bunki 0.5.1 → 0.5.3

package/dist/cli.js

@@ -2133,11 +2133,11 @@ var require_lib = __commonJS((exports, module) => {
   function lookupEscape(ch) {
     return escapeMap[ch];
   }
-  function _prettifyError(path3, withInternals, err) {
+  function _prettifyError(path4, withInternals, err) {
     if (!err.Update) {
       err = new _exports.TemplateError(err);
     }
-    err.Update(path3);
+    err.Update(path4);
     if (!withInternals) {
       var old = err;
       err = new Error(old.message);
@@ -2198,8 +2198,8 @@ var require_lib = __commonJS((exports, module) => {
     err.lineno = lineno;
     err.colno = colno;
     err.firstUpdate = true;
-    err.Update = function Update(path3) {
-      var msg = "(" + (path3 || "unknown path") + ")";
+    err.Update = function Update(path4) {
+      var msg = "(" + (path4 || "unknown path") + ")";
       if (this.firstUpdate) {
         if (this.lineno && this.colno) {
           msg += " [Line " + this.lineno + ", Column " + this.colno + "]";
@@ -6396,7 +6396,7 @@ var require_loader = __commonJS((exports, module) => {
     };
     return _setPrototypeOf(o, p);
   }
-  var path3 = __require("path");
+  var path4 = __require("path");
   var _require = require_object();
   var EmitterObj = _require.EmitterObj;
   module.exports = /* @__PURE__ */ function(_EmitterObj) {
@@ -6406,7 +6406,7 @@ var require_loader = __commonJS((exports, module) => {
     }
     var _proto = Loader.prototype;
     _proto.resolve = function resolve(from, to) {
-      return path3.resolve(path3.dirname(from), to);
+      return path4.resolve(path4.dirname(from), to);
     };
     _proto.isRelative = function isRelative(filename) {
       return filename.indexOf("./") === 0 || filename.indexOf("../") === 0;
@@ -6460,7 +6460,7 @@ var require_precompiled_loader = __commonJS((exports, module) => {
 
 // node_modules/picomatch/lib/constants.js
 var require_constants = __commonJS((exports, module) => {
-  var path3 = __require("path");
+  var path4 = __require("path");
   var WIN_SLASH = "\\\\/";
   var WIN_NO_SLASH = `[^${WIN_SLASH}]`;
   var DOT_LITERAL = "\\.";
@@ -6582,7 +6582,7 @@ var require_constants = __commonJS((exports, module) => {
     CHAR_UNDERSCORE: 95,
     CHAR_VERTICAL_LINE: 124,
     CHAR_ZERO_WIDTH_NOBREAK_SPACE: 65279,
-    SEP: path3.sep,
+    SEP: path4.sep,
     extglobChars(chars) {
       return {
         "!": { type: "negate", open: "(?:(?!(?:", close: `))${chars.STAR})` },
@@ -6600,7 +6600,7 @@ var require_constants = __commonJS((exports, module) => {
 
 // node_modules/picomatch/lib/utils.js
 var require_utils = __commonJS((exports) => {
-  var path3 = __require("path");
+  var path4 = __require("path");
   var win32 = process.platform === "win32";
   var {
     REGEX_BACKSLASH,
@@ -6629,7 +6629,7 @@ var require_utils = __commonJS((exports) => {
     if (options2 && typeof options2.windows === "boolean") {
       return options2.windows;
     }
-    return win32 === true || path3.sep === "\\";
+    return win32 === true || path4.sep === "\\";
   };
   exports.escapeLast = (input, char, lastIdx) => {
     const idx = input.lastIndexOf(char, lastIdx);
@@ -7753,7 +7753,7 @@ var require_parse = __commonJS((exports, module) => {
 
 // node_modules/picomatch/lib/picomatch.js
 var require_picomatch = __commonJS((exports, module) => {
-  var path3 = __require("path");
+  var path4 = __require("path");
   var scan = require_scan();
   var parse2 = require_parse();
   var utils = require_utils();
@@ -7839,7 +7839,7 @@ var require_picomatch = __commonJS((exports, module) => {
   };
   picomatch.matchBase = (input, glob, options2, posix = utils.isWindows(options2)) => {
     const regex = glob instanceof RegExp ? glob : picomatch.makeRe(glob, options2);
-    return regex.test(path3.basename(input));
+    return regex.test(path4.basename(input));
   };
   picomatch.isMatch = (str2, patterns, options2) => picomatch(patterns, options2)(str2);
   picomatch.parse = (pattern, options2) => {
@@ -7948,8 +7948,8 @@ var require_readdirp = __commonJS((exports, module) => {
     static get defaultOptions() {
       return {
         root: ".",
-        fileFilter: (path3) => true,
-        directoryFilter: (path3) => true,
+        fileFilter: (path4) => true,
+        directoryFilter: (path4) => true,
         type: FILE_TYPE,
         lstat: false,
         depth: 2147483648,
@@ -7968,7 +7968,7 @@ var require_readdirp = __commonJS((exports, module) => {
       this._directoryFilter = normalizeFilter(opts.directoryFilter);
       const statMethod = opts.lstat ? lstat : stat;
       if (wantBigintFsStats) {
-        this._stat = (path3) => statMethod(path3, { bigint: true });
+        this._stat = (path4) => statMethod(path4, { bigint: true });
       } else {
         this._stat = statMethod;
       }
@@ -7990,9 +7990,9 @@ var require_readdirp = __commonJS((exports, module) => {
       this.reading = true;
       try {
         while (!this.destroyed && batch > 0) {
-          const { path: path3, depth, files = [] } = this.parent || {};
+          const { path: path4, depth, files = [] } = this.parent || {};
           if (files.length > 0) {
-            const slice = files.splice(0, batch).map((dirent) => this._formatEntry(dirent, path3));
+            const slice = files.splice(0, batch).map((dirent) => this._formatEntry(dirent, path4));
             for (const entry of await Promise.all(slice)) {
               if (this.destroyed)
                 return;
@@ -8029,20 +8029,20 @@ var require_readdirp = __commonJS((exports, module) => {
         this.reading = false;
       }
     }
-    async _exploreDir(path3, depth) {
+    async _exploreDir(path4, depth) {
       let files;
       try {
-        files = await readdir(path3, this._rdOptions);
+        files = await readdir(path4, this._rdOptions);
       } catch (error) {
         this._onError(error);
       }
-      return { files, depth, path: path3 };
+      return { files, depth, path: path4 };
     }
-    async _formatEntry(dirent, path3) {
+    async _formatEntry(dirent, path4) {
       let entry;
       try {
         const basename = this._isDirent ? dirent.name : dirent;
-        const fullPath = sysPath.resolve(sysPath.join(path3, basename));
+        const fullPath = sysPath.resolve(sysPath.join(path4, basename));
         entry = { path: sysPath.relative(this._root, fullPath), fullPath, basename };
         entry[this._statsProp] = this._isDirent ? dirent : await this._stat(fullPath);
       } catch (err) {
@@ -8131,24 +8131,24 @@ var require_normalize_path = __commonJS((exports, module) => {
    * Copyright (c) 2014-2018, Jon Schlinkert.
    * Released under the MIT License.
    */
-  module.exports = function(path3, stripTrailing) {
-    if (typeof path3 !== "string") {
+  module.exports = function(path4, stripTrailing) {
+    if (typeof path4 !== "string") {
       throw new TypeError("expected path to be a string");
     }
-    if (path3 === "\\" || path3 === "/")
+    if (path4 === "\\" || path4 === "/")
       return "/";
-    var len = path3.length;
+    var len = path4.length;
     if (len <= 1)
-      return path3;
+      return path4;
     var prefix = "";
-    if (len > 4 && path3[3] === "\\") {
-      var ch = path3[2];
-      if ((ch === "?" || ch === ".") && path3.slice(0, 2) === "\\\\") {
-        path3 = path3.slice(2);
+    if (len > 4 && path4[3] === "\\") {
+      var ch = path4[2];
+      if ((ch === "?" || ch === ".") && path4.slice(0, 2) === "\\\\") {
+        path4 = path4.slice(2);
         prefix = "//";
       }
     }
-    var segs = path3.split(/[/\\]+/);
+    var segs = path4.split(/[/\\]+/);
     if (stripTrailing !== false && segs[segs.length - 1] === "") {
       segs.pop();
     }
@@ -8183,17 +8183,17 @@ var require_anymatch = __commonJS((exports, module) => {
     if (!isList && typeof _path !== "string") {
       throw new TypeError("anymatch: second argument must be a string: got " + Object.prototype.toString.call(_path));
     }
-    const path3 = normalizePath(_path, false);
+    const path4 = normalizePath(_path, false);
     for (let index = 0;index < negPatterns.length; index++) {
       const nglob = negPatterns[index];
-      if (nglob(path3)) {
+      if (nglob(path4)) {
         return returnIndex ? -1 : false;
       }
     }
-    const applied = isList && [path3].concat(args.slice(1));
+    const applied = isList && [path4].concat(args.slice(1));
     for (let index = 0;index < patterns.length; index++) {
       const pattern = patterns[index];
-      if (isList ? pattern(...applied) : pattern(path3)) {
+      if (isList ? pattern(...applied) : pattern(path4)) {
         return returnIndex ? index : true;
       }
     }
@@ -9712,10 +9712,10 @@ var require_binary_extensions = __commonJS((exports, module) => {
 
 // node_modules/is-binary-path/index.js
 var require_is_binary_path = __commonJS((exports, module) => {
-  var path3 = __require("path");
+  var path4 = __require("path");
   var binaryExtensions = require_binary_extensions();
   var extensions = new Set(binaryExtensions);
-  module.exports = (filePath) => extensions.has(path3.extname(filePath).slice(1).toLowerCase());
+  module.exports = (filePath) => extensions.has(path4.extname(filePath).slice(1).toLowerCase());
 });
 
