lalph 0.1.87 → 0.1.91

package/dist/cli.mjs

@@ -488,7 +488,7 @@ function isString$1(input) {
 * @category guards
 * @since 2.0.0
 */
-function isNumber(input) {
+function isNumber$1(input) {
 	return typeof input === "number";
 }
 /**
@@ -610,7 +610,7 @@ function isSymbol(input) {
 * @since 4.0.0
 */
 function isPropertyKey(u) {
-	return isString$1(u) || isNumber(u) || isSymbol(u);
+	return isString$1(u) || isNumber$1(u) || isSymbol(u);
 }
 /**
 * Checks whether a value is a `function`.
@@ -2791,7 +2791,7 @@ const TaggedError = TaggedError$1;
 * @category constructors
 * @since 2.0.0
 */
-function make$53(compare) {
+function make$54(compare) {
 	return (self$1, that) => self$1 === that ? 0 : compare(self$1, that);
 }
 /**
@@ -2825,7 +2825,7 @@ function make$53(compare) {
 * @category instances
 * @since 4.0.0
 */
-const String$5 = /* @__PURE__ */ make$53((self$1, that) => self$1 < that ? -1 : 1);
+const String$5 = /* @__PURE__ */ make$54((self$1, that) => self$1 < that ? -1 : 1);
 /**
 * An `Order` instance for numbers that compares them numerically.
 *
@@ -2861,7 +2861,7 @@ const String$5 = /* @__PURE__ */ make$53((self$1, that) => self$1 < that ? -1 :
 * @category instances
 * @since 4.0.0
 */
-const Number$4 = /* @__PURE__ */ make$53((self$1, that) => {
+const Number$5 = /* @__PURE__ */ make$54((self$1, that) => {
 	if (globalThis.Number.isNaN(self$1) && globalThis.Number.isNaN(that)) return 0;
 	if (globalThis.Number.isNaN(self$1)) return -1;
 	if (globalThis.Number.isNaN(that)) return 1;
@@ -2897,7 +2897,7 @@ const Number$4 = /* @__PURE__ */ make$53((self$1, that) => {
 * @category instances
 * @since 4.0.0
 */
-const BigInt$3 = /* @__PURE__ */ make$53((self$1, that) => self$1 < that ? -1 : 1);
+const BigInt$3 = /* @__PURE__ */ make$54((self$1, that) => self$1 < that ? -1 : 1);
 /**
 * Transforms an `Order` on type `A` into an `Order` on type `B` by providing a function that
 * maps values of type `B` to values of type `A`.
@@ -2932,7 +2932,7 @@ const BigInt$3 = /* @__PURE__ */ make$53((self$1, that) => self$1 < that ? -1 :
 * @category mapping
 * @since 2.0.0
 */
-const mapInput = /* @__PURE__ */ dual(2, (self$1, f) => make$53((b1, b2) => self$1(f(b1), f(b2))));
+const mapInput = /* @__PURE__ */ dual(2, (self$1, f) => make$54((b1, b2) => self$1(f(b1), f(b2))));
 /**
 * An `Order` instance for `Date` objects that compares them chronologically by their timestamp.
 *
@@ -2966,7 +2966,7 @@ const mapInput = /* @__PURE__ */ dual(2, (self$1, f) => make$53((b1, b2) => self
 * @category instances
 * @since 2.0.0
 */
-const Date$2 = /* @__PURE__ */ mapInput(Number$4, (date$2) => date$2.getTime());
+const Date$2 = /* @__PURE__ */ mapInput(Number$5, (date$2) => date$2.getTime());
 /**
 * Creates an `Order` for a tuple type based on orders for each element.
 *
@@ -3001,7 +3001,7 @@ const Date$2 = /* @__PURE__ */ mapInput(Number$4, (date$2) => date$2.getTime());
 * @since 4.0.0
 */
 function Tuple$2(elements) {
-	return make$53((self$1, that) => {
+	return make$54((self$1, that) => {
 		const len = elements.length;
 		for (let i = 0; i < len; i++) {
 			const o = elements[i](self$1[i], that[i]);
@@ -3045,7 +3045,7 @@ function Tuple$2(elements) {
 * @since 4.0.0
 */
 function Array$4(O) {
-	return make$53((self$1, that) => {
+	return make$54((self$1, that) => {
 		const aLen = self$1.length;
 		const bLen = that.length;
 		const len = Math.min(aLen, bLen);
@@ -3053,7 +3053,7 @@ function Array$4(O) {
 			const o = O(self$1[i], that[i]);
 			if (o !== 0) return o;
 		}
-		return Number$4(aLen, bLen);
+		return Number$5(aLen, bLen);
 	});
 }
 /**
@@ -3099,7 +3099,7 @@ function Array$4(O) {
 */
 function Struct$2(fields) {
 	const keys$1 = Object.keys(fields);
-	return make$53((self$1, that) => {
+	return make$54((self$1, that) => {
 		for (const key of keys$1) {
 			const o = fields[key](self$1[key], that[key]);
 			if (o !== 0) return o;
@@ -3410,7 +3410,7 @@ const liftThrowable = (f) => (...a) => {
 
 //#endregion
 //#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/Duration.js
-const TypeId$56 = "~effect/time/Duration";
+const TypeId$57 = "~effect/time/Duration";
 const bigint0$1 = /* @__PURE__ */ BigInt(0);
 const bigint24 = /* @__PURE__ */ BigInt(24);
 const bigint60 = /* @__PURE__ */ BigInt(60);
@@ -3436,9 +3436,9 @@ const DURATION_REGEXP = /^(-?\d+(?:\.\d+)?)\s+(nanos?|micros?|millis?|seconds?|m
 */
 const fromDurationInputUnsafe = (input) => {
 	if (isDuration(input)) return input;
-	if (isNumber(input)) return millis(input);
+	if (isNumber$1(input)) return millis(input);
 	if (isBigInt(input)) return nanos(input);
-	if (Array.isArray(input) && input.length === 2 && input.every(isNumber)) {
+	if (Array.isArray(input) && input.length === 2 && input.every(isNumber$1)) {
 		if (input[0] === -Infinity || input[1] === -Infinity || Number.isNaN(input[0]) || Number.isNaN(input[1])) return zero;
 		if (input[0] === Infinity || input[1] === Infinity) return infinity;
 		return nanos(BigInt(Math.round(input[0] * 1e9)) + BigInt(Math.round(input[1])));
@@ -3494,7 +3494,7 @@ const zeroDurationValue = {
 };
 const infinityDurationValue = { _tag: "Infinity" };
 const DurationProto = {
-	[TypeId$56]: TypeId$56,
+	[TypeId$57]: TypeId$57,
 	[symbol$3]() {
 		return structure(this.value);
 	},
@@ -3533,9 +3533,9 @@ const DurationProto = {
 		return pipeArguments(this, arguments);
 	}
 };
-const make$52 = (input) => {
+const make$53 = (input) => {
 	const duration = Object.create(DurationProto);
-	if (isNumber(input)) if (isNaN(input) || input <= 0) duration.value = zeroDurationValue;
+	if (isNumber$1(input)) if (isNaN(input) || input <= 0) duration.value = zeroDurationValue;
 	else if (!Number.isFinite(input)) duration.value = infinityDurationValue;
 	else if (!Number.isInteger(input)) duration.value = {
 		_tag: "Nanos",
@@ -3566,7 +3566,7 @@ const make$52 = (input) => {
 * @since 2.0.0
 * @category guards
 */
-const isDuration = (u) => hasProperty(u, TypeId$56);
+const isDuration = (u) => hasProperty(u, TypeId$57);
 /**
 * Checks if a Duration is finite (not infinite).
 *
@@ -3616,7 +3616,7 @@ const isZero = (self$1) => {
 * @since 2.0.0
 * @category constructors
 */
-const zero = /* @__PURE__ */ make$52(0);
+const zero = /* @__PURE__ */ make$53(0);
 /**
 * A Duration representing infinite time.
 *
@@ -3630,7 +3630,7 @@ const zero = /* @__PURE__ */ make$52(0);
 * @since 2.0.0
 * @category constructors
 */
-const infinity = /* @__PURE__ */ make$52(Infinity);
+const infinity = /* @__PURE__ */ make$53(Infinity);
 /**
 * Creates a Duration from nanoseconds.
 *
@@ -3645,7 +3645,7 @@ const infinity = /* @__PURE__ */ make$52(Infinity);
 * @since 2.0.0
 * @category constructors
 */
-const nanos = (nanos$1) => make$52(nanos$1);
+const nanos = (nanos$1) => make$53(nanos$1);
 /**
 * Creates a Duration from microseconds.
 *
@@ -3660,7 +3660,7 @@ const nanos = (nanos$1) => make$52(nanos$1);
 * @since 2.0.0
 * @category constructors
 */
-const micros = (micros$1) => make$52(micros$1 * bigint1e3);
+const micros = (micros$1) => make$53(micros$1 * bigint1e3);
 /**
 * Creates a Duration from milliseconds.
 *
@@ -3675,7 +3675,7 @@ const micros = (micros$1) => make$52(micros$1 * bigint1e3);
 * @since 2.0.0
 * @category constructors
 */
-const millis = (millis$1) => make$52(millis$1);
+const millis = (millis$1) => make$53(millis$1);
 /**
 * Creates a Duration from seconds.
 *
@@ -3690,7 +3690,7 @@ const millis = (millis$1) => make$52(millis$1);
 * @since 2.0.0
 * @category constructors
 */
-const seconds = (seconds$1) => make$52(seconds$1 * 1e3);
+const seconds = (seconds$1) => make$53(seconds$1 * 1e3);
 /**
 * Creates a Duration from minutes.
 *
@@ -3705,7 +3705,7 @@ const seconds = (seconds$1) => make$52(seconds$1 * 1e3);
 * @since 2.0.0
 * @category constructors
 */
-const minutes = (minutes$1) => make$52(minutes$1 * 6e4);
+const minutes = (minutes$1) => make$53(minutes$1 * 6e4);
 /**
 * Creates a Duration from hours.
 *
@@ -3720,7 +3720,7 @@ const minutes = (minutes$1) => make$52(minutes$1 * 6e4);
 * @since 2.0.0
 * @category constructors
 */
-const hours = (hours$1) => make$52(hours$1 * 36e5);
+const hours = (hours$1) => make$53(hours$1 * 36e5);
 /**
 * Creates a Duration from days.
 *
@@ -3735,7 +3735,7 @@ const hours = (hours$1) => make$52(hours$1 * 36e5);
 * @since 2.0.0
 * @category constructors
 */
-const days = (days$1) => make$52(days$1 * 864e5);
+const days = (days$1) => make$53(days$1 * 864e5);
 /**
 * Creates a Duration from weeks.
 *
@@ -3750,7 +3750,7 @@ const days = (days$1) => make$52(days$1 * 864e5);
 * @since 2.0.0
 * @category constructors
 */
-const weeks = (weeks$1) => make$52(weeks$1 * 6048e5);
+const weeks = (weeks$1) => make$53(weeks$1 * 6048e5);
 /**
 * Converts a Duration to milliseconds.
 *
@@ -4065,7 +4065,7 @@ const format$2 = (self$1) => {
 * @category constructors
 * @since 2.0.0
 */
-const make$51 = (isEquivalent) => (self$1, that) => self$1 === that || isEquivalent(self$1, that);
+const make$52 = (isEquivalent) => (self$1, that) => self$1 === that || isEquivalent(self$1, that);
 const isStrictEquivalent = (x, y) => x === y;
 /**
 * Creates an equivalence relation that uses strict equality (`===`) to compare values.
@@ -4175,7 +4175,7 @@ const strictEqual = () => isStrictEquivalent;
 * @since 4.0.0
 */
 function Tuple$1(elements) {
-	return make$51((self$1, that) => {
+	return make$52((self$1, that) => {
 		if (self$1.length !== that.length) return false;
 		for (let i = 0; i < self$1.length; i++) if (!elements[i](self$1[i], that[i])) return false;
 		return true;
@@ -4232,7 +4232,7 @@ function Tuple$1(elements) {
 * @since 4.0.0
 */
 function Array$3(item) {
-	return make$51((self$1, that) => {
+	return make$52((self$1, that) => {
 		if (self$1.length !== that.length) return false;
 		for (let i = 0; i < self$1.length; i++) if (!item(self$1[i], that[i])) return false;
 		return true;
@@ -4308,7 +4308,7 @@ function Array$3(item) {
 */
 function Struct$1(fields) {
 	const keys$1 = Reflect.ownKeys(fields);
-	return make$51((self$1, that) => {
+	return make$52((self$1, that) => {
 		for (const key of keys$1) if (!fields[key](self$1[key], that[key])) return false;
 		return true;
 	});
@@ -4319,9 +4319,9 @@ function Struct$1(fields) {
 /**
 * @since 2.0.0
 */
-const TypeId$55 = "~effect/data/Option";
+const TypeId$56 = "~effect/data/Option";
 const CommonProto$1 = {
-	[TypeId$55]: { _A: (_) => _ },
+	[TypeId$56]: { _A: (_) => _ },
 	...PipeInspectableProto,
 	...YieldableProto
 };
@@ -4372,7 +4372,7 @@ const NoneProto = /* @__PURE__ */ Object.assign(/* @__PURE__ */ Object.create(Co
 	}
 });
 /** @internal */
-const isOption$1 = (input) => hasProperty(input, TypeId$55);
+const isOption$1 = (input) => hasProperty(input, TypeId$56);
 /** @internal */
 const isNone$1 = (fa) => fa._tag === "None";
 /** @internal */
@@ -4388,9 +4388,9 @@ const some$1 = (value) => {
 
 //#endregion
 //#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/internal/result.js
-const TypeId$54 = "~effect/data/Result";
+const TypeId$55 = "~effect/data/Result";
 const CommonProto = {
-	[TypeId$54]: {
+	[TypeId$55]: {
 		_A: (_) => _,
 		_E: (_) => _
 	},
@@ -4444,7 +4444,7 @@ const FailureProto = /* @__PURE__ */ Object.assign(/* @__PURE__ */ Object.create
 	}
 });
 /** @internal */
-const isResult$1 = (input) => hasProperty(input, TypeId$54);
+const isResult$1 = (input) => hasProperty(input, TypeId$55);
 /** @internal */
 const isFailure$5 = (result$2) => result$2._tag === "Failure";
 /** @internal */
@@ -5025,7 +5025,7 @@ const filterMap$2 = flatMap$3;
 * @category Filtering
 * @since 2.0.0
 */
-const filter$5 = /* @__PURE__ */ dual(2, (self$1, predicate) => filterMap$2(self$1, (b) => predicate(b) ? some$1(b) : none$4));
+const filter$6 = /* @__PURE__ */ dual(2, (self$1, predicate) => filterMap$2(self$1, (b) => predicate(b) ? some$1(b) : none$4));
 /**
 * Creates an `Equivalence` instance for comparing `Option` values, using a
 * provided `Equivalence` for the inner type.
@@ -5066,7 +5066,7 @@ const filter$5 = /* @__PURE__ */ dual(2, (self$1, predicate) => filterMap$2(self
 * @category Equivalence
 * @since 2.0.0
 */
-const makeEquivalence$4 = (isEquivalent) => make$51((x, y) => isNone(x) ? isNone(y) : isNone(y) ? false : isEquivalent(x.value, y.value));
+const makeEquivalence$4 = (isEquivalent) => make$52((x, y) => isNone(x) ? isNone(y) : isNone(y) ? false : isEquivalent(x.value, y.value));
 
