@voicenter-team/opensips-js 1.0.81 → 1.0.83

package/dist/opensips-js.es.js

@@ -1,29 +1,29 @@
-var S_ = typeof globalThis < "u" ? globalThis : typeof window < "u" ? window : typeof global < "u" ? global : typeof self < "u" ? self : {};
+var y_ = typeof globalThis < "u" ? globalThis : typeof window < "u" ? window : typeof global < "u" ? global : typeof self < "u" ? self : {};
 function ot(c) {
   return c && c.__esModule && Object.prototype.hasOwnProperty.call(c, "default") ? c.default : c;
 }
-const y_ = "jssip", A_ = "JsSIP", C_ = "the Javascript SIP library", R_ = "3.10.0", I_ = "https://jssip.net", b_ = [
+const A_ = "jssip", C_ = "JsSIP", R_ = "the Javascript SIP library", I_ = "3.10.0", b_ = "https://jssip.net", w_ = [
   "José Luis Millán <jmillan@aliax.net> (https://github.com/jmillan)",
   "Iñaki Baz Castillo <ibc@aliax.net> (https://inakibaz.me)"
-], w_ = "lib/JsSIP.d.ts", O_ = "lib-es5/JsSIP.js", D_ = [
+], O_ = "lib/JsSIP.d.ts", D_ = "lib-es5/JsSIP.js", N_ = [
   "sip",
   "websocket",
   "webrtc",
   "node",
   "browser",
   "library"
-], N_ = "MIT", U_ = {
+], U_ = "MIT", P_ = {
   type: "git",
   url: "https://github.com/versatica/JsSIP.git"
-}, P_ = {
-  url: "https://github.com/versatica/JsSIP/issues"
 }, x_ = {
+  url: "https://github.com/versatica/JsSIP/issues"
+}, M_ = {
   "@types/events": "^3.0.0",
   "@types/debug": "^4.1.7",
   debug: "^4.3.1",
   events: "^3.3.0",
   "sdp-transform": "^2.14.1"
-}, M_ = {
+}, k_ = {
   "@babel/core": "^7.19.6",
   "@babel/preset-env": "^7.19.4",
   "ansi-colors": "^3.2.4",
@@ -42,27 +42,27 @@ const y_ = "jssip", A_ = "JsSIP", C_ = "the Javascript SIP library", R_ = "3.10.
   pegjs: "^0.7.0",
   "vinyl-buffer": "^1.0.1",
   "vinyl-source-stream": "^2.0.0"
-}, k_ = {
+}, L_ = {
   lint: "node npm-scripts.js lint",
   test: "node npm-scripts.js test",
   prepublish: "node npm-scripts.js prepublish",
   release: "node npm-scripts.js release"
 }, bo = {
-  name: y_,
-  title: A_,
-  description: C_,
-  version: R_,
-  homepage: I_,
-  contributors: b_,
-  types: w_,
-  main: O_,
-  keywords: D_,
-  license: N_,
-  repository: U_,
-  bugs: P_,
-  dependencies: x_,
-  devDependencies: M_,
-  scripts: k_
+  name: A_,
+  title: C_,
+  description: R_,
+  version: I_,
+  homepage: b_,
+  contributors: w_,
+  types: O_,
+  main: D_,
+  keywords: N_,
+  license: U_,
+  repository: P_,
+  bugs: x_,
+  dependencies: M_,
+  devDependencies: k_,
+  scripts: L_
 };
 var Nu = bo, rt = {
   USER_AGENT: "".concat(Nu.title, " ").concat(Nu.version),
@@ -260,13 +260,13 @@ function Do(c) {
       a = Reflect.construct(o, arguments, t);
     } else
       a = o.apply(this, arguments);
-    return L_(this, a);
+    return $_(this, a);
   };
 }
-function L_(c, n) {
-  return n && (so(n) === "object" || typeof n == "function") ? n : $_(c);
+function $_(c, n) {
+  return n && (so(n) === "object" || typeof n == "function") ? n : H_(c);
 }
-function $_(c) {
+function H_(c) {
   if (c === void 0)
     throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
   return c;
@@ -274,7 +274,7 @@ function $_(c) {
 function ar(c) {
   var n = typeof Map == "function" ? /* @__PURE__ */ new Map() : void 0;
   return ar = function(o) {
-    if (o === null || !H_(o))
+    if (o === null || !F_(o))
       return o;
     if (typeof o != "function")
       throw new TypeError("Super expression must either be null or a function");
@@ -309,7 +309,7 @@ function wf() {
     return !1;
   }
 }
-function H_(c) {
+function F_(c) {
   return Function.toString.call(c).indexOf("[native code]") !== -1;
 }
 function Gi(c, n) {
@@ -322,7 +322,7 @@ function Wi(c) {
     return r.__proto__ || Object.getPrototypeOf(r);
   }, Wi(c);
 }
-var F_ = /* @__PURE__ */ function(c) {
+var V_ = /* @__PURE__ */ function(c) {
   Oo(r, c);
   var n = Do(r);
   function r(o, a) {
@@ -330,7 +330,7 @@ var F_ = /* @__PURE__ */ function(c) {
     return wo(this, r), t = n.call(this), t.code = 1, t.name = "CONFIGURATION_ERROR", t.parameter = o, t.value = a, t.message = t.value ? "Invalid value ".concat(JSON.stringify(t.value), ' for parameter "').concat(t.parameter, '"') : "Missing parameter: ".concat(t.parameter), t;
   }
   return r;
-}(/* @__PURE__ */ ar(Error)), V_ = /* @__PURE__ */ function(c) {
+}(/* @__PURE__ */ ar(Error)), j_ = /* @__PURE__ */ function(c) {
   Oo(r, c);
   var n = Do(r);
   function r(o) {
@@ -338,7 +338,7 @@ var F_ = /* @__PURE__ */ function(c) {
     return wo(this, r), a = n.call(this), a.code = 2, a.name = "INVALID_STATE_ERROR", a.status = o, a.message = "Invalid status: ".concat(o), a;
   }
   return r;
-}(/* @__PURE__ */ ar(Error)), j_ = /* @__PURE__ */ function(c) {
+}(/* @__PURE__ */ ar(Error)), q_ = /* @__PURE__ */ function(c) {
   Oo(r, c);
   var n = Do(r);
   function r(o) {
@@ -346,7 +346,7 @@ var F_ = /* @__PURE__ */ function(c) {
     return wo(this, r), a = n.call(this), a.code = 3, a.name = "NOT_SUPPORTED_ERROR", a.message = o, a;
   }
   return r;
-}(/* @__PURE__ */ ar(Error)), q_ = /* @__PURE__ */ function(c) {
+}(/* @__PURE__ */ ar(Error)), B_ = /* @__PURE__ */ function(c) {
   Oo(r, c);
   var n = Do(r);
   function r(o) {
@@ -355,10 +355,10 @@ var F_ = /* @__PURE__ */ function(c) {
   }
   return r;
 }(/* @__PURE__ */ ar(Error)), Hs = {
-  ConfigurationError: F_,
-  InvalidStateError: V_,
-  NotSupportedError: j_,
-  NotReadyError: q_
+  ConfigurationError: V_,
+  InvalidStateError: j_,
+  NotSupportedError: q_,
+  NotReadyError: B_
 }, Qe = {}, Xo, Uu;
 function du() {
   if (Uu)
@@ -1111,8 +1111,8 @@ function ns() {
         }
         function me() {
           var e, l, u, f, h, m, v, S, O, ie, Ne, Rt, Ds, k, C, Te;
-          return k = s, C = s, e = oe(), e !== null ? (o.charCodeAt(s) === 58 ? (l = ":", s++) : (l = null, d('":"')), l !== null ? (u = oe(), u !== null ? (o.charCodeAt(s) === 58 ? (f = ":", s++) : (f = null, d('":"')), f !== null ? (h = oe(), h !== null ? (o.charCodeAt(s) === 58 ? (m = ":", s++) : (m = null, d('":"')), m !== null ? (v = oe(), v !== null ? (o.charCodeAt(s) === 58 ? (S = ":", s++) : (S = null, d('":"')), S !== null ? (O = oe(), O !== null ? (o.charCodeAt(s) === 58 ? (ie = ":", s++) : (ie = null, d('":"')), ie !== null ? (Ne = oe(), Ne !== null ? (o.charCodeAt(s) === 58 ? (Rt = ":", s++) : (Rt = null, d('":"')), Rt !== null ? (Ds = lt(), Ds !== null ? e = [e, l, u, f, h, m, v, S, O, ie, Ne, Rt, Ds] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, o.substr(s, 2) === "::" ? (e = "::", s += 2) : (e = null, d('"::"')), e !== null ? (l = oe(), l !== null ? (o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? (o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = oe(), m !== null ? (o.charCodeAt(s) === 58 ? (v = ":", s++) : (v = null, d('":"')), v !== null ? (S = oe(), S !== null ? (o.charCodeAt(s) === 58 ? (O = ":", s++) : (O = null, d('":"')), O !== null ? (ie = oe(), ie !== null ? (o.charCodeAt(s) === 58 ? (Ne = ":", s++) : (Ne = null, d('":"')), Ne !== null ? (Rt = lt(), Rt !== null ? e = [e, l, u, f, h, m, v, S, O, ie, Ne, Rt] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, o.substr(s, 2) === "::" ? (e = "::", s += 2) : (e = null, d('"::"')), e !== null ? (l = oe(), l !== null ? (o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? (o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = oe(), m !== null ? (o.charCodeAt(s) === 58 ? (v = ":", s++) : (v = null, d('":"')), v !== null ? (S = oe(), S !== null ? (o.charCodeAt(s) === 58 ? (O = ":", s++) : (O = null, d('":"')), O !== null ? (ie = lt(), ie !== null ? e = [e, l, u, f, h, m, v, S, O, ie] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, o.substr(s, 2) === "::" ? (e = "::", s += 2) : (e = null, d('"::"')), e !== null ? (l = oe(), l !== null ? (o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? (o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = oe(), m !== null ? (o.charCodeAt(s) === 58 ? (v = ":", s++) : (v = null, d('":"')), v !== null ? (S = lt(), S !== null ? e = [e, l, u, f, h, m, v, S] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, o.substr(s, 2) === "::" ? (e = "::", s += 2) : (e = null, d('"::"')), e !== null ? (l = oe(), l !== null ? (o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? (o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = lt(), m !== null ? e = [e, l, u, f, h, m] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, o.substr(s, 2) === "::" ? (e = "::", s += 2) : (e = null, d('"::"')), e !== null ? (l = oe(), l !== null ? (o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = lt(), f !== null ? e = [e, l, u, f] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, o.substr(s, 2) === "::" ? (e = "::", s += 2) : (e = null, d('"::"')), e !== null ? (l = lt(), l !== null ? e = [e, l] : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, o.substr(s, 2) === "::" ? (e = "::", s += 2) : (e = null, d('"::"')), e !== null ? (l = oe(), l !== null ? e = [e, l] : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, e = oe(), e !== null ? (o.substr(s, 2) === "::" ? (l = "::", s += 2) : (l = null, d('"::"')), l !== null ? (u = oe(), u !== null ? (o.charCodeAt(s) === 58 ? (f = ":", s++) : (f = null, d('":"')), f !== null ? (h = oe(), h !== null ? (o.charCodeAt(s) === 58 ? (m = ":", s++) : (m = null, d('":"')), m !== null ? (v = oe(), v !== null ? (o.charCodeAt(s) === 58 ? (S = ":", s++) : (S = null, d('":"')), S !== null ? (O = oe(), O !== null ? (o.charCodeAt(s) === 58 ? (ie = ":", s++) : (ie = null, d('":"')), ie !== null ? (Ne = lt(), Ne !== null ? e = [e, l, u, f, h, m, v, S, O, ie, Ne] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, e = oe(), e !== null ? (Te = s, o.charCodeAt(s) === 58 ? (l = ":", s++) : (l = null, d('":"')), l !== null ? (u = oe(), u !== null ? l = [l, u] : (l = null, s = Te)) : (l = null, s = Te), l = l !== null ? l : "", l !== null ? (o.substr(s, 2) === "::" ? (u = "::", s += 2) : (u = null, d('"::"')), u !== null ? (f = oe(), f !== null ? (o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = oe(), m !== null ? (o.charCodeAt(s) === 58 ? (v = ":", s++) : (v = null, d('":"')), v !== null ? (S = oe(), S !== null ? (o.charCodeAt(s) === 58 ? (O = ":", s++) : (O = null, d('":"')), O !== null ? (ie = lt(), ie !== null ? e = [e, l, u, f, h, m, v, S, O, ie] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, e = oe(), e !== null ? (Te = s, o.charCodeAt(s) === 58 ? (l = ":", s++) : (l = null, d('":"')), l !== null ? (u = oe(), u !== null ? l = [l, u] : (l = null, s = Te)) : (l = null, s = Te), l = l !== null ? l : "", l !== null ? (Te = s, o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? u = [u, f] : (u = null, s = Te)) : (u = null, s = Te), u = u !== null ? u : "", u !== null ? (o.substr(s, 2) === "::" ? (f = "::", s += 2) : (f = null, d('"::"')), f !== null ? (h = oe(), h !== null ? (o.charCodeAt(s) === 58 ? (m = ":", s++) : (m = null, d('":"')), m !== null ? (v = oe(), v !== null ? (o.charCodeAt(s) === 58 ? (S = ":", s++) : (S = null, d('":"')), S !== null ? (O = lt(), O !== null ? e = [e, l, u, f, h, m, v, S, O] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, e = oe(), e !== null ? (Te = s, o.charCodeAt(s) === 58 ? (l = ":", s++) : (l = null, d('":"')), l !== null ? (u = oe(), u !== null ? l = [l, u] : (l = null, s = Te)) : (l = null, s = Te), l = l !== null ? l : "", l !== null ? (Te = s, o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? u = [u, f] : (u = null, s = Te)) : (u = null, s = Te), u = u !== null ? u : "", u !== null ? (Te = s, o.charCodeAt(s) === 58 ? (f = ":", s++) : (f = null, d('":"')), f !== null ? (h = oe(), h !== null ? f = [f, h] : (f = null, s = Te)) : (f = null, s = Te), f = f !== null ? f : "", f !== null ? (o.substr(s, 2) === "::" ? (h = "::", s += 2) : (h = null, d('"::"')), h !== null ? (m = oe(), m !== null ? (o.charCodeAt(s) === 58 ? (v = ":", s++) : (v = null, d('":"')), v !== null ? (S = lt(), S !== null ? e = [e, l, u, f, h, m, v, S] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, e = oe(), e !== null ? (Te = s, o.charCodeAt(s) === 58 ? (l = ":", s++) : (l = null, d('":"')), l !== null ? (u = oe(), u !== null ? l = [l, u] : (l = null, s = Te)) : (l = null, s = Te), l = l !== null ? l : "", l !== null ? (Te = s, o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? u = [u, f] : (u = null, s = Te)) : (u = null, s = Te), u = u !== null ? u : "", u !== null ? (Te = s, o.charCodeAt(s) === 58 ? (f = ":", s++) : (f = null, d('":"')), f !== null ? (h = oe(), h !== null ? f = [f, h] : (f = null, s = Te)) : (f = null, s = Te), f = f !== null ? f : "", f !== null ? (Te = s, o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = oe(), m !== null ? h = [h, m] : (h = null, s = Te)) : (h = null, s = Te), h = h !== null ? h : "", h !== null ? (o.substr(s, 2) === "::" ? (m = "::", s += 2) : (m = null, d('"::"')), m !== null ? (v = lt(), v !== null ? e = [e, l, u, f, h, m, v] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, e = oe(), e !== null ? (Te = s, o.charCodeAt(s) === 58 ? (l = ":", s++) : (l = null, d('":"')), l !== null ? (u = oe(), u !== null ? l = [l, u] : (l = null, s = Te)) : (l = null, s = Te), l = l !== null ? l : "", l !== null ? (Te = s, o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? u = [u, f] : (u = null, s = Te)) : (u = null, s = Te), u = u !== null ? u : "", u !== null ? (Te = s, o.charCodeAt(s) === 58 ? (f = ":", s++) : (f = null, d('":"')), f !== null ? (h = oe(), h !== null ? f = [f, h] : (f = null, s = Te)) : (f = null, s = Te), f = f !== null ? f : "", f !== null ? (Te = s, o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = oe(), m !== null ? h = [h, m] : (h = null, s = Te)) : (h = null, s = Te), h = h !== null ? h : "", h !== null ? (Te = s, o.charCodeAt(s) === 58 ? (m = ":", s++) : (m = null, d('":"')), m !== null ? (v = oe(), v !== null ? m = [m, v] : (m = null, s = Te)) : (m = null, s = Te), m = m !== null ? m : "", m !== null ? (o.substr(s, 2) === "::" ? (v = "::", s += 2) : (v = null, d('"::"')), v !== null ? (S = oe(), S !== null ? e = [e, l, u, f, h, m, v, S] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, e = oe(), e !== null ? (Te = s, o.charCodeAt(s) === 58 ? (l = ":", s++) : (l = null, d('":"')), l !== null ? (u = oe(), u !== null ? l = [l, u] : (l = null, s = Te)) : (l = null, s = Te), l = l !== null ? l : "", l !== null ? (Te = s, o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? u = [u, f] : (u = null, s = Te)) : (u = null, s = Te), u = u !== null ? u : "", u !== null ? (Te = s, o.charCodeAt(s) === 58 ? (f = ":", s++) : (f = null, d('":"')), f !== null ? (h = oe(), h !== null ? f = [f, h] : (f = null, s = Te)) : (f = null, s = Te), f = f !== null ? f : "", f !== null ? (Te = s, o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = oe(), m !== null ? h = [h, m] : (h = null, s = Te)) : (h = null, s = Te), h = h !== null ? h : "", h !== null ? (Te = s, o.charCodeAt(s) === 58 ? (m = ":", s++) : (m = null, d('":"')), m !== null ? (v = oe(), v !== null ? m = [m, v] : (m = null, s = Te)) : (m = null, s = Te), m = m !== null ? m : "", m !== null ? (Te = s, o.charCodeAt(s) === 58 ? (v = ":", s++) : (v = null, d('":"')), v !== null ? (S = oe(), S !== null ? v = [v, S] : (v = null, s = Te)) : (v = null, s = Te), v = v !== null ? v : "", v !== null ? (o.substr(s, 2) === "::" ? (S = "::", s += 2) : (S = null, d('"::"')), S !== null ? e = [e, l, u, f, h, m, v, S] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C))))))))))))))), e !== null && (e = function(E_) {
-            return w.host_type = "IPv6", o.substring(s, E_);
+          return k = s, C = s, e = oe(), e !== null ? (o.charCodeAt(s) === 58 ? (l = ":", s++) : (l = null, d('":"')), l !== null ? (u = oe(), u !== null ? (o.charCodeAt(s) === 58 ? (f = ":", s++) : (f = null, d('":"')), f !== null ? (h = oe(), h !== null ? (o.charCodeAt(s) === 58 ? (m = ":", s++) : (m = null, d('":"')), m !== null ? (v = oe(), v !== null ? (o.charCodeAt(s) === 58 ? (S = ":", s++) : (S = null, d('":"')), S !== null ? (O = oe(), O !== null ? (o.charCodeAt(s) === 58 ? (ie = ":", s++) : (ie = null, d('":"')), ie !== null ? (Ne = oe(), Ne !== null ? (o.charCodeAt(s) === 58 ? (Rt = ":", s++) : (Rt = null, d('":"')), Rt !== null ? (Ds = lt(), Ds !== null ? e = [e, l, u, f, h, m, v, S, O, ie, Ne, Rt, Ds] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, o.substr(s, 2) === "::" ? (e = "::", s += 2) : (e = null, d('"::"')), e !== null ? (l = oe(), l !== null ? (o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? (o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = oe(), m !== null ? (o.charCodeAt(s) === 58 ? (v = ":", s++) : (v = null, d('":"')), v !== null ? (S = oe(), S !== null ? (o.charCodeAt(s) === 58 ? (O = ":", s++) : (O = null, d('":"')), O !== null ? (ie = oe(), ie !== null ? (o.charCodeAt(s) === 58 ? (Ne = ":", s++) : (Ne = null, d('":"')), Ne !== null ? (Rt = lt(), Rt !== null ? e = [e, l, u, f, h, m, v, S, O, ie, Ne, Rt] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, o.substr(s, 2) === "::" ? (e = "::", s += 2) : (e = null, d('"::"')), e !== null ? (l = oe(), l !== null ? (o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? (o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = oe(), m !== null ? (o.charCodeAt(s) === 58 ? (v = ":", s++) : (v = null, d('":"')), v !== null ? (S = oe(), S !== null ? (o.charCodeAt(s) === 58 ? (O = ":", s++) : (O = null, d('":"')), O !== null ? (ie = lt(), ie !== null ? e = [e, l, u, f, h, m, v, S, O, ie] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, o.substr(s, 2) === "::" ? (e = "::", s += 2) : (e = null, d('"::"')), e !== null ? (l = oe(), l !== null ? (o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? (o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = oe(), m !== null ? (o.charCodeAt(s) === 58 ? (v = ":", s++) : (v = null, d('":"')), v !== null ? (S = lt(), S !== null ? e = [e, l, u, f, h, m, v, S] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, o.substr(s, 2) === "::" ? (e = "::", s += 2) : (e = null, d('"::"')), e !== null ? (l = oe(), l !== null ? (o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? (o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = lt(), m !== null ? e = [e, l, u, f, h, m] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, o.substr(s, 2) === "::" ? (e = "::", s += 2) : (e = null, d('"::"')), e !== null ? (l = oe(), l !== null ? (o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = lt(), f !== null ? e = [e, l, u, f] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, o.substr(s, 2) === "::" ? (e = "::", s += 2) : (e = null, d('"::"')), e !== null ? (l = lt(), l !== null ? e = [e, l] : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, o.substr(s, 2) === "::" ? (e = "::", s += 2) : (e = null, d('"::"')), e !== null ? (l = oe(), l !== null ? e = [e, l] : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, e = oe(), e !== null ? (o.substr(s, 2) === "::" ? (l = "::", s += 2) : (l = null, d('"::"')), l !== null ? (u = oe(), u !== null ? (o.charCodeAt(s) === 58 ? (f = ":", s++) : (f = null, d('":"')), f !== null ? (h = oe(), h !== null ? (o.charCodeAt(s) === 58 ? (m = ":", s++) : (m = null, d('":"')), m !== null ? (v = oe(), v !== null ? (o.charCodeAt(s) === 58 ? (S = ":", s++) : (S = null, d('":"')), S !== null ? (O = oe(), O !== null ? (o.charCodeAt(s) === 58 ? (ie = ":", s++) : (ie = null, d('":"')), ie !== null ? (Ne = lt(), Ne !== null ? e = [e, l, u, f, h, m, v, S, O, ie, Ne] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, e = oe(), e !== null ? (Te = s, o.charCodeAt(s) === 58 ? (l = ":", s++) : (l = null, d('":"')), l !== null ? (u = oe(), u !== null ? l = [l, u] : (l = null, s = Te)) : (l = null, s = Te), l = l !== null ? l : "", l !== null ? (o.substr(s, 2) === "::" ? (u = "::", s += 2) : (u = null, d('"::"')), u !== null ? (f = oe(), f !== null ? (o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = oe(), m !== null ? (o.charCodeAt(s) === 58 ? (v = ":", s++) : (v = null, d('":"')), v !== null ? (S = oe(), S !== null ? (o.charCodeAt(s) === 58 ? (O = ":", s++) : (O = null, d('":"')), O !== null ? (ie = lt(), ie !== null ? e = [e, l, u, f, h, m, v, S, O, ie] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, e = oe(), e !== null ? (Te = s, o.charCodeAt(s) === 58 ? (l = ":", s++) : (l = null, d('":"')), l !== null ? (u = oe(), u !== null ? l = [l, u] : (l = null, s = Te)) : (l = null, s = Te), l = l !== null ? l : "", l !