@revenuecat/purchases-js 0.3.4 → 0.5.0

package/dist/Purchases.es.js

@@ -1,57 +1,57 @@
-var Kt = Object.defineProperty;
-var qt = (t, e, r) => e in t ? Kt(t, e, { enumerable: !0, configurable: !0, writable: !0, value: r }) : t[e] = r;
-var P = (t, e, r) => (qt(t, typeof e != "symbol" ? e + "" : e, r), r);
-function jt(t) {
+var Wt = Object.defineProperty;
+var zt = (t, e, r) => e in t ? Wt(t, e, { enumerable: !0, configurable: !0, writable: !0, value: r }) : t[e] = r;
+var P = (t, e, r) => (zt(t, typeof e != "symbol" ? e + "" : e, r), r);
+function Xt(t) {
   return t != null;
 }
-var W = /* @__PURE__ */ ((t) => (t[t.Silent = 0] = "Silent", t[t.Error = 1] = "Error", t[t.Warn = 2] = "Warn", t[t.Info = 3] = "Info", t[t.Debug = 4] = "Debug", t[t.Verbose = 5] = "Verbose", t))(W || {});
-class G {
+var z = /* @__PURE__ */ ((t) => (t[t.Silent = 0] = "Silent", t[t.Error = 1] = "Error", t[t.Warn = 2] = "Warn", t[t.Info = 3] = "Info", t[t.Debug = 4] = "Debug", t[t.Verbose = 5] = "Verbose", t))(z || {});
+class Y {
   static setLogLevel(e) {
     this.logLevel = e;
   }
   static log(e, r = this.logLevel) {
     const n = `[Purchases] ${e}`;
-    if (!(this.logLevel < r || r === W.Silent))
+    if (!(this.logLevel < r || r === z.Silent))
       switch (r) {
-        case W.Error:
+        case z.Error:
           console.error(n);
           break;
-        case W.Warn:
+        case z.Warn:
           console.warn(n);
           break;
-        case W.Info:
+        case z.Info:
           console.info(n);
           break;
-        case W.Debug:
+        case z.Debug:
           console.debug(n);
           break;
-        case W.Verbose:
+        case z.Verbose:
           console.debug(n);
           break;
       }
   }
   static errorLog(e) {
-    this.log(e, W.Error);
+    this.log(e, z.Error);
   }
   static warnLog(e) {
-    this.log(e, W.Warn);
+    this.log(e, z.Warn);
   }
   static infoLog(e) {
-    this.log(e, W.Info);
+    this.log(e, z.Info);
   }
   static debugLog(e) {
-    this.log(e, W.Debug);
+    this.log(e, z.Debug);
   }
   static verboseLog(e) {
-    this.log(e, W.Verbose);
+    this.log(e, z.Verbose);
   }
 }
-P(G, "logLevel", W.Silent);
+P(Y, "logLevel", z.Silent);
 var ne = /* @__PURE__ */ ((t) => (t.Year = "year", t.Month = "month", t.Week = "week", t.Day = "day", t))(ne || {});
 function Je(t) {
   const e = t.match(/^PT?([0-9]+)([MDYW])$/);
   if (!e || e.length < 3)
-    return G.errorLog(`Invalid ISO 8601 duration format: ${t}`), null;
+    return Y.errorLog(`Invalid ISO 8601 duration format: ${t}`), null;
   const r = parseInt(e[1]);
   switch (e[2]) {
     case "Y":
@@ -79,7 +79,7 @@ function Je(t) {
         /* Day */
       };
     default:
-      return G.errorLog(`Invalid ISO 8601 unit duration format: ${t}`), null;
+      return Y.errorLog(`Invalid ISO 8601 unit duration format: ${t}`), null;
   }
 }
 const Ve = (t, e) => {
@@ -88,7 +88,7 @@ const Ve = (t, e) => {
     style: "currency",
     currency: e
   }).format(r);
-}, Jt = (t) => {
+}, Zt = (t) => {
   const e = t.number;
   if (e === 1)
     switch (t.unit) {
@@ -103,7 +103,7 @@ const Ve = (t, e) => {
     }
   else
     return `every ${e} ${t.unit}s`;
-}, Vt = (t) => {
+}, en = (t) => {
   const e = t.number;
   if (e === 1)
     switch (t.unit) {
@@ -120,13 +120,13 @@ const Ve = (t, e) => {
     return `${e} ${t.unit}s`;
 }, nt = (t) => {
   const e = Je(t);
-  return e ? Jt(e) : "unknown";
-}, Wt = (t) => {
+  return e ? Zt(e) : "unknown";
+}, tn = (t) => {
   const e = Je(t);
-  return e ? Vt(e) : "unknown";
+  return e ? en(e) : "unknown";
 };
-var zt = /* @__PURE__ */ ((t) => (t.Unknown = "unknown", t.Custom = "custom", t.Lifetime = "$rc_lifetime", t.Annual = "$rc_annual", t.SixMonth = "$rc_six_month", t.ThreeMonth = "$rc_three_month", t.TwoMonth = "$rc_two_month", t.Monthly = "$rc_monthly", t.Weekly = "$rc_weekly", t))(zt || {});
-const Xt = (t) => ({
+var nn = /* @__PURE__ */ ((t) => (t.Unknown = "unknown", t.Custom = "custom", t.Lifetime = "$rc_lifetime", t.Annual = "$rc_annual", t.SixMonth = "$rc_six_month", t.ThreeMonth = "$rc_three_month", t.TwoMonth = "$rc_two_month", t.Monthly = "$rc_monthly", t.Weekly = "$rc_weekly", t))(nn || {});
+const rn = (t) => ({
   amount: t.amount,
   currency: t.currency,
   formattedPrice: Ve(t.amount, t.currency)
@@ -136,30 +136,30 @@ const Xt = (t) => ({
     periodDuration: e,
     period: e ? Je(e) : null,
     cycleCount: t.cycle_count,
-    price: t.price ? Xt(t.price) : null
+    price: t.price ? rn(t.price) : null
   };
-}, Zt = (t) => t.base == null ? (G.debugLog("Missing base phase for subscription option. Ignoring."), null) : {
+}, on = (t) => t.base == null ? (Y.debugLog("Missing base phase for subscription option. Ignoring."), null) : {
   id: t.id,
   base: rt(t.base),
   trial: t.trial ? rt(t.trial) : null
-}, en = (t, e) => {
+}, sn = (t, e) => {
   const r = {};
   if (Object.entries(t.subscription_options).forEach(
     ([s, l]) => {
-      const c = Zt(l);
+      const c = on(l);
       c != null && (r[s] = c);
     }
   ), Object.keys(r).length === 0)
-    return G.debugLog(
+    return Y.debugLog(
       `Product ${t.identifier} has no subscription options. Ignoring.`
     ), null;
   const n = t.default_subscription_option_id, i = n && n in r ? r[n] : null;
   if (i == null)
-    return G.debugLog(
+    return Y.debugLog(
       `Product ${t.identifier} has no default subscription option. Ignoring.`
     ), null;
   const o = i.base.price;
-  return o == null ? (G.debugLog(
+  return o == null ? (Y.debugLog(
     `Product ${t.identifier} default option has no base price. Ignoring.`
   ), null) : {
     identifier: t.identifier,
@@ -168,42 +168,49 @@ const Xt = (t) => ({
     description: t.description,
     currentPrice: o,
     normalPeriodDuration: i.base.periodDuration,
-    presentedOfferingIdentifier: e,
+    presentedOfferingIdentifier: e.offeringIdentifier,
+    presentedOfferingContext: e,
     defaultSubscriptionOption: i,
     subscriptionOptions: r
   };
-}, tn = (t, e, r) => {
+}, ln = (t, e, r) => {
   const n = r[e.platform_product_identifier];
   if (n === void 0)
     return null;
-  const i = en(n, t);
+  const i = sn(n, t);
   return i === null ? null : {
     identifier: e.identifier,
     rcBillingProduct: i,
-    packageType: nn(e.identifier)
+    packageType: an(e.identifier)
   };
-}, it = (t, e) => {
-  const r = t.packages.map(
-    (i) => tn(t.identifier, i, e)
-  ).filter(jt), n = {};
-  for (const i of r)
-    i != null && (n[i.identifier] = i);
-  return r.length == 0 ? null : {
-    identifier: t.identifier,
-    serverDescription: t.description,
-    metadata: t.metadata,
-    packagesById: n,
-    availablePackages: r,
-    lifetime: n.$rc_lifetime ?? null,
-    annual: n.$rc_annual ?? null,
-    sixMonth: n.$rc_six_month ?? null,
-    threeMonth: n.$rc_three_month ?? null,
-    twoMonth: n.$rc_two_month ?? null,
-    monthly: n.$rc_monthly ?? null,
-    weekly: n.$rc_weekly ?? null
+}, cn = (t, e, r, n) => {
+  const i = {
+    offeringIdentifier: e.identifier,
+    targetingContext: t && n ? {
+      ruleId: n.rule_id,
+      revision: n.revision
+    } : null
+  }, o = e.packages.map(
+    (l) => ln(i, l, r)
+  ).filter(Xt), s = {};
+  for (const l of o)
+    l != null && (s[l.identifier] = l);
+  return o.length == 0 ? null : {
+    identifier: e.identifier,
+    serverDescription: e.description,
+    metadata: e.metadata,
+    packagesById: s,
+    availablePackages: o,
+    lifetime: s.$rc_lifetime ?? null,
+    annual: s.$rc_annual ?? null,
+    sixMonth: s.$rc_six_month ?? null,
+    threeMonth: s.$rc_three_month ?? null,
+    twoMonth: s.$rc_two_month ?? null,
+    monthly: s.$rc_monthly ?? null,
+    weekly: s.$rc_weekly ?? null
   };
 };
-function nn(t) {
+function an(t) {
   switch (t) {
     case "$rc_lifetime":
       return "$rc_lifetime";
@@ -225,7 +232,7 @@ function nn(t) {
 }
 function v() {
 }
-function rn(t, e) {
+function un(t, e) {
   for (const r in e)
     t[r] = e[r];
   return (
@@ -233,14 +240,14 @@ function rn(t, e) {
     t
   );
 }
-function Bt(t) {
+function $t(t) {
   return t();
 }
-function ot() {
+function it() {
   return /* @__PURE__ */ Object.create(null);
 }
-function we(t) {
-  t.forEach(Bt);
+function Ie(t) {
+  t.forEach($t);
 }
 function ce(t) {
   return typeof t == "function";
@@ -248,15 +255,15 @@ function ce(t) {
 function T(t, e) {
   return t != t ? e == e : t !== e || t && typeof t == "object" || typeof t == "function";
 }
-let Me;
+let De;
 function ee(t, e) {
-  return t === e ? !0 : (Me || (Me = document.createElement("a")), Me.href = e, t === Me.href);
+  return t === e ? !0 : (De || (De = document.createElement("a")), De.href = e, t === De.href);
 }
-function st(t) {
+function ot(t) {
   return t.split(",").map((e) => e.trim().split(" ").filter(Boolean));
 }
-function on(t, e) {
-  const r = st(t.srcset), n = st(e || "");
+function fn(t, e) {
+  const r = ot(t.srcset), n = ot(e || "");
   return n.length === r.length && n.every(
     ([i, o], s) => o === r[s][1] && // We need to test both ways because Vite will create an a full URL with
     // `new URL(asset, import.meta.url).href` for the client when `base: './'`, and the
@@ -266,17 +273,17 @@ function on(t, e) {
     (ee(r[s][0], i) || ee(i, r[s][0]))
   );
 }
-function sn(t) {
+function dn(t) {
   return Object.keys(t).length === 0;
 }
 function q(t, e, r, n) {
   if (t) {
-    const i = Dt(t, e, r, n);
+    const i = Bt(t, e, r, n);
     return t[0](i);
   }
 }
-function Dt(t, e, r, n) {
-  return t[1] && n ? rn(r.ctx.slice(), t[1](n(e))) : r.ctx;
+function Bt(t, e, r, n) {
+  return t[1] && n ? un(r.ctx.slice(), t[1](n(e))) : r.ctx;
 }
 function j(t, e, r, n) {
   if (t[2] && n) {
@@ -295,7 +302,7 @@ function j(t, e, r, n) {
 }
 function J(t, e, r, n, i, o) {
   if (i) {
-    const s = Dt(e, r, n, o);
+    const s = Bt(e, r, n, o);
     t.p(s, i);
   }
 }
@@ -308,20 +315,20 @@ function V(t) {
   }
   return -1;
 }
-function Ee(t) {
+function Ae(t) {
   return t ?? "";
 }
-function Q(t, e) {
+function M(t, e) {
   t.appendChild(e);
 }
 function F(t, e, r) {
-  const n = ln(t);
+  const n = mn(t);
   if (!n.getElementById(e)) {
     const i = k("style");
-    i.id = e, i.textContent = r, cn(n, i);
+    i.id = e, i.textContent = r, gn(n, i);
   }
 }
-function ln(t) {
+function mn(t) {
   if (!t)
     return document;
   const e = t.getRootNode ? t.getRootNode() : t.ownerDocument;
@@ -331,8 +338,8 @@ function ln(t) {
     e
   ) : t.ownerDocument;
 }
-function cn(t, e) {
-  return Q(
+function gn(t, e) {
+  return M(
     /** @type {Document} */
     t.head || t,
     e
@@ -350,16 +357,16 @@ function k(t) {
 function L(t) {
   return document.createTextNode(t);
 }
-function C() {
+function Q() {
   return L(" ");
 }
 function te() {
   return L("");
 }
-function ke(t, e, r, n) {
+function we(t, e, r, n) {
   return t.addEventListener(e, r, n), () => t.removeEventListener(e, r, n);
 }
-function Mt(t) {
+function Dt(t) {
   return function(e) {
     return e.preventDefault(), t.call(this, e);
   };
@@ -367,58 +374,58 @@ function Mt(t) {
 function _(t, e, r) {
   r == null ? t.removeAttribute(e) : t.getAttribute(e) !== r && t.setAttribute(e, r);
 }
-const an = ["width", "height"];
-function un(t, e) {
+const pn = ["width", "height"];
+function _n(t, e) {
   const r = Object.getOwnPropertyDescriptors(t.__proto__);
   for (const n in e)
-    e[n] == null ? t.removeAttribute(n) : n === "style" ? t.style.cssText = e[n] : n === "__value" ? t.value = t[n] = e[n] : r[n] && r[n].set && an.indexOf(n) === -1 ? t[n] = e[n] : _(t, n, e[n]);
+    e[n] == null ? t.removeAttribute(n) : n === "style" ? t.style.cssText = e[n] : n === "__value" ? t.value = t[n] = e[n] : r[n] && r[n].set && pn.indexOf(n) === -1 ? t[n] = e[n] : _(t, n, e[n]);
 }
-function fn(t, e) {
+function hn(t, e) {
   Object.keys(e).forEach((r) => {
-    dn(t, r, e[r]);
+    An(t, r, e[r]);
   });
 }
-function dn(t, e, r) {
+function An(t, e, r) {
   const n = e.toLowerCase();
   n in t ? t[n] = typeof t[n] == "boolean" && r === "" ? !0 : r : e in t ? t[e] = typeof t[e] == "boolean" && r === "" ? !0 : r : _(t, e, r);
 }
-function mn(t) {
-  return /-/.test(t) ? fn : un;
+function En(t) {
+  return /-/.test(t) ? hn : _n;
 }
-function gn(t) {
+function bn(t) {
   return Array.from(t.childNodes);
 }
 function ae(t, e) {
   e = "" + e, t.data !== e && (t.data = /** @type {string} */
   e);
 }
-function lt(t, e) {
+function st(t, e) {
   t.value = e ?? "";
 }
-function pn(t, e, { bubbles: r = !1, cancelable: n = !1 } = {}) {
+function In(t, e, { bubbles: r = !1, cancelable: n = !1 } = {}) {
   return new CustomEvent(t, { detail: e, bubbles: r, cancelable: n });
 }
-let be;
-function Ae(t) {
-  be = t;
+let Ee;
+function _e(t) {
+  Ee = t;
 }
-function $e() {
-  if (!be)
+function ke() {
+  if (!Ee)
     throw new Error("Function called outside component initialization");
-  return be;
+  return Ee;
 }
-function _n(t) {
-  $e().$$.before_update.push(t);
+function wn(t) {
+  ke().$$.before_update.push(t);
 }
-function Oe(t) {
-  $e().$$.on_mount.push(t);
+function Se(t) {
+  ke().$$.on_mount.push(t);
 }
-function An() {
-  const t = $e();
+function kn() {
+  const t = ke();
   return (e, r, { cancelable: n = !1 } = {}) => {
     const i = t.$$.callbacks[e];
     if (i) {
-      const o = pn(
+      const o = In(
         /** @type {string} */
         e,
         r,
@@ -431,68 +438,68 @@ function An() {
     return !0;
   };
 }
-function hn(t, e) {
-  return $e().$$.context.set(t, e), e;
+function yn(t, e) {
+  return ke().$$.context.set(t, e), e;
 }
-function En(t) {
-  return $e().$$.context.get(t);
+function vn(t) {
+  return ke().$$.context.get(t);
 }
-function Qt(t, e) {
+function Ct(t, e) {
   const r = t.$$.callbacks[e.type];
   r && r.slice().forEach((n) => n.call(this, e));
 }
 const se = [], Re = [];
 let le = [];
-const He = [], bn = /* @__PURE__ */ Promise.resolve();
-let Ke = !1;
-function In() {
-  Ke || (Ke = !0, bn.then(Pt));
+const Ge = [], $n = /* @__PURE__ */ Promise.resolve();
+let He = !1;
+function Bn() {
+  He || (He = !0, $n.then(Pt));
 }
-function qe(t) {
+function Ke(t) {
   le.push(t);
 }
-function wn(t) {
-  He.push(t);
+function Dn(t) {
+  Ge.push(t);
 }
-const xe = /* @__PURE__ */ new Set();
+const Fe = /* @__PURE__ */ new Set();
 let ie = 0;
 function Pt() {
   if (ie !== 0)
     return;
-  const t = be;
+  const t = Ee;
   do {
     try {
       for (; ie < se.length; ) {
         const e = se[ie];
-        ie++, Ae(e), kn(e.$$);
+        ie++, _e(e), Cn(e.$$);
       }
     } catch (e) {
       throw se.length = 0, ie = 0, e;
     }
-    for (Ae(null), se.length = 0, ie = 0; Re.length; )
+    for (_e(null), se.length = 0, ie = 0; Re.length; )
       Re.pop()();
     for (let e = 0; e < le.length; e += 1) {
       const r = le[e];
-      xe.has(r) || (xe.add(r), r());
+      Fe.has(r) || (Fe.add(r), r());
     }
     le.length = 0;