 //#endregion
 //#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/Result.js
@@ -5475,7 +5475,7 @@ const has$2 = (key) => (input) => input.has(key) ? input : fail$8(input);
 * @since 4.0.0
 * @category Constructors
 */
-const number$1 = /* @__PURE__ */ fromPredicate(isNumber);
+const number$1 = /* @__PURE__ */ fromPredicate(isNumber$1);
 /**
 * A predefined filter that only passes through boolean values.
 *
@@ -5912,7 +5912,7 @@ const map$11 = /* @__PURE__ */ dual(2, (self$1, f) => {
 * @category filtering
 * @since 2.0.0
 */
-const filter$4 = /* @__PURE__ */ dual(2, (self$1, predicate) => {
+const filter$5 = /* @__PURE__ */ dual(2, (self$1, predicate) => {
 	const out = empty$13();
 	for (const key of keys(self$1)) if (predicate(self$1[key], key)) out[key] = self$1[key];
 	return out;
@@ -6420,7 +6420,7 @@ const map$10 = /* @__PURE__ */ dual(2, (self$1, f) => self$1.map(f));
 * @category filtering
 * @since 2.0.0
 */
-const filter$3 = /* @__PURE__ */ dual(2, (self$1, predicate) => {
+const filter$4 = /* @__PURE__ */ dual(2, (self$1, predicate) => {
 	const as$3 = fromIterable$2(self$1);
 	const out = [];
 	for (let i = 0; i < as$3.length; i++) if (predicate(as$3[i], i)) out.push(as$3[i]);
@@ -6571,23 +6571,23 @@ const ServiceProto = {
 		};
 	},
 	asEffect() {
-		return (this.asEffect = constant(withFiber$1((fiber$2) => exitSucceed(get$7(fiber$2.services, this)))))();
+		return (this.asEffect = constant(withFiber$1((fiber$2) => exitSucceed(get$8(fiber$2.services, this)))))();
 	},
 	of(self$1) {
 		return self$1;
 	},
 	serviceMap(self$1) {
-		return make$50(this, self$1);
+		return make$51(this, self$1);
 	},
 	use(f) {
-		return withFiber$1((fiber$2) => f(get$7(fiber$2.services, this)));
+		return withFiber$1((fiber$2) => f(get$8(fiber$2.services, this)));
 	},
 	useSync(f) {
-		return withFiber$1((fiber$2) => exitSucceed(f(get$7(fiber$2.services, this))));
+		return withFiber$1((fiber$2) => exitSucceed(f(get$8(fiber$2.services, this))));
 	}
 };
 const ReferenceTypeId = "~effect/ServiceMap/Reference";
-const TypeId$53 = "~effect/ServiceMap";
+const TypeId$54 = "~effect/ServiceMap";
 /**
 * @example
 * ```ts
@@ -6611,7 +6611,7 @@ const makeUnsafe$8 = (mapUnsafe) => {
 };
 const Proto$19 = {
 	...PipeInspectableProto,
-	[TypeId$53]: { _Services: (_) => _ },
+	[TypeId$54]: { _Services: (_) => _ },
 	toJSON() {
 		return {
 			_id: "ServiceMap",
@@ -6644,7 +6644,7 @@ const Proto$19 = {
 * @since 4.0.0
 * @category Guards
 */
-const isServiceMap = (u) => hasProperty(u, TypeId$53);
+const isServiceMap = (u) => hasProperty(u, TypeId$54);
 /**
 * Checks if the provided argument is a `Reference`.
 *
@@ -6699,7 +6699,7 @@ const emptyServiceMap = /* @__PURE__ */ makeUnsafe$8(/* @__PURE__ */ new Map());
 * @since 4.0.0
 * @category Constructors
 */
-const make$50 = (key, service$2) => makeUnsafe$8(new Map([[key.key, service$2]]));
+const make$51 = (key, service$2) => makeUnsafe$8(new Map([[key.key, service$2]]));
 /**
 * Adds a service to a given `ServiceMap`.
 *
@@ -6800,7 +6800,7 @@ const getUnsafe = /* @__PURE__ */ dual(2, (self$1, service$2) => {
 * @since 4.0.0
 * @category Getters
 */
-const get$7 = getUnsafe;
+const get$8 = getUnsafe;
 /**
 * @example
 * ```ts
@@ -7243,7 +7243,7 @@ var ParentSpan = class extends Service()(ParentSpanKey) {};
 * })
 * ```
 */
-const make$49 = (options) => options;
+const make$50 = (options) => options;
 /**
 * @since 2.0.0
 * @category constructors
@@ -7312,7 +7312,7 @@ const TracerKey = "effect/Tracer";
 * })
 * ```
 */
-const Tracer = /* @__PURE__ */ Reference(TracerKey, { defaultValue: () => make$49({ span: (name, parent, annotations$1, links, startTime, kind) => new NativeSpan(name, parent, annotations$1, links.slice(), startTime, kind) }) });
+const Tracer = /* @__PURE__ */ Reference(TracerKey, { defaultValue: () => make$50({ span: (name, parent, annotations$1, links, startTime, kind) => new NativeSpan(name, parent, annotations$1, links.slice(), startTime, kind) }) });
 /**
 * @since 4.0.0
 * @category native tracer
@@ -8212,10 +8212,10 @@ var FiberImpl = class {
 	interruptUnsafe(fiberId$2, annotations$1) {
 		if (this._exit) return;
 		let cause = causeInterrupt(fiberId$2);
-		if (this.currentStackFrame) cause = causeAnnotate(cause, make$50(StackTraceKey, this.currentStackFrame));
+		if (this.currentStackFrame) cause = causeAnnotate(cause, make$51(StackTraceKey, this.currentStackFrame));
 		if (annotations$1) cause = causeAnnotate(cause, annotations$1);
 		this._interruptedCause = this._interruptedCause ? causeMerge(this._interruptedCause, cause) : cause;
-		if (this.interruptible) this.evaluate(failCause$4(this._interruptedCause));
+		if (this.interruptible) this.evaluate(failCause$5(this._interruptedCause));
 	}
 	pollUnsafe() {
 		return this._exit;
@@ -8399,7 +8399,7 @@ const fiberInterruptAllAs = /* @__PURE__ */ dual(2, (fibers, fiberId$2) => withF
 /** @internal */
 const succeed$5 = exitSucceed;
 /** @internal */
-const failCause$4 = exitFailCause;
+const failCause$5 = exitFailCause;
 /** @internal */
 const fail$7 = exitFail;
 /** @internal */
@@ -8447,7 +8447,7 @@ const succeedSome$1 = (a) => succeed$5(some(a));
 /** @internal */
 const succeedNone$1 = /* @__PURE__ */ succeed$5(/* @__PURE__ */ none$3());
 /** @internal */
-const failCauseSync$1 = (evaluate$1) => suspend$4(() => failCause$4(internalCall(evaluate$1)));
+const failCauseSync$1 = (evaluate$1) => suspend$4(() => failCause$5(internalCall(evaluate$1)));
 /** @internal */
 const die$4 = (defect) => exitDie(defect);
 /** @internal */
@@ -8523,7 +8523,7 @@ const asyncFinalizer = /* @__PURE__ */ makePrimitive$1({
 		}
 	},
 	[contE](cause, _fiber) {
-		return causeHasInterrupt(cause) ? flatMap$2(this[args](), () => failCause$4(cause)) : failCause$4(cause);
+		return causeHasInterrupt(cause) ? flatMap$2(this[args](), () => failCause$5(cause)) : failCause$5(cause);
 	}
 });
 /** @internal */
@@ -8670,7 +8670,7 @@ const raceAll$1 = (all$2, options) => withFiber$1((parent) => callback$2((resume
 		doneCount++;
 		if (exit$2._tag === "Failure") {
 			failures.push(...exit$2.cause.failures);
-			if (doneCount >= len) resume(failCause$4(causeFromFailures(failures)));
+			if (doneCount >= len) resume(failCause$5(causeFromFailures(failures)));
 			return;
 		}
 		const isWinner = !done$3;
@@ -8872,7 +8872,7 @@ const provideServices$1 = /* @__PURE__ */ dual(2, (self$1, services$2) => {
 	return updateServices$1(self$1, merge$5(services$2));
 });
 /** @internal */
-const provideService$1 = function() {
+const provideService$2 = function() {
 	if (arguments.length === 1) return dual(2, (self$1, impl) => provideServiceImpl(self$1, arguments[0], impl));
 	return dual(3, (self$1, service$2, impl) => provideServiceImpl(self$1, service$2, impl)).apply(this, arguments);
 };
@@ -8882,9 +8882,9 @@ const provideServiceImpl = (self$1, service$2, implementation) => withFiber$1((f
 	return onExit$3(self$1, () => fiber$2.setServices(addOrOmit(fiber$2.services, service$2, prev)));
 });
 /** @internal */
-const provideServiceEffect$1 = /* @__PURE__ */ dual(3, (self$1, service$2, acquire) => flatMap$2(acquire, (implementation) => provideService$1(self$1, service$2, implementation)));
+const provideServiceEffect$2 = /* @__PURE__ */ dual(3, (self$1, service$2, acquire) => flatMap$2(acquire, (implementation) => provideService$2(self$1, service$2, implementation)));
 /** @internal */
-const withConcurrency$1 = /* @__PURE__ */ provideService$1(CurrentConcurrency);
+const withConcurrency$1 = /* @__PURE__ */ provideService$2(CurrentConcurrency);
 /** @internal */
 const zip$1 = /* @__PURE__ */ dual((args$1) => isEffect$1(args$1[1]), (self$1, that, options) => zipWith$1(self$1, that, (a, a2) => [a, a2], options));
 /** @internal */
@@ -8917,21 +8917,21 @@ const OnFailureProto = /* @__PURE__ */ makePrimitiveProto({
 	}
 });
 /** @internal */
-const catchCauseFilter$2 = /* @__PURE__ */ dual(3, (self$1, filter$6, f) => catchCause$2(self$1, (cause) => {
-	const eb = filter$6(cause);
-	return !isFail(eb) ? internalCall(() => f(eb, cause)) : failCause$4(eb.fail);
+const catchCauseFilter$2 = /* @__PURE__ */ dual(3, (self$1, filter$7, f) => catchCause$2(self$1, (cause) => {
+	const eb = filter$7(cause);
+	return !isFail(eb) ? internalCall(() => f(eb, cause)) : failCause$5(eb.fail);
 }));
 /** @internal */
 const catch_$2 = /* @__PURE__ */ dual(2, (self$1, f) => catchCauseFilter$2(self$1, causeFilterError, (e) => f(e)));
 /** @internal */
 const catchDefect$1 = /* @__PURE__ */ dual(2, (self$1, f) => catchCauseFilter$2(self$1, causeFilterDefect, f));
 /** @internal */
-const tapCause$1 = /* @__PURE__ */ dual(2, (self$1, f) => catchCause$2(self$1, (cause) => andThen$1(internalCall(() => f(cause)), failCause$4(cause))));
+const tapCause$1 = /* @__PURE__ */ dual(2, (self$1, f) => catchCause$2(self$1, (cause) => andThen$1(internalCall(() => f(cause)), failCause$5(cause))));
 /** @internal */
-const tapCauseFilter$1 = /* @__PURE__ */ dual(3, (self$1, filter$6, f) => catchCauseFilter$2(self$1, (cause) => {
-	const result$2 = filter$6(cause);
+const tapCauseFilter$1 = /* @__PURE__ */ dual(3, (self$1, filter$7, f) => catchCauseFilter$2(self$1, (cause) => {
+	const result$2 = filter$7(cause);
 	return isFail(result$2) ? fail$8(cause) : result$2;
-}, (failure, cause) => andThen$1(internalCall(() => f(failure, cause)), failCause$4(cause))));
+}, (failure, cause) => andThen$1(internalCall(() => f(failure, cause)), failCause$5(cause))));
 /** @internal */
 const tapError$1 = /* @__PURE__ */ dual(2, (self$1, f) => tapCauseFilter$1(self$1, causeFilterError, (e) => f(e)));
 /** @internal */
@@ -8944,11 +8944,11 @@ const tapDefect$1 = /* @__PURE__ */ dual(2, (self$1, f) => tapCauseFilter$1(self
 /** @internal */
 const catchIf$1 = /* @__PURE__ */ dual(3, (self$1, predicate, f) => catchCause$2(self$1, (cause) => {
 	const error$1 = causeFilterError(cause);
-	if (isFail(error$1)) return failCause$4(error$1.fail);
-	return predicate(error$1) ? internalCall(() => f(error$1)) : failCause$4(cause);
+	if (isFail(error$1)) return failCause$5(error$1.fail);
+	return predicate(error$1) ? internalCall(() => f(error$1)) : failCause$5(cause);
 }));
 /** @internal */
-const catchFilter$1 = /* @__PURE__ */ dual(3, (self$1, filter$6, f) => catchCauseFilter$2(self$1, compose(causeFilterError, mapFail(filter$6, causeFail)), (e) => f(e)));
+const catchFilter$1 = /* @__PURE__ */ dual(3, (self$1, filter$7, f) => catchCauseFilter$2(self$1, compose(causeFilterError, mapFail(filter$7, causeFail)), (e) => f(e)));
 /** @internal */
 const catchTag$1 = /* @__PURE__ */ dual(3, (self$1, k, f) => {
 	const pred = Array.isArray(k) ? (e) => hasProperty(e, "_tag") && k.includes(e._tag) : isTagged(k);
@@ -9037,7 +9037,7 @@ const matchCause$1 = /* @__PURE__ */ dual(2, (self$1, options) => matchCauseEffe
 const matchEffect$2 = /* @__PURE__ */ dual(2, (self$1, options) => matchCauseEffect$1(self$1, {
 	onFailure: (cause) => {
 		const fail$11 = cause.failures.find(failureIsFail$1);
-		return fail$11 ? internalCall(() => options.onFailure(fail$11.error)) : failCause$4(cause);
+		return fail$11 ? internalCall(() => options.onFailure(fail$11.error)) : failCause$5(cause);
 	},
 	onSuccess: options.onSuccess
 }));
@@ -9192,7 +9192,7 @@ const scopeMake = (finalizerStrategy) => sync$1(() => scopeMakeUnsafe(finalizerS
 /** @internal */
 const scope$1 = /* @__PURE__ */ scopeTag.asEffect();
 /** @internal */
-const provideScope = /* @__PURE__ */ provideService$1(scopeTag);
+const provideScope = /* @__PURE__ */ provideService$2(scopeTag);
 /** @internal */
 const scoped$2 = (self$1) => withFiber$1((fiber$2) => {
 	const prev = getOption(fiber$2.services, scopeTag);
@@ -9245,14 +9245,14 @@ const onExitInterruptible$1 = /* @__PURE__ */ dual(2, (self$1, f) => onExitPrimi
 /** @internal */
 const ensuring$1 = /* @__PURE__ */ dual(2, (self$1, finalizer) => onExit$3(self$1, (_) => finalizer));
 /** @internal */
-const onExitFilter$1 = /* @__PURE__ */ dual(3, (self$1, filter$6, f) => onExit$3(self$1, (exit$2) => {
-	const b = filter$6(exit$2);
+const onExitFilter$1 = /* @__PURE__ */ dual(3, (self$1, filter$7, f) => onExit$3(self$1, (exit$2) => {
+	const b = filter$7(exit$2);
 	return isFail(b) ? void 0 : f(b, exit$2);
 }));
 /** @internal */
 const onError$1 = /* @__PURE__ */ dual(2, (self$1, f) => onExitFilter$1(self$1, exitFilterCause, f));
 /** @internal */
-const onErrorFilter$1 = /* @__PURE__ */ dual(3, (self$1, filter$6, f) => onExitFilter$1(self$1, compose(exitFilterCause, filter$6), (eb, exit$2) => f(eb, exit$2.cause)));
+const onErrorFilter$1 = /* @__PURE__ */ dual(3, (self$1, filter$7, f) => onExitFilter$1(self$1, compose(exitFilterCause, filter$7), (eb, exit$2) => f(eb, exit$2.cause)));
 /** @internal */
 const onInterrupt$1 = /* @__PURE__ */ dual(2, (self$1, finalizer) => onErrorFilter$1(self$1, causeFilterInterruptors, isEffect$1(finalizer) ? constant(finalizer) : finalizer));
 /** @internal */
@@ -9289,7 +9289,7 @@ const cachedWithTTL$1 = /* @__PURE__ */ dual(2, (self$1, timeToLive) => map$9(ca
 /** @internal */
 const cached$1 = (self$1) => cachedWithTTL$1(self$1, infinity);
 /** @internal */
-const interrupt$4 = /* @__PURE__ */ withFiber$1((fiber$2) => failCause$4(causeInterrupt(fiber$2.id)));
+const interrupt$4 = /* @__PURE__ */ withFiber$1((fiber$2) => failCause$5(causeInterrupt(fiber$2.id)));
 /** @internal */
 const uninterruptible$1 = (self$1) => withFiber$1((fiber$2) => {
 	if (!fiber$2.interruptible) return self$1;
@@ -9301,7 +9301,7 @@ const setInterruptible = /* @__PURE__ */ makePrimitive$1({
 	op: "SetInterruptible",
 	[contAll](fiber$2) {
 		fiber$2.interruptible = this[args];
-		if (fiber$2._interruptedCause && fiber$2.interruptible) return () => failCause$4(fiber$2._interruptedCause);
+		if (fiber$2._interruptedCause && fiber$2.interruptible) return () => failCause$5(fiber$2._interruptedCause);
 	}
 });
 const setInterruptibleTrue = /* @__PURE__ */ setInterruptible(true);
@@ -9311,7 +9311,7 @@ const interruptible$1 = (self$1) => withFiber$1((fiber$2) => {
 	if (fiber$2.interruptible) return self$1;
 	fiber$2.interruptible = true;
 	fiber$2._stack.push(setInterruptibleFalse);
-	if (fiber$2._interruptedCause) return failCause$4(fiber$2._interruptedCause);
+	if (fiber$2._interruptedCause) return failCause$5(fiber$2._interruptedCause);
 	return self$1;
 });
 /** @internal */
@@ -9441,7 +9441,7 @@ const forEachSequential = (iterable, f, options) => suspend$4(() => {
 });
 const filterOrElse$1 = /* @__PURE__ */ dual(3, (self$1, predicate, orElse$1) => flatMap$2(self$1, (a) => predicate(a) ? succeed$5(a) : orElse$1(a)));
 /** @internal */
-const filter$2 = /* @__PURE__ */ dual((args$1) => isIterable(args$1[0]) && !isEffect$1(args$1[0]), (elements, predicate, options) => suspend$4(() => {
+const filter$3 = /* @__PURE__ */ dual((args$1) => isIterable(args$1[0]) && !isEffect$1(args$1[0]), (elements, predicate, options) => suspend$4(() => {
 	const out = [];
 	return as$1(forEach$2(elements, (a, i) => map$9(predicate(a, i), (keep) => {
 		if (keep) out.push(a);
@@ -9451,9 +9451,9 @@ const filter$2 = /* @__PURE__ */ dual((args$1) => isIterable(args$1[0]) && !isEf
 	}), out);
 }));
 /** @internal */
-const filterMap$1 = /* @__PURE__ */ dual((args$1) => isIterable(args$1[0]) && !isEffect$1(args$1[0]), (elements, filter$6, options) => suspend$4(() => {
+const filterMap$1 = /* @__PURE__ */ dual((args$1) => isIterable(args$1[0]) && !isEffect$1(args$1[0]), (elements, filter$7, options) => suspend$4(() => {
 	const out = [];
-	return as$1(forEach$2(elements, (a) => map$9(filter$6(a), (result$2) => {
+	return as$1(forEach$2(elements, (a) => map$9(filter$7(a), (result$2) => {
 		if (!isFail(result$2)) out.push(result$2);
 	}), {
 		discard: true,
@@ -9696,11 +9696,11 @@ const makeLatch$1 = (open$1) => sync$1(() => makeLatchUnsafe$1(open$1));
 /** @internal */
 const tracer$2 = /* @__PURE__ */ withFiber$1((fiber$2) => succeed$5(fiber$2.getRef(Tracer)));
 /** @internal */
-const withTracer$1 = /* @__PURE__ */ dual(2, (effect$1, tracer$3) => provideService$1(effect$1, Tracer, tracer$3));
+const withTracer$1 = /* @__PURE__ */ dual(2, (effect$1, tracer$3) => provideService$2(effect$1, Tracer, tracer$3));
 /** @internal */
-const withTracerEnabled$1 = /* @__PURE__ */ provideService$1(TracerEnabled);
+const withTracerEnabled$1 = /* @__PURE__ */ provideService$2(TracerEnabled);
 /** @internal */
-const withTracerTiming$1 = /* @__PURE__ */ provideService$1(TracerTimingEnabled);
+const withTracerTiming$1 = /* @__PURE__ */ provideService$2(TracerTimingEnabled);
 const bigint0 = /* @__PURE__ */ BigInt(0);
 const NoopSpanProto = {
 	_tag: "Span",
@@ -9724,11 +9724,11 @@ const NoopSpanProto = {
 /** @internal */
 const noopSpan = (options) => Object.assign(Object.create(NoopSpanProto), options);
 const filterDisablePropagation = (span) => {
-	if (span) return get$7(span.annotations, DisablePropagation) ? span._tag === "Span" ? filterDisablePropagation(span.parent) : void 0 : span;
+	if (span) return get$8(span.annotations, DisablePropagation) ? span._tag === "Span" ? filterDisablePropagation(span.parent) : void 0 : span;
 };
 /** @internal */
 const makeSpanUnsafe = (fiber$2, name, options) => {
-	const disablePropagation = !fiber$2.getRef(TracerEnabled) || options?.annotations && get$7(options.annotations, DisablePropagation);
+	const disablePropagation = !fiber$2.getRef(TracerEnabled) || options?.annotations && get$8(options.annotations, DisablePropagation);
 	const parent = options?.parent ?? (options?.root ? void 0 : filterDisablePropagation(fiber$2.currentSpan));
 	let span;
 	if (disablePropagation) span = noopSpan({
@@ -9808,7 +9808,7 @@ const useSpan$1 = (name, ...args$1) => {
 		});
 	});
 };
-const provideParentSpan = /* @__PURE__ */ provideService$1(ParentSpan);
+const provideParentSpan = /* @__PURE__ */ provideService$2(ParentSpan);
 /** @internal */
 const withParentSpan$1 = function() {
 	const dataFirst = isEffect$1(arguments[0]);
@@ -9962,7 +9962,7 @@ const logLevelToOrder = (level) => {
 	}
 };
 /** @internal */
-const LogLevelOrder = /* @__PURE__ */ mapInput(Number$4, logLevelToOrder);
+const LogLevelOrder = /* @__PURE__ */ mapInput(Number$5, logLevelToOrder);
 /** @internal */
 const isLogLevelGreaterThan = /* @__PURE__ */ isGreaterThan$4(LogLevelOrder);
 /** @internal */
@@ -10247,7 +10247,7 @@ const succeed$4 = exitSucceed;
 * @category constructors
 * @since 2.0.0
 */
-const failCause$3 = exitFailCause;
+const failCause$4 = exitFailCause;
 /**
 * Creates a failed `Exit` from an error value.
 *
@@ -10617,7 +10617,7 @@ const makeUnsafe$7 = () => {
 * @since 2.0.0
 * @category constructors
 */
-const make$48 = () => sync$1(() => makeUnsafe$7());
+const make$49 = () => sync$1(() => makeUnsafe$7());
 const _await = (self$1) => callback$2((resume) => {
 	if (self$1.effect) return resume(self$1.effect);
 	self$1.resumes ??= [];
@@ -10671,6 +10671,47 @@ const completeWith = /* @__PURE__ */ dual(2, (self$1, effect$1) => sync$1(() =>
 */
 const done$1 = completeWith;
 /**
+* Fails the `Deferred` with the specified `Cause`, which will be propagated to
+* all fibers waiting on the value of the `Deferred`.
+*
+* @example
+* ```ts
+* import { Cause, Deferred, Effect } from "effect"
+*
+* const program = Effect.gen(function*() {
+*   const deferred = yield* Deferred.make<number, string>()
+*   const success = yield* Deferred.failCause(
+*     deferred,
+*     Cause.fail("Operation failed")
+*   )
+*   console.log(success) // true
+* })
+* ```
+*
+* @since 2.0.0
+* @category utils
+*/
+const failCause$3 = /* @__PURE__ */ dual(2, (self$1, cause) => done$1(self$1, exitFailCause(cause)));
+/**
+* Completes the `Deferred` with interruption. This will interrupt all fibers
+* waiting on the value of the `Deferred` with the specified `FiberId`.
+*
+* @example
+* ```ts
+* import { Deferred, Effect } from "effect"
+*
+* const program = Effect.gen(function*() {
+*   const deferred = yield* Deferred.make<number>()
+*   const success = yield* Deferred.interruptWith(deferred, 42)
+*   console.log(success) // true
+* })
+* ```
+*
+* @since 2.0.0
+* @category utils
+*/
+const interruptWith = /* @__PURE__ */ dual(2, (self$1, fiberId$2) => failCause$3(self$1, causeInterrupt(fiberId$2)));
+/**
 * Returns `true` if this `Deferred` has already been completed with a value or
 * an error, `false` otherwise.
 *
@@ -10854,7 +10895,7 @@ const Scope = scopeTag;
 * @category constructors
 * @since 2.0.0
 */
-const make$47 = scopeMake;
+const make$48 = scopeMake;
 /**
 * Creates a new `Scope` synchronously without wrapping it in an `Effect`.
 * This is useful when you need a scope immediately but should be used with caution
@@ -11064,7 +11105,7 @@ const use$1 = scopeUse;
 
 //#endregion
 //#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/Layer.js
-const TypeId$52 = "~effect/Layer";
+const TypeId$53 = "~effect/Layer";
 const MemoMapTypeId = "~effect/Layer/MemoMap";
 /**
 * Returns `true` if the specified value is a `Layer`, `false` otherwise.
@@ -11089,9 +11130,9 @@ const MemoMapTypeId = "~effect/Layer/MemoMap";
 * @since 2.0.0
 * @category getters
 */
-const isLayer = (u) => hasProperty(u, TypeId$52);
+const isLayer = (u) => hasProperty(u, TypeId$53);
 const LayerProto = {
-	[TypeId$52]: {
+	[TypeId$53]: {
 		_ROut: identity,
 		_E: identity,
 		_RIn: identity
@@ -11291,7 +11332,7 @@ const CurrentMemoMap = /* @__PURE__ */ Reference("effect/Layer/CurrentMemoMap",
 * @since 2.0.0
 * @category memo map
 */
-const buildWithMemoMap = /* @__PURE__ */ dual(3, (self$1, memoMap, scope$2) => provideService$1(self$1.build(memoMap, scope$2), CurrentMemoMap, memoMap));
+const buildWithMemoMap = /* @__PURE__ */ dual(3, (self$1, memoMap, scope$2) => provideService$2(self$1.build(memoMap, scope$2), CurrentMemoMap, memoMap));
 /**
 * Builds a layer into a scoped value.
 *
@@ -11407,8 +11448,8 @@ const buildWithScope = /* @__PURE__ */ dual(2, (self$1, scope$2) => suspend$4(()
 * @category constructors
 */
 const succeed$2 = function() {
-	if (arguments.length === 1) return (resource) => succeedServices(make$50(arguments[0], resource));
-	return succeedServices(make$50(arguments[0], arguments[1]));
+	if (arguments.length === 1) return (resource) => succeedServices(make$51(arguments[0], resource));
+	return succeedServices(make$51(arguments[0], arguments[1]));
 };
 /**
 * Constructs a layer from the specified value, which must return one or more
@@ -11498,7 +11539,7 @@ const effect = function() {
 	const effectOrFn = arguments[1];
 	return typeof effectOrFn === "function" ? (...args$1) => effectImpl(arguments[0], suspend$4(() => effectOrFn(...args$1))) : effectImpl(arguments[0], effectOrFn);
 };
-const effectImpl = (service$2, effect$1) => effectServices(map$9(effect$1, (value) => make$50(service$2, value)));
+const effectImpl = (service$2, effect$1) => effectServices(map$9(effect$1, (value) => make$51(service$2, value)));
 /**
 * Constructs a layer from the specified scoped effect, which must return one
 * or more services.
@@ -11580,7 +11621,7 @@ const effectDiscard = (effect$1) => effectServices(as$1(effect$1, empty$11()));
 */
 const unwrap$3 = (self$1) => {
 	const service$2 = Service("effect/Layer/unwrap");
-	return flatMap$1(effect(service$2)(self$1), get$7(service$2));
+	return flatMap$1(effect(service$2)(self$1), get$8(service$2));
 };
 const mergeAllEffect = (layers, memoMap, scope$2) => {
 	const parentScope = forkUnsafe(scope$2, "parallel");
@@ -11889,9 +11930,9 @@ const fresh = (self$1) => fromBuildUnsafe((_, scope$2) => self$1.build(makeMemoM
 * @since 3.16.0
 * @category Type IDs
 */
-const TypeId$51 = "~effect/ExecutionPlan";
+const TypeId$52 = "~effect/ExecutionPlan";
 const Proto$18 = {
-	[TypeId$51]: TypeId$51,
+	[TypeId$52]: TypeId$52,
 	get withRequirements() {
 		const self$1 = this;
 		return servicesWith$1((services$2) => succeed$5(makeProto$1(self$1.steps.map((step) => ({
@@ -11922,7 +11963,7 @@ const CurrentMetadata$1 = /* @__PURE__ */ Reference("effect/ExecutionPlan/Curren
 /**
 * @since 2.0.0
 */
-const TypeId$50 = CauseTypeId;
+const TypeId$51 = CauseTypeId;
 /**
 * @since 2.0.0
 */
@@ -12563,11 +12604,11 @@ const currentTimeNanos = currentTimeNanos$1;
 //#endregion
 //#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/internal/dateTime.js
 /** @internal */
-const TypeId$49 = "~effect/time/DateTime";
+const TypeId$50 = "~effect/time/DateTime";
 /** @internal */
 const TimeZoneTypeId = "~effect/time/DateTime/TimeZone";
 const Proto$17 = {
-	[TypeId$49]: TypeId$49,
+	[TypeId$50]: TypeId$50,
 	pipe() {
 		return pipeArguments(this, arguments);
 	},
@@ -12673,7 +12714,7 @@ const makeZonedProto = (epochMillis, zone, partsUtc) => {
 	return self$1;
 };
 /** @internal */
-const isDateTime$1 = (u) => hasProperty(u, TypeId$49);
+const isDateTime$1 = (u) => hasProperty(u, TypeId$50);
 const isDateTimeArgs = (args$1) => isDateTime$1(args$1[0]);
 /** @internal */
 const isTimeZone$1 = (u) => hasProperty(u, TimeZoneTypeId);
@@ -12686,11 +12727,11 @@ const isUtc$1 = (self$1) => self$1._tag === "Utc";
 /** @internal */
 const isZoned$1 = (self$1) => self$1._tag === "Zoned";
 /** @internal */
-const Equivalence$3 = /* @__PURE__ */ make$51((a, b) => a.epochMillis === b.epochMillis);
+const Equivalence$3 = /* @__PURE__ */ make$52((a, b) => a.epochMillis === b.epochMillis);
 /** @internal */
-const Order$3 = /* @__PURE__ */ make$53((self$1, that) => self$1.epochMillis < that.epochMillis ? -1 : self$1.epochMillis > that.epochMillis ? 1 : 0);
+const Order$4 = /* @__PURE__ */ make$54((self$1, that) => self$1.epochMillis < that.epochMillis ? -1 : self$1.epochMillis > that.epochMillis ? 1 : 0);
 /** @internal */
-const clamp$1 = /* @__PURE__ */ clamp$2(Order$3);
+const clamp$1 = /* @__PURE__ */ clamp$2(Order$4);
 const makeUtc = (epochMillis) => {
 	const self$1 = Object.create(ProtoUtc);
 	self$1.epochMillis = epochMillis;
@@ -12741,7 +12782,7 @@ const makeZonedUnsafe$1 = (input, options) => {
 /** @internal */
 const makeZoned$1 = /* @__PURE__ */ liftThrowable(makeZonedUnsafe$1);
 /** @internal */
-const make$46 = /* @__PURE__ */ liftThrowable(makeUnsafe$5);
+const make$47 = /* @__PURE__ */ liftThrowable(makeUnsafe$5);
 const zonedStringRegExp = /^(.{17,35})\[(.+)\]$/;
 /** @internal */
 const makeZonedFromString$1 = (input) => {
@@ -12841,19 +12882,19 @@ const distanceDurationResult$1 = /* @__PURE__ */ dual(2, (self$1, other) => {
 /** @internal */
 const distanceDuration$1 = /* @__PURE__ */ dual(2, (self$1, other) => millis(Math.abs(distance$1(self$1, other))));
 /** @internal */
-const min$1 = /* @__PURE__ */ min$2(Order$3);
+const min$1 = /* @__PURE__ */ min$2(Order$4);
 /** @internal */
-const max$1 = /* @__PURE__ */ max$2(Order$3);
+const max$1 = /* @__PURE__ */ max$2(Order$4);
 /** @internal */
-const isGreaterThan$3 = /* @__PURE__ */ isGreaterThan$4(Order$3);
+const isGreaterThan$3 = /* @__PURE__ */ isGreaterThan$4(Order$4);
 /** @internal */
-const isGreaterThanOrEqualTo$2 = /* @__PURE__ */ isGreaterThanOrEqualTo$3(Order$3);
+const isGreaterThanOrEqualTo$2 = /* @__PURE__ */ isGreaterThanOrEqualTo$3(Order$4);
 /** @internal */
-const isLessThan$3 = /* @__PURE__ */ isLessThan$4(Order$3);
+const isLessThan$3 = /* @__PURE__ */ isLessThan$4(Order$4);
 /** @internal */
-const isLessThanOrEqualTo$2 = /* @__PURE__ */ isLessThanOrEqualTo$3(Order$3);
+const isLessThanOrEqualTo$2 = /* @__PURE__ */ isLessThanOrEqualTo$3(Order$4);
 /** @internal */
-const between$1 = /* @__PURE__ */ isBetween$1(Order$3);
+const between$1 = /* @__PURE__ */ isBetween$1(Order$4);
 /** @internal */
 const isFuture$1 = (self$1) => map$9(now$1, isLessThan$3(self$1));
 /** @internal */
@@ -13171,6 +13212,78 @@ const formatIsoOffset$1 = (self$1) => {
 /** @internal */
 const formatIsoZoned$1 = (self$1) => self$1.zone._tag === "Offset" ? formatIsoOffset$1(self$1) : `${formatIsoOffset$1(self$1)}[${self$1.zone.id}]`;
 