== null ? (Te = s, o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? u = [u, f] : (u = null, s = Te)) : (u = null, s = Te), u = u !== null ? u : "", u !== null ? (o.substr(s, 2) === "::" ? (f = "::", s += 2) : (f = null, d('"::"')), f !== null ? (h = oe(), h !== null ? (o.charCodeAt(s) === 58 ? (m = ":", s++) : (m = null, d('":"')), m !== null ? (v = oe(), v !== null ? (o.charCodeAt(s) === 58 ? (S = ":", s++) : (S = null, d('":"')), S !== null ? (O = lt(), O !== null ? e = [e, l, u, f, h, m, v, S, O] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, e = oe(), e !== null ? (Te = s, o.charCodeAt(s) === 58 ? (l = ":", s++) : (l = null, d('":"')), l !== null ? (u = oe(), u !== null ? l = [l, u] : (l = null, s = Te)) : (l = null, s = Te), l = l !== null ? l : "", l !== null ? (Te = s, o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? u = [u, f] : (u = null, s = Te)) : (u = null, s = Te), u = u !== null ? u : "", u !== null ? (Te = s, o.charCodeAt(s) === 58 ? (f = ":", s++) : (f = null, d('":"')), f !== null ? (h = oe(), h !== null ? f = [f, h] : (f = null, s = Te)) : (f = null, s = Te), f = f !== null ? f : "", f !== null ? (o.substr(s, 2) === "::" ? (h = "::", s += 2) : (h = null, d('"::"')), h !== null ? (m = oe(), m !== null ? (o.charCodeAt(s) === 58 ? (v = ":", s++) : (v = null, d('":"')), v !== null ? (S = lt(), S !== null ? e = [e, l, u, f, h, m, v, S] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, e = oe(), e !== null ? (Te = s, o.charCodeAt(s) === 58 ? (l = ":", s++) : (l = null, d('":"')), l !== null ? (u = oe(), u !== null ? l = [l, u] : (l = null, s = Te)) : (l = null, s = Te), l = l !== null ? l : "", l !== null ? (Te = s, o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? u = [u, f] : (u = null, s = Te)) : (u = null, s = Te), u = u !== null ? u : "", u !== null ? (Te = s, o.charCodeAt(s) === 58 ? (f = ":", s++) : (f = null, d('":"')), f !== null ? (h = oe(), h !== null ? f = [f, h] : (f = null, s = Te)) : (f = null, s = Te), f = f !== null ? f : "", f !== null ? (Te = s, o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = oe(), m !== null ? h = [h, m] : (h = null, s = Te)) : (h = null, s = Te), h = h !== null ? h : "", h !== null ? (o.substr(s, 2) === "::" ? (m = "::", s += 2) : (m = null, d('"::"')), m !== null ? (v = lt(), v !== null ? e = [e, l, u, f, h, m, v] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, e = oe(), e !== null ? (Te = s, o.charCodeAt(s) === 58 ? (l = ":", s++) : (l = null, d('":"')), l !== null ? (u = oe(), u !== null ? l = [l, u] : (l = null, s = Te)) : (l = null, s = Te), l = l !== null ? l : "", l !== null ? (Te = s, o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? u = [u, f] : (u = null, s = Te)) : (u = null, s = Te), u = u !== null ? u : "", u !== null ? (Te = s, o.charCodeAt(s) === 58 ? (f = ":", s++) : (f = null, d('":"')), f !== null ? (h = oe(), h !== null ? f = [f, h] : (f = null, s = Te)) : (f = null, s = Te), f = f !== null ? f : "", f !== null ? (Te = s, o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = oe(), m !== null ? h = [h, m] : (h = null, s = Te)) : (h = null, s = Te), h = h !== null ? h : "", h !== null ? (Te = s, o.charCodeAt(s) === 58 ? (m = ":", s++) : (m = null, d('":"')), m !== null ? (v = oe(), v !== null ? m = [m, v] : (m = null, s = Te)) : (m = null, s = Te), m = m !== null ? m : "", m !== null ? (o.substr(s, 2) === "::" ? (v = "::", s += 2) : (v = null, d('"::"')), v !== null ? (S = oe(), S !== null ? e = [e, l, u, f, h, m, v, S] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C), e === null && (C = s, e = oe(), e !== null ? (Te = s, o.charCodeAt(s) === 58 ? (l = ":", s++) : (l = null, d('":"')), l !== null ? (u = oe(), u !== null ? l = [l, u] : (l = null, s = Te)) : (l = null, s = Te), l = l !== null ? l : "", l !== null ? (Te = s, o.charCodeAt(s) === 58 ? (u = ":", s++) : (u = null, d('":"')), u !== null ? (f = oe(), f !== null ? u = [u, f] : (u = null, s = Te)) : (u = null, s = Te), u = u !== null ? u : "", u !== null ? (Te = s, o.charCodeAt(s) === 58 ? (f = ":", s++) : (f = null, d('":"')), f !== null ? (h = oe(), h !== null ? f = [f, h] : (f = null, s = Te)) : (f = null, s = Te), f = f !== null ? f : "", f !== null ? (Te = s, o.charCodeAt(s) === 58 ? (h = ":", s++) : (h = null, d('":"')), h !== null ? (m = oe(), m !== null ? h = [h, m] : (h = null, s = Te)) : (h = null, s = Te), h = h !== null ? h : "", h !== null ? (Te = s, o.charCodeAt(s) === 58 ? (m = ":", s++) : (m = null, d('":"')), m !== null ? (v = oe(), v !== null ? m = [m, v] : (m = null, s = Te)) : (m = null, s = Te), m = m !== null ? m : "", m !== null ? (Te = s, o.charCodeAt(s) === 58 ? (v = ":", s++) : (v = null, d('":"')), v !== null ? (S = oe(), S !== null ? v = [v, S] : (v = null, s = Te)) : (v = null, s = Te), v = v !== null ? v : "", v !== null ? (o.substr(s, 2) === "::" ? (S = "::", s += 2) : (S = null, d('"::"')), S !== null ? e = [e, l, u, f, h, m, v, S] : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C)) : (e = null, s = C))))))))))))))), e !== null && (e = function(S_) {
+            return w.host_type = "IPv6", o.substring(s, S_);
           }(k)), e === null && (s = k), e;
         }
         function oe() {
@@ -2884,7 +2884,7 @@ or && typeof or.ownKeys == "function" ? ro = or.ownKeys : Object.getOwnPropertyS
 } : ro = function(n) {
   return Object.getOwnPropertyNames(n);
 };
-function B_(c) {
+function G_(c) {
   console && console.warn && console.warn(c);
 }
 var Of = Number.isNaN || function(n) {
@@ -2894,7 +2894,7 @@ function ke() {
   ke.init.call(this);
 }
 pu.exports = ke;
-pu.exports.once = Y_;
+pu.exports.once = z_;
 ke.EventEmitter = ke;
 ke.prototype._events = void 0;
 ke.prototype._eventsCount = 0;
@@ -2965,7 +2965,7 @@ function Nf(c, n, r, o) {
   else if (typeof s == "function" ? s = t[n] = o ? [r, s] : [s, r] : o ? s.unshift(r) : s.push(r), a = Df(c), a > 0 && s.length > a && !s.warned) {
     s.warned = !0;
     var p = new Error("Possible EventEmitter memory leak detected. " + s.length + " " + String(n) + " listeners added. Use emitter.setMaxListeners() to increase limit");
-    p.name = "MaxListenersExceededWarning", p.emitter = c, p.type = n, p.count = s.length, B_(p);
+    p.name = "MaxListenersExceededWarning", p.emitter = c, p.type = n, p.count = s.length, G_(p);
   }
   return c;
 }
@@ -2976,12 +2976,12 @@ ke.prototype.on = ke.prototype.addListener;
 ke.prototype.prependListener = function(n, r) {
   return Nf(this, n, r, !0);
 };
-function G_() {
+function W_() {
   if (!this.fired)
     return this.target.removeListener(this.type, this.wrapFn), this.fired = !0, arguments.length === 0 ? this.listener.call(this.target) : this.listener.apply(this.target, arguments);
 }
 function Uf(c, n, r) {
-  var o = { fired: !1, wrapFn: void 0, target: c, type: n, listener: r }, a = G_.bind(o);
+  var o = { fired: !1, wrapFn: void 0, target: c, type: n, listener: r }, a = W_.bind(o);
   return a.listener = r, o.wrapFn = a, a;
 }
 ke.prototype.once = function(n, r) {
@@ -3006,7 +3006,7 @@ ke.prototype.removeListener = function(n, r) {
       }
     if (t < 0)
       return this;
-    t === 0 ? o.shift() : W_(o, t), o.length === 1 && (a[n] = o[0]), a.removeListener !== void 0 && this.emit("removeListener", n, p || r);
+    t === 0 ? o.shift() : K_(o, t), o.length === 1 && (a[n] = o[0]), a.removeListener !== void 0 && this.emit("removeListener", n, p || r);
   }
   return this;
 };
@@ -3035,7 +3035,7 @@ function Pf(c, n, r) {
   if (o === void 0)
     return [];
   var a = o[n];
-  return a === void 0 ? [] : typeof a == "function" ? r ? [a.listener || a] : [a] : r ? K_(a) : Mf(a, a.length);
+  return a === void 0 ? [] : typeof a == "function" ? r ? [a.listener || a] : [a] : r ? Y_(a) : Mf(a, a.length);
 }
 ke.prototype.listeners = function(n) {
   return Pf(this, n, !0);
@@ -3066,17 +3066,17 @@ function Mf(c, n) {
     r[o] = c[o];
   return r;
 }
-function W_(c, n) {
+function K_(c, n) {
   for (; n + 1 < c.length; n++)
     c[n] = c[n + 1];
   c.pop();
 }
-function K_(c) {
+function Y_(c) {
   for (var n = new Array(c.length), r = 0; r < n.length; ++r)
     n[r] = c[r].listener || c[r];
   return n;
 }
-function Y_(c, n) {
+function z_(c, n) {
   return new Promise(function(r, o) {
     function a(s) {
       c.removeListener(n, t), o(s);
@@ -3084,10 +3084,10 @@ function Y_(c, n) {
     function t() {
       typeof c.removeListener == "function" && c.removeListener("error", a), r([].slice.call(arguments));
     }
-    kf(c, n, t, { once: !0 }), n !== "error" && z_(c, a, { once: !0 });
+    kf(c, n, t, { once: !0 }), n !== "error" && J_(c, a, { once: !0 });
   });
 }
-function z_(c, n, r) {
+function J_(c, n, r) {
   typeof c.on == "function" && kf(c, "error", n, r);
 }
 function kf(c, n, r, o) {
@@ -3101,7 +3101,7 @@ function kf(c, n, r, o) {
     throw new TypeError('The "emitter" argument must be of type EventEmitter. Received type ' + typeof c);
 }
 var ct = pu.exports, za = { exports: {} }, ea, $u;
-function J_() {
+function X_() {
   if ($u)
     return ea;
   $u = 1;
@@ -3183,8 +3183,8 @@ function J_() {
   }
   return ea;
 }
-function X_(c) {
-  r.debug = r, r.default = r, r.coerce = _, r.disable = t, r.enable = a, r.enabled = s, r.humanize = J_(), r.destroy = d, Object.keys(c).forEach((g) => {
+function Q_(c) {
+  r.debug = r, r.default = r, r.coerce = _, r.disable = t, r.enable = a, r.enabled = s, r.humanize = X_(), r.destroy = d, Object.keys(c).forEach((g) => {
     r[g] = c[g];
   }), r.names = [], r.skips = [], r.formatters = {};
   function n(g) {
@@ -3264,7 +3264,7 @@ function X_(c) {
   }
   return r.enable(r.load()), r;
 }
-var Q_ = X_;
+var Z_ = Q_;
 (function(c, n) {
   n.formatArgs = o, n.save = a, n.load = t, n.useColors = r, n.storage = s(), n.destroy = (() => {
     let _ = !1;
@@ -3388,7 +3388,7 @@ var Q_ = X_;
     } catch {
     }
   }
-  c.exports = Q_(n);
+  c.exports = Z_(n);
   const { formatters: p } = c.exports;
   p.j = function(_) {
     try {
@@ -3399,7 +3399,7 @@ var Q_ = X_;
   };
 })(za, za.exports);
 var ur = za.exports;
-function Z_(c, n) {
+function eh(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -3409,14 +3409,14 @@ function Hu(c, n) {
     o.enumerable = o.enumerable || !1, o.configurable = !0, "value" in o && (o.writable = !0), Object.defineProperty(c, o.key, o);
   }
 }
-function eh(c, n, r) {
+function th(c, n, r) {
   return n && Hu(c.prototype, n), r && Hu(c, r), c;
 }
 var Zn = ur, er = "JsSIP", ft = /* @__PURE__ */ function() {
   function c(n) {
-    Z_(this, c), n ? (this._debug = Zn.default("".concat(er, ":").concat(n)), this._warn = Zn.default("".concat(er, ":WARN:").concat(n)), this._error = Zn.default("".concat(er, ":ERROR:").concat(n))) : (this._debug = Zn.default(er), this._warn = Zn.default("".concat(er, ":WARN")), this._error = Zn.default("".concat(er, ":ERROR"))), this._debug.log = console.info.bind(console), this._warn.log = console.warn.bind(console), this._error.log = console.error.bind(console);
+    eh(this, c), n ? (this._debug = Zn.default("".concat(er, ":").concat(n)), this._warn = Zn.default("".concat(er, ":WARN:").concat(n)), this._error = Zn.default("".concat(er, ":ERROR:").concat(n))) : (this._debug = Zn.default(er), this._warn = Zn.default("".concat(er, ":WARN")), this._error = Zn.default("".concat(er, ":ERROR"))), this._debug.log = console.info.bind(console), this._warn.log = console.warn.bind(console), this._error.log = console.error.bind(console);
   }
-  return eh(c, [{
+  return th(c, [{
     key: "debug",
     get: function() {
       return this._debug;
@@ -3935,9 +3935,9 @@ var Hf = $f.exports;
     });
   };
 })(Lf);
-var ta = Hf, th = /%[sdv%]/g, sh = function(c) {
+var ta = Hf, sh = /%[sdv%]/g, nh = function(c) {
   var n = 1, r = arguments, o = r.length;
-  return c.replace(th, function(a) {
+  return c.replace(sh, function(a) {
     if (n >= o)
       return a;
     var t = r[n];
@@ -3961,8 +3961,8 @@ var ta = Hf, th = /%[sdv%]/g, sh = function(c) {
     }
   else
     a.push(r[n.name]);
-  return sh.apply(null, a);
-}, nh = [
+  return nh.apply(null, a);
+}, rh = [
   "v",
   "o",
   "s",
@@ -3976,11 +3976,11 @@ var ta = Hf, th = /%[sdv%]/g, sh = function(c) {
   "r",
   "z",
   "a"
-], rh = ["i", "c", "b", "a"], ih = function(c, n) {
+], ih = ["i", "c", "b", "a"], lh = function(c, n) {
   n = n || {}, c.version == null && (c.version = 0), c.name == null && (c.name = " "), c.media.forEach(function(t) {
     t.payloads == null && (t.payloads = "");
   });
-  var r = n.outerOrder || nh, o = n.innerOrder || rh, a = [];
+  var r = n.outerOrder || rh, o = n.innerOrder || ih, a = [];
   return r.forEach(function(t) {
     ta[t].forEach(function(s) {
       s.name in c && c[s.name] != null ? a.push(yi(t, s, c)) : s.push in c && c[s.push] != null && c[s.push].forEach(function(p) {
@@ -3998,8 +3998,8 @@ var ta = Hf, th = /%[sdv%]/g, sh = function(c) {
   }), a.join(`\r
 `) + `\r
 `;
-}, En = Lf, lh = ih;
-Nt.write = lh;
+}, En = Lf, oh = lh;
+Nt.write = oh;
 Nt.parse = En.parse;
 Nt.parseParams = En.parseParams;
 Nt.parseFmtpConfig = En.parseFmtpConfig;
@@ -4026,7 +4026,7 @@ function Ja(c, n) {
   }, Ja(c, n);
 }
 function gu(c) {
-  var n = uh();
+  var n = ch();
   return function() {
     var o = go(c), a;
     if (n) {
@@ -4034,18 +4034,18 @@ function gu(c) {
       a = Reflect.construct(o, arguments, t);
     } else
       a = o.apply(this, arguments);
-    return oh(this, a);
+    return ah(this, a);
   };
 }
-function oh(c, n) {
-  return n && (io(n) === "object" || typeof n == "function") ? n : ah(c);
+function ah(c, n) {
+  return n && (io(n) === "object" || typeof n == "function") ? n : uh(c);
 }
-function ah(c) {
+function uh(c) {
   if (c === void 0)
     throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
   return c;
 }
-function uh() {
+function ch() {
   if (typeof Reflect > "u" || !Reflect.construct || Reflect.construct.sham)
     return !1;
   if (typeof Proxy == "function")
@@ -4065,7 +4065,7 @@ function go(c) {
 function jt(c, n) {
   var r;
   if (typeof Symbol > "u" || c[Symbol.iterator] == null) {
-    if (Array.isArray(c) || (r = ch(c)) || n && c && typeof c.length == "number") {
+    if (Array.isArray(c) || (r = fh(c)) || n && c && typeof c.length == "number") {
       r && (c = r);
       var o = 0, a = function() {
       };
@@ -4095,7 +4095,7 @@ In order to be iterable, non-array objects must have a [Symbol.iterator]() metho
     }
   } };
 }
-function ch(c, n) {
+function fh(c, n) {
   if (c) {
     if (typeof c == "string")
       return Vu(c, n);
@@ -4125,7 +4125,7 @@ function ju(c, n) {
 function Uo(c, n, r) {
   return n && ju(c.prototype, n), r && ju(c, r), c;
 }
-var Ff = Nt, fh = ft, Tt = rt, st = Ct(), qu = du(), _h = ns(), sa = new fh("SIPMessage"), Vf = /* @__PURE__ */ function() {
+var Ff = Nt, _h = ft, Tt = rt, st = Ct(), qu = du(), hh = ns(), sa = new _h("SIPMessage"), Vf = /* @__PURE__ */ function() {
   function c(n, r, o, a, t, s) {
     if (zi(this, c), !n || !r || !o)
       return null;
@@ -4319,7 +4319,7 @@ var Ff = Nt, fh = ft, Tt = rt, st = Ct(), qu = du(), _h = ns(), sa = new fh("SIP
       }, this), r.body = this.body, r.extraHeaders = st.cloneArray(this.extraHeaders), r.to = this.to, r.from = this.from, r.call_id = this.call_id, r.cseq = this.cseq, r;
     }
   }]), c;
-}(), hh = /* @__PURE__ */ function(c) {
+}(), dh = /* @__PURE__ */ function(c) {
   mu(r, c);
   var n = gu(r);
   function r(o, a, t, s, p) {
@@ -4418,7 +4418,7 @@ var Ff = Nt, fh = ft, Tt = rt, st = Ct(), qu = du(), _h = ns(), sa = new fh("SIP
       var a = this.headers[r][o], t = a.raw;
       if (a.parsed)
         return a.parsed;
-      var s = _h.parse(t, r.replace(/-/g, "_"));
+      var s = hh.parse(t, r.replace(/-/g, "_"));
       if (s === -1) {
         this.headers[r].splice(o, 1), sa.debug('error parsing "'.concat(r, '" header field with value "').concat(t, '"'));
         return;
@@ -4471,7 +4471,7 @@ var Ff = Nt, fh = ft, Tt = rt, st = Ct(), qu = du(), _h = ns(), sa = new fh("SIP
       return this.data;
     }
   }]), c;
-}(), dh = /* @__PURE__ */ function(c) {
+}(), ph = /* @__PURE__ */ function(c) {
   mu(r, c);
   var n = gu(r);
   function r(o) {
@@ -4607,7 +4607,7 @@ var Ff = Nt, fh = ft, Tt = rt, st = Ct(), qu = du(), _h = ns(), sa = new fh("SIP
 `), this.transport.send(p);
     }
   }]), r;
-}(jf), ph = /* @__PURE__ */ function(c) {
+}(jf), mh = /* @__PURE__ */ function(c) {
   mu(r, c);
   var n = gu(r);
   function r() {
@@ -4617,11 +4617,11 @@ var Ff = Nt, fh = ft, Tt = rt, st = Ct(), qu = du(), _h = ns(), sa = new fh("SIP
   return r;
 }(jf), ms = {
   OutgoingRequest: Vf,
-  InitialOutgoingInviteRequest: hh,
-  IncomingRequest: dh,
-  IncomingResponse: ph
+  InitialOutgoingInviteRequest: dh,
+  IncomingRequest: ph,
+  IncomingResponse: mh
 };
-function mh(c, n) {
+function gh(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -4631,14 +4631,14 @@ function Bu(c, n) {
     o.enumerable = o.enumerable || !1, o.configurable = !0, "value" in o && (o.writable = !0), Object.defineProperty(c, o.key, o);
   }
 }
-function gh(c, n, r) {
+function Th(c, n, r) {
   return n && Bu(c.prototype, n), r && Bu(c, r), c;
 }
-var Th = ft, as = Ct(), Gt = new Th("DigestAuthentication"), vh = /* @__PURE__ */ function() {
+var vh = ft, as = Ct(), Gt = new vh("DigestAuthentication"), Eh = /* @__PURE__ */ function() {
   function c(n) {
-    mh(this, c), this._credentials = n, this._cnonce = null, this._nc = 0, this._ncHex = "00000000", this._algorithm = null, this._realm = null, this._nonce = null, this._opaque = null, this._stale = null, this._qop = null, this._method = null, this._uri = null, this._ha1 = null, this._response = null;
+    gh(this, c), this._credentials = n, this._cnonce = null, this._nc = 0, this._ncHex = "00000000", this._algorithm = null, this._realm = null, this._nonce = null, this._opaque = null, this._stale = null, this._qop = null, this._method = null, this._uri = null, this._ha1 = null, this._response = null;
   }
-  return gh(c, [{
+  return Th(c, [{
     key: "get",
     value: function(r) {
       switch (r) {
@@ -4702,9 +4702,9 @@ var Th = ft, as = Ct(), Gt = new Th("DigestAuthentication"), vh = /* @__PURE__ *
       return r.push("algorithm=".concat(this._algorithm)), r.push('username="'.concat(this._credentials.username, '"')), r.push('realm="'.concat(this._realm, '"')), r.push('nonce="'.concat(this._nonce, '"')), r.push('uri="'.concat(this._uri, '"')), r.push('response="'.concat(this._response, '"')), this._opaque && r.push('opaque="'.concat(this._opaque, '"')), this._qop && (r.push("qop=".concat(this._qop)), r.push('cnonce="'.concat(this._cnonce, '"')), r.push("nc=".concat(this._ncHex))), "Digest ".concat(r.join(", "));
     }
   }]), c;
-}(), us = 500, Eh = 4e3, Gu = 5e3, qf = {
+}(), us = 500, Sh = 4e3, Gu = 5e3, qf = {
   T1: us,
-  T2: Eh,
+  T2: Sh,
   T4: Gu,
   TIMER_B: 64 * us,
   TIMER_D: 0 * us,
@@ -4750,7 +4750,7 @@ function Xa(c, n) {
   }, Xa(c, n);
 }
 function Zi(c) {
-  var n = yh();
+  var n = Ah();
   return function() {
     var o = To(c), a;
     if (n) {
@@ -4758,10 +4758,10 @@ function Zi(c) {
       a = Reflect.construct(o, arguments, t);
     } else
       a = o.apply(this, arguments);
-    return Sh(this, a);
+    return yh(this, a);
   };
 }
-function Sh(c, n) {
+function yh(c, n) {
   return n && (lo(n) === "object" || typeof n == "function") ? n : Ls(c);
 }
 function Ls(c) {
@@ -4769,7 +4769,7 @@ function Ls(c) {
     throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
   return c;
 }
-function yh() {
+function Ah() {
   if (typeof Reflect > "u" || !Reflect.construct || Reflect.construct.sham)
     return !1;
   if (typeof Proxy == "function")
@@ -4786,7 +4786,7 @@ function To(c) {
     return r.__proto__ || Object.getPrototypeOf(r);
   }, To(c);
 }
-var el = ct.EventEmitter, tl = ft, Vi = rt, Ku = ms, ts = qf, Yu = new tl("NonInviteClientTransaction"), Ol = new tl("InviteClientTransaction"), Ah = new tl("AckClientTransaction"), zu = new tl("NonInviteServerTransaction"), Dl = new tl("InviteServerTransaction"), _e = {
+var el = ct.EventEmitter, tl = ft, Vi = rt, Ku = ms, ts = qf, Yu = new tl("NonInviteClientTransaction"), Ol = new tl("InviteClientTransaction"), Ch = new tl("AckClientTransaction"), zu = new tl("NonInviteServerTransaction"), Dl = new tl("InviteServerTransaction"), _e = {
   // Transaction states.
