igniteui-webcomponents-grids 5.0.3-beta.0 → 5.1.0

package/grids/combined.js

@@ -1682,7 +1682,7 @@ function Cm(n38) {
 function A4(n38) {
   at2(n38) ? n38() : n38.unsubscribe();
 }
-var Lo = { onUnhandledError: null, onStoppedNotification: null, Promise: void 0, useDeprecatedSynchronousErrorHandling: false, useDeprecatedNextContext: false };
+var No = { onUnhandledError: null, onStoppedNotification: null, Promise: void 0, useDeprecatedSynchronousErrorHandling: false, useDeprecatedNextContext: false };
 var wd = { setTimeout(n38, t, ...o) {
   let { delegate: e } = wd;
   return e?.setTimeout ? e.setTimeout(n38, t, ...o) : setTimeout(n38, t, ...o);
@@ -1692,7 +1692,7 @@ var wd = { setTimeout(n38, t, ...o) {
 }, delegate: void 0 };
 function Im(n38) {
   wd.setTimeout(() => {
-    let { onUnhandledError: t } = Lo;
+    let { onUnhandledError: t } = No;
     if (t) t(n38);
     else throw n38;
   });
@@ -1711,7 +1711,7 @@ function Vx(n38, t, o) {
 }
 var xc = null;
 function Cd(n38) {
-  if (Lo.useDeprecatedSynchronousErrorHandling) {
+  if (No.useDeprecatedSynchronousErrorHandling) {
     let t = !xc;
     if (t && (xc = { errorThrown: false, error: null }), n38(), t) {
       let { errorThrown: o, error: e } = xc;
@@ -1720,7 +1720,7 @@ function Cd(n38) {
   } else n38();
 }
 function F4(n38) {
-  Lo.useDeprecatedSynchronousErrorHandling && xc && (xc.errorThrown = true, xc.error = n38);
+  No.useDeprecatedSynchronousErrorHandling && xc && (xc.errorThrown = true, xc.error = n38);
 }
 var yc = class extends Yi {
   constructor(t) {
@@ -1800,19 +1800,19 @@ var sa = class extends yc {
     if (at2(t) || !t) i = { next: t ?? void 0, error: o ?? void 0, complete: e ?? void 0 };
     else {
       let r;
-      this && Lo.useDeprecatedNextContext ? (r = Object.create(t), r.unsubscribe = () => this.unsubscribe(), i = { next: t.next && Ox(t.next, r), error: t.error && Ox(t.error, r), complete: t.complete && Ox(t.complete, r) }) : i = t;
+      this && No.useDeprecatedNextContext ? (r = Object.create(t), r.unsubscribe = () => this.unsubscribe(), i = { next: t.next && Ox(t.next, r), error: t.error && Ox(t.error, r), complete: t.complete && Ox(t.complete, r) }) : i = t;
     }
     this.destination = new Lx(i);
   }
 };
 function Sm(n38) {
-  Lo.useDeprecatedSynchronousErrorHandling ? F4(n38) : Im(n38);
+  No.useDeprecatedSynchronousErrorHandling ? F4(n38) : Im(n38);
 }
 function xN(n38) {
   throw n38;
 }
 function Nx(n38, t) {
-  let { onStoppedNotification: o } = Lo;
+  let { onStoppedNotification: o } = No;
   o && wd.setTimeout(() => o(n38, t));
 }
 var yN = { closed: true, next: At2, error: xN, complete: At2 };
@@ -1884,7 +1884,7 @@ var di = (() => {
 })();
 function V4(n38) {
   var t;
-  return (t = n38 ?? Lo.Promise) !== null && t !== void 0 ? t : Promise;
+  return (t = n38 ?? No.Promise) !== null && t !== void 0 ? t : Promise;
 }
 function wN(n38) {
   return n38 && at2(n38.next) && at2(n38.error) && at2(n38.complete);
@@ -2746,7 +2746,7 @@ function nS(n38) {
     }));
   });
 }
-function Ho(n38) {
+function Lo(n38) {
   return n38 <= 0 ? () => Rm : Mt2((t, o) => {
     let e = 0;
     t.subscribe(St2(o, (i) => {
@@ -2767,7 +2767,7 @@ function WN() {
 }
 function Xe(n38, t) {
   let o = arguments.length >= 2;
-  return (e) => e.pipe(n38 ? Xt((i, r) => n38(i, r, e)) : ms, Ho(1), o ? nS(t) : rS(() => new jm()));
+  return (e) => e.pipe(n38 ? Xt((i, r) => n38(i, r, e)) : ms, Lo(1), o ? nS(t) : rS(() => new jm()));
 }
 function qx(...n38) {
   let t = n38.length;
@@ -2905,7 +2905,7 @@ function da(n38, t) {
     }));
   });
 }
-function Bo(n38, t = la, o) {
+function Ho(n38, t = la, o) {
   let e = Ic(n38, t);
   return da(() => e, o);
 }
@@ -2984,7 +2984,7 @@ function XS(n38) {
 function he2(n38) {
   return { token: n38.token, providedIn: n38.providedIn || null, factory: n38.factory, value: void 0 };
 }
-function Uo(n38) {
+function $o(n38) {
   return { providers: n38.providers || [], imports: n38.imports || [] };
 }
 function hy(n38) {
@@ -3314,40 +3314,40 @@ function IL(n38, t, o) {
   for (let a = 0; a < t.length; a++) {
     let l = t[a];
     if (typeof l == "number") {
-      if (!s && !zo(e) && !zo(l)) return false;
-      if (s && zo(l)) continue;
+      if (!s && !Bo(e) && !Bo(l)) return false;
+      if (s && Bo(l)) continue;
       s = false, e = l | e & 1;
       continue;
     }
     if (!s) if (e & 4) {
       if (e = 2 | e & 1, l !== "" && !CL(n38, l, o) || l === "" && t.length === 1) {
-        if (zo(e)) return false;
+        if (Bo(e)) return false;
         s = true;
       }
     } else if (e & 8) {
       if (i === null || !wL(n38, i, l, o)) {
-        if (zo(e)) return false;
+        if (Bo(e)) return false;
         s = true;
       }
     } else {
       let c = t[++a], d = SL(l, i, fy(n38), o);
       if (d === -1) {
-        if (zo(e)) return false;
+        if (Bo(e)) return false;
         s = true;
         continue;
       }
       if (c !== "") {
         let g;
         if (d > r ? g = "" : g = i[d + 1].toLowerCase(), e & 2 && c !== g) {
-          if (zo(e)) return false;
+          if (Bo(e)) return false;
           s = true;
         }
       }
     }
   }
-  return zo(e) || s;
+  return Bo(e) || s;
 }
-function zo(n38) {
+function Bo(n38) {
   return (n38 & 1) === 0;
 }
 function SL(n38, t, o, e) {
@@ -3425,7 +3425,7 @@ function RL(n38) {
       let a = n38[++o];
       i += "[" + s + (a.length > 0 ? '="' + a + '"' : "") + "]";
     } else e & 8 ? i += "." + s : e & 4 && (i += " " + s);
-    else i !== "" && !zo(s) && (t += pS(r, i), i = ""), e = s, r = r || !zo(e);
+    else i !== "" && !Bo(s) && (t += pS(r, i), i = ""), e = s, r = r || !Bo(e);
     o++;
   }
   return i !== "" && (t += pS(r, i)), t;
@@ -3439,7 +3439,7 @@ function PL(n38) {
     let r = n38[e];
     if (typeof r == "string") i === 2 ? r !== "" && t.push(r, n38[++e]) : i === 8 && o.push(r);
     else {
-      if (!zo(i)) break;
+      if (!Bo(i)) break;
       i = r;
     }
     e++;
@@ -3460,7 +3460,7 @@ function ML(n38) {
 function kL(n38) {
   return n38 !== null;
 }
-function Wo(n38) {
+function Uo(n38) {
   return lh(() => ({ type: n38.type, bootstrap: n38.bootstrap || Er, declarations: n38.declarations || Er, imports: n38.imports || Er, exports: n38.exports || Er, transitiveCompileScopes: null, schemas: n38.schemas || null, id: n38.id || null }));
 }
 function hS(n38, t) {
@@ -3771,7 +3771,7 @@ var ma = 0;
 var mt2 = 1;
 var lt2 = 2;
 var Yn = 3;
-var jo = 4;
+var Go = 4;
 var Ar = 5;
 var oh = 6;
 var hf = 7;
@@ -4739,10 +4739,10 @@ function sb(n38) {
   return lb(n38[sh]);
 }
 function ab(n38) {
-  return lb(n38[jo]);
+  return lb(n38[Go]);
 }
 function lb(n38) {
-  for (; n38 !== null && !fa(n38); ) n38 = n38[jo];
+  for (; n38 !== null && !fa(n38); ) n38 = n38[Go];
   return n38;
 }
 var A2;
@@ -4823,7 +4823,7 @@ var V2 = class extends ga {
     return "ResourceURL";
   }
 };
-function qo(n38) {
+function Wo(n38) {
   return n38 instanceof ga ? n38.changingThisBreaksApplicationSecurity : n38;
 }
 function ol(n38, t) {
@@ -5021,11 +5021,11 @@ var ho = function(n38) {
 }(ho || {});
 function Cb(n38) {
   let t = Ib();
-  return t ? DS(t.sanitize(ho.HTML, n38) || "") : ol(n38, "HTML") ? DS(qo(n38)) : Fy(db(), Rc(n38));
+  return t ? DS(t.sanitize(ho.HTML, n38) || "") : ol(n38, "HTML") ? DS(Wo(n38)) : Fy(db(), Rc(n38));
 }
 function sl(n38) {
   let t = Ib();
-  return t ? t.sanitize(ho.URL, n38) || "" : ol(n38, "URL") ? qo(n38) : Zf(Rc(n38));
+  return t ? t.sanitize(ho.URL, n38) || "" : ol(n38, "URL") ? Wo(n38) : Zf(Rc(n38));
 }
 function Ib() {
   let n38 = Ze2();
@@ -5090,15 +5090,15 @@ function PB(n38) {
       e && (o = e);
     }
     if (!o) {
-      for (; t && !t[jo] && t !== n38; ) Ka(t) && r2(t[mt2], t), t = t[Yn];
-      t === null && (t = n38), Ka(t) && r2(t[mt2], t), o = t && t[jo];
+      for (; t && !t[Go] && t !== n38; ) Ka(t) && r2(t[mt2], t), t = t[Yn];
+      t === null && (t = n38), Ka(t) && r2(t[mt2], t), o = t && t[Go];
     }
     t = o;
   }
 }
 function MB(n38, t, o, e) {
   let i = Tr + e, r = o.length;
-  e > 0 && (o[i - 1][jo] = t), e < r - Tr ? (t[jo] = o[i], o5(o, Tr + e, t)) : (o.push(t), t[jo] = null), t[Yn] = o;
+  e > 0 && (o[i - 1][Go] = t), e < r - Tr ? (t[Go] = o[i], o5(o, Tr + e, t)) : (o.push(t), t[Go] = null), t[Yn] = o;
   let s = t[Pc];
   s !== null && o !== s && Eb(s, t);
   let a = t[ua];
@@ -5122,11 +5122,11 @@ function If(n38, t) {
   let o = Tr + t, e = n38[o];
   if (e) {
     let i = e[Pc];
-    i !== null && i !== n38 && Oy(i, e), t > 0 && (n38[o - 1][jo] = e[jo]);
+    i !== null && i !== n38 && Oy(i, e), t > 0 && (n38[o - 1][Go] = e[Go]);
     let r = df(n38, Tr + t);
     RB(e[mt2], e);
     let s = r[ua];
-    s !== null && s.detachView(r[mt2]), e[Yn] = null, e[jo] = null, e[lt2] &= -129;
+    s !== null && s.detachView(r[mt2]), e[Yn] = null, e[Go] = null, e[lt2] &= -129;
   }
   return e;
 }
@@ -5702,7 +5702,7 @@ function $b(n38, t) {
   }
 }
 function i0(n38, t) {
-  return n38[sh] ? n38[mS][jo] = t : n38[sh] = t, n38[mS] = t, t;
+  return n38[sh] ? n38[mS][Go] = t : n38[sh] = t, n38[mS] = t, t;
 }
 function z2(n38, t, o) {
   by(0);
@@ -6087,7 +6087,7 @@ var $2 = class {
 var dw = class dw2 {
 };
 dw.NULL = new $2();
-var $o = dw;
+var jo = dw;
 var ws = class {
 };
 var ct2 = (() => {
@@ -6124,7 +6124,7 @@ function Rf(n38, t, o) {
   }
   o ? n38.styles = e : n38.stylesWithoutHost = e, o ? n38.classes = i : n38.classesWithoutHost = i;
 }
-var Af = class extends $o {
+var Af = class extends jo {
   constructor(t) {
     super(), this.ngModule = t;
   }
@@ -6713,7 +6713,7 @@ var kf = class extends tl {
   constructor(t, o, e, i = true) {
     super(), this.ngModuleType = t, this._parent = o, this._bootstrapComponents = [], this.destroyCbs = [], this.componentFactoryResolver = new Af(this);
     let r = VL(t);
-    this._bootstrapComponents = SB(r.bootstrap), this._r3Injector = J5(t, o, [{ provide: tl, useValue: this }, { provide: $o, useValue: this.componentFactoryResolver }, ...e], lr(t), /* @__PURE__ */ new Set(["environment"])), i && this.resolveInjectorInitializers();
+    this._bootstrapComponents = SB(r.bootstrap), this._r3Injector = J5(t, o, [{ provide: tl, useValue: this }, { provide: jo, useValue: this.componentFactoryResolver }, ...e], lr(t), /* @__PURE__ */ new Set(["environment"])), i && this.resolveInjectorInitializers();
   }
   resolveInjectorInitializers() {
     this._r3Injector.resolveInjectorInitializers(), this.instance = this._r3Injector.get(this.ngModuleType);
@@ -6743,7 +6743,7 @@ function bG(n38, t, o) {
 var J2 = class extends tl {
   constructor(t) {
     super(), this.componentFactoryResolver = new Af(this), this.instance = null;
-    let o = new pf([...t.providers, { provide: tl, useValue: this }, { provide: $o, useValue: this.componentFactoryResolver }], t.parent || Bf(), t.debugName, /* @__PURE__ */ new Set(["environment"]));
+    let o = new pf([...t.providers, { provide: tl, useValue: this }, { provide: jo, useValue: this.componentFactoryResolver }], t.parent || Bf(), t.debugName, /* @__PURE__ */ new Set(["environment"]));
     this.injector = o, t.runEnvironmentInitializers && o.resolveInjectorInitializers();
   }
   destroy() {
@@ -6928,19 +6928,19 @@ function HS(n38, t, o, e) {
 function NG(n38, t) {
   return n38 === null || t == null || (Array.isArray(n38) ? n38[1] : n38) === t ? true : Array.isArray(n38) && typeof t == "string" ? dh(n38, t) >= 0 : false;
 }
-var Go = { textEnd: 0, key: 0, keyEnd: 0, value: 0, valueEnd: 0 };
+var zo = { textEnd: 0, key: 0, keyEnd: 0, value: 0, valueEnd: 0 };
 function LG(n38) {
-  return n38.substring(Go.key, Go.keyEnd);
+  return n38.substring(zo.key, zo.keyEnd);
 }
 function HG(n38) {
-  return BG(n38), hD(n38, gD(n38, 0, Go.textEnd));
+  return BG(n38), hD(n38, gD(n38, 0, zo.textEnd));
 }
 function hD(n38, t) {
-  let o = Go.textEnd;
-  return o === t ? -1 : (t = Go.keyEnd = zG(n38, Go.key = t, o), gD(n38, t, o));
+  let o = zo.textEnd;
+  return o === t ? -1 : (t = zo.keyEnd = zG(n38, zo.key = t, o), gD(n38, t, o));
 }
 function BG(n38) {
-  Go.key = 0, Go.keyEnd = 0, Go.value = 0, Go.valueEnd = 0, Go.textEnd = n38.length;
+  zo.key = 0, zo.keyEnd = 0, zo.value = 0, zo.valueEnd = 0, zo.textEnd = n38.length;
 }
 function gD(n38, t, o) {
   for (; t < o && n38.charCodeAt(t) <= 32; ) t++;
@@ -7046,7 +7046,7 @@ function ah(n38, t, o) {
 }
 function WG(n38, t, o) {
   if (o == null || o === "") return Er;
-  let e = [], i = qo(o);
+  let e = [], i = Wo(o);
   if (Array.isArray(i)) for (let r = 0; r < i.length; r++) n38(e, i[r], true);
   else if (typeof i == "object") for (let r in i) i.hasOwnProperty(r) && n38(e, r, i[r]);
   else typeof i == "string" && t(e, i);
@@ -7093,12 +7093,12 @@ function Ff(n38) {
   return n38 !== void 0;
 }
 function KG(n38, t) {
-  return n38 == null || n38 === "" || (typeof t == "string" ? n38 = n38 + t : typeof n38 == "object" && (n38 = lr(qo(n38)))), n38;
+  return n38 == null || n38 === "" || (typeof t == "string" ? n38 = n38 + t : typeof n38 == "object" && (n38 = lr(Wo(n38)))), n38;
 }
 function wD(n38, t) {
   return (n38.flags & (t ? 8 : 16)) !== 0;
 }
-function Qo(n38, t, o) {
+function qo(n38, t, o) {
   let e = Ze2(), i = Jy(e, n38, t, o);
   _D(Lf, mD, i, true);
 }
@@ -7511,7 +7511,7 @@ function Gt2(n38, t, o, e, i) {
 function Is(n38, t, o, e, i, r) {
   return TD(Ze2(), cr(), n38, t, o, e, i, r);
 }
-function Ko(n38, t, o, e, i, r, s) {
+function Qo(n38, t, o, e, i, r, s) {
   return RD(Ze2(), cr(), n38, t, o, e, i, r, s);
 }
 function dt2(n38, t, o, e, i, r, s, a) {
@@ -7530,7 +7530,7 @@ function tw(n38, t, o, e, i, r, s, a, l, c, d) {
   let g = cr() + n38, v = Ze2(), w = jd(v, g, o, e, i, r);
   return jd(v, g + 4, s, a, l, c) || w ? Cs(v, g + 8, d ? t.call(d, o, e, i, r, s, a, l, c) : t(o, e, i, r, s, a, l, c)) : mh(v, g + 8);
 }
-function Yo(n38, t, o, e) {
+function Ko(n38, t, o, e) {
   return AD(Ze2(), cr(), n38, t, o, e);
 }
 function vh(n38, t) {
@@ -7799,7 +7799,7 @@ var Pr = (() => {
         throw new De2(405, I);
       }
       let a;
-      r ? a = e : a = this._injector.get($o).resolveComponentFactory(e), this.componentTypes.push(a.componentType);
+      r ? a = e : a = this._injector.get(jo).resolveComponentFactory(e), this.componentTypes.push(a.componentType);
       let l = Sj(a) ? void 0 : this._injector.get(tl), c = i || a.selector, d = a.create(Dt2.NULL, [], c, l), g = d.location.nativeElement, v = d.injector.get(iw, null);
       return v?.registerApplication(g), d.onDestroy(() => {
         this.detachView(d.hostView), af(this.components, d), v?.unregisterApplication(g);
@@ -8532,7 +8532,7 @@ var BD = (() => {
   };
   t.\u0275fac = function(i) {
     return new (i || t)(we2(Pr));
-  }, t.\u0275mod = Wo({ type: t }), t.\u0275inj = Uo({});
+  }, t.\u0275mod = Uo({ type: t }), t.\u0275inj = $o({});
   let n38 = t;
   return n38;
 })();
@@ -8545,7 +8545,7 @@ function wh(n38, t) {
   let o = I4(n38);
   return t?.equal && (o[oa].equal = t.equal), o;
 }
-function Xo(n38) {
+function Yo(n38) {
   let t = Ot2(null);
   try {
     return n38();
@@ -8805,7 +8805,7 @@ function c0(n38, t) {
     return t != null && e in t ? t[e] : o;
   })), n38;
 }
-function Zo(n38, t, o = "-", e, i) {
+function Xo(n38, t, o = "-", e, i) {
   let r = "";
   (n38 < 0 || i && n38 <= 0) && (i ? n38 = -n38 + 1 : (n38 = -n38, r = o));
   let s = String(n38);
@@ -8813,7 +8813,7 @@ function Zo(n38, t, o = "-", e, i) {
   return e && (s = s.slice(s.length - t)), r + s;
 }
 function t$(n38, t) {
-  return Zo(n38, 3).substring(0, t);
+  return Xo(n38, 3).substring(0, t);
 }
 function nn(n38, t, o = 0, e = false, i = false) {
   return function(r, s) {
@@ -8821,7 +8821,7 @@ function nn(n38, t, o = 0, e = false, i = false) {
     if ((o > 0 || a > -o) && (a += o), n38 === ei.Hours) a === 0 && o === -12 && (a = 12);
     else if (n38 === ei.FractionalSeconds) return t$(a, t);
     let l = go(s, rn.MinusSign);
-    return Zo(a, t, l, e, i);
+    return Xo(a, t, l, e, i);
   };
 }
 function i$(n38, t) {
@@ -8884,13 +8884,13 @@ function d0(n38) {
     let i = -1 * e, r = go(o, rn.MinusSign), s = i > 0 ? Math.floor(i / 60) : Math.ceil(i / 60);
     switch (n38) {
       case xa.Short:
-        return (i >= 0 ? "+" : "") + Zo(s, 2, r) + Zo(Math.abs(i % 60), 2, r);
+        return (i >= 0 ? "+" : "") + Xo(s, 2, r) + Xo(Math.abs(i % 60), 2, r);
       case xa.ShortGMT:
-        return "GMT" + (i >= 0 ? "+" : "") + Zo(s, 1, r);
+        return "GMT" + (i >= 0 ? "+" : "") + Xo(s, 1, r);
       case xa.Long:
-        return "GMT" + (i >= 0 ? "+" : "") + Zo(s, 2, r) + ":" + Zo(Math.abs(i % 60), 2, r);
+        return "GMT" + (i >= 0 ? "+" : "") + Xo(s, 2, r) + ":" + Xo(Math.abs(i % 60), 2, r);
       case xa.Extended:
-        return e === 0 ? "Z" : (i >= 0 ? "+" : "") + Zo(s, 2, r) + ":" + Zo(Math.abs(i % 60), 2, r);
+        return e === 0 ? "Z" : (i >= 0 ? "+" : "") + Xo(s, 2, r) + ":" + Xo(Math.abs(i % 60), 2, r);
       default:
         throw new Error(`Unknown zone width "${n38}"`);
     }
@@ -8916,13 +8916,13 @@ function pw(n38, t = false) {
       let r = JD(o), s = o$(r.getFullYear()), a = r.getTime() - s.getTime();
       i = 1 + Math.round(a / 6048e5);
     }
-    return Zo(i, n38, go(e, rn.MinusSign));
+    return Xo(i, n38, go(e, rn.MinusSign));
   };
 }
 function u0(n38, t = false) {
   return function(o, e) {
     let r = JD(o).getFullYear();
-    return Zo(r, n38, go(e, rn.MinusSign), t);
+    return Xo(r, n38, go(e, rn.MinusSign), t);
   };
 }
 var hw = {};
@@ -9566,12 +9566,12 @@ function eu(n38, t) {
 }
 var xw = class {
   createSubscription(t, o) {
-    return Xo(() => t.subscribe({ next: o, error: (e) => {
+    return Yo(() => t.subscribe({ next: o, error: (e) => {
       throw e;
     } }));
   }
   dispose(t) {
-    Xo(() => t.unsubscribe());
+    Yo(() => t.unsubscribe());
   }
 };
 var yw = class {
@@ -9745,7 +9745,7 @@ var rE = (() => {
   };
   t.\u0275fac = function(i) {
     return new (i || t)();
-  }, t.\u0275mod = Wo({ type: t }), t.\u0275inj = Uo({});
+  }, t.\u0275mod = Uo({ type: t }), t.\u0275inj = $o({});
   let n38 = t;
   return n38;
 })();
@@ -9845,7 +9845,7 @@ function ul(n38) {
 function gE(n38) {
   return n38 != null && typeof n38.length == "number";
 }
-var Jo = new Le2("");
+var Zo = new Le2("");
 var kw = new Le2("");
 var T$ = /^(?=.{1,254}$)(?=.{1,64}@)[a-zA-Z0-9!#$%&'*+/=?^_`{|}~-]+(?:\.[a-zA-Z0-9!#$%&'*+/=?^_`{|}~-]+)*@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*$/;
 var C0 = class {
@@ -10221,10 +10221,10 @@ var E0 = class {
     return this._parent;
   }
   get status() {
-    return Xo(this.statusReactive);
+    return Yo(this.statusReactive);
   }
   set status(t) {
-    Xo(() => this.statusReactive.set(t));
+    Yo(() => this.statusReactive.set(t));
   }
   get valid() {
     return this.status === Sh;
@@ -10242,19 +10242,19 @@ var E0 = class {
     return this.status !== bh;
   }
   get pristine() {
-    return Xo(this.pristineReactive);
+    return Yo(this.pristineReactive);
   }
   set pristine(t) {
-    Xo(() => this.pristineReactive.set(t));
+    Yo(() => this.pristineReactive.set(t));
   }
   get dirty() {
     return !this.pristine;
   }
   get touched() {
-    return Xo(this.touchedReactive);
+    return Yo(this.touchedReactive);
   }
   set touched(t) {
-    Xo(() => this.touchedReactive.set(t));
+    Yo(() => this.touchedReactive.set(t));
   }
   get untouched() {
     return !this.touched;
@@ -10756,7 +10756,7 @@ var qr = (() => {
     }
   };
   t.\u0275fac = function(i) {
-    return new (i || t)(_(nu, 9), _(Jo, 10), _(kw, 10), _(Ii, 10), _(re, 8), _(Th, 8));
+    return new (i || t)(_(nu, 9), _(Zo, 10), _(kw, 10), _(Ii, 10), _(re, 8), _(Th, 8));
   }, t.\u0275dir = U({ type: t, selectors: [["", "ngModel", "", 3, "formControlName", "", 3, "formControl", ""]], inputs: { name: "name", isDisabled: [0, "disabled", "isDisabled"], model: [0, "ngModel", "model"], options: [0, "ngModelOptions", "options"] }, outputs: { update: "ngModelChange" }, exportAs: ["ngModel"], features: [fe2([eU]), ne, ni] });
   let n38 = t;
   return n38;
@@ -10822,7 +10822,7 @@ var Ca = (() => {
     }
   };
   t._ngModelWarningSentOnce = false, t.\u0275fac = function(i) {
-    return new (i || t)(_(Jo, 10), _(kw, 10), _(Ii, 10), _(ME, 8), _(Th, 8));
+    return new (i || t)(_(Zo, 10), _(kw, 10), _(Ii, 10), _(ME, 8), _(Th, 8));
   }, t.\u0275dir = U({ type: t, selectors: [["", "formControl", ""]], inputs: { form: [0, "formControl", "form"], isDisabled: [0, "disabled", "isDisabled"], model: [0, "ngModel", "model"] }, outputs: { update: "ngModelChange" }, exportAs: ["ngForm"], features: [fe2([iU]), ne, ni] });
   let n38 = t;
   return n38;
@@ -10831,7 +10831,7 @@ var nU = { provide: nu, useExisting: zi(() => Ia) };
 var Ia = (() => {
   let t = class t extends nu {
     get submitted() {
-      return Xo(this._submittedReactive);
+      return Yo(this._submittedReactive);
     }
     set submitted(e) {
       this._submittedReactive.set(e);
@@ -10923,7 +10923,7 @@ var Ia = (() => {
     }
   };
   t.\u0275fac = function(i) {
-    return new (i || t)(_(Jo, 10), _(kw, 10), _(Th, 8));
+    return new (i || t)(_(Zo, 10), _(kw, 10), _(Th, 8));
   }, t.\u0275dir = U({ type: t, selectors: [["", "formGroup", ""]], hostBindings: function(i, r) {
     i & 1 && S("submit", function(a) {
       return r.onSubmit(a);
@@ -10939,7 +10939,7 @@ var kE = (() => {
   };
   t.\u0275fac = function(i) {
     return new (i || t)();
-  }, t.\u0275mod = Wo({ type: t }), t.\u0275inj = Uo({});
+  }, t.\u0275mod = Uo({ type: t }), t.\u0275inj = $o({});
   let n38 = t;
   return n38;
 })();
@@ -10951,7 +10951,7 @@ var Mr = (() => {
   };
   t.\u0275fac = function(i) {
     return new (i || t)();
-  }, t.\u0275mod = Wo({ type: t }), t.\u0275inj = Uo({ imports: [kE] });
+  }, t.\u0275mod = Uo({ type: t }), t.\u0275inj = $o({ imports: [kE] });
   let n38 = t;
   return n38;
 })();
@@ -10963,7 +10963,7 @@ var gl = (() => {
   };
   t.\u0275fac = function(i) {
     return new (i || t)();
-  }, t.\u0275mod = Wo({ type: t }), t.\u0275inj = Uo({ imports: [kE] });
+  }, t.\u0275mod = Uo({ type: t }), t.\u0275inj = $o({ imports: [kE] });
   let n38 = t;
   return n38;
 })();
@@ -11737,13 +11737,13 @@ var Oh = (n38) => {
   }), t;
 };
 var q0 = /* @__PURE__ */ new Set(["arrowleft", "left", "arrowright", "right", "home", "end"]);
-var es = /* @__PURE__ */ new Set(["down", "up", "left", "right", "arrowdown", "arrowup", "arrowleft", "arrowright", "home", "end", "space", "spacebar", " "]);
+var Jo = /* @__PURE__ */ new Set(["down", "up", "left", "right", "arrowdown", "arrowup", "arrowleft", "arrowright", "home", "end", "space", "spacebar", " "]);
 var l6 = new Set("up down arrowup arrowdown home end".split(" "));
 var Cl = new Set("right down arrowright arrowdown".split(" "));
 var Il = new Set("left up arrowleft arrowup".split(" "));
 var jw = /* @__PURE__ */ new Set(["+", "add", "\u2260", "\xB1", "="]);
-var Nh = /* @__PURE__ */ new Set([...Array.from(es), ...Array.from(jw), "enter", "f2", "escape", "esc", "pagedown", "pageup"]);
-var jc = /* @__PURE__ */ new Set([...Array.from(es), "escape", "esc", "l", "\xAC"]);
+var Nh = /* @__PURE__ */ new Set([...Array.from(Jo), ...Array.from(jw), "enter", "f2", "escape", "esc", "pagedown", "pageup"]);
+var jc = /* @__PURE__ */ new Set([...Array.from(Jo), "escape", "esc", "l", "\xAC"]);
 var Da = (n38) => new di((t) => {
   let o = new (Gw())((i) => {
     t.next(i);
@@ -11923,7 +11923,7 @@ var Cu = class extends Sl {
     return super.getFieldValue(t.data, o, e, i);
   }
 };
-var ts = class {
+var es = class {
   clone(t) {
     return Fr(t);
   }
@@ -11962,7 +11962,7 @@ var Je2 = class n10 {
   static isHierarchyMatch(t, o, e) {
     return yu(t, o, e);
   }
-  static mergeTransactions(t, o, e, i = new ts(), r = false) {
+  static mergeTransactions(t, o, e, i = new es(), r = false) {
     return t.forEach((s, a) => {
       let l = e ? s[e] : s, c = o.find((d) => d.id === l);
       c && c.type === $e.UPDATE && (t[a] = Zn(i.clone(t[a]), c.newValue));
@@ -11971,7 +11971,7 @@ var Je2 = class n10 {
       0 <= a && a < t.length && t.splice(a, 1);
     }), t.push(...o.filter((s) => s.type === $e.ADD).map((s) => s.newValue)), t;
   }
-  static mergeHierarchicalTransactions(t, o, e, i, r = new ts(), s = false) {
+  static mergeHierarchicalTransactions(t, o, e, i, r = new es(), s = false) {
     for (let a of o) if (a.path) {
       let l = this.findParentFromPath(t, i, e, a.path), c = l ? l[e] : t;
       switch (a.type) {
@@ -12238,7 +12238,7 @@ var Fs = class extends Iu {
     });
   }
 };
-var yo = It2({ quickFilter: "quickFilter", excelStyleFilter: "excelStyleFilter" });
+var ts = It2({ quickFilter: "quickFilter", excelStyleFilter: "excelStyleFilter" });
 var Gn = It2({ top: "top", bottom: "bottom" });
 var bn = It2({ rootLevelOnly: "rootLevelOnly", childLevelsOnly: "childLevelsOnly", rootAndChildLevels: "rootAndChildLevels" });
 var it2 = It2({ none: "none", single: "single", multiple: "multiple", multipleCascade: "multipleCascade" });
@@ -13048,8 +13048,8 @@ var T6 = function(n38, t, o, e, i, r) {
             if (gn > Qe2) {
               if (Qe2 = gn, _t2 = Ki, gn > hn) break;
               for (var $a = Math.min(Ki, gn - 2), mn = 0, Me = 0; Me < $a; ++Me) {
-                var No = tt2 - Ki + Me & 32767, br = R[No], _c = No - br & 32767;
-                _c > mn && (mn = _c, pn = No);
+                var Oo = tt2 - Ki + Me & 32767, br = R[Oo], _c = Oo - br & 32767;
+                _c > mn && (mn = _c, pn = Oo);
               }
             }
           }
@@ -14298,7 +14298,7 @@ var Fu = pe2(oi, { params: { delay: "0s", direction: "", duration: "350ms", easi
