@zohodesk/react-cli 1.1.28 → 1.1.29-exp.1

package/lib/plugins/I18nSplitPlugin/utils/createMetaManifest.js

@@ -0,0 +1,70 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.createMetaManifest = createMetaManifest;
+
+var _webpackSources = require("webpack-sources");
+
+function createMetaManifest(compilation, plugin, skipEmit = false) {
+  const {
+    detailedManifest
+  } = plugin; // Use the plugin's filename property
+
+  const i18nMetaManifestFileName = plugin.i18nMetaManifestFileName;
+
+  if (!skipEmit) {
+    console.log('Generating meta manifest:', i18nMetaManifestFileName);
+  } // Initialize a streamlined meta manifest structure
+
+
+  const finalMetaManifest = {
+    modules: {}
+  }; // Process each chunk's keys into the modules section
+
+  for (const [chunkId, chunkData] of Object.entries(detailedManifest)) {
+    const chunkName = chunkData.chunkName || `chunk_${chunkId}`;
+    const keysArray = Array.isArray(chunkData.keysUsed) ? chunkData.keysUsed : Array.from(chunkData.keysUsed); // Only add modules that have i18n keys
+
+    if (keysArray.length > 0) {
+      finalMetaManifest.modules[chunkName] = {
+        id: chunkId,
+        keys: keysArray
+      };
+    }
+  } // Only include new or moved keys in the masterKeys section
+
+
+  if (plugin.extraKeys && plugin.movedKeys) {
+    // Combine extra (new) and moved keys
+    const masterKeysSet = new Set([...(Array.from(plugin.extraKeys) || []), ...(Array.from(plugin.movedKeys) || [])]); // Convert back to array for the manifest
+
+    finalMetaManifest.masterKeys = Array.from(masterKeysSet); // Log the keys being added to master chunk
+
+    if (finalMetaManifest.masterKeys.length > 0) {
+      console.log(`Extra and moved keys to add to master chunk: ${finalMetaManifest.masterKeys.length}`); // Print each key for clarity
+
+      finalMetaManifest.masterKeys.forEach(key => {
+        console.log(`  - ${key}`);
+      });
+    }
+  } // Store the generated manifest for potential further use
+
+
+  plugin.generatedMetaManifest = finalMetaManifest; // Only emit if not skipped
+
+  if (!skipEmit) {
+    const metaManifestSource = new _webpackSources.RawSource(JSON.stringify(finalMetaManifest, null, 2));
+
+    if (!compilation.emitAsset) {
+      compilation.assets[i18nMetaManifestFileName] = metaManifestSource;
+    } else {
+      compilation.emitAsset(i18nMetaManifestFileName, metaManifestSource, {
+        desc: 'Streamlined chunk-module-i18nKeys mapping with optimized master keys'
+      });
+    }
+  }
+
+  return finalMetaManifest;
+}

package/lib/plugins/I18nSplitPlugin/utils/createRegularManifest.js

@@ -0,0 +1,59 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.createRegularManifest = createRegularManifest;
+
+var _webpackSources = require("webpack-sources");
+
+function createRegularManifest(compilation, plugin) {
+  const {
+    regularManifest,
+    // e.g., { chunkId: { localeA: pathA, localeB: pathB, ... }, ... }
+    locales,
+    // e.g., ['en_US', 'fr_FR', ...]
+    i18nManifestFileName,
+    // e.g., 'i18n-manifest.json'
+    deskI18nManifestFileName = 'desk-i18n-manifest.js'
+  } = plugin; // 1. Create the final manifest structure.
+
+  const finalManifest = {
+    locales: [...locales],
+    chunks: {},
+    basePath: 'i18n-chunk/[locale]/'
+  };
+
+  for (const chunkId of Object.keys(regularManifest)) {
+    const localePaths = regularManifest[chunkId];
+    if (!localePaths) continue;
+    const entries = Object.entries(localePaths);
+    if (!entries.length) continue;
+    const [someLocale, fullPath] = entries[0];
+    if (!fullPath) continue; // Remove the first two segments from the full path to get the basename.
+
+    const pathSegments = fullPath.split('/');
+    const basename = pathSegments.slice(2).join('/');
+    finalManifest.chunks[chunkId] = basename;
+  } // Convert the manifest object to a prettified JSON string.
+
+
+  const manifestStr = JSON.stringify(finalManifest, null, 2); // 2. Create the JSON asset (plain JSON, without any wrapping).
+
+  const jsonManifestSource = new _webpackSources.RawSource(manifestStr); // 3. Create the manifest code for window.desk_i18n_manifest.
+
+  const deskI18nManifestCode = `
+    (function() {
+      window.desk_i18n_manifest = ${manifestStr};
+    })();
+  `;
+  const deskI18nManifestSource = new _webpackSources.RawSource(deskI18nManifestCode); // 4. Emit the plain JSON manifest asset.
+
+  compilation.emitAsset(i18nManifestFileName, jsonManifestSource, {
+    desc: 'Emitted plain JSON i18n manifest'
+  }); // 5. Emit the desk i18n manifest asset.
+
+  compilation.emitAsset(deskI18nManifestFileName, deskI18nManifestSource, {
+    desc: 'Emitted manifest attached to window.desk_i18n_manifest'
+  });
+}