   STATUS_TRYING: 1,
   STATUS_PROCEEDING: 2,
@@ -4800,7 +4800,7 @@ var el = ct.EventEmitter, tl = ft, Vi = rt, Ku = ms, ts = qf, Yu = new tl("NonIn
   NON_INVITE_SERVER: "nist",
   INVITE_CLIENT: "ict",
   INVITE_SERVER: "ist"
-}, Ch = /* @__PURE__ */ function(c) {
+}, Rh = /* @__PURE__ */ function(c) {
   Qi(r, c);
   var n = Zi(r);
   function r(o, a, t, s) {
@@ -4866,7 +4866,7 @@ var el = ct.EventEmitter, tl = ft, Vi = rt, Ku = ms, ts = qf, Yu = new tl("NonIn
       return _e;
     }
   }]), r;
-}(el), Rh = /* @__PURE__ */ function(c) {
+}(el), Ih = /* @__PURE__ */ function(c) {
   Qi(r, c);
   var n = Zi(r);
   function r(o, a, t, s) {
@@ -4976,7 +4976,7 @@ var el = ct.EventEmitter, tl = ft, Vi = rt, Ku = ms, ts = qf, Yu = new tl("NonIn
       return _e;
     }
   }]), r;
-}(el), Ih = /* @__PURE__ */ function(c) {
+}(el), bh = /* @__PURE__ */ function(c) {
   Qi(r, c);
   var n = Zi(r);
   function r(o, a, t, s) {
@@ -4993,7 +4993,7 @@ var el = ct.EventEmitter, tl = ft, Vi = rt, Ku = ms, ts = qf, Yu = new tl("NonIn
   }, {
     key: "onTransportError",
     value: function() {
-      Ah.debug("transport error occurred for transaction ".concat(this.id)), this.eventHandlers.onTransportError();
+      Ch.debug("transport error occurred for transaction ".concat(this.id)), this.eventHandlers.onTransportError();
     }
   }, {
     key: "C",
@@ -5001,7 +5001,7 @@ var el = ct.EventEmitter, tl = ft, Vi = rt, Ku = ms, ts = qf, Yu = new tl("NonIn
       return _e;
     }
   }]), r;
-}(el), bh = /* @__PURE__ */ function(c) {
+}(el), wh = /* @__PURE__ */ function(c) {
   Qi(r, c);
   var n = Zi(r);
   function r(o, a, t) {
@@ -5054,7 +5054,7 @@ var el = ct.EventEmitter, tl = ft, Vi = rt, Ku = ms, ts = qf, Yu = new tl("NonIn
       return _e;
     }
   }]), r;
-}(el), wh = /* @__PURE__ */ function(c) {
+}(el), Oh = /* @__PURE__ */ function(c) {
   Qi(r, c);
   var n = Zi(r);
   function r(o, a, t) {
@@ -5133,7 +5133,7 @@ var el = ct.EventEmitter, tl = ft, Vi = rt, Ku = ms, ts = qf, Yu = new tl("NonIn
     }
   }]), r;
 }(el);
-function Oh(c, n) {
+function Dh(c, n) {
   var r = c._transactions, o;
   switch (n.method) {
     case Vi.INVITE:
@@ -5178,14 +5178,14 @@ function Oh(c, n) {
 }
 var sl = {
   C: _e,
-  NonInviteClientTransaction: Ch,
-  InviteClientTransaction: Rh,
-  AckClientTransaction: Ih,
-  NonInviteServerTransaction: bh,
-  InviteServerTransaction: wh,
-  checkTransaction: Oh
+  NonInviteClientTransaction: Rh,
+  InviteClientTransaction: Ih,
+  AckClientTransaction: bh,
+  NonInviteServerTransaction: wh,
+  InviteServerTransaction: Oh,
+  checkTransaction: Dh
 };
-function Dh(c, n) {
+function Nh(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -5195,10 +5195,10 @@ function Ju(c, n) {
     o.enumerable = o.enumerable || !1, o.configurable = !0, "value" in o && (o.writable = !0), Object.defineProperty(c, o.key, o);
   }
 }
-function Nh(c, n, r) {
+function Uh(c, n, r) {
   return n && Ju(c.prototype, n), r && Ju(c, r), c;
 }
-var Uh = ft, Xu = rt, Ph = vh, na = sl, xh = new Uh("RequestSender"), ra = {
+var Ph = ft, Xu = rt, xh = Eh, na = sl, Mh = new Ph("RequestSender"), ra = {
   onRequestTimeout: function() {
   },
   onTransportError: function() {
@@ -5209,12 +5209,12 @@ var Uh = ft, Xu = rt, Ph = vh, na = sl, xh = new Uh("RequestSender"), ra = {
   }
 }, nl = /* @__PURE__ */ function() {
   function c(n, r, o) {
-    Dh(this, c), this._ua = n, this._eventHandlers = o, this._method = r.method, this._request = r, this._auth = null, this._challenged = !1, this._staled = !1;
+    Nh(this, c), this._ua = n, this._eventHandlers = o, this._method = r.method, this._request = r, this._auth = null, this._challenged = !1, this._staled = !1;
     for (var a in ra)
       Object.prototype.hasOwnProperty.call(ra, a) && (this._eventHandlers[a] || (this._eventHandlers[a] = ra[a]));
     n.status === n.C.STATUS_USER_CLOSED && (this._method !== Xu.BYE || this._method !== Xu.ACK) && this._eventHandlers.onTransportError();
   }
-  return Nh(c, [{
+  return Uh(c, [{
     key: "send",
     value: function() {
       var r = this, o = {
@@ -5250,11 +5250,11 @@ var Uh = ft, Xu = rt, Ph = vh, na = sl, xh = new Uh("RequestSender"), ra = {
       var o, a, t = r.status_code;
       if ((t === 401 || t === 407) && (this._ua.configuration.password !== null || this._ua.configuration.ha1 !== null)) {
         if (r.status_code === 401 ? (o = r.parseHeader("www-authenticate"), a = "authorization") : (o = r.parseHeader("proxy-authenticate"), a = "proxy-authorization"), !o) {
-          xh.debug("".concat(r.status_code, " with wrong or missing challenge, cannot authenticate")), this._eventHandlers.onReceiveResponse(r);
+          Mh.debug("".concat(r.status_code, " with wrong or missing challenge, cannot authenticate")), this._eventHandlers.onReceiveResponse(r);
           return;
         }
         if (!this._challenged || !this._staled && o.stale === !0) {
-          if (this._auth || (this._auth = new Ph({
+          if (this._auth || (this._auth = new xh({
             username: this._ua.configuration.authorization_user,
             password: this._ua.configuration.password,
             realm: this._ua.configuration.realm,
@@ -5271,7 +5271,7 @@ var Uh = ft, Xu = rt, Ph = vh, na = sl, xh = new Uh("RequestSender"), ra = {
     }
   }]), c;
 }();
-function Mh(c, n) {
+function kh(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -5281,14 +5281,14 @@ function Qu(c, n) {
     o.enumerable = o.enumerable || !1, o.configurable = !0, "value" in o && (o.writable = !0), Object.defineProperty(c, o.key, o);
   }
 }
-function kh(c, n, r) {
+function Lh(c, n, r) {
   return n && Qu(c.prototype, n), r && Qu(c, r), c;
 }
-var Lh = ft, ia = Ct(), an = rt, Zu = ms, ec = nl, Ai = new Lh("Registrator"), Nl = 10, $h = /* @__PURE__ */ function() {
+var $h = ft, ia = Ct(), an = rt, Zu = ms, ec = nl, Ai = new $h("Registrator"), Nl = 10, Hh = /* @__PURE__ */ function() {
   function c(n, r) {
-    Mh(this, c), this._reg_id = 1, this._ua = n, this._transport = r, this._registrar = n.configuration.registrar_server, this._expires = n.configuration.register_expires, this._call_id = ia.createRandomToken(22), this._cseq = 0, this._to_uri = n.configuration.uri, this._registrationTimer = null, this._registering = !1, this._registered = !1, this._contact = this._ua.contact.toString(), this._contact += ";+sip.ice", this._extraHeaders = [], this._extraContactParams = "", this._sipInstance = '"<urn:uuid:'.concat(this._ua.configuration.instance_id, '>"'), this._contact += ";reg-id=".concat(this._reg_id), this._contact += ";+sip.instance=".concat(this._sipInstance);
+    kh(this, c), this._reg_id = 1, this._ua = n, this._transport = r, this._registrar = n.configuration.registrar_server, this._expires = n.configuration.register_expires, this._call_id = ia.createRandomToken(22), this._cseq = 0, this._to_uri = n.configuration.uri, this._registrationTimer = null, this._registering = !1, this._registered = !1, this._contact = this._ua.contact.toString(), this._contact += ";+sip.ice", this._extraHeaders = [], this._extraContactParams = "", this._sipInstance = '"<urn:uuid:'.concat(this._ua.configuration.instance_id, '>"'), this._contact += ";reg-id=".concat(this._reg_id), this._contact += ";+sip.instance=".concat(this._sipInstance);
   }
-  return kh(c, [{
+  return Lh(c, [{
     key: "setExtraHeaders",
     value: function(r) {
       Array.isArray(r) || (r = []), this._extraHeaders = r.slice();
@@ -5450,7 +5450,7 @@ var Lh = ft, ia = Ct(), an = rt, Zu = ms, ec = nl, Ai = new Lh("Registrator"), N
     }
   }]), c;
 }();
-function Hh(c, n) {
+function Fh(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -5460,10 +5460,10 @@ function tc(c, n) {
     o.enumerable = o.enumerable || !1, o.configurable = !0, "value" in o && (o.writable = !0), Object.defineProperty(c, o.key, o);
   }
 }
-function Fh(c, n, r) {
+function Vh(c, n, r) {
   return n && tc(c.prototype, n), r && tc(c, r), c;
 }
-var la = rt, Ul = sl, Vh = nl, oa = {
+var la = rt, Ul = sl, jh = nl, oa = {
   onRequestTimeout: function() {
   },
   onTransportError: function() {
@@ -5476,16 +5476,16 @@ var la = rt, Ul = sl, Vh = nl, oa = {
   },
   onDialogError: function() {
   }
-}, jh = /* @__PURE__ */ function() {
+}, qh = /* @__PURE__ */ function() {
   function c(n, r, o) {
-    Hh(this, c), this._dialog = n, this._ua = n._ua, this._request = r, this._eventHandlers = o, this._reattempt = !1, this._reattemptTimer = null;
+    Fh(this, c), this._dialog = n, this._ua = n._ua, this._request = r, this._eventHandlers = o, this._reattempt = !1, this._reattemptTimer = null;
     for (var a in oa)
       Object.prototype.hasOwnProperty.call(oa, a) && (this._eventHandlers[a] || (this._eventHandlers[a] = oa[a]));
   }
-  return Fh(c, [{
+  return Vh(c, [{
     key: "send",
     value: function() {
-      var r = this, o = new Vh(this._ua, this._request, {
+      var r = this, o = new jh(this._ua, this._request, {
         onRequestTimeout: function() {
           r._eventHandlers.onRequestTimeout();
         },
@@ -5522,7 +5522,7 @@ var la = rt, Ul = sl, Vh = nl, oa = {
     }
   }]), c;
 }();
-function qh(c, n) {
+function Bh(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -5535,12 +5535,12 @@ function sc(c, n) {
 function nc(c, n, r) {
   return n && sc(c.prototype, n), r && sc(c, r), c;
 }
-var Bh = ft, rc = ms, Ns = rt, Ci = sl, Gh = jh, aa = Ct(), ua = new Bh("Dialog"), Us = {
+var Gh = ft, rc = ms, Ns = rt, Ci = sl, Wh = qh, aa = Ct(), ua = new Gh("Dialog"), Us = {
   // Dialog states.
   STATUS_EARLY: 1,
   STATUS_CONFIRMED: 2,
   STATUS_TERMINATED: 3
-}, Wh = /* @__PURE__ */ function() {
+}, Kh = /* @__PURE__ */ function() {
   nc(c, null, [{
     key: "C",
     // Expose C object.
@@ -5550,7 +5550,7 @@ var Bh = ft, rc = ms, Ns = rt, Ci = sl, Gh = jh, aa = Ct(), ua = new Bh("Dialog"
   }]);
   function c(n, r, o) {
     var a = arguments.length > 3 && arguments[3] !== void 0 ? arguments[3] : Us.STATUS_CONFIRMED;
-    if (qh(this, c), this._owner = n, this._ua = n._ua, this._uac_pending_reply = !1, this._uas_pending_reply = !1, !r.hasHeader("contact"))
+    if (Bh(this, c), this._owner = n, this._ua = n._ua, this._uac_pending_reply = !1, this._uas_pending_reply = !1, !r.hasHeader("contact"))
       return {
         error: "unable to create a Dialog without Contact header field"
       };
@@ -5594,7 +5594,7 @@ var Bh = ft, rc = ms, Ns = rt, Ci = sl, Gh = jh, aa = Ct(), ua = new Bh("Dialog"
       s.onAuthenticated = function() {
         o._local_seqnum += 1;
       };
-      var d = new Gh(this, _, s);
+      var d = new Wh(this, _, s);
       return d.send(), _;
     }
   }, {
@@ -5696,7 +5696,7 @@ function oo(c) {
     return r && typeof Symbol == "function" && r.constructor === Symbol && r !== Symbol.prototype ? "symbol" : typeof r;
   }, oo(c);
 }
-function Kh(c, n) {
+function Yh(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -5706,10 +5706,10 @@ function ic(c, n) {
     o.enumerable = o.enumerable || !1, o.configurable = !0, "value" in o && (o.writable = !0), Object.defineProperty(c, o.key, o);
   }
 }
-function Yh(c, n, r) {
+function zh(c, n, r) {
   return n && ic(c.prototype, n), r && ic(c, r), c;
 }
-function zh(c, n) {
+function Jh(c, n) {
   if (typeof n != "function" && n !== null)
     throw new TypeError("Super expression must either be null or a function");
   c.prototype = Object.create(n && n.prototype, { constructor: { value: c, writable: !0, configurable: !0 } }), n && Qa(c, n);
@@ -5719,8 +5719,8 @@ function Qa(c, n) {
     return o.__proto__ = a, o;
   }, Qa(c, n);
 }
-function Jh(c) {
-  var n = Zh();
+function Xh(c) {
+  var n = ed();
   return function() {
     var o = vo(c), a;
     if (n) {
@@ -5728,18 +5728,18 @@ function Jh(c) {
       a = Reflect.construct(o, arguments, t);
     } else
       a = o.apply(this, arguments);
-    return Xh(this, a);
+    return Qh(this, a);
   };
 }
-function Xh(c, n) {
-  return n && (oo(n) === "object" || typeof n == "function") ? n : Qh(c);
+function Qh(c, n) {
+  return n && (oo(n) === "object" || typeof n == "function") ? n : Zh(c);
 }
-function Qh(c) {
+function Zh(c) {
   if (c === void 0)
     throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
   return c;
 }
-function Zh() {
+function ed() {
   if (typeof Reflect > "u" || !Reflect.construct || Reflect.construct.sham)
     return !1;
   if (typeof Proxy == "function")
@@ -5756,7 +5756,7 @@ function vo(c) {
     return r.__proto__ || Object.getPrototypeOf(r);
   }, vo(c);
 }
-var ed = ct.EventEmitter, td = ft, sd = rt, nd = Hs, lc = Ct(), rd = new td("RTCSession:DTMF"), Bf = {
+var td = ct.EventEmitter, sd = ft, nd = rt, rd = Hs, lc = Ct(), id = new sd("RTCSession:DTMF"), Bf = {
   MIN_DURATION: 70,
   MAX_DURATION: 6e3,
   DEFAULT_DURATION: 100,
@@ -5764,20 +5764,20 @@ var ed = ct.EventEmitter, td = ft, sd = rt, nd = Hs, lc = Ct(), rd = new td("RTC
   DEFAULT_INTER_TONE_GAP: 500
 };
 Tu.exports = /* @__PURE__ */ function(c) {
-  zh(r, c);
-  var n = Jh(r);
+  Jh(r, c);
+  var n = Xh(r);
   function r(o) {
     var a;
-    return Kh(this, r), a = n.call(this), a._session = o, a._direction = null, a._tone = null, a._duration = null, a._request = null, a;
+    return Yh(this, r), a = n.call(this), a._session = o, a._direction = null, a._tone = null, a._duration = null, a._request = null, a;
   }
-  return Yh(r, [{
+  return zh(r, [{
     key: "send",
     value: function(a) {
       var t = this, s = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {};
       if (a === void 0)
         throw new TypeError("Not enough arguments");
       if (this._direction = "outgoing", this._session.status !== this._session.C.STATUS_CONFIRMED && this._session.status !== this._session.C.STATUS_WAITING_FOR_ACK)
-        throw new nd.InvalidStateError(this._session.status);
+        throw new rd.InvalidStateError(this._session.status);
       var p = lc.cloneArray(s.extraHeaders);
       if (this.eventHandlers = lc.cloneObject(s.eventHandlers), typeof a == "string")
         a = a.toUpperCase();
@@ -5796,7 +5796,7 @@ Tu.exports = /* @__PURE__ */ function(c) {
         originator: "local",
         dtmf: this,
         request: this._request
-      }), this._session.sendRequest(sd.INFO, {
+      }), this._session.sendRequest(nd.INFO, {
         extraHeaders: p,
         eventHandlers: {
           onSuccessResponse: function(g) {
@@ -5837,7 +5837,7 @@ Tu.exports = /* @__PURE__ */ function(c) {
         originator: "remote",
         dtmf: this,
         request: a
-      }) : rd.debug("invalid INFO DTMF received, discarded");
+      }) : id.debug("invalid INFO DTMF received, discarded");
     }
   }, {
     key: "tone",
@@ -5850,9 +5850,9 @@ Tu.exports = /* @__PURE__ */ function(c) {
       return this._duration;
     }
   }]), r;
-}(ed);
+}(td);
 Tu.exports.C = Bf;
-var id = Tu.exports;
+var ld = Tu.exports;
 function ao(c) {
   "@babel/helpers - typeof";
   return typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? ao = function(r) {
@@ -5861,7 +5861,7 @@ function ao(c) {
     return r && typeof Symbol == "function" && r.constructor === Symbol && r !== Symbol.prototype ? "symbol" : typeof r;
   }, ao(c);
 }
-function ld(c, n) {
+function od(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -5871,10 +5871,10 @@ function oc(c, n) {
     o.enumerable = o.enumerable || !1, o.configurable = !0, "value" in o && (o.writable = !0), Object.defineProperty(c, o.key, o);
   }
 }
-function od(c, n, r) {
+function ad(c, n, r) {
   return n && oc(c.prototype, n), r && oc(c, r), c;
 }
-function ad(c, n) {
+function ud(c, n) {
   if (typeof n != "function" && n !== null)
     throw new TypeError("Super expression must either be null or a function");
   c.prototype = Object.create(n && n.prototype, { constructor: { value: c, writable: !0, configurable: !0 } }), n && Za(c, n);
@@ -5884,8 +5884,8 @@ function Za(c, n) {
     return o.__proto__ = a, o;
   }, Za(c, n);
 }
-function ud(c) {
-  var n = _d();
+function cd(c) {
+  var n = hd();
   return function() {
     var o = Eo(c), a;
     if (n) {
@@ -5893,18 +5893,18 @@ function ud(c) {
       a = Reflect.construct(o, arguments, t);
     } else
       a = o.apply(this, arguments);
-    return cd(this, a);
+    return fd(this, a);
   };
 }
-function cd(c, n) {
-  return n && (ao(n) === "object" || typeof n == "function") ? n : fd(c);
+function fd(c, n) {
+  return n && (ao(n) === "object" || typeof n == "function") ? n : _d(c);
 }
-function fd(c) {
+function _d(c) {
   if (c === void 0)
     throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
   return c;
 }
-function _d() {
+function hd() {
   if (typeof Reflect > "u" || !Reflect.construct || Reflect.construct.sham)
     return !1;
   if (typeof Proxy == "function")
@@ -5921,28 +5921,28 @@ function Eo(c) {
     return r.__proto__ || Object.getPrototypeOf(r);
   }, Eo(c);
 }
-var hd = ct.EventEmitter, dd = rt, pd = Hs, md = Ct(), gd = /* @__PURE__ */ function(c) {
-  ad(r, c);
-  var n = ud(r);
+var dd = ct.EventEmitter, pd = rt, md = Hs, gd = Ct(), Td = /* @__PURE__ */ function(c) {
+  ud(r, c);
+  var n = cd(r);
   function r(o) {
     var a;
-    return ld(this, r), a = n.call(this), a._session = o, a._direction = null, a._contentType = null, a._body = null, a;
+    return od(this, r), a = n.call(this), a._session = o, a._direction = null, a._contentType = null, a._body = null, a;
   }
-  return od(r, [{
+  return ad(r, [{
     key: "send",
     value: function(a, t) {
       var s = this, p = arguments.length > 2 && arguments[2] !== void 0 ? arguments[2] : {};
       if (this._direction = "outgoing", a === void 0)
         throw new TypeError("Not enough arguments");
       if (this._session.status !== this._session.C.STATUS_CONFIRMED && this._session.status !== this._session.C.STATUS_WAITING_FOR_ACK)
-        throw new pd.InvalidStateError(this._session.status);
+        throw new md.InvalidStateError(this._session.status);
       this._contentType = a, this._body = t;
-      var _ = md.cloneArray(p.extraHeaders);
+      var _ = gd.cloneArray(p.extraHeaders);
       _.push("Content-Type: ".concat(a)), this._session.newInfo({
         originator: "local",
         info: this,
         request: this.request
-      }), this._session.sendRequest(dd.INFO, {
+      }), this._session.sendRequest(pd.INFO, {
         extraHeaders: _,
         eventHandlers: {
           onSuccessResponse: function(g) {
@@ -5990,8 +5990,8 @@ var hd = ct.EventEmitter, dd = rt, pd = Hs, md = Ct(), gd = /* @__PURE__ */ func
       return this._body;
     }
   }]), r;
-}(hd);
-function Td(c, n) {
+}(dd);
+function vd(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -6001,21 +6001,21 @@ function ac(c, n) {
     o.enumerable = o.enumerable || !1, o.configurable = !0, "value" in o && (o.writable = !0), Object.defineProperty(c, o.key, o);
   }
 }
-function vd(c, n, r) {
+function Ed(c, n, r) {
   return n && ac(c.prototype, n), r && ac(c, r), c;
 }
-var Ed = ft, uc = rt, Sd = new Ed("RTCSession:ReferNotifier"), ca = {
+var Sd = ft, uc = rt, yd = new Sd("RTCSession:ReferNotifier"), ca = {
   event_type: "refer",
   body_type: "message/sipfrag;version=2.0",
   expires: 300
-}, yd = /* @__PURE__ */ function() {
+}, Ad = /* @__PURE__ */ function() {
   function c(n, r, o) {
-    Td(this, c), this._session = n, this._id = r, this._expires = o || ca.expires, this._active = !0, this.notify(100);
+    vd(this, c), this._session = n, this._id = r, this._expires = o || ca.expires, this._active = !0, this.notify(100);
   }
-  return vd(c, [{
+  return Ed(c, [{
     key: "notify",
     value: function(r, o) {
-      if (Sd.debug("notify()"), this._active !== !1) {
+      if (yd.debug("notify()"), this._active !== !1) {
         o = o || uc.REASON_PHRASE[r] || "";
         var a;
         r >= 200 ? a = "terminated;reason=noresource" : a = "active;expires=".concat(this._expires), this._session.sendRequest(uc.NOTIFY, {
@@ -6040,7 +6040,7 @@ function uo(c) {
     return r && typeof Symbol == "function" && r.constructor === Symbol && r !== Symbol.prototype ? "symbol" : typeof r;
   }, uo(c);
 }
-function Ad(c, n) {
+function Cd(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -6050,10 +6050,10 @@ function cc(c, n) {
     o.enumerable = o.enumerable || !1, o.configurable = !0, "value" in o && (o.writable = !0), Object.defineProperty(c, o.key, o);
   }
 }
-function Cd(c, n, r) {
+function Rd(c, n, r) {
   return n && cc(c.prototype, n), r && cc(c, r), c;
 }
-function Rd(c, n) {
+function Id(c, n) {
   if (typeof n != "function" && n !== null)
     throw new TypeError("Super expression must either be null or a function");
   c.prototype = Object.create(n && n.prototype, { constructor: { value: c, writable: !0, configurable: !0 } }), n && eu(c, n);
@@ -6063,8 +6063,8 @@ function eu(c, n) {
     return o.__proto__ = a, o;
   }, eu(c, n);
 }
-function Id(c) {
-  var n = Od();
+function bd(c) {
+  var n = Dd();
   return function() {
     var o = So(c), a;
     if (n) {
@@ -6072,18 +6072,18 @@ function Id(c) {
       a = Reflect.construct(o, arguments, t);
     } else
       a = o.apply(this, arguments);
-    return bd(this, a);
+    return wd(this, a);
   };
 }
-function bd(c, n) {
-  return n && (uo(n) === "object" || typeof n == "function") ? n : wd(c);
+function wd(c, n) {
+  return n && (uo(n) === "object" || typeof n == "function") ? n : Od(c);
 }
-function wd(c) {
+function Od(c) {
   if (c === void 0)
     throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
   return c;
 }
-function Od() {
+function Dd() {
   if (typeof Reflect > "u" || !Reflect.construct || Reflect.construct.sham)
     return !1;
   if (typeof Proxy == "function")
@@ -6100,14 +6100,14 @@ function So(c) {
     return r.__proto__ || Object.getPrototypeOf(r);
   }, So(c);
 }
-var Dd = ct.EventEmitter, Nd = ft, Ri = rt, Ud = ns(), fc = Ct(), un = new Nd("RTCSession:ReferSubscriber"), Pd = /* @__PURE__ */ function(c) {
-  Rd(r, c);
-  var n = Id(r);
+var Nd = ct.EventEmitter, Ud = ft, Ri = rt, Pd = ns(), fc = Ct(), un = new Ud("RTCSession:ReferSubscriber"), xd = /* @__PURE__ */ function(c) {
+  Id(r, c);
+  var n = bd(r);
   function r(o) {
     var a;
-    return Ad(this, r), a = n.call(this), a._id = null, a._session = o, a;
+    return Cd(this, r), a = n.call(this), a._id = null, a._session = o, a;
   }
-  return Cd(r, [{
+  return Rd(r, [{
     key: "sendRefer",
     value: function(a) {
       var t = this, s = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {};
@@ -6151,7 +6151,7 @@ var Dd = ct.EventEmitter, Nd = ft, Ri = rt, Ud = ns(), fc = Ct(), un = new Nd("R
     key: "receiveNotify",
     value: function(a) {
       if (un.debug("receiveNotify()"), !!a.body) {
-        var t = Ud.parse(a.body.trim().split(`\r
+        var t = Pd.parse(a.body.trim().split(`\r
 `, 1)[0], "Status_Line");
         if (t === -1) {
           un.debug('receiveNotify() | error parsing NOTIFY body: "'.concat(a.body, '"'));
@@ -6206,7 +6206,7 @@ var Dd = ct.EventEmitter, Nd = ft, Ri = rt, Ud = ns(), fc = Ct(), un = new Nd("R
       return this._id;
     }
   }]), r;
-}(Dd);
+}(Nd);
 function co(c) {
   "@babel/helpers - typeof";
   return typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? co = function(r) {
@@ -6218,7 +6218,7 @@ function co(c) {
 function cs(c, n) {
   var r;
   if (typeof Symbol > "u" || c[Symbol.iterator] == null) {
-    if (Array.isArray(c) || (r = xd(c)) || n && c && typeof c.length == "number") {
+    if (Array.isArray(c) || (r = Md(c)) || n && c && typeof c.length == "number") {
       r && (c = r);
       var o = 0, a = function() {
       };
@@ -6248,7 +6248,7 @@ In order to be iterable, non-array objects must have a [Symbol.iterator]() metho
     }
   } };
 }
-function xd(c, n) {
+function Md(c, n) {
   if (c) {
     if (typeof c == "string")
       return _c(c, n);
@@ -6265,7 +6265,7 @@ function _c(c, n) {
     o[r] = c[r];
   return o;
 }
-function Md(c, n) {
+function kd(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -6278,7 +6278,7 @@ function hc(c, n) {
 function dc(c, n, r) {
   return n && hc(c.prototype, n), r && hc(c, r), c;
 }
-function kd(c, n) {
+function Ld(c, n) {
   if (typeof n != "function" && n !== null)
     throw new TypeError("Super expression must either be null or a function");
   c.prototype = Object.create(n && n.prototype, { constructor: { value: c, writable: !0, configurable: !0 } }), n && tu(c, n);
@@ -6288,8 +6288,8 @@ function tu(c, n) {
     return o.__proto__ = a, o;
   }, tu(c, n);
 }
-function Ld(c) {
-  var n = Fd();
+function $d(c) {
+  var n = Vd();
   return function() {
     var o = yo(c), a;
     if (n) {
@@ -6297,18 +6297,18 @@ function Ld(c) {
       a = Reflect.construct(o, arguments, t);
     } else
       a = o.apply(this, arguments);
-    return $d(this, a);
+    return Hd(this, a);
   };
 }
-function $d(c, n) {
-  return n && (co(n) === "object" || typeof n == "function") ? n : Hd(c);
+function Hd(c, n) {
+  return n && (co(n) === "object" || typeof n == "function") ? n : Fd(c);
 }
-function Hd(c) {
+function Fd(c) {
   if (c === void 0)
     throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
   return c;
 }
-function Fd() {
+function Vd() {
   if (typeof Reflect > "u" || !Reflect.construct || Reflect.construct.sham)
     return !1;
   if (typeof Proxy == "function")
@@ -6325,7 +6325,7 @@ function yo(c) {
     return r.__proto__ || Object.getPrototypeOf(r);
   }, yo(c);
 }
-var Vd = ct.EventEmitter, pc = Nt, jd = ft, ce = rt, cn = Hs, mc = sl, qe = Ct(), Ii = qf, qd = ms, Pl = Wh, Bd = nl, Ut = id, gc = gd, Gd = yd, Wd = Pd, Tc = Fs(), K = new jd("RTCSession"), X = {
+var jd = ct.EventEmitter, pc = Nt, qd = ft, ce = rt, cn = Hs, mc = sl, qe = Ct(), Ii = qf, Bd = ms, Pl = Kh, Gd = nl, Ut = ld, gc = Td, Wd = Ad, Kd = xd, Tc = Fs(), K = new qd("RTCSession"), X = {
   // RTCSession states.