+//#endregion
+//#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/Number.js
+/**
+* The global `Number` constructor.
+*
+* @example
+* ```ts
+* import * as N from "effect/Number"
+*
+* const num = N.Number("42")
+* console.log(num) // 42
+*
+* const float = N.Number("3.14")
+* console.log(float) // 3.14
+* ```
+*
+* @category constructors
+* @since 4.0.0
+*/
+const Number$4 = globalThis.Number;
+/**
+* Tests if a value is a `number`.
+*
+* @example
+* ```ts
+* import { isNumber } from "effect/Number"
+* import * as assert from "node:assert"
+*
+* assert.deepStrictEqual(isNumber(2), true)
+* assert.deepStrictEqual(isNumber("2"), false)
+* ```
+*
+* @category guards
+* @since 2.0.0
+*/
+const isNumber = isNumber$1;
+/**
+* An `Order` instance for `number` values.
+*
+* @example
+* ```ts
+* import * as Number from "effect/Number"
+*
+* console.log(Number.Order(1, 2)) // -1
+* console.log(Number.Order(2, 1)) // 1
+* console.log(Number.Order(1, 1)) // 0
+* ```
+*
+* @category instances
+* @since 2.0.0
+*/
+const Order$3 = Number$5;
+/**
+* Returns the next power of 2 from the given number.
+*
+* @example
+* ```ts
+* import { nextPow2 } from "effect/Number"
+* import * as assert from "node:assert"
+*
+* assert.deepStrictEqual(nextPow2(5), 8)
+* assert.deepStrictEqual(nextPow2(17), 32)
+* ```
+*
+* @category math
+* @since 2.0.0
+*/
+const nextPow2 = (n) => {
+	const nextPow = Math.ceil(Math.log(n) / Math.log(2));
+	return Math.max(Math.pow(2, nextPow), 2);
+};
+
 //#endregion
 //#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/String.js
 /**
@@ -13298,7 +13411,7 @@ const filterDoneLeftover = /* @__PURE__ */ composePassthrough(filterError, (e) =
 */
 const doneExitFromCause = (cause) => {
 	const halt = filterDone(cause);
-	return !isFail(halt) ? succeed$4(halt.value) : failCause$3(halt.fail);
+	return !isFail(halt) ? succeed$4(halt.value) : failCause$4(halt.fail);
 };
 /**
 * Pattern matches on a Pull, handling success, failure, and done cases.
@@ -13360,7 +13473,7 @@ const matchEffect$1 = /* @__PURE__ */ dual(2, (self$1, options) => matchCauseEff
 *
 * @since 2.0.0
 */
-const TypeId$48 = "~effect/Schedule";
+const TypeId$49 = "~effect/Schedule";
 /**
 * @since 4.0.0
 * @category Metadata
@@ -13376,7 +13489,7 @@ const CurrentMetadata = /* @__PURE__ */ Reference("effect/Schedule/CurrentMetada
 	elapsedSincePrevious: 0
 }) });
 const ScheduleProto = {
-	[TypeId$48]: {
+	[TypeId$49]: {
 		_Out: identity,
 		_In: identity,
 		_Env: identity
@@ -13404,7 +13517,7 @@ const ScheduleProto = {
 * @since 2.0.0
 * @category guards
 */
-const isSchedule = (u) => hasProperty(u, TypeId$48);
+const isSchedule = (u) => hasProperty(u, TypeId$49);
 /**
 * Creates a Schedule from a step function that returns a Pull.
 *
@@ -13505,7 +13618,7 @@ const fromStepWithMetadata = (step) => fromStep(map$9(step, (f) => {
 * @since 4.0.0
 * @category destructors
 */
-const toStep = (schedule) => catchCause$2(schedule.step, (cause) => succeed$5(() => failCause$4(cause)));
+const toStep = (schedule) => catchCause$2(schedule.step, (cause) => succeed$5(() => failCause$5(cause)));
 /**
 * Extracts a step function from a Schedule that provides metadata about each
 * execution. It will also handle sleeping for the computed delay.
@@ -13555,7 +13668,7 @@ const toStepWithMetadata = (schedule) => clockWith$2((clock) => map$9(toStep(sch
 */
 const passthrough$2 = (self$1) => fromStep(map$9(toStep(self$1), (step) => (now$2, input) => matchEffect$1(step(now$2, input), {
 	onSuccess: (result$2) => succeed$5([input, result$2[1]]),
-	onFailure: failCause$4,
+	onFailure: failCause$5,
 	onDone: () => done(input)
 })));
 /**
@@ -13718,7 +13831,7 @@ const provide$2 = /* @__PURE__ */ dual(2, (self$1, source) => isServiceMap(sourc
 /** @internal */
 const repeatOrElse$1 = /* @__PURE__ */ dual(3, (self$1, schedule, orElse$1) => flatMap$2(toStepWithMetadata(schedule), (step) => {
 	let meta = CurrentMetadata.defaultValue();
-	return catch_$2(forever$2(tap$1(flatMap$2(suspend$4(() => provideService$1(self$1, CurrentMetadata, meta)), step), (meta_) => {
+	return catch_$2(forever$2(tap$1(flatMap$2(suspend$4(() => provideService$2(self$1, CurrentMetadata, meta)), step), (meta_) => {
 		meta = meta_;
 	}), { autoYield: false }), (error$1) => isDone$2(error$1) ? succeed$5(error$1.value) : orElse$1(error$1, meta.attempt === 0 ? none$3() : some(meta)));
 }));
@@ -13726,7 +13839,7 @@ const repeatOrElse$1 = /* @__PURE__ */ dual(3, (self$1, schedule, orElse$1) => f
 const retryOrElse$1 = /* @__PURE__ */ dual(3, (self$1, policy, orElse$1) => flatMap$2(toStepWithMetadata(policy), (step) => {
 	let meta = CurrentMetadata.defaultValue();
 	let lastError;
-	const loop = catch_$2(suspend$4(() => provideService$1(self$1, CurrentMetadata, meta)), (error$1) => {
+	const loop = catch_$2(suspend$4(() => provideService$2(self$1, CurrentMetadata, meta)), (error$1) => {
 		lastError = error$1;
 		return flatMap$2(step(error$1), (meta_) => {
 			meta = meta_;
@@ -13740,13 +13853,13 @@ const repeat$1 = /* @__PURE__ */ dual(2, (self$1, options) => {
 	return repeatOrElse$1(self$1, typeof options === "function" ? options(identity) : isSchedule(options) ? options : buildFromOptions(options), fail$7);
 });
 /** @internal */
-const retry$2 = /* @__PURE__ */ dual(2, (self$1, options) => {
+const retry$4 = /* @__PURE__ */ dual(2, (self$1, options) => {
 	return retryOrElse$1(self$1, typeof options === "function" ? options(identity) : isSchedule(options) ? options : buildFromOptions(options), fail$7);
 });
 /** @internal */
 const scheduleFrom$1 = /* @__PURE__ */ dual(3, (self$1, initial, schedule) => flatMap$2(toStepWithMetadata(schedule), (step) => {
 	let meta = CurrentMetadata.defaultValue();
-	const selfWithMeta = suspend$4(() => provideService$1(self$1, CurrentMetadata, meta));
+	const selfWithMeta = suspend$4(() => provideService$2(self$1, CurrentMetadata, meta));
 	return catch_$2(flatMap$2(step(initial), (meta_) => {
 		meta = meta_;
 		const body = constant(flatMap$2(selfWithMeta, step));
@@ -13781,7 +13894,7 @@ const withExecutionPlan$1 = /* @__PURE__ */ dual(2, (self$1, plan$1) => suspend$
 		attempt: 0,
 		stepIndex: 0
 	};
-	const provideMeta = provideServiceEffect$1(CurrentMetadata$1, sync$1(() => {
+	const provideMeta = provideServiceEffect$2(CurrentMetadata$1, sync$1(() => {
 		meta = {
 			attempt: meta.attempt + 1,
 			stepIndex: i
@@ -13802,10 +13915,10 @@ const withExecutionPlan$1 = /* @__PURE__ */ dual(2, (self$1, plan$1) => suspend$
 					attempted = true;
 					return result$2.asEffect();
 				});
-				nextEffect = retry$2(nextEffect, scheduleFromStep(step, false));
+				nextEffect = retry$4(nextEffect, scheduleFromStep(step, false));
 			} else {
 				const schedule = scheduleFromStep(step, true);
-				nextEffect = schedule ? retry$2(nextEffect, schedule) : nextEffect;
+				nextEffect = schedule ? retry$4(nextEffect, schedule) : nextEffect;
 			}
 			return result$1(nextEffect);
 		},
@@ -13833,7 +13946,7 @@ const scheduleOnce = /* @__PURE__ */ recurs(1);
 
 //#endregion
 //#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/Request.js
-const TypeId$47 = "~effect/Request";
+const TypeId$48 = "~effect/Request";
 const requestVariance = /* @__PURE__ */ byReferenceUnsafe({
 	_E: (_) => _,
 	_A: (_) => _,
@@ -13844,7 +13957,7 @@ const requestVariance = /* @__PURE__ */ byReferenceUnsafe({
 */
 const RequestPrototype = {
 	...StructuralProto,
-	[TypeId$47]: requestVariance
+	[TypeId$48]: requestVariance
 };
 /**
 * @since 2.0.0
@@ -13865,7 +13978,7 @@ const request$2 = /* @__PURE__ */ dual(2, (self$1, resolver) => {
 const requestUnsafe$1 = (self$1, options) => {
 	const entry = addEntry(options.resolver, self$1, options.onExit, {
 		services: options.services,
-		currentScheduler: get$7(options.services, Scheduler)
+		currentScheduler: get$8(options.services, Scheduler)
 	});
 	return () => removeEntryUnsafe(options.resolver, entry);
 };
@@ -13954,7 +14067,7 @@ function runBatch(batch) {
 
 //#endregion
 //#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/Effect.js
-const TypeId$46 = EffectTypeId;
+const TypeId$47 = EffectTypeId;
 /**
 * Tests if a value is an `Effect`.
 *
@@ -13969,7 +14082,7 @@ const TypeId$46 = EffectTypeId;
 * @since 2.0.0
 * @category guards
 */
-const isEffect = (u) => typeof u === "object" && u !== null && TypeId$46 in u;
+const isEffect = (u) => typeof u === "object" && u !== null && TypeId$47 in u;
 /**
 * Combines multiple effects into one, returning results based on the input
 * structure.
@@ -14702,7 +14815,7 @@ const failSync = failSync$1;
 * @since 2.0.0
 * @category Creating Effects
 */
-const failCause$2 = failCause$4;
+const failCause$2 = failCause$5;
 /**
 * Creates an `Effect` that represents a failure with a `Cause` computed lazily.
 *
@@ -16245,7 +16358,7 @@ const eventually = eventually$1;
 * @since 2.0.0
 * @category Error handling
 */
-const retry$1 = retry$2;
+const retry$3 = retry$4;
 /**
 * Retries a failing effect and runs a fallback effect if retries are exhausted.
 *
@@ -16721,7 +16834,7 @@ const raceFirst = raceFirst$1;
 * @since 2.0.0
 * @category Filtering
 */
-const filter$1 = filter$2;
+const filter$2 = filter$3;
 /**
 * @since 2.0.0
 * @category Filtering
@@ -17477,7 +17590,7 @@ const updateService = updateService$1;
 * @since 2.0.0
 * @category ServiceMap
 */
-const provideService = provideService$1;
+const provideService$1 = provideService$2;
 /**
 * Provides the effect with the single service it requires. If the effect
 * requires more than one service use `provide` instead.
@@ -17530,7 +17643,7 @@ const provideService = provideService$1;
 * @since 2.0.0
 * @category ServiceMap
 */
-const provideServiceEffect = provideServiceEffect$1;
+const provideServiceEffect$1 = provideServiceEffect$2;
 /**
 * Sets the concurrency level for parallel operations within an effect.
 *
@@ -20095,7 +20208,7 @@ const fnUntracedEager = fnUntracedEager$1;
 * @since 4.0.0
 */
 /** @internal */
-function set$5(self$1, key, value) {
+function set$6(self$1, key, value) {
 	if (key === "__proto__") Object.defineProperty(self$1, key, {
 		value,
 		writable: true,
@@ -20184,7 +20297,7 @@ const escape = (string$8) => string$8.replace(/[/\\^$*+?.()|[\]{}]/g, "\\$&");
 
 //#endregion
 //#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/DateTime.js
-TypeId$49;
+TypeId$50;
 TimeZoneTypeId;
 /**
 * @since 3.6.0
@@ -20271,7 +20384,7 @@ const Equivalence$2 = Equivalence$3;
 * @category instances
 * @since 3.6.0
 */
-const Order$1 = Order$3;
+const Order$1 = Order$4;
 /**
 * Clamp a `DateTime` between a minimum and maximum value.
 *
@@ -20417,7 +20530,7 @@ const makeZoned = makeZoned$1;
 * DateTime.make("2024-01-01")
 * ```
 */
-const make$45 = make$46;
+const make$46 = make$47;
 /**
 * Create a `DateTime.Zoned` from a string.
 *
@@ -22156,7 +22269,7 @@ const redactedRegistry = /* @__PURE__ */ new WeakMap();
 *
 * @since 3.3.0
 */
-const TypeId$45 = "~effect/data/Redacted";
+const TypeId$46 = "~effect/data/Redacted";
 /**
 * @example
 * ```ts
@@ -22172,7 +22285,7 @@ const TypeId$45 = "~effect/data/Redacted";
 * @since 3.3.0
 * @category refinements
 */
-const isRedacted = (u) => hasProperty(u, TypeId$45);
+const isRedacted = (u) => hasProperty(u, TypeId$46);
 /**
 * This function creates a `Redacted<A>` instance from a given value `A`,
 * securely hiding its content.
@@ -22187,14 +22300,14 @@ const isRedacted = (u) => hasProperty(u, TypeId$45);
 * @since 3.3.0
 * @category constructors
 */
-const make$44 = (value, options) => {
+const make$45 = (value, options) => {
 	const redacted = Object.create(Proto$16);
 	if (options?.label) redacted.label = options.label;
 	redactedRegistry.set(redacted, value);
 	return redacted;
 };
 const Proto$16 = {
-	[TypeId$45]: { _A: (_) => _ },
+	[TypeId$46]: { _A: (_) => _ },
 	label: void 0,
 	...PipeInspectableProto,
 	toJSON() {
@@ -22213,15 +22326,15 @@ const Proto$16 = {
 
 //#endregion
 //#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/SchemaIssue.js
-const TypeId$44 = "~effect/SchemaIssue/Issue";
+const TypeId$45 = "~effect/SchemaIssue/Issue";
 /**
 * @since 4.0.0
 */
 function isIssue(u) {
-	return hasProperty(u, TypeId$44);
+	return hasProperty(u, TypeId$45);
 }
 var Base$1 = class {
-	[TypeId$44] = TypeId$44;
+	[TypeId$45] = TypeId$45;
 	toString() {
 		return defaultFormatter$1(this);
 	}
@@ -22246,10 +22359,10 @@ var Filter$1 = class extends Base$1 {
 	* The issue that occurred.
 	*/
 	issue;
-	constructor(actual, filter$6, issue) {
+	constructor(actual, filter$7, issue) {
 		super();
 		this.actual = actual;
-		this.filter = filter$6;
+		this.filter = filter$7;
 		this.issue = issue;
 	}
 };
@@ -22494,7 +22607,7 @@ var OneOf = class extends Base$1 {
 	}
 };
 /** @internal */
-function make$43(input, out) {
+function make$44(input, out) {
 	if (isIssue(out)) return out;
 	if (out === void 0) return;
 	if (typeof out === "boolean") return out ? void 0 : new InvalidValue$1(some(input));
@@ -22763,7 +22876,7 @@ function decodeBase64() {
 */
 function dateTimeUtcFromInput() {
 	return transformOrFail$1((input) => {
-		const dt = make$45(input);
+		const dt = make$46(input);
 		return dt ? succeed$1(toUtc(dt)) : fail$4(new InvalidValue$1(some(input), { message: "Invalid DateTime input" }));
 	});
 }
@@ -22798,13 +22911,13 @@ function collectBracketPathEntries(isLeaf) {
 /**
 * @since 4.0.0
 */
-const TypeId$43 = "~effect/SchemaTransformation/Transformation";
+const TypeId$44 = "~effect/SchemaTransformation/Transformation";
 /**
 * @category model
 * @since 4.0.0
 */
 var Transformation = class Transformation {
-	[TypeId$43] = TypeId$43;
+	[TypeId$44] = TypeId$44;
 	_tag = "Transformation";
 	decode;
 	encode;
@@ -22823,12 +22936,12 @@ var Transformation = class Transformation {
 * @since 4.0.0
 */
 function isTransformation(u) {
-	return hasProperty(u, TypeId$43);
+	return hasProperty(u, TypeId$44);
 }
 /**
 * @since 4.0.0
 */
-const make$42 = (options) => {
+const make$43 = (options) => {
 	if (isTransformation(options)) return options;
 	return new Transformation(options.decode, options.encode);
 };
@@ -22918,7 +23031,7 @@ function makeGuard(tag$1) {
 * @since 4.0.0
 */
 function isAST(u) {
-	return hasProperty(u, TypeId$42) && u[TypeId$42] === TypeId$42;
+	return hasProperty(u, TypeId$43) && u[TypeId$43] === TypeId$43;
 }
 /**
 * @category Guard
@@ -22981,13 +23094,13 @@ var Context = class {
 		this.annotations = annotations$1;
 	}
 };
-const TypeId$42 = "~effect/Schema";
+const TypeId$43 = "~effect/Schema";
 /**
 * @category model
 * @since 4.0.0
 */
 var Base = class {
-	[TypeId$42] = TypeId$42;
+	[TypeId$43] = TypeId$43;
 	annotations;
 	checks;
 	encoding;
@@ -23233,7 +23346,7 @@ var Number$2 = class extends Base {
 	_tag = "Number";
 	/** @internal */
 	getParser() {
-		return fromRefinement(this, isNumber);
+		return fromRefinement(this, isNumber$1);
 	}
 	/** @internal */
 	toCodecJson() {
@@ -23575,7 +23688,7 @@ var Objects = class Objects extends Base {
 							else issues = [issue];
 							continue;
 						} else return yield* fail$4(new Composite(ast, oinput, [issue]));
-					} else set$5(out, key, input[key]);
+					} else set$6(out, key, input[key]);
 				}
 			}
 			for (let i = 0; i < propertyCount; i++) {
@@ -23592,7 +23705,7 @@ var Objects = class Objects extends Base {
 						else issues = [issue];
 						continue;
 					} else return yield* fail$4(new Composite(ast, oinput, [issue]));
-				} else if (exit$2.value._tag === "Some") set$5(out, p.name, exit$2.value.value);
+				} else if (exit$2.value._tag === "Some") set$6(out, p.name, exit$2.value.value);
 				else if (!isOptional(p.type)) {
 					const issue = new Pointer([p.name], new MissingKey(p.type.context?.annotations));
 					if (errorsAllOption) {
@@ -23637,8 +23750,8 @@ var Objects = class Objects extends Base {
 						const v2 = exitValue.value.value;
 						if (is$2.merge && is$2.merge.decode && Object.hasOwn(out, k2)) {
 							const [k, v] = is$2.merge.decode.combine([k2, out[k2]], [k2, v2]);
-							set$5(out, k, v);
-						} else set$5(out, k2, v2);
+							set$6(out, k, v);
+						} else set$6(out, k2, v2);
 					}
 				}
 			}
@@ -23646,7 +23759,7 @@ var Objects = class Objects extends Base {
 			if (options.propertyOrder === "original") {
 				const keys$1 = (inputKeys ?? Reflect.ownKeys(input)).concat(expectedKeys);
 				const preserved = {};
-				for (const key of keys$1) if (Object.hasOwn(out, key)) set$5(preserved, key, out[key]);
+				for (const key of keys$1) if (Object.hasOwn(out, key)) set$6(preserved, key, out[key]);
 				return some(preserved);
 			}
 			return some(out);
@@ -23994,8 +24107,8 @@ var FilterGroup = class FilterGroup extends Class$3 {
 	}
 };
 /** @internal */
-function makeFilter$1(filter$6, annotations$1, aborted = false) {
-	return new Filter((input, ast, options) => make$43(input, filter$6(input, ast, options)), annotations$1, aborted);
+function makeFilter$1(filter$7, annotations$1, aborted = false) {
+	return new Filter((input, ast, options) => make$44(input, filter$7(input, ast, options)), annotations$1, aborted);
 }
 /** @internal */
 function isPattern$1(regExp, annotations$1) {
@@ -24095,7 +24208,7 @@ function optionalKey$1(ast) {
 /** @internal */
 function withConstructorDefault$1(ast, defaultValue) {
 	const encoding = [new Link(unknown, new Transformation(new Getter((o) => {
-		if (isNone(filter$5(o, isNotUndefined))) {
+		if (isNone(filter$6(o, isNotUndefined))) {
 			const oe = defaultValue(o);
 			return isEffect(oe) ? oe : succeed$1(oe);
 		} else return succeed$1(o);
@@ -24378,7 +24491,7 @@ function nominal() {
 /**
 * @since 4.0.0
 */
-const TypeId$41 = "~effect/platform/PlatformError";
+const TypeId$42 = "~effect/platform/PlatformError";
 /**
 * @since 4.0.0
 * @category Models
@@ -24418,7 +24531,7 @@ var PlatformError = class extends TaggedError("PlatformError") {
 	/**
 	* @since 4.0.0
 	*/
-	[TypeId$41] = TypeId$41;
+	[TypeId$42] = TypeId$42;
 	get message() {
 		return this.reason.message;
 	}
@@ -24742,7 +24855,7 @@ const Empty$2 = /* @__PURE__ */ Symbol.for("effect/MutableList/Empty");
 * @since 4.0.0
 * @category constructors
 */
-const make$41 = () => ({
+const make$42 = () => ({
 	head: void 0,
 	tail: void 0,
 	length: 0
@@ -24794,6 +24907,46 @@ const append = (self$1, message) => {
 	self$1.length++;
 };
 /**
+* Prepends an element to the beginning of the MutableList.
+* This operation is optimized for high-frequency usage.
+*
+* @example
+* ```ts
+* import * as MutableList from "effect/MutableList"
+*
+* const list = MutableList.make<string>()
+*
+* // Prepend elements (they'll be at the front)
+* MutableList.prepend(list, "third")
+* MutableList.prepend(list, "second")
+* MutableList.prepend(list, "first")
+*
+* console.log(list.length) // 3
+*
+* // Elements taken from head (most recently prepended first)
+* console.log(MutableList.take(list)) // "first"
+* console.log(MutableList.take(list)) // "second"
+* console.log(MutableList.take(list)) // "third"
+*
+* // Use case: priority items or stack-like behavior
+* MutableList.append(list, "normal")
+* MutableList.prepend(list, "priority") // This will be taken first
+* console.log(MutableList.take(list)) // "priority"
+* ```
+*
+* @since 4.0.0
+* @category mutations
+*/
+const prepend = (self$1, message) => {
+	self$1.head = {
+		array: [message],
+		mutable: true,
+		offset: 0,
+		next: self$1.head
+	};
+	self$1.length++;
+};
+/**
 * Appends all elements from an iterable to the end of the MutableList.
 * Returns the number of elements added.
 *
@@ -24986,6 +25139,48 @@ const takeN = (self$1, n) => {
 	return array$1;
 };
 /**
+* Takes all elements from the MutableList and returns them as an array.
+* The list becomes empty after this operation. This is equivalent to takeN(list, list.length).
+*
+* @example
+* ```ts
+* import * as MutableList from "effect/MutableList"
+*
+* const list = MutableList.make<string>()
+* MutableList.appendAll(list, ["apple", "banana", "cherry"])
+*
+* console.log(list.length) // 3
+*
+* // Take all elements
+* const allItems = MutableList.takeAll(list)
+* console.log(allItems) // ["apple", "banana", "cherry"]
+* console.log(list.length) // 0
+*
+* // Useful for converting to array and clearing
+* const queue = MutableList.make<number>()
+* MutableList.appendAll(queue, [1, 2, 3, 4, 5])
+*
+* const snapshot = MutableList.takeAll(queue)
+* console.log("Queue contents:", snapshot)
+* console.log("Queue is now empty:", queue.length === 0)
+*
+* // Drain pattern for processing
+* function drainAndProcess<T>(
+*   list: MutableList.MutableList<T>,
+*   processor: (items: Array<T>) => void
+* ) {
+*   if (list.length > 0) {
+*     const items = MutableList.takeAll(list)
+*     processor(items)
+*   }
+* }
+* ```
+*
+* @since 4.0.0
+* @category elements
+*/
+const takeAll$1 = (self$1) => takeN(self$1, self$1.length);
+/**
 * Takes a single element from the beginning of the MutableList.
 * Returns the element if available, or the Empty symbol if the list is empty.
 * The taken element is removed from the list.
@@ -25033,7 +25228,7 @@ const takeN = (self$1, n) => {
 * @since 4.0.0
 * @category elements
 */
-const take$1 = (self$1) => {
+const take$2 = (self$1) => {
 	if (!self$1.head) return Empty$2;
 	const message = self$1.head.array[self$1.head.offset];
 	if (self$1.head.mutable) self$1.head.array[self$1.head.offset] = void 0;
@@ -25043,12 +25238,111 @@ const take$1 = (self$1) => {
 	else clear$2(self$1);
 	return message;
 };
+/**
+* Filters the MutableList in place, keeping only elements that satisfy the predicate.
+* This operation modifies the list and rebuilds its internal structure for efficiency.
+*
+* @example
+* ```ts
+* import * as MutableList from "effect/MutableList"
+*
+* const list = MutableList.make<number>()
+* MutableList.appendAll(list, [1, 2, 3, 4, 5, 6, 7, 8, 9, 10])
+*
+* console.log(list.length) // 10
+*
+* // Keep only even numbers
+* MutableList.filter(list, (n) => n % 2 === 0)
+*
+* console.log(list.length) // 5
+* console.log(MutableList.takeAll(list)) // [2, 4, 6, 8, 10]
+*
+* // Filter with index
+* const indexed = MutableList.make<string>()
+* MutableList.appendAll(indexed, ["a", "b", "c", "d", "e"])
+*
+* // Keep elements at even indices
+* MutableList.filter(indexed, (value, index) => index % 2 === 0)
+* console.log(MutableList.takeAll(indexed)) // ["a", "c", "e"]
+*
+* // Real-world example: filtering a log queue
+* const logs = MutableList.make<{ level: string; message: string }>()
+* MutableList.appendAll(logs, [
+*   { level: "INFO", message: "App started" },
+*   { level: "ERROR", message: "Connection failed" },
+*   { level: "DEBUG", message: "Cache hit" },
+*   { level: "ERROR", message: "Timeout" }
+* ])
+*
+* // Keep only errors
+* MutableList.filter(logs, (log) => log.level === "ERROR")
+* console.log(MutableList.takeAll(logs)) // Only error logs
+* ```
+*
+* @since 4.0.0
+* @category mutations
+*/
+const filter$1 = (self$1, f) => {
+	const array$1 = [];
+	let chunk = self$1.head;
+	while (chunk) {
+		for (let i = chunk.offset; i < chunk.array.length; i++) if (f(chunk.array[i], i)) array$1.push(chunk.array[i]);
+		chunk = chunk.next;
+	}
+	self$1.head = self$1.tail = {
+		array: array$1,
+		mutable: true,
+		offset: 0,
+		next: void 0
+	};
+};
+/**
+* Removes all occurrences of a specific value from the MutableList.
+* This operation modifies the list in place.
+*
+* @example
+* ```ts
+* import * as MutableList from "effect/MutableList"
+*
+* const list = MutableList.make<string>()
+* MutableList.appendAll(list, ["apple", "banana", "apple", "cherry", "apple"])
+*
+* console.log(list.length) // 5
+*
+* // Remove all occurrences of "apple"
+* MutableList.remove(list, "apple")
+*
+* console.log(list.length) // 2
+* console.log(MutableList.takeAll(list)) // ["banana", "cherry"]
+*
+* // Remove non-existent value (no effect)
+* MutableList.remove(list, "grape")
+* console.log(list.length) // 2
+*
+* // Real-world example: removing completed tasks
+* const tasks = MutableList.make<{ id: number; status: string }>()
+* MutableList.appendAll(tasks, [
+*   { id: 1, status: "pending" },
+*   { id: 2, status: "completed" },
+*   { id: 3, status: "pending" },
+*   { id: 4, status: "completed" }
+* ])
+*
+* // Remove completed tasks by filtering status
+* MutableList.filter(tasks, (task) => task.status !== "completed")
+* console.log(MutableList.takeAll(tasks)) // Only pending tasks
+* ```
+*
+* @since 4.0.0
+* @category mutations
+*/
+const remove$3 = (self$1, value) => filter$1(self$1, (v) => v !== value);
 
