ani-cli-npm 1.1.1 → 1.2.0

package/aur/pkg/nodejs-ani-cli-npm/usr/lib/node_modules/ani-cli-npm/node_modules/sshpk/lib/utils.js

@@ -0,0 +1,404 @@
+// Copyright 2015 Joyent, Inc.
+
+module.exports = {
+	bufferSplit: bufferSplit,
+	addRSAMissing: addRSAMissing,
+	calculateDSAPublic: calculateDSAPublic,
+	calculateED25519Public: calculateED25519Public,
+	calculateX25519Public: calculateX25519Public,
+	mpNormalize: mpNormalize,
+	mpDenormalize: mpDenormalize,
+	ecNormalize: ecNormalize,
+	countZeros: countZeros,
+	assertCompatible: assertCompatible,
+	isCompatible: isCompatible,
+	opensslKeyDeriv: opensslKeyDeriv,
+	opensshCipherInfo: opensshCipherInfo,
+	publicFromPrivateECDSA: publicFromPrivateECDSA,
+	zeroPadToLength: zeroPadToLength,
+	writeBitString: writeBitString,
+	readBitString: readBitString,
+	pbkdf2: pbkdf2
+};
+
+var assert = require('assert-plus');
+var Buffer = require('safer-buffer').Buffer;
+var PrivateKey = require('./private-key');
+var Key = require('./key');
+var crypto = require('crypto');
+var algs = require('./algs');
+var asn1 = require('asn1');
+
+var ec = require('ecc-jsbn/lib/ec');
+var jsbn = require('jsbn').BigInteger;
+var nacl = require('tweetnacl');
+
+var MAX_CLASS_DEPTH = 3;
+
+function isCompatible(obj, klass, needVer) {
+	if (obj === null || typeof (obj) !== 'object')
+		return (false);
+	if (needVer === undefined)
+		needVer = klass.prototype._sshpkApiVersion;
+	if (obj instanceof klass &&
+	    klass.prototype._sshpkApiVersion[0] == needVer[0])
+		return (true);
+	var proto = Object.getPrototypeOf(obj);
+	var depth = 0;
+	while (proto.constructor.name !== klass.name) {
+		proto = Object.getPrototypeOf(proto);
+		if (!proto || ++depth > MAX_CLASS_DEPTH)
+			return (false);
+	}
+	if (proto.constructor.name !== klass.name)
+		return (false);
+	var ver = proto._sshpkApiVersion;
+	if (ver === undefined)
+		ver = klass._oldVersionDetect(obj);
+	if (ver[0] != needVer[0] || ver[1] < needVer[1])
+		return (false);
+	return (true);
+}
+
+function assertCompatible(obj, klass, needVer, name) {
+	if (name === undefined)
+		name = 'object';
+	assert.ok(obj, name + ' must not be null');
+	assert.object(obj, name + ' must be an object');
+	if (needVer === undefined)
+		needVer = klass.prototype._sshpkApiVersion;
+	if (obj instanceof klass &&
+	    klass.prototype._sshpkApiVersion[0] == needVer[0])
+		return;
+	var proto = Object.getPrototypeOf(obj);
+	var depth = 0;
+	while (proto.constructor.name !== klass.name) {
+		proto = Object.getPrototypeOf(proto);
+		assert.ok(proto && ++depth <= MAX_CLASS_DEPTH,
+		    name + ' must be a ' + klass.name + ' instance');
+	}
+	assert.strictEqual(proto.constructor.name, klass.name,
+	    name + ' must be a ' + klass.name + ' instance');
+	var ver = proto._sshpkApiVersion;
