@warp-ds/elements 2.2.0-next.13 → 2.2.0-next.15

This diff represents the content of publicly available package versions that have been released to one of the supported registries. The information contained in this diff is provided for informational purposes only and reflects changes between package versions as they appear in their respective public registries.
Files changed (59) hide show
  1. package/dist/custom-elements.json +2079 -909
  2. package/dist/packages/attention/index.js +11 -11
  3. package/dist/packages/attention/index.js.map +4 -4
  4. package/dist/packages/breadcrumbs/index.js.map +1 -1
  5. package/dist/packages/combobox/combobox.stories.d.ts +14 -0
  6. package/dist/packages/combobox/combobox.stories.js +95 -0
  7. package/dist/packages/combobox/index.d.ts +100 -0
  8. package/dist/packages/combobox/index.js +2492 -0
  9. package/dist/packages/combobox/index.js.map +7 -0
  10. package/dist/packages/combobox/locales/da/messages.d.mts +1 -0
  11. package/dist/packages/combobox/locales/da/messages.mjs +1 -0
  12. package/dist/packages/combobox/locales/en/messages.d.mts +1 -0
  13. package/dist/packages/combobox/locales/en/messages.mjs +1 -0
  14. package/dist/packages/combobox/locales/fi/messages.d.mts +1 -0
  15. package/dist/packages/combobox/locales/fi/messages.mjs +1 -0
  16. package/dist/packages/combobox/locales/nb/messages.d.mts +1 -0
  17. package/dist/packages/combobox/locales/nb/messages.mjs +1 -0
  18. package/dist/packages/combobox/locales/sv/messages.d.mts +1 -0
  19. package/dist/packages/combobox/locales/sv/messages.mjs +1 -0
  20. package/dist/packages/combobox/styles.d.ts +1 -0
  21. package/dist/packages/combobox/styles.js +2 -0
  22. package/dist/packages/slider/Slider.d.ts +2 -0
  23. package/dist/packages/slider/Slider.js +8 -0
  24. package/dist/packages/slider/SliderThumb.d.ts +2 -0
  25. package/dist/packages/slider/SliderThumb.js +8 -0
  26. package/dist/packages/slider/index.d.ts +2 -0
  27. package/dist/packages/slider/index.js +2791 -0
  28. package/dist/packages/slider/index.js.map +7 -0
  29. package/dist/packages/slider/oddbird-css-anchor-positioning.d.ts +2 -0
  30. package/dist/packages/slider/oddbird-css-anchor-positioning.js +3 -0
  31. package/dist/packages/slider/slider-thumb.d.ts +62 -0
  32. package/dist/packages/slider/slider-thumb.js +2663 -0
  33. package/dist/packages/slider/slider-thumb.js.map +7 -0
  34. package/dist/packages/slider/slider.d.ts +51 -0
  35. package/dist/packages/slider/slider.js +2569 -0
  36. package/dist/packages/slider/slider.js.map +7 -0
  37. package/dist/packages/slider/slider.stories.d.ts +17 -0
  38. package/dist/packages/slider/slider.stories.js +203 -0
  39. package/dist/packages/slider/slider.test.d.ts +4 -0
  40. package/dist/packages/slider/slider.test.js +83 -0
  41. package/dist/packages/slider/styles/w-slider-thumb.styles.d.ts +1 -0
  42. package/dist/packages/slider/styles/w-slider-thumb.styles.js +132 -0
  43. package/dist/packages/slider/styles/w-slider.styles.d.ts +1 -0
  44. package/dist/packages/slider/styles/w-slider.styles.js +118 -0
  45. package/dist/packages/slider/styles.d.ts +1 -0
  46. package/dist/packages/slider/styles.js +2 -0
  47. package/dist/packages/textfield/index.d.ts +12 -1
  48. package/dist/packages/textfield/index.js +77 -28
  49. package/dist/packages/textfield/index.js.map +4 -4
  50. package/dist/packages/textfield/styles/w-textfield.styles.d.ts +1 -0
  51. package/dist/packages/textfield/styles/w-textfield.styles.js +46 -0
  52. package/dist/packages/textfield/styles.js +1 -1
  53. package/dist/packages/textfield/textfield.stories.d.ts +1 -0
  54. package/dist/packages/textfield/textfield.stories.js +19 -0
  55. package/dist/packages/textfield/textfield.test.d.ts +1 -0
  56. package/dist/packages/textfield/textfield.test.js +62 -3
  57. package/dist/vscode.html-custom-data.json +148 -24
  58. package/dist/web-types.json +387 -51
  59. package/package.json +5 -3
@@ -1,6 +1,6 @@
1
1
  {
2
2
  "version": 3,
3
- "sources": ["../../../node_modules/.pnpm/unraw@3.0.0/node_modules/unraw/dist/errors.js", "../../../node_modules/.pnpm/unraw@3.0.0/node_modules/unraw/dist/index.js", "../../../packages/breadcrumbs/index.ts", "../../../node_modules/.pnpm/@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-macros@3.1.0_ty_33a2537ce57a59324989ce8020998d0e/node_modules/@lingui/core/dist/index.mjs", "../../../node_modules/.pnpm/@warp-ds+core@1.1.8_@floating-ui+dom@1.6.13/node_modules/@warp-ds/core/dist/breadcrumbs/index.js", "../../../packages/i18n.ts", "../../../packages/styles.ts", "../../../packages/breadcrumbs/locales/da/messages.mjs", "../../../packages/breadcrumbs/locales/en/messages.mjs", "../../../packages/breadcrumbs/locales/fi/messages.mjs", "../../../packages/breadcrumbs/locales/nb/messages.mjs", "../../../packages/breadcrumbs/locales/sv/messages.mjs", "../../../packages/breadcrumbs/styles.ts"],
3
+ "sources": ["../../../node_modules/.pnpm/unraw@3.0.0/node_modules/unraw/dist/errors.js", "../../../node_modules/.pnpm/unraw@3.0.0/node_modules/unraw/dist/index.js", "../../../packages/breadcrumbs/index.ts", "../../../node_modules/.pnpm/@lingui+core@5.2.0_@lingui+babel-plugin-lingui-macro@5.2.0_babel-plugin-macros@3.1.0_ty_33a2537ce57a59324989ce8020998d0e/node_modules/@lingui/core/dist/index.mjs", "../../../node_modules/.pnpm/@warp-ds+core@1.1.8_@floating-ui+dom@1.7.4/node_modules/@warp-ds/core/dist/breadcrumbs/index.js", "../../../packages/i18n.ts", "../../../packages/styles.ts", "../../../packages/breadcrumbs/locales/da/messages.mjs", "../../../packages/breadcrumbs/locales/en/messages.mjs", "../../../packages/breadcrumbs/locales/fi/messages.mjs", "../../../packages/breadcrumbs/locales/nb/messages.mjs", "../../../packages/breadcrumbs/locales/sv/messages.mjs", "../../../packages/breadcrumbs/styles.ts"],
4
4
  "sourcesContent": ["\"use strict\";\n// NOTE: don't construct errors here or they'll have the wrong stack trace.\n// NOTE: don't make custom error class; the JS engines use `SyntaxError`\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.errorMessages = exports.ErrorType = void 0;\n/**\n * Keys for possible error messages used by `unraw`.\n * Note: These do _not_ map to actual error object types. All errors thrown\n * are `SyntaxError`.\n */\n// Don't use const enum or JS users won't be able to access the enum values\nvar ErrorType;\n(function (ErrorType) {\n /**\n * Thrown when a badly formed Unicode escape sequence is found. Possible\n * reasons include the code being too short (`\"\\u25\"`) or having invalid\n * characters (`\"\\u2$A5\"`).\n */\n ErrorType[\"MalformedUnicode\"] = \"MALFORMED_UNICODE\";\n /**\n * Thrown when a badly formed hexadecimal escape sequence is found. Possible\n * reasons include the code being too short (`\"\\x2\"`) or having invalid\n * characters (`\"\\x2$\"`).\n */\n ErrorType[\"MalformedHexadecimal\"] = \"MALFORMED_HEXADECIMAL\";\n /**\n * Thrown when a Unicode code point escape sequence has too high of a code\n * point. The maximum code point allowed is `\\u{10FFFF}`, so `\\u{110000}` and\n * higher will throw this error.\n */\n ErrorType[\"CodePointLimit\"] = \"CODE_POINT_LIMIT\";\n /**\n * Thrown when an octal escape sequences is encountered and `allowOctals` is\n * `false`. For example, `unraw(\"\\234\", false)`.\n */\n ErrorType[\"OctalDeprecation\"] = \"OCTAL_DEPRECATION\";\n /**\n * Thrown only when a single backslash is found at the end of a string. For\n * example, `\"\\\\\"` or `\"test\\\\x24\\\\\"`.\n */\n ErrorType[\"EndOfString\"] = \"END_OF_STRING\";\n})(ErrorType = exports.ErrorType || (exports.ErrorType = {}));\n/** Map of error message names to the full text of the message. */\nexports.errorMessages = new Map([\n [ErrorType.MalformedUnicode, \"malformed Unicode character escape sequence\"],\n [\n ErrorType.MalformedHexadecimal,\n \"malformed hexadecimal character escape sequence\"\n ],\n [\n ErrorType.CodePointLimit,\n \"Unicode codepoint must not be greater than 0x10FFFF in escape sequence\"\n ],\n [\n ErrorType.OctalDeprecation,\n '\"0\"-prefixed octal literals and octal escape sequences are deprecated; ' +\n 'for octal literals use the \"0o\" prefix instead'\n ],\n [ErrorType.EndOfString, \"malformed escape sequence at end of string\"]\n]);\n", "\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.unraw = exports.errorMessages = exports.ErrorType = void 0;\nconst errors_1 = require(\"./errors\");\nObject.defineProperty(exports, \"ErrorType\", { enumerable: true, get: function () { return errors_1.ErrorType; } });\nObject.defineProperty(exports, \"errorMessages\", { enumerable: true, get: function () { return errors_1.errorMessages; } });\n/**\n * Parse a string as a base-16 number. This is more strict than `parseInt` as it\n * will not allow any other characters, including (for example) \"+\", \"-\", and\n * \".\".\n * @param hex A string containing a hexadecimal number.\n * @returns The parsed integer, or `NaN` if the string is not a valid hex\n * number.\n */\nfunction parseHexToInt(hex) {\n const isOnlyHexChars = !hex.match(/[^a-f0-9]/i);\n return isOnlyHexChars ? parseInt(hex, 16) : NaN;\n}\n/**\n * Check the validity and length of a hexadecimal code and optionally enforces\n * a specific number of hex digits.\n * @param hex The string to validate and parse.\n * @param errorName The name of the error message to throw a `SyntaxError` with\n * if `hex` is invalid. This is used to index `errorMessages`.\n * @param enforcedLength If provided, will throw an error if `hex` is not\n * exactly this many characters.\n * @returns The parsed hex number as a normal number.\n * @throws {SyntaxError} If the code is not valid.\n */\nfunction validateAndParseHex(hex, errorName, enforcedLength) {\n const parsedHex = parseHexToInt(hex);\n if (Number.isNaN(parsedHex) ||\n (enforcedLength !== undefined && enforcedLength !== hex.length)) {\n throw new SyntaxError(errors_1.errorMessages.get(errorName));\n }\n return parsedHex;\n}\n/**\n * Parse a two-digit hexadecimal character escape code.\n * @param code The two-digit hexadecimal number that represents the character to\n * output.\n * @returns The single character represented by the code.\n * @throws {SyntaxError} If the code is not valid hex or is not the right\n * length.\n */\nfunction parseHexadecimalCode(code) {\n const parsedCode = validateAndParseHex(code, errors_1.ErrorType.MalformedHexadecimal, 2);\n return String.fromCharCode(parsedCode);\n}\n/**\n * Parse a four-digit Unicode character escape code.\n * @param code The four-digit unicode number that represents the character to\n * output.\n * @param surrogateCode Optional four-digit unicode surrogate that represents\n * the other half of the character to output.\n * @returns The single character represented by the code.\n * @throws {SyntaxError} If the codes are not valid hex or are not the right\n * length.\n */\nfunction parseUnicodeCode(code, surrogateCode) {\n const parsedCode = validateAndParseHex(code, errors_1.ErrorType.MalformedUnicode, 4);\n if (surrogateCode !== undefined) {\n const parsedSurrogateCode = validateAndParseHex(surrogateCode, errors_1.ErrorType.MalformedUnicode, 4);\n return String.fromCharCode(parsedCode, parsedSurrogateCode);\n }\n return String.fromCharCode(parsedCode);\n}\n/**\n * Test if the text is surrounded by curly braces (`{}`).\n * @param text Text to check.\n * @returns `true` if the text is in the form `{*}`.\n */\nfunction isCurlyBraced(text) {\n return text.charAt(0) === \"{\" && text.charAt(text.length - 1) === \"}\";\n}\n/**\n * Parse a Unicode code point character escape code.\n * @param codePoint A unicode escape code point, including the surrounding curly\n * braces.\n * @returns The single character represented by the code.\n * @throws {SyntaxError} If the code is not valid hex or does not have the\n * surrounding curly braces.\n */\nfunction parseUnicodeCodePointCode(codePoint) {\n if (!isCurlyBraced(codePoint)) {\n throw new SyntaxError(errors_1.errorMessages.get(errors_1.ErrorType.MalformedUnicode));\n }\n const withoutBraces = codePoint.slice(1, -1);\n const parsedCode = validateAndParseHex(withoutBraces, errors_1.ErrorType.MalformedUnicode);\n try {\n return String.fromCodePoint(parsedCode);\n }\n catch (err) {\n throw err instanceof RangeError\n ? new SyntaxError(errors_1.errorMessages.get(errors_1.ErrorType.CodePointLimit))\n : err;\n }\n}\n// Have to give overload that takes boolean for when compiler doesn't know if\n// true or false\nfunction parseOctalCode(code, error = false) {\n if (error) {\n throw new SyntaxError(errors_1.errorMessages.get(errors_1.ErrorType.OctalDeprecation));\n }\n // The original regex only allows digits so we don't need to have a strict\n // octal parser like hexToInt. Length is not enforced for octals.\n const parsedCode = parseInt(code, 8);\n return String.fromCharCode(parsedCode);\n}\n/**\n * Map of unescaped letters to their corresponding special JS escape characters.