   } while (se.length);
-  for (; He.length; )
-    He.pop()();
-  Ke = !1, xe.clear(), Ae(t);
+  for (; Ge.length; )
+    Ge.pop()();
+  He = !1, Fe.clear(), _e(t);
 }
-function kn(t) {
+function Cn(t) {
   if (t.fragment !== null) {
-    t.update(), we(t.before_update);
+    t.update(), Ie(t.before_update);
     const e = t.dirty;
-    t.dirty = [-1], t.fragment && t.fragment.p(t.ctx, e), t.after_update.forEach(qe);
+    t.dirty = [-1], t.fragment && t.fragment.p(t.ctx, e), t.after_update.forEach(Ke);
   }
 }
-function $n(t) {
+function Pn(t) {
   const e = [], r = [];
   le.forEach((n) => t.indexOf(n) === -1 ? e.push(n) : r.push(n)), r.forEach((n) => n()), le = e;
 }
-const Te = /* @__PURE__ */ new Set();
+const Qe = /* @__PURE__ */ new Set();
 let re;
 function H() {
   re = {
@@ -503,22 +510,22 @@ function H() {
   };
 }
 function K() {
-  re.r || we(re.c), re = re.p;
+  re.r || Ie(re.c), re = re.p;
 }
 function f(t, e) {
-  t && t.i && (Te.delete(t), t.i(e));
+  t && t.i && (Qe.delete(t), t.i(e));
 }
 function d(t, e, r, n) {
   if (t && t.o) {
-    if (Te.has(t))
+    if (Qe.has(t))
       return;
-    Te.add(t), re.c.push(() => {
-      Te.delete(t), n && (r && t.d(1), n());
+    Qe.add(t), re.c.push(() => {
+      Qe.delete(t), n && (r && t.d(1), n());
     }), t.o(e);
   } else
     n && n();
 }
-function vn(t, e, r) {
+function Mn(t, e, r) {
   const n = t.$$.props[e];
   n !== void 0 && (t.$$.bound[n] = r, r(t.$$.ctx[n]));
 }
@@ -527,21 +534,21 @@ function w(t) {
 }
 function b(t, e, r) {
   const { fragment: n, after_update: i } = t.$$;
-  n && n.m(e, r), qe(() => {
-    const o = t.$$.on_mount.map(Bt).filter(ce);
-    t.$$.on_destroy ? t.$$.on_destroy.push(...o) : we(o), t.$$.on_mount = [];
-  }), i.forEach(qe);
+  n && n.m(e, r), Ke(() => {
+    const o = t.$$.on_mount.map($t).filter(ce);
+    t.$$.on_destroy ? t.$$.on_destroy.push(...o) : Ie(o), t.$$.on_mount = [];
+  }), i.forEach(Ke);
 }
 function I(t, e) {
   const r = t.$$;
-  r.fragment !== null && ($n(r.after_update), we(r.on_destroy), r.fragment && r.fragment.d(e), r.on_destroy = r.fragment = null, r.ctx = []);
+  r.fragment !== null && (Pn(r.after_update), Ie(r.on_destroy), r.fragment && r.fragment.d(e), r.on_destroy = r.fragment = null, r.ctx = []);
 }
-function yn(t, e) {
-  t.$$.dirty[0] === -1 && (se.push(t), In(), t.$$.dirty.fill(0)), t.$$.dirty[e / 31 | 0] |= 1 << e % 31;
+function Qn(t, e) {
+  t.$$.dirty[0] === -1 && (se.push(t), Bn(), t.$$.dirty.fill(0)), t.$$.dirty[e / 31 | 0] |= 1 << e % 31;
 }
 function N(t, e, r, n, i, o, s = null, l = [-1]) {
-  const c = be;
-  Ae(t);
+  const c = Ee;
+  _e(t);
   const a = t.$$ = {
     fragment: null,
     ctx: [],
@@ -549,7 +556,7 @@ function N(t, e, r, n, i, o, s = null, l = [-1]) {
     props: o,
     update: v,
     not_equal: i,
-    bound: ot(),
+    bound: it(),
     // lifecycle
     on_mount: [],
     on_destroy: [],
@@ -558,27 +565,27 @@ function N(t, e, r, n, i, o, s = null, l = [-1]) {
     after_update: [],
     context: new Map(e.context || (c ? c.$$.context : [])),
     // everything else
-    callbacks: ot(),
+    callbacks: it(),
     dirty: l,
     skip_bound: !1,
     root: e.target || c.$$.root
   };
   s && s(a.root);
   let u = !1;
-  if (a.ctx = r ? r(t, e.props || {}, (m, A, ...$) => {
-    const E = $.length ? $[0] : A;
-    return a.ctx && i(a.ctx[m], a.ctx[m] = E) && (!a.skip_bound && a.bound[m] && a.bound[m](E), u && yn(t, m)), A;
-  }) : [], a.update(), u = !0, we(a.before_update), a.fragment = n ? n(a.ctx) : !1, e.target) {
+  if (a.ctx = r ? r(t, e.props || {}, (m, h, ...y) => {
+    const E = y.length ? y[0] : h;
+    return a.ctx && i(a.ctx[m], a.ctx[m] = E) && (!a.skip_bound && a.bound[m] && a.bound[m](E), u && Qn(t, m)), h;
+  }) : [], a.update(), u = !0, Ie(a.before_update), a.fragment = n ? n(a.ctx) : !1, e.target) {
     if (e.hydrate) {
-      const m = gn(e.target);
+      const m = bn(e.target);
       a.fragment && a.fragment.l(m), m.forEach(g);
     } else
       a.fragment && a.fragment.c();
     e.intro && f(t.$$.fragment), b(t, e.target, e.anchor), Pt();
   }
-  Ae(c);
+  _e(c);
 }
-class U {
+class R {
   constructor() {
     /**
      * ### PRIVATE API
@@ -621,15 +628,15 @@ class U {
    * @returns {void}
    */
   $set(e) {
-    this.$$set && !sn(e) && (this.$$.skip_bound = !0, this.$$set(e), this.$$.skip_bound = !1);
+    this.$$set && !dn(e) && (this.$$.skip_bound = !0, this.$$set(e), this.$$.skip_bound = !1);
   }
 }
-const Bn = "4";
-typeof window < "u" && (window.__svelte || (window.__svelte = { v: /* @__PURE__ */ new Set() })).v.add(Bn);
-function Dn(t) {
+const Tn = "4";
+typeof window < "u" && (window.__svelte || (window.__svelte = { v: /* @__PURE__ */ new Set() })).v.add(Tn);
+function Nn(t) {
   F(t, "svelte-1bzqb13", ".rcb-modal-section.svelte-1bzqb13{padding:8px 0px;display:flex}section.rcb-modal-section.svelte-1bzqb13{flex-grow:1}.rcb-modal-section.svelte-1bzqb13:last-of-type{padding:0}");
 }
-function Ge(t) {
+function xe(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -646,11 +653,11 @@ function Ge(t) {
       e = k(
         /*as*/
         t[0]
-      ), i && i.c(), mn(
+      ), i && i.c(), En(
         /*as*/
         t[0]
       )(e, {
-        class: Ee("rcb-modal-section") + " svelte-1bzqb13"
+        class: Ae("rcb-modal-section") + " svelte-1bzqb13"
       });
     },
     m(o, s) {
@@ -688,13 +695,13 @@ function Ge(t) {
     }
   };
 }
-function Mn(t) {
+function Rn(t) {
   let e = (
     /*as*/
     t[0]
   ), r, n, i = (
     /*as*/
-    t[0] && Ge(t)
+    t[0] && xe(t)
   );
   return {
     c() {
@@ -709,8 +716,8 @@ function Mn(t) {
         e,
         /*as*/
         o[0]
-      ) ? (i.d(1), i = Ge(o), e = /*as*/
-      o[0], i.c(), i.m(r.parentNode, r)) : i.p(o, s) : (i = Ge(o), e = /*as*/
+      ) ? (i.d(1), i = xe(o), e = /*as*/
+      o[0], i.c(), i.m(r.parentNode, r)) : i.p(o, s) : (i = xe(o), e = /*as*/
       o[0], i.c(), i.m(r.parentNode, r)) : e && (i.d(1), i = null, e = /*as*/
       o[0]);
     },
@@ -725,22 +732,22 @@ function Mn(t) {
     }
   };
 }
-function Qn(t, e, r) {
+function Un(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { as: o = "section" } = e;
   return t.$$set = (s) => {
     "as" in s && r(0, o = s.as), "$$scope" in s && r(1, i = s.$$scope);
   }, [o, i, n];
 }
-class ue extends U {
+class ue extends R {
   constructor(e) {
-    super(), N(this, e, Qn, Mn, T, { as: 0 }, Dn);
+    super(), N(this, e, Un, Rn, T, { as: 0 }, Nn);
   }
 }
-function Pn(t) {
+function Sn(t) {
   F(t, "svelte-gf0gr5", ".rcb-pricing-info.svelte-gf0gr5{display:flex;flex-direction:column;margin-top:102px;font-weight:500}.rcb-product-price.svelte-gf0gr5{font-size:24px;margin:12px 0px}.rcb-product-price-after-trial.svelte-gf0gr5{margin-bottom:12px}.rcb-product-details.svelte-gf0gr5{opacity:0.6;list-style-type:disc;list-style-position:inside;margin:0px;padding:0px}@media screen and (max-width: 960px){.rcb-pricing-info.svelte-gf0gr5{margin-top:48px}}");
 }
-function Cn(t) {
-  let e = Wt(
+function On(t) {
+  let e = tn(
     /*trial*/
     t[1].periodDuration
   ) + "", r, n;
@@ -757,7 +764,7 @@ function Cn(t) {
     }
   };
 }
-function Tn(t) {
+function Ln(t) {
   let e = (
     /*basePrice*/
     (t[2].currency || "") + ""
@@ -769,7 +776,7 @@ function Tn(t) {
   ) + "", o;
   return {
     c() {
-      r = L(e), n = C(), o = L(i);
+      r = L(e), n = Q(), o = L(i);
     },
     m(s, l) {
       p(s, r, l), p(s, n, l), p(s, o, l);
@@ -780,7 +787,7 @@ function Tn(t) {
     }
   };
 }
-function Nn(t) {
+function Fn(t) {
   let e;
   return {
     c() {
@@ -803,7 +810,7 @@ function Nn(t) {
     }
   };
 }
-function ct(t) {
+function lt(t) {
   let e, r, n = nt(
     /*productDetails*/
     t[0].normalPeriodDuration
@@ -813,7 +820,7 @@ function ct(t) {
       e = k("li"), r = L("Renews "), i = L(n);
     },
     m(o, s) {
-      p(o, e, s), Q(e, r), Q(e, i);
+      p(o, e, s), M(e, r), M(e, i);
     },
     p(o, s) {
       s & /*productDetails*/
@@ -827,53 +834,53 @@ function ct(t) {
     }
   };
 }
-function Un(t) {
-  var M, ye;
+function xn(t) {
+  var C, ve;
   let e, r, n = (
     /*productDetails*/
     t[0].displayName + ""
-  ), i, o, s, l, c, a, u, m, A, $, E, B = (
+  ), i, o, s, l, c, a, u, m, h, y, E, B = (
     /*trial*/
-    ((M = t[1]) == null ? void 0 : M.periodDuration) && Cn(t)
-  ), h = !/*trial*/
-  ((ye = t[1]) != null && ye.periodDuration) && /*basePrice*/
-  t[2] && Tn(t), y = (
+    ((C = t[1]) == null ? void 0 : C.periodDuration) && On(t)
+  ), A = !/*trial*/
+  ((ve = t[1]) != null && ve.periodDuration) && /*basePrice*/
+  t[2] && Ln(t), $ = (
     /*trial*/
     t[1] && /*basePrice*/
-    t[2] && Nn(t)
-  ), R = (
+    t[2] && Fn(t)
+  ), U = (
     /*productDetails*/
-    t[0].normalPeriodDuration && ct(t)
+    t[0].normalPeriodDuration && lt(t)
   );
   return {
     c() {
-      e = k("div"), r = k("span"), i = L(n), o = C(), s = k("span"), B && B.c(), l = C(), h && h.c(), c = C(), y && y.c(), a = C(), u = k("ul"), R && R.c(), m = C(), A = k("li"), A.textContent = "Continues until canceled", $ = C(), E = k("li"), E.textContent = "Cancel anytime", _(s, "class", "rcb-product-price svelte-gf0gr5"), _(u, "class", "rcb-product-details svelte-gf0gr5"), _(e, "class", "rcb-pricing-info svelte-gf0gr5");
+      e = k("div"), r = k("span"), i = L(n), o = Q(), s = k("span"), B && B.c(), l = Q(), A && A.c(), c = Q(), $ && $.c(), a = Q(), u = k("ul"), U && U.c(), m = Q(), h = k("li"), h.textContent = "Continues until canceled", y = Q(), E = k("li"), E.textContent = "Cancel anytime", _(s, "class", "rcb-product-price svelte-gf0gr5"), _(u, "class", "rcb-product-details svelte-gf0gr5"), _(e, "class", "rcb-pricing-info svelte-gf0gr5");
     },
     m(x, S) {
-      p(x, e, S), Q(e, r), Q(r, i), Q(e, o), Q(e, s), B && B.m(s, null), Q(s, l), h && h.m(s, null), Q(e, c), y && y.m(e, null), Q(e, a), Q(e, u), R && R.m(u, null), Q(u, m), Q(u, A), Q(u, $), Q(u, E);
+      p(x, e, S), M(e, r), M(r, i), M(e, o), M(e, s), B && B.m(s, null), M(s, l), A && A.m(s, null), M(e, c), $ && $.m(e, null), M(e, a), M(e, u), U && U.m(u, null), M(u, m), M(u, h), M(u, y), M(u, E);
     },
     p(x, S) {
-      var Be, De;
+      var $e, Be;
       S & /*productDetails*/
       1 && n !== (n = /*productDetails*/
       x[0].displayName + "") && ae(i, n), /*trial*/
-      (Be = x[1]) != null && Be.periodDuration && B.p(x, S), !/*trial*/
-      ((De = x[1]) != null && De.periodDuration) && /*basePrice*/
-      x[2] && h.p(x, S), /*trial*/
+      ($e = x[1]) != null && $e.periodDuration && B.p(x, S), !/*trial*/
+      ((Be = x[1]) != null && Be.periodDuration) && /*basePrice*/
+      x[2] && A.p(x, S), /*trial*/
       x[1] && /*basePrice*/
-      x[2] && y.p(x, S), /*productDetails*/
-      x[0].normalPeriodDuration ? R ? R.p(x, S) : (R = ct(x), R.c(), R.m(u, m)) : R && (R.d(1), R = null);
+      x[2] && $.p(x, S), /*productDetails*/
+      x[0].normalPeriodDuration ? U ? U.p(x, S) : (U = lt(x), U.c(), U.m(u, m)) : U && (U.d(1), U = null);
     },
     d(x) {
-      x && g(e), B && B.d(), h && h.d(), y && y.d(), R && R.d();
+      x && g(e), B && B.d(), A && A.d(), $ && $.d(), U && U.d();
     }
   };
 }
-function Rn(t) {
+function Yn(t) {
   let e, r;
   return e = new ue({
     props: {
-      $$slots: { default: [Un] },
+      $$slots: { default: [xn] },
       $$scope: { ctx: t }
     }
   }), {
@@ -899,7 +906,7 @@ function Rn(t) {
     }
   };
 }
-function Sn(t, e, r) {
+function Gn(t, e, r) {
   var c;
   let { productDetails: n } = e, { purchaseOption: i } = e;
   const o = i, s = o == null ? void 0 : o.trial, l = (c = o == null ? void 0 : o.base) == null ? void 0 : c.price;
@@ -907,17 +914,17 @@ function Sn(t, e, r) {
     "productDetails" in a && r(0, n = a.productDetails), "purchaseOption" in a && r(3, i = a.purchaseOption);
   }, [n, s, l, i];
 }
-class Ct extends U {
+class Mt extends R {
   constructor(e) {
-    super(), N(this, e, Sn, Rn, T, { productDetails: 0, purchaseOption: 3 }, Pn);
+    super(), N(this, e, Gn, Yn, T, { productDetails: 0, purchaseOption: 3 }, Sn);
   }
 }
-const On = "data:image/gif;base64,R0lGODlhMgAyAPcBAAAAAAD/AAMDAwcHBxERERUVFSoqKi0tLTAwMDg4OD09PURERElJSUtLS1BQUFJSUlVVVVdXV1paWl9fX2NjY2ZmZmlpaWxsbG1tbXNzc3t7e39/f4GBgYKCgoSEhIaGhoeHh4iIiIuLi5KSkpSUlJaWlp2dnaGhoaOjo6SkpKWlpaenp6ioqKqqqqurq6ysrLCwsLGxsbS0tLa2tri4uLm5ub29vb6+vsDAwMHBwcLCwsXFxcjIyMnJyc3Nzc7OztPT09TU1NXV1dfX19nZ2dra2tvb29zc3N7e3uDg4OHh4eLi4uPj4+fn5+np6ezs7O7u7vDw8PHx8fLy8vPz8/X19fb29vj4+Pn5+fz8/P39/f7+/v///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////yH/C05FVFNDQVBFMi4wAwEAAAAh+QQFBAABACwAAAAAMgAyAIcAAAAA/wADAwMHBwcREREVFRUqKiotLS0wMDA4ODg9PT1ERERJSUlLS0tQUFBSUlJVVVVXV1daWlpfX19jY2NmZmZpaWlsbGxtbW1zc3N7e3t/f3+BgYGCgoKEhISGhoaHh4eIiIiLi4uSkpKUlJSWlpadnZ2hoaGjo6OkpKSlpaWnp6eoqKiqqqqrq6usrKywsLCxsbG0tLS2tra4uLi5ubm9vb2+vr7AwMDBwcHCwsLFxcXIyMjJycnNzc3Ozs7T09PU1NTV1dXX19fZ2dna2trb29vc3Nze3t7g4ODh4eHi4uLj4+Pn5+fp6ens7Ozu7u7w8PDx8fHy8vLz8/P19fX29vb4+Pj5+fn8/Pz9/f3+/v7///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////8I/wCzcBFIcKDBgggPKkzIcCEXLlq4bIEokeLEiBcrYrTIcaNHjRobinQ4sqRCkBlTdtR44MBKlR9TmjQJQMBMkgZfdpwSMSYAACgpRtHpcSYSFUIa1mz448UQnAWDfmzSooUVmD9XVnnBwglMlDdvvMjhcOlCHit23CSqcUrVJiizpnTC4sXQmB1vZvmxwgYWhWYLznjRA+rJryqvxGhxxGNLjkVcwMCCN6ZeLkNevDCcRYYKJJfZptyCQwdiijl0CDxdlLPryw2lymY9WzTs17ijVq69mzbM28Bd8x7u23bu46F7i16uXEvw5ziJM5duGbl1k9OLN5cKvfvh7OC3b0jxTv6h+PDUy3unzl67RPXXc56fnz4+/PbofcOHnr9/5f3x4UeffvYVqJuACP5m4IIJ+gfWgusN6KCCAN7WoITVVXjchBxqERAAIfkEBQQAAQAsDQADACAAEAAACKcAAwgcSDDAAwcFEypcSNDAAYYQA2DZstCAAYZOKCqM8uNJxYcKa3DYsVBKECBYFFpU+MTDhiIMkQxBohJkwRYaUkDEEiQIlYQrCyLZ0MFJRCdAkgC1OZBEBxgRJRIBAqXgwYI8NoCwEjWAkyFDoorQ4KOrQCRLoqbQuZCKR7NdqzD5MaQKXIhZmAwBIqTJ3YVYogQZ8oMJ178Kk/A1YhfxQiRHjBYMCAAh+QQFBQABACwNAAMAIAAQAAAInQADCBxIMECGDAUTKlxI8EEEhhADcGEI4QFDJQy5ZJmo0OFCFBFkLNzCRQvHghEgKHQi4cEPhhuzdHyYUMQDDxC5kNSSsGLCIA4x5oxZ0GNBDBFKRAxgkmTBgwVpRJhAZWkAohErPKhhVaLJpR8+YFnohEjXrlB2qHgB5SxELD5etHgBxC1DJC9eqOAxxe5CHSxc0HDilyEOGWYLBgQAIfkEBQQAAQAsGAADABcAFwAACJYAS5AIQLCgwYMINXBAyLDhhg0NtxRpWFBDh4YiDpygGOAhwyUIDOTgqJAhBgMVOHaEeLCHgQMTSV40uKXBAZYcBR5UYSBBFJUNFRhoAbShhZQNi/DYUvRgkxQKmzQlaCVGhw0eakwN4MNDBw0tnmxN8ZAEkq0ET4jYgbat27dw474lMuTHECB1hxBpigRIECBC/AJBEhAAIfkEBQQAAQAsGAADABcAFwAACJIAa9AIQLCgwYMIVbxAyLBhCxYNAwCJSHDFQoYaBIyg6KIFQyQDAMigqJAhBAAMKAZ4iPAGAAETKVpEaECABZUBBB4kAYAAFJwMCwAoAZQhg5QNf4wsajCJhwcRkjANQMVEBAgSVDC9UkNChAcimkz9ADVDkKkEPVRYirat27dw47ad8UKhRYUzitZo8bDjwxoBAQAh+QQFBAABACwYAAMAFwAiAAAIvwCRGAlAsKDBgwh/DEHIsGEQIA0DFIlIEMhChiIOnKAoBCLCJQgM5KCokCEGAxUoBniIsIeBAxMpWkTY4MAGlQEEHlRhIEEUnAwVGGgBlKGFlA1zbCxqkEiFl0SYBojS4YABBCO2MG2RwCqGJFKfGnDQQyrBCgpQaDXLtq3bt3DZkuiggYMGuhxIFC2xoa/fDSXiCh5MuDDBJUSgZGl7ZAiQJFLYbnlCBEiQJFjYXnFiEciTtliSPMzcNspPggEBACH5BAUEAAEALBgAAwAXACIAAAi6ALlsCUCwoMGDCLNwQciwIRctDpU0LKiwIYoIMiYGEMjQiYQHPzRWRCjigQeNGyEeDPIggkSRCw1ywRChBMqNAw3SiDCByk2GFR7U+Mnww4eJMkYQPQiEAQABQJYGgGJBAIABGqSWIGAVghGpTgEcuCGVIIMCSsuqXcu2rdu1NFvKjYCBaAYIEFrifZDhrd+/gAMT1AHjCNsbL1bYYLKWSIwWLXRYUVvlB4sXLISsnYKjBYspbJkgKRgQACH5BAUEAAEALB8ABQAQACgAAAjDAAMIDOBkoMGDAmtw2IEQ4RMPG4o0PNhCQ4qJBpFs6FAQo0ASHWB4FMhjAwgrIwOI0OAjZYAUKbJMzHEiJZEKBg4QwRilwwEDCEZgbJHgJ4YkGHEacNBjZAUFKFxKnUq1qlWBDX5qzdmg4QMDYMMaeHC1rNmzA1WIaJryBAcNJSR61MIjxIYNKqKMnDJj4wYcKZ2cuNuRyRGMQ3xgEUgkyBOXUYAUuZIyCxIgTVxKGQJEZsokQpBWBjJEb2Agj116xhgQACH5BAUFAAEALB8ABQAQACgAAAjFAAMIDBCFy8CDCAP8eDEkYcIqL1g4cYiQx4odFA86YfEiSsaBM170+CiwiAsYWEgGkKECicoAOXRk/CFDZRIPDyIkyUjFRAQIElQYdFhDQoQHIppk/JAzQxCSHirIGPqyqtWrWLEaEACAq1cDDg8AGEsWwIGsaNOqdRiCQo2XHY5m+EEyy4wJECCEmPgxygkIESK0UMmEA4QHTATuuJGxx1uBMFoQeYlkhYwqL2u0oEs4ImaVOlzgeHmFY2KVQFgYqfo5Y0AAIfkEBQQAAQAsGAAFABcAKgAACOUAAwgcSDDAlYIIEw5kMsSJwocCrwgBQgXiQyZAmFhUWAXIkIMbERIZojFkwSdChmQxWfDIjygsCyZJ8rAIj5gDm6TQwKFJTCsxOmzwUIMlFh8eOmho8SRmig0bSCDBGeCEiB1Us2rdyrWryQYHDIQd28DkAwNo0xp44LWt27dtLShYgSUrhbAPsFJVkQDthZIxn3wQe4BEXZxHKKA98pDFiYc2VEAUseHmRiI0CfrQIGLKxokIS2yQsfHHEIRFOGxoCjEIkIQqNjyG6DGhlA0cTj8EndDGhh4QTT98clih662YtwYEACH5BAUEAAEALBgABQAXACoAAAjfAAMIHEgwwJaCCBMOzMIli8KHArdw0cIF4sOGFS0mnMjloEaEDB1+LEhR4siCGE8WlKhFoRMiGVVC2aHiBRSVWHy8aPECiEokL16o4DFFpQ4WLmg4USkQhwwiTKNKnUq16lQMER5k3YphZAYIELSCfZDBqtmzaNMKbFCgxNQFAgAgqCF1BAEAABwkieoEAwABAjZIFbIAr5CHIjp4RBiDBEQKEGZ8nGGjYI0HFKJodNEC4VcTGmsi/BEBAhOLLVgkDBGBg8UVLxI+iRChB0TOClc8oAFRtMLTEFNTpUw1IAAh+QQFBAABACwNAA0AIgAiAAAI5QADCBxIsKDBgwGoPEHIsOHAKkx+DKnisCLBLEyGABHSxKLHKEGG/GBixaPFJBuNUDRpEckRJyxjypxJs6bNmzhvkuiggYMGnhxI5CyxoajRDSVyKl3KtKlTphYUrHhK4YCBBzucqkhgwMAFJk2ffDBw4IDQpkcodD1SEMsSJBUvUGBoQ4VBKECKVFRgwK7HLSFhEiSRlGALAwoWWmQixMiWgkXbPjDgwWIVIj+uGOxpcIdVuA6VAFlyMLLBCwbmNqwiseTmDgeblLXR8EmQjqU3IBxhIIXDlQc5H8QCmqZpp4RrBgQAIfkEBQQAAQAsDQANACIAIgAACOAAAwgcSLCgwYMBuGxByLDhwCxcIGZxSJEgFy0KL1asKDFixI0VL2YEuVEiyZMoU6pcybKly5YzXqh4sULmixkva7RowcLFThY1XgodSrSoUaIhKNSYWLRDhAcZfhidMQEChBBOikY5ASFChBZMhzLhAOEBE4M7cFB0sIBhj6AFjbCIQbEAgBEgs7x4QaQghgwFSwAokLWiDxc0DEaAYPAAgAsVoch8YvBBBIM1BAAYQlFHix0Hyx50AKBtQyczpxy0fFCJAAF0GRJpAQThYoQaAJBwCIUha4ScV4o++ndlQAAh+QQFBAABACwFABgAKgAXAAAI5gADCBxIsKDBgwWJDPkxBMjCIUQQSpxoEAmQIECEXASChKLHjyBDihxJsqTJkyhHbnlSJAlKFSJ6eLyi8McSlCc4aChRBOGVJRmHQMmCUguPEBs2qIhSkElDIky2pBw4ZcaGDhtwDLyCUcmVqQadnEjqZKCTKhJVnPB4gYLEIT5A9tggwqMCAypSXvHQYUfBBg8KtjCg4AnKGBtIaClowIDBBwY8nGziQYNLxgcM7jhgoGPJsSwONj54wYBbkkc0fDBs0EBmg00OHLBBkseGGghHHxxhIEXJJhJdS/QMdqDu4h4BnwwIACH5BAUFAAEALAUAGAAqABcAAAjlAAMIHEiwoMGDBbNwUchwIcKHEA1y2cJFy8SKXCJq3Mixo8ePIEOKHEkSZJEYOUjqgHFE45MZL1TsIHnjxQobTBBW2cHCBQwjJbcQidGihQ4rBX/YfNEjS8mBVX6weMFCyMAoLVjoiPLU4BQcWacMHOIE4ZUQHjSK6PCQCRKnGmk8oKCRAoQZJatIiCCjoAEEBWvM5TrSRIQMBgEASJgBgomRSSQ8GJJYgMEfESDkDOkBgoiDig+GiMAh5I8HEpqAtmzwSYQIPUDKgKACYeiDKx7QCJnkIQDWBrNs7jrwNnGNf0cGBAAh+QQFBAABACwDABgAKgAXAAAI5gCT/BgCZMhAIEkCKFzIsKHDhw2NBAEiBMhEIUYgatzIsaPHjyBDihxJsqTJkygVauEhIsXJJUSgdExCooMGFSePEEwiBeITFhs2gOiR8gkRi0mwNKzxQYMHGFdSKrzipCCQJwudBD3hRGpDLEkmKlW444hGCxU6sjjBBWKUKB9XGFDQUcQGHiinJDiAomGDBw19aBAx5WQHAw6yNDRgwGGJDTJMEkFgwIdDAwccFuGwAStJCgYwPGT8UMWGEyR1GECQ8HJmh1I2cBgy8oSBERBJP7SxgehIIhoxa/TsVaHu4hz/kgwIACH5BAUEAAEALAMAGAAqABcAAAjfAG2oeLHixcAVNgIoXMiwocOHDWm0YOGixUQXNCBq3Mixo8ePIEOKHEmypMmTKBfSoPDhJJctXLRwHIIhwoMQJ7Nw0ZkFohMRDyJMoIHFpZaXMbk0RCHhgYQSVVIq5LlTqUIlEB54UCK1IdKjC2X80NiAQccdNzTq/EgCQIGOMFoQQRmFgIARDTFkaIhkhYyoJi0AOOAwAgSHNVqMLQlkAAAcDoM6ZPKCBeCRCwA8eJj1oQ4XkEfSADDAyEPJDq+weMFk5AgAGiAahgiEhemRQDSiflilZ1eFnX931EsyIAAh+QQFBAABACwDAA0AIgAiAAAI4wADCHwiRaDBgwgTKjyY5ccQJFkWSpxo0AkQIUGaYKHIMWEWJEOAFHHSsaRBKkiABEFi0iSWKEOYtJxJs6bNmzhz6uxYQgMHDR18aiixk8SGo0g3kNjJtKnTp1CjelShwMJTHw0OGLDKdAkGAwYSrGgqAoEBBBumNC0ClkIRqCd0SLRQgSOTIzNXGFDAkUiQJyanJDiAAiEJogejiLxSsoMBBwmPJkzZpCMRsz4S+kwoJWREihQMYFAoOWESIUko6jibWnMHhVmADIky8YSBEQtLJ7QIeCIRiZsXfrap++lhigEBACH5BAUEAAEALAMADQAiACIAAAjgAAMINNJEoMGDCBMqPFhFxYsbVRZKnChQC5AWLlr8uEKxY8IrOV6skDHEo0mDTWq0aIHjpEskL3a4nEmzps2bOHPq9JjhQQSfQDPszADBJ4SiEYTuXMq0qdOnUBOSKMDAKQ4DAgA0YIrkAQAABEgw1TAAwAALUZgC+boAyNMRNCSG8NCRS5aZNB5Q6LiFi5aTVSREkIFwhg2Edu2aNJH078GMCLVw6esxiYQHJRE6TJglcUcPEEQobMFCoeQtFH88kFAw4YoXChPflSgDgoqFkGNLpphE4uaFXHCSjmqYYkAAIfkEBQQAAQAsAwAFABcAKgAACOUAAwgcSDAAloIIEw6M8uOJwocDpQQBchDiQyRDkFh8iCVIECobFToBkqRiSIJYiACBchKhkyFDHmbpQUThFiRLHj7RwMGEw5YDbXTYsEFGFaACpaTgoEHEDqQCj5QgegKqQB8hWFjdyrWr164PDBwQS/bBSQcG0qo14OCr27dw4yZUocACVB8NxtptuQRD2gQrgIpAYADBhilAi6SlUMTqCR0KsaioarXHBhFWr3jo8JQgkSQbY2wggVAIEItNPGgAXfBHTIgnNmhFOBHiEQ0ffhYE8lohjw01FJpG/dA119pbPwcEACH5BAUFAAEALAMABQAXACoAAAjkAAMIHEgwwBQtBRMqFIhEhZCFEAc2adHCSsSIN17kuAhxCsUmHBf+WGEjpMIrMVocMZlwyIsXEWn4gIhDB0QmDyJsYMKS4IoIQE1I6SnwCYgIDyjI2EI0AJAMECB4aCqwxgQRVLNq3cp1KwIAAsCKRWDyAICzaAEc6Mq2rdu3CbXQoPCh6RAMSEP0dCIi5wQaPVFIeCChRJWeSiA88KCEqowfEHfgyGqERQyqWV4SKZiFC0cfLmgwJchlNEQoL1Q8Sdj5oo4WOxRyQQjRiYoXUxS2hkikBZCFpS9Cgbib6mytnQMCACH5BAUEAAEALAMABQAQACgAAAjDAAMIHEgwixOCCBH60IAjoUMiGzpEcZjQRIcUFBE62bDhSEaCMzSU+DiwSogNPUgK3MEhxMAUDR1qOaFCIBIDByYgIZllxAGcHqCQbGLhpwIUKnk8MGCAgsorLRJcUEm1qtWrVpf+3GrggUMHTMMydYC1rNmzaHmIwPgxCYkOGmpSfMKCI4geWSjW+KDBA4wrGTduOHGQ5A6PFJfsVAkFSBGVW4IMKfyRiRAjKqsQ+QGYpBIgSzL/GGJF5ZMgTapWIRgQACH5BAUEAAEALAMABQAQACgAAAjAAAMIHEgwAJOCCAfWeNAiIUIfECI4cVhwQwQQFAkyiQABSMaBJx5k+ChQygQINUgGkBFhwkASMhxm8RBC4BAAAhYMIalhAM4LTz4qcSAAQIERJG0cAACAgcoSBByonEq1qtWMGR5E0Mp1JMIMELRCCBvB69WzaNNO3VIkRo6PT2a8ULGDYpUdLFzAMELxx4sVL3pkoRilBQsdUUgOmZgwC5fBJLlo4RLZMeSMk7dQzmh5c0Yumis/JqlZy9TLAQICACH5BAUEAAEALAMAAwAXACIAAAi+AAMIHEiwoEEkRgwqXPhjyMKBR7IsDALkYQAVBkgsBOLwIQ4DB5goFFLR4oQDFhQ2tBjgyAEDPAxSZBngg4EHVwpypAklgYEVBRHSDIDiQAKLKXA8pJByIRKQE5AMNTji5QEPUKYSbGLhpQIUWgnyeGDAAIWwBFskuIC2rdu3cONaLKGBg4YOdTWUmEpig9+/GzTKHUy4sGGWT4okaXuFyJAfS8JeWQJEyJCsWpkMAUKEyRbJFJXkbOukStuAAAAh+QQFBAABACwDAAMAFwAiAAAItQADCBxIsKDBGjQMKlyo4sXCgUIetmDxMAAJABsWrnD4UAaAAUkUumhRMcACAQ4UNiwpRAAAGwYnlgyAAQACgxtnPiEAoERBhDMDjBBAoCINHw8ZNHjI5EGEDUyCFtSyIoJVE1KkEnwCIsIDCjK0EgSSAQIED2IHYqkxQUTat3Djyp1b0UbDjXdhBqUxcWTfhHQDCx5MuCIXLVy2vOWShTEXsVsOJz6stbHlx1ojI1b8tvHbgAAAIfkEBQQAAQAsAwADABcAFwAACJQAAwgcSLCgwRIkDCpcqIHDwoFHHm7Y8DCACgMJFWroUBGHgQNMFE6sGGDCAQsaHVY8csAAD4MjSX4w8MDgRpIBoCQwsKIgQpwBUBxIULEHkYcUUC580tDEE6AGbXSYKKMKVIJSUnDQIGIHl6sQS0w8AZagjxAsyqpdy7at24pJfgwBMkQukCRQjQQBIgTIXiFGoAYEACH5BAUFAAEALAMAAwAXABcAAAiVAAMIHEiwoMEMGQwqXPggwsKBTLQshPDgYYAaD1owdPjQB4QIThRGgGAxwIYIIBQ2LMlkJBCDFEsGOPEgA5aCK0tKmQChRkGEMgPIiDDhoRYjTR56CPGwiooXN6oENQikhYsWP65MJXglx4sVMoZsJdikRosWOMYSRPJih9q3cOPKnWuRSxa7eO9O3cJFCxe+frdMDQgAIfkEBQUAAQAsBQADACAAEAAACKYAAwgcSLAgwQcODCpcyNDAAYYQAzhpaIDhFYY+NOBY6HAhkyETFRLZ0CGKQgMVDV4RAoQKQxMdUpx8aJAJECYQnWzYcMQgSoNVgAy5CHGGhhI+aRIkMgRnxCohNvQoiLDgEyFDskQUuINDiK1Hfpgc+ETKQi0nVGxNkkSrwCw/hiBxu7XuFidAhARpgqWu3yxIhgApEtLvVipIgARBYthvlKaNFQYEADs=";
-function Ln(t) {
+const Hn = "data:image/gif;base64,R0lGODlhMgAyAPcBAAAAAAD/AAMDAwcHBxERERUVFSoqKi0tLTAwMDg4OD09PURERElJSUtLS1BQUFJSUlVVVVdXV1paWl9fX2NjY2ZmZmlpaWxsbG1tbXNzc3t7e39/f4GBgYKCgoSEhIaGhoeHh4iIiIuLi5KSkpSUlJaWlp2dnaGhoaOjo6SkpKWlpaenp6ioqKqqqqurq6ysrLCwsLGxsbS0tLa2tri4uLm5ub29vb6+vsDAwMHBwcLCwsXFxcjIyMnJyc3Nzc7OztPT09TU1NXV1dfX19nZ2dra2tvb29zc3N7e3uDg4OHh4eLi4uPj4+fn5+np6ezs7O7u7vDw8PHx8fLy8vPz8/X19fb29vj4+Pn5+fz8/P39/f7+/v///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////yH/C05FVFNDQVBFMi4wAwEAAAAh+QQFBAABACwAAAAAMgAyAIcAAAAA/wADAwMHBwcREREVFRUqKiotLS0wMDA4ODg9PT1ERERJSUlLS0tQUFBSUlJVVVVXV1daWlpfX19jY2NmZmZpaWlsbGxtbW1zc3N7e3t/f3+BgYGCgoKEhISGhoaHh4eIiIiLi4uSkpKUlJSWlpadnZ2hoaGjo6OkpKSlpaWnp6eoqKiqqqqrq6usrKywsLCxsbG0tLS2tra4uLi5ubm9vb2+vr7AwMDBwcHCwsLFxcXIyMjJycnNzc3Ozs7T09PU1NTV1dXX19fZ2dna2trb29vc3Nze3t7g4ODh4eHi4uLj4+Pn5+fp6ens7Ozu7u7w8PDx8fHy8vLz8/P19fX29vb4+Pj5+fn8/Pz9/f3+/v7///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////8I/wCzcBFIcKDBgggPKkzIcCEXLlq4bIEokeLEiBcrYrTIcaNHjRobinQ4sqRCkBlTdtR44MBKlR9TmjQJQMBMkgZfdpwSMSYAACgpRtHpcSYSFUIa1mz448UQnAWDfmzSooUVmD9XVnnBwglMlDdvvMjhcOlCHit23CSqcUrVJiizpnTC4sXQmB1vZvmxwgYWhWYLznjRA+rJryqvxGhxxGNLjkVcwMCCN6ZeLkNevDCcRYYKJJfZptyCQwdiijl0CDxdlLPryw2lymY9WzTs17ijVq69mzbM28Bd8x7u23bu46F7i16uXEvw5ziJM5duGbl1k9OLN5cKvfvh7OC3b0jxTv6h+PDUy3unzl67RPXXc56fnz4+/PbofcOHnr9/5f3x4UeffvYVqJuACP5m4IIJ+gfWgusN6KCCAN7WoITVVXjchBxqERAAIfkEBQQAAQAsDQADACAAEAAACKcAAwgcSDDAAwcFEypcSNDAAYYQA2DZstCAAYZOKCqM8uNJxYcKa3DYsVBKECBYFFpU+MTDhiIMkQxBohJkwRYaUkDEEiQIlYQrCyLZ0MFJRCdAkgC1OZBEBxgRJRIBAqXgwYI8NoCwEjWAkyFDoorQ4KOrQCRLoqbQuZCKR7NdqzD5MaQKXIhZmAwBIqTJ3YVYogQZ8oMJ178Kk/A1YhfxQiRHjBYMCAAh+QQFBQABACwNAAMAIAAQAAAInQADCBxIMECGDAUTKlxI8EEEhhADcGEI4QFDJQy5ZJmo0OFCFBFkLNzCRQvHghEgKHQi4cEPhhuzdHyYUMQDDxC5kNSSsGLCIA4x5oxZ0GNBDBFKRAxgkmTBgwVpRJhAZWkAohErPKhhVaLJpR8+YFnohEjXrlB2qHgB5SxELD5etHgBxC1DJC9eqOAxxe5CHSxc0HDilyEOGWYLBgQAIfkEBQQAAQAsGAADABcAFwAACJYAS5AIQLCgwYMINXBAyLDhhg0NtxRpWFBDh4YiDpygGOAhwyUIDOTgqJAhBgMVOHaEeLCHgQMTSV40uKXBAZYcBR5UYSBBFJUNFRhoAbShhZQNi/DYUvRgkxQKmzQlaCVGhw0eakwN4MNDBw0tnmxN8ZAEkq0ET4jYgbat27dw474lMuTHECB1hxBpigRIECBC/AJBEhAAIfkEBQQAAQAsGAADABcAFwAACJIAa9AIQLCgwYMIVbxAyLBhCxYNAwCJSHDFQoYaBIyg6KIFQyQDAMigqJAhBAAMKAZ4iPAGAAETKVpEaECABZUBBB4kAYAAFJwMCwAoAZQhg5QNf4wsajCJhwcRkjANQMVEBAgSVDC9UkNChAcimkz9ADVDkKkEPVRYirat27dw47ad8UKhRYUzitZo8bDjwxoBAQAh+QQFBAABACwYAAMAFwAiAAAIvwCRGAlAsKDBgwh/DEHIsGEQIA0DFIlIEMhChiIOnKAoBCLCJQgM5KCokCEGAxUoBniIsIeBAxMpWkTY4MAGlQEEHlRhIEEUnAwVGGgBlKGFlA1zbCxqkEiFl0SYBojS4YABBCO2MG2RwCqGJFKfGnDQQyrBCgpQaDXLtq3bt3DZkuiggYMGuhxIFC2xoa/fDSXiCh5MuDDBJUSgZGl7ZAiQJFLYbnlCBEiQJFjYXnFiEciTtliSPMzcNspPggEBACH5BAUEAAEALBgAAwAXACIAAAi6ALlsCUCwoMGDCLNwQciwIRctDpU0LKiwIYoIMiYGEMjQiYQHPzRWRCjigQeNGyEeDPIggkSRCw1ywRChBMqNAw3SiDCByk2GFR7U+Mnww4eJMkYQPQiEAQABQJYGgGJBAIABGqSWIGAVghGpTgEcuCGVIIMCSsuqXcu2rdu1NFvKjYCBaAYIEFrifZDhrd+/gAMT1AHjCNsbL1bYYLKWSIwWLXRYUVvlB4sXLISsnYKjBYspbJkgKRgQACH5BAUEAAEALB8ABQAQACgAAAjDAAMIDOBkoMGDAmtw2IEQ4RMPG4o0PNhCQ4qJBpFs6FAQo0ASHWB4FMhjAwgrIwOI0OAjZYAUKbJMzHEiJZEKBg4QwRilwwEDCEZgbJHgJ4YkGHEacNBjZAUFKFxKnUq1qlWBDX5qzdmg4QMDYMMaeHC1rNmzA1WIaJryBAcNJSR61MIjxIYNKqKMnDJj4wYcKZ2cuNuRyRGMQ3xgEUgkyBOXUYAUuZIyCxIgTVxKGQJEZsokQpBWBjJEb2Agj116xhgQACH5BAUFAAEALB8ABQAQACgAAAjFAAMIDBCFy8CDCAP8eDEkYcIqL1g4cYiQx4odFA86YfEiSsaBM170+CiwiAsYWEgGkKECicoAOXRk/CFDZRIPDyIkyUjFRAQIElQYdFhDQoQHIppk/JAzQxCSHirIGPqyqtWrWLEaEACAq1cDDg8AGEsWwIGsaNOqdRiCQo2XHY5m+EEyy4wJECCEmPgxygkIESK0UMmEA4QHTATuuJGxx1uBMFoQeYlkhYwqL2u0oEs4ImaVOlzgeHmFY2KVQFgYqfo5Y0AAIfkEBQQAAQAsGAAFABcAKgAACOUAAwgcSDDAlYIIEw5kMsSJwocCrwgBQgXiQyZAmFhUWAXIkIMbERIZojFkwSdChmQxWfDIjygsCyZJ8rAIj5gDm6TQwKFJTCsxOmzwUIMlFh8eOmho8SRmig0bSCDBGeCEiB1Us2rdyrWryQYHDIQd28DkAwNo0xp44LWt27dtLShYgSUrhbAPsFJVkQDthZIxn3wQe4BEXZxHKKA98pDFiYc2VEAUseHmRiI0CfrQIGLKxokIS2yQsfHHEIRFOGxoCjEIkIQqNjyG6DGhlA0cTj8EndDGhh4QTT98clih662YtwYEACH5BAUEAAEALBgABQAXACoAAAjfAAMIHEgwwJaCCBMOzMIli8KHArdw0cIF4sOGFS0mnMjloEaEDB1+LEhR4siCGE8WlKhFoRMiGVVC2aHiBRSVWHy8aPECiEokL16o4DFFpQ4WLmg4USkQhwwiTKNKnUq16lQMER5k3YphZAYIELSCfZDBqtmzaNMKbFCgxNQFAgAgqCF1BAEAABwkieoEAwABAjZIFbIAr5CHIjp4RBiDBEQKEGZ8nGGjYI0HFKJodNEC4VcTGmsi/BEBAhOLLVgkDBGBg8UVLxI+iRChB0TOClc8oAFRtMLTEFNTpUw1IAAh+QQFBAABACwNAA0AIgAiAAAI5QADCBxIsKDBgwGoPEHIsOHAKkx+DKnisCLBLEyGABHSxKLHKEGG/GBixaPFJBuNUDRpEckRJyxjypxJs6bNmzhvkuiggYMGnhxI5CyxoajRDSVyKl3KtKlTphYUrHhK4YCBBzucqkhgwMAFJk2ffDBw4IDQpkcodD1SEMsSJBUvUGBoQ4VBKECKVFRgwK7HLSFhEiSRlGALAwoWWmQixMiWgkXbPjDgwWIVIj+uGOxpcIdVuA6VAFlyMLLBCwbmNqwiseTmDgeblLXR8EmQjqU3IBxhIIXDlQc5H8QCmqZpp4RrBgQAIfkEBQQAAQAsDQANACIAIgAACOAAAwgcSLCgwYMBuGxByLDhwCxcIGZxSJEgFy0KL1asKDFixI0VL2YEuVEiyZMoU6pcybKly5YzXqh4sULmixkva7RowcLFThY1XgodSrSoUaIhKNSYWLRDhAcZfhidMQEChBBOikY5ASFChBZMhzLhAOEBE4M7cFB0sIBhj6AFjbCIQbEAgBEgs7x4QaQghgwFSwAokLWiDxc0DEaAYPAAgAsVoch8YvBBBIM1BAAYQlFHix0Hyx50AKBtQyczpxy0fFCJAAF0GRJpAQThYoQaAJBwCIUha4ScV4o++ndlQAAh+QQFBAABACwFABgAKgAXAAAI5gADCBxIsKDBgwWJDPkxBMjCIUQQSpxoEAmQIECEXASChKLHjyBDihxJsqTJkyhHbnlSJAlKFSJ6eLyi8McSlCc4aChRBOGVJRmHQMmCUguPEBs2qIhSkElDIky2pBw4ZcaGDhtwDLyCUcmVqQadnEjqZKCTKhJVnPB4gYLEIT5A9tggwqMCAypSXvHQYUfBBg8KtjCg4AnKGBtIaClowIDBBwY8nGziQYNLxgcM7jhgoGPJsSwONj54wYBbkkc0fDBs0EBmg00OHLBBkseGGghHHxxhIEXJJhJdS/QMdqDu4h4BnwwIACH5BAUFAAEALAUAGAAqABcAAAjlAAMIHEiwoMGDBbNwUchwIcKHEA1y2cJFy8SKXCJq3Mixo8ePIEOKHEkSZJEYOUjqgHFE45MZL1TsIHnjxQobTBBW2cHCBQwjJbcQidGihQ4rBX/YfNEjS8mBVX6weMFCyMAoLVjoiPLU4BQcWacMHOIE4ZUQHjSK6PCQCRKnGmk8oKCRAoQZJatIiCCjoAEEBWvM5TrSRIQMBgEASJgBgomRSSQ8GJJYgMEfESDkDOkBgoiDig+GiMAh5I8HEpqAtmzwSYQIPUDKgKACYeiDKx7QCJnkIQDWBrNs7jrwNnGNf0cGBAAh+QQFBAABACwDABgAKgAXAAAI5gCT/BgCZMhAIEkCKFzIsKHDhw2NBAEiBMhEIUYgatzIsaPHjyBDihxJsqTJkygVauEhIsXJJUSgdExCooMGFSePEEwiBeITFhs2gOiR8gkRi0mwNKzxQYMHGFdSKrzipCCQJwudBD3hRGpDLEkmKlW444hGCxU6sjjBBWKUKB9XGFDQUcQGHiinJDiAomGDBw19aBAx5WQHAw6yNDRgwGGJDTJMEkFgwIdDAwccFuGwAStJCgYwPGT8UMWGEyR1GECQ8HJmh1I2cBgy8oSBERBJP7SxgehIIhoxa/TsVaHu4hz/kgwIACH5BAUEAAEALAMAGAAqABcAAAjfAG2oeLHixcAVNgIoXMiwocOHDWm0YOGixUQXNCBq3Mixo8ePIEOKHEmypMmTKBfSoPDhJJctXLRwHIIhwoMQJ7Nw0ZkFohMRDyJMoIHFpZaXMbk0RCHhgYQSVVIq5LlTqUIlEB54UCK1IdKjC2X80NiAQccdNzTq/EgCQIGOMFoQQRmFgIARDTFkaIhkhYyoJi0AOOAwAgSHNVqMLQlkAAAcDoM6ZPKCBeCRCwA8eJj1oQ4XkEfSADDAyEPJDq+weMFk5AgAGiAahgiEhemRQDSiflilZ1eFnX931EsyIAAh+QQFBAABACwDAA0AIgAiAAAI4wADCHwiRaDBgwgTKjyY5ccQJFkWSpxo0AkQIUGaYKHIMWEWJEOAFHHSsaRBKkiABEFi0iSWKEOYtJxJs6bNmzhz6uxYQgMHDR18aiixk8SGo0g3kNjJtKnTp1CjelShwMJTHw0OGLDKdAkGAwYSrGgqAoEBBBumNC0ClkIRqCd0SLRQgSOTIzNXGFDAkUiQJyanJDiAAiEJogejiLxSsoMBBwmPJkzZpCMRsz4S+kwoJWREihQMYFAoOWESIUko6jibWnMHhVmADIky8YSBEQtLJ7QIeCIRiZsXfrap++lhigEBACH5BAUEAAEALAMADQAiACIAAAjgAAMINNJEoMGDCBMqPFhFxYsbVRZKnChQC5AWLlr8uEKxY8IrOV6skDHEo0mDTWq0aIHjpEskL3a4nEmzps2bOHPq9JjhQQSfQDPszADBJ4SiEYTuXMq0qdOnUBOSKMDAKQ4DAgA0YIrkAQAABEgw1TAAwAALUZgC+boAyNMRNCSG8NCRS5aZNB5Q6LiFi5aTVSREkIFwhg2Edu2aNJH078GMCLVw6esxiYQHJRE6TJglcUcPEEQobMFCoeQtFH88kFAw4YoXChPflSgDgoqFkGNLpphE4uaFXHCSjmqYYkAAIfkEBQQAAQAsAwAFABcAKgAACOUAAwgcSDAAloIIEw6M8uOJwocDpQQBchDiQyRDkFh8iCVIECobFToBkqRiSIJYiACBchKhkyFDHmbpQUThFiRLHj7RwMGEw5YDbXTYsEFGFaACpaTgoEHEDqQCj5QgegKqQB8hWFjdyrWr164PDBwQS/bBSQcG0qo14OCr27dw4yZUocACVB8NxtptuQRD2gQrgIpAYADBhilAi6SlUMTqCR0KsaioarXHBhFWr3jo8JQgkSQbY2wggVAIEItNPGgAXfBHTIgnNmhFOBHiEQ0ffhYE8lohjw01FJpG/dA119pbPwcEACH5BAUFAAEALAMABQAXACoAAAjkAAMIHEgwwBQtBRMqFIhEhZCFEAc2adHCSsSIN17kuAhxCsUmHBf+WGEjpMIrMVocMZlwyIsXEWn4gIhDB0QmDyJsYMKS4IoIQE1I6SnwCYgIDyjI2EI0AJAMECB4aCqwxgQRVLNq3cp1KwIAAsCKRWDyAICzaAEc6Mq2rdu3CbXQoPCh6RAMSEP0dCIi5wQaPVFIeCChRJWeSiA88KCEqowfEHfgyGqERQyqWV4SKZiFC0cfLmgwJchlNEQoL1Q8Sdj5oo4WOxRyQQjRiYoXUxS2hkikBZCFpS9Cgbib6mytnQMCACH5BAUEAAEALAMABQAQACgAAAjDAAMIHEgwixOCCBH60IAjoUMiGzpEcZjQRIcUFBE62bDhSEaCMzSU+DiwSogNPUgK3MEhxMAUDR1qOaFCIBIDByYgIZllxAGcHqCQbGLhpwIUKnk8MGCAgsorLRJcUEm1qtWrVpf+3GrggUMHTMMydYC1rNmzaHmIwPgxCYkOGmpSfMKCI4geWSjW+KDBA4wrGTduOHGQ5A6PFJfsVAkFSBGVW4IMKfyRiRAjKqsQ+QGYpBIgSzL/GGJF5ZMgTapWIRgQACH5BAUEAAEALAMABQAQACgAAAjAAAMIHEgwAJOCCAfWeNAiIUIfECI4cVhwQwQQFAkyiQABSMaBJx5k+ChQygQINUgGkBFhwkASMhxm8RBC4BAAAhYMIalhAM4LTz4qcSAAQIERJG0cAACAgcoSBByonEq1qtWMGR5E0Mp1JMIMELRCCBvB69WzaNNO3VIkRo6PT2a8ULGDYpUdLFzAMELxx4sVL3pkoRilBQsdUUgOmZgwC5fBJLlo4RLZMeSMk7dQzmh5c0Yumis/JqlZy9TLAQICACH5BAUEAAEALAMAAwAXACIAAAi+AAMIHEiwoEEkRgwqXPhjyMKBR7IsDALkYQAVBkgsBOLwIQ4DB5goFFLR4oQDFhQ2tBjgyAEDPAxSZBngg4EHVwpypAklgYEVBRHSDIDiQAKLKXA8pJByIRKQE5AMNTji5QEPUKYSbGLhpQIUWgnyeGDAAIWwBFskuIC2rdu3cONaLKGBg4YOdTWUmEpig9+/GzTKHUy4sGGWT4okaXuFyJAfS8JeWQJEyJCsWpkMAUKEyRbJFJXkbOukStuAAAAh+QQFBAABACwDAAMAFwAiAAAItQADCBxIsKDBGjQMKlyo4sXCgUIetmDxMAAJABsWrnD4UAaAAUkUumhRMcACAQ4UNiwpRAAAGwYnlgyAAQACgxtnPiEAoERBhDMDjBBAoCINHw8ZNHjI5EGEDUyCFtSyIoJVE1KkEnwCIsIDCjK0EgSSAQIED2IHYqkxQUTat3Djyp1b0UbDjXdhBqUxcWTfhHQDCx5MuCIXLVy2vOWShTEXsVsOJz6stbHlx1ojI1b8tvHbgAAAIfkEBQQAAQAsAwADABcAFwAACJQAAwgcSLCgwRIkDCpcqIHDwoFHHm7Y8DCACgMJFWroUBGHgQNMFE6sGGDCAQsaHVY8csAAD4MjSX4w8MDgRpIBoCQwsKIgQpwBUBxIULEHkYcUUC580tDEE6AGbXSYKKMKVIJSUnDQIGIHl6sQS0w8AZagjxAsyqpdy7at24pJfgwBMkQukCRQjQQBIgTIXiFGoAYEACH5BAUFAAEALAMAAwAXABcAAAiVAAMIHEiwoMEMGQwqXPggwsKBTLQshPDgYYAaD1owdPjQB4QIThRGgGAxwIYIIBQ2LMlkJBCDFEsGOPEgA5aCK0tKmQChRkGEMgPIiDDhoRYjTR56CPGwiooXN6oENQikhYsWP65MJXglx4sVMoZsJdikRosWOMYSRPJih9q3cOPKnWuRSxa7eO9O3cJFCxe+frdMDQgAIfkEBQUAAQAsBQADACAAEAAACKYAAwgcSLAgwQcODCpcyNDAAYYQAzhpaIDhFYY+NOBY6HAhkyETFRLZ0CGKQgMVDV4RAoQKQxMdUpx8aJAJECYQnWzYcMQgSoNVgAy5CHGGhhI+aRIkMgRnxCohNvQoiLDgEyFDskQUuINDiK1Hfpgc+ETKQi0nVGxNkkSrwCw/hiBxu7XuFidAhARpgqWu3yxIhgApEtLvVipIgARBYthvlKaNFQYEADs=";