+	if (ver === undefined)
+		ver = klass._oldVersionDetect(obj);
+	assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1],
+	    name + ' must be compatible with ' + klass.name + ' klass ' +
+	    'version ' + needVer[0] + '.' + needVer[1]);
+}
+
+var CIPHER_LEN = {
+	'des-ede3-cbc': { key: 24, iv: 8 },
+	'aes-128-cbc': { key: 16, iv: 16 },
+	'aes-256-cbc': { key: 32, iv: 16 }
+};
+var PKCS5_SALT_LEN = 8;
+
+function opensslKeyDeriv(cipher, salt, passphrase, count) {
+	assert.buffer(salt, 'salt');
+	assert.buffer(passphrase, 'passphrase');
+	assert.number(count, 'iteration count');
+
+	var clen = CIPHER_LEN[cipher];
+	assert.object(clen, 'supported cipher');
+
+	salt = salt.slice(0, PKCS5_SALT_LEN);
+
+	var D, D_prev, bufs;
+	var material = Buffer.alloc(0);
+	while (material.length < clen.key + clen.iv) {
+		bufs = [];
+		if (D_prev)
+			bufs.push(D_prev);
+		bufs.push(passphrase);
+		bufs.push(salt);
+		D = Buffer.concat(bufs);
+		for (var j = 0; j < count; ++j)
+			D = crypto.createHash('md5').update(D).digest();
+		material = Buffer.concat([material, D]);
+		D_prev = D;
+	}
+
+	return ({
+	    key: material.slice(0, clen.key),
+	    iv: material.slice(clen.key, clen.key + clen.iv)
+	});
+}
+
+/* See: RFC2898 */
+function pbkdf2(hashAlg, salt, iterations, size, passphrase) {
+	var hkey = Buffer.alloc(salt.length + 4);
+	salt.copy(hkey);
+
+	var gen = 0, ts = [];
+	var i = 1;
+	while (gen < size) {
+		var t = T(i++);
+		gen += t.length;
+		ts.push(t);
+	}
+	return (Buffer.concat(ts).slice(0, size));
+
+	function T(I) {
+		hkey.writeUInt32BE(I, hkey.length - 4);
+
+		var hmac = crypto.createHmac(hashAlg, passphrase);
+		hmac.update(hkey);
+
+		var Ti = hmac.digest();
+		var Uc = Ti;
+		var c = 1;
+		while (c++ < iterations) {
+			hmac = crypto.createHmac(hashAlg, passphrase);
+			hmac.update(Uc);
+			Uc = hmac.digest();
+			for (var x = 0; x < Ti.length; ++x)
+				Ti[x] ^= Uc[x];
+		}
+		return (Ti);
+	}
+}
+
+/* Count leading zero bits on a buffer */
+function countZeros(buf) {
+	var o = 0, obit = 8;
+	while (o < buf.length) {
+		var mask = (1 << obit);
+		if ((buf[o] & mask) === mask)
+			break;
+		obit--;
+		if (obit < 0) {
+			o++;
+			obit = 8;
+		}
+	}
+	return (o*8 + (8 - obit) - 1);
+}
+
+function bufferSplit(buf, chr) {
+	assert.buffer(buf);
+	assert.string(chr);
+
+	var parts = [];
+	var lastPart = 0;
+	var matches = 0;
+	for (var i = 0; i < buf.length; ++i) {
+		if (buf[i] === chr.charCodeAt(matches))
+			++matches;
+		else if (buf[i] === chr.charCodeAt(0))
+			matches = 1;
+		else
+			matches = 0;
+
+		if (matches >= chr.length) {
+			var newPart = i + 1;
+			parts.push(buf.slice(lastPart, newPart - matches));
+			lastPart = newPart;
+			matches = 0;
+		}
+	}
+	if (lastPart <= buf.length)
