@voicenter-team/opensips-js 1.0.117 → 1.0.119

package/dist/opensips-js.es.js

@@ -673,7 +673,7 @@ function Wa() {
           tag_param: jl,
           Max_Forwards: vd,
           Min_Expires: Ya,
-          Name_Addr_Header: sc,
+          Name_Addr_Header: nc,
           Proxy_Authenticate: Go,
           challenge: Wo,
           other_challenge: Aa,
@@ -695,11 +695,11 @@ function Wa() {
           rec_route: Na,
           Reason: Jl,
           reason_param: Ko,
-          reason_cause: rc,
+          reason_cause: sc,
           Require: Xo,
           Route: Yo,
           route_param: Jo,
-          Subscription_State: ic,
+          Subscription_State: rc,
           substate_value: no,
           subexp_params: so,
           event_reason_value: C,
@@ -727,9 +727,9 @@ function Wa() {
           Session_Expires: Kn,
           s_e_expires: Rr,
           s_e_params: Qo,
-          s_e_refresher: ac,
-          extension_header: oc,
-          header_value: lc,
+          s_e_refresher: ic,
+          extension_header: ac,
+          header_value: oc,
           message_body: Td,
           uuid_URI: ro,
           uuid: Ci,
@@ -738,8 +738,8 @@ function Wa() {
           hex12: Ep,
           Refer_To: jy,
           Replaces: xp,
-          call_id: uc,
-          replaces_param: cc,
+          call_id: lc,
+          replaces_param: uc,
           to_tag: wd,
           from_tag: Cd,
           early_flag: Ip
@@ -1808,7 +1808,7 @@ function Wa() {
             le = v;
           }(f, l)), l === null && (a = f), l;
         }
-        function sc() {
+        function nc() {
           var l, f, g, v, S, A, M, X, he, Qe;
           for (X = a, he = a, l = [], f = ai(); f !== null; )
             l.push(f), f = ai();
@@ -2047,9 +2047,9 @@ function Wa() {
         }
         function Ko() {
           var l;
-          return l = rc(), l === null && (l = Xt()), l;
+          return l = sc(), l === null && (l = Xt()), l;
         }
-        function rc() {
+        function sc() {
           var l, f, g, v, S, A;
           if (S = a, A = a, n.substr(a, 5).toLowerCase() === "cause" ? (l = n.substr(a, 5), a += 5) : (l = null, c('"cause"')), l !== null)
             if (f = be(), f !== null) {
@@ -2097,7 +2097,7 @@ function Wa() {
             l = null, a = S;
           return l;
         }
-        function ic() {
+        function rc() {
           var l, f, g, v, S, A;
           if (S = a, l = no(), l !== null) {
             for (f = [], A = a, g = ue(), g !== null ? (v = so(), v !== null ? g = [g, v] : (g = null, a = A)) : (g = null, a = A); g !== null; )
@@ -2286,19 +2286,19 @@ function Wa() {
         }
         function Qo() {
           var l;
-          return l = ac(), l === null && (l = Xt()), l;
+          return l = ic(), l === null && (l = Xt()), l;
         }
-        function ac() {
+        function ic() {
           var l, f, g, v, S;
           return v = a, S = a, n.substr(a, 9).toLowerCase() === "refresher" ? (l = n.substr(a, 9), a += 9) : (l = null, c('"refresher"')), l !== null ? (f = be(), f !== null ? (n.substr(a, 3).toLowerCase() === "uac" ? (g = n.substr(a, 3), a += 3) : (g = null, c('"uac"')), g === null && (n.substr(a, 3).toLowerCase() === "uas" ? (g = n.substr(a, 3), a += 3) : (g = null, c('"uas"'))), g !== null ? l = [l, f, g] : (l = null, a = S)) : (l = null, a = S)) : (l = null, a = S), l !== null && (l = function(A, M) {
             le.refresher = M.toLowerCase();
           }(v, l[2])), l === null && (a = v), l;
         }
-        function oc() {
+        function ac() {
           var l, f, g, v;
-          return v = a, l = Q(), l !== null ? (f = D(), f !== null ? (g = lc(), g !== null ? l = [l, f, g] : (l = null, a = v)) : (l = null, a = v)) : (l = null, a = v), l;
+          return v = a, l = Q(), l !== null ? (f = D(), f !== null ? (g = oc(), g !== null ? l = [l, f, g] : (l = null, a = v)) : (l = null, a = v)) : (l = null, a = v), l;
         }
-        function lc() {
+        function oc() {
           var l, f;
           for (l = [], f = G(), f === null && (f = te(), f === null && (f = O())); f !== null; )
             l.push(f), f = G(), f === null && (f = te(), f === null && (f = O()));
@@ -2350,21 +2350,21 @@ function Wa() {
         }
         function xp() {
           var l, f, g, v, S, A;
-          if (S = a, l = uc(), l !== null) {
-            for (f = [], A = a, g = ue(), g !== null ? (v = cc(), v !== null ? g = [g, v] : (g = null, a = A)) : (g = null, a = A); g !== null; )
-              f.push(g), A = a, g = ue(), g !== null ? (v = cc(), v !== null ? g = [g, v] : (g = null, a = A)) : (g = null, a = A);
+          if (S = a, l = lc(), l !== null) {
+            for (f = [], A = a, g = ue(), g !== null ? (v = uc(), v !== null ? g = [g, v] : (g = null, a = A)) : (g = null, a = A); g !== null; )
+              f.push(g), A = a, g = ue(), g !== null ? (v = uc(), v !== null ? g = [g, v] : (g = null, a = A)) : (g = null, a = A);
             f !== null ? l = [l, f] : (l = null, a = S);
           } else
             l = null, a = S;
           return l;
         }
-        function uc() {
+        function lc() {
           var l, f, g, v, S, A;
           return v = a, S = a, l = fe(), l !== null ? (A = a, n.charCodeAt(a) === 64 ? (f = "@", a++) : (f = null, c('"@"')), f !== null ? (g = fe(), g !== null ? f = [f, g] : (f = null, a = A)) : (f = null, a = A), f = f !== null ? f : "", f !== null ? l = [l, f] : (l = null, a = S)) : (l = null, a = S), l !== null && (l = function(M) {
             le.call_id = n.substring(a, M);
           }(v)), l === null && (a = v), l;
         }
-        function cc() {
+        function uc() {
           var l;
           return l = wd(), l === null && (l = Cd(), l === null && (l = Ip(), l === null && (l = Xt()))), l;
         }
@@ -2916,10 +2916,10 @@ In order to be iterable, non-array objects must have a [Symbol.iterator]() metho
     return d && Object.assign({}, d) || p;
   }, es;
 }
-var Wb = { exports: {} }, Ac = typeof Reflect == "object" ? Reflect : null, n2 = Ac && typeof Ac.apply == "function" ? Ac.apply : function(e, t, n) {
+var Wb = { exports: {} }, Ic = typeof Reflect == "object" ? Reflect : null, n2 = Ic && typeof Ic.apply == "function" ? Ic.apply : function(e, t, n) {
   return Function.prototype.apply.call(e, t, n);
 }, Om;
-Ac && typeof Ac.ownKeys == "function" ? Om = Ac.ownKeys : Object.getOwnPropertySymbols ? Om = function(e) {
+Ic && typeof Ic.ownKeys == "function" ? Om = Ic.ownKeys : Object.getOwnPropertySymbols ? Om = function(e) {
   return Object.getOwnPropertyNames(e).concat(Object.getOwnPropertySymbols(e));
 } : Om = function(e) {
   return Object.getOwnPropertyNames(e);
@@ -3452,9 +3452,9 @@ function i2(r, e) {
 function mD(r, e, t) {
   return e && i2(r.prototype, e), t && i2(r, t), r;
 }
-var dc = Jc, hc = "JsSIP", Ps = /* @__PURE__ */ function() {
+var cc = Jc, dc = "JsSIP", Ps = /* @__PURE__ */ function() {
   function r(e) {
-    pD(this, r), e ? (this._debug = dc.default("".concat(hc, ":").concat(e)), this._warn = dc.default("".concat(hc, ":WARN:").concat(e)), this._error = dc.default("".concat(hc, ":ERROR:").concat(e))) : (this._debug = dc.default(hc), this._warn = dc.default("".concat(hc, ":WARN")), this._error = dc.default("".concat(hc, ":ERROR"))), this._debug.log = console.info.bind(console), this._warn.log = console.warn.bind(console), this._error.log = console.error.bind(console);
+    pD(this, r), e ? (this._debug = cc.default("".concat(dc, ":").concat(e)), this._warn = cc.default("".concat(dc, ":WARN:").concat(e)), this._error = cc.default("".concat(dc, ":ERROR:").concat(e))) : (this._debug = cc.default(dc), this._warn = cc.default("".concat(dc, ":WARN")), this._error = cc.default("".concat(dc, ":ERROR"))), this._debug.log = console.info.bind(console), this._warn.log = console.warn.bind(console), this._error.log = console.error.bind(console);
   }
   return mD(r, [{
     key: "debug",
@@ -4038,15 +4038,15 @@ var Qy = gI, gD = /%[sdv%]/g, _D = function(r) {
   }), i.join(`\r
 `) + `\r
 `;
-}, Lu = pI, TD = bD;
+}, Mu = pI, TD = bD;
 Zr.write = TD;
-Zr.parse = Lu.parse;
-Zr.parseParams = Lu.parseParams;
-Zr.parseFmtpConfig = Lu.parseFmtpConfig;
-Zr.parsePayloads = Lu.parsePayloads;
-Zr.parseRemoteCandidates = Lu.parseRemoteCandidates;
-Zr.parseImageAttributes = Lu.parseImageAttributes;
-Zr.parseSimulcastStreamList = Lu.parseSimulcastStreamList;
+Zr.parse = Mu.parse;
+Zr.parseParams = Mu.parseParams;
+Zr.parseFmtpConfig = Mu.parseFmtpConfig;
+Zr.parsePayloads = Mu.parsePayloads;
+Zr.parseRemoteCandidates = Mu.parseRemoteCandidates;
+Zr.parseImageAttributes = Mu.parseImageAttributes;
+Zr.parseSimulcastStreamList = Mu.parseSimulcastStreamList;
 function $m(r) {
   "@babel/helpers - typeof";
   return typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? $m = function(t) {
@@ -9079,7 +9079,7 @@ function Y2(r, e) {
     n[t] = r[t];
   return n;
 }
-var Cc = Tr(), fu = hs, d1 = Wa(), J2 = Nl(), h1 = Kb, f1 = Rl;
+var wc = Tr(), fu = hs, d1 = Wa(), J2 = Nl(), h1 = Kb, f1 = Rl;
 Jb.settings = {
   // SIP authentication.
   authorization_user: null,
@@ -9114,7 +9114,7 @@ Jb.settings = {
    * Host address.
    * Value to be set in Via sent_by and host part of Contact FQDN.
   */
-  via_host: "".concat(Cc.createRandomToken(12), ".invalid")
+  via_host: "".concat(wc.createRandomToken(12), ".invalid")
 };
 var Up = {
   mandatory: {
@@ -9163,14 +9163,14 @@ var Up = {
         return e;
     },
     connection_recovery_max_interval: function(e) {
-      if (Cc.isDecimal(e)) {
+      if (wc.isDecimal(e)) {
         var t = Number(e);
         if (t > 0)
           return t;
       }
     },
     connection_recovery_min_interval: function(e) {
-      if (Cc.isDecimal(e)) {
+      if (wc.isDecimal(e)) {
         var t = Number(e);
         if (t > 0)
           return t;
@@ -9191,7 +9191,7 @@ var Up = {
         return e;
     },
     no_answer_timeout: function(e) {
-      if (Cc.isDecimal(e)) {
+      if (wc.isDecimal(e)) {
         var t = Number(e);
         if (t > 0)
           return t;
@@ -9223,7 +9223,7 @@ var Up = {
         return e;
     },
     register_expires: function(e) {
-      if (Cc.isDecimal(e)) {
+      if (wc.isDecimal(e)) {
         var t = Number(e);
         if (t > 0)
           return t;
@@ -9272,7 +9272,7 @@ Jb.load = function(r, e) {
   for (var s in Up.optional)
     if (e.hasOwnProperty(s)) {
       var a = e[s];
-      if (Cc.isEmpty(a))
+      if (wc.isEmpty(a))
         continue;
       var o = Up.optional[s](a);
       if (o !== void 0)
@@ -10045,10 +10045,10 @@ var rC = {
     return Fv.version;
   }
 };
-const fc = Jc, pc = "JsSIP";
+const hc = Jc, fc = "JsSIP";
 var Ss = class {
   constructor(e) {
-    e ? (this._debug = fc.default(`${pc}:${e}`), this._warn = fc.default(`${pc}:WARN:${e}`), this._error = fc.default(`${pc}:ERROR:${e}`)) : (this._debug = fc.default(pc), this._warn = fc.default(`${pc}:WARN`), this._error = fc.default(`${pc}:ERROR`)), this._debug.log = console.info.bind(console), this._warn.log = console.warn.bind(console), this._error.log = console.error.bind(console);
+    e ? (this._debug = hc.default(`${fc}:${e}`), this._warn = hc.default(`${fc}:WARN:${e}`), this._error = hc.default(`${fc}:ERROR:${e}`)) : (this._debug = hc.default(fc), this._warn = hc.default(`${fc}:WARN`), this._error = hc.default(`${fc}:ERROR`)), this._debug.log = console.info.bind(console), this._warn.log = console.warn.bind(console), this._error.log = console.error.bind(console);
   }
   get debug() {
     return this._debug;
@@ -10474,7 +10474,7 @@ function va() {
           Max_Forwards: jl,
           Min_Expires: vd,
           Name_Addr_Header: Ya,
-          Proxy_Authenticate: sc,
+          Proxy_Authenticate: nc,
           challenge: Go,
           other_challenge: Wo,
           auth_param: Aa,
@@ -10496,11 +10496,11 @@ function va() {
           Reason: Na,
           reason_param: Jl,
           reason_cause: Ko,
-          Require: rc,
+          Require: sc,
           Route: Xo,
           route_param: Yo,
           Subscription_State: Jo,
-          substate_value: ic,
+          substate_value: rc,
           subexp_params: no,
           event_reason_value: so,
           Subject: C,
@@ -10528,9 +10528,9 @@ function va() {
           s_e_expires: Kn,
           s_e_params: Rr,
           s_e_refresher: Qo,
-          extension_header: ac,
-          header_value: oc,
-          message_body: lc,
+          extension_header: ic,
+          header_value: ac,
+          message_body: oc,
           uuid_URI: Td,
           uuid: ro,
           hex4: Ci,
@@ -10539,8 +10539,8 @@ function va() {
           Refer_To: Ep,
           Replaces: jy,
           call_id: xp,
-          replaces_param: uc,
-          to_tag: cc,
+          replaces_param: lc,
+          to_tag: uc,
           from_tag: wd,
           early_flag: Cd
         };
@@ -11635,7 +11635,7 @@ function va() {
             }
           }()), h === null && (s = M), h;
         }
-        function sc() {
+        function nc() {
           var h;
           return h = Go(), h;
         }
@@ -11867,7 +11867,7 @@ function va() {
             ie.cause = parseInt(M.join(""));
           }(v, h[2])), h === null && (s = v), h;
         }
-        function rc() {
+        function sc() {
           var h, l, f, g, v, S;
           if (v = s, h = W(), h !== null) {
             for (l = [], S = s, f = Ve(), f !== null ? (g = W(), g !== null ? f = [f, g] : (f = null, s = S)) : (f = null, s = S); f !== null; )
@@ -11899,7 +11899,7 @@ function va() {
         }
         function Jo() {
           var h, l, f, g, v, S;
-          if (v = s, h = ic(), h !== null) {
+          if (v = s, h = rc(), h !== null) {
             for (l = [], S = s, f = q(), f !== null ? (g = no(), g !== null ? f = [f, g] : (f = null, s = S)) : (f = null, s = S); f !== null; )
               l.push(f), S = s, f = q(), f !== null ? (g = no(), g !== null ? f = [f, g] : (f = null, s = S)) : (f = null, s = S);
             l !== null ? h = [h, l] : (h = null, s = v);
@@ -11907,7 +11907,7 @@ function va() {
             h = null, s = v;
           return h;
         }
-        function ic() {
+        function rc() {
           var h, l;
           return l = s, t.substr(s, 6).toLowerCase() === "active" ? (h = t.substr(s, 6), s += 6) : (h = null, u('"active"')), h === null && (t.substr(s, 7).toLowerCase() === "pending" ? (h = t.substr(s, 7), s += 7) : (h = null, u('"pending"')), h === null && (t.substr(s, 10).toLowerCase() === "terminated" ? (h = t.substr(s, 10), s += 10) : (h = null, u('"terminated"')), h === null && (h = W()))), h !== null && (h = function(f) {
             ie.state = t.substring(s, f);
@@ -12094,17 +12094,17 @@ function va() {
             ie.refresher = A.toLowerCase();
           }(g, h[2])), h === null && (s = g), h;
         }
-        function ac() {
+        function ic() {
           var h, l, f, g;
-          return g = s, h = W(), h !== null ? (l = F(), l !== null ? (f = oc(), f !== null ? h = [h, l, f] : (h = null, s = g)) : (h = null, s = g)) : (h = null, s = g), h;
+          return g = s, h = W(), h !== null ? (l = F(), l !== null ? (f = ac(), f !== null ? h = [h, l, f] : (h = null, s = g)) : (h = null, s = g)) : (h = null, s = g), h;
         }
-        function oc() {
+        function ac() {
           var h, l;
           for (h = [], l = L(), l === null && (l = j(), l === null && (l = B())); l !== null; )
             h.push(l), l = L(), l === null && (l = j(), l === null && (l = B()));
           return h;
         }
-        function lc() {
+        function oc() {
           var h, l;
           for (h = [], l = y(); l !== null; )
             h.push(l), l = y();
@@ -12151,8 +12151,8 @@ function va() {
         function jy() {
           var h, l, f, g, v, S;
           if (v = s, h = xp(), h !== null) {
-            for (l = [], S = s, f = q(), f !== null ? (g = uc(), g !== null ? f = [f, g] : (f = null, s = S)) : (f = null, s = S); f !== null; )
-              l.push(f), S = s, f = q(), f !== null ? (g = uc(), g !== null ? f = [f, g] : (f = null, s = S)) : (f = null, s = S);
+            for (l = [], S = s, f = q(), f !== null ? (g = lc(), g !== null ? f = [f, g] : (f = null, s = S)) : (f = null, s = S); f !== null; )
+              l.push(f), S = s, f = q(), f !== null ? (g = lc(), g !== null ? f = [f, g] : (f = null, s = S)) : (f = null, s = S);
             l !== null ? h = [h, l] : (h = null, s = v);
           } else
             h = null, s = v;
@@ -12164,11 +12164,11 @@ function va() {
             ie.call_id = t.substring(s, A);
           }(g)), h === null && (s = g), h;
         }
-        function uc() {
+        function lc() {
           var h;
-          return h = cc(), h === null && (h = wd(), h === null && (h = Cd(), h === null && (h = ln()))), h;
+          return h = uc(), h === null && (h = wd(), h === null && (h = Cd(), h === null && (h = ln()))), h;
         }
-        function cc() {
+        function uc() {
           var h, l, f, g, v;
           return g = s, v = s, t.substr(s, 6) === "to-tag" ? (h = "to-tag", s += 6) : (h = null, u('"to-tag"')), h !== null ? (l = ae(), l !== null ? (f = W(), f !== null ? h = [h, l, f] : (h = null, s = v)) : (h = null, s = v)) : (h = null, s = v), h !== null && (h = function(S, A) {
             ie.to_tag = A;
@@ -12870,7 +12870,7 @@ var $s = {
   IncomingRequest: U6,
   IncomingResponse: B6
 };
-const pu = /* @__PURE__ */ yn($s), H6 = Ss, uo = tr(), aa = new H6("DigestAuthentication");
+const Ac = /* @__PURE__ */ yn($s), H6 = Ss, uo = tr(), aa = new H6("DigestAuthentication");
 var NI = class {
   constructor(e) {
     this._credentials = e, this._cnonce = null, this._nc = 0, this._ncHex = "00000000", this._algorithm = null, this._realm = null, this._nonce = null, this._opaque = null, this._stale = null, this._qop = null, this._method = null, this._uri = null, this._ha1 = null, this._response = null;
@@ -15945,7 +15945,7 @@ function ph(r) {
 }
 const c8 = /* @__PURE__ */ yn(GI);
 var mh = {};
-const Ec = tr(), mu = $t, O1 = va(), NC = ko(), $1 = nT, D1 = Oo;
+const Cc = tr(), pu = $t, O1 = va(), NC = ko(), $1 = nT, D1 = Oo;
 mh.settings = {
   // SIP authentication.
   authorization_user: null,
@@ -15963,7 +15963,7 @@ mh.settings = {
   use_preloaded_route: !1,
   // Session parameters.
   session_timers: !0,
-  session_timers_refresh_method: mu.UPDATE,
+  session_timers_refresh_method: pu.UPDATE,
   session_timers_force_refresher: !1,
   no_answer_timeout: 60,
   // Registration parameters.
@@ -15972,15 +15972,15 @@ mh.settings = {
   registrar_server: null,
   // Connection options.
   sockets: null,
-  connection_recovery_max_interval: mu.CONNECTION_RECOVERY_MAX_INTERVAL,
-  connection_recovery_min_interval: mu.CONNECTION_RECOVERY_MIN_INTERVAL,
+  connection_recovery_max_interval: pu.CONNECTION_RECOVERY_MAX_INTERVAL,
+  connection_recovery_min_interval: pu.CONNECTION_RECOVERY_MIN_INTERVAL,
   // Global extra headers, to be added to every request and response
   extra_headers: null,
   /*
    * Host address.
    * Value to be set in Via sent_by and host part of Contact FQDN.