   STATUS_NULL: 0,
   STATUS_INVITE_SENT: 1,
@@ -6337,9 +6337,9 @@ var Vd = ct.EventEmitter, pc = Nt, jd = ft, ce = rt, cn = Hs, mc = sl, qe = Ct()
   STATUS_CANCELED: 7,
   STATUS_TERMINATED: 8,
   STATUS_CONFIRMED: 9
-}, xl = ["audio", "video"], Kd = /* @__PURE__ */ function(c) {
-  kd(r, c);
-  var n = Ld(r);
+}, xl = ["audio", "video"], Yd = /* @__PURE__ */ function(c) {
+  Ld(r, c);
+  var n = $d(r);
   dc(r, null, [{
     key: "C",
     /**
@@ -6351,7 +6351,7 @@ var Vd = ct.EventEmitter, pc = Nt, jd = ft, ce = rt, cn = Hs, mc = sl, qe = Ct()
   }]);
   function r(o) {
     var a;
-    return Md(this, r), K.debug("new"), a = n.call(this), a._id = null, a._ua = o, a._status = X.STATUS_NULL, a._dialog = null, a._earlyDialogs = {}, a._contact = null, a._from_tag = null, a._to_tag = null, a._connection = null, a._connectionPromiseQueue = Promise.resolve(), a._request = null, a._is_canceled = !1, a._cancel_reason = "", a._is_confirmed = !1, a._late_sdp = !1, a._rtcOfferConstraints = null, a._rtcAnswerConstraints = null, a._localMediaStream = null, a._localMediaStreamLocallyGenerated = !1, a._rtcReady = !0, a._iceReady = !1, a._timers = {
+    return kd(this, r), K.debug("new"), a = n.call(this), a._id = null, a._ua = o, a._status = X.STATUS_NULL, a._dialog = null, a._earlyDialogs = {}, a._contact = null, a._from_tag = null, a._to_tag = null, a._connection = null, a._connectionPromiseQueue = Promise.resolve(), a._request = null, a._is_canceled = !1, a._cancel_reason = "", a._is_confirmed = !1, a._late_sdp = !1, a._rtcOfferConstraints = null, a._rtcAnswerConstraints = null, a._localMediaStream = null, a._localMediaStreamLocallyGenerated = !1, a._rtcReady = !0, a._iceReady = !1, a._timers = {
       ackTimer: null,
       expiresTimer: null,
       invite2xxTimer: null,
@@ -6450,7 +6450,7 @@ var Vd = ct.EventEmitter, pc = Nt, jd = ft, ce = rt, cn = Hs, mc = sl, qe = Ct()
       this._contact = this._ua.contact.toString({
         anonymous: I,
         outbound: !0
-      }), I ? ($.from_display_name = "Anonymous", $.from_uri = new Tc("sip", "anonymous", "anonymous.invalid"), d.push("P-Preferred-Identity: ".concat(this._ua.configuration.uri.toString())), d.push("Privacy: id")) : t.fromUserName && ($.from_uri = new Tc("sip", t.fromUserName, this._ua.configuration.uri.host), d.push("P-Preferred-Identity: ".concat(this._ua.configuration.uri.toString()))), t.fromDisplayName && ($.from_display_name = t.fromDisplayName), d.push("Contact: ".concat(this._contact)), d.push("Content-Type: application/sdp"), this._sessionTimers.enabled && d.push("Session-Expires: ".concat(this._sessionTimers.defaultExpires).concat(this._ua.configuration.session_timers_force_refresher ? ";refresher=uac" : "")), this._request = new qd.InitialOutgoingInviteRequest(a, this._ua, $, d), this._id = this._request.call_id + this._from_tag, this._createRTCConnection(E, y), this._direction = "outgoing", this._local_identity = this._request.from, this._remote_identity = this._request.to, s && s(this), this._newRTCSession("local", this._request), this._sendInitialRequest(g, A, T);
+      }), I ? ($.from_display_name = "Anonymous", $.from_uri = new Tc("sip", "anonymous", "anonymous.invalid"), d.push("P-Preferred-Identity: ".concat(this._ua.configuration.uri.toString())), d.push("Privacy: id")) : t.fromUserName && ($.from_uri = new Tc("sip", t.fromUserName, this._ua.configuration.uri.host), d.push("P-Preferred-Identity: ".concat(this._ua.configuration.uri.toString()))), t.fromDisplayName && ($.from_display_name = t.fromDisplayName), d.push("Contact: ".concat(this._contact)), d.push("Content-Type: application/sdp"), this._sessionTimers.enabled && d.push("Session-Expires: ".concat(this._sessionTimers.defaultExpires).concat(this._ua.configuration.session_timers_force_refresher ? ";refresher=uac" : "")), this._request = new Bd.InitialOutgoingInviteRequest(a, this._ua, $, d), this._id = this._request.call_id + this._from_tag, this._createRTCConnection(E, y), this._direction = "outgoing", this._local_identity = this._request.from, this._remote_identity = this._request.to, s && s(this), this._newRTCSession("local", this._request), this._sendInitialRequest(g, A, T);
     }
   }, {
     key: "init_incoming",
@@ -6828,7 +6828,7 @@ var Vd = ct.EventEmitter, pc = Nt, jd = ft, ce = rt, cn = Hs, mc = sl, qe = Ct()
         return !1;
       if (a = this._ua.normalizeTarget(a), !a)
         throw new TypeError("Invalid target: ".concat(p));
-      var _ = new Wd(this);
+      var _ = new Kd(this);
       _.sendRefer(a, t);
       var d = _.id;
       return this._referSubscribers[d] = _, _.on("requestFailed", function() {
@@ -7263,7 +7263,7 @@ var Vd = ct.EventEmitter, pc = Nt, jd = ft, ce = rt, cn = Hs, mc = sl, qe = Ct()
         return;
       }
       a.reply(202);
-      var s = new Gd(this, a.cseq);
+      var s = new Wd(this, a.cseq);
       K.debug('emit "refer"'), this.emit("refer", {
         request: a,
         accept: function(g, T) {
@@ -7363,7 +7363,7 @@ var Vd = ct.EventEmitter, pc = Nt, jd = ft, ce = rt, cn = Hs, mc = sl, qe = Ct()
     value: function(a, t, s) {
       var p = this;
       console.log("rtcOfferConstraints", t);
-      var _ = new Bd(this._ua, this._request, {
+      var _ = new Gd(this._ua, this._request, {
         onRequestTimeout: function() {
           p.onRequestTimeout();
         },
@@ -7988,7 +7988,7 @@ var Vd = ct.EventEmitter, pc = Nt, jd = ft, ce = rt, cn = Hs, mc = sl, qe = Ct()
       return this._status;
     }
   }]), r;
-}(Vd);
+}(jd);
 function fo(c) {
   "@babel/helpers - typeof";
   return typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? fo = function(r) {
@@ -7997,7 +7997,7 @@ function fo(c) {
     return r && typeof Symbol == "function" && r.constructor === Symbol && r !== Symbol.prototype ? "symbol" : typeof r;
   }, fo(c);
 }
-function Yd(c, n) {
+function zd(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -8007,10 +8007,10 @@ function vc(c, n) {
     o.enumerable = o.enumerable || !1, o.configurable = !0, "value" in o && (o.writable = !0), Object.defineProperty(c, o.key, o);
   }
 }
-function zd(c, n, r) {
+function Jd(c, n, r) {
   return n && vc(c.prototype, n), r && vc(c, r), c;
 }
-function Jd(c, n) {
+function Xd(c, n) {
   if (typeof n != "function" && n !== null)
     throw new TypeError("Super expression must either be null or a function");
   c.prototype = Object.create(n && n.prototype, { constructor: { value: c, writable: !0, configurable: !0 } }), n && su(c, n);
@@ -8020,8 +8020,8 @@ function su(c, n) {
     return o.__proto__ = a, o;
   }, su(c, n);
 }
-function Xd(c) {
-  var n = ep();
+function Qd(c) {
+  var n = tp();
   return function() {
     var o = Ao(c), a;
     if (n) {
@@ -8029,18 +8029,18 @@ function Xd(c) {
       a = Reflect.construct(o, arguments, t);
     } else
       a = o.apply(this, arguments);
-    return Qd(this, a);
+    return Zd(this, a);
   };
 }
-function Qd(c, n) {
-  return n && (fo(n) === "object" || typeof n == "function") ? n : Zd(c);
+function Zd(c, n) {
+  return n && (fo(n) === "object" || typeof n == "function") ? n : ep(c);
 }
-function Zd(c) {
+function ep(c) {
   if (c === void 0)
     throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
   return c;
 }
-function ep() {
+function tp() {
   if (typeof Reflect > "u" || !Reflect.construct || Reflect.construct.sham)
     return !1;
   if (typeof Proxy == "function")
@@ -8057,14 +8057,14 @@ function Ao(c) {
     return r.__proto__ || Object.getPrototypeOf(r);
   }, Ao(c);
 }
-var tp = ct.EventEmitter, sp = ft, fa = rt, np = ms, bi = Ct(), rp = nl, Ec = Hs, ip = Fs(), Ml = new sp("Message"), lp = /* @__PURE__ */ function(c) {
-  Jd(r, c);
-  var n = Xd(r);
+var sp = ct.EventEmitter, np = ft, fa = rt, rp = ms, bi = Ct(), ip = nl, Ec = Hs, lp = Fs(), Ml = new np("Message"), op = /* @__PURE__ */ function(c) {
+  Xd(r, c);
+  var n = Qd(r);
   function r(o) {
     var a;
-    return Yd(this, r), a = n.call(this), a._ua = o, a._request = null, a._closed = !1, a._direction = null, a._local_identity = null, a._remote_identity = null, a._is_replied = !1, a._data = {}, a;
+    return zd(this, r), a = n.call(this), a._ua = o, a._request = null, a._closed = !1, a._direction = null, a._local_identity = null, a._remote_identity = null, a._is_replied = !1, a._data = {}, a;
   }
-  return zd(r, [{
+  return Jd(r, [{
     key: "send",
     value: function(a, t) {
       var s = this, p = arguments.length > 2 && arguments[2] !== void 0 ? arguments[2] : {}, _ = a;
@@ -8073,11 +8073,11 @@ var tp = ct.EventEmitter, sp = ft, fa = rt, np = ms, bi = Ct(), rp = nl, Ec = Hs
       if (a = this._ua.normalizeTarget(a), !a)
         throw new TypeError("Invalid target: ".concat(_));
       var d = bi.cloneArray(p.extraHeaders), g = bi.cloneObject(p.eventHandlers), T = p.contentType || "text/plain", E = {};
-      p.fromUserName && (E.from_uri = new ip("sip", p.fromUserName, this._ua.configuration.uri.host), d.push("P-Preferred-Identity: ".concat(this._ua.configuration.uri.toString()))), p.fromDisplayName && (E.from_display_name = p.fromDisplayName);
+      p.fromUserName && (E.from_uri = new lp("sip", p.fromUserName, this._ua.configuration.uri.host), d.push("P-Preferred-Identity: ".concat(this._ua.configuration.uri.toString()))), p.fromDisplayName && (E.from_display_name = p.fromDisplayName);
       for (var y in g)
         Object.prototype.hasOwnProperty.call(g, y) && this.on(y, g[y]);
-      d.push("Content-Type: ".concat(T)), this._request = new np.OutgoingRequest(fa.MESSAGE, a, this._ua, E, d), t && (this._request.body = t);
-      var A = new rp(this._ua, this._request, {
+      d.push("Content-Type: ".concat(T)), this._request = new rp.OutgoingRequest(fa.MESSAGE, a, this._ua, E, d), t && (this._request.body = t);
+      var A = new ip(this._ua, this._request, {
         onRequestTimeout: function() {
           s._onRequestTimeout();
         },
@@ -8202,7 +8202,7 @@ var tp = ct.EventEmitter, sp = ft, fa = rt, np = ms, bi = Ct(), rp = nl, Ec = Hs
       return this._remote_identity;
     }
   }]), r;
-}(tp);
+}(sp);
 function _o(c) {
   "@babel/helpers - typeof";
   return typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? _o = function(r) {
@@ -8211,7 +8211,7 @@ function _o(c) {
     return r && typeof Symbol == "function" && r.constructor === Symbol && r !== Symbol.prototype ? "symbol" : typeof r;
   }, _o(c);
 }
-function op(c, n) {
+function ap(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -8221,10 +8221,10 @@ function Sc(c, n) {
     o.enumerable = o.enumerable || !1, o.configurable = !0, "value" in o && (o.writable = !0), Object.defineProperty(c, o.key, o);
   }
 }
-function ap(c, n, r) {
+function up(c, n, r) {
   return n && Sc(c.prototype, n), r && Sc(c, r), c;
 }
-function up(c, n) {
+function cp(c, n) {
   if (typeof n != "function" && n !== null)
     throw new TypeError("Super expression must either be null or a function");
   c.prototype = Object.create(n && n.prototype, { constructor: { value: c, writable: !0, configurable: !0 } }), n && nu(c, n);
@@ -8234,8 +8234,8 @@ function nu(c, n) {
     return o.__proto__ = a, o;
   }, nu(c, n);
 }
-function cp(c) {
-  var n = hp();
+function fp(c) {
+  var n = dp();
   return function() {
     var o = Co(c), a;
     if (n) {
@@ -8243,18 +8243,18 @@ function cp(c) {
       a = Reflect.construct(o, arguments, t);
     } else
       a = o.apply(this, arguments);
-    return fp(this, a);
+    return _p(this, a);
   };
 }
-function fp(c, n) {
-  return n && (_o(n) === "object" || typeof n == "function") ? n : _p(c);
+function _p(c, n) {
+  return n && (_o(n) === "object" || typeof n == "function") ? n : hp(c);
 }
-function _p(c) {
+function hp(c) {
   if (c === void 0)
     throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
   return c;
 }
-function hp() {
+function dp() {
   if (typeof Reflect > "u" || !Reflect.construct || Reflect.construct.sham)
     return !1;
   if (typeof Proxy == "function")
@@ -8271,14 +8271,14 @@ function Co(c) {
     return r.__proto__ || Object.getPrototypeOf(r);
   }, Co(c);
 }
-var dp = ct.EventEmitter, pp = ft, _a = rt, mp = ms, wi = Ct(), gp = nl, yc = Hs, kl = new pp("Options"), Tp = /* @__PURE__ */ function(c) {
-  up(r, c);
-  var n = cp(r);
+var pp = ct.EventEmitter, mp = ft, _a = rt, gp = ms, wi = Ct(), Tp = nl, yc = Hs, kl = new mp("Options"), vp = /* @__PURE__ */ function(c) {
+  cp(r, c);
+  var n = fp(r);
   function r(o) {
     var a;
-    return op(this, r), a = n.call(this), a._ua = o, a._request = null, a._closed = !1, a._direction = null, a._local_identity = null, a._remote_identity = null, a._is_replied = !1, a._data = {}, a;
+    return ap(this, r), a = n.call(this), a._ua = o, a._request = null, a._closed = !1, a._direction = null, a._local_identity = null, a._remote_identity = null, a._is_replied = !1, a._data = {}, a;
   }
-  return ap(r, [{
+  return up(r, [{
     key: "send",
     value: function(a, t) {
       var s = this, p = arguments.length > 2 && arguments[2] !== void 0 ? arguments[2] : {}, _ = a;
@@ -8289,8 +8289,8 @@ var dp = ct.EventEmitter, pp = ft, _a = rt, mp = ms, wi = Ct(), gp = nl, yc = Hs
       var d = wi.cloneArray(p.extraHeaders), g = wi.cloneObject(p.eventHandlers), T = p.contentType || "application/sdp";
       for (var E in g)
         Object.prototype.hasOwnProperty.call(g, E) && this.on(E, g[E]);
-      d.push("Content-Type: ".concat(T)), this._request = new mp.OutgoingRequest(_a.OPTIONS, a, this._ua, null, d), t && (this._request.body = t);
-      var y = new gp(this._ua, this._request, {
+      d.push("Content-Type: ".concat(T)), this._request = new gp.OutgoingRequest(_a.OPTIONS, a, this._ua, null, d), t && (this._request.body = t);
+      var y = new Tp(this._ua, this._request, {
         onRequestTimeout: function() {
           s._onRequestTimeout();
         },
@@ -8415,7 +8415,7 @@ var dp = ct.EventEmitter, pp = ft, _a = rt, mp = ms, wi = Ct(), gp = nl, yc = Hs
       return this._remote_identity;
     }
   }]), r;
-}(dp), vu = {}, vp = ft, ha = Ct(), Ep = ns(), Oi = new vp("Socket");
+}(pp), vu = {}, Ep = ft, ha = Ct(), Sp = ns(), Oi = new Ep("Socket");
 vu.isSocket = function(c) {
   if (Array.isArray(c))
     return !1;
@@ -8426,7 +8426,7 @@ vu.isSocket = function(c) {
       throw Oi.warn("missing or invalid JsSIP.Socket url property"), new Error("Missing or invalid JsSIP.Socket url property");
     if (!ha.isString(c.via_transport))
       throw Oi.warn("missing or invalid JsSIP.Socket via_transport property"), new Error("Missing or invalid JsSIP.Socket via_transport property");
-    if (Ep.parse(c.sip_uri, "SIP_URI") === -1)
+    if (Sp.parse(c.sip_uri, "SIP_URI") === -1)
       throw Oi.warn("missing or invalid JsSIP.Socket sip_uri property"), new Error("missing or invalid JsSIP.Socket sip_uri property");
   } catch {
     return !1;
@@ -8441,7 +8441,7 @@ vu.isSocket = function(c) {
   }
   return !0;
 };
-function Sp(c, n) {
+function yp(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -8451,10 +8451,10 @@ function Ac(c, n) {
     o.enumerable = o.enumerable || !1, o.configurable = !0, "value" in o && (o.writable = !0), Object.defineProperty(c, o.key, o);
   }
 }
-function yp(c, n, r) {
+function Ap(c, n, r) {
   return n && Ac(c.prototype, n), r && Ac(c, r), c;
 }
-var Ap = ft, Cp = vu, Cc = rt, wt = new Ap("Transport"), Ft = {
+var Cp = ft, Rp = vu, Cc = rt, wt = new Cp("Transport"), Ft = {
   // Transport status.
   STATUS_CONNECTED: 0,
   STATUS_CONNECTING: 1,
@@ -8469,10 +8469,10 @@ var Ap = ft, Cp = vu, Cc = rt, wt = new Ap("Transport"), Ft = {
     // maximum interval in seconds between recover attempts.
     max_interval: Cc.CONNECTION_RECOVERY_MAX_INTERVAL
   }
-}, Rp = /* @__PURE__ */ function() {
+}, Ip = /* @__PURE__ */ function() {
   function c(n) {
     var r = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : Ft.recovery_options;
-    Sp(this, c), wt.debug("new()"), this.status = Ft.STATUS_DISCONNECTED, this.socket = null, this.sockets = [], this.recovery_options = r, this.recover_attempts = 0, this.recovery_timer = null, this.close_requested = !1;
+    yp(this, c), wt.debug("new()"), this.status = Ft.STATUS_DISCONNECTED, this.socket = null, this.sockets = [], this.recovery_options = r, this.recover_attempts = 0, this.recovery_timer = null, this.close_requested = !1;
     try {
       this.textDecoder = new TextDecoder("utf8");
     } catch (o) {
@@ -8481,7 +8481,7 @@ var Ap = ft, Cp = vu, Cc = rt, wt = new Ap("Transport"), Ft = {
     if (typeof n > "u")
       throw new TypeError("Invalid argument. undefined 'sockets' argument");
     n instanceof Array || (n = [n]), n.forEach(function(o) {
-      if (!Cp.isSocket(o.socket))
+      if (!Rp.isSocket(o.socket))
         throw new TypeError("Invalid argument. invalid 'JsSIP.Socket' instance");
       if (o.weight && !Number(o.weight))
         throw new TypeError("Invalid argument. 'weight' attribute is not a number");
@@ -8492,7 +8492,7 @@ var Ap = ft, Cp = vu, Cc = rt, wt = new Ap("Transport"), Ft = {
       });
     }, this), this._getSocket();
   }
-  return yp(c, [{
+  return Ap(c, [{
     key: "connect",
     value: function() {
       if (wt.debug("connect()"), this.isConnected()) {
@@ -8640,7 +8640,7 @@ var Ap = ft, Cp = vu, Cc = rt, wt = new Ap("Transport"), Ft = {
 function Rc(c, n) {
   var r;
   if (typeof Symbol > "u" || c[Symbol.iterator] == null) {
-    if (Array.isArray(c) || (r = Ip(c)) || n && c && typeof c.length == "number") {
+    if (Array.isArray(c) || (r = bp(c)) || n && c && typeof c.length == "number") {
       r && (c = r);
       var o = 0, a = function() {
       };
@@ -8670,7 +8670,7 @@ In order to be iterable, non-array objects must have a [Symbol.iterator]() metho
     }
   } };
 }
-function Ip(c, n) {
+function bp(c, n) {
   if (c) {
     if (typeof c == "string")
       return Ic(c, n);
@@ -8687,7 +8687,7 @@ function Ic(c, n) {
     o[r] = c[r];
   return o;
 }
-var bp = ft, ru = ns(), iu = ms, Ll = new bp("Parser");
+var wp = ft, ru = ns(), iu = ms, Ll = new wp("Parser");
 Gf.parseMessage = function(c, n) {
   var r, o, a = c.indexOf(`\r
 `);
@@ -8703,14 +8703,14 @@ Gf.parseMessage = function(c, n) {
     s.status_code ? (r = new iu.IncomingResponse(), r.status_code = s.status_code, r.reason_phrase = s.reason_phrase) : (r = new iu.IncomingRequest(n), r.method = s.method, r.ruri = s.uri);
   r.data = c;
   for (var p = a + 2; ; ) {
-    if (a = wp(c, p), a === -2) {
+    if (a = Op(c, p), a === -2) {
       o = p + 2;
       break;
     } else if (a === -1) {
       Ll.warn("parseMessage() | malformed message");
       return;
     }
-    if (s = Op(r, c, p, a), s !== !0) {
+    if (s = Dp(r, c, p, a), s !== !0) {
       Ll.warn("parseMessage() |", s.error);
       return;
     }
@@ -8723,7 +8723,7 @@ Gf.parseMessage = function(c, n) {
     r.body = c.substring(o);
   return r;
 };
-function wp(c, n) {
+function Op(c, n) {
   var r = n, o = 0, a = 0;
   if (c.substring(r, r + 2).match(/(^\r\n)/))
     return -2;
@@ -8735,7 +8735,7 @@ function wp(c, n) {
   }
   return o;
 }
-function Op(c, n, r, o) {
+function Dp(c, n, r, o) {
   var a, t = n.indexOf(":", r), s = n.substring(r, t).trim(), p = n.substring(t + 1, o).trim();
   switch (s.toLowerCase()) {
     case "via":
@@ -8834,7 +8834,7 @@ function Op(c, n, r, o) {
 function ho(c, n) {
   var r;
   if (typeof Symbol > "u" || c[Symbol.iterator] == null) {
-    if (Array.isArray(c) || (r = Dp(c)) || n && c && typeof c.length == "number") {
+    if (Array.isArray(c) || (r = Np(c)) || n && c && typeof c.length == "number") {
       r && (c = r);
       var o = 0, a = function() {
       };
@@ -8864,7 +8864,7 @@ In order to be iterable, non-array objects must have a [Symbol.iterator]() metho
     }
   } };
 }
-function Dp(c, n) {
+function Np(c, n) {
   if (c) {
     if (typeof c == "string")
       return bc(c, n);
@@ -8881,9 +8881,9 @@ function bc(c, n) {
     o[r] = c[r];
   return o;
 }
-var Np = ft, Wf = rt, wc = ms, Eu = Ct(), Su = new Np("sanityCheck"), Up = [jp], Pp = [kp, Lp, $p, Hp], xp = [Fp, Vp], He, Qt, Kf, Mp = function(c, n, r) {
+var Up = ft, Wf = rt, wc = ms, Eu = Ct(), Su = new Up("sanityCheck"), Pp = [qp], xp = [Lp, $p, Hp, Fp], Mp = [Vp, jp], He, Qt, Kf, kp = function(c, n, r) {
   He = c, Qt = n, Kf = r;
-  var o = ho(Up), a;
+  var o = ho(Pp), a;
   try {
     for (o.s(); !(a = o.n()).done; ) {
       var t = a.value;
@@ -8896,7 +8896,7 @@ var Np = ft, Wf = rt, wc = ms, Eu = Ct(), Su = new Np("sanityCheck"), Up = [jp],
     o.f();
   }
   if (He instanceof wc.IncomingRequest) {
-    var s = ho(Pp), p;
+    var s = ho(xp), p;
     try {
       for (s.s(); !(p = s.n()).done; ) {
         var _ = p.value;
@@ -8909,7 +8909,7 @@ var Np = ft, Wf = rt, wc = ms, Eu = Ct(), Su = new Np("sanityCheck"), Up = [jp],
       s.f();
     }
   } else if (He instanceof wc.IncomingResponse) {
-    var d = ho(xp), g;
+    var d = ho(Mp), g;
     try {
       for (d.s(); !(g = d.n()).done; ) {
         var T = g.value;
@@ -8924,20 +8924,20 @@ var Np = ft, Wf = rt, wc = ms, Eu = Ct(), Su = new Np("sanityCheck"), Up = [jp],
   }
   return !0;
 };
-function kp() {
+function Lp() {
   if (He.s("to").uri.scheme !== "sip")
     return Ki(416), !1;
 }
-function Lp() {
+function $p() {
   if (!He.to_tag && He.call_id.substr(0, 5) === Qt.configuration.jssip_id)
     return Ki(482), !1;
 }
-function $p() {
+function Hp() {
   var c = Eu.str_utf8_length(He.body), n = He.getHeader("content-length");
   if (c < n)
     return Ki(400), !1;
 }
-function Hp() {
+function Fp() {
   var c = He.from_tag, n = He.call_id, r = He.cseq, o;
   if (!He.to_tag)
     if (He.method === Wf.INVITE) {
@@ -8954,16 +8954,16 @@ function Hp() {
           return Ki(482), !1;
     }
 }
-function Fp() {
+function Vp() {
   if (He.getHeaders("via").length > 1)
     return Su.debug("more than one Via header field present in the response, dropping the response"), !1;
 }
-function Vp() {
+function jp() {
   var c = Eu.str_utf8_length(He.body), n = He.getHeader("content-length");
   if (c < n)
     return Su.debug("message body length is lower than the value in Content-Length header field, dropping the response"), !1;
 }
-function jp() {
+function qp() {
   for (var c = ["from", "to", "call_id", "cseq", "via"], n = 0, r = c; n < r.length; n++) {
     var o = r[n];
     if (!He.hasHeader(o))
@@ -8995,7 +8995,7 @@ var yu = {};
 function Oc(c, n) {
   var r;
   if (typeof Symbol > "u" || c[Symbol.iterator] == null) {
-    if (Array.isArray(c) || (r = qp(c)) || n && c && typeof c.length == "number") {
+    if (Array.isArray(c) || (r = Bp(c)) || n && c && typeof c.length == "number") {
       r && (c = r);
       var o = 0, a = function() {
       };
@@ -9025,7 +9025,7 @@ In order to be iterable, non-array objects must have a [Symbol.iterator]() metho
     }
   } };
 }
-function qp(c, n) {
+function Bp(c, n) {
   if (c) {
     if (typeof c == "string")
       return Dc(c, n);
@@ -9252,7 +9252,7 @@ function po(c) {
     return r && typeof Symbol == "function" && r.constructor === Symbol && r !== Symbol.prototype ? "symbol" : typeof r;
   }, po(c);
 }
-function Bp(c, n) {
+function Gp(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -9265,7 +9265,7 @@ function Uc(c, n) {
 function Pc(c, n, r) {
   return n && Uc(c.prototype, n), r && Uc(c, r), c;
 }
-function Gp(c, n) {
+function Wp(c, n) {
   if (typeof n != "function" && n !== null)
     throw new TypeError("Super expression must either be null or a function");
   c.prototype = Object.create(n && n.prototype, { constructor: { value: c, writable: !0, configurable: !0 } }), n && lu(c, n);
@@ -9275,8 +9275,8 @@ function lu(c, n) {
     return o.__proto__ = a, o;
   }, lu(c, n);
 }
-function Wp(c) {
-  var n = Yp();
+function Kp(c) {
+  var n = zp();
   return function() {
     var o = Ro(c), a;
     if (n) {
@@ -9284,10 +9284,10 @@ function Wp(c) {
       a = Reflect.construct(o, arguments, t);
     } else
       a = o.apply(this, arguments);
-    return Kp(this, a);
+    return Yp(this, a);
   };
 }
-function Kp(c, n) {
+function Yp(c, n) {
   return n && (po(n) === "object" || typeof n == "function") ? n : Yf(c);
 }
 function Yf(c) {
@@ -9295,7 +9295,7 @@ function Yf(c) {
     throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
   return c;
 }
-function Yp() {
+function zp() {
   if (typeof Reflect > "u" || !Reflect.construct || Reflect.construct.sham)
     return !1;
   if (typeof Proxy == "function")
@@ -9312,7 +9312,7 @@ function Ro(c) {
     return r.__proto__ || Object.getPrototypeOf(r);
   }, Ro(c);
 }
-var zp = ct.EventEmitter, Jp = ft, ht = rt, Xp = $h, xc = Kd, Mc = lp, kc = Tp, ga = sl, Qp = Rp, Hl = Ct(), Zp = Hs, em = Fs(), tm = Gf, Ta = ms, sm = Mp, va = yu, Ve = new Jp("UA"), mt = {
+var Jp = ct.EventEmitter, Xp = ft, ht = rt, Qp = Hh, xc = Yd, Mc = op, kc = vp, ga = sl, Zp = Ip, Hl = Ct(), em = Hs, tm = Fs(), sm = Gf, Ta = ms, nm = kp, va = yu, Ve = new Xp("UA"), mt = {
   // UA status codes.
