@soederpop/luca 0.1.1 → 0.1.3

package/src/introspection/generated.agi.ts

@@ -1,7 +1,7 @@
 import { setBuildTimeData, setContainerBuildTimeData } from './index.js';
 
 // Auto-generated introspection registry data
-// Generated at: 2026-03-28T06:19:48.333Z
+// Generated at: 2026-04-03T01:24:52.289Z
 
 setBuildTimeData('features.googleDocs', {
   "id": "features.googleDocs",
@@ -12106,6 +12106,303 @@ setBuildTimeData('clients.openai', {
   ]
 });
 
+setBuildTimeData('clients.comfyui', {
+  "id": "clients.comfyui",
+  "description": "ComfyUI client — execute Stable Diffusion workflows via the ComfyUI API. Connects to a ComfyUI instance to queue prompts, track execution via WebSocket or polling, and download generated images. Supports both UI-format and API-format workflows with automatic conversion.",
+  "shortcut": "clients.comfyui",
+  "className": "ComfyUIClient",
+  "methods": {
+    "queuePrompt": {
+      "description": "Queue a prompt (API-format workflow) for execution.",
+      "parameters": {
+        "prompt": {
+          "type": "Record<string, any>",
+          "description": "The API-format workflow object"
+        },
+        "clientId": {
+          "type": "string",
+          "description": "Override the client ID for this request"
+        }
+      },
+      "required": [
+        "prompt"
+      ],
+      "returns": "Promise<{ prompt_id: string; number: number }>",
+      "examples": [
+        {
+          "language": "ts",
+          "code": "const { prompt_id } = await comfy.queuePrompt(apiWorkflow)"
+        }
+      ]
+    },
+    "getQueue": {
+      "description": "Get the current prompt queue status.",
+      "parameters": {},
+      "required": [],
+      "returns": "Promise<{ queue_running: any[]; queue_pending: any[] }>"
+    },
+    "getHistory": {
+      "description": "Get execution history, optionally for a specific prompt.",
+      "parameters": {
+        "promptId": {
+          "type": "string",
+          "description": "If provided, returns history for this prompt only"
+        }
+      },
+      "required": [],
+      "returns": "Promise<Record<string, any>>"
+    },
+    "getSystemStats": {
+      "description": "Get system stats including GPU memory and queue info.",
+      "parameters": {},
+      "required": [],
+      "returns": "Promise<any>"
+    },
+    "getObjectInfo": {
+      "description": "Get node type info with input/output schemas.",
+      "parameters": {
+        "nodeClass": {
+          "type": "string",
+          "description": "If provided, returns info for this node type only"
+        }
+      },
+      "required": [],
+      "returns": "Promise<any>"
+    },
+    "interrupt": {
+      "description": "Interrupt the currently executing prompt.",
+      "parameters": {},
+      "required": [],
+      "returns": "Promise<void>"
+    },
+    "getModels": {
+      "description": "List available models, optionally filtered by type.",
+      "parameters": {
+        "type": {
+          "type": "string",
+          "description": "Model type filter (e.g., 'checkpoints', 'loras')"
+        }
+      },
+      "required": [],
+      "returns": "Promise<string[]>"
+    },
+    "getEmbeddings": {
+      "description": "List available embedding models.",
+      "parameters": {},
+      "required": [],
+      "returns": "Promise<string[]>"
+    },
+    "uploadImage": {
+      "description": "Upload an image to ComfyUI's input directory.",
+      "parameters": {
+        "file": {
+          "type": "Buffer | Blob",
+          "description": "The image data as Buffer or Blob"
+        },
+        "filename": {
+          "type": "string",
+          "description": "File name for the upload"
+        },
+        "opts": {
+          "type": "{ subfolder?: string; type?: string; overwrite?: boolean }",
+          "description": "Upload options (subfolder, type, overwrite)"
+        }
+      },
+      "required": [
+        "file",
+        "filename"
+      ],
+      "returns": "Promise<any>"
+    },
+    "viewImage": {
+      "description": "Download a generated image from ComfyUI as a Buffer.",
+      "parameters": {
+        "filename": {
+          "type": "string",
+          "description": "The image filename"
+        },
+        "subfolder": {
+          "type": "any",
+          "description": "Subfolder within the output directory"
+        },
+        "type": {
+          "type": "any",
+          "description": "Image type ('output', 'input', 'temp')"
+        }
+      },
+      "required": [
+        "filename"
+      ],
+      "returns": "Promise<Buffer>"
+    },
+    "connectWs": {
+      "description": "Open a WebSocket connection to ComfyUI for real-time execution tracking. Events emitted: `execution_start`, `executing`, `progress`, `executed`, `execution_cached`, `execution_error`, `execution_complete`.",
+      "parameters": {},
+      "required": [],
+      "returns": "Promise<void>"
+    },
+    "disconnectWs": {
+      "description": "Close the WebSocket connection.",
+      "parameters": {},
+      "required": [],
+      "returns": "void"
+    },
+    "toApiFormat": {
+      "description": "Convert a UI-format workflow to the API format that /prompt expects. Requires a running ComfyUI instance to fetch `object_info` so we can map positional `widgets_values` to their named input fields. If the workflow is already in API format, it's returned as-is.",
+      "parameters": {
+        "workflow": {
+          "type": "Record<string, any>",
+          "description": "Parameter workflow"
+        }
+      },
+      "required": [
+        "workflow"
+      ],
+      "returns": "Promise<Record<string, any>>"
+    },
+    "runWorkflow": {
+      "description": "Run a ComfyUI workflow with optional runtime input overrides. Inputs can be provided in two forms: **Direct node mapping** (when no `inputMap` in options): ``` { '3': { seed: 42 }, '6': { text: 'a cat' } } ``` **Named inputs** (when `inputMap` is provided in options): ``` inputs: { positive_prompt: 'a cat', seed: 42 } options.inputMap: { positive_prompt: { nodeId: '6', field: 'text' }, seed: { nodeId: '3', field: 'seed' } } ```",
+      "parameters": {
+        "workflow": {
+          "type": "Record<string, any>",
+          "description": "Parameter workflow"
+        },
+        "inputs": {
+          "type": "Record<string, any>",
+          "description": "Parameter inputs"
+        },
+        "options": {
+          "type": "WorkflowRunOptions",
+          "description": "Parameter options",
+          "properties": {
+            "poll": {
+              "type": "boolean",
+              "description": "Use polling instead of WebSocket for tracking execution"
+            },
+            "pollInterval": {
+              "type": "number",
+              "description": "Polling interval in ms (default 1000)"
+            },
+            "inputMap": {
+              "type": "InputMapping",
+              "description": "Named input mapping: semantic name -> { nodeId, field }"
+            },
+            "outputDir": {
+              "type": "string",
+              "description": "If provided, output images are downloaded to this directory"
+            }
+          }
+        }
+      },
+      "required": [
+        "workflow"
+      ],
+      "returns": "Promise<WorkflowResult>"
+    }
+  },
+  "getters": {
+    "clientId": {
+      "description": "The unique client ID used for WebSocket session tracking.",
+      "returns": "string"
+    },
+    "wsURL": {
+      "description": "The WebSocket URL derived from baseURL or overridden via options.",
+      "returns": "string"
+    }
+  },
+  "events": {
+    "execution_start": {
+      "name": "execution_start",
+      "description": "Event emitted by ComfyUIClient",
+      "arguments": {}
+    },
+    "execution_complete": {
+      "name": "execution_complete",
+      "description": "Event emitted by ComfyUIClient",
+      "arguments": {}
+    },
+    "executing": {
+      "name": "executing",
+      "description": "Event emitted by ComfyUIClient",
+      "arguments": {}
+    },
+    "progress": {
+      "name": "progress",
+      "description": "Event emitted by ComfyUIClient",
+      "arguments": {}
+    },
+    "executed": {
+      "name": "executed",
+      "description": "Event emitted by ComfyUIClient",
+      "arguments": {}
+    },
+    "execution_cached": {
+      "name": "execution_cached",
+      "description": "Event emitted by ComfyUIClient",
+      "arguments": {}
+    },
+    "execution_error": {
+      "name": "execution_error",
+      "description": "Event emitted by ComfyUIClient",
+      "arguments": {}
+    }
+  },
+  "state": {},
+  "options": {},
+  "envVars": [],
+  "examples": [
+    {
+      "language": "ts",
+      "code": "const comfy = container.client('comfyui', { baseURL: 'http://localhost:8188' })\nconst result = await comfy.runWorkflow(workflow, {\n '6': { text: 'a beautiful sunset' }\n})\nconsole.log(result.images)"
+    }
+  ],
+  "types": {
+    "WorkflowRunOptions": {
+      "description": "",
+      "properties": {
+        "poll": {
+          "type": "boolean",
+          "description": "Use polling instead of WebSocket for tracking execution",
+          "optional": true
+        },
+        "pollInterval": {
+          "type": "number",
+          "description": "Polling interval in ms (default 1000)",
+          "optional": true
+        },
+        "inputMap": {
+          "type": "InputMapping",
+          "description": "Named input mapping: semantic name -> { nodeId, field }",
+          "optional": true
+        },
+        "outputDir": {
+          "type": "string",
+          "description": "If provided, output images are downloaded to this directory",
+          "optional": true
+        }
+      }
+    },
+    "WorkflowResult": {
+      "description": "",
+      "properties": {
+        "promptId": {
+          "type": "string",
+          "description": ""
+        },
+        "outputs": {
+          "type": "Record<string, any>",
+          "description": ""
+        },
+        "images": {
+          "type": "Array<{ filename: string; subfolder: string; type: string; localPath?: string }>",
+          "description": "",
+          "optional": true
+        }
+      }
+    }
+  }
+});
+
 setBuildTimeData('clients.elevenlabs', {
   "id": "clients.elevenlabs",
   "description": "ElevenLabs client — text-to-speech synthesis via the ElevenLabs REST API. Provides methods for listing voices, listing models, and generating speech audio. Audio is returned as a Buffer; use `say()` for a convenience method that writes to disk.",
@@ -12566,482 +12863,210 @@ setBuildTimeData('clients.supabase', {
   ]
 });
 
-setBuildTimeData('clients.comfyui', {
-  "id": "clients.comfyui",
-  "description": "ComfyUI client — execute Stable Diffusion workflows via the ComfyUI API. Connects to a ComfyUI instance to queue prompts, track execution via WebSocket or polling, and download generated images. Supports both UI-format and API-format workflows with automatic conversion.",
-  "shortcut": "clients.comfyui",
-  "className": "ComfyUIClient",
+setBuildTimeData('servers.mcp', {
+  "id": "servers.mcp",
+  "description": "MCP (Model Context Protocol) server for exposing tools, resources, and prompts to AI clients like Claude Code. Uses the low-level MCP SDK Server class directly with Zod 4 native JSON Schema conversion. Register tools, resources, and prompts programmatically, then start the server over stdio (for CLI integration) or HTTP (for remote access).",
+  "shortcut": "servers.mcp",
+  "className": "MCPServer",
   "methods": {
-    "queuePrompt": {
-      "description": "Queue a prompt (API-format workflow) for execution.",
+    "tool": {
+      "description": "Register an MCP tool. The tool's Zod schema is converted to JSON Schema for the protocol listing, and used for runtime argument validation. Tool handlers can return a string (auto-wrapped as text content) or a full CallToolResult object for advanced responses (images, errors, etc).",
       "parameters": {
-        "prompt": {
-          "type": "Record<string, any>",
-          "description": "The API-format workflow object"
-        },
-        "clientId": {
+        "name": {
           "type": "string",
-          "description": "Override the client ID for this request"
+          "description": "Unique tool name"
+        },
+        "options": {
+          "type": "ToolRegistrationOptions",
