@runloop/rl-cli 0.2.0 → 0.3.0

package/dist/mcp/server.js

@@ -3,7 +3,9 @@ import { Server } from "@modelcontextprotocol/sdk/server/index.js";
 import { StdioServerTransport } from "@modelcontextprotocol/sdk/server/stdio.js";
 import { CallToolRequestSchema, ListToolsRequestSchema, } from "@modelcontextprotocol/sdk/types.js";
 import Runloop from "@runloop/api-client";
+import { VERSION } from "@runloop/api-client/version.js";
 import Conf from "conf";
+import { processUtils } from "../utils/processUtils.js";
 let configInstance = null;
 function getConfigInstance() {
     if (!configInstance) {
@@ -51,6 +53,9 @@ function getClient() {
         baseURL,
         timeout: 10000, // 10 seconds instead of default 30 seconds
         maxRetries: 2, // 2 retries instead of default 5 (only for retryable errors)
+        defaultHeaders: {
+            "User-Agent": `Runloop/JS ${VERSION} - CLI MCP`,
+        },
     });
 }
 // Define available tools for the MCP server
@@ -452,5 +457,5 @@ async function main() {
 main().catch((error) => {
     console.error("[MCP] Fatal error in main():", error);
     console.error("[MCP] Stack trace:", error instanceof Error ? error.stack : "N/A");
-    process.exit(1);
+    processUtils.exit(1);
 });

package/dist/router/Router.js

@@ -16,6 +16,7 @@ import { DevboxDetailScreen } from "../screens/DevboxDetailScreen.js";
 import { DevboxActionsScreen } from "../screens/DevboxActionsScreen.js";
 import { DevboxCreateScreen } from "../screens/DevboxCreateScreen.js";
 import { BlueprintListScreen } from "../screens/BlueprintListScreen.js";
+import { BlueprintLogsScreen } from "../screens/BlueprintLogsScreen.js";
 import { SnapshotListScreen } from "../screens/SnapshotListScreen.js";
 import { SSHSessionScreen } from "../screens/SSHSessionScreen.js";
 /**
@@ -46,6 +47,7 @@ export function Router() {
                     break;
                 case "blueprint-list":
                 case "blueprint-detail":
+                case "blueprint-logs":
                     if (!currentScreen.startsWith("blueprint")) {
                         useBlueprintStore.getState().clearAll();
                     }
@@ -64,5 +66,5 @@ export function Router() {
     // and mount new component, preventing race conditions during screen transitions.
     // The key ensures React treats this as a completely new component tree.
     // Wrap in ErrorBoundary to catch any Yoga WASM errors gracefully.
-    return (_jsxs(ErrorBoundary, { children: [currentScreen === "menu" && (_jsx(MenuScreen, { ...params }, currentScreen)), currentScreen === "devbox-list" && (_jsx(DevboxListScreen, { ...params }, currentScreen)), currentScreen === "devbox-detail" && (_jsx(DevboxDetailScreen, { ...params }, currentScreen)), currentScreen === "devbox-actions" && (_jsx(DevboxActionsScreen, { ...params }, currentScreen)), currentScreen === "devbox-create" && (_jsx(DevboxCreateScreen, { ...params }, currentScreen)), currentScreen === "blueprint-list" && (_jsx(BlueprintListScreen, { ...params }, currentScreen)), currentScreen === "blueprint-detail" && (_jsx(BlueprintListScreen, { ...params }, currentScreen)), currentScreen === "snapshot-list" && (_jsx(SnapshotListScreen, { ...params }, currentScreen)), currentScreen === "snapshot-detail" && (_jsx(SnapshotListScreen, { ...params }, currentScreen)), currentScreen === "ssh-session" && (_jsx(SSHSessionScreen, { ...params }, currentScreen))] }, `boundary-${currentScreen}`));
+    return (_jsxs(ErrorBoundary, { children: [currentScreen === "menu" && (_jsx(MenuScreen, { ...params }, currentScreen)), currentScreen === "devbox-list" && (_jsx(DevboxListScreen, { ...params }, currentScreen)), currentScreen === "devbox-detail" && (_jsx(DevboxDetailScreen, { ...params }, currentScreen)), currentScreen === "devbox-actions" && (_jsx(DevboxActionsScreen, { ...params }, currentScreen)), currentScreen === "devbox-create" && (_jsx(DevboxCreateScreen, { ...params }, currentScreen)), currentScreen === "blueprint-list" && (_jsx(BlueprintListScreen, { ...params }, currentScreen)), currentScreen === "blueprint-detail" && (_jsx(BlueprintListScreen, { ...params }, currentScreen)), currentScreen === "blueprint-logs" && (_jsx(BlueprintLogsScreen, { ...params }, currentScreen)), currentScreen === "snapshot-list" && (_jsx(SnapshotListScreen, { ...params }, currentScreen)), currentScreen === "snapshot-detail" && (_jsx(SnapshotListScreen, { ...params }, currentScreen)), currentScreen === "ssh-session" && (_jsx(SSHSessionScreen, { ...params }, currentScreen))] }, `boundary-${currentScreen}`));
 }