 // node_modules/chokidar/lib/constants.js
@@ -9841,16 +9841,16 @@ var require_nodefs_handler = __commonJS((exports, module) => {
   };
   var isEmptySet = (val) => val instanceof Set ? val.size === 0 : !val;
   var FsWatchInstances = new Map;
-  function createFsWatchInstance(path3, options2, listener, errHandler, emitRaw) {
+  function createFsWatchInstance(path4, options2, listener, errHandler, emitRaw) {
     const handleEvent = (rawEvent, evPath) => {
-      listener(path3);
-      emitRaw(rawEvent, evPath, { watchedPath: path3 });
-      if (evPath && path3 !== evPath) {
-        fsWatchBroadcast(sysPath.resolve(path3, evPath), KEY_LISTENERS, sysPath.join(path3, evPath));
+      listener(path4);
+      emitRaw(rawEvent, evPath, { watchedPath: path4 });
+      if (evPath && path4 !== evPath) {
+        fsWatchBroadcast(sysPath.resolve(path4, evPath), KEY_LISTENERS, sysPath.join(path4, evPath));
       }
     };
     try {
-      return fs2.watch(path3, options2, handleEvent);
+      return fs2.watch(path4, options2, handleEvent);
     } catch (error) {
       errHandler(error);
     }
@@ -9863,12 +9863,12 @@ var require_nodefs_handler = __commonJS((exports, module) => {
       listener(val1, val2, val3);
     });
   };
-  var setFsWatchListener = (path3, fullPath, options2, handlers) => {
+  var setFsWatchListener = (path4, fullPath, options2, handlers) => {
     const { listener, errHandler, rawEmitter } = handlers;
     let cont = FsWatchInstances.get(fullPath);
     let watcher;
     if (!options2.persistent) {
-      watcher = createFsWatchInstance(path3, options2, listener, errHandler, rawEmitter);
+      watcher = createFsWatchInstance(path4, options2, listener, errHandler, rawEmitter);
       return watcher.close.bind(watcher);
     }
     if (cont) {
@@ -9876,7 +9876,7 @@ var require_nodefs_handler = __commonJS((exports, module) => {
       addAndConvert(cont, KEY_ERR, errHandler);
       addAndConvert(cont, KEY_RAW, rawEmitter);
     } else {
-      watcher = createFsWatchInstance(path3, options2, fsWatchBroadcast.bind(null, fullPath, KEY_LISTENERS), errHandler, fsWatchBroadcast.bind(null, fullPath, KEY_RAW));
+      watcher = createFsWatchInstance(path4, options2, fsWatchBroadcast.bind(null, fullPath, KEY_LISTENERS), errHandler, fsWatchBroadcast.bind(null, fullPath, KEY_RAW));
       if (!watcher)
         return;
       watcher.on(EV_ERROR, async (error) => {
@@ -9884,7 +9884,7 @@ var require_nodefs_handler = __commonJS((exports, module) => {
         cont.watcherUnusable = true;
         if (isWindows && error.code === "EPERM") {
           try {
-            const fd = await open(path3, "r");
+            const fd = await open(path4, "r");
             await close(fd);
             broadcastErr(error);
           } catch (err) {}
@@ -9914,7 +9914,7 @@ var require_nodefs_handler = __commonJS((exports, module) => {
     };
   };
   var FsWatchFileInstances = new Map;
-  var setFsWatchFileListener = (path3, fullPath, options2, handlers) => {
+  var setFsWatchFileListener = (path4, fullPath, options2, handlers) => {
     const { listener, rawEmitter } = handlers;
     let cont = FsWatchFileInstances.get(fullPath);
     let listeners = new Set;
@@ -9940,7 +9940,7 @@ var require_nodefs_handler = __commonJS((exports, module) => {
           });
           const currmtime = curr.mtimeMs;
           if (curr.size !== prev.size || currmtime > prev.mtimeMs || currmtime === 0) {
-            foreach(cont.listeners, (listener2) => listener2(path3, curr));
+            foreach(cont.listeners, (listener2) => listener2(path4, curr));
           }
         })
       };
@@ -9963,25 +9963,25 @@ var require_nodefs_handler = __commonJS((exports, module) => {
       this.fsw = fsW;
       this._boundHandleError = (error) => fsW._handleError(error);
     }
-    _watchWithNodeFs(path3, listener) {
+    _watchWithNodeFs(path4, listener) {
       const opts = this.fsw.options;
-      const directory = sysPath.dirname(path3);
-      const basename = sysPath.basename(path3);
+      const directory = sysPath.dirname(path4);
+      const basename = sysPath.basename(path4);
       const parent = this.fsw._getWatchedDir(directory);
       parent.add(basename);
-      const absolutePath = sysPath.resolve(path3);
+      const absolutePath = sysPath.resolve(path4);
       const options2 = { persistent: opts.persistent };
       if (!listener)
         listener = EMPTY_FN;
       let closer;
       if (opts.usePolling) {
         options2.interval = opts.enableBinaryInterval && isBinaryPath(basename) ? opts.binaryInterval : opts.interval;
-        closer = setFsWatchFileListener(path3, absolutePath, options2, {
+        closer = setFsWatchFileListener(path4, absolutePath, options2, {
           listener,
           rawEmitter: this.fsw._emitRaw
         });
       } else {
-        closer = setFsWatchListener(path3, absolutePath, options2, {
+        closer = setFsWatchListener(path4, absolutePath, options2, {
           listener,
           errHandler: this._boundHandleError,
           rawEmitter: this.fsw._emitRaw
@@ -9999,7 +9999,7 @@ var require_nodefs_handler = __commonJS((exports, module) => {
       let prevStats = stats;
       if (parent.has(basename))
         return;
-      const listener = async (path3, newStats) => {
+      const listener = async (path4, newStats) => {
         if (!this.fsw._throttle(THROTTLE_MODE_WATCH, file, 5))
           return;
         if (!newStats || newStats.mtimeMs === 0) {
@@ -10013,9 +10013,9 @@ var require_nodefs_handler = __commonJS((exports, module) => {
               this.fsw._emit(EV_CHANGE, file, newStats2);
             }
             if (isLinux && prevStats.ino !== newStats2.ino) {
-              this.fsw._closeFile(path3);
+              this.fsw._closeFile(path4);
               prevStats = newStats2;
-              this.fsw._addPathCloser(path3, this._watchWithNodeFs(file, listener));
+              this.fsw._addPathCloser(path4, this._watchWithNodeFs(file, listener));
             } else {
               prevStats = newStats2;
             }
@@ -10039,7 +10039,7 @@ var require_nodefs_handler = __commonJS((exports, module) => {
       }
       return closer;
     }
-    async _handleSymlink(entry, directory, path3, item) {
+    async _handleSymlink(entry, directory, path4, item) {
       if (this.fsw.closed) {
         return;
       }
@@ -10049,7 +10049,7 @@ var require_nodefs_handler = __commonJS((exports, module) => {
         this.fsw._incrReadyCount();
         let linkPath;
         try {
-          linkPath = await fsrealpath(path3);
+          linkPath = await fsrealpath(path4);
         } catch (e) {
           this.fsw._emitReady();
           return true;
@@ -10059,12 +10059,12 @@ var require_nodefs_handler = __commonJS((exports, module) => {
         if (dir.has(item)) {
           if (this.fsw._symlinkPaths.get(full) !== linkPath) {
             this.fsw._symlinkPaths.set(full, linkPath);
-            this.fsw._emit(EV_CHANGE, path3, entry.stats);
+            this.fsw._emit(EV_CHANGE, path4, entry.stats);
           }
         } else {
           dir.add(item);
           this.fsw._symlinkPaths.set(full, linkPath);
-          this.fsw._emit(EV_ADD, path3, entry.stats);
+          this.fsw._emit(EV_ADD, path4, entry.stats);
         }
         this.fsw._emitReady();
         return true;
@@ -10093,9 +10093,9 @@ var require_nodefs_handler = __commonJS((exports, module) => {
           return;
         }
         const item = entry.path;
-        let path3 = sysPath.join(directory, item);
+        let path4 = sysPath.join(directory, item);
         current.add(item);
-        if (entry.stats.isSymbolicLink() && await this._handleSymlink(entry, directory, path3, item)) {
+        if (entry.stats.isSymbolicLink() && await this._handleSymlink(entry, directory, path4, item)) {
           return;
         }
         if (this.fsw.closed) {
@@ -10104,8 +10104,8 @@ var require_nodefs_handler = __commonJS((exports, module) => {
         }
         if (item === target || !target && !previous.has(item)) {
           this.fsw._incrReadyCount();
-          path3 = sysPath.join(dir, sysPath.relative(dir, path3));
-          this._addToNodeFs(path3, initialAdd, wh, depth + 1);
+          path4 = sysPath.join(dir, sysPath.relative(dir, path4));
+          this._addToNodeFs(path4, initialAdd, wh, depth + 1);
         }
       }).on(EV_ERROR, this._boundHandleError);
       return new Promise((resolve) => stream.once(STR_END, () => {
@@ -10153,13 +10153,13 @@ var require_nodefs_handler = __commonJS((exports, module) => {
       }
       return closer;
     }
-    async _addToNodeFs(path3, initialAdd, priorWh, depth, target) {
+    async _addToNodeFs(path4, initialAdd, priorWh, depth, target) {
       const ready = this.fsw._emitReady;
-      if (this.fsw._isIgnored(path3) || this.fsw.closed) {
+      if (this.fsw._isIgnored(path4) || this.fsw.closed) {
         ready();
         return false;
       }
-      const wh = this.fsw._getWatchHelpers(path3, depth);
+      const wh = this.fsw._getWatchHelpers(path4, depth);
       if (!wh.hasGlob && priorWh) {
         wh.hasGlob = priorWh.hasGlob;
         wh.globFilter = priorWh.globFilter;
@@ -10174,11 +10174,11 @@ var require_nodefs_handler = __commonJS((exports, module) => {
           ready();
           return false;
         }
-        const follow = this.fsw.options.followSymlinks && !path3.includes(STAR) && !path3.includes(BRACE_START);
+        const follow = this.fsw.options.followSymlinks && !path4.includes(STAR) && !path4.includes(BRACE_START);
         let closer;
         if (stats.isDirectory()) {
-          const absPath = sysPath.resolve(path3);
-          const targetPath = follow ? await fsrealpath(path3) : path3;
+          const absPath = sysPath.resolve(path4);
+          const targetPath = follow ? await fsrealpath(path4) : path4;
           if (this.fsw.closed)
             return;
           closer = await this._handleDir(wh.watchPath, stats, initialAdd, depth, target, wh, targetPath);
@@ -10188,28 +10188,28 @@ var require_nodefs_handler = __commonJS((exports, module) => {
             this.fsw._symlinkPaths.set(absPath, targetPath);
           }
         } else if (stats.isSymbolicLink()) {
-          const targetPath = follow ? await fsrealpath(path3) : path3;
+          const targetPath = follow ? await fsrealpath(path4) : path4;
           if (this.fsw.closed)
             return;
           const parent = sysPath.dirname(wh.watchPath);
           this.fsw._getWatchedDir(parent).add(wh.watchPath);
           this.fsw._emit(EV_ADD, wh.watchPath, stats);
-          closer = await this._handleDir(parent, stats, initialAdd, depth, path3, wh, targetPath);
+          closer = await this._handleDir(parent, stats, initialAdd, depth, path4, wh, targetPath);
           if (this.fsw.closed)
             return;
           if (targetPath !== undefined) {
-            this.fsw._symlinkPaths.set(sysPath.resolve(path3), targetPath);
+            this.fsw._symlinkPaths.set(sysPath.resolve(path4), targetPath);
           }
         } else {
           closer = this._handleFile(wh.watchPath, stats, initialAdd);
         }
         ready();
-        this.fsw._addPathCloser(path3, closer);
+        this.fsw._addPathCloser(path4, closer);
         return false;
       } catch (error) {
         if (this.fsw._handleError(error)) {
           ready();
-          return path3;
+          return path4;
         }
       }
     }
@@ -10229,9 +10229,9 @@ var require_fsevents2 = __commonJS((exports) => {
   }
   var Native = require_fsevents();
   var events = Native.constants;
-  function watch(path3, since, handler) {
-    if (typeof path3 !== "string") {
-      throw new TypeError(`fsevents argument 1 must be a string and not a ${typeof path3}`);
+  function watch(path4, since, handler) {
+    if (typeof path4 !== "string") {
+      throw new TypeError(`fsevents argument 1 must be a string and not a ${typeof path4}`);
     }
     if (typeof since === "function" && typeof handler === "undefined") {
       handler = since;
@@ -10243,18 +10243,18 @@ var require_fsevents2 = __commonJS((exports) => {
     if (typeof handler !== "function") {
       throw new TypeError(`fsevents argument 3 must be a function and not a ${typeof handler}`);
     }
-    let instance = Native.start(Native.global, path3, since, handler);
+    let instance = Native.start(Native.global, path4, since, handler);
     if (!instance)
-      throw new Error(`could not watch: ${path3}`);
+      throw new Error(`could not watch: ${path4}`);
     return () => {
       const result = instance ? Promise.resolve(instance).then(Native.stop) : Promise.resolve(undefined);
       instance = undefined;
       return result;
     };
   }
-  function getInfo(path3, flags) {
+  function getInfo(path4, flags) {
     return {
-      path: path3,
+      path: path4,
       flags,
       event: getEventType(flags),
       type: getFileType(flags),
@@ -10371,18 +10371,18 @@ var require_fsevents_handler = __commonJS((exports, module) => {
     131840,
     262912
   ]);
-  var createFSEventsInstance = (path3, callback) => {
-    const stop = fsevents.watch(path3, callback);
+  var createFSEventsInstance = (path4, callback) => {
+    const stop = fsevents.watch(path4, callback);
     return { stop };
   };
-  function setFSEventsListener(path3, realPath, listener, rawEmitter) {
+  function setFSEventsListener(path4, realPath, listener, rawEmitter) {
     let watchPath = sysPath.extname(realPath) ? sysPath.dirname(realPath) : realPath;
     const parentPath = sysPath.dirname(watchPath);
     let cont = FSEventsWatchers.get(watchPath);
     if (couldConsolidate(parentPath)) {
       watchPath = parentPath;
     }
-    const resolvedPath = sysPath.resolve(path3);
+    const resolvedPath = sysPath.resolve(path4);
     const hasSymlink = resolvedPath !== realPath;
     const filteredListener = (fullPath, flags, info) => {
       if (hasSymlink)
@@ -10432,10 +10432,10 @@ var require_fsevents_handler = __commonJS((exports, module) => {
       }
     };
   }
-  var couldConsolidate = (path3) => {
+  var couldConsolidate = (path4) => {
     let count = 0;
     for (const watchPath of FSEventsWatchers.keys()) {
-      if (watchPath.indexOf(path3) === 0) {
+      if (watchPath.indexOf(path4) === 0) {
         count++;
         if (count >= consolidateThreshhold) {
           return true;
@@ -10445,9 +10445,9 @@ var require_fsevents_handler = __commonJS((exports, module) => {
     return false;
   };
   var canUse = () => fsevents && FSEventsWatchers.size < 128;
-  var calcDepth = (path3, root) => {
+  var calcDepth = (path4, root) => {
     let i = 0;
-    while (!path3.indexOf(root) && (path3 = sysPath.dirname(path3)) !== root)
+    while (!path4.indexOf(root) && (path4 = sysPath.dirname(path4)) !== root)
       i++;
     return i;
   };
@@ -10457,42 +10457,42 @@ var require_fsevents_handler = __commonJS((exports, module) => {
     constructor(fsw) {
       this.fsw = fsw;
     }
-    checkIgnored(path3, stats) {
+    checkIgnored(path4, stats) {
       const ipaths = this.fsw._ignoredPaths;
-      if (this.fsw._isIgnored(path3, stats)) {
-        ipaths.add(path3);
+      if (this.fsw._isIgnored(path4, stats)) {
+        ipaths.add(path4);
         if (stats && stats.isDirectory()) {
-          ipaths.add(path3 + ROOT_GLOBSTAR);
+          ipaths.add(path4 + ROOT_GLOBSTAR);
         }
         return true;
       }
-      ipaths.delete(path3);
-      ipaths.delete(path3 + ROOT_GLOBSTAR);
+      ipaths.delete(path4);
+      ipaths.delete(path4 + ROOT_GLOBSTAR);
     }
-    addOrChange(path3, fullPath, realPath, parent, watchedDir, item, info, opts) {
+    addOrChange(path4, fullPath, realPath, parent, watchedDir, item, info, opts) {
       const event = watchedDir.has(item) ? EV_CHANGE : EV_ADD;
-      this.handleEvent(event, path3, fullPath, realPath, parent, watchedDir, item, info, opts);
+      this.handleEvent(event, path4, fullPath, realPath, parent, watchedDir, item, info, opts);
     }
-    async checkExists(path3, fullPath, realPath, parent, watchedDir, item, info, opts) {
+    async checkExists(path4, fullPath, realPath, parent, watchedDir, item, info, opts) {
       try {
-        const stats = await stat(path3);
+        const stats = await stat(path4);
         if (this.fsw.closed)
           return;
         if (sameTypes(info, stats)) {
-          this.addOrChange(path3, fullPath, realPath, parent, watchedDir, item, info, opts);
+          this.addOrChange(path4, fullPath, realPath, parent, watchedDir, item, info, opts);
         } else {
-          this.handleEvent(EV_UNLINK, path3, fullPath, realPath, parent, watchedDir, item, info, opts);
+          this.handleEvent(EV_UNLINK, path4, fullPath, realPath, parent, watchedDir, item, info, opts);
         }
       } catch (error) {
         if (error.code === "EACCES") {
-          this.addOrChange(path3, fullPath, realPath, parent, watchedDir, item, info, opts);
+          this.addOrChange(path4, fullPath, realPath, parent, watchedDir, item, info, opts);
         } else {
-          this.handleEvent(EV_UNLINK, path3, fullPath, realPath, parent, watchedDir, item, info, opts);
+          this.handleEvent(EV_UNLINK, path4, fullPath, realPath, parent, watchedDir, item, info, opts);
         }
       }
     }
-    handleEvent(event, path3, fullPath, realPath, parent, watchedDir, item, info, opts) {
-      if (this.fsw.closed || this.checkIgnored(path3))
+    handleEvent(event, path4, fullPath, realPath, parent, watchedDir, item, info, opts) {
+      if (this.fsw.closed || this.checkIgnored(path4))
         return;
       if (event === EV_UNLINK) {
         const isDirectory = info.type === FSEVENT_TYPE_DIRECTORY;
@@ -10502,17 +10502,17 @@ var require_fsevents_handler = __commonJS((exports, module) => {
       } else {
         if (event === EV_ADD) {
           if (info.type === FSEVENT_TYPE_DIRECTORY)
-            this.fsw._getWatchedDir(path3);
+            this.fsw._getWatchedDir(path4);
           if (info.type === FSEVENT_TYPE_SYMLINK && opts.followSymlinks) {
             const curDepth = opts.depth === undefined ? undefined : calcDepth(fullPath, realPath) + 1;
-            return this._addToFsEvents(path3, false, true, curDepth);
+            return this._addToFsEvents(path4, false, true, curDepth);
           }
           this.fsw._getWatchedDir(parent).add(item);
         }
         const eventName = info.type === FSEVENT_TYPE_DIRECTORY ? event + DIR_SUFFIX : event;
-        this.fsw._emit(eventName, path3);
+        this.fsw._emit(eventName, path4);
         if (eventName === EV_ADD_DIR)
-          this._addToFsEvents(path3, false, true);
+          this._addToFsEvents(path4, false, true);
       }
     }
     _watchWithFsEvents(watchPath, realPath, transform, globFilter) {
@@ -10524,38 +10524,38 @@ var require_fsevents_handler = __commonJS((exports, module) => {
           return;
         if (opts.depth !== undefined && calcDepth(fullPath, realPath) > opts.depth)
           return;
-        const path3 = transform(sysPath.join(watchPath, sysPath.relative(watchPath, fullPath)));
-        if (globFilter && !globFilter(path3))
+        const path4 = transform(sysPath.join(watchPath, sysPath.relative(watchPath, fullPath)));
+        if (globFilter && !globFilter(path4))
           return;
-        const parent = sysPath.dirname(path3);
-        const item = sysPath.basename(path3);
-        const watchedDir = this.fsw._getWatchedDir(info.type === FSEVENT_TYPE_DIRECTORY ? path3 : parent);
+        const parent = sysPath.dirname(path4);
+        const item = sysPath.basename(path4);
+        const watchedDir = this.fsw._getWatchedDir(info.type === FSEVENT_TYPE_DIRECTORY ? path4 : parent);
         if (wrongEventFlags.has(flags) || info.event === FSEVENT_UNKNOWN) {
           if (typeof opts.ignored === FUNCTION_TYPE) {
             let stats;
             try {
-              stats = await stat(path3);
+              stats = await stat(path4);
             } catch (error) {}
             if (this.fsw.closed)
               return;
-            if (this.checkIgnored(path3, stats))
+            if (this.checkIgnored(path4, stats))
               return;
             if (sameTypes(info, stats)) {
-              this.addOrChange(path3, fullPath, realPath, parent, watchedDir, item, info, opts);
+              this.addOrChange(path4, fullPath, realPath, parent, watchedDir, item, info, opts);
             } else {
-              this.handleEvent(EV_UNLINK, path3, fullPath, realPath, parent, watchedDir, item, info, opts);
+              this.handleEvent(EV_UNLINK, path4, fullPath, realPath, parent, watchedDir, item, info, opts);
             }
           } else {
-            this.checkExists(path3, fullPath, realPath, parent, watchedDir, item, info, opts);
+            this.checkExists(path4, fullPath, realPath, parent, watchedDir, item, info, opts);
           }
         } else {
           switch (info.event) {
             case FSEVENT_CREATED:
             case FSEVENT_MODIFIED:
-              return this.addOrChange(path3, fullPath, realPath, parent, watchedDir, item, info, opts);
+              return this.addOrChange(path4, fullPath, realPath, parent, watchedDir, item, info, opts);
             case FSEVENT_DELETED:
             case FSEVENT_MOVED:
-              return this.checkExists(path3, fullPath, realPath, parent, watchedDir, item, info, opts);
+              return this.checkExists(path4, fullPath, realPath, parent, watchedDir, item, info, opts);
           }
         }
       };
@@ -10576,12 +10576,12 @@ var require_fsevents_handler = __commonJS((exports, module) => {
           return this.fsw._emitReady();
         }
         this.fsw._incrReadyCount();
-        this._addToFsEvents(linkTarget || linkPath, (path3) => {
+        this._addToFsEvents(linkTarget || linkPath, (path4) => {
           let aliasedPath = linkPath;
           if (linkTarget && linkTarget !== DOT_SLASH) {
-            aliasedPath = path3.replace(linkTarget, linkPath);
-          } else if (path3 !== DOT_SLASH) {
-            aliasedPath = sysPath.join(linkPath, path3);
+            aliasedPath = path4.replace(linkTarget, linkPath);
+          } else if (path4 !== DOT_SLASH) {
+            aliasedPath = sysPath.join(linkPath, path4);
           }
           return transform(aliasedPath);
         }, false, curDepth);
@@ -10605,19 +10605,19 @@ var require_fsevents_handler = __commonJS((exports, module) => {
         this.fsw._emit(isDir ? EV_ADD_DIR : EV_ADD, pp, stats);
       }
     }
-    initWatch(realPath, path3, wh, processPath) {
+    initWatch(realPath, path4, wh, processPath) {
       if (this.fsw.closed)
         return;
       const closer = this._watchWithFsEvents(wh.watchPath, sysPath.resolve(realPath || wh.watchPath), processPath, wh.globFilter);
-      this.fsw._addPathCloser(path3, closer);
+      this.fsw._addPathCloser(path4, closer);
     }
-    async _addToFsEvents(path3, transform, forceAdd, priorDepth) {
+    async _addToFsEvents(path4, transform, forceAdd, priorDepth) {
       if (this.fsw.closed) {
         return;
       }
       const opts = this.fsw.options;
       const processPath = typeof transform === FUNCTION_TYPE ? transform : IDENTITY_FN;
-      const wh = this.fsw._getWatchHelpers(path3);
+      const wh = this.fsw._getWatchHelpers(path4);
       try {
         const stats = await statMethods[wh.statMethod](wh.watchPath);
         if (this.fsw.closed)
@@ -10627,7 +10627,7 @@ var require_fsevents_handler = __commonJS((exports, module) => {
         }
         if (stats.isDirectory()) {
           if (!wh.globFilter)
-            this.emitAdd(processPath(path3), stats, processPath, opts, forceAdd);
+            this.emitAdd(processPath(path4), stats, processPath, opts, forceAdd);
           if (priorDepth && priorDepth > opts.depth)
             return;
           this.fsw._readdirp(wh.watchPath, {
@@ -10663,13 +10663,13 @@ var require_fsevents_handler = __commonJS((exports, module) => {
       }
       if (opts.persistent && forceAdd !== true) {
         if (typeof transform === FUNCTION_TYPE) {
-          this.initWatch(undefined, path3, wh, processPath);
+          this.initWatch(undefined, path4, wh, processPath);
         } else {
           let realPath;
           try {
             realPath = await realpath(wh.watchPath);
           } catch (e) {}
-          this.initWatch(realPath, path3, wh, processPath);
+          this.initWatch(realPath, path4, wh, processPath);
         }
       }
     }
@@ -10760,20 +10760,20 @@ var require_chokidar = __commonJS((exports) => {
     }
     return str2;
   };
-  var normalizePathToUnix = (path3) => toUnix(sysPath.normalize(toUnix(path3)));
-  var normalizeIgnored = (cwd = EMPTY_STR) => (path3) => {
-    if (typeof path3 !== STRING_TYPE)
-      return path3;
-    return normalizePathToUnix(sysPath.isAbsolute(path3) ? path3 : sysPath.join(cwd, path3));
+  var normalizePathToUnix = (path4) => toUnix(sysPath.normalize(toUnix(path4)));
+  var normalizeIgnored = (cwd = EMPTY_STR) => (path4) => {
+    if (typeof path4 !== STRING_TYPE)
+      return path4;
+    return normalizePathToUnix(sysPath.isAbsolute(path4) ? path4 : sysPath.join(cwd, path4));
   };
-  var getAbsolutePath = (path3, cwd) => {
-    if (sysPath.isAbsolute(path3)) {
-      return path3;
+  var getAbsolutePath = (path4, cwd) => {
+    if (sysPath.isAbsolute(path4)) {
+      return path4;
     }
-    if (path3.startsWith(BANG)) {
-      return BANG + sysPath.join(cwd, path3.slice(1));
+    if (path4.startsWith(BANG)) {
+      return BANG + sysPath.join(cwd, path4.slice(1));
     }
-    return sysPath.join(cwd, path3);
+    return sysPath.join(cwd, path4);
   };
   var undef = (opts, key) => opts[key] === undefined;
 