+function Kn(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), ee(e.src, r = On) || _(e, "src", r), _(e, "alt", "spinner");
+      e = k("img"), ee(e.src, r = Hn) || _(e, "src", r), _(e, "alt", "spinner");
     },
     m(n, i) {
       p(n, e, i);
@@ -930,17 +937,17 @@ function Ln(t) {
     }
   };
 }
-class Fn extends U {
+class qn extends R {
   constructor(e) {
-    super(), N(this, e, null, Ln, T, {});
+    super(), N(this, e, null, Kn, T, {});
   }
 }
-function xn(t) {
+function jn(t) {
   F(t, "svelte-1mxx341", ".rcb-modal-loader.svelte-1mxx341{width:100%;flex-grow:1;min-height:100%;display:flex;justify-content:center;align-items:center}");
 }
-function Gn(t) {
+function Jn(t) {
   let e, r, n;
-  return r = new Fn({}), {
+  return r = new qn({}), {
     c() {
       e = k("div"), w(r.$$.fragment), _(e, "class", "rcb-modal-loader svelte-1mxx341");
     },
@@ -959,12 +966,12 @@ function Gn(t) {
     }
   };
 }
-class We extends U {
+class We extends R {
   constructor(e) {
-    super(), N(this, e, null, Gn, T, {}, xn);
+    super(), N(this, e, null, Jn, T, {}, jn);
   }
 }
-var Z = /* @__PURE__ */ ((t) => (t[t.UnknownError = 0] = "UnknownError", t[t.UserCancelledError = 1] = "UserCancelledError", t[t.StoreProblemError = 2] = "StoreProblemError", t[t.PurchaseNotAllowedError = 3] = "PurchaseNotAllowedError", t[t.PurchaseInvalidError = 4] = "PurchaseInvalidError", t[t.ProductNotAvailableForPurchaseError = 5] = "ProductNotAvailableForPurchaseError", t[t.ProductAlreadyPurchasedError = 6] = "ProductAlreadyPurchasedError", t[t.ReceiptAlreadyInUseError = 7] = "ReceiptAlreadyInUseError", t[t.InvalidReceiptError = 8] = "InvalidReceiptError", t[t.MissingReceiptFileError = 9] = "MissingReceiptFileError", t[t.NetworkError = 10] = "NetworkError", t[t.InvalidCredentialsError = 11] = "InvalidCredentialsError", t[t.UnexpectedBackendResponseError = 12] = "UnexpectedBackendResponseError", t[t.InvalidAppUserIdError = 14] = "InvalidAppUserIdError", t[t.OperationAlreadyInProgressError = 15] = "OperationAlreadyInProgressError", t[t.UnknownBackendError = 16] = "UnknownBackendError", t[t.InvalidAppleSubscriptionKeyError = 17] = "InvalidAppleSubscriptionKeyError", t[t.IneligibleError = 18] = "IneligibleError", t[t.InsufficientPermissionsError = 19] = "InsufficientPermissionsError", t[t.PaymentPendingError = 20] = "PaymentPendingError", t[t.InvalidSubscriberAttributesError = 21] = "InvalidSubscriberAttributesError", t[t.LogOutWithAnonymousUserError = 22] = "LogOutWithAnonymousUserError", t[t.ConfigurationError = 23] = "ConfigurationError", t[t.UnsupportedError = 24] = "UnsupportedError", t[t.EmptySubscriberAttributesError = 25] = "EmptySubscriberAttributesError", t[t.CustomerInfoError = 28] = "CustomerInfoError", t[t.SignatureVerificationError = 36] = "SignatureVerificationError", t[t.InvalidEmailError = 38] = "InvalidEmailError", t))(Z || {});
+var X = /* @__PURE__ */ ((t) => (t[t.UnknownError = 0] = "UnknownError", t[t.UserCancelledError = 1] = "UserCancelledError", t[t.StoreProblemError = 2] = "StoreProblemError", t[t.PurchaseNotAllowedError = 3] = "PurchaseNotAllowedError", t[t.PurchaseInvalidError = 4] = "PurchaseInvalidError", t[t.ProductNotAvailableForPurchaseError = 5] = "ProductNotAvailableForPurchaseError", t[t.ProductAlreadyPurchasedError = 6] = "ProductAlreadyPurchasedError", t[t.ReceiptAlreadyInUseError = 7] = "ReceiptAlreadyInUseError", t[t.InvalidReceiptError = 8] = "InvalidReceiptError", t[t.MissingReceiptFileError = 9] = "MissingReceiptFileError", t[t.NetworkError = 10] = "NetworkError", t[t.InvalidCredentialsError = 11] = "InvalidCredentialsError", t[t.UnexpectedBackendResponseError = 12] = "UnexpectedBackendResponseError", t[t.InvalidAppUserIdError = 14] = "InvalidAppUserIdError", t[t.OperationAlreadyInProgressError = 15] = "OperationAlreadyInProgressError", t[t.UnknownBackendError = 16] = "UnknownBackendError", t[t.InvalidAppleSubscriptionKeyError = 17] = "InvalidAppleSubscriptionKeyError", t[t.IneligibleError = 18] = "IneligibleError", t[t.InsufficientPermissionsError = 19] = "InsufficientPermissionsError", t[t.PaymentPendingError = 20] = "PaymentPendingError", t[t.InvalidSubscriberAttributesError = 21] = "InvalidSubscriberAttributesError", t[t.LogOutWithAnonymousUserError = 22] = "LogOutWithAnonymousUserError", t[t.ConfigurationError = 23] = "ConfigurationError", t[t.UnsupportedError = 24] = "UnsupportedError", t[t.EmptySubscriberAttributesError = 25] = "EmptySubscriberAttributesError", t[t.CustomerInfoError = 28] = "CustomerInfoError", t[t.SignatureVerificationError = 36] = "SignatureVerificationError", t[t.InvalidEmailError = 38] = "InvalidEmailError", t))(X || {});
 class he {
   static getPublicMessage(e) {
     switch (e) {
@@ -1071,7 +1078,7 @@ class he {
     }
   }
   static convertCodeToBackendErrorCode(e) {
-    return e in Tt ? e : null;
+    return e in Qt ? e : null;
   }
   static convertPurchaseFlowErrorCodeToErrorCode(e) {
     switch (e) {
@@ -1092,17 +1099,17 @@ class he {
     }
   }
 }
-var Tt = /* @__PURE__ */ ((t) => (t[t.BackendInvalidPlatform = 7e3] = "BackendInvalidPlatform", t[t.BackendInvalidEmail = 7012] = "BackendInvalidEmail", t[t.BackendStoreProblem = 7101] = "BackendStoreProblem", t[t.BackendCannotTransferPurchase = 7102] = "BackendCannotTransferPurchase", t[t.BackendInvalidReceiptToken = 7103] = "BackendInvalidReceiptToken", t[t.BackendInvalidAppStoreSharedSecret = 7104] = "BackendInvalidAppStoreSharedSecret", t[t.BackendInvalidPaymentModeOrIntroPriceNotProvided = 7105] = "BackendInvalidPaymentModeOrIntroPriceNotProvided", t[t.BackendProductIdForGoogleReceiptNotProvided = 7106] = "BackendProductIdForGoogleReceiptNotProvided", t[t.BackendInvalidPlayStoreCredentials = 7107] = "BackendInvalidPlayStoreCredentials", t[t.BackendInternalServerError = 7110] = "BackendInternalServerError", t[t.BackendEmptyAppUserId = 7220] = "BackendEmptyAppUserId", t[t.BackendInvalidAuthToken = 7224] = "BackendInvalidAuthToken", t[t.BackendInvalidAPIKey = 7225] = "BackendInvalidAPIKey", t[t.BackendBadRequest = 7226] = "BackendBadRequest", t[t.BackendPlayStoreQuotaExceeded = 7229] = "BackendPlayStoreQuotaExceeded", t[t.BackendPlayStoreInvalidPackageName = 7230] = "BackendPlayStoreInvalidPackageName", t[t.BackendPlayStoreGenericError = 7231] = "BackendPlayStoreGenericError", t[t.BackendUserIneligibleForPromoOffer = 7232] = "BackendUserIneligibleForPromoOffer", t[t.BackendInvalidAppleSubscriptionKey = 7234] = "BackendInvalidAppleSubscriptionKey", t[t.BackendInvalidSubscriberAttributes = 7263] = "BackendInvalidSubscriberAttributes", t[t.BackendInvalidSubscriberAttributesBody = 7264] = "BackendInvalidSubscriberAttributesBody", t[t.BackendProductIDsMalformed = 7662] = "BackendProductIDsMalformed", t[t.BackendAlreadySubscribedError = 7772] = "BackendAlreadySubscribedError", t[t.BackendOfferNotFound = 7814] = "BackendOfferNotFound", t[t.BackendNoMXRecordsFound = 7834] = "BackendNoMXRecordsFound", t))(Tt || {});
-class X extends Error {
+var Qt = /* @__PURE__ */ ((t) => (t[t.BackendInvalidPlatform = 7e3] = "BackendInvalidPlatform", t[t.BackendInvalidEmail = 7012] = "BackendInvalidEmail", t[t.BackendStoreProblem = 7101] = "BackendStoreProblem", t[t.BackendCannotTransferPurchase = 7102] = "BackendCannotTransferPurchase", t[t.BackendInvalidReceiptToken = 7103] = "BackendInvalidReceiptToken", t[t.BackendInvalidAppStoreSharedSecret = 7104] = "BackendInvalidAppStoreSharedSecret", t[t.BackendInvalidPaymentModeOrIntroPriceNotProvided = 7105] = "BackendInvalidPaymentModeOrIntroPriceNotProvided", t[t.BackendProductIdForGoogleReceiptNotProvided = 7106] = "BackendProductIdForGoogleReceiptNotProvided", t[t.BackendInvalidPlayStoreCredentials = 7107] = "BackendInvalidPlayStoreCredentials", t[t.BackendInternalServerError = 7110] = "BackendInternalServerError", t[t.BackendEmptyAppUserId = 7220] = "BackendEmptyAppUserId", t[t.BackendInvalidAuthToken = 7224] = "BackendInvalidAuthToken", t[t.BackendInvalidAPIKey = 7225] = "BackendInvalidAPIKey", t[t.BackendBadRequest = 7226] = "BackendBadRequest", t[t.BackendPlayStoreQuotaExceeded = 7229] = "BackendPlayStoreQuotaExceeded", t[t.BackendPlayStoreInvalidPackageName = 7230] = "BackendPlayStoreInvalidPackageName", t[t.BackendPlayStoreGenericError = 7231] = "BackendPlayStoreGenericError", t[t.BackendUserIneligibleForPromoOffer = 7232] = "BackendUserIneligibleForPromoOffer", t[t.BackendInvalidAppleSubscriptionKey = 7234] = "BackendInvalidAppleSubscriptionKey", t[t.BackendInvalidSubscriberAttributes = 7263] = "BackendInvalidSubscriberAttributes", t[t.BackendInvalidSubscriberAttributesBody = 7264] = "BackendInvalidSubscriberAttributesBody", t[t.BackendProductIDsMalformed = 7662] = "BackendProductIDsMalformed", t[t.BackendAlreadySubscribedError = 7772] = "BackendAlreadySubscribedError", t[t.BackendOfferNotFound = 7814] = "BackendOfferNotFound", t[t.BackendNoMXRecordsFound = 7834] = "BackendNoMXRecordsFound", t))(Qt || {});
+class W extends Error {
   constructor(r, n, i) {
     super(n);
-    P(this, "toString", () => `PurchasesError(code: ${Z[this.errorCode]}, message: ${this.message})`);
+    P(this, "toString", () => `PurchasesError(code: ${X[this.errorCode]}, message: ${this.message})`);
     this.errorCode = r, this.underlyingErrorMessage = i;
   }
   /** @internal */
   static getForBackendError(r, n) {
     const i = he.getErrorCodeForBackendErrorCode(r);
-    return new X(
+    return new W(
       i,
       he.getPublicMessage(i),
       n
@@ -1110,7 +1117,7 @@ class X extends Error {
   }
   /** @internal */
   static getForPurchasesFlowError(r) {
-    return new X(
+    return new W(
       he.convertPurchaseFlowErrorCodeToErrorCode(
         r.errorCode
       ),
@@ -1119,26 +1126,26 @@ class X extends Error {
     );
   }
 }
-class Yn extends Error {
+class Vn extends Error {
   constructor() {
     super("Purchases must be configured before calling getInstance");
   }
 }
-var pe = /* @__PURE__ */ ((t) => (t.Started = "started", t.InProgress = "in_progress", t.Succeeded = "succeeded", t.Failed = "failed", t))(pe || {}), Ne = /* @__PURE__ */ ((t) => (t[t.SetupIntentCreationFailed = 1] = "SetupIntentCreationFailed", t[t.PaymentMethodCreationFailed = 2] = "PaymentMethodCreationFailed", t[t.PaymentChargeFailed = 3] = "PaymentChargeFailed", t))(Ne || {}), O = /* @__PURE__ */ ((t) => (t[t.ErrorSettingUpPurchase = 0] = "ErrorSettingUpPurchase", t[t.ErrorChargingPayment = 1] = "ErrorChargingPayment", t[t.UnknownError = 2] = "UnknownError", t[t.NetworkError = 3] = "NetworkError", t[t.StripeError = 4] = "StripeError", t[t.MissingEmailError = 5] = "MissingEmailError", t[t.AlreadySubscribedError = 6] = "AlreadySubscribedError", t))(O || {});
-class Y extends Error {
+var ge = /* @__PURE__ */ ((t) => (t.Started = "started", t.InProgress = "in_progress", t.Succeeded = "succeeded", t.Failed = "failed", t))(ge || {}), Te = /* @__PURE__ */ ((t) => (t[t.SetupIntentCreationFailed = 1] = "SetupIntentCreationFailed", t[t.PaymentMethodCreationFailed = 2] = "PaymentMethodCreationFailed", t[t.PaymentChargeFailed = 3] = "PaymentChargeFailed", t))(Te || {}), O = /* @__PURE__ */ ((t) => (t[t.ErrorSettingUpPurchase = 0] = "ErrorSettingUpPurchase", t[t.ErrorChargingPayment = 1] = "ErrorChargingPayment", t[t.UnknownError = 2] = "UnknownError", t[t.NetworkError = 3] = "NetworkError", t[t.StripeError = 4] = "StripeError", t[t.MissingEmailError = 5] = "MissingEmailError", t[t.AlreadySubscribedError = 6] = "AlreadySubscribedError", t))(O || {});
+class G extends Error {
   constructor(e, r, n) {
     super(r), this.errorCode = e, this.underlyingErrorMessage = n;
   }
   static fromPurchasesError(e, r) {
     let n;
-    return e.errorCode === Z.ProductAlreadyPurchasedError ? n = 6 : e.errorCode === Z.InvalidEmailError ? n = 5 : n = r, new Y(
+    return e.errorCode === X.ProductAlreadyPurchasedError ? n = 6 : e.errorCode === X.InvalidEmailError ? n = 5 : n = r, new G(
       n,
       e.message,
       e.underlyingErrorMessage
     );
   }
 }
-class Hn {
+class Wn {
   constructor(e, r = 10) {
     P(this, "operationSessionId", null);
     P(this, "backend");
@@ -1157,15 +1164,15 @@ class Hn {
       );
       return this.operationSessionId = s.operation_session_id, s;
     } catch (s) {
-      if (s instanceof X)
-        throw Y.fromPurchasesError(
+      if (s instanceof W)
+        throw G.fromPurchasesError(
           s,
           0
           /* ErrorSettingUpPurchase */
         );
       {
         const l = "Unknown error starting purchase: " + String(s);
-        throw G.errorLog(l), new Y(
+        throw Y.errorLog(l), new G(
           2,
           l
         );
@@ -1175,7 +1182,7 @@ class Hn {
   async pollCurrentPurchaseForCompletion() {
     const e = this.operationSessionId;
     if (!e)
-      throw new Y(
+      throw new G(
         0,
         "No purchase in progress"
       );
@@ -1183,7 +1190,7 @@ class Hn {
       const i = (o = 1) => {
         if (o > this.maxNumberAttempts) {
           this.clearPurchaseInProgress(), n(
-            new Y(
+            new G(
               2,
               "Max attempts reached trying to get successful purchase status"
             )
@@ -1192,24 +1199,24 @@ class Hn {
         }
         this.backend.getCheckoutStatus(e).then((s) => {
           switch (s.operation.status) {
-            case pe.Started:
-            case pe.InProgress:
+            case ge.Started:
+            case ge.InProgress:
               setTimeout(
                 () => i(o + 1),
                 this.waitMSBetweenAttempts
               );
               break;
-            case pe.Succeeded:
+            case ge.Succeeded:
               this.clearPurchaseInProgress(), r();
               return;
-            case pe.Failed:
+            case ge.Failed:
               this.clearPurchaseInProgress(), this.handlePaymentError(
                 s.operation.error,
                 n
               );
           }
         }).catch((s) => {
-          const l = Y.fromPurchasesError(
+          const l = G.fromPurchasesError(
             s,
             3
             /* NetworkError */
@@ -1226,7 +1233,7 @@ class Hn {
   handlePaymentError(e, r) {
     if (e == null) {
       r(
-        new Y(
+        new G(
           2,
           "Got an error status but error field is empty."