+          "description": "Tool schema, description, and handler",
+          "properties": {
+            "schema": {
+              "type": "z.ZodType",
+              "description": ""
+            },
+            "description": {
+              "type": "string",
+              "description": ""
+            },
+            "handler": {
+              "type": "Function | ((args: any, ctx: any) => any)",
+              "description": ""
+            }
+          }
         }
       },
       "required": [
-        "prompt"
+        "name",
+        "options"
       ],
-      "returns": "Promise<{ prompt_id: string; number: number }>",
-      "examples": [
-        {
-          "language": "ts",
-          "code": "const { prompt_id } = await comfy.queuePrompt(apiWorkflow)"
-        }
-      ]
-    },
-    "getQueue": {
-      "description": "Get the current prompt queue status.",
-      "parameters": {},
-      "required": [],
-      "returns": "Promise<{ queue_running: any[]; queue_pending: any[] }>"
+      "returns": "this"
     },
-    "getHistory": {
-      "description": "Get execution history, optionally for a specific prompt.",
+    "resource": {
+      "description": "Register an MCP resource. Resources expose data (files, configs, etc) that AI clients can read by URI. Accepts either a handler function directly or an options object with additional metadata (name, description, mimeType).",
       "parameters": {
-        "promptId": {
+        "uri": {
           "type": "string",
-          "description": "If provided, returns history for this prompt only"
+          "description": "Unique resource URI (e.g. \"project://readme\")"
+        },
+        "handlerOrOptions": {
+          "type": "ResourceRegistrationOptions['handler'] | ResourceRegistrationOptions",
+          "description": "Handler function or options object with handler"
         }
       },
-      "required": [],
-      "returns": "Promise<Record<string, any>>"
-    },
-    "getSystemStats": {
-      "description": "Get system stats including GPU memory and queue info.",
-      "parameters": {},
-      "required": [],
-      "returns": "Promise<any>"
+      "required": [
+        "uri",
+        "handlerOrOptions"
+      ],
+      "returns": "this"
     },
-    "getObjectInfo": {
-      "description": "Get node type info with input/output schemas.",
+    "prompt": {
+      "description": "Register an MCP prompt. Prompts are reusable message templates that AI clients can invoke with optional string arguments.",
       "parameters": {
-        "nodeClass": {
+        "name": {
           "type": "string",
-          "description": "If provided, returns info for this node type only"
+          "description": "Unique prompt name"
+        },
+        "options": {
+          "type": "PromptRegistrationOptions",
+          "description": "Prompt handler, optional args schema, and description",
+          "properties": {
+            "description": {
+              "type": "string",
+              "description": ""
+            },
+            "args": {
+              "type": "Record<string, z.ZodType>",
+              "description": ""
+            },
+            "handler": {
+              "type": "(args: Record<string, string | undefined>, ctx: MCPContext) => Promise<PromptMessage[]> | PromptMessage[]",
+              "description": ""
+            }
+          }
         }
       },
-      "required": [],
-      "returns": "Promise<any>"
+      "required": [
+        "name",
+        "options"
+      ],
+      "returns": "this"
     },
-    "interrupt": {
-      "description": "Interrupt the currently executing prompt.",
+    "configure": {
+      "description": "Configure the MCP protocol server and register all protocol handlers. Called automatically before start() if not already configured.",
       "parameters": {},
       "required": [],
-      "returns": "Promise<void>"
+      "returns": "Promise<this>"
     },
-    "getModels": {
-      "description": "List available models, optionally filtered by type.",
+    "start": {
+      "description": "Start the MCP server with the specified transport.",
       "parameters": {
-        "type": {
-          "type": "string",
-          "description": "Model type filter (e.g., 'checkpoints', 'loras')"
+        "options": {
+          "type": "{\n    transport?: 'stdio' | 'http'\n    port?: number\n    host?: string\n    mcpCompat?: MCPCompatMode\n    stdioCompat?: StdioCompatMode\n  }",
+          "description": "Transport configuration. Defaults to stdio.",
+          "properties": {
+            "transport": {
+              "type": "any",
+              "description": "'stdio' for CLI integration, 'http' for remote access"
+            },
+            "port": {
+              "type": "any",
+              "description": "Port for HTTP transport (default 3001)"
+            }
+          }
         }
       },
       "required": [],
-      "returns": "Promise<string[]>"
+      "returns": "Promise<this>"
     },
-    "getEmbeddings": {
-      "description": "List available embedding models.",
+    "stop": {
+      "description": "Stop the MCP server and close all connections.",
       "parameters": {},
       "required": [],
-      "returns": "Promise<string[]>"
+      "returns": "Promise<this>"
+    }
+  },
+  "getters": {
+    "mcpServer": {
+      "description": "The underlying MCP protocol server instance. Created during configure().",
+      "returns": "MCPProtocolServer"
     },
-    "uploadImage": {
-      "description": "Upload an image to ComfyUI's input directory.",
-      "parameters": {
-        "file": {
-          "type": "Buffer | Blob",
-          "description": "The image data as Buffer or Blob"
+    "handlerContext": {
+      "description": "The handler context passed to all tool, resource, and prompt handlers.",
+      "returns": "MCPContext"
+    }
+  },
+  "events": {
+    "toolRegistered": {
+      "name": "toolRegistered",
+      "description": "Event emitted by MCPServer",
+      "arguments": {}
+    },
+    "resourceRegistered": {
+      "name": "resourceRegistered",
+      "description": "Event emitted by MCPServer",
+      "arguments": {}
+    },
+    "promptRegistered": {
+      "name": "promptRegistered",
+      "description": "Event emitted by MCPServer",
+      "arguments": {}
+    },
+    "toolCalled": {
+      "name": "toolCalled",
+      "description": "Event emitted by MCPServer",
+      "arguments": {}
+    }
+  },
+  "state": {},
+  "options": {},
+  "envVars": [],
+  "examples": [
+    {
+      "language": "ts",
+      "code": "const mcp = container.server('mcp', { serverName: 'my-server', serverVersion: '1.0.0' })\n\nmcp.tool('search_files', {\n schema: z.object({ pattern: z.string() }),\n description: 'Search for files',\n handler: async (args, ctx) => {\n   return ctx.container.feature('fs').walk('.', { include: [args.pattern] }).files.join('\\n')\n }\n})\n\nawait mcp.start()"
+    }
+  ],
+  "types": {
+    "ToolRegistrationOptions": {
+      "description": "",
+      "properties": {
+        "schema": {
+          "type": "z.ZodType",
+          "description": "",
+          "optional": true
         },
-        "filename": {
+        "description": {
           "type": "string",
-          "description": "File name for the upload"
+          "description": "",
+          "optional": true
         },
-        "opts": {
-          "type": "{ subfolder?: string; type?: string; overwrite?: boolean }",
-          "description": "Upload options (subfolder, type, overwrite)"
-        }
-      },
-      "required": [
-        "file",
-        "filename"
-      ],
-      "returns": "Promise<any>"
-    },
-    "viewImage": {
-      "description": "Download a generated image from ComfyUI as a Buffer.",
-      "parameters": {
-        "filename": {
-          "type": "string",
-          "description": "The image filename"
-        },
-        "subfolder": {
-          "type": "any",
-          "description": "Subfolder within the output directory"
-        },
-        "type": {
-          "type": "any",
-          "description": "Image type ('output', 'input', 'temp')"
-        }
-      },
-      "required": [
-        "filename"
-      ],
-      "returns": "Promise<Buffer>"
-    },
-    "connectWs": {
-      "description": "Open a WebSocket connection to ComfyUI for real-time execution tracking. Events emitted: `execution_start`, `executing`, `progress`, `executed`, `execution_cached`, `execution_error`, `execution_complete`.",
-      "parameters": {},
-      "required": [],
-      "returns": "Promise<void>"
-    },
-    "disconnectWs": {
-      "description": "Close the WebSocket connection.",
-      "parameters": {},
-      "required": [],
-      "returns": "void"
-    },
-    "toApiFormat": {
-      "description": "Convert a UI-format workflow to the API format that /prompt expects. Requires a running ComfyUI instance to fetch `object_info` so we can map positional `widgets_values` to their named input fields. If the workflow is already in API format, it's returned as-is.",
-      "parameters": {
-        "workflow": {
-          "type": "Record<string, any>",
-          "description": "Parameter workflow"
-        }
-      },
-      "required": [
-        "workflow"
-      ],
-      "returns": "Promise<Record<string, any>>"
-    },
-    "runWorkflow": {
-      "description": "Run a ComfyUI workflow with optional runtime input overrides. Inputs can be provided in two forms: **Direct node mapping** (when no `inputMap` in options): ``` { '3': { seed: 42 }, '6': { text: 'a cat' } } ``` **Named inputs** (when `inputMap` is provided in options): ``` inputs: { positive_prompt: 'a cat', seed: 42 } options.inputMap: { positive_prompt: { nodeId: '6', field: 'text' }, seed: { nodeId: '3', field: 'seed' } } ```",
-      "parameters": {
-        "workflow": {
-          "type": "Record<string, any>",
-          "description": "Parameter workflow"
-        },
-        "inputs": {
-          "type": "Record<string, any>",
-          "description": "Parameter inputs"
-        },
-        "options": {
-          "type": "WorkflowRunOptions",
-          "description": "Parameter options",
-          "properties": {
-            "poll": {
-              "type": "boolean",
-              "description": "Use polling instead of WebSocket for tracking execution"
-            },
-            "pollInterval": {
-              "type": "number",
-              "description": "Polling interval in ms (default 1000)"
-            },
-            "inputMap": {
-              "type": "InputMapping",
-              "description": "Named input mapping: semantic name -> { nodeId, field }"
-            },
-            "outputDir": {
-              "type": "string",
-              "description": "If provided, output images are downloaded to this directory"
-            }
-          }
-        }
-      },
-      "required": [
-        "workflow"
-      ],
-      "returns": "Promise<WorkflowResult>"
-    }
-  },
-  "getters": {
-    "clientId": {
-      "description": "The unique client ID used for WebSocket session tracking.",
-      "returns": "string"
-    },
-    "wsURL": {
-      "description": "The WebSocket URL derived from baseURL or overridden via options.",
-      "returns": "string"
-    }
-  },
-  "events": {
-    "execution_start": {
-      "name": "execution_start",
-      "description": "Event emitted by ComfyUIClient",
-      "arguments": {}
-    },
-    "execution_complete": {
-      "name": "execution_complete",
-      "description": "Event emitted by ComfyUIClient",
-      "arguments": {}
-    },
-    "executing": {
-      "name": "executing",
-      "description": "Event emitted by ComfyUIClient",
-      "arguments": {}
-    },
-    "progress": {
-      "name": "progress",
-      "description": "Event emitted by ComfyUIClient",
-      "arguments": {}
-    },
-    "executed": {
-      "name": "executed",
-      "description": "Event emitted by ComfyUIClient",
-      "arguments": {}
-    },
-    "execution_cached": {
-      "name": "execution_cached",
-      "description": "Event emitted by ComfyUIClient",
-      "arguments": {}
-    },
-    "execution_error": {
-      "name": "execution_error",
-      "description": "Event emitted by ComfyUIClient",
-      "arguments": {}
-    }
-  },
-  "state": {},
-  "options": {},
-  "envVars": [],
-  "examples": [
-    {
-      "language": "ts",