 //#endregion
 //#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/MutableRef.js
-const TypeId$40 = "~effect/MutableRef";
+const TypeId$41 = "~effect/MutableRef";
 const MutableRefProto = {
-	[TypeId$40]: TypeId$40,
+	[TypeId$41]: TypeId$41,
 	...PipeInspectableProto,
 	toJSON() {
 		return {
@@ -25081,11 +25375,1402 @@ const MutableRefProto = {
 * @since 2.0.0
 * @category constructors
 */
-const make$40 = (value) => {
+const make$41 = (value) => {
 	const ref = Object.create(MutableRefProto);
 	ref.current = value;
 	return ref;
 };
+/**
+* Gets the current value of the MutableRef.
+*
+* @example
+* ```ts
+* import { MutableRef } from "effect"
+*
+* const ref = MutableRef.make("hello")
+* console.log(MutableRef.get(ref)) // "hello"
+*
+* MutableRef.set(ref, "world")
+* console.log(MutableRef.get(ref)) // "world"
+*
+* // Reading complex objects
+* const config = MutableRef.make({ port: 3000, host: "localhost" })
+* const currentConfig = MutableRef.get(config)
+* console.log(currentConfig.port) // 3000
+*
+* // Multiple reads return the same value
+* const value1 = MutableRef.get(ref)
+* const value2 = MutableRef.get(ref)
+* console.log(value1 === value2) // true
+* ```
+*
+* @since 2.0.0
+* @category general
+*/
+const get$7 = (self$1) => self$1.current;
+/**
+* Sets the MutableRef to a new value and returns the reference.
+*
+* @example
+* ```ts
+* import { MutableRef } from "effect"
+*
+* const ref = MutableRef.make("initial")
+*
+* // Set a new value
+* MutableRef.set(ref, "updated")
+* console.log(MutableRef.get(ref)) // "updated"
+*
+* // Chain set operations (since it returns the ref)
+* const result = MutableRef.set(ref, "final")
+* console.log(result === ref) // true (same reference)
+* console.log(MutableRef.get(ref)) // "final"
+*
+* // Set complex objects
+* const config = MutableRef.make({ debug: false, verbose: false })
+* MutableRef.set(config, { debug: true, verbose: true })
+* console.log(MutableRef.get(config)) // { debug: true, verbose: true }
+*
+* // Pipe-able version
+* const setValue = MutableRef.set("new value")
+* setValue(ref)
+* console.log(MutableRef.get(ref)) // "new value"
+*
+* // Useful for state management
+* const state = MutableRef.make<"idle" | "loading" | "success" | "error">("idle")
+* MutableRef.set(state, "loading")
+* // ... perform async operation
+* MutableRef.set(state, "success")
+* ```
+*
+* @since 2.0.0
+* @category general
+*/
+const set$5 = /* @__PURE__ */ dual(2, (self$1, value) => {
+	self$1.current = value;
+	return self$1;
+});
+
+//#endregion
+//#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/PubSub.js
+/**
+* This module provides utilities for working with publish-subscribe (PubSub) systems.
+*
+* A PubSub is an asynchronous message hub where publishers can publish messages and subscribers
+* can subscribe to receive those messages. PubSub supports various backpressure strategies,
+* message replay, and concurrent access from multiple producers and consumers.
+*
+* @example
+* ```ts
+* import { Effect, PubSub } from "effect"
+*
+* const program = Effect.gen(function*() {
+*   const pubsub = yield* PubSub.bounded<string>(10)
+*
+*   // Publisher
+*   yield* PubSub.publish(pubsub, "Hello")
+*   yield* PubSub.publish(pubsub, "World")
+*
+*   // Subscriber
+*   yield* Effect.scoped(Effect.gen(function*() {
+*     const subscription = yield* PubSub.subscribe(pubsub)
+*     const message1 = yield* PubSub.take(subscription)
+*     const message2 = yield* PubSub.take(subscription)
+*     console.log(message1, message2) // "Hello", "World"
+*   }))
+* })
+* ```
+*
+* @since 2.0.0
+*/
+const TypeId$40 = "~effect/PubSub";
+const SubscriptionTypeId = "~effect/PubSub/Subscription";
+/**
+* Creates a PubSub with a custom atomic implementation and strategy.
+*
+* @example
+* ```ts
+* import { Effect } from "effect"
+* import * as PubSub from "effect/PubSub"
+*
+* const program = Effect.gen(function*() {
+*   // Create custom PubSub with specific atomic implementation and strategy
+*   const pubsub = yield* PubSub.make<string>({
+*     atomicPubSub: () => PubSub.makeAtomicBounded(100),
+*     strategy: () => new PubSub.BackPressureStrategy()
+*   })
+*
+*   // Use the created PubSub
+*   yield* PubSub.publish(pubsub, "Hello")
+* })
+* ```
+*
+* @since 4.0.0
+* @category constructors
+*/
+const make$40 = (options) => sync(() => makePubSubUnsafe(options.atomicPubSub(), /* @__PURE__ */ new Map(), makeUnsafe$6(), makeLatchUnsafe(false), make$41(false), options.strategy()));
+/**
+* Creates a bounded PubSub with backpressure strategy.
+*
+* The PubSub will retain messages until they have been taken by all subscribers.
+* When the PubSub reaches capacity, publishers will be suspended until space becomes available.
+* This ensures message delivery guarantees but may slow down fast publishers.
+*
+* @param capacity - The maximum number of messages the PubSub can hold, or an options object
+*                   with capacity and optional replay buffer size
+* @returns An Effect that creates a bounded PubSub
+*
+* @example
+* ```ts
+* import { Effect } from "effect"
+* import * as PubSub from "effect/PubSub"
+*
+* const program = Effect.gen(function*() {
+*   // Create bounded PubSub with capacity 100
+*   const pubsub = yield* PubSub.bounded<string>(100)
+*
+*   // Create with replay buffer for late subscribers
+*   const pubsubWithReplay = yield* PubSub.bounded<string>({
+*     capacity: 100,
+*     replay: 10 // Last 10 messages replayed to new subscribers
+*   })
+* })
+* ```
+*
+* @since 2.0.0
+* @category constructors
+*/
+const bounded$1 = (capacity) => make$40({
+	atomicPubSub: () => makeAtomicBounded(capacity),
+	strategy: () => new BackPressureStrategy()
+});
+/**
+* Creates a bounded `PubSub` with the dropping strategy. The `PubSub` will drop new
+* messages if the `PubSub` is at capacity.
+*
+* For best performance use capacities that are powers of two.
+*
+* @example
+* ```ts
+* import { Effect } from "effect"
+* import * as PubSub from "effect/PubSub"
+*
+* const program = Effect.gen(function*() {
+*   // Create dropping PubSub that drops new messages when full
+*   const pubsub = yield* PubSub.dropping<string>(3)
+*
+*   // With replay buffer for late subscribers
+*   const pubsubWithReplay = yield* PubSub.dropping<string>({
+*     capacity: 3,
+*     replay: 5
+*   })
+*
+*   // Fill the PubSub and see dropping behavior
+*   yield* PubSub.publish(pubsub, "msg1") // succeeds
+*   yield* PubSub.publish(pubsub, "msg2") // succeeds
+*   yield* PubSub.publish(pubsub, "msg3") // succeeds
+*   const dropped = yield* PubSub.publish(pubsub, "msg4") // returns false (dropped)
+*   console.log("Message dropped:", !dropped)
+* })
+* ```
+*
+* @since 2.0.0
+* @category constructors
+*/
+const dropping = (capacity) => make$40({
+	atomicPubSub: () => makeAtomicBounded(capacity),
+	strategy: () => new DroppingStrategy()
+});
+/**
+* Creates a bounded `PubSub` with the sliding strategy. The `PubSub` will add new
+* messages and drop old messages if the `PubSub` is at capacity.
+*
+* For best performance use capacities that are powers of two.
+*
+* @example
+* ```ts
+* import { Effect } from "effect"
+* import * as PubSub from "effect/PubSub"
+*
+* const program = Effect.gen(function*() {
+*   // Create sliding PubSub that evicts old messages when full
+*   const pubsub = yield* PubSub.sliding<string>(3)
+*
+*   // With replay buffer
+*   const pubsubWithReplay = yield* PubSub.sliding<string>({
+*     capacity: 3,
+*     replay: 2
+*   })
+*
+*   // Fill and overflow the PubSub
+*   yield* PubSub.publish(pubsub, "msg1")
+*   yield* PubSub.publish(pubsub, "msg2")
+*   yield* PubSub.publish(pubsub, "msg3")
+*   yield* PubSub.publish(pubsub, "msg4") // "msg1" is evicted
+*
+*   yield* Effect.scoped(Effect.gen(function*() {
+*     const subscription = yield* PubSub.subscribe(pubsub)
+*     const messages = yield* PubSub.takeAll(subscription)
+*     console.log(messages) // ["msg2", "msg3", "msg4"]
+*   }))
+* })
+* ```
+*
+* @since 2.0.0
+* @category constructors
+*/
+const sliding = (capacity) => make$40({
+	atomicPubSub: () => makeAtomicBounded(capacity),
+	strategy: () => new SlidingStrategy()
+});
+/**
+* Creates an unbounded `PubSub`.
+*
+* @example
+* ```ts
+* import { Effect } from "effect"
+* import * as PubSub from "effect/PubSub"
+*
+* const program = Effect.gen(function*() {
+*   // Create unbounded PubSub
+*   const pubsub = yield* PubSub.unbounded<string>()
+*
+*   // With replay buffer for late subscribers
+*   const pubsubWithReplay = yield* PubSub.unbounded<string>({
+*     replay: 10
+*   })
+*
+*   // Can publish unlimited messages
+*   for (let i = 0; i < 1000; i++) {
+*     yield* PubSub.publish(pubsub, `message-${i}`)
+*   }
+*
+*   yield* Effect.scoped(Effect.gen(function*() {
+*     const subscription = yield* PubSub.subscribe(pubsub)
+*     const message = yield* PubSub.take(subscription)
+*     console.log("First message:", message)
+*   }))
+* })
+* ```
+*
+* @since 2.0.0
+* @category constructors
+*/
+const unbounded = (options) => make$40({
+	atomicPubSub: () => makeAtomicUnbounded(options),
+	strategy: () => new DroppingStrategy()
+});
+/**
+* Creates a bounded atomic PubSub implementation with optional replay buffer.
+*
+* @since 4.0.0
+* @category constructors
+*/
+const makeAtomicBounded = (capacity) => {
+	const options = typeof capacity === "number" ? { capacity } : capacity;
+	ensureCapacity(options.capacity);
+	const replayBuffer = options.replay && options.replay > 0 ? new ReplayBuffer(Math.ceil(options.replay)) : void 0;
+	if (options.capacity === 1) return new BoundedPubSubSingle(replayBuffer);
+	else if (nextPow2(options.capacity) === options.capacity) return new BoundedPubSubPow2(options.capacity, replayBuffer);
+	else return new BoundedPubSubArb(options.capacity, replayBuffer);
+};
+/**
+* Creates an unbounded atomic PubSub implementation with optional replay buffer.
+*
+* @since 4.0.0
+* @category constructors
+*/
+const makeAtomicUnbounded = (options) => new UnboundedPubSub(options?.replay ? new ReplayBuffer(options.replay) : void 0);
+/**
+* Interrupts any fibers that are suspended on `offer` or `take`. Future calls
+* to `offer*` and `take*` will be interrupted immediately.
+*
+* @example
+* ```ts
+* import { Effect, Fiber, PubSub } from "effect"
+*
+* const program = Effect.gen(function*() {
+*   const pubsub = yield* PubSub.bounded<string>(1)
+*
+*   // Start a fiber that will be suspended waiting to publish
+*   const publisherFiber = yield* Effect.forkChild(
+*     Effect.gen(function*() {
+*       yield* PubSub.publish(pubsub, "msg1") // fills the buffer
+*       yield* PubSub.publish(pubsub, "msg2") // will suspend here
+*     })
+*   )
+*
+*   // Shutdown the PubSub
+*   yield* PubSub.shutdown(pubsub)
+*
+*   // The suspended publisher will be interrupted
+*   const result = yield* Fiber.await(publisherFiber)
+*   console.log("Publisher interrupted:", result._tag === "Failure")
+* })
+* ```
+*
+* @since 2.0.0
+* @category lifecycle
+*/
+const shutdown$1 = (self$1) => uninterruptible(withFiber((fiber$2) => {
+	set$5(self$1.shutdownFlag, true);
+	return close(self$1.scope, interrupt$3(fiber$2.id)).pipe(andThen(self$1.strategy.shutdown), when(self$1.shutdownHook.open), asVoid);
+}));
+/**
+* Publishes a message to the `PubSub`, returning whether the message was published
+* to the `PubSub`.
+*
+* @example
+* ```ts
+* import { Effect } from "effect"
+* import * as PubSub from "effect/PubSub"
+*
+* const program = Effect.gen(function*() {
+*   const pubsub = yield* PubSub.bounded<string>(10)
+*
+*   // Publish a message
+*   const published = yield* PubSub.publish(pubsub, "Hello World")
+*   console.log("Message published:", published) // true
+*
+*   // With a full bounded PubSub using backpressure strategy
+*   const smallPubsub = yield* PubSub.bounded<string>(1)
+*   yield* PubSub.publish(smallPubsub, "msg1") // succeeds
+*
+*   // This will suspend until space becomes available
+*   const publishEffect = PubSub.publish(smallPubsub, "msg2")
+*
+*   // Create a subscriber to free up space
+*   yield* Effect.scoped(Effect.gen(function*() {
+*     const subscription = yield* PubSub.subscribe(smallPubsub)
+*     yield* PubSub.take(subscription) // frees space
+*     const result = yield* publishEffect
+*     console.log("Second message published:", result) // true
+*   }))
+* })
+* ```
+*
+* @since 2.0.0
+* @category publishing
+*/
+const publish = /* @__PURE__ */ dual(2, (self$1, value) => suspend$3(() => {
+	if (self$1.shutdownFlag.current) return interrupt$1;
+	if (self$1.pubsub.publish(value)) {
+		self$1.strategy.completeSubscribersUnsafe(self$1.pubsub, self$1.subscribers);
+		return succeed$1(true);
+	}
+	return self$1.strategy.handleSurplus(self$1.pubsub, self$1.subscribers, [value], self$1.shutdownFlag);
+}));
+/**
+* Subscribes to receive messages from the `PubSub`. The resulting subscription can
+* be evaluated multiple times within the scope to take a message from the `PubSub`
+* each time.
+*
+* @example
+* ```ts
+* import { Effect, PubSub } from "effect"
+*
+* const program = Effect.gen(function*() {
+*   const pubsub = yield* PubSub.bounded<string>(10)
+*
+*   // Publish some messages
+*   yield* PubSub.publish(pubsub, "Hello")
+*   yield* PubSub.publish(pubsub, "World")
+*
+*   // Subscribe within a scope for automatic cleanup
+*   yield* Effect.scoped(Effect.gen(function*() {
+*     const subscription = yield* PubSub.subscribe(pubsub)
+*
+*     // Take messages one by one
+*     const msg1 = yield* PubSub.take(subscription)
+*     const msg2 = yield* PubSub.take(subscription)
+*     console.log(msg1, msg2) // "Hello", "World"
+*
+*     // Subscription is automatically cleaned up when scope exits
+*   }))
+*
+*   // Multiple subscribers can receive the same messages
+*   yield* PubSub.publish(pubsub, "Broadcast")
+*
+*   yield* Effect.scoped(Effect.gen(function*() {
+*     const sub1 = yield* PubSub.subscribe(pubsub)
+*     const sub2 = yield* PubSub.subscribe(pubsub)
+*
+*     const [msg1, msg2] = yield* Effect.all([
+*       PubSub.take(sub1),
+*       PubSub.take(sub2)
+*     ])
+*     console.log("Both received:", msg1, msg2) // "Broadcast", "Broadcast"
+*   }))
+* })
+* ```
+*
+* @since 2.0.0
+* @category subscription
+*/
+const subscribe = (self$1) => acquireRelease(sync(() => makeSubscriptionUnsafe(self$1.pubsub, self$1.subscribers, self$1.strategy)), unsubscribe);
+const unsubscribe = (self$1) => uninterruptible(withFiber((state) => {
+	set$5(self$1.shutdownFlag, true);
+	return forEach$1(takeAll$1(self$1.pollers), (d) => interruptWith(d, state.id), {
+		discard: true,
+		concurrency: "unbounded"
+	}).pipe(tap(() => {
+		self$1.subscribers.delete(self$1.subscription);
+		self$1.subscription.unsubscribe();
+		self$1.strategy.onPubSubEmptySpaceUnsafe(self$1.pubsub, self$1.subscribers);
+	}), when(self$1.shutdownHook.open), asVoid);
+}));
+/**
+* Takes a single message from the subscription. If no messages are available,
+* this will suspend until a message becomes available.
+*
+* @example
+* ```ts
+* import { Effect, Fiber, PubSub } from "effect"
+*
+* const program = Effect.gen(function*() {
+*   const pubsub = yield* PubSub.bounded<string>(10)
+*
+*   yield* Effect.scoped(Effect.gen(function*() {
+*     const subscription = yield* PubSub.subscribe(pubsub)
+*
+*     // Start a fiber to take a message (will suspend)
+*     const takeFiber = yield* Effect.forkChild(
+*       PubSub.take(subscription)
+*     )
+*
+*     // Publish a message
+*     yield* PubSub.publish(pubsub, "Hello")
+*
+*     // The take will now complete
+*     const message = yield* Fiber.join(takeFiber)
+*     console.log("Received:", message) // "Hello"
+*   }))
+* })
+* ```
+*
+* @since 4.0.0
+* @category subscription
+*/
+const take$1 = (self$1) => suspend$3(() => {
+	if (self$1.shutdownFlag.current) return interrupt$1;
+	if (self$1.replayWindow.remaining > 0) {
+		const message$1 = self$1.replayWindow.take();
+		return succeed$1(message$1);
+	}
+	const message = self$1.pollers.length === 0 ? self$1.subscription.poll() : Empty$2;
+	if (message === Empty$2) return pollForItem(self$1);
+	else {
+		self$1.strategy.onPubSubEmptySpaceUnsafe(self$1.pubsub, self$1.subscribers);
+		return succeed$1(message);
+	}
+});
+const pollForItem = (self$1) => {
+	const deferred = makeUnsafe$7();
+	let set$7 = self$1.subscribers.get(self$1.subscription);
+	if (!set$7) {
+		set$7 = /* @__PURE__ */ new Set();
+		self$1.subscribers.set(self$1.subscription, set$7);
+	}
+	set$7.add(self$1.pollers);
+	append(self$1.pollers, deferred);
+	self$1.strategy.completePollersUnsafe(self$1.pubsub, self$1.subscribers, self$1.subscription, self$1.pollers);
+	return onInterrupt(_await(deferred), () => {
+		remove$3(self$1.pollers, deferred);
+		return void_$1;
+	});
+};
+const AbsentValue = /* @__PURE__ */ Symbol.for("effect/PubSub/AbsentValue");
+const addSubscribers = (subscribers, subscription, pollers) => {
+	if (!subscribers.has(subscription)) subscribers.set(subscription, /* @__PURE__ */ new Set());
+	subscribers.get(subscription).add(pollers);
+};
+const removeSubscribers = (subscribers, subscription, pollers) => {
+	if (!subscribers.has(subscription)) return;
+	const set$7 = subscribers.get(subscription);
+	set$7.delete(pollers);
+	if (set$7.size === 0) subscribers.delete(subscription);
+};
+const makeSubscriptionUnsafe = (pubsub, subscribers, strategy) => new SubscriptionImpl(pubsub, subscribers, pubsub.subscribe(), make$42(), makeLatchUnsafe(false), make$41(false), strategy, pubsub.replayWindow());
+var BoundedPubSubArb = class {
+	array;
+	publisherIndex = 0;
+	subscribers;
+	subscriberCount = 0;
+	subscribersIndex = 0;
+	capacity;
+	replayBuffer;
+	constructor(capacity, replayBuffer) {
+		this.capacity = capacity;
+		this.replayBuffer = replayBuffer;
+		this.array = Array.from({ length: capacity });
+		this.subscribers = Array.from({ length: capacity });
+	}
+	replayWindow() {
+		return this.replayBuffer ? new ReplayWindowImpl(this.replayBuffer) : emptyReplayWindow;
+	}
+	isEmpty() {
+		return this.publisherIndex === this.subscribersIndex;
+	}
+	isFull() {
+		return this.publisherIndex === this.subscribersIndex + this.capacity;
+	}
+	size() {
+		return this.publisherIndex - this.subscribersIndex;
+	}
+	publish(value) {
+		if (this.isFull()) return false;
+		if (this.subscriberCount !== 0) {
+			const index = this.publisherIndex % this.capacity;
+			this.array[index] = value;
+			this.subscribers[index] = this.subscriberCount;
+			this.publisherIndex += 1;
+		}
+		if (this.replayBuffer) this.replayBuffer.offer(value);
+		return true;
+	}
+	publishAll(elements) {
+		if (this.subscriberCount === 0) {
+			if (this.replayBuffer) this.replayBuffer.offerAll(elements);
+			return [];
+		}
+		const chunk = fromIterable$2(elements);
+		const n = chunk.length;
+		const size$2 = this.publisherIndex - this.subscribersIndex;
+		const available = this.capacity - size$2;
+		const forPubSub = Math.min(n, available);
+		if (forPubSub === 0) return chunk;
+		let iteratorIndex = 0;
+		const publishAllIndex = this.publisherIndex + forPubSub;
+		while (this.publisherIndex !== publishAllIndex) {
+			const a = chunk[iteratorIndex++];
+			const index = this.publisherIndex % this.capacity;
+			this.array[index] = a;
+			this.subscribers[index] = this.subscriberCount;
+			this.publisherIndex += 1;
+			if (this.replayBuffer) this.replayBuffer.offer(a);
+		}
+		return chunk.slice(iteratorIndex);
+	}
+	slide() {
+		if (this.subscribersIndex !== this.publisherIndex) {
+			const index = this.subscribersIndex % this.capacity;
+			this.array[index] = AbsentValue;
+			this.subscribers[index] = 0;
+			this.subscribersIndex += 1;
+		}
+		if (this.replayBuffer) this.replayBuffer.slide();
+	}
+	subscribe() {
+		this.subscriberCount += 1;
+		return new BoundedPubSubArbSubscription(this, this.publisherIndex, false);
+	}
+};
+var BoundedPubSubArbSubscription = class {
+	self;
+	subscriberIndex;
+	unsubscribed;
+	constructor(self$1, subscriberIndex, unsubscribed) {
+		this.self = self$1;
+		this.subscriberIndex = subscriberIndex;
+		this.unsubscribed = unsubscribed;
+	}
+	isEmpty() {
+		return this.unsubscribed || this.self.publisherIndex === this.subscriberIndex || this.self.publisherIndex === this.self.subscribersIndex;
+	}
+	size() {
+		if (this.unsubscribed) return 0;
+		return this.self.publisherIndex - Math.max(this.subscriberIndex, this.self.subscribersIndex);
+	}
+	poll() {
+		if (this.unsubscribed) return Empty$2;
+		this.subscriberIndex = Math.max(this.subscriberIndex, this.self.subscribersIndex);
+		if (this.subscriberIndex !== this.self.publisherIndex) {
+			const index = this.subscriberIndex % this.self.capacity;
+			const elem = this.self.array[index];
+			this.self.subscribers[index] -= 1;
+			if (this.self.subscribers[index] === 0) {
+				this.self.array[index] = AbsentValue;
+				this.self.subscribersIndex += 1;
+			}
+			this.subscriberIndex += 1;
+			return elem;
+		}
+		return Empty$2;
+	}
+	pollUpTo(n) {
+		if (this.unsubscribed) return [];
+		this.subscriberIndex = Math.max(this.subscriberIndex, this.self.subscribersIndex);
+		const size$2 = this.self.publisherIndex - this.subscriberIndex;
+		const toPoll = Math.min(n, size$2);
+		if (toPoll <= 0) return [];
+		const builder = [];
+		const pollUpToIndex = this.subscriberIndex + toPoll;
+		while (this.subscriberIndex !== pollUpToIndex) {
+			const index = this.subscriberIndex % this.self.capacity;
+			const a = this.self.array[index];
+			this.self.subscribers[index] -= 1;
+			if (this.self.subscribers[index] === 0) {
+				this.self.array[index] = AbsentValue;
+				this.self.subscribersIndex += 1;
+			}
+			builder.push(a);
+			this.subscriberIndex += 1;
+		}
+		return builder;
+	}
+	unsubscribe() {
+		if (!this.unsubscribed) {
+			this.unsubscribed = true;
+			this.self.subscriberCount -= 1;
+			this.subscriberIndex = Math.max(this.subscriberIndex, this.self.subscribersIndex);
+			while (this.subscriberIndex !== this.self.publisherIndex) {
+				const index = this.subscriberIndex % this.self.capacity;
+				this.self.subscribers[index] -= 1;
+				if (this.self.subscribers[index] === 0) {
+					this.self.array[index] = AbsentValue;
+					this.self.subscribersIndex += 1;
+				}
+				this.subscriberIndex += 1;
+			}
+		}
+	}
+};
+var BoundedPubSubPow2 = class {
+	array;
+	mask;
+	publisherIndex = 0;
+	subscribers;
+	subscriberCount = 0;
+	subscribersIndex = 0;
+	capacity;
+	replayBuffer;
+	constructor(capacity, replayBuffer) {
+		this.capacity = capacity;
+		this.replayBuffer = replayBuffer;
+		this.array = Array.from({ length: capacity });
+		this.mask = capacity - 1;
+		this.subscribers = Array.from({ length: capacity });
+	}
+	replayWindow() {
+		return this.replayBuffer ? new ReplayWindowImpl(this.replayBuffer) : emptyReplayWindow;
+	}
+	isEmpty() {
+		return this.publisherIndex === this.subscribersIndex;
+	}
+	isFull() {
+		return this.publisherIndex === this.subscribersIndex + this.capacity;
+	}
+	size() {
+		return this.publisherIndex - this.subscribersIndex;
+	}
+	publish(value) {
+		if (this.isFull()) return false;
+		if (this.subscriberCount !== 0) {
+			const index = this.publisherIndex & this.mask;
+			this.array[index] = value;
+			this.subscribers[index] = this.subscriberCount;
+			this.publisherIndex += 1;
+		}
+		if (this.replayBuffer) this.replayBuffer.offer(value);
+		return true;
+	}
+	publishAll(elements) {
+		if (this.subscriberCount === 0) {
+			if (this.replayBuffer) this.replayBuffer.offerAll(elements);
+			return [];
+		}
+		const chunk = fromIterable$2(elements);
+		const n = chunk.length;
+		const size$2 = this.publisherIndex - this.subscribersIndex;
+		const available = this.capacity - size$2;
+		const forPubSub = Math.min(n, available);
+		if (forPubSub === 0) return chunk;
+		let iteratorIndex = 0;
+		const publishAllIndex = this.publisherIndex + forPubSub;
+		while (this.publisherIndex !== publishAllIndex) {
+			const elem = chunk[iteratorIndex++];
+			const index = this.publisherIndex & this.mask;
+			this.array[index] = elem;
+			this.subscribers[index] = this.subscriberCount;
+			this.publisherIndex += 1;
+			if (this.replayBuffer) this.replayBuffer.offer(elem);
+		}
+		return chunk.slice(iteratorIndex);
+	}
+	slide() {
+		if (this.subscribersIndex !== this.publisherIndex) {
+			const index = this.subscribersIndex & this.mask;
+			this.array[index] = AbsentValue;
+			this.subscribers[index] = 0;
+			this.subscribersIndex += 1;
+		}
+		if (this.replayBuffer) this.replayBuffer.slide();
+	}
+	subscribe() {
+		this.subscriberCount += 1;
+		return new BoundedPubSubPow2Subscription(this, this.publisherIndex, false);
+	}
+};
+var BoundedPubSubPow2Subscription = class {
+	self;
+	subscriberIndex;
+	unsubscribed;
+	constructor(self$1, subscriberIndex, unsubscribed) {
+		this.self = self$1;
+		this.subscriberIndex = subscriberIndex;
+		this.unsubscribed = unsubscribed;
+	}
+	isEmpty() {
+		return this.unsubscribed || this.self.publisherIndex === this.subscriberIndex || this.self.publisherIndex === this.self.subscribersIndex;
+	}
+	size() {
+		if (this.unsubscribed) return 0;
+		return this.self.publisherIndex - Math.max(this.subscriberIndex, this.self.subscribersIndex);
+	}
+	poll() {
+		if (this.unsubscribed) return Empty$2;
+		this.subscriberIndex = Math.max(this.subscriberIndex, this.self.subscribersIndex);
+		if (this.subscriberIndex !== this.self.publisherIndex) {
+			const index = this.subscriberIndex & this.self.mask;
+			const elem = this.self.array[index];
+			this.self.subscribers[index] -= 1;
+			if (this.self.subscribers[index] === 0) {
+				this.self.array[index] = AbsentValue;
+				this.self.subscribersIndex += 1;
+			}
+			this.subscriberIndex += 1;
+			return elem;
+		}
+		return Empty$2;
+	}
+	pollUpTo(n) {
+		if (this.unsubscribed) return [];
+		this.subscriberIndex = Math.max(this.subscriberIndex, this.self.subscribersIndex);
+		const size$2 = this.self.publisherIndex - this.subscriberIndex;
+		const toPoll = Math.min(n, size$2);
+		if (toPoll <= 0) return [];
+		const builder = [];
+		const pollUpToIndex = this.subscriberIndex + toPoll;
+		while (this.subscriberIndex !== pollUpToIndex) {
+			const index = this.subscriberIndex & this.self.mask;
+			const elem = this.self.array[index];
+			this.self.subscribers[index] -= 1;
+			if (this.self.subscribers[index] === 0) {
+				this.self.array[index] = AbsentValue;
+				this.self.subscribersIndex += 1;
+			}
+			builder.push(elem);
+			this.subscriberIndex += 1;
+		}
+		return builder;
+	}
+	unsubscribe() {
+		if (!this.unsubscribed) {
+			this.unsubscribed = true;
+			this.self.subscriberCount -= 1;
+			this.subscriberIndex = Math.max(this.subscriberIndex, this.self.subscribersIndex);
+			while (this.subscriberIndex !== this.self.publisherIndex) {
+				const index = this.subscriberIndex & this.self.mask;
+				this.self.subscribers[index] -= 1;
+				if (this.self.subscribers[index] === 0) {
+					this.self.array[index] = AbsentValue;
+					this.self.subscribersIndex += 1;
+				}
+				this.subscriberIndex += 1;
+			}
+		}
+	}
+};
+var BoundedPubSubSingle = class {
+	publisherIndex = 0;
+	subscriberCount = 0;
+	subscribers = 0;
+	value = AbsentValue;
+	capacity = 1;
+	replayBuffer;
+	constructor(replayBuffer) {
+		this.replayBuffer = replayBuffer;
+	}
+	replayWindow() {
+		return this.replayBuffer ? new ReplayWindowImpl(this.replayBuffer) : emptyReplayWindow;
+	}
+	pipe() {
+		return pipeArguments(this, arguments);
+	}
+	isEmpty() {
+		return this.subscribers === 0;
+	}
+	isFull() {
+		return !this.isEmpty();
+	}
+	size() {
+		return this.isEmpty() ? 0 : 1;
+	}
+	publish(value) {
+		if (this.isFull()) return false;
+		if (this.subscriberCount !== 0) {
+			this.value = value;
+			this.subscribers = this.subscriberCount;
+			this.publisherIndex += 1;
+		}
+		if (this.replayBuffer) this.replayBuffer.offer(value);
+		return true;
+	}
+	publishAll(elements) {
+		if (this.subscriberCount === 0) {
+			if (this.replayBuffer) this.replayBuffer.offerAll(elements);
+			return [];
+		}
+		const chunk = fromIterable$2(elements);
+		if (chunk.length === 0) return chunk;
+		if (this.publish(chunk[0])) return chunk.slice(1);
+		else return chunk;
+	}
+	slide() {
+		if (this.isFull()) {
+			this.subscribers = 0;
+			this.value = AbsentValue;
+		}
+		if (this.replayBuffer) this.replayBuffer.slide();
+	}
+	subscribe() {
+		this.subscriberCount += 1;
+		return new BoundedPubSubSingleSubscription(this, this.publisherIndex, false);
+	}
+};
+var BoundedPubSubSingleSubscription = class {
+	self;
+	subscriberIndex;
+	unsubscribed;
+	constructor(self$1, subscriberIndex, unsubscribed) {
+		this.self = self$1;
+		this.subscriberIndex = subscriberIndex;
+		this.unsubscribed = unsubscribed;
+	}
+	isEmpty() {
+		return this.unsubscribed || this.self.subscribers === 0 || this.subscriberIndex === this.self.publisherIndex;
+	}
+	size() {
+		return this.isEmpty() ? 0 : 1;
+	}
+	poll() {
+		if (this.isEmpty()) return Empty$2;
+		const elem = this.self.value;
+		this.self.subscribers -= 1;
+		if (this.self.subscribers === 0) this.self.value = AbsentValue;
+		this.subscriberIndex += 1;
+		return elem;
+	}
+	pollUpTo(n) {
+		if (this.isEmpty() || n < 1) return [];
+		const a = this.self.value;
+		this.self.subscribers -= 1;
+		if (this.self.subscribers === 0) this.self.value = AbsentValue;
+		this.subscriberIndex += 1;
+		return [a];
+	}
+	unsubscribe() {
+		if (!this.unsubscribed) {
+			this.unsubscribed = true;
+			this.self.subscriberCount -= 1;
+			if (this.subscriberIndex !== this.self.publisherIndex) {
+				this.self.subscribers -= 1;
+				if (this.self.subscribers === 0) this.self.value = AbsentValue;
+			}
+		}
+	}
+};
+var UnboundedPubSub = class {
+	publisherHead = {
+		value: AbsentValue,
+		subscribers: 0,
+		next: null
+	};
+	publisherTail = this.publisherHead;
+	publisherIndex = 0;
+	subscribersIndex = 0;
+	capacity = Number.MAX_SAFE_INTEGER;
+	replayBuffer;
+	constructor(replayBuffer) {
+		this.replayBuffer = replayBuffer;
+	}
+	replayWindow() {
+		return this.replayBuffer ? new ReplayWindowImpl(this.replayBuffer) : emptyReplayWindow;
+	}
+	isEmpty() {
+		return this.publisherHead === this.publisherTail;
+	}
+	isFull() {
+		return false;
+	}
+	size() {
+		return this.publisherIndex - this.subscribersIndex;
+	}
+	publish(value) {
+		const subscribers = this.publisherTail.subscribers;
+		if (subscribers !== 0) {
+			this.publisherTail.next = {
+				value,
+				subscribers,
+				next: null
+			};
+			this.publisherTail = this.publisherTail.next;
+			this.publisherIndex += 1;
+		}
+		if (this.replayBuffer) this.replayBuffer.offer(value);
+		return true;
+	}
+	publishAll(elements) {
+		if (this.publisherTail.subscribers !== 0) for (const a of elements) this.publish(a);
+		else if (this.replayBuffer) this.replayBuffer.offerAll(elements);
+		return [];
+	}
+	slide() {
+		if (this.publisherHead !== this.publisherTail) {
+			this.publisherHead = this.publisherHead.next;
+			this.publisherHead.value = AbsentValue;
+			this.subscribersIndex += 1;
+		}
+		if (this.replayBuffer) this.replayBuffer.slide();
+	}
+	subscribe() {
+		this.publisherTail.subscribers += 1;
+		return new UnboundedPubSubSubscription(this, this.publisherTail, this.publisherIndex, false);
+	}
+};
+var UnboundedPubSubSubscription = class {
+	self;
+	subscriberHead;
+	subscriberIndex;
+	unsubscribed;
+	constructor(self$1, subscriberHead, subscriberIndex, unsubscribed) {
+		this.self = self$1;
+		this.subscriberHead = subscriberHead;
+		this.subscriberIndex = subscriberIndex;
+		this.unsubscribed = unsubscribed;
+	}
+	isEmpty() {
+		if (this.unsubscribed) return true;
+		let empty$15 = true;
+		let loop = true;
+		while (loop) if (this.subscriberHead === this.self.publisherTail) loop = false;
+		else if (this.subscriberHead.next.value !== AbsentValue) {
+			empty$15 = false;
+			loop = false;
+		} else {
+			this.subscriberHead = this.subscriberHead.next;
+			this.subscriberIndex += 1;
+		}
+		return empty$15;
+	}
+	size() {
+		if (this.unsubscribed) return 0;
+		return this.self.publisherIndex - Math.max(this.subscriberIndex, this.self.subscribersIndex);
+	}
+	poll() {
+		if (this.unsubscribed) return Empty$2;
+		let loop = true;
+		let polled = Empty$2;
+		while (loop) if (this.subscriberHead === this.self.publisherTail) loop = false;
+		else {
+			const elem = this.subscriberHead.next.value;
+			if (elem !== AbsentValue) {
+				polled = elem;
+				this.subscriberHead.subscribers -= 1;
+				if (this.subscriberHead.subscribers === 0) {
+					this.self.publisherHead = this.self.publisherHead.next;
+					this.self.publisherHead.value = AbsentValue;
+					this.self.subscribersIndex += 1;
+				}
+				loop = false;
+			}
+			this.subscriberHead = this.subscriberHead.next;
+			this.subscriberIndex += 1;
+		}
+		return polled;
+	}
+	pollUpTo(n) {
+		const builder = [];
+		let i = 0;
+		while (i !== n) {
+			const a = this.poll();
+			if (a === Empty$2) i = n;
+			else {
+				builder.push(a);
+				i += 1;
+			}
+		}
+		return builder;
+	}
+	unsubscribe() {
+		if (!this.unsubscribed) {
+			this.unsubscribed = true;
+			this.self.publisherTail.subscribers -= 1;
+			while (this.subscriberHead !== this.self.publisherTail) {
+				if (this.subscriberHead.next.value !== AbsentValue) {
+					this.subscriberHead.subscribers -= 1;
+					if (this.subscriberHead.subscribers === 0) {
+						this.self.publisherHead = this.self.publisherHead.next;
+						this.self.publisherHead.value = AbsentValue;
+						this.self.subscribersIndex += 1;
+					}
+				}
+				this.subscriberHead = this.subscriberHead.next;
+			}
+		}
+	}
+};
+var SubscriptionImpl = class {
+	[SubscriptionTypeId] = { _A: identity };
+	pubsub;
+	subscribers;
+	subscription;
+	pollers;
+	shutdownHook;
+	shutdownFlag;
+	strategy;
+	replayWindow;
+	constructor(pubsub, subscribers, subscription, pollers, shutdownHook, shutdownFlag, strategy, replayWindow) {
+		this.pubsub = pubsub;
+		this.subscribers = subscribers;
+		this.subscription = subscription;
+		this.pollers = pollers;
+		this.shutdownHook = shutdownHook;
+		this.shutdownFlag = shutdownFlag;
+		this.strategy = strategy;
+		this.replayWindow = replayWindow;
+	}
+	pipe() {
+		return pipeArguments(this, arguments);
+	}
+};
+var PubSubImpl = class {
+	[TypeId$40] = { _A: identity };
+	pubsub;
+	subscribers;
+	scope;
+	shutdownHook;
+	shutdownFlag;
+	strategy;
+	constructor(pubsub, subscribers, scope$2, shutdownHook, shutdownFlag, strategy) {
+		this.pubsub = pubsub;
+		this.subscribers = subscribers;
+		this.scope = scope$2;
+		this.shutdownHook = shutdownHook;
+		this.shutdownFlag = shutdownFlag;
+		this.strategy = strategy;
+	}
+	pipe() {
+		return pipeArguments(this, arguments);
+	}
+};
+const makePubSubUnsafe = (pubsub, subscribers, scope$2, shutdownHook, shutdownFlag, strategy) => new PubSubImpl(pubsub, subscribers, scope$2, shutdownHook, shutdownFlag, strategy);
+const ensureCapacity = (capacity) => {
+	if (capacity <= 0) throw new Error(`Cannot construct PubSub with capacity of ${capacity}`);
+};
+/**
+* A strategy that applies back pressure to publishers when the `PubSub` is at
+* capacity. This guarantees that all subscribers will receive all messages
+* published to the `PubSub` while they are subscribed. However, it creates the
+* risk that a slow subscriber will slow down the rate at which messages
+* are published and received by other subscribers.
+*
+* @since 4.0.0
+* @category models
+*/
+var BackPressureStrategy = class {
+	publishers = /* @__PURE__ */ make$42();
+	get shutdown() {
+		return withFiber((fiber$2) => forEach$1(takeAll$1(this.publishers), ([_, deferred, last$1]) => last$1 ? interruptWith(deferred, fiber$2.id) : void_$1, {
+			concurrency: "unbounded",
+			discard: true
+		}));
+	}
+	handleSurplus(pubsub, subscribers, elements, isShutdown) {
+		return suspend$3(() => {
+			const deferred = makeUnsafe$7();
+			this.offerUnsafe(elements, deferred);
+			this.onPubSubEmptySpaceUnsafe(pubsub, subscribers);
+			this.completeSubscribersUnsafe(pubsub, subscribers);
+			return (get$7(isShutdown) ? interrupt$1 : _await(deferred)).pipe(onInterrupt(() => {
+				this.removeUnsafe(deferred);
+				return void_$1;
+			}));
+		});
+	}
+	onPubSubEmptySpaceUnsafe(pubsub, subscribers) {
+		let keepPolling = true;
+		while (keepPolling && !pubsub.isFull()) {
+			const publisher = take$2(this.publishers);
+			if (publisher === Empty$2) keepPolling = false;
+			else {
+				const [value, deferred] = publisher;
+				const published = pubsub.publish(value);
+				if (published && publisher[2]) doneUnsafe(deferred, succeed$4(true));
+				else if (!published) prepend(this.publishers, publisher);
+				this.completeSubscribersUnsafe(pubsub, subscribers);
+			}
+		}
+	}
+	completePollersUnsafe(pubsub, subscribers, subscription, pollers) {
+		return strategyCompletePollersUnsafe(this, pubsub, subscribers, subscription, pollers);
+	}
+	completeSubscribersUnsafe(pubsub, subscribers) {
+		return strategyCompleteSubscribersUnsafe(this, pubsub, subscribers);
+	}
+	offerUnsafe(elements, deferred) {
+		const iterator$1 = elements[Symbol.iterator]();
+		let next = iterator$1.next();
+		if (!next.done) while (1) {
+			const value = next.value;
+			next = iterator$1.next();
+			if (next.done) {
+				append(this.publishers, [
+					value,
+					deferred,
+					true
+				]);
+				break;
+			}
+			append(this.publishers, [
+				value,
+				deferred,
+				false
+			]);
+		}
+	}
+	removeUnsafe(deferred) {
+		filter$1(this.publishers, ([_, d]) => d !== deferred);
+	}
+};
+/**
+* A strategy that drops new messages when the `PubSub` is at capacity. This
+* guarantees that a slow subscriber will not slow down the rate at which
+* messages are published. However, it creates the risk that a slow
+* subscriber will slow down the rate at which messages are received by
+* other subscribers and that subscribers may not receive all messages
+* published to the `PubSub` while they are subscribed.
+*
+* @example
+* ```ts
+* import { Effect } from "effect"
+* import * as PubSub from "effect/PubSub"
+*
+* const program = Effect.gen(function*() {
+*   // Create PubSub with dropping strategy
+*   const pubsub = yield* PubSub.dropping<string>(2)
+*
+*   // Or explicitly create with dropping strategy
+*   const customPubsub = yield* PubSub.make<string>({
+*     atomicPubSub: () => PubSub.makeAtomicBounded(2),
+*     strategy: () => new PubSub.DroppingStrategy()
+*   })
+*
+*   // Fill the PubSub
+*   const pub1 = yield* PubSub.publish(pubsub, "msg1") // true
+*   const pub2 = yield* PubSub.publish(pubsub, "msg2") // true
+*   const pub3 = yield* PubSub.publish(pubsub, "msg3") // false (dropped)
+*
+*   console.log("Publication results:", [pub1, pub2, pub3]) // [true, true, false]
+*
+*   // Subscribers will only see the first two messages
+*   yield* Effect.scoped(Effect.gen(function*() {
+*     const subscription = yield* PubSub.subscribe(pubsub)
+*     const messages = yield* PubSub.takeAll(subscription)
+*     console.log("Received messages:", messages) // ["msg1", "msg2"]
+*   }))
+* })
+* ```
+*
+* @since 4.0.0
+* @category models
+*/
+var DroppingStrategy = class {
+	get shutdown() {
+		return void_$1;
+	}
+	handleSurplus(_pubsub, _subscribers, _elements, _isShutdown) {
+		return succeed$1(false);
+	}
+	onPubSubEmptySpaceUnsafe(_pubsub, _subscribers) {}
+	completePollersUnsafe(pubsub, subscribers, subscription, pollers) {
+		return strategyCompletePollersUnsafe(this, pubsub, subscribers, subscription, pollers);
+	}
+	completeSubscribersUnsafe(pubsub, subscribers) {
+		return strategyCompleteSubscribersUnsafe(this, pubsub, subscribers);
+	}
+};
+/**
+* A strategy that adds new messages and drops old messages when the `PubSub` is
+* at capacity. This guarantees that a slow subscriber will not slow down
+* the rate at which messages are published and received by other
+* subscribers. However, it creates the risk that a slow subscriber will
+* not receive some messages published to the `PubSub` while it is subscribed.
+*
+* @example
+* ```ts
+* import { Effect } from "effect"
+* import * as PubSub from "effect/PubSub"
+*
+* const program = Effect.gen(function*() {
+*   // Create PubSub with sliding strategy
+*   const pubsub = yield* PubSub.sliding<string>(2)
+*
+*   // Or explicitly create with sliding strategy
+*   const customPubsub = yield* PubSub.make<string>({
+*     atomicPubSub: () => PubSub.makeAtomicBounded(2),
+*     strategy: () => new PubSub.SlidingStrategy()
+*   })
+*
+*   // Publish messages that exceed capacity
+*   yield* PubSub.publish(pubsub, "msg1") // stored
+*   yield* PubSub.publish(pubsub, "msg2") // stored
+*   yield* PubSub.publish(pubsub, "msg3") // "msg1" evicted, "msg3" stored
+*   yield* PubSub.publish(pubsub, "msg4") // "msg2" evicted, "msg4" stored
+*
+*   // Subscribers will see the most recent messages
+*   yield* Effect.scoped(Effect.gen(function*() {
+*     const subscription = yield* PubSub.subscribe(pubsub)
+*     const messages = yield* PubSub.takeAll(subscription)
+*     console.log("Recent messages:", messages) // ["msg3", "msg4"]
+*   }))
+* })
+* ```
+*
+* @since 4.0.0
+* @category models
+*/
+var SlidingStrategy = class {
+	get shutdown() {
+		return void_$1;
+	}
+	handleSurplus(pubsub, subscribers, elements, _isShutdown) {
+		return sync(() => {
+			this.slidingPublishUnsafe(pubsub, elements);
+			this.completeSubscribersUnsafe(pubsub, subscribers);
+			return true;
+		});
+	}
+	onPubSubEmptySpaceUnsafe(_pubsub, _subscribers) {}
+	completePollersUnsafe(pubsub, subscribers, subscription, pollers) {
+		return strategyCompletePollersUnsafe(this, pubsub, subscribers, subscription, pollers);
+	}
+	completeSubscribersUnsafe(pubsub, subscribers) {
+		return strategyCompleteSubscribersUnsafe(this, pubsub, subscribers);
+	}
+	slidingPublishUnsafe(pubsub, elements) {
+		const it = elements[Symbol.iterator]();
+		let next = it.next();
+		if (!next.done && pubsub.capacity > 0) {
+			let a = next.value;
+			let loop = true;
+			while (loop) {
+				pubsub.slide();
+				const pub = pubsub.publish(a);
+				if (pub && (next = it.next()) && !next.done) a = next.value;
+				else if (pub) loop = false;
+			}
+		}
+	}
+};
+const strategyCompletePollersUnsafe = (strategy, pubsub, subscribers, subscription, pollers) => {
+	let keepPolling = true;
+	while (keepPolling && !subscription.isEmpty()) {
+		const poller = take$2(pollers);
+		if (poller === Empty$2) {
+			removeSubscribers(subscribers, subscription, pollers);
+			if (pollers.length === 0) keepPolling = false;
+			else addSubscribers(subscribers, subscription, pollers);
+		} else {
+			const pollResult = subscription.poll();
+			if (pollResult === Empty$2) prepend(pollers, poller);
+			else {
+				doneUnsafe(poller, succeed$4(pollResult));
+				strategy.onPubSubEmptySpaceUnsafe(pubsub, subscribers);
+			}
+		}
+	}
+};
+const strategyCompleteSubscribersUnsafe = (strategy, pubsub, subscribers) => {
+	for (const [subscription, pollersSet] of subscribers) for (const pollers of pollersSet) strategy.completePollersUnsafe(pubsub, subscribers, subscription, pollers);
+};
+var ReplayBuffer = class {
+	capacity;
+	head = {
+		value: AbsentValue,
+		next: null
+	};
+	tail = this.head;
+	size = 0;
+	index = 0;
+	constructor(capacity) {
+		this.capacity = capacity;
+	}
+	slide() {
+		this.index++;
+	}
+	offer(a) {
+		this.tail.value = a;
+		this.tail.next = {
+			value: AbsentValue,
+			next: null
+		};
+		this.tail = this.tail.next;
+		if (this.size === this.capacity) this.head = this.head.next;
+		else this.size += 1;
+	}
+	offerAll(as$3) {
+		for (const a of as$3) this.offer(a);
+	}
+};
+var ReplayWindowImpl = class {
+	head;
+	index;
+	remaining;
+	buffer;
+	constructor(buffer$1) {
+		this.buffer = buffer$1;
+		this.index = buffer$1.index;
+		this.remaining = buffer$1.size;
+		this.head = buffer$1.head;
+	}
+	fastForward() {
+		while (this.index < this.buffer.index) {
+			this.head = this.head.next;
+			this.index++;
+		}
+	}
+	take() {
+		if (this.remaining === 0) return;
+		else if (this.index < this.buffer.index) this.fastForward();
+		this.remaining--;
+		const value = this.head.value;
+		this.head = this.head.next;
+		return value;
+	}
+	takeN(n) {
+		if (this.remaining === 0) return [];
+		else if (this.index < this.buffer.index) this.fastForward();
+		const len = Math.min(n, this.remaining);
+		const items = new Array(len);
+		for (let i = 0; i < len; i++) {
+			const value = this.head.value;
+			this.head = this.head.next;
+			items[i] = value;
+		}
+		this.remaining -= len;
+		return items;
+	}
+	takeAll() {
+		return this.takeN(this.remaining);
+	}
+};
+const emptyReplayWindow = {
+	remaining: 0,
+	take: () => void 0,
+	takeN: () => [],
+	takeAll: () => []
+};
 
