SAAUE,EAAKC,EAAKC,EAAO,CACnD,KAAK,KAAKF,EAAM,KAAK,KAAOC,CAAG,GAAKC,CACtC,EASAJ,GAAU,UAAU,WAAa,SAAUE,EAAKC,EAAK,CACnD,OAAO,KAAK,YAAYD,EAAM,KAAK,KAAOC,CAAG,CAC/C,EAEAJ,GAAO,QAAUC,KChEjB,IAAAO,GAAAC,EAAAC,IAAA,CAUA,IAAMC,GAAgB,IAAmB,cAgBzCD,GAAQ,gBAAkB,SAA0BE,EAAS,CAC3D,GAAIA,IAAY,EAAG,MAAO,CAAC,EAE3B,IAAMC,EAAW,KAAK,MAAMD,EAAU,CAAC,EAAI,EACrCE,EAAOH,GAAcC,CAAO,EAC5BG,EAAYD,IAAS,IAAM,GAAK,KAAK,MAAMA,EAAO,KAAO,EAAID,EAAW,EAAE,EAAI,EAC9EG,EAAY,CAACF,EAAO,CAAC,EAE3B,QAASG,EAAI,EAAGA,EAAIJ,EAAW,EAAGI,IAChCD,EAAUC,CAAC,EAAID,EAAUC,EAAI,CAAC,EAAIF,EAGpC,OAAAC,EAAU,KAAK,CAAC,EAETA,EAAU,QAAQ,CAC3B,EAsBAN,GAAQ,aAAe,SAAuBE,EAAS,CACrD,IAAMM,EAAS,CAAC,EACVC,EAAMT,GAAQ,gBAAgBE,CAAO,EACrCQ,EAAYD,EAAI,OAEtB,QAAS,EAAI,EAAG,EAAIC,EAAW,IAC7B,QAASC,EAAI,EAAGA,EAAID,EAAWC,IAExB,IAAM,GAAKA,IAAM,GACjB,IAAM,GAAKA,IAAMD,EAAY,GAC7B,IAAMA,EAAY,GAAKC,IAAM,GAIlCH,EAAO,KAAK,CAACC,EAAI,CAAC,EAAGA,EAAIE,CAAC,CAAC,CAAC,EAIhC,OAAOH,CACT,IClFA,IAAAI,GAAAC,EAAAC,IAAA,KAAMC,GAAgB,IAAmB,cACnCC,GAAsB,EAS5BF,GAAQ,aAAe,SAAuBG,EAAS,CACrD,IAAMC,EAAOH,GAAcE,CAAO,EAElC,MAAO,CAEL,CAAC,EAAG,CAAC,EAEL,CAACC,EAAOF,GAAqB,CAAC,EAE9B,CAAC,EAAGE,EAAOF,EAAmB,CAChC,CACF,ICrBA,IAAAG,GAAAC,EAAAC,GAAA,CAIAA,EAAQ,SAAW,CACjB,WAAY,EACZ,WAAY,EACZ,WAAY,EACZ,WAAY,EACZ,WAAY,EACZ,WAAY,EACZ,WAAY,EACZ,WAAY,CACd,EAMA,IAAMC,EAAgB,CACpB,GAAI,EACJ,GAAI,EACJ,GAAI,GACJ,GAAI,EACN,EAQAD,EAAQ,QAAU,SAAkBE,EAAM,CACxC,OAAOA,GAAQ,MAAQA,IAAS,IAAM,CAAC,MAAMA,CAAI,GAAKA,GAAQ,GAAKA,GAAQ,CAC7E,EASAF,EAAQ,KAAO,SAAeG,EAAO,CACnC,OAAOH,EAAQ,QAAQG,CAAK,EAAI,SAASA,EAAO,EAAE,EAAI,MACxD,EASAH,EAAQ,aAAe,SAAuBI,EAAM,CAClD,IAAMC,EAAOD,EAAK,KACdE,EAAS,EACTC,EAAe,EACfC,EAAe,EACfC,EAAU,KACVC,EAAU,KAEd,QAASC,EAAM,EAAGA,EAAMN,EAAMM,IAAO,CACnCJ,EAAeC,EAAe,EAC9BC,EAAUC,EAAU,KAEpB,QAASE,EAAM,EAAGA,EAAMP,EAAMO,IAAO,CACnC,IAAIC,EAAST,EAAK,IAAIO,EAAKC,CAAG,EAC1BC,IAAWJ,EACbF,KAEIA,GAAgB,IAAGD,GAAUL,EAAc,IAAMM,EAAe,IACpEE,EAAUI,EACVN,EAAe,GAGjBM,EAAST,EAAK,IAAIQ,EAAKD,CAAG,EACtBE,IAAWH,EACbF,KAEIA,GAAgB,IAAGF,GAAUL,EAAc,IAAMO,EAAe,IACpEE,EAAUG,EACVL,EAAe,EAEnB,CAEID,GAAgB,IAAGD,GAAUL,EAAc,IAAMM,EAAe,IAChEC,GAAgB,IAAGF,GAAUL,EAAc,IAAMO,EAAe,GACtE,CAEA,OAAOF,CACT,EAOAN,EAAQ,aAAe,SAAuBI,EAAM,CAClD,IAAMC,EAAOD,EAAK,KACdE,EAAS,EAEb,QAASK,EAAM,EAAGA,EAAMN,EAAO,EAAGM,IAChC,QAASC,EAAM,EAAGA,EAAMP,EAAO,EAAGO,IAAO,CACvC,IAAME,EAAOV,EAAK,IAAIO,EAAKC,CAAG,EAC5BR,EAAK,IAAIO,EAAKC,EAAM,CAAC,EACrBR,EAAK,IAAIO,EAAM,EAAGC,CAAG,EACrBR,EAAK,IAAIO,EAAM,EAAGC,EAAM,CAAC,GAEvBE,IAAS,GAAKA,IAAS,IAAGR,GAChC,CAGF,OAAOA,EAASL,EAAc,EAChC,EAQAD,EAAQ,aAAe,SAAuBI,EAAM,CAClD,IAAMC,EAAOD,EAAK,KACdE,EAAS,EACTS,EAAU,EACVC,EAAU,EAEd,QAASL,EAAM,EAAGA,EAAMN,EAAMM,IAAO,CACnCI,EAAUC,EAAU,EACpB,QAASJ,EAAM,EAAGA,EAAMP,EAAMO,IAC5BG,EAAYA,GAAW,EAAK,KAASX,EAAK,IAAIO,EAAKC,CAAG,EAClDA,GAAO,KAAOG,IAAY,MAASA,IAAY,KAAQT,IAE3DU,EAAYA,GAAW,EAAK,KAASZ,EAAK,IAAIQ,EAAKD,CAAG,EAClDC,GAAO,KAAOI,IAAY,MAASA,IAAY,KAAQV,GAE/D,CAEA,OAAOA,EAASL,EAAc,EAChC,EAUAD,EAAQ,aAAe,SAAuBI,EAAM,CAClD,IAAIa,EAAY,EACVC,EAAed,EAAK,KAAK,OAE/B,QAAS,EAAI,EAAG,EAAIc,EAAc,IAAKD,GAAab,EAAK,KAAK,CAAC,EAI/D,OAFU,KAAK,IAAI,KAAK,KAAMa,EAAY,IAAMC,EAAgB,CAAC,EAAI,EAAE,EAE5DjB,EAAc,EAC3B,EAUA,SAASkB,GAAWC,EAAaC,EAAGC,EAAG,CACrC,OAAQF,EAAa,CACnB,KAAKpB,EAAQ,SAAS,WAAY,OAAQqB,EAAIC,GAAK,IAAM,EACzD,KAAKtB,EAAQ,SAAS,WAAY,OAAOqB,EAAI,IAAM,EACnD,KAAKrB,EAAQ,SAAS,WAAY,OAAOsB,EAAI,IAAM,EACnD,KAAKtB,EAAQ,SAAS,WAAY,OAAQqB,EAAIC,GAAK,IAAM,EACzD,KAAKtB,EAAQ,SAAS,WAAY,OAAQ,KAAK,MAAMqB,EAAI,CAAC,EAAI,KAAK,MAAMC,EAAI,CAAC,GAAK,IAAM,EACzF,KAAKtB,EAAQ,SAAS,WAAY,OAAQqB,EAAIC,EAAK,EAAKD,EAAIC,EAAK,IAAM,EACvE,KAAKtB,EAAQ,SAAS,WAAY,OAASqB,EAAIC,EAAK,EAAKD,EAAIC,EAAK,GAAK,IAAM,EAC7E,KAAKtB,EAAQ,SAAS,WAAY,OAASqB,EAAIC,EAAK,GAAKD,EAAIC,GAAK,GAAK,IAAM,EAE7E,QAAS,MAAM,IAAI,MAAM,mBAAqBF,CAAW,CAC3D,CACF,CAQApB,EAAQ,UAAY,SAAoBuB,EAASnB,EAAM,CACrD,IAAMC,EAAOD,EAAK,KAElB,QAASQ,EAAM,EAAGA,EAAMP,EAAMO,IAC5B,QAASD,EAAM,EAAGA,EAAMN,EAAMM,IACxBP,EAAK,WAAWO,EAAKC,CAAG,GAC5BR,EAAK,IAAIO,EAAKC,EAAKO,GAAUI,EAASZ,EAAKC,CAAG,CAAC,CAGrD,EAQAZ,EAAQ,YAAc,SAAsBI,EAAMoB,EAAiB,CACjE,IAAMC,EAAc,OAAO,KAAKzB,EAAQ,QAAQ,EAAE,OAC9C0B,EAAc,EACdC,EAAe,IAEnB,QAASC,EAAI,EAAGA,EAAIH,EAAaG,IAAK,CACpCJ,EAAgBI,CAAC,EACjB5B,EAAQ,UAAU4B,EAAGxB,CAAI,EAGzB,IAAMyB,EACJ7B,EAAQ,aAAaI,CAAI,EACzBJ,EAAQ,aAAaI,CAAI,EACzBJ,EAAQ,aAAaI,CAAI,EACzBJ,EAAQ,aAAaI,CAAI,EAG3BJ,EAAQ,UAAU4B,EAAGxB,CAAI,EAErByB,EAAUF,IACZA,EAAeE,EACfH,EAAcE,EAElB,CAEA,OAAOF,CACT,ICzOA,IAAAI,GAAAC,EAAAC,IAAA,KAAMC,EAAU,KAEVC,GAAkB,CAEtB,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,GACT,EAAG,EAAG,GAAI,GACV,EAAG,EAAG,GAAI,GACV,EAAG,EAAG,GAAI,GACV,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,EACd,EAEMC,GAAqB,CAEzB,EAAG,GAAI,GAAI,GACX,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,IACZ,GAAI,GAAI,IAAK,IACb,GAAI,GAAI,IAAK,IACb,GAAI,IAAK,IAAK,IACd,GAAI,IAAK,IAAK,IACd,GAAI,IAAK,IAAK,IACd,GAAI,IAAK,IAAK,IACd,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,KACf,IAAK,IAAK,IAAK,KACf,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,IACnB,EAUAH,GAAQ,eAAiB,SAAyBI,EAASC,EAAsB,CAC/E,OAAQA,EAAsB,CAC5B,KAAKJ,EAAQ,EACX,OAAOC,IAAiBE,EAAU,GAAK,EAAI,CAAC,EAC9C,KAAKH,EAAQ,EACX,OAAOC,IAAiBE,EAAU,GAAK,EAAI,CAAC,EAC9C,KAAKH,EAAQ,EACX,OAAOC,IAAiBE,EAAU,GAAK,EAAI,CAAC,EAC9C,KAAKH,EAAQ,EACX,OAAOC,IAAiBE,EAAU,GAAK,EAAI,CAAC,EAC9C,QACE,MACJ,CACF,EAUAJ,GAAQ,uBAAyB,SAAiCI,EAASC,EAAsB,CAC/F,OAAQA,EAAsB,CAC5B,KAAKJ,EAAQ,EACX,OAAOE,IAAoBC,EAAU,GAAK,EAAI,CAAC,EACjD,KAAKH,EAAQ,EACX,OAAOE,IAAoBC,EAAU,GAAK,EAAI,CAAC,EACjD,KAAKH,EAAQ,EACX,OAAOE,IAAoBC,EAAU,GAAK,EAAI,CAAC,EACjD,KAAKH,EAAQ,EACX,OAAOE,IAAoBC,EAAU,GAAK,EAAI,CAAC,EACjD,QACE,MACJ,CACF,ICtIA,IAAAE,GAAAC,EAAAC,IAAA,KAAMC,GAAY,IAAI,WAAW,GAAG,EAC9BC,GAAY,IAAI,WAAW,GAAG,GASlC,UAAuB,CACvB,IAAIC,EAAI,EACR,QAASC,EAAI,EAAGA,EAAI,IAAKA,IACvBH,GAAUG,CAAC,EAAID,EACfD,GAAUC,CAAC,EAAIC,EAEfD,IAAM,EAIFA,EAAI,MACNA,GAAK,KAQT,QAASC,EAAI,IAAKA,EAAI,IAAKA,IACzBH,GAAUG,CAAC,EAAIH,GAAUG,EAAI,GAAG,CAEpC,GAAE,EAQFJ,GAAQ,IAAM,SAAcK,EAAG,CAC7B,GAAIA,EAAI,EAAG,MAAM,IAAI,MAAM,OAASA,EAAI,GAAG,EAC3C,OAAOH,GAAUG,CAAC,CACpB,EAQAL,GAAQ,IAAM,SAAcK,EAAG,CAC7B,OAAOJ,GAAUI,CAAC,CACpB,EASAL,GAAQ,IAAM,SAAcG,EAAGG,EAAG,CAChC,OAAIH,IAAM,GAAKG,IAAM,EAAU,EAIxBL,GAAUC,GAAUC,CAAC,EAAID,GAAUI,CAAC,CAAC,CAC9C,ICpEA,IAAAC,GAAAC,EAAAC,IAAA,KAAMC,GAAK,KASXD,GAAQ,IAAM,SAAcE,EAAIC,EAAI,CAClC,IAAMC,EAAQ,IAAI,WAAWF,EAAG,OAASC,EAAG,OAAS,CAAC,EAEtD,QAASE,EAAI,EAAGA,EAAIH,EAAG,OAAQG,IAC7B,QAASC,EAAI,EAAGA,EAAIH,EAAG,OAAQG,IAC7BF,EAAMC,EAAIC,CAAC,GAAKL,GAAG,IAAIC,EAAGG,CAAC,EAAGF,EAAGG,CAAC,CAAC,EAIvC,OAAOF,CACT,EASAJ,GAAQ,IAAM,SAAcO,EAAUC,EAAS,CAC7C,IAAIC,EAAS,IAAI,WAAWF,CAAQ,EAEpC,KAAQE,EAAO,OAASD,EAAQ,QAAW,GAAG,CAC5C,IAAMJ,EAAQK,EAAO,CAAC,EAEtB,QAASJ,EAAI,EAAGA,EAAIG,EAAQ,OAAQH,IAClCI,EAAOJ,CAAC,GAAKJ,GAAG,IAAIO,EAAQH,CAAC,EAAGD,CAAK,EAIvC,IAAIM,EAAS,EACb,KAAOA,EAASD,EAAO,QAAUA,EAAOC,CAAM,IAAM,GAAGA,IACvDD,EAASA,EAAO,MAAMC,CAAM,CAC9B,CAEA,OAAOD,CACT,EASAT,GAAQ,qBAAuB,SAA+BW,EAAQ,CACpE,IAAIC,EAAO,IAAI,WAAW,CAAC,CAAC,CAAC,EAC7B,QAASP,EAAI,EAAGA,EAAIM,EAAQN,IAC1BO,EAAOZ,GAAQ,IAAIY,EAAM,IAAI,WAAW,CAAC,EAAGX,GAAG,IAAII,CAAC,CAAC,CAAC,CAAC,EAGzD,OAAOO,CACT,IC7DA,IAAAC,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAMC,GAAa,KAEnB,SAASC,GAAoBC,EAAQ,CACnC,KAAK,QAAU,OACf,KAAK,OAASA,EAEV,KAAK,QAAQ,KAAK,WAAW,KAAK,MAAM,CAC9C,CAQAD,GAAmB,UAAU,WAAa,SAAqBC,EAAQ,CAErE,KAAK,OAASA,EACd,KAAK,QAAUF,GAAW,qBAAqB,KAAK,MAAM,CAC5D,EAQAC,GAAmB,UAAU,OAAS,SAAiBE,EAAM,CAC3D,GAAI,CAAC,KAAK,QACR,MAAM,IAAI,MAAM,yBAAyB,EAK3C,IAAMC,EAAa,IAAI,WAAWD,EAAK,OAAS,KAAK,MAAM,EAC3DC,EAAW,IAAID,CAAI,EAInB,IAAME,EAAYL,GAAW,IAAII,EAAY,KAAK,OAAO,EAKnDE,EAAQ,KAAK,OAASD,EAAU,OACtC,GAAIC,EAAQ,EAAG,CACb,IAAMC,EAAO,IAAI,WAAW,KAAK,MAAM,EACvC,OAAAA,EAAK,IAAIF,EAAWC,CAAK,EAElBC,CACT,CAEA,OAAOF,CACT,EAEAN,GAAO,QAAUE,KCvDjB,IAAAO,GAAAC,EAAAC,IAAA,CAMAA,GAAQ,QAAU,SAAkBC,EAAS,CAC3C,MAAO,CAAC,MAAMA,CAAO,GAAKA,GAAW,GAAKA,GAAW,EACvD,ICRA,IAAAC,GAAAC,EAAAC,GAAA,KAAMC,GAAU,SACVC,GAAe,oBACjBC,GAAQ,mNAIZA,GAAQA,GAAM,QAAQ,KAAM,KAAK,EAEjC,IAAMC,GAAO,6BAA+BD,GAAQ;AAAA,MAEpDH,EAAQ,MAAQ,IAAI,OAAOG,GAAO,GAAG,EACrCH,EAAQ,WAAa,IAAI,OAAO,wBAAyB,GAAG,EAC5DA,EAAQ,KAAO,IAAI,OAAOI,GAAM,GAAG,EACnCJ,EAAQ,QAAU,IAAI,OAAOC,GAAS,GAAG,EACzCD,EAAQ,aAAe,IAAI,OAAOE,GAAc,GAAG,EAEnD,IAAMG,GAAa,IAAI,OAAO,IAAMF,GAAQ,GAAG,EACzCG,GAAe,IAAI,OAAO,IAAML,GAAU,GAAG,EAC7CM,GAAoB,IAAI,OAAO,wBAAwB,EAE7DP,EAAQ,UAAY,SAAoBQ,EAAK,CAC3C,OAAOH,GAAW,KAAKG,CAAG,CAC5B,EAEAR,EAAQ,YAAc,SAAsBQ,EAAK,CAC/C,OAAOF,GAAa,KAAKE,CAAG,CAC9B,EAEAR,EAAQ,iBAAmB,SAA2BQ,EAAK,CACzD,OAAOD,GAAkB,KAAKC,CAAG,CACnC,IC9BA,IAAAC,EAAAC,EAAAC,GAAA,KAAMC,GAAe,KACfC,GAAQ,KASdF,EAAQ,QAAU,CAChB,GAAI,UACJ,IAAK,EACL,OAAQ,CAAC,GAAI,GAAI,EAAE,CACrB,EAWAA,EAAQ,aAAe,CACrB,GAAI,eACJ,IAAK,EACL,OAAQ,CAAC,EAAG,GAAI,EAAE,CACpB,EAOAA,EAAQ,KAAO,CACb,GAAI,OACJ,IAAK,EACL,OAAQ,CAAC,EAAG,GAAI,EAAE,CACpB,EAWAA,EAAQ,MAAQ,CACd,GAAI,QACJ,IAAK,EACL,OAAQ,CAAC,EAAG,GAAI,EAAE,CACpB,EAQAA,EAAQ,MAAQ,CACd,IAAK,EACP,EAUAA,EAAQ,sBAAwB,SAAgCG,EAAMC,EAAS,CAC7E,GAAI,CAACD,EAAK,OAAQ,MAAM,IAAI,MAAM,iBAAmBA,CAAI,EAEzD,GAAI,CAACF,GAAa,QAAQG,CAAO,EAC/B,MAAM,IAAI,MAAM,oBAAsBA,CAAO,EAG/C,OAAIA,GAAW,GAAKA,EAAU,GAAWD,EAAK,OAAO,CAAC,EAC7CC,EAAU,GAAWD,EAAK,OAAO,CAAC,EACpCA,EAAK,OAAO,CAAC,CACtB,EAQAH,EAAQ,mBAAqB,SAA6BK,EAAS,CACjE,OAAIH,GAAM,YAAYG,CAAO,EAAUL,EAAQ,QACtCE,GAAM,iBAAiBG,CAAO,EAAUL,EAAQ,aAChDE,GAAM,UAAUG,CAAO,EAAUL,EAAQ,MACtCA,EAAQ,IACtB,EAQAA,EAAQ,SAAW,SAAmBG,EAAM,CAC1C,GAAIA,GAAQA,EAAK,GAAI,OAAOA,EAAK,GACjC,MAAM,IAAI,MAAM,cAAc,CAChC,EAQAH,EAAQ,QAAU,SAAkBG,EAAM,CACxC,OAAOA,GAAQA,EAAK,KAAOA,EAAK,MAClC,EAQA,SAASG,GAAYC,EAAQ,CAC3B,GAAI,OAAOA,GAAW,SACpB,MAAM,IAAI,MAAM,uBAAuB,EAKzC,OAFcA,EAAO,YAAY,EAElB,CACb,IAAK,UACH,OAAOP,EAAQ,QACjB,IAAK,eACH,OAAOA,EAAQ,aACjB,IAAK,QACH,OAAOA,EAAQ,MACjB,IAAK,OACH,OAAOA,EAAQ,KACjB,QACE,MAAM,IAAI,MAAM,iBAAmBO,CAAM,CAC7C,CACF,CAUAP,EAAQ,KAAO,SAAeQ,EAAOC,EAAc,CACjD,GAAIT,EAAQ,QAAQQ,CAAK,EACvB,OAAOA,EAGT,GAAI,CACF,OAAOF,GAAWE,CAAK,CACzB,MAAY,CACV,OAAOC,CACT,CACF,ICtKA,IAAAC,GAAAC,EAAAC,GAAA,KAAMC,GAAQ,IACRC,GAAS,KACTC,GAAU,KACVC,EAAO,IACPC,GAAe,KAGfC,GAAO,KACPC,GAAUN,GAAM,YAAYK,EAAG,EAErC,SAASE,GAA6BC,EAAMC,EAAQC,EAAsB,CACxE,QAASC,EAAiB,EAAGA,GAAkB,GAAIA,IACjD,GAAIF,GAAUV,EAAQ,YAAYY,EAAgBD,EAAsBF,CAAI,EAC1E,OAAOG,CAKb,CAEA,SAASC,GAAsBJ,EAAMK,EAAS,CAE5C,OAAOV,EAAK,sBAAsBK,EAAMK,CAAO,EAAI,CACrD,CAEA,SAASC,GAA2BC,EAAUF,EAAS,CACrD,IAAIG,EAAY,EAEhB,OAAAD,EAAS,QAAQ,SAAUE,EAAM,CAC/B,IAAMC,EAAeN,GAAqBK,EAAK,KAAMJ,CAAO,EAC5DG,GAAaE,EAAeD,EAAK,cAAc,CACjD,CAAC,EAEMD,CACT,CAEA,SAASG,GAA4BJ,EAAUL,EAAsB,CACnE,QAASC,EAAiB,EAAGA,GAAkB,GAAIA,IAEjD,GADeG,GAA0BC,EAAUJ,CAAc,GACnDZ,EAAQ,YAAYY,EAAgBD,EAAsBP,EAAK,KAAK,EAChF,OAAOQ,CAKb,CAUAZ,EAAQ,KAAO,SAAeqB,EAAOC,EAAc,CACjD,OAAIjB,GAAa,QAAQgB,CAAK,EACrB,SAASA,EAAO,EAAE,EAGpBC,CACT,EAWAtB,EAAQ,YAAc,SAAsBc,EAASH,EAAsBF,EAAM,CAC/E,GAAI,CAACJ,GAAa,QAAQS,CAAO,EAC/B,MAAM,IAAI,MAAM,yBAAyB,EAIvC,OAAOL,EAAS,MAAaA,EAAOL,EAAK,MAG7C,IAAMmB,EAAiBtB,GAAM,wBAAwBa,CAAO,EAGtDU,EAAmBtB,GAAO,uBAAuBY,EAASH,CAAoB,EAG9Ec,GAA0BF,EAAiBC,GAAoB,EAErE,GAAIf,IAASL,EAAK,MAAO,OAAOqB,EAEhC,IAAMC,EAAaD,EAAyBZ,GAAqBJ,EAAMK,CAAO,EAG9E,OAAQL,EAAM,CACZ,KAAKL,EAAK,QACR,OAAO,KAAK,MAAOsB,EAAa,GAAM,CAAC,EAEzC,KAAKtB,EAAK,aACR,OAAO,KAAK,MAAOsB,EAAa,GAAM,CAAC,EAEzC,KAAKtB,EAAK,MACR,OAAO,KAAK,MAAMsB,EAAa,EAAE,EAEnC,KAAKtB,EAAK,KACV,QACE,OAAO,KAAK,MAAMsB,EAAa,CAAC,CACpC,CACF,EAUA1B,EAAQ,sBAAwB,SAAgCkB,EAAMP,EAAsB,CAC1F,IAAIgB,EAEEC,EAAMzB,GAAQ,KAAKQ,EAAsBR,GAAQ,CAAC,EAExD,GAAI,MAAM,QAAQe,CAAI,EAAG,CACvB,GAAIA,EAAK,OAAS,EAChB,OAAOE,GAA2BF,EAAMU,CAAG,EAG7C,GAAIV,EAAK,SAAW,EAClB,MAAO,GAGTS,EAAMT,EAAK,CAAC,CACd,MACES,EAAMT,EAGR,OAAOV,GAA4BmB,EAAI,KAAMA,EAAI,UAAU,EAAGC,CAAG,CACnE,EAYA5B,EAAQ,eAAiB,SAAyBc,EAAS,CACzD,GAAI,CAACT,GAAa,QAAQS,CAAO,GAAKA,EAAU,EAC9C,MAAM,IAAI,MAAM,yBAAyB,EAG3C,IAAIe,EAAIf,GAAW,GAEnB,KAAOb,GAAM,YAAY4B,CAAC,EAAItB,IAAW,GACvCsB,GAAMvB,IAAQL,GAAM,YAAY4B,CAAC,EAAItB,GAGvC,OAAQO,GAAW,GAAMe,CAC3B,IClKA,IAAAC,GAAAC,EAAAC,IAAA,KAAMC,GAAQ,IAERC,GAAO,KACPC,GAAY,MACZC,GAAUH,GAAM,YAAYC,EAAG,EAYrCF,GAAQ,eAAiB,SAAyBK,EAAsBC,EAAM,CAC5E,IAAMC,EAASF,EAAqB,KAAO,EAAKC,EAC5CE,EAAID,GAAQ,GAEhB,KAAON,GAAM,YAAYO,CAAC,EAAIJ,IAAW,GACvCI,GAAMN,IAAQD,GAAM,YAAYO,CAAC,EAAIJ,GAMvC,OAASG,GAAQ,GAAMC,GAAKL,EAC9B,IC5BA,IAAAM,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAMC,GAAO,IAEb,SAASC,EAAaC,EAAM,CAC1B,KAAK,KAAOF,GAAK,QACjB,KAAK,KAAOE,EAAK,SAAS,CAC5B,CAEAD,EAAY,cAAgB,SAAwBE,EAAQ,CAC1D,MAAO,IAAK,KAAK,MAAMA,EAAS,CAAC,GAAMA,EAAS,EAAOA,EAAS,EAAK,EAAI,EAAK,EAChF,EAEAF,EAAY,UAAU,UAAY,UAAsB,CACtD,OAAO,KAAK,KAAK,MACnB,EAEAA,EAAY,UAAU,cAAgB,UAA0B,CAC9D,OAAOA,EAAY,cAAc,KAAK,KAAK,MAAM,CACnD,EAEAA,EAAY,UAAU,MAAQ,SAAgBG,EAAW,CACvD,IAAIC,EAAGC,EAAOC,EAId,IAAKF,EAAI,EAAGA,EAAI,GAAK,KAAK,KAAK,OAAQA,GAAK,EAC1CC,EAAQ,KAAK,KAAK,OAAOD,EAAG,CAAC,EAC7BE,EAAQ,SAASD,EAAO,EAAE,EAE1BF,EAAU,IAAIG,EAAO,EAAE,EAKzB,IAAMC,EAAe,KAAK,KAAK,OAASH,EACpCG,EAAe,IACjBF,EAAQ,KAAK,KAAK,OAAOD,CAAC,EAC1BE,EAAQ,SAASD,EAAO,EAAE,EAE1BF,EAAU,IAAIG,EAAOC,EAAe,EAAI,CAAC,EAE7C,EAEAT,GAAO,QAAUE,IC1CjB,IAAAQ,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAMC,GAAO,IAWPC,GAAkB,CACtB,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAC7C,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAC5D,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAC5D,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAC1C,EAEA,SAASC,EAAkBC,EAAM,CAC/B,KAAK,KAAOH,GAAK,aACjB,KAAK,KAAOG,CACd,CAEAD,EAAiB,cAAgB,SAAwBE,EAAQ,CAC/D,MAAO,IAAK,KAAK,MAAMA,EAAS,CAAC,EAAI,GAAKA,EAAS,EACrD,EAEAF,EAAiB,UAAU,UAAY,UAAsB,CAC3D,OAAO,KAAK,KAAK,MACnB,EAEAA,EAAiB,UAAU,cAAgB,UAA0B,CACnE,OAAOA,EAAiB,cAAc,KAAK,KAAK,MAAM,CACxD,EAEAA,EAAiB,UAAU,MAAQ,SAAgBG,EAAW,CAC5D,IAAIC,EAIJ,IAAKA,EAAI,EAAGA,EAAI,GAAK,KAAK,KAAK,OAAQA,GAAK,EAAG,CAE7C,IAAIC,EAAQN,GAAgB,QAAQ,KAAK,KAAKK,CAAC,CAAC,EAAI,GAGpDC,GAASN,GAAgB,QAAQ,KAAK,KAAKK,EAAI,CAAC,CAAC,EAGjDD,EAAU,IAAIE,EAAO,EAAE,CACzB,CAII,KAAK,KAAK,OAAS,GACrBF,EAAU,IAAIJ,GAAgB,QAAQ,KAAK,KAAKK,CAAC,CAAC,EAAG,CAAC,CAE1D,EAEAP,GAAO,QAAUG,IC1DjB,IAAAM,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAMC,GAAO,IAEb,SAASC,GAAUC,EAAM,CACvB,KAAK,KAAOF,GAAK,KACb,OAAQE,GAAU,SACpB,KAAK,KAAO,IAAI,YAAY,EAAE,OAAOA,CAAI,EAEzC,KAAK,KAAO,IAAI,WAAWA,CAAI,CAEnC,CAEAD,GAAS,cAAgB,SAAwBE,EAAQ,CACvD,OAAOA,EAAS,CAClB,EAEAF,GAAS,UAAU,UAAY,UAAsB,CACnD,OAAO,KAAK,KAAK,MACnB,EAEAA,GAAS,UAAU,cAAgB,UAA0B,CAC3D,OAAOA,GAAS,cAAc,KAAK,KAAK,MAAM,CAChD,EAEAA,GAAS,UAAU,MAAQ,SAAUG,EAAW,CAC9C,QAASC,EAAI,EAAGC,EAAI,KAAK,KAAK,OAAQD,EAAIC,EAAGD,IAC3CD,EAAU,IAAI,KAAK,KAAKC,CAAC,EAAG,CAAC,CAEjC,EAEAN,GAAO,QAAUE,KC7BjB,IAAAM,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAMC,GAAO,IACPC,GAAQ,IAEd,SAASC,GAAWC,EAAM,CACxB,KAAK,KAAOH,GAAK,MACjB,KAAK,KAAOG,CACd,CAEAD,GAAU,cAAgB,SAAwBE,EAAQ,CACxD,OAAOA,EAAS,EAClB,EAEAF,GAAU,UAAU,UAAY,UAAsB,CACpD,OAAO,KAAK,KAAK,MACnB,EAEAA,GAAU,UAAU,cAAgB,UAA0B,CAC5D,OAAOA,GAAU,cAAc,KAAK,KAAK,MAAM,CACjD,EAEAA,GAAU,UAAU,MAAQ,SAAUG,EAAW,CAC/C,IAAIC,EAKJ,IAAKA,EAAI,EAAGA,EAAI,KAAK,KAAK,OAAQA,IAAK,CACrC,IAAIC,EAAQN,GAAM,OAAO,KAAK,KAAKK,CAAC,CAAC,EAGrC,GAAIC,GAAS,OAAUA,GAAS,MAE9BA,GAAS,cAGAA,GAAS,OAAUA,GAAS,MAErCA,GAAS,UAET,OAAM,IAAI,MACR,2BAA6B,KAAK,KAAKD,CAAC,EAAI;AAAA,gCACX,EAKrCC,GAAWA,IAAU,EAAK,KAAQ,KAASA,EAAQ,KAGnDF,EAAU,IAAIE,EAAO,EAAE,CACzB,CACF,EAEAR,GAAO,QAAUG,KCrDjB,IAAAM,GAAAC,EAAA,CAAAC,GAAAC,KAAA,cAuBA,IAAIC,GAAW,CACb,6BAA8B,SAASC,EAAOC,EAAGC,EAAG,CAGlD,IAAIC,EAAe,CAAC,EAIhBC,EAAQ,CAAC,EACbA,EAAMH,CAAC,EAAI,EAMX,IAAII,EAAON,GAAS,cAAc,KAAK,EACvCM,EAAK,KAAKJ,EAAG,CAAC,EAUd,QARIK,EACAC,EAAGC,EACHC,EACAC,EACAC,EACAC,EACAC,EACAC,EACG,CAACT,EAAK,MAAM,GAAG,CAGpBC,EAAUD,EAAK,IAAI,EACnBE,EAAID,EAAQ,MACZG,EAAiBH,EAAQ,KAGzBI,EAAiBV,EAAMO,CAAC,GAAK,CAAC,EAK9B,IAAKC,KAAKE,EACJA,EAAe,eAAeF,CAAC,IAEjCG,EAAYD,EAAeF,CAAC,EAK5BI,EAAgCH,EAAiBE,EAMjDE,EAAiBT,EAAMI,CAAC,EACxBM,EAAe,OAAOV,EAAMI,CAAC,EAAM,KAC/BM,GAAeD,EAAiBD,KAClCR,EAAMI,CAAC,EAAII,EACXP,EAAK,KAAKG,EAAGI,CAA6B,EAC1CT,EAAaK,CAAC,EAAID,GAI1B,CAEA,GAAI,OAAOL,EAAM,KAAe,OAAOE,EAAMF,CAAC,EAAM,IAAa,CAC/D,IAAIa,EAAM,CAAC,8BAA+Bd,EAAG,OAAQC,EAAG,GAAG,EAAE,KAAK,EAAE,EACpE,MAAM,IAAI,MAAMa,CAAG,CACrB,CAEA,OAAOZ,CACT,EAEA,4CAA6C,SAASA,EAAcD,EAAG,CAIrE,QAHIc,EAAQ,CAAC,EACTT,EAAIL,EACJe,EACGV,GACLS,EAAM,KAAKT,CAAC,EACZU,EAAcd,EAAaI,CAAC,EAC5BA,EAAIJ,EAAaI,CAAC,EAEpB,OAAAS,EAAM,QAAQ,EACPA,CACT,EAEA,UAAW,SAAShB,EAAOC,EAAGC,EAAG,CAC/B,IAAIC,EAAeJ,GAAS,6BAA6BC,EAAOC,EAAGC,CAAC,EACpE,OAAOH,GAAS,4CACdI,EAAcD,CAAC,CACnB,EAKA,cAAe,CACb,KAAM,SAAUgB,EAAM,CACpB,IAAIC,EAAIpB,GAAS,cACbqB,EAAI,CAAC,EACLC,EACJH,EAAOA,GAAQ,CAAC,EAChB,IAAKG,KAAOF,EACNA,EAAE,eAAeE,CAAG,IACtBD,EAAEC,CAAG,EAAIF,EAAEE,CAAG,GAGlB,OAAAD,EAAE,MAAQ,CAAC,EACXA,EAAE,OAASF,EAAK,QAAUC,EAAE,eACrBC,CACT,EAEA,eAAgB,SAAUE,EAAGC,EAAG,CAC9B,OAAOD,EAAE,KAAOC,EAAE,IACpB,EAMA,KAAM,SAAUC,EAAOC,EAAM,CAC3B,IAAIC,EAAO,CAAC,MAAOF,EAAO,KAAMC,CAAI,EACpC,KAAK,MAAM,KAAKC,CAAI,EACpB,KAAK,MAAM,KAAK,KAAK,MAAM,CAC7B,EAKA,IAAK,UAAY,CACf,OAAO,KAAK,MAAM,MAAM,CAC1B,EAEA,MAAO,UAAY,CACjB,OAAO,KAAK,MAAM,SAAW,CAC/B,CACF,CACF,EAII,OAAO5B,GAAW,MACpBA,GAAO,QAAUC,MCnKnB,IAAA4B,GAAAC,EAAAC,IAAA,KAAMC,EAAO,IACPC,GAAc,KACdC,GAAmB,KACnBC,GAAW,KACXC,GAAY,KACZC,GAAQ,KACRC,GAAQ,IACRC,GAAW,KAQjB,SAASC,GAAqBC,EAAK,CACjC,OAAO,SAAS,mBAAmBA,CAAG,CAAC,EAAE,MAC3C,CAUA,SAASC,GAAaC,EAAOC,EAAMH,EAAK,CACtC,IAAMI,EAAW,CAAC,EACdC,EAEJ,MAAQA,EAASH,EAAM,KAAKF,CAAG,KAAO,MACpCI,EAAS,KAAK,CACZ,KAAMC,EAAO,CAAC,EACd,MAAOA,EAAO,MACd,KAAMF,EACN,OAAQE,EAAO,CAAC,EAAE,MACpB,CAAC,EAGH,OAAOD,CACT,CASA,SAASE,GAAuBC,EAAS,CACvC,IAAMC,EAAUP,GAAYL,GAAM,QAASL,EAAK,QAASgB,CAAO,EAC1DE,EAAeR,GAAYL,GAAM,aAAcL,EAAK,aAAcgB,CAAO,EAC3EG,EACAC,EAEJ,OAAId,GAAM,mBAAmB,GAC3Ba,EAAWT,GAAYL,GAAM,KAAML,EAAK,KAAMgB,CAAO,EACrDI,EAAYV,GAAYL,GAAM,MAAOL,EAAK,MAAOgB,CAAO,IAExDG,EAAWT,GAAYL,GAAM,WAAYL,EAAK,KAAMgB,CAAO,EAC3DI,EAAY,CAAC,GAGFH,EAAQ,OAAOC,EAAcC,EAAUC,CAAS,EAG1D,KAAK,SAAUC,EAAIC,EAAI,CACtB,OAAOD,EAAG,MAAQC,EAAG,KACvB,CAAC,EACA,IAAI,SAAUC,EAAK,CAClB,MAAO,CACL,KAAMA,EAAI,KACV,KAAMA,EAAI,KACV,OAAQA,EAAI,MACd,CACF,CAAC,CACL,CAUA,SAASC,GAAsBC,EAAQb,EAAM,CAC3C,OAAQA,EAAM,CACZ,KAAKZ,EAAK,QACR,OAAOC,GAAY,cAAcwB,CAAM,EACzC,KAAKzB,EAAK,aACR,OAAOE,GAAiB,cAAcuB,CAAM,EAC9C,KAAKzB,EAAK,MACR,OAAOI,GAAU,cAAcqB,CAAM,EACvC,KAAKzB,EAAK,KACR,OAAOG,GAAS,cAAcsB,CAAM,CACxC,CACF,CAQA,SAASC,GAAeC,EAAM,CAC5B,OAAOA,EAAK,OAAO,SAAUC,EAAKC,EAAM,CACtC,IAAMC,EAAUF,EAAI,OAAS,GAAK,EAAIA,EAAIA,EAAI,OAAS,CAAC,EAAI,KAC5D,OAAIE,GAAWA,EAAQ,OAASD,EAAK,MACnCD,EAAIA,EAAI,OAAS,CAAC,EAAE,MAAQC,EAAK,KAC1BD,IAGTA,EAAI,KAAKC,CAAI,EACND,EACT,EAAG,CAAC,CAAC,CACP,CAkBA,SAASG,GAAYJ,EAAM,CACzB,IAAMK,EAAQ,CAAC,EACf,QAASC,EAAI,EAAGA,EAAIN,EAAK,OAAQM,IAAK,CACpC,IAAMC,EAAMP,EAAKM,CAAC,EAElB,OAAQC,EAAI,KAAM,CAChB,KAAKlC,EAAK,QACRgC,EAAM,KAAK,CAACE,EACV,CAAE,KAAMA,EAAI,KAAM,KAAMlC,EAAK,aAAc,OAAQkC,EAAI,MAAO,EAC9D,CAAE,KAAMA,EAAI,KAAM,KAAMlC,EAAK,KAAM,OAAQkC,EAAI,MAAO,CACxD,CAAC,EACD,MACF,KAAKlC,EAAK,aACRgC,EAAM,KAAK,CAACE,EACV,CAAE,KAAMA,EAAI,KAAM,KAAMlC,EAAK,KAAM,OAAQkC,EAAI,MAAO,CACxD,CAAC,EACD,MACF,KAAKlC,EAAK,MACRgC,EAAM,KAAK,CAACE,EACV,CAAE,KAAMA,EAAI,KAAM,KAAMlC,EAAK,KAAM,OAAQQ,GAAoB0B,EAAI,IAAI,CAAE,CAC3E,CAAC,EACD,MACF,KAAKlC,EAAK,KACRgC,EAAM,KAAK,CACT,CAAE,KAAME,EAAI,KAAM,KAAMlC,EAAK,KAAM,OAAQQ,GAAoB0B,EAAI,IAAI,CAAE,CAC3E,CAAC,CACL,CACF,CAEA,OAAOF,CACT,CAcA,SAASG,GAAYH,EAAOI,EAAS,CACnC,IAAMC,EAAQ,CAAC,EACTC,EAAQ,CAAE,MAAO,CAAC,CAAE,EACtBC,EAAc,CAAC,OAAO,EAE1B,QAAS,EAAI,EAAG,EAAIP,EAAM,OAAQ,IAAK,CACrC,IAAMQ,EAAYR,EAAM,CAAC,EACnBS,EAAiB,CAAC,EAExB,QAASC,EAAI,EAAGA,EAAIF,EAAU,OAAQE,IAAK,CACzC,IAAMC,EAAOH,EAAUE,CAAC,EAClBE,EAAM,GAAK,EAAIF,EAErBD,EAAe,KAAKG,CAAG,EACvBP,EAAMO,CAAG,EAAI,CAAE,KAAMD,EAAM,UAAW,CAAE,EACxCL,EAAMM,CAAG,EAAI,CAAC,EAEd,QAASC,EAAI,EAAGA,EAAIN,EAAY,OAAQM,IAAK,CAC3C,IAAMC,EAAaP,EAAYM,CAAC,EAE5BR,EAAMS,CAAU,GAAKT,EAAMS,CAAU,EAAE,KAAK,OAASH,EAAK,MAC5DL,EAAMQ,CAAU,EAAEF,CAAG,EACnBpB,GAAqBa,EAAMS,CAAU,EAAE,UAAYH,EAAK,OAAQA,EAAK,IAAI,EACzEnB,GAAqBa,EAAMS,CAAU,EAAE,UAAWH,EAAK,IAAI,EAE7DN,EAAMS,CAAU,EAAE,WAAaH,EAAK,SAEhCN,EAAMS,CAAU,IAAGT,EAAMS,CAAU,EAAE,UAAYH,EAAK,QAE1DL,EAAMQ,CAAU,EAAEF,CAAG,EAAIpB,GAAqBmB,EAAK,OAAQA,EAAK,IAAI,EAClE,EAAI3C,EAAK,sBAAsB2C,EAAK,KAAMP,CAAO,EAEvD,CACF,CAEAG,EAAcE,CAChB,CAEA,QAASI,EAAI,EAAGA,EAAIN,EAAY,OAAQM,IACtCP,EAAMC,EAAYM,CAAC,CAAC,EAAE,IAAM,EAG9B,MAAO,CAAE,IAAKP,EAAO,MAAOD,CAAM,CACpC,CAUA,SAASU,GAAoBC,EAAMC,EAAW,CAC5C,IAAIrC,EACEsC,EAAWlD,EAAK,mBAAmBgD,CAAI,EAK7C,GAHApC,EAAOZ,EAAK,KAAKiD,EAAWC,CAAQ,EAGhCtC,IAASZ,EAAK,MAAQY,EAAK,IAAMsC,EAAS,IAC5C,MAAM,IAAI,MAAM,IAAMF,EAAO,iCACOhD,EAAK,SAASY,CAAI,EACpD;AAAA,sBAA4BZ,EAAK,SAASkD,CAAQ,CAAC,EAQvD,OAJItC,IAASZ,EAAK,OAAS,CAACM,GAAM,mBAAmB,IACnDM,EAAOZ,EAAK,MAGNY,EAAM,CACZ,KAAKZ,EAAK,QACR,OAAO,IAAIC,GAAY+C,CAAI,EAE7B,KAAKhD,EAAK,aACR,OAAO,IAAIE,GAAiB8C,CAAI,EAElC,KAAKhD,EAAK,MACR,OAAO,IAAII,GAAU4C,CAAI,EAE3B,KAAKhD,EAAK,KACR,OAAO,IAAIG,GAAS6C,CAAI,CAC5B,CACF,CAiBAjD,GAAQ,UAAY,SAAoBoD,EAAO,CAC7C,OAAOA,EAAM,OAAO,SAAUvB,EAAKM,EAAK,CACtC,OAAI,OAAOA,GAAQ,SACjBN,EAAI,KAAKmB,GAAmBb,EAAK,IAAI,CAAC,EAC7BA,EAAI,MACbN,EAAI,KAAKmB,GAAmBb,EAAI,KAAMA,EAAI,IAAI,CAAC,EAG1CN,CACT,EAAG,CAAC,CAAC,CACP,EAUA7B,GAAQ,WAAa,SAAqBiD,EAAMZ,EAAS,CACvD,IAAMT,EAAOZ,GAAsBiC,EAAM1C,GAAM,mBAAmB,CAAC,EAE7D0B,EAAQD,GAAWJ,CAAI,EACvBW,EAAQH,GAAWH,EAAOI,CAAO,EACjCgB,EAAO7C,GAAS,UAAU+B,EAAM,IAAK,QAAS,KAAK,EAEnDe,EAAgB,CAAC,EACvB,QAASpB,EAAI,EAAGA,EAAImB,EAAK,OAAS,EAAGnB,IACnCoB,EAAc,KAAKf,EAAM,MAAMc,EAAKnB,CAAC,CAAC,EAAE,IAAI,EAG9C,OAAOlC,GAAQ,UAAU2B,GAAc2B,CAAa,CAAC,CACvD,EAYAtD,GAAQ,SAAW,SAAmBiD,EAAM,CAC1C,OAAOjD,GAAQ,UACbgB,GAAsBiC,EAAM1C,GAAM,mBAAmB,CAAC,CACxD,CACF,ICzUA,IAAAgD,GAAAC,EAAAC,IAAA,KAAMC,GAAQ,IACRC,GAAU,KACVC,GAAY,KACZC,GAAY,KACZC,GAAmB,KACnBC,GAAgB,KAChBC,GAAc,KACdC,GAAS,KACTC,GAAqB,KACrBC,GAAU,KACVC,GAAa,KACbC,GAAO,IACPC,GAAW,KAkCjB,SAASC,GAAoBC,EAAQC,EAAS,CAC5C,IAAMC,EAAOF,EAAO,KACdG,EAAMZ,GAAc,aAAaU,CAAO,EAE9C,QAASG,EAAI,EAAGA,EAAID,EAAI,OAAQC,IAAK,CACnC,IAAMC,EAAMF,EAAIC,CAAC,EAAE,CAAC,EACdE,EAAMH,EAAIC,CAAC,EAAE,CAAC,EAEpB,QAASG,EAAI,GAAIA,GAAK,EAAGA,IACvB,GAAI,EAAAF,EAAME,GAAK,IAAML,GAAQG,EAAME,GAEnC,QAASC,EAAI,GAAIA,GAAK,EAAGA,IACnBF,EAAME,GAAK,IAAMN,GAAQI,EAAME,IAE9BD,GAAK,GAAKA,GAAK,IAAMC,IAAM,GAAKA,IAAM,IACxCA,GAAK,GAAKA,GAAK,IAAMD,IAAM,GAAKA,IAAM,IACtCA,GAAK,GAAKA,GAAK,GAAKC,GAAK,GAAKA,GAAK,EACpCR,EAAO,IAAIK,EAAME,EAAGD,EAAME,EAAG,GAAM,EAAI,EAEvCR,EAAO,IAAIK,EAAME,EAAGD,EAAME,EAAG,GAAO,EAAI,EAIhD,CACF,CASA,SAASC,GAAoBT,EAAQ,CACnC,IAAME,EAAOF,EAAO,KAEpB,QAAS,EAAI,EAAG,EAAIE,EAAO,EAAG,IAAK,CACjC,IAAMQ,EAAQ,EAAI,IAAM,EACxBV,EAAO,IAAI,EAAG,EAAGU,EAAO,EAAI,EAC5BV,EAAO,IAAI,EAAG,EAAGU,EAAO,EAAI,CAC9B,CACF,CAUA,SAASC,GAAuBX,EAAQC,EAAS,CAC/C,IAAME,EAAMb,GAAiB,aAAaW,CAAO,EAEjD,QAASG,EAAI,EAAGA,EAAID,EAAI,OAAQC,IAAK,CACnC,IAAMC,EAAMF,EAAIC,CAAC,EAAE,CAAC,EACdE,EAAMH,EAAIC,CAAC,EAAE,CAAC,EAEpB,QAASG,EAAI,GAAIA,GAAK,EAAGA,IACvB,QAASC,EAAI,GAAIA,GAAK,EAAGA,IACnBD,IAAM,IAAMA,IAAM,GAAKC,IAAM,IAAMA,IAAM,GAC1CD,IAAM,GAAKC,IAAM,EAClBR,EAAO,IAAIK,EAAME,EAAGD,EAAME,EAAG,GAAM,EAAI,EAEvCR,EAAO,IAAIK,EAAME,EAAGD,EAAME,EAAG,GAAO,EAAI,CAIhD,CACF,CAQA,SAASI,GAAkBZ,EAAQC,EAAS,CAC1C,IAAMC,EAAOF,EAAO,KACda,EAAOlB,GAAQ,eAAeM,CAAO,EACvCI,EAAKC,EAAKQ,EAEd,QAASV,EAAI,EAAGA,EAAI,GAAIA,IACtBC,EAAM,KAAK,MAAMD,EAAI,CAAC,EACtBE,EAAMF,EAAI,EAAIF,EAAO,EAAI,EACzBY,GAAQD,GAAQT,EAAK,KAAO,EAE5BJ,EAAO,IAAIK,EAAKC,EAAKQ,EAAK,EAAI,EAC9Bd,EAAO,IAAIM,EAAKD,EAAKS,EAAK,EAAI,CAElC,CASA,SAASC,GAAiBf,EAAQgB,EAAsBC,EAAa,CACnE,IAAMf,EAAOF,EAAO,KACda,EAAOjB,GAAW,eAAeoB,EAAsBC,CAAW,EACpE,EAAGH,EAEP,IAAK,EAAI,EAAG,EAAI,GAAI,IAClBA,GAAQD,GAAQ,EAAK,KAAO,EAGxB,EAAI,EACNb,EAAO,IAAI,EAAG,EAAGc,EAAK,EAAI,EACjB,EAAI,EACbd,EAAO,IAAI,EAAI,EAAG,EAAGc,EAAK,EAAI,EAE9Bd,EAAO,IAAIE,EAAO,GAAK,EAAG,EAAGY,EAAK,EAAI,EAIpC,EAAI,EACNd,EAAO,IAAI,EAAGE,EAAO,EAAI,EAAGY,EAAK,EAAI,EAC5B,EAAI,EACbd,EAAO,IAAI,EAAG,GAAK,EAAI,EAAI,EAAGc,EAAK,EAAI,EAEvCd,EAAO,IAAI,EAAG,GAAK,EAAI,EAAGc,EAAK,EAAI,EAKvCd,EAAO,IAAIE,EAAO,EAAG,EAAG,EAAG,EAAI,CACjC,CAQA,SAASgB,GAAWlB,EAAQmB,EAAM,CAChC,IAAMjB,EAAOF,EAAO,KAChBoB,EAAM,GACNf,EAAMH,EAAO,EACbmB,EAAW,EACXC,EAAY,EAEhB,QAAShB,EAAMJ,EAAO,EAAGI,EAAM,EAAGA,GAAO,EAGvC,IAFIA,IAAQ,GAAGA,MAEF,CACX,QAASE,EAAI,EAAGA,EAAI,EAAGA,IACrB,GAAI,CAACR,EAAO,WAAWK,EAAKC,EAAME,CAAC,EAAG,CACpC,IAAIe,EAAO,GAEPD,EAAYH,EAAK,SACnBI,GAAUJ,EAAKG,CAAS,IAAMD,EAAY,KAAO,GAGnDrB,EAAO,IAAIK,EAAKC,EAAME,EAAGe,CAAI,EAC7BF,IAEIA,IAAa,KACfC,IACAD,EAAW,EAEf,CAKF,GAFAhB,GAAOe,EAEHf,EAAM,GAAKH,GAAQG,EAAK,CAC1BA,GAAOe,EACPA,EAAM,CAACA,EACP,KACF,CACF,CAEJ,CAUA,SAASI,GAAYvB,EAASe,EAAsBS,EAAU,CAE5D,IAAMC,EAAS,IAAItC,GAEnBqC,EAAS,QAAQ,SAAUN,EAAM,CAE/BO,EAAO,IAAIP,EAAK,KAAK,IAAK,CAAC,EAS3BO,EAAO,IAAIP,EAAK,UAAU,EAAGtB,GAAK,sBAAsBsB,EAAK,KAAMlB,CAAO,CAAC,EAG3EkB,EAAK,MAAMO,CAAM,CACnB,CAAC,EAGD,IAAMC,EAAiBzC,GAAM,wBAAwBe,CAAO,EACtD2B,EAAmBnC,GAAO,uBAAuBQ,EAASe,CAAoB,EAC9Ea,GAA0BF,EAAiBC,GAAoB,EAgBrE,IATIF,EAAO,gBAAgB,EAAI,GAAKG,GAClCH,EAAO,IAAI,EAAG,CAAC,EAQVA,EAAO,gBAAgB,EAAI,IAAM,GACtCA,EAAO,OAAO,CAAC,EAOjB,IAAMI,GAAiBD,EAAyBH,EAAO,gBAAgB,GAAK,EAC5E,QAAStB,EAAI,EAAGA,EAAI0B,EAAe1B,IACjCsB,EAAO,IAAItB,EAAI,EAAI,GAAO,IAAM,CAAC,EAGnC,OAAO2B,GAAgBL,EAAQzB,EAASe,CAAoB,CAC9D,CAWA,SAASe,GAAiBC,EAAW/B,EAASe,EAAsB,CAElE,IAAMW,EAAiBzC,GAAM,wBAAwBe,CAAO,EAGtD2B,EAAmBnC,GAAO,uBAAuBQ,EAASe,CAAoB,EAG9EiB,EAAqBN,EAAiBC,EAGtCM,EAAgBzC,GAAO,eAAeQ,EAASe,CAAoB,EAGnEmB,EAAiBR,EAAiBO,EAClCE,EAAiBF,EAAgBC,EAEjCE,EAAyB,KAAK,MAAMV,EAAiBO,CAAa,EAElEI,EAAwB,KAAK,MAAML,EAAqBC,CAAa,EACrEK,EAAwBD,EAAwB,EAGhDE,EAAUH,EAAyBC,EAGnCG,EAAK,IAAI/C,GAAmB8C,CAAO,EAErCE,EAAS,EACPC,EAAS,IAAI,MAAMT,CAAa,EAChCU,EAAS,IAAI,MAAMV,CAAa,EAClCW,EAAc,EACZnB,EAAS,IAAI,WAAWM,EAAU,MAAM,EAG9C,QAASc,EAAI,EAAGA,EAAIZ,EAAeY,IAAK,CACtC,IAAMC,GAAWD,EAAIV,EAAiBE,EAAwBC,EAG9DI,EAAOG,CAAC,EAAIpB,EAAO,MAAMgB,EAAQA,EAASK,EAAQ,EAGlDH,EAAOE,CAAC,EAAIL,EAAG,OAAOE,EAAOG,CAAC,CAAC,EAE/BJ,GAAUK,GACVF,EAAc,KAAK,IAAIA,EAAaE,EAAQ,CAC9C,CAIA,IAAM5B,EAAO,IAAI,WAAWQ,CAAc,EACtCqB,GAAQ,EACR5C,EAAGG,EAGP,IAAKH,EAAI,EAAGA,EAAIyC,EAAazC,IAC3B,IAAKG,EAAI,EAAGA,EAAI2B,EAAe3B,IACzBH,EAAIuC,EAAOpC,CAAC,EAAE,SAChBY,EAAK6B,IAAO,EAAIL,EAAOpC,CAAC,EAAEH,CAAC,GAMjC,IAAKA,EAAI,EAAGA,EAAIoC,EAASpC,IACvB,IAAKG,EAAI,EAAGA,EAAI2B,EAAe3B,IAC7BY,EAAK6B,IAAO,EAAIJ,EAAOrC,CAAC,EAAEH,CAAC,EAI/B,OAAOe,CACT,CAWA,SAAS8B,GAAc9B,EAAMlB,EAASe,EAAsBC,EAAa,CACvE,IAAIQ,EAEJ,GAAI,MAAM,QAAQN,CAAI,EACpBM,EAAW3B,GAAS,UAAUqB,CAAI,UACzB,OAAOA,GAAS,SAAU,CACnC,IAAI+B,EAAmBjD,EAEvB,GAAI,CAACiD,EAAkB,CACrB,IAAMC,EAAcrD,GAAS,SAASqB,CAAI,EAG1C+B,EAAmBvD,GAAQ,sBAAsBwD,EAAanC,CAAoB,CACpF,CAIAS,EAAW3B,GAAS,WAAWqB,EAAM+B,GAAoB,EAAE,CAC7D,KACE,OAAM,IAAI,MAAM,cAAc,EAIhC,IAAME,EAAczD,GAAQ,sBAAsB8B,EAAUT,CAAoB,EAGhF,GAAI,CAACoC,EACH,MAAM,IAAI,MAAM,yDAAyD,EAI3E,GAAI,CAACnD,EACHA,EAAUmD,UAGDnD,EAAUmD,EACnB,MAAM,IAAI,MAAM;AAAA;AAAA,qDAE0CA,EAAc;AAAA,CACxE,EAGF,IAAMC,EAAW7B,GAAWvB,EAASe,EAAsBS,CAAQ,EAG7D6B,EAAcpE,GAAM,cAAce,CAAO,EACzCsD,EAAU,IAAIlE,GAAUiE,CAAW,EAGzC,OAAAvD,GAAmBwD,EAAStD,CAAO,EACnCQ,GAAmB8C,CAAO,EAC1B5C,GAAsB4C,EAAStD,CAAO,EAMtCc,GAAgBwC,EAASvC,EAAsB,CAAC,EAE5Cf,GAAW,GACbW,GAAiB2C,EAAStD,CAAO,EAInCiB,GAAUqC,EAASF,CAAQ,EAEvB,MAAMpC,CAAW,IAEnBA,EAAczB,GAAY,YAAY+D,EACpCxC,GAAgB,KAAK,KAAMwC,EAASvC,CAAoB,CAAC,GAI7DxB,GAAY,UAAUyB,EAAasC,CAAO,EAG1CxC,GAAgBwC,EAASvC,EAAsBC,CAAW,EAEnD,CACL,QAASsC,EACT,QAAStD,EACT,qBAAsBe,EACtB,YAAaC,EACb,SAAUQ,CACZ,CACF,CAWAxC,GAAQ,OAAS,SAAiBkC,EAAMqC,EAAS,CAC/C,GAAI,OAAOrC,EAAS,KAAeA,IAAS,GAC1C,MAAM,IAAI,MAAM,eAAe,EAGjC,IAAIH,EAAuB7B,GAAQ,EAC/Bc,EACAwD,EAEJ,OAAI,OAAOD,EAAY,MAErBxC,EAAuB7B,GAAQ,KAAKqE,EAAQ,qBAAsBrE,GAAQ,CAAC,EAC3Ec,EAAUN,GAAQ,KAAK6D,EAAQ,OAAO,EACtCC,EAAOjE,GAAY,KAAKgE,EAAQ,WAAW,EAEvCA,EAAQ,YACVtE,GAAM,kBAAkBsE,EAAQ,UAAU,GAIvCP,GAAa9B,EAAMlB,EAASe,EAAsByC,CAAI,CAC/D,IC9eA,IAAAC,GAAAC,EAAAC,GAAA,UAASC,GAAUC,EAAK,CAKtB,GAJI,OAAOA,GAAQ,WACjBA,EAAMA,EAAI,SAAS,GAGjB,OAAOA,GAAQ,SACjB,MAAM,IAAI,MAAM,uCAAuC,EAGzD,IAAIC,EAAUD,EAAI,MAAM,EAAE,QAAQ,IAAK,EAAE,EAAE,MAAM,EAAE,EACnD,GAAIC,EAAQ,OAAS,GAAKA,EAAQ,SAAW,GAAKA,EAAQ,OAAS,EACjE,MAAM,IAAI,MAAM,sBAAwBD,CAAG,GAIzCC,EAAQ,SAAW,GAAKA,EAAQ,SAAW,KAC7CA,EAAU,MAAM,UAAU,OAAO,MAAM,CAAC,EAAGA,EAAQ,IAAI,SAAUC,EAAG,CAClE,MAAO,CAACA,EAAGA,CAAC,CACd,CAAC,CAAC,GAIAD,EAAQ,SAAW,GAAGA,EAAQ,KAAK,IAAK,GAAG,EAE/C,IAAME,EAAW,SAASF,EAAQ,KAAK,EAAE,EAAG,EAAE,EAE9C,MAAO,CACL,EAAIE,GAAY,GAAM,IACtB,EAAIA,GAAY,GAAM,IACtB,EAAIA,GAAY,EAAK,IACrB,EAAGA,EAAW,IACd,IAAK,IAAMF,EAAQ,MAAM,EAAG,CAAC,EAAE,KAAK,EAAE,CACxC,CACF,CAEAH,EAAQ,WAAa,SAAqBM,EAAS,CAC5CA,IAASA,EAAU,CAAC,GACpBA,EAAQ,QAAOA,EAAQ,MAAQ,CAAC,GAErC,IAAMC,EAAS,OAAOD,EAAQ,OAAW,KACvCA,EAAQ,SAAW,MACnBA,EAAQ,OAAS,EACf,EACAA,EAAQ,OAENE,EAAQF,EAAQ,OAASA,EAAQ,OAAS,GAAKA,EAAQ,MAAQ,OAC/DG,EAAQH,EAAQ,OAAS,EAE/B,MAAO,CACL,MAAOE,EACP,MAAOA,EAAQ,EAAIC,EACnB,OAAQF,EACR,MAAO,CACL,KAAMN,GAASK,EAAQ,MAAM,MAAQ,WAAW,EAChD,MAAOL,GAASK,EAAQ,MAAM,OAAS,WAAW,CACpD,EACA,KAAMA,EAAQ,KACd,aAAcA,EAAQ,cAAgB,CAAC,CACzC,CACF,EAEAN,EAAQ,SAAW,SAAmBU,EAAQC,EAAM,CAClD,OAAOA,EAAK,OAASA,EAAK,OAASD,EAASC,EAAK,OAAS,EACtDA,EAAK,OAASD,EAASC,EAAK,OAAS,GACrCA,EAAK,KACX,EAEAX,EAAQ,cAAgB,SAAwBU,EAAQC,EAAM,CAC5D,IAAMF,EAAQT,EAAQ,SAASU,EAAQC,CAAI,EAC3C,OAAO,KAAK,OAAOD,EAASC,EAAK,OAAS,GAAKF,CAAK,CACtD,EAEAT,EAAQ,cAAgB,SAAwBY,EAASC,EAAIF,EAAM,CACjE,IAAMG,EAAOD,EAAG,QAAQ,KAClBE,EAAOF,EAAG,QAAQ,KAClBJ,EAAQT,EAAQ,SAASc,EAAMH,CAAI,EACnCK,EAAa,KAAK,OAAOF,EAAOH,EAAK,OAAS,GAAKF,CAAK,EACxDQ,EAAeN,EAAK,OAASF,EAC7BS,EAAU,CAACP,EAAK,MAAM,MAAOA,EAAK,MAAM,IAAI,EAElD,QAASQ,EAAI,EAAGA,EAAIH,EAAYG,IAC9B,QAASC,EAAI,EAAGA,EAAIJ,EAAYI,IAAK,CACnC,IAAIC,GAAUF,EAAIH,EAAaI,GAAK,EAChCE,EAAUX,EAAK,MAAM,MAEzB,GAAIQ,GAAKF,GAAgBG,GAAKH,GAC5BE,EAAIH,EAAaC,GAAgBG,EAAIJ,EAAaC,EAAc,CAChE,IAAMM,EAAO,KAAK,OAAOJ,EAAIF,GAAgBR,CAAK,EAC5Ce,EAAO,KAAK,OAAOJ,EAAIH,GAAgBR,CAAK,EAClDa,EAAUJ,EAAQH,EAAKQ,EAAOT,EAAOU,CAAI,EAAI,EAAI,CAAC,CACpD,CAEAZ,EAAQS,GAAQ,EAAIC,EAAQ,EAC5BV,EAAQS,GAAQ,EAAIC,EAAQ,EAC5BV,EAAQS,GAAQ,EAAIC,EAAQ,EAC5BV,EAAQS,CAAM,EAAIC,EAAQ,CAC5B,CAEJ,IClGA,IAAAG,GAAAC,EAAAC,IAAA,KAAMC,GAAQ,KAEd,SAASC,GAAaC,EAAKC,EAAQC,EAAM,CACvCF,EAAI,UAAU,EAAG,EAAGC,EAAO,MAAOA,EAAO,MAAM,EAE1CA,EAAO,QAAOA,EAAO,MAAQ,CAAC,GACnCA,EAAO,OAASC,EAChBD,EAAO,MAAQC,EACfD,EAAO,MAAM,OAASC,EAAO,KAC7BD,EAAO,MAAM,MAAQC,EAAO,IAC9B,CAEA,SAASC,IAAoB,CAC3B,GAAI,CACF,OAAO,SAAS,cAAc,QAAQ,CACxC,MAAY,CACV,MAAM,IAAI,MAAM,sCAAsC,CACxD,CACF,CAEAN,GAAQ,OAAS,SAAiBO,EAAQH,EAAQI,EAAS,CACzD,IAAIC,EAAOD,EACPE,EAAWN,EAEX,OAAOK,EAAS,MAAgB,CAACL,GAAU,CAACA,EAAO,cACrDK,EAAOL,EACPA,EAAS,QAGNA,IACHM,EAAWJ,GAAiB,GAG9BG,EAAOR,GAAM,WAAWQ,CAAI,EAC5B,IAAMJ,EAAOJ,GAAM,cAAcM,EAAO,QAAQ,KAAME,CAAI,EAEpDN,EAAMO,EAAS,WAAW,IAAI,EAC9BC,EAAQR,EAAI,gBAAgBE,EAAMA,CAAI,EAC5C,OAAAJ,GAAM,cAAcU,EAAM,KAAMJ,EAAQE,CAAI,EAE5CP,GAAYC,EAAKO,EAAUL,CAAI,EAC/BF,EAAI,aAAaQ,EAAO,EAAG,CAAC,EAErBD,CACT,EAEAV,GAAQ,gBAAkB,SAA0BO,EAAQH,EAAQI,EAAS,CAC3E,IAAIC,EAAOD,EAEP,OAAOC,EAAS,MAAgB,CAACL,GAAU,CAACA,EAAO,cACrDK,EAAOL,EACPA,EAAS,QAGNK,IAAMA,EAAO,CAAC,GAEnB,IAAMC,EAAWV,GAAQ,OAAOO,EAAQH,EAAQK,CAAI,EAE9CG,EAAOH,EAAK,MAAQ,YACpBI,EAAeJ,EAAK,cAAgB,CAAC,EAE3C,OAAOC,EAAS,UAAUE,EAAMC,EAAa,OAAO,CACtD,IC9DA,IAAAC,GAAAC,EAAAC,IAAA,KAAMC,GAAQ,KAEd,SAASC,GAAgBC,EAAOC,EAAQ,CACtC,IAAMC,EAAQF,EAAM,EAAI,IAClBG,EAAMF,EAAS,KAAOD,EAAM,IAAM,IAExC,OAAOE,EAAQ,EACXC,EAAM,IAAMF,EAAS,aAAeC,EAAM,QAAQ,CAAC,EAAE,MAAM,CAAC,EAAI,IAChEC,CACN,CAEA,SAASC,GAAQC,EAAKC,EAAGC,EAAG,CAC1B,IAAIJ,EAAME,EAAMC,EAChB,OAAI,OAAOC,EAAM,MAAaJ,GAAO,IAAMI,GAEpCJ,CACT,CAEA,SAASK,GAAUC,EAAMC,EAAMC,EAAQ,CACrC,IAAIC,EAAO,GACPC,EAAS,EACTC,EAAS,GACTC,EAAa,EAEjB,QAASC,EAAI,EAAGA,EAAIP,EAAK,OAAQO,IAAK,CACpC,IAAMC,EAAM,KAAK,MAAMD,EAAIN,CAAI,EACzBQ,EAAM,KAAK,MAAMF,EAAIN,CAAI,EAE3B,CAACO,GAAO,CAACH,IAAQA,EAAS,IAE1BL,EAAKO,CAAC,GACRD,IAEMC,EAAI,GAAKC,EAAM,GAAKR,EAAKO,EAAI,CAAC,IAClCJ,GAAQE,EACJV,GAAO,IAAKa,EAAMN,EAAQ,GAAMO,EAAMP,CAAM,EAC5CP,GAAO,IAAKS,EAAQ,CAAC,EAEzBA,EAAS,EACTC,EAAS,IAGLG,EAAM,EAAIP,GAAQD,EAAKO,EAAI,CAAC,IAChCJ,GAAQR,GAAO,IAAKW,CAAU,EAC9BA,EAAa,IAGfF,GAEJ,CAEA,OAAOD,CACT,CAEAf,GAAQ,OAAS,SAAiBsB,EAAQC,EAASC,EAAI,CACrD,IAAMC,EAAOxB,GAAM,WAAWsB,CAAO,EAC/BV,EAAOS,EAAO,QAAQ,KACtBV,EAAOU,EAAO,QAAQ,KACtBI,EAAab,EAAOY,EAAK,OAAS,EAElCE,EAAMF,EAAK,MAAM,MAAM,EAEzB,SAAWvB,GAAeuB,EAAK,MAAM,MAAO,MAAM,EAClD,YAAcC,EAAa,IAAMA,EAAa,SAF9C,GAIEX,EACJ,SAAWb,GAAeuB,EAAK,MAAM,KAAM,QAAQ,EACnD,OAASd,GAASC,EAAMC,EAAMY,EAAK,MAAM,EAAI,MAEzCG,EAAU,gBAAuBF,EAAa,IAAMA,EAAa,IAIjEG,EAAS,4CAFAJ,EAAK,MAAa,UAAYA,EAAK,MAAQ,aAAeA,EAAK,MAAQ,KAA1D,IAEwCG,EAAU,iCAAmCD,EAAKZ,EAAO;AAAA,EAE7H,OAAI,OAAOS,GAAO,YAChBA,EAAG,KAAMK,CAAM,EAGVA,CACT,IChFA,IAAAC,GAAAC,EAAAC,IAAA,CACA,IAAMC,GAAa,KAEbC,GAAS,KACTC,GAAiB,KACjBC,GAAc,KAEpB,SAASC,GAAcC,EAAYC,EAAQC,EAAMC,EAAMC,EAAI,CACzD,IAAMC,EAAO,CAAC,EAAE,MAAM,KAAK,UAAW,CAAC,EACjCC,EAAUD,EAAK,OACfE,EAAc,OAAOF,EAAKC,EAAU,CAAC,GAAM,WAEjD,GAAI,CAACC,GAAe,CAACZ,GAAW,EAC9B,MAAM,IAAI,MAAM,oCAAoC,EAGtD,GAAIY,EAAa,CACf,GAAID,EAAU,EACZ,MAAM,IAAI,MAAM,4BAA4B,EAG1CA,IAAY,GACdF,EAAKF,EACLA,EAAOD,EACPA,EAASE,EAAO,QACPG,IAAY,IACjBL,EAAO,YAAc,OAAOG,EAAO,KACrCA,EAAKD,EACLA,EAAO,SAEPC,EAAKD,EACLA,EAAOD,EACPA,EAAOD,EACPA,EAAS,QAGf,KAAO,CACL,GAAIK,EAAU,EACZ,MAAM,IAAI,MAAM,4BAA4B,EAG9C,OAAIA,IAAY,GACdJ,EAAOD,EACPA,EAASE,EAAO,QACPG,IAAY,GAAK,CAACL,EAAO,aAClCE,EAAOD,EACPA,EAAOD,EACPA,EAAS,QAGJ,IAAI,QAAQ,SAAUO,EAASC,EAAQ,CAC5C,GAAI,CACF,IAAMC,EAAOd,GAAO,OAAOM,EAAMC,CAAI,EACrCK,EAAQR,EAAWU,EAAMT,EAAQE,CAAI,CAAC,CACxC,OAASQ,EAAG,CACVF,EAAOE,CAAC,CACV,CACF,CAAC,CACH,CAEA,GAAI,CACF,IAAMD,EAAOd,GAAO,OAAOM,EAAMC,CAAI,EACrCC,EAAG,KAAMJ,EAAWU,EAAMT,EAAQE,CAAI,CAAC,CACzC,OAASQ,EAAG,CACVP,EAAGO,CAAC,CACN,CACF,CAEAjB,GAAQ,OAASE,GAAO,OACxBF,GAAQ,SAAWK,GAAa,KAAK,KAAMF,GAAe,MAAM,EAChEH,GAAQ,UAAYK,GAAa,KAAK,KAAMF,GAAe,eAAe,EAG1EH,GAAQ,SAAWK,GAAa,KAAK,KAAM,SAAUW,EAAME,EAAGT,EAAM,CAClE,OAAOL,GAAY,OAAOY,EAAMP,CAAI,CACtC,CAAC,IC3ED,OAAS,OAAAU,OAAW,sBACpB,OAAOC,OAA6B,QCApC,OAAS,YAAAC,GAAU,QAAAC,OAAY,sB,uDCoD/B,IAAMC,GAAaC,GACR,MAAM,QAAQA,CAAK,EAAIA,EAAQ,CAACA,CAAK,EAS1CC,GAAU,IAAIC,IAAQ,CAACF,KAAUG,IAAS,CAC5C,IAAIC,EAASJ,EACPK,EAAcH,EAAI,MAAM,EAAE,QAAQ,EACxC,QAAS,EAAI,EAAG,EAAIG,EAAY,OAAQ,GAAK,EAAG,CAC5C,IAAMC,EAAKD,EAAY,CAAC,EACxBD,EAASE,EAAGF,EAAQ,GAAGD,CAAI,CAC/B,CACA,OAAOC,CACX,EAqFA,IAAMG,GAAaC,GAAU,oBAAoB,KAAK,GAAGA,CAAK,EAAE,EAO1DC,GAAgBD,GAAU,CAC5B,IAAME,EAAQH,GAAUC,CAAK,EAC7B,GAAIE,EAAO,CACP,IAAMC,EAAI,WAAWD,EAAM,CAAC,CAAC,EAE7B,MAAO,CAAE,QADOC,EAAI,IACF,MAAOA,CAAE,CAC/B,CACA,OAAO,IACX,EA+FA,IAAMC,GAAgBC,GACX,OAAOA,GAAU,SAAW,OAAO,WAAWA,CAAK,EAAIA,EC1QlE,IAAAC,GAAuB,UACvBC,GAAqB,UACrBC,GAAwB,UACxBC,GAAoB,UACpBC,GAAsB,UAQhBC,GAAWC,GAAUA,EAAM,OAAO,OAAO,EAOzCC,GAAeC,GAAWA,EAAO,OAAO,CAACC,EAAKC,IAAU,CAC1D,IAAMC,EAAI,MAAM,QAAQD,CAAK,EAAIE,GAAQF,CAAK,EAAIA,EAClD,cAAO,KAAKC,CAAC,EAAE,QAASE,GAAQ,CACxBF,EAAEE,CAAG,IAAM,MAAQF,EAAEE,CAAG,IAAM,SAC9BJ,EAAII,CAAG,EAAIF,EAAEE,CAAG,EAExB,CAAC,EACMJ,CACX,EAAG,CAAC,CAAC,EAOCG,GAAUE,GAAQP,GAAaF,GAAUU,EAAU,EAqBzD,IAAMC,GAASC,GAAU,SAAS,KAAKA,CAAK,EACtCC,GAASD,GAAU,SAAS,KAAKA,CAAK,EAOtCE,GAAYF,GAAU,CACxB,IAAMG,EAAM,GAAAC,QAAY,IAAI,IAAIJ,CAAK,EACrC,OAAO,GAAAI,QAAY,GAAG,IAAID,CAAG,CACjC,EAOME,GAAYL,GAAU,CACxB,IAAMM,EAAM,GAAAF,QAAY,IAAI,IAAIJ,CAAK,EAAE,IAAI,KAAK,KAAK,EAErD,SADY,GAAAO,SAAS,GAAGD,CAAG,EAChB,YAAY,CAC3B,EAOME,GAAkBR,GAChBD,GAAMC,CAAK,EACJE,GAASF,CAAK,EACrBC,GAAMD,CAAK,EACJK,GAASL,CAAK,EAClBA,EASLS,GAAcT,GAAU,CAC1B,GAAI,OAAOA,GAAU,SACjB,MAAO,CAAE,MAAAA,EAAO,KAAM,MAAU,EACpC,IAAMU,EAAQ,8CAA8C,KAAKV,CAAK,EACtE,OAAOU,EACD,CAAE,MAAO,WAAWA,EAAM,CAAC,CAAC,EAAG,KAAMA,EAAM,CAAC,GAAK,IAAK,EACtD,CAAE,MAAAV,EAAO,KAAM,MAAU,CACnC,EAQMW,EAAgB,CAACC,EAAWZ,IAAU,CACxC,IAAMa,EAASJ,GAAWT,CAAK,EACzBc,EAAY,GACZC,EAAWH,EAAU,KAAO,GAC5BI,EAAY,EAAI,KAAQF,EACxBG,EAAY,EAAI,KAAQH,EAC9B,GAAI,OAAOD,EAAO,OAAU,SACxB,OAAOA,EAAO,MAClB,OAAQA,EAAO,KAAM,CACjB,IAAK,MACD,OAAOA,EAAO,OAASD,EAAU,SAAW,IAChD,IAAK,KACD,OAAOC,EAAO,MAAQC,EAC1B,IAAK,KACD,OAAOD,EAAO,MAAQG,EAC1B,IAAK,KACD,OAAOH,EAAO,MAAQI,EAC1B,IAAK,KACD,OAAOJ,EAAO,OAASD,EAAU,OAAS,KAC9C,IAAK,KACD,OAAOC,EAAO,OAASD,EAAU,MAAQ,KAC7C,IAAK,KACD,OAAO,KAAK,MAAMC,EAAO,OAASC,EAAYC,EAAS,EAC3D,QACI,OAAOF,EAAO,KACtB,CACJ,EAEMK,EAAqB,CAACC,EAAKnB,KAAW,CACxC,CAACmB,CAAG,EAAGC,GAAapB,CAAK,CAC7B,GACMqB,EAAmB,CAACF,EAAKnB,EAAOY,KAAe,CACjD,CAACO,CAAG,EAAGR,EAAcC,EAAWZ,CAAK,CACzC,GACMsB,EAAoB,CAACH,EAAKnB,KACb,CAAE,CAACmB,CAAG,EAAGX,GAAeR,CAAK,CAAE,GAG5CuB,EAAmB,CAACJ,EAAKnB,KAAW,CACtC,CAACmB,CAAG,EAAGnB,CACX,GAEMwB,GAAyB,0DACzBC,GAAwBzB,GAAUA,EAAM,MAAMwB,EAAsB,GAAK,CAAC,EAC1EE,EAAyB,CAACP,EAAKnB,EAAOY,IAAc,CACtD,IAAMF,EAAQe,GAAqB,GAAGzB,CAAK,EAAE,EAC7C,GAAIU,EAAO,CACP,IAAMiB,EAAajB,EAAM,CAAC,GAAKV,EACzB4B,EAAalB,EAAM,CAAC,GAAKV,EACzB6B,EAAanB,EAAM,CAAC,GAAKV,EACzB8B,EAAQF,EACRG,EAAQF,EAAarB,GAAeqB,CAAU,EAAI,OAClDG,EAAQL,EAAahB,EAAcC,EAAWe,CAAU,EAAI,OAClE,GAAIR,EAAI,MAAM,0BAA0B,EACpC,MAAO,CACH,CAAC,GAAGA,CAAG,OAAO,EAAGY,EACjB,CAAC,GAAGZ,CAAG,OAAO,EAAGW,EACjB,CAAC,GAAGX,CAAG,OAAO,EAAGa,CACrB,EAEJ,GAAIb,EAAI,MAAM,QAAQ,EAClB,MAAO,CACH,eAAgBY,EAChB,iBAAkBA,EAClB,kBAAmBA,EACnB,gBAAiBA,CACrB,EAEJ,GAAIZ,EAAI,MAAM,QAAQ,EAAG,CACrB,GAAI,OAAOW,GAAU,SACjB,MAAM,IAAI,MAAM,yBAAyBA,CAAK,EAAE,EACpD,MAAO,CACH,eAAgBA,EAChB,iBAAkBA,EAClB,kBAAmBA,EACnB,gBAAiBA,CACrB,CACJ,CACA,GAAIX,EAAI,MAAM,QAAQ,EAAG,CACrB,GAAI,OAAOa,GAAU,SACjB,MAAM,IAAI,MAAM,yBAAyBA,CAAK,EAAE,EACpD,MAAO,CACH,eAAgBA,EAChB,iBAAkBA,EAClB,kBAAmBA,EACnB,gBAAiBA,CACrB,CACJ,CACA,GAAIb,EAAI,MAAM,SAAS,EAAG,CACtB,IAAMc,EAASjC,EAAQW,EAAcC,EAAWZ,CAAK,EAAI,OACzD,GAAI,OAAOiC,GAAW,SAClB,MAAM,IAAI,MAAM,0BAA0BA,CAAM,EAAE,EACtD,MAAO,CACH,oBAAqBA,EACrB,qBAAsBA,EACtB,wBAAyBA,EACzB,uBAAwBA,CAC5B,CACJ,CACA,GAAI,OAAOD,GAAU,SACjB,MAAM,IAAI,MAAM,yBAAyBA,CAAK,EAAE,EACpD,GAAI,OAAOF,GAAU,SACjB,MAAM,IAAI,MAAM,yBAAyBA,CAAK,EAAE,EACpD,MAAO,CACH,eAAgBC,EAChB,eAAgBD,EAChB,eAAgBE,EAChB,iBAAkBD,EAClB,iBAAkBD,EAClB,iBAAkBE,EAClB,kBAAmBD,EACnB,kBAAmBD,EACnB,kBAAmBE,EACnB,gBAAiBD,EACjB,gBAAiBD,EACjB,gBAAiBE,CACrB,CACJ,CACA,MAAO,CAAE,CAACb,CAAG,EAAGnB,CAAM,CAC1B,EACMkC,GAAa,CACf,OAASR,EACT,aAAeA,EACf,kBAAoBJ,EACpB,uBAAyBD,EACzB,wBAA0BA,EAC1B,kBAAoBE,EACpB,kBAAoBF,EACpB,YAAcK,EACd,WAAaA,EACb,gBAAkBJ,EAClB,gBAAkBC,EAClB,gBAAkBF,EAClB,aAAeK,EACf,YAAcA,EACd,iBAAmBJ,EACnB,iBAAmBC,EACnB,iBAAmBF,EACnB,YAAcK,EACd,UAAYA,EACZ,eAAiBJ,EACjB,oBAAsBD,EACtB,qBAAuBA,EACvB,eAAiBE,EACjB,eAAiBF,EACjB,YAAcK,CAClB,EAEMS,GAAa,CACf,gBAAkBb,EAClB,MAAQA,EACR,QAAUJ,CACd,EAEMkB,GAAa,CACf,OAASf,EACT,UAAYA,EACZ,SAAWA,EACX,UAAYA,EACZ,SAAWA,EACX,MAAQA,CACZ,EAIMgB,GAAe,CAAC,EAAG,EAAG,CAAC,EACvBC,GAAW,CAAC,EAAG,EAAG,MAAM,EACxBC,GAAuB,CAACpB,EAAKnB,EAAOY,IAAc,CACpD,IAAI4B,EAAWH,GACXI,EAAU,CAAC,EACXzC,IAAU,OACVwC,EAAWF,GAGXG,EAAU,GAAGzC,CAAK,GAAG,MAAM,GAAG,EAElC,IAAM0C,EAAWtB,GAAaqB,EAAQ,CAAC,GAAKD,EAAS,CAAC,CAAC,EACjDG,EAAavB,GAAaqB,EAAQ,CAAC,GAAKD,EAAS,CAAC,CAAC,EACnDI,EAAYjC,EAAcC,EAAW6B,EAAQ,CAAC,GAAKD,EAAS,CAAC,CAAC,EACpE,MAAO,CAAE,SAAAE,EAAU,WAAAC,EAAY,UAAAC,CAAU,CAC7C,EACMC,GAAa,CACf,aAAetB,EACf,WAAaA,EACb,UAAYA,EACZ,KAAOgB,GACP,UAAYlB,EACZ,cAAgBE,EAChB,SAAWA,EACX,SAAWL,EACX,WAAaA,EACb,SAAWK,EACX,eAAiBA,EACjB,YAAcA,CAClB,EAEMuB,GAAsB,CAAC3B,EAAKnB,EAAOY,IAAc,CACnD,IAAMF,EAAQ,GAAGV,CAAK,GAAG,MAAM,GAAG,EAC5B+C,EAASpC,EAAcC,EAAWF,IAAQ,CAAC,GAAKV,CAAK,EACrDgD,EAAYrC,EAAcC,EAAWF,IAAQ,CAAC,GAAKV,CAAK,EAC9D,MAAO,CAAE,OAAA+C,EAAQ,UAAAC,CAAU,CAC/B,EACMC,GAAa,CACf,IAAMH,GACN,UAAYzB,EACZ,OAASA,CACb,EAEM6B,GAAa,CACf,YAAchC,EACd,OAASG,EACT,QAAUE,EACV,KAAOF,EACP,SAAWE,EACX,MAAQF,EACR,IAAMA,EACN,SAAWE,EACX,OAASL,CACb,EAEMiC,GAAkB,yBAClBC,GAAW,CAACtB,EAAO9B,IAAU,CAC/B,IAAMqD,EAAOvB,EAAM,SAAS,EAE5B,QAAQ,MAAM;AAAA;AAAA,MAEZuB,CAAI,KAAKrD,CAAK;AAAA,MACd,IAAI,OAAOqD,EAAK,OAAS,CAAC,CAAC;AAAA,kBACfA,CAAI;AAAA,GACnB,CACH,EAOMC,EAAiB,CAAC,CAAE,UAAAC,EAAW,UAAAC,EAAY,EAAG,cAAAC,EAAgB,EAAO,EAAI,CAAC,IAAM,CAACC,EAAO1D,EAAOY,IAAc,CAC/G,IAAM+C,KAAQ,GAAAC,SAAQ,GAAG5D,CAAK,EAAE,EAC1B6D,EAAQ,CAAC,EACf,QAASC,EAAI,EAAGA,EAAIH,EAAM,OAAQG,IAAK,CACnC,IAAMC,EAAOJ,EAAMG,CAAC,EAGpB,GAAIC,EAAK,OAAS,YACdA,EAAK,OAAS,UACdA,EAAK,OAAS,MACd,OAAAX,GAASM,EAAO1D,CAAK,EACd,CAAC,EAEZ,GAAI+D,EAAK,OAAS,OACd,GAAIA,EAAK,QAAU,QAAUN,EACzBI,EAAM,KAAKE,EAAK,KAAK,MAEpB,CACD,IAAMC,KAAS,GAAAC,SAAUF,EAAK,KAAK,EAEnC,GAAIC,GAAUb,GAAgB,SAASa,EAAO,IAAI,EAC9CH,EAAM,KAAKE,EAAK,KAAK,MAGrB,QAAAX,GAASM,EAAO1D,CAAK,EACd,CAAC,CAEhB,CAER,CAEA,GAAI6D,EAAM,OAASL,EACf,OAAAJ,GAASM,EAAO1D,CAAK,EACd,CAAC,EAEZ,IAAMkE,EAAQvD,EAAcC,EAAWiD,EAAM,CAAC,CAAC,EAC/C,GAAIN,EAAW,CACX,IAAMY,EAASxD,EAAcC,EAAWiD,EAAM,CAAC,GAAKA,EAAM,CAAC,CAAC,EACtDO,EAAQzD,EAAcC,EAAWiD,EAAM,CAAC,GAAKA,EAAM,CAAC,CAAC,EACrDQ,EAAS1D,EAAcC,EAAWiD,EAAM,CAAC,GAAKA,EAAM,CAAC,GAAKA,EAAM,CAAC,CAAC,EACxE,OAAON,EAAU,CAAE,MAAAW,EAAO,OAAAC,EAAQ,MAAAC,EAAO,OAAAC,CAAO,CAAC,CACrD,CACA,MAAO,CACH,CAACX,CAAK,EAAGQ,CACb,CACJ,EAEMI,GAAgBhB,EAAe,CACjC,UAAW,CAAC,CAAE,MAAAY,EAAO,OAAAC,EAAQ,MAAAC,EAAO,OAAAC,CAAO,KAAO,CAC9C,UAAWH,EACX,YAAaC,EACb,aAAcC,EACd,WAAYC,CAChB,GACA,UAAW,EACX,cAAe,EACnB,CAAC,EACKE,GAAwBjB,EAAe,CACzC,UAAW,CAAC,CAAE,MAAAY,EAAO,OAAAC,CAAO,KAAO,CAC/B,UAAWD,EACX,aAAcC,CAClB,GACA,UAAW,EACX,cAAe,EACnB,CAAC,EACKK,GAA0BlB,EAAe,CAC3C,UAAW,CAAC,CAAE,MAAAY,EAAO,OAAAC,CAAO,KAAO,CAC/B,YAAaD,EACb,WAAYC,CAChB,GACA,UAAW,EACX,cAAe,EACnB,CAAC,EACKM,GAAsBnB,EAAe,CACvC,cAAe,EACnB,CAAC,EACKoB,GAAa,CACf,OAASJ,GACT,aAAeG,GACf,iBAAmBD,GACnB,WAAaC,GACb,YAAcA,GACd,UAAYA,GACZ,eAAiBF,EACrB,EAEMI,GAAiBrB,EAAe,CAClC,UAAW,CAAC,CAAE,MAAAY,EAAO,OAAAC,EAAQ,MAAAC,EAAO,OAAAC,CAAO,KAAO,CAC9C,WAAYH,EACZ,aAAcC,EACd,cAAeC,EACf,YAAaC,CACjB,GACA,UAAW,CACf,CAAC,EACKO,GAAyBtB,EAAe,CAC1C,UAAW,CAAC,CAAE,MAAAY,EAAO,OAAAC,CAAO,KAAO,CAC/B,WAAYD,EACZ,cAAeC,CACnB,GACA,UAAW,CACf,CAAC,EACKU,GAA2BvB,EAAe,CAC5C,UAAW,CAAC,CAAE,MAAAY,EAAO,OAAAC,CAAO,KAAO,CAC/B,aAAcD,EACd,YAAaC,CACjB,GACA,UAAW,CACf,CAAC,EACKW,GAAuBxB,EAAe,EACtCyB,GAAa,CACf,QAAUJ,GACV,cAAgBG,GAChB,kBAAoBD,GACpB,YAAcC,GACd,aAAeA,GACf,WAAaA,GACb,gBAAkBF,EACtB,EAEMI,EAAiBhF,GAAU,CAC7B,OAAQA,EAAO,CACX,IAAK,MACL,IAAK,OACD,MAAO,KACX,IAAK,QACL,IAAK,SACD,MAAO,OACX,IAAK,SACD,MAAO,MACX,QACI,OAAOA,CACf,CACJ,EAEMiF,GAAwB,CAAC9D,EAAKnB,EAAOY,IAAc,CACrD,IAAMF,EAAQ,GAAGV,CAAK,GAAG,MAAM,GAAG,EAC5BkF,EAAkBF,EAAcrE,EAAcC,EAAWF,IAAQ,CAAC,GAAKV,CAAK,CAAC,EAC7EmF,EAAkBH,EAAcrE,EAAcC,EAAWF,IAAQ,CAAC,GAAKV,CAAK,CAAC,EACnF,MAAO,CAAE,gBAAAkF,EAAiB,gBAAAC,CAAgB,CAC9C,EACMC,GAA6B,CAACjE,EAAKnB,EAAOY,KAAe,CAC3D,CAACO,CAAG,EAAG6D,EAAcrE,EAAcC,EAAWZ,CAAK,CAAC,CACxD,GACMqF,GAAa,CACf,eAAiBJ,GACjB,gBAAkBG,GAClB,gBAAkBA,GAClB,UAAY7D,CAChB,EAEM+D,GAAWtF,GACT,OAAOA,GAAU,SACVA,EACJ,SAASA,EAAO,EAAE,EAGvBuF,GAAe,CACjB,KAAM,IACN,SAAU,IACV,WAAY,IACZ,WAAY,IACZ,MAAO,IACP,OAAQ,IACR,OAAQ,IACR,SAAU,IACV,SAAU,IACV,KAAM,IACN,UAAW,IACX,UAAW,IACX,MAAO,IACP,MAAO,GACX,EACMC,GAAuBxF,GAAU,CACnC,GAAI,CAACA,EACD,OAAOuF,GAAa,OACxB,GAAI,OAAOvF,GAAU,SACjB,OAAOA,EACX,IAAMyF,EAAKzF,EAAM,YAAY,EAC7B,OAAIuF,GAAaE,CAAE,EACRF,GAAaE,CAAE,EACnBH,GAAQtF,CAAK,CACxB,EACM0F,GAAoB,CAACvE,EAAKnB,KACrB,CAAE,CAACmB,CAAG,EAAGqE,GAAoBxF,CAAK,CAAE,GAEzC2F,GAAsB,CAAC3F,EAAO4F,EAAQhF,IAAc,CACtD,GAAIZ,IAAU,GACV,OAAOA,EACX,IAAM6F,EAAWlF,EAAcC,EAAWgF,EAAO,UAAY,EAAE,EACzDE,EAAanF,EAAcC,EAAWZ,CAAK,EAE3C,CAAE,QAAA+F,CAAQ,EAAIC,GAAaF,CAAU,GAAK,CAAC,EACjD,OAAIC,EACOA,EAAUF,EAEd,MAAM7F,CAAK,EAAI8F,EAAaA,EAAaD,CACpD,EACMI,GAAoB,CAAC9E,EAAKnB,EAAOY,EAAWgF,KACvC,CACH,CAACzE,CAAG,EAAGwE,GAAoB3F,EAAO4F,EAAQhF,CAAS,CACvD,GAEEsF,GAAa,CACf,UAAY3E,EACZ,WAAaA,EACb,SAAWF,EACX,UAAYE,EACZ,WAAamE,GACb,cAAgBrE,EAChB,WAAa4E,GACb,SAAW/E,EACX,UAAYK,EACZ,eAAiBA,EACjB,oBAAsBD,EACtB,oBAAsBC,EACtB,WAAaA,EACb,aAAeA,EACf,cAAgBA,EAChB,cAAgBA,CACpB,EAEM4E,GAAenG,GAAU,OAAOA,GAAU,UAAY,gBAAgB,KAAKA,CAAK,EAChFoG,GAAapG,GACX,OAAOA,GAAU,SACVA,EACPmG,GAAYnG,CAAK,EACV,WAAWA,CAAK,EACpBA,EAGLqG,GAASC,GAAoB,CAC/B,IAAMC,EAAaD,EAAgB,KAAK,EAAE,MAAM,WAAW,EAE3D,GAAIC,EAAW,SAAW,EACtB,MAAO,CAAC,CAACA,EAAW,CAAC,EAAG,EAAI,CAAC,EAEjC,IAAMC,EAAS,CAAC,EAChB,QAAS1C,EAAI,EAAGA,EAAIyC,EAAW,OAAQzC,GAAK,EAAG,CAC3C,IAAM2C,EAAYF,EAAWzC,CAAC,EAC9B,GAAI2C,EAAW,CACX,GAAM,CAACpD,EAAMqD,CAAQ,EAAID,EAAU,MAAM,GAAG,EACtCE,EAAYD,EAAS,QAAQ,GAAG,GAAK,EAAI,IAAM,IAC/C1G,EAAQ0G,EAAS,MAAMC,CAAS,EAAE,IAAKC,GAAQA,EAAI,KAAK,CAAC,EAC/DJ,EAAO,KAAK,CAAE,UAAWnD,EAAK,KAAK,EAAG,MAAArD,CAAM,CAAC,CACjD,CACJ,CACA,OAAOwG,CACX,EACMK,GAAc7G,GAAU,CAC1B,IAAM8G,EAAc,uBACd,CAAC,CAAEC,EAAOC,CAAI,EAAIF,EAAY,KAAK9G,CAAK,EACxCiH,EAAS,OAAO,WAAWF,CAAK,EACtC,OAAOC,IAAS,MAASC,EAAS,IAAO,KAAK,GAAKA,CACvD,EACMC,GAA8B,CAAC,CAAE,UAAAC,EAAW,MAAAnH,CAAM,IAAM,CAC1D,OAAQmH,EAAW,CACf,IAAK,QAAS,CACV,GAAM,CAACC,EAAQC,EAASD,CAAM,EAAIpH,EAAM,IAAKsH,GAAQ,OAAO,WAAWA,CAAG,CAAC,EAC3E,MAAO,CAAE,UAAW,QAAS,MAAO,CAACF,EAAQC,CAAM,CAAE,CACzD,CACA,IAAK,SACD,MAAO,CAAE,UAAW,QAAS,MAAO,CAAC,OAAO,WAAWrH,CAAK,EAAG,CAAC,CAAE,EAEtE,IAAK,SACD,MAAO,CAAE,UAAW,QAAS,MAAO,CAAC,EAAG,OAAO,WAAWA,CAAK,CAAC,CAAE,EAEtE,IAAK,SACD,MAAO,CAAE,UAAW,SAAU,MAAO,CAAC6G,GAAW7G,CAAK,CAAC,CAAE,EAE7D,IAAK,YACD,MAAO,CACH,UAAW,YACX,MAAOA,EAAM,IAAKsH,GAAQ,OAAO,WAAWA,CAAG,CAAC,CACpD,EAEJ,IAAK,aACD,MAAO,CACH,UAAW,YACX,MAAO,CAAC,OAAO,WAAWtH,CAAK,EAAG,CAAC,CACvC,EAEJ,IAAK,aACD,MAAO,CAAE,UAAW,YAAa,MAAO,CAAC,EAAG,OAAO,WAAWA,CAAK,CAAC,CAAE,EAE1E,IAAK,OACD,MAAO,CAAE,UAAW,OAAQ,MAAOA,EAAM,IAAI6G,EAAU,CAAE,EAE7D,IAAK,QACD,MAAO,CAAE,UAAW,OAAQ,MAAO,CAACA,GAAW7G,CAAK,EAAG,CAAC,CAAE,EAE9D,IAAK,QACD,MAAO,CAAE,UAAW,OAAQ,MAAO,CAAC,EAAG6G,GAAW7G,CAAK,CAAC,CAAE,EAE9D,QACI,MAAO,CAAE,UAAAmH,EAAW,MAAOnH,EAAM,IAAKsH,GAAQ,OAAO,WAAWA,CAAG,CAAC,CAAE,CAE9E,CACJ,EACMC,GAAaC,GACRA,EAAW,IAAKL,GAAcD,GAA4BC,CAAS,CAAC,EAEzEM,GAAmB,CAACtG,EAAKnB,IACvB,OAAOA,GAAU,SACV,CAAE,CAACmB,CAAG,EAAGnB,CAAM,EACnB,CAAE,CAACmB,CAAG,EAAGoG,GAAUlB,GAAMrG,CAAK,CAAC,CAAE,EAEtC0H,GAAoB,CAAE,IAAK,GAAM,OAAQ,EAAK,EAC9CC,GAA0B,CAACC,EAAGC,IAC5BH,GAAkBE,CAAC,EACZ,EACPF,GAAkBG,CAAC,EACZ,GACJ,EAELC,GAA0BC,GACxB,CAACA,GAAUA,EAAO,SAAW,EACtB,CAAC,SAAU,QAAQ,GACjBA,EAAO,SAAW,EAAI,CAACA,EAAO,CAAC,EAAG,QAAQ,EAAIA,GAC/C,KAAKJ,EAAuB,EAGtCK,GAAkC,CAAC7G,EAAKnB,EAAOY,IAAc,CAC/D,IAAMF,EAAQ,GAAGV,CAAK,GAAG,MAAM,GAAG,EAC5BiI,EAAOH,GAAuBpH,CAAK,EACnCwH,EAAmBvH,EAAcC,EAAWqH,EAAK,CAAC,CAAC,EACnDE,EAAmBxH,EAAcC,EAAWqH,EAAK,CAAC,CAAC,EACzD,MAAO,CACH,iBAAkBjD,EAAckD,CAAgB,GAAK9B,GAAU8B,CAAgB,EAC/E,iBAAkBlD,EAAcmD,CAAgB,GAAK/B,GAAU+B,CAAgB,CACnF,CACJ,EACMC,GAA8B,CAACjH,EAAKnB,EAAOY,IAAc,CAC3D,IAAMyH,EAAI1H,EAAcC,EAAWZ,CAAK,EACxC,MAAO,CAAE,CAACmB,CAAG,EAAG6D,EAAcqD,CAAC,GAAKjC,GAAUiC,CAAC,CAAE,CACrD,EACMC,GAAa,CACf,UAAWb,GACX,kBAAmBA,GACnB,gBAAkBO,GAClB,iBAAmBI,GACnB,iBAAmBA,EACvB,EAEMG,GAAW,CACb,KAAOjH,EACP,OAASA,EACT,gBAAkBC,EAClB,YAAcF,EACd,YAAcH,EACd,cAAgBA,EAChB,SAAWK,EACX,WAAaA,EACb,cAAgBA,EAChB,eAAiBA,EACjB,WAAaA,EACb,SAAWA,EACX,iBAAmBA,CACvB,EAEMiH,GAAa,CACf,GAAGtG,GACH,GAAGC,GACH,GAAGC,GACH,GAAGS,GACH,GAAGI,GACH,GAAGC,GACH,GAAGwB,GACH,GAAGK,GACH,GAAGM,GACH,GAAGa,GACH,GAAGoC,GACH,GAAGC,EACP,sDC1qBO,SAASE,GAAOC,EAAGC,EAAAA,CACtB,IAAIC,EAAI,CAAA,EACR,QAASC,KAAKH,EAAOI,OAAOC,UAAUC,eAAeC,KAAKP,EAAGG,CAAAA,GAAMF,EAAEO,QAAQL,CAAAA,EAAK,IAC9ED,EAAEC,CAAAA,EAAKH,EAAEG,CAAAA,GACb,GAAIH,GAAK,MAAgD,OAAjCI,OAAOK,uBAA0B,WAChD,CAAA,IAAIC,EAAI,EAAb,IAAgBP,EAAIC,OAAOK,sBAAsBT,CAAAA,EAAIU,EAAIP,EAAEQ,OAAQD,IAC3DT,EAAEO,QAAQL,EAAEO,CAAAA,CAAAA,EAAM,GAAKN,OAAOC,UAAUO,qBAAqBL,KAAKP,EAAGG,EAAEO,CAAAA,CAAAA,IACvER,EAAEC,EAAEO,CAAAA,CAAAA,EAAMV,EAAEG,EAAEO,CAAAA,CAAAA,EAF4B,CAItD,OAAOR,CACX,CC/BO,IAAMW,GAAeC,EAAMC,cAAgC,CAC9DC,MAAO,CACHC,YAAa,CAAA,CAAA,CAAA,EAIG,SAAAC,GAAMC,EAAAA,CAAA,GAAA,CAAAC,SAC1BA,EAAQC,WACRA,EACAL,MAAOM,EAAUC,QACjBA,EAAOC,QACPA,CAAAA,EAESL,EADNM,EAAIC,GAAAP,EANmB,CAAA,WAAA,aAAA,QAAA,UAAA,SAAA,CAAA,EAQ1B,IAAMQ,EAAaC,EAAQ,IAAA,CACvB,IAAMZ,EAAQa,GAAQ,CAClB,CACIC,YAAa,UACbb,YAAa,MACbc,YAAa,OAAA,EAAA,GAEbC,MAAMC,QAAQX,CAAAA,EAAcA,EAAa,CAACA,CAAAA,CAAAA,CAAAA,EAGlD,GAA4B,OAAjBN,EAAMkB,QAAW,SAAU,CAClC,GAAA,CAAOjB,EAAac,EAAaD,CAAAA,EAAed,EAAMkB,OAAOC,MAAM,KAAA,EAEnEnB,EAAMC,YAAcmB,OAAOC,WAAWpB,CAAAA,EACtCD,EAAMe,YAAcA,EACpBf,EAAMc,YAAcA,CACvB,MACgC,OAAjBd,EAAMkB,QAAW,WAC7BlB,EAAMC,YAAcD,EAAMkB,QAM9B,OAJiC,OAAtBlB,EAAMC,aAAgB,WAC7BD,EAAMC,YAAcmB,OAAOC,WAAWrB,EAAMC,WAAAA,GAGzCD,CAAK,EACb,CAACM,CAAAA,CAAAA,EAEEgB,EAAOV,EAAQ,IAAA,CACjB,IAAMW,EAA+B,CAAA,EAE/BC,EAAmBC,GAAAA,CACrB3B,EAAM4B,SAASC,QAAQF,EAAOG,GAAAA,CACrB9B,EAAM+B,eAAeD,CAAAA,IAItBA,EAAME,OAAShC,EAAMiC,SACrBP,EAAiBI,EAAMI,MAAuC5B,QAAAA,EAG9DmB,EAAOU,KAAKL,CAAAA,EACf,CAAA,CACH,EAIN,OAFAJ,EAAgBpB,CAAAA,EAGZmB,EAAOW,IAAI,CAACC,EAAIC,IACZtC,EAAMuC,aAAaF,EAAI,CACnBG,IAAK,aAAaF,CAAAA,GAClBG,UAAWH,IAAa,EACxBI,SAAUJ,IAAab,EAAOkB,OAAS,CAAA,CAAA,CAAA,CAGjD,EACH,CAACrC,CAAAA,CAAAA,EAEEJ,EAAQY,EAAQ,IAAM,CACxB,CACI8B,MAAO,MAAA,EAAA,GAEP1B,MAAMC,QAAQX,CAAAA,EAAcA,EAAa,CAACA,CAAAA,EAC9CK,EAAWI,cAAgB,QAAU,CACjCG,OAAQ,KAAA,EAAA,MACRyB,EACNC,OAAOC,OAAAA,EAAU,CAACvC,CAAAA,CAAAA,EAEdwC,EAAoBlC,EAA0B,KAAO,CACvDZ,MAAOW,EACPN,WAAAA,EACAE,QAAAA,EACAC,QAAAA,CAAAA,GACA,CAACG,EAAYN,EAAYE,EAASC,CAAAA,CAAAA,EAEtC,OACIV,EAAAA,cAACD,GAAakD,SAAS,CAAAC,MAAOF,CAAAA,EAC1BhD,EAAAmD,cAACC,GAAIC,OAAAC,OAAA,CAAA,EAAK3C,EAAI,CAAET,MAAOA,CAAAA,CAAAA,EAClBsB,CAAAA,CAAAA,CAIjB,CCxGwB,SAAA+B,GAASlD,EAAAA,CAAA,GAAA,CAAAC,SAACA,EAAUJ,MAAOM,EAAUiC,UAAEA,EAASC,SAAEA,CAAAA,EAAiCrC,EAApBM,EAAIC,GAAAP,EAA1D,CAAA,WAAA,QAAA,YAAA,UAAA,CAAA,EAC7B,GAAA,CAAMK,QAACA,EAASH,WAAYiD,CAAAA,EAAmBC,GAAW1D,EAAAA,EAEpD2D,EAAQ5C,EAAQ,IAAA,CAAA,IAAA6C,EAAAC,EAClB,IAAMnC,EAA+B,CAAA,EAE/BC,EAAmBC,GAAAA,CACrB3B,EAAM4B,SAASC,QAAQF,EAAOG,GAAAA,CACrB9B,EAAM+B,eAAeD,CAAAA,IAItBA,EAAME,OAAShC,EAAMiC,SACrBP,EAAiBI,EAAMI,MAAuC5B,QAAAA,EAG9DmB,EAAOU,KAAKL,CAAAA,EACf,CAAA,CACH,EAENJ,EAAgBpB,CAAAA,EAEhB,IAAIC,EAAqC,CAAA,EAEzC,OAAK,CAAOsD,EAAOC,CAAAA,IAAQrC,EAAOsC,QAAAA,EACjB,GAAAJ,EAATG,EAAI5B,SAAK,MAAA7B,IAAL6B,SAAK7B,EAAE2D,UACXzD,EAAW4B,MAAK8B,EAAAH,EAAI5B,SAAK,MAAA+B,IAAL/B,OAAK+B,OAAAA,EAAED,SAAAA,EAG3BzD,EAAW4B,KAAKqB,IAAkBK,CAAAA,CAAAA,EAI1C,IACMK,GADqB,EAAI3D,EAAW4D,OAAO,CAACC,EAAKC,IAAQD,GAAOC,GAAO,GAAI,CAAA,IAC1B5C,EAAOkB,OAASpC,EAAWuC,OAAOc,GAAkB,OAANA,GAAM,QAANA,EAAgBjB,QAIrH,OAFApC,EAAaA,EAAW6B,IAAIwB,GAAKA,IAALA,OAAuBM,EAA2BN,CAAAA,EAG1EnC,EAAOW,IAAI,CAACkC,EAAIC,IACZvE,EAAMuC,aAAa+B,EAAI,CACnBN,UAAWzD,EAAWgE,CAAAA,EACtB/B,IAAK,aAAa+B,CAAAA,QAClBC,aAAcD,IAAgB,EAC9BE,YAAaF,IAAgB9C,EAAOkB,OAAS,EAC7CF,UAAAA,EACAC,SAAAA,CAAAA,CAAAA,CAAAA,CAGV,EACH,CAACpC,EAAUkD,EAAiBf,EAAWC,CAAAA,CAAAA,EAE1C,OACI1C,EAACmD,cAAAC,GAAAA,OAAAA,OAAAA,CAAAA,EACOzC,EAAI,CACRT,MAAO,CACH,CACIwE,QAAS,OACTC,cAAe,KAAA,EAAA,GAEfzD,MAAMC,QAAQT,CAAAA,EAAWA,EAAU,CAACA,CAAAA,EAAAA,GACpCQ,MAAMC,QAAQX,CAAAA,EAAcA,EAAa,CAACA,CAAAA,CAAAA,CAAAA,CAAAA,EAGjDkD,CAAAA,CAGb,CCzEwB,SAAAkB,GAAYvE,EAAAA,CAAAA,GAAAA,CAAAC,SAACA,EAAQJ,MAAEA,CAAAA,EAAKG,EAAKM,EAAIC,GAAAP,EAAzB,CAAA,WAAA,OAAA,CAAA,EAChC,OACIL,EAACmD,cAAAI,GAAAA,OAAAA,OAAAA,CAAAA,EACO5C,EAAI,CACRT,MAAO,CACH,CACI2E,WAAY,MAAA,EAAA,GAEZ3D,MAAMC,QAAQjB,CAAAA,EAASA,EAAQ,CAACA,CAAAA,CAAAA,CAAAA,CAAAA,EAGvCI,CAAAA,CAGb,CCAwB,SAAAwE,GAAUzE,EAAAA,CAAA,GAAA,CAAAC,SAC9BA,EAAQ0D,UAAEA,EAASQ,aACnBA,EAAYC,YAAEA,EAAWhC,UACzBA,EAASC,SAAEA,CAAAA,EAEErC,EADVM,EAAIC,GAAAP,EAJuB,CAAA,WAAA,YAAA,eAAA,cAAA,YAAA,UAAA,CAAA,EAM9B,IAAM0E,EAAUjE,EAAQ,IAAA,CACpB,IAAMW,EAAwB,CAAA,EAExBC,EAAmBC,GAAAA,CACrB3B,EAAM4B,SAASC,QAAQF,EAAOG,GAAAA,CACtB9B,EAAM+B,eAAeD,CAAAA,GAAUA,GAAOE,OAAShC,EAAMiC,SACrDP,EAAiBI,EAAMI,MAAuC5B,QAAAA,EAG9DmB,EAAOU,KAAKL,CAAAA,CACf,CAAA,CACH,EAIN,OAFAJ,EAAgBpB,CAAAA,EAGZmB,EAAOW,IAAI,CAACN,EAAO+B,IAAAA,CACf,IAAMrB,EAAM,cAAcqB,CAAAA,WAE1B,OAAqB,OAAV/B,GAAU,UAA6B,OAAVA,GAAU,SAE1C9B,EAACmD,cAAA6B,GAAK,CAAAxC,IAAKA,CAAAA,EAAMV,CAAAA,EAIdA,CACV,CAAA,CAEP,EACH,CAACxB,CAAAA,CAAAA,EAAAA,CAEEG,QAACA,EAASP,MAAOW,CAAAA,EAAc4C,GAAW1D,EAAAA,EAC1CkF,EAAAA,IAAmBpE,EAAwB,aAAK,GAAjC,KAGfqE,EAAUpE,EAAQ,IAChBD,EAAWI,cAAgB,QACpB,CACHkE,UAAW,GAAGtE,EAAwB,aAAK,CAAA,MAAOA,EAAWI,WAAAA,IAAeJ,EAAWG,WAAAA,GACvFoE,YAAa,GAAGvE,EAAwB,aAAK,CAAA,MAAOA,EAAWI,WAAAA,IAAeJ,EAAWG,WAAAA,GACzFqE,aAAc,GAAGxE,EAAwB,aAAK,CAAA,MAAOA,EAAWI,WAAAA,IAAeJ,EAAWG,WAAAA,GAC1FsE,WAAY,GAAGzE,EAAwB,aAAK,CAAA,MAAOA,EAAWI,WAAAA,IAAeJ,EAAWG,WAAAA,GACxFuE,OAAQ,GAAGN,CAAAA,IAAgBR,EAAcQ,EAAe,GAAA,IAAOvC,EAAWuC,EAAe,CAAA,IAAKA,CAAAA,EAAAA,EAI3F,CACHE,UAAW1C,EAAAA,OAAwB,GAAG5B,EAAwB,aAAK,CAAA,MAAOA,EAAWI,WAAAA,IAAeJ,EAAWG,WAAAA,GAC/GsE,WAAYd,EAAAA,OAA2B,GAAG3D,EAAwB,aAAK,CAAA,MAAOA,EAAWI,WAAAA,IAAeJ,EAAWG,WAAAA,EAAAA,EAG5H,CAACH,EAAY2D,EAAcC,EAAahC,EAAWA,CAAAA,CAAAA,EAEtD,OACIzC,EAACmD,cAAAC,GACGC,OAAAC,OAAA,CAAAkC,KAAAA,EAAM,EACF7E,EACJ,CAAAT,MAAO,CAAA,OAAA,OAAA,OAAA,OAAA,CAAA,EAEIgF,CAAAA,EAAO,CACVO,KAAMzB,GAAa,EACnBU,QAAS,OACTC,cAAe,MACfe,WAAY,QAAA,CAAA,EAAA,GAEZxE,MAAMC,QAAQV,CAAAA,EAAWA,EAAU,CAACA,CAAAA,EAAAA,GACpCS,MAAMC,QAAQR,EAAKT,KAAAA,EAASS,EAAKT,MAAQ,CAACS,EAAKT,KAAAA,CAAAA,CAAAA,CAAAA,EAGtD6E,CAAAA,CAGb,CCjGA,OAAS,SAAAY,GAAO,QAAAC,GAAM,QAAAC,GAAM,QAAAC,OAAY,sBCDxC,IAAAC,GAA+C,QAC/C,OAAOC,OAAW,QAQX,IAAMC,GAAiB,MAAOC,GAAiB,CACpD,IAAMC,EAAkC,CACtC,OAAQ,EACR,MAAO,IACP,MAAO,CACL,KAAM,OACN,MAAO,MACT,CACF,EACA,OAAO,GAAAC,QAAO,UAAUF,EAAMC,CAAO,CACvC,EAGO,SAASE,EAAmBC,EAAmC,CACpE,GAAM,CAAE,cAAAC,EAAe,WAAAC,EAAY,KAAAC,EAAM,SAAAC,EAAW,CAAC,EAAG,OAAAC,EAAS,CAAC,CAAE,EAAIL,EASxE,GAPII,EAAS,KAAK,OAAOA,EAAS,IAC9BA,EAAS,QAAQ,OAAOA,EAAS,OACjCA,EAAS,OAAO,OAAOA,EAAS,MAChCA,EAAS,WAAW,OAAOA,EAAS,UACpCA,EAAS,UAAU,OAAOA,EAAS,SAGnC,MAAM,QAAQH,CAAa,GAAKA,EAAc,OAAS,EACzD,OAAOA,EAAc,IAAI,CAACK,EAAMC,IAC9BR,EAAmB,CACjB,cAAe,CAAE,GAAGO,EAAM,MAAO,CAAE,GAAGA,EAAK,MAAO,MAAAC,CAAM,CAAE,EAC1D,WAAAL,EACA,KAAAC,EACA,SAAU,CAAC,EACX,OAAAE,CACF,CAAC,CACH,EAIF,GACE,OAAOJ,GAAkB,UACzBA,IAAkB,MAClB,SAAUA,GACV,OAAO,KAAKC,CAAU,EAAE,SAASD,EAAc,IAAI,EACnD,CACA,GAAM,CAAE,KAAAO,EAAM,MAAAC,EAAQ,CAAC,EAAG,SAAAC,EAAU,QAAAC,EAAU,MAAO,EAAIV,EACnDW,EAAc,CAAE,GAAGR,EAAU,GAAGK,CAAM,EAGtCI,EAAYX,EAAWM,CAAI,EAEjC,GAAI,CAACK,EACH,eAAQ,KAAK,mBAAmBL,CAAI,kCAAkC,EAC/D,KAIT,IAAIM,EAAyB,KAEzBJ,IAAa,SACX,MAAM,QAAQA,CAAQ,EAExBI,EAAoBJ,EAAS,IAAI,CAACK,EAAOR,IACvCR,EAAmB,CACjB,cAAegB,EACf,WAAAb,EACA,KAAAC,EACA,SAAUS,EACV,OAAAP,CACF,CAAC,CACH,EAEA,OAAOK,GAAa,UACpBA,IAAa,MACb,SAAUA,EAGVI,EAAoBf,EAAmB,CACrC,cAAeW,EACf,WAAAR,EACA,KAAAC,EACA,SAAUS,EACV,OAAAP,CACF,CAAC,EAGDS,EAAoBJ,GAKxB,IAAMM,EAAoC,CACxC,GAAGJ,EACH,IAAK,OAAO,WAAW,CACzB,EAEIJ,IAAS,QACXQ,EAAa,KAAOb,EACpBa,EAAa,OAASX,GAIxB,GAAM,CAAE,YAAAY,EAAa,gBAAAC,EAAiB,GAAGC,CAAY,EAAIC,GACvD,CACE,GAAGJ,EACH,YAAaF,EACb,gBAAiBH,CACnB,EACAR,EACAE,CACF,EAGA,OADkBgB,GAAgBH,CAAe,EAE7CxB,GAAM,cAAcmB,EAAWM,EAAaF,CAAW,EACvD,IACN,CAGA,OAAOhB,CACT,CAEO,SAASqB,GAAoBtB,EAAmC,CACrE,GAAM,CAAE,cAAAC,EAAe,WAAAC,EAAY,KAAAC,EAAM,SAAAC,EAAW,CAAC,EAAG,OAAAC,EAAS,CAAC,CAAE,EAAIL,EASxE,GAPII,EAAS,KAAK,OAAOA,EAAS,IAC9BA,EAAS,QAAQ,OAAOA,EAAS,OACjCA,EAAS,OAAO,OAAOA,EAAS,MAChCA,EAAS,WAAW,OAAOA,EAAS,UACpCA,EAAS,UAAU,OAAOA,EAAS,SAGnC,MAAM,QAAQH,CAAa,GAAKA,EAAc,OAAS,EACzD,OAAOA,EAAc,IAAI,CAACK,EAAMC,IAC9Be,GAAoB,CAClB,cAAe,CAAE,GAAGhB,EAAM,MAAO,CAAE,GAAGA,EAAK,MAAO,MAAAC,CAAM,CAAE,EAC1D,WAAAL,EACA,KAAAC,EACA,SAAU,CAAC,EACX,OAAAE,CACF,CAAC,CACH,EAIF,GACE,OAAOJ,GAAkB,UACzBA,IAAkB,MAClB,SAAUA,GACV,OAAO,KAAKC,CAAU,EAAE,SAASD,EAAc,IAAI,EACnD,CACA,GAAM,CAAE,KAAAO,EAAM,MAAAC,EAAQ,CAAC,EAAG,SAAAC,EAAU,QAAAC,EAAU,MAAO,EAAIV,EACnDW,EAAc,CAAE,GAAGR,EAAU,GAAGK,CAAM,EAGtCI,EAAYX,EAAWM,CAAI,EAEjC,GAAI,CAACK,EACH,eAAQ,KAAK,mBAAmBL,CAAI,kCAAkC,EAC/D,KAIT,IAAIM,EAAyB,KAEzBJ,IAAa,SACX,MAAM,QAAQA,CAAQ,EAExBI,EAAoBJ,EAAS,IAAI,CAACK,EAAOR,IACvCe,GAAoB,CAClB,cAAeP,EACf,WAAAb,EACA,KAAAC,EACA,SAAUS,EACV,OAAAP,CACF,CAAC,CACH,EAEA,OAAOK,GAAa,UACpBA,IAAa,MACb,SAAUA,EAGVI,EAAoBQ,GAAoB,CACtC,cAAeZ,EACf,WAAAR,EACA,KAAAC,EACA,SAAUS,EACV,OAAAP,CACF,CAAC,EAGDS,EAAoBJ,GAKxB,IAAMM,EAAoC,CACxC,GAAGJ,EACH,IAAK,OAAO,WAAW,CACzB,EAEIJ,IAAS,QACXQ,EAAa,KAAOb,EACpBa,EAAa,OAASX,GAIxB,GAAM,CAAE,YAAAY,EAAa,gBAAAC,EAAiB,GAAGC,CAAY,EAAIC,GACvD,CACE,GAAGJ,EACH,YAAaF,EACb,gBAAiBH,CACnB,EACAR,EACAE,CACF,EAGA,OADkBgB,GAAgBH,CAAe,EAE7CxB,GAAM,cAAcmB,EAAWM,EAAaF,CAAW,EACvD,IACN,CAGA,OAAOhB,CACT,CAEO,IAAMmB,GAAe,CAC1BX,EACAN,EACAE,IACG,CACH,IAAMkB,EAAU,CAAE,MAAOpB,EAAM,OAAQM,EAAO,QAASJ,CAAO,EACxDmB,EAAgB,mBAEhBC,EAAsBC,GAAuB,CACjD,IAAMC,EAAU,MAAM,KAAKD,EAAM,SAASF,CAAa,CAAC,EAExD,GAAIG,EAAQ,SAAW,EACrB,OAAOD,EAIT,GAAIC,EAAQ,SAAW,GAAKA,EAAQ,CAAC,EAAE,CAAC,IAAMD,EAAO,CACnD,IAAME,EAAOD,EAAQ,CAAC,EAAE,CAAC,EAAE,KAAK,EAC1BE,EAAgBC,GAAkB,CAAE,IAAKP,EAAS,KAAAK,CAAK,CAAC,EAC9D,OAAOC,IAAkB,OAAYA,EAAgBH,CACvD,CAGA,OAAOC,EAAQ,OAAO,CAACI,EAAQC,IAAU,CACvC,IAAMJ,EAAOI,EAAM,CAAC,EAAE,KAAK,EACrBH,EAAgBC,GAAkB,CAAE,IAAKP,EAAS,KAAAK,CAAK,CAAC,EACxDK,EACJJ,IAAkB,OAAY,OAAOA,CAAa,EAAIG,EAAM,CAAC,EAC/D,OAAOD,EAAO,QAAQC,EAAM,CAAC,EAAGC,CAAW,CAC7C,EAAGP,CAAK,CACV,EAEA,OAAO,OAAO,YACZ,OAAO,QAAQjB,CAAK,EAAE,IAAI,CAAC,CAACyB,EAAKR,CAAK,IAAM,CAC1CQ,EACA,OAAOR,GAAU,SAAWD,EAAmBC,CAAK,EAAIA,CAC1D,CAAC,CACH,CACF,EAEaS,GAAaC,GAA4C,CACpE,GAAI,CAEF,OADY,KAAK,MAAMA,CAAU,CAEnC,MAAY,CACV,OAAO,IACT,CACF,EAEO,SAASN,GAAkB,CAChC,IAAAO,EACA,KAAAT,CACF,EAGQ,CAEN,IAAMU,EAAOV,EAAK,MAAM,GAAG,EAAE,OAAQM,GAAQA,EAAI,OAAS,CAAC,EAGvDK,EAAUF,EAGd,QAAWH,KAAOI,EAAM,CAEtB,GAAIC,GAAW,MAAQ,EAAEL,KAAOK,GAC9B,OAEFA,EAAUA,EAAQL,CAAG,CACvB,CAEA,OAAI,OAAOK,GAAY,SACd,KAAK,UAAUA,CAAO,EAExBA,CACT,CAEO,SAASlB,GAAgB,KAAc,CAC5C,GAAI,CACF,IAAM,OAAS,KAAK,IAAI,EACxB,OAAO,OAAO,QAAW,UAAY,OAAS,EAChD,OAASmB,EAAO,CACd,eAAQ,MAAM,0BAA0B,IAAI,KAAMA,CAAK,EAChD,EACT,CACF,CAEO,SAASC,GAAoBC,EAA6B,CAC/D,OAAO,IAAI,QAAQ,CAACC,EAASC,IAAW,CACtC,IAAMC,EAAS,IAAI,WAEnBA,EAAO,OAAS,SAAUC,EAAO,CAC/B,IAAMC,EAAUD,EAAM,QAAQ,OAC1B,OAAOC,GAAY,SACrBJ,EAAQI,CAAO,EAEfH,EAAO,IAAI,MAAM,8BAA8B,CAAC,CAEpD,EAEAC,EAAO,QAAU,SAAUL,EAAO,CAChCI,EAAOJ,CAAK,CACd,EAEAK,EAAO,cAAcH,CAAI,CAC3B,CAAC,CACH,CCxUO,IAAMM,GAA0B,CAAC,CACtC,MAAAC,EACA,UAAAC,EACA,KAAAC,EAAO,CAAC,EACR,OAAAC,EAAS,CAAC,EACV,YAAAC,EAAc,MAChB,IAAM,CACJ,IAAMC,EAAc,KAAK,MAAML,CAAK,EAEpC,GAAI,CAAC,MAAM,QAAQK,CAAW,EAAG,OAAO,KAExC,IAAMC,EAAcD,EAAY,IAAI,CAACE,EAAMC,KAAW,CACpD,GAAGP,EACH,MAAO,CACL,GAAGA,EAAU,MACb,CAACG,CAAW,EAAGG,EACf,CAAC,GAAGH,CAAW,OAAO,EAAGI,CAC3B,CACF,EAAE,EAEF,OAAOC,EAAmB,CACxB,cAAeH,EACf,WAAYI,GACZ,KAAAR,EACA,SAAU,CAAC,EACX,OAAAC,CACF,CAAC,CACH,ECvCA,OAAS,SAAAQ,OAAyB,sBAClC,OAAOC,OAAW,QAUT,cAAAC,OAAA,oBAPT,IAAMC,GAAyDC,GAAU,CACvE,GAAM,CAAE,WAAAC,EAAY,GAAGC,CAAW,EAAIF,EAChCG,EAAYC,GAAM,QACtB,SAAY,MAAMC,GAAeJ,CAAU,EAC3C,CAACA,CAAU,CACb,EAEA,OAAOH,GAACQ,GAAA,CAAM,IAAKH,EAAY,GAAGD,EAAY,CAChD,EAEOK,GAAQR,GHRR,IAAMS,GAAiB,CAC5B,KAAMC,GACN,KAAMC,GACN,KAAMC,GACN,MAAOC,GACP,MAAOC,GACP,GAAIC,GACJ,GAAIC,GACJ,GAAIC,GACJ,OAAQC,GACR,IAAKC,EAEP,ERgBS,cAAAC,OAAA,oBAvBF,IAAMC,GAA4C,CAAC,CACxD,KAAAC,EACA,SAAAC,CACF,IAAM,CACJ,IAAMC,EAAiBC,GAAUF,CAAQ,EACnCG,EAAaD,GAAUH,CAAI,GAElBE,GAAgB,OAA0B,CAAC,GACpD,QAASG,GAAqB,CAClCC,GAAK,SAASD,CAAI,CACpB,CAAC,EAED,IAAME,EAAiBL,GAAgB,YAAkC,CAAC,EACpEM,EAASN,GAAgB,QAAU,CAAC,EAEpCO,EAAqBC,EAAmB,CAC5C,cAAAH,EACA,WAAYI,GACZ,KAAMP,GAAc,CAAC,EACrB,SAAU,CAAC,EACX,OAAAI,CACF,CAAC,EAED,OAAOV,GAACc,GAAA,CAAU,SAAAH,EAAmB,CACvC,EDvBO,IAAMI,GAAmC,MAC9CC,EACAC,IACuB,CACvB,GAAI,CAEF,GAAI,CAACD,GAAY,CAACC,EAChB,MAAM,IAAI,MAAM,gCAAgC,EAIlD,IAAIC,EACJ,GAAI,CAEF,GADAA,EAAc,KAAK,MAAMF,CAAQ,EAC7B,CAACE,EAAY,YAAc,CAAC,MAAM,QAAQA,EAAY,UAAU,EAClE,MAAM,IAAI,MACR,iEACF,CAEJ,OAASC,EAAY,CACnB,MAAM,IAAI,MACR,0BAA0BA,aAAsB,MAAQA,EAAW,QAAU,uBAAuB,EACtG,CACF,CAGA,IAAIC,EACJ,GAAI,CAEF,GADAA,EAAU,KAAK,MAAMH,CAAI,EACrB,OAAOG,GAAY,UAAYA,IAAY,KAC7C,MAAM,IAAI,MAAM,kCAAkC,CAEtD,OAASD,EAAY,CACnB,MAAM,IAAI,MACR,sBAAsBA,aAAsB,MAAQA,EAAW,QAAU,uBAAuB,EAClG,CACF,CAGA,IAAME,EAAgCC,GAAM,cAAcC,GAAc,CACtE,KAAAN,EACA,SAAAD,CACF,CAAC,EAOD,OAJ6B,MAAMQ,GACjCH,CACF,EAAE,OAAO,CAGX,OAASI,EAAO,CAEd,IAAMC,EAA+B,IAAI,MACvC,0BAA0BD,aAAiB,MAAQA,EAAM,QAAU,eAAe,EACpF,EAEA,MAAAC,EAAS,cAAgBD,aAAiB,MAAQA,EAAQ,OAC1DC,EAAS,SAAWV,EACpBU,EAAS,KAAOT,EAEVS,CACR,CACF",
-  "names": ["require_queries", "__commonJSMin", "exports", "module", "MaxHeight", "value", "options", "MinHeight", "MaxWidth", "MinWidth", "Orientation", "type", "require_operators", "__commonJSMin", "exports", "module", "And", "left", "right", "options", "Or", "type", "require_parser", "__commonJSMin", "exports", "module", "Query", "Operator", "NUMBERS", "LETTERS", "WHITESPACE", "COLON", "COMMA", "AND", "AT", "tokenizer", "input", "current", "tokens", "char", "value", "parser", "output", "stack", "token", "walk", "head", "l", "r", "query", "ast", "require_src", "__commonJSMin", "exports", "module", "Parser", "queries", "options", "result", "query", "require_converter", "__commonJSMin", "exports", "module", "hslToRgb", "hue", "saturation", "lightness", "chroma", "huePrime", "secondComponent", "red", "green", "blue", "lightnessAdjustment", "require_hsl_to_hex", "__commonJSMin", "exports", "module", "toRgb", "max", "val", "n", "min", "cycle", "hsl", "hue", "saturation", "luminosity", "rgb", "require_color_name", "__commonJSMin", "exports", "module", "require_is_arrayish", "__commonJSMin", "exports", "module", "obj", "require_simple_swizzle", "__commonJSMin", "exports", "module", "isArrayish", "concat", "slice", "swizzle", "args", "results", "i", "len", "arg", "fn", "require_color_string", "__commonJSMin", "exports", "module", "colorNames", "swizzle", "hasOwnProperty", "reverseNames", "name", "cs", "string", "prefix", "val", "model", "abbr", "hex", "rgba", "per", "keyword", "rgb", "match", "i", "hexAlpha", "i2", "clamp", "hsl", "alpha", "h", "s", "l", "hwb", "w", "b", "hexDouble", "r", "g", "hsla", "hwba", "a", "num", "min", "max", "str", "require_parse", "__commonJSMin", "exports", "module", "openParentheses", "closeParentheses", "singleQuote", "doubleQuote", "backslash", "slash", "comma", "colon", "star", "uLower", "uUpper", "plus", "isUnicodeRange", "input", "tokens", "value", "next", "quote", "prev", "token", "escape", "escapePos", "whitespacePos", "parenthesesOpenPos", "pos", "code", "max", "stack", "balanced", "parent", "name", "before", "after", "require_unit", "__commonJSMin", "exports", "module", "minus", "plus", "dot", "exp", "EXP", "likeNumber", "value", "code", "nextCode", "nextNextCode", "pos", "length", "require_can_promise", "__commonJSMin", "exports", "module", "require_utils", "__commonJSMin", "exports", "toSJISFunction", "CODEWORDS_COUNT", "version", "data", "digit", "f", "kanji", "require_error_correction_level", "__commonJSMin", "exports", "fromString", "string", "level", "value", "defaultValue", "require_bit_buffer", "__commonJSMin", "exports", "module", "BitBuffer", "index", "bufIndex", "num", "length", "i", "bit", "require_bit_matrix", "__commonJSMin", "exports", "module", "BitMatrix", "size", "row", "col", "value", "reserved", "index", "require_alignment_pattern", "__commonJSMin", "exports", "getSymbolSize", "version", "posCount", "size", "intervals", "positions", "i", "coords", "pos", "posLength", "j", "require_finder_pattern", "__commonJSMin", "exports", "getSymbolSize", "FINDER_PATTERN_SIZE", "version", "size", "require_mask_pattern", "__commonJSMin", "exports", "PenaltyScores", "mask", "value", "data", "size", "points", "sameCountCol", "sameCountRow", "lastCol", "lastRow", "row", "col", "module", "last", "bitsCol", "bitsRow", "darkCount", "modulesCount", "getMaskAt", "maskPattern", "i", "j", "pattern", "setupFormatFunc", "numPatterns", "bestPattern", "lowerPenalty", "p", "penalty", "require_error_correction_code", "__commonJSMin", "exports", "ECLevel", "EC_BLOCKS_TABLE", "EC_CODEWORDS_TABLE", "version", "errorCorrectionLevel", "require_galois_field", "__commonJSMin", "exports", "EXP_TABLE", "LOG_TABLE", "x", "i", "n", "y", "require_polynomial", "__commonJSMin", "exports", "GF", "p1", "p2", "coeff", "i", "j", "divident", "divisor", "result", "offset", "degree", "poly", "require_reed_solomon_encoder", "__commonJSMin", "exports", "module", "Polynomial", "ReedSolomonEncoder", "degree", "data", "paddedData", "remainder", "start", "buff", "require_version_check", "__commonJSMin", "exports", "version", "require_regex", "__commonJSMin", "exports", "numeric", "alphanumeric", "kanji", "byte", "TEST_KANJI", "TEST_NUMERIC", "TEST_ALPHANUMERIC", "str", "require_mode", "__commonJSMin", "exports", "VersionCheck", "Regex", "mode", "version", "dataStr", "fromString", "string", "value", "defaultValue", "require_version", "__commonJSMin", "exports", "Utils", "ECCode", "ECLevel", "Mode", "VersionCheck", "G18", "G18_BCH", "getBestVersionForDataLength", "mode", "length", "errorCorrectionLevel", "currentVersion", "getReservedBitsCount", "version", "getTotalBitsFromDataArray", "segments", "totalBits", "data", "reservedBits", "getBestVersionForMixedData", "value", "defaultValue", "totalCodewords", "ecTotalCodewords", "dataTotalCodewordsBits", "usableBits", "seg", "ecl", "d", "require_format_info", "__commonJSMin", "exports", "Utils", "G15", "G15_MASK", "G15_BCH", "errorCorrectionLevel", "mask", "data", "d", "require_numeric_data", "__commonJSMin", "exports", "module", "Mode", "NumericData", "data", "length", "bitBuffer", "i", "group", "value", "remainingNum", "require_alphanumeric_data", "__commonJSMin", "exports", "module", "Mode", "ALPHA_NUM_CHARS", "AlphanumericData", "data", "length", "bitBuffer", "i", "value", "require_byte_data", "__commonJSMin", "exports", "module", "Mode", "ByteData", "data", "length", "bitBuffer", "i", "l", "require_kanji_data", "__commonJSMin", "exports", "module", "Mode", "Utils", "KanjiData", "data", "length", "bitBuffer", "i", "value", "require_dijkstra", "__commonJSMin", "exports", "module", "dijkstra", "graph", "s", "d", "predecessors", "costs", "open", "closest", "u", "v", "cost_of_s_to_u", "adjacent_nodes", "cost_of_e", "cost_of_s_to_u_plus_cost_of_e", "cost_of_s_to_v", "first_visit", "msg", "nodes", "predecessor", "opts", "T", "t", "key", "a", "b", "value", "cost", "item", "require_segments", "__commonJSMin", "exports", "Mode", "NumericData", "AlphanumericData", "ByteData", "KanjiData", "Regex", "Utils", "dijkstra", "getStringByteLength", "str", "getSegments", "regex", "mode", "segments", "result", "getSegmentsFromString", "dataStr", "numSegs", "alphaNumSegs", "byteSegs", "kanjiSegs", "s1", "s2", "obj", "getSegmentBitsLength", "length", "mergeSegments", "segs", "acc", "curr", "prevSeg", "buildNodes", "nodes", "i", "seg", "buildGraph", "version", "table", "graph", "prevNodeIds", "nodeGroup", "currentNodeIds", "j", "node", "key", "n", "prevNodeId", "buildSingleSegment", "data", "modesHint", "bestMode", "array", "path", "optimizedSegs", "require_qrcode", "__commonJSMin", "exports", "Utils", "ECLevel", "BitBuffer", "BitMatrix", "AlignmentPattern", "FinderPattern", "MaskPattern", "ECCode", "ReedSolomonEncoder", "Version", "FormatInfo", "Mode", "Segments", "setupFinderPattern", "matrix", "version", "size", "pos", "i", "row", "col", "r", "c", "setupTimingPattern", "value", "setupAlignmentPattern", "setupVersionInfo", "bits", "mod", "setupFormatInfo", "errorCorrectionLevel", "maskPattern", "setupData", "data", "inc", "bitIndex", "byteIndex", "dark", "createData", "segments", "buffer", "totalCodewords", "ecTotalCodewords", "dataTotalCodewordsBits", "remainingByte", "createCodewords", "bitBuffer", "dataTotalCodewords", "ecTotalBlocks", "blocksInGroup2", "blocksInGroup1", "totalCodewordsInGroup1", "dataCodewordsInGroup1", "dataCodewordsInGroup2", "ecCount", "rs", "offset", "dcData", "ecData", "maxDataSize", "b", "dataSize", "index", "createSymbol", "estimatedVersion", "rawSegments", "bestVersion", "dataBits", "moduleCount", "modules", "options", "mask", "require_utils", "__commonJSMin", "exports", "hex2rgba", "hex", "hexCode", "c", "hexValue", "options", "margin", "width", "scale", "qrSize", "opts", "imgData", "qr", "size", "data", "symbolSize", "scaledMargin", "palette", "i", "j", "posDst", "pxColor", "iSrc", "jSrc", "require_canvas", "__commonJSMin", "exports", "Utils", "clearCanvas", "ctx", "canvas", "size", "getCanvasElement", "qrData", "options", "opts", "canvasEl", "image", "type", "rendererOpts", "require_svg_tag", "__commonJSMin", "exports", "Utils", "getColorAttrib", "color", "attrib", "alpha", "str", "svgCmd", "cmd", "x", "y", "qrToPath", "data", "size", "margin", "path", "moveBy", "newRow", "lineLength", "i", "col", "row", "qrData", "options", "cb", "opts", "qrcodesize", "bg", "viewBox", "svgTag", "require_browser", "__commonJSMin", "exports", "canPromise", "QRCode", "CanvasRenderer", "SvgRenderer", "renderCanvas", "renderFunc", "canvas", "text", "opts", "cb", "args", "argsNum", "isLastArgCb", "resolve", "reject", "data", "e", "_", "pdf", "React", "Document", "Font", "castArray", "value", "compose", "fns", "args", "result", "reversedFns", "fn", "isPercent", "value", "matchPercent", "match", "f", "parseFloat$1", "value", "import_media_engine", "import_hsl_to_hex", "import_color_string", "import_parse", "import_unit", "compact", "array", "mergeStyles", "styles", "acc", "style", "s", "flatten", "key", "compose", "castArray", "isRgb", "value", "isHsl", "parseRgb", "rgb", "colorString", "parseHsl", "hsl", "hlsToHex", "transformColor", "parseValue", "match", "transformUnit", "container", "scalar", "outputDpi", "inputDpi", "mmFactor", "cmFactor", "processNumberValue", "key", "parseFloat$1", "processUnitValue", "processColorValue", "processNoopValue", "BORDER_SHORTHAND_REGEX", "matchBorderShorthand", "resolveBorderShorthand", "widthMatch", "styleMatch", "colorMatch", "style", "color", "width", "radius", "handlers$b", "handlers$a", "handlers$9", "flexDefaults", "flexAuto", "processFlexShorthand", "defaults", "matches", "flexGrow", "flexShrink", "flexBasis", "handlers$8", "processGapShorthand", "rowGap", "columnGap", "handlers$7", "handlers$6", "BOX_MODEL_UNITS", "logError", "name", "expandBoxModel", "expandsTo", "maxValues", "autoSupported", "model", "nodes", "parse$1", "parts", "i", "node", "result", "parseUnit", "first", "second", "third", "fourth", "processMargin", "processMarginVertical", "processMarginHorizontal", "processMarginSingle", "handlers$5", "processPadding", "processPaddingVertical", "processPaddingHorizontal", "processPaddingSingle", "handlers$4", "offsetKeyword", "processObjectPosition", "objectPositionX", "objectPositionY", "processObjectPositionValue", "handlers$3", "castInt", "FONT_WEIGHTS", "transformFontWeight", "lv", "processFontWeight", "transformLineHeight", "styles", "fontSize", "lineHeight", "percent", "matchPercent", "processLineHeight", "handlers$2", "matchNumber", "castFloat", "parse", "transformString", "transforms", "parsed", "transform", "rawValue", "splitChar", "val", "parseAngle", "unitsRegexp", "angle", "unit", "number", "normalizeTransformOperation", "operation", "scaleX", "scaleY", "num", "normalize", "operations", "processTransform", "Y_AXIS_SHORTHANDS", "sortTransformOriginPair", "a", "b", "getTransformOriginPair", "values", "processTransformOriginShorthand", "pair", "transformOriginX", "transformOriginY", "processTransformOriginValue", "v", "handlers$1", "handlers", "shorthands", "__rest", "s", "e", "t", "p", "Object", "prototype", "hasOwnProperty", "call", "indexOf", "getOwnPropertySymbols", "i", "length", "propertyIsEnumerable", "tableContext", "React", "createContext", "style", "borderWidth", "Table", "_a", "children", "weightings", "styleProps", "tdStyle", "trStyle", "rest", "__rest", "tableStyle", "useMemo", "flatten", "borderColor", "borderStyle", "Array", "isArray", "border", "split", "Number", "parseFloat", "rows", "output", "flattenChildren", "elem", "Children", "forEach", "child", "isValidElement", "type", "Fragment", "props", "push", "map", "tr", "rowIndex", "cloneElement", "key", "_firstRow", "_lastRow", "length", "width", "undefined", "filter", "Boolean", "tableContextValue", "Provider", "value", "createElement", "View", "Object", "assign", "TableRow", "tableWeightings", "useContext", "cells", "r", "e", "index", "row", "entries", "weighting", "_b", "weightingPerNotSpecified", "reduce", "acc", "val", "td", "columnIndex", "_firstColumn", "_lastColumn", "display", "flexDirection", "TableHeader", "fontWeight", "TableCell", "content", "Text", "borderMargin", "borders", "borderTop", "borderRight", "borderBottom", "borderLeft", "margin", "wrap", "flex", "alignItems", "Image", "Page", "Text", "View", "import_qrcode", "React", "generateQrCode", "text", "options", "QRCode", "renderPdfComponent", "args", "componentData", "components", "data", "allProps", "images", "item", "index", "type", "props", "children", "visible", "mergedProps", "Component", "processedChildren", "child", "propsWithKey", "mappedChild", "mappedIsVisible", "mappedProps", "mapDataProps", "safeBooleanEval", "renderHtmlComponent", "context", "templateRegex", "processStringValue", "value", "matches", "path", "resolvedValue", "getNestedProperty", "result", "match", "replacement", "key", "parseJson", "jsonString", "obj", "keys", "current", "error", "convertFileToBase64", "file", "resolve", "reject", "reader", "event", "content", "Map", "items", "component", "data", "images", "itemKeyWord", "parsedItems", "mappedItems", "item", "index", "renderPdfComponent", "PDF_COMPONENTS", "Image", "React", "jsx", "QrCode", "props", "qrCodeText", "imageProps", "qrCodeURL", "React", "generateQrCode", "Image", "QrCode_default", "PDF_COMPONENTS", "Page", "View", "Text", "Image", "d", "y", "a", "p", "QrCode_default", "Map", "jsx", "PdfGenerator", "data", "template", "templateObject", "parseJson", "dataObject", "font", "Font", "componentData", "images", "renderedComponents", "renderPdfComponent", "PDF_COMPONENTS", "Document", "generatePdf", "template", "data", "templateObj", "parseError", "dataObj", "document", "React", "PdfGenerator", "pdf", "error", "pdfError"]
+  "sources": ["../node_modules/media-engine/src/queries.js", "../node_modules/media-engine/src/operators.js", "../node_modules/media-engine/src/parser.js", "../node_modules/media-engine/src/index.js", "../node_modules/hsl-to-rgb-for-reals/converter.js", "../node_modules/hsl-to-hex/index.js", "../node_modules/color-name/index.js", "../node_modules/is-arrayish/index.js", "../node_modules/simple-swizzle/index.js", "../node_modules/color-string/index.js", "../node_modules/postcss-value-parser/lib/parse.js", "../node_modules/postcss-value-parser/lib/unit.js", "../node_modules/qrcode/lib/can-promise.js", "../node_modules/qrcode/lib/core/utils.js", "../node_modules/qrcode/lib/core/error-correction-level.js", "../node_modules/qrcode/lib/core/bit-buffer.js", "../node_modules/qrcode/lib/core/bit-matrix.js", "../node_modules/qrcode/lib/core/alignment-pattern.js", "../node_modules/qrcode/lib/core/finder-pattern.js", "../node_modules/qrcode/lib/core/mask-pattern.js", "../node_modules/qrcode/lib/core/error-correction-code.js", "../node_modules/qrcode/lib/core/galois-field.js", "../node_modules/qrcode/lib/core/polynomial.js", "../node_modules/qrcode/lib/core/reed-solomon-encoder.js", "../node_modules/qrcode/lib/core/version-check.js", "../node_modules/qrcode/lib/core/regex.js", "../node_modules/qrcode/lib/core/mode.js", "../node_modules/qrcode/lib/core/version.js", "../node_modules/qrcode/lib/core/format-info.js", "../node_modules/qrcode/lib/core/numeric-data.js", "../node_modules/qrcode/lib/core/alphanumeric-data.js", "../node_modules/qrcode/lib/core/byte-data.js", "../node_modules/qrcode/lib/core/kanji-data.js", "../node_modules/dijkstrajs/dijkstra.js", "../node_modules/qrcode/lib/core/segments.js", "../node_modules/qrcode/lib/core/qrcode.js", "../node_modules/qrcode/lib/renderer/utils.js", "../node_modules/qrcode/lib/renderer/canvas.js", "../node_modules/qrcode/lib/renderer/svg-tag.js", "../node_modules/qrcode/lib/browser.js", "../node_modules/extend/index.js", "../src/index.ts", "../src/components/PdfGenerator.tsx", "../node_modules/@react-pdf/fns/lib/index.js", "../node_modules/@react-pdf/stylesheet/lib/index.js", "../node_modules/@ag-media/react-pdf-table/node_modules/tslib/tslib.es6.js", "../node_modules/@ag-media/react-pdf-table/src/Table.tsx", "../node_modules/@ag-media/react-pdf-table/src/TableRow.tsx", "../node_modules/@ag-media/react-pdf-table/src/TableHeader.tsx", "../node_modules/@ag-media/react-pdf-table/src/TableCell.tsx", "../src/utils/pdf-components.ts", "../src/utils/helpers.ts", "../src/components/react-pdf/Map.tsx", "../src/components/react-pdf/QrCode.tsx", "../src/components/react-pdf/Markdown.tsx", "../node_modules/mdast-util-to-string/lib/index.js", "../node_modules/decode-named-character-reference/index.dom.js", "../node_modules/micromark-util-chunked/index.js", "../node_modules/micromark-util-combine-extensions/index.js", "../node_modules/micromark-util-decode-numeric-character-reference/index.js", "../node_modules/micromark-util-normalize-identifier/index.js", "../node_modules/micromark-util-character/index.js", "../node_modules/micromark-factory-space/index.js", "../node_modules/micromark/lib/initialize/content.js", "../node_modules/micromark/lib/initialize/document.js", "../node_modules/micromark-util-classify-character/index.js", "../node_modules/micromark-util-resolve-all/index.js", "../node_modules/micromark-core-commonmark/lib/attention.js", "../node_modules/micromark-core-commonmark/lib/autolink.js", "../node_modules/micromark-core-commonmark/lib/blank-line.js", "../node_modules/micromark-core-commonmark/lib/block-quote.js", "../node_modules/micromark-core-commonmark/lib/character-escape.js", "../node_modules/micromark-core-commonmark/lib/character-reference.js", "../node_modules/micromark-core-commonmark/lib/code-fenced.js", "../node_modules/micromark-core-commonmark/lib/code-indented.js", "../node_modules/micromark-core-commonmark/lib/code-text.js", "../node_modules/micromark-util-subtokenize/lib/splice-buffer.js", "../node_modules/micromark-util-subtokenize/index.js", "../node_modules/micromark-core-commonmark/lib/content.js", "../node_modules/micromark-factory-destination/index.js", "../node_modules/micromark-factory-label/index.js", "../node_modules/micromark-factory-title/index.js", "../node_modules/micromark-factory-whitespace/index.js", "../node_modules/micromark-core-commonmark/lib/definition.js", "../node_modules/micromark-core-commonmark/lib/hard-break-escape.js", "../node_modules/micromark-core-commonmark/lib/heading-atx.js", "../node_modules/micromark-util-html-tag-name/index.js", "../node_modules/micromark-core-commonmark/lib/html-flow.js", "../node_modules/micromark-core-commonmark/lib/html-text.js", "../node_modules/micromark-core-commonmark/lib/label-end.js", "../node_modules/micromark-core-commonmark/lib/label-start-image.js", "../node_modules/micromark-core-commonmark/lib/label-start-link.js", "../node_modules/micromark-core-commonmark/lib/line-ending.js", "../node_modules/micromark-core-commonmark/lib/thematic-break.js", "../node_modules/micromark-core-commonmark/lib/list.js", "../node_modules/micromark-core-commonmark/lib/setext-underline.js", "../node_modules/micromark/lib/initialize/flow.js", "../node_modules/micromark/lib/initialize/text.js", "../node_modules/micromark/lib/constructs.js", "../node_modules/micromark/lib/create-tokenizer.js", "../node_modules/micromark/lib/parse.js", "../node_modules/micromark/lib/postprocess.js", "../node_modules/micromark/lib/preprocess.js", "../node_modules/micromark-util-decode-string/index.js", "../node_modules/unist-util-stringify-position/lib/index.js", "../node_modules/mdast-util-from-markdown/lib/index.js", "../node_modules/remark-parse/lib/index.js", "../node_modules/zwitch/index.js", "../node_modules/mdast-util-to-markdown/lib/configure.js", "../node_modules/mdast-util-to-markdown/lib/handle/blockquote.js", "../node_modules/mdast-util-to-markdown/lib/util/pattern-in-scope.js", "../node_modules/mdast-util-to-markdown/lib/handle/break.js", "../node_modules/longest-streak/index.js", "../node_modules/mdast-util-to-markdown/lib/util/format-code-as-indented.js", "../node_modules/mdast-util-to-markdown/lib/util/check-fence.js", "../node_modules/mdast-util-to-markdown/lib/handle/code.js", "../node_modules/mdast-util-to-markdown/lib/util/check-quote.js", "../node_modules/mdast-util-to-markdown/lib/handle/definition.js", "../node_modules/mdast-util-to-markdown/lib/util/check-emphasis.js", "../node_modules/mdast-util-to-markdown/lib/util/encode-character-reference.js", "../node_modules/mdast-util-to-markdown/lib/util/encode-info.js", "../node_modules/mdast-util-to-markdown/lib/handle/emphasis.js", "../node_modules/unist-util-is/lib/index.js", "../node_modules/unist-util-visit-parents/lib/index.js", "../node_modules/unist-util-visit/lib/index.js", "../node_modules/mdast-util-to-markdown/lib/util/format-heading-as-setext.js", "../node_modules/mdast-util-to-markdown/lib/handle/heading.js", "../node_modules/mdast-util-to-markdown/lib/handle/html.js", "../node_modules/mdast-util-to-markdown/lib/handle/image.js", "../node_modules/mdast-util-to-markdown/lib/handle/image-reference.js", "../node_modules/mdast-util-to-markdown/lib/handle/inline-code.js", "../node_modules/mdast-util-to-markdown/lib/util/format-link-as-autolink.js", "../node_modules/mdast-util-to-markdown/lib/handle/link.js", "../node_modules/mdast-util-to-markdown/lib/handle/link-reference.js", "../node_modules/mdast-util-to-markdown/lib/util/check-bullet.js", "../node_modules/mdast-util-to-markdown/lib/util/check-bullet-other.js", "../node_modules/mdast-util-to-markdown/lib/util/check-bullet-ordered.js", "../node_modules/mdast-util-to-markdown/lib/util/check-rule.js", "../node_modules/mdast-util-to-markdown/lib/handle/list.js", "../node_modules/mdast-util-to-markdown/lib/util/check-list-item-indent.js", "../node_modules/mdast-util-to-markdown/lib/handle/list-item.js", "../node_modules/mdast-util-to-markdown/lib/handle/paragraph.js", "../node_modules/mdast-util-phrasing/lib/index.js", "../node_modules/mdast-util-to-markdown/lib/handle/root.js", "../node_modules/mdast-util-to-markdown/lib/util/check-strong.js", "../node_modules/mdast-util-to-markdown/lib/handle/strong.js", "../node_modules/mdast-util-to-markdown/lib/handle/text.js", "../node_modules/mdast-util-to-markdown/lib/util/check-rule-repetition.js", "../node_modules/mdast-util-to-markdown/lib/handle/thematic-break.js", "../node_modules/mdast-util-to-markdown/lib/handle/index.js", "../node_modules/mdast-util-to-markdown/lib/join.js", "../node_modules/mdast-util-to-markdown/lib/unsafe.js", "../node_modules/mdast-util-to-markdown/lib/util/association.js", "../node_modules/mdast-util-to-markdown/lib/util/compile-pattern.js", "../node_modules/mdast-util-to-markdown/lib/util/container-phrasing.js", "../node_modules/mdast-util-to-markdown/lib/util/container-flow.js", "../node_modules/mdast-util-to-markdown/lib/util/indent-lines.js", "../node_modules/mdast-util-to-markdown/lib/util/safe.js", "../node_modules/mdast-util-to-markdown/lib/util/track.js", "../node_modules/mdast-util-to-markdown/lib/index.js", "../node_modules/remark-stringify/lib/index.js", "../node_modules/bail/index.js", "../node_modules/unified/lib/index.js", "../node_modules/is-plain-obj/index.js", "../node_modules/trough/lib/index.js", "../node_modules/vfile-message/lib/index.js", "../node_modules/vfile/lib/minpath.browser.js", "../node_modules/vfile/lib/minproc.browser.js", "../node_modules/vfile/lib/minurl.shared.js", "../node_modules/vfile/lib/minurl.browser.js", "../node_modules/vfile/lib/index.js", "../node_modules/unified/lib/callable-instance.js", "../node_modules/remark/index.js"],
+  "sourcesContent": ["function MaxHeight(value) {\n  this.value = value;\n\n  this.match = function(options) {\n    return this.value >= options.height;\n  };\n}\n\nfunction MinHeight(value) {\n  this.value = value;\n\n  this.match = function(options) {\n    return this.value < options.height;\n  };\n}\n\nfunction MaxWidth(value) {\n  this.value = value;\n\n  this.match = function(options) {\n    return this.value >= options.width;\n  };\n}\n\nfunction MinWidth(value) {\n  this.value = value;\n\n  this.match = function(options) {\n    return this.value < options.width;\n  };\n}\n\nfunction Orientation(value) {\n  this.value = value;\n\n  this.match = function(options) {\n    return this.value === options.orientation;\n  };\n}\n\nmodule.exports = function Query(type, value) {\n  switch (type) {\n    case 'max-height':\n      return new MaxHeight(value);\n    case 'min-height':\n      return new MinHeight(value);\n    case 'max-width':\n      return new MaxWidth(value);\n    case 'min-width':\n      return new MinWidth(value);\n    case 'orientation':\n      return new Orientation(value);\n    default:\n      throw new Error(value);\n  }\n};\n", "function And(left, right) {\n  this.left = left;\n  this.right = right;\n\n  this.match = function(options) {\n    return left.match(options) && right.match(options);\n  };\n}\n\nfunction Or(left, right) {\n  this.left = left;\n  this.right = right;\n\n  this.match = function(options) {\n    return left.match(options) || right.match(options);\n  };\n}\n\nmodule.exports = function Operator(type, left, right) {\n  switch (type) {\n    case 'and':\n      return new And(left, right);\n    case ',':\n      return new Or(left, right);\n    default:\n      throw new Error(value);\n  }\n};\n", "var Query = require('./queries');\nvar Operator = require('./operators');\n\nvar NUMBERS = /[0-9]/;\nvar LETTERS = /[a-z|\\-]/i;\nvar WHITESPACE = /\\s/;\nvar COLON = /:/;\nvar COMMA = /,/;\nvar AND = /and$/;\nvar AT = /@/;\n\nfunction tokenizer(input) {\n  var current = 0;\n  var tokens = [];\n\n  while (current < input.length) {\n    var char = input[current];\n\n    if (AT.test(char)) {\n      char = input[++current];\n      while (LETTERS.test(char) && char !== undefined) {\n        char = input[++current];\n      }\n    }\n\n    if (WHITESPACE.test(char) || char === ')' || char === '(') {\n      current++;\n      continue;\n    }\n\n    if (COLON.test(char) || COMMA.test(char)) {\n      current++;\n      tokens.push({ type: 'operator', value: char });\n      continue;\n    }\n\n    if (NUMBERS.test(char)) {\n      var value = '';\n      while (NUMBERS.test(char)) {\n        value += char;\n        char = input[++current];\n      }\n\n      tokens.push({ type: 'number', value: value });\n      continue;\n    }\n\n    if (LETTERS.test(char)) {\n      var value = '';\n      while (LETTERS.test(char) && char !== undefined) {\n        value += char;\n        char = input[++current];\n      }\n      if (AND.test(value)) {\n        tokens.push({ type: 'operator', value: value });\n      } else {\n        tokens.push({ type: 'literal', value: value });\n      }\n\n      continue;\n    }\n\n    throw new TypeError(\n      'Tokenizer: I dont know what this character is: ' + char\n    );\n  }\n\n  return tokens;\n}\n\nfunction parser(tokens) {\n  var output = [];\n  var stack = [];\n\n  while (tokens.length > 0) {\n    var token = tokens.shift();\n\n    if (token.type === 'number' || token.type === 'literal') {\n      output.push(token);\n      continue;\n    }\n\n    if (token.type === 'operator') {\n      if (COLON.test(token.value)) {\n        token = { type: 'query', key: output.pop(), value: tokens.shift() };\n        output.push(token);\n        continue;\n      }\n\n      while (stack.length > 0) {\n        output.unshift(stack.pop());\n      }\n      stack.push(token);\n    }\n  }\n\n  while (stack.length > 0) {\n    output.unshift(stack.pop());\n  }\n\n  function walk() {\n    var head = output.shift();\n\n    if (head.type === 'number') {\n      return parseInt(head.value);\n    }\n\n    if (head.type === 'literal') {\n      return head.value;\n    }\n\n    if (head.type === 'operator') {\n      var l = walk();\n      var r = walk();\n\n      return Operator(head.value, l, r);\n    }\n\n    if (head.type === 'query') {\n      var l = head.key.value;\n      var r = head.value.value;\n\n      return Query(l, r);\n    }\n  }\n\n  return walk();\n}\n\nmodule.exports = {\n  parse: function(query) {\n    var tokens = tokenizer(query);\n    var ast = parser(tokens);\n    return ast;\n  }\n};\n", "var Parser = require('./parser');\n\nmodule.exports = function(queries, options) {\n  var result = {};\n\n  Object.keys(queries).forEach(function(query) {\n    if (Parser.parse(query).match(options)) {\n      Object.assign(result, queries[query]);\n    }\n  });\n\n  return result;\n};\n", "// expected hue range: [0, 360)\n// expected saturation range: [0, 1]\n// expected lightness range: [0, 1]\nvar hslToRgb = function(hue, saturation, lightness){\n  // based on algorithm from http://en.wikipedia.org/wiki/HSL_and_HSV#Converting_to_RGB\n  if( hue == undefined ){\n    return [0, 0, 0];\n  }\n\n  var chroma = (1 - Math.abs((2 * lightness) - 1)) * saturation;\n  var huePrime = hue / 60;\n  var secondComponent = chroma * (1 - Math.abs((huePrime % 2) - 1));\n\n  huePrime = Math.floor(huePrime);\n  var red;\n  var green;\n  var blue;\n\n  if( huePrime === 0 ){\n    red = chroma;\n    green = secondComponent;\n    blue = 0;\n  }else if( huePrime === 1 ){\n    red = secondComponent;\n    green = chroma;\n    blue = 0;\n  }else if( huePrime === 2 ){\n    red = 0;\n    green = chroma;\n    blue = secondComponent;\n  }else if( huePrime === 3 ){\n    red = 0;\n    green = secondComponent;\n    blue = chroma;\n  }else if( huePrime === 4 ){\n    red = secondComponent;\n    green = 0;\n    blue = chroma;\n  }else if( huePrime === 5 ){\n    red = chroma;\n    green = 0;\n    blue = secondComponent;\n  }\n\n  var lightnessAdjustment = lightness - (chroma / 2);\n  red += lightnessAdjustment;\n  green += lightnessAdjustment;\n  blue += lightnessAdjustment;\n\n  return [\n      Math.abs(Math.round(red * 255)),\n      Math.abs(Math.round(green * 255)),\n      Math.abs(Math.round(blue * 255))\n  ];\n\n};\n\nmodule.exports = hslToRgb;\n", "// In our case, there's only one dependency\n\nvar toRgb = require('hsl-to-rgb-for-reals')\n\n// Typically all dependencies should be declared at the top of the file.\n\n// Now let's define an API for our module, we're taking hue, saturation and luminosity values and outputting a CSS compatible hex string.\n// Hue is in degrees, between 0 and 359. Since degrees a cyclical in nature, we'll support numbers greater than 359 or less than 0 by \"spinning\" them around until they fall within the 0 to 359 range.\n// Saturation and luminosity are both percentages, we'll represent these percentages with whole numbers between 0 and 100. For these numbers we'll need to enforce a maximum and a minimum, anything below 0 will become 0, anything above 100 will become 100.\n// Let's write some utility functions to handle this logic:\n\nfunction max (val, n) {\n  return (val > n) ? n : val\n}\n\nfunction min (val, n) {\n  return (val < n) ? n : val\n}\n\nfunction cycle (val) {\n  // for safety:\n  val = max(val, 1e7)\n  val = min(val, -1e7)\n  // cycle value:\n  while (val < 0) { val += 360 }\n  while (val > 359) { val -= 360 }\n  return val\n}\n\n// Now for the main piece, the `hsl` function:\n\nfunction hsl (hue, saturation, luminosity) {\n  // resolve degrees to 0 - 359 range\n  hue = cycle(hue)\n\n  // enforce constraints\n  saturation = min(max(saturation, 100), 0)\n  luminosity = min(max(luminosity, 100), 0)\n\n  // convert to 0 to 1 range used by hsl-to-rgb-for-reals\n  saturation /= 100\n  luminosity /= 100\n\n  // let hsl-to-rgb-for-reals do the hard work\n  var rgb = toRgb(hue, saturation, luminosity)\n\n  // convert each value in the returned RGB array\n  // to a 2 character hex value, join the array into\n  // a string, prefixed with a hash\n  return '#' + rgb\n    .map(function (n) {\n      return (256 + n).toString(16).substr(-2)\n    })\n    .join('')\n}\n\n// In order to make our code into a bona fide module we have to export it:\n\nmodule.exports = hsl\n", "'use strict'\r\n\r\nmodule.exports = {\r\n\t\"aliceblue\": [240, 248, 255],\r\n\t\"antiquewhite\": [250, 235, 215],\r\n\t\"aqua\": [0, 255, 255],\r\n\t\"aquamarine\": [127, 255, 212],\r\n\t\"azure\": [240, 255, 255],\r\n\t\"beige\": [245, 245, 220],\r\n\t\"bisque\": [255, 228, 196],\r\n\t\"black\": [0, 0, 0],\r\n\t\"blanchedalmond\": [255, 235, 205],\r\n\t\"blue\": [0, 0, 255],\r\n\t\"blueviolet\": [138, 43, 226],\r\n\t\"brown\": [165, 42, 42],\r\n\t\"burlywood\": [222, 184, 135],\r\n\t\"cadetblue\": [95, 158, 160],\r\n\t\"chartreuse\": [127, 255, 0],\r\n\t\"chocolate\": [210, 105, 30],\r\n\t\"coral\": [255, 127, 80],\r\n\t\"cornflowerblue\": [100, 149, 237],\r\n\t\"cornsilk\": [255, 248, 220],\r\n\t\"crimson\": [220, 20, 60],\r\n\t\"cyan\": [0, 255, 255],\r\n\t\"darkblue\": [0, 0, 139],\r\n\t\"darkcyan\": [0, 139, 139],\r\n\t\"darkgoldenrod\": [184, 134, 11],\r\n\t\"darkgray\": [169, 169, 169],\r\n\t\"darkgreen\": [0, 100, 0],\r\n\t\"darkgrey\": [169, 169, 169],\r\n\t\"darkkhaki\": [189, 183, 107],\r\n\t\"darkmagenta\": [139, 0, 139],\r\n\t\"darkolivegreen\": [85, 107, 47],\r\n\t\"darkorange\": [255, 140, 0],\r\n\t\"darkorchid\": [153, 50, 204],\r\n\t\"darkred\": [139, 0, 0],\r\n\t\"darksalmon\": [233, 150, 122],\r\n\t\"darkseagreen\": [143, 188, 143],\r\n\t\"darkslateblue\": [72, 61, 139],\r\n\t\"darkslategray\": [47, 79, 79],\r\n\t\"darkslategrey\": [47, 79, 79],\r\n\t\"darkturquoise\": [0, 206, 209],\r\n\t\"darkviolet\": [148, 0, 211],\r\n\t\"deeppink\": [255, 20, 147],\r\n\t\"deepskyblue\": [0, 191, 255],\r\n\t\"dimgray\": [105, 105, 105],\r\n\t\"dimgrey\": [105, 105, 105],\r\n\t\"dodgerblue\": [30, 144, 255],\r\n\t\"firebrick\": [178, 34, 34],\r\n\t\"floralwhite\": [255, 250, 240],\r\n\t\"forestgreen\": [34, 139, 34],\r\n\t\"fuchsia\": [255, 0, 255],\r\n\t\"gainsboro\": [220, 220, 220],\r\n\t\"ghostwhite\": [248, 248, 255],\r\n\t\"gold\": [255, 215, 0],\r\n\t\"goldenrod\": [218, 165, 32],\r\n\t\"gray\": [128, 128, 128],\r\n\t\"green\": [0, 128, 0],\r\n\t\"greenyellow\": [173, 255, 47],\r\n\t\"grey\": [128, 128, 128],\r\n\t\"honeydew\": [240, 255, 240],\r\n\t\"hotpink\": [255, 105, 180],\r\n\t\"indianred\": [205, 92, 92],\r\n\t\"indigo\": [75, 0, 130],\r\n\t\"ivory\": [255, 255, 240],\r\n\t\"khaki\": [240, 230, 140],\r\n\t\"lavender\": [230, 230, 250],\r\n\t\"lavenderblush\": [255, 240, 245],\r\n\t\"lawngreen\": [124, 252, 0],\r\n\t\"lemonchiffon\": [255, 250, 205],\r\n\t\"lightblue\": [173, 216, 230],\r\n\t\"lightcoral\": [240, 128, 128],\r\n\t\"lightcyan\": [224, 255, 255],\r\n\t\"lightgoldenrodyellow\": [250, 250, 210],\r\n\t\"lightgray\": [211, 211, 211],\r\n\t\"lightgreen\": [144, 238, 144],\r\n\t\"lightgrey\": [211, 211, 211],\r\n\t\"lightpink\": [255, 182, 193],\r\n\t\"lightsalmon\": [255, 160, 122],\r\n\t\"lightseagreen\": [32, 178, 170],\r\n\t\"lightskyblue\": [135, 206, 250],\r\n\t\"lightslategray\": [119, 136, 153],\r\n\t\"lightslategrey\": [119, 136, 153],\r\n\t\"lightsteelblue\": [176, 196, 222],\r\n\t\"lightyellow\": [255, 255, 224],\r\n\t\"lime\": [0, 255, 0],\r\n\t\"limegreen\": [50, 205, 50],\r\n\t\"linen\": [250, 240, 230],\r\n\t\"magenta\": [255, 0, 255],\r\n\t\"maroon\": [128, 0, 0],\r\n\t\"mediumaquamarine\": [102, 205, 170],\r\n\t\"mediumblue\": [0, 0, 205],\r\n\t\"mediumorchid\": [186, 85, 211],\r\n\t\"mediumpurple\": [147, 112, 219],\r\n\t\"mediumseagreen\": [60, 179, 113],\r\n\t\"mediumslateblue\": [123, 104, 238],\r\n\t\"mediumspringgreen\": [0, 250, 154],\r\n\t\"mediumturquoise\": [72, 209, 204],\r\n\t\"mediumvioletred\": [199, 21, 133],\r\n\t\"midnightblue\": [25, 25, 112],\r\n\t\"mintcream\": [245, 255, 250],\r\n\t\"mistyrose\": [255, 228, 225],\r\n\t\"moccasin\": [255, 228, 181],\r\n\t\"navajowhite\": [255, 222, 173],\r\n\t\"navy\": [0, 0, 128],\r\n\t\"oldlace\": [253, 245, 230],\r\n\t\"olive\": [128, 128, 0],\r\n\t\"olivedrab\": [107, 142, 35],\r\n\t\"orange\": [255, 165, 0],\r\n\t\"orangered\": [255, 69, 0],\r\n\t\"orchid\": [218, 112, 214],\r\n\t\"palegoldenrod\": [238, 232, 170],\r\n\t\"palegreen\": [152, 251, 152],\r\n\t\"paleturquoise\": [175, 238, 238],\r\n\t\"palevioletred\": [219, 112, 147],\r\n\t\"papayawhip\": [255, 239, 213],\r\n\t\"peachpuff\": [255, 218, 185],\r\n\t\"peru\": [205, 133, 63],\r\n\t\"pink\": [255, 192, 203],\r\n\t\"plum\": [221, 160, 221],\r\n\t\"powderblue\": [176, 224, 230],\r\n\t\"purple\": [128, 0, 128],\r\n\t\"rebeccapurple\": [102, 51, 153],\r\n\t\"red\": [255, 0, 0],\r\n\t\"rosybrown\": [188, 143, 143],\r\n\t\"royalblue\": [65, 105, 225],\r\n\t\"saddlebrown\": [139, 69, 19],\r\n\t\"salmon\": [250, 128, 114],\r\n\t\"sandybrown\": [244, 164, 96],\r\n\t\"seagreen\": [46, 139, 87],\r\n\t\"seashell\": [255, 245, 238],\r\n\t\"sienna\": [160, 82, 45],\r\n\t\"silver\": [192, 192, 192],\r\n\t\"skyblue\": [135, 206, 235],\r\n\t\"slateblue\": [106, 90, 205],\r\n\t\"slategray\": [112, 128, 144],\r\n\t\"slategrey\": [112, 128, 144],\r\n\t\"snow\": [255, 250, 250],\r\n\t\"springgreen\": [0, 255, 127],\r\n\t\"steelblue\": [70, 130, 180],\r\n\t\"tan\": [210, 180, 140],\r\n\t\"teal\": [0, 128, 128],\r\n\t\"thistle\": [216, 191, 216],\r\n\t\"tomato\": [255, 99, 71],\r\n\t\"turquoise\": [64, 224, 208],\r\n\t\"violet\": [238, 130, 238],\r\n\t\"wheat\": [245, 222, 179],\r\n\t\"white\": [255, 255, 255],\r\n\t\"whitesmoke\": [245, 245, 245],\r\n\t\"yellow\": [255, 255, 0],\r\n\t\"yellowgreen\": [154, 205, 50]\r\n};\r\n", "module.exports = function isArrayish(obj) {\n\tif (!obj || typeof obj === 'string') {\n\t\treturn false;\n\t}\n\n\treturn obj instanceof Array || Array.isArray(obj) ||\n\t\t(obj.length >= 0 && (obj.splice instanceof Function ||\n\t\t\t(Object.getOwnPropertyDescriptor(obj, (obj.length - 1)) && obj.constructor.name !== 'String')));\n};\n", "'use strict';\n\nvar isArrayish = require('is-arrayish');\n\nvar concat = Array.prototype.concat;\nvar slice = Array.prototype.slice;\n\nvar swizzle = module.exports = function swizzle(args) {\n\tvar results = [];\n\n\tfor (var i = 0, len = args.length; i < len; i++) {\n\t\tvar arg = args[i];\n\n\t\tif (isArrayish(arg)) {\n\t\t\t// http://jsperf.com/javascript-array-concat-vs-push/98\n\t\t\tresults = concat.call(results, slice.call(arg));\n\t\t} else {\n\t\t\tresults.push(arg);\n\t\t}\n\t}\n\n\treturn results;\n};\n\nswizzle.wrap = function (fn) {\n\treturn function () {\n\t\treturn fn(swizzle(arguments));\n\t};\n};\n", "/* MIT license */\nvar colorNames = require('color-name');\nvar swizzle = require('simple-swizzle');\nvar hasOwnProperty = Object.hasOwnProperty;\n\nvar reverseNames = Object.create(null);\n\n// create a list of reverse color names\nfor (var name in colorNames) {\n\tif (hasOwnProperty.call(colorNames, name)) {\n\t\treverseNames[colorNames[name]] = name;\n\t}\n}\n\nvar cs = module.exports = {\n\tto: {},\n\tget: {}\n};\n\ncs.get = function (string) {\n\tvar prefix = string.substring(0, 3).toLowerCase();\n\tvar val;\n\tvar model;\n\tswitch (prefix) {\n\t\tcase 'hsl':\n\t\t\tval = cs.get.hsl(string);\n\t\t\tmodel = 'hsl';\n\t\t\tbreak;\n\t\tcase 'hwb':\n\t\t\tval = cs.get.hwb(string);\n\t\t\tmodel = 'hwb';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tval = cs.get.rgb(string);\n\t\t\tmodel = 'rgb';\n\t\t\tbreak;\n\t}\n\n\tif (!val) {\n\t\treturn null;\n\t}\n\n\treturn {model: model, value: val};\n};\n\ncs.get.rgb = function (string) {\n\tif (!string) {\n\t\treturn null;\n\t}\n\n\tvar abbr = /^#([a-f0-9]{3,4})$/i;\n\tvar hex = /^#([a-f0-9]{6})([a-f0-9]{2})?$/i;\n\tvar rgba = /^rgba?\\(\\s*([+-]?\\d+)(?=[\\s,])\\s*(?:,\\s*)?([+-]?\\d+)(?=[\\s,])\\s*(?:,\\s*)?([+-]?\\d+)\\s*(?:[,|\\/]\\s*([+-]?[\\d\\.]+)(%?)\\s*)?\\)$/;\n\tvar per = /^rgba?\\(\\s*([+-]?[\\d\\.]+)\\%\\s*,?\\s*([+-]?[\\d\\.]+)\\%\\s*,?\\s*([+-]?[\\d\\.]+)\\%\\s*(?:[,|\\/]\\s*([+-]?[\\d\\.]+)(%?)\\s*)?\\)$/;\n\tvar keyword = /^(\\w+)$/;\n\n\tvar rgb = [0, 0, 0, 1];\n\tvar match;\n\tvar i;\n\tvar hexAlpha;\n\n\tif (match = string.match(hex)) {\n\t\thexAlpha = match[2];\n\t\tmatch = match[1];\n\n\t\tfor (i = 0; i < 3; i++) {\n\t\t\t// https://jsperf.com/slice-vs-substr-vs-substring-methods-long-string/19\n\t\t\tvar i2 = i * 2;\n\t\t\trgb[i] = parseInt(match.slice(i2, i2 + 2), 16);\n\t\t}\n\n\t\tif (hexAlpha) {\n\t\t\trgb[3] = parseInt(hexAlpha, 16) / 255;\n\t\t}\n\t} else if (match = string.match(abbr)) {\n\t\tmatch = match[1];\n\t\thexAlpha = match[3];\n\n\t\tfor (i = 0; i < 3; i++) {\n\t\t\trgb[i] = parseInt(match[i] + match[i], 16);\n\t\t}\n\n\t\tif (hexAlpha) {\n\t\t\trgb[3] = parseInt(hexAlpha + hexAlpha, 16) / 255;\n\t\t}\n\t} else if (match = string.match(rgba)) {\n\t\tfor (i = 0; i < 3; i++) {\n\t\t\trgb[i] = parseInt(match[i + 1], 0);\n\t\t}\n\n\t\tif (match[4]) {\n\t\t\tif (match[5]) {\n\t\t\t\trgb[3] = parseFloat(match[4]) * 0.01;\n\t\t\t} else {\n\t\t\t\trgb[3] = parseFloat(match[4]);\n\t\t\t}\n\t\t}\n\t} else if (match = string.match(per)) {\n\t\tfor (i = 0; i < 3; i++) {\n\t\t\trgb[i] = Math.round(parseFloat(match[i + 1]) * 2.55);\n\t\t}\n\n\t\tif (match[4]) {\n\t\t\tif (match[5]) {\n\t\t\t\trgb[3] = parseFloat(match[4]) * 0.01;\n\t\t\t} else {\n\t\t\t\trgb[3] = parseFloat(match[4]);\n\t\t\t}\n\t\t}\n\t} else if (match = string.match(keyword)) {\n\t\tif (match[1] === 'transparent') {\n\t\t\treturn [0, 0, 0, 0];\n\t\t}\n\n\t\tif (!hasOwnProperty.call(colorNames, match[1])) {\n\t\t\treturn null;\n\t\t}\n\n\t\trgb = colorNames[match[1]];\n\t\trgb[3] = 1;\n\n\t\treturn rgb;\n\t} else {\n\t\treturn null;\n\t}\n\n\tfor (i = 0; i < 3; i++) {\n\t\trgb[i] = clamp(rgb[i], 0, 255);\n\t}\n\trgb[3] = clamp(rgb[3], 0, 1);\n\n\treturn rgb;\n};\n\ncs.get.hsl = function (string) {\n\tif (!string) {\n\t\treturn null;\n\t}\n\n\tvar hsl = /^hsla?\\(\\s*([+-]?(?:\\d{0,3}\\.)?\\d+)(?:deg)?\\s*,?\\s*([+-]?[\\d\\.]+)%\\s*,?\\s*([+-]?[\\d\\.]+)%\\s*(?:[,|\\/]\\s*([+-]?(?=\\.\\d|\\d)(?:0|[1-9]\\d*)?(?:\\.\\d*)?(?:[eE][+-]?\\d+)?)\\s*)?\\)$/;\n\tvar match = string.match(hsl);\n\n\tif (match) {\n\t\tvar alpha = parseFloat(match[4]);\n\t\tvar h = ((parseFloat(match[1]) % 360) + 360) % 360;\n\t\tvar s = clamp(parseFloat(match[2]), 0, 100);\n\t\tvar l = clamp(parseFloat(match[3]), 0, 100);\n\t\tvar a = clamp(isNaN(alpha) ? 1 : alpha, 0, 1);\n\n\t\treturn [h, s, l, a];\n\t}\n\n\treturn null;\n};\n\ncs.get.hwb = function (string) {\n\tif (!string) {\n\t\treturn null;\n\t}\n\n\tvar hwb = /^hwb\\(\\s*([+-]?\\d{0,3}(?:\\.\\d+)?)(?:deg)?\\s*,\\s*([+-]?[\\d\\.]+)%\\s*,\\s*([+-]?[\\d\\.]+)%\\s*(?:,\\s*([+-]?(?=\\.\\d|\\d)(?:0|[1-9]\\d*)?(?:\\.\\d*)?(?:[eE][+-]?\\d+)?)\\s*)?\\)$/;\n\tvar match = string.match(hwb);\n\n\tif (match) {\n\t\tvar alpha = parseFloat(match[4]);\n\t\tvar h = ((parseFloat(match[1]) % 360) + 360) % 360;\n\t\tvar w = clamp(parseFloat(match[2]), 0, 100);\n\t\tvar b = clamp(parseFloat(match[3]), 0, 100);\n\t\tvar a = clamp(isNaN(alpha) ? 1 : alpha, 0, 1);\n\t\treturn [h, w, b, a];\n\t}\n\n\treturn null;\n};\n\ncs.to.hex = function () {\n\tvar rgba = swizzle(arguments);\n\n\treturn (\n\t\t'#' +\n\t\thexDouble(rgba[0]) +\n\t\thexDouble(rgba[1]) +\n\t\thexDouble(rgba[2]) +\n\t\t(rgba[3] < 1\n\t\t\t? (hexDouble(Math.round(rgba[3] * 255)))\n\t\t\t: '')\n\t);\n};\n\ncs.to.rgb = function () {\n\tvar rgba = swizzle(arguments);\n\n\treturn rgba.length < 4 || rgba[3] === 1\n\t\t? 'rgb(' + Math.round(rgba[0]) + ', ' + Math.round(rgba[1]) + ', ' + Math.round(rgba[2]) + ')'\n\t\t: 'rgba(' + Math.round(rgba[0]) + ', ' + Math.round(rgba[1]) + ', ' + Math.round(rgba[2]) + ', ' + rgba[3] + ')';\n};\n\ncs.to.rgb.percent = function () {\n\tvar rgba = swizzle(arguments);\n\n\tvar r = Math.round(rgba[0] / 255 * 100);\n\tvar g = Math.round(rgba[1] / 255 * 100);\n\tvar b = Math.round(rgba[2] / 255 * 100);\n\n\treturn rgba.length < 4 || rgba[3] === 1\n\t\t? 'rgb(' + r + '%, ' + g + '%, ' + b + '%)'\n\t\t: 'rgba(' + r + '%, ' + g + '%, ' + b + '%, ' + rgba[3] + ')';\n};\n\ncs.to.hsl = function () {\n\tvar hsla = swizzle(arguments);\n\treturn hsla.length < 4 || hsla[3] === 1\n\t\t? 'hsl(' + hsla[0] + ', ' + hsla[1] + '%, ' + hsla[2] + '%)'\n\t\t: 'hsla(' + hsla[0] + ', ' + hsla[1] + '%, ' + hsla[2] + '%, ' + hsla[3] + ')';\n};\n\n// hwb is a bit different than rgb(a) & hsl(a) since there is no alpha specific syntax\n// (hwb have alpha optional & 1 is default value)\ncs.to.hwb = function () {\n\tvar hwba = swizzle(arguments);\n\n\tvar a = '';\n\tif (hwba.length >= 4 && hwba[3] !== 1) {\n\t\ta = ', ' + hwba[3];\n\t}\n\n\treturn 'hwb(' + hwba[0] + ', ' + hwba[1] + '%, ' + hwba[2] + '%' + a + ')';\n};\n\ncs.to.keyword = function (rgb) {\n\treturn reverseNames[rgb.slice(0, 3)];\n};\n\n// helpers\nfunction clamp(num, min, max) {\n\treturn Math.min(Math.max(min, num), max);\n}\n\nfunction hexDouble(num) {\n\tvar str = Math.round(num).toString(16).toUpperCase();\n\treturn (str.length < 2) ? '0' + str : str;\n}\n", "var openParentheses = \"(\".charCodeAt(0);\nvar closeParentheses = \")\".charCodeAt(0);\nvar singleQuote = \"'\".charCodeAt(0);\nvar doubleQuote = '\"'.charCodeAt(0);\nvar backslash = \"\\\\\".charCodeAt(0);\nvar slash = \"/\".charCodeAt(0);\nvar comma = \",\".charCodeAt(0);\nvar colon = \":\".charCodeAt(0);\nvar star = \"*\".charCodeAt(0);\nvar uLower = \"u\".charCodeAt(0);\nvar uUpper = \"U\".charCodeAt(0);\nvar plus = \"+\".charCodeAt(0);\nvar isUnicodeRange = /^[a-f0-9?-]+$/i;\n\nmodule.exports = function(input) {\n  var tokens = [];\n  var value = input;\n\n  var next,\n    quote,\n    prev,\n    token,\n    escape,\n    escapePos,\n    whitespacePos,\n    parenthesesOpenPos;\n  var pos = 0;\n  var code = value.charCodeAt(pos);\n  var max = value.length;\n  var stack = [{ nodes: tokens }];\n  var balanced = 0;\n  var parent;\n\n  var name = \"\";\n  var before = \"\";\n  var after = \"\";\n\n  while (pos < max) {\n    // Whitespaces\n    if (code <= 32) {\n      next = pos;\n      do {\n        next += 1;\n        code = value.charCodeAt(next);\n      } while (code <= 32);\n      token = value.slice(pos, next);\n\n      prev = tokens[tokens.length - 1];\n      if (code === closeParentheses && balanced) {\n        after = token;\n      } else if (prev && prev.type === \"div\") {\n        prev.after = token;\n        prev.sourceEndIndex += token.length;\n      } else if (\n        code === comma ||\n        code === colon ||\n        (code === slash &&\n          value.charCodeAt(next + 1) !== star &&\n          (!parent ||\n            (parent && parent.type === \"function\" && parent.value !== \"calc\")))\n      ) {\n        before = token;\n      } else {\n        tokens.push({\n          type: \"space\",\n          sourceIndex: pos,\n          sourceEndIndex: next,\n          value: token\n        });\n      }\n\n      pos = next;\n\n      // Quotes\n    } else if (code === singleQuote || code === doubleQuote) {\n      next = pos;\n      quote = code === singleQuote ? \"'\" : '\"';\n      token = {\n        type: \"string\",\n        sourceIndex: pos,\n        quote: quote\n      };\n      do {\n        escape = false;\n        next = value.indexOf(quote, next + 1);\n        if (~next) {\n          escapePos = next;\n          while (value.charCodeAt(escapePos - 1) === backslash) {\n            escapePos -= 1;\n            escape = !escape;\n          }\n        } else {\n          value += quote;\n          next = value.length - 1;\n          token.unclosed = true;\n        }\n      } while (escape);\n      token.value = value.slice(pos + 1, next);\n      token.sourceEndIndex = token.unclosed ? next : next + 1;\n      tokens.push(token);\n      pos = next + 1;\n      code = value.charCodeAt(pos);\n\n      // Comments\n    } else if (code === slash && value.charCodeAt(pos + 1) === star) {\n      next = value.indexOf(\"*/\", pos);\n\n      token = {\n        type: \"comment\",\n        sourceIndex: pos,\n        sourceEndIndex: next + 2\n      };\n\n      if (next === -1) {\n        token.unclosed = true;\n        next = value.length;\n        token.sourceEndIndex = next;\n      }\n\n      token.value = value.slice(pos + 2, next);\n      tokens.push(token);\n\n      pos = next + 2;\n      code = value.charCodeAt(pos);\n\n      // Operation within calc\n    } else if (\n      (code === slash || code === star) &&\n      parent &&\n      parent.type === \"function\" &&\n      parent.value === \"calc\"\n    ) {\n      token = value[pos];\n      tokens.push({\n        type: \"word\",\n        sourceIndex: pos - before.length,\n        sourceEndIndex: pos + token.length,\n        value: token\n      });\n      pos += 1;\n      code = value.charCodeAt(pos);\n\n      // Dividers\n    } else if (code === slash || code === comma || code === colon) {\n      token = value[pos];\n\n      tokens.push({\n        type: \"div\",\n        sourceIndex: pos - before.length,\n        sourceEndIndex: pos + token.length,\n        value: token,\n        before: before,\n        after: \"\"\n      });\n      before = \"\";\n\n      pos += 1;\n      code = value.charCodeAt(pos);\n\n      // Open parentheses\n    } else if (openParentheses === code) {\n      // Whitespaces after open parentheses\n      next = pos;\n      do {\n        next += 1;\n        code = value.charCodeAt(next);\n      } while (code <= 32);\n      parenthesesOpenPos = pos;\n      token = {\n        type: \"function\",\n        sourceIndex: pos - name.length,\n        value: name,\n        before: value.slice(parenthesesOpenPos + 1, next)\n      };\n      pos = next;\n\n      if (name === \"url\" && code !== singleQuote && code !== doubleQuote) {\n        next -= 1;\n        do {\n          escape = false;\n          next = value.indexOf(\")\", next + 1);\n          if (~next) {\n            escapePos = next;\n            while (value.charCodeAt(escapePos - 1) === backslash) {\n              escapePos -= 1;\n              escape = !escape;\n            }\n          } else {\n            value += \")\";\n            next = value.length - 1;\n            token.unclosed = true;\n          }\n        } while (escape);\n        // Whitespaces before closed\n        whitespacePos = next;\n        do {\n          whitespacePos -= 1;\n          code = value.charCodeAt(whitespacePos);\n        } while (code <= 32);\n        if (parenthesesOpenPos < whitespacePos) {\n          if (pos !== whitespacePos + 1) {\n            token.nodes = [\n              {\n                type: \"word\",\n                sourceIndex: pos,\n                sourceEndIndex: whitespacePos + 1,\n                value: value.slice(pos, whitespacePos + 1)\n              }\n            ];\n          } else {\n            token.nodes = [];\n          }\n          if (token.unclosed && whitespacePos + 1 !== next) {\n            token.after = \"\";\n            token.nodes.push({\n              type: \"space\",\n              sourceIndex: whitespacePos + 1,\n              sourceEndIndex: next,\n              value: value.slice(whitespacePos + 1, next)\n            });\n          } else {\n            token.after = value.slice(whitespacePos + 1, next);\n            token.sourceEndIndex = next;\n          }\n        } else {\n          token.after = \"\";\n          token.nodes = [];\n        }\n        pos = next + 1;\n        token.sourceEndIndex = token.unclosed ? next : pos;\n        code = value.charCodeAt(pos);\n        tokens.push(token);\n      } else {\n        balanced += 1;\n        token.after = \"\";\n        token.sourceEndIndex = pos + 1;\n        tokens.push(token);\n        stack.push(token);\n        tokens = token.nodes = [];\n        parent = token;\n      }\n      name = \"\";\n\n      // Close parentheses\n    } else if (closeParentheses === code && balanced) {\n      pos += 1;\n      code = value.charCodeAt(pos);\n\n      parent.after = after;\n      parent.sourceEndIndex += after.length;\n      after = \"\";\n      balanced -= 1;\n      stack[stack.length - 1].sourceEndIndex = pos;\n      stack.pop();\n      parent = stack[balanced];\n      tokens = parent.nodes;\n\n      // Words\n    } else {\n      next = pos;\n      do {\n        if (code === backslash) {\n          next += 1;\n        }\n        next += 1;\n        code = value.charCodeAt(next);\n      } while (\n        next < max &&\n        !(\n          code <= 32 ||\n          code === singleQuote ||\n          code === doubleQuote ||\n          code === comma ||\n          code === colon ||\n          code === slash ||\n          code === openParentheses ||\n          (code === star &&\n            parent &&\n            parent.type === \"function\" &&\n            parent.value === \"calc\") ||\n          (code === slash &&\n            parent.type === \"function\" &&\n            parent.value === \"calc\") ||\n          (code === closeParentheses && balanced)\n        )\n      );\n      token = value.slice(pos, next);\n\n      if (openParentheses === code) {\n        name = token;\n      } else if (\n        (uLower === token.charCodeAt(0) || uUpper === token.charCodeAt(0)) &&\n        plus === token.charCodeAt(1) &&\n        isUnicodeRange.test(token.slice(2))\n      ) {\n        tokens.push({\n          type: \"unicode-range\",\n          sourceIndex: pos,\n          sourceEndIndex: next,\n          value: token\n        });\n      } else {\n        tokens.push({\n          type: \"word\",\n          sourceIndex: pos,\n          sourceEndIndex: next,\n          value: token\n        });\n      }\n\n      pos = next;\n    }\n  }\n\n  for (pos = stack.length - 1; pos; pos -= 1) {\n    stack[pos].unclosed = true;\n    stack[pos].sourceEndIndex = value.length;\n  }\n\n  return stack[0].nodes;\n};\n", "var minus = \"-\".charCodeAt(0);\nvar plus = \"+\".charCodeAt(0);\nvar dot = \".\".charCodeAt(0);\nvar exp = \"e\".charCodeAt(0);\nvar EXP = \"E\".charCodeAt(0);\n\n// Check if three code points would start a number\n// https://www.w3.org/TR/css-syntax-3/#starts-with-a-number\nfunction likeNumber(value) {\n  var code = value.charCodeAt(0);\n  var nextCode;\n\n  if (code === plus || code === minus) {\n    nextCode = value.charCodeAt(1);\n\n    if (nextCode >= 48 && nextCode <= 57) {\n      return true;\n    }\n\n    var nextNextCode = value.charCodeAt(2);\n\n    if (nextCode === dot && nextNextCode >= 48 && nextNextCode <= 57) {\n      return true;\n    }\n\n    return false;\n  }\n\n  if (code === dot) {\n    nextCode = value.charCodeAt(1);\n\n    if (nextCode >= 48 && nextCode <= 57) {\n      return true;\n    }\n\n    return false;\n  }\n\n  if (code >= 48 && code <= 57) {\n    return true;\n  }\n\n  return false;\n}\n\n// Consume a number\n// https://www.w3.org/TR/css-syntax-3/#consume-number\nmodule.exports = function(value) {\n  var pos = 0;\n  var length = value.length;\n  var code;\n  var nextCode;\n  var nextNextCode;\n\n  if (length === 0 || !likeNumber(value)) {\n    return false;\n  }\n\n  code = value.charCodeAt(pos);\n\n  if (code === plus || code === minus) {\n    pos++;\n  }\n\n  while (pos < length) {\n    code = value.charCodeAt(pos);\n\n    if (code < 48 || code > 57) {\n      break;\n    }\n\n    pos += 1;\n  }\n\n  code = value.charCodeAt(pos);\n  nextCode = value.charCodeAt(pos + 1);\n\n  if (code === dot && nextCode >= 48 && nextCode <= 57) {\n    pos += 2;\n\n    while (pos < length) {\n      code = value.charCodeAt(pos);\n\n      if (code < 48 || code > 57) {\n        break;\n      }\n\n      pos += 1;\n    }\n  }\n\n  code = value.charCodeAt(pos);\n  nextCode = value.charCodeAt(pos + 1);\n  nextNextCode = value.charCodeAt(pos + 2);\n\n  if (\n    (code === exp || code === EXP) &&\n    ((nextCode >= 48 && nextCode <= 57) ||\n      ((nextCode === plus || nextCode === minus) &&\n        nextNextCode >= 48 &&\n        nextNextCode <= 57))\n  ) {\n    pos += nextCode === plus || nextCode === minus ? 3 : 2;\n\n    while (pos < length) {\n      code = value.charCodeAt(pos);\n\n      if (code < 48 || code > 57) {\n        break;\n      }\n\n      pos += 1;\n    }\n  }\n\n  return {\n    number: value.slice(0, pos),\n    unit: value.slice(pos)\n  };\n};\n", "// can-promise has a crash in some versions of react native that dont have\n// standard global objects\n// https://github.com/soldair/node-qrcode/issues/157\n\nmodule.exports = function () {\n  return typeof Promise === 'function' && Promise.prototype && Promise.prototype.then\n}\n", "let toSJISFunction\nconst CODEWORDS_COUNT = [\n  0, // Not used\n  26, 44, 70, 100, 134, 172, 196, 242, 292, 346,\n  404, 466, 532, 581, 655, 733, 815, 901, 991, 1085,\n  1156, 1258, 1364, 1474, 1588, 1706, 1828, 1921, 2051, 2185,\n  2323, 2465, 2611, 2761, 2876, 3034, 3196, 3362, 3532, 3706\n]\n\n/**\n * Returns the QR Code size for the specified version\n *\n * @param  {Number} version QR Code version\n * @return {Number}         size of QR code\n */\nexports.getSymbolSize = function getSymbolSize (version) {\n  if (!version) throw new Error('\"version\" cannot be null or undefined')\n  if (version < 1 || version > 40) throw new Error('\"version\" should be in range from 1 to 40')\n  return version * 4 + 17\n}\n\n/**\n * Returns the total number of codewords used to store data and EC information.\n *\n * @param  {Number} version QR Code version\n * @return {Number}         Data length in bits\n */\nexports.getSymbolTotalCodewords = function getSymbolTotalCodewords (version) {\n  return CODEWORDS_COUNT[version]\n}\n\n/**\n * Encode data with Bose-Chaudhuri-Hocquenghem\n *\n * @param  {Number} data Value to encode\n * @return {Number}      Encoded value\n */\nexports.getBCHDigit = function (data) {\n  let digit = 0\n\n  while (data !== 0) {\n    digit++\n    data >>>= 1\n  }\n\n  return digit\n}\n\nexports.setToSJISFunction = function setToSJISFunction (f) {\n  if (typeof f !== 'function') {\n    throw new Error('\"toSJISFunc\" is not a valid function.')\n  }\n\n  toSJISFunction = f\n}\n\nexports.isKanjiModeEnabled = function () {\n  return typeof toSJISFunction !== 'undefined'\n}\n\nexports.toSJIS = function toSJIS (kanji) {\n  return toSJISFunction(kanji)\n}\n", "exports.L = { bit: 1 }\nexports.M = { bit: 0 }\nexports.Q = { bit: 3 }\nexports.H = { bit: 2 }\n\nfunction fromString (string) {\n  if (typeof string !== 'string') {\n    throw new Error('Param is not a string')\n  }\n\n  const lcStr = string.toLowerCase()\n\n  switch (lcStr) {\n    case 'l':\n    case 'low':\n      return exports.L\n\n    case 'm':\n    case 'medium':\n      return exports.M\n\n    case 'q':\n    case 'quartile':\n      return exports.Q\n\n    case 'h':\n    case 'high':\n      return exports.H\n\n    default:\n      throw new Error('Unknown EC Level: ' + string)\n  }\n}\n\nexports.isValid = function isValid (level) {\n  return level && typeof level.bit !== 'undefined' &&\n    level.bit >= 0 && level.bit < 4\n}\n\nexports.from = function from (value, defaultValue) {\n  if (exports.isValid(value)) {\n    return value\n  }\n\n  try {\n    return fromString(value)\n  } catch (e) {\n    return defaultValue\n  }\n}\n", "function BitBuffer () {\n  this.buffer = []\n  this.length = 0\n}\n\nBitBuffer.prototype = {\n\n  get: function (index) {\n    const bufIndex = Math.floor(index / 8)\n    return ((this.buffer[bufIndex] >>> (7 - index % 8)) & 1) === 1\n  },\n\n  put: function (num, length) {\n    for (let i = 0; i < length; i++) {\n      this.putBit(((num >>> (length - i - 1)) & 1) === 1)\n    }\n  },\n\n  getLengthInBits: function () {\n    return this.length\n  },\n\n  putBit: function (bit) {\n    const bufIndex = Math.floor(this.length / 8)\n    if (this.buffer.length <= bufIndex) {\n      this.buffer.push(0)\n    }\n\n    if (bit) {\n      this.buffer[bufIndex] |= (0x80 >>> (this.length % 8))\n    }\n\n    this.length++\n  }\n}\n\nmodule.exports = BitBuffer\n", "/**\n * Helper class to handle QR Code symbol modules\n *\n * @param {Number} size Symbol size\n */\nfunction BitMatrix (size) {\n  if (!size || size < 1) {\n    throw new Error('BitMatrix size must be defined and greater than 0')\n  }\n\n  this.size = size\n  this.data = new Uint8Array(size * size)\n  this.reservedBit = new Uint8Array(size * size)\n}\n\n/**\n * Set bit value at specified location\n * If reserved flag is set, this bit will be ignored during masking process\n *\n * @param {Number}  row\n * @param {Number}  col\n * @param {Boolean} value\n * @param {Boolean} reserved\n */\nBitMatrix.prototype.set = function (row, col, value, reserved) {\n  const index = row * this.size + col\n  this.data[index] = value\n  if (reserved) this.reservedBit[index] = true\n}\n\n/**\n * Returns bit value at specified location\n *\n * @param  {Number}  row\n * @param  {Number}  col\n * @return {Boolean}\n */\nBitMatrix.prototype.get = function (row, col) {\n  return this.data[row * this.size + col]\n}\n\n/**\n * Applies xor operator at specified location\n * (used during masking process)\n *\n * @param {Number}  row\n * @param {Number}  col\n * @param {Boolean} value\n */\nBitMatrix.prototype.xor = function (row, col, value) {\n  this.data[row * this.size + col] ^= value\n}\n\n/**\n * Check if bit at specified location is reserved\n *\n * @param {Number}   row\n * @param {Number}   col\n * @return {Boolean}\n */\nBitMatrix.prototype.isReserved = function (row, col) {\n  return this.reservedBit[row * this.size + col]\n}\n\nmodule.exports = BitMatrix\n", "/**\n * Alignment pattern are fixed reference pattern in defined positions\n * in a matrix symbology, which enables the decode software to re-synchronise\n * the coordinate mapping of the image modules in the event of moderate amounts\n * of distortion of the image.\n *\n * Alignment patterns are present only in QR Code symbols of version 2 or larger\n * and their number depends on the symbol version.\n */\n\nconst getSymbolSize = require('./utils').getSymbolSize\n\n/**\n * Calculate the row/column coordinates of the center module of each alignment pattern\n * for the specified QR Code version.\n *\n * The alignment patterns are positioned symmetrically on either side of the diagonal\n * running from the top left corner of the symbol to the bottom right corner.\n *\n * Since positions are simmetrical only half of the coordinates are returned.\n * Each item of the array will represent in turn the x and y coordinate.\n * @see {@link getPositions}\n *\n * @param  {Number} version QR Code version\n * @return {Array}          Array of coordinate\n */\nexports.getRowColCoords = function getRowColCoords (version) {\n  if (version === 1) return []\n\n  const posCount = Math.floor(version / 7) + 2\n  const size = getSymbolSize(version)\n  const intervals = size === 145 ? 26 : Math.ceil((size - 13) / (2 * posCount - 2)) * 2\n  const positions = [size - 7] // Last coord is always (size - 7)\n\n  for (let i = 1; i < posCount - 1; i++) {\n    positions[i] = positions[i - 1] - intervals\n  }\n\n  positions.push(6) // First coord is always 6\n\n  return positions.reverse()\n}\n\n/**\n * Returns an array containing the positions of each alignment pattern.\n * Each array's element represent the center point of the pattern as (x, y) coordinates\n *\n * Coordinates are calculated expanding the row/column coordinates returned by {@link getRowColCoords}\n * and filtering out the items that overlaps with finder pattern\n *\n * @example\n * For a Version 7 symbol {@link getRowColCoords} returns values 6, 22 and 38.\n * The alignment patterns, therefore, are to be centered on (row, column)\n * positions (6,22), (22,6), (22,22), (22,38), (38,22), (38,38).\n * Note that the coordinates (6,6), (6,38), (38,6) are occupied by finder patterns\n * and are not therefore used for alignment patterns.\n *\n * let pos = getPositions(7)\n * // [[6,22], [22,6], [22,22], [22,38], [38,22], [38,38]]\n *\n * @param  {Number} version QR Code version\n * @return {Array}          Array of coordinates\n */\nexports.getPositions = function getPositions (version) {\n  const coords = []\n  const pos = exports.getRowColCoords(version)\n  const posLength = pos.length\n\n  for (let i = 0; i < posLength; i++) {\n    for (let j = 0; j < posLength; j++) {\n      // Skip if position is occupied by finder patterns\n      if ((i === 0 && j === 0) || // top-left\n          (i === 0 && j === posLength - 1) || // bottom-left\n          (i === posLength - 1 && j === 0)) { // top-right\n        continue\n      }\n\n      coords.push([pos[i], pos[j]])\n    }\n  }\n\n  return coords\n}\n", "const getSymbolSize = require('./utils').getSymbolSize\nconst FINDER_PATTERN_SIZE = 7\n\n/**\n * Returns an array containing the positions of each finder pattern.\n * Each array's element represent the top-left point of the pattern as (x, y) coordinates\n *\n * @param  {Number} version QR Code version\n * @return {Array}          Array of coordinates\n */\nexports.getPositions = function getPositions (version) {\n  const size = getSymbolSize(version)\n\n  return [\n    // top-left\n    [0, 0],\n    // top-right\n    [size - FINDER_PATTERN_SIZE, 0],\n    // bottom-left\n    [0, size - FINDER_PATTERN_SIZE]\n  ]\n}\n", "/**\n * Data mask pattern reference\n * @type {Object}\n */\nexports.Patterns = {\n  PATTERN000: 0,\n  PATTERN001: 1,\n  PATTERN010: 2,\n  PATTERN011: 3,\n  PATTERN100: 4,\n  PATTERN101: 5,\n  PATTERN110: 6,\n  PATTERN111: 7\n}\n\n/**\n * Weighted penalty scores for the undesirable features\n * @type {Object}\n */\nconst PenaltyScores = {\n  N1: 3,\n  N2: 3,\n  N3: 40,\n  N4: 10\n}\n\n/**\n * Check if mask pattern value is valid\n *\n * @param  {Number}  mask    Mask pattern\n * @return {Boolean}         true if valid, false otherwise\n */\nexports.isValid = function isValid (mask) {\n  return mask != null && mask !