-      "code": "const comfy = container.client('comfyui', { baseURL: 'http://localhost:8188' })\nconst result = await comfy.runWorkflow(workflow, {\n '6': { text: 'a beautiful sunset' }\n})\nconsole.log(result.images)"
-    }
-  ],
-  "types": {
-    "WorkflowRunOptions": {
-      "description": "",
-      "properties": {
-        "poll": {
-          "type": "boolean",
-          "description": "Use polling instead of WebSocket for tracking execution",
-          "optional": true
-        },
-        "pollInterval": {
-          "type": "number",
-          "description": "Polling interval in ms (default 1000)",
-          "optional": true
-        },
-        "inputMap": {
-          "type": "InputMapping",
-          "description": "Named input mapping: semantic name -> { nodeId, field }",
-          "optional": true
-        },
-        "outputDir": {
-          "type": "string",
-          "description": "If provided, output images are downloaded to this directory",
-          "optional": true
+        "handler": {
+          "type": "Function | ((args: any, ctx: any) => any)",
+          "description": "",
+          "optional": true
         }
       }
     },
-    "WorkflowResult": {
+    "ResourceRegistrationOptions": {
       "description": "",
       "properties": {
-        "promptId": {
+        "name": {
           "type": "string",
-          "description": ""
-        },
-        "outputs": {
-          "type": "Record<string, any>",
-          "description": ""
-        },
-        "images": {
-          "type": "Array<{ filename: string; subfolder: string; type: string; localPath?: string }>",
           "description": "",
           "optional": true
-        }
-      }
-    }
-  }
-});
-
-setBuildTimeData('servers.mcp', {
-  "id": "servers.mcp",
-  "description": "MCP (Model Context Protocol) server for exposing tools, resources, and prompts to AI clients like Claude Code. Uses the low-level MCP SDK Server class directly with Zod 4 native JSON Schema conversion. Register tools, resources, and prompts programmatically, then start the server over stdio (for CLI integration) or HTTP (for remote access).",
-  "shortcut": "servers.mcp",
-  "className": "MCPServer",
-  "methods": {
-    "tool": {
-      "description": "Register an MCP tool. The tool's Zod schema is converted to JSON Schema for the protocol listing, and used for runtime argument validation. Tool handlers can return a string (auto-wrapped as text content) or a full CallToolResult object for advanced responses (images, errors, etc).",
-      "parameters": {
-        "name": {
-          "type": "string",
-          "description": "Unique tool name"
-        },
-        "options": {
-          "type": "ToolRegistrationOptions",
-          "description": "Tool schema, description, and handler",
-          "properties": {
-            "schema": {
-              "type": "z.ZodObject<any>",
-              "description": ""
-            },
-            "description": {
-              "type": "string",
-              "description": ""
-            },
-            "handler": {
-              "type": "(args: any, ctx: MCPContext) => any",
-              "description": ""
-            }
-          }
-        }
-      },
-      "required": [
-        "name",
-        "options"
-      ],
-      "returns": "this"
-    },
-    "resource": {
-      "description": "Register an MCP resource. Resources expose data (files, configs, etc) that AI clients can read by URI. Accepts either a handler function directly or an options object with additional metadata (name, description, mimeType).",
-      "parameters": {
-        "uri": {
-          "type": "string",
-          "description": "Unique resource URI (e.g. \"project://readme\")"
         },
-        "handlerOrOptions": {
-          "type": "ResourceRegistrationOptions['handler'] | ResourceRegistrationOptions",
-          "description": "Handler function or options object with handler"
-        }
-      },
-      "required": [
-        "uri",
-        "handlerOrOptions"
-      ],
-      "returns": "this"
-    },
-    "prompt": {
-      "description": "Register an MCP prompt. Prompts are reusable message templates that AI clients can invoke with optional string arguments.",
-      "parameters": {
-        "name": {
+        "description": {
           "type": "string",
-          "description": "Unique prompt name"
-        },
-        "options": {
-          "type": "PromptRegistrationOptions",
-          "description": "Prompt handler, optional args schema, and description",
-          "properties": {
-            "description": {
-              "type": "string",
-              "description": ""
-            },
-            "args": {
-              "type": "Record<string, z.ZodType>",
-              "description": ""
-            },
-            "handler": {
-              "type": "(args: Record<string, string | undefined>, ctx: MCPContext) => Promise<PromptMessage[]> | PromptMessage[]",
-              "description": ""
-            }
-          }
-        }
-      },
-      "required": [
-        "name",
-        "options"
-      ],
-      "returns": "this"
-    },
-    "configure": {
-      "description": "Configure the MCP protocol server and register all protocol handlers. Called automatically before start() if not already configured.",
-      "parameters": {},
-      "required": [],
-      "returns": "Promise<this>"
-    },
-    "start": {
-      "description": "Start the MCP server with the specified transport.",
-      "parameters": {
-        "options": {
-          "type": "{\n    transport?: 'stdio' | 'http'\n    port?: number\n    host?: string\n    mcpCompat?: MCPCompatMode\n    stdioCompat?: StdioCompatMode\n  }",
-          "description": "Transport configuration. Defaults to stdio.",
-          "properties": {
-            "transport": {
-              "type": "any",
-              "description": "'stdio' for CLI integration, 'http' for remote access"
-            },
-            "port": {
-              "type": "any",
-              "description": "Port for HTTP transport (default 3001)"
-            }
-          }
-        }
-      },
-      "required": [],
-      "returns": "Promise<this>"
-    },
-    "stop": {
-      "description": "Stop the MCP server and close all connections.",
-      "parameters": {},
-      "required": [],
-      "returns": "Promise<this>"
-    }
-  },
-  "getters": {
-    "mcpServer": {
-      "description": "The underlying MCP protocol server instance. Created during configure().",
-      "returns": "MCPProtocolServer"
-    },
-    "handlerContext": {
-      "description": "The handler context passed to all tool, resource, and prompt handlers.",
-      "returns": "MCPContext"
-    }
-  },
-  "events": {
-    "toolRegistered": {
-      "name": "toolRegistered",
-      "description": "Event emitted by MCPServer",
-      "arguments": {}
-    },
-    "resourceRegistered": {
-      "name": "resourceRegistered",
-      "description": "Event emitted by MCPServer",
-      "arguments": {}
-    },
-    "promptRegistered": {
-      "name": "promptRegistered",
-      "description": "Event emitted by MCPServer",
-      "arguments": {}
-    },
-    "toolCalled": {
-      "name": "toolCalled",
-      "description": "Event emitted by MCPServer",
-      "arguments": {}
-    }
-  },
-  "state": {},
-  "options": {},
-  "envVars": [],
-  "examples": [
-    {
-      "language": "ts",
-      "code": "const mcp = container.server('mcp', { serverName: 'my-server', serverVersion: '1.0.0' })\n\nmcp.tool('search_files', {\n schema: z.object({ pattern: z.string() }),\n description: 'Search for files',\n handler: async (args, ctx) => {\n   return ctx.container.feature('fs').walk('.', { include: [args.pattern] }).files.join('\\n')\n }\n})\n\nawait mcp.start()"
-    }
-  ],
-  "types": {
-    "ToolRegistrationOptions": {
-      "description": "",
-      "properties": {
-        "schema": {
-          "type": "z.ZodObject<any>",
           "description": "",
           "optional": true
         },
-        "description": {
+        "mimeType": {
           "type": "string",
           "description": "",
           "optional": true
         },
         "handler": {
-          "type": "(args: any, ctx: MCPContext) => any",
+          "type": "(uri: string, ctx: MCPContext) => Promise<string> | string",
           "description": ""
         }
       }
@@ -13055,30 +13080,6 @@ setBuildTimeData('servers.mcp', {
         }
       }
     },
-    "ResourceRegistrationOptions": {
-      "description": "",
-      "properties": {
-        "name": {
-          "type": "string",
-          "description": "",
-          "optional": true
-        },
-        "description": {
-          "type": "string",
-          "description": "",
-          "optional": true
-        },
-        "mimeType": {
-          "type": "string",
-          "description": "",
-          "optional": true
-        },
-        "handler": {
-          "type": "(uri: string, ctx: MCPContext) => Promise<string> | string",
-          "description": ""
-        }
-      }
-    },
     "PromptRegistrationOptions": {
       "description": "",
       "properties": {
@@ -13370,8 +13371,51 @@ setBuildTimeData('features.assistantsManager', {
   "shortcut": "features.assistantsManager",
   "className": "AssistantsManager",
   "methods": {
+    "intercept": {
+      "description": "Registers a pipeline interceptor that is applied to every assistant created by this manager. Interceptors are applied at the given interception point on each assistant at creation time. This mirrors the per-assistant `assistant.intercept(point, fn)` API, but scopes it globally across all assistants managed here — useful for cross-cutting concerns like logging, tracing, or policy enforcement.",
+      "parameters": {
+        "point": {
+          "type": "K",
+          "description": "The interception point (beforeAsk, beforeTurn, beforeToolCall, afterToolCall, beforeResponse)"
+        },
+        "fn": {
+          "type": "InterceptorFn<InterceptorPoints[K]>",
+          "description": "Middleware function receiving (ctx, next)"
+        }
+      },
+      "required": [
+        "point",
+        "fn"
+      ],
+      "returns": "this",
+      "examples": [
+        {
+          "language": "ts",
+          "code": "manager.intercept('beforeAsk', async (ctx, next) => {\n console.log(`[${ctx.assistant.name}] asking: ${ctx.message}`)\n await next()\n})"
+        }
+      ]
+    },
+    "addDiscoveryFolder": {
+      "description": "Registers an additional folder to scan during assistant discovery and immediately triggers a new discovery pass.",
+      "parameters": {
+        "folderPath": {
+          "type": "string",
+          "description": "Absolute path to a folder containing assistant subdirectories"
+        }
+      },
+      "required": [
+        "folderPath"
+      ],
+      "returns": "Promise<this>",
+      "examples": [
+        {
+          "language": "ts",
+          "code": "await manager.addDiscoveryFolder('/path/to/more/assistants')\nconsole.log(manager.available) // includes assistants from the new folder"
+        }
+      ]
+    },
     "discover": {
-      "description": "Discovers assistants by listing subdirectories in ~/.luca/assistants/ and cwd/assistants/. Each subdirectory containing a CORE.md is an assistant.",
+      "description": "",
       "parameters": {},
       "required": [],
       "returns": "Promise<this>"
@@ -13615,6 +13659,47 @@ setBuildTimeData('features.conversation', {
       ],
       "returns": "this"
     },
+    "stub": {
+      "description": "Register a hardcoded stub response that bypasses the API when the user's message matches. Streaming is still simulated — chunk/preview events fire word-by-word.",
+      "parameters": {
+        "matcher": {
+          "type": "string | RegExp",
+          "description": "Exact string match, substring, or RegExp tested against user input"
+        },
+        "response": {
+          "type": "string | (() => string)",
+          "description": "The text to stream back, or a zero-arg function that returns it"
+        }
+      },
+      "required": [
+        "matcher",
+        "response"
+      ],
+      "returns": "this",
+      "examples": [
+        {
+          "language": "ts",
+          "code": "conversation.stub('hello', 'Hi there!')\nconversation.stub(/weather/i, () => 'Sunny and 72°F.')"