   */
-  via_host: `${Ec.createRandomToken(12)}.invalid`
+  via_host: `${Cc.createRandomToken(12)}.invalid`
 };
 const Jp = {
   mandatory: {
@@ -15996,7 +15996,7 @@ const Jp = {
       return e;
     },
     uri(r) {
-      /^sip:/i.test(r) || (r = `${mu.SIP}:${r}`);
+      /^sip:/i.test(r) || (r = `${pu.SIP}:${r}`);
       const e = NC.parse(r);
       if (e)
         return e.user ? e : void 0;
@@ -16016,14 +16016,14 @@ const Jp = {
         return r;
     },
     connection_recovery_max_interval(r) {
-      if (Ec.isDecimal(r)) {
+      if (Cc.isDecimal(r)) {
         const e = Number(r);
         if (e > 0)
           return e;
       }
     },
     connection_recovery_min_interval(r) {
-      if (Ec.isDecimal(r)) {
+      if (Cc.isDecimal(r)) {
         const e = Number(r);
         if (e > 0)
           return e;
@@ -16044,7 +16044,7 @@ const Jp = {
         return r;
     },
     no_answer_timeout(r) {
-      if (Ec.isDecimal(r)) {
+      if (Cc.isDecimal(r)) {
         const e = Number(r);
         if (e > 0)
           return e;
@@ -16055,7 +16055,7 @@ const Jp = {
         return r;
     },
     session_timers_refresh_method(r) {
-      if (typeof r == "string" && (r = r.toUpperCase(), r === mu.INVITE || r === mu.UPDATE))
+      if (typeof r == "string" && (r = r.toUpperCase(), r === pu.INVITE || r === pu.UPDATE))
         return r;
     },
     session_timers_force_refresher(r) {
@@ -16076,14 +16076,14 @@ const Jp = {
         return r;
     },
     register_expires(r) {
-      if (Ec.isDecimal(r)) {
+      if (Cc.isDecimal(r)) {
         const e = Number(r);
         if (e > 0)
           return e;
       }
     },
     registrar_server(r) {
-      /^sip:/i.test(r) || (r = `${mu.SIP}:${r}`);
+      /^sip:/i.test(r) || (r = `${pu.SIP}:${r}`);
       const e = NC.parse(r);
       if (e)
         return e.user ? void 0 : e;
@@ -16116,7 +16116,7 @@ mh.load = (r, e) => {
   for (const t in Jp.optional)
     if (e.hasOwnProperty(t)) {
       const n = e[t];
-      if (Ec.isEmpty(n))
+      if (Cc.isEmpty(n))
         continue;
       const i = Jp.optional[t](n);
       if (i !== void 0)
@@ -17276,7 +17276,7 @@ function V(r, e) {
 function Fs(r, e, t = "") {
   V(xn(r, e), () => t + ` Shapes ${r} and ${e} must match`);
 }
-function Uu(r) {
+function Lu(r) {
   V(r != null, () => "The input to the tensor constructor must be a non-null value.");
 }
 function ge(r) {
@@ -17310,7 +17310,7 @@ function xn(r, e) {
       return !1;
   return !0;
 }
-function Eu(r) {
+function Cu(r) {
   return r % 1 === 0;
 }
 function M8(r) {
@@ -17335,7 +17335,7 @@ function L8(r) {
     e[t] = t;
   return zI(e), e;
 }
-function bu(r, e) {
+function vu(r, e) {
   return e <= r.length ? r : r + " ".repeat(e - r.length);
 }
 function Hv(r, e = (i) => 0, t, n) {
@@ -17382,7 +17382,7 @@ function aT(r, e) {
 }
 function On(r, e) {
   const t = e.length;
-  return r = r == null ? e.map((n, i) => i) : [].concat(r), V(r.every((n) => n >= -t && n < t), () => `All values in axis param must be in range [-${t}, ${t}) but got axis ${r}`), V(r.every((n) => Eu(n)), () => `All values in axis param must be integers but got axis ${r}`), r.map((n) => n < 0 ? t + n : n);
+  return r = r == null ? e.map((n, i) => i) : [].concat(r), V(r.every((n) => n >= -t && n < t), () => `All values in axis param must be in range [-${t}, ${t}) but got axis ${r}`), V(r.every((n) => Cu(n)), () => `All values in axis param must be integers but got axis ${r}`), r.map((n) => n < 0 ? t + n : n);
 }
 function $o(r, e) {
   const t = [], n = [], i = e != null && Array.isArray(e) && e.length === 0, s = e == null || i ? null : On(e, r).sort();
@@ -17427,7 +17427,7 @@ function XI(r) {
 function YI(r, e) {
   return !(e === "complex64" || e === "float32" && r !== "complex64" || e === "int32" && r !== "float32" && r !== "complex64" || e === "bool" && r === "bool");
 }
-function xu(r) {
+function Eu(r) {
   if (r === "float32" || r === "int32")
     return 4;
   if (r === "complex64")
@@ -17451,8 +17451,8 @@ function QI(r) {
 function ZI(r) {
   return typeof r == "number";
 }
-function Bu(r) {
-  return Array.isArray(r) ? Bu(r[0]) : r instanceof Float32Array ? "float32" : r instanceof Int32Array || r instanceof Uint8Array || r instanceof Uint8ClampedArray ? "int32" : ZI(r) ? "float32" : vo(r) ? "string" : QI(r) ? "bool" : "float32";
+function Uu(r) {
+  return Array.isArray(r) ? Uu(r[0]) : r instanceof Float32Array ? "float32" : r instanceof Int32Array || r instanceof Uint8Array || r instanceof Uint8ClampedArray ? "int32" : ZI(r) ? "float32" : vo(r) ? "string" : QI(r) ? "bool" : "float32";
 }
 function vl(r) {
   return !!(r && r.constructor && r.call && r.apply);
@@ -17486,7 +17486,7 @@ function eA(r, e, t, n = !1) {
   }
   return i;
 }
-function Tu(r, e, t = !1) {
+function bu(r, e, t = !1) {
   if (r.length === 0)
     return e[0];
   const n = r.reduce((i, s) => i * s) * (t ? 2 : 1);
@@ -17525,11 +17525,11 @@ function xo(r, e) {
 function B8(r, e) {
   const t = r.reduce((n, i) => n * i, 1);
   if (e == null || e === "float32")
-    return Tu(r, new Float32Array(t));
+    return bu(r, new Float32Array(t));
   if (e === "int32")
-    return Tu(r, new Int32Array(t));
+    return bu(r, new Int32Array(t));
   if (e === "bool")
-    return Tu(r, new Uint8Array(t));
+    return bu(r, new Uint8Array(t));
   throw new Error(`Unknown data type ${e}`);
 }
 function ti(r) {
@@ -17709,7 +17709,7 @@ function uT(r, e) {
     return t.set(r, n), t.get(r);
   }
 }
-const Bg = "Abs", Hg = "Acos", Vg = "Acosh", Jh = "Add", Qh = "AddN", Zh = "All", ef = "Any", Gg = "ArgMax", Wg = "ArgMin", zg = "Asin", jg = "Asinh", qg = "Atan", Kg = "Atanh", Xg = "Atan2", tf = "AvgPool", cT = "AvgPoolGrad", Yg = "AvgPool3D", dT = "AvgPool3DGrad", nf = "BatchMatMul", Jg = "BatchToSpaceND", sf = "Bincount", Qg = "BitwiseAnd", j8 = "BroadcastTo", Zg = "BroadcastArgs", rf = "Cast", e_ = "Ceil", af = "ClipByValue", hT = "Complex", fT = "ComplexAbs", t_ = "Concat", of = "Conv2D", pT = "Conv2DBackpropFilter", lf = "Conv2DBackpropInput", uf = "Conv3D", n_ = "Conv3DBackpropFilterV2", cf = "Conv3DBackpropInputV2", s_ = "Cos", r_ = "Cosh", df = "Cumprod", hf = "Cumsum", ff = "CropAndResize", i_ = "DenseBincount", pf = "DepthToSpace", mf = "DepthwiseConv2dNative", mT = "DepthwiseConv2dNativeBackpropFilter", gT = "DepthwiseConv2dNativeBackpropInput", a_ = "Diag", gf = "Dilation2D", _T = "Dilation2DBackpropInput", yT = "Dilation2DBackpropFilter", vT = "Draw", o_ = "RealDiv", bT = "Einsum", l_ = "Elu", u_ = "EluGrad", c_ = "Erf", d_ = "Equal", h_ = "Exp", f_ = "ExpandDims", p_ = "Expm1", TT = "FFT", m_ = "Fill", _f = "FlipLeftRight", g_ = "Floor", __ = "FloorDiv", yf = "FusedBatchNorm", y_ = "GatherV2", vf = "GatherNd", v_ = "Greater", b_ = "GreaterEqual", bf = "Identity", ST = "IFFT", wT = "Imag", T_ = "IsFinite", S_ = "IsInf", w_ = "IsNan", Tf = "LeakyRelu", C_ = "Less", E_ = "LessEqual", Sf = "LinSpace", x_ = "Log", I_ = "Log1p", A_ = "LogicalAnd", R_ = "LogicalNot", N_ = "LogicalOr", sA = "LogicalXor", q8 = "LogSoftmax", K8 = "LowerBound", wf = "LRN", k_ = "LRNGrad", X8 = "MatrixBandPart", Cf = "Max", O_ = "Maximum", Ef = "MaxPool", CT = "MaxPoolGrad", $_ = "MaxPool3D", ET = "MaxPool3DGrad", D_ = "MaxPoolWithArgmax", xf = "Mean", If = "Min", P_ = "Minimum", Af = "MirrorPad", F_ = "Mod", Rf = "Multinomial", M_ = "Multiply", L_ = "Neg", U_ = "NotEqual", Nf = "NonMaxSuppressionV3", kf = "NonMaxSuppressionV4", Of = "NonMaxSuppressionV5", B_ = "OnesLike", $f = "OneHot", H_ = "Pack", Df = "PadV2", Y8 = "Pool", V_ = "Pow", Pf = "Prelu", Ff = "Prod", xT = "RaggedGather", IT = "RaggedRange", AT = "RaggedTensorToTensor", G_ = "Range", RT = "Real", W_ = "Reciprocal", z_ = "Relu", j_ = "Reshape", Mf = "ResizeNearestNeighbor", q_ = "ResizeNearestNeighborGrad", Lf = "ResizeBilinear", K_ = "ResizeBilinearGrad", X_ = "Relu6", Uf = "Reverse", Y_ = "Round", J_ = "Rsqrt", Bf = "ScatterNd", Hf = "TensorScatterUpdate", Vf = "SearchSorted", Q_ = "Select", Z_ = "Selu", e0 = "Slice", t0 = "Sin", n0 = "Sinh", s0 = "Sign", r0 = "Sigmoid", i0 = "Softplus", a0 = "Sqrt", Gf = "Sum", o0 = "SpaceToBatchND", l0 = "SplitV", Wf = "Softmax", u0 = "SparseFillEmptyRows", zf = "SparseReshape", c0 = "SparseSegmentMean", d0 = "SparseSegmentSum", jf = "SparseToDense", h0 = "SquaredDifference", NT = "Square", kT = "StaticRegexReplace", qf = "StridedSlice", f0 = "StringNGrams", p0 = "StringSplit", m0 = "StringToHashBucketFast", g0 = "Sub", _0 = "Tan", y0 = "Tanh", ed = "Tile", Kf = "TopK", Xf = "Transform", Su = "Transpose", v0 = "Unique", b0 = "Unpack", OT = "UnsortedSegmentSum", J8 = "UpperBound", T0 = "ZerosLike", Yf = "Step", ug = "FromPixels", Jf = "RotateWithOffset", Pc = "_FusedMatMul", Fc = "FusedConv2D", Mc = "FusedDepthwiseConv2D";
+const Bg = "Abs", Hg = "Acos", Vg = "Acosh", Jh = "Add", Qh = "AddN", Zh = "All", ef = "Any", Gg = "ArgMax", Wg = "ArgMin", zg = "Asin", jg = "Asinh", qg = "Atan", Kg = "Atanh", Xg = "Atan2", tf = "AvgPool", cT = "AvgPoolGrad", Yg = "AvgPool3D", dT = "AvgPool3DGrad", nf = "BatchMatMul", Jg = "BatchToSpaceND", sf = "Bincount", Qg = "BitwiseAnd", j8 = "BroadcastTo", Zg = "BroadcastArgs", rf = "Cast", e_ = "Ceil", af = "ClipByValue", hT = "Complex", fT = "ComplexAbs", t_ = "Concat", of = "Conv2D", pT = "Conv2DBackpropFilter", lf = "Conv2DBackpropInput", uf = "Conv3D", n_ = "Conv3DBackpropFilterV2", cf = "Conv3DBackpropInputV2", s_ = "Cos", r_ = "Cosh", df = "Cumprod", hf = "Cumsum", ff = "CropAndResize", i_ = "DenseBincount", pf = "DepthToSpace", mf = "DepthwiseConv2dNative", mT = "DepthwiseConv2dNativeBackpropFilter", gT = "DepthwiseConv2dNativeBackpropInput", a_ = "Diag", gf = "Dilation2D", _T = "Dilation2DBackpropInput", yT = "Dilation2DBackpropFilter", vT = "Draw", o_ = "RealDiv", bT = "Einsum", l_ = "Elu", u_ = "EluGrad", c_ = "Erf", d_ = "Equal", h_ = "Exp", f_ = "ExpandDims", p_ = "Expm1", TT = "FFT", m_ = "Fill", _f = "FlipLeftRight", g_ = "Floor", __ = "FloorDiv", yf = "FusedBatchNorm", y_ = "GatherV2", vf = "GatherNd", v_ = "Greater", b_ = "GreaterEqual", bf = "Identity", ST = "IFFT", wT = "Imag", T_ = "IsFinite", S_ = "IsInf", w_ = "IsNan", Tf = "LeakyRelu", C_ = "Less", E_ = "LessEqual", Sf = "LinSpace", x_ = "Log", I_ = "Log1p", A_ = "LogicalAnd", R_ = "LogicalNot", N_ = "LogicalOr", sA = "LogicalXor", q8 = "LogSoftmax", K8 = "LowerBound", wf = "LRN", k_ = "LRNGrad", X8 = "MatrixBandPart", Cf = "Max", O_ = "Maximum", Ef = "MaxPool", CT = "MaxPoolGrad", $_ = "MaxPool3D", ET = "MaxPool3DGrad", D_ = "MaxPoolWithArgmax", xf = "Mean", If = "Min", P_ = "Minimum", Af = "MirrorPad", F_ = "Mod", Rf = "Multinomial", M_ = "Multiply", L_ = "Neg", U_ = "NotEqual", Nf = "NonMaxSuppressionV3", kf = "NonMaxSuppressionV4", Of = "NonMaxSuppressionV5", B_ = "OnesLike", $f = "OneHot", H_ = "Pack", Df = "PadV2", Y8 = "Pool", V_ = "Pow", Pf = "Prelu", Ff = "Prod", xT = "RaggedGather", IT = "RaggedRange", AT = "RaggedTensorToTensor", G_ = "Range", RT = "Real", W_ = "Reciprocal", z_ = "Relu", j_ = "Reshape", Mf = "ResizeNearestNeighbor", q_ = "ResizeNearestNeighborGrad", Lf = "ResizeBilinear", K_ = "ResizeBilinearGrad", X_ = "Relu6", Uf = "Reverse", Y_ = "Round", J_ = "Rsqrt", Bf = "ScatterNd", Hf = "TensorScatterUpdate", Vf = "SearchSorted", Q_ = "Select", Z_ = "Selu", e0 = "Slice", t0 = "Sin", n0 = "Sinh", s0 = "Sign", r0 = "Sigmoid", i0 = "Softplus", a0 = "Sqrt", Gf = "Sum", o0 = "SpaceToBatchND", l0 = "SplitV", Wf = "Softmax", u0 = "SparseFillEmptyRows", zf = "SparseReshape", c0 = "SparseSegmentMean", d0 = "SparseSegmentSum", jf = "SparseToDense", h0 = "SquaredDifference", NT = "Square", kT = "StaticRegexReplace", qf = "StridedSlice", f0 = "StringNGrams", p0 = "StringSplit", m0 = "StringToHashBucketFast", g0 = "Sub", _0 = "Tan", y0 = "Tanh", ed = "Tile", Kf = "TopK", Xf = "Transform", Tu = "Transpose", v0 = "Unique", b0 = "Unpack", OT = "UnsortedSegmentSum", J8 = "UpperBound", T0 = "ZerosLike", Yf = "Step", ug = "FromPixels", Jf = "RotateWithOffset", Pc = "_FusedMatMul", Fc = "FusedConv2D", Mc = "FusedDepthwiseConv2D";
 /**
  * @license
  * Copyright 2018 Google LLC. All Rights Reserved.
@@ -18116,17 +18116,17 @@ function ni(r) {
 }
 Cn.isLong = ni;
 var MC = {}, LC = {};
-function Hu(r, e) {
+function Bu(r, e) {
   var t, n, i;
   return e ? (r >>>= 0, (i = 0 <= r && r < 256) && (n = LC[r], n) ? n : (t = En(r, (r | 0) < 0 ? -1 : 0, !0), i && (LC[r] = t), t)) : (r |= 0, (i = -128 <= r && r < 128) && (n = MC[r], n) ? n : (t = En(r, r < 0 ? -1 : 0, !1), i && (MC[r] = t), t));
 }
-Cn.fromInt = Hu;
+Cn.fromInt = Bu;
 function Fi(r, e) {
   if (isNaN(r))
-    return e ? gu : Mi;
+    return e ? mu : Mi;
   if (e) {
     if (r < 0)
-      return gu;
+      return mu;
     if (r >= aA)
       return uA;
   } else {
@@ -18170,15 +18170,15 @@ function ba(r, e) {
   return typeof r == "number" ? Fi(r, e) : typeof r == "string" ? DT(r, e) : En(r.low, r.high, typeof e == "boolean" ? e : r.unsigned);
 }
 Cn.fromValue = ba;
-var UC = 65536, sM = 1 << 24, Uc = UC * UC, aA = Uc * Uc, BC = aA / 2, HC = Hu(sM), Mi = Hu(0);
+var UC = 65536, sM = 1 << 24, Uc = UC * UC, aA = Uc * Uc, BC = aA / 2, HC = Bu(sM), Mi = Bu(0);
 Cn.ZERO = Mi;
-var gu = Hu(0, !0);
-Cn.UZERO = gu;
-var xc = Hu(1);
-Cn.ONE = xc;
-var oA = Hu(1, !0);
+var mu = Bu(0, !0);
+Cn.UZERO = mu;
+var Ec = Bu(1);
+Cn.ONE = Ec;
+var oA = Bu(1, !0);
 Cn.UONE = oA;
-var Gv = Hu(-1);
+var Gv = Bu(-1);
 Cn.NEG_ONE = Gv;
 var lA = En(-1, 2147483647, !1);
 Cn.MAX_VALUE = lA;
@@ -18298,7 +18298,7 @@ Je.compare = function(e) {
 };
 Je.comp = Je.compare;
 Je.negate = function() {
-  return !this.unsigned && this.eq(Jr) ? Jr : this.not().add(xc);
+  return !this.unsigned && this.eq(Jr) ? Jr : this.not().add(Ec);
 };
 Je.neg = Je.negate;
 Je.add = function(e) {
@@ -18353,24 +18353,24 @@ Je.divide = function(e) {
     return En(t, Pi.get_high(), this.unsigned);
   }
   if (this.isZero())
-    return this.unsigned ? gu : Mi;
+    return this.unsigned ? mu : Mi;
   var n, i, s;
   if (this.unsigned) {
     if (e.unsigned || (e = e.toUnsigned()), e.gt(this))
-      return gu;
+      return mu;
     if (e.gt(this.shru(1)))
       return oA;
-    s = gu;
+    s = mu;
   } else {
     if (this.eq(Jr)) {
-      if (e.eq(xc) || e.eq(Gv))
+      if (e.eq(Ec) || e.eq(Gv))
         return Jr;
       if (e.eq(Jr))
-        return xc;
+        return Ec;
       var a = this.shr(1);
-      return n = a.div(e).shl(1), n.eq(Mi) ? e.isNegative() ? xc : Gv : (i = this.sub(e.mul(n)), s = n.add(i.div(e)), s);
+      return n = a.div(e).shl(1), n.eq(Mi) ? e.isNegative() ? Ec : Gv : (i = this.sub(e.mul(n)), s = n.add(i.div(e)), s);
     } else if (e.eq(Jr))
-      return this.unsigned ? gu : Mi;
+      return this.unsigned ? mu : Mi;
     if (this.isNegative())
       return e.isNegative() ? this.neg().div(e.neg()) : this.neg().div(e).neg();
     if (e.isNegative())
@@ -18381,7 +18381,7 @@ Je.divide = function(e) {
     n = Math.max(1, Math.floor(i.toNumber() / e.toNumber()));
     for (var o = Math.ceil(Math.log(n) / Math.LN2), u = o <= 48 ? 1 : dg(2, o - 48), c = Fi(n), d = c.mul(e); d.isNegative() || d.gt(i); )
       n -= u, c = Fi(n, this.unsigned), d = c.mul(e);
-    c.isZero() && (c = xc), s = s.add(c), i = i.sub(d);
+    c.isZero() && (c = Ec), s = s.add(c), i = i.sub(d);
   }
   return s;
 };
@@ -18597,7 +18597,7 @@ function fA(r, e = r.length) {
  * limitations under the License.
  * =============================================================================
  */
-function Vu(r, e) {
+function Hu(r, e) {
   return e === "string" ? To(r) : Zf([r], e);
 }
 function uM(r, e) {
@@ -18629,7 +18629,7 @@ function pA(r, e) {
 function To(r, e = "utf-8") {
   return e = e || "utf-8", de().platform.encode(r, e);
 }
-function Iu(r, e = "utf-8") {
+function xu(r, e = "utf-8") {
   return e = e || "utf-8", de().platform.decode(r, e);
 }
 function Ts(r) {
@@ -18656,17 +18656,17 @@ const cM = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
   arraysEqualWithNull: qI,
   assert: V,
   assertNonNegativeIntegerDimensions: ti,
-  assertNonNull: Uu,
+  assertNonNull: Lu,
   assertShapesMatch: Fs,
   bytesFromStringArray: JI,
-  bytesPerElement: xu,
+  bytesPerElement: Eu,
   checkConversionForErrors: KI,
   clamp: gh,
   computeStrides: an,
   convertBackendValuesAndArrayBuffer: U8,
-  createScalarValue: Vu,
+  createScalarValue: Hu,
   createShuffledIndices: L8,
-  decodeString: Iu,
+  decodeString: xu,
   distSquared: P8,
   encodeString: To,
   fetch: pA,
@@ -18677,11 +18677,11 @@ const cM = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
   hasEncodingLoss: YI,
   hexToLong: Qf,
   indexToLoc: Ug,
-  inferDtype: Bu,
+  inferDtype: Uu,
   inferFromImplicitShape: aT,
   isBoolean: QI,
   isFunction: vl,
-  isInt: Eu,
+  isInt: Cu,
   isNumber: ZI,
   isPromise: bl,
   isScalarShape: F8,
@@ -18698,7 +18698,7 @@ const cM = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
   parseAxisParam: On,
   randUniform: D8,
   repeatedTry: Hv,
-  rightPad: bu,
+  rightPad: vu,
   shuffle: zI,
   shuffleCombo: $8,
   sizeFromShape: ge,
@@ -18707,7 +18707,7 @@ const cM = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
   sum: jI,
   swap: _o,
   tanh: M8,
-  toNestedArray: Tu,
+  toNestedArray: bu,
   toTypedArray: Zf
 }, Symbol.toStringTag, { value: "Module" }));
 /**
@@ -18781,7 +18781,7 @@ function hM(r, e, t) {
 }
 let fM = class {
   logKernelProfile(e, t, n, i, s, a) {
-    const o = typeof i == "number" ? bu(`${i}ms`, 9) : i.error, u = bu(e, 25), c = t.rank, d = t.size, p = bu(t.shape.toString(), 14);
+    const o = typeof i == "number" ? vu(`${i}ms`, 9) : i.error, u = vu(e, 25), c = t.rank, d = t.size, p = vu(t.shape.toString(), 14);
     let m = "";
     for (const _ in s) {
       const y = s[_];
@@ -18916,7 +18916,7 @@ function _M(r, e, t, n) {
 }
 function eh(r, e, t) {
   let n;
-  return Array.isArray(r) ? n = `${parseFloat(r[0].toFixed(H1))} + ${parseFloat(r[1].toFixed(H1))}j` : vo(r) ? n = `'${r}'` : t === "bool" ? n = mA(r) : n = parseFloat(r.toFixed(H1)).toString(), bu(n, e);
+  return Array.isArray(r) ? n = `${parseFloat(r[0].toFixed(H1))} + ${parseFloat(r[1].toFixed(H1))}j` : vo(r) ? n = `'${r}'` : t === "bool" ? n = mA(r) : n = parseFloat(r.toFixed(H1)).toString(), vu(n, e);
 }
 function mA(r) {
   return r === 0 ? "false" : "true";
@@ -19015,7 +19015,7 @@ function th(r) {
  * limitations under the License.
  * =============================================================================
  */
-class Au {
+class Iu {
   constructor(e, t, n) {
     if (this.dtype = t, this.shape = e.slice(), this.size = ge(e), n != null) {
       const i = n.length;
@@ -19092,12 +19092,12 @@ class Au {
     return ca().makeTensor(this.values, this.shape, this.dtype);
   }
 }
-let ca = null, Sc = null;
+let ca = null, Tc = null;
 function yM(r) {
   ca = r;
 }
 function vM(r) {
-  Sc = r;
+  Tc = r;
 }
 class nn {
   constructor(e, t, n, i) {
@@ -19113,14 +19113,14 @@ class nn {
    */
   async buffer() {
     const e = await this.data();
-    return Sc.buffer(this.shape, this.dtype, e);
+    return Tc.buffer(this.shape, this.dtype, e);
   }
   /**
    * Returns a `tf.TensorBuffer` that holds the underlying data.
    * @doc {heading: 'Tensors', subheading: 'Classes'}
    */
   bufferSync() {
-    return Sc.buffer(this.shape, this.dtype, this.dataSync());
+    return Tc.buffer(this.shape, this.dtype, this.dataSync());
   }
   /**
    * Returns the tensor data as a nested array. The transfer of data is done
@@ -19130,7 +19130,7 @@ class nn {
    */
   async array() {
     const e = await this.data();
-    return Tu(this.shape, e, this.dtype === "complex64");
+    return bu(this.shape, e, this.dtype === "complex64");
   }
   /**
    * Returns the tensor data as a nested array. The transfer of data is done
@@ -19139,7 +19139,7 @@ class nn {
    * @doc {heading: 'Tensors', subheading: 'Classes'}
    */
   arraySync() {
-    return Tu(this.shape, this.dataSync(), this.dtype === "complex64");
+    return bu(this.shape, this.dataSync(), this.dtype === "complex64");
   }
   /**
    * Asynchronously downloads the values from the `tf.Tensor`. Returns a
@@ -19153,7 +19153,7 @@ class nn {
     if (this.dtype === "string") {
       const t = await e;
       try {
-        return t.map((n) => Iu(n));
+        return t.map((n) => xu(n));
       } catch {
         throw new Error("Failed to decode the string bytes into utf-8. To get the original bytes, call tensor.bytes().");
       }
@@ -19208,7 +19208,7 @@ class nn {
     const e = ca().readSync(this.dataId);
     if (this.dtype === "string")
       try {
-        return e.map((t) => Iu(t));
+        return e.map((t) => xu(t));
       } catch {
         throw new Error("Failed to decode the string bytes into utf-8. To get the original bytes, call tensor.bytes().");
       }
@@ -19244,14 +19244,14 @@ class nn {
    * @doc {heading: 'Tensors', subheading: 'Classes'}
    */
   print(e = !1) {
-    return Sc.print(this, e);
+    return Tc.print(this, e);
   }
   /**
    * Returns a copy of the tensor. See `tf.clone` for details.