   STATUS_INIT: 0,
   STATUS_READY: 1,
@@ -9321,9 +9321,9 @@ var zp = ct.EventEmitter, Jp = ft, ht = rt, Xp = $h, xc = Kd, Mc = lp, kc = Tp,
   // UA error codes.
   CONFIGURATION_ERROR: 1,
   NETWORK_ERROR: 2
-}, nm = /* @__PURE__ */ function(c) {
-  Gp(r, c);
-  var n = Wp(r);
+}, rm = /* @__PURE__ */ function(c) {
+  Wp(r, c);
+  var n = Kp(r);
   Pc(r, null, [{
     key: "C",
     // Expose C object.
@@ -9333,7 +9333,7 @@ var zp = ct.EventEmitter, Jp = ft, ht = rt, Xp = $h, xc = Kd, Mc = lp, kc = Tp,
   }]);
   function r(o) {
     var a;
-    if (Bp(this, r), Ve.debug("new() [configuration:%o]", o), a = n.call(this), a._cache = {
+    if (Gp(this, r), Ve.debug("new() [configuration:%o]", o), a = n.call(this), a._cache = {
       credentials: {}
     }, a._configuration = Object.assign({}, va.settings), a._dynConfiguration = {}, a._dialogs = {}, a._applicants = {}, a._sessions = {}, a._transport = null, a._contact = null, a._status = mt.STATUS_INIT, a._error = null, a._transactions = {
       nist: {},
@@ -9347,7 +9347,7 @@ var zp = ct.EventEmitter, Jp = ft, ht = rt, Xp = $h, xc = Kd, Mc = lp, kc = Tp,
     } catch (t) {
       throw a._status = mt.STATUS_NOT_READY, a._error = mt.CONFIGURATION_ERROR, t;
     }
-    return a._registrator = new Xp(Yf(a)), a;
+    return a._registrator = new Qp(Yf(a)), a;
   }
   return Pc(r, [{
     key: "start",
@@ -9770,19 +9770,19 @@ var zp = ct.EventEmitter, Jp = ft, ht = rt, Xp = $h, xc = Kd, Mc = lp, kc = Tp,
       var t = this._configuration.uri.clone();
       t.user = null, this._configuration.hostport_params = t.toString().replace(/^sip:/i, "");
       try {
-        this._transport = new Qp(this._configuration.sockets, {
+        this._transport = new Zp(this._configuration.sockets, {
           // Recovery options.
           max_interval: this._configuration.connection_recovery_max_interval,
           min_interval: this._configuration.connection_recovery_min_interval
-        }), this._transport.onconnecting = rm.bind(this), this._transport.onconnect = im.bind(this), this._transport.ondisconnect = lm.bind(this), this._transport.ondata = om.bind(this);
+        }), this._transport.onconnecting = im.bind(this), this._transport.onconnect = lm.bind(this), this._transport.ondisconnect = om.bind(this), this._transport.ondata = am.bind(this);
       } catch (g) {
-        throw Ve.warn(g), new Zp.ConfigurationError("sockets", this._configuration.sockets);
+        throw Ve.warn(g), new em.ConfigurationError("sockets", this._configuration.sockets);
       }
       if (delete this._configuration.sockets, this._configuration.authorization_user || (this._configuration.authorization_user = this._configuration.uri.user), !this._configuration.registrar_server) {
         var s = this._configuration.uri.clone();
         s.user = null, s.clearParams(), s.clearHeaders(), this._configuration.registrar_server = s;
       }
-      this._configuration.no_answer_timeout *= 1e3, this._configuration.contact_uri ? this._configuration.via_host = this._configuration.contact_uri.host : this._configuration.contact_uri = new em("sip", Hl.createRandomToken(8), this._configuration.via_host, null, {
+      this._configuration.no_answer_timeout *= 1e3, this._configuration.contact_uri ? this._configuration.via_host = this._configuration.contact_uri.host : this._configuration.contact_uri = new tm("sip", Hl.createRandomToken(8), this._configuration.via_host, null, {
         transport: "ws"
       }), this._contact = {
         pub_gruu: null,
@@ -9845,14 +9845,14 @@ var zp = ct.EventEmitter, Jp = ft, ht = rt, Xp = $h, xc = Kd, Mc = lp, kc = Tp,
       return this._transport;
     }
   }]), r;
-}(zp);
-function rm(c) {
+}(Jp);
+function im(c) {
   this.emit("connecting", c);
 }
-function im(c) {
+function lm(c) {
   this._status !== mt.STATUS_USER_CLOSED && (this._status = mt.STATUS_READY, this._error = null, this.emit("connected", c), this._dynConfiguration.register && this._registrator.register());
 }
-function lm(c) {
+function om(c) {
   for (var n = ["nict", "ict", "nist", "ist"], r = 0, o = n; r < o.length; r++) {
     var a = o[r];
     for (var t in this._transactions[a])
@@ -9860,9 +9860,9 @@ function lm(c) {
   }
   this.emit("disconnected", c), this._registrator.onTransportClosed(), this._status !== mt.STATUS_USER_CLOSED && (this._status = mt.STATUS_NOT_READY, this._error = mt.NETWORK_ERROR);
 }
-function om(c) {
+function am(c) {
   var n = c.transport, r = c.message;
-  if (r = tm.parseMessage(r, this), !!r && !(this._status === mt.STATUS_USER_CLOSED && r instanceof Ta.IncomingRequest) && sm(r, this, n)) {
+  if (r = sm.parseMessage(r, this), !!r && !(this._status === mt.STATUS_USER_CLOSED && r instanceof Ta.IncomingRequest) && nm(r, this, n)) {
     if (r instanceof Ta.IncomingRequest)
       r.transport = n, this.receiveRequest(r);
     else if (r instanceof Ta.IncomingResponse) {
@@ -9880,7 +9880,7 @@ function om(c) {
     }
   }
 }
-function am(c, n) {
+function um(c, n) {
   if (!(c instanceof n))
     throw new TypeError("Cannot call a class as a function");
 }
@@ -9890,20 +9890,20 @@ function Lc(c, n) {
     o.enumerable = o.enumerable || !1, o.configurable = !0, "value" in o && (o.writable = !0), Object.defineProperty(c, o.key, o);
   }
 }
-function um(c, n, r) {
+function cm(c, n, r) {
   return n && Lc(c.prototype, n), r && Lc(c, r), c;
 }
-var cm = ft, fm = ns(), It = new cm("WebSocketInterface"), _m = /* @__PURE__ */ function() {
+var fm = ft, _m = ns(), It = new fm("WebSocketInterface"), hm = /* @__PURE__ */ function() {
   function c(n) {
-    am(this, c), It.debug('new() [url:"%s"]', n), this._url = n, this._sip_uri = null, this._via_transport = null, this._ws = null;
-    var r = fm.parse(n, "absoluteURI");
+    um(this, c), It.debug('new() [url:"%s"]', n), this._url = n, this._sip_uri = null, this._via_transport = null, this._ws = null;
+    var r = _m.parse(n, "absoluteURI");
     if (r === -1)
       throw It.warn("invalid WebSocket URI: ".concat(n)), new TypeError("Invalid argument: ".concat(n));
     if (r.scheme !== "wss" && r.scheme !== "ws")
       throw It.warn("invalid WebSocket URI scheme: ".concat(r.scheme)), new TypeError("Invalid argument: ".concat(n));
     this._sip_uri = "sip:".concat(r.host).concat(r.port ? ":".concat(r.port) : "", ";transport=ws"), this._via_transport = r.scheme.toUpperCase();
   }
-  return um(c, [{
+  return cm(c, [{
     key: "connect",
     value: function() {
       if (It.debug("connect()"), this.isConnected()) {
@@ -9988,17 +9988,17 @@ var cm = ft, fm = ns(), It = new cm("WebSocketInterface"), _m = /* @__PURE__ */
       return this._url;
     }
   }]), c;
-}(), ou = bo, hm = rt, dm = Hs, pm = Ct(), mm = nm, gm = Fs(), Tm = du(), vm = ns(), Em = _m, Sm = ur("JsSIP");
-Sm("version %s", ou.version);
+}(), ou = bo, dm = rt, pm = Hs, mm = Ct(), gm = rm, Tm = Fs(), vm = du(), Em = ns(), Sm = hm, ym = ur("JsSIP");
+ym("version %s", ou.version);
 var $c = {
-  C: hm,
-  Exceptions: dm,
-  Utils: pm,
-  UA: mm,
-  URI: gm,
-  NameAddrHeader: Tm,
-  WebSocketInterface: Em,
-  Grammar: vm,
+  C: dm,
+  Exceptions: pm,
+  Utils: mm,
+  UA: gm,
+  URI: Tm,
+  NameAddrHeader: vm,
+  WebSocketInterface: Sm,
+  Grammar: Em,
   // Expose the debug module.
   debug: ur,
   get name() {
@@ -12475,7 +12475,7 @@ function Et() {
       }
   }, Ze.cloneArray = (s) => s && s.slice() || [], Ze.cloneObject = (s, p = {}) => s && Object.assign({}, s) || p, Ze;
 }
-const Qf = Nt, ym = at, vt = Ue, nt = Et(), Bc = Au(), Am = rs(), Aa = new ym("SIPMessage");
+const Qf = Nt, Am = at, vt = Ue, nt = Et(), Bc = Au(), Cm = rs(), Aa = new Am("SIPMessage");
 class Po {
   constructor(n, r, o, a, t, s) {
     if (!n || !r || !o)
@@ -12683,7 +12683,7 @@ class Zf {
     const o = this.headers[n][r], a = o.raw;
     if (o.parsed)
       return o.parsed;
-    const t = Am.parse(a, n.replace(/-/g, "_"));
+    const t = Cm.parse(a, n.replace(/-/g, "_"));
     if (t === -1) {
       this.headers[n].splice(r, 1), Aa.debug(`error parsing "${n}" header field with value "${a}"`);
       return;
@@ -12726,7 +12726,7 @@ class Zf {
     return this.data;
   }
 }
-class Cm extends Zf {
+class Rm extends Zf {
   constructor(n) {
     super(), this.ua = n, this.headers = {}, this.ruri = null, this.transport = null, this.server_transaction = null;
   }
@@ -12822,7 +12822,7 @@ class Cm extends Zf {
 `, this.transport.send(a);
   }
 }
-class Rm extends Zf {
+class Im extends Zf {
   constructor() {
     super(), this.headers = {}, this.status_code = null, this.reason_phrase = null;
   }
@@ -12830,10 +12830,10 @@ class Rm extends Zf {
 var xt = {
   OutgoingRequest: Po,
   InitialOutgoingInviteRequest: Cu,
-  IncomingRequest: Cm,
-  IncomingResponse: Rm
+  IncomingRequest: Rm,
+  IncomingResponse: Im
 };
-const Im = at, fs = Et(), Wt = new Im("DigestAuthentication");
+const bm = at, fs = Et(), Wt = new bm("DigestAuthentication");
 var e_ = class {
   constructor(n) {
     this._credentials = n, this._cnonce = null, this._nc = 0, this._ncHex = "00000000", this._algorithm = null, this._realm = null, this._nonce = null, this._opaque = null, this._stale = null, this._qop = null, this._method = null, this._uri = null, this._ha1 = null, this._response = null;
@@ -12895,10 +12895,10 @@ var e_ = class {
     return n.push(`algorithm=${this._algorithm}`), n.push(`username="${this._credentials.username}"`), n.push(`realm="${this._realm}"`), n.push(`nonce="${this._nonce}"`), n.push(`uri="${this._uri}"`), n.push(`response="${this._response}"`), this._opaque && n.push(`opaque="${this._opaque}"`), this._qop && (n.push(`qop=${this._qop}`), n.push(`cnonce="${this._cnonce}"`), n.push(`nc=${this._ncHex}`)), `Digest ${n.join(", ")}`;
   }
 };
-const bm = /* @__PURE__ */ ot(e_), _s = 500, wm = 4e3, Gc = 5e3;
+const wm = /* @__PURE__ */ ot(e_), _s = 500, Om = 4e3, Gc = 5e3;
 var Ru = {
   T1: _s,
-  T2: wm,
+  T2: Om,
   T4: Gc,
   TIMER_B: 64 * _s,
   TIMER_D: 0 * _s,
@@ -12912,7 +12912,7 @@ var Ru = {
   PROVISIONAL_RESPONSE_INTERVAL: 6e4
   // See RFC 3261 Section 13.3.1.1
 };
-const Di = /* @__PURE__ */ ot(Ru), rl = ct.EventEmitter, il = at, ji = Ue, Wc = xt, ss = Ru, Kc = new il("NonInviteClientTransaction"), Fl = new il("InviteClientTransaction"), Om = new il("AckClientTransaction"), Yc = new il("NonInviteServerTransaction"), Vl = new il("InviteServerTransaction"), he = {
+const Di = /* @__PURE__ */ ot(Ru), rl = ct.EventEmitter, il = at, ji = Ue, Wc = xt, ss = Ru, Kc = new il("NonInviteClientTransaction"), Fl = new il("InviteClientTransaction"), Dm = new il("AckClientTransaction"), Yc = new il("NonInviteServerTransaction"), Vl = new il("InviteServerTransaction"), he = {
   // Transaction states.
   STATUS_TRYING: 1,
   STATUS_PROCEEDING: 2,
@@ -12927,7 +12927,7 @@ const Di = /* @__PURE__ */ ot(Ru), rl = ct.EventEmitter, il = at, ji = Ue, Wc =
   INVITE_CLIENT: "ict",
   INVITE_SERVER: "ist"
 };
-class Dm extends rl {
+class Nm extends rl {
   constructor(n, r, o, a) {
     super(), this.type = he.NON_INVITE_CLIENT, this.id = `z9hG4bK${Math.floor(Math.random() * 1e7)}`, this.ua = n, this.transport = r, this.request = o, this.eventHandlers = a;
     let t = `SIP/2.0/${r.via_transport}`;
@@ -12975,7 +12975,7 @@ class Dm extends rl {
       }
   }
 }
-class Nm extends rl {
+class Um extends rl {
   constructor(n, r, o, a) {
     super(), this.type = he.INVITE_CLIENT, this.id = `z9hG4bK${Math.floor(Math.random() * 1e7)}`, this.ua = n, this.transport = r, this.request = o, this.eventHandlers = a, o.transaction = this;
     let t = `SIP/2.0/${r.via_transport}`;
@@ -13071,7 +13071,7 @@ class Nm extends rl {
       }
   }
 }
-class Um extends rl {
+class Pm extends rl {
   constructor(n, r, o, a) {
     super(), this.id = `z9hG4bK${Math.floor(Math.random() * 1e7)}`, this.transport = r, this.request = o, this.eventHandlers = a;
     let t = `SIP/2.0/${r.via_transport}`;
@@ -13084,10 +13084,10 @@ class Um extends rl {
     this.transport.send(this.request) || this.onTransportError();
   }
   onTransportError() {
-    Om.debug(`transport error occurred for transaction ${this.id}`), this.eventHandlers.onTransportError();
+    Dm.debug(`transport error occurred for transaction ${this.id}`), this.eventHandlers.onTransportError();
   }
 }
-class Pm extends rl {
+class xm extends rl {
   constructor(n, r, o) {
     super(), this.type = he.NON_INVITE_SERVER, this.id = o.via_branch, this.ua = n, this.transport = r, this.request = o, this.last_response = "", o.server_transaction = this, this.state = he.STATUS_TRYING, n.newTransaction(this);
   }
@@ -13126,7 +13126,7 @@ class Pm extends rl {
       }
   }
 }
-class xm extends rl {
+class Mm extends rl {
   constructor(n, r, o) {
     super(), this.type = he.INVITE_SERVER, this.id = o.via_branch, this.ua = n, this.transport = r, this.request = o, this.last_response = "", o.server_transaction = this, this.state = he.STATUS_PROCEEDING, n.newTransaction(this), this.resendProvisionalTimer = null, o.reply(100);
   }
@@ -13184,7 +13184,7 @@ class xm extends rl {
       }
   }
 }
-function Mm({ _transactions: c }, n) {
+function km({ _transactions: c }, n) {
   let r;
   switch (n.method) {
     case ji.INVITE:
@@ -13229,14 +13229,14 @@ function Mm({ _transactions: c }, n) {
 }
 var cr = {
   C: he,
-  NonInviteClientTransaction: Dm,
-  InviteClientTransaction: Nm,
-  AckClientTransaction: Um,
-  NonInviteServerTransaction: Pm,
-  InviteServerTransaction: xm,
-  checkTransaction: Mm
+  NonInviteClientTransaction: Nm,
+  InviteClientTransaction: Um,
+  AckClientTransaction: Pm,
+  NonInviteServerTransaction: xm,
+  InviteServerTransaction: Mm,
+  checkTransaction: km
 };
-const qt = /* @__PURE__ */ ot(cr), km = at, zc = Ue, Lm = e_, Ca = cr, $m = new km("RequestSender"), Ra = {
+const qt = /* @__PURE__ */ ot(cr), Lm = at, zc = Ue, $m = e_, Ca = cr, Hm = new Lm("RequestSender"), Ra = {
   onRequestTimeout: () => {
   },
   onTransportError: () => {
@@ -13304,11 +13304,11 @@ var fr = class {
     const a = n.status_code;
     if ((a === 401 || a === 407) && (this._ua.configuration.password !== null || this._ua.configuration.ha1 !== null)) {
       if (n.status_code === 401 ? (r = n.parseHeader("www-authenticate"), o = "authorization") : (r = n.parseHeader("proxy-authenticate"), o = "proxy-authorization"), !r) {
-        $m.debug(`${n.status_code} with wrong or missing challenge, cannot authenticate`), this._eventHandlers.onReceiveResponse(n);
+        Hm.debug(`${n.status_code} with wrong or missing challenge, cannot authenticate`), this._eventHandlers.onReceiveResponse(n);
         return;
       }
       if (!this._challenged || !this._staled && r.stale === !0) {
-        if (this._auth || (this._auth = new Lm({
+        if (this._auth || (this._auth = new $m({
           username: this._ua.configuration.authorization_user,
           password: this._ua.configuration.password,
           realm: this._ua.configuration.realm,
@@ -13324,8 +13324,8 @@ var fr = class {
       this._eventHandlers.onReceiveResponse(n);
   }
 };
-const t_ = /* @__PURE__ */ ot(fr), Hm = at, Ia = Et(), fn = Ue, Jc = xt, Xc = fr, Ni = new Hm("Registrator"), jl = 10;
-var Fm = class {
+const t_ = /* @__PURE__ */ ot(fr), Fm = at, Ia = Et(), fn = Ue, Jc = xt, Xc = fr, Ni = new Fm("Registrator"), jl = 10;
+var Vm = class {
   constructor(n, r) {
     this._reg_id = 1, this._ua = n, this._transport = r, this._registrar = n.configuration.registrar_server, this._expires = n.configuration.register_expires, this._call_id = Ia.createRandomToken(22), this._cseq = 0, this._to_uri = n.configuration.uri, this._registrationTimer = null, this._registering = !1, this._registered = !1, this._contact = this._ua.contact.toString(), this._contact += ";+sip.ice", this._extraHeaders = [], this._extraContactParams = "", this._sipInstance = `"<urn:uuid:${this._ua.configuration.instance_id}>"`, this._contact += `;reg-id=${this._reg_id}`, this._contact += `;+sip.instance=${this._sipInstance}`;
   }
@@ -13475,33 +13475,33 @@ var Fm = class {
     });
   }
 };
-class Vm extends Error {
+class jm extends Error {
   constructor(n, r) {
     super(), this.code = 1, this.name = "CONFIGURATION_ERROR", this.parameter = n, this.value = r, this.message = this.value ? `Invalid value ${JSON.stringify(this.value)} for parameter "${this.parameter}"` : `Missing parameter: ${this.parameter}`;
   }
 }
-class jm extends Error {
+class qm extends Error {
   constructor(n) {
     super(), this.code = 2, this.name = "INVALID_STATE_ERROR", this.status = n, this.message = `Invalid status: ${n}`;
   }
 }
-class qm extends Error {
+class Bm extends Error {
   constructor(n) {
     super(), this.code = 3, this.name = "NOT_SUPPORTED_ERROR", this.message = n;
   }
 }
-class Bm extends Error {
+class Gm extends Error {
   constructor(n) {
     super(), this.code = 4, this.name = "NOT_READY_ERROR", this.message = n;
   }
 }
 var Ts = {
-  ConfigurationError: Vm,
-  InvalidStateError: jm,
-  NotSupportedError: qm,
-  NotReadyError: Bm
+  ConfigurationError: jm,
+  InvalidStateError: qm,
+  NotSupportedError: Bm,
+  NotReadyError: Gm
 };
-const pn = /* @__PURE__ */ ot(Ts), ba = Ue, ql = cr, Gm = fr, wa = {
+const pn = /* @__PURE__ */ ot(Ts), ba = Ue, ql = cr, Wm = fr, wa = {
   onRequestTimeout: () => {
   },
   onTransportError: () => {
@@ -13525,7 +13525,7 @@ var s_ = class {
     return this._request;
   }
   send() {
-    const n = new Gm(this._ua, this._request, {
+    const n = new Wm(this._ua, this._request, {
       onRequestTimeout: () => {
         this._eventHandlers.onRequestTimeout();
       },
@@ -13553,7 +13553,7 @@ var s_ = class {
     }, 1e3)) : n.status_code >= 200 && n.status_code < 300 ? this._eventHandlers.onSuccessResponse(n) : n.status_code >= 300 && this._eventHandlers.onErrorResponse(n);
   }
 };
-const Wm = /* @__PURE__ */ ot(s_), Km = at, Qc = xt, Ps = Ue, Ui = cr, Ym = s_, Oa = Et(), Da = new Km("Dialog"), xs = {
+const Km = /* @__PURE__ */ ot(s_), Ym = at, Qc = xt, Ps = Ue, Ui = cr, zm = s_, Oa = Et(), Da = new Ym("Dialog"), xs = {
   // Dialog states.