+        }
+      ]
+    },
+    "fork": {
+      "description": "Fork the conversation into a new independent instance. The fork inherits the same system prompt, tools, and full message history, but has its own identity and state — changes in either direction do not affect the other.",
+      "parameters": {
+        "overrides": {
+          "type": "Partial<ConversationOptions>",
+          "description": "Optional option overrides for the forked conversation (e.g. different model or title)"
+        }
+      },
+      "required": [],
+      "returns": "Conversation",
+      "examples": [
+        {
+          "language": "ts",
+          "code": "const fork = conversation.fork()\nawait fork.ask('What if we took a different approach?')\n// original conversation is unchanged"
+        }
+      ]
+    },
     "estimateTokens": {
       "description": "Estimate the input token count for the current messages array using the js-tiktoken tokenizer. Updates state.",
       "parameters": {},
@@ -13793,48 +13878,48 @@ setBuildTimeData('features.conversation', {
       "description": "Event emitted by Conversation",
       "arguments": {}
     },
-    "rawEvent": {
-      "name": "rawEvent",
+    "chunk": {
+      "name": "chunk",
       "description": "Event emitted by Conversation",
       "arguments": {}
     },
-    "mcpEvent": {
-      "name": "mcpEvent",
+    "preview": {
+      "name": "preview",
       "description": "Event emitted by Conversation",
       "arguments": {}
     },
-    "chunk": {
-      "name": "chunk",
+    "turnEnd": {
+      "name": "turnEnd",
       "description": "Event emitted by Conversation",
       "arguments": {}
     },
-    "preview": {
-      "name": "preview",
+    "response": {
+      "name": "response",
       "description": "Event emitted by Conversation",
       "arguments": {}
     },
-    "responseCompleted": {
-      "name": "responseCompleted",
+    "rawEvent": {
+      "name": "rawEvent",
       "description": "Event emitted by Conversation",
       "arguments": {}
     },
-    "toolCallsStart": {
-      "name": "toolCallsStart",
+    "mcpEvent": {
+      "name": "mcpEvent",
       "description": "Event emitted by Conversation",
       "arguments": {}
     },
-    "toolCallsEnd": {
-      "name": "toolCallsEnd",
+    "responseCompleted": {
+      "name": "responseCompleted",
       "description": "Event emitted by Conversation",
       "arguments": {}
     },
-    "turnEnd": {
-      "name": "turnEnd",
+    "toolCallsStart": {
+      "name": "toolCallsStart",
       "description": "Event emitted by Conversation",
       "arguments": {}
     },
-    "response": {
-      "name": "response",
+    "toolCallsEnd": {
+      "name": "toolCallsEnd",
       "description": "Event emitted by Conversation",
       "arguments": {}
     }
@@ -13933,7 +14018,7 @@ setBuildTimeData('features.openapi', {
       ],
       "returns": "EndpointInfo | undefined"
     },
-    "toTools": {
+    "toOpenAITools": {
       "description": "Convert all endpoints into OpenAI-compatible tool definitions.",
       "parameters": {
         "filter": {
@@ -14027,7 +14112,7 @@ setBuildTimeData('features.openapi', {
   "examples": [
     {
       "language": "ts",
-      "code": "const api = container.feature('openapi', { url: 'https://petstore.swagger.io/v2' })\nawait api.load()\n\n// Inspect all endpoints\napi.endpoints\n\n// Get a single endpoint by its friendly name\napi.endpoint('getPetById')\n\n// Convert to OpenAI tool definitions\napi.toTools()\n\n// Convert a single endpoint to a function definition\napi.toFunction('getPetById')"
+      "code": "const api = container.feature('openapi', { url: 'https://petstore.swagger.io/v2' })\nawait api.load()\n\n// Inspect all endpoints\napi.endpoints\n\n// Get a single endpoint by its friendly name\napi.endpoint('getPetById')\n\n// Convert to OpenAI tool definitions\napi.toOpenAITools()\n\n// Convert a single endpoint to a function definition\napi.toFunction('getPetById')"
     }
   ],
   "types": {
@@ -14955,6 +15040,19 @@ setBuildTimeData('features.skillsLibrary', {
   "shortcut": "features.skillsLibrary",
   "className": "SkillsLibrary",
   "methods": {
+    "setupToolsConsumer": {
+      "description": "",
+      "parameters": {
+        "assistant": {
+          "type": "Feature",
+          "description": "Parameter assistant"
+        }
+      },
+      "required": [
+        "assistant"
+      ],
+      "returns": "void"
+    },
     "start": {
       "description": "Start the skills library: read config, scan all locations.",
       "parameters": {},
@@ -15081,6 +15179,24 @@ setBuildTimeData('features.skillsLibrary', {
         "{ skillName, question }"
       ],
       "returns": "Promise<string>"
+    },
+    "findRelevantSkillsForAssistant": {
+      "description": "Fork the given assistant and ask it which skills (if any) are relevant to the user's query. Returns an array of skill names that should be loaded before the real question is answered. The fork is ephemeral (historyMode: 'none') and uses structured output so the result is always a clean string array — never free text.",
+      "parameters": {
+        "assistant": {
+          "type": "Assistant",
+          "description": "The assistant instance to fork"
+        },
+        "userQuery": {
+          "type": "string",
+          "description": "The user's original question"
+        }
+      },
+      "required": [
+        "assistant",
+        "userQuery"
+      ],
+      "returns": "Promise<string[]>"
     }
   },
   "getters": {
@@ -15517,6 +15633,10 @@ setBuildTimeData('features.assistant', {
       "description": "Parsed YAML frontmatter from CORE.md, or empty object if none.",
       "returns": "Record<string, any>"
     },
+    "effectiveOptions": {
+      "description": "Merged options where CORE.md frontmatter provides defaults and constructor options take precedence. Prefer this over `this.options` anywhere model parameters or runtime config is consumed.",
+      "returns": "AssistantOptions & Record<string, any>"
+    },
     "paths": {
       "description": "Provides a helper for creating paths off of the assistant's base folder",
       "returns": "any"
@@ -16096,6 +16216,77 @@ setBuildTimeData('features.claudeCode', {
         }
       ]
     },
+    "listProcessSessions": {
+      "description": "List all Claude Code processes currently registered in ~/.claude/sessions/. Returns each session's metadata along with whether the process is still alive.",
+      "parameters": {},
+      "required": [],
+      "returns": "Promise<Array<{\n    pid: number\n    sessionId: string\n    cwd: string\n    startedAt: number\n    kind: string\n    entrypoint: string\n    alive: boolean\n  }>>",
+      "examples": [
+        {
+          "language": "ts",
+          "code": "const sessions = await cc.listProcessSessions()\nfor (const s of sessions) {\n console.log(`[${s.alive ? 'LIVE' : 'dead'}] PID ${s.pid} in ${s.cwd}`)\n}"
+        }
+      ]
+    },
+    "getProcessSession": {
+      "description": "Read a single process session by PID from ~/.claude/sessions/<pid>.json.",
+      "parameters": {
+        "pid": {
+          "type": "number",
+          "description": "The process ID"
+        }
+      },
+      "required": [
+        "pid"
+      ],
+      "returns": "Promise<{\n    pid: number\n    sessionId: string\n    cwd: string\n    startedAt: number\n    kind: string\n    entrypoint: string\n  } | null>",
+      "examples": [
+        {
+          "language": "ts",
+          "code": "const session = await cc.getProcessSession(12345)\nconsole.log(session?.cwd)"
+        }
+      ]
+    },
+    "getConversationHistory": {
+      "description": "Read the conversation history for a Claude Code session from its JSONL file in ~/.claude/projects/<encoded-cwd>/<sessionId>.jsonl. Returns an array of parsed message objects (user, assistant, tool_use, tool_result).",
+      "parameters": {
+        "sessionId": {
+          "type": "string",
+          "description": "The Claude CLI session ID (from listProcessSessions or getProcessSession)"
+        },
+        "cwd": {
+          "type": "string",
+          "description": "The working directory of the session (used to locate the project folder)"
+        }
+      },
+      "required": [
+        "sessionId"
+      ],
+      "returns": "Promise<any[]>",
+      "examples": [
+        {
+          "language": "ts",
+          "code": "const sessions = await cc.listProcessSessions()\nconst s = sessions[0]\nconst history = await cc.getConversationHistory(s.sessionId, s.cwd)\nconsole.log(history.length, 'turns')"
+        }
+      ]
+    },
+    "listSessionsForCwd": {
+      "description": "List all conversation sessions stored for a given working directory. Reads ~/.claude/projects/<encoded-cwd>/ and returns metadata for each .jsonl file.",
+      "parameters": {
+        "cwd": {
+          "type": "string",
+          "description": "The working directory path to look up"
+        }
+      },
+      "required": [],
+      "returns": "Promise<Array<{\n    sessionId: string\n    filePath: string\n    messageCount: number\n  }>>",
+      "examples": [
+        {
+          "language": "ts",
+          "code": "const sessions = await cc.listSessionsForCwd('/Users/me/my-project')\nfor (const s of sessions) {\n console.log(s.sessionId, s.messageCount, 'messages')\n}"
+        }
+      ]
+    },
     "cleanupMcpTempFiles": {
       "description": "Clean up any temp MCP config files created during sessions.",
       "parameters": {},
@@ -18292,7 +18483,7 @@ setContainerBuildTimeData('Container', {
           "description": "The id of the feature to create."
         },
         "options": {
-          "type": "ConstructorParameters<Features[T]>[0]",
+          "type": "FeatureInputOptions<Features>[T] | Record<string, unknown>",
           "description": "The options to pass to the feature constructor."