    * @doc {heading: 'Tensors', subheading: 'Classes'}
    */
   clone() {
-    return this.throwIfDisposed(), Sc.clone(this);
+    return this.throwIfDisposed(), Tc.clone(this);
   }
   /**
    * Returns a human-readable description of the tensor. Useful for logging.
@@ -19263,7 +19263,7 @@ class nn {
     return gM(t, this.shape, this.dtype, e);
   }
   cast(e) {
-    return this.throwIfDisposed(), Sc.cast(this, e);
+    return this.throwIfDisposed(), Tc.cast(this, e);
   }
   variable(e = !0, t, n) {
     return this.throwIfDisposed(), ca().makeVariable(this, e, t, n);
@@ -19791,7 +19791,7 @@ class Bc {
   trackTensor(e, t) {
     this.state.numTensors++, e.dtype === "string" && this.state.numStringTensors++;
     let n = 0;
-    e.dtype !== "complex64" && e.dtype !== "string" && (n = e.size * xu(e.dtype)), this.state.numBytes += n, this.state.tensorInfo.has(e.dataId) || (this.state.numDataBuffers++, this.state.tensorInfo.set(e.dataId, {
+    e.dtype !== "complex64" && e.dtype !== "string" && (n = e.size * Eu(e.dtype)), this.state.numBytes += n, this.state.tensorInfo.has(e.dataId) || (this.state.numDataBuffers++, this.state.tensorInfo.set(e.dataId, {
       backend: t || this.backend,
       dtype: e.dtype,
       shape: e.shape,
@@ -19814,7 +19814,7 @@ class Bc {
       return;
     const t = this.state.tensorInfo.get(e.dataId);
     if (this.state.numTensors--, e.dtype === "string" && (this.state.numStringTensors--, this.state.numBytes -= t.bytes), e.dtype !== "complex64" && e.dtype !== "string") {
-      const n = e.size * xu(e.dtype);
+      const n = e.size * Eu(e.dtype);
       this.state.numBytes -= n;
     }
     t.backend.disposeData(e.dataId) && this.removeDataId(e.dataId, t.backend);
@@ -20104,7 +20104,7 @@ function Ba(r, e) {
     const i = r.channels || "RGBA";
     return [r.height, r.width * i.length];
   } else if (yA(r))
-    return [r.buffer.size / (e == null ? 4 : xu(e))];
+    return [r.buffer.size / (e == null ? 4 : Eu(e))];
   if (!Array.isArray(r))
     return [];
   const n = [];
@@ -20133,7 +20133,7 @@ function zC(r, e, t, n) {
 function H(r, e, t, n = "numeric") {
   if (r instanceof gA())
     return zC(n, r.dtype, e, t), r;
-  let i = Bu(r);
+  let i = Uu(r);
   if (i !== "string" && ["bool", "int32", "float32"].indexOf(n) >= 0 && (i = n), zC(n, i, e, t), r == null || !Ts(r) && !Array.isArray(r) && typeof r != "number" && typeof r != "boolean" && typeof r != "string") {
     const u = r == null ? "null" : r.constructor.name;
     throw new Error(`Argument '${e}' passed to '${t}' must be a Tensor or TensorLike, but got '${u}'`);
@@ -20224,7 +20224,7 @@ const Io = /* @__PURE__ */ Z({ complex_: RM });
  */
 function kl(r, e, t, n) {
   if (n == null)
-    n = Bu(r);
+    n = Uu(r);
   else if (n === "complex64")
     throw new Error("Cannot construct a complex64 tensor directly. Please use tf.complex(real, imag).");
   if (yA(r) || _A(r)) {
@@ -20281,7 +20281,7 @@ function fi(r, e, t) {
  * limitations under the License.
  * =============================================================================
  */
-const Ru = {
+const Au = {
   float32: 4,
   float16: 2,
   int32: 4,
@@ -20493,14 +20493,14 @@ function jM(r, e) {
   let n;
   if ("quantization" in r) {
     const i = r.quantization;
-    n = Ru[i.dtype];
+    n = Au[i.dtype];
   } else if (r.dtype === "string") {
     let i = 0;
     for (let s = 0; s < t; s++)
       i += Tl + new Uint32Array(e(i, i + Tl))[0];
     return i;
   } else
-    n = Ru[r.dtype];
+    n = Au[r.dtype];
   return t * n;
 }
 async function qM(r, e) {
@@ -20508,14 +20508,14 @@ async function qM(r, e) {
   let n;
   if ("quantization" in r) {
     const i = r.quantization;
-    n = Ru[i.dtype];
+    n = Au[i.dtype];
   } else if (r.dtype === "string") {
     let i = 0;
     for (let s = 0; s < t; s++)
       i += Tl + new Uint32Array(await e(i, i + Tl))[0];
     return i;
   } else
-    n = Ru[r.dtype];
+    n = Au[r.dtype];
   return t * n;
 }
 function CA(r, e) {
@@ -20531,7 +20531,7 @@ function CA(r, e) {
         throw new Error(`Weight ${r.name} is quantized with ${u.dtype} which only supports weights of type float32 not ${n}.`);
     } else
       throw new Error(`Weight ${r.name} has unknown quantization dtype ${u.dtype}. Supported quantization dtypes are: 'uint8', 'uint16', and 'float16'.`);
-    const c = Ru[u.dtype], d = u.dtype === "uint8" ? new Uint8Array(e) : new Uint16Array(e);
+    const c = Au[u.dtype], d = u.dtype === "uint8" ? new Uint8Array(e) : new Uint16Array(e);
     if (n === "float32")
       if (u.dtype === "uint8" || u.dtype === "uint16") {
         a = new Float32Array(d.length);
@@ -20564,7 +20564,7 @@ function CA(r, e) {
       a.push(p), o += d;
     }
   } else {
-    const u = Ru[n];
+    const u = Au[n];
     if (n === "float32")
       a = new Float32Array(e);
     else if (n === "int32")
@@ -20836,7 +20836,7 @@ const nL = (r) => Fn.registerSaveRouter(r), sL = (r) => Fn.registerLoadRouter(r)
  * limitations under the License.
  * =============================================================================
  */
-const Qv = "tensorflowjs", Zv = 1, _u = "models_store", hl = "model_info_store";
+const Qv = "tensorflowjs", Zv = 1, gu = "models_store", hl = "model_info_store";
 function AA() {
   if (!de().getBool("IS_BROWSER"))
     throw new Error("Failed to obtain IndexedDB factory because the current environmentis not a web browser.");
@@ -20847,9 +20847,9 @@ function AA() {
 }
 function eb(r) {
   const e = r.result;
-  e.createObjectStore(_u, { keyPath: "modelPath" }), e.createObjectStore(hl, { keyPath: "modelPath" });
+  e.createObjectStore(gu, { keyPath: "modelPath" }), e.createObjectStore(hl, { keyPath: "modelPath" });
 }
-class Nu {
+class Ru {
   constructor(e) {
     if (this.indexedDB = AA(), e == null || !e)
       throw new Error("For IndexedDB, modelPath must not be null, undefined or empty.");
@@ -20883,7 +20883,7 @@ class Nu {
       s.onupgradeneeded = () => eb(s), s.onsuccess = () => {
         const a = s.result;
         if (t == null) {
-          const o = a.transaction(_u, "readonly"), c = o.objectStore(_u).get(this.modelPath);
+          const o = a.transaction(gu, "readonly"), c = o.objectStore(gu).get(this.modelPath);
           c.onsuccess = () => {
             if (c.result == null)
               return a.close(), i(new Error(`Cannot find model with path '${this.modelPath}' in IndexedDB.`));
@@ -20900,8 +20900,8 @@ class Nu {
           }
           let p;
           d.onsuccess = () => {
-            p = a.transaction(_u, "readwrite");
-            const m = p.objectStore(_u);
+            p = a.transaction(gu, "readwrite");
+            const m = p.objectStore(gu);
             let _;
             try {
               _ = m.put({
@@ -20925,15 +20925,15 @@ class Nu {
     });
   }
 }
-Nu.URL_SCHEME = "indexeddb://";
-const RA = (r) => de().getBool("IS_BROWSER") && !Array.isArray(r) && r.startsWith(Nu.URL_SCHEME) ? aL(r.slice(Nu.URL_SCHEME.length)) : null;
+Ru.URL_SCHEME = "indexeddb://";
+const RA = (r) => de().getBool("IS_BROWSER") && !Array.isArray(r) && r.startsWith(Ru.URL_SCHEME) ? aL(r.slice(Ru.URL_SCHEME.length)) : null;
 Fn.registerSaveRouter(RA);
 Fn.registerLoadRouter(RA);
 function aL(r) {
-  return new Nu(r);
+  return new Ru(r);
 }
 function oL(r) {
-  return r.startsWith(Nu.URL_SCHEME) ? r.slice(Nu.URL_SCHEME.length) : r;
+  return r.startsWith(Ru.URL_SCHEME) ? r.slice(Ru.URL_SCHEME.length) : r;
 }
 class lL {
   constructor() {
@@ -20964,8 +20964,8 @@ class lL {
             return s.close(), n(new Error(`Cannot find model with path '${e}' in IndexedDB.`));
           {
             const d = o.delete(e), p = () => {
-              c = s.transaction(_u, "readwrite");
-              const _ = c.objectStore(_u).delete(e);
+              c = s.transaction(gu, "readwrite");
+              const _ = c.objectStore(gu).delete(e);
               _.onsuccess = () => t(u.result.modelArtifactsInfo), _.onerror = (y) => n(u.error);
             };
             d.onsuccess = p, d.onerror = (m) => (p(), s.close(), n(u.error));
@@ -20993,14 +20993,14 @@ class lL {
  * limitations under the License.
  * =============================================================================
  */
-const yo = "/", wc = "tensorflowjs_models", NA = "info", uL = "model_topology", cL = "weight_specs", dL = "weight_data", hL = "model_metadata";
+const yo = "/", Sc = "tensorflowjs_models", NA = "info", uL = "model_topology", cL = "weight_specs", dL = "weight_data", hL = "model_metadata";
 function kA(r) {
   return {
-    info: [wc, r, NA].join(yo),
-    topology: [wc, r, uL].join(yo),
-    weightSpecs: [wc, r, cL].join(yo),
-    weightData: [wc, r, dL].join(yo),
-    modelMetadata: [wc, r, hL].join(yo)
+    info: [Sc, r, NA].join(yo),
+    topology: [Sc, r, uL].join(yo),
+    weightSpecs: [Sc, r, cL].join(yo),
+    weightData: [Sc, r, dL].join(yo),
+    modelMetadata: [Sc, r, hL].join(yo)
   };
 }
 function OA(r) {
@@ -21014,9 +21014,9 @@ function fL(r) {
   return e.slice(1, e.length - 1).join(yo);
 }
 function pL(r) {
-  return r.startsWith(ku.URL_SCHEME) ? r.slice(ku.URL_SCHEME.length) : r;
+  return r.startsWith(Nu.URL_SCHEME) ? r.slice(Nu.URL_SCHEME.length) : r;
 }
-class ku {
+class Nu {
   constructor(e) {
     if (!de().getBool("IS_BROWSER") || typeof window > "u" || typeof window.localStorage > "u")
       throw new Error("The current environment does not support local storage.");
@@ -21089,19 +21089,19 @@ class ku {
     return t.weightData = YM(a), t;
   }
 }
-ku.URL_SCHEME = "localstorage://";
-const $A = (r) => de().getBool("IS_BROWSER") && !Array.isArray(r) && r.startsWith(ku.URL_SCHEME) ? mL(r.slice(ku.URL_SCHEME.length)) : null;
+Nu.URL_SCHEME = "localstorage://";
+const $A = (r) => de().getBool("IS_BROWSER") && !Array.isArray(r) && r.startsWith(Nu.URL_SCHEME) ? mL(r.slice(Nu.URL_SCHEME.length)) : null;
 Fn.registerSaveRouter($A);
 Fn.registerLoadRouter($A);
 function mL(r) {
-  return new ku(r);
+  return new Nu(r);
 }
 class gL {
   constructor() {
     V(de().getBool("IS_BROWSER"), () => "Current environment is not a web browser"), V(typeof window > "u" || typeof window.localStorage < "u", () => "Current browser does not appear to support localStorage"), this.LS = window.localStorage;
   }
   async listModels() {
-    const e = {}, t = wc + yo, n = yo + NA;
+    const e = {}, t = Sc + yo, n = yo + NA;
     for (let i = 0; i < this.LS.length; ++i) {
       const s = this.LS.key(i);
       if (s.startsWith(t) && s.endsWith(n)) {
@@ -21265,11 +21265,11 @@ class TL {
 if (de().get("IS_BROWSER")) {
   de().setPlatform("browser", new TL());
   try {
-    pr.registerManager(ku.URL_SCHEME, new gL());
+    pr.registerManager(Nu.URL_SCHEME, new gL());
   } catch {
   }
   try {
-    pr.registerManager(Nu.URL_SCHEME, new lL());
+    pr.registerManager(Ru.URL_SCHEME, new lL());
   } catch {
   }
 }
@@ -21335,7 +21335,7 @@ de().get("IS_NODE") && !de().get("IS_BROWSER") && de().setPlatform("node", new w
  * =============================================================================
  */
 function kn(r, e = "float32", t) {
-  return e = e || "float32", ti(r), new Au(r, e, t);
+  return e = e || "float32", ti(r), new Iu(r, e, t);
 }
 /**
  * @license
@@ -22011,7 +22011,7 @@ function wh(r) {
 function Mr(r, e) {
   return wh(r) || wh(e);
 }
-function Ou(r) {
+function ku(r) {
   return Th(r).every((e) => e > 0);
 }
 function $l(r) {
@@ -22026,11 +22026,11 @@ function Vi(r, e, t) {
     if (typeof e == "string")
       throw Error(`Error in ${r}: pad must be an integer when using dimRoundingMode ${t} but got pad ${e}.`);
     if (typeof e == "number")
-      V(Eu(e), () => `Error in ${r}: pad must be an integer when using dimRoundingMode ${t} but got pad ${e}.`);
+      V(Cu(e), () => `Error in ${r}: pad must be an integer when using dimRoundingMode ${t} but got pad ${e}.`);
     else if (typeof e == "object")
       e.forEach((n) => {
         n.forEach((i) => {
-          V(Eu(i), () => `Error in ${r}: pad must be an integer when using dimRoundingMode ${t} but got pad ${i}.`);
+          V(Cu(i), () => `Error in ${r}: pad must be an integer when using dimRoundingMode ${t} but got pad ${i}.`);
         });
       });
     else
@@ -22484,7 +22484,7 @@ const ZA = /* @__PURE__ */ Z({ ceil_: fU });
  * =============================================================================
  */
 function td(r, e, t) {
-  ti(r), t = t || Bu(e);
+  ti(r), t = t || Uu(e);
   const n = { shape: r, value: e, dtype: t };
   return ee.runKernel(m_, {}, n);
 }
@@ -22553,7 +22553,7 @@ function vU(r, e, t, n, i = "NHWC", s = [1, 1], a) {
   let c = o, d = !1;
   o.rank === 3 && (d = !0, c = Se(o, [1, o.shape[0], o.shape[1], o.shape[2]])), V(c.rank === 4, () => `Error in conv2d: input must be rank 4, but got rank ${c.rank}.`), V(u.rank === 4, () => `Error in conv2d: filter must be rank 4, but got rank ${u.rank}.`), Vi("conv2d", n, a);
   const p = i === "NHWC" ? c.shape[3] : c.shape[1];
-  V(p === u.shape[2], () => `Error in conv2d: depth of input (${p}) must match input depth for filter ${u.shape[2]}.`), V(Mr(t, s), () => `Error in conv2D: Either strides or dilations must be 1. Got strides ${t} and dilations '${s}'`), V(Ou(s), () => "Error in conv2D: Dilated rates should be larger than 0."), V(Ou(t), () => "Error in conv2D: Strides should be larger than 0.");
+  V(p === u.shape[2], () => `Error in conv2d: depth of input (${p}) must match input depth for filter ${u.shape[2]}.`), V(Mr(t, s), () => `Error in conv2D: Either strides or dilations must be 1. Got strides ${t} and dilations '${s}'`), V(ku(s), () => "Error in conv2D: Dilated rates should be larger than 0."), V(ku(t), () => "Error in conv2D: Strides should be larger than 0.");
   const m = { x: c, filter: u }, _ = { strides: t, pad: n, dataFormat: i, dilations: s, dimRoundingMode: a }, y = ee.runKernel(of, m, _);
   return d ? Se(y, [y.shape[1], y.shape[2], y.shape[3]]) : y;
 }
@@ -22561,7 +22561,7 @@ const sp = /* @__PURE__ */ Z({ conv2d_: vU });
 function bU(r, e, t, n, i = "NWC", s = 1, a) {
   const o = H(r, "x", "conv1d"), u = H(e, "filter", "conv1d");
   let c = o, d = !1;
-  o.rank === 2 && (d = !0, c = Se(o, [1, o.shape[0], o.shape[1]])), V(c.rank === 3, () => `Error in conv1d: input must be rank 3, but got rank ${c.rank}.`), V(u.rank === 3, () => `Error in conv1d: filter must be rank 3, but got rank ${u.rank}.`), Vi("conv1d", n, a), V(c.shape[2] === u.shape[1], () => `Error in conv1d: depth of input (${c.shape[2]}) must match input depth for filter ${u.shape[1]}.`), V(Mr(t, s), () => `Error in conv1D: Either stride or dilation must be 1. Got stride ${t} and dilation '${s}'`), V(Ou(s), () => "Error in conv1D: Dilated rates should be larger than 0."), V(Ou(t), () => "Error in conv1D: Stride should be larger than 0."), V(i === "NWC", () => `Error in conv1d: got dataFormat of ${i} but only NWC is currently supported.`);
+  o.rank === 2 && (d = !0, c = Se(o, [1, o.shape[0], o.shape[1]])), V(c.rank === 3, () => `Error in conv1d: input must be rank 3, but got rank ${c.rank}.`), V(u.rank === 3, () => `Error in conv1d: filter must be rank 3, but got rank ${u.rank}.`), Vi("conv1d", n, a), V(c.shape[2] === u.shape[1], () => `Error in conv1d: depth of input (${c.shape[2]}) must match input depth for filter ${u.shape[1]}.`), V(Mr(t, s), () => `Error in conv1D: Either stride or dilation must be 1. Got stride ${t} and dilation '${s}'`), V(ku(s), () => "Error in conv1D: Dilated rates should be larger than 0."), V(ku(t), () => "Error in conv1D: Stride should be larger than 0."), V(i === "NWC", () => `Error in conv1d: got dataFormat of ${i} but only NWC is currently supported.`);
   const p = Se(u, [1, u.shape[0], u.shape[1], u.shape[2]]), m = Se(c, [c.shape[0], 1, c.shape[1], c.shape[2]]), T = sp(m, p, [1, t], n, "NHWC", [1, s], a);
   return d ? Se(T, [T.shape[2], T.shape[3]]) : Se(T, [T.shape[0], T.shape[2], T.shape[3]]);
 }
@@ -22616,7 +22616,7 @@ const oR = /* @__PURE__ */ Z({ conv2dTranspose_: SU });
 function wU(r, e, t, n, i = "NDHWC", s = [1, 1, 1]) {
   const a = H(r, "x", "conv3d"), o = H(e, "filter", "conv3d");
   let u = a, c = !1;
-  a.rank === 4 && (c = !0, u = Se(a, [1, a.shape[0], a.shape[1], a.shape[2], a.shape[3]])), V(u.rank === 5, () => `Error in conv3d: input must be rank 5, but got rank ${u.rank}.`), V(o.rank === 5, () => `Error in conv3d: filter must be rank 5, but got rank ${o.rank}.`), V(u.shape[4] === o.shape[3], () => `Error in conv3d: depth of input (${u.shape[4]}) must match input depth for filter ${o.shape[3]}.`), V(Mr(t, s), () => `Error in conv3D: Either strides or dilations must be 1. Got strides ${t} and dilations '${s}'`), V(i === "NDHWC", () => `Error in conv3d: got dataFormat of ${i} but only NDHWC is currently supported.`), V(Ou(s), () => "Error in conv3D: Dilated rates should be larger than 0."), V(Ou(t), () => "Error in conv3D: Strides should be larger than 0.");
+  a.rank === 4 && (c = !0, u = Se(a, [1, a.shape[0], a.shape[1], a.shape[2], a.shape[3]])), V(u.rank === 5, () => `Error in conv3d: input must be rank 5, but got rank ${u.rank}.`), V(o.rank === 5, () => `Error in conv3d: filter must be rank 5, but got rank ${o.rank}.`), V(u.shape[4] === o.shape[3], () => `Error in conv3d: depth of input (${u.shape[4]}) must match input depth for filter ${o.shape[3]}.`), V(Mr(t, s), () => `Error in conv3D: Either strides or dilations must be 1. Got strides ${t} and dilations '${s}'`), V(i === "NDHWC", () => `Error in conv3d: got dataFormat of ${i} but only NDHWC is currently supported.`), V(ku(s), () => "Error in conv3D: Dilated rates should be larger than 0."), V(ku(t), () => "Error in conv3D: Strides should be larger than 0.");
   const d = { x: u, filter: o }, p = { strides: t, pad: n, dataFormat: i, dilations: s }, m = ee.runKernel(uf, d, p);
   return c ? Se(m, [m.shape[1], m.shape[2], m.shape[3], m.shape[4]]) : m;
 }
@@ -23209,7 +23209,7 @@ function jU(r, e = null, t = !1) {
   const i = { x: H(r, "x", "max") }, s = { reductionIndices: e, keepDims: t };
   return ee.runKernel(Cf, i, s);
 }
-const wu = /* @__PURE__ */ Z({ max_: jU });
+const Su = /* @__PURE__ */ Z({ max_: jU });
 /**
  * @license
  * Copyright 2020 Google Inc. All Rights Reserved.