 var l_ = pe2(oi, { params: { delay: "0s", duration: "350ms", easing: "cubic-bezier(0.250, 0.460, 0.450, 0.940)", endOpacity: 1, startOpacity: 0, toScale: 1, xPos: "50%", yPos: "50%", direction: "Y", fromScale: 0.4 } });
 var eg = pe2(oi, { params: { delay: "0s", direction: "", duration: "350ms", easing: "cubic-bezier(0.250, 0.460, 0.450, 0.940)", endOpacity: 1, fromScale: 0.5, startOpacity: 0, toScale: 1, xPos: "50%", yPos: "0" } });
 var tg = pe2(oi, { params: { delay: "0s", direction: "", duration: "350ms", easing: "cubic-bezier(0.250, 0.460, 0.450, 0.940)", endOpacity: 1, fromScale: 0.5, startOpacity: 0, toScale: 1, xPos: "0", yPos: "50%" } });
-var wo = pe2(oi, { params: { delay: "0s", duration: "350ms", easing: "cubic-bezier(0.250, 0.460, 0.450, 0.940)", endOpacity: 1, startOpacity: 0, toScale: 1, direction: "Y", fromScale: 0.4, xPos: "100%", yPos: "0" } });
+var yo = pe2(oi, { params: { delay: "0s", duration: "350ms", easing: "cubic-bezier(0.250, 0.460, 0.450, 0.940)", endOpacity: 1, startOpacity: 0, toScale: 1, direction: "Y", fromScale: 0.4, xPos: "100%", yPos: "0" } });
 var Vu = pe2(oi, { params: { delay: "0s", direction: "", duration: "350ms", easing: "cubic-bezier(0.250, 0.460, 0.450, 0.940)", endOpacity: 1, fromScale: 0.5, startOpacity: 0, toScale: 1, xPos: "100%", yPos: "0" } });
 var Ou = pe2(oi, { params: { delay: "0s", direction: "", duration: "350ms", easing: "cubic-bezier(0.250, 0.460, 0.450, 0.940)", endOpacity: 1, fromScale: 0.5, startOpacity: 0, toScale: 1, xPos: "0", yPos: "0" } });
 var Aa = pe2(oi, { params: { delay: "0s", duration: "350ms", easing: "cubic-bezier(0.250, 0.460, 0.450, 0.940)", endOpacity: 1, startOpacity: 0, toScale: 1, direction: "Y", fromScale: 0.4, xPos: "0", yPos: "100%" } });
@@ -14359,7 +14359,7 @@ var E_ = pe2(er, { params: { delay: "0s", direction: "X", yPos: "center", easing
 var T_ = pe2(er, { params: { delay: "0s", easing: "cubic-bezier(0.600, -0.280, 0.735, 0.045)", endOpacity: 0, startAngle: 0, startOpacity: 1, direction: "Y", duration: ".45s", endAngle: 100, xPos: "center", yPos: "left" } });
 var Rl = class {
   constructor() {
-    this.oppositeAnimation = /* @__PURE__ */ new Map([[En, En], [Tn, Tn], [P1, M1], [M1, P1], [F1, k1], [k1, F1], [V1, O1], [O1, V1], [N1, L1], [L1, N1], [Ta, Ta], [Ra, Ra], [Z1, Z1], [Y1, X1], [X1, Y1], [J1, J1], [H1, H1], [B1, B1], [z1, z1], [G1, G1], [j1, j1], [$1, $1], [U1, U1], [W1, W1], [q1, q1], [Q1, Q1], [K1, K1], [cC, cC], [dC, dC], [e_, r_], [t_, o_], [i_, s_], [n_, a_], [s_, i_], [a_, n_], [r_, e_], [o_, t_], [Wh, Yh], [qh, Xh], [Qh, Zh], [Kh, Jh], [Yh, Wh], [Xh, qh], [Zh, Qh], [Jh, Kh], [uC, uC], [pC, pC], [hC, hC], [gC, gC], [mC, mC], [fC, fC], [_C, _C], [vC, vC], [eg, ng], [rg, ag], [ig, tg], [sg, og], [ng, eg], [ag, rg], [tg, ig], [og, sg], [ku, ku], [d_, d_], [Vu, Fu], [Bu, Lu], [Nu, Ou], [Hu, zu], [Fu, Vu], [Lu, Bu], [Ou, Nu], [zu, Hu], [wo, Aa], [Ls, Wc], [Aa, wo], [Wc, Ls], [l_, l_], [u_, u_], [c_, c_], [p_, p_], [$c, Uc], [qc, Qc], [Uc, $c], [Qc, qc], [Kc, Yc], [Xc, Zc], [cg, lg], [dg, ug], [Yc, Kc], [Zc, Xc], [lg, cg], [ug, dg], [Gu, Uu], [Wu, Qu], [$u, ju], [qu, Ku], [Uu, Gu], [Qu, Wu], [ju, $u], [Ku, qu], [h_, m_], [w_, I_], [g_, f_], [C_, S_], [f_, g_], [S_, C_], [m_, h_], [I_, w_], [__, x_], [b_, E_], [v_, y_], [D_, T_], [x_, __], [E_, b_], [y_, v_], [T_, D_]]), this.horizontalAnimations = [F1, k1, N1, L1, i_, n_, s_, a_, Wh, qh, Qh, Kh, Yh, Xh, Zh, Jh, ig, sg, tg, og, Vu, Bu, Nu, Hu, Fu, Lu, Ou, zu, $c, qc, Uc, Qc, cg, dg, lg, ug, Gu, Wu, $u, qu, Uu, Qu, ju, Ku, g_, C_, f_, S_, v_, D_, y_, T_], this.verticalAnimations = [P1, M1, V1, O1, Ta, Ra, e_, t_, r_, o_, Wh, qh, Qh, Kh, Yh, Xh, Zh, Jh, eg, rg, ng, ag, Vu, Bu, Nu, Hu, Fu, Lu, Ou, zu, wo, Ls, Aa, Wc, Kc, Xc, Yc, Zc, Gu, Wu, $u, qu, Uu, Qu, ju, Ku, h_, w_, m_, I_, __, b_, x_, E_];
+    this.oppositeAnimation = /* @__PURE__ */ new Map([[En, En], [Tn, Tn], [P1, M1], [M1, P1], [F1, k1], [k1, F1], [V1, O1], [O1, V1], [N1, L1], [L1, N1], [Ta, Ta], [Ra, Ra], [Z1, Z1], [Y1, X1], [X1, Y1], [J1, J1], [H1, H1], [B1, B1], [z1, z1], [G1, G1], [j1, j1], [$1, $1], [U1, U1], [W1, W1], [q1, q1], [Q1, Q1], [K1, K1], [cC, cC], [dC, dC], [e_, r_], [t_, o_], [i_, s_], [n_, a_], [s_, i_], [a_, n_], [r_, e_], [o_, t_], [Wh, Yh], [qh, Xh], [Qh, Zh], [Kh, Jh], [Yh, Wh], [Xh, qh], [Zh, Qh], [Jh, Kh], [uC, uC], [pC, pC], [hC, hC], [gC, gC], [mC, mC], [fC, fC], [_C, _C], [vC, vC], [eg, ng], [rg, ag], [ig, tg], [sg, og], [ng, eg], [ag, rg], [tg, ig], [og, sg], [ku, ku], [d_, d_], [Vu, Fu], [Bu, Lu], [Nu, Ou], [Hu, zu], [Fu, Vu], [Lu, Bu], [Ou, Nu], [zu, Hu], [yo, Aa], [Ls, Wc], [Aa, yo], [Wc, Ls], [l_, l_], [u_, u_], [c_, c_], [p_, p_], [$c, Uc], [qc, Qc], [Uc, $c], [Qc, qc], [Kc, Yc], [Xc, Zc], [cg, lg], [dg, ug], [Yc, Kc], [Zc, Xc], [lg, cg], [ug, dg], [Gu, Uu], [Wu, Qu], [$u, ju], [qu, Ku], [Uu, Gu], [Qu, Wu], [ju, $u], [Ku, qu], [h_, m_], [w_, I_], [g_, f_], [C_, S_], [f_, g_], [S_, C_], [m_, h_], [I_, w_], [__, x_], [b_, E_], [v_, y_], [D_, T_], [x_, __], [E_, b_], [y_, v_], [T_, D_]]), this.horizontalAnimations = [F1, k1, N1, L1, i_, n_, s_, a_, Wh, qh, Qh, Kh, Yh, Xh, Zh, Jh, ig, sg, tg, og, Vu, Bu, Nu, Hu, Fu, Lu, Ou, zu, $c, qc, Uc, Qc, cg, dg, lg, ug, Gu, Wu, $u, qu, Uu, Qu, ju, Ku, g_, C_, f_, S_, v_, D_, y_, T_], this.verticalAnimations = [P1, M1, V1, O1, Ta, Ra, e_, t_, r_, o_, Wh, qh, Qh, Kh, Yh, Xh, Zh, Jh, eg, rg, ng, ag, Vu, Bu, Nu, Hu, Fu, Lu, Ou, zu, yo, Ls, Aa, Wc, Kc, Xc, Yc, Zc, Gu, Wu, $u, qu, Uu, Qu, ju, Ku, h_, w_, m_, I_, __, b_, x_, E_];
   }
   static instance() {
     return this._instance || (this._instance = new this());
@@ -14473,7 +14473,7 @@ var os = class n13 {
 };
 var Li = class {
   constructor(t) {
-    this._defaultSettings = { horizontalDirection: ze2.Right, verticalDirection: Ge2.Bottom, horizontalStartPoint: ze2.Left, verticalStartPoint: Ge2.Bottom, openAnimation: wo, closeAnimation: Ls, minSize: { width: 0, height: 0 } }, this.settings = Object.assign({}, this._defaultSettings, t);
+    this._defaultSettings = { horizontalDirection: ze2.Right, verticalDirection: Ge2.Bottom, horizontalStartPoint: ze2.Left, verticalStartPoint: Ge2.Bottom, openAnimation: yo, closeAnimation: Ls, minSize: { width: 0, height: 0 } }, this.settings = Object.assign({}, this._defaultSettings, t);
   }
   position(t, o, e, i, r) {
     let s = this.calculateElementRectangles(t, r);
@@ -14744,7 +14744,7 @@ var pi = (() => {
           i = { horizontalStartPoint: ze2.Center, verticalStartPoint: Ge2.Top, horizontalDirection: ze2.Center, verticalDirection: Ge2.Top, openAnimation: Aa, closeAnimation: Wc };
           break;
         case Pl.Below:
-          i = { horizontalStartPoint: ze2.Center, verticalStartPoint: Ge2.Bottom, horizontalDirection: ze2.Center, verticalDirection: Ge2.Bottom, openAnimation: wo, closeAnimation: Ls };
+          i = { horizontalStartPoint: ze2.Center, verticalStartPoint: Ge2.Bottom, horizontalDirection: ze2.Center, verticalDirection: Ge2.Bottom, openAnimation: yo, closeAnimation: Ls };
           break;
         case Pl.After:
           i = { horizontalStartPoint: ze2.Right, verticalStartPoint: Ge2.Middle, horizontalDirection: ze2.Right, verticalDirection: Ge2.Middle, openAnimation: $c, closeAnimation: qc };
@@ -14754,7 +14754,7 @@ var pi = (() => {
           break;
         case Pl.Default:
         default:
-          i = { horizontalStartPoint: ze2.Left, verticalStartPoint: Ge2.Bottom, horizontalDirection: ze2.Right, verticalDirection: Ge2.Bottom, openAnimation: wo, closeAnimation: Ls };
+          i = { horizontalStartPoint: ze2.Left, verticalStartPoint: Ge2.Bottom, horizontalDirection: ze2.Right, verticalDirection: Ge2.Bottom, openAnimation: yo, closeAnimation: Ls };
           break;
       }
       return i;
@@ -15037,7 +15037,7 @@ var Ju = class extends Fl {
 };
 var ed = class {
   constructor() {
-    this.onStateUpdate = new T(), this._isPending = false, this._pendingTransactions = [], this._pendingStates = /* @__PURE__ */ new Map(), this._cloneStrategy = new ts();
+    this.onStateUpdate = new T(), this._isPending = false, this._pendingTransactions = [], this._pendingStates = /* @__PURE__ */ new Map(), this._cloneStrategy = new es();
   }
   get cloneStrategy() {
     return this._cloneStrategy;
@@ -15303,7 +15303,7 @@ var $n = function(n38) {
 }($n || {});
 var Vl = It2({ ESCAPE: "escape", ENTER: "enter", SPACE: "space" });
 var Ol = new Le2("IgxDropDownBaseToken");
-var Co = (() => {
+var wo = (() => {
   let t = class t {
     constructor(e) {
       this.dropdown = e, this._target = null;
@@ -16594,7 +16594,7 @@ var MC = (() => {
   };
   t.\u0275fac = function(i) {
     return new (i || t)(we2(WK, 12));
-  }, t.\u0275mod = Wo({ type: t }), t.\u0275inj = Uo({ providers: [...QK, ...qK], imports: [rE, BD] });
+  }, t.\u0275mod = Uo({ type: t }), t.\u0275inj = $o({ providers: [...QK, ...qK], imports: [rE, BD] });
   let n38 = t;
   return n38;
 })();
@@ -16621,16 +16621,16 @@ var KK = (() => {
         case ho.NONE:
           return i;
         case ho.HTML:
-          return ol(i, "HTML") ? qo(i) : Fy(this._doc, String(i)).toString();
+          return ol(i, "HTML") ? Wo(i) : Fy(this._doc, String(i)).toString();
         case ho.STYLE:
-          return ol(i, "Style") ? qo(i) : i;
+          return ol(i, "Style") ? Wo(i) : i;
         case ho.SCRIPT:
-          if (ol(i, "Script")) return qo(i);
+          if (ol(i, "Script")) return Wo(i);
           throw new De2(5200, false);
         case ho.URL:
-          return ol(i, "URL") ? qo(i) : Zf(String(i));
+          return ol(i, "URL") ? Wo(i) : Zf(String(i));
         case ho.RESOURCE_URL:
-          if (ol(i, "ResourceURL")) return qo(i);
+          if (ol(i, "ResourceURL")) return Wo(i);
           throw new De2(5201, false);
         default:
           throw new De2(5202, false);
@@ -16658,7 +16658,7 @@ var KK = (() => {
   let n38 = t;
   return n38;
 })();
-var Io = (() => {
+var Co = (() => {
   let t = class t {
     constructor(e, i, r, s) {
       if (this._sanitizer = e, this._httpClient = i, this._platformUtil = r, this.document = s, this._defaultFamily = { name: "material", meta: { className: "material-icons", type: "liga" } }, this._iconRefs = /* @__PURE__ */ new Map(), this._families = /* @__PURE__ */ new Map(), this._cachedIcons = /* @__PURE__ */ new Map(), this._iconLoaded = new ue2(), this.iconLoaded = this._iconLoaded.asObservable(), this.setFamily(this._defaultFamily.name, this._defaultFamily.meta), this._platformUtil?.isBrowser) {
@@ -16848,7 +16848,7 @@ var me = (() => {
     }
   };
   t.\u0275fac = function(i) {
-    return new (i || t)(_(z), _(Io), _(rp), _(re));
+    return new (i || t)(_(z), _(Co), _(rp), _(re));
   }, t.\u0275cmp = q({ type: t, selectors: [["igx-icon"]], hostVars: 5, hostBindings: function(i, r) {
     i & 2 && (H("aria-hidden", r.ariaHidden), ui(r.elementClasses), X("igx-icon--inactive", r.getInactive));
   }, inputs: { family: "family", name: "name", active: [2, "active", "active", B] }, standalone: true, features: [le2, ni, Q], ngContentSelectors: YK, decls: 3, vars: 2, consts: [[3, "innerHTML"]], template: function(i, r) {
@@ -17915,7 +17915,7 @@ var j_ = (() => {
       if (this._afterViewInit = true, !this.platformUtil.isBrowser) return;
       let e = 0;
       this._zone.runOutsideAngular(() => {
-        Da(this.nativeElement).pipe(Bo(e), K(this.destroy$)).subscribe((i) => this.handleMutations(i));
+        Da(this.nativeElement).pipe(Ho(e), K(this.destroy$)).subscribe((i) => this.handleMutations(i));
       });
     }
     get nativeElement() {
@@ -18151,7 +18151,7 @@ var $_ = (() => {
           this.verticalScrollHandler = this.verticalScrollHandler.bind(this), this.scrollComponent.nativeElement.addEventListener("scroll", this.verticalScrollHandler), this.dc.instance.scrollContainer = this.scrollComponent.nativeElement;
         });
         let i = K(this.destroy$);
-        this.contentResizeNotify.pipe(Xt(() => this.igxForContainerSize && this.igxForOf && this.igxForOf.length > 0), Bo(40, void 0, { leading: false, trailing: true }), i).subscribe(() => this._zone.runTask(() => this.updateSizes()));
+        this.contentResizeNotify.pipe(Xt(() => this.igxForContainerSize && this.igxForOf && this.igxForOf.length > 0), Ho(40, void 0, { leading: false, trailing: true }), i).subscribe(() => this._zone.runTask(() => this.updateSizes()));
       }
       this.igxForScrollOrientation === "horizontal" && (this.func = (i) => this.onHScroll(i), this.scrollComponent = this.syncScrollService.getScrollMaster(this.igxForScrollOrientation), this.scrollComponent ? this._zone.runOutsideAngular(() => {
         this.scrollComponent.nativeElement.addEventListener("scroll", this.func), this.dc.instance.scrollContainer = this.scrollComponent.nativeElement;
@@ -20302,7 +20302,7 @@ var sn = (() => {
     i & 1 && S("wheel", function(a) {
       return r.onWheel(a);
     });
-  }, inputs: { locale: "locale", minValue: "minValue", maxValue: "maxValue", spinLoop: [2, "spinLoop", "spinLoop", B], displayFormat: "displayFormat", inputFormat: [0, "igxDateTimeEditor", "inputFormat"], value: "value", defaultFormatType: "defaultFormatType", spinDelta: "spinDelta" }, outputs: { valueChange: "valueChange", validationFailed: "validationFailed" }, exportAs: ["igxDateTimeEditor"], standalone: true, features: [fe2([{ provide: Ii, useExisting: t, multi: true }, { provide: Jo, useExisting: t, multi: true }]), le2, ne, ni] });
+  }, inputs: { locale: "locale", minValue: "minValue", maxValue: "maxValue", spinLoop: [2, "spinLoop", "spinLoop", B], displayFormat: "displayFormat", inputFormat: [0, "igxDateTimeEditor", "inputFormat"], value: "value", defaultFormatType: "defaultFormatType", spinDelta: "spinDelta" }, outputs: { valueChange: "valueChange", validationFailed: "validationFailed" }, exportAs: ["igxDateTimeEditor"], standalone: true, features: [fe2([{ provide: Ii, useExisting: t, multi: true }, { provide: Zo, useExisting: t, multi: true }]), le2, ne, ni] });
   let n38 = t;
   return n38;
 })();
@@ -21396,7 +21396,7 @@ var wr = (() => {
       if (this.virtDir) {
         if (e === -1 || e >= this.collectionLength) return;
         let i = e > (this.focusedItem ? this.focusedItem.index : -1) ? $n.Down : $n.Up, r = this.isIndexOutOfBounds(e, i);
-        this.focusedItem = { value: this.virtDir.igxForOf[e], index: e }, r && this.virtDir.scrollTo(e), r ? this.virtDir.chunkLoad.pipe(Ho(1)).subscribe(() => {
+        this.focusedItem = { value: this.virtDir.igxForOf[e], index: e }, r && this.virtDir.scrollTo(e), r ? this.virtDir.chunkLoad.pipe(Lo(1)).subscribe(() => {
           this.skipHeader(i);
         }) : this.skipHeader(i);
       } else super.navigateItem(e);
@@ -21605,7 +21605,7 @@ var dp = (() => {
   let n38 = t;
   return n38;
 })();
-var So = class {
+var Io = class {
   constructor(t, o, e, i) {
     this.id = t, this.index = o, this.data = e, this.grid = i, this.rowFormGroup = new ru({}), this.rowFormGroup = this.grid.validation.create(t, e);
   }
@@ -21624,7 +21624,7 @@ var So = class {
     return this.constructor.name;
   }
 };
-var Cr = class extends So {
+var Cr = class extends Io {
   constructor(t, o, e, i, r) {
     super(t, o, e, r), this.recordRef = i, this.isAddRow = true;
   }
@@ -21673,7 +21673,7 @@ var zC = class {
     return this.cell = new Tg(t.cellID || t.id, t.row.index, t.column, t.value, t.value, t.row.data, t.grid);
   }
   createRow(t) {
-    return this.row = new So(t.id.rowID, t.rowIndex, t.rowData, t.grid);
+    return this.row = new Io(t.id.rowID, t.rowIndex, t.rowData, t.grid);
   }
   sameRow(t) {
     return this.row && this.row.id === t;
@@ -21747,7 +21747,7 @@ var GC = class extends zC {
     this._rowEditingBlocked = t;
   }
   beginRowEdit(t) {
-    if (!this.row || this.row.getClassName() !== So.name) {
+    if (!this.row || this.row.getClassName() !== Io.name) {
       if (this.row || this.createRow(this.cell), !this._rowEditingStarted) {
         let o = this.row.createRowEditEventArgs(false, t);
         if (this.grid.rowEditEnter.emit(o), o.cancel) return this.endEditMode(), true;
@@ -21768,7 +21768,7 @@ var GC = class extends zC {
   endRowTransaction(t, o) {
     this.row.newData = this.grid.transactions.getAggregatedValue(this.row.id, true);
     let e = this.row.createRowEditEventArgs(true, o), i;
-    if (t) if (this.row.getClassName() === So.name) e = this.grid.gridAPI.update_row(this.row, this.row.newData, o), i = this.rowEditDone(e.oldValue, o);
+    if (t) if (this.row.getClassName() === Io.name) e = this.grid.gridAPI.update_row(this.row, this.row.newData, o), i = this.rowEditDone(e.oldValue, o);
     else {
       let r = this.row.createRowDataEventArgs(o);
       if (this.grid.rowAdd.emit(r), r.cancel) return r;
@@ -22778,7 +22778,7 @@ var ln = (() => {
     update(e) {
       let i = this.grid.crudService;
       i.cellInEditMode && i.cell.id.key === this.key && this.grid.transactions.endPending(false);
-      let r = new So(this.key, this.index, this.data, this.grid);
+      let r = new Io(this.key, this.index, this.data, this.grid);
       this.grid.gridAPI.update_row(r, e), this.cdr.markForCheck();
     }
     delete() {
@@ -22838,7 +22838,7 @@ var ln = (() => {
   let n38 = t;
   return n38;
 })();
-var bo = (() => {
+var So = (() => {
   let t = class t {
     get grid() {
       return this.strip.context.grid;
@@ -22859,7 +22859,7 @@ var bo = (() => {
     }
   };
   t.\u0275fac = function(i) {
-    return new (i || t)(_(Io), _(ki));
+    return new (i || t)(_(Co), _(ki));
   }, t.\u0275dir = U({ type: t, selectors: [["", "igxGridActionsBase", ""]], viewQuery: function(i, r) {
     if (i & 1 && k(dp, 5), i & 2) {
       let s;
@@ -22966,7 +22966,7 @@ var rd = (() => {
   t.\u0275fac = function(i) {
     return new (i || t)(_(qe), _(ct2), _(z), _(re));
   }, t.\u0275cmp = q({ type: t, selectors: [["igx-action-strip"]], contentQueries: function(i, r, s) {
-    if (i & 1 && (de(s, E8, 4), de(s, bo, 4)), i & 2) {
+    if (i & 1 && (de(s, E8, 4), de(s, So, 4)), i & 2) {
       let a;
       b(a = D()) && (r._menuItems = a), b(a = D()) && (r.actionButtons = a);
     }
@@ -22979,7 +22979,7 @@ var rd = (() => {
     i & 2 && (N("display", r.display), X("igx-action-strip", r.hostClass));
   }, inputs: { context: "context", hidden: [2, "hidden", "hidden", B], resourceStrings: "resourceStrings" }, standalone: true, features: [fe2([{ provide: Rn, useExisting: t }]), le2, Q], ngContentSelectors: eZ, decls: 6, vars: 2, consts: [["dropdown", ""], [1, "igx-action-strip__actions"], [4, "ngIf"], ["class", "igx-action-strip__menu-item", 4, "ngFor", "ngForOf"], ["type", "button", "igxIconButton", "flat", "igxRipple", "", 3, "click", "igxToggleAction", "overlaySettings", "title", "igxDropDownItemNavigation"], ["family", "default", "name", "more_vert"], [1, "igx-action-strip__menu-item"], [1, "igx-drop-down__item-template"], [4, "ngTemplateOutlet", "ngTemplateOutletContext"]], template: function(i, r) {
     i & 1 && (Ee(), m(0, "div", 1), ce(1, 0, ["#content", ""]), C(2, iZ, 3, 4, "ng-container", 2), m(3, "igx-drop-down", null, 0), C(5, rZ, 3, 4, "igx-drop-down-item", 3), f()()), i & 2 && (u(2), p("ngIf", r.menuItems.length > 0), u(3), p("ngForOf", r.menuItems));
-  }, dependencies: [ae2, He2, ke, tr, bi, q_, Co, me, wr, yr], encapsulation: 2 });
+  }, dependencies: [ae2, He2, ke, tr, bi, q_, wo, me, wr, yr], encapsulation: 2 });
   let n38 = t;
   return n38;
 })();
@@ -23818,7 +23818,7 @@ function Kre(n38, t) {
   }
 }
 var kg = (() => {
-  let t = class t extends bo {
+  let t = class t extends So {
     constructor() {
       super(...arguments), this.cssClass = "igx-action-strip__editing-actions", this.editRow = true, this.deleteRow = true, this.addChild = false, this.isMessageShown = false, this._addRow = false, this.iconsRendered = false;
     }
@@ -23871,7 +23871,7 @@ var kg = (() => {
     };
   })(), t.\u0275cmp = q({ type: t, selectors: [["igx-grid-editing-actions"]], hostVars: 2, hostBindings: function(i, r) {
     i & 2 && X("igx-action-strip__editing-actions", r.cssClass);
-  }, inputs: { addRow: [2, "addRow", "addRow", B], editRow: [2, "editRow", "editRow", B], deleteRow: [2, "deleteRow", "deleteRow", B], addChild: [2, "addChild", "addChild", B] }, standalone: true, features: [fe2([{ provide: bo, useExisting: t }]), le2, ne, Q], decls: 1, vars: 1, consts: [[4, "ngIf"], ["iconName", "edit", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["iconName", "add_row", "iconSet", "default", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["iconName", "add_child", "iconSet", "default", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["class", "igx-action-strip__delete", "classNames", "igx-action-strip__menu-item--danger", "iconName", "delete", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["iconName", "edit", 3, "actionClick", "asMenuItem", "labelText"], ["iconName", "add_row", "iconSet", "default", 3, "actionClick", "asMenuItem", "labelText"], ["iconName", "add_child", "iconSet", "default", 3, "actionClick", "asMenuItem", "labelText"], ["classNames", "igx-action-strip__menu-item--danger", "iconName", "delete", 1, "igx-action-strip__delete", 3, "actionClick", "asMenuItem", "labelText"]], template: function(i, r) {
+  }, inputs: { addRow: [2, "addRow", "addRow", B], editRow: [2, "editRow", "editRow", B], deleteRow: [2, "deleteRow", "deleteRow", B], addChild: [2, "addChild", "addChild", B] }, standalone: true, features: [fe2([{ provide: So, useExisting: t }]), le2, ne, Q], decls: 1, vars: 1, consts: [[4, "ngIf"], ["iconName", "edit", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["iconName", "add_row", "iconSet", "default", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["iconName", "add_child", "iconSet", "default", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["class", "igx-action-strip__delete", "classNames", "igx-action-strip__menu-item--danger", "iconName", "delete", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["iconName", "edit", 3, "actionClick", "asMenuItem", "labelText"], ["iconName", "add_row", "iconSet", "default", 3, "actionClick", "asMenuItem", "labelText"], ["iconName", "add_child", "iconSet", "default", 3, "actionClick", "asMenuItem", "labelText"], ["classNames", "igx-action-strip__menu-item--danger", "iconName", "delete", 1, "igx-action-strip__delete", 3, "actionClick", "asMenuItem", "labelText"]], template: function(i, r) {
     i & 1 && C(0, Kre, 5, 4, "ng-container", 0), i & 2 && p("ngIf", r.isRowContext);
   }, dependencies: [ae2, dp], encapsulation: 2 });
   let n38 = t;
@@ -23940,7 +23940,7 @@ function eoe(n38, t) {
   }
 }
 var Fg = (() => {
-  let t = class t extends bo {
+  let t = class t extends So {
     constructor() {
       super(...arguments), this.cssClass = "igx-action-strip__pinning-actions", this.iconsRendered = false;
     }
@@ -23984,7 +23984,7 @@ var Fg = (() => {
     };
   })(), t.\u0275cmp = q({ type: t, selectors: [["igx-grid-pinning-actions"]], hostVars: 2, hostBindings: function(i, r) {
     i & 2 && X("igx-action-strip__pinning-actions", r.cssClass);
-  }, standalone: true, features: [fe2([{ provide: bo, useExisting: t }]), ne, Q], decls: 1, vars: 1, consts: [[4, "ngIf"], ["iconSet", "default", "iconName", "jump_down", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["iconSet", "default", "iconName", "jump_up", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["iconSet", "default", "iconName", "pin", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["iconSet", "default", "iconName", "unpin", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["iconSet", "default", "iconName", "jump_down", 3, "actionClick", "asMenuItem", "labelText"], ["iconSet", "default", "iconName", "jump_up", 3, "actionClick", "asMenuItem", "labelText"], ["iconSet", "default", "iconName", "pin", 3, "actionClick", "asMenuItem", "labelText"], ["iconSet", "default", "iconName", "unpin", 3, "actionClick", "asMenuItem", "labelText"]], template: function(i, r) {
+  }, standalone: true, features: [fe2([{ provide: So, useExisting: t }]), ne, Q], decls: 1, vars: 1, consts: [[4, "ngIf"], ["iconSet", "default", "iconName", "jump_down", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["iconSet", "default", "iconName", "jump_up", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["iconSet", "default", "iconName", "pin", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["iconSet", "default", "iconName", "unpin", 3, "asMenuItem", "labelText", "actionClick", 4, "ngIf"], ["iconSet", "default", "iconName", "jump_down", 3, "actionClick", "asMenuItem", "labelText"], ["iconSet", "default", "iconName", "jump_up", 3, "actionClick", "asMenuItem", "labelText"], ["iconSet", "default", "iconName", "pin", 3, "actionClick", "asMenuItem", "labelText"], ["iconSet", "default", "iconName", "unpin", 3, "actionClick", "asMenuItem", "labelText"]], template: function(i, r) {
     i & 1 && C(0, eoe, 5, 4, "ng-container", 0), i & 2 && p("ngIf", r.isRowContext);
   }, dependencies: [ae2, dp], encapsulation: 2 });
   let n38 = t;
@@ -24061,12 +24061,12 @@ function loe(n38, t) {
 function coe(n38, t) {
   if (n38 & 1 && (m(0, "button", 2)(1, "span"), C(2, aoe, 2, 1, "igx-icon", 3)(3, loe, 2, 1, "span", 4), f()()), n38 & 2) {
     let o = t.$implicit, e = h();
-    p("selected", o.selected)("disabled", e.disabled || o.disabled)("igxLabel", o.label)("igxRipple", o.ripple), H("data-togglable", o.togglable), u(), Qo("igx-button-group__item-content ", e.itemContentCssClass, ""), u(), p("ngIf", o.icon), u(), p("ngIf", o.label);
