@voicenter-team/opensips-js 1.0.86 → 1.0.88

package/dist/opensips-js.es.js

@@ -10009,7 +10009,7 @@ var Gc = {
   }
 };
 const rr = dr, ir = "JsSIP";
-var ut = class {
+var at = class {
   constructor(s) {
     s ? (this._debug = rr.default(`${ir}:${s}`), this._warn = rr.default(`${ir}:WARN:${s}`), this._error = rr.default(`${ir}:ERROR:${s}`)) : (this._debug = rr.default(ir), this._warn = rr.default(`${ir}:WARN`), this._error = rr.default(`${ir}:ERROR`)), this._debug.log = console.info.bind(console), this._warn.log = console.warn.bind(console), this._error.log = console.error.bind(console);
   }
@@ -10023,7 +10023,7 @@ var ut = class {
     return this._error;
   }
 };
-const n_ = /* @__PURE__ */ Xe(ut), Wc = xo;
+const n_ = /* @__PURE__ */ Xe(at), Wc = xo;
 var De = {
   USER_AGENT: `${Wc.title} ${Wc.version}`,
   // SIP scheme.
@@ -12475,7 +12475,7 @@ function yt() {
       }
   }, et.cloneArray = (n) => n && n.slice() || [], et.cloneObject = (n, p = {}) => n && Object.assign({}, n) || p, et;
 }
-const l_ = Ut, xm = ut, St = De, rt = yt(), Xc = Du(), Mm = ls(), Da = new xm("SIPMessage");
+const l_ = Ut, xm = at, St = De, rt = yt(), Xc = Du(), Mm = ls(), Da = new xm("SIPMessage");
 class Fo {
   constructor(s, r, o, a, t, n) {
     if (!s || !r || !o)
@@ -12833,7 +12833,7 @@ var Pt = {
   IncomingRequest: km,
   IncomingResponse: Lm
 };
-const Gl = /* @__PURE__ */ Xe(Pt), $m = ut, hs = yt(), Yt = new $m("DigestAuthentication");
+const Gl = /* @__PURE__ */ Xe(Pt), $m = at, hs = yt(), Yt = new $m("DigestAuthentication");
 var a_ = class {
   constructor(s) {
     this._credentials = s, this._cnonce = null, this._nc = 0, this._ncHex = "00000000", this._algorithm = null, this._realm = null, this._nonce = null, this._opaque = null, this._stale = null, this._qop = null, this._method = null, this._uri = null, this._ha1 = null, this._response = null;
@@ -12912,7 +12912,7 @@ var Uu = {
   PROVISIONAL_RESPONSE_INTERVAL: 6e4
   // See RFC 3261 Section 13.3.1.1
 };
-const Mi = /* @__PURE__ */ Xe(Uu), ul = ft.EventEmitter, cl = ut, Ki = De, Zc = Pt, rs = Uu, ef = new cl("NonInviteClientTransaction"), Wl = new cl("InviteClientTransaction"), jm = new cl("AckClientTransaction"), tf = new cl("NonInviteServerTransaction"), Kl = new cl("InviteServerTransaction"), he = {
+const Mi = /* @__PURE__ */ Xe(Uu), ul = ft.EventEmitter, cl = at, Ki = De, Zc = Pt, rs = Uu, ef = new cl("NonInviteClientTransaction"), Wl = new cl("InviteClientTransaction"), jm = new cl("AckClientTransaction"), tf = new cl("NonInviteServerTransaction"), Kl = new cl("InviteServerTransaction"), he = {
   // Transaction states.