 //#endregion
 //#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/Queue.js
@@ -25188,7 +26873,7 @@ const make$39 = (options) => withFiber$1((fiber$2) => {
 	self$1.scheduler = fiber$2.currentScheduler;
 	self$1.capacity = options?.capacity ?? Number.POSITIVE_INFINITY;
 	self$1.strategy = options?.strategy ?? "suspend";
-	self$1.messages = make$41();
+	self$1.messages = make$42();
 	self$1.scheduleRunning = false;
 	self$1.state = {
 		_tag: "Open",
@@ -25267,7 +26952,7 @@ const offer = (self$1, message) => suspend$4(() => {
 			}
 			return offerRemainingSingle(self$1, message);
 		case "sliding":
-			take$1(self$1.messages);
+			take$2(self$1.messages);
 			append(self$1.messages, message);
 			return exitTrue;
 	}
@@ -25307,7 +26992,7 @@ const offerUnsafe = (self$1, message) => {
 	if (self$1.state._tag !== "Open") return false;
 	else if (self$1.messages.length >= self$1.capacity) {
 		if (self$1.strategy === "sliding") {
-			take$1(self$1.messages);
+			take$2(self$1.messages);
 			append(self$1.messages, message);
 			return true;
 		} else if (self$1.capacity <= 0 && self$1.state.takers.size > 0) {
@@ -25704,14 +27389,14 @@ const take = (self$1) => suspend$4(() => takeUnsafe(self$1) ?? andThen$1(awaitTa
 const takeUnsafe = (self$1) => {
 	if (self$1.state._tag === "Done") return self$1.state.exit;
 	if (self$1.messages.length > 0) {
-		const message = take$1(self$1.messages);
+		const message = take$2(self$1.messages);
 		releaseCapacity(self$1);
 		return exitSucceed(message);
 	} else if (self$1.capacity <= 0 && self$1.state.offers.size > 0) {
 		self$1.capacity = 1;
 		releaseCapacity(self$1);
 		self$1.capacity = 0;
-		const message = take$1(self$1.messages);
+		const message = take$2(self$1.messages);
 		releaseCapacity(self$1);
 		return exitSucceed(message);
 	}
@@ -25781,7 +27466,7 @@ const takeBetweenUnsafe = (self$1, min$3, max$3) => {
 		self$1.capacity = 1;
 		releaseCapacity(self$1);
 		self$1.capacity = 0;
-		const messages = [take$1(self$1.messages)];
+		const messages = [take$2(self$1.messages)];
 		releaseCapacity(self$1);
 		return exitSucceed(messages);
 	}
@@ -25868,6 +27553,14 @@ const finalize = (self$1, exit$2) => {
 	openState.awaiters.clear();
 };
 