package/dist/screens/BlueprintLogsScreen.js

@@ -0,0 +1,74 @@
+import { jsx as _jsx, Fragment as _Fragment, jsxs as _jsxs } from "react/jsx-runtime";
+/**
+ * BlueprintLogsScreen - Screen for viewing blueprint build logs
+ */
+import React from "react";
+import { Box, Text } from "ink";
+import { useNavigation } from "../store/navigationStore.js";
+import { LogsViewer } from "../components/LogsViewer.js";
+import { Header } from "../components/Header.js";
+import { SpinnerComponent } from "../components/Spinner.js";
+import { Breadcrumb } from "../components/Breadcrumb.js";
+import { ErrorMessage } from "../components/ErrorMessage.js";
+import { getBlueprintLogs } from "../services/blueprintService.js";
+import { colors } from "../utils/theme.js";
+export function BlueprintLogsScreen({ blueprintId }) {
+    const { goBack, params } = useNavigation();
+    const [logs, setLogs] = React.useState([]);
+    const [loading, setLoading] = React.useState(true);
+    const [error, setError] = React.useState(null);
+    // Use blueprintId from props or params
+    const id = blueprintId || params.blueprintId;
+    React.useEffect(() => {
+        if (!id) {
+            goBack();
+            return;
+        }
+        let cancelled = false;
+        const fetchLogs = async () => {
+            try {
+                setLoading(true);
+                setError(null);
+                const blueprintLogs = await getBlueprintLogs(id);
+                if (!cancelled) {
+                    setLogs(Array.isArray(blueprintLogs) ? blueprintLogs : []);
+                    setLoading(false);
+                }
+            }
+            catch (err) {
+                if (!cancelled) {
+                    setError(err);
+                    setLoading(false);
+                }
+            }
+        };
+        fetchLogs();
+        return () => {
+            cancelled = true;
+        };
+    }, [id, goBack]);
+    if (!id) {
+        return null;
+    }
+    // Get blueprint name from params if available (for breadcrumb)
+    const blueprintName = params.blueprintName || id;
+    if (loading) {
+        return (_jsxs(_Fragment, { children: [_jsx(Breadcrumb, { items: [
+                        { label: "Blueprints" },
+                        { label: blueprintName },
+                        { label: "Logs", active: true },
+                    ] }), _jsx(Header, { title: "Loading Logs" }), _jsx(SpinnerComponent, { message: "Fetching blueprint logs..." })] }));
+    }
+    if (error) {
+        return (_jsxs(_Fragment, { children: [_jsx(Breadcrumb, { items: [
+                        { label: "Blueprints" },
+                        { label: blueprintName },
+                        { label: "Logs", active: true },
+                    ] }), _jsx(Header, { title: "Error" }), _jsx(ErrorMessage, { message: "Failed to load blueprint logs", error: error }), _jsx(Box, { marginTop: 1, paddingX: 1, children: _jsx(Text, { color: colors.textDim, dimColor: true, children: "Press [q] or [esc] to go back" }) })] }));
+    }
+    return (_jsx(LogsViewer, { logs: logs, breadcrumbItems: [
+            { label: "Blueprints" },
+            { label: blueprintName },
+            { label: "Logs", active: true },
+        ], onBack: goBack, title: "Blueprint Build Logs" }));
+}

