claude-threads 0.44.0 → 0.45.0

package/CHANGELOG.md

@@ -7,6 +7,20 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 
 ## [Unreleased]
 
+## [0.45.0] - 2026-01-07
+
+### Added
+- **Update modal in CLI UI** - Press `u` to open a modal showing update status, changelog, and options to apply or defer updates
+- **Worktree path shortening** - Tool output shows shortened worktree paths as `[branch]/path` instead of full paths for readability
+
+### Fixed
+- **Duplicate task list posts in Slack** - Fixed race condition that caused double task list messages
+- **Worktree prompt cleanup** - Remove ❌ reaction from worktree prompts after user responds
+- **Streaming message failures** - Handle `updatePost` failures gracefully with automatic recovery
+
+### Changed
+- **`.claude-threads-meta.json` added to .gitignore** - Session metadata files are no longer tracked
+
 ## [0.44.0] - 2026-01-07
 
 ### Added

package/dist/index.js

@@ -45274,12 +45274,11 @@ async function flush(session, registerPost) {
       if (breakInfo && breakInfo.position < content.length) {
         breakPoint = breakInfo.position;
       } else {
-        const result = await withErrorHandling(() => session.platform.updatePost(session.currentPostId, content), { action: "Update post (no breakpoint)", session });
-        if (result === undefined) {
-          sessionLog(session).warn("Update failed (no breakpoint), starting new message");
+        try {
+          await session.platform.updatePost(session.currentPostId, content);
+        } catch {
+          sessionLog(session).debug("Update failed (no breakpoint), will create new post on next flush");
           session.currentPostId = null;
-          session.currentPostContent = "";
-          return flush(session, registerPost);
         }
         return;
       }
@@ -45295,20 +45294,18 @@ async function flush(session, registerPost) {
     const firstPartWithMarker = remainder ? firstPart + `
 
 ` + formatter2.formatItalic("... (continued below)") : firstPart;
-    const updateResult = await withErrorHandling(() => session.platform.updatePost(session.currentPostId, firstPartWithMarker), { action: "Update post with first part", session });
-    if (updateResult === undefined) {
-      sessionLog(session).warn("Update failed during split, including content in new message");
-      session.pendingContent = content;
-    } else {
-      session.pendingContent = remainder;
+    try {
+      await session.platform.updatePost(session.currentPostId, firstPartWithMarker);
+    } catch {
+      sessionLog(session).debug("Update failed during split, continuing with new post");
     }
     session.currentPostId = null;
-    const contentToPost = session.pendingContent;
-    if (contentToPost) {
-      const continuationMarker = updateResult !== undefined ? formatter2.formatItalic("(continued)") + `
+    session.pendingContent = remainder;
+    if (remainder) {
+      const continuationMarker = formatter2.formatItalic("(continued)");
+      const continuationContent = continuationMarker + `
 
-` : "";
-      const continuationContent = continuationMarker + contentToPost;
+` + remainder;
       const hasActiveTasks = session.tasksPostId && session.lastTasksContent && !session.tasksCompleted;
       if (hasActiveTasks) {
         const postId = await bumpTasksToBottomWithContent(session, continuationContent, registerPost);
@@ -45332,12 +45329,11 @@ async function flush(session, registerPost) {
 ` + formatter2.formatItalic("... (truncated)");
   }
   if (session.currentPostId) {
-    const result = await withErrorHandling(() => session.platform.updatePost(session.currentPostId, content), { action: "Update current post", session });
-    if (result === undefined) {
-      sessionLog(session).warn("Update failed, starting new message");
+    try {
+      await session.platform.updatePost(session.currentPostId, content);
+    } catch {
+      sessionLog(session).debug("Update failed, will create new post on next flush");
       session.currentPostId = null;
-      session.currentPostContent = "";
-      return flush(session, registerPost);
     }
   } else {
     const hasActiveTasks = session.tasksPostId && session.lastTasksContent && !session.tasksCompleted;
@@ -45981,15 +45977,22 @@ class ArrayDiff extends Diff {
 var arrayDiff = new ArrayDiff;
 