   STATUS_TRYING: 1,
   STATUS_PROCEEDING: 2,
@@ -13236,7 +13236,7 @@ var pr = {
   InviteServerTransaction: Wm,
   checkTransaction: Km
 };
-const Bt = /* @__PURE__ */ Xe(pr), Ym = ut, sf = De, zm = a_, Na = pr, Jm = new Ym("RequestSender"), Ua = {
+const Bt = /* @__PURE__ */ Xe(pr), Ym = at, sf = De, zm = a_, Na = pr, Jm = new Ym("RequestSender"), Ua = {
   onRequestTimeout: () => {
   },
   onTransportError: () => {
@@ -13324,7 +13324,7 @@ var mr = class {
       this._eventHandlers.onReceiveResponse(s);
   }
 };
-const u_ = /* @__PURE__ */ Xe(mr), Xm = ut, Pa = yt(), pn = De, nf = Pt, rf = mr, ki = new Xm("Registrator"), Yl = 10;
+const u_ = /* @__PURE__ */ Xe(mr), Xm = at, Pa = yt(), pn = De, nf = Pt, rf = mr, ki = new Xm("Registrator"), Yl = 10;
 var Qm = class {
   constructor(s, r) {
     this._reg_id = 1, this._ua = s, this._transport = r, this._registrar = s.configuration.registrar_server, this._expires = s.configuration.register_expires, this._call_id = Pa.createRandomToken(22), this._cseq = 0, this._to_uri = s.configuration.uri, this._registrationTimer = null, this._registering = !1, this._registered = !1, this._contact = this._ua.contact.toString(), this._contact += ";+sip.ice", this._extraHeaders = [], this._extraContactParams = "", this._sipInstance = `"<urn:uuid:${this._ua.configuration.instance_id}>"`, this._contact += `;reg-id=${this._reg_id}`, this._contact += `;+sip.instance=${this._sipInstance}`;
@@ -13553,7 +13553,7 @@ var c_ = class {
     }, 1e3)) : s.status_code >= 200 && s.status_code < 300 ? this._eventHandlers.onSuccessResponse(s) : s.status_code >= 300 && this._eventHandlers.onErrorResponse(s);
   }
 };
-const rg = /* @__PURE__ */ Xe(c_), ig = ut, lf = Pt, Ms = De, Li = pr, lg = c_, ka = yt(), La = new ig("Dialog"), ks = {
+const rg = /* @__PURE__ */ Xe(c_), ig = at, lf = Pt, Ms = De, Li = pr, lg = c_, ka = yt(), La = new ig("Dialog"), ks = {
   // Dialog states.
   STATUS_EARLY: 1,
   STATUS_CONFIRMED: 2,
@@ -13684,7 +13684,7 @@ var f_ = class {
 };
 const Jl = /* @__PURE__ */ Xe(f_);
 var Pu = { exports: {} };
-const og = ft.EventEmitter, ag = ut, ug = De, cg = Es, of = yt(), fg = new ag("RTCSession:DTMF"), __ = {
+const og = ft.EventEmitter, ag = at, ug = De, cg = Es, of = yt(), fg = new ag("RTCSession:DTMF"), __ = {
   MIN_DURATION: 70,
   MAX_DURATION: 6e3,
   DEFAULT_DURATION: 100,
@@ -13826,7 +13826,7 @@ var d_ = class extends hg {
     });
   }
 };
-const pu = /* @__PURE__ */ Xe(d_), gg = ut, af = De, Tg = new gg("RTCSession:ReferNotifier"), $a = {
+const pu = /* @__PURE__ */ Xe(d_), gg = at, af = De, Tg = new gg("RTCSession:ReferNotifier"), $a = {
   event_type: "refer",
   body_type: "message/sipfrag;version=2.0",
   expires: 300
@@ -13856,7 +13856,7 @@ var p_ = class {
     });
   }
 };
-const vg = /* @__PURE__ */ Xe(p_), Eg = ft.EventEmitter, Sg = ut, $i = De, yg = ls(), uf = yt(), mn = new Sg("RTCSession:ReferSubscriber");
+const vg = /* @__PURE__ */ Xe(p_), Eg = ft.EventEmitter, Sg = at, $i = De, yg = ls(), uf = yt(), mn = new Sg("RTCSession:ReferSubscriber");
 var m_ = class extends Eg {
   constructor(s) {
     super(), this._id = null, this._session = s;
@@ -13947,7 +13947,7 @@ var m_ = class extends Eg {
     });
   }
 };
-const Ag = /* @__PURE__ */ Xe(m_), Cg = ft.EventEmitter, cf = Ut, Rg = ut, fe = De, gn = Es, ff = pr, Be = yt(), Hi = Uu, Ig = Pt, Xl = f_, bg = mr, Mt = h_, _f = d_, wg = p_, Og = m_, hf = vs(), Y = new Rg("RTCSession"), Z = {
+const Ag = /* @__PURE__ */ Xe(m_), Cg = ft.EventEmitter, cf = Ut, Rg = at, fe = De, gn = Es, ff = pr, Be = yt(), Hi = Uu, Ig = Pt, Xl = f_, bg = mr, Mt = h_, _f = d_, wg = p_, Og = m_, hf = vs(), Y = new Rg("RTCSession"), Z = {
   // RTCSession states.