== '' && !isNaN(mask) && mask >= 0 && mask <= 7\n}\n\n/**\n * Returns mask pattern from a value.\n * If value is not valid, returns undefined\n *\n * @param  {Number|String} value        Mask pattern value\n * @return {Number}                     Valid mask pattern or undefined\n */\nexports.from = function from (value) {\n  return exports.isValid(value) ? parseInt(value, 10) : undefined\n}\n\n/**\n* Find adjacent modules in row/column with the same color\n* and assign a penalty value.\n*\n* Points: N1 + i\n* i is the amount by which the number of adjacent modules of the same color exceeds 5\n*/\nexports.getPenaltyN1 = function getPenaltyN1 (data) {\n  const size = data.size\n  let points = 0\n  let sameCountCol = 0\n  let sameCountRow = 0\n  let lastCol = null\n  let lastRow = null\n\n  for (let row = 0; row < size; row++) {\n    sameCountCol = sameCountRow = 0\n    lastCol = lastRow = null\n\n    for (let col = 0; col < size; col++) {\n      let module = data.get(row, col)\n      if (module === lastCol) {\n        sameCountCol++\n      } else {\n        if (sameCountCol >= 5) points += PenaltyScores.N1 + (sameCountCol - 5)\n        lastCol = module\n        sameCountCol = 1\n      }\n\n      module = data.get(col, row)\n      if (module === lastRow) {\n        sameCountRow++\n      } else {\n        if (sameCountRow >= 5) points += PenaltyScores.N1 + (sameCountRow - 5)\n        lastRow = module\n        sameCountRow = 1\n      }\n    }\n\n    if (sameCountCol >= 5) points += PenaltyScores.N1 + (sameCountCol - 5)\n    if (sameCountRow >= 5) points += PenaltyScores.N1 + (sameCountRow - 5)\n  }\n\n  return points\n}\n\n/**\n * Find 2x2 blocks with the same color and assign a penalty value\n *\n * Points: N2 * (m - 1) * (n - 1)\n */\nexports.getPenaltyN2 = function getPenaltyN2 (data) {\n  const size = data.size\n  let points = 0\n\n  for (let row = 0; row < size - 1; row++) {\n    for (let col = 0; col < size - 1; col++) {\n      const last = data.get(row, col) +\n        data.get(row, col + 1) +\n        data.get(row + 1, col) +\n        data.get(row + 1, col + 1)\n\n      if (last === 4 || last === 0) points++\n    }\n  }\n\n  return points * PenaltyScores.N2\n}\n\n/**\n * Find 1:1:3:1:1 ratio (dark:light:dark:light:dark) pattern in row/column,\n * preceded or followed by light area 4 modules wide\n *\n * Points: N3 * number of pattern found\n */\nexports.getPenaltyN3 = function getPenaltyN3 (data) {\n  const size = data.size\n  let points = 0\n  let bitsCol = 0\n  let bitsRow = 0\n\n  for (let row = 0; row < size; row++) {\n    bitsCol = bitsRow = 0\n    for (let col = 0; col < size; col++) {\n      bitsCol = ((bitsCol << 1) & 0x7FF) | data.get(row, col)\n      if (col >= 10 && (bitsCol === 0x5D0 || bitsCol === 0x05D)) points++\n\n      bitsRow = ((bitsRow << 1) & 0x7FF) | data.get(col, row)\n      if (col >= 10 && (bitsRow === 0x5D0 || bitsRow === 0x05D)) points++\n    }\n  }\n\n  return points * PenaltyScores.N3\n}\n\n/**\n * Calculate proportion of dark modules in entire symbol\n *\n * Points: N4 * k\n *\n * k is the rating of the deviation of the proportion of dark modules\n * in the symbol from 50% in steps of 5%\n */\nexports.getPenaltyN4 = function getPenaltyN4 (data) {\n  let darkCount = 0\n  const modulesCount = data.data.length\n\n  for (let i = 0; i < modulesCount; i++) darkCount += data.data[i]\n\n  const k = Math.abs(Math.ceil((darkCount * 100 / modulesCount) / 5) - 10)\n\n  return k * PenaltyScores.N4\n}\n\n/**\n * Return mask value at given position\n *\n * @param  {Number} maskPattern Pattern reference value\n * @param  {Number} i           Row\n * @param  {Number} j           Column\n * @return {Boolean}            Mask value\n */\nfunction getMaskAt (maskPattern, i, j) {\n  switch (maskPattern) {\n    case exports.Patterns.PATTERN000: return (i + j) % 2 === 0\n    case exports.Patterns.PATTERN001: return i % 2 === 0\n    case exports.Patterns.PATTERN010: return j % 3 === 0\n    case exports.Patterns.PATTERN011: return (i + j) % 3 === 0\n    case exports.Patterns.PATTERN100: return (Math.floor(i / 2) + Math.floor(j / 3)) % 2 === 0\n    case exports.Patterns.PATTERN101: return (i * j) % 2 + (i * j) % 3 === 0\n    case exports.Patterns.PATTERN110: return ((i * j) % 2 + (i * j) % 3) % 2 === 0\n    case exports.Patterns.PATTERN111: return ((i * j) % 3 + (i + j) % 2) % 2 === 0\n\n    default: throw new Error('bad maskPattern:' + maskPattern)\n  }\n}\n\n/**\n * Apply a mask pattern to a BitMatrix\n *\n * @param  {Number}    pattern Pattern reference number\n * @param  {BitMatrix} data    BitMatrix data\n */\nexports.applyMask = function applyMask (pattern, data) {\n  const size = data.size\n\n  for (let col = 0; col < size; col++) {\n    for (let row = 0; row < size; row++) {\n      if (data.isReserved(row, col)) continue\n      data.xor(row, col, getMaskAt(pattern, row, col))\n    }\n  }\n}\n\n/**\n * Returns the best mask pattern for data\n *\n * @param  {BitMatrix} data\n * @return {Number} Mask pattern reference number\n */\nexports.getBestMask = function getBestMask (data, setupFormatFunc) {\n  const numPatterns = Object.keys(exports.Patterns).length\n  let bestPattern = 0\n  let lowerPenalty = Infinity\n\n  for (let p = 0; p < numPatterns; p++) {\n    setupFormatFunc(p)\n    exports.applyMask(p, data)\n\n    // Calculate penalty\n    const penalty =\n      exports.getPenaltyN1(data) +\n      exports.getPenaltyN2(data) +\n      exports.getPenaltyN3(data) +\n      exports.getPenaltyN4(data)\n\n    // Undo previously applied mask\n    exports.applyMask(p, data)\n\n    if (penalty < lowerPenalty) {\n      lowerPenalty = penalty\n      bestPattern = p\n    }\n  }\n\n  return bestPattern\n}\n", "const ECLevel = require('./error-correction-level')\r\n\r\nconst EC_BLOCKS_TABLE = [\r\n// L  M  Q  H\r\n  1, 1, 1, 1,\r\n  1, 1, 1, 1,\r\n  1, 1, 2, 2,\r\n  1, 2, 2, 4,\r\n  1, 2, 4, 4,\r\n  2, 4, 4, 4,\r\n  2, 4, 6, 5,\r\n  2, 4, 6, 6,\r\n  2, 5, 8, 8,\r\n  4, 5, 8, 8,\r\n  4, 5, 8, 11,\r\n  4, 8, 10, 11,\r\n  4, 9, 12, 16,\r\n  4, 9, 16, 16,\r\n  6, 10, 12, 18,\r\n  6, 10, 17, 16,\r\n  6, 11, 16, 19,\r\n  6, 13, 18, 21,\r\n  7, 14, 21, 25,\r\n  8, 16, 20, 25,\r\n  8, 17, 23, 25,\r\n  9, 17, 23, 34,\r\n  9, 18, 25, 30,\r\n  10, 20, 27, 32,\r\n  12, 21, 29, 35,\r\n  12, 23, 34, 37,\r\n  12, 25, 34, 40,\r\n  13, 26, 35, 42,\r\n  14, 28, 38, 45,\r\n  15, 29, 40, 48,\r\n  16, 31, 43, 51,\r\n  17, 33, 45, 54,\r\n  18, 35, 48, 57,\r\n  19, 37, 51, 60,\r\n  19, 38, 53, 63,\r\n  20, 40, 56, 66,\r\n  21, 43, 59, 70,\r\n  22, 45, 62, 74,\r\n  24, 47, 65, 77,\r\n  25, 49, 68, 81\r\n]\r\n\r\nconst EC_CODEWORDS_TABLE = [\r\n// L  M  Q  H\r\n  7, 10, 13, 17,\r\n  10, 16, 22, 28,\r\n  15, 26, 36, 44,\r\n  20, 36, 52, 64,\r\n  26, 48, 72, 88,\r\n  36, 64, 96, 112,\r\n  40, 72, 108, 130,\r\n  48, 88, 132, 156,\r\n  60, 110, 160, 192,\r\n  72, 130, 192, 224,\r\n  80, 150, 224, 264,\r\n  96, 176, 260, 308,\r\n  104, 198, 288, 352,\r\n  120, 216, 320, 384,\r\n  132, 240, 360, 432,\r\n  144, 280, 408, 480,\r\n  168, 308, 448, 532,\r\n  180, 338, 504, 588,\r\n  196, 364, 546, 650,\r\n  224, 416, 600, 700,\r\n  224, 442, 644, 750,\r\n  252, 476, 690, 816,\r\n  270, 504, 750, 900,\r\n  300, 560, 810, 960,\r\n  312, 588, 870, 1050,\r\n  336, 644, 952, 1110,\r\n  360, 700, 1020, 1200,\r\n  390, 728, 1050, 1260,\r\n  420, 784, 1140, 1350,\r\n  450, 812, 1200, 1440,\r\n  480, 868, 1290, 1530,\r\n  510, 924, 1350, 1620,\r\n  540, 980, 1440, 1710,\r\n  570, 1036, 1530, 1800,\r\n  570, 1064, 1590, 1890,\r\n  600, 1120, 1680, 1980,\r\n  630, 1204, 1770, 2100,\r\n  660, 1260, 1860, 2220,\r\n  720, 1316, 1950, 2310,\r\n  750, 1372, 2040, 2430\r\n]\r\n\r\n/**\r\n * Returns the number of error correction block that the QR Code should contain\r\n * for the specified version and error correction level.\r\n *\r\n * @param  {Number} version              QR Code version\r\n * @param  {Number} errorCorrectionLevel Error correction level\r\n * @return {Number}                      Number of error correction blocks\r\n */\r\nexports.getBlocksCount = function getBlocksCount (version, errorCorrectionLevel) {\r\n  switch (errorCorrectionLevel) {\r\n    case ECLevel.L:\r\n      return EC_BLOCKS_TABLE[(version - 1) * 4 + 0]\r\n    case ECLevel.M:\r\n      return EC_BLOCKS_TABLE[(version - 1) * 4 + 1]\r\n    case ECLevel.Q:\r\n      return EC_BLOCKS_TABLE[(version - 1) * 4 + 2]\r\n    case ECLevel.H:\r\n      return EC_BLOCKS_TABLE[(version - 1) * 4 + 3]\r\n    default:\r\n      return undefined\r\n  }\r\n}\r\n\r\n/**\r\n * Returns the number of error correction codewords to use for the specified\r\n * version and error correction level.\r\n *\r\n * @param  {Number} version              QR Code version\r\n * @param  {Number} errorCorrectionLevel Error correction level\r\n * @return {Number}                      Number of error correction codewords\r\n */\r\nexports.getTotalCodewordsCount = function getTotalCodewordsCount (version, errorCorrectionLevel) {\r\n  switch (errorCorrectionLevel) {\r\n    case ECLevel.L:\r\n      return EC_CODEWORDS_TABLE[(version - 1) * 4 + 0]\r\n    case ECLevel.M:\r\n      return EC_CODEWORDS_TABLE[(version - 1) * 4 + 1]\r\n    case ECLevel.Q:\r\n      return EC_CODEWORDS_TABLE[(version - 1) * 4 + 2]\r\n    case ECLevel.H:\r\n      return EC_CODEWORDS_TABLE[(version - 1) * 4 + 3]\r\n    default:\r\n      return undefined\r\n  }\r\n}\r\n", "const EXP_TABLE = new Uint8Array(512)\nconst LOG_TABLE = new Uint8Array(256)\n/**\n * Precompute the log and anti-log tables for faster computation later\n *\n * For each possible value in the galois field 2^8, we will pre-compute\n * the logarithm and anti-logarithm (exponential) of this value\n *\n * ref {@link https://en.wikiversity.org/wiki/Reed%E2%80%93Solomon_codes_for_coders#Introduction_to_mathematical_fields}\n */\n;(function initTables () {\n  let x = 1\n  for (let i = 0; i < 255; i++) {\n    EXP_TABLE[i] = x\n    LOG_TABLE[x] = i\n\n    x <<= 1 // multiply by 2\n\n    // The QR code specification says to use byte-wise modulo 100011101 arithmetic.\n    // This means that when a number is 256 or larger, it should be XORed with 0x11D.\n    if (x & 0x100) { // similar to x >= 256, but a lot faster (because 0x100 == 256)\n      x ^= 0x11D\n    }\n  }\n\n  // Optimization: double the size of the anti-log table so that we don't need to mod 255 to\n  // stay inside the bounds (because we will mainly use this table for the multiplication of\n  // two GF numbers, no more).\n  // @see {@link mul}\n  for (let i = 255; i < 512; i++) {\n    EXP_TABLE[i] = EXP_TABLE[i - 255]\n  }\n}())\n\n/**\n * Returns log value of n inside Galois Field\n *\n * @param  {Number} n\n * @return {Number}\n */\nexports.log = function log (n) {\n  if (n < 1) throw new Error('log(' + n + ')')\n  return LOG_TABLE[n]\n}\n\n/**\n * Returns anti-log value of n inside Galois Field\n *\n * @param  {Number} n\n * @return {Number}\n */\nexports.exp = function exp (n) {\n  return EXP_TABLE[n]\n}\n\n/**\n * Multiplies two number inside Galois Field\n *\n * @param  {Number} x\n * @param  {Number} y\n * @return {Number}\n */\nexports.mul = function mul (x, y) {\n  if (x === 0 || y === 0) return 0\n\n  // should be EXP_TABLE[(LOG_TABLE[x] + LOG_TABLE[y]) % 255] if EXP_TABLE wasn't oversized\n  // @see {@link initTables}\n  return EXP_TABLE[LOG_TABLE[x] + LOG_TABLE[y]]\n}\n", "const GF = require('./galois-field')\n\n/**\n * Multiplies two polynomials inside Galois Field\n *\n * @param  {Uint8Array} p1 Polynomial\n * @param  {Uint8Array} p2 Polynomial\n * @return {Uint8Array}    Product of p1 and p2\n */\nexports.mul = function mul (p1, p2) {\n  const coeff = new Uint8Array(p1.length + p2.length - 1)\n\n  for (let i = 0; i < p1.length; i++) {\n    for (let j = 0; j < p2.length; j++) {\n      coeff[i + j] ^= GF.mul(p1[i], p2[j])\n    }\n  }\n\n  return coeff\n}\n\n/**\n * Calculate the remainder of polynomials division\n *\n * @param  {Uint8Array} divident Polynomial\n * @param  {Uint8Array} divisor  Polynomial\n * @return {Uint8Array}          Remainder\n */\nexports.mod = function mod (divident, divisor) {\n  let result = new Uint8Array(divident)\n\n  while ((result.length - divisor.length) >= 0) {\n    const coeff = result[0]\n\n    for (let i = 0; i < divisor.length; i++) {\n      result[i] ^= GF.mul(divisor[i], coeff)\n    }\n\n    // remove all zeros from buffer head\n    let offset = 0\n    while (offset < result.length && result[offset] === 0) offset++\n    result = result.slice(offset)\n  }\n\n  return result\n}\n\n/**\n * Generate an irreducible generator polynomial of specified degree\n * (used by Reed-Solomon encoder)\n *\n * @param  {Number} degree Degree of the generator polynomial\n * @return {Uint8Array}    Buffer containing polynomial coefficients\n */\nexports.generateECPolynomial = function generateECPolynomial (degree) {\n  let poly = new Uint8Array([1])\n  for (let i = 0; i < degree; i++) {\n    poly = exports.mul(poly, new Uint8Array([1, GF.exp(i)]))\n  }\n\n  return poly\n}\n", "const Polynomial = require('./polynomial')\n\nfunction ReedSolomonEncoder (degree) {\n  this.genPoly = undefined\n  this.degree = degree\n\n  if (this.degree) this.initialize(this.degree)\n}\n\n/**\n * Initialize the encoder.\n * The input param should correspond to the number of error correction codewords.\n *\n * @param  {Number} degree\n */\nReedSolomonEncoder.prototype.initialize = function initialize (degree) {\n  // create an irreducible generator polynomial\n  this.degree = degree\n  this.genPoly = Polynomial.generateECPolynomial(this.degree)\n}\n\n/**\n * Encodes a chunk of data\n *\n * @param  {Uint8Array} data Buffer containing input data\n * @return {Uint8Array}      Buffer containing encoded data\n */\nReedSolomonEncoder.prototype.encode = function encode (data) {\n  if (!this.genPoly) {\n    throw new Error('Encoder not initialized')\n  }\n\n  // Calculate EC for this data block\n  // extends data size to data+genPoly size\n  const paddedData = new Uint8Array(data.length + this.degree)\n  paddedData.set(data)\n\n  // The error correction codewords are the remainder after dividing the data codewords\n  // by a generator polynomial\n  const remainder = Polynomial.mod(paddedData, this.genPoly)\n\n  // return EC data blocks (last n byte, where n is the degree of genPoly)\n  // If coefficients number in remainder are less than genPoly degree,\n  // pad with 0s to the left to reach the needed number of coefficients\n  const start = this.degree - remainder.length\n  if (start > 0) {\n    const buff = new Uint8Array(this.degree)\n    buff.set(remainder, start)\n\n    return buff\n  }\n\n  return remainder\n}\n\nmodule.exports = ReedSolomonEncoder\n", "/**\n * Check if QR Code version is valid\n *\n * @param  {Number}  version QR Code version\n * @return {Boolean}         true if valid version, false otherwise\n */\nexports.isValid = function isValid (version) {\n  return !isNaN(version) && version >= 1 && version <= 40\n}\n", "const numeric = '[0-9]+'\nconst alphanumeric = '[A-Z $%*+\\\\-./:]+'\nlet kanji = '(?:[u3000-u303F]|[u3040-u309F]|[u30A0-u30FF]|' +\n  '[uFF00-uFFEF]|[u4E00-u9FAF]|[u2605-u2606]|[u2190-u2195]|u203B|' +\n  '[u2010u2015u2018u2019u2025u2026u201Cu201Du2225u2260]|' +\n  '[u0391-u0451]|[u00A7u00A8u00B1u00B4u00D7u00F7])+'\nkanji = kanji.replace(/u/g, '\\\\u')\n\nconst byte = '(?:(?![A-Z0-9 $%*+\\\\-./:]|' + kanji + ')(?:.|[\\r\\n]))+'\n\nexports.KANJI = new RegExp(kanji, 'g')\nexports.BYTE_KANJI = new RegExp('[^A-Z0-9 $%*+\\\\-./:]+', 'g')\nexports.BYTE = new RegExp(byte, 'g')\nexports.NUMERIC = new RegExp(numeric, 'g')\nexports.ALPHANUMERIC = new RegExp(alphanumeric, 'g')\n\nconst TEST_KANJI = new RegExp('^' + kanji + '$')\nconst TEST_NUMERIC = new RegExp('^' + numeric + '$')\nconst TEST_ALPHANUMERIC = new RegExp('^[A-Z0-9 $%*+\\\\-./:]+$')\n\nexports.testKanji = function testKanji (str) {\n  return TEST_KANJI.test(str)\n}\n\nexports.testNumeric = function testNumeric (str) {\n  return TEST_NUMERIC.test(str)\n}\n\nexports.testAlphanumeric = function testAlphanumeric (str) {\n  return TEST_ALPHANUMERIC.test(str)\n}\n", "const VersionCheck = require('./version-check')\nconst Regex = require('./regex')\n\n/**\n * Numeric mode encodes data from the decimal digit set (0 - 9)\n * (byte values 30HEX to 39HEX).\n * Normally, 3 data characters are represented by 10 bits.\n *\n * @type {Object}\n */\nexports.NUMERIC = {\n  id: 'Numeric',\n  bit: 1 << 0,\n  ccBits: [10, 12, 14]\n}\n\n/**\n * Alphanumeric mode encodes data from a set of 45 characters,\n * i.e. 10 numeric digits (0 - 9),\n *      26 alphabetic characters (A - Z),\n *   and 9 symbols (SP, $, %, *, +, -, ., /, :).\n * Normally, two input characters are represented by 11 bits.\n *\n * @type {Object}\n */\nexports.ALPHANUMERIC = {\n  id: 'Alphanumeric',\n  bit: 1 << 1,\n  ccBits: [9, 11, 13]\n}\n\n/**\n * In byte mode, data is encoded at 8 bits per character.\n *\n * @type {Object}\n */\nexports.BYTE = {\n  id: 'Byte',\n  bit: 1 << 2,\n  ccBits: [8, 16, 16]\n}\n\n/**\n * The Kanji mode efficiently encodes Kanji characters in accordance with\n * the Shift JIS system based on JIS X 0208.\n * The Shift JIS values are shifted from the JIS X 0208 values.\n * JIS X 0208 gives details of the shift coded representation.\n * Each two-byte character value is compacted to a 13-bit binary codeword.\n *\n * @type {Object}\n */\nexports.KANJI = {\n  id: 'Kanji',\n  bit: 1 << 3,\n  ccBits: [8, 10, 12]\n}\n\n/**\n * Mixed mode will contain a sequences of data in a combination of any of\n * the modes described above\n *\n * @type {Object}\n */\nexports.MIXED = {\n  bit: -1\n}\n\n/**\n * Returns the number of bits needed to store the data length\n * according to QR Code specifications.\n *\n * @param  {Mode}   mode    Data mode\n * @param  {Number} version QR Code version\n * @return {Number}         Number of bits\n */\nexports.getCharCountIndicator = function getCharCountIndicator (mode, version) {\n  if (!mode.ccBits) throw new Error('Invalid mode: ' + mode)\n\n  if (!VersionCheck.isValid(version)) {\n    throw new Error('Invalid version: ' + version)\n  }\n\n  if (version >= 1 && version < 10) return mode.ccBits[0]\n  else if (version < 27) return mode.ccBits[1]\n  return mode.ccBits[2]\n}\n\n/**\n * Returns the most efficient mode to store the specified data\n *\n * @param  {String} dataStr Input data string\n * @return {Mode}           Best mode\n */\nexports.getBestModeForData = function getBestModeForData (dataStr) {\n  if (Regex.testNumeric(dataStr)) return exports.NUMERIC\n  else if (Regex.testAlphanumeric(dataStr)) return exports.ALPHANUMERIC\n  else if (Regex.testKanji(dataStr)) return exports.KANJI\n  else return exports.BYTE\n}\n\n/**\n * Return mode name as string\n *\n * @param {Mode} mode Mode object\n * @returns {String}  Mode name\n */\nexports.toString = function toString (mode) {\n  if (mode && mode.id) return mode.id\n  throw new Error('Invalid mode')\n}\n\n/**\n * Check if input param is a valid mode object\n *\n * @param   {Mode}    mode Mode object\n * @returns {Boolean} True if valid mode, false otherwise\n */\nexports.isValid = function isValid (mode) {\n  return mode && mode.bit && mode.ccBits\n}\n\n/**\n * Get mode object from its name\n *\n * @param   {String} string Mode name\n * @returns {Mode}          Mode object\n */\nfunction fromString (string) {\n  if (typeof string !== 'string') {\n    throw new Error('Param is not a string')\n  }\n\n  const lcStr = string.toLowerCase()\n\n  switch (lcStr) {\n    case 'numeric':\n      return exports.NUMERIC\n    case 'alphanumeric':\n      return exports.ALPHANUMERIC\n    case 'kanji':\n      return exports.KANJI\n    case 'byte':\n      return exports.BYTE\n    default:\n      throw new Error('Unknown mode: ' + string)\n  }\n}\n\n/**\n * Returns mode from a value.\n * If value is not a valid mode, returns defaultValue\n *\n * @param  {Mode|String} value        Encoding mode\n * @param  {Mode}        defaultValue Fallback value\n * @return {Mode}                     Encoding mode\n */\nexports.from = function from (value, defaultValue) {\n  if (exports.isValid(value)) {\n    return value\n  }\n\n  try {\n    return fromString(value)\n  } catch (e) {\n    return defaultValue\n  }\n}\n", "const Utils = require('./utils')\nconst ECCode = require('./error-correction-code')\nconst ECLevel = require('./error-correction-level')\nconst Mode = require('./mode')\nconst VersionCheck = require('./version-check')\n\n// Generator polynomial used to encode version information\nconst G18 = (1 << 12) | (1 << 11) | (1 << 10) | (1 << 9) | (1 << 8) | (1 << 5) | (1 << 2) | (1 << 0)\nconst G18_BCH = Utils.getBCHDigit(G18)\n\nfunction getBestVersionForDataLength (mode, length, errorCorrectionLevel) {\n  for (let currentVersion = 1; currentVersion <= 40; currentVersion++) {\n    if (length <= exports.getCapacity(currentVersion, errorCorrectionLevel, mode)) {\n      return currentVersion\n    }\n  }\n\n  return undefined\n}\n\nfunction getReservedBitsCount (mode, version) {\n  // Character count indicator + mode indicator bits\n  return Mode.getCharCountIndicator(mode, version) + 4\n}\n\nfunction getTotalBitsFromDataArray (segments, version) {\n  let totalBits = 0\n\n  segments.forEach(function (data) {\n    const reservedBits = getReservedBitsCount(data.mode, version)\n    totalBits += reservedBits + data.getBitsLength()\n  })\n\n  return totalBits\n}\n\nfunction getBestVersionForMixedData (segments, errorCorrectionLevel) {\n  for (let currentVersion = 1; currentVersion <= 40; currentVersion++) {\n    const length = getTotalBitsFromDataArray(segments, currentVersion)\n    if (length <= exports.getCapacity(currentVersion, errorCorrectionLevel, Mode.MIXED)) {\n      return currentVersion\n    }\n  }\n\n  return undefined\n}\n\n/**\n * Returns version number from a value.\n * If value is not a valid version, returns defaultValue\n *\n * @param  {Number|String} value        QR Code version\n * @param  {Number}        defaultValue Fallback value\n * @return {Number}                     QR Code version number\n */\nexports.from = function from (value, defaultValue) {\n  if (VersionCheck.isValid(value)) {\n    return parseInt(value, 10)\n  }\n\n  return defaultValue\n}\n\n/**\n * Returns how much data can be stored with the specified QR code version\n * and error correction level\n *\n * @param  {Number} version              QR Code version (1-40)\n * @param  {Number} errorCorrectionLevel Error correction level\n * @param  {Mode}   mode                 Data mode\n * @return {Number}                      Quantity of storable data\n */\nexports.getCapacity = function getCapacity (version, errorCorrectionLevel, mode) {\n  if (!VersionCheck.isValid(version)) {\n    throw new Error('Invalid QR Code version')\n  }\n\n  // Use Byte mode as default\n  if (typeof mode === 'undefined') mode = Mode.BYTE\n\n  // Total codewords for this QR code version (Data + Error correction)\n  const totalCodewords = Utils.getSymbolTotalCodewords(version)\n\n  // Total number of error correction codewords\n  const ecTotalCodewords = ECCode.getTotalCodewordsCount(version, errorCorrectionLevel)\n\n  // Total number of data codewords\n  const dataTotalCodewordsBits = (totalCodewords - ecTotalCodewords) * 8\n\n  if (mode === Mode.MIXED) return dataTotalCodewordsBits\n\n  const usableBits = dataTotalCodewordsBits - getReservedBitsCount(mode, version)\n\n  // Return max number of storable codewords\n  switch (mode) {\n    case Mode.NUMERIC:\n      return Math.floor((usableBits / 10) * 3)\n\n    case Mode.ALPHANUMERIC:\n      return Math.floor((usableBits / 11) * 2)\n\n    case Mode.KANJI:\n      return Math.floor(usableBits / 13)\n\n    case Mode.BYTE:\n    default:\n      return Math.floor(usableBits / 8)\n  }\n}\n\n/**\n * Returns the minimum version needed to contain the amount of data\n *\n * @param  {Segment} data                    Segment of data\n * @param  {Number} [errorCorrectionLevel=H] Error correction level\n * @param  {Mode} mode                       Data mode\n * @return {Number}                          QR Code version\n */\nexports.getBestVersionForData = function getBestVersionForData (data, errorCorrectionLevel) {\n  let seg\n\n  const ecl = ECLevel.from(errorCorrectionLevel, ECLevel.M)\n\n  if (Array.isArray(data)) {\n    if (data.length > 1) {\n      return getBestVersionForMixedData(data, ecl)\n    }\n\n    if (data.length === 0) {\n      return 1\n    }\n\n    seg = data[0]\n  } else {\n    seg = data\n  }\n\n  return getBestVersionForDataLength(seg.mode, seg.getLength(), ecl)\n}\n\n/**\n * Returns version information with relative error correction bits\n *\n * The version information is included in QR Code symbols of version 7 or larger.\n * It consists of an 18-bit sequence containing 6 data bits,\n * with 12 error correction bits calculated using the (18, 6) Golay code.\n *\n * @param  {Number} version QR Code version\n * @return {Number}         Encoded version info bits\n */\nexports.getEncodedBits = function getEncodedBits (version) {\n  if (!VersionCheck.isValid(version) || version < 7) {\n    throw new Error('Invalid QR Code version')\n  }\n\n  let d = version << 12\n\n  while (Utils.getBCHDigit(d) - G18_BCH >= 0) {\n    d ^= (G18 << (Utils.getBCHDigit(d) - G18_BCH))\n  }\n\n  return (version << 12) | d\n}\n", "const Utils = require('./utils')\n\nconst G15 = (1 << 10) | (1 << 8) | (1 << 5) | (1 << 4) | (1 << 2) | (1 << 1) | (1 << 0)\nconst G15_MASK = (1 << 14) | (1 << 12) | (1 << 10) | (1 << 4) | (1 << 1)\nconst G15_BCH = Utils.getBCHDigit(G15)\n\n/**\n * Returns format information with relative error correction bits\n *\n * The format information is a 15-bit sequence containing 5 data bits,\n * with 10 error correction bits calculated using the (15, 5) BCH code.\n *\n * @param  {Number} errorCorrectionLevel Error correction level\n * @param  {Number} mask                 Mask pattern\n * @return {Number}                      Encoded format information bits\n */\nexports.getEncodedBits = function getEncodedBits (errorCorrectionLevel, mask) {\n  const data = ((errorCorrectionLevel.bit << 3) | mask)\n  let d = data << 10\n\n  while (Utils.getBCHDigit(d) - G15_BCH >= 0) {\n    d ^= (G15 << (Utils.getBCHDigit(d) - G15_BCH))\n  }\n\n  // xor final data with mask pattern in order to ensure that\n  // no combination of Error Correction Level and data mask pattern\n  // will result in an all-zero data string\n  return ((data << 10) | d) ^ G15_MASK\n}\n", "const Mode = require('./mode')\n\nfunction NumericData (data) {\n  this.mode = Mode.NUMERIC\n  this.data = data.toString()\n}\n\nNumericData.getBitsLength = function getBitsLength (length) {\n  return 10 * Math.floor(length / 3) + ((length % 3) ? ((length % 3) * 3 + 1) : 0)\n}\n\nNumericData.prototype.getLength = function getLength () {\n  return this.data.length\n}\n\nNumericData.prototype.getBitsLength = function getBitsLength () {\n  return NumericData.getBitsLength(this.data.length)\n}\n\nNumericData.prototype.write = function write (bitBuffer) {\n  let i, group, value\n\n  // The input data string is divided into groups of three digits,\n  // and each group is converted to its 10-bit binary equivalent.\n  for (i = 0; i + 3 <= this.data.length; i += 3) {\n    group = this.data.substr(i, 3)\n    value = parseInt(group, 10)\n\n    bitBuffer.put(value, 10)\n  }\n\n  // If the number of input digits is not an exact multiple of three,\n  // the final one or two digits are converted to 4 or 7 bits respectively.\n  const remainingNum = this.data.length - i\n  if (remainingNum > 0) {\n    group = this.data.substr(i)\n    value = parseInt(group, 10)\n\n    bitBuffer.put(value, remainingNum * 3 + 1)\n  }\n}\n\nmodule.exports = NumericData\n", "const Mode = require('./mode')\n\n/**\n * Array of characters available in alphanumeric mode\n *\n * As per QR Code specification, to each character\n * is assigned a value from 0 to 44 which in this case coincides\n * with the array index\n *\n * @type {Array}\n */\nconst ALPHA_NUM_CHARS = [\n  '0', '1', '2', '3', '4', '5', '6', '7', '8', '9',\n  'A', 'B', 'C', 'D', 'E', 'F', 'G', 'H', 'I', 'J', 'K', 'L', 'M',\n  'N', 'O', 'P', 'Q', 'R', 'S', 'T', 'U', 'V', 'W', 'X', 'Y', 'Z',\n  ' ', '$', '%', '*', '+', '-', '.', '/', ':'\n]\n\nfunction AlphanumericData (data) {\n  this.mode = Mode.ALPHANUMERIC\n  this.data = data\n}\n\nAlphanumericData.getBitsLength = function getBitsLength (length) {\n  return 11 * Math.floor(length / 2) + 6 * (length % 2)\n}\n\nAlphanumericData.prototype.getLength = function getLength () {\n  return this.data.length\n}\n\nAlphanumericData.prototype.getBitsLength = function getBitsLength () {\n  return AlphanumericData.getBitsLength(this.data.length)\n}\n\nAlphanumericData.prototype.write = function write (bitBuffer) {\n  let i\n\n  // Input data characters are divided into groups of two characters\n  // and encoded as 11-bit binary codes.\n  for (i = 0; i + 2 <= this.data.length; i += 2) {\n    // The character value of the first character is multiplied by 45\n    let value = ALPHA_NUM_CHARS.indexOf(this.data[i]) * 45\n\n    // The character value of the second digit is added to the product\n    value += ALPHA_NUM_CHARS.indexOf(this.data[i + 1])\n\n    // The sum is then stored as 11-bit binary number\n    bitBuffer.put(value, 11)\n  }\n\n  // If the number of input data characters is not a multiple of two,\n  // the character value of the final character is encoded as a 6-bit binary number.\n  if (this.data.length % 2) {\n    bitBuffer.put(ALPHA_NUM_CHARS.indexOf(this.data[i]), 6)\n  }\n}\n\nmodule.exports = AlphanumericData\n", "const Mode = require('./mode')\n\nfunction ByteData (data) {\n  this.mode = Mode.BYTE\n  if (typeof (data) === 'string') {\n    this.data = new TextEncoder().encode(data)\n  } else {\n    this.data = new Uint8Array(data)\n  }\n}\n\nByteData.getBitsLength = function getBitsLength (length) {\n  return length * 8\n}\n\nByteData.prototype.getLength = function getLength () {\n  return this.data.length\n}\n\nByteData.prototype.getBitsLength = function getBitsLength () {\n  return ByteData.getBitsLength(this.data.length)\n}\n\nByteData.prototype.write = function (bitBuffer) {\n  for (let i = 0, l = this.data.length; i < l; i++) {\n    bitBuffer.put(this.data[i], 8)\n  }\n}\n\nmodule.exports = ByteData\n", "const Mode = require('./mode')\nconst Utils = require('./utils')\n\nfunction KanjiData (data) {\n  this.mode = Mode.KANJI\n  this.data = data\n}\n\nKanjiData.getBitsLength = function getBitsLength (length) {\n  return length * 13\n}\n\nKanjiData.prototype.getLength = function getLength () {\n  return this.data.length\n}\n\nKanjiData.prototype.getBitsLength = function getBitsLength () {\n  return KanjiData.getBitsLength(this.data.length)\n}\n\nKanjiData.prototype.write = function (bitBuffer) {\n  let i\n\n  // In the Shift JIS system, Kanji characters are represented by a two byte combination.\n  // These byte values are shifted from the JIS X 0208 values.\n  // JIS X 0208 gives details of the shift coded representation.\n  for (i = 0; i < this.data.length; i++) {\n    let value = Utils.toSJIS(this.data[i])\n\n    // For characters with Shift JIS values from 0x8140 to 0x9FFC:\n    if (value >= 0x8140 && value <= 0x9FFC) {\n      // Subtract 0x8140 from Shift JIS value\n      value -= 0x8140\n\n    // For characters with Shift JIS values from 0xE040 to 0xEBBF\n    } else if (value >= 0xE040 && value <= 0xEBBF) {\n      // Subtract 0xC140 from Shift JIS value\n      value -= 0xC140\n    } else {\n      throw new Error(\n        'Invalid SJIS character: ' + this.data[i] + '\\n' +\n        'Make sure your charset is UTF-8')\n    }\n\n    // Multiply most significant byte of result by 0xC0\n    // and add least significant byte to product\n    value = (((value >>> 8) & 0xff) * 0xC0) + (value & 0xff)\n\n    // Convert result to a 13-bit binary string\n    bitBuffer.put(value, 13)\n  }\n}\n\nmodule.exports = KanjiData\n", "'use strict';\n\n/******************************************************************************\n * Created 2008-08-19.\n *\n * Dijkstra path-finding functions. Adapted from the Dijkstar Python project.\n *\n * Copyright (C) 2008\n *   Wyatt Baldwin <self@wyattbaldwin.com>\n *   All rights reserved\n *\n * Licensed under the MIT license.\n *\n *   http://www.opensource.org/licenses/mit-license.php\n *\n * THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\n * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,\n * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE\n * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER\n * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,\n * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN\n * THE SOFTWARE.\n *****************************************************************************/\nvar dijkstra = {\n  single_source_shortest_paths: function(graph, s, d) {\n    // Predecessor map for each node that has been encountered.\n    // node ID => predecessor node ID\n    var predecessors = {};\n\n    // Costs of shortest paths from s to all nodes encountered.\n    // node ID => cost\n    var costs = {};\n    costs[s] = 0;\n\n    // Costs of shortest paths from s to all nodes encountered; differs from\n    // `costs` in that it provides easy access to the node that currently has\n    // the known shortest path from s.\n    // XXX: Do we actually need both `costs` and `open`?\n    var open = dijkstra.PriorityQueue.make();\n    open.push(s, 0);\n\n    var closest,\n        u, v,\n        cost_of_s_to_u,\n        adjacent_nodes,\n        cost_of_e,\n        cost_of_s_to_u_plus_cost_of_e,\n        cost_of_s_to_v,\n        first_visit;\n    while (!open.empty()) {\n      // In the nodes remaining in graph that have a known cost from s,\n      // find the node, u, that currently has the shortest path from s.\n      closest = open.pop();\n      u = closest.value;\n      cost_of_s_to_u = closest.cost;\n\n      // Get nodes adjacent to u...\n      adjacent_nodes = graph[u] || {};\n\n      // ...and explore the edges that connect u to those nodes, updating\n      // the cost of the shortest paths to any or all of those nodes as\n      // necessary. v is the node across the current edge from u.\n      for (v in adjacent_nodes) {\n        if (adjacent_nodes.hasOwnProperty(v)) {\n          // Get the cost of the edge running from u to v.\n          cost_of_e = adjacent_nodes[v];\n\n          // Cost of s to u plus the cost of u to v across e--this is *a*\n          // cost from s to v that may or may not be less than the current\n          // known cost to v.\n          cost_of_s_to_u_plus_cost_of_e = cost_of_s_to_u + cost_of_e;\n\n          // If we haven't visited v yet OR if the current known cost from s to\n          // v is greater than the new cost we just found (cost of s to u plus\n          // cost of u to v across e), update v's cost in the cost list and\n          // update v's predecessor in the predecessor list (it's now u).\n          cost_of_s_to_v = costs[v];\n          first_visit = (typeof costs[v] === 'undefined');\n          if (first_visit || cost_of_s_to_v > cost_of_s_to_u_plus_cost_of_e) {\n            costs[v] = cost_of_s_to_u_plus_cost_of_e;\n            open.push(v, cost_of_s_to_u_plus_cost_of_e);\n            predecessors[v] = u;\n          }\n        }\n      }\n    }\n\n    if (typeof d !== 'undefined' && typeof costs[d] === 'undefined') {\n      var msg = ['Could not find a path from ', s, ' to ', d, '.'].join('');\n      throw new Error(msg);\n    }\n\n    return predecessors;\n  },\n\n  extract_shortest_path_from_predecessor_list: function(predecessors, d) {\n    var nodes = [];\n    var u = d;\n    var predecessor;\n    while (u) {\n      nodes.push(u);\n      predecessor = predecessors[u];\n      u = predecessors[u];\n    }\n    nodes.reverse();\n    return nodes;\n  },\n\n  find_path: function(graph, s, d) {\n    var predecessors = dijkstra.single_source_shortest_paths(graph, s, d);\n    return dijkstra.extract_shortest_path_from_predecessor_list(\n      predecessors, d);\n  },\n\n  /**\n   * A very naive priority queue implementation.\n   */\n  PriorityQueue: {\n    make: function (opts) {\n      var T = dijkstra.PriorityQueue,\n          t = {},\n          key;\n      opts = opts || {};\n      for (key in T) {\n        if (T.hasOwnProperty(key)) {\n          t[key] = T[key];\n        }\n      }\n      t.queue = [];\n      t.sorter = opts.sorter || T.default_sorter;\n      return t;\n    },\n\n    default_sorter: function (a, b) {\n      return a.cost - b.cost;\n    },\n\n    /**\n     * Add a new item to the queue and ensure the highest priority element\n     * is at the front of the queue.\n     */\n    push: function (value, cost) {\n      var item = {value: value, cost: cost};\n      this.queue.push(item);\n      this.queue.sort(this.sorter);\n    },\n\n    /**\n     * Return the highest priority element in the queue.\n     */\n    pop: function () {\n      return this.queue.shift();\n    },\n\n    empty: function () {\n      return this.queue.length === 0;\n    }\n  }\n};\n\n\n// node.js module exports\nif (typeof module !== 'undefined') {\n  module.exports = dijkstra;\n}\n", "const Mode = require('./mode')\nconst NumericData = require('./numeric-data')\nconst AlphanumericData = require('./alphanumeric-data')\nconst ByteData = require('./byte-data')\nconst KanjiData = require('./kanji-data')\nconst Regex = require('./regex')\nconst Utils = require('./utils')\nconst dijkstra = require('dijkstrajs')\n\n/**\n * Returns UTF8 byte length\n *\n * @param  {String} str Input string\n * @return {Number}     Number of byte\n */\nfunction getStringByteLength (str) {\n  return unescape(encodeURIComponent(str)).length\n}\n\n/**\n * Get a list of segments of the specified mode\n * from a string\n *\n * @param  {Mode}   mode Segment mode\n * @param  {String} str  String to process\n * @return {Array}       Array of object with segments data\n */\nfunction getSegments (regex, mode, str) {\n  const segments = []\n  let result\n\n  while ((result = regex.exec(str)) !== null) {\n    segments.push({\n      data: result[0],\n      index: result.index,\n      mode: mode,\n      length: result[0].length\n    })\n  }\n\n  return segments\n}\n\n/**\n * Extracts a series of segments with the appropriate\n * modes from a string\n *\n * @param  {String} dataStr Input string\n * @return {Array}          Array of object with segments data\n */\nfunction getSegmentsFromString (dataStr) {\n  const numSegs = getSegments(Regex.NUMERIC, Mode.NUMERIC, dataStr)\n  const alphaNumSegs = getSegments(Regex.ALPHANUMERIC, Mode.ALPHANUMERIC, dataStr)\n  let byteSegs\n  let kanjiSegs\n\n  if (Utils.isKanjiModeEnabled()) {\n    byteSegs = getSegments(Regex.BYTE, Mode.BYTE, dataStr)\n    kanjiSegs = getSegments(Regex.KANJI, Mode.KANJI, dataStr)\n  } else {\n    byteSegs = getSegments(Regex.BYTE_KANJI, Mode.BYTE, dataStr)\n    kanjiSegs = []\n  }\n\n  const segs = numSegs.concat(alphaNumSegs, byteSegs, kanjiSegs)\n\n  return segs\n    .sort(function (s1, s2) {\n      return s1.index - s2.index\n    })\n    .map(function (obj) {\n      return {\n        data: obj.data,\n        mode: obj.mode,\n        length: obj.length\n      }\n    })\n}\n\n/**\n * Returns how many bits are needed to encode a string of\n * specified length with the specified mode\n *\n * @param  {Number} length String length\n * @param  {Mode} mode     Segment mode\n * @return {Number}        Bit length\n */\nfunction getSegmentBitsLength (length, mode) {\n  switch (mode) {\n    case Mode.NUMERIC:\n      return NumericData.getBitsLength(length)\n    case Mode.ALPHANUMERIC:\n      return AlphanumericData.getBitsLength(length)\n    case Mode.KANJI:\n      return KanjiData.getBitsLength(length)\n    case Mode.BYTE:\n      return ByteData.getBitsLength(length)\n  }\n}\n\n/**\n * Merges adjacent segments which have the same mode\n *\n * @param  {Array} segs Array of object with segments data\n * @return {Array}      Array of object with segments data\n */\nfunction mergeSegments (segs) {\n  return segs.reduce(function (acc, curr) {\n    const prevSeg = acc.length - 1 >= 0 ? acc[acc.length - 1] : null\n    if (prevSeg && prevSeg.mode === curr.mode) {\n      acc[acc.length - 1].data += curr.data\n      return acc\n    }\n\n    acc.push(curr)\n    return acc\n  }, [])\n}\n\n/**\n * Generates a list of all possible nodes combination which\n * will be used to build a segments graph.\n *\n * Nodes are divided by groups. Each group will contain a list of all the modes\n * in which is possible to encode the given text.\n *\n * For example the text '12345' can be encoded as Numeric, Alphanumeric or Byte.\n * The group for '12345' will contain then 3 objects, one for each\n * possible encoding mode.\n *\n * Each node represents a possible segment.\n *\n * @param  {Array} segs Array of object with segments data\n * @return {Array}      Array of object with segments data\n */\nfunction buildNodes (segs) {\n  const nodes = []\n  for (let i = 0; i < segs.length; i++) {\n    const seg = segs[i]\n\n    switch (seg.mode) {\n      case Mode.NUMERIC:\n        nodes.push([seg,\n          { data: seg.data, mode: Mode.ALPHANUMERIC, length: seg.length },\n          { data: seg.data, mode: Mode.BYTE, length: seg.length }\n        ])\n        break\n      case Mode.ALPHANUMERIC:\n        nodes.push([seg,\n          { data: seg.data, mode: Mode.BYTE, length: seg.length }\n        ])\n        break\n      case Mode.KANJI:\n        nodes.push([seg,\n          { data: seg.data, mode: Mode.BYTE, length: getStringByteLength(seg.data) }\n        ])\n        break\n      case Mode.BYTE:\n        nodes.push([\n          { data: seg.data, mode: Mode.BYTE, length: getStringByteLength(seg.data) }\n        ])\n    }\n  }\n\n  return nodes\n}\n\n/**\n * Builds a graph from a list of nodes.\n * All segments in each node group will be connected with all the segments of\n * the next group and so on.\n *\n * At each connection will be assigned a weight depending on the\n * segment's byte length.\n *\n * @param  {Array} nodes    Array of object with segments data\n * @param  {Number} version QR Code version\n * @return {Object}         Graph of all possible segments\n */\nfunction buildGraph (nodes, version) {\n  const table = {}\n  const graph = { start: {} }\n  let prevNodeIds = ['start']\n\n  for (let i = 0; i < nodes.length; i++) {\n    const nodeGroup = nodes[i]\n    const currentNodeIds = []\n\n    for (let j = 0; j < nodeGroup.length; j++) {\n      const node = nodeGroup[j]\n      const key = '' + i + j\n\n      currentNodeIds.push(key)\n      table[key] = { node: node, lastCount: 0 }\n      graph[key] = {}\n\n      for (let n = 0; n < prevNodeIds.length; n++) {\n        const prevNodeId = prevNodeIds[n]\n\n        if (table[prevNodeId] && table[prevNodeId].node.mode === node.mode) {\n          graph[prevNodeId][key] =\n            getSegmentBitsLength(table[prevNodeId].lastCount + node.length, node.mode) -\n            getSegmentBitsLength(table[prevNodeId].lastCount, node.mode)\n\n          table[prevNodeId].lastCount += node.length\n        } else {\n          if (table[prevNodeId]) table[prevNodeId].lastCount = node.length\n\n          graph[prevNodeId][key] = getSegmentBitsLength(node.length, node.mode) +\n            4 + Mode.getCharCountIndicator(node.mode, version) // switch cost\n        }\n      }\n    }\n\n    prevNodeIds = currentNodeIds\n  }\n\n  for (let n = 0; n < prevNodeIds.length; n++) {\n    graph[prevNodeIds[n]].end = 0\n  }\n\n  return { map: graph, table: table }\n}\n\n/**\n * Builds a segment from a specified data and mode.\n * If a mode is not specified, the more suitable will be used.\n *\n * @param  {String} data             Input data\n * @param  {Mode | String} modesHint Data mode\n * @return {Segment}                 Segment\n */\nfunction buildSingleSegment (data, modesHint) {\n  let mode\n  const bestMode = Mode.getBestModeForData(data)\n\n  mode = Mode.from(modesHint, bestMode)\n\n  // Make sure data can be encoded\n  if (mode !== Mode.BYTE && mode.bit < bestMode.bit) {\n    throw new Error('\"' + data + '\"' +\n      ' cannot be encoded with mode ' + Mode.toString(mode) +\n      '.\\n Suggested mode is: ' + Mode.toString(bestMode))\n  }\n\n  // Use Mode.BYTE if Kanji support is disabled\n  if (mode === Mode.KANJI && !Utils.isKanjiModeEnabled()) {\n    mode = Mode.BYTE\n  }\n\n  switch (mode) {\n    case Mode.NUMERIC:\n      return new NumericData(data)\n\n    case Mode.ALPHANUMERIC:\n      return new AlphanumericData(data)\n\n    case Mode.KANJI:\n      return new KanjiData(data)\n\n    case Mode.BYTE:\n      return new ByteData(data)\n  }\n}\n\n/**\n * Builds a list of segments from an array.\n * Array can contain Strings or Objects with segment's info.\n *\n * For each item which is a string, will be generated a segment with the given\n * string and the more appropriate encoding mode.\n *\n * For each item which is an object, will be generated a segment with the given\n * data and mode.\n * Objects must contain at least the property \"data\".\n * If property \"mode\" is not present, the more suitable mode will be used.\n *\n * @param  {Array} array Array of objects with segments data\n * @return {Array}       Array of Segments\n */\nexports.fromArray = function fromArray (array) {\n  return array.reduce(function (acc, seg) {\n    if (typeof seg === 'string') {\n      acc.push(buildSingleSegment(seg, null))\n    } else if (seg.data) {\n      acc.push(buildSingleSegment(seg.data, seg.mode))\n    }\n\n    return acc\n  }, [])\n}\n\n/**\n * Builds an optimized sequence of segments from a string,\n * which will produce the shortest possible bitstream.\n *\n * @param  {String} data    Input string\n * @param  {Number} version QR Code version\n * @return {Array}          Array of segments\n */\nexports.fromString = function fromString (data, version) {\n  const segs = getSegmentsFromString(data, Utils.isKanjiModeEnabled())\n\n  const nodes = buildNodes(segs)\n  const graph = buildGraph(nodes, version)\n  const path = dijkstra.find_path(graph.map, 'start', 'end')\n\n  const optimizedSegs = []\n  for (let i = 1; i < path.length - 1; i++) {\n    optimizedSegs.push(graph.table[path[i]].node)\n  }\n\n  return exports.fromArray(mergeSegments(optimizedSegs))\n}\n\n/**\n * Splits a string in various segments with the modes which\n * best represent their content.\n * The produced segments are far from being optimized.\n * The output of this function is only used to estimate a QR Code version\n * which may contain the data.\n *\n * @param  {string} data Input string\n * @return {Array}       Array of segments\n */\nexports.rawSplit = function rawSplit (data) {\n  return exports.fromArray(\n    getSegmentsFromString(data, Utils.isKanjiModeEnabled())\n  )\n}\n", "const Utils = require('./utils')\nconst ECLevel = require('./error-correction-level')\nconst BitBuffer = require('./bit-buffer')\nconst BitMatrix = require('./bit-matrix')\nconst AlignmentPattern = require('./alignment-pattern')\nconst FinderPattern = require('./finder-pattern')\nconst MaskPattern = require('./mask-pattern')\nconst ECCode = require('./error-correction-code')\nconst ReedSolomonEncoder = require('./reed-solomon-encoder')\nconst Version = require('./version')\nconst FormatInfo = require('./format-info')\nconst Mode = require('./mode')\nconst Segments = require('./segments')\n\n/**\n * QRCode for JavaScript\n *\n * modified by Ryan Day for nodejs support\n * Copyright (c) 2011 Ryan Day\n *\n * Licensed under the MIT license:\n *   http://www.opensource.org/licenses/mit-license.php\n *\n//---------------------------------------------------------------------\n// QRCode for JavaScript\n//\n// Copyright (c) 2009 Kazuhiko Arase\n//\n// URL: http://www.d-project.com/\n//\n// Licensed under the MIT license:\n//   http://www.opensource.org/licenses/mit-license.php\n//\n// The word \"QR Code\" is registered trademark of\n// DENSO WAVE INCORPORATED\n//   http://www.denso-wave.com/qrcode/faqpatent-e.html\n//\n//---------------------------------------------------------------------\n*/\n\n/**\n * Add finder patterns bits to matrix\n *\n * @param  {BitMatrix} matrix  Modules matrix\n * @param  {Number}    version QR Code version\n */\nfunction setupFinderPattern (matrix, version) {\n  const size = matrix.size\n  const pos = FinderPattern.getPositions(version)\n\n  for (let i = 0; i < pos.length; i++) {\n    const row = pos[i][0]\n    const col = pos[i][1]\n\n    for (let r = -1; r <= 7; r++) {\n      if (row + r <= -1 || size <= row + r) continue\n\n      for (let c = -1; c <= 7; c++) {\n        if (col + c <= -1 || size <= col + c) continue\n\n        if ((r >= 0 && r <= 6 && (c === 0 || c === 6)) ||\n          (c >= 0 && c <= 6 && (r === 0 || r === 6)) ||\n          (r >= 2 && r <= 4 && c >= 2 && c <= 4)) {\n          matrix.set(row + r, col + c, true, true)\n        } else {\n          matrix.set(row + r, col + c, false, true)\n        }\n      }\n    }\n  }\n}\n\n/**\n * Add timing pattern bits to matrix\n *\n * Note: this function must be called before {@link setupAlignmentPattern}\n *\n * @param  {BitMatrix} matrix Modules matrix\n */\nfunction setupTimingPattern (matrix) {\n  const size = matrix.size\n\n  for (let r = 8; r < size - 8; r++) {\n    const value = r % 2 === 0\n    matrix.set(r, 6, value, true)\n    matrix.set(6, r, value, true)\n  }\n}\n\n/**\n * Add alignment patterns bits to matrix\n *\n * Note: this function must be called after {@link setupTimingPattern}\n *\n * @param  {BitMatrix} matrix  Modules matrix\n * @param  {Number}    version QR Code version\n */\nfunction setupAlignmentPattern (matrix, version) {\n  const pos = AlignmentPattern.getPositions(version)\n\n  for (let i = 0; i < pos.length; i++) {\n    const row = pos[i][0]\n    const col = pos[i][1]\n\n    for (let r = -2; r <= 2; r++) {\n      for (let c = -2; c <= 2; c++) {\n        if (r === -2 || r === 2 || c === -2 || c === 2 ||\n          (r === 0 && c === 0)) {\n          matrix.set(row + r, col + c, true, true)\n        } else {\n          matrix.set(row + r, col + c, false, true)\n        }\n      }\n    }\n  }\n}\n\n/**\n * Add version info bits to matrix\n *\n * @param  {BitMatrix} matrix  Modules matrix\n * @param  {Number}    version QR Code version\n */\nfunction setupVersionInfo (matrix, version) {\n  const size = matrix.size\n  const bits = Version.getEncodedBits(version)\n  let row, col, mod\n\n  for (let i = 0; i < 18; i++) {\n    row = Math.floor(i / 3)\n    col = i % 3 + size - 8 - 3\n    mod = ((bits >> i) & 1) === 1\n\n    matrix.set(row, col, mod, true)\n    matrix.set(col, row, mod, true)\n  }\n}\n\n/**\n * Add format info bits to matrix\n *\n * @param  {BitMatrix} matrix               Modules matrix\n * @param  {ErrorCorrectionLevel}    errorCorrectionLevel Error correction level\n * @param  {Number}    maskPattern          Mask pattern reference value\n */\nfunction setupFormatInfo (matrix, errorCorrectionLevel, maskPattern) {\n  const size = matrix.size\n  const bits = FormatInfo.getEncodedBits(errorCorrectionLevel, maskPattern)\n  let i, mod\n\n  for (i = 0; i < 15; i++) {\n    mod = ((bits >> i) & 1) === 1\n\n    // vertical\n    if (i < 6) {\n      matrix.set(i, 8, mod, true)\n    } else if (i < 8) {\n      matrix.set(i + 1, 8, mod, true)\n    } else {\n      matrix.set(size - 15 + i, 8, mod, true)\n    }\n\n    // horizontal\n    if (i < 8) {\n      matrix.set(8, size - i - 1, mod, true)\n    } else if (i < 9) {\n      matrix.set(8, 15 - i - 1 + 1, mod, true)\n    } else {\n      matrix.set(8, 15 - i - 1, mod, true)\n    }\n  }\n\n  // fixed module\n  matrix.set(size - 8, 8, 1, true)\n}\n\n/**\n * Add encoded data bits to matrix\n *\n * @param  {BitMatrix}  matrix Modules matrix\n * @param  {Uint8Array} data   Data codewords\n */\nfunction setupData (matrix, data) {\n  const size = matrix.size\n  let inc = -1\n  let row = size - 1\n  let bitIndex = 7\n  let byteIndex = 0\n\n  for (let col = size - 1; col > 0; col -= 2) {\n    if (col === 6) col--\n\n    while (true) {\n      for (let c = 0; c < 2; c++) {\n        if (!matrix.isReserved(row, col - c)) {\n          let dark = false\n\n          if (byteIndex < data.length) {\n            dark = (((data[byteIndex] >>> bitIndex) & 1) === 1)\n          }\n\n          matrix.set(row, col - c, dark)\n          bitIndex--\n\n          if (bitIndex === -1) {\n            byteIndex++\n            bitIndex = 7\n          }\n        }\n      }\n\n      row += inc\n\n      if (row < 0 || size <= row) {\n        row -= inc\n        inc = -inc\n        break\n      }\n    }\n  }\n}\n\n/**\n * Create encoded codewords from data input\n *\n * @param  {Number}   version              QR Code version\n * @param  {ErrorCorrectionLevel}   errorCorrectionLevel Error correction level\n * @param  {ByteData} data                 Data input\n * @return {Uint8Array}                    Buffer containing encoded codewords\n */\nfunction createData (version, errorCorrectionLevel, segments) {\n  // Prepare data buffer\n  const buffer = new BitBuffer()\n\n  segments.forEach(function (data) {\n    // prefix data with mode indicator (4 bits)\n    buffer.put(data.mode.bit, 4)\n\n    // Prefix data with character count indicator.\n    // The character count indicator is a string of bits that represents the\n    // number of characters that are being encoded.\n    // The character count indicator must be placed after the mode indicator\n    // and must be a certain number of bits long, depending on the QR version\n    // and data mode\n    // @see {@link Mode.getCharCountIndicator}.\n    buffer.put(data.getLength(), Mode.getCharCountIndicator(data.mode, version))\n\n    // add binary data sequence to buffer\n    data.write(buffer)\n  })\n\n  // Calculate required number of bits\n  const totalCodewords = Utils.getSymbolTotalCodewords(version)\n  const ecTotalCodewords = ECCode.getTotalCodewordsCount(version, errorCorrectionLevel)\n  const dataTotalCodewordsBits = (totalCodewords - ecTotalCodewords) * 8\n\n  // Add a terminator.\n  // If the bit string is shorter than the total number of required bits,\n  // a terminator of up to four 0s must be added to the right side of the string.\n  // If the bit string is more than four bits shorter than the required number of bits,\n  // add four 0s to the end.\n  if (buffer.getLengthInBits() + 4 <= dataTotalCodewordsBits) {\n    buffer.put(0, 4)\n  }\n\n  // If the bit string is fewer than four bits shorter, add only the number of 0s that\n  // are needed to reach the required number of bits.\n\n  // After adding the terminator, if the number of bits in the string is not a multiple of 8,\n  // pad the string on the right with 0s to make the string's length a multiple of 8.\n  while (buffer.getLengthInBits() % 8 !== 0) {\n    buffer.putBit(0)\n  }\n\n  // Add pad bytes if the string is still shorter than the total number of required bits.\n  // Extend the buffer to fill the data capacity of the symbol corresponding to\n  // the Version and Error Correction Level by adding the Pad Codewords 11101100 (0xEC)\n  // and 00010001 (0x11) alternately.\n  const remainingByte = (dataTotalCodewordsBits - buffer.getLengthInBits()) / 8\n  for (let i = 0; i < remainingByte; i++) {\n    buffer.put(i % 2 ? 0x11 : 0xEC, 8)\n  }\n\n  return createCodewords(buffer, version, errorCorrectionLevel)\n}\n\n/**\n * Encode input data with Reed-Solomon and return codewords with\n * relative error correction bits\n *\n * @param  {BitBuffer} bitBuffer            Data to encode\n * @param  {Number}    version              QR Code version\n * @param  {ErrorCorrectionLevel} errorCorrectionLevel Error correction level\n * @return {Uint8Array}                     Buffer containing encoded codewords\n */\nfunction createCodewords (bitBuffer, version, errorCorrectionLevel) {\n  // Total codewords for this QR code version (Data + Error correction)\n  const totalCodewords = Utils.getSymbolTotalCodewords(version)\n\n  // Total number of error correction codewords\n  const ecTotalCodewords = ECCode.getTotalCodewordsCount(version, errorCorrectionLevel)\n\n  // Total number of data codewords\n  const dataTotalCodewords = totalCodewords - ecTotalCodewords\n\n  // Total number of blocks\n  const ecTotalBlocks = ECCode.getBlocksCount(version, errorCorrectionLevel)\n\n  // Calculate how many blocks each group should contain\n  const blocksInGroup2 = totalCodewords % ecTotalBlocks\n  const blocksInGroup1 = ecTotalBlocks - blocksInGroup2\n\n  const totalCodewordsInGroup1 = Math.floor(totalCodewords / ecTotalBlocks)\n\n  const dataCodewordsInGroup1 = Math.floor(dataTotalCodewords / ecTotalBlocks)\n  const dataCodewordsInGroup2 = dataCodewordsInGroup1 + 1\n\n  // Number of EC codewords is the same for both groups\n  const ecCount = totalCodewordsInGroup1 - dataCodewordsInGroup1\n\n  // Initialize a Reed-Solomon encoder with a generator polynomial of degree ecCount\n  const rs = new ReedSolomonEncoder(ecCount)\n\n  let offset = 0\n  const dcData = new Array(ecTotalBlocks)\n  const ecData = new Array(ecTotalBlocks)\n  let maxDataSize = 0\n  const buffer = new Uint8Array(bitBuffer.buffer)\n\n  // Divide the buffer into the required number of blocks\n  for (let b = 0; b < ecTotalBlocks; b++) {\n    const dataSize = b < blocksInGroup1 ? dataCodewordsInGroup1 : dataCodewordsInGroup2\n\n    // extract a block of data from buffer\n    dcData[b] = buffer.slice(offset, offset + dataSize)\n\n    // Calculate EC codewords for this data block\n    ecData[b] = rs.encode(dcData[b])\n\n    offset += dataSize\n    maxDataSize = Math.max(maxDataSize, dataSize)\n  }\n\n  // Create final data\n  // Interleave the data and error correction codewords from each block\n  const data = new Uint8Array(totalCodewords)\n  let index = 0\n  let i, r\n\n  // Add data codewords\n  for (i = 0; i < maxDataSize; i++) {\n    for (r = 0; r < ecTotalBlocks; r++) {\n      if (i < dcData[r].length) {\n        data[index++] = dcData[r][i]\n      }\n    }\n  }\n\n  // Apped EC codewords\n  for (i = 0; i < ecCount; i++) {\n    for (r = 0; r < ecTotalBlocks; r++) {\n      data[index++] = ecData[r][i]\n    }\n  }\n\n  return data\n}\n\n/**\n * Build QR Code symbol\n *\n * @param  {String} data                 Input string\n * @param  {Number} version              QR Code version\n * @param  {ErrorCorretionLevel} errorCorrectionLevel Error level\n * @param  {MaskPattern} maskPattern     Mask pattern\n * @return {Object}                      Object containing symbol data\n */\nfunction createSymbol (data, version, errorCorrectionLevel, maskPattern) {\n  let segments\n\n  if (Array.isArray(data)) {\n    segments = Segments.fromArray(data)\n  } else if (typeof data === 'string') {\n    let estimatedVersion = version\n\n    if (!estimatedVersion) {\n      const rawSegments = Segments.rawSplit(data)\n\n      // Estimate best version that can contain raw splitted segments\n      estimatedVersion = Version.getBestVersionForData(rawSegments, errorCorrectionLevel)\n    }\n\n    // Build optimized segments\n    // If estimated version is undefined, try with the highest version\n    segments = Segments.fromString(data, estimatedVersion || 40)\n  } else {\n    throw new Error('Invalid data')\n  }\n\n  // Get the min version that can contain data\n  const bestVersion = Version.getBestVersionForData(segments, errorCorrectionLevel)\n\n  // If no version is found, data cannot be stored\n  if (!bestVersion) {\n    throw new Error('The amount of data is too big to be stored in a QR Code')\n  }\n\n  // If not specified, use min version as default\n  if (!version) {\n    version = bestVersion\n\n  // Check if the specified version can contain the data\n  } else if (version < bestVersion) {\n    throw new Error('\\n' +\n      'The chosen QR Code version cannot contain this amount of data.\\n' +\n      'Minimum version required to store current data is: ' + bestVersion + '.\\n'\n    )\n  }\n\n  const dataBits = createData(version, errorCorrectionLevel, segments)\n\n  // Allocate matrix buffer\n  const moduleCount = Utils.getSymbolSize(version)\n  const modules = new BitMatrix(moduleCount)\n\n  // Add function modules\n  setupFinderPattern(modules, version)\n  setupTimingPattern(modules)\n  setupAlignmentPattern(modules, version)\n\n  // Add temporary dummy bits for format info just to set them as reserved.\n  // This is needed to prevent these bits from being masked by {@link MaskPattern.applyMask}\n  // since the masking operation must be performed only on the encoding region.\n  // These blocks will be replaced with correct values later in code.\n  setupFormatInfo(modules, errorCorrectionLevel, 0)\n\n  if (version >= 7) {\n    setupVersionInfo(modules, version)\n  }\n\n  // Add data codewords\n  setupData(modules, dataBits)\n\n  if (isNaN(maskPattern)) {\n    // Find best mask pattern\n    maskPattern = MaskPattern.getBestMask(modules,\n      setupFormatInfo.bind(null, modules, errorCorrectionLevel))\n  }\n\n  // Apply mask pattern\n  MaskPattern.applyMask(maskPattern, modules)\n\n  // Replace format info bits with correct values\n  setupFormatInfo(modules, errorCorrectionLevel, maskPattern)\n\n  return {\n    modules: modules,\n    version: version,\n    errorCorrectionLevel: errorCorrectionLevel,\n    maskPattern: maskPattern,\n    segments: segments\n  }\n}\n\n/**\n * QR Code\n *\n * @param {String | Array} data                 Input data\n * @param {Object} options                      Optional configurations\n * @param {Number} options.version              QR Code version\n * @param {String} options.errorCorrectionLevel Error correction level\n * @param {Function} options.toSJISFunc         Helper func to convert utf8 to sjis\n */\nexports.create = function create (data, options) {\n  if (typeof data === 'undefined' || data === '') {\n    throw new Error('No input text')\n  }\n\n  let errorCorrectionLevel = ECLevel.M\n  let version\n  let mask\n\n  if (typeof options !== 'undefined') {\n    // Use higher error correction level as default\n    errorCorrectionLevel = ECLevel.from(options.errorCorrectionLevel, ECLevel.M)\n    version = Version.from(options.version)\n    mask = MaskPattern.from(options.maskPattern)\n\n    if (options.toSJISFunc) {\n      Utils.setToSJISFunction(options.toSJISFunc)\n    }\n  }\n\n  return createSymbol(data, version, errorCorrectionLevel, mask)\n}\n", "function hex2rgba (hex) {\n  if (typeof hex === 'number') {\n    hex = hex.toString()\n  }\n\n  if (typeof hex !== 'string') {\n    throw new Error('Color should be defined as hex string')\n  }\n\n  let hexCode = hex.slice().replace('#', '').split('')\n  if (hexCode.length < 3 || hexCode.length === 5 || hexCode.length > 8) {\n    throw new Error('Invalid hex color: ' + hex)\n  }\n\n  // Convert from short to long form (fff -> ffffff)\n  if (hexCode.length === 3 || hexCode.length === 4) {\n    hexCode = Array.prototype.concat.apply([], hexCode.map(function (c) {\n      return [c, c]\n    }))\n  }\n\n  // Add default alpha value\n  if (hexCode.length === 6) hexCode.push('F', 'F')\n\n  const hexValue = parseInt(hexCode.join(''), 16)\n\n  return {\n    r: (hexValue >> 24) & 255,\n    g: (hexValue >> 16) & 255,\n    b: (hexValue >> 8) & 255,\n    a: hexValue & 255,\n    hex: '#' + hexCode.slice(0, 6).join('')\n  }\n}\n\nexports.getOptions = function getOptions (options) {\n  if (!options) options = {}\n  if (!options.color) options.color = {}\n\n  const margin = typeof options.margin === 'undefined' ||\n    options.margin === null ||\n    options.margin < 0\n    ? 4\n    : options.margin\n\n  const width = options.width && options.width >= 21 ? options.width : undefined\n  const scale = options.scale || 4\n\n  return {\n    width: width,\n    scale: width ? 4 : scale,\n    margin: margin,\n    color: {\n      dark: hex2rgba(options.color.dark || '#000000ff'),\n      light: hex2rgba(options.color.light || '#ffffffff')\n    },\n    type: options.type,\n    rendererOpts: options.rendererOpts || {}\n  }\n}\n\nexports.getScale = function getScale (qrSize, opts) {\n  return opts.width && opts.width >= qrSize + opts.margin * 2\n    ? opts.width / (qrSize + opts.margin * 2)\n    : opts.scale\n}\n\nexports.getImageWidth = function getImageWidth (qrSize, opts) {\n  const scale = exports.getScale(qrSize, opts)\n  return Math.floor((qrSize + opts.margin * 2) * scale)\n}\n\nexports.qrToImageData = function qrToImageData (imgData, qr, opts) {\n  const size = qr.modules.size\n  const data = qr.modules.data\n  const scale = exports.getScale(size, opts)\n  const symbolSize = Math.floor((size + opts.margin * 2) * scale)\n  const scaledMargin = opts.margin * scale\n  const palette = [opts.color.light, opts.color.dark]\n\n  for (let i = 0; i < symbolSize; i++) {\n    for (let j = 0; j < symbolSize; j++) {\n      let posDst = (i * symbolSize + j) * 4\n      let pxColor = opts.color.light\n\n      if (i >= scaledMargin && j >= scaledMargin &&\n        i < symbolSize - scaledMargin && j < symbolSize - scaledMargin) {\n        const iSrc = Math.floor((i - scaledMargin) / scale)\n        const jSrc = Math.floor((j - scaledMargin) / scale)\n        pxColor = palette[data[iSrc * size + jSrc] ? 1 : 0]\n      }\n\n      imgData[posDst++] = pxColor.r\n      imgData[posDst++] = pxColor.g\n      imgData[posDst++] = pxColor.b\n      imgData[posDst] = pxColor.a\n    }\n  }\n}\n", "const Utils = require('./utils')\n\nfunction clearCanvas (ctx, canvas, size) {\n  ctx.clearRect(0, 0, canvas.width, canvas.height)\n\n  if (!canvas.style) canvas.style = {}\n  canvas.height = size\n  canvas.width = size\n  canvas.style.height = size + 'px'\n  canvas.style.width = size + 'px'\n}\n\nfunction getCanvasElement () {\n  try {\n    return document.createElement('canvas')\n  } catch (e) {\n    throw new Error('You need to specify a canvas element')\n  }\n}\n\nexports.render = function render (qrData, canvas, options) {\n  let opts = options\n  let canvasEl = canvas\n\n  if (typeof opts === 'undefined' && (!canvas || !canvas.getContext)) {\n    opts = canvas\n    canvas = undefined\n  }\n\n  if (!canvas) {\n    canvasEl = getCanvasElement()\n  }\n\n  opts = Utils.getOptions(opts)\n  const size = Utils.getImageWidth(qrData.modules.size, opts)\n\n  const ctx = canvasEl.getContext('2d')\n  const image = ctx.createImageData(size, size)\n  Utils.qrToImageData(image.data, qrData, opts)\n\n  clearCanvas(ctx, canvasEl, size)\n  ctx.putImageData(image, 0, 0)\n\n  return canvasEl\n}\n\nexports.renderToDataURL = function renderToDataURL (qrData, canvas, options) {\n  let opts = options\n\n  if (typeof opts === 'undefined' && (!canvas || !canvas.getContext)) {\n    opts = canvas\n    canvas = undefined\n  }\n\n  if (!opts) opts = {}\n\n  const canvasEl = exports.render(qrData, canvas, opts)\n\n  const type = opts.type || 'image/png'\n  const rendererOpts = opts.rendererOpts || {}\n\n  return canvasEl.toDataURL(type, rendererOpts.quality)\n}\n", "const Utils = require('./utils')\n\nfunction getColorAttrib (color, attrib) {\n  const alpha = color.a / 255\n  const str = attrib + '=\"' + color.hex + '\"'\n\n  return alpha < 1\n    ? str + ' ' + attrib + '-opacity=\"' + alpha.toFixed(2).slice(1) + '\"'\n    : str\n}\n\nfunction svgCmd (cmd, x, y) {\n  let str = cmd + x\n  if (typeof y !== 'undefined') str += ' ' + y\n\n  return str\n}\n\nfunction qrToPath (data, size, margin) {\n  let path = ''\n  let moveBy = 0\n  let newRow = false\n  let lineLength = 0\n\n  for (let i = 0; i < data.length; i++) {\n    const col = Math.floor(i % size)\n    const row = Math.floor(i / size)\n\n    if (!col && !newRow) newRow = true\n\n    if (data[i]) {\n      lineLength++\n\n      if (!(i > 0 && col > 0 && data[i - 1])) {\n        path += newRow\n          ? svgCmd('M', col + margin, 0.5 + row + margin)\n          : svgCmd('m', moveBy, 0)\n\n        moveBy = 0\n        newRow = false\n      }\n\n      if (!(col + 1 < size && data[i + 1])) {\n        path += svgCmd('h', lineLength)\n        lineLength = 0\n      }\n    } else {\n      moveBy++\n    }\n  }\n\n  return path\n}\n\nexports.render = function render (qrData, options, cb) {\n  const opts = Utils.getOptions(options)\n  const size = qrData.modules.size\n  const data = qrData.modules.data\n  const qrcodesize = size + opts.margin * 2\n\n  const bg = !opts.color.light.a\n    ? ''\n    : '<path ' + getColorAttrib(opts.color.light, 'fill') +\n      ' d=\"M0 0h' + qrcodesize + 'v' + qrcodesize + 'H0z\"/>'\n\n  const path =\n    '<path ' + getColorAttrib(opts.color.dark, 'stroke') +\n    ' d=\"' + qrToPath(data, size, opts.margin) + '\"/>'\n\n  const viewBox = 'viewBox=\"' + '0 0 ' + qrcodesize + ' ' + qrcodesize + '\"'\n\n  const width = !opts.width ? '' : 'width=\"' + opts.width + '\" height=\"' + opts.width + '\" '\n\n  const svgTag = '<svg xmlns=\"http://www.w3.org/2000/svg\" ' + width + viewBox + ' shape-rendering=\"crispEdges\">' + bg + path + '</svg>\\n'\n\n  if (typeof cb === 'function') {\n    cb(null, svgTag)\n  }\n\n  return svgTag\n}\n", "\nconst canPromise = require('./can-promise')\n\nconst QRCode = require('./core/qrcode')\nconst CanvasRenderer = require('./renderer/canvas')\nconst SvgRenderer = require('./renderer/svg-tag.js')\n\nfunction renderCanvas (renderFunc, canvas, text, opts, cb) {\n  const args = [].slice.call(arguments, 1)\n  const argsNum = args.length\n  const isLastArgCb = typeof args[argsNum - 1] === 'function'\n\n  if (!isLastArgCb && !canPromise()) {\n    throw new Error('Callback required as last argument')\n  }\n\n  if (isLastArgCb) {\n    if (argsNum < 2) {\n      throw new Error('Too few arguments provided')\n    }\n\n    if (argsNum === 2) {\n      cb = text\n      text = canvas\n      canvas = opts = undefined\n    } else if (argsNum === 3) {\n      if (canvas.getContext && typeof cb === 'undefined') {\n        cb = opts\n        opts = undefined\n      } else {\n        cb = opts\n        opts = text\n        text = canvas\n        canvas = undefined\n      }\n    }\n  } else {\n    if (argsNum < 1) {\n      throw new Error('Too few arguments provided')\n    }\n\n    if (argsNum === 1) {\n      text = canvas\n      canvas = opts = undefined\n    } else if (argsNum === 2 && !canvas.getContext) {\n      opts = text\n      text = canvas\n      canvas = undefined\n    }\n\n    return new Promise(function (resolve, reject) {\n      try {\n        const data = QRCode.create(text, opts)\n        resolve(renderFunc(data, canvas, opts))\n      } catch (e) {\n        reject(e)\n      }\n    })\n  }\n\n  try {\n    const data = QRCode.create(text, opts)\n    cb(null, renderFunc(data, canvas, opts))\n  } catch (e) {\n    cb(e)\n  }\n}\n\nexports.create = QRCode.create\nexports.toCanvas = renderCanvas.bind(null, CanvasRenderer.render)\nexports.toDataURL = renderCanvas.bind(null, CanvasRenderer.renderToDataURL)\n\n// only svg for now.\nexports.toString = renderCanvas.bind(null, function (data, _, opts) {\n  return SvgRenderer.render(data, opts)\n})\n", "'use strict';\n\nvar hasOwn = Object.prototype.hasOwnProperty;\nvar toStr = Object.prototype.toString;\nvar defineProperty = Object.defineProperty;\nvar gOPD = Object.getOwnPropertyDescriptor;\n\nvar isArray = function isArray(arr) {\n\tif (typeof Array.isArray === 'function') {\n\t\treturn Array.isArray(arr);\n\t}\n\n\treturn toStr.call(arr) === '[object Array]';\n};\n\nvar isPlainObject = function isPlainObject(obj) {\n\tif (!obj || toStr.call(obj) !== '[object Object]') {\n\t\treturn false;\n\t}\n\n\tvar hasOwnConstructor = hasOwn.call(obj, 'constructor');\n\tvar hasIsPrototypeOf = obj.constructor && obj.constructor.prototype && hasOwn.call(obj.constructor.prototype, 'isPrototypeOf');\n\t// Not own constructor property must be Object\n\tif (obj.constructor && !hasOwnConstructor && !hasIsPrototypeOf) {\n\t\treturn false;\n\t}\n\n\t// Own properties are enumerated firstly, so to speed up,\n\t// if last one is own, then all properties are own.\n\tvar key;\n\tfor (key in obj) { /**/ }\n\n\treturn typeof key === 'undefined' || hasOwn.call(obj, key);\n};\n\n// If name is '__proto__', and Object.defineProperty is available, define __proto__ as an own property on target\nvar setProperty = function setProperty(target, options) {\n\tif (defineProperty && options.name === '__proto__') {\n\t\tdefineProperty(target, options.name, {\n\t\t\tenumerable: true,\n\t\t\tconfigurable: true,\n\t\t\tvalue: options.newValue,\n\t\t\twritable: true\n\t\t});\n\t} else {\n\t\ttarget[options.name] = options.newValue;\n\t}\n};\n\n// Return undefined instead of __proto__ if '__proto__' is not an own property\nvar getProperty = function getProperty(obj, name) {\n\tif (name === '__proto__') {\n\t\tif (!hasOwn.call(obj, name)) {\n\t\t\treturn void 0;\n\t\t} else if (gOPD) {\n\t\t\t// In early versions of node, obj['__proto__'] is buggy when obj has\n\t\t\t// __proto__ as an own property. Object.getOwnPropertyDescriptor() works.\n\t\t\treturn gOPD(obj, name).value;\n\t\t}\n\t}\n\n\treturn obj[name];\n};\n\nmodule.exports = function extend() {\n\tvar options, name, src, copy, copyIsArray, clone;\n\tvar target = arguments[0];\n\tvar i = 1;\n\tvar length = arguments.length;\n\tvar deep = false;\n\n\t// Handle a deep copy situation\n\tif (typeof target === 'boolean') {\n\t\tdeep = target;\n\t\ttarget = arguments[1] || {};\n\t\t// skip the boolean and the target\n\t\ti = 2;\n\t}\n\tif (target == null || (typeof target !== 'object' && typeof target !== 'function')) {\n\t\ttarget = {};\n\t}\n\n\tfor (; i < length; ++i) {\n\t\toptions = arguments[i];\n\t\t// Only deal with non-null/undefined values\n\t\tif (options != null) {\n\t\t\t// Extend the base object\n\t\t\tfor (name in options) {\n\t\t\t\tsrc = getProperty(target, name);\n\t\t\t\tcopy = getProperty(options, name);\n\n\t\t\t\t// Prevent never-ending loop\n\t\t\t\tif (target !== copy) {\n\t\t\t\t\t// Recurse if we're merging plain objects or arrays\n\t\t\t\t\tif (deep && copy && (isPlainObject(copy) || (copyIsArray = isArray(copy)))) {\n\t\t\t\t\t\tif (copyIsArray) {\n\t\t\t\t\t\t\tcopyIsArray = false;\n\t\t\t\t\t\t\tclone = src && isArray(src) ? src : [];\n\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\tclone = src && isPlainObject(src) ? src : {};\n\t\t\t\t\t\t}\n\n\t\t\t\t\t\t// Never move original objects, clone them\n\t\t\t\t\t\tsetProperty(target, { name: name, newValue: extend(deep, clone, copy) });\n\n\t\t\t\t\t// Don't bring in undefined values\n\t\t\t\t\t} else if (typeof copy !== 'undefined') {\n\t\t\t\t\t\tsetProperty(target, { name: name, newValue: copy });\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\t// Return the modified object\n\treturn target;\n};\n", "import { pdf } from '@react-pdf/renderer';\nimport React, { ReactElement } from 'react';\nimport { PdfGenerator } from '~/components/PdfGenerator';\nimport {\n  GeneratePdfFunction,\n  PdfResult,\n  PdfGenerationError,\n  PdfComponentElement,\n  Template,\n  TemplateData,\n} from '~/types';\n\nexport const generatePdf: GeneratePdfFunction = async (\n  template: string,\n  data: string,\n): Promise<PdfResult> => {\n  try {\n    // Validate inputs\n    if (!template || !data) {\n      throw new Error('Template and data are required');\n    }\n\n    // Parse and validate template\n    let templateObj: Template;\n    try {\n      templateObj = JSON.parse(template);\n      if (!templateObj.components || !Array.isArray(templateObj.components)) {\n        throw new Error(\n          'Invalid template structure: missing or invalid components array',\n        );\n      }\n    } catch (parseError) {\n      throw new Error(\n        `Invalid template JSON: ${parseError instanceof Error ? parseError.message : 'Unknown parsing error'}`,\n      );\n    }\n\n    // Parse and validate data\n    let dataObj: TemplateData;\n    try {\n      dataObj = JSON.parse(data);\n      if (typeof dataObj !== 'object' || dataObj === null) {\n        throw new Error('Data must be a valid JSON object');\n      }\n    } catch (parseError) {\n      throw new Error(\n        `Invalid data JSON: ${parseError instanceof Error ? parseError.message : 'Unknown parsing error'}`,\n      );\n    }\n\n    // Create the PDF document element\n    const document: PdfComponentElement = React.createElement(PdfGenerator, {\n      data,\n      template,\n    });\n\n    // Generate PDF blob\n    const pdfBuffer: PdfResult = await pdf(\n      document as ReactElement<any>,\n    ).toBlob();\n\n    return pdfBuffer;\n  } catch (error) {\n    // Create a custom error with additional context\n    const pdfError: PdfGenerationError = new Error(\n      `PDF generation failed: ${error instanceof Error ? error.message : 'Unknown error'}`,\n    ) as PdfGenerationError;\n\n    pdfError.originalError = error instanceof Error ? error : undefined;\n    pdfError.template = template;\n    pdfError.data = data;\n\n    throw pdfError;\n  }\n};\n", "import { FontStyle } from '@react-pdf/font';\nimport { Document, Font } from '@react-pdf/renderer';\nimport { PDF_COMPONENTS } from '~/utils/pdf-components';\nimport { parseJson, renderPdfComponent } from '~/utils/helpers';\nimport {\n  PdfGeneratorProps,\n  FontConfig,\n  ComponentData,\n  TemplateData,\n} from '~/types';\n\nexport const PdfGenerator: React.FC<PdfGeneratorProps> = ({\n  data,\n  template,\n}) => {\n  const templateObject = parseJson(template) as TemplateData;\n  const dataObject = parseJson(data) as TemplateData;\n\n  const fonts = (templateObject?.fonts as FontConfig[]) || [];\n  fonts.forEach((font: FontConfig) => {\n    Font.register(font);\n  });\n\n  const componentData = (templateObject?.components as ComponentData[]) || [];\n  const images = templateObject?.images || {};\n\n  const renderedComponents = renderPdfComponent({\n    componentData,\n    components: PDF_COMPONENTS,\n    data: dataObject || {},\n    allProps: {},\n    images,\n  });\n\n  return <Document>{renderedComponents}</Document>;\n};\n", "/**\n * Applies a function to the value at the given index of an array\n *\n * @param index\n * @param fn\n * @param collection\n * @returns Copy of the array with the element at the given index replaced with the result of the function application.\n */\nconst adjust = (index, fn, collection) => {\n    if (index >= 0 && index >= collection.length)\n        return collection;\n    if (index < 0 && Math.abs(index) > collection.length)\n        return collection;\n    const i = index < 0 ? collection.length + index : index;\n    return Object.assign([], collection, { [i]: fn(collection[i]) });\n};\n\n/* eslint-disable no-await-in-loop */\n/**\n * Performs right-to-left function composition with async functions support\n *\n * @param fns - Functions\n * @returns Composed function\n */\nconst asyncCompose = (...fns) => async (value, ...args) => {\n    let result = value;\n    const reversedFns = fns.slice().reverse();\n    for (let i = 0; i < reversedFns.length; i += 1) {\n        const fn = reversedFns[i];\n        result = await fn(result, ...args);\n    }\n    return result;\n};\n\n/**\n * Capitalize first letter of each word\n *\n * @param value - Any string\n * @returns Capitalized string\n */\nconst capitalize = (value) => {\n    if (!value)\n        return value;\n    return value.replace(/(^|\\s)\\S/g, (l) => l.toUpperCase());\n};\n\n/**\n * Casts value to array\n *\n * @template T - The type of the value.\n * @param value - The value to cast into an array.\n * @returns An array containing the given value.\n */\nconst castArray = (value) => {\n    return Array.isArray(value) ? value : [value];\n};\n\n/**\n * Performs right-to-left function composition\n *\n * @param fns - Functions\n * @returns Composed function\n */\nconst compose = (...fns) => (value, ...args) => {\n    let result = value;\n    const reversedFns = fns.slice().reverse();\n    for (let i = 0; i < reversedFns.length; i += 1) {\n        const fn = reversedFns[i];\n        result = fn(result, ...args);\n    }\n    return result;\n};\n\n/**\n * Drops the last element from an array.\n *\n * @template T\n * @param  array - The array to drop the last element from\n * @returns - The new array with the last element dropped\n */\nconst dropLast = (array) => array.slice(0, array.length - 1);\n\n/**\n * Applies a set of transformations to an object and returns a new object with the transformed values.\n *\n * @template T\n * @param transformations - The transformations to apply.\n * @param object - The object to transform.\n * @returns The transformed object.\n */\nfunction evolve(transformations, object) {\n    const result = {};\n    const keys = Object.keys(object);\n    for (let i = 0; i < keys.length; i += 1) {\n        const key = keys[i];\n        const transformation = transformations[key];\n        if (typeof transformation === 'function') {\n            result[key] = transformation(object[key]);\n        }\n        else {\n            result[key] = object[key];\n        }\n    }\n    return result;\n}\n\n/**\n * Checks if a value is null or undefined.\n *\n * @template T - The type of the value.\n * @param value - The value to check\n * @returns True if the value is null or undefined, false otherwise\n */\nconst isNil = (value) => value === null || value === undefined;\n\n/**\n * Retrieves the value at a given path from an object.\n *\n * @param target - The object to retrieve the value from.\n * @param path - The path of the value to retrieve.\n * @param defaultValue - The default value to return if the path does not exist.\n * @returns The value at the given path, or the default value if the path does not exist.\n */\nconst get = (target, path, defaultValue) => {\n    if (isNil(target))\n        return defaultValue;\n    const _path = castArray(path);\n    let result = target;\n    for (let i = 0; i < _path.length; i += 1) {\n        if (isNil(result))\n            return undefined;\n        result = result[_path[i]];\n    }\n    return isNil(result) ? defaultValue : result;\n};\n\nfunction last(value) {\n    return value === '' ? '' : value[value.length - 1];\n}\n\n/**\n * Maps over the values of an object and applies a function to each value.\n *\n * @param object - The object to map over\n * @param fn - The function to apply to each value\n * @returns A new object with the mapped values\n */\nconst mapValues = (object, fn) => {\n    const entries = Object.entries(object);\n    const acc = {};\n    return entries.reduce((acc, [key, value], index) => {\n        acc[key] = fn(value, key, index);\n        return acc;\n    }, acc);\n};\n\nconst isPercent = (value) => /((-)?\\d+\\.?\\d*)%/g.exec(`${value}`);\n/**\n * Get percentage value of input\n *\n * @param value\n * @returns Percent value (if matches)\n */\nconst matchPercent = (value) => {\n    const match = isPercent(value);\n    if (match) {\n        const f = parseFloat(match[1]);\n        const percent = f / 100;\n        return { percent, value: f };\n    }\n    return null;\n};\n\n/**\n * Creates a new object by omitting specified keys from the original object.\n *\n * @param keys - The key or keys to omit\n * @param object - The original object\n * @returns The new object without the omitted keys\n */\nconst omit = (keys, object) => {\n    const _keys = castArray(keys);\n    const copy = Object.assign({}, object);\n    _keys.forEach((key) => {\n        delete copy[key];\n    });\n    return copy;\n};\n\n/**\n * Picks the specified keys from an object and returns a new object with only those keys.\n *\n * @param keys - The keys to pick from the object\n * @param object - The object to pick the keys from\n * @returns A new object with only the picked keys\n */\nconst pick = (keys, obj) => {\n    const result = {};\n    for (let i = 0; i < keys.length; i += 1) {\n        const key = keys[i];\n        if (key in obj)\n            result[key] = obj[key];\n    }\n    return result;\n};\n\n/**\n * Repeats an element a specified number of times.\n *\n * @template T\n * @param element - Element to be repeated\n * @param length - Number of times to repeat element\n * @returns Repeated elements\n */\nconst repeat = (element, length = 0) => {\n    const result = new Array(length);\n    for (let i = 0; i < length; i += 1) {\n        result[i] = element;\n    }\n    return result;\n};\n\n/**\n * Reverses the list\n *\n * @template T\n * @param list - List to be reversed\n * @returns Reversed list\n */\nconst reverse = (list) => Array.prototype.slice.call(list, 0).reverse();\n\n/**\n * Capitalize first letter of string\n *\n * @param value - String\n * @returns Capitalized string\n */\nconst upperFirst = (value) => {\n    if (!value)\n        return value;\n    return value.charAt(0).toUpperCase() + value.slice(1);\n};\n\n/**\n * Returns a new array with all the values from the original array that are not present in the keys array.\n *\n * @param keys - The keys to pick from the object\n * @param array - Array to filter the values from\n * @returns A new array with without the omitted values\n */\nconst without = (keys, array) => {\n    const result = [];\n    for (let i = 0; i < array.length; i += 1) {\n        const value = array[i];\n        if (!keys.includes(value))\n            result.push(value);\n    }\n    return result;\n};\n\n/**\n * Parse a string or number to a float\n *\n * @param value - String or number\n * @returns Parsed float\n */\nconst parseFloat$1 = (value) => {\n    return typeof value === 'string' ? Number.parseFloat(value) : value;\n};\n\nexport { adjust, asyncCompose, capitalize, castArray, compose, dropLast, evolve, get, isNil, last, mapValues, matchPercent, omit, parseFloat$1 as parseFloat, pick, repeat, reverse, upperFirst, without };\n", "import { compose, castArray, parseFloat as parseFloat$1, matchPercent } from '@react-pdf/fns';\nimport matchMedia from 'media-engine';\nimport hlsToHex from 'hsl-to-hex';\nimport colorString from 'color-string';\nimport parse$1 from 'postcss-value-parser/lib/parse.js';\nimport parseUnit from 'postcss-value-parser/lib/unit.js';\n\n/**\n * Remove nil values from array\n *\n * @param array - Style array\n * @returns Style array without nils\n */\nconst compact = (array) => array.filter(Boolean);\n/**\n * Merges style objects array\n *\n * @param styles - Style array\n * @returns Merged style object\n */\nconst mergeStyles = (styles) => styles.reduce((acc, style) => {\n    const s = Array.isArray(style) ? flatten(style) : style;\n    Object.keys(s).forEach((key) => {\n        if (s[key] !== null && s[key] !== undefined) {\n            acc[key] = s[key];\n        }\n    });\n    return acc;\n}, {});\n/**\n * Flattens an array of style objects, into one aggregated style object.\n *\n * @param styles - Style or style array\n * @returns Flattened style object\n */\nconst flatten = compose(mergeStyles, compact, (castArray));\n\n/**\n * Resolves media queries in styles object\n *\n * @param container - Container for which styles are resolved\n * @param style - Style description\n * @returns Resolved style object\n */\nconst resolveMediaQueries = (container, style) => {\n    return Object.keys(style).reduce((acc, key) => {\n        if (/@media/.test(key)) {\n            return {\n                ...acc,\n                ...matchMedia({ [key]: style[key] }, container),\n            };\n        }\n        return { ...acc, [key]: style[key] };\n    }, {});\n};\n\nconst isRgb = (value) => /rgba?/g.test(value);\nconst isHsl = (value) => /hsla?/g.test(value);\n/**\n * Transform rgb color to hexa\n *\n * @param value - Styles value\n * @returns Transformed value\n */\nconst parseRgb = (value) => {\n    const rgb = colorString.get.rgb(value);\n    return colorString.to.hex(rgb);\n};\n/**\n * Transform Hsl color to hexa\n *\n * @param value - Styles value\n * @returns Transformed value\n */\nconst parseHsl = (value) => {\n    const hsl = colorString.get.hsl(value).map(Math.round);\n    const hex = hlsToHex(...hsl);\n    return hex.toUpperCase();\n};\n/**\n * Transform given color to hexa\n *\n * @param value - Styles value\n * @returns Transformed value\n */\nconst transformColor = (value) => {\n    if (isRgb(value))\n        return parseRgb(value);\n    if (isHsl(value))\n        return parseHsl(value);\n    return value;\n};\n\n/**\n * Parses scalar value in value and unit pairs\n *\n * @param value - Scalar value\n * @returns Parsed value\n */\nconst parseValue = (value) => {\n    if (typeof value === 'number')\n        return { value, unit: undefined };\n    const match = /^(-?\\d*\\.?\\d+)(in|mm|cm|pt|vh|vw|px|rem)?$/g.exec(value);\n    return match\n        ? { value: parseFloat(match[1]), unit: match[2] || 'pt' }\n        : { value, unit: undefined };\n};\n/**\n * Transform given scalar value\n *\n * @param container\n * @param value - Styles value\n * @returns Transformed value\n */\nconst transformUnit = (container, value) => {\n    const scalar = parseValue(value);\n    const outputDpi = 72;\n    const inputDpi = container.dpi || 72;\n    const mmFactor = (1 / 25.4) * outputDpi;\n    const cmFactor = (1 / 2.54) * outputDpi;\n    if (typeof scalar.value !== 'number')\n        return scalar.value;\n    switch (scalar.unit) {\n        case 'rem':\n            return scalar.value * (container.remBase || 18);\n        case 'in':\n            return scalar.value * outputDpi;\n        case 'mm':\n            return scalar.value * mmFactor;\n        case 'cm':\n            return scalar.value * cmFactor;\n        case 'vh':\n            return scalar.value * (container.height / 100);\n        case 'vw':\n            return scalar.value * (container.width / 100);\n        case 'px':\n            return Math.round(scalar.value * (outputDpi / inputDpi));\n        default:\n            return scalar.value;\n    }\n};\n\nconst processNumberValue = (key, value) => ({\n    [key]: parseFloat$1(value),\n});\nconst processUnitValue = (key, value, container) => ({\n    [key]: transformUnit(container, value),\n});\nconst processColorValue = (key, value) => {\n    const result = { [key]: transformColor(value) };\n    return result;\n};\nconst processNoopValue = (key, value) => ({\n    [key]: value,\n});\n\nconst BORDER_SHORTHAND_REGEX = /(-?\\d+(\\.\\d+)?(in|mm|cm|pt|vw|vh|px|rem)?)\\s(\\S+)\\s(.+)/;\nconst matchBorderShorthand = (value) => value.match(BORDER_SHORTHAND_REGEX) || [];\nconst resolveBorderShorthand = (key, value, container) => {\n    const match = matchBorderShorthand(`${value}`);\n    if (match) {\n        const widthMatch = match[1] || value;\n        const styleMatch = match[4] || value;\n        const colorMatch = match[5] || value;\n        const style = styleMatch;\n        const color = colorMatch ? transformColor(colorMatch) : undefined;\n        const width = widthMatch ? transformUnit(container, widthMatch) : undefined;\n        if (key.match(/(Top|Right|Bottom|Left)$/)) {\n            return {\n                [`${key}Color`]: color,\n                [`${key}Style`]: style,\n                [`${key}Width`]: width,\n            };\n        }\n        if (key.match(/Color$/)) {\n            return {\n                borderTopColor: color,\n                borderRightColor: color,\n                borderBottomColor: color,\n                borderLeftColor: color,\n            };\n        }\n        if (key.match(/Style$/)) {\n            if (typeof style === 'number')\n                throw new Error(`Invalid border style: ${style}`);\n            return {\n                borderTopStyle: style,\n                borderRightStyle: style,\n                borderBottomStyle: style,\n                borderLeftStyle: style,\n            };\n        }\n        if (key.match(/Width$/)) {\n            if (typeof width !== 'number')\n                throw new Error(`Invalid border width: ${width}`);\n            return {\n                borderTopWidth: width,\n                borderRightWidth: width,\n                borderBottomWidth: width,\n                borderLeftWidth: width,\n            };\n        }\n        if (key.match(/Radius$/)) {\n            const radius = value ? transformUnit(container, value) : undefined;\n            if (typeof radius !== 'number')\n                throw new Error(`Invalid border radius: ${radius}`);\n            return {\n                borderTopLeftRadius: radius,\n                borderTopRightRadius: radius,\n                borderBottomRightRadius: radius,\n                borderBottomLeftRadius: radius,\n            };\n        }\n        if (typeof width !== 'number')\n            throw new Error(`Invalid border width: ${width}`);\n        if (typeof style === 'number')\n            throw new Error(`Invalid border style: ${style}`);\n        return {\n            borderTopColor: color,\n            borderTopStyle: style,\n            borderTopWidth: width,\n            borderRightColor: color,\n            borderRightStyle: style,\n            borderRightWidth: width,\n            borderBottomColor: color,\n            borderBottomStyle: style,\n            borderBottomWidth: width,\n            borderLeftColor: color,\n            borderLeftStyle: style,\n            borderLeftWidth: width,\n        };\n    }\n    return { [key]: value };\n};\nconst handlers$b = {\n    border: (resolveBorderShorthand),\n    borderBottom: (resolveBorderShorthand),\n    borderBottomColor: (processColorValue),\n    borderBottomLeftRadius: (processUnitValue),\n    borderBottomRightRadius: (processUnitValue),\n    borderBottomStyle: (processNoopValue),\n    borderBottomWidth: (processUnitValue),\n    borderColor: (resolveBorderShorthand),\n    borderLeft: (resolveBorderShorthand),\n    borderLeftColor: (processColorValue),\n    borderLeftStyle: (processNoopValue),\n    borderLeftWidth: (processUnitValue),\n    borderRadius: (resolveBorderShorthand),\n    borderRight: (resolveBorderShorthand),\n    borderRightColor: (processColorValue),\n    borderRightStyle: (processNoopValue),\n    borderRightWidth: (processUnitValue),\n    borderStyle: (resolveBorderShorthand),\n    borderTop: (resolveBorderShorthand),\n    borderTopColor: (processColorValue),\n    borderTopLeftRadius: (processUnitValue),\n    borderTopRightRadius: (processUnitValue),\n    borderTopStyle: (processNoopValue),\n    borderTopWidth: (processUnitValue),\n    borderWidth: (resolveBorderShorthand),\n};\n\nconst handlers$a = {\n    backgroundColor: (processColorValue),\n    color: (processColorValue),\n    opacity: (processNumberValue),\n};\n\nconst handlers$9 = {\n    height: (processUnitValue),\n    maxHeight: (processUnitValue),\n    maxWidth: (processUnitValue),\n    minHeight: (processUnitValue),\n    minWidth: (processUnitValue),\n    width: (processUnitValue),\n};\n\n// https://developer.mozilla.org/en-US/docs/Web/CSS/flex#values\n// TODO: change flex defaults to [0, 1, 'auto'] as in spec in next major release\nconst flexDefaults = [1, 1, 0];\nconst flexAuto = [1, 1, 'auto'];\nconst processFlexShorthand = (key, value, container) => {\n    let defaults = flexDefaults;\n    let matches = [];\n    if (value === 'auto') {\n        defaults = flexAuto;\n    }\n    else {\n        matches = `${value}`.split(' ');\n    }\n    const flexGrow = parseFloat$1(matches[0] || defaults[0]);\n    const flexShrink = parseFloat$1(matches[1] || defaults[1]);\n    const flexBasis = transformUnit(container, matches[2] || defaults[2]);\n    return { flexGrow, flexShrink, flexBasis };\n};\nconst handlers$8 = {\n    alignContent: (processNoopValue),\n    alignItems: (processNoopValue),\n    alignSelf: (processNoopValue),\n    flex: (processFlexShorthand),\n    flexBasis: (processUnitValue),\n    flexDirection: (processNoopValue),\n    flexFlow: (processNoopValue),\n    flexGrow: (processNumberValue),\n    flexShrink: (processNumberValue),\n    flexWrap: (processNoopValue),\n    justifyContent: (processNoopValue),\n    justifySelf: (processNoopValue),\n};\n\nconst processGapShorthand = (key, value, container) => {\n    const match = `${value}`.split(' ');\n    const rowGap = transformUnit(container, match?.[0] || value);\n    const columnGap = transformUnit(container, match?.[1] || value);\n    return { rowGap, columnGap };\n};\nconst handlers$7 = {\n    gap: (processGapShorthand),\n    columnGap: (processUnitValue),\n    rowGap: (processUnitValue),\n};\n\nconst handlers$6 = {\n    aspectRatio: (processNumberValue),\n    bottom: (processUnitValue),\n    display: (processNoopValue),\n    left: (processUnitValue),\n    position: (processNoopValue),\n    right: (processUnitValue),\n    top: (processUnitValue),\n    overflow: (processNoopValue),\n    zIndex: (processNumberValue),\n};\n\nconst BOX_MODEL_UNITS = 'px,in,mm,cm,pt,%,vw,vh';\nconst logError = (style, value) => {\n    const name = style.toString();\n    // eslint-disable-next-line no-console\n    console.error(`\n    @react-pdf/stylesheet parsing error:\n    ${name}: ${value},\n    ${' '.repeat(name.length + 2)}^\n    Unsupported ${name} value format\n  `);\n};\n/**\n * @param options\n * @param [options.expandsTo]\n * @param [options.maxValues]\n * @param [options.autoSupported]\n */\nconst expandBoxModel = ({ expandsTo, maxValues = 1, autoSupported = false, } = {}) => (model, value, container) => {\n    const nodes = parse$1(`${value}`);\n    const parts = [];\n    for (let i = 0; i < nodes.length; i++) {\n        const node = nodes[i];\n        // value contains `calc`, `url` or other css function\n        // `,`, `/` or strings that unsupported by margin and padding\n        if (node.type === 'function' ||\n            node.type === 'string' ||\n            node.type === 'div') {\n            logError(model, value);\n            return {};\n        }\n        if (node.type === 'word') {\n            if (node.value === 'auto' && autoSupported) {\n                parts.push(node.value);\n            }\n            else {\n                const result = parseUnit(node.value);\n                // when unit isn't specified this condition is true\n                if (result && BOX_MODEL_UNITS.includes(result.unit)) {\n                    parts.push(node.value);\n                }\n                else {\n                    logError(model, value);\n                    return {};\n                }\n            }\n        }\n    }\n    // checks that we have enough parsed values\n    if (parts.length > maxValues) {\n        logError(model, value);\n        return {};\n    }\n    const first = transformUnit(container, parts[0]);\n    if (expandsTo) {\n        const second = transformUnit(container, parts[1] || parts[0]);\n        const third = transformUnit(container, parts[2] || parts[0]);\n        const fourth = transformUnit(container, parts[3] || parts[1] || parts[0]);\n        return expandsTo({ first, second, third, fourth });\n    }\n    return {\n        [model]: first,\n    };\n};\n\nconst processMargin = expandBoxModel({\n    expandsTo: ({ first, second, third, fourth }) => ({\n        marginTop: first,\n        marginRight: second,\n        marginBottom: third,\n        marginLeft: fourth,\n    }),\n    maxValues: 4,\n    autoSupported: true,\n});\nconst processMarginVertical = expandBoxModel({\n    expandsTo: ({ first, second }) => ({\n        marginTop: first,\n        marginBottom: second,\n    }),\n    maxValues: 2,\n    autoSupported: true,\n});\nconst processMarginHorizontal = expandBoxModel({\n    expandsTo: ({ first, second }) => ({\n        marginRight: first,\n        marginLeft: second,\n    }),\n    maxValues: 2,\n    autoSupported: true,\n});\nconst processMarginSingle = expandBoxModel({\n    autoSupported: true,\n});\nconst handlers$5 = {\n    margin: (processMargin),\n    marginBottom: (processMarginSingle),\n    marginHorizontal: (processMarginHorizontal),\n    marginLeft: (processMarginSingle),\n    marginRight: (processMarginSingle),\n    marginTop: (processMarginSingle),\n    marginVertical: (processMarginVertical),\n};\n\nconst processPadding = expandBoxModel({\n    expandsTo: ({ first, second, third, fourth }) => ({\n        paddingTop: first,\n        paddingRight: second,\n        paddingBottom: third,\n        paddingLeft: fourth,\n    }),\n    maxValues: 4,\n});\nconst processPaddingVertical = expandBoxModel({\n    expandsTo: ({ first, second }) => ({\n        paddingTop: first,\n        paddingBottom: second,\n    }),\n    maxValues: 2,\n});\nconst processPaddingHorizontal = expandBoxModel({\n    expandsTo: ({ first, second }) => ({\n        paddingRight: first,\n        paddingLeft: second,\n    }),\n    maxValues: 2,\n});\nconst processPaddingSingle = expandBoxModel();\nconst handlers$4 = {\n    padding: (processPadding),\n    paddingBottom: (processPaddingSingle),\n    paddingHorizontal: (processPaddingHorizontal),\n    paddingLeft: (processPaddingSingle),\n    paddingRight: (processPaddingSingle),\n    paddingTop: (processPaddingSingle),\n    paddingVertical: (processPaddingVertical),\n};\n\nconst offsetKeyword = (value) => {\n    switch (value) {\n        case 'top':\n        case 'left':\n            return '0%';\n        case 'right':\n        case 'bottom':\n            return '100%';\n        case 'center':\n            return '50%';\n        default:\n            return value;\n    }\n};\n\nconst processObjectPosition = (key, value, container) => {\n    const match = `${value}`.split(' ');\n    const objectPositionX = offsetKeyword(transformUnit(container, match?.[0] || value));\n    const objectPositionY = offsetKeyword(transformUnit(container, match?.[1] || value));\n    return { objectPositionX, objectPositionY };\n};\nconst processObjectPositionValue = (key, value, container) => ({\n    [key]: offsetKeyword(transformUnit(container, value)),\n});\nconst handlers$3 = {\n    objectPosition: (processObjectPosition),\n    objectPositionX: (processObjectPositionValue),\n    objectPositionY: (processObjectPositionValue),\n    objectFit: (processNoopValue),\n};\n\nconst castInt = (value) => {\n    if (typeof value === 'number')\n        return value;\n    return parseInt(value, 10);\n};\n\nconst FONT_WEIGHTS = {\n    thin: 100,\n    hairline: 100,\n    ultralight: 200,\n    extralight: 200,\n    light: 300,\n    normal: 400,\n    medium: 500,\n    semibold: 600,\n    demibold: 600,\n    bold: 700,\n    ultrabold: 800,\n    extrabold: 800,\n    heavy: 900,\n    black: 900,\n};\nconst transformFontWeight = (value) => {\n    if (!value)\n        return FONT_WEIGHTS.normal;\n    if (typeof value === 'number')\n        return value;\n    const lv = value.toLowerCase();\n    if (FONT_WEIGHTS[lv])\n        return FONT_WEIGHTS[lv];\n    return castInt(value);\n};\nconst processFontWeight = (key, value) => {\n    return { [key]: transformFontWeight(value) };\n};\nconst transformLineHeight = (value, styles, container) => {\n    if (value === '')\n        return value;\n    const fontSize = transformUnit(container, styles.fontSize || 18);\n    const lineHeight = transformUnit(container, value);\n    // Percent values: use this number multiplied by the element's font size\n    const { percent } = matchPercent(lineHeight) || {};\n    if (percent)\n        return percent * fontSize;\n    // Unitless values: use this number multiplied by the element's font size\n    return isNaN(value) ? lineHeight : lineHeight * fontSize;\n};\nconst processLineHeight = (key, value, container, styles) => {\n    return {\n        [key]: transformLineHeight(value, styles, container),\n    };\n};\nconst handlers$2 = {\n    direction: (processNoopValue),\n    fontFamily: (processNoopValue),\n    fontSize: (processUnitValue),\n    fontStyle: (processNoopValue),\n    fontWeight: (processFontWeight),\n    letterSpacing: (processUnitValue),\n    lineHeight: (processLineHeight),\n    maxLines: (processNumberValue),\n    textAlign: (processNoopValue),\n    textDecoration: (processNoopValue),\n    textDecorationColor: (processColorValue),\n    textDecorationStyle: (processNoopValue),\n    textIndent: (processNoopValue),\n    textOverflow: (processNoopValue),\n    textTransform: (processNoopValue),\n    verticalAlign: (processNoopValue),\n};\n\nconst matchNumber = (value) => typeof value === 'string' && /^-?\\d*\\.?\\d*$/.test(value);\nconst castFloat = (value) => {\n    if (typeof value !== 'string')\n        return value;\n    if (matchNumber(value))\n        return parseFloat(value);\n    return value;\n};\n\nconst parse = (transformString) => {\n    const transforms = transformString.trim().split(/\\)[ ,]|\\)/);\n    // Handle \"initial\", \"inherit\", \"unset\".\n    if (transforms.length === 1) {\n        return [[transforms[0], true]];\n    }\n    const parsed = [];\n    for (let i = 0; i < transforms.length; i += 1) {\n        const transform = transforms[i];\n        if (transform) {\n            const [name, rawValue] = transform.split('(');\n            const splitChar = rawValue.indexOf(',') >= 0 ? ',' : ' ';\n            const value = rawValue.split(splitChar).map((val) => val.trim());\n            parsed.push({ operation: name.trim(), value });\n        }\n    }\n    return parsed;\n};\nconst parseAngle = (value) => {\n    const unitsRegexp = /(-?\\d*\\.?\\d*)(\\w*)?/i;\n    const [, angle, unit] = unitsRegexp.exec(value);\n    const number = Number.parseFloat(angle);\n    return unit === 'rad' ? (number * 180) / Math.PI : number;\n};\nconst normalizeTransformOperation = ({ operation, value }) => {\n    switch (operation) {\n        case 'scale': {\n            const [scaleX, scaleY = scaleX] = value.map((num) => Number.parseFloat(num));\n            return { operation: 'scale', value: [scaleX, scaleY] };\n        }\n        case 'scaleX': {\n            return { operation: 'scale', value: [Number.parseFloat(value), 1] };\n        }\n        case 'scaleY': {\n            return { operation: 'scale', value: [1, Number.parseFloat(value)] };\n        }\n        case 'rotate': {\n            return { operation: 'rotate', value: [parseAngle(value)] };\n        }\n        case 'translate': {\n            return {\n                operation: 'translate',\n                value: value.map((num) => Number.parseFloat(num)),\n            };\n        }\n        case 'translateX': {\n            return {\n                operation: 'translate',\n                value: [Number.parseFloat(value), 0],\n            };\n        }\n        case 'translateY': {\n            return { operation: 'translate', value: [0, Number.parseFloat(value)] };\n        }\n        case 'skew': {\n            return { operation: 'skew', value: value.map(parseAngle) };\n        }\n        case 'skewX': {\n            return { operation: 'skew', value: [parseAngle(value), 0] };\n        }\n        case 'skewY': {\n            return { operation: 'skew', value: [0, parseAngle(value)] };\n        }\n        default: {\n            return { operation, value: value.map((num) => Number.parseFloat(num)) };\n        }\n    }\n};\nconst normalize = (operations) => {\n    return operations.map((operation) => normalizeTransformOperation(operation));\n};\nconst processTransform = (key, value) => {\n    if (typeof value !== 'string')\n        return { [key]: value };\n    return { [key]: normalize(parse(value)) };\n};\nconst Y_AXIS_SHORTHANDS = { top: true, bottom: true };\nconst sortTransformOriginPair = (a, b) => {\n    if (Y_AXIS_SHORTHANDS[a])\n        return 1;\n    if (Y_AXIS_SHORTHANDS[b])\n        return -1;\n    return 0;\n};\nconst getTransformOriginPair = (values) => {\n    if (!values || values.length === 0)\n        return ['center', 'center'];\n    const pair = values.length === 1 ? [values[0], 'center'] : values;\n    return pair.sort(sortTransformOriginPair);\n};\n// Transforms shorthand transformOrigin values\nconst processTransformOriginShorthand = (key, value, container) => {\n    const match = `${value}`.split(' ');\n    const pair = getTransformOriginPair(match);\n    const transformOriginX = transformUnit(container, pair[0]);\n    const transformOriginY = transformUnit(container, pair[1]);\n    return {\n        transformOriginX: offsetKeyword(transformOriginX) || castFloat(transformOriginX),\n        transformOriginY: offsetKeyword(transformOriginY) || castFloat(transformOriginY),\n    };\n};\nconst processTransformOriginValue = (key, value, container) => {\n    const v = transformUnit(container, value);\n    return { [key]: offsetKeyword(v) || castFloat(v) };\n};\nconst handlers$1 = {\n    transform: processTransform,\n    gradientTransform: processTransform,\n    transformOrigin: (processTransformOriginShorthand),\n    transformOriginX: (processTransformOriginValue),\n    transformOriginY: (processTransformOriginValue),\n};\n\nconst handlers = {\n    fill: (processColorValue),\n    stroke: (processColorValue),\n    strokeDasharray: (processNoopValue),\n    strokeWidth: (processUnitValue),\n    fillOpacity: (processNumberValue),\n    strokeOpacity: (processNumberValue),\n    fillRule: (processNoopValue),\n    textAnchor: (processNoopValue),\n    strokeLinecap: (processNoopValue),\n    strokeLinejoin: (processNoopValue),\n    visibility: (processNoopValue),\n    clipPath: (processNoopValue),\n    dominantBaseline: (processNoopValue),\n};\n\nconst shorthands = {\n    ...handlers$b,\n    ...handlers$a,\n    ...handlers$9,\n    ...handlers$8,\n    ...handlers$7,\n    ...handlers$6,\n    ...handlers$5,\n    ...handlers$4,\n    ...handlers$3,\n    ...handlers$2,\n    ...handlers$1,\n    ...handlers,\n};\n/**\n * Expand the shorthand properties.\n *\n * @param style - Style object\n * @returns Expanded style object\n */\nconst resolve = (container) => (style) => {\n    const propsArray = Object.keys(style);\n    const resolvedStyle = {};\n    for (let i = 0; i < propsArray.length; i += 1) {\n        const key = propsArray[i];\n        const value = style[key];\n        if (!shorthands[key]) {\n            resolvedStyle[key] = value;\n            continue;\n        }\n        const resolved = shorthands[key](key, value, container, style);\n        const keys = Object.keys(resolved);\n        for (let j = 0; j < keys.length; j += 1) {\n            const propName = keys[j];\n            const propValue = resolved[propName];\n            resolvedStyle[propName] = propValue;\n        }\n    }\n    return resolvedStyle;\n};\n\n/**\n * Resolves styles\n *\n * @param container\n * @param style - Style\n * @returns Resolved style\n */\nconst resolveStyles = (container, style) => {\n    const computeMediaQueries = (value) => resolveMediaQueries(container, value);\n    return compose(resolve(container), computeMediaQueries, flatten)(style);\n};\n\nexport { resolveStyles as default, flatten, transformColor };\n", "/******************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise, SuppressedError, Symbol, Iterator */\r\n\r\nvar extendStatics = function(d, b) {\r\n    extendStatics = Object.setPrototypeOf ||\r\n        ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n        function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; };\r\n    return extendStatics(d, b);\r\n};\r\n\r\nexport function __extends(d, b) {\r\n    if (typeof b !== \"function\" && b !== null)\r\n        throw new TypeError(\"Class extends value \" + String(b) + \" is not a constructor or null\");\r\n    extendStatics(d, b);\r\n    function __() { this.constructor = d; }\r\n    d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nexport var __assign = function() {\r\n    __assign = Object.assign || function __assign(t) {\r\n        for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n            s = arguments[i];\r\n            for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n        }\r\n        return t;\r\n    }\r\n    return __assign.apply(this, arguments);\r\n}\r\n\r\nexport function __rest(s, e) {\r\n    var t = {};\r\n    for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n        t[p] = s[p];\r\n    if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n        for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n            if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n                t[p[i]] = s[p[i]];\r\n        }\r\n    return t;\r\n}\r\n\r\nexport function __decorate(decorators, target, key, desc) {\r\n    var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n    if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n    else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n    return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nexport function __param(paramIndex, decorator) {\r\n    return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nexport function __esDecorate(ctor, descriptorIn, decorators, contextIn, initializers, extraInitializers) {\r\n    function accept(f) { if (f !== void 0 && typeof f !== \"function\") throw new TypeError(\"Function expected\"); return f; }\r\n    var kind = contextIn.kind, key = kind === \"getter\" ? \"get\" : kind === \"setter\" ? \"set\" : \"value\";\r\n    var target = !descriptorIn && ctor ? contextIn[\"static\"] ? ctor : ctor.prototype : null;\r\n    var descriptor = descriptorIn || (target ? Object.getOwnPropertyDescriptor(target, contextIn.name) : {});\r\n    var _, done = false;\r\n    for (var i = decorators.length - 1; i >= 0; i--) {\r\n        var context = {};\r\n        for (var p in contextIn) context[p] = p === \"access\" ? {} : contextIn[p];\r\n        for (var p in contextIn.access) context.access[p] = contextIn.access[p];\r\n        context.addInitializer = function (f) { if (done) throw new TypeError(\"Cannot add initializers after decoration has completed\"); extraInitializers.push(accept(f || null)); };\r\n        var result = (0, decorators[i])(kind === \"accessor\" ? { get: descriptor.get, set: descriptor.set } : descriptor[key], context);\r\n        if (kind === \"accessor\") {\r\n            if (result === void 0) continue;\r\n            if (result === null || typeof result !== \"object\") throw new TypeError(\"Object expected\");\r\n            if (_ = accept(result.get)) descriptor.get = _;\r\n            if (_ = accept(result.set)) descriptor.set = _;\r\n            if (_ = accept(result.init)) initializers.unshift(_);\r\n        }\r\n        else if (_ = accept(result)) {\r\n            if (kind === \"field\") initializers.unshift(_);\r\n            else descriptor[key] = _;\r\n        }\r\n    }\r\n    if (target) Object.defineProperty(target, contextIn.name, descriptor);\r\n    done = true;\r\n};\r\n\r\nexport function __runInitializers(thisArg, initializers, value) {\r\n    var useValue = arguments.length > 2;\r\n    for (var i = 0; i < initializers.length; i++) {\r\n        value = useValue ? initializers[i].call(thisArg, value) : initializers[i].call(thisArg);\r\n    }\r\n    return useValue ? value : void 0;\r\n};\r\n\r\nexport function __propKey(x) {\r\n    return typeof x === \"symbol\" ? x : \"\".concat(x);\r\n};\r\n\r\nexport function __setFunctionName(f, name, prefix) {\r\n    if (typeof name === \"symbol\") name = name.description ? \"[\".concat(name.description, \"]\") : \"\";\r\n    return Object.defineProperty(f, \"name\", { configurable: true, value: prefix ? \"\".concat(prefix, \" \", name) : name });\r\n};\r\n\r\nexport function __metadata(metadataKey, metadataValue) {\r\n    if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nexport function __awaiter(thisArg, _arguments, P, generator) {\r\n    function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n    return new (P || (P = Promise))(function (resolve, reject) {\r\n        function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n        function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n        function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n        step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n    });\r\n}\r\n\r\nexport function __generator(thisArg, body) {\r\n    var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g = Object.create((typeof Iterator === \"function\" ? Iterator : Object).prototype);\r\n    return g.next = verb(0), g[\"throw\"] = verb(1), g[\"return\"] = verb(2), typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n    function verb(n) { return function (v) { return step([n, v]); }; }\r\n    function step(op) {\r\n        if (f) throw new TypeError(\"Generator is already executing.\");\r\n        while (g && (g = 0, op[0] && (_ = 0)), _) try {\r\n            if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n            if (y = 0, t) op = [op[0] & 2, t.value];\r\n            switch (op[0]) {\r\n                case 0: case 1: t = op; break;\r\n                case 4: _.label++; return { value: op[1], done: false };\r\n                case 5: _.label++; y = op[1]; op = [0]; continue;\r\n                case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n                default:\r\n                    if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n                    if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n                    if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n                    if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n                    if (t[2]) _.ops.pop();\r\n                    _.trys.pop(); continue;\r\n            }\r\n            op = body.call(thisArg, _);\r\n        } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n        if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n    }\r\n}\r\n\r\nexport var __createBinding = Object.create ? (function(o, m, k, k2) {\r\n    if (k2 === undefined) k2 = k;\r\n    var desc = Object.getOwnPropertyDescriptor(m, k);\r\n    if (!desc || (\"get\" in desc ? !m.__esModule : desc.writable || desc.configurable)) {\r\n        desc = { enumerable: true, get: function() { return m[k]; } };\r\n    }\r\n    Object.defineProperty(o, k2, desc);\r\n}) : (function(o, m, k, k2) {\r\n    if (k2 === undefined) k2 = k;\r\n    o[k2] = m[k];\r\n});\r\n\r\nexport function __exportStar(m, o) {\r\n    for (var p in m) if (p !== \"default\" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p);\r\n}\r\n\r\nexport function __values(o) {\r\n    var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n    if (m) return m.call(o);\r\n    if (o && typeof o.length === \"number\") return {\r\n        next: function () {\r\n            if (o && i >= o.length) o = void 0;\r\n            return { value: o && o[i++], done: !o };\r\n        }\r\n    };\r\n    throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nexport function __read(o, n) {\r\n    var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n    if (!m) return o;\r\n    var i = m.call(o), r, ar = [], e;\r\n    try {\r\n        while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n    }\r\n    catch (error) { e = { error: error }; }\r\n    finally {\r\n        try {\r\n            if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n        }\r\n        finally { if (e) throw e.error; }\r\n    }\r\n    return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spread() {\r\n    for (var ar = [], i = 0; i < arguments.length; i++)\r\n        ar = ar.concat(__read(arguments[i]));\r\n    return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spreadArrays() {\r\n    for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n    for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n        for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n            r[k] = a[j];\r\n    return r;\r\n}\r\n\r\nexport function __spreadArray(to, from, pack) {\r\n    if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) {\r\n        if (ar || !(i in from)) {\r\n            if (!ar) ar = Array.prototype.slice.call(from, 0, i);\r\n            ar[i] = from[i];\r\n        }\r\n    }\r\n    return to.concat(ar || Array.prototype.slice.call(from));\r\n}\r\n\r\nexport function __await(v) {\r\n    return this instanceof __await ? (this.v = v, this) : new __await(v);\r\n}\r\n\r\nexport function __asyncGenerator(thisArg, _arguments, generator) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n    return i = Object.create((typeof AsyncIterator === \"function\" ? AsyncIterator : Object).prototype), verb(\"next\"), verb(\"throw\"), verb(\"return\", awaitReturn), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n    function awaitReturn(f) { return function (v) { return Promise.resolve(v).then(f, reject); }; }\r\n    function verb(n, f) { if (g[n]) { i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; if (f) i[n] = f(i[n]); } }\r\n    function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n    function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n    function fulfill(value) { resume(\"next\", value); }\r\n    function reject(value) { resume(\"throw\", value); }\r\n    function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nexport function __asyncDelegator(o) {\r\n    var i, p;\r\n    return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n    function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: false } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nexport function __asyncValues(o) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var m = o[Symbol.asyncIterator], i;\r\n    return m ? m.call(o) : (o = typeof __values === \"function\" ? __values(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n    function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n    function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nexport function __makeTemplateObject(cooked, raw) {\r\n    if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n    return cooked;\r\n};\r\n\r\nvar __setModuleDefault = Object.create ? (function(o, v) {\r\n    Object.defineProperty(o, \"default\", { enumerable: true, value: v });\r\n}) : function(o, v) {\r\n    o[\"default\"] = v;\r\n};\r\n\r\nvar ownKeys = function(o) {\r\n    ownKeys = Object.getOwnPropertyNames || function (o) {\r\n        var ar = [];\r\n        for (var k in o) if (Object.prototype.hasOwnProperty.call(o, k)) ar[ar.length] = k;\r\n        return ar;\r\n    };\r\n    return ownKeys(o);\r\n};\r\n\r\nexport function __importStar(mod) {\r\n    if (mod && mod.