+		parts.push(buf.slice(lastPart, buf.length));
+
+	return (parts);
+}
+
+function ecNormalize(buf, addZero) {
+	assert.buffer(buf);
+	if (buf[0] === 0x00 && buf[1] === 0x04) {
+		if (addZero)
+			return (buf);
+		return (buf.slice(1));
+	} else if (buf[0] === 0x04) {
+		if (!addZero)
+			return (buf);
+	} else {
+		while (buf[0] === 0x00)
+			buf = buf.slice(1);
+		if (buf[0] === 0x02 || buf[0] === 0x03)
+			throw (new Error('Compressed elliptic curve points ' +
+			    'are not supported'));
+		if (buf[0] !== 0x04)
+			throw (new Error('Not a valid elliptic curve point'));
+		if (!addZero)
+			return (buf);
+	}
+	var b = Buffer.alloc(buf.length + 1);
+	b[0] = 0x0;
+	buf.copy(b, 1);
+	return (b);
+}
+
+function readBitString(der, tag) {
+	if (tag === undefined)
+		tag = asn1.Ber.BitString;
+	var buf = der.readString(tag, true);
+	assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' +
+	    'not supported (0x' + buf[0].toString(16) + ')');
+	return (buf.slice(1));
+}
+
+function writeBitString(der, buf, tag) {
+	if (tag === undefined)
+		tag = asn1.Ber.BitString;
+	var b = Buffer.alloc(buf.length + 1);
+	b[0] = 0x00;
+	buf.copy(b, 1);
+	der.writeBuffer(b, tag);
+}
+
+function mpNormalize(buf) {
+	assert.buffer(buf);
+	while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00)
+		buf = buf.slice(1);
+	if ((buf[0] & 0x80) === 0x80) {
+		var b = Buffer.alloc(buf.length + 1);
+		b[0] = 0x00;
+		buf.copy(b, 1);
+		buf = b;
+	}
+	return (buf);
+}
+
+function mpDenormalize(buf) {
+	assert.buffer(buf);
+	while (buf.length > 1 && buf[0] === 0x00)
+		buf = buf.slice(1);
+	return (buf);
+}
+
+function zeroPadToLength(buf, len) {
+	assert.buffer(buf);
+	assert.number(len);
+	while (buf.length > len) {
+		assert.equal(buf[0], 0x00);
+		buf = buf.slice(1);
+	}
+	while (buf.length < len) {
+		var b = Buffer.alloc(buf.length + 1);
+		b[0] = 0x00;
+		buf.copy(b, 1);
+		buf = b;
+	}
+	return (buf);
+}
+
+function bigintToMpBuf(bigint) {
+	var buf = Buffer.from(bigint.toByteArray());
+	buf = mpNormalize(buf);
+	return (buf);
+}
+
+function calculateDSAPublic(g, p, x) {
+	assert.buffer(g);
+	assert.buffer(p);
+	assert.buffer(x);
+	g = new jsbn(g);
+	p = new jsbn(p);
+	x = new jsbn(x);
+	var y = g.modPow(x, p);
+	var ybuf = bigintToMpBuf(y);
+	return (ybuf);
+}
+
+function calculateED25519Public(k) {
+	assert.buffer(k);
+
+	var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k));
+	return (Buffer.from(kp.publicKey));
+}
+
+function calculateX25519Public(k) {
+	assert.buffer(k);
+
+	var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k));
+	return (Buffer.from(kp.publicKey));
+}
+
+function addRSAMissing(key) {
+	assert.object(key);
+	assertCompatible(key, PrivateKey, [1, 1]);
+
+	var d = new jsbn(key.part.d.data);
+	var buf;
+
+	if (!key.part.dmodp) {