         )
@@ -1234,25 +1241,25 @@ class Hn {
       return;
     }
     switch (e.code) {
-      case Ne.SetupIntentCreationFailed:
+      case Te.SetupIntentCreationFailed:
         r(
-          new Y(
+          new G(
             0,
             "Setup intent creation failed"
           )
         );
         return;
-      case Ne.PaymentMethodCreationFailed:
+      case Te.PaymentMethodCreationFailed:
         r(
-          new Y(
+          new G(
             0,
             "Payment method creation failed"
           )
         );
         return;
-      case Ne.PaymentChargeFailed:
+      case Te.PaymentChargeFailed:
         r(
-          new Y(
+          new G(
             1,
             "Payment charge failed"
           )
@@ -1261,15 +1268,15 @@ class Hn {
     }
   }
 }
-const Kn = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23767676'/%3e%3cpath%20d='M87.6668%2041.504L82.4968%2036.334L62.0002%2056.8307L41.5035%2036.334L36.3335%2041.504L56.8302%2062.0006L36.3335%2082.4973L41.5035%2087.6673L62.0002%2067.1706L82.4968%2087.6673L87.6668%2082.4973L67.1702%2062.0006L87.6668%2041.504Z'%20fill='white'/%3e%3c/svg%3e";
-function qn(t) {
+const zn = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23767676'/%3e%3cpath%20d='M87.6668%2041.504L82.4968%2036.334L62.0002%2056.8307L41.5035%2036.334L36.3335%2041.504L56.8302%2062.0006L36.3335%2082.4973L41.5035%2087.6673L62.0002%2067.1706L82.4968%2087.6673L87.6668%2082.4973L67.1702%2062.0006L87.6668%2041.504Z'%20fill='white'/%3e%3c/svg%3e";
+function Xn(t) {
   F(t, "svelte-1609h93", "img.svelte-1609h93{width:124px;height:124px;margin:0 auto}");
 }
-function jn(t) {
+function Zn(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), ee(e.src, r = Kn) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon svelte-1609h93");
+      e = k("img"), ee(e.src, r = zn) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon svelte-1609h93");
     },
     m(n, i) {
       p(n, e, i);
@@ -1282,15 +1289,15 @@ function jn(t) {
     }
   };
 }
-class Jn extends U {
+class er extends R {
   constructor(e) {
-    super(), N(this, e, null, jn, T, {}, qn);
+    super(), N(this, e, null, Zn, T, {}, Xn);
   }
 }
-function Vn(t) {
+function tr(t) {
   F(t, "svelte-1rmxk7q", "button.svelte-1rmxk7q{border:none;border-radius:56px;font-size:16px;cursor:pointer;height:56px;color:var(--rc-color-grey-text-dark);background-color:var(--rc-color-grey-ui-dark);display:flex;align-items:center;justify-content:center}button.intent-primary.svelte-1rmxk7q{background-color:var(--rc-color-grey-text-dark);color:var(--rc-color-white);font-size:16px}button.svelte-1rmxk7q:disabled{color:var(--rc-color-grey-text-light)}button.intent-primary.svelte-1rmxk7q:disabled{color:var(--rc-color-grey-text-light)}");
 }
-function Wn(t) {
+function nr(t) {
   let e, r, n, i, o;
   const s = (
     /*#slots*/
@@ -1304,12 +1311,12 @@ function Wn(t) {
   );
   return {
     c() {
-      e = k("button"), l && l.c(), _(e, "class", r = Ee(`intent-${/*intent*/
+      e = k("button"), l && l.c(), _(e, "class", r = Ae(`intent-${/*intent*/
       t[0]}`) + " svelte-1rmxk7q"), e.disabled = /*disabled*/
       t[1];
     },
     m(c, a) {
-      p(c, e, a), l && l.m(e, null), n = !0, i || (o = ke(
+      p(c, e, a), l && l.m(e, null), n = !0, i || (o = we(
         e,
         "click",
         /*click_handler*/
@@ -1336,7 +1343,7 @@ function Wn(t) {
         ),
         null
       ), (!n || a & /*intent*/
-      1 && r !== (r = Ee(`intent-${/*intent*/
+      1 && r !== (r = Ae(`intent-${/*intent*/
       c[0]}`) + " svelte-1rmxk7q")) && _(e, "class", r), (!n || a & /*disabled*/
       2) && (e.disabled = /*disabled*/
       c[1]);
@@ -1352,24 +1359,24 @@ function Wn(t) {
     }
   };
 }
-function zn(t, e, r) {
+function rr(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { intent: o = "primary" } = e, { disabled: s = !1 } = e;
   function l(c) {
-    Qt.call(this, t, c);
+    Ct.call(this, t, c);
   }
   return t.$$set = (c) => {
     "intent" in c && r(0, o = c.intent), "disabled" in c && r(1, s = c.disabled), "$$scope" in c && r(2, i = c.$$scope);
   }, [o, s, i, n, l];
 }
-class Ie extends U {
+class be extends R {
   constructor(e) {
-    super(), N(this, e, zn, Wn, T, { intent: 0, disabled: 1 }, Vn);
+    super(), N(this, e, rr, nr, T, { intent: 0, disabled: 1 }, tr);
   }
 }
-function Xn(t) {
+function ir(t) {
   F(t, "svelte-1f9z0o8", "footer.svelte-1f9z0o8{display:flex;flex-direction:column}");
 }
-function Zn(t) {
+function or(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -1420,21 +1427,21 @@ function Zn(t) {
     }
   };
 }
-function er(t, e, r) {
+function sr(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e;
   return t.$$set = (o) => {
     "$$scope" in o && r(0, i = o.$$scope);
   }, [i, n];
 }
-class ze extends U {
+class ze extends R {
   constructor(e) {
-    super(), N(this, e, er, Zn, T, {}, Xn);
+    super(), N(this, e, sr, or, T, {}, ir);
   }
 }
-function tr(t) {
+function lr(t) {
   F(t, "svelte-6o8e90", '.column.svelte-6o8e90{display:flex;flex-direction:column;justify-content:flex-start;gap:var(--gap, "8px");flex-grow:1}');
 }
-function nr(t) {
+function cr(t) {
   let e, r, n;
   const i = (
     /*#slots*/
@@ -1488,30 +1495,30 @@ function nr(t) {
     }
   };
 }
-function rr(t, e, r) {
+function ar(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { gutter: o = "8px" } = e;
   return t.$$set = (s) => {
     "gutter" in s && r(0, o = s.gutter), "$$scope" in s && r(1, i = s.$$scope);
   }, [o, i, n];
 }
-class ve extends U {
+class ye extends R {
   constructor(e) {
-    super(), N(this, e, rr, nr, T, { gutter: 0 }, tr);
+    super(), N(this, e, ar, cr, T, { gutter: 0 }, lr);
   }
 }
-const ir = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20id='mdi_close'%3e%3cpath%20id='Vector'%20d='M19%206.41L17.59%205L12%2010.59L6.41%205L5%206.41L10.59%2012L5%2017.59L6.41%2019L12%2013.41L17.59%2019L19%2017.59L13.41%2012L19%206.41Z'%20fill='%23767676'/%3e%3c/g%3e%3c/svg%3e";
-function or(t) {
+const ur = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20id='mdi_close'%3e%3cpath%20id='Vector'%20d='M19%206.41L17.59%205L12%2010.59L6.41%205L5%206.41L10.59%2012L5%2017.59L6.41%2019L12%2013.41L17.59%2019L19%2017.59L13.41%2012L19%206.41Z'%20fill='%23767676'/%3e%3c/g%3e%3c/svg%3e";
+function fr(t) {
   F(t, "svelte-14xreta", ".close-button.svelte-14xreta{border:none;cursor:pointer;background-color:transparent;padding:0px}");
 }
-function sr(t) {
+function dr(t) {
   let e, r, n, i, o;
   return {
     c() {
-      e = k("button"), r = k("img"), ee(r.src, n = ir) || _(r, "src", n), _(r, "alt", "close"), _(e, "class", "close-button svelte-14xreta"), e.disabled = /*disabled*/
+      e = k("button"), r = k("img"), ee(r.src, n = ur) || _(r, "src", n), _(r, "alt", "close"), _(e, "class", "close-button svelte-14xreta"), e.disabled = /*disabled*/
       t[0];
     },
     m(s, l) {
-      p(s, e, l), Q(e, r), i || (o = ke(
+      p(s, e, l), M(e, r), i || (o = we(
         e,
         "click",
         /*click_handler*/
@@ -1530,24 +1537,24 @@ function sr(t) {
     }
   };
 }
-function lr(t, e, r) {
+function mr(t, e, r) {
   let { disabled: n = !1 } = e;
   function i(o) {
-    Qt.call(this, t, o);
+    Ct.call(this, t, o);
   }
   return t.$$set = (o) => {
     "disabled" in o && r(0, n = o.disabled);
   }, [n, i];
 }
-class cr extends U {
+class gr extends R {
   constructor(e) {
-    super(), N(this, e, lr, sr, T, { disabled: 0 }, or);
+    super(), N(this, e, mr, dr, T, { disabled: 0 }, fr);
   }
 }
-function ar(t) {
+function pr(t) {
   F(t, "svelte-44qpq9", ".rcb-app-icon.svelte-44qpq9{width:40px;height:40px;border-radius:12px;box-shadow:0px 1px 10px 0px rgba(0, 0, 0, 0.1);margin-right:16px}.rcb-app-icon-picture-container.svelte-44qpq9{height:40px}.rcb-app-icon.loading.svelte-44qpq9{background-color:gray}");
 }
-function ur(t) {
+function _r(t) {
   let e;
   return {
     c() {
@@ -1562,16 +1569,16 @@ function ur(t) {
     }
   };
 }
-function fr(t) {
+function hr(t) {
   let e, r, n, i, o, s;
   return {
     c() {
-      e = k("picture"), r = k("source"), i = C(), o = k("img"), _(r, "type", "image/webp"), on(r, n = /*srcWebp*/
+      e = k("picture"), r = k("source"), i = Q(), o = k("img"), _(r, "type", "image/webp"), fn(r, n = /*srcWebp*/
       t[1]) || _(r, "srcset", n), _(o, "class", "rcb-app-icon svelte-44qpq9"), ee(o.src, s = /*src*/
       t[0]) || _(o, "src", s), _(o, "alt", "App icon"), _(e, "class", "rcb-app-icon-picture-container svelte-44qpq9");
     },
     m(l, c) {
-      p(l, e, c), Q(e, r), Q(e, i), Q(e, o);
+      p(l, e, c), M(e, r), M(e, i), M(e, o);
     },
     p(l, c) {
       c & /*srcWebp*/
@@ -1585,12 +1592,12 @@ function fr(t) {
     }
   };
 }
-function dr(t) {
+function Ar(t) {
   let e;
   function r(o, s) {
     return (
       /*src*/
-      o[0] !== null ? fr : ur
+      o[0] !== null ? hr : _r
     );
   }
   let n = r(t), i = n(t);
@@ -1611,24 +1618,24 @@ function dr(t) {
     }
   };
 }
-function mr(t, e, r) {
+function Er(t, e, r) {
   let { src: n = null } = e, { srcWebp: i = null } = e;
   return t.$$set = (o) => {
     "src" in o && r(0, n = o.src), "srcWebp" in o && r(1, i = o.srcWebp);
   }, [n, i];
 }
-class Nt extends U {
+class Tt extends R {
   constructor(e) {
-    super(), N(this, e, mr, dr, T, { src: 0, srcWebp: 1 }, ar);
+    super(), N(this, e, Er, Ar, T, { src: 0, srcWebp: 1 }, pr);
   }
 }
-const Qe = (t) => `https://da08ctfrofx1b.cloudfront.net/${t}`;
-function gr(t) {
+const Ce = (t) => `https://da08ctfrofx1b.cloudfront.net/${t}`;
+function br(t) {
   F(t, "svelte-10uf5fq", ".app-title.svelte-10uf5fq{font-weight:500;margin:8px 0;font-size:16px}.rcb-header-layout__business-info.svelte-10uf5fq{display:flex;align-items:center}");
 }
-function pr(t) {
+function Ir(t) {
   let e, r;
-  return e = new Nt({}), {
+  return e = new Tt({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -1647,27 +1654,27 @@ function pr(t) {
     }
   };
 }
-function _r(t) {
+function wr(t) {
   let e, r, n = (
     /*brandingInfo*/
     t[0].seller_company_name + ""
   ), i, o, s = (
     /*brandingInfo*/
     t[0].app_icon_webp !== null && /*brandingInfo*/
-    t[0].app_icon !== null && at(t)
+    t[0].app_icon !== null && ct(t)
   );
   return {
     c() {
-      s && s.c(), e = C(), r = k("span"), i = L(n), _(r, "class", "app-title svelte-10uf5fq");
+      s && s.c(), e = Q(), r = k("span"), i = L(n), _(r, "class", "app-title svelte-10uf5fq");
     },
     m(l, c) {
-      s && s.m(l, c), p(l, e, c), p(l, r, c), Q(r, i), o = !0;
+      s && s.m(l, c), p(l, e, c), p(l, r, c), M(r, i), o = !0;
     },
     p(l, c) {
       /*brandingInfo*/
       l[0].app_icon_webp !== null && /*brandingInfo*/
       l[0].app_icon !== null ? s ? (s.p(l, c), c & /*brandingInfo*/
-      1 && f(s, 1)) : (s = at(l), s.c(), f(s, 1), s.m(e.parentNode, e)) : s && (H(), d(s, 1, 1, () => {
+      1 && f(s, 1)) : (s = ct(l), s.c(), f(s, 1), s.m(e.parentNode, e)) : s && (H(), d(s, 1, 1, () => {
         s = null;
       }), K()), (!o || c & /*brandingInfo*/
       1) && n !== (n = /*brandingInfo*/
@@ -1684,15 +1691,15 @@ function _r(t) {
     }
   };
 }
-function at(t) {
+function ct(t) {
   let e, r;
-  return e = new Nt({
+  return e = new Tt({
     props: {
-      src: Qe(
+      src: Ce(
         /*brandingInfo*/
         t[0].app_icon
       ),
-      srcWebp: Qe(
+      srcWebp: Ce(
         /*brandingInfo*/
         t[0].app_icon_webp
       )
@@ -1707,11 +1714,11 @@ function at(t) {
     p(n, i) {
       const o = {};
       i & /*brandingInfo*/
-      1 && (o.src = Qe(
+      1 && (o.src = Ce(
         /*brandingInfo*/
         n[0].app_icon
       )), i & /*brandingInfo*/
-      1 && (o.srcWebp = Qe(
+      1 && (o.srcWebp = Ce(
         /*brandingInfo*/
         n[0].app_icon_webp
       )), e.$set(o);
@@ -1727,9 +1734,9 @@ function at(t) {
     }
   };
 }
-function Ar(t) {
+function kr(t) {
   let e, r, n, i;
-  const o = [_r, pr], s = [];
+  const o = [wr, Ir], s = [];
   function l(c, a) {
     return (
       /*brandingInfo*/
@@ -1760,38 +1767,38 @@ function Ar(t) {
     }
   };
 }
-function hr(t, e, r) {
+function yr(t, e, r) {
   let { brandingInfo: n = null } = e;
   return t.$$set = (i) => {
     "brandingInfo" in i && r(0, n = i.brandingInfo);
   }, [n];
 }
-class Ut extends U {
+class Nt extends R {
   constructor(e) {
-    super(), N(this, e, hr, Ar, T, { brandingInfo: 0 }, gr);
+    super(), N(this, e, yr, kr, T, { brandingInfo: 0 }, br);
   }
 }
-function Er(t) {
+function vr(t) {
   F(t, "svelte-17puakv", ".rcb-post-purchase-header-layout.svelte-17puakv{display:flex;justify-content:space-between;align-items:center;width:100%;margin-top:-4px}");
 }
-function br(t) {
+function $r(t) {
   let e, r, n, i, o;
-  return r = new Ut({
+  return r = new Nt({
     props: { brandingInfo: (
       /*brandingInfo*/
       t[0]
     ) }
-  }), i = new cr({}), i.$on("click", function() {
+  }), i = new gr({}), i.$on("click", function() {
     ce(
       /*onClose*/
       t[1]
     ) && t[1].apply(this, arguments);
   }), {
     c() {
-      e = k("div"), w(r.$$.fragment), n = C(), w(i.$$.fragment), _(e, "class", "rcb-post-purchase-header-layout svelte-17puakv");
+      e = k("div"), w(r.$$.fragment), n = Q(), w(i.$$.fragment), _(e, "class", "rcb-post-purchase-header-layout svelte-17puakv");
     },
     m(s, l) {
-      p(s, e, l), b(r, e, null), Q(e, n), b(i, e, null), o = !0;
+      p(s, e, l), b(r, e, null), M(e, n), b(i, e, null), o = !0;
     },
     p(s, l) {
       t = s;
@@ -1811,12 +1818,12 @@ function br(t) {
     }
   };
 }
-function Ir(t) {
+function Br(t) {
   let e, r;
   return e = new ue({
     props: {
       as: "header",
-      $$slots: { default: [br] },
+      $$slots: { default: [$r] },
       $$scope: { ctx: t }
     }
   }), {
@@ -1842,22 +1849,22 @@ function Ir(t) {
     }
   };
 }
-function wr(t, e, r) {
+function Dr(t, e, r) {
   let { brandingInfo: n = null } = e, { onClose: i } = e;
   return t.$$set = (o) => {
     "brandingInfo" in o && r(0, n = o.brandingInfo), "onClose" in o && r(1, i = o.onClose);
   }, [n, i];
 }
-class kr extends U {
+class Cr extends R {
   constructor(e) {
-    super(), N(this, e, wr, Ir, T, { brandingInfo: 0, onClose: 1 }, Er);
+    super(), N(this, e, Dr, Br, T, { brandingInfo: 0, onClose: 1 }, vr);
   }
 }
-function $r(t) {
+function Pr(t) {
   F(t, "svelte-10pcqja", ".rcb-modal-message.svelte-10pcqja{width:100%;min-height:160px;display:flex;justify-content:center;align-items:center;flex-direction:column;text-align:center}.title.svelte-10pcqja{font-size:24px;line-height:1.25em}.subtitle.svelte-10pcqja{font-size:16px;line-height:1.25em;overflow-wrap:anywhere}");
 }
-const vr = (t) => ({}), ut = (t) => ({});
-function yr(t) {
+const Mr = (t) => ({}), at = (t) => ({});
+function Qr(t) {
   let e, r, n, i, o;
   const s = (
     /*#slots*/
@@ -1874,10 +1881,10 @@ function yr(t) {
       e = k("span"), r = L(
         /*title*/
         t[2]
-      ), n = C(), i = k("span"), l && l.c(), _(e, "class", "title svelte-10pcqja"), _(i, "class", "subtitle svelte-10pcqja");
+      ), n = Q(), i = k("span"), l && l.c(), _(e, "class", "title svelte-10pcqja"), _(i, "class", "subtitle svelte-10pcqja");
     },
     m(c, a) {
-      p(c, e, a), Q(e, r), p(c, n, a), p(c, i, a), l && l.m(i, null), o = !0;
+      p(c, e, a), M(e, r), p(c, n, a), p(c, i, a), l && l.m(i, null), o = !0;
     },
     p(c, a) {
       (!o || a & /*title*/
@@ -1916,7 +1923,7 @@ function yr(t) {
     }
   };
 }
-function Br(t) {
+function Tr(t) {
   let e, r, n;
   const i = (
     /*#slots*/
@@ -1926,17 +1933,17 @@ function Br(t) {
     t,
     /*$$scope*/
     t[5],
-    ut
+    at
   );
-  return r = new ve({
+  return r = new ye({
     props: {
       gutter: "16px",
-      $$slots: { default: [yr] },
+      $$slots: { default: [Qr] },
       $$scope: { ctx: t }
     }
   }), {
     c() {
-      o && o.c(), e = C(), w(r.$$.fragment);
+      o && o.c(), e = Q(), w(r.$$.fragment);
     },
     m(s, l) {
       o && o.m(s, l), p(s, e, l), b(r, s, l), n = !0;
@@ -1954,12 +1961,12 @@ function Br(t) {
           /*$$scope*/
           s[5],
           l,
-          vr
+          Mr
         ) : V(
           /*$$scope*/
           s[5]
         ),
-        ut
+        at
       );
       const c = {};
       l & /*$$scope, title*/
@@ -1976,12 +1983,12 @@ function Br(t) {
     }
   };
 }
-function Dr(t) {
+function Nr(t) {
   let e, r, n;