 // src/utils/tool-formatter.ts
-var DEFAULT_OPTIONS = {
-  detailed: false,
-  maxCommandLength: 50,
-  maxPathLength: 60,
-  maxPreviewLines: 20
-};
-function shortenPath(path2, homeDir) {
+var DEFAULT_DETAILED = false;
+var DEFAULT_MAX_COMMAND_LENGTH = 50;
+var DEFAULT_MAX_PREVIEW_LINES = 20;
+function shortenPath(path2, homeDir, worktreeInfo) {
   if (!path2)
     return "";
+  if (worktreeInfo?.path && worktreeInfo?.branch) {
+    const worktreePath = worktreeInfo.path.endsWith("/") ? worktreeInfo.path : worktreeInfo.path + "/";
+    if (path2.startsWith(worktreePath)) {
+      const relativePath = path2.slice(worktreePath.length);
+      return `[${worktreeInfo.branch}]/${relativePath}`;
+    }
+    if (path2 === worktreeInfo.path) {
+      return `[${worktreeInfo.branch}]/`;
+    }
+  }
   const home = homeDir ?? process.env.HOME ?? "";
   if (home && path2.startsWith(home)) {
     return "~" + path2.slice(home.length);
@@ -46008,8 +46011,10 @@ function parseMcpToolName(toolName) {
   };
 }
 function formatToolUse(toolName, input, formatter, options = {}) {
-  const opts = { ...DEFAULT_OPTIONS, ...options };
-  const short = (p) => shortenPath(p);
+  const detailed = options.detailed ?? DEFAULT_DETAILED;
+  const maxCommandLength = options.maxCommandLength ?? DEFAULT_MAX_COMMAND_LENGTH;
+  const maxPreviewLines = options.maxPreviewLines ?? DEFAULT_MAX_PREVIEW_LINES;
+  const short = (p) => shortenPath(p, undefined, options.worktreeInfo);
   switch (toolName) {
     case "Read":
       return `\uD83D\uDCC4 ${formatter.formatBold("Read")} ${formatter.formatCode(short(input.file_path))}`;
@@ -46017,9 +46022,9 @@ function formatToolUse(toolName, input, formatter, options = {}) {
       const filePath = short(input.file_path);
       const oldStr = input.old_string || "";
       const newStr = input.new_string || "";
-      if (opts.detailed && (oldStr || newStr)) {
+      if (detailed && (oldStr || newStr)) {
         const changes = diffLines(oldStr, newStr);
-        const maxLines = opts.maxPreviewLines;
+        const maxLines = maxPreviewLines;
         let lineCount = 0;
         const diffLines2 = [];
         for (const change of changes) {
@@ -46064,7 +46069,7 @@ ${formatter.formatCodeBlock(diffLines2.join(`
       const lines = content.split(`
 `);
       const lineCount = lines.length;
-      if (opts.detailed && content && lineCount > 0) {
+      if (detailed && content && lineCount > 0) {
         const maxLines = 6;
         const previewLines = lines.slice(0, maxLines);
         let preview = `\uD83D\uDCDD ${formatter.formatBold("Write")} ${formatter.formatCode(filePath)} ${formatter.formatItalic(`(${lineCount} lines)`)}
@@ -46082,8 +46087,8 @@ ${formatter.formatCodeBlock(diffLines2.join(`
       return `\uD83D\uDCDD ${formatter.formatBold("Write")} ${formatter.formatCode(filePath)}`;
     }
     case "Bash": {
-      const cmd = (input.command || "").substring(0, opts.maxCommandLength);
-      const truncated = cmd.length >= opts.maxCommandLength;
+      const cmd = (input.command || "").substring(0, maxCommandLength);
+      const truncated = cmd.length >= maxCommandLength;
       return `\uD83D\uDCBB ${formatter.formatBold("Bash")} ${formatter.formatCode(cmd + (truncated ? "..." : ""))}`;
     }
     case "Glob":
@@ -46373,7 +46378,8 @@ function formatEvent(session, e, ctx) {
           if (text)
             parts.push(text);
         } else if (block.type === "tool_use" && block.name) {
-          const formatted = formatToolUse(block.name, block.input || {}, session.platform.getFormatter(), { detailed: true });
+          const worktreeInfo = session.worktreeInfo ? { path: session.worktreeInfo.worktreePath, branch: session.worktreeInfo.branch } : undefined;
+          const formatted = formatToolUse(block.name, block.input || {}, session.platform.getFormatter(), { detailed: true, worktreeInfo });
           if (formatted)
             parts.push(formatted);
         } else if (block.type === "thinking" && block.thinking) {
@@ -46401,7 +46407,8 @@ function formatEvent(session, e, ctx) {
       if (tool.id) {
         session.activeToolStarts.set(tool.id, Date.now());
       }
-      return formatToolUse(tool.name, tool.input || {}, session.platform.getFormatter(), { detailed: true }) || null;
+      const worktreeInfo = session.worktreeInfo ? { path: session.worktreeInfo.worktreePath, branch: session.worktreeInfo.branch } : undefined;
+      return formatToolUse(tool.name, tool.input || {}, session.platform.getFormatter(), { detailed: true, worktreeInfo }) || null;
     }
     case "tool_result": {
       const result = e.tool_result;
@@ -46477,6 +46484,9 @@ async function handleExitPlanMode(session, toolUseId, ctx) {
   ctx.ops.stopTyping(session);
 }
 async function handleTodoWrite(session, input, ctx) {
+  if (session.taskListCreationPromise) {
+    await session.taskListCreationPromise;
+  }
   const todos = input.todos;
   if (!todos || todos.length === 0) {
     session.tasksCompleted = true;
@@ -46558,12 +46568,21 @@ async function handleTodoWrite(session, input, ctx) {
   if (existingTasksPostId) {
     await withErrorHandling(() => session.platform.updatePost(existingTasksPostId, displayMessage), { action: "Update tasks", session });
   } else {
-    const post = await withErrorHandling(() => session.platform.createInteractivePost(displayMessage, [TASK_TOGGLE_EMOJIS[0]], session.threadId), { action: "Create tasks post", session });
-    if (post) {