@@ -10830,17 +10830,17 @@ var require_chokidar = __commonJS((exports) => {
   var STAT_METHOD_L = "lstat";
 
   class WatchHelper {
-    constructor(path3, watchPath, follow, fsw) {
+    constructor(path4, watchPath, follow, fsw) {
       this.fsw = fsw;
-      this.path = path3 = path3.replace(REPLACER_RE, EMPTY_STR);
+      this.path = path4 = path4.replace(REPLACER_RE, EMPTY_STR);
       this.watchPath = watchPath;
       this.fullWatchPath = sysPath.resolve(watchPath);
-      this.hasGlob = watchPath !== path3;
-      if (path3 === EMPTY_STR)
+      this.hasGlob = watchPath !== path4;
+      if (path4 === EMPTY_STR)
         this.hasGlob = false;
       this.globSymlink = this.hasGlob && follow ? undefined : false;
-      this.globFilter = this.hasGlob ? anymatch(path3, undefined, ANYMATCH_OPTS) : false;
-      this.dirParts = this.getDirParts(path3);
+      this.globFilter = this.hasGlob ? anymatch(path4, undefined, ANYMATCH_OPTS) : false;
+      this.dirParts = this.getDirParts(path4);
       this.dirParts.forEach((parts) => {
         if (parts.length > 1)
           parts.pop();
@@ -10868,13 +10868,13 @@ var require_chokidar = __commonJS((exports) => {
       const matchesGlob = this.hasGlob && typeof this.globFilter === FUNCTION_TYPE ? this.globFilter(resolvedPath) : true;
       return matchesGlob && this.fsw._isntIgnored(resolvedPath, stats) && this.fsw._hasReadPermissions(stats);
     }
-    getDirParts(path3) {
+    getDirParts(path4) {
       if (!this.hasGlob)
         return [];
       const parts = [];
-      const expandedPath = path3.includes(BRACE_START) ? braces.expand(path3) : [path3];
-      expandedPath.forEach((path4) => {
-        parts.push(sysPath.relative(this.watchPath, path4).split(SLASH_OR_BACK_SLASH_RE));
+      const expandedPath = path4.includes(BRACE_START) ? braces.expand(path4) : [path4];
+      expandedPath.forEach((path5) => {
+        parts.push(sysPath.relative(this.watchPath, path5).split(SLASH_OR_BACK_SLASH_RE));
       });
       return parts;
     }
@@ -10990,21 +10990,21 @@ var require_chokidar = __commonJS((exports) => {
       this.closed = false;
       let paths = unifyPaths(paths_);
       if (cwd) {
-        paths = paths.map((path3) => {
-          const absPath = getAbsolutePath(path3, cwd);
-          if (disableGlobbing || !isGlob(path3)) {
+        paths = paths.map((path4) => {
+          const absPath = getAbsolutePath(path4, cwd);
+          if (disableGlobbing || !isGlob(path4)) {
             return absPath;
           }
           return normalizePath(absPath);
         });
       }
-      paths = paths.filter((path3) => {
-        if (path3.startsWith(BANG)) {
-          this._ignoredPaths.add(path3.slice(1));
+      paths = paths.filter((path4) => {
+        if (path4.startsWith(BANG)) {
+          this._ignoredPaths.add(path4.slice(1));
           return false;
         }
-        this._ignoredPaths.delete(path3);
-        this._ignoredPaths.delete(path3 + SLASH_GLOBSTAR);
+        this._ignoredPaths.delete(path4);
+        this._ignoredPaths.delete(path4 + SLASH_GLOBSTAR);
         this._userIgnored = undefined;
         return true;
       });
@@ -11013,13 +11013,13 @@ var require_chokidar = __commonJS((exports) => {
           this._readyCount = paths.length;
         if (this.options.persistent)
           this._readyCount += paths.length;
-        paths.forEach((path3) => this._fsEventsHandler._addToFsEvents(path3));
+        paths.forEach((path4) => this._fsEventsHandler._addToFsEvents(path4));
       } else {
         if (!this._readyCount)
           this._readyCount = 0;
         this._readyCount += paths.length;
-        Promise.all(paths.map(async (path3) => {
-          const res = await this._nodeFsHandler._addToNodeFs(path3, !_internal, 0, 0, _origAdd);
+        Promise.all(paths.map(async (path4) => {
+          const res = await this._nodeFsHandler._addToNodeFs(path4, !_internal, 0, 0, _origAdd);
           if (res)
             this._emitReady();
           return res;
@@ -11038,16 +11038,16 @@ var require_chokidar = __commonJS((exports) => {
         return this;
       const paths = unifyPaths(paths_);
       const { cwd } = this.options;
-      paths.forEach((path3) => {
-        if (!sysPath.isAbsolute(path3) && !this._closers.has(path3)) {
+      paths.forEach((path4) => {
+        if (!sysPath.isAbsolute(path4) && !this._closers.has(path4)) {
           if (cwd)
-            path3 = sysPath.join(cwd, path3);
-          path3 = sysPath.resolve(path3);
+            path4 = sysPath.join(cwd, path4);
+          path4 = sysPath.resolve(path4);
         }
-        this._closePath(path3);
-        this._ignoredPaths.add(path3);
-        if (this._watched.has(path3)) {
-          this._ignoredPaths.add(path3 + SLASH_GLOBSTAR);
+        this._closePath(path4);
+        this._ignoredPaths.add(path4);
+        if (this._watched.has(path4)) {
+          this._ignoredPaths.add(path4 + SLASH_GLOBSTAR);
         }
         this._userIgnored = undefined;
       });
@@ -11090,15 +11090,15 @@ var require_chokidar = __commonJS((exports) => {
       if (event !== EV_ERROR)
         this.emit(EV_ALL, ...args);
     }
-    async _emit(event, path3, val1, val2, val3) {
+    async _emit(event, path4, val1, val2, val3) {
       if (this.closed)
         return;
       const opts = this.options;
       if (isWindows)
-        path3 = sysPath.normalize(path3);
+        path4 = sysPath.normalize(path4);
       if (opts.cwd)
-        path3 = sysPath.relative(opts.cwd, path3);
-      const args = [event, path3];
+        path4 = sysPath.relative(opts.cwd, path4);
+      const args = [event, path4];
       if (val3 !== undefined)
         args.push(val1, val2, val3);
       else if (val2 !== undefined)
@@ -11107,25 +11107,25 @@ var require_chokidar = __commonJS((exports) => {
         args.push(val1);
       const awf = opts.awaitWriteFinish;
       let pw;
-      if (awf && (pw = this._pendingWrites.get(path3))) {
+      if (awf && (pw = this._pendingWrites.get(path4))) {
         pw.lastChange = new Date;
         return this;
       }
       if (opts.atomic) {
         if (event === EV_UNLINK) {
-          this._pendingUnlinks.set(path3, args);
+          this._pendingUnlinks.set(path4, args);
           setTimeout(() => {
-            this._pendingUnlinks.forEach((entry, path4) => {
+            this._pendingUnlinks.forEach((entry, path5) => {
               this.emit(...entry);
               this.emit(EV_ALL, ...entry);
-              this._pendingUnlinks.delete(path4);
+              this._pendingUnlinks.delete(path5);
             });
           }, typeof opts.atomic === "number" ? opts.atomic : 100);
           return this;
         }
-        if (event === EV_ADD && this._pendingUnlinks.has(path3)) {
+        if (event === EV_ADD && this._pendingUnlinks.has(path4)) {
           event = args[0] = EV_CHANGE;
-          this._pendingUnlinks.delete(path3);
+          this._pendingUnlinks.delete(path4);
         }
       }
       if (awf && (event === EV_ADD || event === EV_CHANGE) && this._readyEmitted) {
@@ -11143,16 +11143,16 @@ var require_chokidar = __commonJS((exports) => {
             this.emitWithAll(event, args);
           }
         };
-        this._awaitWriteFinish(path3, awf.stabilityThreshold, event, awfEmit);
+        this._awaitWriteFinish(path4, awf.stabilityThreshold, event, awfEmit);
         return this;
       }
       if (event === EV_CHANGE) {
-        const isThrottled = !this._throttle(EV_CHANGE, path3, 50);
+        const isThrottled = !this._throttle(EV_CHANGE, path4, 50);
         if (isThrottled)
           return this;
       }
       if (opts.alwaysStat && val1 === undefined && (event === EV_ADD || event === EV_ADD_DIR || event === EV_CHANGE)) {
-        const fullPath = opts.cwd ? sysPath.join(opts.cwd, path3) : path3;
+        const fullPath = opts.cwd ? sysPath.join(opts.cwd, path4) : path4;
         let stats;
         try {
           stats = await stat(fullPath);
@@ -11171,21 +11171,21 @@ var require_chokidar = __commonJS((exports) => {
       }
       return error || this.closed;
     }
-    _throttle(actionType, path3, timeout) {
+    _throttle(actionType, path4, timeout) {
       if (!this._throttled.has(actionType)) {
         this._throttled.set(actionType, new Map);
       }
       const action = this._throttled.get(actionType);
-      const actionPath = action.get(path3);
+      const actionPath = action.get(path4);
       if (actionPath) {
         actionPath.count++;
         return false;
       }
       let timeoutObject;
       const clear = () => {
-        const item = action.get(path3);
+        const item = action.get(path4);
         const count = item ? item.count : 0;
-        action.delete(path3);
+        action.delete(path4);
         clearTimeout(timeoutObject);
         if (item)
           clearTimeout(item.timeoutObject);
@@ -11193,45 +11193,45 @@ var require_chokidar = __commonJS((exports) => {
       };
       timeoutObject = setTimeout(clear, timeout);
       const thr = { timeoutObject, clear, count: 0 };
-      action.set(path3, thr);
+      action.set(path4, thr);
       return thr;
     }
     _incrReadyCount() {
       return this._readyCount++;
     }
-    _awaitWriteFinish(path3, threshold, event, awfEmit) {
+    _awaitWriteFinish(path4, threshold, event, awfEmit) {
       let timeoutHandler;
-      let fullPath = path3;
-      if (this.options.cwd && !sysPath.isAbsolute(path3)) {
-        fullPath = sysPath.join(this.options.cwd, path3);
+      let fullPath = path4;
+      if (this.options.cwd && !sysPath.isAbsolute(path4)) {
+        fullPath = sysPath.join(this.options.cwd, path4);
       }
       const now = new Date;
       const awaitWriteFinish = (prevStat) => {
         fs2.stat(fullPath, (err, curStat) => {
-          if (err || !this._pendingWrites.has(path3)) {
+          if (err || !this._pendingWrites.has(path4)) {
             if (err && err.code !== "ENOENT")
               awfEmit(err);
             return;
           }
           const now2 = Number(new Date);
           if (prevStat && curStat.size !== prevStat.size) {
-            this._pendingWrites.get(path3).lastChange = now2;
+            this._pendingWrites.get(path4).lastChange = now2;
           }
-          const pw = this._pendingWrites.get(path3);
+          const pw = this._pendingWrites.get(path4);
           const df = now2 - pw.lastChange;
           if (df >= threshold) {
-            this._pendingWrites.delete(path3);
+            this._pendingWrites.delete(path4);
             awfEmit(undefined, curStat);
           } else {
             timeoutHandler = setTimeout(awaitWriteFinish, this.options.awaitWriteFinish.pollInterval, curStat);
           }
         });
       };
-      if (!this._pendingWrites.has(path3)) {
-        this._pendingWrites.set(path3, {
+      if (!this._pendingWrites.has(path4)) {
+        this._pendingWrites.set(path4, {
           lastChange: now,
           cancelWait: () => {
-            this._pendingWrites.delete(path3);
+            this._pendingWrites.delete(path4);
             clearTimeout(timeoutHandler);
             return event;
           }
@@ -11242,26 +11242,26 @@ var require_chokidar = __commonJS((exports) => {
     _getGlobIgnored() {
       return [...this._ignoredPaths.values()];
     }
-    _isIgnored(path3, stats) {
-      if (this.options.atomic && DOT_RE.test(path3))
+    _isIgnored(path4, stats) {
+      if (this.options.atomic && DOT_RE.test(path4))
         return true;
       if (!this._userIgnored) {
         const { cwd } = this.options;
         const ign = this.options.ignored;
         const ignored = ign && ign.map(normalizeIgnored(cwd));
-        const paths = arrify(ignored).filter((path4) => typeof path4 === STRING_TYPE && !isGlob(path4)).map((path4) => path4 + SLASH_GLOBSTAR);
+        const paths = arrify(ignored).filter((path5) => typeof path5 === STRING_TYPE && !isGlob(path5)).map((path5) => path5 + SLASH_GLOBSTAR);
         const list = this._getGlobIgnored().map(normalizeIgnored(cwd)).concat(ignored, paths);
         this._userIgnored = anymatch(list, undefined, ANYMATCH_OPTS);
       }
-      return this._userIgnored([path3, stats]);
+      return this._userIgnored([path4, stats]);
     }
-    _isntIgnored(path3, stat2) {
-      return !this._isIgnored(path3, stat2);
+    _isntIgnored(path4, stat2) {
+      return !this._isIgnored(path4, stat2);
     }
-    _getWatchHelpers(path3, depth) {
-      const watchPath = depth || this.options.disableGlobbing || !isGlob(path3) ? path3 : globParent(path3);
+    _getWatchHelpers(path4, depth) {
+      const watchPath = depth || this.options.disableGlobbing || !isGlob(path4) ? path4 : globParent(path4);
       const follow = this.options.followSymlinks;
-      return new WatchHelper(path3, watchPath, follow, this);
+      return new WatchHelper(path4, watchPath, follow, this);
     }
     _getWatchedDir(directory) {
       if (!this._boundRemove)
@@ -11280,59 +11280,59 @@ var require_chokidar = __commonJS((exports) => {
       return Boolean(4 & it);
     }
     _remove(directory, item, isDirectory) {
-      const path3 = sysPath.join(directory, item);
-      const fullPath = sysPath.resolve(path3);
-      isDirectory = isDirectory != null ? isDirectory : this._watched.has(path3) || this._watched.has(fullPath);
-      if (!this._throttle("remove", path3, 100))
+      const path4 = sysPath.join(directory, item);
+      const fullPath = sysPath.resolve(path4);
+      isDirectory = isDirectory != null ? isDirectory : this._watched.has(path4) || this._watched.has(fullPath);
+      if (!this._throttle("remove", path4, 100))
         return;
       if (!isDirectory && !this.options.useFsEvents && this._watched.size === 1) {
         this.add(directory, item, true);
       }
-      const wp = this._getWatchedDir(path3);
+      const wp = this._getWatchedDir(path4);
       const nestedDirectoryChildren = wp.getChildren();
-      nestedDirectoryChildren.forEach((nested) => this._remove(path3, nested));
+      nestedDirectoryChildren.forEach((nested) => this._remove(path4, nested));
       const parent = this._getWatchedDir(directory);
       const wasTracked = parent.has(item);
       parent.remove(item);
       if (this._symlinkPaths.has(fullPath)) {
         this._symlinkPaths.delete(fullPath);
       }
-      let relPath = path3;
+      let relPath = path4;
       if (this.options.cwd)
-        relPath = sysPath.relative(this.options.cwd, path3);
+        relPath = sysPath.relative(this.options.cwd, path4);
       if (this.options.awaitWriteFinish && this._pendingWrites.has(relPath)) {
         const event = this._pendingWrites.get(relPath).cancelWait();
         if (event === EV_ADD)
           return;
       }
-      this._watched.delete(path3);
+      this._watched.delete(path4);
       this._watched.delete(fullPath);
       const eventName = isDirectory ? EV_UNLINK_DIR : EV_UNLINK;
-      if (wasTracked && !this._isIgnored(path3))
-        this._emit(eventName, path3);
+      if (wasTracked && !this._isIgnored(path4))
+        this._emit(eventName, path4);
       if (!this.options.useFsEvents) {
-        this._closePath(path3);
+        this._closePath(path4);
       }
     }
-    _closePath(path3) {
-      this._closeFile(path3);
-      const dir = sysPath.dirname(path3);
-      this._getWatchedDir(dir).remove(sysPath.basename(path3));
+    _closePath(path4) {
+      this._closeFile(path4);
+      const dir = sysPath.dirname(path4);
+      this._getWatchedDir(dir).remove(sysPath.basename(path4));
     }
-    _closeFile(path3) {
-      const closers = this._closers.get(path3);
+    _closeFile(path4) {
+      const closers = this._closers.get(path4);
       if (!closers)
         return;
       closers.forEach((closer) => closer());
-      this._closers.delete(path3);
+      this._closers.delete(path4);
     }
-    _addPathCloser(path3, closer) {
+    _addPathCloser(path4, closer) {
       if (!closer)
         return;
-      let list = this._closers.get(path3);
+      let list = this._closers.get(path4);
       if (!list) {
         list = [];
-        this._closers.set(path3, list);
+        this._closers.set(path4, list);
       }
       list.push(closer);
     }
@@ -11378,7 +11378,7 @@ var require_node_loaders = __commonJS((exports, module) => {
     return _setPrototypeOf(o, p);
   }
   var fs2 = __require("fs");
-  var path3 = __require("path");
+  var path4 = __require("path");
   var Loader = require_loader();
   var _require = require_precompiled_loader();
   var PrecompiledLoader = _require.PrecompiledLoader;
@@ -11396,7 +11396,7 @@ var require_node_loaders = __commonJS((exports, module) => {
       _this.noCache = !!opts.noCache;
       if (searchPaths) {
         searchPaths = Array.isArray(searchPaths) ? searchPaths : [searchPaths];
-        _this.searchPaths = searchPaths.map(path3.normalize);
+        _this.searchPaths = searchPaths.map(path4.normalize);
       } else {
         _this.searchPaths = ["."];
       }
@@ -11409,7 +11409,7 @@ var require_node_loaders = __commonJS((exports, module) => {
         var paths = _this.searchPaths.filter(fs2.existsSync);
         var watcher = chokidar.watch(paths);
         watcher.on("all", function(event, fullname) {
-          fullname = path3.resolve(fullname);
+          fullname = path4.resolve(fullname);
           if (event === "change" && fullname in _this.pathsToNames) {
             _this.emit("update", _this.pathsToNames[fullname], fullname);
           }
@@ -11425,8 +11425,8 @@ var require_node_loaders = __commonJS((exports, module) => {
       var fullpath = null;
       var paths = this.searchPaths;
       for (var i = 0;i < paths.length; i++) {
-        var basePath = path3.resolve(paths[i]);
-        var p = path3.resolve(paths[i], name);
+        var basePath = path4.resolve(paths[i]);
+        var p = path4.resolve(paths[i], name);
         if (p.indexOf(basePath) === 0 && fs2.existsSync(p)) {
           fullpath = p;
           break;
@@ -11675,13 +11675,13 @@ var require_globals = __commonJS((exports, module) => {
 