__esModule) return mod;\r\n    var result = {};\r\n    if (mod != null) for (var k = ownKeys(mod), i = 0; i < k.length; i++) if (k[i] !== \"default\") __createBinding(result, mod, k[i]);\r\n    __setModuleDefault(result, mod);\r\n    return result;\r\n}\r\n\r\nexport function __importDefault(mod) {\r\n    return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nexport function __classPrivateFieldGet(receiver, state, kind, f) {\r\n    if (kind === \"a\" && !f) throw new TypeError(\"Private accessor was defined without a getter\");\r\n    if (typeof state === \"function\" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError(\"Cannot read private member from an object whose class did not declare it\");\r\n    return kind === \"m\" ? f : kind === \"a\" ? f.call(receiver) : f ? f.value : state.get(receiver);\r\n}\r\n\r\nexport function __classPrivateFieldSet(receiver, state, value, kind, f) {\r\n    if (kind === \"m\") throw new TypeError(\"Private method is not writable\");\r\n    if (kind === \"a\" && !f) throw new TypeError(\"Private accessor was defined without a setter\");\r\n    if (typeof state === \"function\" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError(\"Cannot write private member to an object whose class did not declare it\");\r\n    return (kind === \"a\" ? f.call(receiver, value) : f ? f.value = value : state.set(receiver, value)), value;\r\n}\r\n\r\nexport function __classPrivateFieldIn(state, receiver) {\r\n    if (receiver === null || (typeof receiver !== \"object\" && typeof receiver !== \"function\")) throw new TypeError(\"Cannot use 'in' operator on non-object\");\r\n    return typeof state === \"function\" ? receiver === state : state.has(receiver);\r\n}\r\n\r\nexport function __addDisposableResource(env, value, async) {\r\n    if (value !== null && value !== void 0) {\r\n        if (typeof value !== \"object\" && typeof value !== \"function\") throw new TypeError(\"Object expected.\");\r\n        var dispose, inner;\r\n        if (async) {\r\n            if (!Symbol.asyncDispose) throw new TypeError(\"Symbol.asyncDispose is not defined.\");\r\n            dispose = value[Symbol.asyncDispose];\r\n        }\r\n        if (dispose === void 0) {\r\n            if (!Symbol.dispose) throw new TypeError(\"Symbol.dispose is not defined.\");\r\n            dispose = value[Symbol.dispose];\r\n            if (async) inner = dispose;\r\n        }\r\n        if (typeof dispose !== \"function\") throw new TypeError(\"Object not disposable.\");\r\n        if (inner) dispose = function() { try { inner.call(this); } catch (e) { return Promise.reject(e); } };\r\n        env.stack.push({ value: value, dispose: dispose, async: async });\r\n    }\r\n    else if (async) {\r\n        env.stack.push({ async: true });\r\n    }\r\n    return value;\r\n\r\n}\r\n\r\nvar _SuppressedError = typeof SuppressedError === \"function\" ? SuppressedError : function (error, suppressed, message) {\r\n    var e = new Error(message);\r\n    return e.name = \"SuppressedError\", e.error = error, e.suppressed = suppressed, e;\r\n};\r\n\r\nexport function __disposeResources(env) {\r\n    function fail(e) {\r\n        env.error = env.hasError ? new _SuppressedError(e, env.error, \"An error was suppressed during disposal.\") : e;\r\n        env.hasError = true;\r\n    }\r\n    var r, s = 0;\r\n    function next() {\r\n        while (r = env.stack.pop()) {\r\n            try {\r\n                if (!r.async && s === 1) return s = 0, env.stack.push(r), Promise.resolve().then(next);\r\n                if (r.dispose) {\r\n                    var result = r.dispose.call(r.value);\r\n                    if (r.async) return s |= 2, Promise.resolve(result).then(next, function(e) { fail(e); return next(); });\r\n                }\r\n                else s |= 1;\r\n            }\r\n            catch (e) {\r\n                fail(e);\r\n            }\r\n        }\r\n        if (s === 1) return env.hasError ? Promise.reject(env.error) : Promise.resolve();\r\n        if (env.hasError) throw env.error;\r\n    }\r\n    return next();\r\n}\r\n\r\nexport function __rewriteRelativeImportExtension(path, preserveJsx) {\r\n    if (typeof path === \"string\" && /^\\.\\.?\\//.test(path)) {\r\n        return path.replace(/\\.(tsx)$|((?:\\.d)?)((?:\\.[^./]+?)?)\\.([cm]?)ts$/i, function (m, tsx, d, ext, cm) {\r\n            return tsx ? preserveJsx ? \".jsx\" : \".js\" : d && (!ext || !cm) ? m : (d + ext + \".\" + cm.toLowerCase() + \"js\");\r\n        });\r\n    }\r\n    return path;\r\n}\r\n\r\nexport default {\r\n    __extends: __extends,\r\n    __assign: __assign,\r\n    __rest: __rest,\r\n    __decorate: __decorate,\r\n    __param: __param,\r\n    __esDecorate: __esDecorate,\r\n    __runInitializers: __runInitializers,\r\n    __propKey: __propKey,\r\n    __setFunctionName: __setFunctionName,\r\n    __metadata: __metadata,\r\n    __awaiter: __awaiter,\r\n    __generator: __generator,\r\n    __createBinding: __createBinding,\r\n    __exportStar: __exportStar,\r\n    __values: __values,\r\n    __read: __read,\r\n    __spread: __spread,\r\n    __spreadArrays: __spreadArrays,\r\n    __spreadArray: __spreadArray,\r\n    __await: __await,\r\n    __asyncGenerator: __asyncGenerator,\r\n    __asyncDelegator: __asyncDelegator,\r\n    __asyncValues: __asyncValues,\r\n    __makeTemplateObject: __makeTemplateObject,\r\n    __importStar: __importStar,\r\n    __importDefault: __importDefault,\r\n    __classPrivateFieldGet: __classPrivateFieldGet,\r\n    __classPrivateFieldSet: __classPrivateFieldSet,\r\n    __classPrivateFieldIn: __classPrivateFieldIn,\r\n    __addDisposableResource: __addDisposableResource,\r\n    __disposeResources: __disposeResources,\r\n    __rewriteRelativeImportExtension: __rewriteRelativeImportExtension,\r\n};\r\n", "import {View} from '@react-pdf/renderer';\nimport {flatten} from '@react-pdf/stylesheet';\nimport {Style} from '@react-pdf/types';\nimport React, {useMemo} from 'react';\n\nexport interface TableProps extends Omit<React.ComponentProps<typeof View>, 'children'> {\n    weightings?: number[],\n    tdStyle?: Style | Style[],\n    trStyle?: Style | Style[],\n    children: React.ReactElement | React.ReactElement[] | React.ReactFragment | React.ReactFragment[],\n}\n\nexport interface TableContextType {\n    weightings?: number[],\n    style: Omit<Style, 'borderWidth'> & {\n        borderWidth: number,\n    },\n    tdStyle?: TableProps['tdStyle'],\n    trStyle?: TableProps['trStyle'],\n}\n\nexport const tableContext = React.createContext<TableContextType>({\n    style: {\n        borderWidth: 1,\n    },\n});\n\nexport default function Table({\n    children,\n    weightings,\n    style: styleProps,\n    tdStyle,\n    trStyle,\n    ...rest\n}: TableProps) {\n    const tableStyle = useMemo(() => {\n        const style = flatten([\n            {\n                borderColor: '#000000',\n                borderWidth: '1px',\n                borderStyle: 'solid',\n            },\n            ...(Array.isArray(styleProps) ? styleProps : [styleProps]),\n        ]) as TableContextType['style'];\n\n        if (typeof style.border === 'string') {\n            const [borderWidth, borderStyle, borderColor] = style.border.split(/\\s+/);\n\n            style.borderWidth = Number.parseFloat(borderWidth);\n            style.borderStyle = borderStyle as Style['borderStyle'];\n            style.borderColor = borderColor;\n        }\n        else if (typeof style.border === 'number') {\n            style.borderWidth = style.border;\n        }\n        if (typeof style.borderWidth === 'string') {\n            style.borderWidth = Number.parseFloat(style.borderWidth);\n        }\n\n        return style;\n    }, [styleProps]);\n\n    const rows = useMemo(() => {\n        const output: React.ReactElement[] = [];\n\n        const flattenChildren = (elem: typeof children) => {\n            React.Children.forEach(elem, (child) => {\n                if (!React.isValidElement(child)) {\n                    return;\n                }\n\n                if (child.type === React.Fragment) {\n                    flattenChildren((child.props as {children?: React.ReactNode}).children);\n                }\n                else {\n                    output.push(child);\n                }\n            });\n        };\n        flattenChildren(children);\n\n        return (\n            output.map((tr, rowIndex) => (\n                React.cloneElement(tr, {\n                    key: `table_row_${rowIndex}`,\n                    _firstRow: rowIndex === 0,\n                    _lastRow: rowIndex === output.length - 1,\n                })\n            ))\n        );\n    }, [children]);\n\n    const style = useMemo(() => [\n        {\n            width: '100%',\n        },\n        ...(Array.isArray(styleProps) ? styleProps : [styleProps]),\n        tableStyle.borderStyle === 'solid' ? {\n            border: '0px',\n        } : undefined,\n    ].filter(Boolean), [styleProps]);\n\n    const tableContextValue = useMemo<TableContextType>(() => ({\n        style: tableStyle,\n        weightings,\n        tdStyle,\n        trStyle,\n    }), [tableStyle, weightings, tdStyle, trStyle]);\n\n    return (\n        <tableContext.Provider value={tableContextValue}>\n            <View {...rest} style={style}>\n                {rows}\n            </View>\n        </tableContext.Provider>\n    );\n}\n", "import {View} from '@react-pdf/renderer';\nimport React, {useContext, useMemo} from 'react';\n\nimport {tableContext} from './Table';\n\nexport interface TableRowProps extends Omit<React.ComponentProps<typeof View>, 'children'> {\n    _firstRow?: boolean,\n    _lastRow?: boolean,\n\n    children?: React.ReactElement | React.ReactElement[] | React.ReactFragment | React.ReactFragment[],\n}\n\nexport default function TableRow({children, style: styleProps, _firstRow, _lastRow, ...rest}: TableRowProps) {\n    const {trStyle, weightings: tableWeightings} = useContext(tableContext);\n\n    const cells = useMemo(() => {\n        const output: React.ReactElement[] = [];\n\n        const flattenChildren = (elem: typeof children) => {\n            React.Children.forEach(elem, (child) => {\n                if (!React.isValidElement(child)) {\n                    return;\n                }\n\n                if (child.type === React.Fragment) {\n                    flattenChildren((child.props as {children?: React.ReactNode}).children);\n                }\n                else {\n                    output.push(child);\n                }\n            });\n        };\n        flattenChildren(children);\n\n        let weightings: (number | undefined)[] = [];\n\n        for (const [index, row] of output.entries()) {\n            if (row.props?.weighting) {\n                weightings.push(row.props?.weighting);\n            }\n            else {\n                weightings.push(tableWeightings?.[index]);\n            }\n        }\n\n        const remainingWeighting = 1 - weightings.reduce((acc, val) => acc + (val || 0), 0);\n        const weightingPerNotSpecified = remainingWeighting / (output.length - weightings.filter(e => typeof e === 'number').length);\n\n        weightings = weightings.map(e => e === undefined ? weightingPerNotSpecified : e);\n\n        return (\n            output.map((td, columnIndex) => (\n                React.cloneElement(td, {\n                    weighting: weightings[columnIndex],\n                    key: `table_col_${columnIndex}_cell`,\n                    _firstColumn: columnIndex === 0,\n                    _lastColumn: columnIndex === output.length - 1,\n                    _firstRow,\n                    _lastRow,\n                })\n            ))\n        );\n    }, [children, tableWeightings, _firstRow, _lastRow]);\n\n    return (\n        <View\n            {...rest}\n            style={[\n                {\n                    display: 'flex',\n                    flexDirection: 'row',\n                },\n                ...(Array.isArray(trStyle) ? trStyle : [trStyle]),\n                ...(Array.isArray(styleProps) ? styleProps : [styleProps]),\n            ]}\n        >\n            {cells}\n        </View>\n    );\n}\n", "import React from 'react';\n\nimport TableRow, {TableRowProps} from './TableRow';\n\nexport type TableHeaderProps = TableRowProps;\n\nexport default function TableHeader({children, style, ...rest}: TableHeaderProps) {\n    return (\n        <TableRow\n            {...rest}\n            style={[\n                {\n                    fontWeight: 'bold',\n                },\n                ...(Array.isArray(style) ? style : [style]),\n            ]}\n        >\n            {children}\n        </TableRow>\n    );\n}\n", "import {Text, View} from '@react-pdf/renderer';\nimport React, {useContext, useMemo} from 'react';\n\nimport {tableContext} from './Table';\n\nexport interface TableCellProps extends Omit<React.ComponentProps<typeof View>, 'children'> {\n    /**\n     * The weighting of a cell based on the flex layout style.\n     * This value is between 0..1, if not specified 1 is assumed, this will take up the remaining available space.\n     */\n    weighting?: number,\n\n    _firstColumn?: boolean,\n    _lastColumn?: boolean,\n    _firstRow?: boolean,\n    _lastRow?: boolean,\n\n    children?: React.ReactNode | React.ReactNode[],\n}\n\nexport default function TableCell({\n    children, weighting,\n    _firstColumn, _lastColumn,\n    _firstRow, _lastRow,\n    ...rest\n}: TableCellProps) {\n    const content = useMemo(() => {\n        const output: JSX.Element[] = [];\n\n        const flattenChildren = (elem: typeof children) => {\n            React.Children.forEach(elem, (child) => {\n                if (React.isValidElement(child) && child?.type === React.Fragment) {\n                    flattenChildren((child.props as {children?: React.ReactNode}).children);\n                }\n                else {\n                    output.push(child as JSX.Element);\n                }\n            });\n        };\n        flattenChildren(children);\n\n        return (\n            output.map((child, index) => {\n                const key = `table_cell_${index}_content`;\n\n                if (typeof child === 'string' || typeof child === 'number') {\n                    return (\n                        <Text key={key}>{child}</Text>\n                    );\n                }\n                else {\n                    return child;\n                }\n            })\n        );\n    }, [children]);\n\n    const {tdStyle, style: tableStyle} = useContext(tableContext);\n    const borderMargin = `${(tableStyle['borderWidth'] || 0) * -1}px`;\n\n    // all this fuckery is to ensure no micro-gaps in the solid borders (1000x zoom to see)\n    const borders = useMemo(() => {\n        if (tableStyle.borderStyle === 'solid') {\n            return {\n                borderTop: `${tableStyle['borderWidth'] || 0}px ${tableStyle.borderStyle} ${tableStyle.borderColor}`,\n                borderRight: `${tableStyle['borderWidth'] || 0}px ${tableStyle.borderStyle} ${tableStyle.borderColor}`,\n                borderBottom: `${tableStyle['borderWidth'] || 0}px ${tableStyle.borderStyle} ${tableStyle.borderColor}`,\n                borderLeft: `${tableStyle['borderWidth'] || 0}px ${tableStyle.borderStyle} ${tableStyle.borderColor}`,\n                margin: `${borderMargin} ${_lastColumn ? borderMargin : '0'} ${_lastRow ? borderMargin : 0} ${borderMargin}`,\n            };\n        }\n        else {\n            return {\n                borderTop: _firstRow ? undefined : `${tableStyle['borderWidth'] || 0}px ${tableStyle.borderStyle} ${tableStyle.borderColor}`,\n                borderLeft: _firstColumn ? undefined : `${tableStyle['borderWidth'] || 0}px ${tableStyle.borderStyle} ${tableStyle.borderColor}`,\n            };\n        }\n    }, [tableStyle, _firstColumn, _lastColumn, _firstRow, _firstRow]);\n\n    return (\n        <View\n            wrap={true}\n            {...rest}\n            style={[\n                {\n                    ...borders,\n                    flex: weighting ?? 1,\n                    display: 'flex',\n                    flexDirection: 'row',\n                    alignItems: 'center',\n                },\n                ...(Array.isArray(tdStyle) ? tdStyle : [tdStyle]),\n                ...(Array.isArray(rest.style) ? rest.style : [rest.style]),\n            ]}\n        >\n            {content}\n        </View>\n    );\n}\n", "import { Table, TD, TH, TR } from '@ag-media/react-pdf-table';\nimport { Image, Page, Text, View } from '@react-pdf/renderer';\nimport { Map } from '~/components/react-pdf/Map';\nimport QrCode from '~/components/react-pdf/QrCode';\nimport { Markdown } from '~/components/react-pdf/Markdown';\n// import { Bullet } from '~/components/react-pdf/Bullet';\n\nexport const PDF_COMPONENTS = {\n  Page: Page,\n  View: View,\n  Text: Text,\n  Image: Image,\n  Table: Table,\n  TH: TH,\n  TR: TR,\n  TD: TD,\n  QrCode: QrCode,\n  Map: Map,\n  Markdown: Markdown,\n  // Bullet: Bullet,\n};\n", "import QRCode, { QRCodeToDataURLOptions } from 'qrcode';\nimport React from 'react';\nimport {\n  ComponentData,\n  ComponentMap,\n  RenderPdfComponentArgs,\n  TemplateData,\n} from '~/types';\n\nexport const generateQrCode = async (text: string) => {\n  const options: QRCodeToDataURLOptions = {\n    margin: 0,\n    width: 300,\n    color: {\n      dark: '#000',\n      light: '#fff',\n    },\n  };\n  return QRCode.toDataURL(text, options);\n};\n\n// Recursive function to render components from nested data structure\nexport function renderPdfComponent(args: RenderPdfComponentArgs): any {\n  const { componentData, components, data, allProps = {}, images = {} } = args;\n\n  if (allProps.key) delete allProps.key;\n  if (allProps.styles) delete allProps.styles;\n  if (allProps.index) delete allProps.index;\n  if (allProps.className) delete allProps.className;\n  if (allProps.children) delete allProps.children;\n\n  // Handle array of components\n  if (Array.isArray(componentData) && componentData.length > 0) {\n    return componentData.map((item, index) =>\n      renderPdfComponent({\n        componentData: { ...item, props: { ...item.props, index } },\n        components,\n        data,\n        allProps: {},\n        images,\n      }),\n    );\n  }\n\n  // Handle single component object\n  if (\n    typeof componentData === 'object' &&\n    componentData !== null &&\n    'type' in componentData &&\n    Object.keys(components).includes(componentData.type)\n  ) {\n    const { type, props = {}, children, visible = 'true' } = componentData;\n    const mergedProps = { ...allProps, ...props };\n\n    // Get the component constructor/function from the components object\n    const Component = components[type];\n\n    if (!Component) {\n      console.warn(`Component type \"${type}\" not found in components object`);\n      return null;\n    }\n\n    // Process children recursively\n    let processedChildren: any = null;\n\n    if (children !== undefined) {\n      if (Array.isArray(children)) {\n        // If children is an array, recursively process each child\n        processedChildren = children.map((child, index) =>\n          renderPdfComponent({\n            componentData: child,\n            components,\n            data,\n            allProps: mergedProps,\n            images,\n          }),\n        );\n      } else if (\n        typeof children === 'object' &&\n        children !== null &&\n        'type' in children\n      ) {\n        // If children is a single component object, process it\n        processedChildren = renderPdfComponent({\n          componentData: children,\n          components,\n          data,\n          allProps: mergedProps,\n          images,\n        });\n      } else {\n        // If children is a string or other primitive, use it directly\n        processedChildren = children;\n      }\n    }\n\n    // Return the component with processed children\n    const propsWithKey: Record<string, any> = {\n      ...mergedProps,\n      key: crypto.randomUUID(),\n    };\n\n    if (type === 'Map') {\n      propsWithKey.data = data;\n      propsWithKey.images = images;\n    }\n\n    // const mappedProps = mapDataProps(propsWithKey, data);\n    const { mappedChild, mappedIsVisible, ...mappedProps } = mapDataProps(\n      {\n        ...propsWithKey,\n        mappedChild: processedChildren,\n        mappedIsVisible: visible,\n      },\n      data,\n      images,\n    );\n\n    const canRender = safeBooleanEval(mappedIsVisible);\n    return canRender\n      ? React.createElement(Component, mappedProps, mappedChild)\n      : null;\n  }\n\n  // Handle primitive values (strings, numbers, etc.)\n  return componentData;\n}\n\nexport function renderHtmlComponent(args: RenderPdfComponentArgs): any {\n  const { componentData, components, data, allProps = {}, images = {} } = args;\n\n  if (allProps.key) delete allProps.key;\n  if (allProps.styles) delete allProps.styles;\n  if (allProps.index) delete allProps.index;\n  if (allProps.className) delete allProps.className;\n  if (allProps.children) delete allProps.children;\n\n  // Handle array of components\n  if (Array.isArray(componentData) && componentData.length > 0) {\n    return componentData.map((item, index) =>\n      renderHtmlComponent({\n        componentData: { ...item, props: { ...item.props, index } },\n        components,\n        data,\n        allProps: {},\n        images,\n      }),\n    );\n  }\n\n  // Handle single component object\n  if (\n    typeof componentData === 'object' &&\n    componentData !== null &&\n    'type' in componentData &&\n    Object.keys(components).includes(componentData.type)\n  ) {\n    const { type, props = {}, children, visible = 'true' } = componentData;\n    const mergedProps = { ...allProps, ...props };\n\n    // Get the component constructor/function from the components object\n    const Component = components[type];\n\n    if (!Component) {\n      console.warn(`Component type \"${type}\" not found in components object`);\n      return null;\n    }\n\n    // Process children recursively\n    let processedChildren: any = null;\n\n    if (children !== undefined) {\n      if (Array.isArray(children)) {\n        // If children is an array, recursively process each child\n        processedChildren = children.map((child, index) =>\n          renderHtmlComponent({\n            componentData: child,\n            components,\n            data,\n            allProps: mergedProps,\n            images,\n          }),\n        );\n      } else if (\n        typeof children === 'object' &&\n        children !== null &&\n        'type' in children\n      ) {\n        // If children is a single component object, process it\n        processedChildren = renderHtmlComponent({\n          componentData: children,\n          components,\n          data,\n          allProps: mergedProps,\n          images,\n        });\n      } else {\n        // If children is a string or other primitive, use it directly\n        processedChildren = children;\n      }\n    }\n\n    // Return the component with processed children\n    const propsWithKey: Record<string, any> = {\n      ...mergedProps,\n      key: crypto.randomUUID(),\n    };\n\n    if (type === 'Map') {\n      propsWithKey.data = data;\n      propsWithKey.images = images;\n    }\n\n    // const mappedProps = mapDataProps(propsWithKey, data);\n    const { mappedChild, mappedIsVisible, ...mappedProps } = mapDataProps(\n      {\n        ...propsWithKey,\n        mappedChild: processedChildren,\n        mappedIsVisible: visible,\n      },\n      data,\n      images,\n    );\n\n    const canRender = safeBooleanEval(mappedIsVisible);\n    return canRender\n      ? React.createElement(Component, mappedProps, mappedChild)\n      : null;\n  }\n\n  // Handle primitive values (strings, numbers, etc.)\n  return componentData;\n}\n\nexport const mapDataProps = (\n  props: Record<string, any>,\n  data: any,\n  images: any,\n) => {\n  const context = { $data: data, $props: props, $images: images };\n  const templateRegex = /\\{\\{([^}]+)\\}\\}/g;\n\n  const processStringValue = (value: string): any => {\n    const matches = Array.from(value.matchAll(templateRegex));\n\n    if (matches.length === 0) {\n      return value;\n    }\n\n    // Single template that spans the entire string - return the actual value\n    if (matches.length === 1 && matches[0][0] === value) {\n      const path = matches[0][1].trim();\n      const resolvedValue = getNestedProperty({ obj: context, path });\n      return resolvedValue !== undefined ? resolvedValue : value;\n    }\n\n    // Multiple templates or partial string replacement - always return string\n    return matches.reduce((result, match) => {\n      const path = match[1].trim();\n      const resolvedValue = getNestedProperty({ obj: context, path });\n      const replacement =\n        resolvedValue !== undefined ? String(resolvedValue) : match[0];\n      return result.replace(match[0], replacement);\n    }, value);\n  };\n\n  return Object.fromEntries(\n    Object.entries(props).map(([key, value]) => [\n      key,\n      typeof value === 'string' ? processStringValue(value) : value,\n    ]),\n  );\n};\n\nexport const parseJson = (jsonString: string): TemplateData | null => {\n  try {\n    const obj = JSON.parse(jsonString);\n    return obj;\n  } catch (e) {\n    return null;\n  }\n};\n\nexport function getNestedProperty({\n  obj,\n  path,\n}: {\n  obj?: any;\n  path: string;\n}): any {\n  // Split the path by dots and filter out empty strings\n  const keys = path.split('.').filter((key) => key.length > 0);\n\n  // Start with the root object\n  let current = obj;\n\n  // Traverse through each key in the path\n  for (const key of keys) {\n    // Check if current is null/undefined or if the key doesn't exist\n    if (current == null || !(key in current)) {\n      return undefined;\n    }\n    current = current[key];\n  }\n\n  if (typeof current === 'object') {\n    return JSON.stringify(current);\n  }\n  return current;\n}\n\nexport function safeBooleanEval(code: string) {\n  try {\n    const result = eval(code);\n    return typeof result === 'boolean' ? result : false;\n  } catch (error) {\n    console.error(`Error evaluating code \"${code}\":`, error);\n    return false;\n  }\n}\n\nexport function convertFileToBase64(file: File): Promise<string> {\n  return new Promise((resolve, reject) => {\n    const reader = new FileReader();\n\n    reader.onload = function (event) {\n      const content = event.target?.result;\n      if (typeof content === 'string') {\n        resolve(content);\n      } else {\n        reject(new Error('File content is not a string'));\n      }\n    };\n\n    reader.onerror = function (error) {\n      reject(error);\n    };\n\n    reader.readAsDataURL(file);\n  });\n}\n", "import React from 'react';\nimport { PDF_COMPONENTS } from '~/utils/pdf-components';\nimport { renderPdfComponent } from '~/utils/helpers';\n\ninterface MapProps {\n  items: string;\n  itemKeyWord?: string;\n  component: any;\n  data: any;\n  images: any;\n}\n\nexport const Map: React.FC<MapProps> = ({\n  items,\n  component,\n  data = {},\n  images = {},\n  itemKeyWord = 'item',\n}) => {\n  const parsedItems = JSON.parse(items);\n\n  if (!Array.isArray(parsedItems)) return null;\n\n  const mappedItems = parsedItems.map((item, index) => ({\n    ...component,\n    props: {\n      ...component.props,\n      [itemKeyWord]: item,\n      [`${itemKeyWord}Index`]: index,\n    },\n  }));\n\n  return renderPdfComponent({\n    componentData: mappedItems,\n    components: PDF_COMPONENTS,\n    data,\n    allProps: {},\n    images,\n  });\n};\n", "import { Image, ImageProps } from '@react-pdf/renderer';\nimport React from 'react';\nimport { generateQrCode } from '~/utils/helpers';\n\nconst QrCode: React.FC<ImageProps & { qrCodeText: string }> = (props) => {\n  const { qrCodeText, ...imageProps } = props;\n  const qrCodeURL = React.useMemo(\n    async () => await generateQrCode(qrCodeText),\n    [qrCodeText],\n  );\n\n  return <Image src={qrCodeURL} {...imageProps} />;\n};\n\nexport default QrCode;\n", "import React from 'react';\nimport { Text, View } from '@react-pdf/renderer';\nimport { remark } from 'remark';\nimport remarkParse from 'remark-parse';\nimport type { Root, Content, PhrasingContent } from 'mdast';\n\ninterface MarkdownProps {\n  children?: string | React.ReactNode;\n  text?: string;\n  markdown?: string;\n  style?: any;\n  [key: string]: any;\n}\n\nconst renderNode = (\n  node: Content | PhrasingContent,\n  index: number = 0,\n): React.ReactElement | React.ReactElement[] | string | null => {\n  if (!node) return null;\n\n  switch (node.type) {\n    case 'heading': {\n      const fontSize =\n        node.depth === 1\n          ? 24\n          : node.depth === 2\n            ? 20\n            : node.depth === 3\n              ? 18\n              : 16;\n      const fontWeight = node.depth <= 2 ? 'bold' : 'normal';\n      return (\n        <View\n          key={index}\n          style={{ marginBottom: 8, marginTop: node.depth === 1 ? 0 : 4 }}\n        >\n          <Text style={{ fontSize, fontWeight }}>\n            {node.children.map((child, i) => renderNode(child, i))}\n          </Text>\n        </View>\n      );\n    }\n\n    case 'paragraph': {\n      return (\n        <View key={index} style={{ marginBottom: 6 }}>\n          <Text>{node.children.map((child, i) => renderNode(child, i))}</Text>\n        </View>\n      );\n    }\n\n    case 'text': {\n      return node.value;\n    }\n\n    case 'strong': {\n      return (\n        <Text key={index} style={{ fontWeight: 'bold' }}>\n          {node.children.map((child, i) => renderNode(child, i))}\n        </Text>\n      );\n    }\n\n    case 'emphasis': {\n      return (\n        <Text key={index} style={{ fontStyle: 'italic' }}>\n          {node.children.map((child, i) => renderNode(child, i))}\n        </Text>\n      );\n    }\n\n    case 'list': {\n      return (\n        <View key={index} style={{ marginBottom: 8, marginLeft: 0 }}>\n          {node.children.map((item, i) => (\n            <View key={i} style={{ flexDirection: 'row', marginBottom: 4 }}>\n              <Text style={{ marginRight: 8, width: 20 }}>\n                {node.ordered ? `${i + 1}.` : '\u2022'}\n              </Text>\n              <View style={{ flex: 1 }}>\n                {item.children.map((child, j) => renderNode(child, j))}\n              </View>\n            </View>\n          ))}\n        </View>\n      );\n    }\n\n    case 'listItem': {\n      // List items are handled within the list case, but we still need this for nested structures\n      return (\n        <React.Fragment key={index}>\n          {node.children.map((child, i) => renderNode(child, i))}\n        </React.Fragment>\n      );\n    }\n\n    case 'link': {\n      return (\n        <Text key={index} style={{ color: '#0066cc' }}>\n          {node.children.map((child, i) => renderNode(child, i))}\n        </Text>\n      );\n    }\n\n    case 'code': {\n      return (\n        <Text\n          key={index}\n          style={{\n            fontFamily: 'Courier',\n            backgroundColor: '#f5f5f5',\n            padding: 4,\n          }}\n        >\n          {node.value}\n        </Text>\n      );\n    }\n\n    case 'inlineCode': {\n      return (\n        <Text\n          key={index}\n          style={{ fontFamily: 'Courier', backgroundColor: '#f5f5f5' }}\n        >\n          {node.value}\n        </Text>\n      );\n    }\n\n    case 'blockquote': {\n      return (\n        <View\n          key={index}\n          style={{\n            marginLeft: 20,\n            marginBottom: 8,\n            borderLeft: '2px solid #ccc',\n            paddingLeft: 10,\n          }}\n        >\n          {node.children.map((child, i) => renderNode(child, i))}\n        </View>\n      );\n    }\n\n    case 'break': {\n      return '\\n';\n    }\n\n    case 'thematicBreak': {\n      return (\n        <View\n          key={index}\n          style={{ borderBottom: '1px solid #ccc', marginVertical: 12 }}\n        />\n      );\n    }\n\n    default:\n      // For unknown node types, try to render children if they exist\n      if ('children' in node && Array.isArray(node.children)) {\n        return (\n          <React.Fragment key={index}>\n            {node.children.map((child, i) => renderNode(child, i))}\n          </React.Fragment>\n        );\n      }\n      return null;\n  }\n};\n\nexport const Markdown: React.FC<MarkdownProps> = ({\n  children,\n  text,\n  markdown,\n  style,\n  ...props\n}) => {\n  // Get markdown text from children, text, or markdown prop\n  const markdownText =\n    markdown || text || (typeof children === 'string' ? children : null);\n\n  if (!markdownText || typeof markdownText !== 'string') {\n    return null;\n  }\n\n  try {\n    const processor = remark().use(remarkParse);\n    const tree = processor.parse(markdownText) as Root;\n\n    return (\n      <View style={style} {...props}>\n        {tree.children.map((node, index) => renderNode(node, index))}\n      </View>\n    );\n  } catch (error) {\n    console.error('Error parsing markdown:', error);\n    // Fallback to plain text if parsing fails\n    return (\n      <View style={style} {...props}>\n        <Text>{markdownText}</Text>\n      </View>\n    );\n  }\n};\n", "/**\n * @typedef {import('mdast').Nodes} Nodes\n *\n * @typedef Options\n *   Configuration (optional).\n * @property {boolean | null | undefined} [includeImageAlt=true]\n *   Whether to use `alt` for `image`s (default: `true`).\n * @property {boolean | null | undefined} [includeHtml=true]\n *   Whether to use `value` of HTML (default: `true`).\n */\n\n/** @type {Options} */\nconst emptyOptions = {}\n\n/**\n * Get the text content of a node or list of nodes.\n *\n * Prefers the node\u2019s plain-text fields, otherwise serializes its children,\n * and if the given value is an array, serialize the nodes in it.\n *\n * @param {unknown} [value]\n *   Thing to serialize, typically `Node`.\n * @param {Options | null | undefined} [options]\n *   Configuration (optional).\n * @returns {string}\n *   Serialized `value`.\n */\nexport function toString(value, options) {\n  const settings = options || emptyOptions\n  const includeImageAlt =\n    typeof settings.includeImageAlt === 'boolean'\n      ? settings.includeImageAlt\n      : true\n  const includeHtml =\n    typeof settings.includeHtml === 'boolean' ? settings.includeHtml : true\n\n  return one(value, includeImageAlt, includeHtml)\n}\n\n/**\n * One node or several nodes.\n *\n * @param {unknown} value\n *   Thing to serialize.\n * @param {boolean} includeImageAlt\n *   Include image `alt`s.\n * @param {boolean} includeHtml\n *   Include HTML.\n * @returns {string}\n *   Serialized node.\n */\nfunction one(value, includeImageAlt, includeHtml) {\n  if (node(value)) {\n    if ('value' in value) {\n      return value.type === 'html' && !includeHtml ? '' : value.value\n    }\n\n    if (includeImageAlt && 'alt' in value && value.alt) {\n      return value.alt\n    }\n\n    if ('children' in value) {\n      return all(value.children, includeImageAlt, includeHtml)\n    }\n  }\n\n  if (Array.isArray(value)) {\n    return all(value, includeImageAlt, includeHtml)\n  }\n\n  return ''\n}\n\n/**\n * Serialize a list of nodes.\n *\n * @param {Array<unknown>} values\n *   Thing to serialize.\n * @param {boolean} includeImageAlt\n *   Include image `alt`s.\n * @param {boolean} includeHtml\n *   Include HTML.\n * @returns {string}\n *   Serialized nodes.\n */\nfunction all(values, includeImageAlt, includeHtml) {\n  /** @type {Array<string>} */\n  const result = []\n  let index = -1\n\n  while (++index < values.length) {\n    result[index] = one(values[index], includeImageAlt, includeHtml)\n  }\n\n  return result.join('')\n}\n\n/**\n * Check if `value` looks like a node.\n *\n * @param {unknown} value\n *   Thing.\n * @returns {value is Nodes}\n *   Whether `value` is a node.\n */\nfunction node(value) {\n  return Boolean(value && typeof value === 'object')\n}\n", "/// <reference lib=\"dom\" />\n\n/* global document */\n\nconst element = document.createElement('i')\n\n/**\n * @param {string} value\n * @returns {string | false}\n */\nexport function decodeNamedCharacterReference(value) {\n  const characterReference = '&' + value + ';'\n  element.innerHTML = characterReference\n  const character = element.textContent\n\n  // Some named character references do not require the closing semicolon\n  // (`&not`, for instance), which leads to situations where parsing the assumed\n  // named reference of `&notit;` will result in the string `\u00ACit;`.\n  // When we encounter a trailing semicolon after parsing, and the character\n  // reference to decode was not a semicolon (`&semi;`), we can assume that the\n  // matching was not complete.\n  if (\n    // @ts-expect-error: TypeScript is wrong that `textContent` on elements can\n    // yield `null`.\n    character.charCodeAt(character.length - 1) === 59 /* `;` */ &&\n    value !== 'semi'\n  ) {\n    return false\n  }\n\n  // If the decoded string is equal to the input, the character reference was\n  // not valid.\n  // @ts-expect-error: TypeScript is wrong that `textContent` on elements can\n  // yield `null`.\n  return character === characterReference ? false : character\n}\n", "/**\n * Like `Array#splice`, but smarter for giant arrays.\n *\n * `Array#splice` takes all items to be inserted as individual argument which\n * causes a stack overflow in V8 when trying to insert 100k items for instance.\n *\n * Otherwise, this does not return the removed items, and takes `items` as an\n * array instead of rest parameters.\n *\n * @template {unknown} T\n *   Item type.\n * @param {Array<T>} list\n *   List to operate on.\n * @param {number} start\n *   Index to remove/insert at (can be negative).\n * @param {number} remove\n *   Number of items to remove.\n * @param {Array<T>} items\n *   Items to inject into `list`.\n * @returns {undefined}\n *   Nothing.\n */\nexport function splice(list, start, remove, items) {\n  const end = list.length;\n  let chunkStart = 0;\n  /** @type {Array<unknown>} */\n  let parameters;\n\n  // Make start between zero and `end` (included).\n  if (start < 0) {\n    start = -start > end ? 0 : end + start;\n  } else {\n    start = start > end ? end : start;\n  }\n  remove = remove > 0 ? remove : 0;\n\n  // No need to chunk the items if there\u2019s only a couple (10k) items.\n  if (items.length < 10000) {\n    parameters = Array.from(items);\n    parameters.unshift(start, remove);\n    // @ts-expect-error Hush, it\u2019s fine.\n    list.splice(...parameters);\n  } else {\n    // Delete `remove` items starting from `start`\n    if (remove) list.splice(start, remove);\n\n    // Insert the items in chunks to not cause stack overflows.\n    while (chunkStart < items.length) {\n      parameters = items.slice(chunkStart, chunkStart + 10000);\n      parameters.unshift(start, 0);\n      // @ts-expect-error Hush, it\u2019s fine.\n      list.splice(...parameters);\n      chunkStart += 10000;\n      start += 10000;\n    }\n  }\n}\n\n/**\n * Append `items` (an array) at the end of `list` (another array).\n * When `list` was empty, returns `items` instead.\n *\n * This prevents a potentially expensive operation when `list` is empty,\n * and adds items in batches to prevent V8 from hanging.\n *\n * @template {unknown} T\n *   Item type.\n * @param {Array<T>} list\n *   List to operate on.\n * @param {Array<T>} items\n *   Items to add to `list`.\n * @returns {Array<T>}\n *   Either `list` or `items`.\n */\nexport function push(list, items) {\n  if (list.length > 0) {\n    splice(list, list.length, 0, items);\n    return list;\n  }\n  return items;\n}", "/**\n * @import {\n *   Extension,\n *   Handles,\n *   HtmlExtension,\n *   NormalizedExtension\n * } from 'micromark-util-types'\n */\n\nimport {splice} from 'micromark-util-chunked'\n\nconst hasOwnProperty = {}.hasOwnProperty\n\n/**\n * Combine multiple syntax extensions into one.\n *\n * @param {ReadonlyArray<Extension>} extensions\n *   List of syntax extensions.\n * @returns {NormalizedExtension}\n *   A single combined extension.\n */\nexport function combineExtensions(extensions) {\n  /** @type {NormalizedExtension} */\n  const all = {}\n  let index = -1\n\n  while (++index < extensions.length) {\n    syntaxExtension(all, extensions[index])\n  }\n\n  return all\n}\n\n/**\n * Merge `extension` into `all`.\n *\n * @param {NormalizedExtension} all\n *   Extension to merge into.\n * @param {Extension} extension\n *   Extension to merge.\n * @returns {undefined}\n *   Nothing.\n */\nfunction syntaxExtension(all, extension) {\n  /** @type {keyof Extension} */\n  let hook\n\n  for (hook in extension) {\n    const maybe = hasOwnProperty.call(all, hook) ? all[hook] : undefined\n    /** @type {Record<string, unknown>} */\n    const left = maybe || (all[hook] = {})\n    /** @type {Record<string, unknown> | undefined} */\n    const right = extension[hook]\n    /** @type {string} */\n    let code\n\n    if (right) {\n      for (code in right) {\n        if (!hasOwnProperty.call(left, code)) left[code] = []\n        const value = right[code]\n        constructs(\n          // @ts-expect-error Looks like a list.\n          left[code],\n          Array.isArray(value) ? value : value ? [value] : []\n        )\n      }\n    }\n  }\n}\n\n/**\n * Merge `list` into `existing` (both lists of constructs).\n * Mutates `existing`.\n *\n * @param {Array<unknown>} existing\n *   List of constructs to merge into.\n * @param {Array<unknown>} list\n *   List of constructs to merge.\n * @returns {undefined}\n *   Nothing.\n */\nfunction constructs(existing, list) {\n  let index = -1\n  /** @type {Array<unknown>} */\n  const before = []\n\n  while (++index < list.length) {\n    // @ts-expect-error Looks like an object.\n    ;(list[index].add === 'after' ? existing : before).push(list[index])\n  }\n\n  splice(existing, 0, 0, before)\n}\n\n/**\n * Combine multiple HTML extensions into one.\n *\n * @param {ReadonlyArray<HtmlExtension>} htmlExtensions\n *   List of HTML extensions.\n * @returns {HtmlExtension}\n *   Single combined HTML extension.\n */\nexport function combineHtmlExtensions(htmlExtensions) {\n  /** @type {HtmlExtension} */\n  const handlers = {}\n  let index = -1\n\n  while (++index < htmlExtensions.length) {\n    htmlExtension(handlers, htmlExtensions[index])\n  }\n\n  return handlers\n}\n\n/**\n * Merge `extension` into `all`.\n *\n * @param {HtmlExtension} all\n *   Extension to merge into.\n * @param {HtmlExtension} extension\n *   Extension to merge.\n * @returns {undefined}\n *   Nothing.\n */\nfunction htmlExtension(all, extension) {\n  /** @type {keyof HtmlExtension} */\n  let hook\n\n  for (hook in extension) {\n    const maybe = hasOwnProperty.call(all, hook) ? all[hook] : undefined\n    const left = maybe || (all[hook] = {})\n    const right = extension[hook]\n    /** @type {keyof Handles} */\n    let type\n\n    if (right) {\n      for (type in right) {\n        // @ts-expect-error assume document vs regular handler are managed correctly.\n        left[type] = right[type]\n      }\n    }\n  }\n}\n", "/**\n * Turn the number (in string form as either hexa- or plain decimal) coming from\n * a numeric character reference into a character.\n *\n * Sort of like `String.fromCodePoint(Number.parseInt(value, base))`, but makes\n * non-characters and control characters safe.\n *\n * @param {string} value\n *   Value to decode.\n * @param {number} base\n *   Numeric base.\n * @returns {string}\n *   Character.\n */\nexport function decodeNumericCharacterReference(value, base) {\n  const code = Number.parseInt(value, base);\n  if (\n  // C0 except for HT, LF, FF, CR, space.\n  code < 9 || code === 11 || code > 13 && code < 32 ||\n  // Control character (DEL) of C0, and C1 controls.\n  code > 126 && code < 160 ||\n  // Lone high surrogates and low surrogates.\n  code > 55_295 && code < 57_344 ||\n  // Noncharacters.\n  code > 64_975 && code < 65_008 || /* eslint-disable no-bitwise */\n  (code & 65_535) === 65_535 || (code & 65_535) === 65_534 || /* eslint-enable no-bitwise */\n  // Out of range\n  code > 1_114_111) {\n    return \"\\uFFFD\";\n  }\n  return String.fromCodePoint(code);\n}", "/**\n * Normalize an identifier (as found in references, definitions).\n *\n * Collapses markdown whitespace, trim, and then lower- and uppercase.\n *\n * Some characters are considered \u201Cuppercase\u201D, such as U+03F4 (`\u03F4`), but if their\n * lowercase counterpart (U+03B8 (`\u03B8`)) is uppercased will result in a different\n * uppercase character (U+0398 (`\u0398`)).\n * So, to get a canonical form, we perform both lower- and uppercase.\n *\n * Using uppercase last makes sure keys will never interact with default\n * prototypal values (such as `constructor`): nothing in the prototype of\n * `Object` is uppercase.\n *\n * @param {string} value\n *   Identifier to normalize.\n * @returns {string}\n *   Normalized identifier.\n */\nexport function normalizeIdentifier(value) {\n  return value\n  // Collapse markdown whitespace.\n  .replace(/[\\t\\n\\r ]+/g, \" \")\n  // Trim.\n  .replace(/^ | $/g, '')\n  // Some characters are considered \u201Cuppercase\u201D, but if their lowercase\n  // counterpart is uppercased will result in a different uppercase\n  // character.\n  // Hence, to get that form, we perform both lower- and uppercase.\n  // Upper case makes sure keys will not interact with default prototypal\n  // methods: no method is uppercase.\n  .toLowerCase().toUpperCase();\n}", "/**\n * @import {Code} from 'micromark-util-types'\n */\n\n/**\n * Check whether the character code represents an ASCII alpha (`a` through `z`,\n * case insensitive).\n *\n * An **ASCII alpha** is an ASCII upper alpha or ASCII lower alpha.\n *\n * An **ASCII upper alpha** is a character in the inclusive range U+0041 (`A`)\n * to U+005A (`Z`).\n *\n * An **ASCII lower alpha** is a character in the inclusive range U+0061 (`a`)\n * to U+007A (`z`).\n *\n * @param code\n *   Code.\n * @returns {boolean}\n *   Whether it matches.\n */\nexport const asciiAlpha = regexCheck(/[A-Za-z]/);\n\n/**\n * Check whether the character code represents an ASCII alphanumeric (`a`\n * through `z`, case insensitive, or `0` through `9`).\n *\n * An **ASCII alphanumeric** is an ASCII digit (see `asciiDigit`) or ASCII alpha\n * (see `asciiAlpha`).\n *\n * @param code\n *   Code.\n * @returns {boolean}\n *   Whether it matches.\n */\nexport const asciiAlphanumeric = regexCheck(/[\\dA-Za-z]/);\n\n/**\n * Check whether the character code represents an ASCII atext.\n *\n * atext is an ASCII alphanumeric (see `asciiAlphanumeric`), or a character in\n * the inclusive ranges U+0023 NUMBER SIGN (`#`) to U+0027 APOSTROPHE (`'`),\n * U+002A ASTERISK (`*`), U+002B PLUS SIGN (`+`), U+002D DASH (`-`), U+002F\n * SLASH (`/`), U+003D EQUALS TO (`=`), U+003F QUESTION MARK (`?`), U+005E\n * CARET (`^`) to U+0060 GRAVE ACCENT (`` ` ``), or U+007B LEFT CURLY BRACE\n * (`{`) to U+007E TILDE (`~`).\n *\n * See:\n * **\\[RFC5322]**:\n * [Internet Message Format](https://tools.ietf.org/html/rfc5322).\n * P. Resnick.\n * IETF.\n *\n * @param code\n *   Code.\n * @returns {boolean}\n *   Whether it matches.\n */\nexport const asciiAtext = regexCheck(/[#-'*+\\--9=?A-Z^-~]/);\n\n/**\n * Check whether a character code is an ASCII control character.\n *\n * An **ASCII control** is a character in the inclusive range U+0000 NULL (NUL)\n * to U+001F (US), or U+007F (DEL).\n *\n * @param {Code} code\n *   Code.\n * @returns {boolean}\n *   Whether it matches.\n */\nexport function asciiControl(code) {\n  return (\n    // Special whitespace codes (which have negative values), C0 and Control\n    // character DEL\n    code !== null && (code < 32 || code === 127)\n  );\n}\n\n/**\n * Check whether the character code represents an ASCII digit (`0` through `9`).\n *\n * An **ASCII digit** is a character in the inclusive range U+0030 (`0`) to\n * U+0039 (`9`).\n *\n * @param code\n *   Code.\n * @returns {boolean}\n *   Whether it matches.\n */\nexport const asciiDigit = regexCheck(/\\d/);\n\n/**\n * Check whether the character code represents an ASCII hex digit (`a` through\n * `f`, case insensitive, or `0` through `9`).\n *\n * An **ASCII hex digit** is an ASCII digit (see `asciiDigit`), ASCII upper hex\n * digit, or an ASCII lower hex digit.\n *\n * An **ASCII upper hex digit** is a character in the inclusive range U+0041\n * (`A`) to U+0046 (`F`).\n *\n * An **ASCII lower hex digit** is a character in the inclusive range U+0061\n * (`a`) to U+0066 (`f`).\n *\n * @param code\n *   Code.\n * @returns {boolean}\n *   Whether it matches.\n */\nexport const asciiHexDigit = regexCheck(/[\\dA-Fa-f]/);\n\n/**\n * Check whether the character code represents ASCII punctuation.\n *\n * An **ASCII punctuation** is a character in the inclusive ranges U+0021\n * EXCLAMATION MARK (`!`) to U+002F SLASH (`/`), U+003A COLON (`:`) to U+0040 AT\n * SIGN (`@`), U+005B LEFT SQUARE BRACKET (`[`) to U+0060 GRAVE ACCENT\n * (`` ` ``), or U+007B LEFT CURLY BRACE (`{`) to U+007E TILDE (`~`).\n *\n * @param code\n *   Code.\n * @returns {boolean}\n *   Whether it matches.\n */\nexport const asciiPunctuation = regexCheck(/[!-/:-@[-`{-~]/);\n\n/**\n * Check whether a character code is a markdown line ending.\n *\n * A **markdown line ending** is the virtual characters M-0003 CARRIAGE RETURN\n * LINE FEED (CRLF), M-0004 LINE FEED (LF) and M-0005 CARRIAGE RETURN (CR).\n *\n * In micromark, the actual character U+000A LINE FEED (LF) and U+000D CARRIAGE\n * RETURN (CR) are replaced by these virtual characters depending on whether\n * they occurred together.\n *\n * @param {Code} code\n *   Code.\n * @returns {boolean}\n *   Whether it matches.\n */\nexport function markdownLineEnding(code) {\n  return code !== null && code < -2;\n}\n\n/**\n * Check whether a character code is a markdown line ending (see\n * `markdownLineEnding`) or markdown space (see `markdownSpace`).\n *\n * @param {Code} code\n *   Code.\n * @returns {boolean}\n *   Whether it matches.\n */\nexport function markdownLineEndingOrSpace(code) {\n  return code !== null && (code < 0 || code === 32);\n}\n\n/**\n * Check whether a character code is a markdown space.\n *\n * A **markdown space** is the concrete character U+0020 SPACE (SP) and the\n * virtual characters M-0001 VIRTUAL SPACE (VS) and M-0002 HORIZONTAL TAB (HT).\n *\n * In micromark, the actual character U+0009 CHARACTER TABULATION (HT) is\n * replaced by one M-0002 HORIZONTAL TAB (HT) and between 0 and 3 M-0001 VIRTUAL\n * SPACE (VS) characters, depending on the column at which the tab occurred.\n *\n * @param {Code} code\n *   Code.\n * @returns {boolean}\n *   Whether it matches.\n */\nexport function markdownSpace(code) {\n  return code === -2 || code === -1 || code === 32;\n}\n\n// Size note: removing ASCII from the regex and using `asciiPunctuation` here\n// In fact adds to the bundle size.\n/**\n * Check whether the character code represents Unicode punctuation.\n *\n * A **Unicode punctuation** is a character in the Unicode `Pc` (Punctuation,\n * Connector), `Pd` (Punctuation, Dash), `Pe` (Punctuation, Close), `Pf`\n * (Punctuation, Final quote), `Pi` (Punctuation, Initial quote), `Po`\n * (Punctuation, Other), or `Ps` (Punctuation, Open) categories, or an ASCII\n * punctuation (see `asciiPunctuation`).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n *   Code.\n * @returns\n *   Whether it matches.\n */\nexport const unicodePunctuation = regexCheck(/\\p{P}|\\p{S}/u);\n\n/**\n * Check whether the character code represents Unicode whitespace.\n *\n * Note that this does handle micromark specific markdown whitespace characters.\n * See `markdownLineEndingOrSpace` to check that.\n *\n * A **Unicode whitespace** is a character in the Unicode `Zs` (Separator,\n * Space) category, or U+0009 CHARACTER TABULATION (HT), U+000A LINE FEED (LF),\n * U+000C (FF), or U+000D CARRIAGE RETURN (CR) (**\\[UNICODE]**).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n *   Code.\n * @returns\n *   Whether it matches.\n */\nexport const unicodeWhitespace = regexCheck(/\\s/);\n\n/**\n * Create a code check from a regex.\n *\n * @param {RegExp} regex\n *   Expression.\n * @returns {(code: Code) => boolean}\n *   Check.\n */\nfunction regexCheck(regex) {\n  return check;\n\n  /**\n   * Check whether a code matches the bound regex.\n   *\n   * @param {Code} code\n   *   Character code.\n   * @returns {boolean}\n   *   Whether the character code matches the bound regex.\n   */\n  function check(code) {\n    return code !== null && code > -1 && regex.test(String.fromCharCode(code));\n  }\n}", "/**\n * @import {Effects, State, TokenType} from 'micromark-util-types'\n */\n\nimport { markdownSpace } from 'micromark-util-character';\n\n// To do: implement `spaceOrTab`, `spaceOrTabMinMax`, `spaceOrTabWithOptions`.\n\n/**\n * Parse spaces and tabs.\n *\n * There is no `nok` parameter:\n *\n * *   spaces in markdown are often optional, in which case this factory can be\n *     used and `ok` will be switched to whether spaces were found or not\n * *   one line ending or space can be detected with `markdownSpace(code)` right\n *     before using `factorySpace`\n *\n * ###### Examples\n *\n * Where `\u2409` represents a tab (plus how much it expands) and `\u2420` represents a\n * single space.\n *\n * ```markdown\n * \u2409\n * \u2420\u2420\u2420\u2420\n * \u2409\u2420\n * ```\n *\n * @param {Effects} effects\n *   Context.\n * @param {State} ok\n *   State switched to when successful.\n * @param {TokenType} type\n *   Type (`' \\t'`).\n * @param {number | undefined} [max=Infinity]\n *   Max (exclusive).\n * @returns {State}\n *   Start state.\n */\nexport function factorySpace(effects, ok, type, max) {\n  const limit = max ? max - 1 : Number.POSITIVE_INFINITY;\n  let size = 0;\n  return start;\n\n  /** @type {State} */\n  function start(code) {\n    if (markdownSpace(code)) {\n      effects.enter(type);\n      return prefix(code);\n    }\n    return ok(code);\n  }\n\n  /** @type {State} */\n  function prefix(code) {\n    if (markdownSpace(code) && size++ < limit) {\n      effects.consume(code);\n      return prefix;\n    }\n    effects.exit(type);\n    return ok(code);\n  }\n}", "/**\n * @import {\n *   InitialConstruct,\n *   Initializer,\n *   State,\n *   TokenizeContext,\n *   Token\n * } from 'micromark-util-types'\n */\n\nimport { factorySpace } from 'micromark-factory-space';\nimport { markdownLineEnding } from 'micromark-util-character';\n/** @type {InitialConstruct} */\nexport const content = {\n  tokenize: initializeContent\n};\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Initializer}\n *   Content.\n */\nfunction initializeContent(effects) {\n  const contentStart = effects.attempt(this.parser.constructs.contentInitial, afterContentStartConstruct, paragraphInitial);\n  /** @type {Token} */\n  let previous;\n  return contentStart;\n\n  /** @type {State} */\n  function afterContentStartConstruct(code) {\n    if (code === null) {\n      effects.consume(code);\n      return;\n    }\n    effects.enter(\"lineEnding\");\n    effects.consume(code);\n    effects.exit(\"lineEnding\");\n    return factorySpace(effects, contentStart, \"linePrefix\");\n  }\n\n  /** @type {State} */\n  function paragraphInitial(code) {\n    effects.enter(\"paragraph\");\n    return lineStart(code);\n  }\n\n  /** @type {State} */\n  function lineStart(code) {\n    const token = effects.enter(\"chunkText\", {\n      contentType: \"text\",\n      previous\n    });\n    if (previous) {\n      previous.next = token;\n    }\n    previous = token;\n    return data(code);\n  }\n\n  /** @type {State} */\n  function data(code) {\n    if (code === null) {\n      effects.exit(\"chunkText\");\n      effects.exit(\"paragraph\");\n      effects.consume(code);\n      return;\n    }\n    if (markdownLineEnding(code)) {\n      effects.consume(code);\n      effects.exit(\"chunkText\");\n      return lineStart;\n    }\n\n    // Data.\n    effects.consume(code);\n    return data;\n  }\n}", "/**\n * @import {\n *   Construct,\n *   ContainerState,\n *   InitialConstruct,\n *   Initializer,\n *   Point,\n *   State,\n *   TokenizeContext,\n *   Tokenizer,\n *   Token\n * } from 'micromark-util-types'\n */\n\n/**\n * @typedef {[Construct, ContainerState]} StackItem\n *   Construct and its state.\n */\n\nimport { factorySpace } from 'micromark-factory-space';\nimport { markdownLineEnding } from 'micromark-util-character';\nimport { splice } from 'micromark-util-chunked';\n/** @type {InitialConstruct} */\nexport const document = {\n  tokenize: initializeDocument\n};\n\n/** @type {Construct} */\nconst containerConstruct = {\n  tokenize: tokenizeContainer\n};\n\n/**\n * @this {TokenizeContext}\n *   Self.\n * @type {Initializer}\n *   Initializer.\n */\nfunction initializeDocument(effects) {\n  const self = this;\n  /** @type {Array<StackItem>} */\n  const stack = [];\n  let continued = 0;\n  /** @type {TokenizeContext | undefined} */\n  let childFlow;\n  /** @type {Token | undefined} */\n  let childToken;\n  /** @type {number} */\n  let lineStartOffset;\n  return start;\n\n  /** @type {State} */\n  function start(code) {\n    // First we iterate through the open blocks, starting with the root\n    // document, and descending through last children down to the last open\n    // block.\n    // Each block imposes a condition that the line must satisfy if the block is\n    // to remain open.\n    // For example, a block quote requires a `>` character.\n    // A paragraph requires a non-blank line.\n    // In this phase we may match all or just some of the open blocks.\n    // But we cannot close unmatched blocks yet, because we may have a lazy\n    // continuation line.\n    if (continued < stack.length) {\n      const item = stack[continued];\n      self.containerState = item[1];\n      return effects.attempt(item[0].continuation, documentContinue, checkNewContainers)(code);\n    }\n\n    // Done.\n    return checkNewContainers(code);\n  }\n\n  /** @type {State} */\n  function documentContinue(code) {\n    continued++;\n\n    // Note: this field is called `_closeFlow` but it also closes containers.\n    // Perhaps a good idea to rename it but it\u2019s already used in the wild by\n    // extensions.\n    if (self.containerState._closeFlow) {\n      self.containerState._closeFlow = undefined;\n      if (childFlow) {\n        closeFlow();\n      }\n\n      // Note: this algorithm for moving events around is similar to the\n      // algorithm when dealing with lazy lines in `writeToChild`.\n      const indexBeforeExits = self.events.length;\n      let indexBeforeFlow = indexBeforeExits;\n      /** @type {Point | undefined} */\n      let point;\n\n      // Find the flow chunk.\n      while (indexBeforeFlow--) {\n        if (self.events[indexBeforeFlow][0] === 'exit' && self.events[indexBeforeFlow][1].type === \"chunkFlow\") {\n          point = self.events[indexBeforeFlow][1].end;\n          break;\n        }\n      }\n      exitContainers(continued);\n\n      // Fix positions.\n      let index = indexBeforeExits;\n      while (index < self.events.length) {\n        self.events[index][1].end = {\n          ...point\n        };\n        index++;\n      }\n\n      // Inject the exits earlier (they\u2019re still also at the end).\n      splice(self.events, indexBeforeFlow + 1, 0, self.events.slice(indexBeforeExits));\n\n      // Discard the duplicate exits.\n      self.events.length = index;\n      return checkNewContainers(code);\n    }\n    return start(code);\n  }\n\n  /** @type {State} */\n  function checkNewContainers(code) {\n    // Next, after consuming the continuation markers for existing blocks, we\n    // look for new block starts (e.g. `>` for a block quote).\n    // If we encounter a new block start, we close any blocks unmatched in\n    // step 1 before creating the new block as a child of the last matched\n    // block.\n    if (continued === stack.length) {\n      // No need to `check` whether there\u2019s a container, of `exitContainers`\n      // would be moot.\n      // We can instead immediately `attempt` to parse one.\n      if (!childFlow) {\n        return documentContinued(code);\n      }\n\n      // If we have concrete content, such as block HTML or fenced code,\n      // we can\u2019t have containers \u201Cpierce\u201D into them, so we can immediately\n      // start.\n      if (childFlow.currentConstruct && childFlow.currentConstruct.concrete) {\n        return flowStart(code);\n      }\n\n      // If we do have flow, it could still be a blank line,\n      // but we\u2019d be interrupting it w/ a new container if there\u2019s a current\n      // construct.\n      // To do: next major: remove `_gfmTableDynamicInterruptHack` (no longer\n      // needed in micromark-extension-gfm-table@1.0.6).\n      self.interrupt = Boolean(childFlow.currentConstruct && !childFlow._gfmTableDynamicInterruptHack);\n    }\n\n    // Check if there is a new container.\n    self.containerState = {};\n    return effects.check(containerConstruct, thereIsANewContainer, thereIsNoNewContainer)(code);\n  }\n\n  /** @type {State} */\n  function thereIsANewContainer(code) {\n    if (childFlow) closeFlow();\n    exitContainers(continued);\n    return documentContinued(code);\n  }\n\n  /** @type {State} */\n  function thereIsNoNewContainer(code) {\n    self.parser.lazy[self.now().line] = continued !== stack.length;\n    lineStartOffset = self.now().offset;\n    return flowStart(code);\n  }\n\n  /** @type {State} */\n  function documentContinued(code) {\n    // Try new containers.\n    self.containerState = {};\n    return effects.attempt(containerConstruct, containerContinue, flowStart)(code);\n  }\n\n  /** @type {State} */\n  function containerContinue(code) {\n    continued++;\n    stack.push([self.currentConstruct, self.containerState]);\n    // Try another.\n    return documentContinued(code);\n  }\n\n  /** @type {State} */\n  function flowStart(code) {\n    if (code === null) {\n      if (childFlow) closeFlow();\n      exitContainers(0);\n      effects.consume(code);\n      return;\n    }\n    childFlow = childFlow || self.parser.flow(self.now());\n    effects.enter(\"chunkFlow\", {\n      _tokenizer: childFlow,\n      contentType: \"flow\",\n      previous: childToken\n    });\n    return flowContinue(code);\n  }\n\n  /** @type {State} */\n  function flowContinue(code) {\n    if (code === null) {\n      writeToChild(effects.exit(\"chunkFlow\"), true);\n      exitContainers(0);\n      effects.consume(code);\n      return;\n    }\n    if (markdownLineEnding(code)) {\n      effects.consume(code);\n      writeToChild(effects.exit(\"chunkFlow\"));\n      // Get ready for the next line.\n      continued = 0;\n      self.interrupt = undefined;\n      return start;\n    }\n    effects.consume(code);\n    return flowContinue;\n  }\n\n  /**\n   * @param {Token} token\n   *   Token.\n   * @param {boolean | undefined} [endOfFile]\n   *   Whether the token is at the end of the file (default: `false`).\n   * @returns {undefined}\n   *   Nothing.\n   */\n  function writeToChild(token, endOfFile) {\n    const stream = self.sliceStream(token);\n    if (endOfFile) stream.push(null);\n    token.previous = childToken;\n    if (childToken) childToken.next = token;\n    childToken = token;\n    childFlow.defineSkip(token.start);\n    childFlow.write(stream);\n\n    // Alright, so we just added a lazy line:\n    //\n    // ```markdown\n    // > a\n    // b.\n    //\n    // Or:\n    //\n    // > ~~~c\n    // d\n    //\n    // Or:\n    //\n    // > | e |\n    // f\n    // ```\n    //\n    // The construct in the second example (fenced code) does not accept lazy\n    // lines, so it marked itself as done at the end of its first line, and\n    // then the content construct parses `d`.\n    // Most constructs in markdown match on the first line: if the first line\n    // forms a construct, a non-lazy line can\u2019t \u201Cunmake\u201D it.\n    //\n    // The construct in the third example is potentially a GFM table, and\n    // those are *weird*.\n    // It *could* be a table, from the first line, if the following line\n    // matches a condition.\n    // In this case, that second line is lazy, which \u201Cunmakes\u201D the first line\n    // and turns the whole into one content block.\n    //\n    // We\u2019ve now parsed the non-lazy and the lazy line, and can figure out\n    // whether the lazy line started a new flow block.\n    // If it did, we exit the current containers between the two flow blocks.\n    if (self.parser.lazy[token.start.line]) {\n      let index = childFlow.events.length;\n      while (index--) {\n        if (\n        // The token starts before the line ending\u2026\n        childFlow.events[index][1].start.offset < lineStartOffset && (\n        // \u2026and either is not ended yet\u2026\n        !childFlow.events[index][1].end ||\n        // \u2026or ends after it.\n        childFlow.events[index][1].end.offset > lineStartOffset)) {\n          // Exit: there\u2019s still something open, which means it\u2019s a lazy line\n          // part of something.\n          return;\n        }\n      }\n\n      // Note: this algorithm for moving events around is similar to the\n      // algorithm when closing flow in `documentContinue`.\n      const indexBeforeExits = self.events.length;\n      let indexBeforeFlow = indexBeforeExits;\n      /** @type {boolean | undefined} */\n      let seen;\n      /** @type {Point | undefined} */\n      let point;\n\n      // Find the previous chunk (the one before the lazy line).\n      while (indexBeforeFlow--) {\n        if (self.events[indexBeforeFlow][0] === 'exit' && self.events[indexBeforeFlow][1].type === \"chunkFlow\") {\n          if (seen) {\n            point = self.events[indexBeforeFlow][1].end;\n            break;\n          }\n          seen = true;\n        }\n      }\n      exitContainers(continued);\n\n      // Fix positions.\n      index = indexBeforeExits;\n      while (index < self.events.length) {\n        self.events[index][1].end = {\n          ...point\n        };\n        index++;\n      }\n\n      // Inject the exits earlier (they\u2019re still also at the end).\n      splice(self.events, indexBeforeFlow + 1, 0, self.events.slice(indexBeforeExits));\n\n      // Discard the duplicate exits.\n      self.events.length = index;\n    }\n  }\n\n  /**\n   * @param {number} size\n   *   Size.\n   * @returns {undefined}\n   *   Nothing.\n   */\n  function exitContainers(size) {\n    let index = stack.length;\n\n    // Exit open containers.\n    while (index-- > size) {\n      const entry = stack[index];\n      self.containerState = entry[1];\n      entry[0].exit.call(self, effects);\n    }\n    stack.length = size;\n  }\n  function closeFlow() {\n    childFlow.write([null]);\n    childToken = undefined;\n    childFlow = undefined;\n    self.containerState._closeFlow = undefined;\n  }\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n *   Tokenizer.\n */\nfunction tokenizeContainer(effects, ok, nok) {\n  // Always populated by defaults.\n\n  return factorySpace(effects, effects.attempt(this.parser.constructs.document, ok, nok), \"linePrefix\", this.parser.constructs.disable.null.includes('codeIndented') ? undefined : 4);\n}", "/**\n * @import {Code} from 'micromark-util-types'\n */\n\nimport { markdownLineEndingOrSpace, unicodePunctuation, unicodeWhitespace } from 'micromark-util-character';\n/**\n * Classify whether a code represents whitespace, punctuation, or something\n * else.\n *\n * Used for attention (emphasis, strong), whose sequences can open or close\n * based on the class of surrounding characters.\n *\n * > \uD83D\uDC49 **Note**: eof (`null`) is seen as whitespace.\n *\n * @param {Code} code\n *   Code.\n * @returns {typeof constants.characterGroupWhitespace | typeof constants.characterGroupPunctuation | undefined}\n *   Group.\n */\nexport function classifyCharacter(code) {\n  if (code === null || markdownLineEndingOrSpace(code) || unicodeWhitespace(code)) {\n    return 1;\n  }\n  if (unicodePunctuation(code)) {\n    return 2;\n  }\n}", "/**\n * @import {Event, Resolver, TokenizeContext} from 'micromark-util-types'\n */\n\n/**\n * Call all `resolveAll`s.\n *\n * @param {ReadonlyArray<{resolveAll?: Resolver | undefined}>} constructs\n *   List of constructs, optionally with `resolveAll`s.\n * @param {Array<Event>} events\n *   List of events.\n * @param {TokenizeContext} context\n *   Context used by `tokenize`.\n * @returns {Array<Event>}\n *   Changed events.\n */\nexport function resolveAll(constructs, events, context) {\n  /** @type {Array<Resolver>} */\n  const called = []\n  let index = -1\n\n  while (++index < constructs.length) {\n    const resolve = constructs[index].resolveAll\n\n    if (resolve && !called.includes(resolve)) {\n      events = resolve(events, context)\n      called.push(resolve)\n    }\n  }\n\n  return events\n}\n", "/**\n * @import {\n *   Code,\n *   Construct,\n *   Event,\n *   Point,\n *   Resolver,\n *   State,\n *   TokenizeContext,\n *   Tokenizer,\n *   Token\n * } from 'micromark-util-types'\n */\n\nimport { push, splice } from 'micromark-util-chunked';\nimport { classifyCharacter } from 'micromark-util-classify-character';\nimport { resolveAll } from 'micromark-util-resolve-all';\n/** @type {Construct} */\nexport const attention = {\n  name: 'attention',\n  resolveAll: resolveAllAttention,\n  tokenize: tokenizeAttention\n};\n\n/**\n * Take all events and resolve attention to emphasis or strong.\n *\n * @type {Resolver}\n */\n// eslint-disable-next-line complexity\nfunction resolveAllAttention(events, context) {\n  let index = -1;\n  /** @type {number} */\n  let open;\n  /** @type {Token} */\n  let group;\n  /** @type {Token} */\n  let text;\n  /** @type {Token} */\n  let openingSequence;\n  /** @type {Token} */\n  let closingSequence;\n  /** @type {number} */\n  let use;\n  /** @type {Array<Event>} */\n  let nextEvents;\n  /** @type {number} */\n  let offset;\n\n  // Walk through all events.\n  //\n  // Note: performance of this is fine on an mb of normal markdown, but it\u2019s\n  // a bottleneck for malicious stuff.\n  while (++index < events.length) {\n    // Find a token that can close.\n    if (events[index][0] === 'enter' && events[index][1].type === 'attentionSequence' && events[index][1]._close) {\n      open = index;\n\n      // Now walk back to find an opener.\n      while (open--) {\n        // Find a token that can open the closer.\n        if (events[open][0] === 'exit' && events[open][1].type === 'attentionSequence' && events[open][1]._open &&\n        // If the markers are the same:\n        context.sliceSerialize(events[open][1]).charCodeAt(0) === context.sliceSerialize(events[index][1]).charCodeAt(0)) {\n          // If the opening can close or the closing can open,\n          // and the close size *is not* a multiple of three,\n          // but the sum of the opening and closing size *is* multiple of three,\n          // then don\u2019t match.\n          if ((events[open][1]._close || events[index][1]._open) && (events[index][1].end.offset - events[index][1].start.offset) % 3 && !((events[open][1].end.offset - events[open][1].start.offset + events[index][1].end.offset - events[index][1].start.offset) % 3)) {\n            continue;\n          }\n\n          // Number of markers to use from the sequence.\n          use = events[open][1].end.offset - events[open][1].start.offset > 1 && events[index][1].end.offset - events[index][1].start.offset > 1 ? 2 : 1;\n          const start = {\n            ...events[open][1].end\n          };\n          const end = {\n            ...events[index][1].start\n          };\n          movePoint(start, -use);\n          movePoint(end, use);\n          openingSequence = {\n            type: use > 1 ? \"strongSequence\" : \"emphasisSequence\",\n            start,\n            end: {\n              ...events[open][1].end\n            }\n          };\n          closingSequence = {\n            type: use > 1 ? \"strongSequence\" : \"emphasisSequence\",\n            start: {\n              ...events[index][1].start\n            },\n            end\n          };\n          text = {\n            type: use > 1 ? \"strongText\" : \"emphasisText\",\n            start: {\n              ...events[open][1].end\n            },\n            end: {\n              ...events[index][1].start\n            }\n          };\n          group = {\n            type: use > 1 ? \"strong\" : \"emphasis\",\n            start: {\n              ...openingSequence.start\n            },\n            end: {\n              ...closingSequence.end\n            }\n          };\n          events[open][1].end = {\n            ...openingSequence.start\n          };\n          events[index][1].start = {\n            ...closingSequence.end\n          };\n          nextEvents = [];\n\n          // If there are more markers in the opening, add them before.\n          if (events[open][1].end.offset - events[open][1].start.offset) {\n            nextEvents = push(nextEvents, [['enter', events[open][1], context], ['exit', events[open][1], context]]);\n          }\n\n          // Opening.\n          nextEvents = push(nextEvents, [['enter', group, context], ['enter', openingSequence, context], ['exit', openingSequence, context], ['enter', text, context]]);\n\n          // Always populated by defaults.\n\n          // Between.\n          nextEvents = push(nextEvents, resolveAll(context.parser.constructs.insideSpan.null, events.slice(open + 1, index), context));\n\n          // Closing.\n          nextEvents = push(nextEvents, [['exit', text, context], ['enter', closingSequence, context], ['exit', closingSequence, context], ['exit', group, context]]);\n\n          // If there are more markers in the closing, add them after.\n          if (events[index][1].end.offset - events[index][1].start.offset) {\n            offset = 2;\n            nextEvents = push(nextEvents, [['enter', events[index][1], context], ['exit', events[index][1], context]]);\n          } else {\n            offset = 0;\n          }\n          splice(events, open - 1, index - open + 3, nextEvents);\n          index = open + nextEvents.length - offset - 2;\n          break;\n        }\n      }\n    }\n  }\n\n  // Remove remaining sequences.\n  index = -1;\n  while (++index < events.length) {\n    if (events[index][1].type === 'attentionSequence') {\n      events[index][1].type = 'data';\n    }\n  }\n  return events;\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeAttention(effects, ok) {\n  const attentionMarkers = this.parser.constructs.attentionMarkers.null;\n  const previous = this.previous;\n  const before = classifyCharacter(previous);\n\n  /** @type {NonNullable<Code>} */\n  let marker;\n  return start;\n\n  /**\n   * Before a sequence.\n   *\n   * ```markdown\n   * > | **\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    marker = code;\n    effects.enter('attentionSequence');\n    return inside(code);\n  }\n\n  /**\n   * In a sequence.\n   *\n   * ```markdown\n   * > | **\n   *     ^^\n   * ```\n   *\n   * @type {State}\n   */\n  function inside(code) {\n    if (code === marker) {\n      effects.consume(code);\n      return inside;\n    }\n    const token = effects.exit('attentionSequence');\n\n    // To do: next major: move this to resolver, just like `markdown-rs`.\n    const after = classifyCharacter(code);\n\n    // Always populated by defaults.\n\n    const open = !after || after === 2 && before || attentionMarkers.includes(code);\n    const close = !before || before === 2 && after || attentionMarkers.includes(previous);\n    token._open = Boolean(marker === 42 ? open : open && (before || !close));\n    token._close = Boolean(marker === 42 ? close : close && (after || !open));\n    return ok(code);\n  }\n}\n\n/**\n * Move a point a bit.\n *\n * Note: `move` only works inside lines! It\u2019s not possible to move past other\n * chunks (replacement characters, tabs, or line endings).\n *\n * @param {Point} point\n *   Point.\n * @param {number} offset\n *   Amount to move.\n * @returns {undefined}\n *   Nothing.\n */\nfunction movePoint(point, offset) {\n  point.column += offset;\n  point.offset += offset;\n  point._bufferIndex += offset;\n}", "/**\n * @import {\n *   Construct,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { asciiAlphanumeric, asciiAlpha, asciiAtext, asciiControl } from 'micromark-util-character';\n/** @type {Construct} */\nexport const autolink = {\n  name: 'autolink',\n  tokenize: tokenizeAutolink\n};\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeAutolink(effects, ok, nok) {\n  let size = 0;\n  return start;\n\n  /**\n   * Start of an autolink.\n   *\n   * ```markdown\n   * > | a<https://example.com>b\n   *      ^\n   * > | a<user@example.com>b\n   *      ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    effects.enter(\"autolink\");\n    effects.enter(\"autolinkMarker\");\n    effects.consume(code);\n    effects.exit(\"autolinkMarker\");\n    effects.enter(\"autolinkProtocol\");\n    return open;\n  }\n\n  /**\n   * After `<`, at protocol or atext.\n   *\n   * ```markdown\n   * > | a<https://example.com>b\n   *       ^\n   * > | a<user@example.com>b\n   *       ^\n   * ```\n   *\n   * @type {State}\n   */\n  function open(code) {\n    if (asciiAlpha(code)) {\n      effects.consume(code);\n      return schemeOrEmailAtext;\n    }\n    if (code === 64) {\n      return nok(code);\n    }\n    return emailAtext(code);\n  }\n\n  /**\n   * At second byte of protocol or atext.\n   *\n   * ```markdown\n   * > | a<https://example.com>b\n   *        ^\n   * > | a<user@example.com>b\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function schemeOrEmailAtext(code) {\n    // ASCII alphanumeric and `+`, `-`, and `.`.\n    if (code === 43 || code === 45 || code === 46 || asciiAlphanumeric(code)) {\n      // Count the previous alphabetical from `open` too.\n      size = 1;\n      return schemeInsideOrEmailAtext(code);\n    }\n    return emailAtext(code);\n  }\n\n  /**\n   * In ambiguous protocol or atext.\n   *\n   * ```markdown\n   * > | a<https://example.com>b\n   *        ^\n   * > | a<user@example.com>b\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function schemeInsideOrEmailAtext(code) {\n    if (code === 58) {\n      effects.consume(code);\n      size = 0;\n      return urlInside;\n    }\n\n    // ASCII alphanumeric and `+`, `-`, and `.`.\n    if ((code === 43 || code === 45 || code === 46 || asciiAlphanumeric(code)) && size++ < 32) {\n      effects.consume(code);\n      return schemeInsideOrEmailAtext;\n    }\n    size = 0;\n    return emailAtext(code);\n  }\n\n  /**\n   * After protocol, in URL.\n   *\n   * ```markdown\n   * > | a<https://example.com>b\n   *             ^\n   * ```\n   *\n   * @type {State}\n   */\n  function urlInside(code) {\n    if (code === 62) {\n      effects.exit(\"autolinkProtocol\");\n      effects.enter(\"autolinkMarker\");\n      effects.consume(code);\n      effects.exit(\"autolinkMarker\");\n      effects.exit(\"autolink\");\n      return ok;\n    }\n\n    // ASCII control, space, or `<`.\n    if (code === null || code === 32 || code === 60 || asciiControl(code)) {\n      return nok(code);\n    }\n    effects.consume(code);\n    return urlInside;\n  }\n\n  /**\n   * In email atext.\n   *\n   * ```markdown\n   * > | a<user.name@example.com>b\n   *              ^\n   * ```\n   *\n   * @type {State}\n   */\n  function emailAtext(code) {\n    if (code === 64) {\n      effects.consume(code);\n      return emailAtSignOrDot;\n    }\n    if (asciiAtext(code)) {\n      effects.consume(code);\n      return emailAtext;\n    }\n    return nok(code);\n  }\n\n  /**\n   * In label, after at-sign or dot.\n   *\n   * ```markdown\n   * > | a<user.name@example.com>b\n   *                 ^       ^\n   * ```\n   *\n   * @type {State}\n   */\n  function emailAtSignOrDot(code) {\n    return asciiAlphanumeric(code) ? emailLabel(code) : nok(code);\n  }\n\n  /**\n   * In label, where `.` and `>` are allowed.\n   *\n   * ```markdown\n   * > | a<user.name@example.com>b\n   *                   ^\n   * ```\n   *\n   * @type {State}\n   */\n  function emailLabel(code) {\n    if (code === 46) {\n      effects.consume(code);\n      size = 0;\n      return emailAtSignOrDot;\n    }\n    if (code === 62) {\n      // Exit, then change the token type.\n      effects.exit(\"autolinkProtocol\").type = \"autolinkEmail\";\n      effects.enter(\"autolinkMarker\");\n      effects.consume(code);\n      effects.exit(\"autolinkMarker\");\n      effects.exit(\"autolink\");\n      return ok;\n    }\n    return emailValue(code);\n  }\n\n  /**\n   * In label, where `.` and `>` are *not* allowed.\n   *\n   * Though, this is also used in `emailLabel` to parse other values.\n   *\n   * ```markdown\n   * > | a<user.name@ex-ample.com>b\n   *                    ^\n   * ```\n   *\n   * @type {State}\n   */\n  function emailValue(code) {\n    // ASCII alphanumeric or `-`.\n    if ((code === 45 || asciiAlphanumeric(code)) && size++ < 63) {\n      const next = code === 45 ? emailValue : emailLabel;\n      effects.consume(code);\n      return next;\n    }\n    return nok(code);\n  }\n}", "/**\n * @import {\n *   Construct,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { factorySpace } from 'micromark-factory-space';\nimport { markdownLineEnding, markdownSpace } from 'micromark-util-character';\n/** @type {Construct} */\nexport const blankLine = {\n  partial: true,\n  tokenize: tokenizeBlankLine\n};\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeBlankLine(effects, ok, nok) {\n  return start;\n\n  /**\n   * Start of blank line.\n   *\n   * > \uD83D\uDC49 **Note**: `\u2420` represents a space character.\n   *\n   * ```markdown\n   * > | \u2420\u2420\u240A\n   *     ^\n   * > | \u240A\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    return markdownSpace(code) ? factorySpace(effects, after, \"linePrefix\")(code) : after(code);\n  }\n\n  /**\n   * At eof/eol, after optional whitespace.\n   *\n   * > \uD83D\uDC49 **Note**: `\u2420` represents a space character.\n   *\n   * ```markdown\n   * > | \u2420\u2420\u240A\n   *       ^\n   * > | \u240A\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function after(code) {\n    return code === null || markdownLineEnding(code) ? ok(code) : nok(code);\n  }\n}", "/**\n * @import {\n *   Construct,\n *   Exiter,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { factorySpace } from 'micromark-factory-space';\nimport { markdownSpace } from 'micromark-util-character';\n/** @type {Construct} */\nexport const blockQuote = {\n  continuation: {\n    tokenize: tokenizeBlockQuoteContinuation\n  },\n  exit,\n  name: 'blockQuote',\n  tokenize: tokenizeBlockQuoteStart\n};\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeBlockQuoteStart(effects, ok, nok) {\n  const self = this;\n  return start;\n\n  /**\n   * Start of block quote.\n   *\n   * ```markdown\n   * > | > a\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    if (code === 62) {\n      const state = self.containerState;\n      if (!state.open) {\n        effects.enter(\"blockQuote\", {\n          _container: true\n        });\n        state.open = true;\n      }\n      effects.enter(\"blockQuotePrefix\");\n      effects.enter(\"blockQuoteMarker\");\n      effects.consume(code);\n      effects.exit(\"blockQuoteMarker\");\n      return after;\n    }\n    return nok(code);\n  }\n\n  /**\n   * After `>`, before optional whitespace.\n   *\n   * ```markdown\n   * > | > a\n   *      ^\n   * ```\n   *\n   * @type {State}\n   */\n  function after(code) {\n    if (markdownSpace(code)) {\n      effects.enter(\"blockQuotePrefixWhitespace\");\n      effects.consume(code);\n      effects.exit(\"blockQuotePrefixWhitespace\");\n      effects.exit(\"blockQuotePrefix\");\n      return ok;\n    }\n    effects.exit(\"blockQuotePrefix\");\n    return ok(code);\n  }\n}\n\n/**\n * Start of block quote continuation.\n *\n * ```markdown\n *   | > a\n * > | > b\n *     ^\n * ```\n *\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeBlockQuoteContinuation(effects, ok, nok) {\n  const self = this;\n  return contStart;\n\n  /**\n   * Start of block quote continuation.\n   *\n   * Also used to parse the first block quote opening.\n   *\n   * ```markdown\n   *   | > a\n   * > | > b\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function contStart(code) {\n    if (markdownSpace(code)) {\n      // Always populated by defaults.\n\n      return factorySpace(effects, contBefore, \"linePrefix\", self.parser.constructs.disable.null.includes('codeIndented') ? undefined : 4)(code);\n    }\n    return contBefore(code);\n  }\n\n  /**\n   * At `>`, after optional whitespace.\n   *\n   * Also used to parse the first block quote opening.\n   *\n   * ```markdown\n   *   | > a\n   * > | > b\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function contBefore(code) {\n    return effects.attempt(blockQuote, ok, nok)(code);\n  }\n}\n\n/** @type {Exiter} */\nfunction exit(effects) {\n  effects.exit(\"blockQuote\");\n}", "/**\n * @import {\n *   Construct,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { asciiPunctuation } from 'micromark-util-character';\n/** @type {Construct} */\nexport const characterEscape = {\n  name: 'characterEscape',\n  tokenize: tokenizeCharacterEscape\n};\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeCharacterEscape(effects, ok, nok) {\n  return start;\n\n  /**\n   * Start of character escape.\n   *\n   * ```markdown\n   * > | a\\*b\n   *      ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    effects.enter(\"characterEscape\");\n    effects.enter(\"escapeMarker\");\n    effects.consume(code);\n    effects.exit(\"escapeMarker\");\n    return inside;\n  }\n\n  /**\n   * After `\\`, at punctuation.\n   *\n   * ```markdown\n   * > | a\\*b\n   *       ^\n   * ```\n   *\n   * @type {State}\n   */\n  function inside(code) {\n    // ASCII punctuation.\n    if (asciiPunctuation(code)) {\n      effects.enter(\"characterEscapeValue\");\n      effects.consume(code);\n      effects.exit(\"characterEscapeValue\");\n      effects.exit(\"characterEscape\");\n      return ok;\n    }\n    return nok(code);\n  }\n}", "/**\n * @import {\n *   Code,\n *   Construct,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { decodeNamedCharacterReference } from 'decode-named-character-reference';\nimport { asciiAlphanumeric, asciiDigit, asciiHexDigit } from 'micromark-util-character';\n/** @type {Construct} */\nexport const characterReference = {\n  name: 'characterReference',\n  tokenize: tokenizeCharacterReference\n};\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeCharacterReference(effects, ok, nok) {\n  const self = this;\n  let size = 0;\n  /** @type {number} */\n  let max;\n  /** @type {(code: Code) => boolean} */\n  let test;\n  return start;\n\n  /**\n   * Start of character reference.\n   *\n   * ```markdown\n   * > | a&amp;b\n   *      ^\n   * > | a&#123;b\n   *      ^\n   * > | a&#x9;b\n   *      ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    effects.enter(\"characterReference\");\n    effects.enter(\"characterReferenceMarker\");\n    effects.consume(code);\n    effects.exit(\"characterReferenceMarker\");\n    return open;\n  }\n\n  /**\n   * After `&`, at `#` for numeric references or alphanumeric for named\n   * references.\n   *\n   * ```markdown\n   * > | a&amp;b\n   *       ^\n   * > | a&#123;b\n   *       ^\n   * > | a&#x9;b\n   *       ^\n   * ```\n   *\n   * @type {State}\n   */\n  function open(code) {\n    if (code === 35) {\n      effects.enter(\"characterReferenceMarkerNumeric\");\n      effects.consume(code);\n      effects.exit(\"characterReferenceMarkerNumeric\");\n      return numeric;\n    }\n    effects.enter(\"characterReferenceValue\");\n    max = 31;\n    test = asciiAlphanumeric;\n    return value(code);\n  }\n\n  /**\n   * After `#`, at `x` for hexadecimals or digit for decimals.\n   *\n   * ```markdown\n   * > | a&#123;b\n   *        ^\n   * > | a&#x9;b\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function numeric(code) {\n    if (code === 88 || code === 120) {\n      effects.enter(\"characterReferenceMarkerHexadecimal\");\n      effects.consume(code);\n      effects.exit(\"characterReferenceMarkerHexadecimal\");\n      effects.enter(\"characterReferenceValue\");\n      max = 6;\n      test = asciiHexDigit;\n      return value;\n    }\n    effects.enter(\"characterReferenceValue\");\n    max = 7;\n    test = asciiDigit;\n    return value(code);\n  }\n\n  /**\n   * After markers (`&#x`, `&#`, or `&`), in value, before `;`.\n   *\n   * The character reference kind defines what and how many characters are\n   * allowed.\n   *\n   * ```markdown\n   * > | a&amp;b\n   *       ^^^\n   * > | a&#123;b\n   *        ^^^\n   * > | a&#x9;b\n   *         ^\n   * ```\n   *\n   * @type {State}\n   */\n  function value(code) {\n    if (code === 59 && size) {\n      const token = effects.exit(\"characterReferenceValue\");\n      if (test === asciiAlphanumeric && !decodeNamedCharacterReference(self.sliceSerialize(token))) {\n        return nok(code);\n      }\n\n      // To do: `markdown-rs` uses a different name:\n      // `CharacterReferenceMarkerSemi`.\n      effects.enter(\"characterReferenceMarker\");\n      effects.consume(code);\n      effects.exit(\"characterReferenceMarker\");\n      effects.exit(\"characterReference\");\n      return ok;\n    }\n    if (test(code) && size++ < max) {\n      effects.consume(code);\n      return value;\n    }\n    return nok(code);\n  }\n}", "/**\n * @import {\n *   Code,\n *   Construct,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { factorySpace } from 'micromark-factory-space';\nimport { markdownLineEnding, markdownSpace } from 'micromark-util-character';\n/** @type {Construct} */\nconst nonLazyContinuation = {\n  partial: true,\n  tokenize: tokenizeNonLazyContinuation\n};\n\n/** @type {Construct} */\nexport const codeFenced = {\n  concrete: true,\n  name: 'codeFenced',\n  tokenize: tokenizeCodeFenced\n};\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeCodeFenced(effects, ok, nok) {\n  const self = this;\n  /** @type {Construct} */\n  const closeStart = {\n    partial: true,\n    tokenize: tokenizeCloseStart\n  };\n  let initialPrefix = 0;\n  let sizeOpen = 0;\n  /** @type {NonNullable<Code>} */\n  let marker;\n  return start;\n\n  /**\n   * Start of code.\n   *\n   * ```markdown\n   * > | ~~~js\n   *     ^\n   *   | alert(1)\n   *   | ~~~\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    // To do: parse whitespace like `markdown-rs`.\n    return beforeSequenceOpen(code);\n  }\n\n  /**\n   * In opening fence, after prefix, at sequence.\n   *\n   * ```markdown\n   * > | ~~~js\n   *     ^\n   *   | alert(1)\n   *   | ~~~\n   * ```\n   *\n   * @type {State}\n   */\n  function beforeSequenceOpen(code) {\n    const tail = self.events[self.events.length - 1];\n    initialPrefix = tail && tail[1].type === \"linePrefix\" ? tail[2].sliceSerialize(tail[1], true).length : 0;\n    marker = code;\n    effects.enter(\"codeFenced\");\n    effects.enter(\"codeFencedFence\");\n    effects.enter(\"codeFencedFenceSequence\");\n    return sequenceOpen(code);\n  }\n\n  /**\n   * In opening fence sequence.\n   *\n   * ```markdown\n   * > | ~~~js\n   *      ^\n   *   | alert(1)\n   *   | ~~~\n   * ```\n   *\n   * @type {State}\n   */\n  function sequenceOpen(code) {\n    if (code === marker) {\n      sizeOpen++;\n      effects.consume(code);\n      return sequenceOpen;\n    }\n    if (sizeOpen < 3) {\n      return nok(code);\n    }\n    effects.exit(\"codeFencedFenceSequence\");\n    return markdownSpace(code) ? factorySpace(effects, infoBefore, \"whitespace\")(code) : infoBefore(code);\n  }\n\n  /**\n   * In opening fence, after the sequence (and optional whitespace), before info.\n   *\n   * ```markdown\n   * > | ~~~js\n   *        ^\n   *   | alert(1)\n   *   | ~~~\n   * ```\n   *\n   * @type {State}\n   */\n  function infoBefore(code) {\n    if (code === null || markdownLineEnding(code)) {\n      effects.exit(\"codeFencedFence\");\n      return self.interrupt ? ok(code) : effects.check(nonLazyContinuation, atNonLazyBreak, after)(code);\n    }\n    effects.enter(\"codeFencedFenceInfo\");\n    effects.enter(\"chunkString\", {\n      contentType: \"string\"\n    });\n    return info(code);\n  }\n\n  /**\n   * In info.\n   *\n   * ```markdown\n   * > | ~~~js\n   *        ^\n   *   | alert(1)\n   *   | ~~~\n   * ```\n   *\n   * @type {State}\n   */\n  function info(code) {\n    if (code === null || markdownLineEnding(code)) {\n      effects.exit(\"chunkString\");\n      effects.exit(\"codeFencedFenceInfo\");\n      return infoBefore(code);\n    }\n    if (markdownSpace(code)) {\n      effects.exit(\"chunkString\");\n      effects.exit(\"codeFencedFenceInfo\");\n      return factorySpace(effects, metaBefore, \"whitespace\")(code);\n    }\n    if (code === 96 && code === marker) {\n      return nok(code);\n    }\n    effects.consume(code);\n    return info;\n  }\n\n  /**\n   * In opening fence, after info and whitespace, before meta.\n   *\n   * ```markdown\n   * > | ~~~js eval\n   *           ^\n   *   | alert(1)\n   *   | ~~~\n   * ```\n   *\n   * @type {State}\n   */\n  function metaBefore(code) {\n    if (code === null || markdownLineEnding(code)) {\n      return infoBefore(code);\n    }\n    effects.enter(\"codeFencedFenceMeta\");\n    effects.enter(\"chunkString\", {\n      contentType: \"string\"\n    });\n    return meta(code);\n  }\n\n  /**\n   * In meta.\n   *\n   * ```markdown\n   * > | ~~~js eval\n   *           ^\n   *   | alert(1)\n   *   | ~~~\n   * ```\n   *\n   * @type {State}\n   */\n  function meta(code) {\n    if (code === null || markdownLineEnding(code)) {\n      effects.exit(\"chunkString\");\n      effects.exit(\"codeFencedFenceMeta\");\n      return infoBefore(code);\n    }\n    if (code === 96 && code === marker) {\n      return nok(code);\n    }\n    effects.consume(code);\n    return meta;\n  }\n\n  /**\n   * At eol/eof in code, before a non-lazy closing fence or content.\n   *\n   * ```markdown\n   * > | ~~~js\n   *          ^\n   * > | alert(1)\n   *             ^\n   *   | ~~~\n   * ```\n   *\n   * @type {State}\n   */\n  function atNonLazyBreak(code) {\n    return effects.attempt(closeStart, after, contentBefore)(code);\n  }\n\n  /**\n   * Before code content, not a closing fence, at eol.\n   *\n   * ```markdown\n   *   | ~~~js\n   * > | alert(1)\n   *             ^\n   *   | ~~~\n   * ```\n   *\n   * @type {State}\n   */\n  function contentBefore(code) {\n    effects.enter(\"lineEnding\");\n    effects.consume(code);\n    effects.exit(\"lineEnding\");\n    return contentStart;\n  }\n\n  /**\n   * Before code content, not a closing fence.\n   *\n   * ```markdown\n   *   | ~~~js\n   * > | alert(1)\n   *     ^\n   *   | ~~~\n   * ```\n   *\n   * @type {State}\n   */\n  function contentStart(code) {\n    return initialPrefix > 0 && markdownSpace(code) ? factorySpace(effects, beforeContentChunk, \"linePrefix\", initialPrefix + 1)(code) : beforeContentChunk(code);\n  }\n\n  /**\n   * Before code content, after optional prefix.\n   *\n   * ```markdown\n   *   | ~~~js\n   * > | alert(1)\n   *     ^\n   *   | ~~~\n   * ```\n   *\n   * @type {State}\n   */\n  function beforeContentChunk(code) {\n    if (code === null || markdownLineEnding(code)) {\n      return effects.check(nonLazyContinuation, atNonLazyBreak, after)(code);\n    }\n    effects.enter(\"codeFlowValue\");\n    return contentChunk(code);\n  }\n\n  /**\n   * In code content.\n   *\n   * ```markdown\n   *   | ~~~js\n   * > | alert(1)\n   *     ^^^^^^^^\n   *   | ~~~\n   * ```\n   *\n   * @type {State}\n   */\n  function contentChunk(code) {\n    if (code === null || markdownLineEnding(code)) {\n      effects.exit(\"codeFlowValue\");\n      return beforeContentChunk(code);\n    }\n    effects.consume(code);\n    return contentChunk;\n  }\n\n  /**\n   * After code.\n   *\n   * ```markdown\n   *   | ~~~js\n   *   | alert(1)\n   * > | ~~~\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function after(code) {\n    effects.exit(\"codeFenced\");\n    return ok(code);\n  }\n\n  /**\n   * @this {TokenizeContext}\n   *   Context.\n   * @type {Tokenizer}\n   */\n  function tokenizeCloseStart(effects, ok, nok) {\n    let size = 0;\n    return startBefore;\n\n    /**\n     *\n     *\n     * @type {State}\n     */\n    function startBefore(code) {\n      effects.enter(\"lineEnding\");\n      effects.consume(code);\n      effects.exit(\"lineEnding\");\n      return start;\n    }\n\n    /**\n     * Before closing fence, at optional whitespace.\n     *\n     * ```markdown\n     *   | ~~~js\n     *   | alert(1)\n     * > | ~~~\n     *     ^\n     * ```\n     *\n     * @type {State}\n     */\n    function start(code) {\n      // Always populated by defaults.\n\n      // To do: `enter` here or in next state?\n      effects.enter(\"codeFencedFence\");\n      return markdownSpace(code) ? factorySpace(effects, beforeSequenceClose, \"linePrefix\", self.parser.constructs.disable.null.includes('codeIndented') ? undefined : 4)(code) : beforeSequenceClose(code);\n    }\n\n    /**\n     * In closing fence, after optional whitespace, at sequence.\n     *\n     * ```markdown\n     *   | ~~~js\n     *   | alert(1)\n     * > | ~~~\n     *     ^\n     * ```\n     *\n     * @type {State}\n     */\n    function beforeSequenceClose(code) {\n      if (code === marker) {\n        effects.enter(\"codeFencedFenceSequence\");\n        return sequenceClose(code);\n      }\n      return nok(code);\n    }\n\n    /**\n     * In closing fence sequence.\n     *\n     * ```markdown\n     *   | ~~~js\n     *   | alert(1)\n     * > | ~~~\n     *     ^\n     * ```\n     *\n     * @type {State}\n     */\n    function sequenceClose(code) {\n      if (code === marker) {\n        size++;\n        effects.consume(code);\n        return sequenceClose;\n      }\n      if (size >= sizeOpen) {\n        effects.exit(\"codeFencedFenceSequence\");\n        return markdownSpace(code) ? factorySpace(effects, sequenceCloseAfter, \"whitespace\")(code) : sequenceCloseAfter(code);\n      }\n      return nok(code);\n    }\n\n    /**\n     * After closing fence sequence, after optional whitespace.\n     *\n     * ```markdown\n     *   | ~~~js\n     *   | alert(1)\n     * > | ~~~\n     *        ^\n     * ```\n     *\n     * @type {State}\n     */\n    function sequenceCloseAfter(code) {\n      if (code === null || markdownLineEnding(code)) {\n        effects.exit(\"codeFencedFence\");\n        return ok(code);\n      }\n      return nok(code);\n    }\n  }\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeNonLazyContinuation(effects, ok, nok) {\n  const self = this;\n  return start;\n\n  /**\n   *\n   *\n   * @type {State}\n   */\n  function start(code) {\n    if (code === null) {\n      return nok(code);\n    }\n    effects.enter(\"lineEnding\");\n    effects.consume(code);\n    effects.exit(\"lineEnding\");\n    return lineStart;\n  }\n\n  /**\n   *\n   *\n   * @type {State}\n   */\n  function lineStart(code) {\n    return self.parser.lazy[self.now().line] ? nok(code) : ok(code);\n  }\n}", "/**\n * @import {\n *   Construct,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { factorySpace } from 'micromark-factory-space';\nimport { markdownLineEnding, markdownSpace } from 'micromark-util-character';\n/** @type {Construct} */\nexport const codeIndented = {\n  name: 'codeIndented',\n  tokenize: tokenizeCodeIndented\n};\n\n/** @type {Construct} */\nconst furtherStart = {\n  partial: true,\n  tokenize: tokenizeFurtherStart\n};\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeCodeIndented(effects, ok, nok) {\n  const self = this;\n  return start;\n\n  /**\n   * Start of code (indented).\n   *\n   * > **Parsing note**: it is not needed to check if this first line is a\n   * > filled line (that it has a non-whitespace character), because blank lines\n   * > are parsed already, so we never run into that.\n   *\n   * ```markdown\n   * > |     aaa\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    // To do: manually check if interrupting like `markdown-rs`.\n\n    effects.enter(\"codeIndented\");\n    // To do: use an improved `space_or_tab` function like `markdown-rs`,\n    // so that we can drop the next state.\n    return factorySpace(effects, afterPrefix, \"linePrefix\", 4 + 1)(code);\n  }\n\n  /**\n   * At start, after 1 or 4 spaces.\n   *\n   * ```markdown\n   * > |     aaa\n   *         ^\n   * ```\n   *\n   * @type {State}\n   */\n  function afterPrefix(code) {\n    const tail = self.events[self.events.length - 1];\n    return tail && tail[1].type === \"linePrefix\" && tail[2].sliceSerialize(tail[1], true).length >= 4 ? atBreak(code) : nok(code);\n  }\n\n  /**\n   * At a break.\n   *\n   * ```markdown\n   * > |     aaa\n   *         ^  ^\n   * ```\n   *\n   * @type {State}\n   */\n  function atBreak(code) {\n    if (code === null) {\n      return after(code);\n    }\n    if (markdownLineEnding(code)) {\n      return effects.attempt(furtherStart, atBreak, after)(code);\n    }\n    effects.enter(\"codeFlowValue\");\n    return inside(code);\n  }\n\n  /**\n   * In code content.\n   *\n   * ```markdown\n   * > |     aaa\n   *         ^^^^\n   * ```\n   *\n   * @type {State}\n   */\n  function inside(code) {\n    if (code === null || markdownLineEnding(code)) {\n      effects.exit(\"codeFlowValue\");\n      return atBreak(code);\n    }\n    effects.consume(code);\n    return inside;\n  }\n\n  /** @type {State} */\n  function after(code) {\n    effects.exit(\"codeIndented\");\n    // To do: allow interrupting like `markdown-rs`.\n    // Feel free to interrupt.\n    // tokenizer.interrupt = false\n    return ok(code);\n  }\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeFurtherStart(effects, ok, nok) {\n  const self = this;\n  return furtherStart;\n\n  /**\n   * At eol, trying to parse another indent.\n   *\n   * ```markdown\n   * > |     aaa\n   *            ^\n   *   |     bbb\n   * ```\n   *\n   * @type {State}\n   */\n  function furtherStart(code) {\n    // To do: improve `lazy` / `pierce` handling.\n    // If this is a lazy line, it can\u2019t be code.\n    if (self.parser.lazy[self.now().line]) {\n      return nok(code);\n    }\n    if (markdownLineEnding(code)) {\n      effects.enter(\"lineEnding\");\n      effects.consume(code);\n      effects.exit(\"lineEnding\");\n      return furtherStart;\n    }\n\n    // To do: the code here in `micromark-js` is a bit different from\n    // `markdown-rs` because there it can attempt spaces.\n    // We can\u2019t yet.\n    //\n    // To do: use an improved `space_or_tab` function like `markdown-rs`,\n    // so that we can drop the next state.\n    return factorySpace(effects, afterPrefix, \"linePrefix\", 4 + 1)(code);\n  }\n\n  /**\n   * At start, after 1 or 4 spaces.\n   *\n   * ```markdown\n   * > |     aaa\n   *         ^\n   * ```\n   *\n   * @type {State}\n   */\n  function afterPrefix(code) {\n    const tail = self.events[self.events.length - 1];\n    return tail && tail[1].type === \"linePrefix\" && tail[2].sliceSerialize(tail[1], true).length >= 4 ? ok(code) : markdownLineEnding(code) ? furtherStart(code) : nok(code);\n  }\n}", "/**\n * @import {\n *   Construct,\n *   Previous,\n *   Resolver,\n *   State,\n *   TokenizeContext,\n *   Tokenizer,\n *   Token\n * } from 'micromark-util-types'\n */\n\nimport { markdownLineEnding } from 'micromark-util-character';\n/** @type {Construct} */\nexport const codeText = {\n  name: 'codeText',\n  previous,\n  resolve: resolveCodeText,\n  tokenize: tokenizeCodeText\n};\n\n// To do: next major: don\u2019t resolve, like `markdown-rs`.\n/** @type {Resolver} */\nfunction resolveCodeText(events) {\n  let tailExitIndex = events.length - 4;\n  let headEnterIndex = 3;\n  /** @type {number} */\n  let index;\n  /** @type {number | undefined} */\n  let enter;\n\n  // If we start and end with an EOL or a space.\n  if ((events[headEnterIndex][1].type === \"lineEnding\" || events[headEnterIndex][1].type === 'space') && (events[tailExitIndex][1].type === \"lineEnding\" || events[tailExitIndex][1].type === 'space')) {\n    index = headEnterIndex;\n\n    // And we have data.\n    while (++index < tailExitIndex) {\n      if (events[index][1].type === \"codeTextData\") {\n        // Then we have padding.\n        events[headEnterIndex][1].type = \"codeTextPadding\";\n        events[tailExitIndex][1].type = \"codeTextPadding\";\n        headEnterIndex += 2;\n        tailExitIndex -= 2;\n        break;\n      }\n    }\n  }\n\n  // Merge adjacent spaces and data.\n  index = headEnterIndex - 1;\n  tailExitIndex++;\n  while (++index <= tailExitIndex) {\n    if (enter === undefined) {\n      if (index !== tailExitIndex && events[index][1].type !== \"lineEnding\") {\n        enter = index;\n      }\n    } else if (index === tailExitIndex || events[index][1].type === \"lineEnding\") {\n      events[enter][1].type = \"codeTextData\";\n      if (index !== enter + 2) {\n        events[enter][1].end = events[index - 1][1].end;\n        events.splice(enter + 2, index - enter - 2);\n        tailExitIndex -= index - enter - 2;\n        index = enter + 2;\n      }\n      enter = undefined;\n    }\n  }\n  return events;\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Previous}\n */\nfunction previous(code) {\n  // If there is a previous code, there will always be a tail.\n  return code !== 96 || this.events[this.events.length - 1][1].type === \"characterEscape\";\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeCodeText(effects, ok, nok) {\n  const self = this;\n  let sizeOpen = 0;\n  /** @type {number} */\n  let size;\n  /** @type {Token} */\n  let token;\n  return start;\n\n  /**\n   * Start of code (text).\n   *\n   * ```markdown\n   * > | `a`\n   *     ^\n   * > | \\`a`\n   *      ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    effects.enter(\"codeText\");\n    effects.enter(\"codeTextSequence\");\n    return sequenceOpen(code);\n  }\n\n  /**\n   * In opening sequence.\n   *\n   * ```markdown\n   * > | `a`\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function sequenceOpen(code) {\n    if (code === 96) {\n      effects.consume(code);\n      sizeOpen++;\n      return sequenceOpen;\n    }\n    effects.exit(\"codeTextSequence\");\n    return between(code);\n  }\n\n  /**\n   * Between something and something else.\n   *\n   * ```markdown\n   * > | `a`\n   *      ^^\n   * ```\n   *\n   * @type {State}\n   */\n  function between(code) {\n    // EOF.\n    if (code === null) {\n      return nok(code);\n    }\n\n    // To do: next major: don\u2019t do spaces in resolve, but when compiling,\n    // like `markdown-rs`.\n    // Tabs don\u2019t work, and virtual spaces don\u2019t make sense.\n    if (code === 32) {\n      effects.enter('space');\n      effects.consume(code);\n      effects.exit('space');\n      return between;\n    }\n\n    // Closing fence? Could also be data.\n    if (code === 96) {\n      token = effects.enter(\"codeTextSequence\");\n      size = 0;\n      return sequenceClose(code);\n    }\n    if (markdownLineEnding(code)) {\n      effects.enter(\"lineEnding\");\n      effects.consume(code);\n      effects.exit(\"lineEnding\");\n      return between;\n    }\n\n    // Data.\n    effects.enter(\"codeTextData\");\n    return data(code);\n  }\n\n  /**\n   * In data.\n   *\n   * ```markdown\n   * > | `a`\n   *      ^\n   * ```\n   *\n   * @type {State}\n   */\n  function data(code) {\n    if (code === null || code === 32 || code === 96 || markdownLineEnding(code)) {\n      effects.exit(\"codeTextData\");\n      return between(code);\n    }\n    effects.consume(code);\n    return data;\n  }\n\n  /**\n   * In closing sequence.\n   *\n   * ```markdown\n   * > | `a`\n   *       ^\n   * ```\n   *\n   * @type {State}\n   */\n  function sequenceClose(code) {\n    // More.\n    if (code === 96) {\n      effects.consume(code);\n      size++;\n      return sequenceClose;\n    }\n\n    // Done!\n    if (size === sizeOpen) {\n      effects.exit(\"codeTextSequence\");\n      effects.exit(\"codeText\");\n      return ok(code);\n    }\n\n    // More or less accents: mark as data.\n    token.type = \"codeTextData\";\n    return data(code);\n  }\n}", "/**\n * Some of the internal operations of micromark do lots of editing\n * operations on very large arrays. This runs into problems with two\n * properties of most circa-2020 JavaScript interpreters:\n *\n *  - Array-length modifications at the high end of an array (push/pop) are\n *    expected to be common and are implemented in (amortized) time\n *    proportional to the number of elements added or removed, whereas\n *    other operations (shift/unshift and splice) are much less efficient.\n *  - Function arguments are passed on the stack, so adding tens of thousands\n *    of elements to an array with `arr.push(...newElements)` will frequently\n *    cause stack overflows. (see <https://stackoverflow.com/questions/22123769/rangeerror-maximum-call-stack-size-exceeded-why>)\n *\n * SpliceBuffers are an implementation of gap buffers, which are a\n * generalization of the \"queue made of two stacks\" idea. The splice buffer\n * maintains a cursor, and moving the cursor has cost proportional to the\n * distance the cursor moves, but inserting, deleting, or splicing in\n * new information at the cursor is as efficient as the push/pop operation.\n * This allows for an efficient sequence of splices (or pushes, pops, shifts,\n * or unshifts) as long such edits happen at the same part of the array or\n * generally sweep through the array from the beginning to the end.\n *\n * The interface for splice buffers also supports large numbers of inputs by\n * passing a single array argument rather passing multiple arguments on the\n * function call stack.\n *\n * @template T\n *   Item type.\n */\nexport class SpliceBuffer {\n  /**\n   * @param {ReadonlyArray<T> | null | undefined} [initial]\n   *   Initial items (optional).\n   * @returns\n   *   Splice buffer.\n   */\n  constructor(initial) {\n    /** @type {Array<T>} */\n    this.left = initial ? [...initial] : [];\n    /** @type {Array<T>} */\n    this.right = [];\n  }\n\n  /**\n   * Array access;\n   * does not move the cursor.\n   *\n   * @param {number} index\n   *   Index.\n   * @return {T}\n   *   Item.\n   */\n  get(index) {\n    if (index < 0 || index >= this.left.length + this.right.length) {\n      throw new RangeError('Cannot access index `' + index + '` in a splice buffer of size `' + (this.left.length + this.right.length) + '`');\n    }\n    if (index < this.left.length) return this.left[index];\n    return this.right[this.right.length - index + this.left.length - 1];\n  }\n\n  /**\n   * The length of the splice buffer, one greater than the largest index in the\n   * array.\n   */\n  get length() {\n    return this.left.length + this.right.length;\n  }\n\n  /**\n   * Remove and return `list[0]`;\n   * moves the cursor to `0`.\n   *\n   * @returns {T | undefined}\n   *   Item, optional.\n   */\n  shift() {\n    this.setCursor(0);\n    return this.right.pop();\n  }\n\n  /**\n   * Slice the buffer to get an array;\n   * does not move the cursor.\n   *\n   * @param {number} start\n   *   Start.\n   * @param {number | null | undefined} [end]\n   *   End (optional).\n   * @returns {Array<T>}\n   *   Array of items.\n   */\n  slice(start, end) {\n    /** @type {number} */\n    const stop = end === null || end === undefined ? Number.POSITIVE_INFINITY : end;\n    if (stop < this.left.length) {\n      return this.left.slice(start, stop);\n    }\n    if (start > this.left.length) {\n      return this.right.slice(this.right.length - stop + this.left.length, this.right.length - start + this.left.length).reverse();\n    }\n    return this.left.slice(start).concat(this.right.slice(this.right.length - stop + this.left.length).reverse());\n  }\n\n  /**\n   * Mimics the behavior of Array.prototype.splice() except for the change of\n   * interface necessary to avoid segfaults when patching in very large arrays.\n   *\n   * This operation moves cursor is moved to `start` and results in the cursor\n   * placed after any inserted items.\n   *\n   * @param {number} start\n   *   Start;\n   *   zero-based index at which to start changing the array;\n   *   negative numbers count backwards from the end of the array and values\n   *   that are out-of bounds are clamped to the appropriate end of the array.\n   * @param {number | null | undefined} [deleteCount=0]\n   *   Delete count (default: `0`);\n   *   maximum number of elements to delete, starting from start.\n   * @param {Array<T> | null | undefined} [items=[]]\n   *   Items to include in place of the deleted items (default: `[]`).\n   * @return {Array<T>}\n   *   Any removed items.\n   */\n  splice(start, deleteCount, items) {\n    /** @type {number} */\n    const count = deleteCount || 0;\n    this.setCursor(Math.trunc(start));\n    const removed = this.right.splice(this.right.length - count, Number.POSITIVE_INFINITY);\n    if (items) chunkedPush(this.left, items);\n    return removed.reverse();\n  }\n\n  /**\n   * Remove and return the highest-numbered item in the array, so\n   * `list[list.length - 1]`;\n   * Moves the cursor to `length`.\n   *\n   * @returns {T | undefined}\n   *   Item, optional.\n   */\n  pop() {\n    this.setCursor(Number.POSITIVE_INFINITY);\n    return this.left.pop();\n  }\n\n  /**\n   * Inserts a single item to the high-numbered side of the array;\n   * moves the cursor to `length`.\n   *\n   * @param {T} item\n   *   Item.\n   * @returns {undefined}\n   *   Nothing.\n   */\n  push(item) {\n    this.setCursor(Number.POSITIVE_INFINITY);\n    this.left.push(item);\n  }\n\n  /**\n   * Inserts many items to the high-numbered side of the array.\n   * Moves the cursor to `length`.\n   *\n   * @param {Array<T>} items\n   *   Items.\n   * @returns {undefined}\n   *   Nothing.\n   */\n  pushMany(items) {\n    this.setCursor(Number.POSITIVE_INFINITY);\n    chunkedPush(this.left, items);\n  }\n\n  /**\n   * Inserts a single item to the low-numbered side of the array;\n   * Moves the cursor to `0`.\n   *\n   * @param {T} item\n   *   Item.\n   * @returns {undefined}\n   *   Nothing.\n   */\n  unshift(item) {\n    this.setCursor(0);\n    this.right.push(item);\n  }\n\n  /**\n   * Inserts many items to the low-numbered side of the array;\n   * moves the cursor to `0`.\n   *\n   * @param {Array<T>} items\n   *   Items.\n   * @returns {undefined}\n   *   Nothing.\n   */\n  unshiftMany(items) {\n    this.setCursor(0);\n    chunkedPush(this.right, items.reverse());\n  }\n\n  /**\n   * Move the cursor to a specific position in the array. Requires\n   * time proportional to the distance moved.\n   *\n   * If `n < 0`, the cursor will end up at the beginning.\n   * If `n > length`, the cursor will end up at the end.\n   *\n   * @param {number} n\n   *   Position.\n   * @return {undefined}\n   *   Nothing.\n   */\n  setCursor(n) {\n    if (n === this.left.length || n > this.left.length && this.right.length === 0 || n < 0 && this.left.length === 0) return;\n    if (n < this.left.length) {\n      // Move cursor to the this.left\n      const removed = this.left.splice(n, Number.POSITIVE_INFINITY);\n      chunkedPush(this.right, removed.reverse());\n    } else {\n      // Move cursor to the this.right\n      const removed = this.right.splice(this.left.length + this.right.length - n, Number.POSITIVE_INFINITY);\n      chunkedPush(this.left, removed.reverse());\n    }\n  }\n}\n\n/**\n * Avoid stack overflow by pushing items onto the stack in segments\n *\n * @template T\n *   Item type.\n * @param {Array<T>} list\n *   List to inject into.\n * @param {ReadonlyArray<T>} right\n *   Items to inject.\n * @return {undefined}\n *   Nothing.\n */\nfunction chunkedPush(list, right) {\n  /** @type {number} */\n  let chunkStart = 0;\n  if (right.length < 10000) {\n    list.push(...right);\n  } else {\n    while (chunkStart < right.length) {\n      list.push(...right.slice(chunkStart, chunkStart + 10000));\n      chunkStart += 10000;\n    }\n  }\n}", "/**\n * @import {Chunk, Event, Token} from 'micromark-util-types'\n */\n\nimport { splice } from 'micromark-util-chunked';\nimport { SpliceBuffer } from './lib/splice-buffer.js';\n\n// Hidden API exposed for testing.\nexport { SpliceBuffer } from './lib/splice-buffer.js';\n\n/**\n * Tokenize subcontent.\n *\n * @param {Array<Event>} eventsArray\n *   List of events.\n * @returns {boolean}\n *   Whether subtokens were found.\n */\n// eslint-disable-next-line complexity\nexport function subtokenize(eventsArray) {\n  /** @type {Record<string, number>} */\n  const jumps = {};\n  let index = -1;\n  /** @type {Event} */\n  let event;\n  /** @type {number | undefined} */\n  let lineIndex;\n  /** @type {number} */\n  let otherIndex;\n  /** @type {Event} */\n  let otherEvent;\n  /** @type {Array<Event>} */\n  let parameters;\n  /** @type {Array<Event>} */\n  let subevents;\n  /** @type {boolean | undefined} */\n  let more;\n  const events = new SpliceBuffer(eventsArray);\n  while (++index < events.length) {\n    while (index in jumps) {\n      index = jumps[index];\n    }\n    event = events.get(index);\n\n    // Add a hook for the GFM tasklist extension, which needs to know if text\n    // is in the first content of a list item.\n    if (index && event[1].type === \"chunkFlow\" && events.get(index - 1)[1].type === \"listItemPrefix\") {\n      subevents = event[1]._tokenizer.events;\n      otherIndex = 0;\n      if (otherIndex < subevents.length && subevents[otherIndex][1].type === \"lineEndingBlank\") {\n        otherIndex += 2;\n      }\n      if (otherIndex < subevents.length && subevents[otherIndex][1].type === \"content\") {\n        while (++otherIndex < subevents.length) {\n          if (subevents[otherIndex][1].type === \"content\") {\n            break;\n          }\n          if (subevents[otherIndex][1].type === \"chunkText\") {\n            subevents[otherIndex][1]._isInFirstContentOfListItem = true;\n            otherIndex++;\n          }\n        }\n      }\n    }\n\n    // Enter.\n    if (event[0] === 'enter') {\n      if (event[1].contentType) {\n        Object.assign(jumps, subcontent(events, index));\n        index = jumps[index];\n        more = true;\n      }\n    }\n    // Exit.\n    else if (event[1]._container) {\n      otherIndex = index;\n      lineIndex = undefined;\n      while (otherIndex--) {\n        otherEvent = events.get(otherIndex);\n        if (otherEvent[1].type === \"lineEnding\" || otherEvent[1].type === \"lineEndingBlank\") {\n          if (otherEvent[0] === 'enter') {\n            if (lineIndex) {\n              events.get(lineIndex)[1].type = \"lineEndingBlank\";\n            }\n            otherEvent[1].type = \"lineEnding\";\n            lineIndex = otherIndex;\n          }\n        } else if (otherEvent[1].type === \"linePrefix\" || otherEvent[1].type === \"listItemIndent\") {\n          // Move past.\n        } else {\n          break;\n        }\n      }\n      if (lineIndex) {\n        // Fix position.\n        event[1].end = {\n          ...events.get(lineIndex)[1].start\n        };\n\n        // Switch container exit w/ line endings.\n        parameters = events.slice(lineIndex, index);\n        parameters.unshift(event);\n        events.splice(lineIndex, index - lineIndex + 1, parameters);\n      }\n    }\n  }\n\n  // The changes to the `events` buffer must be copied back into the eventsArray\n  splice(eventsArray, 0, Number.POSITIVE_INFINITY, events.slice(0));\n  return !more;\n}\n\n/**\n * Tokenize embedded tokens.\n *\n * @param {SpliceBuffer<Event>} events\n *   Events.\n * @param {number} eventIndex\n *   Index.\n * @returns {Record<string, number>}\n *   Gaps.\n */\nfunction subcontent(events, eventIndex) {\n  const token = events.get(eventIndex)[1];\n  const context = events.get(eventIndex)[2];\n  let startPosition = eventIndex - 1;\n  /** @type {Array<number>} */\n  const startPositions = [];\n  let tokenizer = token._tokenizer;\n  if (!tokenizer) {\n    tokenizer = context.parser[token.contentType](token.start);\n    if (token._contentTypeTextTrailing) {\n      tokenizer._contentTypeTextTrailing = true;\n    }\n  }\n  const childEvents = tokenizer.events;\n  /** @type {Array<[number, number]>} */\n  const jumps = [];\n  /** @type {Record<string, number>} */\n  const gaps = {};\n  /** @type {Array<Chunk>} */\n  let stream;\n  /** @type {Token | undefined} */\n  let previous;\n  let index = -1;\n  /** @type {Token | undefined} */\n  let current = token;\n  let adjust = 0;\n  let start = 0;\n  const breaks = [start];\n\n  // Loop forward through the linked tokens to pass them in order to the\n  // subtokenizer.