   STATUS_NULL: 0,
   STATUS_INVITE_SENT: 1,
@@ -15274,7 +15274,7 @@ var g_ = class mu extends Cg {
     });
   }
 };
-const Dg = /* @__PURE__ */ Xe(g_), Ng = ft.EventEmitter, Ug = ut, Ha = De, Pg = Pt, Fi = yt(), xg = mr, df = Es, Mg = vs(), Zl = new Ug("Message");
+const Dg = /* @__PURE__ */ Xe(g_), Ng = ft.EventEmitter, Ug = at, Ha = De, Pg = Pt, Fi = yt(), xg = mr, df = Es, Mg = vs(), Zl = new Ug("Message");
 var kg = class extends Ng {
   constructor(s) {
     super(), this._ua = s, this._request = null, this._closed = !1, this._direction = null, this._local_identity = null, this._remote_identity = null, this._is_replied = !1, this._data = {};
@@ -15395,7 +15395,7 @@ var kg = class extends Ng {
     });
   }
 };
-const Lg = ft.EventEmitter, $g = ut, Fa = De, Hg = Pt, ji = yt(), Fg = mr, pf = Es, eo = new $g("Options");
+const Lg = ft.EventEmitter, $g = at, Fa = De, Hg = Pt, ji = yt(), Fg = mr, pf = Es, eo = new $g("Options");
 var jg = class extends Lg {
   constructor(s) {
     super(), this._ua = s, this._request = null, this._closed = !1, this._direction = null, this._local_identity = null, this._remote_identity = null, this._is_replied = !1, this._data = {};
@@ -15515,7 +15515,7 @@ var jg = class extends Lg {
     });
   }
 }, xu = {};
-const Vg = ut, ja = yt(), qg = ls(), Vi = new Vg("Socket");
+const Vg = at, ja = yt(), qg = ls(), Vi = new Vg("Socket");
 xu.isSocket = (c) => {
   if (Array.isArray(c))
     return !1;
@@ -15541,7 +15541,7 @@ xu.isSocket = (c) => {
   }
   return !0;
 };
-const Bg = ut, Gg = xu, mf = De, Nt = new Bg("Transport"), Vt = {
+const Bg = at, Gg = xu, mf = De, Nt = new Bg("Transport"), Vt = {
   // Transport status.
   STATUS_CONNECTED: 0,
   STATUS_CONNECTING: 1,
@@ -15693,7 +15693,7 @@ ${s}
 };
 const Wg = /* @__PURE__ */ Xe(T_);
 var Mu = {};
-const Kg = ut, gu = ls(), Tu = Pt, to = new Kg("Parser");
+const Kg = at, gu = ls(), Tu = Pt, to = new Kg("Parser");
 Mu.parseMessage = (c, s) => {
   let r, o, a = c.indexOf(`\r
 `);
@@ -15820,7 +15820,7 @@ function zg(c, s, r, o) {
     error: `error parsing header "${n}"`
   } : !0;
 }
-const Jg = ut, v_ = De, gf = Pt, ku = yt(), Lu = new Jg("sanityCheck"), Xg = [lT], Qg = [
+const Jg = at, v_ = De, gf = Pt, ku = yt(), Lu = new Jg("sanityCheck"), Xg = [lT], Qg = [
   eT,
   tT,
   sT,
@@ -16088,7 +16088,7 @@ Zi.load = (c, s) => {
         throw new Ba.ConfigurationError(r, o);
     }
 };
-const aT = ft.EventEmitter, uT = ut, mt = De, cT = Qm, vf = g_, Ef = kg, Sf = jg, Ga = pr, fT = T_, no = yt(), _T = Es, hT = vs(), dT = Mu, Wa = Pt, pT = S_, Ka = Zi, Ve = new uT("UA"), vt = {
+const aT = ft.EventEmitter, uT = at, mt = De, cT = Qm, vf = g_, Ef = kg, Sf = jg, Ga = pr, fT = T_, no = yt(), _T = Es, hT = vs(), dT = Mu, Wa = Pt, pT = S_, Ka = Zi, Ve = new uT("UA"), vt = {
   // UA status codes.