-      session.tasksPostId = post.id;
-      ctx.ops.registerPost(post.id, session.threadId);
-      updateLastMessage(session, post);
-      await session.platform.pinPost(post.id).catch(() => {});
+    let resolveCreation;
+    session.taskListCreationPromise = new Promise((resolve2) => {
+      resolveCreation = resolve2;
+    });
+    try {
+      const post = await withErrorHandling(() => session.platform.createInteractivePost(displayMessage, [TASK_TOGGLE_EMOJIS[0]], session.threadId), { action: "Create tasks post", session });
+      if (post) {
+        session.tasksPostId = post.id;
+        ctx.ops.registerPost(post.id, session.threadId);
+        updateLastMessage(session, post);
+        await session.platform.pinPost(post.id).catch(() => {});
+      }
+    } finally {
+      resolveCreation();
+      session.taskListCreationPromise = undefined;
     }
   }
   ctx.ops.updateStickyMessage().catch(() => {});
@@ -52250,6 +52269,7 @@ async function handleWorktreeSkip(session, username, persistSession, offerContex
   const promptPostId = session.worktreePromptPostId;
   if (promptPostId) {
     await withErrorHandling(() => session.platform.updatePost(promptPostId, `\u2705 Continuing in main repo (skipped by @${username})`), { action: "Update worktree prompt", session });
+    await withErrorHandling(() => session.platform.removeReaction(promptPostId, "x"), { action: "Remove x reaction from worktree prompt", session });
   }
   session.pendingWorktreePrompt = false;
   session.worktreePromptPostId = undefined;
@@ -52284,6 +52304,7 @@ async function createAndSwitchToWorktree(session, branch, username, options) {
       const worktreePromptId = session.worktreePromptPostId;
       if (worktreePromptId) {
         await withErrorHandling(() => session.platform.updatePost(worktreePromptId, `\u2705 Joining existing worktree for ${fmt.formatCode(branch)}`), { action: "Update worktree prompt", session });
+        await withErrorHandling(() => session.platform.removeReaction(worktreePromptId, "x"), { action: "Remove x reaction from worktree prompt", session });
       }
       const queuedPrompt = session.queuedPrompt;
       const queuedFiles = session.queuedFiles;
@@ -52365,6 +52386,7 @@ ${fmt.formatItalic("Claude Code restarted in the worktree")}`);
     const worktreePromptId = session.worktreePromptPostId;
     if (worktreePromptId) {
       await withErrorHandling(() => session.platform.updatePost(worktreePromptId, `\u2705 Created worktree for \`${branch}\``), { action: "Update worktree prompt", session });
+      await withErrorHandling(() => session.platform.removeReaction(worktreePromptId, "x"), { action: "Remove x reaction from worktree prompt", session });
     }
     const wasPending = session.pendingWorktreePrompt;
     session.pendingWorktreePrompt = false;
@@ -52431,6 +52453,7 @@ ${fmt.formatItalic("Claude Code restarted in the new worktree")}`);
     const worktreePromptId = session.worktreePromptPostId;
     if (worktreePromptId) {
       await withErrorHandling(() => session.platform.updatePost(worktreePromptId, `\u274C Failed to create worktree for ${fmt.formatCode(branch)} - continuing in main repo`), { action: "Update worktree prompt after failure", session });
+      await withErrorHandling(() => session.platform.removeReaction(worktreePromptId, "x"), { action: "Remove x reaction from worktree prompt", session });
     }
     const wasPending = session.pendingWorktreePrompt;
     session.pendingWorktreePrompt = false;
@@ -59517,6 +59540,8 @@ var use_input_default = useInput;
 var import_react20 = __toESM(require_react(), 1);
 // node_modules/ink/build/hooks/use-stdout.js
 var import_react21 = __toESM(require_react(), 1);
+var useStdout = () => import_react21.useContext(StdoutContext_default);
+var use_stdout_default = useStdout;
 // node_modules/ink/build/hooks/use-stderr.js
 var import_react22 = __toESM(require_react(), 1);
 // node_modules/ink/build/hooks/use-focus.js
@@ -62860,7 +62885,8 @@ function CollapsibleSession(props) {
 }
 // src/ui/components/StatusLine.tsx
 var jsx_dev_runtime7 = __toESM(require_jsx_dev_runtime(), 1);
-function ToggleKey({ keyChar, label, enabled }) {
+function ToggleKey({ keyChar, label, enabled, color }) {
+  const displayColor = color ?? (enabled ? "green" : "gray");
   return /* @__PURE__ */ jsx_dev_runtime7.jsxDEV(Box_default, {
     gap: 0,
     children: [
@@ -62869,7 +62895,7 @@ function ToggleKey({ keyChar, label, enabled }) {
         children: "["
       }, undefined, false, undefined, this),
       /* @__PURE__ */ jsx_dev_runtime7.jsxDEV(Text, {
-        color: enabled ? "green" : "gray",
+        color: displayColor,
         bold: true,
         children: keyChar
       }, undefined, false, undefined, this),
@@ -62878,12 +62904,44 @@ function ToggleKey({ keyChar, label, enabled }) {
         children: "]"
       }, undefined, false, undefined, this),
       /* @__PURE__ */ jsx_dev_runtime7.jsxDEV(Text, {
-        color: enabled ? "green" : "gray",
+        color: displayColor,
         children: label
       }, undefined, false, undefined, this)
     ]
   }, undefined, true, undefined, this);
 }
+function getUpdateColor(state) {
+  if (!state)
+    return "gray";
+  switch (state.status) {
+    case "available":
+      return "green";
+    case "scheduled":
+    case "installing":
+    case "pending_restart":
+      return "yellow";
+    case "failed":
+      return "red";
+    case "deferred":
+    case "idle":
+    default:
+      return "gray";