         }
       },
@@ -18301,6 +18492,52 @@ setContainerBuildTimeData('Container', {
       ],
       "returns": "InstanceType<Features[T]>"
     },
+    "entity": {
+      "description": "Creates a lightweight entity object with observable state, a typed event bus, and access to the container. Same id + options always returns the same cached base instance. An optional third argument auto-extends the entity with functions and getters. All extended methods and getters can access the entity (state, options, container, on/off/emit, etc.) via `this`.",
+      "parameters": {
+        "id": {
+          "type": "string",
+          "description": "Stable identifier for this entity (included in cache key)"
+        },
+        "options": {
+          "type": "TOptions",
+          "description": "Arbitrary options stored on `entity.options` (included in cache key)"
+        },
+        "extensions": {
+          "type": "Ext & ThisType<Entity<TState, TOptions, TEvents> & Ext>",
+          "description": "Optional object of functions/getters to graft onto the entity"
+        }
+      },
+      "required": [
+        "id"
+      ],
+      "returns": "Entity<TState, TOptions, TEvents> & Ext",
+      "examples": [
+        {
+          "language": "ts",
+          "code": "// Basic entity with typed state and events\nconst counter = container.entity<{ count: number }>('counter')\ncounter.setState({ count: 0 })\ncounter.on('tick', () => counter.setState(s => ({ count: s.count + 1 })))\n\n// With options and auto-extension\nconst user = container.entity('user:42', { name: 'Alice' }, {\n greet() { return `Hello ${this.options.name}` },\n get label() { return `User: ${this.options.name}` },\n})\nuser.greet() // \"Hello Alice\""
+        }
+      ]
+    },
+    "getHelperByUUID": {
+      "description": "Look up any helper instance (feature, client, server) by its UUID. Returns undefined if the UUID is unknown or the instance was never created.",
+      "parameters": {
+        "uuid": {
+          "type": "string",
+          "description": "The `instance.uuid` value assigned at construction time"
+        }
+      },
+      "required": [
+        "uuid"
+      ],
+      "returns": "Helper | undefined",
+      "examples": [
+        {
+          "language": "ts",
+          "code": "const assistant = container.feature('assistant')\nconst { uuid } = assistant\n// ... later ...\nconst same = container.getHelperByUUID(uuid) // === assistant"
+        }
+      ]
+    },
     "start": {
       "description": "Start the container. Emits the 'started' event and sets `state.started` to true. Plugins and features can listen for this event to perform initialization.",
       "parameters": {},
@@ -18607,7 +18844,7 @@ setContainerBuildTimeData('NodeContainer', {
     },
     "urlUtils": {
       "description": "Returns URL utility functions for parsing URIs.",
-      "returns": "{ parse: (uri: string) => url.URL | null }"
+      "returns": "{ parse: (uri: string) => url.UrlWithStringQuery }"
     },
     "paths": {
       "description": "Returns path utility functions scoped to the current working directory (join, resolve, relative, dirname, parse).",
@@ -30727,6 +30964,302 @@ export const introspectionData = [
       }
     ]
   },
+  {
+    "id": "clients.comfyui",
+    "description": "ComfyUI client — execute Stable Diffusion workflows via the ComfyUI API. Connects to a ComfyUI instance to queue prompts, track execution via WebSocket or polling, and download generated images. Supports both UI-format and API-format workflows with automatic conversion.",
+    "shortcut": "clients.comfyui",
+    "className": "ComfyUIClient",
+    "methods": {
+      "queuePrompt": {
+        "description": "Queue a prompt (API-format workflow) for execution.",
+        "parameters": {
+          "prompt": {
+            "type": "Record<string, any>",
+            "description": "The API-format workflow object"
+          },
+          "clientId": {
+            "type": "string",
+            "description": "Override the client ID for this request"
+          }
+        },
+        "required": [
+          "prompt"
+        ],
+        "returns": "Promise<{ prompt_id: string; number: number }>",
+        "examples": [
+          {
+            "language": "ts",
+            "code": "const { prompt_id } = await comfy.queuePrompt(apiWorkflow)"
+          }
+        ]
+      },
+      "getQueue": {
+        "description": "Get the current prompt queue status.",
+        "parameters": {},
+        "required": [],
+        "returns": "Promise<{ queue_running: any[]; queue_pending: any[] }>"
+      },
+      "getHistory": {
+        "description": "Get execution history, optionally for a specific prompt.",
+        "parameters": {
+          "promptId": {
+            "type": "string",
+            "description": "If provided, returns history for this prompt only"
+          }
+        },
+        "required": [],
+        "returns": "Promise<Record<string, any>>"
+      },
+      "getSystemStats": {
+        "description": "Get system stats including GPU memory and queue info.",
+        "parameters": {},
+        "required": [],
+        "returns": "Promise<any>"
+      },
+      "getObjectInfo": {
+        "description": "Get node type info with input/output schemas.",
+        "parameters": {
+          "nodeClass": {
+            "type": "string",
+            "description": "If provided, returns info for this node type only"
+          }
+        },
+        "required": [],
+        "returns": "Promise<any>"
+      },
+      "interrupt": {
+        "description": "Interrupt the currently executing prompt.",
+        "parameters": {},
+        "required": [],
+        "returns": "Promise<void>"
+      },
+      "getModels": {
+        "description": "List available models, optionally filtered by type.",
+        "parameters": {
+          "type": {
+            "type": "string",
+            "description": "Model type filter (e.g., 'checkpoints', 'loras')"
+          }
+        },
+        "required": [],
+        "returns": "Promise<string[]>"
+      },
+      "getEmbeddings": {
+        "description": "List available embedding models.",
+        "parameters": {},
+        "required": [],
+        "returns": "Promise<string[]>"
+      },
+      "uploadImage": {
+        "description": "Upload an image to ComfyUI's input directory.",
+        "parameters": {
+          "file": {
+            "type": "Buffer | Blob",
+            "description": "The image data as Buffer or Blob"
+          },
+          "filename": {
+            "type": "string",
+            "description": "File name for the upload"
+          },
+          "opts": {
+            "type": "{ subfolder?: string; type?: string; overwrite?: boolean }",
+            "description": "Upload options (subfolder, type, overwrite)"
+          }
+        },
+        "required": [
+          "file",
+          "filename"
+        ],
+        "returns": "Promise<any>"
+      },
+      "viewImage": {
+        "description": "Download a generated image from ComfyUI as a Buffer.",
+        "parameters": {
+          "filename": {
+            "type": "string",
+            "description": "The image filename"
+          },
+          "subfolder": {
+            "type": "any",
+            "description": "Subfolder within the output directory"
+          },
+          "type": {
+            "type": "any",
+            "description": "Image type ('output', 'input', 'temp')"
+          }
+        },
+        "required": [
+          "filename"
+        ],
+        "returns": "Promise<Buffer>"
+      },
+      "connectWs": {
+        "description": "Open a WebSocket connection to ComfyUI for real-time execution tracking. Events emitted: `execution_start`, `executing`, `progress`, `executed`, `execution_cached`, `execution_error`, `execution_complete`.",
+        "parameters": {},
+        "required": [],
+        "returns": "Promise<void>"
+      },
+      "disconnectWs": {
+        "description": "Close the WebSocket connection.",
+        "parameters": {},
+        "required": [],
+        "returns": "void"
+      },
+      "toApiFormat": {
+        "description": "Convert a UI-format workflow to the API format that /prompt expects. Requires a running ComfyUI instance to fetch `object_info` so we can map positional `widgets_values` to their named input fields. If the workflow is already in API format, it's returned as-is.",
+        "parameters": {
+          "workflow": {
+            "type": "Record<string, any>",
+            "description": "Parameter workflow"
+          }
+        },
+        "required": [
+          "workflow"
+        ],
+        "returns": "Promise<Record<string, any>>"
+      },
+      "runWorkflow": {
+        "description": "Run a ComfyUI workflow with optional runtime input overrides. Inputs can be provided in two forms: **Direct node mapping** (when no `inputMap` in options): ``` { '3': { seed: 42 }, '6': { text: 'a cat' } } ``` **Named inputs** (when `inputMap` is provided in options): ``` inputs: { positive_prompt: 'a cat', seed: 42 } options.inputMap: { positive_prompt: { nodeId: '6', field: 'text' }, seed: { nodeId: '3', field: 'seed' } } ```",
+        "parameters": {
+          "workflow": {
+            "type": "Record<string, any>",
+            "description": "Parameter workflow"
+          },
+          "inputs": {
+            "type": "Record<string, any>",
+            "description": "Parameter inputs"
+          },
+          "options": {
+            "type": "WorkflowRunOptions",
+            "description": "Parameter options",
+            "properties": {
+              "poll": {
+                "type": "boolean",
+                "description": "Use polling instead of WebSocket for tracking execution"
+              },
+              "pollInterval": {
+                "type": "number",
+                "description": "Polling interval in ms (default 1000)"
+              },
+              "inputMap": {
+                "type": "InputMapping",
+                "description": "Named input mapping: semantic name -> { nodeId, field }"
+              },
+              "outputDir": {
+                "type": "string",
+                "description": "If provided, output images are downloaded to this directory"
+              }
+            }
+          }
+        },
+        "required": [
+          "workflow"
+        ],
+        "returns": "Promise<WorkflowResult>"
+      }
+    },
+    "getters": {
+      "clientId": {
+        "description": "The unique client ID used for WebSocket session tracking.",
+        "returns": "string"
+      },
+      "wsURL": {
+        "description": "The WebSocket URL derived from baseURL or overridden via options.",
+        "returns": "string"
+      }
+    },
+    "events": {
+      "execution_start": {
+        "name": "execution_start",
+        "description": "Event emitted by ComfyUIClient",
+        "arguments": {}
+      },
+      "execution_complete": {
+        "name": "execution_complete",
+        "description": "Event emitted by ComfyUIClient",
+        "arguments": {}
+      },
+      "executing": {
+        "name": "executing",
+        "description": "Event emitted by ComfyUIClient",
+        "arguments": {}
+      },
+      "progress": {
+        "name": "progress",
+        "description": "Event emitted by ComfyUIClient",
+        "arguments": {}
+      },
+      "executed": {
+        "name": "executed",
+        "description": "Event emitted by ComfyUIClient",
+        "arguments": {}
+      },
+      "execution_cached": {
+        "name": "execution_cached",
+        "description": "Event emitted by ComfyUIClient",
+        "arguments": {}
+      },
+      "execution_error": {
+        "name": "execution_error",
+        "description": "Event emitted by ComfyUIClient",
+        "arguments": {}
+      }
+    },
+    "state": {},
+    "options": {},
+    "envVars": [],
+    "examples": [
+      {
+        "language": "ts",
+        "code": "const comfy = container.client('comfyui', { baseURL: 'http://localhost:8188' })\nconst result = await comfy.runWorkflow(workflow, {\n '6': { text: 'a beautiful sunset' }\n})\nconsole.log(result.images)"
+      }
+    ],
+    "types": {
+      "WorkflowRunOptions": {
+        "description": "",
+        "properties": {
+          "poll": {
+            "type": "boolean",
+            "description": "Use polling instead of WebSocket for tracking execution",
+            "optional": true
+          },
+          "pollInterval": {
+            "type": "number",
+            "description": "Polling interval in ms (default 1000)",
+            "optional": true
+          },
+          "inputMap": {
+            "type": "InputMapping",
+            "description": "Named input mapping: semantic name -> { nodeId, field }",
+            "optional": true
+          },
+          "outputDir": {
+            "type": "string",
+            "description": "If provided, output images are downloaded to this directory",
+            "optional": true
+          }
+        }
+      },
+      "WorkflowResult": {
+        "description": "",
+        "properties": {
+          "promptId": {
+            "type": "string",
+            "description": ""
+          },
+          "outputs": {
+            "type": "Record<string, any>",