-  return r = new ve({
+  return r = new ye({
     props: {
       gutter: "16px",
-      $$slots: { default: [Br] },
+      $$slots: { default: [Tr] },
       $$scope: { ctx: t }
     }
   }), {
@@ -2018,7 +2025,7 @@ function Dr(t) {
     }
   };
 }
-function Mr(t) {
+function Rr(t) {
   let e;
   return {
     c() {
@@ -2032,11 +2039,11 @@ function Mr(t) {
     }
   };
 }
-function Qr(t) {
+function Ur(t) {
   let e, r;
-  return e = new Ie({
+  return e = new be({
     props: {
-      $$slots: { default: [Mr] },
+      $$slots: { default: [Rr] },
       $$scope: { ctx: t }
     }
   }), e.$on("click", function() {
@@ -2068,9 +2075,9 @@ function Qr(t) {
     }
   };
 }
-function Pr(t) {
+function Sr(t) {
   let e, r, n, i, o, s;
-  return e = new kr({
+  return e = new Cr({
     props: {
       brandingInfo: (
         /*brandingInfo*/
@@ -2083,17 +2090,17 @@ function Pr(t) {
     }
   }), n = new ue({
     props: {
-      $$slots: { default: [Dr] },
+      $$slots: { default: [Nr] },
       $$scope: { ctx: t }
     }
   }), o = new ze({
     props: {
-      $$slots: { default: [Qr] },
+      $$slots: { default: [Ur] },
       $$scope: { ctx: t }
     }
   }), {
     c() {
-      w(e.$$.fragment), r = C(), w(n.$$.fragment), i = C(), w(o.$$.fragment);
+      w(e.$$.fragment), r = Q(), w(n.$$.fragment), i = Q(), w(o.$$.fragment);
     },
     m(l, c) {
       b(e, l, c), p(l, r, c), b(n, l, c), p(l, i, c), b(o, l, c), s = !0;
@@ -2123,12 +2130,12 @@ function Pr(t) {
     }
   };
 }
-function Cr(t) {
+function Or(t) {
   let e, r;
-  return e = new ve({
+  return e = new ye({
     props: {
       gutter: "32px",
-      $$slots: { default: [Pr] },
+      $$slots: { default: [Sr] },
       $$scope: { ctx: t }
     }
   }), {
@@ -2154,19 +2161,19 @@ function Cr(t) {
     }
   };
 }
-function Tr(t, e, r) {
+function Lr(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { brandingInfo: o = null } = e, { onContinue: s } = e, { title: l } = e, { type: c } = e;
   return t.$$set = (a) => {
     "brandingInfo" in a && r(0, o = a.brandingInfo), "onContinue" in a && r(1, s = a.onContinue), "title" in a && r(2, l = a.title), "type" in a && r(3, c = a.type), "$$scope" in a && r(5, i = a.$$scope);
   }, [o, s, l, c, n, i];
 }
-class Rt extends U {
+class Rt extends R {
   constructor(e) {
     super(), N(
       this,
       e,
-      Tr,
-      Cr,
+      Lr,
+      Or,
       T,
       {
         brandingInfo: 0,
@@ -2174,11 +2181,11 @@ class Rt extends U {
         title: 2,
         type: 3
       },
-      $r
+      Pr
     );
   }
 }
-function ft(t) {
+function ut(t) {
   let e, r, n, i, o;
   return {
     c() {
@@ -2189,7 +2196,7 @@ function ft(t) {
       t[1]);
     },
     m(s, l) {
-      p(s, e, l), p(s, r, l), Q(r, n), p(s, o, l);
+      p(s, e, l), p(s, r, l), M(r, n), p(s, o, l);
     },
     p(s, l) {
       l & /*supportEmail*/
@@ -2206,33 +2213,33 @@ function ft(t) {
     }
   };
 }
-function Nr(t) {
+function Fr(t) {
   let e = (
     /*getErrorMessage*/
     t[3]() + ""
   ), r, n, i, o = (
     /*supportEmail*/
-    t[1] && ft(t)
+    t[1] && ut(t)
   );
   return {
     c() {
-      r = L(e), n = C(), o && o.c(), i = te();
+      r = L(e), n = Q(), o && o.c(), i = te();
     },
     m(s, l) {
       p(s, r, l), p(s, n, l), o && o.m(s, l), p(s, i, l);
     },
     p(s, l) {
       /*supportEmail*/
-      s[1] ? o ? o.p(s, l) : (o = ft(s), o.c(), o.m(i.parentNode, i)) : o && (o.d(1), o = null);
+      s[1] ? o ? o.p(s, l) : (o = ut(s), o.c(), o.m(i.parentNode, i)) : o && (o.d(1), o = null);
     },
     d(s) {
       s && (g(r), g(n), g(i)), o && o.d(s);
     }
   };
 }
-function Ur(t) {
+function xr(t) {
   let e, r;
-  return e = new Jn({ props: { slot: "icon" } }), {
+  return e = new er({ props: { slot: "icon" } }), {
     c() {
       w(e.$$.fragment);
     },
@@ -2251,7 +2258,7 @@ function Ur(t) {
     }
   };
 }
-function Rr(t) {
+function Yr(t) {
   let e, r;
   return e = new Rt({
     props: {
@@ -2269,8 +2276,8 @@ function Rr(t) {
       ),
       type: "error",
       $$slots: {
-        icon: [Ur],
-        default: [Nr]
+        icon: [xr],
+        default: [Fr]
       },
       $$scope: { ctx: t }
     }
@@ -2301,10 +2308,10 @@ function Rr(t) {
     }
   };
 }
-function Sr(t, e, r) {
+function Gr(t, e, r) {
   let { brandingInfo: n = null } = e, { lastError: i } = e, { supportEmail: o = null } = e, { onContinue: s } = e;
-  Oe(() => {
-    G.errorLog(`Displayed error: ${O[i.errorCode]}. Message: ${i.message ?? "None"}. Underlying error: ${i.underlyingErrorMessage ?? "None"}`);
+  Se(() => {
+    Y.errorLog(`Displayed error: ${O[i.errorCode]}. Message: ${i.message ?? "None"}. Underlying error: ${i.underlyingErrorMessage ?? "None"}`);
   });
   function l() {
     switch (i.errorCode) {
@@ -2344,9 +2351,9 @@ function Sr(t, e, r) {
     i
   ];
 }
-class Or extends U {
+class Hr extends R {
   constructor(e) {
-    super(), N(this, e, Sr, Rr, T, {
+    super(), N(this, e, Gr, Yr, T, {
       brandingInfo: 0,
       lastError: 5,
       supportEmail: 1,
@@ -2354,15 +2361,15 @@ class Or extends U {
     });
   }
 }
-const Lr = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23576CDB'/%3e%3crect%20x='44.1116'%20y='56'%20width='27.5'%20height='11'%20transform='rotate(45%2044.1116%2056)'%20fill='white'/%3e%3crect%20x='79.1133'%20y='44.334'%20width='11'%20height='44'%20transform='rotate(45%2079.1133%2044.334)'%20fill='white'/%3e%3c/svg%3e";
-function Fr(t) {
+const Kr = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23576CDB'/%3e%3crect%20x='44.1116'%20y='56'%20width='27.5'%20height='11'%20transform='rotate(45%2044.1116%2056)'%20fill='white'/%3e%3crect%20x='79.1133'%20y='44.334'%20width='11'%20height='44'%20transform='rotate(45%2079.1133%2044.334)'%20fill='white'/%3e%3c/svg%3e";
+function qr(t) {
   F(t, "svelte-1609h93", "img.svelte-1609h93{width:124px;height:124px;margin:0 auto}");
 }
-function xr(t) {
+function jr(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), ee(e.src, r = Lr) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon svelte-1609h93");
+      e = k("img"), ee(e.src, r = Kr) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon svelte-1609h93");
     },
     m(n, i) {
       p(n, e, i);
@@ -2375,12 +2382,12 @@ function xr(t) {
     }
   };
 }
-class Gr extends U {
+class Jr extends R {
   constructor(e) {
-    super(), N(this, e, null, xr, T, {}, Fr);
+    super(), N(this, e, null, jr, T, {}, qr);
   }
 }
-function Yr(t) {
+function Vr(t) {
   let e;
   return {
     c() {
@@ -2394,9 +2401,9 @@ function Yr(t) {
     }
   };
 }
-function Hr(t) {
+function Wr(t) {
   let e, r;
-  return e = new Gr({ props: { slot: "icon" } }), {
+  return e = new Jr({ props: { slot: "icon" } }), {
     c() {
       w(e.$$.fragment);
     },
@@ -2415,7 +2422,7 @@ function Hr(t) {
     }
   };
 }
-function Kr(t) {
+function zr(t) {
   let e, r;
   return e = new Rt({
     props: {
@@ -2430,8 +2437,8 @@ function Kr(t) {
         t[1]
       ),
       $$slots: {
-        icon: [Hr],
-        default: [Yr]
+        icon: [Wr],
+        default: [Vr]
       },
       $$scope: { ctx: t }
     }
@@ -2462,30 +2469,30 @@ function Kr(t) {
     }
   };
 }
-function qr(t, e, r) {
+function Xr(t, e, r) {
   let { brandingInfo: n = null } = e, { onContinue: i } = e;
   return t.$$set = (o) => {
     "brandingInfo" in o && r(0, n = o.brandingInfo), "onContinue" in o && r(1, i = o.onContinue);
   }, [n, i];
 }
-class jr extends U {
+class Zr extends R {
   constructor(e) {
-    super(), N(this, e, qr, Kr, T, { brandingInfo: 0, onContinue: 1 });
+    super(), N(this, e, Xr, zr, T, { brandingInfo: 0, onContinue: 1 });
   }
 }
-function Jr(t, e, r, n, i = {}) {
+function ei(t, e, r, n, i = {}) {
   const o = r.create(e, i);
   return o.mount(t), o.on("change", (s) => n("change", s)), o.on("ready", (s) => n("ready", s)), o.on("focus", (s) => n("focus", s)), o.on("blur", (s) => n("blur", s)), o.on("escape", (s) => n("escape", s)), o.on("click", (s) => n("click", s)), o.on("loaderror", (s) => n("loaderror", s)), o.on("loaderstart", (s) => n("loaderstart", s)), o.on("networkschange", (s) => n("networkschange", s)), o;
 }
-const Vr = typeof window > "u";
-function Wr(t) {
-  if (!Vr)
+const ti = typeof window > "u";
+function ni(t) {
+  if (!ti)
     return t.registerAppInfo({
       name: "svelte-stripe-js",
       url: "https://svelte-stripe-js.vercel.app"
     });
 }
-function zr(t) {
+function ri(t) {
   let e;
   return {
     c() {
@@ -2502,11 +2509,11 @@ function zr(t) {
     }
   };
 }
-function Xr(t, e, r) {
+function ii(t, e, r) {
   let n, i;
-  const o = An(), { elements: s } = En("stripe");
+  const o = kn(), { elements: s } = vn("stripe");
   let { options: l = void 0 } = e;
-  Oe(() => (n = Jr(i, "payment", s, o, l), () => n.destroy()));
+  Se(() => (n = ei(i, "payment", s, o, l), () => n.destroy()));
   function c() {
     n.blur();
   }
@@ -2519,18 +2526,18 @@ function Xr(t, e, r) {
   function m() {
     n.focus();
   }
-  function A($) {
-    Re[$ ? "unshift" : "push"](() => {
-      i = $, r(0, i);
+  function h(y) {
+    Re[y ? "unshift" : "push"](() => {
+      i = y, r(0, i);
     });
   }
-  return t.$$set = ($) => {
-    "options" in $ && r(1, l = $.options);
-  }, [i, l, c, a, u, m, A];
+  return t.$$set = (y) => {
+    "options" in y && r(1, l = y.options);
+  }, [i, l, c, a, u, m, h];
 }
-class Zr extends U {
+class oi extends R {
   constructor(e) {
-    super(), N(this, e, Xr, zr, T, {
+    super(), N(this, e, ii, ri, T, {
       options: 1,
       blur: 2,
       clear: 3,
@@ -2551,7 +2558,7 @@ class Zr extends U {
     return this.$$.ctx[5];
   }
 }
-function dt(t) {
+function ft(t) {
   let e;
   const r = (
     /*#slots*/
@@ -2602,11 +2609,11 @@ function dt(t) {
     }
   };
 }
-function ei(t) {
+function si(t) {
   let e, r, n = (
     /*stripe*/
     t[1] && /*elements*/
-    t[0] && dt(t)
+    t[0] && ft(t)
   );
   return {
     c() {
@@ -2619,7 +2626,7 @@ function ei(t) {
       /*stripe*/
       i[1] && /*elements*/
       i[0] ? n ? (n.p(i, o), o & /*stripe, elements*/
-      3 && f(n, 1)) : (n = dt(i), n.c(), f(n, 1), n.m(e.parentNode, e)) : n && (H(), d(n, 1, 1, () => {
+      3 && f(n, 1)) : (n = ft(i), n.c(), f(n, 1), n.m(e.parentNode, e)) : n && (H(), d(n, 1, 1, () => {
         n = null;
       }), K());
     },
@@ -2634,46 +2641,46 @@ function ei(t) {
     }
   };
 }
-function ti(t, e, r) {
-  let n, { $$slots: i = {}, $$scope: o } = e, { stripe: s } = e, { mode: l = void 0 } = e, { theme: c = "stripe" } = e, { variables: a = {} } = e, { rules: u = {} } = e, { labels: m = "above" } = e, { loader: A = "auto" } = e, { fonts: $ = [] } = e, { locale: E = "auto" } = e, { currency: B = void 0 } = e, { amount: h = void 0 } = e, { clientSecret: y = void 0 } = e, { elements: R = null } = e;
-  return t.$$set = (M) => {
-    "stripe" in M && r(1, s = M.stripe), "mode" in M && r(2, l = M.mode), "theme" in M && r(3, c = M.theme), "variables" in M && r(4, a = M.variables), "rules" in M && r(5, u = M.rules), "labels" in M && r(6, m = M.labels), "loader" in M && r(7, A = M.loader), "fonts" in M && r(8, $ = M.fonts), "locale" in M && r(9, E = M.locale), "currency" in M && r(10, B = M.currency), "amount" in M && r(11, h = M.amount), "clientSecret" in M && r(12, y = M.clientSecret), "elements" in M && r(0, R = M.elements), "$$scope" in M && r(14, o = M.$$scope);
+function li(t, e, r) {
+  let n, { $$slots: i = {}, $$scope: o } = e, { stripe: s } = e, { mode: l = void 0 } = e, { theme: c = "stripe" } = e, { variables: a = {} } = e, { rules: u = {} } = e, { labels: m = "above" } = e, { loader: h = "auto" } = e, { fonts: y = [] } = e, { locale: E = "auto" } = e, { currency: B = void 0 } = e, { amount: A = void 0 } = e, { clientSecret: $ = void 0 } = e, { elements: U = null } = e;
+  return t.$$set = (C) => {
+    "stripe" in C && r(1, s = C.stripe), "mode" in C && r(2, l = C.mode), "theme" in C && r(3, c = C.theme), "variables" in C && r(4, a = C.variables), "rules" in C && r(5, u = C.rules), "labels" in C && r(6, m = C.labels), "loader" in C && r(7, h = C.loader), "fonts" in C && r(8, y = C.fonts), "locale" in C && r(9, E = C.locale), "currency" in C && r(10, B = C.currency), "amount" in C && r(11, A = C.amount), "clientSecret" in C && r(12, $ = C.clientSecret), "elements" in C && r(0, U = C.elements), "$$scope" in C && r(14, o = C.$$scope);
   }, t.$$.update = () => {
     t.$$.dirty & /*theme, variables, rules, labels*/
     120 && r(13, n = { theme: c, variables: a, rules: u, labels: m }), t.$$.dirty & /*stripe, elements, mode, currency, amount, appearance, clientSecret, fonts, loader, locale*/
-    16263 && s && !R && (r(0, R = s.elements({
+    16263 && s && !U && (r(0, U = s.elements({
       mode: l,
       currency: B,
-      amount: h,
+      amount: A,
       appearance: n,
-      clientSecret: y,
-      fonts: $,
-      loader: A,
+      clientSecret: $,
+      fonts: y,
+      loader: h,
       locale: E
-    })), Wr(s), hn("stripe", { stripe: s, elements: R })), t.$$.dirty & /*elements, appearance, locale*/
-    8705 && R && R.update({ appearance: n, locale: E });
+    })), ni(s), yn("stripe", { stripe: s, elements: U })), t.$$.dirty & /*elements, appearance, locale*/
+    8705 && U && U.update({ appearance: n, locale: E });
   }, [
-    R,
+    U,
     s,
     l,
     c,
     a,
     u,
     m,
-    A,
-    $,
-    E,
-    B,
     h,
     y,
+    E,
+    B,
+    A,
+    $,
     n,
     o,
     i
   ];
 }
-class ni extends U {
+class ci extends R {
   constructor(e) {
-    super(), N(this, e, ti, ei, T, {
+    super(), N(this, e, li, si, T, {
       stripe: 1,
       mode: 2,
       theme: 3,
@@ -2690,90 +2697,90 @@ class ni extends U {
     });
   }
 }
-var St = "https://js.stripe.com/v3", ri = /^https:\/\/js\.stripe\.com\/v3\/?(\?.*)?$/, mt = "loadStripe.setLoadParameters was called but an existing Stripe.js script already exists in the document; existing script parameters will be used", ii = function() {
-  for (var e = document.querySelectorAll('script[src^="'.concat(St, '"]')), r = 0; r < e.length; r++) {
+var Ut = "https://js.stripe.com/v3", ai = /^https:\/\/js\.stripe\.com\/v3\/?(\?.*)?$/, dt = "loadStripe.setLoadParameters was called but an existing Stripe.js script already exists in the document; existing script parameters will be used", ui = function() {
+  for (var e = document.querySelectorAll('script[src^="'.concat(Ut, '"]')), r = 0; r < e.length; r++) {
     var n = e[r];
-    if (ri.test(n.src))
+    if (ai.test(n.src))
       return n;
   }
   return null;
-}, gt = function(e) {
+}, mt = function(e) {
   var r = e && !e.advancedFraudSignals ? "?advancedFraudSignals=false" : "", n = document.createElement("script");
-  n.src = "".concat(St).concat(r);
+  n.src = "".concat(Ut).concat(r);
   var i = document.head || document.body;
   if (!i)
     throw new Error("Expected document.body not to be null. Stripe.js requires a <body> element.");
   return i.appendChild(n), n;
-}, oi = function(e, r) {
+}, fi = function(e, r) {
   !e || !e._registerWrapper || e._registerWrapper({
     name: "stripe-js",
     version: "2.4.0",
     startTime: r
   });
-}, me = null, Pe = null, Ce = null, si = function(e) {
+}, de = null, Pe = null, Me = null, di = function(e) {
   return function() {
     e(new Error("Failed to load Stripe.js"));
   };
-}, li = function(e, r) {
+}, mi = function(e, r) {
   return function() {
     window.Stripe ? e(window.Stripe) : r(new Error("Stripe.js not available"));
   };
-}, ci = function(e) {
-  return me !== null ? me : (me = new Promise(function(r, n) {
+}, gi = function(e) {
+  return de !== null ? de : (de = new Promise(function(r, n) {
     if (typeof window > "u" || typeof document > "u") {
       r(null);
       return;
     }
-    if (window.Stripe && e && console.warn(mt), window.Stripe) {
+    if (window.Stripe && e && console.warn(dt), window.Stripe) {
       r(window.Stripe);
       return;
     }
     try {
-      var i = ii();
+      var i = ui();
       if (i && e)
-        console.warn(mt);
+        console.warn(dt);
       else if (!i)
-        i = gt(e);
-      else if (i && Ce !== null && Pe !== null) {
+        i = mt(e);
+      else if (i && Me !== null && Pe !== null) {
         var o;
-        i.removeEventListener("load", Ce), i.removeEventListener("error", Pe), (o = i.parentNode) === null || o === void 0 || o.removeChild(i), i = gt(e);