+    p("selected", o.selected)("disabled", e.disabled || o.disabled)("igxLabel", o.label)("igxRipple", o.ripple), H("data-togglable", o.togglable), u(), qo("igx-button-group__item-content ", e.itemContentCssClass, ""), u(), p("ngIf", o.icon), u(), p("ngIf", o.label);
   }
 }
 var $C = It2({ horizontal: "horizontal", vertical: "vertical" });
 var doe = 0;
-var Do = (() => {
+var bo = (() => {
   let t = class t {
     get buttons() {
       return [...this.viewButtons.toArray(), ...this.templateButtons.toArray()];
@@ -26350,7 +26350,7 @@ var li = (() => {
   return n38;
 })();
 var Bse = ["*"];
-var Eo = (() => {
+var Do = (() => {
   let t = class t {
     get _widthToRem() {
       return vu(this.width);
@@ -26901,7 +26901,7 @@ var Hr = (() => {
     i & 1 && S("keydown", function(a) {
       return r.onKeyDown(a);
     }), i & 2 && H("id", r.id);
-  }, inputs: { hideOutsideDays: [2, "hideOutsideDays", "hideOutsideDays", B], displayMonthsCount: "displayMonthsCount", showWeekNumbers: [2, "showWeekNumbers", "showWeekNumbers", B], formatter: "formatter", headerOrientation: "headerOrientation", todayButtonLabel: "todayButtonLabel", cancelButtonLabel: "cancelButtonLabel", spinLoop: [2, "spinLoop", "spinLoop", B], spinDelta: "spinDelta", outlet: "outlet", id: "id", formatViews: "formatViews", disabledDates: "disabledDates", specialDates: "specialDates", calendarFormat: "calendarFormat", value: "value", minValue: "minValue", maxValue: "maxValue", resourceStrings: "resourceStrings", readOnly: [2, "readOnly", "readOnly", B] }, outputs: { valueChange: "valueChange", validationFailed: "validationFailed" }, standalone: true, features: [fe2([{ provide: Ii, useExisting: t, multi: true }, { provide: Jo, useExisting: t, multi: true }]), le2, ne, Q], ngContentSelectors: Yse, decls: 12, vars: 17, consts: [[3, "type"], [3, "click", 4, "ngIf"], ["igxInput", "", "aria-haspopup", "dialog", "aria-autocomplete", "none", "role", "combobox", 1, "igx-date-picker__input-date", 3, "displayValuePipe", "igxDateTimeEditor", "displayFormat", "minValue", "maxValue", "spinDelta", "spinLoop", "disabled", "placeholder", "readonly", "igxTextSelection", "locale"], ["ngProjectAs", "[igxLabel]", 5, ["", "igxLabel", ""]], ["ngProjectAs", "igx-prefix", 5, ["igx-prefix"]], ["ngProjectAs", "igx-suffix", 5, ["igx-suffix"]], ["ngProjectAs", "igx-hint", 5, ["igx-hint"]], [3, "click"], ["family", "default", "name", "today", 3, "title"], ["family", "default", "name", "input_clear"]], template: function(i, r) {
+  }, inputs: { hideOutsideDays: [2, "hideOutsideDays", "hideOutsideDays", B], displayMonthsCount: "displayMonthsCount", showWeekNumbers: [2, "showWeekNumbers", "showWeekNumbers", B], formatter: "formatter", headerOrientation: "headerOrientation", todayButtonLabel: "todayButtonLabel", cancelButtonLabel: "cancelButtonLabel", spinLoop: [2, "spinLoop", "spinLoop", B], spinDelta: "spinDelta", outlet: "outlet", id: "id", formatViews: "formatViews", disabledDates: "disabledDates", specialDates: "specialDates", calendarFormat: "calendarFormat", value: "value", minValue: "minValue", maxValue: "maxValue", resourceStrings: "resourceStrings", readOnly: [2, "readOnly", "readOnly", B] }, outputs: { valueChange: "valueChange", validationFailed: "validationFailed" }, standalone: true, features: [fe2([{ provide: Ii, useExisting: t, multi: true }, { provide: Zo, useExisting: t, multi: true }]), le2, ne, Q], ngContentSelectors: Yse, decls: 12, vars: 17, consts: [[3, "type"], [3, "click", 4, "ngIf"], ["igxInput", "", "aria-haspopup", "dialog", "aria-autocomplete", "none", "role", "combobox", 1, "igx-date-picker__input-date", 3, "displayValuePipe", "igxDateTimeEditor", "displayFormat", "minValue", "maxValue", "spinDelta", "spinLoop", "disabled", "placeholder", "readonly", "igxTextSelection", "locale"], ["ngProjectAs", "[igxLabel]", 5, ["", "igxLabel", ""]], ["ngProjectAs", "igx-prefix", 5, ["igx-prefix"]], ["ngProjectAs", "igx-suffix", 5, ["igx-suffix"]], ["ngProjectAs", "igx-hint", 5, ["igx-hint"]], [3, "click"], ["family", "default", "name", "today", 3, "title"], ["family", "default", "name", "input_clear"]], template: function(i, r) {
     i & 1 && (Ee(Kse), m(0, "igx-input-group", 0), C(1, Xse, 2, 1, "igx-prefix", 1), E(2, "input", 2), C(3, Zse, 2, 0, "igx-suffix", 1), G(4, 3), ce(5), j(), G(6, 4), ce(7, 1), j(), G(8, 5), ce(9, 2), j(), G(10, 6), ce(11, 3), j(), f()), i & 2 && (p("type", r.type), u(), p("ngIf", !r.toggleComponents.length), u(), p("displayValuePipe", r.formatter ? r.displayValue : null)("igxDateTimeEditor", r.inputFormat)("displayFormat", r.displayFormat)("minValue", r.minValue)("maxValue", r.maxValue)("spinDelta", r.spinDelta)("spinLoop", r.spinLoop)("disabled", r.disabled)("placeholder", r.placeholder)("readonly", !r.isDropdown || r.readOnly)("igxTextSelection", r.isDropdown && !r.readOnly)("locale", r.locale), H("aria-expanded", !r.collapsed)("aria-labelledby", r.label == null ? null : r.label.id), u(), p("ngIf", !r.clearComponents.length && r.value));
   }, dependencies: [ae2, Kt, Ft2, me, Tt2, sn, zs, Qt], styles: ["[_nghost-%COMP%]{display:block}"] });
   let n38 = t;
@@ -26941,7 +26941,7 @@ function iae(n38, t) {
   }
 }
 var nae = 0;
-var To = (() => {
+var Eo = (() => {
   let t = class t {
     constructor(e) {
       this.differs = e, this.indentation = 30, this.cssClass = "igx-column-actions", this.columnsAreaMaxHeight = "100%", this.hideFilter = false, this.title = "", this.columnToggled = new T(), this.actionableColumns = [], this.filteredColumns = [], this.pipeTrigger = 0, this._differ = null, this._filterColumnsPrompt = "", this._filterCriteria = "", this._columnDisplayOrder = zh.DisplayOrder, this._id = `igx-column-actions-${nae++}`, this.trackChanges = (i, r) => r.field + "_" + this.actionsDirective.actionEnabledColumnsFilter(r, i, []), this._differ = this.differs.find([]).create(this.trackChanges);
@@ -27035,7 +27035,7 @@ var rae = (() => {
     }
   };
   t.\u0275fac = function(i) {
-    return new (i || t)(_(To, 16));
+    return new (i || t)(_(Eo, 16));
   }, t.\u0275pipe = Re2({ name: "columnActionEnabled", type: t, pure: true, standalone: true });
   let n38 = t;
   return n38;
@@ -27059,7 +27059,7 @@ var oae = (() => {
     }
   };
   t.\u0275fac = function(i) {
-    return new (i || t)(_(To, 16));
+    return new (i || t)(_(Eo, 16));
   }, t.\u0275pipe = Re2({ name: "filterActionColumns", type: t, pure: true, standalone: true });
   let n38 = t;
   return n38;
@@ -27116,7 +27116,7 @@ var XC = (() => {
     }
   };
   t.\u0275fac = function(i) {
-    return new (i || t)(_(To));
+    return new (i || t)(_(Eo));
   }, t.\u0275dir = U({ type: t, selectors: [["", "igxColumnHiding", ""]], standalone: true, features: [ne] });
   let n38 = t;
   return n38;
@@ -27152,7 +27152,7 @@ var ZC = (() => {
     }
   };
   t.\u0275fac = function(i) {
-    return new (i || t)(_(To));
+    return new (i || t)(_(Eo));
   }, t.\u0275dir = U({ type: t, selectors: [["", "igxColumnPinning", ""]], standalone: true, features: [ne] });
   let n38 = t;
   return n38;
@@ -27908,7 +27908,7 @@ var ft2 = (() => {
     }
   };
   t.\u0275fac = function(i) {
-    return new (i || t)(_(Ie2), _(Jo, 10), _(re), _(ye2));
+    return new (i || t)(_(Ie2), _(Zo, 10), _(re), _(ye2));
   }, t.\u0275cmp = q({ type: t, selectors: [["igx-column"]], contentQueries: function(i, r, s) {
     if (i & 1 && (de(s, JC, 5, JC), de(s, o3, 5, o3), de(s, e3, 5, e3), de(s, t3, 5, t3), de(s, n34, 5, n34), de(s, r3, 5, r3), de(s, i3, 4, i3)), i & 2) {
       let a;
@@ -28195,7 +28195,7 @@ var a3 = (() => {
   return n38 = We2([z4(2, ch())], n38), n38;
 })();
 var mF = (() => {
-  let t = class t extends Co {
+  let t = class t extends wo {
     get target() {
       return this._target;
     }
@@ -28724,7 +28724,7 @@ var fF = (() => {
   return n38;
 })();
 var _F = { igx_time_picker_ok: "OK", igx_time_picker_cancel: "Cancel", igx_time_picker_change_time: "Change Time", igx_time_picker_choose_time: "Choose Time" };
-var Ro = 7;
+var To = 7;
 var vF = (() => {
   let t = class t {
     constructor(e) {
@@ -28796,8 +28796,8 @@ var xF = (() => {
         d >= a && d <= l && (d = this.timePicker.isTwelveHourFormat ? this.toTwelveHourFormat(d) : d, r.find((g) => g === d) || r.push(d));
       }
       else r.push(0);
-      if (r.length < Ro || s < Ro || !this.timePicker.spinLoop) {
-        let c = !this.timePicker.spinLoop || r.length < Ro && s < Ro ? 6 : 3;
+      if (r.length < To || s < To || !this.timePicker.spinLoop) {
+        let c = !this.timePicker.spinLoop || r.length < To && s < To ? 6 : 3;
         for (let d = 0; d < c; d++) r.push(null);
       }
       return r;
@@ -28809,8 +28809,8 @@ var xF = (() => {
         let c = l * this.timePicker.itemsDelta.minutes;
         e.setMinutes(c), e >= i && e <= r && s.push(l * this.timePicker.itemsDelta.minutes);
       }
-      if (s.length < Ro || a < Ro || !this.timePicker.spinLoop) {
-        let l = !this.timePicker.spinLoop || s.length < Ro && a < Ro ? 6 : 3;
+      if (s.length < To || a < To || !this.timePicker.spinLoop) {
+        let l = !this.timePicker.spinLoop || s.length < To && a < To ? 6 : 3;
         for (let c = 0; c < l; c++) s.push(null);
       }
       return s;
@@ -28822,8 +28822,8 @@ var xF = (() => {
         let c = l * this.timePicker.itemsDelta.seconds;
         e.setSeconds(c), e.getTime() >= i.getTime() && e.getTime() <= r.getTime() && s.push(l * this.timePicker.itemsDelta.seconds);
       }
-      if (s.length < Ro || a < Ro || !this.timePicker.spinLoop) {
-        let l = !this.timePicker.spinLoop || s.length < Ro && a < Ro ? 6 : 3;
+      if (s.length < To || a < To || !this.timePicker.spinLoop) {
+        let l = !this.timePicker.spinLoop || s.length < To && a < To ? 6 : 3;
         for (let c = 0; c < l; c++) s.push(null);
       }
       return s;
@@ -28933,7 +28933,7 @@ function Jae(n38, t) {
 function ele(n38, t) {
   if (n38 & 1 && (m(0, "div", 30, 3), C(2, Jae, 3, 6, "span", 31), A(3, "timeItemPipe"), f()), n38 & 2) {
     let o = h();
-    p("igxItemList", "hourList"), u(2), p("ngForOf", ge2(3, 2, Ko(8, Gae, o.hourItems, o.selectedDate, o.minDropdownValue, o.maxDropdownValue)));
+    p("igxItemList", "hourList"), u(2), p("ngForOf", ge2(3, 2, Qo(8, Gae, o.hourItems, o.selectedDate, o.minDropdownValue, o.maxDropdownValue)));
   }
 }
 function tle(n38, t) {
@@ -28945,7 +28945,7 @@ function tle(n38, t) {
 function ile(n38, t) {
   if (n38 & 1 && (m(0, "div", 30, 5), C(2, tle, 3, 6, "span", 33), A(3, "timeItemPipe"), f()), n38 & 2) {
     let o = h();
-    p("igxItemList", "minuteList"), u(2), p("ngForOf", ge2(3, 2, Ko(8, jae, o.minuteItems, o.selectedDate, o.minDropdownValue, o.maxDropdownValue)));
+    p("igxItemList", "minuteList"), u(2), p("ngForOf", ge2(3, 2, Qo(8, jae, o.minuteItems, o.selectedDate, o.minDropdownValue, o.maxDropdownValue)));
   }
 }
 function nle(n38, t) {
@@ -28957,7 +28957,7 @@ function nle(n38, t) {
 function rle(n38, t) {
   if (n38 & 1 && (m(0, "div", 30, 6), C(2, nle, 3, 6, "span", 35), A(3, "timeItemPipe"), f()), n38 & 2) {
     let o = h();
-    p("igxItemList", "secondsList"), u(2), p("ngForOf", ge2(3, 2, Ko(8, $ae, o.secondsItems, o.selectedDate, o.minDropdownValue, o.maxDropdownValue)));
+    p("igxItemList", "secondsList"), u(2), p("ngForOf", ge2(3, 2, Qo(8, $ae, o.secondsItems, o.selectedDate, o.minDropdownValue, o.maxDropdownValue)));
   }
 }
 function ole(n38, t) {
@@ -28969,7 +28969,7 @@ function ole(n38, t) {
 function sle(n38, t) {
   if (n38 & 1 && (m(0, "div", 30, 7), C(2, ole, 3, 6, "span", 37), A(3, "timeItemPipe"), f()), n38 & 2) {
     let o = h();
-    p("igxItemList", "ampmList"), u(2), p("ngForOf", ge2(3, 2, Ko(8, Uae, o.ampmItems, o.selectedDate, o.minDropdownValue, o.maxDropdownValue)));
+    p("igxItemList", "ampmList"), u(2), p("ngForOf", ge2(3, 2, Qo(8, Uae, o.ampmItems, o.selectedDate, o.minDropdownValue, o.maxDropdownValue)));
   }
 }
 function ale(n38, t) {
@@ -29343,7 +29343,7 @@ var Br = (() => {
     i & 1 && S("keydown", function(a) {
       return r.onKeyDown(a);
     }), i & 2 && H("id", r.id);
-  }, inputs: { id: "id", displayFormat: "displayFormat", inputFormat: "inputFormat", mode: "mode", minValue: "minValue", maxValue: "maxValue", spinLoop: [2, "spinLoop", "spinLoop", B], formatter: "formatter", headerOrientation: "headerOrientation", readOnly: [2, "readOnly", "readOnly", B], value: "value", resourceStrings: "resourceStrings", okButtonLabel: "okButtonLabel", cancelButtonLabel: "cancelButtonLabel", itemsDelta: "itemsDelta" }, outputs: { selected: "selected", valueChange: "valueChange", validationFailed: "validationFailed" }, standalone: true, features: [fe2([{ provide: Ii, useExisting: t, multi: true }, { provide: Wl, useExisting: t }, { provide: Jo, useExisting: t, multi: true }]), le2, ne, Q], ngContentSelectors: Bae, decls: 26, vars: 27, consts: [["inputGroup", ""], ["defaultTimePickerActions", ""], ["toggleDirective", "toggle"], ["hourList", ""], ["timeItem", "timeItem"], ["minuteList", ""], ["secondsList", ""], ["ampmList", ""], [3, "type"], ["igxInput", "", "type", "text", "defaultFormatType", "time", "role", "combobox", "aria-haspopup", "dialog", 3, "click", "displayValuePipe", "igxDateTimeEditor", "readonly", "minValue", "maxValue", "locale", "spinDelta", "spinLoop", "placeholder", "disabled", "displayFormat", "igxTextSelection"], [3, "click", 4, "ngIf"], ["ngProjectAs", "[igxLabel]", 5, ["", "igxLabel", ""]], ["ngProjectAs", "igx-prefix", 5, ["igx-prefix"]], ["ngProjectAs", "igx-suffix", 5, ["igx-suffix"]], ["ngProjectAs", "igx-hint", 5, ["igx-hint"]], ["igxToggle", "", "role", "dialog", 1, "igx-time-picker", 3, "ngClass"], [1, "igx-time-picker__main"], ["class", "igx-time-picker__header", 4, "ngIf"], [1, "igx-time-picker__body"], [3, "igxItemList", 4, "ngIf"], [4, "ngTemplateOutlet"], [3, "click"], ["family", "default", "name", "clock", 3, "title"], ["family", "default", "name", "input_clear"], ["class", "igx-time-picker__buttons", 4, "ngIf"], [1, "igx-time-picker__buttons"], ["type", "button", "igxButton", "flat", 3, "click", 4, "ngIf"], ["type", "button", "igxButton", "flat", 3, "click"], [1, "igx-time-picker__header"], [1, "igx-time-picker__header-hour"], [3, "igxItemList"], ["aria-label", "hour", 3, "igxTimeItem", 4, "ngFor", "ngForOf"], ["aria-label", "hour", 3, "igxTimeItem"], ["aria-label", "minutes", 3, "igxTimeItem", 4, "ngFor", "ngForOf"], ["aria-label", "minutes", 3, "igxTimeItem"], ["aria-label", "seconds", 3, "igxTimeItem", 4, "ngFor", "ngForOf"], ["aria-label", "seconds", 3, "igxTimeItem"], ["aria-label", "ampm", 3, "igxTimeItem", 4, "ngFor", "ngForOf"], ["aria-label", "ampm", 3, "igxTimeItem"]], template: function(i, r) {
+  }, inputs: { id: "id", displayFormat: "displayFormat", inputFormat: "inputFormat", mode: "mode", minValue: "minValue", maxValue: "maxValue", spinLoop: [2, "spinLoop", "spinLoop", B], formatter: "formatter", headerOrientation: "headerOrientation", readOnly: [2, "readOnly", "readOnly", B], value: "value", resourceStrings: "resourceStrings", okButtonLabel: "okButtonLabel", cancelButtonLabel: "cancelButtonLabel", itemsDelta: "itemsDelta" }, outputs: { selected: "selected", valueChange: "valueChange", validationFailed: "validationFailed" }, standalone: true, features: [fe2([{ provide: Ii, useExisting: t, multi: true }, { provide: Wl, useExisting: t }, { provide: Zo, useExisting: t, multi: true }]), le2, ne, Q], ngContentSelectors: Bae, decls: 26, vars: 27, consts: [["inputGroup", ""], ["defaultTimePickerActions", ""], ["toggleDirective", "toggle"], ["hourList", ""], ["timeItem", "timeItem"], ["minuteList", ""], ["secondsList", ""], ["ampmList", ""], [3, "type"], ["igxInput", "", "type", "text", "defaultFormatType", "time", "role", "combobox", "aria-haspopup", "dialog", 3, "click", "displayValuePipe", "igxDateTimeEditor", "readonly", "minValue", "maxValue", "locale", "spinDelta", "spinLoop", "placeholder", "disabled", "displayFormat", "igxTextSelection"], [3, "click", 4, "ngIf"], ["ngProjectAs", "[igxLabel]", 5, ["", "igxLabel", ""]], ["ngProjectAs", "igx-prefix", 5, ["igx-prefix"]], ["ngProjectAs", "igx-suffix", 5, ["igx-suffix"]], ["ngProjectAs", "igx-hint", 5, ["igx-hint"]], ["igxToggle", "", "role", "dialog", 1, "igx-time-picker", 3, "ngClass"], [1, "igx-time-picker__main"], ["class", "igx-time-picker__header", 4, "ngIf"], [1, "igx-time-picker__body"], [3, "igxItemList", 4, "ngIf"], [4, "ngTemplateOutlet"], [3, "click"], ["family", "default", "name", "clock", 3, "title"], ["family", "default", "name", "input_clear"], ["class", "igx-time-picker__buttons", 4, "ngIf"], [1, "igx-time-picker__buttons"], ["type", "button", "igxButton", "flat", 3, "click", 4, "ngIf"], ["type", "button", "igxButton", "flat", 3, "click"], [1, "igx-time-picker__header"], [1, "igx-time-picker__header-hour"], [3, "igxItemList"], ["aria-label", "hour", 3, "igxTimeItem", 4, "ngFor", "ngForOf"], ["aria-label", "hour", 3, "igxTimeItem"], ["aria-label", "minutes", 3, "igxTimeItem", 4, "ngFor", "ngForOf"], ["aria-label", "minutes", 3, "igxTimeItem"], ["aria-label", "seconds", 3, "igxTimeItem", 4, "ngFor", "ngForOf"], ["aria-label", "seconds", 3, "igxTimeItem"], ["aria-label", "ampm", 3, "igxTimeItem", 4, "ngFor", "ngForOf"], ["aria-label", "ampm", 3, "igxTimeItem"]], template: function(i, r) {
     if (i & 1) {
       let s = F();
       Ee(Hae), m(0, "igx-input-group", 8, 0)(2, "input", 9), S("click", function() {
@@ -30184,7 +30184,7 @@ var c3 = (() => {
     }
   };
   t.\u0275fac = function(i) {
-    return new (i || t)(_(re), _(Io), _(ye2), _(z), _(Zt2));
+    return new (i || t)(_(re), _(Co), _(ye2), _(z), _(Zt2));
   }, t.\u0275cmp = q({ type: t, selectors: [["igx-query-builder"]], contentQueries: function(i, r, s) {
     if (i & 1 && de(s, jg, 5), i & 2) {
       let a;
@@ -30216,7 +30216,7 @@ var c3 = (() => {
       let s = M(3);
       u(4), p("ngIf", !r.headerContent), u(4), p("ngIf", !r.rootGroup), u(7), p("ngIf", r.rootGroup), u(3), p("ngTemplateOutlet", s), u(), p("ngIf", r.contextualGroup), u(), p("ngIf", !r.contextualGroup);
     }
-  }, dependencies: [ae2, jg, st2, me, li, Ft2, Qt, us, Mr, wn, Cn, qr, He2, Ws, Kt, Tt2, Hr, Oa, Us, Br, sn, ke, Oe, Bt2, Do, on, yn, hce, tr], encapsulation: 2 });
+  }, dependencies: [ae2, jg, st2, me, li, Ft2, Qt, us, Mr, wn, Cn, qr, He2, Ws, Kt, Tt2, Hr, Oa, Us, Br, sn, ke, Oe, Bt2, bo, on, yn, hce, tr], encapsulation: 2 });
   let n38 = t;
   return n38;
 })();
@@ -30528,7 +30528,7 @@ var $g = (() => {
   t.\u0275fac = function(i) {
     return new (i || t)(_(re), _(ye2));
   }, t.\u0275cmp = q({ type: t, selectors: [["igx-excel-style-default-expression"]], viewQuery: function(i, r) {
-    if (i & 1 && (k(vce, 7, on), k(xce, 7, us), k(yce, 5, Do), k(wce, 7, Tt2)), i & 2) {
+    if (i & 1 && (k(vce, 7, on), k(xce, 7, us), k(yce, 5, bo), k(wce, 7, Tt2)), i & 2) {
       let s;
       b(s = D()) && (r.overlayOutlet = s.first), b(s = D()) && (r.dropdownConditions = s.first), b(s = D()) && (r.logicOperatorButtonGroup = s.first), b(s = D()) && (r.inputValuesDirective = s.first);
     }
@@ -30544,7 +30544,7 @@ var $g = (() => {
       }), f();
     }
     i & 2 && (p("placeholder", r.conditionsPlaceholder)("overlaySettings", r.dropDownOverlaySettings), u(3), p("ngIf", r.expressionUI.expression.condition), u(), p("ngIf", !r.expressionUI.expression.condition), u(), p("ngForOf", r.conditions), u(3), p("type", r.type)("placeholder", r.inputValuePlaceholder)("disabled", r.expressionUI.expression.condition && r.expressionUI.expression.condition.isUnary)("value", r.expressionUI.expression.searchVal), u(2), p("ngIf", !r.isSingle), u(), p("ngIf", !r.isLast));
-  }, dependencies: [us, Ft2, ae2, me, He2, Ws, Kt, Tt2, st2, Do, on, tr], encapsulation: 2 });
+  }, dependencies: [us, Ft2, ae2, me, He2, Ws, Kt, Tt2, st2, bo, on, tr], encapsulation: 2 });
   let n38 = t;
   return n38;
 })();
@@ -30686,7 +30686,7 @@ var d3 = (() => {
       }), f();
     }
     i & 2 && (p("placeholder", r.conditionsPlaceholder)("overlaySettings", r.dropDownOverlaySettings), u(3), p("ngIf", r.expressionUI.expression.condition), u(), p("ngIf", !r.expressionUI.expression.condition), u(), p("ngForOf", r.conditions), u(), p("ngIf", r.column.dataType === "date"), u(), p("ngIf", r.column.dataType === "time"), u(), p("ngIf", r.column.dataType === "dateTime"), u(), p("ngIf", !r.isSingle), u(), p("ngIf", !r.isLast));
-  }, dependencies: [us, Ft2, ae2, me, He2, Ws, Hr, Oa, Us, Br, Kt, Mr, wn, Cn, qr, Tt2, sn, st2, Do, on, tr], encapsulation: 2 });
+  }, dependencies: [us, Ft2, ae2, me, He2, Ws, Hr, Oa, Us, Br, Kt, Mr, wn, Cn, qr, Tt2, sn, st2, bo, on, tr], encapsulation: 2 });
   let n38 = t;
   return n38;
 })();
@@ -31005,7 +31005,7 @@ var IF = (() => {
     }
   }, standalone: true, features: [Q], decls: 1, vars: 1, consts: [["subMenu", ""], ["customDialog", ""], [4, "ngIf"], ["tabindex", "0", "role", "menuitem", "aria-haspopup", "true", 1, "igx-excel-filter__actions-filter", 3, "keydown", "click", "ngClass", "igxDropDownItemNavigation"], [1, "igx-excel-filter__filter-number"], ["name", "chevron_right", "family", "default"], [3, "selectionChanging", "closed", "maxHeight"], [3, "selected", "value", 4, "ngFor", "ngForOf"], [3, "selected", 4, "ngIf"], [3, "column", "filteringService", "overlayComponentId"], [3, "selected", "value"], [1, "igx-grid__filtering-dropdown-items"], ["family", "default", 3, "name"], [1, "igx-grid__filtering-dropdown-text"], [3, "selected"], ["name", "filter_list", "family", "default"]], template: function(i, r) {
     i & 1 && C(0, Xce, 13, 12, "ng-container", 2), i & 2 && p("ngIf", r.esf.column);
-  }, dependencies: [ae2, Oe, Co, me, wr, He2, yr, u3], encapsulation: 2 });
+  }, dependencies: [ae2, Oe, wo, me, wr, He2, yr, u3], encapsulation: 2 });
   let n38 = t;
   return n38;
 })();
@@ -31153,7 +31153,7 @@ var DF = (() => {
     i & 2 && X("igx-excel-filter__move", r.defaultClass);
   }, standalone: true, features: [Q], decls: 1, vars: 1, consts: [[4, "ngIf"], ["type", "button", "igxButton", "", 3, "click", "disabled"], ["family", "default", "name", "arrow_back"], ["family", "default", "name", "arrow_forward"]], template: function(i, r) {
     i & 1 && C(0, nde, 12, 5, "ng-container", 0), i & 2 && p("ngIf", r.esf.column);
-  }, dependencies: [ae2, Do, st2, me], encapsulation: 2 });
+  }, dependencies: [ae2, bo, st2, me], encapsulation: 2 });
   let n38 = t;
   return n38;
 })();
@@ -31412,7 +31412,7 @@ var g3 = (n38, t, o = 0) => Math.max(Math.min(n38, t), o);
 var Ql = (n38, t) => t ? Math.floor(100 * n38 / t) : 0;
 var TF = (n38, t) => t * n38 / 100;
 var PF = { igx_expand: "Expand", igx_collapse: "Collapse" };
-var Ao = It2({ None: "None", BiState: "BiState", Cascading: "Cascading" });
+var Ro = It2({ None: "None", BiState: "BiState", Cascading: "Cascading" });
 var pv = new Le2("IgxTreeToken");
 var Kl = new Le2("IgxTreeNodeToken");
 var Yl = (() => {
@@ -31463,7 +31463,7 @@ var Xl = (() => {
       this.emitNodeSelectionEvent(c, l, [], i);
     }
     selectNode(e, i) {
-      this.tree.selection !== Ao.None && this.emitNodeSelectionEvent([...this.getSelectedNodes(), e], [e], [], i);
+      this.tree.selection !== Ro.None && this.emitNodeSelectionEvent([...this.getSelectedNodes(), e], [e], [], i);
     }
     deselectNode(e, i) {
       let r = this.getSelectedNodes().filter((s) => s !== e);
@@ -31479,7 +31479,7 @@ var Xl = (() => {
       return this.indeterminateNodes.has(e);
     }
     selectNodesWithNoEvent(e, i = false, r = true) {
-      if (this.tree && this.tree.selection === Ao.Cascading) {
+      if (this.tree && this.tree.selection === Ro.Cascading) {
         this.cascadeSelectNodesWithNoEvent(e, i);
         return;
       }
@@ -31488,10 +31488,10 @@ var Xl = (() => {
     }
     deselectNodesWithNoEvent(e, i = true) {
       let r = this.getSelectedNodes();
-      e ? this.tree && this.tree.selection === Ao.Cascading ? this.cascadeDeselectNodesWithNoEvent(e) : e.forEach((s) => this.nodeSelection.delete(s)) : this.nodeSelection.clear(), i && this.emitSelectedChangeEvent(r);
+      e ? this.tree && this.tree.selection === Ro.Cascading ? this.cascadeDeselectNodesWithNoEvent(e) : e.forEach((s) => this.nodeSelection.delete(s)) : this.nodeSelection.clear(), i && this.emitSelectedChangeEvent(r);
     }
     ensureStateOnNodeDelete(e) {
-      this.tree?.selection === Ao.Cascading && requestAnimationFrame(() => {
+      this.tree?.selection === Ro.Cascading && requestAnimationFrame(() => {
         if (this.isNodeSelected(e)) this.deselectNodesWithNoEvent([e], false);
         else {
           if (!e.parentNode) return;
@@ -31511,7 +31511,7 @@ var Xl = (() => {
       return this.indeterminateNodes.size ? Array.from(this.indeterminateNodes) : [];
     }
     emitNodeSelectionEvent(e, i, r, s) {
-      if (this.tree.selection === Ao.Cascading) {
+      if (this.tree.selection === Ro.Cascading) {
         this.emitCascadeNodeSelectionEvent(e, i, r, s);
         return;
       }
@@ -31631,7 +31631,7 @@ var ld = (() => {
     handleKeydown(e) {
       let i = e.key.toLowerCase();
       if (this.focusedNode) {
-        if (!(es.has(i) || i === "*")) {
+        if (!(Jo.has(i) || i === "*")) {
           i === "enter" && (this.activeNode = this.focusedNode);
           return;
         }
@@ -31705,7 +31705,7 @@ var ld = (() => {
       });
     }
     handleSpace(e = false) {
-      if (this.tree.selection !== Ao.None) {
+      if (this.tree.selection !== Ro.None) {
         if (this.activeNode = this.focusedNode, e) {
           this.selectionService.selectMultipleNodes(this.focusedNode);
           return;
@@ -31832,7 +31832,7 @@ function Gde(n38, t) {
   }
   if (n38 & 2) {
     let o = h();
