@socketsecurity/lib 1.3.5 → 2.0.0

package/dist/debug.d.ts

@@ -18,17 +18,14 @@ export type { DebugOptions, NamespacesOrOptions, InspectOptions };
 /**
  * Debug output for object inspection with caller info.
  */
-/*@__NO_SIDE_EFFECTS__*/
 declare function debugDirNs(namespacesOrOpts: NamespacesOrOptions, obj: unknown, inspectOpts?: InspectOptions | undefined): void;
 /**
  * Debug output with caller info.
  */
-/*@__NO_SIDE_EFFECTS__*/
 declare function debugNs(namespacesOrOpts: NamespacesOrOptions, ...args: unknown[]): void;
 /**
  * Debug logging function with caller info.
  */
-/*@__NO_SIDE_EFFECTS__*/
 declare function debugLogNs(namespacesOrOpts: NamespacesOrOptions, ...args: unknown[]): void;
 /**
  * Debug output for cache operations with caller info.
@@ -36,7 +33,6 @@ declare function debugLogNs(namespacesOrOpts: NamespacesOrOptions, ...args: unkn
  * Second argument is the cache key or message.
  * Optional third argument is metadata object.
  */
-/*@__NO_SIDE_EFFECTS__*/
 declare function debugCacheNs(namespacesOrOpts: NamespacesOrOptions, operation: string, key: string, meta?: unknown | undefined): void;
 /**
  * Cache debug function with caller info.
@@ -51,17 +47,14 @@ declare function isDebugNs(namespaces: string | undefined): boolean;
 /**
  * Debug output with caller info (wrapper for debugNs with default namespace).
  */
-/*@__NO_SIDE_EFFECTS__*/
 declare function debug(...args: unknown[]): void;
 /**
  * Debug output for object inspection (wrapper for debugDirNs with default namespace).
  */
-/*@__NO_SIDE_EFFECTS__*/
 declare function debugDir(obj: unknown, inspectOpts?: InspectOptions | undefined): void;
 /**
  * Debug logging function (wrapper for debugLogNs with default namespace).
  */
-/*@__NO_SIDE_EFFECTS__*/
 declare function debugLog(...args: unknown[]): void;
 /**
  * Check if debug mode is enabled.

package/dist/debug.js

@@ -1,4 +1,4 @@
 /* Socket Lib - Built with esbuild */
-var A=Object.create;var h=Object.defineProperty;var G=Object.getOwnPropertyDescriptor;var j=Object.getOwnPropertyNames;var T=Object.getPrototypeOf,L=Object.prototype.hasOwnProperty;var W=(n,t)=>{for(var e in t)h(n,e,{get:t[e],enumerable:!0})},S=(n,t,e,i)=>{if(t&&typeof t=="object"||typeof t=="function")for(let o of j(t))!L.call(n,o)&&o!==e&&h(n,o,{get:()=>t[o],enumerable:!(i=G(t,o))||i.enumerable});return n};var I=(n,t,e)=>(e=n!=null?A(T(n)):{},S(t||!n||!n.__esModule?h(e,"default",{value:n,enumerable:!0}):e,n)),J=n=>S(h({},"__esModule",{value:!0}),n);var Y={};W(Y,{debug:()=>P,debugCache:()=>K,debugCacheNs:()=>q,debugDir:()=>z,debugDirNs:()=>H,debugLog:()=>F,debugLogNs:()=>v,debugNs:()=>U,debuglog:()=>V,debugtime:()=>X,isDebug:()=>Q,isDebugNs:()=>M});module.exports=J(Y);var m=require("#constants/process"),C=require("#env/debug"),a=require("#env/socket-debug"),g=I(require("./external/@socketregistry/is-unicode-supported")),f=I(require("./external/debug")),d=require("./logger"),B=require("./objects"),k=require("./strings");const $=Reflect.apply,E=new Map;function _(n){let t=E.get(n);return t||(!C.DEBUG&&a.SOCKET_DEBUG&&(n==="error"||n==="notice")&&f.default.enable(n),t=(0,f.default)(n),t.log=R,E.set(n,t),t)}let D;function N(){return D===void 0&&(D=require("node:util")),D}function b(n=3){let t="";const e=Error.captureStackTrace;if(typeof e=="function"){const i={};e(i,b);const o=i.stack;if(typeof o=="string"){let u=0,c=0;for(let s=0,{length:l}=o;s<l;s+=1)if(o[s]===`
-`)if(u+=1,u<n)c=s+1;else{const r=o.slice(c,s).trimStart(),w=/(?<=^at\s+).*?(?=\s+\(|$)/.exec(r)?.[0];if(w&&(t=w.replace(/^(?:async|bound|get|new|set)\s+/,""),t.startsWith("Object."))){const x=t.slice(7);(0,B.hasOwn)(Object,x)||(t=x)}break}}}return t}function R(...n){const t=N(),e=f.default.inspectOpts?{...f.default.inspectOpts,showHidden:f.default.inspectOpts.showHidden===null?void 0:f.default.inspectOpts.showHidden,depth:f.default.inspectOpts.depth===null||typeof f.default.inspectOpts.depth=="boolean"?void 0:f.default.inspectOpts.depth}:{};$(d.logger.info,d.logger,[t.formatWithOptions(e,...n)])}function y(n){return n!==null&&typeof n=="object"?{__proto__:null,...n}:{__proto__:null,namespaces:n}}function O(n){if(!a.SOCKET_DEBUG)return!1;if(typeof n!="string"||!n||n==="*")return!0;const t=n.trim().replace(/\s+/g,",").split(",").filter(Boolean),e=[],i=[];for(const o of t)o.startsWith("-")?i.push(o.slice(1)):e.push(o);return e.length&&!e.some(o=>_(o).enabled)?!1:i.every(o=>!_(o).enabled)}function H(n,t,e){const i=y(n),{namespaces:o}=i;if(!O(o))return;const u=b(4)||"anonymous";p===void 0&&(p=(0,g.default)()?"\u25B8":">");let c=e;if(c===void 0){const r=f.default.inspectOpts;r&&(c={...r,showHidden:r.showHidden===null?void 0:r.showHidden,depth:r.depth===null||typeof r.depth=="boolean"?null:r.depth})}const s=i.spinner||(0,m.getSpinner)(),l=s?.isSpinning;s?.stop(),d.logger.info(`[DEBUG] ${u} ${p} object inspection:`),d.logger.dir(t,e),l&&s?.start()}let p;function U(n,...t){const e=y(n),{namespaces:i}=e;if(!O(i))return;const o=b(4)||"anonymous";p===void 0&&(p=(0,g.default)()?"\u25B8":">");const u=t.at(0),c=typeof u=="string"?[(0,k.applyLinePrefix)(`${o?`${o} ${p} `:""}${u}`,{prefix:"[DEBUG] "}),...t.slice(1)]:t,s=e.spinner||(0,m.getSpinner)(),l=s?.isSpinning;s?.stop(),$(d.logger.info,d.logger,c),l&&s?.start()}function v(n,...t){const e=y(n),{namespaces:i}=e;if(!O(i))return;const o=b(4)||"anonymous";p===void 0&&(p=(0,g.default)()?"\u25B8":">");const u=t.at(0),c=typeof u=="string"?[(0,k.applyLinePrefix)(`${o?`${o} ${p} `:""}${u}`,{prefix:"[DEBUG] "}),...t.slice(1)]:[`[DEBUG] ${o} ${p}`,...t],s=e.spinner||(0,m.getSpinner)(),l=s?.isSpinning;s?.stop(),$(d.logger.info,d.logger,c),l&&s?.start()}function q(n,t,e,i){const o=y(n),{namespaces:u}=o;if(!O(u))return;const c=b(4)||"cache";p===void 0&&(p=(0,g.default)()?"\u25B8":">");const s=`[CACHE] ${c} ${p} ${t}: ${e}`,l=i!==void 0?[s,i]:[s],r=o.spinner||(0,m.getSpinner)(),w=r?.isSpinning;r?.stop(),$(d.logger.info,d.logger,l),w&&r?.start()}function K(n,t,e){if(!a.SOCKET_DEBUG)return;const i=b(3)||"cache";p===void 0&&(p=(0,g.default)()?"\u25B8":">");const o=`[CACHE] ${i} ${p} ${n}: ${t}`;console.log(...e!==void 0?[o,e]:[o])}function M(n){return!!a.SOCKET_DEBUG&&O(n)}function P(...n){[...n]}function z(n,t){}function F(...n){[...n]}function Q(){return!!a.SOCKET_DEBUG}function V(n){return N().debuglog(n)}function X(n){const t=N();let e;const i=()=>{if(e===void 0)e=Date.now();else{const o=Date.now()-e;t.debuglog("time")(`${n}: ${o}ms`),e=void 0}};return i.start=()=>{e=Date.now()},i.end=()=>{if(e!==void 0){const o=Date.now()-e;t.debuglog("time")(`${n}: ${o}ms`),e=void 0}},i}0&&(module.exports={debug,debugCache,debugCacheNs,debugDir,debugDirNs,debugLog,debugLogNs,debugNs,debuglog,debugtime,isDebug,isDebugNs});
+var U=Object.create;var h=Object.defineProperty;var j=Object.getOwnPropertyDescriptor;var G=Object.getOwnPropertyNames;var L=Object.getPrototypeOf,T=Object.prototype.hasOwnProperty;var W=(n,t)=>{for(var e in t)h(n,e,{get:t[e],enumerable:!0})},S=(n,t,e,i)=>{if(t&&typeof t=="object"||typeof t=="function")for(let o of G(t))!T.call(n,o)&&o!==e&&h(n,o,{get:()=>t[o],enumerable:!(i=j(t,o))||i.enumerable});return n};var I=(n,t,e)=>(e=n!=null?U(L(n)):{},S(t||!n||!n.__esModule?h(e,"default",{value:n,enumerable:!0}):e,n)),J=n=>S(h({},"__esModule",{value:!0}),n);var Y={};W(Y,{debug:()=>z,debugCache:()=>M,debugCacheNs:()=>q,debugDir:()=>F,debugDirNs:()=>v,debugLog:()=>K,debugLogNs:()=>B,debugNs:()=>A,debuglog:()=>V,debugtime:()=>X,isDebug:()=>Q,isDebugNs:()=>P});module.exports=J(Y);var m=require("#constants/process"),E=require("#env/debug"),a=require("#env/socket"),g=I(require("./external/@socketregistry/is-unicode-supported")),f=I(require("./external/debug")),d=require("./logger"),H=require("./objects"),D=require("./strings");const $=Reflect.apply,_=new Map;function C(n){let t=_.get(n);return t||(!(0,E.getDebug)()&&(0,a.getSocketDebug)()&&(n==="error"||n==="notice")&&f.default.enable(n),t=(0,f.default)(n),t.log=R,_.set(n,t),t)}let x;function N(){return x===void 0&&(x=require("node:util")),x}function b(n=3){let t="";const e=Error.captureStackTrace;if(typeof e=="function"){const i={};e(i,b);const o=i.stack;if(typeof o=="string"){let u=0,c=0;for(let s=0,{length:l}=o;s<l;s+=1)if(o[s]===`
+`)if(u+=1,u<n)c=s+1;else{const r=o.slice(c,s).trimStart(),w=/(?<=^at\s+).*?(?=\s+\(|$)/.exec(r)?.[0];if(w&&(t=w.replace(/^(?:async|bound|get|new|set)\s+/,""),t.startsWith("Object."))){const k=t.slice(7);(0,H.hasOwn)(Object,k)||(t=k)}break}}}return t}function R(...n){const t=N(),e=f.default.inspectOpts?{...f.default.inspectOpts,showHidden:f.default.inspectOpts.showHidden===null?void 0:f.default.inspectOpts.showHidden,depth:f.default.inspectOpts.depth===null||typeof f.default.inspectOpts.depth=="boolean"?void 0:f.default.inspectOpts.depth}:{};$(d.logger.info,d.logger,[t.formatWithOptions(e,...n)])}function y(n){return n!==null&&typeof n=="object"?{__proto__:null,...n}:{__proto__:null,namespaces:n}}function O(n){if(!(0,a.getSocketDebug)())return!1;if(typeof n!="string"||!n||n==="*")return!0;const t=n.trim().replace(/\s+/g,",").split(",").filter(Boolean),e=[],i=[];for(const o of t)o.startsWith("-")?i.push(o.slice(1)):e.push(o);return e.length&&!e.some(o=>C(o).enabled)?!1:i.every(o=>!C(o).enabled)}function v(n,t,e){const i=y(n),{namespaces:o}=i;if(!O(o))return;const u=b(4)||"anonymous";p===void 0&&(p=(0,g.default)()?"\u25B8":">");let c=e;if(c===void 0){const r=f.default.inspectOpts;r&&(c={...r,showHidden:r.showHidden===null?void 0:r.showHidden,depth:r.depth===null||typeof r.depth=="boolean"?null:r.depth})}const s=i.spinner||(0,m.getSpinner)(),l=s?.isSpinning;s?.stop(),d.logger.info(`[DEBUG] ${u} ${p} object inspection:`),d.logger.dir(t,e),l&&s?.start()}let p;function A(n,...t){const e=y(n),{namespaces:i}=e;if(!O(i))return;const o=b(4)||"anonymous";p===void 0&&(p=(0,g.default)()?"\u25B8":">");const u=t.at(0),c=typeof u=="string"?[(0,D.applyLinePrefix)(`${o?`${o} ${p} `:""}${u}`,{prefix:"[DEBUG] "}),...t.slice(1)]:t,s=e.spinner||(0,m.getSpinner)(),l=s?.isSpinning;s?.stop(),$(d.logger.info,d.logger,c),l&&s?.start()}function B(n,...t){const e=y(n),{namespaces:i}=e;if(!O(i))return;const o=b(4)||"anonymous";p===void 0&&(p=(0,g.default)()?"\u25B8":">");const u=t.at(0),c=typeof u=="string"?[(0,D.applyLinePrefix)(`${o?`${o} ${p} `:""}${u}`,{prefix:"[DEBUG] "}),...t.slice(1)]:[`[DEBUG] ${o} ${p}`,...t],s=e.spinner||(0,m.getSpinner)(),l=s?.isSpinning;s?.stop(),$(d.logger.info,d.logger,c),l&&s?.start()}function q(n,t,e,i){const o=y(n),{namespaces:u}=o;if(!O(u))return;const c=b(4)||"cache";p===void 0&&(p=(0,g.default)()?"\u25B8":">");const s=`[CACHE] ${c} ${p} ${t}: ${e}`,l=i!==void 0?[s,i]:[s],r=o.spinner||(0,m.getSpinner)(),w=r?.isSpinning;r?.stop(),$(d.logger.info,d.logger,l),w&&r?.start()}function M(n,t,e){if(!(0,a.getSocketDebug)())return;const i=b(3)||"cache";p===void 0&&(p=(0,g.default)()?"\u25B8":">");const o=`[CACHE] ${i} ${p} ${n}: ${t}`;console.log(...e!==void 0?[o,e]:[o])}function P(n){return!!(0,a.getSocketDebug)()&&O(n)}function z(...n){A("*",...n)}function F(n,t){v("*",n,t)}function K(...n){B("*",...n)}function Q(){return!!(0,a.getSocketDebug)()}function V(n){return N().debuglog(n)}function X(n){const t=N();let e;const i=()=>{if(e===void 0)e=Date.now();else{const o=Date.now()-e;t.debuglog("time")(`${n}: ${o}ms`),e=void 0}};return i.start=()=>{e=Date.now()},i.end=()=>{if(e!==void 0){const o=Date.now()-e;t.debuglog("time")(`${n}: ${o}ms`),e=void 0}},i}0&&(module.exports={debug,debugCache,debugCacheNs,debugDir,debugDirNs,debugLog,debugLogNs,debugNs,debuglog,debugtime,isDebug,isDebugNs});
 //# sourceMappingURL=debug.js.map