@@ -23377,7 +23377,7 @@ function wR(r, e, t = null) {
     if (e === 1)
       return gn(Xr(r), t);
     if (e === 1 / 0)
-      return wu(Xr(r), t);
+      return Su(Xr(r), t);
     if (e === -1 / 0)
       return fg(Xr(r), t);
     if (e === "euclidean" || e === 2)
@@ -23386,9 +23386,9 @@ function wR(r, e, t = null) {
   }
   if (Array.isArray(t) && t.length === 2) {
     if (e === 1)
-      return wu(gn(Xr(r), t[0]), t[1] - 1);
+      return Su(gn(Xr(r), t[0]), t[1] - 1);
     if (e === 1 / 0)
-      return wu(gn(Xr(r), t[1]), t[0]);
+      return Su(gn(Xr(r), t[1]), t[0]);
     if (e === -1 / 0)
       return fg(gn(Xr(r), t[1]), t[0]);
     if (e === "fro" || e === "euclidean")
@@ -23825,7 +23825,7 @@ function RR(r, e, t) {
 function g9(r, e = 5, t = 1, n = 1, i = 0.5) {
   const s = H(r, "x", "localResponseNormalization");
   V(s.rank === 4 || s.rank === 3, () => `Error in localResponseNormalization: x must be rank 3 or 4 but got
-               rank ${s.rank}.`), V(Eu(e), () => `Error in localResponseNormalization: depthRadius must be an integer but got depthRadius ${e}.`);
+               rank ${s.rank}.`), V(Cu(e), () => `Error in localResponseNormalization: depthRadius must be an integer but got depthRadius ${e}.`);
   let a = s, o = !1;
   s.rank === 3 && (o = !0, a = Se(s, [1, s.shape[0], s.shape[1], s.shape[2]]));
   const u = { x: a }, c = { depthRadius: e, bias: t, alpha: n, beta: i }, d = ee.runKernel(wf, u, c);
@@ -24055,7 +24055,7 @@ function I9(r, e = -1) {
   if (e === -1 && (e = t.rank - 1), e !== t.rank - 1)
     throw Error(`Log Softmax along a non-last dimension is not yet supported. Logits was rank ${t.rank} and axis was ${e}`);
   return Va((i, s) => {
-    const o = wu(i, e, !0), u = Rt(i, o), c = Rt(Qt(u, "float32"), Vc(gn(Sl(u), e, !0)));
+    const o = Su(i, e, !0), u = Rt(i, o), c = Rt(Qt(u, "float32"), Vc(gn(Sl(u), e, !0)));
     return s([c]), { value: c, gradFunc: (p, m) => {
       const [_] = m, y = !0, b = Sl(_);
       return Rt(p, Ye(gn(p, e, y), b));
@@ -24080,7 +24080,7 @@ const $R = /* @__PURE__ */ Z({ logSoftmax_: I9 });
  * =============================================================================
  */
 function A9(r, e = null, t = !1) {
-  const n = H(r, "x", "logSumExp"), i = On(e, n.shape), s = wu(
+  const n = H(r, "x", "logSumExp"), i = On(e, n.shape), s = Su(
     n,
     i,
     !0
@@ -24667,21 +24667,21 @@ function X9(r, e, t = 0) {
   const i = { paddings: e, constantValue: t }, s = { x: n };
   return ee.runKernel(Df, s, i);
 }
-const Gu = /* @__PURE__ */ Z({ pad_: X9 });
+const Vu = /* @__PURE__ */ Z({ pad_: X9 });
 function Y9(r, e, t = 0) {
-  return V(e.length === 2, () => "Invalid number of paddings. Must be length of 2."), Gu(r, [e], t);
+  return V(e.length === 2, () => "Invalid number of paddings. Must be length of 2."), Vu(r, [e], t);
 }
 const zR = /* @__PURE__ */ Z({ pad1d_: Y9 });
 function J9(r, e, t = 0) {
-  return V(e.length === 2 && e[0].length === 2 && e[1].length === 2, () => "Invalid number of paddings. Must be length of 2 each."), Gu(r, e, t);
+  return V(e.length === 2 && e[0].length === 2 && e[1].length === 2, () => "Invalid number of paddings. Must be length of 2 each."), Vu(r, e, t);
 }
 const jR = /* @__PURE__ */ Z({ pad2d_: J9 });
 function Q9(r, e, t = 0) {
-  return V(e.length === 3 && e[0].length === 2 && e[1].length === 2 && e[2].length === 2, () => "Invalid number of paddings. Must be length of 2 each."), Gu(r, e, t);
+  return V(e.length === 3 && e[0].length === 2 && e[1].length === 2 && e[2].length === 2, () => "Invalid number of paddings. Must be length of 2 each."), Vu(r, e, t);
 }
 const pS = /* @__PURE__ */ Z({ pad3d_: Q9 });
 function Z9(r, e, t = 0) {
-  return V(e.length === 4 && e[0].length === 2 && e[1].length === 2 && e[2].length === 2 && e[3].length === 2, () => "Invalid number of paddings. Must be length of 2 each."), Gu(r, e, t);
+  return V(e.length === 4 && e[0].length === 2 && e[1].length === 2 && e[2].length === 2 && e[3].length === 2, () => "Invalid number of paddings. Must be length of 2 each."), Vu(r, e, t);
 }
 const qR = /* @__PURE__ */ Z({ pad4d_: Z9 });
 /**
@@ -25268,14 +25268,14 @@ const g7 = {}, _7 = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineP
     // math: package containing random, pow, and seedrandom
   );
 })(eN);
-var y7 = eN.exports, v7 = c7, b7 = d7, T7 = h7, S7 = f7, w7 = p7, C7 = m7, Wu = y7;
-Wu.alea = v7;
-Wu.xor128 = b7;
-Wu.xorwow = T7;
-Wu.xorshift7 = S7;
-Wu.xor4096 = w7;
-Wu.tychei = C7;
-var wS = Wu;
+var y7 = eN.exports, v7 = c7, b7 = d7, T7 = h7, S7 = f7, w7 = p7, C7 = m7, Gu = y7;
+Gu.alea = v7;
+Gu.xor128 = b7;
+Gu.xorwow = T7;
+Gu.xorshift7 = S7;
+Gu.xor4096 = w7;
+Gu.tychei = C7;
+var wS = Gu;
 /**
  * @license
  * Copyright 2017 Google LLC. All Rights Reserved.
@@ -25894,7 +25894,7 @@ async function tB(r, e) {
   let o = 0;
   for (let d = 0; d < i.length; d++)
     a.has(i[d]) || o++;
-  const u = new Au([o], t.dtype), c = new Au([o], "int32");
+  const u = new Iu([o], t.dtype), c = new Iu([o], "int32");
   for (let d = 0, p = 0; d < i.length; d++)
     a.has(i[d]) || (u.values[p] = i[d], c.values[p] = d, p++);
   return [u.toTensor(), c.toTensor()];
@@ -26358,7 +26358,7 @@ const CN = /* @__PURE__ */ Z({ tan_: bB });
  * =============================================================================
  */
 function di(r, e) {
-  Uu(r);
+  Lu(r);
   const t = Ba(r, e);
   if (t.length !== 1)
     throw new Error("tensor1d() requires values to be a flat/TypedArray");
@@ -26380,8 +26380,8 @@ function di(r, e) {
  * limitations under the License.
  * =============================================================================
  */
-function Cu(r, e, t) {
-  if (Uu(r), e != null && e.length !== 2)
+function wu(r, e, t) {
+  if (Lu(r), e != null && e.length !== 2)
     throw new Error("tensor2d() requires shape to have two numbers");
   const n = Ba(r, t);
   if (n.length !== 2 && n.length !== 1)
@@ -26407,7 +26407,7 @@ function Cu(r, e, t) {
  * =============================================================================
  */
 function $S(r, e, t) {
-  if (Uu(r), e != null && e.length !== 3)
+  if (Lu(r), e != null && e.length !== 3)
     throw new Error("tensor3d() requires shape to have three numbers");
   const n = Ba(r, t);
   if (n.length !== 3 && n.length !== 1)
@@ -26433,7 +26433,7 @@ function $S(r, e, t) {
  * =============================================================================
  */
 function EN(r, e, t) {
-  if (Uu(r), e != null && e.length !== 4)
+  if (Lu(r), e != null && e.length !== 4)
     throw new Error("tensor4d() requires shape to have four numbers");
   const n = Ba(r, t);
   if (n.length !== 4 && n.length !== 1)
@@ -26459,7 +26459,7 @@ function EN(r, e, t) {
  * =============================================================================
  */
 function xN(r, e, t) {
-  if (Uu(r), e != null && e.length !== 5)
+  if (Lu(r), e != null && e.length !== 5)
     throw new Error("tensor5d() requires shape to have five numbers");
   const n = Ba(r, t);
   if (n.length !== 5 && n.length !== 1)
@@ -26485,7 +26485,7 @@ function xN(r, e, t) {
  * =============================================================================
  */
 function IN(r, e, t) {
-  if (Uu(r), e != null && e.length !== 6)
+  if (Lu(r), e != null && e.length !== 6)
     throw new Error("tensor6d() requires shape to have six numbers");
   const n = Ba(r, t);
   if (n.length !== 6 && n.length !== 1)
@@ -26663,7 +26663,7 @@ const kN = /* @__PURE__ */ Z({ unique_: EB });
  */
 function xB(r, e, t) {
   const n = H(r, "x", "unsortedSegmentSum"), i = H(e, "segmentIds", "unsortedSegmentSum", "int32");
-  V(Eu(t), () => "numSegments must be of dtype int");
+  V(Cu(t), () => "numSegments must be of dtype int");
   const s = { x: n, segmentIds: i }, a = { numSegments: t };
   return ee.runKernel(OT, s, a);
 }
@@ -26828,8 +26828,8 @@ function NB(r, e, t) {
   const i = { x: n }, s = { perm: e };
   return n.dtype === "complex64" ? Tt(() => {
     let a = Gc(n), o = op(n);
-    return a = ee.runKernel(Su, { x: a }, s), o = ee.runKernel(Su, { x: o }, s), t && (o = ma(o)), Io(a, o);
-  }) : ee.runKernel(Su, i, s);
+    return a = ee.runKernel(Tu, { x: a }, s), o = ee.runKernel(Tu, { x: o }, s), t && (o = ma(o)), Io(a, o);
+  }) : ee.runKernel(Tu, i, s);
 }
 const Nh = /* @__PURE__ */ Z({ transpose_: NB });
 /**
@@ -27487,7 +27487,7 @@ function eH(r, e, t, n = !1, i = 0) {
       ]);
       a.push(u), s += t;
     }
-  return a.length === 0 ? Cu([], [0, e]) : Se(er(a), [a.length, e]);
+  return a.length === 0 ? wu([], [0, e]) : Se(er(a), [a.length, e]);
 }
 const WN = /* @__PURE__ */ Z({ frame_: eH });
 /**
@@ -28183,13 +28183,13 @@ function YC(r, e = !1) {
     V(r.shape.length === 2, () => `qr2d() requires a 2D Tensor, but got a ${r.shape.length}D Tensor.`);
     const t = r.shape[0], n = r.shape[1];
     let i = eS(t), s = So(r);
-    const a = Cu([[1]], [1, 1]);
+    const a = wu([[1]], [1, 1]);
     let o = So(a);
     const u = t >= n ? n : t;
     for (let c = 0; c < u; ++c) {
       const d = s, p = o, m = i;
       [o, s, i] = ee.tidy(() => {
-        const _ = cn(s, [c, c], [t - c, 1]), y = ap(_), b = cn(s, [c, c], [1, 1]), T = wo(nd(b, 0), Cu([[-1]]), Cu([[1]])), w = Rt(b, Ye(T, y)), x = fn(_, w);
+        const _ = cn(s, [c, c], [t - c, 1]), y = ap(_), b = cn(s, [c, c], [1, 1]), T = wo(nd(b, 0), wu([[-1]]), wu([[1]])), w = Rt(b, Ye(T, y)), x = fn(_, w);
         x.shape[0] === 1 ? o = So(a) : o = er([
           a,
           cn(x, [1, 0], [x.shape[0] - 1, x.shape[1]])
@@ -28731,7 +28731,7 @@ const zN = {
   hannWindow: GN,
   frame: WN,
   stft: nH
-}, $u = {
+}, Ou = {
   flipLeftRight: aH,
   grayscaleToRGB: lH,
   resizeNearestNeighbor: DH,
@@ -29515,11 +29515,11 @@ const OV = "model", $V = ".json", DV = ".weights.bin";
 function JC(r) {
   return new Promise((e) => setTimeout(e)).then(r);
 }
-class Du {
+class $u {
   constructor(e) {
     if (!de().getBool("IS_BROWSER"))
       throw new Error("browserDownloads() cannot proceed because the current environment is not a browser.");
-    e.startsWith(Du.URL_SCHEME) && (e = e.slice(Du.URL_SCHEME.length)), (e == null || e.length === 0) && (e = OV), this.modelJsonFileName = e + $V, this.weightDataFileName = e + DV;
+    e.startsWith($u.URL_SCHEME) && (e = e.slice($u.URL_SCHEME.length)), (e == null || e.length === 0) && (e = OV), this.modelJsonFileName = e + $V, this.weightDataFileName = e + DV;
   }
   async save(e) {
     if (typeof document > "u")
@@ -29540,7 +29540,7 @@ class Du {
     }
   }
 }
-Du.URL_SCHEME = "downloads://";
+$u.URL_SCHEME = "downloads://";
 class PV {
   constructor(e) {
     if (e == null || e.length < 1)
@@ -29604,10 +29604,10 @@ class PV {
     return i;
   }
 }
-const FV = (r) => de().getBool("IS_BROWSER") && !Array.isArray(r) && r.startsWith(Du.URL_SCHEME) ? MV(r.slice(Du.URL_SCHEME.length)) : null;
+const FV = (r) => de().getBool("IS_BROWSER") && !Array.isArray(r) && r.startsWith($u.URL_SCHEME) ? MV(r.slice($u.URL_SCHEME.length)) : null;
 Fn.registerSaveRouter(FV);
 function MV(r = "model") {
-  return new Du(r);
+  return new $u(r);
 }
 function LV(r) {
   return new PV(r);
@@ -29693,7 +29693,7 @@ function e3(r) {
     if (e.forEach((_, y) => {
       let b = 0;
       _.weights.forEach((T) => {
-        const w = "quantization" in T ? T.quantization.dtype : T.dtype, x = Ru[w] * ge(T.shape), E = () => {
+        const w = "quantization" in T ? T.quantization.dtype : T.dtype, x = Au[w] * ge(T.shape), E = () => {
           i[y] = !0, s[y] == null && (s[y] = []), s[y].push({
             manifestEntry: T,
             groupOffset: b,
@@ -31230,7 +31230,7 @@ const wG = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
  */
 function zc(r) {
   try {
-    return r.map((e) => Iu(e));
+    return r.map((e) => xu(e));
   } catch (e) {
     throw new Error(`Failed to decode encoded string bytes into utf-8, error: ${e}`);
   }
@@ -31321,7 +31321,7 @@ const M3 = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
   shouldFuse: F0,
   slice_util: m3,
   splitRealAndImagArrays: pG,
-  stridesOrDilationsArePositive: Ou,
+  stridesOrDilationsArePositive: ku,
   tupleValuesAreOne: wh,
   upcastType: _a,
   validateDefaultValueShape: T3,
@@ -31563,12 +31563,12 @@ const L3 = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
   Tan: _0,
   Tanh: y0,
   Tensor: nn,
-  TensorBuffer: Au,
+  TensorBuffer: Iu,
   TensorScatterUpdate: Hf,
   Tile: ed,
   TopK: Kf,
   Transform: Xf,
-  Transpose: Su,
+  Transpose: Tu,
   Unique: v0,
   Unpack: b0,
   UnsortedSegmentSum: OT,
@@ -31679,7 +31679,7 @@ const L3 = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
   greaterEqual: sS,
   ifft: Rh,
   imag: op,
-  image: $u,
+  image: Ou,
   inTopKAsync: HN,
   io: YS,
   irfft: NS,
@@ -31707,7 +31707,7 @@ const L3 = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
   lowerBound: PR,
   matMul: en,
   math: JV,
-  max: wu,
+  max: Su,
   maxPool: cS,
   maxPool3d: FR,
   maxPoolWithArgmax: MR,
@@ -31733,7 +31733,7 @@ const L3 = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
   onesLike: GR,
   op: Z,
   outerProduct: WR,
-  pad: Gu,
+  pad: Vu,
   pad1d: zR,
   pad2d: jR,
   pad3d: pS,
@@ -31815,7 +31815,7 @@ const L3 = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
   tanh: hg,
   tensor: fi,
   tensor1d: di,
-  tensor2d: Cu,
+  tensor2d: wu,
   tensor3d: $S,
   tensor4d: EN,
   tensor5d: xN,
@@ -32043,14 +32043,14 @@ function U3(r, e) {
     return;
   }
   const n = +t[1], i = r.split(`
-`), s = i.length.toString().length + 2, a = i.map((p, m) => bu((m + 1).toString(), s) + p);
+`), s = i.length.toString().length + 2, a = i.map((p, m) => vu((m + 1).toString(), s) + p);
   let o = 0;
   for (let p = 0; p < a.length; p++)
     o = Math.max(a[p].length, o);
   const u = a.slice(0, n - 1), c = a.slice(n - 1, n), d = a.slice(n);
   console.log(u.join(`
 `)), console.log(e.split(`
-`)[0]), console.log(`%c ${bu(c[0], o)}`, "border:1px solid red; background-color:#e3d2d2; color:#a61717"), console.log(d.join(`
+`)[0]), console.log(`%c ${vu(c[0], o)}`, "border:1px solid red; background-color:#e3d2d2; color:#a61717"), console.log(d.join(`
 `));
 }
 function LG(r) {
@@ -32440,7 +32440,7 @@ function Sr() {
  * limitations under the License.
  * =============================================================================
  */
-function zu(r, e, t = "index") {
+function Wu(r, e, t = "index") {
   const n = an(e);
   return n.map((i, s) => {
     const a = `int ${r[s]} = ${t} / ${i}`, o = s === n.length - 1 ? `int ${r[s + 1]} = ${t} - ${r[s]} * ${i}` : `index -= ${r[s]} * ${i}`;
@@ -32914,7 +32914,7 @@ function SW(r, e, t) {
     return ivec3(r, c, d);
   }
 `;
-  const n = zu(["r", "c", "d"], r);
+  const n = Wu(["r", "c", "d"], r);
   return `
     ivec3 getOutputCoords() {
       ivec2 resTexRC = ivec2(resultUV.yx *
@@ -32986,7 +32986,7 @@ function CW(r, e, t) {
       return ivec4(r, c, d, d2);
     }
   `;
-  const n = zu(["r", "c", "d", "d2"], r);
+  const n = Wu(["r", "c", "d", "d2"], r);
   return `
     ivec4 getOutputCoords() {
       ivec2 resTexRC = ivec2(resultUV.yx *
@@ -32998,7 +32998,7 @@ function CW(r, e, t) {
   `;
 }
 function EW(r, e) {
-  const t = zu(["r", "c", "d", "d2", "d3"], r);
+  const t = Wu(["r", "c", "d", "d2", "d3"], r);
   return `
     ivec5 getOutputCoords() {
       ivec2 resTexRC = ivec2(resultUV.yx * vec2(${e[0]},
@@ -33014,7 +33014,7 @@ function EW(r, e) {
   `;
 }
 function xW(r, e) {
-  const t = zu(["r", "c", "d", "d2", "d3", "d4"], r);
+  const t = Wu(["r", "c", "d", "d2", "d3", "d4"], r);
   return `
     ivec6 getOutputCoords() {
       ivec2 resTexRC = ivec2(resultUV.yx *
@@ -33125,7 +33125,7 @@ function AW(r, e, t) {
     }
   `;
 }
-function ju(r) {
+function zu(r) {
   return `offset${r}`;
 }
 function RW(r) {
@@ -33147,7 +33147,7 @@ function NW(r, e) {
         return sampleTexture(${t}, halfCR);
       }
     `;
-  const a = ju(t);
+  const a = zu(t);
   if (e)
     return `
     float ${n}() {
@@ -33198,7 +33198,7 @@ function OW(r, e) {
         return sampleTexture(${t}, halfCR);
       }
     `;
-  const o = ju(t);
+  const o = zu(t);
   return a === 1 ? e ? `
       float ${n}(int index) {
         vec2 uv = vec2(0.5, (float(index + ${o}) + 0.5) / float(${t}TexShape[0]));
@@ -33299,7 +33299,7 @@ function DW(r, e) {
         ${ad(r)}
       }
     `;
-  const c = s[0], d = s[1], p = ju(n);
+  const c = s[0], d = s[1], p = zu(n);
   return d === 1 ? e ? `
       float ${i}(int row, int col) {
         float index = dot(vec3(row, col, ${p}), vec3(${n}Shape[1], 1, 1));
@@ -33427,7 +33427,7 @@ function FW(r, e) {
       return sampleTexture(${n}, uv);
     }
   `;
-  const y = ju(n);
+  const y = zu(n);
   return e ? `
     float ${i}(int row, int col, int depth) {
       // Explicitly use integer operations as dot() only works on floats.
@@ -33540,7 +33540,7 @@ function LW(r, e) {
         return sampleTexture(${n}, uv);
       }
     `;
-  const w = ju(n);
+  const w = zu(n);
   return e ? `
     float ${i}(int row, int col, int depth, int depth2) {
       // Explicitly use integer operations as dot() only works on floats.
@@ -33608,7 +33608,7 @@ function UW(r) {
         return sampleTexture(${t}, uv);
       }
     `;
-  const y = ju(t);
+  const y = zu(t);
   return `
     float ${n}(int row, int col, int depth, int depth2, int depth3) {
       // Explicitly use integer operations as dot() only works on floats.
@@ -33674,7 +33674,7 @@ function BW(r) {
         return sampleTexture(${t}, uv);
       }
     `;
-  const b = ju(t);
+  const b = zu(t);
   return `
     float ${n}(int row, int col, int depth,
                   int depth2, int depth3, int depth4) {
@@ -34015,7 +34015,7 @@ class jW {
     const t = Sr();
     this.outputShape = e, this.enableShapeUniforms = sr(this.outputShape.length), this.userCode = `
       ivec3 outCoordsFromFlatIndex(int index) {
-        ${this.enableShapeUniforms ? G0(["r", "c", "d"], e) : zu(["r", "c", "d"], e)}
+        ${this.enableShapeUniforms ? G0(["r", "c", "d"], e) : Wu(["r", "c", "d"], e)}
         return ivec3(r, c, d);
       }
 
@@ -34058,7 +34058,7 @@ class qW {
     const t = Sr();
     this.outputShape = e, this.enableShapeUniforms = sr(this.outputShape.length), this.userCode = `
       ivec3 outCoordsFromFlatIndex(int index) {
-        ${this.enableShapeUniforms ? G0(["r", "c", "d"], e) : zu(["r", "c", "d"], e)}
+        ${this.enableShapeUniforms ? G0(["r", "c", "d"], e) : Wu(["r", "c", "d"], e)}
         return ivec3(r, c, d);
       }
 
@@ -35251,7 +35251,7 @@ const J3 = Ur((r, e) => r * e);
  * =============================================================================
  */
 function Lz(r, e, t) {
-  const n = Vu(-1, t);
+  const n = Hu(-1, t);
   return J3([], e, n, r, t);
 }
 /**
@@ -35814,7 +35814,7 @@ function Qz(r, e, t, n, i, s, a, o, u, c) {
   const d = [n / i, i], p = r.values, m = e.values;
   if (n === 0)
     return kn(t, e.dtype);
-  const _ = u instanceof Au ? u : kn(d, e.dtype);
+  const _ = u instanceof Iu ? u : kn(d, e.dtype);
   typeof u == "string" || typeof u == "number" ? _.values.fill(u) : typeof u == "boolean" && _.values.fill(+u);
   for (let y = 0; y < s; y++) {
     const b = [];
@@ -36472,7 +36472,7 @@ function sk(r, e, t, n) {
   s[1] = t[i];
   for (let y = i + 1; y < t.length; y++)
     s[2] *= t[y];
-  const a = /* @__PURE__ */ new Map(), o = new Int32Array(t[i]), u = new Au(s, n, r), c = [], d = s[0] === 1 && s[2] === 1;
+  const a = /* @__PURE__ */ new Map(), o = new Int32Array(t[i]), u = new Iu(s, n, r), c = [], d = s[0] === 1 && s[2] === 1;
   for (let y = 0; y < t[i]; y++) {
     let b;
     if (d)
@@ -36494,7 +36494,7 @@ function sk(r, e, t, n) {
   }
   const p = s.slice();
   p[1] = a.size;
-  const m = new Au(p, n);
+  const m = new Iu(p, n);
   c.forEach((y, b) => {
     for (let T = 0; T < s[0]; T++)
       for (let w = 0; w < s[2]; w++)
@@ -36764,7 +36764,7 @@ class lk {
 function aq(r, e) {
   return `
     ivec3 inputCoordsFromReshapedOutCoords(int index) {
-      ${e ? aW(["r", "c", "d"], "inputShape") : zu(["r", "c", "d"], r)}
+      ${e ? aW(["r", "c", "d"], "inputShape") : Wu(["r", "c", "d"], r)}
       return ivec3(r, c, d);
     }
   `;
@@ -37215,7 +37215,7 @@ class W0 extends Mg {
     const t = this.readSync(e.dataId);
     if (e.dtype === "string")
       try {
-        const n = t.map((i) => Iu(i));
+        const n = t.map((i) => xu(i));
         return kn(e.shape, e.dtype, n);
       } catch {
         throw new Error("Failed to decode encoded string bytes into utf-8");
@@ -37515,7 +37515,7 @@ class W0 extends Mg {
     return this.textureManager.acquireTexture(e, t, i);
   }
   computeBytes(e, t) {
-    return e[0] * e[1] * xu(t);
+    return e[0] * e[1] * Eu(t);
   }
   checkCompileCompletion() {
     for (const [, e] of Object.entries(this.binaryCache))
@@ -37623,7 +37623,7 @@ const Cw = `
   if (isnan(a)) return a;
   if (isnan(b)) return b;
 `;
-class Pu {
+class Du {
   constructor(e, t, n) {
     this.variableNames = ["A", "B"], this.outputShape = Dt(t, n), this.enableShapeUniforms = sr(this.outputShape.length), this.userCode = `
       float binaryOperation(float a, float b) {
@@ -37654,7 +37654,7 @@ class Pu {
  * limitations under the License.