   STATUS_INIT: 0,
   STATUS_READY: 1,
@@ -17918,7 +17918,7 @@ class Po extends ft.EventEmitter {
           return sender.dtmf
       }*/
   requestAudioAndVideoPermissions() {
-    return this.loadStream();
+    return console.log("MMM requestAudioAndVideoPermissions"), this.loadStream();
   }
   async loadStream() {
     const s = {
@@ -17926,7 +17926,7 @@ class Po extends ft.EventEmitter {
       video: !0
     };
     try {
-      this.stream = await navigator.mediaDevices.getUserMedia(s), J.info("Got local user media.");
+      this.stream = await navigator.mediaDevices.getUserMedia(s);
     } catch {
       try {
         s.video = !1, this.stream = await navigator.mediaDevices.getUserMedia(s);
@@ -18049,7 +18049,7 @@ class Po extends ft.EventEmitter {
       const d = _.streams[0].getAudioTracks(), g = _.streams[0].getVideoTracks(), T = [];
       d[0] && T.push(d[0]), g[0] && T.push(g[0]);
       const E = new MediaStream(T);
-      s.stream = E;
+      s.stream = E, this._ua.emit("memberJoin", s.memberInfo);
     };
     let t, n = [];
     const p = (_) => {
@@ -18152,14 +18152,17 @@ class Po extends ft.EventEmitter {
           body: JSON.stringify(o),
           eventHandlers: {
             onSuccessResponse: async (t) => {
-              t.status_code === 200 && (this.subscribeSent = !0, this.lastTrickleReceived && !this.isConfigureSent && this._sendConfigureMessage({
+              t.status_code === 200 && (this.subscribeSent = !0, this.lastTrickleReceived && !this.isConfigureSent && (this.addTracks(this.stream.getTracks()), this._ua.emit("changeMainVideoStream", {
+                name: this.display_name,
+                stream: this.stream
+              }), this._sendConfigureMessage({
                 audio: !0,
                 video: !0
               }).then(() => {
-              }));
+              })));
             }
           }
-        }), this.publisherSubscribeSent = !0, this.addTracks(this.stream.getTracks());
+        }), this.publisherSubscribeSent = !0;
       });
     }
     if (this._is_canceled) {
@@ -19077,7 +19080,7 @@ a=path:${s.getHeader("Use-Path")} msrp://${this._ua._configuration.authorization
     });
   }
 }
-const at = console, Fs = {
+const ut = console, Fs = {
   // UA status codes.