 // node_modules/nunjucks/src/express-app.js
 var require_express_app = __commonJS((exports, module) => {
-  var path3 = __require("path");
+  var path4 = __require("path");
   module.exports = function express(env, app) {
     function NunjucksView(name, opts) {
       this.name = name;
       this.path = name;
       this.defaultEngine = opts.defaultEngine;
-      this.ext = path3.extname(name);
+      this.ext = path4.extname(name);
       if (!this.ext && !this.defaultEngine) {
         throw new Error("No default engine was specified and no extension was provided.");
       }
@@ -12058,7 +12058,7 @@ var require_environment = __commonJS((exports, module) => {
       return _Obj2.apply(this, arguments) || this;
     }
     var _proto3 = Template2.prototype;
-    _proto3.init = function init(src, env, path3, eagerCompile) {
+    _proto3.init = function init(src, env, path4, eagerCompile) {
       this.env = env || new Environment;
       if (lib.isObject(src)) {
         switch (src.type) {
@@ -12076,7 +12076,7 @@ var require_environment = __commonJS((exports, module) => {
       } else {
         throw new Error("src must be a string or an object describing the source");
       }
-      this.path = path3;
+      this.path = path4;
       if (eagerCompile) {
         try {
           this._compile();
@@ -12226,7 +12226,7 @@ var require_precompile_global = __commonJS((exports, module) => {
 // node_modules/nunjucks/src/precompile.js
 var require_precompile = __commonJS((exports, module) => {
   var fs2 = __require("fs");
-  var path3 = __require("path");
+  var path4 = __require("path");
   var _require = require_lib();
   var _prettifyError = _require._prettifyError;
   var compiler = require_compiler();
@@ -12263,8 +12263,8 @@ var require_precompile = __commonJS((exports, module) => {
     var templates = [];
     function addTemplates(dir) {
       fs2.readdirSync(dir).forEach(function(file) {
-        var filepath = path3.join(dir, file);
-        var subpath = filepath.substr(path3.join(input, "/").length);
+        var filepath = path4.join(dir, file);
+        var subpath = filepath.substr(path4.join(input, "/").length);
         var stat = fs2.statSync(filepath);
         if (stat && stat.isDirectory()) {
           subpath += "/";
@@ -12281,7 +12281,7 @@ var require_precompile = __commonJS((exports, module) => {
     } else if (pathStats.isDirectory()) {
       addTemplates(input);
       for (var i = 0;i < templates.length; i++) {
-        var name = templates[i].replace(path3.join(input, "/"), "");
+        var name = templates[i].replace(path4.join(input, "/"), "");
         try {
           precompiled.push(_precompile(fs2.readFileSync(templates[i], "utf-8"), name, env));
         } catch (e) {
@@ -12653,11 +12653,11 @@ var require_nunjucks = __commonJS((exports, module) => {
     reset: function reset() {
       e = undefined;
     },
-    compile: function compile(src, env, path3, eagerCompile) {
+    compile: function compile(src, env, path4, eagerCompile) {
       if (!e) {
         configure();
       }
-      return new Template(src, env, path3, eagerCompile);
+      return new Template(src, env, path4, eagerCompile);
     },
     render: function render(name, ctx, cb) {
       if (!e) {
@@ -23258,27 +23258,27 @@ var require_util = __commonJS((exports) => {
     };
   }
   var normalize = lruMemoize(function normalize(aPath) {
-    var path4 = aPath;
+    var path5 = aPath;
     var url = urlParse(aPath);
     if (url) {
       if (!url.path) {
         return aPath;
       }
-      path4 = url.path;
+      path5 = url.path;
     }
-    var isAbsolute = exports.isAbsolute(path4);
+    var isAbsolute = exports.isAbsolute(path5);
     var parts = [];
     var start = 0;
     var i = 0;
     while (true) {
       start = i;
-      i = path4.indexOf("/", start);
+      i = path5.indexOf("/", start);
       if (i === -1) {
-        parts.push(path4.slice(start));
+        parts.push(path5.slice(start));
         break;
       } else {
-        parts.push(path4.slice(start, i));
-        while (i < path4.length && path4[i] === "/") {
+        parts.push(path5.slice(start, i));
+        while (i < path5.length && path5[i] === "/") {
           i++;
         }
       }
@@ -23299,15 +23299,15 @@ var require_util = __commonJS((exports) => {
         }
       }
     }
-    path4 = parts.join("/");
-    if (path4 === "") {
-      path4 = isAbsolute ? "/" : ".";
+    path5 = parts.join("/");
+    if (path5 === "") {
+      path5 = isAbsolute ? "/" : ".";
     }
     if (url) {
-      url.path = path4;
+      url.path = path5;
       return urlGenerate(url);
     }
-    return path4;
+    return path5;
   });
   exports.normalize = normalize;
   function join(aRoot, aPath) {
@@ -24996,11 +24996,11 @@ var require_previous_map = __commonJS((exports, module) => {
         this.annotation = this.getAnnotationURL(css.substring(start, end));
       }
     }
-    loadFile(path4) {
-      this.root = dirname(path4);
-      if (existsSync(path4)) {
-        this.mapFile = path4;
-        return readFileSync(path4, "utf-8").toString().trim();
+    loadFile(path5) {
+      this.root = dirname(path5);
+      if (existsSync(path5)) {
+        this.mapFile = path5;
+        return readFileSync(path5, "utf-8").toString().trim();
       }
     }
     loadMap(file, prev) {
@@ -25683,9 +25683,9 @@ var require_map_generator = __commonJS((exports, module) => {
       if (typeof this.mapOpts.annotation === "string") {
         from = dirname(resolve(from, this.mapOpts.annotation));
       }
-      let path4 = relative(from, file);
-      this.memoizedPaths.set(file, path4);
-      return path4;
+      let path5 = relative(from, file);
+      this.memoizedPaths.set(file, path5);
+      return path5;
     }
     previous() {
       if (!this.previousMaps) {
@@ -25741,27 +25741,27 @@ var require_map_generator = __commonJS((exports, module) => {
         return window.btoa(unescape(encodeURIComponent(str2)));
       }
     }
-    toFileUrl(path4) {
-      let cached = this.memoizedFileURLs.get(path4);
+    toFileUrl(path5) {
+      let cached = this.memoizedFileURLs.get(path5);
       if (cached)
         return cached;
       if (pathToFileURL) {
-        let fileURL = pathToFileURL(path4).toString();
-        this.memoizedFileURLs.set(path4, fileURL);
+        let fileURL = pathToFileURL(path5).toString();
+        this.memoizedFileURLs.set(path5, fileURL);
         return fileURL;
       } else {
         throw new Error("`map.absolute` option is not available in this PostCSS build");
       }
     }
-    toUrl(path4) {
-      let cached = this.memoizedURLs.get(path4);
+    toUrl(path5) {
+      let cached = this.memoizedURLs.get(path5);
       if (cached)
         return cached;
       if (sep === "\\") {
-        path4 = path4.replace(/\\/g, "/");
+        path5 = path5.replace(/\\/g, "/");
       }
-      let url = encodeURI(path4).replace(/[#?]/g, encodeURIComponent);
-      this.memoizedURLs.set(path4, url);
+      let url = encodeURI(path5).replace(/[#?]/g, encodeURIComponent);
+      this.memoizedURLs.set(path5, url);
       return url;
     }
   }
@@ -28108,8 +28108,8 @@ var {
   Help
 } = import__.default;
 
-// src/cli.ts
-import path8 from "path";
+// src/cli/commands/css.ts
+import path3 from "path";
 
 // src/config.ts
 import path from "path";
@@ -28223,138 +28223,205 @@ export default function(): SiteConfig {
   }
 }
 