+  }
+}
+function getUpdateIndicator(state) {
+  if (!state)
+    return "";
+  switch (state.status) {
+    case "available":
+      return " \uD83C\uDD95";
+    case "installing":
+      return " \uD83D\uDCE6";
+    case "failed":
+      return " \u274C";
+    default:
+      return "";
+  }
+}
 function PlatformToggle({
   index,
   platform: platform2
@@ -62927,9 +62985,12 @@ function StatusLine({
   shuttingDown,
   sessionCount,
   toggles,
-  platforms
+  platforms,
+  updateState
 }) {
   const platformList = Array.from(platforms.values());
+  const updateColor = getUpdateColor(updateState);
+  const updateIndicator = getUpdateIndicator(updateState);
   return /* @__PURE__ */ jsx_dev_runtime7.jsxDEV(Box_default, {
     flexDirection: "column",
     marginTop: 1,
@@ -63002,6 +63063,20 @@ function StatusLine({
                 label: "eep-alive",
                 enabled: toggles.keepAliveEnabled
               }, undefined, false, undefined, this),
+              /* @__PURE__ */ jsx_dev_runtime7.jsxDEV(Box_default, {
+                gap: 0,
+                children: [
+                  /* @__PURE__ */ jsx_dev_runtime7.jsxDEV(ToggleKey, {
+                    keyChar: "u",
+                    label: "pdate",
+                    enabled: updateState?.status === "available",
+                    color: updateColor
+                  }, undefined, false, undefined, this),
+                  updateIndicator && /* @__PURE__ */ jsx_dev_runtime7.jsxDEV(Text, {
+                    children: updateIndicator
+                  }, undefined, false, undefined, this)
+                ]
+              }, undefined, true, undefined, this),
               platformList.length > 0 && /* @__PURE__ */ jsx_dev_runtime7.jsxDEV(jsx_dev_runtime7.Fragment, {
                 children: [
                   /* @__PURE__ */ jsx_dev_runtime7.jsxDEV(Text, {
@@ -63093,6 +63168,187 @@ function LogPanel({ logs, maxLines = 10 }) {
     }, log19.id, true, undefined, this))
   }, undefined, false, undefined, this);
 }
+// src/ui/components/Modal.tsx
+var jsx_dev_runtime9 = __toESM(require_jsx_dev_runtime(), 1);
+function Modal({ title, children, hint }) {
+  const { stdout } = use_stdout_default();
+  const terminalWidth = stdout?.columns ?? 80;
+  const modalWidth = Math.min(50, terminalWidth - 4);
+  return /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Box_default, {
+    flexDirection: "column",
+    borderStyle: "round",
+    borderColor: "cyan",
+    paddingX: 1,
+    paddingY: 0,
+    width: modalWidth,
+    children: [
+      /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Box_default, {
+        justifyContent: "center",
+        marginBottom: 1,
+        children: /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Text, {
+          color: "cyan",
+          bold: true,
+          children: title
+        }, undefined, false, undefined, this)
+      }, undefined, false, undefined, this),
+      /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Box_default, {
+        flexDirection: "column",
+        children
+      }, undefined, false, undefined, this),
+      hint && /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Box_default, {
+        justifyContent: "center",
+        marginTop: 1,
+        children: /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Text, {
+          dimColor: true,
+          children: hint
+        }, undefined, false, undefined, this)
+      }, undefined, false, undefined, this)
+    ]
+  }, undefined, true, undefined, this);
+}
+// src/ui/components/UpdateModal.tsx
+var jsx_dev_runtime10 = __toESM(require_jsx_dev_runtime(), 1);
+function formatTime(date) {
+  return date.toLocaleTimeString([], { hour: "2-digit", minute: "2-digit" });
+}
+function getStatusDisplay(state) {
+  switch (state.status) {
+    case "idle":
+      return { icon: "\u2713", label: "Up to date", color: "green" };
+    case "available":
+      return { icon: "\uD83C\uDD95", label: "Update available", color: "green" };
+    case "scheduled":
+      return { icon: "\u23F0", label: "Restart scheduled", color: "yellow" };
+    case "installing":
+      return { icon: "\uD83D\uDCE6", label: "Installing...", color: "cyan" };
+    case "pending_restart":
+      return { icon: "\uD83D\uDD04", label: "Restarting...", color: "yellow" };
+    case "failed":
+      return { icon: "\u274C", label: "Update failed", color: "red" };
+    case "deferred":
+      return { icon: "\u23F8\uFE0F", label: "Update deferred", color: "gray" };
+    default:
+      return { icon: "?", label: "Unknown", color: "gray" };
+  }
+}
+function getHint(state) {
+  const canUpdate = state.status === "available" || state.status === "deferred";
+  if (canUpdate) {
+    return "Press [Shift+U] to update now  |  [u] or [Esc] to close";
+  }
+  return "Press [u] or [Esc] to close";
+}
+function UpdateModal({ state }) {
+  const statusDisplay = getStatusDisplay(state);
+  const hint = getHint(state);
+  return /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Modal, {
+    title: "Update Status",
+    hint,
+    children: [
+      /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Box_default, {
+        flexDirection: "column",
+        gap: 0,
+        children: [
+          /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Box_default, {
+            children: [
+              /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Text, {
+                dimColor: true,
+                children: "Current version: "