package/dist/debug.js.map

@@ -1,7 +1,7 @@
 {
   "version": 3,
   "sources": ["../src/debug.ts"],
-  "sourcesContent": ["/**\n * @fileoverview Debug logging utilities with lazy loading and environment-based control.\n * Provides Socket CLI specific debug functionality and logging formatters.\n */\n\nimport { getSpinner } from '#constants/process'\nimport { DEBUG } from '#env/debug'\nimport { SOCKET_DEBUG } from '#env/socket-debug'\nimport isUnicodeSupported from './external/@socketregistry/is-unicode-supported'\nimport debugJs from './external/debug'\n\nimport { logger } from './logger'\nimport { hasOwn } from './objects'\nimport { applyLinePrefix } from './strings'\n\n// IMPORTANT: Do not use destructuring here - use direct assignment instead.\n// tsgo has a bug that incorrectly transpiles destructured exports, resulting in\n// `exports.SomeName = void 0;` which causes runtime errors.\n// See: https://github.com/SocketDev/socket-packageurl-js/issues/3\nconst ReflectApply = Reflect.apply\n\n// Type definitions\ninterface DebugOptions {\n  namespaces?: string\n  spinner?: { isSpinning: boolean; stop(): void; start(): void }\n  [key: string]: unknown\n}\n\ntype NamespacesOrOptions = string | DebugOptions\n\ninterface InspectOptions {\n  depth?: number | null\n  colors?: boolean\n  [key: string]: unknown\n}\n\nexport type { DebugOptions, NamespacesOrOptions, InspectOptions }\n\nconst debugByNamespace = new Map()\n/**\n * Get or create a debug instance for a namespace.\n * @private\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction getDebugJsInstance(namespace: string) {\n  let inst = debugByNamespace.get(namespace)\n  if (inst) {\n    return inst\n  }\n  if (\n    !DEBUG &&\n    SOCKET_DEBUG &&\n    (namespace === 'error' || namespace === 'notice')\n  ) {\n    debugJs.enable(namespace)\n  }\n  inst = debugJs(namespace)\n  inst.log = customLog\n  debugByNamespace.set(namespace, inst)\n  return inst\n}\n\nlet _util: typeof import('util') | undefined\n/**\n * Lazily load the util module.\n * @private\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction getUtil() {\n  if (_util === undefined) {\n    // Use non-'node:' prefixed require to avoid Webpack errors.\n\n    _util = /*@__PURE__*/ require('node:util')\n  }\n  return _util as typeof import('util')\n}\n\n/**\n * Extract caller information from the stack trace.\n * @private\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction getCallerInfo(stackOffset: number = 3): string {\n  let name = ''\n  const captureStackTrace = Error.captureStackTrace\n  if (typeof captureStackTrace === 'function') {\n    const obj: { stack?: unknown } = {}\n    captureStackTrace(obj, getCallerInfo)\n    const stack = obj.stack\n    if (typeof stack === 'string') {\n      let lineCount = 0\n      let lineStart = 0\n      for (let i = 0, { length } = stack; i < length; i += 1) {\n        if (stack[i] === '\\n') {\n          lineCount += 1\n          if (lineCount < stackOffset) {\n            // Store the start index of the next line.\n            lineStart = i + 1\n          } else {\n            // Extract the full line and trim it.\n            const line = stack.slice(lineStart, i).trimStart()\n            // Match the function name portion (e.g., \"async runFix\").\n            const match = /(?<=^at\\s+).*?(?=\\s+\\(|$)/.exec(line)?.[0]\n            if (match) {\n              name = match\n                // Strip known V8 invocation prefixes to get the name.\n                .replace(/^(?:async|bound|get|new|set)\\s+/, '')\n              if (name.startsWith('Object.')) {\n                // Strip leading 'Object.' if not an own property of Object.\n                const afterDot = name.slice(7 /*'Object.'.length*/)\n                if (!hasOwn(Object, afterDot)) {\n                  name = afterDot\n                }\n              }\n            }\n            break\n          }\n        }\n      }\n    }\n  }\n  return name\n}\n\n/**\n * Custom log function for debug output.\n * @private\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction customLog(...args: unknown[]) {\n  const util = getUtil()\n  const inspectOpts = debugJs.inspectOpts\n    ? {\n        ...debugJs.inspectOpts,\n        showHidden:\n          debugJs.inspectOpts.showHidden === null\n            ? undefined\n            : debugJs.inspectOpts.showHidden,\n        depth:\n          debugJs.inspectOpts.depth === null ||\n          typeof debugJs.inspectOpts.depth === 'boolean'\n            ? undefined\n            : debugJs.inspectOpts.depth,\n      }\n    : {}\n  ReflectApply(logger.info, logger, [\n    util.formatWithOptions(inspectOpts, ...args),\n  ])\n}\n\n/**\n * Extract options from namespaces parameter.\n * @private\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction extractOptions(namespaces: NamespacesOrOptions): DebugOptions {\n  return namespaces !== null && typeof namespaces === 'object'\n    ? ({ __proto__: null, ...namespaces } as DebugOptions)\n    : ({ __proto__: null, namespaces } as DebugOptions)\n}\n\n/**\n * Check if debug is enabled for given namespaces.\n * @private\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction isEnabled(namespaces: string | undefined) {\n  // Check if debugging is enabled at all\n  if (!SOCKET_DEBUG) {\n    return false\n  }\n  if (typeof namespaces !== 'string' || !namespaces || namespaces === '*') {\n    return true\n  }\n  // Namespace splitting logic is based the 'debug' package implementation:\n  // https://github.com/debug-js/debug/blob/4.4.1/src/common.js#L169-L173.\n  const split = namespaces\n    .trim()\n    .replace(/\\s+/g, ',')\n    .split(',')\n    .filter(Boolean)\n  const names = []\n  const skips = []\n  for (const ns of split) {\n    if (ns.startsWith('-')) {\n      skips.push(ns.slice(1))\n    } else {\n      names.push(ns)\n    }\n  }\n  if (names.length && !names.some(ns => getDebugJsInstance(ns).enabled)) {\n    return false\n  }\n  return skips.every(ns => !getDebugJsInstance(ns).enabled)\n}\n\n/**\n * Debug output for object inspection with caller info.\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction debugDirNs(\n  namespacesOrOpts: NamespacesOrOptions,\n  obj: unknown,\n  inspectOpts?: InspectOptions | undefined,\n) {\n  const options = extractOptions(namespacesOrOpts)\n  const { namespaces } = options\n  if (!isEnabled(namespaces as string)) {\n    return\n  }\n  // Get caller info with stack offset of 4 (caller -> debugDirNs -> getCallerInfo).\n  const callerName = getCallerInfo(4) || 'anonymous'\n\n  if (pointingTriangle === undefined) {\n    const supported = isUnicodeSupported()\n    pointingTriangle = supported ? '\u25B8' : '>'\n  }\n\n  let opts: InspectOptions | undefined = inspectOpts\n  if (opts === undefined) {\n    const debugOpts = debugJs.inspectOpts\n    if (debugOpts) {\n      opts = {\n        ...debugOpts,\n        showHidden:\n          debugOpts.showHidden === null ? undefined : debugOpts.showHidden,\n        depth:\n          debugOpts.depth === null || typeof debugOpts.depth === 'boolean'\n            ? null\n            : debugOpts.depth,\n      } as InspectOptions\n    }\n  }\n  const spinnerInstance = options.spinner || getSpinner()\n  const wasSpinning = spinnerInstance?.isSpinning\n  spinnerInstance?.stop()\n  logger.info(`[DEBUG] ${callerName} ${pointingTriangle} object inspection:`)\n  logger.dir(obj, inspectOpts)\n  if (wasSpinning) {\n    spinnerInstance?.start()\n  }\n}\n\nlet pointingTriangle: string | undefined\n/**\n * Debug output with caller info.\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction debugNs(namespacesOrOpts: NamespacesOrOptions, ...args: unknown[]) {\n  const options = extractOptions(namespacesOrOpts)\n  const { namespaces } = options\n  if (!isEnabled(namespaces as string)) {\n    return\n  }\n  // Get caller info with stack offset of 4 (caller -> debugNs -> getCallerInfo).\n  const name = getCallerInfo(4) || 'anonymous'\n  if (pointingTriangle === undefined) {\n    const supported = isUnicodeSupported()\n    pointingTriangle = supported ? '\u25B8' : '>'\n  }\n  const text = args.at(0)\n  const logArgs =\n    typeof text === 'string'\n      ? [\n          applyLinePrefix(\n            `${name ? `${name} ${pointingTriangle} ` : ''}${text}`,\n            { prefix: '[DEBUG] ' },\n          ),\n          ...args.slice(1),\n        ]\n      : args\n  const spinnerInstance = options.spinner || getSpinner()\n  const wasSpinning = spinnerInstance?.isSpinning\n  spinnerInstance?.stop()\n  ReflectApply(logger.info, logger, logArgs)\n  if (wasSpinning) {\n    spinnerInstance?.start()\n  }\n}\n\n/**\n * Debug logging function with caller info.\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction debugLogNs(namespacesOrOpts: NamespacesOrOptions, ...args: unknown[]) {\n  const options = extractOptions(namespacesOrOpts)\n  const { namespaces } = options\n  if (!isEnabled(namespaces as string)) {\n    return\n  }\n  // Get caller info with stack offset of 4 (caller -> debugLogNs -> getCallerInfo).\n  const callerName = getCallerInfo(4) || 'anonymous'\n\n  if (pointingTriangle === undefined) {\n    const supported = isUnicodeSupported()\n    pointingTriangle = supported ? '\u25B8' : '>'\n  }\n\n  const text = args.at(0)\n  const logArgs =\n    typeof text === 'string'\n      ? [\n          applyLinePrefix(\n            `${callerName ? `${callerName} ${pointingTriangle} ` : ''}${text}`,\n            { prefix: '[DEBUG] ' },\n          ),\n          ...args.slice(1),\n        ]\n      : [`[DEBUG] ${callerName} ${pointingTriangle}`, ...args]\n\n  const spinnerInstance = options.spinner || getSpinner()\n  const wasSpinning = spinnerInstance?.isSpinning\n  spinnerInstance?.stop()\n  ReflectApply(logger.info, logger, logArgs)\n  if (wasSpinning) {\n    spinnerInstance?.start()\n  }\n}\n\n/**\n * Debug output for cache operations with caller info.\n * First argument is the operation type (hit/miss/set/clear).\n * Second argument is the cache key or message.\n * Optional third argument is metadata object.\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction debugCacheNs(\n  namespacesOrOpts: NamespacesOrOptions,\n  operation: string,\n  key: string,\n  meta?: unknown | undefined,\n) {\n  const options = extractOptions(namespacesOrOpts)\n  const { namespaces } = options\n  if (!isEnabled(namespaces as string)) {\n    return\n  }\n  // Get caller info with stack offset of 4 (caller -> debugCacheNs -> getCallerInfo).\n  const callerName = getCallerInfo(4) || 'cache'\n\n  if (pointingTriangle === undefined) {\n    const supported = isUnicodeSupported()\n    pointingTriangle = supported ? '\u25B8' : '>'\n  }\n\n  const prefix = `[CACHE] ${callerName} ${pointingTriangle} ${operation}: ${key}`\n  const logArgs = meta !== undefined ? [prefix, meta] : [prefix]\n\n  const spinnerInstance = options.spinner || getSpinner()\n  const wasSpinning = spinnerInstance?.isSpinning\n  spinnerInstance?.stop()\n  ReflectApply(logger.info, logger, logArgs)\n  if (wasSpinning) {\n    spinnerInstance?.start()\n  }\n}\n\n/**\n * Cache debug function with caller info.\n */\n/*@__NO_SIDE_EFFECTS__*/\nexport function debugCache(\n  operation: string,\n  key: string,\n  meta?: unknown | undefined,\n): void {\n  if (!SOCKET_DEBUG) {\n    return\n  }\n  // Get caller info with stack offset of 3 (caller -> debugCache -> getCallerInfo).\n  const callerName = getCallerInfo(3) || 'cache'\n\n  if (pointingTriangle === undefined) {\n    const supported = isUnicodeSupported()\n    pointingTriangle = supported ? '\u25B8' : '>'\n  }\n\n  const prefix = `[CACHE] ${callerName} ${pointingTriangle} ${operation}: ${key}`\n  const args = meta !== undefined ? [prefix, meta] : [prefix]\n  console.log(...args)\n}\n\n/**\n * Check if debug mode is enabled.\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction isDebugNs(namespaces: string | undefined): boolean {\n  return !!SOCKET_DEBUG && isEnabled(namespaces)\n}\n\n/**\n * Debug output with caller info (wrapper for debugNs with default namespace).\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction debug(...args: unknown[]): void {\n  debugNs('*', ...args)\n}\n\n/**\n * Debug output for object inspection (wrapper for debugDirNs with default namespace).\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction debugDir(\n  obj: unknown,\n  inspectOpts?: InspectOptions | undefined,\n): void {\n  debugDirNs('*', obj, inspectOpts)\n}\n\n/**\n * Debug logging function (wrapper for debugLogNs with default namespace).\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction debugLog(...args: unknown[]): void {\n  debugLogNs('*', ...args)\n}\n\n/**\n * Check if debug mode is enabled.\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction isDebug(): boolean {\n  return !!SOCKET_DEBUG\n}\n\n/**\n * Create a Node.js util.debuglog compatible function.\n * Returns a function that conditionally writes debug messages to stderr.\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction debuglog(section: string) {\n  const util = getUtil()\n  return util.debuglog(section)\n}\n\n/**\n * Create timing functions for measuring code execution time.\n * Returns an object with start() and end() methods, plus a callable function.\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction debugtime(label: string) {\n  const util = getUtil()\n  // Node.js util doesn't have debugtime - create a custom implementation\n  let startTime: number | undefined\n  const impl = () => {\n    if (startTime === undefined) {\n      startTime = Date.now()\n    } else {\n      const duration = Date.now() - startTime\n      util.debuglog('time')(`${label}: ${duration}ms`)\n      startTime = undefined\n    }\n  }\n  impl.start = () => {\n    startTime = Date.now()\n  }\n  impl.end = () => {\n    if (startTime !== undefined) {\n      const duration = Date.now() - startTime\n      util.debuglog('time')(`${label}: ${duration}ms`)\n      startTime = undefined\n    }\n  }\n  return impl\n}\n\n// Export main debug functions with caller info.\nexport { debug }\n// debugCache is already exported directly above\nexport { debugCacheNs }\nexport { debugDir }\nexport { debugDirNs }\nexport { debugLog }\nexport { debuglog }\nexport { debugLogNs }\nexport { debugNs }\nexport { debugtime }\nexport { isDebug }\nexport { isDebugNs }\n"],
-  "mappings": ";6iBAAA,IAAAA,EAAA,GAAAC,EAAAD,EAAA,WAAAE,EAAA,eAAAC,EAAA,iBAAAC,EAAA,aAAAC,EAAA,eAAAC,EAAA,aAAAC,EAAA,eAAAC,EAAA,YAAAC,EAAA,aAAAC,EAAA,cAAAC,EAAA,YAAAC,EAAA,cAAAC,IAAA,eAAAC,EAAAd,GAKA,IAAAe,EAA2B,8BAC3BC,EAAsB,sBACtBC,EAA6B,6BAC7BC,EAA+B,8DAC/BF,EAAoB,+BAEpBG,EAAuB,oBACvBC,EAAuB,qBACvBC,EAAgC,qBAMhC,MAAMC,EAAe,QAAQ,MAmBvBC,EAAmB,IAAI,IAM7B,SAASC,EAAmBC,EAAmB,CAC7C,IAAIC,EAAOH,EAAiB,IAAIE,CAAS,EACzC,OAAIC,IAIF,CAAC,SACD,iBACCD,IAAc,SAAWA,IAAc,WAExC,EAAAE,QAAQ,OAAOF,CAAS,EAE1BC,KAAO,EAAAC,SAAQF,CAAS,EACxBC,EAAK,IAAME,EACXL,EAAiB,IAAIE,EAAWC,CAAI,EAC7BA,EACT,CAEA,IAAIG,EAMJ,SAASC,GAAU,CACjB,OAAID,IAAU,SAGZA,EAAsB,QAAQ,WAAW,GAEpCA,CACT,CAOA,SAASE,EAAcC,EAAsB,EAAW,CACtD,IAAIC,EAAO,GACX,MAAMC,EAAoB,MAAM,kBAChC,GAAI,OAAOA,GAAsB,WAAY,CAC3C,MAAMC,EAA2B,CAAC,EAClCD,EAAkBC,EAAKJ,CAAa,EACpC,MAAMK,EAAQD,EAAI,MAClB,GAAI,OAAOC,GAAU,SAAU,CAC7B,IAAIC,EAAY,EACZC,EAAY,EAChB,QAASC,EAAI,EAAG,CAAE,OAAAC,CAAO,EAAIJ,EAAOG,EAAIC,EAAQD,GAAK,EACnD,GAAIH,EAAMG,CAAC,IAAM;AAAA,EAEf,GADAF,GAAa,EACTA,EAAYL,EAEdM,EAAYC,EAAI,MACX,CAEL,MAAME,EAAOL,EAAM,MAAME,EAAWC,CAAC,EAAE,UAAU,EAE3CG,EAAQ,4BAA4B,KAAKD,CAAI,IAAI,CAAC,EACxD,GAAIC,IACFT,EAAOS,EAEJ,QAAQ,kCAAmC,EAAE,EAC5CT,EAAK,WAAW,SAAS,GAAG,CAE9B,MAAMU,EAAWV,EAAK,MAAM,CAAsB,KAC7C,UAAO,OAAQU,CAAQ,IAC1BV,EAAOU,EAEX,CAEF,KACF,CAGN,CACF,CACA,OAAOV,CACT,CAOA,SAASL,KAAagB,EAAiB,CACrC,MAAMC,EAAOf,EAAQ,EACfgB,EAAc,EAAAnB,QAAQ,YACxB,CACE,GAAG,EAAAA,QAAQ,YACX,WACE,EAAAA,QAAQ,YAAY,aAAe,KAC/B,OACA,EAAAA,QAAQ,YAAY,WAC1B,MACE,EAAAA,QAAQ,YAAY,QAAU,MAC9B,OAAO,EAAAA,QAAQ,YAAY,OAAU,UACjC,OACA,EAAAA,QAAQ,YAAY,KAC5B,EACA,CAAC,EACLL,EAAa,SAAO,KAAM,SAAQ,CAChCuB,EAAK,kBAAkBC,EAAa,GAAGF,CAAI,CAC7C,CAAC,CACH,CAOA,SAASG,EAAeC,EAA+C,CACrE,OAAOA,IAAe,MAAQ,OAAOA,GAAe,SAC/C,CAAE,UAAW,KAAM,GAAGA,CAAW,EACjC,CAAE,UAAW,KAAM,WAAAA,CAAW,CACrC,CAOA,SAASC,EAAUD,EAAgC,CAEjD,GAAI,CAAC,eACH,MAAO,GAET,GAAI,OAAOA,GAAe,UAAY,CAACA,GAAcA,IAAe,IAClE,MAAO,GAIT,MAAME,EAAQF,EACX,KAAK,EACL,QAAQ,OAAQ,GAAG,EACnB,MAAM,GAAG,EACT,OAAO,OAAO,EACXG,EAAQ,CAAC,EACTC,EAAQ,CAAC,EACf,UAAWC,KAAMH,EACXG,EAAG,WAAW,GAAG,EACnBD,EAAM,KAAKC,EAAG,MAAM,CAAC,CAAC,EAEtBF,EAAM,KAAKE,CAAE,EAGjB,OAAIF,EAAM,QAAU,CAACA,EAAM,KAAKE,GAAM7B,EAAmB6B,CAAE,EAAE,OAAO,EAC3D,GAEFD,EAAM,MAAMC,GAAM,CAAC7B,EAAmB6B,CAAE,EAAE,OAAO,CAC1D,CAMA,SAAS/C,EACPgD,EACAnB,EACAW,EACA,CACA,MAAMS,EAAUR,EAAeO,CAAgB,EACzC,CAAE,WAAAN,CAAW,EAAIO,EACvB,GAAI,CAACN,EAAUD,CAAoB,EACjC,OAGF,MAAMQ,EAAazB,EAAc,CAAC,GAAK,YAEnC0B,IAAqB,SAEvBA,KADkB,EAAAC,SAAmB,EACN,SAAM,KAGvC,IAAIC,EAAmCb,EACvC,GAAIa,IAAS,OAAW,CACtB,MAAMC,EAAY,EAAAjC,QAAQ,YACtBiC,IACFD,EAAO,CACL,GAAGC,EACH,WACEA,EAAU,aAAe,KAAO,OAAYA,EAAU,WACxD,MACEA,EAAU,QAAU,MAAQ,OAAOA,EAAU,OAAU,UACnD,KACAA,EAAU,KAClB,EAEJ,CACA,MAAMC,EAAkBN,EAAQ,YAAW,cAAW,EAChDO,EAAcD,GAAiB,WACrCA,GAAiB,KAAK,EACtB,SAAO,KAAK,WAAWL,CAAU,IAAIC,CAAgB,qBAAqB,EAC1E,SAAO,IAAItB,EAAKW,CAAW,EACvBgB,GACFD,GAAiB,MAAM,CAE3B,CAEA,IAAIJ,EAKJ,SAAShD,EAAQ6C,KAA0CV,EAAiB,CAC1E,MAAMW,EAAUR,EAAeO,CAAgB,EACzC,CAAE,WAAAN,CAAW,EAAIO,EACvB,GAAI,CAACN,EAAUD,CAAoB,EACjC,OAGF,MAAMf,EAAOF,EAAc,CAAC,GAAK,YAC7B0B,IAAqB,SAEvBA,KADkB,EAAAC,SAAmB,EACN,SAAM,KAEvC,MAAMK,EAAOnB,EAAK,GAAG,CAAC,EAChBoB,EACJ,OAAOD,GAAS,SACZ,IACE,mBACE,GAAG9B,EAAO,GAAGA,CAAI,IAAIwB,CAAgB,IAAM,EAAE,GAAGM,CAAI,GACpD,CAAE,OAAQ,UAAW,CACvB,EACA,GAAGnB,EAAK,MAAM,CAAC,CACjB,EACAA,EACAiB,EAAkBN,EAAQ,YAAW,cAAW,EAChDO,EAAcD,GAAiB,WACrCA,GAAiB,KAAK,EACtBvC,EAAa,SAAO,KAAM,SAAQ0C,CAAO,EACrCF,GACFD,GAAiB,MAAM,CAE3B,CAMA,SAASrD,EAAW8C,KAA0CV,EAAiB,CAC7E,MAAMW,EAAUR,EAAeO,CAAgB,EACzC,CAAE,WAAAN,CAAW,EAAIO,EACvB,GAAI,CAACN,EAAUD,CAAoB,EACjC,OAGF,MAAMQ,EAAazB,EAAc,CAAC,GAAK,YAEnC0B,IAAqB,SAEvBA,KADkB,EAAAC,SAAmB,EACN,SAAM,KAGvC,MAAMK,EAAOnB,EAAK,GAAG,CAAC,EAChBoB,EACJ,OAAOD,GAAS,SACZ,IACE,mBACE,GAAGP,EAAa,GAAGA,CAAU,IAAIC,CAAgB,IAAM,EAAE,GAAGM,CAAI,GAChE,CAAE,OAAQ,UAAW,CACvB,EACA,GAAGnB,EAAK,MAAM,CAAC,CACjB,EACA,CAAC,WAAWY,CAAU,IAAIC,CAAgB,GAAI,GAAGb,CAAI,EAErDiB,EAAkBN,EAAQ,YAAW,cAAW,EAChDO,EAAcD,GAAiB,WACrCA,GAAiB,KAAK,EACtBvC,EAAa,SAAO,KAAM,SAAQ0C,CAAO,EACrCF,GACFD,GAAiB,MAAM,CAE3B,CASA,SAASzD,EACPkD,EACAW,EACAC,EACAC,EACA,CACA,MAAMZ,EAAUR,EAAeO,CAAgB,EACzC,CAAE,WAAAN,CAAW,EAAIO,EACvB,GAAI,CAACN,EAAUD,CAAoB,EACjC,OAGF,MAAMQ,EAAazB,EAAc,CAAC,GAAK,QAEnC0B,IAAqB,SAEvBA,KADkB,EAAAC,SAAmB,EACN,SAAM,KAGvC,MAAMU,EAAS,WAAWZ,CAAU,IAAIC,CAAgB,IAAIQ,CAAS,KAAKC,CAAG,GACvEF,EAAUG,IAAS,OAAY,CAACC,EAAQD,CAAI,EAAI,CAACC,CAAM,EAEvDP,EAAkBN,EAAQ,YAAW,cAAW,EAChDO,EAAcD,GAAiB,WACrCA,GAAiB,KAAK,EACtBvC,EAAa,SAAO,KAAM,SAAQ0C,CAAO,EACrCF,GACFD,GAAiB,MAAM,CAE3B,CAMO,SAAS1D,EACd8D,EACAC,EACAC,EACM,CACN,GAAI,CAAC,eACH,OAGF,MAAMX,EAAazB,EAAc,CAAC,GAAK,QAEnC0B,IAAqB,SAEvBA,KADkB,EAAAC,SAAmB,EACN,SAAM,KAGvC,MAAMU,EAAS,WAAWZ,CAAU,IAAIC,CAAgB,IAAIQ,CAAS,KAAKC,CAAG,GAE7E,QAAQ,IAAI,GADCC,IAAS,OAAY,CAACC,EAAQD,CAAI,EAAI,CAACC,CAAM,CACvC,CACrB,CAMA,SAASvD,EAAUmC,EAAyC,CAC1D,MAAO,CAAC,CAAC,gBAAgBC,EAAUD,CAAU,CAC/C,CAMA,SAAS9C,KAAS0C,EAAuB,CAC1B,IAAGA,EAClB,CAMA,SAASvC,EACP8B,EACAW,EACM,CAER,CAMA,SAASvC,KAAYqC,EAAuB,CAC1B,IAAGA,EACrB,CAMA,SAAShC,GAAmB,CAC1B,MAAO,CAAC,CAAC,cACX,CAOA,SAASF,EAAS2D,EAAiB,CAEjC,OADavC,EAAQ,EACT,SAASuC,CAAO,CAC9B,CAOA,SAAS1D,EAAU2D,EAAe,CAChC,MAAMzB,EAAOf,EAAQ,EAErB,IAAIyC,EACJ,MAAMC,EAAO,IAAM,CACjB,GAAID,IAAc,OAChBA,EAAY,KAAK,IAAI,MAChB,CACL,MAAME,EAAW,KAAK,IAAI,EAAIF,EAC9B1B,EAAK,SAAS,MAAM,EAAE,GAAGyB,CAAK,KAAKG,CAAQ,IAAI,EAC/CF,EAAY,MACd,CACF,EACA,OAAAC,EAAK,MAAQ,IAAM,CACjBD,EAAY,KAAK,IAAI,CACvB,EACAC,EAAK,IAAM,IAAM,CACf,GAAID,IAAc,OAAW,CAC3B,MAAME,EAAW,KAAK,IAAI,EAAIF,EAC9B1B,EAAK,SAAS,MAAM,EAAE,GAAGyB,CAAK,KAAKG,CAAQ,IAAI,EAC/CF,EAAY,MACd,CACF,EACOC,CACT",
-  "names": ["debug_exports", "__export", "debug", "debugCache", "debugCacheNs", "debugDir", "debugDirNs", "debugLog", "debugLogNs", "debugNs", "debuglog", "debugtime", "isDebug", "isDebugNs", "__toCommonJS", "import_process", "import_debug", "import_socket_debug", "import_is_unicode_supported", "import_logger", "import_objects", "import_strings", "ReflectApply", "debugByNamespace", "getDebugJsInstance", "namespace", "inst", "debugJs", "customLog", "_util", "getUtil", "getCallerInfo", "stackOffset", "name", "captureStackTrace", "obj", "stack", "lineCount", "lineStart", "i", "length", "line", "match", "afterDot", "args", "util", "inspectOpts", "extractOptions", "namespaces", "isEnabled", "split", "names", "skips", "ns", "namespacesOrOpts", "options", "callerName", "pointingTriangle", "isUnicodeSupported", "opts", "debugOpts", "spinnerInstance", "wasSpinning", "text", "logArgs", "operation", "key", "meta", "prefix", "section", "label", "startTime", "impl", "duration"]