\n * Intentionally does not include characters that map to themselves like \"\\'\".\n */\nconst singleCharacterEscapes = new Map([\n [\"b\", \"\\b\"],\n [\"f\", \"\\f\"],\n [\"n\", \"\\n\"],\n [\"r\", \"\\r\"],\n [\"t\", \"\\t\"],\n [\"v\", \"\\v\"],\n [\"0\", \"\\0\"]\n]);\n/**\n * Parse a single character escape sequence and return the matching character.\n * If none is matched, defaults to `code`.\n * @param code A single character code.\n */\nfunction parseSingleCharacterCode(code) {\n return singleCharacterEscapes.get(code) || code;\n}\n/**\n * Matches every escape sequence possible, including invalid ones.\n *\n * All capture groups (described below) are unique (only one will match), except\n * for 4, which can only potentially match if 3 does.\n *\n * **Capture Groups:**\n * 0. A single backslash\n * 1. Hexadecimal code\n * 2. Unicode code point code with surrounding curly braces\n * 3. Unicode escape code with surrogate\n * 4. Surrogate code\n * 5. Unicode escape code without surrogate\n * 6. Octal code _NOTE: includes \"0\"._\n * 7. A single character (will never be \\, x, u, or 0-3)\n */\nconst escapeMatch = /\\\\(?:(\\\\)|x([\\s\\S]{0,2})|u(\\{[^}]*\\}?)|u([\\s\\S]{4})\\\\u([^{][\\s\\S]{0,3})|u([\\s\\S]{0,4})|([0-3]?[0-7]{1,2})|([\\s\\S])|$)/g;\n/**\n * Replace raw escape character strings with their escape characters.\n * @param raw A string where escape characters are represented as raw string\n * values like `\\'` rather than `'`.\n * @param allowOctals If `true`, will process the now-deprecated octal escape\n * sequences (ie, `\\111`).\n * @returns The processed string, with escape characters replaced by their\n * respective actual Unicode characters.\n */\nfunction unraw(raw, allowOctals = false) {\n return raw.replace(escapeMatch, function (_, backslash, hex, codePoint, unicodeWithSurrogate, surrogate, unicode, octal, singleCharacter) {\n // Compare groups to undefined because empty strings mean different errors\n // Otherwise, `\\u` would fail the same as `\\` which is wrong.\n if (backslash !== undefined) {\n return \"\\\\\";\n }\n if (hex !== undefined) {\n return parseHexadecimalCode(hex);\n }\n if (codePoint !== undefined) {\n return parseUnicodeCodePointCode(codePoint);\n }\n if (unicodeWithSurrogate !== undefined) {\n return parseUnicodeCode(unicodeWithSurrogate, surrogate);\n }\n if (unicode !== undefined) {\n return parseUnicodeCode(unicode);\n }\n if (octal === \"0\") {\n return \"\\0\";\n }\n if (octal !== undefined) {\n return parseOctalCode(octal, !allowOctals);\n }\n if (singleCharacter !== undefined) {\n return parseSingleCharacterCode(singleCharacter);\n }\n throw new SyntaxError(errors_1.errorMessages.get(errors_1.ErrorType.EndOfString));\n });\n}\nexports.unraw = unraw;\nexports.default = unraw;\n", "// @warp-css;\n\nimport { html, LitElement, TemplateResult } from 'lit';\n\nimport { i18n } from '@lingui/core';\nimport { interleave } from '@warp-ds/core/breadcrumbs';\nimport { property } from 'lit/decorators.js';\n\nimport { activateI18n } from '../i18n';\nimport { reset } from '../styles.js';\n\nimport { messages as daMessages } from './locales/da/messages.mjs';\nimport { messages as enMessages } from './locales/en/messages.mjs';\nimport { messages as fiMessages } from './locales/fi/messages.mjs';\nimport { messages as nbMessages } from './locales/nb/messages.mjs';\nimport { messages as svMessages } from './locales/sv/messages.mjs';\nimport { styles } from './styles.js';\n\nexport const ccBreadcrumbs = {\n wrapper: 'flex space-x-8',\n text: 's-text',\n link: 's-text-link',\n separator: 'select-none s-icon',\n a11y: 'sr-only',\n};\n\nconst separator = html`<span class=${ccBreadcrumbs.separator}>/</span>`;\n\n/**\n * Breadcrumbs show the navigation structure for the current location.\n *\n * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/navigation-breadcrumbs--docs)\n */\nclass WarpBreadcrumbs extends LitElement {\n @property({ attribute: 'aria-label', type: String })\n ariaLabel: string;\n\n static styles = [reset, styles];\n\n constructor() {\n super();\n activateI18n(enMessages, nbMessages, fiMessages, daMessages, svMessages);\n\n this.ariaLabel = i18n._({\n id: 'breadcrumbs.ariaLabel',\n message: 'You are here',\n comment: 'Default screen reader message for the breadcrumb component',\n });\n }\n\n /** @internal */\n _children: Array<Element | TemplateResult>;\n\n connectedCallback() {\n super.connectedCallback();\n // Grab existing children at the point that the component is added to the page\n const flattenedChildren = Array.from(this.children)\n .flat(Infinity)\n .filter((child) => child);\n const styledChildren = flattenedChildren.map((child, index) => {\n if (typeof child === 'string') {\n const isLastEl = index === this.children.length - 1;\n return html`<span class=${ccBreadcrumbs.text} aria-current=${isLastEl ? 'page' : undefined}>${child}</span>`;\n }\n child.classList.add(child.tagName === 'A' ? ccBreadcrumbs.link : ccBreadcrumbs.text);\n return child;\n });\n\n // Interleave '/' separator with breadcrumbs\n this._children = interleave(styledChildren, separator);\n }\n\n render() {\n return html`\n <nav aria-labelledby=\"breadCrumbLabel\">\n <h2 id=\"breadCrumbLabel\" class=${ccBreadcrumbs.a11y}>${this.ariaLabel}</h2>\n <div class=${ccBreadcrumbs.wrapper}>${this._children}</div>\n </nav>\n `;\n }\n}\n\nif (!customElements.get('w-breadcrumbs')) {\n customElements.define('w-breadcrumbs', WarpBreadcrumbs);\n}\n\nexport { WarpBreadcrumbs };\n\ndeclare global {\n interface HTMLElementTagNameMap {\n 'w-breadcrumbs': WarpBreadcrumbs;\n }\n}\n", "import { unraw } from 'unraw';\nimport { compileMessage } from '@lingui/message-utils/compileMessage';\n\nconst isString = (s) => typeof s === \"string\";\nconst isFunction = (f) => typeof f === \"function\";\n\nconst cache = /* @__PURE__ */ new Map();\nconst defaultLocale = \"en\";\nfunction normalizeLocales(locales) {\n const out = Array.isArray(locales) ? locales : [locales];\n return [...out, defaultLocale];\n}\nfunction date(locales, value, format) {\n const _locales = normalizeLocales(locales);\n if (!format) {\n format = \"default\";\n }\n let o;\n if (typeof format === \"string\") {\n o = {\n day: \"numeric\",\n month: \"short\",\n year: \"numeric\"\n };\n switch (format) {\n case \"full\":\n o.weekday = \"long\";\n case \"long\":\n o.month = \"long\";\n break;\n case \"short\":\n o.month = \"numeric\";\n break;\n }\n } else {\n o = format;\n }\n const formatter = getMemoized(\n () => cacheKey(\"date\", _locales, format),\n () => new Intl.DateTimeFormat(_locales, o)\n );\n return formatter.format(isString(value) ? new Date(value) : value);\n}\nfunction time(locales, value, format) {\n let o;\n if (!format) {\n format = \"default\";\n }\n if (typeof format === \"string\") {\n o = {\n second: \"numeric\",\n minute: \"numeric\",\n hour: \"numeric\"\n };\n switch (format) {\n case \"full\":\n case \"long\":\n o.timeZoneName = \"short\";\n break;\n case \"short\":\n delete o.second;\n }\n } else {\n o = format;\n }\n return date(locales, value, o);\n}\nfunction number(locales, value, format) {\n const _locales = normalizeLocales(locales);\n const formatter = getMemoized(\n () => cacheKey(\"number\", _locales, format),\n () => new Intl.NumberFormat(_locales, format)\n );\n return formatter.format(value);\n}\nfunction plural(locales, ordinal, value, { offset = 0, ...rules }) {\n const _locales = normalizeLocales(locales);\n const plurals = ordinal ? getMemoized(\n () => cacheKey(\"plural-ordinal\", _locales),\n () => new Intl.PluralRules(_locales, { type: \"ordinal\" })\n ) : getMemoized(\n () => cacheKey(\"plural-cardinal\", _locales),\n () => new Intl.PluralRules(_locales, { type: \"cardinal\" })\n );\n return rules[value] ?? rules[plurals.select(value - offset)] ?? rules.other;\n}\nfunction getMemoized(getKey, construct) {\n const key = getKey();\n let formatter = cache.get(key);\n if (!formatter) {\n formatter = construct();\n cache.set(key, formatter);\n }\n return formatter;\n}\nfunction cacheKey(type, locales, options) {\n const localeKey = locales.join(\"-\");\n return `${type}-${localeKey}-${JSON.stringify(options)}`;\n}\n\nconst formats = {\n __proto__: null,\n date: date,\n defaultLocale: defaultLocale,\n number: number,\n plural: plural,\n time: time\n};\n\nconst UNICODE_REGEX = /\\\\u[a-fA-F0-9]{4}|\\\\x[a-fA-F0-9]{2}/;\nconst OCTOTHORPE_PH = \"%__lingui_octothorpe__%\";\nconst getDefaultFormats = (locale, passedLocales, formats = {}) => {\n const locales = passedLocales || locale;\n const style = (format) => {\n if (typeof format === \"object\")\n return format;\n return formats[format];\n };\n const replaceOctothorpe = (value, message) => {\n const numberFormat = Object.keys(formats).length ? style(\"number\") : void 0;\n const valueStr = number(locales, value, numberFormat);\n return message.replace(new RegExp(OCTOTHORPE_PH, \"g\"), valueStr);\n };\n return {\n plural: (value, cases) => {\n const { offset = 0 } = cases;\n const message = plural(locales, false, value, cases);\n return replaceOctothorpe(value - offset, message);\n },\n selectordinal: (value, cases) => {\n const { offset = 0 } = cases;\n const message = plural(locales, true, value, cases);\n return replaceOctothorpe(value - offset, message);\n },\n select: selectFormatter,\n number: (value, format) => number(\n locales,\n value,\n style(format) || { style: format }\n ),\n date: (value, format) => date(locales, value, style(format) || format),\n time: (value, format) => time(locales, value, style(format) || format)\n };\n};\nconst selectFormatter = (value, rules) => rules[value] ?? rules.other;\nfunction interpolate(translation, locale, locales) {\n return (values = {}, formats) => {\n const formatters = getDefaultFormats(locale, locales, formats);\n const formatMessage = (tokens, replaceOctothorpe = false) => {\n if (!Array.isArray(tokens))\n return tokens;\n return tokens.reduce((message, token) => {\n if (token === \"#\" && replaceOctothorpe) {\n return message + OCTOTHORPE_PH;\n }\n if (isString(token)) {\n return message + token;\n }\n const [name, type, format] = token;\n let interpolatedFormat = {};\n if (type === \"plural\" || type === \"selectordinal\" || type === \"select\") {\n Object.entries(format).forEach(\n ([key, value2]) => {\n interpolatedFormat[key] = formatMessage(\n value2,\n type === \"plural\" || type === \"selectordinal\"\n );\n }\n );\n } else {\n interpolatedFormat = format;\n }\n let value;\n if (type) {\n const formatter = formatters[type];\n value = formatter(values[name], interpolatedFormat);\n } else {\n value = values[name];\n }\n if (value == null) {\n return message;\n }\n return message + value;\n }, \"\");\n };\n const result = formatMessage(translation);\n if (isString(result) && UNICODE_REGEX.test(result)) {\n return unraw(result);\n }\n if (isString(result))\n return result;\n return result ? String(result) : \"\";\n };\n}\n\nvar __defProp$1 = Object.defineProperty;\nvar __defNormalProp$1 = (obj, key, value) => key in obj ? __defProp$1(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;\nvar __publicField$1 = (obj, key, value) => {\n __defNormalProp$1(obj, typeof key !== \"symbol\" ? key + \"\" : key, value);\n return value;\n};\nclass EventEmitter {\n constructor() {\n __publicField$1(this, \"_events\", {});\n }\n on(event, listener) {\n var _a;\n (_a = this._events)[event] ?? (_a[event] = []);\n this._events[event].push(listener);\n return () => this.removeListener(event, listener);\n }\n removeListener(event, listener) {\n const maybeListeners = this._getListeners(event);\n if (!maybeListeners)\n return;\n const index = maybeListeners.indexOf(listener);\n if (~index)\n maybeListeners.splice(index, 1);\n }\n emit(event, ...args) {\n const maybeListeners = this._getListeners(event);\n if (!maybeListeners)\n return;\n maybeListeners.map((listener) => listener.apply(this, args));\n }\n _getListeners(event) {\n const maybeListeners = this._events[event];\n return Array.isArray(maybeListeners) ? maybeListeners : false;\n }\n}\n\nvar __defProp = Object.defineProperty;\nvar __defNormalProp = (obj, key, value) => key in obj ? __defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;\nvar __publicField = (obj, key, value) => {\n __defNormalProp(obj, typeof key !== \"symbol\" ? key + \"\" : key, value);\n return value;\n};\nclass I18n extends EventEmitter {\n constructor(params) {\n super();\n __publicField(this, \"_locale\", \"\");\n __publicField(this, \"_locales\");\n __publicField(this, \"_localeData\", {});\n __publicField(this, \"_messages\", {});\n __publicField(this, \"_missing\");\n __publicField(this, \"_messageCompiler\");\n /**\n * Alias for {@see I18n._}\n */\n __publicField(this, \"t\", this._.bind(this));\n if (process.env.NODE_ENV !