+              }, undefined, false, undefined, this),
+              /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Text, {
+                bold: true,
+                children: [
+                  "v",
+                  state.currentVersion
+                ]
+              }, undefined, true, undefined, this)
+            ]
+          }, undefined, true, undefined, this),
+          state.latestVersion && state.latestVersion !== state.currentVersion && /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Box_default, {
+            children: [
+              /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Text, {
+                dimColor: true,
+                children: "Latest version:  "
+              }, undefined, false, undefined, this),
+              /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Text, {
+                bold: true,
+                color: "green",
+                children: [
+                  "v",
+                  state.latestVersion
+                ]
+              }, undefined, true, undefined, this)
+            ]
+          }, undefined, true, undefined, this)
+        ]
+      }, undefined, true, undefined, this),
+      /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Box_default, {
+        marginTop: 1,
+        children: state.status === "installing" ? /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Box_default, {
+          gap: 1,
+          children: [
+            /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Spinner2, {
+              type: "dots"
+            }, undefined, false, undefined, this),
+            /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Text, {
+              color: statusDisplay.color,
+              children: statusDisplay.label
+            }, undefined, false, undefined, this)
+          ]
+        }, undefined, true, undefined, this) : /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Box_default, {
+          gap: 1,
+          children: [
+            /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Text, {
+              children: statusDisplay.icon
+            }, undefined, false, undefined, this),
+            /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Text, {
+              color: statusDisplay.color,
+              children: statusDisplay.label
+            }, undefined, false, undefined, this)
+          ]
+        }, undefined, true, undefined, this)
+      }, undefined, false, undefined, this),
+      state.status === "scheduled" && state.scheduledRestartAt && /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Box_default, {
+        marginTop: 1,
+        children: [
+          /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Text, {
+            dimColor: true,
+            children: "Restart at: "
+          }, undefined, false, undefined, this),
+          /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Text, {
+            children: formatTime(state.scheduledRestartAt)
+          }, undefined, false, undefined, this)
+        ]
+      }, undefined, true, undefined, this),
+      state.status === "deferred" && state.deferredUntil && /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Box_default, {
+        marginTop: 1,
+        children: [
+          /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Text, {
+            dimColor: true,
+            children: "Deferred until: "
+          }, undefined, false, undefined, this),
+          /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Text, {
+            children: formatTime(state.deferredUntil)
+          }, undefined, false, undefined, this)
+        ]
+      }, undefined, true, undefined, this),
+      state.status === "failed" && state.errorMessage && /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Box_default, {
+        marginTop: 1,
+        flexDirection: "column",
+        children: [
+          /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Text, {
+            color: "red",
+            children: "Error:"
+          }, undefined, false, undefined, this),
+          /* @__PURE__ */ jsx_dev_runtime10.jsxDEV(Text, {
+            dimColor: true,
+            children: state.errorMessage
+          }, undefined, false, undefined, this)
+        ]
+      }, undefined, true, undefined, this)
+    ]
+  }, undefined, true, undefined, this);
+}
 // src/ui/hooks/useAppState.ts
 var import_react57 = __toESM(require_react(), 1);
 var logIdCounter = 0;
@@ -63237,15 +63493,26 @@ function useKeyboard({
   onDebugToggle,
   onPermissionsToggle,
   onChromeToggle,
-  onKeepAliveToggle
+  onKeepAliveToggle,
+  onUpdateModalToggle,
+  onForceUpdate,
+  updateModalVisible
 }) {
   use_input_default((input, key) => {
+    if (key.escape && updateModalVisible) {
+      onUpdateModalToggle?.();
+      return;
+    }
     if (input === "\x03" || input === "c" && key.ctrl) {
       if (onQuit) {
         onQuit();
       }
       return;
     }
+    if (input === "U") {
+      onForceUpdate?.();
+      return;
+    }
     const platformIndex = SHIFT_NUMBER_MAP[input];
     if (platformIndex !== undefined && onPlatformToggle) {
       const platformId = platformIds[platformIndex];
@@ -63274,6 +63541,9 @@ function useKeyboard({
       case "k":
         onKeepAliveToggle?.();
         break;
+      case "u":
+        onUpdateModalToggle?.();
+        break;
       case "q":
         onQuit?.();
         break;
@@ -63282,7 +63552,7 @@ function useKeyboard({
 }
 