+//#endregion
+//#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/Take.js
+/**
+* @since 4.0.0
+* @categor Conversions
+*/
+const toPull = (take$3) => isExit(take$3) ? isSuccess$2(take$3) ? done(take$3.value) : take$3 : succeed$1(take$3);
+
 //#endregion
 //#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/Channel.js
 /**
@@ -26228,6 +27921,16 @@ const failCause = (cause) => fromPull$1(failCause$2(cause));
 */
 const die = (defect) => failCause(die$2(defect));
 /**
+* @since 4.0.0
+* @category constructors
+*/
+const fromEffectTake = (effect$1) => fromPull$1(succeed$1(flatMap(effect$1, toPull)));
+/**
+* @since 4.0.0
+* @category constructors
+*/
+const fromPubSubTake$1 = (pubsub) => unwrap$2(map$6(subscribe(pubsub), (sub) => fromEffectTake(take$1(sub))));
+/**
 * Maps the output of this channel using the specified function.
 *
 * @example
@@ -26371,7 +28074,7 @@ const mapEffectConcurrent = (self$1, f, options) => fromTransformBracket(fnUntra
 			trackFiber(fiber$2);
 			fiber$2.addObserver(onExit$4);
 			return offer(effects, join$1(fiber$2));
-		}), forever({ autoYield: false }), catchCause$1((cause) => offer(effects, failCause$3(cause)).pipe(andThen(failCause$1(effects, cause)))), forkIn(forkedScope));
+		}), forever({ autoYield: false }), catchCause$1((cause) => offer(effects, failCause$4(cause)).pipe(andThen(failCause$1(effects, cause)))), forkIn(forkedScope));
 	}
 	return take(queue);
 }));
@@ -26428,8 +28131,8 @@ const flattenArray = (self$1) => transformPull$1(self$1, (pull) => {
 * @since 4.0.0
 * @category Filtering
 */
-const filterMapEffect$1 = /* @__PURE__ */ dual(2, (self$1, filter$6) => fromTransform$1((upstream, scope$2) => map$6(toTransform(self$1)(upstream, scope$2), (pull) => flatMap(pull, function loop(elem) {
-	return flatMap(filter$6(elem), (result$2) => isFail(result$2) ? flatMap(pull, loop) : succeed$1(result$2));
+const filterMapEffect$1 = /* @__PURE__ */ dual(2, (self$1, filter$7) => fromTransform$1((upstream, scope$2) => map$6(toTransform(self$1)(upstream, scope$2), (pull) => flatMap(pull, function loop(elem) {
+	return flatMap(filter$7(elem), (result$2) => isFail(result$2) ? flatMap(pull, loop) : succeed$1(result$2));
 }))));
 /**
 * Filters arrays of elements emitted by a channel, applying the filter
@@ -26467,14 +28170,14 @@ const filterMapEffect$1 = /* @__PURE__ */ dual(2, (self$1, filter$6) => fromTran
 * @category Filtering
 */
 const filterArray = /* @__PURE__ */ dual(2, (self$1, predicate) => transformPull$1(self$1, (pull) => succeed$1(flatMap(pull, function loop(arr) {
-	const filtered = filter$3(arr, predicate);
+	const filtered = filter$4(arr, predicate);
 	return isReadonlyArrayNonEmpty(filtered) ? succeed$1(filtered) : flatMap(pull, loop);
 }))));
 /**
 * @since 4.0.0
 * @category Filtering
 */
-const filterMapArrayEffect = /* @__PURE__ */ dual(2, (self$1, filter$6) => filterMapEffect$1(self$1, (arr) => map$6(filterMap(arr, filter$6), (passes) => isReadonlyArrayNonEmpty(passes) ? passes : failVoid)));
+const filterMapArrayEffect = /* @__PURE__ */ dual(2, (self$1, filter$7) => filterMapEffect$1(self$1, (arr) => map$6(filterMap(arr, filter$7), (passes) => isReadonlyArrayNonEmpty(passes) ? passes : failVoid)));
 /**
 * Catches any cause of failure from the channel and allows recovery by
 * creating a new channel based on the caught cause.
@@ -26517,7 +28220,7 @@ const catchCause = /* @__PURE__ */ dual(2, (self$1, f) => fromTransform$1((upstr
 			if (isDoneCause(cause)) return failCause$2(cause);
 			const toClose = forkedScope;
 			forkedScope = forkUnsafe(scope$2);
-			return close(toClose, failCause$3(cause)).pipe(andThen(toTransform(f(cause))(upstream, forkedScope)), flatMap((childPull) => {
+			return close(toClose, failCause$4(cause)).pipe(andThen(toTransform(f(cause))(upstream, forkedScope)), flatMap((childPull) => {
 				currentPull = childPull;
 				return childPull;
 			}));
@@ -26532,8 +28235,8 @@ const catchCause = /* @__PURE__ */ dual(2, (self$1, f) => fromTransform$1((upstr
 * @since 4.0.0
 * @category Error handling
 */
-const catchCauseFilter = /* @__PURE__ */ dual(3, (self$1, filter$6, f) => catchCause(self$1, (cause) => {
-	const eb = filter$6(cause);
+const catchCauseFilter = /* @__PURE__ */ dual(3, (self$1, filter$7, f) => catchCause(self$1, (cause) => {
+	const eb = filter$7(cause);
 	return !isFail(eb) ? f(eb, cause) : failCause(eb.fail);
 }));
 const catch_ = /* @__PURE__ */ dual(2, (self$1, f) => catchCauseFilter(self$1, filterError, f));
@@ -26572,6 +28275,28 @@ const mapError$1 = /* @__PURE__ */ dual(2, (self$1, f) => catch_(self$1, (err) =
 */
 const orDie$1 = (self$1) => catch_(self$1, die);
 /**
+* Returns a new channel that retries this channel according to the specified
+* schedule whenever it fails.
+*
+* @since 4.0.0
+* @category utils
+*/
+const retry$2 = /* @__PURE__ */ dual(2, (self$1, schedule) => suspend$2(() => {
+	let step = void 0;
+	let meta = CurrentMetadata.defaultValue();
+	const withReset = onFirst(provideServiceEffect(self$1, CurrentMetadata, sync(() => meta)), () => {
+		step = void 0;
+		return void_$1;
+	});
+	const resolvedSchedule = typeof schedule === "function" ? schedule(identity) : schedule;
+	const loop = catch_(withReset, fnUntraced(function* (error$1) {
+		if (!step) step = yield* toStepWithMetadata(resolvedSchedule);
+		meta = yield* step(error$1);
+		return loop;
+	}, (effect$1, error$1) => catchDone(effect$1, () => succeed$1(fail$2(error$1))), unwrap$2));
+	return loop;
+}));
+/**
 * Returns a new channel, which is the merge of this channel and the specified
 * channel.
 *
@@ -26784,12 +28509,34 @@ const bufferArray = /* @__PURE__ */ dual(2, (self$1, options) => fromTransform$1
 * @category utils
 */
 const onExit$1 = /* @__PURE__ */ dual(2, (self$1, finalizer) => fromTransformBracket((upstream, scope$2, forkedScope) => addFinalizerExit(forkedScope, finalizer).pipe(andThen(toTransform(self$1)(upstream, scope$2)))));
+/**
+* @since 4.0.0
+* @category utils
+*/
+const onFirst = /* @__PURE__ */ dual(2, (self$1, onFirst$1) => transformPull$1(self$1, (pull) => sync(() => {
+	let isFirst = true;
+	const pullFirst = tap(pull, (element) => {
+		isFirst = false;
+		return onFirst$1(element);
+	});
+	return suspend$3(() => isFirst ? pullFirst : pull);
+})));
 const runWith$1 = (self$1, f, onHalt) => suspend$3(() => {
 	const scope$2 = makeUnsafe$6();
 	const makePull = toTransform(self$1)(done(), scope$2);
 	return catchDone(flatMap(makePull, f), onHalt ? onHalt : succeed$1).pipe(onExit$2((exit$2) => close(scope$2, exit$2)));
 });
 /**
+* @since 4.0.0
+* @category Services
+*/
+const provideService = /* @__PURE__ */ dual(3, (self$1, key, service$2) => fromTransform$1((upstream, scope$2) => map$6(provideService$1(toTransform(self$1)(upstream, scope$2), key, service$2), provideService$1(key, service$2))));
+/**
+* @since 4.0.0
+* @category Services
+*/
+const provideServiceEffect = /* @__PURE__ */ dual(3, (self$1, key, service$2) => fromTransform$1((upstream, scope$2) => flatMap(service$2, (s) => toTransform(provideService(self$1, key, s))(upstream, scope$2))));
+/**
 * Runs a channel and applies an effect to each output element.
 *
 * @example
@@ -26875,6 +28622,18 @@ const runFold = /* @__PURE__ */ dual(3, (self$1, initial, f) => suspend$3(() =>
 * @category Destructors
 */
 const toPullScoped = (self$1, scope$2) => toTransform(self$1)(done(), scope$2);
+const makePubSub = (options) => acquireRelease(options.capacity === "unbounded" ? unbounded(options) : options.strategy === "dropping" ? dropping(options) : options.strategy === "sliding" ? sliding(options) : bounded$1(options), shutdown$1);
+/**
+* Converts a channel to a PubSub for concurrent consumption.
+*
+* @since 4.0.0
+* @category Destructors
+*/
+const toPubSubTake$1 = /* @__PURE__ */ dual(2, /* @__PURE__ */ fnUntraced(function* (self$1, options) {
+	const pubsub = yield* makePubSub(options);
+	yield* runForEach$1(self$1, (value) => publish(pubsub, value)).pipe(onExit$2((exit$2) => publish(pubsub, exit$2)), forkScoped);
+	return pubsub;
+}));
 
 //#endregion
 //#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/internal/stream.js
@@ -27500,7 +29259,7 @@ const makeUnsafe$3 = (options) => ({
 */
 const make$37 = (options) => withFiber((fiber$2) => {
 	const services$2 = fiber$2.services;
-	const scope$2 = get$7(services$2, Scope);
+	const scope$2 = get$8(services$2, Scope);
 	const self$1 = makeUnsafe$3({
 		lookup: options.lookup,
 		services: services$2,
@@ -27668,7 +29427,7 @@ var RcRefImpl = class {
 /** @internal */
 const make$36 = (options) => withFiber((fiber$2) => {
 	const services$2 = fiber$2.services;
-	const scope$2 = get$7(services$2, Scope);
+	const scope$2 = get$8(services$2, Scope);
 	const ref = new RcRefImpl(options.acquire, services$2, scope$2, options.idleTimeToLive ? fromDurationInputUnsafe(options.idleTimeToLive) : void 0);
 	return as(addFinalizerExit(scope$2, () => {
 		const close$1 = ref.state._tag === "Acquired" ? close(ref.state.scope, void_$2) : void_$1;
@@ -27873,6 +29632,35 @@ const DefaultChunkSize = DefaultChunkSize$1;
 */
 const fromChannel = fromChannel$2;
 /**
+* Creates a stream from an effect producing a value of type `A`, which is
+* repeated using the specified schedule.
+*
+* **Previously Known As**
+*
+* This API replaces the following from Effect 3.x:
+*
+* - `Stream.repeatEffectWithSchedule`
+*
+* @since 2.0.0
+* @category constructors
+*/
+const fromEffectSchedule = (effect$1, schedule) => fromPull(gen(function* () {
+	const step = yield* toStepWithMetadata(schedule);
+	let s = yield* provideService$1(effect$1, CurrentMetadata, CurrentMetadata.defaultValue());
+	let initial = true;
+	const pull = suspend$3(() => step(s)).pipe(flatMap((meta) => provideService$1(effect$1, CurrentMetadata, meta)), map$6((next) => {
+		s = next;
+		return of(next);
+	}));
+	return suspend$3(() => {
+		if (initial) {
+			initial = false;
+			return succeed$1(of(s));
+		}
+		return pull;
+	});
+}));
+/**
 * Creates a stream from a pull effect.
 *
 * A pull effect is a low-level representation of a stream that can be used
@@ -28032,6 +29820,11 @@ const suspend$1 = (stream$3) => fromChannel(suspend$2(() => stream$3().channel))
 */
 const fail$1 = (error$1) => fromChannel(fail$2(error$1));
 /**
+* @since 4.0.0
+* @category constructors
+*/
+const fromPubSubTake = (pubsub) => fromChannel(fromPubSubTake$1(pubsub));
+/**
 * Creates a stream from a ReadableStream.
 *
 * @example
@@ -28201,7 +29994,7 @@ const filter = /* @__PURE__ */ dual(2, (self$1, predicate) => fromChannel(filter
 * @since 2.0.0
 * @category Filtering
 */
-const filterMapEffect = /* @__PURE__ */ dual(2, (self$1, filter$6) => fromChannel(filterMapArrayEffect(toChannel(self$1), filter$6)));
+const filterMapEffect = /* @__PURE__ */ dual(2, (self$1, filter$7) => fromChannel(filterMapArrayEffect(toChannel(self$1), filter$7)));
 /**
 * Allows a faster producer to progress independently of a slower consumer by
 * buffering up to `capacity` elements in a queue.
@@ -28239,6 +30032,19 @@ const mapError = /* @__PURE__ */ dual(2, (self$1, f) => fromChannel(mapError$1(s
 */
 const orDie = (self$1) => fromChannel(orDie$1(self$1.channel));
 /**
+* When the stream fails, retry it according to the given schedule
+*
+* This retries the entire stream, so will re-execute all of the stream's
+* acquire operations.
+*
+* The schedule is reset as soon as the first element passes through the
+* stream again.
+*
+* @since 2.0.0
+* @category Error handling
+*/
+const retry$1 = /* @__PURE__ */ dual(2, (self$1, policy) => fromChannel(retry$2(self$1.channel, policy)));
+/**
 * Applies the Sink transducer to the stream and emits its outputs.
 *
 * @since 2.0.0
@@ -28265,6 +30071,19 @@ const transduce = /* @__PURE__ */ dual(2, (self$1, sink) => transformPull(self$1
 	return suspend$3(() => done$3 ? done$3 : pull);
 })));
 /**
+* @since 2.0.0
+* @category Broadcast
+*/
+const broadcast = /* @__PURE__ */ dual(2, (self$1, options) => map$6(toPubSubTake(self$1, options), fromPubSubTake));
+/**
+* @since 2.0.0
+* @category Broadcast
+*/
+const share = /* @__PURE__ */ dual(2, (self$1, options) => map$6(make$35({
+	acquire: broadcast(self$1, options),
+	idleTimeToLive: options.idleTimeToLive
+}), (ref) => unwrap(get$3(ref))));
+/**
 * Pipes all the values from this stream through the provided channel.
 *
 * The channel processes chunks of values (NonEmptyReadonlyArray) and can transform both
@@ -28574,6 +30393,11 @@ const toReadableStreamWith = /* @__PURE__ */ dual((args$1) => isStream(args$1[0]
 * @category destructors
 */
 const toReadableStreamEffect = /* @__PURE__ */ dual((args$1) => isStream(args$1[0]), (self$1, options) => map$6(services(), (context) => toReadableStreamWith(self$1, context, options)));
+/**
+* @since 4.0.0
+* @category destructors
+*/
+const toPubSubTake = /* @__PURE__ */ dual(2, (self$1, options) => toPubSubTake$1(self$1.channel, options));
 
 //#endregion
 //#region node_modules/.pnpm/effect@https+++pkg.pr.new+Effect-TS+effect-smol+effect@53d2c5b_bb57938f6a2db8d6e7529a5713147df2/node_modules/effect/dist/FileSystem.js
@@ -29272,15 +31096,15 @@ const Proto$15 = {
 * @category Constructors
 * @since 4.0.0
 */
-function make$33(get$8, mapInput$1, prefix$2) {
+function make$33(get$9, mapInput$1, prefix$2) {
 	const self$1 = Object.create(Proto$15);
-	self$1.get = get$8;
+	self$1.get = get$9;
 	self$1.mapInput = mapInput$1;
 	self$1.prefix = prefix$2;
 	self$1.load = (path$2) => {
 		if (mapInput$1) path$2 = mapInput$1(path$2);
 		if (prefix$2) path$2 = [...prefix$2, ...path$2];
-		return get$8(path$2);
+		return get$9(path$2);
 	};
 	return self$1;
 }
@@ -30060,7 +31884,7 @@ function fromASTs(asts) {
 	const schemas = map$10(asts, (ast) => recur$2(ast));
 	return {
 		representations: map$10(schemas, compact),
-		references: map$11(filter$4(references, (_, k) => !isCompactable(k)), compact)
+		references: map$11(filter$5(references, (_, k) => !isCompactable(k)), compact)
 	};
 	function isCompactable($ref) {
 		return !usedReferences.has($ref);
@@ -30327,7 +32151,7 @@ const fromASTBlacklist = /* @__PURE__ */ new Set([
 ]);
 function fromASTAnnotations(annotations$1) {
 	if (annotations$1 !== void 0) {
-		const filtered = filter$4(annotations$1, (_, k) => !fromASTBlacklist.has(k));
+		const filtered = filter$5(annotations$1, (_, k) => !fromASTBlacklist.has(k));
 		if (!isEmptyRecord(filtered)) return { annotations: filtered };
 	}
 }
@@ -30539,11 +32363,11 @@ function toJsonSchemaMultiDocument(multiDocument, options) {
 			}
 		}
 	}
-	function filterToJsonSchema(filter$6, type) {
-		const meta = filter$6.meta;
+	function filterToJsonSchema(filter$7, type) {
+		const meta = filter$7.meta;
 		if (!meta) return void 0;
 		let out = on$1(meta);
-		const a = collectJsonSchemaAnnotations(filter$6.annotations);
+		const a = collectJsonSchemaAnnotations(filter$7.annotations);
 		if (a) out = {
 			...out,
 			...a
@@ -31159,7 +32983,7 @@ function suspend(f) {
 }
 function decodeTo(to, transformation) {
 	return (from) => {
-		return make$31(decodeTo$1(from.ast, to.ast, transformation ? make$42(transformation) : passthrough()), {
+		return make$31(decodeTo$1(from.ast, to.ast, transformation ? make$43(transformation) : passthrough()), {
 			from,
 			to
 		});
@@ -31202,7 +33026,7 @@ function instanceOf(constructor, annotations$1) {
 */
 function link$1() {
 	return (encodeTo, transformation) => {
-		return new Link(encodeTo.ast, make$42(transformation));
+		return new Link(encodeTo.ast, make$43(transformation));
 	};
 }
 /**
@@ -31428,7 +33252,7 @@ function makeIsBetween(deriveOptions) {
 * @since 4.0.0
 */
 const isGreaterThan = /* @__PURE__ */ makeIsGreaterThan({
-	order: Number$4,
+	order: Number$5,
 	annotate: (exclusiveMinimum) => ({
 		meta: {
 			_tag: "isGreaterThan",
@@ -31457,7 +33281,7 @@ const isGreaterThan = /* @__PURE__ */ makeIsGreaterThan({
 * @since 4.0.0
 */
 const isGreaterThanOrEqualTo = /* @__PURE__ */ makeIsGreaterThanOrEqualTo({
-	order: Number$4,
+	order: Number$5,
 	annotate: (minimum) => ({
 		meta: {
 			_tag: "isGreaterThanOrEqualTo",
@@ -31483,7 +33307,7 @@ const isGreaterThanOrEqualTo = /* @__PURE__ */ makeIsGreaterThanOrEqualTo({
 * @since 4.0.0
 */
 const isLessThan = /* @__PURE__ */ makeIsLessThan({
-	order: Number$4,
+	order: Number$5,
 	annotate: (exclusiveMaximum) => ({
 		meta: {
 			_tag: "isLessThan",
@@ -31512,7 +33336,7 @@ const isLessThan = /* @__PURE__ */ makeIsLessThan({
 * @since 4.0.0
 */
 const isLessThanOrEqualTo = /* @__PURE__ */ makeIsLessThanOrEqualTo({
-	order: Number$4,
+	order: Number$5,
 	annotate: (maximum) => ({
 		meta: {
 			_tag: "isLessThanOrEqualTo",
@@ -31540,7 +33364,7 @@ const isLessThanOrEqualTo = /* @__PURE__ */ makeIsLessThanOrEqualTo({
 * @since 4.0.0
 */
 const isBetween = /* @__PURE__ */ makeIsBetween({
-	order: Number$4,
+	order: Number$5,
 	annotate: (options) => {
 		return {
 			meta: {
@@ -33470,7 +35294,7 @@ var require_ini = /* @__PURE__ */ __commonJSMin$1(((exports, module) => {
 			if (Array.isArray(p[key])) p[key].push(value);
 			else p[key] = value;
 		}
-		const remove$3 = [];
+		const remove$4 = [];
 		for (const k of Object.keys(out)) {
 			if (!hasOwnProperty.call(out, k) || typeof out[k] !== "object" || Array.isArray(out[k])) continue;
 			const parts$1 = splitSections(k, ".");
@@ -33484,9 +35308,9 @@ var require_ini = /* @__PURE__ */ __commonJSMin$1(((exports, module) => {
 			}
 			if (p === out && nl === l) continue;
 			p[nl] = out[k];
-			remove$3.push(k);
+			remove$4.push(k);
 		}
-		for (const del of remove$3) delete out[del];
+		for (const del of remove$4) delete out[del];
 		return out;
 	};
 	const isQuoted = (val) => {
@@ -39900,12 +41724,12 @@ var require_set = /* @__PURE__ */ __commonJSMin$1(((exports) => {
 		}
 		static from(schema$1, iterable, ctx) {
 			const { replacer } = ctx;
-			const set$6 = new this(schema$1);
+			const set$7 = new this(schema$1);
 			if (iterable && Symbol.iterator in Object(iterable)) for (let value of iterable) {
 				if (typeof replacer === "function") value = replacer.call(iterable, value, value);
-				set$6.items.push(Pair.createPair(value, null, ctx));
+				set$7.items.push(Pair.createPair(value, null, ctx));
 			}
-			return set$6;
+			return set$7;
 		}
 	};
 	YAMLSet.tag = "tag:yaml.org,2002:set";
@@ -44641,11 +46465,11 @@ const renderAutoCompleteFilter = (state, options) => {
 };
 const renderAutoCompleteOutput = (state, leadingSymbol, trailingSymbol, options) => {
 	const prefix$2 = leadingSymbol + " ";
-	const filter$6 = renderAutoCompleteFilter(state, options);
+	const filter$7 = renderAutoCompleteFilter(state, options);
 	return match$5(options.message.split(NEWLINE_REGEXP), {
-		onEmpty: () => prefix$2 + " " + trailingSymbol + " " + filter$6,
+		onEmpty: () => prefix$2 + " " + trailingSymbol + " " + filter$7,
 		onNonEmpty: (promptLines) => {
-			return prefix$2 + map$10(promptLines, (line) => annotateLine(line)).join("\n") + " " + trailingSymbol + " " + filter$6;
+			return prefix$2 + map$10(promptLines, (line) => annotateLine(line)).join("\n") + " " + trailingSymbol + " " + filter$7;
 		}
 	});
 };
@@ -47533,7 +49357,7 @@ const withSubcommands = /* @__PURE__ */ dual(2, (self$1, subcommands) => {
 		if (internal._subcommand) {
 			const child = byName.get(internal._subcommand.name);
 			if (!child) return yield* new ShowHelp({ commandPath: path$2 });
-			return yield* child.handle(internal._subcommand.result, [...path$2, child.name]).pipe(provideService(impl.service, input));
+			return yield* child.handle(internal._subcommand.result, [...path$2, child.name]).pipe(provideService$1(impl.service, input));
 		}
 		return yield* impl.handle(input, path$2);
 	});
@@ -47732,7 +49556,7 @@ const runWith = (command, config) => {
 		if (parseResult._tag === "Failure") return yield* showHelp(command, commandPath, [parseResult.failure]);
 		const parsed = parseResult.success;
 		const program = commandImpl.handle(parsed, [command.name]);
-		yield* logLevel !== void 0 ? provideService(program, MinimumLogLevel, logLevel) : program;
+		yield* logLevel !== void 0 ? provideService$1(program, MinimumLogLevel, logLevel) : program;
 	}, catch_$1((error$1) => isCliError(error$1) && error$1._tag === "ShowHelp" ? showHelp(command, error$1.commandPath) : fail$4(error$1)));
 };
 