  * =============================================================================
  */
-const qu = `
+const ju = `
   result.r = isNaN.r ? NAN : result.r;
   result.g = isNaN.g ? NAN : result.g;
   result.b = isNaN.b ? NAN : result.b;
@@ -37793,7 +37793,7 @@ const uk = "return (a < 0.) ? b * a : a;", ck = `
   return (aLessThanZero * (b * a)) + ((vec4(1.0) - aLessThanZero) * a);
 `;
 function Oq(r) {
-  const { inputs: e, backend: t, attrs: n } = r, { x: i } = e, { alpha: s } = n, a = t.makeTensorInfo([], "float32", Vu(s, "float32")), o = de().getBool("WEBGL_PACK_BINARY_OPERATIONS") ? new ud(ck, i.shape, a.shape) : new Pu(uk, i.shape, a.shape), u = t.runWebGLProgram(o, [i, a], "float32");
+  const { inputs: e, backend: t, attrs: n } = r, { x: i } = e, { alpha: s } = n, a = t.makeTensorInfo([], "float32", Hu(s, "float32")), o = de().getBool("WEBGL_PACK_BINARY_OPERATIONS") ? new ud(ck, i.shape, a.shape) : new Du(uk, i.shape, a.shape), u = t.runWebGLProgram(o, [i, a], "float32");
   return t.disposeIntermediateTensorInfo(a), u;
 }
 const $q = {
@@ -37822,7 +37822,7 @@ const dk = "return (a < 0.) ? b * a : a;", hk = `
   return (aLessThanZero * (b * a)) + ((vec4(1.0) - aLessThanZero) * a);
 `;
 function Dq(r) {
-  const { inputs: e, backend: t } = r, { x: n, alpha: i } = e, s = de().getBool("WEBGL_PACK_BINARY_OPERATIONS") ? new ud(hk, n.shape, i.shape) : new Pu(dk, n.shape, i.shape);
+  const { inputs: e, backend: t } = r, { x: n, alpha: i } = e, s = de().getBool("WEBGL_PACK_BINARY_OPERATIONS") ? new ud(hk, n.shape, i.shape) : new Du(dk, n.shape, i.shape);
   return t.runWebGLProgram(s, [n, i], "float32");
 }
 const Pq = {
@@ -37875,7 +37875,7 @@ function Us({ opSnippet: r, packedOpSnippet: e, checkOutOfBounds: t = !1, suppor
           dataId: R.dataId,
           dtype: R.dtype,
           shape: c.shape
-        }, O = new Pu(r, u.shape, c.shape);
+        }, O = new Du(r, u.shape, c.shape);
         return d.runWebGLProgram(O, [P, B], _a(I.dtype, R.dtype));
       }), x = Ml({ inputs: { real: T, imag: w }, backend: d });
       return d.disposeIntermediateTensorInfo(T), d.disposeIntermediateTensorInfo(w), x;
@@ -37893,7 +37893,7 @@ function Us({ opSnippet: r, packedOpSnippet: e, checkOutOfBounds: t = !1, suppor
     }
     const m = de().getBool("WEBGL_PACK_BINARY_OPERATIONS") && e != null;
     let _;
-    return m ? _ = new ud(e, u.shape, c.shape, t) : _ = new Pu(r, u.shape, c.shape), d.runWebGLProgram(_, [u, c], p);
+    return m ? _ = new ud(e, u.shape, c.shape, t) : _ = new Du(r, u.shape, c.shape), d.runWebGLProgram(_, [u, c], p);
   };
 }
 function $h(r, e = !1) {
@@ -38067,7 +38067,7 @@ function Ew(r) {
     return m.values = c, p;
   }
   let a;
-  return de().getBool("WEBGL_PACK_BINARY_OPERATIONS") ? a = new ud(yE, n.shape, i.shape) : a = new Pu(yE, n.shape, i.shape), t.runWebGLProgram(a, [n, i], s);
+  return de().getBool("WEBGL_PACK_BINARY_OPERATIONS") ? a = new ud(yE, n.shape, i.shape) : a = new Du(yE, n.shape, i.shape), t.runWebGLProgram(a, [n, i], s);
 }
 const Fq = {
   kernelName: M_,
@@ -38156,7 +38156,7 @@ class vE {
     let c = "sumValue += dot(values, ones);";
     if (t != null) {
       const p = 1 / t;
-      c = `sumValue += dot(values * ${Eu(p) ? p.toPrecision(2) : p}, ones);`;
+      c = `sumValue += dot(values * ${Cu(p) ? p.toPrecision(2) : p}, ones);`;
     }
     let d = "";
     s % n > 0 && (d = `
@@ -38367,7 +38367,7 @@ function Bq(r) {
   }
   return e;
 }
-function Ku(r, e, t, n) {
+function qu(r, e, t, n) {
   const i = Bq(r.shape);
   let s = r;
   for (let a = 0; a < i.length; a++) {
@@ -38511,7 +38511,7 @@ function Wq(r, e, t, n) {
   const [p, m] = nr(d.shape, o);
   let _ = p;
   t && (_ = fs(p, a));
-  const y = ge(m), T = ge(r.shape) / y, w = Ke({ inputs: { x: d }, attrs: { shape: [T, y] }, backend: n }), x = w0(r.dtype), E = Ku(w, x, "sum", n), I = Ke({ inputs: { x: E }, attrs: { shape: _ }, backend: n });
+  const y = ge(m), T = ge(r.shape) / y, w = Ke({ inputs: { x: d }, attrs: { shape: [T, y] }, backend: n }), x = w0(r.dtype), E = qu(w, x, "sum", n), I = Ke({ inputs: { x: E }, attrs: { shape: _ }, backend: n });
   return n.disposeIntermediateTensorInfo(w), n.disposeIntermediateTensorInfo(E), c && n.disposeIntermediateTensorInfo(d), I;
 }
 /**
@@ -38570,7 +38570,7 @@ function br(r) {
   return c;
 }
 const jq = {
-  kernelName: Su,
+  kernelName: Tu,
   backendName: "webgl",
   kernelFunc: br
 };
@@ -38618,7 +38618,7 @@ function _g({ a: r, b: e, transposeA: t, transposeB: n, backend: i, bias: s = nu
   } else {
     const fe = _a(r.dtype, e.dtype), ne = new fk(R, P, [D, _, y], t, n, G, W, j, te), ae = [B, O];
     if (s != null && ae.push(s), j && ae.push(a), te) {
-      const be = i.makeTensorInfo([], "float32", Vu(o, "float32"));
+      const be = i.makeTensorInfo([], "float32", Hu(o, "float32"));
       ae.push(be), F.push(be);
     }
     oe = i.runWebGLProgram(ne, ae, fe);
@@ -38894,7 +38894,7 @@ function lK(r) {
   const d = Lr(c, o);
   let p = i;
   d != null && (p = br({ inputs: { x: i }, backend: t, attrs: { perm: d } }), c = Ls(c.length, o)), ps("all", c, o);
-  const [m, _] = nr(p.shape, c), y = ge(_), b = Ke({ inputs: { x: p }, backend: t, attrs: { shape: [-1, y] } }), T = Ku(b, b.dtype, "all", t);
+  const [m, _] = nr(p.shape, c), y = ge(_), b = Ke({ inputs: { x: p }, backend: t, attrs: { shape: [-1, y] } }), T = qu(b, b.dtype, "all", t);
   let w;
   if (a) {
     const x = fs(m, u);
@@ -38930,7 +38930,7 @@ function cK(r) {
   const d = Lr(c, o);
   let p = i;
   d != null && (p = br({ inputs: { x: i }, backend: t, attrs: { perm: d } }), c = Ls(c.length, o)), ps("any", c, o);
-  const [m, _] = nr(p.shape, c), y = ge(_), b = Ke({ inputs: { x: p }, backend: t, attrs: { shape: [-1, y] } }), T = Ku(b, b.dtype, "any", t);
+  const [m, _] = nr(p.shape, c), y = ge(_), b = Ke({ inputs: { x: p }, backend: t, attrs: { shape: [-1, y] } }), T = qu(b, b.dtype, "any", t);
   let w;
   if (a) {
     const x = fs(m, u);
@@ -39289,7 +39289,7 @@ const IK = Cw + `
   bvec4 isNaNA = isnan(a);
   bvec4 isNaNB = isnan(b);
   bvec4 isNaN = bvec4(isNaNA.x || isNaNB.x, isNaNA.y || isNaNB.y, isNaNA.z || isNaNB.z, isNaNA.w || isNaNB.w);
-  ` + qu + `
+  ` + ju + `
   return result;
 `, RK = Us({ opSnippet: IK, packedOpSnippet: AK }), NK = {
   kernelName: Xg,
@@ -40283,7 +40283,7 @@ function oX(r) {
     return _.values = d, m;
   }
   let o;
-  return s ? o = new ud(iX, n.shape, i.shape, !1) : o = new Pu(aX, n.shape, i.shape), t.runWebGLProgram(o, [n, i], n.dtype);
+  return s ? o = new ud(iX, n.shape, i.shape, !1) : o = new Du(aX, n.shape, i.shape), t.runWebGLProgram(o, [n, i], n.dtype);
 }
 const lX = {
   kernelName: Qg,
@@ -41578,7 +41578,7 @@ function wk({ x: r, filter: e, convInfo: t, backend: n, bias: i = null, preluAct
   I.push(O), I.push(F);
   const D = i != null, L = s != null, G = o === "leakyrelu", j = o ? $h(o, !0) : null, te = new fk(y ? F.shape : R.shape, y ? R.shape : F.shape, y ? [t.batchSize, T, t.outChannels] : [t.batchSize, t.outChannels, T], x, E, D, j, L, G), W = y ? [F, R] : [R, F];
   if (i && W.push(i), L && W.push(s), G) {
-    const Ce = n.makeTensorInfo([], "float32", Vu(a, "float32"));
+    const Ce = n.makeTensorInfo([], "float32", Hu(a, "float32"));
     W.push(Ce), I.push(Ce);
   }
   const Q = n.runWebGLProgram(te, W, "float32"), oe = Ke({ inputs: { x: Q }, backend: n, attrs: { shape: t.outShape } });
@@ -42116,7 +42116,7 @@ const YX = cd + `
 `, JX = `
   vec4 result = cos(x);
   bvec4 isNaN = isnan(x);
-  ${qu}
+  ${ju}
   return result;
 `, QX = qt({ opSnippet: YX, packedOpSnippet: JX }), ZX = {
   kernelName: s_,
@@ -43309,7 +43309,7 @@ const PY = "return (b >= 0.0) ? a : a * (b + 1.0);", FY = `
   vec4 bGTEZero = vec4(greaterThanEqual(b, vec4(0.)));
   return (bGTEZero * a) + ((vec4(1.0) - bGTEZero) * (a * (b + vec4(1.0))));
 `, MY = (r) => {
-  const { inputs: e, backend: t } = r, { dy: n, y: i } = e, s = de().getBool("WEBGL_PACK_BINARY_OPERATIONS") ? new ud(FY, n.shape, i.shape) : new Pu(PY, n.shape, i.shape);
+  const { inputs: e, backend: t } = r, { dy: n, y: i } = e, s = de().getBool("WEBGL_PACK_BINARY_OPERATIONS") ? new ud(FY, n.shape, i.shape) : new Du(PY, n.shape, i.shape);
   return t.runWebGLProgram(s, [n, i], n.dtype);
 }, LY = {
   kernelName: u_,
@@ -43632,7 +43632,7 @@ class eJ {
 function _p(r) {
   const { backend: e, attrs: t } = r, { shape: n, value: i } = t;
   let { dtype: s } = t;
-  if (s = s || Bu(i), s === "string") {
+  if (s = s || Uu(i), s === "string") {
     const a = ds(s, ge(n));
     return a.fill(i), e.makeTensorInfo(n, s, a);
   } else {
@@ -43902,7 +43902,7 @@ const hJ = {
   backendName: "webgl",
   kernelFunc: fJ
 };
-let mc, J1 = de().getBool("CANVAS2D_WILL_READ_FREQUENTLY_FOR_GPU");
+let pc, J1 = de().getBool("CANVAS2D_WILL_READ_FREQUENTLY_FOR_GPU");
 function fJ(r) {
   const { inputs: e, backend: t, attrs: n } = r;
   let { pixels: i } = e;
@@ -43912,7 +43912,7 @@ function fJ(r) {
   ] : [i.width, i.height], d = [c, u], p = [c, u, s];
   if (o || a) {
     const b = de().getBool("CANVAS2D_WILL_READ_FREQUENTLY_FOR_GPU");
-    (mc == null || b !== J1) && (J1 = b, mc = document.createElement("canvas").getContext("2d", { willReadFrequently: J1 })), mc.canvas.width = u, mc.canvas.height = c, mc.drawImage(i, 0, 0, u, c), i = mc.canvas;
+    (pc == null || b !== J1) && (J1 = b, pc = document.createElement("canvas").getContext("2d", { willReadFrequently: J1 })), pc.canvas.width = u, pc.canvas.height = c, pc.drawImage(i, 0, 0, u, c), i = pc.canvas;
   }
   const m = t.makeTensorInfo(d, "int32");
   t.texData.get(m.dataId).usage = hi.PIXELS, t.gpgpu.uploadPixelDataToTexture(t.getTexture(m.dataId), i);
@@ -43951,7 +43951,7 @@ function pJ(r) {
       return D;
     };
     if (E && O.push(F(a, d)), I && O.push(F(o, d)), R) {
-      const D = t.makeTensorInfo([], "float32", Vu(y, "float32"));
+      const D = t.makeTensorInfo([], "float32", Hu(y, "float32"));
       O.push(D), x.push(D);
     }
     return O;
@@ -44029,7 +44029,7 @@ function gJ(r) {
     /* depthwise */
   ), w = de().getBool("WEBGL_PACK_DEPTHWISECONV") && T.strideWidth <= 2 && T.outChannels / T.inChannels === 1, x = m ? $h(m, w) : null, E = [i, s], I = a != null, R = o != null, P = m === "leakyrelu";
   if (I && E.push(a), R && E.push(o), P) {
-    const D = t.makeTensorInfo([], "float32", Vu(_, "float32"));
+    const D = t.makeTensorInfo([], "float32", Hu(_, "float32"));
     E.push(D), y.push(D);
   }
   let B;
@@ -44833,7 +44833,7 @@ const SQ = (r) => {
  * =============================================================================
  */
 function CQ(r, e, t, n) {
-  const i = ge(e), a = ge(r.shape) / i, o = Ke({ inputs: { x: r }, attrs: { shape: [a, i] }, backend: n }), u = Ku(o, r.dtype, "max", n), c = Ke({ inputs: { x: u }, attrs: { shape: t }, backend: n });
+  const i = ge(e), a = ge(r.shape) / i, o = Ke({ inputs: { x: r }, attrs: { shape: [a, i] }, backend: n }), u = qu(o, r.dtype, "max", n), c = Ke({ inputs: { x: u }, attrs: { shape: t }, backend: n });
   return n.disposeIntermediateTensorInfo(o), n.disposeIntermediateTensorInfo(u), c;
 }
 /**
@@ -44912,7 +44912,7 @@ const xQ = Cw + `
   bvec4 isNaNA = isnan(a);
   bvec4 isNaNB = isnan(b);
   bvec4 isNaN = bvec4(isNaNA.x || isNaNB.x, isNaNA.y || isNaNB.y, isNaNA.z || isNaNB.z, isNaNA.w || isNaNB.w);
-  ` + qu + `
+  ` + ju + `
   return result;
 `, AQ = Us({
   opSnippet: xQ,
@@ -45245,7 +45245,7 @@ const HQ = {
  * =============================================================================
  */
 function VQ(r, e, t, n) {
-  const i = ge(e), a = ge(r.shape) / i, o = Ke({ inputs: { x: r }, attrs: { shape: [a, i] }, backend: n }), u = Ku(o, "float32", "mean", n), c = Ke({ inputs: { x: u }, attrs: { shape: t }, backend: n });
+  const i = ge(e), a = ge(r.shape) / i, o = Ke({ inputs: { x: r }, attrs: { shape: [a, i] }, backend: n }), u = qu(o, "float32", "mean", n), c = Ke({ inputs: { x: u }, attrs: { shape: t }, backend: n });
   return n.disposeIntermediateTensorInfo(o), n.disposeIntermediateTensorInfo(u), c;
 }
 /**
@@ -45317,7 +45317,7 @@ function WQ(r) {
   const d = Lr(c, o);
   let p = i;
   d != null && (p = br({ inputs: { x: i }, backend: t, attrs: { perm: d } }), c = Ls(c.length, i.shape.length)), ps("min", c, o);
-  const [m, _] = nr(p.shape, c), y = ge(_), b = Ke({ inputs: { x: p }, backend: t, attrs: { shape: [-1, y] } }), T = Ku(b, b.dtype, "min", t);
+  const [m, _] = nr(p.shape, c), y = ge(_), b = Ke({ inputs: { x: p }, backend: t, attrs: { shape: [-1, y] } }), T = qu(b, b.dtype, "min", t);
   let w;
   if (a) {
     const x = fs(m, u);
@@ -45354,7 +45354,7 @@ const jQ = Cw + `
   bvec4 isNaNA = isnan(a);
   bvec4 isNaNB = isnan(b);
   bvec4 isNaN = bvec4(isNaNA.x || isNaNB.x, isNaNA.y || isNaNB.y, isNaNA.z || isNaNB.z, isNaNA.w || isNaNB.w);
-  ` + qu + `
+  ` + ju + `
   return result;
 `, KQ = Us({
   opSnippet: jQ,
@@ -45558,7 +45558,7 @@ const eZ = `if (b == 0.0) return NAN;
   return mod(a, b);`, tZ = `
   vec4 result = mod(a, b);
   bvec4 isNaN = equal(b, vec4(0.0));
-  ` + qu + `
+  ` + ju + `
   return result;
 `, nZ = Us({
   opSnippet: eZ,
@@ -46207,7 +46207,7 @@ const PZ = `
   bvec4 isNaN1 = lessThan(a, vec4(0.0));
   bvec4 isNaN2 = lessThan(floor(b), b);
   bvec4 isNaN = bvec4(isNaN1.x && isNaN2.x, isNaN1.y && isNaN2.y, isNaN1.z && isNaN2.z, isNaN1.w && isNaN2.w);
-  ` + qu + `
+  ` + ju + `
   return result;
 `, MZ = Us({ opSnippet: PZ, packedOpSnippet: FZ }), LZ = {
   kernelName: V_,
@@ -46241,7 +46241,7 @@ function UZ(r) {
     const y = t.texData.get(m.dataId).values, { outVals: b, outShape: T, outDtype: w } = Mj(m.shape, m.dtype, y, d);
     _ = t.makeTensorInfo(T, w, b);
   } else {
-    const [y, b] = nr(m.shape, d), T = ge(b), w = Ke({ inputs: { x: m }, backend: t, attrs: { shape: [-1, T] } }), x = w0(i.dtype), E = Ku(w, x, "prod", t);
+    const [y, b] = nr(m.shape, d), T = ge(b), w = Ke({ inputs: { x: m }, backend: t, attrs: { shape: [-1, T] } }), x = w0(i.dtype), E = qu(w, x, "prod", t);
     _ = Ke({ inputs: { x: E }, backend: t, attrs: { shape: y } }), u.push(w), u.push(E);
   }
   if (a) {
@@ -47722,7 +47722,7 @@ const Yee = cd + `
 `, Jee = `
   vec4 result = sin(x);
   bvec4 isNaN = isnan(x);
-  ${qu}
+  ${ju}
   return result;
 `, Qee = qt({ opSnippet: Yee, packedOpSnippet: Jee }), Zee = {
   kernelName: t0,
@@ -47997,7 +47997,7 @@ const mte = {
 function gte(r) {
   const { inputs: e, backend: t, attrs: n } = r, { sparseIndices: i, sparseValues: s, defaultValue: a } = e, { outputShape: o } = n, { sliceRank: u, numUpdates: c, sliceSize: d, strides: p, outputSize: m } = Dl(s, i, o), _ = !1;
   if (s.dtype === "string") {
-    const w = t.bufferSync(i), x = t.bufferSync(s), E = Iu(t.readSync(a.dataId)[0]), I = Gj(w, x, o, m, d, c, u, p, E, _);
+    const w = t.bufferSync(i), x = t.bufferSync(s), E = xu(t.readSync(a.dataId)[0]), I = Gj(w, x, o, m, d, c, u, p, E, _);
     return t.makeTensorInfo(o, I.dtype, I.values);
   }
   const y = new Iw(c, u, i.shape.length, s.shape.length, p, [m, 1], _), b = t.runWebGLProgram(y, [s, i, a], s.dtype), T = Ke({ inputs: { x: b }, backend: t, attrs: { shape: o } });
@@ -48463,7 +48463,7 @@ function Xte(r) {
 function Mk(r) {
   const { inputs: e, backend: t, attrs: n } = r, { x: i } = e, { reps: s } = n;
   if (i.dtype === "string" || i.shape.length > 5) {
-    const u = t.readSync(i.dataId), c = i.dtype === "string" ? u.map((m) => Iu(m)) : u, d = kn(i.shape, i.dtype, c), p = tq(d, s);
+    const u = t.readSync(i.dataId), c = i.dtype === "string" ? u.map((m) => xu(m)) : u, d = kn(i.shape, i.dtype, c), p = tq(d, s);
     return t.makeTensorInfo(p.shape, p.dtype, p.values);
   }
   const a = new Kte(i.shape, s);
@@ -49588,7 +49588,7 @@ const Sne = {
  */
 let Bk;
 function wne(r) {
-  Bk = r.wasm.cwrap(Su, null, [
+  Bk = r.wasm.cwrap(Tu, null, [
     "number",
     "array",
     "number",
@@ -49635,7 +49635,7 @@ function Ene(r, e) {
   return [t, n];
 }
 const xne = {
-  kernelName: Su,
+  kernelName: Tu,
   backendName: "wasm",
   kernelFunc: xl,
   setupFunc: wne
@@ -50330,7 +50330,7 @@ const tse = {
  * limitations under the License.