 // src/ui/App.tsx
-var jsx_dev_runtime9 = __toESM(require_jsx_dev_runtime(), 1);
+var jsx_dev_runtime11 = __toESM(require_jsx_dev_runtime(), 1);
 function App2({ config, onStateReady, onResizeReady, onQuit, toggleCallbacks }) {
   const {
     state,
@@ -63303,7 +63573,12 @@ function App2({ config, onStateReady, onResizeReady, onQuit, toggleCallbacks })
     debugMode: process.env.DEBUG === "1",
     skipPermissions: config.skipPermissions,
     chromeEnabled: config.chromeEnabled,
-    keepAliveEnabled: config.keepAliveEnabled
+    keepAliveEnabled: config.keepAliveEnabled,
+    updateModalVisible: false
+  });
+  const [updateState, setUpdateState] = import_react58.default.useState({
+    status: "idle",
+    currentVersion: config.version
   });
   const handleDebugToggle = import_react58.default.useCallback(() => {
     setToggles((prev) => {
@@ -63334,6 +63609,9 @@ function App2({ config, onStateReady, onResizeReady, onQuit, toggleCallbacks })
       return { ...prev, keepAliveEnabled: newValue };
     });
   }, [toggleCallbacks]);
+  const handleUpdateModalToggle = import_react58.default.useCallback(() => {
+    setToggles((prev) => ({ ...prev, updateModalVisible: !prev.updateModalVisible }));
+  }, []);
   const handlePlatformToggle = import_react58.default.useCallback((platformId) => {
     const newEnabled = togglePlatformEnabled(platformId);
     toggleCallbacks?.onPlatformToggle?.(platformId, newEnabled);
@@ -63348,9 +63626,10 @@ function App2({ config, onStateReady, onResizeReady, onQuit, toggleCallbacks })
       removeSession,
       addLog,
       setPlatformStatus,
+      setUpdateState,
       getToggles
     });
-  }, [onStateReady, setReady, setShuttingDown2, addSession, updateSession, removeSession, addLog, setPlatformStatus, getToggles]);
+  }, [onStateReady, setReady, setShuttingDown2, addSession, updateSession, removeSession, addLog, setPlatformStatus, setUpdateState, getToggles]);
   import_react58.default.useEffect(() => {
     if (onResizeReady) {
       onResizeReady(() => setResizeCount((c) => c + 1));
@@ -63367,58 +63646,61 @@ function App2({ config, onStateReady, onResizeReady, onQuit, toggleCallbacks })
     onDebugToggle: handleDebugToggle,
     onPermissionsToggle: handlePermissionsToggle,
     onChromeToggle: handleChromeToggle,
-    onKeepAliveToggle: handleKeepAliveToggle
+    onKeepAliveToggle: handleKeepAliveToggle,
+    onUpdateModalToggle: handleUpdateModalToggle,
+    onForceUpdate: toggleCallbacks?.onForceUpdate,
+    updateModalVisible: toggles.updateModalVisible
   });
   const staticContent = import_react58.default.useMemo(() => [
-    { id: `header-${resizeCount}`, element: /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Header, {
+    { id: `header-${resizeCount}`, element: /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(Header, {
       version: config.version
     }, undefined, false, undefined, this) },
-    { id: `config-${resizeCount}`, element: /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(ConfigSummary, {
+    { id: `config-${resizeCount}`, element: /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(ConfigSummary, {
       config
     }, undefined, false, undefined, this) }
   ], [config, resizeCount]);
   const globalLogs = getGlobalLogs();
   const hasLogs = globalLogs.length > 0;
   const hasSessions = state.sessions.size > 0;
-  return /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Box_default, {
+  return /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(Box_default, {
     flexDirection: "column",
     children: [
-      /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Static, {
+      /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(Static, {
         items: staticContent,
-        children: (item) => /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Box_default, {
+        children: (item) => /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(Box_default, {
           children: item.element
         }, item.id, false, undefined, this)
       }, undefined, false, undefined, this),
-      /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Platforms, {
+      /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(Platforms, {
         platforms: state.platforms
       }, undefined, false, undefined, this),
-      hasLogs && /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(jsx_dev_runtime9.Fragment, {
+      hasLogs && /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(jsx_dev_runtime11.Fragment, {
         children: [
-          /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Box_default, {
+          /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(Box_default, {
             marginTop: 1,
-            children: /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Text, {
+            children: /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(Text, {
               dimColor: true,
               children: "\u2500".repeat(50)
             }, undefined, false, undefined, this)
           }, undefined, false, undefined, this),
-          /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(LogPanel, {
+          /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(LogPanel, {
             logs: globalLogs,
             maxLines: 10
           }, undefined, false, undefined, this)
         ]
       }, undefined, true, undefined, this),
-      hasSessions && /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(jsx_dev_runtime9.Fragment, {
+      hasSessions && /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(jsx_dev_runtime11.Fragment, {
         children: [
-          /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Box_default, {
+          /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(Box_default, {