   STATUS_INIT: 0,
   STATUS_READY: 1,
@@ -19101,7 +19104,7 @@ class OT extends wT {
     return super.call(s, r);
   }
   joinVideoCall(s, r, o) {
-    at.debug("call()");
+    ut.debug("call()");
     const a = new Po(this);
     return a.connect(s, r, o), a;
   }
@@ -19121,7 +19124,7 @@ class OT extends wT {
         min_interval: this._configuration.connection_recovery_min_interval
       }), this._transport.onconnecting = DT.bind(this), this._transport.onconnect = NT.bind(this), this._transport.ondisconnect = UT.bind(this), this._transport.ondata = PT.bind(this);
     } catch (a) {
-      throw at.warn(a), new Hs.ConfigurationError("sockets", this._configuration.sockets);
+      throw ut.warn(a), new Hs.ConfigurationError("sockets", this._configuration.sockets);
     }
     if (delete this._configuration.sockets, this._configuration.authorization_user || (this._configuration.authorization_user = this._configuration.uri.user), !this._configuration.registrar_server) {
       const a = this._configuration.uri.clone();
@@ -19154,21 +19157,21 @@ class OT extends wT {
         writable: !1,
         configurable: !1
       }));
-    at.debug("configuration parameters after validation:");
+    ut.debug("configuration parameters after validation:");
     for (const a in this._configuration)
       if (Object.prototype.hasOwnProperty.call(Zi.settings, a))
         switch (a) {
           case "uri":
           case "registrar_server":
-            at.debug(`- ${a}: ${this._configuration[a]}`);
+            ut.debug(`- ${a}: ${this._configuration[a]}`);
             break;
           case "password":
           case "ha1":
           case "authorization_jwt":
-            at.debug(`- ${a}: NOT SHOWN`);
+            ut.debug(`- ${a}: NOT SHOWN`);
             break;
           default:
-            at.debug(`- ${a}: ${JSON.stringify(this._configuration[a])}`);
+            ut.debug(`- ${a}: ${JSON.stringify(this._configuration[a])}`);
         }
   }
   /*call (target, options) {
@@ -19201,10 +19204,10 @@ class OT extends wT {
     delete this._janus_sessions[s.id];
   }
   receiveRequest(s) {
-    var n, p;
+    var t, n;
     const r = s.method;
     if (console.log("-----------"), s.ruri.user !== this._configuration.uri.user && s.ruri.user !== this._contact.uri.user) {
-      at.debug("Request-URI does not point to us"), s.method !== De.ACK && s.reply_sl(404);
+      ut.debug("Request-URI does not point to us"), s.method !== De.ACK && s.reply_sl(404);
       return;
     }
     if (s.ruri.scheme === De.SIPS) {
@@ -19230,30 +19233,42 @@ class OT extends wT {
       return;
     }
     let o, a;
-    const t = JSON.parse(s.body) || {};
-    if ((p = (n = t.plugindata) == null ? void 0 : n.data) != null && p.publishers && Object.values(this._janus_sessions)[0].receivePublishers(t), s.to_tag)
-      o = this._findDialog(s.call_id, s.from_tag, s.to_tag), o ? o.receiveRequest(s) : r === De.NOTIFY ? (a = this._findSession(s), a ? a.receiveRequest(s) : (at.debug("received NOTIFY request for a non existent subscription"), s.reply(200))) : r !== De.ACK && s.reply(481);
+    if (s.to_tag)
+      if (o = this._findDialog(s.call_id, s.from_tag, s.to_tag), o)
+        o.receiveRequest(s);
+      else if (r === De.NOTIFY)
+        if (a = this._findSession(s), a)
+          a.receiveRequest(s);
+        else {
+          if (s.body) {
+            const p = JSON.parse(s.body) || {};
+            (n = (t = p.plugindata) == null ? void 0 : t.data) != null && n.publishers && Object.values(this._janus_sessions)[0].receivePublishers(p);
+          }
+          s.reply(200);
+        }
+      else
+        r !== De.ACK && s.reply(481);
     else
       switch (r) {
         case De.INVITE:
           if (window.RTCPeerConnection)
             if (s.hasHeader("replaces")) {
-              const _ = s.replaces;
+              const p = s.replaces;
               o = this._findDialog(
-                _.call_id,
-                _.from_tag,
-                _.to_tag
+                p.call_id,
+                p.from_tag,
+                p.to_tag
               ), o ? (a = o.owner, a.isEnded() ? s.reply(603) : a.receiveRequest(s)) : s.reply(481);
             } else