+  "sourcesContent": ["/**\n * @fileoverview Debug logging utilities with lazy loading and environment-based control.\n * Provides Socket CLI specific debug functionality and logging formatters.\n */\n\nimport { getSpinner } from '#constants/process'\nimport { getDebug } from '#env/debug'\nimport { getSocketDebug } from '#env/socket'\nimport isUnicodeSupported from './external/@socketregistry/is-unicode-supported'\nimport debugJs from './external/debug'\n\nimport { logger } from './logger'\nimport { hasOwn } from './objects'\nimport { applyLinePrefix } from './strings'\n\n// IMPORTANT: Do not use destructuring here - use direct assignment instead.\n// tsgo has a bug that incorrectly transpiles destructured exports, resulting in\n// `exports.SomeName = void 0;` which causes runtime errors.\n// See: https://github.com/SocketDev/socket-packageurl-js/issues/3\nconst ReflectApply = Reflect.apply\n\n// Type definitions\ninterface DebugOptions {\n  namespaces?: string\n  spinner?: { isSpinning: boolean; stop(): void; start(): void }\n  [key: string]: unknown\n}\n\ntype NamespacesOrOptions = string | DebugOptions\n\ninterface InspectOptions {\n  depth?: number | null\n  colors?: boolean\n  [key: string]: unknown\n}\n\nexport type { DebugOptions, NamespacesOrOptions, InspectOptions }\n\nconst debugByNamespace = new Map()\n/**\n * Get or create a debug instance for a namespace.\n * @private\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction getDebugJsInstance(namespace: string) {\n  let inst = debugByNamespace.get(namespace)\n  if (inst) {\n    return inst\n  }\n  if (\n    !getDebug() &&\n    getSocketDebug() &&\n    (namespace === 'error' || namespace === 'notice')\n  ) {\n    debugJs.enable(namespace)\n  }\n  inst = debugJs(namespace)\n  inst.log = customLog\n  debugByNamespace.set(namespace, inst)\n  return inst\n}\n\nlet _util: typeof import('util') | undefined\n/**\n * Lazily load the util module.\n * @private\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction getUtil() {\n  if (_util === undefined) {\n    // Use non-'node:' prefixed require to avoid Webpack errors.\n\n    _util = /*@__PURE__*/ require('node:util')\n  }\n  return _util as typeof import('util')\n}\n\n/**\n * Extract caller information from the stack trace.\n * @private\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction getCallerInfo(stackOffset: number = 3): string {\n  let name = ''\n  const captureStackTrace = Error.captureStackTrace\n  if (typeof captureStackTrace === 'function') {\n    const obj: { stack?: unknown } = {}\n    captureStackTrace(obj, getCallerInfo)\n    const stack = obj.stack\n    if (typeof stack === 'string') {\n      let lineCount = 0\n      let lineStart = 0\n      for (let i = 0, { length } = stack; i < length; i += 1) {\n        if (stack[i] === '\\n') {\n          lineCount += 1\n          if (lineCount < stackOffset) {\n            // Store the start index of the next line.\n            lineStart = i + 1\n          } else {\n            // Extract the full line and trim it.\n            const line = stack.slice(lineStart, i).trimStart()\n            // Match the function name portion (e.g., \"async runFix\").\n            const match = /(?<=^at\\s+).*?(?=\\s+\\(|$)/.exec(line)?.[0]\n            if (match) {\n              name = match\n                // Strip known V8 invocation prefixes to get the name.\n                .replace(/^(?:async|bound|get|new|set)\\s+/, '')\n              if (name.startsWith('Object.')) {\n                // Strip leading 'Object.' if not an own property of Object.\n                const afterDot = name.slice(7 /*'Object.'.length*/)\n                if (!hasOwn(Object, afterDot)) {\n                  name = afterDot\n                }\n              }\n            }\n            break\n          }\n        }\n      }\n    }\n  }\n  return name\n}\n\n/**\n * Custom log function for debug output.\n * @private\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction customLog(...args: unknown[]) {\n  const util = getUtil()\n  const inspectOpts = debugJs.inspectOpts\n    ? {\n        ...debugJs.inspectOpts,\n        showHidden:\n          debugJs.inspectOpts.showHidden === null\n            ? undefined\n            : debugJs.inspectOpts.showHidden,\n        depth:\n          debugJs.inspectOpts.depth === null ||\n          typeof debugJs.inspectOpts.depth === 'boolean'\n            ? undefined\n            : debugJs.inspectOpts.depth,\n      }\n    : {}\n  ReflectApply(logger.info, logger, [\n    util.formatWithOptions(inspectOpts, ...args),\n  ])\n}\n\n/**\n * Extract options from namespaces parameter.\n * @private\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction extractOptions(namespaces: NamespacesOrOptions): DebugOptions {\n  return namespaces !== null && typeof namespaces === 'object'\n    ? ({ __proto__: null, ...namespaces } as DebugOptions)\n    : ({ __proto__: null, namespaces } as DebugOptions)\n}\n\n/**\n * Check if debug is enabled for given namespaces.\n * @private\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction isEnabled(namespaces: string | undefined) {\n  // Check if debugging is enabled at all\n  if (!getSocketDebug()) {\n    return false\n  }\n  if (typeof namespaces !== 'string' || !namespaces || namespaces === '*') {\n    return true\n  }\n  // Namespace splitting logic is based the 'debug' package implementation:\n  // https://github.com/debug-js/debug/blob/4.4.1/src/common.js#L169-L173.\n  const split = namespaces\n    .trim()\n    .replace(/\\s+/g, ',')\n    .split(',')\n    .filter(Boolean)\n  const names = []\n  const skips = []\n  for (const ns of split) {\n    if (ns.startsWith('-')) {\n      skips.push(ns.slice(1))\n    } else {\n      names.push(ns)\n    }\n  }\n  if (names.length && !names.some(ns => getDebugJsInstance(ns).enabled)) {\n    return false\n  }\n  return skips.every(ns => !getDebugJsInstance(ns).enabled)\n}\n\n/**\n * Debug output for object inspection with caller info.\n */\nfunction debugDirNs(\n  namespacesOrOpts: NamespacesOrOptions,\n  obj: unknown,\n  inspectOpts?: InspectOptions | undefined,\n) {\n  const options = extractOptions(namespacesOrOpts)\n  const { namespaces } = options\n  if (!isEnabled(namespaces as string)) {\n    return\n  }\n  // Get caller info with stack offset of 4 (caller -> debugDirNs -> getCallerInfo).\n  const callerName = getCallerInfo(4) || 'anonymous'\n\n  if (pointingTriangle === undefined) {\n    const supported = isUnicodeSupported()\n    pointingTriangle = supported ? '\u25B8' : '>'\n  }\n\n  let opts: InspectOptions | undefined = inspectOpts\n  if (opts === undefined) {\n    const debugOpts = debugJs.inspectOpts\n    if (debugOpts) {\n      opts = {\n        ...debugOpts,\n        showHidden:\n          debugOpts.showHidden === null ? undefined : debugOpts.showHidden,\n        depth:\n          debugOpts.depth === null || typeof debugOpts.depth === 'boolean'\n            ? null\n            : debugOpts.depth,\n      } as InspectOptions\n    }\n  }\n  const spinnerInstance = options.spinner || getSpinner()\n  const wasSpinning = spinnerInstance?.isSpinning\n  spinnerInstance?.stop()\n  logger.info(`[DEBUG] ${callerName} ${pointingTriangle} object inspection:`)\n  logger.dir(obj, inspectOpts)\n  if (wasSpinning) {\n    spinnerInstance?.start()\n  }\n}\n\nlet pointingTriangle: string | undefined\n/**\n * Debug output with caller info.\n */\nfunction debugNs(namespacesOrOpts: NamespacesOrOptions, ...args: unknown[]) {\n  const options = extractOptions(namespacesOrOpts)\n  const { namespaces } = options\n  if (!isEnabled(namespaces as string)) {\n    return\n  }\n  // Get caller info with stack offset of 4 (caller -> debugNs -> getCallerInfo).\n  const name = getCallerInfo(4) || 'anonymous'\n  if (pointingTriangle === undefined) {\n    const supported = isUnicodeSupported()\n    pointingTriangle = supported ? '\u25B8' : '>'\n  }\n  const text = args.at(0)\n  const logArgs =\n    typeof text === 'string'\n      ? [\n          applyLinePrefix(\n            `${name ? `${name} ${pointingTriangle} ` : ''}${text}`,\n            { prefix: '[DEBUG] ' },\n          ),\n          ...args.slice(1),\n        ]\n      : args\n  const spinnerInstance = options.spinner || getSpinner()\n  const wasSpinning = spinnerInstance?.isSpinning\n  spinnerInstance?.stop()\n  ReflectApply(logger.info, logger, logArgs)\n  if (wasSpinning) {\n    spinnerInstance?.start()\n  }\n}\n\n/**\n * Debug logging function with caller info.\n */\nfunction debugLogNs(namespacesOrOpts: NamespacesOrOptions, ...args: unknown[]) {\n  const options = extractOptions(namespacesOrOpts)\n  const { namespaces } = options\n  if (!isEnabled(namespaces as string)) {\n    return\n  }\n  // Get caller info with stack offset of 4 (caller -> debugLogNs -> getCallerInfo).\n  const callerName = getCallerInfo(4) || 'anonymous'\n\n  if (pointingTriangle === undefined) {\n    const supported = isUnicodeSupported()\n    pointingTriangle = supported ? '\u25B8' : '>'\n  }\n\n  const text = args.at(0)\n  const logArgs =\n    typeof text === 'string'\n      ? [\n          applyLinePrefix(\n            `${callerName ? `${callerName} ${pointingTriangle} ` : ''}${text}`,\n            { prefix: '[DEBUG] ' },\n          ),\n          ...args.slice(1),\n        ]\n      : [`[DEBUG] ${callerName} ${pointingTriangle}`, ...args]\n\n  const spinnerInstance = options.spinner || getSpinner()\n  const wasSpinning = spinnerInstance?.isSpinning\n  spinnerInstance?.stop()\n  ReflectApply(logger.info, logger, logArgs)\n  if (wasSpinning) {\n    spinnerInstance?.start()\n  }\n}\n\n/**\n * Debug output for cache operations with caller info.\n * First argument is the operation type (hit/miss/set/clear).\n * Second argument is the cache key or message.\n * Optional third argument is metadata object.\n */\nfunction debugCacheNs(\n  namespacesOrOpts: NamespacesOrOptions,\n  operation: string,\n  key: string,\n  meta?: unknown | undefined,\n) {\n  const options = extractOptions(namespacesOrOpts)\n  const { namespaces } = options\n  if (!isEnabled(namespaces as string)) {\n    return\n  }\n  // Get caller info with stack offset of 4 (caller -> debugCacheNs -> getCallerInfo).\n  const callerName = getCallerInfo(4) || 'cache'\n\n  if (pointingTriangle === undefined) {\n    const supported = isUnicodeSupported()\n    pointingTriangle = supported ? '\u25B8' : '>'\n  }\n\n  const prefix = `[CACHE] ${callerName} ${pointingTriangle} ${operation}: ${key}`\n  const logArgs = meta !== undefined ? [prefix, meta] : [prefix]\n\n  const spinnerInstance = options.spinner || getSpinner()\n  const wasSpinning = spinnerInstance?.isSpinning\n  spinnerInstance?.stop()\n  ReflectApply(logger.info, logger, logArgs)\n  if (wasSpinning) {\n    spinnerInstance?.start()\n  }\n}\n\n/**\n * Cache debug function with caller info.\n */\n/*@__NO_SIDE_EFFECTS__*/\nexport function debugCache(\n  operation: string,\n  key: string,\n  meta?: unknown | undefined,\n): void {\n  if (!getSocketDebug()) {\n    return\n  }\n  // Get caller info with stack offset of 3 (caller -> debugCache -> getCallerInfo).\n  const callerName = getCallerInfo(3) || 'cache'\n\n  if (pointingTriangle === undefined) {\n    const supported = isUnicodeSupported()\n    pointingTriangle = supported ? '\u25B8' : '>'\n  }\n\n  const prefix = `[CACHE] ${callerName} ${pointingTriangle} ${operation}: ${key}`\n  const args = meta !== undefined ? [prefix, meta] : [prefix]\n  console.log(...args)\n}\n\n/**\n * Check if debug mode is enabled.\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction isDebugNs(namespaces: string | undefined): boolean {\n  return !!getSocketDebug() && isEnabled(namespaces)\n}\n\n/**\n * Debug output with caller info (wrapper for debugNs with default namespace).\n */\nfunction debug(...args: unknown[]): void {\n  debugNs('*', ...args)\n}\n\n/**\n * Debug output for object inspection (wrapper for debugDirNs with default namespace).\n */\nfunction debugDir(\n  obj: unknown,\n  inspectOpts?: InspectOptions | undefined,\n): void {\n  debugDirNs('*', obj, inspectOpts)\n}\n\n/**\n * Debug logging function (wrapper for debugLogNs with default namespace).\n */\nfunction debugLog(...args: unknown[]): void {\n  debugLogNs('*', ...args)\n}\n\n/**\n * Check if debug mode is enabled.\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction isDebug(): boolean {\n  return !!getSocketDebug()\n}\n\n/**\n * Create a Node.js util.debuglog compatible function.\n * Returns a function that conditionally writes debug messages to stderr.\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction debuglog(section: string) {\n  const util = getUtil()\n  return util.debuglog(section)\n}\n\n/**\n * Create timing functions for measuring code execution time.\n * Returns an object with start() and end() methods, plus a callable function.\n */\n/*@__NO_SIDE_EFFECTS__*/\nfunction debugtime(label: string) {\n  const util = getUtil()\n  // Node.js util doesn't have debugtime - create a custom implementation\n  let startTime: number | undefined\n  const impl = () => {\n    if (startTime === undefined) {\n      startTime = Date.now()\n    } else {\n      const duration = Date.now() - startTime\n      util.debuglog('time')(`${label}: ${duration}ms`)\n      startTime = undefined\n    }\n  }\n  impl.start = () => {\n    startTime = Date.now()\n  }\n  impl.end = () => {\n    if (startTime !== undefined) {\n      const duration = Date.now() - startTime\n      util.debuglog('time')(`${label}: ${duration}ms`)\n      startTime = undefined\n    }\n  }\n  return impl\n}\n\n// Export main debug functions with caller info.\nexport { debug }\n// debugCache is already exported directly above\nexport { debugCacheNs }\nexport { debugDir }\nexport { debugDirNs }\nexport { debugLog }\nexport { debuglog }\nexport { debugLogNs }\nexport { debugNs }\nexport { debugtime }\nexport { isDebug }\nexport { isDebugNs }\n"],
+  "mappings": ";6iBAAA,IAAAA,EAAA,GAAAC,EAAAD,EAAA,WAAAE,EAAA,eAAAC,EAAA,iBAAAC,EAAA,aAAAC,EAAA,eAAAC,EAAA,aAAAC,EAAA,eAAAC,EAAA,YAAAC,EAAA,aAAAC,EAAA,cAAAC,EAAA,YAAAC,EAAA,cAAAC,IAAA,eAAAC,EAAAd,GAKA,IAAAe,EAA2B,8BAC3BC,EAAyB,sBACzBC,EAA+B,uBAC/BC,EAA+B,8DAC/BF,EAAoB,+BAEpBG,EAAuB,oBACvBC,EAAuB,qBACvBC,EAAgC,qBAMhC,MAAMC,EAAe,QAAQ,MAmBvBC,EAAmB,IAAI,IAM7B,SAASC,EAAmBC,EAAmB,CAC7C,IAAIC,EAAOH,EAAiB,IAAIE,CAAS,EACzC,OAAIC,IAIF,IAAC,YAAS,MACV,kBAAe,IACdD,IAAc,SAAWA,IAAc,WAExC,EAAAE,QAAQ,OAAOF,CAAS,EAE1BC,KAAO,EAAAC,SAAQF,CAAS,EACxBC,EAAK,IAAME,EACXL,EAAiB,IAAIE,EAAWC,CAAI,EAC7BA,EACT,CAEA,IAAIG,EAMJ,SAASC,GAAU,CACjB,OAAID,IAAU,SAGZA,EAAsB,QAAQ,WAAW,GAEpCA,CACT,CAOA,SAASE,EAAcC,EAAsB,EAAW,CACtD,IAAIC,EAAO,GACX,MAAMC,EAAoB,MAAM,kBAChC,GAAI,OAAOA,GAAsB,WAAY,CAC3C,MAAMC,EAA2B,CAAC,EAClCD,EAAkBC,EAAKJ,CAAa,EACpC,MAAMK,EAAQD,EAAI,MAClB,GAAI,OAAOC,GAAU,SAAU,CAC7B,IAAIC,EAAY,EACZC,EAAY,EAChB,QAASC,EAAI,EAAG,CAAE,OAAAC,CAAO,EAAIJ,EAAOG,EAAIC,EAAQD,GAAK,EACnD,GAAIH,EAAMG,CAAC,IAAM;AAAA,EAEf,GADAF,GAAa,EACTA,EAAYL,EAEdM,EAAYC,EAAI,MACX,CAEL,MAAME,EAAOL,EAAM,MAAME,EAAWC,CAAC,EAAE,UAAU,EAE3CG,EAAQ,4BAA4B,KAAKD,CAAI,IAAI,CAAC,EACxD,GAAIC,IACFT,EAAOS,EAEJ,QAAQ,kCAAmC,EAAE,EAC5CT,EAAK,WAAW,SAAS,GAAG,CAE9B,MAAMU,EAAWV,EAAK,MAAM,CAAsB,KAC7C,UAAO,OAAQU,CAAQ,IAC1BV,EAAOU,EAEX,CAEF,KACF,CAGN,CACF,CACA,OAAOV,CACT,CAOA,SAASL,KAAagB,EAAiB,CACrC,MAAMC,EAAOf,EAAQ,EACfgB,EAAc,EAAAnB,QAAQ,YACxB,CACE,GAAG,EAAAA,QAAQ,YACX,WACE,EAAAA,QAAQ,YAAY,aAAe,KAC/B,OACA,EAAAA,QAAQ,YAAY,WAC1B,MACE,EAAAA,QAAQ,YAAY,QAAU,MAC9B,OAAO,EAAAA,QAAQ,YAAY,OAAU,UACjC,OACA,EAAAA,QAAQ,YAAY,KAC5B,EACA,CAAC,EACLL,EAAa,SAAO,KAAM,SAAQ,CAChCuB,EAAK,kBAAkBC,EAAa,GAAGF,CAAI,CAC7C,CAAC,CACH,CAOA,SAASG,EAAeC,EAA+C,CACrE,OAAOA,IAAe,MAAQ,OAAOA,GAAe,SAC/C,CAAE,UAAW,KAAM,GAAGA,CAAW,EACjC,CAAE,UAAW,KAAM,WAAAA,CAAW,CACrC,CAOA,SAASC,EAAUD,EAAgC,CAEjD,GAAI,IAAC,kBAAe,EAClB,MAAO,GAET,GAAI,OAAOA,GAAe,UAAY,CAACA,GAAcA,IAAe,IAClE,MAAO,GAIT,MAAME,EAAQF,EACX,KAAK,EACL,QAAQ,OAAQ,GAAG,EACnB,MAAM,GAAG,EACT,OAAO,OAAO,EACXG,EAAQ,CAAC,EACTC,EAAQ,CAAC,EACf,UAAWC,KAAMH,EACXG,EAAG,WAAW,GAAG,EACnBD,EAAM,KAAKC,EAAG,MAAM,CAAC,CAAC,EAEtBF,EAAM,KAAKE,CAAE,EAGjB,OAAIF,EAAM,QAAU,CAACA,EAAM,KAAKE,GAAM7B,EAAmB6B,CAAE,EAAE,OAAO,EAC3D,GAEFD,EAAM,MAAMC,GAAM,CAAC7B,EAAmB6B,CAAE,EAAE,OAAO,CAC1D,CAKA,SAAS/C,EACPgD,EACAnB,EACAW,EACA,CACA,MAAMS,EAAUR,EAAeO,CAAgB,EACzC,CAAE,WAAAN,CAAW,EAAIO,EACvB,GAAI,CAACN,EAAUD,CAAoB,EACjC,OAGF,MAAMQ,EAAazB,EAAc,CAAC,GAAK,YAEnC0B,IAAqB,SAEvBA,KADkB,EAAAC,SAAmB,EACN,SAAM,KAGvC,IAAIC,EAAmCb,EACvC,GAAIa,IAAS,OAAW,CACtB,MAAMC,EAAY,EAAAjC,QAAQ,YACtBiC,IACFD,EAAO,CACL,GAAGC,EACH,WACEA,EAAU,aAAe,KAAO,OAAYA,EAAU,WACxD,MACEA,EAAU,QAAU,MAAQ,OAAOA,EAAU,OAAU,UACnD,KACAA,EAAU,KAClB,EAEJ,CACA,MAAMC,EAAkBN,EAAQ,YAAW,cAAW,EAChDO,EAAcD,GAAiB,WACrCA,GAAiB,KAAK,EACtB,SAAO,KAAK,WAAWL,CAAU,IAAIC,CAAgB,qBAAqB,EAC1E,SAAO,IAAItB,EAAKW,CAAW,EACvBgB,GACFD,GAAiB,MAAM,CAE3B,CAEA,IAAIJ,EAIJ,SAAShD,EAAQ6C,KAA0CV,EAAiB,CAC1E,MAAMW,EAAUR,EAAeO,CAAgB,EACzC,CAAE,WAAAN,CAAW,EAAIO,EACvB,GAAI,CAACN,EAAUD,CAAoB,EACjC,OAGF,MAAMf,EAAOF,EAAc,CAAC,GAAK,YAC7B0B,IAAqB,SAEvBA,KADkB,EAAAC,SAAmB,EACN,SAAM,KAEvC,MAAMK,EAAOnB,EAAK,GAAG,CAAC,EAChBoB,EACJ,OAAOD,GAAS,SACZ,IACE,mBACE,GAAG9B,EAAO,GAAGA,CAAI,IAAIwB,CAAgB,IAAM,EAAE,GAAGM,CAAI,GACpD,CAAE,OAAQ,UAAW,CACvB,EACA,GAAGnB,EAAK,MAAM,CAAC,CACjB,EACAA,EACAiB,EAAkBN,EAAQ,YAAW,cAAW,EAChDO,EAAcD,GAAiB,WACrCA,GAAiB,KAAK,EACtBvC,EAAa,SAAO,KAAM,SAAQ0C,CAAO,EACrCF,GACFD,GAAiB,MAAM,CAE3B,CAKA,SAASrD,EAAW8C,KAA0CV,EAAiB,CAC7E,MAAMW,EAAUR,EAAeO,CAAgB,EACzC,CAAE,WAAAN,CAAW,EAAIO,EACvB,GAAI,CAACN,EAAUD,CAAoB,EACjC,OAGF,MAAMQ,EAAazB,EAAc,CAAC,GAAK,YAEnC0B,IAAqB,SAEvBA,KADkB,EAAAC,SAAmB,EACN,SAAM,KAGvC,MAAMK,EAAOnB,EAAK,GAAG,CAAC,EAChBoB,EACJ,OAAOD,GAAS,SACZ,IACE,mBACE,GAAGP,EAAa,GAAGA,CAAU,IAAIC,CAAgB,IAAM,EAAE,GAAGM,CAAI,GAChE,CAAE,OAAQ,UAAW,CACvB,EACA,GAAGnB,EAAK,MAAM,CAAC,CACjB,EACA,CAAC,WAAWY,CAAU,IAAIC,CAAgB,GAAI,GAAGb,CAAI,EAErDiB,EAAkBN,EAAQ,YAAW,cAAW,EAChDO,EAAcD,GAAiB,WACrCA,GAAiB,KAAK,EACtBvC,EAAa,SAAO,KAAM,SAAQ0C,CAAO,EACrCF,GACFD,GAAiB,MAAM,CAE3B,CAQA,SAASzD,EACPkD,EACAW,EACAC,EACAC,EACA,CACA,MAAMZ,EAAUR,EAAeO,CAAgB,EACzC,CAAE,WAAAN,CAAW,EAAIO,EACvB,GAAI,CAACN,EAAUD,CAAoB,EACjC,OAGF,MAAMQ,EAAazB,EAAc,CAAC,GAAK,QAEnC0B,IAAqB,SAEvBA,KADkB,EAAAC,SAAmB,EACN,SAAM,KAGvC,MAAMU,EAAS,WAAWZ,CAAU,IAAIC,CAAgB,IAAIQ,CAAS,KAAKC,CAAG,GACvEF,EAAUG,IAAS,OAAY,CAACC,EAAQD,CAAI,EAAI,CAACC,CAAM,EAEvDP,EAAkBN,EAAQ,YAAW,cAAW,EAChDO,EAAcD,GAAiB,WACrCA,GAAiB,KAAK,EACtBvC,EAAa,SAAO,KAAM,SAAQ0C,CAAO,EACrCF,GACFD,GAAiB,MAAM,CAE3B,CAMO,SAAS1D,EACd8D,EACAC,EACAC,EACM,CACN,GAAI,IAAC,kBAAe,EAClB,OAGF,MAAMX,EAAazB,EAAc,CAAC,GAAK,QAEnC0B,IAAqB,SAEvBA,KADkB,EAAAC,SAAmB,EACN,SAAM,KAGvC,MAAMU,EAAS,WAAWZ,CAAU,IAAIC,CAAgB,IAAIQ,CAAS,KAAKC,CAAG,GAE7E,QAAQ,IAAI,GADCC,IAAS,OAAY,CAACC,EAAQD,CAAI,EAAI,CAACC,CAAM,CACvC,CACrB,CAMA,SAASvD,EAAUmC,EAAyC,CAC1D,MAAO,CAAC,IAAC,kBAAe,GAAKC,EAAUD,CAAU,CACnD,CAKA,SAAS9C,KAAS0C,EAAuB,CACvCnC,EAAQ,IAAK,GAAGmC,CAAI,CACtB,CAKA,SAASvC,EACP8B,EACAW,EACM,CACNxC,EAAW,IAAK6B,EAAKW,CAAW,CAClC,CAKA,SAASvC,KAAYqC,EAAuB,CAC1CpC,EAAW,IAAK,GAAGoC,CAAI,CACzB,CAMA,SAAShC,GAAmB,CAC1B,MAAO,CAAC,IAAC,kBAAe,CAC1B,CAOA,SAASF,EAAS2D,EAAiB,CAEjC,OADavC,EAAQ,EACT,SAASuC,CAAO,CAC9B,CAOA,SAAS1D,EAAU2D,EAAe,CAChC,MAAMzB,EAAOf,EAAQ,EAErB,IAAIyC,EACJ,MAAMC,EAAO,IAAM,CACjB,GAAID,IAAc,OAChBA,EAAY,KAAK,IAAI,MAChB,CACL,MAAME,EAAW,KAAK,IAAI,EAAIF,EAC9B1B,EAAK,SAAS,MAAM,EAAE,GAAGyB,CAAK,KAAKG,CAAQ,IAAI,EAC/CF,EAAY,MACd,CACF,EACA,OAAAC,EAAK,MAAQ,IAAM,CACjBD,EAAY,KAAK,IAAI,CACvB,EACAC,EAAK,IAAM,IAAM,CACf,GAAID,IAAc,OAAW,CAC3B,MAAME,EAAW,KAAK,IAAI,EAAIF,EAC9B1B,EAAK,SAAS,MAAM,EAAE,GAAGyB,CAAK,KAAKG,CAAQ,IAAI,EAC/CF,EAAY,MACd,CACF,EACOC,CACT",
+  "names": ["debug_exports", "__export", "debug", "debugCache", "debugCacheNs", "debugDir", "debugDirNs", "debugLog", "debugLogNs", "debugNs", "debuglog", "debugtime", "isDebug", "isDebugNs", "__toCommonJS", "import_process", "import_debug", "import_socket", "import_is_unicode_supported", "import_logger", "import_objects", "import_strings", "ReflectApply", "debugByNamespace", "getDebugJsInstance", "namespace", "inst", "debugJs", "customLog", "_util", "getUtil", "getCallerInfo", "stackOffset", "name", "captureStackTrace", "obj", "stack", "lineCount", "lineStart", "i", "length", "line", "match", "afterDot", "args", "util", "inspectOpts", "extractOptions", "namespaces", "isEnabled", "split", "names", "skips", "ns", "namespacesOrOpts", "options", "callerName", "pointingTriangle", "isUnicodeSupported", "opts", "debugOpts", "spinnerInstance", "wasSpinning", "text", "logArgs", "operation", "key", "meta", "prefix", "section", "label", "startTime", "impl", "duration"]
 }