             marginTop: 1,
-            children: /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Text, {
+            children: /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(Text, {
               dimColor: true,
               children: "\u2500".repeat(50)
             }, undefined, false, undefined, this)
           }, undefined, false, undefined, this),
-          /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Box_default, {
+          /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(Box_default, {
             marginTop: 0,
-            children: /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(Text, {
+            children: /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(Text, {
               dimColor: true,
               children: [
                 "Sessions (",
@@ -63427,7 +63709,7 @@ function App2({ config, onStateReady, onResizeReady, onQuit, toggleCallbacks })
               ]
             }, undefined, true, undefined, this)
           }, undefined, false, undefined, this),
-          Array.from(state.sessions.entries()).map(([id, session], index) => /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(CollapsibleSession, {
+          Array.from(state.sessions.entries()).map(([id, session], index) => /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(CollapsibleSession, {
             session,
             logs: getLogsForSession(id),
             expanded: state.expandedSessions.has(id),
@@ -63435,12 +63717,20 @@ function App2({ config, onStateReady, onResizeReady, onQuit, toggleCallbacks })
           }, id, false, undefined, this))
         ]
       }, undefined, true, undefined, this),
-      /* @__PURE__ */ jsx_dev_runtime9.jsxDEV(StatusLine, {
+      /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(StatusLine, {
         ready: state.ready,
         shuttingDown: state.shuttingDown,
         sessionCount: state.sessions.size,
         toggles,
-        platforms: state.platforms
+        platforms: state.platforms,
+        updateState
+      }, undefined, false, undefined, this),
+      toggles.updateModalVisible && /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(Box_default, {
+        marginTop: 1,
+        justifyContent: "center",
+        children: /* @__PURE__ */ jsx_dev_runtime11.jsxDEV(UpdateModal, {
+          state: updateState
+        }, undefined, false, undefined, this)
       }, undefined, false, undefined, this)
     ]
   }, undefined, true, undefined, this);
@@ -63487,6 +63777,7 @@ async function startUI(options) {
     removeSession: handlers.removeSession,
     addLog: handlers.addLog,
     setPlatformStatus: handlers.setPlatformStatus,
+    setUpdateState: handlers.setUpdateState,
     waitUntilExit,
     getToggles: handlers.getToggles
   };
@@ -64613,6 +64904,16 @@ async function main() {
           ui.setPlatformStatus(platformId, { connected: false });
           ui.addLog({ level: "info", component: "toggle", message: `\u2713 Platform ${platformId} disabled` });
         }
+      },
+      onForceUpdate: () => {
+        if (autoUpdateManager?.hasUpdate()) {
+          ui.addLog({ level: "info", component: "update", message: "\uD83D\uDE80 Force updating via Shift+U..." });
+          autoUpdateManager.forceUpdate().catch((err) => {
+            ui.addLog({ level: "error", component: "update", message: `Force update failed: ${err}` });
+          });
+        } else {
+          ui.addLog({ level: "info", component: "update", message: "No update available to install" });
+        }
       }
     }
   });
@@ -64677,19 +64978,53 @@ async function main() {
   session.setAutoUpdateManager(autoUpdateManager);
   autoUpdateManager.on("update:available", (info) => {
     ui.addLog({ level: "info", component: "update", message: `\uD83C\uDD95 Update available: v${info.currentVersion} \u2192 v${info.latestVersion}` });
+    ui.setUpdateState({
+      status: "available",
+      currentVersion: info.currentVersion,
+      latestVersion: info.latestVersion
+    });
   });
   autoUpdateManager.on("update:countdown", (seconds) => {
     if (seconds === 60 || seconds === 30 || seconds === 10 || seconds <= 5) {
       ui.addLog({ level: "info", component: "update", message: `\uD83D\uDD04 Restarting in ${seconds} seconds...` });
     }
+    const restartAt = autoUpdateManager?.getScheduledRestartAt();
+    const updateInfo = autoUpdateManager?.getUpdateInfo();
+    if (restartAt) {
+      ui.setUpdateState({
+        status: "scheduled",
+        currentVersion: VERSION,
+        latestVersion: updateInfo?.latestVersion,
+        scheduledRestartAt: restartAt
+      });
+    }
   });
   autoUpdateManager.on("update:status", (status, message) => {
     if (message) {
       ui.addLog({ level: "info", component: "update", message: `\uD83D\uDD04 ${status}: ${message}` });
     }
+    const updateInfo = autoUpdateManager?.getUpdateInfo();
+    const state = autoUpdateManager?.getState();
+    ui.setUpdateState({
+      status,
+      currentVersion: VERSION,
+      latestVersion: updateInfo?.latestVersion,
+      scheduledRestartAt: autoUpdateManager?.getScheduledRestartAt() ?? undefined,
+      errorMessage: state?.errorMessage
+    });
   });
   autoUpdateManager.on("update:failed", (error) => {
     ui.addLog({ level: "error", component: "update", message: `\u274C Update failed: ${error}` });
+    ui.setUpdateState({
+      status: "failed",
+      currentVersion: VERSION,
+      latestVersion: autoUpdateManager?.getUpdateInfo()?.latestVersion,
+      errorMessage: error
+    });
+  });
+  ui.setUpdateState({
+    status: "idle",
+    currentVersion: VERSION
   });
   autoUpdateManager.start();
   ui.setReady();