\n  while (current) {\n    // Find the position of the event for this token.\n    while (events.get(++startPosition)[1] !== current) {\n      // Empty.\n    }\n    startPositions.push(startPosition);\n    if (!current._tokenizer) {\n      stream = context.sliceStream(current);\n      if (!current.next) {\n        stream.push(null);\n      }\n      if (previous) {\n        tokenizer.defineSkip(current.start);\n      }\n      if (current._isInFirstContentOfListItem) {\n        tokenizer._gfmTasklistFirstContentOfListItem = true;\n      }\n      tokenizer.write(stream);\n      if (current._isInFirstContentOfListItem) {\n        tokenizer._gfmTasklistFirstContentOfListItem = undefined;\n      }\n    }\n\n    // Unravel the next token.\n    previous = current;\n    current = current.next;\n  }\n\n  // Now, loop back through all events (and linked tokens), to figure out which\n  // parts belong where.\n  current = token;\n  while (++index < childEvents.length) {\n    if (\n    // Find a void token that includes a break.\n    childEvents[index][0] === 'exit' && childEvents[index - 1][0] === 'enter' && childEvents[index][1].type === childEvents[index - 1][1].type && childEvents[index][1].start.line !== childEvents[index][1].end.line) {\n      start = index + 1;\n      breaks.push(start);\n      // Help GC.\n      current._tokenizer = undefined;\n      current.previous = undefined;\n      current = current.next;\n    }\n  }\n\n  // Help GC.\n  tokenizer.events = [];\n\n  // If there\u2019s one more token (which is the cases for lines that end in an\n  // EOF), that\u2019s perfect: the last point we found starts it.\n  // If there isn\u2019t then make sure any remaining content is added to it.\n  if (current) {\n    // Help GC.\n    current._tokenizer = undefined;\n    current.previous = undefined;\n  } else {\n    breaks.pop();\n  }\n\n  // Now splice the events from the subtokenizer into the current events,\n  // moving back to front so that splice indices aren\u2019t affected.\n  index = breaks.length;\n  while (index--) {\n    const slice = childEvents.slice(breaks[index], breaks[index + 1]);\n    const start = startPositions.pop();\n    jumps.push([start, start + slice.length - 1]);\n    events.splice(start, 2, slice);\n  }\n  jumps.reverse();\n  index = -1;\n  while (++index < jumps.length) {\n    gaps[adjust + jumps[index][0]] = adjust + jumps[index][1];\n    adjust += jumps[index][1] - jumps[index][0] - 1;\n  }\n  return gaps;\n}", "/**\n * @import {\n *   Construct,\n *   Resolver,\n *   State,\n *   TokenizeContext,\n *   Tokenizer,\n *   Token\n * } from 'micromark-util-types'\n */\n\nimport { factorySpace } from 'micromark-factory-space';\nimport { markdownLineEnding } from 'micromark-util-character';\nimport { subtokenize } from 'micromark-util-subtokenize';\n/**\n * No name because it must not be turned off.\n * @type {Construct}\n */\nexport const content = {\n  resolve: resolveContent,\n  tokenize: tokenizeContent\n};\n\n/** @type {Construct} */\nconst continuationConstruct = {\n  partial: true,\n  tokenize: tokenizeContinuation\n};\n\n/**\n * Content is transparent: it\u2019s parsed right now. That way, definitions are also\n * parsed right now: before text in paragraphs (specifically, media) are parsed.\n *\n * @type {Resolver}\n */\nfunction resolveContent(events) {\n  subtokenize(events);\n  return events;\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeContent(effects, ok) {\n  /** @type {Token | undefined} */\n  let previous;\n  return chunkStart;\n\n  /**\n   * Before a content chunk.\n   *\n   * ```markdown\n   * > | abc\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function chunkStart(code) {\n    effects.enter(\"content\");\n    previous = effects.enter(\"chunkContent\", {\n      contentType: \"content\"\n    });\n    return chunkInside(code);\n  }\n\n  /**\n   * In a content chunk.\n   *\n   * ```markdown\n   * > | abc\n   *     ^^^\n   * ```\n   *\n   * @type {State}\n   */\n  function chunkInside(code) {\n    if (code === null) {\n      return contentEnd(code);\n    }\n\n    // To do: in `markdown-rs`, each line is parsed on its own, and everything\n    // is stitched together resolving.\n    if (markdownLineEnding(code)) {\n      return effects.check(continuationConstruct, contentContinue, contentEnd)(code);\n    }\n\n    // Data.\n    effects.consume(code);\n    return chunkInside;\n  }\n\n  /**\n   *\n   *\n   * @type {State}\n   */\n  function contentEnd(code) {\n    effects.exit(\"chunkContent\");\n    effects.exit(\"content\");\n    return ok(code);\n  }\n\n  /**\n   *\n   *\n   * @type {State}\n   */\n  function contentContinue(code) {\n    effects.consume(code);\n    effects.exit(\"chunkContent\");\n    previous.next = effects.enter(\"chunkContent\", {\n      contentType: \"content\",\n      previous\n    });\n    previous = previous.next;\n    return chunkInside;\n  }\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeContinuation(effects, ok, nok) {\n  const self = this;\n  return startLookahead;\n\n  /**\n   *\n   *\n   * @type {State}\n   */\n  function startLookahead(code) {\n    effects.exit(\"chunkContent\");\n    effects.enter(\"lineEnding\");\n    effects.consume(code);\n    effects.exit(\"lineEnding\");\n    return factorySpace(effects, prefixed, \"linePrefix\");\n  }\n\n  /**\n   *\n   *\n   * @type {State}\n   */\n  function prefixed(code) {\n    if (code === null || markdownLineEnding(code)) {\n      return nok(code);\n    }\n\n    // Always populated by defaults.\n\n    const tail = self.events[self.events.length - 1];\n    if (!self.parser.constructs.disable.null.includes('codeIndented') && tail && tail[1].type === \"linePrefix\" && tail[2].sliceSerialize(tail[1], true).length >= 4) {\n      return ok(code);\n    }\n    return effects.interrupt(self.parser.constructs.flow, nok, ok)(code);\n  }\n}", "/**\n * @import {Effects, State, TokenType} from 'micromark-util-types'\n */\n\nimport { asciiControl, markdownLineEndingOrSpace, markdownLineEnding } from 'micromark-util-character';\n/**\n * Parse destinations.\n *\n * ###### Examples\n *\n * ```markdown\n * <a>\n * <a\\>b>\n * <a b>\n * <a)>\n * a\n * a\\)b\n * a(b)c\n * a(b)\n * ```\n *\n * @param {Effects} effects\n *   Context.\n * @param {State} ok\n *   State switched to when successful.\n * @param {State} nok\n *   State switched to when unsuccessful.\n * @param {TokenType} type\n *   Type for whole (`<a>` or `b`).\n * @param {TokenType} literalType\n *   Type when enclosed (`<a>`).\n * @param {TokenType} literalMarkerType\n *   Type for enclosing (`<` and `>`).\n * @param {TokenType} rawType\n *   Type when not enclosed (`b`).\n * @param {TokenType} stringType\n *   Type for the value (`a` or `b`).\n * @param {number | undefined} [max=Infinity]\n *   Depth of nested parens (inclusive).\n * @returns {State}\n *   Start state.\n */\nexport function factoryDestination(effects, ok, nok, type, literalType, literalMarkerType, rawType, stringType, max) {\n  const limit = max || Number.POSITIVE_INFINITY;\n  let balance = 0;\n  return start;\n\n  /**\n   * Start of destination.\n   *\n   * ```markdown\n   * > | <aa>\n   *     ^\n   * > | aa\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    if (code === 60) {\n      effects.enter(type);\n      effects.enter(literalType);\n      effects.enter(literalMarkerType);\n      effects.consume(code);\n      effects.exit(literalMarkerType);\n      return enclosedBefore;\n    }\n\n    // ASCII control, space, closing paren.\n    if (code === null || code === 32 || code === 41 || asciiControl(code)) {\n      return nok(code);\n    }\n    effects.enter(type);\n    effects.enter(rawType);\n    effects.enter(stringType);\n    effects.enter(\"chunkString\", {\n      contentType: \"string\"\n    });\n    return raw(code);\n  }\n\n  /**\n   * After `<`, at an enclosed destination.\n   *\n   * ```markdown\n   * > | <aa>\n   *      ^\n   * ```\n   *\n   * @type {State}\n   */\n  function enclosedBefore(code) {\n    if (code === 62) {\n      effects.enter(literalMarkerType);\n      effects.consume(code);\n      effects.exit(literalMarkerType);\n      effects.exit(literalType);\n      effects.exit(type);\n      return ok;\n    }\n    effects.enter(stringType);\n    effects.enter(\"chunkString\", {\n      contentType: \"string\"\n    });\n    return enclosed(code);\n  }\n\n  /**\n   * In enclosed destination.\n   *\n   * ```markdown\n   * > | <aa>\n   *      ^\n   * ```\n   *\n   * @type {State}\n   */\n  function enclosed(code) {\n    if (code === 62) {\n      effects.exit(\"chunkString\");\n      effects.exit(stringType);\n      return enclosedBefore(code);\n    }\n    if (code === null || code === 60 || markdownLineEnding(code)) {\n      return nok(code);\n    }\n    effects.consume(code);\n    return code === 92 ? enclosedEscape : enclosed;\n  }\n\n  /**\n   * After `\\`, at a special character.\n   *\n   * ```markdown\n   * > | <a\\*a>\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function enclosedEscape(code) {\n    if (code === 60 || code === 62 || code === 92) {\n      effects.consume(code);\n      return enclosed;\n    }\n    return enclosed(code);\n  }\n\n  /**\n   * In raw destination.\n   *\n   * ```markdown\n   * > | aa\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function raw(code) {\n    if (!balance && (code === null || code === 41 || markdownLineEndingOrSpace(code))) {\n      effects.exit(\"chunkString\");\n      effects.exit(stringType);\n      effects.exit(rawType);\n      effects.exit(type);\n      return ok(code);\n    }\n    if (balance < limit && code === 40) {\n      effects.consume(code);\n      balance++;\n      return raw;\n    }\n    if (code === 41) {\n      effects.consume(code);\n      balance--;\n      return raw;\n    }\n\n    // ASCII control (but *not* `\\0`) and space and `(`.\n    // Note: in `markdown-rs`, `\\0` exists in codes, in `micromark-js` it\n    // doesn\u2019t.\n    if (code === null || code === 32 || code === 40 || asciiControl(code)) {\n      return nok(code);\n    }\n    effects.consume(code);\n    return code === 92 ? rawEscape : raw;\n  }\n\n  /**\n   * After `\\`, at special character.\n   *\n   * ```markdown\n   * > | a\\*a\n   *       ^\n   * ```\n   *\n   * @type {State}\n   */\n  function rawEscape(code) {\n    if (code === 40 || code === 41 || code === 92) {\n      effects.consume(code);\n      return raw;\n    }\n    return raw(code);\n  }\n}", "/**\n * @import {\n *   Effects,\n *   State,\n *   TokenizeContext,\n *   TokenType\n * } from 'micromark-util-types'\n */\n\nimport { markdownLineEnding, markdownSpace } from 'micromark-util-character';\n/**\n * Parse labels.\n *\n * > \uD83D\uDC49 **Note**: labels in markdown are capped at 999 characters in the string.\n *\n * ###### Examples\n *\n * ```markdown\n * [a]\n * [a\n * b]\n * [a\\]b]\n * ```\n *\n * @this {TokenizeContext}\n *   Tokenize context.\n * @param {Effects} effects\n *   Context.\n * @param {State} ok\n *   State switched to when successful.\n * @param {State} nok\n *   State switched to when unsuccessful.\n * @param {TokenType} type\n *   Type of the whole label (`[a]`).\n * @param {TokenType} markerType\n *   Type for the markers (`[` and `]`).\n * @param {TokenType} stringType\n *   Type for the identifier (`a`).\n * @returns {State}\n *   Start state.\n */\nexport function factoryLabel(effects, ok, nok, type, markerType, stringType) {\n  const self = this;\n  let size = 0;\n  /** @type {boolean} */\n  let seen;\n  return start;\n\n  /**\n   * Start of label.\n   *\n   * ```markdown\n   * > | [a]\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    effects.enter(type);\n    effects.enter(markerType);\n    effects.consume(code);\n    effects.exit(markerType);\n    effects.enter(stringType);\n    return atBreak;\n  }\n\n  /**\n   * In label, at something, before something else.\n   *\n   * ```markdown\n   * > | [a]\n   *      ^\n   * ```\n   *\n   * @type {State}\n   */\n  function atBreak(code) {\n    if (size > 999 || code === null || code === 91 || code === 93 && !seen ||\n    // To do: remove in the future once we\u2019ve switched from\n    // `micromark-extension-footnote` to `micromark-extension-gfm-footnote`,\n    // which doesn\u2019t need this.\n    // Hidden footnotes hook.\n    /* c8 ignore next 3 */\n    code === 94 && !size && '_hiddenFootnoteSupport' in self.parser.constructs) {\n      return nok(code);\n    }\n    if (code === 93) {\n      effects.exit(stringType);\n      effects.enter(markerType);\n      effects.consume(code);\n      effects.exit(markerType);\n      effects.exit(type);\n      return ok;\n    }\n\n    // To do: indent? Link chunks and EOLs together?\n    if (markdownLineEnding(code)) {\n      effects.enter(\"lineEnding\");\n      effects.consume(code);\n      effects.exit(\"lineEnding\");\n      return atBreak;\n    }\n    effects.enter(\"chunkString\", {\n      contentType: \"string\"\n    });\n    return labelInside(code);\n  }\n\n  /**\n   * In label, in text.\n   *\n   * ```markdown\n   * > | [a]\n   *      ^\n   * ```\n   *\n   * @type {State}\n   */\n  function labelInside(code) {\n    if (code === null || code === 91 || code === 93 || markdownLineEnding(code) || size++ > 999) {\n      effects.exit(\"chunkString\");\n      return atBreak(code);\n    }\n    effects.consume(code);\n    if (!seen) seen = !markdownSpace(code);\n    return code === 92 ? labelEscape : labelInside;\n  }\n\n  /**\n   * After `\\`, at a special character.\n   *\n   * ```markdown\n   * > | [a\\*a]\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function labelEscape(code) {\n    if (code === 91 || code === 92 || code === 93) {\n      effects.consume(code);\n      size++;\n      return labelInside;\n    }\n    return labelInside(code);\n  }\n}", "/**\n * @import {\n *   Code,\n *   Effects,\n *   State,\n *   TokenType\n * } from 'micromark-util-types'\n */\n\nimport { factorySpace } from 'micromark-factory-space';\nimport { markdownLineEnding } from 'micromark-util-character';\n/**\n * Parse titles.\n *\n * ###### Examples\n *\n * ```markdown\n * \"a\"\n * 'b'\n * (c)\n * \"a\n * b\"\n * 'a\n *     b'\n * (a\\)b)\n * ```\n *\n * @param {Effects} effects\n *   Context.\n * @param {State} ok\n *   State switched to when successful.\n * @param {State} nok\n *   State switched to when unsuccessful.\n * @param {TokenType} type\n *   Type of the whole title (`\"a\"`, `'b'`, `(c)`).\n * @param {TokenType} markerType\n *   Type for the markers (`\"`, `'`, `(`, and `)`).\n * @param {TokenType} stringType\n *   Type for the value (`a`).\n * @returns {State}\n *   Start state.\n */\nexport function factoryTitle(effects, ok, nok, type, markerType, stringType) {\n  /** @type {NonNullable<Code>} */\n  let marker;\n  return start;\n\n  /**\n   * Start of title.\n   *\n   * ```markdown\n   * > | \"a\"\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    if (code === 34 || code === 39 || code === 40) {\n      effects.enter(type);\n      effects.enter(markerType);\n      effects.consume(code);\n      effects.exit(markerType);\n      marker = code === 40 ? 41 : code;\n      return begin;\n    }\n    return nok(code);\n  }\n\n  /**\n   * After opening marker.\n   *\n   * This is also used at the closing marker.\n   *\n   * ```markdown\n   * > | \"a\"\n   *      ^\n   * ```\n   *\n   * @type {State}\n   */\n  function begin(code) {\n    if (code === marker) {\n      effects.enter(markerType);\n      effects.consume(code);\n      effects.exit(markerType);\n      effects.exit(type);\n      return ok;\n    }\n    effects.enter(stringType);\n    return atBreak(code);\n  }\n\n  /**\n   * At something, before something else.\n   *\n   * ```markdown\n   * > | \"a\"\n   *      ^\n   * ```\n   *\n   * @type {State}\n   */\n  function atBreak(code) {\n    if (code === marker) {\n      effects.exit(stringType);\n      return begin(marker);\n    }\n    if (code === null) {\n      return nok(code);\n    }\n\n    // Note: blank lines can\u2019t exist in content.\n    if (markdownLineEnding(code)) {\n      // To do: use `space_or_tab_eol_with_options`, connect.\n      effects.enter(\"lineEnding\");\n      effects.consume(code);\n      effects.exit(\"lineEnding\");\n      return factorySpace(effects, atBreak, \"linePrefix\");\n    }\n    effects.enter(\"chunkString\", {\n      contentType: \"string\"\n    });\n    return inside(code);\n  }\n\n  /**\n   *\n   *\n   * @type {State}\n   */\n  function inside(code) {\n    if (code === marker || code === null || markdownLineEnding(code)) {\n      effects.exit(\"chunkString\");\n      return atBreak(code);\n    }\n    effects.consume(code);\n    return code === 92 ? escape : inside;\n  }\n\n  /**\n   * After `\\`, at a special character.\n   *\n   * ```markdown\n   * > | \"a\\*b\"\n   *      ^\n   * ```\n   *\n   * @type {State}\n   */\n  function escape(code) {\n    if (code === marker || code === 92) {\n      effects.consume(code);\n      return inside;\n    }\n    return inside(code);\n  }\n}", "/**\n * @import {Effects, State} from 'micromark-util-types'\n */\n\nimport { factorySpace } from 'micromark-factory-space';\nimport { markdownLineEnding, markdownSpace } from 'micromark-util-character';\n/**\n * Parse spaces and tabs.\n *\n * There is no `nok` parameter:\n *\n * *   line endings or spaces in markdown are often optional, in which case this\n *     factory can be used and `ok` will be switched to whether spaces were found\n *     or not\n * *   one line ending or space can be detected with\n *     `markdownLineEndingOrSpace(code)` right before using `factoryWhitespace`\n *\n * @param {Effects} effects\n *   Context.\n * @param {State} ok\n *   State switched to when successful.\n * @returns {State}\n *   Start state.\n */\nexport function factoryWhitespace(effects, ok) {\n  /** @type {boolean} */\n  let seen;\n  return start;\n\n  /** @type {State} */\n  function start(code) {\n    if (markdownLineEnding(code)) {\n      effects.enter(\"lineEnding\");\n      effects.consume(code);\n      effects.exit(\"lineEnding\");\n      seen = true;\n      return start;\n    }\n    if (markdownSpace(code)) {\n      return factorySpace(effects, start, seen ? \"linePrefix\" : \"lineSuffix\")(code);\n    }\n    return ok(code);\n  }\n}", "/**\n * @import {\n *   Construct,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { factoryDestination } from 'micromark-factory-destination';\nimport { factoryLabel } from 'micromark-factory-label';\nimport { factorySpace } from 'micromark-factory-space';\nimport { factoryTitle } from 'micromark-factory-title';\nimport { factoryWhitespace } from 'micromark-factory-whitespace';\nimport { markdownLineEndingOrSpace, markdownLineEnding, markdownSpace } from 'micromark-util-character';\nimport { normalizeIdentifier } from 'micromark-util-normalize-identifier';\n/** @type {Construct} */\nexport const definition = {\n  name: 'definition',\n  tokenize: tokenizeDefinition\n};\n\n/** @type {Construct} */\nconst titleBefore = {\n  partial: true,\n  tokenize: tokenizeTitleBefore\n};\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeDefinition(effects, ok, nok) {\n  const self = this;\n  /** @type {string} */\n  let identifier;\n  return start;\n\n  /**\n   * At start of a definition.\n   *\n   * ```markdown\n   * > | [a]: b \"c\"\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    // Do not interrupt paragraphs (but do follow definitions).\n    // To do: do `interrupt` the way `markdown-rs` does.\n    // To do: parse whitespace the way `markdown-rs` does.\n    effects.enter(\"definition\");\n    return before(code);\n  }\n\n  /**\n   * After optional whitespace, at `[`.\n   *\n   * ```markdown\n   * > | [a]: b \"c\"\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function before(code) {\n    // To do: parse whitespace the way `markdown-rs` does.\n\n    return factoryLabel.call(self, effects, labelAfter,\n    // Note: we don\u2019t need to reset the way `markdown-rs` does.\n    nok, \"definitionLabel\", \"definitionLabelMarker\", \"definitionLabelString\")(code);\n  }\n\n  /**\n   * After label.\n   *\n   * ```markdown\n   * > | [a]: b \"c\"\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function labelAfter(code) {\n    identifier = normalizeIdentifier(self.sliceSerialize(self.events[self.events.length - 1][1]).slice(1, -1));\n    if (code === 58) {\n      effects.enter(\"definitionMarker\");\n      effects.consume(code);\n      effects.exit(\"definitionMarker\");\n      return markerAfter;\n    }\n    return nok(code);\n  }\n\n  /**\n   * After marker.\n   *\n   * ```markdown\n   * > | [a]: b \"c\"\n   *         ^\n   * ```\n   *\n   * @type {State}\n   */\n  function markerAfter(code) {\n    // Note: whitespace is optional.\n    return markdownLineEndingOrSpace(code) ? factoryWhitespace(effects, destinationBefore)(code) : destinationBefore(code);\n  }\n\n  /**\n   * Before destination.\n   *\n   * ```markdown\n   * > | [a]: b \"c\"\n   *          ^\n   * ```\n   *\n   * @type {State}\n   */\n  function destinationBefore(code) {\n    return factoryDestination(effects, destinationAfter,\n    // Note: we don\u2019t need to reset the way `markdown-rs` does.\n    nok, \"definitionDestination\", \"definitionDestinationLiteral\", \"definitionDestinationLiteralMarker\", \"definitionDestinationRaw\", \"definitionDestinationString\")(code);\n  }\n\n  /**\n   * After destination.\n   *\n   * ```markdown\n   * > | [a]: b \"c\"\n   *           ^\n   * ```\n   *\n   * @type {State}\n   */\n  function destinationAfter(code) {\n    return effects.attempt(titleBefore, after, after)(code);\n  }\n\n  /**\n   * After definition.\n   *\n   * ```markdown\n   * > | [a]: b\n   *           ^\n   * > | [a]: b \"c\"\n   *               ^\n   * ```\n   *\n   * @type {State}\n   */\n  function after(code) {\n    return markdownSpace(code) ? factorySpace(effects, afterWhitespace, \"whitespace\")(code) : afterWhitespace(code);\n  }\n\n  /**\n   * After definition, after optional whitespace.\n   *\n   * ```markdown\n   * > | [a]: b\n   *           ^\n   * > | [a]: b \"c\"\n   *               ^\n   * ```\n   *\n   * @type {State}\n   */\n  function afterWhitespace(code) {\n    if (code === null || markdownLineEnding(code)) {\n      effects.exit(\"definition\");\n\n      // Note: we don\u2019t care about uniqueness.\n      // It\u2019s likely that that doesn\u2019t happen very frequently.\n      // It is more likely that it wastes precious time.\n      self.parser.defined.push(identifier);\n\n      // To do: `markdown-rs` interrupt.\n      // // You\u2019d be interrupting.\n      // tokenizer.interrupt = true\n      return ok(code);\n    }\n    return nok(code);\n  }\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeTitleBefore(effects, ok, nok) {\n  return titleBefore;\n\n  /**\n   * After destination, at whitespace.\n   *\n   * ```markdown\n   * > | [a]: b\n   *           ^\n   * > | [a]: b \"c\"\n   *           ^\n   * ```\n   *\n   * @type {State}\n   */\n  function titleBefore(code) {\n    return markdownLineEndingOrSpace(code) ? factoryWhitespace(effects, beforeMarker)(code) : nok(code);\n  }\n\n  /**\n   * At title.\n   *\n   * ```markdown\n   *   | [a]: b\n   * > | \"c\"\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function beforeMarker(code) {\n    return factoryTitle(effects, titleAfter, nok, \"definitionTitle\", \"definitionTitleMarker\", \"definitionTitleString\")(code);\n  }\n\n  /**\n   * After title.\n   *\n   * ```markdown\n   * > | [a]: b \"c\"\n   *               ^\n   * ```\n   *\n   * @type {State}\n   */\n  function titleAfter(code) {\n    return markdownSpace(code) ? factorySpace(effects, titleAfterOptionalWhitespace, \"whitespace\")(code) : titleAfterOptionalWhitespace(code);\n  }\n\n  /**\n   * After title, after optional whitespace.\n   *\n   * ```markdown\n   * > | [a]: b \"c\"\n   *               ^\n   * ```\n   *\n   * @type {State}\n   */\n  function titleAfterOptionalWhitespace(code) {\n    return code === null || markdownLineEnding(code) ? ok(code) : nok(code);\n  }\n}", "/**\n * @import {\n *   Construct,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { markdownLineEnding } from 'micromark-util-character';\n/** @type {Construct} */\nexport const hardBreakEscape = {\n  name: 'hardBreakEscape',\n  tokenize: tokenizeHardBreakEscape\n};\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeHardBreakEscape(effects, ok, nok) {\n  return start;\n\n  /**\n   * Start of a hard break (escape).\n   *\n   * ```markdown\n   * > | a\\\n   *      ^\n   *   | b\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    effects.enter(\"hardBreakEscape\");\n    effects.consume(code);\n    return after;\n  }\n\n  /**\n   * After `\\`, at eol.\n   *\n   * ```markdown\n   * > | a\\\n   *       ^\n   *   | b\n   * ```\n   *\n   *  @type {State}\n   */\n  function after(code) {\n    if (markdownLineEnding(code)) {\n      effects.exit(\"hardBreakEscape\");\n      return ok(code);\n    }\n    return nok(code);\n  }\n}", "/**\n * @import {\n *   Construct,\n *   Resolver,\n *   State,\n *   TokenizeContext,\n *   Tokenizer,\n *   Token\n * } from 'micromark-util-types'\n */\n\nimport { factorySpace } from 'micromark-factory-space';\nimport { markdownLineEndingOrSpace, markdownLineEnding, markdownSpace } from 'micromark-util-character';\nimport { splice } from 'micromark-util-chunked';\n/** @type {Construct} */\nexport const headingAtx = {\n  name: 'headingAtx',\n  resolve: resolveHeadingAtx,\n  tokenize: tokenizeHeadingAtx\n};\n\n/** @type {Resolver} */\nfunction resolveHeadingAtx(events, context) {\n  let contentEnd = events.length - 2;\n  let contentStart = 3;\n  /** @type {Token} */\n  let content;\n  /** @type {Token} */\n  let text;\n\n  // Prefix whitespace, part of the opening.\n  if (events[contentStart][1].type === \"whitespace\") {\n    contentStart += 2;\n  }\n\n  // Suffix whitespace, part of the closing.\n  if (contentEnd - 2 > contentStart && events[contentEnd][1].type === \"whitespace\") {\n    contentEnd -= 2;\n  }\n  if (events[contentEnd][1].type === \"atxHeadingSequence\" && (contentStart === contentEnd - 1 || contentEnd - 4 > contentStart && events[contentEnd - 2][1].type === \"whitespace\")) {\n    contentEnd -= contentStart + 1 === contentEnd ? 2 : 4;\n  }\n  if (contentEnd > contentStart) {\n    content = {\n      type: \"atxHeadingText\",\n      start: events[contentStart][1].start,\n      end: events[contentEnd][1].end\n    };\n    text = {\n      type: \"chunkText\",\n      start: events[contentStart][1].start,\n      end: events[contentEnd][1].end,\n      contentType: \"text\"\n    };\n    splice(events, contentStart, contentEnd - contentStart + 1, [['enter', content, context], ['enter', text, context], ['exit', text, context], ['exit', content, context]]);\n  }\n  return events;\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeHeadingAtx(effects, ok, nok) {\n  let size = 0;\n  return start;\n\n  /**\n   * Start of a heading (atx).\n   *\n   * ```markdown\n   * > | ## aa\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    // To do: parse indent like `markdown-rs`.\n    effects.enter(\"atxHeading\");\n    return before(code);\n  }\n\n  /**\n   * After optional whitespace, at `#`.\n   *\n   * ```markdown\n   * > | ## aa\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function before(code) {\n    effects.enter(\"atxHeadingSequence\");\n    return sequenceOpen(code);\n  }\n\n  /**\n   * In opening sequence.\n   *\n   * ```markdown\n   * > | ## aa\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function sequenceOpen(code) {\n    if (code === 35 && size++ < 6) {\n      effects.consume(code);\n      return sequenceOpen;\n    }\n\n    // Always at least one `#`.\n    if (code === null || markdownLineEndingOrSpace(code)) {\n      effects.exit(\"atxHeadingSequence\");\n      return atBreak(code);\n    }\n    return nok(code);\n  }\n\n  /**\n   * After something, before something else.\n   *\n   * ```markdown\n   * > | ## aa\n   *       ^\n   * ```\n   *\n   * @type {State}\n   */\n  function atBreak(code) {\n    if (code === 35) {\n      effects.enter(\"atxHeadingSequence\");\n      return sequenceFurther(code);\n    }\n    if (code === null || markdownLineEnding(code)) {\n      effects.exit(\"atxHeading\");\n      // To do: interrupt like `markdown-rs`.\n      // // Feel free to interrupt.\n      // tokenizer.interrupt = false\n      return ok(code);\n    }\n    if (markdownSpace(code)) {\n      return factorySpace(effects, atBreak, \"whitespace\")(code);\n    }\n\n    // To do: generate `data` tokens, add the `text` token later.\n    // Needs edit map, see: `markdown.rs`.\n    effects.enter(\"atxHeadingText\");\n    return data(code);\n  }\n\n  /**\n   * In further sequence (after whitespace).\n   *\n   * Could be normal \u201Cvisible\u201D hashes in the heading or a final sequence.\n   *\n   * ```markdown\n   * > | ## aa ##\n   *           ^\n   * ```\n   *\n   * @type {State}\n   */\n  function sequenceFurther(code) {\n    if (code === 35) {\n      effects.consume(code);\n      return sequenceFurther;\n    }\n    effects.exit(\"atxHeadingSequence\");\n    return atBreak(code);\n  }\n\n  /**\n   * In text.\n   *\n   * ```markdown\n   * > | ## aa\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function data(code) {\n    if (code === null || code === 35 || markdownLineEndingOrSpace(code)) {\n      effects.exit(\"atxHeadingText\");\n      return atBreak(code);\n    }\n    effects.consume(code);\n    return data;\n  }\n}", "/**\n * List of lowercase HTML \u201Cblock\u201D tag names.\n *\n * The list, when parsing HTML (flow), results in more relaxed rules (condition\n * 6).\n * Because they are known blocks, the HTML-like syntax doesn\u2019t have to be\n * strictly parsed.\n * For tag names not in this list, a more strict algorithm (condition 7) is used\n * to detect whether the HTML-like syntax is seen as HTML (flow) or not.\n *\n * This is copied from:\n * <https://spec.commonmark.org/0.30/#html-blocks>.\n *\n * > \uD83D\uDC49 **Note**: `search` was added in `CommonMark@0.31`.\n */\nexport const htmlBlockNames = [\n  'address',\n  'article',\n  'aside',\n  'base',\n  'basefont',\n  'blockquote',\n  'body',\n  'caption',\n  'center',\n  'col',\n  'colgroup',\n  'dd',\n  'details',\n  'dialog',\n  'dir',\n  'div',\n  'dl',\n  'dt',\n  'fieldset',\n  'figcaption',\n  'figure',\n  'footer',\n  'form',\n  'frame',\n  'frameset',\n  'h1',\n  'h2',\n  'h3',\n  'h4',\n  'h5',\n  'h6',\n  'head',\n  'header',\n  'hr',\n  'html',\n  'iframe',\n  'legend',\n  'li',\n  'link',\n  'main',\n  'menu',\n  'menuitem',\n  'nav',\n  'noframes',\n  'ol',\n  'optgroup',\n  'option',\n  'p',\n  'param',\n  'search',\n  'section',\n  'summary',\n  'table',\n  'tbody',\n  'td',\n  'tfoot',\n  'th',\n  'thead',\n  'title',\n  'tr',\n  'track',\n  'ul'\n]\n\n/**\n * List of lowercase HTML \u201Craw\u201D tag names.\n *\n * The list, when parsing HTML (flow), results in HTML that can include lines\n * without exiting, until a closing tag also in this list is found (condition\n * 1).\n *\n * This module is copied from:\n * <https://spec.commonmark.org/0.30/#html-blocks>.\n *\n * > \uD83D\uDC49 **Note**: `textarea` was added in `CommonMark@0.30`.\n */\nexport const htmlRawNames = ['pre', 'script', 'style', 'textarea']\n", "/**\n * @import {\n *   Code,\n *   Construct,\n *   Resolver,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { asciiAlphanumeric, asciiAlpha, markdownLineEndingOrSpace, markdownLineEnding, markdownSpace } from 'micromark-util-character';\nimport { htmlBlockNames, htmlRawNames } from 'micromark-util-html-tag-name';\nimport { blankLine } from './blank-line.js';\n\n/** @type {Construct} */\nexport const htmlFlow = {\n  concrete: true,\n  name: 'htmlFlow',\n  resolveTo: resolveToHtmlFlow,\n  tokenize: tokenizeHtmlFlow\n};\n\n/** @type {Construct} */\nconst blankLineBefore = {\n  partial: true,\n  tokenize: tokenizeBlankLineBefore\n};\nconst nonLazyContinuationStart = {\n  partial: true,\n  tokenize: tokenizeNonLazyContinuationStart\n};\n\n/** @type {Resolver} */\nfunction resolveToHtmlFlow(events) {\n  let index = events.length;\n  while (index--) {\n    if (events[index][0] === 'enter' && events[index][1].type === \"htmlFlow\") {\n      break;\n    }\n  }\n  if (index > 1 && events[index - 2][1].type === \"linePrefix\") {\n    // Add the prefix start to the HTML token.\n    events[index][1].start = events[index - 2][1].start;\n    // Add the prefix start to the HTML line token.\n    events[index + 1][1].start = events[index - 2][1].start;\n    // Remove the line prefix.\n    events.splice(index - 2, 2);\n  }\n  return events;\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeHtmlFlow(effects, ok, nok) {\n  const self = this;\n  /** @type {number} */\n  let marker;\n  /** @type {boolean} */\n  let closingTag;\n  /** @type {string} */\n  let buffer;\n  /** @type {number} */\n  let index;\n  /** @type {Code} */\n  let markerB;\n  return start;\n\n  /**\n   * Start of HTML (flow).\n   *\n   * ```markdown\n   * > | <x />\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    // To do: parse indent like `markdown-rs`.\n    return before(code);\n  }\n\n  /**\n   * At `<`, after optional whitespace.\n   *\n   * ```markdown\n   * > | <x />\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function before(code) {\n    effects.enter(\"htmlFlow\");\n    effects.enter(\"htmlFlowData\");\n    effects.consume(code);\n    return open;\n  }\n\n  /**\n   * After `<`, at tag name or other stuff.\n   *\n   * ```markdown\n   * > | <x />\n   *      ^\n   * > | <!doctype>\n   *      ^\n   * > | <!--xxx-->\n   *      ^\n   * ```\n   *\n   * @type {State}\n   */\n  function open(code) {\n    if (code === 33) {\n      effects.consume(code);\n      return declarationOpen;\n    }\n    if (code === 47) {\n      effects.consume(code);\n      closingTag = true;\n      return tagCloseStart;\n    }\n    if (code === 63) {\n      effects.consume(code);\n      marker = 3;\n      // To do:\n      // tokenizer.concrete = true\n      // To do: use `markdown-rs` style interrupt.\n      // While we\u2019re in an instruction instead of a declaration, we\u2019re on a `?`\n      // right now, so we do need to search for `>`, similar to declarations.\n      return self.interrupt ? ok : continuationDeclarationInside;\n    }\n\n    // ASCII alphabetical.\n    if (asciiAlpha(code)) {\n      // Always the case.\n      effects.consume(code);\n      buffer = String.fromCharCode(code);\n      return tagName;\n    }\n    return nok(code);\n  }\n\n  /**\n   * After `<!`, at declaration, comment, or CDATA.\n   *\n   * ```markdown\n   * > | <!doctype>\n   *       ^\n   * > | <!--xxx-->\n   *       ^\n   * > | <![CDATA[>&<]]>\n   *       ^\n   * ```\n   *\n   * @type {State}\n   */\n  function declarationOpen(code) {\n    if (code === 45) {\n      effects.consume(code);\n      marker = 2;\n      return commentOpenInside;\n    }\n    if (code === 91) {\n      effects.consume(code);\n      marker = 5;\n      index = 0;\n      return cdataOpenInside;\n    }\n\n    // ASCII alphabetical.\n    if (asciiAlpha(code)) {\n      effects.consume(code);\n      marker = 4;\n      // // Do not form containers.\n      // tokenizer.concrete = true\n      return self.interrupt ? ok : continuationDeclarationInside;\n    }\n    return nok(code);\n  }\n\n  /**\n   * After `<!-`, inside a comment, at another `-`.\n   *\n   * ```markdown\n   * > | <!--xxx-->\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function commentOpenInside(code) {\n    if (code === 45) {\n      effects.consume(code);\n      // // Do not form containers.\n      // tokenizer.concrete = true\n      return self.interrupt ? ok : continuationDeclarationInside;\n    }\n    return nok(code);\n  }\n\n  /**\n   * After `<![`, inside CDATA, expecting `CDATA[`.\n   *\n   * ```markdown\n   * > | <![CDATA[>&<]]>\n   *        ^^^^^^\n   * ```\n   *\n   * @type {State}\n   */\n  function cdataOpenInside(code) {\n    const value = \"CDATA[\";\n    if (code === value.charCodeAt(index++)) {\n      effects.consume(code);\n      if (index === value.length) {\n        // // Do not form containers.\n        // tokenizer.concrete = true\n        return self.interrupt ? ok : continuation;\n      }\n      return cdataOpenInside;\n    }\n    return nok(code);\n  }\n\n  /**\n   * After `</`, in closing tag, at tag name.\n   *\n   * ```markdown\n   * > | </x>\n   *       ^\n   * ```\n   *\n   * @type {State}\n   */\n  function tagCloseStart(code) {\n    if (asciiAlpha(code)) {\n      // Always the case.\n      effects.consume(code);\n      buffer = String.fromCharCode(code);\n      return tagName;\n    }\n    return nok(code);\n  }\n\n  /**\n   * In tag name.\n   *\n   * ```markdown\n   * > | <ab>\n   *      ^^\n   * > | </ab>\n   *       ^^\n   * ```\n   *\n   * @type {State}\n   */\n  function tagName(code) {\n    if (code === null || code === 47 || code === 62 || markdownLineEndingOrSpace(code)) {\n      const slash = code === 47;\n      const name = buffer.toLowerCase();\n      if (!slash && !closingTag && htmlRawNames.includes(name)) {\n        marker = 1;\n        // // Do not form containers.\n        // tokenizer.concrete = true\n        return self.interrupt ? ok(code) : continuation(code);\n      }\n      if (htmlBlockNames.includes(buffer.toLowerCase())) {\n        marker = 6;\n        if (slash) {\n          effects.consume(code);\n          return basicSelfClosing;\n        }\n\n        // // Do not form containers.\n        // tokenizer.concrete = true\n        return self.interrupt ? ok(code) : continuation(code);\n      }\n      marker = 7;\n      // Do not support complete HTML when interrupting.\n      return self.interrupt && !self.parser.lazy[self.now().line] ? nok(code) : closingTag ? completeClosingTagAfter(code) : completeAttributeNameBefore(code);\n    }\n\n    // ASCII alphanumerical and `-`.\n    if (code === 45 || asciiAlphanumeric(code)) {\n      effects.consume(code);\n      buffer += String.fromCharCode(code);\n      return tagName;\n    }\n    return nok(code);\n  }\n\n  /**\n   * After closing slash of a basic tag name.\n   *\n   * ```markdown\n   * > | <div/>\n   *          ^\n   * ```\n   *\n   * @type {State}\n   */\n  function basicSelfClosing(code) {\n    if (code === 62) {\n      effects.consume(code);\n      // // Do not form containers.\n      // tokenizer.concrete = true\n      return self.interrupt ? ok : continuation;\n    }\n    return nok(code);\n  }\n\n  /**\n   * After closing slash of a complete tag name.\n   *\n   * ```markdown\n   * > | <x/>\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function completeClosingTagAfter(code) {\n    if (markdownSpace(code)) {\n      effects.consume(code);\n      return completeClosingTagAfter;\n    }\n    return completeEnd(code);\n  }\n\n  /**\n   * At an attribute name.\n   *\n   * At first, this state is used after a complete tag name, after whitespace,\n   * where it expects optional attributes or the end of the tag.\n   * It is also reused after attributes, when expecting more optional\n   * attributes.\n   *\n   * ```markdown\n   * > | <a />\n   *        ^\n   * > | <a :b>\n   *        ^\n   * > | <a _b>\n   *        ^\n   * > | <a b>\n   *        ^\n   * > | <a >\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function completeAttributeNameBefore(code) {\n    if (code === 47) {\n      effects.consume(code);\n      return completeEnd;\n    }\n\n    // ASCII alphanumerical and `:` and `_`.\n    if (code === 58 || code === 95 || asciiAlpha(code)) {\n      effects.consume(code);\n      return completeAttributeName;\n    }\n    if (markdownSpace(code)) {\n      effects.consume(code);\n      return completeAttributeNameBefore;\n    }\n    return completeEnd(code);\n  }\n\n  /**\n   * In attribute name.\n   *\n   * ```markdown\n   * > | <a :b>\n   *         ^\n   * > | <a _b>\n   *         ^\n   * > | <a b>\n   *         ^\n   * ```\n   *\n   * @type {State}\n   */\n  function completeAttributeName(code) {\n    // ASCII alphanumerical and `-`, `.`, `:`, and `_`.\n    if (code === 45 || code === 46 || code === 58 || code === 95 || asciiAlphanumeric(code)) {\n      effects.consume(code);\n      return completeAttributeName;\n    }\n    return completeAttributeNameAfter(code);\n  }\n\n  /**\n   * After attribute name, at an optional initializer, the end of the tag, or\n   * whitespace.\n   *\n   * ```markdown\n   * > | <a b>\n   *         ^\n   * > | <a b=c>\n   *         ^\n   * ```\n   *\n   * @type {State}\n   */\n  function completeAttributeNameAfter(code) {\n    if (code === 61) {\n      effects.consume(code);\n      return completeAttributeValueBefore;\n    }\n    if (markdownSpace(code)) {\n      effects.consume(code);\n      return completeAttributeNameAfter;\n    }\n    return completeAttributeNameBefore(code);\n  }\n\n  /**\n   * Before unquoted, double quoted, or single quoted attribute value, allowing\n   * whitespace.\n   *\n   * ```markdown\n   * > | <a b=c>\n   *          ^\n   * > | <a b=\"c\">\n   *          ^\n   * ```\n   *\n   * @type {State}\n   */\n  function completeAttributeValueBefore(code) {\n    if (code === null || code === 60 || code === 61 || code === 62 || code === 96) {\n      return nok(code);\n    }\n    if (code === 34 || code === 39) {\n      effects.consume(code);\n      markerB = code;\n      return completeAttributeValueQuoted;\n    }\n    if (markdownSpace(code)) {\n      effects.consume(code);\n      return completeAttributeValueBefore;\n    }\n    return completeAttributeValueUnquoted(code);\n  }\n\n  /**\n   * In double or single quoted attribute value.\n   *\n   * ```markdown\n   * > | <a b=\"c\">\n   *           ^\n   * > | <a b='c'>\n   *           ^\n   * ```\n   *\n   * @type {State}\n   */\n  function completeAttributeValueQuoted(code) {\n    if (code === markerB) {\n      effects.consume(code);\n      markerB = null;\n      return completeAttributeValueQuotedAfter;\n    }\n    if (code === null || markdownLineEnding(code)) {\n      return nok(code);\n    }\n    effects.consume(code);\n    return completeAttributeValueQuoted;\n  }\n\n  /**\n   * In unquoted attribute value.\n   *\n   * ```markdown\n   * > | <a b=c>\n   *          ^\n   * ```\n   *\n   * @type {State}\n   */\n  function completeAttributeValueUnquoted(code) {\n    if (code === null || code === 34 || code === 39 || code === 47 || code === 60 || code === 61 || code === 62 || code === 96 || markdownLineEndingOrSpace(code)) {\n      return completeAttributeNameAfter(code);\n    }\n    effects.consume(code);\n    return completeAttributeValueUnquoted;\n  }\n\n  /**\n   * After double or single quoted attribute value, before whitespace or the\n   * end of the tag.\n   *\n   * ```markdown\n   * > | <a b=\"c\">\n   *            ^\n   * ```\n   *\n   * @type {State}\n   */\n  function completeAttributeValueQuotedAfter(code) {\n    if (code === 47 || code === 62 || markdownSpace(code)) {\n      return completeAttributeNameBefore(code);\n    }\n    return nok(code);\n  }\n\n  /**\n   * In certain circumstances of a complete tag where only an `>` is allowed.\n   *\n   * ```markdown\n   * > | <a b=\"c\">\n   *             ^\n   * ```\n   *\n   * @type {State}\n   */\n  function completeEnd(code) {\n    if (code === 62) {\n      effects.consume(code);\n      return completeAfter;\n    }\n    return nok(code);\n  }\n\n  /**\n   * After `>` in a complete tag.\n   *\n   * ```markdown\n   * > | <x>\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function completeAfter(code) {\n    if (code === null || markdownLineEnding(code)) {\n      // // Do not form containers.\n      // tokenizer.concrete = true\n      return continuation(code);\n    }\n    if (markdownSpace(code)) {\n      effects.consume(code);\n      return completeAfter;\n    }\n    return nok(code);\n  }\n\n  /**\n   * In continuation of any HTML kind.\n   *\n   * ```markdown\n   * > | <!--xxx-->\n   *          ^\n   * ```\n   *\n   * @type {State}\n   */\n  function continuation(code) {\n    if (code === 45 && marker === 2) {\n      effects.consume(code);\n      return continuationCommentInside;\n    }\n    if (code === 60 && marker === 1) {\n      effects.consume(code);\n      return continuationRawTagOpen;\n    }\n    if (code === 62 && marker === 4) {\n      effects.consume(code);\n      return continuationClose;\n    }\n    if (code === 63 && marker === 3) {\n      effects.consume(code);\n      return continuationDeclarationInside;\n    }\n    if (code === 93 && marker === 5) {\n      effects.consume(code);\n      return continuationCdataInside;\n    }\n    if (markdownLineEnding(code) && (marker === 6 || marker === 7)) {\n      effects.exit(\"htmlFlowData\");\n      return effects.check(blankLineBefore, continuationAfter, continuationStart)(code);\n    }\n    if (code === null || markdownLineEnding(code)) {\n      effects.exit(\"htmlFlowData\");\n      return continuationStart(code);\n    }\n    effects.consume(code);\n    return continuation;\n  }\n\n  /**\n   * In continuation, at eol.\n   *\n   * ```markdown\n   * > | <x>\n   *        ^\n   *   | asd\n   * ```\n   *\n   * @type {State}\n   */\n  function continuationStart(code) {\n    return effects.check(nonLazyContinuationStart, continuationStartNonLazy, continuationAfter)(code);\n  }\n\n  /**\n   * In continuation, at eol, before non-lazy content.\n   *\n   * ```markdown\n   * > | <x>\n   *        ^\n   *   | asd\n   * ```\n   *\n   * @type {State}\n   */\n  function continuationStartNonLazy(code) {\n    effects.enter(\"lineEnding\");\n    effects.consume(code);\n    effects.exit(\"lineEnding\");\n    return continuationBefore;\n  }\n\n  /**\n   * In continuation, before non-lazy content.\n   *\n   * ```markdown\n   *   | <x>\n   * > | asd\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function continuationBefore(code) {\n    if (code === null || markdownLineEnding(code)) {\n      return continuationStart(code);\n    }\n    effects.enter(\"htmlFlowData\");\n    return continuation(code);\n  }\n\n  /**\n   * In comment continuation, after one `-`, expecting another.\n   *\n   * ```markdown\n   * > | <!--xxx-->\n   *             ^\n   * ```\n   *\n   * @type {State}\n   */\n  function continuationCommentInside(code) {\n    if (code === 45) {\n      effects.consume(code);\n      return continuationDeclarationInside;\n    }\n    return continuation(code);\n  }\n\n  /**\n   * In raw continuation, after `<`, at `/`.\n   *\n   * ```markdown\n   * > | <script>console.log(1)</script>\n   *                            ^\n   * ```\n   *\n   * @type {State}\n   */\n  function continuationRawTagOpen(code) {\n    if (code === 47) {\n      effects.consume(code);\n      buffer = '';\n      return continuationRawEndTag;\n    }\n    return continuation(code);\n  }\n\n  /**\n   * In raw continuation, after `</`, in a raw tag name.\n   *\n   * ```markdown\n   * > | <script>console.log(1)</script>\n   *                             ^^^^^^\n   * ```\n   *\n   * @type {State}\n   */\n  function continuationRawEndTag(code) {\n    if (code === 62) {\n      const name = buffer.toLowerCase();\n      if (htmlRawNames.includes(name)) {\n        effects.consume(code);\n        return continuationClose;\n      }\n      return continuation(code);\n    }\n    if (asciiAlpha(code) && buffer.length < 8) {\n      // Always the case.\n      effects.consume(code);\n      buffer += String.fromCharCode(code);\n      return continuationRawEndTag;\n    }\n    return continuation(code);\n  }\n\n  /**\n   * In cdata continuation, after `]`, expecting `]>`.\n   *\n   * ```markdown\n   * > | <![CDATA[>&<]]>\n   *                  ^\n   * ```\n   *\n   * @type {State}\n   */\n  function continuationCdataInside(code) {\n    if (code === 93) {\n      effects.consume(code);\n      return continuationDeclarationInside;\n    }\n    return continuation(code);\n  }\n\n  /**\n   * In declaration or instruction continuation, at `>`.\n   *\n   * ```markdown\n   * > | <!-->\n   *         ^\n   * > | <?>\n   *       ^\n   * > | <!q>\n   *        ^\n   * > | <!--ab-->\n   *             ^\n   * > | <![CDATA[>&<]]>\n   *                   ^\n   * ```\n   *\n   * @type {State}\n   */\n  function continuationDeclarationInside(code) {\n    if (code === 62) {\n      effects.consume(code);\n      return continuationClose;\n    }\n\n    // More dashes.\n    if (code === 45 && marker === 2) {\n      effects.consume(code);\n      return continuationDeclarationInside;\n    }\n    return continuation(code);\n  }\n\n  /**\n   * In closed continuation: everything we get until the eol/eof is part of it.\n   *\n   * ```markdown\n   * > | <!doctype>\n   *               ^\n   * ```\n   *\n   * @type {State}\n   */\n  function continuationClose(code) {\n    if (code === null || markdownLineEnding(code)) {\n      effects.exit(\"htmlFlowData\");\n      return continuationAfter(code);\n    }\n    effects.consume(code);\n    return continuationClose;\n  }\n\n  /**\n   * Done.\n   *\n   * ```markdown\n   * > | <!doctype>\n   *               ^\n   * ```\n   *\n   * @type {State}\n   */\n  function continuationAfter(code) {\n    effects.exit(\"htmlFlow\");\n    // // Feel free to interrupt.\n    // tokenizer.interrupt = false\n    // // No longer concrete.\n    // tokenizer.concrete = false\n    return ok(code);\n  }\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeNonLazyContinuationStart(effects, ok, nok) {\n  const self = this;\n  return start;\n\n  /**\n   * At eol, before continuation.\n   *\n   * ```markdown\n   * > | * ```js\n   *            ^\n   *   | b\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    if (markdownLineEnding(code)) {\n      effects.enter(\"lineEnding\");\n      effects.consume(code);\n      effects.exit(\"lineEnding\");\n      return after;\n    }\n    return nok(code);\n  }\n\n  /**\n   * A continuation.\n   *\n   * ```markdown\n   *   | * ```js\n   * > | b\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function after(code) {\n    return self.parser.lazy[self.now().line] ? nok(code) : ok(code);\n  }\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeBlankLineBefore(effects, ok, nok) {\n  return start;\n\n  /**\n   * Before eol, expecting blank line.\n   *\n   * ```markdown\n   * > | <div>\n   *          ^\n   *   |\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    effects.enter(\"lineEnding\");\n    effects.consume(code);\n    effects.exit(\"lineEnding\");\n    return effects.attempt(blankLine, ok, nok);\n  }\n}", "/**\n * @import {\n *   Code,\n *   Construct,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { factorySpace } from 'micromark-factory-space';\nimport { asciiAlphanumeric, asciiAlpha, markdownLineEndingOrSpace, markdownLineEnding, markdownSpace } from 'micromark-util-character';\n/** @type {Construct} */\nexport const htmlText = {\n  name: 'htmlText',\n  tokenize: tokenizeHtmlText\n};\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeHtmlText(effects, ok, nok) {\n  const self = this;\n  /** @type {NonNullable<Code> | undefined} */\n  let marker;\n  /** @type {number} */\n  let index;\n  /** @type {State} */\n  let returnState;\n  return start;\n\n  /**\n   * Start of HTML (text).\n   *\n   * ```markdown\n   * > | a <b> c\n   *       ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    effects.enter(\"htmlText\");\n    effects.enter(\"htmlTextData\");\n    effects.consume(code);\n    return open;\n  }\n\n  /**\n   * After `<`, at tag name or other stuff.\n   *\n   * ```markdown\n   * > | a <b> c\n   *        ^\n   * > | a <!doctype> c\n   *        ^\n   * > | a <!--b--> c\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function open(code) {\n    if (code === 33) {\n      effects.consume(code);\n      return declarationOpen;\n    }\n    if (code === 47) {\n      effects.consume(code);\n      return tagCloseStart;\n    }\n    if (code === 63) {\n      effects.consume(code);\n      return instruction;\n    }\n\n    // ASCII alphabetical.\n    if (asciiAlpha(code)) {\n      effects.consume(code);\n      return tagOpen;\n    }\n    return nok(code);\n  }\n\n  /**\n   * After `<!`, at declaration, comment, or CDATA.\n   *\n   * ```markdown\n   * > | a <!doctype> c\n   *         ^\n   * > | a <!--b--> c\n   *         ^\n   * > | a <![CDATA[>&<]]> c\n   *         ^\n   * ```\n   *\n   * @type {State}\n   */\n  function declarationOpen(code) {\n    if (code === 45) {\n      effects.consume(code);\n      return commentOpenInside;\n    }\n    if (code === 91) {\n      effects.consume(code);\n      index = 0;\n      return cdataOpenInside;\n    }\n    if (asciiAlpha(code)) {\n      effects.consume(code);\n      return declaration;\n    }\n    return nok(code);\n  }\n\n  /**\n   * In a comment, after `<!-`, at another `-`.\n   *\n   * ```markdown\n   * > | a <!--b--> c\n   *          ^\n   * ```\n   *\n   * @type {State}\n   */\n  function commentOpenInside(code) {\n    if (code === 45) {\n      effects.consume(code);\n      return commentEnd;\n    }\n    return nok(code);\n  }\n\n  /**\n   * In comment.\n   *\n   * ```markdown\n   * > | a <!--b--> c\n   *           ^\n   * ```\n   *\n   * @type {State}\n   */\n  function comment(code) {\n    if (code === null) {\n      return nok(code);\n    }\n    if (code === 45) {\n      effects.consume(code);\n      return commentClose;\n    }\n    if (markdownLineEnding(code)) {\n      returnState = comment;\n      return lineEndingBefore(code);\n    }\n    effects.consume(code);\n    return comment;\n  }\n\n  /**\n   * In comment, after `-`.\n   *\n   * ```markdown\n   * > | a <!--b--> c\n   *             ^\n   * ```\n   *\n   * @type {State}\n   */\n  function commentClose(code) {\n    if (code === 45) {\n      effects.consume(code);\n      return commentEnd;\n    }\n    return comment(code);\n  }\n\n  /**\n   * In comment, after `--`.\n   *\n   * ```markdown\n   * > | a <!--b--> c\n   *              ^\n   * ```\n   *\n   * @type {State}\n   */\n  function commentEnd(code) {\n    return code === 62 ? end(code) : code === 45 ? commentClose(code) : comment(code);\n  }\n\n  /**\n   * After `<![`, in CDATA, expecting `CDATA[`.\n   *\n   * ```markdown\n   * > | a <![CDATA[>&<]]> b\n   *          ^^^^^^\n   * ```\n   *\n   * @type {State}\n   */\n  function cdataOpenInside(code) {\n    const value = \"CDATA[\";\n    if (code === value.charCodeAt(index++)) {\n      effects.consume(code);\n      return index === value.length ? cdata : cdataOpenInside;\n    }\n    return nok(code);\n  }\n\n  /**\n   * In CDATA.\n   *\n   * ```markdown\n   * > | a <![CDATA[>&<]]> b\n   *                ^^^\n   * ```\n   *\n   * @type {State}\n   */\n  function cdata(code) {\n    if (code === null) {\n      return nok(code);\n    }\n    if (code === 93) {\n      effects.consume(code);\n      return cdataClose;\n    }\n    if (markdownLineEnding(code)) {\n      returnState = cdata;\n      return lineEndingBefore(code);\n    }\n    effects.consume(code);\n    return cdata;\n  }\n\n  /**\n   * In CDATA, after `]`, at another `]`.\n   *\n   * ```markdown\n   * > | a <![CDATA[>&<]]> b\n   *                    ^\n   * ```\n   *\n   * @type {State}\n   */\n  function cdataClose(code) {\n    if (code === 93) {\n      effects.consume(code);\n      return cdataEnd;\n    }\n    return cdata(code);\n  }\n\n  /**\n   * In CDATA, after `]]`, at `>`.\n   *\n   * ```markdown\n   * > | a <![CDATA[>&<]]> b\n   *                     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function cdataEnd(code) {\n    if (code === 62) {\n      return end(code);\n    }\n    if (code === 93) {\n      effects.consume(code);\n      return cdataEnd;\n    }\n    return cdata(code);\n  }\n\n  /**\n   * In declaration.\n   *\n   * ```markdown\n   * > | a <!b> c\n   *          ^\n   * ```\n   *\n   * @type {State}\n   */\n  function declaration(code) {\n    if (code === null || code === 62) {\n      return end(code);\n    }\n    if (markdownLineEnding(code)) {\n      returnState = declaration;\n      return lineEndingBefore(code);\n    }\n    effects.consume(code);\n    return declaration;\n  }\n\n  /**\n   * In instruction.\n   *\n   * ```markdown\n   * > | a <?b?> c\n   *         ^\n   * ```\n   *\n   * @type {State}\n   */\n  function instruction(code) {\n    if (code === null) {\n      return nok(code);\n    }\n    if (code === 63) {\n      effects.consume(code);\n      return instructionClose;\n    }\n    if (markdownLineEnding(code)) {\n      returnState = instruction;\n      return lineEndingBefore(code);\n    }\n    effects.consume(code);\n    return instruction;\n  }\n\n  /**\n   * In instruction, after `?`, at `>`.\n   *\n   * ```markdown\n   * > | a <?b?> c\n   *           ^\n   * ```\n   *\n   * @type {State}\n   */\n  function instructionClose(code) {\n    return code === 62 ? end(code) : instruction(code);\n  }\n\n  /**\n   * After `</`, in closing tag, at tag name.\n   *\n   * ```markdown\n   * > | a </b> c\n   *         ^\n   * ```\n   *\n   * @type {State}\n   */\n  function tagCloseStart(code) {\n    // ASCII alphabetical.\n    if (asciiAlpha(code)) {\n      effects.consume(code);\n      return tagClose;\n    }\n    return nok(code);\n  }\n\n  /**\n   * After `</x`, in a tag name.\n   *\n   * ```markdown\n   * > | a </b> c\n   *          ^\n   * ```\n   *\n   * @type {State}\n   */\n  function tagClose(code) {\n    // ASCII alphanumerical and `-`.\n    if (code === 45 || asciiAlphanumeric(code)) {\n      effects.consume(code);\n      return tagClose;\n    }\n    return tagCloseBetween(code);\n  }\n\n  /**\n   * In closing tag, after tag name.\n   *\n   * ```markdown\n   * > | a </b> c\n   *          ^\n   * ```\n   *\n   * @type {State}\n   */\n  function tagCloseBetween(code) {\n    if (markdownLineEnding(code)) {\n      returnState = tagCloseBetween;\n      return lineEndingBefore(code);\n    }\n    if (markdownSpace(code)) {\n      effects.consume(code);\n      return tagCloseBetween;\n    }\n    return end(code);\n  }\n\n  /**\n   * After `<x`, in opening tag name.\n   *\n   * ```markdown\n   * > | a <b> c\n   *         ^\n   * ```\n   *\n   * @type {State}\n   */\n  function tagOpen(code) {\n    // ASCII alphanumerical and `-`.\n    if (code === 45 || asciiAlphanumeric(code)) {\n      effects.consume(code);\n      return tagOpen;\n    }\n    if (code === 47 || code === 62 || markdownLineEndingOrSpace(code)) {\n      return tagOpenBetween(code);\n    }\n    return nok(code);\n  }\n\n  /**\n   * In opening tag, after tag name.\n   *\n   * ```markdown\n   * > | a <b> c\n   *         ^\n   * ```\n   *\n   * @type {State}\n   */\n  function tagOpenBetween(code) {\n    if (code === 47) {\n      effects.consume(code);\n      return end;\n    }\n\n    // ASCII alphabetical and `:` and `_`.\n    if (code === 58 || code === 95 || asciiAlpha(code)) {\n      effects.consume(code);\n      return tagOpenAttributeName;\n    }\n    if (markdownLineEnding(code)) {\n      returnState = tagOpenBetween;\n      return lineEndingBefore(code);\n    }\n    if (markdownSpace(code)) {\n      effects.consume(code);\n      return tagOpenBetween;\n    }\n    return end(code);\n  }\n\n  /**\n   * In attribute name.\n   *\n   * ```markdown\n   * > | a <b c> d\n   *          ^\n   * ```\n   *\n   * @type {State}\n   */\n  function tagOpenAttributeName(code) {\n    // ASCII alphabetical and `-`, `.`, `:`, and `_`.\n    if (code === 45 || code === 46 || code === 58 || code === 95 || asciiAlphanumeric(code)) {\n      effects.consume(code);\n      return tagOpenAttributeName;\n    }\n    return tagOpenAttributeNameAfter(code);\n  }\n\n  /**\n   * After attribute name, before initializer, the end of the tag, or\n   * whitespace.\n   *\n   * ```markdown\n   * > | a <b c> d\n   *           ^\n   * ```\n   *\n   * @type {State}\n   */\n  function tagOpenAttributeNameAfter(code) {\n    if (code === 61) {\n      effects.consume(code);\n      return tagOpenAttributeValueBefore;\n    }\n    if (markdownLineEnding(code)) {\n      returnState = tagOpenAttributeNameAfter;\n      return lineEndingBefore(code);\n    }\n    if (markdownSpace(code)) {\n      effects.consume(code);\n      return tagOpenAttributeNameAfter;\n    }\n    return tagOpenBetween(code);\n  }\n\n  /**\n   * Before unquoted, double quoted, or single quoted attribute value, allowing\n   * whitespace.\n   *\n   * ```markdown\n   * > | a <b c=d> e\n   *            ^\n   * ```\n   *\n   * @type {State}\n   */\n  function tagOpenAttributeValueBefore(code) {\n    if (code === null || code === 60 || code === 61 || code === 62 || code === 96) {\n      return nok(code);\n    }\n    if (code === 34 || code === 39) {\n      effects.consume(code);\n      marker = code;\n      return tagOpenAttributeValueQuoted;\n    }\n    if (markdownLineEnding(code)) {\n      returnState = tagOpenAttributeValueBefore;\n      return lineEndingBefore(code);\n    }\n    if (markdownSpace(code)) {\n      effects.consume(code);\n      return tagOpenAttributeValueBefore;\n    }\n    effects.consume(code);\n    return tagOpenAttributeValueUnquoted;\n  }\n\n  /**\n   * In double or single quoted attribute value.\n   *\n   * ```markdown\n   * > | a <b c=\"d\"> e\n   *             ^\n   * ```\n   *\n   * @type {State}\n   */\n  function tagOpenAttributeValueQuoted(code) {\n    if (code === marker) {\n      effects.consume(code);\n      marker = undefined;\n      return tagOpenAttributeValueQuotedAfter;\n    }\n    if (code === null) {\n      return nok(code);\n    }\n    if (markdownLineEnding(code)) {\n      returnState = tagOpenAttributeValueQuoted;\n      return lineEndingBefore(code);\n    }\n    effects.consume(code);\n    return tagOpenAttributeValueQuoted;\n  }\n\n  /**\n   * In unquoted attribute value.\n   *\n   * ```markdown\n   * > | a <b c=d> e\n   *            ^\n   * ```\n   *\n   * @type {State}\n   */\n  function tagOpenAttributeValueUnquoted(code) {\n    if (code === null || code === 34 || code === 39 || code === 60 || code === 61 || code === 96) {\n      return nok(code);\n    }\n    if (code === 47 || code === 62 || markdownLineEndingOrSpace(code)) {\n      return tagOpenBetween(code);\n    }\n    effects.consume(code);\n    return tagOpenAttributeValueUnquoted;\n  }\n\n  /**\n   * After double or single quoted attribute value, before whitespace or the end\n   * of the tag.\n   *\n   * ```markdown\n   * > | a <b c=\"d\"> e\n   *               ^\n   * ```\n   *\n   * @type {State}\n   */\n  function tagOpenAttributeValueQuotedAfter(code) {\n    if (code === 47 || code === 62 || markdownLineEndingOrSpace(code)) {\n      return tagOpenBetween(code);\n    }\n    return nok(code);\n  }\n\n  /**\n   * In certain circumstances of a tag where only an `>` is allowed.\n   *\n   * ```markdown\n   * > | a <b c=\"d\"> e\n   *               ^\n   * ```\n   *\n   * @type {State}\n   */\n  function end(code) {\n    if (code === 62) {\n      effects.consume(code);\n      effects.exit(\"htmlTextData\");\n      effects.exit(\"htmlText\");\n      return ok;\n    }\n    return nok(code);\n  }\n\n  /**\n   * At eol.\n   *\n   * > \uD83D\uDC49 **Note**: we can\u2019t have blank lines in text, so no need to worry about\n   * > empty tokens.\n   *\n   * ```markdown\n   * > | a <!--a\n   *            ^\n   *   | b-->\n   * ```\n   *\n   * @type {State}\n   */\n  function lineEndingBefore(code) {\n    effects.exit(\"htmlTextData\");\n    effects.enter(\"lineEnding\");\n    effects.consume(code);\n    effects.exit(\"lineEnding\");\n    return lineEndingAfter;\n  }\n\n  /**\n   * After eol, at optional whitespace.\n   *\n   * > \uD83D\uDC49 **Note**: we can\u2019t have blank lines in text, so no need to worry about\n   * > empty tokens.\n   *\n   * ```markdown\n   *   | a <!--a\n   * > | b-->\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function lineEndingAfter(code) {\n    // Always populated by defaults.\n\n    return markdownSpace(code) ? factorySpace(effects, lineEndingAfterPrefix, \"linePrefix\", self.parser.constructs.disable.null.includes('codeIndented') ? undefined : 4)(code) : lineEndingAfterPrefix(code);\n  }\n\n  /**\n   * After eol, after optional whitespace.\n   *\n   * > \uD83D\uDC49 **Note**: we can\u2019t have blank lines in text, so no need to worry about\n   * > empty tokens.\n   *\n   * ```markdown\n   *   | a <!--a\n   * > | b-->\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function lineEndingAfterPrefix(code) {\n    effects.enter(\"htmlTextData\");\n    return returnState(code);\n  }\n}", "/**\n * @import {\n *   Construct,\n *   Event,\n *   Resolver,\n *   State,\n *   TokenizeContext,\n *   Tokenizer,\n *   Token\n * } from 'micromark-util-types'\n */\n\nimport { factoryDestination } from 'micromark-factory-destination';\nimport { factoryLabel } from 'micromark-factory-label';\nimport { factoryTitle } from 'micromark-factory-title';\nimport { factoryWhitespace } from 'micromark-factory-whitespace';\nimport { markdownLineEndingOrSpace } from 'micromark-util-character';\nimport { push, splice } from 'micromark-util-chunked';\nimport { normalizeIdentifier } from 'micromark-util-normalize-identifier';\nimport { resolveAll } from 'micromark-util-resolve-all';\n/** @type {Construct} */\nexport const labelEnd = {\n  name: 'labelEnd',\n  resolveAll: resolveAllLabelEnd,\n  resolveTo: resolveToLabelEnd,\n  tokenize: tokenizeLabelEnd\n};\n\n/** @type {Construct} */\nconst resourceConstruct = {\n  tokenize: tokenizeResource\n};\n/** @type {Construct} */\nconst referenceFullConstruct = {\n  tokenize: tokenizeReferenceFull\n};\n/** @type {Construct} */\nconst referenceCollapsedConstruct = {\n  tokenize: tokenizeReferenceCollapsed\n};\n\n/** @type {Resolver} */\nfunction resolveAllLabelEnd(events) {\n  let index = -1;\n  /** @type {Array<Event>} */\n  const newEvents = [];\n  while (++index < events.length) {\n    const token = events[index][1];\n    newEvents.push(events[index]);\n    if (token.type === \"labelImage\" || token.type === \"labelLink\" || token.type === \"labelEnd\") {\n      // Remove the marker.\n      const offset = token.type === \"labelImage\" ? 4 : 2;\n      token.type = \"data\";\n      index += offset;\n    }\n  }\n\n  // If the events are equal, we don't have to copy newEvents to events\n  if (events.length !== newEvents.length) {\n    splice(events, 0, events.length, newEvents);\n  }\n  return events;\n}\n\n/** @type {Resolver} */\nfunction resolveToLabelEnd(events, context) {\n  let index = events.length;\n  let offset = 0;\n  /** @type {Token} */\n  let token;\n  /** @type {number | undefined} */\n  let open;\n  /** @type {number | undefined} */\n  let close;\n  /** @type {Array<Event>} */\n  let media;\n\n  // Find an opening.\n  while (index--) {\n    token = events[index][1];\n    if (open) {\n      // If we see another link, or inactive link label, we\u2019ve been here before.\n      if (token.type === \"link\" || token.type === \"labelLink\" && token._inactive) {\n        break;\n      }\n\n      // Mark other link openings as inactive, as we can\u2019t have links in\n      // links.\n      if (events[index][0] === 'enter' && token.type === \"labelLink\") {\n        token._inactive = true;\n      }\n    } else if (close) {\n      if (events[index][0] === 'enter' && (token.type === \"labelImage\" || token.type === \"labelLink\") && !token._balanced) {\n        open = index;\n        if (token.type !== \"labelLink\") {\n          offset = 2;\n          break;\n        }\n      }\n    } else if (token.type === \"labelEnd\") {\n      close = index;\n    }\n  }\n  const group = {\n    type: events[open][1].type === \"labelLink\" ? \"link\" : \"image\",\n    start: {\n      ...events[open][1].start\n    },\n    end: {\n      ...events[events.length - 1][1].end\n    }\n  };\n  const label = {\n    type: \"label\",\n    start: {\n      ...events[open][1].start\n    },\n    end: {\n      ...events[close][1].end\n    }\n  };\n  const text = {\n    type: \"labelText\",\n    start: {\n      ...events[open + offset + 2][1].end\n    },\n    end: {\n      ...events[close - 2][1].start\n    }\n  };\n  media = [['enter', group, context], ['enter', label, context]];\n\n  // Opening marker.\n  media = push(media, events.slice(open + 1, open + offset + 3));\n\n  // Text open.\n  media = push(media, [['enter', text, context]]);\n\n  // Always populated by defaults.\n\n  // Between.\n  media = push(media, resolveAll(context.parser.constructs.insideSpan.null, events.slice(open + offset + 4, close - 3), context));\n\n  // Text close, marker close, label close.\n  media = push(media, [['exit', text, context], events[close - 2], events[close - 1], ['exit', label, context]]);\n\n  // Reference, resource, or so.\n  media = push(media, events.slice(close + 1));\n\n  // Media close.\n  media = push(media, [['exit', group, context]]);\n  splice(events, open, events.length, media);\n  return events;\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeLabelEnd(effects, ok, nok) {\n  const self = this;\n  let index = self.events.length;\n  /** @type {Token} */\n  let labelStart;\n  /** @type {boolean} */\n  let defined;\n\n  // Find an opening.\n  while (index--) {\n    if ((self.events[index][1].type === \"labelImage\" || self.events[index][1].type === \"labelLink\") && !self.events[index][1]._balanced) {\n      labelStart = self.events[index][1];\n      break;\n    }\n  }\n  return start;\n\n  /**\n   * Start of label end.\n   *\n   * ```markdown\n   * > | [a](b) c\n   *       ^\n   * > | [a][b] c\n   *       ^\n   * > | [a][] b\n   *       ^\n   * > | [a] b\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    // If there is not an okay opening.\n    if (!labelStart) {\n      return nok(code);\n    }\n\n    // If the corresponding label (link) start is marked as inactive,\n    // it means we\u2019d be wrapping a link, like this:\n    //\n    // ```markdown\n    // > | a [b [c](d) e](f) g.\n    //                  ^\n    // ```\n    //\n    // We can\u2019t have that, so it\u2019s just balanced brackets.\n    if (labelStart._inactive) {\n      return labelEndNok(code);\n    }\n    defined = self.parser.defined.includes(normalizeIdentifier(self.sliceSerialize({\n      start: labelStart.end,\n      end: self.now()\n    })));\n    effects.enter(\"labelEnd\");\n    effects.enter(\"labelMarker\");\n    effects.consume(code);\n    effects.exit(\"labelMarker\");\n    effects.exit(\"labelEnd\");\n    return after;\n  }\n\n  /**\n   * After `]`.\n   *\n   * ```markdown\n   * > | [a](b) c\n   *       ^\n   * > | [a][b] c\n   *       ^\n   * > | [a][] b\n   *       ^\n   * > | [a] b\n   *       ^\n   * ```\n   *\n   * @type {State}\n   */\n  function after(code) {\n    // Note: `markdown-rs` also parses GFM footnotes here, which for us is in\n    // an extension.\n\n    // Resource (`[asd](fgh)`)?\n    if (code === 40) {\n      return effects.attempt(resourceConstruct, labelEndOk, defined ? labelEndOk : labelEndNok)(code);\n    }\n\n    // Full (`[asd][fgh]`) or collapsed (`[asd][]`) reference?\n    if (code === 91) {\n      return effects.attempt(referenceFullConstruct, labelEndOk, defined ? referenceNotFull : labelEndNok)(code);\n    }\n\n    // Shortcut (`[asd]`) reference?\n    return defined ? labelEndOk(code) : labelEndNok(code);\n  }\n\n  /**\n   * After `]`, at `[`, but not at a full reference.\n   *\n   * > \uD83D\uDC49 **Note**: we only get here if the label is defined.\n   *\n   * ```markdown\n   * > | [a][] b\n   *        ^\n   * > | [a] b\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function referenceNotFull(code) {\n    return effects.attempt(referenceCollapsedConstruct, labelEndOk, labelEndNok)(code);\n  }\n\n  /**\n   * Done, we found something.\n   *\n   * ```markdown\n   * > | [a](b) c\n   *           ^\n   * > | [a][b] c\n   *           ^\n   * > | [a][] b\n   *          ^\n   * > | [a] b\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function labelEndOk(code) {\n    // Note: `markdown-rs` does a bunch of stuff here.\n    return ok(code);\n  }\n\n  /**\n   * Done, it\u2019s nothing.\n   *\n   * There was an okay opening, but we didn\u2019t match anything.\n   *\n   * ```markdown\n   * > | [a](b c\n   *        ^\n   * > | [a][b c\n   *        ^\n   * > | [a] b\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function labelEndNok(code) {\n    labelStart._balanced = true;\n    return nok(code);\n  }\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeResource(effects, ok, nok) {\n  return resourceStart;\n\n  /**\n   * At a resource.\n   *\n   * ```markdown\n   * > | [a](b) c\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function resourceStart(code) {\n    effects.enter(\"resource\");\n    effects.enter(\"resourceMarker\");\n    effects.consume(code);\n    effects.exit(\"resourceMarker\");\n    return resourceBefore;\n  }\n\n  /**\n   * In resource, after `(`, at optional whitespace.\n   *\n   * ```markdown\n   * > | [a](b) c\n   *         ^\n   * ```\n   *\n   * @type {State}\n   */\n  function resourceBefore(code) {\n    return markdownLineEndingOrSpace(code) ? factoryWhitespace(effects, resourceOpen)(code) : resourceOpen(code);\n  }\n\n  /**\n   * In resource, after optional whitespace, at `)` or a destination.\n   *\n   * ```markdown\n   * > | [a](b) c\n   *         ^\n   * ```\n   *\n   * @type {State}\n   */\n  function resourceOpen(code) {\n    if (code === 41) {\n      return resourceEnd(code);\n    }\n    return factoryDestination(effects, resourceDestinationAfter, resourceDestinationMissing, \"resourceDestination\", \"resourceDestinationLiteral\", \"resourceDestinationLiteralMarker\", \"resourceDestinationRaw\", \"resourceDestinationString\", 32)(code);\n  }\n\n  /**\n   * In resource, after destination, at optional whitespace.\n   *\n   * ```markdown\n   * > | [a](b) c\n   *          ^\n   * ```\n   *\n   * @type {State}\n   */\n  function resourceDestinationAfter(code) {\n    return markdownLineEndingOrSpace(code) ? factoryWhitespace(effects, resourceBetween)(code) : resourceEnd(code);\n  }\n\n  /**\n   * At invalid destination.\n   *\n   * ```markdown\n   * > | [a](<<) b\n   *         ^\n   * ```\n   *\n   * @type {State}\n   */\n  function resourceDestinationMissing(code) {\n    return nok(code);\n  }\n\n  /**\n   * In resource, after destination and whitespace, at `(` or title.\n   *\n   * ```markdown\n   * > | [a](b ) c\n   *           ^\n   * ```\n   *\n   * @type {State}\n   */\n  function resourceBetween(code) {\n    if (code === 34 || code === 39 || code === 40) {\n      return factoryTitle(effects, resourceTitleAfter, nok, \"resourceTitle\", \"resourceTitleMarker\", \"resourceTitleString\")(code);\n    }\n    return resourceEnd(code);\n  }\n\n  /**\n   * In resource, after title, at optional whitespace.\n   *\n   * ```markdown\n   * > | [a](b \"c\") d\n   *              ^\n   * ```\n   *\n   * @type {State}\n   */\n  function resourceTitleAfter(code) {\n    return markdownLineEndingOrSpace(code) ? factoryWhitespace(effects, resourceEnd)(code) : resourceEnd(code);\n  }\n\n  /**\n   * In resource, at `)`.\n   *\n   * ```markdown\n   * > | [a](b) d\n   *          ^\n   * ```\n   *\n   * @type {State}\n   */\n  function resourceEnd(code) {\n    if (code === 41) {\n      effects.enter(\"resourceMarker\");\n      effects.consume(code);\n      effects.exit(\"resourceMarker\");\n      effects.exit(\"resource\");\n      return ok;\n    }\n    return nok(code);\n  }\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeReferenceFull(effects, ok, nok) {\n  const self = this;\n  return referenceFull;\n\n  /**\n   * In a reference (full), at the `[`.\n   *\n   * ```markdown\n   * > | [a][b] d\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function referenceFull(code) {\n    return factoryLabel.call(self, effects, referenceFullAfter, referenceFullMissing, \"reference\", \"referenceMarker\", \"referenceString\")(code);\n  }\n\n  /**\n   * In a reference (full), after `]`.\n   *\n   * ```markdown\n   * > | [a][b] d\n   *          ^\n   * ```\n   *\n   * @type {State}\n   */\n  function referenceFullAfter(code) {\n    return self.parser.defined.includes(normalizeIdentifier(self.sliceSerialize(self.events[self.events.length - 1][1]).slice(1, -1))) ? ok(code) : nok(code);\n  }\n\n  /**\n   * In reference (full) that was missing.\n   *\n   * ```markdown\n   * > | [a][b d\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function referenceFullMissing(code) {\n    return nok(code);\n  }\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeReferenceCollapsed(effects, ok, nok) {\n  return referenceCollapsedStart;\n\n  /**\n   * In reference (collapsed), at `[`.\n   *\n   * > \uD83D\uDC49 **Note**: we only get here if the label is defined.\n   *\n   * ```markdown\n   * > | [a][] d\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function referenceCollapsedStart(code) {\n    // We only attempt a collapsed label if there\u2019s a `[`.\n\n    effects.enter(\"reference\");\n    effects.enter(\"referenceMarker\");\n    effects.consume(code);\n    effects.exit(\"referenceMarker\");\n    return referenceCollapsedOpen;\n  }\n\n  /**\n   * In reference (collapsed), at `]`.\n   *\n   * > \uD83D\uDC49 **Note**: we only get here if the label is defined.\n   *\n   * ```markdown\n   * > | [a][] d\n   *         ^\n   * ```\n   *\n   *  @type {State}\n   */\n  function referenceCollapsedOpen(code) {\n    if (code === 93) {\n      effects.enter(\"referenceMarker\");\n      effects.consume(code);\n      effects.exit(\"referenceMarker\");\n      effects.exit(\"reference\");\n      return ok;\n    }\n    return nok(code);\n  }\n}", "/**\n * @import {\n *   Construct,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { labelEnd } from './label-end.js';\n\n/** @type {Construct} */\nexport const labelStartImage = {\n  name: 'labelStartImage',\n  resolveAll: labelEnd.resolveAll,\n  tokenize: tokenizeLabelStartImage\n};\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeLabelStartImage(effects, ok, nok) {\n  const self = this;\n  return start;\n\n  /**\n   * Start of label (image) start.\n   *\n   * ```markdown\n   * > | a ![b] c\n   *       ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    effects.enter(\"labelImage\");\n    effects.enter(\"labelImageMarker\");\n    effects.consume(code);\n    effects.exit(\"labelImageMarker\");\n    return open;\n  }\n\n  /**\n   * After `!`, at `[`.\n   *\n   * ```markdown\n   * > | a ![b] c\n   *        ^\n   * ```\n   *\n   * @type {State}\n   */\n  function open(code) {\n    if (code === 91) {\n      effects.enter(\"labelMarker\");\n      effects.consume(code);\n      effects.exit(\"labelMarker\");\n      effects.exit(\"labelImage\");\n      return after;\n    }\n    return nok(code);\n  }\n\n  /**\n   * After `![`.\n   *\n   * ```markdown\n   * > | a ![b] c\n   *         ^\n   * ```\n   *\n   * This is needed in because, when GFM footnotes are enabled, images never\n   * form when started with a `^`.\n   * Instead, links form:\n   *\n   * ```markdown\n   * ![^a](b)\n   *\n   * ![^a][b]\n   *\n   * [b]: c\n   * ```\n   *\n   * ```html\n   * <p>!<a href=\\\"b\\\">^a</a></p>\n   * <p>!<a href=\\\"c\\\">^a</a></p>\n   * ```\n   *\n   * @type {State}\n   */\n  function after(code) {\n    // To do: use a new field to do this, this is still needed for\n    // `micromark-extension-gfm-footnote`, but the `label-start-link`\n    // behavior isn\u2019t.\n    // Hidden footnotes hook.\n    /* c8 ignore next 3 */\n    return code === 94 && '_hiddenFootnoteSupport' in self.parser.constructs ? nok(code) : ok(code);\n  }\n}", "/**\n * @import {\n *   Construct,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { labelEnd } from './label-end.js';\n\n/** @type {Construct} */\nexport const labelStartLink = {\n  name: 'labelStartLink',\n  resolveAll: labelEnd.resolveAll,\n  tokenize: tokenizeLabelStartLink\n};\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeLabelStartLink(effects, ok, nok) {\n  const self = this;\n  return start;\n\n  /**\n   * Start of label (link) start.\n   *\n   * ```markdown\n   * > | a [b] c\n   *       ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    effects.enter(\"labelLink\");\n    effects.enter(\"labelMarker\");\n    effects.consume(code);\n    effects.exit(\"labelMarker\");\n    effects.exit(\"labelLink\");\n    return after;\n  }\n\n  /** @type {State} */\n  function after(code) {\n    // To do: this isn\u2019t needed in `micromark-extension-gfm-footnote`,\n    // remove.\n    // Hidden footnotes hook.\n    /* c8 ignore next 3 */\n    return code === 94 && '_hiddenFootnoteSupport' in self.parser.constructs ? nok(code) : ok(code);\n  }\n}", "/**\n * @import {\n *   Construct,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { factorySpace } from 'micromark-factory-space';\nimport { markdownLineEnding } from 'micromark-util-character';\n/** @type {Construct} */\nexport const lineEnding = {\n  name: 'lineEnding',\n  tokenize: tokenizeLineEnding\n};\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeLineEnding(effects, ok) {\n  return start;\n\n  /** @type {State} */\n  function start(code) {\n    effects.enter(\"lineEnding\");\n    effects.consume(code);\n    effects.exit(\"lineEnding\");\n    return factorySpace(effects, ok, \"linePrefix\");\n  }\n}", "/**\n * @import {\n *   Code,\n *   Construct,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { factorySpace } from 'micromark-factory-space';\nimport { markdownLineEnding, markdownSpace } from 'micromark-util-character';\n/** @type {Construct} */\nexport const thematicBreak = {\n  name: 'thematicBreak',\n  tokenize: tokenizeThematicBreak\n};\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeThematicBreak(effects, ok, nok) {\n  let size = 0;\n  /** @type {NonNullable<Code>} */\n  let marker;\n  return start;\n\n  /**\n   * Start of thematic break.\n   *\n   * ```markdown\n   * > | ***\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    effects.enter(\"thematicBreak\");\n    // To do: parse indent like `markdown-rs`.\n    return before(code);\n  }\n\n  /**\n   * After optional whitespace, at marker.\n   *\n   * ```markdown\n   * > | ***\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function before(code) {\n    marker = code;\n    return atBreak(code);\n  }\n\n  /**\n   * After something, before something else.\n   *\n   * ```markdown\n   * > | ***\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function atBreak(code) {\n    if (code === marker) {\n      effects.enter(\"thematicBreakSequence\");\n      return sequence(code);\n    }\n    if (size >= 3 && (code === null || markdownLineEnding(code))) {\n      effects.exit(\"thematicBreak\");\n      return ok(code);\n    }\n    return nok(code);\n  }\n\n  /**\n   * In sequence.\n   *\n   * ```markdown\n   * > | ***\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function sequence(code) {\n    if (code === marker) {\n      effects.consume(code);\n      size++;\n      return sequence;\n    }\n    effects.exit(\"thematicBreakSequence\");\n    return markdownSpace(code) ? factorySpace(effects, atBreak, \"whitespace\")(code) : atBreak(code);\n  }\n}", "/**\n * @import {\n *   Code,\n *   Construct,\n *   Exiter,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { factorySpace } from 'micromark-factory-space';\nimport { asciiDigit, markdownSpace } from 'micromark-util-character';\nimport { blankLine } from './blank-line.js';\nimport { thematicBreak } from './thematic-break.js';\n\n/** @type {Construct} */\nexport const list = {\n  continuation: {\n    tokenize: tokenizeListContinuation\n  },\n  exit: tokenizeListEnd,\n  name: 'list',\n  tokenize: tokenizeListStart\n};\n\n/** @type {Construct} */\nconst listItemPrefixWhitespaceConstruct = {\n  partial: true,\n  tokenize: tokenizeListItemPrefixWhitespace\n};\n\n/** @type {Construct} */\nconst indentConstruct = {\n  partial: true,\n  tokenize: tokenizeIndent\n};\n\n// To do: `markdown-rs` parses list items on their own and later stitches them\n// together.\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeListStart(effects, ok, nok) {\n  const self = this;\n  const tail = self.events[self.events.length - 1];\n  let initialSize = tail && tail[1].type === \"linePrefix\" ? tail[2].sliceSerialize(tail[1], true).length : 0;\n  let size = 0;\n  return start;\n\n  /** @type {State} */\n  function start(code) {\n    const kind = self.containerState.type || (code === 42 || code === 43 || code === 45 ? \"listUnordered\" : \"listOrdered\");\n    if (kind === \"listUnordered\" ? !self.containerState.marker || code === self.containerState.marker : asciiDigit(code)) {\n      if (!self.containerState.type) {\n        self.containerState.type = kind;\n        effects.enter(kind, {\n          _container: true\n        });\n      }\n      if (kind === \"listUnordered\") {\n        effects.enter(\"listItemPrefix\");\n        return code === 42 || code === 45 ? effects.check(thematicBreak, nok, atMarker)(code) : atMarker(code);\n      }\n      if (!self.interrupt || code === 49) {\n        effects.enter(\"listItemPrefix\");\n        effects.enter(\"listItemValue\");\n        return inside(code);\n      }\n    }\n    return nok(code);\n  }\n\n  /** @type {State} */\n  function inside(code) {\n    if (asciiDigit(code) && ++size < 10) {\n      effects.consume(code);\n      return inside;\n    }\n    if ((!self.interrupt || size < 2) && (self.containerState.marker ? code === self.containerState.marker : code === 41 || code === 46)) {\n      effects.exit(\"listItemValue\");\n      return atMarker(code);\n    }\n    return nok(code);\n  }\n\n  /**\n   * @type {State}\n   **/\n  function atMarker(code) {\n    effects.enter(\"listItemMarker\");\n    effects.consume(code);\n    effects.exit(\"listItemMarker\");\n    self.containerState.marker = self.containerState.marker || code;\n    return effects.check(blankLine,\n    // Can\u2019t be empty when interrupting.\n    self.interrupt ? nok : onBlank, effects.attempt(listItemPrefixWhitespaceConstruct, endOfPrefix, otherPrefix));\n  }\n\n  /** @type {State} */\n  function onBlank(code) {\n    self.containerState.initialBlankLine = true;\n    initialSize++;\n    return endOfPrefix(code);\n  }\n\n  /** @type {State} */\n  function otherPrefix(code) {\n    if (markdownSpace(code)) {\n      effects.enter(\"listItemPrefixWhitespace\");\n      effects.consume(code);\n      effects.exit(\"listItemPrefixWhitespace\");\n      return endOfPrefix;\n    }\n    return nok(code);\n  }\n\n  /** @type {State} */\n  function endOfPrefix(code) {\n    self.containerState.size = initialSize + self.sliceSerialize(effects.exit(\"listItemPrefix\"), true).length;\n    return ok(code);\n  }\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeListContinuation(effects, ok, nok) {\n  const self = this;\n  self.containerState._closeFlow = undefined;\n  return effects.check(blankLine, onBlank, notBlank);\n\n  /** @type {State} */\n  function onBlank(code) {\n    self.containerState.furtherBlankLines = self.containerState.furtherBlankLines || self.containerState.initialBlankLine;\n\n    // We have a blank line.\n    // Still, try to consume at most the items size.\n    return factorySpace(effects, ok, \"listItemIndent\", self.containerState.size + 1)(code);\n  }\n\n  /** @type {State} */\n  function notBlank(code) {\n    if (self.containerState.furtherBlankLines || !markdownSpace(code)) {\n      self.containerState.furtherBlankLines = undefined;\n      self.containerState.initialBlankLine = undefined;\n      return notInCurrentItem(code);\n    }\n    self.containerState.furtherBlankLines = undefined;\n    self.containerState.initialBlankLine = undefined;\n    return effects.attempt(indentConstruct, ok, notInCurrentItem)(code);\n  }\n\n  /** @type {State} */\n  function notInCurrentItem(code) {\n    // While we do continue, we signal that the flow should be closed.\n    self.containerState._closeFlow = true;\n    // As we\u2019re closing flow, we\u2019re no longer interrupting.\n    self.interrupt = undefined;\n    // Always populated by defaults.\n\n    return factorySpace(effects, effects.attempt(list, ok, nok), \"linePrefix\", self.parser.constructs.disable.null.includes('codeIndented') ? undefined : 4)(code);\n  }\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeIndent(effects, ok, nok) {\n  const self = this;\n  return factorySpace(effects, afterPrefix, \"listItemIndent\", self.containerState.size + 1);\n\n  /** @type {State} */\n  function afterPrefix(code) {\n    const tail = self.events[self.events.length - 1];\n    return tail && tail[1].type === \"listItemIndent\" && tail[2].sliceSerialize(tail[1], true).length === self.containerState.size ? ok(code) : nok(code);\n  }\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Exiter}\n */\nfunction tokenizeListEnd(effects) {\n  effects.exit(this.containerState.type);\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeListItemPrefixWhitespace(effects, ok, nok) {\n  const self = this;\n\n  // Always populated by defaults.\n\n  return factorySpace(effects, afterPrefix, \"listItemPrefixWhitespace\", self.parser.constructs.disable.null.includes('codeIndented') ? undefined : 4 + 1);\n\n  /** @type {State} */\n  function afterPrefix(code) {\n    const tail = self.events[self.events.length - 1];\n    return !markdownSpace(code) && tail && tail[1].type === \"listItemPrefixWhitespace\" ? ok(code) : nok(code);\n  }\n}", "/**\n * @import {\n *   Code,\n *   Construct,\n *   Resolver,\n *   State,\n *   TokenizeContext,\n *   Tokenizer\n * } from 'micromark-util-types'\n */\n\nimport { factorySpace } from 'micromark-factory-space';\nimport { markdownLineEnding, markdownSpace } from 'micromark-util-character';\n/** @type {Construct} */\nexport const setextUnderline = {\n  name: 'setextUnderline',\n  resolveTo: resolveToSetextUnderline,\n  tokenize: tokenizeSetextUnderline\n};\n\n/** @type {Resolver} */\nfunction resolveToSetextUnderline(events, context) {\n  // To do: resolve like `markdown-rs`.\n  let index = events.length;\n  /** @type {number | undefined} */\n  let content;\n  /** @type {number | undefined} */\n  let text;\n  /** @type {number | undefined} */\n  let definition;\n\n  // Find the opening of the content.\n  // It\u2019ll always exist: we don\u2019t tokenize if it isn\u2019t there.\n  while (index--) {\n    if (events[index][0] === 'enter') {\n      if (events[index][1].type === \"content\") {\n        content = index;\n        break;\n      }\n      if (events[index][1].type === \"paragraph\") {\n        text = index;\n      }\n    }\n    // Exit\n    else {\n      if (events[index][1].type === \"content\") {\n        // Remove the content end (if needed we\u2019ll add it later)\n        events.splice(index, 1);\n      }\n      if (!definition && events[index][1].type === \"definition\") {\n        definition = index;\n      }\n    }\n  }\n  const heading = {\n    type: \"setextHeading\",\n    start: {\n      ...events[content][1].start\n    },\n    end: {\n      ...events[events.length - 1][1].end\n    }\n  };\n\n  // Change the paragraph to setext heading text.\n  events[text][1].type = \"setextHeadingText\";\n\n  // If we have definitions in the content, we\u2019ll keep on having content,\n  // but we need move it.\n  if (definition) {\n    events.splice(text, 0, ['enter', heading, context]);\n    events.splice(definition + 1, 0, ['exit', events[content][1], context]);\n    events[content][1].end = {\n      ...events[definition][1].end\n    };\n  } else {\n    events[content][1] = heading;\n  }\n\n  // Add the heading exit at the end.\n  events.push(['exit', heading, context]);\n  return events;\n}\n\n/**\n * @this {TokenizeContext}\n *   Context.\n * @type {Tokenizer}\n */\nfunction tokenizeSetextUnderline(effects, ok, nok) {\n  const self = this;\n  /** @type {NonNullable<Code>} */\n  let marker;\n  return start;\n\n  /**\n   * At start of heading (setext) underline.\n   *\n   * ```markdown\n   *   | aa\n   * > | ==\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function start(code) {\n    let index = self.events.length;\n    /** @type {boolean | undefined} */\n    let paragraph;\n    // Find an opening.\n    while (index--) {\n      // Skip enter/exit of line ending, line prefix, and content.\n      // We can now either have a definition or a paragraph.\n      if (self.events[index][1].type !== \"lineEnding\" && self.events[index][1].type !== \"linePrefix\" && self.events[index][1].type !== \"content\") {\n        paragraph = self.events[index][1].type === \"paragraph\";\n        break;\n      }\n    }\n\n    // To do: handle lazy/pierce like `markdown-rs`.\n    // To do: parse indent like `markdown-rs`.\n    if (!self.parser.lazy[self.now().line] && (self.interrupt || paragraph)) {\n      effects.enter(\"setextHeadingLine\");\n      marker = code;\n      return before(code);\n    }\n    return nok(code);\n  }\n\n  /**\n   * After optional whitespace, at `-` or `=`.\n   *\n   * ```markdown\n   *   | aa\n   * > | ==\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function before(code) {\n    effects.enter(\"setextHeadingLineSequence\");\n    return inside(code);\n  }\n\n  /**\n   * In sequence.\n   *\n   * ```markdown\n   *   | aa\n   * > | ==\n   *     ^\n   * ```\n   *\n   * @type {State}\n   */\n  function inside(code) {\n    if (code === marker) {\n      effects.consume(code);\n      return inside;\n    }\n    effects.exit(\"setextHeadingLineSequence\");\n    return markdownSpace(code) ? factorySpace(effects, after, \"lineSuffix\")(code) : after(code);\n  }\n\n  /**\n   * After sequence, after optional whitespace.\n   *\n   * ```markdown\n   *   | aa\n   * > | ==\n   *       ^\n   * ```\n   *\n   * @type {State}\n   */\n  function after(code) {\n    if (code === null || markdownLineEnding(code)) {\n      effects.exit(\"setextHeadingLine\");\n      return ok(code);\n    }\n    return nok(code);\n  }\n}", "/**\n * @import {\n *   InitialConstruct,\n *   Initializer,\n *   State,\n *   TokenizeContext\n * } from 'micromark-util-types'\n */\n\nimport { blankLine, content } from 'micromark-core-commonmark';\nimport { factorySpace } from 'micromark-factory-space';\nimport { markdownLineEnding } from 'micromark-util-character';\n/** @type {InitialConstruct} */\nexport const flow = {\n  tokenize: initializeFlow\n};\n\n/**\n * @this {TokenizeContext}\n *   Self.\n * @type {Initializer}\n *   Initializer.\n */\nfunction initializeFlow(effects) {\n  const self = this;\n  const initial = effects.attempt(\n  // Try to parse a blank line.\n  blankLine, atBlankEnding,\n  // Try to parse initial flow (essentially, only code).\n  effects.attempt(this.parser.constructs.flowInitial, afterConstruct, factorySpace(effects, effects.attempt(this.parser.constructs.flow, afterConstruct, effects.attempt(content, afterConstruct)), \"linePrefix\")));\n  return initial;\n\n  /** @type {State} */\n  function atBlankEnding(code) {\n    if (code === null) {\n      effects.consume(code);\n      return;\n    }\n    effects.enter(\"lineEndingBlank\");\n    effects.consume(code);\n    effects.exit(\"lineEndingBlank\");\n    self.currentConstruct = undefined;\n    return initial;\n  }\n\n  /** @type {State} */\n  function afterConstruct(code) {\n    if (code === null) {\n      effects.consume(code);\n      return;\n    }\n    effects.enter(\"lineEnding\");\n    effects.consume(code);\n    effects.exit(\"lineEnding\");\n    self.currentConstruct = undefined;\n    return initial;\n  }\n}", "/**\n * @import {\n *   Code,\n *   InitialConstruct,\n *   Initializer,\n *   Resolver,\n *   State,\n *   TokenizeContext\n * } from 'micromark-util-types'\n */\n\nexport const resolver = {\n  resolveAll: createResolver()\n};\nexport const string = initializeFactory('string');\nexport const text = initializeFactory('text');\n\n/**\n * @param {'string' | 'text'} field\n *   Field.\n * @returns {InitialConstruct}\n *   Construct.\n */\nfunction initializeFactory(field) {\n  return {\n    resolveAll: createResolver(field === 'text' ? resolveAllLineSuffixes : undefined),\n    tokenize: initializeText\n  };\n\n  /**\n   * @this {TokenizeContext}\n   *   Context.\n   * @type {Initializer}\n   */\n  function initializeText(effects) {\n    const self = this;\n    const constructs = this.parser.constructs[field];\n    const text = effects.attempt(constructs, start, notText);\n    return start;\n\n    /** @type {State} */\n    function start(code) {\n      return atBreak(code) ? text(code) : notText(code);\n    }\n\n    /** @type {State} */\n    function notText(code) {\n      if (code === null) {\n        effects.consume(code);\n        return;\n      }\n      effects.enter(\"data\");\n      effects.consume(code);\n      return data;\n    }\n\n    /** @type {State} */\n    function data(code) {\n      if (atBreak(code)) {\n        effects.exit(\"data\");\n        return text(code);\n      }\n\n      // Data.\n      effects.consume(code);\n      return data;\n    }\n\n    /**\n     * @param {Code} code\n     *   Code.\n     * @returns {boolean}\n     *   Whether the code is a break.\n     */\n    function atBreak(code) {\n      if (code === null) {\n        return true;\n      }\n      const list = constructs[code];\n      let index = -1;\n      if (list) {\n        // Always populated by defaults.\n\n        while (++index < list.length) {\n          const item = list[index];\n          if (!item.previous || item.previous.call(self, self.previous)) {\n            return true;\n          }\n        }\n      }\n      return false;\n    }\n  }\n}\n\n/**\n * @param {Resolver | undefined} [extraResolver]\n *   Resolver.\n * @returns {Resolver}\n *   Resolver.\n */\nfunction createResolver(extraResolver) {\n  return resolveAllText;\n\n  /** @type {Resolver} */\n  function resolveAllText(events, context) {\n    let index = -1;\n    /** @type {number | undefined} */\n    let enter;\n\n    // A rather boring computation (to merge adjacent `data` events) which\n    // improves mm performance by 29%.\n    while (++index <= events.length) {\n      if (enter === undefined) {\n        if (events[index] && events[index][1].type === \"data\") {\n          enter = index;\n          index++;\n        }\n      } else if (!events[index] || events[index][1].type !== \"data\") {\n        // Don\u2019t do anything if there is one data token.\n        if (index !== enter + 2) {\n          events[enter][1].end = events[index - 1][1].end;\n          events.splice(enter + 2, index - enter - 2);\n          index = enter + 2;\n        }\n        enter = undefined;\n      }\n    }\n    return extraResolver ? extraResolver(events, context) : events;\n  }\n}\n\n/**\n * A rather ugly set of instructions which again looks at chunks in the input\n * stream.\n * The reason to do this here is that it is *much* faster to parse in reverse.\n * And that we can\u2019t hook into `null` to split the line suffix before an EOF.\n * To do: figure out if we can make this into a clean utility, or even in core.\n * As it will be useful for GFMs literal autolink extension (and maybe even\n * tables?)\n *\n * @type {Resolver}\n */\nfunction resolveAllLineSuffixes(events, context) {\n  let eventIndex = 0; // Skip first.\n\n  while (++eventIndex <= events.length) {\n    if ((eventIndex === events.length || events[eventIndex][1].type === \"lineEnding\") && events[eventIndex - 1][1].type === \"data\") {\n      const data = events[eventIndex - 1][1];\n      const chunks = context.sliceStream(data);\n      let index = chunks.length;\n      let bufferIndex = -1;\n      let size = 0;\n      /** @type {boolean | undefined} */\n      let tabs;\n      while (index--) {\n        const chunk = chunks[index];\n        if (typeof chunk === 'string') {\n          bufferIndex = chunk.length;\n          while (chunk.charCodeAt(bufferIndex - 1) === 32) {\n            size++;\n            bufferIndex--;\n          }\n          if (bufferIndex) break;\n          bufferIndex = -1;\n        }\n        // Number\n        else if (chunk === -2) {\n          tabs = true;\n          size++;\n        } else if (chunk === -1) {\n          // Empty\n        } else {\n          // Replacement character, exit.\n          index++;\n          break;\n        }\n      }\n\n      // Allow final trailing whitespace.\n      if (context._contentTypeTextTrailing && eventIndex === events.length) {\n        size = 0;\n      }\n      if (size) {\n        const token = {\n          type: eventIndex === events.length || tabs || size < 2 ? \"lineSuffix\" : \"hardBreakTrailing\",\n          start: {\n            _bufferIndex: index ? bufferIndex : data.start._bufferIndex + bufferIndex,\n            _index: data.start._index + index,\n            line: data.end.line,\n            column: data.end.column - size,\n            offset: data.end.offset - size\n          },\n          end: {\n            ...data.end\n          }\n        };\n        data.end = {\n          ...token.start\n        };\n        if (data.start.offset === data.end.offset) {\n          Object.assign(data, token);\n        } else {\n          events.splice(eventIndex, 0, ['enter', token, context], ['exit', token, context]);\n          eventIndex += 2;\n        }\n      }\n      eventIndex++;\n    }\n  }\n  return events;\n}", "/**\n * @import {Extension} from 'micromark-util-types'\n */\n\nimport { attention, autolink, blockQuote, characterEscape, characterReference, codeFenced, codeIndented, codeText, definition, hardBreakEscape, headingAtx, htmlFlow, htmlText, labelEnd, labelStartImage, labelStartLink, lineEnding, list, setextUnderline, thematicBreak } from 'micromark-core-commonmark';\nimport { resolver as resolveText } from './initialize/text.js';\n\n/** @satisfies {Extension['document']} */\nexport const document = {\n  [42]: list,\n  [43]: list,\n  [45]: list,\n  [48]: list,\n  [49]: list,\n  [50]: list,\n  [51]: list,\n  [52]: list,\n  [53]: list,\n  [54]: list,\n  [55]: list,\n  [56]: list,\n  [57]: list,\n  [62]: blockQuote\n};\n\n/** @satisfies {Extension['contentInitial']} */\nexport const contentInitial = {\n  [91]: definition\n};\n\n/** @satisfies {Extension['flowInitial']} */\nexport const flowInitial = {\n  [-2]: codeIndented,\n  [-1]: codeIndented,\n  [32]: codeIndented\n};\n\n/** @satisfies {Extension['flow']} */\nexport const flow = {\n  [35]: headingAtx,\n  [42]: thematicBreak,\n  [45]: [setextUnderline, thematicBreak],\n  [60]: htmlFlow,\n  [61]: setextUnderline,\n  [95]: thematicBreak,\n  [96]: codeFenced,\n  [126]: codeFenced\n};\n\n/** @satisfies {Extension['string']} */\nexport const string = {\n  [38]: characterReference,\n  [92]: characterEscape\n};\n\n/** @satisfies {Extension['text']} */\nexport const text = {\n  [-5]: lineEnding,\n  [-4]: lineEnding,\n  [-3]: lineEnding,\n  [33]: labelStartImage,\n  [38]: characterReference,\n  [42]: attention,\n  [60]: [autolink, htmlText],\n  [91]: labelStartLink,\n  [92]: [hardBreakEscape, characterEscape],\n  [93]: labelEnd,\n  [95]: attention,\n  [96]: codeText\n};\n\n/** @satisfies {Extension['insideSpan']} */\nexport const insideSpan = {\n  null: [attention, resolveText]\n};\n\n/** @satisfies {Extension['attentionMarkers']} */\nexport const attentionMarkers = {\n  null: [42, 95]\n};\n\n/** @satisfies {Extension['disable']} */\nexport const disable = {\n  null: []\n};", "/**\n * @import {\n *   Chunk,\n *   Code,\n *   ConstructRecord,\n *   Construct,\n *   Effects,\n *   InitialConstruct,\n *   ParseContext,\n *   Point,\n *   State,\n *   TokenizeContext,\n *   Token\n * } from 'micromark-util-types'\n */\n\n/**\n * @callback Restore\n *   Restore the state.\n * @returns {undefined}\n *   Nothing.\n *\n * @typedef Info\n *   Info.\n * @property {Restore} restore\n *   Restore.\n * @property {number} from\n *   From.\n *\n * @callback ReturnHandle\n *   Handle a successful run.\n * @param {Construct} construct\n *   Construct.\n * @param {Info} info\n *   Info.\n * @returns {undefined}\n *   Nothing.\n */\n\nimport { markdownLineEnding } from 'micromark-util-character';\nimport { push, splice } from 'micromark-util-chunked';\nimport { resolveAll } from 'micromark-util-resolve-all';\n/**\n * Create a tokenizer.\n * Tokenizers deal with one type of data (e.g., containers, flow, text).\n * The parser is the object dealing with it all.\n * `initialize` works like other constructs, except that only its `tokenize`\n * function is used, in which case it doesn\u2019t receive an `ok` or `nok`.\n * `from` can be given to set the point before the first character, although\n * when further lines are indented, they must be set with `defineSkip`.\n *\n * @param {ParseContext} parser\n *   Parser.\n * @param {InitialConstruct} initialize\n *   Construct.\n * @param {Omit<Point, '_bufferIndex' | '_index'> | undefined} [from]\n *   Point (optional).\n * @returns {TokenizeContext}\n *   Context.\n */\nexport function createTokenizer(parser, initialize, from) {\n  /** @type {Point} */\n  let point = {\n    _bufferIndex: -1,\n    _index: 0,\n    line: from && from.line || 1,\n    column: from && from.column || 1,\n    offset: from && from.offset || 0\n  };\n  /** @type {Record<string, number>} */\n  const columnStart = {};\n  /** @type {Array<Construct>} */\n  const resolveAllConstructs = [];\n  /** @type {Array<Chunk>} */\n  let chunks = [];\n  /** @type {Array<Token>} */\n  let stack = [];\n  /** @type {boolean | undefined} */\n  let consumed = true;\n\n  /**\n   * Tools used for tokenizing.\n   *\n   * @type {Effects}\n   */\n  const effects = {\n    attempt: constructFactory(onsuccessfulconstruct),\n    check: constructFactory(onsuccessfulcheck),\n    consume,\n    enter,\n    exit,\n    interrupt: constructFactory(onsuccessfulcheck, {\n      interrupt: true\n    })\n  };\n\n  /**\n   * State and tools for resolving and serializing.\n   *\n   * @type {TokenizeContext}\n   */\n  const context = {\n    code: null,\n    containerState: {},\n    defineSkip,\n    events: [],\n    now,\n    parser,\n    previous: null,\n    sliceSerialize,\n    sliceStream,\n    write\n  };\n\n  /**\n   * The state function.\n   *\n   * @type {State | undefined}\n   */\n  let state = initialize.tokenize.call(context, effects);\n\n  /**\n   * Track which character we expect to be consumed, to catch bugs.\n   *\n   * @type {Code}\n   */\n  let expectedCode;\n  if (initialize.resolveAll) {\n    resolveAllConstructs.push(initialize);\n  }\n  return context;\n\n  /** @type {TokenizeContext['write']} */\n  function write(slice) {\n    chunks = push(chunks, slice);\n    main();\n\n    // Exit if we\u2019re not done, resolve might change stuff.\n    if (chunks[chunks.length - 1] !== null) {\n      return [];\n    }\n    addResult(initialize, 0);\n\n    // Otherwise, resolve, and exit.\n    context.events = resolveAll(resolveAllConstructs, context.events, context);\n    return context.events;\n  }\n\n  //\n  // Tools.\n  //\n\n  /** @type {TokenizeContext['sliceSerialize']} */\n  function sliceSerialize(token, expandTabs) {\n    return serializeChunks(sliceStream(token), expandTabs);\n  }\n\n  /** @type {TokenizeContext['sliceStream']} */\n  function sliceStream(token) {\n    return sliceChunks(chunks, token);\n  }\n\n  /** @type {TokenizeContext['now']} */\n  function now() {\n    // This is a hot path, so we clone manually instead of `Object.assign({}, point)`\n    const {\n      _bufferIndex,\n      _index,\n      line,\n      column,\n      offset\n    } = point;\n    return {\n      _bufferIndex,\n      _index,\n      line,\n      column,\n      offset\n    };\n  }\n\n  /** @type {TokenizeContext['defineSkip']} */\n  function defineSkip(value) {\n    columnStart[value.line] = value.column;\n    accountForPotentialSkip();\n  }\n\n  //\n  // State management.\n  //\n\n  /**\n   * Main loop (note that `_index` and `_bufferIndex` in `point` are modified by\n   * `consume`).\n   * Here is where we walk through the chunks, which either include strings of\n   * several characters, or numerical character codes.\n   * The reason to do this in a loop instead of a call is so the stack can\n   * drain.\n   *\n   * @returns {undefined}\n   *   Nothing.\n   */\n  function main() {\n    /** @type {number} */\n    let chunkIndex;\n    while (point._index < chunks.length) {\n      const chunk = chunks[point._index];\n\n      // If we\u2019re in a buffer chunk, loop through it.\n      if (typeof chunk === 'string') {\n        chunkIndex = point._index;\n        if (point._bufferIndex < 0) {\n          point._bufferIndex = 0;\n        }\n        while (point._index === chunkIndex && point._bufferIndex < chunk.length) {\n          go(chunk.charCodeAt(point._bufferIndex));\n        }\n      } else {\n        go(chunk);\n      }\n    }\n  }\n\n  /**\n   * Deal with one code.\n   *\n   * @param {Code} code\n   *   Code.\n   * @returns {undefined}\n   *   Nothing.\n   */\n  function go(code) {\n    consumed = undefined;\n    expectedCode = code;\n    state = state(code);\n  }\n\n  /** @type {Effects['consume']} */\n  function consume(code) {\n    if (markdownLineEnding(code)) {\n      point.line++;\n      point.column = 1;\n      point.offset += code === -3 ? 2 : 1;\n      accountForPotentialSkip();\n    } else if (code !== -1) {\n      point.column++;\n      point.offset++;\n    }\n\n    // Not in a string chunk.\n    if (point._bufferIndex < 0) {\n      point._index++;\n    } else {\n      point._bufferIndex++;\n\n      // At end of string chunk.\n      if (point._bufferIndex ===\n      // Points w/ non-negative `_bufferIndex` reference\n      // strings.\n      /** @type {string} */\n      chunks[point._index].length) {\n        point._bufferIndex = -1;\n        point._index++;\n      }\n    }\n\n    // Expose the previous character.\n    context.previous = code;\n\n    // Mark as consumed.\n    consumed = true;\n  }\n\n  /** @type {Effects['enter']} */\n  function enter(type, fields) {\n    /** @type {Token} */\n    // @ts-expect-error Patch instead of assign required fields to help GC.\n    const token = fields || {};\n    token.type = type;\n    token.start = now();\n    context.events.push(['enter', token, context]);\n    stack.push(token);\n    return token;\n  }\n\n  /** @type {Effects['exit']} */\n  function exit(type) {\n    const token = stack.pop();\n    token.end = now();\n    context.events.push(['exit', token, context]);\n    return token;\n  }\n\n  /**\n   * Use results.\n   *\n   * @type {ReturnHandle}\n   */\n  function onsuccessfulconstruct(construct, info) {\n    addResult(construct, info.from);\n  }\n\n  /**\n   * Discard results.\n   *\n   * @type {ReturnHandle}\n   */\n  function onsuccessfulcheck(_, info) {\n    info.restore();\n  }\n\n  /**\n   * Factory to attempt/check/interrupt.\n   *\n   * @param {ReturnHandle} onreturn\n   *   Callback.\n   * @param {{interrupt?: boolean | undefined} | undefined} [fields]\n   *   Fields.\n   */\n  function constructFactory(onreturn, fields) {\n    return hook;\n\n    /**\n     * Handle either an object mapping codes to constructs, a list of\n     * constructs, or a single construct.\n     *\n     * @param {Array<Construct> | ConstructRecord | Construct} constructs\n     *   Constructs.\n     * @param {State} returnState\n     *   State.\n     * @param {State | undefined} [bogusState]\n     *   State.\n     * @returns {State}\n     *   State.\n     */\n    function hook(constructs, returnState, bogusState) {\n      /** @type {ReadonlyArray<Construct>} */\n      let listOfConstructs;\n      /** @type {number} */\n      let constructIndex;\n      /** @type {Construct} */\n      let currentConstruct;\n      /** @type {Info} */\n      let info;\n      return Array.isArray(constructs) ? /* c8 ignore next 1 */\n      handleListOfConstructs(constructs) : 'tokenize' in constructs ?\n      // Looks like a construct.\n      handleListOfConstructs([(/** @type {Construct} */constructs)]) : handleMapOfConstructs(constructs);\n\n      /**\n       * Handle a list of construct.\n       *\n       * @param {ConstructRecord} map\n       *   Constructs.\n       * @returns {State}\n       *   State.\n       */\n      function handleMapOfConstructs(map) {\n        return start;\n\n        /** @type {State} */\n        function start(code) {\n          const left = code !== null && map[code];\n          const all = code !== null && map.null;\n          const list = [\n          // To do: add more extension tests.\n          /* c8 ignore next 2 */\n          ...(Array.isArray(left) ? left : left ? [left] : []), ...(Array.isArray(all) ? all : all ? [all] : [])];\n          return handleListOfConstructs(list)(code);\n        }\n      }\n\n      /**\n       * Handle a list of construct.\n       *\n       * @param {ReadonlyArray<Construct>} list\n       *   Constructs.\n       * @returns {State}\n       *   State.\n       */\n      function handleListOfConstructs(list) {\n        listOfConstructs = list;\n        constructIndex = 0;\n        if (list.length === 0) {\n          return bogusState;\n        }\n        return handleConstruct(list[constructIndex]);\n      }\n\n      /**\n       * Handle a single construct.\n       *\n       * @param {Construct} construct\n       *   Construct.\n       * @returns {State}\n       *   State.\n       */\n      function handleConstruct(construct) {\n        return start;\n\n        /** @type {State} */\n        function start(code) {\n          // To do: not needed to store if there is no bogus state, probably?\n          // Currently doesn\u2019t work because `inspect` in document does a check\n          // w/o a bogus, which doesn\u2019t make sense. But it does seem to help perf\n          // by not storing.\n          info = store();\n          currentConstruct = construct;\n          if (!construct.partial) {\n            context.currentConstruct = construct;\n          }\n\n          // Always populated by defaults.\n\n          if (construct.name && context.parser.constructs.disable.null.includes(construct.name)) {\n            return nok(code);\n          }\n          return construct.tokenize.call(\n          // If we do have fields, create an object w/ `context` as its\n          // prototype.\n          // This allows a \u201Clive binding\u201D, which is needed for `interrupt`.\n          fields ? Object.assign(Object.create(context), fields) : context, effects, ok, nok)(code);\n        }\n      }\n\n      /** @type {State} */\n      function ok(code) {\n        consumed = true;\n        onreturn(currentConstruct, info);\n        return returnState;\n      }\n\n      /** @type {State} */\n      function nok(code) {\n        consumed = true;\n        info.restore();\n        if (++constructIndex < listOfConstructs.length) {\n          return handleConstruct(listOfConstructs[constructIndex]);\n        }\n        return bogusState;\n      }\n    }\n  }\n\n  /**\n   * @param {Construct} construct\n   *   Construct.\n   * @param {number} from\n   *   From.\n   * @returns {undefined}\n   *   Nothing.\n   */\n  function addResult(construct, from) {\n    if (construct.resolveAll && !resolveAllConstructs.includes(construct)) {\n      resolveAllConstructs.push(construct);\n    }\n    if (construct.resolve) {\n      splice(context.events, from, context.events.length - from, construct.resolve(context.events.slice(from), context));\n    }\n    if (construct.resolveTo) {\n      context.events = construct.resolveTo(context.events, context);\n    }\n  }\n\n  /**\n   * Store state.\n   *\n   * @returns {Info}\n   *   Info.\n   */\n  function store() {\n    const startPoint = now();\n    const startPrevious = context.previous;\n    const startCurrentConstruct = context.currentConstruct;\n    const startEventsIndex = context.events.length;\n    const startStack = Array.from(stack);\n    return {\n      from: startEventsIndex,\n      restore\n    };\n\n    /**\n     * Restore state.\n     *\n     * @returns {undefined}\n     *   Nothing.\n     */\n    function restore() {\n      point = startPoint;\n      context.previous = startPrevious;\n      context.currentConstruct = startCurrentConstruct;\n      context.events.length = startEventsIndex;\n      stack = startStack;\n      accountForPotentialSkip();\n    }\n  }\n\n  /**\n   * Move the current point a bit forward in the line when it\u2019s on a column\n   * skip.\n   *\n   * @returns {undefined}\n   *   Nothing.\n   */\n  function accountForPotentialSkip() {\n    if (point.line in columnStart && point.column < 2) {\n      point.column = columnStart[point.line];\n      point.offset += columnStart[point.line] - 1;\n    }\n  }\n}\n\n/**\n * Get the chunks from a slice of chunks in the range of a token.\n *\n * @param {ReadonlyArray<Chunk>} chunks\n *   Chunks.\n * @param {Pick<Token, 'end' | 'start'>} token\n *   Token.\n * @returns {Array<Chunk>}\n *   Chunks.\n */\nfunction sliceChunks(chunks, token) {\n  const startIndex = token.start._index;\n  const startBufferIndex = token.start._bufferIndex;\n  const endIndex = token.end._index;\n  const endBufferIndex = token.end._bufferIndex;\n  /** @type {Array<Chunk>} */\n  let view;\n  if (startIndex === endIndex) {\n    // @ts-expect-error `_bufferIndex` is used on string chunks.\n    view = [chunks[startIndex].slice(startBufferIndex, endBufferIndex)];\n  } else {\n    view = chunks.slice(startIndex, endIndex);\n    if (startBufferIndex > -1) {\n      const head = view[0];\n      if (typeof head === 'string') {\n        view[0] = head.slice(startBufferIndex);\n        /* c8 ignore next 4 -- used to be used, no longer */\n      } else {\n        view.shift();\n      }\n    }\n    if (endBufferIndex > 0) {\n      // @ts-expect-error `_bufferIndex` is used on string chunks.\n      view.push(chunks[endIndex].slice(0, endBufferIndex));\n    }\n  }\n  return view;\n}\n\n/**\n * Get the string value of a slice of chunks.\n *\n * @param {ReadonlyArray<Chunk>} chunks\n *   Chunks.\n * @param {boolean | undefined} [expandTabs=false]\n *   Whether to expand tabs (default: `false`).\n * @returns {string}\n *   Result.\n */\nfunction serializeChunks(chunks, expandTabs) {\n  let index = -1;\n  /** @type {Array<string>} */\n  const result = [];\n  /** @type {boolean | undefined} */\n  let atTab;\n  while (++index < chunks.length) {\n    const chunk = chunks[index];\n    /** @type {string} */\n    let value;\n    if (typeof chunk === 'string') {\n      value = chunk;\n    } else switch (chunk) {\n      case -5:\n        {\n          value = \"\\r\";\n          break;\n        }\n      case -4:\n        {\n          value = \"\\n\";\n          break;\n        }\n      case -3:\n        {\n          value = \"\\r\" + \"\\n\";\n          break;\n        }\n      case -2:\n        {\n          value = expandTabs ? \" \" : \"\\t\";\n          break;\n        }\n      case -1:\n        {\n          if (!expandTabs && atTab) continue;\n          value = \" \";\n          break;\n        }\n      default:\n        {\n          // Currently only replacement character.\n          value = String.fromCharCode(chunk);\n        }\n    }\n    atTab = chunk === -2;\n    result.push(value);\n  }\n  return result.join('');\n}", "/**\n * @import {\n *   Create,\n *   FullNormalizedExtension,\n *   InitialConstruct,\n *   ParseContext,\n *   ParseOptions\n * } from 'micromark-util-types'\n */\n\nimport { combineExtensions } from 'micromark-util-combine-extensions';\nimport { content } from './initialize/content.js';\nimport { document } from './initialize/document.js';\nimport { flow } from './initialize/flow.js';\nimport { string, text } from './initialize/text.js';\nimport * as defaultConstructs from './constructs.js';\nimport { createTokenizer } from './create-tokenizer.js';\n\n/**\n * @param {ParseOptions | null | undefined} [options]\n *   Configuration (optional).\n * @returns {ParseContext}\n *   Parser.\n */\nexport function parse(options) {\n  const settings = options || {};\n  const constructs = /** @type {FullNormalizedExtension} */\n  combineExtensions([defaultConstructs, ...(settings.extensions || [])]);\n\n  /** @type {ParseContext} */\n  const parser = {\n    constructs,\n    content: create(content),\n    defined: [],\n    document: create(document),\n    flow: create(flow),\n    lazy: {},\n    string: create(string),\n    text: create(text)\n  };\n  return parser;\n\n  /**\n   * @param {InitialConstruct} initial\n   *   Construct to start with.\n   * @returns {Create}\n   *   Create a tokenizer.\n   */\n  function create(initial) {\n    return creator;\n    /** @type {Create} */\n    function creator(from) {\n      return createTokenizer(parser, initial, from);\n    }\n  }\n}", "/**\n * @import {Event} from 'micromark-util-types'\n */\n\nimport { subtokenize } from 'micromark-util-subtokenize';\n\n/**\n * @param {Array<Event>} events\n *   Events.\n * @returns {Array<Event>}\n *   Events.\n */\nexport function postprocess(events) {\n  while (!subtokenize(events)) {\n    // Empty\n  }\n  return events;\n}", "/**\n * @import {Chunk, Code, Encoding, Value} from 'micromark-util-types'\n */\n\n/**\n * @callback Preprocessor\n *   Preprocess a value.\n * @param {Value} value\n *   Value.\n * @param {Encoding | null | undefined} [encoding]\n *   Encoding when `value` is a typed array (optional).\n * @param {boolean | null | undefined} [end=false]\n *   Whether this is the last chunk (default: `false`).\n * @returns {Array<Chunk>}\n *   Chunks.\n */\n\nconst search = /[\\0\\t\\n\\r]/g;\n\n/**\n * @returns {Preprocessor}\n *   Preprocess a value.