== \"production\") {\n this.setMessagesCompiler(compileMessage);\n }\n if (params.missing != null)\n this._missing = params.missing;\n if (params.messages != null)\n this.load(params.messages);\n if (params.localeData != null)\n this.loadLocaleData(params.localeData);\n if (typeof params.locale === \"string\" || params.locales) {\n this.activate(params.locale ?? defaultLocale, params.locales);\n }\n }\n get locale() {\n return this._locale;\n }\n get locales() {\n return this._locales;\n }\n get messages() {\n return this._messages[this._locale] ?? {};\n }\n /**\n * @deprecated this has no effect. Please remove this from the code. Deprecated in v4\n */\n get localeData() {\n return this._localeData[this._locale] ?? {};\n }\n _loadLocaleData(locale, localeData) {\n const maybeLocaleData = this._localeData[locale];\n if (!maybeLocaleData) {\n this._localeData[locale] = localeData;\n } else {\n Object.assign(maybeLocaleData, localeData);\n }\n }\n /**\n * Registers a `MessageCompiler` to enable the use of uncompiled catalogs at runtime.\n *\n * In production builds, the `MessageCompiler` is typically excluded to reduce bundle size.\n * By default, message catalogs should be precompiled during the build process. However,\n * if you need to compile catalogs at runtime, you can use this method to set a message compiler.\n *\n * Example usage:\n *\n * ```ts\n * import { compileMessage } from \"@lingui/message-utils/compileMessage\";\n *\n * i18n.setMessagesCompiler(compileMessage);\n * ```\n */\n setMessagesCompiler(compiler) {\n this._messageCompiler = compiler;\n return this;\n }\n /**\n * @deprecated Plurals automatically used from Intl.PluralRules you can safely remove this call. Deprecated in v4\n */\n loadLocaleData(localeOrAllData, localeData) {\n if (typeof localeOrAllData === \"string\") {\n this._loadLocaleData(localeOrAllData, localeData);\n } else {\n Object.keys(localeOrAllData).forEach(\n (locale) => this._loadLocaleData(locale, localeOrAllData[locale])\n );\n }\n this.emit(\"change\");\n }\n _load(locale, messages) {\n const maybeMessages = this._messages[locale];\n if (!maybeMessages) {\n this._messages[locale] = messages;\n } else {\n Object.assign(maybeMessages, messages);\n }\n }\n load(localeOrMessages, messages) {\n if (typeof localeOrMessages == \"string\" && typeof messages === \"object\") {\n this._load(localeOrMessages, messages);\n } else {\n Object.entries(localeOrMessages).forEach(\n ([locale, messages2]) => this._load(locale, messages2)\n );\n }\n this.emit(\"change\");\n }\n /**\n * @param options {@link LoadAndActivateOptions}\n */\n loadAndActivate({ locale, locales, messages }) {\n this._locale = locale;\n this._locales = locales || void 0;\n this._messages[this._locale] = messages;\n this.emit(\"change\");\n }\n activate(locale, locales) {\n if (process.env.NODE_ENV !== \"production\") {\n if (!this._messages[locale]) {\n console.warn(`Messages for locale \"${locale}\" not loaded.`);\n }\n }\n this._locale = locale;\n this._locales = locales;\n this.emit(\"change\");\n }\n _(id, values, options) {\n if (!this.locale) {\n throw new Error(\n \"Lingui: Attempted to call a translation function without setting a locale.\\nMake sure to call `i18n.activate(locale)` before using Lingui functions.\\nThis issue may also occur due to a race condition in your initialization logic.\"\n );\n }\n let message = options?.message;\n if (!id) {\n id = \"\";\n }\n if (!isString(id)) {\n values = id.values || values;\n message = id.message;\n id = id.id;\n }\n const messageForId = this.messages[id];\n const messageMissing = messageForId === void 0;\n const missing = this._missing;\n if (missing && messageMissing) {\n return isFunction(missing) ? missing(this._locale, id) : missing;\n }\n if (messageMissing) {\n this.emit(\"missing\", { id, locale: this._locale });\n }\n let translation = messageForId || message || id;\n if (isString(translation)) {\n if (this._messageCompiler) {\n translation = this._messageCompiler(translation);\n } else {\n console.warn(`Uncompiled message detected! Message:\n\n> ${translation}\n\nThat means you use raw catalog or your catalog doesn't have a translation for the message and fallback was used.\nICU features such as interpolation and plurals will not work properly for that message. \n\nPlease compile your catalog first. \n`);\n }\n }\n if (isString(translation) && UNICODE_REGEX.test(translation))\n return JSON.parse(`\"${translation}\"`);\n if (isString(translation))\n return translation;\n return interpolate(\n translation,\n this._locale,\n this._locales\n )(values, options?.formats);\n }\n date(value, format) {\n return date(this._locales || this._locale, value, format);\n }\n number(value, format) {\n return number(this._locales || this._locale, value, format);\n }\n}\nfunction setupI18n(params = {}) {\n return new I18n(params);\n}\n\nconst i18n = setupI18n();\n\nexport { I18n, formats, i18n, setupI18n };\n", "/**\n * Inject a separator between each item in a list\n * @param array List of items\n * @param separator Element to be interleaved between each item\n * @returns\n */\nexport function interleave(array, separator) {\n return array.flatMap((el) => [el, separator]).slice(0, -1);\n}\n", "import { Messages, i18n } from '@lingui/core';\n\nexport const supportedLocales = ['en', 'nb', 'fi', 'da', 'sv'] as const;\ntype SupportedLocale = (typeof supportedLocales)[number];\n\nexport const defaultLocale = 'en';\n\nexport const getSupportedLocale = (usedLocale: string) => {\n return supportedLocales.find((locale) => usedLocale === locale || usedLocale.toLowerCase().includes(locale)) || defaultLocale;\n};\n\nexport function detectLocale(): SupportedLocale {\n if (typeof window === 'undefined') {\n /**\n * Server locale detection. This requires e.g LANG environment variable to be set on the server.\n */\n const serverLocale = process.env.NMP_LANGUAGE || Intl.DateTimeFormat().resolvedOptions().locale;\n return getSupportedLocale(serverLocale);\n }\n\n try {\n /**\n * Client locale detection. Expects the lang attribute to be defined.\n */\n const htmlLocale = document.documentElement.lang;\n return getSupportedLocale(htmlLocale);\n } catch (e) {\n console.warn('could not detect locale, falling back to source locale', e);\n return defaultLocale;\n }\n}\n\nexport const getMessages = (\n locale: SupportedLocale,\n enMsg: Messages,\n nbMsg: Messages,\n fiMsg: Messages,\n daMsg: Messages,\n svMsg: Messages,\n) => {\n if (locale === 'nb') return nbMsg;\n if (locale === 'fi') return fiMsg;\n if (locale === 'da') return daMsg;\n if (locale === 'sv') return svMsg;\n // Default to English\n return enMsg;\n};\n\nexport const activateI18n = (\n enMessages: Messages,\n nbMessages: Messages,\n fiMessages: Messages,\n daMessages: Messages,\n svMessages: Messages,\n) => {\n const locale = detectLocale();\n const messages = getMessages(locale, enMessages, nbMessages, fiMessages, daMessages, svMessages);\n i18n.load(locale, messages);\n i18n.activate(locale);\n};\n", "import { css } from 'lit';\n\nexport const reset = css`\n *,\n :before,\n :after {\n box-sizing: border-box;\n border-style: solid;\n border-width: 0;\n border-color: var(--w-s-color-border);\n }\n html {\n font-size: 62.5%;\n }\n body {\n background-color: var(--w-s-color-background);\n min-height: 100%;\n margin: 0;\n overflow-y: scroll;\n }\n body,\n :host {\n -webkit-text-size-adjust: 100%;\n tab-size: 4;\n -webkit-tap-highlight-color: transparent;\n font-family: var(--w-font-family);\n font-size: var(--w-font-size-m);\n line-height: var(--w-line-height-m);\n color: var(--w-s-color-text);\n }\n hr {\n color: inherit;\n border-top-width: 1px;\n height: 0;\n }\n abbr:where([title]) {\n -webkit-text-decoration: underline dotted;\n text-decoration: underline dotted;\n }\n h1,\n h2,\n h3,\n h4,\n h5,\n h6 {\n font-size: inherit;\n font-weight: 700;\n }\n a {\n cursor: pointer;\n color: var(--w-s-color-text-link);\n text-decoration: none;\n }\n a:hover,\n a:focus,\n a:active {\n text-decoration: underline;\n }\n a:focus-visible {\n outline: 2px solid var(--w-s-color-border-focus);\n outline-offset: 1px;\n }\n b,\n strong {\n font-weight: 700;\n }\n code,\n kbd,\n samp,\n pre {\n font-family:\n ui-monospace,\n SFMono-Regular,\n Menlo,\n Monaco,\n Consolas,\n Liberation Mono,\n Courier New,\n monospace;\n font-size: 1em;\n }\n sub,\n sup {\n vertical-align: baseline;\n font-size: 75%;\n line-height: 0;\n position: relative;\n }\n sub {\n bottom: -0.25em;\n }\n sup {\n top: -0.5em;\n }\n table {\n text-indent: 0;\n border-color: inherit;\n border-collapse: collapse;\n }\n button,\n input,\n optgroup,\n select,\n textarea {\n font-family: inherit;\n font-size: 100%;\n font-weight: inherit;\n line-height: inherit;\n color: inherit;\n margin: 0;\n padding: 0;\n }\n button,\n select {\n text-transform: none;\n }\n button,\n [type='button'],\n [type='reset'],\n [type='submit'] {\n -webkit-appearance: button;\n }\n :-moz-focusring {\n outline: auto;\n }\n :-moz-ui-invalid {\n box-shadow: none;\n }\n progress {\n vertical-align: baseline;\n }\n ::-webkit-inner-spin-button {\n height: auto;\n }\n ::-webkit-outer-spin-button {\n height: auto;\n }\n [type='search'] {\n -webkit-appearance: textfield;\n outline-offset: -2px;\n }\n ::-webkit-search-decoration {\n -webkit-appearance: none;\n }\n ::-webkit-file-upload-button {\n -webkit-appearance: button;\n font: inherit;\n }\n summary {\n display: list-item;\n }\n blockquote,\n dl,\n dd,\n h1,\n h2,\n h3,\n h4,\n h5,\n h6,\n hr,\n figure,\n p,\n pre {\n margin: 0;\n }\n fieldset {\n margin: 0;\n padding: 0;\n }\n legend {\n padding: 0;\n }\n ol,\n ul,\n menu {\n margin: 0;\n padding: 0;\n list-style: none;\n }\n textarea {\n resize: vertical;\n }\n input::placeholder,\n textarea::placeholder {\n opacity: 1;\n color: var(--w-s-color-text-placeholder);\n }\n button,\n [role='button'] {\n cursor: pointer;\n }\n :disabled {\n cursor: default;\n }\n img,\n svg,\n video,\n canvas,\n audio,\n iframe,\n embed,\n object {\n vertical-align: middle;\n display: block;\n }\n img,\n video {\n max-width: 100%;\n height: auto;\n }\n h1 {\n font-size: var(--w-font-size-xxl);\n line-height: var(--w-line-height-xxl);\n }\n h2 {\n font-size: var(--w-font-size-xl);\n line-height: var(--w-line-height-xl);\n }\n h3 {\n font-size: var(--w-font-size-l);\n line-height: var(--w-line-height-l);\n }\n h4 {\n font-size: var(--w-font-size-m);\n line-height: var(--w-line-height-m);\n }\n h5 {\n font-size: var(--w-font-size-s);\n line-height: var(--w-line-height-s);\n }\n dt,\n dd {\n margin: 0 16px;\n }\n h1,\n h2,\n h3,\n h4,\n h5,\n ul,\n ol,\n dl,\n p,\n blockquote {\n margin: 0 0 8px;\n }\n [hidden] {\n display: none !important;\n }\n [tabindex='-1']:focus:not(:focus-visible) {\n outline: none;\n }\n legend {\n float: left;\n width: 100%;\n margin: 0;\n padding: 0;\n display: table;\n }\n legend + * {\n clear: both;\n }\n fieldset {\n border: 0;\n min-width: 0;\n margin: 0;\n padding: 0.01em 0 0;\n }\n body:not(:-moz-handler-blocked) fieldset {\n display: table-cell;\n }\n svg {\n pointer-events: none;\n }\n`;\nexport const components = css`*, :before, :after {\n --w-rotate: 0;\n --w-rotate-x: 0;\n --w-rotate-y: 0;\n --w-rotate-z: 0;\n --w-scale-x: 1;\n --w-scale-y: 1;\n --w-scale-z: 1;\n --w-skew-x: 0;\n --w-skew-y: 0;\n --w-translate-x: 0;\n --w-translate-y: 0;\n --w-translate-z: 0\n }\n\n .h4, .t4 {\n font-weight: 700;\n font-size: var(--w-font-size-m);\n line-height: var(--w-line-height-m)\n }\n\n .t3 {\n font-weight: 700;\n font-size: var(--w-font-size-l);\n line-height: var(--w-line-height-l)\n }\n\n @media (min-width: 480px) {\n .sm\\\\:h3 {\n font-weight: 700;\n font-size: var(--w-font-size-l);\n line-height: var(--w-line-height-l)\n }\n }\n\n .text-center {\n text-align: center\n }\n\n .before\\\\:text-center:before {\n text-align: center\n }\n\n .text-left {\n text-align: left\n }\n\n .text-right {\n text-align: right\n }\n\n .align-middle {\n vertical-align: middle\n }\n\n .animate-inprogress {\n background-image: linear-gradient(135deg, rgba(0, 0, 0, .05) 25%, transparent 0, transparent 50%, rgba(0, 0, 0, .05) 0, rgba(0, 0, 0, .05) 75%, transparent 0, transparent) !important;\n background-size: 30px 30px;\n animation: animate-inprogress 3s linear infinite\n }\n\n @keyframes animate-inprogress {\n 0% {\n background-position: 0 0\n }\n to {\n background-position: 60px 0\n }\n }\n\n .\\\\[--w-modal-max-height\\\\:80\\\\%\\\\] {\n --w-modal-max-height: 80%\n }\n\n .