  * =============================================================================
  */
-function Fu(r) {
+function Pu(r) {
   const { inputs: { x: e }, attrs: { begin: t, size: n }, backend: i } = r, [s, a] = QS(e, t, n), o = B0(e.shape, s, a), u = i.readSync(e.dataId), c = i.makeOutput(a, e.dtype), d = an(e.shape), p = i.dataIdMap.get(c.dataId);
   if (o) {
     const y = H0(s, d);
@@ -50383,7 +50383,7 @@ function rse(r, e, t, n, i, s, a) {
 const ise = {
   kernelName: e0,
   backendName: "wasm",
-  kernelFunc: Fu
+  kernelFunc: Pu
 };
 /**
  * @license
@@ -50402,7 +50402,7 @@ const ise = {
  * =============================================================================
  */
 function ase(r) {
-  const { inputs: e, backend: t, attrs: n } = r, { x: i } = e, { blockShape: s, crops: a } = n, o = s.reduce((w, x) => w * x), u = cp(i.shape, s, o), c = dp(u.length, s.length), d = hp(i.shape, s, o), p = sw(a, s.length), m = rw(d, a, s.length), _ = Pr({ inputs: { x: i }, backend: t, attrs: { shape: u } }), y = xl({ inputs: { x: _ }, backend: t, attrs: { perm: c } }), b = Pr({ inputs: { x: y }, backend: t, attrs: { shape: d } }), T = Fu({
+  const { inputs: e, backend: t, attrs: n } = r, { x: i } = e, { blockShape: s, crops: a } = n, o = s.reduce((w, x) => w * x), u = cp(i.shape, s, o), c = dp(u.length, s.length), d = hp(i.shape, s, o), p = sw(a, s.length), m = rw(d, a, s.length), _ = Pr({ inputs: { x: i }, backend: t, attrs: { shape: u } }), y = xl({ inputs: { x: _ }, backend: t, attrs: { perm: c } }), b = Pr({ inputs: { x: y }, backend: t, attrs: { shape: d } }), T = Pu({
     inputs: { x: b },
     backend: t,
     attrs: { begin: p, size: m }
@@ -51734,7 +51734,7 @@ const Sre = zt(p_, "float32");
 function pO(r) {
   const { attrs: { shape: e, value: t }, backend: n } = r;
   let { attrs: { dtype: i } } = r;
-  i = i || Bu(t);
+  i = i || Uu(t);
   const s = n.makeOutput(e, i);
   return n.typedArrayFromHeap(s).fill(t), s;
 }
@@ -54413,11 +54413,11 @@ function Coe(r) {
   if (e.disposeData(P.dataId), D)
     throw e.disposeData(y.dataId), e.disposeData(T.dataId), e.disposeData(x.dataId), e.disposeData(I.dataId), new Error(D);
   let L = y, G = T;
-  return O !== d[0] && (L = Fu({
+  return O !== d[0] && (L = Pu({
     inputs: { x: y },
     attrs: { begin: 0, size: [O, u] },
     backend: e
-  }), G = Fu({
+  }), G = Pu({
     inputs: { x: T },
     attrs: { begin: 0, size: O },
     backend: e
@@ -54687,7 +54687,7 @@ function Foe(r) {
   return u.map((p) => {
     const m = [...d];
     m[o] = p;
-    const _ = Fu({ inputs: { x: i }, attrs: { begin: c, size: m }, backend: n });
+    const _ = Pu({ inputs: { x: i }, attrs: { begin: c, size: m }, backend: n });
     return c[o] += p, _;
   });
 }
@@ -54822,7 +54822,7 @@ function zoe(r) {
     R = Pr({ inputs: { x: i }, backend: e, attrs: { shape: y } });
   else if (T || w) {
     V(i.shape.length >= 1, () => `Input must have rank at least 1, got: ${i.shape.length}`);
-    const P = JS(x, E, I), B = Fu({ inputs: { x: i }, backend: e, attrs: { begin: x, size: P } });
+    const P = JS(x, E, I), B = Pu({ inputs: { x: i }, backend: e, attrs: { begin: x, size: P } });
     R = Pr({ inputs: { x: B }, backend: e, attrs: { shape: y } }), e.disposeData(B.dataId);
   } else {
     const P = e.makeOutput(_, "float32"), B = e.dataIdMap.get(i.dataId).id, O = new Uint8Array(new Int32Array(an(i.shape)).buffer), F = new Uint8Array(new Int32Array(x).buffer), D = new Uint8Array(new Int32Array(E).buffer), L = new Uint8Array(new Int32Array(I).buffer), G = new Uint8Array(new Int32Array(_).buffer), j = new Uint8Array(new Int32Array(an(_)).buffer), te = e.dataIdMap.get(P.dataId).id;
@@ -55287,7 +55287,7 @@ function vle(r) {
   const d = new Array(a), p = new Array(o).fill(0), m = i.shape.slice();
   m[s] = 1;
   for (let _ = 0; _ < d.length; _++)
-    p[s] = _, d[_] = Fu({ inputs: { x: i }, attrs: { begin: p, size: m }, backend: t });
+    p[s] = _, d[_] = Pu({ inputs: { x: i }, attrs: { begin: p, size: m }, backend: t });
   return d.map(({ dataId: _, dtype: y }) => ({ dataId: _, dtype: y, shape: u }));
 }
 const ble = {
@@ -57349,7 +57349,7 @@ class Ale extends Mg {
       this.dataIdMap.set(e, { id: a, stringBytes: d, shape: n, dtype: i, memoryOffset: null, refCount: s });
       return;
     }
-    const o = ge(n), u = o * xu(i), c = this.wasm._malloc(u) >>> 0;
+    const o = ge(n), u = o * Eu(i), c = this.wasm._malloc(u) >>> 0;
     this.dataIdMap.set(e, { id: a, memoryOffset: c, shape: n, dtype: i, refCount: s }), this.wasm.tfjs.registerTensor(a, o, c), t != null && this.wasm.HEAPU8.set(new Uint8Array(t.buffer, t.byteOffset, u), c);
   }
   async read(e) {
@@ -57360,7 +57360,7 @@ class Ale extends Mg {
     if (s === "string")
       return (t == null || t === 0) && (n == null || n >= o.length) ? o : o.slice(t, n);
     t = t || 0, n = n || ge(a);
-    const u = xu(s), c = this.wasm.HEAPU8.slice(i + t * u, i + n * u);
+    const u = Eu(s), c = this.wasm.HEAPU8.slice(i + t * u, i + n * u);
     return kle(c.buffer, s);
   }
   /**
@@ -57637,7 +57637,7 @@ function k(r, e, t, n, i) {
       }).map((y) => Os(y, t, n, i));
     }
     const d = Os(e.inputNames[c], t, n, i), p = d.dataSync();
-    return s.type === "number" ? p[0] : Tu(d.shape, p);
+    return s.type === "number" ? p[0] : bu(d.shape, p);
   }
   const a = e.attrParams[r];
   return a && a.value;
@@ -64626,7 +64626,7 @@ const Bs = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
   greaterEqual: sS,
   ifft: Rh,
   imag: op,
-  image: $u,
+  image: Ou,
   inTopKAsync: HN,
   irfft: NS,
   isFinite: xR,
@@ -64650,7 +64650,7 @@ const Bs = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
   losses: KN,
   lowerBound: PR,
   matMul: en,
-  max: wu,
+  max: Su,
   maxPool: cS,
   maxPool3d: FR,
   maxPoolWithArgmax: MR,
@@ -64674,7 +64674,7 @@ const Bs = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
   onesLike: GR,
   op: Z,
   outerProduct: WR,
-  pad: Gu,
+  pad: Vu,
   pad1d: zR,
   pad2d: jR,
   pad3d: pS,
@@ -64744,7 +64744,7 @@ const Bs = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
   tanh: hg,
   tensor: fi,
   tensor1d: di,
-  tensor2d: Cu,
+  tensor2d: wu,
   tensor3d: $S,
   tensor4d: EN,
   tensor5d: xN,
@@ -65164,7 +65164,7 @@ class Aue {
  * limitations under the License.
  * =============================================================================
  */
-class Mu {
+class Fu {
   get id() {
     return this.idTensor.id;
   }
@@ -65188,7 +65188,7 @@ class Mu {
    * Get a new TensorList containing a copy of the underlying tensor container.
    */
   copy() {
-    return new Mu([...this.tensors], this.elementShape, this.elementDtype);
+    return new Fu([...this.tensors], this.elementShape, this.elementDtype);
   }
   /**
    * Dispose the tensors and idTensor and clear the tensor list.
@@ -65256,7 +65256,7 @@ class Mu {
       throw new Error(`TensorListResize expects size to be non-negative. Got: ${e}`);
     if (this.maxNumElements !== -1 && e > this.maxNumElements)
       throw new Error(`TensorListResize input size ${e} is greater maxNumElement ${this.maxNumElements}.`);
-    const t = new Mu([], this.elementShape, this.elementDtype, this.maxNumElements);
+    const t = new Fu([], this.elementShape, this.elementDtype, this.maxNumElements);
     t.tensors.length = e;
     for (let n = 0; n < Math.min(this.tensors.length, e); ++n)
       t.tensors[n] = this.tensors[n];
@@ -65333,10 +65333,10 @@ function Rue(r, e, t) {
   const i = r.shape.slice(1);
   ki(i, e, "TensorList shape mismatch: ");
   const s = Pl(r);
-  return new Mu(s, e, n);
+  return new Fu(s, e, n);
 }
 function Nue(r, e, t, n) {
-  return new Mu([], r, e, n);
+  return new Fu([], r, e, n);
 }
 function kue(r, e, t, n) {
   if (e.length !== r.shape[0])
@@ -65344,7 +65344,7 @@ function kue(r, e, t, n) {
   const i = Math.max(...e);
   if (n != null && n !== -1 && i >= n)
     throw new Error(`Max index must be < array size (${i}  vs. ${n})`);
-  const s = new Mu([], t, r.dtype, n), a = Pl(r, 0);
+  const s = new Fu([], t, r.dtype, n), a = Pl(r, 0);
   return e.forEach((o, u) => {
     s.setItem(o, a[u]);
   }), s;
@@ -65364,7 +65364,7 @@ function Oue(r, e, t) {
       d[p] = Se(cn(r, _, y), a);
     }
     return r.dispose(), d;
-  }), c = new Mu([], t, r.dtype, e.length);
+  }), c = new Fu([], t, r.dtype, e.length);
   for (let d = 0; d < u.length; d++)
     c.setItem(d, u[d]);
   return c;
@@ -69094,13 +69094,13 @@ var hce = {};
     jn.call(this, C);
   }
   T(Ya, jn);
-  var sc = [Ya, 1, At, 2, At, 3, At, 4, At, 5, At];
-  Ya.prototype.l = Tn(sc);
+  var nc = [Ya, 1, At, 2, At, 3, At, 4, At, 5, At];
+  Ya.prototype.l = Tn(nc);
   function Go(C) {
     jn.call(this, C, -1, Wo);
   }
   T(Go, jn);
-  var Wo = [1], Aa = Xa([Go, 1, ta, sc]);
+  var Wo = [1], Aa = Xa([Go, 1, ta, nc]);
   function Ar(C) {
     jn.call(this, C);
   }
@@ -69308,7 +69308,7 @@ var hce = {};
         z = U.value, C.j.overrideFile(z, C.D[z]);
       if (C.D = {}, C.h.listeners)
         for (J = o(C.h.listeners), K = J.next(); !K.done; K = J.next())
-          se = K.value, ic(C, se);
+          se = K.value, rc(C, se);
       pe = C.l, C.l = {}, C.setOptions(pe), ke.h = 0;
     });
   }
@@ -69353,7 +69353,7 @@ var hce = {};
       (U.length !== 0 || z.length !== 0) && (this.u = !0, this.H = (this.H === void 0 ? [] : this.H).concat(z), this.F = (this.F === void 0 ? [] : this.F).concat(U));
     }
   };
-  function rc(C) {
+  function sc(C) {
     var N, $, U, z, J, K, se;
     return L(function(pe) {
       switch (pe.h) {
@@ -69389,7 +69389,7 @@ var hce = {};
   r.initialize = function() {
     var C = this;
     return L(function(N) {
-      return N.h == 1 ? I(N, Jl(C), 2) : N.h != 3 ? I(N, Ko(C), 3) : I(N, rc(C), 0);
+      return N.h == 1 ? I(N, Jl(C), 2) : N.h != 3 ? I(N, Ko(C), 3) : I(N, sc(C), 0);
     });
   };
   function Xo(C, N) {
@@ -69487,9 +69487,9 @@ var hce = {};
           if (dt = N[yt.stream], yt.type === "detection_list") {
             if (dt) {
               for (var Un = dt.getRectList(), ys = dt.getLandmarksList(), ls = dt.getClassificationsList(), Vt = [], Kn = 0; Kn < Un.size(); ++Kn) {
-                var Rr = ql(Un.get(Kn)), Qo = as(Rr, 1), ac = as(Rr, 2), oc = as(Rr, 3), lc = as(Rr, 4), Td = as(Rr, 5, 0), ro = void 0;
+                var Rr = ql(Un.get(Kn)), Qo = as(Rr, 1), ic = as(Rr, 2), ac = as(Rr, 3), oc = as(Rr, 4), Td = as(Rr, 5, 0), ro = void 0;
                 ro = ro === void 0 ? 0 : ro, Rr = {
-                  la: { sa: Qo, ta: ac, height: oc, width: lc, rotation: Td, pa: Ws(bn(Rr, 6), ro) },
+                  la: { sa: Qo, ta: ic, height: ac, width: oc, rotation: Td, pa: Ws(bn(Rr, 6), ro) },
                   ea: ji(Aa(ys.get(Kn)), Ya, 1).map(Qa),
                   ba: Ja(vd(ls.get(Kn)))
                 }, Vt.push(Rr);
@@ -69546,7 +69546,7 @@ var hce = {};
       return typeof $ == "number" || $ instanceof Uint8Array || $ instanceof C.i.Uint8BlobList ? z.return($) : $ instanceof C.i.Texture2dDataOut ? (U = C.v[N], U || (U = new Za(C.i, C.K), C.v[N] = U), z.return(jo(U, $, C.M))) : z.return(void 0);
     });
   }
-  function ic(C, N) {
+  function rc(C, N) {
     for (var $ = N.name || "$", U = [].concat(u(N.wants)), z = new C.i.StringList(), J = o(N.wants), K = J.next(); !K.done; K = J.next())
       z.push_back(K.value);
     J = C.i.PacketListener.implement({
@@ -70323,15 +70323,15 @@ function pm(r, e, t) {
   }(r);
   return [JE(n * s, e), JE(i * s, e)];
 }
-function gc(r, e, t, n, i) {
+function mc(r, e, t, n, i) {
   var s = e[0], a = e[1], o = t[0], u = t[1], c = n[0], d = c[0], p = c[1], m = n[1], _ = m[0], y = m[1];
   return i === void 0 && (i = !1), Tt(function() {
-    var b = $u.resizeBilinear(r, [o, u], !0);
+    var b = Ou.resizeBilinear(r, [o, u], !0);
     return i && (b = Ma(b)), function(T, w, x) {
       var E = w[0], I = w[1], R = x[0], P = R[0], B = R[1], O = x[1], F = O[0], D = O[1];
       return Tt(function() {
         var L = $r(T);
-        return Li($u.cropAndResize(L, [[P / (E + P + B - 1), F / (I + F + D - 1), (P + E - 1) / (E + P + B - 1), (F + I - 1) / (I + F + D - 1)]], [0], [E, I]), [0]);
+        return Li(Ou.cropAndResize(L, [[P / (E + P + B - 1), F / (I + F + D - 1), (P + E - 1) / (E + P + B - 1), (F + I - 1) / (I + F + D - 1)]], [0], [E, I]), [0]);
       });
     }(b, [s, a], [[d, p], [_, y]]);
   });
@@ -70343,7 +70343,7 @@ function mm(r, e) {
     var y = function(b) {
       return b instanceof nn ? b : L0(b);
     }(r);
-    return y = pS(y, [[c, d], [p, m], [0, 0]]), $u.resizeBilinear(y, [t, n]);
+    return y = pS(y, [[c, d], [p, m], [0, 0]]), Ou.resizeBilinear(y, [t, n]);
   });
   return { resized: _, padding: { top: c, left: p, right: m, bottom: d } };
 }
@@ -70422,7 +70422,7 @@ var M$ = function() {
     var i = this;
     n === void 0 && (n = 0.5);
     var s = ih(e), a = s[0], o = s[1], u = pm(t, this.baseModel.outputStride, [a, o]), c = mm(e, u), d = c.resized, p = c.padding, m = Tt(function() {
-      var x = i.predictForPersonSegmentation(d), E = x.segmentLogits, I = x.heatmapScores, R = x.offsets, P = x.displacementFwd, B = x.displacementBwd, O = d.shape, F = O[0], D = O[1], L = gc(E, [a, o], [F, D], [[p.top, p.bottom], [p.left, p.right]], !0);
+      var x = i.predictForPersonSegmentation(d), E = x.segmentLogits, I = x.heatmapScores, R = x.offsets, P = x.displacementFwd, B = x.displacementBwd, O = d.shape, F = O[0], D = O[1], L = mc(E, [a, o], [F, D], [[p.top, p.bottom], [p.left, p.right]], !0);
       return { segmentation: hm(Li(L), n), heatmapScores: I, offsets: R, displacementFwd: P, displacementBwd: B };
     }), _ = m.segmentation, y = m.heatmapScores, b = m.offsets, T = m.displacementFwd, w = m.displacementBwd;
     return d.dispose(), { segmentation: _, heatmapScores: y, offsets: b, displacementFwd: T, displacementBwd: w, padding: p, internalResolutionHeightAndWidth: u };
@@ -70447,7 +70447,7 @@ var M$ = function() {
         switch (F.label) {
           case 0:
             return rx(t = fr(fr({}, vm), t)), n = ih(e), i = n[0], s = n[1], a = pm(t.internalResolution, this.baseModel.outputStride, [i, s]), o = mm(e, a), u = o.resized, c = o.padding, d = Tt(function() {
-              var D, L = O.predictForMultiPersonInstanceSegmentationAndPart(u), G = L.segmentLogits, j = L.longOffsets, te = L.heatmapScores, W = L.offsets, Q = L.displacementFwd, oe = L.displacementBwd, Ce = gc(G, [i, s], a, [[c.top, c.bottom], [c.left, c.right]], !0);
+              var D, L = O.predictForMultiPersonInstanceSegmentationAndPart(u), G = L.segmentLogits, j = L.longOffsets, te = L.heatmapScores, W = L.offsets, Q = L.displacementFwd, oe = L.displacementBwd, Ce = mc(G, [i, s], a, [[c.top, c.bottom], [c.left, c.right]], !0);
               return D = j, { segmentation: hm(Li(Ce), t.segmentationThreshold), longOffsets: D, heatmapScoresRaw: te, offsetsRaw: W, displacementFwdRaw: Q, displacementBwdRaw: oe };
             }), p = d.segmentation, m = d.longOffsets, _ = d.heatmapScoresRaw, y = d.offsetsRaw, b = d.displacementFwdRaw, T = d.displacementBwdRaw, [4, gm([_, y, b, T])];
           case 1:
@@ -70461,7 +70461,7 @@ var M$ = function() {
     var i = this;
     n === void 0 && (n = 0.5);
     var s = ih(e), a = s[0], o = s[1], u = pm(t, this.baseModel.outputStride, [a, o]), c = mm(e, u), d = c.resized, p = c.padding, m = Tt(function() {
-      var x = i.predictForPersonSegmentationAndPart(d), E = x.segmentLogits, I = x.partHeatmapLogits, R = x.heatmapScores, P = x.offsets, B = x.displacementFwd, O = x.displacementBwd, F = d.shape, D = F[0], L = F[1], G = gc(E, [a, o], [D, L], [[p.top, p.bottom], [p.left, p.right]], !0), j = gc(I, [a, o], [D, L], [[p.top, p.bottom], [p.left, p.right]], !0);
+      var x = i.predictForPersonSegmentationAndPart(d), E = x.segmentLogits, I = x.partHeatmapLogits, R = x.heatmapScores, P = x.offsets, B = x.displacementFwd, O = x.displacementBwd, F = d.shape, D = F[0], L = F[1], G = mc(E, [a, o], [D, L], [[p.top, p.bottom], [p.left, p.right]], !0), j = mc(I, [a, o], [D, L], [[p.top, p.bottom], [p.left, p.right]], !0);
       return { partSegmentation: fce(hm(Li(G), n), j), heatmapScores: R, offsets: P, displacementFwd: B, displacementBwd: O };
     }), _ = m.partSegmentation, y = m.heatmapScores, b = m.offsets, T = m.displacementFwd, w = m.displacementBwd;
     return d.dispose(), { partSegmentation: _, heatmapScores: y, offsets: b, displacementFwd: T, displacementBwd: w, padding: p, internalResolutionHeightAndWidth: u };
@@ -70486,7 +70486,7 @@ var M$ = function() {
         switch (D.label) {
           case 0:
             return rx(t = fr(fr({}, vm), t)), n = ih(e), i = n[0], s = n[1], a = pm(t.internalResolution, this.baseModel.outputStride, [i, s]), o = mm(e, a), u = o.resized, c = o.padding, d = Tt(function() {
-              var L = F.predictForMultiPersonInstanceSegmentationAndPart(u), G = L.segmentLogits, j = L.longOffsets, te = L.heatmapScores, W = L.offsets, Q = L.displacementFwd, oe = L.displacementBwd, Ce = L.partHeatmaps, fe = gc(G, [i, s], a, [[c.top, c.bottom], [c.left, c.right]], !0), ne = gc(Ce, [i, s], a, [[c.top, c.bottom], [c.left, c.right]], !0), ae = j, be = hm(Li(fe), t.segmentationThreshold), Te = function(Me) {
+              var L = F.predictForMultiPersonInstanceSegmentationAndPart(u), G = L.segmentLogits, j = L.longOffsets, te = L.heatmapScores, W = L.offsets, Q = L.displacementFwd, oe = L.displacementBwd, Ce = L.partHeatmaps, fe = mc(G, [i, s], a, [[c.top, c.bottom], [c.left, c.right]], !0), ne = mc(Ce, [i, s], a, [[c.top, c.bottom], [c.left, c.right]], !0), ae = j, be = hm(Li(fe), t.segmentationThreshold), Te = function(Me) {
                 var ot = Me.shape, Ve = ot[0], q = ot[1], ue = ot[2];
                 return Tt(function() {
                   var Le = I$(Me), mt = $r(Cl(0, ue, 1, "int32"), 1), Oe = Qt(en(Le, mt), "int32");
@@ -70780,9 +70780,9 @@ function Uce(r, e, t) {
     var w, x, E = b / T, I = m.height / m.width, R = 0, P = 0;
     return E > I ? (w = m.width, x = m.width * E, P = (1 - I / E) / 2) : (w = m.height / E, x = m.height, R = (1 - E / I) / 2), m.width = w, m.height = x, { top: P, left: R, right: R, bottom: P };
   }(u, n, i), d = Mce(u, o.width, o.height, !1), p = Tt(function() {
-    var m, _ = (m = r) instanceof nn ? m : L0(m), y = Cu(function(w, x, E) {
+    var m, _ = (m = r) instanceof nn ? m : L0(m), y = wu(function(w, x, E) {
       return nv(E, "inputResolution"), [1 / E.width * w[0][0] * x.width, 1 / E.height * w[0][1] * x.width, w[0][3] * x.width, 1 / E.width * w[1][0] * x.height, 1 / E.height * w[1][1] * x.height, w[1][3] * x.height, 0, 0];
-    }(d, o, n), [1, 8]), b = s === "zero" ? "constant" : "nearest", T = $u.transform($r(Qt(_, "float32")), y, "bilinear", b, 0, [n.height, n.width]);
+    }(d, o, n), [1, 8]), b = s === "zero" ? "constant" : "nearest", T = Ou.transform($r(Qt(_, "float32")), y, "bilinear", b, 0, [n.height, n.width]);
     return a != null ? Lce(T, a) : T;
   });
   return { imageTensor: p, padding: c, transformationMatrix: d };
@@ -70803,7 +70803,7 @@ function Bce(r, e, t) {
         default:
           throw new Error("Activation not supported (" + e.activation + ")");
       }
-      var a = t ? $u.resizeBilinear(s, [t.height, t.width]) : s;
+      var a = t ? Ou.resizeBilinear(s, [t.height, t.width]) : s;
       return Li(a, [2]);
     }
     throw new Error("Unsupported number of tensor channels " + i);
@@ -70852,7 +70852,7 @@ var Mh, jce = function() {
           var o = fr({}, a);
           return o.flipHorizontal == null && (o.flipHorizontal = lx.flipHorizontal), o;
         }(t), e == null ? (this.reset(), [2, []]) : (n = Tt(function() {
-          var a = Uce(e, i.modelType === "general" ? Hce : Vce).imageTensor, o = cn(i.model.predict(a), [0, 0, 0, 1], -1), u = L$(e), c = Bce(o, Gce, u), d = $r(c, 2), p = Gu(d, [[0, 0], [0, 0], [0, 1]]);
+          var a = Uce(e, i.modelType === "general" ? Hce : Vce).imageTensor, o = cn(i.model.predict(a), [0, 0, 0, 1], -1), u = L$(e), c = Bce(o, Gce, u), d = $r(c, 2), p = Vu(d, [[0, 0], [0, 0], [0, 1]]);
           return hS(p, [[0, 0], [0, 0], [0, 2]], "symmetric");
         }), [2, [{ maskValueToLabel: zce, mask: new Wce(n) }]]);
       });
@@ -71856,10 +71856,10 @@ class Cg extends Ds.EventEmitter {
     });
   }
   startAudio() {