+        i.removeEventListener("load", Me), i.removeEventListener("error", Pe), (o = i.parentNode) === null || o === void 0 || o.removeChild(i), i = mt(e);
       }
-      Ce = li(r, n), Pe = si(n), i.addEventListener("load", Ce), i.addEventListener("error", Pe);
+      Me = mi(r, n), Pe = di(n), i.addEventListener("load", Me), i.addEventListener("error", Pe);
     } catch (s) {
       n(s);
       return;
     }
-  }), me.catch(function(r) {
-    return me = null, Promise.reject(r);
+  }), de.catch(function(r) {
+    return de = null, Promise.reject(r);
   }));
-}, ai = function(e, r, n) {
+}, pi = function(e, r, n) {
   if (e === null)
     return null;
   var i = e.apply(void 0, r);
-  return oi(i, n), i;
-}, ge, Ot = !1, Lt = function() {
-  return ge || (ge = ci(null).catch(function(e) {
-    return ge = null, Promise.reject(e);
-  }), ge);
+  return fi(i, n), i;
+}, me, St = !1, Ot = function() {
+  return me || (me = gi(null).catch(function(e) {
+    return me = null, Promise.reject(e);
+  }), me);
 };
 Promise.resolve().then(function() {
-  return Lt();
+  return Ot();
 }).catch(function(t) {
-  Ot || console.warn(t);
+  St || console.warn(t);
 });
-var ui = function() {
+var _i = function() {
   for (var e = arguments.length, r = new Array(e), n = 0; n < e; n++)
     r[n] = arguments[n];
-  Ot = !0;
+  St = !0;
   var i = Date.now();
-  return Lt().then(function(o) {
-    return ai(o, r, i);
+  return Ot().then(function(o) {
+    return pi(o, r, i);
   });
 };
-function fi(t) {
+function hi(t) {
   F(t, "svelte-1xe711j", ".rcb-header-layout.svelte-1xe711j{display:flex;justify-content:space-between;align-items:center;width:100%;font-size:24px;margin:0;font-weight:500}");
 }
-function di(t) {
+function Ai(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -2824,12 +2831,12 @@ function di(t) {
     }
   };
 }
-function mi(t) {
+function Ei(t) {
   let e, r;
   return e = new ue({
     props: {
       as: "header",
-      $$slots: { default: [di] },
+      $$slots: { default: [Ai] },
       $$scope: { ctx: t }
     }
   }), {
@@ -2855,23 +2862,23 @@ function mi(t) {
     }
   };
 }
-function gi(t, e, r) {
+function bi(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e;
   return t.$$set = (o) => {
     "$$scope" in o && r(1, i = o.$$scope);
   }, [n, i];
 }
-class Xe extends U {
+class Xe extends R {
   constructor(e) {
-    super(), N(this, e, gi, mi, T, {}, fi);
+    super(), N(this, e, bi, Ei, T, {}, hi);
   }
 }
-const pi = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cpath%20d='M18%208H17V6C17%203.24%2014.76%201%2012%201C9.24%201%207%203.24%207%206V8H6C4.9%208%204%208.9%204%2010V20C4%2021.1%204.9%2022%206%2022H18C19.1%2022%2020%2021.1%2020%2020V10C20%208.9%2019.1%208%2018%208ZM12%2017C10.9%2017%2010%2016.1%2010%2015C10%2013.9%2010.9%2013%2012%2013C13.1%2013%2014%2013.9%2014%2015C14%2016.1%2013.1%2017%2012%2017ZM15.1%208H8.9V6C8.9%204.29%2010.29%202.9%2012%202.9C13.71%202.9%2015.1%204.29%2015.1%206V8Z'%20fill='%2311D483'/%3e%3c/svg%3e";
-function _i(t) {
+const Ii = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cpath%20d='M18%208H17V6C17%203.24%2014.76%201%2012%201C9.24%201%207%203.24%207%206V8H6C4.9%208%204%208.9%204%2010V20C4%2021.1%204.9%2022%206%2022H18C19.1%2022%2020%2021.1%2020%2020V10C20%208.9%2019.1%208%2018%208ZM12%2017C10.9%2017%2010%2016.1%2010%2015C10%2013.9%2010.9%2013%2012%2013C13.1%2013%2014%2013.9%2014%2015C14%2016.1%2013.1%2017%2012%2017ZM15.1%208H8.9V6C8.9%204.29%2010.29%202.9%2012%202.9C13.71%202.9%2015.1%204.29%2015.1%206V8Z'%20fill='%2311D483'/%3e%3c/svg%3e";
+function wi(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), ee(e.src, r = pi) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
+      e = k("img"), ee(e.src, r = Ii) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
     },
     m(n, i) {
       p(n, e, i);
@@ -2884,12 +2891,12 @@ function _i(t) {
     }
   };
 }
-class Ai extends U {
+class ki extends R {
   constructor(e) {
-    super(), N(this, e, null, _i, T, {});
+    super(), N(this, e, null, wi, T, {});
   }
 }
-const _e = {
+const pe = {
   error: "#f2545b",
   warning: "#f4e971",
   focus: "#000080",
@@ -2898,7 +2905,7 @@ const _e = {
   "grey-ui-dark": "#dfdfdf",
   white: "#ffffff"
 };
-function hi(t) {
+function yi(t) {
   F(t, "svelte-rjmul6", `.processing.svelte-rjmul6{width:12px;aspect-ratio:1;border-radius:50%;animation:svelte-rjmul6-l5 1.5s infinite linear}@keyframes svelte-rjmul6-l5{0%{box-shadow:20px 0 #fff2,
         -20px 0 #fff2;background:#fff2}25%{box-shadow:20px 0 #fff2,
         -20px 0 #ffff;background:#fff2}50%{box-shadow:20px 0 #fff2,
@@ -2906,7 +2913,7 @@ function hi(t) {
         -20px 0 #fff2;background:#fff2}100%{box-shadow:20px 0 #fff2,
         -20px 0 #fff2;background:#fff2}}`);
 }
-function Ei(t) {
+function vi(t) {
   let e;
   return {
     c() {
@@ -2923,15 +2930,15 @@ function Ei(t) {
     }
   };
 }
-class Ft extends U {
+class Lt extends R {
   constructor(e) {
-    super(), N(this, e, null, Ei, T, {}, hi);
+    super(), N(this, e, null, vi, T, {}, yi);
   }
 }
-function bi(t) {
+function $i(t) {
   F(t, "svelte-1wxt892", ".rcb-stripe-elements-container.svelte-1wxt892{width:100%;margin-top:32px;margin-bottom:24px}");
 }
-function Ii(t) {
+function Bi(t) {
   let e, r;
   return e = new We({}), {
     c() {
@@ -2952,7 +2959,7 @@ function Ii(t) {
     }
   };
 }
-function wi(t) {
+function Di(t) {
   let e, r, n, i, o, s;
   function l(a) {
     t[9](a);
@@ -2973,17 +2980,17 @@ function wi(t) {
       fontSizeBase: "16px",
       fontSizeSm: "16px",
       spacingGridRow: "16px",
-      colorText: _e["grey-text-dark"],
+      colorText: pe["grey-text-dark"],
       focusBoxShadow: "none",
-      colorDanger: _e.error
+      colorDanger: pe.error
     },
     rules: {
       ".Input": {
         boxShadow: "none",
-        border: `2px solid ${_e["grey-ui-dark"]}`
+        border: `2px solid ${pe["grey-ui-dark"]}`
       },
       ".Input:focus": {
-        border: `2px solid ${_e.focus}`,
+        border: `2px solid ${pe.focus}`,
         outline: "none"
       },
       ".Label": {
@@ -2993,18 +3000,18 @@ function wi(t) {
       },
       ".Input--invalid": { boxShadow: "none" }
     },
-    $$slots: { default: [Pi] },
+    $$slots: { default: [Si] },
     $$scope: { ctx: t }
   };
   return (
     /*elements*/
     t[2] !== void 0 && (c.elements = /*elements*/
-    t[2]), r = new ni({ props: c }), Re.push(() => vn(r, "elements", l)), {
+    t[2]), r = new ci({ props: c }), Re.push(() => Mn(r, "elements", l)), {
       c() {
         e = k("form"), w(r.$$.fragment);
       },
       m(a, u) {
-        p(a, e, u), b(r, e, null), i = !0, o || (s = ke(e, "submit", Mt(
+        p(a, e, u), b(r, e, null), i = !0, o || (s = we(e, "submit", Dt(
           /*handleContinue*/
           t[5]
         )), o = !0);
@@ -3016,7 +3023,7 @@ function wi(t) {
         a[3]), u & /*$$scope, processing, onClose*/
         2051 && (m.$$scope = { dirty: u, ctx: a }), !n && u & /*elements*/
         4 && (n = !0, m.elements = /*elements*/
-        a[2], wn(() => n = !1)), r.$set(m);
+        a[2], Dn(() => n = !1)), r.$set(m);
       },
       i(a) {
         i || (f(r.$$.fragment, a), i = !0);
@@ -3030,11 +3037,11 @@ function wi(t) {
     }
   );
 }
-function ki(t) {
+function Ci(t) {
   let e, r, n, i;
-  return n = new Ai({}), {
+  return n = new ki({}), {
     c() {
-      e = k("div"), e.textContent = "Secure Checkout", r = C(), w(n.$$.fragment);
+      e = k("div"), e.textContent = "Secure Checkout", r = Q(), w(n.$$.fragment);
     },
     m(o, s) {
       p(o, e, s), p(o, r, s), b(n, o, s), i = !0;
@@ -3051,9 +3058,9 @@ function ki(t) {
     }
   };
 }
-function $i(t) {
+function Pi(t) {
   let e, r, n;
-  return r = new Zr({}), {
+  return r = new oi({}), {
     c() {
       e = k("div"), w(r.$$.fragment), _(e, "class", "rcb-stripe-elements-container svelte-1wxt892");
     },
@@ -3072,7 +3079,7 @@ function $i(t) {
     }
   };
 }
-function vi(t) {
+function Mi(t) {
   let e;
   return {
     c() {
@@ -3088,9 +3095,9 @@ function vi(t) {
     }
   };
 }
-function yi(t) {
+function Qi(t) {
   let e, r;
-  return e = new Ft({}), {
+  return e = new Lt({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -3108,9 +3115,9 @@ function yi(t) {
     }
   };
 }
-function Bi(t) {
+function Ti(t) {
   let e, r, n, i;
-  const o = [yi, vi], s = [];
+  const o = [Qi, Mi], s = [];
   function l(c, a) {
     return (
       /*processing*/
@@ -3141,7 +3148,7 @@ function Bi(t) {
     }
   };
 }
-function Di(t) {
+function Ni(t) {
   let e;
   return {
     c() {
@@ -3155,25 +3162,25 @@ function Di(t) {
     }
   };
 }
-function Mi(t) {
+function Ri(t) {
   let e, r, n, i;
-  return e = new Ie({
+  return e = new be({
     props: {
       disabled: (
         /*processing*/
         t[0]
       ),
-      $$slots: { default: [Bi] },
+      $$slots: { default: [Ti] },
       $$scope: { ctx: t }
     }
-  }), n = new Ie({
+  }), n = new be({
     props: {
       disabled: (
         /*processing*/
         t[0]
       ),
       intent: "secondary",
-      $$slots: { default: [Di] },
+      $$slots: { default: [Ni] },
       $$scope: { ctx: t }
     }
   }), n.$on("click", function() {
@@ -3183,7 +3190,7 @@ function Mi(t) {
     ) && t[1].apply(this, arguments);
   }), {
     c() {
-      w(e.$$.fragment), r = C(), w(n.$$.fragment);
+      w(e.$$.fragment), r = Q(), w(n.$$.fragment);
     },
     m(o, s) {
       b(e, o, s), p(o, r, s), b(n, o, s), i = !0;
@@ -3212,11 +3219,11 @@ function Mi(t) {
     }
   };
 }
-function Qi(t) {
+function Ui(t) {
   let e, r;
-  return e = new ve({
+  return e = new ye({
     props: {
-      $$slots: { default: [Mi] },
+      $$slots: { default: [Ri] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3242,26 +3249,26 @@ function Qi(t) {
     }
   };
 }
-function Pi(t) {
+function Si(t) {
   let e, r, n, i, o, s;
   return e = new Xe({
     props: {
-      $$slots: { default: [ki] },
+      $$slots: { default: [Ci] },
       $$scope: { ctx: t }
     }
   }), n = new ue({
     props: {
-      $$slots: { default: [$i] },
+      $$slots: { default: [Pi] },
       $$scope: { ctx: t }
     }
   }), o = new ze({
     props: {
-      $$slots: { default: [Qi] },
+      $$slots: { default: [Ui] },
       $$scope: { ctx: t }
     }
   }), {
     c() {
-      w(e.$$.fragment), r = C(), w(n.$$.fragment), i = C(), w(o.$$.fragment);
+      w(e.$$.fragment), r = Q(), w(n.$$.fragment), i = Q(), w(o.$$.fragment);
     },
     m(l, c) {
       b(e, l, c), p(l, r, c), b(n, l, c), p(l, i, c), b(o, l, c), s = !0;
@@ -3288,9 +3295,9 @@ function Pi(t) {
     }
   };
 }
-function Ci(t) {
+function Oi(t) {
   let e, r, n, i;
-  const o = [wi, Ii], s = [];
+  const o = [Di, Bi], s = [];
   function l(c, a) {
     return (
       /*stripe*/
@@ -3322,17 +3329,17 @@ function Ci(t) {
     }
   };
 }
-function Ti(t, e, r) {
+function Li(t, e, r) {
   let { onClose: n } = e, { onContinue: i } = e, { onError: o } = e, { paymentInfoCollectionMetadata: s } = e, { processing: l = !1 } = e;
   const c = s.data.client_secret;
   let a = null, u, m;
-  Oe(async () => {
+  Se(async () => {
     const E = s.data.publishable_api_key, B = s.data.stripe_account_id;
     if (!E || !B)
       throw new Error("Stripe publishable key or account ID not found");
-    r(3, a = await ui(E, { stripeAccount: B }));
+    r(3, a = await _i(E, { stripeAccount: B }));
   });
-  const A = async () => {
+  const h = async () => {
     if (l || !a || !m)
       return;
     r(0, l = !0);
@@ -3340,9 +3347,9 @@ function Ti(t, e, r) {
       elements: m,
       redirect: "if_required"
     });
-    E.error ? (r(0, l = !1), o(new Y(O.StripeError, E.error.message))) : i();
+    E.error ? (r(0, l = !1), o(new G(O.StripeError, E.error.message))) : i();
   };
-  function $(E) {
+  function y(E) {
     u = E, r(2, u);
   }
   return t.$$set = (E) => {
@@ -3356,20 +3363,20 @@ function Ti(t, e, r) {
     u,
     a,
     c,
-    A,
+    h,
     i,
     o,
     s,
-    $
+    y
   ];
 }
-class Ni extends U {
+class Fi extends R {
   constructor(e) {
     super(), N(
       this,
       e,
-      Ti,
-      Ci,
+      Li,
+      Oi,
       T,
       {
         onClose: 1,
@@ -3378,17 +3385,17 @@ class Ni extends U {
         paymentInfoCollectionMetadata: 8,
         processing: 0
       },
-      bi
+      $i
     );
   }
 }
-function Ui(t) {
+function xi(t) {
   return t.trim() === "" ? "You need to provide your email address to continue." : t.match(/^[^@]+@[^@]+\.[^@]+$/) ? null : "Email is not valid. Please provide a valid email address.";
 }
-function Ri(t) {
+function Yi(t) {
   F(t, "svelte-favd20", "form.svelte-favd20.svelte-favd20{display:flex;flex-direction:column;min-height:100%;flex-grow:1}.form-container.svelte-favd20.svelte-favd20{display:flex;flex-direction:column;width:100%;margin-top:32px;margin-bottom:16px}.form-label.svelte-favd20.svelte-favd20{margin-top:8px;margin-bottom:8px;display:block;font-weight:500;line-height:22px}.form-input.error.svelte-favd20 input.svelte-favd20{border-color:var(--rc-color-error)}.form-error.svelte-favd20.svelte-favd20{margin-top:4px;font-size:16px;line-height:20px;min-height:40px;color:var(--rc-color-error)}input.svelte-favd20.svelte-favd20{width:100%;box-sizing:border-box;padding:8px;border:2px solid var(--rc-color-grey-ui-dark);border-radius:12px;font-size:16px;height:48px;padding:6px 14px}input.svelte-favd20.svelte-favd20:focus{outline:none;border:2px solid var(--rc-color-focus)}");
 }
-function Si(t) {
+function Gi(t) {
   let e;
   return {
     c() {
@@ -3402,7 +3409,7 @@ function Si(t) {
     }
   };
 }
-function pt(t) {
+function gt(t) {
   let e, r;
   return {
     c() {
@@ -3412,7 +3419,7 @@ function pt(t) {
       ), _(e, "class", "form-error svelte-favd20");
     },
     m(n, i) {
-      p(n, e, i), Q(e, r);
+      p(n, e, i), M(e, r);
     },
     p(n, i) {
       i & /*error*/
@@ -3427,46 +3434,46 @@ function pt(t) {
     }
   };
 }
-function Oi(t) {
+function Hi(t) {
   let e, r, n, i, o, s, l, c, a, u = (
     /*error*/
-    t[2] && pt(t)
+    t[2] && gt(t)
   );
   return {
     c() {
-      e = k("div"), r = k("div"), r.innerHTML = '<label for="email">Email</label>', n = C(), i = k("div"), o = k("input"), l = C(), u && u.c(), _(r, "class", "form-label svelte-favd20"), _(o, "name", "email"), _(o, "placeholder", "john@appleseed.com"), _(o, "autocapitalize", "off"), _(o, "class", "svelte-favd20"), _(i, "class", s = "form-input " + /*inputClass*/
+      e = k("div"), r = k("div"), r.innerHTML = '<label for="email">Email</label>', n = Q(), i = k("div"), o = k("input"), l = Q(), u && u.c(), _(r, "class", "form-label svelte-favd20"), _(o, "name", "email"), _(o, "placeholder", "john@appleseed.com"), _(o, "autocapitalize", "off"), _(o, "class", "svelte-favd20"), _(i, "class", s = "form-input " + /*inputClass*/
       t[4] + " svelte-favd20"), _(e, "class", "form-container svelte-favd20");
     },
-    m(m, A) {
-      p(m, e, A), Q(e, r), Q(e, n), Q(e, i), Q(i, o), lt(
+    m(m, h) {
+      p(m, e, h), M(e, r), M(e, n), M(e, i), M(i, o), st(
         o,
         /*email*/
         t[3]
-      ), Q(e, l), u && u.m(e, null), c || (a = ke(
+      ), M(e, l), u && u.m(e, null), c || (a = we(
         o,
         "input",
         /*input_input_handler*/
         t[8]
       ), c = !0);
     },
-    p(m, A) {
-      A & /*email*/
+    p(m, h) {
+      h & /*email*/
       8 && o.value !== /*email*/
-      m[3] && lt(
+      m[3] && st(
         o,
         /*email*/
         m[3]
-      ), A & /*inputClass*/
+      ), h & /*inputClass*/
       16 && s !== (s = "form-input " + /*inputClass*/
       m[4] + " svelte-favd20") && _(i, "class", s), /*error*/
-      m[2] ? u ? u.p(m, A) : (u = pt(m), u.c(), u.m(e, null)) : u && (u.d(1), u = null);
+      m[2] ? u ? u.p(m, h) : (u = gt(m), u.c(), u.m(e, null)) : u && (u.d(1), u = null);
     },
     d(m) {
       m && g(e), u && u.d(), c = !1, a();
     }
   };
 }
-function Li(t) {
+function Ki(t) {
   let e;
   return {
     c() {
@@ -3482,9 +3489,9 @@ function Li(t) {
     }
   };
 }
-function Fi(t) {
+function qi(t) {
   let e, r;
-  return e = new Ft({}), {
+  return e = new Lt({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -3502,9 +3509,9 @@ function Fi(t) {
     }
   };
 }
-function xi(t) {
+function ji(t) {
   let e, r, n, i;
-  const o = [Fi, Li], s = [];
+  const o = [qi, Ki], s = [];
   function l(c, a) {
     return (
       /*processing*/
@@ -3535,7 +3542,7 @@ function xi(t) {
     }
   };
 }
-function Gi(t) {