package/dist/dlx-binary.js

@@ -1,3 +1,3 @@
 /* Socket Lib - Built with esbuild */
-var H=Object.create;var x=Object.defineProperty;var N=Object.getOwnPropertyDescriptor;var z=Object.getOwnPropertyNames;var F=Object.getPrototypeOf,L=Object.prototype.hasOwnProperty;var q=(t,n)=>{for(var e in n)x(t,e,{get:n[e],enumerable:!0})},C=(t,n,e,a)=>{if(n&&typeof n=="object"||typeof n=="function")for(let r of z(n))!L.call(t,r)&&r!==e&&x(t,r,{get:()=>n[r],enumerable:!(a=N(n,r))||a.enumerable});return t};var O=(t,n,e)=>(e=t!=null?H(F(t)):{},C(n||!t||!t.__esModule?x(e,"default",{value:t,enumerable:!0}):e,t)),I=t=>C(x({},"__esModule",{value:!0}),t);var G={};q(G,{cleanDlxCache:()=>X,dlxBinary:()=>Y,getDlxCachePath:()=>P,listDlxCache:()=>V});module.exports=I(G);var j=require("node:crypto"),s=require("node:fs"),D=O(require("node:os")),l=O(require("node:path")),A=require("#constants/platform"),m=require("./fs"),R=require("./http-request"),S=require("./objects"),$=require("./path"),T=require("./paths"),_=require("./spawn");function J(t){return(0,j.createHash)("sha256").update(t).digest("hex")}function g(t){return l.default.join(t,".dlx-metadata.json")}async function K(t,n){try{const e=g(t);if(!(0,s.existsSync)(e))return!1;const a=await(0,m.readJson)(e,{throws:!1});return(0,S.isObjectObject)(a)?Date.now()-(a.timestamp||0)<n:!1}catch{return!1}}async function M(t,n,e){const a=await(0,R.httpRequest)(t);if(!a.ok)throw new Error(`Failed to download binary: ${a.status} ${a.statusText}`);const r=`${n}.download`,c=(0,j.createHash)("sha256");try{await s.promises.mkdir(l.default.dirname(n),{recursive:!0});const i=a.body;c.update(i);const o=c.digest("hex");if(e&&o!==e)throw new Error(`Checksum mismatch: expected ${e}, got ${o}`);return await s.promises.writeFile(r,i),A.WIN32||await s.promises.chmod(r,493),await s.promises.rename(r,n),o}catch(i){try{await(0,m.safeDelete)(r)}catch{}throw i}}async function W(t,n,e){const a=g(t),r={arch:D.default.arch(),checksum:e,platform:D.default.platform(),timestamp:Date.now(),url:n,version:"1.0.0"};await s.promises.writeFile(a,JSON.stringify(r,null,2))}async function X(t=require("./constants/time").DLX_BINARY_CACHE_TTL){const n=P();if(!(0,s.existsSync)(n))return 0;let e=0;const a=Date.now(),r=await s.promises.readdir(n);for(const c of r){const i=l.default.join(n,c),o=g(i);try{if(!await(0,m.isDir)(i))continue;const u=await(0,m.readJson)(o,{throws:!1});if(!u||typeof u!="object"||Array.isArray(u))continue;a-(u.timestamp||0)>t&&(await(0,m.safeDelete)(i,{force:!0,recursive:!0}),e+=1)}catch{try{(await s.promises.readdir(i)).length||(await(0,m.safeDelete)(i),e+=1)}catch{}}}return e}async function Y(t,n,e){const{cacheTtl:a=require("./constants/time").DLX_BINARY_CACHE_TTL,checksum:r,force:c=!1,name:i,spawnOptions:o,url:u}={__proto__:null,...n},h=P(),p=J(u),f=l.default.join(h,p),d=i||`binary-${process.platform}-${D.default.arch()}`,b=(0,$.normalizePath)(l.default.join(f,d));let w=!1,k=r;if(!c&&(0,s.existsSync)(f)&&await K(f,a))try{const E=g(f),y=await(0,m.readJson)(E,{throws:!1});y&&typeof y=="object"&&!Array.isArray(y)&&typeof y.checksum=="string"?k=y.checksum:w=!0}catch{w=!0}else w=!0;w&&(await s.promises.mkdir(f,{recursive:!0}),k=await M(u,b,r),await W(f,u,k||""));const B=A.WIN32&&/\.(?:bat|cmd|ps1)$/i.test(b)?{...o,env:{...o?.env,PATH:`${f}${l.default.delimiter}${process.env.PATH||""}`},shell:!0}:o,v=(0,_.spawn)(b,t,B,e);return{binaryPath:b,downloaded:w,spawnPromise:v}}function P(){return(0,T.getSocketDlxDir)()}async function V(){const t=P();if(!(0,s.existsSync)(t))return[];const n=[],e=Date.now(),a=await s.promises.readdir(t);for(const r of a){const c=l.default.join(t,r);try{if(!await(0,m.isDir)(c))continue;const i=g(c),o=await(0,m.readJson)(i,{throws:!1});if(!o||typeof o!="object"||Array.isArray(o))continue;const h=(await s.promises.readdir(c)).find(p=>!p.startsWith("."));if(h){const p=l.default.join(c,h),f=await s.promises.stat(p),d=o;n.push({age:e-(d.timestamp||0),arch:d.arch||"unknown",checksum:d.checksum||"",name:h,platform:d.platform||"unknown",size:f.size,url:d.url||""})}}catch{}}return n}0&&(module.exports={cleanDlxCache,dlxBinary,getDlxCachePath,listDlxCache});
+var I=Object.create;var b=Object.defineProperty;var N=Object.getOwnPropertyDescriptor;var F=Object.getOwnPropertyNames;var H=Object.getPrototypeOf,z=Object.prototype.hasOwnProperty;var L=(t,n)=>{for(var e in n)b(t,e,{get:n[e],enumerable:!0})},O=(t,n,e,a)=>{if(n&&typeof n=="object"||typeof n=="function")for(let r of F(n))!z.call(t,r)&&r!==e&&b(t,r,{get:()=>n[r],enumerable:!(a=N(n,r))||a.enumerable});return t};var $=(t,n,e)=>(e=t!=null?I(H(t)):{},O(n||!t||!t.__esModule?b(e,"default",{value:t,enumerable:!0}):e,t)),q=t=>O(b({},"__esModule",{value:!0}),t);var G={};L(G,{cleanDlxCache:()=>V,dlxBinary:()=>W,getDlxCachePath:()=>P,listDlxCache:()=>X});module.exports=q(G);var j=require("node:crypto"),s=require("node:fs"),x=$(require("node:os")),p=$(require("node:path")),A=require("#constants/platform"),u=require("./fs"),C=require("./http-request"),S=require("./objects"),T=require("./path"),R=require("./paths"),_=require("./spawn");function Y(t,n){return(0,j.createHash)("sha256").update(`${t}:${n}`).digest("hex")}function y(t){return p.default.join(t,".dlx-metadata.json")}async function J(t,n){try{const e=y(t);if(!(0,s.existsSync)(e))return!1;const a=await(0,u.readJson)(e,{throws:!1});if(!(0,S.isObjectObject)(a))return!1;const r=Date.now(),i=a.timestamp;return typeof i!="number"||i<=0?!1:r-i<n}catch{return!1}}async function K(t,n,e){const a=await(0,C.httpRequest)(t);if(!a.ok)throw new Error(`Failed to download binary: ${a.status} ${a.statusText}`);const r=`${n}.download`,i=(0,j.createHash)("sha256");try{await s.promises.mkdir(p.default.dirname(n),{recursive:!0});const o=a.body;i.update(o);const c=i.digest("hex");if(e&&c!==e)throw new Error(`Checksum mismatch: expected ${e}, got ${c}`);return await s.promises.writeFile(r,o),A.WIN32||await s.promises.chmod(r,493),await s.promises.rename(r,n),c}catch(o){try{await(0,u.safeDelete)(r)}catch{}throw o}}async function M(t,n,e){const a=y(t),r={arch:x.default.arch(),checksum:e,platform:x.default.platform(),timestamp:Date.now(),url:n,version:"1.0.0"};await s.promises.writeFile(a,JSON.stringify(r,null,2))}async function V(t=require("#constants/time").DLX_BINARY_CACHE_TTL){const n=P();if(!(0,s.existsSync)(n))return 0;let e=0;const a=Date.now(),r=await s.promises.readdir(n);for(const i of r){const o=p.default.join(n,i),c=y(o);try{if(!await(0,u.isDir)(o))continue;const f=await(0,u.readJson)(c,{throws:!1});if(!f||typeof f!="object"||Array.isArray(f))continue;const l=f.timestamp;(typeof l=="number"&&l>0?a-l:Number.POSITIVE_INFINITY)>t&&(await(0,u.safeDelete)(o,{force:!0,recursive:!0}),e+=1)}catch{try{(await s.promises.readdir(o)).length||(await(0,u.safeDelete)(o),e+=1)}catch{}}}return e}async function W(t,n,e){const{cacheTtl:a=require("#constants/time").DLX_BINARY_CACHE_TTL,checksum:r,force:i=!1,name:o,spawnOptions:c,url:f}={__proto__:null,...n},l=P(),d=o||`binary-${process.platform}-${x.default.arch()}`,D=Y(f,d),m=p.default.join(l,D),g=(0,T.normalizePath)(p.default.join(m,d));let h=!1,k=r;if(!i&&(0,s.existsSync)(m)&&await J(m,a))try{const E=y(m),w=await(0,u.readJson)(E,{throws:!1});w&&typeof w=="object"&&!Array.isArray(w)&&typeof w.checksum=="string"?k=w.checksum:h=!0}catch{h=!0}else h=!0;h&&(await s.promises.mkdir(m,{recursive:!0}),k=await K(f,g,r),await M(m,f,k||""));const B=A.WIN32&&/\.(?:bat|cmd|ps1)$/i.test(g)?{...c,env:{...c?.env,PATH:`${m}${p.default.delimiter}${process.env.PATH||""}`},shell:!0}:c,v=(0,_.spawn)(g,t,B,e);return{binaryPath:g,downloaded:h,spawnPromise:v}}function P(){return(0,R.getSocketDlxDir)()}async function X(){const t=P();if(!(0,s.existsSync)(t))return[];const n=[],e=Date.now(),a=await s.promises.readdir(t);for(const r of a){const i=p.default.join(t,r);try{if(!await(0,u.isDir)(i))continue;const o=y(i),c=await(0,u.readJson)(o,{throws:!1});if(!c||typeof c!="object"||Array.isArray(c))continue;const l=(await s.promises.readdir(i)).find(d=>!d.startsWith("."));if(l){const d=p.default.join(i,l),D=await s.promises.stat(d),m=c;n.push({age:e-(m.timestamp||0),arch:m.arch||"unknown",checksum:m.checksum||"",name:l,platform:m.platform||"unknown",size:D.size,url:m.url||""})}}catch{}}return n}0&&(module.exports={cleanDlxCache,dlxBinary,getDlxCachePath,listDlxCache});
 //# sourceMappingURL=dlx-binary.js.map