+            "description": ""
+          },
+          "images": {
+            "type": "Array<{ filename: string; subfolder: string; type: string; localPath?: string }>",
+            "description": "",
+            "optional": true
+          }
+        }
+      }
+    }
+  },
   {
     "id": "clients.elevenlabs",
     "description": "ElevenLabs client — text-to-speech synthesis via the ElevenLabs REST API. Provides methods for listing voices, listing models, and generating speech audio. Audio is returned as a Buffer; use `say()` for a convenience method that writes to disk.",
@@ -31005,481 +31538,185 @@ export const introspectionData = [
           }
         },
         "required": [
-          "table"
-        ],
-        "returns": "void"
-      },
-      "rpc": {
-        "description": "Call a Postgres function (RPC).",
-        "parameters": {
-          "fn": {
-            "type": "string",
-            "description": "The function name"
-          },
-          "params": {
-            "type": "Record<string, unknown>",
-            "description": "Arguments to pass to the function"
-          },
-          "options": {
-            "type": "{ head?: boolean; get?: boolean; count?: \"exact\" | \"planned\" | \"estimated\" }",
-            "description": "Optional settings (head, get, count)"
-          }
-        },
-        "required": [
-          "fn"
-        ],
-        "returns": "void"
-      },
-      "signInWithPassword": {
-        "description": "Sign in with email and password.",
-        "parameters": {
-          "email": {
-            "type": "string",
-            "description": "Parameter email"
-          },
-          "password": {
-            "type": "string",
-            "description": "Parameter password"
-          }
-        },
-        "required": [
-          "email",
-          "password"
-        ],
-        "returns": "void"
-      },
-      "signUp": {
-        "description": "Create a new user account with email and password.",
-        "parameters": {
-          "email": {
-            "type": "string",
-            "description": "Parameter email"
-          },
-          "password": {
-            "type": "string",
-            "description": "Parameter password"
-          }
-        },
-        "required": [
-          "email",
-          "password"
-        ],
-        "returns": "void"
-      },
-      "signOut": {
-        "description": "Sign the current user out.",
-        "parameters": {},
-        "required": [],
-        "returns": "void"
-      },
-      "getSession": {
-        "description": "Get the current session, if any.",
-        "parameters": {},
-        "required": [],
-        "returns": "void"
-      },
-      "getUser": {
-        "description": "Get the current user, if any.",
-        "parameters": {},
-        "required": [],
-        "returns": "void"
-      },
-      "invoke": {
-        "description": "Invoke a Supabase Edge Function by name.",
-        "parameters": {
-          "name": {
-            "type": "string",
-            "description": "Parameter name"
-          },
-          "body": {
-            "type": "any",
-            "description": "Parameter body"
-          }
-        },
-        "required": [
-          "name"
-        ],
-        "returns": "void"
-      },
-      "subscribe": {
-        "description": "Subscribe to realtime changes on a Postgres table.",
-        "parameters": {
-          "channelName": {
-            "type": "string",
-            "description": "A name for this subscription channel"
-          },
-          "table": {
-            "type": "string",
-            "description": "The table to listen to"
-          },
-          "callback": {
-            "type": "(payload: any) => void",
-            "description": "Called with the payload on each change"
-          },
-          "event": {
-            "type": "\"INSERT\" | \"UPDATE\" | \"DELETE\" | \"*\"",
-            "description": "The event type to listen for (default: all changes)"
-          }
-        },
-        "required": [
-          "channelName",
-          "table",
-          "callback"
-        ],
-        "returns": "RealtimeChannel"
-      },
-      "unsubscribe": {
-        "description": "Unsubscribe and remove a realtime channel by name.",
-        "parameters": {
-          "channelName": {
-            "type": "string",
-            "description": "The channel name to remove"
-          }
-        },
-        "required": [
-          "channelName"
-        ],
-        "returns": "void"
-      },
-      "unsubscribeAll": {
-        "description": "Unsubscribe and remove all realtime channels.",
-        "parameters": {},
-        "required": [],
-        "returns": "void"
-      },
-      "connect": {
-        "description": "Connect is a no-op since the Supabase SDK initializes on construction. The client is ready to use immediately after creation.",
-        "parameters": {},
-        "required": [],
-        "returns": "void"
-      },
-      "disconnect": {
-        "description": "Disconnect by signing out and removing all realtime channels.",
-        "parameters": {},
-        "required": [],
-        "returns": "void"
-      }
-    },
-    "getters": {
-      "sdk": {
-        "description": "Returns the raw Supabase SDK client for full access to all SDK methods.",
-        "returns": "SupabaseSDKClient<any, any>"
-      },
-      "storage": {
-        "description": "Returns the Supabase Storage client for managing buckets and files.",
-        "returns": "any"
-      },
-      "functions": {
-        "description": "Returns the Supabase Functions client.",
-        "returns": "any"
-      }
-    },
-    "events": {},
-    "state": {},
-    "options": {},
-    "envVars": [],
-    "examples": [
-      {
-        "language": "ts",
-        "code": "const supabase = container.client('supabase', {\n supabaseUrl: 'https://xyz.supabase.co',\n supabaseKey: 'your-anon-key',\n})\n\n// Query data\nconst { data } = await supabase.from('users').select('*')\n\n// Auth\nawait supabase.signInWithPassword('user@example.com', 'password')\n\n// Realtime\nsupabase.subscribe('changes', 'users', (payload) => {\n console.log('Change:', payload)\n})"
-      }
-    ]
-  },
-  {
-    "id": "clients.comfyui",
-    "description": "ComfyUI client — execute Stable Diffusion workflows via the ComfyUI API. Connects to a ComfyUI instance to queue prompts, track execution via WebSocket or polling, and download generated images. Supports both UI-format and API-format workflows with automatic conversion.",
-    "shortcut": "clients.comfyui",
-    "className": "ComfyUIClient",
-    "methods": {
-      "queuePrompt": {
-        "description": "Queue a prompt (API-format workflow) for execution.",
-        "parameters": {
-          "prompt": {
-            "type": "Record<string, any>",
-            "description": "The API-format workflow object"
-          },
-          "clientId": {
-            "type": "string",
-            "description": "Override the client ID for this request"
-          }
-        },
-        "required": [
-          "prompt"
-        ],
-        "returns": "Promise<{ prompt_id: string; number: number }>",
-        "examples": [
-          {
-            "language": "ts",
-            "code": "const { prompt_id } = await comfy.queuePrompt(apiWorkflow)"
-          }
-        ]
-      },
-      "getQueue": {
-        "description": "Get the current prompt queue status.",
-        "parameters": {},
-        "required": [],
-        "returns": "Promise<{ queue_running: any[]; queue_pending: any[] }>"
-      },
-      "getHistory": {
-        "description": "Get execution history, optionally for a specific prompt.",
-        "parameters": {
-          "promptId": {
-            "type": "string",
-            "description": "If provided, returns history for this prompt only"
-          }
-        },
-        "required": [],
-        "returns": "Promise<Record<string, any>>"
-      },
-      "getSystemStats": {
-        "description": "Get system stats including GPU memory and queue info.",
-        "parameters": {},
-        "required": [],
-        "returns": "Promise<any>"
-      },
-      "getObjectInfo": {
-        "description": "Get node type info with input/output schemas.",
-        "parameters": {
-          "nodeClass": {
-            "type": "string",
-            "description": "If provided, returns info for this node type only"
-          }
-        },
-        "required": [],
-        "returns": "Promise<any>"
-      },
-      "interrupt": {
-        "description": "Interrupt the currently executing prompt.",
-        "parameters": {},
-        "required": [],
-        "returns": "Promise<void>"
+          "table"
+        ],
+        "returns": "void"
       },
-      "getModels": {
-        "description": "List available models, optionally filtered by type.",
+      "rpc": {
+        "description": "Call a Postgres function (RPC).",
         "parameters": {
-          "type": {
+          "fn": {
             "type": "string",
-            "description": "Model type filter (e.g., 'checkpoints', 'loras')"
+            "description": "The function name"
+          },
+          "params": {
+            "type": "Record<string, unknown>",
+            "description": "Arguments to pass to the function"
+          },
+          "options": {
+            "type": "{ head?: boolean; get?: boolean; count?: \"exact\" | \"planned\" | \"estimated\" }",
+            "description": "Optional settings (head, get, count)"
           }
         },
-        "required": [],
-        "returns": "Promise<string[]>"
-      },
-      "getEmbeddings": {
-        "description": "List available embedding models.",
-        "parameters": {},
-        "required": [],
-        "returns": "Promise<string[]>"
+        "required": [
+          "fn"
+        ],
+        "returns": "void"
       },
-      "uploadImage": {
-        "description": "Upload an image to ComfyUI's input directory.",
+      "signInWithPassword": {
+        "description": "Sign in with email and password.",
         "parameters": {
-          "file": {
-            "type": "Buffer | Blob",
-            "description": "The image data as Buffer or Blob"
-          },
-          "filename": {
+          "email": {
             "type": "string",
-            "description": "File name for the upload"
+            "description": "Parameter email"
           },
-          "opts": {
-            "type": "{ subfolder?: string; type?: string; overwrite?: boolean }",
-            "description": "Upload options (subfolder, type, overwrite)"
+          "password": {
+            "type": "string",
+            "description": "Parameter password"
           }
         },
         "required": [
-          "file",
-          "filename"
+          "email",
+          "password"
         ],
-        "returns": "Promise<any>"
+        "returns": "void"
       },
-      "viewImage": {
-        "description": "Download a generated image from ComfyUI as a Buffer.",
+      "signUp": {
+        "description": "Create a new user account with email and password.",
         "parameters": {
-          "filename": {
+          "email": {
             "type": "string",
-            "description": "The image filename"
-          },
-          "subfolder": {
-            "type": "any",
-            "description": "Subfolder within the output directory"
+            "description": "Parameter email"
           },
-          "type": {
-            "type": "any",
-            "description": "Image type ('output', 'input', 'temp')"
+          "password": {
+            "type": "string",
+            "description": "Parameter password"
           }
         },
         "required": [
-          "filename"
+          "email",
+          "password"
         ],
-        "returns": "Promise<Buffer>"
+        "returns": "void"
       },
-      "connectWs": {
-        "description": "Open a WebSocket connection to ComfyUI for real-time execution tracking. Events emitted: `execution_start`, `executing`, `progress`, `executed`, `execution_cached`, `execution_error`, `execution_complete`.",
+      "signOut": {
+        "description": "Sign the current user out.",
         "parameters": {},
         "required": [],
-        "returns": "Promise<void>"
+        "returns": "void"
       },
-      "disconnectWs": {
-        "description": "Close the WebSocket connection.",
+      "getSession": {
+        "description": "Get the current session, if any.",
         "parameters": {},
         "required": [],
         "returns": "void"
       },
-      "toApiFormat": {
-        "description": "Convert a UI-format workflow to the API format that /prompt expects. Requires a running ComfyUI instance to fetch `object_info` so we can map positional `widgets_values` to their named input fields. If the workflow is already in API format, it's returned as-is.",
+      "getUser": {
+        "description": "Get the current user, if any.",
+        "parameters": {},
+        "required": [],
+        "returns": "void"
+      },
+      "invoke": {
+        "description": "Invoke a Supabase Edge Function by name.",
         "parameters": {
-          "workflow": {
-            "type": "Record<string, any>",
-            "description": "Parameter workflow"
+          "name": {