-// src/server.ts
+// src/utils/css-processor.ts
+import { spawn } from "child_process";
 import fs from "fs";
 import path2 from "path";
-async function startServer(outputDir = DEFAULT_OUTPUT_DIR, port = 3000) {
-  try {
-    const stats = await fs.promises.stat(outputDir);
-    if (!stats.isDirectory()) {
-      const msg = `Error: Output directory ${outputDir} does not exist or is not accessible.`;
-      console.error(msg);
-      console.log('Try running "bunki generate" first to build your site.');
-      throw new Error(msg);
+async function processCSS(options2) {
+  const { css, projectRoot, outputDir, verbose = false } = options2;
+  if (!css.enabled) {
+    if (verbose) {
+      console.log("CSS processing is disabled");
     }
+    return;
+  }
+  const inputPath = path2.resolve(projectRoot, css.input);
+  const outputPath = path2.resolve(outputDir, css.output);
+  const postcssConfigPath = css.postcssConfig ? path2.resolve(projectRoot, css.postcssConfig) : path2.resolve(projectRoot, "postcss.config.js");
+  try {
+    await fs.promises.access(inputPath);
   } catch (error) {
-    const msg = `Error: Output directory ${outputDir} does not exist or is not accessible.`;
-    console.error(msg);
-    console.log('Try running "bunki generate" first to build your site.');
-    throw new Error(msg);
+    throw new Error(`CSS input file not found: ${inputPath}`);
   }
-  console.log(`Starting server for site in ${outputDir}...`);
-  const server = Bun.serve({
-    port,
-    async fetch(req) {
-      try {
-        const url = new URL(req.url);
-        let pathname = url.pathname;
-        if (pathname === "/") {
-          pathname = "/index.html";
-        }
-        if (pathname.endsWith("/")) {
-          pathname = pathname + "index.html";
+  let postcssConfigExists = false;
+  try {
+    await fs.promises.access(postcssConfigPath);
+    postcssConfigExists = true;
+  } catch (error) {
+    if (verbose) {
+      console.log(`PostCSS config not found at ${postcssConfigPath}, will fallback to simple copy`);
+    }
+  }
+  const outputDirPath = path2.dirname(outputPath);
+  await fs.promises.mkdir(outputDirPath, { recursive: true });
+  if (verbose) {
+    console.log("\uD83C\uDFA8 Building CSS with PostCSS...");
+    console.log(`Input: ${inputPath}`);
+    console.log(`Output: ${outputPath}`);
+    console.log(`Config: ${postcssConfigPath}`);
+  }
+  if (!postcssConfigExists) {
+    await fs.promises.copyFile(inputPath, outputPath);
+    if (verbose)
+      console.log("Copied CSS without PostCSS config");
+    return;
+  }
+  const runPostCSS = (configPathToUse) => {
+    return new Promise((resolve, reject) => {
+      const args = ["postcss", inputPath, "-o", outputPath];
+      if (configPathToUse && fs.existsSync(configPathToUse)) {
+        args.push("--config", configPathToUse);
+      }
+      const postcss = spawn("bunx", args, {
+        stdio: verbose ? "inherit" : ["ignore", "pipe", "pipe"],
+        cwd: projectRoot
+      });
+      let errorOutput = "";
+      if (!verbose) {
+        postcss.stderr?.on("data", (data) => {
+          errorOutput += data.toString();
+        });
+      }
+      postcss.on("close", async (code) => {
+        if (code === 0) {
+          if (verbose)
+            console.log("\u2705 CSS build completed successfully!");
+          return resolve();
         }
-        const homePaginationMatch = pathname.match(/^\/page\/(\d+)\/?$/);
-        const tagPaginationMatch = pathname.match(/^\/tags\/([^\/]+)\/page\/(\d+)\/?$/);
-        const yearPaginationMatch = pathname.match(/^\/(\d{4})\/page\/(\d+)\/?$/);
-        let filePath = "";
-        if (homePaginationMatch) {
-          const pageNumber = homePaginationMatch[1];
-          filePath = path2.join(outputDir, "page", pageNumber, "index.html");
-        } else if (tagPaginationMatch) {
-          const tagSlug = tagPaginationMatch[1];
-          const pageNumber = tagPaginationMatch[2];
-          filePath = path2.join(outputDir, "tags", tagSlug, "page", pageNumber, "index.html");
-        } else if (yearPaginationMatch) {
-          const year = yearPaginationMatch[1];
-          const pageNumber = yearPaginationMatch[2];
-          filePath = path2.join(outputDir, year, "page", pageNumber, "index.html");
-        } else {
-          const directPath = path2.join(outputDir, pathname);
-          const withoutSlash = path2.join(outputDir, pathname + ".html");
-          const withHtml = pathname.endsWith(".html") ? directPath : withoutSlash;
-          const bunFileDirect = Bun.file(directPath);
-          const bunFileHtml = Bun.file(withHtml);
-          if (await bunFileDirect.exists()) {
-            filePath = directPath;
-          } else if (await bunFileHtml.exists()) {
-            filePath = withHtml;
-          } else {
-            const indexPath = path2.join(outputDir, pathname, "index.html");
-            const bunFileIndex = Bun.file(indexPath);
-            if (await bunFileIndex.exists()) {
-              filePath = indexPath;
-            } else {
-              console.log(`404 Not Found: ${pathname}`);
-              return new Response(`<h1>404 Not Found</h1><p>Could not find ${pathname}</p>`, {
-                status: 404,
-                headers: { "Content-Type": "text/html" }
-              });
+        if (/module is not defined in ES module scope/i.test(errorOutput) && configPathToUse.endsWith(".js")) {
+          const cjsPath = configPathToUse.replace(/\.js$/, ".cjs");
+          try {
+            if (!fs.existsSync(cjsPath)) {
+              const original = await fs.promises.readFile(configPathToUse, "utf-8");
+              await fs.promises.writeFile(cjsPath, original, "utf-8");
+              if (verbose) {
+                console.log(`Retrying PostCSS with converted CommonJS config at ${cjsPath}`);
+              }
             }
+            return resolve(runPostCSS(cjsPath));
+          } catch (e) {
+            if (verbose)
+              console.warn("CJS fallback failed, copying CSS.");
+            await fs.promises.copyFile(inputPath, outputPath);
+            return resolve();
           }
         }
-        console.log(`Serving file: ${filePath}`);
-        const extname = path2.extname(filePath);
-        let contentType = "text/html";
-        switch (extname) {
-          case ".js":
-            contentType = "text/javascript";
-            break;
-          case ".css":
-            contentType = "text/css";
-            break;
-          case ".json":
-            contentType = "application/json";
-            break;
-          case ".png":
-            contentType = "image/png";
-            break;
-          case ".jpg":
-          case ".jpeg":
-            contentType = "image/jpeg";
-            break;
-          case ".svg":
-            contentType = "image/svg+xml";
-            break;
-          case ".xml":
-            contentType = "application/xml";
-            break;
+        if (verbose) {
+          console.warn(`PostCSS failed (code ${code}). Falling back to simple copy. Error: ${errorOutput.trim()}`);
         }
         try {
-          const bunFile = Bun.file(filePath);
-          return new Response(bunFile, {
-            headers: { "Content-Type": contentType }
-          });
-        } catch (err) {
-          console.error(`Error reading file ${filePath}:`, err);
-          return new Response(`<h1>500 Server Error</h1><p>Error reading file: ${filePath}</p><pre>${err}</pre>`, {
-            status: 500,
-            headers: { "Content-Type": "text/html" }
-          });
+          await fs.promises.copyFile(inputPath, outputPath);
+          resolve();
+        } catch (copyErr) {
+          reject(new Error(`CSS build failed with code ${code} and fallback copy also failed: ${copyErr.message}`));
+        }
+      });
+      postcss.on("error", (err) => {
+        if (verbose) {
+          console.warn(`Failed to start PostCSS process (${err.message}). Falling back to copy.`);
         }
+        fs.promises.copyFile(inputPath, outputPath).then(() => resolve()).catch((copyErr) => reject(new Error(`Failed to start PostCSS and fallback copy failed: ${copyErr.message}`)));
+      });
+    });
+  };
+  await runPostCSS(postcssConfigPath);
+}
+async function watchCSS(options2) {
+  const { css, projectRoot, verbose = false } = options2;
+  if (!css.enabled || !css.watch) {
+    return;
+  }
+  const inputPath = path2.resolve(projectRoot, css.input);
+  const watchDir = path2.dirname(inputPath);
+  if (verbose) {
+    console.log(`\uD83D\uDC40 Watching CSS files in ${watchDir}...`);
+  }
+  const watcher = fs.watch(watchDir, { recursive: true }, async (eventType, filename) => {
+    if (filename && (filename.endsWith(".css") || filename.endsWith(".pcss"))) {
+      if (verbose) {
+        console.log(`\uD83D\uDD04 CSS file changed: ${filename}`);
+      }
+      try {
+        await processCSS(options2);
       } catch (error) {
-        console.error("Server error:", error);
-        return new Response(`<h1>500 Server Error</h1><pre>${error}</pre>`, {
-          status: 500,
-          headers: { "Content-Type": "text/html" }
-        });
+        console.error("\u274C CSS rebuild failed:", error);
       }
     }
   });
-  console.log(`Bunki development server running at http://localhost:${port}/`);
-  return server;
+  return new Promise(() => {
+    process.on("SIGINT", () => {
+      watcher.close();
+      process.exit(0);
+    });
+  });
+}
+function getDefaultCSSConfig() {
+  return {
+    input: "templates/styles/main.css",
+    output: "css/style.css",
+    postcssConfig: "postcss.config.js",
+    enabled: true,
+    watch: false
+  };
+}
+
+// src/cli/commands/css.ts
+var defaultDeps = {
+  loadConfig,
+  processCSS,
+  watchCSS,
+  getDefaultCSSConfig,
+  logger: console,
+  exit: (code) => process.exit(code)
+};
+async function handleCssCommand(options2, deps = defaultDeps) {
+  try {
+    const configPath = path3.resolve(options2.config);
+    const outputDir = path3.resolve(options2.output);
+    const config = await deps.loadConfig(configPath);
+    const cssConfig = config.css || deps.getDefaultCSSConfig();
+    if (!cssConfig.enabled) {
+      deps.logger.log("CSS processing is disabled in configuration");
+      return;
+    }
+    const processorOptions = {
+      css: cssConfig,
+      projectRoot: process.cwd(),
+      outputDir,
+      verbose: true
+    };
+    if (options2.watch) {
+      deps.logger.log("Starting CSS watch mode...");
+      cssConfig.watch = true;
+      await deps.processCSS(processorOptions);
+      await deps.watchCSS(processorOptions);
+    } else {
+      await deps.processCSS(processorOptions);
+    }
+  } catch (error) {
+    deps.logger.error("Error processing CSS:", error);
+    deps.exit(1);
+  }
 }
+function registerCssCommand(program2) {
+  return program2.command("css").description("Process CSS using PostCSS").option("-c, --config <file>", "Config file path", "bunki.config.ts").option("-o, --output <dir>", "Output directory", DEFAULT_OUTPUT_DIR).option("-w, --watch", "Watch for changes and rebuild").action(async (options2) => {
+    await handleCssCommand(options2);
+  });
+}
+
+// src/cli/commands/generate.ts
+import path6 from "path";
 
 // src/site-generator.ts
 var import_nunjucks = __toESM(require_nunjucks(), 1);
 var import_slugify = __toESM(require_slugify(), 1);
 var {Glob: Glob2 } = globalThis.Bun;
-import fs3 from "fs";
+import fs2 from "fs";
 import path5 from "path";
 
 // src/utils/file-utils.ts
 var {Glob } = globalThis.Bun;
-import path3 from "path";
+import path4 from "path";
 async function findFilesByPattern(pattern, directory, absolute = true) {
   const glob = new Glob(pattern);
   const files = [];
@@ -28383,7 +28450,7 @@ async function readFileAsText(filePath) {
   }
 }
 function getBaseFilename(filePath, extension = ".md") {
-  return path3.basename(filePath, extension);
+  return path4.basename(filePath, extension);
 }
 async function ensureDir(dirPath) {
   try {
@@ -32854,157 +32921,15 @@ async function parseMarkdownDirectory(contentDir) {
   }
 }
 
-// src/utils/css-processor.ts
-import { spawn } from "child_process";
-import fs2 from "fs";
-import path4 from "path";
-async function processCSS(options2) {
-  const { css, projectRoot, outputDir, verbose = false } = options2;
-  if (!css.enabled) {
-    if (verbose) {
-      console.log("CSS processing is disabled");
-    }
-    return;
-  }
-  const inputPath = path4.resolve(projectRoot, css.input);
-  const outputPath = path4.resolve(outputDir, css.output);
-  const postcssConfigPath = css.postcssConfig ? path4.resolve(projectRoot, css.postcssConfig) : path4.resolve(projectRoot, "postcss.config.js");
-  try {
-    await fs2.promises.access(inputPath);
-  } catch (error) {
-    throw new Error(`CSS input file not found: ${inputPath}`);
-  }
-  let postcssConfigExists = false;
-  try {
-    await fs2.promises.access(postcssConfigPath);
-    postcssConfigExists = true;
-  } catch (error) {
-    if (verbose) {
-      console.log(`PostCSS config not found at ${postcssConfigPath}, will fallback to simple copy`);
-    }
-  }
-  const outputDirPath = path4.dirname(outputPath);
-  await fs2.promises.mkdir(outputDirPath, { recursive: true });
-  if (verbose) {
-    console.log("\uD83C\uDFA8 Building CSS with PostCSS...");
-    console.log(`Input: ${inputPath}`);
-    console.log(`Output: ${outputPath}`);
-    console.log(`Config: ${postcssConfigPath}`);
-  }
-  if (!postcssConfigExists) {
-    await fs2.promises.copyFile(inputPath, outputPath);
-    if (verbose)
-      console.log("Copied CSS without PostCSS config");
-    return;
-  }
-  const runPostCSS = (configPathToUse) => {
-    return new Promise((resolve, reject) => {
-      const args = ["postcss", inputPath, "-o", outputPath];
-      if (configPathToUse && fs2.existsSync(configPathToUse)) {
-        args.push("--config", configPathToUse);
-      }
-      const postcss = spawn("bunx", args, {
-        stdio: verbose ? "inherit" : ["ignore", "pipe", "pipe"],
-        cwd: projectRoot
-      });
-      let errorOutput = "";
-      if (!verbose) {
-        postcss.stderr?.on("data", (data) => {
-          errorOutput += data.toString();
-        });
-      }
-      postcss.on("close", async (code) => {
-        if (code === 0) {
-          if (verbose)
-            console.log("\u2705 CSS build completed successfully!");
-          return resolve();
-        }
-        if (/module is not defined in ES module scope/i.test(errorOutput) && configPathToUse.endsWith(".js")) {
-          const cjsPath = configPathToUse.replace(/\.js$/, ".cjs");
-          try {
-            if (!fs2.existsSync(cjsPath)) {
-              const original = await fs2.promises.readFile(configPathToUse, "utf-8");
-              await fs2.promises.writeFile(cjsPath, original, "utf-8");
-              if (verbose) {
-                console.log(`Retrying PostCSS with converted CommonJS config at ${cjsPath}`);
-              }
-            }
-            return resolve(runPostCSS(cjsPath));
-          } catch (e) {
-            if (verbose)
-              console.warn("CJS fallback failed, copying CSS.");
-            await fs2.promises.copyFile(inputPath, outputPath);
-            return resolve();
-          }
-        }
-        if (verbose) {
-          console.warn(`PostCSS failed (code ${code}). Falling back to simple copy. Error: ${errorOutput.trim()}`);
-        }
-        try {
-          await fs2.promises.copyFile(inputPath, outputPath);
-          resolve();
-        } catch (copyErr) {
-          reject(new Error(`CSS build failed with code ${code} and fallback copy also failed: ${copyErr.message}`));
-        }
-      });
-      postcss.on("error", (err) => {
-        if (verbose) {
-          console.warn(`Failed to start PostCSS process (${err.message}). Falling back to copy.`);
-        }
-        fs2.promises.copyFile(inputPath, outputPath).then(() => resolve()).catch((copyErr) => reject(new Error(`Failed to start PostCSS and fallback copy failed: ${copyErr.message}`)));
-      });
-    });
-  };
-  await runPostCSS(postcssConfigPath);
-}
-async function watchCSS(options2) {
-  const { css, projectRoot, verbose = false } = options2;
-  if (!css.enabled || !css.watch) {
-    return;
-  }
-  const inputPath = path4.resolve(projectRoot, css.input);
-  const watchDir = path4.dirname(inputPath);
-  if (verbose) {
-    console.log(`\uD83D\uDC40 Watching CSS files in ${watchDir}...`);
-  }
-  const watcher = fs2.watch(watchDir, { recursive: true }, async (eventType, filename) => {
-    if (filename && (filename.endsWith(".css") || filename.endsWith(".pcss"))) {
-      if (verbose) {
-        console.log(`\uD83D\uDD04 CSS file changed: ${filename}`);
-      }
-      try {
-        await processCSS(options2);
-      } catch (error) {
-        console.error("\u274C CSS rebuild failed:", error);
-      }
-    }
-  });
-  return new Promise(() => {
-    process.on("SIGINT", () => {
-      watcher.close();
-      process.exit(0);
-    });
-  });
-}
-function getDefaultCSSConfig() {
-  return {
-    input: "templates/styles/main.css",
-    output: "css/style.css",
-    postcssConfig: "postcss.config.js",
-    enabled: true,
-    watch: false
-  };
-}
-
-// src/site-generator.ts
-class SiteGenerator {
-  options;
-  site;
-  formatRSSDate(date) {
-    const pacificDate = new Date(new Date(date).toLocaleString("en-US", {
-      timeZone: "America/Los_Angeles"
-    }));
-    return pacificDate.toUTCString();
+// src/site-generator.ts
+class SiteGenerator {
+  options;
+  site;
+  formatRSSDate(date) {
+    const pacificDate = new Date(new Date(date).toLocaleString("en-US", {
+      timeZone: "America/Los_Angeles"
+    }));
+    return pacificDate.toUTCString();
   }
   getPacificDate(date) {
     return new Date(new Date(date).toLocaleString("en-US", {
@@ -33288,7 +33213,7 @@ class SiteGenerator {
     const publicDir = path5.join(process.cwd(), "public");
     async function dirExists(p) {
       try {
-        const stat = await fs3.promises.stat(p);
+        const stat = await fs2.promises.stat(p);
         return stat.isDirectory();
       } catch {
         return false;
@@ -33312,7 +33237,7 @@ class SiteGenerator {
     }
     if (await dirExists(publicDir)) {
       const copyRecursive = async (srcDir) => {
-        const entries = await fs3.promises.readdir(srcDir, {
+        const entries = await fs2.promises.readdir(srcDir, {
           withFileTypes: true
         });
         for (const entry of entries) {
@@ -33532,12 +33457,46 @@ Sitemap: ${config.baseUrl}/sitemap.xml
   }
 }
 