\\\\[--w-modal-width\\\\:640px\\\\] {\n --w-modal-width: 640px\n }\n\n .focus\\\\:\\\\[--w-outline-offset\\\\:-2px\\\\]:focus {\n --w-outline-offset: -2px\n }\n\n .backdrop-blur {\n -webkit-backdrop-filter: blur(4px);\n backdrop-filter: blur(4px)\n }\n\n .peer:checked ~ .peer-checked\\\\:before\\\\:bg-center:before {\n background-position: center\n }\n\n .hover\\\\:bg-clip-padding:hover {\n -webkit-background-clip: padding-box;\n background-clip: padding-box\n }\n\n .bg-transparent, .group\\\\/steph:first-child .group-first\\\\/steph\\\\:bg-transparent, .group\\\\/steph:last-child .group-last\\\\/steph\\\\:bg-transparent {\n background-color: transparent\n }\n\n .bg-\\\\[--w-black\\\\/25\\\\] {\n background-color: rgba(var(--w-rgb-black), .25)\n }\n\n .bg-\\\\[--w-black\\\\/70\\\\], .bg-\\\\[var\\\\(--w-black\\\\)\\\\/70\\\\] {\n background-color: rgba(var(--w-rgb-black), .7)\n }\n\n .bg-\\\\[--w-color-badge-info-background\\\\] {\n background-color: var(--w-color-badge-info-background)\n }\n\n .bg-\\\\[--w-color-badge-negative-background\\\\] {\n background-color: var(--w-color-badge-negative-background)\n }\n\n .bg-\\\\[--w-color-badge-neutral-background\\\\] {\n background-color: var(--w-color-badge-neutral-background)\n }\n\n .bg-\\\\[--w-color-badge-positive-background\\\\] {\n background-color: var(--w-color-badge-positive-background)\n }\n\n .bg-\\\\[--w-color-badge-sponsored-background\\\\] {\n background-color: var(--w-color-badge-sponsored-background)\n }\n\n .bg-\\\\[--w-color-badge-warning-background\\\\] {\n background-color: var(--w-color-badge-warning-background)\n }\n\n .bg-\\\\[--w-color-button-primary-background\\\\] {\n background-color: var(--w-color-button-primary-background)\n }\n\n .bg-\\\\[--w-color-buttongroup-utility-background-selected\\\\] {\n background-color: var(--w-color-buttongroup-utility-background-selected)\n }\n\n .bg-\\\\[--w-color-callout-background\\\\] {\n background-color: var(--w-color-callout-background)\n }\n\n .bg-\\\\[--w-color-pill-suggestion-background\\\\] {\n background-color: var(--w-color-pill-suggestion-background)\n }\n\n .bg-\\\\[--w-color-switch-track-background\\\\] {\n background-color: var(--w-color-switch-track-background)\n }\n\n .bg-\\\\[--w-s-color-surface-elevated-100\\\\] {\n background-color: var(--w-s-color-surface-elevated-100)\n }\n\n .bg-\\\\[--w-s-color-surface-elevated-300\\\\] {\n background-color: var(--w-s-color-surface-elevated-300)\n }\n\n .bg-\\\\[--w-s-icon-selected\\\\] {\n background-color: var(--w-s-icon-selected)\n }\n\n .group:hover .group-hover\\\\:bg-\\\\[--w-color-switch-track-background-hover\\\\] {\n background-color: var(--w-color-switch-track-background-hover)\n }\n\n .hover\\\\:bg-\\\\[--w-color-button-pill-background-hover\\\\]:hover {\n background-color: var(--w-color-button-pill-background-hover)\n }\n\n .hover\\\\:bg-\\\\[--w-color-button-primary-background-hover\\\\]:hover {\n background-color: var(--w-color-button-primary-background-hover)\n }\n\n .hover\\\\:bg-\\\\[--w-color-buttongroup-utility-background-hover\\\\]:hover {\n background-color: var(--w-color-buttongroup-utility-background-hover)\n }\n\n .hover\\\\:bg-\\\\[--w-color-pill-suggestion-background-hover\\\\]:hover {\n background-color: var(--w-color-pill-suggestion-background-hover)\n }\n\n .hover\\\\:bg-\\\\[--w-s-icon-subtle\\\\]:hover {\n background-color: var(--w-s-icon-subtle)\n }\n\n .hover\\\\:bg-\\\\[var\\\\(--w-black\\\\)\\\\/85\\\\]:hover {\n background-color: rgba(var(--w-rgb-black), .85)\n }\n\n .active\\\\:bg-\\\\[--w-color-button-pill-background-active\\\\]:active {\n background-color: var(--w-color-button-pill-background-active)\n }\n\n .active\\\\:bg-\\\\[--w-color-button-primary-background-active\\\\]:active {\n background-color: var(--w-color-button-primary-background-active)\n }\n\n .active\\\\:bg-\\\\[--w-color-buttongroup-utility-background-selected\\\\]:active {\n background-color: var(--w-color-buttongroup-utility-background-selected)\n }\n\n .active\\\\:bg-\\\\[--w-color-pill-suggestion-background-active\\\\]:active {\n background-color: var(--w-color-pill-suggestion-background-active)\n }\n\n .active\\\\:bg-\\\\[var\\\\(--w-black\\\\)\\\\]:active {\n background-color: var(--w-black)\n }\n\n .peer:checked ~ .peer-checked\\\\:before\\\\:bg-\\\\[url\\\\(var\\\\(--w-icon-toggle-checked\\\\)\\\\)\\\\]:before {\n background-image: var(--w-icon-toggle-checked)\n }\n\n .appearance-none {\n -moz-appearance: none;\n appearance: none;\n -webkit-appearance: none\n }\n\n .will-change-height {\n will-change: height\n }\n\n .border, .border-1 {\n border-width: 1px\n }\n\n .border-b {\n border-bottom-width: 1px\n }\n\n .before\\\\:border:before {\n border-width: 1px\n }\n\n .border-0 {\n border-width: 0\n }\n\n .border-2 {\n border-width: 2px\n }\n\n .border-b-0 {\n border-bottom-width: 0\n }\n\n .border-b-4 {\n border-bottom-width: 4px\n }\n\n .border-l-4 {\n border-left-width: 4px\n }\n\n .border-r-0, .group:not(:last-of-type) .group-not-last-of-type\\\\:border-r-0 {\n border-right-width: 0\n }\n\n .peer:checked ~ .peer-checked\\\\:before\\\\:border-\\\\[6\\\\]:before {\n border-width: .6rem\n }\n\n .border-transparent {\n border-color: transparent\n }\n\n .border-\\\\[--w-color-buttongroup-utility-border\\\\] {\n border-color: var(--w-color-buttongroup-utility-border)\n }\n\n .border-\\\\[--w-color-callout-border\\\\] {\n border-color: var(--w-color-callout-border)\n }\n\n .border-\\\\[--w-s-color-background-inverted\\\\] {\n border-color: var(--w-s-color-background-inverted)\n }\n\n .border-\\\\[--w-s-color-surface-elevated-300\\\\] {\n border-color: var(--w-s-color-surface-elevated-300)\n }\n\n .active\\\\:border-\\\\[--w-color-buttongroup-utility-border-selected\\\\]:active {\n border-color: var(--w-color-buttongroup-utility-border-selected)\n }\n\n .divide-x > * + * {\n --w-divide-x-reverse: 0;\n border-left-width: calc(1px * calc(1 - var(--w-divide-x-reverse)));\n border-right-width: calc(1px * var(--w-divide-x-reverse))\n }\n\n .divide-y > * + * {\n --w-divide-y-reverse: 0;\n border-top-width: calc(1px * calc(1 - var(--w-divide-y-reverse)));\n border-bottom-width: calc(1px * var(--w-divide-y-reverse))\n }\n\n .rounded-4 {\n border-radius: 4px\n }\n\n .rounded-8 {\n border-radius: 8px\n }\n\n .rounded-full {\n border-radius: 9999px\n }\n\n .before\\\\:rounded-2:before {\n border-radius: 2px\n }\n\n .before\\\\:rounded-full:before {\n border-radius: 9999px\n }\n\n .rounded-b-0 {\n border-bottom-left-radius: 0;\n border-bottom-right-radius: 0\n }\n\n .rounded-bl-0 {\n border-bottom-left-radius: 0\n }\n\n .rounded-br-0 {\n border-bottom-right-radius: 0\n }\n\n .rounded-l-0 {\n border-top-left-radius: 0;\n border-bottom-left-radius: 0\n }\n\n .rounded-l-full {\n border-top-left-radius: 9999px;\n border-bottom-left-radius: 9999px\n }\n\n .rounded-r-0 {\n border-top-right-radius: 0;\n border-bottom-right-radius: 0\n }\n\n .rounded-r-full {\n border-top-right-radius: 9999px;\n border-bottom-right-radius: 9999px\n }\n\n .rounded-tl-0 {\n border-top-left-radius: 0\n }\n\n .rounded-tl-4 {\n border-top-left-radius: 4px\n }\n\n .rounded-tr-0 {\n border-top-right-radius: 0\n }\n\n .group:first-of-type .group-first-of-type\\\\:rounded-bl-8 {\n border-bottom-left-radius: 8px\n }\n\n .group:first-of-type .group-first-of-type\\\\:rounded-tl-8 {\n border-top-left-radius: 8px\n }\n\n .first\\\\:rounded-lb-4:first-child {\n border-bottom-left-radius: 4px\n }\n\n .first\\\\:rounded-lt-4:first-child {\n border-top-left-radius: 4px\n }\n\n .first\\\\:rounded-rt-4:first-child {\n border-top-right-radius: 4px\n }\n\n .group:last-of-type .group-last-of-type\\\\:rounded-br-8 {\n border-bottom-right-radius: 8px\n }\n\n .group:last-of-type .group-last-of-type\\\\:rounded-tr-8 {\n border-top-right-radius: 8px\n }\n\n .last\\\\:rounded-lb-4:last-child {\n border-bottom-left-radius: 4px\n }\n\n .last\\\\:rounded-rb-4:last-child {\n border-bottom-right-radius: 4px\n }\n\n .last\\\\:rounded-rt-4:last-child {\n border-top-right-radius: 4px\n }\n\n .caret-current {\n caret-color: currentColor\n }\n\n .opacity-25 {\n opacity: 25%\n }\n\n .block {\n display: block\n }\n\n .before\\\\:block:before {\n display: block\n }\n\n .inline-block {\n display: inline-block\n }\n\n .inline {\n display: inline\n }\n\n .flex, .open\\\\:flex[open] {\n display: flex\n }\n\n .inline-flex {\n display: inline-flex\n }\n\n .grid {\n display: grid\n }\n\n .inline-grid {\n display: inline-grid\n }\n\n .hidden, .group\\\\/stepv:last-child .group-last\\\\/stepv\\\\:hidden {\n display: none\n }\n\n .before\\\\:hidden:before {\n display: none\n }\n\n .hover\\\\:underline:hover {\n text-decoration-line: underline\n }\n\n .focus\\\\:underline:focus {\n text-decoration-line: underline\n }\n\n .focus-visible\\\\:underline:focus-visible {\n text-decoration-line: underline\n }\n\n .active\\\\:underline:active {\n text-decoration-line: underline\n }\n\n .hover\\\\:no-underline:hover {\n text-decoration: none\n }\n\n .focus\\\\:no-underline:focus {\n text-decoration: none\n }\n\n .active\\\\:no-underline:active {\n text-decoration: none\n }\n\n .flex-1 {\n flex: 1 1 0%\n }\n\n .shrink {\n flex-shrink: 1\n }\n\n .shrink-0 {\n flex-shrink: 0\n }\n\n .shrink-0\\\\! {\n flex-shrink: 0 !important\n }\n\n .grow, .grow-1 {\n flex-grow: 1\n }\n\n .basis-auto {\n flex-basis: auto\n }\n\n .flex-col {\n flex-direction: column\n }\n\n .focus-within\\\\:focusable:focus-within {\n outline: 2px solid var(--w-s-color-border-focus);\n outline-offset: var(--w-outline-offset, 1px)\n }\n\n .focusable:focus, .focusable:focus-visible {\n outline: 2px solid var(--w-s-color-border-focus);\n outline-offset: var(--w-outline-offset, 1px)\n }\n\n .focusable:not(:focus-visible) {\n outline: none\n }\n\n .peer:focus ~ .peer-focus\\\\:focusable, .peer:focus-visible ~ .peer-focus\\\\:focusable {\n outline: 2px solid var(--w-s-color-border-focus);\n outline-offset: var(--w-outline-offset, 1px)\n }\n\n .peer:not(:focus-visible) ~ .peer-focus\\\\:focusable {\n outline: none\n }\n\n .focusable-inset {\n --w-outline-offset: -3px\n }\n\n .gap-12 {\n gap: 1.2rem\n }\n\n .gap-8 {\n gap: .8rem\n }\n\n .gap-x-16 {\n column-gap: 1.6rem\n }\n\n .gap-y-16 {\n row-gap: 1.6rem\n }\n\n .row-span-2 {\n grid-row: span 2/span 2\n }\n\n .col-span-2 {\n grid-column: span 2/span 2\n }\n\n .col-span-3 {\n grid-column: span 3/span 3\n }\n\n .row-start-1 {\n grid-row-start: 1\n }\n\n .row-start-2 {\n grid-row-start: 2\n }\n\n .col-start-2 {\n grid-column-start: 2\n }\n\n .auto-rows-auto {\n grid-auto-rows: auto\n }\n\n .grid-flow-col {\n grid-auto-flow: column\n }\n\n .grid-rows-\\\\[20px_auto\\\\] {\n grid-template-rows:20px auto\n }\n\n .grid-rows-\\\\[auto_20px\\\\] {\n grid-template-rows:auto 20px\n }\n\n .grid-cols-\\\\[1fr_20px_1fr\\\\] {\n grid-template-columns:1fr 20px 1fr\n }\n\n .grid-cols-\\\\[1fr_20px\\\\] {\n grid-template-columns:1fr 20px\n }\n\n .grid-cols-\\\\[20px_1fr\\\\] {\n grid-template-columns:20px 1fr\n }\n\n .grid-cols-\\\\[auto_1fr_auto\\\\] {\n grid-template-columns:auto 1fr auto\n }\n\n .grid-cols-1 {\n grid-template-columns:repeat(1, minmax(0, 1fr))\n }\n\n .grid-cols-2 {\n grid-template-columns:repeat(2, minmax(0, 1fr))\n }\n\n .grid-cols-3 {\n grid-template-columns:repeat(3, minmax(0, 1fr))\n }\n\n .grid-cols-4 {\n grid-template-columns:repeat(4, minmax(0, 1fr))\n }\n\n .grid-cols-5 {\n grid-template-columns:repeat(5, minmax(0, 1fr))\n }\n\n .grid-cols-6 {\n grid-template-columns:repeat(6, minmax(0, 1fr))\n }\n\n .grid-cols-7 {\n grid-template-columns:repeat(7, minmax(0, 1fr))\n }\n\n .grid-cols-8 {\n grid-template-columns:repeat(8, minmax(0, 1fr))\n }\n\n .grid-cols-9 {\n grid-template-columns:repeat(9, minmax(0, 1fr))\n }\n\n .overflow-hidden {\n overflow: hidden\n }\n\n .overflow-x-hidden {\n overflow-x: hidden\n }\n\n .overflow-y-auto {\n overflow-y: auto\n }\n\n .list-none {\n list-style-type: none\n }\n\n .outline-\\\\[--w-s-color-border-negative\\\\]\\\\! {\n outline-color: var(--w-s-color-border-negative) !important\n }\n\n .outline-none {\n outline: 2px solid transparent;\n outline-offset: 2px\n }\n\n .focus\\\\:outline-none:focus {\n outline: 2px solid transparent;\n outline-offset: 2px\n }\n\n .items-start {\n align-items: flex-start\n }\n\n .items-end {\n align-items: flex-end\n }\n\n .items-center {\n align-items: center\n }\n\n .self-center {\n align-self: center\n }\n\n .inset-0 {\n top: 0rem;\n right: 0rem;\n bottom: 0rem;\n left: 0rem\n }\n\n .-bottom-0 {\n bottom: -0rem\n }\n\n .bottom-0 {\n bottom: 0rem\n }\n\n .bottom-10 {\n bottom: 1rem\n }\n\n .bottom-16 {\n bottom: 1.6rem\n }\n\n .left-0 {\n left: 0rem\n }\n\n .left-4 {\n left: .4rem\n }\n\n .right-0 {\n right: 0rem\n }\n\n .right-8 {\n right: .8rem\n }\n\n .top-\\\\[1\\\\.92rem\\\\] {\n top: 1.92rem\n }\n\n .top-0 {\n top: 0rem\n }\n\n .top-20 {\n top: 2rem\n }\n\n .top-4 {\n top: .4rem\n }\n\n .top-8 {\n top: .8rem\n }\n\n .before\\\\:bottom-0:before {\n bottom: 0rem\n }\n\n .before\\\\:left-0:before {\n left: 0rem\n }\n\n .before\\\\:right-0:before {\n right: 0rem\n }\n\n .before\\\\:top-2:before {\n top: .2rem\n }\n\n .-bottom-\\\\[8px\\\\] {\n bottom: -8px\n }\n\n .-left-\\\\[8px\\\\] {\n left: -8px\n }\n\n .-right-\\\\[8px\\\\] {\n right: -8px\n }\n\n .