+            "type": "string",
+            "description": "Parameter name"
+          },
+          "body": {
+            "type": "any",
+            "description": "Parameter body"
           }
         },
         "required": [
-          "workflow"
+          "name"
         ],
-        "returns": "Promise<Record<string, any>>"
+        "returns": "void"
       },
-      "runWorkflow": {
-        "description": "Run a ComfyUI workflow with optional runtime input overrides. Inputs can be provided in two forms: **Direct node mapping** (when no `inputMap` in options): ``` { '3': { seed: 42 }, '6': { text: 'a cat' } } ``` **Named inputs** (when `inputMap` is provided in options): ``` inputs: { positive_prompt: 'a cat', seed: 42 } options.inputMap: { positive_prompt: { nodeId: '6', field: 'text' }, seed: { nodeId: '3', field: 'seed' } } ```",
+      "subscribe": {
+        "description": "Subscribe to realtime changes on a Postgres table.",
         "parameters": {
-          "workflow": {
-            "type": "Record<string, any>",
-            "description": "Parameter workflow"
+          "channelName": {
+            "type": "string",
+            "description": "A name for this subscription channel"
           },
-          "inputs": {
-            "type": "Record<string, any>",
-            "description": "Parameter inputs"
+          "table": {
+            "type": "string",
+            "description": "The table to listen to"
           },
-          "options": {
-            "type": "WorkflowRunOptions",
-            "description": "Parameter options",
-            "properties": {
-              "poll": {
-                "type": "boolean",
-                "description": "Use polling instead of WebSocket for tracking execution"
-              },
-              "pollInterval": {
-                "type": "number",
-                "description": "Polling interval in ms (default 1000)"
-              },
-              "inputMap": {
-                "type": "InputMapping",
-                "description": "Named input mapping: semantic name -> { nodeId, field }"
-              },
-              "outputDir": {
-                "type": "string",
-                "description": "If provided, output images are downloaded to this directory"
-              }
-            }
+          "callback": {
+            "type": "(payload: any) => void",
+            "description": "Called with the payload on each change"
+          },
+          "event": {
+            "type": "\"INSERT\" | \"UPDATE\" | \"DELETE\" | \"*\"",
+            "description": "The event type to listen for (default: all changes)"
           }
         },
         "required": [
-          "workflow"
+          "channelName",
+          "table",
+          "callback"
         ],
-        "returns": "Promise<WorkflowResult>"
-      }
-    },
-    "getters": {
-      "clientId": {
-        "description": "The unique client ID used for WebSocket session tracking.",
-        "returns": "string"
-      },
-      "wsURL": {
-        "description": "The WebSocket URL derived from baseURL or overridden via options.",
-        "returns": "string"
-      }
-    },
-    "events": {
-      "execution_start": {
-        "name": "execution_start",
-        "description": "Event emitted by ComfyUIClient",
-        "arguments": {}
+        "returns": "RealtimeChannel"
       },
-      "execution_complete": {
-        "name": "execution_complete",
-        "description": "Event emitted by ComfyUIClient",
-        "arguments": {}
+      "unsubscribe": {
+        "description": "Unsubscribe and remove a realtime channel by name.",
+        "parameters": {
+          "channelName": {
+            "type": "string",
+            "description": "The channel name to remove"
+          }
+        },
+        "required": [
+          "channelName"
+        ],
+        "returns": "void"
       },
-      "executing": {
-        "name": "executing",
-        "description": "Event emitted by ComfyUIClient",
-        "arguments": {}
+      "unsubscribeAll": {
+        "description": "Unsubscribe and remove all realtime channels.",
+        "parameters": {},
+        "required": [],
+        "returns": "void"
       },
-      "progress": {
-        "name": "progress",
-        "description": "Event emitted by ComfyUIClient",
-        "arguments": {}
+      "connect": {
+        "description": "Connect is a no-op since the Supabase SDK initializes on construction. The client is ready to use immediately after creation.",
+        "parameters": {},
+        "required": [],
+        "returns": "void"
       },
-      "executed": {
-        "name": "executed",
-        "description": "Event emitted by ComfyUIClient",
-        "arguments": {}
+      "disconnect": {
+        "description": "Disconnect by signing out and removing all realtime channels.",
+        "parameters": {},
+        "required": [],
+        "returns": "void"
+      }
+    },
+    "getters": {
+      "sdk": {
+        "description": "Returns the raw Supabase SDK client for full access to all SDK methods.",
+        "returns": "SupabaseSDKClient<any, any>"
       },
-      "execution_cached": {
-        "name": "execution_cached",
-        "description": "Event emitted by ComfyUIClient",
-        "arguments": {}
+      "storage": {
+        "description": "Returns the Supabase Storage client for managing buckets and files.",
+        "returns": "any"
       },
-      "execution_error": {
-        "name": "execution_error",
-        "description": "Event emitted by ComfyUIClient",
-        "arguments": {}
+      "functions": {
+        "description": "Returns the Supabase Functions client.",
+        "returns": "any"
       }
     },
+    "events": {},
     "state": {},
     "options": {},
     "envVars": [],
     "examples": [
       {
         "language": "ts",
-        "code": "const comfy = container.client('comfyui', { baseURL: 'http://localhost:8188' })\nconst result = await comfy.runWorkflow(workflow, {\n '6': { text: 'a beautiful sunset' }\n})\nconsole.log(result.images)"
-      }
-    ],
-    "types": {
-      "WorkflowRunOptions": {
-        "description": "",
-        "properties": {
-          "poll": {
-            "type": "boolean",
-            "description": "Use polling instead of WebSocket for tracking execution",
-            "optional": true
-          },
-          "pollInterval": {
-            "type": "number",
-            "description": "Polling interval in ms (default 1000)",
-            "optional": true
-          },
-          "inputMap": {
-            "type": "InputMapping",
-            "description": "Named input mapping: semantic name -> { nodeId, field }",
-            "optional": true
-          },
-          "outputDir": {
-            "type": "string",
-            "description": "If provided, output images are downloaded to this directory",
-            "optional": true
-          }
-        }
-      },
-      "WorkflowResult": {
-        "description": "",
-        "properties": {
-          "promptId": {
-            "type": "string",
-            "description": ""
-          },
-          "outputs": {
-            "type": "Record<string, any>",
-            "description": ""
-          },
-          "images": {
-            "type": "Array<{ filename: string; subfolder: string; type: string; localPath?: string }>",
-            "description": "",
-            "optional": true
-          }
-        }
+        "code": "const supabase = container.client('supabase', {\n supabaseUrl: 'https://xyz.supabase.co',\n supabaseKey: 'your-anon-key',\n})\n\n// Query data\nconst { data } = await supabase.from('users').select('*')\n\n// Auth\nawait supabase.signInWithPassword('user@example.com', 'password')\n\n// Realtime\nsupabase.subscribe('changes', 'users', (payload) => {\n console.log('Change:', payload)\n})"
       }
-    }
+    ]
   },
   {
     "id": "servers.mcp",
@@ -31499,7 +31736,7 @@ export const introspectionData = [
             "description": "Tool schema, description, and handler",
             "properties": {
               "schema": {
-                "type": "z.ZodObject<any>",
+                "type": "z.ZodType",
                 "description": ""
               },
               "description": {
@@ -31507,7 +31744,7 @@ export const introspectionData = [
                 "description": ""
               },
               "handler": {
-                "type": "(args: any, ctx: MCPContext) => any",
+                "type": "Function | ((args: any, ctx: any) => any)",
                 "description": ""
               }
             }
@@ -31649,7 +31886,7 @@ export const introspectionData = [
         "description": "",
         "properties": {
           "schema": {
-            "type": "z.ZodObject<any>",
+            "type": "z.ZodType",
             "description": "",
             "optional": true
           },
@@ -31659,17 +31896,9 @@ export const introspectionData = [
             "optional": true
           },
           "handler": {
-            "type": "(args: any, ctx: MCPContext) => any",
-            "description": ""
-          }
-        }
-      },
-      "MCPContext": {
-        "description": "Context object passed to all MCP tool, resource, and prompt handlers.",
-        "properties": {
-          "container": {
-            "type": "NodeContainer",
-            "description": ""
+            "type": "Function | ((args: any, ctx: any) => any)",
+            "description": "",
+            "optional": true
           }
         }
       },
@@ -31697,6 +31926,15 @@ export const introspectionData = [
           }
         }
       },
+      "MCPContext": {
+        "description": "Context object passed to all MCP tool, resource, and prompt handlers.",
+        "properties": {
+          "container": {
+            "type": "NodeContainer",
+            "description": ""
+          }
+        }
+      },
       "PromptRegistrationOptions": {
         "description": "",
         "properties": {
@@ -31985,8 +32223,51 @@ export const introspectionData = [
     "shortcut": "features.assistantsManager",
     "className": "AssistantsManager",
     "methods": {
+      "intercept": {
+        "description": "Registers a pipeline interceptor that is applied to every assistant created by this manager. Interceptors are applied at the given interception point on each assistant at creation time. This mirrors the per-assistant `assistant.intercept(point, fn)` API, but scopes it globally across all assistants managed here — useful for cross-cutting concerns like logging, tracing, or policy enforcement.",
+        "parameters": {
+          "point": {
+            "type": "K",
+            "description": "The interception point (beforeAsk, beforeTurn, beforeToolCall, afterToolCall, beforeResponse)"
+          },
+          "fn": {
+            "type": "InterceptorFn<InterceptorPoints[K]>",
+            "description": "Middleware function receiving (ctx, next)"
+          }
+        },
+        "required": [
+          "point",
+          "fn"
+        ],
+        "returns": "this",
+        "examples": [
+          {
+            "language": "ts",
+            "code": "manager.intercept('beforeAsk', async (ctx, next) => {\n console.log(`[${ctx.assistant.name}] asking: ${ctx.message}`)\n await next()\n})"
+          }
+        ]
+      },
+      "addDiscoveryFolder": {
+        "description": "Registers an additional folder to scan during assistant discovery and immediately triggers a new discovery pass.",
+        "parameters": {
+          "folderPath": {
+            "type": "string",
+            "description": "Absolute path to a folder containing assistant subdirectories"
+          }
+        },
+        "required": [
+          "folderPath"
+        ],
+        "returns": "Promise<this>",
+        "examples": [
+          {
+            "language": "ts",
+            "code": "await manager.addDiscoveryFolder('/path/to/more/assistants')\nconsole.log(manager.available) // includes assistants from the new folder"
+          }
+        ]
+      },
       "discover": {
-        "description": "Discovers assistants by listing subdirectories in ~/.luca/assistants/ and cwd/assistants/. Each subdirectory containing a CORE.md is an assistant.",
+        "description": "",
         "parameters": {},
         "required": [],
         "returns": "Promise<this>"
@@ -32229,6 +32510,47 @@ export const introspectionData = [
         ],
         "returns": "this"
       },
+      "stub": {
+        "description": "Register a hardcoded stub response that bypasses the API when the user's message matches. Streaming is still simulated — chunk/preview events fire word-by-word.",
+        "parameters": {
+          "matcher": {
+            "type": "string | RegExp",
+            "description": "Exact string match, substring, or RegExp tested against user input"
+          },
+          "response": {
+            "type": "string | (() => string)",
+            "description": "The text to stream back, or a zero-arg function that returns it"
+          }
+        },
+        "required": [
+          "matcher",
+          "response"
+        ],
+        "returns": "this",
+        "examples": [
+          {
+            "language": "ts",
+            "code": "conversation.stub('hello', 'Hi there!')\nconversation.stub(/weather/i, () => 'Sunny and 72°F.')"