package/lib/schemas/index.js

@@ -232,7 +232,6 @@ var _default = {
       none: '(hover: none)'
     },
     disableES5Transpile: false,
-    disableES5Import: false,
     isReactMig: false,
     hasWidget: false,
     hasEFC: {

package/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@zohodesk/react-cli",
-  "version": "1.1.28",
+  "version": "1.1.29-exp.1",
   "description": "A CLI tool for build modern web application and libraries",
   "scripts": {
     "init": "node ./lib/utils/init.js",

package/packages/client_build_tool/lib/allCommandsConfigs.js

@@ -1,25 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.default = void 0;
-
-var _fs = require("fs");
-
-var _path = require("path");
-
-/* eslint-disable global-require */
-const allConfigs = [];
-(0, _fs.readdirSync)((0, _path.join)(__dirname, 'commands')).forEach(folderName => {
-  const modulePath = (0, _path.join)(__dirname, `./commands/${folderName}/config.js`);
-
-  if ((0, _fs.existsSync)(modulePath)) {
-    // eslint-disable-next-line import/no-dynamic-require
-    const config = require(modulePath).default;
-
-    allConfigs.push(config);
-  }
-});
-var _default = allConfigs;
-exports.default = _default;

package/packages/client_build_tool/lib/commands/build/commandExecutor.js

@@ -1,17 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.commandExecutor = commandExecutor;
-
-var _logger = require("../../logger");
-
-var _webpackBuild = _interopRequireDefault(require("../../shared/bundler/webpack/webpackBuild"));
-
-function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
-
-function commandExecutor(options) {
-  (0, _logger.messageLogger)('Build is running.....');
-  (0, _webpackBuild.default)(options);
-}

package/packages/client_build_tool/lib/commands/build/config.js

@@ -1,12 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.default = void 0;
-var _default = {
-  name: 'build',
-  alias: ['devbuild'],
-  dirname: __dirname
-};
-exports.default = _default;

package/packages/client_build_tool/lib/commands/build/optionsProcessor.js

@@ -1,35 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.optionsProcessor = optionsProcessor;
-
-var _decidePublicPath = require("../../shared/bundler/webpack/common/decidePublicPath");
-
-var _modeUtils = require("../../shared/bundler/webpack/common/modeUtils");
-
-var _constants = require("../../shared/constants");
-
-function optionsProcessor(options) {
-  const {
-    context,
-    mode,
-    noPublicPath
-  } = options;
-  const {
-    isCdnEnabled
-  } = options.cdnMapping;
-  const serverExtras = (0, _decidePublicPath.modifiedServerOptions)(options);
-  const publicPath = noPublicPath ? undefined : (0, _decidePublicPath.decidePublicPath)(serverExtras);
-  const contextFolderPath = (0, _constants.joinWithAppPath)(context);
-  const defaultAppliedOptions = { ...options,
-    serverExtras,
-    // eslint-disable-next-line no-nested-ternary
-    mode: mode === null ? 'prod' : mode === 'dev' ? 'dev' : 'prod',
-    publicPath: (0, _modeUtils.isDevelopmentMode)(mode) || isCdnEnabled ? undefined : publicPath,
-    contextFolderPath,
-    httpsOptions: serverExtras.httpsOptions
-  };
-  return defaultAppliedOptions;
-}

package/packages/client_build_tool/lib/commands/build/preProcessor.js

@@ -1,12 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.preProcessor = preProcessor;
-
-var _runPreProcess = require("../../shared/pre_process/runPreProcess");
-
-function preProcessor(options) {
-  (0, _runPreProcess.runPreProcess)(options, 'node');
-}

package/packages/client_build_tool/lib/commands/buildEs/commandExecutor.js

@@ -1,33 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.commandExecutor = commandExecutor;
-
-var _constants = require("../../shared/constants");
-
-var _watchRun = require("../../shared/fileUtils/watchRun");
-
-function commandExecutor(options) {
-  const {
-    extraArgs = []
-  } = options;
-  const index = extraArgs.indexOf('-w');
-  const canWatch = index !== -1;
-
-  if (canWatch) {
-    extraArgs.splice(index, 1);
-  }
-
-  let [src, target] = extraArgs;
-  src = (0, _constants.joinWithAppPath)(src || 'src');
-  target = (0, _constants.joinWithAppPath)(target || 'es');
-  (0, _watchRun.watchRun)({
-    options,
-    src,
-    target,
-    canWatch,
-    mode: 'es'
-  });
-}