-    fa.toggleAudioMute(this.stream), this.enableAudio(!0), this.isAudioOn = !0;
+    fa.toggleAudioMute(this.stream), this._toggleMuteAudio(!1), this.enableAudio(!0), this.isAudioOn = !0;
   }
   stopAudio() {
-    fa.toggleAudioMute(this.stream), this.enableAudio(!1), this.isAudioOn = !1;
+    fa.toggleAudioMute(this.stream), this._toggleMuteAudio(!0), this.enableAudio(!1), this.isAudioOn = !1;
   }
   enableVideo(e) {
     const t = {
@@ -71886,10 +71886,10 @@ class Cg extends Ds.EventEmitter {
     });
   }
   startVideo() {
-    fa.toggleVideoMute(this.stream), this.enableVideo(!0), this.isVideoOn = !0;
+    fa.toggleVideoMute(this.stream), this._toggleMuteVideo(!1), this.enableVideo(!0), this.isVideoOn = !0;
   }
   stopVideo() {
-    fa.toggleVideoMute(this.stream), this.enableVideo(!1), this.isVideoOn = !1;
+    fa.toggleVideoMute(this.stream), this._toggleMuteVideo(!0), this.enableVideo(!1), this.isVideoOn = !1;
   }
   sendStateMessage(e) {
     const t = {
@@ -73403,7 +73403,7 @@ class Cg extends Ds.EventEmitter {
     });
   }
 }
-class _c {
+class gc {
   constructor(e) {
     if (this.headers = {}, e.length > 0) {
       let t = !1;
@@ -73508,7 +73508,7 @@ class av extends Ds.EventEmitter {
     };
   }
   _sendKeepAlive() {
-    const e = new _c("");
+    const e = new gc("");
     e.method = "SEND", e.addHeader("To-Path", `${this.my_addr[1]}`), e.addHeader("From-Path", `${this.my_addr[0]}`), e.addHeader("Message-ID", Yt.createRandomToken(10)), this._connection.send(e.toString());
   }
   answer() {
@@ -73610,7 +73610,7 @@ a=path:${e.getHeader("Use-Path")} msrp://${this._ua._configuration.authorization
   }
   authenticate(e) {
     this.status = "auth";
-    let t = new _c("");
+    let t = new gc("");
     t.method = "AUTH", t.addHeader("To-Path", `msrp://${this._ua._configuration.realm}:2856;ws`), t.addHeader(
       "From-Path",
       `msrp://${this.credentials.username}.${this.credentials.realm}:2856/${this.auth_id};ws`
@@ -73624,7 +73624,7 @@ a=path:${e.getHeader("Use-Path")} msrp://${this._ua._configuration.authorization
   }
   onmessage(e) {
     console.log("onmessage", e);
-    const t = new _c(e.data);
+    const t = new gc(e.data);
     if (this.status === "auth" && t.code === 401) {
       const n = this.parseAuth(t.getHeader("WWW-Authenticate")), i = new V6(this.credentials);
       i.authenticate({
@@ -73732,7 +73732,7 @@ a=path:${e.getHeader("Use-Path")} msrp://${this._ua._configuration.authorization
       }
   }
   sendMSRP(e) {
-    const t = new _c("");
+    const t = new gc("");
     t.method = "SEND", t.addHeader("To-Path", `${this.my_addr[1]} ${this.target_addr[1]} ${this.target_addr[0]}`), t.addHeader("From-Path", `${this.my_addr[0]}`), t.addHeader("Message-ID", Yt.createRandomToken(10)), t.addHeader("Byte-Range", "1-25/25"), t.addHeader("Content-Type", "text/plain"), t.addHeader("Success-Report", "yes"), t.addHeader("Failure-Report", "yes"), t.body = e;
     let n = t.toString();
     console.log(n);
@@ -73742,7 +73742,7 @@ a=path:${e.getHeader("Use-Path")} msrp://${this._ua._configuration.authorization
     console.log(i), this._connection.send(t.toString()), t.direction = "outgoing", this.emit("newMessage", t), this._msgHistory.push(t), this.emit("msgHistoryUpdate", this._msgHistory);
   }
   _sendOk(e) {
-    let t = e.ident, n = e.getHeader("Message-ID"), i = new _c("");
+    let t = e.ident, n = e.getHeader("Message-ID"), i = new gc("");
     i.method = "200 OK", i.addHeader("To-Path", `${this.my_addr[1]}`), i.addHeader("From-Path", `${this.my_addr[0]}`), i.addHeader("Message-ID", n), i.ident = t;
     let s = i.toString();
     console.log(s);
@@ -73752,7 +73752,7 @@ a=path:${e.getHeader("Use-Path")} msrp://${this._ua._configuration.authorization
     console.log(a), this._connection.send(i.toString());
   }
   _sendReport(e) {
-    let t = e.ident, n = e.getHeader("Message-ID"), i = new _c("");
+    let t = e.ident, n = e.getHeader("Message-ID"), i = new gc("");
     i.method = "REPORT", i.addHeader("To-Path", `${e.getHeader("From-Path")}`), i.addHeader("From-Path", `${this.my_addr[0]}`), i.addHeader("Message-ID", n), i.addHeader("Byte-Range", "1-25/25"), i.addHeader("Status", "000 200 OK"), i.ident = t;
     let s = i.toString();
     console.log(s);
@@ -73975,7 +73975,7 @@ const Rb = /* @__PURE__ */ yn(pde), Tm = new Pg("Parser"), mde = (r, e) => {
     Tm.warn(`parseMessage() | error parsing first line of SIP message: "${s}"`);
     return;
   } else
-    a.status_code ? (t = new pu.IncomingResponse(), t.status_code = a.status_code, t.reason_phrase = a.reason_phrase) : (t = new pu.IncomingRequest(e), t.method = a.method, t.ruri = a.uri);
+    a.status_code ? (t = new Ac.IncomingResponse(), t.status_code = a.status_code, t.reason_phrase = a.reason_phrase) : (t = new Ac.IncomingRequest(e), t.method = a.method, t.ruri = a.uri);
   t.data = r;
   let o = i + 2;
   for (; ; ) {
@@ -74055,7 +74055,7 @@ function _de(r, e, t, n) {
       r.setHeader("content-type", o), i = r.parseHeader("content-type");
       break;
     case "cseq":
-      r.setHeader("cseq", o), i = r.parseHeader("cseq"), i && (r.cseq = i.value), r instanceof pu.IncomingResponse && (r.method = i.method);
+      r.setHeader("cseq", o), i = r.parseHeader("cseq"), i && (r.cseq = i.value), r instanceof Ac.IncomingResponse && (r.method = i.method);
       break;
     case "max-forwards":
       r.setHeader("max-forwards", o), i = r.parseHeader("max-forwards");
@@ -74585,14 +74585,13 @@ function Cde(r) {
   this.emit("disconnected", r), this._registrator.onTransportClosed(), this._status !== _l.STATUS_USER_CLOSED && (this._status = _l.STATUS_NOT_READY, this._error = _l.NETWORK_ERROR);
 }
 function Ede(r) {
-  console.log("onTransportData", r);
   const e = r.transport;
   let t = r.message;
   if (t = yde.parseMessage(t, this), !t) {
     console.log("if 1 return");
     return;
   }
-  if (this._status === _l.STATUS_USER_CLOSED && t instanceof pu.IncomingRequest) {
+  if (this._status === _l.STATUS_USER_CLOSED && t instanceof Ac.IncomingRequest) {
     console.log("if 2 return");
     return;
   }
@@ -74600,9 +74599,9 @@ function Ede(r) {
     console.log("if 3 return");
     return;
   }
-  if (console.log("onTransportData message", t), console.log("onTransportData instanceof", t instanceof pu.IncomingRequest), t instanceof pu.IncomingRequest)
-    t.transport = e, console.log("onTransportData receiveRequest"), this.receiveRequest(t);
-  else if (t instanceof pu.IncomingResponse) {
+  if (t instanceof Ac.IncomingRequest)
+    t.transport = e, this.receiveRequest(t);
+  else if (t instanceof Ac.IncomingResponse) {
     let n;
     switch (t.method) {
       case $t.INVITE:
@@ -77006,11 +77005,11 @@ vp.Factory.backCompat(Et, {
   setRotationDeg: "setRotation",
   getRotationDeg: "getRotation"
 });
-var Xu = {};
-Object.defineProperty(Xu, "__esModule", { value: !0 });
-Xu.Container = void 0;
+var Ku = {};
+Object.defineProperty(Ku, "__esModule", { value: !0 });
+Ku.Container = void 0;
 const hd = Ft, ov = Ln, ny = Ct;
-class Yu extends ov.Node {
+class Xu extends ov.Node {
   constructor() {
     super(...arguments), this.children = [];
   }
@@ -77201,18 +77200,18 @@ class Yu extends ov.Node {
     }, n ? c : this._transformedRect(c, i);
   }
 }
-Xu.Container = Yu;
-hd.Factory.addComponentsGetterSetter(Yu, "clip", [
+Ku.Container = Xu;
+hd.Factory.addComponentsGetterSetter(Xu, "clip", [
   "x",
   "y",
   "width",
   "height"
 ]);
-hd.Factory.addGetterSetter(Yu, "clipX", void 0, (0, ny.getNumberValidator)());
-hd.Factory.addGetterSetter(Yu, "clipY", void 0, (0, ny.getNumberValidator)());
-hd.Factory.addGetterSetter(Yu, "clipWidth", void 0, (0, ny.getNumberValidator)());
-hd.Factory.addGetterSetter(Yu, "clipHeight", void 0, (0, ny.getNumberValidator)());
-hd.Factory.addGetterSetter(Yu, "clipFunc");
+hd.Factory.addGetterSetter(Xu, "clipX", void 0, (0, ny.getNumberValidator)());
+hd.Factory.addGetterSetter(Xu, "clipY", void 0, (0, ny.getNumberValidator)());
+hd.Factory.addGetterSetter(Xu, "clipWidth", void 0, (0, ny.getNumberValidator)());
+hd.Factory.addGetterSetter(Xu, "clipHeight", void 0, (0, ny.getNumberValidator)());
+hd.Factory.addGetterSetter(Xu, "clipFunc");
 var X$ = {}, Bl = {};
 Object.defineProperty(Bl, "__esModule", { value: !0 });
 Bl.getCapturedShape = hhe;
@@ -77245,7 +77244,7 @@ function J$(r, e) {
 }
 (function(r) {
   Object.defineProperty(r, "__esModule", { value: !0 }), r.Stage = r.stages = void 0;
-  const e = Gn, t = Ft, n = Xu, i = Pt, s = ga, a = ty, o = Pt, u = Bl, c = "Stage", d = "string", p = "px", m = "mouseout", _ = "mouseleave", y = "mouseover", b = "mouseenter", T = "mousemove", w = "mousedown", x = "mouseup", E = "pointermove", I = "pointerdown", R = "pointerup", P = "pointercancel", B = "lostpointercapture", O = "pointerout", F = "pointerleave", D = "pointerover", L = "pointerenter", G = "contextmenu", j = "touchstart", te = "touchend", W = "touchmove", Q = "touchcancel", oe = "wheel", Ce = 5, fe = [
+  const e = Gn, t = Ft, n = Ku, i = Pt, s = ga, a = ty, o = Pt, u = Bl, c = "Stage", d = "string", p = "px", m = "mouseout", _ = "mouseleave", y = "mouseover", b = "mouseenter", T = "mousemove", w = "mousedown", x = "mouseup", E = "pointermove", I = "pointerdown", R = "pointerup", P = "pointercancel", B = "lostpointercapture", O = "pointerout", F = "pointerleave", D = "pointerover", L = "pointerenter", G = "contextmenu", j = "touchstart", te = "touchend", W = "touchmove", Q = "touchcancel", oe = "wheel", Ce = 5, fe = [
     [b, "_pointerenter"],
     [w, "_pointerdown"],
     [T, "_pointermove"],
@@ -77971,7 +77970,7 @@ var bp = {}, ws = {};
 })(ws);
 Object.defineProperty(bp, "__esModule", { value: !0 });
 bp.Layer = void 0;
-const ho = Gn, lv = Xu, yc = Ln, Lw = Ft, wx = ga, mhe = Ct, ghe = ws, _he = Pt, yhe = "#", vhe = "beforeDraw", bhe = "draw", Q$ = [
+const ho = Gn, lv = Ku, _c = Ln, Lw = Ft, wx = ga, mhe = Ct, ghe = ws, _he = Pt, yhe = "#", vhe = "beforeDraw", bhe = "draw", Q$ = [
   { x: 0, y: 0 },
   { x: -1, y: -1 },
   { x: 1, y: -1 },
@@ -78008,18 +78007,18 @@ class fd extends lv.Container {
     return t && t.content && (t.content.removeChild(this.getNativeCanvasElement()), e < t.children.length - 1 ? t.content.insertBefore(this.getNativeCanvasElement(), t.children[e + 1].getCanvas()._canvas) : t.content.appendChild(this.getNativeCanvasElement())), this;
   }
   moveToTop() {
-    yc.Node.prototype.moveToTop.call(this);
+    _c.Node.prototype.moveToTop.call(this);
     const e = this.getStage();
     return e && e.content && (e.content.removeChild(this.getNativeCanvasElement()), e.content.appendChild(this.getNativeCanvasElement())), !0;
   }
   moveUp() {
-    if (!yc.Node.prototype.moveUp.call(this))
+    if (!_c.Node.prototype.moveUp.call(this))
       return !1;
     const t = this.getStage();
     return !t || !t.content ? !1 : (t.content.removeChild(this.getNativeCanvasElement()), this.index < t.children.length - 1 ? t.content.insertBefore(this.getNativeCanvasElement(), t.children[this.index + 1].getCanvas()._canvas) : t.content.appendChild(this.getNativeCanvasElement()), !0);
   }
   moveDown() {
-    if (yc.Node.prototype.moveDown.call(this)) {
+    if (_c.Node.prototype.moveDown.call(this)) {
       const e = this.getStage();
       if (e) {
         const t = e.children;
@@ -78030,7 +78029,7 @@ class fd extends lv.Container {
     return !1;
   }
   moveToBottom() {
-    if (yc.Node.prototype.moveToBottom.call(this)) {
+    if (_c.Node.prototype.moveToBottom.call(this)) {
       const e = this.getStage();
       if (e) {
         const t = e.children;
@@ -78045,7 +78044,7 @@ class fd extends lv.Container {
   }
   remove() {
     const e = this.getNativeCanvasElement();
-    return yc.Node.prototype.remove.call(this), e && e.parentNode && ho.Util._isInDocument(e) && e.parentNode.removeChild(e), this;
+    return _c.Node.prototype.remove.call(this), e && e.parentNode && ho.Util._isInDocument(e) && e.parentNode.removeChild(e), this;
   }
   getStage() {
     return this.parent;
@@ -78058,7 +78057,7 @@ class fd extends lv.Container {
     t !== "Group" && t !== "Shape" && ho.Util.throw("You may only add groups and shapes to a layer.");
   }
   _toKonvaCanvas(e) {
-    return e = e || {}, e.width = e.width || this.getWidth(), e.height = e.height || this.getHeight(), e.x = e.x !== void 0 ? e.x : this.x(), e.y = e.y !== void 0 ? e.y : this.y(), yc.Node.prototype._toKonvaCanvas.call(this, e);
+    return e = e || {}, e.width = e.width || this.getWidth(), e.height = e.height || this.getHeight(), e.x = e.x !== void 0 ? e.x : this.x(), e.y = e.y !== void 0 ? e.y : this.y(), _c.Node.prototype._toKonvaCanvas.call(this, e);
   }
   _checkVisibility() {
     this.visible() ? this.canvas._canvas.style.display = "block" : this.canvas._canvas.style.display = "none";
@@ -78176,7 +78175,7 @@ Uw.prototype.nodeType = "FastLayer";
 var pd = {};
 Object.defineProperty(pd, "__esModule", { value: !0 });
 pd.Group = void 0;
-const Ehe = Gn, xhe = Xu, Ihe = Pt;
+const Ehe = Gn, xhe = Ku, Ihe = Pt;
 class Bw extends xhe.Container {
   _validateAdd(e) {
     const t = e.getType();
@@ -78502,7 +78501,7 @@ var Z$ = {};
 })(Z$);
 (function(r) {
   Object.defineProperty(r, "__esModule", { value: !0 }), r.Konva = void 0;
-  const e = Pt, t = Gn, n = Ln, i = Xu, s = X$, a = bp, o = sy, u = pd, c = ty, d = ws, p = md, m = Z$, _ = Co, y = ga;
+  const e = Pt, t = Gn, n = Ln, i = Ku, s = X$, a = bp, o = sy, u = pd, c = ty, d = ws, p = md, m = Z$, _ = Co, y = ga;
   r.Konva = t.Util._assign(e.Konva, {
     Util: t.Util,
     Transform: t.Transform,
@@ -79416,7 +79415,7 @@ var gd = {}, t4 = {};
 })(t4);
 Object.defineProperty(gd, "__esModule", { value: !0 });
 gd.Path = void 0;
-const Ohe = Ft, $he = ws, Dhe = Pt, vc = t4;
+const Ohe = Ft, $he = ws, Dhe = Pt, yc = t4;
 class vs extends $he.Shape {
   constructor(e) {
     super(e), this.dataArray = [], this.pathLength = 0, this._readDataAttribute(), this.on("dataChange.konva", function() {
@@ -79526,9 +79525,9 @@ class vs extends $he.Shape {
       case "L":
         return vs.getPointOnLine(e, a.start.x, a.start.y, o[0], o[1]);
       case "C":
-        return vs.getPointOnCubicBezier((0, vc.t2length)(e, vs.getPathLength(t), (b) => (0, vc.getCubicArcLength)([a.start.x, o[0], o[2], o[4]], [a.start.y, o[1], o[3], o[5]], b)), a.start.x, a.start.y, o[0], o[1], o[2], o[3], o[4], o[5]);
+        return vs.getPointOnCubicBezier((0, yc.t2length)(e, vs.getPathLength(t), (b) => (0, yc.getCubicArcLength)([a.start.x, o[0], o[2], o[4]], [a.start.y, o[1], o[3], o[5]], b)), a.start.x, a.start.y, o[0], o[1], o[2], o[3], o[4], o[5]);
       case "Q":
-        return vs.getPointOnQuadraticBezier((0, vc.t2length)(e, vs.getPathLength(t), (b) => (0, vc.getQuadraticArcLength)([a.start.x, o[0], o[2]], [a.start.y, o[1], o[3]], b)), a.start.x, a.start.y, o[0], o[1], o[2], o[3]);
+        return vs.getPointOnQuadraticBezier((0, yc.t2length)(e, vs.getPathLength(t), (b) => (0, yc.getQuadraticArcLength)([a.start.x, o[0], o[2]], [a.start.y, o[1], o[3]], b)), a.start.x, a.start.y, o[0], o[1], o[2], o[3]);
       case "A":
         var u = o[0], c = o[1], d = o[2], p = o[3], m = o[4], _ = o[5], y = o[6];
         return m += _ * e / a.pathLength, vs.getPointOnEllipticalArc(u, c, d, p, m, y);
@@ -79733,9 +79732,9 @@ class vs extends $he.Shape {
       case "L":
         return c.getLineLength(e, t, i[0], i[1]);
       case "C":
-        return (0, vc.getCubicArcLength)([e, i[0], i[2], i[4]], [t, i[1], i[3], i[5]], 1);
+        return (0, yc.getCubicArcLength)([e, i[0], i[2], i[4]], [t, i[1], i[3], i[5]], 1);
       case "Q":
-        return (0, vc.getQuadraticArcLength)([e, i[0], i[2]], [t, i[1], i[3]], 1);
+        return (0, yc.getQuadraticArcLength)([e, i[0], i[2]], [t, i[1], i[3]], 1);
       case "A":
         s = 0;
         var d = i[4], p = i[5], m = i[4] + p, _ = Math.PI / 180;
@@ -79773,7 +79772,7 @@ Ohe.Factory.addGetterSetter(vs, "data");
 Object.defineProperty(oy, "__esModule", { value: !0 });
 oy.Arrow = void 0;
 const uy = Ft, Phe = Tp, n4 = Ct, Fhe = Pt, Ix = gd;
-class Ju extends Phe.Line {
+class Yu extends Phe.Line {
   _sceneFunc(e) {
     super._sceneFunc(e);
     const t = Math.PI * 2, n = this.points();
@@ -79811,13 +79810,13 @@ class Ju extends Phe.Line {
     };
   }
 }
-oy.Arrow = Ju;
-Ju.prototype.className = "Arrow";
-(0, Fhe._registerNode)(Ju);
-uy.Factory.addGetterSetter(Ju, "pointerLength", 10, (0, n4.getNumberValidator)());
-uy.Factory.addGetterSetter(Ju, "pointerWidth", 10, (0, n4.getNumberValidator)());
-uy.Factory.addGetterSetter(Ju, "pointerAtBeginning", !1);
-uy.Factory.addGetterSetter(Ju, "pointerAtEnding", !0);
+oy.Arrow = Yu;
+Yu.prototype.className = "Arrow";
+(0, Fhe._registerNode)(Yu);
+uy.Factory.addGetterSetter(Yu, "pointerLength", 10, (0, n4.getNumberValidator)());
+uy.Factory.addGetterSetter(Yu, "pointerWidth", 10, (0, n4.getNumberValidator)());
+uy.Factory.addGetterSetter(Yu, "pointerAtBeginning", !1);
+uy.Factory.addGetterSetter(Yu, "pointerAtEnding", !0);
 var cy = {};
 Object.defineProperty(cy, "__esModule", { value: !0 });
 cy.Circle = void 0;
@@ -79878,7 +79877,7 @@ Hw.Factory.addGetterSetter(Vl, "radiusY", 0, (0, s4.getNumberValidator)());
 var hy = {};
 Object.defineProperty(hy, "__esModule", { value: !0 });
 hy.Image = void 0;
-const dv = Gn, Qu = Ft, Ghe = ws, Whe = Pt, Sp = Ct;
+const dv = Gn, Ju = Ft, Ghe = ws, Whe = Pt, Sp = Ct;
 let za = class r4 extends Ghe.Shape {
   constructor(e) {
     super(e), this.on("imageChange.konva", () => {
@@ -79939,13 +79938,13 @@ let za = class r4 extends Ghe.Shape {
 hy.Image = za;
 za.prototype.className = "Image";
 (0, Whe._registerNode)(za);
-Qu.Factory.addGetterSetter(za, "cornerRadius", 0, (0, Sp.getNumberOrArrayOfNumbersValidator)(4));
-Qu.Factory.addGetterSetter(za, "image");
-Qu.Factory.addComponentsGetterSetter(za, "crop", ["x", "y", "width", "height"]);
-Qu.Factory.addGetterSetter(za, "cropX", 0, (0, Sp.getNumberValidator)());
-Qu.Factory.addGetterSetter(za, "cropY", 0, (0, Sp.getNumberValidator)());
-Qu.Factory.addGetterSetter(za, "cropWidth", 0, (0, Sp.getNumberValidator)());
-Qu.Factory.addGetterSetter(za, "cropHeight", 0, (0, Sp.getNumberValidator)());
+Ju.Factory.addGetterSetter(za, "cornerRadius", 0, (0, Sp.getNumberOrArrayOfNumbersValidator)(4));
+Ju.Factory.addGetterSetter(za, "image");
+Ju.Factory.addComponentsGetterSetter(za, "crop", ["x", "y", "width", "height"]);
+Ju.Factory.addGetterSetter(za, "cropX", 0, (0, Sp.getNumberValidator)());
+Ju.Factory.addGetterSetter(za, "cropY", 0, (0, Sp.getNumberValidator)());
+Ju.Factory.addGetterSetter(za, "cropWidth", 0, (0, Sp.getNumberValidator)());
+Ju.Factory.addGetterSetter(za, "cropHeight", 0, (0, Sp.getNumberValidator)());
 var Kc = {};
 Object.defineProperty(Kc, "__esModule", { value: !0 });
 Kc.Tag = Kc.Label = void 0;
@@ -80020,7 +80019,7 @@ class Gw extends jhe.Group {
 Kc.Label = Gw;
 Gw.prototype.className = "Label";
 (0, i4._registerNode)(Gw);
-class Zu extends zhe.Shape {
+class Qu extends zhe.Shape {
   _sceneFunc(e) {
     const t = this.width(), n = this.height(), i = this.pointerDirection(), s = this.pointerWidth(), a = this.pointerHeight(), o = this.cornerRadius();
     let u = 0, c = 0, d = 0, p = 0;
@@ -80036,13 +80035,13 @@ class Zu extends zhe.Shape {
     };
   }
 }
-Kc.Tag = Zu;
-Zu.prototype.className = "Tag";
-(0, i4._registerNode)(Zu);
-fy.Factory.addGetterSetter(Zu, "pointerDirection", Khe);
-fy.Factory.addGetterSetter(Zu, "pointerWidth", 0, (0, Vw.getNumberValidator)());
-fy.Factory.addGetterSetter(Zu, "pointerHeight", 0, (0, Vw.getNumberValidator)());
-fy.Factory.addGetterSetter(Zu, "cornerRadius", 0, (0, Vw.getNumberOrArrayOfNumbersValidator)(4));
+Kc.Tag = Qu;
+Qu.prototype.className = "Tag";
+(0, i4._registerNode)(Qu);
+fy.Factory.addGetterSetter(Qu, "pointerDirection", Khe);
+fy.Factory.addGetterSetter(Qu, "pointerWidth", 0, (0, Vw.getNumberValidator)());
+fy.Factory.addGetterSetter(Qu, "pointerHeight", 0, (0, Vw.getNumberValidator)());
+fy.Factory.addGetterSetter(Qu, "cornerRadius", 0, (0, Vw.getNumberOrArrayOfNumbersValidator)(4));
 var wp = {};
 Object.defineProperty(wp, "__esModule", { value: !0 });
 wp.Rect = void 0;
@@ -80061,7 +80060,7 @@ var my = {};
 Object.defineProperty(my, "__esModule", { value: !0 });