+// src/cli/commands/generate.ts
+var defaultDeps2 = {
+  loadConfig,
+  createGenerator: (opts) => new SiteGenerator(opts),
+  logger: console,
+  exit: (code) => process.exit(code)
+};
+async function handleGenerateCommand(options2, deps = defaultDeps2) {
+  try {
+    const configPath = path6.resolve(options2.config);
+    const contentDir = path6.resolve(options2.content);
+    const outputDir = path6.resolve(options2.output);
+    const templatesDir = path6.resolve(options2.templates);
+    deps.logger.log("Generating site with:");
+    deps.logger.log(`- Config file: ${configPath}`);
+    deps.logger.log(`- Content directory: ${contentDir}`);
+    deps.logger.log(`- Output directory: ${outputDir}`);
+    deps.logger.log(`- Templates directory: ${templatesDir}`);
+    const config = await deps.loadConfig(configPath);
+    const generator = deps.createGenerator({ contentDir, outputDir, templatesDir, config });
+    await generator.initialize();
+    await generator.generate();
+    deps.logger.log("Site generation completed successfully!");
+  } catch (error) {
+    deps.logger.error("Error generating site:", error);
+    deps.exit(1);
+  }
+}
+function registerGenerateCommand(program2) {
+  return program2.command("generate").description("Generate static site from markdown content").option("-c, --config <file>", "Config file path", "bunki.config.ts").option("-d, --content <dir>", "Content directory", DEFAULT_CONTENT_DIR).option("-o, --output <dir>", "Output directory", DEFAULT_OUTPUT_DIR).option("-t, --templates <dir>", "Templates directory", DEFAULT_TEMPLATES_DIR).action(async (options2) => {
+    await handleGenerateCommand(options2);
+  });
+}
+
 // src/utils/image-uploader.ts
-import path7 from "path";
+import path8 from "path";
 
 // src/utils/s3-uploader.ts
 var {S3Client } = globalThis.Bun;
-import path6 from "path";
+import path7 from "path";
 
 class S3Uploader {
   s3Config;
@@ -33649,18 +33608,18 @@ class S3Uploader {
       console.log(`Found ${imageFiles.length} images to upload`);
       for (const imageFile of imageFiles) {
         try {
-          const imagePath = path6.join(imagesDir, imageFile);
-          const filename = path6.basename(imagePath);
-          console.log(`[S3] Uploading image ${imagePath} to S3 bucket ${this.s3Config.bucket}/${filename}...`);
+          const imagePath = path7.join(imagesDir, imageFile);
+          const filename = path7.basename(imagePath);
+          console.log(`[S3] Uploading image ${imagePath} to S3 bucket ${this.s3Config.bucket}/${imageFile}...`);
           const file = Bun.file(imagePath);
           const contentType = file.type;
           if (process.env.BUNKI_DRY_RUN === "true") {
-            console.log(`[S3] Dry run: would upload ${filename} with content type ${contentType}`);
+            console.log(`[S3] Dry run: would upload ${imageFile} with content type ${contentType}`);
           } else {
-            const s3File = this.client.file(filename);
+            const s3File = this.client.file(imageFile);
             await s3File.write(file);
           }
-          const imageUrl = this.getPublicUrl(filename);
+          const imageUrl = this.getPublicUrl(imageFile);
           console.log(`[S3] Image uploaded to ${imageUrl}`);
           imageUrls[imageFile] = imageUrl;
         } catch (error) {
@@ -33680,10 +33639,10 @@ function createUploader(config) {
 }
 
 // src/utils/image-uploader.ts
-var DEFAULT_IMAGES_DIR = path7.join(process.cwd(), "images");
+var DEFAULT_IMAGES_DIR = path8.join(process.cwd(), "images");
 async function uploadImages(options2 = {}) {
   try {
-    const imagesDir = path7.resolve(options2.images || DEFAULT_IMAGES_DIR);
+    const imagesDir = path8.resolve(options2.images || DEFAULT_IMAGES_DIR);
     if (!await fileExists(imagesDir)) {
       console.log(`Creating images directory at ${imagesDir}...`);
       await ensureDir(imagesDir);
@@ -33717,7 +33676,7 @@ async function uploadImages(options2 = {}) {
     const uploader = createUploader(s3Config);
     const imageUrlMap = await uploader.uploadImages(imagesDir);
     if (options2.outputJson) {
-      const outputFile = path7.resolve(options2.outputJson);
+      const outputFile = path8.resolve(options2.outputJson);
       await Bun.write(outputFile, JSON.stringify(imageUrlMap, null, 2));
       console.log(`Image URL mapping saved to ${outputFile}`);
     }
@@ -33737,605 +33696,750 @@ Image upload completed successfully!`);
   }
 }
 
-// src/cli.ts
-var program2 = new Command;
-program2.name("bunki").description("An opinionated static site generator built with Bun").version("0.2.4");
-program2.command("init").description("Initialize a new site with default structure").option("-c, --config <file>", "Path to config file", "bunki.config.ts").action(async (options2) => {
+// src/cli/commands/images-push.ts
+var defaultDeps3 = {
+  uploadImages,
+  logger: console,
+  exit: (code) => process.exit(code)
+};
+async function handleImagesPushCommand(options2, deps = defaultDeps3) {
   try {
-    const configPath = path8.resolve(options2.config);
-    const configCreated = await createDefaultConfig(configPath);
-    if (configCreated) {
-      console.log("Creating directory structure...");
-      await ensureDir(DEFAULT_CONTENT_DIR);
-      await ensureDir(DEFAULT_TEMPLATES_DIR);
-      await ensureDir(path8.join(DEFAULT_TEMPLATES_DIR, "styles"));
-      await ensureDir(path8.join(process.cwd(), "public"));
-      const templates = {
-        "base.njk": `<!DOCTYPE html>
-<html lang="en">
-<head>
-  <meta charset="UTF-8">
-  <meta name="viewport" content="width=device-width, initial-scale=1.0">
-  <title>{% block title %}{{ site.title }}{% endblock %}</title>
-  <meta name="description" content="{% block description %}{{ site.description }}{% endblock %}">
-  <link rel="stylesheet" href="/css/style.css">
-  {% block head %}{% endblock %}
-</head>
-<body>
-  <header>
-    <div class="container">
-      <h1><a href="/">{{ site.title }}</a></h1>
-      <nav>
-        <ul>
-          <li><a href="/">Home</a></li>
-          <li><a href="/tags/">Tags</a></li>
-        </ul>
-      </nav>
-    </div>
-  </header>
-
-  <main class="container">
-    {% block content %}{% endblock %}
-  </main>
-
-  <footer>
-    <div class="container">
-      <p>&copy; {{ "now" | date("YYYY") }} {{ site.title }}</p>
-    </div>
-  </footer>
-</body>
-</html>`,
-        "index.njk": `{% extends "base.njk" %}
-
-{% block content %}
-  <h1>Latest Posts</h1>
-
-  {% if posts.length > 0 %}
-    <div class="posts">
-      {% for post in posts %}
-        <article class="post-card">
-          <h2><a href="{{ post.url }}">{{ post.title }}</a></h2>
-          <div class="post-meta">
-            <time datetime="{{ post.date }}">{{ post.date | date("MMMM D, YYYY") }}</time>
-            {% if post.tags.length > 0 %}
-              <span class="tags">
-                {% for tag in post.tags %}
-                  <a href="/tags/{{ post.tagSlugs[tag] }}/">{{ tag }}</a>{% if not loop.last %}, {% endif %}
-                {% endfor %}
-              </span>
-            {% endif %}
-          </div>
-          <div class="post-excerpt">{{ post.excerpt }}</div>
-          <a href="{{ post.url }}" class="read-more">Read more \u2192</a>
-        </article>
-      {% endfor %}
-    </div>
-
-    {% if pagination.totalPages > 1 %}
-      <nav class="pagination">
-        {% if pagination.hasPrevPage %}
-          <a href="{{ pagination.pagePath }}{% if pagination.prevPage > 1 %}page/{{ pagination.prevPage }}/{% endif %}" class="prev">\u2190 Previous</a>
-        {% endif %}
-
-        {% if pagination.hasNextPage %}
-          <a href="{{ pagination.pagePath }}page/{{ pagination.nextPage }}/" class="next">Next \u2192</a>
-        {% endif %}
-
-        <span class="page-info">Page {{ pagination.currentPage }} of {{ pagination.totalPages }}</span>
-      </nav>
-    {% endif %}
-  {% else %}
-    <p>No posts yet!</p>
-  {% endif %}
-{% endblock %}`,
-        "post.njk": `{% extends "base.njk" %}
-
-{% block title %}{{ post.title }} | {{ site.title }}{% endblock %}
-{% block description %}{{ post.excerpt }}{% endblock %}
-
-{% block content %}
-  <article class="post">
-    <header class="post-header">
-      <h1>{{ post.title }}</h1>
-      <div class="post-meta">
-        <time datetime="{{ post.date }}">{{ post.date | date("MMMM D, YYYY") }}</time>
-        {% if post.tags.length > 0 %}
-          <span class="tags">
-            {% for tag in post.tags %}
-              <a href="/tags/{{ post.tagSlugs[tag] }}/">{{ tag }}</a>{% if not loop.last %}, {% endif %}
-            {% endfor %}
-          </span>
-        {% endif %}
+    await deps.uploadImages({
+      domain: options2.domain,
+      images: options2.images,
+      outputJson: options2.outputJson
+    });
+  } catch (error) {
+    deps.logger.error("Error uploading images:", error);
+    deps.exit(1);
+  }
+}
+function registerImagesPushCommand(program2) {
+  return program2.command("images:push").description("Upload images to S3-compatible storage").option("-d, --domain <domain>", "Domain name for bucket identification (defaults to domain in bunki.config.ts)").option("-i, --images <dir>", "Images directory path", DEFAULT_IMAGES_DIR).option("--output-json <file>", "Output URL mapping to JSON file").action(async (options2) => {
+    await handleImagesPushCommand(options2);
+  });
+}
+
+// src/cli/commands/init.ts
+import path9 from "path";
+var defaultDependencies = {
+  createDefaultConfig,
+  ensureDir,
+  writeFile: (filePath, data) => Bun.write(filePath, data),
+  logger: console,
+  exit: (code) => process.exit(code)
+};
+async function handleInitCommand(options2, deps = defaultDependencies) {
+  try {
+    const configPath = path9.resolve(options2.config);
+    const configCreated = await deps.createDefaultConfig(configPath);
+    if (!configCreated) {
+      deps.logger.log(`
+Skipped initialization because the config file already exists`);
+      return;
+    }
+    deps.logger.log("Creating directory structure...");
+    const baseDir = process.cwd();
+    const contentDir = path9.join(baseDir, "content");
+    const templatesDir = path9.join(baseDir, "templates");
+    const stylesDir = path9.join(templatesDir, "styles");
+    const publicDir = path9.join(baseDir, "public");
+    await deps.ensureDir(contentDir);
+    await deps.ensureDir(templatesDir);
+    await deps.ensureDir(stylesDir);
+    await deps.ensureDir(publicDir);
+    for (const [filename, content] of Object.entries(getDefaultTemplates())) {
+      await deps.writeFile(path9.join(templatesDir, filename), content);
+    }
+    await deps.writeFile(path9.join(stylesDir, "main.css"), getDefaultCss());
+    await deps.writeFile(path9.join(contentDir, "welcome.md"), getSamplePost());
+    deps.logger.log(`
+Initialization complete! Here are the next steps:`);
+    deps.logger.log("1. Edit bunki.config.ts to configure your site");
+    deps.logger.log("2. Add markdown files to the content directory");
+    deps.logger.log('3. Run "bunki generate" to build your site');
+    deps.logger.log('4. Run "bunki serve" to preview your site locally');
+  } catch (error) {
+    deps.logger.error("Error initializing site:", error);
+    deps.exit(1);
+  }
+}
+function registerInitCommand(program2, deps = defaultDependencies) {
+  return program2.command("init").description("Initialize a new site with default structure").option("-c, --config <file>", "Path to config file", "bunki.config.ts").action(async (options2) => {
+    await handleInitCommand(options2, deps);
+  });
+}
+function getDefaultTemplates() {
+  return {
+    "base.njk": String.raw`<!DOCTYPE html>
+  <html lang="en">
+  <head>
+    <meta charset="UTF-8">
+    <meta name="viewport" content="width=device-width, initial-scale=1.0">
+    <title>{% block title %}{{ site.title }}{% endblock %}</title>
+    <meta name="description" content="{% block description %}{{ site.description }}{% endblock %}">
+    <link rel="stylesheet" href="/css/style.css">
+    {% block head %}{% endblock %}
+  </head>
+  <body>
+    <header>
+      <div class="container">
+        <h1><a href="/">{{ site.title }}</a></h1>
+        <nav>
+          <ul>
+            <li><a href="/">Home</a></li>
+            <li><a href="/tags/">Tags</a></li>
+          </ul>
+        </nav>
       </div>
     </header>
 