+		var p = new jsbn(key.part.p.data);
+		var dmodp = d.mod(p.subtract(1));
+
+		buf = bigintToMpBuf(dmodp);
+		key.part.dmodp = {name: 'dmodp', data: buf};
+		key.parts.push(key.part.dmodp);
+	}
+	if (!key.part.dmodq) {
+		var q = new jsbn(key.part.q.data);
+		var dmodq = d.mod(q.subtract(1));
+
+		buf = bigintToMpBuf(dmodq);
+		key.part.dmodq = {name: 'dmodq', data: buf};
+		key.parts.push(key.part.dmodq);
+	}
+}
+
+function publicFromPrivateECDSA(curveName, priv) {
+	assert.string(curveName, 'curveName');
+	assert.buffer(priv);
+	var params = algs.curves[curveName];
+	var p = new jsbn(params.p);
+	var a = new jsbn(params.a);
+	var b = new jsbn(params.b);
+	var curve = new ec.ECCurveFp(p, a, b);
+	var G = curve.decodePointHex(params.G.toString('hex'));
+
+	var d = new jsbn(mpNormalize(priv));
+	var pub = G.multiply(d);
+	pub = Buffer.from(curve.encodePointHex(pub), 'hex');
+
+	var parts = [];
+	parts.push({name: 'curve', data: Buffer.from(curveName)});
+	parts.push({name: 'Q', data: pub});
+
+	var key = new Key({type: 'ecdsa', curve: curve, parts: parts});
+	return (key);
+}
+
+function opensshCipherInfo(cipher) {
+	var inf = {};
+	switch (cipher) {
+	case '3des-cbc':
+		inf.keySize = 24;
+		inf.blockSize = 8;
+		inf.opensslName = 'des-ede3-cbc';
+		break;
+	case 'blowfish-cbc':
+		inf.keySize = 16;
+		inf.blockSize = 8;
+		inf.opensslName = 'bf-cbc';
+		break;
+	case 'aes128-cbc':
+	case 'aes128-ctr':
+	case 'aes128-gcm@openssh.com':
+		inf.keySize = 16;
+		inf.blockSize = 16;
+		inf.opensslName = 'aes-128-' + cipher.slice(7, 10);
+		break;
+	case 'aes192-cbc':
+	case 'aes192-ctr':
+	case 'aes192-gcm@openssh.com':
+		inf.keySize = 24;
+		inf.blockSize = 16;
+		inf.opensslName = 'aes-192-' + cipher.slice(7, 10);
+		break;
+	case 'aes256-cbc':
+	case 'aes256-ctr':
+	case 'aes256-gcm@openssh.com':
+		inf.keySize = 32;
+		inf.blockSize = 16;
+		inf.opensslName = 'aes-256-' + cipher.slice(7, 10);
+		break;
+	default:
+		throw (new Error(
+		    'Unsupported openssl cipher "' + cipher + '"'));
+	}
+	return (inf);
+}

package/aur/pkg/nodejs-ani-cli-npm/usr/lib/node_modules/ani-cli-npm/node_modules/sshpk/man/man1/sshpk-conv.1

@@ -0,0 +1,135 @@
+.TH sshpk\-conv 1 "Jan 2016" sshpk "sshpk Commands"
+.SH NAME
+.PP
+sshpk\-conv \- convert between key formats
+.SH SYNOPSYS
+.PP
+\fB\fCsshpk\-conv\fR \-t FORMAT [FILENAME] [OPTIONS...]
+.PP
+\fB\fCsshpk\-conv\fR \-i [FILENAME] [OPTIONS...]
+.SH DESCRIPTION
+.PP
+Reads in a public or private key and converts it between different formats,
+particularly formats used in the SSH protocol and the well\-known PEM PKCS#1/7
+formats.
+.PP
+In the second form, with the \fB\fC\-i\fR option given, identifies a key and prints to 
+stderr information about its nature, size and fingerprint.