 my.RegularPolygon = void 0;
 const o4 = Ft, tfe = ws, l4 = Ct, nfe = Pt;
-class ec extends tfe.Shape {
+class Zu extends tfe.Shape {
   _sceneFunc(e) {
     const t = this._getPoints();
     e.beginPath(), e.moveTo(t[0].x, t[0].y);
@@ -80103,18 +80102,18 @@ class ec extends tfe.Shape {
     this.radius(e / 2);
   }
 }
-my.RegularPolygon = ec;
-ec.prototype.className = "RegularPolygon";
-ec.prototype._centroid = !0;
-ec.prototype._attrsAffectingSize = ["radius"];
-(0, nfe._registerNode)(ec);
-o4.Factory.addGetterSetter(ec, "radius", 0, (0, l4.getNumberValidator)());
-o4.Factory.addGetterSetter(ec, "sides", 0, (0, l4.getNumberValidator)());
+my.RegularPolygon = Zu;
+Zu.prototype.className = "RegularPolygon";
+Zu.prototype._centroid = !0;
+Zu.prototype._attrsAffectingSize = ["radius"];
+(0, nfe._registerNode)(Zu);
+o4.Factory.addGetterSetter(Zu, "radius", 0, (0, l4.getNumberValidator)());
+o4.Factory.addGetterSetter(Zu, "sides", 0, (0, l4.getNumberValidator)());
 var gy = {};
 Object.defineProperty(gy, "__esModule", { value: !0 });
 gy.Ring = void 0;
 const u4 = Ft, sfe = ws, c4 = Ct, rfe = Pt, Ax = Math.PI * 2;
-class tc extends sfe.Shape {
+class ec extends sfe.Shape {
   _sceneFunc(e) {
     e.beginPath(), e.arc(0, 0, this.innerRadius(), 0, Ax, !1), e.moveTo(this.outerRadius(), 0), e.arc(0, 0, this.outerRadius(), Ax, 0, !0), e.closePath(), e.fillStrokeShape(this);
   }
@@ -80131,17 +80130,17 @@ class tc extends sfe.Shape {
     this.outerRadius(e / 2);
   }
 }
-gy.Ring = tc;
-tc.prototype.className = "Ring";
-tc.prototype._centroid = !0;
-tc.prototype._attrsAffectingSize = ["innerRadius", "outerRadius"];
-(0, rfe._registerNode)(tc);
-u4.Factory.addGetterSetter(tc, "innerRadius", 0, (0, c4.getNumberValidator)());
-u4.Factory.addGetterSetter(tc, "outerRadius", 0, (0, c4.getNumberValidator)());
+gy.Ring = ec;
+ec.prototype.className = "Ring";
+ec.prototype._centroid = !0;
+ec.prototype._attrsAffectingSize = ["innerRadius", "outerRadius"];
+(0, rfe._registerNode)(ec);
+u4.Factory.addGetterSetter(ec, "innerRadius", 0, (0, c4.getNumberValidator)());
+u4.Factory.addGetterSetter(ec, "outerRadius", 0, (0, c4.getNumberValidator)());
 var _y = {};
 Object.defineProperty(_y, "__esModule", { value: !0 });
 _y.Sprite = void 0;
-const nc = Ft, ife = ws, afe = md, d4 = Ct, ofe = Pt;
+const tc = Ft, ife = ws, afe = md, d4 = Ct, ofe = Pt;
 class ja extends ife.Shape {
   constructor(e) {
     super(e), this._updated = !0, this.anim = new afe.Animation(() => {
@@ -80202,13 +80201,13 @@ class ja extends ife.Shape {
 _y.Sprite = ja;
 ja.prototype.className = "Sprite";
 (0, ofe._registerNode)(ja);
-nc.Factory.addGetterSetter(ja, "animation");
-nc.Factory.addGetterSetter(ja, "animations");
-nc.Factory.addGetterSetter(ja, "frameOffsets");
-nc.Factory.addGetterSetter(ja, "image");
-nc.Factory.addGetterSetter(ja, "frameIndex", 0, (0, d4.getNumberValidator)());
-nc.Factory.addGetterSetter(ja, "frameRate", 17, (0, d4.getNumberValidator)());
-nc.Factory.backCompat(ja, {
+tc.Factory.addGetterSetter(ja, "animation");
+tc.Factory.addGetterSetter(ja, "animations");
+tc.Factory.addGetterSetter(ja, "frameOffsets");
+tc.Factory.addGetterSetter(ja, "image");
+tc.Factory.addGetterSetter(ja, "frameIndex", 0, (0, d4.getNumberValidator)());
+tc.Factory.addGetterSetter(ja, "frameRate", 17, (0, d4.getNumberValidator)());
+tc.Factory.backCompat(ja, {
   index: "frameIndex",
   getIndex: "getFrameIndex",
   setIndex: "setFrameIndex"
@@ -80256,7 +80255,7 @@ const Mb = Gn, wr = Ft, cfe = ws, hv = Pt, Wl = Ct, dfe = Pt;
 function h4(r) {
   return [...r].reduce((e, t, n, i) => (/\p{Emoji_Modifier_Base}\p{Emoji_Modifier}?(?:\u200D\p{Emoji_Presentation})+/u.test(t) ? e.push(t) : /\p{Regional_Indicator}{2}/u.test(t + (i[n + 1] || "")) ? e.push(t + i[n + 1]) : n > 0 && /\p{Mn}|\p{Me}|\p{Mc}/u.test(t) ? e[e.length - 1] += t : e.push(t), e), []);
 }
-const bc = "auto", hfe = "center", f4 = "inherit", Kd = "justify", ffe = "Change.konva", pfe = "2d", Rx = "-", p4 = "left", mfe = "text", gfe = "Text", _fe = "top", yfe = "bottom", Nx = "middle", m4 = "normal", vfe = "px ", Em = " ", bfe = "right", kx = "rtl", Tfe = "word", Sfe = "char", Ox = "none", fv = "…", g4 = [
+const vc = "auto", hfe = "center", f4 = "inherit", Kd = "justify", ffe = "Change.konva", pfe = "2d", Rx = "-", p4 = "left", mfe = "text", gfe = "Text", _fe = "top", yfe = "bottom", Nx = "middle", m4 = "normal", vfe = "px ", Em = " ", bfe = "right", kx = "rtl", Tfe = "word", Sfe = "char", Ox = "none", fv = "…", g4 = [
   "direction",
   "fontFamily",
   "fontSize",
@@ -80349,10 +80348,10 @@ class Jn extends cfe.Shape {
     return this._setAttr(mfe, t), this;
   }
   getWidth() {
-    return this.attrs.width === bc || this.attrs.width === void 0 ? this.getTextWidth() + this.padding() * 2 : this.attrs.width;
+    return this.attrs.width === vc || this.attrs.width === void 0 ? this.getTextWidth() + this.padding() * 2 : this.attrs.width;
   }
   getHeight() {
-    return this.attrs.height === bc || this.attrs.height === void 0 ? this.fontSize() * this.textArr.length * this.lineHeight() + this.padding() * 2 : this.attrs.height;
+    return this.attrs.height === vc || this.attrs.height === void 0 ? this.fontSize() * this.textArr.length * this.lineHeight() + this.padding() * 2 : this.attrs.height;
   }
   getTextWidth() {
     return this.textWidth;
@@ -80399,7 +80398,7 @@ class Jn extends cfe.Shape {
   }
   _setTextData() {
     let e = this.text().split(`
-`), t = +this.fontSize(), n = 0, i = this.lineHeight() * t, s = this.attrs.width, a = this.attrs.height, o = s !== bc && s !== void 0, u = a !== bc && a !== void 0, c = this.padding(), d = s - c * 2, p = a - c * 2, m = 0, _ = this.wrap(), y = _ !== Ox, b = _ !== Sfe && y, T = this.ellipsis();
+`), t = +this.fontSize(), n = 0, i = this.lineHeight() * t, s = this.attrs.width, a = this.attrs.height, o = s !== vc && s !== void 0, u = a !== vc && a !== void 0, c = this.padding(), d = s - c * 2, p = a - c * 2, m = 0, _ = this.wrap(), y = _ !== Ox, b = _ !== Sfe && y, T = this.ellipsis();
     this.textArr = [], pv().font = this._getContextFont();
     const w = T ? this._getTextWidth(fv) : 0;
     for (let E = 0, I = e.length; E < I; ++E) {
@@ -80436,11 +80435,11 @@ class Jn extends cfe.Shape {
     this.textHeight = t, this.textWidth = n;
   }
   _shouldHandleEllipsis(e) {
-    const t = +this.fontSize(), n = this.lineHeight() * t, i = this.attrs.height, s = i !== bc && i !== void 0, a = this.padding(), o = i - a * 2;
+    const t = +this.fontSize(), n = this.lineHeight() * t, i = this.attrs.height, s = i !== vc && i !== void 0, a = this.padding(), o = i - a * 2;
     return !(this.wrap() !== Ox) || s && e + n > o;
   }
   _tryToAddEllipsisToLastLine() {
-    const e = this.attrs.width, t = e !== bc && e !== void 0, n = this.padding(), i = e - n * 2, s = this.ellipsis(), a = this.textArr[this.textArr.length - 1];
+    const e = this.attrs.width, t = e !== vc && e !== void 0, n = this.padding(), i = e - n * 2, s = this.ellipsis(), a = this.textArr[this.textArr.length - 1];
     !a || !s || (t && (this._getTextWidth(a.text + fv) < i || (a.text = a.text.slice(0, a.text.length - 3))), this.textArr.splice(this.textArr.length - 1, 1), this._addTextLine(a.text + fv));
   }
   getStrokeScaleEnabled() {
@@ -82313,7 +82312,7 @@ Object.defineProperty(Eme, "__esModule", { value: !0 });
 const xme = Q0;
 Fw.exports = xme.Konva;
 var Ime = Fw.exports;
-const Tc = /* @__PURE__ */ yn(Ime), yv = {
+const bc = /* @__PURE__ */ yn(Ime), yv = {
   STROKE_WIDTH: 5,
   STROKE_COLOR: "#f32",
   EMPTY_DRAWER_RECT_COLOR: "#fff"
@@ -82321,7 +82320,7 @@ const Tc = /* @__PURE__ */ yn(Ime), yv = {
 class Ub {
   constructor(e) {
     this.stage = null, this.strokeWidth = yv.STROKE_WIDTH, this.strokeColor = yv.STROKE_COLOR, this.emptyDrawerRectColor = yv.EMPTY_DRAWER_RECT_COLOR, this.emptyDrawerRect = null;
-    const { container: t, width: n, height: i } = e, s = new Tc.Stage({
+    const { container: t, width: n, height: i } = e, s = new bc.Stage({
       container: t,
       width: n,
       height: i
@@ -82336,7 +82335,7 @@ class Ub {
   * @param cameraParam From app `STATE.camera`.
   */
   addLayer() {
-    const e = new Tc.Layer();
+    const e = new bc.Layer();
     return this.stage.add(e), e;
   }
   initFreeDrawing(e) {
@@ -82344,7 +82343,7 @@ class Ub {
     this.stage.on("mousedown touchstart", (i) => {
       t = !0;
       const s = this.stage.getPointerPosition();
-      n = new Tc.Line({
+      n = new bc.Line({
         stroke: this.strokeColor,
         strokeWidth: this.strokeWidth,
         globalCompositeOperation: "source-over",
@@ -82365,7 +82364,7 @@ class Ub {
     });
   }
   addRect(e, t, n) {
-    const i = new Tc.Rect({
+    const i = new bc.Rect({
       width: t,
       height: n,
       fill: this.emptyDrawerRectColor
@@ -82378,7 +82377,7 @@ class Ub {
     let n, i;
     const s = t.width / t.height;
     this.stage.width() < t.width ? (n = this.stage.width(), i = this.stage.width() / s) : (n = t.width, i = t.width / s), console.log("imageWidth", n), console.log("imageHeight", i);
-    const a = new Tc.Image({
+    const a = new bc.Image({
       image: t,
       x: (this.stage.width() - n) / 2,
       //(this.stage.width() - imageObj.width) / 2, // Center horizontally
@@ -82391,7 +82390,7 @@ class Ub {
   }
   // Hack to make the drawings visible after canvas resize
   addWakeupLine(e) {
-    const t = new Tc.Line({
+    const t = new bc.Line({
       stroke: "#ffffff",
       strokeWidth: 1,
       globalCompositeOperation: "source-over",
@@ -82420,13 +82419,13 @@ class Wy extends Dw {
     super("ScreenShareWhiteboard", "screen"), this.imageSrc = null, this.konvaDrawer = null, this.mode = void 0, this.screenSharePlugin = null, this.selectors = {}, this.screenSharePlugin = e, this.selectors = {
       ...Ame,
       ...t.selectors || {}
-    };
+    }, this.selectors.document || (this.selectors.document = document);
   }
   createVideoElement() {
-    const e = document.createElement("video");
+    const e = this.selectors.document.createElement("video");
     e.setAttribute("id", this.selectors.videoElement), e.setAttribute("autoplay", ""), e.style.setProperty("visibility", "hidden"), e.style.setProperty("width", "auto"), e.style.setProperty("height", "auto"), this.video = e;
-    const t = document.createElement("div");
-    t.classList.add(this.selectors.videoElementContainer), t.style.setProperty("display", "none"), t.appendChild(e), this.wrapperEl = t, document.body.appendChild(t);
+    const t = this.selectors.document.createElement("div");
+    t.classList.add(this.selectors.videoElementContainer), t.style.setProperty("display", "none"), t.appendChild(e), this.wrapperEl = t, this.selectors.document.body ? this.selectors.document.body.appendChild(t) : this.selectors.document.appendChild(t);
   }
   getAspectRatioDimensions(e, t) {
     const n = e.getTracks()[0].getSettings(), i = t.clientWidth, s = t.clientHeight, a = n.width, o = n.height, u = a / o, c = i / s;
@@ -82445,9 +82444,9 @@ class Wy extends Dw {
   */
   async start(e) {
     this.createVideoElement(), this.initialStream = e, this.video.srcObject = e;
-    const t = document.getElementById(this.selectors.container);
+    const t = this.selectors.document.getElementById(this.selectors.container);
     t.style.setProperty("position", "relative"), t.style.setProperty("min-width", "100%"), t.style.setProperty("height", "100%"), t.style.setProperty("display", "flex"), t.style.setProperty("justify-content", "center");
-    const n = document.getElementById(this.selectors.compositeCanvasContainer);
+    const n = this.selectors.document.getElementById(this.selectors.compositeCanvasContainer);
     n.style.setProperty("position", "relative"), n.style.setProperty("margin", "auto 0");
     const { width: i, height: s } = this.getAspectRatioDimensions(e, t);
     let a = i, o = s;
@@ -82458,7 +82457,7 @@ class Wy extends Dw {
     });
     const u = this.screenShareKonvaDrawer.addLayer();
     this.screenShareKonvaDrawer.initFreeDrawing(u);
-    const c = document.getElementById(this.selectors.drawerContainer), d = c.querySelector("canvas"), p = c.querySelector(".konvajs-content"), m = document.getElementById(this.selectors.compositeCanvas);
+    const c = this.selectors.document.getElementById(this.selectors.drawerContainer), d = c.querySelector("canvas"), p = c.querySelector(".konvajs-content"), m = this.selectors.document.getElementById(this.selectors.compositeCanvas);
     m.style.setProperty("position", "absolute"), m.style.setProperty("top", "0"), m.style.setProperty("left", "0");
     const _ = m.getContext("2d"), y = () => {
       const { width: w, height: x } = this.getAspectRatioDimensions(e, t);
@@ -82795,7 +82794,7 @@ var I4 = {};
 })(I4);
 const zme = rr, jme = I4;
 var qme = Object.assign(zme, { instanceMethods: jme });
-const yu = new AudioContext(), ua = {
+const _u = new AudioContext(), ua = {
   NEW_CALL: "new_call",
   CALL_CONFIRMED: "confirmed",
   CALL_FAILED: "failed",
@@ -83301,11 +83300,11 @@ const Xme = (r) => {
   t ? yr.debug(Ro(Ao(), r, e), t) : yr.debug(Ro(Ao(), r, e));
 }, bv = (r, e) => {
   yr.info(Ro(Ao(), r, e));
-}, vu = (r, e) => {
+}, yu = (r, e) => {
   yr.info(Ro(Ao(), r, e));
 }, Ym = (r, e) => {
   yr.warn(Ro(Ao(), r, e));
-}, Ic = (r, e) => {
+}, xc = (r, e) => {
   yr.error(Ro(Ao(), r, e));
 };
 function Jme(r) {
@@ -85299,7 +85298,7 @@ class $ge {
     this._callbacks = {
       onreport: null,
       onticket: null
-    }, this._id = uge(), this._moduleName = this._id, this._probeId = t, this._config = e, this._exporter = new mge(e), this._state = go.IDLE, this.registerToPCEvents(), vu(this._moduleName, `new collector created for probe ${this._probeId}`);
+    }, this._id = uge(), this._moduleName = this._id, this._probeId = t, this._config = e, this._exporter = new mge(e), this._state = go.IDLE, this.registerToPCEvents(), yu(this._moduleName, `new collector created for probe ${this._probeId}`);
   }
   analyze(e, t, n, i) {
     const s = (u, c) => u === _e.AUDIO ? c === la.INBOUND_RTP ? { ...R4 } : { ...N4 } : c === la.INBOUND_RTP ? { ...k4 } : { ...O4 }, a = rge(t);
@@ -85381,7 +85380,7 @@ class $ge {
         `got report for probe ${this._probeId}#${this._exporter.getReportsNumber() + 1}`
       ), this.fireOnReport(n), n;
     } catch (e) {
-      return Ic(this._moduleName, `got error ${e}`), null;
+      return xc(this._moduleName, `got error ${e}`), null;
     }
   }
   async start() {
@@ -85404,13 +85403,13 @@ class $ge {
     e in this._callbacks ? (this._callbacks[e] = {
       callback: t,
       context: n
-    }, Jt(this._moduleName, `registered callback '${e}'`)) : Ic(
+    }, Jt(this._moduleName, `registered callback '${e}'`)) : xc(
       this._moduleName,
       `can't register callback for '${e}' - not found`
     );
   }
   unregisterCallback(e) {
-    e in this._callbacks ? (this._callbacks[e] = null, delete this._callbacks[e], Jt(this._moduleName, `unregistered callback '${e}'`)) : Ic(
+    e in this._callbacks ? (this._callbacks[e] = null, delete this._callbacks[e], Jt(this._moduleName, `unregistered callback '${e}'`)) : xc(
       this._moduleName,
       `can't unregister callback for '${e}' - not found`
     );
@@ -85458,7 +85457,7 @@ class $ge {
           "Media Devices state"
         );
       } catch {
-        Ic(this._moduleName, "can't get devices");
+        xc(this._moduleName, "can't get devices");
       }
     }, e) {
       e.oniceconnectionstatechange = () => {
@@ -85522,7 +85521,7 @@ class $ge {
 }
 class Dge {
   constructor(e) {
-    this._id = e.pname && e.pname.substr(0, 12).padEnd(12, " ") || lge(), this._moduleName = this._id, vu(this._moduleName, "probe created"), this._config = e, this._collector = new $ge(this._config, this._id);
+    this._id = e.pname && e.pname.substr(0, 12).padEnd(12, " ") || lge(), this._moduleName = this._id, yu(this._moduleName, "probe created"), this._config = e, this._collector = new $ge(this._config, this._id);
   }
   /**
    * Register a callback to 'onreport'
@@ -85636,7 +85635,7 @@ class Pge {
   constructor(e) {
     this._config = e, this._probes = [], this._startedTime = null, this._callbacks = {
       onresult: null
-    }, vu(dr, `configured for probing every ${this._config.refreshEvery}ms`), vu(dr, `configured for starting after ${this._config.startAfter}ms`), vu(dr, `${!this._config.stopAfter || this._config.stopAfter !== -1 ? `configured for stopped after ${this._config.stopAfter}ms` : "configured for never stopped"}`), Jt(dr, "engine initialized");
+    }, yu(dr, `configured for probing every ${this._config.refreshEvery}ms`), yu(dr, `configured for starting after ${this._config.startAfter}ms`), yu(dr, `${!this._config.stopAfter || this._config.stopAfter !== -1 ? `configured for stopped after ${this._config.stopAfter}ms` : "configured for never stopped"}`), Jt(dr, "engine initialized");
   }
   get probes() {
     return this._probes;
@@ -85685,13 +85684,13 @@ class Pge {
         i.stop(n);
       });
     };
-    vu(dr, "stop collecting"), t(e);
+    yu(dr, "stop collecting"), t(e);
   }
   registerCallback(e, t, n) {
-    e in this._callbacks ? (this._callbacks[e] = { callback: t, context: n }, Jt(dr, `registered callback '${e}'`)) : Ic(dr, `can't register callback for '${e}' - not found`);
+    e in this._callbacks ? (this._callbacks[e] = { callback: t, context: n }, Jt(dr, `registered callback '${e}'`)) : xc(dr, `can't register callback for '${e}' - not found`);
   }
   unregisterCallback(e) {
-    e in this._callbacks ? (this._callbacks[e] = null, delete this._callbacks[e], Jt(this._moduleName, `unregistered callback '${e}'`)) : Ic(this._moduleName, `can't unregister callback for '${e}' - not found`);
+    e in this._callbacks ? (this._callbacks[e] = null, delete this._callbacks[e], Jt(this._moduleName, `unregistered callback '${e}'`)) : xc(this._moduleName, `can't unregister callback for '${e}' - not found`);
   }
   fireOnReports(e) {
     this._callbacks.onresult && e.probes.length > 0 && Hb(this._callbacks.onresult.callback, this._callbacks.onresult.context, e);
@@ -85700,7 +85699,7 @@ class Pge {
 const Fge = "interface   ";
 class Mge {
   constructor(e) {
-    this._config = oge(e), vu(Fge, `welcome to ${this._config.name} version ${this._config.version}`), Xme(this._config.verbose || !1), this._engine = new Pge(this._config);
+    this._config = oge(e), yu(Fge, `welcome to ${this._config.name} version ${this._config.version}`), Xme(this._config.verbose || !1), this._engine = new Pge(this._config);
   }
   /**
    * Change log level manually
@@ -85802,8 +85801,8 @@ class Bge {
   }
   beginCalculation(e, t) {
     this.clearVolumeInterval(t);
-    const n = yu.createAnalyser(), i = yu.createMediaStreamSource(e), s = yu.createScriptProcessor(2048, 1, 1);
-    n.smoothingTimeConstant = 0.8, n.fftSize = 1024, i.connect(n), n.connect(s), s.connect(yu.destination), this.intervals[t] = setInterval(() => {
+    const n = _u.createAnalyser(), i = _u.createMediaStreamSource(e), s = _u.createScriptProcessor(2048, 1, 1);
+    n.smoothingTimeConstant = 0.8, n.fftSize = 1024, i.connect(n), n.connect(s), s.connect(_u.destination), this.intervals[t] = setInterval(() => {
       const a = new Uint8Array(n.frequencyBinCount);
       n.getByteFrequencyData(a);
       let o = 0;
@@ -86239,14 +86238,14 @@ class Vge {
       var a;
       if (n == null)
         return;
-      const i = new MediaStream(), s = yu.createMediaStreamDestination();
+      const i = new MediaStream(), s = _u.createMediaStreamDestination();
       if (n.connection.getReceivers().forEach((o) => {
         t.forEach((u) => {
-          i.addTrack(o.track), o.track.id !== u.id && yu.createMediaStreamSource(new MediaStream([u])).connect(s);
+          i.addTrack(o.track), o.track.id !== u.id && _u.createMediaStreamSource(new MediaStream([u])).connect(s);
         });
       }), e[0].roomId === this.currentActiveRoomId) {
         const o = this.getActiveStream();
-        yu.createMediaStreamSource(o).connect(s);
+        _u.createMediaStreamSource(o).connect(s);
       }
       (a = n.connection) != null && a.getSenders()[0] && (await n.connection.getSenders()[0].replaceTrack(s.stream.getTracks()[0]), this.muteReconfigure(n));
     });