-    <div class="post-content">
-      {{ post.html | safe }}
-    </div>
-  </article>
-{% endblock %}`,
-        "tag.njk": `{% extends "base.njk" %}
-
-{% block title %}{{ tag.name }} | {{ site.title }}{% endblock %}
-{% block description %}Posts tagged with {{ tag.name }} on {{ site.title }}{% endblock %}
-
-{% block content %}
-  <h1>Posts tagged "{{ tag.name }}"</h1>
-
-  {% if tag.description %}
-    <div class="tag-description">{{ tag.description }}</div>
-  {% endif %}
-
-  {% if tag.posts.length > 0 %}
-    <div class="posts">
-      {% for post in tag.posts %}
-        <article class="post-card">
-          <h2><a href="{{ post.url }}">{{ post.title }}</a></h2>
-          <div class="post-meta">
-            <time datetime="{{ post.date }}">{{ post.date | date("MMMM D, YYYY") }}</time>
-          </div>
-          <div class="post-excerpt">{{ post.excerpt }}</div>
-          <a href="{{ post.url }}" class="read-more">Read more \u2192</a>
-        </article>
-      {% endfor %}
-    </div>
-
-    {% if pagination.totalPages > 1 %}
-      <nav class="pagination">
-        {% if pagination.hasPrevPage %}
-          <a href="{{ pagination.pagePath }}{% if pagination.prevPage > 1 %}page/{{ pagination.prevPage }}/{% endif %}" class="prev">\u2190 Previous</a>
-        {% endif %}
-
-        {% if pagination.hasNextPage %}
-          <a href="{{ pagination.pagePath }}page/{{ pagination.nextPage }}/" class="next">Next \u2192</a>
-        {% endif %}
-
-        <span class="page-info">Page {{ pagination.currentPage }} of {{ pagination.totalPages }}</span>
-      </nav>
+    <main class="container">
+      {% block content %}{% endblock %}
+    </main>
+
+    <footer>
+      <div class="container">
+        <p>&copy; {{ "now" | date("YYYY") }} {{ site.title }}</p>
+      </div>
+    </footer>
+  </body>
+  </html>`,
+    "index.njk": String.raw`{% extends "base.njk" %}
+
+  {% block content %}
+    <h1>Latest Posts</h1>
+
+    {% if posts.length > 0 %}
+      <div class="posts">
+        {% for post in posts %}
+          <article class="post-card">
+            <h2><a href="{{ post.url }}">{{ post.title }}</a></h2>
+            <div class="post-meta">
+              <time datetime="{{ post.date }}">{{ post.date | date("MMMM D, YYYY") }}</time>
+              {% if post.tags.length > 0 %}
+                <span class="tags">
+                  {% for tag in post.tags %}
+                    <a href="/tags/{{ post.tagSlugs[tag] }}/">{{ tag }}</a>{% if not loop.last %}, {% endif %}
+                  {% endfor %}
+                </span>
+              {% endif %}
+            </div>
+            <div class="post-excerpt">{{ post.excerpt }}</div>
+            <a href="{{ post.url }}" class="read-more">Read more \u2192</a>
+          </article>
+        {% endfor %}
+      </div>
+
+      {% if pagination.totalPages > 1 %}
+        <nav class="pagination">
+          {% if pagination.hasPrevPage %}
+            <a href="{{ pagination.pagePath }}{% if pagination.prevPage > 1 %}page/{{ pagination.prevPage }}/{% endif %}" class="prev">\u2190 Previous</a>
+          {% endif %}
+
+          {% if pagination.hasNextPage %}
+            <a href="{{ pagination.pagePath }}page/{{ pagination.nextPage }}/" class="next">Next \u2192</a>
+          {% endif %}
+
+          <span class="page-info">Page {{ pagination.currentPage }} of {{ pagination.totalPages }}</span>
+        </nav>
+      {% endif %}
+    {% else %}
+      <p>No posts yet!</p>
     {% endif %}
-  {% else %}
-    <p>No posts with this tag yet!</p>
-  {% endif %}
-{% endblock %}`,
-        "tags.njk": `{% extends "base.njk" %}
-
-{% block title %}Tags | {{ site.title }}{% endblock %}
-{% block description %}Browse all tags on {{ site.title }}{% endblock %}
-
-{% block content %}
-  <h1>All Tags</h1>
-
-  {% if tags.length > 0 %}
-    <ul class="tags-list">
-      {% for tag in tags %}
-        <li>
-          <a href="/tags/{{ tag.slug }}/">{{ tag.name }}</a>
-          <span class="count">({{ tag.count }})</span>
-          {% if tag.description %}
-            <p class="description">{{ tag.description }}</p>
+  {% endblock %}`,
+    "post.njk": String.raw`{% extends "base.njk" %}
+
+  {% block title %}{{ post.title }} | {{ site.title }}{% endblock %}
+  {% block description %}{{ post.excerpt }}{% endblock %}
+
+  {% block content %}
+    <article class="post">
+      <header class="post-header">
+        <h1>{{ post.title }}</h1>
+        <div class="post-meta">
+          <time datetime="{{ post.date }}">{{ post.date | date("MMMM D, YYYY") }}</time>
+          {% if post.tags.length > 0 %}
+            <span class="tags">
+              {% for tag in post.tags %}
+                <a href="/tags/{{ post.tagSlugs[tag] }}/">{{ tag }}</a>{% if not loop.last %}, {% endif %}
+              {% endfor %}
+            </span>
           {% endif %}
-        </li>
-      {% endfor %}
-    </ul>
-  {% else %}
-    <p>No tags found!</p>
-  {% endif %}
-{% endblock %}`,
-        "archive.njk": `{% extends "base.njk" %}
-
-{% block title %}Archive {{ year }} | {{ site.title }}{% endblock %}
-{% block description %}Posts from {{ year }} on {{ site.title }}{% endblock %}
-
-{% block content %}
-  <h1>Posts from {{ year }}</h1>
-
-  {% if posts.length > 0 %}
-    <div class="posts">
-      {% for post in posts %}
-        <article class="post-card">
-          <h2><a href="{{ post.url }}">{{ post.title }}</a></h2>
-          <div class="post-meta">
-            <time datetime="{{ post.date }}">{{ post.date | date("MMMM D, YYYY") }}</time>
-            {% if post.tags.length > 0 %}
-              <span class="tags">
-                {% for tag in post.tags %}
-                  <a href="/tags/{{ post.tagSlugs[tag] }}/">{{ tag }}</a>{% if not loop.last %}, {% endif %}
-                {% endfor %}
-              </span>
+        </div>
+      </header>
+
+      <div class="post-content">
+        {{ post.html | safe }}
+      </div>
+    </article>
+  {% endblock %}`,
+    "tag.njk": String.raw`{% extends "base.njk" %}
+
+  {% block title %}{{ tag.name }} | {{ site.title }}{% endblock %}
+  {% block description %}Posts tagged with {{ tag.name }} on {{ site.title }}{% endblock %}
+
+  {% block content %}
+    <h1>Posts tagged "{{ tag.name }}"</h1>
+
+    {% if tag.description %}
+      <div class="tag-description">{{ tag.description }}</div>
+    {% endif %}
+
+    {% if tag.posts.length > 0 %}
+      <div class="posts">
+        {% for post in tag.posts %}
+          <article class="post-card">
+            <h2><a href="{{ post.url }}">{{ post.title }}</a></h2>
+            <div class="post-meta">
+              <time datetime="{{ post.date }}">{{ post.date | date("MMMM D, YYYY") }}</time>
+            </div>
+            <div class="post-excerpt">{{ post.excerpt }}</div>
+            <a href="{{ post.url }}" class="read-more">Read more \u2192</a>
+          </article>
+        {% endfor %}
+      </div>
+
+      {% if pagination.totalPages > 1 %}
+        <nav class="pagination">
+          {% if pagination.hasPrevPage %}
+            <a href="{{ pagination.pagePath }}{% if pagination.prevPage > 1 %}page/{{ pagination.prevPage }}/{% endif %}" class="prev">\u2190 Previous</a>
+          {% endif %}
+
+          {% if pagination.hasNextPage %}
+            <a href="{{ pagination.pagePath }}page/{{ pagination.nextPage }}/" class="next">Next \u2192</a>
+          {% endif %}
+
+          <span class="page-info">Page {{ pagination.currentPage }} of {{ pagination.totalPages }}</span>
+        </nav>
+      {% endif %}
+    {% else %}
+      <p>No posts with this tag yet!</p>
+    {% endif %}
+  {% endblock %}`,
+    "tags.njk": String.raw`{% extends "base.njk" %}
+
+  {% block title %}Tags | {{ site.title }}{% endblock %}
+  {% block description %}Browse all tags on {{ site.title }}{% endblock %}
+
+  {% block content %}
+    <h1>All Tags</h1>
+
+    {% if tags.length > 0 %}
+      <ul class="tags-list">
+        {% for tag in tags %}
+          <li>
+            <a href="/tags/{{ tag.slug }}/">{{ tag.name }}</a>
+            <span class="count">({{ tag.count }})</span>
+            {% if tag.description %}
+              <p class="description">{{ tag.description }}</p>
             {% endif %}
-          </div>
-          <div class="post-excerpt">{{ post.excerpt }}</div>
-          <a href="{{ post.url }}" class="read-more">Read more \u2192</a>
-        </article>
-      {% endfor %}
-    </div>
-
-    {% if pagination.totalPages > 1 %}
-      <nav class="pagination">
-        {% if pagination.hasPrevPage %}
-          <a href="/{{ year }}/{% if pagination.prevPage > 1 %}page/{{ pagination.prevPage }}/{% endif %}" class="prev">\u2190 Previous</a>
-        {% endif %}
-
-        {% if pagination.hasNextPage %}
-          <a href="/{{ year }}/page/{{ pagination.nextPage }}/" class="next">Next \u2192</a>
-        {% endif %}
-
-        <span class="page-info">Page {{ pagination.currentPage }} of {{ pagination.totalPages }}</span>
-      </nav>
+          </li>
+        {% endfor %}
+      </ul>
+    {% else %}
+      <p>No tags found!</p>
     {% endif %}
-  {% else %}
-    <p>No posts from {{ year }}!</p>
-  {% endif %}
-{% endblock %}`
-      };
-      for (const [filename, content] of Object.entries(templates)) {
-        await Bun.write(path8.join(DEFAULT_TEMPLATES_DIR, filename), content);
-      }
-      const defaultCss = `/* Reset & base styles */
-* {
-  margin: 0;
-  padding: 0;
-  box-sizing: border-box;
-}
+  {% endblock %}`,
+    "archive.njk": String.raw`{% extends "base.njk" %}
+
+  {% block title %}Archive {{ year }} | {{ site.title }}{% endblock %}
+  {% block description %}Posts from {{ year }} on {{ site.title }}{% endblock %}
+
+  {% block content %}
+    <h1>Posts from {{ year }}</h1>
+
+    {% if posts.length > 0 %}
+      <div class="posts">
+        {% for post in posts %}
+          <article class="post-card">
+            <h2><a href="{{ post.url }}">{{ post.title }}</a></h2>
+            <div class="post-meta">
+              <time datetime="{{ post.date }}">{{ post.date | date("MMMM D, YYYY") }}</time>
+              {% if post.tags.length > 0 %}
+                <span class="tags">
+                  {% for tag in post.tags %}
+                    <a href="/tags/{{ post.tagSlugs[tag] }}/">{{ tag }}</a>{% if not loop.last %}, {% endif %}
+                  {% endfor %}
+                </span>
+              {% endif %}
+            </div>
+            <div class="post-excerpt">{{ post.excerpt }}</div>
+            <a href="{{ post.url }}" class="read-more">Read more \u2192</a>
+          </article>
+        {% endfor %}
+      </div>
 
-body {
-  font-family: system-ui, -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, Oxygen-Sans, Ubuntu, Cantarell, "Helvetica Neue", sans-serif;
-  line-height: 1.6;
-  color: #333;
-  background-color: #f8f9fa;
-  padding-bottom: 2rem;
-}
+      {% if pagination.totalPages > 1 %}
+        <nav class="pagination">
+          {% if pagination.hasPrevPage %}
+            <a href="/{{ year }}/{% if pagination.prevPage > 1 %}page/{{ pagination.prevPage }}/{% endif %}" class="prev">\u2190 Previous</a>
+          {% endif %}
 
-a {
-  color: #0066cc;
-  text-decoration: none;
-}
+          {% if pagination.hasNextPage %}
+            <a href="/{{ year }}/page/{{ pagination.nextPage }}/" class="next">Next \u2192</a>
+          {% endif %}
 
-a:hover {
-  text-decoration: underline;
+          <span class="page-info">Page {{ pagination.currentPage }} of {{ pagination.totalPages }}</span>
+        </nav>
+      {% endif %}
+    {% else %}
+      <p>No posts from {{ year }}!</p>
+    {% endif %}
+  {% endblock %}`
+  };
 }
+function getDefaultCss() {
+  return String.raw`/* Reset & base styles */
+  * {
+    margin: 0;
+    padding: 0;
+    box-sizing: border-box;
+  }
 
-.container {
-  max-width: 800px;
-  margin: 0 auto;
-  padding: 0 1.5rem;
-}
+  body {
+    font-family: system-ui, -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, Oxygen-Sans, Ubuntu, Cantarell, "Helvetica Neue", sans-serif;
+    line-height: 1.6;
+    color: #333;
+    background-color: #f8f9fa;
+    padding-bottom: 2rem;
+  }
 
-/* Header */
-header {
-  background-color: #fff;
-  padding: 1.5rem 0;
-  box-shadow: 0 1px 3px rgba(0,0,0,0.1);
-  margin-bottom: 2rem;
-}
+  a {
+    color: #0066cc;
+    text-decoration: none;
+  }
 
-header h1 {
-  font-size: 1.8rem;
-  margin: 0;
-}
+  a:hover {
+    text-decoration: underline;
+  }
 
-header h1 a {
-  color: #333;
-  text-decoration: none;
-}
+  .container {
+    max-width: 800px;
+    margin: 0 auto;
+    padding: 0 1.5rem;
+  }
 
-header nav {
-  margin-top: 0.5rem;
-}
+  /* Header */
+  header {
+    background-color: #fff;
+    padding: 1.5rem 0;
+    box-shadow: 0 1px 3px rgba(0,0,0,0.1);
+    margin-bottom: 2rem;
+  }
 
-header nav ul {
-  display: flex;
-  list-style: none;
-  gap: 1.5rem;
-}
+  header h1 {
+    font-size: 1.8rem;
+    margin: 0;
+  }
 
-/* Main content */
-main {
-  background-color: #fff;
-  padding: 2rem;
-  border-radius: 5px;
-  box-shadow: 0 1px 3px rgba(0,0,0,0.1);
-}
+  header h1 a {
+    color: #333;
+    text-decoration: none;
+  }
 
-/* Posts */
-.posts {
-  display: flex;
-  flex-direction: column;
-  gap: 2rem;
-}
+  header nav {
+    margin-top: 0.5rem;
+  }
 
-.post-card {
-  border-bottom: 1px solid #eee;
-  padding-bottom: 1.5rem;
-}
+  header nav ul {
+    display: flex;
+    list-style: none;
+    gap: 1.5rem;
+  }
 
-.post-card:last-child {
-  border-bottom: none;
-}
+  /* Main content */
+  main {
+    background-color: #fff;
+    padding: 2rem;
+    border-radius: 5px;
+    box-shadow: 0 1px 3px rgba(0,0,0,0.1);
+  }
 
-.post-card h2 {
-  margin-bottom: 0.5rem;
-}
+  /* Posts */
+  .posts {
+    display: flex;
+    flex-direction: column;
+    gap: 2rem;
+  }
 
-.post-meta {
-  font-size: 0.9rem;
-  color: #6c757d;
-  margin-bottom: 1rem;
-}
+  .post-card {
+    border-bottom: 1px solid #eee;
+    padding-bottom: 1.5rem;
+  }
 
-.post-excerpt {
-  margin-bottom: 1rem;
-}
+  .post-card:last-child {
+    border-bottom: none;
+  }
 
-.read-more {
-  font-weight: 500;
-}
+  .post-card h2 {
+    margin-bottom: 0.5rem;
+  }
 
-/* Single post */
-.post-header {
-  margin-bottom: 2rem;
-}
+  .post-meta {
+    font-size: 0.9rem;
+    color: #6c757d;
+    margin-bottom: 1rem;
+  }
 
-.post-content {
-  line-height: 1.8;
-}
+  .post-excerpt {
+    margin-bottom: 1rem;
+  }
 
-.post-content p,
-.post-content ul,
-.post-content ol,
-.post-content blockquote {
-  margin-bottom: 1.5rem;
-}
+  .read-more {
+    font-weight: 500;
+  }
 
-.post-content h2,
-.post-content h3,
-.post-content h4 {
-  margin-top: 2rem;
-  margin-bottom: 1rem;
-}
+  /* Single post */
+  .post-header {
+    margin-bottom: 2rem;
+  }
 
-.post-content img {
-  max-width: 100%;
-  height: auto;
-  display: block;
-  margin: 2rem auto;
-}
+  .post-content {
+    line-height: 1.8;
+  }
 
-.post-content pre {
-  background-color: #f5f5f5;
-  padding: 1rem;
-  border-radius: 4px;
-  overflow-x: auto;
-  margin-bottom: 1.5rem;
-}
+  .post-content p,
+  .post-content ul,
+  .post-content ol,
+  .post-content blockquote {
+    margin-bottom: 1.5rem;
+  }
 
-.post-content code {
-  font-family: 'SFMono-Regular', Consolas, 'Liberation Mono', Menlo, monospace;
-  font-size: 0.9em;
-  background-color: #f5f5f5;
-  padding: 0.2em 0.4em;
-  border-radius: 3px;
-}
+  .post-content h2,
+  .post-content h3,
+  .post-content h4 {
+    margin-top: 2rem;
+    margin-bottom: 1rem;
+  }
 
-.post-content pre code {
-  padding: 0;
-  background-color: transparent;
-}
+  .post-content img {
+    max-width: 100%;
+    height: auto;
+    display: block;
+    margin: 2rem auto;
+  }
 
-/* Tags */
-.tags a {
-  display: inline-block;
-  margin-left: 0.5rem;
-}
+  .post-content pre {
+    background-color: #f5f5f5;
+    padding: 1rem;
+    border-radius: 4px;
+    overflow-x: auto;
+    margin-bottom: 1.5rem;
+  }
 
-.tags-list {
-  list-style: none;
-}
+  .post-content code {
+    font-family: 'SFMono-Regular', Consolas, 'Liberation Mono', Menlo, monospace;
+    font-size: 0.9em;
+    background-color: #f5f5f5;
+    padding: 0.2em 0.4em;
+    border-radius: 3px;
+  }
 
-.tags-list li {
-  margin-bottom: 1rem;
-}
+  .post-content pre code {
+    padding: 0;
+    background-color: transparent;
+  }
 
-.tags-list .count {
-  color: #6c757d;
-  font-size: 0.9rem;
-}
+  /* Tags */
+  .tags a {
+    display: inline-block;
+    margin-left: 0.5rem;
+  }
 
-.tags-list .description {
-  margin-top: 0.25rem;
-  font-size: 0.9rem;
-  color: #6c757d;
-}
+  .tags-list {
+    list-style: none;
+  }
 
-/* Pagination */
-.pagination {
-  display: flex;
-  justify-content: space-between;
-  align-items: center;
-  margin-top: 2rem;
-  padding-top: 1rem;
-  border-top: 1px solid #eee;
-}
+  .tags-list li {
+    margin-bottom: 1rem;
+  }
 
-.pagination .page-info {
-  color: #6c757d;
-  font-size: 0.9rem;
-}
+  .tags-list .count {
+    color: #6c757d;
+    font-size: 0.9rem;
+  }
 
-/* Footer */
-footer {
-  text-align: center;
-  padding: 2rem 0;
-  color: #6c757d;
-  font-size: 0.9rem;
-}`;
-      await Bun.write(path8.join(DEFAULT_TEMPLATES_DIR, "styles", "main.css"), defaultCss);
-      const samplePost = `---
-title: Welcome to Bunki
-date: ${new Date().toISOString()}
-tags: [getting-started, bunki]
----
+  .tags-list .description {
+    margin-top: 0.25rem;
+    font-size: 0.9rem;
+    color: #6c757d;
+  }
 
-# Welcome to Your New Bunki Site
+  /* Pagination */
+  .pagination {
+    display: flex;
+    justify-content: space-between;
+    align-items: center;
+    margin-top: 2rem;
+    padding-top: 1rem;
+    border-top: 1px solid #eee;
+  }
 
-This is a sample blog post to help you get started with Bunki. You can edit this file or create new markdown files in the \`content\` directory.
+  .pagination .page-info {
+    color: #6c757d;
+    font-size: 0.9rem;
+  }
 
-## Features
+  /* Footer */
+  footer {
+    text-align: center;
+    padding: 2rem 0;
+    color: #6c757d;
+    font-size: 0.9rem;
+  }`;
+}
+function getSamplePost() {
+  return `---
+  title: Welcome to Bunki
+  date: ${new Date().toISOString()}
+  tags: [getting-started, bunki]
+  ---
 
-- Markdown support with frontmatter
-- Syntax highlighting for code blocks
-- Tag-based organization
-- Pagination for post listings
-- RSS feed generation
-- Sitemap generation
+  # Welcome to Your New Bunki Site
 
-## Adding Content
+  This is a sample blog post to help you get started with Bunki. You can edit this file or create new markdown files in the \`content\` directory.
 