   STATUS_EARLY: 1,
   STATUS_CONFIRMED: 2,
@@ -13621,7 +13621,7 @@ var n_ = class {
     const o = Oa.cloneArray(r.extraHeaders), a = Oa.cloneObject(r.eventHandlers), t = r.body || null, s = this._createRequest(n, o, t);
     return a.onAuthenticated = () => {
       this._local_seqnum += 1;
-    }, new Ym(this, s, a).send(), s;
+    }, new zm(this, s, a).send(), s;
   }
   receiveRequest(n) {
     this._checkInDialogRequest(n) && (n.method === Ps.ACK && this._ack_seqnum !== null ? this._ack_seqnum = null : n.method === Ps.INVITE && (this._ack_seqnum = n.cseq), this._owner.receiveRequest(n));
@@ -13684,14 +13684,14 @@ var n_ = class {
 };
 const Bl = /* @__PURE__ */ ot(n_);
 var Iu = { exports: {} };
-const zm = ct.EventEmitter, Jm = at, Xm = Ue, Qm = Ts, Zc = Et(), Zm = new Jm("RTCSession:DTMF"), r_ = {
+const Jm = ct.EventEmitter, Xm = at, Qm = Ue, Zm = Ts, Zc = Et(), eg = new Xm("RTCSession:DTMF"), r_ = {
   MIN_DURATION: 70,
   MAX_DURATION: 6e3,
   DEFAULT_DURATION: 100,
   MIN_INTER_TONE_GAP: 50,
   DEFAULT_INTER_TONE_GAP: 500
 };
-Iu.exports = class extends zm {
+Iu.exports = class extends Jm {
   constructor(n) {
     super(), this._session = n, this._direction = null, this._tone = null, this._duration = null, this._request = null;
   }
@@ -13705,7 +13705,7 @@ Iu.exports = class extends zm {
     if (n === void 0)
       throw new TypeError("Not enough arguments");
     if (this._direction = "outgoing", this._session.status !== this._session.C.STATUS_CONFIRMED && this._session.status !== this._session.C.STATUS_WAITING_FOR_ACK)
-      throw new Qm.InvalidStateError(this._session.status);
+      throw new Zm.InvalidStateError(this._session.status);
     const o = Zc.cloneArray(r.extraHeaders);
     if (this.eventHandlers = Zc.cloneObject(r.eventHandlers), typeof n == "string")
       n = n.toUpperCase();
@@ -13724,7 +13724,7 @@ Iu.exports = class extends zm {
       originator: "local",
       dtmf: this,
       request: this._request
-    }), this._session.sendRequest(Xm.INFO, {
+    }), this._session.sendRequest(Qm.INFO, {
       extraHeaders: o,
       eventHandlers: {
         onSuccessResponse: (t) => {
@@ -13763,13 +13763,13 @@ Iu.exports = class extends zm {
       originator: "remote",
       dtmf: this,
       request: n
-    }) : Zm.debug("invalid INFO DTMF received, discarded");
+    }) : eg.debug("invalid INFO DTMF received, discarded");
   }
 };
 Iu.exports.C = r_;
 var i_ = Iu.exports;
-const eg = /* @__PURE__ */ ot(i_), tg = ct.EventEmitter, sg = Ue, ng = Ts, rg = Et();
-var l_ = class extends tg {
+const tg = /* @__PURE__ */ ot(i_), sg = ct.EventEmitter, ng = Ue, rg = Ts, ig = Et();
+var l_ = class extends sg {
   constructor(n) {
     super(), this._session = n, this._direction = null, this._contentType = null, this._body = null;
   }
@@ -13783,14 +13783,14 @@ var l_ = class extends tg {
     if (this._direction = "outgoing", n === void 0)
       throw new TypeError("Not enough arguments");
     if (this._session.status !== this._session.C.STATUS_CONFIRMED && this._session.status !== this._session.C.STATUS_WAITING_FOR_ACK)
-      throw new ng.InvalidStateError(this._session.status);
+      throw new rg.InvalidStateError(this._session.status);
     this._contentType = n, this._body = r;
-    const a = rg.cloneArray(o.extraHeaders);
+    const a = ig.cloneArray(o.extraHeaders);
     a.push(`Content-Type: ${n}`), this._session.newInfo({
       originator: "local",
       info: this,
       request: this.request
-    }), this._session.sendRequest(sg.INFO, {
+    }), this._session.sendRequest(ng.INFO, {
       extraHeaders: a,
       eventHandlers: {
         onSuccessResponse: (t) => {
@@ -13826,7 +13826,7 @@ var l_ = class extends tg {
     });
   }
 };
-const au = /* @__PURE__ */ ot(l_), ig = at, ef = Ue, lg = new ig("RTCSession:ReferNotifier"), Na = {
+const au = /* @__PURE__ */ ot(l_), lg = at, ef = Ue, og = new lg("RTCSession:ReferNotifier"), Na = {
   event_type: "refer",
   body_type: "message/sipfrag;version=2.0",
   expires: 300
@@ -13836,7 +13836,7 @@ var o_ = class {
     this._session = n, this._id = r, this._expires = o || Na.expires, this._active = !0, this.notify(100);
   }
   notify(n, r) {
-    if (lg.debug("notify()"), this._active === !1)
+    if (og.debug("notify()"), this._active === !1)
       return;
     r = r || ef.REASON_PHRASE[n] || "";
     let o;
@@ -13856,8 +13856,8 @@ var o_ = class {
     });
   }
 };
-const og = /* @__PURE__ */ ot(o_), ag = ct.EventEmitter, ug = at, Pi = Ue, cg = rs(), tf = Et(), _n = new ug("RTCSession:ReferSubscriber");
-var a_ = class extends ag {
+const ag = /* @__PURE__ */ ot(o_), ug = ct.EventEmitter, cg = at, Pi = Ue, fg = rs(), tf = Et(), _n = new cg("RTCSession:ReferSubscriber");
+var a_ = class extends ug {
   constructor(n) {
     super(), this._id = null, this._session = n;
   }
@@ -13902,7 +13902,7 @@ var a_ = class extends ag {
   receiveNotify(n) {
     if (_n.debug("receiveNotify()"), !n.body)
       return;
-    const r = cg.parse(n.body.trim().split(`\r
+    const r = fg.parse(n.body.trim().split(`\r
 `, 1)[0], "Status_Line");
     if (r === -1) {
       _n.debug(`receiveNotify() | error parsing NOTIFY body: "${n.body}"`);
@@ -13947,7 +13947,7 @@ var a_ = class extends ag {
     });
   }
 };
-const fg = /* @__PURE__ */ ot(a_), _g = ct.EventEmitter, sf = Nt, hg = at, fe = Ue, hn = Ts, nf = cr, Be = Et(), xi = Ru, dg = xt, Gl = n_, pg = fr, Pt = i_, rf = l_, mg = o_, gg = a_, lf = gs(), Y = new hg("RTCSession"), Q = {
+const _g = /* @__PURE__ */ ot(a_), hg = ct.EventEmitter, sf = Nt, dg = at, fe = Ue, hn = Ts, nf = cr, Be = Et(), xi = Ru, pg = xt, Gl = n_, mg = fr, Pt = i_, rf = l_, gg = o_, Tg = a_, lf = gs(), Y = new dg("RTCSession"), Q = {
   // RTCSession states.
   STATUS_NULL: 0,
   STATUS_INVITE_SENT: 1,
@@ -13960,7 +13960,7 @@ const fg = /* @__PURE__ */ ot(a_), _g = ct.EventEmitter, sf = Nt, hg = at, fe =
   STATUS_TERMINATED: 8,
   STATUS_CONFIRMED: 9
 }, Wl = ["audio", "video"];
-var u_ = class uu extends _g {
+var u_ = class uu extends hg {
   /**
    * Expose C object.
    */
@@ -14093,7 +14093,7 @@ var u_ = class uu extends _g {
     this._contact = this._ua.contact.toString({
       anonymous: E,
       outbound: !0
-    }), E ? (y.from_display_name = "Anonymous", y.from_uri = new lf("sip", "anonymous", "anonymous.invalid"), s.push(`P-Preferred-Identity: ${this._ua.configuration.uri.toString()}`), s.push("Privacy: id")) : r.fromUserName && (y.from_uri = new lf("sip", r.fromUserName, this._ua.configuration.uri.host), s.push(`P-Preferred-Identity: ${this._ua.configuration.uri.toString()}`)), r.fromDisplayName && (y.from_display_name = r.fromDisplayName), s.push(`Contact: ${this._contact}`), s.push("Content-Type: application/sdp"), this._sessionTimers.enabled && s.push(`Session-Expires: ${this._sessionTimers.defaultExpires}${this._ua.configuration.session_timers_force_refresher ? ";refresher=uac" : ""}`), this._request = new dg.InitialOutgoingInviteRequest(
+    }), E ? (y.from_display_name = "Anonymous", y.from_uri = new lf("sip", "anonymous", "anonymous.invalid"), s.push(`P-Preferred-Identity: ${this._ua.configuration.uri.toString()}`), s.push("Privacy: id")) : r.fromUserName && (y.from_uri = new lf("sip", r.fromUserName, this._ua.configuration.uri.host), s.push(`P-Preferred-Identity: ${this._ua.configuration.uri.toString()}`)), r.fromDisplayName && (y.from_display_name = r.fromDisplayName), s.push(`Contact: ${this._contact}`), s.push("Content-Type: application/sdp"), this._sessionTimers.enabled && s.push(`Session-Expires: ${this._sessionTimers.defaultExpires}${this._ua.configuration.session_timers_force_refresher ? ";refresher=uac" : ""}`), this._request = new pg.InitialOutgoingInviteRequest(
       n,
       this._ua,
       y,
@@ -14414,7 +14414,7 @@ var u_ = class uu extends _g {
       return !1;
     if (n = this._ua.normalizeTarget(n), !n)
       throw new TypeError(`Invalid target: ${o}`);
-    const a = new gg(this);
+    const a = new Tg(this);
     a.sendRefer(n, r);
     const t = a.id;
     return this._referSubscribers[t] = a, a.on("requestFailed", () => {
@@ -14777,7 +14777,7 @@ var u_ = class uu extends _g {
       return;
     }
     n.reply(202);
-    const r = new mg(this, n.cseq);
+    const r = new gg(this, n.cseq);
     Y.debug('emit "refer"'), this.emit("refer", {
       request: n,
       accept: (t, s) => {
@@ -14863,7 +14863,7 @@ var u_ = class uu extends _g {
    * Initial Request Sender
    */
   _sendInitialRequest(n, r, o) {
-    const a = new pg(this._ua, this._request, {
+    const a = new mg(this._ua, this._request, {
       onRequestTimeout: () => {
         this.onRequestTimeout();
       },
@@ -15274,8 +15274,8 @@ var u_ = class uu extends _g {
     });
   }
 };
-const Tg = /* @__PURE__ */ ot(u_), vg = ct.EventEmitter, Eg = at, Ua = Ue, Sg = xt, Mi = Et(), yg = fr, of = Ts, Ag = gs(), Kl = new Eg("Message");
-var Cg = class extends vg {
+const vg = /* @__PURE__ */ ot(u_), Eg = ct.EventEmitter, Sg = at, Ua = Ue, yg = xt, Mi = Et(), Ag = fr, of = Ts, Cg = gs(), Kl = new Sg("Message");
+var Rg = class extends Eg {
   constructor(n) {
     super(), this._ua = n, this._request = null, this._closed = !1, this._direction = null, this._local_identity = null, this._remote_identity = null, this._is_replied = !1, this._data = {};
   }
@@ -15295,17 +15295,17 @@ var Cg = class extends vg {
     if (n = this._ua.normalizeTarget(n), !n)
       throw new TypeError(`Invalid target: ${a}`);
     const t = Mi.cloneArray(o.extraHeaders), s = Mi.cloneObject(o.eventHandlers), p = o.contentType || "text/plain", _ = {};
-    o.fromUserName && (_.from_uri = new Ag("sip", o.fromUserName, this._ua.configuration.uri.host), t.push(`P-Preferred-Identity: ${this._ua.configuration.uri.toString()}`)), o.fromDisplayName && (_.from_display_name = o.fromDisplayName);
+    o.fromUserName && (_.from_uri = new Cg("sip", o.fromUserName, this._ua.configuration.uri.host), t.push(`P-Preferred-Identity: ${this._ua.configuration.uri.toString()}`)), o.fromDisplayName && (_.from_display_name = o.fromDisplayName);
     for (const g in s)
       Object.prototype.hasOwnProperty.call(s, g) && this.on(g, s[g]);
-    t.push(`Content-Type: ${p}`), this._request = new Sg.OutgoingRequest(
+    t.push(`Content-Type: ${p}`), this._request = new yg.OutgoingRequest(
       Ua.MESSAGE,
       n,
       this._ua,
       _,
       t
     ), r && (this._request.body = r);
-    const d = new yg(this._ua, this._request, {
+    const d = new Ag(this._ua, this._request, {
       onRequestTimeout: () => {
         this._onRequestTimeout();
       },
@@ -15395,8 +15395,8 @@ var Cg = class extends vg {
     });
   }
 };
-const Rg = ct.EventEmitter, Ig = at, Pa = Ue, bg = xt, ki = Et(), wg = fr, af = Ts, Yl = new Ig("Options");
-var Og = class extends Rg {
+const Ig = ct.EventEmitter, bg = at, Pa = Ue, wg = xt, ki = Et(), Og = fr, af = Ts, Yl = new bg("Options");
+var Dg = class extends Ig {
   constructor(n) {
     super(), this._ua = n, this._request = null, this._closed = !1, this._direction = null, this._local_identity = null, this._remote_identity = null, this._is_replied = !1, this._data = {};
   }
@@ -15418,14 +15418,14 @@ var Og = class extends Rg {
     const t = ki.cloneArray(o.extraHeaders), s = ki.cloneObject(o.eventHandlers), p = o.contentType || "application/sdp";
     for (const d in s)
       Object.prototype.hasOwnProperty.call(s, d) && this.on(d, s[d]);
-    t.push(`Content-Type: ${p}`), this._request = new bg.OutgoingRequest(
+    t.push(`Content-Type: ${p}`), this._request = new wg.OutgoingRequest(
       Pa.OPTIONS,
       n,
       this._ua,
       null,
       t
     ), r && (this._request.body = r);
-    const _ = new wg(this._ua, this._request, {
+    const _ = new Og(this._ua, this._request, {
       onRequestTimeout: () => {
         this._onRequestTimeout();
       },
@@ -15515,7 +15515,7 @@ var Og = class extends Rg {
     });
   }
 }, bu = {};
-const Dg = at, xa = Et(), Ng = rs(), Li = new Dg("Socket");
+const Ng = at, xa = Et(), Ug = rs(), Li = new Ng("Socket");
 bu.isSocket = (c) => {
   if (Array.isArray(c))
     return !1;
@@ -15526,7 +15526,7 @@ bu.isSocket = (c) => {
       throw Li.warn("missing or invalid JsSIP.Socket url property"), new Error("Missing or invalid JsSIP.Socket url property");
     if (!xa.isString(c.via_transport))
       throw Li.warn("missing or invalid JsSIP.Socket via_transport property"), new Error("Missing or invalid JsSIP.Socket via_transport property");
-    if (Ng.parse(c.sip_uri, "SIP_URI") === -1)
+    if (Ug.parse(c.sip_uri, "SIP_URI") === -1)
       throw Li.warn("missing or invalid JsSIP.Socket sip_uri property"), new Error("missing or invalid JsSIP.Socket sip_uri property");
   } catch {
     return !1;
@@ -15541,7 +15541,7 @@ bu.isSocket = (c) => {
   }
   return !0;
 };
-const Ug = at, Pg = bu, uf = Ue, Ot = new Ug("Transport"), Vt = {
+const Pg = at, xg = bu, uf = Ue, Ot = new Pg("Transport"), Vt = {
   // Transport status.
   STATUS_CONNECTED: 0,
   STATUS_CONNECTING: 1,
@@ -15557,7 +15557,7 @@ const Ug = at, Pg = bu, uf = Ue, Ot = new Ug("Transport"), Vt = {
     max_interval: uf.CONNECTION_RECOVERY_MAX_INTERVAL
   }
 };
-var xg = class {
+var Mg = class {
   constructor(n, r = Vt.recovery_options) {
     Ot.debug("new()"), this.status = Vt.STATUS_DISCONNECTED, this.socket = null, this.sockets = [], this.recovery_options = r, this.recover_attempts = 0, this.recovery_timer = null, this.close_requested = !1;
     try {
@@ -15568,7 +15568,7 @@ var xg = class {
     if (typeof n > "u")
       throw new TypeError("Invalid argument. undefined 'sockets' argument");
     n instanceof Array || (n = [n]), n.forEach(function(o) {
-      if (!Pg.isSocket(o.socket))
+      if (!xg.isSocket(o.socket))
         throw new TypeError("Invalid argument. invalid 'JsSIP.Socket' instance");
       if (o.weight && !Number(o.weight))
         throw new TypeError("Invalid argument. 'weight' attribute is not a number");
@@ -15691,7 +15691,7 @@ ${n}
     this.ondata({ transport: this, message: n });
   }
 }, c_ = {};
-const Mg = at, cu = rs(), fu = xt, zl = new Mg("Parser");
+const kg = at, cu = rs(), fu = xt, zl = new kg("Parser");
 c_.parseMessage = (c, n) => {
   let r, o, a = c.indexOf(`\r
 `);
@@ -15709,14 +15709,14 @@ c_.parseMessage = (c, n) => {
   r.data = c;
   let p = a + 2;
   for (; ; ) {
-    if (a = kg(c, p), a === -2) {
+    if (a = Lg(c, p), a === -2) {
       o = p + 2;
       break;
     } else if (a === -1) {
       zl.warn("parseMessage() | malformed message");
       return;
     }
-    if (s = Lg(r, c, p, a), s !== !0) {
+    if (s = $g(r, c, p, a), s !== !0) {
       zl.warn("parseMessage() |", s.error);
       return;
     }
@@ -15729,7 +15729,7 @@ c_.parseMessage = (c, n) => {
     r.body = c.substring(o);
   return r;
 };
-function kg(c, n) {
+function Lg(c, n) {
   let r = n, o = 0, a = 0;
   if (c.substring(r, r + 2).match(/(^\r\n)/))
     return -2;
@@ -15741,7 +15741,7 @@ function kg(c, n) {
   }
   return o;
 }
-function Lg(c, n, r, o) {
+function $g(c, n, r, o) {
   let a;
   const t = n.indexOf(":", r), s = n.substring(r, t).trim(), p = n.substring(t + 1, o).trim();
   switch (s.toLowerCase()) {
@@ -15818,46 +15818,46 @@ function Lg(c, n, r, o) {
     error: `error parsing header "${s}"`
   } : !0;
 }
-const $g = at, f_ = Ue, cf = xt, wu = Et(), Ou = new $g("sanityCheck"), Hg = [zg], Fg = [
-  qg,
+const Hg = at, f_ = Ue, cf = xt, wu = Et(), Ou = new Hg("sanityCheck"), Fg = [Jg], Vg = [
   Bg,
   Gg,
-  Wg
-], Vg = [
-  Kg,
-  Yg
+  Wg,
+  Kg
+], jg = [
+  Yg,
+  zg
 ];
 let Fe, Zt, __;
-var jg = (c, n, r) => {
+var qg = (c, n, r) => {
   Fe = c, Zt = n, __ = r;
-  for (const o of Hg)
+  for (const o of Fg)
     if (o() === !1)
       return !1;
   if (Fe instanceof cf.IncomingRequest) {
-    for (const o of Fg)
+    for (const o of Vg)
       if (o() === !1)
         return !1;
   } else if (Fe instanceof cf.IncomingResponse) {
-    for (const o of Vg)
+    for (const o of jg)
       if (o() === !1)
         return !1;
   }
   return !0;
 };
-function qg() {
+function Bg() {
   if (Fe.s("to").uri.scheme !== "sip")
     return Yi(416), !1;
 }
-function Bg() {
+function Gg() {
   if (!Fe.to_tag && Fe.call_id.substr(0, 5) === Zt.configuration.jssip_id)
     return Yi(482), !1;
 }
-function Gg() {
+function Wg() {
   const c = wu.str_utf8_length(Fe.body), n = Fe.getHeader("content-length");
   if (c < n)
     return Yi(400), !1;
 }
-function Wg() {
+function Kg() {
   const c = Fe.from_tag, n = Fe.call_id, r = Fe.cseq;
   let o;
   if (!Fe.to_tag)
@@ -15875,16 +15875,16 @@ function Wg() {
           return Yi(482), !1;
     }
 }
-function Kg() {
+function Yg() {
   if (Fe.getHeaders("via").length > 1)
     return Ou.debug("more than one Via header field present in the response, dropping the response"), !1;
 }
-function Yg() {
+function zg() {
   const c = wu.str_utf8_length(Fe.body), n = Fe.getHeader("content-length");
   if (c < n)
     return Ou.debug("message body length is lower than the value in Content-Length header field, dropping the response"), !1;
 }
-function zg() {
+function Jg() {
   const c = ["from", "to", "call_id", "cseq", "via"];
   for (const n of c)
     if (!Fe.hasHeader(n))
@@ -16085,7 +16085,7 @@ Du.load = (c, n) => {
         throw new La.ConfigurationError(r, o);
     }
 };
-const Jg = ct.EventEmitter, Xg = at, dt = Ue, Qg = Fm, _f = u_, hf = Cg, df = Og, $a = cr, Zg = xg, Xl = Et(), eT = Ts, tT = gs(), sT = c_, Ha = xt, nT = jg, Fa = Du, je = new Xg("UA"), gt = {
+const Xg = ct.EventEmitter, Qg = at, dt = Ue, Zg = Vm, _f = u_, hf = Rg, df = Dg, $a = cr, eT = Mg, Xl = Et(), tT = Ts, sT = gs(), nT = c_, Ha = xt, rT = qg, Fa = Du, je = new Qg("UA"), gt = {
   // UA status codes.
   STATUS_INIT: 0,
   STATUS_READY: 1,
@@ -16095,7 +16095,7 @@ const Jg = ct.EventEmitter, Xg = at, dt = Ue, Qg = Fm, _f = u_, hf = Cg, df = Og
   CONFIGURATION_ERROR: 1,
   NETWORK_ERROR: 2
 };
-var h_ = class extends Jg {
+var h_ = class extends Xg {
   // Expose C object.
   static get C() {
     return gt;
@@ -16115,7 +16115,7 @@ var h_ = class extends Jg {
     } catch (r) {
       throw this._status = gt.STATUS_NOT_READY, this._error = gt.CONFIGURATION_ERROR, r;
     }
-    this._registrator = new Qg(this);
+    this._registrator = new Zg(this);
   }
   get C() {
     return gt;
@@ -16492,19 +16492,19 @@ var h_ = class extends Jg {
     const r = this._configuration.uri.clone();
     r.user = null, this._configuration.hostport_params = r.toString().replace(/^sip:/i, "");
     try {
-      this._transport = new Zg(this._configuration.sockets, {
+      this._transport = new eT(this._configuration.sockets, {
         // Recovery options.
         max_interval: this._configuration.connection_recovery_max_interval,
         min_interval: this._configuration.connection_recovery_min_interval
-      }), this._transport.onconnecting = rT.bind(this), this._transport.onconnect = iT.bind(this), this._transport.ondisconnect = lT.bind(this), this._transport.ondata = oT.bind(this);
+      }), this._transport.onconnecting = iT.bind(this), this._transport.onconnect = lT.bind(this), this._transport.ondisconnect = oT.bind(this), this._transport.ondata = aT.bind(this);
     } catch (a) {
-      throw je.warn(a), new eT.ConfigurationError("sockets", this._configuration.sockets);
+      throw je.warn(a), new tT.ConfigurationError("sockets", this._configuration.sockets);
     }
     if (delete this._configuration.sockets, this._configuration.authorization_user || (this._configuration.authorization_user = this._configuration.uri.user), !this._configuration.registrar_server) {
       const a = this._configuration.uri.clone();
       a.user = null, a.clearParams(), a.clearHeaders(), this._configuration.registrar_server = a;
     }
-    this._configuration.no_answer_timeout *= 1e3, this._configuration.contact_uri ? this._configuration.via_host = this._configuration.contact_uri.host : this._configuration.contact_uri = new tT("sip", Xl.createRandomToken(8), this._configuration.via_host, null, { transport: "ws" }), this._contact = {
+    this._configuration.no_answer_timeout *= 1e3, this._configuration.contact_uri ? this._configuration.via_host = this._configuration.contact_uri.host : this._configuration.contact_uri = new sT("sip", Xl.createRandomToken(8), this._configuration.via_host, null, { transport: "ws" }), this._contact = {
       pub_gruu: null,
       temp_gruu: null,
       uri: this._configuration.contact_uri,
@@ -16549,23 +16549,23 @@ var h_ = class extends Jg {
         }
   }
 };
-function rT(c) {
+function iT(c) {
   this.emit("connecting", c);
 }
-function iT(c) {
+function lT(c) {
   this._status !== gt.STATUS_USER_CLOSED && (this._status = gt.STATUS_READY, this._error = null, this.emit("connected", c), this._dynConfiguration.register && this._registrator.register());
 }
-function lT(c) {
+function oT(c) {
   const n = ["nict", "ict", "nist", "ist"];
   for (const r of n)
     for (const o in this._transactions[r])
       Object.prototype.hasOwnProperty.call(this._transactions[r], o) && this._transactions[r][o].onTransportError();
   this.emit("disconnected", c), this._registrator.onTransportClosed(), this._status !== gt.STATUS_USER_CLOSED && (this._status = gt.STATUS_NOT_READY, this._error = gt.NETWORK_ERROR);
 }
-function oT(c) {
+function aT(c) {
   const n = c.transport;
   let r = c.message;
-  if (r = sT.parseMessage(r, this), !!r && !(this._status === gt.STATUS_USER_CLOSED && r instanceof Ha.IncomingRequest) && nT(r, this, n)) {
+  if (r = nT.parseMessage(r, this), !!r && !(this._status === gt.STATUS_USER_CLOSED && r instanceof Ha.IncomingRequest) && rT(r, this, n)) {
     if (r instanceof Ha.IncomingRequest)
       r.transport = n, this.receiveRequest(r);
     else if (r instanceof Ha.IncomingResponse) {
@@ -16583,7 +16583,7 @@ function oT(c) {
     }
   }
 }
-const aT = /* @__PURE__ */ ot(h_);
+const uT = /* @__PURE__ */ ot(h_);
 var Me = Et();
 const Va = /* @__PURE__ */ ot(Me), ja = new zf("Dialog"), Ms = {
   // Dialog states.