-    p("tabIndex", o.tabIndex)("ngClass", Ko(8, Sde, o.selected, o.active, o.focused, o.disabled)), H("role", o.role), u(3), p("ngForOf", Zi(13, kF).constructor(o.level)), u(), p("ngIf", !o.loading), u(), p("ngIf", o.loading), u(), p("ngIf", o.showSelectors), u(4), p("ngForOf", Zi(14, kF).constructor(o.level));
+    p("tabIndex", o.tabIndex)("ngClass", Qo(8, Sde, o.selected, o.active, o.focused, o.disabled)), H("role", o.role), u(3), p("ngForOf", Zi(13, kF).constructor(o.level)), u(), p("ngIf", !o.loading), u(), p("ngIf", o.loading), u(), p("ngIf", o.showSelectors), u(4), p("ngForOf", Zi(14, kF).constructor(o.level));
   }
 }
 function jde(n38, t) {
@@ -31934,7 +31934,7 @@ var hv = (() => {
       super(l), this.tree = e, this.selectionService = i, this.treeService = r, this.navService = s, this.cdr = a, this.element = c, this.parentNode = d, this.loading = false, this.selectedChange = new T(), this.expandedChange = new T(), this.cssClass = "igx-tree-node", this.registeredChildren = [], this._resourceStrings = hi(PF), this._tabIndex = null, this._disabled = false;
     }
     get showSelectors() {
-      return this.tree.selection !== Ao.None;
+      return this.tree.selection !== Ro.None;
     }
     get indeterminate() {
       return this.selectionService.isNodeIndeterminate(this);
@@ -32072,7 +32072,7 @@ var _3 = (() => {
       return this.nodes?.filter((e) => e.level === 0);
     }
     constructor(e, i, r, s) {
-      this.navService = e, this.selectionService = i, this.treeService = r, this.element = s, this.cssClass = "igx-tree", this.singleBranchExpand = false, this.toggleNodeOnClick = false, this.animationSettings = { openAnimation: Ta, closeAnimation: Ra }, this.nodeSelection = new T(), this.nodeExpanding = new T(), this.nodeExpanded = new T(), this.nodeCollapsing = new T(), this.nodeCollapsed = new T(), this.activeNodeChanged = new T(), this.disabledChange = new T(), this.activeNodeBindingChange = new T(), this.forceSelect = [], this.resizeNotify = new ue2(), this._selection = Ao.None, this.destroy$ = new ue2(), this.unsubChildren$ = new ue2(), this._comparer = (a, l) => l.data === a, this.selectionService.register(this), this.treeService.register(this), this.navService.register(this);
+      this.navService = e, this.selectionService = i, this.treeService = r, this.element = s, this.cssClass = "igx-tree", this.singleBranchExpand = false, this.toggleNodeOnClick = false, this.animationSettings = { openAnimation: Ta, closeAnimation: Ra }, this.nodeSelection = new T(), this.nodeExpanding = new T(), this.nodeExpanded = new T(), this.nodeCollapsing = new T(), this.nodeCollapsed = new T(), this.activeNodeChanged = new T(), this.disabledChange = new T(), this.activeNodeBindingChange = new T(), this.forceSelect = [], this.resizeNotify = new ue2(), this._selection = Ro.None, this.destroy$ = new ue2(), this.unsubChildren$ = new ue2(), this._comparer = (a, l) => l.data === a, this.selectionService.register(this), this.treeService.register(this), this.navService.register(this);
     }
     get nativeElement() {
       return this.element.nativeElement;
@@ -32098,7 +32098,7 @@ var _3 = (() => {
         this.navService.update_disabled_cache(e);
       }), this.activeNodeBindingChange.pipe(K(this.destroy$)).subscribe((e) => {
         this.expandToNode(this.navService.activeNode), this.scrollNodeIntoView(e?.header?.nativeElement);
-      }), this.subToCollapsing(), this.resizeNotify.pipe(Bo(40, null, { trailing: true }), K(this.destroy$)).subscribe(() => {
+      }), this.subToCollapsing(), this.resizeNotify.pipe(Ho(40, null, { trailing: true }), K(this.destroy$)).subscribe(() => {
         requestAnimationFrame(() => {
           this.scrollNodeIntoView(this.navService.activeNode?.header.nativeElement);
         });
@@ -33118,7 +33118,7 @@ var OF = (() => {
   t.\u0275fac = function(i) {
     return new (i || t)(_(Ji), _(re));
   }, t.\u0275cmp = q({ type: t, selectors: [["igx-excel-style-sorting"]], viewQuery: function(i, r) {
-    if (i & 1 && k(ope, 5, Do), i & 2) {
+    if (i & 1 && k(ope, 5, bo), i & 2) {
       let s;
       b(s = D()) && (r.sortButtonGroup = s.first);
     }
@@ -33126,7 +33126,7 @@ var OF = (() => {
     i & 2 && X("igx-excel-filter__sort", r.defaultClass);
   }, standalone: true, features: [Q], decls: 1, vars: 1, consts: [["sortButtonGroup", ""], [4, "ngIf"], ["type", "button", "igxButton", "", 3, "buttonSelected"], ["family", "default", "name", "sort_asc"], ["family", "default", "name", "sort_desc"]], template: function(i, r) {
     i & 1 && C(0, spe, 13, 5, "ng-container", 1), i & 2 && p("ngIf", r.esf.column);
-  }, dependencies: [ae2, Do, st2, me], encapsulation: 2 });
+  }, dependencies: [ae2, bo, st2, me], encapsulation: 2 });
   let n38 = t;
   return n38;
 })();
@@ -33285,7 +33285,9 @@ var qs = (() => {
       });
     }
     renderValues() {
-      this.filterValues = this.generateFilterValues(), this.generateListData();
+      this.filterValues = this.generateFilterValues(), this.generateListData(), this.expressionsList.forEach((e) => {
+        this.column.dataType === ie.String && this.column.filteringIgnoreCase && e.expression.searchVal && this.modifyExpression(e);
+      });
     }
     generateFilterValues() {
       let e = (s) => {
@@ -33303,6 +33305,12 @@ var qs = (() => {
       }, i = (s, a) => a.expression.condition.name === "in" ? [...s, ...Array.from(a.expression.searchVal.values()).map((l) => e(l))] : [...s, e(a.expression.searchVal)];
       return new Set(this.expressionsList.reduce(i, []));
     }
+    modifyExpression(e) {
+      let i = new Set(Array.from(e.expression.searchVal).map((r) => r.toLowerCase()));
+      this.grid.data.forEach((r) => {
+        i.has(r[this.column.field]?.toLowerCase()) && e.expression.searchVal.add(r[this.column.field]);
+      });
+    }
     generateListData() {
       this.listData = new Array();
       let e = this.areExpressionsSelectable();
@@ -33715,7 +33723,7 @@ var Jl = (() => {
   let n38 = t;
   return n38;
 })();
-var Po = (() => {
+var Ao = (() => {
   let t = class t {
     transform(e, i, r) {
       let s = {};
@@ -33903,9 +33911,6 @@ var Yg = (() => {
     get selectedStyle() {
       return this.selected;
     }
-    get height() {
-      return !this.grid.hasColumnGroups || this.grid.type === "pivot" ? null : (this.grid.maxLevelHeaderDepth + 1 - this.column.level) * this.grid.defaultRowHeight / this.grid._baseFontSize;
-    }
     get esfIconTemplate() {
       return this.grid.excelStyleHeaderIconTemplate || this.defaultESFHeaderIconTemplate;
     }
@@ -33992,14 +33997,14 @@ var Yg = (() => {
       let s;
       b(s = D()) && (r.defaultESFHeaderIconTemplate = s.first), b(s = D()) && (r.defaultSortHeaderIconTemplate = s.first), b(s = D()) && (r.sortIconContainer = s.first);
     }
-  }, hostVars: 21, hostBindings: function(i, r) {
+  }, hostVars: 19, hostBindings: function(i, r) {
     i & 1 && S("click", function(a) {
       return r.onClick(a);
     })("pointerenter", function() {
       return r.onPinterEnter();
     })("pointerleave", function() {
       return r.onPointerLeave();
-    }), i & 2 && (H("aria-selected", r.ariaSelected), N("height", r.height, "rem"), X("igx-grid-th", r.columnGroupStyle)("asc", r.sortAscendingStyle)("desc", r.sortDescendingStyle)("igx-grid-th--number", r.numberStyle)("igx-grid-th--sortable", r.sortableStyle)("igx-grid-th--selectable", r.selectableStyle)("igx-grid-th--filtrable", r.filterableStyle)("igx-grid-th--sorted", r.sortedStyle)("igx-grid-th--selected", r.selectedStyle));
+    }), i & 2 && (H("aria-selected", r.ariaSelected), X("igx-grid-th", r.columnGroupStyle)("asc", r.sortAscendingStyle)("desc", r.sortDescendingStyle)("igx-grid-th--number", r.numberStyle)("igx-grid-th--sortable", r.sortableStyle)("igx-grid-th--selectable", r.selectableStyle)("igx-grid-th--filtrable", r.filterableStyle)("igx-grid-th--sorted", r.sortedStyle)("igx-grid-th--selected", r.selectedStyle));
   }, inputs: { column: "column" }, standalone: true, features: [Q], decls: 9, vars: 6, consts: [["defaultColumn", ""], ["defaultESFHeaderIconTemplate", ""], ["defaultSortHeaderIconTemplate", ""], ["sortIconContainer", ""], [1, "igx-grid-th__title"], [4, "ngTemplateOutlet", "ngTemplateOutletContext"], [4, "ngIf"], [3, "title"], ["family", "default", "name", "more_vert"], ["family", "default", 3, "name"], [1, "igx-grid-th__icons"], [1, "sort-icon", 3, "pointerdown", "click"], [3, "pointerdown", "click", "ngClass"]], template: function(i, r) {
     if (i & 1 && (C(0, Epe, 2, 2, "ng-template", null, 0, O)(2, Tpe, 1, 0, "ng-template", null, 1, O)(4, Rpe, 1, 1, "ng-template", null, 2, O), m(6, "span", 4), C(7, Ape, 1, 0, "ng-container", 5), f(), C(8, Vpe, 4, 2, "ng-container", 6)), i & 2) {
       let s = M(1);
@@ -34204,7 +34209,7 @@ var Wt2 = (() => {
     }
   };
   t.\u0275fac = function(i) {
-    return new (i || t)(we2(Io), we2(pi));
+    return new (i || t)(we2(Co), we2(pi));
   }, t.\u0275prov = he2({ token: t, factory: t.\u0275fac });
   let n38 = t;
   return n38;
@@ -34370,7 +34375,7 @@ var C3 = (() => {
   t.\u0275fac = function(i) {
     return new (i || t)(_(re), _(Wt2));
   }, t.\u0275cmp = q({ type: t, selectors: [["igx-grid-filtering-cell"]], viewQuery: function(i, r) {
-    if (i & 1 && (k(Ope, 7, ee2), k(Npe, 7, ee2), k(Lpe, 7, ee2), k(Hpe, 5, Eo), k(Bpe, 5, z), k(zpe, 5, li), k(Gpe, 5, li)), i & 2) {
+    if (i & 1 && (k(Ope, 7, ee2), k(Npe, 7, ee2), k(Lpe, 7, ee2), k(Hpe, 5, Do), k(Bpe, 5, z), k(zpe, 5, li), k(Gpe, 5, li)), i & 2) {
       let s;
       b(s = D()) && (r.emptyFilter = s.first), b(s = D()) && (r.defaultFilter = s.first), b(s = D()) && (r.complexFilter = s.first), b(s = D()) && (r.chipsArea = s.first), b(s = D()) && (r.moreIcon = s.first), b(s = D()) && (r.ghostChip = s.first), b(s = D()) && (r.complexChip = s.first);
     }
@@ -34378,7 +34383,7 @@ var C3 = (() => {
     i & 2 && ui(r.styleClasses);
   }, inputs: { column: "column" }, standalone: true, features: [Q], decls: 7, vars: 2, consts: [["emptyFilter", ""], ["defaultFilter", ""], ["complexFilter", ""], ["ghostChip", ""], ["chipsArea", ""], ["moreIcon", ""], ["label", ""], ["complexChip", ""], [4, "ngTemplateOutlet", "ngTemplateOutletContext"], [1, "igx-filtering-chips"], [3, "click", "tabIndex"], ["igxPrefix", "", "family", "default", "name", "filter_list"], [4, "ngFor", "ngForOf"], [3, "click", "ngClass"], ["family", "default", "name", "filter_list"], [3, "value"], [3, "removable", "tabIndex", "--ig-size", "click", "remove", 4, "ngIf"], ["class", "igx-filtering-chips__connector", 4, "ngIf"], [3, "click", "remove", "removable", "tabIndex"], ["igxPrefix", "", "family", "default", 3, "name"], [1, "igx-filtering-chips__connector"], [3, "remove", "removable", "tabIndex"]], template: function(i, r) {
     i & 1 && C(0, jpe, 6, 8, "ng-template", null, 0, O)(2, qpe, 7, 3, "ng-template", null, 1, O)(4, Qpe, 5, 5, "ng-template", null, 2, O)(6, Kpe, 1, 0, "ng-container", 8), i & 2 && (u(6), p("ngTemplateOutlet", r.template)("ngTemplateOutletContext", r.context));
-  }, dependencies: [Eo, li, me, Ft2, He2, ae2, Oe, mp, ke], encapsulation: 2, changeDetection: 0 });
+  }, dependencies: [Do, li, me, Ft2, He2, ae2, Oe, mp, ke], encapsulation: 2, changeDetection: 0 });
   let n38 = t;
   return n38;
 })();
@@ -34771,7 +34776,7 @@ var Ba = (() => {
     }), i & 2 && (H("id", r.headerID), N("grid-row-end", r.rowEnd)("grid-column-end", r.colEnd)("grid-row-start", r.rowStart)("grid-column-start", r.colStart)("z-index", r.zIndex)("display", r.groupDisplayStyle), X("igx-grid-th--active", r.active)("igx-grid-thead__item", r.defaultCss)("igx-grid-th--pinned", r.pinnedCss)("igx-grid-th--pinned-last", r.pinnedLastCss)("igx-grid-th--pinned-first", r.pinnedFirstCSS)("igx-grid__drag-col-header", r.headerDragCss)("igx-grid-th--filtering", r.filteringCss));
   }, inputs: { column: "column" }, standalone: true, features: [Q], decls: 7, vars: 3, consts: [["defaultColumn", ""], ["defaultCollapseIndicator", ""], [4, "ngIf"], ["class", "igx-grid-th__drop-indicator-left", 4, "ngIf"], [1, "igx-grid-thead__group", "igx-grid__mrl-block", 3, "ngClass", "ngStyle"], [4, "ngFor", "ngForOf"], ["class", "igx-grid-th__drop-indicator-right", 4, "ngIf"], [1, "igx-grid-th__drop-indicator-left"], ["class", "igx-grid-thead__subgroup", 3, "ngClass", "ngStyle", "column", 4, "ngIf"], [1, "igx-grid-thead__subgroup", 3, "ngClass", "ngStyle", "column"], [1, "igx-grid-th__drop-indicator-right"], [1, "igx-grid-th__group-title", 3, "title"], ["family", "default", 3, "name"], ["role", "columnheader", 1, "igx-grid-thead__title", 3, "pointerdown", "click", "pointerenter", "pointerleave", "ngClass", "igxColumnMovingDrag", "ghostHost", "igxColumnMovingDrop"], [4, "ngTemplateOutlet", "ngTemplateOutletContext"], ["class", "igx-grid-thead__group", 4, "ngIf"], [1, "igx-grid-th__expander", 3, "pointerdown", "click"], [1, "igx-grid-thead__group"], ["class", "igx-grid-thead__subgroup", 3, "ngClass", "ngStyle", "column", "min-width", "flex-basis", 4, "ngIf"], ["role", "columnheader", 1, "igx-grid-th--fw", 3, "pointerdown", "id", "ngClass", "ngStyle", "igxColumnMovingDrag", "ghostHost", "igxColumnMovingDrop", "column"], [3, "column", 4, "ngIf"], ["class", "igx-grid-th__resize-handle", 3, "igxResizeHandle", "cursor", 4, "ngIf"], [3, "column"], [1, "igx-grid-th__resize-handle", 3, "igxResizeHandle"]], template: function(i, r) {
     i & 1 && C(0, nhe, 5, 11, "ng-container", 2)(1, rhe, 2, 2, "ng-template", null, 0, O)(3, ohe, 1, 1, "ng-template", null, 1, O)(5, ghe, 7, 24, "ng-container", 2)(6, xhe, 7, 16, "ng-container", 2), i & 2 && (p("ngIf", r.grid.hasColumnLayouts && r.column.columnGroup), u(5), p("ngIf", !r.grid.hasColumnLayouts && r.column.columnGroup), u(), p("ngIf", !r.column.columnGroup));
-  }, dependencies: [t, ae2, Oe, ri, He2, to, rr, me, ke, Yg, C3, vv, Jl, Po], encapsulation: 2, changeDetection: 0 });
+  }, dependencies: [t, ae2, Oe, ri, He2, to, rr, me, ke, Yg, C3, vv, Jl, Ao], encapsulation: 2, changeDetection: 0 });
   let n38 = t;
   return n38;
 })();
@@ -35433,7 +35438,7 @@ var I3 = (() => {
   t.\u0275fac = function(i) {
     return new (i || t)(_(Wt2), _(z), _(re), _(ye2));
   }, t.\u0275cmp = q({ type: t, selectors: [["igx-grid-filtering-row"]], viewQuery: function(i, r) {
-    if (i & 1 && (k(whe, 7, ee2), k(Che, 7, ee2), k(Ihe, 7, ee2), k(She, 7, ee2), k(bhe, 5, z), k(Dhe, 7, wr), k(Ehe, 7, Eo), k(The, 5, z), k(Rhe, 5), k(Ahe, 5, z), k(Phe, 7), k(Mhe, 5), k(khe, 7), k(Fhe, 5, wr)), i & 2) {
+    if (i & 1 && (k(whe, 7, ee2), k(Che, 7, ee2), k(Ihe, 7, ee2), k(She, 7, ee2), k(bhe, 5, z), k(Dhe, 7, wr), k(Ehe, 7, Do), k(The, 5, z), k(Rhe, 5), k(Ahe, 5, z), k(Phe, 7), k(Mhe, 5), k(khe, 7), k(Fhe, 5, wr)), i & 2) {
       let s;
       b(s = D()) && (r.defaultFilterUI = s.first), b(s = D()) && (r.defaultDateUI = s.first), b(s = D()) && (r.defaultTimeUI = s.first), b(s = D()) && (r.defaultDateTimeUI = s.first), b(s = D()) && (r.input = s.first), b(s = D()) && (r.dropDownConditions = s.first), b(s = D()) && (r.chipsArea = s.first), b(s = D()) && (r.inputGroup = s.first), b(s = D()) && (r.picker = s.first), b(s = D()) && (r.inputGroupPrefix = s.first), b(s = D()) && (r.container = s.first), b(s = D()) && (r.operand = s.first), b(s = D()) && (r.closeButton = s.first), b(s = D()) && (r.dropDownOperators = s);
     }
@@ -35449,7 +35454,7 @@ var I3 = (() => {
       }), C(2, Ohe, 5, 4, "igx-drop-down-item", 16), f(), C(3, Lhe, 8, 9, "ng-template", null, 1, O)(5, Bhe, 8, 11, "ng-template", null, 2, O)(7, Ghe, 8, 13, "ng-template", null, 3, O)(9, $he, 8, 11, "ng-template", null, 4, O)(11, Uhe, 1, 0, "ng-container", 17)(12, Whe, 2, 0, "button", 18), m(13, "div", 19, 5)(15, "div")(16, "igx-chips-area", null, 6), C(18, Qhe, 7, 8, "ng-container", 20), f()()(), C(19, Khe, 2, 0, "button", 21), m(20, "div", 22, 7), C(22, Yhe, 10, 8, "ng-container", 23)(23, Xhe, 6, 6, "ng-container", 23), f();
     }
     i & 2 && (N("--ig-size", r.filteringElementsSize), p("height", "200px"), u(2), p("ngForOf", r.conditions), u(9), p("ngTemplateOutlet", r.template)("ngTemplateOutletContext", Ve2(12, Vhe, r)), u(), p("ngIf", r.showArrows), u(6), p("ngForOf", r.expressionsList), u(), p("ngIf", r.showArrows), u(), p("ngClass", r.isNarrowWidth ? "igx-grid__filtering-row-editing-buttons--small" : "igx-grid__filtering-row-editing-buttons"), u(2), p("ngIf", !r.isNarrowWidth), u(), p("ngIf", r.isNarrowWidth));
-  }, dependencies: [He2, wr, yr, Eo, li, me, Kt, Ft2, Co, Tt2, ae2, Qt, Hr, Oa, Us, Br, sn, ke, st2, Oe, bi, tr], encapsulation: 2, changeDetection: 0 });
+  }, dependencies: [He2, wr, yr, Do, li, me, Kt, Ft2, wo, Tt2, ae2, Qt, Hr, Oa, Us, Br, sn, ke, st2, Oe, bi, tr], encapsulation: 2, changeDetection: 0 });
   let n38 = t;
   return n38;
 })();
@@ -35522,7 +35527,7 @@ var Xg = class {
   update(t) {
     let o = this.grid.crudService;
     o.cellInEditMode && o.cell.id.rowID === this.key && this.grid.transactions.endPending(false);
-    let e = new So(this.key, this.index, this.data, this.grid);
+    let e = new Io(this.key, this.index, this.data, this.grid);
     this.grid.gridAPI.update_row(e, t), this.grid.notifyChanges();
   }
   delete() {
@@ -36152,7 +36157,7 @@ var jr = (() => {
       }), m(1, "div", 10), C(2, age, 2, 3, "ng-container", 11)(3, lge, 2, 3, "ng-container", 11)(4, dge, 5, 3, "ng-container", 11)(5, pge, 4, 4, "ng-container", 11)(6, gge, 4, 10, "ng-container", 11)(7, fge, 4, 7, "ng-container", 11)(8, vge, 3, 3, "ng-container", 11)(9, xge, 4, 19, "ng-template", 12, 0, O), A(11, "igxTopLevel"), C(12, wge, 3, 3, "ng-container", 11), f(), C(13, Cge, 3, 3, "ng-container", 11)(14, Ige, 2, 1, "ng-container", 11), f(), E(15, "div", 13), C(16, Sge, 3, 9, "ng-template", 14, 1, O);
     }
     i & 2 && (N("width", r.width, "px"), X("igx-grid__tr--mrl", r.hasMRL), u(), N("width", r.width, "px"), u(), p("ngIf", r.grid.moving && r.grid.columnInDrag && r.pinnedColumnCollection.length <= 0), u(), p("ngIf", r.grid.moving && r.grid.columnInDrag && r.pinnedColumnCollection.length > 0), u(), p("ngIf", r.grid.rowDraggable), u(), p("ngIf", r.grid.showRowSelectors), u(), p("ngIf", r.isHierarchicalGrid), u(), p("ngIf", r.grid == null || r.grid.groupingExpressions == null ? null : r.grid.groupingExpressions.length), u(), p("ngIf", r.pinnedColumnCollection.length && r.grid.isPinningToStart), u(), p("igxGridForOf", ot2(11, 25, r.unpinnedColumnCollection))("igxForScrollContainer", r.grid.parentVirtDir)("igxForContainerSize", r.grid.unpinnedWidth)("igxForTrackBy", r.grid.trackColumnChanges)("igxForSizePropName", "calcPixelWidth")("igxForScrollOrientation", "horizontal"), u(3), p("ngIf", r.pinnedColumnCollection.length && !r.grid.isPinningToStart), u(), p("ngIf", r.grid.filteringService.isFilterRowVisible), u(), p("ngIf", r.grid.moving && r.grid.columnInDrag), u(), N("width", r.grid.scrollSize, "px"), p("hidden", !r.grid.hasVerticalScroll()));
-  }, dependencies: [ae2, rr, ke, Oe, He2, Ba, ri, jt2, I3, $t, Ep, Jl, Po], encapsulation: 2, changeDetection: 0 });
+  }, dependencies: [ae2, rr, ke, Oe, He2, Ba, ri, jt2, I3, $t, Ep, Jl, Ao], encapsulation: 2, changeDetection: 0 });
   let n38 = t;
   return n38;
 })();
@@ -36307,7 +36312,7 @@ var JF = (() => {
   return n38;
 })();
 var $r = {};
-p4($r, { CSSResult: () => dd, LitElement: () => Ys, ReactiveElement: () => Mo, UpdatingElement: () => rV, _$LE: () => oV, adoptStyles: () => Jg, css: () => b3, defaultConverter: () => em, getCompatibleStyle: () => kp, notEqual: () => Iv, supportsAdoptingStyleSheets: () => Pp, unsafeCSS: () => Mp });
+p4($r, { CSSResult: () => dd, LitElement: () => Ys, ReactiveElement: () => Po, UpdatingElement: () => rV, _$LE: () => oV, adoptStyles: () => Jg, css: () => b3, defaultConverter: () => em, getCompatibleStyle: () => kp, notEqual: () => Iv, supportsAdoptingStyleSheets: () => Pp, unsafeCSS: () => Mp });
 var wv = window;
 var Pp = wv.ShadowRoot && (wv.ShadyCSS === void 0 || wv.ShadyCSS.nativeShadow) && "adoptedStyleSheets" in Document.prototype && "replace" in CSSStyleSheet.prototype;
 var S3 = Symbol();
@@ -36386,7 +36391,7 @@ var em = { toAttribute(n38, t) {
 var Iv = (n38, t) => t !== n38 && (t == t || n38 == n38);
 var E3 = { attribute: true, type: String, converter: em, reflect: false, hasChanged: Iv };
 var T3 = "finalized";
-var Mo = class extends HTMLElement {
+var Po = class extends HTMLElement {
   constructor() {
     super(), this._$Ei = /* @__PURE__ */ new Map(), this.isUpdatePending = false, this.hasUpdated = false, this._$El = null, this._$Eu();
   }
@@ -36561,14 +36566,14 @@ var Mo = class extends HTMLElement {
   firstUpdated(t) {
   }
 };
-Mo[T3] = true, Mo.elementProperties = /* @__PURE__ */ new Map(), Mo.elementStyles = [], Mo.shadowRootOptions = { mode: "open" }, iV?.({ ReactiveElement: Mo }), ((D3 = Cv.reactiveElementVersions) !== null && D3 !== void 0 ? D3 : Cv.reactiveElementVersions = []).push("1.6.3");
+Po[T3] = true, Po.elementProperties = /* @__PURE__ */ new Map(), Po.elementStyles = [], Po.shadowRootOptions = { mode: "open" }, iV?.({ ReactiveElement: Po }), ((D3 = Cv.reactiveElementVersions) !== null && D3 !== void 0 ? D3 : Cv.reactiveElementVersions = []).push("1.6.3");
 var $i = {};
-p4($i, { CSSResult: () => dd, LitElement: () => Ys, ReactiveElement: () => Mo, UpdatingElement: () => rV, _$LE: () => oV, adoptStyles: () => Jg, css: () => b3, defaultConverter: () => em, getCompatibleStyle: () => kp, notEqual: () => Iv, supportsAdoptingStyleSheets: () => Pp, unsafeCSS: () => Mp });
+p4($i, { CSSResult: () => dd, LitElement: () => Ys, ReactiveElement: () => Po, UpdatingElement: () => rV, _$LE: () => oV, adoptStyles: () => Jg, css: () => b3, defaultConverter: () => em, getCompatibleStyle: () => kp, notEqual: () => Iv, supportsAdoptingStyleSheets: () => Pp, unsafeCSS: () => Mp });
 gi($i, Uxt);
 var R3;
 var A3;
-var rV = Mo;
-var Ys = class extends Mo {
+var rV = Po;
+var Ys = class extends Po {
   constructor() {
     super(...arguments), this.renderOptions = { host: this }, this._$Do = void 0;
   }
@@ -36665,7 +36670,7 @@ var bv = class extends Li {
   }
   position(t, o, e, i, r) {
     let s = this.settings.container, a = r;
-    this.isTop = this.isTopInitialPosition !== null ? this.isTopInitialPosition : s.getBoundingClientRect().bottom < a.getBoundingClientRect().bottom + t.getBoundingClientRect().height, t.style.width = a.clientWidth + "px", this.settings.verticalStartPoint = this.settings.verticalDirection = this.isTop ? Ge2.Top : Ge2.Bottom, this.settings.openAnimation = this.isTop ? Aa : wo, super.position(t, { width: a.clientWidth, height: a.clientHeight }, e, i, a);
+    this.isTop = this.isTopInitialPosition !== null ? this.isTopInitialPosition : s.getBoundingClientRect().bottom < a.getBoundingClientRect().bottom + t.getBoundingClientRect().height, t.style.width = a.clientWidth + "px", this.settings.verticalStartPoint = this.settings.verticalDirection = this.isTop ? Ge2.Top : Ge2.Bottom, this.settings.openAnimation = this.isTop ? Aa : yo, super.position(t, { width: a.clientWidth, height: a.clientHeight }, e, i, a);
   }
 };
 var kn = class {
@@ -37215,7 +37220,7 @@ var Tv = (() => {
       let s = M(5);
       u(), p("ngForOf", r.chipExpressions), u(), p("hidden", !r.dropAreaVisible), H("gridId", r.grid.id), u(), p("ngTemplateOutlet", r.dropAreaTemplate || s);
     }
-  }, dependencies: [Eo, He2, li, me, Qt, mv, Or, ke, gv], encapsulation: 2 });
+  }, dependencies: [Do, He2, li, me, Qt, mv, Or, ke, gv], encapsulation: 2 });
   let n38 = t;
   return n38;
 })();
@@ -37328,13 +37333,13 @@ var Ur = (() => {
     }
     handleNavigation(e) {
       let i = e.key.toLowerCase();
-      es.has(i) && e.stopPropagation(), !(this.grid.crudService.cell && es.has(i)) && ((e.repeat && Nh.has(i) || i === "tab" && this.grid.crudService.cell) && e.preventDefault(), e.repeat ? setTimeout(() => this.dispatchEvent(e), 1) : this.dispatchEvent(e));
+      Jo.has(i) && e.stopPropagation(), !(this.grid.crudService.cell && Jo.has(i)) && ((e.repeat && Nh.has(i) || i === "tab" && this.grid.crudService.cell) && e.preventDefault(), e.repeat ? setTimeout(() => this.dispatchEvent(e), 1) : this.dispatchEvent(e));
     }
     dispatchEvent(e) {
       let i = e.key.toLowerCase(), r = this.grid.crudService.cell || this.grid.crudService.row;
       if (!this.activeNode || !(Nh.has(i) || i === "tab" && r)) return;
       let s = e.shiftKey, a = e.ctrlKey;
-      if (es.has(i) && this.pendingNavigation) {
+      if (Jo.has(i) && this.pendingNavigation) {
         e.preventDefault();
         return;
       }
@@ -37346,7 +37351,7 @@ var Ur = (() => {
       }
       [" ", "spacebar", "space"].indexOf(i) === -1 && this.grid.selectionService.keyboardStateOnKeydown(this.activeNode, s, s && i === "tab");
       let c = this.getNextPosition(this.activeNode.row, this.activeNode.column, i, s, a, e);
-      es.has(i) && (e.preventDefault(), this.navigateInBody(c.rowIndex, c.colIndex, (d) => {
+      Jo.has(i) && (e.preventDefault(), this.navigateInBody(c.rowIndex, c.colIndex, (d) => {
         d.target.activate(e), this.grid.cdr.detectChanges();
       })), this.grid.cdr.detectChanges();
     }
@@ -37620,7 +37625,7 @@ var Ur = (() => {
         this.handleMCHExpandCollapse(i, e);
         return;
       }
-      if ([" ", "spacebar", "space"].indexOf(i) !== -1 && this.handleColumnSelection(e, l), a && (i === "l" || i === "\xAC") && this.grid.allowAdvancedFiltering && this.grid.openAdvancedFilteringDialog(), s && r && i === "l" && this.grid.allowFiltering && !e.columnGroup && e.filterable) if (this.grid.filterMode === yo.excelStyleFilter) {
+      if ([" ", "spacebar", "space"].indexOf(i) !== -1 && this.handleColumnSelection(e, l), a && (i === "l" || i === "\xAC") && this.grid.allowAdvancedFiltering && this.grid.openAdvancedFilteringDialog(), s && r && i === "l" && this.grid.allowFiltering && !e.columnGroup && e.filterable) if (this.grid.filterMode === ts.excelStyleFilter) {