@@ -48377,12 +50201,12 @@ const makeUnsafe = (backing, deferred) => {
 * @since 2.0.0
 * @category constructors
 */
-const make$25 = () => acquireRelease(sync(() => makeUnsafe(/* @__PURE__ */ new Set(), makeUnsafe$7())), (set$6) => suspend$3(() => {
-	const state = set$6.state;
+const make$25 = () => acquireRelease(sync(() => makeUnsafe(/* @__PURE__ */ new Set(), makeUnsafe$7())), (set$7) => suspend$3(() => {
+	const state = set$7.state;
 	if (state._tag === "Closed") return void_$1;
-	set$6.state = { _tag: "Closed" };
+	set$7.state = { _tag: "Closed" };
 	const fibers = state.backing;
-	return interruptAll(fibers).pipe(into(set$6.deferred));
+	return interruptAll(fibers).pipe(into(set$7.deferred));
 }));
 const internalFiberId = -1;
 const isInternalInterruption = /* @__PURE__ */ toPredicate(/* @__PURE__ */ compose(filterInterruptors, /* @__PURE__ */ has$2(internalFiberId)));
@@ -49125,20 +50949,20 @@ const toSchemaStore = (self$1, schema$1) => {
 	const jsonSchema = fromJsonString(serializer);
 	const decode$2 = decodeEffect(jsonSchema);
 	const encode$2 = encodeEffect(jsonSchema);
-	const get$8 = (key) => flatMap(self$1.get(key), match$9({
+	const get$9 = (key) => flatMap(self$1.get(key), match$9({
 		onUndefined: () => succeedNone,
 		onDefined: (value) => asSome(decode$2(value))
 	}));
-	const set$6 = (key, value) => flatMap(encode$2(value), (json) => self$1.set(key, json));
-	const modify$1 = (key, f) => flatMap(get$8(key), (o) => {
+	const set$7 = (key, value) => flatMap(encode$2(value), (json) => self$1.set(key, json));
+	const modify$1 = (key, f) => flatMap(get$9(key), (o) => {
 		if (isNone(o)) return succeedNone;
 		const newValue = f(o.value);
-		return as(set$6(key, newValue), some(newValue));
+		return as(set$7(key, newValue), some(newValue));
 	});
 	return {
 		[SchemaStoreTypeId]: SchemaStoreTypeId,
-		get: get$8,
-		set: set$6,
+		get: get$9,
+		set: set$7,
 		modify: modify$1,
 		remove: self$1.remove,
 		clear: self$1.clear,
@@ -50810,7 +52634,7 @@ const makePipedCommand = (left, right, options = {}) => Object.assign(Object.cre
 * @since 4.0.0
 * @category Constructors
 */
-const make$21 = function make$54(...args$1) {
+const make$21 = function make$55(...args$1) {
 	if (isTemplateString(args$1[0])) {
 		const [templates, ...expressions] = args$1;
 		const tokens = parseTemplates(templates, expressions);
@@ -51257,7 +53081,7 @@ const toUint8Array = (readable, options) => map$6(toArrayBuffer(readable, option
 const readableToPullUnsafe = (options) => {
 	const readable = options.readable;
 	const closeOnDone = options.closeOnDone ?? true;
-	const exit$2 = options.exit ?? make$40(void 0);
+	const exit$2 = options.exit ?? make$41(void 0);
 	const latch = makeLatchUnsafe(false);
 	function onReadable() {
 		latch.openUnsafe();
@@ -52105,7 +53929,7 @@ const TypeId$14 = /* @__PURE__ */ Symbol.for("~effect/http/Headers");
 const Proto$5 = /* @__PURE__ */ Object.assign(/* @__PURE__ */ Object.create(null), BaseProto, {
 	[TypeId$14]: TypeId$14,
 	[symbolRedactable](context) {
-		return redact(this, get$7(context, CurrentRedactedNames));
+		return redact(this, get$8(context, CurrentRedactedNames));
 	},
 	toJSON() {
 		return redact$1(this);
@@ -52193,8 +54017,8 @@ const redact = /* @__PURE__ */ dual(2, (self$1, key) => {
 	const modify$1 = (key$1) => {
 		if (typeof key$1 === "string") {
 			const k = key$1.toLowerCase();
-			if (k in self$1) out[k] = make$44(self$1[k]);
-		} else for (const name in self$1) if (key$1.test(name)) out[name] = make$44(self$1[name]);
+			if (k in self$1) out[k] = make$45(self$1[k]);
+		} else for (const name in self$1) if (key$1.test(name)) out[name] = make$45(self$1[name]);
 	};
 	if (Array.isArray(key)) for (let i = 0; i < key.length; i++) modify$1(key[i]);
 	else modify$1(key);
@@ -52417,7 +54241,7 @@ const fromInputNested = (input) => {
 * @since 4.0.0
 * @category Equivalence
 */
-const Equivalence = /* @__PURE__ */ make$51((a, b) => arrayEquivalence(a.params, b.params));
+const Equivalence = /* @__PURE__ */ make$52((a, b) => arrayEquivalence(a.params, b.params));
 const arrayEquivalence = /* @__PURE__ */ makeEquivalence$1(/* @__PURE__ */ makeEquivalence$3([/* @__PURE__ */ strictEqual(), /* @__PURE__ */ strictEqual()]));
 /**
 * @since 4.0.0
@@ -53239,7 +55063,7 @@ const retryTransient = /* @__PURE__ */ dual(2, (self$1, options) => {
 		schedule: passthroughSchedule,
 		times,
 		while: isTransientResponse
-	}), mode === "response-only" ? identity : retry$1({
+	}), mode === "response-only" ? identity : retry$3({
 		while: isOnlySchedule || options.while === void 0 ? isTransientError : or(isTransientError, options.while),
 		schedule,
 		times
@@ -54523,7 +56347,7 @@ const fromWebSocket = (acquire, options) => withFiber((fiber$2) => {
 	const runRaw = (handler$1, opts) => scopedWith(fnUntraced(function* (scope$2) {
 		const fiberSet = yield* make$25().pipe(provide$4(scope$2));
 		const ws = yield* provide$4(acquire, scope$2);
-		const run$8 = yield* provideService(runtime(fiberSet)(), WebSocket$1, ws);
+		const run$8 = yield* provideService$1(runtime(fiberSet)(), WebSocket$1, ws);
 		let open$1 = false;
 		function onMessage(event) {
 			if (event.data instanceof Blob) return promise(() => event.data.arrayBuffer()).pipe(andThen((buffer$1) => handler$1(new Uint8Array(buffer$1))), run$8);
@@ -55529,7 +57353,7 @@ var MultipartError = class MultipartError extends TaggedError("MultipartError")
 * @category Config
 */
 const makeConfig = (headers) => withFiber((fiber$2) => {
-	const mimeTypes = get$7(fiber$2.services, FieldMimeTypes);
+	const mimeTypes = get$8(fiber$2.services, FieldMimeTypes);
 	return succeed$1({
 		headers,
 		maxParts: fiber$2.getRef(MaxParts),
@@ -55578,7 +57402,7 @@ const makeChannel = (headers) => fromTransform$1((upstream) => map$6(makeConfig(
 		return void_$1;
 	}), catchCause$1((cause) => {
 		if (isDoneCause(cause)) parser.end();
-		else exit$2 = some(failCause$3(cause));
+		else exit$2 = some(failCause$4(cause));
 		return void_$1;
 	}));
 	return pump.pipe(flatMap(function loop() {
@@ -56537,7 +58361,7 @@ var MiddlewareImpl = class MiddlewareImpl {
 			const stack = [context.mapUnsafe.get(fnContextKey)];
 			if (this.dependencies) {
 				const memoMap = yield* CurrentMemoMap;
-				const scope$2 = get$7(context, Scope);
+				const scope$2 = get$8(context, Scope);
 				const depsContext = yield* buildWithMemoMap(this.dependencies, memoMap, scope$2);
 				stack.push(...getMiddleware(depsContext));
 			}
@@ -61573,8 +63397,8 @@ var Settings = class extends Service()("lalph/Settings", { make: gen(function* (
 		},
 		capacity: Number.MAX_SAFE_INTEGER
 	});
-	const get$8 = (setting) => get$2(cache, setting);
-	const set$6 = (setting, value) => {
+	const get$9 = (setting) => get$2(cache, setting);
+	const set$7 = (setting, value) => {
 		const s = toSchemaStore(store, setting.schema);
 		const setCache = set$3(cache, setting, value);
 		const update = match$7(value, {
@@ -61584,8 +63408,8 @@ var Settings = class extends Service()("lalph/Settings", { make: gen(function* (
 		return andThen(update, setCache);
 	};
 	return {
-		get: get$8,
-		set: set$6
+		get: get$9,
+		set: set$7
 	};
 }) }) {
 	static layer = effect(this, this.make).pipe(provide$3(layerKvs));
@@ -61620,8 +63444,7 @@ var PrdIssue = class PrdIssue extends Class("PrdIssue")({
 		"done"
 	]).annotate({ description: "The state of the issue." }),
 	blockedBy: Array$1(String$1).annotate({ description: "An array of issue IDs that block this issue. These issues must be completed before this issue can be worked on." }),
-	autoMerge: Boolean$2.annotate({ description: "Whether the issue should be auto-merged when complete. Read-only field" }),
-	githubPrNumber: NullOr(Finite).annotate({ description: "The created or updated Github pull request number for this task." })
+	autoMerge: Boolean$2.annotate({ description: "Whether the issue should be auto-merged when complete. Read-only field" })
 }) {
 	static Array = Array$1(this);
 	static ArrayFromJson = toCodecJson(this.Array);
@@ -61641,12 +63464,6 @@ var PrdIssue = class PrdIssue extends Class("PrdIssue")({
 	isChangedComparedTo(issue) {
 		return this.title !== issue.title || this.description !== issue.description || this.state !== issue.state || !makeEquivalence$1(asEquivalence())(this.blockedBy, issue.blockedBy);
 	}
-	withGithubPrNumber(prNumber) {
-		return new PrdIssue({
-			...this,
-			githubPrNumber: prNumber
-		});
-	}
 };
 
 //#endregion
@@ -127133,11 +128950,11 @@ var UpdateNotificationCategoryChannelSubscriptionMutation = class extends Reques
 	* @param subscribe - required subscribe to pass to updateNotificationCategoryChannelSubscription
 	* @returns parsed response from UpdateNotificationCategoryChannelSubscriptionMutation
 	*/
-	async fetch(category, channel, subscribe) {
+	async fetch(category, channel, subscribe$1) {
 		const data = (await this._request(UpdateNotificationCategoryChannelSubscriptionDocument.toString(), {
 			category,
 			channel,
-			subscribe
+			subscribe: subscribe$1
 		})).notificationCategoryChannelSubscriptionUpdate;
 		return new UserSettingsPayload(this._request, data);
 	}
@@ -134692,8 +136509,8 @@ var LinearSdk = class extends Request$1 {
 	* @param subscribe - required subscribe to pass to updateNotificationCategoryChannelSubscription
 	* @returns UserSettingsPayload
 	*/
-	updateNotificationCategoryChannelSubscription(category, channel, subscribe) {
-		return new UpdateNotificationCategoryChannelSubscriptionMutation(this._request).fetch(category, channel, subscribe);
+	updateNotificationCategoryChannelSubscription(category, channel, subscribe$1) {
+		return new UpdateNotificationCategoryChannelSubscriptionMutation(this._request).fetch(category, channel, subscribe$1);
 	}
 	/**
 	* Marks notification and all related notifications as read.
@@ -135730,7 +137547,7 @@ var TokenManager$1 = class extends Service()("lalph/Linear/TokenManager", { make
 	const tokenStore = toSchemaStore(kvs, AccessToken$1);
 	const httpClient = (yield* HttpClient).pipe(filterStatusOk, retryTransient({ schedule: spaced(1e3) }));
 	let currentToken = yield* orDie$2(tokenStore.get(""));
-	const set$6 = (token) => match$7(token, {
+	const set$7 = (token) => match$7(token, {
 		onNone: () => orDie$2(tokenStore.remove("")).pipe(map$6(() => {
 			currentToken = none$3();
 		})),
@@ -135741,19 +137558,19 @@ var TokenManager$1 = class extends Service()("lalph/Linear/TokenManager", { make
 	const getNoLock = uninterruptibleMask(fnUntraced(function* (restore) {
 		if (isNone(currentToken)) {
 			const newToken = yield* restore(pkce);
-			yield* set$6(some(newToken));
+			yield* set$7(some(newToken));
 			return newToken;
 		} else if (currentToken.value.isExpired()) {
 			const newToken = yield* refresh(currentToken.value);
-			yield* set$6(newToken);
+			yield* set$7(newToken);
 			if (isNone(newToken)) return yield* getNoLock;
 			return newToken.value;
 		}
 		return currentToken.value;
 	}));
-	const get$8 = makeSemaphoreUnsafe(1).withPermit(getNoLock);
+	const get$9 = makeSemaphoreUnsafe(1).withPermit(getNoLock);
 	const pkce = gen(function* () {
-		const deferred = yield* make$48();
+		const deferred = yield* make$49();
 		const CallbackRoute = add("GET", "/callback", gen(function* () {
 			const params$1 = yield* callbackParams;
 			yield* succeed$3(deferred, params$1);
@@ -135794,7 +137611,7 @@ var TokenManager$1 = class extends Service()("lalph/Linear/TokenManager", { make
 		}), httpClient.execute, flatMap(schemaBodyJson(TokenResponse$1)));
 		return AccessToken$1.fromResponse(res);
 	}, option$1);
-	return { get: get$8 };
+	return { get: get$9 };
 }) }) {
 	static layer = effect(this, this.make).pipe(provide$3([layerKvs, layer$9]));
 };
@@ -135828,6 +137645,15 @@ const TokenResponse$1 = Struct({
 //#endregion
 //#region src/IssueSource.ts
 var IssueSource = class extends Service()("lalph/IssueSource") {};
+var IssueSourceUpdates = class extends Service()("lalph/IssueSourceUpdates", { make: gen(function* () {
+	const source = yield* IssueSource;
+	return yield* fromEffectSchedule(source.issues, spaced("1 minute")).pipe(retry$1(spaced("10 seconds")), orDie, share({
+		capacity: 1,
+		strategy: "dropping"
+	}));
+}) }) {
+	static layer = effect(this, this.make);
+};
 var IssueSourceError = class extends ErrorClass("lalph/IssueSourceError")({
 	_tag: tag("IssueSourceError"),
 	cause: Defect
@@ -135914,7 +137740,7 @@ var Linear = class extends Service()("lalph/Linear", { make: gen(function* () {
 			try: () => prev.fetchNext(),
 			catch: (cause) => new LinearError({ cause })
 		}) : use$2(f);
-		return [connection.nodes, some(connection).pipe(filter$5((c) => c.pageInfo.hasNextPage))];
+		return [connection.nodes, some(connection).pipe(filter$6((c) => c.pageInfo.hasNextPage))];
 	}));
 	const projects = stream$3((client) => client.projects({ filter: { status: { type: { nin: ["canceled", "completed"] } } } }));
 	const labels = stream$3((client) => client.issueLabels());
@@ -135995,7 +137821,7 @@ const LinearIssueSource = effect(IssueSource, gen(function* () {
 		projectId: project.id
 	}).pipe(mapError$2((cause) => new IssueSourceError({ cause })), map$6((issues$1) => {
 		const threeDaysAgo = nowUnsafe().pipe(subtract({ days: 3 }));
-		return pipe(filter$3(issues$1, (issue) => {
+		return pipe(filter$4(issues$1, (issue) => {
 			identifierMap.set(issue.identifier, issue.id);
 			const completedAt = issue.completedAt;
 			if (!completedAt) return true;
@@ -136010,8 +137836,7 @@ const LinearIssueSource = effect(IssueSource, gen(function* () {
 				estimate: issue.estimate ?? null,
 				state: linearStateToPrdState(issue.state),
 				blockedBy: blocks.map((r) => r.issue.identifier),
-				autoMerge: autoMergeLabelId.pipe(map$12((labelId$1) => issue.labelIds.includes(labelId$1)), getOrElse(() => false)),
-				githubPrNumber: null
+				autoMerge: autoMergeLabelId.pipe(map$12((labelId$1) => issue.labelIds.includes(labelId$1)), getOrElse(() => false))
 			});
 		}));
 	}));
@@ -138969,11 +140794,11 @@ var require_light = /* @__PURE__ */ __commonJSMin$1(((exports, module) => {
 				return this._onFailure(error$1, eventInfo, clearGlobalState, run$7, free);
 			}
 			async _onFailure(error$1, eventInfo, clearGlobalState, run$7, free) {
-				var retry$3, retryAfter;
+				var retry$5, retryAfter;
 				if (clearGlobalState()) {
-					retry$3 = await this.Events.trigger("failed", error$1, eventInfo);
-					if (retry$3 != null) {
-						retryAfter = ~~retry$3;
+					retry$5 = await this.Events.trigger("failed", error$1, eventInfo);
+					if (retry$5 != null) {
+						retryAfter = ~~retry$5;
 						this.Events.trigger("retry", `Retrying ${this.options.id} after ${retryAfter} ms`, eventInfo);
 						this.retryCount++;
 						return run$7(retryAfter);
@@ -142234,7 +144059,7 @@ var TokenManager = class extends Service()("lalph/Github/TokenManager", { make:
 	const tokenStore = toSchemaStore(kvs, AccessToken);
 	const httpClient = (yield* HttpClient).pipe(filterStatusOk, retryTransient({ schedule: spaced(1e3) }));
 	let currentToken = yield* orDie$2(tokenStore.get(""));
-	const set$6 = (token) => match$7(token, {
+	const set$7 = (token) => match$7(token, {
 		onNone: () => orDie$2(tokenStore.remove("")).pipe(map$6(() => {
 			currentToken = none$3();
 		})),
@@ -142245,12 +144070,12 @@ var TokenManager = class extends Service()("lalph/Github/TokenManager", { make:
 	const getNoLock = gen(function* () {
 		if (isNone(currentToken)) {
 			const newToken = yield* deviceCode;
-			yield* set$6(some(newToken));
+			yield* set$7(some(newToken));
 			return newToken;
 		}
 		return currentToken.value;
 	});
-	const get$8 = makeSemaphoreUnsafe(1).withPermit(getNoLock);
+	const get$9 = makeSemaphoreUnsafe(1).withPermit(getNoLock);
 	const deviceCode = gen(function* () {
 		const code = yield* post("https://github.com/login/device/code").pipe(bodyUrlParams({
 			client_id: clientId,
@@ -142265,7 +144090,7 @@ var TokenManager = class extends Service()("lalph/Github/TokenManager", { make:
 		}), httpClient.execute, flatMap(schemaBodyUrlParams(PollResponse)), delay(seconds(code.interval)), repeat({ until: (res) => "access_token" in res }));
 		return AccessToken.fromResponse(tokenResponse);
 	});
-	return { get: get$8 };
+	return { get: get$9 };
 }) }) {
 	static layer = effect(this, this.make).pipe(provide$3([layerKvs, layer$9]));
 };
@@ -142332,7 +144157,7 @@ var ReviewThreads = class extends Class("github/ReviewThreads")({ edges: Array$1
 //#region src/Github/Cli.ts
 var GithubCli = class extends Service()("lalph/Github/Cli", { make: gen(function* () {
 	const spawner = yield* ChildProcessSpawner;
-	const [owner, repo] = (yield* make$21`gh repo view --json nameWithOwner -q ${".nameWithOwner"}`.pipe(string, option$1, flatMap(flow(map$12(trim), filter$5(isNonEmpty), match$7({
+	const [owner, repo] = (yield* make$21`gh repo view --json nameWithOwner -q ${".nameWithOwner"}`.pipe(string, option$1, flatMap(flow(map$12(trim), filter$6(isNonEmpty), match$7({
 		onNone: () => fail$4(new GithubCliRepoNotFound()),
 		onSome: (value) => succeed$1(value)
 	}))))).split("/");
@@ -142341,7 +144166,7 @@ var GithubCli = class extends Service()("lalph/Github/Cli", { make: gen(function
 			comments: data.data.repository.pullRequest.comments.edges.map((edge) => edge.node),
 			reviewThreads: data.data.repository.pullRequest.reviewThreads.edges.map((edge) => edge.node)
 		};
-	}), provideService(ChildProcessSpawner, spawner));
+	}), provideService$1(ChildProcessSpawner, spawner));
 	const prFeedbackMd = (pr) => reviewComments(pr).pipe(map$6(({ comments, reviewThreads }) => {
 		const eligibleReviewThreads = reviewThreads.filter((thread) => thread.shouldDisplayThread);
 		if (comments.length === 0 && eligibleReviewThreads.length === 0) return `No review comments found.`;
@@ -142505,8 +144330,7 @@ const GithubIssueSource = effect(IssueSource, gen(function* () {
 			estimate: null,
 			state,
 			blockedBy: dependencies.map((dep) => `#${dep.number}`),
-			autoMerge: autoMergeLabelName.pipe(map$12((labelName) => hasLabel(issue.labels, labelName)), getOrElse(() => false)),
-			githubPrNumber: null
+			autoMerge: autoMergeLabelName.pipe(map$12((labelName) => hasLabel(issue.labels, labelName)), getOrElse(() => false))
 		});
 	}), { concurrency: 10 }), runCollect, mapError$2((cause) => new IssueSourceError({ cause })));
 	const createIssue = github.wrap((rest) => rest.issues.create);
@@ -142627,7 +144451,7 @@ const GithubIssueSource = effect(IssueSource, gen(function* () {
 const labelFilter = new Setting("github.labelFilter", Option(String$1));
 const labelSelect = gen(function* () {
 	const label = yield* text$2({ message: "What label do you want to filter issues by? (leave empty for none)" });
-	const labelOption = some(label.trim()).pipe(filter$5(isNonEmpty));
+	const labelOption = some(label.trim()).pipe(filter$6(isNonEmpty));
 	yield* labelFilter.set(some(labelOption));
 	return labelOption;
 });
@@ -142639,7 +144463,7 @@ const getOrSelectLabel = gen(function* () {
 const autoMergeLabel = new Setting("github.autoMergeLabel", Option(String$1));
 const autoMergeLabelSelect = gen(function* () {
 	const label = yield* text$2({ message: "What label do you want to use for auto-mergable issues? (leave empty for none)" });
-	const labelOption = some(label.trim()).pipe(filter$5(isNonEmpty));
+	const labelOption = some(label.trim()).pipe(filter$6(isNonEmpty));
 	yield* autoMergeLabel.set(some(labelOption));
 	return labelOption;
 });
@@ -142649,7 +144473,7 @@ const getOrSelectAutoMergeLabel = gen(function* () {
 	return yield* autoMergeLabelSelect;
 });
 const resetGithub = labelFilter.set(none$3()).pipe(andThen(autoMergeLabel.set(none$3())));
-const maybeNextPage = (page, linkHeader) => pipe(fromNullishOr$2(linkHeader), filter$5((_) => _.includes(`rel="next"`)), as$2(page + 1));
+const maybeNextPage = (page, linkHeader) => pipe(fromNullishOr$2(linkHeader), filter$6((_) => _.includes(`rel="next"`)), as$2(page + 1));
 
 //#endregion
 //#region src/IssueSources.ts
@@ -142690,7 +144514,7 @@ const resetCurrentIssueSource = gen(function* () {
 var CurrentIssueSource = class CurrentIssueSource extends Service()("lalph/CurrentIssueSource") {
 	static layer = effectServices(gen(function* () {
 		const source = yield* getOrSelectIssueSource;
-		const services$2 = yield* buildWithMemoMap(source.layer, yield* CurrentMemoMap, yield* scope).pipe(withSpan("CurrentIssueSource.build"));
+		const services$2 = yield* buildWithMemoMap(IssueSourceUpdates.layer.pipe(provideMerge(source.layer)), yield* CurrentMemoMap, yield* scope).pipe(withSpan("CurrentIssueSource.build"));
 		return add$3(services$2, CurrentIssueSource, source);
 	}));
 };
@@ -142909,31 +144733,85 @@ ${prdNotes(options)}`;
 	static layer = effect(this, this.make);
 };
 