@@ -16656,7 +16656,7 @@ class Ql {
     const o = Va.cloneArray(r.extraHeaders), a = Va.cloneObject(r.eventHandlers), t = r.body || null, s = this._createRequest(n, o, t);
     return a.onAuthenticated = () => {
       this._local_seqnum += 1;
-    }, new Wm(this, s, a).send(), s;
+    }, new Km(this, s, a).send(), s;
   }
   receiveRequest(n) {
     this._checkInDialogRequest(n) && (n.method === G.ACK && this._ack_seqnum !== null ? this._ack_seqnum = null : n.method === G.INVITE && (this._ack_seqnum = n.cseq), this._owner.receiveRequest(n));
@@ -16717,9 +16717,9 @@ class Ql {
     return !0;
   }
 }
-var uT = gs();
-const qi = /* @__PURE__ */ ot(uT);
-function cT(c) {
+var cT = gs();
+const qi = /* @__PURE__ */ ot(cT);
+function fT(c) {
   const n = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789";
   let r = "";
   for (let o = 0; o < c; o++) {
@@ -17288,7 +17288,7 @@ class Io extends ct.EventEmitter {
       return !1;
     if (n = this._ua.normalizeTarget(n), !n)
       throw new TypeError(`Invalid target: ${o}`);
-    const a = new fg(this);
+    const a = new _g(this);
     a.sendRefer(n, r);
     const t = a.id;
     return this._referSubscribers[t] = a, a.on("requestFailed", () => {
@@ -17354,7 +17354,7 @@ class Io extends ct.EventEmitter {
         case G.INFO:
           if (this._status === te.STATUS_1XX_RECEIVED || this._status === te.STATUS_WAITING_FOR_ANSWER || this._status === te.STATUS_ANSWERED || this._status === te.STATUS_WAITING_FOR_ACK || this._status === te.STATUS_CONFIRMED) {
             const r = n.hasHeader("Content-Type") ? n.getHeader("Content-Type").toLowerCase() : void 0;
-            r && r.match(/^application\/dtmf-relay/i) ? new eg(this).init_incoming(n) : r !== void 0 ? new au(this).init_incoming(n) : n.reply(415);
+            r && r.match(/^application\/dtmf-relay/i) ? new tg(this).init_incoming(n) : r !== void 0 ? new au(this).init_incoming(n) : n.reply(415);
           } else
             n.reply(403, "Wrong Status");
           break;
@@ -17675,7 +17675,7 @@ class Io extends ct.EventEmitter {
       return;
     }
     n.reply(202);
-    const r = new og(this, n.cseq);
+    const r = new ag(this, n.cseq);
     Z.debug('emit "refer"'), this.emit("refer", {
       request: n,
       accept: (t, s) => {
@@ -17764,7 +17764,7 @@ class Io extends ct.EventEmitter {
    * Initial Request Sender
    */
   _sendInitialRequest(n, r, o) {
-    this.ackSent = !1;
+    this.ackSent = !1, this.publisherSubscribeSent = !1;
     const a = new t_(this._ua, this._request, {
       onRequestTimeout: () => {
         this.onRequestTimeout();
@@ -17845,7 +17845,7 @@ class Io extends ct.EventEmitter {
         this.sendRequest(G.ACK), this.sendRequest(G.BYE);
         return;
       }
-    if (this.ackSent) {
+    if (this.ackSent && !this.publisherSubscribeSent) {
       const r = JSON.parse(n.body);
       this.session_id = r.session_id, this.handle_id = r.data.id;
       const a = {
@@ -17856,14 +17856,14 @@ class Io extends ct.EventEmitter {
           ptype: "publisher",
           display: "User1",
           clientID: "dufgjb023gh4vr872v238ugf2y82g4",
-          opaque_id: `videoroomtest-${cT(12)}`
+          opaque_id: `videoroomtest-${fT(12)}`
         },
         handle_id: this.handle_id
       }, t = ["PTYPE: Publisher"];
-      console.log("JOIN MESSAGE", a), this.sendRequest(G.SUBSCRIBE, {
+      this.sendRequest(G.SUBSCRIBE, {
         extraHeaders: t,
         body: JSON.stringify(a)
-      });
+      }), this.publisherSubscribeSent = !0;
     }
     if (this._is_canceled) {
       console.log("IF 2 canceled"), n.status_code >= 100 && n.status_code < 200 ? this._request.cancel(this._cancel_reason) : n.status_code >= 200 && n.status_code < 299 && (console.log("IF 2 _acceptAndTerminate"), this._acceptAndTerminate(n));
@@ -18451,7 +18451,7 @@ a=path:${n.getHeader("Use-Path")} msrp://${this._ua._configuration.authorization
     console.log("onmessage", n);
     const r = new nr(n.data);
     if (this.status === "auth" && r.code === 401) {
-      const o = this.parseAuth(r.getHeader("WWW-Authenticate")), a = new bm(this.credentials);
+      const o = this.parseAuth(r.getHeader("WWW-Authenticate")), a = new wm(this.credentials);
       a.authenticate({
         method: "AUTH",
         ruri: `msrp://${this._ua._configuration.realm}:2856;ws`,
@@ -18795,8 +18795,8 @@ const Dt = console, pf = {
   // UA error codes.
   CONFIGURATION_ERROR: 1,
   NETWORK_ERROR: 2
-}, fT = aT;
-class _T extends fT {
+}, _T = uT;
+class hT extends _T {
   //_janus_session: any = null
   constructor(n) {
     super(n), this._msrp_sessions = [], this._transactions = {
@@ -18886,7 +18886,7 @@ class _T extends fT {
                 t.to_tag
               ), o ? (a = o.owner, a.isEnded() ? n.reply(603) : a.receiveRequest(n)) : n.reply(481);
             } else
-              n.body.search(/MSRP/ig) > -1 ? (a = new qa(this), a.init_incoming(n)) : n.body.search(/JANUS/ig) > -1 || (a = new Tg(this), a.init_incoming(n));
+              n.body.search(/MSRP/ig) > -1 ? (a = new qa(this), a.init_incoming(n)) : n.body.search(/JANUS/ig) > -1 || (a = new vg(this), a.init_incoming(n));
           else
             Dt.warn("INVITE received but WebRTC is not supported"), n.reply(488);
           break;
@@ -18985,7 +18985,7 @@ class _T extends fT {
   //     return session
   // }
 }
-const hT = [
+const dT = [
   "roomId",
   "_audioMuted",
   "_cancel_reason",
@@ -19009,7 +19009,7 @@ const hT = [
   //'originalStream',
   "localMuted",
   "autoAnswer"
-], dT = [
+], pT = [
   //'roomId',
   "_cancel_reason",
   "_contact",
@@ -19028,13 +19028,13 @@ const hT = [
 ];
 function mf(c) {
   const n = {};
-  return hT.forEach((r) => {
+  return dT.forEach((r) => {
     c[r] !== void 0 && (n[r] = c[r]);
   }), n.localHold = c._localHold, n;
 }
 function gf(c) {
   const n = {};
-  return dT.forEach((r) => {
+  return pT.forEach((r) => {
     c[r] !== void 0 && (n[r] = c[r]);
   }), n;
 }
@@ -19042,19 +19042,22 @@ function Tf(c, n) {
   const r = new AudioContext(), o = r.createMediaStreamSource(c), a = r.createMediaStreamDestination(), t = r.createGain();
   return o.connect(t), t.connect(a), t.gain.value = n, a.stream;
 }
-function pT(c, n, r, o) {
+function mT(c, n, r, o) {
   const a = document.createElement("audio");
-  a.id = n._id, a.className = "audioTag", a.srcObject = c, a.setSinkId(r), a.volume = o, a.play(), n.audioTag = a;
+  a.id = n._id, a.className = "audioTag", a.srcObject = c, d_() || (a.setSinkId(r), a.volume = o), a.play(), n.audioTag = a;
 }
-function mT(c) {
+function gT(c) {
   if (c && typeof c.log == "function" && typeof c.warn == "function" && typeof c.error == "function")
     return !0;
 }
-const gT = at, TT = rs(), bt = new gT("WebSocketInterface");
-var vT = class {
+function d_() {
+  return /Mobi|Android|iPhone/i.test(navigator.userAgent);
+}
+const TT = at, vT = rs(), bt = new TT("WebSocketInterface");
+var ET = class {
   constructor(n) {
     bt.debug('new() [url:"%s"]', n), this._url = n, this._sip_uri = null, this._via_transport = null, this._ws = null;
-    const r = TT.parse(n, "absoluteURI");
+    const r = vT.parse(n, "absoluteURI");
     if (r === -1)
       throw bt.warn(`invalid WebSocket URI: ${n}`), new TypeError(`Invalid argument: ${n}`);
     if (r.scheme !== "wss" && r.scheme !== "ws")
@@ -19120,17 +19123,17 @@ var vT = class {
     bt.warn(`WebSocket ${this._url} error: `, n);
   }
 };
-const _u = bo, ET = Ue, ST = Ts, yT = Et(), AT = h_, CT = gs(), RT = Au(), IT = rs(), bT = vT, wT = ur("JsSIP");
-wT("version %s", _u.version);
-var OT = {
-  C: ET,
-  Exceptions: ST,
-  Utils: yT,
-  UA: AT,
-  URI: CT,
-  NameAddrHeader: RT,
-  WebSocketInterface: bT,
-  Grammar: IT,
+const _u = bo, ST = Ue, yT = Ts, AT = Et(), CT = h_, RT = gs(), IT = Au(), bT = rs(), wT = ET, OT = ur("JsSIP");
+OT("version %s", _u.version);
+var DT = {
+  C: ST,
+  Exceptions: yT,
+  Utils: AT,
+  UA: CT,
+  URI: RT,
+  NameAddrHeader: IT,
+  WebSocketInterface: wT,
+  Grammar: bT,
   // Expose the debug module.
   debug: ur,
   get name() {
@@ -19140,11 +19143,11 @@ var OT = {
     return _u.version;
   }
 };
-const DT = /* @__PURE__ */ ot(OT);
+const NT = /* @__PURE__ */ ot(DT);
 function Ba(c) {
   return c < 10 ? `0${c}` : `${c}`;
 }
-function NT(c) {
+function UT(c) {
   let n = c.hours || 0, r = c.minutes || 0, o = c.seconds || 0;
   o++, o === 60 && (o = 0, r++, r === 60 && (r = 0, n++));
   const a = `${Ba(n)}:${Ba(r)}:${Ba(o)}`;
@@ -19278,7 +19281,7 @@ St.reduce = async (c, n, r) => {
     o in c && (a = await n(await a, await c[o], o, c));
   return a;
 };
-var d_ = {};
+var p_ = {};
 (function(c) {
   const n = St;
   Object.keys(n).forEach((r) => {
@@ -19287,9 +19290,9 @@ var d_ = {};
       return n[r](this, ...a);
     };
   });
-})(d_);
-const UT = St, PT = d_;
-var vf = Object.assign(UT, { instanceMethods: PT });
+})(p_);
+const PT = St, xT = p_;
+var vf = Object.assign(PT, { instanceMethods: xT });
 const Tn = new AudioContext(), es = {
   NEW_CALL: "new_call",
   CALL_CONFIRMED: "confirmed",
@@ -19297,7 +19300,7 @@ const Tn = new AudioContext(), es = {
   CALL_PROGRESS: "progress",
   CALL_ENDED: "ended"
 };
-var xT = { exports: {} };
+var MT = { exports: {} };
 (function(c) {
   var n = function(r) {
     var o = Object.prototype, a = o.hasOwnProperty, t = Object.defineProperty || function(ee, W, B) {
@@ -19641,12 +19644,12 @@ var xT = { exports: {} };
   } catch {
     typeof globalThis == "object" ? globalThis.regeneratorRuntime = n : Function("r", "regeneratorRuntime = r")(n);
   }
-})(xT);
-var p_ = { exports: {} };
+})(MT);
+var m_ = { exports: {} };
 (function(c) {
   (function(n, r) {
     c.exports ? c.exports = r() : n.log = r();
-  })(S_, function() {
+  })(y_, function() {
     var n = function() {
     }, r = "undefined", o = typeof window !== r && typeof window.navigator !== r && /Trident\/|MSIE /.test(window.navigator.userAgent), a = [
       "trace",
@@ -19783,13 +19786,13 @@ var p_ = { exports: {} };
       return y;
     }, E.default = E, E;
   });
-})(p_);
-var At = p_.exports;
+})(m_);
+var At = m_.exports;
 const ds = () => `${(/* @__PURE__ */ new Date()).toISOString()} | metrics`, ps = (c, n, r) => `${c} | ${n} | ${r}`;
 At.setDefaultLevel(At.levels.TRACE);
-const MT = (c) => {
+const kT = (c) => {
   At.info(ps(ds(), "log         ", `set log level to ${c ? "verbose" : "info"}`)), At.setLevel(c ? At.levels.TRACE : At.levels.INFO);
-}, kT = (c) => {
+}, LT = (c) => {
   const n = [...Object.keys(At.levels)];
   n.includes(c) ? (At.info(ps(ds(), "log         ", `update log level to ${c.toLowerCase()}`)), At.setLevel(c)) : At.warn(ps(ds(), "log         ", "Incorrect log level please choose one of "), n);
 }, Pe = (c, n, r) => {
@@ -19803,7 +19806,7 @@ const MT = (c) => {
 }, lr = (c, n) => {
   At.error(ps(ds(), c, n));
 };
-function LT(c) {
+function $T(c) {
   return Math.floor(Math.random() * c).toString();
 }
 function Ef(c, n) {
@@ -19812,13 +19815,13 @@ function Ef(c, n) {
     r = r.replace(o, "");
   }), r;
 }
-function $T(c, n) {
+function HT(c, n) {
   let r = "";
   for (let o = 0; o < n; o += 1)
-    r += c[LT(c.length)];
+    r += c[$T(c.length)];
   return r;
 }
-function HT({
+function FT({
   length: c = 20,
   useLetters: n = !0,
   useNumbers: r = !0,
@@ -19826,10 +19829,10 @@ function HT({
   excludeSymbols: a = []
 } = {}) {
   let t = "abcdefghijklmnopqrstuvwxyz", s = "0123456789", p = [], _ = [], d = [];
-  return n && (a.length && (t = Ef(a, t)), _ = t.split("")), r && (a.length && (s = Ef(a, s)), d = s.split("")), p = [..._, ...d, ...o], $T(p, c);
+  return n && (a.length && (t = Ef(a, t)), _ = t.split("")), r && (a.length && (s = Ef(a, s)), d = s.split("")), p = [..._, ...d, ...o], HT(p, c);
 }
-var FT = HT;
-const Bi = /* @__PURE__ */ ot(FT), VT = () => "WebRTCMetrics", jT = () => "5.0.3", $e = {
+var VT = FT;
+const Bi = /* @__PURE__ */ ot(VT), jT = () => "WebRTCMetrics", qT = () => "5.0.3", $e = {
   INBOUND: "inbound",
   OUTBOUND: "outbound"
 }, hs = {
@@ -19844,7 +19847,7 @@ const Bi = /* @__PURE__ */ ot(FT), VT = () => "WebRTCMetrics", jT = () => "5.0.3
   DISCONNECTED: "disconnected",
   FAILED: "failed",
   CLOSED: "closed"
-}, qT = () => ({
+}, BT = () => ({
   ...{
     delta_time_to_measure_probes_ms: 0,
     // Total time to measure all probes
@@ -19858,7 +19861,7 @@ const Bi = /* @__PURE__ */ ot(FT), VT = () => "WebRTCMetrics", jT = () => "5.0.3
     total_time_encoded_out: 0,
     probes: []
   }
-}), m_ = {
+}), g_ = {
   level_in: 0,
   codec_id_in: "",
   codec_in: { mime_type: null, clock_rate: null, sdp_fmtp_line: null },
@@ -19875,7 +19878,7 @@ const Bi = /* @__PURE__ */ ot(FT), VT = () => "WebRTCMetrics", jT = () => "5.0.3
   mos_emodel_in: 0,
   ssrc: "",
   direction: $e.INBOUND
-}, g_ = {
+}, T_ = {
   level_out: 0,
   codec_id_out: "",
   codec_out: { mime_type: null, clock_rate: null, sdp_fmtp_line: null },
@@ -19896,7 +19899,7 @@ const Bi = /* @__PURE__ */ ot(FT), VT = () => "WebRTCMetrics", jT = () => "5.0.3
   mos_emodel_out: 0,
   ssrc: "",
   direction: $e.OUTBOUND
-}, T_ = {
+}, v_ = {
   codec_id_in: "",
   size_in: { width: null, height: null, framerate: null },
   codec_in: { mime_type: null, clock_rate: null },
@@ -19919,7 +19922,7 @@ const Bi = /* @__PURE__ */ ot(FT), VT = () => "WebRTCMetrics", jT = () => "5.0.3
   total_pli_sent_in: 0,
   ssrc: "",
   direction: $e.INBOUND
-}, v_ = {
+}, E_ = {
   codec_id_out: "",
   size_out: { width: null, height: null, framerate: null },
   codec_out: { mime_type: null, clock_rate: null },
@@ -19947,7 +19950,7 @@ const Bi = /* @__PURE__ */ ot(FT), VT = () => "WebRTCMetrics", jT = () => "5.0.3
   timestamp_out: null,
   ssrc: "",
   direction: $e.OUTBOUND
-}, BT = (c) => {
+}, GT = (c) => {
   const n = {
     pname: "",
     call_id: "",
@@ -20006,7 +20009,7 @@ const Bi = /* @__PURE__ */ ot(FT), VT = () => "WebRTCMetrics", jT = () => "5.0.3
     network: { ...n.network },
     experimental: { ...n.experimental }
   };
-}, GT = {
+}, WT = {
   refreshEvery: 2e3,
   // Default - generate a report every 2s (in ms). Min 1s.
   startAfter: 0,
@@ -20109,12 +20112,12 @@ const Bi = /* @__PURE__ */ ot(FT), VT = () => "WebRTCMetrics", jT = () => "5.0.3
   VIDEO: "video",
   NETWORK: "network",
   DATA: "data"
-}, Ka = "config      ", WT = (c, n = {}, r) => {
+}, Ka = "config      ", KT = (c, n = {}, r) => {
   const o = { ...r, ...n };
   return n.pname || mo(Ka, `Argument [String] 'cfg.pname' for the peerConnection name or id is missing - use generated '${r.pname}'`), n.cid || mo(Ka, `Argument [String] 'cfg.cid' for the call name or id is missing - use generated '${r.cid}'`), n.uid || mo(Ka, `Argument [String] 'cfg.uid' for the user name or id is missing - use generated '${r.uid}'`), o.pc = c, o;
-}, KT = (c = {}) => {
-  const n = { ...GT, ...c };
-  return n.name = VT(), n.version = jT(), n;
+}, YT = (c = {}) => {
+  const n = { ...WT, ...c };
+  return n.name = jT(), n.version = qT(), n;
 }, ll = (c, n, r, o = !1, a) => {
   let t = c.map((s) => {
     if (!r)
@@ -20125,7 +20128,7 @@ const Bi = /* @__PURE__ */ ot(FT), VT = () => "WebRTCMetrics", jT = () => "5.0.3
     return p ? p[r] : null;
   });
   return t = t.filter((s) => o ? Number.isFinite(s) && s > 0 : Number.isFinite(s)), t.length === 0 ? [] : t;
-}, $s = (c) => c.reduce((n, r) => n + r, 0) / c.length, YT = () => `probe-${Bi()}`, zT = () => `coltr-${Bi()}`, Sf = (c) => new Promise((n) => setTimeout(n, c)), hu = (c, n, r) => {
+}, $s = (c) => c.reduce((n, r) => n + r, 0) / c.length, zT = () => `probe-${Bi()}`, JT = () => `coltr-${Bi()}`, Sf = (c) => new Promise((n) => setTimeout(n, c)), hu = (c, n, r) => {
   n ? c.call(n, r) : c(r);
 }, Ke = (c, n, r, o) => {
   const a = ll(c, n, r, !0, o);
@@ -20152,15 +20155,15 @@ const Bi = /* @__PURE__ */ ot(FT), VT = () => "WebRTCMetrics", jT = () => "5.0.3
     return a[n][r];
   const t = a[n][o];
   return t ? t[r] : null;
-}, JT = (c) => c.slice().pop(), ut = (c, n, r) => {
+}, XT = (c) => c.slice().pop(), ut = (c, n, r) => {
   if (!n)
     return null;
   const o = {};
   let a = n[x.AUDIO][c];
-  a || (a = r === $e.INBOUND ? { ...m_ } : { ...g_ }), o[x.AUDIO] = a;
+  a || (a = r === $e.INBOUND ? { ...g_ } : { ...T_ }), o[x.AUDIO] = a;
   let t = n[x.VIDEO][c];
-  return t || (t = r === $e.INBOUND ? { ...T_ } : { ...v_ }), o[x.VIDEO] = t, o;
-}, Fi = "exporter    ", XT = "2.0", yf = (c, n, r) => {
+  return t || (t = r === $e.INBOUND ? { ...v_ } : { ...E_ }), o[x.VIDEO] = t, o;
+}, Fi = "exporter    ", QT = "2.0", yf = (c, n, r) => {
   if (!c || c.length === 0)
     return 0;
   const o = c[c.length - 1];
@@ -20172,7 +20175,7 @@ const Bi = /* @__PURE__ */ ot(FT), VT = () => "WebRTCMetrics", jT = () => "5.0.3
     return !s || !t ? Je(c, n, "delta_rtt_ms_out", !1, r) : Number(t / s);
   }
   return null;
-}, QT = (c, n) => {
+}, ZT = (c, n) => {
   if (!c || c.length === 0)
     return 0;
   const r = c[c.length - 1];
@@ -20184,7 +20187,7 @@ const Bi = /* @__PURE__ */ ot(FT), VT = () => "WebRTCMetrics", jT = () => "5.0.3
     n,
     "delta_rtt_connectivity_ms"
   ) : Number(o / a);
-}, ZT = (c) => pt(
+}, ev = (c) => pt(
   c,
   "network",
   "local_candidate_type"
@@ -20196,7 +20199,7 @@ const Bi = /* @__PURE__ */ ot(FT), VT = () => "WebRTCMetrics", jT = () => "5.0.3
   c,
   "network",
   "local_candidate_relay_protocol"
-)}`, ev = (c) => {
+)}`, tv = (c) => {
   const n = pt(
     c,
     "network",
@@ -20208,7 +20211,7 @@ const Bi = /* @__PURE__ */ ot(FT), VT = () => "WebRTCMetrics", jT = () => "5.0.3
   );
   return n !== "relay" ? `direct/${r}` : `turn/${r}`;
 };
-class tv {
+class sv {
   constructor(n) {
     this._start = null, this._end = null, this._cfg = n, this._referenceReport = null, this._reports = [], this._events = [];
   }
@@ -20258,7 +20261,7 @@ class tv {
       this._reports,
       "video",
       "total_packets_in"
-    ), t = {}, s = JT(this._reports);
+    ), t = {}, s = XT(this._reports);
     return s && (Object.keys(s[x.AUDIO]).forEach((p) => {
       const _ = s[x.AUDIO][p];
       if (t[_.ssrc] = {
@@ -20835,7 +20838,7 @@ class tv {
         t[p].jitter = d, t[p].rtt = E, t[p].traffic = T, t[p].bitrate = g, t[p].loss = R;
       }
     })), {
-      version: XT,
+      version: QT,
       configuration: {
         frequency: this._cfg.refreshEvery
       },
@@ -20858,7 +20861,7 @@ class tv {
       ssrc: t,
       data: {
         rtt: {
-          avg: QT(this._reports, "data"),
+          avg: ZT(this._reports, "data"),
           min: Ye(
             this._reports,
             "data",
@@ -20961,8 +20964,8 @@ class tv {
           }
         },
         network: {
-          localConnection: ZT(this._reports),
-          remoteConnection: ev(this._reports)
+          localConnection: ev(this._reports),
+          remoteConnection: tv(this._reports)
         }
       }
     };
@@ -21000,7 +21003,7 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
     totalRTT: T,
     totalRTTMeasurements: E
   };
-}, sv = (c, n, r, o) => {
+}, nv = (c, n, r, o) => {
   if (!Object.prototype.hasOwnProperty.call(
     c,
     V.CURRENT_ROUND_TRIP_TIME
@@ -21017,7 +21020,7 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
     totalRTT: t,
     totalRTTMeasurements: s
   };
-}, eo = (c, n, r) => c[V.TIMESTAMP] === r[n].timestamp_out || !Object.prototype.hasOwnProperty.call(c, V.JITTER) ? null : 1e3 * (Number(c[V.JITTER]) || 0), nv = (c, n) => {
+}, eo = (c, n, r) => c[V.TIMESTAMP] === r[n].timestamp_out || !Object.prototype.hasOwnProperty.call(c, V.JITTER) ? null : 1e3 * (Number(c[V.JITTER]) || 0), rv = (c, n) => {
   if (!Object.prototype.hasOwnProperty.call(c, V.FRAMES_DECODED) || !Object.prototype.hasOwnProperty.call(c, V.TOTAL_DECODE_TIME))
     return {
       delta_ms_decode_frame: n[x.VIDEO].delta_ms_decode_frame_in,
@@ -21030,7 +21033,7 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
     frames_decoded: r,
     total_decode_time: o
   };
-}, rv = (c, n) => {
+}, iv = (c, n) => {
   if (!Object.prototype.hasOwnProperty.call(c, V.FRAMES_ENCODED) || !Object.prototype.hasOwnProperty.call(c, V.TOTAL_ENCODE_TIME))
     return {
       delta_ms_encode_frame: n[x.VIDEO].delta_ms_encode_frame_out,
@@ -21090,7 +21093,7 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
     deltaKBytesReceived: g,
     kbsReceived: R
   };
-}, iv = (c) => c[V.CANDIDATE_TYPE] !== "relay" ? "" : c[V.RELAY_PROTOCOL] || "", lv = (c) => {
+}, lv = (c) => c[V.CANDIDATE_TYPE] !== "relay" ? "" : c[V.RELAY_PROTOCOL] || "", ov = (c) => {
   if (!Object.prototype.hasOwnProperty.call(c, V.NETWORK_TYPE))
     return Hi.WIFI;
   switch (c[V.NETWORK_TYPE]) {
@@ -21107,7 +21110,7 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
   width: c[V.FRAME_WIDTH] || null,
   height: c[V.FRAME_HEIGHT] || null,
   framerate: c[V.FRAMES_PER_SECOND]
-}, ov = (c) => {
+}, av = (c) => {
   const n = Object.prototype.hasOwnProperty.call(
     c,
     V.QUALITY_LIMITATION_REASON
@@ -21121,7 +21124,7 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
   return o && Object.keys(o).forEach((a) => {
     o[a] > 1e3 && (o[a] = Number(o[a] / 1e3));
   }), { reason: n, durations: o, resolutionChanges: r };
-}, av = (c, n, r) => {
+}, uv = (c, n, r) => {
   if (!Object.prototype.hasOwnProperty.call(c, V.PLI) || !Object.prototype.hasOwnProperty.call(c, V.NACK))
     return {
       pliCount: n.total_pli_sent_in,
@@ -21136,7 +21139,7 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
     deltaPliCount: o - n[x.VIDEO].total_pli_sent_in,
     deltaNackCount: a - n[x.VIDEO].total_nack_sent_in