package/packages/client_build_tool/lib/commands/buildEs/config.js

@@ -1,12 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.default = void 0;
-var _default = {
-  name: 'buildEs',
-  alias: ['build_es', 'build:es'],
-  dirname: __dirname
-};
-exports.default = _default;

package/packages/client_build_tool/lib/commands/buildEs/preProcessor.js

@@ -1,17 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.preProcessor = preProcessor;
-
-var _runPreProcess = require("../../shared/pre_process/runPreProcess");
-
-function preProcessor(options) {
-  const {
-    extraArgs = []
-  } = options;
-  const index = extraArgs.indexOf('-w');
-  const canWatch = index !== -1;
-  (0, _runPreProcess.runPreProcess)(options, canWatch ? 'nodemon' : 'node');
-}

package/packages/client_build_tool/lib/commands/buildLib/commandExecutor.js

@@ -1,33 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.commandExecutor = commandExecutor;
-
-var _constants = require("../../shared/constants");
-
-var _watchRun = require("../../shared/fileUtils/watchRun");
-
-function commandExecutor(options) {
-  const {
-    extraArgs = []
-  } = options;
-  const index = extraArgs.indexOf('-w');
-  const canWatch = index !== -1;
-
-  if (canWatch) {
-    extraArgs.splice(index, 1);
-  }
-
-  let [src, target] = extraArgs;
-  src = (0, _constants.joinWithAppPath)(src || 'src');
-  target = (0, _constants.joinWithAppPath)(target || 'lib');
-  (0, _watchRun.watchRun)({
-    options,
-    src,
-    target,
-    canWatch,
-    mode: 'lib'
-  });
-}

package/packages/client_build_tool/lib/commands/buildLib/config.js

@@ -1,12 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.default = void 0;
-var _default = {
-  name: 'buildLib',
-  alias: ['build:lib', 'build_lib'],
-  dirname: __dirname
-};
-exports.default = _default;

package/packages/client_build_tool/lib/commands/buildLib/preProcessor.js

@@ -1,17 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.preProcessor = preProcessor;
-
-var _runPreProcess = require("../../shared/pre_process/runPreProcess");
-
-function preProcessor(options) {
-  const {
-    extraArgs = []
-  } = options;
-  const index = extraArgs.indexOf('-w');
-  const canWatch = index !== -1;
-  (0, _runPreProcess.runPreProcess)(options, canWatch ? 'nodemon' : 'node');
-}

package/packages/client_build_tool/lib/commands/mockserver/commandExecutor.js

@@ -1,43 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.commandExecutor = commandExecutor;
-
-var _path = require("path");
-
-var _logger = require("../../logger");
-
-var _spawnSyncIO = require("../../shared/commands-utils/spawnSyncIO");
-
-var _constants = require("../../shared/constants");
-
-function commandExecutor(options) {
-  const {
-    extraArgs
-  } = options;
-  const {
-    enable,
-    separateSeverPort,
-    mockEntryFile,
-    disableNodemon
-  } = options.mockServer;
-
-  if (!enable) {
-    (0, _logger.messageLogger)('mock server not enabled');
-    return;
-  }
-
-  if (!separateSeverPort) {
-    (0, _logger.messageLogger)('mock server not port enabled');
-    return;
-  }
-
-  const absolutePath = (0, _path.join)(__dirname, '..', '..', 'shared', 'server', 'mockServer.js');
-  const mockFile = (0, _constants.joinWithAppPath)(mockEntryFile);
-  (0, _logger.verboseLogger)('Mock server is running path', absolutePath);
-  (0, _logger.verboseLogger)('App mock server is path', mockFile);
-  (0, _logger.messageLogger)('mock server is running.....');
-  (0, _spawnSyncIO.spawnSyncIO)(disableNodemon ? 'node' : 'nodemon', [absolutePath, '--watch', (0, _path.dirname)(mockFile), ...extraArgs]); // webpackBuild(options);
-}

package/packages/client_build_tool/lib/commands/mockserver/config.js

@@ -1,12 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.default = void 0;
-var _default = {
-  name: 'mockServer',
-  alias: ['mockserver', 'mock_server', 'mock-server', 'mock:server'],
-  dirname: __dirname
-};
-exports.default = _default;