package/dist/dlx-binary.js.map

@@ -1,7 +1,7 @@
 {
   "version": 3,
   "sources": ["../src/dlx-binary.ts"],
-  "sourcesContent": ["/** @fileoverview DLX binary execution utilities for Socket ecosystem. */\n\nimport { createHash } from 'node:crypto'\nimport { existsSync, promises as fs } from 'node:fs'\nimport os from 'node:os'\nimport path from 'node:path'\n\nimport { WIN32 } from '#constants/platform'\n\nimport { isDir, readJson, safeDelete } from './fs'\nimport { httpRequest } from './http-request'\nimport { isObjectObject } from './objects'\nimport { normalizePath } from './path'\nimport { getSocketDlxDir } from './paths'\nimport type { SpawnExtra, SpawnOptions } from './spawn'\nimport { spawn } from './spawn'\n\nexport interface DlxBinaryOptions {\n  /** URL to download the binary from. */\n  url: string\n  /** Optional name for the cached binary (defaults to URL hash). */\n  name?: string | undefined\n  /** Expected checksum (sha256) for verification. */\n  checksum?: string | undefined\n  /** Cache TTL in milliseconds (default: 7 days). */\n  cacheTtl?: number | undefined\n  /** Force re-download even if cached. */\n  force?: boolean | undefined\n  /** Additional spawn options. */\n  spawnOptions?: SpawnOptions | undefined\n}\n\nexport interface DlxBinaryResult {\n  /** Path to the cached binary. */\n  binaryPath: string\n  /** Whether the binary was newly downloaded. */\n  downloaded: boolean\n  /** The spawn promise for the running process. */\n  spawnPromise: ReturnType<typeof spawn>\n}\n\n/**\n * Generate a cache directory name from URL, similar to pnpm/npx.\n * Uses SHA256 hash to create content-addressed storage.\n */\nfunction generateCacheKey(url: string): string {\n  return createHash('sha256').update(url).digest('hex')\n}\n\n/**\n * Get metadata file path for a cached binary.\n */\nfunction getMetadataPath(cacheEntryPath: string): string {\n  return path.join(cacheEntryPath, '.dlx-metadata.json')\n}\n\n/**\n * Check if a cached binary is still valid.\n */\nasync function isCacheValid(\n  cacheEntryPath: string,\n  cacheTtl: number,\n): Promise<boolean> {\n  try {\n    const metaPath = getMetadataPath(cacheEntryPath)\n    if (!existsSync(metaPath)) {\n      return false\n    }\n\n    const metadata = await readJson(metaPath, { throws: false })\n    if (!isObjectObject(metadata)) {\n      return false\n    }\n    const now = Date.now()\n    const age =\n      now -\n      (((metadata as Record<string, unknown>)['timestamp'] as number) || 0)\n\n    return age < cacheTtl\n  } catch {\n    return false\n  }\n}\n\n/**\n * Download a file from a URL with integrity checking.\n */\nasync function downloadBinary(\n  url: string,\n  destPath: string,\n  checksum?: string | undefined,\n): Promise<string> {\n  const response = await httpRequest(url)\n  if (!response.ok) {\n    throw new Error(\n      `Failed to download binary: ${response.status} ${response.statusText}`,\n    )\n  }\n\n  // Create a temporary file first.\n  const tempPath = `${destPath}.download`\n  const hasher = createHash('sha256')\n\n  try {\n    // Ensure directory exists.\n    await fs.mkdir(path.dirname(destPath), { recursive: true })\n\n    // Get the response as a buffer and compute hash.\n    const buffer = response.body\n\n    // Compute hash.\n    hasher.update(buffer)\n    const actualChecksum = hasher.digest('hex')\n\n    // Verify checksum if provided.\n    if (checksum && actualChecksum !== checksum) {\n      throw new Error(\n        `Checksum mismatch: expected ${checksum}, got ${actualChecksum}`,\n      )\n    }\n\n    // Write to temp file.\n    await fs.writeFile(tempPath, buffer)\n\n    // Make executable on POSIX systems.\n    if (!WIN32) {\n      await fs.chmod(tempPath, 0o755)\n    }\n\n    // Move temp file to final location.\n    await fs.rename(tempPath, destPath)\n\n    return actualChecksum\n  } catch (e) {\n    // Clean up temp file on error.\n    try {\n      await safeDelete(tempPath)\n    } catch {\n      // Ignore cleanup errors.\n    }\n    throw e\n  }\n}\n\n/**\n * Write metadata for a cached binary.\n */\nasync function writeMetadata(\n  cacheEntryPath: string,\n  url: string,\n  checksum: string,\n): Promise<void> {\n  const metaPath = getMetadataPath(cacheEntryPath)\n  const metadata = {\n    arch: os.arch(),\n    checksum,\n    platform: os.platform(),\n    timestamp: Date.now(),\n    url,\n    version: '1.0.0',\n  }\n  await fs.writeFile(metaPath, JSON.stringify(metadata, null, 2))\n}\n\n/**\n * Clean expired entries from the DLX cache.\n */\nexport async function cleanDlxCache(\n  maxAge: number = /*@__INLINE__*/ require('../constants/time').DLX_BINARY_CACHE_TTL,\n): Promise<number> {\n  const cacheDir = getDlxCachePath()\n\n  if (!existsSync(cacheDir)) {\n    return 0\n  }\n\n  let cleaned = 0\n  const now = Date.now()\n  const entries = await fs.readdir(cacheDir)\n\n  for (const entry of entries) {\n    const entryPath = path.join(cacheDir, entry)\n    const metaPath = getMetadataPath(entryPath)\n\n    try {\n      // eslint-disable-next-line no-await-in-loop\n      if (!(await isDir(entryPath))) {\n        continue\n      }\n\n      // eslint-disable-next-line no-await-in-loop\n      const metadata = await readJson(metaPath, { throws: false })\n      if (\n        !metadata ||\n        typeof metadata !== 'object' ||\n        Array.isArray(metadata)\n      ) {\n        continue\n      }\n      const age =\n        now -\n        (((metadata as Record<string, unknown>)['timestamp'] as number) || 0)\n\n      if (age > maxAge) {\n        // Remove entire cache entry directory.\n        // eslint-disable-next-line no-await-in-loop\n        await safeDelete(entryPath, { force: true, recursive: true })\n        cleaned += 1\n      }\n    } catch {\n      // If we can't read metadata, check if directory is empty or corrupted.\n      try {\n        // eslint-disable-next-line no-await-in-loop\n        const contents = await fs.readdir(entryPath)\n        if (!contents.length) {\n          // Remove empty directory.\n          // eslint-disable-next-line no-await-in-loop\n          await safeDelete(entryPath)\n          cleaned += 1\n        }\n      } catch {}\n    }\n  }\n\n  return cleaned\n}\n\n/**\n * Download and execute a binary from a URL with caching.\n */\nexport async function dlxBinary(\n  args: readonly string[] | string[],\n  options?: DlxBinaryOptions | undefined,\n  spawnExtra?: SpawnExtra | undefined,\n): Promise<DlxBinaryResult> {\n  const {\n    cacheTtl = /*@__INLINE__*/ require('../constants/time').DLX_BINARY_CACHE_TTL,\n    checksum,\n    force = false,\n    name,\n    spawnOptions,\n    url,\n  } = { __proto__: null, ...options } as DlxBinaryOptions\n\n  // Generate cache paths similar to pnpm/npx structure.\n  const cacheDir = getDlxCachePath()\n  const cacheKey = generateCacheKey(url)\n  const cacheEntryDir = path.join(cacheDir, cacheKey)\n  const binaryName = name || `binary-${process.platform}-${os.arch()}`\n  const binaryPath = normalizePath(path.join(cacheEntryDir, binaryName))\n\n  let downloaded = false\n  let computedChecksum = checksum\n\n  // Check if we need to download.\n  if (\n    !force &&\n    existsSync(cacheEntryDir) &&\n    (await isCacheValid(cacheEntryDir, cacheTtl))\n  ) {\n    // Binary is cached and valid, read the checksum from metadata.\n    try {\n      const metaPath = getMetadataPath(cacheEntryDir)\n      const metadata = await readJson(metaPath, { throws: false })\n      if (\n        metadata &&\n        typeof metadata === 'object' &&\n        !Array.isArray(metadata) &&\n        typeof (metadata as Record<string, unknown>)['checksum'] === 'string'\n      ) {\n        computedChecksum = (metadata as Record<string, unknown>)[\n          'checksum'\n        ] as string\n      } else {\n        // If metadata is invalid, re-download.\n        downloaded = true\n      }\n    } catch {\n      // If we can't read metadata, re-download.\n      downloaded = true\n    }\n  } else {\n    downloaded = true\n  }\n\n  if (downloaded) {\n    // Ensure cache directory exists.\n    await fs.mkdir(cacheEntryDir, { recursive: true })\n\n    // Download the binary.\n    computedChecksum = await downloadBinary(url, binaryPath, checksum)\n    await writeMetadata(cacheEntryDir, url, computedChecksum || '')\n  }\n\n  // Execute the binary.\n  // On Windows, script files (.bat, .cmd, .ps1) require shell: true because\n  // they are not executable on their own and must be run through cmd.exe.\n  // Note: .exe files are actual binaries and don't need shell mode.\n  const needsShell = WIN32 && /\\.(?:bat|cmd|ps1)$/i.test(binaryPath)\n  // Windows cmd.exe PATH resolution behavior:\n  // When shell: true on Windows with .cmd/.bat/.ps1 files, spawn will automatically\n  // strip the full path down to just the basename without extension (e.g.,\n  // C:\\cache\\test.cmd becomes just \"test\"). Windows cmd.exe then searches for \"test\"\n  // in directories listed in PATH, trying each extension from PATHEXT environment\n  // variable (.COM, .EXE, .BAT, .CMD, etc.) until it finds a match.\n  //\n  // Since our binaries are downloaded to a custom cache directory that's not in PATH\n  // (unlike system package managers like npm/pnpm/yarn which are already in PATH),\n  // we must prepend the cache directory to PATH so cmd.exe can locate the binary.\n  //\n  // This approach is consistent with how other tools handle Windows command execution:\n  // - npm's promise-spawn: uses which.sync() to find commands in PATH\n  // - cross-spawn: spawns cmd.exe with escaped arguments\n  // - Node.js spawn with shell: true: delegates to cmd.exe which uses PATH\n  const finalSpawnOptions = needsShell\n    ? {\n        ...spawnOptions,\n        env: {\n          ...spawnOptions?.env,\n          PATH: `${cacheEntryDir}${path.delimiter}${process.env['PATH'] || ''}`,\n        },\n        shell: true,\n      }\n    : spawnOptions\n  const spawnPromise = spawn(binaryPath, args, finalSpawnOptions, spawnExtra)\n\n  return {\n    binaryPath,\n    downloaded,\n    spawnPromise,\n  }\n}\n\n/**\n * Get the DLX binary cache directory path.\n * Returns normalized path for cross-platform compatibility.\n * Uses same directory as dlx-package for unified DLX storage.\n */\nexport function getDlxCachePath(): string {\n  return getSocketDlxDir()\n}\n\n/**\n * Get information about cached binaries.\n */\nexport async function listDlxCache(): Promise<\n  Array<{\n    age: number\n    arch: string\n    checksum: string\n    name: string\n    platform: string\n    size: number\n    url: string\n  }>\n> {\n  const cacheDir = getDlxCachePath()\n\n  if (!existsSync(cacheDir)) {\n    return []\n  }\n\n  const results = []\n  const now = Date.now()\n  const entries = await fs.readdir(cacheDir)\n\n  for (const entry of entries) {\n    const entryPath = path.join(cacheDir, entry)\n    try {\n      // eslint-disable-next-line no-await-in-loop\n      if (!(await isDir(entryPath))) {\n        continue\n      }\n\n      const metaPath = getMetadataPath(entryPath)\n      // eslint-disable-next-line no-await-in-loop\n      const metadata = await readJson(metaPath, { throws: false })\n      if (\n        !metadata ||\n        typeof metadata !== 'object' ||\n        Array.isArray(metadata)\n      ) {\n        continue\n      }\n\n      // Find the binary file in the directory.\n      // eslint-disable-next-line no-await-in-loop\n      const files = await fs.readdir(entryPath)\n      const binaryFile = files.find(f => !f.startsWith('.'))\n\n      if (binaryFile) {\n        const binaryPath = path.join(entryPath, binaryFile)\n        // eslint-disable-next-line no-await-in-loop\n        const binaryStats = await fs.stat(binaryPath)\n\n        const metaObj = metadata as Record<string, unknown>\n        results.push({\n          age: now - ((metaObj['timestamp'] as number) || 0),\n          arch: (metaObj['arch'] as string) || 'unknown',\n          checksum: (metaObj['checksum'] as string) || '',\n          name: binaryFile,\n          platform: (metaObj['platform'] as string) || 'unknown',\n          size: binaryStats.size,\n          url: (metaObj['url'] as string) || '',\n        })\n      }\n    } catch {}\n  }\n\n  return results\n}\n"],
-  "mappings": ";6iBAAA,IAAAA,EAAA,GAAAC,EAAAD,EAAA,mBAAAE,EAAA,cAAAC,EAAA,oBAAAC,EAAA,iBAAAC,IAAA,eAAAC,EAAAN,GAEA,IAAAO,EAA2B,uBAC3BC,EAA2C,mBAC3CC,EAAe,sBACfC,EAAiB,wBAEjBC,EAAsB,+BAEtBC,EAA4C,gBAC5CC,EAA4B,0BAC5BC,EAA+B,qBAC/BC,EAA8B,kBAC9BC,EAAgC,mBAEhCC,EAAsB,mBA8BtB,SAASC,EAAiBC,EAAqB,CAC7C,SAAO,cAAW,QAAQ,EAAE,OAAOA,CAAG,EAAE,OAAO,KAAK,CACtD,CAKA,SAASC,EAAgBC,EAAgC,CACvD,OAAO,EAAAC,QAAK,KAAKD,EAAgB,oBAAoB,CACvD,CAKA,eAAeE,EACbF,EACAG,EACkB,CAClB,GAAI,CACF,MAAMC,EAAWL,EAAgBC,CAAc,EAC/C,GAAI,IAAC,cAAWI,CAAQ,EACtB,MAAO,GAGT,MAAMC,EAAW,QAAM,YAASD,EAAU,CAAE,OAAQ,EAAM,CAAC,EAC3D,SAAK,kBAAeC,CAAQ,EAGhB,KAAK,IAAI,GAGhBA,EAAqC,WAA2B,GAExDF,EAPJ,EAQX,MAAQ,CACN,MAAO,EACT,CACF,CAKA,eAAeG,EACbR,EACAS,EACAC,EACiB,CACjB,MAAMC,EAAW,QAAM,eAAYX,CAAG,EACtC,GAAI,CAACW,EAAS,GACZ,MAAM,IAAI,MACR,8BAA8BA,EAAS,MAAM,IAAIA,EAAS,UAAU,EACtE,EAIF,MAAMC,EAAW,GAAGH,CAAQ,YACtBI,KAAS,cAAW,QAAQ,EAElC,GAAI,CAEF,MAAM,EAAAC,SAAG,MAAM,EAAAX,QAAK,QAAQM,CAAQ,EAAG,CAAE,UAAW,EAAK,CAAC,EAG1D,MAAMM,EAASJ,EAAS,KAGxBE,EAAO,OAAOE,CAAM,EACpB,MAAMC,EAAiBH,EAAO,OAAO,KAAK,EAG1C,GAAIH,GAAYM,IAAmBN,EACjC,MAAM,IAAI,MACR,+BAA+BA,CAAQ,SAASM,CAAc,EAChE,EAIF,aAAM,EAAAF,SAAG,UAAUF,EAAUG,CAAM,EAG9B,SACH,MAAM,EAAAD,SAAG,MAAMF,EAAU,GAAK,EAIhC,MAAM,EAAAE,SAAG,OAAOF,EAAUH,CAAQ,EAE3BO,CACT,OAASC,EAAG,CAEV,GAAI,CACF,QAAM,cAAWL,CAAQ,CAC3B,MAAQ,CAER,CACA,MAAMK,CACR,CACF,CAKA,eAAeC,EACbhB,EACAF,EACAU,EACe,CACf,MAAMJ,EAAWL,EAAgBC,CAAc,EACzCK,EAAW,CACf,KAAM,EAAAY,QAAG,KAAK,EACd,SAAAT,EACA,SAAU,EAAAS,QAAG,SAAS,EACtB,UAAW,KAAK,IAAI,EACpB,IAAAnB,EACA,QAAS,OACX,EACA,MAAM,EAAAc,SAAG,UAAUR,EAAU,KAAK,UAAUC,EAAU,KAAM,CAAC,CAAC,CAChE,CAKA,eAAsBxB,EACpBqC,EAAiC,QAAQ,mBAAmB,EAAE,qBAC7C,CACjB,MAAMC,EAAWpC,EAAgB,EAEjC,GAAI,IAAC,cAAWoC,CAAQ,EACtB,MAAO,GAGT,IAAIC,EAAU,EACd,MAAMC,EAAM,KAAK,IAAI,EACfC,EAAU,MAAM,EAAAV,SAAG,QAAQO,CAAQ,EAEzC,UAAWI,KAASD,EAAS,CAC3B,MAAME,EAAY,EAAAvB,QAAK,KAAKkB,EAAUI,CAAK,EACrCnB,EAAWL,EAAgByB,CAAS,EAE1C,GAAI,CAEF,GAAI,CAAE,QAAM,SAAMA,CAAS,EACzB,SAIF,MAAMnB,EAAW,QAAM,YAASD,EAAU,CAAE,OAAQ,EAAM,CAAC,EAC3D,GACE,CAACC,GACD,OAAOA,GAAa,UACpB,MAAM,QAAQA,CAAQ,EAEtB,SAGAgB,GACGhB,EAAqC,WAA2B,GAE3Da,IAGR,QAAM,cAAWM,EAAW,CAAE,MAAO,GAAM,UAAW,EAAK,CAAC,EAC5DJ,GAAW,EAEf,MAAQ,CAEN,GAAI,EAEe,MAAM,EAAAR,SAAG,QAAQY,CAAS,GAC7B,SAGZ,QAAM,cAAWA,CAAS,EAC1BJ,GAAW,EAEf,MAAQ,CAAC,CACX,CACF,CAEA,OAAOA,CACT,CAKA,eAAsBtC,EACpB2C,EACAC,EACAC,EAC0B,CAC1B,KAAM,CACJ,SAAAxB,EAA2B,QAAQ,mBAAmB,EAAE,qBACxD,SAAAK,EACA,MAAAoB,EAAQ,GACR,KAAAC,EACA,aAAAC,EACA,IAAAhC,CACF,EAAI,CAAE,UAAW,KAAM,GAAG4B,CAAQ,EAG5BP,EAAWpC,EAAgB,EAC3BgD,EAAWlC,EAAiBC,CAAG,EAC/BkC,EAAgB,EAAA/B,QAAK,KAAKkB,EAAUY,CAAQ,EAC5CE,EAAaJ,GAAQ,UAAU,QAAQ,QAAQ,IAAI,EAAAZ,QAAG,KAAK,CAAC,GAC5DiB,KAAa,iBAAc,EAAAjC,QAAK,KAAK+B,EAAeC,CAAU,CAAC,EAErE,IAAIE,EAAa,GACbC,EAAmB5B,EAGvB,GACE,CAACoB,MACD,cAAWI,CAAa,GACvB,MAAM9B,EAAa8B,EAAe7B,CAAQ,EAG3C,GAAI,CACF,MAAMC,EAAWL,EAAgBiC,CAAa,EACxC3B,EAAW,QAAM,YAASD,EAAU,CAAE,OAAQ,EAAM,CAAC,EAEzDC,GACA,OAAOA,GAAa,UACpB,CAAC,MAAM,QAAQA,CAAQ,GACvB,OAAQA,EAAqC,UAAgB,SAE7D+B,EAAoB/B,EAClB,SAIF8B,EAAa,EAEjB,MAAQ,CAENA,EAAa,EACf,MAEAA,EAAa,GAGXA,IAEF,MAAM,EAAAvB,SAAG,MAAMoB,EAAe,CAAE,UAAW,EAAK,CAAC,EAGjDI,EAAmB,MAAM9B,EAAeR,EAAKoC,EAAY1B,CAAQ,EACjE,MAAMQ,EAAcgB,EAAelC,EAAKsC,GAAoB,EAAE,GAuBhE,MAAMC,EAhBa,SAAS,sBAAsB,KAAKH,CAAU,EAiB7D,CACE,GAAGJ,EACH,IAAK,CACH,GAAGA,GAAc,IACjB,KAAM,GAAGE,CAAa,GAAG,EAAA/B,QAAK,SAAS,GAAG,QAAQ,IAAI,MAAW,EAAE,EACrE,EACA,MAAO,EACT,EACA6B,EACEQ,KAAe,SAAMJ,EAAYT,EAAMY,EAAmBV,CAAU,EAE1E,MAAO,CACL,WAAAO,EACA,WAAAC,EACA,aAAAG,CACF,CACF,CAOO,SAASvD,GAA0B,CACxC,SAAO,mBAAgB,CACzB,CAKA,eAAsBC,GAUpB,CACA,MAAMmC,EAAWpC,EAAgB,EAEjC,GAAI,IAAC,cAAWoC,CAAQ,EACtB,MAAO,CAAC,EAGV,MAAMoB,EAAU,CAAC,EACXlB,EAAM,KAAK,IAAI,EACfC,EAAU,MAAM,EAAAV,SAAG,QAAQO,CAAQ,EAEzC,UAAWI,KAASD,EAAS,CAC3B,MAAME,EAAY,EAAAvB,QAAK,KAAKkB,EAAUI,CAAK,EAC3C,GAAI,CAEF,GAAI,CAAE,QAAM,SAAMC,CAAS,EACzB,SAGF,MAAMpB,EAAWL,EAAgByB,CAAS,EAEpCnB,EAAW,QAAM,YAASD,EAAU,CAAE,OAAQ,EAAM,CAAC,EAC3D,GACE,CAACC,GACD,OAAOA,GAAa,UACpB,MAAM,QAAQA,CAAQ,EAEtB,SAMF,MAAMmC,GADQ,MAAM,EAAA5B,SAAG,QAAQY,CAAS,GACf,KAAKiB,GAAK,CAACA,EAAE,WAAW,GAAG,CAAC,EAErD,GAAID,EAAY,CACd,MAAMN,EAAa,EAAAjC,QAAK,KAAKuB,EAAWgB,CAAU,EAE5CE,EAAc,MAAM,EAAA9B,SAAG,KAAKsB,CAAU,EAEtCS,EAAUtC,EAChBkC,EAAQ,KAAK,CACX,IAAKlB,GAAQsB,EAAQ,WAA2B,GAChD,KAAOA,EAAQ,MAAsB,UACrC,SAAWA,EAAQ,UAA0B,GAC7C,KAAMH,EACN,SAAWG,EAAQ,UAA0B,UAC7C,KAAMD,EAAY,KAClB,IAAMC,EAAQ,KAAqB,EACrC,CAAC,CACH,CACF,MAAQ,CAAC,CACX,CAEA,OAAOJ,CACT",
-  "names": ["dlx_binary_exports", "__export", "cleanDlxCache", "dlxBinary", "getDlxCachePath", "listDlxCache", "__toCommonJS", "import_node_crypto", "import_node_fs", "import_node_os", "import_node_path", "import_platform", "import_fs", "import_http_request", "import_objects", "import_path", "import_paths", "import_spawn", "generateCacheKey", "url", "getMetadataPath", "cacheEntryPath", "path", "isCacheValid", "cacheTtl", "metaPath", "metadata", "downloadBinary", "destPath", "checksum", "response", "tempPath", "hasher", "fs", "buffer", "actualChecksum", "e", "writeMetadata", "os", "maxAge", "cacheDir", "cleaned", "now", "entries", "entry", "entryPath", "args", "options", "spawnExtra", "force", "name", "spawnOptions", "cacheKey", "cacheEntryDir", "binaryName", "binaryPath", "downloaded", "computedChecksum", "finalSpawnOptions", "spawnPromise", "results", "binaryFile", "f", "binaryStats", "metaObj"]
+  "sourcesContent": ["/** @fileoverview DLX binary execution utilities for Socket ecosystem. */\n\nimport { createHash } from 'node:crypto'\nimport { existsSync, promises as fs } from 'node:fs'\nimport os from 'node:os'\nimport path from 'node:path'\n\nimport { WIN32 } from '#constants/platform'\n\nimport { isDir, readJson, safeDelete } from './fs'\nimport { httpRequest } from './http-request'\nimport { isObjectObject } from './objects'\nimport { normalizePath } from './path'\nimport { getSocketDlxDir } from './paths'\nimport type { SpawnExtra, SpawnOptions } from './spawn'\nimport { spawn } from './spawn'\n\nexport interface DlxBinaryOptions {\n  /** URL to download the binary from. */\n  url: string\n  /** Optional name for the cached binary (defaults to URL hash). */\n  name?: string | undefined\n  /** Expected checksum (sha256) for verification. */\n  checksum?: string | undefined\n  /** Cache TTL in milliseconds (default: 7 days). */\n  cacheTtl?: number | undefined\n  /** Force re-download even if cached. */\n  force?: boolean | undefined\n  /** Additional spawn options. */\n  spawnOptions?: SpawnOptions | undefined\n}\n\nexport interface DlxBinaryResult {\n  /** Path to the cached binary. */\n  binaryPath: string\n  /** Whether the binary was newly downloaded. */\n  downloaded: boolean\n  /** The spawn promise for the running process. */\n  spawnPromise: ReturnType<typeof spawn>\n}\n\n/**\n * Generate a cache directory name from URL and binary name.\n * Uses SHA256 hash to create content-addressed storage.\n * Includes binary name to prevent collisions when multiple binaries\n * are downloaded from the same URL with different names.\n */\nfunction generateCacheKey(url: string, name: string): string {\n  return createHash('sha256').update(`${url}:${name}`).digest('hex')\n}\n\n/**\n * Get metadata file path for a cached binary.\n */\nfunction getMetadataPath(cacheEntryPath: string): string {\n  return path.join(cacheEntryPath, '.dlx-metadata.json')\n}\n\n/**\n * Check if a cached binary is still valid.\n */\nasync function isCacheValid(\n  cacheEntryPath: string,\n  cacheTtl: number,\n): Promise<boolean> {\n  try {\n    const metaPath = getMetadataPath(cacheEntryPath)\n    if (!existsSync(metaPath)) {\n      return false\n    }\n\n    const metadata = await readJson(metaPath, { throws: false })\n    if (!isObjectObject(metadata)) {\n      return false\n    }\n    const now = Date.now()\n    const timestamp = (metadata as Record<string, unknown>)['timestamp']\n    // If timestamp is missing or invalid, cache is invalid\n    if (typeof timestamp !== 'number' || timestamp <= 0) {\n      return false\n    }\n    const age = now - timestamp\n\n    return age < cacheTtl\n  } catch {\n    return false\n  }\n}\n\n/**\n * Download a file from a URL with integrity checking.\n */\nasync function downloadBinary(\n  url: string,\n  destPath: string,\n  checksum?: string | undefined,\n): Promise<string> {\n  const response = await httpRequest(url)\n  if (!response.ok) {\n    throw new Error(\n      `Failed to download binary: ${response.status} ${response.statusText}`,\n    )\n  }\n\n  // Create a temporary file first.\n  const tempPath = `${destPath}.download`\n  const hasher = createHash('sha256')\n\n  try {\n    // Ensure directory exists.\n    await fs.mkdir(path.dirname(destPath), { recursive: true })\n\n    // Get the response as a buffer and compute hash.\n    const buffer = response.body\n\n    // Compute hash.\n    hasher.update(buffer)\n    const actualChecksum = hasher.digest('hex')\n\n    // Verify checksum if provided.\n    if (checksum && actualChecksum !== checksum) {\n      throw new Error(\n        `Checksum mismatch: expected ${checksum}, got ${actualChecksum}`,\n      )\n    }\n\n    // Write to temp file.\n    await fs.writeFile(tempPath, buffer)\n\n    // Make executable on POSIX systems.\n    if (!WIN32) {\n      await fs.chmod(tempPath, 0o755)\n    }\n\n    // Move temp file to final location.\n    await fs.rename(tempPath, destPath)\n\n    return actualChecksum\n  } catch (e) {\n    // Clean up temp file on error.\n    try {\n      await safeDelete(tempPath)\n    } catch {\n      // Ignore cleanup errors.\n    }\n    throw e\n  }\n}\n\n/**\n * Write metadata for a cached binary.\n */\nasync function writeMetadata(\n  cacheEntryPath: string,\n  url: string,\n  checksum: string,\n): Promise<void> {\n  const metaPath = getMetadataPath(cacheEntryPath)\n  const metadata = {\n    arch: os.arch(),\n    checksum,\n    platform: os.platform(),\n    timestamp: Date.now(),\n    url,\n    version: '1.0.0',\n  }\n  await fs.writeFile(metaPath, JSON.stringify(metadata, null, 2))\n}\n\n/**\n * Clean expired entries from the DLX cache.\n */\nexport async function cleanDlxCache(\n  maxAge: number = /*@__INLINE__*/ require('#constants/time').DLX_BINARY_CACHE_TTL,\n): Promise<number> {\n  const cacheDir = getDlxCachePath()\n\n  if (!existsSync(cacheDir)) {\n    return 0\n  }\n\n  let cleaned = 0\n  const now = Date.now()\n  const entries = await fs.readdir(cacheDir)\n\n  for (const entry of entries) {\n    const entryPath = path.join(cacheDir, entry)\n    const metaPath = getMetadataPath(entryPath)\n\n    try {\n      // eslint-disable-next-line no-await-in-loop\n      if (!(await isDir(entryPath))) {\n        continue\n      }\n\n      // eslint-disable-next-line no-await-in-loop\n      const metadata = await readJson(metaPath, { throws: false })\n      if (\n        !metadata ||\n        typeof metadata !== 'object' ||\n        Array.isArray(metadata)\n      ) {\n        continue\n      }\n      const timestamp = (metadata as Record<string, unknown>)['timestamp']\n      // If timestamp is missing or invalid, treat as expired (age = infinity)\n      const age =\n        typeof timestamp === 'number' && timestamp > 0\n          ? now - timestamp\n          : Number.POSITIVE_INFINITY\n\n      if (age > maxAge) {\n        // Remove entire cache entry directory.\n        // eslint-disable-next-line no-await-in-loop\n        await safeDelete(entryPath, { force: true, recursive: true })\n        cleaned += 1\n      }\n    } catch {\n      // If we can't read metadata, check if directory is empty or corrupted.\n      try {\n        // eslint-disable-next-line no-await-in-loop\n        const contents = await fs.readdir(entryPath)\n        if (!contents.length) {\n          // Remove empty directory.\n          // eslint-disable-next-line no-await-in-loop\n          await safeDelete(entryPath)\n          cleaned += 1\n        }\n      } catch {}\n    }\n  }\n\n  return cleaned\n}\n\n/**\n * Download and execute a binary from a URL with caching.\n */\nexport async function dlxBinary(\n  args: readonly string[] | string[],\n  options?: DlxBinaryOptions | undefined,\n  spawnExtra?: SpawnExtra | undefined,\n): Promise<DlxBinaryResult> {\n  const {\n    cacheTtl = /*@__INLINE__*/ require('#constants/time').DLX_BINARY_CACHE_TTL,\n    checksum,\n    force = false,\n    name,\n    spawnOptions,\n    url,\n  } = { __proto__: null, ...options } as DlxBinaryOptions\n\n  // Generate cache paths similar to pnpm/npx structure.\n  const cacheDir = getDlxCachePath()\n  const binaryName = name || `binary-${process.platform}-${os.arch()}`\n  const cacheKey = generateCacheKey(url, binaryName)\n  const cacheEntryDir = path.join(cacheDir, cacheKey)\n  const binaryPath = normalizePath(path.join(cacheEntryDir, binaryName))\n\n  let downloaded = false\n  let computedChecksum = checksum\n\n  // Check if we need to download.\n  if (\n    !force &&\n    existsSync(cacheEntryDir) &&\n    (await isCacheValid(cacheEntryDir, cacheTtl))\n  ) {\n    // Binary is cached and valid, read the checksum from metadata.\n    try {\n      const metaPath = getMetadataPath(cacheEntryDir)\n      const metadata = await readJson(metaPath, { throws: false })\n      if (\n        metadata &&\n        typeof metadata === 'object' &&\n        !Array.isArray(metadata) &&\n        typeof (metadata as Record<string, unknown>)['checksum'] === 'string'\n      ) {\n        computedChecksum = (metadata as Record<string, unknown>)[\n          'checksum'\n        ] as string\n      } else {\n        // If metadata is invalid, re-download.\n        downloaded = true\n      }\n    } catch {\n      // If we can't read metadata, re-download.\n      downloaded = true\n    }\n  } else {\n    downloaded = true\n  }\n\n  if (downloaded) {\n    // Ensure cache directory exists.\n    await fs.mkdir(cacheEntryDir, { recursive: true })\n\n    // Download the binary.\n    computedChecksum = await downloadBinary(url, binaryPath, checksum)\n    await writeMetadata(cacheEntryDir, url, computedChecksum || '')\n  }\n\n  // Execute the binary.\n  // On Windows, script files (.bat, .cmd, .ps1) require shell: true because\n  // they are not executable on their own and must be run through cmd.exe.\n  // Note: .exe files are actual binaries and don't need shell mode.\n  const needsShell = WIN32 && /\\.(?:bat|cmd|ps1)$/i.test(binaryPath)\n  // Windows cmd.exe PATH resolution behavior:\n  // When shell: true on Windows with .cmd/.bat/.ps1 files, spawn will automatically\n  // strip the full path down to just the basename without extension (e.g.,\n  // C:\\cache\\test.cmd becomes just \"test\"). Windows cmd.exe then searches for \"test\"\n  // in directories listed in PATH, trying each extension from PATHEXT environment\n  // variable (.COM, .EXE, .BAT, .CMD, etc.) until it finds a match.\n  //\n  // Since our binaries are downloaded to a custom cache directory that's not in PATH\n  // (unlike system package managers like npm/pnpm/yarn which are already in PATH),\n  // we must prepend the cache directory to PATH so cmd.exe can locate the binary.\n  //\n  // This approach is consistent with how other tools handle Windows command execution:\n  // - npm's promise-spawn: uses which.sync() to find commands in PATH\n  // - cross-spawn: spawns cmd.exe with escaped arguments\n  // - Node.js spawn with shell: true: delegates to cmd.exe which uses PATH\n  const finalSpawnOptions = needsShell\n    ? {\n        ...spawnOptions,\n        env: {\n          ...spawnOptions?.env,\n          PATH: `${cacheEntryDir}${path.delimiter}${process.env['PATH'] || ''}`,\n        },\n        shell: true,\n      }\n    : spawnOptions\n  const spawnPromise = spawn(binaryPath, args, finalSpawnOptions, spawnExtra)\n\n  return {\n    binaryPath,\n    downloaded,\n    spawnPromise,\n  }\n}\n\n/**\n * Get the DLX binary cache directory path.\n * Returns normalized path for cross-platform compatibility.\n * Uses same directory as dlx-package for unified DLX storage.\n */\nexport function getDlxCachePath(): string {\n  return getSocketDlxDir()\n}\n\n/**\n * Get information about cached binaries.\n */\nexport async function listDlxCache(): Promise<\n  Array<{\n    age: number\n    arch: string\n    checksum: string\n    name: string\n    platform: string\n    size: number\n    url: string\n  }>\n> {\n  const cacheDir = getDlxCachePath()\n\n  if (!existsSync(cacheDir)) {\n    return []\n  }\n\n  const results = []\n  const now = Date.now()\n  const entries = await fs.readdir(cacheDir)\n\n  for (const entry of entries) {\n    const entryPath = path.join(cacheDir, entry)\n    try {\n      // eslint-disable-next-line no-await-in-loop\n      if (!(await isDir(entryPath))) {\n        continue\n      }\n\n      const metaPath = getMetadataPath(entryPath)\n      // eslint-disable-next-line no-await-in-loop\n      const metadata = await readJson(metaPath, { throws: false })\n      if (\n        !metadata ||\n        typeof metadata !== 'object' ||\n        Array.isArray(metadata)\n      ) {\n        continue\n      }\n\n      // Find the binary file in the directory.\n      // eslint-disable-next-line no-await-in-loop\n      const files = await fs.readdir(entryPath)\n      const binaryFile = files.find(f => !f.startsWith('.'))\n\n      if (binaryFile) {\n        const binaryPath = path.join(entryPath, binaryFile)\n        // eslint-disable-next-line no-await-in-loop\n        const binaryStats = await fs.stat(binaryPath)\n\n        const metaObj = metadata as Record<string, unknown>\n        results.push({\n          age: now - ((metaObj['timestamp'] as number) || 0),\n          arch: (metaObj['arch'] as string) || 'unknown',\n          checksum: (metaObj['checksum'] as string) || '',\n          name: binaryFile,\n          platform: (metaObj['platform'] as string) || 'unknown',\n          size: binaryStats.size,\n          url: (metaObj['url'] as string) || '',\n        })\n      }\n    } catch {}\n  }\n\n  return results\n}\n"],
+  "mappings": ";6iBAAA,IAAAA,EAAA,GAAAC,EAAAD,EAAA,mBAAAE,EAAA,cAAAC,EAAA,oBAAAC,EAAA,iBAAAC,IAAA,eAAAC,EAAAN,GAEA,IAAAO,EAA2B,uBAC3BC,EAA2C,mBAC3CC,EAAe,sBACfC,EAAiB,wBAEjBC,EAAsB,+BAEtBC,EAA4C,gBAC5CC,EAA4B,0BAC5BC,EAA+B,qBAC/BC,EAA8B,kBAC9BC,EAAgC,mBAEhCC,EAAsB,mBAgCtB,SAASC,EAAiBC,EAAaC,EAAsB,CAC3D,SAAO,cAAW,QAAQ,EAAE,OAAO,GAAGD,CAAG,IAAIC,CAAI,EAAE,EAAE,OAAO,KAAK,CACnE,CAKA,SAASC,EAAgBC,EAAgC,CACvD,OAAO,EAAAC,QAAK,KAAKD,EAAgB,oBAAoB,CACvD,CAKA,eAAeE,EACbF,EACAG,EACkB,CAClB,GAAI,CACF,MAAMC,EAAWL,EAAgBC,CAAc,EAC/C,GAAI,IAAC,cAAWI,CAAQ,EACtB,MAAO,GAGT,MAAMC,EAAW,QAAM,YAASD,EAAU,CAAE,OAAQ,EAAM,CAAC,EAC3D,GAAI,IAAC,kBAAeC,CAAQ,EAC1B,MAAO,GAET,MAAMC,EAAM,KAAK,IAAI,EACfC,EAAaF,EAAqC,UAExD,OAAI,OAAOE,GAAc,UAAYA,GAAa,EACzC,GAEGD,EAAMC,EAELJ,CACf,MAAQ,CACN,MAAO,EACT,CACF,CAKA,eAAeK,EACbX,EACAY,EACAC,EACiB,CACjB,MAAMC,EAAW,QAAM,eAAYd,CAAG,EACtC,GAAI,CAACc,EAAS,GACZ,MAAM,IAAI,MACR,8BAA8BA,EAAS,MAAM,IAAIA,EAAS,UAAU,EACtE,EAIF,MAAMC,EAAW,GAAGH,CAAQ,YACtBI,KAAS,cAAW,QAAQ,EAElC,GAAI,CAEF,MAAM,EAAAC,SAAG,MAAM,EAAAb,QAAK,QAAQQ,CAAQ,EAAG,CAAE,UAAW,EAAK,CAAC,EAG1D,MAAMM,EAASJ,EAAS,KAGxBE,EAAO,OAAOE,CAAM,EACpB,MAAMC,EAAiBH,EAAO,OAAO,KAAK,EAG1C,GAAIH,GAAYM,IAAmBN,EACjC,MAAM,IAAI,MACR,+BAA+BA,CAAQ,SAASM,CAAc,EAChE,EAIF,aAAM,EAAAF,SAAG,UAAUF,EAAUG,CAAM,EAG9B,SACH,MAAM,EAAAD,SAAG,MAAMF,EAAU,GAAK,EAIhC,MAAM,EAAAE,SAAG,OAAOF,EAAUH,CAAQ,EAE3BO,CACT,OAASC,EAAG,CAEV,GAAI,CACF,QAAM,cAAWL,CAAQ,CAC3B,MAAQ,CAER,CACA,MAAMK,CACR,CACF,CAKA,eAAeC,EACblB,EACAH,EACAa,EACe,CACf,MAAMN,EAAWL,EAAgBC,CAAc,EACzCK,EAAW,CACf,KAAM,EAAAc,QAAG,KAAK,EACd,SAAAT,EACA,SAAU,EAAAS,QAAG,SAAS,EACtB,UAAW,KAAK,IAAI,EACpB,IAAAtB,EACA,QAAS,OACX,EACA,MAAM,EAAAiB,SAAG,UAAUV,EAAU,KAAK,UAAUC,EAAU,KAAM,CAAC,CAAC,CAChE,CAKA,eAAsBzB,EACpBwC,EAAiC,QAAQ,iBAAiB,EAAE,qBAC3C,CACjB,MAAMC,EAAWvC,EAAgB,EAEjC,GAAI,IAAC,cAAWuC,CAAQ,EACtB,MAAO,GAGT,IAAIC,EAAU,EACd,MAAMhB,EAAM,KAAK,IAAI,EACfiB,EAAU,MAAM,EAAAT,SAAG,QAAQO,CAAQ,EAEzC,UAAWG,KAASD,EAAS,CAC3B,MAAME,EAAY,EAAAxB,QAAK,KAAKoB,EAAUG,CAAK,EACrCpB,EAAWL,EAAgB0B,CAAS,EAE1C,GAAI,CAEF,GAAI,CAAE,QAAM,SAAMA,CAAS,EACzB,SAIF,MAAMpB,EAAW,QAAM,YAASD,EAAU,CAAE,OAAQ,EAAM,CAAC,EAC3D,GACE,CAACC,GACD,OAAOA,GAAa,UACpB,MAAM,QAAQA,CAAQ,EAEtB,SAEF,MAAME,EAAaF,EAAqC,WAGtD,OAAOE,GAAc,UAAYA,EAAY,EACzCD,EAAMC,EACN,OAAO,mBAEHa,IAGR,QAAM,cAAWK,EAAW,CAAE,MAAO,GAAM,UAAW,EAAK,CAAC,EAC5DH,GAAW,EAEf,MAAQ,CAEN,GAAI,EAEe,MAAM,EAAAR,SAAG,QAAQW,CAAS,GAC7B,SAGZ,QAAM,cAAWA,CAAS,EAC1BH,GAAW,EAEf,MAAQ,CAAC,CACX,CACF,CAEA,OAAOA,CACT,CAKA,eAAsBzC,EACpB6C,EACAC,EACAC,EAC0B,CAC1B,KAAM,CACJ,SAAAzB,EAA2B,QAAQ,iBAAiB,EAAE,qBACtD,SAAAO,EACA,MAAAmB,EAAQ,GACR,KAAA/B,EACA,aAAAgC,EACA,IAAAjC,CACF,EAAI,CAAE,UAAW,KAAM,GAAG8B,CAAQ,EAG5BN,EAAWvC,EAAgB,EAC3BiD,EAAajC,GAAQ,UAAU,QAAQ,QAAQ,IAAI,EAAAqB,QAAG,KAAK,CAAC,GAC5Da,EAAWpC,EAAiBC,EAAKkC,CAAU,EAC3CE,EAAgB,EAAAhC,QAAK,KAAKoB,EAAUW,CAAQ,EAC5CE,KAAa,iBAAc,EAAAjC,QAAK,KAAKgC,EAAeF,CAAU,CAAC,EAErE,IAAII,EAAa,GACbC,EAAmB1B,EAGvB,GACE,CAACmB,MACD,cAAWI,CAAa,GACvB,MAAM/B,EAAa+B,EAAe9B,CAAQ,EAG3C,GAAI,CACF,MAAMC,EAAWL,EAAgBkC,CAAa,EACxC5B,EAAW,QAAM,YAASD,EAAU,CAAE,OAAQ,EAAM,CAAC,EAEzDC,GACA,OAAOA,GAAa,UACpB,CAAC,MAAM,QAAQA,CAAQ,GACvB,OAAQA,EAAqC,UAAgB,SAE7D+B,EAAoB/B,EAClB,SAIF8B,EAAa,EAEjB,MAAQ,CAENA,EAAa,EACf,MAEAA,EAAa,GAGXA,IAEF,MAAM,EAAArB,SAAG,MAAMmB,EAAe,CAAE,UAAW,EAAK,CAAC,EAGjDG,EAAmB,MAAM5B,EAAeX,EAAKqC,EAAYxB,CAAQ,EACjE,MAAMQ,EAAce,EAAepC,EAAKuC,GAAoB,EAAE,GAuBhE,MAAMC,EAhBa,SAAS,sBAAsB,KAAKH,CAAU,EAiB7D,CACE,GAAGJ,EACH,IAAK,CACH,GAAGA,GAAc,IACjB,KAAM,GAAGG,CAAa,GAAG,EAAAhC,QAAK,SAAS,GAAG,QAAQ,IAAI,MAAW,EAAE,EACrE,EACA,MAAO,EACT,EACA6B,EACEQ,KAAe,SAAMJ,EAAYR,EAAMW,EAAmBT,CAAU,EAE1E,MAAO,CACL,WAAAM,EACA,WAAAC,EACA,aAAAG,CACF,CACF,CAOO,SAASxD,GAA0B,CACxC,SAAO,mBAAgB,CACzB,CAKA,eAAsBC,GAUpB,CACA,MAAMsC,EAAWvC,EAAgB,EAEjC,GAAI,IAAC,cAAWuC,CAAQ,EACtB,MAAO,CAAC,EAGV,MAAMkB,EAAU,CAAC,EACXjC,EAAM,KAAK,IAAI,EACfiB,EAAU,MAAM,EAAAT,SAAG,QAAQO,CAAQ,EAEzC,UAAWG,KAASD,EAAS,CAC3B,MAAME,EAAY,EAAAxB,QAAK,KAAKoB,EAAUG,CAAK,EAC3C,GAAI,CAEF,GAAI,CAAE,QAAM,SAAMC,CAAS,EACzB,SAGF,MAAMrB,EAAWL,EAAgB0B,CAAS,EAEpCpB,EAAW,QAAM,YAASD,EAAU,CAAE,OAAQ,EAAM,CAAC,EAC3D,GACE,CAACC,GACD,OAAOA,GAAa,UACpB,MAAM,QAAQA,CAAQ,EAEtB,SAMF,MAAMmC,GADQ,MAAM,EAAA1B,SAAG,QAAQW,CAAS,GACf,KAAKgB,GAAK,CAACA,EAAE,WAAW,GAAG,CAAC,EAErD,GAAID,EAAY,CACd,MAAMN,EAAa,EAAAjC,QAAK,KAAKwB,EAAWe,CAAU,EAE5CE,EAAc,MAAM,EAAA5B,SAAG,KAAKoB,CAAU,EAEtCS,EAAUtC,EAChBkC,EAAQ,KAAK,CACX,IAAKjC,GAAQqC,EAAQ,WAA2B,GAChD,KAAOA,EAAQ,MAAsB,UACrC,SAAWA,EAAQ,UAA0B,GAC7C,KAAMH,EACN,SAAWG,EAAQ,UAA0B,UAC7C,KAAMD,EAAY,KAClB,IAAMC,EAAQ,KAAqB,EACrC,CAAC,CACH,CACF,MAAQ,CAAC,CACX,CAEA,OAAOJ,CACT",
+  "names": ["dlx_binary_exports", "__export", "cleanDlxCache", "dlxBinary", "getDlxCachePath", "listDlxCache", "__toCommonJS", "import_node_crypto", "import_node_fs", "import_node_os", "import_node_path", "import_platform", "import_fs", "import_http_request", "import_objects", "import_path", "import_paths", "import_spawn", "generateCacheKey", "url", "name", "getMetadataPath", "cacheEntryPath", "path", "isCacheValid", "cacheTtl", "metaPath", "metadata", "now", "timestamp", "downloadBinary", "destPath", "checksum", "response", "tempPath", "hasher", "fs", "buffer", "actualChecksum", "e", "writeMetadata", "os", "maxAge", "cacheDir", "cleaned", "entries", "entry", "entryPath", "args", "options", "spawnExtra", "force", "spawnOptions", "binaryName", "cacheKey", "cacheEntryDir", "binaryPath", "downloaded", "computedChecksum", "finalSpawnOptions", "spawnPromise", "results", "binaryFile", "f", "binaryStats", "metaObj"]
 }