-Create new markdown files in the \`content\` directory with frontmatter like this:
+  ## Features
 
-\`\`\`markdown
----
-title: Your Post Title
-date: 2025-01-01T12:00:00Z
-tags: [tag1, tag2]
----
+  - Markdown support with frontmatter
+  - Syntax highlighting for code blocks
+  - Tag-based organization
+  - Pagination for post listings
+  - RSS feed generation
+  - Sitemap generation
 
-Your post content goes here...
-\`\`\`
+  ## Adding Content
 
-## Code Highlighting
+  Create new markdown files in the \`content\` directory with frontmatter like this:
 
-Bunki supports syntax highlighting for code blocks:
+  \`\`\`markdown
+  ---
+  title: Your Post Title
+  date: 2025-01-01T12:00:00Z
+  tags: [tag1, tag2]
+  ---
 
-\`\`\`javascript
-function hello() {
-  console.log('Hello, world!');
-}
-\`\`\`
+  Your post content goes here...
+  \`\`\`
 
-## Next Steps
+  ## Code Highlighting
 
-1. Edit the site configuration in \`bunki.config.ts\`
-2. Create your own templates in the \`templates\` directory
-3. Add more blog posts in the \`content\` directory
-4. Run \`bunki generate\` to build your site
-5. Run \`bunki serve\` to preview your site locally
-`;
-      await Bun.write(path8.join(DEFAULT_CONTENT_DIR, "welcome.md"), samplePost);
-      console.log(`
-Initialization complete! Here are the next steps:`);
-      console.log("1. Edit bunki.config.ts to configure your site");
-      console.log("2. Add markdown files to the content directory");
-      console.log('3. Run "bunki generate" to build your site');
-      console.log('4. Run "bunki serve" to preview your site locally');
-    } else {
-      console.log(`
-Skipped initialization because the config file already exists`);
-    }
-  } catch (error) {
-    console.error("Error initializing site:", error);
-    process.exit(1);
+  Bunki supports syntax highlighting for code blocks:
+
+  \`\`\`javascript
+  function hello() {
+    console.log('Hello, world!');
   }
-});
-program2.command("new").description("Create a new blog post").argument("<title>", "Title of the post").option("-t, --tags <tags>", "Comma-separated list of tags", "").action(async (title, options2) => {
+  \`\`\`
+
+  ## Next Steps
+
+  1. Edit the site configuration in \`bunki.config.ts\`
+  2. Create your own templates in the \`templates\` directory
+  3. Add more blog posts in the \`content\` directory
+  4. Run \`bunki generate\` to build your site
+  5. Run \`bunki serve\` to preview your site locally
+  `;
+}
+
+// src/cli/commands/new-post.ts
+import path10 from "path";
+var defaultDeps4 = {
+  writeFile: (filePath, data) => Bun.write(filePath, data),
+  now: () => new Date,
+  logger: console,
+  exit: (code) => process.exit(code)
+};
+function createSlug(title) {
+  return title.toLowerCase().replace(/[^a-z0-9]+/g, "-").replace(/^-|-$/g, "");
+}
+async function handleNewCommand(title, options2, deps = defaultDeps4) {
   try {
-    const slug = title.toLowerCase().replace(/[^a-z0-9]+/g, "-").replace(/^-|-$/g, "");
-    const date = new Date().toISOString();
-    const tags = options2.tags ? options2.tags.split(",").map((tag) => tag.trim()) : [];
+    const slug = createSlug(title);
+    const date = deps.now().toISOString();
+    const tags = options2.tags ? options2.tags.split(",").map((tag) => tag.trim()).filter(Boolean) : [];
     const frontmatter = `---
-title: ${title}
-date: ${date}
-tags: [${tags.join(", ")}]
----
+` + `title: ${title}
+` + `date: ${date}
+` + `tags: [${tags.join(", ")}]
+` + `---
 
-# ${title}
+` + `# ${title}
 
 `;
-    const filePath = path8.join(DEFAULT_CONTENT_DIR, `${slug}.md`);
-    await Bun.write(filePath, frontmatter);
-    console.log(`Created new post: ${filePath}`);
-  } catch (error) {
-    console.error("Error creating new post:", error);
-    process.exit(1);
-  }
-});
-program2.command("generate").description("Generate static site from markdown content").option("-c, --config <file>", "Config file path", "bunki.config.ts").option("-d, --content <dir>", "Content directory", DEFAULT_CONTENT_DIR).option("-o, --output <dir>", "Output directory", DEFAULT_OUTPUT_DIR).option("-t, --templates <dir>", "Templates directory", DEFAULT_TEMPLATES_DIR).action(async (options2) => {
-  try {
-    const configPath = path8.resolve(options2.config);
-    const contentDir = path8.resolve(options2.content);
-    const outputDir = path8.resolve(options2.output);
-    const templatesDir = path8.resolve(options2.templates);
-    console.log("Generating site with:");
-    console.log(`- Config file: ${configPath}`);
-    console.log(`- Content directory: ${contentDir}`);
-    console.log(`- Output directory: ${outputDir}`);
-    console.log(`- Templates directory: ${templatesDir}`);
-    const config = await loadConfig(configPath);
-    const generator = new SiteGenerator({
-      contentDir,
-      outputDir,
-      templatesDir,
-      config
-    });
-    await generator.initialize();
-    await generator.generate();
-    console.log("Site generation completed successfully!");
+    const filePath = path10.join(DEFAULT_CONTENT_DIR, `${slug}.md`);
+    await deps.writeFile(filePath, frontmatter);
+    deps.logger.log(`Created new post: ${filePath}`);
+    return filePath;
   } catch (error) {
-    console.error("Error generating site:", error);
-    process.exit(1);
-  }
-});
-program2.command("serve").description("Start a local development server").option("-o, --output <dir>", "Output directory", DEFAULT_OUTPUT_DIR).option("-p, --port <number>", "Port number", "3000").action(async (options2) => {
-  try {
-    const outputDir = path8.resolve(options2.output);
-    const port = parseInt(options2.port, 10);
-    await startServer(outputDir, port);
-  } catch (error) {
-    console.error("Error starting dev server:", error);
-    process.exit(1);
+    deps.logger.error("Error creating new post:", error);
+    deps.exit(1);
+    return "";
   }
-});
-program2.command("css").description("Process CSS using PostCSS").option("-c, --config <file>", "Config file path", "bunki.config.ts").option("-o, --output <dir>", "Output directory", DEFAULT_OUTPUT_DIR).option("-w, --watch", "Watch for changes and rebuild").action(async (options2) => {
+}
+function registerNewCommand(program2) {
+  return program2.command("new").description("Create a new blog post").argument("<title>", "Title of the post").option("-t, --tags <tags>", "Comma-separated list of tags", "").action(async (title, options2) => {
+    await handleNewCommand(title, options2, defaultDeps4);
+  });
+}
+
+// src/cli/commands/serve.ts
+import path12 from "path";
+
+// src/server.ts
+import fs3 from "fs";
+import path11 from "path";
+async function startServer(outputDir = DEFAULT_OUTPUT_DIR, port = 3000) {
   try {
-    const configPath = path8.resolve(options2.config);
-    const outputDir = path8.resolve(options2.output);
-    const config = await loadConfig(configPath);
-    const cssConfig = config.css || getDefaultCSSConfig();
-    if (!cssConfig.enabled) {
-      console.log("CSS processing is disabled in configuration");
-      return;
-    }
-    const processorOptions = {
-      css: cssConfig,
-      projectRoot: process.cwd(),
-      outputDir,
-      verbose: true
-    };
-    if (options2.watch) {
-      console.log("Starting CSS watch mode...");
-      cssConfig.watch = true;
-      await processCSS(processorOptions);
-      await watchCSS(processorOptions);
-    } else {
-      await processCSS(processorOptions);
+    const stats = await fs3.promises.stat(outputDir);
+    if (!stats.isDirectory()) {
+      const msg = `Error: Output directory ${outputDir} does not exist or is not accessible.`;
+      console.error(msg);
+      console.log('Try running "bunki generate" first to build your site.');
+      throw new Error(msg);
     }
   } catch (error) {
-    console.error("Error processing CSS:", error);
-    process.exit(1);
+    const msg = `Error: Output directory ${outputDir} does not exist or is not accessible.`;
+    console.error(msg);
+    console.log('Try running "bunki generate" first to build your site.');
+    throw new Error(msg);
   }
-});
-program2.command("images:push").description("Upload images to S3-compatible storage").option("-d, --domain <domain>", "Domain name for bucket identification (defaults to domain in bunki.config.ts)").option("-i, --images <dir>", "Images directory path", DEFAULT_IMAGES_DIR).option("--output-json <file>", "Output URL mapping to JSON file").action(async (options2) => {
+  console.log(`Starting server for site in ${outputDir}...`);
+  const server = Bun.serve({
+    port,
+    async fetch(req) {
+      try {
+        const url = new URL(req.url);
+        let pathname = url.pathname;
+        if (pathname === "/") {
+          pathname = "/index.html";
+        }
+        if (pathname.endsWith("/")) {
+          pathname = pathname + "index.html";
+        }
+        const homePaginationMatch = pathname.match(/^\/page\/(\d+)\/?$/);
+        const tagPaginationMatch = pathname.match(/^\/tags\/([^\/]+)\/page\/(\d+)\/?$/);
+        const yearPaginationMatch = pathname.match(/^\/(\d{4})\/page\/(\d+)\/?$/);
+        let filePath = "";
+        if (homePaginationMatch) {
+          const pageNumber = homePaginationMatch[1];
+          filePath = path11.join(outputDir, "page", pageNumber, "index.html");
+        } else if (tagPaginationMatch) {
+          const tagSlug = tagPaginationMatch[1];
+          const pageNumber = tagPaginationMatch[2];
+          filePath = path11.join(outputDir, "tags", tagSlug, "page", pageNumber, "index.html");
+        } else if (yearPaginationMatch) {
+          const year = yearPaginationMatch[1];
+          const pageNumber = yearPaginationMatch[2];
+          filePath = path11.join(outputDir, year, "page", pageNumber, "index.html");
+        } else {
+          const directPath = path11.join(outputDir, pathname);
+          const withoutSlash = path11.join(outputDir, pathname + ".html");
+          const withHtml = pathname.endsWith(".html") ? directPath : withoutSlash;
+          const bunFileDirect = Bun.file(directPath);
+          const bunFileHtml = Bun.file(withHtml);
+          if (await bunFileDirect.exists()) {
+            filePath = directPath;
+          } else if (await bunFileHtml.exists()) {
+            filePath = withHtml;
+          } else {
+            const indexPath = path11.join(outputDir, pathname, "index.html");
+            const bunFileIndex = Bun.file(indexPath);
+            if (await bunFileIndex.exists()) {
+              filePath = indexPath;
+            } else {
+              console.log(`404 Not Found: ${pathname}`);
+              return new Response(`<h1>404 Not Found</h1><p>Could not find ${pathname}</p>`, {
+                status: 404,
+                headers: { "Content-Type": "text/html" }
+              });
+            }
+          }
+        }
+        console.log(`Serving file: ${filePath}`);
+        const extname = path11.extname(filePath);
+        let contentType = "text/html";
+        switch (extname) {
+          case ".js":
+            contentType = "text/javascript";
+            break;
+          case ".css":
+            contentType = "text/css";
+            break;
+          case ".json":
+            contentType = "application/json";
+            break;
+          case ".png":
+            contentType = "image/png";
+            break;
+          case ".jpg":
+          case ".jpeg":
+            contentType = "image/jpeg";
+            break;
+          case ".svg":
+            contentType = "image/svg+xml";
+            break;
+          case ".xml":
+            contentType = "application/xml";
+            break;
+        }
+        try {
+          const bunFile = Bun.file(filePath);
+          return new Response(bunFile, {
+            headers: { "Content-Type": contentType }
+          });
+        } catch (err) {
+          console.error(`Error reading file ${filePath}:`, err);
+          return new Response(`<h1>500 Server Error</h1><p>Error reading file: ${filePath}</p><pre>${err}</pre>`, {
+            status: 500,
+            headers: { "Content-Type": "text/html" }
+          });
+        }
+      } catch (error) {
+        console.error("Server error:", error);
+        return new Response(`<h1>500 Server Error</h1><pre>${error}</pre>`, {
+          status: 500,
+          headers: { "Content-Type": "text/html" }
+        });
+      }
+    }
+  });
+  console.log(`Bunki development server running at http://localhost:${port}/`);
+  return server;
+}
+
+// src/cli/commands/serve.ts
+var defaultDeps5 = {
+  startServer,
+  logger: console,
+  exit: (code) => process.exit(code)
+};
+async function handleServeCommand(options2, deps = defaultDeps5) {
   try {
-    await uploadImages({
-      domain: options2.domain,
-      images: options2.images,
-      outputJson: options2.outputJson
-    });
+    const outputDir = path12.resolve(options2.output);
+    const port = parseInt(options2.port, 10);
+    await deps.startServer(outputDir, port);
   } catch (error) {
-    console.error("Error uploading images:", error);
-    process.exit(1);
+    deps.logger.error("Error starting dev server:", error);
+    deps.exit(1);
   }
-});
-if (import.meta.url === Bun.main || process.argv[1] === import.meta.url.substring(7)) {
-  program2.parse(process.argv);
+}
+function registerServeCommand(program2) {
+  return program2.command("serve").description("Start a local development server").option("-o, --output <dir>", "Output directory", DEFAULT_OUTPUT_DIR).option("-p, --port <number>", "Port number", "3000").action(async (options2) => {
+    await handleServeCommand(options2);
+  });
+}
+
+// src/cli.ts
+var program2 = new Command;
+registerInitCommand(program2);
+registerNewCommand(program2);
+registerGenerateCommand(program2);
+registerServeCommand(program2);
+registerCssCommand(program2);
+registerImagesPushCommand(program2);
+program2.name("bunki").description("An opinionated static site generator built with Bun").version("0.5.3");
+if (import.meta.url === Bun.main) {
+  program2.parse(Bun.argv);
 }