\n */\nexport function preprocess() {\n  let column = 1;\n  let buffer = '';\n  /** @type {boolean | undefined} */\n  let start = true;\n  /** @type {boolean | undefined} */\n  let atCarriageReturn;\n  return preprocessor;\n\n  /** @type {Preprocessor} */\n  // eslint-disable-next-line complexity\n  function preprocessor(value, encoding, end) {\n    /** @type {Array<Chunk>} */\n    const chunks = [];\n    /** @type {RegExpMatchArray | null} */\n    let match;\n    /** @type {number} */\n    let next;\n    /** @type {number} */\n    let startPosition;\n    /** @type {number} */\n    let endPosition;\n    /** @type {Code} */\n    let code;\n    value = buffer + (typeof value === 'string' ? value.toString() : new TextDecoder(encoding || undefined).decode(value));\n    startPosition = 0;\n    buffer = '';\n    if (start) {\n      // To do: `markdown-rs` actually parses BOMs (byte order mark).\n      if (value.charCodeAt(0) === 65279) {\n        startPosition++;\n      }\n      start = undefined;\n    }\n    while (startPosition < value.length) {\n      search.lastIndex = startPosition;\n      match = search.exec(value);\n      endPosition = match && match.index !== undefined ? match.index : value.length;\n      code = value.charCodeAt(endPosition);\n      if (!match) {\n        buffer = value.slice(startPosition);\n        break;\n      }\n      if (code === 10 && startPosition === endPosition && atCarriageReturn) {\n        chunks.push(-3);\n        atCarriageReturn = undefined;\n      } else {\n        if (atCarriageReturn) {\n          chunks.push(-5);\n          atCarriageReturn = undefined;\n        }\n        if (startPosition < endPosition) {\n          chunks.push(value.slice(startPosition, endPosition));\n          column += endPosition - startPosition;\n        }\n        switch (code) {\n          case 0:\n            {\n              chunks.push(65533);\n              column++;\n              break;\n            }\n          case 9:\n            {\n              next = Math.ceil(column / 4) * 4;\n              chunks.push(-2);\n              while (column++ < next) chunks.push(-1);\n              break;\n            }\n          case 10:\n            {\n              chunks.push(-4);\n              column = 1;\n              break;\n            }\n          default:\n            {\n              atCarriageReturn = true;\n              column = 1;\n            }\n        }\n      }\n      startPosition = endPosition + 1;\n    }\n    if (end) {\n      if (atCarriageReturn) chunks.push(-5);\n      if (buffer) chunks.push(buffer);\n      chunks.push(null);\n    }\n    return chunks;\n  }\n}", "import { decodeNamedCharacterReference } from 'decode-named-character-reference';\nimport { decodeNumericCharacterReference } from 'micromark-util-decode-numeric-character-reference';\nconst characterEscapeOrReference = /\\\\([!-/:-@[-`{-~])|&(#(?:\\d{1,7}|x[\\da-f]{1,6})|[\\da-z]{1,31});/gi;\n\n/**\n * Decode markdown strings (which occur in places such as fenced code info\n * strings, destinations, labels, and titles).\n *\n * The \u201Cstring\u201D content type allows character escapes and -references.\n * This decodes those.\n *\n * @param {string} value\n *   Value to decode.\n * @returns {string}\n *   Decoded value.\n */\nexport function decodeString(value) {\n  return value.replace(characterEscapeOrReference, decode);\n}\n\n/**\n * @param {string} $0\n *   Match.\n * @param {string} $1\n *   Character escape.\n * @param {string} $2\n *   Character reference.\n * @returns {string}\n *   Decoded value\n */\nfunction decode($0, $1, $2) {\n  if ($1) {\n    // Escape.\n    return $1;\n  }\n\n  // Reference.\n  const head = $2.charCodeAt(0);\n  if (head === 35) {\n    const head = $2.charCodeAt(1);\n    const hex = head === 120 || head === 88;\n    return decodeNumericCharacterReference($2.slice(hex ? 2 : 1), hex ? 16 : 10);\n  }\n  return decodeNamedCharacterReference($2) || $0;\n}", "/**\n * @typedef {import('unist').Node} Node\n * @typedef {import('unist').Point} Point\n * @typedef {import('unist').Position} Position\n */\n\n/**\n * @typedef NodeLike\n * @property {string} type\n * @property {PositionLike | null | undefined} [position]\n *\n * @typedef PointLike\n * @property {number | null | undefined} [line]\n * @property {number | null | undefined} [column]\n * @property {number | null | undefined} [offset]\n *\n * @typedef PositionLike\n * @property {PointLike | null | undefined} [start]\n * @property {PointLike | null | undefined} [end]\n */\n\n/**\n * Serialize the positional info of a point, position (start and end points),\n * or node.\n *\n * @param {Node | NodeLike | Point | PointLike | Position | PositionLike | null | undefined} [value]\n *   Node, position, or point.\n * @returns {string}\n *   Pretty printed positional info of a node (`string`).\n *\n *   In the format of a range `ls:cs-le:ce` (when given `node` or `position`)\n *   or a point `l:c` (when given `point`), where `l` stands for line, `c` for\n *   column, `s` for `start`, and `e` for end.\n *   An empty string (`''`) is returned if the given value is neither `node`,\n *   `position`, nor `point`.\n */\nexport function stringifyPosition(value) {\n  // Nothing.\n  if (!value || typeof value !== 'object') {\n    return ''\n  }\n\n  // Node.\n  if ('position' in value || 'type' in value) {\n    return position(value.position)\n  }\n\n  // Position.\n  if ('start' in value || 'end' in value) {\n    return position(value)\n  }\n\n  // Point.\n  if ('line' in value || 'column' in value) {\n    return point(value)\n  }\n\n  // ?\n  return ''\n}\n\n/**\n * @param {Point | PointLike | null | undefined} point\n * @returns {string}\n */\nfunction point(point) {\n  return index(point && point.line) + ':' + index(point && point.column)\n}\n\n/**\n * @param {Position | PositionLike | null | undefined} pos\n * @returns {string}\n */\nfunction position(pos) {\n  return point(pos && pos.start) + '-' + point(pos && pos.end)\n}\n\n/**\n * @param {number | null | undefined} value\n * @returns {number}\n */\nfunction index(value) {\n  return value && typeof value === 'number' ? value : 1\n}\n", "/**\n * @import {\n *   Break,\n *   Blockquote,\n *   Code,\n *   Definition,\n *   Emphasis,\n *   Heading,\n *   Html,\n *   Image,\n *   InlineCode,\n *   Link,\n *   ListItem,\n *   List,\n *   Nodes,\n *   Paragraph,\n *   PhrasingContent,\n *   ReferenceType,\n *   Root,\n *   Strong,\n *   Text,\n *   ThematicBreak\n * } from 'mdast'\n * @import {\n *   Encoding,\n *   Event,\n *   Token,\n *   Value\n * } from 'micromark-util-types'\n * @import {Point} from 'unist'\n * @import {\n *   CompileContext,\n *   CompileData,\n *   Config,\n *   Extension,\n *   Handle,\n *   OnEnterError,\n *   Options\n * } from './types.js'\n */\n\nimport { toString } from 'mdast-util-to-string';\nimport { parse, postprocess, preprocess } from 'micromark';\nimport { decodeNumericCharacterReference } from 'micromark-util-decode-numeric-character-reference';\nimport { decodeString } from 'micromark-util-decode-string';\nimport { normalizeIdentifier } from 'micromark-util-normalize-identifier';\nimport { decodeNamedCharacterReference } from 'decode-named-character-reference';\nimport { stringifyPosition } from 'unist-util-stringify-position';\nconst own = {}.hasOwnProperty;\n\n/**\n * Turn markdown into a syntax tree.\n *\n * @overload\n * @param {Value} value\n * @param {Encoding | null | undefined} [encoding]\n * @param {Options | null | undefined} [options]\n * @returns {Root}\n *\n * @overload\n * @param {Value} value\n * @param {Options | null | undefined} [options]\n * @returns {Root}\n *\n * @param {Value} value\n *   Markdown to parse.\n * @param {Encoding | Options | null | undefined} [encoding]\n *   Character encoding for when `value` is `Buffer`.\n * @param {Options | null | undefined} [options]\n *   Configuration.\n * @returns {Root}\n *   mdast tree.\n */\nexport function fromMarkdown(value, encoding, options) {\n  if (typeof encoding !== 'string') {\n    options = encoding;\n    encoding = undefined;\n  }\n  return compiler(options)(postprocess(parse(options).document().write(preprocess()(value, encoding, true))));\n}\n\n/**\n * Note this compiler only understand complete buffering, not streaming.\n *\n * @param {Options | null | undefined} [options]\n */\nfunction compiler(options) {\n  /** @type {Config} */\n  const config = {\n    transforms: [],\n    canContainEols: ['emphasis', 'fragment', 'heading', 'paragraph', 'strong'],\n    enter: {\n      autolink: opener(link),\n      autolinkProtocol: onenterdata,\n      autolinkEmail: onenterdata,\n      atxHeading: opener(heading),\n      blockQuote: opener(blockQuote),\n      characterEscape: onenterdata,\n      characterReference: onenterdata,\n      codeFenced: opener(codeFlow),\n      codeFencedFenceInfo: buffer,\n      codeFencedFenceMeta: buffer,\n      codeIndented: opener(codeFlow, buffer),\n      codeText: opener(codeText, buffer),\n      codeTextData: onenterdata,\n      data: onenterdata,\n      codeFlowValue: onenterdata,\n      definition: opener(definition),\n      definitionDestinationString: buffer,\n      definitionLabelString: buffer,\n      definitionTitleString: buffer,\n      emphasis: opener(emphasis),\n      hardBreakEscape: opener(hardBreak),\n      hardBreakTrailing: opener(hardBreak),\n      htmlFlow: opener(html, buffer),\n      htmlFlowData: onenterdata,\n      htmlText: opener(html, buffer),\n      htmlTextData: onenterdata,\n      image: opener(image),\n      label: buffer,\n      link: opener(link),\n      listItem: opener(listItem),\n      listItemValue: onenterlistitemvalue,\n      listOrdered: opener(list, onenterlistordered),\n      listUnordered: opener(list),\n      paragraph: opener(paragraph),\n      reference: onenterreference,\n      referenceString: buffer,\n      resourceDestinationString: buffer,\n      resourceTitleString: buffer,\n      setextHeading: opener(heading),\n      strong: opener(strong),\n      thematicBreak: opener(thematicBreak)\n    },\n    exit: {\n      atxHeading: closer(),\n      atxHeadingSequence: onexitatxheadingsequence,\n      autolink: closer(),\n      autolinkEmail: onexitautolinkemail,\n      autolinkProtocol: onexitautolinkprotocol,\n      blockQuote: closer(),\n      characterEscapeValue: onexitdata,\n      characterReferenceMarkerHexadecimal: onexitcharacterreferencemarker,\n      characterReferenceMarkerNumeric: onexitcharacterreferencemarker,\n      characterReferenceValue: onexitcharacterreferencevalue,\n      characterReference: onexitcharacterreference,\n      codeFenced: closer(onexitcodefenced),\n      codeFencedFence: onexitcodefencedfence,\n      codeFencedFenceInfo: onexitcodefencedfenceinfo,\n      codeFencedFenceMeta: onexitcodefencedfencemeta,\n      codeFlowValue: onexitdata,\n      codeIndented: closer(onexitcodeindented),\n      codeText: closer(onexitcodetext),\n      codeTextData: onexitdata,\n      data: onexitdata,\n      definition: closer(),\n      definitionDestinationString: onexitdefinitiondestinationstring,\n      definitionLabelString: onexitdefinitionlabelstring,\n      definitionTitleString: onexitdefinitiontitlestring,\n      emphasis: closer(),\n      hardBreakEscape: closer(onexithardbreak),\n      hardBreakTrailing: closer(onexithardbreak),\n      htmlFlow: closer(onexithtmlflow),\n      htmlFlowData: onexitdata,\n      htmlText: closer(onexithtmltext),\n      htmlTextData: onexitdata,\n      image: closer(onexitimage),\n      label: onexitlabel,\n      labelText: onexitlabeltext,\n      lineEnding: onexitlineending,\n      link: closer(onexitlink),\n      listItem: closer(),\n      listOrdered: closer(),\n      listUnordered: closer(),\n      paragraph: closer(),\n      referenceString: onexitreferencestring,\n      resourceDestinationString: onexitresourcedestinationstring,\n      resourceTitleString: onexitresourcetitlestring,\n      resource: onexitresource,\n      setextHeading: closer(onexitsetextheading),\n      setextHeadingLineSequence: onexitsetextheadinglinesequence,\n      setextHeadingText: onexitsetextheadingtext,\n      strong: closer(),\n      thematicBreak: closer()\n    }\n  };\n  configure(config, (options || {}).mdastExtensions || []);\n\n  /** @type {CompileData} */\n  const data = {};\n  return compile;\n\n  /**\n   * Turn micromark events into an mdast tree.\n   *\n   * @param {Array<Event>} events\n   *   Events.\n   * @returns {Root}\n   *   mdast tree.\n   */\n  function compile(events) {\n    /** @type {Root} */\n    let tree = {\n      type: 'root',\n      children: []\n    };\n    /** @type {Omit<CompileContext, 'sliceSerialize'>} */\n    const context = {\n      stack: [tree],\n      tokenStack: [],\n      config,\n      enter,\n      exit,\n      buffer,\n      resume,\n      data\n    };\n    /** @type {Array<number>} */\n    const listStack = [];\n    let index = -1;\n    while (++index < events.length) {\n      // We preprocess lists to add `listItem` tokens, and to infer whether\n      // items the list itself are spread out.\n      if (events[index][1].type === \"listOrdered\" || events[index][1].type === \"listUnordered\") {\n        if (events[index][0] === 'enter') {\n          listStack.push(index);\n        } else {\n          const tail = listStack.pop();\n          index = prepareList(events, tail, index);\n        }\n      }\n    }\n    index = -1;\n    while (++index < events.length) {\n      const handler = config[events[index][0]];\n      if (own.call(handler, events[index][1].type)) {\n        handler[events[index][1].type].call(Object.assign({\n          sliceSerialize: events[index][2].sliceSerialize\n        }, context), events[index][1]);\n      }\n    }\n\n    // Handle tokens still being open.\n    if (context.tokenStack.length > 0) {\n      const tail = context.tokenStack[context.tokenStack.length - 1];\n      const handler = tail[1] || defaultOnError;\n      handler.call(context, undefined, tail[0]);\n    }\n\n    // Figure out `root` position.\n    tree.position = {\n      start: point(events.length > 0 ? events[0][1].start : {\n        line: 1,\n        column: 1,\n        offset: 0\n      }),\n      end: point(events.length > 0 ? events[events.length - 2][1].end : {\n        line: 1,\n        column: 1,\n        offset: 0\n      })\n    };\n\n    // Call transforms.\n    index = -1;\n    while (++index < config.transforms.length) {\n      tree = config.transforms[index](tree) || tree;\n    }\n    return tree;\n  }\n\n  /**\n   * @param {Array<Event>} events\n   * @param {number} start\n   * @param {number} length\n   * @returns {number}\n   */\n  function prepareList(events, start, length) {\n    let index = start - 1;\n    let containerBalance = -1;\n    let listSpread = false;\n    /** @type {Token | undefined} */\n    let listItem;\n    /** @type {number | undefined} */\n    let lineIndex;\n    /** @type {number | undefined} */\n    let firstBlankLineIndex;\n    /** @type {boolean | undefined} */\n    let atMarker;\n    while (++index <= length) {\n      const event = events[index];\n      switch (event[1].type) {\n        case \"listUnordered\":\n        case \"listOrdered\":\n        case \"blockQuote\":\n          {\n            if (event[0] === 'enter') {\n              containerBalance++;\n            } else {\n              containerBalance--;\n            }\n            atMarker = undefined;\n            break;\n          }\n        case \"lineEndingBlank\":\n          {\n            if (event[0] === 'enter') {\n              if (listItem && !atMarker && !containerBalance && !firstBlankLineIndex) {\n                firstBlankLineIndex = index;\n              }\n              atMarker = undefined;\n            }\n            break;\n          }\n        case \"linePrefix\":\n        case \"listItemValue\":\n        case \"listItemMarker\":\n        case \"listItemPrefix\":\n        case \"listItemPrefixWhitespace\":\n          {\n            // Empty.\n\n            break;\n          }\n        default:\n          {\n            atMarker = undefined;\n          }\n      }\n      if (!containerBalance && event[0] === 'enter' && event[1].type === \"listItemPrefix\" || containerBalance === -1 && event[0] === 'exit' && (event[1].type === \"listUnordered\" || event[1].type === \"listOrdered\")) {\n        if (listItem) {\n          let tailIndex = index;\n          lineIndex = undefined;\n          while (tailIndex--) {\n            const tailEvent = events[tailIndex];\n            if (tailEvent[1].type === \"lineEnding\" || tailEvent[1].type === \"lineEndingBlank\") {\n              if (tailEvent[0] === 'exit') continue;\n              if (lineIndex) {\n                events[lineIndex][1].type = \"lineEndingBlank\";\n                listSpread = true;\n              }\n              tailEvent[1].type = \"lineEnding\";\n              lineIndex = tailIndex;\n            } else if (tailEvent[1].type === \"linePrefix\" || tailEvent[1].type === \"blockQuotePrefix\" || tailEvent[1].type === \"blockQuotePrefixWhitespace\" || tailEvent[1].type === \"blockQuoteMarker\" || tailEvent[1].type === \"listItemIndent\") {\n              // Empty\n            } else {\n              break;\n            }\n          }\n          if (firstBlankLineIndex && (!lineIndex || firstBlankLineIndex < lineIndex)) {\n            listItem._spread = true;\n          }\n\n          // Fix position.\n          listItem.end = Object.assign({}, lineIndex ? events[lineIndex][1].start : event[1].end);\n          events.splice(lineIndex || index, 0, ['exit', listItem, event[2]]);\n          index++;\n          length++;\n        }\n\n        // Create a new list item.\n        if (event[1].type === \"listItemPrefix\") {\n          /** @type {Token} */\n          const item = {\n            type: 'listItem',\n            _spread: false,\n            start: Object.assign({}, event[1].start),\n            // @ts-expect-error: we\u2019ll add `end` in a second.\n            end: undefined\n          };\n          listItem = item;\n          events.splice(index, 0, ['enter', item, event[2]]);\n          index++;\n          length++;\n          firstBlankLineIndex = undefined;\n          atMarker = true;\n        }\n      }\n    }\n    events[start][1]._spread = listSpread;\n    return length;\n  }\n\n  /**\n   * Create an opener handle.\n   *\n   * @param {(token: Token) => Nodes} create\n   *   Create a node.\n   * @param {Handle | undefined} [and]\n   *   Optional function to also run.\n   * @returns {Handle}\n   *   Handle.\n   */\n  function opener(create, and) {\n    return open;\n\n    /**\n     * @this {CompileContext}\n     * @param {Token} token\n     * @returns {undefined}\n     */\n    function open(token) {\n      enter.call(this, create(token), token);\n      if (and) and.call(this, token);\n    }\n  }\n\n  /**\n   * @type {CompileContext['buffer']}\n   */\n  function buffer() {\n    this.stack.push({\n      type: 'fragment',\n      children: []\n    });\n  }\n\n  /**\n   * @type {CompileContext['enter']}\n   */\n  function enter(node, token, errorHandler) {\n    const parent = this.stack[this.stack.length - 1];\n    /** @type {Array<Nodes>} */\n    const siblings = parent.children;\n    siblings.push(node);\n    this.stack.push(node);\n    this.tokenStack.push([token, errorHandler || undefined]);\n    node.position = {\n      start: point(token.start),\n      // @ts-expect-error: `end` will be patched later.\n      end: undefined\n    };\n  }\n\n  /**\n   * Create a closer handle.\n   *\n   * @param {Handle | undefined} [and]\n   *   Optional function to also run.\n   * @returns {Handle}\n   *   Handle.\n   */\n  function closer(and) {\n    return close;\n\n    /**\n     * @this {CompileContext}\n     * @param {Token} token\n     * @returns {undefined}\n     */\n    function close(token) {\n      if (and) and.call(this, token);\n      exit.call(this, token);\n    }\n  }\n\n  /**\n   * @type {CompileContext['exit']}\n   */\n  function exit(token, onExitError) {\n    const node = this.stack.pop();\n    const open = this.tokenStack.pop();\n    if (!open) {\n      throw new Error('Cannot close `' + token.type + '` (' + stringifyPosition({\n        start: token.start,\n        end: token.end\n      }) + '): it\u2019s not open');\n    } else if (open[0].type !== token.type) {\n      if (onExitError) {\n        onExitError.call(this, token, open[0]);\n      } else {\n        const handler = open[1] || defaultOnError;\n        handler.call(this, token, open[0]);\n      }\n    }\n    node.position.end = point(token.end);\n  }\n\n  /**\n   * @type {CompileContext['resume']}\n   */\n  function resume() {\n    return toString(this.stack.pop());\n  }\n\n  //\n  // Handlers.\n  //\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onenterlistordered() {\n    this.data.expectingFirstListItemValue = true;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onenterlistitemvalue(token) {\n    if (this.data.expectingFirstListItemValue) {\n      const ancestor = this.stack[this.stack.length - 2];\n      ancestor.start = Number.parseInt(this.sliceSerialize(token), 10);\n      this.data.expectingFirstListItemValue = undefined;\n    }\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitcodefencedfenceinfo() {\n    const data = this.resume();\n    const node = this.stack[this.stack.length - 1];\n    node.lang = data;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitcodefencedfencemeta() {\n    const data = this.resume();\n    const node = this.stack[this.stack.length - 1];\n    node.meta = data;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitcodefencedfence() {\n    // Exit if this is the closing fence.\n    if (this.data.flowCodeInside) return;\n    this.buffer();\n    this.data.flowCodeInside = true;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitcodefenced() {\n    const data = this.resume();\n    const node = this.stack[this.stack.length - 1];\n    node.value = data.replace(/^(\\r?\\n|\\r)|(\\r?\\n|\\r)$/g, '');\n    this.data.flowCodeInside = undefined;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitcodeindented() {\n    const data = this.resume();\n    const node = this.stack[this.stack.length - 1];\n    node.value = data.replace(/(\\r?\\n|\\r)$/g, '');\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitdefinitionlabelstring(token) {\n    const label = this.resume();\n    const node = this.stack[this.stack.length - 1];\n    node.label = label;\n    node.identifier = normalizeIdentifier(this.sliceSerialize(token)).toLowerCase();\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitdefinitiontitlestring() {\n    const data = this.resume();\n    const node = this.stack[this.stack.length - 1];\n    node.title = data;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitdefinitiondestinationstring() {\n    const data = this.resume();\n    const node = this.stack[this.stack.length - 1];\n    node.url = data;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitatxheadingsequence(token) {\n    const node = this.stack[this.stack.length - 1];\n    if (!node.depth) {\n      const depth = this.sliceSerialize(token).length;\n      node.depth = depth;\n    }\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitsetextheadingtext() {\n    this.data.setextHeadingSlurpLineEnding = true;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitsetextheadinglinesequence(token) {\n    const node = this.stack[this.stack.length - 1];\n    node.depth = this.sliceSerialize(token).codePointAt(0) === 61 ? 1 : 2;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitsetextheading() {\n    this.data.setextHeadingSlurpLineEnding = undefined;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onenterdata(token) {\n    const node = this.stack[this.stack.length - 1];\n    /** @type {Array<Nodes>} */\n    const siblings = node.children;\n    let tail = siblings[siblings.length - 1];\n    if (!tail || tail.type !== 'text') {\n      // Add a new text node.\n      tail = text();\n      tail.position = {\n        start: point(token.start),\n        // @ts-expect-error: we\u2019ll add `end` later.\n        end: undefined\n      };\n      siblings.push(tail);\n    }\n    this.stack.push(tail);\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onexitdata(token) {\n    const tail = this.stack.pop();\n    tail.value += this.sliceSerialize(token);\n    tail.position.end = point(token.end);\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onexitlineending(token) {\n    const context = this.stack[this.stack.length - 1];\n    // If we\u2019re at a hard break, include the line ending in there.\n    if (this.data.atHardBreak) {\n      const tail = context.children[context.children.length - 1];\n      tail.position.end = point(token.end);\n      this.data.atHardBreak = undefined;\n      return;\n    }\n    if (!this.data.setextHeadingSlurpLineEnding && config.canContainEols.includes(context.type)) {\n      onenterdata.call(this, token);\n      onexitdata.call(this, token);\n    }\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onexithardbreak() {\n    this.data.atHardBreak = true;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onexithtmlflow() {\n    const data = this.resume();\n    const node = this.stack[this.stack.length - 1];\n    node.value = data;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onexithtmltext() {\n    const data = this.resume();\n    const node = this.stack[this.stack.length - 1];\n    node.value = data;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onexitcodetext() {\n    const data = this.resume();\n    const node = this.stack[this.stack.length - 1];\n    node.value = data;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onexitlink() {\n    const node = this.stack[this.stack.length - 1];\n    // Note: there are also `identifier` and `label` fields on this link node!\n    // These are used / cleaned here.\n\n    // To do: clean.\n    if (this.data.inReference) {\n      /** @type {ReferenceType} */\n      const referenceType = this.data.referenceType || 'shortcut';\n      node.type += 'Reference';\n      // @ts-expect-error: mutate.\n      node.referenceType = referenceType;\n      // @ts-expect-error: mutate.\n      delete node.url;\n      delete node.title;\n    } else {\n      // @ts-expect-error: mutate.\n      delete node.identifier;\n      // @ts-expect-error: mutate.\n      delete node.label;\n    }\n    this.data.referenceType = undefined;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onexitimage() {\n    const node = this.stack[this.stack.length - 1];\n    // Note: there are also `identifier` and `label` fields on this link node!\n    // These are used / cleaned here.\n\n    // To do: clean.\n    if (this.data.inReference) {\n      /** @type {ReferenceType} */\n      const referenceType = this.data.referenceType || 'shortcut';\n      node.type += 'Reference';\n      // @ts-expect-error: mutate.\n      node.referenceType = referenceType;\n      // @ts-expect-error: mutate.\n      delete node.url;\n      delete node.title;\n    } else {\n      // @ts-expect-error: mutate.\n      delete node.identifier;\n      // @ts-expect-error: mutate.\n      delete node.label;\n    }\n    this.data.referenceType = undefined;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onexitlabeltext(token) {\n    const string = this.sliceSerialize(token);\n    const ancestor = this.stack[this.stack.length - 2];\n    // @ts-expect-error: stash this on the node, as it might become a reference\n    // later.\n    ancestor.label = decodeString(string);\n    // @ts-expect-error: same as above.\n    ancestor.identifier = normalizeIdentifier(string).toLowerCase();\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onexitlabel() {\n    const fragment = this.stack[this.stack.length - 1];\n    const value = this.resume();\n    const node = this.stack[this.stack.length - 1];\n    // Assume a reference.\n    this.data.inReference = true;\n    if (node.type === 'link') {\n      /** @type {Array<PhrasingContent>} */\n      const children = fragment.children;\n      node.children = children;\n    } else {\n      node.alt = value;\n    }\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onexitresourcedestinationstring() {\n    const data = this.resume();\n    const node = this.stack[this.stack.length - 1];\n    node.url = data;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onexitresourcetitlestring() {\n    const data = this.resume();\n    const node = this.stack[this.stack.length - 1];\n    node.title = data;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onexitresource() {\n    this.data.inReference = undefined;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onenterreference() {\n    this.data.referenceType = 'collapsed';\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onexitreferencestring(token) {\n    const label = this.resume();\n    const node = this.stack[this.stack.length - 1];\n    // @ts-expect-error: stash this on the node, as it might become a reference\n    // later.\n    node.label = label;\n    // @ts-expect-error: same as above.\n    node.identifier = normalizeIdentifier(this.sliceSerialize(token)).toLowerCase();\n    this.data.referenceType = 'full';\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n\n  function onexitcharacterreferencemarker(token) {\n    this.data.characterReferenceType = token.type;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitcharacterreferencevalue(token) {\n    const data = this.sliceSerialize(token);\n    const type = this.data.characterReferenceType;\n    /** @type {string} */\n    let value;\n    if (type) {\n      value = decodeNumericCharacterReference(data, type === \"characterReferenceMarkerNumeric\" ? 10 : 16);\n      this.data.characterReferenceType = undefined;\n    } else {\n      const result = decodeNamedCharacterReference(data);\n      value = result;\n    }\n    const tail = this.stack[this.stack.length - 1];\n    tail.value += value;\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitcharacterreference(token) {\n    const tail = this.stack.pop();\n    tail.position.end = point(token.end);\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitautolinkprotocol(token) {\n    onexitdata.call(this, token);\n    const node = this.stack[this.stack.length - 1];\n    node.url = this.sliceSerialize(token);\n  }\n\n  /**\n   * @this {CompileContext}\n   * @type {Handle}\n   */\n  function onexitautolinkemail(token) {\n    onexitdata.call(this, token);\n    const node = this.stack[this.stack.length - 1];\n    node.url = 'mailto:' + this.sliceSerialize(token);\n  }\n\n  //\n  // Creaters.\n  //\n\n  /** @returns {Blockquote} */\n  function blockQuote() {\n    return {\n      type: 'blockquote',\n      children: []\n    };\n  }\n\n  /** @returns {Code} */\n  function codeFlow() {\n    return {\n      type: 'code',\n      lang: null,\n      meta: null,\n      value: ''\n    };\n  }\n\n  /** @returns {InlineCode} */\n  function codeText() {\n    return {\n      type: 'inlineCode',\n      value: ''\n    };\n  }\n\n  /** @returns {Definition} */\n  function definition() {\n    return {\n      type: 'definition',\n      identifier: '',\n      label: null,\n      title: null,\n      url: ''\n    };\n  }\n\n  /** @returns {Emphasis} */\n  function emphasis() {\n    return {\n      type: 'emphasis',\n      children: []\n    };\n  }\n\n  /** @returns {Heading} */\n  function heading() {\n    return {\n      type: 'heading',\n      // @ts-expect-error `depth` will be set later.\n      depth: 0,\n      children: []\n    };\n  }\n\n  /** @returns {Break} */\n  function hardBreak() {\n    return {\n      type: 'break'\n    };\n  }\n\n  /** @returns {Html} */\n  function html() {\n    return {\n      type: 'html',\n      value: ''\n    };\n  }\n\n  /** @returns {Image} */\n  function image() {\n    return {\n      type: 'image',\n      title: null,\n      url: '',\n      alt: null\n    };\n  }\n\n  /** @returns {Link} */\n  function link() {\n    return {\n      type: 'link',\n      title: null,\n      url: '',\n      children: []\n    };\n  }\n\n  /**\n   * @param {Token} token\n   * @returns {List}\n   */\n  function list(token) {\n    return {\n      type: 'list',\n      ordered: token.type === 'listOrdered',\n      start: null,\n      spread: token._spread,\n      children: []\n    };\n  }\n\n  /**\n   * @param {Token} token\n   * @returns {ListItem}\n   */\n  function listItem(token) {\n    return {\n      type: 'listItem',\n      spread: token._spread,\n      checked: null,\n      children: []\n    };\n  }\n\n  /** @returns {Paragraph} */\n  function paragraph() {\n    return {\n      type: 'paragraph',\n      children: []\n    };\n  }\n\n  /** @returns {Strong} */\n  function strong() {\n    return {\n      type: 'strong',\n      children: []\n    };\n  }\n\n  /** @returns {Text} */\n  function text() {\n    return {\n      type: 'text',\n      value: ''\n    };\n  }\n\n  /** @returns {ThematicBreak} */\n  function thematicBreak() {\n    return {\n      type: 'thematicBreak'\n    };\n  }\n}\n\n/**\n * Copy a point-like value.\n *\n * @param {Point} d\n *   Point-like value.\n * @returns {Point}\n *   unist point.\n */\nfunction point(d) {\n  return {\n    line: d.line,\n    column: d.column,\n    offset: d.offset\n  };\n}\n\n/**\n * @param {Config} combined\n * @param {Array<Array<Extension> | Extension>} extensions\n * @returns {undefined}\n */\nfunction configure(combined, extensions) {\n  let index = -1;\n  while (++index < extensions.length) {\n    const value = extensions[index];\n    if (Array.isArray(value)) {\n      configure(combined, value);\n    } else {\n      extension(combined, value);\n    }\n  }\n}\n\n/**\n * @param {Config} combined\n * @param {Extension} extension\n * @returns {undefined}\n */\nfunction extension(combined, extension) {\n  /** @type {keyof Extension} */\n  let key;\n  for (key in extension) {\n    if (own.call(extension, key)) {\n      switch (key) {\n        case 'canContainEols':\n          {\n            const right = extension[key];\n            if (right) {\n              combined[key].push(...right);\n            }\n            break;\n          }\n        case 'transforms':\n          {\n            const right = extension[key];\n            if (right) {\n              combined[key].push(...right);\n            }\n            break;\n          }\n        case 'enter':\n        case 'exit':\n          {\n            const right = extension[key];\n            if (right) {\n              Object.assign(combined[key], right);\n            }\n            break;\n          }\n        // No default\n      }\n    }\n  }\n}\n\n/** @type {OnEnterError} */\nfunction defaultOnError(left, right) {\n  if (left) {\n    throw new Error('Cannot close `' + left.type + '` (' + stringifyPosition({\n      start: left.start,\n      end: left.end\n    }) + '): a different token (`' + right.type + '`, ' + stringifyPosition({\n      start: right.start,\n      end: right.end\n    }) + ') is open');\n  } else {\n    throw new Error('Cannot close document, a token (`' + right.type + '`, ' + stringifyPosition({\n      start: right.start,\n      end: right.end\n    }) + ') is still open');\n  }\n}", "/**\n * @typedef {import('mdast').Root} Root\n * @typedef {import('mdast-util-from-markdown').Options} FromMarkdownOptions\n * @typedef {import('unified').Parser<Root>} Parser\n * @typedef {import('unified').Processor<Root>} Processor\n */\n\n/**\n * @typedef {Omit<FromMarkdownOptions, 'extensions' | 'mdastExtensions'>} Options\n */\n\nimport {fromMarkdown} from 'mdast-util-from-markdown'\n\n/**\n * Aadd support for parsing from markdown.\n *\n * @param {Readonly<Options> | null | undefined} [options]\n *   Configuration (optional).\n * @returns {undefined}\n *   Nothing.\n */\nexport default function remarkParse(options) {\n  /** @type {Processor} */\n  // @ts-expect-error: TS in JSDoc generates wrong types if `this` is typed regularly.\n  const self = this\n\n  self.parser = parser\n\n  /**\n   * @type {Parser}\n   */\n  function parser(doc) {\n    return fromMarkdown(doc, {\n      ...self.data('settings'),\n      ...options,\n      // Note: these options are not in the readme.\n      // The goal is for them to be set by plugins on `data` instead of being\n      // passed by users.\n      extensions: self.data('micromarkExtensions') || [],\n      mdastExtensions: self.data('fromMarkdownExtensions') || []\n    })\n  }\n}\n", "/**\n * @callback Handler\n *   Handle a value, with a certain ID field set to a certain value.\n *   The ID field is passed to `zwitch`, and it\u2019s value is this function\u2019s\n *   place on the `handlers` record.\n * @param {...any} parameters\n *   Arbitrary parameters passed to the zwitch.\n *   The first will be an object with a certain ID field set to a certain value.\n * @returns {any}\n *   Anything!\n */\n\n/**\n * @callback UnknownHandler\n *   Handle values that do have a certain ID field, but it\u2019s set to a value\n *   that is not listed in the `handlers` record.\n * @param {unknown} value\n *   An object with a certain ID field set to an unknown value.\n * @param {...any} rest\n *   Arbitrary parameters passed to the zwitch.\n * @returns {any}\n *   Anything!\n */\n\n/**\n * @callback InvalidHandler\n *   Handle values that do not have a certain ID field.\n * @param {unknown} value\n *   Any unknown value.\n * @param {...any} rest\n *   Arbitrary parameters passed to the zwitch.\n * @returns {void|null|undefined|never}\n *   This should crash or return nothing.\n */\n\n/**\n * @template {InvalidHandler} [Invalid=InvalidHandler]\n * @template {UnknownHandler} [Unknown=UnknownHandler]\n * @template {Record<string, Handler>} [Handlers=Record<string, Handler>]\n * @typedef Options\n *   Configuration (required).\n * @property {Invalid} [invalid]\n *   Handler to use for invalid values.\n * @property {Unknown} [unknown]\n *   Handler to use for unknown values.\n * @property {Handlers} [handlers]\n *   Handlers to use.\n */\n\nconst own = {}.hasOwnProperty\n\n/**\n * Handle values based on a field.\n *\n * @template {InvalidHandler} [Invalid=InvalidHandler]\n * @template {UnknownHandler} [Unknown=UnknownHandler]\n * @template {Record<string, Handler>} [Handlers=Record<string, Handler>]\n * @param {string} key\n *   Field to switch on.\n * @param {Options<Invalid, Unknown, Handlers>} [options]\n *   Configuration (required).\n * @returns {{unknown: Unknown, invalid: Invalid, handlers: Handlers, (...parameters: Parameters<Handlers[keyof Handlers]>): ReturnType<Handlers[keyof Handlers]>, (...parameters: Parameters<Unknown>): ReturnType<Unknown>}}\n */\nexport function zwitch(key, options) {\n  const settings = options || {}\n\n  /**\n   * Handle one value.\n   *\n   * Based on the bound `key`, a respective handler will be called.\n   * If `value` is not an object, or doesn\u2019t have a `key` property, the special\n   * \u201Cinvalid\u201D handler will be called.\n   * If `value` has an unknown `key`, the special \u201Cunknown\u201D handler will be\n   * called.\n   *\n   * All arguments, and the context object, are passed through to the handler,\n   * and it\u2019s result is returned.\n   *\n   * @this {unknown}\n   *   Any context object.\n   * @param {unknown} [value]\n   *   Any value.\n   * @param {...unknown} parameters\n   *   Arbitrary parameters passed to the zwitch.\n   * @property {Handler} invalid\n   *   Handle for values that do not have a certain ID field.\n   * @property {Handler} unknown\n   *   Handle values that do have a certain ID field, but it\u2019s set to a value\n   *   that is not listed in the `handlers` record.\n   * @property {Handlers} handlers\n   *   Record of handlers.\n   * @returns {unknown}\n   *   Anything.\n   */\n  function one(value, ...parameters) {\n    /** @type {Handler|undefined} */\n    let fn = one.invalid\n    const handlers = one.handlers\n\n    if (value && own.call(value, key)) {\n      // @ts-expect-error Indexable.\n      const id = String(value[key])\n      // @ts-expect-error Indexable.\n      fn = own.call(handlers, id) ? handlers[id] : one.unknown\n    }\n\n    if (fn) {\n      return fn.call(this, value, ...parameters)\n    }\n  }\n\n  one.handlers = settings.handlers || {}\n  one.invalid = settings.invalid\n  one.unknown = settings.unknown\n\n  // @ts-expect-error: matches!\n  return one\n}\n", "/**\n * @import {Options, State} from './types.js'\n */\n\nconst own = {}.hasOwnProperty\n\n/**\n * @param {State} base\n * @param {Options} extension\n * @returns {State}\n */\nexport function configure(base, extension) {\n  let index = -1\n  /** @type {keyof Options} */\n  let key\n\n  // First do subextensions.\n  if (extension.extensions) {\n    while (++index < extension.extensions.length) {\n      configure(base, extension.extensions[index])\n    }\n  }\n\n  for (key in extension) {\n    if (own.call(extension, key)) {\n      switch (key) {\n        case 'extensions': {\n          // Empty.\n          break\n        }\n\n        /* c8 ignore next 4 */\n        case 'unsafe': {\n          list(base[key], extension[key])\n          break\n        }\n\n        case 'join': {\n          list(base[key], extension[key])\n          break\n        }\n\n        case 'handlers': {\n          map(base[key], extension[key])\n          break\n        }\n\n        default: {\n          // @ts-expect-error: matches.\n          base.options[key] = extension[key]\n        }\n      }\n    }\n  }\n\n  return base\n}\n\n/**\n * @template T\n * @param {Array<T>} left\n * @param {Array<T> | null | undefined} right\n */\nfunction list(left, right) {\n  if (right) {\n    left.push(...right)\n  }\n}\n\n/**\n * @template T\n * @param {Record<string, T>} left\n * @param {Record<string, T> | null | undefined} right\n */\nfunction map(left, right) {\n  if (right) {\n    Object.assign(left, right)\n  }\n}\n", "/**\n * @import {Blockquote, Parents} from 'mdast'\n * @import {Info, Map, State} from 'mdast-util-to-markdown'\n */\n\n/**\n * @param {Blockquote} node\n * @param {Parents | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function blockquote(node, _, state, info) {\n  const exit = state.enter('blockquote')\n  const tracker = state.createTracker(info)\n  tracker.move('> ')\n  tracker.shift(2)\n  const value = state.indentLines(\n    state.containerFlow(node, tracker.current()),\n    map\n  )\n  exit()\n  return value\n}\n\n/** @type {Map} */\nfunction map(line, _, blank) {\n  return '>' + (blank ? '' : ' ') + line\n}\n", "/**\n * @import {ConstructName, Unsafe} from 'mdast-util-to-markdown'\n */\n\n/**\n * @param {Array<ConstructName>} stack\n * @param {Unsafe} pattern\n * @returns {boolean}\n */\nexport function patternInScope(stack, pattern) {\n  return (\n    listInScope(stack, pattern.inConstruct, true) &&\n    !listInScope(stack, pattern.notInConstruct, false)\n  )\n}\n\n/**\n * @param {Array<ConstructName>} stack\n * @param {Unsafe['inConstruct']} list\n * @param {boolean} none\n * @returns {boolean}\n */\nfunction listInScope(stack, list, none) {\n  if (typeof list === 'string') {\n    list = [list]\n  }\n\n  if (!list || list.length === 0) {\n    return none\n  }\n\n  let index = -1\n\n  while (++index < list.length) {\n    if (stack.includes(list[index])) {\n      return true\n    }\n  }\n\n  return false\n}\n", "/**\n * @import {Break, Parents} from 'mdast'\n * @import {Info, State} from 'mdast-util-to-markdown'\n */\n\nimport {patternInScope} from '../util/pattern-in-scope.js'\n\n/**\n * @param {Break} _\n * @param {Parents | undefined} _1\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function hardBreak(_, _1, state, info) {\n  let index = -1\n\n  while (++index < state.unsafe.length) {\n    // If we can\u2019t put eols in this construct (setext headings, tables), use a\n    // space instead.\n    if (\n      state.unsafe[index].character === '\\n' &&\n      patternInScope(state.stack, state.unsafe[index])\n    ) {\n      return /[ \\t]/.test(info.before) ? '' : ' '\n    }\n  }\n\n  return '\\\\\\n'\n}\n", "/**\n * Get the count of the longest repeating streak of `substring` in `value`.\n *\n * @param {string} value\n *   Content to search in.\n * @param {string} substring\n *   Substring to look for, typically one character.\n * @returns {number}\n *   Count of most frequent adjacent `substring`s in `value`.\n */\nexport function longestStreak(value, substring) {\n  const source = String(value)\n  let index = source.indexOf(substring)\n  let expected = index\n  let count = 0\n  let max = 0\n\n  if (typeof substring !== 'string') {\n    throw new TypeError('Expected substring')\n  }\n\n  while (index !== -1) {\n    if (index === expected) {\n      if (++count > max) {\n        max = count\n      }\n    } else {\n      count = 1\n    }\n\n    expected = index + substring.length\n    index = source.indexOf(substring, expected)\n  }\n\n  return max\n}\n", "/**\n * @import {State} from 'mdast-util-to-markdown'\n * @import {Code} from 'mdast'\n */\n\n/**\n * @param {Code} node\n * @param {State} state\n * @returns {boolean}\n */\nexport function formatCodeAsIndented(node, state) {\n  return Boolean(\n    state.options.fences === false &&\n      node.value &&\n      // If there\u2019s no info\u2026\n      !node.lang &&\n      // And there\u2019s a non-whitespace character\u2026\n      /[^ \\r\\n]/.test(node.value) &&\n      // And the value doesn\u2019t start or end in a blank\u2026\n      !/^[\\t ]*(?:[\\r\\n]|$)|(?:^|[\\r\\n])[\\t ]*$/.test(node.value)\n  )\n}\n", "/**\n * @import {Options, State} from 'mdast-util-to-markdown'\n */\n\n/**\n * @param {State} state\n * @returns {Exclude<Options['fence'], null | undefined>}\n */\nexport function checkFence(state) {\n  const marker = state.options.fence || '`'\n\n  if (marker !== '`' && marker !== '~') {\n    throw new Error(\n      'Cannot serialize code with `' +\n        marker +\n        '` for `options.fence`, expected `` ` `` or `~`'\n    )\n  }\n\n  return marker\n}\n", "/**\n * @import {Info, Map, State} from 'mdast-util-to-markdown'\n * @import {Code, Parents} from 'mdast'\n */\n\nimport {longestStreak} from 'longest-streak'\nimport {formatCodeAsIndented} from '../util/format-code-as-indented.js'\nimport {checkFence} from '../util/check-fence.js'\n\n/**\n * @param {Code} node\n * @param {Parents | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function code(node, _, state, info) {\n  const marker = checkFence(state)\n  const raw = node.value || ''\n  const suffix = marker === '`' ? 'GraveAccent' : 'Tilde'\n\n  if (formatCodeAsIndented(node, state)) {\n    const exit = state.enter('codeIndented')\n    const value = state.indentLines(raw, map)\n    exit()\n    return value\n  }\n\n  const tracker = state.createTracker(info)\n  const sequence = marker.repeat(Math.max(longestStreak(raw, marker) + 1, 3))\n  const exit = state.enter('codeFenced')\n  let value = tracker.move(sequence)\n\n  if (node.lang) {\n    const subexit = state.enter(`codeFencedLang${suffix}`)\n    value += tracker.move(\n      state.safe(node.lang, {\n        before: value,\n        after: ' ',\n        encode: ['`'],\n        ...tracker.current()\n      })\n    )\n    subexit()\n  }\n\n  if (node.lang && node.meta) {\n    const subexit = state.enter(`codeFencedMeta${suffix}`)\n    value += tracker.move(' ')\n    value += tracker.move(\n      state.safe(node.meta, {\n        before: value,\n        after: '\\n',\n        encode: ['`'],\n        ...tracker.current()\n      })\n    )\n    subexit()\n  }\n\n  value += tracker.move('\\n')\n\n  if (raw) {\n    value += tracker.move(raw + '\\n')\n  }\n\n  value += tracker.move(sequence)\n  exit()\n  return value\n}\n\n/** @type {Map} */\nfunction map(line, _, blank) {\n  return (blank ? '' : '    ') + line\n}\n", "/**\n * @import {Options, State} from 'mdast-util-to-markdown'\n */\n\n/**\n * @param {State} state\n * @returns {Exclude<Options['quote'], null | undefined>}\n */\nexport function checkQuote(state) {\n  const marker = state.options.quote || '\"'\n\n  if (marker !== '\"' && marker !== \"'\") {\n    throw new Error(\n      'Cannot serialize title with `' +\n        marker +\n        '` for `options.quote`, expected `\"`, or `\\'`'\n    )\n  }\n\n  return marker\n}\n", "/**\n * @import {Info, State} from 'mdast-util-to-markdown'\n * @import {Definition, Parents} from 'mdast'\n */\n\nimport {checkQuote} from '../util/check-quote.js'\n\n/**\n * @param {Definition} node\n * @param {Parents | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function definition(node, _, state, info) {\n  const quote = checkQuote(state)\n  const suffix = quote === '\"' ? 'Quote' : 'Apostrophe'\n  const exit = state.enter('definition')\n  let subexit = state.enter('label')\n  const tracker = state.createTracker(info)\n  let value = tracker.move('[')\n  value += tracker.move(\n    state.safe(state.associationId(node), {\n      before: value,\n      after: ']',\n      ...tracker.current()\n    })\n  )\n  value += tracker.move(']: ')\n\n  subexit()\n\n  if (\n    // If there\u2019s no url, or\u2026\n    !node.url ||\n    // If there are control characters or whitespace.\n    /[\\0- \\u007F]/.test(node.url)\n  ) {\n    subexit = state.enter('destinationLiteral')\n    value += tracker.move('<')\n    value += tracker.move(\n      state.safe(node.url, {before: value, after: '>', ...tracker.current()})\n    )\n    value += tracker.move('>')\n  } else {\n    // No whitespace, raw is prettier.\n    subexit = state.enter('destinationRaw')\n    value += tracker.move(\n      state.safe(node.url, {\n        before: value,\n        after: node.title ? ' ' : '\\n',\n        ...tracker.current()\n      })\n    )\n  }\n\n  subexit()\n\n  if (node.title) {\n    subexit = state.enter(`title${suffix}`)\n    value += tracker.move(' ' + quote)\n    value += tracker.move(\n      state.safe(node.title, {\n        before: value,\n        after: quote,\n        ...tracker.current()\n      })\n    )\n    value += tracker.move(quote)\n    subexit()\n  }\n\n  exit()\n\n  return value\n}\n", "/**\n * @import {Options, State} from 'mdast-util-to-markdown'\n */\n\n/**\n * @param {State} state\n * @returns {Exclude<Options['emphasis'], null | undefined>}\n */\nexport function checkEmphasis(state) {\n  const marker = state.options.emphasis || '*'\n\n  if (marker !== '*' && marker !== '_') {\n    throw new Error(\n      'Cannot serialize emphasis with `' +\n        marker +\n        '` for `options.emphasis`, expected `*`, or `_`'\n    )\n  }\n\n  return marker\n}\n", "/**\n * Encode a code point as a character reference.\n *\n * @param {number} code\n *   Code point to encode.\n * @returns {string}\n *   Encoded character reference.\n */\nexport function encodeCharacterReference(code) {\n  return '&#x' + code.toString(16).toUpperCase() + ';'\n}\n", "/**\n * @import {EncodeSides} from '../types.js'\n */\n\nimport {classifyCharacter} from 'micromark-util-classify-character'\n\n/**\n * Check whether to encode (as a character reference) the characters\n * surrounding an attention run.\n *\n * Which characters are around an attention run influence whether it works or\n * not.\n *\n * See <https://github.com/orgs/syntax-tree/discussions/60> for more info.\n * See this markdown in a particular renderer to see what works:\n *\n * ```markdown\n * |                         | A (letter inside) | B (punctuation inside) | C (whitespace inside) | D (nothing inside) |\n * | ----------------------- | ----------------- | ---------------------- | --------------------- | ------------------ |\n * | 1 (letter outside)      | x*y*z             | x*.*z                  | x* *z                 | x**z               |\n * | 2 (punctuation outside) | .*y*.             | .*.*.                  | .* *.                 | .**.               |\n * | 3 (whitespace outside)  | x *y* z           | x *.* z                | x * * z               | x ** z             |\n * | 4 (nothing outside)     | *x*               | *.*                    | * *                   | **                 |\n * ```\n *\n * @param {number} outside\n *   Code point on the outer side of the run.\n * @param {number} inside\n *   Code point on the inner side of the run.\n * @param {'*' | '_'} marker\n *   Marker of the run.\n *   Underscores are handled more strictly (they form less often) than\n *   asterisks.\n * @returns {EncodeSides}\n *   Whether to encode characters.\n */\n// Important: punctuation must never be encoded.\n// Punctuation is solely used by markdown constructs.\n// And by encoding itself.\n// Encoding them will break constructs or double encode things.\nexport function encodeInfo(outside, inside, marker) {\n  const outsideKind = classifyCharacter(outside)\n  const insideKind = classifyCharacter(inside)\n\n  // Letter outside:\n  if (outsideKind === undefined) {\n    return insideKind === undefined\n      ? // Letter inside:\n        // we have to encode *both* letters for `_` as it is looser.\n        // it already forms for `*` (and GFMs `~`).\n        marker === '_'\n        ? {inside: true, outside: true}\n        : {inside: false, outside: false}\n      : insideKind === 1\n        ? // Whitespace inside: encode both (letter, whitespace).\n          {inside: true, outside: true}\n        : // Punctuation inside: encode outer (letter)\n          {inside: false, outside: true}\n  }\n\n  // Whitespace outside:\n  if (outsideKind === 1) {\n    return insideKind === undefined\n      ? // Letter inside: already forms.\n        {inside: false, outside: false}\n      : insideKind === 1\n        ? // Whitespace inside: encode both (whitespace).\n          {inside: true, outside: true}\n        : // Punctuation inside: already forms.\n          {inside: false, outside: false}\n  }\n\n  // Punctuation outside:\n  return insideKind === undefined\n    ? // Letter inside: already forms.\n      {inside: false, outside: false}\n    : insideKind === 1\n      ? // Whitespace inside: encode inner (whitespace).\n        {inside: true, outside: false}\n      : // Punctuation inside: already forms.\n        {inside: false, outside: false}\n}\n", "/**\n * @import {Info, State} from 'mdast-util-to-markdown'\n * @import {Emphasis, Parents} from 'mdast'\n */\n\nimport {checkEmphasis} from '../util/check-emphasis.js'\nimport {encodeCharacterReference} from '../util/encode-character-reference.js'\nimport {encodeInfo} from '../util/encode-info.js'\n\nemphasis.peek = emphasisPeek\n\n/**\n * @param {Emphasis} node\n * @param {Parents | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function emphasis(node, _, state, info) {\n  const marker = checkEmphasis(state)\n  const exit = state.enter('emphasis')\n  const tracker = state.createTracker(info)\n  const before = tracker.move(marker)\n\n  let between = tracker.move(\n    state.containerPhrasing(node, {\n      after: marker,\n      before,\n      ...tracker.current()\n    })\n  )\n  const betweenHead = between.charCodeAt(0)\n  const open = encodeInfo(\n    info.before.charCodeAt(info.before.length - 1),\n    betweenHead,\n    marker\n  )\n\n  if (open.inside) {\n    between = encodeCharacterReference(betweenHead) + between.slice(1)\n  }\n\n  const betweenTail = between.charCodeAt(between.length - 1)\n  const close = encodeInfo(info.after.charCodeAt(0), betweenTail, marker)\n\n  if (close.inside) {\n    between = between.slice(0, -1) + encodeCharacterReference(betweenTail)\n  }\n\n  const after = tracker.move(marker)\n\n  exit()\n\n  state.attentionEncodeSurroundingInfo = {\n    after: close.outside,\n    before: open.outside\n  }\n  return before + between + after\n}\n\n/**\n * @param {Emphasis} _\n * @param {Parents | undefined} _1\n * @param {State} state\n * @returns {string}\n */\nfunction emphasisPeek(_, _1, state) {\n  return state.options.emphasis || '*'\n}\n", "/**\n * @typedef {import('unist').Node} Node\n * @typedef {import('unist').Parent} Parent\n */\n\n/**\n * @template Fn\n * @template Fallback\n * @typedef {Fn extends (value: any) => value is infer Thing ? Thing : Fallback} Predicate\n */\n\n/**\n * @callback Check\n *   Check that an arbitrary value is a node.\n * @param {unknown} this\n *   The given context.\n * @param {unknown} [node]\n *   Anything (typically a node).\n * @param {number | null | undefined} [index]\n *   The node\u2019s position in its parent.\n * @param {Parent | null | undefined} [parent]\n *   The node\u2019s parent.\n * @returns {boolean}\n *   Whether this is a node and passes a test.\n *\n * @typedef {Record<string, unknown> | Node} Props\n *   Object to check for equivalence.\n *\n *   Note: `Node` is included as it is common but is not indexable.\n *\n * @typedef {Array<Props | TestFunction | string> | Props | TestFunction | string | null | undefined} Test\n *   Check for an arbitrary node.\n *\n * @callback TestFunction\n *   Check if a node passes a test.\n * @param {unknown} this\n *   The given context.\n * @param {Node} node\n *   A node.\n * @param {number | undefined} [index]\n *   The node\u2019s position in its parent.\n * @param {Parent | undefined} [parent]\n *   The node\u2019s parent.\n * @returns {boolean | undefined | void}\n *   Whether this node passes the test.\n *\n *   Note: `void` is included until TS sees no return as `undefined`.\n */\n\n/**\n * Check if `node` is a `Node` and whether it passes the given test.\n *\n * @param {unknown} node\n *   Thing to check, typically `Node`.\n * @param {Test} test\n *   A check for a specific node.\n * @param {number | null | undefined} index\n *   The node\u2019s position in its parent.\n * @param {Parent | null | undefined} parent\n *   The node\u2019s parent.\n * @param {unknown} context\n *   Context object (`this`) to pass to `test` functions.\n * @returns {boolean}\n *   Whether `node` is a node and passes a test.\n */\nexport const is =\n  // Note: overloads in JSDoc can\u2019t yet use different `@template`s.\n  /**\n   * @type {(\n   *   (<Condition extends string>(node: unknown, test: Condition, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & {type: Condition}) &\n   *   (<Condition extends Props>(node: unknown, test: Condition, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & Condition) &\n   *   (<Condition extends TestFunction>(node: unknown, test: Condition, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & Predicate<Condition, Node>) &\n   *   ((node?: null | undefined) => false) &\n   *   ((node: unknown, test?: null | undefined, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node) &\n   *   ((node: unknown, test?: Test, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => boolean)\n   * )}\n   */\n  (\n    /**\n     * @param {unknown} [node]\n     * @param {Test} [test]\n     * @param {number | null | undefined} [index]\n     * @param {Parent | null | undefined} [parent]\n     * @param {unknown} [context]\n     * @returns {boolean}\n     */\n    // eslint-disable-next-line max-params\n    function (node, test, index, parent, context) {\n      const check = convert(test)\n\n      if (\n        index !== undefined &&\n        index !== null &&\n        (typeof index !== 'number' ||\n          index < 0 ||\n          index === Number.POSITIVE_INFINITY)\n      ) {\n        throw new Error('Expected positive finite index')\n      }\n\n      if (\n        parent !== undefined &&\n        parent !== null &&\n        (!is(parent) || !parent.children)\n      ) {\n        throw new Error('Expected parent node')\n      }\n\n      if (\n        (parent === undefined || parent === null) !==\n        (index === undefined || index === null)\n      ) {\n        throw new Error('Expected both parent and index')\n      }\n\n      return looksLikeANode(node)\n        ? check.call(context, node, index, parent)\n        : false\n    }\n  )\n\n/**\n * Generate an assertion from a test.\n *\n * Useful if you\u2019re going to test many nodes, for example when creating a\n * utility where something else passes a compatible test.\n *\n * The created function is a bit faster because it expects valid input only:\n * a `node`, `index`, and `parent`.\n *\n * @param {Test} test\n *   *   when nullish, checks if `node` is a `Node`.\n *   *   when `string`, works like passing `(node) => node.type === test`.\n *   *   when `function` checks if function passed the node is true.\n *   *   when `object`, checks that all keys in test are in node, and that they have (strictly) equal values.\n *   *   when `array`, checks if any one of the subtests pass.\n * @returns {Check}\n *   An assertion.\n */\nexport const convert =\n  // Note: overloads in JSDoc can\u2019t yet use different `@template`s.\n  /**\n   * @type {(\n   *   (<Condition extends string>(test: Condition) => (node: unknown, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & {type: Condition}) &\n   *   (<Condition extends Props>(test: Condition) => (node: unknown, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & Condition) &\n   *   (<Condition extends TestFunction>(test: Condition) => (node: unknown, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & Predicate<Condition, Node>) &\n   *   ((test?: null | undefined) => (node?: unknown, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node) &\n   *   ((test?: Test) => Check)\n   * )}\n   */\n  (\n    /**\n     * @param {Test} [test]\n     * @returns {Check}\n     */\n    function (test) {\n      if (test === null || test === undefined) {\n        return ok\n      }\n\n      if (typeof test === 'function') {\n        return castFactory(test)\n      }\n\n      if (typeof test === 'object') {\n        return Array.isArray(test) ? anyFactory(test) : propsFactory(test)\n      }\n\n      if (typeof test === 'string') {\n        return typeFactory(test)\n      }\n\n      throw new Error('Expected function, string, or object as test')\n    }\n  )\n\n/**\n * @param {Array<Props | TestFunction | string>} tests\n * @returns {Check}\n */\nfunction anyFactory(tests) {\n  /** @type {Array<Check>} */\n  const checks = []\n  let index = -1\n\n  while (++index < tests.length) {\n    checks[index] = convert(tests[index])\n  }\n\n  return castFactory(any)\n\n  /**\n   * @this {unknown}\n   * @type {TestFunction}\n   */\n  function any(...parameters) {\n    let index = -1\n\n    while (++index < checks.length) {\n      if (checks[index].apply(this, parameters)) return true\n    }\n\n    return false\n  }\n}\n\n/**\n * Turn an object into a test for a node with a certain fields.\n *\n * @param {Props} check\n * @returns {Check}\n */\nfunction propsFactory(check) {\n  const checkAsRecord = /** @type {Record<string, unknown>} */ (check)\n\n  return castFactory(all)\n\n  /**\n   * @param {Node} node\n   * @returns {boolean}\n   */\n  function all(node) {\n    const nodeAsRecord = /** @type {Record<string, unknown>} */ (\n      /** @type {unknown} */ (node)\n    )\n\n    /** @type {string} */\n    let key\n\n    for (key in check) {\n      if (nodeAsRecord[key] !== checkAsRecord[key]) return false\n    }\n\n    return true\n  }\n}\n\n/**\n * Turn a string into a test for a node with a certain type.\n *\n * @param {string} check\n * @returns {Check}\n */\nfunction typeFactory(check) {\n  return castFactory(type)\n\n  /**\n   * @param {Node} node\n   */\n  function type(node) {\n    return node && node.type === check\n  }\n}\n\n/**\n * Turn a custom test into a test for a node that passes that test.\n *\n * @param {TestFunction} testFunction\n * @returns {Check}\n */\nfunction castFactory(testFunction) {\n  return check\n\n  /**\n   * @this {unknown}\n   * @type {Check}\n   */\n  function check(value, index, parent) {\n    return Boolean(\n      looksLikeANode(value) &&\n        testFunction.call(\n          this,\n          value,\n          typeof index === 'number' ? index : undefined,\n          parent || undefined\n        )\n    )\n  }\n}\n\nfunction ok() {\n  return true\n}\n\n/**\n * @param {unknown} value\n * @returns {value is Node}\n */\nfunction looksLikeANode(value) {\n  return value !== null && typeof value === 'object' && 'type' in value\n}\n", "/**\n * @typedef {import('unist').Node} UnistNode\n * @typedef {import('unist').Parent} UnistParent\n */\n\n/**\n * @typedef {Exclude<import('unist-util-is').Test, undefined> | undefined} Test\n *   Test from `unist-util-is`.\n *\n *   Note: we have remove and add `undefined`, because otherwise when generating\n *   automatic `.d.ts` files, TS tries to flatten paths from a local perspective,\n *   which doesn\u2019t work when publishing on npm.\n */\n\n/**\n * @typedef {(\n *   Fn extends (value: any) => value is infer Thing\n *   ? Thing\n *   : Fallback\n * )} Predicate\n *   Get the value of a type guard `Fn`.\n * @template Fn\n *   Value; typically function that is a type guard (such as `(x): x is Y`).\n * @template Fallback\n *   Value to yield if `Fn` is not a type guard.\n */\n\n/**\n * @typedef {(\n *   Check extends null | undefined // No test.\n *   ? Value\n *   : Value extends {type: Check} // String (type) test.\n *   ? Value\n *   : Value extends Check // Partial test.\n *   ? Value\n *   : Check extends Function // Function test.\n *   ? Predicate<Check, Value> extends Value\n *     ? Predicate<Check, Value>\n *     : never\n *   : never // Some other test?\n * )} MatchesOne\n *   Check whether a node matches a primitive check in the type system.\n * @template Value\n *   Value; typically unist `Node`.\n * @template Check\n *   Value; typically `unist-util-is`-compatible test, but not arrays.\n */\n\n/**\n * @typedef {(\n *   Check extends Array<any>\n *   ? MatchesOne<Value, Check[keyof Check]>\n *   : MatchesOne<Value, Check>\n * )} Matches\n *   Check whether a node matches a check in the type system.\n * @template Value\n *   Value; typically unist `Node`.\n * @template Check\n *   Value; typically `unist-util-is`-compatible test.\n */\n\n/**\n * @typedef {0 | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10} Uint\n *   Number; capped reasonably.\n */\n\n/**\n * @typedef {I extends 0 ? 1 : I extends 1 ? 2 : I extends 2 ? 3 : I extends 3 ? 4 : I extends 4 ? 5 : I extends 5 ? 6 : I extends 6 ? 7 : I extends 7 ? 8 : I extends 8 ? 9 : 10} Increment\n *   Increment a number in the type system.\n * @template {Uint} [I=0]\n *   Index.\n */\n\n/**\n * @typedef {(\n *   Node extends UnistParent\n *   ? Node extends {children: Array<infer Children>}\n *     ? Child extends Children ? Node : never\n *     : never\n *   : never\n * )} InternalParent\n *   Collect nodes that can be parents of `Child`.\n * @template {UnistNode} Node\n *   All node types in a tree.\n * @template {UnistNode} Child\n *   Node to search for.\n */\n\n/**\n * @typedef {InternalParent<InclusiveDescendant<Tree>, Child>} Parent\n *   Collect nodes in `Tree` that can be parents of `Child`.\n * @template {UnistNode} Tree\n *   All node types in a tree.\n * @template {UnistNode} Child\n *   Node to search for.\n */\n\n/**\n * @typedef {(\n *   Depth extends Max\n *   ? never\n *   :\n *     | InternalParent<Node, Child>\n *     | InternalAncestor<Node, InternalParent<Node, Child>, Max, Increment<Depth>>\n * )} InternalAncestor\n *   Collect nodes in `Tree` that can be ancestors of `Child`.\n * @template {UnistNode} Node\n *   All node types in a tree.\n * @template {UnistNode} Child\n *   Node to search for.\n * @template {Uint} [Max=10]\n *   Max; searches up to this depth.\n * @template {Uint} [Depth=0]\n *   Current depth.\n */\n\n/**\n * @typedef {InternalAncestor<InclusiveDescendant<Tree>, Child>} Ancestor\n *   Collect nodes in `Tree` that can be ancestors of `Child`.\n * @template {UnistNode} Tree\n *   All node types in a tree.\n * @template {UnistNode} Child\n *   Node to search for.\n */\n\n/**\n * @typedef {(\n *   Tree extends UnistParent\n *     ? Depth extends Max\n *       ? Tree\n *       : Tree | InclusiveDescendant<Tree['children'][number], Max, Increment<Depth>>\n *     : Tree\n * )} InclusiveDescendant\n *   Collect all (inclusive) descendants of `Tree`.\n *\n *   > \uD83D\uDC49 **Note**: for performance reasons, this seems to be the fastest way to\n *   > recurse without actually running into an infinite loop, which the\n *   > previous version did.\n *   >\n *   > Practically, a max of `2` is typically enough assuming a `Root` is\n *   > passed, but it doesn\u2019t improve performance.\n *   > It gets higher with `List > ListItem > Table > TableRow > TableCell`.\n *   > Using up to `10` doesn\u2019t hurt or help either.\n * @template {UnistNode} Tree\n *   Tree type.\n * @template {Uint} [Max=10]\n *   Max; searches up to this depth.\n * @template {Uint} [Depth=0]\n *   Current depth.\n */\n\n/**\n * @typedef {'skip' | boolean} Action\n *   Union of the action types.\n *\n * @typedef {number} Index\n *   Move to the sibling at `index` next (after node itself is completely\n *   traversed).\n *\n *   Useful if mutating the tree, such as removing the node the visitor is\n *   currently on, or any of its previous siblings.\n *   Results less than 0 or greater than or equal to `children.length` stop\n *   traversing the parent.\n *\n * @typedef {[(Action | null | undefined | void)?, (Index | null | undefined)?]} ActionTuple\n *   List with one or two values, the first an action, the second an index.\n *\n * @typedef {Action | ActionTuple | Index | null | undefined | void} VisitorResult\n *   Any value that can be returned from a visitor.\n */\n\n/**\n * @callback Visitor\n *   Handle a node (matching `test`, if given).\n *\n *   Visitors are free to transform `node`.\n *   They can also transform the parent of node (the last of `ancestors`).\n *\n *   Replacing `node` itself, if `SKIP` is not returned, still causes its\n *   descendants to be walked (which is a bug).\n *\n *   When adding or removing previous siblings of `node` (or next siblings, in\n *   case of reverse), the `Visitor` should return a new `Index` to specify the\n *   sibling to traverse after `node` is traversed.\n *   Adding or removing next siblings of `node` (or previous siblings, in case\n *   of reverse) is handled as expected without needing to return a new `Index`.\n *\n *   Removing the children property of an ancestor still results in them being\n *   traversed.\n * @param {Visited} node\n *   Found node.\n * @param {Array<VisitedParents>} ancestors\n *   Ancestors of `node`.\n * @returns {VisitorResult}\n *   What to do next.\n *\n *   An `Index` is treated as a tuple of `[CONTINUE, Index]`.\n *   An `Action` is treated as a tuple of `[Action]`.\n *\n *   Passing a tuple back only makes sense if the `Action` is `SKIP`.\n *   When the `Action` is `EXIT`, that action can be returned.\n *   When the `Action` is `CONTINUE`, `Index` can be returned.\n * @template {UnistNode} [Visited=UnistNode]\n *   Visited node type.\n * @template {UnistParent} [VisitedParents=UnistParent]\n *   Ancestor type.\n */\n\n/**\n * @typedef {Visitor<Matches<InclusiveDescendant<Tree>, Check>, Ancestor<Tree, Matches<InclusiveDescendant<Tree>, Check>>>} BuildVisitor\n *   Build a typed `Visitor` function from a tree and a test.\n *\n *   It will infer which values are passed as `node` and which as `parents`.\n * @template {UnistNode} [Tree=UnistNode]\n *   Tree type.\n * @template {Test} [Check=Test]\n *   Test type.\n */\n\nimport {convert} from 'unist-util-is'\nimport {color} from 'unist-util-visit-parents/do-not-use-color'\n\n/** @type {Readonly<ActionTuple>} */\nconst empty = []\n\n/**\n * Continue traversing as normal.\n */\nexport const CONTINUE = true\n\n/**\n * Stop traversing immediately.\n */\nexport const EXIT = false\n\n/**\n * Do not traverse this node\u2019s children.\n */\nexport const SKIP = 'skip'\n\n/**\n * Visit nodes, with ancestral information.\n *\n * This algorithm performs *depth-first* *tree traversal* in *preorder*\n * (**NLR**) or if `reverse` is given, in *reverse preorder* (**NRL**).\n *\n * You can choose for which nodes `visitor` is called by passing a `test`.\n * For complex tests, you should test yourself in `visitor`, as it will be\n * faster and will have improved type information.\n *\n * Walking the tree is an intensive task.\n * Make use of the return values of the visitor when possible.\n * Instead of walking a tree multiple times, walk it once, use `unist-util-is`\n * to check if a node matches, and then perform different operations.\n *\n * You can change the tree.\n * See `Visitor` for more info.\n *\n * @overload\n * @param {Tree} tree\n * @param {Check} check\n * @param {BuildVisitor<Tree, Check>} visitor\n * @param {boolean | null | undefined} [reverse]\n * @returns {undefined}\n *\n * @overload\n * @param {Tree} tree\n * @param {BuildVisitor<Tree>} visitor\n * @param {boolean | null | undefined} [reverse]\n * @returns {undefined}\n *\n * @param {UnistNode} tree\n *   Tree to traverse.\n * @param {Visitor | Test} test\n *   `unist-util-is`-compatible test\n * @param {Visitor | boolean | null | undefined} [visitor]\n *   Handle each node.\n * @param {boolean | null | undefined} [reverse]\n *   Traverse in reverse preorder (NRL) instead of the default preorder (NLR).\n * @returns {undefined}\n *   Nothing.\n *\n * @template {UnistNode} Tree\n *   Node type.\n * @template {Test} Check\n *   `unist-util-is`-compatible test.\n */\nexport function visitParents(tree, test, visitor, reverse) {\n  /** @type {Test} */\n  let check\n\n  if (typeof test === 'function' && typeof visitor !== 'function') {\n    reverse = visitor\n    // @ts-expect-error no visitor given, so `visitor` is test.\n    visitor = test\n  } else {\n    // @ts-expect-error visitor given, so `test` isn\u2019t a visitor.\n    check = test\n  }\n\n  const is = convert(check)\n  const step = reverse ? -1 : 1\n\n  factory(tree, undefined, [])()\n\n  /**\n   * @param {UnistNode} node\n   * @param {number | undefined} index\n   * @param {Array<UnistParent>} parents\n   */\n  function factory(node, index, parents) {\n    const value = /** @type {Record<string, unknown>} */ (\n      node && typeof node === 'object' ? node : {}\n    )\n\n    if (typeof value.type === 'string') {\n      const name =\n        // `hast`\n        typeof value.tagName === 'string'\n          ? value.tagName\n          : // `xast`\n          typeof value.name === 'string'\n          ? value.name\n          : undefined\n\n      Object.defineProperty(visit, 'name', {\n        value:\n          'node (' + color(node.type + (name ? '<' + name + '>' : '')) + ')'\n      })\n    }\n\n    return visit\n\n    function visit() {\n      /** @type {Readonly<ActionTuple>} */\n      let result = empty\n      /** @type {Readonly<ActionTuple>} */\n      let subresult\n      /** @type {number} */\n      let offset\n      /** @type {Array<UnistParent>} */\n      let grandparents\n\n      if (!test || is(node, index, parents[parents.length - 1] || undefined)) {\n        // @ts-expect-error: `visitor` is now a visitor.\n        result = toResult(visitor(node, parents))\n\n        if (result[0] === EXIT) {\n          return result\n        }\n      }\n\n      if ('children' in node && node.children) {\n        const nodeAsParent = /** @type {UnistParent} */ (node)\n\n        if (nodeAsParent.children && result[0] !== SKIP) {\n          offset = (reverse ? nodeAsParent.children.length : -1) + step\n          grandparents = parents.concat(nodeAsParent)\n\n          while (offset > -1 && offset < nodeAsParent.children.length) {\n            const child = nodeAsParent.children[offset]\n\n            subresult = factory(child, offset, grandparents)()\n\n            if (subresult[0] === EXIT) {\n              return subresult\n            }\n\n            offset =\n              typeof subresult[1] === 'number' ? subresult[1] : offset + step\n          }\n        }\n      }\n\n      return result\n    }\n  }\n}\n\n/**\n * Turn a return value into a clean result.\n *\n * @param {VisitorResult} value\n *   Valid return values from visitors.\n * @returns {Readonly<ActionTuple>}\n *   Clean result.\n */\nfunction toResult(value) {\n  if (Array.isArray(value)) {\n    return value\n  }\n\n  if (typeof value === 'number') {\n    return [CONTINUE, value]\n  }\n\n  return value === null || value === undefined ? empty : [value]\n}\n", "/**\n * @typedef {import('unist').Node} UnistNode\n * @typedef {import('unist').Parent} UnistParent\n * @typedef {import('unist-util-visit-parents').VisitorResult} VisitorResult\n */\n\n/**\n * @typedef {Exclude<import('unist-util-is').Test, undefined> | undefined} Test\n *   Test from `unist-util-is`.\n *\n *   Note: we have remove and add `undefined`, because otherwise when generating\n *   automatic `.d.ts` files, TS tries to flatten paths from a local perspective,\n *   which doesn\u2019t work when publishing on npm.\n */\n\n// To do: use types from `unist-util-visit-parents` when it\u2019s released.\n\n/**\n * @typedef {(\n *   Fn extends (value: any) => value is infer Thing\n *   ? Thing\n *   : Fallback\n * )} Predicate\n *   Get the value of a type guard `Fn`.\n * @template Fn\n *   Value; typically function that is a type guard (such as `(x): x is Y`).\n * @template Fallback\n *   Value to yield if `Fn` is not a type guard.\n */\n\n/**\n * @typedef {(\n *   Check extends null | undefined // No test.\n *   ? Value\n *   : Value extends {type: Check} // String (type) test.\n *   ? Value\n *   : Value extends Check // Partial test.\n *   ? Value\n *   : Check extends Function // Function test.\n *   ? Predicate<Check, Value> extends Value\n *     ? Predicate<Check, Value>\n *     : never\n *   : never // Some other test?\n * )} MatchesOne\n *   Check whether a node matches a primitive check in the type system.\n * @template Value\n *   Value; typically unist `Node`.\n * @template Check\n *   Value; typically `unist-util-is`-compatible test, but not arrays.\n */\n\n/**\n * @typedef {(\n *   Check extends Array<any>\n *   ? MatchesOne<Value, Check[keyof Check]>\n *   : MatchesOne<Value, Check>\n * )} Matches\n *   Check whether a node matches a check in the type system.\n * @template Value\n *   Value; typically unist `Node`.\n * @template Check\n *   Value; typically `unist-util-is`-compatible test.\n */\n\n/**\n * @typedef {0 | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10} Uint\n *   Number; capped reasonably.\n */\n\n/**\n * @typedef {I extends 0 ? 1 : I extends 1 ? 2 : I extends 2 ? 3 : I extends 3 ? 4 : I extends 4 ? 5 : I extends 5 ? 6 : I extends 6 ? 7 : I extends 7 ? 8 : I extends 8 ? 9 : 10} Increment\n *   Increment a number in the type system.\n * @template {Uint} [I=0]\n *   Index.\n */\n\n/**\n * @typedef {(\n *   Node extends UnistParent\n *   ? Node extends {children: Array<infer Children>}\n *     ? Child extends Children ? Node : never\n *     : never\n *   : never\n * )} InternalParent\n *   Collect nodes that can be parents of `Child`.\n * @template {UnistNode} Node\n *   All node types in a tree.\n * @template {UnistNode} Child\n *   Node to search for.\n */\n\n/**\n * @typedef {InternalParent<InclusiveDescendant<Tree>, Child>} Parent\n *   Collect nodes in `Tree` that can be parents of `Child`.\n * @template {UnistNode} Tree\n *   All node types in a tree.\n * @template {UnistNode} Child\n *   Node to search for.\n */\n\n/**\n * @typedef {(\n *   Depth extends Max\n *   ? never\n *   :\n *     | InternalParent<Node, Child>\n *     | InternalAncestor<Node, InternalParent<Node, Child>, Max, Increment<Depth>>\n * )} InternalAncestor\n *   Collect nodes in `Tree` that can be ancestors of `Child`.\n * @template {UnistNode} Node\n *   All node types in a tree.\n * @template {UnistNode} Child\n *   Node to search for.\n * @template {Uint} [Max=10]\n *   Max; searches up to this depth.\n * @template {Uint} [Depth=0]\n *   Current depth.\n */\n\n/**\n * @typedef {(\n *   Tree extends UnistParent\n *     ? Depth extends Max\n *       ? Tree\n *       : Tree | InclusiveDescendant<Tree['children'][number], Max, Increment<Depth>>\n *     : Tree\n * )} InclusiveDescendant\n *   Collect all (inclusive) descendants of `Tree`.\n *\n *   > \uD83D\uDC49 **Note**: for performance reasons, this seems to be the fastest way to\n *   > recurse without actually running into an infinite loop, which the\n *   > previous version did.\n *   >\n *   > Practically, a max of `2` is typically enough assuming a `Root` is\n *   > passed, but it doesn\u2019t improve performance.\n *   > It gets higher with `List > ListItem > Table > TableRow > TableCell`.\n *   > Using up to `10` doesn\u2019t hurt or help either.\n * @template {UnistNode} Tree\n *   Tree type.\n * @template {Uint} [Max=10]\n *   Max; searches up to this depth.\n * @template {Uint} [Depth=0]\n *   Current depth.\n */\n\n/**\n * @callback Visitor\n *   Handle a node (matching `test`, if given).\n *\n *   Visitors are free to transform `node`.\n *   They can also transform `parent`.\n *\n *   Replacing `node` itself, if `SKIP` is not returned, still causes its\n *   descendants to be walked (which is a bug).\n *\n *   When adding or removing previous siblings of `node` (or next siblings, in\n *   case of reverse), the `Visitor` should return a new `Index` to specify the\n *   sibling to traverse after `node` is traversed.\n *   Adding or removing next siblings of `node` (or previous siblings, in case\n *   of reverse) is handled as expected without needing to return a new `Index`.\n *\n *   Removing the children property of `parent` still results in them being\n *   traversed.\n * @param {Visited} node\n *   Found node.\n * @param {Visited extends UnistNode ? number | undefined : never} index\n *   Index of `node` in `parent`.\n * @param {Ancestor extends UnistParent ? Ancestor | undefined : never} parent\n *   Parent of `node`.\n * @returns {VisitorResult}\n *   What to do next.\n *\n *   An `Index` is treated as a tuple of `[CONTINUE, Index]`.\n *   An `Action` is treated as a tuple of `[Action]`.\n *\n *   Passing a tuple back only makes sense if the `Action` is `SKIP`.\n *   When the `Action` is `EXIT`, that action can be returned.\n *   When the `Action` is `CONTINUE`, `Index` can be returned.\n * @template {UnistNode} [Visited=UnistNode]\n *   Visited node type.\n * @template {UnistParent} [Ancestor=UnistParent]\n *   Ancestor type.\n */\n\n/**\n * @typedef {Visitor<Visited, Parent<Ancestor, Visited>>} BuildVisitorFromMatch\n *   Build a typed `Visitor` function from a node and all possible parents.\n *\n *   It will infer which values are passed as `node` and which as `parent`.\n * @template {UnistNode} Visited\n *   Node type.\n * @template {UnistParent} Ancestor\n *   Parent type.\n */\n\n/**\n * @typedef {(\n *   BuildVisitorFromMatch<\n *     Matches<Descendant, Check>,\n *     Extract<Descendant, UnistParent>\n *   >\n * )} BuildVisitorFromDescendants\n *   Build a typed `Visitor` function from a list of descendants and a test.\n *\n *   It will infer which values are passed as `node` and which as `parent`.\n * @template {UnistNode} Descendant\n *   Node type.\n * @template {Test} Check\n *   Test type.\n */\n\n/**\n * @typedef {(\n *   BuildVisitorFromDescendants<\n *     InclusiveDescendant<Tree>,\n *     Check\n *   >\n * )} BuildVisitor\n *   Build a typed `Visitor` function from a tree and a test.\n *\n *   It will infer which values are passed as `node` and which as `parent`.\n * @template {UnistNode} [Tree=UnistNode]\n *   Node type.\n * @template {Test} [Check=Test]\n *   Test type.\n */\n\nimport {visitParents} from 'unist-util-visit-parents'\n\nexport {CONTINUE, EXIT, SKIP} from 'unist-util-visit-parents'\n\n/**\n * Visit nodes.\n *\n * This algorithm performs *depth-first* *tree traversal* in *preorder*\n * (**NLR**) or if `reverse` is given, in *reverse preorder* (**NRL**).\n *\n * You can choose for which nodes `visitor` is called by passing a `test`.\n * For complex tests, you should test yourself in `visitor`, as it will be\n * faster and will have improved type information.\n *\n * Walking the tree is an intensive task.\n * Make use of the return values of the visitor when possible.\n * Instead of walking a tree multiple times, walk it once, use `unist-util-is`\n * to check if a node matches, and then perform different operations.\n *\n * You can change the tree.\n * See `Visitor` for more info.\n *\n * @overload\n * @param {Tree} tree\n * @param {Check} check\n * @param {BuildVisitor<Tree, Check>} visitor\n * @param {boolean | null | undefined} [reverse]\n * @returns {undefined}\n *\n * @overload\n * @param {Tree} tree\n * @param {BuildVisitor<Tree>} visitor\n * @param {boolean | null | undefined} [reverse]\n * @returns {undefined}\n *\n * @param {UnistNode} tree\n *   Tree to traverse.\n * @param {Visitor | Test} testOrVisitor\n *   `unist-util-is`-compatible test (optional, omit to pass a visitor).\n * @param {Visitor | boolean | null | undefined} [visitorOrReverse]\n *   Handle each node (when test is omitted, pass `reverse`).\n * @param {boolean | null | undefined} [maybeReverse=false]\n *   Traverse in reverse preorder (NRL) instead of the default preorder (NLR).\n * @returns {undefined}\n *   Nothing.\n *\n * @template {UnistNode} Tree\n *   Node type.\n * @template {Test} Check\n *   `unist-util-is`-compatible test.\n */\nexport function visit(tree, testOrVisitor, visitorOrReverse, maybeReverse) {\n  /** @type {boolean | null | undefined} */\n  let reverse\n  /** @type {Test} */\n  let test\n  /** @type {Visitor} */\n  let visitor\n\n  if (\n    typeof testOrVisitor === 'function' &&\n    typeof visitorOrReverse !== 'function'\n  ) {\n    test = undefined\n    visitor = testOrVisitor\n    reverse = visitorOrReverse\n  } else {\n    // @ts-expect-error: assume the overload with test was given.\n    test = testOrVisitor\n    // @ts-expect-error: assume the overload with test was given.\n    visitor = visitorOrReverse\n    reverse = maybeReverse\n  }\n\n  visitParents(tree, test, overload, reverse)\n\n  /**\n   * @param {UnistNode} node\n   * @param {Array<UnistParent>} parents\n   */\n  function overload(node, parents) {\n    const parent = parents[parents.length - 1]\n    const index = parent ? parent.children.indexOf(node) : undefined\n    return visitor(node, index, parent)\n  }\n}\n", "/**\n * @import {State} from 'mdast-util-to-markdown'\n * @import {Heading} from 'mdast'\n */\n\nimport {EXIT, visit} from 'unist-util-visit'\nimport {toString} from 'mdast-util-to-string'\n\n/**\n * @param {Heading} node\n * @param {State} state\n * @returns {boolean}\n */\nexport function formatHeadingAsSetext(node, state) {\n  let literalWithBreak = false\n\n  // Look for literals with a line break.\n  // Note that this also\n  visit(node, function (node) {\n    if (\n      ('value' in node && /\\r?\\n|\\r/.test(node.value)) ||\n      node.type === 'break'\n    ) {\n      literalWithBreak = true\n      return EXIT\n    }\n  })\n\n  return Boolean(\n    (!node.depth || node.depth < 3) &&\n      toString(node) &&\n      (state.options.setext || literalWithBreak)\n  )\n}\n", "/**\n * @import {Info, State} from 'mdast-util-to-markdown'\n * @import {Heading, Parents} from 'mdast'\n */\n\nimport {encodeCharacterReference} from '../util/encode-character-reference.js'\nimport {formatHeadingAsSetext} from '../util/format-heading-as-setext.js'\n\n/**\n * @param {Heading} node\n * @param {Parents | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function heading(node, _, state, info) {\n  const rank = Math.max(Math.min(6, node.depth || 1), 1)\n  const tracker = state.createTracker(info)\n\n  if (formatHeadingAsSetext(node, state)) {\n    const exit = state.enter('headingSetext')\n    const subexit = state.enter('phrasing')\n    const value = state.containerPhrasing(node, {\n      ...tracker.current(),\n      before: '\\n',\n      after: '\\n'\n    })\n    subexit()\n    exit()\n\n    return (\n      value +\n      '\\n' +\n      (rank === 1 ? '=' : '-').repeat(\n        // The whole size\u2026\n        value.length -\n          // Minus the position of the character after the last EOL (or\n          // 0 if there is none)\u2026\n          (Math.max(value.lastIndexOf('\\r'), value.lastIndexOf('\\n')) + 1)\n      )\n    )\n  }\n\n  const sequence = '#'.repeat(rank)\n  const exit = state.enter('headingAtx')\n  const subexit = state.enter('phrasing')\n\n  // Note: for proper tracking, we should reset the output positions when there\n  // is no content returned, because then the space is not output.\n  // Practically, in that case, there is no content, so it doesn\u2019t matter that\n  // we\u2019ve tracked one too many characters.\n  tracker.move(sequence + ' ')\n\n  let value = state.containerPhrasing(node, {\n    before: '# ',\n    after: '\\n',\n    ...tracker.current()\n  })\n\n  if (/^[\\t ]/.test(value)) {\n    // To do: what effect has the character reference on tracking?\n    value = encodeCharacterReference(value.charCodeAt(0)) + value.slice(1)\n  }\n\n  value = value ? sequence + ' ' + value : sequence\n\n  if (state.options.closeAtx) {\n    value += ' ' + sequence\n  }\n\n  subexit()\n  exit()\n\n  return value\n}\n", "/**\n * @import {Html} from 'mdast'\n */\n\nhtml.peek = htmlPeek\n\n/**\n * @param {Html} node\n * @returns {string}\n */\nexport function html(node) {\n  return node.value || ''\n}\n\n/**\n * @returns {string}\n */\nfunction htmlPeek() {\n  return '<'\n}\n", "/**\n * @import {Info, State} from 'mdast-util-to-markdown'\n * @import {Image, Parents} from 'mdast'\n */\n\nimport {checkQuote} from '../util/check-quote.js'\n\nimage.peek = imagePeek\n\n/**\n * @param {Image} node\n * @param {Parents | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function image(node, _, state, info) {\n  const quote = checkQuote(state)\n  const suffix = quote === '\"' ? 'Quote' : 'Apostrophe'\n  const exit = state.enter('image')\n  let subexit = state.enter('label')\n  const tracker = state.createTracker(info)\n  let value = tracker.move('![')\n  value += tracker.move(\n    state.safe(node.alt, {before: value, after: ']', ...tracker.current()})\n  )\n  value += tracker.move('](')\n\n  subexit()\n\n  if (\n    // If there\u2019s no url but there is a title\u2026\n    (!node.url && node.title) ||\n    // If there are control characters or whitespace.\n    /[\\0- \\u007F]/.test(node.url)\n  ) {\n    subexit = state.enter('destinationLiteral')\n    value += tracker.move('<')\n    value += tracker.move(\n      state.safe(node.url, {before: value, after: '>', ...tracker.current()})\n    )\n    value += tracker.move('>')\n  } else {\n    // No whitespace, raw is prettier.\n    subexit = state.enter('destinationRaw')\n    value += tracker.move(\n      state.safe(node.url, {\n        before: value,\n        after: node.title ? ' ' : ')',\n        ...tracker.current()\n      })\n    )\n  }\n\n  subexit()\n\n  if (node.title) {\n    subexit = state.enter(`title${suffix}`)\n    value += tracker.move(' ' + quote)\n    value += tracker.move(\n      state.safe(node.title, {\n        before: value,\n        after: quote,\n        ...tracker.current()\n      })\n    )\n    value += tracker.move(quote)\n    subexit()\n  }\n\n  value += tracker.move(')')\n  exit()\n\n  return value\n}\n\n/**\n * @returns {string}\n */\nfunction imagePeek() {\n  return '!'\n}\n", "/**\n * @import {Info, State} from 'mdast-util-to-markdown'\n * @import {ImageReference, Parents} from 'mdast'\n */\n\nimageReference.peek = imageReferencePeek\n\n/**\n * @param {ImageReference} node\n * @param {Parents | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function imageReference(node, _, state, info) {\n  const type = node.referenceType\n  const exit = state.enter('imageReference')\n  let subexit = state.enter('label')\n  const tracker = state.createTracker(info)\n  let value = tracker.move('![')\n  const alt = state.safe(node.alt, {\n    before: value,\n    after: ']',\n    ...tracker.current()\n  })\n  value += tracker.move(alt + '][')\n\n  subexit()\n  // Hide the fact that we\u2019re in phrasing, because escapes don\u2019t work.\n  const stack = state.stack\n  state.stack = []\n  subexit = state.enter('reference')\n  // Note: for proper tracking, we should reset the output positions when we end\n  // up making a `shortcut` reference, because then there is no brace output.\n  // Practically, in that case, there is no content, so it doesn\u2019t matter that\n  // we\u2019ve tracked one too many characters.\n  const reference = state.safe(state.associationId(node), {\n    before: value,\n    after: ']',\n    ...tracker.current()\n  })\n  subexit()\n  state.stack = stack\n  exit()\n\n  if (type === 'full' || !alt || alt !== reference) {\n    value += tracker.move(reference + ']')\n  } else if (type === 'shortcut') {\n    // Remove the unwanted `[`.\n    value = value.slice(0, -1)\n  } else {\n    value += tracker.move(']')\n  }\n\n  return value\n}\n\n/**\n * @returns {string}\n */\nfunction imageReferencePeek() {\n  return '!'\n}\n", "/**\n * @import {State} from 'mdast-util-to-markdown'\n * @import {InlineCode, Parents} from 'mdast'\n */\n\ninlineCode.peek = inlineCodePeek\n\n/**\n * @param {InlineCode} node\n * @param {Parents | undefined} _\n * @param {State} state\n * @returns {string}\n */\nexport function inlineCode(node, _, state) {\n  let value = node.value || ''\n  let sequence = '`'\n  let index = -1\n\n  // If there is a single grave accent on its own in the code, use a fence of\n  // two.\n  // If there are two in a row, use one.\n  while (new RegExp('(^|[^`])' + sequence + '([^`]|$)').test(value)) {\n    sequence += '`'\n  }\n\n  // If this is not just spaces or eols (tabs don\u2019t count), and either the\n  // first or last character are a space, eol, or tick, then pad with spaces.\n  if (\n    /[^ \\r\\n]/.test(value) &&\n    ((/^[ \\r\\n]/.test(value) && /[ \\r\\n]$/.test(value)) || /^`|`$/.test(value))\n  ) {\n    value = ' ' + value + ' '\n  }\n\n  // We have a potential problem: certain characters after eols could result in\n  // blocks being seen.\n  // For example, if someone injected the string `'\\n# b'`, then that would\n  // result in an ATX heading.\n  // We can\u2019t escape characters in `inlineCode`, but because eols are\n  // transformed to spaces when going from markdown to HTML anyway, we can swap\n  // them out.\n  while (++index < state.unsafe.length) {\n    const pattern = state.unsafe[index]\n    const expression = state.compilePattern(pattern)\n    /** @type {RegExpExecArray | null} */\n    let match\n\n    // Only look for `atBreak`s.\n    // Btw: note that `atBreak` patterns will always start the regex at LF or\n    // CR.\n    if (!pattern.atBreak) continue\n\n    while ((match = expression.exec(value))) {\n      let position = match.index\n\n      // Support CRLF (patterns only look for one of the characters).\n      if (\n        value.charCodeAt(position) === 10 /* `\\n` */ &&\n        value.charCodeAt(position - 1) === 13 /* `\\r` */\n      ) {\n        position--\n      }\n\n      value = value.slice(0, position) + ' ' + value.slice(match.index + 1)\n    }\n  }\n\n  return sequence + value + sequence\n}\n\n/**\n * @returns {string}\n */\nfunction inlineCodePeek() {\n  return '`'\n}\n", "/**\n * @import {State} from 'mdast-util-to-markdown'\n * @import {Link} from 'mdast'\n */\n\nimport {toString} from 'mdast-util-to-string'\n\n/**\n * @param {Link} node\n * @param {State} state\n * @returns {boolean}\n */\nexport function formatLinkAsAutolink(node, state) {\n  const raw = toString(node)\n\n  return Boolean(\n    !state.options.resourceLink &&\n      // If there\u2019s a url\u2026\n      node.url &&\n      // And there\u2019s a no title\u2026\n      !node.title &&\n      // And the content of `node` is a single text node\u2026\n      node.children &&\n      node.children.length === 1 &&\n      node.children[0].type === 'text' &&\n      // And if the url is the same as the content\u2026\n      (raw === node.url || 'mailto:' + raw === node.url) &&\n      // And that starts w/ a protocol\u2026\n      /^[a-z][a-z+.-]+:/i.test(node.url) &&\n      // And that doesn\u2019t contain ASCII control codes (character escapes and\n      // references don\u2019t work), space, or angle brackets\u2026\n      !/[\\0- <>\\u007F]/.test(node.url)\n  )\n}\n", "/**\n * @import {Info, State} from 'mdast-util-to-markdown'\n * @import {Link, Parents} from 'mdast'\n * @import {Exit} from '../types.js'\n */\n\nimport {checkQuote} from '../util/check-quote.js'\nimport {formatLinkAsAutolink} from '../util/format-link-as-autolink.js'\n\nlink.peek = linkPeek\n\n/**\n * @param {Link} node\n * @param {Parents | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function link(node, _, state, info) {\n  const quote = checkQuote(state)\n  const suffix = quote === '\"' ? 'Quote' : 'Apostrophe'\n  const tracker = state.createTracker(info)\n  /** @type {Exit} */\n  let exit\n  /** @type {Exit} */\n  let subexit\n\n  if (formatLinkAsAutolink(node, state)) {\n    // Hide the fact that we\u2019re in phrasing, because escapes don\u2019t work.\n    const stack = state.stack\n    state.stack = []\n    exit = state.enter('autolink')\n    let value = tracker.move('<')\n    value += tracker.move(\n      state.containerPhrasing(node, {\n        before: value,\n        after: '>',\n        ...tracker.current()\n      })\n    )\n    value += tracker.move('>')\n    exit()\n    state.stack = stack\n    return value\n  }\n\n  exit = state.enter('link')\n  subexit = state.enter('label')\n  let value = tracker.move('[')\n  value += tracker.move(\n    state.containerPhrasing(node, {\n      before: value,\n      after: '](',\n      ...tracker.current()\n    })\n  )\n  value += tracker.move('](')\n  subexit()\n\n  if (\n    // If there\u2019s no url but there is a title\u2026\n    (!node.url && node.title) ||\n    // If there are control characters or whitespace.\n    /[\\0- \\u007F]/.test(node.url)\n  ) {\n    subexit = state.enter('destinationLiteral')\n    value += tracker.move('<')\n    value += tracker.move(\n      state.safe(node.url, {before: value, after: '>', ...tracker.current()})\n    )\n    value += tracker.move('>')\n  } else {\n    // No whitespace, raw is prettier.\n    subexit = state.enter('destinationRaw')\n    value += tracker.move(\n      state.safe(node.url, {\n        before: value,\n        after: node.title ? ' ' : ')',\n        ...tracker.current()\n      })\n    )\n  }\n\n  subexit()\n\n  if (node.title) {\n    subexit = state.enter(`title${suffix}`)\n    value += tracker.move(' ' + quote)\n    value += tracker.move(\n      state.safe(node.title, {\n        before: value,\n        after: quote,\n        ...tracker.current()\n      })\n    )\n    value += tracker.move(quote)\n    subexit()\n  }\n\n  value += tracker.move(')')\n\n  exit()\n  return value\n}\n\n/**\n * @param {Link} node\n * @param {Parents | undefined} _\n * @param {State} state\n * @returns {string}\n */\nfunction linkPeek(node, _, state) {\n  return formatLinkAsAutolink(node, state) ? '<' : '['\n}\n", "/**\n * @import {Info, State} from 'mdast-util-to-markdown'\n * @import {LinkReference, Parents} from 'mdast'\n */\n\nlinkReference.peek = linkReferencePeek\n\n/**\n * @param {LinkReference} node\n * @param {Parents | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function linkReference(node, _, state, info) {\n  const type = node.referenceType\n  const exit = state.enter('linkReference')\n  let subexit = state.enter('label')\n  const tracker = state.createTracker(info)\n  let value = tracker.move('[')\n  const text = state.containerPhrasing(node, {\n    before: value,\n    after: ']',\n    ...tracker.current()\n  })\n  value += tracker.move(text + '][')\n\n  subexit()\n  // Hide the fact that we\u2019re in phrasing, because escapes don\u2019t work.\n  const stack = state.stack\n  state.stack = []\n  subexit = state.enter('reference')\n  // Note: for proper tracking, we should reset the output positions when we end\n  // up making a `shortcut` reference, because then there is no brace output.\n  // Practically, in that case, there is no content, so it doesn\u2019t matter that\n  // we\u2019ve tracked one too many characters.\n  const reference = state.safe(state.associationId(node), {\n    before: value,\n    after: ']',\n    ...tracker.current()\n  })\n  subexit()\n  state.stack = stack\n  exit()\n\n  if (type === 'full' || !text || text !== reference) {\n    value += tracker.move(reference + ']')\n  } else if (type === 'shortcut') {\n    // Remove the unwanted `[`.\n    value = value.slice(0, -1)\n  } else {\n    value += tracker.move(']')\n  }\n\n  return value\n}\n\n/**\n * @returns {string}\n */\nfunction linkReferencePeek() {\n  return '['\n}\n", "/**\n * @import {Options, State} from 'mdast-util-to-markdown'\n */\n\n/**\n * @param {State} state\n * @returns {Exclude<Options['bullet'], null | undefined>}\n */\nexport function checkBullet(state) {\n  const marker = state.options.bullet || '*'\n\n  if (marker !== '*' && marker !== '+' && marker !== '-') {\n    throw new Error(\n      'Cannot serialize items with `' +\n        marker +\n        '` for `options.bullet`, expected `*`, `+`, or `-`'\n    )\n  }\n\n  return marker\n}\n", "/**\n * @import {Options, State} from 'mdast-util-to-markdown'\n */\n\nimport {checkBullet} from './check-bullet.js'\n\n/**\n * @param {State} state\n * @returns {Exclude<Options['bullet'], null | undefined>}\n */\nexport function checkBulletOther(state) {\n  const bullet = checkBullet(state)\n  const bulletOther = state.options.bulletOther\n\n  if (!bulletOther) {\n    return bullet === '*' ? '-' : '*'\n  }\n\n  if (bulletOther !== '*' && bulletOther !== '+' && bulletOther !== '-') {\n    throw new Error(\n      'Cannot serialize items with `' +\n        bulletOther +\n        '` for `options.bulletOther`, expected `*`, `+`, or `-`'\n    )\n  }\n\n  if (bulletOther === bullet) {\n    throw new Error(\n      'Expected `bullet` (`' +\n        bullet +\n        '`) and `bulletOther` (`' +\n        bulletOther +\n        '`) to be different'\n    )\n  }\n\n  return bulletOther\n}\n", "/**\n * @import {Options, State} from 'mdast-util-to-markdown'\n */\n\n/**\n * @param {State} state\n * @returns {Exclude<Options['bulletOrdered'], null | undefined>}\n */\nexport function checkBulletOrdered(state) {\n  const marker = state.options.bulletOrdered || '.'\n\n  if (marker !== '.' && marker !== ')') {\n    throw new Error(\n      'Cannot serialize items with `' +\n        marker +\n        '` for `options.bulletOrdered`, expected `.` or `)`'\n    )\n  }\n\n  return marker\n}\n", "/**\n * @import {Options, State} from 'mdast-util-to-markdown'\n */\n\n/**\n * @param {State} state\n * @returns {Exclude<Options['rule'], null | undefined>}\n */\nexport function checkRule(state) {\n  const marker = state.options.rule || '*'\n\n  if (marker !== '*' && marker !== '-' && marker !== '_') {\n    throw new Error(\n      'Cannot serialize rules with `' +\n        marker +\n        '` for `options.rule`, expected `*`, `-`, or `_`'\n    )\n  }\n\n  return marker\n}\n", "/**\n * @import {Info, State} from 'mdast-util-to-markdown'\n * @import {List, Parents} from 'mdast'\n */\n\nimport {checkBullet} from '../util/check-bullet.js'\nimport {checkBulletOther} from '../util/check-bullet-other.js'\nimport {checkBulletOrdered} from '../util/check-bullet-ordered.js'\nimport {checkRule} from '../util/check-rule.js'\n\n/**\n * @param {List} node\n * @param {Parents | undefined} parent\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function list(node, parent, state, info) {\n  const exit = state.enter('list')\n  const bulletCurrent = state.bulletCurrent\n  /** @type {string} */\n  let bullet = node.ordered ? checkBulletOrdered(state) : checkBullet(state)\n  /** @type {string} */\n  const bulletOther = node.ordered\n    ? bullet === '.'\n      ? ')'\n      : '.'\n    : checkBulletOther(state)\n  let useDifferentMarker =\n    parent && state.bulletLastUsed ? bullet === state.bulletLastUsed : false\n\n  if (!node.ordered) {\n    const firstListItem = node.children ? node.children[0] : undefined\n\n    // If there\u2019s an empty first list item directly in two list items,\n    // we have to use a different bullet:\n    //\n    // ```markdown\n    // * - *\n    // ```\n    //\n    // \u2026because otherwise it would become one big thematic break.\n    if (\n      // Bullet could be used as a thematic break marker:\n      (bullet === '*' || bullet === '-') &&\n      // Empty first list item:\n      firstListItem &&\n      (!firstListItem.children || !firstListItem.children[0]) &&\n      // Directly in two other list items:\n      state.stack[state.stack.length - 1] === 'list' &&\n      state.stack[state.stack.length - 2] === 'listItem' &&\n      state.stack[state.stack.length - 3] === 'list' &&\n      state.stack[state.stack.length - 4] === 'listItem' &&\n      // That are each the first child.\n      state.indexStack[state.indexStack.length - 1] === 0 &&\n      state.indexStack[state.indexStack.length - 2] === 0 &&\n      state.indexStack[state.indexStack.length - 3] === 0\n    ) {\n      useDifferentMarker = true\n    }\n\n    // If there\u2019s a thematic break at the start of the first list item,\n    // we have to use a different bullet:\n    //\n    // ```markdown\n    // * ---\n    // ```\n    //\n    // \u2026because otherwise it would become one big thematic break.\n    if (checkRule(state) === bullet && firstListItem) {\n      let index = -1\n\n      while (++index < node.children.length) {\n        const item = node.children[index]\n\n        if (\n          item &&\n          item.type === 'listItem' &&\n          item.children &&\n          item.children[0] &&\n          item.children[0].type === 'thematicBreak'\n        ) {\n          useDifferentMarker = true\n          break\n        }\n      }\n    }\n  }\n\n  if (useDifferentMarker) {\n    bullet = bulletOther\n  }\n\n  state.bulletCurrent = bullet\n  const value = state.containerFlow(node, info)\n  state.bulletLastUsed = bullet\n  state.bulletCurrent = bulletCurrent\n  exit()\n  return value\n}\n", "/**\n * @import {Options, State} from 'mdast-util-to-markdown'\n */\n\n/**\n * @param {State} state\n * @returns {Exclude<Options['listItemIndent'], null | undefined>}\n */\nexport function checkListItemIndent(state) {\n  const style = state.options.listItemIndent || 'one'\n\n  if (style !== 'tab' && style !== 'one' && style !== 'mixed') {\n    throw new Error(\n      'Cannot serialize items with `' +\n        style +\n        '` for `options.listItemIndent`, expected `tab`, `one`, or `mixed`'\n    )\n  }\n\n  return style\n}\n", "/**\n * @import {Info, Map, State} from 'mdast-util-to-markdown'\n * @import {ListItem, Parents} from 'mdast'\n */\n\nimport {checkBullet} from '../util/check-bullet.js'\nimport {checkListItemIndent} from '../util/check-list-item-indent.js'\n\n/**\n * @param {ListItem} node\n * @param {Parents | undefined} parent\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function listItem(node, parent, state, info) {\n  const listItemIndent = checkListItemIndent(state)\n  let bullet = state.bulletCurrent || checkBullet(state)\n\n  // Add the marker value for ordered lists.\n  if (parent && parent.type === 'list' && parent.ordered) {\n    bullet =\n      (typeof parent.start === 'number' && parent.start > -1\n        ? parent.start\n        : 1) +\n      (state.options.incrementListMarker === false\n        ? 0\n        : parent.children.indexOf(node)) +\n      bullet\n  }\n\n  let size = bullet.length + 1\n\n  if (\n    listItemIndent === 'tab' ||\n    (listItemIndent === 'mixed' &&\n      ((parent && parent.type === 'list' && parent.spread) || node.spread))\n  ) {\n    size = Math.ceil(size / 4) * 4\n  }\n\n  const tracker = state.createTracker(info)\n  tracker.move(bullet + ' '.repeat(size - bullet.length))\n  tracker.shift(size)\n  const exit = state.enter('listItem')\n  const value = state.indentLines(\n    state.containerFlow(node, tracker.current()),\n    map\n  )\n  exit()\n\n  return value\n\n  /** @type {Map} */\n  function map(line, index, blank) {\n    if (index) {\n      return (blank ? '' : ' '.repeat(size)) + line\n    }\n\n    return (blank ? bullet : bullet + ' '.repeat(size - bullet.length)) + line\n  }\n}\n", "/**\n * @import {Info, State} from 'mdast-util-to-markdown'\n * @import {Paragraph, Parents} from 'mdast'\n */\n\n/**\n * @param {Paragraph} node\n * @param {Parents | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function paragraph(node, _, state, info) {\n  const exit = state.enter('paragraph')\n  const subexit = state.enter('phrasing')\n  const value = state.containerPhrasing(node, info)\n  subexit()\n  exit()\n  return value\n}\n", "/**\n * @typedef {import('mdast').Html} Html\n * @typedef {import('mdast').PhrasingContent} PhrasingContent\n */\n\nimport {convert} from 'unist-util-is'\n\n/**\n * Check if the given value is *phrasing content*.\n *\n * > \uD83D\uDC49 **Note**: Excludes `html`, which can be both phrasing or flow.\n *\n * @param node\n *   Thing to check, typically `Node`.\n * @returns\n *   Whether `value` is phrasing content.\n */\n\nexport const phrasing =\n  /** @type {(node?: unknown) => node is Exclude<PhrasingContent, Html>} */\n  (\n    convert([\n      'break',\n      'delete',\n      'emphasis',\n      // To do: next major: removed since footnotes were added to GFM.\n      'footnote',\n      'footnoteReference',\n      'image',\n      'imageReference',\n      'inlineCode',\n      // Enabled by `mdast-util-math`:\n      'inlineMath',\n      'link',\n      'linkReference',\n      // Enabled by `mdast-util-mdx`:\n      'mdxJsxTextElement',\n      // Enabled by `mdast-util-mdx`:\n      'mdxTextExpression',\n      'strong',\n      'text',\n      // Enabled by `mdast-util-directive`:\n      'textDirective'\n    ])\n  )\n", "/**\n * @import {Info, State} from 'mdast-util-to-markdown'\n * @import {Parents, Root} from 'mdast'\n */\n\nimport {phrasing} from 'mdast-util-phrasing'\n\n/**\n * @param {Root} node\n * @param {Parents | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function root(node, _, state, info) {\n  // Note: `html` nodes are ambiguous.\n  const hasPhrasing = node.children.some(function (d) {\n    return phrasing(d)\n  })\n\n  const container = hasPhrasing ? state.containerPhrasing : state.containerFlow\n  return container.call(state, node, info)\n}\n", "/**\n * @import {Options, State} from 'mdast-util-to-markdown'\n */\n\n/**\n * @param {State} state\n * @returns {Exclude<Options['strong'], null | undefined>}\n */\nexport function checkStrong(state) {\n  const marker = state.options.strong || '*'\n\n  if (marker !== '*' && marker !== '_') {\n    throw new Error(\n      'Cannot serialize strong with `' +\n        marker +\n        '` for `options.strong`, expected `*`, or `_`'\n    )\n  }\n\n  return marker\n}\n", "/**\n * @import {Info, State} from 'mdast-util-to-markdown'\n * @import {Parents, Strong} from 'mdast'\n */\n\nimport {checkStrong} from '../util/check-strong.js'\nimport {encodeCharacterReference} from '../util/encode-character-reference.js'\nimport {encodeInfo} from '../util/encode-info.js'\n\nstrong.peek = strongPeek\n\n/**\n * @param {Strong} node\n * @param {Parents | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function strong(node, _, state, info) {\n  const marker = checkStrong(state)\n  const exit = state.enter('strong')\n  const tracker = state.createTracker(info)\n  const before = tracker.move(marker + marker)\n\n  let between = tracker.move(\n    state.containerPhrasing(node, {\n      after: marker,\n      before,\n      ...tracker.current()\n    })\n  )\n  const betweenHead = between.charCodeAt(0)\n  const open = encodeInfo(\n    info.before.charCodeAt(info.before.length - 1),\n    betweenHead,\n    marker\n  )\n\n  if (open.inside) {\n    between = encodeCharacterReference(betweenHead) + between.slice(1)\n  }\n\n  const betweenTail = between.charCodeAt(between.length - 1)\n  const close = encodeInfo(info.after.charCodeAt(0), betweenTail, marker)\n\n  if (close.inside) {\n    between = between.slice(0, -1) + encodeCharacterReference(betweenTail)\n  }\n\n  const after = tracker.move(marker + marker)\n\n  exit()\n\n  state.attentionEncodeSurroundingInfo = {\n    after: close.outside,\n    before: open.outside\n  }\n  return before + between + after\n}\n\n/**\n * @param {Strong} _\n * @param {Parents | undefined} _1\n * @param {State} state\n * @returns {string}\n */\nfunction strongPeek(_, _1, state) {\n  return state.options.strong || '*'\n}\n", "/**\n * @import {Info, State} from 'mdast-util-to-markdown'\n * @import {Parents, Text} from 'mdast'\n */\n\n/**\n * @param {Text} node\n * @param {Parents | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function text(node, _, state, info) {\n  return state.safe(node.value, info)\n}\n", "/**\n * @import {Options, State} from 'mdast-util-to-markdown'\n */\n\n/**\n * @param {State} state\n * @returns {Exclude<Options['ruleRepetition'], null | undefined>}\n */\nexport function checkRuleRepetition(state) {\n  const repetition = state.options.ruleRepetition || 3\n\n  if (repetition < 3) {\n    throw new Error(\n      'Cannot serialize rules with repetition `' +\n        repetition +\n        '` for `options.ruleRepetition`, expected `3` or more'\n    )\n  }\n\n  return repetition\n}\n", "/**\n * @import {State} from 'mdast-util-to-markdown'\n * @import {Parents, ThematicBreak} from 'mdast'\n */\n\nimport {checkRuleRepetition} from '../util/check-rule-repetition.js'\nimport {checkRule} from '../util/check-rule.js'\n\n/**\n * @param {ThematicBreak} _\n * @param {Parents | undefined} _1\n * @param {State} state\n * @returns {string}\n */\nexport function thematicBreak(_, _1, state) {\n  const value = (\n    checkRule(state) + (state.options.ruleSpaces ? ' ' : '')\n  ).repeat(checkRuleRepetition(state))\n\n  return state.options.ruleSpaces ? value.slice(0, -1) : value\n}\n", "import {blockquote} from './blockquote.js'\nimport {hardBreak} from './break.js'\nimport {code} from './code.js'\nimport {definition} from './definition.js'\nimport {emphasis} from './emphasis.js'\nimport {heading} from './heading.js'\nimport {html} from './html.js'\nimport {image} from './image.js'\nimport {imageReference} from './image-reference.js'\nimport {inlineCode} from './inline-code.js'\nimport {link} from './link.js'\nimport {linkReference} from './link-reference.js'\nimport {list} from './list.js'\nimport {listItem} from './list-item.js'\nimport {paragraph} from './paragraph.js'\nimport {root} from './root.js'\nimport {strong} from './strong.js'\nimport {text} from './text.js'\nimport {thematicBreak} from './thematic-break.js'\n\n/**\n * Default (CommonMark) handlers.\n */\nexport const handle = {\n  blockquote,\n  break: hardBreak,\n  code,\n  definition,\n  emphasis,\n  hardBreak,\n  heading,\n  html,\n  image,\n  imageReference,\n  inlineCode,\n  link,\n  linkReference,\n  list,\n  listItem,\n  paragraph,\n  root,\n  strong,\n  text,\n  thematicBreak\n}\n", "/**\n * @import {Join} from 'mdast-util-to-markdown'\n */\n\nimport {formatCodeAsIndented} from './util/format-code-as-indented.js'\nimport {formatHeadingAsSetext} from './util/format-heading-as-setext.js'\n\n/** @type {Array<Join>} */\nexport const join = [joinDefaults]\n\n/** @type {Join} */\nfunction joinDefaults(left, right, parent, state) {\n  // Indented code after list or another indented code.\n  if (\n    right.type === 'code' &&\n    formatCodeAsIndented(right, state) &&\n    (left.type === 'list' ||\n      (left.type === right.type && formatCodeAsIndented(left, state)))\n  ) {\n    return false\n  }\n\n  // Join children of a list or an item.\n  // In which case, `parent` has a `spread` field.\n  if ('spread' in parent && typeof parent.spread === 'boolean') {\n    if (\n      left.type === 'paragraph' &&\n      // Two paragraphs.\n      (left.type === right.type ||\n        right.type === 'definition' ||\n        // Paragraph followed by a setext heading.\n        (right.type === 'heading' && formatHeadingAsSetext(right, state)))\n    ) {\n      return\n    }\n\n    return parent.spread ? 1 : 0\n  }\n}\n", "/**\n * @import {ConstructName, Unsafe} from 'mdast-util-to-markdown'\n */\n\n/**\n * List of constructs that occur in phrasing (paragraphs, headings), but cannot\n * contain things like attention (emphasis, strong), images, or links.\n * So they sort of cancel each other out.\n * Note: could use a better name.\n *\n * @type {Array<ConstructName>}\n */\nconst fullPhrasingSpans = [\n  'autolink',\n  'destinationLiteral',\n  'destinationRaw',\n  'reference',\n  'titleQuote',\n  'titleApostrophe'\n]\n\n/** @type {Array<Unsafe>} */\nexport const unsafe = [\n  {character: '\\t', after: '[\\\\r\\\\n]', inConstruct: 'phrasing'},\n  {character: '\\t', before: '[\\\\r\\\\n]', inConstruct: 'phrasing'},\n  {\n    character: '\\t',\n    inConstruct: ['codeFencedLangGraveAccent', 'codeFencedLangTilde']\n  },\n  {\n    character: '\\r',\n    inConstruct: [\n      'codeFencedLangGraveAccent',\n      'codeFencedLangTilde',\n      'codeFencedMetaGraveAccent',\n      'codeFencedMetaTilde',\n      'destinationLiteral',\n      'headingAtx'\n    ]\n  },\n  {\n    character: '\\n',\n    inConstruct: [\n      'codeFencedLangGraveAccent',\n      'codeFencedLangTilde',\n      'codeFencedMetaGraveAccent',\n      'codeFencedMetaTilde',\n      'destinationLiteral',\n      'headingAtx'\n    ]\n  },\n  {character: ' ', after: '[\\\\r\\\\n]', inConstruct: 'phrasing'},\n  {character: ' ', before: '[\\\\r\\\\n]', inConstruct: 'phrasing'},\n  {\n    character: ' ',\n    inConstruct: ['codeFencedLangGraveAccent', 'codeFencedLangTilde']\n  },\n  // An exclamation mark can start an image, if it is followed by a link or\n  // a link reference.\n  {\n    character: '!',\n    after: '\\\\[',\n    inConstruct: 'phrasing',\n    notInConstruct: fullPhrasingSpans\n  },\n  // A quote can break out of a title.\n  {character: '\"', inConstruct: 'titleQuote'},\n  // A number sign could start an ATX heading if it starts a line.\n  {atBreak: true, character: '#'},\n  {character: '#', inConstruct: 'headingAtx', after: '(?:[\\r\\n]|$)'},\n  // Dollar sign and percentage are not used in markdown.\n  // An ampersand could start a character reference.\n  {character: '&', after: '[#A-Za-z]', inConstruct: 'phrasing'},\n  // An apostrophe can break out of a title.\n  {character: \"'\", inConstruct: 'titleApostrophe'},\n  // A left paren could break out of a destination raw.\n  {character: '(', inConstruct: 'destinationRaw'},\n  // A left paren followed by `]` could make something into a link or image.\n  {\n    before: '\\\\]',\n    character: '(',\n    inConstruct: 'phrasing',\n    notInConstruct: fullPhrasingSpans\n  },\n  // A right paren could start a list item or break out of a destination\n  // raw.\n  {atBreak: true, before: '\\\\d+', character: ')'},\n  {character: ')', inConstruct: 'destinationRaw'},\n  // An asterisk can start thematic breaks, list items, emphasis, strong.\n  {atBreak: true, character: '*', after: '(?:[ \\t\\r\\n*])'},\n  {character: '*', inConstruct: 'phrasing', notInConstruct: fullPhrasingSpans},\n  // A plus sign could start a list item.\n  {atBreak: true, character: '+', after: '(?:[ \\t\\r\\n])'},\n  // A dash can start thematic breaks, list items, and setext heading\n  // underlines.\n  {atBreak: true, character: '-', after: '(?:[ \\t\\r\\n-])'},\n  // A dot could start a list item.\n  {atBreak: true, before: '\\\\d+', character: '.', after: '(?:[ \\t\\r\\n]|$)'},\n  // Slash, colon, and semicolon are not used in markdown for constructs.\n  // A less than can start html (flow or text) or an autolink.\n  // HTML could start with an exclamation mark (declaration, cdata, comment),\n  // slash (closing tag), question mark (instruction), or a letter (tag).\n  // An autolink also starts with a letter.\n  // Finally, it could break out of a destination literal.\n  {atBreak: true, character: '<', after: '[!/?A-Za-z]'},\n  {\n    character: '<',\n    after: '[!/?A-Za-z]',\n    inConstruct: 'phrasing',\n    notInConstruct: fullPhrasingSpans\n  },\n  {character: '<', inConstruct: 'destinationLiteral'},\n  // An equals to can start setext heading underlines.\n  {atBreak: true, character: '='},\n  // A greater than can start block quotes and it can break out of a\n  // destination literal.\n  {atBreak: true, character: '>'},\n  {character: '>', inConstruct: 'destinationLiteral'},\n  // Question mark and at sign are not used in markdown for constructs.\n  // A left bracket can start definitions, references, labels,\n  {atBreak: true, character: '['},\n  {character: '[', inConstruct: 'phrasing', notInConstruct: fullPhrasingSpans},\n  {character: '[', inConstruct: ['label', 'reference']},\n  // A backslash can start an escape (when followed by punctuation) or a\n  // hard break (when followed by an eol).\n  // Note: typical escapes are handled in `safe`!\n  {character: '\\\\', after: '[\\\\r\\\\n]', inConstruct: 'phrasing'},\n  // A right bracket can exit labels.\n  {character: ']', inConstruct: ['label', 'reference']},\n  // Caret is not used in markdown for constructs.\n  // An underscore can start emphasis, strong, or a thematic break.\n  {atBreak: true, character: '_'},\n  {character: '_', inConstruct: 'phrasing', notInConstruct: fullPhrasingSpans},\n  // A grave accent can start code (fenced or text), or it can break out of\n  // a grave accent code fence.\n  {atBreak: true, character: '`'},\n  {\n    character: '`',\n    inConstruct: ['codeFencedLangGraveAccent', 'codeFencedMetaGraveAccent']\n  },\n  {character: '`', inConstruct: 'phrasing', notInConstruct: fullPhrasingSpans},\n  // Left brace, vertical bar, right brace are not used in markdown for\n  // constructs.\n  // A tilde can start code (fenced).\n  {atBreak: true, character: '~'}\n]\n", "/**\n * @import {AssociationId} from '../types.js'\n */\n\nimport {decodeString} from 'micromark-util-decode-string'\n\n/**\n * Get an identifier from an association to match it to others.