         let d = this.grid.headerGroups.find((g) => g.active).nativeElement;
         this.grid.filteringService.toggleFilterDropdown(d, e);
       } else this.performHorizontalScrollToCell(e.visibleIndex), this.grid.filteringService.filteredColumn = e, this.grid.filteringService.isFilterRowVisible = true;
@@ -38080,7 +38085,7 @@ var dc = (() => {
       return this._allowFiltering;
     }
     set allowFiltering(e) {
-      this._allowFiltering !== e && (this._allowFiltering = e, this.filteringService.registerSVGIcons(), this._init || this.calcGridHeadRow(), this.filteringService.isFilterRowVisible = false, this.filteringService.filteredColumn = null, this.notifyChanges(true));
+      this._allowFiltering !== e && (this._allowFiltering = e, this.filteringService.registerSVGIcons(), this.filteringService.isFilterRowVisible = false, this.filteringService.filteredColumn = null, this.notifyChanges(true));
     }
     get allowAdvancedFiltering() {
       return this._allowAdvancedFiltering;
@@ -38093,8 +38098,8 @@ var dc = (() => {
     }
     set filterMode(e) {
       switch (e) {
-        case yo.excelStyleFilter:
-        case yo.quickFilter:
+        case ts.excelStyleFilter:
+        case ts.quickFilter:
           this._filterMode = e;
           break;
         default:
@@ -38349,7 +38354,7 @@ var dc = (() => {
       return this.gridAPI.cms.column;
     }
     constructor(e, i, r, s, a, l, c, d, g, v, w, I, R, V, L, J, te2, se, Te, be2, Ne2) {
-      this.validation = e, this.selectionService = i, this.colResizingService = r, this.gridAPI = s, this.transactionFactory = a, this.elementRef = l, this.zone = c, this.document = d, this.cdr = g, this.differs = v, this.viewRef = w, this.injector = I, this.envInjector = R, this.navigation = V, this.filteringService = L, this.textHighlightService = J, this.overlayService = te2, this.summaryService = se, this.localeId = Te, this.platform = be2, this._diTransactions = Ne2, this.snackbarDisplayTime = 6e3, this.autoGenerate = false, this.autoGenerateExclude = [], this.moving = false, this.clipboardOptions = { enabled: true, copyHeaders: true, copyFormatters: true, separator: "	" }, this.filteringExpressionsTreeChange = new T(), this.advancedFilteringExpressionsTreeChange = new T(), this.gridScroll = new T(), this.rowStyles = null, this.cellClick = new T(), this.rowClick = new T(), this.formGroupCreated = new T(), this.validationStatusChange = new T(), this.selected = new T(), this.rowSelectionChanging = new T(), this.columnSelectionChanging = new T(), this.columnPin = new T(), this.columnPinned = new T(), this.cellEditEnter = new T(), this.cellEditExit = new T(), this.cellEdit = new T(), this.cellEditDone = new T(), this.rowEditEnter = new T(), this.rowEdit = new T(), this.rowEditDone = new T(), this.rowEditExit = new T(), this.columnInit = new T(), this.columnsAutogenerated = new T(), this.sorting = new T(), this.sortingDone = new T(), this.filtering = new T(), this.filteringDone = new T(), this.rowAdded = new T(), this.rowDeleted = new T(), this.rowDelete = new T(), this.rowAdd = new T(), this.columnResized = new T(), this.contextMenu = new T(), this.doubleClick = new T(), this.columnVisibilityChanging = new T(), this.columnVisibilityChanged = new T(), this.columnMovingStart = new T(), this.columnMoving = new T(), this.columnMovingEnd = new T(), this.gridKeydown = new T(), this.rowDragStart = new T(), this.rowDragEnd = new T(), this.gridCopy = new T(), this.expansionStatesChange = new T(), this.selectedRowsChange = new T(), this.rowToggle = new T(), this.rowPinning = new T(), this.rowPinned = new T(), this.activeNodeChange = new T(), this.sortingExpressionsChange = new T(), this.toolbarExporting = new T(), this.rangeSelected = new T(), this.rendered = new T(), this.localeChange = new T(), this.dataChanging = new T(), this.dataChanged = new T(), this.columnList = new Xi(), this.tmpOutlets = new Xi(), this.rowExpandedIndicatorDirectiveTemplate = null, this.rowCollapsedIndicatorDirectiveTemplate = null, this.headerExpandedIndicatorDirectiveTemplate = null, this.headerCollapsedIndicatorDirectiveTemplate = null, this.excelStyleHeaderIconDirectiveTemplate = null, this.sortAscendingHeaderIconDirectiveTemplate = null, this.sortDescendingHeaderIconDirectiveTemplate = null, this.sortHeaderIconDirectiveTemplate = null, this.tabindex = 0, this.hostRole = "grid", this.baseClass = "igx-grid", this.validationTrigger = "change", this.rowDragging = false, this.dragRowID = null, this.calcHeight = 0, this.disableTransitions = false, this.columnWidthSetByUser = false, this.rendered$ = this.rendered.asObservable().pipe(Kx({ bufferSize: 1, refCount: true })), this.resizeNotify = new ue2(), this.rowAddedNotifier = new ue2(), this.rowDeletedNotifier = new ue2(), this.pipeTriggerNotifier = new ue2(), this._destroyed = false, this._totalRecords = -1, this.columnsWithNoSetWidths = null, this.pipeTrigger = 0, this.filteringPipeTrigger = 0, this.summaryPipeTrigger = 0, this.groupablePipeTrigger = 0, this.EMPTY_DATA = [], this.destroy$ = new ue2(), this._pagingMode = is.Local, this._hideRowSelectors = false, this._rowDrag = false, this._columns = [], this._pinnedColumns = [], this._unpinnedColumns = [], this._filteringExpressionsTree = new Ue(Pt2.And), this._sortingExpressions = [], this._maxLevelHeaderDepth = null, this._columnHiding = false, this._columnPinning = false, this._pinnedRecordIDs = [], this._allowFiltering = false, this._allowAdvancedFiltering = false, this._filterMode = yo.quickFilter, this._defaultTargetRecordNumber = 10, this._expansionStates = /* @__PURE__ */ new Map(), this._defaultExpandState = false, this._headerFeaturesWidth = NaN, this._init = true, this._firstAutoResize = true, this._autoSizeColumnsNotify = new ue2(), this._cdrRequestRepaint = false, this._batchEditing = false, this._sortingOptions = { mode: "multiple" }, this._filterStrategy = new Bh(), this._autoGeneratedCols = [], this._dataView = [], this._lastSearchInfo = { searchText: "", caseSensitive: false, exactMatch: false, activeMatchIndex: 0, matchInfoCache: [], matchCount: 0, content: "" }, this._rowEditable = false, this._filteredSortedData = null, this._filteredData = null, this._cdrRequests = false, this._resourceStrings = hi(yp), this._emptyGridMessage = null, this._emptyFilteredGridMessage = null, this._isLoading = false, this.overlayIDs = [], this._pinning = { columns: Gh.Start }, this._shouldRecalcRowHeight = false, this._advancedFilteringPositionSettings = { verticalDirection: Ge2.Middle, horizontalDirection: ze2.Center, horizontalStartPoint: ze2.Center, verticalStartPoint: Ge2.Middle }, this._advancedFilteringOverlaySettings = { closeOnOutsideClick: false, modal: false, positionStrategy: new Li(this._advancedFilteringPositionSettings) }, this._height = "100%", this._width = "100%", this._horizontalForOfs = [], this._multiRowLayoutRowSize = 1, this._totalWidth = NaN, this._pinnedVisible = [], this._unpinnedVisible = [], this._pinnedWidth = NaN, this._unpinnedWidth = NaN, this._visibleColumns = [], this._columnGroups = false, this._summaryPosition = Gn.bottom, this._summaryCalculationMode = bn.rootAndChildLevels, this._showSummaryOnCollapse = false, this._summaryRowHeight = 0, this._cellSelectionMode = it2.multiple, this._rowSelectionMode = it2.none, this._selectRowOnClick = true, this._columnSelectionMode = it2.none, this.rowEditPositioningStrategy = new bv({ horizontalDirection: ze2.Right, verticalDirection: Ge2.Bottom, horizontalStartPoint: ze2.Left, verticalStartPoint: Ge2.Bottom, closeAnimation: null }), this.rowEditSettings = { scrollStrategy: new Yt(), modal: false, closeOnOutsideClick: false, outlet: this.rowOutletDirective, positionStrategy: this.rowEditPositioningStrategy }, this.transactionChange$ = new ue2(), this._rendered = false, this.DRAG_SCROLL_DELTA = 10, this._dataCloneStrategy = new ts(), this._autoSize = false, this._sortHeaderIconTemplate = null, this._sortAscendingHeaderIconTemplate = null, this._sortDescendingHeaderIconTemplate = null, this._gridSize = Ni.Large, this._defaultRowHeight = 50, this.isHorizontalScrollHidden = false, this.preventContainerScroll = (Fe2) => {
+      this.validation = e, this.selectionService = i, this.colResizingService = r, this.gridAPI = s, this.transactionFactory = a, this.elementRef = l, this.zone = c, this.document = d, this.cdr = g, this.differs = v, this.viewRef = w, this.injector = I, this.envInjector = R, this.navigation = V, this.filteringService = L, this.textHighlightService = J, this.overlayService = te2, this.summaryService = se, this.localeId = Te, this.platform = be2, this._diTransactions = Ne2, this.snackbarDisplayTime = 6e3, this.autoGenerate = false, this.autoGenerateExclude = [], this.moving = false, this.clipboardOptions = { enabled: true, copyHeaders: true, copyFormatters: true, separator: "	" }, this.filteringExpressionsTreeChange = new T(), this.advancedFilteringExpressionsTreeChange = new T(), this.gridScroll = new T(), this.rowStyles = null, this.cellClick = new T(), this.rowClick = new T(), this.formGroupCreated = new T(), this.validationStatusChange = new T(), this.selected = new T(), this.rowSelectionChanging = new T(), this.columnSelectionChanging = new T(), this.columnPin = new T(), this.columnPinned = new T(), this.cellEditEnter = new T(), this.cellEditExit = new T(), this.cellEdit = new T(), this.cellEditDone = new T(), this.rowEditEnter = new T(), this.rowEdit = new T(), this.rowEditDone = new T(), this.rowEditExit = new T(), this.columnInit = new T(), this.columnsAutogenerated = new T(), this.sorting = new T(), this.sortingDone = new T(), this.filtering = new T(), this.filteringDone = new T(), this.rowAdded = new T(), this.rowDeleted = new T(), this.rowDelete = new T(), this.rowAdd = new T(), this.columnResized = new T(), this.contextMenu = new T(), this.doubleClick = new T(), this.columnVisibilityChanging = new T(), this.columnVisibilityChanged = new T(), this.columnMovingStart = new T(), this.columnMoving = new T(), this.columnMovingEnd = new T(), this.gridKeydown = new T(), this.rowDragStart = new T(), this.rowDragEnd = new T(), this.gridCopy = new T(), this.expansionStatesChange = new T(), this.selectedRowsChange = new T(), this.rowToggle = new T(), this.rowPinning = new T(), this.rowPinned = new T(), this.activeNodeChange = new T(), this.sortingExpressionsChange = new T(), this.toolbarExporting = new T(), this.rangeSelected = new T(), this.rendered = new T(), this.localeChange = new T(), this.dataChanging = new T(), this.dataChanged = new T(), this.columnList = new Xi(), this.tmpOutlets = new Xi(), this.rowExpandedIndicatorDirectiveTemplate = null, this.rowCollapsedIndicatorDirectiveTemplate = null, this.headerExpandedIndicatorDirectiveTemplate = null, this.headerCollapsedIndicatorDirectiveTemplate = null, this.excelStyleHeaderIconDirectiveTemplate = null, this.sortAscendingHeaderIconDirectiveTemplate = null, this.sortDescendingHeaderIconDirectiveTemplate = null, this.sortHeaderIconDirectiveTemplate = null, this.tabindex = 0, this.hostRole = "grid", this.baseClass = "igx-grid", this.validationTrigger = "change", this.rowDragging = false, this.dragRowID = null, this.calcHeight = 0, this.disableTransitions = false, this.columnWidthSetByUser = false, this.rendered$ = this.rendered.asObservable().pipe(Kx({ bufferSize: 1, refCount: true })), this.resizeNotify = new ue2(), this.rowAddedNotifier = new ue2(), this.rowDeletedNotifier = new ue2(), this.pipeTriggerNotifier = new ue2(), this._destroyed = false, this._totalRecords = -1, this.columnsWithNoSetWidths = null, this.pipeTrigger = 0, this.filteringPipeTrigger = 0, this.summaryPipeTrigger = 0, this.groupablePipeTrigger = 0, this.EMPTY_DATA = [], this.destroy$ = new ue2(), this._pagingMode = is.Local, this._hideRowSelectors = false, this._rowDrag = false, this._columns = [], this._pinnedColumns = [], this._unpinnedColumns = [], this._filteringExpressionsTree = new Ue(Pt2.And), this._sortingExpressions = [], this._maxLevelHeaderDepth = null, this._columnHiding = false, this._columnPinning = false, this._pinnedRecordIDs = [], this._allowFiltering = false, this._allowAdvancedFiltering = false, this._filterMode = ts.quickFilter, this._defaultTargetRecordNumber = 10, this._expansionStates = /* @__PURE__ */ new Map(), this._defaultExpandState = false, this._headerFeaturesWidth = NaN, this._init = true, this._firstAutoResize = true, this._autoSizeColumnsNotify = new ue2(), this._cdrRequestRepaint = false, this._batchEditing = false, this._sortingOptions = { mode: "multiple" }, this._filterStrategy = new Bh(), this._autoGeneratedCols = [], this._dataView = [], this._lastSearchInfo = { searchText: "", caseSensitive: false, exactMatch: false, activeMatchIndex: 0, matchInfoCache: [], matchCount: 0, content: "" }, this._rowEditable = false, this._filteredSortedData = null, this._filteredData = null, this._cdrRequests = false, this._resourceStrings = hi(yp), this._emptyGridMessage = null, this._emptyFilteredGridMessage = null, this._isLoading = false, this.overlayIDs = [], this._pinning = { columns: Gh.Start }, this._shouldRecalcRowHeight = false, this._advancedFilteringPositionSettings = { verticalDirection: Ge2.Middle, horizontalDirection: ze2.Center, horizontalStartPoint: ze2.Center, verticalStartPoint: Ge2.Middle }, this._advancedFilteringOverlaySettings = { closeOnOutsideClick: false, modal: false, positionStrategy: new Li(this._advancedFilteringPositionSettings) }, this._height = "100%", this._width = "100%", this._horizontalForOfs = [], this._multiRowLayoutRowSize = 1, this._totalWidth = NaN, this._pinnedVisible = [], this._unpinnedVisible = [], this._pinnedWidth = NaN, this._unpinnedWidth = NaN, this._visibleColumns = [], this._columnGroups = false, this._summaryPosition = Gn.bottom, this._summaryCalculationMode = bn.rootAndChildLevels, this._showSummaryOnCollapse = false, this._summaryRowHeight = 0, this._cellSelectionMode = it2.multiple, this._rowSelectionMode = it2.none, this._selectRowOnClick = true, this._columnSelectionMode = it2.none, this.rowEditPositioningStrategy = new bv({ horizontalDirection: ze2.Right, verticalDirection: Ge2.Bottom, horizontalStartPoint: ze2.Left, verticalStartPoint: Ge2.Bottom, closeAnimation: null }), this.rowEditSettings = { scrollStrategy: new Yt(), modal: false, closeOnOutsideClick: false, outlet: this.rowOutletDirective, positionStrategy: this.rowEditPositioningStrategy }, this.transactionChange$ = new ue2(), this._rendered = false, this.DRAG_SCROLL_DELTA = 10, this._dataCloneStrategy = new es(), this._autoSize = false, this._sortHeaderIconTemplate = null, this._sortAscendingHeaderIconTemplate = null, this._sortDescendingHeaderIconTemplate = null, this._gridSize = Ni.Large, this._defaultRowHeight = 50, this.isHorizontalScrollHidden = false, this.preventContainerScroll = (Fe2) => {
         Fe2.target.scrollTop !== 0 && (this.verticalScrollContainer.addScroll(Fe2.target.scrollTop), Fe2.target.scrollTop = 0), Fe2.target.scrollLeft !== 0 && (this.headerContainer.scrollPosition += Fe2.target.scrollLeft, Fe2.target.scrollLeft = 0);
       }, this.locale = this.locale || this.localeId, this._transactions = this.transactionFactory.create("None"), this._transactions.cloneStrategy = this.dataCloneStrategy, this.cdr.detach(), this.selectionService.selectedRowsChange.pipe(K(this.destroy$)).subscribe((Fe2) => {
         this.selectedRowsChange.emit(Fe2);
@@ -38420,7 +38425,7 @@ var dc = (() => {
         !this.crudService.cell && r && (i.target === this.tbody.nativeElement && r.row >= 0 && r.row < this.dataView.length || i.target === this.theadRow.nativeElement && r.row === -1 || i.target === this.tfoot.nativeElement && r.row === this.dataView.length) && !(this.rowEditable && this.crudService.rowEditingBlocked && this.crudService.rowInEditMode) && this.clearActiveNode();
       }), this.rowAddedNotifier.pipe(e).subscribe((i) => this.refreshGridState(i)), this.rowDeletedNotifier.pipe(e).subscribe((i) => {
         this.summaryService.deleteOperation = true, this.summaryService.clearSummaryCache(i);
-      }), this.subscribeToTransactions(), this.resizeNotify.pipe(Xt(() => !this._init), Bo(40, sr, { leading: true, trailing: true }), e).subscribe(() => {
+      }), this.subscribeToTransactions(), this.resizeNotify.pipe(Xt(() => !this._init), Ho(40, sr, { leading: true, trailing: true }), e).subscribe(() => {
         this.zone.run(() => {
           this.nativeElement.isConnected && (this.shouldResize && (this._gridSize = this.gridSize, this.updateDefaultRowHeight(), this._autoSize = this.isPercentHeight && this.calcHeight !== this.getDataBasedBodyHeight(), this.crudService.endEdit(false), this._summaryRowHeight === 0 && (this.summaryService.summaryHeight = 0)), this.notifyChanges(true));
         });
@@ -38450,9 +38455,9 @@ var dc = (() => {
         this.notifyChanges(true), this.cdr.detectChanges(), Promise.resolve().then(() => this.headerContainer.updateScroll());
       }), this.headerContainer?.scrollbarVisibilityChanged.pipe(Xt(() => !this._init), e).subscribe(() => {
         this.notifyChanges(true), this.cdr.detectChanges();
-      }), this.verticalScrollContainer.contentSizeChange.pipe(Xt(() => !this._init), Bo(30), e).subscribe(() => {
+      }), this.verticalScrollContainer.contentSizeChange.pipe(Xt(() => !this._init), Ho(30), e).subscribe(() => {
         this.notifyChanges(true);
-      }), this._autoSizeColumnsNotify.pipe(Bo(0, sr, { leading: false, trailing: true }), e).subscribe(() => {
+      }), this._autoSizeColumnsNotify.pipe(Ho(0, sr, { leading: false, trailing: true }), e).subscribe(() => {
         this.autoSizeColumnsInView(), this._firstAutoResize = false;
       });
     }
@@ -38758,7 +38763,7 @@ var dc = (() => {
       if (this.isDefined(this.primaryKey)) {
         let r = this.crudService.cell;
         r && r.id.rowID === i && this.crudService.endCellEdit();
-        let s = new So(i, -1, this.gridAPI.getRowData(i), this);
+        let s = new Io(i, -1, this.gridAPI.getRowData(i), this);
         this.gridAPI.update_row(s, e), this.notifyChanges();
       }
     }
@@ -39348,15 +39353,8 @@ var dc = (() => {
         this._autoSizeColumnsNotify.next();
       }));
     }
-    calcGridHeadRow() {
-      if (this.maxLevelHeaderDepth) {
-        this._baseFontSize = parseFloat(getComputedStyle(this.document.documentElement).getPropertyValue("font-size"));
-        let e = this._allowFiltering && this._filterMode === yo.quickFilter, i = (this.maxLevelHeaderDepth + 1 + (e ? 1 : 0)) * this.defaultRowHeight / this._baseFontSize;
-        this.theadRow.nativeElement.style.minHeight = `${i}rem`;
-      }
-    }
     calculateGridHeight() {
-      this.calcGridHeadRow(), this.calcHeight = this._calculateGridBodyHeight(), this.pinnedRowHeight && this.calcHeight && (this.calcHeight -= this.pinnedRowHeight);
+      this.calcHeight = this._calculateGridBodyHeight(), this.pinnedRowHeight && this.calcHeight && (this.calcHeight -= this.pinnedRowHeight);
     }
     getGroupAreaHeight() {
       return 0;
@@ -39369,7 +39367,7 @@ var dc = (() => {
     }
     getTheadRowHeight() {
       let e = this.getComputedHeight(this.theadRow.nativeElement) || 0;
-      return !this.allowFiltering || this.allowFiltering && this.filterMode !== yo.quickFilter ? e - this.getFilterCellHeight() : e;
+      return !this.allowFiltering || this.allowFiltering && this.filterMode !== ts.quickFilter ? e - this.getFilterCellHeight() : e;
     }
     getToolbarHeight() {
       let e = 0;
@@ -41510,7 +41508,7 @@ function N0e(n38, t) {
   }
   if (n38 & 2) {
     let o = h(2), e = M(8);
-    u(2), p("ngTemplateOutlet", o.grid.rowSelectorTemplate ? o.grid.rowSelectorTemplate : e)("ngTemplateOutletContext", Ve2(7, E0e, Ko(2, D0e, o.viewIndex, o.key, o.key, o.selected)));
+    u(2), p("ngTemplateOutlet", o.grid.rowSelectorTemplate ? o.grid.rowSelectorTemplate : e)("ngTemplateOutletContext", Ve2(7, E0e, Qo(2, D0e, o.viewIndex, o.key, o.key, o.selected)));
   }
 }
 function L0e(n38, t) {
@@ -41524,7 +41522,7 @@ function L0e(n38, t) {
   }
   if (n38 & 2) {
     let o = h(2);
-    u(), Qo("igx-grid__row-indentation igx-grid__row-indentation--level-", o.grid.groupingExpressions.length, "");
+    u(), qo("igx-grid__row-indentation igx-grid__row-indentation--level-", o.grid.groupingExpressions.length, "");
   }
 }
 function H0e(n38, t) {
@@ -41694,9 +41692,9 @@ var CV = (() => {
   let n38 = t;
   return n38;
 })();
-var ko = function(n38) {
+var Mo = function(n38) {
   return n38[n38.NONE = 0] = "NONE", n38[n38.LEFT = 1] = "LEFT", n38[n38.TOP = 2] = "TOP", n38[n38.RIGHT = 3] = "RIGHT", n38[n38.BOTTOM = 4] = "BOTTOM", n38[n38.TOPLEFT = 5] = "TOPLEFT", n38[n38.TOPRIGHT = 6] = "TOPRIGHT", n38[n38.BOTTOMLEFT = 7] = "BOTTOMLEFT", n38[n38.BOTTOMRIGHT = 8] = "BOTTOMRIGHT", n38;
-}(ko || {});
+}(Mo || {});
 var pc = (() => {
   let t = class t {
     get activeDrag() {
@@ -41709,12 +41707,12 @@ var pc = (() => {
       return this.ref.nativeElement;
     }
     constructor(e, i) {
-      this.ref = e, this.zone = i, this.dragStop = new T(), this.dragScroll = new T(), this.end$ = new ue2(), this.lastDirection = ko.NONE, this.startDragSelection = (r) => {
+      this.ref = e, this.zone = i, this.dragStop = new T(), this.dragScroll = new T(), this.end$ = new ue2(), this.lastDirection = Mo.NONE, this.startDragSelection = (r) => {
         if (!this.activeDrag) return;
         let s = r.clientX, a = r.clientY, { direction: l, delta: c } = this._measureDimensions(s, a);
         l !== this.lastDirection && (this.unsubscribe(), this._sub = this._interval$.subscribe(() => this.dragScroll.emit(c)), this.lastDirection = l);
       }, this.stopDragSelection = () => {
-        this.activeDrag && (this.dragStop.emit(false), this.unsubscribe(), this.lastDirection = ko.NONE);
+        this.activeDrag && (this.dragStop.emit(false), this.unsubscribe(), this.lastDirection = Mo.NONE);
       }, this._interval$ = Kn(0, sr).pipe(K(this.end$), Xt(() => this.activeDrag));
     }
     ngOnInit() {
@@ -41729,7 +41727,7 @@ var pc = (() => {
     }
     _measureDimensions(e, i) {
       let r, s = { left: 0, top: 0 }, { left: a, top: l, width: c, height: d } = this.nativeElement.getBoundingClientRect(), g = 0.15, v = Math.trunc(e - a), w = Math.trunc(i - l), I = v <= c * g, R = v >= c * (1 - g), V = w <= d * g, L = w >= d * (1 - g);
-      return V && I ? (r = ko.TOPLEFT, s = { left: -1, top: -1 }) : V && R ? (r = ko.TOPRIGHT, s = { left: 1, top: -1 }) : L && I ? (r = ko.BOTTOMLEFT, s = { left: -1, top: 1 }) : L && R ? (r = ko.BOTTOMRIGHT, s = { top: 1, left: 1 }) : V ? (r = ko.TOP, s.top = -1) : L ? (r = ko.BOTTOM, s.top = 1) : I ? (r = ko.LEFT, s.left = -1) : R ? (r = ko.RIGHT, s.left = 1) : r = ko.NONE, { direction: r, delta: s };
+      return V && I ? (r = Mo.TOPLEFT, s = { left: -1, top: -1 }) : V && R ? (r = Mo.TOPRIGHT, s = { left: 1, top: -1 }) : L && I ? (r = Mo.BOTTOMLEFT, s = { left: -1, top: 1 }) : L && R ? (r = Mo.BOTTOMRIGHT, s = { top: 1, left: 1 }) : V ? (r = Mo.TOP, s.top = -1) : L ? (r = Mo.BOTTOM, s.top = 1) : I ? (r = Mo.LEFT, s.left = -1) : R ? (r = Mo.RIGHT, s.left = 1) : r = Mo.NONE, { direction: r, delta: s };
     }
     unsubscribe() {
       this._sub && this._sub.unsubscribe();
@@ -41838,13 +41836,13 @@ function L1e(n38, t) {
 function H1e(n38, t) {
   if (n38 & 1 && (E(0, "igx-grid-row", 79, 31), A(2, "igxGridRowClasses"), A(3, "igxGridRowStyles")), n38 & 2) {
     let o = t.index, e = t.$implicit, i = t.disabled, r = M(1), s = h();
-    p("gridID", s.id)("index", o)("data", e)("disabled", i)("ngClass", ge2(2, 6, Yo(24, SV, [s.rowClasses, r, r.inEditMode, r.selected, r.dirty, r.deleted, r.dragging, o, s.hasColumnLayouts, e, s.pipeTrigger])))("ngStyle", rt2(3, 19, s.rowStyles, e, o, s.pipeTrigger));
+    p("gridID", s.id)("index", o)("data", e)("disabled", i)("ngClass", ge2(2, 6, Ko(24, SV, [s.rowClasses, r, r.inEditMode, r.selected, r.dirty, r.deleted, r.dragging, o, s.hasColumnLayouts, e, s.pipeTrigger])))("ngStyle", rt2(3, 19, s.rowStyles, e, o, s.pipeTrigger));
   }
 }
 function B1e(n38, t) {
   if (n38 & 1 && (E(0, "igx-grid-row", 80, 32), A(3, "igxGridRowClasses"), A(4, "igxGridRowStyles")), n38 & 2) {
     let o = t.index, e = t.$implicit, i = M(1), r = h();
-    p("gridID", r.id)("index", o)("data", e)("ngClass", ge2(3, 5, Yo(23, SV, [r.rowClasses, i, i.inEditMode, i.selected, i.dirty, i.deleted, i.dragging, o, r.hasColumnLayouts, e, r.pipeTrigger])))("ngStyle", rt2(4, 18, r.rowStyles, e, o, r.pipeTrigger));
+    p("gridID", r.id)("index", o)("data", e)("ngClass", ge2(3, 5, Ko(23, SV, [r.rowClasses, i, i.inEditMode, i.selected, i.dirty, i.deleted, i.dragging, o, r.hasColumnLayouts, e, r.pipeTrigger])))("ngStyle", rt2(4, 18, r.rowStyles, e, o, r.pipeTrigger));
   }
 }
 function z1e(n38, t) {
@@ -41862,7 +41860,7 @@ function G1e(n38, t) {
 function j1e(n38, t) {
   if (n38 & 1 && (G(0), E(1, "div"), j()), n38 & 2) {
     let o = h(2);
-    u(), Qo("igx-grid__row-indentation igx-grid__row-indentation--level-", o.groupingExpressions.length, "");
+    u(), qo("igx-grid__row-indentation igx-grid__row-indentation--level-", o.groupingExpressions.length, "");
   }
 }
 function $1e(n38, t) {
@@ -42062,7 +42060,7 @@ var On = (() => {
           a.push(this.getColumnByName(g.fieldName));
         }, this), this.notifyChanges();
         let d = { expressions: r, groupedColumns: s, ungroupedColumns: a };
-        this.groupingPerformed$.pipe(Ho(1)).subscribe(() => {
+        this.groupingPerformed$.pipe(Lo(1)).subscribe(() => {
           this.groupingDone.emit(d);
         });
       }
@@ -42190,7 +42188,7 @@ var On = (() => {