+          }
+        ]
+      },
+      "fork": {
+        "description": "Fork the conversation into a new independent instance. The fork inherits the same system prompt, tools, and full message history, but has its own identity and state — changes in either direction do not affect the other.",
+        "parameters": {
+          "overrides": {
+            "type": "Partial<ConversationOptions>",
+            "description": "Optional option overrides for the forked conversation (e.g. different model or title)"
+          }
+        },
+        "required": [],
+        "returns": "Conversation",
+        "examples": [
+          {
+            "language": "ts",
+            "code": "const fork = conversation.fork()\nawait fork.ask('What if we took a different approach?')\n// original conversation is unchanged"
+          }
+        ]
+      },
       "estimateTokens": {
         "description": "Estimate the input token count for the current messages array using the js-tiktoken tokenizer. Updates state.",
         "parameters": {},
@@ -32407,48 +32729,48 @@ export const introspectionData = [
         "description": "Event emitted by Conversation",
         "arguments": {}
       },
-      "rawEvent": {
-        "name": "rawEvent",
+      "chunk": {
+        "name": "chunk",
         "description": "Event emitted by Conversation",
         "arguments": {}
       },
-      "mcpEvent": {
-        "name": "mcpEvent",
+      "preview": {
+        "name": "preview",
         "description": "Event emitted by Conversation",
         "arguments": {}
       },
-      "chunk": {
-        "name": "chunk",
+      "turnEnd": {
+        "name": "turnEnd",
         "description": "Event emitted by Conversation",
         "arguments": {}
       },
-      "preview": {
-        "name": "preview",
+      "response": {
+        "name": "response",
         "description": "Event emitted by Conversation",
         "arguments": {}
       },
-      "responseCompleted": {
-        "name": "responseCompleted",
+      "rawEvent": {
+        "name": "rawEvent",
         "description": "Event emitted by Conversation",
         "arguments": {}
       },
-      "toolCallsStart": {
-        "name": "toolCallsStart",
+      "mcpEvent": {
+        "name": "mcpEvent",
         "description": "Event emitted by Conversation",
         "arguments": {}
       },
-      "toolCallsEnd": {
-        "name": "toolCallsEnd",
+      "responseCompleted": {
+        "name": "responseCompleted",
         "description": "Event emitted by Conversation",
         "arguments": {}
       },
-      "turnEnd": {
-        "name": "turnEnd",
+      "toolCallsStart": {
+        "name": "toolCallsStart",
         "description": "Event emitted by Conversation",
         "arguments": {}
       },
-      "response": {
-        "name": "response",
+      "toolCallsEnd": {
+        "name": "toolCallsEnd",
         "description": "Event emitted by Conversation",
         "arguments": {}
       }
@@ -32546,7 +32868,7 @@ export const introspectionData = [
         ],
         "returns": "EndpointInfo | undefined"
       },
-      "toTools": {
+      "toOpenAITools": {
         "description": "Convert all endpoints into OpenAI-compatible tool definitions.",
         "parameters": {
           "filter": {
@@ -32640,7 +32962,7 @@ export const introspectionData = [
     "examples": [
       {
         "language": "ts",
-        "code": "const api = container.feature('openapi', { url: 'https://petstore.swagger.io/v2' })\nawait api.load()\n\n// Inspect all endpoints\napi.endpoints\n\n// Get a single endpoint by its friendly name\napi.endpoint('getPetById')\n\n// Convert to OpenAI tool definitions\napi.toTools()\n\n// Convert a single endpoint to a function definition\napi.toFunction('getPetById')"
+        "code": "const api = container.feature('openapi', { url: 'https://petstore.swagger.io/v2' })\nawait api.load()\n\n// Inspect all endpoints\napi.endpoints\n\n// Get a single endpoint by its friendly name\napi.endpoint('getPetById')\n\n// Convert to OpenAI tool definitions\napi.toOpenAITools()\n\n// Convert a single endpoint to a function definition\napi.toFunction('getPetById')"
       }
     ],
     "types": {
@@ -33565,6 +33887,19 @@ export const introspectionData = [
     "shortcut": "features.skillsLibrary",
     "className": "SkillsLibrary",
     "methods": {
+      "setupToolsConsumer": {
+        "description": "",
+        "parameters": {
+          "assistant": {
+            "type": "Feature",
+            "description": "Parameter assistant"
+          }
+        },
+        "required": [
+          "assistant"
+        ],
+        "returns": "void"
+      },
       "start": {
         "description": "Start the skills library: read config, scan all locations.",
         "parameters": {},
@@ -33691,6 +34026,24 @@ export const introspectionData = [
           "{ skillName, question }"
         ],
         "returns": "Promise<string>"
+      },
+      "findRelevantSkillsForAssistant": {
+        "description": "Fork the given assistant and ask it which skills (if any) are relevant to the user's query. Returns an array of skill names that should be loaded before the real question is answered. The fork is ephemeral (historyMode: 'none') and uses structured output so the result is always a clean string array — never free text.",
+        "parameters": {
+          "assistant": {
+            "type": "Assistant",
+            "description": "The assistant instance to fork"
+          },
+          "userQuery": {
+            "type": "string",
+            "description": "The user's original question"
+          }
+        },
+        "required": [
+          "assistant",
+          "userQuery"
+        ],
+        "returns": "Promise<string[]>"
       }
     },
     "getters": {
@@ -34126,6 +34479,10 @@ export const introspectionData = [
         "description": "Parsed YAML frontmatter from CORE.md, or empty object if none.",
         "returns": "Record<string, any>"
       },
+      "effectiveOptions": {
+        "description": "Merged options where CORE.md frontmatter provides defaults and constructor options take precedence. Prefer this over `this.options` anywhere model parameters or runtime config is consumed.",
+        "returns": "AssistantOptions & Record<string, any>"
+      },
       "paths": {
         "description": "Provides a helper for creating paths off of the assistant's base folder",
         "returns": "any"
@@ -34704,6 +35061,77 @@ export const introspectionData = [
           }
         ]
       },
+      "listProcessSessions": {
+        "description": "List all Claude Code processes currently registered in ~/.claude/sessions/. Returns each session's metadata along with whether the process is still alive.",
+        "parameters": {},
+        "required": [],
+        "returns": "Promise<Array<{\n    pid: number\n    sessionId: string\n    cwd: string\n    startedAt: number\n    kind: string\n    entrypoint: string\n    alive: boolean\n  }>>",
+        "examples": [
+          {
+            "language": "ts",
+            "code": "const sessions = await cc.listProcessSessions()\nfor (const s of sessions) {\n console.log(`[${s.alive ? 'LIVE' : 'dead'}] PID ${s.pid} in ${s.cwd}`)\n}"
+          }
+        ]
+      },
+      "getProcessSession": {
+        "description": "Read a single process session by PID from ~/.claude/sessions/<pid>.json.",
+        "parameters": {
+          "pid": {
+            "type": "number",
+            "description": "The process ID"
+          }
+        },
+        "required": [
+          "pid"
+        ],
+        "returns": "Promise<{\n    pid: number\n    sessionId: string\n    cwd: string\n    startedAt: number\n    kind: string\n    entrypoint: string\n  } | null>",
+        "examples": [
+          {
+            "language": "ts",
+            "code": "const session = await cc.getProcessSession(12345)\nconsole.log(session?.cwd)"
+          }
+        ]
+      },
+      "getConversationHistory": {
+        "description": "Read the conversation history for a Claude Code session from its JSONL file in ~/.claude/projects/<encoded-cwd>/<sessionId>.jsonl. Returns an array of parsed message objects (user, assistant, tool_use, tool_result).",
+        "parameters": {
+          "sessionId": {
+            "type": "string",
+            "description": "The Claude CLI session ID (from listProcessSessions or getProcessSession)"
+          },
+          "cwd": {
+            "type": "string",
+            "description": "The working directory of the session (used to locate the project folder)"
+          }
+        },
+        "required": [
+          "sessionId"
+        ],
+        "returns": "Promise<any[]>",
+        "examples": [
+          {
+            "language": "ts",
+            "code": "const sessions = await cc.listProcessSessions()\nconst s = sessions[0]\nconst history = await cc.getConversationHistory(s.sessionId, s.cwd)\nconsole.log(history.length, 'turns')"
+          }
+        ]
+      },
+      "listSessionsForCwd": {
+        "description": "List all conversation sessions stored for a given working directory. Reads ~/.claude/projects/<encoded-cwd>/ and returns metadata for each .jsonl file.",
+        "parameters": {
+          "cwd": {
+            "type": "string",
+            "description": "The working directory path to look up"
+          }
+        },
+        "required": [],
+        "returns": "Promise<Array<{\n    sessionId: string\n    filePath: string\n    messageCount: number\n  }>>",
+        "examples": [
+          {
+            "language": "ts",
+            "code": "const sessions = await cc.listSessionsForCwd('/Users/me/my-project')\nfor (const s of sessions) {\n console.log(s.sessionId, s.messageCount, 'messages')\n}"
+          }
+        ]
+      },
       "cleanupMcpTempFiles": {
         "description": "Clean up any temp MCP config files created during sessions.",
         "parameters": {},
@@ -36896,7 +37324,7 @@ export const containerIntrospectionData = [
             "description": "The id of the feature to create."
           },
           "options": {
-            "type": "ConstructorParameters<Features[T]>[0]",
+            "type": "FeatureInputOptions<Features>[T] | Record<string, unknown>",
             "description": "The options to pass to the feature constructor."
           }
         },
@@ -36905,6 +37333,52 @@ export const containerIntrospectionData = [
         ],
         "returns": "InstanceType<Features[T]>"
       },
+      "entity": {
+        "description": "Creates a lightweight entity object with observable state, a typed event bus, and access to the container. Same id + options always returns the same cached base instance. An optional third argument auto-extends the entity with functions and getters. All extended methods and getters can access the entity (state, options, container, on/off/emit, etc.) via `this`.",
+        "parameters": {
+          "id": {
+            "type": "string",
+            "description": "Stable identifier for this entity (included in cache key)"
+          },
+          "options": {
+            "type": "TOptions",
+            "description": "Arbitrary options stored on `entity.options` (included in cache key)"
+          },
+          "extensions": {
+            "type": "Ext & ThisType<Entity<TState, TOptions, TEvents> & Ext>",
+            "description": "Optional object of functions/getters to graft onto the entity"
+          }
+        },
+        "required": [
+          "id"
+        ],
+        "returns": "Entity<TState, TOptions, TEvents> & Ext",
+        "examples": [
+          {
+            "language": "ts",
+            "code": "// Basic entity with typed state and events\nconst counter = container.entity<{ count: number }>('counter')\ncounter.setState({ count: 0 })\ncounter.on('tick', () => counter.setState(s => ({ count: s.count + 1 })))\n\n// With options and auto-extension\nconst user = container.entity('user:42', { name: 'Alice' }, {\n greet() { return `Hello ${this.options.name}` },\n get label() { return `User: ${this.options.name}` },\n})\nuser.greet() // \"Hello Alice\""
+          }
+        ]
+      },
+      "getHelperByUUID": {
+        "description": "Look up any helper instance (feature, client, server) by its UUID. Returns undefined if the UUID is unknown or the instance was never created.",
+        "parameters": {
+          "uuid": {
+            "type": "string",
+            "description": "The `instance.uuid` value assigned at construction time"
+          }
+        },
+        "required": [
+          "uuid"
+        ],
+        "returns": "Helper | undefined",
+        "examples": [
+          {
+            "language": "ts",
+            "code": "const assistant = container.feature('assistant')\nconst { uuid } = assistant\n// ... later ...\nconst same = container.getHelperByUUID(uuid) // === assistant"
+          }
+        ]
+      },
       "start": {
         "description": "Start the container. Emits the 'started' event and sets `state.started` to true. Plugins and features can listen for this event to perform initialization.",
         "parameters": {},
@@ -37210,7 +37684,7 @@ export const containerIntrospectionData = [
       },
       "urlUtils": {
         "description": "Returns URL utility functions for parsing URIs.",
-        "returns": "{ parse: (uri: string) => url.URL | null }"
+        "returns": "{ parse: (uri: string) => url.UrlWithStringQuery }"
       },
       "paths": {
         "description": "Returns path utility functions scoped to the current working directory (join, resolve, relative, dirname, parse).",