+.SH EXAMPLES
+.PP
+Assume the following SSH\-format public key in \fB\fCid_ecdsa.pub\fR:
+.PP
+.RS
+.nf
+ecdsa\-sha2\-nistp256 AAAAE2VjZHNhLXNoYTI...9M/4c4= user@host
+.fi
+.RE
+.PP
+Identify it with \fB\fC\-i\fR:
+.PP
+.RS
+.nf
+$ sshpk\-conv \-i id_ecdsa.pub
+id_ecdsa: a 256 bit ECDSA public key
+ECDSA curve: nistp256
+Comment: user@host
+Fingerprint:
+  SHA256:vCNX7eUkdvqqW0m4PoxQAZRv+CM4P4fS8+CbliAvS4k
+  81:ad:d5:57:e5:6f:7d:a2:93:79:56:af:d7:c0:38:51
+.fi
+.RE
+.PP
+Convert it to \fB\fCpkcs8\fR format, for use with e.g. OpenSSL:
+.PP
+.RS
+.nf
+$ sshpk\-conv \-t pkcs8 id_ecdsa
+\-\-\-\-\-BEGIN PUBLIC KEY\-\-\-\-\-
+MFkwEwYHKoZIzj0CAQYIKoZIzj0DAQcDQgAEAsA4R6N6AS3gzaPBeLjG2ObSgUsR
+zOt+kWJoijLnw3ZMYUKmAx+lD0I5XUxdrPcs1vH5f3cn9TvRvO9L0z/hzg==
+\-\-\-\-\-END PUBLIC KEY\-\-\-\-\-
+.fi
+.RE
+.PP
+Retrieve the public half of a private key:
+.PP
+.RS
+.nf
+$ openssl genrsa 2048 | sshpk\-conv \-t ssh \-c foo@bar
+ssh\-rsa AAAAB3NzaC1yc2EAAA...koK7 foo@bar
+.fi
+.RE
+.PP
+Convert a private key to PKCS#1 (OpenSSL) format from a new\-style OpenSSH key
+format (the \fB\fCssh\-keygen \-o\fR format):
+.PP
+.RS
+.nf
+$ ssh\-keygen \-o \-f foobar
+\&...
+$ sshpk\-conv \-p \-t pkcs1 foobar
+\-\-\-\-\-BEGIN RSA PRIVATE KEY\-\-\-\-\-
+MIIDpAIBAAKCAQEA6T/GYJndb1TRH3+NL....
+\-\-\-\-\-END RSA PRIVATE KEY\-\-\-\-\-
+.fi
+.RE
+.SH OPTIONS
+.TP
+\fB\fC\-i, \-\-identify\fR
+Instead of converting the key, output identifying information about it to 
+stderr, including its type, size and fingerprints.
+.TP
+\fB\fC\-p, \-\-private\fR
+Treat the key as a private key instead of a public key (the default). If you
+supply \fB\fCsshpk\-conv\fR with a private key and do not give this option, it will
+extract only the public half of the key from it and work with that.
+.TP
+\fB\fC\-f PATH, \-\-file=PATH\fR
+Input file to take the key from instead of stdin. If a filename is supplied
+as a positional argument, it is equivalent to using this option.
+.TP
+\fB\fC\-o PATH, \-\-out=PATH\fR
+Output file name to use instead of stdout.
+.PP
+\fB\fC\-T FORMAT, \-\-informat=FORMAT\fR
+.TP
+\fB\fC\-t FORMAT, \-\-outformat=FORMAT\fR
+Selects the input and output formats to be used (see FORMATS, below).
+.TP
+\fB\fC\-c TEXT, \-\-comment=TEXT\fR
+Sets the key comment for the output file, if supported.
+.SH FORMATS
+.PP
+Currently supported formats:
+.TP
+\fB\fCpem, pkcs1\fR
+The standard PEM format used by older OpenSSH and most TLS libraries such as
+OpenSSL. The classic \fB\fCid_rsa\fR file is usually in this format. It is an ASN.1
+encoded structure, base64\-encoded and placed between PEM headers.
+.TP
+\fB\fCssh\fR
+The SSH public key text format (the format of an \fB\fCid_rsa.pub\fR file). A single
+line, containing 3 space separated parts: the key type, key body and optional
+key comment.
+.TP
+\fB\fCpkcs8\fR
+A newer PEM format, usually used only for public keys by TLS libraries such
+as OpenSSL. The ASN.1 structure is more generic than that of \fB\fCpkcs1\fR\&.