package/dist/effects/text-shimmer.js

@@ -1,3 +1,3 @@
 /* Socket Lib - Built with esbuild */
-var y=Object.defineProperty;var O=Object.getOwnPropertyDescriptor;var G=Object.getOwnPropertyNames;var M=Object.prototype.hasOwnProperty;var A=(e,r)=>{for(var t in r)y(e,t,{get:r[t],enumerable:!0})},E=(e,r,t,n)=>{if(r&&typeof r=="object"||typeof r=="function")for(let o of G(r))!M.call(e,o)&&o!==t&&y(e,o,{get:()=>r[o],enumerable:!(n=O(r,o))||n.enumerable});return e};var N=e=>E(y({},"__esModule",{value:!0}),e);var H={};A(H,{COLOR_INHERIT:()=>j,DIR_LTR:()=>p,DIR_NONE:()=>x,DIR_RANDOM:()=>a,DIR_RTL:()=>u,MODE_BI:()=>_,applyShimmer:()=>B});module.exports=N(H);var l=require("../ansi"),$=require("../arrays"),C=require("#env/ci");function k(e){return{__proto__:null,bold:/\x1b\[1m/.test(e),dim:/\x1b\[2m/.test(e),italic:/\x1b\[3m/.test(e),strikethrough:/\x1b\[9m/.test(e),underline:/\x1b\[4m/.test(e)}}function D(e){let r="";return e.bold&&(r+="\x1B[1m"),e.dim&&(r+="\x1B[2m"),e.italic&&(r+="\x1B[3m"),e.underline&&(r+="\x1B[4m"),e.strikethrough&&(r+="\x1B[9m"),r}const j="inherit",p="ltr",x="none",a="random",u="rtl",_="bi";function w(e,r=2.5){return e>r?0:(1-e/r)**2.5}function z(e,r,t){const n=Math.round(e[0]+(r[0]-e[0])*t),o=Math.round(e[1]+(r[1]-e[1])*t),s=Math.round(e[2]+(r[2]-e[2])*t);return[n,o,s]}function L(e,r,t,n,o){const s=Math.abs(r-t),m=w(s),b=D(o),i=(0,$.isArray)(n[0])?n[r%n.length]??[140,82,255]:n;if(m===0){const h=`\x1B[38;2;${i[0]};${i[1]};${i[2]}m`;return`${b}${h}${e}${l.ANSI_RESET}`}const d=z(i,[255,255,255],m),c=`\x1B[38;2;${d[0]};${d[1]};${d[2]}m`;return`${b}${c}${e}${l.ANSI_RESET}`}function P(e,r,t,n=2.5){const o=e+n+2;return t===u?e-r%o:r%o}function W(e){return e===a?Math.random()<.5?p:u:e===u?u:p}function B(e,r,t){const n={__proto__:null,...t},o=n.direction??x,s=n.shimmerWidth??2.5,m=n.color??[140,82,255],b=n.styles??k(e),i=(0,l.stripAnsi)(e);if(C.CI||!i||o===x){const h=D(b),S=(0,$.isArray)(m[0]);return i.split("").map((R,T)=>{const f=S?m[T%m.length]??[140,82,255]:m,I=`\x1B[38;2;${f[0]};${f[1]};${f[2]}m`;return`${h}${I}${R}${l.ANSI_RESET}`}).join("")}const g=P(i.length,r.step,r.currentDir,s),d=i.split("").map((h,S)=>L(h,S,g,m,b)).join("");r.step+=r.speed;const c=i.length+s+2;return r.mode===_?r.step>=c&&(r.step=0,r.currentDir=r.currentDir===p?u:p):r.mode===a?r.step>=c&&(r.step=0,r.currentDir=W(a)):r.step>=c&&(r.step=0),d}0&&(module.exports={COLOR_INHERIT,DIR_LTR,DIR_NONE,DIR_RANDOM,DIR_RTL,MODE_BI,applyShimmer});
+var y=Object.defineProperty;var O=Object.getOwnPropertyDescriptor;var G=Object.getOwnPropertyNames;var M=Object.prototype.hasOwnProperty;var A=(e,r)=>{for(var t in r)y(e,t,{get:r[t],enumerable:!0})},E=(e,r,t,n)=>{if(r&&typeof r=="object"||typeof r=="function")for(let o of G(r))!M.call(e,o)&&o!==t&&y(e,o,{get:()=>r[o],enumerable:!(n=O(r,o))||n.enumerable});return e};var N=e=>E(y({},"__esModule",{value:!0}),e);var H={};A(H,{COLOR_INHERIT:()=>j,DIR_LTR:()=>p,DIR_NONE:()=>x,DIR_RANDOM:()=>a,DIR_RTL:()=>u,MODE_BI:()=>_,applyShimmer:()=>B});module.exports=N(H);var l=require("../ansi"),$=require("../arrays"),C=require("#env/ci");function k(e){return{__proto__:null,bold:/\x1b\[1m/.test(e),dim:/\x1b\[2m/.test(e),italic:/\x1b\[3m/.test(e),strikethrough:/\x1b\[9m/.test(e),underline:/\x1b\[4m/.test(e)}}function D(e){let r="";return e.bold&&(r+="\x1B[1m"),e.dim&&(r+="\x1B[2m"),e.italic&&(r+="\x1B[3m"),e.underline&&(r+="\x1B[4m"),e.strikethrough&&(r+="\x1B[9m"),r}const j="inherit",p="ltr",x="none",a="random",u="rtl",_="bi";function w(e,r=2.5){return e>r?0:(1-e/r)**2.5}function z(e,r,t){const n=Math.round(e[0]+(r[0]-e[0])*t),o=Math.round(e[1]+(r[1]-e[1])*t),s=Math.round(e[2]+(r[2]-e[2])*t);return[n,o,s]}function L(e,r,t,n,o){const s=Math.abs(r-t),m=w(s),b=D(o),i=(0,$.isArray)(n[0])?n[r%n.length]??[140,82,255]:n;if(m===0){const h=`\x1B[38;2;${i[0]};${i[1]};${i[2]}m`;return`${b}${h}${e}${l.ANSI_RESET}`}const d=z(i,[255,255,255],m),c=`\x1B[38;2;${d[0]};${d[1]};${d[2]}m`;return`${b}${c}${e}${l.ANSI_RESET}`}function P(e,r,t,n=2.5){const o=e+n+2;return t===u?e-r%o:r%o}function W(e){return e===a?Math.random()<.5?p:u:e===u?u:p}function B(e,r,t){const n={__proto__:null,...t},o=n.direction??x,s=n.shimmerWidth??2.5,m=n.color??[140,82,255],b=n.styles??k(e),i=(0,l.stripAnsi)(e);if((0,C.getCI)()||!i||o===x){const h=D(b),S=(0,$.isArray)(m[0]);return i.split("").map((R,T)=>{const f=S?m[T%m.length]??[140,82,255]:m,I=`\x1B[38;2;${f[0]};${f[1]};${f[2]}m`;return`${h}${I}${R}${l.ANSI_RESET}`}).join("")}const g=P(i.length,r.step,r.currentDir,s),d=i.split("").map((h,S)=>L(h,S,g,m,b)).join("");r.step+=r.speed;const c=i.length+s+2;return r.mode===_?r.step>=c&&(r.step=0,r.currentDir=r.currentDir===p?u:p):r.mode===a?r.step>=c&&(r.step=0,r.currentDir=W(a)):r.step>=c&&(r.step=0),d}0&&(module.exports={COLOR_INHERIT,DIR_LTR,DIR_NONE,DIR_RANDOM,DIR_RTL,MODE_BI,applyShimmer});
 //# sourceMappingURL=text-shimmer.js.map