\n *\n * Associations are nodes that match to something else through an ID:\n * <https://github.com/syntax-tree/mdast#association>.\n *\n * The `label` of an association is the string value: character escapes and\n * references work, and casing is intact.\n * The `identifier` is used to match one association to another:\n * controversially, character escapes and references don\u2019t work in this\n * matching: `&copy;` does not match `\u00A9`, and `\\+` does not match `+`.\n *\n * But casing is ignored (and whitespace) is trimmed and collapsed: ` A\\nb`\n * matches `a b`.\n * So, we do prefer the label when figuring out how we\u2019re going to serialize:\n * it has whitespace, casing, and we can ignore most useless character\n * escapes and all character references.\n *\n * @type {AssociationId}\n */\nexport function association(node) {\n  if (node.label || !node.identifier) {\n    return node.label || ''\n  }\n\n  return decodeString(node.identifier)\n}\n", "/**\n * @import {CompilePattern} from '../types.js'\n */\n\n/**\n * @type {CompilePattern}\n */\nexport function compilePattern(pattern) {\n  if (!pattern._compiled) {\n    const before =\n      (pattern.atBreak ? '[\\\\r\\\\n][\\\\t ]*' : '') +\n      (pattern.before ? '(?:' + pattern.before + ')' : '')\n\n    pattern._compiled = new RegExp(\n      (before ? '(' + before + ')' : '') +\n        (/[|\\\\{}()[\\]^$+*?.-]/.test(pattern.character) ? '\\\\' : '') +\n        pattern.character +\n        (pattern.after ? '(?:' + pattern.after + ')' : ''),\n      'g'\n    )\n  }\n\n  return pattern._compiled\n}\n", "/**\n * @import {Handle, Info, State} from 'mdast-util-to-markdown'\n * @import {PhrasingParents} from '../types.js'\n */\n\nimport {encodeCharacterReference} from './encode-character-reference.js'\n\n/**\n * Serialize the children of a parent that contains phrasing children.\n *\n * These children will be joined flush together.\n *\n * @param {PhrasingParents} parent\n *   Parent of flow nodes.\n * @param {State} state\n *   Info passed around about the current state.\n * @param {Info} info\n *   Info on where we are in the document we are generating.\n * @returns {string}\n *   Serialized children, joined together.\n */\nexport function containerPhrasing(parent, state, info) {\n  const indexStack = state.indexStack\n  const children = parent.children || []\n  /** @type {Array<string>} */\n  const results = []\n  let index = -1\n  let before = info.before\n  /** @type {string | undefined} */\n  let encodeAfter\n\n  indexStack.push(-1)\n  let tracker = state.createTracker(info)\n\n  while (++index < children.length) {\n    const child = children[index]\n    /** @type {string} */\n    let after\n\n    indexStack[indexStack.length - 1] = index\n\n    if (index + 1 < children.length) {\n      /** @type {Handle} */\n      // @ts-expect-error: hush, it\u2019s actually a `zwitch`.\n      let handle = state.handle.handlers[children[index + 1].type]\n      /** @type {Handle} */\n      // @ts-expect-error: hush, it\u2019s actually a `zwitch`.\n      if (handle && handle.peek) handle = handle.peek\n      after = handle\n        ? handle(children[index + 1], parent, state, {\n            before: '',\n            after: '',\n            ...tracker.current()\n          }).charAt(0)\n        : ''\n    } else {\n      after = info.after\n    }\n\n    // In some cases, html (text) can be found in phrasing right after an eol.\n    // When we\u2019d serialize that, in most cases that would be seen as html\n    // (flow).\n    // As we can\u2019t escape or so to prevent it from happening, we take a somewhat\n    // reasonable approach: replace that eol with a space.\n    // See: <https://github.com/syntax-tree/mdast-util-to-markdown/issues/15>\n    if (\n      results.length > 0 &&\n      (before === '\\r' || before === '\\n') &&\n      child.type === 'html'\n    ) {\n      results[results.length - 1] = results[results.length - 1].replace(\n        /(\\r?\\n|\\r)$/,\n        ' '\n      )\n      before = ' '\n\n      // To do: does this work to reset tracker?\n      tracker = state.createTracker(info)\n      tracker.move(results.join(''))\n    }\n\n    let value = state.handle(child, parent, state, {\n      ...tracker.current(),\n      after,\n      before\n    })\n\n    // If we had to encode the first character after the previous node and it\u2019s\n    // still the same character,\n    // encode it.\n    if (encodeAfter && encodeAfter === value.slice(0, 1)) {\n      value =\n        encodeCharacterReference(encodeAfter.charCodeAt(0)) + value.slice(1)\n    }\n\n    const encodingInfo = state.attentionEncodeSurroundingInfo\n    state.attentionEncodeSurroundingInfo = undefined\n    encodeAfter = undefined\n\n    // If we have to encode the first character before the current node and\n    // it\u2019s still the same character,\n    // encode it.\n    if (encodingInfo) {\n      if (\n        results.length > 0 &&\n        encodingInfo.before &&\n        before === results[results.length - 1].slice(-1)\n      ) {\n        results[results.length - 1] =\n          results[results.length - 1].slice(0, -1) +\n          encodeCharacterReference(before.charCodeAt(0))\n      }\n\n      if (encodingInfo.after) encodeAfter = after\n    }\n\n    tracker.move(value)\n    results.push(value)\n    before = value.slice(-1)\n  }\n\n  indexStack.pop()\n\n  return results.join('')\n}\n", "/**\n * @import {State} from 'mdast-util-to-markdown'\n * @import {FlowChildren, FlowParents, TrackFields} from '../types.js'\n */\n\n/**\n * @param {FlowParents} parent\n *   Parent of flow nodes.\n * @param {State} state\n *   Info passed around about the current state.\n * @param {TrackFields} info\n *   Info on where we are in the document we are generating.\n * @returns {string}\n *   Serialized children, joined by (blank) lines.\n */\nexport function containerFlow(parent, state, info) {\n  const indexStack = state.indexStack\n  const children = parent.children || []\n  const tracker = state.createTracker(info)\n  /** @type {Array<string>} */\n  const results = []\n  let index = -1\n\n  indexStack.push(-1)\n\n  while (++index < children.length) {\n    const child = children[index]\n\n    indexStack[indexStack.length - 1] = index\n\n    results.push(\n      tracker.move(\n        state.handle(child, parent, state, {\n          before: '\\n',\n          after: '\\n',\n          ...tracker.current()\n        })\n      )\n    )\n\n    if (child.type !== 'list') {\n      state.bulletLastUsed = undefined\n    }\n\n    if (index < children.length - 1) {\n      results.push(\n        tracker.move(between(child, children[index + 1], parent, state))\n      )\n    }\n  }\n\n  indexStack.pop()\n\n  return results.join('')\n}\n\n/**\n * @param {FlowChildren} left\n * @param {FlowChildren} right\n * @param {FlowParents} parent\n * @param {State} state\n * @returns {string}\n */\nfunction between(left, right, parent, state) {\n  let index = state.join.length\n\n  while (index--) {\n    const result = state.join[index](left, right, parent, state)\n\n    if (result === true || result === 1) {\n      break\n    }\n\n    if (typeof result === 'number') {\n      return '\\n'.repeat(1 + result)\n    }\n\n    if (result === false) {\n      return '\\n\\n<!---->\\n\\n'\n    }\n  }\n\n  return '\\n\\n'\n}\n", "/**\n * @import {IndentLines} from '../types.js'\n */\n\nconst eol = /\\r?\\n|\\r/g\n\n/**\n * @type {IndentLines}\n */\nexport function indentLines(value, map) {\n  /** @type {Array<string>} */\n  const result = []\n  let start = 0\n  let line = 0\n  /** @type {RegExpExecArray | null} */\n  let match\n\n  while ((match = eol.exec(value))) {\n    one(value.slice(start, match.index))\n    result.push(match[0])\n    start = match.index + match[0].length\n    line++\n  }\n\n  one(value.slice(start))\n\n  return result.join('')\n\n  /**\n   * @param {string} value\n   */\n  function one(value) {\n    result.push(map(value, line, !value))\n  }\n}\n", "/**\n * @import {SafeConfig, State} from 'mdast-util-to-markdown'\n */\n\nimport {encodeCharacterReference} from './encode-character-reference.js'\nimport {patternInScope} from './pattern-in-scope.js'\n\n/**\n * Make a string safe for embedding in markdown constructs.\n *\n * In markdown, almost all punctuation characters can, in certain cases,\n * result in something.\n * Whether they do is highly subjective to where they happen and in what\n * they happen.\n *\n * To solve this, `mdast-util-to-markdown` tracks:\n *\n * * Characters before and after something;\n * * What \u201Cconstructs\u201D we are in.\n *\n * This information is then used by this function to escape or encode\n * special characters.\n *\n * @param {State} state\n *   Info passed around about the current state.\n * @param {string | null | undefined} input\n *   Raw value to make safe.\n * @param {SafeConfig} config\n *   Configuration.\n * @returns {string}\n *   Serialized markdown safe for embedding.\n */\nexport function safe(state, input, config) {\n  const value = (config.before || '') + (input || '') + (config.after || '')\n  /** @type {Array<number>} */\n  const positions = []\n  /** @type {Array<string>} */\n  const result = []\n  /** @type {Record<number, {before: boolean, after: boolean}>} */\n  const infos = {}\n  let index = -1\n\n  while (++index < state.unsafe.length) {\n    const pattern = state.unsafe[index]\n\n    if (!patternInScope(state.stack, pattern)) {\n      continue\n    }\n\n    const expression = state.compilePattern(pattern)\n    /** @type {RegExpExecArray | null} */\n    let match\n\n    while ((match = expression.exec(value))) {\n      const before = 'before' in pattern || Boolean(pattern.atBreak)\n      const after = 'after' in pattern\n      const position = match.index + (before ? match[1].length : 0)\n\n      if (positions.includes(position)) {\n        if (infos[position].before && !before) {\n          infos[position].before = false\n        }\n\n        if (infos[position].after && !after) {\n          infos[position].after = false\n        }\n      } else {\n        positions.push(position)\n        infos[position] = {before, after}\n      }\n    }\n  }\n\n  positions.sort(numerical)\n\n  let start = config.before ? config.before.length : 0\n  const end = value.length - (config.after ? config.after.length : 0)\n  index = -1\n\n  while (++index < positions.length) {\n    const position = positions[index]\n\n    // Character before or after matched:\n    if (position < start || position >= end) {\n      continue\n    }\n\n    // If this character is supposed to be escaped because it has a condition on\n    // the next character, and the next character is definitly being escaped,\n    // then skip this escape.\n    if (\n      (position + 1 < end &&\n        positions[index + 1] === position + 1 &&\n        infos[position].after &&\n        !infos[position + 1].before &&\n        !infos[position + 1].after) ||\n      (positions[index - 1] === position - 1 &&\n        infos[position].before &&\n        !infos[position - 1].before &&\n        !infos[position - 1].after)\n    ) {\n      continue\n    }\n\n    if (start !== position) {\n      // If we have to use a character reference, an ampersand would be more\n      // correct, but as backslashes only care about punctuation, either will\n      // do the trick\n      result.push(escapeBackslashes(value.slice(start, position), '\\\\'))\n    }\n\n    start = position\n\n    if (\n      /[!-/:-@[-`{-~]/.test(value.charAt(position)) &&\n      (!config.encode || !config.encode.includes(value.charAt(position)))\n    ) {\n      // Character escape.\n      result.push('\\\\')\n    } else {\n      // Character reference.\n      result.push(encodeCharacterReference(value.charCodeAt(position)))\n      start++\n    }\n  }\n\n  result.push(escapeBackslashes(value.slice(start, end), config.after))\n\n  return result.join('')\n}\n\n/**\n * @param {number} a\n * @param {number} b\n * @returns {number}\n */\nfunction numerical(a, b) {\n  return a - b\n}\n\n/**\n * @param {string} value\n * @param {string} after\n * @returns {string}\n */\nfunction escapeBackslashes(value, after) {\n  const expression = /\\\\(?=[!-/:-@[-`{-~])/g\n  /** @type {Array<number>} */\n  const positions = []\n  /** @type {Array<string>} */\n  const results = []\n  const whole = value + after\n  let index = -1\n  let start = 0\n  /** @type {RegExpExecArray | null} */\n  let match\n\n  while ((match = expression.exec(whole))) {\n    positions.push(match.index)\n  }\n\n  while (++index < positions.length) {\n    if (start !== positions[index]) {\n      results.push(value.slice(start, positions[index]))\n    }\n\n    results.push('\\\\')\n    start = positions[index]\n  }\n\n  results.push(value.slice(start))\n\n  return results.join('')\n}\n", "/**\n * @import {CreateTracker, TrackCurrent, TrackMove, TrackShift} from '../types.js'\n */\n\n/**\n * Track positional info in the output.\n *\n * @type {CreateTracker}\n */\nexport function track(config) {\n  // Defaults are used to prevent crashes when older utilities somehow activate\n  // this code.\n  /* c8 ignore next 5 */\n  const options = config || {}\n  const now = options.now || {}\n  let lineShift = options.lineShift || 0\n  let line = now.line || 1\n  let column = now.column || 1\n\n  return {move, current, shift}\n\n  /**\n   * Get the current tracked info.\n   *\n   * @type {TrackCurrent}\n   */\n  function current() {\n    return {now: {line, column}, lineShift}\n  }\n\n  /**\n   * Define an increased line shift (the typical indent for lines).\n   *\n   * @type {TrackShift}\n   */\n  function shift(value) {\n    lineShift += value\n  }\n\n  /**\n   * Move past some generated markdown.\n   *\n   * @type {TrackMove}\n   */\n  function move(input) {\n    // eslint-disable-next-line unicorn/prefer-default-parameters\n    const value = input || ''\n    const chunks = value.split(/\\r?\\n|\\r/g)\n    const tail = chunks[chunks.length - 1]\n    line += chunks.length - 1\n    column =\n      chunks.length === 1 ? column + tail.length : 1 + tail.length + lineShift\n    return value\n  }\n}\n", "/**\n * @import {Info, Join, Options, SafeConfig, State} from 'mdast-util-to-markdown'\n * @import {Nodes} from 'mdast'\n * @import {Enter, FlowParents, PhrasingParents, TrackFields} from './types.js'\n */\n\nimport {zwitch} from 'zwitch'\nimport {configure} from './configure.js'\nimport {handle as handlers} from './handle/index.js'\nimport {join} from './join.js'\nimport {unsafe} from './unsafe.js'\nimport {association} from './util/association.js'\nimport {compilePattern} from './util/compile-pattern.js'\nimport {containerPhrasing} from './util/container-phrasing.js'\nimport {containerFlow} from './util/container-flow.js'\nimport {indentLines} from './util/indent-lines.js'\nimport {safe} from './util/safe.js'\nimport {track} from './util/track.js'\n\n/**\n * Turn an mdast syntax tree into markdown.\n *\n * @param {Nodes} tree\n *   Tree to serialize.\n * @param {Options | null | undefined} [options]\n *   Configuration (optional).\n * @returns {string}\n *   Serialized markdown representing `tree`.\n */\nexport function toMarkdown(tree, options) {\n  const settings = options || {}\n  /** @type {State} */\n  const state = {\n    associationId: association,\n    containerPhrasing: containerPhrasingBound,\n    containerFlow: containerFlowBound,\n    createTracker: track,\n    compilePattern,\n    enter,\n    // @ts-expect-error: GFM / frontmatter are typed in `mdast` but not defined\n    // here.\n    handlers: {...handlers},\n    // @ts-expect-error: add `handle` in a second.\n    handle: undefined,\n    indentLines,\n    indexStack: [],\n    join: [...join],\n    options: {},\n    safe: safeBound,\n    stack: [],\n    unsafe: [...unsafe]\n  }\n\n  configure(state, settings)\n\n  if (state.options.tightDefinitions) {\n    state.join.push(joinDefinition)\n  }\n\n  state.handle = zwitch('type', {\n    invalid,\n    unknown,\n    handlers: state.handlers\n  })\n\n  let result = state.handle(tree, undefined, state, {\n    before: '\\n',\n    after: '\\n',\n    now: {line: 1, column: 1},\n    lineShift: 0\n  })\n\n  if (\n    result &&\n    result.charCodeAt(result.length - 1) !== 10 &&\n    result.charCodeAt(result.length - 1) !== 13\n  ) {\n    result += '\\n'\n  }\n\n  return result\n\n  /** @type {Enter} */\n  function enter(name) {\n    state.stack.push(name)\n    return exit\n\n    /**\n     * @returns {undefined}\n     */\n    function exit() {\n      state.stack.pop()\n    }\n  }\n}\n\n/**\n * @param {unknown} value\n * @returns {never}\n */\nfunction invalid(value) {\n  throw new Error('Cannot handle value `' + value + '`, expected node')\n}\n\n/**\n * @param {unknown} value\n * @returns {never}\n */\nfunction unknown(value) {\n  // Always a node.\n  const node = /** @type {Nodes} */ (value)\n  throw new Error('Cannot handle unknown node `' + node.type + '`')\n}\n\n/** @type {Join} */\nfunction joinDefinition(left, right) {\n  // No blank line between adjacent definitions.\n  if (left.type === 'definition' && left.type === right.type) {\n    return 0\n  }\n}\n\n/**\n * Serialize the children of a parent that contains phrasing children.\n *\n * These children will be joined flush together.\n *\n * @this {State}\n *   Info passed around about the current state.\n * @param {PhrasingParents} parent\n *   Parent of flow nodes.\n * @param {Info} info\n *   Info on where we are in the document we are generating.\n * @returns {string}\n *   Serialized children, joined together.\n */\nfunction containerPhrasingBound(parent, info) {\n  return containerPhrasing(parent, this, info)\n}\n\n/**\n * Serialize the children of a parent that contains flow children.\n *\n * These children will typically be joined by blank lines.\n * What they are joined by exactly is defined by `Join` functions.\n *\n * @this {State}\n *   Info passed around about the current state.\n * @param {FlowParents} parent\n *   Parent of flow nodes.\n * @param {TrackFields} info\n *   Info on where we are in the document we are generating.\n * @returns {string}\n *   Serialized children, joined by (blank) lines.\n */\nfunction containerFlowBound(parent, info) {\n  return containerFlow(parent, this, info)\n}\n\n/**\n * Make a string safe for embedding in markdown constructs.\n *\n * In markdown, almost all punctuation characters can, in certain cases,\n * result in something.\n * Whether they do is highly subjective to where they happen and in what\n * they happen.\n *\n * To solve this, `mdast-util-to-markdown` tracks:\n *\n * * Characters before and after something;\n * * What \u201Cconstructs\u201D we are in.\n *\n * This information is then used by this function to escape or encode\n * special characters.\n *\n * @this {State}\n *   Info passed around about the current state.\n * @param {string | null | undefined} value\n *   Raw value to make safe.\n * @param {SafeConfig} config\n *   Configuration.\n * @returns {string}\n *   Serialized markdown safe for embedding.\n */\nfunction safeBound(value, config) {\n  return safe(this, value, config)\n}\n", "/**\n * @typedef {import('mdast').Root} Root\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownOptions\n * @typedef {import('unified').Compiler<Root, string>} Compiler\n * @typedef {import('unified').Processor<undefined, undefined, undefined, Root, string>} Processor\n */\n\n/**\n * @typedef {Omit<ToMarkdownOptions, 'extensions'>} Options\n */\n\nimport {toMarkdown} from 'mdast-util-to-markdown'\n\n/**\n * Add support for serializing to markdown.\n *\n * @param {Readonly<Options> | null | undefined} [options]\n *   Configuration (optional).\n * @returns {undefined}\n *   Nothing.\n */\nexport default function remarkStringify(options) {\n  /** @type {Processor} */\n  // @ts-expect-error: TS in JSDoc generates wrong types if `this` is typed regularly.\n  const self = this\n\n  self.compiler = compiler\n\n  /**\n   * @type {Compiler}\n   */\n  function compiler(tree) {\n    return toMarkdown(tree, {\n      ...self.data('settings'),\n      ...options,\n      // Note: this option is not in the readme.\n      // The goal is for it to be set by plugins on `data` instead of being\n      // passed by users.\n      extensions: self.data('toMarkdownExtensions') || []\n    })\n  }\n}\n", "/**\n * Throw a given error.\n *\n * @param {Error|null|undefined} [error]\n *   Maybe error.\n * @returns {asserts error is null|undefined}\n */\nexport function bail(error) {\n  if (error) {\n    throw error\n  }\n}\n", "/**\n * @typedef {import('trough').Pipeline} Pipeline\n *\n * @typedef {import('unist').Node} Node\n *\n * @typedef {import('vfile').Compatible} Compatible\n * @typedef {import('vfile').Value} Value\n *\n * @typedef {import('../index.js').CompileResultMap} CompileResultMap\n * @typedef {import('../index.js').Data} Data\n * @typedef {import('../index.js').Settings} Settings\n */\n\n/**\n * @typedef {CompileResultMap[keyof CompileResultMap]} CompileResults\n *   Acceptable results from compilers.\n *\n *   To register custom results, add them to\n *   {@linkcode CompileResultMap}.\n */\n\n/**\n * @template {Node} [Tree=Node]\n *   The node that the compiler receives (default: `Node`).\n * @template {CompileResults} [Result=CompileResults]\n *   The thing that the compiler yields (default: `CompileResults`).\n * @callback Compiler\n *   A **compiler** handles the compiling of a syntax tree to something else\n *   (in most cases, text) (TypeScript type).\n *\n *   It is used in the stringify phase and called with a {@linkcode Node}\n *   and {@linkcode VFile} representation of the document to compile.\n *   It should return the textual representation of the given tree (typically\n *   `string`).\n *\n *   > **Note**: unified typically compiles by serializing: most compilers\n *   > return `string` (or `Uint8Array`).\n *   > Some compilers, such as the one configured with\n *   > [`rehype-react`][rehype-react], return other values (in this case, a\n *   > React tree).\n *   > If you\u2019re using a compiler that doesn\u2019t serialize, expect different\n *   > result values.\n *   >\n *   > To register custom results in TypeScript, add them to\n *   > {@linkcode CompileResultMap}.\n *\n *   [rehype-react]: https://github.com/rehypejs/rehype-react\n * @param {Tree} tree\n *   Tree to compile.\n * @param {VFile} file\n *   File associated with `tree`.\n * @returns {Result}\n *   New content: compiled text (`string` or `Uint8Array`, for `file.value`) or\n *   something else (for `file.result`).\n */\n\n/**\n * @template {Node} [Tree=Node]\n *   The node that the parser yields (default: `Node`)\n * @callback Parser\n *   A **parser** handles the parsing of text to a syntax tree.\n *\n *   It is used in the parse phase and is called with a `string` and\n *   {@linkcode VFile} of the document to parse.\n *   It must return the syntax tree representation of the given file\n *   ({@linkcode Node}).\n * @param {string} document\n *   Document to parse.\n * @param {VFile} file\n *   File associated with `document`.\n * @returns {Tree}\n *   Node representing the given file.\n */\n\n/**\n * @typedef {(\n *   Plugin<Array<any>, any, any> |\n *   PluginTuple<Array<any>, any, any> |\n *   Preset\n * )} Pluggable\n *   Union of the different ways to add plugins and settings.\n */\n\n/**\n * @typedef {Array<Pluggable>} PluggableList\n *   List of plugins and presets.\n */\n\n// Note: we can\u2019t use `callback` yet as it messes up `this`:\n//  <https://github.com/microsoft/TypeScript/issues/55197>.\n/**\n * @template {Array<unknown>} [PluginParameters=[]]\n *   Arguments passed to the plugin (default: `[]`, the empty tuple).\n * @template {Node | string | undefined} [Input=Node]\n *   Value that is expected as input (default: `Node`).\n *\n *   *   If the plugin returns a {@linkcode Transformer}, this\n *       should be the node it expects.\n *   *   If the plugin sets a {@linkcode Parser}, this should be\n *       `string`.\n *   *   If the plugin sets a {@linkcode Compiler}, this should be the\n *       node it expects.\n * @template [Output=Input]\n *   Value that is yielded as output (default: `Input`).\n *\n *   *   If the plugin returns a {@linkcode Transformer}, this\n *       should be the node that that yields.\n *   *   If the plugin sets a {@linkcode Parser}, this should be the\n *       node that it yields.\n *   *   If the plugin sets a {@linkcode Compiler}, this should be\n *       result it yields.\n * @typedef {(\n *   (this: Processor, ...parameters: PluginParameters) =>\n *     Input extends string ? // Parser.\n *        Output extends Node | undefined ? undefined | void : never :\n *     Output extends CompileResults ? // Compiler.\n *        Input extends Node | undefined ? undefined | void : never :\n *     Transformer<\n *       Input extends Node ? Input : Node,\n *       Output extends Node ? Output : Node\n *     > | undefined | void\n * )} Plugin\n *   Single plugin.\n *\n *   Plugins configure the processors they are applied on in the following\n *   ways:\n *\n *   *   they change the processor, such as the parser, the compiler, or by\n *       configuring data\n *   *   they specify how to handle trees and files\n *\n *   In practice, they are functions that can receive options and configure the\n *   processor (`this`).\n *\n *   > **Note**: plugins are called when the processor is *frozen*, not when\n *   > they are applied.\n */\n\n/**\n * Tuple of a plugin and its configuration.\n *\n * The first item is a plugin, the rest are its parameters.\n *\n * @template {Array<unknown>} [TupleParameters=[]]\n *   Arguments passed to the plugin (default: `[]`, the empty tuple).\n * @template {Node | string | undefined} [Input=undefined]\n *   Value that is expected as input (optional).\n *\n *   *   If the plugin returns a {@linkcode Transformer}, this\n *       should be the node it expects.\n *   *   If the plugin sets a {@linkcode Parser}, this should be\n *       `string`.\n *   *   If the plugin sets a {@linkcode Compiler}, this should be the\n *       node it expects.\n * @template [Output=undefined] (optional).\n *   Value that is yielded as output.\n *\n *   *   If the plugin returns a {@linkcode Transformer}, this\n *       should be the node that that yields.\n *   *   If the plugin sets a {@linkcode Parser}, this should be the\n *       node that it yields.\n *   *   If the plugin sets a {@linkcode Compiler}, this should be\n *       result it yields.\n * @typedef {(\n *   [\n *     plugin: Plugin<TupleParameters, Input, Output>,\n *     ...parameters: TupleParameters\n *   ]\n * )} PluginTuple\n */\n\n/**\n * @typedef Preset\n *   Sharable configuration.\n *\n *   They can contain plugins and settings.\n * @property {PluggableList | undefined} [plugins]\n *   List of plugins and presets (optional).\n * @property {Settings | undefined} [settings]\n *   Shared settings for parsers and compilers (optional).\n */\n\n/**\n * @template {VFile} [File=VFile]\n *   The file that the callback receives (default: `VFile`).\n * @callback ProcessCallback\n *   Callback called when the process is done.\n *\n *   Called with either an error or a result.\n * @param {Error | undefined} [error]\n *   Fatal error (optional).\n * @param {File | undefined} [file]\n *   Processed file (optional).\n * @returns {undefined}\n *   Nothing.\n */\n\n/**\n * @template {Node} [Tree=Node]\n *   The tree that the callback receives (default: `Node`).\n * @callback RunCallback\n *   Callback called when transformers are done.\n *\n *   Called with either an error or results.\n * @param {Error | undefined} [error]\n *   Fatal error (optional).\n * @param {Tree | undefined} [tree]\n *   Transformed tree (optional).\n * @param {VFile | undefined} [file]\n *   File (optional).\n * @returns {undefined}\n *   Nothing.\n */\n\n/**\n * @template {Node} [Output=Node]\n *   Node type that the transformer yields (default: `Node`).\n * @callback TransformCallback\n *   Callback passed to transforms.\n *\n *   If the signature of a `transformer` accepts a third argument, the\n *   transformer may perform asynchronous operations, and must call it.\n * @param {Error | undefined} [error]\n *   Fatal error to stop the process (optional).\n * @param {Output | undefined} [tree]\n *   New, changed, tree (optional).\n * @param {VFile | undefined} [file]\n *   New, changed, file (optional).\n * @returns {undefined}\n *   Nothing.\n */\n\n/**\n * @template {Node} [Input=Node]\n *   Node type that the transformer expects (default: `Node`).\n * @template {Node} [Output=Input]\n *   Node type that the transformer yields (default: `Input`).\n * @callback Transformer\n *   Transformers handle syntax trees and files.\n *\n *   They are functions that are called each time a syntax tree and file are\n *   passed through the run phase.\n *   When an error occurs in them (either because it\u2019s thrown, returned,\n *   rejected, or passed to `next`), the process stops.\n *\n *   The run phase is handled by [`trough`][trough], see its documentation for\n *   the exact semantics of these functions.\n *\n *   > **Note**: you should likely ignore `next`: don\u2019t accept it.\n *   > it supports callback-style async work.\n *   > But promises are likely easier to reason about.\n *\n *   [trough]: https://github.com/wooorm/trough#function-fninput-next\n * @param {Input} tree\n *   Tree to handle.\n * @param {VFile} file\n *   File to handle.\n * @param {TransformCallback<Output>} next\n *   Callback.\n * @returns {(\n *   Promise<Output | undefined | void> |\n *   Promise<never> | // For some reason this is needed separately.\n *   Output |\n *   Error |\n *   undefined |\n *   void\n * )}\n *   If you accept `next`, nothing.\n *   Otherwise:\n *\n *   *   `Error` \u2014 fatal error to stop the process\n *   *   `Promise<undefined>` or `undefined` \u2014 the next transformer keeps using\n *       same tree\n *   *   `Promise<Node>` or `Node` \u2014 new, changed, tree\n */\n\n/**\n * @template {Node | undefined} ParseTree\n *   Output of `parse`.\n * @template {Node | undefined} HeadTree\n *   Input for `run`.\n * @template {Node | undefined} TailTree\n *   Output for `run`.\n * @template {Node | undefined} CompileTree\n *   Input of `stringify`.\n * @template {CompileResults | undefined} CompileResult\n *   Output of `stringify`.\n * @template {Node | string | undefined} Input\n *   Input of plugin.\n * @template Output\n *   Output of plugin (optional).\n * @typedef {(\n *   Input extends string\n *     ? Output extends Node | undefined\n *       ? // Parser.\n *         Processor<\n *           Output extends undefined ? ParseTree : Output,\n *           HeadTree,\n *           TailTree,\n *           CompileTree,\n *           CompileResult\n *         >\n *       : // Unknown.\n *         Processor<ParseTree, HeadTree, TailTree, CompileTree, CompileResult>\n *     : Output extends CompileResults\n *     ? Input extends Node | undefined\n *       ? // Compiler.\n *         Processor<\n *           ParseTree,\n *           HeadTree,\n *           TailTree,\n *           Input extends undefined ? CompileTree : Input,\n *           Output extends undefined ? CompileResult : Output\n *         >\n *       : // Unknown.\n *         Processor<ParseTree, HeadTree, TailTree, CompileTree, CompileResult>\n *     : Input extends Node | undefined\n *     ? Output extends Node | undefined\n *       ? // Transform.\n *         Processor<\n *           ParseTree,\n *           HeadTree extends undefined ? Input : HeadTree,\n *           Output extends undefined ? TailTree : Output,\n *           CompileTree,\n *           CompileResult\n *         >\n *       : // Unknown.\n *         Processor<ParseTree, HeadTree, TailTree, CompileTree, CompileResult>\n *     : // Unknown.\n *       Processor<ParseTree, HeadTree, TailTree, CompileTree, CompileResult>\n * )} UsePlugin\n *   Create a processor based on the input/output of a {@link Plugin plugin}.\n */\n\n/**\n * @template {CompileResults | undefined} Result\n *   Node type that the transformer yields.\n * @typedef {(\n *   Result extends Value | undefined ?\n *     VFile :\n *     VFile & {result: Result}\n *   )} VFileWithOutput\n *   Type to generate a {@linkcode VFile} corresponding to a compiler result.\n *\n *   If a result that is not acceptable on a `VFile` is used, that will\n *   be stored on the `result` field of {@linkcode VFile}.\n */\n\nimport {bail} from 'bail'\nimport extend from 'extend'\nimport {ok as assert} from 'devlop'\nimport isPlainObj from 'is-plain-obj'\nimport {trough} from 'trough'\nimport {VFile} from 'vfile'\nimport {CallableInstance} from './callable-instance.js'\n\n// To do: next major: drop `Compiler`, `Parser`: prefer lowercase.\n\n// To do: we could start yielding `never` in TS when a parser is missing and\n// `parse` is called.\n// Currently, we allow directly setting `processor.parser`, which is untyped.\n\nconst own = {}.hasOwnProperty\n\n/**\n * @template {Node | undefined} [ParseTree=undefined]\n *   Output of `parse` (optional).\n * @template {Node | undefined} [HeadTree=undefined]\n *   Input for `run` (optional).\n * @template {Node | undefined} [TailTree=undefined]\n *   Output for `run` (optional).\n * @template {Node | undefined} [CompileTree=undefined]\n *   Input of `stringify` (optional).\n * @template {CompileResults | undefined} [CompileResult=undefined]\n *   Output of `stringify` (optional).\n * @extends {CallableInstance<[], Processor<ParseTree, HeadTree, TailTree, CompileTree, CompileResult>>}\n */\nexport class Processor extends CallableInstance {\n  /**\n   * Create a processor.\n   */\n  constructor() {\n    // If `Processor()` is called (w/o new), `copy` is called instead.\n    super('copy')\n\n    /**\n     * Compiler to use (deprecated).\n     *\n     * @deprecated\n     *   Use `compiler` instead.\n     * @type {(\n     *   Compiler<\n     *     CompileTree extends undefined ? Node : CompileTree,\n     *     CompileResult extends undefined ? CompileResults : CompileResult\n     *   > |\n     *   undefined\n     * )}\n     */\n    this.Compiler = undefined\n\n    /**\n     * Parser to use (deprecated).\n     *\n     * @deprecated\n     *   Use `parser` instead.\n     * @type {(\n     *   Parser<ParseTree extends undefined ? Node : ParseTree> |\n     *   undefined\n     * )}\n     */\n    this.Parser = undefined\n\n    // Note: the following fields are considered private.\n    // However, they are needed for tests, and TSC generates an untyped\n    // `private freezeIndex` field for, which trips `type-coverage` up.\n    // Instead, we use `@deprecated` to visualize that they shouldn\u2019t be used.\n    /**\n     * Internal list of configured plugins.\n     *\n     * @deprecated\n     *   This is a private internal property and should not be used.\n     * @type {Array<PluginTuple<Array<unknown>>>}\n     */\n    this.attachers = []\n\n    /**\n     * Compiler to use.\n     *\n     * @type {(\n     *   Compiler<\n     *     CompileTree extends undefined ? Node : CompileTree,\n     *     CompileResult extends undefined ? CompileResults : CompileResult\n     *   > |\n     *   undefined\n     * )}\n     */\n    this.compiler = undefined\n\n    /**\n     * Internal state to track where we are while freezing.\n     *\n     * @deprecated\n     *   This is a private internal property and should not be used.\n     * @type {number}\n     */\n    this.freezeIndex = -1\n\n    /**\n     * Internal state to track whether we\u2019re frozen.\n     *\n     * @deprecated\n     *   This is a private internal property and should not be used.\n     * @type {boolean | undefined}\n     */\n    this.frozen = undefined\n\n    /**\n     * Internal state.\n     *\n     * @deprecated\n     *   This is a private internal property and should not be used.\n     * @type {Data}\n     */\n    this.namespace = {}\n\n    /**\n     * Parser to use.\n     *\n     * @type {(\n     *   Parser<ParseTree extends undefined ? Node : ParseTree> |\n     *   undefined\n     * )}\n     */\n    this.parser = undefined\n\n    /**\n     * Internal list of configured transformers.\n     *\n     * @deprecated\n     *   This is a private internal property and should not be used.\n     * @type {Pipeline}\n     */\n    this.transformers = trough()\n  }\n\n  /**\n   * Copy a processor.\n   *\n   * @deprecated\n   *   This is a private internal method and should not be used.\n   * @returns {Processor<ParseTree, HeadTree, TailTree, CompileTree, CompileResult>}\n   *   New *unfrozen* processor ({@linkcode Processor}) that is\n   *   configured to work the same as its ancestor.\n   *   When the descendant processor is configured in the future it does not\n   *   affect the ancestral processor.\n   */\n  copy() {\n    // Cast as the type parameters will be the same after attaching.\n    const destination =\n      /** @type {Processor<ParseTree, HeadTree, TailTree, CompileTree, CompileResult>} */ (\n        new Processor()\n      )\n    let index = -1\n\n    while (++index < this.attachers.length) {\n      const attacher = this.attachers[index]\n      destination.use(...attacher)\n    }\n\n    destination.data(extend(true, {}, this.namespace))\n\n    return destination\n  }\n\n  /**\n   * Configure the processor with info available to all plugins.\n   * Information is stored in an object.\n   *\n   * Typically, options can be given to a specific plugin, but sometimes it\n   * makes sense to have information shared with several plugins.\n   * For example, a list of HTML elements that are self-closing, which is\n   * needed during all phases.\n   *\n   * > **Note**: setting information cannot occur on *frozen* processors.\n   * > Call the processor first to create a new unfrozen processor.\n   *\n   * > **Note**: to register custom data in TypeScript, augment the\n   * > {@linkcode Data} interface.\n   *\n   * @example\n   *   This example show how to get and set info:\n   *\n   *   ```js\n   *   import {unified} from 'unified'\n   *\n   *   const processor = unified().data('alpha', 'bravo')\n   *\n   *   processor.data('alpha') // => 'bravo'\n   *\n   *   processor.data() // => {alpha: 'bravo'}\n   *\n   *   processor.data({charlie: 'delta'})\n   *\n   *   processor.data() // => {charlie: 'delta'}\n   *   ```\n   *\n   * @template {keyof Data} Key\n   *\n   * @overload\n   * @returns {Data}\n   *\n   * @overload\n   * @param {Data} dataset\n   * @returns {Processor<ParseTree, HeadTree, TailTree, CompileTree, CompileResult>}\n   *\n   * @overload\n   * @param {Key} key\n   * @returns {Data[Key]}\n   *\n   * @overload\n   * @param {Key} key\n   * @param {Data[Key]} value\n   * @returns {Processor<ParseTree, HeadTree, TailTree, CompileTree, CompileResult>}\n   *\n   * @param {Data | Key} [key]\n   *   Key to get or set, or entire dataset to set, or nothing to get the\n   *   entire dataset (optional).\n   * @param {Data[Key]} [value]\n   *   Value to set (optional).\n   * @returns {unknown}\n   *   The current processor when setting, the value at `key` when getting, or\n   *   the entire dataset when getting without key.\n   */\n  data(key, value) {\n    if (typeof key === 'string') {\n      // Set `key`.\n      if (arguments.length === 2) {\n        assertUnfrozen('data', this.frozen)\n        this.namespace[key] = value\n        return this\n      }\n\n      // Get `key`.\n      return (own.call(this.namespace, key) && this.namespace[key]) || undefined\n    }\n\n    // Set space.\n    if (key) {\n      assertUnfrozen('data', this.frozen)\n      this.namespace = key\n      return this\n    }\n\n    // Get space.\n    return this.namespace\n  }\n\n  /**\n   * Freeze a processor.\n   *\n   * Frozen processors are meant to be extended and not to be configured\n   * directly.\n   *\n   * When a processor is frozen it cannot be unfrozen.\n   * New processors working the same way can be created by calling the\n   * processor.\n   *\n   * It\u2019s possible to freeze processors explicitly by calling `.freeze()`.\n   * Processors freeze automatically when `.parse()`, `.run()`, `.runSync()`,\n   * `.stringify()`, `.process()`, or `.processSync()` are called.\n   *\n   * @returns {Processor<ParseTree, HeadTree, TailTree, CompileTree, CompileResult>}\n   *   The current processor.\n   */\n  freeze() {\n    if (this.frozen) {\n      return this\n    }\n\n    // Cast so that we can type plugins easier.\n    // Plugins are supposed to be usable on different processors, not just on\n    // this exact processor.\n    const self = /** @type {Processor} */ (/** @type {unknown} */ (this))\n\n    while (++this.freezeIndex < this.attachers.length) {\n      const [attacher, ...options] = this.attachers[this.freezeIndex]\n\n      if (options[0] === false) {\n        continue\n      }\n\n      if (options[0] === true) {\n        options[0] = undefined\n      }\n\n      const transformer = attacher.call(self, ...options)\n\n      if (typeof transformer === 'function') {\n        this.transformers.use(transformer)\n      }\n    }\n\n    this.frozen = true\n    this.freezeIndex = Number.POSITIVE_INFINITY\n\n    return this\n  }\n\n  /**\n   * Parse text to a syntax tree.\n   *\n   * > **Note**: `parse` freezes the processor if not already *frozen*.\n   *\n   * > **Note**: `parse` performs the parse phase, not the run phase or other\n   * > phases.\n   *\n   * @param {Compatible | undefined} [file]\n   *   file to parse (optional); typically `string` or `VFile`; any value\n   *   accepted as `x` in `new VFile(x)`.\n   * @returns {ParseTree extends undefined ? Node : ParseTree}\n   *   Syntax tree representing `file`.\n   */\n  parse(file) {\n    this.freeze()\n    const realFile = vfile(file)\n    const parser = this.parser || this.Parser\n    assertParser('parse', parser)\n    return parser(String(realFile), realFile)\n  }\n\n  /**\n   * Process the given file as configured on the processor.\n   *\n   * > **Note**: `process` freezes the processor if not already *frozen*.\n   *\n   * > **Note**: `process` performs the parse, run, and stringify phases.\n   *\n   * @overload\n   * @param {Compatible | undefined} file\n   * @param {ProcessCallback<VFileWithOutput<CompileResult>>} done\n   * @returns {undefined}\n   *\n   * @overload\n   * @param {Compatible | undefined} [file]\n   * @returns {Promise<VFileWithOutput<CompileResult>>}\n   *\n   * @param {Compatible | undefined} [file]\n   *   File (optional); typically `string` or `VFile`]; any value accepted as\n   *   `x` in `new VFile(x)`.\n   * @param {ProcessCallback<VFileWithOutput<CompileResult>> | undefined} [done]\n   *   Callback (optional).\n   * @returns {Promise<VFile> | undefined}\n   *   Nothing if `done` is given.\n   *   Otherwise a promise, rejected with a fatal error or resolved with the\n   *   processed file.\n   *\n   *   The parsed, transformed, and compiled value is available at\n   *   `file.value` (see note).\n   *\n   *   > **Note**: unified typically compiles by serializing: most\n   *   > compilers return `string` (or `Uint8Array`).\n   *   > Some compilers, such as the one configured with\n   *   > [`rehype-react`][rehype-react], return other values (in this case, a\n   *   > React tree).\n   *   > If you\u2019re using a compiler that doesn\u2019t serialize, expect different\n   *   > result values.\n   *   >\n   *   > To register custom results in TypeScript, add them to\n   *   > {@linkcode CompileResultMap}.\n   *\n   *   [rehype-react]: https://github.com/rehypejs/rehype-react\n   */\n  process(file, done) {\n    const self = this\n\n    this.freeze()\n    assertParser('process', this.parser || this.Parser)\n    assertCompiler('process', this.compiler || this.Compiler)\n\n    return done ? executor(undefined, done) : new Promise(executor)\n\n    // Note: `void`s needed for TS.\n    /**\n     * @param {((file: VFileWithOutput<CompileResult>) => undefined | void) | undefined} resolve\n     * @param {(error: Error | undefined) => undefined | void} reject\n     * @returns {undefined}\n     */\n    function executor(resolve, reject) {\n      const realFile = vfile(file)\n      // Assume `ParseTree` (the result of the parser) matches `HeadTree` (the\n      // input of the first transform).\n      const parseTree =\n        /** @type {HeadTree extends undefined ? Node : HeadTree} */ (\n          /** @type {unknown} */ (self.parse(realFile))\n        )\n\n      self.run(parseTree, realFile, function (error, tree, file) {\n        if (error || !tree || !file) {\n          return realDone(error)\n        }\n\n        // Assume `TailTree` (the output of the last transform) matches\n        // `CompileTree` (the input of the compiler).\n        const compileTree =\n          /** @type {CompileTree extends undefined ? Node : CompileTree} */ (\n            /** @type {unknown} */ (tree)\n          )\n\n        const compileResult = self.stringify(compileTree, file)\n\n        if (looksLikeAValue(compileResult)) {\n          file.value = compileResult\n        } else {\n          file.result = compileResult\n        }\n\n        realDone(error, /** @type {VFileWithOutput<CompileResult>} */ (file))\n      })\n\n      /**\n       * @param {Error | undefined} error\n       * @param {VFileWithOutput<CompileResult> | undefined} [file]\n       * @returns {undefined}\n       */\n      function realDone(error, file) {\n        if (error || !file) {\n          reject(error)\n        } else if (resolve) {\n          resolve(file)\n        } else {\n          assert(done, '`done` is defined if `resolve` is not')\n          done(undefined, file)\n        }\n      }\n    }\n  }\n\n  /**\n   * Process the given file as configured on the processor.\n   *\n   * An error is thrown if asynchronous transforms are configured.\n   *\n   * > **Note**: `processSync` freezes the processor if not already *frozen*.\n   *\n   * > **Note**: `processSync` performs the parse, run, and stringify phases.\n   *\n   * @param {Compatible | undefined} [file]\n   *   File (optional); typically `string` or `VFile`; any value accepted as\n   *   `x` in `new VFile(x)`.\n   * @returns {VFileWithOutput<CompileResult>}\n   *   The processed file.\n   *\n   *   The parsed, transformed, and compiled value is available at\n   *   `file.value` (see note).\n   *\n   *   > **Note**: unified typically compiles by serializing: most\n   *   > compilers return `string` (or `Uint8Array`).\n   *   > Some compilers, such as the one configured with\n   *   > [`rehype-react`][rehype-react], return other values (in this case, a\n   *   > React tree).\n   *   > If you\u2019re using a compiler that doesn\u2019t serialize, expect different\n   *   > result values.\n   *   >\n   *   > To register custom results in TypeScript, add them to\n   *   > {@linkcode CompileResultMap}.\n   *\n   *   [rehype-react]: https://github.com/rehypejs/rehype-react\n   */\n  processSync(file) {\n    /** @type {boolean} */\n    let complete = false\n    /** @type {VFileWithOutput<CompileResult> | undefined} */\n    let result\n\n    this.freeze()\n    assertParser('processSync', this.parser || this.Parser)\n    assertCompiler('processSync', this.compiler || this.Compiler)\n\n    this.process(file, realDone)\n    assertDone('processSync', 'process', complete)\n    assert(result, 'we either bailed on an error or have a tree')\n\n    return result\n\n    /**\n     * @type {ProcessCallback<VFileWithOutput<CompileResult>>}\n     */\n    function realDone(error, file) {\n      complete = true\n      bail(error)\n      result = file\n    }\n  }\n\n  /**\n   * Run *transformers* on a syntax tree.\n   *\n   * > **Note**: `run` freezes the processor if not already *frozen*.\n   *\n   * > **Note**: `run` performs the run phase, not other phases.\n   *\n   * @overload\n   * @param {HeadTree extends undefined ? Node : HeadTree} tree\n   * @param {RunCallback<TailTree extends undefined ? Node : TailTree>} done\n   * @returns {undefined}\n   *\n   * @overload\n   * @param {HeadTree extends undefined ? Node : HeadTree} tree\n   * @param {Compatible | undefined} file\n   * @param {RunCallback<TailTree extends undefined ? Node : TailTree>} done\n   * @returns {undefined}\n   *\n   * @overload\n   * @param {HeadTree extends undefined ? Node : HeadTree} tree\n   * @param {Compatible | undefined} [file]\n   * @returns {Promise<TailTree extends undefined ? Node : TailTree>}\n   *\n   * @param {HeadTree extends undefined ? Node : HeadTree} tree\n   *   Tree to transform and inspect.\n   * @param {(\n   *   RunCallback<TailTree extends undefined ? Node : TailTree> |\n   *   Compatible\n   * )} [file]\n   *   File associated with `node` (optional); any value accepted as `x` in\n   *   `new VFile(x)`.\n   * @param {RunCallback<TailTree extends undefined ? Node : TailTree>} [done]\n   *   Callback (optional).\n   * @returns {Promise<TailTree extends undefined ? Node : TailTree> | undefined}\n   *   Nothing if `done` is given.\n   *   Otherwise, a promise rejected with a fatal error or resolved with the\n   *   transformed tree.\n   */\n  run(tree, file, done) {\n    assertNode(tree)\n    this.freeze()\n\n    const transformers = this.transformers\n\n    if (!done && typeof file === 'function') {\n      done = file\n      file = undefined\n    }\n\n    return done ? executor(undefined, done) : new Promise(executor)\n\n    // Note: `void`s needed for TS.\n    /**\n     * @param {(\n     *   ((tree: TailTree extends undefined ? Node : TailTree) => undefined | void) |\n     *   undefined\n     * )} resolve\n     * @param {(error: Error) => undefined | void} reject\n     * @returns {undefined}\n     */\n    function executor(resolve, reject) {\n      assert(\n        typeof file !== 'function',\n        '`file` can\u2019t be a `done` anymore, we checked'\n      )\n      const realFile = vfile(file)\n      transformers.run(tree, realFile, realDone)\n\n      /**\n       * @param {Error | undefined} error\n       * @param {Node} outputTree\n       * @param {VFile} file\n       * @returns {undefined}\n       */\n      function realDone(error, outputTree, file) {\n        const resultingTree =\n          /** @type {TailTree extends undefined ? Node : TailTree} */ (\n            outputTree || tree\n          )\n\n        if (error) {\n          reject(error)\n        } else if (resolve) {\n          resolve(resultingTree)\n        } else {\n          assert(done, '`done` is defined if `resolve` is not')\n          done(undefined, resultingTree, file)\n        }\n      }\n    }\n  }\n\n  /**\n   * Run *transformers* on a syntax tree.\n   *\n   * An error is thrown if asynchronous transforms are configured.\n   *\n   * > **Note**: `runSync` freezes the processor if not already *frozen*.\n   *\n   * > **Note**: `runSync` performs the run phase, not other phases.\n   *\n   * @param {HeadTree extends undefined ? Node : HeadTree} tree\n   *   Tree to transform and inspect.\n   * @param {Compatible | undefined} [file]\n   *   File associated with `node` (optional); any value accepted as `x` in\n   *   `new VFile(x)`.\n   * @returns {TailTree extends undefined ? Node : TailTree}\n   *   Transformed tree.\n   */\n  runSync(tree, file) {\n    /** @type {boolean} */\n    let complete = false\n    /** @type {(TailTree extends undefined ? Node : TailTree) | undefined} */\n    let result\n\n    this.run(tree, file, realDone)\n\n    assertDone('runSync', 'run', complete)\n    assert(result, 'we either bailed on an error or have a tree')\n    return result\n\n    /**\n     * @type {RunCallback<TailTree extends undefined ? Node : TailTree>}\n     */\n    function realDone(error, tree) {\n      bail(error)\n      result = tree\n      complete = true\n    }\n  }\n\n  /**\n   * Compile a syntax tree.\n   *\n   * > **Note**: `stringify` freezes the processor if not already *frozen*.\n   *\n   * > **Note**: `stringify` performs the stringify phase, not the run phase\n   * > or other phases.\n   *\n   * @param {CompileTree extends undefined ? Node : CompileTree} tree\n   *   Tree to compile.\n   * @param {Compatible | undefined} [file]\n   *   File associated with `node` (optional); any value accepted as `x` in\n   *   `new VFile(x)`.\n   * @returns {CompileResult extends undefined ? Value : CompileResult}\n   *   Textual representation of the tree (see note).\n   *\n   *   > **Note**: unified typically compiles by serializing: most compilers\n   *   > return `string` (or `Uint8Array`).\n   *   > Some compilers, such as the one configured with\n   *   > [`rehype-react`][rehype-react], return other values (in this case, a\n   *   > React tree).\n   *   > If you\u2019re using a compiler that doesn\u2019t serialize, expect different\n   *   > result values.\n   *   >\n   *   > To register custom results in TypeScript, add them to\n   *   > {@linkcode CompileResultMap}.\n   *\n   *   [rehype-react]: https://github.com/rehypejs/rehype-react\n   */\n  stringify(tree, file) {\n    this.freeze()\n    const realFile = vfile(file)\n    const compiler = this.compiler || this.Compiler\n    assertCompiler('stringify', compiler)\n    assertNode(tree)\n\n    return compiler(tree, realFile)\n  }\n\n  /**\n   * Configure the processor to use a plugin, a list of usable values, or a\n   * preset.\n   *\n   * If the processor is already using a plugin, the previous plugin\n   * configuration is changed based on the options that are passed in.\n   * In other words, the plugin is not added a second time.\n   *\n   * > **Note**: `use` cannot be called on *frozen* processors.\n   * > Call the processor first to create a new unfrozen processor.\n   *\n   * @example\n   *   There are many ways to pass plugins to `.use()`.\n   *   This example gives an overview:\n   *\n   *   ```js\n   *   import {unified} from 'unified'\n   *\n   *   unified()\n   *     // Plugin with options:\n   *     .use(pluginA, {x: true, y: true})\n   *     // Passing the same plugin again merges configuration (to `{x: true, y: false, z: true}`):\n   *     .use(pluginA, {y: false, z: true})\n   *     // Plugins:\n   *     .use([pluginB, pluginC])\n   *     // Two plugins, the second with options:\n   *     .use([pluginD, [pluginE, {}]])\n   *     // Preset with plugins and settings:\n   *     .use({plugins: [pluginF, [pluginG, {}]], settings: {position: false}})\n   *     // Settings only:\n   *     .use({settings: {position: false}})\n   *   ```\n   *\n   * @template {Array<unknown>} [Parameters=[]]\n   * @template {Node | string | undefined} [Input=undefined]\n   * @template [Output=Input]\n   *\n   * @overload\n   * @param {Preset | null | undefined} [preset]\n   * @returns {Processor<ParseTree, HeadTree, TailTree, CompileTree, CompileResult>}\n   *\n   * @overload\n   * @param {PluggableList} list\n   * @returns {Processor<ParseTree, HeadTree, TailTree, CompileTree, CompileResult>}\n   *\n   * @overload\n   * @param {Plugin<Parameters, Input, Output>} plugin\n   * @param {...(Parameters | [boolean])} parameters\n   * @returns {UsePlugin<ParseTree, HeadTree, TailTree, CompileTree, CompileResult, Input, Output>}\n   *\n   * @param {PluggableList | Plugin | Preset | null | undefined} value\n   *   Usable value.\n   * @param {...unknown} parameters\n   *   Parameters, when a plugin is given as a usable value.\n   * @returns {Processor<ParseTree, HeadTree, TailTree, CompileTree, CompileResult>}\n   *   Current processor.\n   */\n  use(value, ...parameters) {\n    const attachers = this.attachers\n    const namespace = this.namespace\n\n    assertUnfrozen('use', this.frozen)\n\n    if (value === null || value === undefined) {\n      // Empty.\n    } else if (typeof value === 'function') {\n      addPlugin(value, parameters)\n    } else if (typeof value === 'object') {\n      if (Array.isArray(value)) {\n        addList(value)\n      } else {\n        addPreset(value)\n      }\n    } else {\n      throw new TypeError('Expected usable value, not `' + value + '`')\n    }\n\n    return this\n\n    /**\n     * @param {Pluggable} value\n     * @returns {undefined}\n     */\n    function add(value) {\n      if (typeof value === 'function') {\n        addPlugin(value, [])\n      } else if (typeof value === 'object') {\n        if (Array.isArray(value)) {\n          const [plugin, ...parameters] =\n            /** @type {PluginTuple<Array<unknown>>} */ (value)\n          addPlugin(plugin, parameters)\n        } else {\n          addPreset(value)\n        }\n      } else {\n        throw new TypeError('Expected usable value, not `' + value + '`')\n      }\n    }\n\n    /**\n     * @param {Preset} result\n     * @returns {undefined}\n     */\n    function addPreset(result) {\n      if (!('plugins' in result) && !('settings' in result)) {\n        throw new Error(\n          'Expected usable value but received an empty preset, which is probably a mistake: presets typically come with `plugins` and sometimes with `settings`, but this has neither'\n        )\n      }\n\n      addList(result.plugins)\n\n      if (result.settings) {\n        namespace.settings = extend(true, namespace.settings, result.settings)\n      }\n    }\n\n    /**\n     * @param {PluggableList | null | undefined} plugins\n     * @returns {undefined}\n     */\n    function addList(plugins) {\n      let index = -1\n\n      if (plugins === null || plugins === undefined) {\n        // Empty.\n      } else if (Array.isArray(plugins)) {\n        while (++index < plugins.length) {\n          const thing = plugins[index]\n          add(thing)\n        }\n      } else {\n        throw new TypeError('Expected a list of plugins, not `' + plugins + '`')\n      }\n    }\n\n    /**\n     * @param {Plugin} plugin\n     * @param {Array<unknown>} parameters\n     * @returns {undefined}\n     */\n    function addPlugin(plugin, parameters) {\n      let index = -1\n      let entryIndex = -1\n\n      while (++index < attachers.length) {\n        if (attachers[index][0] === plugin) {\n          entryIndex = index\n          break\n        }\n      }\n\n      if (entryIndex === -1) {\n        attachers.push([plugin, ...parameters])\n      }\n      // Only set if there was at least a `primary` value, otherwise we\u2019d change\n      // `arguments.length`.\n      else if (parameters.length > 0) {\n        let [primary, ...rest] = parameters\n        const currentPrimary = attachers[entryIndex][1]\n        if (isPlainObj(currentPrimary) && isPlainObj(primary)) {\n          primary = extend(true, currentPrimary, primary)\n        }\n\n        attachers[entryIndex] = [plugin, primary, ...rest]\n      }\n    }\n  }\n}\n\n// Note: this returns a *callable* instance.\n// That\u2019s why it\u2019s documented as a function.\n/**\n * Create a new processor.\n *\n * @example\n *   This example shows how a new processor can be created (from `remark`) and linked\n *   to **stdin**(4) and **stdout**(4).\n *\n *   ```js\n *   import process from 'node:process'\n *   import concatStream from 'concat-stream'\n *   import {remark} from 'remark'\n *\n *   process.stdin.pipe(\n *     concatStream(function (buf) {\n *       process.stdout.write(String(remark().processSync(buf)))\n *     })\n *   )\n *   ```\n *\n * @returns\n *   New *unfrozen* processor (`processor`).\n *\n *   This processor is configured to work the same as its ancestor.\n *   When the descendant processor is configured in the future it does not\n *   affect the ancestral processor.\n */\nexport const unified = new Processor().freeze()\n\n/**\n * Assert a parser is available.\n *\n * @param {string} name\n * @param {unknown} value\n * @returns {asserts value is Parser}\n */\nfunction assertParser(name, value) {\n  if (typeof value !== 'function') {\n    throw new TypeError('Cannot `' + name + '` without `parser`')\n  }\n}\n\n/**\n * Assert a compiler is available.\n *\n * @param {string} name\n * @param {unknown} value\n * @returns {asserts value is Compiler}\n */\nfunction assertCompiler(name, value) {\n  if (typeof value !== 'function') {\n    throw new TypeError('Cannot `' + name + '` without `compiler`')\n  }\n}\n\n/**\n * Assert the processor is not frozen.\n *\n * @param {string} name\n * @param {unknown} frozen\n * @returns {asserts frozen is false}\n */\nfunction assertUnfrozen(name, frozen) {\n  if (frozen) {\n    throw new Error(\n      'Cannot call `' +\n        name +\n        '` on a frozen processor.\\nCreate a new processor first, by calling it: use `processor()` instead of `processor`.'\n    )\n  }\n}\n\n/**\n * Assert `node` is a unist node.\n *\n * @param {unknown} node\n * @returns {asserts node is Node}\n */\nfunction assertNode(node) {\n  // `isPlainObj` unfortunately uses `any` instead of `unknown`.\n  // type-coverage:ignore-next-line\n  if (!isPlainObj(node) || typeof node.type !== 'string') {\n    throw new TypeError('Expected node, got `' + node + '`')\n    // Fine.\n  }\n}\n\n/**\n * Assert that `complete` is `true`.\n *\n * @param {string} name\n * @param {string} asyncName\n * @param {unknown} complete\n * @returns {asserts complete is true}\n */\nfunction assertDone(name, asyncName, complete) {\n  if (!complete) {\n    throw new Error(\n      '`' + name + '` finished async. Use `' + asyncName + '` instead'\n    )\n  }\n}\n\n/**\n * @param {Compatible | undefined} [value]\n * @returns {VFile}\n */\nfunction vfile(value) {\n  return looksLikeAVFile(value) ? value : new VFile(value)\n}\n\n/**\n * @param {Compatible | undefined} [value]\n * @returns {value is VFile}\n */\nfunction looksLikeAVFile(value) {\n  return Boolean(\n    value &&\n      typeof value === 'object' &&\n      'message' in value &&\n      'messages' in value\n  )\n}\n\n/**\n * @param {unknown} [value]\n * @returns {value is Value}\n */\nfunction looksLikeAValue(value) {\n  return typeof value === 'string' || isUint8Array(value)\n}\n\n/**\n * Assert `value` is an `Uint8Array`.\n *\n * @param {unknown} value\n *   thing.\n * @returns {value is Uint8Array}\n *   Whether `value` is an `Uint8Array`.\n */\nfunction isUint8Array(value) {\n  return Boolean(\n    value &&\n      typeof value === 'object' &&\n      'byteLength' in value &&\n      'byteOffset' in value\n  )\n}\n", "export default function isPlainObject(value) {\n\tif (typeof value !== 'object' || value === null) {\n\t\treturn false;\n\t}\n\n\tconst prototype = Object.getPrototypeOf(value);\n\treturn (prototype === null || prototype === Object.prototype || Object.getPrototypeOf(prototype) === null) && !(Symbol.toStringTag in value) && !(Symbol.iterator in value);\n}\n", "// To do: remove `void`s\n// To do: remove `null` from output of our APIs, allow it as user APIs.\n\n/**\n * @typedef {(error?: Error | null | undefined, ...output: Array<any>) => void} Callback\n *   Callback.\n *\n * @typedef {(...input: Array<any>) => any} Middleware\n *   Ware.\n *\n * @typedef Pipeline\n *   Pipeline.\n * @property {Run} run\n *   Run the pipeline.\n * @property {Use} use\n *   Add middleware.\n *\n * @typedef {(...input: Array<any>) => void} Run\n *   Call all middleware.\n *\n *   Calls `done` on completion with either an error or the output of the\n *   last middleware.\n *\n *   > \uD83D\uDC49 **Note**: as the length of input defines whether async functions get a\n *   > `next` function,\n *   > it\u2019s recommended to keep `input` at one value normally.\n\n *\n * @typedef {(fn: Middleware) => Pipeline} Use\n *   Add middleware.\n */\n\n/**\n * Create new middleware.\n *\n * @returns {Pipeline}\n *   Pipeline.\n */\nexport function trough() {\n  /** @type {Array<Middleware>} */\n  const fns = []\n  /** @type {Pipeline} */\n  const pipeline = {run, use}\n\n  return pipeline\n\n  /** @type {Run} */\n  function run(...values) {\n    let middlewareIndex = -1\n    /** @type {Callback} */\n    const callback = values.pop()\n\n    if (typeof callback !== 'function') {\n      throw new TypeError('Expected function as last argument, not ' + callback)\n    }\n\n    next(null, ...values)\n\n    /**\n     * Run the next `fn`, or we\u2019re done.\n     *\n     * @param {Error | null | undefined} error\n     * @param {Array<any>} output\n     */\n    function next(error, ...output) {\n      const fn = fns[++middlewareIndex]\n      let index = -1\n\n      if (error) {\n        callback(error)\n        return\n      }\n\n      // Copy non-nullish input into values.\n      while (++index < values.length) {\n        if (output[index] === null || output[index] === undefined) {\n          output[index] = values[index]\n        }\n      }\n\n      // Save the newly created `output` for the next call.\n      values = output\n\n      // Next or done.\n      if (fn) {\n        wrap(fn, next)(...output)\n      } else {\n        callback(null, ...output)\n      }\n    }\n  }\n\n  /** @type {Use} */\n  function use(middelware) {\n    if (typeof middelware !== 'function') {\n      throw new TypeError(\n        'Expected `middelware` to be a function, not ' + middelware\n      )\n    }\n\n    fns.push(middelware)\n    return pipeline\n  }\n}\n\n/**\n * Wrap `middleware` into a uniform interface.\n *\n * You can pass all input to the resulting function.\n * `callback` is then called with the output of `middleware`.\n *\n * If `middleware` accepts more arguments than the later given in input,\n * an extra `done` function is passed to it after that input,\n * which must be called by `middleware`.\n *\n * The first value in `input` is the main input value.\n * All other input values are the rest input values.\n * The values given to `callback` are the input values,\n * merged with every non-nullish output value.\n *\n * * if `middleware` throws an error,\n *   returns a promise that is rejected,\n *   or calls the given `done` function with an error,\n *   `callback` is called with that error\n * * if `middleware` returns a value or returns a promise that is resolved,\n *   that value is the main output value\n * * if `middleware` calls `done`,\n *   all non-nullish values except for the first one (the error) overwrite the\n *   output values\n *\n * @param {Middleware} middleware\n *   Function to wrap.\n * @param {Callback} callback\n *   Callback called with the output of `middleware`.\n * @returns {Run}\n *   Wrapped middleware.\n */\nexport function wrap(middleware, callback) {\n  /** @type {boolean} */\n  let called\n\n  return wrapped\n\n  /**\n   * Call `middleware`.\n   * @this {any}\n   * @param {Array<any>} parameters\n   * @returns {void}\n   */\n  function wrapped(...parameters) {\n    const fnExpectsCallback = middleware.length > parameters.length\n    /** @type {any} */\n    let result\n\n    if (fnExpectsCallback) {\n      parameters.push(done)\n    }\n\n    try {\n      result = middleware.apply(this, parameters)\n    } catch (error) {\n      const exception = /** @type {Error} */ (error)\n\n      // Well, this is quite the pickle.\n      // `middleware` received a callback and called it synchronously, but that\n      // threw an error.\n      // The only thing left to do is to throw the thing instead.\n      if (fnExpectsCallback && called) {\n        throw exception\n      }\n\n      return done(exception)\n    }\n\n    if (!fnExpectsCallback) {\n      if (result && result.then && typeof result.then === 'function') {\n        result.then(then, done)\n      } else if (result instanceof Error) {\n        done(result)\n      } else {\n        then(result)\n      }\n    }\n  }\n\n  /**\n   * Call `callback`, only once.\n   *\n   * @type {Callback}\n   */\n  function done(error, ...output) {\n    if (!called) {\n      called = true\n      callback(error, ...output)\n    }\n  }\n\n  /**\n   * Call `done` with one value.\n   *\n   * @param {any} [value]\n   */\n  function then(value) {\n    done(null, value)\n  }\n}\n", "/**\n * @import {Node, Point, Position} from 'unist'\n */\n\n/**\n * @typedef {object & {type: string, position?: Position | undefined}} NodeLike\n *\n * @typedef Options\n *   Configuration.\n * @property {Array<Node> | null | undefined} [ancestors]\n *   Stack of (inclusive) ancestor nodes surrounding the message (optional).\n * @property {Error | null | undefined} [cause]\n *   Original error cause of the message (optional).\n * @property {Point | Position | null | undefined} [place]\n *   Place of message (optional).\n * @property {string | null | undefined} [ruleId]\n *   Category of message (optional, example: `'my-rule'`).\n * @property {string | null | undefined} [source]\n *   Namespace of who sent the message (optional, example: `'my-package'`).\n */\n\nimport {stringifyPosition} from 'unist-util-stringify-position'\n\n/**\n * Message.\n */\nexport class VFileMessage extends Error {\n  /**\n   * Create a message for `reason`.\n   *\n   * > \uD83E\uDEA6 **Note**: also has obsolete signatures.\n   *\n   * @overload\n   * @param {string} reason\n   * @param {Options | null | undefined} [options]\n   * @returns\n   *\n   * @overload\n   * @param {string} reason\n   * @param {Node | NodeLike | null | undefined} parent\n   * @param {string | null | undefined} [origin]\n   * @returns\n   *\n   * @overload\n   * @param {string} reason\n   * @param {Point | Position | null | undefined} place\n   * @param {string | null | undefined} [origin]\n   * @returns\n   *\n   * @overload\n   * @param {string} reason\n   * @param {string | null | undefined} [origin]\n   * @returns\n   *\n   * @overload\n   * @param {Error | VFileMessage} cause\n   * @param {Node | NodeLike | null | undefined} parent\n   * @param {string | null | undefined} [origin]\n   * @returns\n   *\n   * @overload\n   * @param {Error | VFileMessage} cause\n   * @param {Point | Position | null | undefined} place\n   * @param {string | null | undefined} [origin]\n   * @returns\n   *\n   * @overload\n   * @param {Error | VFileMessage} cause\n   * @param {string | null | undefined} [origin]\n   * @returns\n   *\n   * @param {Error | VFileMessage | string} causeOrReason\n   *   Reason for message, should use markdown.\n   * @param {Node | NodeLike | Options | Point | Position | string | null | undefined} [optionsOrParentOrPlace]\n   *   Configuration (optional).\n   * @param {string | null | undefined} [origin]\n   *   Place in code where the message originates (example:\n   *   `'my-package:my-rule'` or `'my-rule'`).\n   * @returns\n   *   Instance of `VFileMessage`.\n   */\n  // eslint-disable-next-line complexity\n  constructor(causeOrReason, optionsOrParentOrPlace, origin) {\n    super()\n\n    if (typeof optionsOrParentOrPlace === 'string') {\n      origin = optionsOrParentOrPlace\n      optionsOrParentOrPlace = undefined\n    }\n\n    /** @type {string} */\n    let reason = ''\n    /** @type {Options} */\n    let options = {}\n    let legacyCause = false\n\n    if (optionsOrParentOrPlace) {\n      // Point.\n      if (\n        'line' in optionsOrParentOrPlace &&\n        'column' in optionsOrParentOrPlace\n      ) {\n        options = {place: optionsOrParentOrPlace}\n      }\n      // Position.\n      else if (\n        'start' in optionsOrParentOrPlace &&\n        'end' in optionsOrParentOrPlace\n      ) {\n        options = {place: optionsOrParentOrPlace}\n      }\n      // Node.\n      else if ('type' in optionsOrParentOrPlace) {\n        options = {\n          ancestors: [optionsOrParentOrPlace],\n          place: optionsOrParentOrPlace.position\n        }\n      }\n      // Options.\n      else {\n        options = {...optionsOrParentOrPlace}\n      }\n    }\n\n    if (typeof causeOrReason === 'string') {\n      reason = causeOrReason\n    }\n    // Error.\n    else if (!options.cause && causeOrReason) {\n      legacyCause = true\n      reason = causeOrReason.message\n      options.cause = causeOrReason\n    }\n\n    if (!options.ruleId && !options.source && typeof origin === 'string') {\n      const index = origin.indexOf(':')\n\n      if (index === -1) {\n        options.ruleId = origin\n      } else {\n        options.source = origin.slice(0, index)\n        options.ruleId = origin.slice(index + 1)\n      }\n    }\n\n    if (!options.place && options.ancestors && options.ancestors) {\n      const parent = options.ancestors[options.ancestors.length - 1]\n\n      if (parent) {\n        options.place = parent.position\n      }\n    }\n\n    const start =\n      options.place && 'start' in options.place\n        ? options.place.start\n        : options.place\n\n    /**\n     * Stack of ancestor nodes surrounding the message.\n     *\n     * @type {Array<Node> | undefined}\n     */\n    this.ancestors = options.ancestors || undefined\n\n    /**\n     * Original error cause of the message.\n     *\n     * @type {Error | undefined}\n     */\n    this.cause = options.cause || undefined\n\n    /**\n     * Starting column of message.\n     *\n     * @type {number | undefined}\n     */\n    this.column = start ? start.column : undefined\n\n    /**\n     * State of problem.\n     *\n     * * `true` \u2014 error, file not usable\n     * * `false` \u2014 warning, change may be needed\n     * * `undefined` \u2014 change likely not needed\n     *\n     * @type {boolean | null | undefined}\n     */\n    this.fatal = undefined\n\n    /**\n     * Path of a file (used throughout the `VFile` ecosystem).\n     *\n     * @type {string | undefined}\n     */\n    this.file = ''\n\n    // Field from `Error`.\n    /**\n     * Reason for message.\n     *\n     * @type {string}\n     */\n    this.message = reason\n\n    /**\n     * Starting line of error.\n     *\n     * @type {number | undefined}\n     */\n    this.line = start ? start.line : undefined\n\n    // Field from `Error`.\n    /**\n     * Serialized positional info of message.\n     *\n     * On normal errors, this would be something like `ParseError`, buit in\n     * `VFile` messages we use this space to show where an error happened.\n     */\n    this.name = stringifyPosition(options.place) || '1:1'\n\n    /**\n     * Place of message.\n     *\n     * @type {Point | Position | undefined}\n     */\n    this.place = options.place || undefined\n\n    /**\n     * Reason for message, should use markdown.\n     *\n     * @type {string}\n     */\n    this.reason = this.message\n\n    /**\n     * Category of message (example: `'my-rule'`).\n     *\n     * @type {string | undefined}\n     */\n    this.ruleId = options.ruleId || undefined\n\n    /**\n     * Namespace of message (example: `'my-package'`).\n     *\n     * @type {string | undefined}\n     */\n    this.source = options.source || undefined\n\n    // Field from `Error`.\n    /**\n     * Stack of message.\n     *\n     * This is used by normal errors to show where something happened in\n     * programming code, irrelevant for `VFile` messages,\n     *\n     * @type {string}\n     */\n    this.stack =\n      legacyCause && options.cause && typeof options.cause.stack === 'string'\n        ? options.cause.stack\n        : ''\n\n    // The following fields are \u201Cwell known\u201D.\n    // Not standard.\n    // Feel free to add other non-standard fields to your messages.\n\n    /**\n     * Specify the source value that\u2019s being reported, which is deemed\n     * incorrect.\n     *\n     * @type {string | undefined}\n     */\n    this.actual = undefined\n\n    /**\n     * Suggest acceptable values that can be used instead of `actual`.\n     *\n     * @type {Array<string> | undefined}\n     */\n    this.expected = undefined\n\n    /**\n     * Long form description of the message (you should use markdown).\n     *\n     * @type {string | undefined}\n     */\n    this.note = undefined\n\n    /**\n     * Link to docs for the message.\n     *\n     * > \uD83D\uDC49 **Note**: this must be an absolute URL that can be passed as `x`\n     * > to `new URL(x)`.\n     *\n     * @type {string | undefined}\n     */\n    this.url = undefined\n  }\n}\n\nVFileMessage.prototype.file = ''\nVFileMessage.prototype.name = ''\nVFileMessage.prototype.reason = ''\nVFileMessage.prototype.message = ''\nVFileMessage.prototype.stack = ''\nVFileMessage.prototype.column = undefined\nVFileMessage.prototype.line = undefined\nVFileMessage.prototype.ancestors = undefined\nVFileMessage.prototype.cause = undefined\nVFileMessage.prototype.fatal = undefined\nVFileMessage.prototype.place = undefined\nVFileMessage.prototype.ruleId = undefined\nVFileMessage.prototype.source = undefined\n", "// A derivative work based on:\n// <https://github.com/browserify/path-browserify>.\n// Which is licensed:\n//\n// MIT License\n//\n// Copyright (c) 2013 James Halliday\n//\n// Permission is hereby granted, free of charge, to any person obtaining a copy of\n// this software and associated documentation files (the \"Software\"), to deal in\n// the Software without restriction, including without limitation the rights to\n// use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of\n// the Software, and to permit persons to whom the Software is furnished to do so,\n// subject to the following conditions:\n//\n// The above copyright notice and this permission notice shall be included in all\n// copies or substantial portions of the Software.\n//\n// THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\n// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS\n// FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR\n// COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER\n// IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN\n// CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.\n// A derivative work based on:\n//\n// Parts of that are extracted from Node\u2019s internal `path` module:\n// <https://github.com/nodejs/node/blob/master/lib/path.js>.\n// Which is licensed:\n//\n// Copyright Joyent, Inc. and other Node contributors.\n//\n// Permission is hereby granted, free of charge, to any person obtaining a\n// copy of this software and associated documentation files (the\n// \"Software\"), to deal in the Software without restriction, including\n// without limitation the rights to use, copy, modify, merge, publish,\n// distribute, sublicense, and/or sell copies of the Software, and to permit\n// persons to whom the Software is furnished to do so, subject to the\n// following conditions:\n//\n// The above copyright notice and this permission notice shall be included\n// in all copies or substantial portions of the Software.\n//\n// THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS\n// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF\n// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN\n// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,\n// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR\n// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE\n// USE OR OTHER DEALINGS IN THE SOFTWARE.\n\nexport const minpath = {basename, dirname, extname, join, sep: '/'}\n\n/* eslint-disable max-depth, complexity */\n\n/**\n * Get the basename from a path.\n *\n * @param {string} path\n *   File path.\n * @param {string | null | undefined} [extname]\n *   Extension to strip.\n * @returns {string}\n *   Stem or basename.\n */\nfunction basename(path, extname) {\n  if (extname !== undefined && typeof extname !== 'string') {\n    throw new TypeError('\"ext\" argument must be a string')\n  }\n\n  assertPath(path)\n  let start = 0\n  let end = -1\n  let index = path.length\n  /** @type {boolean | undefined} */\n  let seenNonSlash\n\n  if (\n    extname === undefined ||\n    extname.length === 0 ||\n    extname.length > path.length\n  ) {\n    while (index--) {\n      if (path.codePointAt(index) === 47 /* `/` */) {\n        // If we reached a path separator that was not part of a set of path\n        // separators at the end of the string, stop now.\n        if (seenNonSlash) {\n          start = index + 1\n          break\n        }\n      } else if (end < 0) {\n        // We saw the first non-path separator, mark this as the end of our\n        // path component.\n        seenNonSlash = true\n        end = index + 1\n      }\n    }\n\n    return end < 0 ? '' : path.slice(start, end)\n  }\n\n  if (extname === path) {\n    return ''\n  }\n\n  let firstNonSlashEnd = -1\n  let extnameIndex = extname.length - 1\n\n  while (index--) {\n    if (path.codePointAt(index) === 47 /* `/` */) {\n      // If we reached a path separator that was not part of a set of path\n      // separators at the end of the string, stop now.\n      if (seenNonSlash) {\n        start = index + 1\n        break\n      }\n    } else {\n      if (firstNonSlashEnd < 0) {\n        // We saw the first non-path separator, remember this index in case\n        // we need it if the extension ends up not matching.\n        seenNonSlash = true\n        firstNonSlashEnd = index + 1\n      }\n\n      if (extnameIndex > -1) {\n        // Try to match the explicit extension.\n        if (path.codePointAt(index) === extname.codePointAt(extnameIndex--)) {\n          if (extnameIndex < 0) {\n            // We matched the extension, so mark this as the end of our path\n            // component\n            end = index\n          }\n        } else {\n          // Extension does not match, so our result is the entire path\n          // component\n          extnameIndex = -1\n          end = firstNonSlashEnd\n        }\n      }\n    }\n  }\n\n  if (start === end) {\n    end = firstNonSlashEnd\n  } else if (end < 0) {\n    end = path.length\n  }\n\n  return path.slice(start, end)\n}\n\n/**\n * Get the dirname from a path.\n *\n * @param {string} path\n *   File path.\n * @returns {string}\n *   File path.\n */\nfunction dirname(path) {\n  assertPath(path)\n\n  if (path.length === 0) {\n    return '.'\n  }\n\n  let end = -1\n  let index = path.length\n  /** @type {boolean | undefined} */\n  let unmatchedSlash\n\n  // Prefix `--` is important to not run on `0`.\n  while (--index) {\n    if (path.codePointAt(index) === 47 /* `/` */) {\n      if (unmatchedSlash) {\n        end = index\n        break\n      }\n    } else if (!unmatchedSlash) {\n      // We saw the first non-path separator\n      unmatchedSlash = true\n    }\n  }\n\n  return end < 0\n    ? path.codePointAt(0) === 47 /* `/` */\n      ? '/'\n      : '.'\n    : end === 1 && path.codePointAt(0) === 47 /* `/` */\n      ? '//'\n      : path.slice(0, end)\n}\n\n/**\n * Get an extname from a path.\n *\n * @param {string} path\n *   File path.\n * @returns {string}\n *   Extname.\n */\nfunction extname(path) {\n  assertPath(path)\n\n  let index = path.length\n\n  let end = -1\n  let startPart = 0\n  let startDot = -1\n  // Track the state of characters (if any) we see before our first dot and\n  // after any path separator we find.\n  let preDotState = 0\n  /** @type {boolean | undefined} */\n  let unmatchedSlash\n\n  while (index--) {\n    const code = path.codePointAt(index)\n\n    if (code === 47 /* `/` */) {\n      // If we reached a path separator that was not part of a set of path\n      // separators at the end of the string, stop now.\n      if (unmatchedSlash) {\n        startPart = index + 1\n        break\n      }\n\n      continue\n    }\n\n    if (end < 0) {\n      // We saw the first non-path separator, mark this as the end of our\n      // extension.\n      unmatchedSlash = true\n      end = index + 1\n    }\n\n    if (code === 46 /* `.` */) {\n      // If this is our first dot, mark it as the start of our extension.\n      if (startDot < 0) {\n        startDot = index\n      } else if (preDotState !== 1) {\n        preDotState = 1\n      }\n    } else if (startDot > -1) {\n      // We saw a non-dot and non-path separator before our dot, so we should\n      // have a good chance at having a non-empty extension.\n      preDotState = -1\n    }\n  }\n\n  if (\n    startDot < 0 ||\n    end < 0 ||\n    // We saw a non-dot character immediately before the dot.\n    preDotState === 0 ||\n    // The (right-most) trimmed path component is exactly `..`.\n    (preDotState === 1 && startDot === end - 1 && startDot === startPart + 1)\n  ) {\n    return ''\n  }\n\n  return path.slice(startDot, end)\n}\n\n/**\n * Join segments from a path.\n *\n * @param {Array<string>} segments\n *   Path segments.\n * @returns {string}\n *   File path.\n */\nfunction join(...segments) {\n  let index = -1\n  /** @type {string | undefined} */\n  let joined\n\n  while (++index < segments.length) {\n    assertPath(segments[index])\n\n    if (segments[index]) {\n      joined =\n        joined === undefined ? segments[index] : joined + '/' + segments[index]\n    }\n  }\n\n  return joined === undefined ? '.' : normalize(joined)\n}\n\n/**\n * Normalize a basic file path.\n *\n * @param {string} path\n *   File path.\n * @returns {string}\n *   File path.\n */\n// Note: `normalize` is not exposed as `path.normalize`, so some code is\n// manually removed from it.\nfunction normalize(path) {\n  assertPath(path)\n\n  const absolute = path.codePointAt(0) === 47 /* `/` */\n\n  // Normalize the path according to POSIX rules.\n  let value = normalizeString(path, !absolute)\n\n  if (value.length === 0 && !absolute) {\n    value = '.'\n  }\n\n  if (value.length > 0 && path.codePointAt(path.length - 1) === 47 /* / */) {\n    value += '/'\n  }\n\n  return absolute ? '/' + value : value\n}\n\n/**\n * Resolve `.` and `..` elements in a path with directory names.\n *\n * @param {string} path\n *   File path.\n * @param {boolean} allowAboveRoot\n *   Whether `..` can move above root.\n * @returns {string}\n *   File path.\n */\nfunction normalizeString(path, allowAboveRoot) {\n  let result = ''\n  let lastSegmentLength = 0\n  let lastSlash = -1\n  let dots = 0\n  let index = -1\n  /** @type {number | undefined} */\n  let code\n  /** @type {number} */\n  let lastSlashIndex\n\n  while (++index <= path.length) {\n    if (index < path.length) {\n      code = path.codePointAt(index)\n    } else if (code === 47 /* `/` */) {\n      break\n    } else {\n      code = 47 /* `/` */\n    }\n\n    if (code === 47 /* `/` */) {\n      if (lastSlash === index - 1 || dots === 1) {\n        // Empty.\n      } else if (lastSlash !== index - 1 && dots === 2) {\n        if (\n          result.length < 2 ||\n          lastSegmentLength !== 2 ||\n          result.codePointAt(result.length - 1) !== 46 /* `.` */ ||\n          result.codePointAt(result.length - 2) !== 46 /* `.` */\n        ) {\n          if (result.length > 2) {\n            lastSlashIndex = result.lastIndexOf('/')\n\n            if (lastSlashIndex !== result.length - 1) {\n              if (lastSlashIndex < 0) {\n                result = ''\n                lastSegmentLength = 0\n              } else {\n                result = result.slice(0, lastSlashIndex)\n                lastSegmentLength = result.length - 1 - result.lastIndexOf('/')\n              }\n\n              lastSlash = index\n              dots = 0\n              continue\n            }\n          } else if (result.length > 0) {\n            result = ''\n            lastSegmentLength = 0\n            lastSlash = index\n            dots = 0\n            continue\n          }\n        }\n\n        if (allowAboveRoot) {\n          result = result.length > 0 ? result + '/..' : '..'\n          lastSegmentLength = 2\n        }\n      } else {\n        if (result.length > 0) {\n          result += '/' + path.slice(lastSlash + 1, index)\n        } else {\n          result = path.slice(lastSlash + 1, index)\n        }\n\n        lastSegmentLength = index - lastSlash - 1\n      }\n\n      lastSlash = index\n      dots = 0\n    } else if (code === 46 /* `.` */ && dots > -1) {\n      dots++\n    } else {\n      dots = -1\n    }\n  }\n\n  return result\n}\n\n/**\n * Make sure `path` is a string.\n *\n * @param {string} path\n *   File path.\n * @returns {asserts path is string}\n *   Nothing.\n */\nfunction assertPath(path) {\n  if (typeof path !== 'string') {\n    throw new TypeError(\n      'Path must be a string. Received ' + JSON.stringify(path)\n    )\n  }\n}\n\n/* eslint-enable max-depth, complexity */\n", "// Somewhat based on:\n// <https://github.com/defunctzombie/node-process/blob/master/browser.js>.\n// But I don\u2019t think one tiny line of code can be copyrighted. \uD83D\uDE05\nexport const minproc = {cwd}\n\nfunction cwd() {\n  return '/'\n}\n", "/**\n * Checks if a value has the shape of a WHATWG URL object.\n *\n * Using a symbol or instanceof would not be able to recognize URL objects\n * coming from other implementations (e.g. in Electron), so instead we are\n * checking some well known properties for a lack of a better test.\n *\n * We use `href` and `protocol` as they are the only properties that are\n * easy to retrieve and calculate due to the lazy nature of the getters.\n *\n * We check for auth attribute to distinguish legacy url instance with\n * WHATWG URL instance.\n *\n * @param {unknown} fileUrlOrPath\n *   File path or URL.\n * @returns {fileUrlOrPath is URL}\n *   Whether it\u2019s a URL.\n */\n// From: <https://github.com/nodejs/node/blob/6a3403c/lib/internal/url.js#L720>\nexport function isUrl(fileUrlOrPath) {\n  return Boolean(\n    fileUrlOrPath !== null &&\n      typeof fileUrlOrPath === 'object' &&\n      'href' in fileUrlOrPath &&\n      fileUrlOrPath.href &&\n      'protocol' in fileUrlOrPath &&\n      fileUrlOrPath.protocol &&\n      // @ts-expect-error: indexing is fine.\n      fileUrlOrPath.auth === undefined\n  )\n}\n", "import {isUrl} from './minurl.shared.js'\n\nexport {isUrl} from './minurl.shared.js'\n\n// See: <https://github.com/nodejs/node/blob/6a3403c/lib/internal/url.js>\n\n/**\n * @param {URL | string} path\n *   File URL.\n * @returns {string}\n *   File URL.\n */\nexport function urlToPath(path) {\n  if (typeof path === 'string') {\n    path = new URL(path)\n  } else if (!isUrl(path)) {\n    /** @type {NodeJS.ErrnoException} */\n    const error = new TypeError(\n      'The \"path\" argument must be of type string or an instance of URL. Received `' +\n        path +\n        '`'\n    )\n    error.code = 'ERR_INVALID_ARG_TYPE'\n    throw error\n  }\n\n  if (path.protocol !== 'file:') {\n    /** @type {NodeJS.ErrnoException} */\n    const error = new TypeError('The URL must be of scheme file')\n    error.code = 'ERR_INVALID_URL_SCHEME'\n    throw error\n  }\n\n  return getPathFromURLPosix(path)\n}\n\n/**\n * Get a path from a POSIX URL.\n *\n * @param {URL} url\n *   URL.\n * @returns {string}\n *   File path.\n */\nfunction getPathFromURLPosix(url) {\n  if (url.hostname !== '') {\n    /** @type {NodeJS.ErrnoException} */\n    const error = new TypeError(\n      'File URL host must be \"localhost\" or empty on darwin'\n    )\n    error.code = 'ERR_INVALID_FILE_URL_HOST'\n    throw error\n  }\n\n  const pathname = url.pathname\n  let index = -1\n\n  while (++index < pathname.length) {\n    if (\n      pathname.codePointAt(index) === 37 /* `%` */ &&\n      pathname.codePointAt(index + 1) === 50 /* `2` */\n    ) {\n      const third = pathname.codePointAt(index + 2)\n      if (third === 70 /* `F` */ || third === 102 /* `f` */) {\n        /** @type {NodeJS.ErrnoException} */\n        const error = new TypeError(\n          'File URL path must not include encoded / characters'\n        )\n        error.code = 'ERR_INVALID_FILE_URL_PATH'\n        throw error\n      }\n    }\n  }\n\n  return decodeURIComponent(pathname)\n}\n", "/**\n * @import {Node, Point, Position} from 'unist'\n * @import {Options as MessageOptions} from 'vfile-message'\n * @import {Compatible, Data, Map, Options, Value} from 'vfile'\n */\n\n/**\n * @typedef {object & {type: string, position?: Position | undefined}} NodeLike\n */\n\nimport {VFileMessage} from 'vfile-message'\nimport {minpath} from '#minpath'\nimport {minproc} from '#minproc'\nimport {urlToPath, isUrl} from '#minurl'\n\n/**\n * Order of setting (least specific to most), we need this because otherwise\n * `{stem: 'a', path: '~/b.js'}` would throw, as a path is needed before a\n * stem can be set.\n */\nconst order = /** @type {const} */ ([\n  'history',\n  'path',\n  'basename',\n  'stem',\n  'extname',\n  'dirname'\n])\n\nexport class VFile {\n  /**\n   * Create a new virtual file.\n   *\n   * `options` is treated as:\n   *\n   * *   `string` or `Uint8Array` \u2014 `{value: options}`\n   * *   `URL` \u2014 `{path: options}`\n   * *   `VFile` \u2014 shallow copies its data over to the new file\n   * *   `object` \u2014 all fields are shallow copied over to the new file\n   *\n   * Path related fields are set in the following order (least specific to\n   * most specific): `history`, `path`, `basename`, `stem`, `extname`,\n   * `dirname`.\n   *\n   * You cannot set `dirname` or `extname` without setting either `history`,\n   * `path`, `basename`, or `stem` too.\n   *\n   * @param {Compatible | null | undefined} [value]\n   *   File value.\n   * @returns\n   *   New instance.\n   */\n  constructor(value) {\n    /** @type {Options | VFile} */\n    let options\n\n    if (!value) {\n      options = {}\n    } else if (isUrl(value)) {\n      options = {path: value}\n    } else if (typeof value === 'string' || isUint8Array(value)) {\n      options = {value}\n    } else {\n      options = value\n    }\n\n    /* eslint-disable no-unused-expressions */\n\n    /**\n     * Base of `path` (default: `process.cwd()` or `'/'` in browsers).\n     *\n     * @type {string}\n     */\n    // Prevent calling `cwd` (which could be expensive) if it\u2019s not needed;\n    // the empty string will be overridden in the next block.\n    this.cwd = 'cwd' in options ? '' : minproc.cwd()\n\n    /**\n     * Place to store custom info (default: `{}`).\n     *\n     * It\u2019s OK to store custom data directly on the file but moving it to\n     * `data` is recommended.\n     *\n     * @type {Data}\n     */\n    this.data = {}\n\n    /**\n     * List of file paths the file moved between.\n     *\n     * The first is the original path and the last is the current path.\n     *\n     * @type {Array<string>}\n     */\n    this.history = []\n\n    /**\n     * List of messages associated with the file.\n     *\n     * @type {Array<VFileMessage>}\n     */\n    this.messages = []\n\n    /**\n     * Raw value.\n     *\n     * @type {Value}\n     */\n    this.value\n\n    // The below are non-standard, they are \u201Cwell-known\u201D.\n    // As in, used in several tools.\n    /**\n     * Source map.\n     *\n     * This type is equivalent to the `RawSourceMap` type from the `source-map`\n     * module.\n     *\n     * @type {Map | null | undefined}\n     */\n    this.map\n\n    /**\n     * Custom, non-string, compiled, representation.\n     *\n     * This is used by unified to store non-string results.\n     * One example is when turning markdown into React nodes.\n     *\n     * @type {unknown}\n     */\n    this.result\n\n    /**\n     * Whether a file was saved to disk.\n     *\n     * This is used by vfile reporters.\n     *\n     * @type {boolean}\n     */\n    this.stored\n    /* eslint-enable no-unused-expressions */\n\n    // Set path related properties in the correct order.\n    let index = -1\n\n    while (++index < order.length) {\n      const field = order[index]\n\n      // Note: we specifically use `in` instead of `hasOwnProperty` to accept\n      // `vfile`s too.\n      if (\n        field in options &&\n        options[field] !== undefined &&\n        options[field] !== null\n      ) {\n        // @ts-expect-error: TS doesn\u2019t understand basic reality.\n        this[field] = field === 'history' ? [...options[field]] : options[field]\n      }\n    }\n\n    /** @type {string} */\n    let field\n\n    // Set non-path related properties.\n    for (field in options) {\n      // @ts-expect-error: fine to set other things.\n      if (!order.includes(field)) {\n        // @ts-expect-error: fine to set other things.\n        this[field] = options[field]\n      }\n    }\n  }\n\n  /**\n   * Get the basename (including extname) (example: `'index.min.js'`).\n   *\n   * @returns {string | undefined}\n   *   Basename.\n   */\n  get basename() {\n    return typeof this.path === 'string'\n      ? minpath.basename(this.path)\n      : undefined\n  }\n\n  /**\n   * Set basename (including extname) (`'index.min.js'`).\n   *\n   * Cannot contain path separators (`'/'` on unix, macOS, and browsers, `'\\'`\n   * on windows).\n   * Cannot be nullified (use `file.path = file.dirname` instead).\n   *\n   * @param {string} basename\n   *   Basename.\n   * @returns {undefined}\n   *   Nothing.\n   */\n  set basename(basename) {\n    assertNonEmpty(basename, 'basename')\n    assertPart(basename, 'basename')\n    this.path = minpath.join(this.dirname || '', basename)\n  }\n\n  /**\n   * Get the parent path (example: `'~'`).\n   *\n   * @returns {string | undefined}\n   *   Dirname.\n   */\n  get dirname() {\n    return typeof this.path === 'string'\n      ? minpath.dirname(this.path)\n      : undefined\n  }\n\n  /**\n   * Set the parent path (example: `'~'`).\n   *\n   * Cannot be set if there\u2019s no `path` yet.\n   *\n   * @param {string | undefined} dirname\n   *   Dirname.\n   * @returns {undefined}\n   *   Nothing.\n   */\n  set dirname(dirname) {\n    assertPath(this.basename, 'dirname')\n    this.path = minpath.join(dirname || '', this.basename)\n  }\n\n  /**\n   * Get the extname (including dot) (example: `'.js'`).\n   *\n   * @returns {string | undefined}\n   *   Extname.\n   */\n  get extname() {\n    return typeof this.path === 'string'\n      ? minpath.extname(this.path)\n      : undefined\n  }\n\n  /**\n   * Set the extname (including dot) (example: `'.js'`).\n   *\n   * Cannot contain path separators (`'/'` on unix, macOS, and browsers, `'\\'`\n   * on windows).\n   * Cannot be set if there\u2019s no `path` yet.\n   *\n   * @param {string | undefined} extname\n   *   Extname.\n   * @returns {undefined}\n   *   Nothing.\n   */\n  set extname(extname) {\n    assertPart(extname, 'extname')\n    assertPath(this.dirname, 'extname')\n\n    if (extname) {\n      if (extname.codePointAt(0) !== 46 /* `.` */) {\n        throw new Error('`extname` must start with `.`')\n      }\n\n      if (extname.includes('.', 1)) {\n        throw new Error('`extname` cannot contain multiple dots')\n      }\n    }\n\n    this.path = minpath.join(this.dirname, this.stem + (extname || ''))\n  }\n\n  /**\n   * Get the full path (example: `'~/index.min.js'`).\n   *\n   * @returns {string}\n   *   Path.\n   */\n  get path() {\n    return this.history[this.history.length - 1]\n  }\n\n  /**\n   * Set the full path (example: `'~/index.min.js'`).\n   *\n   * Cannot be nullified.\n   * You can set a file URL (a `URL` object with a `file:` protocol) which will\n   * be turned into a path with `url.fileURLToPath`.\n   *\n   * @param {URL | string} path\n   *   Path.\n   * @returns {undefined}\n   *   Nothing.\n   */\n  set path(path) {\n    if (isUrl(path)) {\n      path = urlToPath(path)\n    }\n\n    assertNonEmpty(path, 'path')\n\n    if (this.path !== path) {\n      this.history.push(path)\n    }\n  }\n\n  /**\n   * Get the stem (basename w/o extname) (example: `'index.min'`).\n   *\n   * @returns {string | undefined}\n   *   Stem.\n   */\n  get stem() {\n    return typeof this.path === 'string'\n      ? minpath.basename(this.path, this.extname)\n      : undefined\n  }\n\n  /**\n   * Set the stem (basename w/o extname) (example: `'index.min'`).\n   *\n   * Cannot contain path separators (`'/'` on unix, macOS, and browsers, `'\\'`\n   * on windows).\n   * Cannot be nullified (use `file.path = file.dirname` instead).\n   *\n   * @param {string} stem\n   *   Stem.\n   * @returns {undefined}\n   *   Nothing.\n   */\n  set stem(stem) {\n    assertNonEmpty(stem, 'stem')\n    assertPart(stem, 'stem')\n    this.path = minpath.join(this.dirname || '', stem + (this.extname || ''))\n  }\n\n  // Normal prototypal methods.\n  /**\n   * Create a fatal message for `reason` associated with the file.\n   *\n   * The `fatal` field of the message is set to `true` (error; file not usable)\n   * and the `file` field is set to the current file path.\n   * The message is added to the `messages` field on `file`.\n   *\n   * > \uD83E\uDEA6 **Note**: also has obsolete signatures.\n   *\n   * @overload\n   * @param {string} reason\n   * @param {MessageOptions | null | undefined} [options]\n   * @returns {never}\n   *\n   * @overload\n   * @param {string} reason\n   * @param {Node | NodeLike | null | undefined} parent\n   * @param {string | null | undefined} [origin]\n   * @returns {never}\n   *\n   * @overload\n   * @param {string} reason\n   * @param {Point | Position | null | undefined} place\n   * @param {string | null | undefined} [origin]\n   * @returns {never}\n   *\n   * @overload\n   * @param {string} reason\n   * @param {string | null | undefined} [origin]\n   * @returns {never}\n   *\n   * @overload\n   * @param {Error | VFileMessage} cause\n   * @param {Node | NodeLike | null | undefined} parent\n   * @param {string | null | undefined} [origin]\n   * @returns {never}\n   *\n   * @overload\n   * @param {Error | VFileMessage} cause\n   * @param {Point | Position | null | undefined} place\n   * @param {string | null | undefined} [origin]\n   * @returns {never}\n   *\n   * @overload\n   * @param {Error | VFileMessage} cause\n   * @param {string | null | undefined} [origin]\n   * @returns {never}\n   *\n   * @param {Error | VFileMessage | string} causeOrReason\n   *   Reason for message, should use markdown.\n   * @param {Node | NodeLike | MessageOptions | Point | Position | string | null | undefined} [optionsOrParentOrPlace]\n   *   Configuration (optional).\n   * @param {string | null | undefined} [origin]\n   *   Place in code where the message originates (example:\n   *   `'my-package:my-rule'` or `'my-rule'`).\n   * @returns {never}\n   *   Never.\n   * @throws {VFileMessage}\n   *   Message.\n   */\n  fail(causeOrReason, optionsOrParentOrPlace, origin) {\n    // @ts-expect-error: the overloads are fine.\n    const message = this.message(causeOrReason, optionsOrParentOrPlace, origin)\n\n    message.fatal = true\n\n    throw message\n  }\n\n  /**\n   * Create an info message for `reason` associated with the file.\n   *\n   * The `fatal` field of the message is set to `undefined` (info; change\n   * likely not needed) and the `file` field is set to the current file path.\n   * The message is added to the `messages` field on `file`.\n   *\n   * > \uD83E\uDEA6 **Note**: also has obsolete signatures.\n   *\n   * @overload\n   * @param {string} reason\n   * @param {MessageOptions | null | undefined} [options]\n   * @returns {VFileMessage}\n   *\n   * @overload\n   * @param {string} reason\n   * @param {Node | NodeLike | null | undefined} parent\n   * @param {string | null | undefined} [origin]\n   * @returns {VFileMessage}\n   *\n   * @overload\n   * @param {string} reason\n   * @param {Point | Position | null | undefined} place\n   * @param {string | null | undefined} [origin]\n   * @returns {VFileMessage}\n   *\n   * @overload\n   * @param {string} reason\n   * @param {string | null | undefined} [origin]\n   * @returns {VFileMessage}\n   *\n   * @overload\n   * @param {Error | VFileMessage} cause\n   * @param {Node | NodeLike | null | undefined} parent\n   * @param {string | null | undefined} [origin]\n   * @returns {VFileMessage}\n   *\n   * @overload\n   * @param {Error | VFileMessage} cause\n   * @param {Point | Position | null | undefined} place\n   * @param {string | null | undefined} [origin]\n   * @returns {VFileMessage}\n   *\n   * @overload\n   * @param {Error | VFileMessage} cause\n   * @param {string | null | undefined} [origin]\n   * @returns {VFileMessage}\n   *\n   * @param {Error | VFileMessage | string} causeOrReason\n   *   Reason for message, should use markdown.\n   * @param {Node | NodeLike | MessageOptions | Point | Position | string | null | undefined} [optionsOrParentOrPlace]\n   *   Configuration (optional).\n   * @param {string | null | undefined} [origin]\n   *   Place in code where the message originates (example:\n   *   `'my-package:my-rule'` or `'my-rule'`).\n   * @returns {VFileMessage}\n   *   Message.\n   */\n  info(causeOrReason, optionsOrParentOrPlace, origin) {\n    // @ts-expect-error: the overloads are fine.\n    const message = this.message(causeOrReason, optionsOrParentOrPlace, origin)\n\n    message.fatal = undefined\n\n    return message\n  }\n\n  /**\n   * Create a message for `reason` associated with the file.\n   *\n   * The `fatal` field of the message is set to `false` (warning; change may be\n   * needed) and the `file` field is set to the current file path.\n   * The message is added to the `messages` field on `file`.\n   *\n   * > \uD83E\uDEA6 **Note**: also has obsolete signatures.\n   *\n   * @overload\n   * @param {string} reason\n   * @param {MessageOptions | null | undefined} [options]\n   * @returns {VFileMessage}\n   *\n   * @overload\n   * @param {string} reason\n   * @param {Node | NodeLike | null | undefined} parent\n   * @param {string | null | undefined} [origin]\n   * @returns {VFileMessage}\n   *\n   * @overload\n   * @param {string} reason\n   * @param {Point | Position | null | undefined} place\n   * @param {string | null | undefined} [origin]\n   * @returns {VFileMessage}\n   *\n   * @overload\n   * @param {string} reason\n   * @param {string | null | undefined} [origin]\n   * @returns {VFileMessage}\n   *\n   * @overload\n   * @param {Error | VFileMessage} cause\n   * @param {Node | NodeLike | null | undefined} parent\n   * @param {string | null | undefined} [origin]\n   * @returns {VFileMessage}\n   *\n   * @overload\n   * @param {Error | VFileMessage} cause\n   * @param {Point | Position | null | undefined} place\n   * @param {string | null | undefined} [origin]\n   * @returns {VFileMessage}\n   *\n   * @overload\n   * @param {Error | VFileMessage} cause\n   * @param {string | null | undefined} [origin]\n   * @returns {VFileMessage}\n   *\n   * @param {Error | VFileMessage | string} causeOrReason\n   *   Reason for message, should use markdown.\n   * @param {Node | NodeLike | MessageOptions | Point | Position | string | null | undefined} [optionsOrParentOrPlace]\n   *   Configuration (optional).\n   * @param {string | null | undefined} [origin]\n   *   Place in code where the message originates (example:\n   *   `'my-package:my-rule'` or `'my-rule'`).\n   * @returns {VFileMessage}\n   *   Message.\n   */\n  message(causeOrReason, optionsOrParentOrPlace, origin) {\n    const message = new VFileMessage(\n      // @ts-expect-error: the overloads are fine.\n      causeOrReason,\n      optionsOrParentOrPlace,\n      origin\n    )\n\n    if (this.path) {\n      message.name = this.path + ':' + message.name\n      message.file = this.path\n    }\n\n    message.fatal = false\n\n    this.messages.push(message)\n\n    return message\n  }\n\n  /**\n   * Serialize the file.\n   *\n   * > **Note**: which encodings are supported depends on the engine.\n   * > For info on Node.js, see:\n   * > <https://nodejs.org/api/util.html#whatwg-supported-encodings>.\n   *\n   * @param {string | null | undefined} [encoding='utf8']\n   *   Character encoding to understand `value` as when it\u2019s a `Uint8Array`\n   *   (default: `'utf-8'`).\n   * @returns {string}\n   *   Serialized file.\n   */\n  toString(encoding) {\n    if (this.value === undefined) {\n      return ''\n    }\n\n    if (typeof this.value === 'string') {\n      return this.value\n    }\n\n    const decoder = new TextDecoder(encoding || undefined)\n    return decoder.decode(this.value)\n  }\n}\n\n/**\n * Assert that `part` is not a path (as in, does not contain `path.sep`).\n *\n * @param {string | null | undefined} part\n *   File path part.\n * @param {string} name\n *   Part name.\n * @returns {undefined}\n *   Nothing.\n */\nfunction assertPart(part, name) {\n  if (part && part.includes(minpath.sep)) {\n    throw new Error(\n      '`' + name + '` cannot be a path: did not expect `' + minpath.sep + '`'\n    )\n  }\n}\n\n/**\n * Assert that `part` is not empty.\n *\n * @param {string | undefined} part\n *   Thing.\n * @param {string} name\n *   Part name.\n * @returns {asserts part is string}\n *   Nothing.\n */\nfunction assertNonEmpty(part, name) {\n  if (!part) {\n    throw new Error('`' + name + '` cannot be empty')\n  }\n}\n\n/**\n * Assert `path` exists.\n *\n * @param {string | undefined} path\n *   Path.\n * @param {string} name\n *   Dependency name.\n * @returns {asserts path is string}\n *   Nothing.\n */\nfunction assertPath(path, name) {\n  if (!path) {\n    throw new Error('Setting `' + name + '` requires `path` to be set too')\n  }\n}\n\n/**\n * Assert `value` is an `Uint8Array`.\n *\n * @param {unknown} value\n *   thing.\n * @returns {value is Uint8Array}\n *   Whether `value` is an `Uint8Array`.\n */\nfunction isUint8Array(value) {\n  return Boolean(\n    value &&\n      typeof value === 'object' &&\n      'byteLength' in value &&\n      'byteOffset' in value\n  )\n}\n", "export const CallableInstance =\n  /**\n   * @type {new <Parameters extends Array<unknown>, Result>(property: string | symbol) => (...parameters: Parameters) => Result}\n   */\n  (\n    /** @type {unknown} */\n    (\n      /**\n       * @this {Function}\n       * @param {string | symbol} property\n       * @returns {(...parameters: Array<unknown>) => unknown}\n       */\n      function (property) {\n        const self = this\n        const constr = self.constructor\n        const proto = /** @type {Record<string | symbol, Function>} */ (\n          // Prototypes do exist.\n          // type-coverage:ignore-next-line\n          constr.prototype\n        )\n        const value = proto[property]\n        /** @type {(...parameters: Array<unknown>) => unknown} */\n        const apply = function () {\n          return value.apply(apply, arguments)\n        }\n\n        Object.setPrototypeOf(apply, proto)\n\n        // Not needed for us in `unified`: we only call this on the `copy`\n        // function,\n        // and we don't need to add its fields (`length`, `name`)\n        // over.\n        // See also: GH-246.\n        // const names = Object.getOwnPropertyNames(value)\n        //\n        // for (const p of names) {\n        //   const descriptor = Object.getOwnPropertyDescriptor(value, p)\n        //   if (descriptor) Object.defineProperty(apply, p, descriptor)\n        // }\n\n        return apply\n      }\n    )\n  )\n", "// Note: types exposed from `index.d.ts`\nimport remarkParse from 'remark-parse'\nimport remarkStringify from 'remark-stringify'\nimport {unified} from 'unified'\n\n/**\n * Create a new unified processor that already uses `remark-parse` and\n * `remark-stringify`.\n */\nexport const remark = unified().use(remarkParse).use(remarkStringify).freeze()\n"],