       return this.groupsExpanded ? this.headerExpandedIndicatorTemplate || this.defaultExpandedTemplate : this.headerCollapsedIndicatorTemplate || this.defaultCollapsedTemplate;
     }
     ngAfterContentInit() {
-      super.ngAfterContentInit(), this.allowFiltering && this.hasColumnLayouts && (this.filterMode = yo.excelStyleFilter), this.groupTemplate && (this._groupRowTemplate = this.groupTemplate.template), this.detailTemplateDirective && (this._detailTemplate = this.detailTemplateDirective), this.hideGroupedColumns && this._columns && this.groupingExpressions && this._setGroupColsVisibility(this.hideGroupedColumns), this._setupNavigationService();
+      super.ngAfterContentInit(), this.allowFiltering && this.hasColumnLayouts && (this.filterMode = ts.excelStyleFilter), this.groupTemplate && (this._groupRowTemplate = this.groupTemplate.template), this.detailTemplateDirective && (this._detailTemplate = this.detailTemplateDirective), this.hideGroupedColumns && this._columns && this.groupingExpressions && this._setGroupColsVisibility(this.hideGroupedColumns), this._setupNavigationService();
     }
     ngAfterViewInit() {
       super.ngAfterViewInit(), this.verticalScrollContainer.beforeViewDestroyed.pipe(K(this.destroy$)).subscribe((e) => {
@@ -42668,7 +42666,7 @@ var Ov = (() => {
     i & 2 && (H("id", r.headerID)("title", r.title), N("user-select", r.userSelect), X("igx-grid-th--active", r.active)("asc", r.sortAscendingStyle)("desc", r.sortDescendingStyle)("igx-grid-th--sortable", r.sortableStyle)("igx-grid-th--sorted", r.sortedStyle));
   }, inputs: { rowIndex: "rowIndex", dimWidth: "dimWidth", rootDimension: "rootDimension" }, standalone: true, features: [ne, Q], decls: 5, vars: 1, consts: [["defaultColumn", ""], ["defaultCollapseIndicator", ""], [4, "ngIf"], [1, "igx-grid-th__group-title", 3, "title"], ["family", "default", 3, "name"], ["class", "igx-grid-th__drop-indicator-left", 4, "ngIf"], ["role", "columnheader", 1, "igx-grid-th--fw", 3, "pointerdown", "keydown", "id", "ngClass", "ngStyle", "igxColumnMovingDrag", "ghostHost", "igxColumnMovingDrop", "column"], ["class", "igx-grid-th__resize-handle", 3, "igxPivotResizeHandle", "igxPivotResizeHandleHeader", "cursor", 4, "ngIf"], ["class", "igx-grid-th__drop-indicator-right", 4, "ngIf"], [1, "igx-grid-th__drop-indicator-left"], [1, "igx-grid-th__resize-handle", 3, "igxPivotResizeHandle", "igxPivotResizeHandleHeader"], [1, "igx-grid-th__drop-indicator-right"]], template: function(i, r) {
     i & 1 && C(0, R_e, 2, 2, "ng-template", null, 0, O)(2, A_e, 1, 1, "ng-template", null, 1, O)(4, F_e, 6, 15, "ng-container", 2), i & 2 && (u(4), p("ngIf", !r.column.columnGroup));
-  }, dependencies: [me, ae2, Np, Oe, ri, to, rr, Vv, Po], encapsulation: 2, changeDetection: 0 });
+  }, dependencies: [me, ae2, Np, Oe, ri, to, rr, Vv, Ao], encapsulation: 2, changeDetection: 0 });
   let n38 = t;
   return n38;
 })();
@@ -43468,7 +43466,7 @@ var L3 = (() => {
       }), C(21, Rve, 2, 3, "igx-drop-down-item", 35), f(), m(22, "div", 36)(23, "igx-grid-excel-style-filtering", 37, 1)(25, "div", 38)(26, "igx-chips-area", null, 2), C(28, Ave, 2, 5, "igx-chip", 39), f()(), m(29, "igx-excel-style-filter-operations"), E(30, "igx-excel-style-search"), f()()(), m(31, "div", 40)(32, "igx-chips-area", 41, 3), C(34, Pve, 3, 4, "igx-chip", 42), f()(), C(35, Mve, 1, 2, "ng-template", null, 4, O);
     }
     i & 2 && (u(), N("width", r.width, "px"), u(), N("width", r.width, "px"), u(2), p("ngIf", r.grid.pivotUI.showConfiguration), u(2), p("ngIf", r.grid.pivotUI.showConfiguration && r.grid.pivotUI.showRowHeaders), u(2), p("ngIf", r.grid.pivotUI.showConfiguration), u(), p("ngIf", r.grid.pivotUI.showConfiguration), u(), N("width", r.width, "px"), X("igx-grid__tr--mrl", r.hasMRL), H("aria-activedescendant", r.activeDescendant), u(), N("width", r.width, "px"), u(), p("ngIf", !r.grid.pivotUI.showRowHeaders || r.grid.rowDimensions.length === 0), u(), p("ngIf", r.grid.pivotUI.showRowHeaders && r.grid.visibleRowDimensions.length > 0), u(), p("ngIf", r.pinnedColumnCollection.length && r.grid.isPinningToStart), u(), N("max-height", r.maxContainerHeight, "px"), u(), p("ngForOf", r.columnDimensionsByLevel), u(), p("ngIf", r.pinnedColumnCollection.length && !r.grid.isPinningToStart), u(), N("width", r.grid.scrollSize, "px"), p("hidden", !r.grid.hasVerticalScroll()), u(3), p("ngForOf", r.aggregateList), u(), p("hidden", true), u(), p("maxHeight", r.grid.excelStyleFilterMaxHeight)("minHeight", r.grid.excelStyleFilterMinHeight), u(5), p("ngForOf", r.filterDropdownDimensions), u(6), p("ngForOf", r.grid.filterDimensions));
-  }, dependencies: [ae2, Or, Eo, He2, li, me, Ft2, mp, Qt, Co, ke, Ba, Oe, ri, jt2, wr, yr, qs, Ip, Sp, Cp, Jl, Po, Ep, Ov], encapsulation: 2, changeDetection: 0 });
+  }, dependencies: [ae2, Or, Do, He2, li, me, Ft2, mp, Qt, wo, ke, Ba, Oe, ri, jt2, wr, yr, qs, Ip, Sp, Cp, Jl, Ao, Ep, Ov], encapsulation: 2, changeDetection: 0 });
   let n38 = t;
   return n38;
 })();
@@ -43686,7 +43684,7 @@ var Nv = (() => {
       return Nn(this, null, function* () {
         let i = this.grid.verticalScrollContainer;
         i.isIndexOutsideView(e) && (i.scrollTo(e), yield new Promise((r) => {
-          this.grid.gridScroll.pipe(Ho(1), $x({ first: 1e4 })).subscribe({ next: (s) => r(s), error: (s) => r(s) });
+          this.grid.gridScroll.pipe(Lo(1), $x({ first: 1e4 })).subscribe({ next: (s) => r(s), error: (s) => r(s) });
         }));
       });
     }
@@ -43844,7 +43842,7 @@ var H3 = (() => {
     }), i & 2 && (H("id", r.headerID)("title", r.title), N("user-select", r.userSelect), X("igx-grid-th--active", r.active));
   }, inputs: { rowIndex: "rowIndex", colIndex: "colIndex", layout: "layout", parent: "parent" }, standalone: true, features: [ne, Q], decls: 5, vars: 1, consts: [["defaultColumn", ""], ["defaultCollapseIndicator", ""], [4, "ngIf"], [1, "igx-grid-th__group-title", 3, "title"], ["family", "default", 3, "name"], ["class", "igx-grid-th__drop-indicator-left", 4, "ngIf"], ["role", "columnheader", 1, "igx-grid-th--fw", 3, "pointerdown", "keydown", "id", "ngClass", "ngStyle", "igxColumnMovingDrag", "ghostHost", "igxColumnMovingDrop", "column"], ["class", "igx-grid-th__resize-handle", 3, "igxPivotResizeHandle", "igxPivotResizeHandleHeader", "cursor", 4, "ngIf"], ["class", "igx-grid-th__drop-indicator-right", 4, "ngIf"], [1, "igx-grid-th__drop-indicator-left"], [1, "igx-grid-th__resize-handle", 3, "igxPivotResizeHandle", "igxPivotResizeHandleHeader"], [1, "igx-grid-th__drop-indicator-right"]], template: function(i, r) {
     i & 1 && C(0, Fve, 2, 2, "ng-template", null, 0, O)(2, Vve, 1, 1, "ng-template", null, 1, O)(4, Hve, 6, 15, "ng-container", 2), i & 2 && (u(4), p("ngIf", !r.column.columnGroup));
-  }, dependencies: [me, ae2, Np, Oe, ri, to, rr, Vv, Po], encapsulation: 2, changeDetection: 0 });
+  }, dependencies: [me, ae2, Np, Oe, ri, to, rr, Vv, Ao], encapsulation: 2, changeDetection: 0 });
   let n38 = t;
   return n38;
 })();
@@ -43861,13 +43859,13 @@ function Gve(n38, t) {
   }
   if (n38 & 2) {
     let o = t.$implicit, e = h();
-    Qo("igx-grid__tr--header igx-grid__row-indentation--level-", e.getLevel(), ""), u(), p("name", e.getExpandState() ? "tree_collapse" : "tree_expand"), H("draggable", false), u(), Z(" ", o.header, " ");
+    qo("igx-grid__tr--header igx-grid__row-indentation--level-", e.getLevel(), ""), u(), p("name", e.getExpandState() ? "tree_collapse" : "tree_expand"), H("draggable", false), u(), Z(" ", o.header, " ");
   }
 }
 function jve(n38, t) {
   if (n38 & 1 && (m(0, "div", 6), E(1, "igx-icon", 7), P(2), f()), n38 & 2) {
     let o = t.$implicit, e = h();
-    Qo("igx-grid__tr--header igx-grid__row-indentation--level-", e.getLevel(), ""), u(), H("draggable", false), u(), Z(" ", o.header, " ");
+    qo("igx-grid__tr--header igx-grid__row-indentation--level-", e.getLevel(), ""), u(), H("draggable", false), u(), Z(" ", o.header, " ");
   }
 }
 var Lp = (() => {
@@ -43938,7 +43936,7 @@ var Lp = (() => {
     i & 2 && N("grid-row-start", r.rowStart)("grid-row-end", r.rowsEnd)("grid-column-start", r.colStart)("grid-column-end", r.colEnd);
   }, inputs: { rowIndex: "rowIndex", colIndex: "colIndex", layout: "layout", dimension: "dimension", rootDimension: "rootDimension", rowData: "rowData" }, standalone: true, features: [ne, ni, Q], decls: 11, vars: 35, consts: [["headerTemplate", ""], ["headerDefaultTemplate", ""], ["role", "rowgroup", 1, "igx-grid-thead__wrapper"], ["role", "row", 1, "igx-grid__tr", "igx-grid__tr-header-row"], [3, "ngClass", "ngStyle", "column", "rowIndex", "colIndex", "layout", "parent"], ["family", "default", 3, "click", "name"], [2, "--component-size", "3"], [2, "flex-shrink", "0"]], template: function(i, r) {
     i & 1 && (m(0, "div", 2)(1, "div", 3), E(2, "igx-pivot-row-dimension-header-group", 4), A(3, "igxHeaderGroupWidth"), A(4, "igxHeaderGroupWidth"), A(5, "igxHeaderGroupWidth"), A(6, "igxHeaderGroupStyle"), f()(), C(7, Gve, 3, 6, "ng-template", null, 0, O)(9, jve, 3, 5, "ng-template", null, 1, O)), i & 2 && (N("width", r.width, "px"), X("igx-grid__tr--mrl", r.hasMRL), u(), N("width", r.width, "px"), u(), N("min-width", oe2(3, 19, r.getHeaderWidthFromDimension(), r.grid.defaultHeaderGroupMinWidth, r.hasMRL))("width", oe2(4, 23, r.getHeaderWidthFromDimension(), r.grid.defaultHeaderGroupMinWidth, r.hasMRL))("flex-basis", oe2(5, 27, r.getHeaderWidthFromDimension(), r.grid.defaultHeaderGroupMinWidth, r.hasMRL)), p("ngClass", r.rowDimensionColumn.headerGroupClasses)("ngStyle", oe2(6, 31, r.rowDimensionColumn.headerGroupStyles, r.rowDimensionColumn, r.grid.pipeTrigger))("column", r.rowDimensionColumn)("rowIndex", r.rowIndex)("colIndex", r.colIndex)("layout", r.layout)("parent", r));
-  }, dependencies: [H3, Oe, ri, me, Jl, Po], encapsulation: 2, changeDetection: 0 });
+  }, dependencies: [H3, Oe, ri, me, Jl, Ao], encapsulation: 2, changeDetection: 0 });
   let n38 = t;
   return n38;
 })();
@@ -44534,7 +44532,7 @@ function uxe(n38, t) {
 function pxe(n38, t) {
   if (n38 & 1 && (E(0, "igx-pivot-row", 60, 21), A(2, "igxGridRowClasses"), A(3, "igxGridRowStyles")), n38 & 2) {
     let o = t.index, e = t.$implicit, i = M(1), r = h();
-    p("gridID", r.id)("index", o)("data", e)("ngClass", ge2(2, 5, Yo(23, sxe, [r.rowClasses, i, i.inEditMode, i.selected, i.dirty, i.deleted, i.dragging, o, r.hasColumnLayouts, e, r.pipeTrigger])))("ngStyle", rt2(3, 18, r.rowStyles, e, o, r.pipeTrigger));
+    p("gridID", r.id)("index", o)("data", e)("ngClass", ge2(2, 5, Ko(23, sxe, [r.rowClasses, i, i.inEditMode, i.selected, i.dirty, i.deleted, i.dragging, o, r.hasColumnLayouts, e, r.pipeTrigger])))("ngStyle", rt2(3, 18, r.rowStyles, e, o, r.pipeTrigger));
   }
 }
 function hxe(n38, t) {
@@ -44683,7 +44681,7 @@ function Mxe(n38, t) {
 var kxe = 0;
 var WV = 200;
 var Fxe = 104;
-var Fo = (() => {
+var ko = (() => {
   let t = class t extends dc {
     get dimensionsSortingExpressions() {
       let e = this.rowDimensions.concat(this.columnDimensions);
@@ -44762,7 +44760,7 @@ var Fo = (() => {
     set allowAdvancedFiltering(e) {
     }
     get filterMode() {
-      return yo.quickFilter;
+      return ts.quickFilter;
     }
     set filterMode(e) {
     }
@@ -44858,7 +44856,7 @@ var Fo = (() => {
       }), e;
     }
     constructor(e, i, r, s, a, l, c, d, g, v, w, I, R, V, L, J, te2, se, Te, be2, Ne2) {
-      super(e, i, r, s, a, l, c, d, g, v, w, I, R, V, L, J, te2, se, Te, be2, Ne2), this.dimensionsChange = new T(), this.pivotConfigurationChange = new T(), this.dimensionInit = new T(), this.valueInit = new T(), this.dimensionsSortingExpressionsChange = new T(), this.valuesChange = new T(), this.autoGenerateConfig = false, this.role = "grid", this.autoGenerateExclude = [], this.snackbarDisplayTime = 6e3, this.cellEdit = new T(), this.cellEditDone = new T(), this.cellEditEnter = new T(), this.cellEditExit = new T(), this.columnMovingStart = new T(), this.columnMoving = new T(), this.columnMovingEnd = new T(), this.columnPin = new T(), this.columnPinned = new T(), this.rowAdd = new T(), this.rowAdded = new T(), this.rowDeleted = new T(), this.rowDelete = new T(), this.rowDragStart = new T(), this.rowDragEnd = new T(), this.rowEditEnter = new T(), this.rowEdit = new T(), this.rowEditDone = new T(), this.rowEditExit = new T(), this.rowPinning = new T(), this.rowPinned = new T(), this.columnGroupStates = /* @__PURE__ */ new Map(), this.dragRowID = null, this.rowDimensionResizing = true, this._emptyRowDimension = { memberName: "", enabled: true, level: 0 }, this._pivotValueCloneStrategy = new ts(), this._defaultExpandState = false, this._filterStrategy = new hc(), this.regroupTrigger = 0, this._pivotConfiguration = { rows: null, columns: null, values: null, filters: null }, this.p_id = `igx-pivot-grid-${kxe++}`, this._superCompactMode = false, this._pivotUI = { showConfiguration: true, showRowHeaders: false, rowLayout: $l.Vertical, horizontalSummariesPosition: nd.Bottom }, this._sortableColumns = true, this._visibleRowDimensions = [], this._shouldUpdateSizes = false, this.autoGenerate = true, this.moving = false, this.toolbarExporting = new T();
+      super(e, i, r, s, a, l, c, d, g, v, w, I, R, V, L, J, te2, se, Te, be2, Ne2), this.dimensionsChange = new T(), this.pivotConfigurationChange = new T(), this.dimensionInit = new T(), this.valueInit = new T(), this.dimensionsSortingExpressionsChange = new T(), this.valuesChange = new T(), this.autoGenerateConfig = false, this.role = "grid", this.autoGenerateExclude = [], this.snackbarDisplayTime = 6e3, this.cellEdit = new T(), this.cellEditDone = new T(), this.cellEditEnter = new T(), this.cellEditExit = new T(), this.columnMovingStart = new T(), this.columnMoving = new T(), this.columnMovingEnd = new T(), this.columnPin = new T(), this.columnPinned = new T(), this.rowAdd = new T(), this.rowAdded = new T(), this.rowDeleted = new T(), this.rowDelete = new T(), this.rowDragStart = new T(), this.rowDragEnd = new T(), this.rowEditEnter = new T(), this.rowEdit = new T(), this.rowEditDone = new T(), this.rowEditExit = new T(), this.rowPinning = new T(), this.rowPinned = new T(), this.columnGroupStates = /* @__PURE__ */ new Map(), this.dragRowID = null, this.rowDimensionResizing = true, this._emptyRowDimension = { memberName: "", enabled: true, level: 0 }, this._pivotValueCloneStrategy = new es(), this._defaultExpandState = false, this._filterStrategy = new hc(), this.regroupTrigger = 0, this._pivotConfiguration = { rows: null, columns: null, values: null, filters: null }, this.p_id = `igx-pivot-grid-${kxe++}`, this._superCompactMode = false, this._pivotUI = { showConfiguration: true, showRowHeaders: false, rowLayout: $l.Vertical, horizontalSummariesPosition: nd.Bottom }, this._sortableColumns = true, this._visibleRowDimensions = [], this._shouldUpdateSizes = false, this.autoGenerate = true, this.moving = false, this.toolbarExporting = new T();
     }
     ngOnInit() {
       this.autoGenerate = true, super.ngOnInit();
@@ -44874,7 +44872,7 @@ var Fo = (() => {
       });
     }
     ngOnChanges(e) {
-      e.superCompactMode && !e.superCompactMode.isFirstChange() && (this._shouldUpdateSizes = true, Da(this.verticalScrollContainer.displayContainer).pipe(Ho(1), K(this.destroy$)).subscribe(() => this.resizeNotify.next()));
+      e.superCompactMode && !e.superCompactMode.isFirstChange() && (this._shouldUpdateSizes = true, Da(this.verticalScrollContainer.displayContainer).pipe(Lo(1), K(this.destroy$)).subscribe(() => this.resizeNotify.next()));
     }
     notifyDimensionChange(e = false) {
       e && this.setupColumns(), this.pipeTrigger++, this.cdr.detectChanges();
@@ -45199,8 +45197,6 @@ var Fo = (() => {
         this.resolveToggle(a, l);
       });
     }
-    calcGridHeadRow() {
-    }
     buildDataView(e) {
       this._dataView = e;
     }
@@ -45568,14 +45564,14 @@ var qV = (() => {
         return a.gridAPI.getParentRowId(l);
       } }, pivotConfiguration: { getFeatureState(a) {
         let l = a.currGrid.pivotConfiguration;
-        if (!l || !(a.currGrid instanceof Fo)) return { pivotConfiguration: void 0 };
+        if (!l || !(a.currGrid instanceof ko)) return { pivotConfiguration: void 0 };
         let c = Fr(l);
         return c.rows = Ye(l.rows, true), c.columns = Ye(l.columns, true), c.filters = Ye(l.filters, true), [...c.rows || [], ...c.columns || [], ...c.filters || []].filter((v) => a.isDateDimension(v))?.forEach((v) => {
           v.resourceStrings = {};
         }), { pivotConfiguration: c };
       }, restoreFeatureState(a, l) {
         let c = l;
-        !c || !(a.currGrid instanceof Fo) || (a.restoreValues(c, a.currGrid), a.restoreDimensions(c), a.currGrid.pivotConfiguration = c);
+        !c || !(a.currGrid instanceof ko) || (a.restoreValues(c, a.currGrid), a.restoreDimensions(c), a.currGrid.pivotConfiguration = c);
       } } };
     }
     getStateInternal(e = true, i) {
@@ -45642,7 +45638,7 @@ var qV = (() => {
         i.filteringOperands.push(s);
       } else {
         let s = r, a;
-        if (this.currGrid instanceof Fo) a = this.currGrid.allDimensions.find((c) => c.memberName === s.fieldName).dataType;
+        if (this.currGrid instanceof ko) a = this.currGrid.allDimensions.find((c) => c.memberName === s.fieldName).dataType;
         else if (this.currGrid.columns.length > 0) a = this.currGrid.columns.find((c) => c.field === s.fieldName).dataType;
         else if (this.state.columns) a = this.state.columns.find((c) => c.field === s.fieldName).dataType;
         else return null;
@@ -45845,7 +45841,7 @@ var ta = (() => {
     }
   };
   t.\u0275fac = function(i) {
-    return new (i || t)(_(ir), _(Io), _(z));
+    return new (i || t)(_(ir), _(Co), _(z));
   }, t.\u0275cmp = q({ type: t, selectors: [["igx-grid-toolbar"]], contentQueries: function(i, r, s) {
     if (i & 1 && de(s, gc, 5), i & 2) {
       let a;
@@ -46041,13 +46037,13 @@ var zv = (() => {
       return (e || (e = Ae2(t)))(r || t);
     };
   })(), t.\u0275cmp = q({ type: t, selectors: [["igx-grid-toolbar-hiding"]], viewQuery: function(i, r) {
-    if (i & 1 && k(XC, 5, To), i & 2) {
+    if (i & 1 && k(XC, 5, Eo), i & 2) {
       let s;
       b(s = D()) && (r.content = s.first);
     }
   }, standalone: true, features: [ne, Q], decls: 2, vars: 3, consts: [["btn", ""], ["actions", "", "ref", "toggle"], [4, "ngIf"], ["igxButton", "outlined", "type", "button", "name", "btnColumnHiding", 3, "click", "title"], ["family", "default", 3, "name"], ["igxColumnHiding", "", "igxToggle", "", 3, "opened", "grid", "title", "filterColumnsPrompt", "hideFilter", "filterCriteria", "columnDisplayOrder", "columnsAreaMaxHeight", "uncheckAllText", "checkAllText", "indentation"]], template: function(i, r) {
     i & 1 && (C(0, Zxe, 11, 14, "ng-container", 2), A(1, "async")), i & 2 && p("ngIf", ot2(1, 1, r.grid.rendered$));
-  }, dependencies: [ae2, st2, me, To, XC, Bt2, x0], encapsulation: 2 });
+  }, dependencies: [ae2, st2, me, Eo, XC, Bt2, x0], encapsulation: 2 });
   let n38 = t;
   return n38;
 })();
@@ -46081,13 +46077,13 @@ var Gv = (() => {
       return (e || (e = Ae2(t)))(r || t);
     };
   })(), t.\u0275cmp = q({ type: t, selectors: [["igx-grid-toolbar-pinning"]], viewQuery: function(i, r) {
-    if (i & 1 && k(ZC, 5, To), i & 2) {
+    if (i & 1 && k(ZC, 5, Eo), i & 2) {
       let s;
       b(s = D()) && (r.content = s.first);
     }
   }, standalone: true, features: [ne, Q], decls: 2, vars: 3, consts: [["btn", ""], ["actions", "", "ref", "toggle"], [4, "ngIf"], ["igxButton", "outlined", "type", "button", "name", "btnColumnPinning", 3, "click", "title"], ["family", "default", 3, "name"], ["igxColumnPinning", "", "igxToggle", "", 3, "opened", "grid", "title", "filterColumnsPrompt", "hideFilter", "filterCriteria", "columnDisplayOrder", "columnsAreaMaxHeight", "uncheckAllText", "checkAllText", "indentation"]], template: function(i, r) {
     i & 1 && (C(0, Jxe, 11, 14, "ng-container", 2), A(1, "async")), i & 2 && p("ngIf", ot2(1, 1, r.grid.rendered$));
-  }, dependencies: [ae2, st2, me, To, ZC, Bt2, x0], encapsulation: 2 });
+  }, dependencies: [ae2, st2, me, Eo, ZC, Bt2, x0], encapsulation: 2 });
   let n38 = t;
   return n38;
 })();
@@ -46562,7 +46558,7 @@ var jv = (() => {
       let s = M(4);
       u(6), p("ngForOf", oe2(7, 4, r.dims, s.value, r.grid == null ? null : r.grid.pipeTrigger)), u(2), p("ngForOf", oe2(9, 8, r.values, s.value, r.grid == null ? null : r.grid.pipeTrigger)), u(3), p("ngForOf", r._panels), u(3), p("ngForOf", r.aggregateList);
     }
-  }, dependencies: [Kt, me, Ft2, Tt2, Kg, He2, wp, $t, y8, K_, Eg, Or, x8, li, bg, ae2, ss, Co, wg, wr, yr, GV], encapsulation: 2 });
+  }, dependencies: [Kt, me, Ft2, Tt2, Kg, He2, wp, $t, y8, K_, Eg, Or, x8, li, bg, ae2, ss, wo, wg, wr, yr, GV], encapsulation: 2 });
   let n38 = t;
   return n38;
 })();
@@ -46934,7 +46930,7 @@ var Q3 = (() => {
       let s = M(5);
       u(), p("ngForOf", r.chipExpressions), u(), p("hidden", !r.dropAreaVisible), H("gridId", r.grid.id), u(), p("ngTemplateOutlet", r.dropAreaTemplate || s);
     }
-  }, dependencies: [Eo, He2, li, me, Qt, mv, Or, ke, gv], encapsulation: 2 });
+  }, dependencies: [Do, He2, li, me, Qt, mv, Or, ke, gv], encapsulation: 2 });
   let n38 = t;
   return n38;
 })();
@@ -47340,7 +47336,7 @@ function K2e(n38, t) {
 function Y2e(n38, t) {
   if (n38 & 1 && (G(0), E(1, "div", 32, 8), j()), n38 & 2) {
     let o = h(2);
-    u(), Qo("igx-grid__tree-cell--padding-level-", o.level, ""), p("ngStyle", Ve2(4, T2e, "calc(var(--igx-tree-indent-size) *" + o.level + ")"));
+    u(), qo("igx-grid__tree-cell--padding-level-", o.level, ""), p("ngStyle", Ve2(4, T2e, "calc(var(--igx-tree-indent-size) *" + o.level + ")"));
   }
 }
 function X2e(n38, t) {
@@ -47558,7 +47554,7 @@ function Eye(n38, t) {
   if (n38 & 2) {
     h();
     let o = M(8), e = h();
-    u(2), p("ngTemplateOutlet", e.grid.rowSelectorTemplate ? e.grid.rowSelectorTemplate : o)("ngTemplateOutletContext", Ve2(7, xye, Ko(2, vye, e.viewIndex, e.key, e.key, e.selected)));
+    u(2), p("ngTemplateOutlet", e.grid.rowSelectorTemplate ? e.grid.rowSelectorTemplate : o)("ngTemplateOutletContext", Ve2(7, xye, Qo(2, vye, e.viewIndex, e.key, e.key, e.selected)));
   }
 }
 function Tye(n38, t) {
@@ -47783,13 +47779,13 @@ function cwe(n38, t) {
 function dwe(n38, t) {
   if (n38 & 1 && (E(0, "igx-tree-grid-row", 72, 26), A(2, "igxGridRowClasses"), A(3, "igxGridRowStyles")), n38 & 2) {
     let o = t.index, e = t.disabled, i = t.$implicit, r = M(1), s = h();
-    p("gridID", s.id)("index", o)("treeRow", i)("disabled", e)("ngClass", ge2(2, 6, Yo(24, gO, [s.rowClasses, r, r.inEditMode, r.selected, r.dirty, r.deleted, r.dragging, o, s.hasColumnLayouts, r.treeRow.isFilteredOutParent, i, s.pipeTrigger])))("ngStyle", rt2(3, 19, s.rowStyles, i, o, s.pipeTrigger));
+    p("gridID", s.id)("index", o)("treeRow", i)("disabled", e)("ngClass", ge2(2, 6, Ko(24, gO, [s.rowClasses, r, r.inEditMode, r.selected, r.dirty, r.deleted, r.dragging, o, s.hasColumnLayouts, r.treeRow.isFilteredOutParent, i, s.pipeTrigger])))("ngStyle", rt2(3, 19, s.rowStyles, i, o, s.pipeTrigger));
   }
 }
 function uwe(n38, t) {
   if (n38 & 1 && (E(0, "igx-tree-grid-row", 73, 27), A(3, "igxGridRowClasses"), A(4, "igxGridRowStyles")), n38 & 2) {
     let o = t.index, e = t.$implicit, i = M(1), r = h();
-    p("gridID", r.id)("index", o)("treeRow", e)("ngClass", ge2(3, 5, Yo(23, gO, [r.rowClasses, i, i.inEditMode, i.selected, i.dirty, i.deleted, i.dragging, o, r.hasColumnLayouts, i.treeRow.isFilteredOutParent, e, r.pipeTrigger])))("ngStyle", rt2(4, 18, r.rowStyles, e, o, r.pipeTrigger));
+    p("gridID", r.id)("index", o)("treeRow", e)("ngClass", ge2(3, 5, Ko(23, gO, [r.rowClasses, i, i.inEditMode, i.selected, i.dirty, i.deleted, i.dragging, o, r.hasColumnLayouts, i.treeRow.isFilteredOutParent, e, r.pipeTrigger])))("ngStyle", rt2(4, 18, r.rowStyles, e, o, r.pipeTrigger));
   }
 }
 function pwe(n38, t) {
@@ -48341,7 +48337,7 @@ var zp = (() => {
     dispatchEvent(e) {
       let i = e.key.toLowerCase(), r = this.grid.crudService.cell || this.grid.crudService.row;
       if (!(!this.activeNode || !(Nh.has(i) || i === "tab" && r) || (this.getClosestElemByTag(e.target, "igx-hierarchical-grid") || this.getClosestElemByTag(e.target, "igc-hierarchical-grid")) !== this.grid.nativeElement)) {
-        if (this._pendingNavigation && es.has(i)) {
+        if (this._pendingNavigation && Jo.has(i)) {
           e.preventDefault();
           return;
         }
@@ -49414,13 +49410,13 @@ function v3e(n38, t) {
 function x3e(n38, t) {
   if (n38 & 1 && (E(0, "igx-hierarchical-grid-row", 76, 30), A(2, "igxGridRowClasses"), A(3, "igxGridRowStyles")), n38 & 2) {
     let o = t.index, e = t.disabled, i = t.$implicit, r = M(1), s = h();
-    p("gridID", s.id)("index", o)("disabled", e)("data", i)("ngClass", ge2(2, 6, Yo(24, bO, [s.rowClasses, r, r.inEditMode, r.selected, r.dirty, r.deleted, r.dragging, o, s.hasColumnLayouts, i, s.pipeTrigger])))("ngStyle", rt2(3, 19, s.rowStyles, i, o, s.pipeTrigger));
+    p("gridID", s.id)("index", o)("disabled", e)("data", i)("ngClass", ge2(2, 6, Ko(24, bO, [s.rowClasses, r, r.inEditMode, r.selected, r.dirty, r.deleted, r.dragging, o, s.hasColumnLayouts, i, s.pipeTrigger])))("ngStyle", rt2(3, 19, s.rowStyles, i, o, s.pipeTrigger));
   }
 }
 function y3e(n38, t) {
   if (n38 & 1 && (E(0, "igx-hierarchical-grid-row", 77, 31), A(3, "igxGridRowClasses"), A(4, "igxGridRowStyles")), n38 & 2) {
     let o = t.index, e = t.$implicit, i = M(1), r = h();
-    p("gridID", r.id)("index", o)("data", e)("ngClass", ge2(3, 5, Yo(23, bO, [r.rowClasses, i, i.inEditMode, i.selected, i.dirty, i.deleted, i.dragging, o, r.hasColumnLayouts, e, r.pipeTrigger])))("ngStyle", rt2(4, 18, r.rowStyles, e, o, r.pipeTrigger));