package/dist/effects/text-shimmer.js.map

@@ -1,7 +1,7 @@
 {
   "version": 3,
   "sources": ["../../src/effects/text-shimmer.ts"],
-  "sourcesContent": ["/**\n * @fileoverview Text shimmer animation utilities.\n * Provides animated highlight effects for spinner text with configurable directions:\n * - LTR (left-to-right): Shimmer wave moves from left to right\n * - RTL (right-to-left): Shimmer wave moves from right to left\n * - Bidirectional: Alternates between LTR and RTL each cycle\n * - Random: Picks a random direction each cycle\n * - None: No shimmer animation\n *\n * The shimmer effect creates a bright wave that travels across the text,\n * with characters near the wave appearing nearly white and fading to the\n * base color as they get further from the wave position.\n */\n\nimport { ANSI_RESET, stripAnsi } from '../ansi'\nimport { isArray } from '../arrays'\nimport { CI } from '#env/ci'\n\nimport type {\n  ShimmerColorGradient,\n  ShimmerColorRgb,\n  ShimmerDirection,\n  ShimmerState,\n} from './types'\n\n// Re-export types for backward compatibility.\nexport type {\n  ShimmerColor,\n  ShimmerColorGradient,\n  ShimmerColorInherit,\n  ShimmerColorRgb,\n  ShimmerConfig,\n  ShimmerDirection,\n  ShimmerState,\n} from './types'\n\n/**\n * Detected text formatting styles from ANSI codes.\n */\ntype TextStyles = {\n  bold: boolean\n  dim: boolean\n  italic: boolean\n  strikethrough: boolean\n  underline: boolean\n}\n\n/**\n * Detect all text formatting styles present in ANSI-coded text.\n * Checks for bold, dim, italic, underline, and strikethrough.\n */\nfunction detectStyles(text: string): TextStyles {\n  return {\n    __proto__: null,\n    // biome-ignore lint/suspicious/noControlCharactersInRegex: ANSI escape sequence detection.\n    bold: /\\x1b\\[1m/.test(text),\n    // biome-ignore lint/suspicious/noControlCharactersInRegex: ANSI escape sequence detection.\n    dim: /\\x1b\\[2m/.test(text),\n    // biome-ignore lint/suspicious/noControlCharactersInRegex: ANSI escape sequence detection.\n    italic: /\\x1b\\[3m/.test(text),\n    // biome-ignore lint/suspicious/noControlCharactersInRegex: ANSI escape sequence detection.\n    strikethrough: /\\x1b\\[9m/.test(text),\n    // biome-ignore lint/suspicious/noControlCharactersInRegex: ANSI escape sequence detection.\n    underline: /\\x1b\\[4m/.test(text),\n  } as TextStyles\n}\n\n/**\n * Build ANSI code string from text styles.\n * Returns the concatenated ANSI codes needed to apply the styles.\n */\nfunction stylesToAnsi(styles: TextStyles): string {\n  let codes = ''\n  if (styles.bold) {\n    codes += '\\x1b[1m'\n  }\n  if (styles.dim) {\n    codes += '\\x1b[2m'\n  }\n  if (styles.italic) {\n    codes += '\\x1b[3m'\n  }\n  if (styles.underline) {\n    codes += '\\x1b[4m'\n  }\n  if (styles.strikethrough) {\n    codes += '\\x1b[9m'\n  }\n  return codes\n}\n\n// Internal options for applyShimmer function.\ntype ShimmerOptions = {\n  readonly color?: ShimmerColorRgb | ShimmerColorGradient | undefined\n  readonly direction?: ShimmerDirection | undefined\n  readonly shimmerWidth?: number | undefined\n  readonly styles?: TextStyles | undefined\n}\n\nexport const COLOR_INHERIT = 'inherit'\n\nexport const DIR_LTR = 'ltr'\n\nexport const DIR_NONE = 'none'\n\nexport const DIR_RANDOM = 'random'\n\nexport const DIR_RTL = 'rtl'\n\nexport const MODE_BI = 'bi'\n\n/**\n * Calculate shimmer intensity based on distance from shimmer wave position.\n * Uses a power curve for smooth falloff - characters close to the wave\n * get high intensity (bright white), while distant characters get 0.\n */\nfunction shimmerIntensity(\n  distance: number,\n  shimmerWidth: number = 2.5,\n): number {\n  // Characters beyond shimmer width get no effect.\n  if (distance > shimmerWidth) {\n    return 0\n  }\n  // Smooth falloff using power curve.\n  const normalized = distance / shimmerWidth\n  return (1 - normalized) ** 2.5\n}\n\n/**\n * Blend two RGB colors based on a blend factor (0-1).\n * factor 0 = color1, factor 1 = color2, factor 0.5 = 50/50 blend.\n */\nfunction blendColors(\n  color1: readonly [number, number, number],\n  color2: readonly [number, number, number],\n  factor: number,\n): readonly [number, number, number] {\n  const r = Math.round(color1[0] + (color2[0] - color1[0]) * factor)\n  const g = Math.round(color1[1] + (color2[1] - color1[1]) * factor)\n  const b = Math.round(color1[2] + (color2[2] - color1[2]) * factor)\n  return [r, g, b] as const\n}\n\n/**\n * Render character with shimmer effect based on distance from shimmer position.\n * Characters closer to the shimmer position get brighter (nearly white),\n * while characters further away use the base color.\n * Creates a smooth gradient by blending base color with white based on intensity.\n * Supports both single color and per-character color gradients.\n */\nfunction renderChar(\n  char: string,\n  index: number,\n  shimmerPos: number,\n  baseColor: readonly [number, number, number] | ShimmerColorGradient,\n  styles: TextStyles,\n): string {\n  // Calculate how far this character is from the shimmer wave.\n  const distance = Math.abs(index - shimmerPos)\n  const intensity = shimmerIntensity(distance)\n\n  const styleCode = stylesToAnsi(styles)\n\n  // Get base color for this character (single or per-character from gradient).\n  const charColor: readonly [number, number, number] = isArray(baseColor[0])\n    ? ((baseColor as ShimmerColorGradient)[index % baseColor.length] ?? [\n        140, 82, 255,\n      ])\n    : (baseColor as readonly [number, number, number])\n\n  // If no shimmer intensity, use base color as-is.\n  if (intensity === 0) {\n    const base = `\\x1b[38;2;${charColor[0]};${charColor[1]};${charColor[2]}m`\n    return `${styleCode}${base}${char}${ANSI_RESET}`\n  }\n\n  // Blend base color with white based on intensity to create smooth gradient.\n  // Higher intensity = more white, creating the shimmer wave effect.\n  const white: readonly [number, number, number] = [255, 255, 255] as const\n  const blended = blendColors(charColor, white, intensity)\n\n  const color = `\\x1b[38;2;${blended[0]};${blended[1]};${blended[2]}m`\n  return `${styleCode}${color}${char}${ANSI_RESET}`\n}\n\n/**\n * Calculate shimmer wave position for current animation step.\n * The shimmer wave moves across the text length, with extra space\n * for the wave to fade in/out at the edges.\n */\nfunction getShimmerPos(\n  textLength: number,\n  step: number,\n  currentDir: 'ltr' | 'rtl',\n  shimmerWidth: number = 2.5,\n): number {\n  // Total steps for one complete cycle (text length + fade in/out space).\n  const totalSteps = textLength + shimmerWidth + 2\n\n  // RTL: Shimmer moves from right to left.\n  if (currentDir === DIR_RTL) {\n    return textLength - (step % totalSteps)\n  }\n\n  // LTR: Shimmer moves from left to right.\n  return step % totalSteps\n}\n\n/**\n * Resolve shimmer direction to a concrete 'ltr' or 'rtl' value.\n * Used for initializing shimmer state and picking random directions.\n */\nfunction pickDirection(direction: ShimmerDirection): 'ltr' | 'rtl' {\n  // Random mode: 50/50 chance of LTR or RTL.\n  if (direction === DIR_RANDOM) {\n    return Math.random() < 0.5 ? DIR_LTR : DIR_RTL\n  }\n  // RTL mode: Use RTL direction.\n  if (direction === DIR_RTL) {\n    return DIR_RTL\n  }\n  // LTR mode (or any other): Default to LTR.\n  return DIR_LTR\n}\n\n/**\n * Apply shimmer animation effect to text.\n * This is the main entry point for shimmer animations. It:\n * 1. Strips ANSI codes to get plain text for character positioning\n * 2. Detects any styling (bold, italic, underline, etc.) to preserve\n * 3. Calculates the current shimmer wave position based on animation step\n * 4. Renders each character with appropriate brightness based on distance from wave\n * 5. Updates the animation state for the next frame\n * 6. Handles direction changes for bidirectional and random modes\n */\nexport function applyShimmer(\n  text: string,\n  state: ShimmerState,\n  options?: ShimmerOptions | undefined,\n): string {\n  const opts = { __proto__: null, ...options } as ShimmerOptions\n  const direction = opts.direction ?? DIR_NONE\n  const shimmerWidth = opts.shimmerWidth ?? 2.5\n  // Socket purple.\n  const color = opts.color ?? ([140, 82, 255] as const)\n\n  // Detect text formatting styles from original text.\n  const styles = opts.styles ?? detectStyles(text)\n\n  // Strip ANSI codes to get plain text.\n  const plainText = stripAnsi(text)\n\n  // No shimmer effect in CI or when direction is 'none'.\n  if (CI || !plainText || direction === DIR_NONE) {\n    const styleCode = stylesToAnsi(styles)\n\n    // Support gradient colors (array of colors, one per character).\n    const isGradient = isArray(color[0])\n\n    return plainText\n      .split('')\n      .map((char, i) => {\n        const charColor: readonly [number, number, number] = isGradient\n          ? ((color as ShimmerColorGradient)[i % color.length] ?? [\n              140, 82, 255,\n            ])\n          : (color as readonly [number, number, number])\n        const base = `\\x1b[38;2;${charColor[0]};${charColor[1]};${charColor[2]}m`\n        return `${styleCode}${base}${char}${ANSI_RESET}`\n      })\n      .join('')\n  }\n\n  // Calculate shimmer position.\n  const shimmerPos = getShimmerPos(\n    plainText.length,\n    state.step,\n    state.currentDir,\n    shimmerWidth,\n  )\n\n  // Render text with shimmer.\n  const result = plainText\n    .split('')\n    .map((char, i) => renderChar(char, i, shimmerPos, color, styles))\n    .join('')\n\n  // Advance shimmer position by speed amount each frame.\n  // Speed represents steps per frame (e.g., 0.33 = advance 0.33 steps per frame).\n  // This creates smooth animation by moving in small increments every frame\n  // instead of jumping larger distances every N frames.\n  state.step += state.speed\n\n  // Handle bidirectional direction changes.\n  const totalSteps = plainText.length + shimmerWidth + 2\n  if (state.mode === MODE_BI) {\n    if (state.step >= totalSteps) {\n      state.step = 0\n      // Toggle direction every cycle.\n      state.currentDir = state.currentDir === DIR_LTR ? DIR_RTL : DIR_LTR\n    }\n  } else if (state.mode === DIR_RANDOM) {\n    // Change direction randomly at end of each cycle.\n    if (state.step >= totalSteps) {\n      state.step = 0\n      state.currentDir = pickDirection(DIR_RANDOM)\n    }\n  } else {\n    // Reset for continuous loops.\n    if (state.step >= totalSteps) {\n      state.step = 0\n    }\n  }\n\n  return result\n}\n"],
-  "mappings": ";4ZAAA,IAAAA,EAAA,GAAAC,EAAAD,EAAA,mBAAAE,EAAA,YAAAC,EAAA,aAAAC,EAAA,eAAAC,EAAA,YAAAC,EAAA,YAAAC,EAAA,iBAAAC,IAAA,eAAAC,EAAAT,GAcA,IAAAU,EAAsC,mBACtCC,EAAwB,qBACxBC,EAAmB,mBAmCnB,SAASC,EAAaC,EAA0B,CAC9C,MAAO,CACL,UAAW,KAEX,KAAM,WAAW,KAAKA,CAAI,EAE1B,IAAK,WAAW,KAAKA,CAAI,EAEzB,OAAQ,WAAW,KAAKA,CAAI,EAE5B,cAAe,WAAW,KAAKA,CAAI,EAEnC,UAAW,WAAW,KAAKA,CAAI,CACjC,CACF,CAMA,SAASC,EAAaC,EAA4B,CAChD,IAAIC,EAAQ,GACZ,OAAID,EAAO,OACTC,GAAS,WAEPD,EAAO,MACTC,GAAS,WAEPD,EAAO,SACTC,GAAS,WAEPD,EAAO,YACTC,GAAS,WAEPD,EAAO,gBACTC,GAAS,WAEJA,CACT,CAUO,MAAMf,EAAgB,UAEhBC,EAAU,MAEVC,EAAW,OAEXC,EAAa,SAEbC,EAAU,MAEVC,EAAU,KAOvB,SAASW,EACPC,EACAC,EAAuB,IACf,CAER,OAAID,EAAWC,EACN,GAID,EADWD,EAAWC,IACH,GAC7B,CAMA,SAASC,EACPC,EACAC,EACAC,EACmC,CACnC,MAAMC,EAAI,KAAK,MAAMH,EAAO,CAAC,GAAKC,EAAO,CAAC,EAAID,EAAO,CAAC,GAAKE,CAAM,EAC3DE,EAAI,KAAK,MAAMJ,EAAO,CAAC,GAAKC,EAAO,CAAC,EAAID,EAAO,CAAC,GAAKE,CAAM,EAC3DG,EAAI,KAAK,MAAML,EAAO,CAAC,GAAKC,EAAO,CAAC,EAAID,EAAO,CAAC,GAAKE,CAAM,EACjE,MAAO,CAACC,EAAGC,EAAGC,CAAC,CACjB,CASA,SAASC,EACPC,EACAC,EACAC,EACAC,EACAhB,EACQ,CAER,MAAMG,EAAW,KAAK,IAAIW,EAAQC,CAAU,EACtCE,EAAYf,EAAiBC,CAAQ,EAErCe,EAAYnB,EAAaC,CAAM,EAG/BmB,KAA+C,WAAQH,EAAU,CAAC,CAAC,EACnEA,EAAmCF,EAAQE,EAAU,MAAM,GAAK,CAChE,IAAK,GAAI,GACX,EACCA,EAGL,GAAIC,IAAc,EAAG,CACnB,MAAMG,EAAO,aAAaD,EAAU,CAAC,CAAC,IAAIA,EAAU,CAAC,CAAC,IAAIA,EAAU,CAAC,CAAC,IACtE,MAAO,GAAGD,CAAS,GAAGE,CAAI,GAAGP,CAAI,GAAG,YAAU,EAChD,CAKA,MAAMQ,EAAUhB,EAAYc,EADqB,CAAC,IAAK,IAAK,GAAG,EACjBF,CAAS,EAEjDK,EAAQ,aAAaD,EAAQ,CAAC,CAAC,IAAIA,EAAQ,CAAC,CAAC,IAAIA,EAAQ,CAAC,CAAC,IACjE,MAAO,GAAGH,CAAS,GAAGI,CAAK,GAAGT,CAAI,GAAG,YAAU,EACjD,CAOA,SAASU,EACPC,EACAC,EACAC,EACAtB,EAAuB,IACf,CAER,MAAMuB,EAAaH,EAAapB,EAAe,EAG/C,OAAIsB,IAAepC,EACVkC,EAAcC,EAAOE,EAIvBF,EAAOE,CAChB,CAMA,SAASC,EAAcC,EAA4C,CAEjE,OAAIA,IAAcxC,EACT,KAAK,OAAO,EAAI,GAAMF,EAAUG,EAGrCuC,IAAcvC,EACTA,EAGFH,CACT,CAYO,SAASK,EACdM,EACAgC,EACAC,EACQ,CACR,MAAMC,EAAO,CAAE,UAAW,KAAM,GAAGD,CAAQ,EACrCF,EAAYG,EAAK,WAAa5C,EAC9BgB,EAAe4B,EAAK,cAAgB,IAEpCV,EAAQU,EAAK,OAAU,CAAC,IAAK,GAAI,GAAG,EAGpChC,EAASgC,EAAK,QAAUnC,EAAaC,CAAI,EAGzCmC,KAAY,aAAUnC,CAAI,EAGhC,GAAI,MAAM,CAACmC,GAAaJ,IAAczC,EAAU,CAC9C,MAAM8B,EAAYnB,EAAaC,CAAM,EAG/BkC,KAAa,WAAQZ,EAAM,CAAC,CAAC,EAEnC,OAAOW,EACJ,MAAM,EAAE,EACR,IAAI,CAACpB,EAAMsB,IAAM,CAChB,MAAMhB,EAA+Ce,EAC/CZ,EAA+Ba,EAAIb,EAAM,MAAM,GAAK,CACpD,IAAK,GAAI,GACX,EACCA,EACCF,EAAO,aAAaD,EAAU,CAAC,CAAC,IAAIA,EAAU,CAAC,CAAC,IAAIA,EAAU,CAAC,CAAC,IACtE,MAAO,GAAGD,CAAS,GAAGE,CAAI,GAAGP,CAAI,GAAG,YAAU,EAChD,CAAC,EACA,KAAK,EAAE,CACZ,CAGA,MAAME,EAAaQ,EACjBU,EAAU,OACVH,EAAM,KACNA,EAAM,WACN1B,CACF,EAGMgC,EAASH,EACZ,MAAM,EAAE,EACR,IAAI,CAACpB,EAAMsB,IAAMvB,EAAWC,EAAMsB,EAAGpB,EAAYO,EAAOtB,CAAM,CAAC,EAC/D,KAAK,EAAE,EAMV8B,EAAM,MAAQA,EAAM,MAGpB,MAAMH,EAAaM,EAAU,OAAS7B,EAAe,EACrD,OAAI0B,EAAM,OAASvC,EACbuC,EAAM,MAAQH,IAChBG,EAAM,KAAO,EAEbA,EAAM,WAAaA,EAAM,aAAe3C,EAAUG,EAAUH,GAErD2C,EAAM,OAASzC,EAEpByC,EAAM,MAAQH,IAChBG,EAAM,KAAO,EACbA,EAAM,WAAaF,EAAcvC,CAAU,GAIzCyC,EAAM,MAAQH,IAChBG,EAAM,KAAO,GAIVM,CACT",
+  "sourcesContent": ["/**\n * @fileoverview Text shimmer animation utilities.\n * Provides animated highlight effects for spinner text with configurable directions:\n * - LTR (left-to-right): Shimmer wave moves from left to right\n * - RTL (right-to-left): Shimmer wave moves from right to left\n * - Bidirectional: Alternates between LTR and RTL each cycle\n * - Random: Picks a random direction each cycle\n * - None: No shimmer animation\n *\n * The shimmer effect creates a bright wave that travels across the text,\n * with characters near the wave appearing nearly white and fading to the\n * base color as they get further from the wave position.\n */\n\nimport { ANSI_RESET, stripAnsi } from '../ansi'\nimport { isArray } from '../arrays'\nimport { getCI } from '#env/ci'\n\nimport type {\n  ShimmerColorGradient,\n  ShimmerColorRgb,\n  ShimmerDirection,\n  ShimmerState,\n} from './types'\n\n// Re-export types for backward compatibility.\nexport type {\n  ShimmerColor,\n  ShimmerColorGradient,\n  ShimmerColorInherit,\n  ShimmerColorRgb,\n  ShimmerConfig,\n  ShimmerDirection,\n  ShimmerState,\n} from './types'\n\n/**\n * Detected text formatting styles from ANSI codes.\n */\ntype TextStyles = {\n  bold: boolean\n  dim: boolean\n  italic: boolean\n  strikethrough: boolean\n  underline: boolean\n}\n\n/**\n * Detect all text formatting styles present in ANSI-coded text.\n * Checks for bold, dim, italic, underline, and strikethrough.\n */\nfunction detectStyles(text: string): TextStyles {\n  return {\n    __proto__: null,\n    // biome-ignore lint/suspicious/noControlCharactersInRegex: ANSI escape sequence detection.\n    bold: /\\x1b\\[1m/.test(text),\n    // biome-ignore lint/suspicious/noControlCharactersInRegex: ANSI escape sequence detection.\n    dim: /\\x1b\\[2m/.test(text),\n    // biome-ignore lint/suspicious/noControlCharactersInRegex: ANSI escape sequence detection.\n    italic: /\\x1b\\[3m/.test(text),\n    // biome-ignore lint/suspicious/noControlCharactersInRegex: ANSI escape sequence detection.\n    strikethrough: /\\x1b\\[9m/.test(text),\n    // biome-ignore lint/suspicious/noControlCharactersInRegex: ANSI escape sequence detection.\n    underline: /\\x1b\\[4m/.test(text),\n  } as TextStyles\n}\n\n/**\n * Build ANSI code string from text styles.\n * Returns the concatenated ANSI codes needed to apply the styles.\n */\nfunction stylesToAnsi(styles: TextStyles): string {\n  let codes = ''\n  if (styles.bold) {\n    codes += '\\x1b[1m'\n  }\n  if (styles.dim) {\n    codes += '\\x1b[2m'\n  }\n  if (styles.italic) {\n    codes += '\\x1b[3m'\n  }\n  if (styles.underline) {\n    codes += '\\x1b[4m'\n  }\n  if (styles.strikethrough) {\n    codes += '\\x1b[9m'\n  }\n  return codes\n}\n\n// Internal options for applyShimmer function.\ntype ShimmerOptions = {\n  readonly color?: ShimmerColorRgb | ShimmerColorGradient | undefined\n  readonly direction?: ShimmerDirection | undefined\n  readonly shimmerWidth?: number | undefined\n  readonly styles?: TextStyles | undefined\n}\n\nexport const COLOR_INHERIT = 'inherit'\n\nexport const DIR_LTR = 'ltr'\n\nexport const DIR_NONE = 'none'\n\nexport const DIR_RANDOM = 'random'\n\nexport const DIR_RTL = 'rtl'\n\nexport const MODE_BI = 'bi'\n\n/**\n * Calculate shimmer intensity based on distance from shimmer wave position.\n * Uses a power curve for smooth falloff - characters close to the wave\n * get high intensity (bright white), while distant characters get 0.\n */\nfunction shimmerIntensity(\n  distance: number,\n  shimmerWidth: number = 2.5,\n): number {\n  // Characters beyond shimmer width get no effect.\n  if (distance > shimmerWidth) {\n    return 0\n  }\n  // Smooth falloff using power curve.\n  const normalized = distance / shimmerWidth\n  return (1 - normalized) ** 2.5\n}\n\n/**\n * Blend two RGB colors based on a blend factor (0-1).\n * factor 0 = color1, factor 1 = color2, factor 0.5 = 50/50 blend.\n */\nfunction blendColors(\n  color1: readonly [number, number, number],\n  color2: readonly [number, number, number],\n  factor: number,\n): readonly [number, number, number] {\n  const r = Math.round(color1[0] + (color2[0] - color1[0]) * factor)\n  const g = Math.round(color1[1] + (color2[1] - color1[1]) * factor)\n  const b = Math.round(color1[2] + (color2[2] - color1[2]) * factor)\n  return [r, g, b] as const\n}\n\n/**\n * Render character with shimmer effect based on distance from shimmer position.\n * Characters closer to the shimmer position get brighter (nearly white),\n * while characters further away use the base color.\n * Creates a smooth gradient by blending base color with white based on intensity.\n * Supports both single color and per-character color gradients.\n */\nfunction renderChar(\n  char: string,\n  index: number,\n  shimmerPos: number,\n  baseColor: readonly [number, number, number] | ShimmerColorGradient,\n  styles: TextStyles,\n): string {\n  // Calculate how far this character is from the shimmer wave.\n  const distance = Math.abs(index - shimmerPos)\n  const intensity = shimmerIntensity(distance)\n\n  const styleCode = stylesToAnsi(styles)\n\n  // Get base color for this character (single or per-character from gradient).\n  const charColor: readonly [number, number, number] = isArray(baseColor[0])\n    ? ((baseColor as ShimmerColorGradient)[index % baseColor.length] ?? [\n        140, 82, 255,\n      ])\n    : (baseColor as readonly [number, number, number])\n\n  // If no shimmer intensity, use base color as-is.\n  if (intensity === 0) {\n    const base = `\\x1b[38;2;${charColor[0]};${charColor[1]};${charColor[2]}m`\n    return `${styleCode}${base}${char}${ANSI_RESET}`\n  }\n\n  // Blend base color with white based on intensity to create smooth gradient.\n  // Higher intensity = more white, creating the shimmer wave effect.\n  const white: readonly [number, number, number] = [255, 255, 255] as const\n  const blended = blendColors(charColor, white, intensity)\n\n  const color = `\\x1b[38;2;${blended[0]};${blended[1]};${blended[2]}m`\n  return `${styleCode}${color}${char}${ANSI_RESET}`\n}\n\n/**\n * Calculate shimmer wave position for current animation step.\n * The shimmer wave moves across the text length, with extra space\n * for the wave to fade in/out at the edges.\n */\nfunction getShimmerPos(\n  textLength: number,\n  step: number,\n  currentDir: 'ltr' | 'rtl',\n  shimmerWidth: number = 2.5,\n): number {\n  // Total steps for one complete cycle (text length + fade in/out space).\n  const totalSteps = textLength + shimmerWidth + 2\n\n  // RTL: Shimmer moves from right to left.\n  if (currentDir === DIR_RTL) {\n    return textLength - (step % totalSteps)\n  }\n\n  // LTR: Shimmer moves from left to right.\n  return step % totalSteps\n}\n\n/**\n * Resolve shimmer direction to a concrete 'ltr' or 'rtl' value.\n * Used for initializing shimmer state and picking random directions.\n */\nfunction pickDirection(direction: ShimmerDirection): 'ltr' | 'rtl' {\n  // Random mode: 50/50 chance of LTR or RTL.\n  if (direction === DIR_RANDOM) {\n    return Math.random() < 0.5 ? DIR_LTR : DIR_RTL\n  }\n  // RTL mode: Use RTL direction.\n  if (direction === DIR_RTL) {\n    return DIR_RTL\n  }\n  // LTR mode (or any other): Default to LTR.\n  return DIR_LTR\n}\n\n/**\n * Apply shimmer animation effect to text.\n * This is the main entry point for shimmer animations. It:\n * 1. Strips ANSI codes to get plain text for character positioning\n * 2. Detects any styling (bold, italic, underline, etc.) to preserve\n * 3. Calculates the current shimmer wave position based on animation step\n * 4. Renders each character with appropriate brightness based on distance from wave\n * 5. Updates the animation state for the next frame\n * 6. Handles direction changes for bidirectional and random modes\n */\nexport function applyShimmer(\n  text: string,\n  state: ShimmerState,\n  options?: ShimmerOptions | undefined,\n): string {\n  const opts = { __proto__: null, ...options } as ShimmerOptions\n  const direction = opts.direction ?? DIR_NONE\n  const shimmerWidth = opts.shimmerWidth ?? 2.5\n  // Socket purple.\n  const color = opts.color ?? ([140, 82, 255] as const)\n\n  // Detect text formatting styles from original text.\n  const styles = opts.styles ?? detectStyles(text)\n\n  // Strip ANSI codes to get plain text.\n  const plainText = stripAnsi(text)\n\n  // No shimmer effect in CI or when direction is 'none'.\n  if (getCI() || !plainText || direction === DIR_NONE) {\n    const styleCode = stylesToAnsi(styles)\n\n    // Support gradient colors (array of colors, one per character).\n    const isGradient = isArray(color[0])\n\n    return plainText\n      .split('')\n      .map((char, i) => {\n        const charColor: readonly [number, number, number] = isGradient\n          ? ((color as ShimmerColorGradient)[i % color.length] ?? [\n              140, 82, 255,\n            ])\n          : (color as readonly [number, number, number])\n        const base = `\\x1b[38;2;${charColor[0]};${charColor[1]};${charColor[2]}m`\n        return `${styleCode}${base}${char}${ANSI_RESET}`\n      })\n      .join('')\n  }\n\n  // Calculate shimmer position.\n  const shimmerPos = getShimmerPos(\n    plainText.length,\n    state.step,\n    state.currentDir,\n    shimmerWidth,\n  )\n\n  // Render text with shimmer.\n  const result = plainText\n    .split('')\n    .map((char, i) => renderChar(char, i, shimmerPos, color, styles))\n    .join('')\n\n  // Advance shimmer position by speed amount each frame.\n  // Speed represents steps per frame (e.g., 0.33 = advance 0.33 steps per frame).\n  // This creates smooth animation by moving in small increments every frame\n  // instead of jumping larger distances every N frames.\n  state.step += state.speed\n\n  // Handle bidirectional direction changes.\n  const totalSteps = plainText.length + shimmerWidth + 2\n  if (state.mode === MODE_BI) {\n    if (state.step >= totalSteps) {\n      state.step = 0\n      // Toggle direction every cycle.\n      state.currentDir = state.currentDir === DIR_LTR ? DIR_RTL : DIR_LTR\n    }\n  } else if (state.mode === DIR_RANDOM) {\n    // Change direction randomly at end of each cycle.\n    if (state.step >= totalSteps) {\n      state.step = 0\n      state.currentDir = pickDirection(DIR_RANDOM)\n    }\n  } else {\n    // Reset for continuous loops.\n    if (state.step >= totalSteps) {\n      state.step = 0\n    }\n  }\n\n  return result\n}\n"],
+  "mappings": ";4ZAAA,IAAAA,EAAA,GAAAC,EAAAD,EAAA,mBAAAE,EAAA,YAAAC,EAAA,aAAAC,EAAA,eAAAC,EAAA,YAAAC,EAAA,YAAAC,EAAA,iBAAAC,IAAA,eAAAC,EAAAT,GAcA,IAAAU,EAAsC,mBACtCC,EAAwB,qBACxBC,EAAsB,mBAmCtB,SAASC,EAAaC,EAA0B,CAC9C,MAAO,CACL,UAAW,KAEX,KAAM,WAAW,KAAKA,CAAI,EAE1B,IAAK,WAAW,KAAKA,CAAI,EAEzB,OAAQ,WAAW,KAAKA,CAAI,EAE5B,cAAe,WAAW,KAAKA,CAAI,EAEnC,UAAW,WAAW,KAAKA,CAAI,CACjC,CACF,CAMA,SAASC,EAAaC,EAA4B,CAChD,IAAIC,EAAQ,GACZ,OAAID,EAAO,OACTC,GAAS,WAEPD,EAAO,MACTC,GAAS,WAEPD,EAAO,SACTC,GAAS,WAEPD,EAAO,YACTC,GAAS,WAEPD,EAAO,gBACTC,GAAS,WAEJA,CACT,CAUO,MAAMf,EAAgB,UAEhBC,EAAU,MAEVC,EAAW,OAEXC,EAAa,SAEbC,EAAU,MAEVC,EAAU,KAOvB,SAASW,EACPC,EACAC,EAAuB,IACf,CAER,OAAID,EAAWC,EACN,GAID,EADWD,EAAWC,IACH,GAC7B,CAMA,SAASC,EACPC,EACAC,EACAC,EACmC,CACnC,MAAMC,EAAI,KAAK,MAAMH,EAAO,CAAC,GAAKC,EAAO,CAAC,EAAID,EAAO,CAAC,GAAKE,CAAM,EAC3DE,EAAI,KAAK,MAAMJ,EAAO,CAAC,GAAKC,EAAO,CAAC,EAAID,EAAO,CAAC,GAAKE,CAAM,EAC3DG,EAAI,KAAK,MAAML,EAAO,CAAC,GAAKC,EAAO,CAAC,EAAID,EAAO,CAAC,GAAKE,CAAM,EACjE,MAAO,CAACC,EAAGC,EAAGC,CAAC,CACjB,CASA,SAASC,EACPC,EACAC,EACAC,EACAC,EACAhB,EACQ,CAER,MAAMG,EAAW,KAAK,IAAIW,EAAQC,CAAU,EACtCE,EAAYf,EAAiBC,CAAQ,EAErCe,EAAYnB,EAAaC,CAAM,EAG/BmB,KAA+C,WAAQH,EAAU,CAAC,CAAC,EACnEA,EAAmCF,EAAQE,EAAU,MAAM,GAAK,CAChE,IAAK,GAAI,GACX,EACCA,EAGL,GAAIC,IAAc,EAAG,CACnB,MAAMG,EAAO,aAAaD,EAAU,CAAC,CAAC,IAAIA,EAAU,CAAC,CAAC,IAAIA,EAAU,CAAC,CAAC,IACtE,MAAO,GAAGD,CAAS,GAAGE,CAAI,GAAGP,CAAI,GAAG,YAAU,EAChD,CAKA,MAAMQ,EAAUhB,EAAYc,EADqB,CAAC,IAAK,IAAK,GAAG,EACjBF,CAAS,EAEjDK,EAAQ,aAAaD,EAAQ,CAAC,CAAC,IAAIA,EAAQ,CAAC,CAAC,IAAIA,EAAQ,CAAC,CAAC,IACjE,MAAO,GAAGH,CAAS,GAAGI,CAAK,GAAGT,CAAI,GAAG,YAAU,EACjD,CAOA,SAASU,EACPC,EACAC,EACAC,EACAtB,EAAuB,IACf,CAER,MAAMuB,EAAaH,EAAapB,EAAe,EAG/C,OAAIsB,IAAepC,EACVkC,EAAcC,EAAOE,EAIvBF,EAAOE,CAChB,CAMA,SAASC,EAAcC,EAA4C,CAEjE,OAAIA,IAAcxC,EACT,KAAK,OAAO,EAAI,GAAMF,EAAUG,EAGrCuC,IAAcvC,EACTA,EAGFH,CACT,CAYO,SAASK,EACdM,EACAgC,EACAC,EACQ,CACR,MAAMC,EAAO,CAAE,UAAW,KAAM,GAAGD,CAAQ,EACrCF,EAAYG,EAAK,WAAa5C,EAC9BgB,EAAe4B,EAAK,cAAgB,IAEpCV,EAAQU,EAAK,OAAU,CAAC,IAAK,GAAI,GAAG,EAGpChC,EAASgC,EAAK,QAAUnC,EAAaC,CAAI,EAGzCmC,KAAY,aAAUnC,CAAI,EAGhC,MAAI,SAAM,GAAK,CAACmC,GAAaJ,IAAczC,EAAU,CACnD,MAAM8B,EAAYnB,EAAaC,CAAM,EAG/BkC,KAAa,WAAQZ,EAAM,CAAC,CAAC,EAEnC,OAAOW,EACJ,MAAM,EAAE,EACR,IAAI,CAACpB,EAAMsB,IAAM,CAChB,MAAMhB,EAA+Ce,EAC/CZ,EAA+Ba,EAAIb,EAAM,MAAM,GAAK,CACpD,IAAK,GAAI,GACX,EACCA,EACCF,EAAO,aAAaD,EAAU,CAAC,CAAC,IAAIA,EAAU,CAAC,CAAC,IAAIA,EAAU,CAAC,CAAC,IACtE,MAAO,GAAGD,CAAS,GAAGE,CAAI,GAAGP,CAAI,GAAG,YAAU,EAChD,CAAC,EACA,KAAK,EAAE,CACZ,CAGA,MAAME,EAAaQ,EACjBU,EAAU,OACVH,EAAM,KACNA,EAAM,WACN1B,CACF,EAGMgC,EAASH,EACZ,MAAM,EAAE,EACR,IAAI,CAACpB,EAAMsB,IAAMvB,EAAWC,EAAMsB,EAAGpB,EAAYO,EAAOtB,CAAM,CAAC,EAC/D,KAAK,EAAE,EAMV8B,EAAM,MAAQA,EAAM,MAGpB,MAAMH,EAAaM,EAAU,OAAS7B,EAAe,EACrD,OAAI0B,EAAM,OAASvC,EACbuC,EAAM,MAAQH,IAChBG,EAAM,KAAO,EAEbA,EAAM,WAAaA,EAAM,aAAe3C,EAAUG,EAAUH,GAErD2C,EAAM,OAASzC,EAEpByC,EAAM,MAAQH,IAChBG,EAAM,KAAO,EACbA,EAAM,WAAaF,EAAcvC,CAAU,GAIzCyC,EAAM,MAAQH,IAChBG,EAAM,KAAO,GAIVM,CACT",
   "names": ["text_shimmer_exports", "__export", "COLOR_INHERIT", "DIR_LTR", "DIR_NONE", "DIR_RANDOM", "DIR_RTL", "MODE_BI", "applyShimmer", "__toCommonJS", "import_ansi", "import_arrays", "import_ci", "detectStyles", "text", "stylesToAnsi", "styles", "codes", "shimmerIntensity", "distance", "shimmerWidth", "blendColors", "color1", "color2", "factor", "r", "g", "b", "renderChar", "char", "index", "shimmerPos", "baseColor", "intensity", "styleCode", "charColor", "base", "blended", "color", "getShimmerPos", "textLength", "step", "currentDir", "totalSteps", "pickDirection", "direction", "state", "options", "opts", "plainText", "isGradient", "i", "result"]
 }