+  "mappings": "ilBAAA,IAAAA,GAAAC,EAAA,CAAAC,GAAAC,KAAA,UAASC,GAAUC,EAAO,CACxB,KAAK,MAAQA,EAEb,KAAK,MAAQ,SAASC,EAAS,CAC7B,OAAO,KAAK,OAASA,EAAQ,MAC/B,CACF,CAEA,SAASC,GAAUF,EAAO,CACxB,KAAK,MAAQA,EAEb,KAAK,MAAQ,SAASC,EAAS,CAC7B,OAAO,KAAK,MAAQA,EAAQ,MAC9B,CACF,CAEA,SAASE,GAASH,EAAO,CACvB,KAAK,MAAQA,EAEb,KAAK,MAAQ,SAASC,EAAS,CAC7B,OAAO,KAAK,OAASA,EAAQ,KAC/B,CACF,CAEA,SAASG,GAASJ,EAAO,CACvB,KAAK,MAAQA,EAEb,KAAK,MAAQ,SAASC,EAAS,CAC7B,OAAO,KAAK,MAAQA,EAAQ,KAC9B,CACF,CAEA,SAASI,GAAYL,EAAO,CAC1B,KAAK,MAAQA,EAEb,KAAK,MAAQ,SAASC,EAAS,CAC7B,OAAO,KAAK,QAAUA,EAAQ,WAChC,CACF,CAEAH,GAAO,QAAU,SAAeQ,EAAMN,EAAO,CAC3C,OAAQM,EAAM,CACZ,IAAK,aACH,OAAO,IAAIP,GAAUC,CAAK,EAC5B,IAAK,aACH,OAAO,IAAIE,GAAUF,CAAK,EAC5B,IAAK,YACH,OAAO,IAAIG,GAASH,CAAK,EAC3B,IAAK,YACH,OAAO,IAAII,GAASJ,CAAK,EAC3B,IAAK,cACH,OAAO,IAAIK,GAAYL,CAAK,EAC9B,QACE,MAAM,IAAI,MAAMA,CAAK,CACzB,CACF,ICvDA,IAAAO,GAAAC,EAAA,CAAAC,GAAAC,KAAA,UAASC,GAAIC,EAAMC,EAAO,CACxB,KAAK,KAAOD,EACZ,KAAK,MAAQC,EAEb,KAAK,MAAQ,SAASC,EAAS,CAC7B,OAAOF,EAAK,MAAME,CAAO,GAAKD,EAAM,MAAMC,CAAO,CACnD,CACF,CAEA,SAASC,GAAGH,EAAMC,EAAO,CACvB,KAAK,KAAOD,EACZ,KAAK,MAAQC,EAEb,KAAK,MAAQ,SAASC,EAAS,CAC7B,OAAOF,EAAK,MAAME,CAAO,GAAKD,EAAM,MAAMC,CAAO,CACnD,CACF,CAEAJ,GAAO,QAAU,SAAkBM,EAAMJ,EAAMC,EAAO,CACpD,OAAQG,EAAM,CACZ,IAAK,MACH,OAAO,IAAIL,GAAIC,EAAMC,CAAK,EAC5B,IAAK,IACH,OAAO,IAAIE,GAAGH,EAAMC,CAAK,EAC3B,QACE,MAAM,IAAI,MAAM,KAAK,CACzB,CACF,IC3BA,IAAAI,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAIC,GAAQ,KACRC,GAAW,KAEXC,GAAU,QACVC,GAAU,YACVC,GAAa,KACbC,GAAQ,IACRC,GAAQ,IACRC,GAAM,OACNC,GAAK,IAET,SAASC,GAAUC,EAAO,CAIxB,QAHIC,EAAU,EACVC,EAAS,CAAC,EAEPD,EAAUD,EAAM,QAAQ,CAC7B,IAAIG,EAAOH,EAAMC,CAAO,EAExB,GAAIH,GAAG,KAAKK,CAAI,EAEd,IADAA,EAAOH,EAAM,EAAEC,CAAO,EACfR,GAAQ,KAAKU,CAAI,GAAKA,IAAS,QACpCA,EAAOH,EAAM,EAAEC,CAAO,EAI1B,GAAIP,GAAW,KAAKS,CAAI,GAAKA,IAAS,KAAOA,IAAS,IAAK,CACzDF,IACA,QACF,CAEA,GAAIN,GAAM,KAAKQ,CAAI,GAAKP,GAAM,KAAKO,CAAI,EAAG,CACxCF,IACAC,EAAO,KAAK,CAAE,KAAM,WAAY,MAAOC,CAAK,CAAC,EAC7C,QACF,CAEA,GAAIX,GAAQ,KAAKW,CAAI,EAAG,CAEtB,QADIC,EAAQ,GACLZ,GAAQ,KAAKW,CAAI,GACtBC,GAASD,EACTA,EAAOH,EAAM,EAAEC,CAAO,EAGxBC,EAAO,KAAK,CAAE,KAAM,SAAU,MAAOE,CAAM,CAAC,EAC5C,QACF,CAEA,GAAIX,GAAQ,KAAKU,CAAI,EAAG,CAEtB,QADIC,EAAQ,GACLX,GAAQ,KAAKU,CAAI,GAAKA,IAAS,QACpCC,GAASD,EACTA,EAAOH,EAAM,EAAEC,CAAO,EAEpBJ,GAAI,KAAKO,CAAK,EAChBF,EAAO,KAAK,CAAE,KAAM,WAAY,MAAOE,CAAM,CAAC,EAE9CF,EAAO,KAAK,CAAE,KAAM,UAAW,MAAOE,CAAM,CAAC,EAG/C,QACF,CAEA,MAAM,IAAI,UACR,kDAAoDD,CACtD,CACF,CAEA,OAAOD,CACT,CAEA,SAASG,GAAOH,EAAQ,CAItB,QAHII,EAAS,CAAC,EACVC,EAAQ,CAAC,EAENL,EAAO,OAAS,GAAG,CACxB,IAAIM,EAAQN,EAAO,MAAM,EAEzB,GAAIM,EAAM,OAAS,UAAYA,EAAM,OAAS,UAAW,CACvDF,EAAO,KAAKE,CAAK,EACjB,QACF,CAEA,GAAIA,EAAM,OAAS,WAAY,CAC7B,GAAIb,GAAM,KAAKa,EAAM,KAAK,EAAG,CAC3BA,EAAQ,CAAE,KAAM,QAAS,IAAKF,EAAO,IAAI,EAAG,MAAOJ,EAAO,MAAM,CAAE,EAClEI,EAAO,KAAKE,CAAK,EACjB,QACF,CAEA,KAAOD,EAAM,OAAS,GACpBD,EAAO,QAAQC,EAAM,IAAI,CAAC,EAE5BA,EAAM,KAAKC,CAAK,CAClB,CACF,CAEA,KAAOD,EAAM,OAAS,GACpBD,EAAO,QAAQC,EAAM,IAAI,CAAC,EAG5B,SAASE,GAAO,CACd,IAAIC,EAAOJ,EAAO,MAAM,EAExB,GAAII,EAAK,OAAS,SAChB,OAAO,SAASA,EAAK,KAAK,EAG5B,GAAIA,EAAK,OAAS,UAChB,OAAOA,EAAK,MAGd,GAAIA,EAAK,OAAS,WAAY,CAC5B,IAAIC,EAAIF,EAAK,EACTG,EAAIH,EAAK,EAEb,OAAOlB,GAASmB,EAAK,MAAOC,EAAGC,CAAC,CAClC,CAEA,GAAIF,EAAK,OAAS,QAAS,CACzB,IAAIC,EAAID,EAAK,IAAI,MACbE,EAAIF,EAAK,MAAM,MAEnB,OAAOpB,GAAMqB,EAAGC,CAAC,CACnB,CACF,CAEA,OAAOH,EAAK,CACd,CAEApB,GAAO,QAAU,CACf,MAAO,SAASwB,EAAO,CACrB,IAAIX,EAASH,GAAUc,CAAK,EACxBC,EAAMT,GAAOH,CAAM,EACvB,OAAOY,CACT,CACF,ICvIA,IAAAC,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAIC,GAAS,KAEbD,GAAO,QAAU,SAASE,EAASC,EAAS,CAC1C,IAAIC,EAAS,CAAC,EAEd,cAAO,KAAKF,CAAO,EAAE,QAAQ,SAASG,EAAO,CACvCJ,GAAO,MAAMI,CAAK,EAAE,MAAMF,CAAO,GACnC,OAAO,OAAOC,EAAQF,EAAQG,CAAK,CAAC,CAExC,CAAC,EAEMD,CACT,ICZA,IAAAE,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CAGA,IAAIC,GAAW,SAASC,EAAKC,EAAYC,EAAU,CAEjD,GAAIF,GAAO,KACT,MAAO,CAAC,EAAG,EAAG,CAAC,EAGjB,IAAIG,GAAU,EAAI,KAAK,IAAK,EAAID,EAAa,CAAC,GAAKD,EAC/CG,EAAWJ,EAAM,GACjBK,EAAkBF,GAAU,EAAI,KAAK,IAAKC,EAAW,EAAK,CAAC,GAE/DA,EAAW,KAAK,MAAMA,CAAQ,EAC9B,IAAIE,EACAC,EACAC,EAEAJ,IAAa,GACfE,EAAMH,EACNI,EAAQF,EACRG,EAAO,GACCJ,IAAa,GACrBE,EAAMD,EACNE,EAAQJ,EACRK,EAAO,GACCJ,IAAa,GACrBE,EAAM,EACNC,EAAQJ,EACRK,EAAOH,GACCD,IAAa,GACrBE,EAAM,EACNC,EAAQF,EACRG,EAAOL,GACCC,IAAa,GACrBE,EAAMD,EACNE,EAAQ,EACRC,EAAOL,GACCC,IAAa,IACrBE,EAAMH,EACNI,EAAQ,EACRC,EAAOH,GAGT,IAAII,EAAsBP,EAAaC,EAAS,EAChD,OAAAG,GAAOG,EACPF,GAASE,EACTD,GAAQC,EAED,CACH,KAAK,IAAI,KAAK,MAAMH,EAAM,GAAG,CAAC,EAC9B,KAAK,IAAI,KAAK,MAAMC,EAAQ,GAAG,CAAC,EAChC,KAAK,IAAI,KAAK,MAAMC,EAAO,GAAG,CAAC,CACnC,CAEF,EAEAV,GAAO,QAAUC,KCzDjB,IAAAW,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CAEA,IAAIC,GAAQ,KASZ,SAASC,GAAKC,EAAKC,EAAG,CACpB,OAAQD,EAAMC,EAAKA,EAAID,CACzB,CAEA,SAASE,GAAKF,EAAKC,EAAG,CACpB,OAAQD,EAAMC,EAAKA,EAAID,CACzB,CAEA,SAASG,GAAOH,EAAK,CAKnB,IAHAA,EAAMD,GAAIC,EAAK,GAAG,EAClBA,EAAME,GAAIF,EAAK,IAAI,EAEZA,EAAM,GAAKA,GAAO,IACzB,KAAOA,EAAM,KAAOA,GAAO,IAC3B,OAAOA,CACT,CAIA,SAASI,GAAKC,EAAKC,EAAYC,EAAY,CAEzCF,EAAMF,GAAME,CAAG,EAGfC,EAAaJ,GAAIH,GAAIO,EAAY,GAAG,EAAG,CAAC,EACxCC,EAAaL,GAAIH,GAAIQ,EAAY,GAAG,EAAG,CAAC,EAGxCD,GAAc,IACdC,GAAc,IAGd,IAAIC,EAAMV,GAAMO,EAAKC,EAAYC,CAAU,EAK3C,MAAO,IAAMC,EACV,IAAI,SAAUP,EAAG,CAChB,OAAQ,IAAMA,GAAG,SAAS,EAAE,EAAE,OAAO,EAAE,CACzC,CAAC,EACA,KAAK,EAAE,CACZ,CAIAJ,GAAO,QAAUO,KC1DjB,IAAAK,GAAAC,EAAA,CAAAC,GAAAC,KAAA,cAEAA,GAAO,QAAU,CAChB,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,aAAgB,CAAC,IAAK,IAAK,GAAG,EAC9B,KAAQ,CAAC,EAAG,IAAK,GAAG,EACpB,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,MAAS,CAAC,IAAK,IAAK,GAAG,EACvB,MAAS,CAAC,IAAK,IAAK,GAAG,EACvB,OAAU,CAAC,IAAK,IAAK,GAAG,EACxB,MAAS,CAAC,EAAG,EAAG,CAAC,EACjB,eAAkB,CAAC,IAAK,IAAK,GAAG,EAChC,KAAQ,CAAC,EAAG,EAAG,GAAG,EAClB,WAAc,CAAC,IAAK,GAAI,GAAG,EAC3B,MAAS,CAAC,IAAK,GAAI,EAAE,EACrB,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,UAAa,CAAC,GAAI,IAAK,GAAG,EAC1B,WAAc,CAAC,IAAK,IAAK,CAAC,EAC1B,UAAa,CAAC,IAAK,IAAK,EAAE,EAC1B,MAAS,CAAC,IAAK,IAAK,EAAE,EACtB,eAAkB,CAAC,IAAK,IAAK,GAAG,EAChC,SAAY,CAAC,IAAK,IAAK,GAAG,EAC1B,QAAW,CAAC,IAAK,GAAI,EAAE,EACvB,KAAQ,CAAC,EAAG,IAAK,GAAG,EACpB,SAAY,CAAC,EAAG,EAAG,GAAG,EACtB,SAAY,CAAC,EAAG,IAAK,GAAG,EACxB,cAAiB,CAAC,IAAK,IAAK,EAAE,EAC9B,SAAY,CAAC,IAAK,IAAK,GAAG,EAC1B,UAAa,CAAC,EAAG,IAAK,CAAC,EACvB,SAAY,CAAC,IAAK,IAAK,GAAG,EAC1B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,YAAe,CAAC,IAAK,EAAG,GAAG,EAC3B,eAAkB,CAAC,GAAI,IAAK,EAAE,EAC9B,WAAc,CAAC,IAAK,IAAK,CAAC,EAC1B,WAAc,CAAC,IAAK,GAAI,GAAG,EAC3B,QAAW,CAAC,IAAK,EAAG,CAAC,EACrB,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,aAAgB,CAAC,IAAK,IAAK,GAAG,EAC9B,cAAiB,CAAC,GAAI,GAAI,GAAG,EAC7B,cAAiB,CAAC,GAAI,GAAI,EAAE,EAC5B,cAAiB,CAAC,GAAI,GAAI,EAAE,EAC5B,cAAiB,CAAC,EAAG,IAAK,GAAG,EAC7B,WAAc,CAAC,IAAK,EAAG,GAAG,EAC1B,SAAY,CAAC,IAAK,GAAI,GAAG,EACzB,YAAe,CAAC,EAAG,IAAK,GAAG,EAC3B,QAAW,CAAC,IAAK,IAAK,GAAG,EACzB,QAAW,CAAC,IAAK,IAAK,GAAG,EACzB,WAAc,CAAC,GAAI,IAAK,GAAG,EAC3B,UAAa,CAAC,IAAK,GAAI,EAAE,EACzB,YAAe,CAAC,IAAK,IAAK,GAAG,EAC7B,YAAe,CAAC,GAAI,IAAK,EAAE,EAC3B,QAAW,CAAC,IAAK,EAAG,GAAG,EACvB,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,KAAQ,CAAC,IAAK,IAAK,CAAC,EACpB,UAAa,CAAC,IAAK,IAAK,EAAE,EAC1B,KAAQ,CAAC,IAAK,IAAK,GAAG,EACtB,MAAS,CAAC,EAAG,IAAK,CAAC,EACnB,YAAe,CAAC,IAAK,IAAK,EAAE,EAC5B,KAAQ,CAAC,IAAK,IAAK,GAAG,EACtB,SAAY,CAAC,IAAK,IAAK,GAAG,EAC1B,QAAW,CAAC,IAAK,IAAK,GAAG,EACzB,UAAa,CAAC,IAAK,GAAI,EAAE,EACzB,OAAU,CAAC,GAAI,EAAG,GAAG,EACrB,MAAS,CAAC,IAAK,IAAK,GAAG,EACvB,MAAS,CAAC,IAAK,IAAK,GAAG,EACvB,SAAY,CAAC,IAAK,IAAK,GAAG,EAC1B,cAAiB,CAAC,IAAK,IAAK,GAAG,EAC/B,UAAa,CAAC,IAAK,IAAK,CAAC,EACzB,aAAgB,CAAC,IAAK,IAAK,GAAG,EAC9B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,qBAAwB,CAAC,IAAK,IAAK,GAAG,EACtC,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,YAAe,CAAC,IAAK,IAAK,GAAG,EAC7B,cAAiB,CAAC,GAAI,IAAK,GAAG,EAC9B,aAAgB,CAAC,IAAK,IAAK,GAAG,EAC9B,eAAkB,CAAC,IAAK,IAAK,GAAG,EAChC,eAAkB,CAAC,IAAK,IAAK,GAAG,EAChC,eAAkB,CAAC,IAAK,IAAK,GAAG,EAChC,YAAe,CAAC,IAAK,IAAK,GAAG,EAC7B,KAAQ,CAAC,EAAG,IAAK,CAAC,EAClB,UAAa,CAAC,GAAI,IAAK,EAAE,EACzB,MAAS,CAAC,IAAK,IAAK,GAAG,EACvB,QAAW,CAAC,IAAK,EAAG,GAAG,EACvB,OAAU,CAAC,IAAK,EAAG,CAAC,EACpB,iBAAoB,CAAC,IAAK,IAAK,GAAG,EAClC,WAAc,CAAC,EAAG,EAAG,GAAG,EACxB,aAAgB,CAAC,IAAK,GAAI,GAAG,EAC7B,aAAgB,CAAC,IAAK,IAAK,GAAG,EAC9B,eAAkB,CAAC,GAAI,IAAK,GAAG,EAC/B,gBAAmB,CAAC,IAAK,IAAK,GAAG,EACjC,kBAAqB,CAAC,EAAG,IAAK,GAAG,EACjC,gBAAmB,CAAC,GAAI,IAAK,GAAG,EAChC,gBAAmB,CAAC,IAAK,GAAI,GAAG,EAChC,aAAgB,CAAC,GAAI,GAAI,GAAG,EAC5B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,SAAY,CAAC,IAAK,IAAK,GAAG,EAC1B,YAAe,CAAC,IAAK,IAAK,GAAG,EAC7B,KAAQ,CAAC,EAAG,EAAG,GAAG,EAClB,QAAW,CAAC,IAAK,IAAK,GAAG,EACzB,MAAS,CAAC,IAAK,IAAK,CAAC,EACrB,UAAa,CAAC,IAAK,IAAK,EAAE,EAC1B,OAAU,CAAC,IAAK,IAAK,CAAC,EACtB,UAAa,CAAC,IAAK,GAAI,CAAC,EACxB,OAAU,CAAC,IAAK,IAAK,GAAG,EACxB,cAAiB,CAAC,IAAK,IAAK,GAAG,EAC/B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,cAAiB,CAAC,IAAK,IAAK,GAAG,EAC/B,cAAiB,CAAC,IAAK,IAAK,GAAG,EAC/B,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,KAAQ,CAAC,IAAK,IAAK,EAAE,EACrB,KAAQ,CAAC,IAAK,IAAK,GAAG,EACtB,KAAQ,CAAC,IAAK,IAAK,GAAG,EACtB,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,OAAU,CAAC,IAAK,EAAG,GAAG,EACtB,cAAiB,CAAC,IAAK,GAAI,GAAG,EAC9B,IAAO,CAAC,IAAK,EAAG,CAAC,EACjB,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,UAAa,CAAC,GAAI,IAAK,GAAG,EAC1B,YAAe,CAAC,IAAK,GAAI,EAAE,EAC3B,OAAU,CAAC,IAAK,IAAK,GAAG,EACxB,WAAc,CAAC,IAAK,IAAK,EAAE,EAC3B,SAAY,CAAC,GAAI,IAAK,EAAE,EACxB,SAAY,CAAC,IAAK,IAAK,GAAG,EAC1B,OAAU,CAAC,IAAK,GAAI,EAAE,EACtB,OAAU,CAAC,IAAK,IAAK,GAAG,EACxB,QAAW,CAAC,IAAK,IAAK,GAAG,EACzB,UAAa,CAAC,IAAK,GAAI,GAAG,EAC1B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,UAAa,CAAC,IAAK,IAAK,GAAG,EAC3B,KAAQ,CAAC,IAAK,IAAK,GAAG,EACtB,YAAe,CAAC,EAAG,IAAK,GAAG,EAC3B,UAAa,CAAC,GAAI,IAAK,GAAG,EAC1B,IAAO,CAAC,IAAK,IAAK,GAAG,EACrB,KAAQ,CAAC,EAAG,IAAK,GAAG,EACpB,QAAW,CAAC,IAAK,IAAK,GAAG,EACzB,OAAU,CAAC,IAAK,GAAI,EAAE,EACtB,UAAa,CAAC,GAAI,IAAK,GAAG,EAC1B,OAAU,CAAC,IAAK,IAAK,GAAG,EACxB,MAAS,CAAC,IAAK,IAAK,GAAG,EACvB,MAAS,CAAC,IAAK,IAAK,GAAG,EACvB,WAAc,CAAC,IAAK,IAAK,GAAG,EAC5B,OAAU,CAAC,IAAK,IAAK,CAAC,EACtB,YAAe,CAAC,IAAK,IAAK,EAAE,CAC7B,ICvJA,IAAAC,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CAAAA,GAAO,QAAU,SAAoBC,EAAK,CACzC,MAAI,CAACA,GAAO,OAAOA,GAAQ,SACnB,GAGDA,aAAe,OAAS,MAAM,QAAQA,CAAG,GAC9CA,EAAI,QAAU,IAAMA,EAAI,kBAAkB,UACzC,OAAO,yBAAyBA,EAAMA,EAAI,OAAS,CAAE,GAAKA,EAAI,YAAY,OAAS,SACvF,ICRA,IAAAC,GAAAC,EAAA,CAAAC,GAAAC,KAAA,cAEA,IAAIC,GAAa,KAEbC,GAAS,MAAM,UAAU,OACzBC,GAAQ,MAAM,UAAU,MAExBC,GAAUJ,GAAO,QAAU,SAAiBK,EAAM,CAGrD,QAFIC,EAAU,CAAC,EAENC,EAAI,EAAGC,EAAMH,EAAK,OAAQE,EAAIC,EAAKD,IAAK,CAChD,IAAIE,EAAMJ,EAAKE,CAAC,EAEZN,GAAWQ,CAAG,EAEjBH,EAAUJ,GAAO,KAAKI,EAASH,GAAM,KAAKM,CAAG,CAAC,EAE9CH,EAAQ,KAAKG,CAAG,CAElB,CAEA,OAAOH,CACR,EAEAF,GAAQ,KAAO,SAAUM,EAAI,CAC5B,OAAO,UAAY,CAClB,OAAOA,EAAGN,GAAQ,SAAS,CAAC,CAC7B,CACD,IC5BA,IAAAO,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CACA,IAAIC,GAAa,KACbC,GAAU,KACVC,GAAiB,OAAO,eAExBC,GAAe,OAAO,OAAO,IAAI,EAGrC,IAASC,MAAQJ,GACZE,GAAe,KAAKF,GAAYI,EAAI,IACvCD,GAAaH,GAAWI,EAAI,CAAC,EAAIA,IAF1B,IAAAA,GAMLC,GAAKN,GAAO,QAAU,CACzB,GAAI,CAAC,EACL,IAAK,CAAC,CACP,EAEAM,GAAG,IAAM,SAAUC,EAAQ,CAC1B,IAAIC,EAASD,EAAO,UAAU,EAAG,CAAC,EAAE,YAAY,EAC5CE,EACAC,EACJ,OAAQF,EAAQ,CACf,IAAK,MACJC,EAAMH,GAAG,IAAI,IAAIC,CAAM,EACvBG,EAAQ,MACR,MACD,IAAK,MACJD,EAAMH,GAAG,IAAI,IAAIC,CAAM,EACvBG,EAAQ,MACR,MACD,QACCD,EAAMH,GAAG,IAAI,IAAIC,CAAM,EACvBG,EAAQ,MACR,KACF,CAEA,OAAKD,EAIE,CAAC,MAAOC,EAAO,MAAOD,CAAG,EAHxB,IAIT,EAEAH,GAAG,IAAI,IAAM,SAAUC,EAAQ,CAC9B,GAAI,CAACA,EACJ,OAAO,KAGR,IAAII,EAAO,sBACPC,EAAM,kCACNC,EAAO,+HACPC,EAAM,uHACNC,EAAU,UAEVC,EAAM,CAAC,EAAG,EAAG,EAAG,CAAC,EACjBC,EACAC,EACAC,EAEJ,GAAIF,EAAQV,EAAO,MAAMK,CAAG,EAAG,CAI9B,IAHAO,EAAWF,EAAM,CAAC,EAClBA,EAAQA,EAAM,CAAC,EAEVC,EAAI,EAAGA,EAAI,EAAGA,IAAK,CAEvB,IAAIE,EAAKF,EAAI,EACbF,EAAIE,CAAC,EAAI,SAASD,EAAM,MAAMG,EAAIA,EAAK,CAAC,EAAG,EAAE,CAC9C,CAEID,IACHH,EAAI,CAAC,EAAI,SAASG,EAAU,EAAE,EAAI,IAEpC,SAAWF,EAAQV,EAAO,MAAMI,CAAI,EAAG,CAItC,IAHAM,EAAQA,EAAM,CAAC,EACfE,EAAWF,EAAM,CAAC,EAEbC,EAAI,EAAGA,EAAI,EAAGA,IAClBF,EAAIE,CAAC,EAAI,SAASD,EAAMC,CAAC,EAAID,EAAMC,CAAC,EAAG,EAAE,EAGtCC,IACHH,EAAI,CAAC,EAAI,SAASG,EAAWA,EAAU,EAAE,EAAI,IAE/C,SAAWF,EAAQV,EAAO,MAAMM,CAAI,EAAG,CACtC,IAAKK,EAAI,EAAGA,EAAI,EAAGA,IAClBF,EAAIE,CAAC,EAAI,SAASD,EAAMC,EAAI,CAAC,EAAG,CAAC,EAG9BD,EAAM,CAAC,IACNA,EAAM,CAAC,EACVD,EAAI,CAAC,EAAI,WAAWC,EAAM,CAAC,CAAC,EAAI,IAEhCD,EAAI,CAAC,EAAI,WAAWC,EAAM,CAAC,CAAC,EAG/B,SAAWA,EAAQV,EAAO,MAAMO,CAAG,EAAG,CACrC,IAAKI,EAAI,EAAGA,EAAI,EAAGA,IAClBF,EAAIE,CAAC,EAAI,KAAK,MAAM,WAAWD,EAAMC,EAAI,CAAC,CAAC,EAAI,IAAI,EAGhDD,EAAM,CAAC,IACNA,EAAM,CAAC,EACVD,EAAI,CAAC,EAAI,WAAWC,EAAM,CAAC,CAAC,EAAI,IAEhCD,EAAI,CAAC,EAAI,WAAWC,EAAM,CAAC,CAAC,EAG/B,KAAO,QAAIA,EAAQV,EAAO,MAAMQ,CAAO,GAClCE,EAAM,CAAC,IAAM,cACT,CAAC,EAAG,EAAG,EAAG,CAAC,EAGdd,GAAe,KAAKF,GAAYgB,EAAM,CAAC,CAAC,GAI7CD,EAAMf,GAAWgB,EAAM,CAAC,CAAC,EACzBD,EAAI,CAAC,EAAI,EAEFA,GANC,KAQD,KAGR,IAAKE,EAAI,EAAGA,EAAI,EAAGA,IAClBF,EAAIE,CAAC,EAAIG,GAAML,EAAIE,CAAC,EAAG,EAAG,GAAG,EAE9B,OAAAF,EAAI,CAAC,EAAIK,GAAML,EAAI,CAAC,EAAG,EAAG,CAAC,EAEpBA,CACR,EAEAV,GAAG,IAAI,IAAM,SAAUC,EAAQ,CAC9B,GAAI,CAACA,EACJ,OAAO,KAGR,IAAIe,EAAM,+KACNL,EAAQV,EAAO,MAAMe,CAAG,EAE5B,GAAIL,EAAO,CACV,IAAIM,EAAQ,WAAWN,EAAM,CAAC,CAAC,EAC3BO,GAAM,WAAWP,EAAM,CAAC,CAAC,EAAI,IAAO,KAAO,IAC3CQ,EAAIJ,GAAM,WAAWJ,EAAM,CAAC,CAAC,EAAG,EAAG,GAAG,EACtCS,EAAIL,GAAM,WAAWJ,EAAM,CAAC,CAAC,EAAG,EAAG,GAAG,EACtC,EAAII,GAAM,MAAME,CAAK,EAAI,EAAIA,EAAO,EAAG,CAAC,EAE5C,MAAO,CAACC,EAAGC,EAAGC,EAAG,CAAC,CACnB,CAEA,OAAO,IACR,EAEApB,GAAG,IAAI,IAAM,SAAUC,EAAQ,CAC9B,GAAI,CAACA,EACJ,OAAO,KAGR,IAAIoB,EAAM,sKACNV,EAAQV,EAAO,MAAMoB,CAAG,EAE5B,GAAIV,EAAO,CACV,IAAIM,EAAQ,WAAWN,EAAM,CAAC,CAAC,EAC3BO,GAAM,WAAWP,EAAM,CAAC,CAAC,EAAI,IAAO,KAAO,IAC3CW,EAAIP,GAAM,WAAWJ,EAAM,CAAC,CAAC,EAAG,EAAG,GAAG,EACtCY,EAAIR,GAAM,WAAWJ,EAAM,CAAC,CAAC,EAAG,EAAG,GAAG,EACtC,EAAII,GAAM,MAAME,CAAK,EAAI,EAAIA,EAAO,EAAG,CAAC,EAC5C,MAAO,CAACC,EAAGI,EAAGC,EAAG,CAAC,CACnB,CAEA,OAAO,IACR,EAEAvB,GAAG,GAAG,IAAM,UAAY,CACvB,IAAIO,EAAOX,GAAQ,SAAS,EAE5B,MACC,IACA4B,GAAUjB,EAAK,CAAC,CAAC,EACjBiB,GAAUjB,EAAK,CAAC,CAAC,EACjBiB,GAAUjB,EAAK,CAAC,CAAC,GAChBA,EAAK,CAAC,EAAI,EACPiB,GAAU,KAAK,MAAMjB,EAAK,CAAC,EAAI,GAAG,CAAC,EACpC,GAEL,EAEAP,GAAG,GAAG,IAAM,UAAY,CACvB,IAAIO,EAAOX,GAAQ,SAAS,EAE5B,OAAOW,EAAK,OAAS,GAAKA,EAAK,CAAC,IAAM,EACnC,OAAS,KAAK,MAAMA,EAAK,CAAC,CAAC,EAAI,KAAO,KAAK,MAAMA,EAAK,CAAC,CAAC,EAAI,KAAO,KAAK,MAAMA,EAAK,CAAC,CAAC,EAAI,IACzF,QAAU,KAAK,MAAMA,EAAK,CAAC,CAAC,EAAI,KAAO,KAAK,MAAMA,EAAK,CAAC,CAAC,EAAI,KAAO,KAAK,MAAMA,EAAK,CAAC,CAAC,EAAI,KAAOA,EAAK,CAAC,EAAI,GAC/G,EAEAP,GAAG,GAAG,IAAI,QAAU,UAAY,CAC/B,IAAIO,EAAOX,GAAQ,SAAS,EAExB6B,EAAI,KAAK,MAAMlB,EAAK,CAAC,EAAI,IAAM,GAAG,EAClCmB,EAAI,KAAK,MAAMnB,EAAK,CAAC,EAAI,IAAM,GAAG,EAClCgB,EAAI,KAAK,MAAMhB,EAAK,CAAC,EAAI,IAAM,GAAG,EAEtC,OAAOA,EAAK,OAAS,GAAKA,EAAK,CAAC,IAAM,EACnC,OAASkB,EAAI,MAAQC,EAAI,MAAQH,EAAI,KACrC,QAAUE,EAAI,MAAQC,EAAI,MAAQH,EAAI,MAAQhB,EAAK,CAAC,EAAI,GAC5D,EAEAP,GAAG,GAAG,IAAM,UAAY,CACvB,IAAI2B,EAAO/B,GAAQ,SAAS,EAC5B,OAAO+B,EAAK,OAAS,GAAKA,EAAK,CAAC,IAAM,EACnC,OAASA,EAAK,CAAC,EAAI,KAAOA,EAAK,CAAC,EAAI,MAAQA,EAAK,CAAC,EAAI,KACtD,QAAUA,EAAK,CAAC,EAAI,KAAOA,EAAK,CAAC,EAAI,MAAQA,EAAK,CAAC,EAAI,MAAQA,EAAK,CAAC,EAAI,GAC7E,EAIA3B,GAAG,GAAG,IAAM,UAAY,CACvB,IAAI4B,EAAOhC,GAAQ,SAAS,EAExBiC,EAAI,GACR,OAAID,EAAK,QAAU,GAAKA,EAAK,CAAC,IAAM,IACnCC,EAAI,KAAOD,EAAK,CAAC,GAGX,OAASA,EAAK,CAAC,EAAI,KAAOA,EAAK,CAAC,EAAI,MAAQA,EAAK,CAAC,EAAI,IAAMC,EAAI,GACxE,EAEA7B,GAAG,GAAG,QAAU,SAAUU,EAAK,CAC9B,OAAOZ,GAAaY,EAAI,MAAM,EAAG,CAAC,CAAC,CACpC,EAGA,SAASK,GAAMe,EAAKC,EAAKC,EAAK,CAC7B,OAAO,KAAK,IAAI,KAAK,IAAID,EAAKD,CAAG,EAAGE,CAAG,CACxC,CAEA,SAASR,GAAUM,EAAK,CACvB,IAAIG,EAAM,KAAK,MAAMH,CAAG,EAAE,SAAS,EAAE,EAAE,YAAY,EACnD,OAAQG,EAAI,OAAS,EAAK,IAAMA,EAAMA,CACvC,ICjPA,IAAAC,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAIC,GAAkB,GAClBC,GAAmB,GACnBC,GAAc,GACdC,GAAc,GACdC,GAAY,GACZC,GAAQ,GACRC,GAAQ,GACRC,GAAQ,GACRC,GAAO,GACPC,GAAS,IACTC,GAAS,GACTC,GAAO,GACPC,GAAiB,iBAErBb,GAAO,QAAU,SAASc,EAAO,CAuB/B,QAtBIC,EAAS,CAAC,EACVC,EAAQF,EAERG,EACFC,EACAC,EACAC,EACAC,EACAC,EACAC,EACAC,EACEC,EAAM,EACNC,EAAOV,EAAM,WAAWS,CAAG,EAC3BE,EAAMX,EAAM,OACZY,EAAQ,CAAC,CAAE,MAAOb,CAAO,CAAC,EAC1Bc,EAAW,EACXC,EAEAC,EAAO,GACPC,EAAS,GACTC,EAAQ,GAELR,EAAME,GAEX,GAAID,GAAQ,GAAI,CACdT,EAAOQ,EACP,GACER,GAAQ,EACRS,EAAOV,EAAM,WAAWC,CAAI,QACrBS,GAAQ,IACjBN,EAAQJ,EAAM,MAAMS,EAAKR,CAAI,EAE7BE,EAAOJ,EAAOA,EAAO,OAAS,CAAC,EAC3BW,IAASxB,IAAoB2B,EAC/BI,EAAQb,EACCD,GAAQA,EAAK,OAAS,OAC/BA,EAAK,MAAQC,EACbD,EAAK,gBAAkBC,EAAM,QAE7BM,IAASnB,IACTmB,IAASlB,IACRkB,IAASpB,IACRU,EAAM,WAAWC,EAAO,CAAC,IAAMR,KAC9B,CAACqB,GACCA,GAAUA,EAAO,OAAS,YAAcA,EAAO,QAAU,QAE9DE,EAASZ,EAETL,EAAO,KAAK,CACV,KAAM,QACN,YAAaU,EACb,eAAgBR,EAChB,MAAOG,CACT,CAAC,EAGHK,EAAMR,CAGR,SAAWS,IAASvB,IAAeuB,IAAStB,GAAa,CACvDa,EAAOQ,EACPP,EAAQQ,IAASvB,GAAc,IAAM,IACrCiB,EAAQ,CACN,KAAM,SACN,YAAaK,EACb,MAAOP,CACT,EACA,EAGE,IAFAG,EAAS,GACTJ,EAAOD,EAAM,QAAQE,EAAOD,EAAO,CAAC,EAChC,CAACA,EAEH,IADAK,EAAYL,EACLD,EAAM,WAAWM,EAAY,CAAC,IAAMjB,IACzCiB,GAAa,EACbD,EAAS,CAACA,OAGZL,GAASE,EACTD,EAAOD,EAAM,OAAS,EACtBI,EAAM,SAAW,SAEZC,GACTD,EAAM,MAAQJ,EAAM,MAAMS,EAAM,EAAGR,CAAI,EACvCG,EAAM,eAAiBA,EAAM,SAAWH,EAAOA,EAAO,EACtDF,EAAO,KAAKK,CAAK,EACjBK,EAAMR,EAAO,EACbS,EAAOV,EAAM,WAAWS,CAAG,CAG7B,SAAWC,IAASpB,IAASU,EAAM,WAAWS,EAAM,CAAC,IAAMhB,GACzDQ,EAAOD,EAAM,QAAQ,KAAMS,CAAG,EAE9BL,EAAQ,CACN,KAAM,UACN,YAAaK,EACb,eAAgBR,EAAO,CACzB,EAEIA,IAAS,KACXG,EAAM,SAAW,GACjBH,EAAOD,EAAM,OACbI,EAAM,eAAiBH,GAGzBG,EAAM,MAAQJ,EAAM,MAAMS,EAAM,EAAGR,CAAI,EACvCF,EAAO,KAAKK,CAAK,EAEjBK,EAAMR,EAAO,EACbS,EAAOV,EAAM,WAAWS,CAAG,WAI1BC,IAASpB,IAASoB,IAASjB,KAC5BqB,GACAA,EAAO,OAAS,YAChBA,EAAO,QAAU,OAEjBV,EAAQJ,EAAMS,CAAG,EACjBV,EAAO,KAAK,CACV,KAAM,OACN,YAAaU,EAAMO,EAAO,OAC1B,eAAgBP,EAAML,EAAM,OAC5B,MAAOA,CACT,CAAC,EACDK,GAAO,EACPC,EAAOV,EAAM,WAAWS,CAAG,UAGlBC,IAASpB,IAASoB,IAASnB,IAASmB,IAASlB,GACtDY,EAAQJ,EAAMS,CAAG,EAEjBV,EAAO,KAAK,CACV,KAAM,MACN,YAAaU,EAAMO,EAAO,OAC1B,eAAgBP,EAAML,EAAM,OAC5B,MAAOA,EACP,OAAQY,EACR,MAAO,EACT,CAAC,EACDA,EAAS,GAETP,GAAO,EACPC,EAAOV,EAAM,WAAWS,CAAG,UAGlBxB,KAAoByB,EAAM,CAEnCT,EAAOQ,EACP,GACER,GAAQ,EACRS,EAAOV,EAAM,WAAWC,CAAI,QACrBS,GAAQ,IAUjB,GATAF,EAAqBC,EACrBL,EAAQ,CACN,KAAM,WACN,YAAaK,EAAMM,EAAK,OACxB,MAAOA,EACP,OAAQf,EAAM,MAAMQ,EAAqB,EAAGP,CAAI,CAClD,EACAQ,EAAMR,EAEFc,IAAS,OAASL,IAASvB,IAAeuB,IAAStB,GAAa,CAClEa,GAAQ,EACR,EAGE,IAFAI,EAAS,GACTJ,EAAOD,EAAM,QAAQ,IAAKC,EAAO,CAAC,EAC9B,CAACA,EAEH,IADAK,EAAYL,EACLD,EAAM,WAAWM,EAAY,CAAC,IAAMjB,IACzCiB,GAAa,EACbD,EAAS,CAACA,OAGZL,GAAS,IACTC,EAAOD,EAAM,OAAS,EACtBI,EAAM,SAAW,SAEZC,GAETE,EAAgBN,EAChB,GACEM,GAAiB,EACjBG,EAAOV,EAAM,WAAWO,CAAa,QAC9BG,GAAQ,IACbF,EAAqBD,GACnBE,IAAQF,EAAgB,EAC1BH,EAAM,MAAQ,CACZ,CACE,KAAM,OACN,YAAaK,EACb,eAAgBF,EAAgB,EAChC,MAAOP,EAAM,MAAMS,EAAKF,EAAgB,CAAC,CAC3C,CACF,EAEAH,EAAM,MAAQ,CAAC,EAEbA,EAAM,UAAYG,EAAgB,IAAMN,GAC1CG,EAAM,MAAQ,GACdA,EAAM,MAAM,KAAK,CACf,KAAM,QACN,YAAaG,EAAgB,EAC7B,eAAgBN,EAChB,MAAOD,EAAM,MAAMO,EAAgB,EAAGN,CAAI,CAC5C,CAAC,IAEDG,EAAM,MAAQJ,EAAM,MAAMO,EAAgB,EAAGN,CAAI,EACjDG,EAAM,eAAiBH,KAGzBG,EAAM,MAAQ,GACdA,EAAM,MAAQ,CAAC,GAEjBK,EAAMR,EAAO,EACbG,EAAM,eAAiBA,EAAM,SAAWH,EAAOQ,EAC/CC,EAAOV,EAAM,WAAWS,CAAG,EAC3BV,EAAO,KAAKK,CAAK,CACnB,MACES,GAAY,EACZT,EAAM,MAAQ,GACdA,EAAM,eAAiBK,EAAM,EAC7BV,EAAO,KAAKK,CAAK,EACjBQ,EAAM,KAAKR,CAAK,EAChBL,EAASK,EAAM,MAAQ,CAAC,EACxBU,EAASV,EAEXW,EAAO,EAGT,SAAW7B,KAAqBwB,GAAQG,EACtCJ,GAAO,EACPC,EAAOV,EAAM,WAAWS,CAAG,EAE3BK,EAAO,MAAQG,EACfH,EAAO,gBAAkBG,EAAM,OAC/BA,EAAQ,GACRJ,GAAY,EACZD,EAAMA,EAAM,OAAS,CAAC,EAAE,eAAiBH,EACzCG,EAAM,IAAI,EACVE,EAASF,EAAMC,CAAQ,EACvBd,EAASe,EAAO,UAGX,CACLb,EAAOQ,EACP,GACMC,IAASrB,KACXY,GAAQ,GAEVA,GAAQ,EACRS,EAAOV,EAAM,WAAWC,CAAI,QAE5BA,EAAOU,GACP,EACED,GAAQ,IACRA,IAASvB,IACTuB,IAAStB,IACTsB,IAASnB,IACTmB,IAASlB,IACTkB,IAASpB,IACToB,IAASzB,IACRyB,IAASjB,IACRqB,GACAA,EAAO,OAAS,YAChBA,EAAO,QAAU,QAClBJ,IAASpB,IACRwB,EAAO,OAAS,YAChBA,EAAO,QAAU,QAClBJ,IAASxB,IAAoB2B,IAGlCT,EAAQJ,EAAM,MAAMS,EAAKR,CAAI,EAEzBhB,KAAoByB,EACtBK,EAAOX,GAENV,KAAWU,EAAM,WAAW,CAAC,GAAKT,KAAWS,EAAM,WAAW,CAAC,IAChER,KAASQ,EAAM,WAAW,CAAC,GAC3BP,GAAe,KAAKO,EAAM,MAAM,CAAC,CAAC,EAElCL,EAAO,KAAK,CACV,KAAM,gBACN,YAAaU,EACb,eAAgBR,EAChB,MAAOG,CACT,CAAC,EAEDL,EAAO,KAAK,CACV,KAAM,OACN,YAAaU,EACb,eAAgBR,EAChB,MAAOG,CACT,CAAC,EAGHK,EAAMR,CACR,CAGF,IAAKQ,EAAMG,EAAM,OAAS,EAAGH,EAAKA,GAAO,EACvCG,EAAMH,CAAG,EAAE,SAAW,GACtBG,EAAMH,CAAG,EAAE,eAAiBT,EAAM,OAGpC,OAAOY,EAAM,CAAC,EAAE,KAClB,IChUA,IAAAM,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAIC,GAAQ,GACRC,GAAO,GACPC,GAAM,GACNC,GAAM,IACNC,GAAM,GAIV,SAASC,GAAWC,EAAO,CACzB,IAAIC,EAAOD,EAAM,WAAW,CAAC,EACzBE,EAEJ,GAAID,IAASN,IAAQM,IAASP,GAAO,CAGnC,GAFAQ,EAAWF,EAAM,WAAW,CAAC,EAEzBE,GAAY,IAAMA,GAAY,GAChC,MAAO,GAGT,IAAIC,EAAeH,EAAM,WAAW,CAAC,EAErC,OAAIE,IAAaN,IAAOO,GAAgB,IAAMA,GAAgB,EAKhE,CAEA,OAAIF,IAASL,IACXM,EAAWF,EAAM,WAAW,CAAC,EAEzBE,GAAY,IAAMA,GAAY,IAOhCD,GAAQ,IAAMA,GAAQ,EAK5B,CAIAR,GAAO,QAAU,SAASO,EAAO,CAC/B,IAAII,EAAM,EACNC,EAASL,EAAM,OACfC,EACAC,EACAC,EAEJ,GAAIE,IAAW,GAAK,CAACN,GAAWC,CAAK,EACnC,MAAO,GAST,IANAC,EAAOD,EAAM,WAAWI,CAAG,GAEvBH,IAASN,IAAQM,IAASP,KAC5BU,IAGKA,EAAMC,IACXJ,EAAOD,EAAM,WAAWI,CAAG,EAEvB,EAAAH,EAAO,IAAMA,EAAO,MAIxBG,GAAO,EAMT,GAHAH,EAAOD,EAAM,WAAWI,CAAG,EAC3BF,EAAWF,EAAM,WAAWI,EAAM,CAAC,EAE/BH,IAASL,IAAOM,GAAY,IAAMA,GAAY,GAGhD,IAFAE,GAAO,EAEAA,EAAMC,IACXJ,EAAOD,EAAM,WAAWI,CAAG,EAEvB,EAAAH,EAAO,IAAMA,EAAO,MAIxBG,GAAO,EAQX,GAJAH,EAAOD,EAAM,WAAWI,CAAG,EAC3BF,EAAWF,EAAM,WAAWI,EAAM,CAAC,EACnCD,EAAeH,EAAM,WAAWI,EAAM,CAAC,GAGpCH,IAASJ,IAAOI,IAASH,MACxBI,GAAY,IAAMA,GAAY,KAC5BA,IAAaP,IAAQO,IAAaR,KAClCS,GAAgB,IAChBA,GAAgB,IAIpB,IAFAC,GAAOF,IAAaP,IAAQO,IAAaR,GAAQ,EAAI,EAE9CU,EAAMC,IACXJ,EAAOD,EAAM,WAAWI,CAAG,EAEvB,EAAAH,EAAO,IAAMA,EAAO,MAIxBG,GAAO,EAIX,MAAO,CACL,OAAQJ,EAAM,MAAM,EAAGI,CAAG,EAC1B,KAAMJ,EAAM,MAAMI,CAAG,CACvB,CACF,ICvHA,IAAAE,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CAIAA,GAAO,QAAU,UAAY,CAC3B,OAAO,OAAO,SAAY,YAAc,QAAQ,WAAa,QAAQ,UAAU,IACjF,ICNA,IAAAC,GAAAC,EAAAC,IAAA,KAAIC,GACEC,GAAkB,CACtB,EACA,GAAI,GAAI,GAAI,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAC1C,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,KAC7C,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KACtD,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,IACxD,EAQAF,GAAQ,cAAgB,SAAwBG,EAAS,CACvD,GAAI,CAACA,EAAS,MAAM,IAAI,MAAM,uCAAuC,EACrE,GAAIA,EAAU,GAAKA,EAAU,GAAI,MAAM,IAAI,MAAM,2CAA2C,EAC5F,OAAOA,EAAU,EAAI,EACvB,EAQAH,GAAQ,wBAA0B,SAAkCG,EAAS,CAC3E,OAAOD,GAAgBC,CAAO,CAChC,EAQAH,GAAQ,YAAc,SAAUI,EAAM,CACpC,IAAIC,EAAQ,EAEZ,KAAOD,IAAS,GACdC,IACAD,KAAU,EAGZ,OAAOC,CACT,EAEAL,GAAQ,kBAAoB,SAA4BM,EAAG,CACzD,GAAI,OAAOA,GAAM,WACf,MAAM,IAAI,MAAM,uCAAuC,EAGzDL,GAAiBK,CACnB,EAEAN,GAAQ,mBAAqB,UAAY,CACvC,OAAO,OAAOC,GAAmB,GACnC,EAEAD,GAAQ,OAAS,SAAiBO,EAAO,CACvC,OAAON,GAAeM,CAAK,CAC7B,IC9DA,IAAAC,GAAAC,EAAAC,IAAA,CAAAA,GAAQ,EAAI,CAAE,IAAK,CAAE,EACrBA,GAAQ,EAAI,CAAE,IAAK,CAAE,EACrBA,GAAQ,EAAI,CAAE,IAAK,CAAE,EACrBA,GAAQ,EAAI,CAAE,IAAK,CAAE,EAErB,SAASC,GAAYC,EAAQ,CAC3B,GAAI,OAAOA,GAAW,SACpB,MAAM,IAAI,MAAM,uBAAuB,EAKzC,OAFcA,EAAO,YAAY,EAElB,CACb,IAAK,IACL,IAAK,MACH,OAAOF,GAAQ,EAEjB,IAAK,IACL,IAAK,SACH,OAAOA,GAAQ,EAEjB,IAAK,IACL,IAAK,WACH,OAAOA,GAAQ,EAEjB,IAAK,IACL,IAAK,OACH,OAAOA,GAAQ,EAEjB,QACE,MAAM,IAAI,MAAM,qBAAuBE,CAAM,CACjD,CACF,CAEAF,GAAQ,QAAU,SAAkBG,EAAO,CACzC,OAAOA,GAAS,OAAOA,EAAM,IAAQ,KACnCA,EAAM,KAAO,GAAKA,EAAM,IAAM,CAClC,EAEAH,GAAQ,KAAO,SAAeI,EAAOC,EAAc,CACjD,GAAIL,GAAQ,QAAQI,CAAK,EACvB,OAAOA,EAGT,GAAI,CACF,OAAOH,GAAWG,CAAK,CACzB,MAAY,CACV,OAAOC,CACT,CACF,ICjDA,IAAAC,GAAAC,EAAA,CAAAC,GAAAC,KAAA,UAASC,IAAa,CACpB,KAAK,OAAS,CAAC,EACf,KAAK,OAAS,CAChB,CAEAA,GAAU,UAAY,CAEpB,IAAK,SAAUC,EAAO,CACpB,IAAMC,EAAW,KAAK,MAAMD,EAAQ,CAAC,EACrC,OAAS,KAAK,OAAOC,CAAQ,IAAO,EAAID,EAAQ,EAAM,KAAO,CAC/D,EAEA,IAAK,SAAUE,EAAKC,EAAQ,CAC1B,QAASC,EAAI,EAAGA,EAAID,EAAQC,IAC1B,KAAK,QAASF,IAASC,EAASC,EAAI,EAAM,KAAO,CAAC,CAEtD,EAEA,gBAAiB,UAAY,CAC3B,OAAO,KAAK,MACd,EAEA,OAAQ,SAAUC,EAAK,CACrB,IAAMJ,EAAW,KAAK,MAAM,KAAK,OAAS,CAAC,EACvC,KAAK,OAAO,QAAUA,GACxB,KAAK,OAAO,KAAK,CAAC,EAGhBI,IACF,KAAK,OAAOJ,CAAQ,GAAM,MAAU,KAAK,OAAS,GAGpD,KAAK,QACP,CACF,EAEAH,GAAO,QAAUC,KCpCjB,IAAAO,GAAAC,EAAA,CAAAC,GAAAC,KAAA,CAKA,SAASC,GAAWC,EAAM,CACxB,GAAI,CAACA,GAAQA,EAAO,EAClB,MAAM,IAAI,MAAM,mDAAmD,EAGrE,KAAK,KAAOA,EACZ,KAAK,KAAO,IAAI,WAAWA,EAAOA,CAAI,EACtC,KAAK,YAAc,IAAI,WAAWA,EAAOA,CAAI,CAC/C,CAWAD,GAAU,UAAU,IAAM,SAAUE,EAAKC,EAAKC,EAAOC,EAAU,CAC7D,IAAMC,EAAQJ,EAAM,KAAK,KAAOC,EAChC,KAAK,KAAKG,CAAK,EAAIF,EACfC,IAAU,KAAK,YAAYC,CAAK,EAAI,GAC1C,EASAN,GAAU,UAAU,IAAM,SAAUE,EAAKC,EAAK,CAC5C,OAAO,KAAK,KAAKD,EAAM,KAAK,KAAOC,CAAG,CACxC,EAUAH,GAAU,UAAU,IAAM,SAAUE,EAAKC,EAAKC,EAAO,CACnD,KAAK,KAAKF,EAAM,KAAK,KAAOC,CAAG,GAAKC,CACtC,EASAJ,GAAU,UAAU,WAAa,SAAUE,EAAKC,EAAK,CACnD,OAAO,KAAK,YAAYD,EAAM,KAAK,KAAOC,CAAG,CAC/C,EAEAJ,GAAO,QAAUC,KChEjB,IAAAO,GAAAC,EAAAC,IAAA,CAUA,IAAMC,GAAgB,KAAmB,cAgBzCD,GAAQ,gBAAkB,SAA0BE,EAAS,CAC3D,GAAIA,IAAY,EAAG,MAAO,CAAC,EAE3B,IAAMC,EAAW,KAAK,MAAMD,EAAU,CAAC,EAAI,EACrCE,EAAOH,GAAcC,CAAO,EAC5BG,EAAYD,IAAS,IAAM,GAAK,KAAK,MAAMA,EAAO,KAAO,EAAID,EAAW,EAAE,EAAI,EAC9EG,EAAY,CAACF,EAAO,CAAC,EAE3B,QAASG,EAAI,EAAGA,EAAIJ,EAAW,EAAGI,IAChCD,EAAUC,CAAC,EAAID,EAAUC,EAAI,CAAC,EAAIF,EAGpC,OAAAC,EAAU,KAAK,CAAC,EAETA,EAAU,QAAQ,CAC3B,EAsBAN,GAAQ,aAAe,SAAuBE,EAAS,CACrD,IAAMM,EAAS,CAAC,EACVC,EAAMT,GAAQ,gBAAgBE,CAAO,EACrCQ,EAAYD,EAAI,OAEtB,QAASF,EAAI,EAAGA,EAAIG,EAAWH,IAC7B,QAASI,EAAI,EAAGA,EAAID,EAAWC,IAExBJ,IAAM,GAAKI,IAAM,GACjBJ,IAAM,GAAKI,IAAMD,EAAY,GAC7BH,IAAMG,EAAY,GAAKC,IAAM,GAIlCH,EAAO,KAAK,CAACC,EAAIF,CAAC,EAAGE,EAAIE,CAAC,CAAC,CAAC,EAIhC,OAAOH,CACT,IClFA,IAAAI,GAAAC,EAAAC,IAAA,KAAMC,GAAgB,KAAmB,cACnCC,GAAsB,EAS5BF,GAAQ,aAAe,SAAuBG,EAAS,CACrD,IAAMC,EAAOH,GAAcE,CAAO,EAElC,MAAO,CAEL,CAAC,EAAG,CAAC,EAEL,CAACC,EAAOF,GAAqB,CAAC,EAE9B,CAAC,EAAGE,EAAOF,EAAmB,CAChC,CACF,ICrBA,IAAAG,GAAAC,EAAAC,GAAA,CAIAA,EAAQ,SAAW,CACjB,WAAY,EACZ,WAAY,EACZ,WAAY,EACZ,WAAY,EACZ,WAAY,EACZ,WAAY,EACZ,WAAY,EACZ,WAAY,CACd,EAMA,IAAMC,GAAgB,CACpB,GAAI,EACJ,GAAI,EACJ,GAAI,GACJ,GAAI,EACN,EAQAD,EAAQ,QAAU,SAAkBE,EAAM,CACxC,OAAOA,GAAQ,MAAQA,IAAS,IAAM,CAAC,MAAMA,CAAI,GAAKA,GAAQ,GAAKA,GAAQ,CAC7E,EASAF,EAAQ,KAAO,SAAeG,EAAO,CACnC,OAAOH,EAAQ,QAAQG,CAAK,EAAI,SAASA,EAAO,EAAE,EAAI,MACxD,EASAH,EAAQ,aAAe,SAAuBI,EAAM,CAClD,IAAMC,EAAOD,EAAK,KACdE,EAAS,EACTC,EAAe,EACfC,EAAe,EACfC,EAAU,KACVC,EAAU,KAEd,QAASC,EAAM,EAAGA,EAAMN,EAAMM,IAAO,CACnCJ,EAAeC,EAAe,EAC9BC,EAAUC,EAAU,KAEpB,QAASE,EAAM,EAAGA,EAAMP,EAAMO,IAAO,CACnC,IAAIC,EAAST,EAAK,IAAIO,EAAKC,CAAG,EAC1BC,IAAWJ,EACbF,KAEIA,GAAgB,IAAGD,GAAUL,GAAc,IAAMM,EAAe,IACpEE,EAAUI,EACVN,EAAe,GAGjBM,EAAST,EAAK,IAAIQ,EAAKD,CAAG,EACtBE,IAAWH,EACbF,KAEIA,GAAgB,IAAGF,GAAUL,GAAc,IAAMO,EAAe,IACpEE,EAAUG,EACVL,EAAe,EAEnB,CAEID,GAAgB,IAAGD,GAAUL,GAAc,IAAMM,EAAe,IAChEC,GAAgB,IAAGF,GAAUL,GAAc,IAAMO,EAAe,GACtE,CAEA,OAAOF,CACT,EAOAN,EAAQ,aAAe,SAAuBI,EAAM,CAClD,IAAMC,EAAOD,EAAK,KACdE,EAAS,EAEb,QAASK,EAAM,EAAGA,EAAMN,EAAO,EAAGM,IAChC,QAASC,EAAM,EAAGA,EAAMP,EAAO,EAAGO,IAAO,CACvC,IAAME,EAAOV,EAAK,IAAIO,EAAKC,CAAG,EAC5BR,EAAK,IAAIO,EAAKC,EAAM,CAAC,EACrBR,EAAK,IAAIO,EAAM,EAAGC,CAAG,EACrBR,EAAK,IAAIO,EAAM,EAAGC,EAAM,CAAC,GAEvBE,IAAS,GAAKA,IAAS,IAAGR,GAChC,CAGF,OAAOA,EAASL,GAAc,EAChC,EAQAD,EAAQ,aAAe,SAAuBI,EAAM,CAClD,IAAMC,EAAOD,EAAK,KACdE,EAAS,EACTS,EAAU,EACVC,EAAU,EAEd,QAASL,EAAM,EAAGA,EAAMN,EAAMM,IAAO,CACnCI,EAAUC,EAAU,EACpB,QAASJ,EAAM,EAAGA,EAAMP,EAAMO,IAC5BG,EAAYA,GAAW,EAAK,KAASX,EAAK,IAAIO,EAAKC,CAAG,EAClDA,GAAO,KAAOG,IAAY,MAASA,IAAY,KAAQT,IAE3DU,EAAYA,GAAW,EAAK,KAASZ,EAAK,IAAIQ,EAAKD,CAAG,EAClDC,GAAO,KAAOI,IAAY,MAASA,IAAY,KAAQV,GAE/D,CAEA,OAAOA,EAASL,GAAc,EAChC,EAUAD,EAAQ,aAAe,SAAuBI,EAAM,CAClD,IAAIa,EAAY,EACVC,EAAed,EAAK,KAAK,OAE/B,QAASe,EAAI,EAAGA,EAAID,EAAcC,IAAKF,GAAab,EAAK,KAAKe,CAAC,EAI/D,OAFU,KAAK,IAAI,KAAK,KAAMF,EAAY,IAAMC,EAAgB,CAAC,EAAI,EAAE,EAE5DjB,GAAc,EAC3B,EAUA,SAASmB,GAAWC,EAAaF,EAAGG,EAAG,CACrC,OAAQD,EAAa,CACnB,KAAKrB,EAAQ,SAAS,WAAY,OAAQmB,EAAIG,GAAK,IAAM,EACzD,KAAKtB,EAAQ,SAAS,WAAY,OAAOmB,EAAI,IAAM,EACnD,KAAKnB,EAAQ,SAAS,WAAY,OAAOsB,EAAI,IAAM,EACnD,KAAKtB,EAAQ,SAAS,WAAY,OAAQmB,EAAIG,GAAK,IAAM,EACzD,KAAKtB,EAAQ,SAAS,WAAY,OAAQ,KAAK,MAAMmB,EAAI,CAAC,EAAI,KAAK,MAAMG,EAAI,CAAC,GAAK,IAAM,EACzF,KAAKtB,EAAQ,SAAS,WAAY,OAAQmB,EAAIG,EAAK,EAAKH,EAAIG,EAAK,IAAM,EACvE,KAAKtB,EAAQ,SAAS,WAAY,OAASmB,EAAIG,EAAK,EAAKH,EAAIG,EAAK,GAAK,IAAM,EAC7E,KAAKtB,EAAQ,SAAS,WAAY,OAASmB,EAAIG,EAAK,GAAKH,EAAIG,GAAK,GAAK,IAAM,EAE7E,QAAS,MAAM,IAAI,MAAM,mBAAqBD,CAAW,CAC3D,CACF,CAQArB,EAAQ,UAAY,SAAoBuB,EAASnB,EAAM,CACrD,IAAMC,EAAOD,EAAK,KAElB,QAASQ,EAAM,EAAGA,EAAMP,EAAMO,IAC5B,QAASD,EAAM,EAAGA,EAAMN,EAAMM,IACxBP,EAAK,WAAWO,EAAKC,CAAG,GAC5BR,EAAK,IAAIO,EAAKC,EAAKQ,GAAUG,EAASZ,EAAKC,CAAG,CAAC,CAGrD,EAQAZ,EAAQ,YAAc,SAAsBI,EAAMoB,EAAiB,CACjE,IAAMC,EAAc,OAAO,KAAKzB,EAAQ,QAAQ,EAAE,OAC9C0B,EAAc,EACdC,EAAe,IAEnB,QAASC,EAAI,EAAGA,EAAIH,EAAaG,IAAK,CACpCJ,EAAgBI,CAAC,EACjB5B,EAAQ,UAAU4B,EAAGxB,CAAI,EAGzB,IAAMyB,EACJ7B,EAAQ,aAAaI,CAAI,EACzBJ,EAAQ,aAAaI,CAAI,EACzBJ,EAAQ,aAAaI,CAAI,EACzBJ,EAAQ,aAAaI,CAAI,EAG3BJ,EAAQ,UAAU4B,EAAGxB,CAAI,EAErByB,EAAUF,IACZA,EAAeE,EACfH,EAAcE,EAElB,CAEA,OAAOF,CACT,ICzOA,IAAAI,GAAAC,EAAAC,IAAA,KAAMC,GAAU,KAEVC,GAAkB,CAEtB,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,GACT,EAAG,EAAG,GAAI,GACV,EAAG,EAAG,GAAI,GACV,EAAG,EAAG,GAAI,GACV,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,EACd,EAEMC,GAAqB,CAEzB,EAAG,GAAI,GAAI,GACX,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,IACZ,GAAI,GAAI,IAAK,IACb,GAAI,GAAI,IAAK,IACb,GAAI,IAAK,IAAK,IACd,GAAI,IAAK,IAAK,IACd,GAAI,IAAK,IAAK,IACd,GAAI,IAAK,IAAK,IACd,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,KACf,IAAK,IAAK,IAAK,KACf,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,IACnB,EAUAH,GAAQ,eAAiB,SAAyBI,EAASC,EAAsB,CAC/E,OAAQA,EAAsB,CAC5B,KAAKJ,GAAQ,EACX,OAAOC,IAAiBE,EAAU,GAAK,EAAI,CAAC,EAC9C,KAAKH,GAAQ,EACX,OAAOC,IAAiBE,EAAU,GAAK,EAAI,CAAC,EAC9C,KAAKH,GAAQ,EACX,OAAOC,IAAiBE,EAAU,GAAK,EAAI,CAAC,EAC9C,KAAKH,GAAQ,EACX,OAAOC,IAAiBE,EAAU,GAAK,EAAI,CAAC,EAC9C,QACE,MACJ,CACF,EAUAJ,GAAQ,uBAAyB,SAAiCI,EAASC,EAAsB,CAC/F,OAAQA,EAAsB,CAC5B,KAAKJ,GAAQ,EACX,OAAOE,IAAoBC,EAAU,GAAK,EAAI,CAAC,EACjD,KAAKH,GAAQ,EACX,OAAOE,IAAoBC,EAAU,GAAK,EAAI,CAAC,EACjD,KAAKH,GAAQ,EACX,OAAOE,IAAoBC,EAAU,GAAK,EAAI,CAAC,EACjD,KAAKH,GAAQ,EACX,OAAOE,IAAoBC,EAAU,GAAK,EAAI,CAAC,EACjD,QACE,MACJ,CACF,ICtIA,IAAAE,GAAAC,EAAAC,IAAA,KAAMC,GAAY,IAAI,WAAW,GAAG,EAC9BC,GAAY,IAAI,WAAW,GAAG,GASlC,UAAuB,CACvB,IAAIC,EAAI,EACR,QAASC,EAAI,EAAGA,EAAI,IAAKA,IACvBH,GAAUG,CAAC,EAAID,EACfD,GAAUC,CAAC,EAAIC,EAEfD,IAAM,EAIFA,EAAI,MACNA,GAAK,KAQT,QAASC,EAAI,IAAKA,EAAI,IAAKA,IACzBH,GAAUG,CAAC,EAAIH,GAAUG,EAAI,GAAG,CAEpC,GAAE,EAQFJ,GAAQ,IAAM,SAAcK,EAAG,CAC7B,GAAIA,EAAI,EAAG,MAAM,IAAI,MAAM,OAASA,EAAI,GAAG,EAC3C,OAAOH,GAAUG,CAAC,CACpB,EAQAL,GAAQ,IAAM,SAAcK,EAAG,CAC7B,OAAOJ,GAAUI,CAAC,CACpB,EASAL,GAAQ,IAAM,SAAcG,EAAGG,EAAG,CAChC,OAAIH,IAAM,GAAKG,IAAM,EAAU,EAIxBL,GAAUC,GAAUC,CAAC,EAAID,GAAUI,CAAC,CAAC,CAC9C,ICpEA,IAAAC,GAAAC,EAAAC,IAAA,KAAMC,GAAK,KASXD,GAAQ,IAAM,SAAcE,EAAIC,EAAI,CAClC,IAAMC,EAAQ,IAAI,WAAWF,EAAG,OAASC,EAAG,OAAS,CAAC,EAEtD,QAAS,EAAI,EAAG,EAAID,EAAG,OAAQ,IAC7B,QAASG,EAAI,EAAGA,EAAIF,EAAG,OAAQE,IAC7BD,EAAM,EAAIC,CAAC,GAAKJ,GAAG,IAAIC,EAAG,CAAC,EAAGC,EAAGE,CAAC,CAAC,EAIvC,OAAOD,CACT,EASAJ,GAAQ,IAAM,SAAcM,EAAUC,EAAS,CAC7C,IAAIC,EAAS,IAAI,WAAWF,CAAQ,EAEpC,KAAQE,EAAO,OAASD,EAAQ,QAAW,GAAG,CAC5C,IAAMH,EAAQI,EAAO,CAAC,EAEtB,QAASC,EAAI,EAAGA,EAAIF,EAAQ,OAAQE,IAClCD,EAAOC,CAAC,GAAKR,GAAG,IAAIM,EAAQE,CAAC,EAAGL,CAAK,EAIvC,IAAIM,EAAS,EACb,KAAOA,EAASF,EAAO,QAAUA,EAAOE,CAAM,IAAM,GAAGA,IACvDF,EAASA,EAAO,MAAME,CAAM,CAC9B,CAEA,OAAOF,CACT,EASAR,GAAQ,qBAAuB,SAA+BW,EAAQ,CACpE,IAAIC,EAAO,IAAI,WAAW,CAAC,CAAC,CAAC,EAC7B,QAASH,EAAI,EAAGA,EAAIE,EAAQF,IAC1BG,EAAOZ,GAAQ,IAAIY,EAAM,IAAI,WAAW,CAAC,EAAGX,GAAG,IAAIQ,CAAC,CAAC,CAAC,CAAC,EAGzD,OAAOG,CACT,IC7DA,IAAAC,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAMC,GAAa,KAEnB,SAASC,GAAoBC,EAAQ,CACnC,KAAK,QAAU,OACf,KAAK,OAASA,EAEV,KAAK,QAAQ,KAAK,WAAW,KAAK,MAAM,CAC9C,CAQAD,GAAmB,UAAU,WAAa,SAAqBC,EAAQ,CAErE,KAAK,OAASA,EACd,KAAK,QAAUF,GAAW,qBAAqB,KAAK,MAAM,CAC5D,EAQAC,GAAmB,UAAU,OAAS,SAAiBE,EAAM,CAC3D,GAAI,CAAC,KAAK,QACR,MAAM,IAAI,MAAM,yBAAyB,EAK3C,IAAMC,EAAa,IAAI,WAAWD,EAAK,OAAS,KAAK,MAAM,EAC3DC,EAAW,IAAID,CAAI,EAInB,IAAME,EAAYL,GAAW,IAAII,EAAY,KAAK,OAAO,EAKnDE,EAAQ,KAAK,OAASD,EAAU,OACtC,GAAIC,EAAQ,EAAG,CACb,IAAMC,EAAO,IAAI,WAAW,KAAK,MAAM,EACvC,OAAAA,EAAK,IAAIF,EAAWC,CAAK,EAElBC,CACT,CAEA,OAAOF,CACT,EAEAN,GAAO,QAAUE,KCvDjB,IAAAO,GAAAC,EAAAC,IAAA,CAMAA,GAAQ,QAAU,SAAkBC,EAAS,CAC3C,MAAO,CAAC,MAAMA,CAAO,GAAKA,GAAW,GAAKA,GAAW,EACvD,ICRA,IAAAC,GAAAC,EAAAC,IAAA,KAAMC,GAAU,SACVC,GAAe,oBACjBC,GAAQ,mNAIZA,GAAQA,GAAM,QAAQ,KAAM,KAAK,EAEjC,IAAMC,GAAO,6BAA+BD,GAAQ;AAAA,MAEpDH,GAAQ,MAAQ,IAAI,OAAOG,GAAO,GAAG,EACrCH,GAAQ,WAAa,IAAI,OAAO,wBAAyB,GAAG,EAC5DA,GAAQ,KAAO,IAAI,OAAOI,GAAM,GAAG,EACnCJ,GAAQ,QAAU,IAAI,OAAOC,GAAS,GAAG,EACzCD,GAAQ,aAAe,IAAI,OAAOE,GAAc,GAAG,EAEnD,IAAMG,GAAa,IAAI,OAAO,IAAMF,GAAQ,GAAG,EACzCG,GAAe,IAAI,OAAO,IAAML,GAAU,GAAG,EAC7CM,GAAoB,IAAI,OAAO,wBAAwB,EAE7DP,GAAQ,UAAY,SAAoBQ,EAAK,CAC3C,OAAOH,GAAW,KAAKG,CAAG,CAC5B,EAEAR,GAAQ,YAAc,SAAsBQ,EAAK,CAC/C,OAAOF,GAAa,KAAKE,CAAG,CAC9B,EAEAR,GAAQ,iBAAmB,SAA2BQ,EAAK,CACzD,OAAOD,GAAkB,KAAKC,CAAG,CACnC,IC9BA,IAAAC,GAAAC,EAAAC,GAAA,KAAMC,GAAe,KACfC,GAAQ,KASdF,EAAQ,QAAU,CAChB,GAAI,UACJ,IAAK,EACL,OAAQ,CAAC,GAAI,GAAI,EAAE,CACrB,EAWAA,EAAQ,aAAe,CACrB,GAAI,eACJ,IAAK,EACL,OAAQ,CAAC,EAAG,GAAI,EAAE,CACpB,EAOAA,EAAQ,KAAO,CACb,GAAI,OACJ,IAAK,EACL,OAAQ,CAAC,EAAG,GAAI,EAAE,CACpB,EAWAA,EAAQ,MAAQ,CACd,GAAI,QACJ,IAAK,EACL,OAAQ,CAAC,EAAG,GAAI,EAAE,CACpB,EAQAA,EAAQ,MAAQ,CACd,IAAK,EACP,EAUAA,EAAQ,sBAAwB,SAAgCG,EAAMC,EAAS,CAC7E,GAAI,CAACD,EAAK,OAAQ,MAAM,IAAI,MAAM,iBAAmBA,CAAI,EAEzD,GAAI,CAACF,GAAa,QAAQG,CAAO,EAC/B,MAAM,IAAI,MAAM,oBAAsBA,CAAO,EAG/C,OAAIA,GAAW,GAAKA,EAAU,GAAWD,EAAK,OAAO,CAAC,EAC7CC,EAAU,GAAWD,EAAK,OAAO,CAAC,EACpCA,EAAK,OAAO,CAAC,CACtB,EAQAH,EAAQ,mBAAqB,SAA6BK,EAAS,CACjE,OAAIH,GAAM,YAAYG,CAAO,EAAUL,EAAQ,QACtCE,GAAM,iBAAiBG,CAAO,EAAUL,EAAQ,aAChDE,GAAM,UAAUG,CAAO,EAAUL,EAAQ,MACtCA,EAAQ,IACtB,EAQAA,EAAQ,SAAW,SAAmBG,EAAM,CAC1C,GAAIA,GAAQA,EAAK,GAAI,OAAOA,EAAK,GACjC,MAAM,IAAI,MAAM,cAAc,CAChC,EAQAH,EAAQ,QAAU,SAAkBG,EAAM,CACxC,OAAOA,GAAQA,EAAK,KAAOA,EAAK,MAClC,EAQA,SAASG,GAAYC,EAAQ,CAC3B,GAAI,OAAOA,GAAW,SACpB,MAAM,IAAI,MAAM,uBAAuB,EAKzC,OAFcA,EAAO,YAAY,EAElB,CACb,IAAK,UACH,OAAOP,EAAQ,QACjB,IAAK,eACH,OAAOA,EAAQ,aACjB,IAAK,QACH,OAAOA,EAAQ,MACjB,IAAK,OACH,OAAOA,EAAQ,KACjB,QACE,MAAM,IAAI,MAAM,iBAAmBO,CAAM,CAC7C,CACF,CAUAP,EAAQ,KAAO,SAAeQ,EAAOC,EAAc,CACjD,GAAIT,EAAQ,QAAQQ,CAAK,EACvB,OAAOA,EAGT,GAAI,CACF,OAAOF,GAAWE,CAAK,CACzB,MAAY,CACV,OAAOC,CACT,CACF,ICtKA,IAAAC,GAAAC,EAAAC,IAAA,KAAMC,GAAQ,KACRC,GAAS,KACTC,GAAU,KACVC,GAAO,KACPC,GAAe,KAGfC,GAAO,KACPC,GAAUN,GAAM,YAAYK,EAAG,EAErC,SAASE,GAA6BC,EAAMC,EAAQC,EAAsB,CACxE,QAASC,EAAiB,EAAGA,GAAkB,GAAIA,IACjD,GAAIF,GAAUV,GAAQ,YAAYY,EAAgBD,EAAsBF,CAAI,EAC1E,OAAOG,CAKb,CAEA,SAASC,GAAsBJ,EAAMK,EAAS,CAE5C,OAAOV,GAAK,sBAAsBK,EAAMK,CAAO,EAAI,CACrD,CAEA,SAASC,GAA2BC,EAAUF,EAAS,CACrD,IAAIG,EAAY,EAEhB,OAAAD,EAAS,QAAQ,SAAUE,EAAM,CAC/B,IAAMC,EAAeN,GAAqBK,EAAK,KAAMJ,CAAO,EAC5DG,GAAaE,EAAeD,EAAK,cAAc,CACjD,CAAC,EAEMD,CACT,CAEA,SAASG,GAA4BJ,EAAUL,EAAsB,CACnE,QAASC,EAAiB,EAAGA,GAAkB,GAAIA,IAEjD,GADeG,GAA0BC,EAAUJ,CAAc,GACnDZ,GAAQ,YAAYY,EAAgBD,EAAsBP,GAAK,KAAK,EAChF,OAAOQ,CAKb,CAUAZ,GAAQ,KAAO,SAAeqB,EAAOC,EAAc,CACjD,OAAIjB,GAAa,QAAQgB,CAAK,EACrB,SAASA,EAAO,EAAE,EAGpBC,CACT,EAWAtB,GAAQ,YAAc,SAAsBc,EAASH,EAAsBF,EAAM,CAC/E,GAAI,CAACJ,GAAa,QAAQS,CAAO,EAC/B,MAAM,IAAI,MAAM,yBAAyB,EAIvC,OAAOL,EAAS,MAAaA,EAAOL,GAAK,MAG7C,IAAMmB,EAAiBtB,GAAM,wBAAwBa,CAAO,EAGtDU,EAAmBtB,GAAO,uBAAuBY,EAASH,CAAoB,EAG9Ec,GAA0BF,EAAiBC,GAAoB,EAErE,GAAIf,IAASL,GAAK,MAAO,OAAOqB,EAEhC,IAAMC,EAAaD,EAAyBZ,GAAqBJ,EAAMK,CAAO,EAG9E,OAAQL,EAAM,CACZ,KAAKL,GAAK,QACR,OAAO,KAAK,MAAOsB,EAAa,GAAM,CAAC,EAEzC,KAAKtB,GAAK,aACR,OAAO,KAAK,MAAOsB,EAAa,GAAM,CAAC,EAEzC,KAAKtB,GAAK,MACR,OAAO,KAAK,MAAMsB,EAAa,EAAE,EAEnC,KAAKtB,GAAK,KACV,QACE,OAAO,KAAK,MAAMsB,EAAa,CAAC,CACpC,CACF,EAUA1B,GAAQ,sBAAwB,SAAgCkB,EAAMP,EAAsB,CAC1F,IAAIgB,EAEEC,EAAMzB,GAAQ,KAAKQ,EAAsBR,GAAQ,CAAC,EAExD,GAAI,MAAM,QAAQe,CAAI,EAAG,CACvB,GAAIA,EAAK,OAAS,EAChB,OAAOE,GAA2BF,EAAMU,CAAG,EAG7C,GAAIV,EAAK,SAAW,EAClB,MAAO,GAGTS,EAAMT,EAAK,CAAC,CACd,MACES,EAAMT,EAGR,OAAOV,GAA4BmB,EAAI,KAAMA,EAAI,UAAU,EAAGC,CAAG,CACnE,EAYA5B,GAAQ,eAAiB,SAAyBc,EAAS,CACzD,GAAI,CAACT,GAAa,QAAQS,CAAO,GAAKA,EAAU,EAC9C,MAAM,IAAI,MAAM,yBAAyB,EAG3C,IAAIe,EAAIf,GAAW,GAEnB,KAAOb,GAAM,YAAY4B,CAAC,EAAItB,IAAW,GACvCsB,GAAMvB,IAAQL,GAAM,YAAY4B,CAAC,EAAItB,GAGvC,OAAQO,GAAW,GAAMe,CAC3B,IClKA,IAAAC,GAAAC,EAAAC,IAAA,KAAMC,GAAQ,KAERC,GAAO,KACPC,GAAY,MACZC,GAAUH,GAAM,YAAYC,EAAG,EAYrCF,GAAQ,eAAiB,SAAyBK,EAAsBC,EAAM,CAC5E,IAAMC,EAASF,EAAqB,KAAO,EAAKC,EAC5CE,EAAID,GAAQ,GAEhB,KAAON,GAAM,YAAYO,CAAC,EAAIJ,IAAW,GACvCI,GAAMN,IAAQD,GAAM,YAAYO,CAAC,EAAIJ,GAMvC,OAASG,GAAQ,GAAMC,GAAKL,EAC9B,IC5BA,IAAAM,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAMC,GAAO,KAEb,SAASC,GAAaC,EAAM,CAC1B,KAAK,KAAOF,GAAK,QACjB,KAAK,KAAOE,EAAK,SAAS,CAC5B,CAEAD,GAAY,cAAgB,SAAwBE,EAAQ,CAC1D,MAAO,IAAK,KAAK,MAAMA,EAAS,CAAC,GAAMA,EAAS,EAAOA,EAAS,EAAK,EAAI,EAAK,EAChF,EAEAF,GAAY,UAAU,UAAY,UAAsB,CACtD,OAAO,KAAK,KAAK,MACnB,EAEAA,GAAY,UAAU,cAAgB,UAA0B,CAC9D,OAAOA,GAAY,cAAc,KAAK,KAAK,MAAM,CACnD,EAEAA,GAAY,UAAU,MAAQ,SAAgBG,EAAW,CACvD,IAAIC,EAAGC,EAAOC,EAId,IAAKF,EAAI,EAAGA,EAAI,GAAK,KAAK,KAAK,OAAQA,GAAK,EAC1CC,EAAQ,KAAK,KAAK,OAAOD,EAAG,CAAC,EAC7BE,EAAQ,SAASD,EAAO,EAAE,EAE1BF,EAAU,IAAIG,EAAO,EAAE,EAKzB,IAAMC,EAAe,KAAK,KAAK,OAASH,EACpCG,EAAe,IACjBF,EAAQ,KAAK,KAAK,OAAOD,CAAC,EAC1BE,EAAQ,SAASD,EAAO,EAAE,EAE1BF,EAAU,IAAIG,EAAOC,EAAe,EAAI,CAAC,EAE7C,EAEAT,GAAO,QAAUE,KC1CjB,IAAAQ,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAMC,GAAO,KAWPC,GAAkB,CACtB,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAC7C,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAC5D,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAC5D,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAC1C,EAEA,SAASC,GAAkBC,EAAM,CAC/B,KAAK,KAAOH,GAAK,aACjB,KAAK,KAAOG,CACd,CAEAD,GAAiB,cAAgB,SAAwBE,EAAQ,CAC/D,MAAO,IAAK,KAAK,MAAMA,EAAS,CAAC,EAAI,GAAKA,EAAS,EACrD,EAEAF,GAAiB,UAAU,UAAY,UAAsB,CAC3D,OAAO,KAAK,KAAK,MACnB,EAEAA,GAAiB,UAAU,cAAgB,UAA0B,CACnE,OAAOA,GAAiB,cAAc,KAAK,KAAK,MAAM,CACxD,EAEAA,GAAiB,UAAU,MAAQ,SAAgBG,EAAW,CAC5D,IAAIC,EAIJ,IAAKA,EAAI,EAAGA,EAAI,GAAK,KAAK,KAAK,OAAQA,GAAK,EAAG,CAE7C,IAAIC,EAAQN,GAAgB,QAAQ,KAAK,KAAKK,CAAC,CAAC,EAAI,GAGpDC,GAASN,GAAgB,QAAQ,KAAK,KAAKK,EAAI,CAAC,CAAC,EAGjDD,EAAU,IAAIE,EAAO,EAAE,CACzB,CAII,KAAK,KAAK,OAAS,GACrBF,EAAU,IAAIJ,GAAgB,QAAQ,KAAK,KAAKK,CAAC,CAAC,EAAG,CAAC,CAE1D,EAEAP,GAAO,QAAUG,KC1DjB,IAAAM,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAMC,GAAO,KAEb,SAASC,GAAUC,EAAM,CACvB,KAAK,KAAOF,GAAK,KACb,OAAQE,GAAU,SACpB,KAAK,KAAO,IAAI,YAAY,EAAE,OAAOA,CAAI,EAEzC,KAAK,KAAO,IAAI,WAAWA,CAAI,CAEnC,CAEAD,GAAS,cAAgB,SAAwBE,EAAQ,CACvD,OAAOA,EAAS,CAClB,EAEAF,GAAS,UAAU,UAAY,UAAsB,CACnD,OAAO,KAAK,KAAK,MACnB,EAEAA,GAAS,UAAU,cAAgB,UAA0B,CAC3D,OAAOA,GAAS,cAAc,KAAK,KAAK,MAAM,CAChD,EAEAA,GAAS,UAAU,MAAQ,SAAUG,EAAW,CAC9C,QAASC,EAAI,EAAGC,EAAI,KAAK,KAAK,OAAQD,EAAIC,EAAGD,IAC3CD,EAAU,IAAI,KAAK,KAAKC,CAAC,EAAG,CAAC,CAEjC,EAEAN,GAAO,QAAUE,KC7BjB,IAAAM,GAAAC,EAAA,CAAAC,GAAAC,KAAA,KAAMC,GAAO,KACPC,GAAQ,KAEd,SAASC,GAAWC,EAAM,CACxB,KAAK,KAAOH,GAAK,MACjB,KAAK,KAAOG,CACd,CAEAD,GAAU,cAAgB,SAAwBE,EAAQ,CACxD,OAAOA,EAAS,EAClB,EAEAF,GAAU,UAAU,UAAY,UAAsB,CACpD,OAAO,KAAK,KAAK,MACnB,EAEAA,GAAU,UAAU,cAAgB,UAA0B,CAC5D,OAAOA,GAAU,cAAc,KAAK,KAAK,MAAM,CACjD,EAEAA,GAAU,UAAU,MAAQ,SAAUG,EAAW,CAC/C,IAAIC,EAKJ,IAAKA,EAAI,EAAGA,EAAI,KAAK,KAAK,OAAQA,IAAK,CACrC,IAAIC,EAAQN,GAAM,OAAO,KAAK,KAAKK,CAAC,CAAC,EAGrC,GAAIC,GAAS,OAAUA,GAAS,MAE9BA,GAAS,cAGAA,GAAS,OAAUA,GAAS,MAErCA,GAAS,UAET,OAAM,IAAI,MACR,2BAA6B,KAAK,KAAKD,CAAC,EAAI;AAAA,gCACX,EAKrCC,GAAWA,IAAU,EAAK,KAAQ,KAASA,EAAQ,KAGnDF,EAAU,IAAIE,EAAO,EAAE,CACzB,CACF,EAEAR,GAAO,QAAUG,KCrDjB,IAAAM,GAAAC,EAAA,CAAAC,GAAAC,KAAA,cAuBA,IAAIC,GAAW,CACb,6BAA8B,SAASC,EAAOC,EAAGC,EAAG,CAGlD,IAAIC,EAAe,CAAC,EAIhBC,EAAQ,CAAC,EACbA,EAAMH,CAAC,EAAI,EAMX,IAAII,EAAON,GAAS,cAAc,KAAK,EACvCM,EAAK,KAAKJ,EAAG,CAAC,EAUd,QARIK,EACAC,EAAGC,EACHC,EACAC,EACAC,EACAC,EACAC,EACAC,EACG,CAACT,EAAK,MAAM,GAAG,CAGpBC,EAAUD,EAAK,IAAI,EACnBE,EAAID,EAAQ,MACZG,EAAiBH,EAAQ,KAGzBI,EAAiBV,EAAMO,CAAC,GAAK,CAAC,EAK9B,IAAKC,KAAKE,EACJA,EAAe,eAAeF,CAAC,IAEjCG,EAAYD,EAAeF,CAAC,EAK5BI,EAAgCH,EAAiBE,EAMjDE,EAAiBT,EAAMI,CAAC,EACxBM,EAAe,OAAOV,EAAMI,CAAC,EAAM,KAC/BM,GAAeD,EAAiBD,KAClCR,EAAMI,CAAC,EAAII,EACXP,EAAK,KAAKG,EAAGI,CAA6B,EAC1CT,EAAaK,CAAC,EAAID,GAI1B,CAEA,GAAI,OAAOL,EAAM,KAAe,OAAOE,EAAMF,CAAC,EAAM,IAAa,CAC/D,IAAIa,EAAM,CAAC,8BAA+Bd,EAAG,OAAQC,EAAG,GAAG,EAAE,KAAK,EAAE,EACpE,MAAM,IAAI,MAAMa,CAAG,CACrB,CAEA,OAAOZ,CACT,EAEA,4CAA6C,SAASA,EAAcD,EAAG,CAIrE,QAHIc,EAAQ,CAAC,EACTT,EAAIL,EACJe,EACGV,GACLS,EAAM,KAAKT,CAAC,EACZU,EAAcd,EAAaI,CAAC,EAC5BA,EAAIJ,EAAaI,CAAC,EAEpB,OAAAS,EAAM,QAAQ,EACPA,CACT,EAEA,UAAW,SAAShB,EAAOC,EAAGC,EAAG,CAC/B,IAAIC,EAAeJ,GAAS,6BAA6BC,EAAOC,EAAGC,CAAC,EACpE,OAAOH,GAAS,4CACdI,EAAcD,CAAC,CACnB,EAKA,cAAe,CACb,KAAM,SAAUgB,EAAM,CACpB,IAAIC,EAAIpB,GAAS,cACbqB,EAAI,CAAC,EACLC,EACJH,EAAOA,GAAQ,CAAC,EAChB,IAAKG,KAAOF,EACNA,EAAE,eAAeE,CAAG,IACtBD,EAAEC,CAAG,EAAIF,EAAEE,CAAG,GAGlB,OAAAD,EAAE,MAAQ,CAAC,EACXA,EAAE,OAASF,EAAK,QAAUC,EAAE,eACrBC,CACT,EAEA,eAAgB,SAAUE,EAAGC,EAAG,CAC9B,OAAOD,EAAE,KAAOC,EAAE,IACpB,EAMA,KAAM,SAAUC,EAAOC,EAAM,CAC3B,IAAIC,EAAO,CAAC,MAAOF,EAAO,KAAMC,CAAI,EACpC,KAAK,MAAM,KAAKC,CAAI,EACpB,KAAK,MAAM,KAAK,KAAK,MAAM,CAC7B,EAKA,IAAK,UAAY,CACf,OAAO,KAAK,MAAM,MAAM,CAC1B,EAEA,MAAO,UAAY,CACjB,OAAO,KAAK,MAAM,SAAW,CAC/B,CACF,CACF,EAII,OAAO5B,GAAW,MACpBA,GAAO,QAAUC,MCnKnB,IAAA4B,GAAAC,EAAAC,IAAA,KAAMC,EAAO,KACPC,GAAc,KACdC,GAAmB,KACnBC,GAAW,KACXC,GAAY,KACZC,GAAQ,KACRC,GAAQ,KACRC,GAAW,KAQjB,SAASC,GAAqBC,EAAK,CACjC,OAAO,SAAS,mBAAmBA,CAAG,CAAC,EAAE,MAC3C,CAUA,SAASC,GAAaC,EAAOC,EAAMH,EAAK,CACtC,IAAMI,EAAW,CAAC,EACdC,EAEJ,MAAQA,EAASH,EAAM,KAAKF,CAAG,KAAO,MACpCI,EAAS,KAAK,CACZ,KAAMC,EAAO,CAAC,EACd,MAAOA,EAAO,MACd,KAAMF,EACN,OAAQE,EAAO,CAAC,EAAE,MACpB,CAAC,EAGH,OAAOD,CACT,CASA,SAASE,GAAuBC,EAAS,CACvC,IAAMC,EAAUP,GAAYL,GAAM,QAASL,EAAK,QAASgB,CAAO,EAC1DE,EAAeR,GAAYL,GAAM,aAAcL,EAAK,aAAcgB,CAAO,EAC3EG,EACAC,EAEJ,OAAId,GAAM,mBAAmB,GAC3Ba,EAAWT,GAAYL,GAAM,KAAML,EAAK,KAAMgB,CAAO,EACrDI,EAAYV,GAAYL,GAAM,MAAOL,EAAK,MAAOgB,CAAO,IAExDG,EAAWT,GAAYL,GAAM,WAAYL,EAAK,KAAMgB,CAAO,EAC3DI,EAAY,CAAC,GAGFH,EAAQ,OAAOC,EAAcC,EAAUC,CAAS,EAG1D,KAAK,SAAUC,EAAIC,EAAI,CACtB,OAAOD,EAAG,MAAQC,EAAG,KACvB,CAAC,EACA,IAAI,SAAUC,EAAK,CAClB,MAAO,CACL,KAAMA,EAAI,KACV,KAAMA,EAAI,KACV,OAAQA,EAAI,MACd,CACF,CAAC,CACL,CAUA,SAASC,GAAsBC,EAAQb,EAAM,CAC3C,OAAQA,EAAM,CACZ,KAAKZ,EAAK,QACR,OAAOC,GAAY,cAAcwB,CAAM,EACzC,KAAKzB,EAAK,aACR,OAAOE,GAAiB,cAAcuB,CAAM,EAC9C,KAAKzB,EAAK,MACR,OAAOI,GAAU,cAAcqB,CAAM,EACvC,KAAKzB,EAAK,KACR,OAAOG,GAAS,cAAcsB,CAAM,CACxC,CACF,CAQA,SAASC,GAAeC,EAAM,CAC5B,OAAOA,EAAK,OAAO,SAAUC,EAAKC,EAAM,CACtC,IAAMC,EAAUF,EAAI,OAAS,GAAK,EAAIA,EAAIA,EAAI,OAAS,CAAC,EAAI,KAC5D,OAAIE,GAAWA,EAAQ,OAASD,EAAK,MACnCD,EAAIA,EAAI,OAAS,CAAC,EAAE,MAAQC,EAAK,KAC1BD,IAGTA,EAAI,KAAKC,CAAI,EACND,EACT,EAAG,CAAC,CAAC,CACP,CAkBA,SAASG,GAAYJ,EAAM,CACzB,IAAMK,EAAQ,CAAC,EACf,QAASC,EAAI,EAAGA,EAAIN,EAAK,OAAQM,IAAK,CACpC,IAAMC,EAAMP,EAAKM,CAAC,EAElB,OAAQC,EAAI,KAAM,CAChB,KAAKlC,EAAK,QACRgC,EAAM,KAAK,CAACE,EACV,CAAE,KAAMA,EAAI,KAAM,KAAMlC,EAAK,aAAc,OAAQkC,EAAI,MAAO,EAC9D,CAAE,KAAMA,EAAI,KAAM,KAAMlC,EAAK,KAAM,OAAQkC,EAAI,MAAO,CACxD,CAAC,EACD,MACF,KAAKlC,EAAK,aACRgC,EAAM,KAAK,CAACE,EACV,CAAE,KAAMA,EAAI,KAAM,KAAMlC,EAAK,KAAM,OAAQkC,EAAI,MAAO,CACxD,CAAC,EACD,MACF,KAAKlC,EAAK,MACRgC,EAAM,KAAK,CAACE,EACV,CAAE,KAAMA,EAAI,KAAM,KAAMlC,EAAK,KAAM,OAAQQ,GAAoB0B,EAAI,IAAI,CAAE,CAC3E,CAAC,EACD,MACF,KAAKlC,EAAK,KACRgC,EAAM,KAAK,CACT,CAAE,KAAME,EAAI,KAAM,KAAMlC,EAAK,KAAM,OAAQQ,GAAoB0B,EAAI,IAAI,CAAE,CAC3E,CAAC,CACL,CACF,CAEA,OAAOF,CACT,CAcA,SAASG,GAAYH,EAAOI,EAAS,CACnC,IAAMC,EAAQ,CAAC,EACTC,EAAQ,CAAE,MAAO,CAAC,CAAE,EACtBC,EAAc,CAAC,OAAO,EAE1B,QAASN,EAAI,EAAGA,EAAID,EAAM,OAAQC,IAAK,CACrC,IAAMO,EAAYR,EAAMC,CAAC,EACnBQ,EAAiB,CAAC,EAExB,QAASC,EAAI,EAAGA,EAAIF,EAAU,OAAQE,IAAK,CACzC,IAAMC,EAAOH,EAAUE,CAAC,EAClBE,EAAM,GAAKX,EAAIS,EAErBD,EAAe,KAAKG,CAAG,EACvBP,EAAMO,CAAG,EAAI,CAAE,KAAMD,EAAM,UAAW,CAAE,EACxCL,EAAMM,CAAG,EAAI,CAAC,EAEd,QAASC,EAAI,EAAGA,EAAIN,EAAY,OAAQM,IAAK,CAC3C,IAAMC,EAAaP,EAAYM,CAAC,EAE5BR,EAAMS,CAAU,GAAKT,EAAMS,CAAU,EAAE,KAAK,OAASH,EAAK,MAC5DL,EAAMQ,CAAU,EAAEF,CAAG,EACnBpB,GAAqBa,EAAMS,CAAU,EAAE,UAAYH,EAAK,OAAQA,EAAK,IAAI,EACzEnB,GAAqBa,EAAMS,CAAU,EAAE,UAAWH,EAAK,IAAI,EAE7DN,EAAMS,CAAU,EAAE,WAAaH,EAAK,SAEhCN,EAAMS,CAAU,IAAGT,EAAMS,CAAU,EAAE,UAAYH,EAAK,QAE1DL,EAAMQ,CAAU,EAAEF,CAAG,EAAIpB,GAAqBmB,EAAK,OAAQA,EAAK,IAAI,EAClE,EAAI3C,EAAK,sBAAsB2C,EAAK,KAAMP,CAAO,EAEvD,CACF,CAEAG,EAAcE,CAChB,CAEA,QAASI,EAAI,EAAGA,EAAIN,EAAY,OAAQM,IACtCP,EAAMC,EAAYM,CAAC,CAAC,EAAE,IAAM,EAG9B,MAAO,CAAE,IAAKP,EAAO,MAAOD,CAAM,CACpC,CAUA,SAASU,GAAoBC,EAAMC,EAAW,CAC5C,IAAIrC,EACEsC,EAAWlD,EAAK,mBAAmBgD,CAAI,EAK7C,GAHApC,EAAOZ,EAAK,KAAKiD,EAAWC,CAAQ,EAGhCtC,IAASZ,EAAK,MAAQY,EAAK,IAAMsC,EAAS,IAC5C,MAAM,IAAI,MAAM,IAAMF,EAAO,iCACOhD,EAAK,SAASY,CAAI,EACpD;AAAA,sBAA4BZ,EAAK,SAASkD,CAAQ,CAAC,EAQvD,OAJItC,IAASZ,EAAK,OAAS,CAACM,GAAM,mBAAmB,IACnDM,EAAOZ,EAAK,MAGNY,EAAM,CACZ,KAAKZ,EAAK,QACR,OAAO,IAAIC,GAAY+C,CAAI,EAE7B,KAAKhD,EAAK,aACR,OAAO,IAAIE,GAAiB8C,CAAI,EAElC,KAAKhD,EAAK,MACR,OAAO,IAAII,GAAU4C,CAAI,EAE3B,KAAKhD,EAAK,KACR,OAAO,IAAIG,GAAS6C,CAAI,CAC5B,CACF,CAiBAjD,GAAQ,UAAY,SAAoBoD,EAAO,CAC7C,OAAOA,EAAM,OAAO,SAAUvB,EAAKM,EAAK,CACtC,OAAI,OAAOA,GAAQ,SACjBN,EAAI,KAAKmB,GAAmBb,EAAK,IAAI,CAAC,EAC7BA,EAAI,MACbN,EAAI,KAAKmB,GAAmBb,EAAI,KAAMA,EAAI,IAAI,CAAC,EAG1CN,CACT,EAAG,CAAC,CAAC,CACP,EAUA7B,GAAQ,WAAa,SAAqBiD,EAAMZ,EAAS,CACvD,IAAMT,EAAOZ,GAAsBiC,EAAM1C,GAAM,mBAAmB,CAAC,EAE7D0B,EAAQD,GAAWJ,CAAI,EACvBW,EAAQH,GAAWH,EAAOI,CAAO,EACjCgB,EAAO7C,GAAS,UAAU+B,EAAM,IAAK,QAAS,KAAK,EAEnDe,EAAgB,CAAC,EACvB,QAASpB,EAAI,EAAGA,EAAImB,EAAK,OAAS,EAAGnB,IACnCoB,EAAc,KAAKf,EAAM,MAAMc,EAAKnB,CAAC,CAAC,EAAE,IAAI,EAG9C,OAAOlC,GAAQ,UAAU2B,GAAc2B,CAAa,CAAC,CACvD,EAYAtD,GAAQ,SAAW,SAAmBiD,EAAM,CAC1C,OAAOjD,GAAQ,UACbgB,GAAsBiC,EAAM1C,GAAM,mBAAmB,CAAC,CACxD,CACF,ICzUA,IAAAgD,GAAAC,EAAAC,IAAA,KAAMC,GAAQ,KACRC,GAAU,KACVC,GAAY,KACZC,GAAY,KACZC,GAAmB,KACnBC,GAAgB,KAChBC,GAAc,KACdC,GAAS,KACTC,GAAqB,KACrBC,GAAU,KACVC,GAAa,KACbC,GAAO,KACPC,GAAW,KAkCjB,SAASC,GAAoBC,EAAQC,EAAS,CAC5C,IAAMC,EAAOF,EAAO,KACdG,EAAMZ,GAAc,aAAaU,CAAO,EAE9C,QAAS,EAAI,EAAG,EAAIE,EAAI,OAAQ,IAAK,CACnC,IAAMC,EAAMD,EAAI,CAAC,EAAE,CAAC,EACdE,EAAMF,EAAI,CAAC,EAAE,CAAC,EAEpB,QAASG,EAAI,GAAIA,GAAK,EAAGA,IACvB,GAAI,EAAAF,EAAME,GAAK,IAAMJ,GAAQE,EAAME,GAEnC,QAASC,EAAI,GAAIA,GAAK,EAAGA,IACnBF,EAAME,GAAK,IAAML,GAAQG,EAAME,IAE9BD,GAAK,GAAKA,GAAK,IAAMC,IAAM,GAAKA,IAAM,IACxCA,GAAK,GAAKA,GAAK,IAAMD,IAAM,GAAKA,IAAM,IACtCA,GAAK,GAAKA,GAAK,GAAKC,GAAK,GAAKA,GAAK,EACpCP,EAAO,IAAII,EAAME,EAAGD,EAAME,EAAG,GAAM,EAAI,EAEvCP,EAAO,IAAII,EAAME,EAAGD,EAAME,EAAG,GAAO,EAAI,EAIhD,CACF,CASA,SAASC,GAAoBR,EAAQ,CACnC,IAAME,EAAOF,EAAO,KAEpB,QAASM,EAAI,EAAGA,EAAIJ,EAAO,EAAGI,IAAK,CACjC,IAAMG,EAAQH,EAAI,IAAM,EACxBN,EAAO,IAAIM,EAAG,EAAGG,EAAO,EAAI,EAC5BT,EAAO,IAAI,EAAGM,EAAGG,EAAO,EAAI,CAC9B,CACF,CAUA,SAASC,GAAuBV,EAAQC,EAAS,CAC/C,IAAME,EAAMb,GAAiB,aAAaW,CAAO,EAEjD,QAASU,EAAI,EAAGA,EAAIR,EAAI,OAAQQ,IAAK,CACnC,IAAMP,EAAMD,EAAIQ,CAAC,EAAE,CAAC,EACdN,EAAMF,EAAIQ,CAAC,EAAE,CAAC,EAEpB,QAASL,EAAI,GAAIA,GAAK,EAAGA,IACvB,QAASC,EAAI,GAAIA,GAAK,EAAGA,IACnBD,IAAM,IAAMA,IAAM,GAAKC,IAAM,IAAMA,IAAM,GAC1CD,IAAM,GAAKC,IAAM,EAClBP,EAAO,IAAII,EAAME,EAAGD,EAAME,EAAG,GAAM,EAAI,EAEvCP,EAAO,IAAII,EAAME,EAAGD,EAAME,EAAG,GAAO,EAAI,CAIhD,CACF,CAQA,SAASK,GAAkBZ,EAAQC,EAAS,CAC1C,IAAMC,EAAOF,EAAO,KACda,EAAOlB,GAAQ,eAAeM,CAAO,EACvCG,EAAKC,EAAKS,EAEd,QAASH,EAAI,EAAGA,EAAI,GAAIA,IACtBP,EAAM,KAAK,MAAMO,EAAI,CAAC,EACtBN,EAAMM,EAAI,EAAIT,EAAO,EAAI,EACzBY,GAAQD,GAAQF,EAAK,KAAO,EAE5BX,EAAO,IAAII,EAAKC,EAAKS,EAAK,EAAI,EAC9Bd,EAAO,IAAIK,EAAKD,EAAKU,EAAK,EAAI,CAElC,CASA,SAASC,GAAiBf,EAAQgB,EAAsBC,EAAa,CACnE,IAAMf,EAAOF,EAAO,KACda,EAAOjB,GAAW,eAAeoB,EAAsBC,CAAW,EACpEN,EAAGG,EAEP,IAAKH,EAAI,EAAGA,EAAI,GAAIA,IAClBG,GAAQD,GAAQF,EAAK,KAAO,EAGxBA,EAAI,EACNX,EAAO,IAAIW,EAAG,EAAGG,EAAK,EAAI,EACjBH,EAAI,EACbX,EAAO,IAAIW,EAAI,EAAG,EAAGG,EAAK,EAAI,EAE9Bd,EAAO,IAAIE,EAAO,GAAKS,EAAG,EAAGG,EAAK,EAAI,EAIpCH,EAAI,EACNX,EAAO,IAAI,EAAGE,EAAOS,EAAI,EAAGG,EAAK,EAAI,EAC5BH,EAAI,EACbX,EAAO,IAAI,EAAG,GAAKW,EAAI,EAAI,EAAGG,EAAK,EAAI,EAEvCd,EAAO,IAAI,EAAG,GAAKW,EAAI,EAAGG,EAAK,EAAI,EAKvCd,EAAO,IAAIE,EAAO,EAAG,EAAG,EAAG,EAAI,CACjC,CAQA,SAASgB,GAAWlB,EAAQmB,EAAM,CAChC,IAAMjB,EAAOF,EAAO,KAChBoB,EAAM,GACNhB,EAAMF,EAAO,EACbmB,EAAW,EACXC,EAAY,EAEhB,QAASjB,EAAMH,EAAO,EAAGG,EAAM,EAAGA,GAAO,EAGvC,IAFIA,IAAQ,GAAGA,MAEF,CACX,QAASE,EAAI,EAAGA,EAAI,EAAGA,IACrB,GAAI,CAACP,EAAO,WAAWI,EAAKC,EAAME,CAAC,EAAG,CACpC,IAAIgB,EAAO,GAEPD,EAAYH,EAAK,SACnBI,GAAUJ,EAAKG,CAAS,IAAMD,EAAY,KAAO,GAGnDrB,EAAO,IAAII,EAAKC,EAAME,EAAGgB,CAAI,EAC7BF,IAEIA,IAAa,KACfC,IACAD,EAAW,EAEf,CAKF,GAFAjB,GAAOgB,EAEHhB,EAAM,GAAKF,GAAQE,EAAK,CAC1BA,GAAOgB,EACPA,EAAM,CAACA,EACP,KACF,CACF,CAEJ,CAUA,SAASI,GAAYvB,EAASe,EAAsBS,EAAU,CAE5D,IAAMC,EAAS,IAAItC,GAEnBqC,EAAS,QAAQ,SAAUN,EAAM,CAE/BO,EAAO,IAAIP,EAAK,KAAK,IAAK,CAAC,EAS3BO,EAAO,IAAIP,EAAK,UAAU,EAAGtB,GAAK,sBAAsBsB,EAAK,KAAMlB,CAAO,CAAC,EAG3EkB,EAAK,MAAMO,CAAM,CACnB,CAAC,EAGD,IAAMC,EAAiBzC,GAAM,wBAAwBe,CAAO,EACtD2B,EAAmBnC,GAAO,uBAAuBQ,EAASe,CAAoB,EAC9Ea,GAA0BF,EAAiBC,GAAoB,EAgBrE,IATIF,EAAO,gBAAgB,EAAI,GAAKG,GAClCH,EAAO,IAAI,EAAG,CAAC,EAQVA,EAAO,gBAAgB,EAAI,IAAM,GACtCA,EAAO,OAAO,CAAC,EAOjB,IAAMI,GAAiBD,EAAyBH,EAAO,gBAAgB,GAAK,EAC5E,QAASf,EAAI,EAAGA,EAAImB,EAAenB,IACjCe,EAAO,IAAIf,EAAI,EAAI,GAAO,IAAM,CAAC,EAGnC,OAAOoB,GAAgBL,EAAQzB,EAASe,CAAoB,CAC9D,CAWA,SAASe,GAAiBC,EAAW/B,EAASe,EAAsB,CAElE,IAAMW,EAAiBzC,GAAM,wBAAwBe,CAAO,EAGtD2B,EAAmBnC,GAAO,uBAAuBQ,EAASe,CAAoB,EAG9EiB,EAAqBN,EAAiBC,EAGtCM,EAAgBzC,GAAO,eAAeQ,EAASe,CAAoB,EAGnEmB,EAAiBR,EAAiBO,EAClCE,EAAiBF,EAAgBC,EAEjCE,EAAyB,KAAK,MAAMV,EAAiBO,CAAa,EAElEI,EAAwB,KAAK,MAAML,EAAqBC,CAAa,EACrEK,EAAwBD,EAAwB,EAGhDE,EAAUH,EAAyBC,EAGnCG,EAAK,IAAI/C,GAAmB8C,CAAO,EAErCE,EAAS,EACPC,EAAS,IAAI,MAAMT,CAAa,EAChCU,EAAS,IAAI,MAAMV,CAAa,EAClCW,EAAc,EACZnB,EAAS,IAAI,WAAWM,EAAU,MAAM,EAG9C,QAASc,EAAI,EAAGA,EAAIZ,EAAeY,IAAK,CACtC,IAAMC,EAAWD,EAAIV,EAAiBE,EAAwBC,EAG9DI,EAAOG,CAAC,EAAIpB,EAAO,MAAMgB,EAAQA,EAASK,CAAQ,EAGlDH,EAAOE,CAAC,EAAIL,EAAG,OAAOE,EAAOG,CAAC,CAAC,EAE/BJ,GAAUK,EACVF,EAAc,KAAK,IAAIA,EAAaE,CAAQ,CAC9C,CAIA,IAAM5B,EAAO,IAAI,WAAWQ,CAAc,EACtCqB,EAAQ,EACRrC,EAAGL,EAGP,IAAKK,EAAI,EAAGA,EAAIkC,EAAalC,IAC3B,IAAKL,EAAI,EAAGA,EAAI4B,EAAe5B,IACzBK,EAAIgC,EAAOrC,CAAC,EAAE,SAChBa,EAAK6B,GAAO,EAAIL,EAAOrC,CAAC,EAAEK,CAAC,GAMjC,IAAKA,EAAI,EAAGA,EAAI6B,EAAS7B,IACvB,IAAKL,EAAI,EAAGA,EAAI4B,EAAe5B,IAC7Ba,EAAK6B,GAAO,EAAIJ,EAAOtC,CAAC,EAAEK,CAAC,EAI/B,OAAOQ,CACT,CAWA,SAAS8B,GAAc9B,EAAMlB,EAASe,EAAsBC,EAAa,CACvE,IAAIQ,EAEJ,GAAI,MAAM,QAAQN,CAAI,EACpBM,EAAW3B,GAAS,UAAUqB,CAAI,UACzB,OAAOA,GAAS,SAAU,CACnC,IAAI+B,EAAmBjD,EAEvB,GAAI,CAACiD,EAAkB,CACrB,IAAMC,EAAcrD,GAAS,SAASqB,CAAI,EAG1C+B,EAAmBvD,GAAQ,sBAAsBwD,EAAanC,CAAoB,CACpF,CAIAS,EAAW3B,GAAS,WAAWqB,EAAM+B,GAAoB,EAAE,CAC7D,KACE,OAAM,IAAI,MAAM,cAAc,EAIhC,IAAME,EAAczD,GAAQ,sBAAsB8B,EAAUT,CAAoB,EAGhF,GAAI,CAACoC,EACH,MAAM,IAAI,MAAM,yDAAyD,EAI3E,GAAI,CAACnD,EACHA,EAAUmD,UAGDnD,EAAUmD,EACnB,MAAM,IAAI,MAAM;AAAA;AAAA,qDAE0CA,EAAc;AAAA,CACxE,EAGF,IAAMC,EAAW7B,GAAWvB,EAASe,EAAsBS,CAAQ,EAG7D6B,EAAcpE,GAAM,cAAce,CAAO,EACzCsD,EAAU,IAAIlE,GAAUiE,CAAW,EAGzC,OAAAvD,GAAmBwD,EAAStD,CAAO,EACnCO,GAAmB+C,CAAO,EAC1B7C,GAAsB6C,EAAStD,CAAO,EAMtCc,GAAgBwC,EAASvC,EAAsB,CAAC,EAE5Cf,GAAW,GACbW,GAAiB2C,EAAStD,CAAO,EAInCiB,GAAUqC,EAASF,CAAQ,EAEvB,MAAMpC,CAAW,IAEnBA,EAAczB,GAAY,YAAY+D,EACpCxC,GAAgB,KAAK,KAAMwC,EAASvC,CAAoB,CAAC,GAI7DxB,GAAY,UAAUyB,EAAasC,CAAO,EAG1CxC,GAAgBwC,EAASvC,EAAsBC,CAAW,EAEnD,CACL,QAASsC,EACT,QAAStD,EACT,qBAAsBe,EACtB,YAAaC,EACb,SAAUQ,CACZ,CACF,CAWAxC,GAAQ,OAAS,SAAiBkC,EAAMqC,EAAS,CAC/C,GAAI,OAAOrC,EAAS,KAAeA,IAAS,GAC1C,MAAM,IAAI,MAAM,eAAe,EAGjC,IAAIH,EAAuB7B,GAAQ,EAC/Bc,EACAwD,EAEJ,OAAI,OAAOD,EAAY,MAErBxC,EAAuB7B,GAAQ,KAAKqE,EAAQ,qBAAsBrE,GAAQ,CAAC,EAC3Ec,EAAUN,GAAQ,KAAK6D,EAAQ,OAAO,EACtCC,EAAOjE,GAAY,KAAKgE,EAAQ,WAAW,EAEvCA,EAAQ,YACVtE,GAAM,kBAAkBsE,EAAQ,UAAU,GAIvCP,GAAa9B,EAAMlB,EAASe,EAAsByC,CAAI,CAC/D,IC9eA,IAAAC,GAAAC,EAAAC,IAAA,UAASC,GAAUC,EAAK,CAKtB,GAJI,OAAOA,GAAQ,WACjBA,EAAMA,EAAI,SAAS,GAGjB,OAAOA,GAAQ,SACjB,MAAM,IAAI,MAAM,uCAAuC,EAGzD,IAAIC,EAAUD,EAAI,MAAM,EAAE,QAAQ,IAAK,EAAE,EAAE,MAAM,EAAE,EACnD,GAAIC,EAAQ,OAAS,GAAKA,EAAQ,SAAW,GAAKA,EAAQ,OAAS,EACjE,MAAM,IAAI,MAAM,sBAAwBD,CAAG,GAIzCC,EAAQ,SAAW,GAAKA,EAAQ,SAAW,KAC7CA,EAAU,MAAM,UAAU,OAAO,MAAM,CAAC,EAAGA,EAAQ,IAAI,SAAUC,EAAG,CAClE,MAAO,CAACA,EAAGA,CAAC,CACd,CAAC,CAAC,GAIAD,EAAQ,SAAW,GAAGA,EAAQ,KAAK,IAAK,GAAG,EAE/C,IAAME,EAAW,SAASF,EAAQ,KAAK,EAAE,EAAG,EAAE,EAE9C,MAAO,CACL,EAAIE,GAAY,GAAM,IACtB,EAAIA,GAAY,GAAM,IACtB,EAAIA,GAAY,EAAK,IACrB,EAAGA,EAAW,IACd,IAAK,IAAMF,EAAQ,MAAM,EAAG,CAAC,EAAE,KAAK,EAAE,CACxC,CACF,CAEAH,GAAQ,WAAa,SAAqBM,EAAS,CAC5CA,IAASA,EAAU,CAAC,GACpBA,EAAQ,QAAOA,EAAQ,MAAQ,CAAC,GAErC,IAAMC,EAAS,OAAOD,EAAQ,OAAW,KACvCA,EAAQ,SAAW,MACnBA,EAAQ,OAAS,EACf,EACAA,EAAQ,OAENE,EAAQF,EAAQ,OAASA,EAAQ,OAAS,GAAKA,EAAQ,MAAQ,OAC/DG,EAAQH,EAAQ,OAAS,EAE/B,MAAO,CACL,MAAOE,EACP,MAAOA,EAAQ,EAAIC,EACnB,OAAQF,EACR,MAAO,CACL,KAAMN,GAASK,EAAQ,MAAM,MAAQ,WAAW,EAChD,MAAOL,GAASK,EAAQ,MAAM,OAAS,WAAW,CACpD,EACA,KAAMA,EAAQ,KACd,aAAcA,EAAQ,cAAgB,CAAC,CACzC,CACF,EAEAN,GAAQ,SAAW,SAAmBU,EAAQC,EAAM,CAClD,OAAOA,EAAK,OAASA,EAAK,OAASD,EAASC,EAAK,OAAS,EACtDA,EAAK,OAASD,EAASC,EAAK,OAAS,GACrCA,EAAK,KACX,EAEAX,GAAQ,cAAgB,SAAwBU,EAAQC,EAAM,CAC5D,IAAMF,EAAQT,GAAQ,SAASU,EAAQC,CAAI,EAC3C,OAAO,KAAK,OAAOD,EAASC,EAAK,OAAS,GAAKF,CAAK,CACtD,EAEAT,GAAQ,cAAgB,SAAwBY,EAASC,EAAIF,EAAM,CACjE,IAAMG,EAAOD,EAAG,QAAQ,KAClBE,EAAOF,EAAG,QAAQ,KAClBJ,EAAQT,GAAQ,SAASc,EAAMH,CAAI,EACnCK,EAAa,KAAK,OAAOF,EAAOH,EAAK,OAAS,GAAKF,CAAK,EACxDQ,EAAeN,EAAK,OAASF,EAC7BS,EAAU,CAACP,EAAK,MAAM,MAAOA,EAAK,MAAM,IAAI,EAElD,QAASQ,EAAI,EAAGA,EAAIH,EAAYG,IAC9B,QAASC,EAAI,EAAGA,EAAIJ,EAAYI,IAAK,CACnC,IAAIC,GAAUF,EAAIH,EAAaI,GAAK,EAChCE,EAAUX,EAAK,MAAM,MAEzB,GAAIQ,GAAKF,GAAgBG,GAAKH,GAC5BE,EAAIH,EAAaC,GAAgBG,EAAIJ,EAAaC,EAAc,CAChE,IAAMM,EAAO,KAAK,OAAOJ,EAAIF,GAAgBR,CAAK,EAC5Ce,EAAO,KAAK,OAAOJ,EAAIH,GAAgBR,CAAK,EAClDa,EAAUJ,EAAQH,EAAKQ,EAAOT,EAAOU,CAAI,EAAI,EAAI,CAAC,CACpD,CAEAZ,EAAQS,GAAQ,EAAIC,EAAQ,EAC5BV,EAAQS,GAAQ,EAAIC,EAAQ,EAC5BV,EAAQS,GAAQ,EAAIC,EAAQ,EAC5BV,EAAQS,CAAM,EAAIC,EAAQ,CAC5B,CAEJ,IClGA,IAAAG,GAAAC,EAAAC,IAAA,KAAMC,GAAQ,KAEd,SAASC,GAAaC,EAAKC,EAAQC,EAAM,CACvCF,EAAI,UAAU,EAAG,EAAGC,EAAO,MAAOA,EAAO,MAAM,EAE1CA,EAAO,QAAOA,EAAO,MAAQ,CAAC,GACnCA,EAAO,OAASC,EAChBD,EAAO,MAAQC,EACfD,EAAO,MAAM,OAASC,EAAO,KAC7BD,EAAO,MAAM,MAAQC,EAAO,IAC9B,CAEA,SAASC,IAAoB,CAC3B,GAAI,CACF,OAAO,SAAS,cAAc,QAAQ,CACxC,MAAY,CACV,MAAM,IAAI,MAAM,sCAAsC,CACxD,CACF,CAEAN,GAAQ,OAAS,SAAiBO,EAAQH,EAAQI,EAAS,CACzD,IAAIC,EAAOD,EACPE,EAAWN,EAEX,OAAOK,EAAS,MAAgB,CAACL,GAAU,CAACA,EAAO,cACrDK,EAAOL,EACPA,EAAS,QAGNA,IACHM,EAAWJ,GAAiB,GAG9BG,EAAOR,GAAM,WAAWQ,CAAI,EAC5B,IAAMJ,EAAOJ,GAAM,cAAcM,EAAO,QAAQ,KAAME,CAAI,EAEpDN,EAAMO,EAAS,WAAW,IAAI,EAC9BC,EAAQR,EAAI,gBAAgBE,EAAMA,CAAI,EAC5C,OAAAJ,GAAM,cAAcU,EAAM,KAAMJ,EAAQE,CAAI,EAE5CP,GAAYC,EAAKO,EAAUL,CAAI,EAC/BF,EAAI,aAAaQ,EAAO,EAAG,CAAC,EAErBD,CACT,EAEAV,GAAQ,gBAAkB,SAA0BO,EAAQH,EAAQI,EAAS,CAC3E,IAAIC,EAAOD,EAEP,OAAOC,EAAS,MAAgB,CAACL,GAAU,CAACA,EAAO,cACrDK,EAAOL,EACPA,EAAS,QAGNK,IAAMA,EAAO,CAAC,GAEnB,IAAMC,EAAWV,GAAQ,OAAOO,EAAQH,EAAQK,CAAI,EAE9CG,EAAOH,EAAK,MAAQ,YACpBI,EAAeJ,EAAK,cAAgB,CAAC,EAE3C,OAAOC,EAAS,UAAUE,EAAMC,EAAa,OAAO,CACtD,IC9DA,IAAAC,GAAAC,EAAAC,IAAA,KAAMC,GAAQ,KAEd,SAASC,GAAgBC,EAAOC,EAAQ,CACtC,IAAMC,EAAQF,EAAM,EAAI,IAClBG,EAAMF,EAAS,KAAOD,EAAM,IAAM,IAExC,OAAOE,EAAQ,EACXC,EAAM,IAAMF,EAAS,aAAeC,EAAM,QAAQ,CAAC,EAAE,MAAM,CAAC,EAAI,IAChEC,CACN,CAEA,SAASC,GAAQC,EAAKC,EAAGC,EAAG,CAC1B,IAAIJ,EAAME,EAAMC,EAChB,OAAI,OAAOC,EAAM,MAAaJ,GAAO,IAAMI,GAEpCJ,CACT,CAEA,SAASK,GAAUC,EAAMC,EAAMC,EAAQ,CACrC,IAAIC,EAAO,GACPC,EAAS,EACTC,EAAS,GACTC,EAAa,EAEjB,QAASC,EAAI,EAAGA,EAAIP,EAAK,OAAQO,IAAK,CACpC,IAAMC,EAAM,KAAK,MAAMD,EAAIN,CAAI,EACzBQ,EAAM,KAAK,MAAMF,EAAIN,CAAI,EAE3B,CAACO,GAAO,CAACH,IAAQA,EAAS,IAE1BL,EAAKO,CAAC,GACRD,IAEMC,EAAI,GAAKC,EAAM,GAAKR,EAAKO,EAAI,CAAC,IAClCJ,GAAQE,EACJV,GAAO,IAAKa,EAAMN,EAAQ,GAAMO,EAAMP,CAAM,EAC5CP,GAAO,IAAKS,EAAQ,CAAC,EAEzBA,EAAS,EACTC,EAAS,IAGLG,EAAM,EAAIP,GAAQD,EAAKO,EAAI,CAAC,IAChCJ,GAAQR,GAAO,IAAKW,CAAU,EAC9BA,EAAa,IAGfF,GAEJ,CAEA,OAAOD,CACT,CAEAf,GAAQ,OAAS,SAAiBsB,EAAQC,EAASC,EAAI,CACrD,IAAMC,EAAOxB,GAAM,WAAWsB,CAAO,EAC/BV,EAAOS,EAAO,QAAQ,KACtBV,EAAOU,EAAO,QAAQ,KACtBI,EAAab,EAAOY,EAAK,OAAS,EAElCE,EAAMF,EAAK,MAAM,MAAM,EAEzB,SAAWvB,GAAeuB,EAAK,MAAM,MAAO,MAAM,EAClD,YAAcC,EAAa,IAAMA,EAAa,SAF9C,GAIEX,EACJ,SAAWb,GAAeuB,EAAK,MAAM,KAAM,QAAQ,EACnD,OAASd,GAASC,EAAMC,EAAMY,EAAK,MAAM,EAAI,MAEzCG,EAAU,gBAAuBF,EAAa,IAAMA,EAAa,IAIjEG,EAAS,4CAFAJ,EAAK,MAAa,UAAYA,EAAK,MAAQ,aAAeA,EAAK,MAAQ,KAA1D,IAEwCG,EAAU,iCAAmCD,EAAKZ,EAAO;AAAA,EAE7H,OAAI,OAAOS,GAAO,YAChBA,EAAG,KAAMK,CAAM,EAGVA,CACT,IChFA,IAAAC,GAAAC,EAAAC,IAAA,CACA,IAAMC,GAAa,KAEbC,GAAS,KACTC,GAAiB,KACjBC,GAAc,KAEpB,SAASC,GAAcC,EAAYC,EAAQC,EAAMC,EAAMC,EAAI,CACzD,IAAMC,EAAO,CAAC,EAAE,MAAM,KAAK,UAAW,CAAC,EACjCC,EAAUD,EAAK,OACfE,EAAc,OAAOF,EAAKC,EAAU,CAAC,GAAM,WAEjD,GAAI,CAACC,GAAe,CAACZ,GAAW,EAC9B,MAAM,IAAI,MAAM,oCAAoC,EAGtD,GAAIY,EAAa,CACf,GAAID,EAAU,EACZ,MAAM,IAAI,MAAM,4BAA4B,EAG1CA,IAAY,GACdF,EAAKF,EACLA,EAAOD,EACPA,EAASE,EAAO,QACPG,IAAY,IACjBL,EAAO,YAAc,OAAOG,EAAO,KACrCA,EAAKD,EACLA,EAAO,SAEPC,EAAKD,EACLA,EAAOD,EACPA,EAAOD,EACPA,EAAS,QAGf,KAAO,CACL,GAAIK,EAAU,EACZ,MAAM,IAAI,MAAM,4BAA4B,EAG9C,OAAIA,IAAY,GACdJ,EAAOD,EACPA,EAASE,EAAO,QACPG,IAAY,GAAK,CAACL,EAAO,aAClCE,EAAOD,EACPA,EAAOD,EACPA,EAAS,QAGJ,IAAI,QAAQ,SAAUO,EAASC,EAAQ,CAC5C,GAAI,CACF,IAAMC,EAAOd,GAAO,OAAOM,EAAMC,CAAI,EACrCK,EAAQR,EAAWU,EAAMT,EAAQE,CAAI,CAAC,CACxC,OAASQ,EAAG,CACVF,EAAOE,CAAC,CACV,CACF,CAAC,CACH,CAEA,GAAI,CACF,IAAMD,EAAOd,GAAO,OAAOM,EAAMC,CAAI,EACrCC,EAAG,KAAMJ,EAAWU,EAAMT,EAAQE,CAAI,CAAC,CACzC,OAASQ,EAAG,CACVP,EAAGO,CAAC,CACN,CACF,CAEAjB,GAAQ,OAASE,GAAO,OACxBF,GAAQ,SAAWK,GAAa,KAAK,KAAMF,GAAe,MAAM,EAChEH,GAAQ,UAAYK,GAAa,KAAK,KAAMF,GAAe,eAAe,EAG1EH,GAAQ,SAAWK,GAAa,KAAK,KAAM,SAAUW,EAAME,EAAGT,EAAM,CAClE,OAAOL,GAAY,OAAOY,EAAMP,CAAI,CACtC,CAAC,IC3ED,IAAAU,GAAAC,EAAA,CAAAC,GAAAC,KAAA,cAEA,IAAIC,GAAS,OAAO,UAAU,eAC1BC,GAAQ,OAAO,UAAU,SACzBC,GAAiB,OAAO,eACxBC,GAAO,OAAO,yBAEdC,GAAU,SAAiBC,EAAK,CACnC,OAAI,OAAO,MAAM,SAAY,WACrB,MAAM,QAAQA,CAAG,EAGlBJ,GAAM,KAAKI,CAAG,IAAM,gBAC5B,EAEIC,GAAgB,SAAuBC,EAAK,CAC/C,GAAI,CAACA,GAAON,GAAM,KAAKM,CAAG,IAAM,kBAC/B,MAAO,GAGR,IAAIC,EAAoBR,GAAO,KAAKO,EAAK,aAAa,EAClDE,EAAmBF,EAAI,aAAeA,EAAI,YAAY,WAAaP,GAAO,KAAKO,EAAI,YAAY,UAAW,eAAe,EAE7H,GAAIA,EAAI,aAAe,CAACC,GAAqB,CAACC,EAC7C,MAAO,GAKR,IAAIC,EACJ,IAAKA,KAAOH,EAAK,CAEjB,OAAO,OAAOG,EAAQ,KAAeV,GAAO,KAAKO,EAAKG,CAAG,CAC1D,EAGIC,GAAc,SAAqBC,EAAQC,EAAS,CACnDX,IAAkBW,EAAQ,OAAS,YACtCX,GAAeU,EAAQC,EAAQ,KAAM,CACpC,WAAY,GACZ,aAAc,GACd,MAAOA,EAAQ,SACf,SAAU,EACX,CAAC,EAEDD,EAAOC,EAAQ,IAAI,EAAIA,EAAQ,QAEjC,EAGIC,GAAc,SAAqBP,EAAKQ,EAAM,CACjD,GAAIA,IAAS,YACZ,GAAKf,GAAO,KAAKO,EAAKQ,CAAI,GAEnB,GAAIZ,GAGV,OAAOA,GAAKI,EAAKQ,CAAI,EAAE,UAJvB,QAQF,OAAOR,EAAIQ,CAAI,CAChB,EAEAhB,GAAO,QAAU,SAASiB,GAAS,CAClC,IAAIH,EAASE,EAAME,EAAKC,EAAMC,EAAaC,EACvCR,EAAS,UAAU,CAAC,EACpBS,EAAI,EACJC,EAAS,UAAU,OACnBC,EAAO,GAaX,IAVI,OAAOX,GAAW,YACrBW,EAAOX,EACPA,EAAS,UAAU,CAAC,GAAK,CAAC,EAE1BS,EAAI,IAEDT,GAAU,MAAS,OAAOA,GAAW,UAAY,OAAOA,GAAW,cACtEA,EAAS,CAAC,GAGJS,EAAIC,EAAQ,EAAED,EAGpB,GAFAR,EAAU,UAAUQ,CAAC,EAEjBR,GAAW,KAEd,IAAKE,KAAQF,EACZI,EAAMH,GAAYF,EAAQG,CAAI,EAC9BG,EAAOJ,GAAYD,EAASE,CAAI,EAG5BH,IAAWM,IAEVK,GAAQL,IAASZ,GAAcY,CAAI,IAAMC,EAAcf,GAAQc,CAAI,KAClEC,GACHA,EAAc,GACdC,EAAQH,GAAOb,GAAQa,CAAG,EAAIA,EAAM,CAAC,GAErCG,EAAQH,GAAOX,GAAcW,CAAG,EAAIA,EAAM,CAAC,EAI5CN,GAAYC,EAAQ,CAAE,KAAMG,EAAM,SAAUC,EAAOO,EAAMH,EAAOF,CAAI,CAAE,CAAC,GAG7D,OAAOA,EAAS,KAC1BP,GAAYC,EAAQ,CAAE,KAAMG,EAAM,SAAUG,CAAK,CAAC,GAQvD,OAAON,CACR,ICpHA,OAAS,OAAAY,OAAW,sBACpB,OAAOC,OAA6B,QCApC,OAAS,YAAAC,GAAU,QAAAC,OAAY,sB,uDCoD/B,IAAMC,GAAaC,GACR,MAAM,QAAQA,CAAK,EAAIA,EAAQ,CAACA,CAAK,EAS1CC,GAAU,IAAIC,IAAQ,CAACF,KAAUG,IAAS,CAC5C,IAAIC,EAASJ,EACPK,EAAcH,EAAI,MAAM,EAAE,QAAQ,EACxC,QAASI,EAAI,EAAGA,EAAID,EAAY,OAAQC,GAAK,EAAG,CAC5C,IAAMC,EAAKF,EAAYC,CAAC,EACxBF,EAASG,EAAGH,EAAQ,GAAGD,CAAI,CAC/B,CACA,OAAOC,CACX,EAqFA,IAAMI,GAAaC,GAAU,oBAAoB,KAAK,GAAGA,CAAK,EAAE,EAO1DC,GAAgBD,GAAU,CAC5B,IAAME,EAAQH,GAAUC,CAAK,EAC7B,GAAIE,EAAO,CACP,IAAMC,EAAI,WAAWD,EAAM,CAAC,CAAC,EAE7B,MAAO,CAAE,QADOC,EAAI,IACF,MAAOA,CAAE,CAC/B,CACA,OAAO,IACX,EA+FA,IAAMC,GAAgBC,GACX,OAAOA,GAAU,SAAW,OAAO,WAAWA,CAAK,EAAIA,EC1QlE,IAAAC,GAAuB,WACvBC,GAAqB,WACrBC,GAAwB,WACxBC,GAAoB,WACpBC,GAAsB,WAQhBC,GAAWC,GAAUA,EAAM,OAAO,OAAO,EAOzCC,GAAeC,GAAWA,EAAO,OAAO,CAACC,EAAKC,IAAU,CAC1D,IAAMC,EAAI,MAAM,QAAQD,CAAK,EAAIE,GAAQF,CAAK,EAAIA,EAClD,cAAO,KAAKC,CAAC,EAAE,QAASE,GAAQ,CACxBF,EAAEE,CAAG,IAAM,MAAQF,EAAEE,CAAG,IAAM,SAC9BJ,EAAII,CAAG,EAAIF,EAAEE,CAAG,EAExB,CAAC,EACMJ,CACX,EAAG,CAAC,CAAC,EAOCG,GAAUE,GAAQP,GAAaF,GAAUU,EAAU,EAqBzD,IAAMC,GAASC,GAAU,SAAS,KAAKA,CAAK,EACtCC,GAASD,GAAU,SAAS,KAAKA,CAAK,EAOtCE,GAAYF,GAAU,CACxB,IAAMG,EAAM,GAAAC,QAAY,IAAI,IAAIJ,CAAK,EACrC,OAAO,GAAAI,QAAY,GAAG,IAAID,CAAG,CACjC,EAOME,GAAYL,GAAU,CACxB,IAAMM,EAAM,GAAAF,QAAY,IAAI,IAAIJ,CAAK,EAAE,IAAI,KAAK,KAAK,EAErD,SADY,GAAAO,SAAS,GAAGD,CAAG,EAChB,YAAY,CAC3B,EAOME,GAAkBR,GAChBD,GAAMC,CAAK,EACJE,GAASF,CAAK,EACrBC,GAAMD,CAAK,EACJK,GAASL,CAAK,EAClBA,EASLS,GAAcT,GAAU,CAC1B,GAAI,OAAOA,GAAU,SACjB,MAAO,CAAE,MAAAA,EAAO,KAAM,MAAU,EACpC,IAAMU,EAAQ,8CAA8C,KAAKV,CAAK,EACtE,OAAOU,EACD,CAAE,MAAO,WAAWA,EAAM,CAAC,CAAC,EAAG,KAAMA,EAAM,CAAC,GAAK,IAAK,EACtD,CAAE,MAAAV,EAAO,KAAM,MAAU,CACnC,EAQMW,EAAgB,CAACC,EAAWZ,IAAU,CACxC,IAAMa,EAASJ,GAAWT,CAAK,EACzBc,EAAY,GACZC,EAAWH,EAAU,KAAO,GAC5BI,EAAY,EAAI,KAAQF,EACxBG,EAAY,EAAI,KAAQH,EAC9B,GAAI,OAAOD,EAAO,OAAU,SACxB,OAAOA,EAAO,MAClB,OAAQA,EAAO,KAAM,CACjB,IAAK,MACD,OAAOA,EAAO,OAASD,EAAU,SAAW,IAChD,IAAK,KACD,OAAOC,EAAO,MAAQC,EAC1B,IAAK,KACD,OAAOD,EAAO,MAAQG,EAC1B,IAAK,KACD,OAAOH,EAAO,MAAQI,EAC1B,IAAK,KACD,OAAOJ,EAAO,OAASD,EAAU,OAAS,KAC9C,IAAK,KACD,OAAOC,EAAO,OAASD,EAAU,MAAQ,KAC7C,IAAK,KACD,OAAO,KAAK,MAAMC,EAAO,OAASC,EAAYC,EAAS,EAC3D,QACI,OAAOF,EAAO,KACtB,CACJ,EAEMK,GAAqB,CAACC,EAAKnB,KAAW,CACxC,CAACmB,CAAG,EAAGC,GAAapB,CAAK,CAC7B,GACMqB,EAAmB,CAACF,EAAKnB,EAAOY,KAAe,CACjD,CAACO,CAAG,EAAGR,EAAcC,EAAWZ,CAAK,CACzC,GACMsB,GAAoB,CAACH,EAAKnB,KACb,CAAE,CAACmB,CAAG,EAAGX,GAAeR,CAAK,CAAE,GAG5CuB,EAAmB,CAACJ,EAAKnB,KAAW,CACtC,CAACmB,CAAG,EAAGnB,CACX,GAEMwB,GAAyB,0DACzBC,GAAwBzB,GAAUA,EAAM,MAAMwB,EAAsB,GAAK,CAAC,EAC1EE,GAAyB,CAACP,EAAKnB,EAAOY,IAAc,CACtD,IAAMF,EAAQe,GAAqB,GAAGzB,CAAK,EAAE,EAC7C,GAAIU,EAAO,CACP,IAAMiB,EAAajB,EAAM,CAAC,GAAKV,EACzB4B,EAAalB,EAAM,CAAC,GAAKV,EACzB6B,EAAanB,EAAM,CAAC,GAAKV,EACzB8B,EAAQF,EACRG,EAAQF,EAAarB,GAAeqB,CAAU,EAAI,OAClDG,EAAQL,EAAahB,EAAcC,EAAWe,CAAU,EAAI,OAClE,GAAIR,EAAI,MAAM,0BAA0B,EACpC,MAAO,CACH,CAAC,GAAGA,CAAG,OAAO,EAAGY,EACjB,CAAC,GAAGZ,CAAG,OAAO,EAAGW,EACjB,CAAC,GAAGX,CAAG,OAAO,EAAGa,CACrB,EAEJ,GAAIb,EAAI,MAAM,QAAQ,EAClB,MAAO,CACH,eAAgBY,EAChB,iBAAkBA,EAClB,kBAAmBA,EACnB,gBAAiBA,CACrB,EAEJ,GAAIZ,EAAI,MAAM,QAAQ,EAAG,CACrB,GAAI,OAAOW,GAAU,SACjB,MAAM,IAAI,MAAM,yBAAyBA,CAAK,EAAE,EACpD,MAAO,CACH,eAAgBA,EAChB,iBAAkBA,EAClB,kBAAmBA,EACnB,gBAAiBA,CACrB,CACJ,CACA,GAAIX,EAAI,MAAM,QAAQ,EAAG,CACrB,GAAI,OAAOa,GAAU,SACjB,MAAM,IAAI,MAAM,yBAAyBA,CAAK,EAAE,EACpD,MAAO,CACH,eAAgBA,EAChB,iBAAkBA,EAClB,kBAAmBA,EACnB,gBAAiBA,CACrB,CACJ,CACA,GAAIb,EAAI,MAAM,SAAS,EAAG,CACtB,IAAMc,EAASjC,EAAQW,EAAcC,EAAWZ,CAAK,EAAI,OACzD,GAAI,OAAOiC,GAAW,SAClB,MAAM,IAAI,MAAM,0BAA0BA,CAAM,EAAE,EACtD,MAAO,CACH,oBAAqBA,EACrB,qBAAsBA,EACtB,wBAAyBA,EACzB,uBAAwBA,CAC5B,CACJ,CACA,GAAI,OAAOD,GAAU,SACjB,MAAM,IAAI,MAAM,yBAAyBA,CAAK,EAAE,EACpD,GAAI,OAAOF,GAAU,SACjB,MAAM,IAAI,MAAM,yBAAyBA,CAAK,EAAE,EACpD,MAAO,CACH,eAAgBC,EAChB,eAAgBD,EAChB,eAAgBE,EAChB,iBAAkBD,EAClB,iBAAkBD,EAClB,iBAAkBE,EAClB,kBAAmBD,EACnB,kBAAmBD,EACnB,kBAAmBE,EACnB,gBAAiBD,EACjB,gBAAiBD,EACjB,gBAAiBE,CACrB,CACJ,CACA,MAAO,CAAE,CAACb,CAAG,EAAGnB,CAAM,CAC1B,EACMkC,GAAa,CACf,OAASR,GACT,aAAeA,GACf,kBAAoBJ,GACpB,uBAAyBD,EACzB,wBAA0BA,EAC1B,kBAAoBE,EACpB,kBAAoBF,EACpB,YAAcK,GACd,WAAaA,GACb,gBAAkBJ,GAClB,gBAAkBC,EAClB,gBAAkBF,EAClB,aAAeK,GACf,YAAcA,GACd,iBAAmBJ,GACnB,iBAAmBC,EACnB,iBAAmBF,EACnB,YAAcK,GACd,UAAYA,GACZ,eAAiBJ,GACjB,oBAAsBD,EACtB,qBAAuBA,EACvB,eAAiBE,EACjB,eAAiBF,EACjB,YAAcK,EAClB,EAEMS,GAAa,CACf,gBAAkBb,GAClB,MAAQA,GACR,QAAUJ,EACd,EAEMkB,GAAa,CACf,OAASf,EACT,UAAYA,EACZ,SAAWA,EACX,UAAYA,EACZ,SAAWA,EACX,MAAQA,CACZ,EAIMgB,GAAe,CAAC,EAAG,EAAG,CAAC,EACvBC,GAAW,CAAC,EAAG,EAAG,MAAM,EACxBC,GAAuB,CAACpB,EAAKnB,EAAOY,IAAc,CACpD,IAAI4B,EAAWH,GACXI,EAAU,CAAC,EACXzC,IAAU,OACVwC,EAAWF,GAGXG,EAAU,GAAGzC,CAAK,GAAG,MAAM,GAAG,EAElC,IAAM0C,EAAWtB,GAAaqB,EAAQ,CAAC,GAAKD,EAAS,CAAC,CAAC,EACjDG,EAAavB,GAAaqB,EAAQ,CAAC,GAAKD,EAAS,CAAC,CAAC,EACnDI,EAAYjC,EAAcC,EAAW6B,EAAQ,CAAC,GAAKD,EAAS,CAAC,CAAC,EACpE,MAAO,CAAE,SAAAE,EAAU,WAAAC,EAAY,UAAAC,CAAU,CAC7C,EACMC,GAAa,CACf,aAAetB,EACf,WAAaA,EACb,UAAYA,EACZ,KAAOgB,GACP,UAAYlB,EACZ,cAAgBE,EAChB,SAAWA,EACX,SAAWL,GACX,WAAaA,GACb,SAAWK,EACX,eAAiBA,EACjB,YAAcA,CAClB,EAEMuB,GAAsB,CAAC3B,EAAKnB,EAAOY,IAAc,CACnD,IAAMF,EAAQ,GAAGV,CAAK,GAAG,MAAM,GAAG,EAC5B+C,EAASpC,EAAcC,EAAWF,IAAQ,CAAC,GAAKV,CAAK,EACrDgD,EAAYrC,EAAcC,EAAWF,IAAQ,CAAC,GAAKV,CAAK,EAC9D,MAAO,CAAE,OAAA+C,EAAQ,UAAAC,CAAU,CAC/B,EACMC,GAAa,CACf,IAAMH,GACN,UAAYzB,EACZ,OAASA,CACb,EAEM6B,GAAa,CACf,YAAchC,GACd,OAASG,EACT,QAAUE,EACV,KAAOF,EACP,SAAWE,EACX,MAAQF,EACR,IAAMA,EACN,SAAWE,EACX,OAASL,EACb,EAEMiC,GAAkB,yBAClBC,GAAW,CAACtB,EAAO9B,IAAU,CAC/B,IAAMqD,EAAOvB,EAAM,SAAS,EAE5B,QAAQ,MAAM;AAAA;AAAA,MAEZuB,CAAI,KAAKrD,CAAK;AAAA,MACd,IAAI,OAAOqD,EAAK,OAAS,CAAC,CAAC;AAAA,kBACfA,CAAI;AAAA,GACnB,CACH,EAOMC,GAAiB,CAAC,CAAE,UAAAC,EAAW,UAAAC,EAAY,EAAG,cAAAC,EAAgB,EAAO,EAAI,CAAC,IAAM,CAACC,EAAO1D,EAAOY,IAAc,CAC/G,IAAM+C,KAAQ,GAAAC,SAAQ,GAAG5D,CAAK,EAAE,EAC1B6D,EAAQ,CAAC,EACf,QAASC,EAAI,EAAGA,EAAIH,EAAM,OAAQG,IAAK,CACnC,IAAMC,EAAOJ,EAAMG,CAAC,EAGpB,GAAIC,EAAK,OAAS,YACdA,EAAK,OAAS,UACdA,EAAK,OAAS,MACd,OAAAX,GAASM,EAAO1D,CAAK,EACd,CAAC,EAEZ,GAAI+D,EAAK,OAAS,OACd,GAAIA,EAAK,QAAU,QAAUN,EACzBI,EAAM,KAAKE,EAAK,KAAK,MAEpB,CACD,IAAMC,KAAS,GAAAC,SAAUF,EAAK,KAAK,EAEnC,GAAIC,GAAUb,GAAgB,SAASa,EAAO,IAAI,EAC9CH,EAAM,KAAKE,EAAK,KAAK,MAGrB,QAAAX,GAASM,EAAO1D,CAAK,EACd,CAAC,CAEhB,CAER,CAEA,GAAI6D,EAAM,OAASL,EACf,OAAAJ,GAASM,EAAO1D,CAAK,EACd,CAAC,EAEZ,IAAMkE,EAAQvD,EAAcC,EAAWiD,EAAM,CAAC,CAAC,EAC/C,GAAIN,EAAW,CACX,IAAMY,EAASxD,EAAcC,EAAWiD,EAAM,CAAC,GAAKA,EAAM,CAAC,CAAC,EACtDO,EAAQzD,EAAcC,EAAWiD,EAAM,CAAC,GAAKA,EAAM,CAAC,CAAC,EACrDQ,EAAS1D,EAAcC,EAAWiD,EAAM,CAAC,GAAKA,EAAM,CAAC,GAAKA,EAAM,CAAC,CAAC,EACxE,OAAON,EAAU,CAAE,MAAAW,EAAO,OAAAC,EAAQ,MAAAC,EAAO,OAAAC,CAAO,CAAC,CACrD,CACA,MAAO,CACH,CAACX,CAAK,EAAGQ,CACb,CACJ,EAEMI,GAAgBhB,GAAe,CACjC,UAAW,CAAC,CAAE,MAAAY,EAAO,OAAAC,EAAQ,MAAAC,EAAO,OAAAC,CAAO,KAAO,CAC9C,UAAWH,EACX,YAAaC,EACb,aAAcC,EACd,WAAYC,CAChB,GACA,UAAW,EACX,cAAe,EACnB,CAAC,EACKE,GAAwBjB,GAAe,CACzC,UAAW,CAAC,CAAE,MAAAY,EAAO,OAAAC,CAAO,KAAO,CAC/B,UAAWD,EACX,aAAcC,CAClB,GACA,UAAW,EACX,cAAe,EACnB,CAAC,EACKK,GAA0BlB,GAAe,CAC3C,UAAW,CAAC,CAAE,MAAAY,EAAO,OAAAC,CAAO,KAAO,CAC/B,YAAaD,EACb,WAAYC,CAChB,GACA,UAAW,EACX,cAAe,EACnB,CAAC,EACKM,GAAsBnB,GAAe,CACvC,cAAe,EACnB,CAAC,EACKoB,GAAa,CACf,OAASJ,GACT,aAAeG,GACf,iBAAmBD,GACnB,WAAaC,GACb,YAAcA,GACd,UAAYA,GACZ,eAAiBF,EACrB,EAEMI,GAAiBrB,GAAe,CAClC,UAAW,CAAC,CAAE,MAAAY,EAAO,OAAAC,EAAQ,MAAAC,EAAO,OAAAC,CAAO,KAAO,CAC9C,WAAYH,EACZ,aAAcC,EACd,cAAeC,EACf,YAAaC,CACjB,GACA,UAAW,CACf,CAAC,EACKO,GAAyBtB,GAAe,CAC1C,UAAW,CAAC,CAAE,MAAAY,EAAO,OAAAC,CAAO,KAAO,CAC/B,WAAYD,EACZ,cAAeC,CACnB,GACA,UAAW,CACf,CAAC,EACKU,GAA2BvB,GAAe,CAC5C,UAAW,CAAC,CAAE,MAAAY,EAAO,OAAAC,CAAO,KAAO,CAC/B,aAAcD,EACd,YAAaC,CACjB,GACA,UAAW,CACf,CAAC,EACKW,GAAuBxB,GAAe,EACtCyB,GAAa,CACf,QAAUJ,GACV,cAAgBG,GAChB,kBAAoBD,GACpB,YAAcC,GACd,aAAeA,GACf,WAAaA,GACb,gBAAkBF,EACtB,EAEMI,GAAiBhF,GAAU,CAC7B,OAAQA,EAAO,CACX,IAAK,MACL,IAAK,OACD,MAAO,KACX,IAAK,QACL,IAAK,SACD,MAAO,OACX,IAAK,SACD,MAAO,MACX,QACI,OAAOA,CACf,CACJ,EAEMiF,GAAwB,CAAC9D,EAAKnB,EAAOY,IAAc,CACrD,IAAMF,EAAQ,GAAGV,CAAK,GAAG,MAAM,GAAG,EAC5BkF,EAAkBF,GAAcrE,EAAcC,EAAWF,IAAQ,CAAC,GAAKV,CAAK,CAAC,EAC7EmF,EAAkBH,GAAcrE,EAAcC,EAAWF,IAAQ,CAAC,GAAKV,CAAK,CAAC,EACnF,MAAO,CAAE,gBAAAkF,EAAiB,gBAAAC,CAAgB,CAC9C,EACMC,GAA6B,CAACjE,EAAKnB,EAAOY,KAAe,CAC3D,CAACO,CAAG,EAAG6D,GAAcrE,EAAcC,EAAWZ,CAAK,CAAC,CACxD,GACMqF,GAAa,CACf,eAAiBJ,GACjB,gBAAkBG,GAClB,gBAAkBA,GAClB,UAAY7D,CAChB,EAEM+D,GAAWtF,GACT,OAAOA,GAAU,SACVA,EACJ,SAASA,EAAO,EAAE,EAGvBuF,GAAe,CACjB,KAAM,IACN,SAAU,IACV,WAAY,IACZ,WAAY,IACZ,MAAO,IACP,OAAQ,IACR,OAAQ,IACR,SAAU,IACV,SAAU,IACV,KAAM,IACN,UAAW,IACX,UAAW,IACX,MAAO,IACP,MAAO,GACX,EACMC,GAAuBxF,GAAU,CACnC,GAAI,CAACA,EACD,OAAOuF,GAAa,OACxB,GAAI,OAAOvF,GAAU,SACjB,OAAOA,EACX,IAAMyF,EAAKzF,EAAM,YAAY,EAC7B,OAAIuF,GAAaE,CAAE,EACRF,GAAaE,CAAE,EACnBH,GAAQtF,CAAK,CACxB,EACM0F,GAAoB,CAACvE,EAAKnB,KACrB,CAAE,CAACmB,CAAG,EAAGqE,GAAoBxF,CAAK,CAAE,GAEzC2F,GAAsB,CAAC3F,EAAO4F,EAAQhF,IAAc,CACtD,GAAIZ,IAAU,GACV,OAAOA,EACX,IAAM6F,EAAWlF,EAAcC,EAAWgF,EAAO,UAAY,EAAE,EACzDE,EAAanF,EAAcC,EAAWZ,CAAK,EAE3C,CAAE,QAAA+F,CAAQ,EAAIC,GAAaF,CAAU,GAAK,CAAC,EACjD,OAAIC,EACOA,EAAUF,EAEd,MAAM7F,CAAK,EAAI8F,EAAaA,EAAaD,CACpD,EACMI,GAAoB,CAAC9E,EAAKnB,EAAOY,EAAWgF,KACvC,CACH,CAACzE,CAAG,EAAGwE,GAAoB3F,EAAO4F,EAAQhF,CAAS,CACvD,GAEEsF,GAAa,CACf,UAAY3E,EACZ,WAAaA,EACb,SAAWF,EACX,UAAYE,EACZ,WAAamE,GACb,cAAgBrE,EAChB,WAAa4E,GACb,SAAW/E,GACX,UAAYK,EACZ,eAAiBA,EACjB,oBAAsBD,GACtB,oBAAsBC,EACtB,WAAaA,EACb,aAAeA,EACf,cAAgBA,EAChB,cAAgBA,CACpB,EAEM4E,GAAenG,GAAU,OAAOA,GAAU,UAAY,gBAAgB,KAAKA,CAAK,EAChFoG,GAAapG,GACX,OAAOA,GAAU,SACVA,EACPmG,GAAYnG,CAAK,EACV,WAAWA,CAAK,EACpBA,EAGLqG,GAASC,GAAoB,CAC/B,IAAMC,EAAaD,EAAgB,KAAK,EAAE,MAAM,WAAW,EAE3D,GAAIC,EAAW,SAAW,EACtB,MAAO,CAAC,CAACA,EAAW,CAAC,EAAG,EAAI,CAAC,EAEjC,IAAMC,EAAS,CAAC,EAChB,QAAS1C,EAAI,EAAGA,EAAIyC,EAAW,OAAQzC,GAAK,EAAG,CAC3C,IAAM2C,EAAYF,EAAWzC,CAAC,EAC9B,GAAI2C,EAAW,CACX,GAAM,CAACpD,EAAMqD,CAAQ,EAAID,EAAU,MAAM,GAAG,EACtCE,EAAYD,EAAS,QAAQ,GAAG,GAAK,EAAI,IAAM,IAC/C1G,EAAQ0G,EAAS,MAAMC,CAAS,EAAE,IAAKC,GAAQA,EAAI,KAAK,CAAC,EAC/DJ,EAAO,KAAK,CAAE,UAAWnD,EAAK,KAAK,EAAG,MAAArD,CAAM,CAAC,CACjD,CACJ,CACA,OAAOwG,CACX,EACMK,GAAc7G,GAAU,CAC1B,IAAM8G,EAAc,uBACd,CAAC,CAAEC,EAAOC,CAAI,EAAIF,EAAY,KAAK9G,CAAK,EACxCiH,EAAS,OAAO,WAAWF,CAAK,EACtC,OAAOC,IAAS,MAASC,EAAS,IAAO,KAAK,GAAKA,CACvD,EACMC,GAA8B,CAAC,CAAE,UAAAC,EAAW,MAAAnH,CAAM,IAAM,CAC1D,OAAQmH,EAAW,CACf,IAAK,QAAS,CACV,GAAM,CAACC,EAAQC,EAASD,CAAM,EAAIpH,EAAM,IAAKsH,GAAQ,OAAO,WAAWA,CAAG,CAAC,EAC3E,MAAO,CAAE,UAAW,QAAS,MAAO,CAACF,EAAQC,CAAM,CAAE,CACzD,CACA,IAAK,SACD,MAAO,CAAE,UAAW,QAAS,MAAO,CAAC,OAAO,WAAWrH,CAAK,EAAG,CAAC,CAAE,EAEtE,IAAK,SACD,MAAO,CAAE,UAAW,QAAS,MAAO,CAAC,EAAG,OAAO,WAAWA,CAAK,CAAC,CAAE,EAEtE,IAAK,SACD,MAAO,CAAE,UAAW,SAAU,MAAO,CAAC6G,GAAW7G,CAAK,CAAC,CAAE,EAE7D,IAAK,YACD,MAAO,CACH,UAAW,YACX,MAAOA,EAAM,IAAKsH,GAAQ,OAAO,WAAWA,CAAG,CAAC,CACpD,EAEJ,IAAK,aACD,MAAO,CACH,UAAW,YACX,MAAO,CAAC,OAAO,WAAWtH,CAAK,EAAG,CAAC,CACvC,EAEJ,IAAK,aACD,MAAO,CAAE,UAAW,YAAa,MAAO,CAAC,EAAG,OAAO,WAAWA,CAAK,CAAC,CAAE,EAE1E,IAAK,OACD,MAAO,CAAE,UAAW,OAAQ,MAAOA,EAAM,IAAI6G,EAAU,CAAE,EAE7D,IAAK,QACD,MAAO,CAAE,UAAW,OAAQ,MAAO,CAACA,GAAW7G,CAAK,EAAG,CAAC,CAAE,EAE9D,IAAK,QACD,MAAO,CAAE,UAAW,OAAQ,MAAO,CAAC,EAAG6G,GAAW7G,CAAK,CAAC,CAAE,EAE9D,QACI,MAAO,CAAE,UAAAmH,EAAW,MAAOnH,EAAM,IAAKsH,GAAQ,OAAO,WAAWA,CAAG,CAAC,CAAE,CAE9E,CACJ,EACMC,GAAaC,GACRA,EAAW,IAAKL,GAAcD,GAA4BC,CAAS,CAAC,EAEzEM,GAAmB,CAACtG,EAAKnB,IACvB,OAAOA,GAAU,SACV,CAAE,CAACmB,CAAG,EAAGnB,CAAM,EACnB,CAAE,CAACmB,CAAG,EAAGoG,GAAUlB,GAAMrG,CAAK,CAAC,CAAE,EAEtC0H,GAAoB,CAAE,IAAK,GAAM,OAAQ,EAAK,EAC9CC,GAA0B,CAACC,EAAGC,IAC5BH,GAAkBE,CAAC,EACZ,EACPF,GAAkBG,CAAC,EACZ,GACJ,EAELC,GAA0BC,GACxB,CAACA,GAAUA,EAAO,SAAW,EACtB,CAAC,SAAU,QAAQ,GACjBA,EAAO,SAAW,EAAI,CAACA,EAAO,CAAC,EAAG,QAAQ,EAAIA,GAC/C,KAAKJ,EAAuB,EAGtCK,GAAkC,CAAC7G,EAAKnB,EAAOY,IAAc,CAC/D,IAAMF,EAAQ,GAAGV,CAAK,GAAG,MAAM,GAAG,EAC5BiI,EAAOH,GAAuBpH,CAAK,EACnCwH,EAAmBvH,EAAcC,EAAWqH,EAAK,CAAC,CAAC,EACnDE,EAAmBxH,EAAcC,EAAWqH,EAAK,CAAC,CAAC,EACzD,MAAO,CACH,iBAAkBjD,GAAckD,CAAgB,GAAK9B,GAAU8B,CAAgB,EAC/E,iBAAkBlD,GAAcmD,CAAgB,GAAK/B,GAAU+B,CAAgB,CACnF,CACJ,EACMC,GAA8B,CAACjH,EAAKnB,EAAOY,IAAc,CAC3D,IAAMyH,EAAI1H,EAAcC,EAAWZ,CAAK,EACxC,MAAO,CAAE,CAACmB,CAAG,EAAG6D,GAAcqD,CAAC,GAAKjC,GAAUiC,CAAC,CAAE,CACrD,EACMC,GAAa,CACf,UAAWb,GACX,kBAAmBA,GACnB,gBAAkBO,GAClB,iBAAmBI,GACnB,iBAAmBA,EACvB,EAEMG,GAAW,CACb,KAAOjH,GACP,OAASA,GACT,gBAAkBC,EAClB,YAAcF,EACd,YAAcH,GACd,cAAgBA,GAChB,SAAWK,EACX,WAAaA,EACb,cAAgBA,EAChB,eAAiBA,EACjB,WAAaA,EACb,SAAWA,EACX,iBAAmBA,CACvB,EAEMiH,GAAa,CACf,GAAGtG,GACH,GAAGC,GACH,GAAGC,GACH,GAAGS,GACH,GAAGI,GACH,GAAGC,GACH,GAAGwB,GACH,GAAGK,GACH,GAAGM,GACH,GAAGa,GACH,GAAGoC,GACH,GAAGC,EACP,uDC1qBO,SAASE,GAAOC,EAAGC,EAAAA,CACtB,IAAIC,EAAI,CAAA,EACR,QAASC,KAAKH,EAAOI,OAAOC,UAAUC,eAAeC,KAAKP,EAAGG,CAAAA,GAAMF,EAAEO,QAAQL,CAAAA,EAAK,IAC9ED,EAAEC,CAAAA,EAAKH,EAAEG,CAAAA,GACb,GAAIH,GAAK,MAAgD,OAAjCI,OAAOK,uBAA0B,WAChD,CAAA,IAAIC,EAAI,EAAb,IAAgBP,EAAIC,OAAOK,sBAAsBT,CAAAA,EAAIU,EAAIP,EAAEQ,OAAQD,IAC3DT,EAAEO,QAAQL,EAAEO,CAAAA,CAAAA,EAAM,GAAKN,OAAOC,UAAUO,qBAAqBL,KAAKP,EAAGG,EAAEO,CAAAA,CAAAA,IACvER,EAAEC,EAAEO,CAAAA,CAAAA,EAAMV,EAAEG,EAAEO,CAAAA,CAAAA,EAF4B,CAItD,OAAOR,CACX,CC/BO,IAAMW,GAAeC,EAAMC,cAAgC,CAC9DC,MAAO,CACHC,YAAa,CAAA,CAAA,CAAA,EAIG,SAAAC,GAAMC,EAAAA,CAAA,GAAA,CAAAC,SAC1BA,EAAQC,WACRA,EACAL,MAAOM,EAAUC,QACjBA,EAAOC,QACPA,CAAAA,EAESL,EADNM,EAAIC,GAAAP,EANmB,CAAA,WAAA,aAAA,QAAA,UAAA,SAAA,CAAA,EAQ1B,IAAMQ,EAAaC,GAAQ,IAAA,CACvB,IAAMZ,EAAQa,GAAQ,CAClB,CACIC,YAAa,UACbb,YAAa,MACbc,YAAa,OAAA,EAAA,GAEbC,MAAMC,QAAQX,CAAAA,EAAcA,EAAa,CAACA,CAAAA,CAAAA,CAAAA,EAGlD,GAA4B,OAAjBN,EAAMkB,QAAW,SAAU,CAClC,GAAA,CAAOjB,EAAac,EAAaD,CAAAA,EAAed,EAAMkB,OAAOC,MAAM,KAAA,EAEnEnB,EAAMC,YAAcmB,OAAOC,WAAWpB,CAAAA,EACtCD,EAAMe,YAAcA,EACpBf,EAAMc,YAAcA,CACvB,MACgC,OAAjBd,EAAMkB,QAAW,WAC7BlB,EAAMC,YAAcD,EAAMkB,QAM9B,OAJiC,OAAtBlB,EAAMC,aAAgB,WAC7BD,EAAMC,YAAcmB,OAAOC,WAAWrB,EAAMC,WAAAA,GAGzCD,CAAK,EACb,CAACM,CAAAA,CAAAA,EAEEgB,EAAOV,GAAQ,IAAA,CACjB,IAAMW,EAA+B,CAAA,EAE/BC,EAAmBC,GAAAA,CACrB3B,EAAM4B,SAASC,QAAQF,EAAOG,GAAAA,CACrB9B,EAAM+B,eAAeD,CAAAA,IAItBA,EAAME,OAAShC,EAAMiC,SACrBP,EAAiBI,EAAMI,MAAuC5B,QAAAA,EAG9DmB,EAAOU,KAAKL,CAAAA,EACf,CAAA,CACH,EAIN,OAFAJ,EAAgBpB,CAAAA,EAGZmB,EAAOW,IAAI,CAACC,EAAIC,IACZtC,EAAMuC,aAAaF,EAAI,CACnBG,IAAK,aAAaF,CAAAA,GAClBG,UAAWH,IAAa,EACxBI,SAAUJ,IAAab,EAAOkB,OAAS,CAAA,CAAA,CAAA,CAGjD,EACH,CAACrC,CAAAA,CAAAA,EAEEJ,EAAQY,GAAQ,IAAM,CACxB,CACI8B,MAAO,MAAA,EAAA,GAEP1B,MAAMC,QAAQX,CAAAA,EAAcA,EAAa,CAACA,CAAAA,EAC9CK,EAAWI,cAAgB,QAAU,CACjCG,OAAQ,KAAA,EAAA,MACRyB,EACNC,OAAOC,OAAAA,EAAU,CAACvC,CAAAA,CAAAA,EAEdwC,EAAoBlC,GAA0B,KAAO,CACvDZ,MAAOW,EACPN,WAAAA,EACAE,QAAAA,EACAC,QAAAA,CAAAA,GACA,CAACG,EAAYN,EAAYE,EAASC,CAAAA,CAAAA,EAEtC,OACIV,EAAAA,cAACD,GAAakD,SAAS,CAAAC,MAAOF,CAAAA,EAC1BhD,EAAAmD,cAACC,GAAIC,OAAAC,OAAA,CAAA,EAAK3C,EAAI,CAAET,MAAOA,CAAAA,CAAAA,EAClBsB,CAAAA,CAAAA,CAIjB,CCxGwB,SAAA+B,GAASlD,EAAAA,CAAA,GAAA,CAAAC,SAACA,EAAUJ,MAAOM,EAAUiC,UAAEA,EAASC,SAAEA,CAAAA,EAAiCrC,EAApBM,EAAIC,GAAAP,EAA1D,CAAA,WAAA,QAAA,YAAA,UAAA,CAAA,EAC7B,GAAA,CAAMK,QAACA,EAASH,WAAYiD,CAAAA,EAAmBC,GAAW1D,EAAAA,EAEpD2D,EAAQ5C,GAAQ,IAAA,CAAA,IAAA6C,EAAAC,EAClB,IAAMnC,EAA+B,CAAA,EAE/BC,EAAmBC,GAAAA,CACrB3B,EAAM4B,SAASC,QAAQF,EAAOG,GAAAA,CACrB9B,EAAM+B,eAAeD,CAAAA,IAItBA,EAAME,OAAShC,EAAMiC,SACrBP,EAAiBI,EAAMI,MAAuC5B,QAAAA,EAG9DmB,EAAOU,KAAKL,CAAAA,EACf,CAAA,CACH,EAENJ,EAAgBpB,CAAAA,EAEhB,IAAIC,EAAqC,CAAA,EAEzC,OAAK,CAAOsD,EAAOC,CAAAA,IAAQrC,EAAOsC,QAAAA,EACjB,GAAAJ,EAATG,EAAI5B,SAAK,MAAA7B,IAAL6B,SAAK7B,EAAE2D,UACXzD,EAAW4B,MAAK8B,EAAAH,EAAI5B,SAAK,MAAA+B,IAAL/B,OAAK+B,OAAAA,EAAED,SAAAA,EAG3BzD,EAAW4B,KAAKqB,IAAkBK,CAAAA,CAAAA,EAI1C,IACMK,GADqB,EAAI3D,EAAW4D,OAAO,CAACC,EAAKC,IAAQD,GAAOC,GAAO,GAAI,CAAA,IAC1B5C,EAAOkB,OAASpC,EAAWuC,OAAOc,GAAkB,OAANA,GAAM,QAANA,EAAgBjB,QAIrH,OAFApC,EAAaA,EAAW6B,IAAIwB,GAAKA,IAALA,OAAuBM,EAA2BN,CAAAA,EAG1EnC,EAAOW,IAAI,CAACkC,EAAIC,IACZvE,EAAMuC,aAAa+B,EAAI,CACnBN,UAAWzD,EAAWgE,CAAAA,EACtB/B,IAAK,aAAa+B,CAAAA,QAClBC,aAAcD,IAAgB,EAC9BE,YAAaF,IAAgB9C,EAAOkB,OAAS,EAC7CF,UAAAA,EACAC,SAAAA,CAAAA,CAAAA,CAAAA,CAGV,EACH,CAACpC,EAAUkD,EAAiBf,EAAWC,CAAAA,CAAAA,EAE1C,OACI1C,EAACmD,cAAAC,GAAAA,OAAAA,OAAAA,CAAAA,EACOzC,EAAI,CACRT,MAAO,CACH,CACIwE,QAAS,OACTC,cAAe,KAAA,EAAA,GAEfzD,MAAMC,QAAQT,CAAAA,EAAWA,EAAU,CAACA,CAAAA,EAAAA,GACpCQ,MAAMC,QAAQX,CAAAA,EAAcA,EAAa,CAACA,CAAAA,CAAAA,CAAAA,CAAAA,EAGjDkD,CAAAA,CAGb,CCzEwB,SAAAkB,GAAYvE,EAAAA,CAAAA,GAAAA,CAAAC,SAACA,EAAQJ,MAAEA,CAAAA,EAAKG,EAAKM,EAAIC,GAAAP,EAAzB,CAAA,WAAA,OAAA,CAAA,EAChC,OACIL,EAACmD,cAAAI,GAAAA,OAAAA,OAAAA,CAAAA,EACO5C,EAAI,CACRT,MAAO,CACH,CACI2E,WAAY,MAAA,EAAA,GAEZ3D,MAAMC,QAAQjB,CAAAA,EAASA,EAAQ,CAACA,CAAAA,CAAAA,CAAAA,CAAAA,EAGvCI,CAAAA,CAGb,CCAwB,SAAAwE,GAAUzE,EAAAA,CAAA,GAAA,CAAAC,SAC9BA,EAAQ0D,UAAEA,EAASQ,aACnBA,EAAYC,YAAEA,EAAWhC,UACzBA,EAASC,SAAEA,CAAAA,EAEErC,EADVM,EAAIC,GAAAP,EAJuB,CAAA,WAAA,YAAA,eAAA,cAAA,YAAA,UAAA,CAAA,EAM9B,IAAM0E,EAAUjE,GAAQ,IAAA,CACpB,IAAMW,EAAwB,CAAA,EAExBC,EAAmBC,GAAAA,CACrB3B,EAAM4B,SAASC,QAAQF,EAAOG,GAAAA,CACtB9B,EAAM+B,eAAeD,CAAAA,GAAUA,GAAOE,OAAShC,EAAMiC,SACrDP,EAAiBI,EAAMI,MAAuC5B,QAAAA,EAG9DmB,EAAOU,KAAKL,CAAAA,CACf,CAAA,CACH,EAIN,OAFAJ,EAAgBpB,CAAAA,EAGZmB,EAAOW,IAAI,CAACN,EAAO+B,IAAAA,CACf,IAAMrB,EAAM,cAAcqB,CAAAA,WAE1B,OAAqB,OAAV/B,GAAU,UAA6B,OAAVA,GAAU,SAE1C9B,EAACmD,cAAA6B,GAAK,CAAAxC,IAAKA,CAAAA,EAAMV,CAAAA,EAIdA,CACV,CAAA,CAEP,EACH,CAACxB,CAAAA,CAAAA,EAAAA,CAEEG,QAACA,EAASP,MAAOW,CAAAA,EAAc4C,GAAW1D,EAAAA,EAC1CkF,EAAAA,IAAmBpE,EAAwB,aAAK,GAAjC,KAGfqE,EAAUpE,GAAQ,IAChBD,EAAWI,cAAgB,QACpB,CACHkE,UAAW,GAAGtE,EAAwB,aAAK,CAAA,MAAOA,EAAWI,WAAAA,IAAeJ,EAAWG,WAAAA,GACvFoE,YAAa,GAAGvE,EAAwB,aAAK,CAAA,MAAOA,EAAWI,WAAAA,IAAeJ,EAAWG,WAAAA,GACzFqE,aAAc,GAAGxE,EAAwB,aAAK,CAAA,MAAOA,EAAWI,WAAAA,IAAeJ,EAAWG,WAAAA,GAC1FsE,WAAY,GAAGzE,EAAwB,aAAK,CAAA,MAAOA,EAAWI,WAAAA,IAAeJ,EAAWG,WAAAA,GACxFuE,OAAQ,GAAGN,CAAAA,IAAgBR,EAAcQ,EAAe,GAAA,IAAOvC,EAAWuC,EAAe,CAAA,IAAKA,CAAAA,EAAAA,EAI3F,CACHE,UAAW1C,EAAAA,OAAwB,GAAG5B,EAAwB,aAAK,CAAA,MAAOA,EAAWI,WAAAA,IAAeJ,EAAWG,WAAAA,GAC/GsE,WAAYd,EAAAA,OAA2B,GAAG3D,EAAwB,aAAK,CAAA,MAAOA,EAAWI,WAAAA,IAAeJ,EAAWG,WAAAA,EAAAA,EAG5H,CAACH,EAAY2D,EAAcC,EAAahC,EAAWA,CAAAA,CAAAA,EAEtD,OACIzC,EAACmD,cAAAC,GACGC,OAAAC,OAAA,CAAAkC,KAAAA,EAAM,EACF7E,EACJ,CAAAT,MAAO,CAAA,OAAA,OAAA,OAAA,OAAA,CAAA,EAEIgF,CAAAA,EAAO,CACVO,KAAMzB,GAAa,EACnBU,QAAS,OACTC,cAAe,MACfe,WAAY,QAAA,CAAA,EAAA,GAEZxE,MAAMC,QAAQV,CAAAA,EAAWA,EAAU,CAACA,CAAAA,EAAAA,GACpCS,MAAMC,QAAQR,EAAKT,KAAAA,EAASS,EAAKT,MAAQ,CAACS,EAAKT,KAAAA,CAAAA,CAAAA,CAAAA,EAGtD6E,CAAAA,CAGb,CCjGA,OAAS,SAAAY,GAAO,QAAAC,GAAM,QAAAC,GAAM,QAAAC,OAAY,sBCDxC,IAAAC,GAA+C,SAC/C,OAAOC,OAAW,QAQX,IAAMC,GAAiB,MAAOC,GAAiB,CACpD,IAAMC,EAAkC,CACtC,OAAQ,EACR,MAAO,IACP,MAAO,CACL,KAAM,OACN,MAAO,MACT,CACF,EACA,OAAO,GAAAC,QAAO,UAAUF,EAAMC,CAAO,CACvC,EAGO,SAASE,GAAmBC,EAAmC,CACpE,GAAM,CAAE,cAAAC,EAAe,WAAAC,EAAY,KAAAC,EAAM,SAAAC,EAAW,CAAC,EAAG,OAAAC,EAAS,CAAC,CAAE,EAAIL,EASxE,GAPII,EAAS,KAAK,OAAOA,EAAS,IAC9BA,EAAS,QAAQ,OAAOA,EAAS,OACjCA,EAAS,OAAO,OAAOA,EAAS,MAChCA,EAAS,WAAW,OAAOA,EAAS,UACpCA,EAAS,UAAU,OAAOA,EAAS,SAGnC,MAAM,QAAQH,CAAa,GAAKA,EAAc,OAAS,EACzD,OAAOA,EAAc,IAAI,CAACK,EAAMC,IAC9BR,GAAmB,CACjB,cAAe,CAAE,GAAGO,EAAM,MAAO,CAAE,GAAGA,EAAK,MAAO,MAAAC,CAAM,CAAE,EAC1D,WAAAL,EACA,KAAAC,EACA,SAAU,CAAC,EACX,OAAAE,CACF,CAAC,CACH,EAIF,GACE,OAAOJ,GAAkB,UACzBA,IAAkB,MAClB,SAAUA,GACV,OAAO,KAAKC,CAAU,EAAE,SAASD,EAAc,IAAI,EACnD,CACA,GAAM,CAAE,KAAAO,EAAM,MAAAC,EAAQ,CAAC,EAAG,SAAAC,EAAU,QAAAC,EAAU,MAAO,EAAIV,EACnDW,EAAc,CAAE,GAAGR,EAAU,GAAGK,CAAM,EAGtCI,EAAYX,EAAWM,CAAI,EAEjC,GAAI,CAACK,EACH,eAAQ,KAAK,mBAAmBL,CAAI,kCAAkC,EAC/D,KAIT,IAAIM,EAAyB,KAEzBJ,IAAa,SACX,MAAM,QAAQA,CAAQ,EAExBI,EAAoBJ,EAAS,IAAI,CAACK,EAAOR,IACvCR,GAAmB,CACjB,cAAegB,EACf,WAAAb,EACA,KAAAC,EACA,SAAUS,EACV,OAAAP,CACF,CAAC,CACH,EAEA,OAAOK,GAAa,UACpBA,IAAa,MACb,SAAUA,EAGVI,EAAoBf,GAAmB,CACrC,cAAeW,EACf,WAAAR,EACA,KAAAC,EACA,SAAUS,EACV,OAAAP,CACF,CAAC,EAGDS,EAAoBJ,GAKxB,IAAMM,EAAoC,CACxC,GAAGJ,EACH,IAAK,OAAO,WAAW,CACzB,EAEIJ,IAAS,QACXQ,EAAa,KAAOb,EACpBa,EAAa,OAASX,GAIxB,GAAM,CAAE,YAAAY,EAAa,gBAAAC,EAAiB,GAAGC,CAAY,EAAIC,GACvD,CACE,GAAGJ,EACH,YAAaF,EACb,gBAAiBH,CACnB,EACAR,EACAE,CACF,EAGA,OADkBgB,GAAgBH,CAAe,EAE7CxB,GAAM,cAAcmB,EAAWM,EAAaF,CAAW,EACvD,IACN,CAGA,OAAOhB,CACT,CAEO,SAASqB,GAAoBtB,EAAmC,CACrE,GAAM,CAAE,cAAAC,EAAe,WAAAC,EAAY,KAAAC,EAAM,SAAAC,EAAW,CAAC,EAAG,OAAAC,EAAS,CAAC,CAAE,EAAIL,EASxE,GAPII,EAAS,KAAK,OAAOA,EAAS,IAC9BA,EAAS,QAAQ,OAAOA,EAAS,OACjCA,EAAS,OAAO,OAAOA,EAAS,MAChCA,EAAS,WAAW,OAAOA,EAAS,UACpCA,EAAS,UAAU,OAAOA,EAAS,SAGnC,MAAM,QAAQH,CAAa,GAAKA,EAAc,OAAS,EACzD,OAAOA,EAAc,IAAI,CAACK,EAAMC,IAC9Be,GAAoB,CAClB,cAAe,CAAE,GAAGhB,EAAM,MAAO,CAAE,GAAGA,EAAK,MAAO,MAAAC,CAAM,CAAE,EAC1D,WAAAL,EACA,KAAAC,EACA,SAAU,CAAC,EACX,OAAAE,CACF,CAAC,CACH,EAIF,GACE,OAAOJ,GAAkB,UACzBA,IAAkB,MAClB,SAAUA,GACV,OAAO,KAAKC,CAAU,EAAE,SAASD,EAAc,IAAI,EACnD,CACA,GAAM,CAAE,KAAAO,EAAM,MAAAC,EAAQ,CAAC,EAAG,SAAAC,EAAU,QAAAC,EAAU,MAAO,EAAIV,EACnDW,EAAc,CAAE,GAAGR,EAAU,GAAGK,CAAM,EAGtCI,EAAYX,EAAWM,CAAI,EAEjC,GAAI,CAACK,EACH,eAAQ,KAAK,mBAAmBL,CAAI,kCAAkC,EAC/D,KAIT,IAAIM,EAAyB,KAEzBJ,IAAa,SACX,MAAM,QAAQA,CAAQ,EAExBI,EAAoBJ,EAAS,IAAI,CAACK,EAAOR,IACvCe,GAAoB,CAClB,cAAeP,EACf,WAAAb,EACA,KAAAC,EACA,SAAUS,EACV,OAAAP,CACF,CAAC,CACH,EAEA,OAAOK,GAAa,UACpBA,IAAa,MACb,SAAUA,EAGVI,EAAoBQ,GAAoB,CACtC,cAAeZ,EACf,WAAAR,EACA,KAAAC,EACA,SAAUS,EACV,OAAAP,CACF,CAAC,EAGDS,EAAoBJ,GAKxB,IAAMM,EAAoC,CACxC,GAAGJ,EACH,IAAK,OAAO,WAAW,CACzB,EAEIJ,IAAS,QACXQ,EAAa,KAAOb,EACpBa,EAAa,OAASX,GAIxB,GAAM,CAAE,YAAAY,EAAa,gBAAAC,EAAiB,GAAGC,CAAY,EAAIC,GACvD,CACE,GAAGJ,EACH,YAAaF,EACb,gBAAiBH,CACnB,EACAR,EACAE,CACF,EAGA,OADkBgB,GAAgBH,CAAe,EAE7CxB,GAAM,cAAcmB,EAAWM,EAAaF,CAAW,EACvD,IACN,CAGA,OAAOhB,CACT,CAEO,IAAMmB,GAAe,CAC1BX,EACAN,EACAE,IACG,CACH,IAAMkB,EAAU,CAAE,MAAOpB,EAAM,OAAQM,EAAO,QAASJ,CAAO,EACxDmB,EAAgB,mBAEhBC,EAAsBC,GAAuB,CACjD,IAAMC,EAAU,MAAM,KAAKD,EAAM,SAASF,CAAa,CAAC,EAExD,GAAIG,EAAQ,SAAW,EACrB,OAAOD,EAIT,GAAIC,EAAQ,SAAW,GAAKA,EAAQ,CAAC,EAAE,CAAC,IAAMD,EAAO,CACnD,IAAME,EAAOD,EAAQ,CAAC,EAAE,CAAC,EAAE,KAAK,EAC1BE,EAAgBC,GAAkB,CAAE,IAAKP,EAAS,KAAAK,CAAK,CAAC,EAC9D,OAAOC,IAAkB,OAAYA,EAAgBH,CACvD,CAGA,OAAOC,EAAQ,OAAO,CAACI,EAAQC,IAAU,CACvC,IAAMJ,EAAOI,EAAM,CAAC,EAAE,KAAK,EACrBH,EAAgBC,GAAkB,CAAE,IAAKP,EAAS,KAAAK,CAAK,CAAC,EACxDK,EACJJ,IAAkB,OAAY,OAAOA,CAAa,EAAIG,EAAM,CAAC,EAC/D,OAAOD,EAAO,QAAQC,EAAM,CAAC,EAAGC,CAAW,CAC7C,EAAGP,CAAK,CACV,EAEA,OAAO,OAAO,YACZ,OAAO,QAAQjB,CAAK,EAAE,IAAI,CAAC,CAACyB,EAAKR,CAAK,IAAM,CAC1CQ,EACA,OAAOR,GAAU,SAAWD,EAAmBC,CAAK,EAAIA,CAC1D,CAAC,CACH,CACF,EAEaS,GAAaC,GAA4C,CACpE,GAAI,CAEF,OADY,KAAK,MAAMA,CAAU,CAEnC,MAAY,CACV,OAAO,IACT,CACF,EAEO,SAASN,GAAkB,CAChC,IAAAO,EACA,KAAAT,CACF,EAGQ,CAEN,IAAMU,EAAOV,EAAK,MAAM,GAAG,EAAE,OAAQM,GAAQA,EAAI,OAAS,CAAC,EAGvDK,EAAUF,EAGd,QAAWH,KAAOI,EAAM,CAEtB,GAAIC,GAAW,MAAQ,EAAEL,KAAOK,GAC9B,OAEFA,EAAUA,EAAQL,CAAG,CACvB,CAEA,OAAI,OAAOK,GAAY,SACd,KAAK,UAAUA,CAAO,EAExBA,CACT,CAEO,SAASlB,GAAgB,KAAc,CAC5C,GAAI,CACF,IAAM,OAAS,KAAK,IAAI,EACxB,OAAO,OAAO,QAAW,UAAY,OAAS,EAChD,OAASmB,EAAO,CACd,eAAQ,MAAM,0BAA0B,IAAI,KAAMA,CAAK,EAChD,EACT,CACF,CAEO,SAASC,GAAoBC,EAA6B,CAC/D,OAAO,IAAI,QAAQ,CAACC,EAASC,IAAW,CACtC,IAAMC,EAAS,IAAI,WAEnBA,EAAO,OAAS,SAAUC,EAAO,CAC/B,IAAMC,EAAUD,EAAM,QAAQ,OAC1B,OAAOC,GAAY,SACrBJ,EAAQI,CAAO,EAEfH,EAAO,IAAI,MAAM,8BAA8B,CAAC,CAEpD,EAEAC,EAAO,QAAU,SAAUL,EAAO,CAChCI,EAAOJ,CAAK,CACd,EAEAK,EAAO,cAAcH,CAAI,CAC3B,CAAC,CACH,CCxUO,IAAMM,GAA0B,CAAC,CACtC,MAAAC,EACA,UAAAC,EACA,KAAAC,EAAO,CAAC,EACR,OAAAC,EAAS,CAAC,EACV,YAAAC,EAAc,MAChB,IAAM,CACJ,IAAMC,EAAc,KAAK,MAAML,CAAK,EAEpC,GAAI,CAAC,MAAM,QAAQK,CAAW,EAAG,OAAO,KAExC,IAAMC,EAAcD,EAAY,IAAI,CAACE,EAAMC,KAAW,CACpD,GAAGP,EACH,MAAO,CACL,GAAGA,EAAU,MACb,CAACG,CAAW,EAAGG,EACf,CAAC,GAAGH,CAAW,OAAO,EAAGI,CAC3B,CACF,EAAE,EAEF,OAAOC,GAAmB,CACxB,cAAeH,EACf,WAAYI,GACZ,KAAAR,EACA,SAAU,CAAC,EACX,OAAAC,CACF,CAAC,CACH,ECvCA,OAAS,SAAAQ,OAAyB,sBAClC,OAAOC,OAAW,QAUT,cAAAC,OAAA,oBAPT,IAAMC,GAAyDC,GAAU,CACvE,GAAM,CAAE,WAAAC,EAAY,GAAGC,CAAW,EAAIF,EAChCG,EAAYC,GAAM,QACtB,SAAY,MAAMC,GAAeJ,CAAU,EAC3C,CAACA,CAAU,CACb,EAEA,OAAOH,GAACQ,GAAA,CAAM,IAAKH,EAAY,GAAGD,EAAY,CAChD,EAEOK,GAAQR,GCdf,OAAOS,OAAW,QAClB,OAAS,QAAAC,GAAM,QAAAC,OAAY,sBCW3B,IAAMC,GAAe,CAAC,EAef,SAASC,GAASC,EAAOC,EAAS,CACvC,IAAMC,EAAWD,GAAWH,GACtBK,EACJ,OAAOD,EAAS,iBAAoB,UAChCA,EAAS,gBACT,GACAE,EACJ,OAAOF,EAAS,aAAgB,UAAYA,EAAS,YAAc,GAErE,OAAOG,GAAIL,EAAOG,EAAiBC,CAAW,CAChD,CAcA,SAASC,GAAIL,EAAOG,EAAiBC,EAAa,CAChD,GAAIE,GAAKN,CAAK,EAAG,CACf,GAAI,UAAWA,EACb,OAAOA,EAAM,OAAS,QAAU,CAACI,EAAc,GAAKJ,EAAM,MAG5D,GAAIG,GAAmB,QAASH,GAASA,EAAM,IAC7C,OAAOA,EAAM,IAGf,GAAI,aAAcA,EAChB,OAAOO,GAAIP,EAAM,SAAUG,EAAiBC,CAAW,CAE3D,CAEA,OAAI,MAAM,QAAQJ,CAAK,EACdO,GAAIP,EAAOG,EAAiBC,CAAW,EAGzC,EACT,CAcA,SAASG,GAAIC,EAAQL,EAAiBC,EAAa,CAEjD,IAAMK,EAAS,CAAC,EACZC,EAAQ,GAEZ,KAAO,EAAEA,EAAQF,EAAO,QACtBC,EAAOC,CAAK,EAAIL,GAAIG,EAAOE,CAAK,EAAGP,EAAiBC,CAAW,EAGjE,OAAOK,EAAO,KAAK,EAAE,CACvB,CAUA,SAASH,GAAKN,EAAO,CACnB,MAAO,GAAQA,GAAS,OAAOA,GAAU,SAC3C,CCvGA,IAAMW,GAAU,SAAS,cAAc,GAAG,EAMnC,SAASC,GAA8BC,EAAO,CACnD,IAAMC,EAAqB,IAAMD,EAAQ,IACzCF,GAAQ,UAAYG,EACpB,IAAMC,EAAYJ,GAAQ,YAQ1B,OAGEI,EAAU,WAAWA,EAAU,OAAS,CAAC,IAAM,IAC/CF,IAAU,QASLE,IAAcD,EAPZ,GAOyCC,CACpD,CCbO,SAASC,GAAOC,EAAMC,EAAOC,EAAQC,EAAO,CACjD,IAAMC,EAAMJ,EAAK,OACbK,EAAa,EAEbC,EAWJ,GARIL,EAAQ,EACVA,EAAQ,CAACA,EAAQG,EAAM,EAAIA,EAAMH,EAEjCA,EAAQA,EAAQG,EAAMA,EAAMH,EAE9BC,EAASA,EAAS,EAAIA,EAAS,EAG3BC,EAAM,OAAS,IACjBG,EAAa,MAAM,KAAKH,CAAK,EAC7BG,EAAW,QAAQL,EAAOC,CAAM,EAEhCF,EAAK,OAAO,GAAGM,CAAU,MAMzB,KAHIJ,GAAQF,EAAK,OAAOC,EAAOC,CAAM,EAG9BG,EAAaF,EAAM,QACxBG,EAAaH,EAAM,MAAME,EAAYA,EAAa,GAAK,EACvDC,EAAW,QAAQL,EAAO,CAAC,EAE3BD,EAAK,OAAO,GAAGM,CAAU,EACzBD,GAAc,IACdJ,GAAS,GAGf,CAkBO,SAASM,GAAKP,EAAMG,EAAO,CAChC,OAAIH,EAAK,OAAS,GAChBD,GAAOC,EAAMA,EAAK,OAAQ,EAAGG,CAAK,EAC3BH,GAEFG,CACT,CCrEA,IAAMK,GAAiB,CAAC,EAAE,eAUnB,SAASC,GAAkBC,EAAY,CAE5C,IAAMC,EAAM,CAAC,EACTC,EAAQ,GAEZ,KAAO,EAAEA,EAAQF,EAAW,QAC1BG,GAAgBF,EAAKD,EAAWE,CAAK,CAAC,EAGxC,OAAOD,CACT,CAYA,SAASE,GAAgBF,EAAKG,EAAW,CAEvC,IAAIC,EAEJ,IAAKA,KAAQD,EAAW,CAGtB,IAAME,GAFQR,GAAe,KAAKG,EAAKI,CAAI,EAAIJ,EAAII,CAAI,EAAI,UAEpCJ,EAAII,CAAI,EAAI,CAAC,GAE9BE,EAAQH,EAAUC,CAAI,EAExBG,EAEJ,GAAID,EACF,IAAKC,KAAQD,EAAO,CACbT,GAAe,KAAKQ,EAAME,CAAI,IAAGF,EAAKE,CAAI,EAAI,CAAC,GACpD,IAAMC,EAAQF,EAAMC,CAAI,EACxBE,GAEEJ,EAAKE,CAAI,EACT,MAAM,QAAQC,CAAK,EAAIA,EAAQA,EAAQ,CAACA,CAAK,EAAI,CAAC,CACpD,CACF,CAEJ,CACF,CAaA,SAASC,GAAWC,EAAUC,EAAM,CAClC,IAAIV,EAAQ,GAENW,EAAS,CAAC,EAEhB,KAAO,EAAEX,EAAQU,EAAK,SAElBA,EAAKV,CAAK,EAAE,MAAQ,QAAUS,EAAWE,GAAQ,KAAKD,EAAKV,CAAK,CAAC,EAGrEY,GAAOH,EAAU,EAAG,EAAGE,CAAM,CAC/B,CC9EO,SAASE,GAAgCC,EAAOC,EAAM,CAC3D,IAAMC,EAAO,OAAO,SAASF,EAAOC,CAAI,EACxC,OAEAC,EAAO,GAAKA,IAAS,IAAMA,EAAO,IAAMA,EAAO,IAE/CA,EAAO,KAAOA,EAAO,KAErBA,EAAO,OAAUA,EAAO,OAExBA,EAAO,OAAUA,EAAO,QACvBA,EAAO,SAAY,QAAWA,EAAO,SAAY,OAElDA,EAAO,QACE,SAEF,OAAO,cAAcA,CAAI,CAClC,CCZO,SAASC,GAAoBC,EAAO,CACzC,OAAOA,EAEN,QAAQ,cAAe,GAAG,EAE1B,QAAQ,SAAU,EAAE,EAOpB,YAAY,EAAE,YAAY,CAC7B,CCXO,IAAMC,GAAaC,GAAW,UAAU,EAclCC,GAAoBD,GAAW,YAAY,EAuB3CE,GAAaF,GAAW,qBAAqB,EAanD,SAASG,GAAaC,EAAM,CACjC,OAGEA,IAAS,OAASA,EAAO,IAAMA,IAAS,IAE5C,CAaO,IAAMC,GAAaL,GAAW,IAAI,EAoB5BM,GAAgBN,GAAW,YAAY,EAevCO,GAAmBP,GAAW,gBAAgB,EAiBpD,SAASQ,EAAmBJ,EAAM,CACvC,OAAOA,IAAS,MAAQA,EAAO,EACjC,CAWO,SAASK,EAA0BL,EAAM,CAC9C,OAAOA,IAAS,OAASA,EAAO,GAAKA,IAAS,GAChD,CAiBO,SAASM,EAAcN,EAAM,CAClC,OAAOA,IAAS,IAAMA,IAAS,IAAMA,IAAS,EAChD,CAuBO,IAAMO,GAAqBX,GAAW,cAAc,EAsB9CY,GAAoBZ,GAAW,IAAI,EAUhD,SAASA,GAAWa,EAAO,CACzB,OAAOC,EAUP,SAASA,EAAMV,EAAM,CACnB,OAAOA,IAAS,MAAQA,EAAO,IAAMS,EAAM,KAAK,OAAO,aAAaT,CAAI,CAAC,CAC3E,CACF,CC7MO,SAASW,EAAaC,EAASC,EAAIC,EAAMC,EAAK,CACnD,IAAMC,EAAQD,EAAMA,EAAM,EAAI,OAAO,kBACjCE,EAAO,EACX,OAAOC,EAGP,SAASA,EAAMC,EAAM,CACnB,OAAIC,EAAcD,CAAI,GACpBP,EAAQ,MAAME,CAAI,EACXO,EAAOF,CAAI,GAEbN,EAAGM,CAAI,CAChB,CAGA,SAASE,EAAOF,EAAM,CACpB,OAAIC,EAAcD,CAAI,GAAKF,IAASD,GAClCJ,EAAQ,QAAQO,CAAI,EACbE,IAETT,EAAQ,KAAKE,CAAI,EACVD,EAAGM,CAAI,EAChB,CACF,CClDO,IAAMG,GAAU,CACrB,SAAUC,EACZ,EAQA,SAASA,GAAkBC,EAAS,CAClC,IAAMC,EAAeD,EAAQ,QAAQ,KAAK,OAAO,WAAW,eAAgBE,EAA4BC,CAAgB,EAEpHC,EACJ,OAAOH,EAGP,SAASC,EAA2BG,EAAM,CACxC,GAAIA,IAAS,KAAM,CACjBL,EAAQ,QAAQK,CAAI,EACpB,MACF,CACA,OAAAL,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQK,CAAI,EACpBL,EAAQ,KAAK,YAAY,EAClBM,EAAaN,EAASC,EAAc,YAAY,CACzD,CAGA,SAASE,EAAiBE,EAAM,CAC9B,OAAAL,EAAQ,MAAM,WAAW,EAClBO,EAAUF,CAAI,CACvB,CAGA,SAASE,EAAUF,EAAM,CACvB,IAAMG,EAAQR,EAAQ,MAAM,YAAa,CACvC,YAAa,OACb,SAAAI,CACF,CAAC,EACD,OAAIA,IACFA,EAAS,KAAOI,GAElBJ,EAAWI,EACJC,EAAKJ,CAAI,CAClB,CAGA,SAASI,EAAKJ,EAAM,CAClB,GAAIA,IAAS,KAAM,CACjBL,EAAQ,KAAK,WAAW,EACxBA,EAAQ,KAAK,WAAW,EACxBA,EAAQ,QAAQK,CAAI,EACpB,MACF,CACA,OAAIK,EAAmBL,CAAI,GACzBL,EAAQ,QAAQK,CAAI,EACpBL,EAAQ,KAAK,WAAW,EACjBO,IAITP,EAAQ,QAAQK,CAAI,EACbI,EACT,CACF,CCvDO,IAAME,GAAW,CACtB,SAAUC,EACZ,EAGMC,GAAqB,CACzB,SAAUC,EACZ,EAQA,SAASF,GAAmBG,EAAS,CACnC,IAAMC,EAAO,KAEPC,EAAQ,CAAC,EACXC,EAAY,EAEZC,EAEAC,EAEAC,EACJ,OAAOC,EAGP,SAASA,EAAMC,EAAM,CAWnB,GAAIL,EAAYD,EAAM,OAAQ,CAC5B,IAAMO,EAAOP,EAAMC,CAAS,EAC5B,OAAAF,EAAK,eAAiBQ,EAAK,CAAC,EACrBT,EAAQ,QAAQS,EAAK,CAAC,EAAE,aAAcC,EAAkBC,CAAkB,EAAEH,CAAI,CACzF,CAGA,OAAOG,EAAmBH,CAAI,CAChC,CAGA,SAASE,EAAiBF,EAAM,CAM9B,GALAL,IAKIF,EAAK,eAAe,WAAY,CAClCA,EAAK,eAAe,WAAa,OAC7BG,GACFQ,EAAU,EAKZ,IAAMC,EAAmBZ,EAAK,OAAO,OACjCa,EAAkBD,EAElBE,EAGJ,KAAOD,KACL,GAAIb,EAAK,OAAOa,CAAe,EAAE,CAAC,IAAM,QAAUb,EAAK,OAAOa,CAAe,EAAE,CAAC,EAAE,OAAS,YAAa,CACtGC,EAAQd,EAAK,OAAOa,CAAe,EAAE,CAAC,EAAE,IACxC,KACF,CAEFE,EAAeb,CAAS,EAGxB,IAAIc,EAAQJ,EACZ,KAAOI,EAAQhB,EAAK,OAAO,QACzBA,EAAK,OAAOgB,CAAK,EAAE,CAAC,EAAE,IAAM,CAC1B,GAAGF,CACL,EACAE,IAIF,OAAAC,GAAOjB,EAAK,OAAQa,EAAkB,EAAG,EAAGb,EAAK,OAAO,MAAMY,CAAgB,CAAC,EAG/EZ,EAAK,OAAO,OAASgB,EACdN,EAAmBH,CAAI,CAChC,CACA,OAAOD,EAAMC,CAAI,CACnB,CAGA,SAASG,EAAmBH,EAAM,CAMhC,GAAIL,IAAcD,EAAM,OAAQ,CAI9B,GAAI,CAACE,EACH,OAAOe,EAAkBX,CAAI,EAM/B,GAAIJ,EAAU,kBAAoBA,EAAU,iBAAiB,SAC3D,OAAOgB,EAAUZ,CAAI,EAQvBP,EAAK,UAAY,GAAQG,EAAU,kBAAoB,CAACA,EAAU,8BACpE,CAGA,OAAAH,EAAK,eAAiB,CAAC,EAChBD,EAAQ,MAAMF,GAAoBuB,EAAsBC,CAAqB,EAAEd,CAAI,CAC5F,CAGA,SAASa,EAAqBb,EAAM,CAClC,OAAIJ,GAAWQ,EAAU,EACzBI,EAAeb,CAAS,EACjBgB,EAAkBX,CAAI,CAC/B,CAGA,SAASc,EAAsBd,EAAM,CACnC,OAAAP,EAAK,OAAO,KAAKA,EAAK,IAAI,EAAE,IAAI,EAAIE,IAAcD,EAAM,OACxDI,EAAkBL,EAAK,IAAI,EAAE,OACtBmB,EAAUZ,CAAI,CACvB,CAGA,SAASW,EAAkBX,EAAM,CAE/B,OAAAP,EAAK,eAAiB,CAAC,EAChBD,EAAQ,QAAQF,GAAoByB,EAAmBH,CAAS,EAAEZ,CAAI,CAC/E,CAGA,SAASe,EAAkBf,EAAM,CAC/B,OAAAL,IACAD,EAAM,KAAK,CAACD,EAAK,iBAAkBA,EAAK,cAAc,CAAC,EAEhDkB,EAAkBX,CAAI,CAC/B,CAGA,SAASY,EAAUZ,EAAM,CACvB,GAAIA,IAAS,KAAM,CACbJ,GAAWQ,EAAU,EACzBI,EAAe,CAAC,EAChBhB,EAAQ,QAAQQ,CAAI,EACpB,MACF,CACA,OAAAJ,EAAYA,GAAaH,EAAK,OAAO,KAAKA,EAAK,IAAI,CAAC,EACpDD,EAAQ,MAAM,YAAa,CACzB,WAAYI,EACZ,YAAa,OACb,SAAUC,CACZ,CAAC,EACMmB,EAAahB,CAAI,CAC1B,CAGA,SAASgB,EAAahB,EAAM,CAC1B,GAAIA,IAAS,KAAM,CACjBiB,EAAazB,EAAQ,KAAK,WAAW,EAAG,EAAI,EAC5CgB,EAAe,CAAC,EAChBhB,EAAQ,QAAQQ,CAAI,EACpB,MACF,CACA,OAAIkB,EAAmBlB,CAAI,GACzBR,EAAQ,QAAQQ,CAAI,EACpBiB,EAAazB,EAAQ,KAAK,WAAW,CAAC,EAEtCG,EAAY,EACZF,EAAK,UAAY,OACVM,IAETP,EAAQ,QAAQQ,CAAI,EACbgB,EACT,CAUA,SAASC,EAAaE,EAAOC,EAAW,CACtC,IAAMC,EAAS5B,EAAK,YAAY0B,CAAK,EAyCrC,GAxCIC,GAAWC,EAAO,KAAK,IAAI,EAC/BF,EAAM,SAAWtB,EACbA,IAAYA,EAAW,KAAOsB,GAClCtB,EAAasB,EACbvB,EAAU,WAAWuB,EAAM,KAAK,EAChCvB,EAAU,MAAMyB,CAAM,EAmClB5B,EAAK,OAAO,KAAK0B,EAAM,MAAM,IAAI,EAAG,CACtC,IAAIV,EAAQb,EAAU,OAAO,OAC7B,KAAOa,KACL,GAEAb,EAAU,OAAOa,CAAK,EAAE,CAAC,EAAE,MAAM,OAASX,IAE1C,CAACF,EAAU,OAAOa,CAAK,EAAE,CAAC,EAAE,KAE5Bb,EAAU,OAAOa,CAAK,EAAE,CAAC,EAAE,IAAI,OAASX,GAGtC,OAMJ,IAAMO,EAAmBZ,EAAK,OAAO,OACjCa,EAAkBD,EAElBiB,EAEAf,EAGJ,KAAOD,KACL,GAAIb,EAAK,OAAOa,CAAe,EAAE,CAAC,IAAM,QAAUb,EAAK,OAAOa,CAAe,EAAE,CAAC,EAAE,OAAS,YAAa,CACtG,GAAIgB,EAAM,CACRf,EAAQd,EAAK,OAAOa,CAAe,EAAE,CAAC,EAAE,IACxC,KACF,CACAgB,EAAO,EACT,CAMF,IAJAd,EAAeb,CAAS,EAGxBc,EAAQJ,EACDI,EAAQhB,EAAK,OAAO,QACzBA,EAAK,OAAOgB,CAAK,EAAE,CAAC,EAAE,IAAM,CAC1B,GAAGF,CACL,EACAE,IAIFC,GAAOjB,EAAK,OAAQa,EAAkB,EAAG,EAAGb,EAAK,OAAO,MAAMY,CAAgB,CAAC,EAG/EZ,EAAK,OAAO,OAASgB,CACvB,CACF,CAQA,SAASD,EAAee,EAAM,CAC5B,IAAId,EAAQf,EAAM,OAGlB,KAAOe,KAAUc,GAAM,CACrB,IAAMC,EAAQ9B,EAAMe,CAAK,EACzBhB,EAAK,eAAiB+B,EAAM,CAAC,EAC7BA,EAAM,CAAC,EAAE,KAAK,KAAK/B,EAAMD,CAAO,CAClC,CACAE,EAAM,OAAS6B,CACjB,CACA,SAASnB,GAAY,CACnBR,EAAU,MAAM,CAAC,IAAI,CAAC,EACtBC,EAAa,OACbD,EAAY,OACZH,EAAK,eAAe,WAAa,MACnC,CACF,CAQA,SAASF,GAAkBC,EAASiC,EAAIC,EAAK,CAG3C,OAAOC,EAAanC,EAASA,EAAQ,QAAQ,KAAK,OAAO,WAAW,SAAUiC,EAAIC,CAAG,EAAG,aAAc,KAAK,OAAO,WAAW,QAAQ,KAAK,SAAS,cAAc,EAAI,OAAY,CAAC,CACpL,CCtVO,SAASE,GAAkBC,EAAM,CACtC,GAAIA,IAAS,MAAQC,EAA0BD,CAAI,GAAKE,GAAkBF,CAAI,EAC5E,MAAO,GAET,GAAIG,GAAmBH,CAAI,EACzB,MAAO,EAEX,CCVO,SAASI,GAAWC,EAAYC,EAAQC,EAAS,CAEtD,IAAMC,EAAS,CAAC,EACZC,EAAQ,GAEZ,KAAO,EAAEA,EAAQJ,EAAW,QAAQ,CAClC,IAAMK,EAAUL,EAAWI,CAAK,EAAE,WAE9BC,GAAW,CAACF,EAAO,SAASE,CAAO,IACrCJ,EAASI,EAAQJ,EAAQC,CAAO,EAChCC,EAAO,KAAKE,CAAO,EAEvB,CAEA,OAAOJ,CACT,CCbO,IAAMK,GAAY,CACvB,KAAM,YACN,WAAYC,GACZ,SAAUC,EACZ,EAQA,SAASD,GAAoBE,EAAQC,EAAS,CAC5C,IAAIC,EAAQ,GAERC,EAEAC,EAEAC,EAEAC,EAEAC,EAEAC,EAEAC,EAEAC,EAMJ,KAAO,EAAER,EAAQF,EAAO,QAEtB,GAAIA,EAAOE,CAAK,EAAE,CAAC,IAAM,SAAWF,EAAOE,CAAK,EAAE,CAAC,EAAE,OAAS,qBAAuBF,EAAOE,CAAK,EAAE,CAAC,EAAE,QAIpG,IAHAC,EAAOD,EAGAC,KAEL,GAAIH,EAAOG,CAAI,EAAE,CAAC,IAAM,QAAUH,EAAOG,CAAI,EAAE,CAAC,EAAE,OAAS,qBAAuBH,EAAOG,CAAI,EAAE,CAAC,EAAE,OAElGF,EAAQ,eAAeD,EAAOG,CAAI,EAAE,CAAC,CAAC,EAAE,WAAW,CAAC,IAAMF,EAAQ,eAAeD,EAAOE,CAAK,EAAE,CAAC,CAAC,EAAE,WAAW,CAAC,EAAG,CAKhH,IAAKF,EAAOG,CAAI,EAAE,CAAC,EAAE,QAAUH,EAAOE,CAAK,EAAE,CAAC,EAAE,SAAWF,EAAOE,CAAK,EAAE,CAAC,EAAE,IAAI,OAASF,EAAOE,CAAK,EAAE,CAAC,EAAE,MAAM,QAAU,GAAK,GAAGF,EAAOG,CAAI,EAAE,CAAC,EAAE,IAAI,OAASH,EAAOG,CAAI,EAAE,CAAC,EAAE,MAAM,OAASH,EAAOE,CAAK,EAAE,CAAC,EAAE,IAAI,OAASF,EAAOE,CAAK,EAAE,CAAC,EAAE,MAAM,QAAU,GAC3P,SAIFM,EAAMR,EAAOG,CAAI,EAAE,CAAC,EAAE,IAAI,OAASH,EAAOG,CAAI,EAAE,CAAC,EAAE,MAAM,OAAS,GAAKH,EAAOE,CAAK,EAAE,CAAC,EAAE,IAAI,OAASF,EAAOE,CAAK,EAAE,CAAC,EAAE,MAAM,OAAS,EAAI,EAAI,EAC7I,IAAMS,EAAQ,CACZ,GAAGX,EAAOG,CAAI,EAAE,CAAC,EAAE,GACrB,EACMS,EAAM,CACV,GAAGZ,EAAOE,CAAK,EAAE,CAAC,EAAE,KACtB,EACAW,GAAUF,EAAO,CAACH,CAAG,EACrBK,GAAUD,EAAKJ,CAAG,EAClBF,EAAkB,CAChB,KAAME,EAAM,EAAI,iBAAmB,mBACnC,MAAAG,EACA,IAAK,CACH,GAAGX,EAAOG,CAAI,EAAE,CAAC,EAAE,GACrB,CACF,EACAI,EAAkB,CAChB,KAAMC,EAAM,EAAI,iBAAmB,mBACnC,MAAO,CACL,GAAGR,EAAOE,CAAK,EAAE,CAAC,EAAE,KACtB,EACA,IAAAU,CACF,EACAP,EAAO,CACL,KAAMG,EAAM,EAAI,aAAe,eAC/B,MAAO,CACL,GAAGR,EAAOG,CAAI,EAAE,CAAC,EAAE,GACrB,EACA,IAAK,CACH,GAAGH,EAAOE,CAAK,EAAE,CAAC,EAAE,KACtB,CACF,EACAE,EAAQ,CACN,KAAMI,EAAM,EAAI,SAAW,WAC3B,MAAO,CACL,GAAGF,EAAgB,KACrB,EACA,IAAK,CACH,GAAGC,EAAgB,GACrB,CACF,EACAP,EAAOG,CAAI,EAAE,CAAC,EAAE,IAAM,CACpB,GAAGG,EAAgB,KACrB,EACAN,EAAOE,CAAK,EAAE,CAAC,EAAE,MAAQ,CACvB,GAAGK,EAAgB,GACrB,EACAE,EAAa,CAAC,EAGVT,EAAOG,CAAI,EAAE,CAAC,EAAE,IAAI,OAASH,EAAOG,CAAI,EAAE,CAAC,EAAE,MAAM,SACrDM,EAAaK,GAAKL,EAAY,CAAC,CAAC,QAAST,EAAOG,CAAI,EAAE,CAAC,EAAGF,CAAO,EAAG,CAAC,OAAQD,EAAOG,CAAI,EAAE,CAAC,EAAGF,CAAO,CAAC,CAAC,GAIzGQ,EAAaK,GAAKL,EAAY,CAAC,CAAC,QAASL,EAAOH,CAAO,EAAG,CAAC,QAASK,EAAiBL,CAAO,EAAG,CAAC,OAAQK,EAAiBL,CAAO,EAAG,CAAC,QAASI,EAAMJ,CAAO,CAAC,CAAC,EAK5JQ,EAAaK,GAAKL,EAAYM,GAAWd,EAAQ,OAAO,WAAW,WAAW,KAAMD,EAAO,MAAMG,EAAO,EAAGD,CAAK,EAAGD,CAAO,CAAC,EAG3HQ,EAAaK,GAAKL,EAAY,CAAC,CAAC,OAAQJ,EAAMJ,CAAO,EAAG,CAAC,QAASM,EAAiBN,CAAO,EAAG,CAAC,OAAQM,EAAiBN,CAAO,EAAG,CAAC,OAAQG,EAAOH,CAAO,CAAC,CAAC,EAGtJD,EAAOE,CAAK,EAAE,CAAC,EAAE,IAAI,OAASF,EAAOE,CAAK,EAAE,CAAC,EAAE,MAAM,QACvDQ,EAAS,EACTD,EAAaK,GAAKL,EAAY,CAAC,CAAC,QAAST,EAAOE,CAAK,EAAE,CAAC,EAAGD,CAAO,EAAG,CAAC,OAAQD,EAAOE,CAAK,EAAE,CAAC,EAAGD,CAAO,CAAC,CAAC,GAEzGS,EAAS,EAEXM,GAAOhB,EAAQG,EAAO,EAAGD,EAAQC,EAAO,EAAGM,CAAU,EACrDP,EAAQC,EAAOM,EAAW,OAASC,EAAS,EAC5C,KACF,EAON,IADAR,EAAQ,GACD,EAAEA,EAAQF,EAAO,QAClBA,EAAOE,CAAK,EAAE,CAAC,EAAE,OAAS,sBAC5BF,EAAOE,CAAK,EAAE,CAAC,EAAE,KAAO,QAG5B,OAAOF,CACT,CAOA,SAASD,GAAkBkB,EAASC,EAAI,CACtC,IAAMC,EAAmB,KAAK,OAAO,WAAW,iBAAiB,KAC3DC,EAAW,KAAK,SAChBC,EAASC,GAAkBF,CAAQ,EAGrCG,EACJ,OAAOZ,EAYP,SAASA,EAAMa,EAAM,CACnB,OAAAD,EAASC,EACTP,EAAQ,MAAM,mBAAmB,EAC1BQ,EAAOD,CAAI,CACpB,CAYA,SAASC,EAAOD,EAAM,CACpB,GAAIA,IAASD,EACX,OAAAN,EAAQ,QAAQO,CAAI,EACbC,EAET,IAAMC,EAAQT,EAAQ,KAAK,mBAAmB,EAGxCU,EAAQL,GAAkBE,CAAI,EAI9BrB,EAAO,CAACwB,GAASA,IAAU,GAAKN,GAAUF,EAAiB,SAASK,CAAI,EACxEI,EAAQ,CAACP,GAAUA,IAAW,GAAKM,GAASR,EAAiB,SAASC,CAAQ,EACpF,OAAAM,EAAM,MAAQ,GAAQH,IAAW,GAAKpB,EAAOA,IAASkB,GAAU,CAACO,IACjEF,EAAM,OAAS,GAAQH,IAAW,GAAKK,EAAQA,IAAUD,GAAS,CAACxB,IAC5De,EAAGM,CAAI,CAChB,CACF,CAeA,SAASX,GAAUgB,EAAOnB,EAAQ,CAChCmB,EAAM,QAAUnB,EAChBmB,EAAM,QAAUnB,EAChBmB,EAAM,cAAgBnB,CACxB,CCrOO,IAAMoB,GAAW,CACtB,KAAM,WACN,SAAUC,EACZ,EAOA,SAASA,GAAiBC,EAASC,EAAIC,EAAK,CAC1C,IAAIC,EAAO,EACX,OAAOC,EAcP,SAASA,EAAMC,EAAM,CACnB,OAAAL,EAAQ,MAAM,UAAU,EACxBA,EAAQ,MAAM,gBAAgB,EAC9BA,EAAQ,QAAQK,CAAI,EACpBL,EAAQ,KAAK,gBAAgB,EAC7BA,EAAQ,MAAM,kBAAkB,EACzBM,CACT,CAcA,SAASA,EAAKD,EAAM,CAClB,OAAIE,GAAWF,CAAI,GACjBL,EAAQ,QAAQK,CAAI,EACbG,GAELH,IAAS,GACJH,EAAIG,CAAI,EAEVI,EAAWJ,CAAI,CACxB,CAcA,SAASG,EAAmBH,EAAM,CAEhC,OAAIA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IAAMK,GAAkBL,CAAI,GAErEF,EAAO,EACAQ,EAAyBN,CAAI,GAE/BI,EAAWJ,CAAI,CACxB,CAcA,SAASM,EAAyBN,EAAM,CACtC,OAAIA,IAAS,IACXL,EAAQ,QAAQK,CAAI,EACpBF,EAAO,EACAS,IAIJP,IAAS,IAAMA,IAAS,IAAMA,IAAS,IAAMK,GAAkBL,CAAI,IAAMF,IAAS,IACrFH,EAAQ,QAAQK,CAAI,EACbM,IAETR,EAAO,EACAM,EAAWJ,CAAI,EACxB,CAYA,SAASO,EAAUP,EAAM,CACvB,OAAIA,IAAS,IACXL,EAAQ,KAAK,kBAAkB,EAC/BA,EAAQ,MAAM,gBAAgB,EAC9BA,EAAQ,QAAQK,CAAI,EACpBL,EAAQ,KAAK,gBAAgB,EAC7BA,EAAQ,KAAK,UAAU,EAChBC,GAILI,IAAS,MAAQA,IAAS,IAAMA,IAAS,IAAMQ,GAAaR,CAAI,EAC3DH,EAAIG,CAAI,GAEjBL,EAAQ,QAAQK,CAAI,EACbO,EACT,CAYA,SAASH,EAAWJ,EAAM,CACxB,OAAIA,IAAS,IACXL,EAAQ,QAAQK,CAAI,EACbS,GAELC,GAAWV,CAAI,GACjBL,EAAQ,QAAQK,CAAI,EACbI,GAEFP,EAAIG,CAAI,CACjB,CAYA,SAASS,EAAiBT,EAAM,CAC9B,OAAOK,GAAkBL,CAAI,EAAIW,EAAWX,CAAI,EAAIH,EAAIG,CAAI,CAC9D,CAYA,SAASW,EAAWX,EAAM,CACxB,OAAIA,IAAS,IACXL,EAAQ,QAAQK,CAAI,EACpBF,EAAO,EACAW,GAELT,IAAS,IAEXL,EAAQ,KAAK,kBAAkB,EAAE,KAAO,gBACxCA,EAAQ,MAAM,gBAAgB,EAC9BA,EAAQ,QAAQK,CAAI,EACpBL,EAAQ,KAAK,gBAAgB,EAC7BA,EAAQ,KAAK,UAAU,EAChBC,GAEFgB,EAAWZ,CAAI,CACxB,CAcA,SAASY,EAAWZ,EAAM,CAExB,IAAKA,IAAS,IAAMK,GAAkBL,CAAI,IAAMF,IAAS,GAAI,CAC3D,IAAMe,EAAOb,IAAS,GAAKY,EAAaD,EACxC,OAAAhB,EAAQ,QAAQK,CAAI,EACba,CACT,CACA,OAAOhB,EAAIG,CAAI,CACjB,CACF,CC5NO,IAAMc,GAAY,CACvB,QAAS,GACT,SAAUC,EACZ,EAOA,SAASA,GAAkBC,EAASC,EAAIC,EAAK,CAC3C,OAAOC,EAgBP,SAASA,EAAMC,EAAM,CACnB,OAAOC,EAAcD,CAAI,EAAIE,EAAaN,EAASO,EAAO,YAAY,EAAEH,CAAI,EAAIG,EAAMH,CAAI,CAC5F,CAgBA,SAASG,EAAMH,EAAM,CACnB,OAAOA,IAAS,MAAQI,EAAmBJ,CAAI,EAAIH,EAAGG,CAAI,EAAIF,EAAIE,CAAI,CACxE,CACF,CC/CO,IAAMK,GAAa,CACxB,aAAc,CACZ,SAAUC,EACZ,EACA,KAAAC,GACA,KAAM,aACN,SAAUC,EACZ,EAOA,SAASA,GAAwBC,EAASC,EAAIC,EAAK,CACjD,IAAMC,EAAO,KACb,OAAOC,EAYP,SAASA,EAAMC,EAAM,CACnB,GAAIA,IAAS,GAAI,CACf,IAAMC,EAAQH,EAAK,eACnB,OAAKG,EAAM,OACTN,EAAQ,MAAM,aAAc,CAC1B,WAAY,EACd,CAAC,EACDM,EAAM,KAAO,IAEfN,EAAQ,MAAM,kBAAkB,EAChCA,EAAQ,MAAM,kBAAkB,EAChCA,EAAQ,QAAQK,CAAI,EACpBL,EAAQ,KAAK,kBAAkB,EACxBO,CACT,CACA,OAAOL,EAAIG,CAAI,CACjB,CAYA,SAASE,EAAMF,EAAM,CACnB,OAAIG,EAAcH,CAAI,GACpBL,EAAQ,MAAM,4BAA4B,EAC1CA,EAAQ,QAAQK,CAAI,EACpBL,EAAQ,KAAK,4BAA4B,EACzCA,EAAQ,KAAK,kBAAkB,EACxBC,IAETD,EAAQ,KAAK,kBAAkB,EACxBC,EAAGI,CAAI,EAChB,CACF,CAeA,SAASR,GAA+BG,EAASC,EAAIC,EAAK,CACxD,IAAMC,EAAO,KACb,OAAOM,EAeP,SAASA,EAAUJ,EAAM,CACvB,OAAIG,EAAcH,CAAI,EAGbK,EAAaV,EAASW,EAAY,aAAcR,EAAK,OAAO,WAAW,QAAQ,KAAK,SAAS,cAAc,EAAI,OAAY,CAAC,EAAEE,CAAI,EAEpIM,EAAWN,CAAI,CACxB,CAeA,SAASM,EAAWN,EAAM,CACxB,OAAOL,EAAQ,QAAQJ,GAAYK,EAAIC,CAAG,EAAEG,CAAI,CAClD,CACF,CAGA,SAASP,GAAKE,EAAS,CACrBA,EAAQ,KAAK,YAAY,CAC3B,CCnIO,IAAMY,GAAkB,CAC7B,KAAM,kBACN,SAAUC,EACZ,EAOA,SAASA,GAAwBC,EAASC,EAAIC,EAAK,CACjD,OAAOC,EAYP,SAASA,EAAMC,EAAM,CACnB,OAAAJ,EAAQ,MAAM,iBAAiB,EAC/BA,EAAQ,MAAM,cAAc,EAC5BA,EAAQ,QAAQI,CAAI,EACpBJ,EAAQ,KAAK,cAAc,EACpBK,CACT,CAYA,SAASA,EAAOD,EAAM,CAEpB,OAAIE,GAAiBF,CAAI,GACvBJ,EAAQ,MAAM,sBAAsB,EACpCA,EAAQ,QAAQI,CAAI,EACpBJ,EAAQ,KAAK,sBAAsB,EACnCA,EAAQ,KAAK,iBAAiB,EACvBC,GAEFC,EAAIE,CAAI,CACjB,CACF,CClDO,IAAMG,GAAqB,CAChC,KAAM,qBACN,SAAUC,EACZ,EAOA,SAASA,GAA2BC,EAASC,EAAIC,EAAK,CACpD,IAAMC,EAAO,KACTC,EAAO,EAEPC,EAEAC,EACJ,OAAOC,EAgBP,SAASA,EAAMC,EAAM,CACnB,OAAAR,EAAQ,MAAM,oBAAoB,EAClCA,EAAQ,MAAM,0BAA0B,EACxCA,EAAQ,QAAQQ,CAAI,EACpBR,EAAQ,KAAK,0BAA0B,EAChCS,CACT,CAiBA,SAASA,EAAKD,EAAM,CAClB,OAAIA,IAAS,IACXR,EAAQ,MAAM,iCAAiC,EAC/CA,EAAQ,QAAQQ,CAAI,EACpBR,EAAQ,KAAK,iCAAiC,EACvCU,IAETV,EAAQ,MAAM,yBAAyB,EACvCK,EAAM,GACNC,EAAOK,GACAC,EAAMJ,CAAI,EACnB,CAcA,SAASE,EAAQF,EAAM,CACrB,OAAIA,IAAS,IAAMA,IAAS,KAC1BR,EAAQ,MAAM,qCAAqC,EACnDA,EAAQ,QAAQQ,CAAI,EACpBR,EAAQ,KAAK,qCAAqC,EAClDA,EAAQ,MAAM,yBAAyB,EACvCK,EAAM,EACNC,EAAOO,GACAD,IAETZ,EAAQ,MAAM,yBAAyB,EACvCK,EAAM,EACNC,EAAOQ,GACAF,EAAMJ,CAAI,EACnB,CAmBA,SAASI,EAAMJ,EAAM,CACnB,GAAIA,IAAS,IAAMJ,EAAM,CACvB,IAAMW,EAAQf,EAAQ,KAAK,yBAAyB,EACpD,OAAIM,IAASK,IAAqB,CAACK,GAA8Bb,EAAK,eAAeY,CAAK,CAAC,EAClFb,EAAIM,CAAI,GAKjBR,EAAQ,MAAM,0BAA0B,EACxCA,EAAQ,QAAQQ,CAAI,EACpBR,EAAQ,KAAK,0BAA0B,EACvCA,EAAQ,KAAK,oBAAoB,EAC1BC,EACT,CACA,OAAIK,EAAKE,CAAI,GAAKJ,IAASC,GACzBL,EAAQ,QAAQQ,CAAI,EACbI,GAEFV,EAAIM,CAAI,CACjB,CACF,CCvIA,IAAMS,GAAsB,CAC1B,QAAS,GACT,SAAUC,EACZ,EAGaC,GAAa,CACxB,SAAU,GACV,KAAM,aACN,SAAUC,EACZ,EAOA,SAASA,GAAmBC,EAASC,EAAIC,EAAK,CAC5C,IAAMC,EAAO,KAEPC,EAAa,CACjB,QAAS,GACT,SAAUC,CACZ,EACIC,EAAgB,EAChBC,EAAW,EAEXC,EACJ,OAAOC,EAcP,SAASA,EAAMC,EAAM,CAEnB,OAAOC,EAAmBD,CAAI,CAChC,CAcA,SAASC,EAAmBD,EAAM,CAChC,IAAME,EAAOT,EAAK,OAAOA,EAAK,OAAO,OAAS,CAAC,EAC/C,OAAAG,EAAgBM,GAAQA,EAAK,CAAC,EAAE,OAAS,aAAeA,EAAK,CAAC,EAAE,eAAeA,EAAK,CAAC,EAAG,EAAI,EAAE,OAAS,EACvGJ,EAASE,EACTV,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,MAAM,iBAAiB,EAC/BA,EAAQ,MAAM,yBAAyB,EAChCa,EAAaH,CAAI,CAC1B,CAcA,SAASG,EAAaH,EAAM,CAC1B,OAAIA,IAASF,GACXD,IACAP,EAAQ,QAAQU,CAAI,EACbG,GAELN,EAAW,EACNL,EAAIQ,CAAI,GAEjBV,EAAQ,KAAK,yBAAyB,EAC/Bc,EAAcJ,CAAI,EAAIK,EAAaf,EAASgB,EAAY,YAAY,EAAEN,CAAI,EAAIM,EAAWN,CAAI,EACtG,CAcA,SAASM,EAAWN,EAAM,CACxB,OAAIA,IAAS,MAAQO,EAAmBP,CAAI,GAC1CV,EAAQ,KAAK,iBAAiB,EACvBG,EAAK,UAAYF,EAAGS,CAAI,EAAIV,EAAQ,MAAMJ,GAAqBsB,EAAgBC,CAAK,EAAET,CAAI,IAEnGV,EAAQ,MAAM,qBAAqB,EACnCA,EAAQ,MAAM,cAAe,CAC3B,YAAa,QACf,CAAC,EACMoB,EAAKV,CAAI,EAClB,CAcA,SAASU,EAAKV,EAAM,CAClB,OAAIA,IAAS,MAAQO,EAAmBP,CAAI,GAC1CV,EAAQ,KAAK,aAAa,EAC1BA,EAAQ,KAAK,qBAAqB,EAC3BgB,EAAWN,CAAI,GAEpBI,EAAcJ,CAAI,GACpBV,EAAQ,KAAK,aAAa,EAC1BA,EAAQ,KAAK,qBAAqB,EAC3Be,EAAaf,EAASqB,EAAY,YAAY,EAAEX,CAAI,GAEzDA,IAAS,IAAMA,IAASF,EACnBN,EAAIQ,CAAI,GAEjBV,EAAQ,QAAQU,CAAI,EACbU,EACT,CAcA,SAASC,EAAWX,EAAM,CACxB,OAAIA,IAAS,MAAQO,EAAmBP,CAAI,EACnCM,EAAWN,CAAI,GAExBV,EAAQ,MAAM,qBAAqB,EACnCA,EAAQ,MAAM,cAAe,CAC3B,YAAa,QACf,CAAC,EACMsB,EAAKZ,CAAI,EAClB,CAcA,SAASY,EAAKZ,EAAM,CAClB,OAAIA,IAAS,MAAQO,EAAmBP,CAAI,GAC1CV,EAAQ,KAAK,aAAa,EAC1BA,EAAQ,KAAK,qBAAqB,EAC3BgB,EAAWN,CAAI,GAEpBA,IAAS,IAAMA,IAASF,EACnBN,EAAIQ,CAAI,GAEjBV,EAAQ,QAAQU,CAAI,EACbY,EACT,CAeA,SAASJ,EAAeR,EAAM,CAC5B,OAAOV,EAAQ,QAAQI,EAAYe,EAAOI,CAAa,EAAEb,CAAI,CAC/D,CAcA,SAASa,EAAcb,EAAM,CAC3B,OAAAV,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQU,CAAI,EACpBV,EAAQ,KAAK,YAAY,EAClBwB,CACT,CAcA,SAASA,EAAad,EAAM,CAC1B,OAAOJ,EAAgB,GAAKQ,EAAcJ,CAAI,EAAIK,EAAaf,EAASyB,EAAoB,aAAcnB,EAAgB,CAAC,EAAEI,CAAI,EAAIe,EAAmBf,CAAI,CAC9J,CAcA,SAASe,EAAmBf,EAAM,CAChC,OAAIA,IAAS,MAAQO,EAAmBP,CAAI,EACnCV,EAAQ,MAAMJ,GAAqBsB,EAAgBC,CAAK,EAAET,CAAI,GAEvEV,EAAQ,MAAM,eAAe,EACtB0B,EAAahB,CAAI,EAC1B,CAcA,SAASgB,EAAahB,EAAM,CAC1B,OAAIA,IAAS,MAAQO,EAAmBP,CAAI,GAC1CV,EAAQ,KAAK,eAAe,EACrByB,EAAmBf,CAAI,IAEhCV,EAAQ,QAAQU,CAAI,EACbgB,EACT,CAcA,SAASP,EAAMT,EAAM,CACnB,OAAAV,EAAQ,KAAK,YAAY,EAClBC,EAAGS,CAAI,CAChB,CAOA,SAASL,EAAmBL,EAASC,EAAIC,EAAK,CAC5C,IAAIyB,EAAO,EACX,OAAOC,EAOP,SAASA,EAAYlB,EAAM,CACzB,OAAAV,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQU,CAAI,EACpBV,EAAQ,KAAK,YAAY,EAClBS,EACT,CAcA,SAASA,GAAMC,EAAM,CAInB,OAAAV,EAAQ,MAAM,iBAAiB,EACxBc,EAAcJ,CAAI,EAAIK,EAAaf,EAAS6B,EAAqB,aAAc1B,EAAK,OAAO,WAAW,QAAQ,KAAK,SAAS,cAAc,EAAI,OAAY,CAAC,EAAEO,CAAI,EAAImB,EAAoBnB,CAAI,CACtM,CAcA,SAASmB,EAAoBnB,EAAM,CACjC,OAAIA,IAASF,GACXR,EAAQ,MAAM,yBAAyB,EAChC8B,EAAcpB,CAAI,GAEpBR,EAAIQ,CAAI,CACjB,CAcA,SAASoB,EAAcpB,EAAM,CAC3B,OAAIA,IAASF,GACXmB,IACA3B,EAAQ,QAAQU,CAAI,EACboB,GAELH,GAAQpB,GACVP,EAAQ,KAAK,yBAAyB,EAC/Bc,EAAcJ,CAAI,EAAIK,EAAaf,EAAS+B,EAAoB,YAAY,EAAErB,CAAI,EAAIqB,EAAmBrB,CAAI,GAE/GR,EAAIQ,CAAI,CACjB,CAcA,SAASqB,EAAmBrB,EAAM,CAChC,OAAIA,IAAS,MAAQO,EAAmBP,CAAI,GAC1CV,EAAQ,KAAK,iBAAiB,EACvBC,EAAGS,CAAI,GAETR,EAAIQ,CAAI,CACjB,CACF,CACF,CAOA,SAASb,GAA4BG,EAASC,EAAIC,EAAK,CACrD,IAAMC,EAAO,KACb,OAAOM,EAOP,SAASA,EAAMC,EAAM,CACnB,OAAIA,IAAS,KACJR,EAAIQ,CAAI,GAEjBV,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQU,CAAI,EACpBV,EAAQ,KAAK,YAAY,EAClBgC,EACT,CAOA,SAASA,EAAUtB,EAAM,CACvB,OAAOP,EAAK,OAAO,KAAKA,EAAK,IAAI,EAAE,IAAI,EAAID,EAAIQ,CAAI,EAAIT,EAAGS,CAAI,CAChE,CACF,CC/bO,IAAMuB,GAAe,CAC1B,KAAM,eACN,SAAUC,EACZ,EAGMC,GAAe,CACnB,QAAS,GACT,SAAUC,EACZ,EAOA,SAASF,GAAqBG,EAASC,EAAIC,EAAK,CAC9C,IAAMC,EAAO,KACb,OAAOC,EAgBP,SAASA,EAAMC,EAAM,CAGnB,OAAAL,EAAQ,MAAM,cAAc,EAGrBM,EAAaN,EAASO,EAAa,aAAc,CAAK,EAAEF,CAAI,CACrE,CAYA,SAASE,EAAYF,EAAM,CACzB,IAAMG,EAAOL,EAAK,OAAOA,EAAK,OAAO,OAAS,CAAC,EAC/C,OAAOK,GAAQA,EAAK,CAAC,EAAE,OAAS,cAAgBA,EAAK,CAAC,EAAE,eAAeA,EAAK,CAAC,EAAG,EAAI,EAAE,QAAU,EAAIC,EAAQJ,CAAI,EAAIH,EAAIG,CAAI,CAC9H,CAYA,SAASI,EAAQJ,EAAM,CACrB,OAAIA,IAAS,KACJK,EAAML,CAAI,EAEfM,EAAmBN,CAAI,EAClBL,EAAQ,QAAQF,GAAcW,EAASC,CAAK,EAAEL,CAAI,GAE3DL,EAAQ,MAAM,eAAe,EACtBY,EAAOP,CAAI,EACpB,CAYA,SAASO,EAAOP,EAAM,CACpB,OAAIA,IAAS,MAAQM,EAAmBN,CAAI,GAC1CL,EAAQ,KAAK,eAAe,EACrBS,EAAQJ,CAAI,IAErBL,EAAQ,QAAQK,CAAI,EACbO,EACT,CAGA,SAASF,EAAML,EAAM,CACnB,OAAAL,EAAQ,KAAK,cAAc,EAIpBC,EAAGI,CAAI,CAChB,CACF,CAOA,SAASN,GAAqBC,EAASC,EAAIC,EAAK,CAC9C,IAAMC,EAAO,KACb,OAAOL,EAaP,SAASA,EAAaO,EAAM,CAG1B,OAAIF,EAAK,OAAO,KAAKA,EAAK,IAAI,EAAE,IAAI,EAC3BD,EAAIG,CAAI,EAEbM,EAAmBN,CAAI,GACzBL,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQK,CAAI,EACpBL,EAAQ,KAAK,YAAY,EAClBF,GASFQ,EAAaN,EAASO,EAAa,aAAc,CAAK,EAAEF,CAAI,CACrE,CAYA,SAASE,EAAYF,EAAM,CACzB,IAAMG,EAAOL,EAAK,OAAOA,EAAK,OAAO,OAAS,CAAC,EAC/C,OAAOK,GAAQA,EAAK,CAAC,EAAE,OAAS,cAAgBA,EAAK,CAAC,EAAE,eAAeA,EAAK,CAAC,EAAG,EAAI,EAAE,QAAU,EAAIP,EAAGI,CAAI,EAAIM,EAAmBN,CAAI,EAAIP,EAAaO,CAAI,EAAIH,EAAIG,CAAI,CACzK,CACF,CClKO,IAAMQ,GAAW,CACtB,KAAM,WACN,SAAAC,GACA,QAASC,GACT,SAAUC,EACZ,EAIA,SAASD,GAAgBE,EAAQ,CAC/B,IAAIC,EAAgBD,EAAO,OAAS,EAChCE,EAAiB,EAEjBC,EAEAC,EAGJ,IAAKJ,EAAOE,CAAc,EAAE,CAAC,EAAE,OAAS,cAAgBF,EAAOE,CAAc,EAAE,CAAC,EAAE,OAAS,WAAaF,EAAOC,CAAa,EAAE,CAAC,EAAE,OAAS,cAAgBD,EAAOC,CAAa,EAAE,CAAC,EAAE,OAAS,UAI1L,IAHAE,EAAQD,EAGD,EAAEC,EAAQF,GACf,GAAID,EAAOG,CAAK,EAAE,CAAC,EAAE,OAAS,eAAgB,CAE5CH,EAAOE,CAAc,EAAE,CAAC,EAAE,KAAO,kBACjCF,EAAOC,CAAa,EAAE,CAAC,EAAE,KAAO,kBAChCC,GAAkB,EAClBD,GAAiB,EACjB,KACF,EAOJ,IAFAE,EAAQD,EAAiB,EACzBD,IACO,EAAEE,GAASF,GACZG,IAAU,OACRD,IAAUF,GAAiBD,EAAOG,CAAK,EAAE,CAAC,EAAE,OAAS,eACvDC,EAAQD,IAEDA,IAAUF,GAAiBD,EAAOG,CAAK,EAAE,CAAC,EAAE,OAAS,gBAC9DH,EAAOI,CAAK,EAAE,CAAC,EAAE,KAAO,eACpBD,IAAUC,EAAQ,IACpBJ,EAAOI,CAAK,EAAE,CAAC,EAAE,IAAMJ,EAAOG,EAAQ,CAAC,EAAE,CAAC,EAAE,IAC5CH,EAAO,OAAOI,EAAQ,EAAGD,EAAQC,EAAQ,CAAC,EAC1CH,GAAiBE,EAAQC,EAAQ,EACjCD,EAAQC,EAAQ,GAElBA,EAAQ,QAGZ,OAAOJ,CACT,CAOA,SAASH,GAASQ,EAAM,CAEtB,OAAOA,IAAS,IAAM,KAAK,OAAO,KAAK,OAAO,OAAS,CAAC,EAAE,CAAC,EAAE,OAAS,iBACxE,CAOA,SAASN,GAAiBO,EAASC,EAAIC,EAAK,CAC1C,IAAMC,EAAO,KACTC,EAAW,EAEXC,EAEAC,EACJ,OAAOC,EAcP,SAASA,EAAMR,EAAM,CACnB,OAAAC,EAAQ,MAAM,UAAU,EACxBA,EAAQ,MAAM,kBAAkB,EACzBQ,EAAaT,CAAI,CAC1B,CAYA,SAASS,EAAaT,EAAM,CAC1B,OAAIA,IAAS,IACXC,EAAQ,QAAQD,CAAI,EACpBK,IACOI,IAETR,EAAQ,KAAK,kBAAkB,EACxBS,EAAQV,CAAI,EACrB,CAYA,SAASU,EAAQV,EAAM,CAErB,OAAIA,IAAS,KACJG,EAAIH,CAAI,EAMbA,IAAS,IACXC,EAAQ,MAAM,OAAO,EACrBA,EAAQ,QAAQD,CAAI,EACpBC,EAAQ,KAAK,OAAO,EACbS,GAILV,IAAS,IACXO,EAAQN,EAAQ,MAAM,kBAAkB,EACxCK,EAAO,EACAK,EAAcX,CAAI,GAEvBY,EAAmBZ,CAAI,GACzBC,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQD,CAAI,EACpBC,EAAQ,KAAK,YAAY,EAClBS,IAITT,EAAQ,MAAM,cAAc,EACrBY,EAAKb,CAAI,EAClB,CAYA,SAASa,EAAKb,EAAM,CAClB,OAAIA,IAAS,MAAQA,IAAS,IAAMA,IAAS,IAAMY,EAAmBZ,CAAI,GACxEC,EAAQ,KAAK,cAAc,EACpBS,EAAQV,CAAI,IAErBC,EAAQ,QAAQD,CAAI,EACba,EACT,CAYA,SAASF,EAAcX,EAAM,CAE3B,OAAIA,IAAS,IACXC,EAAQ,QAAQD,CAAI,EACpBM,IACOK,GAILL,IAASD,GACXJ,EAAQ,KAAK,kBAAkB,EAC/BA,EAAQ,KAAK,UAAU,EAChBC,EAAGF,CAAI,IAIhBO,EAAM,KAAO,eACNM,EAAKb,CAAI,EAClB,CACF,CCnMO,IAAMc,GAAN,KAAmB,CAOxB,YAAYC,EAAS,CAEnB,KAAK,KAAOA,EAAU,CAAC,GAAGA,CAAO,EAAI,CAAC,EAEtC,KAAK,MAAQ,CAAC,CAChB,CAWA,IAAIC,EAAO,CACT,GAAIA,EAAQ,GAAKA,GAAS,KAAK,KAAK,OAAS,KAAK,MAAM,OACtD,MAAM,IAAI,WAAW,wBAA0BA,EAAQ,kCAAoC,KAAK,KAAK,OAAS,KAAK,MAAM,QAAU,GAAG,EAExI,OAAIA,EAAQ,KAAK,KAAK,OAAe,KAAK,KAAKA,CAAK,EAC7C,KAAK,MAAM,KAAK,MAAM,OAASA,EAAQ,KAAK,KAAK,OAAS,CAAC,CACpE,CAMA,IAAI,QAAS,CACX,OAAO,KAAK,KAAK,OAAS,KAAK,MAAM,MACvC,CASA,OAAQ,CACN,YAAK,UAAU,CAAC,EACT,KAAK,MAAM,IAAI,CACxB,CAaA,MAAMC,EAAOC,EAAK,CAEhB,IAAMC,EAAOD,GAAoC,OAAO,kBACxD,OAAIC,EAAO,KAAK,KAAK,OACZ,KAAK,KAAK,MAAMF,EAAOE,CAAI,EAEhCF,EAAQ,KAAK,KAAK,OACb,KAAK,MAAM,MAAM,KAAK,MAAM,OAASE,EAAO,KAAK,KAAK,OAAQ,KAAK,MAAM,OAASF,EAAQ,KAAK,KAAK,MAAM,EAAE,QAAQ,EAEtH,KAAK,KAAK,MAAMA,CAAK,EAAE,OAAO,KAAK,MAAM,MAAM,KAAK,MAAM,OAASE,EAAO,KAAK,KAAK,MAAM,EAAE,QAAQ,CAAC,CAC9G,CAsBA,OAAOF,EAAOG,EAAaC,EAAO,CAEhC,IAAMC,EAAQF,GAAe,EAC7B,KAAK,UAAU,KAAK,MAAMH,CAAK,CAAC,EAChC,IAAMM,EAAU,KAAK,MAAM,OAAO,KAAK,MAAM,OAASD,EAAO,OAAO,iBAAiB,EACrF,OAAID,GAAOG,GAAY,KAAK,KAAMH,CAAK,EAChCE,EAAQ,QAAQ,CACzB,CAUA,KAAM,CACJ,YAAK,UAAU,OAAO,iBAAiB,EAChC,KAAK,KAAK,IAAI,CACvB,CAWA,KAAKE,EAAM,CACT,KAAK,UAAU,OAAO,iBAAiB,EACvC,KAAK,KAAK,KAAKA,CAAI,CACrB,CAWA,SAASJ,EAAO,CACd,KAAK,UAAU,OAAO,iBAAiB,EACvCG,GAAY,KAAK,KAAMH,CAAK,CAC9B,CAWA,QAAQI,EAAM,CACZ,KAAK,UAAU,CAAC,EAChB,KAAK,MAAM,KAAKA,CAAI,CACtB,CAWA,YAAYJ,EAAO,CACjB,KAAK,UAAU,CAAC,EAChBG,GAAY,KAAK,MAAOH,EAAM,QAAQ,CAAC,CACzC,CAcA,UAAUK,EAAG,CACX,GAAI,EAAAA,IAAM,KAAK,KAAK,QAAUA,EAAI,KAAK,KAAK,QAAU,KAAK,MAAM,SAAW,GAAKA,EAAI,GAAK,KAAK,KAAK,SAAW,GAC/G,GAAIA,EAAI,KAAK,KAAK,OAAQ,CAExB,IAAMH,EAAU,KAAK,KAAK,OAAOG,EAAG,OAAO,iBAAiB,EAC5DF,GAAY,KAAK,MAAOD,EAAQ,QAAQ,CAAC,CAC3C,KAAO,CAEL,IAAMA,EAAU,KAAK,MAAM,OAAO,KAAK,KAAK,OAAS,KAAK,MAAM,OAASG,EAAG,OAAO,iBAAiB,EACpGF,GAAY,KAAK,KAAMD,EAAQ,QAAQ,CAAC,CAC1C,CACF,CACF,EAcA,SAASC,GAAYG,EAAMC,EAAO,CAEhC,IAAIC,EAAa,EACjB,GAAID,EAAM,OAAS,IACjBD,EAAK,KAAK,GAAGC,CAAK,MAElB,MAAOC,EAAaD,EAAM,QACxBD,EAAK,KAAK,GAAGC,EAAM,MAAMC,EAAYA,EAAa,GAAK,CAAC,EACxDA,GAAc,GAGpB,CCvOO,SAASC,GAAYC,EAAa,CAEvC,IAAMC,EAAQ,CAAC,EACXC,EAAQ,GAERC,EAEAC,EAEAC,EAEAC,EAEAC,EAEAC,EAEAC,EACEC,EAAS,IAAIC,GAAaX,CAAW,EAC3C,KAAO,EAAEE,EAAQQ,EAAO,QAAQ,CAC9B,KAAOR,KAASD,GACdC,EAAQD,EAAMC,CAAK,EAMrB,GAJAC,EAAQO,EAAO,IAAIR,CAAK,EAIpBA,GAASC,EAAM,CAAC,EAAE,OAAS,aAAeO,EAAO,IAAIR,EAAQ,CAAC,EAAE,CAAC,EAAE,OAAS,mBAC9EM,EAAYL,EAAM,CAAC,EAAE,WAAW,OAChCE,EAAa,EACTA,EAAaG,EAAU,QAAUA,EAAUH,CAAU,EAAE,CAAC,EAAE,OAAS,oBACrEA,GAAc,GAEZA,EAAaG,EAAU,QAAUA,EAAUH,CAAU,EAAE,CAAC,EAAE,OAAS,WACrE,KAAO,EAAEA,EAAaG,EAAU,QAC1BA,EAAUH,CAAU,EAAE,CAAC,EAAE,OAAS,WAGlCG,EAAUH,CAAU,EAAE,CAAC,EAAE,OAAS,cACpCG,EAAUH,CAAU,EAAE,CAAC,EAAE,4BAA8B,GACvDA,KAOR,GAAIF,EAAM,CAAC,IAAM,QACXA,EAAM,CAAC,EAAE,cACX,OAAO,OAAOF,EAAOW,GAAWF,EAAQR,CAAK,CAAC,EAC9CA,EAAQD,EAAMC,CAAK,EACnBO,EAAO,YAIFN,EAAM,CAAC,EAAE,WAAY,CAG5B,IAFAE,EAAaH,EACbE,EAAY,OACLC,KAEL,GADAC,EAAaI,EAAO,IAAIL,CAAU,EAC9BC,EAAW,CAAC,EAAE,OAAS,cAAgBA,EAAW,CAAC,EAAE,OAAS,kBAC5DA,EAAW,CAAC,IAAM,UAChBF,IACFM,EAAO,IAAIN,CAAS,EAAE,CAAC,EAAE,KAAO,mBAElCE,EAAW,CAAC,EAAE,KAAO,aACrBF,EAAYC,WAEL,EAAAC,EAAW,CAAC,EAAE,OAAS,cAAgBA,EAAW,CAAC,EAAE,OAAS,kBAGvE,MAGAF,IAEFD,EAAM,CAAC,EAAE,IAAM,CACb,GAAGO,EAAO,IAAIN,CAAS,EAAE,CAAC,EAAE,KAC9B,EAGAG,EAAaG,EAAO,MAAMN,EAAWF,CAAK,EAC1CK,EAAW,QAAQJ,CAAK,EACxBO,EAAO,OAAON,EAAWF,EAAQE,EAAY,EAAGG,CAAU,EAE9D,CACF,CAGA,OAAAM,GAAOb,EAAa,EAAG,OAAO,kBAAmBU,EAAO,MAAM,CAAC,CAAC,EACzD,CAACD,CACV,CAYA,SAASG,GAAWF,EAAQI,EAAY,CACtC,IAAMC,EAAQL,EAAO,IAAII,CAAU,EAAE,CAAC,EAChCE,EAAUN,EAAO,IAAII,CAAU,EAAE,CAAC,EACpCG,EAAgBH,EAAa,EAE3BI,EAAiB,CAAC,EACpBC,EAAYJ,EAAM,WACjBI,IACHA,EAAYH,EAAQ,OAAOD,EAAM,WAAW,EAAEA,EAAM,KAAK,EACrDA,EAAM,2BACRI,EAAU,yBAA2B,KAGzC,IAAMC,EAAcD,EAAU,OAExBlB,EAAQ,CAAC,EAEToB,EAAO,CAAC,EAEVC,EAEAC,EACArB,EAAQ,GAERsB,EAAUT,EACVU,EAAS,EACTC,EAAQ,EACNC,EAAS,CAACD,CAAK,EAIrB,KAAOF,GAAS,CAEd,KAAOd,EAAO,IAAI,EAAEO,CAAa,EAAE,CAAC,IAAMO,GAAS,CAGnDN,EAAe,KAAKD,CAAa,EAC5BO,EAAQ,aACXF,EAASN,EAAQ,YAAYQ,CAAO,EAC/BA,EAAQ,MACXF,EAAO,KAAK,IAAI,EAEdC,GACFJ,EAAU,WAAWK,EAAQ,KAAK,EAEhCA,EAAQ,8BACVL,EAAU,mCAAqC,IAEjDA,EAAU,MAAMG,CAAM,EAClBE,EAAQ,8BACVL,EAAU,mCAAqC,SAKnDI,EAAWC,EACXA,EAAUA,EAAQ,IACpB,CAKA,IADAA,EAAUT,EACH,EAAEb,EAAQkB,EAAY,QAG3BA,EAAYlB,CAAK,EAAE,CAAC,IAAM,QAAUkB,EAAYlB,EAAQ,CAAC,EAAE,CAAC,IAAM,SAAWkB,EAAYlB,CAAK,EAAE,CAAC,EAAE,OAASkB,EAAYlB,EAAQ,CAAC,EAAE,CAAC,EAAE,MAAQkB,EAAYlB,CAAK,EAAE,CAAC,EAAE,MAAM,OAASkB,EAAYlB,CAAK,EAAE,CAAC,EAAE,IAAI,OAC3MwB,EAAQxB,EAAQ,EAChByB,EAAO,KAAKD,CAAK,EAEjBF,EAAQ,WAAa,OACrBA,EAAQ,SAAW,OACnBA,EAAUA,EAAQ,MAqBtB,IAhBAL,EAAU,OAAS,CAAC,EAKhBK,GAEFA,EAAQ,WAAa,OACrBA,EAAQ,SAAW,QAEnBG,EAAO,IAAI,EAKbzB,EAAQyB,EAAO,OACRzB,KAAS,CACd,IAAM0B,EAAQR,EAAY,MAAMO,EAAOzB,CAAK,EAAGyB,EAAOzB,EAAQ,CAAC,CAAC,EAC1DwB,EAAQR,EAAe,IAAI,EACjCjB,EAAM,KAAK,CAACyB,EAAOA,EAAQE,EAAM,OAAS,CAAC,CAAC,EAC5ClB,EAAO,OAAOgB,EAAO,EAAGE,CAAK,CAC/B,CAGA,IAFA3B,EAAM,QAAQ,EACdC,EAAQ,GACD,EAAEA,EAAQD,EAAM,QACrBoB,EAAKI,EAASxB,EAAMC,CAAK,EAAE,CAAC,CAAC,EAAIuB,EAASxB,EAAMC,CAAK,EAAE,CAAC,EACxDuB,GAAUxB,EAAMC,CAAK,EAAE,CAAC,EAAID,EAAMC,CAAK,EAAE,CAAC,EAAI,EAEhD,OAAOmB,CACT,CCjNO,IAAMQ,GAAU,CACrB,QAASC,GACT,SAAUC,EACZ,EAGMC,GAAwB,CAC5B,QAAS,GACT,SAAUC,EACZ,EAQA,SAASH,GAAeI,EAAQ,CAC9B,OAAAC,GAAYD,CAAM,EACXA,CACT,CAOA,SAASH,GAAgBK,EAASC,EAAI,CAEpC,IAAIC,EACJ,OAAOC,EAYP,SAASA,EAAWC,EAAM,CACxB,OAAAJ,EAAQ,MAAM,SAAS,EACvBE,EAAWF,EAAQ,MAAM,eAAgB,CACvC,YAAa,SACf,CAAC,EACMK,EAAYD,CAAI,CACzB,CAYA,SAASC,EAAYD,EAAM,CACzB,OAAIA,IAAS,KACJE,EAAWF,CAAI,EAKpBG,EAAmBH,CAAI,EAClBJ,EAAQ,MAAMJ,GAAuBY,EAAiBF,CAAU,EAAEF,CAAI,GAI/EJ,EAAQ,QAAQI,CAAI,EACbC,EACT,CAOA,SAASC,EAAWF,EAAM,CACxB,OAAAJ,EAAQ,KAAK,cAAc,EAC3BA,EAAQ,KAAK,SAAS,EACfC,EAAGG,CAAI,CAChB,CAOA,SAASI,EAAgBJ,EAAM,CAC7B,OAAAJ,EAAQ,QAAQI,CAAI,EACpBJ,EAAQ,KAAK,cAAc,EAC3BE,EAAS,KAAOF,EAAQ,MAAM,eAAgB,CAC5C,YAAa,UACb,SAAAE,CACF,CAAC,EACDA,EAAWA,EAAS,KACbG,CACT,CACF,CAOA,SAASR,GAAqBG,EAASC,EAAIQ,EAAK,CAC9C,IAAMC,EAAO,KACb,OAAOC,EAOP,SAASA,EAAeP,EAAM,CAC5B,OAAAJ,EAAQ,KAAK,cAAc,EAC3BA,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQI,CAAI,EACpBJ,EAAQ,KAAK,YAAY,EAClBY,EAAaZ,EAASa,EAAU,YAAY,CACrD,CAOA,SAASA,EAAST,EAAM,CACtB,GAAIA,IAAS,MAAQG,EAAmBH,CAAI,EAC1C,OAAOK,EAAIL,CAAI,EAKjB,IAAMU,EAAOJ,EAAK,OAAOA,EAAK,OAAO,OAAS,CAAC,EAC/C,MAAI,CAACA,EAAK,OAAO,WAAW,QAAQ,KAAK,SAAS,cAAc,GAAKI,GAAQA,EAAK,CAAC,EAAE,OAAS,cAAgBA,EAAK,CAAC,EAAE,eAAeA,EAAK,CAAC,EAAG,EAAI,EAAE,QAAU,EACrJb,EAAGG,CAAI,EAETJ,EAAQ,UAAUU,EAAK,OAAO,WAAW,KAAMD,EAAKR,CAAE,EAAEG,CAAI,CACrE,CACF,CCxHO,SAASW,GAAmBC,EAASC,EAAIC,EAAKC,EAAMC,EAAaC,EAAmBC,EAASC,EAAYC,EAAK,CACnH,IAAMC,EAAQD,GAAO,OAAO,kBACxBE,EAAU,EACd,OAAOC,EAcP,SAASA,EAAMC,EAAM,CACnB,OAAIA,IAAS,IACXZ,EAAQ,MAAMG,CAAI,EAClBH,EAAQ,MAAMI,CAAW,EACzBJ,EAAQ,MAAMK,CAAiB,EAC/BL,EAAQ,QAAQY,CAAI,EACpBZ,EAAQ,KAAKK,CAAiB,EACvBQ,GAILD,IAAS,MAAQA,IAAS,IAAMA,IAAS,IAAME,GAAaF,CAAI,EAC3DV,EAAIU,CAAI,GAEjBZ,EAAQ,MAAMG,CAAI,EAClBH,EAAQ,MAAMM,CAAO,EACrBN,EAAQ,MAAMO,CAAU,EACxBP,EAAQ,MAAM,cAAe,CAC3B,YAAa,QACf,CAAC,EACMe,EAAIH,CAAI,EACjB,CAYA,SAASC,EAAeD,EAAM,CAC5B,OAAIA,IAAS,IACXZ,EAAQ,MAAMK,CAAiB,EAC/BL,EAAQ,QAAQY,CAAI,EACpBZ,EAAQ,KAAKK,CAAiB,EAC9BL,EAAQ,KAAKI,CAAW,EACxBJ,EAAQ,KAAKG,CAAI,EACVF,IAETD,EAAQ,MAAMO,CAAU,EACxBP,EAAQ,MAAM,cAAe,CAC3B,YAAa,QACf,CAAC,EACMgB,EAASJ,CAAI,EACtB,CAYA,SAASI,EAASJ,EAAM,CACtB,OAAIA,IAAS,IACXZ,EAAQ,KAAK,aAAa,EAC1BA,EAAQ,KAAKO,CAAU,EAChBM,EAAeD,CAAI,GAExBA,IAAS,MAAQA,IAAS,IAAMK,EAAmBL,CAAI,EAClDV,EAAIU,CAAI,GAEjBZ,EAAQ,QAAQY,CAAI,EACbA,IAAS,GAAKM,EAAiBF,EACxC,CAYA,SAASE,EAAeN,EAAM,CAC5B,OAAIA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IACzCZ,EAAQ,QAAQY,CAAI,EACbI,GAEFA,EAASJ,CAAI,CACtB,CAYA,SAASG,EAAIH,EAAM,CACjB,MAAI,CAACF,IAAYE,IAAS,MAAQA,IAAS,IAAMO,EAA0BP,CAAI,IAC7EZ,EAAQ,KAAK,aAAa,EAC1BA,EAAQ,KAAKO,CAAU,EACvBP,EAAQ,KAAKM,CAAO,EACpBN,EAAQ,KAAKG,CAAI,EACVF,EAAGW,CAAI,GAEZF,EAAUD,GAASG,IAAS,IAC9BZ,EAAQ,QAAQY,CAAI,EACpBF,IACOK,GAELH,IAAS,IACXZ,EAAQ,QAAQY,CAAI,EACpBF,IACOK,GAMLH,IAAS,MAAQA,IAAS,IAAMA,IAAS,IAAME,GAAaF,CAAI,EAC3DV,EAAIU,CAAI,GAEjBZ,EAAQ,QAAQY,CAAI,EACbA,IAAS,GAAKQ,EAAYL,EACnC,CAYA,SAASK,EAAUR,EAAM,CACvB,OAAIA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IACzCZ,EAAQ,QAAQY,CAAI,EACbG,GAEFA,EAAIH,CAAI,CACjB,CACF,CCpKO,SAASS,GAAaC,EAASC,EAAIC,EAAKC,EAAMC,EAAYC,EAAY,CAC3E,IAAMC,EAAO,KACTC,EAAO,EAEPC,EACJ,OAAOC,EAYP,SAASA,EAAMC,EAAM,CACnB,OAAAV,EAAQ,MAAMG,CAAI,EAClBH,EAAQ,MAAMI,CAAU,EACxBJ,EAAQ,QAAQU,CAAI,EACpBV,EAAQ,KAAKI,CAAU,EACvBJ,EAAQ,MAAMK,CAAU,EACjBM,CACT,CAYA,SAASA,EAAQD,EAAM,CACrB,OAAIH,EAAO,KAAOG,IAAS,MAAQA,IAAS,IAAMA,IAAS,IAAM,CAACF,GAMlEE,IAAS,IAAM,CAACH,GAAQ,2BAA4BD,EAAK,OAAO,WACvDJ,EAAIQ,CAAI,EAEbA,IAAS,IACXV,EAAQ,KAAKK,CAAU,EACvBL,EAAQ,MAAMI,CAAU,EACxBJ,EAAQ,QAAQU,CAAI,EACpBV,EAAQ,KAAKI,CAAU,EACvBJ,EAAQ,KAAKG,CAAI,EACVF,GAILW,EAAmBF,CAAI,GACzBV,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQU,CAAI,EACpBV,EAAQ,KAAK,YAAY,EAClBW,IAETX,EAAQ,MAAM,cAAe,CAC3B,YAAa,QACf,CAAC,EACMa,EAAYH,CAAI,EACzB,CAYA,SAASG,EAAYH,EAAM,CACzB,OAAIA,IAAS,MAAQA,IAAS,IAAMA,IAAS,IAAME,EAAmBF,CAAI,GAAKH,IAAS,KACtFP,EAAQ,KAAK,aAAa,EACnBW,EAAQD,CAAI,IAErBV,EAAQ,QAAQU,CAAI,EACfF,IAAMA,EAAO,CAACM,EAAcJ,CAAI,GAC9BA,IAAS,GAAKK,EAAcF,EACrC,CAYA,SAASE,EAAYL,EAAM,CACzB,OAAIA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IACzCV,EAAQ,QAAQU,CAAI,EACpBH,IACOM,GAEFA,EAAYH,CAAI,CACzB,CACF,CCzGO,SAASM,GAAaC,EAASC,EAAIC,EAAKC,EAAMC,EAAYC,EAAY,CAE3E,IAAIC,EACJ,OAAOC,EAYP,SAASA,EAAMC,EAAM,CACnB,OAAIA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IACzCR,EAAQ,MAAMG,CAAI,EAClBH,EAAQ,MAAMI,CAAU,EACxBJ,EAAQ,QAAQQ,CAAI,EACpBR,EAAQ,KAAKI,CAAU,EACvBE,EAASE,IAAS,GAAK,GAAKA,EACrBC,GAEFP,EAAIM,CAAI,CACjB,CAcA,SAASC,EAAMD,EAAM,CACnB,OAAIA,IAASF,GACXN,EAAQ,MAAMI,CAAU,EACxBJ,EAAQ,QAAQQ,CAAI,EACpBR,EAAQ,KAAKI,CAAU,EACvBJ,EAAQ,KAAKG,CAAI,EACVF,IAETD,EAAQ,MAAMK,CAAU,EACjBK,EAAQF,CAAI,EACrB,CAYA,SAASE,EAAQF,EAAM,CACrB,OAAIA,IAASF,GACXN,EAAQ,KAAKK,CAAU,EAChBI,EAAMH,CAAM,GAEjBE,IAAS,KACJN,EAAIM,CAAI,EAIbG,EAAmBH,CAAI,GAEzBR,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQQ,CAAI,EACpBR,EAAQ,KAAK,YAAY,EAClBY,EAAaZ,EAASU,EAAS,YAAY,IAEpDV,EAAQ,MAAM,cAAe,CAC3B,YAAa,QACf,CAAC,EACMa,EAAOL,CAAI,EACpB,CAOA,SAASK,EAAOL,EAAM,CACpB,OAAIA,IAASF,GAAUE,IAAS,MAAQG,EAAmBH,CAAI,GAC7DR,EAAQ,KAAK,aAAa,EACnBU,EAAQF,CAAI,IAErBR,EAAQ,QAAQQ,CAAI,EACbA,IAAS,GAAKM,EAASD,EAChC,CAYA,SAASC,EAAON,EAAM,CACpB,OAAIA,IAASF,GAAUE,IAAS,IAC9BR,EAAQ,QAAQQ,CAAI,EACbK,GAEFA,EAAOL,CAAI,CACpB,CACF,CCrIO,SAASO,GAAkBC,EAASC,EAAI,CAE7C,IAAIC,EACJ,OAAOC,EAGP,SAASA,EAAMC,EAAM,CACnB,OAAIC,EAAmBD,CAAI,GACzBJ,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQI,CAAI,EACpBJ,EAAQ,KAAK,YAAY,EACzBE,EAAO,GACAC,GAELG,EAAcF,CAAI,EACbG,EAAaP,EAASG,EAAOD,EAAO,aAAe,YAAY,EAAEE,CAAI,EAEvEH,EAAGG,CAAI,CAChB,CACF,CC1BO,IAAMI,GAAa,CACxB,KAAM,aACN,SAAUC,EACZ,EAGMC,GAAc,CAClB,QAAS,GACT,SAAUC,EACZ,EAOA,SAASF,GAAmBG,EAASC,EAAIC,EAAK,CAC5C,IAAMC,EAAO,KAETC,EACJ,OAAOC,EAYP,SAASA,EAAMC,EAAM,CAInB,OAAAN,EAAQ,MAAM,YAAY,EACnBO,EAAOD,CAAI,CACpB,CAYA,SAASC,EAAOD,EAAM,CAGpB,OAAOE,GAAa,KAAKL,EAAMH,EAASS,EAExCP,EAAK,kBAAmB,wBAAyB,uBAAuB,EAAEI,CAAI,CAChF,CAYA,SAASG,EAAWH,EAAM,CAExB,OADAF,EAAaM,GAAoBP,EAAK,eAAeA,EAAK,OAAOA,EAAK,OAAO,OAAS,CAAC,EAAE,CAAC,CAAC,EAAE,MAAM,EAAG,EAAE,CAAC,EACrGG,IAAS,IACXN,EAAQ,MAAM,kBAAkB,EAChCA,EAAQ,QAAQM,CAAI,EACpBN,EAAQ,KAAK,kBAAkB,EACxBW,GAEFT,EAAII,CAAI,CACjB,CAYA,SAASK,EAAYL,EAAM,CAEzB,OAAOM,EAA0BN,CAAI,EAAIO,GAAkBb,EAASc,CAAiB,EAAER,CAAI,EAAIQ,EAAkBR,CAAI,CACvH,CAYA,SAASQ,EAAkBR,EAAM,CAC/B,OAAOS,GAAmBf,EAASgB,EAEnCd,EAAK,wBAAyB,+BAAgC,qCAAsC,2BAA4B,6BAA6B,EAAEI,CAAI,CACrK,CAYA,SAASU,EAAiBV,EAAM,CAC9B,OAAON,EAAQ,QAAQF,GAAamB,EAAOA,CAAK,EAAEX,CAAI,CACxD,CAcA,SAASW,EAAMX,EAAM,CACnB,OAAOY,EAAcZ,CAAI,EAAIa,EAAanB,EAASoB,EAAiB,YAAY,EAAEd,CAAI,EAAIc,EAAgBd,CAAI,CAChH,CAcA,SAASc,EAAgBd,EAAM,CAC7B,OAAIA,IAAS,MAAQe,EAAmBf,CAAI,GAC1CN,EAAQ,KAAK,YAAY,EAKzBG,EAAK,OAAO,QAAQ,KAAKC,CAAU,EAK5BH,EAAGK,CAAI,GAETJ,EAAII,CAAI,CACjB,CACF,CAOA,SAASP,GAAoBC,EAASC,EAAIC,EAAK,CAC7C,OAAOJ,EAcP,SAASA,EAAYQ,EAAM,CACzB,OAAOM,EAA0BN,CAAI,EAAIO,GAAkBb,EAASsB,CAAY,EAAEhB,CAAI,EAAIJ,EAAII,CAAI,CACpG,CAaA,SAASgB,EAAahB,EAAM,CAC1B,OAAOiB,GAAavB,EAASwB,EAAYtB,EAAK,kBAAmB,wBAAyB,uBAAuB,EAAEI,CAAI,CACzH,CAYA,SAASkB,EAAWlB,EAAM,CACxB,OAAOY,EAAcZ,CAAI,EAAIa,EAAanB,EAASyB,EAA8B,YAAY,EAAEnB,CAAI,EAAImB,EAA6BnB,CAAI,CAC1I,CAYA,SAASmB,EAA6BnB,EAAM,CAC1C,OAAOA,IAAS,MAAQe,EAAmBf,CAAI,EAAIL,EAAGK,CAAI,EAAIJ,EAAII,CAAI,CACxE,CACF,CClPO,IAAMoB,GAAkB,CAC7B,KAAM,kBACN,SAAUC,EACZ,EAOA,SAASA,GAAwBC,EAASC,EAAIC,EAAK,CACjD,OAAOC,EAaP,SAASA,EAAMC,EAAM,CACnB,OAAAJ,EAAQ,MAAM,iBAAiB,EAC/BA,EAAQ,QAAQI,CAAI,EACbC,CACT,CAaA,SAASA,EAAMD,EAAM,CACnB,OAAIE,EAAmBF,CAAI,GACzBJ,EAAQ,KAAK,iBAAiB,EACvBC,EAAGG,CAAI,GAETF,EAAIE,CAAI,CACjB,CACF,CC5CO,IAAMG,GAAa,CACxB,KAAM,aACN,QAASC,GACT,SAAUC,EACZ,EAGA,SAASD,GAAkBE,EAAQC,EAAS,CAC1C,IAAIC,EAAaF,EAAO,OAAS,EAC7BG,EAAe,EAEfC,EAEAC,EAGJ,OAAIL,EAAOG,CAAY,EAAE,CAAC,EAAE,OAAS,eACnCA,GAAgB,GAIdD,EAAa,EAAIC,GAAgBH,EAAOE,CAAU,EAAE,CAAC,EAAE,OAAS,eAClEA,GAAc,GAEZF,EAAOE,CAAU,EAAE,CAAC,EAAE,OAAS,uBAAyBC,IAAiBD,EAAa,GAAKA,EAAa,EAAIC,GAAgBH,EAAOE,EAAa,CAAC,EAAE,CAAC,EAAE,OAAS,gBACjKA,GAAcC,EAAe,IAAMD,EAAa,EAAI,GAElDA,EAAaC,IACfC,EAAU,CACR,KAAM,iBACN,MAAOJ,EAAOG,CAAY,EAAE,CAAC,EAAE,MAC/B,IAAKH,EAAOE,CAAU,EAAE,CAAC,EAAE,GAC7B,EACAG,EAAO,CACL,KAAM,YACN,MAAOL,EAAOG,CAAY,EAAE,CAAC,EAAE,MAC/B,IAAKH,EAAOE,CAAU,EAAE,CAAC,EAAE,IAC3B,YAAa,MACf,EACAI,GAAON,EAAQG,EAAcD,EAAaC,EAAe,EAAG,CAAC,CAAC,QAASC,EAASH,CAAO,EAAG,CAAC,QAASI,EAAMJ,CAAO,EAAG,CAAC,OAAQI,EAAMJ,CAAO,EAAG,CAAC,OAAQG,EAASH,CAAO,CAAC,CAAC,GAEnKD,CACT,CAOA,SAASD,GAAmBQ,EAASC,EAAIC,EAAK,CAC5C,IAAIC,EAAO,EACX,OAAOC,EAYP,SAASA,EAAMC,EAAM,CAEnB,OAAAL,EAAQ,MAAM,YAAY,EACnBM,EAAOD,CAAI,CACpB,CAYA,SAASC,EAAOD,EAAM,CACpB,OAAAL,EAAQ,MAAM,oBAAoB,EAC3BO,EAAaF,CAAI,CAC1B,CAYA,SAASE,EAAaF,EAAM,CAC1B,OAAIA,IAAS,IAAMF,IAAS,GAC1BH,EAAQ,QAAQK,CAAI,EACbE,GAILF,IAAS,MAAQG,EAA0BH,CAAI,GACjDL,EAAQ,KAAK,oBAAoB,EAC1BS,EAAQJ,CAAI,GAEdH,EAAIG,CAAI,CACjB,CAYA,SAASI,EAAQJ,EAAM,CACrB,OAAIA,IAAS,IACXL,EAAQ,MAAM,oBAAoB,EAC3BU,EAAgBL,CAAI,GAEzBA,IAAS,MAAQM,EAAmBN,CAAI,GAC1CL,EAAQ,KAAK,YAAY,EAIlBC,EAAGI,CAAI,GAEZO,EAAcP,CAAI,EACbQ,EAAab,EAASS,EAAS,YAAY,EAAEJ,CAAI,GAK1DL,EAAQ,MAAM,gBAAgB,EACvBc,EAAKT,CAAI,EAClB,CAcA,SAASK,EAAgBL,EAAM,CAC7B,OAAIA,IAAS,IACXL,EAAQ,QAAQK,CAAI,EACbK,IAETV,EAAQ,KAAK,oBAAoB,EAC1BS,EAAQJ,CAAI,EACrB,CAYA,SAASS,EAAKT,EAAM,CAClB,OAAIA,IAAS,MAAQA,IAAS,IAAMG,EAA0BH,CAAI,GAChEL,EAAQ,KAAK,gBAAgB,EACtBS,EAAQJ,CAAI,IAErBL,EAAQ,QAAQK,CAAI,EACbS,EACT,CACF,CCnLO,IAAMC,GAAiB,CAC5B,UACA,UACA,QACA,OACA,WACA,aACA,OACA,UACA,SACA,MACA,WACA,KACA,UACA,SACA,MACA,MACA,KACA,KACA,WACA,aACA,SACA,SACA,OACA,QACA,WACA,KACA,KACA,KACA,KACA,KACA,KACA,OACA,SACA,KACA,OACA,SACA,SACA,KACA,OACA,OACA,OACA,WACA,MACA,WACA,KACA,WACA,SACA,IACA,QACA,SACA,UACA,UACA,QACA,QACA,KACA,QACA,KACA,QACA,QACA,KACA,QACA,IACF,EAcaC,GAAe,CAAC,MAAO,SAAU,QAAS,UAAU,EC5E1D,IAAMC,GAAW,CACtB,SAAU,GACV,KAAM,WACN,UAAWC,GACX,SAAUC,EACZ,EAGMC,GAAkB,CACtB,QAAS,GACT,SAAUC,EACZ,EACMC,GAA2B,CAC/B,QAAS,GACT,SAAUC,EACZ,EAGA,SAASL,GAAkBM,EAAQ,CACjC,IAAIC,EAAQD,EAAO,OACnB,KAAOC,KACD,EAAAD,EAAOC,CAAK,EAAE,CAAC,IAAM,SAAWD,EAAOC,CAAK,EAAE,CAAC,EAAE,OAAS,aAA9D,CAIF,OAAIA,EAAQ,GAAKD,EAAOC,EAAQ,CAAC,EAAE,CAAC,EAAE,OAAS,eAE7CD,EAAOC,CAAK,EAAE,CAAC,EAAE,MAAQD,EAAOC,EAAQ,CAAC,EAAE,CAAC,EAAE,MAE9CD,EAAOC,EAAQ,CAAC,EAAE,CAAC,EAAE,MAAQD,EAAOC,EAAQ,CAAC,EAAE,CAAC,EAAE,MAElDD,EAAO,OAAOC,EAAQ,EAAG,CAAC,GAErBD,CACT,CAOA,SAASL,GAAiBO,EAASC,EAAIC,EAAK,CAC1C,IAAMC,EAAO,KAETC,EAEAC,EAEAC,EAEAP,EAEAQ,EACJ,OAAOC,EAYP,SAASA,EAAMC,EAAM,CAEnB,OAAOC,EAAOD,CAAI,CACpB,CAYA,SAASC,EAAOD,EAAM,CACpB,OAAAT,EAAQ,MAAM,UAAU,EACxBA,EAAQ,MAAM,cAAc,EAC5BA,EAAQ,QAAQS,CAAI,EACbE,CACT,CAgBA,SAASA,EAAKF,EAAM,CAClB,OAAIA,IAAS,IACXT,EAAQ,QAAQS,CAAI,EACbG,GAELH,IAAS,IACXT,EAAQ,QAAQS,CAAI,EACpBJ,EAAa,GACNQ,GAELJ,IAAS,IACXT,EAAQ,QAAQS,CAAI,EACpBL,EAAS,EAMFD,EAAK,UAAYF,EAAKa,GAI3BC,GAAWN,CAAI,GAEjBT,EAAQ,QAAQS,CAAI,EACpBH,EAAS,OAAO,aAAaG,CAAI,EAC1BO,GAEFd,EAAIO,CAAI,CACjB,CAgBA,SAASG,EAAgBH,EAAM,CAC7B,OAAIA,IAAS,IACXT,EAAQ,QAAQS,CAAI,EACpBL,EAAS,EACFa,GAELR,IAAS,IACXT,EAAQ,QAAQS,CAAI,EACpBL,EAAS,EACTL,EAAQ,EACDmB,GAILH,GAAWN,CAAI,GACjBT,EAAQ,QAAQS,CAAI,EACpBL,EAAS,EAGFD,EAAK,UAAYF,EAAKa,GAExBZ,EAAIO,CAAI,CACjB,CAYA,SAASQ,EAAkBR,EAAM,CAC/B,OAAIA,IAAS,IACXT,EAAQ,QAAQS,CAAI,EAGbN,EAAK,UAAYF,EAAKa,GAExBZ,EAAIO,CAAI,CACjB,CAYA,SAASS,EAAgBT,EAAM,CAC7B,IAAMU,GAAQ,SACd,OAAIV,IAASU,GAAM,WAAWpB,GAAO,GACnCC,EAAQ,QAAQS,CAAI,EAChBV,IAAUoB,GAAM,OAGXhB,EAAK,UAAYF,EAAKmB,EAExBF,GAEFhB,EAAIO,CAAI,CACjB,CAYA,SAASI,EAAcJ,EAAM,CAC3B,OAAIM,GAAWN,CAAI,GAEjBT,EAAQ,QAAQS,CAAI,EACpBH,EAAS,OAAO,aAAaG,CAAI,EAC1BO,GAEFd,EAAIO,CAAI,CACjB,CAcA,SAASO,EAAQP,EAAM,CACrB,GAAIA,IAAS,MAAQA,IAAS,IAAMA,IAAS,IAAMY,EAA0BZ,CAAI,EAAG,CAClF,IAAMa,GAAQb,IAAS,GACjBc,GAAOjB,EAAO,YAAY,EAChC,MAAI,CAACgB,IAAS,CAACjB,GAAcmB,GAAa,SAASD,EAAI,GACrDnB,EAAS,EAGFD,EAAK,UAAYF,EAAGQ,CAAI,EAAIW,EAAaX,CAAI,GAElDgB,GAAe,SAASnB,EAAO,YAAY,CAAC,GAC9CF,EAAS,EACLkB,IACFtB,EAAQ,QAAQS,CAAI,EACbiB,GAKFvB,EAAK,UAAYF,EAAGQ,CAAI,EAAIW,EAAaX,CAAI,IAEtDL,EAAS,EAEFD,EAAK,WAAa,CAACA,EAAK,OAAO,KAAKA,EAAK,IAAI,EAAE,IAAI,EAAID,EAAIO,CAAI,EAAIJ,EAAasB,EAAwBlB,CAAI,EAAImB,EAA4BnB,CAAI,EACzJ,CAGA,OAAIA,IAAS,IAAMoB,GAAkBpB,CAAI,GACvCT,EAAQ,QAAQS,CAAI,EACpBH,GAAU,OAAO,aAAaG,CAAI,EAC3BO,GAEFd,EAAIO,CAAI,CACjB,CAYA,SAASiB,EAAiBjB,EAAM,CAC9B,OAAIA,IAAS,IACXT,EAAQ,QAAQS,CAAI,EAGbN,EAAK,UAAYF,EAAKmB,GAExBlB,EAAIO,CAAI,CACjB,CAYA,SAASkB,EAAwBlB,EAAM,CACrC,OAAIqB,EAAcrB,CAAI,GACpBT,EAAQ,QAAQS,CAAI,EACbkB,GAEFI,EAAYtB,CAAI,CACzB,CAyBA,SAASmB,EAA4BnB,EAAM,CACzC,OAAIA,IAAS,IACXT,EAAQ,QAAQS,CAAI,EACbsB,GAILtB,IAAS,IAAMA,IAAS,IAAMM,GAAWN,CAAI,GAC/CT,EAAQ,QAAQS,CAAI,EACbuB,GAELF,EAAcrB,CAAI,GACpBT,EAAQ,QAAQS,CAAI,EACbmB,GAEFG,EAAYtB,CAAI,CACzB,CAgBA,SAASuB,EAAsBvB,EAAM,CAEnC,OAAIA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IAAMoB,GAAkBpB,CAAI,GACpFT,EAAQ,QAAQS,CAAI,EACbuB,GAEFC,EAA2BxB,CAAI,CACxC,CAeA,SAASwB,EAA2BxB,EAAM,CACxC,OAAIA,IAAS,IACXT,EAAQ,QAAQS,CAAI,EACbyB,GAELJ,EAAcrB,CAAI,GACpBT,EAAQ,QAAQS,CAAI,EACbwB,GAEFL,EAA4BnB,CAAI,CACzC,CAeA,SAASyB,EAA6BzB,EAAM,CAC1C,OAAIA,IAAS,MAAQA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IAAMA,IAAS,GAClEP,EAAIO,CAAI,EAEbA,IAAS,IAAMA,IAAS,IAC1BT,EAAQ,QAAQS,CAAI,EACpBF,EAAUE,EACH0B,GAELL,EAAcrB,CAAI,GACpBT,EAAQ,QAAQS,CAAI,EACbyB,GAEFE,EAA+B3B,CAAI,CAC5C,CAcA,SAAS0B,EAA6B1B,EAAM,CAC1C,OAAIA,IAASF,GACXP,EAAQ,QAAQS,CAAI,EACpBF,EAAU,KACH8B,GAEL5B,IAAS,MAAQ6B,EAAmB7B,CAAI,EACnCP,EAAIO,CAAI,GAEjBT,EAAQ,QAAQS,CAAI,EACb0B,EACT,CAYA,SAASC,EAA+B3B,EAAM,CAC5C,OAAIA,IAAS,MAAQA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IAAMY,EAA0BZ,CAAI,EACnJwB,EAA2BxB,CAAI,GAExCT,EAAQ,QAAQS,CAAI,EACb2B,EACT,CAaA,SAASC,EAAkC5B,EAAM,CAC/C,OAAIA,IAAS,IAAMA,IAAS,IAAMqB,EAAcrB,CAAI,EAC3CmB,EAA4BnB,CAAI,EAElCP,EAAIO,CAAI,CACjB,CAYA,SAASsB,EAAYtB,EAAM,CACzB,OAAIA,IAAS,IACXT,EAAQ,QAAQS,CAAI,EACb8B,IAEFrC,EAAIO,CAAI,CACjB,CAYA,SAAS8B,GAAc9B,EAAM,CAC3B,OAAIA,IAAS,MAAQ6B,EAAmB7B,CAAI,EAGnCW,EAAaX,CAAI,EAEtBqB,EAAcrB,CAAI,GACpBT,EAAQ,QAAQS,CAAI,EACb8B,IAEFrC,EAAIO,CAAI,CACjB,CAYA,SAASW,EAAaX,EAAM,CAC1B,OAAIA,IAAS,IAAML,IAAW,GAC5BJ,EAAQ,QAAQS,CAAI,EACb+B,GAEL/B,IAAS,IAAML,IAAW,GAC5BJ,EAAQ,QAAQS,CAAI,EACbgC,GAELhC,IAAS,IAAML,IAAW,GAC5BJ,EAAQ,QAAQS,CAAI,EACbiC,IAELjC,IAAS,IAAML,IAAW,GAC5BJ,EAAQ,QAAQS,CAAI,EACbK,GAELL,IAAS,IAAML,IAAW,GAC5BJ,EAAQ,QAAQS,CAAI,EACbkC,IAELL,EAAmB7B,CAAI,IAAML,IAAW,GAAKA,IAAW,IAC1DJ,EAAQ,KAAK,cAAc,EACpBA,EAAQ,MAAMN,GAAiBkD,GAAmBC,CAAiB,EAAEpC,CAAI,GAE9EA,IAAS,MAAQ6B,EAAmB7B,CAAI,GAC1CT,EAAQ,KAAK,cAAc,EACpB6C,EAAkBpC,CAAI,IAE/BT,EAAQ,QAAQS,CAAI,EACbW,EACT,CAaA,SAASyB,EAAkBpC,EAAM,CAC/B,OAAOT,EAAQ,MAAMJ,GAA0BkD,EAA0BF,EAAiB,EAAEnC,CAAI,CAClG,CAaA,SAASqC,EAAyBrC,EAAM,CACtC,OAAAT,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQS,CAAI,EACpBT,EAAQ,KAAK,YAAY,EAClB+C,CACT,CAaA,SAASA,EAAmBtC,EAAM,CAChC,OAAIA,IAAS,MAAQ6B,EAAmB7B,CAAI,EACnCoC,EAAkBpC,CAAI,GAE/BT,EAAQ,MAAM,cAAc,EACrBoB,EAAaX,CAAI,EAC1B,CAYA,SAAS+B,EAA0B/B,EAAM,CACvC,OAAIA,IAAS,IACXT,EAAQ,QAAQS,CAAI,EACbK,GAEFM,EAAaX,CAAI,CAC1B,CAYA,SAASgC,EAAuBhC,EAAM,CACpC,OAAIA,IAAS,IACXT,EAAQ,QAAQS,CAAI,EACpBH,EAAS,GACF0C,IAEF5B,EAAaX,CAAI,CAC1B,CAYA,SAASuC,GAAsBvC,EAAM,CACnC,GAAIA,IAAS,GAAI,CACf,IAAMc,GAAOjB,EAAO,YAAY,EAChC,OAAIkB,GAAa,SAASD,EAAI,GAC5BvB,EAAQ,QAAQS,CAAI,EACbiC,IAEFtB,EAAaX,CAAI,CAC1B,CACA,OAAIM,GAAWN,CAAI,GAAKH,EAAO,OAAS,GAEtCN,EAAQ,QAAQS,CAAI,EACpBH,GAAU,OAAO,aAAaG,CAAI,EAC3BuC,IAEF5B,EAAaX,CAAI,CAC1B,CAYA,SAASkC,GAAwBlC,EAAM,CACrC,OAAIA,IAAS,IACXT,EAAQ,QAAQS,CAAI,EACbK,GAEFM,EAAaX,CAAI,CAC1B,CAoBA,SAASK,EAA8BL,EAAM,CAC3C,OAAIA,IAAS,IACXT,EAAQ,QAAQS,CAAI,EACbiC,IAILjC,IAAS,IAAML,IAAW,GAC5BJ,EAAQ,QAAQS,CAAI,EACbK,GAEFM,EAAaX,CAAI,CAC1B,CAYA,SAASiC,GAAkBjC,EAAM,CAC/B,OAAIA,IAAS,MAAQ6B,EAAmB7B,CAAI,GAC1CT,EAAQ,KAAK,cAAc,EACpB4C,GAAkBnC,CAAI,IAE/BT,EAAQ,QAAQS,CAAI,EACbiC,GACT,CAYA,SAASE,GAAkBnC,EAAM,CAC/B,OAAAT,EAAQ,KAAK,UAAU,EAKhBC,EAAGQ,CAAI,CAChB,CACF,CAOA,SAASZ,GAAiCG,EAASC,EAAIC,EAAK,CAC1D,IAAMC,EAAO,KACb,OAAOK,EAaP,SAASA,EAAMC,EAAM,CACnB,OAAI6B,EAAmB7B,CAAI,GACzBT,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQS,CAAI,EACpBT,EAAQ,KAAK,YAAY,EAClBiD,GAEF/C,EAAIO,CAAI,CACjB,CAaA,SAASwC,EAAMxC,EAAM,CACnB,OAAON,EAAK,OAAO,KAAKA,EAAK,IAAI,EAAE,IAAI,EAAID,EAAIO,CAAI,EAAIR,EAAGQ,CAAI,CAChE,CACF,CAOA,SAASd,GAAwBK,EAASC,EAAIC,EAAK,CACjD,OAAOM,EAaP,SAASA,EAAMC,EAAM,CACnB,OAAAT,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQS,CAAI,EACpBT,EAAQ,KAAK,YAAY,EAClBA,EAAQ,QAAQkD,GAAWjD,EAAIC,CAAG,CAC3C,CACF,CC91BO,IAAMiD,GAAW,CACtB,KAAM,WACN,SAAUC,EACZ,EAOA,SAASA,GAAiBC,EAASC,EAAIC,EAAK,CAC1C,IAAMC,EAAO,KAETC,EAEAC,EAEAC,EACJ,OAAOC,EAYP,SAASA,EAAMC,EAAM,CACnB,OAAAR,EAAQ,MAAM,UAAU,EACxBA,EAAQ,MAAM,cAAc,EAC5BA,EAAQ,QAAQQ,CAAI,EACbC,CACT,CAgBA,SAASA,EAAKD,EAAM,CAClB,OAAIA,IAAS,IACXR,EAAQ,QAAQQ,CAAI,EACbE,GAELF,IAAS,IACXR,EAAQ,QAAQQ,CAAI,EACbG,GAELH,IAAS,IACXR,EAAQ,QAAQQ,CAAI,EACbI,GAILC,GAAWL,CAAI,GACjBR,EAAQ,QAAQQ,CAAI,EACbM,GAEFZ,EAAIM,CAAI,CACjB,CAgBA,SAASE,EAAgBF,EAAM,CAC7B,OAAIA,IAAS,IACXR,EAAQ,QAAQQ,CAAI,EACbO,GAELP,IAAS,IACXR,EAAQ,QAAQQ,CAAI,EACpBH,EAAQ,EACDW,GAELH,GAAWL,CAAI,GACjBR,EAAQ,QAAQQ,CAAI,EACbS,GAEFf,EAAIM,CAAI,CACjB,CAYA,SAASO,EAAkBP,EAAM,CAC/B,OAAIA,IAAS,IACXR,EAAQ,QAAQQ,CAAI,EACbU,GAEFhB,EAAIM,CAAI,CACjB,CAYA,SAASW,EAAQX,EAAM,CACrB,OAAIA,IAAS,KACJN,EAAIM,CAAI,EAEbA,IAAS,IACXR,EAAQ,QAAQQ,CAAI,EACbY,GAELC,EAAmBb,CAAI,GACzBF,EAAca,EACPG,EAAiBd,CAAI,IAE9BR,EAAQ,QAAQQ,CAAI,EACbW,EACT,CAYA,SAASC,EAAaZ,EAAM,CAC1B,OAAIA,IAAS,IACXR,EAAQ,QAAQQ,CAAI,EACbU,GAEFC,EAAQX,CAAI,CACrB,CAYA,SAASU,EAAWV,EAAM,CACxB,OAAOA,IAAS,GAAKe,EAAIf,CAAI,EAAIA,IAAS,GAAKY,EAAaZ,CAAI,EAAIW,EAAQX,CAAI,CAClF,CAYA,SAASQ,EAAgBR,EAAM,CAC7B,IAAMgB,GAAQ,SACd,OAAIhB,IAASgB,GAAM,WAAWnB,GAAO,GACnCL,EAAQ,QAAQQ,CAAI,EACbH,IAAUmB,GAAM,OAASC,EAAQT,GAEnCd,EAAIM,CAAI,CACjB,CAYA,SAASiB,EAAMjB,EAAM,CACnB,OAAIA,IAAS,KACJN,EAAIM,CAAI,EAEbA,IAAS,IACXR,EAAQ,QAAQQ,CAAI,EACbkB,GAELL,EAAmBb,CAAI,GACzBF,EAAcmB,EACPH,EAAiBd,CAAI,IAE9BR,EAAQ,QAAQQ,CAAI,EACbiB,EACT,CAYA,SAASC,EAAWlB,EAAM,CACxB,OAAIA,IAAS,IACXR,EAAQ,QAAQQ,CAAI,EACbmB,GAEFF,EAAMjB,CAAI,CACnB,CAYA,SAASmB,EAASnB,EAAM,CACtB,OAAIA,IAAS,GACJe,EAAIf,CAAI,EAEbA,IAAS,IACXR,EAAQ,QAAQQ,CAAI,EACbmB,GAEFF,EAAMjB,CAAI,CACnB,CAYA,SAASS,EAAYT,EAAM,CACzB,OAAIA,IAAS,MAAQA,IAAS,GACrBe,EAAIf,CAAI,EAEba,EAAmBb,CAAI,GACzBF,EAAcW,EACPK,EAAiBd,CAAI,IAE9BR,EAAQ,QAAQQ,CAAI,EACbS,EACT,CAYA,SAASL,EAAYJ,EAAM,CACzB,OAAIA,IAAS,KACJN,EAAIM,CAAI,EAEbA,IAAS,IACXR,EAAQ,QAAQQ,CAAI,EACboB,GAELP,EAAmBb,CAAI,GACzBF,EAAcM,EACPU,EAAiBd,CAAI,IAE9BR,EAAQ,QAAQQ,CAAI,EACbI,EACT,CAYA,SAASgB,EAAiBpB,EAAM,CAC9B,OAAOA,IAAS,GAAKe,EAAIf,CAAI,EAAII,EAAYJ,CAAI,CACnD,CAYA,SAASG,EAAcH,EAAM,CAE3B,OAAIK,GAAWL,CAAI,GACjBR,EAAQ,QAAQQ,CAAI,EACbqB,GAEF3B,EAAIM,CAAI,CACjB,CAYA,SAASqB,EAASrB,EAAM,CAEtB,OAAIA,IAAS,IAAMsB,GAAkBtB,CAAI,GACvCR,EAAQ,QAAQQ,CAAI,EACbqB,GAEFE,EAAgBvB,CAAI,CAC7B,CAYA,SAASuB,EAAgBvB,EAAM,CAC7B,OAAIa,EAAmBb,CAAI,GACzBF,EAAcyB,EACPT,EAAiBd,CAAI,GAE1BwB,EAAcxB,CAAI,GACpBR,EAAQ,QAAQQ,CAAI,EACbuB,GAEFR,EAAIf,CAAI,CACjB,CAYA,SAASM,EAAQN,EAAM,CAErB,OAAIA,IAAS,IAAMsB,GAAkBtB,CAAI,GACvCR,EAAQ,QAAQQ,CAAI,EACbM,GAELN,IAAS,IAAMA,IAAS,IAAMyB,EAA0BzB,CAAI,EACvD0B,EAAe1B,CAAI,EAErBN,EAAIM,CAAI,CACjB,CAYA,SAAS0B,EAAe1B,EAAM,CAC5B,OAAIA,IAAS,IACXR,EAAQ,QAAQQ,CAAI,EACbe,GAILf,IAAS,IAAMA,IAAS,IAAMK,GAAWL,CAAI,GAC/CR,EAAQ,QAAQQ,CAAI,EACb2B,GAELd,EAAmBb,CAAI,GACzBF,EAAc4B,EACPZ,EAAiBd,CAAI,GAE1BwB,EAAcxB,CAAI,GACpBR,EAAQ,QAAQQ,CAAI,EACb0B,GAEFX,EAAIf,CAAI,CACjB,CAYA,SAAS2B,EAAqB3B,EAAM,CAElC,OAAIA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IAAMsB,GAAkBtB,CAAI,GACpFR,EAAQ,QAAQQ,CAAI,EACb2B,GAEFC,GAA0B5B,CAAI,CACvC,CAaA,SAAS4B,GAA0B5B,EAAM,CACvC,OAAIA,IAAS,IACXR,EAAQ,QAAQQ,CAAI,EACb6B,GAELhB,EAAmBb,CAAI,GACzBF,EAAc8B,GACPd,EAAiBd,CAAI,GAE1BwB,EAAcxB,CAAI,GACpBR,EAAQ,QAAQQ,CAAI,EACb4B,IAEFF,EAAe1B,CAAI,CAC5B,CAaA,SAAS6B,EAA4B7B,EAAM,CACzC,OAAIA,IAAS,MAAQA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IAAMA,IAAS,GAClEN,EAAIM,CAAI,EAEbA,IAAS,IAAMA,IAAS,IAC1BR,EAAQ,QAAQQ,CAAI,EACpBJ,EAASI,EACF8B,GAELjB,EAAmBb,CAAI,GACzBF,EAAc+B,EACPf,EAAiBd,CAAI,GAE1BwB,EAAcxB,CAAI,GACpBR,EAAQ,QAAQQ,CAAI,EACb6B,IAETrC,EAAQ,QAAQQ,CAAI,EACb+B,EACT,CAYA,SAASD,EAA4B9B,EAAM,CACzC,OAAIA,IAASJ,GACXJ,EAAQ,QAAQQ,CAAI,EACpBJ,EAAS,OACFoC,GAELhC,IAAS,KACJN,EAAIM,CAAI,EAEba,EAAmBb,CAAI,GACzBF,EAAcgC,EACPhB,EAAiBd,CAAI,IAE9BR,EAAQ,QAAQQ,CAAI,EACb8B,EACT,CAYA,SAASC,EAA8B/B,EAAM,CAC3C,OAAIA,IAAS,MAAQA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IAAMA,IAAS,IAAMA,IAAS,GACjFN,EAAIM,CAAI,EAEbA,IAAS,IAAMA,IAAS,IAAMyB,EAA0BzB,CAAI,EACvD0B,EAAe1B,CAAI,GAE5BR,EAAQ,QAAQQ,CAAI,EACb+B,EACT,CAaA,SAASC,EAAiChC,EAAM,CAC9C,OAAIA,IAAS,IAAMA,IAAS,IAAMyB,EAA0BzB,CAAI,EACvD0B,EAAe1B,CAAI,EAErBN,EAAIM,CAAI,CACjB,CAYA,SAASe,EAAIf,EAAM,CACjB,OAAIA,IAAS,IACXR,EAAQ,QAAQQ,CAAI,EACpBR,EAAQ,KAAK,cAAc,EAC3BA,EAAQ,KAAK,UAAU,EAChBC,GAEFC,EAAIM,CAAI,CACjB,CAgBA,SAASc,EAAiBd,EAAM,CAC9B,OAAAR,EAAQ,KAAK,cAAc,EAC3BA,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQQ,CAAI,EACpBR,EAAQ,KAAK,YAAY,EAClByC,EACT,CAgBA,SAASA,GAAgBjC,EAAM,CAG7B,OAAOwB,EAAcxB,CAAI,EAAIkC,EAAa1C,EAAS2C,GAAuB,aAAcxC,EAAK,OAAO,WAAW,QAAQ,KAAK,SAAS,cAAc,EAAI,OAAY,CAAC,EAAEK,CAAI,EAAImC,GAAsBnC,CAAI,CAC1M,CAgBA,SAASmC,GAAsBnC,EAAM,CACnC,OAAAR,EAAQ,MAAM,cAAc,EACrBM,EAAYE,CAAI,CACzB,CACF,CChpBO,IAAMoC,GAAW,CACtB,KAAM,WACN,WAAYC,GACZ,UAAWC,GACX,SAAUC,EACZ,EAGMC,GAAoB,CACxB,SAAUC,EACZ,EAEMC,GAAyB,CAC7B,SAAUC,EACZ,EAEMC,GAA8B,CAClC,SAAUC,EACZ,EAGA,SAASR,GAAmBS,EAAQ,CAClC,IAAIC,EAAQ,GAENC,EAAY,CAAC,EACnB,KAAO,EAAED,EAAQD,EAAO,QAAQ,CAC9B,IAAMG,EAAQH,EAAOC,CAAK,EAAE,CAAC,EAE7B,GADAC,EAAU,KAAKF,EAAOC,CAAK,CAAC,EACxBE,EAAM,OAAS,cAAgBA,EAAM,OAAS,aAAeA,EAAM,OAAS,WAAY,CAE1F,IAAMC,EAASD,EAAM,OAAS,aAAe,EAAI,EACjDA,EAAM,KAAO,OACbF,GAASG,CACX,CACF,CAGA,OAAIJ,EAAO,SAAWE,EAAU,QAC9BG,GAAOL,EAAQ,EAAGA,EAAO,OAAQE,CAAS,EAErCF,CACT,CAGA,SAASR,GAAkBQ,EAAQM,EAAS,CAC1C,IAAIL,EAAQD,EAAO,OACfI,EAAS,EAETD,EAEAI,EAEAC,EAEAC,EAGJ,KAAOR,KAEL,GADAE,EAAQH,EAAOC,CAAK,EAAE,CAAC,EACnBM,EAAM,CAER,GAAIJ,EAAM,OAAS,QAAUA,EAAM,OAAS,aAAeA,EAAM,UAC/D,MAKEH,EAAOC,CAAK,EAAE,CAAC,IAAM,SAAWE,EAAM,OAAS,cACjDA,EAAM,UAAY,GAEtB,SAAWK,GACT,GAAIR,EAAOC,CAAK,EAAE,CAAC,IAAM,UAAYE,EAAM,OAAS,cAAgBA,EAAM,OAAS,cAAgB,CAACA,EAAM,YACxGI,EAAON,EACHE,EAAM,OAAS,aAAa,CAC9BC,EAAS,EACT,KACF,OAEOD,EAAM,OAAS,aACxBK,EAAQP,GAGZ,IAAMS,EAAQ,CACZ,KAAMV,EAAOO,CAAI,EAAE,CAAC,EAAE,OAAS,YAAc,OAAS,QACtD,MAAO,CACL,GAAGP,EAAOO,CAAI,EAAE,CAAC,EAAE,KACrB,EACA,IAAK,CACH,GAAGP,EAAOA,EAAO,OAAS,CAAC,EAAE,CAAC,EAAE,GAClC,CACF,EACMW,EAAQ,CACZ,KAAM,QACN,MAAO,CACL,GAAGX,EAAOO,CAAI,EAAE,CAAC,EAAE,KACrB,EACA,IAAK,CACH,GAAGP,EAAOQ,CAAK,EAAE,CAAC,EAAE,GACtB,CACF,EACMI,EAAO,CACX,KAAM,YACN,MAAO,CACL,GAAGZ,EAAOO,EAAOH,EAAS,CAAC,EAAE,CAAC,EAAE,GAClC,EACA,IAAK,CACH,GAAGJ,EAAOQ,EAAQ,CAAC,EAAE,CAAC,EAAE,KAC1B,CACF,EACA,OAAAC,EAAQ,CAAC,CAAC,QAASC,EAAOJ,CAAO,EAAG,CAAC,QAASK,EAAOL,CAAO,CAAC,EAG7DG,EAAQI,GAAKJ,EAAOT,EAAO,MAAMO,EAAO,EAAGA,EAAOH,EAAS,CAAC,CAAC,EAG7DK,EAAQI,GAAKJ,EAAO,CAAC,CAAC,QAASG,EAAMN,CAAO,CAAC,CAAC,EAK9CG,EAAQI,GAAKJ,EAAOK,GAAWR,EAAQ,OAAO,WAAW,WAAW,KAAMN,EAAO,MAAMO,EAAOH,EAAS,EAAGI,EAAQ,CAAC,EAAGF,CAAO,CAAC,EAG9HG,EAAQI,GAAKJ,EAAO,CAAC,CAAC,OAAQG,EAAMN,CAAO,EAAGN,EAAOQ,EAAQ,CAAC,EAAGR,EAAOQ,EAAQ,CAAC,EAAG,CAAC,OAAQG,EAAOL,CAAO,CAAC,CAAC,EAG7GG,EAAQI,GAAKJ,EAAOT,EAAO,MAAMQ,EAAQ,CAAC,CAAC,EAG3CC,EAAQI,GAAKJ,EAAO,CAAC,CAAC,OAAQC,EAAOJ,CAAO,CAAC,CAAC,EAC9CD,GAAOL,EAAQO,EAAMP,EAAO,OAAQS,CAAK,EAClCT,CACT,CAOA,SAASP,GAAiBsB,EAASC,EAAIC,EAAK,CAC1C,IAAMC,EAAO,KACTjB,EAAQiB,EAAK,OAAO,OAEpBC,EAEAC,EAGJ,KAAOnB,KACL,IAAKiB,EAAK,OAAOjB,CAAK,EAAE,CAAC,EAAE,OAAS,cAAgBiB,EAAK,OAAOjB,CAAK,EAAE,CAAC,EAAE,OAAS,cAAgB,CAACiB,EAAK,OAAOjB,CAAK,EAAE,CAAC,EAAE,UAAW,CACnIkB,EAAaD,EAAK,OAAOjB,CAAK,EAAE,CAAC,EACjC,KACF,CAEF,OAAOoB,EAiBP,SAASA,EAAMC,EAAM,CAEnB,OAAKH,EAaDA,EAAW,UACNI,EAAYD,CAAI,GAEzBF,EAAUF,EAAK,OAAO,QAAQ,SAASM,GAAoBN,EAAK,eAAe,CAC7E,MAAOC,EAAW,IAClB,IAAKD,EAAK,IAAI,CAChB,CAAC,CAAC,CAAC,EACHH,EAAQ,MAAM,UAAU,EACxBA,EAAQ,MAAM,aAAa,EAC3BA,EAAQ,QAAQO,CAAI,EACpBP,EAAQ,KAAK,aAAa,EAC1BA,EAAQ,KAAK,UAAU,EAChBU,GAxBER,EAAIK,CAAI,CAyBnB,CAkBA,SAASG,EAAMH,EAAM,CAKnB,OAAIA,IAAS,GACJP,EAAQ,QAAQrB,GAAmBgC,EAAYN,EAAUM,EAAaH,CAAW,EAAED,CAAI,EAI5FA,IAAS,GACJP,EAAQ,QAAQnB,GAAwB8B,EAAYN,EAAUO,EAAmBJ,CAAW,EAAED,CAAI,EAIpGF,EAAUM,EAAWJ,CAAI,EAAIC,EAAYD,CAAI,CACtD,CAgBA,SAASK,EAAiBL,EAAM,CAC9B,OAAOP,EAAQ,QAAQjB,GAA6B4B,EAAYH,CAAW,EAAED,CAAI,CACnF,CAkBA,SAASI,EAAWJ,EAAM,CAExB,OAAON,EAAGM,CAAI,CAChB,CAkBA,SAASC,EAAYD,EAAM,CACzB,OAAAH,EAAW,UAAY,GAChBF,EAAIK,CAAI,CACjB,CACF,CAOA,SAAS3B,GAAiBoB,EAASC,EAAIC,EAAK,CAC1C,OAAOW,EAYP,SAASA,EAAcN,EAAM,CAC3B,OAAAP,EAAQ,MAAM,UAAU,EACxBA,EAAQ,MAAM,gBAAgB,EAC9BA,EAAQ,QAAQO,CAAI,EACpBP,EAAQ,KAAK,gBAAgB,EACtBc,CACT,CAYA,SAASA,EAAeP,EAAM,CAC5B,OAAOQ,EAA0BR,CAAI,EAAIS,GAAkBhB,EAASiB,CAAY,EAAEV,CAAI,EAAIU,EAAaV,CAAI,CAC7G,CAYA,SAASU,EAAaV,EAAM,CAC1B,OAAIA,IAAS,GACJW,EAAYX,CAAI,EAElBY,GAAmBnB,EAASoB,EAA0BC,EAA4B,sBAAuB,6BAA8B,mCAAoC,yBAA0B,4BAA6B,EAAE,EAAEd,CAAI,CACnP,CAYA,SAASa,EAAyBb,EAAM,CACtC,OAAOQ,EAA0BR,CAAI,EAAIS,GAAkBhB,EAASsB,CAAe,EAAEf,CAAI,EAAIW,EAAYX,CAAI,CAC/G,CAYA,SAASc,EAA2Bd,EAAM,CACxC,OAAOL,EAAIK,CAAI,CACjB,CAYA,SAASe,EAAgBf,EAAM,CAC7B,OAAIA,IAAS,IAAMA,IAAS,IAAMA,IAAS,GAClCgB,GAAavB,EAASwB,EAAoBtB,EAAK,gBAAiB,sBAAuB,qBAAqB,EAAEK,CAAI,EAEpHW,EAAYX,CAAI,CACzB,CAYA,SAASiB,EAAmBjB,EAAM,CAChC,OAAOQ,EAA0BR,CAAI,EAAIS,GAAkBhB,EAASkB,CAAW,EAAEX,CAAI,EAAIW,EAAYX,CAAI,CAC3G,CAYA,SAASW,EAAYX,EAAM,CACzB,OAAIA,IAAS,IACXP,EAAQ,MAAM,gBAAgB,EAC9BA,EAAQ,QAAQO,CAAI,EACpBP,EAAQ,KAAK,gBAAgB,EAC7BA,EAAQ,KAAK,UAAU,EAChBC,GAEFC,EAAIK,CAAI,CACjB,CACF,CAOA,SAASzB,GAAsBkB,EAASC,EAAIC,EAAK,CAC/C,IAAMC,EAAO,KACb,OAAOsB,EAYP,SAASA,EAAclB,EAAM,CAC3B,OAAOmB,GAAa,KAAKvB,EAAMH,EAAS2B,EAAoBC,EAAsB,YAAa,kBAAmB,iBAAiB,EAAErB,CAAI,CAC3I,CAYA,SAASoB,EAAmBpB,EAAM,CAChC,OAAOJ,EAAK,OAAO,QAAQ,SAASM,GAAoBN,EAAK,eAAeA,EAAK,OAAOA,EAAK,OAAO,OAAS,CAAC,EAAE,CAAC,CAAC,EAAE,MAAM,EAAG,EAAE,CAAC,CAAC,EAAIF,EAAGM,CAAI,EAAIL,EAAIK,CAAI,CAC1J,CAYA,SAASqB,EAAqBrB,EAAM,CAClC,OAAOL,EAAIK,CAAI,CACjB,CACF,CAOA,SAASvB,GAA2BgB,EAASC,EAAIC,EAAK,CACpD,OAAO2B,EAcP,SAASA,EAAwBtB,EAAM,CAGrC,OAAAP,EAAQ,MAAM,WAAW,EACzBA,EAAQ,MAAM,iBAAiB,EAC/BA,EAAQ,QAAQO,CAAI,EACpBP,EAAQ,KAAK,iBAAiB,EACvB8B,CACT,CAcA,SAASA,EAAuBvB,EAAM,CACpC,OAAIA,IAAS,IACXP,EAAQ,MAAM,iBAAiB,EAC/BA,EAAQ,QAAQO,CAAI,EACpBP,EAAQ,KAAK,iBAAiB,EAC9BA,EAAQ,KAAK,WAAW,EACjBC,GAEFC,EAAIK,CAAI,CACjB,CACF,CCniBO,IAAMwB,GAAkB,CAC7B,KAAM,kBACN,WAAYC,GAAS,WACrB,SAAUC,EACZ,EAOA,SAASA,GAAwBC,EAASC,EAAIC,EAAK,CACjD,IAAMC,EAAO,KACb,OAAOC,EAYP,SAASA,EAAMC,EAAM,CACnB,OAAAL,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,MAAM,kBAAkB,EAChCA,EAAQ,QAAQK,CAAI,EACpBL,EAAQ,KAAK,kBAAkB,EACxBM,CACT,CAYA,SAASA,EAAKD,EAAM,CAClB,OAAIA,IAAS,IACXL,EAAQ,MAAM,aAAa,EAC3BA,EAAQ,QAAQK,CAAI,EACpBL,EAAQ,KAAK,aAAa,EAC1BA,EAAQ,KAAK,YAAY,EAClBO,GAEFL,EAAIG,CAAI,CACjB,CA6BA,SAASE,EAAMF,EAAM,CAMnB,OAAOA,IAAS,IAAM,2BAA4BF,EAAK,OAAO,WAAaD,EAAIG,CAAI,EAAIJ,EAAGI,CAAI,CAChG,CACF,CCzFO,IAAMG,GAAiB,CAC5B,KAAM,iBACN,WAAYC,GAAS,WACrB,SAAUC,EACZ,EAOA,SAASA,GAAuBC,EAASC,EAAIC,EAAK,CAChD,IAAMC,EAAO,KACb,OAAOC,EAYP,SAASA,EAAMC,EAAM,CACnB,OAAAL,EAAQ,MAAM,WAAW,EACzBA,EAAQ,MAAM,aAAa,EAC3BA,EAAQ,QAAQK,CAAI,EACpBL,EAAQ,KAAK,aAAa,EAC1BA,EAAQ,KAAK,WAAW,EACjBM,CACT,CAGA,SAASA,EAAMD,EAAM,CAKnB,OAAOA,IAAS,IAAM,2BAA4BF,EAAK,OAAO,WAAaD,EAAIG,CAAI,EAAIJ,EAAGI,CAAI,CAChG,CACF,CC1CO,IAAME,GAAa,CACxB,KAAM,aACN,SAAUC,EACZ,EAOA,SAASA,GAAmBC,EAASC,EAAI,CACvC,OAAOC,EAGP,SAASA,EAAMC,EAAM,CACnB,OAAAH,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQG,CAAI,EACpBH,EAAQ,KAAK,YAAY,EAClBI,EAAaJ,EAASC,EAAI,YAAY,CAC/C,CACF,CCnBO,IAAMI,GAAgB,CAC3B,KAAM,gBACN,SAAUC,EACZ,EAOA,SAASA,GAAsBC,EAASC,EAAIC,EAAK,CAC/C,IAAIC,EAAO,EAEPC,EACJ,OAAOC,EAYP,SAASA,EAAMC,EAAM,CACnB,OAAAN,EAAQ,MAAM,eAAe,EAEtBO,EAAOD,CAAI,CACpB,CAYA,SAASC,EAAOD,EAAM,CACpB,OAAAF,EAASE,EACFE,EAAQF,CAAI,CACrB,CAYA,SAASE,EAAQF,EAAM,CACrB,OAAIA,IAASF,GACXJ,EAAQ,MAAM,uBAAuB,EAC9BS,EAASH,CAAI,GAElBH,GAAQ,IAAMG,IAAS,MAAQI,EAAmBJ,CAAI,IACxDN,EAAQ,KAAK,eAAe,EACrBC,EAAGK,CAAI,GAETJ,EAAII,CAAI,CACjB,CAYA,SAASG,EAASH,EAAM,CACtB,OAAIA,IAASF,GACXJ,EAAQ,QAAQM,CAAI,EACpBH,IACOM,IAETT,EAAQ,KAAK,uBAAuB,EAC7BW,EAAcL,CAAI,EAAIM,EAAaZ,EAASQ,EAAS,YAAY,EAAEF,CAAI,EAAIE,EAAQF,CAAI,EAChG,CACF,CCpFO,IAAMO,GAAO,CAClB,aAAc,CACZ,SAAUC,EACZ,EACA,KAAMC,GACN,KAAM,OACN,SAAUC,EACZ,EAGMC,GAAoC,CACxC,QAAS,GACT,SAAUC,EACZ,EAGMC,GAAkB,CACtB,QAAS,GACT,SAAUC,EACZ,EAUA,SAASJ,GAAkBK,EAASC,EAAIC,EAAK,CAC3C,IAAMC,EAAO,KACPC,EAAOD,EAAK,OAAOA,EAAK,OAAO,OAAS,CAAC,EAC3CE,EAAcD,GAAQA,EAAK,CAAC,EAAE,OAAS,aAAeA,EAAK,CAAC,EAAE,eAAeA,EAAK,CAAC,EAAG,EAAI,EAAE,OAAS,EACrGE,EAAO,EACX,OAAOC,EAGP,SAASA,EAAMC,EAAM,CACnB,IAAMC,EAAON,EAAK,eAAe,OAASK,IAAS,IAAMA,IAAS,IAAMA,IAAS,GAAK,gBAAkB,eACxG,GAAIC,IAAS,gBAAkB,CAACN,EAAK,eAAe,QAAUK,IAASL,EAAK,eAAe,OAASO,GAAWF,CAAI,EAAG,CAOpH,GANKL,EAAK,eAAe,OACvBA,EAAK,eAAe,KAAOM,EAC3BT,EAAQ,MAAMS,EAAM,CAClB,WAAY,EACd,CAAC,GAECA,IAAS,gBACX,OAAAT,EAAQ,MAAM,gBAAgB,EACvBQ,IAAS,IAAMA,IAAS,GAAKR,EAAQ,MAAMW,GAAeT,EAAKU,CAAQ,EAAEJ,CAAI,EAAII,EAASJ,CAAI,EAEvG,GAAI,CAACL,EAAK,WAAaK,IAAS,GAC9B,OAAAR,EAAQ,MAAM,gBAAgB,EAC9BA,EAAQ,MAAM,eAAe,EACtBa,EAAOL,CAAI,CAEtB,CACA,OAAON,EAAIM,CAAI,CACjB,CAGA,SAASK,EAAOL,EAAM,CACpB,OAAIE,GAAWF,CAAI,GAAK,EAAEF,EAAO,IAC/BN,EAAQ,QAAQQ,CAAI,EACbK,IAEJ,CAACV,EAAK,WAAaG,EAAO,KAAOH,EAAK,eAAe,OAASK,IAASL,EAAK,eAAe,OAASK,IAAS,IAAMA,IAAS,KAC/HR,EAAQ,KAAK,eAAe,EACrBY,EAASJ,CAAI,GAEfN,EAAIM,CAAI,CACjB,CAKA,SAASI,EAASJ,EAAM,CACtB,OAAAR,EAAQ,MAAM,gBAAgB,EAC9BA,EAAQ,QAAQQ,CAAI,EACpBR,EAAQ,KAAK,gBAAgB,EAC7BG,EAAK,eAAe,OAASA,EAAK,eAAe,QAAUK,EACpDR,EAAQ,MAAMc,GAErBX,EAAK,UAAYD,EAAMa,EAASf,EAAQ,QAAQJ,GAAmCoB,EAAaC,CAAW,CAAC,CAC9G,CAGA,SAASF,EAAQP,EAAM,CACrB,OAAAL,EAAK,eAAe,iBAAmB,GACvCE,IACOW,EAAYR,CAAI,CACzB,CAGA,SAASS,EAAYT,EAAM,CACzB,OAAIU,EAAcV,CAAI,GACpBR,EAAQ,MAAM,0BAA0B,EACxCA,EAAQ,QAAQQ,CAAI,EACpBR,EAAQ,KAAK,0BAA0B,EAChCgB,GAEFd,EAAIM,CAAI,CACjB,CAGA,SAASQ,EAAYR,EAAM,CACzB,OAAAL,EAAK,eAAe,KAAOE,EAAcF,EAAK,eAAeH,EAAQ,KAAK,gBAAgB,EAAG,EAAI,EAAE,OAC5FC,EAAGO,CAAI,CAChB,CACF,CAOA,SAASf,GAAyBO,EAASC,EAAIC,EAAK,CAClD,IAAMC,EAAO,KACb,OAAAA,EAAK,eAAe,WAAa,OAC1BH,EAAQ,MAAMc,GAAWC,EAASI,CAAQ,EAGjD,SAASJ,EAAQP,EAAM,CACrB,OAAAL,EAAK,eAAe,kBAAoBA,EAAK,eAAe,mBAAqBA,EAAK,eAAe,iBAI9FiB,EAAapB,EAASC,EAAI,iBAAkBE,EAAK,eAAe,KAAO,CAAC,EAAEK,CAAI,CACvF,CAGA,SAASW,EAASX,EAAM,CACtB,OAAIL,EAAK,eAAe,mBAAqB,CAACe,EAAcV,CAAI,GAC9DL,EAAK,eAAe,kBAAoB,OACxCA,EAAK,eAAe,iBAAmB,OAChCkB,EAAiBb,CAAI,IAE9BL,EAAK,eAAe,kBAAoB,OACxCA,EAAK,eAAe,iBAAmB,OAChCH,EAAQ,QAAQF,GAAiBG,EAAIoB,CAAgB,EAAEb,CAAI,EACpE,CAGA,SAASa,EAAiBb,EAAM,CAE9B,OAAAL,EAAK,eAAe,WAAa,GAEjCA,EAAK,UAAY,OAGViB,EAAapB,EAASA,EAAQ,QAAQR,GAAMS,EAAIC,CAAG,EAAG,aAAcC,EAAK,OAAO,WAAW,QAAQ,KAAK,SAAS,cAAc,EAAI,OAAY,CAAC,EAAEK,CAAI,CAC/J,CACF,CAOA,SAAST,GAAeC,EAASC,EAAIC,EAAK,CACxC,IAAMC,EAAO,KACb,OAAOiB,EAAapB,EAASsB,EAAa,iBAAkBnB,EAAK,eAAe,KAAO,CAAC,EAGxF,SAASmB,EAAYd,EAAM,CACzB,IAAMJ,EAAOD,EAAK,OAAOA,EAAK,OAAO,OAAS,CAAC,EAC/C,OAAOC,GAAQA,EAAK,CAAC,EAAE,OAAS,kBAAoBA,EAAK,CAAC,EAAE,eAAeA,EAAK,CAAC,EAAG,EAAI,EAAE,SAAWD,EAAK,eAAe,KAAOF,EAAGO,CAAI,EAAIN,EAAIM,CAAI,CACrJ,CACF,CAOA,SAASd,GAAgBM,EAAS,CAChCA,EAAQ,KAAK,KAAK,eAAe,IAAI,CACvC,CAOA,SAASH,GAAiCG,EAASC,EAAIC,EAAK,CAC1D,IAAMC,EAAO,KAIb,OAAOiB,EAAapB,EAASsB,EAAa,2BAA4BnB,EAAK,OAAO,WAAW,QAAQ,KAAK,SAAS,cAAc,EAAI,OAAY,CAAK,EAGtJ,SAASmB,EAAYd,EAAM,CACzB,IAAMJ,EAAOD,EAAK,OAAOA,EAAK,OAAO,OAAS,CAAC,EAC/C,MAAO,CAACe,EAAcV,CAAI,GAAKJ,GAAQA,EAAK,CAAC,EAAE,OAAS,2BAA6BH,EAAGO,CAAI,EAAIN,EAAIM,CAAI,CAC1G,CACF,CCtMO,IAAMe,GAAkB,CAC7B,KAAM,kBACN,UAAWC,GACX,SAAUC,EACZ,EAGA,SAASD,GAAyBE,EAAQC,EAAS,CAEjD,IAAIC,EAAQF,EAAO,OAEfG,EAEAC,EAEAC,EAIJ,KAAOH,KACL,GAAIF,EAAOE,CAAK,EAAE,CAAC,IAAM,QAAS,CAChC,GAAIF,EAAOE,CAAK,EAAE,CAAC,EAAE,OAAS,UAAW,CACvCC,EAAUD,EACV,KACF,CACIF,EAAOE,CAAK,EAAE,CAAC,EAAE,OAAS,cAC5BE,EAAOF,EAEX,MAGMF,EAAOE,CAAK,EAAE,CAAC,EAAE,OAAS,WAE5BF,EAAO,OAAOE,EAAO,CAAC,EAEpB,CAACG,GAAcL,EAAOE,CAAK,EAAE,CAAC,EAAE,OAAS,eAC3CG,EAAaH,GAInB,IAAMI,EAAU,CACd,KAAM,gBACN,MAAO,CACL,GAAGN,EAAOG,CAAO,EAAE,CAAC,EAAE,KACxB,EACA,IAAK,CACH,GAAGH,EAAOA,EAAO,OAAS,CAAC,EAAE,CAAC,EAAE,GAClC,CACF,EAGA,OAAAA,EAAOI,CAAI,EAAE,CAAC,EAAE,KAAO,oBAInBC,GACFL,EAAO,OAAOI,EAAM,EAAG,CAAC,QAASE,EAASL,CAAO,CAAC,EAClDD,EAAO,OAAOK,EAAa,EAAG,EAAG,CAAC,OAAQL,EAAOG,CAAO,EAAE,CAAC,EAAGF,CAAO,CAAC,EACtED,EAAOG,CAAO,EAAE,CAAC,EAAE,IAAM,CACvB,GAAGH,EAAOK,CAAU,EAAE,CAAC,EAAE,GAC3B,GAEAL,EAAOG,CAAO,EAAE,CAAC,EAAIG,EAIvBN,EAAO,KAAK,CAAC,OAAQM,EAASL,CAAO,CAAC,EAC/BD,CACT,CAOA,SAASD,GAAwBQ,EAASC,EAAIC,EAAK,CACjD,IAAMC,EAAO,KAETC,EACJ,OAAOC,EAaP,SAASA,EAAMC,EAAM,CACnB,IAAIX,EAAQQ,EAAK,OAAO,OAEpBI,EAEJ,KAAOZ,KAGL,GAAIQ,EAAK,OAAOR,CAAK,EAAE,CAAC,EAAE,OAAS,cAAgBQ,EAAK,OAAOR,CAAK,EAAE,CAAC,EAAE,OAAS,cAAgBQ,EAAK,OAAOR,CAAK,EAAE,CAAC,EAAE,OAAS,UAAW,CAC1IY,EAAYJ,EAAK,OAAOR,CAAK,EAAE,CAAC,EAAE,OAAS,YAC3C,KACF,CAKF,MAAI,CAACQ,EAAK,OAAO,KAAKA,EAAK,IAAI,EAAE,IAAI,IAAMA,EAAK,WAAaI,IAC3DP,EAAQ,MAAM,mBAAmB,EACjCI,EAASE,EACFE,EAAOF,CAAI,GAEbJ,EAAII,CAAI,CACjB,CAaA,SAASE,EAAOF,EAAM,CACpB,OAAAN,EAAQ,MAAM,2BAA2B,EAClCS,EAAOH,CAAI,CACpB,CAaA,SAASG,EAAOH,EAAM,CACpB,OAAIA,IAASF,GACXJ,EAAQ,QAAQM,CAAI,EACbG,IAETT,EAAQ,KAAK,2BAA2B,EACjCU,EAAcJ,CAAI,EAAIK,EAAaX,EAASY,EAAO,YAAY,EAAEN,CAAI,EAAIM,EAAMN,CAAI,EAC5F,CAaA,SAASM,EAAMN,EAAM,CACnB,OAAIA,IAAS,MAAQO,EAAmBP,CAAI,GAC1CN,EAAQ,KAAK,mBAAmB,EACzBC,EAAGK,CAAI,GAETJ,EAAII,CAAI,CACjB,CACF,CC3KO,IAAMQ,GAAO,CAClB,SAAUC,EACZ,EAQA,SAASA,GAAeC,EAAS,CAC/B,IAAMC,EAAO,KACPC,EAAUF,EAAQ,QAExBG,GAAWC,EAEXJ,EAAQ,QAAQ,KAAK,OAAO,WAAW,YAAaK,EAAgBC,EAAaN,EAASA,EAAQ,QAAQ,KAAK,OAAO,WAAW,KAAMK,EAAgBL,EAAQ,QAAQO,GAASF,CAAc,CAAC,EAAG,YAAY,CAAC,CAAC,EAChN,OAAOH,EAGP,SAASE,EAAcI,EAAM,CAC3B,GAAIA,IAAS,KAAM,CACjBR,EAAQ,QAAQQ,CAAI,EACpB,MACF,CACA,OAAAR,EAAQ,MAAM,iBAAiB,EAC/BA,EAAQ,QAAQQ,CAAI,EACpBR,EAAQ,KAAK,iBAAiB,EAC9BC,EAAK,iBAAmB,OACjBC,CACT,CAGA,SAASG,EAAeG,EAAM,CAC5B,GAAIA,IAAS,KAAM,CACjBR,EAAQ,QAAQQ,CAAI,EACpB,MACF,CACA,OAAAR,EAAQ,MAAM,YAAY,EAC1BA,EAAQ,QAAQQ,CAAI,EACpBR,EAAQ,KAAK,YAAY,EACzBC,EAAK,iBAAmB,OACjBC,CACT,CACF,CC9CO,IAAMO,GAAW,CACtB,WAAYC,GAAe,CAC7B,EACaC,GAASC,GAAkB,QAAQ,EACnCC,GAAOD,GAAkB,MAAM,EAQ5C,SAASA,GAAkBE,EAAO,CAChC,MAAO,CACL,WAAYJ,GAAeI,IAAU,OAASC,GAAyB,MAAS,EAChF,SAAUC,CACZ,EAOA,SAASA,EAAeC,EAAS,CAC/B,IAAMC,EAAO,KACPC,EAAa,KAAK,OAAO,WAAWL,CAAK,EACzCD,EAAOI,EAAQ,QAAQE,EAAYC,EAAOC,CAAO,EACvD,OAAOD,EAGP,SAASA,EAAME,EAAM,CACnB,OAAOC,EAAQD,CAAI,EAAIT,EAAKS,CAAI,EAAID,EAAQC,CAAI,CAClD,CAGA,SAASD,EAAQC,EAAM,CACrB,GAAIA,IAAS,KAAM,CACjBL,EAAQ,QAAQK,CAAI,EACpB,MACF,CACA,OAAAL,EAAQ,MAAM,MAAM,EACpBA,EAAQ,QAAQK,CAAI,EACbE,CACT,CAGA,SAASA,EAAKF,EAAM,CAClB,OAAIC,EAAQD,CAAI,GACdL,EAAQ,KAAK,MAAM,EACZJ,EAAKS,CAAI,IAIlBL,EAAQ,QAAQK,CAAI,EACbE,EACT,CAQA,SAASD,EAAQD,EAAM,CACrB,GAAIA,IAAS,KACX,MAAO,GAET,IAAMG,EAAON,EAAWG,CAAI,EACxBI,EAAQ,GACZ,GAAID,EAGF,KAAO,EAAEC,EAAQD,EAAK,QAAQ,CAC5B,IAAME,EAAOF,EAAKC,CAAK,EACvB,GAAI,CAACC,EAAK,UAAYA,EAAK,SAAS,KAAKT,EAAMA,EAAK,QAAQ,EAC1D,MAAO,EAEX,CAEF,MAAO,EACT,CACF,CACF,CAQA,SAASR,GAAekB,EAAe,CACrC,OAAOC,EAGP,SAASA,EAAeC,EAAQC,EAAS,CACvC,IAAIL,EAAQ,GAERM,EAIJ,KAAO,EAAEN,GAASI,EAAO,QACnBE,IAAU,OACRF,EAAOJ,CAAK,GAAKI,EAAOJ,CAAK,EAAE,CAAC,EAAE,OAAS,SAC7CM,EAAQN,EACRA,MAEO,CAACI,EAAOJ,CAAK,GAAKI,EAAOJ,CAAK,EAAE,CAAC,EAAE,OAAS,UAEjDA,IAAUM,EAAQ,IACpBF,EAAOE,CAAK,EAAE,CAAC,EAAE,IAAMF,EAAOJ,EAAQ,CAAC,EAAE,CAAC,EAAE,IAC5CI,EAAO,OAAOE,EAAQ,EAAGN,EAAQM,EAAQ,CAAC,EAC1CN,EAAQM,EAAQ,GAElBA,EAAQ,QAGZ,OAAOJ,EAAgBA,EAAcE,EAAQC,CAAO,EAAID,CAC1D,CACF,CAaA,SAASf,GAAuBe,EAAQC,EAAS,CAC/C,IAAIE,EAAa,EAEjB,KAAO,EAAEA,GAAcH,EAAO,QAC5B,IAAKG,IAAeH,EAAO,QAAUA,EAAOG,CAAU,EAAE,CAAC,EAAE,OAAS,eAAiBH,EAAOG,EAAa,CAAC,EAAE,CAAC,EAAE,OAAS,OAAQ,CAC9H,IAAMT,EAAOM,EAAOG,EAAa,CAAC,EAAE,CAAC,EAC/BC,EAASH,EAAQ,YAAYP,CAAI,EACnCE,EAAQQ,EAAO,OACfC,EAAc,GACdC,EAAO,EAEPC,EACJ,KAAOX,KAAS,CACd,IAAMY,EAAQJ,EAAOR,CAAK,EAC1B,GAAI,OAAOY,GAAU,SAAU,CAE7B,IADAH,EAAcG,EAAM,OACbA,EAAM,WAAWH,EAAc,CAAC,IAAM,IAC3CC,IACAD,IAEF,GAAIA,EAAa,MACjBA,EAAc,EAChB,SAESG,IAAU,GACjBD,EAAO,GACPD,YACSE,IAAU,GAEd,CAELZ,IACA,KACF,CACF,CAMA,GAHIK,EAAQ,0BAA4BE,IAAeH,EAAO,SAC5DM,EAAO,GAELA,EAAM,CACR,IAAMG,EAAQ,CACZ,KAAMN,IAAeH,EAAO,QAAUO,GAAQD,EAAO,EAAI,aAAe,oBACxE,MAAO,CACL,aAAcV,EAAQS,EAAcX,EAAK,MAAM,aAAeW,EAC9D,OAAQX,EAAK,MAAM,OAASE,EAC5B,KAAMF,EAAK,IAAI,KACf,OAAQA,EAAK,IAAI,OAASY,EAC1B,OAAQZ,EAAK,IAAI,OAASY,CAC5B,EACA,IAAK,CACH,GAAGZ,EAAK,GACV,CACF,EACAA,EAAK,IAAM,CACT,GAAGe,EAAM,KACX,EACIf,EAAK,MAAM,SAAWA,EAAK,IAAI,OACjC,OAAO,OAAOA,EAAMe,CAAK,GAEzBT,EAAO,OAAOG,EAAY,EAAG,CAAC,QAASM,EAAOR,CAAO,EAAG,CAAC,OAAQQ,EAAOR,CAAO,CAAC,EAChFE,GAAc,EAElB,CACAA,GACF,CAEF,OAAOH,CACT,CCnNA,IAAAU,GAAA,GAAAC,GAAAD,GAAA,sBAAAE,GAAA,mBAAAC,GAAA,YAAAC,GAAA,aAAAC,GAAA,SAAAC,GAAA,gBAAAC,GAAA,eAAAC,GAAA,WAAAC,GAAA,SAAAC,KAQO,IAAMC,GAAW,CACrB,GAAKC,GACL,GAAKA,GACL,GAAKA,GACL,GAAKA,GACL,GAAKA,GACL,GAAKA,GACL,GAAKA,GACL,GAAKA,GACL,GAAKA,GACL,GAAKA,GACL,GAAKA,GACL,GAAKA,GACL,GAAKA,GACL,GAAKC,EACR,EAGaC,GAAiB,CAC3B,GAAKC,EACR,EAGaC,GAAc,CACzB,CAAC,EAAE,EAAGC,GACN,CAAC,EAAE,EAAGA,GACL,GAAKA,EACR,EAGaC,GAAO,CACjB,GAAKC,GACL,GAAKC,GACL,GAAK,CAACC,GAAiBD,EAAa,EACpC,GAAKE,GACL,GAAKD,GACL,GAAKD,GACL,GAAKG,GACL,IAAMA,EACT,EAGaC,GAAS,CACnB,GAAKC,GACL,GAAKC,EACR,EAGaC,GAAO,CAClB,CAAC,EAAE,EAAGC,GACN,CAAC,EAAE,EAAGA,GACN,CAAC,EAAE,EAAGA,GACL,GAAKC,GACL,GAAKJ,GACL,GAAKK,GACL,GAAK,CAACC,GAAUC,EAAQ,EACxB,GAAKC,GACL,GAAK,CAACC,GAAiBR,EAAe,EACtC,GAAKS,GACL,GAAKL,GACL,GAAKM,EACR,EAGaC,GAAa,CACxB,KAAM,CAACP,GAAWQ,EAAW,CAC/B,EAGaC,GAAmB,CAC9B,KAAM,CAAC,GAAI,EAAE,CACf,EAGaC,GAAU,CACrB,KAAM,CAAC,CACT,ECxBO,SAASC,GAAgBC,EAAQC,EAAYC,EAAM,CAExD,IAAIC,EAAQ,CACV,aAAc,GACd,OAAQ,EACR,KAAMD,GAAQA,EAAK,MAAQ,EAC3B,OAAQA,GAAQA,EAAK,QAAU,EAC/B,OAAQA,GAAQA,EAAK,QAAU,CACjC,EAEME,EAAc,CAAC,EAEfC,EAAuB,CAAC,EAE1BC,EAAS,CAAC,EAEVC,EAAQ,CAAC,EAETC,EAAW,GAOTC,EAAU,CACd,QAASC,EAAiBC,CAAqB,EAC/C,MAAOD,EAAiBE,CAAiB,EACzC,QAAAC,EACA,MAAAC,EACA,KAAAC,EACA,UAAWL,EAAiBE,EAAmB,CAC7C,UAAW,EACb,CAAC,CACH,EAOMI,EAAU,CACd,KAAM,KACN,eAAgB,CAAC,EACjB,WAAAC,EACA,OAAQ,CAAC,EACT,IAAAC,EACA,OAAAlB,EACA,SAAU,KACV,eAAAmB,EACA,YAAAC,EACA,MAAAC,CACF,EAOIC,EAAQrB,EAAW,SAAS,KAAKe,EAASP,CAAO,EAOjDc,EACJ,OAAItB,EAAW,YACbI,EAAqB,KAAKJ,CAAU,EAE/Be,EAGP,SAASK,EAAMG,EAAO,CAKpB,OAJAlB,EAASmB,GAAKnB,EAAQkB,CAAK,EAC3BE,EAAK,EAGDpB,EAAOA,EAAO,OAAS,CAAC,IAAM,KACzB,CAAC,GAEVqB,EAAU1B,EAAY,CAAC,EAGvBe,EAAQ,OAASY,GAAWvB,EAAsBW,EAAQ,OAAQA,CAAO,EAClEA,EAAQ,OACjB,CAOA,SAASG,EAAeU,EAAOC,EAAY,CACzC,OAAOC,GAAgBX,EAAYS,CAAK,EAAGC,CAAU,CACvD,CAGA,SAASV,EAAYS,EAAO,CAC1B,OAAOG,GAAY1B,EAAQuB,CAAK,CAClC,CAGA,SAASX,GAAM,CAEb,GAAM,CACJ,aAAAe,EACA,OAAAC,EACA,KAAAC,EACA,OAAAC,EACA,OAAAC,CACF,EAAIlC,EACJ,MAAO,CACL,aAAA8B,EACA,OAAAC,EACA,KAAAC,EACA,OAAAC,EACA,OAAAC,CACF,CACF,CAGA,SAASpB,EAAWqB,EAAO,CACzBlC,EAAYkC,EAAM,IAAI,EAAIA,EAAM,OAChCC,EAAwB,CAC1B,CAiBA,SAASb,GAAO,CAEd,IAAIc,EACJ,KAAOrC,EAAM,OAASG,EAAO,QAAQ,CACnC,IAAMmC,EAAQnC,EAAOH,EAAM,MAAM,EAGjC,GAAI,OAAOsC,GAAU,SAKnB,IAJAD,EAAarC,EAAM,OACfA,EAAM,aAAe,IACvBA,EAAM,aAAe,GAEhBA,EAAM,SAAWqC,GAAcrC,EAAM,aAAesC,EAAM,QAC/DC,EAAGD,EAAM,WAAWtC,EAAM,YAAY,CAAC,OAGzCuC,EAAGD,CAAK,CAEZ,CACF,CAUA,SAASC,EAAGC,EAAM,CAChBnC,EAAW,OACXe,EAAeoB,EACfrB,EAAQA,EAAMqB,CAAI,CACpB,CAGA,SAAS9B,EAAQ8B,EAAM,CACjBC,EAAmBD,CAAI,GACzBxC,EAAM,OACNA,EAAM,OAAS,EACfA,EAAM,QAAUwC,IAAS,GAAK,EAAI,EAClCJ,EAAwB,GACfI,IAAS,KAClBxC,EAAM,SACNA,EAAM,UAIJA,EAAM,aAAe,EACvBA,EAAM,UAENA,EAAM,eAGFA,EAAM,eAIVG,EAAOH,EAAM,MAAM,EAAE,SACnBA,EAAM,aAAe,GACrBA,EAAM,WAKVa,EAAQ,SAAW2B,EAGnBnC,EAAW,EACb,CAGA,SAASM,EAAM+B,EAAMC,EAAQ,CAG3B,IAAMjB,EAAQiB,GAAU,CAAC,EACzB,OAAAjB,EAAM,KAAOgB,EACbhB,EAAM,MAAQX,EAAI,EAClBF,EAAQ,OAAO,KAAK,CAAC,QAASa,EAAOb,CAAO,CAAC,EAC7CT,EAAM,KAAKsB,CAAK,EACTA,CACT,CAGA,SAASd,EAAK8B,EAAM,CAClB,IAAMhB,EAAQtB,EAAM,IAAI,EACxB,OAAAsB,EAAM,IAAMX,EAAI,EAChBF,EAAQ,OAAO,KAAK,CAAC,OAAQa,EAAOb,CAAO,CAAC,EACrCa,CACT,CAOA,SAASlB,EAAsBoC,EAAWC,EAAM,CAC9CrB,EAAUoB,EAAWC,EAAK,IAAI,CAChC,CAOA,SAASpC,EAAkBqC,EAAGD,EAAM,CAClCA,EAAK,QAAQ,CACf,CAUA,SAAStC,EAAiBwC,EAAUJ,EAAQ,CAC1C,OAAOK,EAeP,SAASA,EAAKC,EAAYC,EAAaC,GAAY,CAEjD,IAAIC,GAEAC,EAEAC,GAEAT,GACJ,OAAO,MAAM,QAAQI,CAAU,EAC/BM,GAAuBN,CAAU,EAAI,aAAcA,EAEnDM,GAAuB,CAA0BN,CAAW,CAAC,EAAIO,EAAsBP,CAAU,EAUjG,SAASO,EAAsBC,GAAK,CAClC,OAAOC,GAGP,SAASA,GAAMlB,GAAM,CACnB,IAAMmB,GAAOnB,KAAS,MAAQiB,GAAIjB,EAAI,EAChCoB,GAAMpB,KAAS,MAAQiB,GAAI,KAC3BI,GAAO,CAGb,GAAI,MAAM,QAAQF,EAAI,EAAIA,GAAOA,GAAO,CAACA,EAAI,EAAI,CAAC,EAAI,GAAI,MAAM,QAAQC,EAAG,EAAIA,GAAMA,GAAM,CAACA,EAAG,EAAI,CAAC,CAAE,EACtG,OAAOL,GAAuBM,EAAI,EAAErB,EAAI,CAC1C,CACF,CAUA,SAASe,GAAuBM,GAAM,CAGpC,OAFAT,GAAmBS,GACnBR,EAAiB,EACbQ,GAAK,SAAW,EACXV,GAEFW,GAAgBD,GAAKR,CAAc,CAAC,CAC7C,CAUA,SAASS,GAAgBlB,GAAW,CAClC,OAAOc,GAGP,SAASA,GAAMlB,GAAM,CAanB,OARAK,GAAOkB,GAAM,EACbT,GAAmBV,GACdA,GAAU,UACb/B,EAAQ,iBAAmB+B,IAKzBA,GAAU,MAAQ/B,EAAQ,OAAO,WAAW,QAAQ,KAAK,SAAS+B,GAAU,IAAI,EAC3EoB,GAAIxB,EAAI,EAEVI,GAAU,SAAS,KAI1BD,EAAS,OAAO,OAAO,OAAO,OAAO9B,CAAO,EAAG8B,CAAM,EAAI9B,EAASP,EAAS2D,GAAID,EAAG,EAAExB,EAAI,CAC1F,CACF,CAGA,SAASyB,GAAGzB,GAAM,CAChB,OAAAnC,EAAW,GACX0C,EAASO,GAAkBT,EAAI,EACxBK,CACT,CAGA,SAASc,GAAIxB,GAAM,CAGjB,OAFAnC,EAAW,GACXwC,GAAK,QAAQ,EACT,EAAEQ,EAAiBD,GAAiB,OAC/BU,GAAgBV,GAAiBC,CAAc,CAAC,EAElDF,EACT,CACF,CACF,CAUA,SAAS3B,EAAUoB,EAAW7C,EAAM,CAC9B6C,EAAU,YAAc,CAAC1C,EAAqB,SAAS0C,CAAS,GAClE1C,EAAqB,KAAK0C,CAAS,EAEjCA,EAAU,SACZsB,GAAOrD,EAAQ,OAAQd,EAAMc,EAAQ,OAAO,OAASd,EAAM6C,EAAU,QAAQ/B,EAAQ,OAAO,MAAMd,CAAI,EAAGc,CAAO,CAAC,EAE/G+B,EAAU,YACZ/B,EAAQ,OAAS+B,EAAU,UAAU/B,EAAQ,OAAQA,CAAO,EAEhE,CAQA,SAASkD,IAAQ,CACf,IAAMI,EAAapD,EAAI,EACjBqD,EAAgBvD,EAAQ,SACxBwD,EAAwBxD,EAAQ,iBAChCyD,EAAmBzD,EAAQ,OAAO,OAClC0D,EAAa,MAAM,KAAKnE,CAAK,EACnC,MAAO,CACL,KAAMkE,EACN,QAAAE,EACF,EAQA,SAASA,IAAU,CACjBxE,EAAQmE,EACRtD,EAAQ,SAAWuD,EACnBvD,EAAQ,iBAAmBwD,EAC3BxD,EAAQ,OAAO,OAASyD,EACxBlE,EAAQmE,EACRnC,EAAwB,CAC1B,CACF,CASA,SAASA,GAA0B,CAC7BpC,EAAM,QAAQC,GAAeD,EAAM,OAAS,IAC9CA,EAAM,OAASC,EAAYD,EAAM,IAAI,EACrCA,EAAM,QAAUC,EAAYD,EAAM,IAAI,EAAI,EAE9C,CACF,CAYA,SAAS6B,GAAY1B,EAAQuB,EAAO,CAClC,IAAM+C,EAAa/C,EAAM,MAAM,OACzBgD,EAAmBhD,EAAM,MAAM,aAC/BiD,EAAWjD,EAAM,IAAI,OACrBkD,EAAiBlD,EAAM,IAAI,aAE7BmD,EACJ,GAAIJ,IAAeE,EAEjBE,EAAO,CAAC1E,EAAOsE,CAAU,EAAE,MAAMC,EAAkBE,CAAc,CAAC,MAC7D,CAEL,GADAC,EAAO1E,EAAO,MAAMsE,EAAYE,CAAQ,EACpCD,EAAmB,GAAI,CACzB,IAAMI,EAAOD,EAAK,CAAC,EACf,OAAOC,GAAS,SAClBD,EAAK,CAAC,EAAIC,EAAK,MAAMJ,CAAgB,EAGrCG,EAAK,MAAM,CAEf,CACID,EAAiB,GAEnBC,EAAK,KAAK1E,EAAOwE,CAAQ,EAAE,MAAM,EAAGC,CAAc,CAAC,CAEvD,CACA,OAAOC,CACT,CAYA,SAASjD,GAAgBzB,EAAQwB,EAAY,CAC3C,IAAIoD,EAAQ,GAENC,EAAS,CAAC,EAEZC,EACJ,KAAO,EAAEF,EAAQ5E,EAAO,QAAQ,CAC9B,IAAMmC,EAAQnC,EAAO4E,CAAK,EAEtB5C,EACJ,GAAI,OAAOG,GAAU,SACnBH,EAAQG,MACH,QAAQA,EAAO,CACpB,IAAK,GACH,CACEH,EAAQ,KACR,KACF,CACF,IAAK,GACH,CACEA,EAAQ;AAAA,EACR,KACF,CACF,IAAK,GACH,CACEA,EAAQ;AAAA,EACR,KACF,CACF,IAAK,GACH,CACEA,EAAQR,EAAa,IAAM,IAC3B,KACF,CACF,IAAK,GACH,CACE,GAAI,CAACA,GAAcsD,EAAO,SAC1B9C,EAAQ,IACR,KACF,CACF,QAGIA,EAAQ,OAAO,aAAaG,CAAK,CAEvC,CACA2C,EAAQ3C,IAAU,GAClB0C,EAAO,KAAK7C,CAAK,CACnB,CACA,OAAO6C,EAAO,KAAK,EAAE,CACvB,CC1kBO,SAASE,GAAMC,EAAS,CAM7B,IAAMC,EAAS,CACb,WAJFC,GAAkB,CAACC,GAAmB,IAFrBH,GAAW,CAAC,GAEsB,YAAc,CAAC,CAAE,CAAC,EAKnE,QAASI,EAAOC,EAAO,EACvB,QAAS,CAAC,EACV,SAAUD,EAAOE,EAAQ,EACzB,KAAMF,EAAOG,EAAI,EACjB,KAAM,CAAC,EACP,OAAQH,EAAOI,EAAM,EACrB,KAAMJ,EAAOK,EAAI,CACnB,EACA,OAAOR,EAQP,SAASG,EAAOM,EAAS,CACvB,OAAOC,EAEP,SAASA,EAAQC,EAAM,CACrB,OAAOC,GAAgBZ,EAAQS,EAASE,CAAI,CAC9C,CACF,CACF,CC3CO,SAASE,GAAYC,EAAQ,CAClC,KAAO,CAACC,GAAYD,CAAM,GAAG,CAG7B,OAAOA,CACT,CCAA,IAAME,GAAS,cAMR,SAASC,IAAa,CAC3B,IAAIC,EAAS,EACTC,EAAS,GAETC,EAAQ,GAERC,EACJ,OAAOC,EAIP,SAASA,EAAaC,EAAOC,EAAUC,EAAK,CAE1C,IAAMC,EAAS,CAAC,EAEZC,EAEAC,EAEAC,EAEAC,EAEAC,EAWJ,IAVAR,EAAQJ,GAAU,OAAOI,GAAU,SAAWA,EAAM,SAAS,EAAI,IAAI,YAAYC,GAAY,MAAS,EAAE,OAAOD,CAAK,GACpHM,EAAgB,EAChBV,EAAS,GACLC,IAEEG,EAAM,WAAW,CAAC,IAAM,OAC1BM,IAEFT,EAAQ,QAEHS,EAAgBN,EAAM,QAAQ,CAKnC,GAJAP,GAAO,UAAYa,EACnBF,EAAQX,GAAO,KAAKO,CAAK,EACzBO,EAAcH,GAASA,EAAM,QAAU,OAAYA,EAAM,MAAQJ,EAAM,OACvEQ,EAAOR,EAAM,WAAWO,CAAW,EAC/B,CAACH,EAAO,CACVR,EAASI,EAAM,MAAMM,CAAa,EAClC,KACF,CACA,GAAIE,IAAS,IAAMF,IAAkBC,GAAeT,EAClDK,EAAO,KAAK,EAAE,EACdL,EAAmB,WAUnB,QARIA,IACFK,EAAO,KAAK,EAAE,EACdL,EAAmB,QAEjBQ,EAAgBC,IAClBJ,EAAO,KAAKH,EAAM,MAAMM,EAAeC,CAAW,CAAC,EACnDZ,GAAUY,EAAcD,GAElBE,EAAM,CACZ,IAAK,GACH,CACEL,EAAO,KAAK,KAAK,EACjBR,IACA,KACF,CACF,IAAK,GACH,CAGE,IAFAU,EAAO,KAAK,KAAKV,EAAS,CAAC,EAAI,EAC/BQ,EAAO,KAAK,EAAE,EACPR,IAAWU,GAAMF,EAAO,KAAK,EAAE,EACtC,KACF,CACF,IAAK,IACH,CACEA,EAAO,KAAK,EAAE,EACdR,EAAS,EACT,KACF,CACF,QAEIG,EAAmB,GACnBH,EAAS,CAEf,CAEFW,EAAgBC,EAAc,CAChC,CACA,OAAIL,IACEJ,GAAkBK,EAAO,KAAK,EAAE,EAChCP,GAAQO,EAAO,KAAKP,CAAM,EAC9BO,EAAO,KAAK,IAAI,GAEXA,CACT,CACF,CChHA,IAAMM,GAA6B,oEAc5B,SAASC,GAAaC,EAAO,CAClC,OAAOA,EAAM,QAAQF,GAA4BG,EAAM,CACzD,CAYA,SAASA,GAAOC,EAAIC,EAAIC,EAAI,CAC1B,GAAID,EAEF,OAAOA,EAKT,GADaC,EAAG,WAAW,CAAC,IACf,GAAI,CACf,IAAMC,EAAOD,EAAG,WAAW,CAAC,EACtBE,EAAMD,IAAS,KAAOA,IAAS,GACrC,OAAOE,GAAgCH,EAAG,MAAME,EAAM,EAAI,CAAC,EAAGA,EAAM,GAAK,EAAE,CAC7E,CACA,OAAOE,GAA8BJ,CAAE,GAAKF,CAC9C,CCRO,SAASO,GAAkBC,EAAO,CAEvC,MAAI,CAACA,GAAS,OAAOA,GAAU,SACtB,GAIL,aAAcA,GAAS,SAAUA,EAC5BC,GAASD,EAAM,QAAQ,EAI5B,UAAWA,GAAS,QAASA,EACxBC,GAASD,CAAK,EAInB,SAAUA,GAAS,WAAYA,EAC1BE,GAAMF,CAAK,EAIb,EACT,CAMA,SAASE,GAAMA,EAAO,CACpB,OAAOC,GAAMD,GAASA,EAAM,IAAI,EAAI,IAAMC,GAAMD,GAASA,EAAM,MAAM,CACvE,CAMA,SAASD,GAASG,EAAK,CACrB,OAAOF,GAAME,GAAOA,EAAI,KAAK,EAAI,IAAMF,GAAME,GAAOA,EAAI,GAAG,CAC7D,CAMA,SAASD,GAAMH,EAAO,CACpB,OAAOA,GAAS,OAAOA,GAAU,SAAWA,EAAQ,CACtD,CCnCA,IAAMK,GAAM,CAAC,EAAE,eAyBR,SAASC,GAAaC,EAAOC,EAAUC,EAAS,CACrD,OAAI,OAAOD,GAAa,WACtBC,EAAUD,EACVA,EAAW,QAENE,GAASD,CAAO,EAAEE,GAAYC,GAAMH,CAAO,EAAE,SAAS,EAAE,MAAMI,GAAW,EAAEN,EAAOC,EAAU,EAAI,CAAC,CAAC,CAAC,CAC5G,CAOA,SAASE,GAASD,EAAS,CAEzB,IAAMK,EAAS,CACb,WAAY,CAAC,EACb,eAAgB,CAAC,WAAY,WAAY,UAAW,YAAa,QAAQ,EACzE,MAAO,CACL,SAAUC,EAAOC,EAAI,EACrB,iBAAkBC,EAClB,cAAeA,EACf,WAAYF,EAAOG,EAAO,EAC1B,WAAYH,EAAOI,EAAU,EAC7B,gBAAiBF,EACjB,mBAAoBA,EACpB,WAAYF,EAAOK,EAAQ,EAC3B,oBAAqBC,EACrB,oBAAqBA,EACrB,aAAcN,EAAOK,GAAUC,CAAM,EACrC,SAAUN,EAAOO,GAAUD,CAAM,EACjC,aAAcJ,EACd,KAAMA,EACN,cAAeA,EACf,WAAYF,EAAOQ,EAAU,EAC7B,4BAA6BF,EAC7B,sBAAuBA,EACvB,sBAAuBA,EACvB,SAAUN,EAAOS,EAAQ,EACzB,gBAAiBT,EAAOU,EAAS,EACjC,kBAAmBV,EAAOU,EAAS,EACnC,SAAUV,EAAOW,GAAML,CAAM,EAC7B,aAAcJ,EACd,SAAUF,EAAOW,GAAML,CAAM,EAC7B,aAAcJ,EACd,MAAOF,EAAOY,EAAK,EACnB,MAAON,EACP,KAAMN,EAAOC,EAAI,EACjB,SAAUD,EAAOa,EAAQ,EACzB,cAAeC,EACf,YAAad,EAAOe,GAAMC,CAAkB,EAC5C,cAAehB,EAAOe,EAAI,EAC1B,UAAWf,EAAOiB,EAAS,EAC3B,UAAWC,EACX,gBAAiBZ,EACjB,0BAA2BA,EAC3B,oBAAqBA,EACrB,cAAeN,EAAOG,EAAO,EAC7B,OAAQH,EAAOmB,EAAM,EACrB,cAAenB,EAAOoB,EAAa,CACrC,EACA,KAAM,CACJ,WAAYC,EAAO,EACnB,mBAAoBC,EACpB,SAAUD,EAAO,EACjB,cAAeE,GACf,iBAAkBC,GAClB,WAAYH,EAAO,EACnB,qBAAsBI,EACtB,oCAAqCC,GACrC,gCAAiCA,GACjC,wBAAyBC,GACzB,mBAAoBC,GACpB,WAAYP,EAAOQ,CAAgB,EACnC,gBAAiBC,EACjB,oBAAqBC,EACrB,oBAAqBC,EACrB,cAAeP,EACf,aAAcJ,EAAOY,CAAkB,EACvC,SAAUZ,EAAOa,CAAc,EAC/B,aAAcT,EACd,KAAMA,EACN,WAAYJ,EAAO,EACnB,4BAA6Bc,EAC7B,sBAAuBC,EACvB,sBAAuBC,EACvB,SAAUhB,EAAO,EACjB,gBAAiBA,EAAOiB,CAAe,EACvC,kBAAmBjB,EAAOiB,CAAe,EACzC,SAAUjB,EAAOkB,CAAc,EAC/B,aAAcd,EACd,SAAUJ,EAAOmB,CAAc,EAC/B,aAAcf,EACd,MAAOJ,EAAOoB,CAAW,EACzB,MAAOC,GACP,UAAWC,GACX,WAAYC,GACZ,KAAMvB,EAAOwB,CAAU,EACvB,SAAUxB,EAAO,EACjB,YAAaA,EAAO,EACpB,cAAeA,EAAO,EACtB,UAAWA,EAAO,EAClB,gBAAiByB,GACjB,0BAA2BC,EAC3B,oBAAqBC,GACrB,SAAUC,GACV,cAAe5B,EAAO6B,CAAmB,EACzC,0BAA2BC,EAC3B,kBAAmBC,EACnB,OAAQ/B,EAAO,EACf,cAAeA,EAAO,CACxB,CACF,EACAgC,GAAUtD,GAASL,GAAW,CAAC,GAAG,iBAAmB,CAAC,CAAC,EAGvD,IAAM4D,EAAO,CAAC,EACd,OAAOC,EAUP,SAASA,EAAQC,EAAQ,CAEvB,IAAIC,EAAO,CACT,KAAM,OACN,SAAU,CAAC,CACb,EAEMC,EAAU,CACd,MAAO,CAACD,CAAI,EACZ,WAAY,CAAC,EACb,OAAA1D,EACA,MAAA4D,EACA,KAAAC,EACA,OAAAtD,EACA,OAAAuD,EACA,KAAAP,CACF,EAEMQ,EAAY,CAAC,EACfC,EAAQ,GACZ,KAAO,EAAEA,EAAQP,EAAO,QAGtB,GAAIA,EAAOO,CAAK,EAAE,CAAC,EAAE,OAAS,eAAiBP,EAAOO,CAAK,EAAE,CAAC,EAAE,OAAS,gBACvE,GAAIP,EAAOO,CAAK,EAAE,CAAC,IAAM,QACvBD,EAAU,KAAKC,CAAK,MACf,CACL,IAAMC,GAAOF,EAAU,IAAI,EAC3BC,EAAQE,EAAYT,EAAQQ,GAAMD,CAAK,CACzC,CAIJ,IADAA,EAAQ,GACD,EAAEA,EAAQP,EAAO,QAAQ,CAC9B,IAAMU,GAAUnE,EAAOyD,EAAOO,CAAK,EAAE,CAAC,CAAC,EACnCzE,GAAI,KAAK4E,GAASV,EAAOO,CAAK,EAAE,CAAC,EAAE,IAAI,GACzCG,GAAQV,EAAOO,CAAK,EAAE,CAAC,EAAE,IAAI,EAAE,KAAK,OAAO,OAAO,CAChD,eAAgBP,EAAOO,CAAK,EAAE,CAAC,EAAE,cACnC,EAAGL,CAAO,EAAGF,EAAOO,CAAK,EAAE,CAAC,CAAC,CAEjC,CAGA,GAAIL,EAAQ,WAAW,OAAS,EAAG,CACjC,IAAMM,GAAON,EAAQ,WAAWA,EAAQ,WAAW,OAAS,CAAC,GAC7CM,GAAK,CAAC,GAAKG,IACnB,KAAKT,EAAS,OAAWM,GAAK,CAAC,CAAC,CAC1C,CAkBA,IAfAP,EAAK,SAAW,CACd,MAAOW,GAAMZ,EAAO,OAAS,EAAIA,EAAO,CAAC,EAAE,CAAC,EAAE,MAAQ,CACpD,KAAM,EACN,OAAQ,EACR,OAAQ,CACV,CAAC,EACD,IAAKY,GAAMZ,EAAO,OAAS,EAAIA,EAAOA,EAAO,OAAS,CAAC,EAAE,CAAC,EAAE,IAAM,CAChE,KAAM,EACN,OAAQ,EACR,OAAQ,CACV,CAAC,CACH,EAGAO,EAAQ,GACD,EAAEA,EAAQhE,EAAO,WAAW,QACjC0D,EAAO1D,EAAO,WAAWgE,CAAK,EAAEN,CAAI,GAAKA,EAE3C,OAAOA,CACT,CAQA,SAASQ,EAAYT,EAAQa,EAAOC,EAAQ,CAC1C,IAAIP,EAAQM,EAAQ,EAChBE,EAAmB,GACnBC,GAAa,GAEb3D,GAEA4D,GAEAC,GAEAC,GACJ,KAAO,EAAEZ,GAASO,GAAQ,CACxB,IAAMM,GAAQpB,EAAOO,CAAK,EAC1B,OAAQa,GAAM,CAAC,EAAE,KAAM,CACrB,IAAK,gBACL,IAAK,cACL,IAAK,aACH,CACMA,GAAM,CAAC,IAAM,QACfL,IAEAA,IAEFI,GAAW,OACX,KACF,CACF,IAAK,kBACH,CACMC,GAAM,CAAC,IAAM,UACX/D,IAAY,CAAC8D,IAAY,CAACJ,GAAoB,CAACG,KACjDA,GAAsBX,GAExBY,GAAW,QAEb,KACF,CACF,IAAK,aACL,IAAK,gBACL,IAAK,iBACL,IAAK,iBACL,IAAK,2BAID,MAEJ,QAEIA,GAAW,MAEjB,CACA,GAAI,CAACJ,GAAoBK,GAAM,CAAC,IAAM,SAAWA,GAAM,CAAC,EAAE,OAAS,kBAAoBL,IAAqB,IAAMK,GAAM,CAAC,IAAM,SAAWA,GAAM,CAAC,EAAE,OAAS,iBAAmBA,GAAM,CAAC,EAAE,OAAS,eAAgB,CAC/M,GAAI/D,GAAU,CACZ,IAAIgE,GAAYd,EAEhB,IADAU,GAAY,OACLI,MAAa,CAClB,IAAMC,GAAYtB,EAAOqB,EAAS,EAClC,GAAIC,GAAU,CAAC,EAAE,OAAS,cAAgBA,GAAU,CAAC,EAAE,OAAS,kBAAmB,CACjF,GAAIA,GAAU,CAAC,IAAM,OAAQ,SACzBL,KACFjB,EAAOiB,EAAS,EAAE,CAAC,EAAE,KAAO,kBAC5BD,GAAa,IAEfM,GAAU,CAAC,EAAE,KAAO,aACpBL,GAAYI,EACd,SAAW,EAAAC,GAAU,CAAC,EAAE,OAAS,cAAgBA,GAAU,CAAC,EAAE,OAAS,oBAAsBA,GAAU,CAAC,EAAE,OAAS,8BAAgCA,GAAU,CAAC,EAAE,OAAS,oBAAsBA,GAAU,CAAC,EAAE,OAAS,kBAGnN,KAEJ,CACIJ,KAAwB,CAACD,IAAaC,GAAsBD,MAC9D5D,GAAS,QAAU,IAIrBA,GAAS,IAAM,OAAO,OAAO,CAAC,EAAG4D,GAAYjB,EAAOiB,EAAS,EAAE,CAAC,EAAE,MAAQG,GAAM,CAAC,EAAE,GAAG,EACtFpB,EAAO,OAAOiB,IAAaV,EAAO,EAAG,CAAC,OAAQlD,GAAU+D,GAAM,CAAC,CAAC,CAAC,EACjEb,IACAO,GACF,CAGA,GAAIM,GAAM,CAAC,EAAE,OAAS,iBAAkB,CAEtC,IAAMG,GAAO,CACX,KAAM,WACN,QAAS,GACT,MAAO,OAAO,OAAO,CAAC,EAAGH,GAAM,CAAC,EAAE,KAAK,EAEvC,IAAK,MACP,EACA/D,GAAWkE,GACXvB,EAAO,OAAOO,EAAO,EAAG,CAAC,QAASgB,GAAMH,GAAM,CAAC,CAAC,CAAC,EACjDb,IACAO,IACAI,GAAsB,OACtBC,GAAW,EACb,CACF,CACF,CACA,OAAAnB,EAAOa,CAAK,EAAE,CAAC,EAAE,QAAUG,GACpBF,CACT,CAYA,SAAStE,EAAOgF,EAAQC,EAAK,CAC3B,OAAOC,EAOP,SAASA,EAAKC,EAAO,CACnBxB,EAAM,KAAK,KAAMqB,EAAOG,CAAK,EAAGA,CAAK,EACjCF,GAAKA,EAAI,KAAK,KAAME,CAAK,CAC/B,CACF,CAKA,SAAS7E,GAAS,CAChB,KAAK,MAAM,KAAK,CACd,KAAM,WACN,SAAU,CAAC,CACb,CAAC,CACH,CAKA,SAASqD,EAAMyB,EAAMD,EAAOE,EAAc,CACzB,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAEvB,SACf,KAAKD,CAAI,EAClB,KAAK,MAAM,KAAKA,CAAI,EACpB,KAAK,WAAW,KAAK,CAACD,EAAOE,GAAgB,MAAS,CAAC,EACvDD,EAAK,SAAW,CACd,MAAOhB,GAAMe,EAAM,KAAK,EAExB,IAAK,MACP,CACF,CAUA,SAAS9D,EAAO4D,EAAK,CACnB,OAAOK,EAOP,SAASA,EAAMH,EAAO,CAChBF,GAAKA,EAAI,KAAK,KAAME,CAAK,EAC7BvB,EAAK,KAAK,KAAMuB,CAAK,CACvB,CACF,CAKA,SAASvB,EAAKuB,EAAOI,EAAa,CAChC,IAAMH,EAAO,KAAK,MAAM,IAAI,EACtBF,EAAO,KAAK,WAAW,IAAI,EACjC,GAAKA,EAKMA,EAAK,CAAC,EAAE,OAASC,EAAM,OAC5BI,EACFA,EAAY,KAAK,KAAMJ,EAAOD,EAAK,CAAC,CAAC,GAErBA,EAAK,CAAC,GAAKf,IACnB,KAAK,KAAMgB,EAAOD,EAAK,CAAC,CAAC,OATnC,OAAM,IAAI,MAAM,iBAAmBC,EAAM,KAAO,MAAQK,GAAkB,CACxE,MAAOL,EAAM,MACb,IAAKA,EAAM,GACb,CAAC,EAAI,uBAAkB,EASzBC,EAAK,SAAS,IAAMhB,GAAMe,EAAM,GAAG,CACrC,CAKA,SAAStB,GAAS,CAChB,OAAO4B,GAAS,KAAK,MAAM,IAAI,CAAC,CAClC,CAUA,SAASzE,GAAqB,CAC5B,KAAK,KAAK,4BAA8B,EAC1C,CAMA,SAASF,EAAqBqE,EAAO,CACnC,GAAI,KAAK,KAAK,4BAA6B,CACzC,IAAMO,EAAW,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EACjDA,EAAS,MAAQ,OAAO,SAAS,KAAK,eAAeP,CAAK,EAAG,EAAE,EAC/D,KAAK,KAAK,4BAA8B,MAC1C,CACF,CAMA,SAASpD,GAA4B,CACnC,IAAMuB,EAAO,KAAK,OAAO,EACnB8B,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,KAAO9B,CACd,CAMA,SAAStB,GAA4B,CACnC,IAAMsB,EAAO,KAAK,OAAO,EACnB8B,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,KAAO9B,CACd,CAMA,SAASxB,GAAwB,CAE3B,KAAK,KAAK,iBACd,KAAK,OAAO,EACZ,KAAK,KAAK,eAAiB,GAC7B,CAMA,SAASD,GAAmB,CAC1B,IAAMyB,EAAO,KAAK,OAAO,EACnB8B,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,MAAQ9B,EAAK,QAAQ,2BAA4B,EAAE,EACxD,KAAK,KAAK,eAAiB,MAC7B,CAMA,SAASrB,GAAqB,CAC5B,IAAMqB,EAAO,KAAK,OAAO,EACnB8B,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,MAAQ9B,EAAK,QAAQ,eAAgB,EAAE,CAC9C,CAMA,SAASlB,EAA4B+C,EAAO,CAC1C,IAAMQ,EAAQ,KAAK,OAAO,EACpBP,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,MAAQO,EACbP,EAAK,WAAaQ,GAAoB,KAAK,eAAeT,CAAK,CAAC,EAAE,YAAY,CAChF,CAMA,SAAS9C,GAA8B,CACrC,IAAMiB,EAAO,KAAK,OAAO,EACnB8B,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,MAAQ9B,CACf,CAMA,SAASnB,GAAoC,CAC3C,IAAMmB,EAAO,KAAK,OAAO,EACnB8B,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,IAAM9B,CACb,CAMA,SAAShC,EAAyB6D,EAAO,CACvC,IAAMC,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7C,GAAI,CAACA,EAAK,MAAO,CACf,IAAMS,EAAQ,KAAK,eAAeV,CAAK,EAAE,OACzCC,EAAK,MAAQS,CACf,CACF,CAMA,SAASzC,GAA0B,CACjC,KAAK,KAAK,6BAA+B,EAC3C,CAMA,SAASD,EAAgCgC,EAAO,CAC9C,IAAMC,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,MAAQ,KAAK,eAAeD,CAAK,EAAE,YAAY,CAAC,IAAM,GAAK,EAAI,CACtE,CAMA,SAASjC,GAAsB,CAC7B,KAAK,KAAK,6BAA+B,MAC3C,CAOA,SAAShD,EAAYiF,EAAO,CAG1B,IAAMW,EAFO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAEvB,SAClB9B,EAAO8B,EAASA,EAAS,OAAS,CAAC,GACnC,CAAC9B,GAAQA,EAAK,OAAS,UAEzBA,EAAO+B,GAAK,EACZ/B,EAAK,SAAW,CACd,MAAOI,GAAMe,EAAM,KAAK,EAExB,IAAK,MACP,EACAW,EAAS,KAAK9B,CAAI,GAEpB,KAAK,MAAM,KAAKA,CAAI,CACtB,CAOA,SAASvC,EAAW0D,EAAO,CACzB,IAAMnB,EAAO,KAAK,MAAM,IAAI,EAC5BA,EAAK,OAAS,KAAK,eAAemB,CAAK,EACvCnB,EAAK,SAAS,IAAMI,GAAMe,EAAM,GAAG,CACrC,CAOA,SAASvC,GAAiBuC,EAAO,CAC/B,IAAMzB,EAAU,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAEhD,GAAI,KAAK,KAAK,YAAa,CACzB,IAAMM,EAAON,EAAQ,SAASA,EAAQ,SAAS,OAAS,CAAC,EACzDM,EAAK,SAAS,IAAMI,GAAMe,EAAM,GAAG,EACnC,KAAK,KAAK,YAAc,OACxB,MACF,CACI,CAAC,KAAK,KAAK,8BAAgCpF,EAAO,eAAe,SAAS2D,EAAQ,IAAI,IACxFxD,EAAY,KAAK,KAAMiF,CAAK,EAC5B1D,EAAW,KAAK,KAAM0D,CAAK,EAE/B,CAOA,SAAS7C,GAAkB,CACzB,KAAK,KAAK,YAAc,EAC1B,CAOA,SAASC,GAAiB,CACxB,IAAMe,EAAO,KAAK,OAAO,EACnB8B,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,MAAQ9B,CACf,CAOA,SAASd,GAAiB,CACxB,IAAMc,EAAO,KAAK,OAAO,EACnB8B,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,MAAQ9B,CACf,CAOA,SAASpB,GAAiB,CACxB,IAAMoB,EAAO,KAAK,OAAO,EACnB8B,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,MAAQ9B,CACf,CAOA,SAAST,GAAa,CACpB,IAAMuC,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAK7C,GAAI,KAAK,KAAK,YAAa,CAEzB,IAAMY,EAAgB,KAAK,KAAK,eAAiB,WACjDZ,EAAK,MAAQ,YAEbA,EAAK,cAAgBY,EAErB,OAAOZ,EAAK,IACZ,OAAOA,EAAK,KACd,MAEE,OAAOA,EAAK,WAEZ,OAAOA,EAAK,MAEd,KAAK,KAAK,cAAgB,MAC5B,CAOA,SAAS3C,GAAc,CACrB,IAAM2C,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAK7C,GAAI,KAAK,KAAK,YAAa,CAEzB,IAAMY,EAAgB,KAAK,KAAK,eAAiB,WACjDZ,EAAK,MAAQ,YAEbA,EAAK,cAAgBY,EAErB,OAAOZ,EAAK,IACZ,OAAOA,EAAK,KACd,MAEE,OAAOA,EAAK,WAEZ,OAAOA,EAAK,MAEd,KAAK,KAAK,cAAgB,MAC5B,CAOA,SAASzC,GAAgBwC,EAAO,CAC9B,IAAMc,EAAS,KAAK,eAAed,CAAK,EAClCO,EAAW,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAGjDA,EAAS,MAAQQ,GAAaD,CAAM,EAEpCP,EAAS,WAAaE,GAAoBK,CAAM,EAAE,YAAY,CAChE,CAOA,SAASvD,IAAc,CACrB,IAAMyD,EAAW,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC3C3G,EAAQ,KAAK,OAAO,EACpB4F,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAG7C,GADA,KAAK,KAAK,YAAc,GACpBA,EAAK,OAAS,OAAQ,CAExB,IAAMgB,EAAWD,EAAS,SAC1Bf,EAAK,SAAWgB,CAClB,MACEhB,EAAK,IAAM5F,CAEf,CAOA,SAASuD,GAAkC,CACzC,IAAMO,EAAO,KAAK,OAAO,EACnB8B,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,IAAM9B,CACb,CAOA,SAASN,IAA4B,CACnC,IAAMM,EAAO,KAAK,OAAO,EACnB8B,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,MAAQ9B,CACf,CAOA,SAASL,IAAiB,CACxB,KAAK,KAAK,YAAc,MAC1B,CAOA,SAAS/B,GAAmB,CAC1B,KAAK,KAAK,cAAgB,WAC5B,CAOA,SAAS4B,GAAsBqC,EAAO,CACpC,IAAMQ,EAAQ,KAAK,OAAO,EACpBP,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAG7CA,EAAK,MAAQO,EAEbP,EAAK,WAAaQ,GAAoB,KAAK,eAAeT,CAAK,CAAC,EAAE,YAAY,EAC9E,KAAK,KAAK,cAAgB,MAC5B,CAOA,SAASzD,GAA+ByD,EAAO,CAC7C,KAAK,KAAK,uBAAyBA,EAAM,IAC3C,CAMA,SAASxD,GAA8BwD,EAAO,CAC5C,IAAM7B,EAAO,KAAK,eAAe6B,CAAK,EAChCkB,EAAO,KAAK,KAAK,uBAEnB7G,EACA6G,GACF7G,EAAQ8G,GAAgChD,EAAM+C,IAAS,kCAAoC,GAAK,EAAE,EAClG,KAAK,KAAK,uBAAyB,QAGnC7G,EADe+G,GAA8BjD,CAAI,EAGnD,IAAMU,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,OAASxE,CAChB,CAMA,SAASoC,GAAyBuD,EAAO,CACvC,IAAMnB,EAAO,KAAK,MAAM,IAAI,EAC5BA,EAAK,SAAS,IAAMI,GAAMe,EAAM,GAAG,CACrC,CAMA,SAAS3D,GAAuB2D,EAAO,CACrC1D,EAAW,KAAK,KAAM0D,CAAK,EAC3B,IAAMC,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,IAAM,KAAK,eAAeD,CAAK,CACtC,CAMA,SAAS5D,GAAoB4D,EAAO,CAClC1D,EAAW,KAAK,KAAM0D,CAAK,EAC3B,IAAMC,EAAO,KAAK,MAAM,KAAK,MAAM,OAAS,CAAC,EAC7CA,EAAK,IAAM,UAAY,KAAK,eAAeD,CAAK,CAClD,CAOA,SAAS/E,IAAa,CACpB,MAAO,CACL,KAAM,aACN,SAAU,CAAC,CACb,CACF,CAGA,SAASC,IAAW,CAClB,MAAO,CACL,KAAM,OACN,KAAM,KACN,KAAM,KACN,MAAO,EACT,CACF,CAGA,SAASE,IAAW,CAClB,MAAO,CACL,KAAM,aACN,MAAO,EACT,CACF,CAGA,SAASC,IAAa,CACpB,MAAO,CACL,KAAM,aACN,WAAY,GACZ,MAAO,KACP,MAAO,KACP,IAAK,EACP,CACF,CAGA,SAASC,IAAW,CAClB,MAAO,CACL,KAAM,WACN,SAAU,CAAC,CACb,CACF,CAGA,SAASN,IAAU,CACjB,MAAO,CACL,KAAM,UAEN,MAAO,EACP,SAAU,CAAC,CACb,CACF,CAGA,SAASO,IAAY,CACnB,MAAO,CACL,KAAM,OACR,CACF,CAGA,SAASC,IAAO,CACd,MAAO,CACL,KAAM,OACN,MAAO,EACT,CACF,CAGA,SAASC,IAAQ,CACf,MAAO,CACL,KAAM,QACN,MAAO,KACP,IAAK,GACL,IAAK,IACP,CACF,CAGA,SAASX,IAAO,CACd,MAAO,CACL,KAAM,OACN,MAAO,KACP,IAAK,GACL,SAAU,CAAC,CACb,CACF,CAMA,SAASc,GAAKoE,EAAO,CACnB,MAAO,CACL,KAAM,OACN,QAASA,EAAM,OAAS,cACxB,MAAO,KACP,OAAQA,EAAM,QACd,SAAU,CAAC,CACb,CACF,CAMA,SAAStE,GAASsE,EAAO,CACvB,MAAO,CACL,KAAM,WACN,OAAQA,EAAM,QACd,QAAS,KACT,SAAU,CAAC,CACb,CACF,CAGA,SAASlE,IAAY,CACnB,MAAO,CACL,KAAM,YACN,SAAU,CAAC,CACb,CACF,CAGA,SAASE,IAAS,CAChB,MAAO,CACL,KAAM,SACN,SAAU,CAAC,CACb,CACF,CAGA,SAAS4E,IAAO,CACd,MAAO,CACL,KAAM,OACN,MAAO,EACT,CACF,CAGA,SAAS3E,IAAgB,CACvB,MAAO,CACL,KAAM,eACR,CACF,CACF,CAUA,SAASgD,GAAMoC,EAAG,CAChB,MAAO,CACL,KAAMA,EAAE,KACR,OAAQA,EAAE,OACV,OAAQA,EAAE,MACZ,CACF,CAOA,SAASnD,GAAUoD,EAAUC,EAAY,CACvC,IAAI3C,EAAQ,GACZ,KAAO,EAAEA,EAAQ2C,EAAW,QAAQ,CAClC,IAAMlH,EAAQkH,EAAW3C,CAAK,EAC1B,MAAM,QAAQvE,CAAK,EACrB6D,GAAUoD,EAAUjH,CAAK,EAEzBmH,GAAUF,EAAUjH,CAAK,CAE7B,CACF,CAOA,SAASmH,GAAUF,EAAUE,EAAW,CAEtC,IAAIC,EACJ,IAAKA,KAAOD,EACV,GAAIrH,GAAI,KAAKqH,EAAWC,CAAG,EACzB,OAAQA,EAAK,CACX,IAAK,iBACH,CACE,IAAMC,EAAQF,EAAUC,CAAG,EACvBC,GACFJ,EAASG,CAAG,EAAE,KAAK,GAAGC,CAAK,EAE7B,KACF,CACF,IAAK,aACH,CACE,IAAMA,EAAQF,EAAUC,CAAG,EACvBC,GACFJ,EAASG,CAAG,EAAE,KAAK,GAAGC,CAAK,EAE7B,KACF,CACF,IAAK,QACL,IAAK,OACH,CACE,IAAMA,EAAQF,EAAUC,CAAG,EACvBC,GACF,OAAO,OAAOJ,EAASG,CAAG,EAAGC,CAAK,EAEpC,KACF,CAEJ,CAGN,CAGA,SAAS1C,GAAe2C,EAAMD,EAAO,CACnC,MAAIC,EACI,IAAI,MAAM,iBAAmBA,EAAK,KAAO,MAAQtB,GAAkB,CACvE,MAAOsB,EAAK,MACZ,IAAKA,EAAK,GACZ,CAAC,EAAI,0BAA4BD,EAAM,KAAO,MAAQrB,GAAkB,CACtE,MAAOqB,EAAM,MACb,IAAKA,EAAM,GACb,CAAC,EAAI,WAAW,EAEV,IAAI,MAAM,oCAAsCA,EAAM,KAAO,MAAQrB,GAAkB,CAC3F,MAAOqB,EAAM,MACb,IAAKA,EAAM,GACb,CAAC,EAAI,iBAAiB,CAE1B,CCnoCe,SAARE,GAA6BC,EAAS,CAG3C,IAAMC,EAAO,KAEbA,EAAK,OAASC,EAKd,SAASA,EAAOC,EAAK,CACnB,OAAOC,GAAaD,EAAK,CACvB,GAAGF,EAAK,KAAK,UAAU,EACvB,GAAGD,EAIH,WAAYC,EAAK,KAAK,qBAAqB,GAAK,CAAC,EACjD,gBAAiBA,EAAK,KAAK,wBAAwB,GAAK,CAAC,CAC3D,CAAC,CACH,CACF,CCOA,IAAMI,GAAM,CAAC,EAAE,eAcR,SAASC,GAAOC,EAAKC,EAAS,CACnC,IAAMC,EAAWD,GAAW,CAAC,EA8B7B,SAASE,EAAIC,KAAUC,EAAY,CAEjC,IAAIC,EAAKH,EAAI,QACPI,EAAWJ,EAAI,SAErB,GAAIC,GAASN,GAAI,KAAKM,EAAOJ,CAAG,EAAG,CAEjC,IAAMQ,EAAK,OAAOJ,EAAMJ,CAAG,CAAC,EAE5BM,EAAKR,GAAI,KAAKS,EAAUC,CAAE,EAAID,EAASC,CAAE,EAAIL,EAAI,OACnD,CAEA,GAAIG,EACF,OAAOA,EAAG,KAAK,KAAMF,EAAO,GAAGC,CAAU,CAE7C,CAEA,OAAAF,EAAI,SAAWD,EAAS,UAAY,CAAC,EACrCC,EAAI,QAAUD,EAAS,QACvBC,EAAI,QAAUD,EAAS,QAGhBC,CACT,CCjHA,IAAMM,GAAM,CAAC,EAAE,eAOR,SAASC,GAAUC,EAAMC,EAAW,CACzC,IAAIC,EAAQ,GAERC,EAGJ,GAAIF,EAAU,WACZ,KAAO,EAAEC,EAAQD,EAAU,WAAW,QACpCF,GAAUC,EAAMC,EAAU,WAAWC,CAAK,CAAC,EAI/C,IAAKC,KAAOF,EACV,GAAIH,GAAI,KAAKG,EAAWE,CAAG,EACzB,OAAQA,EAAK,CACX,IAAK,aAEH,MAIF,IAAK,SAAU,CACbC,GAAKJ,EAAKG,CAAG,EAAGF,EAAUE,CAAG,CAAC,EAC9B,KACF,CAEA,IAAK,OAAQ,CACXC,GAAKJ,EAAKG,CAAG,EAAGF,EAAUE,CAAG,CAAC,EAC9B,KACF,CAEA,IAAK,WAAY,CACfE,GAAIL,EAAKG,CAAG,EAAGF,EAAUE,CAAG,CAAC,EAC7B,KACF,CAEA,QAEEH,EAAK,QAAQG,CAAG,EAAIF,EAAUE,CAAG,CAErC,CAIJ,OAAOH,CACT,CAOA,SAASI,GAAKE,EAAMC,EAAO,CACrBA,GACFD,EAAK,KAAK,GAAGC,CAAK,CAEtB,CAOA,SAASF,GAAIC,EAAMC,EAAO,CACpBA,GACF,OAAO,OAAOD,EAAMC,CAAK,CAE7B,CClEO,SAASC,GAAWC,EAAMC,EAAGC,EAAOC,EAAM,CAC/C,IAAMC,EAAOF,EAAM,MAAM,YAAY,EAC/BG,EAAUH,EAAM,cAAcC,CAAI,EACxCE,EAAQ,KAAK,IAAI,EACjBA,EAAQ,MAAM,CAAC,EACf,IAAMC,EAAQJ,EAAM,YAClBA,EAAM,cAAcF,EAAMK,EAAQ,QAAQ,CAAC,EAC3CE,EACF,EACA,OAAAH,EAAK,EACEE,CACT,CAGA,SAASC,GAAIC,EAAMP,EAAGQ,EAAO,CAC3B,MAAO,KAAOA,EAAQ,GAAK,KAAOD,CACpC,CCnBO,SAASE,GAAeC,EAAOC,EAAS,CAC7C,OACEC,GAAYF,EAAOC,EAAQ,YAAa,EAAI,GAC5C,CAACC,GAAYF,EAAOC,EAAQ,eAAgB,EAAK,CAErD,CAQA,SAASC,GAAYF,EAAOG,EAAMC,EAAM,CAKtC,GAJI,OAAOD,GAAS,WAClBA,EAAO,CAACA,CAAI,GAGV,CAACA,GAAQA,EAAK,SAAW,EAC3B,OAAOC,EAGT,IAAIC,EAAQ,GAEZ,KAAO,EAAEA,EAAQF,EAAK,QACpB,GAAIH,EAAM,SAASG,EAAKE,CAAK,CAAC,EAC5B,MAAO,GAIX,MAAO,EACT,CC1BO,SAASC,GAAUC,EAAGC,EAAIC,EAAOC,EAAM,CAC5C,IAAIC,EAAQ,GAEZ,KAAO,EAAEA,EAAQF,EAAM,OAAO,QAG5B,GACEA,EAAM,OAAOE,CAAK,EAAE,YAAc;AAAA,GAClCC,GAAeH,EAAM,MAAOA,EAAM,OAAOE,CAAK,CAAC,EAE/C,MAAO,QAAQ,KAAKD,EAAK,MAAM,EAAI,GAAK,IAI5C,MAAO;AAAA,CACT,CCnBO,SAASG,GAAcC,EAAOC,EAAW,CAC9C,IAAMC,EAAS,OAAOF,CAAK,EACvBG,EAAQD,EAAO,QAAQD,CAAS,EAChCG,EAAWD,EACXE,EAAQ,EACRC,EAAM,EAEV,GAAI,OAAOL,GAAc,SACvB,MAAM,IAAI,UAAU,oBAAoB,EAG1C,KAAOE,IAAU,IACXA,IAAUC,EACR,EAAEC,EAAQC,IACZA,EAAMD,GAGRA,EAAQ,EAGVD,EAAWD,EAAQF,EAAU,OAC7BE,EAAQD,EAAO,QAAQD,EAAWG,CAAQ,EAG5C,OAAOE,CACT,CCzBO,SAASC,GAAqBC,EAAMC,EAAO,CAChD,MAAO,GACLA,EAAM,QAAQ,SAAW,IACvBD,EAAK,OAEL,CAACA,EAAK,MAEN,WAAW,KAAKA,EAAK,KAAK,GAE1B,CAAC,0CAA0C,KAAKA,EAAK,KAAK,EAEhE,CCbO,SAASE,GAAWC,EAAO,CAChC,IAAMC,EAASD,EAAM,QAAQ,OAAS,IAEtC,GAAIC,IAAW,KAAOA,IAAW,IAC/B,MAAM,IAAI,MACR,+BACEA,EACA,gDACJ,EAGF,OAAOA,CACT,CCJO,SAASC,GAAKC,EAAMC,EAAGC,EAAOC,EAAM,CACzC,IAAMC,EAASC,GAAWH,CAAK,EACzBI,EAAMN,EAAK,OAAS,GACpBO,EAASH,IAAW,IAAM,cAAgB,QAEhD,GAAII,GAAqBR,EAAME,CAAK,EAAG,CACrC,IAAMO,EAAOP,EAAM,MAAM,cAAc,EACjCQ,EAAQR,EAAM,YAAYI,EAAKK,EAAG,EACxC,OAAAF,EAAK,EACEC,CACT,CAEA,IAAME,EAAUV,EAAM,cAAcC,CAAI,EAClCU,EAAWT,EAAO,OAAO,KAAK,IAAIU,GAAcR,EAAKF,CAAM,EAAI,EAAG,CAAC,CAAC,EACpEK,EAAOP,EAAM,MAAM,YAAY,EACjCQ,EAAQE,EAAQ,KAAKC,CAAQ,EAEjC,GAAIb,EAAK,KAAM,CACb,IAAMe,EAAUb,EAAM,MAAM,iBAAiBK,CAAM,EAAE,EACrDG,GAASE,EAAQ,KACfV,EAAM,KAAKF,EAAK,KAAM,CACpB,OAAQU,EACR,MAAO,IACP,OAAQ,CAAC,GAAG,EACZ,GAAGE,EAAQ,QAAQ,CACrB,CAAC,CACH,EACAG,EAAQ,CACV,CAEA,GAAIf,EAAK,MAAQA,EAAK,KAAM,CAC1B,IAAMe,EAAUb,EAAM,MAAM,iBAAiBK,CAAM,EAAE,EACrDG,GAASE,EAAQ,KAAK,GAAG,EACzBF,GAASE,EAAQ,KACfV,EAAM,KAAKF,EAAK,KAAM,CACpB,OAAQU,EACR,MAAO;AAAA,EACP,OAAQ,CAAC,GAAG,EACZ,GAAGE,EAAQ,QAAQ,CACrB,CAAC,CACH,EACAG,EAAQ,CACV,CAEA,OAAAL,GAASE,EAAQ,KAAK;AAAA,CAAI,EAEtBN,IACFI,GAASE,EAAQ,KAAKN,EAAM;AAAA,CAAI,GAGlCI,GAASE,EAAQ,KAAKC,CAAQ,EAC9BJ,EAAK,EACEC,CACT,CAGA,SAASC,GAAIK,EAAMf,EAAGgB,EAAO,CAC3B,OAAQA,EAAQ,GAAK,QAAUD,CACjC,CClEO,SAASE,GAAWC,EAAO,CAChC,IAAMC,EAASD,EAAM,QAAQ,OAAS,IAEtC,GAAIC,IAAW,KAAOA,IAAW,IAC/B,MAAM,IAAI,MACR,gCACEA,EACA,8CACJ,EAGF,OAAOA,CACT,CCNO,SAASC,GAAWC,EAAMC,EAAGC,EAAOC,EAAM,CAC/C,IAAMC,EAAQC,GAAWH,CAAK,EACxBI,EAASF,IAAU,IAAM,QAAU,aACnCG,EAAOL,EAAM,MAAM,YAAY,EACjCM,EAAUN,EAAM,MAAM,OAAO,EAC3BO,EAAUP,EAAM,cAAcC,CAAI,EACpCO,EAAQD,EAAQ,KAAK,GAAG,EAC5B,OAAAC,GAASD,EAAQ,KACfP,EAAM,KAAKA,EAAM,cAAcF,CAAI,EAAG,CACpC,OAAQU,EACR,MAAO,IACP,GAAGD,EAAQ,QAAQ,CACrB,CAAC,CACH,EACAC,GAASD,EAAQ,KAAK,KAAK,EAE3BD,EAAQ,EAIN,CAACR,EAAK,KAEN,eAAe,KAAKA,EAAK,GAAG,GAE5BQ,EAAUN,EAAM,MAAM,oBAAoB,EAC1CQ,GAASD,EAAQ,KAAK,GAAG,EACzBC,GAASD,EAAQ,KACfP,EAAM,KAAKF,EAAK,IAAK,CAAC,OAAQU,EAAO,MAAO,IAAK,GAAGD,EAAQ,QAAQ,CAAC,CAAC,CACxE,EACAC,GAASD,EAAQ,KAAK,GAAG,IAGzBD,EAAUN,EAAM,MAAM,gBAAgB,EACtCQ,GAASD,EAAQ,KACfP,EAAM,KAAKF,EAAK,IAAK,CACnB,OAAQU,EACR,MAAOV,EAAK,MAAQ,IAAM;AAAA,EAC1B,GAAGS,EAAQ,QAAQ,CACrB,CAAC,CACH,GAGFD,EAAQ,EAEJR,EAAK,QACPQ,EAAUN,EAAM,MAAM,QAAQI,CAAM,EAAE,EACtCI,GAASD,EAAQ,KAAK,IAAML,CAAK,EACjCM,GAASD,EAAQ,KACfP,EAAM,KAAKF,EAAK,MAAO,CACrB,OAAQU,EACR,MAAON,EACP,GAAGK,EAAQ,QAAQ,CACrB,CAAC,CACH,EACAC,GAASD,EAAQ,KAAKL,CAAK,EAC3BI,EAAQ,GAGVD,EAAK,EAEEG,CACT,CCnEO,SAASC,GAAcC,EAAO,CACnC,IAAMC,EAASD,EAAM,QAAQ,UAAY,IAEzC,GAAIC,IAAW,KAAOA,IAAW,IAC/B,MAAM,IAAI,MACR,mCACEA,EACA,gDACJ,EAGF,OAAOA,CACT,CCZO,SAASC,GAAyBC,EAAM,CAC7C,MAAO,MAAQA,EAAK,SAAS,EAAE,EAAE,YAAY,EAAI,GACnD,CC8BO,SAASC,GAAWC,EAASC,EAAQC,EAAQ,CAClD,IAAMC,EAAcC,GAAkBJ,CAAO,EACvCK,EAAaD,GAAkBH,CAAM,EAG3C,OAAIE,IAAgB,OACXE,IAAe,OAIlBH,IAAW,IACT,CAAC,OAAQ,GAAM,QAAS,EAAI,EAC5B,CAAC,OAAQ,GAAO,QAAS,EAAK,EAChCG,IAAe,EAEb,CAAC,OAAQ,GAAM,QAAS,EAAI,EAE5B,CAAC,OAAQ,GAAO,QAAS,EAAI,EAIjCF,IAAgB,EACXE,IAAe,OAElB,CAAC,OAAQ,GAAO,QAAS,EAAK,EAC9BA,IAAe,EAEb,CAAC,OAAQ,GAAM,QAAS,EAAI,EAE5B,CAAC,OAAQ,GAAO,QAAS,EAAK,EAI/BA,IAAe,OAElB,CAAC,OAAQ,GAAO,QAAS,EAAK,EAC9BA,IAAe,EAEb,CAAC,OAAQ,GAAM,QAAS,EAAK,EAE7B,CAAC,OAAQ,GAAO,QAAS,EAAK,CACtC,CCxEAC,GAAS,KAAOC,GAST,SAASD,GAASE,EAAMC,EAAGC,EAAOC,EAAM,CAC7C,IAAMC,EAASC,GAAcH,CAAK,EAC5BI,EAAOJ,EAAM,MAAM,UAAU,EAC7BK,EAAUL,EAAM,cAAcC,CAAI,EAClCK,EAASD,EAAQ,KAAKH,CAAM,EAE9BK,EAAUF,EAAQ,KACpBL,EAAM,kBAAkBF,EAAM,CAC5B,MAAOI,EACP,OAAAI,EACA,GAAGD,EAAQ,QAAQ,CACrB,CAAC,CACH,EACMG,EAAcD,EAAQ,WAAW,CAAC,EAClCE,EAAOC,GACXT,EAAK,OAAO,WAAWA,EAAK,OAAO,OAAS,CAAC,EAC7CO,EACAN,CACF,EAEIO,EAAK,SACPF,EAAUI,GAAyBH,CAAW,EAAID,EAAQ,MAAM,CAAC,GAGnE,IAAMK,EAAcL,EAAQ,WAAWA,EAAQ,OAAS,CAAC,EACnDM,EAAQH,GAAWT,EAAK,MAAM,WAAW,CAAC,EAAGW,EAAaV,CAAM,EAElEW,EAAM,SACRN,EAAUA,EAAQ,MAAM,EAAG,EAAE,EAAII,GAAyBC,CAAW,GAGvE,IAAME,EAAQT,EAAQ,KAAKH,CAAM,EAEjC,OAAAE,EAAK,EAELJ,EAAM,+BAAiC,CACrC,MAAOa,EAAM,QACb,OAAQJ,EAAK,OACf,EACOH,EAASC,EAAUO,CAC5B,CAQA,SAASjB,GAAaE,EAAGgB,EAAIf,EAAO,CAClC,OAAOA,EAAM,QAAQ,UAAY,GACnC,CCuEO,IAAMgB,GAgBT,SAAUC,EAAM,CACd,GAAIA,GAAS,KACX,OAAOC,GAGT,GAAI,OAAOD,GAAS,WAClB,OAAOE,GAAYF,CAAI,EAGzB,GAAI,OAAOA,GAAS,SAClB,OAAO,MAAM,QAAQA,CAAI,EAAIG,GAAWH,CAAI,EAAII,GAAaJ,CAAI,EAGnE,GAAI,OAAOA,GAAS,SAClB,OAAOK,GAAYL,CAAI,EAGzB,MAAM,IAAI,MAAM,8CAA8C,CAChE,EAOJ,SAASG,GAAWG,EAAO,CAEzB,IAAMC,EAAS,CAAC,EACZC,EAAQ,GAEZ,KAAO,EAAEA,EAAQF,EAAM,QACrBC,EAAOC,CAAK,EAAIT,GAAQO,EAAME,CAAK,CAAC,EAGtC,OAAON,GAAYO,CAAG,EAMtB,SAASA,KAAOC,EAAY,CAC1B,IAAIF,EAAQ,GAEZ,KAAO,EAAEA,EAAQD,EAAO,QACtB,GAAIA,EAAOC,CAAK,EAAE,MAAM,KAAME,CAAU,EAAG,MAAO,GAGpD,MAAO,EACT,CACF,CAQA,SAASN,GAAaO,EAAO,CAC3B,IAAMC,EAAwDD,EAE9D,OAAOT,GAAYW,CAAG,EAMtB,SAASA,EAAIC,EAAM,CACjB,IAAMC,EACoBD,EAItBE,EAEJ,IAAKA,KAAOL,EACV,GAAII,EAAaC,CAAG,IAAMJ,EAAcI,CAAG,EAAG,MAAO,GAGvD,MAAO,EACT,CACF,CAQA,SAASX,GAAYM,EAAO,CAC1B,OAAOT,GAAYe,CAAI,EAKvB,SAASA,EAAKH,EAAM,CAClB,OAAOA,GAAQA,EAAK,OAASH,CAC/B,CACF,CAQA,SAAST,GAAYgB,EAAc,CACjC,OAAOP,EAMP,SAASA,EAAMQ,EAAOX,EAAOY,EAAQ,CACnC,MAAO,GACLC,GAAeF,CAAK,GAClBD,EAAa,KACX,KACAC,EACA,OAAOX,GAAU,SAAWA,EAAQ,OACpCY,GAAU,MACZ,EAEN,CACF,CAEA,SAASnB,IAAK,CACZ,MAAO,EACT,CAMA,SAASoB,GAAeF,EAAO,CAC7B,OAAOA,IAAU,MAAQ,OAAOA,GAAU,UAAY,SAAUA,CAClE,CCnEA,IAAMG,GAAQ,CAAC,EAKFC,GAAW,GAKXC,GAAO,GAKPC,GAAO,OAiDb,SAASC,GAAaC,EAAMC,EAAMC,EAASC,EAAS,CAEzD,IAAIC,EAEA,OAAOH,GAAS,YAAc,OAAOC,GAAY,YACnDC,EAAUD,EAEVA,EAAUD,GAGVG,EAAQH,EAGV,IAAMI,EAAKC,GAAQF,CAAK,EAClBG,EAAOJ,EAAU,GAAK,EAE5BK,EAAQR,EAAM,OAAW,CAAC,CAAC,EAAE,EAO7B,SAASQ,EAAQC,EAAMC,EAAOC,EAAS,CACrC,IAAMC,EACJH,GAAQ,OAAOA,GAAS,SAAWA,EAAO,CAAC,EAG7C,GAAI,OAAOG,EAAM,MAAS,SAAU,CAClC,IAAMC,EAEJ,OAAOD,EAAM,SAAY,SACrBA,EAAM,QAER,OAAOA,EAAM,MAAS,SACpBA,EAAM,KACN,OAEN,OAAO,eAAeE,EAAO,OAAQ,CACnC,MACE,UAAiBL,EAAK,MAAQI,EAAO,IAAMA,EAAO,IAAM,KAAO,GACnE,CAAC,CACH,CAEA,OAAOC,EAEP,SAASA,GAAQ,CAEf,IAAIC,EAASpB,GAETqB,EAEAC,EAEAC,EAEJ,IAAI,CAACjB,GAAQI,EAAGI,EAAMC,EAAOC,EAAQA,EAAQ,OAAS,CAAC,GAAK,MAAS,KAEnEI,EAASI,GAASjB,EAAQO,EAAME,CAAO,CAAC,EAEpCI,EAAO,CAAC,IAAMlB,IAChB,OAAOkB,EAIX,GAAI,aAAcN,GAAQA,EAAK,SAAU,CACvC,IAAMW,EAA2CX,EAEjD,GAAIW,EAAa,UAAYL,EAAO,CAAC,IAAMjB,GAIzC,IAHAmB,GAAUd,EAAUiB,EAAa,SAAS,OAAS,IAAMb,EACzDW,EAAeP,EAAQ,OAAOS,CAAY,EAEnCH,EAAS,IAAMA,EAASG,EAAa,SAAS,QAAQ,CAC3D,IAAMC,EAAQD,EAAa,SAASH,CAAM,EAI1C,GAFAD,EAAYR,EAAQa,EAAOJ,EAAQC,CAAY,EAAE,EAE7CF,EAAU,CAAC,IAAMnB,GACnB,OAAOmB,EAGTC,EACE,OAAOD,EAAU,CAAC,GAAM,SAAWA,EAAU,CAAC,EAAIC,EAASV,CAC/D,CAEJ,CAEA,OAAOQ,CACT,CACF,CACF,CAUA,SAASI,GAASP,EAAO,CACvB,OAAI,MAAM,QAAQA,CAAK,EACdA,EAGL,OAAOA,GAAU,SACZ,CAAChB,GAAUgB,CAAK,EAGlBA,GAAU,KAA8BjB,GAAQ,CAACiB,CAAK,CAC/D,CCvHO,SAASU,GAAMC,EAAMC,EAAeC,EAAkBC,EAAc,CAEzE,IAAIC,EAEAC,EAEAC,EAGF,OAAOL,GAAkB,YACzB,OAAOC,GAAqB,YAE5BG,EAAO,OACPC,EAAUL,EACVG,EAAUF,IAGVG,EAAOJ,EAEPK,EAAUJ,EACVE,EAAUD,GAGZI,GAAaP,EAAMK,EAAMG,EAAUJ,CAAO,EAM1C,SAASI,EAASC,EAAMC,EAAS,CAC/B,IAAMC,EAASD,EAAQA,EAAQ,OAAS,CAAC,EACnCE,EAAQD,EAASA,EAAO,SAAS,QAAQF,CAAI,EAAI,OACvD,OAAOH,EAAQG,EAAMG,EAAOD,CAAM,CACpC,CACF,CC3SO,SAASE,GAAsBC,EAAMC,EAAO,CACjD,IAAIC,EAAmB,GAIvB,OAAAC,GAAMH,EAAM,SAAUA,EAAM,CAC1B,GACG,UAAWA,GAAQ,WAAW,KAAKA,EAAK,KAAK,GAC9CA,EAAK,OAAS,QAEd,OAAAE,EAAmB,GACZE,EAEX,CAAC,EAEM,IACJ,CAACJ,EAAK,OAASA,EAAK,MAAQ,IAC3BK,GAASL,CAAI,IACZC,EAAM,QAAQ,QAAUC,GAE/B,CClBO,SAASI,GAAQC,EAAMC,EAAGC,EAAOC,EAAM,CAC5C,IAAMC,EAAO,KAAK,IAAI,KAAK,IAAI,EAAGJ,EAAK,OAAS,CAAC,EAAG,CAAC,EAC/CK,EAAUH,EAAM,cAAcC,CAAI,EAExC,GAAIG,GAAsBN,EAAME,CAAK,EAAG,CACtC,IAAMK,EAAOL,EAAM,MAAM,eAAe,EAClCM,EAAUN,EAAM,MAAM,UAAU,EAChCO,EAAQP,EAAM,kBAAkBF,EAAM,CAC1C,GAAGK,EAAQ,QAAQ,EACnB,OAAQ;AAAA,EACR,MAAO;AAAA,CACT,CAAC,EACD,OAAAG,EAAQ,EACRD,EAAK,EAGHE,EACA;AAAA,GACCL,IAAS,EAAI,IAAM,KAAK,OAEvBK,EAAM,QAGH,KAAK,IAAIA,EAAM,YAAY,IAAI,EAAGA,EAAM,YAAY;AAAA,CAAI,CAAC,EAAI,EAClE,CAEJ,CAEA,IAAMC,EAAW,IAAI,OAAON,CAAI,EAC1BG,EAAOL,EAAM,MAAM,YAAY,EAC/BM,EAAUN,EAAM,MAAM,UAAU,EAMtCG,EAAQ,KAAKK,EAAW,GAAG,EAE3B,IAAID,EAAQP,EAAM,kBAAkBF,EAAM,CACxC,OAAQ,KACR,MAAO;AAAA,EACP,GAAGK,EAAQ,QAAQ,CACrB,CAAC,EAED,MAAI,SAAS,KAAKI,CAAK,IAErBA,EAAQE,GAAyBF,EAAM,WAAW,CAAC,CAAC,EAAIA,EAAM,MAAM,CAAC,GAGvEA,EAAQA,EAAQC,EAAW,IAAMD,EAAQC,EAErCR,EAAM,QAAQ,WAChBO,GAAS,IAAMC,GAGjBF,EAAQ,EACRD,EAAK,EAEEE,CACT,CCtEAG,GAAK,KAAOC,GAML,SAASD,GAAKE,EAAM,CACzB,OAAOA,EAAK,OAAS,EACvB,CAKA,SAASD,IAAW,CAClB,MAAO,GACT,CCZAE,GAAM,KAAOC,GASN,SAASD,GAAME,EAAMC,EAAGC,EAAOC,EAAM,CAC1C,IAAMC,EAAQC,GAAWH,CAAK,EACxBI,EAASF,IAAU,IAAM,QAAU,aACnCG,EAAOL,EAAM,MAAM,OAAO,EAC5BM,EAAUN,EAAM,MAAM,OAAO,EAC3BO,EAAUP,EAAM,cAAcC,CAAI,EACpCO,EAAQD,EAAQ,KAAK,IAAI,EAC7B,OAAAC,GAASD,EAAQ,KACfP,EAAM,KAAKF,EAAK,IAAK,CAAC,OAAQU,EAAO,MAAO,IAAK,GAAGD,EAAQ,QAAQ,CAAC,CAAC,CACxE,EACAC,GAASD,EAAQ,KAAK,IAAI,EAE1BD,EAAQ,EAIL,CAACR,EAAK,KAAOA,EAAK,OAEnB,eAAe,KAAKA,EAAK,GAAG,GAE5BQ,EAAUN,EAAM,MAAM,oBAAoB,EAC1CQ,GAASD,EAAQ,KAAK,GAAG,EACzBC,GAASD,EAAQ,KACfP,EAAM,KAAKF,EAAK,IAAK,CAAC,OAAQU,EAAO,MAAO,IAAK,GAAGD,EAAQ,QAAQ,CAAC,CAAC,CACxE,EACAC,GAASD,EAAQ,KAAK,GAAG,IAGzBD,EAAUN,EAAM,MAAM,gBAAgB,EACtCQ,GAASD,EAAQ,KACfP,EAAM,KAAKF,EAAK,IAAK,CACnB,OAAQU,EACR,MAAOV,EAAK,MAAQ,IAAM,IAC1B,GAAGS,EAAQ,QAAQ,CACrB,CAAC,CACH,GAGFD,EAAQ,EAEJR,EAAK,QACPQ,EAAUN,EAAM,MAAM,QAAQI,CAAM,EAAE,EACtCI,GAASD,EAAQ,KAAK,IAAML,CAAK,EACjCM,GAASD,EAAQ,KACfP,EAAM,KAAKF,EAAK,MAAO,CACrB,OAAQU,EACR,MAAON,EACP,GAAGK,EAAQ,QAAQ,CACrB,CAAC,CACH,EACAC,GAASD,EAAQ,KAAKL,CAAK,EAC3BI,EAAQ,GAGVE,GAASD,EAAQ,KAAK,GAAG,EACzBF,EAAK,EAEEG,CACT,CAKA,SAASX,IAAY,CACnB,MAAO,GACT,CC5EAY,GAAe,KAAOC,GASf,SAASD,GAAeE,EAAMC,EAAGC,EAAOC,EAAM,CACnD,IAAMC,EAAOJ,EAAK,cACZK,EAAOH,EAAM,MAAM,gBAAgB,EACrCI,EAAUJ,EAAM,MAAM,OAAO,EAC3BK,EAAUL,EAAM,cAAcC,CAAI,EACpCK,EAAQD,EAAQ,KAAK,IAAI,EACvBE,EAAMP,EAAM,KAAKF,EAAK,IAAK,CAC/B,OAAQQ,EACR,MAAO,IACP,GAAGD,EAAQ,QAAQ,CACrB,CAAC,EACDC,GAASD,EAAQ,KAAKE,EAAM,IAAI,EAEhCH,EAAQ,EAER,IAAMI,EAAQR,EAAM,MACpBA,EAAM,MAAQ,CAAC,EACfI,EAAUJ,EAAM,MAAM,WAAW,EAKjC,IAAMS,EAAYT,EAAM,KAAKA,EAAM,cAAcF,CAAI,EAAG,CACtD,OAAQQ,EACR,MAAO,IACP,GAAGD,EAAQ,QAAQ,CACrB,CAAC,EACD,OAAAD,EAAQ,EACRJ,EAAM,MAAQQ,EACdL,EAAK,EAEDD,IAAS,QAAU,CAACK,GAAOA,IAAQE,EACrCH,GAASD,EAAQ,KAAKI,EAAY,GAAG,EAC5BP,IAAS,WAElBI,EAAQA,EAAM,MAAM,EAAG,EAAE,EAEzBA,GAASD,EAAQ,KAAK,GAAG,EAGpBC,CACT,CAKA,SAAST,IAAqB,CAC5B,MAAO,GACT,CCzDAa,GAAW,KAAOC,GAQX,SAASD,GAAWE,EAAMC,EAAGC,EAAO,CACzC,IAAIC,EAAQH,EAAK,OAAS,GACtBI,EAAW,IACXC,EAAQ,GAKZ,KAAO,IAAI,OAAO,WAAaD,EAAW,UAAU,EAAE,KAAKD,CAAK,GAC9DC,GAAY,IAmBd,IAbE,WAAW,KAAKD,CAAK,IACnB,WAAW,KAAKA,CAAK,GAAK,WAAW,KAAKA,CAAK,GAAM,QAAQ,KAAKA,CAAK,KAEzEA,EAAQ,IAAMA,EAAQ,KAUjB,EAAEE,EAAQH,EAAM,OAAO,QAAQ,CACpC,IAAMI,EAAUJ,EAAM,OAAOG,CAAK,EAC5BE,EAAaL,EAAM,eAAeI,CAAO,EAE3CE,EAKJ,GAAKF,EAAQ,QAEb,KAAQE,EAAQD,EAAW,KAAKJ,CAAK,GAAI,CACvC,IAAIM,EAAWD,EAAM,MAInBL,EAAM,WAAWM,CAAQ,IAAM,IAC/BN,EAAM,WAAWM,EAAW,CAAC,IAAM,IAEnCA,IAGFN,EAAQA,EAAM,MAAM,EAAGM,CAAQ,EAAI,IAAMN,EAAM,MAAMK,EAAM,MAAQ,CAAC,CACtE,CACF,CAEA,OAAOJ,EAAWD,EAAQC,CAC5B,CAKA,SAASL,IAAiB,CACxB,MAAO,GACT,CC/DO,SAASW,GAAqBC,EAAMC,EAAO,CAChD,IAAMC,EAAMC,GAASH,CAAI,EAEzB,MAAO,GACL,CAACC,EAAM,QAAQ,cAEbD,EAAK,KAEL,CAACA,EAAK,OAENA,EAAK,UACLA,EAAK,SAAS,SAAW,GACzBA,EAAK,SAAS,CAAC,EAAE,OAAS,SAEzBE,IAAQF,EAAK,KAAO,UAAYE,IAAQF,EAAK,MAE9C,oBAAoB,KAAKA,EAAK,GAAG,GAGjC,CAAC,iBAAiB,KAAKA,EAAK,GAAG,EAErC,CCxBAI,GAAK,KAAOC,GASL,SAASD,GAAKE,EAAMC,EAAGC,EAAOC,EAAM,CACzC,IAAMC,EAAQC,GAAWH,CAAK,EACxBI,EAASF,IAAU,IAAM,QAAU,aACnCG,EAAUL,EAAM,cAAcC,CAAI,EAEpCK,EAEAC,EAEJ,GAAIC,GAAqBV,EAAME,CAAK,EAAG,CAErC,IAAMS,EAAQT,EAAM,MACpBA,EAAM,MAAQ,CAAC,EACfM,EAAON,EAAM,MAAM,UAAU,EAC7B,IAAIU,EAAQL,EAAQ,KAAK,GAAG,EAC5B,OAAAK,GAASL,EAAQ,KACfL,EAAM,kBAAkBF,EAAM,CAC5B,OAAQY,EACR,MAAO,IACP,GAAGL,EAAQ,QAAQ,CACrB,CAAC,CACH,EACAK,GAASL,EAAQ,KAAK,GAAG,EACzBC,EAAK,EACLN,EAAM,MAAQS,EACPC,CACT,CAEAJ,EAAON,EAAM,MAAM,MAAM,EACzBO,EAAUP,EAAM,MAAM,OAAO,EAC7B,IAAIU,EAAQL,EAAQ,KAAK,GAAG,EAC5B,OAAAK,GAASL,EAAQ,KACfL,EAAM,kBAAkBF,EAAM,CAC5B,OAAQY,EACR,MAAO,KACP,GAAGL,EAAQ,QAAQ,CACrB,CAAC,CACH,EACAK,GAASL,EAAQ,KAAK,IAAI,EAC1BE,EAAQ,EAIL,CAACT,EAAK,KAAOA,EAAK,OAEnB,eAAe,KAAKA,EAAK,GAAG,GAE5BS,EAAUP,EAAM,MAAM,oBAAoB,EAC1CU,GAASL,EAAQ,KAAK,GAAG,EACzBK,GAASL,EAAQ,KACfL,EAAM,KAAKF,EAAK,IAAK,CAAC,OAAQY,EAAO,MAAO,IAAK,GAAGL,EAAQ,QAAQ,CAAC,CAAC,CACxE,EACAK,GAASL,EAAQ,KAAK,GAAG,IAGzBE,EAAUP,EAAM,MAAM,gBAAgB,EACtCU,GAASL,EAAQ,KACfL,EAAM,KAAKF,EAAK,IAAK,CACnB,OAAQY,EACR,MAAOZ,EAAK,MAAQ,IAAM,IAC1B,GAAGO,EAAQ,QAAQ,CACrB,CAAC,CACH,GAGFE,EAAQ,EAEJT,EAAK,QACPS,EAAUP,EAAM,MAAM,QAAQI,CAAM,EAAE,EACtCM,GAASL,EAAQ,KAAK,IAAMH,CAAK,EACjCQ,GAASL,EAAQ,KACfL,EAAM,KAAKF,EAAK,MAAO,CACrB,OAAQY,EACR,MAAOR,EACP,GAAGG,EAAQ,QAAQ,CACrB,CAAC,CACH,EACAK,GAASL,EAAQ,KAAKH,CAAK,EAC3BK,EAAQ,GAGVG,GAASL,EAAQ,KAAK,GAAG,EAEzBC,EAAK,EACEI,CACT,CAQA,SAASb,GAASC,EAAMC,EAAGC,EAAO,CAChC,OAAOQ,GAAqBV,EAAME,CAAK,EAAI,IAAM,GACnD,CC5GAW,GAAc,KAAOC,GASd,SAASD,GAAcE,EAAMC,EAAGC,EAAOC,EAAM,CAClD,IAAMC,EAAOJ,EAAK,cACZK,EAAOH,EAAM,MAAM,eAAe,EACpCI,EAAUJ,EAAM,MAAM,OAAO,EAC3BK,EAAUL,EAAM,cAAcC,CAAI,EACpCK,EAAQD,EAAQ,KAAK,GAAG,EACtBE,EAAOP,EAAM,kBAAkBF,EAAM,CACzC,OAAQQ,EACR,MAAO,IACP,GAAGD,EAAQ,QAAQ,CACrB,CAAC,EACDC,GAASD,EAAQ,KAAKE,EAAO,IAAI,EAEjCH,EAAQ,EAER,IAAMI,EAAQR,EAAM,MACpBA,EAAM,MAAQ,CAAC,EACfI,EAAUJ,EAAM,MAAM,WAAW,EAKjC,IAAMS,EAAYT,EAAM,KAAKA,EAAM,cAAcF,CAAI,EAAG,CACtD,OAAQQ,EACR,MAAO,IACP,GAAGD,EAAQ,QAAQ,CACrB,CAAC,EACD,OAAAD,EAAQ,EACRJ,EAAM,MAAQQ,EACdL,EAAK,EAEDD,IAAS,QAAU,CAACK,GAAQA,IAASE,EACvCH,GAASD,EAAQ,KAAKI,EAAY,GAAG,EAC5BP,IAAS,WAElBI,EAAQA,EAAM,MAAM,EAAG,EAAE,EAEzBA,GAASD,EAAQ,KAAK,GAAG,EAGpBC,CACT,CAKA,SAAST,IAAoB,CAC3B,MAAO,GACT,CCtDO,SAASa,GAAYC,EAAO,CACjC,IAAMC,EAASD,EAAM,QAAQ,QAAU,IAEvC,GAAIC,IAAW,KAAOA,IAAW,KAAOA,IAAW,IACjD,MAAM,IAAI,MACR,gCACEA,EACA,mDACJ,EAGF,OAAOA,CACT,CCVO,SAASC,GAAiBC,EAAO,CACtC,IAAMC,EAASC,GAAYF,CAAK,EAC1BG,EAAcH,EAAM,QAAQ,YAElC,GAAI,CAACG,EACH,OAAOF,IAAW,IAAM,IAAM,IAGhC,GAAIE,IAAgB,KAAOA,IAAgB,KAAOA,IAAgB,IAChE,MAAM,IAAI,MACR,gCACEA,EACA,wDACJ,EAGF,GAAIA,IAAgBF,EAClB,MAAM,IAAI,MACR,uBACEA,EACA,0BACAE,EACA,oBACJ,EAGF,OAAOA,CACT,CC7BO,SAASC,GAAmBC,EAAO,CACxC,IAAMC,EAASD,EAAM,QAAQ,eAAiB,IAE9C,GAAIC,IAAW,KAAOA,IAAW,IAC/B,MAAM,IAAI,MACR,gCACEA,EACA,oDACJ,EAGF,OAAOA,CACT,CCZO,SAASC,GAAUC,EAAO,CAC/B,IAAMC,EAASD,EAAM,QAAQ,MAAQ,IAErC,GAAIC,IAAW,KAAOA,IAAW,KAAOA,IAAW,IACjD,MAAM,IAAI,MACR,gCACEA,EACA,iDACJ,EAGF,OAAOA,CACT,CCHO,SAASC,GAAKC,EAAMC,EAAQC,EAAOC,EAAM,CAC9C,IAAMC,EAAOF,EAAM,MAAM,MAAM,EACzBG,EAAgBH,EAAM,cAExBI,EAASN,EAAK,QAAUO,GAAmBL,CAAK,EAAIM,GAAYN,CAAK,EAEnEO,EAAcT,EAAK,QACrBM,IAAW,IACT,IACA,IACFI,GAAiBR,CAAK,EACtBS,EACFV,GAAUC,EAAM,eAAiBI,IAAWJ,EAAM,eAAiB,GAErE,GAAI,CAACF,EAAK,QAAS,CACjB,IAAMY,EAAgBZ,EAAK,SAAWA,EAAK,SAAS,CAAC,EAAI,OAqCzD,IAzBGM,IAAW,KAAOA,IAAW,MAE9BM,IACC,CAACA,EAAc,UAAY,CAACA,EAAc,SAAS,CAAC,IAErDV,EAAM,MAAMA,EAAM,MAAM,OAAS,CAAC,IAAM,QACxCA,EAAM,MAAMA,EAAM,MAAM,OAAS,CAAC,IAAM,YACxCA,EAAM,MAAMA,EAAM,MAAM,OAAS,CAAC,IAAM,QACxCA,EAAM,MAAMA,EAAM,MAAM,OAAS,CAAC,IAAM,YAExCA,EAAM,WAAWA,EAAM,WAAW,OAAS,CAAC,IAAM,GAClDA,EAAM,WAAWA,EAAM,WAAW,OAAS,CAAC,IAAM,GAClDA,EAAM,WAAWA,EAAM,WAAW,OAAS,CAAC,IAAM,IAElDS,EAAqB,IAWnBE,GAAUX,CAAK,IAAMI,GAAUM,EAAe,CAChD,IAAIE,EAAQ,GAEZ,KAAO,EAAEA,EAAQd,EAAK,SAAS,QAAQ,CACrC,IAAMe,EAAOf,EAAK,SAASc,CAAK,EAEhC,GACEC,GACAA,EAAK,OAAS,YACdA,EAAK,UACLA,EAAK,SAAS,CAAC,GACfA,EAAK,SAAS,CAAC,EAAE,OAAS,gBAC1B,CACAJ,EAAqB,GACrB,KACF,CACF,CACF,CACF,CAEIA,IACFL,EAASG,GAGXP,EAAM,cAAgBI,EACtB,IAAMU,EAAQd,EAAM,cAAcF,EAAMG,CAAI,EAC5C,OAAAD,EAAM,eAAiBI,EACvBJ,EAAM,cAAgBG,EACtBD,EAAK,EACEY,CACT,CC3FO,SAASC,GAAoBC,EAAO,CACzC,IAAMC,EAAQD,EAAM,QAAQ,gBAAkB,MAE9C,GAAIC,IAAU,OAASA,IAAU,OAASA,IAAU,QAClD,MAAM,IAAI,MACR,gCACEA,EACA,mEACJ,EAGF,OAAOA,CACT,CCLO,SAASC,GAASC,EAAMC,EAAQC,EAAOC,EAAM,CAClD,IAAMC,EAAiBC,GAAoBH,CAAK,EAC5CI,EAASJ,EAAM,eAAiBK,GAAYL,CAAK,EAGjDD,GAAUA,EAAO,OAAS,QAAUA,EAAO,UAC7CK,GACG,OAAOL,EAAO,OAAU,UAAYA,EAAO,MAAQ,GAChDA,EAAO,MACP,IACHC,EAAM,QAAQ,sBAAwB,GACnC,EACAD,EAAO,SAAS,QAAQD,CAAI,GAChCM,GAGJ,IAAIE,EAAOF,EAAO,OAAS,GAGzBF,IAAmB,OAClBA,IAAmB,UAChBH,GAAUA,EAAO,OAAS,QAAUA,EAAO,QAAWD,EAAK,WAE/DQ,EAAO,KAAK,KAAKA,EAAO,CAAC,EAAI,GAG/B,IAAMC,EAAUP,EAAM,cAAcC,CAAI,EACxCM,EAAQ,KAAKH,EAAS,IAAI,OAAOE,EAAOF,EAAO,MAAM,CAAC,EACtDG,EAAQ,MAAMD,CAAI,EAClB,IAAME,EAAOR,EAAM,MAAM,UAAU,EAC7BS,EAAQT,EAAM,YAClBA,EAAM,cAAcF,EAAMS,EAAQ,QAAQ,CAAC,EAC3CG,CACF,EACA,OAAAF,EAAK,EAEEC,EAGP,SAASC,EAAIC,EAAMC,EAAOC,EAAO,CAC/B,OAAID,GACMC,EAAQ,GAAK,IAAI,OAAOP,CAAI,GAAKK,GAGnCE,EAAQT,EAASA,EAAS,IAAI,OAAOE,EAAOF,EAAO,MAAM,GAAKO,CACxE,CACF,CCjDO,SAASG,GAAUC,EAAMC,EAAGC,EAAOC,EAAM,CAC9C,IAAMC,EAAOF,EAAM,MAAM,WAAW,EAC9BG,EAAUH,EAAM,MAAM,UAAU,EAChCI,EAAQJ,EAAM,kBAAkBF,EAAMG,CAAI,EAChD,OAAAE,EAAQ,EACRD,EAAK,EACEE,CACT,CCDO,IAAMC,GAGTC,GAAQ,CACN,QACA,SACA,WAEA,WACA,oBACA,QACA,iBACA,aAEA,aACA,OACA,gBAEA,oBAEA,oBACA,SACA,OAEA,eACF,CAAC,EC7BE,SAASC,GAAKC,EAAMC,EAAGC,EAAOC,EAAM,CAOzC,OALoBH,EAAK,SAAS,KAAK,SAAUI,EAAG,CAClD,OAAOC,GAASD,CAAC,CACnB,CAAC,EAE+BF,EAAM,kBAAoBA,EAAM,eAC/C,KAAKA,EAAOF,EAAMG,CAAI,CACzC,CCdO,SAASG,GAAYC,EAAO,CACjC,IAAMC,EAASD,EAAM,QAAQ,QAAU,IAEvC,GAAIC,IAAW,KAAOA,IAAW,IAC/B,MAAM,IAAI,MACR,iCACEA,EACA,8CACJ,EAGF,OAAOA,CACT,CCXAC,GAAO,KAAOC,GASP,SAASD,GAAOE,EAAMC,EAAGC,EAAOC,EAAM,CAC3C,IAAMC,EAASC,GAAYH,CAAK,EAC1BI,EAAOJ,EAAM,MAAM,QAAQ,EAC3BK,EAAUL,EAAM,cAAcC,CAAI,EAClCK,EAASD,EAAQ,KAAKH,EAASA,CAAM,EAEvCK,EAAUF,EAAQ,KACpBL,EAAM,kBAAkBF,EAAM,CAC5B,MAAOI,EACP,OAAAI,EACA,GAAGD,EAAQ,QAAQ,CACrB,CAAC,CACH,EACMG,EAAcD,EAAQ,WAAW,CAAC,EAClCE,EAAOC,GACXT,EAAK,OAAO,WAAWA,EAAK,OAAO,OAAS,CAAC,EAC7CO,EACAN,CACF,EAEIO,EAAK,SACPF,EAAUI,GAAyBH,CAAW,EAAID,EAAQ,MAAM,CAAC,GAGnE,IAAMK,EAAcL,EAAQ,WAAWA,EAAQ,OAAS,CAAC,EACnDM,EAAQH,GAAWT,EAAK,MAAM,WAAW,CAAC,EAAGW,EAAaV,CAAM,EAElEW,EAAM,SACRN,EAAUA,EAAQ,MAAM,EAAG,EAAE,EAAII,GAAyBC,CAAW,GAGvE,IAAME,EAAQT,EAAQ,KAAKH,EAASA,CAAM,EAE1C,OAAAE,EAAK,EAELJ,EAAM,+BAAiC,CACrC,MAAOa,EAAM,QACb,OAAQJ,EAAK,OACf,EACOH,EAASC,EAAUO,CAC5B,CAQA,SAASjB,GAAWE,EAAGgB,EAAIf,EAAO,CAChC,OAAOA,EAAM,QAAQ,QAAU,GACjC,CCxDO,SAASgB,GAAKC,EAAMC,EAAGC,EAAOC,EAAM,CACzC,OAAOD,EAAM,KAAKF,EAAK,MAAOG,CAAI,CACpC,CCNO,SAASC,GAAoBC,EAAO,CACzC,IAAMC,EAAaD,EAAM,QAAQ,gBAAkB,EAEnD,GAAIC,EAAa,EACf,MAAM,IAAI,MACR,2CACEA,EACA,sDACJ,EAGF,OAAOA,CACT,CCNO,SAASC,GAAcC,EAAGC,EAAIC,EAAO,CAC1C,IAAMC,GACJC,GAAUF,CAAK,GAAKA,EAAM,QAAQ,WAAa,IAAM,KACrD,OAAOG,GAAoBH,CAAK,CAAC,EAEnC,OAAOA,EAAM,QAAQ,WAAaC,EAAM,MAAM,EAAG,EAAE,EAAIA,CACzD,CCGO,IAAMG,GAAS,CACpB,WAAAC,GACA,MAAOC,GACP,KAAAC,GACA,WAAAC,GACA,SAAAC,GACA,UAAAH,GACA,QAAAI,GACA,KAAAC,GACA,MAAAC,GACA,eAAAC,GACA,WAAAC,GACA,KAAAC,GACA,cAAAC,GACA,KAAAC,GACA,SAAAC,GACA,UAAAC,GACA,KAAAC,GACA,OAAAC,GACA,KAAAC,GACA,cAAAC,EACF,ECpCO,IAAMC,GAAO,CAACC,EAAY,EAGjC,SAASA,GAAaC,EAAMC,EAAOC,EAAQC,EAAO,CAEhD,GACEF,EAAM,OAAS,QACfG,GAAqBH,EAAOE,CAAK,IAChCH,EAAK,OAAS,QACZA,EAAK,OAASC,EAAM,MAAQG,GAAqBJ,EAAMG,CAAK,GAE/D,MAAO,GAKT,GAAI,WAAYD,GAAU,OAAOA,EAAO,QAAW,UACjD,OACEF,EAAK,OAAS,cAEbA,EAAK,OAASC,EAAM,MACnBA,EAAM,OAAS,cAEdA,EAAM,OAAS,WAAaI,GAAsBJ,EAAOE,CAAK,GAEjE,OAGKD,EAAO,OAAS,EAAI,CAE/B,CC1BA,IAAMI,GAAoB,CACxB,WACA,qBACA,iBACA,YACA,aACA,iBACF,EAGaC,GAAS,CACpB,CAAC,UAAW,IAAM,MAAO,WAAY,YAAa,UAAU,EAC5D,CAAC,UAAW,IAAM,OAAQ,WAAY,YAAa,UAAU,EAC7D,CACE,UAAW,IACX,YAAa,CAAC,4BAA6B,qBAAqB,CAClE,EACA,CACE,UAAW,KACX,YAAa,CACX,4BACA,sBACA,4BACA,sBACA,qBACA,YACF,CACF,EACA,CACE,UAAW;AAAA,EACX,YAAa,CACX,4BACA,sBACA,4BACA,sBACA,qBACA,YACF,CACF,EACA,CAAC,UAAW,IAAK,MAAO,WAAY,YAAa,UAAU,EAC3D,CAAC,UAAW,IAAK,OAAQ,WAAY,YAAa,UAAU,EAC5D,CACE,UAAW,IACX,YAAa,CAAC,4BAA6B,qBAAqB,CAClE,EAGA,CACE,UAAW,IACX,MAAO,MACP,YAAa,WACb,eAAgBD,EAClB,EAEA,CAAC,UAAW,IAAK,YAAa,YAAY,EAE1C,CAAC,QAAS,GAAM,UAAW,GAAG,EAC9B,CAAC,UAAW,IAAK,YAAa,aAAc,MAAO;AAAA,KAAc,EAGjE,CAAC,UAAW,IAAK,MAAO,YAAa,YAAa,UAAU,EAE5D,CAAC,UAAW,IAAK,YAAa,iBAAiB,EAE/C,CAAC,UAAW,IAAK,YAAa,gBAAgB,EAE9C,CACE,OAAQ,MACR,UAAW,IACX,YAAa,WACb,eAAgBA,EAClB,EAGA,CAAC,QAAS,GAAM,OAAQ,OAAQ,UAAW,GAAG,EAC9C,CAAC,UAAW,IAAK,YAAa,gBAAgB,EAE9C,CAAC,QAAS,GAAM,UAAW,IAAK,MAAO;AAAA,IAAgB,EACvD,CAAC,UAAW,IAAK,YAAa,WAAY,eAAgBA,EAAiB,EAE3E,CAAC,QAAS,GAAM,UAAW,IAAK,MAAO;AAAA,GAAe,EAGtD,CAAC,QAAS,GAAM,UAAW,IAAK,MAAO;AAAA,IAAgB,EAEvD,CAAC,QAAS,GAAM,OAAQ,OAAQ,UAAW,IAAK,MAAO;AAAA,KAAiB,EAOxE,CAAC,QAAS,GAAM,UAAW,IAAK,MAAO,aAAa,EACpD,CACE,UAAW,IACX,MAAO,cACP,YAAa,WACb,eAAgBA,EAClB,EACA,CAAC,UAAW,IAAK,YAAa,oBAAoB,EAElD,CAAC,QAAS,GAAM,UAAW,GAAG,EAG9B,CAAC,QAAS,GAAM,UAAW,GAAG,EAC9B,CAAC,UAAW,IAAK,YAAa,oBAAoB,EAGlD,CAAC,QAAS,GAAM,UAAW,GAAG,EAC9B,CAAC,UAAW,IAAK,YAAa,WAAY,eAAgBA,EAAiB,EAC3E,CAAC,UAAW,IAAK,YAAa,CAAC,QAAS,WAAW,CAAC,EAIpD,CAAC,UAAW,KAAM,MAAO,WAAY,YAAa,UAAU,EAE5D,CAAC,UAAW,IAAK,YAAa,CAAC,QAAS,WAAW,CAAC,EAGpD,CAAC,QAAS,GAAM,UAAW,GAAG,EAC9B,CAAC,UAAW,IAAK,YAAa,WAAY,eAAgBA,EAAiB,EAG3E,CAAC,QAAS,GAAM,UAAW,GAAG,EAC9B,CACE,UAAW,IACX,YAAa,CAAC,4BAA6B,2BAA2B,CACxE,EACA,CAAC,UAAW,IAAK,YAAa,WAAY,eAAgBA,EAAiB,EAI3E,CAAC,QAAS,GAAM,UAAW,GAAG,CAChC,ECvHO,SAASE,GAAYC,EAAM,CAChC,OAAIA,EAAK,OAAS,CAACA,EAAK,WACfA,EAAK,OAAS,GAGhBC,GAAaD,EAAK,UAAU,CACrC,CCzBO,SAASE,GAAeC,EAAS,CACtC,GAAI,CAACA,EAAQ,UAAW,CACtB,IAAMC,GACHD,EAAQ,QAAU,kBAAoB,KACtCA,EAAQ,OAAS,MAAQA,EAAQ,OAAS,IAAM,IAEnDA,EAAQ,UAAY,IAAI,QACrBC,EAAS,IAAMA,EAAS,IAAM,KAC5B,sBAAsB,KAAKD,EAAQ,SAAS,EAAI,KAAO,IACxDA,EAAQ,WACPA,EAAQ,MAAQ,MAAQA,EAAQ,MAAQ,IAAM,IACjD,GACF,CACF,CAEA,OAAOA,EAAQ,SACjB,CCFO,SAASE,GAAkBC,EAAQC,EAAOC,EAAM,CACrD,IAAMC,EAAaF,EAAM,WACnBG,EAAWJ,EAAO,UAAY,CAAC,EAE/BK,EAAU,CAAC,EACbC,EAAQ,GACRC,EAASL,EAAK,OAEdM,EAEJL,EAAW,KAAK,EAAE,EAClB,IAAIM,EAAUR,EAAM,cAAcC,CAAI,EAEtC,KAAO,EAAEI,EAAQF,EAAS,QAAQ,CAChC,IAAMM,EAAQN,EAASE,CAAK,EAExBK,EAIJ,GAFAR,EAAWA,EAAW,OAAS,CAAC,EAAIG,EAEhCA,EAAQ,EAAIF,EAAS,OAAQ,CAG/B,IAAIQ,EAASX,EAAM,OAAO,SAASG,EAASE,EAAQ,CAAC,EAAE,IAAI,EAGvDM,GAAUA,EAAO,OAAMA,EAASA,EAAO,MAC3CD,EAAQC,EACJA,EAAOR,EAASE,EAAQ,CAAC,EAAGN,EAAQC,EAAO,CACzC,OAAQ,GACR,MAAO,GACP,GAAGQ,EAAQ,QAAQ,CACrB,CAAC,EAAE,OAAO,CAAC,EACX,EACN,MACEE,EAAQT,EAAK,MAUbG,EAAQ,OAAS,IAChBE,IAAW,MAAQA,IAAW;AAAA,IAC/BG,EAAM,OAAS,SAEfL,EAAQA,EAAQ,OAAS,CAAC,EAAIA,EAAQA,EAAQ,OAAS,CAAC,EAAE,QACxD,cACA,GACF,EACAE,EAAS,IAGTE,EAAUR,EAAM,cAAcC,CAAI,EAClCO,EAAQ,KAAKJ,EAAQ,KAAK,EAAE,CAAC,GAG/B,IAAIQ,EAAQZ,EAAM,OAAOS,EAAOV,EAAQC,EAAO,CAC7C,GAAGQ,EAAQ,QAAQ,EACnB,MAAAE,EACA,OAAAJ,CACF,CAAC,EAKGC,GAAeA,IAAgBK,EAAM,MAAM,EAAG,CAAC,IACjDA,EACEC,GAAyBN,EAAY,WAAW,CAAC,CAAC,EAAIK,EAAM,MAAM,CAAC,GAGvE,IAAME,EAAed,EAAM,+BAC3BA,EAAM,+BAAiC,OACvCO,EAAc,OAKVO,IAEAV,EAAQ,OAAS,GACjBU,EAAa,QACbR,IAAWF,EAAQA,EAAQ,OAAS,CAAC,EAAE,MAAM,EAAE,IAE/CA,EAAQA,EAAQ,OAAS,CAAC,EACxBA,EAAQA,EAAQ,OAAS,CAAC,EAAE,MAAM,EAAG,EAAE,EACvCS,GAAyBP,EAAO,WAAW,CAAC,CAAC,GAG7CQ,EAAa,QAAOP,EAAcG,IAGxCF,EAAQ,KAAKI,CAAK,EAClBR,EAAQ,KAAKQ,CAAK,EAClBN,EAASM,EAAM,MAAM,EAAE,CACzB,CAEA,OAAAV,EAAW,IAAI,EAERE,EAAQ,KAAK,EAAE,CACxB,CC7GO,SAASW,GAAcC,EAAQC,EAAOC,EAAM,CACjD,IAAMC,EAAaF,EAAM,WACnBG,EAAWJ,EAAO,UAAY,CAAC,EAC/BK,EAAUJ,EAAM,cAAcC,CAAI,EAElCI,EAAU,CAAC,EACbC,EAAQ,GAIZ,IAFAJ,EAAW,KAAK,EAAE,EAEX,EAAEI,EAAQH,EAAS,QAAQ,CAChC,IAAMI,EAAQJ,EAASG,CAAK,EAE5BJ,EAAWA,EAAW,OAAS,CAAC,EAAII,EAEpCD,EAAQ,KACND,EAAQ,KACNJ,EAAM,OAAOO,EAAOR,EAAQC,EAAO,CACjC,OAAQ;AAAA,EACR,MAAO;AAAA,EACP,GAAGI,EAAQ,QAAQ,CACrB,CAAC,CACH,CACF,EAEIG,EAAM,OAAS,SACjBP,EAAM,eAAiB,QAGrBM,EAAQH,EAAS,OAAS,GAC5BE,EAAQ,KACND,EAAQ,KAAKI,GAAQD,EAAOJ,EAASG,EAAQ,CAAC,EAAGP,EAAQC,CAAK,CAAC,CACjE,CAEJ,CAEA,OAAAE,EAAW,IAAI,EAERG,EAAQ,KAAK,EAAE,CACxB,CASA,SAASG,GAAQC,EAAMC,EAAOX,EAAQC,EAAO,CAC3C,IAAIM,EAAQN,EAAM,KAAK,OAEvB,KAAOM,KAAS,CACd,IAAMK,EAASX,EAAM,KAAKM,CAAK,EAAEG,EAAMC,EAAOX,EAAQC,CAAK,EAE3D,GAAIW,IAAW,IAAQA,IAAW,EAChC,MAGF,GAAI,OAAOA,GAAW,SACpB,MAAO;AAAA,EAAK,OAAO,EAAIA,CAAM,EAG/B,GAAIA,IAAW,GACb,MAAO;AAAA;AAAA;AAAA;AAAA,CAEX,CAEA,MAAO;AAAA;AAAA,CACT,CC/EA,IAAMC,GAAM,YAKL,SAASC,GAAYC,EAAOC,EAAK,CAEtC,IAAMC,EAAS,CAAC,EACZC,EAAQ,EACRC,EAAO,EAEPC,EAEJ,KAAQA,EAAQP,GAAI,KAAKE,CAAK,GAC5BM,EAAIN,EAAM,MAAMG,EAAOE,EAAM,KAAK,CAAC,EACnCH,EAAO,KAAKG,EAAM,CAAC,CAAC,EACpBF,EAAQE,EAAM,MAAQA,EAAM,CAAC,EAAE,OAC/BD,IAGF,OAAAE,EAAIN,EAAM,MAAMG,CAAK,CAAC,EAEfD,EAAO,KAAK,EAAE,EAKrB,SAASI,EAAIN,EAAO,CAClBE,EAAO,KAAKD,EAAID,EAAOI,EAAM,CAACJ,CAAK,CAAC,CACtC,CACF,CCFO,SAASO,GAAKC,EAAOC,EAAOC,EAAQ,CACzC,IAAMC,GAASD,EAAO,QAAU,KAAOD,GAAS,KAAOC,EAAO,OAAS,IAEjEE,EAAY,CAAC,EAEbC,EAAS,CAAC,EAEVC,EAAQ,CAAC,EACXC,EAAQ,GAEZ,KAAO,EAAEA,EAAQP,EAAM,OAAO,QAAQ,CACpC,IAAMQ,EAAUR,EAAM,OAAOO,CAAK,EAElC,GAAI,CAACE,GAAeT,EAAM,MAAOQ,CAAO,EACtC,SAGF,IAAME,EAAaV,EAAM,eAAeQ,CAAO,EAE3CG,EAEJ,KAAQA,EAAQD,EAAW,KAAKP,CAAK,GAAI,CACvC,IAAMS,EAAS,WAAYJ,GAAW,EAAQA,EAAQ,QAChDK,EAAQ,UAAWL,EACnBM,EAAWH,EAAM,OAASC,EAASD,EAAM,CAAC,EAAE,OAAS,GAEvDP,EAAU,SAASU,CAAQ,GACzBR,EAAMQ,CAAQ,EAAE,QAAU,CAACF,IAC7BN,EAAMQ,CAAQ,EAAE,OAAS,IAGvBR,EAAMQ,CAAQ,EAAE,OAAS,CAACD,IAC5BP,EAAMQ,CAAQ,EAAE,MAAQ,MAG1BV,EAAU,KAAKU,CAAQ,EACvBR,EAAMQ,CAAQ,EAAI,CAAC,OAAAF,EAAQ,MAAAC,CAAK,EAEpC,CACF,CAEAT,EAAU,KAAKW,EAAS,EAExB,IAAIC,EAAQd,EAAO,OAASA,EAAO,OAAO,OAAS,EAC7Ce,EAAMd,EAAM,QAAUD,EAAO,MAAQA,EAAO,MAAM,OAAS,GAGjE,IAFAK,EAAQ,GAED,EAAEA,EAAQH,EAAU,QAAQ,CACjC,IAAMU,EAAWV,EAAUG,CAAK,EAG5BO,EAAWE,GAASF,GAAYG,GAQjCH,EAAW,EAAIG,GACdb,EAAUG,EAAQ,CAAC,IAAMO,EAAW,GACpCR,EAAMQ,CAAQ,EAAE,OAChB,CAACR,EAAMQ,EAAW,CAAC,EAAE,QACrB,CAACR,EAAMQ,EAAW,CAAC,EAAE,OACtBV,EAAUG,EAAQ,CAAC,IAAMO,EAAW,GACnCR,EAAMQ,CAAQ,EAAE,QAChB,CAACR,EAAMQ,EAAW,CAAC,EAAE,QACrB,CAACR,EAAMQ,EAAW,CAAC,EAAE,QAKrBE,IAAUF,GAIZT,EAAO,KAAKa,GAAkBf,EAAM,MAAMa,EAAOF,CAAQ,EAAG,IAAI,CAAC,EAGnEE,EAAQF,EAGN,iBAAiB,KAAKX,EAAM,OAAOW,CAAQ,CAAC,IAC3C,CAACZ,EAAO,QAAU,CAACA,EAAO,OAAO,SAASC,EAAM,OAAOW,CAAQ,CAAC,GAGjET,EAAO,KAAK,IAAI,GAGhBA,EAAO,KAAKc,GAAyBhB,EAAM,WAAWW,CAAQ,CAAC,CAAC,EAChEE,KAEJ,CAEA,OAAAX,EAAO,KAAKa,GAAkBf,EAAM,MAAMa,EAAOC,CAAG,EAAGf,EAAO,KAAK,CAAC,EAE7DG,EAAO,KAAK,EAAE,CACvB,CAOA,SAASU,GAAUK,EAAGC,EAAG,CACvB,OAAOD,EAAIC,CACb,CAOA,SAASH,GAAkBf,EAAOU,EAAO,CACvC,IAAMH,EAAa,wBAEbN,EAAY,CAAC,EAEbkB,EAAU,CAAC,EACXC,EAAQpB,EAAQU,EAClBN,EAAQ,GACRS,EAAQ,EAERL,EAEJ,KAAQA,EAAQD,EAAW,KAAKa,CAAK,GACnCnB,EAAU,KAAKO,EAAM,KAAK,EAG5B,KAAO,EAAEJ,EAAQH,EAAU,QACrBY,IAAUZ,EAAUG,CAAK,GAC3Be,EAAQ,KAAKnB,EAAM,MAAMa,EAAOZ,EAAUG,CAAK,CAAC,CAAC,EAGnDe,EAAQ,KAAK,IAAI,EACjBN,EAAQZ,EAAUG,CAAK,EAGzB,OAAAe,EAAQ,KAAKnB,EAAM,MAAMa,CAAK,CAAC,EAExBM,EAAQ,KAAK,EAAE,CACxB,CCpKO,SAASE,GAAMC,EAAQ,CAI5B,IAAMC,EAAUD,GAAU,CAAC,EACrBE,EAAMD,EAAQ,KAAO,CAAC,EACxBE,EAAYF,EAAQ,WAAa,EACjCG,EAAOF,EAAI,MAAQ,EACnBG,EAASH,EAAI,QAAU,EAE3B,MAAO,CAAC,KAAAI,EAAM,QAAAC,EAAS,MAAAC,CAAK,EAO5B,SAASD,GAAU,CACjB,MAAO,CAAC,IAAK,CAAC,KAAAH,EAAM,OAAAC,CAAM,EAAG,UAAAF,CAAS,CACxC,CAOA,SAASK,EAAMC,EAAO,CACpBN,GAAaM,CACf,CAOA,SAASH,EAAKI,EAAO,CAEnB,IAAMD,EAAQC,GAAS,GACjBC,EAASF,EAAM,MAAM,WAAW,EAChCG,EAAOD,EAAOA,EAAO,OAAS,CAAC,EACrC,OAAAP,GAAQO,EAAO,OAAS,EACxBN,EACEM,EAAO,SAAW,EAAIN,EAASO,EAAK,OAAS,EAAIA,EAAK,OAAST,EAC1DM,CACT,CACF,CCzBO,SAASI,GAAWC,EAAMC,EAAS,CACxC,IAAMC,EAAWD,GAAW,CAAC,EAEvBE,EAAQ,CACZ,cAAeC,GACf,kBAAmBC,GACnB,cAAeC,GACf,cAAeC,GACf,eAAAC,GACA,MAAAC,EAGA,SAAU,CAAC,GAAGC,EAAQ,EAEtB,OAAQ,OACR,YAAAC,GACA,WAAY,CAAC,EACb,KAAM,CAAC,GAAGC,EAAI,EACd,QAAS,CAAC,EACV,KAAMC,GACN,MAAO,CAAC,EACR,OAAQ,CAAC,GAAGC,EAAM,CACpB,EAEAC,GAAUZ,EAAOD,CAAQ,EAErBC,EAAM,QAAQ,kBAChBA,EAAM,KAAK,KAAKa,EAAc,EAGhCb,EAAM,OAASc,GAAO,OAAQ,CAC5B,QAAAC,GACA,QAAAC,GACA,SAAUhB,EAAM,QAClB,CAAC,EAED,IAAIiB,EAASjB,EAAM,OAAOH,EAAM,OAAWG,EAAO,CAChD,OAAQ;AAAA,EACR,MAAO;AAAA,EACP,IAAK,CAAC,KAAM,EAAG,OAAQ,CAAC,EACxB,UAAW,CACb,CAAC,EAED,OACEiB,GACAA,EAAO,WAAWA,EAAO,OAAS,CAAC,IAAM,IACzCA,EAAO,WAAWA,EAAO,OAAS,CAAC,IAAM,KAEzCA,GAAU;AAAA,GAGLA,EAGP,SAASX,EAAMY,EAAM,CACnB,OAAAlB,EAAM,MAAM,KAAKkB,CAAI,EACdC,EAKP,SAASA,GAAO,CACdnB,EAAM,MAAM,IAAI,CAClB,CACF,CACF,CAMA,SAASe,GAAQK,EAAO,CACtB,MAAM,IAAI,MAAM,wBAA0BA,EAAQ,kBAAkB,CACtE,CAMA,SAASJ,GAAQI,EAAO,CAEtB,IAAMC,EAA6BD,EACnC,MAAM,IAAI,MAAM,+BAAiCC,EAAK,KAAO,GAAG,CAClE,CAGA,SAASR,GAAeS,EAAMC,EAAO,CAEnC,GAAID,EAAK,OAAS,cAAgBA,EAAK,OAASC,EAAM,KACpD,MAAO,EAEX,CAgBA,SAASrB,GAAuBsB,EAAQC,EAAM,CAC5C,OAAOC,GAAkBF,EAAQ,KAAMC,CAAI,CAC7C,CAiBA,SAAStB,GAAmBqB,EAAQC,EAAM,CACxC,OAAOE,GAAcH,EAAQ,KAAMC,CAAI,CACzC,CA2BA,SAASf,GAAUU,EAAOQ,EAAQ,CAChC,OAAOC,GAAK,KAAMT,EAAOQ,CAAM,CACjC,CCrKe,SAARE,GAAiCC,EAAS,CAG/C,IAAMC,EAAO,KAEbA,EAAK,SAAWC,EAKhB,SAASA,EAASC,EAAM,CACtB,OAAOC,GAAWD,EAAM,CACtB,GAAGF,EAAK,KAAK,UAAU,EACvB,GAAGD,EAIH,WAAYC,EAAK,KAAK,sBAAsB,GAAK,CAAC,CACpD,CAAC,CACH,CACF,CClCO,SAASI,GAAKC,EAAO,CAC1B,GAAIA,EACF,MAAMA,CAEV,CCkVA,IAAAC,GAAmB,WC7VJ,SAARC,GAA+BC,EAAO,CAC5C,GAAI,OAAOA,GAAU,UAAYA,IAAU,KAC1C,MAAO,GAGR,IAAMC,EAAY,OAAO,eAAeD,CAAK,EAC7C,OAAQC,IAAc,MAAQA,IAAc,OAAO,WAAa,OAAO,eAAeA,CAAS,IAAM,OAAS,EAAE,OAAO,eAAeD,IAAU,EAAE,OAAO,YAAYA,EACtK,CC+BO,SAASE,IAAS,CAEvB,IAAMC,EAAM,CAAC,EAEPC,EAAW,CAAC,IAAAC,EAAK,IAAAC,CAAG,EAE1B,OAAOF,EAGP,SAASC,KAAOE,EAAQ,CACtB,IAAIC,EAAkB,GAEhBC,EAAWF,EAAO,IAAI,EAE5B,GAAI,OAAOE,GAAa,WACtB,MAAM,IAAI,UAAU,2CAA6CA,CAAQ,EAG3EC,EAAK,KAAM,GAAGH,CAAM,EAQpB,SAASG,EAAKC,KAAUC,EAAQ,CAC9B,IAAMC,EAAKV,EAAI,EAAEK,CAAe,EAC5BM,EAAQ,GAEZ,GAAIH,EAAO,CACTF,EAASE,CAAK,EACd,MACF,CAGA,KAAO,EAAEG,EAAQP,EAAO,SAClBK,EAAOE,CAAK,IAAM,MAAQF,EAAOE,CAAK,IAAM,UAC9CF,EAAOE,CAAK,EAAIP,EAAOO,CAAK,GAKhCP,EAASK,EAGLC,EACFE,GAAKF,EAAIH,CAAI,EAAE,GAAGE,CAAM,EAExBH,EAAS,KAAM,GAAGG,CAAM,CAE5B,CACF,CAGA,SAASN,EAAIU,EAAY,CACvB,GAAI,OAAOA,GAAe,WACxB,MAAM,IAAI,UACR,+CAAiDA,CACnD,EAGF,OAAAb,EAAI,KAAKa,CAAU,EACZZ,CACT,CACF,CAkCO,SAASW,GAAKE,EAAYR,EAAU,CAEzC,IAAIS,EAEJ,OAAOC,EAQP,SAASA,KAAWC,EAAY,CAC9B,IAAMC,EAAoBJ,EAAW,OAASG,EAAW,OAErDE,EAEAD,GACFD,EAAW,KAAKG,CAAI,EAGtB,GAAI,CACFD,EAASL,EAAW,MAAM,KAAMG,CAAU,CAC5C,OAAST,EAAO,CACd,IAAMa,EAAkCb,EAMxC,GAAIU,GAAqBH,EACvB,MAAMM,EAGR,OAAOD,EAAKC,CAAS,CACvB,CAEKH,IACCC,GAAUA,EAAO,MAAQ,OAAOA,EAAO,MAAS,WAClDA,EAAO,KAAKG,EAAMF,CAAI,EACbD,aAAkB,MAC3BC,EAAKD,CAAM,EAEXG,EAAKH,CAAM,EAGjB,CAOA,SAASC,EAAKZ,KAAUC,EAAQ,CACzBM,IACHA,EAAS,GACTT,EAASE,EAAO,GAAGC,CAAM,EAE7B,CAOA,SAASa,EAAKC,EAAO,CACnBH,EAAK,KAAMG,CAAK,CAClB,CACF,CCnLO,IAAMC,EAAN,cAA2B,KAAM,CAwDtC,YAAYC,EAAeC,EAAwBC,EAAQ,CACzD,MAAM,EAEF,OAAOD,GAA2B,WACpCC,EAASD,EACTA,EAAyB,QAI3B,IAAIE,EAAS,GAETC,EAAU,CAAC,EACXC,EAAc,GAwClB,GAtCIJ,IAGA,SAAUA,GACV,WAAYA,EAEZG,EAAU,CAAC,MAAOH,CAAsB,EAIxC,UAAWA,GACX,QAASA,EAETG,EAAU,CAAC,MAAOH,CAAsB,EAGjC,SAAUA,EACjBG,EAAU,CACR,UAAW,CAACH,CAAsB,EAClC,MAAOA,EAAuB,QAChC,EAIAG,EAAU,CAAC,GAAGH,CAAsB,GAIpC,OAAOD,GAAkB,SAC3BG,EAASH,EAGF,CAACI,EAAQ,OAASJ,IACzBK,EAAc,GACdF,EAASH,EAAc,QACvBI,EAAQ,MAAQJ,GAGd,CAACI,EAAQ,QAAU,CAACA,EAAQ,QAAU,OAAOF,GAAW,SAAU,CACpE,IAAMI,EAAQJ,EAAO,QAAQ,GAAG,EAE5BI,IAAU,GACZF,EAAQ,OAASF,GAEjBE,EAAQ,OAASF,EAAO,MAAM,EAAGI,CAAK,EACtCF,EAAQ,OAASF,EAAO,MAAMI,EAAQ,CAAC,EAE3C,CAEA,GAAI,CAACF,EAAQ,OAASA,EAAQ,WAAaA,EAAQ,UAAW,CAC5D,IAAMG,EAASH,EAAQ,UAAUA,EAAQ,UAAU,OAAS,CAAC,EAEzDG,IACFH,EAAQ,MAAQG,EAAO,SAE3B,CAEA,IAAMC,EACJJ,EAAQ,OAAS,UAAWA,EAAQ,MAChCA,EAAQ,MAAM,MACdA,EAAQ,MAOd,KAAK,UAAYA,EAAQ,WAAa,OAOtC,KAAK,MAAQA,EAAQ,OAAS,OAO9B,KAAK,OAASI,EAAQA,EAAM,OAAS,OAWrC,KAAK,MAAQ,OAOb,KAAK,KAAO,GAQZ,KAAK,QAAUL,EAOf,KAAK,KAAOK,EAAQA,EAAM,KAAO,OASjC,KAAK,KAAOC,GAAkBL,EAAQ,KAAK,GAAK,MAOhD,KAAK,MAAQA,EAAQ,OAAS,OAO9B,KAAK,OAAS,KAAK,QAOnB,KAAK,OAASA,EAAQ,QAAU,OAOhC,KAAK,OAASA,EAAQ,QAAU,OAWhC,KAAK,MACHC,GAAeD,EAAQ,OAAS,OAAOA,EAAQ,MAAM,OAAU,SAC3DA,EAAQ,MAAM,MACd,GAYN,KAAK,OAAS,OAOd,KAAK,SAAW,OAOhB,KAAK,KAAO,OAUZ,KAAK,IAAM,MACb,CACF,EAEAL,EAAa,UAAU,KAAO,GAC9BA,EAAa,UAAU,KAAO,GAC9BA,EAAa,UAAU,OAAS,GAChCA,EAAa,UAAU,QAAU,GACjCA,EAAa,UAAU,MAAQ,GAC/BA,EAAa,UAAU,OAAS,OAChCA,EAAa,UAAU,KAAO,OAC9BA,EAAa,UAAU,UAAY,OACnCA,EAAa,UAAU,MAAQ,OAC/BA,EAAa,UAAU,MAAQ,OAC/BA,EAAa,UAAU,MAAQ,OAC/BA,EAAa,UAAU,OAAS,OAChCA,EAAa,UAAU,OAAS,OCtQzB,IAAMW,GAAU,CAAC,SAAAC,GAAU,QAAAC,GAAS,QAAAC,GAAS,KAAAC,GAAM,IAAK,GAAG,EAclE,SAASH,GAASI,EAAMF,EAAS,CAC/B,GAAIA,IAAY,QAAa,OAAOA,GAAY,SAC9C,MAAM,IAAI,UAAU,iCAAiC,EAGvDG,GAAWD,CAAI,EACf,IAAIE,EAAQ,EACRC,EAAM,GACNC,EAAQJ,EAAK,OAEbK,EAEJ,GACEP,IAAY,QACZA,EAAQ,SAAW,GACnBA,EAAQ,OAASE,EAAK,OACtB,CACA,KAAOI,KACL,GAAIJ,EAAK,YAAYI,CAAK,IAAM,IAG9B,GAAIC,EAAc,CAChBH,EAAQE,EAAQ,EAChB,KACF,OACSD,EAAM,IAGfE,EAAe,GACfF,EAAMC,EAAQ,GAIlB,OAAOD,EAAM,EAAI,GAAKH,EAAK,MAAME,EAAOC,CAAG,CAC7C,CAEA,GAAIL,IAAYE,EACd,MAAO,GAGT,IAAIM,EAAmB,GACnBC,EAAeT,EAAQ,OAAS,EAEpC,KAAOM,KACL,GAAIJ,EAAK,YAAYI,CAAK,IAAM,IAG9B,GAAIC,EAAc,CAChBH,EAAQE,EAAQ,EAChB,KACF,OAEIE,EAAmB,IAGrBD,EAAe,GACfC,EAAmBF,EAAQ,GAGzBG,EAAe,KAEbP,EAAK,YAAYI,CAAK,IAAMN,EAAQ,YAAYS,GAAc,EAC5DA,EAAe,IAGjBJ,EAAMC,IAKRG,EAAe,GACfJ,EAAMG,IAMd,OAAIJ,IAAUC,EACZA,EAAMG,EACGH,EAAM,IACfA,EAAMH,EAAK,QAGNA,EAAK,MAAME,EAAOC,CAAG,CAC9B,CAUA,SAASN,GAAQG,EAAM,CAGrB,GAFAC,GAAWD,CAAI,EAEXA,EAAK,SAAW,EAClB,MAAO,IAGT,IAAIG,EAAM,GACNC,EAAQJ,EAAK,OAEbQ,EAGJ,KAAO,EAAEJ,GACP,GAAIJ,EAAK,YAAYI,CAAK,IAAM,IAC9B,GAAII,EAAgB,CAClBL,EAAMC,EACN,KACF,OACUI,IAEVA,EAAiB,IAIrB,OAAOL,EAAM,EACTH,EAAK,YAAY,CAAC,IAAM,GACtB,IACA,IACFG,IAAQ,GAAKH,EAAK,YAAY,CAAC,IAAM,GACnC,KACAA,EAAK,MAAM,EAAGG,CAAG,CACzB,CAUA,SAASL,GAAQE,EAAM,CACrBC,GAAWD,CAAI,EAEf,IAAII,EAAQJ,EAAK,OAEbG,EAAM,GACNM,EAAY,EACZC,EAAW,GAGXC,EAAc,EAEdH,EAEJ,KAAOJ,KAAS,CACd,IAAMQ,EAAOZ,EAAK,YAAYI,CAAK,EAEnC,GAAIQ,IAAS,GAAc,CAGzB,GAAIJ,EAAgB,CAClBC,EAAYL,EAAQ,EACpB,KACF,CAEA,QACF,CAEID,EAAM,IAGRK,EAAiB,GACjBL,EAAMC,EAAQ,GAGZQ,IAAS,GAEPF,EAAW,EACbA,EAAWN,EACFO,IAAgB,IACzBA,EAAc,GAEPD,EAAW,KAGpBC,EAAc,GAElB,CAEA,OACED,EAAW,GACXP,EAAM,GAENQ,IAAgB,GAEfA,IAAgB,GAAKD,IAAaP,EAAM,GAAKO,IAAaD,EAAY,EAEhE,GAGFT,EAAK,MAAMU,EAAUP,CAAG,CACjC,CAUA,SAASJ,MAAQc,EAAU,CACzB,IAAIT,EAAQ,GAERU,EAEJ,KAAO,EAAEV,EAAQS,EAAS,QACxBZ,GAAWY,EAAST,CAAK,CAAC,EAEtBS,EAAST,CAAK,IAChBU,EACEA,IAAW,OAAYD,EAAST,CAAK,EAAIU,EAAS,IAAMD,EAAST,CAAK,GAI5E,OAAOU,IAAW,OAAY,IAAMC,GAAUD,CAAM,CACtD,CAYA,SAASC,GAAUf,EAAM,CACvBC,GAAWD,CAAI,EAEf,IAAMgB,EAAWhB,EAAK,YAAY,CAAC,IAAM,GAGrCiB,EAAQC,GAAgBlB,EAAM,CAACgB,CAAQ,EAE3C,OAAIC,EAAM,SAAW,GAAK,CAACD,IACzBC,EAAQ,KAGNA,EAAM,OAAS,GAAKjB,EAAK,YAAYA,EAAK,OAAS,CAAC,IAAM,KAC5DiB,GAAS,KAGJD,EAAW,IAAMC,EAAQA,CAClC,CAYA,SAASC,GAAgBlB,EAAMmB,EAAgB,CAC7C,IAAIC,EAAS,GACTC,EAAoB,EACpBC,EAAY,GACZC,EAAO,EACPnB,EAAQ,GAERQ,EAEAY,EAEJ,KAAO,EAAEpB,GAASJ,EAAK,QAAQ,CAC7B,GAAII,EAAQJ,EAAK,OACfY,EAAOZ,EAAK,YAAYI,CAAK,MACxB,IAAIQ,IAAS,GAClB,MAEAA,EAAO,GAGT,GAAIA,IAAS,GAAc,CACzB,GAAI,EAAAU,IAAclB,EAAQ,GAAKmB,IAAS,GAEjC,GAAID,IAAclB,EAAQ,GAAKmB,IAAS,EAAG,CAChD,GACEH,EAAO,OAAS,GAChBC,IAAsB,GACtBD,EAAO,YAAYA,EAAO,OAAS,CAAC,IAAM,IAC1CA,EAAO,YAAYA,EAAO,OAAS,CAAC,IAAM,IAE1C,GAAIA,EAAO,OAAS,GAGlB,GAFAI,EAAiBJ,EAAO,YAAY,GAAG,EAEnCI,IAAmBJ,EAAO,OAAS,EAAG,CACpCI,EAAiB,GACnBJ,EAAS,GACTC,EAAoB,IAEpBD,EAASA,EAAO,MAAM,EAAGI,CAAc,EACvCH,EAAoBD,EAAO,OAAS,EAAIA,EAAO,YAAY,GAAG,GAGhEE,EAAYlB,EACZmB,EAAO,EACP,QACF,UACSH,EAAO,OAAS,EAAG,CAC5BA,EAAS,GACTC,EAAoB,EACpBC,EAAYlB,EACZmB,EAAO,EACP,QACF,EAGEJ,IACFC,EAASA,EAAO,OAAS,EAAIA,EAAS,MAAQ,KAC9CC,EAAoB,EAExB,MACMD,EAAO,OAAS,EAClBA,GAAU,IAAMpB,EAAK,MAAMsB,EAAY,EAAGlB,CAAK,EAE/CgB,EAASpB,EAAK,MAAMsB,EAAY,EAAGlB,CAAK,EAG1CiB,EAAoBjB,EAAQkB,EAAY,EAG1CA,EAAYlB,EACZmB,EAAO,CACT,MAAWX,IAAS,IAAgBW,EAAO,GACzCA,IAEAA,EAAO,EAEX,CAEA,OAAOH,CACT,CAUA,SAASnB,GAAWD,EAAM,CACxB,GAAI,OAAOA,GAAS,SAClB,MAAM,IAAI,UACR,mCAAqC,KAAK,UAAUA,CAAI,CAC1D,CAEJ,CCpaO,IAAMyB,GAAU,CAAC,IAAAC,EAAG,EAE3B,SAASA,IAAM,CACb,MAAO,GACT,CCYO,SAASC,GAAMC,EAAe,CACnC,MAAO,GACLA,IAAkB,MAChB,OAAOA,GAAkB,UACzB,SAAUA,GACVA,EAAc,MACd,aAAcA,GACdA,EAAc,UAEdA,EAAc,OAAS,OAE7B,CClBO,SAASC,GAAUC,EAAM,CAC9B,GAAI,OAAOA,GAAS,SAClBA,EAAO,IAAI,IAAIA,CAAI,UACV,CAACC,GAAMD,CAAI,EAAG,CAEvB,IAAME,EAAQ,IAAI,UAChB,+EACEF,EACA,GACJ,EACA,MAAAE,EAAM,KAAO,uBACPA,CACR,CAEA,GAAIF,EAAK,WAAa,QAAS,CAE7B,IAAME,EAAQ,IAAI,UAAU,gCAAgC,EAC5D,MAAAA,EAAM,KAAO,yBACPA,CACR,CAEA,OAAOC,GAAoBH,CAAI,CACjC,CAUA,SAASG,GAAoBC,EAAK,CAChC,GAAIA,EAAI,WAAa,GAAI,CAEvB,IAAMF,EAAQ,IAAI,UAChB,sDACF,EACA,MAAAA,EAAM,KAAO,4BACPA,CACR,CAEA,IAAMG,EAAWD,EAAI,SACjBE,EAAQ,GAEZ,KAAO,EAAEA,EAAQD,EAAS,QACxB,GACEA,EAAS,YAAYC,CAAK,IAAM,IAChCD,EAAS,YAAYC,EAAQ,CAAC,IAAM,GACpC,CACA,IAAMC,EAAQF,EAAS,YAAYC,EAAQ,CAAC,EAC5C,GAAIC,IAAU,IAAgBA,IAAU,IAAe,CAErD,IAAML,EAAQ,IAAI,UAChB,qDACF,EACA,MAAAA,EAAM,KAAO,4BACPA,CACR,CACF,CAGF,OAAO,mBAAmBG,CAAQ,CACpC,CCvDA,IAAMG,GAA8B,CAClC,UACA,OACA,WACA,OACA,UACA,SACF,EAEaC,GAAN,KAAY,CAuBjB,YAAYC,EAAO,CAEjB,IAAIC,EAECD,EAEME,GAAMF,CAAK,EACpBC,EAAU,CAAC,KAAMD,CAAK,EACb,OAAOA,GAAU,UAAYG,GAAaH,CAAK,EACxDC,EAAU,CAAC,MAAAD,CAAK,EAEhBC,EAAUD,EANVC,EAAU,CAAC,EAkBb,KAAK,IAAM,QAASA,EAAU,GAAKG,GAAQ,IAAI,EAU/C,KAAK,KAAO,CAAC,EASb,KAAK,QAAU,CAAC,EAOhB,KAAK,SAAW,CAAC,EAOjB,KAAK,MAYL,KAAK,IAUL,KAAK,OASL,KAAK,OAIL,IAAIC,EAAQ,GAEZ,KAAO,EAAEA,EAAQP,GAAM,QAAQ,CAC7B,IAAMQ,EAAQR,GAAMO,CAAK,EAKvBC,KAASL,GACTA,EAAQK,CAAK,IAAM,QACnBL,EAAQK,CAAK,IAAM,OAGnB,KAAKA,CAAK,EAAIA,IAAU,UAAY,CAAC,GAAGL,EAAQK,CAAK,CAAC,EAAIL,EAAQK,CAAK,EAE3E,CAGA,IAAIA,EAGJ,IAAKA,KAASL,EAEPH,GAAM,SAASQ,CAAK,IAEvB,KAAKA,CAAK,EAAIL,EAAQK,CAAK,EAGjC,CAQA,IAAI,UAAW,CACb,OAAO,OAAO,KAAK,MAAS,SACxBC,GAAQ,SAAS,KAAK,IAAI,EAC1B,MACN,CAcA,IAAI,SAASC,EAAU,CACrBC,GAAeD,EAAU,UAAU,EACnCE,GAAWF,EAAU,UAAU,EAC/B,KAAK,KAAOD,GAAQ,KAAK,KAAK,SAAW,GAAIC,CAAQ,CACvD,CAQA,IAAI,SAAU,CACZ,OAAO,OAAO,KAAK,MAAS,SACxBD,GAAQ,QAAQ,KAAK,IAAI,EACzB,MACN,CAYA,IAAI,QAAQI,EAAS,CACnBC,GAAW,KAAK,SAAU,SAAS,EACnC,KAAK,KAAOL,GAAQ,KAAKI,GAAW,GAAI,KAAK,QAAQ,CACvD,CAQA,IAAI,SAAU,CACZ,OAAO,OAAO,KAAK,MAAS,SACxBJ,GAAQ,QAAQ,KAAK,IAAI,EACzB,MACN,CAcA,IAAI,QAAQM,EAAS,CAInB,GAHAH,GAAWG,EAAS,SAAS,EAC7BD,GAAW,KAAK,QAAS,SAAS,EAE9BC,EAAS,CACX,GAAIA,EAAQ,YAAY,CAAC,IAAM,GAC7B,MAAM,IAAI,MAAM,+BAA+B,EAGjD,GAAIA,EAAQ,SAAS,IAAK,CAAC,EACzB,MAAM,IAAI,MAAM,wCAAwC,CAE5D,CAEA,KAAK,KAAON,GAAQ,KAAK,KAAK,QAAS,KAAK,MAAQM,GAAW,GAAG,CACpE,CAQA,IAAI,MAAO,CACT,OAAO,KAAK,QAAQ,KAAK,QAAQ,OAAS,CAAC,CAC7C,CAcA,IAAI,KAAKC,EAAM,CACTZ,GAAMY,CAAI,IACZA,EAAOC,GAAUD,CAAI,GAGvBL,GAAeK,EAAM,MAAM,EAEvB,KAAK,OAASA,GAChB,KAAK,QAAQ,KAAKA,CAAI,CAE1B,CAQA,IAAI,MAAO,CACT,OAAO,OAAO,KAAK,MAAS,SACxBP,GAAQ,SAAS,KAAK,KAAM,KAAK,OAAO,EACxC,MACN,CAcA,IAAI,KAAKS,EAAM,CACbP,GAAeO,EAAM,MAAM,EAC3BN,GAAWM,EAAM,MAAM,EACvB,KAAK,KAAOT,GAAQ,KAAK,KAAK,SAAW,GAAIS,GAAQ,KAAK,SAAW,GAAG,CAC1E,CA+DA,KAAKC,EAAeC,EAAwBC,EAAQ,CAElD,IAAMC,EAAU,KAAK,QAAQH,EAAeC,EAAwBC,CAAM,EAE1E,MAAAC,EAAQ,MAAQ,GAEVA,CACR,CA4DA,KAAKH,EAAeC,EAAwBC,EAAQ,CAElD,IAAMC,EAAU,KAAK,QAAQH,EAAeC,EAAwBC,CAAM,EAE1E,OAAAC,EAAQ,MAAQ,OAETA,CACT,CA4DA,QAAQH,EAAeC,EAAwBC,EAAQ,CACrD,IAAMC,EAAU,IAAIC,EAElBJ,EACAC,EACAC,CACF,EAEA,OAAI,KAAK,OACPC,EAAQ,KAAO,KAAK,KAAO,IAAMA,EAAQ,KACzCA,EAAQ,KAAO,KAAK,MAGtBA,EAAQ,MAAQ,GAEhB,KAAK,SAAS,KAAKA,CAAO,EAEnBA,CACT,CAeA,SAASE,EAAU,CACjB,OAAI,KAAK,QAAU,OACV,GAGL,OAAO,KAAK,OAAU,SACjB,KAAK,MAGE,IAAI,YAAYA,GAAY,MAAS,EACtC,OAAO,KAAK,KAAK,CAClC,CACF,EAYA,SAASZ,GAAWa,EAAMC,EAAM,CAC9B,GAAID,GAAQA,EAAK,SAAShB,GAAQ,GAAG,EACnC,MAAM,IAAI,MACR,IAAMiB,EAAO,uCAAyCjB,GAAQ,IAAM,GACtE,CAEJ,CAYA,SAASE,GAAec,EAAMC,EAAM,CAClC,GAAI,CAACD,EACH,MAAM,IAAI,MAAM,IAAMC,EAAO,mBAAmB,CAEpD,CAYA,SAASZ,GAAWE,EAAMU,EAAM,CAC9B,GAAI,CAACV,EACH,MAAM,IAAI,MAAM,YAAcU,EAAO,iCAAiC,CAE1E,CAUA,SAASrB,GAAaH,EAAO,CAC3B,MAAO,GACLA,GACE,OAAOA,GAAU,UACjB,eAAgBA,GAChB,eAAgBA,EAEtB,CCloBO,IAAMyB,GAYP,SAAUC,EAAU,CAGlB,IAAMC,EAFO,KACO,YAIX,UAEHC,EAAQD,EAAMD,CAAQ,EAEtBG,EAAQ,UAAY,CACxB,OAAOD,EAAM,MAAMC,EAAO,SAAS,CACrC,EAEA,cAAO,eAAeA,EAAOF,CAAK,EAc3BE,CACT,ETiUN,IAAMC,GAAM,CAAC,EAAE,eAeFC,GAAN,MAAMC,UAAkBC,EAAiB,CAI9C,aAAc,CAEZ,MAAM,MAAM,EAeZ,KAAK,SAAW,OAYhB,KAAK,OAAS,OAad,KAAK,UAAY,CAAC,EAalB,KAAK,SAAW,OAShB,KAAK,YAAc,GASnB,KAAK,OAAS,OASd,KAAK,UAAY,CAAC,EAUlB,KAAK,OAAS,OASd,KAAK,aAAeC,GAAO,CAC7B,CAaA,MAAO,CAEL,IAAMC,EAEF,IAAIH,EAEJI,EAAQ,GAEZ,KAAO,EAAEA,EAAQ,KAAK,UAAU,QAAQ,CACtC,IAAMC,EAAW,KAAK,UAAUD,CAAK,EACrCD,EAAY,IAAI,GAAGE,CAAQ,CAC7B,CAEA,OAAAF,EAAY,QAAK,GAAAG,SAAO,GAAM,CAAC,EAAG,KAAK,SAAS,CAAC,EAE1CH,CACT,CA6DA,KAAKI,EAAKC,EAAO,CACf,OAAI,OAAOD,GAAQ,SAEb,UAAU,SAAW,GACvBE,GAAe,OAAQ,KAAK,MAAM,EAClC,KAAK,UAAUF,CAAG,EAAIC,EACf,MAIDV,GAAI,KAAK,KAAK,UAAWS,CAAG,GAAK,KAAK,UAAUA,CAAG,GAAM,OAI/DA,GACFE,GAAe,OAAQ,KAAK,MAAM,EAClC,KAAK,UAAYF,EACV,MAIF,KAAK,SACd,CAmBA,QAAS,CACP,GAAI,KAAK,OACP,OAAO,KAMT,IAAMG,EAAyD,KAE/D,KAAO,EAAE,KAAK,YAAc,KAAK,UAAU,QAAQ,CACjD,GAAM,CAACL,EAAU,GAAGM,CAAO,EAAI,KAAK,UAAU,KAAK,WAAW,EAE9D,GAAIA,EAAQ,CAAC,IAAM,GACjB,SAGEA,EAAQ,CAAC,IAAM,KACjBA,EAAQ,CAAC,EAAI,QAGf,IAAMC,EAAcP,EAAS,KAAKK,EAAM,GAAGC,CAAO,EAE9C,OAAOC,GAAgB,YACzB,KAAK,aAAa,IAAIA,CAAW,CAErC,CAEA,YAAK,OAAS,GACd,KAAK,YAAc,OAAO,kBAEnB,IACT,CAgBA,MAAMC,EAAM,CACV,KAAK,OAAO,EACZ,IAAMC,EAAWC,GAAMF,CAAI,EACrBG,EAAS,KAAK,QAAU,KAAK,OACnC,OAAAC,GAAa,QAASD,CAAM,EACrBA,EAAO,OAAOF,CAAQ,EAAGA,CAAQ,CAC1C,CA4CA,QAAQD,EAAMK,EAAM,CAClB,IAAMR,EAAO,KAEb,YAAK,OAAO,EACZO,GAAa,UAAW,KAAK,QAAU,KAAK,MAAM,EAClDE,GAAe,UAAW,KAAK,UAAY,KAAK,QAAQ,EAEjDD,EAAOE,EAAS,OAAWF,CAAI,EAAI,IAAI,QAAQE,CAAQ,EAQ9D,SAASA,EAASC,EAASC,EAAQ,CACjC,IAAMR,EAAWC,GAAMF,CAAI,EAGrBU,EAEsBb,EAAK,MAAMI,CAAQ,EAG/CJ,EAAK,IAAIa,EAAWT,EAAU,SAAUU,EAAOC,EAAMZ,EAAM,CACzD,GAAIW,GAAS,CAACC,GAAQ,CAACZ,EACrB,OAAOa,EAASF,CAAK,EAKvB,IAAMG,EAEsBF,EAGtBG,EAAgBlB,EAAK,UAAUiB,EAAad,CAAI,EAElDgB,GAAgBD,CAAa,EAC/Bf,EAAK,MAAQe,EAEbf,EAAK,OAASe,EAGhBF,EAASF,EAAsDX,CAAK,CACtE,CAAC,EAOD,SAASa,EAASF,EAAOX,EAAM,CACzBW,GAAS,CAACX,EACZS,EAAOE,CAAK,EACHH,EACTA,EAAQR,CAAI,EAGZK,EAAK,OAAWL,CAAI,CAExB,CACF,CACF,CAiCA,YAAYA,EAAM,CAEhB,IAAIiB,EAAW,GAEXC,EAEJ,YAAK,OAAO,EACZd,GAAa,cAAe,KAAK,QAAU,KAAK,MAAM,EACtDE,GAAe,cAAe,KAAK,UAAY,KAAK,QAAQ,EAE5D,KAAK,QAAQN,EAAMa,CAAQ,EAC3BM,GAAW,cAAe,UAAWF,CAAQ,EAGtCC,EAKP,SAASL,EAASF,EAAOX,EAAM,CAC7BiB,EAAW,GACXG,GAAKT,CAAK,EACVO,EAASlB,CACX,CACF,CAwCA,IAAIY,EAAMZ,EAAMK,EAAM,CACpBgB,GAAWT,CAAI,EACf,KAAK,OAAO,EAEZ,IAAMU,EAAe,KAAK,aAE1B,MAAI,CAACjB,GAAQ,OAAOL,GAAS,aAC3BK,EAAOL,EACPA,EAAO,QAGFK,EAAOE,EAAS,OAAWF,CAAI,EAAI,IAAI,QAAQE,CAAQ,EAW9D,SAASA,EAASC,EAASC,EAAQ,CAKjC,IAAMR,EAAWC,GAAMF,CAAI,EAC3BsB,EAAa,IAAIV,EAAMX,EAAUY,CAAQ,EAQzC,SAASA,EAASF,EAAOY,EAAYvB,EAAM,CACzC,IAAMwB,EAEFD,GAAcX,EAGdD,EACFF,EAAOE,CAAK,EACHH,EACTA,EAAQgB,CAAa,EAGrBnB,EAAK,OAAWmB,EAAexB,CAAI,CAEvC,CACF,CACF,CAmBA,QAAQY,EAAMZ,EAAM,CAElB,IAAIiB,EAAW,GAEXC,EAEJ,YAAK,IAAIN,EAAMZ,EAAMa,CAAQ,EAE7BM,GAAW,UAAW,MAAOF,CAAQ,EAE9BC,EAKP,SAASL,EAASF,EAAOC,EAAM,CAC7BQ,GAAKT,CAAK,EACVO,EAASN,EACTK,EAAW,EACb,CACF,CA+BA,UAAUL,EAAMZ,EAAM,CACpB,KAAK,OAAO,EACZ,IAAMC,EAAWC,GAAMF,CAAI,EACrByB,EAAW,KAAK,UAAY,KAAK,SACvC,OAAAnB,GAAe,YAAamB,CAAQ,EACpCJ,GAAWT,CAAI,EAERa,EAASb,EAAMX,CAAQ,CAChC,CA2DA,IAAIN,KAAU+B,EAAY,CACxB,IAAMC,EAAY,KAAK,UACjBC,EAAY,KAAK,UAIvB,GAFAhC,GAAe,MAAO,KAAK,MAAM,EAE7BD,GAAU,KAEP,GAAI,OAAOA,GAAU,WAC1BkC,EAAUlC,EAAO+B,CAAU,UAClB,OAAO/B,GAAU,SACtB,MAAM,QAAQA,CAAK,EACrBmC,EAAQnC,CAAK,EAEboC,EAAUpC,CAAK,MAGjB,OAAM,IAAI,UAAU,+BAAiCA,EAAQ,GAAG,EAGlE,OAAO,KAMP,SAASqC,EAAIrC,EAAO,CAClB,GAAI,OAAOA,GAAU,WACnBkC,EAAUlC,EAAO,CAAC,CAAC,UACV,OAAOA,GAAU,SAC1B,GAAI,MAAM,QAAQA,CAAK,EAAG,CACxB,GAAM,CAACsC,EAAQ,GAAGP,CAAU,EACkB/B,EAC9CkC,EAAUI,EAAQP,CAAU,CAC9B,MACEK,EAAUpC,CAAK,MAGjB,OAAM,IAAI,UAAU,+BAAiCA,EAAQ,GAAG,CAEpE,CAMA,SAASoC,EAAUb,EAAQ,CACzB,GAAI,EAAE,YAAaA,IAAW,EAAE,aAAcA,GAC5C,MAAM,IAAI,MACR,4KACF,EAGFY,EAAQZ,EAAO,OAAO,EAElBA,EAAO,WACTU,EAAU,YAAW,GAAAnC,SAAO,GAAMmC,EAAU,SAAUV,EAAO,QAAQ,EAEzE,CAMA,SAASY,EAAQI,EAAS,CACxB,IAAI3C,EAAQ,GAEZ,GAAI2C,GAAY,KAET,GAAI,MAAM,QAAQA,CAAO,EAC9B,KAAO,EAAE3C,EAAQ2C,EAAQ,QAAQ,CAC/B,IAAMC,EAAQD,EAAQ3C,CAAK,EAC3ByC,EAAIG,CAAK,CACX,KAEA,OAAM,IAAI,UAAU,oCAAsCD,EAAU,GAAG,CAE3E,CAOA,SAASL,EAAUI,EAAQP,EAAY,CACrC,IAAInC,EAAQ,GACR6C,EAAa,GAEjB,KAAO,EAAE7C,EAAQoC,EAAU,QACzB,GAAIA,EAAUpC,CAAK,EAAE,CAAC,IAAM0C,EAAQ,CAClCG,EAAa7C,EACb,KACF,CAGF,GAAI6C,IAAe,GACjBT,EAAU,KAAK,CAACM,EAAQ,GAAGP,CAAU,CAAC,UAI/BA,EAAW,OAAS,EAAG,CAC9B,GAAI,CAACW,EAAS,GAAGC,CAAI,EAAIZ,EACnBa,EAAiBZ,EAAUS,CAAU,EAAE,CAAC,EAC1CI,GAAWD,CAAc,GAAKC,GAAWH,CAAO,IAClDA,KAAU,GAAA5C,SAAO,GAAM8C,EAAgBF,CAAO,GAGhDV,EAAUS,CAAU,EAAI,CAACH,EAAQI,EAAS,GAAGC,CAAI,CACnD,CACF,CACF,CACF,EA8BaG,GAAU,IAAIvD,GAAU,EAAE,OAAO,EAS9C,SAASkB,GAAasC,EAAM/C,EAAO,CACjC,GAAI,OAAOA,GAAU,WACnB,MAAM,IAAI,UAAU,WAAa+C,EAAO,oBAAoB,CAEhE,CASA,SAASpC,GAAeoC,EAAM/C,EAAO,CACnC,GAAI,OAAOA,GAAU,WACnB,MAAM,IAAI,UAAU,WAAa+C,EAAO,sBAAsB,CAElE,CASA,SAAS9C,GAAe8C,EAAMC,EAAQ,CACpC,GAAIA,EACF,MAAM,IAAI,MACR,gBACED,EACA,kHACJ,CAEJ,CAQA,SAASrB,GAAWuB,EAAM,CAGxB,GAAI,CAACJ,GAAWI,CAAI,GAAK,OAAOA,EAAK,MAAS,SAC5C,MAAM,IAAI,UAAU,uBAAyBA,EAAO,GAAG,CAG3D,CAUA,SAASzB,GAAWuB,EAAMG,EAAW5B,EAAU,CAC7C,GAAI,CAACA,EACH,MAAM,IAAI,MACR,IAAMyB,EAAO,0BAA4BG,EAAY,WACvD,CAEJ,CAMA,SAAS3C,GAAMP,EAAO,CACpB,OAAOmD,GAAgBnD,CAAK,EAAIA,EAAQ,IAAIoD,GAAMpD,CAAK,CACzD,CAMA,SAASmD,GAAgBnD,EAAO,CAC9B,MAAO,GACLA,GACE,OAAOA,GAAU,UACjB,YAAaA,GACb,aAAcA,EAEpB,CAMA,SAASqB,GAAgBrB,EAAO,CAC9B,OAAO,OAAOA,GAAU,UAAYqD,GAAarD,CAAK,CACxD,CAUA,SAASqD,GAAarD,EAAO,CAC3B,MAAO,GACLA,GACE,OAAOA,GAAU,UACjB,eAAgBA,GAChB,eAAgBA,EAEtB,CUjyCO,IAAMsD,GAASC,GAAQ,EAAE,IAAIC,EAAW,EAAE,IAAIC,EAAe,EAAE,OAAO,EtH2BnE,cAAAC,EAuCE,QAAAC,OAvCF,oBAtBV,IAAMC,GAAa,CACjBC,EACAC,EAAgB,IAC8C,CAC9D,GAAI,CAACD,EAAM,OAAO,KAElB,OAAQA,EAAK,KAAM,CACjB,IAAK,UAAW,CACd,IAAME,EACJF,EAAK,QAAU,EACX,GACAA,EAAK,QAAU,EACb,GACAA,EAAK,QAAU,EACb,GACA,GACJG,EAAaH,EAAK,OAAS,EAAI,OAAS,SAC9C,OACEH,EAACO,GAAA,CAEC,MAAO,CAAE,aAAc,EAAG,UAAWJ,EAAK,QAAU,EAAI,EAAI,CAAE,EAE9D,SAAAH,EAACQ,GAAA,CAAK,MAAO,CAAE,SAAAH,EAAU,WAAAC,CAAW,EACjC,SAAAH,EAAK,SAAS,IAAI,CAACM,EAAOC,IAAMR,GAAWO,EAAOC,CAAC,CAAC,EACvD,GALKN,CAMP,CAEJ,CAEA,IAAK,YACH,OACEJ,EAACO,GAAA,CAAiB,MAAO,CAAE,aAAc,CAAE,EACzC,SAAAP,EAACQ,GAAA,CAAM,SAAAL,EAAK,SAAS,IAAI,CAACM,EAAOC,IAAMR,GAAWO,EAAOC,CAAC,CAAC,EAAE,GADpDN,CAEX,EAIJ,IAAK,OACH,OAAOD,EAAK,MAGd,IAAK,SACH,OACEH,EAACQ,GAAA,CAAiB,MAAO,CAAE,WAAY,MAAO,EAC3C,SAAAL,EAAK,SAAS,IAAI,CAACM,EAAOC,IAAMR,GAAWO,EAAOC,CAAC,CAAC,GAD5CN,CAEX,EAIJ,IAAK,WACH,OACEJ,EAACQ,GAAA,CAAiB,MAAO,CAAE,UAAW,QAAS,EAC5C,SAAAL,EAAK,SAAS,IAAI,CAACM,EAAOC,IAAMR,GAAWO,EAAOC,CAAC,CAAC,GAD5CN,CAEX,EAIJ,IAAK,OACH,OACEJ,EAACO,GAAA,CAAiB,MAAO,CAAE,aAAc,EAAG,WAAY,CAAE,EACvD,SAAAJ,EAAK,SAAS,IAAI,CAACQ,EAAMD,IACxBT,GAACM,GAAA,CAAa,MAAO,CAAE,cAAe,MAAO,aAAc,CAAE,EAC3D,UAAAP,EAACQ,GAAA,CAAK,MAAO,CAAE,YAAa,EAAG,MAAO,EAAG,EACtC,SAAAL,EAAK,QAAU,GAAGO,EAAI,CAAC,IAAM,SAChC,EACAV,EAACO,GAAA,CAAK,MAAO,CAAE,KAAM,CAAE,EACpB,SAAAI,EAAK,SAAS,IAAI,CAACF,EAAOG,IAAMV,GAAWO,EAAOG,CAAC,CAAC,EACvD,IANSF,CAOX,CACD,GAVQN,CAWX,EAIJ,IAAK,WAEH,OACEJ,EAACa,GAAM,SAAN,CACE,SAAAV,EAAK,SAAS,IAAI,CAACM,EAAOC,IAAMR,GAAWO,EAAOC,CAAC,CAAC,GADlCN,CAErB,EAIJ,IAAK,OACH,OACEJ,EAACQ,GAAA,CAAiB,MAAO,CAAE,MAAO,SAAU,EACzC,SAAAL,EAAK,SAAS,IAAI,CAACM,EAAOC,IAAMR,GAAWO,EAAOC,CAAC,CAAC,GAD5CN,CAEX,EAIJ,IAAK,OACH,OACEJ,EAACQ,GAAA,CAEC,MAAO,CACL,WAAY,UACZ,gBAAiB,UACjB,QAAS,CACX,EAEC,SAAAL,EAAK,OAPDC,CAQP,EAIJ,IAAK,aACH,OACEJ,EAACQ,GAAA,CAEC,MAAO,CAAE,WAAY,UAAW,gBAAiB,SAAU,EAE1D,SAAAL,EAAK,OAHDC,CAIP,EAIJ,IAAK,aACH,OACEJ,EAACO,GAAA,CAEC,MAAO,CACL,WAAY,GACZ,aAAc,EACd,WAAY,iBACZ,YAAa,EACf,EAEC,SAAAJ,EAAK,SAAS,IAAI,CAACM,EAAOC,IAAMR,GAAWO,EAAOC,CAAC,CAAC,GARhDN,CASP,EAIJ,IAAK,QACH,MAAO;AAAA,EAGT,IAAK,gBACH,OACEJ,EAACO,GAAA,CAEC,MAAO,CAAE,aAAc,iBAAkB,eAAgB,EAAG,GADvDH,CAEP,EAIJ,QAEE,MAAI,aAAcD,GAAQ,MAAM,QAAQA,EAAK,QAAQ,EAEjDH,EAACa,GAAM,SAAN,CACE,SAAAV,EAAK,SAAS,IAAI,CAACM,EAAOC,IAAMR,GAAWO,EAAOC,CAAC,CAAC,GADlCN,CAErB,EAGG,IACX,CACF,EAEaU,GAAoC,CAAC,CAChD,SAAAC,EACA,KAAAC,EACA,SAAAC,EACA,MAAAC,EACA,GAAGC,CACL,IAAM,CAEJ,IAAMC,EACJH,GAAYD,IAAS,OAAOD,GAAa,SAAWA,EAAW,MAEjE,GAAI,CAACK,GAAgB,OAAOA,GAAiB,SAC3C,OAAO,KAGT,GAAI,CAEF,IAAMC,EADYC,GAAO,EAAE,IAAIC,EAAW,EACnB,MAAMH,CAAY,EAEzC,OACEpB,EAACO,GAAA,CAAK,MAAOW,EAAQ,GAAGC,EACrB,SAAAE,EAAK,SAAS,IAAI,CAAClB,EAAMC,IAAUF,GAAWC,EAAMC,CAAK,CAAC,EAC7D,CAEJ,OAASoB,EAAO,CACd,eAAQ,MAAM,0BAA2BA,CAAK,EAG5CxB,EAACO,GAAA,CAAK,MAAOW,EAAQ,GAAGC,EACtB,SAAAnB,EAACQ,GAAA,CAAM,SAAAY,EAAa,EACtB,CAEJ,CACF,EJvMO,IAAMK,GAAiB,CAC5B,KAAMC,GACN,KAAMC,GACN,KAAMC,GACN,MAAOC,GACP,MAAOC,GACP,GAAIC,GACJ,GAAIC,GACJ,GAAIC,GACJ,OAAQC,GACR,IAAKC,GACL,SAAUC,EAEZ,ERcS,cAAAC,OAAA,oBAvBF,IAAMC,GAA4C,CAAC,CACxD,KAAAC,EACA,SAAAC,CACF,IAAM,CACJ,IAAMC,EAAiBC,GAAUF,CAAQ,EACnCG,EAAaD,GAAUH,CAAI,GAElBE,GAAgB,OAA0B,CAAC,GACpD,QAASG,GAAqB,CAClCC,GAAK,SAASD,CAAI,CACpB,CAAC,EAED,IAAME,EAAiBL,GAAgB,YAAkC,CAAC,EACpEM,EAASN,GAAgB,QAAU,CAAC,EAEpCO,EAAqBC,GAAmB,CAC5C,cAAAH,EACA,WAAYI,GACZ,KAAMP,GAAc,CAAC,EACrB,SAAU,CAAC,EACX,OAAAI,CACF,CAAC,EAED,OAAOV,GAACc,GAAA,CAAU,SAAAH,EAAmB,CACvC,EDvBO,IAAMI,GAAmC,MAC9CC,EACAC,IACuB,CACvB,GAAI,CAEF,GAAI,CAACD,GAAY,CAACC,EAChB,MAAM,IAAI,MAAM,gCAAgC,EAIlD,IAAIC,EACJ,GAAI,CAEF,GADAA,EAAc,KAAK,MAAMF,CAAQ,EAC7B,CAACE,EAAY,YAAc,CAAC,MAAM,QAAQA,EAAY,UAAU,EAClE,MAAM,IAAI,MACR,iEACF,CAEJ,OAASC,EAAY,CACnB,MAAM,IAAI,MACR,0BAA0BA,aAAsB,MAAQA,EAAW,QAAU,uBAAuB,EACtG,CACF,CAGA,IAAIC,EACJ,GAAI,CAEF,GADAA,EAAU,KAAK,MAAMH,CAAI,EACrB,OAAOG,GAAY,UAAYA,IAAY,KAC7C,MAAM,IAAI,MAAM,kCAAkC,CAEtD,OAASD,EAAY,CACnB,MAAM,IAAI,MACR,sBAAsBA,aAAsB,MAAQA,EAAW,QAAU,uBAAuB,EAClG,CACF,CAGA,IAAME,EAAgCC,GAAM,cAAcC,GAAc,CACtE,KAAAN,EACA,SAAAD,CACF,CAAC,EAOD,OAJ6B,MAAMQ,GACjCH,CACF,EAAE,OAAO,CAGX,OAASI,EAAO,CAEd,IAAMC,EAA+B,IAAI,MACvC,0BAA0BD,aAAiB,MAAQA,EAAM,QAAU,eAAe,EACpF,EAEA,MAAAC,EAAS,cAAgBD,aAAiB,MAAQA,EAAQ,OAC1DC,EAAS,SAAWV,EACpBU,EAAS,KAAOT,EAEVS,CACR,CACF",
+  "names": ["require_queries", "__commonJSMin", "exports", "module", "MaxHeight", "value", "options", "MinHeight", "MaxWidth", "MinWidth", "Orientation", "type", "require_operators", "__commonJSMin", "exports", "module", "And", "left", "right", "options", "Or", "type", "require_parser", "__commonJSMin", "exports", "module", "Query", "Operator", "NUMBERS", "LETTERS", "WHITESPACE", "COLON", "COMMA", "AND", "AT", "tokenizer", "input", "current", "tokens", "char", "value", "parser", "output", "stack", "token", "walk", "head", "l", "r", "query", "ast", "require_src", "__commonJSMin", "exports", "module", "Parser", "queries", "options", "result", "query", "require_converter", "__commonJSMin", "exports", "module", "hslToRgb", "hue", "saturation", "lightness", "chroma", "huePrime", "secondComponent", "red", "green", "blue", "lightnessAdjustment", "require_hsl_to_hex", "__commonJSMin", "exports", "module", "toRgb", "max", "val", "n", "min", "cycle", "hsl", "hue", "saturation", "luminosity", "rgb", "require_color_name", "__commonJSMin", "exports", "module", "require_is_arrayish", "__commonJSMin", "exports", "module", "obj", "require_simple_swizzle", "__commonJSMin", "exports", "module", "isArrayish", "concat", "slice", "swizzle", "args", "results", "i", "len", "arg", "fn", "require_color_string", "__commonJSMin", "exports", "module", "colorNames", "swizzle", "hasOwnProperty", "reverseNames", "name", "cs", "string", "prefix", "val", "model", "abbr", "hex", "rgba", "per", "keyword", "rgb", "match", "i", "hexAlpha", "i2", "clamp", "hsl", "alpha", "h", "s", "l", "hwb", "w", "b", "hexDouble", "r", "g", "hsla", "hwba", "a", "num", "min", "max", "str", "require_parse", "__commonJSMin", "exports", "module", "openParentheses", "closeParentheses", "singleQuote", "doubleQuote", "backslash", "slash", "comma", "colon", "star", "uLower", "uUpper", "plus", "isUnicodeRange", "input", "tokens", "value", "next", "quote", "prev", "token", "escape", "escapePos", "whitespacePos", "parenthesesOpenPos", "pos", "code", "max", "stack", "balanced", "parent", "name", "before", "after", "require_unit", "__commonJSMin", "exports", "module", "minus", "plus", "dot", "exp", "EXP", "likeNumber", "value", "code", "nextCode", "nextNextCode", "pos", "length", "require_can_promise", "__commonJSMin", "exports", "module", "require_utils", "__commonJSMin", "exports", "toSJISFunction", "CODEWORDS_COUNT", "version", "data", "digit", "f", "kanji", "require_error_correction_level", "__commonJSMin", "exports", "fromString", "string", "level", "value", "defaultValue", "require_bit_buffer", "__commonJSMin", "exports", "module", "BitBuffer", "index", "bufIndex", "num", "length", "i", "bit", "require_bit_matrix", "__commonJSMin", "exports", "module", "BitMatrix", "size", "row", "col", "value", "reserved", "index", "require_alignment_pattern", "__commonJSMin", "exports", "getSymbolSize", "version", "posCount", "size", "intervals", "positions", "i", "coords", "pos", "posLength", "j", "require_finder_pattern", "__commonJSMin", "exports", "getSymbolSize", "FINDER_PATTERN_SIZE", "version", "size", "require_mask_pattern", "__commonJSMin", "exports", "PenaltyScores", "mask", "value", "data", "size", "points", "sameCountCol", "sameCountRow", "lastCol", "lastRow", "row", "col", "module", "last", "bitsCol", "bitsRow", "darkCount", "modulesCount", "i", "getMaskAt", "maskPattern", "j", "pattern", "setupFormatFunc", "numPatterns", "bestPattern", "lowerPenalty", "p", "penalty", "require_error_correction_code", "__commonJSMin", "exports", "ECLevel", "EC_BLOCKS_TABLE", "EC_CODEWORDS_TABLE", "version", "errorCorrectionLevel", "require_galois_field", "__commonJSMin", "exports", "EXP_TABLE", "LOG_TABLE", "x", "i", "n", "y", "require_polynomial", "__commonJSMin", "exports", "GF", "p1", "p2", "coeff", "j", "divident", "divisor", "result", "i", "offset", "degree", "poly", "require_reed_solomon_encoder", "__commonJSMin", "exports", "module", "Polynomial", "ReedSolomonEncoder", "degree", "data", "paddedData", "remainder", "start", "buff", "require_version_check", "__commonJSMin", "exports", "version", "require_regex", "__commonJSMin", "exports", "numeric", "alphanumeric", "kanji", "byte", "TEST_KANJI", "TEST_NUMERIC", "TEST_ALPHANUMERIC", "str", "require_mode", "__commonJSMin", "exports", "VersionCheck", "Regex", "mode", "version", "dataStr", "fromString", "string", "value", "defaultValue", "require_version", "__commonJSMin", "exports", "Utils", "ECCode", "ECLevel", "Mode", "VersionCheck", "G18", "G18_BCH", "getBestVersionForDataLength", "mode", "length", "errorCorrectionLevel", "currentVersion", "getReservedBitsCount", "version", "getTotalBitsFromDataArray", "segments", "totalBits", "data", "reservedBits", "getBestVersionForMixedData", "value", "defaultValue", "totalCodewords", "ecTotalCodewords", "dataTotalCodewordsBits", "usableBits", "seg", "ecl", "d", "require_format_info", "__commonJSMin", "exports", "Utils", "G15", "G15_MASK", "G15_BCH", "errorCorrectionLevel", "mask", "data", "d", "require_numeric_data", "__commonJSMin", "exports", "module", "Mode", "NumericData", "data", "length", "bitBuffer", "i", "group", "value", "remainingNum", "require_alphanumeric_data", "__commonJSMin", "exports", "module", "Mode", "ALPHA_NUM_CHARS", "AlphanumericData", "data", "length", "bitBuffer", "i", "value", "require_byte_data", "__commonJSMin", "exports", "module", "Mode", "ByteData", "data", "length", "bitBuffer", "i", "l", "require_kanji_data", "__commonJSMin", "exports", "module", "Mode", "Utils", "KanjiData", "data", "length", "bitBuffer", "i", "value", "require_dijkstra", "__commonJSMin", "exports", "module", "dijkstra", "graph", "s", "d", "predecessors", "costs", "open", "closest", "u", "v", "cost_of_s_to_u", "adjacent_nodes", "cost_of_e", "cost_of_s_to_u_plus_cost_of_e", "cost_of_s_to_v", "first_visit", "msg", "nodes", "predecessor", "opts", "T", "t", "key", "a", "b", "value", "cost", "item", "require_segments", "__commonJSMin", "exports", "Mode", "NumericData", "AlphanumericData", "ByteData", "KanjiData", "Regex", "Utils", "dijkstra", "getStringByteLength", "str", "getSegments", "regex", "mode", "segments", "result", "getSegmentsFromString", "dataStr", "numSegs", "alphaNumSegs", "byteSegs", "kanjiSegs", "s1", "s2", "obj", "getSegmentBitsLength", "length", "mergeSegments", "segs", "acc", "curr", "prevSeg", "buildNodes", "nodes", "i", "seg", "buildGraph", "version", "table", "graph", "prevNodeIds", "nodeGroup", "currentNodeIds", "j", "node", "key", "n", "prevNodeId", "buildSingleSegment", "data", "modesHint", "bestMode", "array", "path", "optimizedSegs", "require_qrcode", "__commonJSMin", "exports", "Utils", "ECLevel", "BitBuffer", "BitMatrix", "AlignmentPattern", "FinderPattern", "MaskPattern", "ECCode", "ReedSolomonEncoder", "Version", "FormatInfo", "Mode", "Segments", "setupFinderPattern", "matrix", "version", "size", "pos", "row", "col", "r", "c", "setupTimingPattern", "value", "setupAlignmentPattern", "i", "setupVersionInfo", "bits", "mod", "setupFormatInfo", "errorCorrectionLevel", "maskPattern", "setupData", "data", "inc", "bitIndex", "byteIndex", "dark", "createData", "segments", "buffer", "totalCodewords", "ecTotalCodewords", "dataTotalCodewordsBits", "remainingByte", "createCodewords", "bitBuffer", "dataTotalCodewords", "ecTotalBlocks", "blocksInGroup2", "blocksInGroup1", "totalCodewordsInGroup1", "dataCodewordsInGroup1", "dataCodewordsInGroup2", "ecCount", "rs", "offset", "dcData", "ecData", "maxDataSize", "b", "dataSize", "index", "createSymbol", "estimatedVersion", "rawSegments", "bestVersion", "dataBits", "moduleCount", "modules", "options", "mask", "require_utils", "__commonJSMin", "exports", "hex2rgba", "hex", "hexCode", "c", "hexValue", "options", "margin", "width", "scale", "qrSize", "opts", "imgData", "qr", "size", "data", "symbolSize", "scaledMargin", "palette", "i", "j", "posDst", "pxColor", "iSrc", "jSrc", "require_canvas", "__commonJSMin", "exports", "Utils", "clearCanvas", "ctx", "canvas", "size", "getCanvasElement", "qrData", "options", "opts", "canvasEl", "image", "type", "rendererOpts", "require_svg_tag", "__commonJSMin", "exports", "Utils", "getColorAttrib", "color", "attrib", "alpha", "str", "svgCmd", "cmd", "x", "y", "qrToPath", "data", "size", "margin", "path", "moveBy", "newRow", "lineLength", "i", "col", "row", "qrData", "options", "cb", "opts", "qrcodesize", "bg", "viewBox", "svgTag", "require_browser", "__commonJSMin", "exports", "canPromise", "QRCode", "CanvasRenderer", "SvgRenderer", "renderCanvas", "renderFunc", "canvas", "text", "opts", "cb", "args", "argsNum", "isLastArgCb", "resolve", "reject", "data", "e", "_", "require_extend", "__commonJSMin", "exports", "module", "hasOwn", "toStr", "defineProperty", "gOPD", "isArray", "arr", "isPlainObject", "obj", "hasOwnConstructor", "hasIsPrototypeOf", "key", "setProperty", "target", "options", "getProperty", "name", "extend", "src", "copy", "copyIsArray", "clone", "i", "length", "deep", "pdf", "React", "Document", "Font", "castArray", "value", "compose", "fns", "args", "result", "reversedFns", "i", "fn", "isPercent", "value", "matchPercent", "match", "f", "parseFloat$1", "value", "import_media_engine", "import_hsl_to_hex", "import_color_string", "import_parse", "import_unit", "compact", "array", "mergeStyles", "styles", "acc", "style", "s", "flatten", "key", "compose", "castArray", "isRgb", "value", "isHsl", "parseRgb", "rgb", "colorString", "parseHsl", "hsl", "hlsToHex", "transformColor", "parseValue", "match", "transformUnit", "container", "scalar", "outputDpi", "inputDpi", "mmFactor", "cmFactor", "processNumberValue", "key", "parseFloat$1", "processUnitValue", "processColorValue", "processNoopValue", "BORDER_SHORTHAND_REGEX", "matchBorderShorthand", "resolveBorderShorthand", "widthMatch", "styleMatch", "colorMatch", "style", "color", "width", "radius", "handlers$b", "handlers$a", "handlers$9", "flexDefaults", "flexAuto", "processFlexShorthand", "defaults", "matches", "flexGrow", "flexShrink", "flexBasis", "handlers$8", "processGapShorthand", "rowGap", "columnGap", "handlers$7", "handlers$6", "BOX_MODEL_UNITS", "logError", "name", "expandBoxModel", "expandsTo", "maxValues", "autoSupported", "model", "nodes", "parse$1", "parts", "i", "node", "result", "parseUnit", "first", "second", "third", "fourth", "processMargin", "processMarginVertical", "processMarginHorizontal", "processMarginSingle", "handlers$5", "processPadding", "processPaddingVertical", "processPaddingHorizontal", "processPaddingSingle", "handlers$4", "offsetKeyword", "processObjectPosition", "objectPositionX", "objectPositionY", "processObjectPositionValue", "handlers$3", "castInt", "FONT_WEIGHTS", "transformFontWeight", "lv", "processFontWeight", "transformLineHeight", "styles", "fontSize", "lineHeight", "percent", "matchPercent", "processLineHeight", "handlers$2", "matchNumber", "castFloat", "parse", "transformString", "transforms", "parsed", "transform", "rawValue", "splitChar", "val", "parseAngle", "unitsRegexp", "angle", "unit", "number", "normalizeTransformOperation", "operation", "scaleX", "scaleY", "num", "normalize", "operations", "processTransform", "Y_AXIS_SHORTHANDS", "sortTransformOriginPair", "a", "b", "getTransformOriginPair", "values", "processTransformOriginShorthand", "pair", "transformOriginX", "transformOriginY", "processTransformOriginValue", "v", "handlers$1", "handlers", "shorthands", "__rest", "s", "e", "t", "p", "Object", "prototype", "hasOwnProperty", "call", "indexOf", "getOwnPropertySymbols", "i", "length", "propertyIsEnumerable", "tableContext", "React", "createContext", "style", "borderWidth", "Table", "_a", "children", "weightings", "styleProps", "tdStyle", "trStyle", "rest", "__rest", "tableStyle", "useMemo", "flatten", "borderColor", "borderStyle", "Array", "isArray", "border", "split", "Number", "parseFloat", "rows", "output", "flattenChildren", "elem", "Children", "forEach", "child", "isValidElement", "type", "Fragment", "props", "push", "map", "tr", "rowIndex", "cloneElement", "key", "_firstRow", "_lastRow", "length", "width", "undefined", "filter", "Boolean", "tableContextValue", "Provider", "value", "createElement", "View", "Object", "assign", "TableRow", "tableWeightings", "useContext", "cells", "r", "e", "index", "row", "entries", "weighting", "_b", "weightingPerNotSpecified", "reduce", "acc", "val", "td", "columnIndex", "_firstColumn", "_lastColumn", "display", "flexDirection", "TableHeader", "fontWeight", "TableCell", "content", "Text", "borderMargin", "borders", "borderTop", "borderRight", "borderBottom", "borderLeft", "margin", "wrap", "flex", "alignItems", "Image", "Page", "Text", "View", "import_qrcode", "React", "generateQrCode", "text", "options", "QRCode", "renderPdfComponent", "args", "componentData", "components", "data", "allProps", "images", "item", "index", "type", "props", "children", "visible", "mergedProps", "Component", "processedChildren", "child", "propsWithKey", "mappedChild", "mappedIsVisible", "mappedProps", "mapDataProps", "safeBooleanEval", "renderHtmlComponent", "context", "templateRegex", "processStringValue", "value", "matches", "path", "resolvedValue", "getNestedProperty", "result", "match", "replacement", "key", "parseJson", "jsonString", "obj", "keys", "current", "error", "convertFileToBase64", "file", "resolve", "reject", "reader", "event", "content", "Map", "items", "component", "data", "images", "itemKeyWord", "parsedItems", "mappedItems", "item", "index", "renderPdfComponent", "PDF_COMPONENTS", "Image", "React", "jsx", "QrCode", "props", "qrCodeText", "imageProps", "qrCodeURL", "React", "generateQrCode", "Image", "QrCode_default", "React", "Text", "View", "emptyOptions", "toString", "value", "options", "settings", "includeImageAlt", "includeHtml", "one", "node", "all", "values", "result", "index", "element", "decodeNamedCharacterReference", "value", "characterReference", "character", "splice", "list", "start", "remove", "items", "end", "chunkStart", "parameters", "push", "hasOwnProperty", "combineExtensions", "extensions", "all", "index", "syntaxExtension", "extension", "hook", "left", "right", "code", "value", "constructs", "existing", "list", "before", "splice", "decodeNumericCharacterReference", "value", "base", "code", "normalizeIdentifier", "value", "asciiAlpha", "regexCheck", "asciiAlphanumeric", "asciiAtext", "asciiControl", "code", "asciiDigit", "asciiHexDigit", "asciiPunctuation", "markdownLineEnding", "markdownLineEndingOrSpace", "markdownSpace", "unicodePunctuation", "unicodeWhitespace", "regex", "check", "factorySpace", "effects", "ok", "type", "max", "limit", "size", "start", "code", "markdownSpace", "prefix", "content", "initializeContent", "effects", "contentStart", "afterContentStartConstruct", "paragraphInitial", "previous", "code", "factorySpace", "lineStart", "token", "data", "markdownLineEnding", "document", "initializeDocument", "containerConstruct", "tokenizeContainer", "effects", "self", "stack", "continued", "childFlow", "childToken", "lineStartOffset", "start", "code", "item", "documentContinue", "checkNewContainers", "closeFlow", "indexBeforeExits", "indexBeforeFlow", "point", "exitContainers", "index", "splice", "documentContinued", "flowStart", "thereIsANewContainer", "thereIsNoNewContainer", "containerContinue", "flowContinue", "writeToChild", "markdownLineEnding", "token", "endOfFile", "stream", "seen", "size", "entry", "ok", "nok", "factorySpace", "classifyCharacter", "code", "markdownLineEndingOrSpace", "unicodeWhitespace", "unicodePunctuation", "resolveAll", "constructs", "events", "context", "called", "index", "resolve", "attention", "resolveAllAttention", "tokenizeAttention", "events", "context", "index", "open", "group", "text", "openingSequence", "closingSequence", "use", "nextEvents", "offset", "start", "end", "movePoint", "push", "resolveAll", "splice", "effects", "ok", "attentionMarkers", "previous", "before", "classifyCharacter", "marker", "code", "inside", "token", "after", "close", "point", "autolink", "tokenizeAutolink", "effects", "ok", "nok", "size", "start", "code", "open", "asciiAlpha", "schemeOrEmailAtext", "emailAtext", "asciiAlphanumeric", "schemeInsideOrEmailAtext", "urlInside", "asciiControl", "emailAtSignOrDot", "asciiAtext", "emailLabel", "emailValue", "next", "blankLine", "tokenizeBlankLine", "effects", "ok", "nok", "start", "code", "markdownSpace", "factorySpace", "after", "markdownLineEnding", "blockQuote", "tokenizeBlockQuoteContinuation", "exit", "tokenizeBlockQuoteStart", "effects", "ok", "nok", "self", "start", "code", "state", "after", "markdownSpace", "contStart", "factorySpace", "contBefore", "characterEscape", "tokenizeCharacterEscape", "effects", "ok", "nok", "start", "code", "inside", "asciiPunctuation", "characterReference", "tokenizeCharacterReference", "effects", "ok", "nok", "self", "size", "max", "test", "start", "code", "open", "numeric", "asciiAlphanumeric", "value", "asciiHexDigit", "asciiDigit", "token", "decodeNamedCharacterReference", "nonLazyContinuation", "tokenizeNonLazyContinuation", "codeFenced", "tokenizeCodeFenced", "effects", "ok", "nok", "self", "closeStart", "tokenizeCloseStart", "initialPrefix", "sizeOpen", "marker", "start", "code", "beforeSequenceOpen", "tail", "sequenceOpen", "markdownSpace", "factorySpace", "infoBefore", "markdownLineEnding", "atNonLazyBreak", "after", "info", "metaBefore", "meta", "contentBefore", "contentStart", "beforeContentChunk", "contentChunk", "size", "startBefore", "beforeSequenceClose", "sequenceClose", "sequenceCloseAfter", "lineStart", "codeIndented", "tokenizeCodeIndented", "furtherStart", "tokenizeFurtherStart", "effects", "ok", "nok", "self", "start", "code", "factorySpace", "afterPrefix", "tail", "atBreak", "after", "markdownLineEnding", "inside", "codeText", "previous", "resolveCodeText", "tokenizeCodeText", "events", "tailExitIndex", "headEnterIndex", "index", "enter", "code", "effects", "ok", "nok", "self", "sizeOpen", "size", "token", "start", "sequenceOpen", "between", "sequenceClose", "markdownLineEnding", "data", "SpliceBuffer", "initial", "index", "start", "end", "stop", "deleteCount", "items", "count", "removed", "chunkedPush", "item", "n", "list", "right", "chunkStart", "subtokenize", "eventsArray", "jumps", "index", "event", "lineIndex", "otherIndex", "otherEvent", "parameters", "subevents", "more", "events", "SpliceBuffer", "subcontent", "splice", "eventIndex", "token", "context", "startPosition", "startPositions", "tokenizer", "childEvents", "gaps", "stream", "previous", "current", "adjust", "start", "breaks", "slice", "content", "resolveContent", "tokenizeContent", "continuationConstruct", "tokenizeContinuation", "events", "subtokenize", "effects", "ok", "previous", "chunkStart", "code", "chunkInside", "contentEnd", "markdownLineEnding", "contentContinue", "nok", "self", "startLookahead", "factorySpace", "prefixed", "tail", "factoryDestination", "effects", "ok", "nok", "type", "literalType", "literalMarkerType", "rawType", "stringType", "max", "limit", "balance", "start", "code", "enclosedBefore", "asciiControl", "raw", "enclosed", "markdownLineEnding", "enclosedEscape", "markdownLineEndingOrSpace", "rawEscape", "factoryLabel", "effects", "ok", "nok", "type", "markerType", "stringType", "self", "size", "seen", "start", "code", "atBreak", "markdownLineEnding", "labelInside", "markdownSpace", "labelEscape", "factoryTitle", "effects", "ok", "nok", "type", "markerType", "stringType", "marker", "start", "code", "begin", "atBreak", "markdownLineEnding", "factorySpace", "inside", "escape", "factoryWhitespace", "effects", "ok", "seen", "start", "code", "markdownLineEnding", "markdownSpace", "factorySpace", "definition", "tokenizeDefinition", "titleBefore", "tokenizeTitleBefore", "effects", "ok", "nok", "self", "identifier", "start", "code", "before", "factoryLabel", "labelAfter", "normalizeIdentifier", "markerAfter", "markdownLineEndingOrSpace", "factoryWhitespace", "destinationBefore", "factoryDestination", "destinationAfter", "after", "markdownSpace", "factorySpace", "afterWhitespace", "markdownLineEnding", "beforeMarker", "factoryTitle", "titleAfter", "titleAfterOptionalWhitespace", "hardBreakEscape", "tokenizeHardBreakEscape", "effects", "ok", "nok", "start", "code", "after", "markdownLineEnding", "headingAtx", "resolveHeadingAtx", "tokenizeHeadingAtx", "events", "context", "contentEnd", "contentStart", "content", "text", "splice", "effects", "ok", "nok", "size", "start", "code", "before", "sequenceOpen", "markdownLineEndingOrSpace", "atBreak", "sequenceFurther", "markdownLineEnding", "markdownSpace", "factorySpace", "data", "htmlBlockNames", "htmlRawNames", "htmlFlow", "resolveToHtmlFlow", "tokenizeHtmlFlow", "blankLineBefore", "tokenizeBlankLineBefore", "nonLazyContinuationStart", "tokenizeNonLazyContinuationStart", "events", "index", "effects", "ok", "nok", "self", "marker", "closingTag", "buffer", "markerB", "start", "code", "before", "open", "declarationOpen", "tagCloseStart", "continuationDeclarationInside", "asciiAlpha", "tagName", "commentOpenInside", "cdataOpenInside", "value", "continuation", "markdownLineEndingOrSpace", "slash", "name", "htmlRawNames", "htmlBlockNames", "basicSelfClosing", "completeClosingTagAfter", "completeAttributeNameBefore", "asciiAlphanumeric", "markdownSpace", "completeEnd", "completeAttributeName", "completeAttributeNameAfter", "completeAttributeValueBefore", "completeAttributeValueQuoted", "completeAttributeValueUnquoted", "completeAttributeValueQuotedAfter", "markdownLineEnding", "completeAfter", "continuationCommentInside", "continuationRawTagOpen", "continuationClose", "continuationCdataInside", "continuationAfter", "continuationStart", "continuationStartNonLazy", "continuationBefore", "continuationRawEndTag", "after", "blankLine", "htmlText", "tokenizeHtmlText", "effects", "ok", "nok", "self", "marker", "index", "returnState", "start", "code", "open", "declarationOpen", "tagCloseStart", "instruction", "asciiAlpha", "tagOpen", "commentOpenInside", "cdataOpenInside", "declaration", "commentEnd", "comment", "commentClose", "markdownLineEnding", "lineEndingBefore", "end", "value", "cdata", "cdataClose", "cdataEnd", "instructionClose", "tagClose", "asciiAlphanumeric", "tagCloseBetween", "markdownSpace", "markdownLineEndingOrSpace", "tagOpenBetween", "tagOpenAttributeName", "tagOpenAttributeNameAfter", "tagOpenAttributeValueBefore", "tagOpenAttributeValueQuoted", "tagOpenAttributeValueUnquoted", "tagOpenAttributeValueQuotedAfter", "lineEndingAfter", "factorySpace", "lineEndingAfterPrefix", "labelEnd", "resolveAllLabelEnd", "resolveToLabelEnd", "tokenizeLabelEnd", "resourceConstruct", "tokenizeResource", "referenceFullConstruct", "tokenizeReferenceFull", "referenceCollapsedConstruct", "tokenizeReferenceCollapsed", "events", "index", "newEvents", "token", "offset", "splice", "context", "open", "close", "media", "group", "label", "text", "push", "resolveAll", "effects", "ok", "nok", "self", "labelStart", "defined", "start", "code", "labelEndNok", "normalizeIdentifier", "after", "labelEndOk", "referenceNotFull", "resourceStart", "resourceBefore", "markdownLineEndingOrSpace", "factoryWhitespace", "resourceOpen", "resourceEnd", "factoryDestination", "resourceDestinationAfter", "resourceDestinationMissing", "resourceBetween", "factoryTitle", "resourceTitleAfter", "referenceFull", "factoryLabel", "referenceFullAfter", "referenceFullMissing", "referenceCollapsedStart", "referenceCollapsedOpen", "labelStartImage", "labelEnd", "tokenizeLabelStartImage", "effects", "ok", "nok", "self", "start", "code", "open", "after", "labelStartLink", "labelEnd", "tokenizeLabelStartLink", "effects", "ok", "nok", "self", "start", "code", "after", "lineEnding", "tokenizeLineEnding", "effects", "ok", "start", "code", "factorySpace", "thematicBreak", "tokenizeThematicBreak", "effects", "ok", "nok", "size", "marker", "start", "code", "before", "atBreak", "sequence", "markdownLineEnding", "markdownSpace", "factorySpace", "list", "tokenizeListContinuation", "tokenizeListEnd", "tokenizeListStart", "listItemPrefixWhitespaceConstruct", "tokenizeListItemPrefixWhitespace", "indentConstruct", "tokenizeIndent", "effects", "ok", "nok", "self", "tail", "initialSize", "size", "start", "code", "kind", "asciiDigit", "thematicBreak", "atMarker", "inside", "blankLine", "onBlank", "endOfPrefix", "otherPrefix", "markdownSpace", "notBlank", "factorySpace", "notInCurrentItem", "afterPrefix", "setextUnderline", "resolveToSetextUnderline", "tokenizeSetextUnderline", "events", "context", "index", "content", "text", "definition", "heading", "effects", "ok", "nok", "self", "marker", "start", "code", "paragraph", "before", "inside", "markdownSpace", "factorySpace", "after", "markdownLineEnding", "flow", "initializeFlow", "effects", "self", "initial", "blankLine", "atBlankEnding", "afterConstruct", "factorySpace", "content", "code", "resolver", "createResolver", "string", "initializeFactory", "text", "field", "resolveAllLineSuffixes", "initializeText", "effects", "self", "constructs", "start", "notText", "code", "atBreak", "data", "list", "index", "item", "extraResolver", "resolveAllText", "events", "context", "enter", "eventIndex", "chunks", "bufferIndex", "size", "tabs", "chunk", "token", "constructs_exports", "__export", "attentionMarkers", "contentInitial", "disable", "document", "flow", "flowInitial", "insideSpan", "string", "text", "document", "list", "blockQuote", "contentInitial", "definition", "flowInitial", "codeIndented", "flow", "headingAtx", "thematicBreak", "setextUnderline", "htmlFlow", "codeFenced", "string", "characterReference", "characterEscape", "text", "lineEnding", "labelStartImage", "attention", "autolink", "htmlText", "labelStartLink", "hardBreakEscape", "labelEnd", "codeText", "insideSpan", "resolver", "attentionMarkers", "disable", "createTokenizer", "parser", "initialize", "from", "point", "columnStart", "resolveAllConstructs", "chunks", "stack", "consumed", "effects", "constructFactory", "onsuccessfulconstruct", "onsuccessfulcheck", "consume", "enter", "exit", "context", "defineSkip", "now", "sliceSerialize", "sliceStream", "write", "state", "expectedCode", "slice", "push", "main", "addResult", "resolveAll", "token", "expandTabs", "serializeChunks", "sliceChunks", "_bufferIndex", "_index", "line", "column", "offset", "value", "accountForPotentialSkip", "chunkIndex", "chunk", "go", "code", "markdownLineEnding", "type", "fields", "construct", "info", "_", "onreturn", "hook", "constructs", "returnState", "bogusState", "listOfConstructs", "constructIndex", "currentConstruct", "handleListOfConstructs", "handleMapOfConstructs", "map", "start", "left", "all", "list", "handleConstruct", "store", "nok", "ok", "splice", "startPoint", "startPrevious", "startCurrentConstruct", "startEventsIndex", "startStack", "restore", "startIndex", "startBufferIndex", "endIndex", "endBufferIndex", "view", "head", "index", "result", "atTab", "parse", "options", "parser", "combineExtensions", "constructs_exports", "create", "content", "document", "flow", "string", "text", "initial", "creator", "from", "createTokenizer", "postprocess", "events", "subtokenize", "search", "preprocess", "column", "buffer", "start", "atCarriageReturn", "preprocessor", "value", "encoding", "end", "chunks", "match", "next", "startPosition", "endPosition", "code", "characterEscapeOrReference", "decodeString", "value", "decode", "$0", "$1", "$2", "head", "hex", "decodeNumericCharacterReference", "decodeNamedCharacterReference", "stringifyPosition", "value", "position", "point", "index", "pos", "own", "fromMarkdown", "value", "encoding", "options", "compiler", "postprocess", "parse", "preprocess", "config", "opener", "link", "onenterdata", "heading", "blockQuote", "codeFlow", "buffer", "codeText", "definition", "emphasis", "hardBreak", "html", "image", "listItem", "onenterlistitemvalue", "list", "onenterlistordered", "paragraph", "onenterreference", "strong", "thematicBreak", "closer", "onexitatxheadingsequence", "onexitautolinkemail", "onexitautolinkprotocol", "onexitdata", "onexitcharacterreferencemarker", "onexitcharacterreferencevalue", "onexitcharacterreference", "onexitcodefenced", "onexitcodefencedfence", "onexitcodefencedfenceinfo", "onexitcodefencedfencemeta", "onexitcodeindented", "onexitcodetext", "onexitdefinitiondestinationstring", "onexitdefinitionlabelstring", "onexitdefinitiontitlestring", "onexithardbreak", "onexithtmlflow", "onexithtmltext", "onexitimage", "onexitlabel", "onexitlabeltext", "onexitlineending", "onexitlink", "onexitreferencestring", "onexitresourcedestinationstring", "onexitresourcetitlestring", "onexitresource", "onexitsetextheading", "onexitsetextheadinglinesequence", "onexitsetextheadingtext", "configure", "data", "compile", "events", "tree", "context", "enter", "exit", "resume", "listStack", "index", "tail", "prepareList", "handler", "defaultOnError", "point", "start", "length", "containerBalance", "listSpread", "lineIndex", "firstBlankLineIndex", "atMarker", "event", "tailIndex", "tailEvent", "item", "create", "and", "open", "token", "node", "errorHandler", "close", "onExitError", "stringifyPosition", "toString", "ancestor", "label", "normalizeIdentifier", "depth", "siblings", "text", "referenceType", "string", "decodeString", "fragment", "children", "type", "decodeNumericCharacterReference", "decodeNamedCharacterReference", "d", "combined", "extensions", "extension", "key", "right", "left", "remarkParse", "options", "self", "parser", "doc", "fromMarkdown", "own", "zwitch", "key", "options", "settings", "one", "value", "parameters", "fn", "handlers", "id", "own", "configure", "base", "extension", "index", "key", "list", "map", "left", "right", "blockquote", "node", "_", "state", "info", "exit", "tracker", "value", "map", "line", "blank", "patternInScope", "stack", "pattern", "listInScope", "list", "none", "index", "hardBreak", "_", "_1", "state", "info", "index", "patternInScope", "longestStreak", "value", "substring", "source", "index", "expected", "count", "max", "formatCodeAsIndented", "node", "state", "checkFence", "state", "marker", "code", "node", "_", "state", "info", "marker", "checkFence", "raw", "suffix", "formatCodeAsIndented", "exit", "value", "map", "tracker", "sequence", "longestStreak", "subexit", "line", "blank", "checkQuote", "state", "marker", "definition", "node", "_", "state", "info", "quote", "checkQuote", "suffix", "exit", "subexit", "tracker", "value", "checkEmphasis", "state", "marker", "encodeCharacterReference", "code", "encodeInfo", "outside", "inside", "marker", "outsideKind", "classifyCharacter", "insideKind", "emphasis", "emphasisPeek", "node", "_", "state", "info", "marker", "checkEmphasis", "exit", "tracker", "before", "between", "betweenHead", "open", "encodeInfo", "encodeCharacterReference", "betweenTail", "close", "after", "_1", "convert", "test", "ok", "castFactory", "anyFactory", "propsFactory", "typeFactory", "tests", "checks", "index", "any", "parameters", "check", "checkAsRecord", "all", "node", "nodeAsRecord", "key", "type", "testFunction", "value", "parent", "looksLikeANode", "empty", "CONTINUE", "EXIT", "SKIP", "visitParents", "tree", "test", "visitor", "reverse", "check", "is", "convert", "step", "factory", "node", "index", "parents", "value", "name", "visit", "result", "subresult", "offset", "grandparents", "toResult", "nodeAsParent", "child", "visit", "tree", "testOrVisitor", "visitorOrReverse", "maybeReverse", "reverse", "test", "visitor", "visitParents", "overload", "node", "parents", "parent", "index", "formatHeadingAsSetext", "node", "state", "literalWithBreak", "visit", "EXIT", "toString", "heading", "node", "_", "state", "info", "rank", "tracker", "formatHeadingAsSetext", "exit", "subexit", "value", "sequence", "encodeCharacterReference", "html", "htmlPeek", "node", "image", "imagePeek", "node", "_", "state", "info", "quote", "checkQuote", "suffix", "exit", "subexit", "tracker", "value", "imageReference", "imageReferencePeek", "node", "_", "state", "info", "type", "exit", "subexit", "tracker", "value", "alt", "stack", "reference", "inlineCode", "inlineCodePeek", "node", "_", "state", "value", "sequence", "index", "pattern", "expression", "match", "position", "formatLinkAsAutolink", "node", "state", "raw", "toString", "link", "linkPeek", "node", "_", "state", "info", "quote", "checkQuote", "suffix", "tracker", "exit", "subexit", "formatLinkAsAutolink", "stack", "value", "linkReference", "linkReferencePeek", "node", "_", "state", "info", "type", "exit", "subexit", "tracker", "value", "text", "stack", "reference", "checkBullet", "state", "marker", "checkBulletOther", "state", "bullet", "checkBullet", "bulletOther", "checkBulletOrdered", "state", "marker", "checkRule", "state", "marker", "list", "node", "parent", "state", "info", "exit", "bulletCurrent", "bullet", "checkBulletOrdered", "checkBullet", "bulletOther", "checkBulletOther", "useDifferentMarker", "firstListItem", "checkRule", "index", "item", "value", "checkListItemIndent", "state", "style", "listItem", "node", "parent", "state", "info", "listItemIndent", "checkListItemIndent", "bullet", "checkBullet", "size", "tracker", "exit", "value", "map", "line", "index", "blank", "paragraph", "node", "_", "state", "info", "exit", "subexit", "value", "phrasing", "convert", "root", "node", "_", "state", "info", "d", "phrasing", "checkStrong", "state", "marker", "strong", "strongPeek", "node", "_", "state", "info", "marker", "checkStrong", "exit", "tracker", "before", "between", "betweenHead", "open", "encodeInfo", "encodeCharacterReference", "betweenTail", "close", "after", "_1", "text", "node", "_", "state", "info", "checkRuleRepetition", "state", "repetition", "thematicBreak", "_", "_1", "state", "value", "checkRule", "checkRuleRepetition", "handle", "blockquote", "hardBreak", "code", "definition", "emphasis", "heading", "html", "image", "imageReference", "inlineCode", "link", "linkReference", "list", "listItem", "paragraph", "root", "strong", "text", "thematicBreak", "join", "joinDefaults", "left", "right", "parent", "state", "formatCodeAsIndented", "formatHeadingAsSetext", "fullPhrasingSpans", "unsafe", "association", "node", "decodeString", "compilePattern", "pattern", "before", "containerPhrasing", "parent", "state", "info", "indexStack", "children", "results", "index", "before", "encodeAfter", "tracker", "child", "after", "handle", "value", "encodeCharacterReference", "encodingInfo", "containerFlow", "parent", "state", "info", "indexStack", "children", "tracker", "results", "index", "child", "between", "left", "right", "result", "eol", "indentLines", "value", "map", "result", "start", "line", "match", "one", "safe", "state", "input", "config", "value", "positions", "result", "infos", "index", "pattern", "patternInScope", "expression", "match", "before", "after", "position", "numerical", "start", "end", "escapeBackslashes", "encodeCharacterReference", "a", "b", "results", "whole", "track", "config", "options", "now", "lineShift", "line", "column", "move", "current", "shift", "value", "input", "chunks", "tail", "toMarkdown", "tree", "options", "settings", "state", "association", "containerPhrasingBound", "containerFlowBound", "track", "compilePattern", "enter", "handle", "indentLines", "join", "safeBound", "unsafe", "configure", "joinDefinition", "zwitch", "invalid", "unknown", "result", "name", "exit", "value", "node", "left", "right", "parent", "info", "containerPhrasing", "containerFlow", "config", "safe", "remarkStringify", "options", "self", "compiler", "tree", "toMarkdown", "bail", "error", "import_extend", "isPlainObject", "value", "prototype", "trough", "fns", "pipeline", "run", "use", "values", "middlewareIndex", "callback", "next", "error", "output", "fn", "index", "wrap", "middelware", "middleware", "called", "wrapped", "parameters", "fnExpectsCallback", "result", "done", "exception", "then", "value", "VFileMessage", "causeOrReason", "optionsOrParentOrPlace", "origin", "reason", "options", "legacyCause", "index", "parent", "start", "stringifyPosition", "minpath", "basename", "dirname", "extname", "join", "path", "assertPath", "start", "end", "index", "seenNonSlash", "firstNonSlashEnd", "extnameIndex", "unmatchedSlash", "startPart", "startDot", "preDotState", "code", "segments", "joined", "normalize", "absolute", "value", "normalizeString", "allowAboveRoot", "result", "lastSegmentLength", "lastSlash", "dots", "lastSlashIndex", "minproc", "cwd", "isUrl", "fileUrlOrPath", "urlToPath", "path", "isUrl", "error", "getPathFromURLPosix", "url", "pathname", "index", "third", "order", "VFile", "value", "options", "isUrl", "isUint8Array", "minproc", "index", "field", "minpath", "basename", "assertNonEmpty", "assertPart", "dirname", "assertPath", "extname", "path", "urlToPath", "stem", "causeOrReason", "optionsOrParentOrPlace", "origin", "message", "VFileMessage", "encoding", "part", "name", "CallableInstance", "property", "proto", "value", "apply", "own", "Processor", "_Processor", "CallableInstance", "trough", "destination", "index", "attacher", "extend", "key", "value", "assertUnfrozen", "self", "options", "transformer", "file", "realFile", "vfile", "parser", "assertParser", "done", "assertCompiler", "executor", "resolve", "reject", "parseTree", "error", "tree", "realDone", "compileTree", "compileResult", "looksLikeAValue", "complete", "result", "assertDone", "bail", "assertNode", "transformers", "outputTree", "resultingTree", "compiler", "parameters", "attachers", "namespace", "addPlugin", "addList", "addPreset", "add", "plugin", "plugins", "thing", "entryIndex", "primary", "rest", "currentPrimary", "isPlainObject", "unified", "name", "frozen", "node", "asyncName", "looksLikeAVFile", "VFile", "isUint8Array", "remark", "unified", "remarkParse", "remarkStringify", "jsx", "jsxs", "renderNode", "node", "index", "fontSize", "fontWeight", "View", "Text", "child", "i", "item", "j", "React", "Markdown", "children", "text", "markdown", "style", "props", "markdownText", "tree", "remark", "remarkParse", "error", "PDF_COMPONENTS", "Page", "View", "Text", "Image", "d", "y", "a", "p", "QrCode_default", "Map", "Markdown", "jsx", "PdfGenerator", "data", "template", "templateObject", "parseJson", "dataObject", "font", "Font", "componentData", "images", "renderedComponents", "renderPdfComponent", "PDF_COMPONENTS", "Document", "generatePdf", "template", "data", "templateObj", "parseError", "dataObj", "document", "React", "PdfGenerator", "pdf", "error", "pdfError"]
 }