package/packages/client_build_tool/lib/commands/pre_process/commandExecutor.js

@@ -1,18 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.commandExecutor = commandExecutor;
-
-var _runPreProcess = require("../../shared/pre_process/runPreProcess");
-
-function commandExecutor(options) {
-  const {
-    extraArgs = []
-  } = options;
-  const index = extraArgs.indexOf('-w');
-  const canWatch = index !== -1;
-  const result = (0, _runPreProcess.runPreProcess)(options, canWatch ? 'nodemon' : 'node');
-  !canWatch && process.exit(result ? result.status : 0);
-}

package/packages/client_build_tool/lib/commands/pre_process/config.js

@@ -1,12 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.default = void 0;
-var _default = {
-  name: 'pre_process',
-  alias: ['preprocess', 'pre:process', 'preProcess'],
-  dirname: __dirname
-};
-exports.default = _default;

package/packages/client_build_tool/lib/commands/start/commandExecutor.js

@@ -1,12 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.commandExecutor = commandExecutor;
-
-var _serverBywebpackDevMiddleware = require("../../shared/server/serverBywebpackDevMiddleware");
-
-function commandExecutor(options) {
-  (0, _serverBywebpackDevMiddleware.run)(options);
-}

package/packages/client_build_tool/lib/commands/start/config.js

@@ -1,12 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.default = void 0;
-var _default = {
-  name: 'start',
-  alias: ['dstart', 'devSeverStart'],
-  dirname: __dirname
-};
-exports.default = _default;

package/packages/client_build_tool/lib/commands/start/optionsProcessor.js

@@ -1,30 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.optionsProcessor = optionsProcessor;
-
-var _decidePublicPath = require("../../shared/bundler/webpack/common/decidePublicPath");
-
-var _constants = require("../../shared/constants");
-
-function optionsProcessor(options) {
-  const {
-    context,
-    mode,
-    noPublicPath
-  } = options;
-  const serverExtras = (0, _decidePublicPath.modifiedServerOptions)(options);
-  const publicPath = noPublicPath ? undefined : (0, _decidePublicPath.decidePublicPath)(serverExtras);
-  const contextFolderPath = (0, _constants.joinWithAppPath)(context);
-  const defaultAppliedOptions = { ...options,
-    // eslint-disable-next-line no-nested-ternary
-    mode: options.mode === null ? 'dev' : mode === 'prod' ? 'prod' : 'dev',
-    serverExtras,
-    publicPath,
-    contextFolderPath,
-    httpsOptions: serverExtras.httpsOptions
-  };
-  return defaultAppliedOptions;
-}

package/packages/client_build_tool/lib/commands/start/preProcessor.js

@@ -1,12 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.preProcessor = preProcessor;
-
-var _runPreProcess = require("../../shared/pre_process/runPreProcess");
-
-function preProcessor(options) {
-  (0, _runPreProcess.runPreProcess)(options, 'nodemon');
-}

package/packages/client_build_tool/lib/commands/template/commandExecutor.js

@@ -1,28 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.commandExecutor = commandExecutor;
-
-var _constants = require("../../shared/constants");
-
-var _logger = require("../../logger");
-
-var _spawnSyncIO = require("../../shared/commands-utils/spawnSyncIO");
-
-const supportedTemplates = ['app', 'library'];
-
-function commandExecutor(options) {
-  const {
-    extraArgs = []
-  } = options;
-  const [templateName, ...args] = extraArgs;
-
-  if (!supportedTemplates.includes(templateName)) {
-    (0, _logger.messageLogger)(`template not supported "${templateName}" only these \n${supportedTemplates.join('\n ')} are supported`);
-    return;
-  }
-
-  (0, _spawnSyncIO.spawnSyncIO)('cp', ['-r', (0, _constants.getTemplatePath)(templateName)].concat(args));
-}

package/packages/client_build_tool/lib/commands/template/config.js

@@ -1,12 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.default = void 0;
-var _default = {
-  name: 'template',
-  alias: ['template', 'templates'],
-  dirname: __dirname
-};
-exports.default = _default;

package/packages/client_build_tool/lib/commands/version/commandExecutor.js

@@ -1,14 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.commandExecutor = commandExecutor;
-
-var _logger = require("../../logger");
-
-var _versionPrint = require("../../shared/utils/versionPrint");
-
-function commandExecutor() {
-  (0, _versionPrint.versionPrint)(_logger.messageLogger);
-}

package/packages/client_build_tool/lib/commands/version/config.js

@@ -1,12 +0,0 @@
-"use strict";
-
-Object.defineProperty(exports, "__esModule", {
-  value: true
-});
-exports.default = void 0;
-var _default = {
-  name: 'version',
-  alias: ['v', '-v', '--v', '-version', '--version'],
-  dirname: __dirname
-};
-exports.default = _default;