   };
-}, uv = (c, n, r) => {
+}, cv = (c, n, r) => {
   if (!Object.prototype.hasOwnProperty.call(c, V.PLI) || !Object.prototype.hasOwnProperty.call(c, V.NACK))
     return {
       pliCount: n.total_pli_received_out,
@@ -21151,15 +21154,15 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
     deltaPliCount: o - n[x.VIDEO].total_pli_received_out,
     deltaNackCount: a - n[x.VIDEO].total_nack_received_out
   };
-}, cv = (c) => ({
+}, fv = (c) => ({
   channels: c[V.CHANNELS] || null,
   clock_rate: c[V.CLOCK_RATE] || null,
   mime_type: c[V.MIME_TYPE] || null,
   sdp_fmtp_line: c[V.SDP_FMTP_LINE] || null
-}), fv = (c) => ({
+}), _v = (c) => ({
   clock_rate: c[V.CLOCK_RATE] || null,
   mime_type: c[V.MIME_TYPE] || null
-}), _v = (c, n, r) => {
+}), hv = (c, n, r) => {
   const o = (c[V.BYTES_RECEIVED] || 0) / 1024 - (r ? r.data.total_KBytes_in : 0), a = (c[V.BYTES_SENT] || 0) / 1024 - (r ? r.data.total_KBytes_out : 0), t = c[V.TIMESTAMP] || Date.now(), s = o - n.data.total_KBytes_in, p = a - n.data.total_KBytes_out, _ = r ? r.timestamp : null;
   let d = n.timestamp;
   !d && _ && (d = _);
@@ -21172,13 +21175,13 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
     kbs_speed_received: T,
     kbs_speed_sent: E
   };
-}, hv = (c) => {
+}, dv = (c) => {
   const n = c[V.AVAILABLE_INCOMING_BITRATE] / 1024 || 0, r = c[V.AVAILABLE_OUTGOING_BITRATE] / 1024 || 0;
   return {
     kbs_incoming_bandwidth: n,
     kbs_outgoing_bandwidth: r
   };
-}, dv = (c, n, r, o) => {
+}, pv = (c, n, r, o) => {
   if (!c)
     return [];
   switch (c[V.TYPE]) {
@@ -21189,11 +21192,11 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
         `analyze() - got stats ${c[V.TYPE]} for ${r}`,
         c
       ), V.SELECTED in c && !c[V.SELECTED] && (a = !1)), a) {
-        const s = c[V.LOCAL_CANDIDATE_ID], p = c[V.REMOTE_CANDIDATE_ID], _ = _v(
+        const s = c[V.LOCAL_CANDIDATE_ID], p = c[V.REMOTE_CANDIDATE_ID], _ = hv(
           c,
           n,
           o
-        ), d = hv(c), g = sv(
+        ), d = dv(c), g = nv(
           c,
           "data",
           o,
@@ -21264,7 +21267,7 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
         return [
           {
             type: ne.NETWORK,
-            value: { infrastructure: lv(c) }
+            value: { infrastructure: ov(c) }
           },
           {
             type: ne.NETWORK,
@@ -21279,7 +21282,7 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
           {
             type: ne.NETWORK,
             value: {
-              local_candidate_relay_protocol: iv(c)
+              local_candidate_relay_protocol: lv(c)
             }
           }
         ];
@@ -21371,12 +21374,12 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
         ];
       }
       if (c[V.MEDIA_TYPE] === x.VIDEO) {
-        const d = nv(c, p), g = If(
+        const d = rv(c, p), g = If(
           c,
           x.VIDEO,
           p,
           _
-        ), T = eo(c, x.VIDEO, p), E = c[V.DECODER_IMPLEMENTATION] || null, y = c[V.CODEC_ID] || null, A = bf(c), R = av(
+        ), T = eo(c, x.VIDEO, p), E = c[V.DECODER_IMPLEMENTATION] || null, y = c[V.CODEC_ID] || null, A = bf(c), R = uv(
           c,
           p,
           _
@@ -21526,7 +21529,7 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
         ];
       }
       if (c[V.MEDIA_TYPE] === x.VIDEO) {
-        const d = c[V.ENCODER_IMPLEMENTATION] || null, g = c[V.CODEC_ID] || null, T = rv(c, p), E = bf(c), y = ov(c), A = uv(
+        const d = c[V.ENCODER_IMPLEMENTATION] || null, g = c[V.CODEC_ID] || null, T = iv(c, p), E = bf(c), y = av(c), A = cv(
           c,
           p,
           _
@@ -21642,7 +21645,7 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
             `analyze() - got stats ${c[V.TYPE]} for ${r}`,
             c
           );
-          const _ = cv(c);
+          const _ = fv(c);
           c[V.ID] === p.codec_id_in ? t.push({ ssrc: p.ssrc, type: ne.AUDIO, value: { codec_in: _ } }) : t.push({ ssrc: p.ssrc, type: ne.AUDIO, value: { codec_out: _ } });
         }
       }), Object.keys(n[x.VIDEO]).forEach((s) => {
@@ -21653,7 +21656,7 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
             `analyze() - got stats ${c[V.TYPE]} for ${r}`,
             c
           );
-          const _ = fv(c);
+          const _ = _v(c);
           c[V.ID] === p.codec_id_in ? t.push({ ssrc: p.ssrc, type: ne.VIDEO, value: { codec_in: _ } }) : t.push({ ssrc: p.ssrc, type: ne.VIDEO, value: { codec_out: _ } });
         }
       }), t;
@@ -21768,40 +21771,40 @@ const ks = "extractor   ", Af = (c, n, r, o) => {
     }
   }
   return [];
-}, xo = (c) => c < 0 ? 1 : c > 100 ? 4.5 : 1 + 0.035 * c + 7 / 1e6 * c * (c - 60) * (100 - c), pv = (c, n = x.AUDIO, r, o, a) => {
+}, xo = (c) => c < 0 ? 1 : c > 100 ? 4.5 : 1 + 0.035 * c + 7 / 1e6 * c * (c - 60) * (100 - c), mv = (c, n = x.AUDIO, r, o, a) => {
   const t = ut(a, c, $e.INBOUND), s = ut(a, r, $e.INBOUND), p = ut(a, o, $e.INBOUND), _ = [], d = [], g = t[n].percent_packets_lost_in, T = t[n].delta_jitter_ms_in, E = s && s[n].delta_jitter_ms_in || null, y = p && p[n].delta_jitter_ms_in || null, A = c.data.delta_rtt_connectivity_ms, R = r && r.data.delta_rtt_connectivity_ms || null, I = o && o.data.delta_rtt_connectivity_ms || null;
   A && _.push(A), R && _.push(R), I && _.push(I), T && d.push(T), r && E && d.push(E), o && y && d.push(y);
   const $ = _.length > 0 ? $s(_) : 100, L = d.length > 0 ? $s(d) : 10, ae = 93.2 - g, N = 0.18 * ae * ae - 27.9 * ae + 1126.62, F = ($ + L) / 2, Se = F - 177.3 < 0 ? 0 : 1, ve = 0.024 * F + 0.11 * (F - 177.3) * Se, M = N - ve;
   return xo(M);
-}, mv = (c, n = x.AUDIO, r, o, a) => {
+}, gv = (c, n = x.AUDIO, r, o, a) => {
   const t = ut(a, c, $e.OUTBOUND), s = ut(a, r, $e.OUTBOUND), p = ut(a, o, $e.OUTBOUND), _ = [], d = [], g = t[n].percent_packets_lost_out, T = t[n].delta_rtt_ms_out, E = s && s[n].delta_rtt_ms_out || null, y = p && p[n].delta_rtt_ms_out || null, A = t[n].delta_jitter_ms_out, R = s && s[n].delta_jitter_ms_out || null, I = p && p[n].delta_jitter_ms_out || null, $ = c.data.delta_rtt_connectivity_ms, L = r && r.data.delta_rtt_connectivity_ms || null, ae = o && o.data.delta_rtt_connectivity_ms || null;
   T ? _.push(T) : $ && _.push($), E ? _.push(E) : L && _.push(L), y ? _.push(y) : ae && _.push(ae), A && d.push(A), r && R && d.push(R), o && I && d.push(I);
   const N = _.length > 0 ? $s(_) : 100, F = d.length > 0 ? $s(d) : 10, Se = 93.2 - g, ve = 0.18 * Se * Se - 27.9 * Se + 1126.62, M = (N + F) / 2, D = M - 177.3 < 0 ? 0 : 1, q = 0.024 * M + 0.11 * (M - 177.3) * D, j = ve - q;
   return xo(j);
-}, gv = (c, n = x.AUDIO, r, o, a) => {
+}, Tv = (c, n = x.AUDIO, r, o, a) => {
   const t = ut(a, c, $e.INBOUND), s = ut(a, r, $e.INBOUND), p = ut(a, o, $e.INBOUND), _ = [], d = [], g = t[n].percent_packets_lost_in / 100, T = t[n].delta_jitter_ms_in, E = s && s[n].delta_jitter_ms_in || null, y = p && p[n].delta_jitter_ms_in || null, A = c.data.delta_rtt_connectivity_ms, R = r && r.data.delta_rtt_connectivity_ms || null, I = o && o.data.delta_rtt_connectivity_ms || null;
   A && _.push(A), R && _.push(R), I && _.push(I), T && d.push(T), s && E && d.push(E), p && y && d.push(y);
   const $ = _.length > 0 ? $s(_) : 100, L = d.length > 0 ? $s(d) : 10, ae = 0, N = 19.8, F = 29.7, Se = 30, ve = ($ + L) / 2 + Se, M = ve - 177.3 < 0 ? 0 : 1, D = 0.024 * ve + 0.11 * (ve - 177.3) * M, j = 93.2 - (ae + N * Math.log(1 + F * g) + D);
   return xo(j);
-}, Tv = (c, n = x.AUDIO, r, o, a) => {
+}, vv = (c, n = x.AUDIO, r, o, a) => {
   const t = ut(a, c, $e.OUTBOUND), s = ut(a, r, $e.OUTBOUND), p = ut(a, o, $e.OUTBOUND), _ = [], d = [], g = t[n].percent_packets_lost_out / 100, T = t[n].delta_rtt_ms_out, E = s && s[n].delta_rtt_ms_out || null, y = p && p[n].delta_rtt_ms_out || null, A = t[n].delta_jitter_ms_out, R = s && s[n].delta_jitter_ms_out || null, I = p && p[n].delta_jitter_ms_out || null, $ = c.data.delta_rtt_connectivity_ms, L = r && r.data.delta_rtt_connectivity_ms || null, ae = o && o.data.delta_rtt_connectivity_ms || null;
   T ? _.push(T) : $ && _.push($), E ? _.push(E) : L && _.push(L), y ? _.push(y) : ae && _.push(ae), A && d.push(A), s && R && d.push(R), p && I && d.push(I);
   const N = _.length > 0 ? $s(_) : 100, F = d.length > 0 ? $s(d) : 10, Se = 0, ve = 19.8, M = 29.7, D = 30, q = (N + F) / 2 + D, j = q - 177.3 < 0 ? 0 : 1, z = 0.024 * q + 0.11 * (q - 177.3) * j, J = 93.2 - (Se + ve * Math.log(1 + M * g) + z);
   return xo(J);
 };
-class vv {
+class Ev {
   constructor(n, r) {
     this._callbacks = {
       onreport: null,
       onticket: null
-    }, this._id = zT(), this._moduleName = this._id, this._probeId = r, this._config = n, this._exporter = new tv(n), this._state = hs.IDLE, this.registerToPCEvents(), vn(this._moduleName, `new collector created for probe ${this._probeId}`);
+    }, this._id = JT(), this._moduleName = this._id, this._probeId = r, this._config = n, this._exporter = new sv(n), this._state = hs.IDLE, this.registerToPCEvents(), vn(this._moduleName, `new collector created for probe ${this._probeId}`);
   }
   analyze(n, r, o, a) {
-    const t = (_, d) => _ === x.AUDIO ? d === Kt.INBOUND_RTP ? { ...m_ } : { ...g_ } : d === Kt.INBOUND_RTP ? { ...T_ } : { ...v_ }, s = BT(r);
+    const t = (_, d) => _ === x.AUDIO ? d === Kt.INBOUND_RTP ? { ...g_ } : { ...T_ } : d === Kt.INBOUND_RTP ? { ...v_ } : { ...E_ }, s = GT(r);
     s.pname = this._config.pname, s.call_id = this._config.cid, s.user_id = this._config.uid, s.count = r ? r.count + 1 : 1;
     let p = null;
     return n.forEach((_) => {
-      !p && _.timestamp && (p = _.timestamp), dv(_, s, s.pname, a).forEach((g) => {
+      !p && _.timestamp && (p = _.timestamp), pv(_, s, s.pname, a).forEach((g) => {
         if (g.value && g.type)
           if (g.ssrc) {
             let T = s[g.type][g.ssrc];
@@ -21815,25 +21818,25 @@ class vv {
       });
     }), s.timestamp = p, Object.keys(s[x.AUDIO]).forEach((_) => {
       const d = s[x.AUDIO][_];
-      d.direction === $e.INBOUND ? (d.mos_emodel_in = pv(
+      d.direction === $e.INBOUND ? (d.mos_emodel_in = mv(
         s,
         x.AUDIO,
         r,
         o,
         d.ssrc
-      ), d.mos_in = gv(
+      ), d.mos_in = Tv(
         s,
         x.AUDIO,
         r,
         o,
         d.ssrc
-      )) : (d.mos_emodel_out = mv(
+      )) : (d.mos_emodel_out = gv(
         s,
         x.AUDIO,
         r,
         o,
         d.ssrc
-      ), d.mos_out = Tv(
+      ), d.mos_out = vv(
         s,
         x.AUDIO,
         r,
@@ -22015,9 +22018,9 @@ class vv {
     }
   }
 }
-class Ev {
+class Sv {
   constructor(n) {
-    this._id = n.pname && n.pname.substr(0, 12).padEnd(12, " ") || YT(), this._moduleName = this._id, vn(this._moduleName, "probe created"), this._config = n, this._collector = new vv(this._config, this._id);
+    this._id = n.pname && n.pname.substr(0, 12).padEnd(12, " ") || zT(), this._moduleName = this._id, vn(this._moduleName, "probe created"), this._config = n, this._collector = new Ev(this._config, this._id);
   }
   /**
    * Register a callback to 'onreport'
@@ -22127,7 +22130,7 @@ class Ev {
   }
 }
 const yt = "engine      ";
-class Sv {
+class yv {
   constructor(n) {
     this._config = n, this._probes = [], this._startedTime = null, this._callbacks = {
       onresult: null
@@ -22145,7 +22148,7 @@ class Sv {
   addNewProbe(n, r) {
     if (!n)
       throw new Error("undefined peer connection");
-    const o = WT(n, r, this._config), a = new Ev(o);
+    const o = KT(n, r, this._config), a = new Sv(o);
     return this._probes.push(a), Pe(yt, `${this._probes.length} probes registered`), a;
   }
   removeExistingProbe(n) {
@@ -22157,7 +22160,7 @@ class Sv {
     const n = () => {
       this._probes.forEach((t) => t.start());
     }, r = async () => Promise.all(this._probes.map((t) => t.takeReferenceStats())), o = () => this.isIdle ? !1 : !this._config.stopAfter || this._config.stopAfter < 0 ? !0 : Date.now() < this._startedTime + this._config.stopAfter, a = async () => {
-      const t = qT(), s = this._probes.filter((p) => p.isRunning);
+      const t = BT(), s = this._probes.filter((p) => p.isRunning);
       for (const p of s) {
         const _ = await p.collectStats();
         _ && t.probes.push(_), Pe(yt, `got probe ${p.id}`), await Sf(0);
@@ -22192,17 +22195,17 @@ class Sv {
     this._callbacks.onresult && n.probes.length > 0 && hu(this._callbacks.onresult.callback, this._callbacks.onresult.context, n);
   }
 }
-const yv = "interface   ";
-class Av {
+const Av = "interface   ";
+class Cv {
   constructor(n) {
-    this._config = KT(n), vn(yv, `welcome to ${this._config.name} version ${this._config.version}`), MT(this._config.verbose || !1), this._engine = new Sv(this._config);
+    this._config = YT(n), vn(Av, `welcome to ${this._config.name} version ${this._config.version}`), kT(this._config.verbose || !1), this._engine = new yv(this._config);
   }
   /**
    * Change log level manually
    * @param {string} level - The level of logs. Can be one of 'TRACE', 'DEBUG', 'INFO', 'WARN', 'ERROR', 'SILENT'
    */
   setupLogLevel(n) {
-    kT(n);
+    LT(n);
   }
   /**
    * Get the version
@@ -22267,7 +22270,7 @@ class Av {
     n ? this._engine.registerCallback("onresult", n) : this._engine.unregisterCallback("onresult");
   }
 }
-function Cv(c, n) {
+function Rv(c, n) {
   return Object.keys(c).filter((r) => n.includes(r)).reduce((r, o) => {
     const a = o;
     return {
@@ -22276,8 +22279,8 @@ function Cv(c, n) {
     };
   }, {});
 }
-const Rv = ["mos_in", "codec_in", "delta_KBytes_in", "delta_kbs_in", "delta_jitter_ms_in", "delta_packets_lost_in"];
-class Iv {
+const Iv = ["mos_in", "codec_in", "delta_KBytes_in", "delta_kbs_in", "delta_jitter_ms_in", "delta_packets_lost_in"];
+class bv {
   constructor(n) {
     this.intervals = {}, this.emitInterval = n.emitInterval || 200, this.onChangeFunction = n.onChangeFunction;
   }
@@ -22313,8 +22316,8 @@ class Iv {
 const to = {
   SELECTED_INPUT_DEVICE: "OpensipsJSInputDevice",
   SELECTED_OUTPUT_DEVICE: "OpensipsJSOutputDevice"
-}, bv = 0;
-class wv {
+}, wv = 0;
+class Ov {
   constructor(n) {
     this.isAutoAnswer = !1, this.muteWhenJoinEnabled = !1, this.isDNDEnabled = !1, this.muted = !1, this.microphoneInputLevelValue = 1, this.speakerVolumeValue = 1, this.activeRooms = {}, this.activeCalls = {}, this.extendedCalls = {}, this.availableMediaDevices = [], this.selectedMediaDevices = {
       input: "default",
@@ -22324,7 +22327,7 @@ class wv {
     }, this.activeStreamValue = null, this.initialStreamValue = null, this.context = n, this.context.on(
       this.context.newRTCSessionEventName,
       this.newRTCSessionCallback.bind(this)
-    ), this.VUMeter = new Iv({
+    ), this.VUMeter = new bv({
       onChangeFunction: this.emitVolumeChange.bind(this)
     }), this.initializeMediaDevices();
   }
@@ -22442,7 +22445,10 @@ class wv {
     return this.availableMediaDevices.filter((n) => n.kind === "audiooutput");
   }
   get getUserMediaConstraints() {
-    return {
+    return d_() ? {
+      video: !1,
+      audio: !0
+    } : {
       audio: {
         deviceId: {
           exact: this.selectedMediaDevices.input
@@ -22470,12 +22476,15 @@ class wv {
   }
   async initializeMediaDevices() {
     const n = localStorage.getItem(to.SELECTED_INPUT_DEVICE) || "default", r = localStorage.getItem(to.SELECTED_OUTPUT_DEVICE) || "default";
-    (await navigator.mediaDevices.getUserMedia(this.getUserMediaConstraints)).getTracks().forEach((t) => t.stop());
-    const a = await navigator.mediaDevices.enumerateDevices();
-    this.setAvailableMediaDevices(a), await this.setMicrophone(n), await this.setSpeaker(r), navigator.mediaDevices.addEventListener("devicechange", async () => {
-      const t = await navigator.mediaDevices.enumerateDevices();
-      this.setAvailableMediaDevices(t);
-    });
+    try {
+      const o = await navigator.mediaDevices.getUserMedia(this.getUserMediaConstraints), a = await navigator.mediaDevices.enumerateDevices();
+      this.setAvailableMediaDevices(a), await this.setMicrophone(n), await this.setSpeaker(r), navigator.mediaDevices.addEventListener("devicechange", async () => {
+        const t = await navigator.mediaDevices.enumerateDevices();
+        this.setAvailableMediaDevices(t);
+      }), o.getTracks().forEach((t) => t.stop());
+    } catch (o) {
+      console.error(o);
+    }
   }
   setCallTime(n) {
     const r = { ...n };
@@ -22562,7 +22571,7 @@ class wv {
     });
   }
   cancelAllOutgoingUnanswered() {
-    Object.values(this.getActiveCalls).filter((n) => n.direction === "outgoing" && n.status === bv).forEach((n) => this.terminateCall(n._id));
+    Object.values(this.getActiveCalls).filter((n) => n.direction === "outgoing" && n.status === wv).forEach((n) => this.terminateCall(n._id));
   }
   answerCall(n) {
     const r = this.extendedCalls[n];
@@ -22801,7 +22810,7 @@ class wv {
     };
     this.setCallTime(r);
     const o = setInterval(() => {
-      const a = { ...this.callTime[n] }, t = NT(a);
+      const a = { ...this.callTime[n] }, t = UT(a);
       this.setCallTime({
         callId: n,
         ...t
@@ -22943,7 +22952,7 @@ class wv {
     }, this.context.emit("changeCallMetrics", this.callMetrics);
   }
   getCallQuality(n) {
-    const r = new Av(this.metricConfig), o = r.createProbe(n.connection, {
+    const r = new Cv(this.metricConfig), o = r.createProbe(n.connection, {
       cid: n._id
     }), a = [];
     let t;
@@ -22951,7 +22960,7 @@ class wv {
       Object.entries(s.audio).forEach(([d, g]) => {
         g.direction === "inbound" && !a.includes(d) && (a.push(d), t = d);
       });
-      const p = s.audio[t], _ = Cv(p, Rv);
+      const p = s.audio[t], _ = Rv(p, Iv);
       _.callId = n._id, this.setCallMetrics(r);
     }, this.context.subscribe(es.CALL_ENDED, (s) => {
       s._id === n._id && r.stopAllProbes();
@@ -22972,7 +22981,7 @@ class wv {
     const o = Tf(this.initialStreamValue, this.microphoneInputLevel * 2), a = this.isMuted || this.muteWhenJoin;
     o.getTracks().forEach((s) => s.enabled = !a), this.setActiveStream(o), await r.connection.getSenders()[0].replaceTrack(o.getTracks()[0]);
     const t = new MediaStream([n.track]);
-    pT(t, r, this.selectedOutputDevice, this.speakerVolume), this.setupVUMeter(t, r._id), this.getCallQuality(r), this.updateCall(r);
+    mT(t, r, this.selectedOutputDevice, this.speakerVolume), this.setupVUMeter(t, r._id), this.getCallQuality(r), this.updateCall(r);
   }
   //@requireInitialization()
   initCall(n, r) {
@@ -23002,7 +23011,7 @@ class wv {
     });
   }
 }
-class Ov {
+class Dv {
   constructor(n) {
     this.context = n;
   }
@@ -23032,7 +23041,7 @@ class Ov {
       })
   }*/
 }
-class Dv {
+class Nv {
   constructor(n) {
     this.activeMessages = {}, this.extendedMessages = {}, this.msrpHistory = {}, this.context = n, this.context.on(
       this.context.newMSRPSessionEventName,
@@ -23203,15 +23212,15 @@ const Ya = {
   VIDEO: "video",
   MSRP: "msrp"
 };
-class Wv extends _T {
+class Kv extends hT {
   constructor(n, r) {
     if (!n.modules.length)
       throw new Error("options.modules should include at least 1 module");
     const o = {
       ...n.configuration,
-      sockets: n.socketInterfaces.map((a) => new DT.WebSocketInterface(a))
+      sockets: n.socketInterfaces.map((a) => new NT.WebSocketInterface(a))
     };
-    super(o), this.initialized = !1, this.logger = console, this.newRTCSessionEventName = "newRTCSession", this.registeredEventName = "registered", this.unregisteredEventName = "unregistered", this.disconnectedEventName = "disconnected", this.connectedEventName = "connected", this.newMSRPSessionEventName = "newMSRPSession", this.isReconnecting = !1, this.audio = null, this.msrp = null, this.video = null, this.listenersList = {}, this.modules = [], n.pnExtraHeaders && Object.keys(n.pnExtraHeaders).length && this.registrator().setExtraContactParams(n.pnExtraHeaders), this.options = n, this.modules = n.modules, r && mT(r) && (this.logger = r);
+    super(o), this.initialized = !1, this.logger = console, this.newRTCSessionEventName = "newRTCSession", this.registeredEventName = "registered", this.unregisteredEventName = "unregistered", this.disconnectedEventName = "disconnected", this.connectedEventName = "connected", this.newMSRPSessionEventName = "newMSRPSession", this.isReconnecting = !1, this.audio = null, this.msrp = null, this.video = null, this.listenersList = {}, this.modules = [], n.pnExtraHeaders && Object.keys(n.pnExtraHeaders).length && this.registrator().setExtraContactParams(n.pnExtraHeaders), this.options = n, this.modules = n.modules, r && gT(r) && (this.logger = r);
   }
   on(n, r) {
     return super.on(n, r);
@@ -23230,7 +23239,7 @@ class Wv extends _T {
       console.error("Connection is already established");
       return;
     }
-    return this.modules.includes(Ya.AUDIO) && (this.audio = new wv(this)), this.modules.includes(Ya.MSRP) && (this.msrp = new Dv(this)), this.modules.includes(Ya.VIDEO) && (this.video = new Ov(this)), this.on(
+    return this.modules.includes(Ya.AUDIO) && (this.audio = new Ov(this)), this.modules.includes(Ya.MSRP) && (this.msrp = new Nv(this)), this.modules.includes(Ya.VIDEO) && (this.video = new Dv(this)), this.on(
       this.registeredEventName,
       () => {
         this.logger.log("Successfully registered to", this.options.socketInterfaces[0]), this.setInitialized(!0);
@@ -24404,5 +24413,5 @@ class Wv extends _T {
       }*/
 }
 export {
-  Wv as default
+  Kv as default
 };