-top-\\\\[8px\\\\] {\n top: -8px\n }\n\n .top-\\\\[19px\\\\] {\n top: 19px\n }\n\n .top-\\\\[30\\\\%\\\\] {\n top: 30%\n }\n\n .justify-end {\n justify-content: flex-end\n }\n\n .justify-center {\n justify-content: center\n }\n\n .justify-between {\n justify-content: space-between\n }\n\n .justify-items-center {\n justify-items: center\n }\n\n .justify-self-start {\n justify-self: start\n }\n\n .justify-self-end {\n justify-self: end\n }\n\n .justify-self-center {\n justify-self: center\n }\n\n .absolute {\n position: absolute\n }\n\n .fixed {\n position: fixed\n }\n\n .relative {\n position: relative\n }\n\n .open\\\\:fixed[open] {\n position: fixed\n }\n\n .before\\\\:absolute:before {\n position: absolute\n }\n\n .z-10, .peer:checked ~ .peer-checked\\\\:z-10 {\n z-index: 10\n }\n\n .z-30 {\n z-index: 30\n }\n\n .z-50 {\n z-index: 50\n }\n\n .hover\\\\:z-30:hover {\n z-index: 30\n }\n\n .\\\\!s-bg-selected {\n background-color: var(--w-s-color-background-selected) !important\n }\n\n .s-bg {\n background-color: var(--w-s-color-background)\n }\n\n .s-bg-disabled {\n background-color: var(--w-s-color-background-disabled)\n }\n\n .s-bg-disabled-subtle {\n background-color: var(--w-s-color-background-disabled-subtle)\n }\n\n .s-bg-info-subtle {\n background-color: var(--w-s-color-background-info-subtle)\n }\n\n .s-bg-inverted {\n background-color: var(--w-s-color-background-inverted)\n }\n\n .s-bg-negative {\n background-color: var(--w-s-color-background-negative)\n }\n\n .s-bg-negative-subtle {\n background-color: var(--w-s-color-background-negative-subtle)\n }\n\n .s-bg-positive-subtle {\n background-color: var(--w-s-color-background-positive-subtle)\n }\n\n .s-bg-primary, .peer:checked ~ .peer-checked\\\\:s-bg-primary {\n background-color: var(--w-s-color-background-primary)\n }\n\n .s-bg-selected {\n background-color: var(--w-s-color-background-selected)\n }\n\n .s-bg-subtle {\n background-color: var(--w-s-color-background-subtle)\n }\n\n .s-bg-warning-subtle {\n background-color: var(--w-s-color-background-warning-subtle)\n }\n\n .peer:checked:hover ~ .peer-checked\\\\:peer-hover\\\\:before\\\\:s-bg-negative-hover:before {\n background-color: var(--w-s-color-background-negative-hover)\n }\n\n .peer:checked:hover ~ .peer-checked\\\\:peer-hover\\\\:before\\\\:s-bg-primary-hover:before {\n background-color: var(--w-s-color-background-primary-hover)\n }\n\n .peer:checked ~ .peer-checked\\\\:before\\\\:s-bg-disabled:before {\n background-color: var(--w-s-color-background-disabled)\n }\n\n .peer:checked ~ .peer-checked\\\\:before\\\\:s-bg-negative:before {\n background-color: var(--w-s-color-background-negative)\n }\n\n .peer:checked ~ .peer-checked\\\\:before\\\\:s-bg-primary:before {\n background-color: var(--w-s-color-background-primary)\n }\n\n .peer:indeterminate ~ .peer-indeterminate\\\\:before\\\\:s-bg-disabled:before {\n background-color: var(--w-s-color-background-disabled)\n }\n\n .peer:indeterminate ~ .peer-indeterminate\\\\:before\\\\:s-bg-negative:before {\n background-color: var(--w-s-color-background-negative)\n }\n\n .peer:indeterminate ~ .peer-indeterminate\\\\:before\\\\:s-bg-primary:before {\n background-color: var(--w-s-color-background-primary)\n }\n\n .peer:indeterminate ~ .peer-indeterminate\\\\:hover\\\\:before\\\\:s-bg-negative-hover:hover:before {\n background-color: var(--w-s-color-background-negative-hover)\n }\n\n .peer:indeterminate ~ .peer-indeterminate\\\\:hover\\\\:before\\\\:s-bg-primary-hover:hover:before {\n background-color: var(--w-s-color-background-primary-hover)\n }\n\n .\\\\!hover\\\\:s-bg-selected-hover:hover {\n background-color: var(--w-s-color-background-selected-hover) !important\n }\n\n .group:hover .group-hover\\\\:s-bg-primary-hover {\n background-color: var(--w-s-color-background-primary-hover)\n }\n\n .hover\\\\:before\\\\:s-bg-hover:hover:before {\n background-color: var(--w-s-color-background-hover)\n }\n\n .hover\\\\:before\\\\:s-bg-negative-subtle-hover:hover:before {\n background-color: var(--w-s-color-background-negative-subtle-hover)\n }\n\n .hover\\\\:s-bg-hover:hover {\n background-color: var(--w-s-color-background-hover)\n }\n\n .hover\\\\:s-bg-negative-hover:hover {\n background-color: var(--w-s-color-background-negative-hover)\n }\n\n .hover\\\\:s-bg-negative-subtle-hover:hover {\n background-color: var(--w-s-color-background-negative-subtle-hover)\n }\n\n .hover\\\\:s-bg-primary-hover:hover {\n background-color: var(--w-s-color-background-primary-hover)\n }\n\n .hover\\\\:s-bg-selected-hover:hover {\n background-color: var(--w-s-color-background-selected-hover)\n }\n\n .peer:hover:not(:checked) ~ .peer-hover\\\\:peer-not-checked\\\\:s-bg-hover {\n background-color: var(--w-s-color-background-hover)\n }\n\n .peer:hover ~ .peer-hover\\\\:before\\\\:s-bg-hover:before {\n background-color: var(--w-s-color-background-hover)\n }\n\n .peer:hover ~ .peer-hover\\\\:before\\\\:s-bg-negative-subtle:before {\n background-color: var(--w-s-color-background-negative-subtle)\n }\n\n .focus\\\\:s-bg-primary-hover:focus {\n background-color: var(--w-s-color-background-primary-hover)\n }\n\n .\\\\!active\\\\:s-bg-selected-active:active {\n background-color: var(--w-s-color-background-selected-active) !important\n }\n\n .active\\\\:s-bg-active:active {\n background-color: var(--w-s-color-background-active)\n }\n\n .active\\\\:s-bg-negative-active:active {\n background-color: var(--w-s-color-background-negative-active)\n }\n\n .active\\\\:s-bg-negative-subtle-active:active {\n background-color: var(--w-s-color-background-negative-subtle-active)\n }\n\n .active\\\\:s-bg-primary-active:active {\n background-color: var(--w-s-color-background-primary-active)\n }\n\n .active\\\\:s-bg-selected-active:active {\n background-color: var(--w-s-color-background-selected-active)\n }\n\n .before\\\\:s-bg-disabled-subtle:before {\n background-color: var(--w-s-color-background-disabled-subtle)\n }\n\n .before\\\\:s-bg:before {\n background-color: var(--w-s-color-background)\n }\n\n .s-text {\n color: var(--w-s-color-text)\n }\n\n .s-text-disabled {\n color: var(--w-s-color-text-disabled)\n }\n\n .s-text-inverted, .peer:checked ~ .peer-checked\\\\:s-text-inverted {\n color: var(--w-s-color-text-inverted)\n }\n\n .s-text-inverted-static {\n color: var(--w-s-color-text-inverted-static)\n }\n\n .s-text-link {\n color: var(--w-s-color-text-link)\n }\n\n .s-text-negative {\n color: var(--w-s-color-text-negative)\n }\n\n .s-text-subtle {\n color: var(--w-s-color-text-subtle)\n }\n\n .hover\\\\:s-text-link:hover {\n color: var(--w-s-color-text-link)\n }\n\n .active\\\\:s-text:active {\n color: var(--w-s-color-text)\n }\n\n .placeholder\\\\:s-text-placeholder::placeholder {\n color: var(--w-s-color-text-placeholder)\n }\n\n .s-icon {\n color: var(--w-s-color-icon)\n }\n\n .s-icon-info {\n color: var(--w-s-color-icon-info)\n }\n\n .s-icon-inverted {\n color: var(--w-s-color-icon-inverted)\n }\n\n .s-icon-negative {\n color: var(--w-s-color-icon-negative)\n }\n\n .s-icon-positive {\n color: var(--w-s-color-icon-positive)\n }\n\n .s-icon-warning {\n color: var(--w-s-color-icon-warning)\n }\n\n .hover\\\\:s-icon-hover:hover {\n color: var(--w-s-color-icon-hover)\n }\n\n .active\\\\:s-icon-active:active {\n color: var(--w-s-color-icon-active)\n }\n\n .before\\\\:s-icon-inverted:before {\n color: var(--w-s-color-icon-inverted)\n }\n\n .s-border {\n border-color: var(--w-s-color-border)\n }\n\n .s-border-disabled {\n border-color: var(--w-s-color-border-disabled)\n }\n\n .s-border-info-subtle {\n border-color: var(--w-s-color-border-info-subtle)\n }\n\n .s-border-l-info {\n border-left-color: var(--w-s-color-border-info)\n }\n\n .s-border-l-negative {\n border-left-color: var(--w-s-color-border-negative)\n }\n\n .s-border-l-positive {\n border-left-color: var(--w-s-color-border-positive)\n }\n\n .s-border-l-warning {\n border-left-color: var(--w-s-color-border-warning)\n }\n\n .s-border-negative {\n border-color: var(--w-s-color-border-negative)\n }\n\n .s-border-negative-subtle {\n border-color: var(--w-s-color-border-negative-subtle)\n }\n\n .s-border-positive-subtle {\n border-color: var(--w-s-color-border-positive-subtle)\n }\n\n .s-border-primary, .peer:checked ~ .peer-checked\\\\:s-border-primary {\n border-color: var(--w-s-color-border-primary)\n }\n\n .s-border-selected {\n border-color: var(--w-s-color-border-selected)\n }\n\n .s-border-warning-subtle {\n border-color: var(--w-s-color-border-warning-subtle)\n }\n\n .peer:checked:hover ~ .peer-checked\\\\:peer-hover\\\\:before\\\\:s-border-negative-hover:before {\n border-color: var(--w-s-color-border-negative-hover)\n }\n\n .peer:checked:hover ~ .peer-checked\\\\:peer-hover\\\\:before\\\\:s-border-primary-hover:before {\n border-color: var(--w-s-color-border-primary-hover)\n }\n\n .peer:checked:hover ~ .peer-checked\\\\:peer-hover\\\\:before\\\\:s-border-selected-hover:before {\n border-color: var(--w-s-color-border-selected-hover)\n }\n\n .peer:checked ~ .peer-checked\\\\:before\\\\:s-border-disabled:before {\n border-color: var(--w-s-color-border-disabled)\n }\n\n .peer:checked ~ .peer-checked\\\\:before\\\\:s-border-negative:before {\n border-color: var(--w-s-color-border-negative)\n }\n\n .peer:checked ~ .peer-checked\\\\:before\\\\:s-border-primary:before {\n border-color: var(--w-s-color-border-primary)\n }\n\n .peer:checked ~ .peer-checked\\\\:before\\\\:s-border-selected:before {\n border-color: var(--w-s-color-border-selected)\n }\n\n .peer:indeterminate ~ .peer-indeterminate\\\\:before\\\\:s-border-disabled:before {\n border-color: var(--w-s-color-border-disabled)\n }\n\n .peer:indeterminate ~ .peer-indeterminate\\\\:before\\\\:s-border-negative:before {\n border-color: var(--w-s-color-border-negative)\n }\n\n .peer:indeterminate ~ .peer-indeterminate\\\\:before\\\\:s-border-primary:before {\n border-color: var(--w-s-color-border-primary)\n }\n\n .peer:indeterminate ~ .peer-indeterminate\\\\:hover\\\\:before\\\\:s-border-negative-hover:hover:before {\n border-color: var(--w-s-color-border-negative-hover)\n }\n\n .peer:indeterminate ~ .peer-indeterminate\\\\:hover\\\\:before\\\\:s-border-primary-hover:hover:before {\n border-color: var(--w-s-color-border-primary-hover)\n }\n\n .group:hover .group-hover\\\\:s-border-selected-hover {\n border-color: var(--w-s-color-border-selected-hover)\n }\n\n .hover\\\\:before\\\\:s-border-negative-hover:hover:before {\n border-color: var(--w-s-color-border-negative-hover)\n }\n\n .hover\\\\:before\\\\:s-border-primary:hover:before {\n border-color: var(--w-s-color-border-primary)\n }\n\n .hover\\\\:s-border-disabled:hover {\n border-color: var(--w-s-color-border-disabled)\n }\n\n .hover\\\\:s-border-hover:hover {\n border-color: var(--w-s-color-border-hover)\n }\n\n .hover\\\\:s-border-negative-hover:hover {\n border-color: var(--w-s-color-border-negative-hover)\n }\n\n .hover\\\\:s-border-primary-hover:hover {\n border-color: var(--w-s-color-border-primary-hover)\n }\n\n .hover\\\\:s-border-primary:hover {\n border-color: var(--w-s-color-border-primary)\n }\n\n .hover\\\\:s-border-selected-hover:hover {\n border-color: var(--w-s-color-border-selected-hover)\n }\n\n .peer:hover ~ .peer-hover\\\\:before\\\\:s-border-negative-hover:before {\n border-color: var(--w-s-color-border-negative-hover)\n }\n\n .peer:hover ~ .peer-hover\\\\:before\\\\:s-border-primary:before {\n border-color: var(--w-s-color-border-primary)\n }\n\n .focus\\\\:s-border-primary-hover:focus {\n border-color: var(--w-s-color-border-primary-hover)\n }\n\n .active\\\\:s-border-active:active {\n border-color: var(--w-s-color-border-active)\n }\n\n .active\\\\:s-border-disabled:active {\n border-color: var(--w-s-color-border-disabled)\n }\n\n .active\\\\:s-border-primary-active:active {\n border-color: var(--w-s-color-border-primary-active)\n }\n\n .active\\\\:s-border-selected-active:active {\n border-color: var(--w-s-color-border-selected-active)\n }\n\n .active\\\\:s-border-selected:active {\n border-color: var(--w-s-color-border-selected)\n }\n\n .group:active .group-active\\\\:s-border-active {\n border-color: var(--w-s-color-border-active)\n }\n\n .group:active .group-active\\\\:s-border-selected-active {\n border-color: var(--w-s-color-border-selected-active)\n }\n\n .before\\\\:s-border-disabled:before {\n border-color: var(--w-s-color-border-disabled)\n }\n\n .before\\\\:s-border-negative:before {\n border-color: var(--w-s-color-border-negative)\n }\n\n .s-surface-sunken {\n background-color: var(--w-s-color-surface-sunken)\n }\n\n .s-surface-elevated-200 {\n background-color: var(--w-s-color-surface-elevated-200);\n box-shadow: var(--w-s-shadow-surface-elevated-200)\n }\n\n .hover\\\\:s-surface-elevated-200-hover:hover {\n background-color: var(--w-s-color-surface-elevated-200-hover);\n box-shadow: var(--w-s-shadow-surface-elevated-200-hover)\n }\n\n .active\\\\:s-surface-elevated-200-active:active {\n background-color: var(--w-s-color-surface-elevated-200-active);\n box-shadow: var(--w-s-shadow-surface-elevated-200-active)\n }\n\n .drop-shadow-m {\n filter: drop-shadow(rgba(64, 64, 64, .24) 0 3px 8px) drop-shadow(rgba(64, 64, 64, .16) 0 3px 6px)\n }\n\n .shadow-m {\n box-shadow: var(--w-shadow-m)\n }\n\n .shadow-s {\n box-shadow: var(--w-shadow-s)\n }\n\n .shadow-\\\\[--w-shadow-slider\\\\] {\n box-shadow: var(--w-shadow-slider)\n }\n\n .hover\\\\:shadow-\\\\[--w-shadow-slider-handle-hover\\\\]:hover {\n box-shadow: var(--w-shadow-slider-handle-hover)\n }\n\n .focus\\\\:shadow-\\\\[--w-shadow-slider-handle-hover\\\\]:focus {\n box-shadow: var(--w-shadow-slider-handle-hover)\n }\n\n .active\\\\:shadow-\\\\[--w-shadow-slider-handle-active\\\\]:active {\n box-shadow: var(--w-shadow-slider-handle-active)\n }\n\n .h-0 {\n height: 0rem\n }\n\n .h-16 {\n height: 1.6rem\n }\n\n .h-2 {\n height: .2rem\n }\n\n .h-20 {\n height: 2rem\n }\n\n .h-24 {\n height: 2.4rem\n }\n\n .h-4 {\n height: .4rem\n }\n\n .h-44 {\n height: 4.4rem\n }\n\n .h-6 {\n height: .6rem\n }\n\n .h-8 {\n height: .8rem\n }\n\n .h-full {\n height: 100%\n }\n\n .h-unset {\n height: unset\n }\n\n .max-h-unset {\n max-height: unset\n }\n\n .max-w-full {\n max-width: 100%\n }\n\n .max-w-max {\n max-width: max-content\n }\n\n .max-w-unset {\n max-width: unset\n }\n\n .min-h-32 {\n min-height: 3.2rem\n }\n\n .min-h-40 {\n min-height: 4rem\n }\n\n .min-w-16 {\n min-width: 1.6rem\n }\n\n .min-w-32 {\n min-width: 3.2rem\n }\n\n .w-16 {\n width: 1.6rem\n }\n\n .w-2 {\n width: .2rem\n }\n\n .w-20 {\n width: 2rem\n }\n\n .w-24 {\n width: 2.4rem\n }\n\n .w-32 {\n width: 3.2rem\n }\n\n .w-40 {\n width: 4rem\n }\n\n .w-44 {\n width: 4.4rem\n }\n\n .w-8 {\n width: .8rem\n }\n\n .w-full {\n width: 100%\n }\n\n .w-max {\n width: max-content\n }\n\n .w-unset {\n width: unset\n }\n\n .before\\\\:h-20:before {\n height: 2rem\n }\n\n .before\\\\:h-full:before {\n height: 100%\n }\n\n .before\\\\:w-20:before {\n width: 2rem\n }\n\n .before\\\\:w-32:before {\n width: 3.2rem\n }\n\n .h-\\\\[--w-modal-height\\\\] {\n height: var(--w-modal-height)\n }\n\n .h-\\\\[14px\\\\] {\n height: 14px\n }\n\n .h-\\\\[16px\\\\] {\n height: 16px\n }\n\n .max-h-\\\\[--w-modal-max-height\\\\] {\n max-height: var(--w-modal-max-height)\n }\n\n .min-h-\\\\[--w-modal-min-height\\\\] {\n min-height: var(--w-modal-min-height)\n }\n\n .min-h-\\\\[32px\\\\] {\n min-height: 32px\n }\n\n .min-h-\\\\[40px\\\\] {\n min-height: 40px\n }\n\n .min-h-\\\\[42\\\\] {\n min-height: 4.2rem\n }\n\n .min-h-\\\\[44px\\\\] {\n min-height: 44px\n }\n\n .min-w-\\\\[32px\\\\] {\n min-width: 32px\n }\n\n .min-w-\\\\[40px\\\\] {\n min-width: 40px\n }\n\n .min-w-\\\\[44px\\\\] {\n min-width: 44px\n }\n\n .w-\\\\[--w-modal-width\\\\] {\n width: var(--w-modal-width)\n }\n\n .w-\\\\[14px\\\\] {\n width: 14px\n }\n\n .w-\\\\[16px\\\\] {\n width: 16px\n }\n\n .space-x-8 > :not([hidden]) ~ :not([hidden]) {\n --w-space-x-reverse: 0;\n margin-left: calc(.8rem * calc(1 - var(--w-space-x-reverse)));\n margin-right: calc(.8rem * var(--w-space-x-reverse))\n }\n\n .space-y-16 > :not([hidden]) ~ :not([hidden]) {\n --w-space-y-reverse: 0;\n margin-top: calc(1.6rem * calc(1 - var(--w-space-y-reverse)));\n margin-bottom: calc(1.6rem * var(--w-space-y-reverse))\n }\n\n .m-0 {\n margin: 0rem\n }\n\n .m-auto {\n margin: auto\n }\n\n .-mx-16 {\n margin-left: -1.6rem;\n margin-right: -1.6rem\n }\n\n .mx-0 {\n margin-left: 0rem;\n margin-right: 0rem\n }\n\n .mx-8 {\n margin-left: .8rem;\n margin-right: .8rem\n }\n\n .mx-auto {\n margin-left: auto;\n margin-right: auto\n }\n\n .-mb-1 {\n margin-bottom: -.1rem\n }\n\n .-ml-8 {\n margin-left: -.8rem\n }\n\n .-mr-1 {\n margin-right: -.1rem\n }\n\n .-mr-8 {\n margin-right: -.8rem\n }\n\n .-mt-2 {\n margin-top: -.2rem\n }\n\n .-mt-4 {\n margin-top: -.4rem\n }\n\n .last-child\\\\:mb-0 > :last-child, .mb-0 {\n margin-bottom: 0rem\n }\n\n .mb-32 {\n margin-bottom: 3.2rem\n }\n\n .ml-8 {\n margin-left: .8rem\n }\n\n .ml-auto {\n margin-left: auto\n }\n\n .mr-8 {\n margin-right: .8rem\n }\n\n .mt-16 {\n margin-top: 1.6rem\n }\n\n .mt-4 {\n margin-top: .4rem\n }\n\n .group:not(:first-child) .group-not-first\\\\:-ml-2 {\n margin-left: -.2rem\n }\n\n .last\\\\:mb-0:last-child {\n margin-bottom: 0rem\n }\n\n .last\\\\:mr-0:last-child {\n margin-right: 0rem\n }\n\n .m-\\\\[8px\\\\] {\n margin: 8px\n }\n\n .p-0 {\n padding: 0rem\n }\n\n .p-16 {\n padding: 1.6rem\n }\n\n .p-4 {\n padding: .4rem\n }\n\n .p-8 {\n padding: .8rem\n }\n\n .px-0 {\n padding-left: 0rem;\n padding-right: 0rem\n }\n\n .px-1 {\n padding-left: .1rem;\n padding-right: .1rem\n }\n\n .px-12 {\n padding-left: 1.2rem;\n padding-right: 1.2rem\n }\n\n .px-14 {\n padding-left: 1.4rem;\n padding-right: 1.4rem\n }\n\n .px-16 {\n padding-left: 1.6rem;\n padding-right: 1.6rem\n }\n\n .px-8 {\n padding-left: .8rem;\n padding-right: .8rem\n }\n\n .py-0 {\n padding-top: 0rem;\n padding-bottom: 0rem\n }\n\n .py-1 {\n padding-top: .1rem;\n padding-bottom: .1rem\n }\n\n .py-10 {\n padding-top: 1rem;\n padding-bottom: 1rem\n }\n\n .py-12 {\n padding-top: 1.2rem;\n padding-bottom: 1.2rem\n }\n\n .py-2 {\n padding-top: .2rem;\n padding-bottom: .2rem\n }\n\n .py-4 {\n padding-top: .4rem;\n padding-bottom: .4rem\n }\n\n .py-6 {\n padding-top: .6rem;\n padding-bottom: .6rem\n }\n\n .py-8 {\n padding-top: .8rem;\n padding-bottom: .8rem\n }\n\n .pb-0 {\n padding-bottom: 0rem\n }\n\n .pb-32 {\n padding-bottom: 3.2rem\n }\n\n .pb-4 {\n padding-bottom: .4rem\n }\n\n .pb-8 {\n padding-bottom: .8rem\n }\n\n .pl-0 {\n padding-left: 0rem\n }\n\n .pl-1 {\n padding-left: .1rem\n }\n\n .pl-12 {\n padding-left: 1.2rem\n }\n\n .pl-28 {\n padding-left: 2.8rem\n }\n\n .pl-4 {\n padding-left: .4rem\n }\n\n .pl-8 {\n padding-left: .8rem\n }\n\n .pr-12 {\n padding-right: 1.2rem\n }\n\n .pr-14 {\n padding-right: 1.4rem\n }\n\n .pr-2 {\n padding-right: .2rem\n }\n\n .pr-32 {\n padding-right: 3.2rem\n }\n\n .pr-40 {\n padding-right: 4rem\n }\n\n .pt-0 {\n padding-top: 0rem\n }\n\n .pt-1 {\n padding-top: .1rem\n }\n\n .pt-16 {\n padding-top: 1.6rem\n }\n\n .pt-24 {\n padding-top: 2.4rem\n }\n\n .pt-8 {\n padding-top: .8rem\n }\n\n .group\\\\/step:last-child .group-last\\\\/step\\\\:last\\\\:pb-0:last-child {\n padding-bottom: 0rem\n }\n\n .last\\\\:pb-1:last-child {\n padding-bottom: .1rem\n }\n\n .last\\\\:pr-1:last-child {\n padding-right: .1rem\n }\n\n .p-\\\\[8px\\\\] {\n padding: 8px\n }\n\n .px-\\\\[15px\\\\] {\n padding-left: 15px;\n padding-right: 15px\n }\n\n .px-\\\\[8px\\\\] {\n padding-left: 8px;\n padding-right: 8px\n }\n\n .py-\\\\[11px\\\\] {\n padding-top: 11px;\n padding-bottom: 11px\n }\n\n .py-\\\\[5px\\\\] {\n padding-top: 5px;\n padding-bottom: 5px\n }\n\n .py-\\\\[7px\\\\] {\n padding-top: 7px;\n padding-bottom: 7px\n }\n\n .pl-\\\\[var\\\\(--w-prefix-width\\\\,_40px\\\\)\\\\] {\n padding-left: var(--w-prefix-width, 40px)\n }\n\n .invisible {\n visibility: hidden\n }\n\n .backface-hidden {\n backface-visibility: hidden\n }\n\n .break-words {\n overflow-wrap: break-word\n }\n\n .before\\\\:content-\\\\[\\\\\"\u00E2\u20AC\u201C\\\\\"\\\\]:before {\n content: \"\u00E2\u20AC\u201C\"\n }\n\n .before\\\\:content-\\\\[\\\\\"\\\\\"\\\\]:before {\n content: \"\"\n }\n\n .cursor-default {\n cursor: default\n }\n\n .cursor-pointer {\n cursor: pointer\n }\n\n .antialiased {\n -webkit-font-smoothing: antialiased;\n -moz-osx-font-smoothing: grayscale;\n font-smoothing: grayscale\n }\n\n .font-bold {\n font-weight: 700\n }\n\n .before\\\\:font-bold:before {\n font-weight: 700\n }\n\n .font-normal {\n font-weight: 400\n }\n\n .pointer-events-auto {\n pointer-events: auto\n }\n\n .pointer-events-none {\n pointer-events: none\n }\n\n .before\\\\:pointer-events-none:before {\n pointer-events: none\n }\n\n .pb-safe-\\\\[32\\\\] {\n padding-bottom: calc(32px + env(safe-area-inset-bottom, 0px))\n }\n\n .sr-only {\n position: absolute;\n width: 1px;\n height: 1px;\n padding: 0;\n margin: -1px;\n overflow: hidden;\n clip: rect(0, 0, 0, 0);\n white-space: nowrap;\n border-width: 0\n }\n\n .touch-pan-y {\n touch-action: pan-y\n }\n\n .select-none {\n -webkit-user-select: none;\n user-select: none\n }\n\n .translate-x-20 {\n --w-translate-x: 2rem;\n transform: translate(var(--w-translate-x)) translateY(var(--w-translate-y)) translateZ(var(--w-translate-z)) rotate(var(--w-rotate)) rotateX(var(--w-rotate-x)) rotateY(var(--w-rotate-y)) rotate(var(--w-rotate-z)) skew(var(--w-skew-x)) skewY(var(--w-skew-y)) scaleX(var(--w-scale-x)) scaleY(var(--w-scale-y)) scaleZ(var(--w-scale-z))\n }\n\n .translate-z-0 {\n --w-translate-z: 0rem;\n transform: translate(var(--w-translate-x)) translateY(var(--w-translate-y)) translateZ(var(--w-translate-z)) rotate(var(--w-rotate)) rotateX(var(--w-rotate-x)) rotateY(var(--w-rotate-y)) rotate(var(--w-rotate-z)) skew(var(--w-skew-x)) skewY(var(--w-skew-y)) scaleX(var(--w-scale-x)) scaleY(var(--w-scale-y)) scaleZ(var(--w-scale-z))\n }\n\n .-rotate-180, .part-\\\\[w-icon-chevron-down-16-part\\\\]\\\\:-rotate-180::part(w-icon-chevron-down-16-part) {\n --w-rotate-x: 0;\n --w-rotate-y: 0;\n --w-rotate-z: 0;\n --w-rotate: -180deg;\n transform: translate(var(--w-translate-x)) translateY(var(--w-translate-y)) translateZ(var(--w-translate-z)) rotate(var(--w-rotate)) rotateX(var(--w-rotate-x)) rotateY(var(--w-rotate-y)) rotate(var(--w-rotate-z)) skew(var(--w-skew-x)) skewY(var(--w-skew-y)) scaleX(var(--w-scale-x)) scaleY(var(--w-scale-y)) scaleZ(var(--w-scale-z))\n }\n\n .part-\\\\[w-icon-chevron-up-16-part\\\\]\\\\:rotate-180::part(w-icon-chevron-up-16-part), .rotate-180 {\n --w-rotate-x: 0;\n --w-rotate-y: 0;\n --w-rotate-z: 0;\n --w-rotate: 180deg;\n transform: translate(var(--w-translate-x)) translateY(var(--w-translate-y)) translateZ(var(--w-translate-z)) rotate(var(--w-rotate)) rotateX(var(--w-rotate-x)) rotateY(var(--w-rotate-y)) rotate(var(--w-rotate-z)) skew(var(--w-skew-x)) skewY(var(--w-skew-y)) scaleX(var(--w-scale-x)) scaleY(var(--w-scale-y)) scaleZ(var(--w-scale-z))\n }\n\n .rotate-90 {\n --w-rotate-x: 0;\n --w-rotate-y: 0;\n --w-rotate-z: 0;\n --w-rotate: 90deg;\n transform: translate(var(--w-translate-x)) translateY(var(--w-translate-y)) translateZ(var(--w-translate-z)) rotate(var(--w-rotate)) rotateX(var(--w-rotate-x)) rotateY(var(--w-rotate-y)) rotate(var(--w-rotate-z)) skew(var(--w-skew-x)) skewY(var(--w-skew-y)) scaleX(var(--w-scale-x)) scaleY(var(--w-scale-y)) scaleZ(var(--w-scale-z))\n }\n\n .part-\\\\[w-icon-chevron-down-16-part\\\\]\\\\:transform::part(w-icon-chevron-down-16-part), .part-\\\\[w-icon-chevron-up-16-part\\\\]\\\\:transform::part(w-icon-chevron-up-16-part), .transform {\n transform: translate(var(--w-translate-x)) translateY(var(--w-translate-y)) translateZ(var(--w-translate-z)) rotate(var(--w-rotate)) rotateX(var(--w-rotate-x)) rotateY(var(--w-rotate-y)) rotate(var(--w-rotate-z)) skew(var(--w-skew-x)) skewY(var(--w-skew-y)) scaleX(var(--w-scale-x)) scaleY(var(--w-scale-y)) scaleZ(var(--w-scale-z))\n }\n\n .part-\\\\[w-icon-chevron-down-16-part\\\\]\\\\:transform-gpu::part(w-icon-chevron-down-16-part), .part-\\\\[w-icon-chevron-up-16-part\\\\]\\\\:transform-gpu::part(w-icon-chevron-up-16-part), .transform-gpu {\n transform: translate3d(var(--w-translate-x), var(--w-translate-y), var(--w-translate-z)) rotate(var(--w-rotate)) rotateX(var(--w-rotate-x)) rotateY(var(--w-rotate-y)) rotate(var(--w-rotate-z)) skew(var(--w-skew-x)) skewY(var(--w-skew-y)) scaleX(var(--w-scale-x)) scaleY(var(--w-scale-y)) scaleZ(var(--w-scale-z))\n }\n\n .part-\\\\[w-icon-chevron-down-16-part\\\\]\\\\:transition-transform::part(w-icon-chevron-down-16-part), .part-\\\\[w-icon-chevron-up-16-part\\\\]\\\\:transition-transform::part(w-icon-chevron-up-16-part), .transition-transform {\n transition-property: transform;\n transition-timing-function: cubic-bezier(.4, 0, .2, 1);\n transition-duration: .15s\n }\n\n .transition-300 {\n transition-property: color, background-color, border-color, text-decoration-color, fill, stroke, opacity, box-shadow, transform, filter, backdrop-filter;\n transition-timing-function: cubic-bezier(.4, 0, .2, 1);\n transition-duration: .3s\n }\n\n .transition-all {\n transition-property: all;\n transition-timing-function: cubic-bezier(.4, 0, .2, 1);\n transition-duration: .15s\n }\n\n .transition-colors {\n transition-property: color, background-color, border-color, text-decoration-color, fill, stroke;\n transition-timing-function: cubic-bezier(.4, 0, .2, 1);\n transition-duration: .15s\n }\n\n .transition-shadow {\n transition-property: box-shadow;\n transition-timing-function: cubic-bezier(.4, 0, .2, 1);\n transition-duration: .15s\n }\n\n .before\\\\:transition-all:before {\n transition-property: all;\n transition-timing-function: cubic-bezier(.4, 0, .2, 1);\n transition-duration: .15s\n }\n\n .duration-300 {\n transition-duration: .3s\n }\n\n .ease-in-out, .part-\\\\[w-icon-chevron-down-16-part\\\\]\\\\:ease-in-out::part(w-icon-chevron-down-16-part), .part-\\\\[w-icon-chevron-up-16-part\\\\]\\\\:ease-in-out::part(w-icon-chevron-up-16-part) {\n transition-timing-function: cubic-bezier(.4, 0, .2, 1)\n }\n\n .text-m {\n font-size: var(--w-font-size-m);\n line-height: var(--w-line-height-m)\n }\n\n .text-s {\n font-size: var(--w-font-size-s);\n