+    p("gridID", r.id)("index", o)("data", e)("ngClass", ge2(3, 5, Ko(23, bO, [r.rowClasses, i, i.inEditMode, i.selected, i.dirty, i.deleted, i.dragging, o, r.hasColumnLayouts, e, r.pipeTrigger])))("ngStyle", rt2(4, 18, r.rowStyles, e, o, r.pipeTrigger));
   }
 }
 function w3e(n38, t) {
@@ -49613,7 +49609,7 @@ var SO = (() => {
       this.gridAPI = e, this.element = i, this.cdr = r, this.expanded = false;
     }
     ngOnInit() {
-      let e = this.container.createComponent(Vo, { injector: this.container.injector });
+      let e = this.container.createComponent(Fo, { injector: this.container.injector });
       this.hGrid = e.instance, this.hGrid.setDataInternal(this.data.childGridsData[this.layout.key]), this.hGrid.nativeElement.__componentRef = e, this.layout.layoutChange.subscribe((r) => {
         this._handleLayoutChanges(r);
       }), this.layout.initialChanges.forEach((r) => {
@@ -49653,7 +49649,7 @@ var SO = (() => {
   let n38 = t;
   return n38;
 })();
-var Vo = (() => {
+var Fo = (() => {
   let t = class t extends Wv {
     constructor() {
       super(...arguments), this.role = "grid", this.childLayoutKeys = [], this.dataSetByUser = false, this.highlightedRowID = null, this.updateOnRender = false, this.parent = null, this.h_id = `igx-hierarchical-grid-${Z3e++}`, this.childGridTemplates = /* @__PURE__ */ new Map();
@@ -50003,7 +49999,7 @@ var Yv = (() => {
   let n38 = t;
   return n38;
 })();
-var Ui = [{ component: rd, selector: "igc-action-strip", parents: [On, ia, Vo, Wn], contentQueries: [{ property: "actionButtons", childType: bo, isQueryList: true }], additionalProperties: [], methods: ["show", "hide"], boolProps: ["hidden"], provideAs: Rn }, { component: ft2, selector: "igc-column", parents: [On, ia, Vo, Fo, Wn, Mn, sd], contentQueries: [], additionalProperties: [{ name: "selected", writable: true }, { name: "index" }, { name: "visibleIndex" }, { name: "columnGroup" }, { name: "columnLayout" }, { name: "columnLayoutChild" }, { name: "childColumns" }, { name: "level" }, { name: "filteringExpressionsTree" }, { name: "parent", writable: true }, { name: "grid", writable: true }, { name: "topLevelParent" }], methods: ["pin", "unpin", "move", "autosize"], templateProps: ["summaryTemplate", "bodyTemplate", "headerTemplate", "inlineEditorTemplate", "errorTemplate", "filterCellTemplate"], numericProps: ["rowEnd", "colEnd", "rowStart", "colStart"], boolProps: ["sortable", "selectable", "groupable", "editable", "filterable", "resizable", "autosizeHeader", "hasSummary", "hidden", "disableHiding", "disablePinning", "filteringIgnoreCase", "sortingIgnoreCase", "searchable", "pinned", "visibleWhenCollapsed"] }, { component: Mn, selector: "igc-column-group", parents: [On, ia, Vo, Mn, Wn], contentQueries: [{ property: "children", childType: ft2, isQueryList: true }], additionalProperties: [{ name: "selected", writable: true }, { name: "childColumns" }, { name: "columnGroup" }, { name: "columnLayout" }, { name: "index" }, { name: "visibleIndex" }, { name: "columnLayoutChild" }, { name: "level" }, { name: "filteringExpressionsTree" }, { name: "parent", writable: true }, { name: "grid", writable: true }, { name: "topLevelParent" }], methods: ["pin", "unpin", "move", "autosize"], templateProps: ["collapsibleIndicatorTemplate", "summaryTemplate", "headerTemplate", "errorTemplate", "filterCellTemplate"], numericProps: ["rowEnd", "colEnd", "rowStart", "colStart"], boolProps: ["collapsible", "expanded", "searchable", "hidden", "sortable", "groupable", "editable", "filterable", "resizable", "autosizeHeader", "hasSummary", "disableHiding", "disablePinning", "filteringIgnoreCase", "sortingIgnoreCase", "pinned", "visibleWhenCollapsed"], provideAs: ft2 }, { component: sd, selector: "igc-column-layout", parents: [On], contentQueries: [{ property: "children", childType: ft2, isQueryList: true }], additionalProperties: [{ name: "columnLayout" }, { name: "visibleIndex" }, { name: "selected", writable: true }, { name: "childColumns" }, { name: "columnGroup" }, { name: "index" }, { name: "columnLayoutChild" }, { name: "level" }, { name: "filteringExpressionsTree" }, { name: "parent", writable: true }, { name: "grid", writable: true }, { name: "topLevelParent" }], methods: ["pin", "unpin", "move", "autosize"], templateProps: ["collapsibleIndicatorTemplate", "summaryTemplate", "headerTemplate", "errorTemplate", "filterCellTemplate"], numericProps: ["rowEnd", "colEnd", "rowStart", "colStart"], boolProps: ["hidden", "collapsible", "expanded", "searchable", "sortable", "groupable", "editable", "filterable", "resizable", "autosizeHeader", "hasSummary", "disableHiding", "disablePinning", "filteringIgnoreCase", "sortingIgnoreCase", "pinned", "visibleWhenCollapsed"], provideAs: ft2 }, { component: On, selector: "igc-grid", parents: [], contentQueries: [{ property: "columnList", childType: ft2, isQueryList: true, descendants: true }, { property: "actionStripComponents", childType: Rn, isQueryList: true }, { property: "toolbar", childType: kn, isQueryList: true }, { property: "paginationComponents", childType: Sr, isQueryList: true }], additionalProperties: [{ name: "groupsRecords" }, { name: "selectedCells" }, { name: "shouldGenerate", writable: true }, { name: "rowList" }, { name: "dataRowList" }, { name: "hiddenColumnsCount" }, { name: "pinnedColumnsCount" }, { name: "transactions" }, { name: "lastSearchInfo" }, { name: "filteredData" }, { name: "filteredSortedData" }, { name: "validation" }, { name: "gridAPI" }, { name: "cdr" }, { name: "navigation", writable: true }, { name: "virtualizationState" }, { name: "nativeElement" }, { name: "defaultRowHeight" }, { name: "defaultHeaderGroupMinWidth" }, { name: "columns" }, { name: "pinnedColumns" }, { name: "pinnedRows" }, { name: "unpinnedColumns" }, { name: "visibleColumns" }, { name: "dataView" }], methods: ["groupBy", "clearGrouping", "isExpandedGroup", "toggleGroup", "selectRowsInGroup", "deselectRowsInGroup", "fullyExpandGroup", "toggleAllGroupRows", "getSelectedData", "getRowByIndex", "getRowByKey", "getCellByColumn", "getCellByKey", "pinRow", "unpinRow", "isRecordPinnedByIndex", "toggleColumnVisibility", "expandAll", "collapseAll", "expandRow", "collapseRow", "toggleRow", "getHeaderGroupWidth", "getColumnByName", "getColumnByVisibleIndex", "recalculateAutoSizes", "moveColumn", "markForCheck", "addRow", "deleteRow", "updateCell", "updateRow", "getRowData", "sort", "filter", "filterGlobal", "enableSummaries", "disableSummaries", "clearFilter", "clearSort", "pinColumn", "unpinColumn", "reflow", "findNext", "findPrev", "refreshSearch", "clearSearch", "getPinnedWidth", "selectRows", "deselectRows", "selectAllRows", "deselectAllRows", "clearCellSelection", "selectRange", "getSelectedRanges", "selectedColumns", "selectColumns", "deselectColumns", "deselectAllColumns", "selectAllColumns", "getSelectedColumnsData", "navigateTo", "getNextCell", "getPreviousCell", "openAdvancedFilteringDialog", "closeAdvancedFilteringDialog", "endEdit", "beginAddRowById", "beginAddRowByIndex"], templateProps: ["dropAreaTemplate", "detailTemplate", "groupByRowSelectorTemplate", "groupRowTemplate", "emptyGridTemplate", "addRowEmptyTemplate", "loadingGridTemplate", "dragGhostCustomTemplate", "rowEditTextTemplate", "rowAddTextTemplate", "rowEditActionsTemplate", "rowExpandedIndicatorTemplate", "rowCollapsedIndicatorTemplate", "headerExpandedIndicatorTemplate", "headerCollapsedIndicatorTemplate", "excelStyleHeaderIconTemplate", "sortAscendingHeaderIconTemplate", "sortDescendingHeaderIconTemplate", "sortHeaderIconTemplate", "headSelectorTemplate", "rowSelectorTemplate", "dragIndicatorIconTemplate"], numericProps: ["totalItemCount", "snackbarDisplayTime", "summaryRowHeight", "rowHeight", "totalRecords"], boolProps: ["groupsExpanded", "hideGroupedColumns", "showGroupArea", "autoGenerate", "moving", "hideRowSelectors", "rowDraggable", "rowEditable", "isLoading", "allowFiltering", "allowAdvancedFiltering", "showSummaryOnCollapse", "batchEditing", "selectRowOnClick"] }, { component: kg, selector: "igc-grid-editing-actions", parents: [rd], contentQueries: [], additionalProperties: [{ name: "hasChildren" }], methods: ["startEdit"], boolProps: ["addRow", "editRow", "deleteRow", "addChild", "asMenuItems"], provideAs: bo }, { component: Fg, selector: "igc-grid-pinning-actions", parents: [rd], contentQueries: [], additionalProperties: [], methods: ["pin", "unpin", "scrollToRow"], boolProps: ["asMenuItems"], provideAs: bo }, { component: Yv, selector: "igc-grid-state", parents: [On, ia, Vo, Fo], contentQueries: [], additionalProperties: [{ name: "grid", writable: true }], methods: ["applyState", "applyStateFromString", "getState", "getStateAsString"] }, { component: gc, selector: "igc-grid-toolbar-actions", parents: [ta], contentQueries: [], additionalProperties: [], methods: [] }, { component: Hp, selector: "igc-grid-toolbar-advanced-filtering", parents: [ta], contentQueries: [], additionalProperties: [], methods: [] }, { component: ta, selector: "igc-grid-toolbar", parents: [On, ia, Vo, Fo], contentQueries: [{ property: "hasActions", childType: gc }], additionalProperties: [{ name: "nativeElement" }], methods: [], boolProps: ["showProgress"], provideAs: kn }, { component: Bv, selector: "igc-grid-toolbar-exporter", parents: [ta], contentQueries: [], additionalProperties: [], methods: ["export"], boolProps: ["exportCSV", "exportExcel"] }, { component: zv, selector: "igc-grid-toolbar-hiding", parents: [ta], contentQueries: [], additionalProperties: [], methods: ["checkAll", "uncheckAll"], numericProps: ["indentetion"], boolProps: ["hideFilter"] }, { component: Gv, selector: "igc-grid-toolbar-pinning", parents: [ta], contentQueries: [], additionalProperties: [], methods: ["checkAll", "uncheckAll"], numericProps: ["indentetion"], boolProps: ["hideFilter"] }, { component: Lv, selector: "igc-grid-toolbar-title", parents: [ta], contentQueries: [], additionalProperties: [], methods: [] }, { component: Vo, selector: "igc-hierarchical-grid", parents: [], contentQueries: [{ property: "childLayoutList", childType: Wn, isQueryList: true }, { property: "allLayoutList", childType: Wn, isQueryList: true, descendants: true }, { property: "paginatorList", childType: Sr, isQueryList: true, descendants: true }, { property: "actionStripComponents", childType: Rn, isQueryList: true }, { property: "columnList", childType: ft2, isQueryList: true, descendants: true }, { property: "toolbar", childType: kn, isQueryList: true }, { property: "paginationComponents", childType: Sr, isQueryList: true }], additionalProperties: [{ name: "foreignKey" }, { name: "selectedCells" }, { name: "gridAPI", writable: true }, { name: "shouldGenerate", writable: true }, { name: "rowList" }, { name: "dataRowList" }, { name: "hiddenColumnsCount" }, { name: "pinnedColumnsCount" }, { name: "transactions" }, { name: "lastSearchInfo" }, { name: "filteredData" }, { name: "filteredSortedData" }, { name: "validation" }, { name: "cdr" }, { name: "navigation", writable: true }, { name: "virtualizationState" }, { name: "nativeElement" }, { name: "defaultRowHeight" }, { name: "defaultHeaderGroupMinWidth" }, { name: "columns" }, { name: "pinnedColumns" }, { name: "pinnedRows" }, { name: "unpinnedColumns" }, { name: "visibleColumns" }, { name: "dataView" }], methods: ["getRowByIndex", "getRowByKey", "getCellByColumn", "getCellByKey", "pinRow", "unpinRow", "getDefaultExpandState", "isRecordPinnedByIndex", "toggleColumnVisibility", "expandAll", "collapseAll", "expandRow", "collapseRow", "toggleRow", "getHeaderGroupWidth", "getColumnByName", "getColumnByVisibleIndex", "recalculateAutoSizes", "moveColumn", "markForCheck", "addRow", "deleteRow", "updateCell", "updateRow", "getRowData", "sort", "filter", "filterGlobal", "enableSummaries", "disableSummaries", "clearFilter", "clearSort", "pinColumn", "unpinColumn", "reflow", "findNext", "findPrev", "refreshSearch", "clearSearch", "getPinnedWidth", "selectRows", "deselectRows", "selectAllRows", "deselectAllRows", "clearCellSelection", "selectRange", "getSelectedRanges", "getSelectedData", "selectedColumns", "selectColumns", "deselectColumns", "deselectAllColumns", "selectAllColumns", "getSelectedColumnsData", "navigateTo", "getNextCell", "getPreviousCell", "openAdvancedFilteringDialog", "closeAdvancedFilteringDialog", "endEdit", "beginAddRowById", "beginAddRowByIndex"], templateProps: ["emptyGridTemplate", "addRowEmptyTemplate", "loadingGridTemplate", "dragGhostCustomTemplate", "rowEditTextTemplate", "rowAddTextTemplate", "rowEditActionsTemplate", "rowExpandedIndicatorTemplate", "rowCollapsedIndicatorTemplate", "headerExpandedIndicatorTemplate", "headerCollapsedIndicatorTemplate", "excelStyleHeaderIconTemplate", "sortAscendingHeaderIconTemplate", "sortDescendingHeaderIconTemplate", "sortHeaderIconTemplate", "headSelectorTemplate", "rowSelectorTemplate", "dragIndicatorIconTemplate"], numericProps: ["totalItemCount", "snackbarDisplayTime", "summaryRowHeight", "rowHeight", "totalRecords"], boolProps: ["expandChildren", "showExpandAll", "autoGenerate", "moving", "hideRowSelectors", "rowDraggable", "rowEditable", "isLoading", "allowFiltering", "allowAdvancedFiltering", "showSummaryOnCollapse", "selectRowOnClick"] }, { component: Bp, selector: "igc-paginator", parents: [On, ia, Vo, Fo], contentQueries: [], additionalProperties: [{ name: "totalPages", writable: true }, { name: "isLastPage" }, { name: "isFirstPage" }, { name: "nativeElement" }], methods: ["nextPage", "previousPage", "paginate"], numericProps: ["page", "perPage", "totalRecords"], provideAs: Sr }, { component: jv, selector: "igc-pivot-data-selector", parents: [], contentQueries: [], additionalProperties: [{ name: "animationSettings", writable: true }], methods: [], boolProps: ["columnsExpanded", "rowsExpanded", "filtersExpanded", "valuesExpanded"] }, { component: Fo, selector: "igc-pivot-grid", parents: [], contentQueries: [{ property: "columnList", childType: ft2, isQueryList: true, descendants: true }, { property: "toolbar", childType: kn, isQueryList: true }, { property: "paginationComponents", childType: Sr, isQueryList: true }], additionalProperties: [{ name: "dimensionsSortingExpressions" }, { name: "allDimensions" }, { name: "rowList" }, { name: "dataRowList" }, { name: "lastSearchInfo" }, { name: "filteredData" }, { name: "filteredSortedData" }, { name: "validation" }, { name: "gridAPI" }, { name: "cdr" }, { name: "navigation", writable: true }, { name: "virtualizationState" }, { name: "nativeElement" }, { name: "defaultRowHeight" }, { name: "defaultHeaderGroupMinWidth" }, { name: "columns" }, { name: "visibleColumns" }, { name: "dataView" }], methods: ["notifyDimensionChange", "toggleColumn", "getColumnGroupExpandState", "toggleRowGroup", "autoSizeRowDimension", "insertDimensionAt", "moveDimension", "removeDimension", "toggleDimension", "insertValueAt", "moveValue", "removeValue", "toggleValue", "sortDimension", "filterDimension", "toggleRow", "getHeaderGroupWidth", "getColumnByName", "getColumnByVisibleIndex", "recalculateAutoSizes", "markForCheck", "getRowData", "sort", "filter", "filterGlobal", "clearFilter", "clearSort", "reflow", "selectRows", "deselectRows", "selectAllRows", "deselectAllRows", "clearCellSelection", "selectRange", "getSelectedRanges", "getSelectedData", "selectedColumns", "selectColumns", "deselectColumns", "deselectAllColumns", "selectAllColumns", "getSelectedColumnsData", "navigateTo"], templateProps: ["valueChipTemplate", "rowDimensionHeaderTemplate", "emptyPivotGridTemplate", "emptyGridTemplate", "loadingGridTemplate", "dragGhostCustomTemplate", "rowEditTextTemplate", "rowAddTextTemplate", "rowEditActionsTemplate", "rowExpandedIndicatorTemplate", "rowCollapsedIndicatorTemplate", "headerExpandedIndicatorTemplate", "headerCollapsedIndicatorTemplate", "excelStyleHeaderIconTemplate", "sortAscendingHeaderIconTemplate", "sortDescendingHeaderIconTemplate", "sortHeaderIconTemplate", "headSelectorTemplate", "rowSelectorTemplate"], numericProps: ["rowHeight"], boolProps: ["autoGenerateConfig", "superCompactMode", "defaultExpandState", "isLoading", "selectRowOnClick"] }, { component: Wn, selector: "igc-row-island", parents: [Vo, Wn], contentQueries: [{ property: "children", childType: Wn, isQueryList: true }, { property: "childLayoutList", childType: Wn, isQueryList: true }, { property: "childColumns", childType: ft2, isQueryList: true }, { property: "actionStripComponents", childType: Rn, isQueryList: true }, { property: "columnList", childType: ft2, isQueryList: true, descendants: true }], additionalProperties: [{ name: "rowIslandAPI", writable: true }, { name: "gridAPI", writable: true }, { name: "shouldGenerate", writable: true }, { name: "rowList" }, { name: "dataRowList" }, { name: "transactions" }, { name: "validation" }, { name: "cdr" }, { name: "navigation", writable: true }, { name: "nativeElement" }, { name: "defaultRowHeight" }, { name: "defaultHeaderGroupMinWidth" }, { name: "columns" }, { name: "pinnedRows" }], methods: ["isRecordPinnedByIndex", "toggleColumnVisibility", "expandAll", "collapseAll", "expandRow", "collapseRow", "toggleRow", "getHeaderGroupWidth", "getColumnByName", "getColumnByVisibleIndex", "recalculateAutoSizes", "moveColumn", "markForCheck", "addRow", "deleteRow", "updateCell", "updateRow", "getRowData", "sort", "filter", "filterGlobal", "enableSummaries", "disableSummaries", "clearFilter", "clearSort", "pinColumn", "unpinColumn", "pinRow", "unpinRow", "findNext", "findPrev", "refreshSearch", "clearSearch", "getPinnedWidth", "selectRows", "deselectRows", "selectAllRows", "deselectAllRows", "clearCellSelection", "selectRange", "getSelectedRanges", "getSelectedData", "selectedColumns", "selectColumns", "deselectColumns", "deselectAllColumns", "selectAllColumns", "getSelectedColumnsData", "navigateTo", "getNextCell", "getPreviousCell", "openAdvancedFilteringDialog", "closeAdvancedFilteringDialog", "endEdit", "beginAddRowById", "beginAddRowByIndex"], templateProps: ["toolbarTemplate", "paginatorTemplate", "emptyGridTemplate", "addRowEmptyTemplate", "loadingGridTemplate", "dragGhostCustomTemplate", "rowEditTextTemplate", "rowAddTextTemplate", "rowEditActionsTemplate", "rowExpandedIndicatorTemplate", "rowCollapsedIndicatorTemplate", "headerExpandedIndicatorTemplate", "headerCollapsedIndicatorTemplate", "excelStyleHeaderIconTemplate", "sortAscendingHeaderIconTemplate", "sortDescendingHeaderIconTemplate", "sortHeaderIconTemplate", "headSelectorTemplate", "rowSelectorTemplate", "dragIndicatorIconTemplate"], numericProps: ["snackbarDisplayTime", "summaryRowHeight", "rowHeight", "totalRecords"], boolProps: ["expandChildren", "showExpandAll", "autoGenerate", "moving", "hideRowSelectors", "rowDraggable", "rowEditable", "isLoading", "allowFiltering", "allowAdvancedFiltering", "showSummaryOnCollapse", "selectRowOnClick"] }, { component: ia, selector: "igc-tree-grid", parents: [], contentQueries: [{ property: "columnList", childType: ft2, isQueryList: true, descendants: true }, { property: "actionStripComponents", childType: Rn, isQueryList: true }, { property: "toolbar", childType: kn, isQueryList: true }, { property: "paginationComponents", childType: Sr, isQueryList: true }], additionalProperties: [{ name: "rootRecords", writable: true }, { name: "records", writable: true }, { name: "processedRootRecords", writable: true }, { name: "processedRecords", writable: true }, { name: "selectedCells" }, { name: "shouldGenerate", writable: true }, { name: "rowList" }, { name: "dataRowList" }, { name: "hiddenColumnsCount" }, { name: "pinnedColumnsCount" }, { name: "lastSearchInfo" }, { name: "filteredData" }, { name: "filteredSortedData" }, { name: "validation" }, { name: "gridAPI" }, { name: "cdr" }, { name: "navigation", writable: true }, { name: "virtualizationState" }, { name: "nativeElement" }, { name: "defaultRowHeight" }, { name: "defaultHeaderGroupMinWidth" }, { name: "columns" }, { name: "pinnedColumns" }, { name: "pinnedRows" }, { name: "unpinnedColumns" }, { name: "visibleColumns" }, { name: "dataView" }], methods: ["getDefaultExpandState", "expandAll", "collapseAll", "addRow", "beginAddRowByIndex", "getSelectedData", "getRowByIndex", "getRowByKey", "getCellByColumn", "getCellByKey", "pinRow", "unpinRow", "isRecordPinnedByIndex", "toggleColumnVisibility", "expandRow", "collapseRow", "toggleRow", "getHeaderGroupWidth", "getColumnByName", "getColumnByVisibleIndex", "recalculateAutoSizes", "moveColumn", "markForCheck", "deleteRow", "updateCell", "updateRow", "getRowData", "sort", "filter", "filterGlobal", "enableSummaries", "disableSummaries", "clearFilter", "clearSort", "pinColumn", "unpinColumn", "reflow", "findNext", "findPrev", "refreshSearch", "clearSearch", "getPinnedWidth", "selectRows", "deselectRows", "selectAllRows", "deselectAllRows", "clearCellSelection", "selectRange", "getSelectedRanges", "selectedColumns", "selectColumns", "deselectColumns", "deselectAllColumns", "selectAllColumns", "getSelectedColumnsData", "navigateTo", "getNextCell", "getPreviousCell", "openAdvancedFilteringDialog", "closeAdvancedFilteringDialog", "endEdit", "beginAddRowById"], templateProps: ["rowLoadingIndicatorTemplate", "emptyGridTemplate", "addRowEmptyTemplate", "loadingGridTemplate", "dragGhostCustomTemplate", "rowEditTextTemplate", "rowAddTextTemplate", "rowEditActionsTemplate", "rowExpandedIndicatorTemplate", "rowCollapsedIndicatorTemplate", "headerExpandedIndicatorTemplate", "headerCollapsedIndicatorTemplate", "excelStyleHeaderIconTemplate", "sortAscendingHeaderIconTemplate", "sortDescendingHeaderIconTemplate", "sortHeaderIconTemplate", "headSelectorTemplate", "rowSelectorTemplate", "dragIndicatorIconTemplate"], numericProps: ["expansionDepth", "snackbarDisplayTime", "summaryRowHeight", "rowHeight", "totalRecords"], boolProps: ["cascadeOnDelete", "autoGenerate", "moving", "hideRowSelectors", "rowDraggable", "rowEditable", "isLoading", "allowFiltering", "allowAdvancedFiltering", "showSummaryOnCollapse", "batchEditing", "selectRowOnClick"] }];