package/dist/mcp/permission-server.js

@@ -33641,9 +33641,19 @@ function isAllowAllEmoji(emoji3) {
 }
 
 // src/utils/tool-formatter.ts
-function shortenPath(path, homeDir) {
+function shortenPath(path, homeDir, worktreeInfo) {
   if (!path)
     return "";
+  if (worktreeInfo?.path && worktreeInfo?.branch) {
+    const worktreePath = worktreeInfo.path.endsWith("/") ? worktreeInfo.path : worktreeInfo.path + "/";
+    if (path.startsWith(worktreePath)) {
+      const relativePath = path.slice(worktreePath.length);
+      return `[${worktreeInfo.branch}]/${relativePath}`;
+    }
+    if (path === worktreeInfo.path) {
+      return `[${worktreeInfo.branch}]/`;
+    }
+  }
   const home = homeDir ?? process.env.HOME ?? "";
   if (home && path.startsWith(home)) {
     return "~" + path.slice(home.length);
@@ -33661,8 +33671,8 @@ function parseMcpToolName(toolName) {
     tool: parts.slice(2).join("__")
   };
 }
-function formatToolForPermission(toolName, input, formatter) {
-  const short = (p) => shortenPath(p);
+function formatToolForPermission(toolName, input, formatter, options = {}) {
+  const short = (p) => shortenPath(p, undefined, options.worktreeInfo);
   switch (toolName) {
     case "Read":
       return `\uD83D\uDCC4 ${formatter.formatBold("Read")} ${formatter.formatCode(short(input.file_path))}`;

package/package.json

@@ -1,6 +1,6 @@
 {
   "name": "claude-threads",
-  "version": "0.44.0",
+  "version": "0.45.0",
   "description": "Share Claude Code sessions live in a Mattermost channel with interactive features",
   "main": "dist/index.js",
   "type": "module",