package/dist/services/blueprintService.js

@@ -72,34 +72,30 @@ export async function getBlueprint(id) {
 }
 /**
  * Get blueprint logs
+ * Returns the raw logs array from the API response
+ * Similar to getDevboxLogs - formatting is handled by logFormatter
  */
 export async function getBlueprintLogs(id) {
     const client = getClient();
     const response = await client.blueprints.logs(id);
-    // CRITICAL: Truncate all strings to prevent Yoga crashes
-    const MAX_MESSAGE_LENGTH = 1000;
-    const MAX_LEVEL_LENGTH = 20;
-    const logs = [];
+    // Return the logs array directly - formatting is handled by logFormatter
+    // Ensure timestamp_ms is present (API may return timestamp or timestamp_ms)
     if (response.logs && Array.isArray(response.logs)) {
-        response.logs.forEach((log) => {
-            // Truncate message and escape newlines
-            let message = String(log.message || "");
-            if (message.length > MAX_MESSAGE_LENGTH) {
-                message = message.substring(0, MAX_MESSAGE_LENGTH) + "...";
+        return response.logs.map((log) => {
+            // Normalize timestamp field to timestamp_ms if needed
+            // Create a new object to avoid mutating the original
+            const normalizedLog = { ...log };
+            if (normalizedLog.timestamp && !normalizedLog.timestamp_ms) {
+                // If timestamp is a number, use it directly; if it's a string, parse it
+                if (typeof normalizedLog.timestamp === "number") {
+                    normalizedLog.timestamp_ms = normalizedLog.timestamp;
+                }
+                else if (typeof normalizedLog.timestamp === "string") {
+                    normalizedLog.timestamp_ms = new Date(normalizedLog.timestamp).getTime();
+                }
             }
-            message = message
-                .replace(/\r\n/g, "\\n")
-                .replace(/\n/g, "\\n")
-                .replace(/\r/g, "\\r")
-                .replace(/\t/g, "\\t");
-            logs.push({
-                timestamp: log.timestamp,
-                message,
-                level: log.level
-                    ? String(log.level).substring(0, MAX_LEVEL_LENGTH)
-                    : undefined,
-            });
+            return normalizedLog;
         });
     }
-    return logs;
+    return [];
 }

package/dist/utils/CommandExecutor.js

@@ -5,8 +5,6 @@
 import { render } from "ink";
 import { getClient } from "./client.js";
 import { shouldUseNonInteractiveOutput, outputList, outputResult, } from "./output.js";
-import { enableSynchronousUpdates, disableSynchronousUpdates, } from "./terminalSync.js";
-import { exitAlternateScreenBuffer, enterAlternateScreenBuffer, } from "./screen.js";
 import YAML from "yaml";
 export class CommandExecutor {
     options;
@@ -34,16 +32,13 @@ export class CommandExecutor {
             return;
         }
         // Interactive mode
-        // Enter alternate screen buffer (this automatically clears the screen)
-        enableSynchronousUpdates();
-        const { waitUntilExit } = render(renderUI(), {
-            patchConsole: false,
-            exitOnCtrlC: false,
-        });
+        // Enter alternate screen buffer
+        process.stdout.write("\x1b[?1049h");
+        console.clear();
+        const { waitUntilExit } = render(renderUI());
         await waitUntilExit();
         // Exit alternate screen buffer
-        disableSynchronousUpdates();
-        exitAlternateScreenBuffer();
+        process.stdout.write("\x1b[?1049l");
     }
     /**
      * Execute a create/action command with automatic format handling
@@ -60,17 +55,13 @@ export class CommandExecutor {
             return;
         }
         // Interactive mode
-        // Enter alternate screen buffer (this automatically clears the screen)
-        enterAlternateScreenBuffer();
-        enableSynchronousUpdates();
-        const { waitUntilExit } = render(renderUI(), {
-            patchConsole: false,
-            exitOnCtrlC: false,
-        });
+        // Enter alternate screen buffer
+        process.stdout.write("\x1b[?1049h");
+        console.clear();
+        const { waitUntilExit } = render(renderUI());
         await waitUntilExit();
         // Exit alternate screen buffer
-        disableSynchronousUpdates();
-        exitAlternateScreenBuffer();
+        process.stdout.write("\x1b[?1049l");
     }
     /**
      * Execute a delete command with automatic format handling
@@ -88,50 +79,30 @@ export class CommandExecutor {
         }
         // Interactive mode
         // Enter alternate screen buffer
-        enterAlternateScreenBuffer();
-        enableSynchronousUpdates();
-        const { waitUntilExit } = render(renderUI(), {
-            patchConsole: false,
-            exitOnCtrlC: false,
-        });
+        process.stdout.write("\x1b[?1049h");
+        const { waitUntilExit } = render(renderUI());
         await waitUntilExit();
         // Exit alternate screen buffer
-        disableSynchronousUpdates();
-        exitAlternateScreenBuffer();
+        process.stdout.write("\x1b[?1049l");
     }
     /**
      * Fetch items from an async iterator with optional filtering and limits
-     * IMPORTANT: This method tries to access the page data directly first to avoid
-     * auto-pagination issues that can cause memory errors with large datasets.
      */
     async fetchFromIterator(iterator, options = {}) {
         const { filter, limit = 100 } = options;
-        let items = [];
-        // Try to access page data directly to avoid auto-pagination
-        const pageData = iterator.data || iterator.items;
-        if (pageData && Array.isArray(pageData)) {
-            items = pageData;
-        }
-        else {
-            // Fall back to iteration with limit
-            let count = 0;
-            for await (const item of iterator) {
-                if (filter && !filter(item)) {
-                    continue;
-                }
-                items.push(item);
-                count++;
-                if (count >= limit) {
-                    break;
-                }
+        const items = [];
+        let count = 0;
+        for await (const item of iterator) {
+            if (filter && !filter(item)) {
+                continue;
+            }
+            items.push(item);
+            count++;
+            if (count >= limit) {
+                break;
             }
         }
-        // Apply filter if provided
-        if (filter) {
-            items = items.filter(filter);
-        }
-        // Apply limit
-        return items.slice(0, limit);
+        return items;
     }
     /**
      * Handle errors consistently across all commands