+.TP
+\fB\fCopenssh\fR
+The new \fB\fCssh\-keygen \-o\fR format from OpenSSH. This can be mistaken for a PEM
+encoding but is actually an OpenSSH internal format.
+.TP
+\fB\fCrfc4253\fR
+The internal binary format of keys when sent over the wire in the SSH
+protocol. This is also the format that the \fB\fCssh\-agent\fR uses in its protocol.
+.SH SEE ALSO
+.PP
+.BR ssh-keygen (1), 
+.BR openssl (1)
+.SH BUGS
+.PP
+Encrypted (password\-protected) keys are not supported.
+.PP
+Report bugs at Github
+\[la]https://github.com/arekinath/node-sshpk/issues\[ra]

package/aur/pkg/nodejs-ani-cli-npm/usr/lib/node_modules/ani-cli-npm/node_modules/sshpk/man/man1/sshpk-sign.1

@@ -0,0 +1,81 @@
+.TH sshpk\-sign 1 "Jan 2016" sshpk "sshpk Commands"
+.SH NAME
+.PP
+sshpk\-sign \- sign data using an SSH key
+.SH SYNOPSYS
+.PP
+\fB\fCsshpk\-sign\fR \-i KEYPATH [OPTION...]
+.SH DESCRIPTION
+.PP
+Takes in arbitrary bytes, and signs them using an SSH private key. The key can
+be of any type or format supported by the \fB\fCsshpk\fR library, including the
+standard OpenSSH formats, as well as PEM PKCS#1 and PKCS#8.
+.PP
+The signature is printed out in Base64 encoding, unless the \fB\fC\-\-binary\fR or \fB\fC\-b\fR
+option is given.
+.SH EXAMPLES
+.PP
+Signing with default settings:
+.PP
+.RS
+.nf
+$ printf 'foo' | sshpk\-sign \-i ~/.ssh/id_ecdsa
+MEUCIAMdLS/vXrrtWFepwe...
+.fi
+.RE
+.PP
+Signing in SSH (RFC 4253) format (rather than the default ASN.1):
+.PP
+.RS
+.nf
+$ printf 'foo' | sshpk\-sign \-i ~/.ssh/id_ecdsa \-t ssh
+AAAAFGVjZHNhLXNoYTIt...
+.fi
+.RE
+.PP
+Saving the binary signature to a file:
+.PP
+.RS
+.nf
+$ printf 'foo' | sshpk\-sign \-i ~/.ssh/id_ecdsa \\
+                            \-o signature.bin \-b
+$ cat signature.bin | base64
+MEUCIAMdLS/vXrrtWFepwe...
+.fi
+.RE
+.SH OPTIONS
+.TP
+\fB\fC\-v, \-\-verbose\fR
+Print extra information about the key and signature to stderr when signing.
+.TP
+\fB\fC\-b, \-\-binary\fR
+Don't base64\-encode the signature before outputting it.
+.TP
+\fB\fC\-i KEY, \-\-identity=KEY\fR
+Select the key to be used for signing. \fB\fCKEY\fR must be a relative or absolute
+filesystem path to the key file. Any format supported by the \fB\fCsshpk\fR library
+is supported, including OpenSSH formats and standard PEM PKCS.
+.TP
+\fB\fC\-f PATH, \-\-file=PATH\fR
+Input file to sign instead of stdin.
+.TP
+\fB\fC\-o PATH, \-\-out=PATH\fR
+Output file to save signature in instead of stdout.
+.TP
+\fB\fC\-H HASH, \-\-hash=HASH\fR
+Set the hash algorithm to be used for signing. This should be one of \fB\fCsha1\fR,
+\fB\fCsha256\fR or \fB\fCsha512\fR\&. Some key types may place restrictions on which hash
+algorithms may be used (e.g. ED25519 keys can only use SHA\-512).