+//#endregion
+//#region src/Worktree.ts
+var Worktree = class extends Service()("lalph/Worktree", { make: gen(function* () {
+	const fs = yield* FileSystem;
+	const pathService = yield* Path$1;
+	const inExisting = yield* fs.exists(pathService.join(".lalph", "prd.yml"));
+	if (inExisting) return {
+		directory: pathService.resolve("."),
+		inExisting
+	};
+	const directory$2 = yield* fs.makeTempDirectory();
+	yield* addFinalizer(fnUntraced(function* () {
+		yield* execIgnore(make$21`git worktree remove --force ${directory$2}`);
+	}));
+	yield* make$21`git worktree add ${directory$2} -d HEAD`.pipe(exitCode);
+	yield* fs.makeDirectory(pathService.join(directory$2, ".lalph"), { recursive: true });
+	const setupPath = pathService.resolve("scripts", "worktree-setup.sh");
+	yield* seedSetupScript(setupPath);
+	if (yield* fs.exists(setupPath)) yield* make$21({
+		cwd: directory$2,
+		extendEnv: true,
+		shell: process.env.SHELL ?? true
+	})`${setupPath}`.pipe(exitCode);
+	return {
+		directory: directory$2,
+		inExisting
+	};
+}) }) {
+	static layer = effect(this, this.make);
+	static layerLocal = effect(this, gen(function* () {
+		const pathService = yield* Path$1;
+		const fs = yield* FileSystem;
+		return {
+			directory: pathService.resolve("."),
+			inExisting: yield* fs.exists(pathService.join(".lalph", "prd.yml"))
+		};
+	}));
+};
+const execIgnore = (command) => command.pipe(exitCode, catchCause$1(logWarning));
+const seedSetupScript = fnUntraced(function* (setupPath) {
+	const fs = yield* FileSystem;
+	const pathService = yield* Path$1;
+	if (yield* fs.exists(setupPath)) return;
+	const baseBranch = yield* discoverBaseBranch;
+	yield* fs.makeDirectory(pathService.dirname(setupPath), { recursive: true });
+	yield* fs.writeFileString(setupPath, setupScriptTemplate(baseBranch));
+	yield* fs.chmod(setupPath, 493);
+});
+const discoverBaseBranch = gen(function* () {
+	const originHead = yield* make$21`git symbolic-ref --short refs/remotes/origin/HEAD`.pipe(string, catch_$1((_) => succeed$1("")), map$6((output) => output.trim()));
+	if (originHead !== "") return originHead.startsWith("origin/") ? originHead.slice(7) : originHead;
+	const currentBranch = yield* make$21`git branch --show-current`.pipe(string, catch_$1((_) => succeed$1("")), map$6((output) => output.trim()));
+	return currentBranch === "" ? "main" : currentBranch;
+});
+const setupScriptTemplate = (baseBranch) => `#!/usr/bin/env bash
+set -euo pipefail
+
+git fetch origin
+git checkout origin/${baseBranch}
+
+# Seeded by lalph. Customize this to prepare new worktrees.
+`;
+
 //#endregion
 //#region src/Prd.ts
 var Prd = class extends Service()("lalph/Prd", { make: gen(function* () {
+	const worktree = yield* Worktree;
 	const pathService = yield* Path$1;
 	const fs = yield* FileSystem;
 	const source = yield* IssueSource;
-	const tempDir = yield* fs.makeTempDirectoryScoped();
-	const prdFile = pathService.join(tempDir, `prd.yml`);
+	const sourceUpdates = yield* IssueSourceUpdates;
+	let chosenIssueId = null;
+	const lalphDir = pathService.join(worktree.directory, `.lalph`);
+	const prdFile = pathService.join(worktree.directory, `.lalph`, `prd.yml`);
 	const readPrd = gen(function* () {
 		const yaml = yield* fs.readFileString(prdFile);
 		return PrdIssue.arrayFromYaml(yaml);
 	});
 	const syncSemaphore = makeSemaphoreUnsafe(1);
-	const mergableGithubPrs = gen(function* () {
-		const updated = yield* readPrd;
-		const prs = empty$12();
-		for (const issue of updated) {
-			if (!updatedIssues.get(issue.id ?? "") || !issue.githubPrNumber || issue.state !== "in-review") continue;
-			prs.push({
-				issueId: issue.id,
-				prNumber: issue.githubPrNumber
-			});
-		}
-		return prs;
-	});
 	const maybeRevertIssue = fnUntraced(function* (options) {
 		const issue = (yield* readPrd).find((i) => i.id === options.issueId);
 		if (!issue || issue.state === "in-review") return;
@@ -142953,13 +144831,39 @@ var Prd = class extends Service()("lalph/Prd", { make: gen(function* () {
 			state: "todo"
 		});
 	});
+	if (worktree.inExisting) {
+		const initialPrdIssues = yield* readPrd;
+		return {
+			path: prdFile,
+			maybeRevertIssue,
+			revertUpdatedIssues: gen(function* () {
+				const updated = yield* readPrd;
+				for (const issue of updated) {
+					if (issue.state !== "in-progress") continue;
+					const prevIssue = initialPrdIssues.find((i) => i.id === issue.id);
+					if (!prevIssue || prevIssue.state === "in-progress") continue;
+					yield* source.updateIssue({
+						issueId: issue.id,
+						state: prevIssue.state
+					});
+				}
+			}),
+			flagUnmergable,
+			findById: fnUntraced(function* (issueId) {
+				return (yield* readPrd).find((i) => i.id === issueId) ?? null;
+			}),
+			setChosenIssueId: (issueId) => sync(() => {
+				chosenIssueId = issueId;
+			})
+		};
+	}
+	yield* addFinalizer(() => ignore(fs.remove(prdFile)));
 	let current = yield* source.issues;
 	yield* fs.writeFileString(prdFile, PrdIssue.arrayToYaml(current));
 	const updatedIssues = /* @__PURE__ */ new Map();
 	const sync$2 = gen(function* () {
 		const updated = yield* readPrd;
 		if (!(updated.length !== current.length || updated.some((u, i) => u.isChangedComparedTo(current[i])))) return;
-		const githubPrs = /* @__PURE__ */ new Map();
 		const toRemove = new Set(current.filter((i) => i.id !== null).map((i) => i.id));
 		for (const issue of updated) {
 			toRemove.delete(issue.id);
@@ -142967,9 +144871,9 @@ var Prd = class extends Service()("lalph/Prd", { make: gen(function* () {
 				yield* source.createIssue(issue);
 				continue;
 			}
-			if (issue.githubPrNumber) githubPrs.set(issue.id, issue.githubPrNumber);
 			const existing = current.find((i) => i.id === issue.id);
 			if (!existing || !existing.isChangedComparedTo(issue)) continue;
+			if (chosenIssueId && existing.id !== chosenIssueId) continue;
 			yield* source.updateIssue({
 				issueId: issue.id,
 				title: issue.title,
@@ -142981,36 +144885,27 @@ var Prd = class extends Service()("lalph/Prd", { make: gen(function* () {
 		}
 		yield* forEach$1(toRemove, (issueId) => source.cancelIssue(issueId), { concurrency: "unbounded" });
 		current = yield* source.issues;
-		yield* fs.writeFileString(prdFile, PrdIssue.arrayToYaml(current.map((issue) => {
-			const prNumber = githubPrs.get(issue.id);
-			if (!prNumber) return issue;
-			return new PrdIssue({
-				...issue,
-				githubPrNumber: prNumber
-			});
-		})));
+		yield* fs.writeFileString(prdFile, PrdIssue.arrayToYaml(current));
 	}).pipe(uninterruptible, syncSemaphore.withPermit, withSpan("Prd.sync"), catchTag("IssueSourceError", (e) => logWarning(fail$5(e))), annotateLogs({
 		module: "Prd",
 		method: "sync"
 	}));
 	const updateSyncHandle = yield* make$26();
-	const updateSync = gen(function* () {
+	const updateSync = fnUntraced(function* (sourceIssues) {
 		const tempFile = yield* fs.makeTempFileScoped();
-		const sourceIssues = yield* source.issues;
 		if (!(sourceIssues.length !== current.length || sourceIssues.some((u, i) => u.isChangedComparedTo(current[i])))) return;
 		yield* fs.writeFileString(tempFile, PrdIssue.arrayToYaml(sourceIssues));
 		yield* fs.rename(tempFile, prdFile);
 		current = sourceIssues;
-	}).pipe(scoped$1, run$2(updateSyncHandle, { onlyIfMissing: true }));
-	yield* fs.watch(tempDir).pipe(buffer({
+	}, scoped$1, run$2(updateSyncHandle, { onlyIfMissing: true }));
+	yield* fs.watch(lalphDir).pipe(buffer({
 		capacity: 1,
 		strategy: "dropping"
-	}), runForEach((_) => clear(updateSyncHandle).pipe(andThen(ignore(sync$2)))), retry$1(forever$1), forkScoped);
-	yield* updateSync.pipe(delay("1 minute"), forever, forkScoped);
+	}), runForEach((_) => clear(updateSyncHandle).pipe(andThen(ignore(sync$2)))), retry$3(forever$1), forkScoped);
+	yield* sourceUpdates.pipe(runForEach(updateSync), forkScoped);
 	const findById = (issueId) => sync(() => current.find((i) => i.id === issueId) ?? null);
 	return {
 		path: prdFile,
-		mergableGithubPrs,
 		maybeRevertIssue,
 		revertUpdatedIssues: syncSemaphore.withPermit(gen(function* () {
 			for (const issue of updatedIssues.values()) {
@@ -143022,77 +144917,16 @@ var Prd = class extends Service()("lalph/Prd", { make: gen(function* () {
 			}
 		})),
 		flagUnmergable,
-		findById
+		findById,
+		setChosenIssueId: (issueId) => sync(() => {
+			chosenIssueId = issueId;
+		})
 	};
 }).pipe(withSpan("Prd.build")) }) {
-	static layer = effect(this, this.make);
-};
-
-//#endregion
-//#region src/Worktree.ts
-var Worktree = class extends Service()("lalph/Worktree", { make: gen(function* () {
-	const fs = yield* FileSystem;
-	const pathService = yield* Path$1;
-	const prd = yield* Prd;
-	const inExisting = yield* fs.exists(pathService.join(".lalph", "worktree"));
-	if (inExisting) return {
-		directory: pathService.resolve("."),
-		inExisting
-	};
-	const directory$2 = yield* fs.makeTempDirectory();
-	yield* addFinalizer(fnUntraced(function* () {
-		yield* execIgnore(make$21`git worktree remove --force ${directory$2}`);
-	}));
-	yield* make$21`git worktree add ${directory$2} -d HEAD`.pipe(exitCode);
-	yield* fs.makeDirectory(pathService.join(directory$2, ".lalph"), { recursive: true });
-	yield* scoped$1(fs.open(pathService.join(directory$2, ".lalph", "worktree"), { flag: "a+" }));
-	yield* fs.symlink(prd.path, pathService.join(directory$2, ".lalph", "prd.yml"));
-	const setupPath = pathService.resolve("scripts", "worktree-setup.sh");
-	yield* seedSetupScript(setupPath);
-	if (yield* fs.exists(setupPath)) yield* make$21({
-		cwd: directory$2,
-		extendEnv: true,
-		shell: process.env.SHELL ?? true
-	})`${setupPath}`.pipe(exitCode);
-	return {
-		directory: directory$2,
-		inExisting
-	};
-}) }) {
-	static layer = effect(this, this.make);
-	static layerLocal = effect(this, gen(function* () {
-		const pathService = yield* Path$1;
-		const fs = yield* FileSystem;
-		return {
-			directory: pathService.resolve("."),
-			inExisting: yield* fs.exists(pathService.join(".lalph", "prd.yml"))
-		};
-	}));
+	static layerNoWorktree = effect(this, this.make);
+	static layer = this.layerNoWorktree.pipe(provideMerge(Worktree.layer));
+	static layerLocal = this.layerNoWorktree.pipe(provideMerge(Worktree.layerLocal));
 };
-const execIgnore = (command) => command.pipe(exitCode, catchCause$1(logWarning));
-const seedSetupScript = fnUntraced(function* (setupPath) {
-	const fs = yield* FileSystem;
-	const pathService = yield* Path$1;
-	if (yield* fs.exists(setupPath)) return;
-	const baseBranch = yield* discoverBaseBranch;
-	yield* fs.makeDirectory(pathService.dirname(setupPath), { recursive: true });
-	yield* fs.writeFileString(setupPath, setupScriptTemplate(baseBranch));
-	yield* fs.chmod(setupPath, 493);
-});
-const discoverBaseBranch = gen(function* () {
-	const originHead = yield* make$21`git symbolic-ref --short refs/remotes/origin/HEAD`.pipe(string, catch_$1((_) => succeed$1("")), map$6((output) => output.trim()));
-	if (originHead !== "") return originHead.startsWith("origin/") ? originHead.slice(7) : originHead;
-	const currentBranch = yield* make$21`git branch --show-current`.pipe(string, catch_$1((_) => succeed$1("")), map$6((output) => output.trim()));
-	return currentBranch === "" ? "main" : currentBranch;
-});
-const setupScriptTemplate = (baseBranch) => `#!/usr/bin/env bash
-set -euo pipefail
-
-git fetch origin
-git checkout origin/${baseBranch}
-
-# Seeded by lalph. Customize this to prepare new worktrees.
-`;
 
 //#endregion
 //#region src/shared/child-process.ts
@@ -143126,7 +144960,7 @@ const parseCommandPrefix = (value) => {
 	const parts$1 = parseCommand(value);
 	return isReadonlyArrayNonEmpty(parts$1) ? prefix(parts$1[0], parts$1.slice(1)) : identity;
 };
-const normalizePrefix = (value) => some(value.trim()).pipe(filter$5(isNonEmpty));
+const normalizePrefix = (value) => some(value.trim()).pipe(filter$6(isNonEmpty));
 const promptForCommandPrefix = gen(function* () {
 	const prefixOption = normalizePrefix(yield* text$2({ message: "Command prefix for agent commands? (leave empty for none)" }));
 	yield* commandPrefixSetting.set(some(prefixOption));
@@ -143181,6 +145015,7 @@ const commandRoot = make$28("lalph", {
 	specsDirectory,
 	verbose
 }).pipe(withHandler(fnUntraced(function* ({ iterations: iterations$1, concurrency: concurrency$1, targetBranch: targetBranch$1, maxIterationMinutes: maxIterationMinutes$1, stallMinutes: stallMinutes$1, specsDirectory: specsDirectory$1 }) {
+	const source = yield* build(CurrentIssueSource.layer);
 	const commandPrefix = yield* getCommandPrefix;
 	yield* getOrSelectCliAgent;
 	const isFinite$3 = Number.isFinite(iterations$1);
@@ -143188,7 +145023,7 @@ const commandRoot = make$28("lalph", {
 	const runConcurrency = Math.max(1, concurrency$1);
 	const semaphore = makeSemaphoreUnsafe(runConcurrency);
 	const fibers = yield* make$25();
-	yield* resetInProgress.pipe(withSpan("Main.resetInProgress"));
+	yield* resetInProgress.pipe(provide$1(source), withSpan("Main.resetInProgress"));
 	yield* log$1(`Executing ${iterationsDisplay} iteration(s) with concurrency ${runConcurrency}`);
 	if (isSome(targetBranch$1)) yield* log$1(`Using target branch: ${targetBranch$1.value}`);
 	let iteration = 0;
@@ -143197,7 +145032,7 @@ const commandRoot = make$28("lalph", {
 		yield* semaphore.take(1);
 		if (quit || isFinite$3 && iteration >= iterations$1) break;
 		const currentIteration = iteration;
-		const startedDeferred = yield* make$48();
+		const startedDeferred = yield* make$49();
 		yield* checkForWork.pipe(andThen(run({
 			startedDeferred,
 			targetBranch: targetBranch$1,
@@ -143218,12 +145053,12 @@ const commandRoot = make$28("lalph", {
 				quit = true;
 				return void_$1;
 			}
-		}), annotateLogs({ iteration: currentIteration }), ensuring(semaphore.release(1)), ensuring(completeWith(startedDeferred, void_$1)), run$1(fibers));
+		}), annotateLogs({ iteration: currentIteration }), ensuring(semaphore.release(1)), ensuring(completeWith(startedDeferred, void_$1)), provide$1(source), run$1(fibers));
 		yield* _await(startedDeferred);
 		iteration++;
 	}
 	yield* awaitEmpty(fibers);
-}, scoped$1, provide$1(Prd.layer.pipe(provideMerge(CurrentIssueSource.layer))))));
+}, scoped$1)));
 const run = fnUntraced(function* (options) {
 	const fs = yield* FileSystem;
 	const pathService = yield* Path$1;
@@ -143234,6 +145069,8 @@ const run = fnUntraced(function* (options) {
 	const prd = yield* Prd;
 	const source = yield* IssueSource;
 	const exec = (template, ...args$1) => make$21({ cwd: worktree.directory })(template, ...args$1).pipe(exitCode);
+	const execString = (template, ...args$1) => make$21({ cwd: worktree.directory })(template, ...args$1).pipe(string);
+	const viewPrState = (prNumber) => execString`gh pr view ${prNumber ? prNumber : ""} --json number,state`.pipe(flatMap(decodeEffect(PrState)), option$1);
 	const execWithStallTimeout = fnUntraced(function* (command) {
 		let lastOutputAt = yield* now;
 		const stallTimeout = suspend$3(function loop() {
@@ -143251,7 +145088,7 @@ const run = fnUntraced(function* (options) {
 		}), raceFirst(stallTimeout));
 		return yield* handle.exitCode;
 	}, scoped$1);
-	const currentBranch = (dir) => make$21({ cwd: dir })`git branch --show-current`.pipe(string, flatMap((output) => some(output.trim()).pipe(filter$5((b) => b.length > 0), fromOption)));
+	const currentBranch = (dir) => make$21({ cwd: dir })`git branch --show-current`.pipe(string, flatMap((output) => some(output.trim()).pipe(filter$6((b) => b.length > 0), fromOption)));
 	if (isSome(options.targetBranch)) yield* exec`git checkout ${`origin/${options.targetBranch.value}`}`;
 	yield* gen(function* () {
 		let taskId = void 0;
@@ -143269,12 +145106,16 @@ const run = fnUntraced(function* (options) {
 			onTimeout: () => fail$4(new RunnerStalled())
 		}));
 		const taskJson = yield* fs.readFileString(pathService.join(worktree.directory, ".lalph", "task.json"));
-		const chosenTask = yield* decodeEffect(ChosenTask)(taskJson).pipe(mapError$2(() => new ChosenTaskNotFound()), flatMap(fnUntraced(function* (task$1) {
-			const prdTask = yield* prd.findById(task$1.id);
-			if (prdTask?.state === "in-progress") return task$1.githubPrNumber ? prdTask.withGithubPrNumber(task$1.githubPrNumber) : prdTask;
+		const chosenTask = yield* decodeEffect(ChosenTask)(taskJson).pipe(mapError$2(() => new ChosenTaskNotFound()), flatMap(fnUntraced(function* (task) {
+			const prdTask = yield* prd.findById(task.id);
+			if (prdTask?.state === "in-progress") return {
+				...task,
+				prd: prdTask
+			};
 			return yield* new ChosenTaskNotFound();
 		})));
 		taskId = chosenTask.id;
+		yield* prd.setChosenIssueId(taskId);
 		yield* source.ensureInProgress(taskId).pipe(timeoutOrElse({
 			duration: "1 minute",
 			onTimeout: () => fail$4(new RunnerStalled())
@@ -143288,7 +145129,7 @@ const run = fnUntraced(function* (options) {
 		yield* pipe(cliAgent.command({
 			outputMode: "pipe",
 			prompt: promptGen.promptInstructions({
-				task: chosenTask,
+				task: chosenTask.prd,
 				targetBranch: getOrUndefined(options.targetBranch),
 				specsDirectory: options.specsDirectory,
 				githubPrNumber: chosenTask.githubPrNumber ?? void 0
@@ -143315,20 +145156,28 @@ const run = fnUntraced(function* (options) {
 			return yield* error$1;
 		})));
 		yield* log$1(`Agent exited with code: ${exitCode$1}`);
-		const prs = yield* prd.mergableGithubPrs;
-		const task = yield* prd.findById(taskId);
-		if (prs.length === 0) yield* prd.maybeRevertIssue({ issueId: taskId });
-		else if (task?.autoMerge) for (const pr of prs) {
-			if (isSome(options.targetBranch)) yield* exec`gh pr edit ${pr.prNumber} --base ${options.targetBranch.value}`;
-			if ((yield* exec`gh pr merge ${pr.prNumber} -sd`) !== 0) yield* prd.flagUnmergable({ issueId: pr.issueId });
-		}
+		const autoMerge = gen(function* () {
+			let prState = yield* viewPrState();
+			yield* log$1("PR state", prState);
+			if (isNone(prState)) return;
+			if (isSome(options.targetBranch)) yield* exec`gh pr edit --base ${options.targetBranch.value}`;
+			yield* exec`gh pr merge -sd`;
+			yield* sleep(seconds(3));
+			prState = yield* viewPrState(prState.value.number);
+			yield* log$1("PR state after merge", prState);
+			if (isSome(prState) && prState.value.state === "MERGED") return;
+			yield* log$1("Flagging unmergable PR");
+			yield* prd.flagUnmergable({ issueId: taskId });
+		}).pipe(annotateLogs({ phase: "autoMerge" }));
+		if ((yield* prd.findById(taskId))?.autoMerge) yield* autoMerge;
+		else yield* prd.maybeRevertIssue({ issueId: taskId });
 	}).pipe(ensuring(gen(function* () {
 		const currentBranchName = yield* currentBranch(worktree.directory).pipe(option$1, map$6(getOrUndefined));
 		if (!currentBranchName) return;
 		yield* exec`git checkout --detach ${currentBranchName}`;
 		yield* exec`git branch -D ${currentBranchName}`;
 	}).pipe(ignore)));
-}, scoped$1, provide$1([PromptGen.layer, Worktree.layer]));
+}, scoped$1, provide$1([PromptGen.layer, Prd.layer]));
 var RunnerStalled = class extends TaggedError("RunnerStalled") {
 	message = "The runner has stalled due to inactivity.";
 };
@@ -143339,6 +145188,10 @@ const ChosenTask = fromJsonString(Struct({
 	id: String$1,
 	githubPrNumber: NullOr(Finite)
 }));
+const PrState = fromJsonString(Struct({
+	number: Finite,
+	state: String$1
+}));
 
 //#endregion
 //#region src/commands/plan.ts
@@ -143350,7 +145203,7 @@ const commandPlan = make$28("plan", { dangerous }).pipe(withDescription("Iterate
 		targetBranch: targetBranch$1,
 		commandPrefix: yield* getCommandPrefix,
 		dangerous: dangerous$1
-	}).pipe(provide$1(Prd.layer.pipe(provideMerge(CurrentIssueSource.layer))));
+	}).pipe(provide$1(CurrentIssueSource.layer));
 })));
 const plan = fnUntraced(function* (options) {
 	const fs = yield* FileSystem;
@@ -143370,7 +145223,11 @@ const plan = fnUntraced(function* (options) {
 	}), setCwd(worktree.directory), options.commandPrefix, exitCode);
 	yield* log$1(`Agent exited with code: ${exitCode$1}`);
 	if (!worktree.inExisting) yield* pipe(fs.copy(pathService.join(worktree.directory, options.specsDirectory), options.specsDirectory, { overwrite: true }), ignore);
-}, scoped$1, provide$1([PromptGen.layer, Worktree.layer]));
+}, scoped$1, provide$1([
+	PromptGen.layer,
+	Prd.layer,
+	Worktree.layer
+]));
 
 //#endregion
 //#region src/shared/config.ts
@@ -143426,8 +145283,7 @@ const commandIssue = make$28("issue").pipe(withDescription("Create a new issue i
 		id: null,
 		...frontMatter,
 		description,
-		state: "todo",
-		githubPrNumber: null
+		state: "todo"
 	}));
 	console.log(`Created issue with ID: ${created.id}`);
 	console.log(`URL: ${created.url}`);
@@ -143444,7 +145300,7 @@ const commandEdit = make$28("edit").pipe(withDescription("Open the prd.yml file
 		stdout: "inherit",
 		stderr: "inherit"
 	}).pipe(exitCode);
-}, scoped$1, provide$1(Prd.layer.pipe(provide$3(CurrentIssueSource.layer))))));
+}, scoped$1, provide$1(Prd.layerLocal.pipe(provide$3(CurrentIssueSource.layer))))));
 
 //#endregion
 //#region src/commands/shell.ts
@@ -143459,7 +145315,7 @@ const commandShell = make$28("shell").pipe(withDescription("Enter an interactive
 		stdout: "inherit",
 		stderr: "inherit"
 	}).pipe(exitCode);
-}, scoped$1, provide$1(Worktree.layer.pipe(provide$3(Prd.layer), provide$3(CurrentIssueSource.layer))))));
+}, scoped$1, provide$1(Prd.layer.pipe(provide$3(CurrentIssueSource.layer))))));
 
 //#endregion
 //#region src/commands/source.ts
@@ -143467,7 +145323,7 @@ const commandSource = make$28("source").pipe(withDescription("Select the issue s
 
 //#endregion
 //#region package.json
-var version = "0.1.87";
+var version = "0.1.91";
 
 //#endregion
 //#region src/Tracing.ts
@@ -143492,7 +145348,7 @@ const TracerLogger = gen(function* () {
 			logger$1.log(options);
 		});
 	};
-	return make$49({ span(name, parent, annotations$1, links, startTime, kind, options) {
+	return make$50({ span(name, parent, annotations$1, links, startTime, kind, options) {
 		const span = tracer$3.span(name, parent, annotations$1, links, startTime, kind, options);
 		log$2(`${name}: started`, startTime);
 		const oldEnd = span.end;