package/dist/utils/client.js

@@ -1,4 +1,5 @@
 import Runloop from "@runloop/api-client";
+import { VERSION } from "@runloop/api-client/version.js";
 import { getConfig } from "./config.js";
 /**
  * Get the base URL based on RUNLOOP_ENV environment variable
@@ -24,5 +25,8 @@ export function getClient() {
     return new Runloop({
         bearerToken: config.apiKey,
         baseURL,
+        defaultHeaders: {
+            "User-Agent": `Runloop/JS ${VERSION} - CLI`,
+        },
     });
 }

package/dist/utils/logFormatter.js

@@ -83,7 +83,7 @@ export function getSourceInfo(source) {
     return { abbrev, color: "white" };
 }
 /**
- * Parse a log entry into formatted parts (for use in Ink UI)
+ * Parse a devbox log entry into formatted parts (for use in Ink UI)
  */
 export function parseLogEntry(log) {
     const levelInfo = getLogLevelInfo(log.level);
@@ -101,6 +101,52 @@ export function parseLogEntry(log) {
         exitCodeColor: log.exit_code === 0 ? "green" : "red",
     };
 }
+/**
+ * Parse a blueprint log entry into formatted parts (for use in Ink UI)
+ * Blueprint logs have a simpler structure (no source, shell_name, cmd, exit_code)
+ */
+export function parseBlueprintLogEntry(log) {
+    const levelInfo = getLogLevelInfo(log.level);
+    // Blueprint logs don't have a source, use "build" as default
+    const sourceInfo = getSourceInfo("build");
+    // Handle timestamp - may be timestamp_ms or timestamp
+    let timestampMs;
+    if (log.timestamp_ms !== undefined) {
+        timestampMs = log.timestamp_ms;
+    }
+    else if (log.timestamp !== undefined) {
+        const ts = log.timestamp;
+        timestampMs = typeof ts === "number" ? ts : new Date(ts).getTime();
+    }
+    else {
+        // Fallback to current time if no timestamp
+        timestampMs = Date.now();
+    }
+    return {
+        timestamp: formatTimestamp(timestampMs),
+        level: levelInfo.name,
+        levelColor: levelInfo.color,
+        source: sourceInfo.abbrev,
+        sourceColor: sourceInfo.color,
+        shellName: null,
+        cmd: null,
+        message: log.message || "",
+        exitCode: null,
+        exitCodeColor: "gray",
+    };
+}
+/**
+ * Parse any log entry (devbox or blueprint) into formatted parts
+ */
+export function parseAnyLogEntry(log) {
+    // Check if it's a devbox log by looking for source field
+    if ("source" in log || "shell_name" in log || "cmd" in log) {
+        return parseLogEntry(log);
+    }
+    else {
+        return parseBlueprintLogEntry(log);
+    }
+}
 /**
  * Format a log entry as a string with chalk colors (for CLI output)
  */