+.TP
+\fB\fC\-t FORMAT, \-\-format=FORMAT\fR
+Choose the signature format to use, from \fB\fCasn1\fR, \fB\fCssh\fR or \fB\fCraw\fR (only for
+ED25519 signatures). The \fB\fCasn1\fR format is the default, as it is the format
+used with TLS and typically the standard in most non\-SSH libraries (e.g.
+OpenSSL). The \fB\fCssh\fR format is used in the SSH protocol and by the ssh\-agent.
+.SH SEE ALSO
+.PP
+.BR sshpk-verify (1)
+.SH BUGS
+.PP
+Report bugs at Github
+\[la]https://github.com/arekinath/node-sshpk/issues\[ra]

package/aur/pkg/nodejs-ani-cli-npm/usr/lib/node_modules/ani-cli-npm/node_modules/sshpk/man/man1/sshpk-verify.1

@@ -0,0 +1,68 @@
+.TH sshpk\-verify 1 "Jan 2016" sshpk "sshpk Commands"
+.SH NAME
+.PP
+sshpk\-verify \- verify a signature on data using an SSH key
+.SH SYNOPSYS
+.PP
+\fB\fCsshpk\-verify\fR \-i KEYPATH \-s SIGNATURE [OPTION...]
+.SH DESCRIPTION
+.PP
+Takes in arbitrary bytes and a Base64\-encoded signature, and verifies that the
+signature was produced by the private half of the given SSH public key.
+.SH EXAMPLES
+.PP
+.RS
+.nf
+$ printf 'foo' | sshpk\-verify \-i ~/.ssh/id_ecdsa \-s MEUCIQCYp...
+OK
+$ printf 'foo' | sshpk\-verify \-i ~/.ssh/id_ecdsa \-s GARBAGE...
+NOT OK
+.fi
+.RE
+.SH EXIT STATUS
+.TP
+\fB\fC0\fR
+Signature validates and matches the key.
+.TP
+\fB\fC1\fR
+Signature is parseable and the correct length but does not match the key or
+otherwise is invalid.
+.TP
+\fB\fC2\fR
+The signature or key could not be parsed.
+.TP
+\fB\fC3\fR
+Invalid commandline options were supplied.
+.SH OPTIONS
+.TP
+\fB\fC\-v, \-\-verbose\fR
+Print extra information about the key and signature to stderr when verifying.
+.TP
+\fB\fC\-i KEY, \-\-identity=KEY\fR
+Select the key to be used for verification. \fB\fCKEY\fR must be a relative or
+absolute filesystem path to the key file. Any format supported by the \fB\fCsshpk\fR
+library is supported, including OpenSSH formats and standard PEM PKCS.
+.TP
+\fB\fC\-s BASE64, \-\-signature=BASE64\fR
+Supplies the base64\-encoded signature to be verified.
+.TP
+\fB\fC\-f PATH, \-\-file=PATH\fR
+Input file to verify instead of stdin.
+.TP
+\fB\fC\-H HASH, \-\-hash=HASH\fR
+Set the hash algorithm to be used for signing. This should be one of \fB\fCsha1\fR,
+\fB\fCsha256\fR or \fB\fCsha512\fR\&. Some key types may place restrictions on which hash
+algorithms may be used (e.g. ED25519 keys can only use SHA\-512).
+.TP
+\fB\fC\-t FORMAT, \-\-format=FORMAT\fR
+Choose the signature format to use, from \fB\fCasn1\fR, \fB\fCssh\fR or \fB\fCraw\fR (only for
+ED25519 signatures). The \fB\fCasn1\fR format is the default, as it is the format
+used with TLS and typically the standard in most non\-SSH libraries (e.g.
+OpenSSL). The \fB\fCssh\fR format is used in the SSH protocol and by the ssh\-agent.
+.SH SEE ALSO
+.PP
+.BR sshpk-sign (1)
+.SH BUGS
+.PP
+Report bugs at Github
+\[la]https://github.com/arekinath/node-sshpk/issues\[ra]