+var Ui = [{ component: rd, selector: "igc-action-strip", parents: [On, ia, Fo, Wn], contentQueries: [{ property: "actionButtons", childType: So, isQueryList: true }], additionalProperties: [], methods: ["show", "hide"], boolProps: ["hidden"], provideAs: Rn }, { component: ft2, selector: "igc-column", parents: [On, ia, Fo, ko, Wn, Mn, sd], contentQueries: [], additionalProperties: [{ name: "selected", writable: true }, { name: "index" }, { name: "visibleIndex" }, { name: "columnGroup" }, { name: "columnLayout" }, { name: "columnLayoutChild" }, { name: "childColumns" }, { name: "level" }, { name: "filteringExpressionsTree" }, { name: "parent", writable: true }, { name: "grid", writable: true }, { name: "topLevelParent" }], methods: ["pin", "unpin", "move", "autosize"], templateProps: ["summaryTemplate", "bodyTemplate", "headerTemplate", "inlineEditorTemplate", "errorTemplate", "filterCellTemplate"], numericProps: ["rowEnd", "colEnd", "rowStart", "colStart"], boolProps: ["sortable", "selectable", "groupable", "editable", "filterable", "resizable", "autosizeHeader", "hasSummary", "hidden", "disableHiding", "disablePinning", "filteringIgnoreCase", "sortingIgnoreCase", "searchable", "pinned", "visibleWhenCollapsed"] }, { component: Mn, selector: "igc-column-group", parents: [On, ia, Fo, Mn, Wn], contentQueries: [{ property: "children", childType: ft2, isQueryList: true }], additionalProperties: [{ name: "selected", writable: true }, { name: "childColumns" }, { name: "columnGroup" }, { name: "columnLayout" }, { name: "index" }, { name: "visibleIndex" }, { name: "columnLayoutChild" }, { name: "level" }, { name: "filteringExpressionsTree" }, { name: "parent", writable: true }, { name: "grid", writable: true }, { name: "topLevelParent" }], methods: ["pin", "unpin", "move", "autosize"], templateProps: ["collapsibleIndicatorTemplate", "summaryTemplate", "headerTemplate", "errorTemplate", "filterCellTemplate"], numericProps: ["rowEnd", "colEnd", "rowStart", "colStart"], boolProps: ["collapsible", "expanded", "searchable", "hidden", "sortable", "groupable", "editable", "filterable", "resizable", "autosizeHeader", "hasSummary", "disableHiding", "disablePinning", "filteringIgnoreCase", "sortingIgnoreCase", "pinned", "visibleWhenCollapsed"], provideAs: ft2 }, { component: sd, selector: "igc-column-layout", parents: [On], contentQueries: [{ property: "children", childType: ft2, isQueryList: true }], additionalProperties: [{ name: "columnLayout" }, { name: "visibleIndex" }, { name: "selected", writable: true }, { name: "childColumns" }, { name: "columnGroup" }, { name: "index" }, { name: "columnLayoutChild" }, { name: "level" }, { name: "filteringExpressionsTree" }, { name: "parent", writable: true }, { name: "grid", writable: true }, { name: "topLevelParent" }], methods: ["pin", "unpin", "move", "autosize"], templateProps: ["collapsibleIndicatorTemplate", "summaryTemplate", "headerTemplate", "errorTemplate", "filterCellTemplate"], numericProps: ["rowEnd", "colEnd", "rowStart", "colStart"], boolProps: ["hidden", "collapsible", "expanded", "searchable", "sortable", "groupable", "editable", "filterable", "resizable", "autosizeHeader", "hasSummary", "disableHiding", "disablePinning", "filteringIgnoreCase", "sortingIgnoreCase", "pinned", "visibleWhenCollapsed"], provideAs: ft2 }, { component: On, selector: "igc-grid", parents: [], contentQueries: [{ property: "columnList", childType: ft2, isQueryList: true, descendants: true }, { property: "actionStripComponents", childType: Rn, isQueryList: true }, { property: "toolbar", childType: kn, isQueryList: true }, { property: "paginationComponents", childType: Sr, isQueryList: true }], additionalProperties: [{ name: "groupsRecords" }, { name: "selectedCells" }, { name: "shouldGenerate", writable: true }, { name: "rowList" }, { name: "dataRowList" }, { name: "hiddenColumnsCount" }, { name: "pinnedColumnsCount" }, { name: "transactions" }, { name: "lastSearchInfo" }, { name: "filteredData" }, { name: "filteredSortedData" }, { name: "validation" }, { name: "gridAPI" }, { name: "cdr" }, { name: "navigation", writable: true }, { name: "virtualizationState" }, { name: "nativeElement" }, { name: "defaultRowHeight" }, { name: "defaultHeaderGroupMinWidth" }, { name: "columns" }, { name: "pinnedColumns" }, { name: "pinnedRows" }, { name: "unpinnedColumns" }, { name: "visibleColumns" }, { name: "dataView" }], methods: ["groupBy", "clearGrouping", "isExpandedGroup", "toggleGroup", "selectRowsInGroup", "deselectRowsInGroup", "fullyExpandGroup", "toggleAllGroupRows", "getSelectedData", "getRowByIndex", "getRowByKey", "getCellByColumn", "getCellByKey", "pinRow", "unpinRow", "isRecordPinnedByIndex", "toggleColumnVisibility", "expandAll", "collapseAll", "expandRow", "collapseRow", "toggleRow", "getHeaderGroupWidth", "getColumnByName", "getColumnByVisibleIndex", "recalculateAutoSizes", "moveColumn", "markForCheck", "addRow", "deleteRow", "updateCell", "updateRow", "getRowData", "sort", "filter", "filterGlobal", "enableSummaries", "disableSummaries", "clearFilter", "clearSort", "pinColumn", "unpinColumn", "reflow", "findNext", "findPrev", "refreshSearch", "clearSearch", "getPinnedWidth", "selectRows", "deselectRows", "selectAllRows", "deselectAllRows", "clearCellSelection", "selectRange", "getSelectedRanges", "selectedColumns", "selectColumns", "deselectColumns", "deselectAllColumns", "selectAllColumns", "getSelectedColumnsData", "navigateTo", "getNextCell", "getPreviousCell", "openAdvancedFilteringDialog", "closeAdvancedFilteringDialog", "endEdit", "beginAddRowById", "beginAddRowByIndex"], templateProps: ["dropAreaTemplate", "detailTemplate", "groupByRowSelectorTemplate", "groupRowTemplate", "emptyGridTemplate", "addRowEmptyTemplate", "loadingGridTemplate", "dragGhostCustomTemplate", "rowEditTextTemplate", "rowAddTextTemplate", "rowEditActionsTemplate", "rowExpandedIndicatorTemplate", "rowCollapsedIndicatorTemplate", "headerExpandedIndicatorTemplate", "headerCollapsedIndicatorTemplate", "excelStyleHeaderIconTemplate", "sortAscendingHeaderIconTemplate", "sortDescendingHeaderIconTemplate", "sortHeaderIconTemplate", "headSelectorTemplate", "rowSelectorTemplate", "dragIndicatorIconTemplate"], numericProps: ["totalItemCount", "snackbarDisplayTime", "summaryRowHeight", "rowHeight", "totalRecords"], boolProps: ["groupsExpanded", "hideGroupedColumns", "showGroupArea", "autoGenerate", "moving", "hideRowSelectors", "rowDraggable", "rowEditable", "isLoading", "allowFiltering", "allowAdvancedFiltering", "showSummaryOnCollapse", "batchEditing", "selectRowOnClick"] }, { component: kg, selector: "igc-grid-editing-actions", parents: [rd], contentQueries: [], additionalProperties: [{ name: "hasChildren" }], methods: ["startEdit"], boolProps: ["addRow", "editRow", "deleteRow", "addChild", "asMenuItems"], provideAs: So }, { component: Fg, selector: "igc-grid-pinning-actions", parents: [rd], contentQueries: [], additionalProperties: [], methods: ["pin", "unpin", "scrollToRow"], boolProps: ["asMenuItems"], provideAs: So }, { component: Yv, selector: "igc-grid-state", parents: [On, ia, Fo, ko], contentQueries: [], additionalProperties: [{ name: "grid", writable: true }], methods: ["applyState", "applyStateFromString", "getState", "getStateAsString"] }, { component: gc, selector: "igc-grid-toolbar-actions", parents: [ta], contentQueries: [], additionalProperties: [], methods: [] }, { component: Hp, selector: "igc-grid-toolbar-advanced-filtering", parents: [ta], contentQueries: [], additionalProperties: [], methods: [] }, { component: ta, selector: "igc-grid-toolbar", parents: [On, ia, Fo, ko], contentQueries: [{ property: "hasActions", childType: gc }], additionalProperties: [{ name: "nativeElement" }], methods: [], boolProps: ["showProgress"], provideAs: kn }, { component: Bv, selector: "igc-grid-toolbar-exporter", parents: [ta], contentQueries: [], additionalProperties: [], methods: ["export"], boolProps: ["exportCSV", "exportExcel"] }, { component: zv, selector: "igc-grid-toolbar-hiding", parents: [ta], contentQueries: [], additionalProperties: [], methods: ["checkAll", "uncheckAll"], numericProps: ["indentetion"], boolProps: ["hideFilter"] }, { component: Gv, selector: "igc-grid-toolbar-pinning", parents: [ta], contentQueries: [], additionalProperties: [], methods: ["checkAll", "uncheckAll"], numericProps: ["indentetion"], boolProps: ["hideFilter"] }, { component: Lv, selector: "igc-grid-toolbar-title", parents: [ta], contentQueries: [], additionalProperties: [], methods: [] }, { component: Fo, selector: "igc-hierarchical-grid", parents: [], contentQueries: [{ property: "childLayoutList", childType: Wn, isQueryList: true }, { property: "allLayoutList", childType: Wn, isQueryList: true, descendants: true }, { property: "paginatorList", childType: Sr, isQueryList: true, descendants: true }, { property: "actionStripComponents", childType: Rn, isQueryList: true }, { property: "columnList", childType: ft2, isQueryList: true, descendants: true }, { property: "toolbar", childType: kn, isQueryList: true }, { property: "paginationComponents", childType: Sr, isQueryList: true }], additionalProperties: [{ name: "foreignKey" }, { name: "selectedCells" }, { name: "gridAPI", writable: true }, { name: "shouldGenerate", writable: true }, { name: "rowList" }, { name: "dataRowList" }, { name: "hiddenColumnsCount" }, { name: "pinnedColumnsCount" }, { name: "transactions" }, { name: "lastSearchInfo" }, { name: "filteredData" }, { name: "filteredSortedData" }, { name: "validation" }, { name: "cdr" }, { name: "navigation", writable: true }, { name: "virtualizationState" }, { name: "nativeElement" }, { name: "defaultRowHeight" }, { name: "defaultHeaderGroupMinWidth" }, { name: "columns" }, { name: "pinnedColumns" }, { name: "pinnedRows" }, { name: "unpinnedColumns" }, { name: "visibleColumns" }, { name: "dataView" }], methods: ["getRowByIndex", "getRowByKey", "getCellByColumn", "getCellByKey", "pinRow", "unpinRow", "getDefaultExpandState", "isRecordPinnedByIndex", "toggleColumnVisibility", "expandAll", "collapseAll", "expandRow", "collapseRow", "toggleRow", "getHeaderGroupWidth", "getColumnByName", "getColumnByVisibleIndex", "recalculateAutoSizes", "moveColumn", "markForCheck", "addRow", "deleteRow", "updateCell", "updateRow", "getRowData", "sort", "filter", "filterGlobal", "enableSummaries", "disableSummaries", "clearFilter", "clearSort", "pinColumn", "unpinColumn", "reflow", "findNext", "findPrev", "refreshSearch", "clearSearch", "getPinnedWidth", "selectRows", "deselectRows", "selectAllRows", "deselectAllRows", "clearCellSelection", "selectRange", "getSelectedRanges", "getSelectedData", "selectedColumns", "selectColumns", "deselectColumns", "deselectAllColumns", "selectAllColumns", "getSelectedColumnsData", "navigateTo", "getNextCell", "getPreviousCell", "openAdvancedFilteringDialog", "closeAdvancedFilteringDialog", "endEdit", "beginAddRowById", "beginAddRowByIndex"], templateProps: ["emptyGridTemplate", "addRowEmptyTemplate", "loadingGridTemplate", "dragGhostCustomTemplate", "rowEditTextTemplate", "rowAddTextTemplate", "rowEditActionsTemplate", "rowExpandedIndicatorTemplate", "rowCollapsedIndicatorTemplate", "headerExpandedIndicatorTemplate", "headerCollapsedIndicatorTemplate", "excelStyleHeaderIconTemplate", "sortAscendingHeaderIconTemplate", "sortDescendingHeaderIconTemplate", "sortHeaderIconTemplate", "headSelectorTemplate", "rowSelectorTemplate", "dragIndicatorIconTemplate"], numericProps: ["totalItemCount", "snackbarDisplayTime", "summaryRowHeight", "rowHeight", "totalRecords"], boolProps: ["expandChildren", "showExpandAll", "autoGenerate", "moving", "hideRowSelectors", "rowDraggable", "rowEditable", "isLoading", "allowFiltering", "allowAdvancedFiltering", "showSummaryOnCollapse", "selectRowOnClick"] }, { component: Bp, selector: "igc-paginator", parents: [On, ia, Fo, ko], contentQueries: [], additionalProperties: [{ name: "totalPages", writable: true }, { name: "isLastPage" }, { name: "isFirstPage" }, { name: "nativeElement" }], methods: ["nextPage", "previousPage", "paginate"], numericProps: ["page", "perPage", "totalRecords"], provideAs: Sr }, { component: jv, selector: "igc-pivot-data-selector", parents: [], contentQueries: [], additionalProperties: [{ name: "animationSettings", writable: true }], methods: [], boolProps: ["columnsExpanded", "rowsExpanded", "filtersExpanded", "valuesExpanded"] }, { component: ko, selector: "igc-pivot-grid", parents: [], contentQueries: [{ property: "columnList", childType: ft2, isQueryList: true, descendants: true }, { property: "toolbar", childType: kn, isQueryList: true }, { property: "paginationComponents", childType: Sr, isQueryList: true }], additionalProperties: [{ name: "dimensionsSortingExpressions" }, { name: "allDimensions" }, { name: "rowList" }, { name: "dataRowList" }, { name: "lastSearchInfo" }, { name: "filteredData" }, { name: "filteredSortedData" }, { name: "validation" }, { name: "gridAPI" }, { name: "cdr" }, { name: "navigation", writable: true }, { name: "virtualizationState" }, { name: "nativeElement" }, { name: "defaultRowHeight" }, { name: "defaultHeaderGroupMinWidth" }, { name: "columns" }, { name: "visibleColumns" }, { name: "dataView" }], methods: ["notifyDimensionChange", "toggleColumn", "getColumnGroupExpandState", "toggleRowGroup", "autoSizeRowDimension", "insertDimensionAt", "moveDimension", "removeDimension", "toggleDimension", "insertValueAt", "moveValue", "removeValue", "toggleValue", "sortDimension", "filterDimension", "toggleRow", "getHeaderGroupWidth", "getColumnByName", "getColumnByVisibleIndex", "recalculateAutoSizes", "markForCheck", "getRowData", "sort", "filter", "filterGlobal", "clearFilter", "clearSort", "reflow", "selectRows", "deselectRows", "selectAllRows", "deselectAllRows", "clearCellSelection", "selectRange", "getSelectedRanges", "getSelectedData", "selectedColumns", "selectColumns", "deselectColumns", "deselectAllColumns", "selectAllColumns", "getSelectedColumnsData", "navigateTo"], templateProps: ["valueChipTemplate", "rowDimensionHeaderTemplate", "emptyPivotGridTemplate", "emptyGridTemplate", "loadingGridTemplate", "dragGhostCustomTemplate", "rowEditTextTemplate", "rowAddTextTemplate", "rowEditActionsTemplate", "rowExpandedIndicatorTemplate", "rowCollapsedIndicatorTemplate", "headerExpandedIndicatorTemplate", "headerCollapsedIndicatorTemplate", "excelStyleHeaderIconTemplate", "sortAscendingHeaderIconTemplate", "sortDescendingHeaderIconTemplate", "sortHeaderIconTemplate", "headSelectorTemplate", "rowSelectorTemplate"], numericProps: ["rowHeight"], boolProps: ["autoGenerateConfig", "superCompactMode", "defaultExpandState", "isLoading", "selectRowOnClick"] }, { component: Wn, selector: "igc-row-island", parents: [Fo, Wn], contentQueries: [{ property: "children", childType: Wn, isQueryList: true }, { property: "childLayoutList", childType: Wn, isQueryList: true }, { property: "childColumns", childType: ft2, isQueryList: true }, { property: "actionStripComponents", childType: Rn, isQueryList: true }, { property: "columnList", childType: ft2, isQueryList: true, descendants: true }], additionalProperties: [{ name: "rowIslandAPI", writable: true }, { name: "gridAPI", writable: true }, { name: "shouldGenerate", writable: true }, { name: "rowList" }, { name: "dataRowList" }, { name: "transactions" }, { name: "validation" }, { name: "cdr" }, { name: "navigation", writable: true }, { name: "nativeElement" }, { name: "defaultRowHeight" }, { name: "defaultHeaderGroupMinWidth" }, { name: "columns" }, { name: "pinnedRows" }], methods: ["isRecordPinnedByIndex", "toggleColumnVisibility", "expandAll", "collapseAll", "expandRow", "collapseRow", "toggleRow", "getHeaderGroupWidth", "getColumnByName", "getColumnByVisibleIndex", "recalculateAutoSizes", "moveColumn", "markForCheck", "addRow", "deleteRow", "updateCell", "updateRow", "getRowData", "sort", "filter", "filterGlobal", "enableSummaries", "disableSummaries", "clearFilter", "clearSort", "pinColumn", "unpinColumn", "pinRow", "unpinRow", "findNext", "findPrev", "refreshSearch", "clearSearch", "getPinnedWidth", "selectRows", "deselectRows", "selectAllRows", "deselectAllRows", "clearCellSelection", "selectRange", "getSelectedRanges", "getSelectedData", "selectedColumns", "selectColumns", "deselectColumns", "deselectAllColumns", "selectAllColumns", "getSelectedColumnsData", "navigateTo", "getNextCell", "getPreviousCell", "openAdvancedFilteringDialog", "closeAdvancedFilteringDialog", "endEdit", "beginAddRowById", "beginAddRowByIndex"], templateProps: ["toolbarTemplate", "paginatorTemplate", "emptyGridTemplate", "addRowEmptyTemplate", "loadingGridTemplate", "dragGhostCustomTemplate", "rowEditTextTemplate", "rowAddTextTemplate", "rowEditActionsTemplate", "rowExpandedIndicatorTemplate", "rowCollapsedIndicatorTemplate", "headerExpandedIndicatorTemplate", "headerCollapsedIndicatorTemplate", "excelStyleHeaderIconTemplate", "sortAscendingHeaderIconTemplate", "sortDescendingHeaderIconTemplate", "sortHeaderIconTemplate", "headSelectorTemplate", "rowSelectorTemplate", "dragIndicatorIconTemplate"], numericProps: ["snackbarDisplayTime", "summaryRowHeight", "rowHeight", "totalRecords"], boolProps: ["expandChildren", "showExpandAll", "autoGenerate", "moving", "hideRowSelectors", "rowDraggable", "rowEditable", "isLoading", "allowFiltering", "allowAdvancedFiltering", "showSummaryOnCollapse", "selectRowOnClick"] }, { component: ia, selector: "igc-tree-grid", parents: [], contentQueries: [{ property: "columnList", childType: ft2, isQueryList: true, descendants: true }, { property: "actionStripComponents", childType: Rn, isQueryList: true }, { property: "toolbar", childType: kn, isQueryList: true }, { property: "paginationComponents", childType: Sr, isQueryList: true }], additionalProperties: [{ name: "rootRecords", writable: true }, { name: "records", writable: true }, { name: "processedRootRecords", writable: true }, { name: "processedRecords", writable: true }, { name: "selectedCells" }, { name: "shouldGenerate", writable: true }, { name: "rowList" }, { name: "dataRowList" }, { name: "hiddenColumnsCount" }, { name: "pinnedColumnsCount" }, { name: "lastSearchInfo" }, { name: "filteredData" }, { name: "filteredSortedData" }, { name: "validation" }, { name: "gridAPI" }, { name: "cdr" }, { name: "navigation", writable: true }, { name: "virtualizationState" }, { name: "nativeElement" }, { name: "defaultRowHeight" }, { name: "defaultHeaderGroupMinWidth" }, { name: "columns" }, { name: "pinnedColumns" }, { name: "pinnedRows" }, { name: "unpinnedColumns" }, { name: "visibleColumns" }, { name: "dataView" }], methods: ["getDefaultExpandState", "expandAll", "collapseAll", "addRow", "beginAddRowByIndex", "getSelectedData", "getRowByIndex", "getRowByKey", "getCellByColumn", "getCellByKey", "pinRow", "unpinRow", "isRecordPinnedByIndex", "toggleColumnVisibility", "expandRow", "collapseRow", "toggleRow", "getHeaderGroupWidth", "getColumnByName", "getColumnByVisibleIndex", "recalculateAutoSizes", "moveColumn", "markForCheck", "deleteRow", "updateCell", "updateRow", "getRowData", "sort", "filter", "filterGlobal", "enableSummaries", "disableSummaries", "clearFilter", "clearSort", "pinColumn", "unpinColumn", "reflow", "findNext", "findPrev", "refreshSearch", "clearSearch", "getPinnedWidth", "selectRows", "deselectRows", "selectAllRows", "deselectAllRows", "clearCellSelection", "selectRange", "getSelectedRanges", "selectedColumns", "selectColumns", "deselectColumns", "deselectAllColumns", "selectAllColumns", "getSelectedColumnsData", "navigateTo", "getNextCell", "getPreviousCell", "openAdvancedFilteringDialog", "closeAdvancedFilteringDialog", "endEdit", "beginAddRowById"], templateProps: ["rowLoadingIndicatorTemplate", "emptyGridTemplate", "addRowEmptyTemplate", "loadingGridTemplate", "dragGhostCustomTemplate", "rowEditTextTemplate", "rowAddTextTemplate", "rowEditActionsTemplate", "rowExpandedIndicatorTemplate", "rowCollapsedIndicatorTemplate", "headerExpandedIndicatorTemplate", "headerCollapsedIndicatorTemplate", "excelStyleHeaderIconTemplate", "sortAscendingHeaderIconTemplate", "sortDescendingHeaderIconTemplate", "sortHeaderIconTemplate", "headSelectorTemplate", "rowSelectorTemplate", "dragIndicatorIconTemplate"], numericProps: ["expansionDepth", "snackbarDisplayTime", "summaryRowHeight", "rowHeight", "totalRecords"], boolProps: ["cascadeOnDelete", "autoGenerate", "moving", "hideRowSelectors", "rowDraggable", "rowEditable", "isLoading", "allowFiltering", "allowAdvancedFiltering", "showSummaryOnCollapse", "batchEditing", "selectRowOnClick"] }];
 var Xv = { schedule(n38, t) {
   let o = setTimeout(n38, t);
   return () => clearTimeout(o);
@@ -50040,7 +50036,7 @@ function rIe(n38) {
   }), t;
 }
 function oIe(n38, t) {
-  return t.get($o).resolveComponentFactory(n38).inputs;
+  return t.get(jo).resolveComponentFactory(n38).inputs;
 }
 function sIe(n38, t) {
   let o = n38.childNodes, e = t.map(() => []), i = -1;
@@ -50058,7 +50054,7 @@ function aIe(n38, t, o) {
 var lIe = 10;
 var iI = class {
   constructor(t, o) {
-    this.componentFactory = o.get($o).resolveComponentFactory(t);
+    this.componentFactory = o.get(jo).resolveComponentFactory(t);
   }
   create(t) {
     return new nI(this.componentFactory, t);
@@ -50192,7 +50188,7 @@ function DO(n38, t) {
 var cIe = 10;
 var Zv = class {
   constructor(t, o) {
-    this.componentFactory = o.get($o).resolveComponentFactory(t);
+    this.componentFactory = o.get(jo).resolveComponentFactory(t);
   }
   create(t) {
     return new am(this.componentFactory, t);
@@ -50587,7 +50583,7 @@ var nx = (() => {
     }
   };
   t.\u0275fac = function(i) {
-    return new (i || t)(we2(Io), we2(ye2, 8));
+    return new (i || t)(we2(Co), we2(ye2, 8));
   }, t.\u0275prov = he2({ token: t, factory: t.\u0275fac });
   let n38 = t;
   return n38;
@@ -51752,7 +51748,7 @@ var cm = "void";
 var gI = new pm(cm);
 var TI = class {
   constructor(t, o, e) {
-    this.id = t, this.hostElement = o, this._engine = e, this.players = [], this._triggers = /* @__PURE__ */ new Map(), this._queue = [], this._elementListeners = /* @__PURE__ */ new Map(), this._hostClassName = "ng-tns-" + t, Oo(o, this._hostClassName);
+    this.id = t, this.hostElement = o, this._engine = e, this.players = [], this._triggers = /* @__PURE__ */ new Map(), this._queue = [], this._elementListeners = /* @__PURE__ */ new Map(), this._hostClassName = "ng-tns-" + t, Vo(o, this._hostClassName);
   }
   listen(t, o, e, i) {
     if (!this._triggers.has(o)) throw WIe(e, o);
@@ -51761,7 +51757,7 @@ var TI = class {
     let r = ro(this._elementListeners, t, []), s = { name: o, phase: e, callback: i };
     r.push(s);
     let a = ro(this._engine.statesByElement, t, /* @__PURE__ */ new Map());
-    return a.has(o) || (Oo(t, rx), Oo(t, rx + "-" + o), a.set(o, gI)), () => {
+    return a.has(o) || (Vo(t, rx), Vo(t, rx + "-" + o), a.set(o, gI)), () => {
       this._engine.afterFlush(() => {
         let l = r.indexOf(s);
         l >= 0 && r.splice(l, 1), this._triggers.has(o) || a.delete(o);
@@ -51778,7 +51774,7 @@ var TI = class {
   }
   trigger(t, o, e, i = true) {
     let r = this._getTrigger(o), s = new hm(this.id, o, t), a = this._engine.statesByElement.get(t);
-    a || (Oo(t, rx), Oo(t, rx + "-" + o), this._engine.statesByElement.set(t, a = /* @__PURE__ */ new Map()));
+    a || (Vo(t, rx), Vo(t, rx + "-" + o), this._engine.statesByElement.set(t, a = /* @__PURE__ */ new Map()));
     let l = a.get(o), c = new pm(e, this.id);
     if (!(e && e.hasOwnProperty("value")) && l && c.absorbOptions(l.options), a.set(o, c), l || (l = gI), !(c.value === cm) && l.value === c.value) {
       if (!B4e(l.params, c.params)) {
@@ -51798,7 +51794,7 @@ var TI = class {
       if (!i) return;
       w = r.fallbackTransition, I = true;
     }
-    return this._engine.totalQueuedPlayers++, this._queue.push({ element: t, triggerName: o, transition: w, fromState: l, toState: c, player: s, isFallbackTransition: I }), I || (Oo(t, HO), s.onStart(() => {
+    return this._engine.totalQueuedPlayers++, this._queue.push({ element: t, triggerName: o, transition: w, fromState: l, toState: c, player: s, isFallbackTransition: I }), I || (Vo(t, HO), s.onStart(() => {
       $p(t, HO);
     })), s.onDone(() => {
       let R = this.players.indexOf(s);
@@ -51876,7 +51872,7 @@ var TI = class {
     }
   }
   insertNode(t, o) {
-    Oo(t, this._hostClassName);
+    Vo(t, this._hostClassName);
   }
   drainQueuedTransitions(t) {
     let o = [];
@@ -51993,7 +51989,7 @@ var RI = class {
     this.collectedEnterElements.push(t);
   }
   markElementAsDisabled(t, o) {
-    o ? this.disabledNodes.has(t) || (this.disabledNodes.add(t), Oo(t, hI)) : this.disabledNodes.has(t) && (this.disabledNodes.delete(t), $p(t, hI));
+    o ? this.disabledNodes.has(t) || (this.disabledNodes.add(t), Vo(t, hI)) : this.disabledNodes.has(t) && (this.disabledNodes.delete(t), $p(t, hI));
   }
   removeNode(t, o, e) {
     if (ax(o)) {
@@ -52051,7 +52047,7 @@ var RI = class {
     let o = [];
     if (this.newHostElements.size && (this.newHostElements.forEach((e, i) => this._balanceNamespaceList(e, i)), this.newHostElements.clear()), this.totalAnimations && this.collectedEnterElements.length) for (let e = 0; e < this.collectedEnterElements.length; e++) {
       let i = this.collectedEnterElements[e];
-      Oo(i, P4e);
+      Vo(i, P4e);
     }
     if (this._namespaceList.length && (this.totalQueuedPlayers || this.collectedLeaveElements.length)) {
       let e = [];
@@ -52084,7 +52080,7 @@ var RI = class {
     let g = this.bodyNode, v = Array.from(this.statesByElement.keys()), w = GO(v, this.collectedEnterElements), I = /* @__PURE__ */ new Map(), R = 0;
     w.forEach((Pe2, Me) => {
       let Qe2 = QO + R++;
-      I.set(Me, Qe2), Pe2.forEach((_t2) => Oo(_t2, Qe2));
+      I.set(Me, Qe2), Pe2.forEach((_t2) => Vo(_t2, Qe2));
     });
     let V = [], L = /* @__PURE__ */ new Set(), J = /* @__PURE__ */ new Set();
     for (let Pe2 = 0; Pe2 < this.collectedLeaveElements.length; Pe2++) {
@@ -52094,7 +52090,7 @@ var RI = class {
     let te2 = /* @__PURE__ */ new Map(), se = GO(v, Array.from(L));
     se.forEach((Pe2, Me) => {
       let Qe2 = fI + R++;
-      te2.set(Me, Qe2), Pe2.forEach((_t2) => Oo(_t2, Qe2));
+      te2.set(Me, Qe2), Pe2.forEach((_t2) => Vo(_t2, Qe2));
     }), t.push(() => {
       w.forEach((Pe2, Me) => {
         let Qe2 = I.get(Me);
@@ -52113,10 +52109,10 @@ var RI = class {
         let mn = Bi[gs];
         if (mn && mn.setForMove) {
           if (mn.previousTriggersValues && mn.previousTriggersValues.has(Qe2.triggerName)) {
-            let No = mn.previousTriggersValues.get(Qe2.triggerName), br = this.statesByElement.get(Qe2.element);
+            let Oo = mn.previousTriggersValues.get(Qe2.triggerName), br = this.statesByElement.get(Qe2.element);
             if (br && br.has(Qe2.triggerName)) {
               let _c = br.get(Qe2.triggerName);
-              _c.value = No, br.set(Qe2.triggerName, _c);
+              _c.value = Oo, br.set(Qe2.triggerName, _c);
             }
           }
           _t2.destroy();
@@ -52141,14 +52137,14 @@ var RI = class {
         mn.stretchStartingKeyframe = true, this.disabledNodes.has(mn.element) || gn.push(mn);
       }), zt2.timelines = gn, e.append(Bi, zt2.timelines);
       let $a = { instruction: zt2, player: _t2, element: Bi };
-      s.push($a), zt2.queriedElements.forEach((mn) => ro(a, mn, []).push(_t2)), zt2.preStyleProps.forEach((mn, No) => {
+      s.push($a), zt2.queriedElements.forEach((mn) => ro(a, mn, []).push(_t2)), zt2.preStyleProps.forEach((mn, Oo) => {
         if (mn.size) {
-          let br = l.get(No);
-          br || l.set(No, br = /* @__PURE__ */ new Set()), mn.forEach((_c, vd) => br.add(vd));
+          let br = l.get(Oo);
+          br || l.set(Oo, br = /* @__PURE__ */ new Set()), mn.forEach((_c, vd) => br.add(vd));
         }
-      }), zt2.postStyleProps.forEach((mn, No) => {
-        let br = c.get(No);
-        br || c.set(No, br = /* @__PURE__ */ new Set()), mn.forEach((_c, vd) => br.add(vd));
+      }), zt2.postStyleProps.forEach((mn, Oo) => {
+        let br = c.get(Oo);
+        br || c.set(Oo, br = /* @__PURE__ */ new Set()), mn.forEach((_c, vd) => br.add(vd));
       });
     });
     if (be2.length) {
@@ -52290,7 +52286,7 @@ var RI = class {
     });
     c.forEach((I) => {
       ro(this.playersByQueriedElement, I.element, []).push(I), I.onDone(() => V4e(this.playersByQueriedElement, I.element, I));
-    }), d.forEach((I) => Oo(I, kO));
+    }), d.forEach((I) => Vo(I, kO));
     let w = fc(v);
     return w.onDestroy(() => {
       d.forEach((I) => $p(I, kO)), na(l, o.toStyles);
@@ -52422,7 +52418,7 @@ function GO(n38, t) {
     l !== e && o.get(l).push(a);
   }), o;
 }
-function Oo(n38, t) {
+function Vo(n38, t) {
   n38.classList?.add(t);
 }
 function $p(n38, t) {
@@ -52870,11 +52866,11 @@ var Z4e = Wi(ia, { injector: Hi, registerConfig: Ui });
 var GI = qi(Z4e, () => {
   Qi(GI);
 });
-var J4e = Wi(Vo, { injector: Hi, registerConfig: Ui });
+var J4e = Wi(Fo, { injector: Hi, registerConfig: Ui });
 var jI = qi(J4e, () => {
   Qi(jI);
 });
-var eSe = Wi(Fo, { injector: Hi, registerConfig: Ui });
+var eSe = Wi(ko, { injector: Hi, registerConfig: Ui });
 var $I = qi(eSe, () => {
   Qi($I);
 });