               s.body.search(/MSRP/ig) > -1 ? (a = new Ja(this), a.init_incoming(s)) : s.body.search(/JANUS/ig) > -1 || (a = new Dg(this), a.init_incoming(s));
           else
-            at.warn("INVITE received but WebRTC is not supported"), s.reply(488);
+            ut.warn("INVITE received but WebRTC is not supported"), s.reply(488);
           break;
         case De.BYE:
           s.reply(481);
           break;
         case De.CANCEL:
-          a = this._findSession(s), a ? a.receiveRequest(s) : at.debug("received CANCEL request for a non existent session");
+          a = this._findSession(s), a ? a.receiveRequest(s) : ut.debug("received CANCEL request for a non existent session");
           break;
         case De.ACK:
           break;
@@ -19269,35 +19284,35 @@ class OT extends wT {
       }
   }
   startMSRP(s, r) {
-    at.debug("startMSRP()", r);
+    ut.debug("startMSRP()", r);
     const o = new Ja(this);
     return o.connect(s), o;
   }
   startJanus(s, r) {
-    at.debug("startJanus()", r);
+    ut.debug("startJanus()", r);
     const o = new Ja(this);
     return o.connect(s), o;
   }
   terminateMSRPSessions(s) {
-    at.debug("terminateSessions()");
+    ut.debug("terminateSessions()");
     for (const r in this._msrp_sessions)
       this._msrp_sessions[r].isEnded() || this._msrp_sessions[r].terminate(s);
   }
   terminateJanusSessions(s) {
-    at.debug("terminateSessions()");
+    ut.debug("terminateSessions()");
     for (const r in this._janus_sessions)
       this._janus_sessions[r].isEnded() || this._janus_sessions[r].terminate(s);
   }
   stop() {
-    if (at.debug("stop()"), this._dynConfiguration = {}, this._status === Fs.STATUS_USER_CLOSED) {
-      at.debug("UA already closed");
+    if (ut.debug("stop()"), this._dynConfiguration = {}, this._status === Fs.STATUS_USER_CLOSED) {
+      ut.debug("UA already closed");
       return;
     }
     this._registrator.close();
     const s = Object.keys(this._sessions).length;
     for (const o in this._sessions)
       if (Object.prototype.hasOwnProperty.call(this._sessions, o)) {
-        at.debug(`closing session ${o}`);
+        ut.debug(`closing session ${o}`);
         try {
           this._sessions[o].terminate();
         } catch (a) {
@@ -19306,7 +19321,7 @@ class OT extends wT {
       }
     for (const o in this._msrp_sessions)
       if (Object.prototype.hasOwnProperty.call(this._msrp_sessions, o)) {
-        at.debug(`closing session ${o}`);
+        ut.debug(`closing session ${o}`);
         try {
           this._msrp_sessions[o].terminate();
         } catch (a) {
@@ -19315,7 +19330,7 @@ class OT extends wT {
       }
     for (const o in this._janus_sessions)
       if (Object.prototype.hasOwnProperty.call(this._janus_sessions, o)) {
-        at.debug(`closing session ${o}`);
+        ut.debug(`closing session ${o}`);
         try {
           this._janus_sessions[o].terminate();
         } catch (a) {
@@ -19457,7 +19472,7 @@ function LT(c) {
 function A_() {
   return /Mobi|Android|iPhone/i.test(navigator.userAgent);
 }
-const $T = ut, HT = ls(), Ot = new $T("WebSocketInterface");
+const $T = at, HT = ls(), Ot = new $T("WebSocketInterface");
 var FT = class {
   constructor(s) {
     Ot.debug('new() [url:"%s"]', s), this._url = s, this._sip_uri = null, this._via_transport = null, this._ws = null;
@@ -23201,6 +23216,18 @@ class zv {
       isMerging: !0
     }), o.refer(a.remote_identity.uri.toString(), { replaces: a }), this.updateCall(o));
   }
+  mergeCallByIds(s, r) {
+    const o = Object.values(this.extendedCalls).find((t) => t._id === s), a = Object.values(this.extendedCalls).find((t) => t._id === r);
+    if (!o || !a)
+      throw new Error("Call ID is not provided");
+    this.updateCallStatus({
+      callId: s,
+      isMerging: !0
+    }), this.updateCallStatus({
+      callId: r,
+      isMerging: !0
+    }), o.refer(a.remote_identity.uri.toString(), { replaces: a }), this.updateCall(o);
+  }
   // TODO: Use this method in demo
   setDND(s) {
     this.isDNDEnabled = s, this.context.emit("changeIsDND", s);
@@ -23443,6 +23470,9 @@ class Jv {
       this.sipOptions
     ), console.log("video call");
   }
+  stop(s = {}) {
+    this.context.terminateJanusSessions(s);
+  }
   /*public invite1 (roomId: string) {
       const inviteData = {
           janus: 'invite',