package/dist/env/ci.d.ts

@@ -1 +1 @@
-export declare const CI: boolean;
+export declare function getCI(): boolean;

package/dist/env/ci.js

@@ -1,3 +1,3 @@
 /* Socket Lib - Built with esbuild */
-var n=Object.defineProperty;var i=Object.getOwnPropertyDescriptor;var s=Object.getOwnPropertyNames;var v=Object.prototype.hasOwnProperty;var C=(r,o)=>{for(var m in o)n(r,m,{get:o[m],enumerable:!0})},I=(r,o,m,t)=>{if(o&&typeof o=="object"||typeof o=="function")for(let e of s(o))!v.call(r,e)&&e!==m&&n(r,e,{get:()=>o[e],enumerable:!(t=i(o,e))||t.enumerable});return r};var a=r=>I(n({},"__esModule",{value:!0}),r);var l={};C(l,{CI:()=>c});module.exports=a(l);var p=require("node:process"),f=require("#env/helpers");const c=(0,f.envAsBoolean)(p.env.CI);0&&(module.exports={CI});
+var t=Object.defineProperty;var i=Object.getOwnPropertyDescriptor;var l=Object.getOwnPropertyNames;var p=Object.prototype.hasOwnProperty;var u=(e,o)=>{for(var r in o)t(e,r,{get:o[r],enumerable:!0})},g=(e,o,r,m)=>{if(o&&typeof o=="object"||typeof o=="function")for(let n of l(o))!p.call(e,n)&&n!==r&&t(e,n,{get:()=>o[n],enumerable:!(m=i(o,n))||m.enumerable});return e};var v=e=>g(t({},"__esModule",{value:!0}),e);var I={};u(I,{getCI:()=>C});module.exports=v(I);var a=require("#env/helpers"),f=require("#env/rewire");function C(){return(0,a.envAsBoolean)((0,f.getEnvValue)("CI"))}0&&(module.exports={getCI});
 //# sourceMappingURL=ci.js.map

package/dist/env/ci.js.map

@@ -1,7 +1,7 @@
 {
   "version": 3,
   "sources": ["../../src/env/ci.ts"],
-  "sourcesContent": ["/**\n * CI environment variable snapshot.\n * Determines if code is running in a Continuous Integration environment.\n */\n\nimport { env } from 'node:process'\n\nimport { envAsBoolean } from '#env/helpers'\n\nexport const CI = envAsBoolean(env['CI'])\n"],
-  "mappings": ";4ZAAA,IAAAA,EAAA,GAAAC,EAAAD,EAAA,QAAAE,IAAA,eAAAC,EAAAH,GAKA,IAAAI,EAAoB,wBAEpBC,EAA6B,wBAEtB,MAAMH,KAAK,gBAAa,MAAI,EAAK",
-  "names": ["ci_exports", "__export", "CI", "__toCommonJS", "import_node_process", "import_helpers"]
+  "sourcesContent": ["/**\n * CI environment variable getter.\n * Determines if code is running in a Continuous Integration environment.\n */\n\nimport { envAsBoolean } from '#env/helpers'\nimport { getEnvValue } from '#env/rewire'\n\nexport function getCI(): boolean {\n  return envAsBoolean(getEnvValue('CI'))\n}\n"],
+  "mappings": ";4ZAAA,IAAAA,EAAA,GAAAC,EAAAD,EAAA,WAAAE,IAAA,eAAAC,EAAAH,GAKA,IAAAI,EAA6B,wBAC7BC,EAA4B,uBAErB,SAASH,GAAiB,CAC/B,SAAO,mBAAa,eAAY,IAAI,CAAC,CACvC",
+  "names": ["ci_exports", "__export", "getCI", "__toCommonJS", "import_helpers", "import_rewire"]
 }

package/dist/env/debug.d.ts

@@ -1 +1 @@
-export declare const DEBUG: string;
+export declare function getDebug(): string | undefined;

package/dist/env/debug.js

@@ -1,3 +1,3 @@
 /* Socket Lib - Built with esbuild */
-var m=Object.defineProperty;var B=Object.getOwnPropertyDescriptor;var D=Object.getOwnPropertyNames;var E=Object.prototype.hasOwnProperty;var G=(r,o)=>{for(var e in o)m(r,e,{get:o[e],enumerable:!0})},U=(r,o,e,n)=>{if(o&&typeof o=="object"||typeof o=="function")for(let t of D(o))!E.call(r,t)&&t!==e&&m(r,t,{get:()=>o[t],enumerable:!(n=B(o,t))||n.enumerable});return r};var c=r=>U(m({},"__esModule",{value:!0}),r);var i={};G(i,{DEBUG:()=>f});module.exports=c(i);var p=require("node:process");const f=p.env.DEBUG;0&&(module.exports={DEBUG});
+var u=Object.defineProperty;var o=Object.getOwnPropertyDescriptor;var f=Object.getOwnPropertyNames;var d=Object.prototype.hasOwnProperty;var m=(n,e)=>{for(var r in e)u(n,r,{get:e[r],enumerable:!0})},p=(n,e,r,g)=>{if(e&&typeof e=="object"||typeof e=="function")for(let t of f(e))!d.call(n,t)&&t!==r&&u(n,t,{get:()=>e[t],enumerable:!(g=o(e,t))||g.enumerable});return n};var D=n=>p(u({},"__esModule",{value:!0}),n);var a={};m(a,{getDebug:()=>E});module.exports=D(a);var i=require("#env/rewire");function E(){return(0,i.getEnvValue)("DEBUG")}0&&(module.exports={getDebug});
 //# sourceMappingURL=debug.js.map

package/dist/env/debug.js.map

@@ -1,7 +1,7 @@
 {
   "version": 3,
   "sources": ["../../src/env/debug.ts"],
-  "sourcesContent": ["/**\n * DEBUG environment variable snapshot.\n * Controls debug output for the debug package.\n */\n\nimport { env } from 'node:process'\n\nexport const DEBUG = env['DEBUG']\n"],
-  "mappings": ";4ZAAA,IAAAA,EAAA,GAAAC,EAAAD,EAAA,WAAAE,IAAA,eAAAC,EAAAH,GAKA,IAAAI,EAAoB,wBAEb,MAAMF,EAAQ,MAAI",
-  "names": ["debug_exports", "__export", "DEBUG", "__toCommonJS", "import_node_process"]
+  "sourcesContent": ["/**\n * DEBUG environment variable getter.\n * Controls debug output for the debug package.\n */\n\nimport { getEnvValue } from '#env/rewire'\n\nexport function getDebug(): string | undefined {\n  return getEnvValue('DEBUG')\n}\n"],
+  "mappings": ";4ZAAA,IAAAA,EAAA,GAAAC,EAAAD,EAAA,cAAAE,IAAA,eAAAC,EAAAH,GAKA,IAAAI,EAA4B,uBAErB,SAASF,GAA+B,CAC7C,SAAO,eAAY,OAAO,CAC5B",
+  "names": ["debug_exports", "__export", "getDebug", "__toCommonJS", "import_rewire"]
 }

package/dist/env/github.d.ts

@@ -0,0 +1,40 @@
+/**
+ * GITHUB_API_URL environment variable.
+ * GitHub API URL (e.g., https://api.github.com).
+ */
+export declare function getGithubApiUrl(): string | undefined;
+/**
+ * GITHUB_BASE_REF environment variable.
+ * GitHub pull request base branch.
+ */
+export declare function getGithubBaseRef(): string | undefined;
+/**
+ * GITHUB_REF_NAME environment variable.
+ * GitHub branch or tag name.
+ */
+export declare function getGithubRefName(): string | undefined;
+/**
+ * GITHUB_REF_TYPE environment variable.
+ * GitHub ref type (branch or tag).
+ */
+export declare function getGithubRefType(): string | undefined;
+/**
+ * GITHUB_REPOSITORY environment variable.
+ * GitHub repository name in owner/repo format.
+ */
+export declare function getGithubRepository(): string | undefined;
+/**
+ * GITHUB_SERVER_URL environment variable.
+ * GitHub server URL (e.g., https://github.com).
+ */
+export declare function getGithubServerUrl(): string | undefined;
+/**
+ * GITHUB_TOKEN environment variable.
+ * GitHub authentication token for API access.
+ */
+export declare function getGithubToken(): string | undefined;
+/**
+ * GH_TOKEN environment variable.
+ * Alternative GitHub authentication token for API access (used by GitHub CLI).
+ */
+export declare function getGhToken(): string | undefined;

package/dist/env/github.js

@@ -0,0 +1,3 @@
+/* Socket Lib - Built with esbuild */
+var u=Object.defineProperty;var f=Object.getOwnPropertyDescriptor;var g=Object.getOwnPropertyNames;var d=Object.prototype.hasOwnProperty;var G=(t,e)=>{for(var i in e)u(t,i,{get:e[i],enumerable:!0})},T=(t,e,i,o)=>{if(e&&typeof e=="object"||typeof e=="function")for(let r of g(e))!d.call(t,r)&&r!==i&&u(t,r,{get:()=>e[r],enumerable:!(o=f(e,r))||o.enumerable});return t};var R=t=>T(u({},"__esModule",{value:!0}),t);var h={};G(h,{getGhToken:()=>c,getGithubApiUrl:()=>_,getGithubBaseRef:()=>p,getGithubRefName:()=>E,getGithubRefType:()=>U,getGithubRepository:()=>s,getGithubServerUrl:()=>B,getGithubToken:()=>I});module.exports=R(h);var n=require("#env/rewire");function _(){return(0,n.getEnvValue)("GITHUB_API_URL")}function p(){return(0,n.getEnvValue)("GITHUB_BASE_REF")}function E(){return(0,n.getEnvValue)("GITHUB_REF_NAME")}function U(){return(0,n.getEnvValue)("GITHUB_REF_TYPE")}function s(){return(0,n.getEnvValue)("GITHUB_REPOSITORY")}function B(){return(0,n.getEnvValue)("GITHUB_SERVER_URL")}function I(){return(0,n.getEnvValue)("GITHUB_TOKEN")}function c(){return(0,n.getEnvValue)("GH_TOKEN")}0&&(module.exports={getGhToken,getGithubApiUrl,getGithubBaseRef,getGithubRefName,getGithubRefType,getGithubRepository,getGithubServerUrl,getGithubToken});
+//# sourceMappingURL=github.js.map

package/dist/env/github.js.map

@@ -0,0 +1,7 @@
+{
+  "version": 3,
+  "sources": ["../../src/env/github.ts"],
+  "sourcesContent": ["/**\n * @fileoverview GitHub Actions environment variable getters.\n * Provides access to GitHub Actions CI/CD environment variables.\n */\n\nimport { getEnvValue } from '#env/rewire'\n\n/**\n * GITHUB_API_URL environment variable.\n * GitHub API URL (e.g., https://api.github.com).\n */\nexport function getGithubApiUrl(): string | undefined {\n  return getEnvValue('GITHUB_API_URL')\n}\n\n/**\n * GITHUB_BASE_REF environment variable.\n * GitHub pull request base branch.\n */\nexport function getGithubBaseRef(): string | undefined {\n  return getEnvValue('GITHUB_BASE_REF')\n}\n\n/**\n * GITHUB_REF_NAME environment variable.\n * GitHub branch or tag name.\n */\nexport function getGithubRefName(): string | undefined {\n  return getEnvValue('GITHUB_REF_NAME')\n}\n\n/**\n * GITHUB_REF_TYPE environment variable.\n * GitHub ref type (branch or tag).\n */\nexport function getGithubRefType(): string | undefined {\n  return getEnvValue('GITHUB_REF_TYPE')\n}\n\n/**\n * GITHUB_REPOSITORY environment variable.\n * GitHub repository name in owner/repo format.\n */\nexport function getGithubRepository(): string | undefined {\n  return getEnvValue('GITHUB_REPOSITORY')\n}\n\n/**\n * GITHUB_SERVER_URL environment variable.\n * GitHub server URL (e.g., https://github.com).\n */\nexport function getGithubServerUrl(): string | undefined {\n  return getEnvValue('GITHUB_SERVER_URL')\n}\n\n/**\n * GITHUB_TOKEN environment variable.\n * GitHub authentication token for API access.\n */\nexport function getGithubToken(): string | undefined {\n  return getEnvValue('GITHUB_TOKEN')\n}\n\n/**\n * GH_TOKEN environment variable.\n * Alternative GitHub authentication token for API access (used by GitHub CLI).\n */\nexport function getGhToken(): string | undefined {\n  return getEnvValue('GH_TOKEN')\n}\n"],
+  "mappings": ";4ZAAA,IAAAA,EAAA,GAAAC,EAAAD,EAAA,gBAAAE,EAAA,oBAAAC,EAAA,qBAAAC,EAAA,qBAAAC,EAAA,qBAAAC,EAAA,wBAAAC,EAAA,uBAAAC,EAAA,mBAAAC,IAAA,eAAAC,EAAAV,GAKA,IAAAW,EAA4B,uBAMrB,SAASR,GAAsC,CACpD,SAAO,eAAY,gBAAgB,CACrC,CAMO,SAASC,GAAuC,CACrD,SAAO,eAAY,iBAAiB,CACtC,CAMO,SAASC,GAAuC,CACrD,SAAO,eAAY,iBAAiB,CACtC,CAMO,SAASC,GAAuC,CACrD,SAAO,eAAY,iBAAiB,CACtC,CAMO,SAASC,GAA0C,CACxD,SAAO,eAAY,mBAAmB,CACxC,CAMO,SAASC,GAAyC,CACvD,SAAO,eAAY,mBAAmB,CACxC,CAMO,SAASC,GAAqC,CACnD,SAAO,eAAY,cAAc,CACnC,CAMO,SAASP,GAAiC,CAC/C,SAAO,eAAY,UAAU,CAC/B",
+  "names": ["github_exports", "__export", "getGhToken", "getGithubApiUrl", "getGithubBaseRef", "getGithubRefName", "getGithubRefType", "getGithubRepository", "getGithubServerUrl", "getGithubToken", "__toCommonJS", "import_rewire"]
+}

package/dist/env/home.d.ts

@@ -1 +1 @@
-export declare const HOME: string;
+export declare function getHome(): string | undefined;

package/dist/env/home.js

@@ -1,3 +1,3 @@
 /* Socket Lib - Built with esbuild */
-var m=Object.defineProperty;var E=Object.getOwnPropertyDescriptor;var H=Object.getOwnPropertyNames;var M=Object.prototype.hasOwnProperty;var O=(r,o)=>{for(var e in o)m(r,e,{get:o[e],enumerable:!0})},c=(r,o,e,n)=>{if(o&&typeof o=="object"||typeof o=="function")for(let t of H(o))!M.call(r,t)&&t!==e&&m(r,t,{get:()=>o[t],enumerable:!(n=E(o,t))||n.enumerable});return r};var f=r=>c(m({},"__esModule",{value:!0}),r);var s={};O(s,{HOME:()=>i});module.exports=f(s);var p=require("node:process");const i=p.env.HOME;0&&(module.exports={HOME});
+var o=Object.defineProperty;var f=Object.getOwnPropertyDescriptor;var g=Object.getOwnPropertyNames;var m=Object.prototype.hasOwnProperty;var d=(n,e)=>{for(var r in e)o(n,r,{get:e[r],enumerable:!0})},p=(n,e,r,i)=>{if(e&&typeof e=="object"||typeof e=="function")for(let t of g(e))!m.call(n,t)&&t!==r&&o(n,t,{get:()=>e[t],enumerable:!(i=f(e,t))||i.enumerable});return n};var E=n=>p(o({},"__esModule",{value:!0}),n);var a={};d(a,{getHome:()=>H});module.exports=E(a);var u=require("#env/rewire");function H(){return(0,u.getEnvValue)("HOME")}0&&(module.exports={getHome});
 //# sourceMappingURL=home.js.map

package/dist/env/home.js.map

@@ -1,7 +1,7 @@
 {
   "version": 3,
   "sources": ["../../src/env/home.ts"],
-  "sourcesContent": ["/**\n * HOME environment variable snapshot.\n * Points to the user's home directory.\n */\n\nimport { env } from 'node:process'\n\nexport const HOME = env['HOME']\n"],
-  "mappings": ";4ZAAA,IAAAA,EAAA,GAAAC,EAAAD,EAAA,UAAAE,IAAA,eAAAC,EAAAH,GAKA,IAAAI,EAAoB,wBAEb,MAAMF,EAAO,MAAI",
-  "names": ["home_exports", "__export", "HOME", "__toCommonJS", "import_node_process"]
+  "sourcesContent": ["/**\n * HOME environment variable getter.\n * Points to the user's home directory.\n */\n\nimport { getEnvValue } from '#env/rewire'\n\nexport function getHome(): string | undefined {\n  return getEnvValue('HOME')\n}\n"],
+  "mappings": ";4ZAAA,IAAAA,EAAA,GAAAC,EAAAD,EAAA,aAAAE,IAAA,eAAAC,EAAAH,GAKA,IAAAI,EAA4B,uBAErB,SAASF,GAA8B,CAC5C,SAAO,eAAY,MAAM,CAC3B",
+  "names": ["home_exports", "__export", "getHome", "__toCommonJS", "import_rewire"]
 }

package/dist/env/locale.d.ts

@@ -0,0 +1,15 @@
+/**
+ * LANG environment variable.
+ * System locale and language settings.
+ */
+export declare function getLang(): string | undefined;
+/**
+ * LC_ALL environment variable.
+ * Override for all locale settings.
+ */
+export declare function getLcAll(): string | undefined;
+/**
+ * LC_MESSAGES environment variable.
+ * Locale setting for message translations.
+ */
+export declare function getLcMessages(): string | undefined;