line-height: var(--w-line-height-s)\n }\n\n .text-xs {\n font-size: var(--w-font-size-xs);\n line-height: var(--w-line-height-xs)\n }\n\n .leading-m {\n line-height: var(--w-line-height-m)\n }\n\n .before\\\\:leading-xs:before {\n line-height: var(--w-line-height-xs)\n }\n\n .leading-\\\\[24\\\\] {\n line-height: 2.4rem\n }\n\n @media (max-width: 479.9px) {\n .lt-sm\\\\:rounded-b-0 {\n border-bottom-left-radius: 0;\n border-bottom-right-radius: 0\n }\n }\n @media (min-width: 480px) {\n .sm\\\\:border-b-0 {\n border-bottom-width: 0\n }\n\n .sm\\\\:rounded-8 {\n border-radius: 8px\n }\n\n .sm\\\\:rounded-b-8 {\n border-bottom-left-radius: 8px;\n border-bottom-right-radius: 8px\n }\n\n .sm\\\\:gap-16 {\n gap: 1.6rem\n }\n\n .sm\\\\:place-content-center {\n place-content: center\n }\n\n .sm\\\\:place-items-center {\n place-items: center\n }\n\n .sm\\\\:h-24 {\n height: 2.4rem\n }\n\n .sm\\\\:min-h-48 {\n min-height: 4.8rem\n }\n\n .sm\\\\:w-24 {\n width: 2.4rem\n }\n\n .sm\\\\:min-h-\\\\[32px\\\\] {\n min-height: 32px\n }\n\n .sm\\\\:min-h-\\\\[44px\\\\] {\n min-height: 44px\n }\n\n .sm\\\\:min-h-\\\\[45\\\\] {\n min-height: 4.5rem\n }\n\n .sm\\\\:min-w-\\\\[32px\\\\] {\n min-width: 32px\n }\n\n .sm\\\\:min-w-\\\\[44px\\\\] {\n min-width: 44px\n }\n\n .sm\\\\:mx-0 {\n margin-left: 0rem;\n margin-right: 0rem\n }\n\n .sm\\\\:mx-16 {\n margin-left: 1.6rem;\n margin-right: 1.6rem\n }\n\n .sm\\\\:-ml-12 {\n margin-left: -1.2rem\n }\n\n .sm\\\\:-mr-12 {\n margin-right: -1.2rem\n }\n\n .sm\\\\:-mt-8 {\n margin-top: -.8rem\n }\n\n .sm\\\\:px-32 {\n padding-left: 3.2rem;\n padding-right: 3.2rem\n }\n\n .sm\\\\:py-0 {\n padding-top: 0rem;\n padding-bottom: 0rem\n }\n\n .sm\\\\:pb-32 {\n padding-bottom: 3.2rem\n }\n\n .sm\\\\:pt-24 {\n padding-top: 2.4rem\n }\n\n .sm\\\\:pt-32 {\n padding-top: 3.2rem\n }\n }\n @media (min-width: 768px) {\n .md\\\\:block {\n display: block\n }\n\n .md\\\\:hidden {\n display: none\n }\n }\n `;\n", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"breadcrumbs.ariaLabel\\\":[\\\"Du er her\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"breadcrumbs.ariaLabel\\\":[\\\"You are here\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"breadcrumbs.ariaLabel\\\":[\\\"Olet t\u00E4ss\u00E4\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"breadcrumbs.ariaLabel\\\":[\\\"Her er du\\\"]}\");", "/*eslint-disable*/export const messages=JSON.parse(\"{\\\"breadcrumbs.ariaLabel\\\":[\\\"Du \u00E4r h\u00E4r\\\"]}\");", "import { css } from 'lit'; export const styles = css`*,:before,:after{--w-rotate:0;--w-rotate-x:0;--w-rotate-y:0;--w-rotate-z:0;--w-scale-x:1;--w-scale-y:1;--w-scale-z:1;--w-skew-x:0;--w-skew-y:0;--w-translate-x:0;--w-translate-y:0;--w-translate-z:0}.flex{display:flex}.static{position:static}.s-text{color:var(--w-s-color-text)}.s-text-link{color:var(--w-s-color-text-link)}.s-icon{color:var(--w-s-color-icon)}.space-x-8>:not([hidden])~:not([hidden]){--w-space-x-reverse:0;margin-left:calc(.8rem*calc(1 - var(--w-space-x-reverse)));margin-right:calc(.8rem*var(--w-space-x-reverse))}.sr-only{clip:rect(0,0,0,0);white-space:nowrap;border-width:0;width:1px;height:1px;margin:-1px;padding:0;position:absolute;overflow:hidden}.select-none{-webkit-user-select:none;user-select:none}`;\n"],
5
5
  "mappings": "0pBAAA,IAAAA,EAAAC,EAAAC,GAAA,cAGA,OAAO,eAAeA,EAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5DA,EAAQ,cAAgBA,EAAQ,UAAY,OAO5C,IAAIC,GACH,SAAUA,EAAW,CAMlBA,EAAU,iBAAsB,oBAMhCA,EAAU,qBAA0B,wBAMpCA,EAAU,eAAoB,mBAK9BA,EAAU,iBAAsB,oBAKhCA,EAAU,YAAiB,eAC/B,GAAGA,EAAYD,EAAQ,YAAcA,EAAQ,UAAY,CAAC,EAAE,EAE5DA,EAAQ,cAAgB,IAAI,IAAI,CAC5B,CAACC,EAAU,iBAAkB,6CAA6C,EAC1E,CACIA,EAAU,qBACV,iDACJ,EACA,CACIA,EAAU,eACV,wEACJ,EACA,CACIA,EAAU,iBACV,uHAEJ,EACA,CAACA,EAAU,YAAa,4CAA4C,CACxE,CAAC,IC3DD,IAAAC,EAAAC,EAAAC,GAAA,cACA,OAAO,eAAeA,EAAS,aAAc,CAAE,MAAO,EAAK,CAAC,EAC5DA,EAAQ,MAAQA,EAAQ,cAAgBA,EAAQ,UAAY,OAC5D,IAAMC,EAAW,IACjB,OAAO,eAAeD,EAAS,YAAa,CAAE,WAAY,GAAM,IAAK,UAAY,CAAE,OAAOC,EAAS,SAAW,CAAE,CAAC,EACjH,OAAO,eAAeD,EAAS,gBAAiB,CAAE,WAAY,GAAM,IAAK,UAAY,CAAE,OAAOC,EAAS,aAAe,CAAE,CAAC,EASzH,SAASC,GAAcC,EAAK,CAExB,MADuB,CAACA,EAAI,MAAM,YAAY,EACtB,SAASA,EAAK,EAAE,EAAI,GAChD,CAYA,SAASC,EAAoBD,EAAKE,EAAWC,EAAgB,CACzD,IAAMC,EAAYL,GAAcC,CAAG,EACnC,GAAI,OAAO,MAAMI,CAAS,GACrBD,IAAmB,QAAaA,IAAmBH,EAAI,OACxD,MAAM,IAAI,YAAYF,EAAS,cAAc,IAAII,CAAS,CAAC,EAE/D,OAAOE,CACX,CASA,SAASC,GAAqBC,EAAM,CAChC,IAAMC,EAAaN,EAAoBK,EAAMR,EAAS,UAAU,qBAAsB,CAAC,EACvF,OAAO,OAAO,aAAaS,CAAU,CACzC,CAWA,SAASC,EAAiBF,EAAMG,EAAe,CAC3C,IAAMF,EAAaN,EAAoBK,EAAMR,EAAS,UAAU,iBAAkB,CAAC,EACnF,GAAIW,IAAkB,OAAW,CAC7B,IAAMC,EAAsBT,EAAoBQ,EAAeX,EAAS,UAAU,iBAAkB,CAAC,EACrG,OAAO,OAAO,aAAaS,EAAYG,CAAmB,CAC9D,CACA,OAAO,OAAO,aAAaH,CAAU,CACzC,CAMA,SAASI,GAAcC,EAAM,CACzB,OAAOA,EAAK,OAAO,CAAC,IAAM,KAAOA,EAAK,OAAOA,EAAK,OAAS,CAAC,IAAM,GACtE,CASA,SAASC,GAA0BC,EAAW,CAC1C,GAAI,CAACH,GAAcG,CAAS,EACxB,MAAM,IAAI,YAAYhB,EAAS,cAAc,IAAIA,EAAS,UAAU,gBAAgB,CAAC,EAEzF,IAAMiB,EAAgBD,EAAU,MAAM,EAAG,EAAE,EACrCP,EAAaN,EAAoBc,EAAejB,EAAS,UAAU,gBAAgB,EACzF,GAAI,CACA,OAAO,OAAO,cAAcS,CAAU,CAC1C,OACOS,EAAK,CACR,MAAMA,aAAe,WACf,IAAI,YAAYlB,EAAS,cAAc,IAAIA,EAAS,UAAU,cAAc,CAAC,EAC7EkB,CACV,CACJ,CAGA,SAASC,GAAeX,EAAMY,EAAQ,GAAO,CACzC,GAAIA,EACA,MAAM,IAAI,YAAYpB,EAAS,cAAc,IAAIA,EAAS,UAAU,gBAAgB,CAAC,EAIzF,IAAMS,EAAa,SAASD,EAAM,CAAC,EACnC,OAAO,OAAO,aAAaC,CAAU,CACzC,CAKA,IAAMY,GAAyB,IAAI,IAAI,CACnC,CAAC,IAAK,IAAI,EACV,CAAC,IAAK,IAAI,EACV,CAAC,IAAK;AAAA,CAAI,EACV,CAAC,IAAK,IAAI,EACV,CAAC,IAAK,GAAI,EACV,CAAC,IAAK,IAAI,EACV,CAAC,IAAK,IAAI,CACd,CAAC,EAMD,SAASC,GAAyBd,EAAM,CACpC,OAAOa,GAAuB,IAAIb,CAAI,GAAKA,CAC/C,CAiBA,IAAMe,GAAc,yHAUpB,SAASC,EAAMC,EAAKC,EAAc,GAAO,CACrC,OAAOD,EAAI,QAAQF,GAAa,SAAUI,EAAGC,EAAW1B,EAAKc,EAAWa,EAAsBC,EAAWC,EAASC,EAAOC,EAAiB,CAGtI,GAAIL,IAAc,OACd,MAAO,KAEX,GAAI1B,IAAQ,OACR,OAAOK,GAAqBL,CAAG,EAEnC,GAAIc,IAAc,OACd,OAAOD,GAA0BC,CAAS,EAE9C,GAAIa,IAAyB,OACzB,OAAOnB,EAAiBmB,EAAsBC,CAAS,EAE3D,GAAIC,IAAY,OACZ,OAAOrB,EAAiBqB,CAAO,EAEnC,GAAIC,IAAU,IACV,MAAO,KAEX,GAAIA,IAAU,OACV,OAAOb,GAAea,EAAO,CAACN,CAAW,EAE7C,GAAIO,IAAoB,OACpB,OAAOX,GAAyBW,CAAe,EAEnD,MAAM,IAAI,YAAYjC,EAAS,cAAc,IAAIA,EAAS,UAAU,WAAW,CAAC,CACpF,CAAC,CACL,CACAD,EAAQ,MAAQyB,EAChBzB,EAAQ,QAAUyB,IC1LlB,OAAS,QAAAU,EAAM,cAAAC,OAAkC,MCFjD,IAAAC,EAAsB,UAGtB,IAAMC,EAAYC,GAAM,OAAOA,GAAM,SAC/BC,GAAcC,GAAM,OAAOA,GAAM,WAEjCC,EAAwB,IAAI,IAC5BC,EAAgB,KACtB,SAASC,EAAiBC,EAAS,CAEjC,MAAO,CAAC,GADI,MAAM,QAAQA,CAAO,EAAIA,EAAU,CAACA,CAAO,EACvCF,CAAa,CAC/B,CACA,SAASG,EAAKD,EAASE,EAAOC,EAAQ,CACpC,IAAMC,EAAWL,EAAiBC,CAAO,EACpCG,IACHA,EAAS,WAEX,IAAIE,EACJ,GAAI,OAAOF,GAAW,SAMpB,OALAE,EAAI,CACF,IAAK,UACL,MAAO,QACP,KAAM,SACR,EACQF,EAAQ,CACd,IAAK,OACHE,EAAE,QAAU,OACd,IAAK,OACHA,EAAE,MAAQ,OACV,MACF,IAAK,QACHA,EAAE,MAAQ,UACV,KACJ,MAEAA,EAAIF,EAMN,OAJkBG,EAChB,IAAMC,EAAS,OAAQH,EAAUD,CAAM,EACvC,IAAM,IAAI,KAAK,eAAeC,EAAUC,CAAC,CAC3C,EACiB,OAAOZ,EAASS,CAAK,EAAI,IAAI,KAAKA,CAAK,EAAIA,CAAK,CACnE,CACA,SAASM,GAAKR,EAASE,EAAOC,EAAQ,CACpC,IAAIE,EAIJ,GAHKF,IACHA,EAAS,WAEP,OAAOA,GAAW,SAMpB,OALAE,EAAI,CACF,OAAQ,UACR,OAAQ,UACR,KAAM,SACR,EACQF,EAAQ,CACd,IAAK,OACL,IAAK,OACHE,EAAE,aAAe,QACjB,MACF,IAAK,QACH,OAAOA,EAAE,MACb,MAEAA,EAAIF,EAEN,OAAOF,EAAKD,EAASE,EAAOG,CAAC,CAC/B,CACA,SAASI,EAAOT,EAASE,EAAOC,EAAQ,CACtC,IAAMC,EAAWL,EAAiBC,CAAO,EAKzC,OAJkBM,EAChB,IAAMC,EAAS,SAAUH,EAAUD,CAAM,EACzC,IAAM,IAAI,KAAK,aAAaC,EAAUD,CAAM,CAC9C,EACiB,OAAOD,CAAK,CAC/B,CACA,SAASQ,EAAOV,EAASW,EAAST,EAAO,CAAE,OAAAU,EAAS,EAAG,GAAGC,CAAM,EAAG,CA3EnE,IAAAC,EAAAC,EA4EE,IAAMX,EAAWL,EAAiBC,CAAO,EACnCgB,EAAUL,EAAUL,EACxB,IAAMC,EAAS,iBAAkBH,CAAQ,EACzC,IAAM,IAAI,KAAK,YAAYA,EAAU,CAAE,KAAM,SAAU,CAAC,CAC1D,EAAIE,EACF,IAAMC,EAAS,kBAAmBH,CAAQ,EAC1C,IAAM,IAAI,KAAK,YAAYA,EAAU,CAAE,KAAM,UAAW,CAAC,CAC3D,EACA,OAAOW,GAAAD,EAAAD,EAAMX,CAAK,IAAX,KAAAY,EAAgBD,EAAMG,EAAQ,OAAOd,EAAQU,CAAM,CAAC,IAApD,KAAAG,EAAyDF,EAAM,KACxE,CACA,SAASP,EAAYW,EAAQC,EAAW,CACtC,IAAMC,EAAMF,EAAO,EACfG,EAAYvB,EAAM,IAAIsB,CAAG,EAC7B,OAAKC,IACHA,EAAYF,EAAU,EACtBrB,EAAM,IAAIsB,EAAKC,CAAS,GAEnBA,CACT,CACA,SAASb,EAASc,EAAMrB,EAASsB,EAAS,CACxC,IAAMC,EAAYvB,EAAQ,KAAK,GAAG,EAClC,MAAO,GAAGqB,CAAI,IAAIE,CAAS,IAAI,KAAK,UAAUD,CAAO,CAAC,EACxD,CAWA,IAAME,EAAgB,sCAChBC,EAAgB,0BAChBC,GAAoB,CAACC,EAAQC,EAAeC,EAAU,CAAC,IAAM,CACjE,IAAMC,EAAUF,GAAiBD,EAC3BI,EAASC,GACT,OAAOA,GAAW,SACbA,EACFH,EAAQG,CAAM,EAEjBC,EAAoB,CAACC,EAAOC,IAAY,CAC5C,IAAMC,EAAe,OAAO,KAAKP,CAAO,EAAE,OAASE,EAAM,QAAQ,EAAI,OAC/DM,EAAWC,EAAOR,EAASI,EAAOE,CAAY,EACpD,OAAOD,EAAQ,QAAQ,IAAI,OAAOV,EAAe,GAAG,EAAGY,CAAQ,CACjE,EACA,MAAO,CACL,OAAQ,CAACH,EAAOK,IAAU,CACxB,GAAM,CAAE,OAAAC,EAAS,CAAE,EAAID,EACjBJ,EAAUM,EAAOX,EAAS,GAAOI,EAAOK,CAAK,EACnD,OAAON,EAAkBC,EAAQM,EAAQL,CAAO,CAClD,EACA,cAAe,CAACD,EAAOK,IAAU,CAC/B,GAAM,CAAE,OAAAC,EAAS,CAAE,EAAID,EACjBJ,EAAUM,EAAOX,EAAS,GAAMI,EAAOK,CAAK,EAClD,OAAON,EAAkBC,EAAQM,EAAQL,CAAO,CAClD,EACA,OAAQO,GACR,OAAQ,CAACR,EAAOF,IAAWM,EACzBR,EACAI,EACAH,EAAMC,CAAM,GAAK,CAAE,MAAOA,CAAO,CACnC,EACA,KAAM,CAACE,EAAOF,IAAWW,EAAKb,EAASI,EAAOH,EAAMC,CAAM,GAAKA,CAAM,EACrE,KAAM,CAACE,EAAOF,IAAWY,GAAKd,EAASI,EAAOH,EAAMC,CAAM,GAAKA,CAAM,CACvE,CACF,EACMU,GAAkB,CAACR,EAAOW,IAAO,CAhJvC,IAAAC,EAgJ0C,OAAAA,EAAAD,EAAMX,CAAK,IAAX,KAAAY,EAAgBD,EAAM,OAChE,SAASE,GAAYC,EAAarB,EAAQG,EAAS,CACjD,MAAO,CAACmB,EAAS,CAAC,EAAGpB,IAAY,CAC/B,IAAMqB,EAAaxB,GAAkBC,EAAQG,EAASD,CAAO,EACvDsB,EAAgB,CAACC,EAAQnB,EAAoB,KAC5C,MAAM,QAAQmB,CAAM,EAElBA,EAAO,OAAO,CAACjB,EAASkB,IAAU,CACvC,GAAIA,IAAU,KAAOpB,EACnB,OAAOE,EAAUV,EAEnB,GAAI6B,EAASD,CAAK,EAChB,OAAOlB,EAAUkB,EAEnB,GAAM,CAACE,EAAMC,EAAMxB,CAAM,EAAIqB,EACzBI,EAAqB,CAAC,EACtBD,IAAS,UAAYA,IAAS,iBAAmBA,IAAS,SAC5D,OAAO,QAAQxB,CAAM,EAAE,QACrB,CAAC,CAAC0B,EAAKC,EAAM,IAAM,CACjBF,EAAmBC,CAAG,EAAIP,EACxBQ,GACAH,IAAS,UAAYA,IAAS,eAChC,CACF,CACF,EAEAC,EAAqBzB,EAEvB,IAAIE,EACJ,GAAIsB,EAAM,CACR,IAAMI,EAAYV,EAAWM,CAAI,EACjCtB,EAAQ0B,EAAUX,EAAOM,CAAI,EAAGE,CAAkB,CACpD,MACEvB,EAAQe,EAAOM,CAAI,EAErB,OAAIrB,GAAS,KACJC,EAEFA,EAAUD,CACnB,EAAG,EAAE,EAjCIkB,EAmCLS,EAASV,EAAcH,CAAW,EACxC,OAAIM,EAASO,CAAM,GAAKrC,EAAc,KAAKqC,CAAM,KACxC,SAAMA,CAAM,EAEjBP,EAASO,CAAM,EACVA,EACFA,EAAS,OAAOA,CAAM,EAAI,EACnC,CACF,CAEA,IAAIC,GAAc,OAAO,eACrBC,GAAoB,CAACC,EAAKN,EAAKxB,IAAUwB,KAAOM,EAAMF,GAAYE,EAAKN,EAAK,CAAE,WAAY,GAAM,aAAc,GAAM,SAAU,GAAM,MAAAxB,CAAM,CAAC,EAAI8B,EAAIN,CAAG,EAAIxB,EAC1J+B,GAAkB,CAACD,EAAKN,EAAKxB,KAC/B6B,GAAkBC,EAAK,OAAON,GAAQ,SAAWA,EAAM,GAAKA,EAAKxB,CAAK,EAC/DA,GAEHgC,EAAN,KAAmB,CACjB,aAAc,CACZD,GAAgB,KAAM,UAAW,CAAC,CAAC,CACrC,CACA,GAAGE,EAAOC,EAAU,CA7MtB,IAAAtB,EA8MI,IAAIA,EACJ,OAACA,KAAK,KAAK,SAASqB,CAAK,IAAxB,OAA8BrB,EAAGqB,CAAK,EAAI,CAAC,GAC5C,KAAK,QAAQA,CAAK,EAAE,KAAKC,CAAQ,EAC1B,IAAM,KAAK,eAAeD,EAAOC,CAAQ,CAClD,CACA,eAAeD,EAAOC,EAAU,CAC9B,IAAMC,EAAiB,KAAK,cAAcF,CAAK,EAC/C,GAAI,CAACE,EACH,OACF,IAAMC,EAAQD,EAAe,QAAQD,CAAQ,EACzC,CAACE,GACHD,EAAe,OAAOC,EAAO,CAAC,CAClC,CACA,KAAKH,KAAUI,EAAM,CACnB,IAAMF,EAAiB,KAAK,cAAcF,CAAK,EAC1CE,GAELA,EAAe,IAAKD,GAAaA,EAAS,MAAM,KAAMG,CAAI,CAAC,CAC7D,CACA,cAAcJ,EAAO,CACnB,IAAME,EAAiB,KAAK,QAAQF,CAAK,EACzC,OAAO,MAAM,QAAQE,CAAc,EAAIA,EAAiB,EAC1D,CACF,EAEIG,GAAY,OAAO,eACnBC,GAAkB,CAACT,EAAKN,EAAKxB,IAAUwB,KAAOM,EAAMQ,GAAUR,EAAKN,EAAK,CAAE,WAAY,GAAM,aAAc,GAAM,SAAU,GAAM,MAAAxB,CAAM,CAAC,EAAI8B,EAAIN,CAAG,EAAIxB,EACtJwC,EAAgB,CAACV,EAAKN,EAAKxB,KAC7BuC,GAAgBT,EAAK,OAAON,GAAQ,SAAWA,EAAM,GAAKA,EAAKxB,CAAK,EAC7DA,GAEHyC,EAAN,cAAmBT,CAAa,CAC9B,YAAYU,EAAQ,CA9OtB,IAAA9B,EA+OI,MAAM,EACN4B,EAAc,KAAM,UAAW,EAAE,EACjCA,EAAc,KAAM,UAAU,EAC9BA,EAAc,KAAM,cAAe,CAAC,CAAC,EACrCA,EAAc,KAAM,YAAa,CAAC,CAAC,EACnCA,EAAc,KAAM,UAAU,EAC9BA,EAAc,KAAM,kBAAkB,EAItCA,EAAc,KAAM,IAAK,KAAK,EAAE,KAAK,IAAI,CAAC,EAItCE,EAAO,SAAW,OACpB,KAAK,SAAWA,EAAO,SACrBA,EAAO,UAAY,MACrB,KAAK,KAAKA,EAAO,QAAQ,EACvBA,EAAO,YAAc,MACvB,KAAK,eAAeA,EAAO,UAAU,GACnC,OAAOA,EAAO,QAAW,UAAYA,EAAO,UAC9C,KAAK,UAAS9B,EAAA8B,EAAO,SAAP,KAAA9B,EAAiB+B,EAAeD,EAAO,OAAO,CAEhE,CACA,IAAI,QAAS,CACX,OAAO,KAAK,OACd,CACA,IAAI,SAAU,CACZ,OAAO,KAAK,QACd,CACA,IAAI,UAAW,CA7QjB,IAAA9B,EA8QI,OAAOA,EAAA,KAAK,UAAU,KAAK,OAAO,IAA3B,KAAAA,EAAgC,CAAC,CAC1C,CAIA,IAAI,YAAa,CAnRnB,IAAAA,EAoRI,OAAOA,EAAA,KAAK,YAAY,KAAK,OAAO,IAA7B,KAAAA,EAAkC,CAAC,CAC5C,CACA,gBAAgBnB,EAAQmD,EAAY,CAClC,IAAMC,EAAkB,KAAK,YAAYpD,CAAM,EAC1CoD,EAGH,OAAO,OAAOA,EAAiBD,CAAU,EAFzC,KAAK,YAAYnD,CAAM,EAAImD,CAI/B,CAgBA,oBAAoBE,EAAU,CAC5B,YAAK,iBAAmBA,EACjB,IACT,CAIA,eAAeC,EAAiBH,EAAY,CACtC,OAAOG,GAAoB,SAC7B,KAAK,gBAAgBA,EAAiBH,CAAU,EAEhD,OAAO,KAAKG,CAAe,EAAE,QAC1BtD,GAAW,KAAK,gBAAgBA,EAAQsD,EAAgBtD,CAAM,CAAC,CAClE,EAEF,KAAK,KAAK,QAAQ,CACpB,CACA,MAAMA,EAAQuD,EAAU,CACtB,IAAMC,EAAgB,KAAK,UAAUxD,CAAM,EACtCwD,EAGH,OAAO,OAAOA,EAAeD,CAAQ,EAFrC,KAAK,UAAUvD,CAAM,EAAIuD,CAI7B,CACA,KAAKE,EAAkBF,EAAU,CAC3B,OAAOE,GAAoB,UAAY,OAAOF,GAAa,SAC7D,KAAK,MAAME,EAAkBF,CAAQ,EAErC,OAAO,QAAQE,CAAgB,EAAE,QAC/B,CAAC,CAACzD,EAAQ0D,CAAS,IAAM,KAAK,MAAM1D,EAAQ0D,CAAS,CACvD,EAEF,KAAK,KAAK,QAAQ,CACpB,CAIA,gBAAgB,CAAE,OAAA1D,EAAQ,QAAAG,EAAS,SAAAoD,CAAS,EAAG,CAC7C,KAAK,QAAUvD,EACf,KAAK,SAAWG,GAAW,OAC3B,KAAK,UAAU,KAAK,OAAO,EAAIoD,EAC/B,KAAK,KAAK,QAAQ,CACpB,CACA,SAASvD,EAAQG,EAAS,CAMxB,KAAK,QAAUH,EACf,KAAK,SAAWG,EAChB,KAAK,KAAK,QAAQ,CACpB,CACA,EAAEwD,EAAIrC,EAAQsC,EAAS,CACrB,GAAI,CAAC,KAAK,OACR,MAAM,IAAI,MACR,uOACF,EAEF,IAAIpD,EAAUoD,GAAA,YAAAA,EAAS,QAClBD,IACHA,EAAK,IAEFhC,EAASgC,CAAE,IACdrC,EAASqC,EAAG,QAAUrC,EACtBd,EAAUmD,EAAG,QACbA,EAAKA,EAAG,IAEV,IAAME,EAAe,KAAK,SAASF,CAAE,EAC/BG,EAAiBD,IAAiB,OAClCE,EAAU,KAAK,SACrB,GAAIA,GAAWD,EACb,OAAOE,GAAWD,CAAO,EAAIA,EAAQ,KAAK,QAASJ,CAAE,EAAII,EAEvDD,GACF,KAAK,KAAK,UAAW,CAAE,GAAAH,EAAI,OAAQ,KAAK,OAAQ,CAAC,EAEnD,IAAItC,EAAcwC,GAAgBrD,GAAWmD,EAgB7C,OAfIhC,EAASN,CAAW,IAClB,KAAK,iBACPA,EAAc,KAAK,iBAAiBA,CAAW,EAE/C,QAAQ,KAAK;AAAA;AAAA,IAEjBA,CAAW;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,CAMd,GAGOM,EAASN,CAAW,GAAKxB,EAAc,KAAKwB,CAAW,EAClD,KAAK,MAAM,IAAIA,CAAW,GAAG,EAClCM,EAASN,CAAW,EACfA,EACFD,GACLC,EACA,KAAK,QACL,KAAK,QACP,EAAEC,EAAQsC,GAAA,YAAAA,EAAS,OAAO,CAC5B,CACA,KAAKrD,EAAOF,EAAQ,CAClB,OAAOW,EAAK,KAAK,UAAY,KAAK,QAAST,EAAOF,CAAM,CAC1D,CACA,OAAOE,EAAOF,EAAQ,CACpB,OAAOM,EAAO,KAAK,UAAY,KAAK,QAASJ,EAAOF,CAAM,CAC5D,CACF,EACA,SAAS4D,GAAUhB,EAAS,CAAC,EAAG,CAC9B,OAAO,IAAID,EAAKC,CAAM,CACxB,CAEA,IAAMiB,EAAOD,GAAU,EC1ZhB,SAASE,EAAWC,EAAOC,EAAW,CACzC,OAAOD,EAAM,QAASE,GAAO,CAACA,EAAID,CAAS,CAAC,EAAE,MAAM,EAAG,EAAE,CAC7D,CFFA,OAAS,YAAAE,OAAgB,oBGJlB,IAAMC,GAAmB,CAAC,KAAM,KAAM,KAAM,KAAM,IAAI,EAGhDC,EAAgB,KAEhBC,EAAsBC,GAC1BH,GAAiB,KAAMI,GAAWD,IAAeC,GAAUD,EAAW,YAAY,EAAE,SAASC,CAAM,CAAC,GAAKH,EAG3G,SAASI,IAAgC,CAC9C,GAAI,OAAO,QAAW,YAAa,CAIjC,IAAMC,EAAe,QAAQ,IAAI,cAAgB,KAAK,eAAe,EAAE,gBAAgB,EAAE,OACzF,OAAOJ,EAAmBI,CAAY,CACxC,CAEA,GAAI,CAIF,IAAMC,EAAa,SAAS,gBAAgB,KAC5C,OAAOL,EAAmBK,CAAU,CACtC,OAASC,EAAG,CACV,eAAQ,KAAK,yDAA0DA,CAAC,EACjEP,CACT,CACF,CAEO,IAAMQ,GAAc,CACzBL,EACAM,EACAC,EACAC,EACAC,EACAC,IAEIV,IAAW,KAAaO,EACxBP,IAAW,KAAaQ,EACxBR,IAAW,KAAaS,EACxBT,IAAW,KAAaU,EAErBJ,EAGIK,EAAe,CAC1BC,EACAC,EACAC,EACAC,EACAC,IACG,CACH,IAAMhB,EAASC,GAAa,EACtBgB,EAAWZ,GAAYL,EAAQY,EAAYC,EAAYC,EAAYC,EAAYC,CAAU,EAC/FE,EAAK,KAAKlB,EAAQiB,CAAQ,EAC1BC,EAAK,SAASlB,CAAM,CACtB,EC3DA,OAAS,OAAAmB,OAAW,MAEb,IAAMC,GAAQD;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,EAkRRE,GAAaF;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;UCpRD,IAAMG,GAAS,KAAK,MAAM,yCAA6C,ECAvE,IAAMC,GAAS,KAAK,MAAM,4CAAgD,ECA1E,IAAMC,GAAS,KAAK,MAAM,gDAA8C,ECAxE,IAAMC,GAAS,KAAK,MAAM,yCAA6C,ECAvE,IAAMC,GAAS,KAAK,MAAM,+CAA6C,ECAhG,OAAS,OAAAC,OAAW,MAAc,IAAMC,GAASD,ytBVkB1C,IAAME,EAAgB,CAC3B,QAAS,iBACT,KAAM,SACN,KAAM,cACN,UAAW,qBACX,KAAM,SACR,EAEMC,GAAYC,gBAAmBF,EAAc,SAAS,YAOtDG,EAAN,cAA8BC,EAAW,CAMvC,aAAc,CACZ,MAAM,EACNC,EAAaC,GAAYA,GAAYA,GAAYA,GAAYA,EAAU,EAEvE,KAAK,UAAYC,EAAK,EAAE,CACtB,GAAI,wBACJ,QAAS,eACT,QAAS,4DACX,CAAC,CACH,CAKA,mBAAoB,CAClB,MAAM,kBAAkB,EAKxB,IAAMC,EAHoB,MAAM,KAAK,KAAK,QAAQ,EAC/C,KAAK,GAAQ,EACb,OAAQC,GAAUA,CAAK,EACe,IAAI,CAACA,EAAOC,IAAU,CAC7D,GAAI,OAAOD,GAAU,SAAU,CAC7B,IAAME,EAAWD,IAAU,KAAK,SAAS,OAAS,EAClD,OAAOR,gBAAmBF,EAAc,IAAI,iBAAiBW,EAAW,OAAS,MAAS,IAAIF,CAAK,SACrG,CACA,OAAAA,EAAM,UAAU,IAAIA,EAAM,UAAY,IAAMT,EAAc,KAAOA,EAAc,IAAI,EAC5ES,CACT,CAAC,EAGD,KAAK,UAAYG,EAAWJ,EAAgBP,EAAS,CACvD,CAEA,QAAS,CACP,OAAOC;AAAA;AAAA,yCAE8BF,EAAc,IAAI,IAAI,KAAK,SAAS;AAAA,qBACxDA,EAAc,OAAO,IAAI,KAAK,SAAS;AAAA;AAAA,KAG1D,CACF,EA/CMG,EAIG,OAAS,CAACU,GAAOC,EAAM,EAF9BC,EAAA,CADCC,GAAS,CAAE,UAAW,aAAc,KAAM,MAAO,CAAC,GAD/Cb,EAEJ,yBA+CG,eAAe,IAAI,eAAe,GACrC,eAAe,OAAO,gBAAiBA,CAAe",
6
6
  "names": ["require_errors", "__commonJSMin", "exports", "ErrorType", "require_dist", "__commonJSMin", "exports", "errors_1", "parseHexToInt", "hex", "validateAndParseHex", "errorName", "enforcedLength", "parsedHex", "parseHexadecimalCode", "code", "parsedCode", "parseUnicodeCode", "surrogateCode", "parsedSurrogateCode", "isCurlyBraced", "text", "parseUnicodeCodePointCode", "codePoint", "withoutBraces", "err", "parseOctalCode", "error", "singleCharacterEscapes", "parseSingleCharacterCode", "escapeMatch", "unraw", "raw", "allowOctals", "_", "backslash", "unicodeWithSurrogate", "surrogate", "unicode", "octal", "singleCharacter", "html", "LitElement", "import_unraw", "isString", "s", "isFunction", "f", "cache", "defaultLocale", "normalizeLocales", "locales", "date", "value", "format", "_locales", "o", "getMemoized", "cacheKey", "time", "number", "plural", "ordinal", "offset", "rules", "_a", "_b", "plurals", "getKey", "construct", "key", "formatter", "type", "options", "localeKey", "UNICODE_REGEX", "OCTOTHORPE_PH", "getDefaultFormats", "locale", "passedLocales", "formats", "locales", "style", "format", "replaceOctothorpe", "value", "message", "numberFormat", "valueStr", "number", "cases", "offset", "plural", "selectFormatter", "date", "time", "rules", "_a", "interpolate", "translation", "values", "formatters", "formatMessage", "tokens", "token", "isString", "name", "type", "interpolatedFormat", "key", "value2", "formatter", "result", "__defProp$1", "__defNormalProp$1", "obj", "__publicField$1", "EventEmitter", "event", "listener", "maybeListeners", "index", "args", "__defProp", "__defNormalProp", "__publicField", "I18n", "params", "defaultLocale", "localeData", "maybeLocaleData", "compiler", "localeOrAllData", "messages", "maybeMessages", "localeOrMessages", "messages2", "id", "options", "messageForId", "messageMissing", "missing", "isFunction", "setupI18n", "i18n", "interleave", "array", "separator", "el", "property", "supportedLocales", "defaultLocale", "getSupportedLocale", "usedLocale", "locale", "detectLocale", "serverLocale", "htmlLocale", "e", "getMessages", "enMsg", "nbMsg", "fiMsg", "daMsg", "svMsg", "activateI18n", "enMessages", "nbMessages", "fiMessages", "daMessages", "svMessages", "messages", "i18n", "css", "reset", "components", "messages", "messages", "messages", "messages", "messages", "css", "styles", "ccBreadcrumbs", "separator", "html", "WarpBreadcrumbs", "LitElement", "activateI18n", "messages", "i18n", "styledChildren", "child", "index", "isLastEl", "interleave", "reset", "styles", "__decorateClass", "property"]
@@ -0,0 +1,14 @@
1
+ import type { Meta, StoryObj } from '@storybook/web-components';
2
+ import './index.js';
3
+ import type { WarpCombobox } from './index.js';
4
+ declare const meta: Meta<WarpCombobox>;
5
+ export default meta;
6
+ type Story = StoryObj<WarpCombobox>;
7
+ export declare const Default: Story;
8
+ export declare const WithValue: Story;
9
+ export declare const OpenOnFocus: Story;
10
+ export declare const WithTextMatching: Story;
11
+ export declare const Invalid: Story;
12
+ export declare const Disabled: Story;
13
+ export declare const Optional: Story;
14
+ export declare const DisableStaticFiltering: Story;
@@ -0,0 +1,95 @@
1
+ import { html } from 'lit';
2
+ import { getStorybookHelpers } from '@wc-toolkit/storybook-helpers';
3
+ import './index.js';
4
+ const { events, args, argTypes } = getStorybookHelpers('w-combobox');
5
+ const meta = {
6
+ title: 'Forms/Combobox',
7
+ component: 'w-combobox',
8
+ parameters: {
9
+ docs: {
10
+ description: {
11
+ component: 'A combobox element for text input with selectable options.',
12
+ },
13
+ },
14
+ actions: {
15
+ handles: events,
16
+ },
17
+ },
18
+ args,
19
+ argTypes,
20
+ };
21
+ export default meta;
22
+ const sampleOptions = [
23
+ { value: 'Apple', label: 'Apple' },
24
+ { value: 'Banana', label: 'Banana' },
25
+ { value: 'Orange', label: 'Orange' },
26
+ { value: 'Grape', label: 'Grape' },
27
+ { value: 'Strawberry', label: 'Strawberry' },
28
+ { value: 'Pineapple', label: 'Pineapple' },
29
+ { value: 'Mango', label: 'Mango' },
30
+ ];
31
+ export const Default = {
32
+ render: () => html ` <w-combobox label="Select a fruit" placeholder="Type to search..." .options="${sampleOptions}"></w-combobox> `,
33
+ };
34
+ export const WithValue = {
35
+ render: () => html `
36
+ <w-combobox label="Select a fruit" placeholder="Type to search..." .options="${sampleOptions}" value="Apple"></w-combobox>
37
+ `,
38
+ };
39
+ export const OpenOnFocus = {
40
+ render: () => html `
41
+ <w-combobox label="Select a fruit" placeholder="Type to search..." open-on-focus .options="${sampleOptions}"></w-combobox>
42
+ `,
43
+ };
44
+ export const WithTextMatching = {
45
+ render: () => html `
46
+ <w-combobox label="Select a fruit" placeholder="Type to search..." match-text-segments .options="${sampleOptions}"></w-combobox>
47
+ `,
48
+ };
49
+ export const Invalid = {
50
+ render: () => html `
51
+ <w-combobox
52
+ label="Select a fruit"
53
+ placeholder="Type to search..."
54
+ invalid
55
+ .options="${sampleOptions}"
56
+ value="Invalid fruit"
57
+ help-text="Please select a valid fruit from the list"></w-combobox>
58
+ `,
59
+ };
60
+ export const Disabled = {
61
+ render: () => html `
62
+ <w-combobox label="Select a fruit" placeholder="Type to search..." disabled .options="${sampleOptions}" value="Apple"></w-combobox>
63
+ `,
64
+ };
65
+ export const Optional = {
66
+ render: () => html `
67
+ <w-combobox label="Select a fruit" placeholder="Type to search..." optional .options="${sampleOptions}"></w-combobox>
68
+ `,
69
+ };
70
+ export const DisableStaticFiltering = {
71
+ render: () => html `
72
+ <w-combobox
73
+ id="combobox-dynamic"
74
+ label="Select a fruit (dynamic)"
75
+ placeholder="Type to search..."
76
+ disable-static-filtering></w-combobox>
77
+ <script type="module">
78
+ const combobox = document.querySelector('#combobox-dynamic');
79
+ const sampleOptions = ${JSON.stringify(sampleOptions)};
80
+ combobox.options = sampleOptions;
81
+ combobox.value = '';
82
+
83
+ combobox.addEventListener('change', (e) => {
84
+ combobox.value = e.detail.value;
85
+ // Simulate dynamic filtering
86
+ const filteredOptions = sampleOptions.filter((option) => option.value.toLowerCase().includes(e.detail.value.toLowerCase()));
87
+ combobox.options = filteredOptions;
88
+ });
89
+
90
+ combobox.addEventListener('select', (e) => {
91
+ combobox.value = e.detail.value;
92
+ });
93
+ </script>
94
+ `,
95
+ };
@@ -0,0 +1,100 @@
1
+ import { LitElement, PropertyValues } from 'lit';
2
+ export declare const ccCombobox: {
3
+ wrapper: string;
4
+ base: string;
5
+ listbox: string;
6
+ option: string;
7
+ optionUnselected: string;
8
+ optionSelected: string;
9
+ textMatch: string;
10
+ a11y: string;
11
+ };
12
+ export interface ComboboxOption {
13
+ value: string;
14
+ label?: string;
15
+ key?: string;
16
+ }
17
+ /**
18
+ * A combobox element for text input with selectable options.
19
+ *
20
+ * [See Storybook for usage examples](https://warp-ds.github.io/elements/?path=/docs/forms-combobox--docs)
21
+ */
22
+ export declare class WarpCombobox extends LitElement {
23
+ /** The available options to select from */
24
+ options: ComboboxOption[];
25
+ /** Label above input */
26
+ label?: string;
27
+ /** Input placeholder */
28
+ placeholder?: string;
29
+ /** The input value */
30
+ value: string;
31
+ /** Whether the popover opens when focus is on the text field */
32
+ openOnFocus: boolean;
33
+ /** Select active option on blur */
34
+ selectOnBlur: boolean;
35
+ /** Whether the matching text segments in the options should be highlighted */
36
+ matchTextSegments: boolean;
37
+ /** Disable client-side static filtering */
38
+ disableStaticFiltering: boolean;
39
+ /** Renders the input field in an invalid state */
40
+ invalid: boolean;
41
+ /** The content to display as the help text */
42
+ helpText?: string;
43
+ /** Whether the element is disabled */
44
+ disabled: boolean;
45
+ /** Whether the element is required */
46
+ required: boolean;
47
+ /** Whether to show optional text */
48
+ optional: boolean;
49
+ /** Additional container styling */
50
+ containerClassName?: string;
51
+ /** Additional list styling */
52
+ listClassName?: string;
53
+ /** Name attribute for form submission */
54
+ name?: string;
55
+ /** @internal Options list open boolean */
56
+ private _isOpen;
57
+ /** @internal The option the user has navigated to with their keyboard */
58
+ private _navigationOption;
59
+ /** @internal Available options based on user's input value */
60
+ private _currentOptions;
61
+ /** @internal Unique identifier counter for options */
62
+ private _optionIdCounter;
63
+ static styles: import("lit").CSSResult[];
64
+ constructor();
65
+ private get _listboxId();
66
+ private get _id();
67
+ private get _helpId();
68
+ private get _navigationValueOrInputValue();
69
+ /** Generate options with unique IDs and match information */
70
+ private _createOptionsWithIdAndMatch;
71
+ /** Get ARIA text for screen readers */
72
+ private _getAriaText;
73
+ /** Get option classes */
74
+ private _getOptionClasses;
75
+ /** Handle keyboard navigation */
76
+ private _handleKeyDown;
77
+ /** Find and set active option based on keyboard navigation */
78
+ private _findAndSetActiveOption;
79
+ /** Handle option selection */
80
+ private _handleSelect;
81
+ /** Handle input change */
82
+ private _handleChange;
83
+ /** Handle input focus */
84
+ private _handleFocus;
85
+ /** Handle input blur */
86
+ private _handleBlur;
87
+ /** Handle option click */
88
+ private _handleOptionClick;
89
+ /** Handle container blur */
90
+ private _handleContainerBlur;
91
+ /** Render highlighted text match */
92
+ private _renderTextMatch;
93
+ protected updated(changedProperties: PropertyValues<this>): void;
94
+ render(): import("lit").TemplateResult<1>;
95
+ }
96
+ declare global {
97
+ interface HTMLElementTagNameMap {
98
+ 'w-combobox': WarpCombobox;
99
+ }
100
+ }