package/dist/utils/output.js

@@ -6,6 +6,7 @@
  * - outputError(message, error) - outputs error and exits
  */
 import YAML from "yaml";
+import { processUtils } from "./processUtils.js";
 /**
  * Resolve the output format from options
  */
@@ -15,7 +16,7 @@ function resolveFormat(options) {
         return format;
     }
     console.error(`Unknown output format: ${format}. Valid options: text, json, yaml`);
-    process.exit(1);
+    processUtils.exit(1);
 }
 /**
  * Format a value for text output (key-value pairs)
@@ -119,7 +120,7 @@ export function outputError(message, error) {
     if (error && errorMessage !== message) {
         console.error(`  ${errorMessage}`);
     }
-    process.exit(1);
+    processUtils.exit(1);
 }
 /**
  * Output a success message for action commands
@@ -202,5 +203,5 @@ export function validateOutputFormat(format) {
         return "yaml";
     }
     console.error(`Unknown output format: ${format}. Valid options: text, json, yaml`);
-    process.exit(1);
+    processUtils.exit(1);
 }

package/dist/utils/process.js

@@ -0,0 +1,106 @@
+/**
+ * Process utilities wrapper for testability.
+ *
+ * This module provides wrappers around Node.js process functions
+ * that can be easily mocked in tests.
+ */
+/**
+ * Default implementation using real process
+ */
+const defaultProcess = {
+    exit: (code) => {
+        process.exit(code);
+    },
+    stdout: {
+        write: (data) => process.stdout.write(data),
+        get isTTY() {
+            return process.stdout.isTTY;
+        },
+    },
+    stderr: {
+        write: (data) => process.stderr.write(data),
+    },
+    get env() {
+        return process.env;
+    },
+    cwd: () => process.cwd(),
+};
+/**
+ * Current process implementation - can be swapped for testing
+ */
+let currentProcess = defaultProcess;
+/**
+ * Get the current process wrapper
+ */
+export function getProcess() {
+    return currentProcess;
+}
+/**
+ * Set a custom process wrapper (for testing)
+ */
+export function setProcess(proc) {
+    currentProcess = proc;
+}
+/**
+ * Reset to the default process wrapper
+ */
+export function resetProcess() {
+    currentProcess = defaultProcess;
+}
+/**
+ * Exit the process with an optional exit code
+ */
+export function exitProcess(code) {
+    return currentProcess.exit(code);
+}
+/**
+ * Write to stdout
+ */
+export function writeStdout(data) {
+    return currentProcess.stdout.write(data);
+}
+/**
+ * Write to stderr
+ */
+export function writeStderr(data) {
+    return currentProcess.stderr.write(data);
+}
+/**
+ * Check if stdout is a TTY
+ */
+export function isStdoutTTY() {
+    return !!currentProcess.stdout.isTTY;
+}
+/**
+ * Get environment variable
+ */
+export function getEnv(key) {
+    return currentProcess.env[key];
+}
+/**
+ * Get current working directory
+ */
+export function getCwd() {
+    return currentProcess.cwd();
+}
+/**
+ * Create a mock process for testing
+ */
+export function createMockProcess(overrides = {}) {
+    const exitFn = jest.fn();
+    const stdoutWriteFn = jest.fn().mockReturnValue(true);
+    const stderrWriteFn = jest.fn().mockReturnValue(true);
+    const cwdFn = jest.fn().mockReturnValue("/mock/cwd");
+    return {
+        exit: overrides.exit ?? exitFn,
+        stdout: overrides.stdout ?? {
+            write: stdoutWriteFn,
+            isTTY: true,
+        },
+        stderr: overrides.stderr ?? {
+            write: stderrWriteFn,
+        },
+        env: overrides.env ?? {},
+        cwd: overrides.cwd ?? cwdFn,
+    };
+}

package/dist/utils/processUtils.js

@@ -0,0 +1,135 @@
+/**
+ * Process utilities wrapper for testability.
+ *
+ * This module provides a mockable interface for process-related operations
+ * like exit, stdout/stderr writes, and terminal detection. In tests, you can
+ * replace these functions with mocks to avoid actual process termination
+ * and capture output.
+ *
+ * Usage in code:
+ *   import { processUtils } from '../utils/processUtils.js';
+ *   processUtils.exit(1);
+ *   processUtils.stdout.write('Hello');
+ *
+ * Usage in tests:
+ *   import { processUtils, resetProcessUtils } from '../utils/processUtils.js';
+ *   processUtils.exit = jest.fn();
+ *   // ... run tests ...
+ *   resetProcessUtils(); // restore original behavior
+ */
+// Store original references for reset
+const originalExit = process.exit.bind(process);
+const originalStdoutWrite = process.stdout.write.bind(process.stdout);
+const originalStderrWrite = process.stderr.write.bind(process.stderr);
+const originalCwd = process.cwd.bind(process);
+const originalOn = process.on.bind(process);
+const originalOff = process.off.bind(process);
+/**
+ * The main process utilities object.
+ * All properties are mutable for testing purposes.
+ */
+export const processUtils = {
+    exit: originalExit,
+    stdout: {
+        write: (data) => originalStdoutWrite(data),
+        get isTTY() {
+            return process.stdout.isTTY ?? false;
+        },
+    },
+    stderr: {
+        write: (data) => originalStderrWrite(data),
+        get isTTY() {
+            return process.stderr.isTTY ?? false;
+        },
+    },
+    stdin: {
+        get isTTY() {
+            return process.stdin.isTTY ?? false;
+        },
+        setRawMode: process.stdin.setRawMode?.bind(process.stdin),
+        on: process.stdin.on.bind(process.stdin),
+        removeListener: process.stdin.removeListener.bind(process.stdin),
+    },
+    cwd: originalCwd,
+    on: originalOn,
+    off: originalOff,
+    get env() {
+        return process.env;
+    },
+};
+/**
+ * Reset all process utilities to their original implementations.
+ * Call this in test teardown to restore normal behavior.
+ */
+export function resetProcessUtils() {
+    processUtils.exit = originalExit;
+    processUtils.stdout.write = (data) => originalStdoutWrite(data);
+    processUtils.stderr.write = (data) => originalStderrWrite(data);
+    processUtils.cwd = originalCwd;
+    processUtils.on = originalOn;
+    processUtils.off = originalOff;
+}
+/**
+ * Create a mock process utils for testing.
+ * Returns an object with jest mock functions.
+ */
+export function createMockProcessUtils() {
+    const exitMock = (() => {
+        throw new Error("process.exit called");
+    });
+    return {
+        exit: exitMock,
+        stdout: {
+            write: () => true,
+            isTTY: false,
+        },
+        stderr: {
+            write: () => true,
+            isTTY: false,
+        },
+        stdin: {
+            isTTY: false,
+            setRawMode: () => { },
+            on: () => { },
+            removeListener: () => { },
+        },
+        cwd: () => "/mock/cwd",
+        on: () => { },
+        off: () => { },
+        env: {},
+    };
+}
+/**
+ * Install mock process utils for testing.
+ * Returns a cleanup function to restore originals.
+ */
+export function installMockProcessUtils(mock) {
+    const backup = {
+        exit: processUtils.exit,
+        stdoutWrite: processUtils.stdout.write,
+        stderrWrite: processUtils.stderr.write,
+        cwd: processUtils.cwd,
+        on: processUtils.on,
+        off: processUtils.off,
+    };
+    if (mock.exit)
+        processUtils.exit = mock.exit;
+    if (mock.stdout?.write)
+        processUtils.stdout.write = mock.stdout.write;
+    if (mock.stderr?.write)
+        processUtils.stderr.write = mock.stderr.write;
+    if (mock.cwd)
+        processUtils.cwd = mock.cwd;
+    if (mock.on)
+        processUtils.on = mock.on;
+    if (mock.off)
+        processUtils.off = mock.off;
+    return () => {
+        processUtils.exit = backup.exit;
+        processUtils.stdout.write = backup.stdoutWrite;
+        processUtils.stderr.write = backup.stderrWrite;
+        processUtils.cwd = backup.cwd;
+        processUtils.on = backup.on;
+        processUtils.off = backup.off;
+    };
+}