+function Ji(t) {
   let e;
   return {
     c() {
@@ -3549,25 +3556,25 @@ function Gi(t) {
     }
   };
 }
-function Yi(t) {
+function Vi(t) {
   let e, r, n, i;
-  return e = new Ie({
+  return e = new be({
     props: {
       disabled: (
         /*processing*/
         t[1]
       ),
-      $$slots: { default: [xi] },
+      $$slots: { default: [ji] },
       $$scope: { ctx: t }
     }
-  }), n = new Ie({
+  }), n = new be({
     props: {
       intent: "secondary",
       disabled: (
         /*processing*/
         t[1]
       ),
-      $$slots: { default: [Gi] },
+      $$slots: { default: [Ji] },
       $$scope: { ctx: t }
     }
   }), n.$on("click", function() {
@@ -3577,7 +3584,7 @@ function Yi(t) {
     ) && t[0].apply(this, arguments);
   }), {
     c() {
-      w(e.$$.fragment), r = C(), w(n.$$.fragment);
+      w(e.$$.fragment), r = Q(), w(n.$$.fragment);
     },
     m(o, s) {
       b(e, o, s), p(o, r, s), b(n, o, s), i = !0;
@@ -3606,11 +3613,11 @@ function Yi(t) {
     }
   };
 }
-function Hi(t) {
+function Wi(t) {
   let e, r;
-  return e = new ve({
+  return e = new ye({
     props: {
-      $$slots: { default: [Yi] },
+      $$slots: { default: [Vi] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3636,40 +3643,40 @@ function Hi(t) {
     }
   };
 }
-function Ki(t) {
+function zi(t) {
   let e, r, n, i, o, s, l, c, a;
   return r = new Xe({
     props: {
-      $$slots: { default: [Si] },
+      $$slots: { default: [Gi] },
       $$scope: { ctx: t }
     }
   }), i = new ue({
     props: {
-      $$slots: { default: [Oi] },
+      $$slots: { default: [Hi] },
       $$scope: { ctx: t }
     }
   }), s = new ze({
     props: {
-      $$slots: { default: [Hi] },
+      $$slots: { default: [Wi] },
       $$scope: { ctx: t }
     }
   }), {
     c() {
-      e = k("form"), w(r.$$.fragment), n = C(), w(i.$$.fragment), o = C(), w(s.$$.fragment), _(e, "class", "svelte-favd20");
+      e = k("form"), w(r.$$.fragment), n = Q(), w(i.$$.fragment), o = Q(), w(s.$$.fragment), _(e, "class", "svelte-favd20");
     },
     m(u, m) {
-      p(u, e, m), b(r, e, null), Q(e, n), b(i, e, null), Q(e, o), b(s, e, null), l = !0, c || (a = ke(e, "submit", Mt(
+      p(u, e, m), b(r, e, null), M(e, n), b(i, e, null), M(e, o), b(s, e, null), l = !0, c || (a = we(e, "submit", Dt(
         /*handleContinue*/
         t[5]
       )), c = !0);
     },
     p(u, [m]) {
-      const A = {};
+      const h = {};
       m & /*$$scope*/
-      512 && (A.$$scope = { dirty: m, ctx: u }), r.$set(A);
-      const $ = {};
+      512 && (h.$$scope = { dirty: m, ctx: u }), r.$set(h);
+      const y = {};
       m & /*$$scope, error, inputClass, email*/
-      540 && ($.$$scope = { dirty: m, ctx: u }), i.$set($);
+      540 && (y.$$scope = { dirty: m, ctx: u }), i.$set(y);
       const E = {};
       m & /*$$scope, processing, onClose*/
       515 && (E.$$scope = { dirty: m, ctx: u }), s.$set(E);
@@ -3685,20 +3692,20 @@ function Ki(t) {
     }
   };
 }
-function qi(t, e, r) {
+function Xi(t, e, r) {
   let n, i, o, { onContinue: s } = e, { onClose: l } = e, { processing: c } = e, { lastError: a } = e;
   const u = async () => {
-    const A = Ui(n);
-    A ? r(2, i = A) : s({ email: n });
+    const h = xi(n);
+    h ? r(2, i = h) : s({ email: n });
   };
-  _n(async () => {
+  wn(async () => {
     r(2, i = (a == null ? void 0 : a.message) ?? "");
   });
   function m() {
     n = this.value, r(3, n);
   }
-  return t.$$set = (A) => {
-    "onContinue" in A && r(6, s = A.onContinue), "onClose" in A && r(0, l = A.onClose), "processing" in A && r(1, c = A.processing), "lastError" in A && r(7, a = A.lastError);
+  return t.$$set = (h) => {
+    "onContinue" in h && r(6, s = h.onContinue), "onClose" in h && r(0, l = h.onClose), "processing" in h && r(1, c = h.processing), "lastError" in h && r(7, a = h.lastError);
   }, t.$$.update = () => {
     t.$$.dirty & /*error*/
     4 && r(4, o = i ? "error" : "");
@@ -3714,13 +3721,13 @@ function qi(t, e, r) {
     m
   ];
 }
-class ji extends U {
+class Zi extends R {
   constructor(e) {
     super(), N(
       this,
       e,
-      qi,
-      Ki,
+      Xi,
+      zi,
       T,
       {
         onContinue: 6,
@@ -3728,14 +3735,14 @@ class ji extends U {
         processing: 1,
         lastError: 7
       },
-      Ri
+      Yi
     );
   }
 }
-function Ji(t) {
+function eo(t) {
   F(t, "svelte-17tslso", ".rcb-modal-backdrop.svelte-17tslso{position:fixed;top:0;left:0;right:0;min-width:100%;width:100vw;width:100dvw;min-height:100%;height:100vh;height:100dvh;background-color:rgba(40, 40, 40, 0.75);display:flex;flex-direction:column;justify-content:space-around;z-index:1000001}");
 }
-function Vi(t) {
+function to(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -3786,21 +3793,21 @@ function Vi(t) {
     }
   };
 }
-function Wi(t, e, r) {
+function no(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e;
   return t.$$set = (o) => {
     "$$scope" in o && r(0, i = o.$$scope);
   }, [i, n];
 }
-class zi extends U {
+class ro extends R {
   constructor(e) {
-    super(), N(this, e, Wi, Vi, T, {}, Ji);
+    super(), N(this, e, no, to, T, {}, eo);
   }
 }
-function Xi(t) {
-  F(t, "svelte-ioxu5d", ".rcb-modal-container.svelte-ioxu5d{width:100%}.rcb-modal-main.svelte-ioxu5d{box-sizing:border-box;border-radius:8px;background-color:var(--rc-color-white);color:var(--rc-color-grey-text-dark);min-height:460px;padding:40px;flex-direction:column;display:flex}.rcb-modal-dark.svelte-ioxu5d{background-color:var(--rc-color-grey-text-dark);color:var(--rc-color-white);min-height:0px}@media screen and (max-width: 960px){.rcb-modal-container.svelte-ioxu5d{width:calc(100% - 32px);min-width:300px;max-width:640px;margin:auto}.rcb-modal-main.svelte-ioxu5d,.rcb-modal-dark.svelte-ioxu5d{min-width:300px;max-width:640px;padding:32px}}");
+function io(t) {
+  F(t, "svelte-z3twhy", ".rcb-modal-container.svelte-z3twhy{width:100%}.rcb-modal-main.svelte-z3twhy{box-sizing:border-box;border-radius:16px;background-color:var(--rc-color-white);color:var(--rc-color-grey-text-dark);min-height:460px;padding:40px;flex-direction:column;display:flex}.rcb-modal-dark.svelte-z3twhy{background-color:var(--rc-color-grey-text-dark);color:var(--rc-color-white);min-height:0px}@media screen and (max-width: 960px){.rcb-modal-container.svelte-z3twhy{width:calc(100% - 32px);min-width:300px;max-width:640px;margin:auto}.rcb-modal-main.svelte-z3twhy,.rcb-modal-dark.svelte-z3twhy{min-width:300px;max-width:640px;padding:32px}}");
 }
-function Zi(t) {
+function oo(t) {
   let e, r, n, i;
   const o = (
     /*#slots*/
@@ -3814,11 +3821,11 @@ function Zi(t) {
   );
   return {
     c() {
-      e = k("div"), r = k("main"), s && s.c(), _(r, "class", n = Ee(`rcb-modal-main ${/*dark*/
-      t[0] ? "rcb-modal-dark" : ""}`) + " svelte-ioxu5d"), _(e, "class", "rcb-modal-container svelte-ioxu5d");
+      e = k("div"), r = k("main"), s && s.c(), _(r, "class", n = Ae(`rcb-modal-main ${/*dark*/
+      t[0] ? "rcb-modal-dark" : ""}`) + " svelte-z3twhy"), _(e, "class", "rcb-modal-container svelte-z3twhy");
     },
     m(l, c) {
-      p(l, e, c), Q(e, r), s && s.m(r, null), i = !0;
+      p(l, e, c), M(e, r), s && s.m(r, null), i = !0;
     },
     p(l, [c]) {
       s && s.p && (!i || c & /*$$scope*/
@@ -3840,8 +3847,8 @@ function Zi(t) {
         ),
         null
       ), (!i || c & /*dark*/
-      1 && n !== (n = Ee(`rcb-modal-main ${/*dark*/
-      l[0] ? "rcb-modal-dark" : ""}`) + " svelte-ioxu5d")) && _(r, "class", n);
+      1 && n !== (n = Ae(`rcb-modal-main ${/*dark*/
+      l[0] ? "rcb-modal-dark" : ""}`) + " svelte-z3twhy")) && _(r, "class", n);
     },
     i(l) {
       i || (f(s, l), i = !0);
@@ -3854,18 +3861,18 @@ function Zi(t) {
     }
   };
 }
-function eo(t, e, r) {
+function so(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { dark: o = !1 } = e;
   return t.$$set = (s) => {
     "dark" in s && r(0, o = s.dark), "$$scope" in s && r(1, i = s.$$scope);
   }, [o, i, n];
 }
-class to extends U {
+class lo extends R {
   constructor(e) {
-    super(), N(this, e, eo, Zi, T, { dark: 0 }, Xi);
+    super(), N(this, e, so, oo, T, { dark: 0 }, io);
   }
 }
-function no(t) {
+function co(t) {
   let e;
   const r = (
     /*#slots*/
@@ -3916,11 +3923,11 @@ function no(t) {
     }
   };
 }
-function ro(t) {
+function ao(t) {
   let e, r;
-  return e = new zi({
+  return e = new ro({
     props: {
-      $$slots: { default: [io] },
+      $$slots: { default: [uo] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3946,7 +3953,7 @@ function ro(t) {
     }
   };
 }
-function io(t) {
+function uo(t) {
   let e;
   const r = (
     /*#slots*/
@@ -3997,9 +4004,9 @@ function io(t) {
     }
   };
 }
-function oo(t) {
+function fo(t) {
   let e, r, n, i;
-  const o = [ro, no], s = [];
+  const o = [ao, co], s = [];
   function l(c, a) {
     return (
       /*condition*/
@@ -4030,19 +4037,19 @@ function oo(t) {
     }
   };
 }
-function so(t, e, r) {
+function mo(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { condition: o = !1 } = e;
   return t.$$set = (s) => {
     "condition" in s && r(0, o = s.condition), "$$scope" in s && r(2, i = s.$$scope);
   }, [o, n, i];
 }
-class lo extends U {
+class go extends R {
   constructor(e) {
-    super(), N(this, e, so, oo, T, { condition: 0 });
+    super(), N(this, e, mo, fo, T, { condition: 0 });
   }
 }
-const co = (t) => ({}), _t = (t) => ({});
-function ao(t) {
+const po = (t) => ({}), pt = (t) => ({});
+function _o(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -4052,7 +4059,7 @@ function ao(t) {
     t,
     /*$$scope*/
     t[2],
-    _t
+    pt
   ), o = (
     /*#slots*/
     t[1].default
@@ -4065,7 +4072,7 @@ function ao(t) {
   );
   return {
     c() {
-      i && i.c(), e = C(), s && s.c();
+      i && i.c(), e = Q(), s && s.c();
     },
     m(l, c) {
       i && i.m(l, c), p(l, e, c), s && s.m(l, c), r = !0;
@@ -4083,12 +4090,12 @@ function ao(t) {
           /*$$scope*/
           l[2],
           c,
-          co
+          po
         ) : V(
           /*$$scope*/
           l[2]
         ),
-        _t
+        pt
       ), s && s.p && (!r || c & /*$$scope*/
       4) && J(
         s,
@@ -4120,15 +4127,15 @@ function ao(t) {
     }
   };
 }
-function uo(t) {
+function ho(t) {
   let e, r;
-  return e = new to({
+  return e = new lo({
     props: {
       dark: (
         /*dark*/
         t[0]
       ),
-      $$slots: { default: [ao] },
+      $$slots: { default: [_o] },
       $$scope: { ctx: t }
     }
   }), {
@@ -4156,53 +4163,54 @@ function uo(t) {
     }
   };
 }
-function fo(t, e, r) {
+function Ao(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { dark: o = !1 } = e;
   return t.$$set = (s) => {
     "dark" in s && r(0, o = s.dark), "$$scope" in s && r(2, i = s.$$scope);
   }, [o, n, i];
 }
-class xt extends U {
+class Ft extends R {
   constructor(e) {
-    super(), N(this, e, fo, uo, T, { dark: 0 });
+    super(), N(this, e, Ao, ho, T, { dark: 0 });
   }
 }
-const mo = "0.3.4", fe = "https://api.revenuecat.com";
-var Se;
+const Eo = "0.5.0", bo = "https://api.revenuecat.com";
+var Ue;
 (function(t) {
   t[t.CONTINUE = 100] = "CONTINUE", t[t.SWITCHING_PROTOCOLS = 101] = "SWITCHING_PROTOCOLS", t[t.PROCESSING = 102] = "PROCESSING", t[t.EARLY_HINTS = 103] = "EARLY_HINTS", t[t.OK = 200] = "OK", t[t.CREATED = 201] = "CREATED", t[t.ACCEPTED = 202] = "ACCEPTED", t[t.NON_AUTHORITATIVE_INFORMATION = 203] = "NON_AUTHORITATIVE_INFORMATION", t[t.NO_CONTENT = 204] = "NO_CONTENT", t[t.RESET_CONTENT = 205] = "RESET_CONTENT", t[t.PARTIAL_CONTENT = 206] = "PARTIAL_CONTENT", t[t.MULTI_STATUS = 207] = "MULTI_STATUS", t[t.MULTIPLE_CHOICES = 300] = "MULTIPLE_CHOICES", t[t.MOVED_PERMANENTLY = 301] = "MOVED_PERMANENTLY", t[t.MOVED_TEMPORARILY = 302] = "MOVED_TEMPORARILY", t[t.SEE_OTHER = 303] = "SEE_OTHER", t[t.NOT_MODIFIED = 304] = "NOT_MODIFIED", t[t.USE_PROXY = 305] = "USE_PROXY", t[t.TEMPORARY_REDIRECT = 307] = "TEMPORARY_REDIRECT", t[t.PERMANENT_REDIRECT = 308] = "PERMANENT_REDIRECT", t[t.BAD_REQUEST = 400] = "BAD_REQUEST", t[t.UNAUTHORIZED = 401] = "UNAUTHORIZED", t[t.PAYMENT_REQUIRED = 402] = "PAYMENT_REQUIRED", t[t.FORBIDDEN = 403] = "FORBIDDEN", t[t.NOT_FOUND = 404] = "NOT_FOUND", t[t.METHOD_NOT_ALLOWED = 405] = "METHOD_NOT_ALLOWED", t[t.NOT_ACCEPTABLE = 406] = "NOT_ACCEPTABLE", t[t.PROXY_AUTHENTICATION_REQUIRED = 407] = "PROXY_AUTHENTICATION_REQUIRED", t[t.REQUEST_TIMEOUT = 408] = "REQUEST_TIMEOUT", t[t.CONFLICT = 409] = "CONFLICT", t[t.GONE = 410] = "GONE", t[t.LENGTH_REQUIRED = 411] = "LENGTH_REQUIRED", t[t.PRECONDITION_FAILED = 412] = "PRECONDITION_FAILED", t[t.REQUEST_TOO_LONG = 413] = "REQUEST_TOO_LONG", t[t.REQUEST_URI_TOO_LONG = 414] = "REQUEST_URI_TOO_LONG", t[t.UNSUPPORTED_MEDIA_TYPE = 415] = "UNSUPPORTED_MEDIA_TYPE", t[t.REQUESTED_RANGE_NOT_SATISFIABLE = 416] = "REQUESTED_RANGE_NOT_SATISFIABLE", t[t.EXPECTATION_FAILED = 417] = "EXPECTATION_FAILED", t[t.IM_A_TEAPOT = 418] = "IM_A_TEAPOT", t[t.INSUFFICIENT_SPACE_ON_RESOURCE = 419] = "INSUFFICIENT_SPACE_ON_RESOURCE", t[t.METHOD_FAILURE = 420] = "METHOD_FAILURE", t[t.MISDIRECTED_REQUEST = 421] = "MISDIRECTED_REQUEST", t[t.UNPROCESSABLE_ENTITY = 422] = "UNPROCESSABLE_ENTITY", t[t.LOCKED = 423] = "LOCKED", t[t.FAILED_DEPENDENCY = 424] = "FAILED_DEPENDENCY", t[t.UPGRADE_REQUIRED = 426] = "UPGRADE_REQUIRED", t[t.PRECONDITION_REQUIRED = 428] = "PRECONDITION_REQUIRED", t[t.TOO_MANY_REQUESTS = 429] = "TOO_MANY_REQUESTS", t[t.REQUEST_HEADER_FIELDS_TOO_LARGE = 431] = "REQUEST_HEADER_FIELDS_TOO_LARGE", t[t.UNAVAILABLE_FOR_LEGAL_REASONS = 451] = "UNAVAILABLE_FOR_LEGAL_REASONS", t[t.INTERNAL_SERVER_ERROR = 500] = "INTERNAL_SERVER_ERROR", t[t.NOT_IMPLEMENTED = 501] = "NOT_IMPLEMENTED", t[t.BAD_GATEWAY = 502] = "BAD_GATEWAY", t[t.SERVICE_UNAVAILABLE = 503] = "SERVICE_UNAVAILABLE", t[t.GATEWAY_TIMEOUT = 504] = "GATEWAY_TIMEOUT", t[t.HTTP_VERSION_NOT_SUPPORTED = 505] = "HTTP_VERSION_NOT_SUPPORTED", t[t.INSUFFICIENT_STORAGE = 507] = "INSUFFICIENT_STORAGE", t[t.NETWORK_AUTHENTICATION_REQUIRED = 511] = "NETWORK_AUTHENTICATION_REQUIRED";
-})(Se || (Se = {}));
-function je(t) {
+})(Ue || (Ue = {}));
+function qe(t) {
   return t ? t.startsWith("rcb_sb_") : !1;
 }
-async function oe(t, e, r, n) {
+async function oe(t, e) {
+  const { apiKey: r, body: n, headers: i, httpConfig: o } = e, l = `${(o == null ? void 0 : o.proxyURL) ?? bo}${t.urlPath()}`;
   try {
-    const i = await fetch(t.url(), {
+    const c = await fetch(l, {
       method: t.method,
-      headers: _o(e, n),
-      body: po(r)
+      headers: yo(r, i, o == null ? void 0 : o.additionalHeaders),
+      body: wo(n)
     });
-    return await go(i, t), await i.json();
-  } catch (i) {
-    throw i instanceof TypeError ? new X(
-      Z.NetworkError,
-      he.getPublicMessage(Z.NetworkError),
-      i.message
-    ) : i;
+    return await Io(c, t), await c.json();
+  } catch (c) {
+    throw c instanceof TypeError ? new W(
+      X.NetworkError,
+      he.getPublicMessage(X.NetworkError),
+      c.message
+    ) : c;
   }
 }
-async function go(t, e) {
+async function Io(t, e) {
   const r = t.status;
-  if (r >= Se.INTERNAL_SERVER_ERROR)
+  if (r >= Ue.INTERNAL_SERVER_ERROR)
     Ye(e, r, await t.text());
-  else if (r >= Se.BAD_REQUEST) {
+  else if (r >= Ue.BAD_REQUEST) {
     const n = await t.json(), i = n ? JSON.stringify(n) : null, o = n == null ? void 0 : n.code, s = n == null ? void 0 : n.message;
     if (o != null) {
       const l = he.convertCodeToBackendErrorCode(o);
       if (l == null)
         Ye(e, r, i);
       else
-        throw X.getForBackendError(
+        throw W.getForBackendError(
           l,
           s
         );
@@ -4211,48 +4219,56 @@ async function go(t, e) {
   }
 }
 function Ye(t, e, r) {
-  throw new X(
-    Z.UnknownBackendError,
+  throw new W(
+    X.UnknownBackendError,
     `Unknown backend error. Request: ${t.name}. Status code: ${e}. Body: ${r}.`
   );
 }
-function po(t) {
+function wo(t) {
   return t == null ? null : JSON.stringify(t);
 }
-function _o(t, e) {
-  let r = {
-    Authorization: `Bearer ${t}`,
-    "Content-Type": "application/json",
-    Accept: "application/json",
-    "X-Platform": "web",
-    "X-Version": mo,
-    "X-Is-Sandbox": `${je(t)}`
+const xt = "Authorization", Yt = "Content-Type", Gt = "Accept", Ht = "X-Platform", Kt = "X-Version", qt = "X-Is-Sandbox", ko = /* @__PURE__ */ new Set([
+  xt,
+  Yt,
+  Gt,
+  Ht,
+  Kt,
+  qt
+]);
+function yo(t, e, r) {
+  let n = {
+    [xt]: `Bearer ${t}`,
+    [Yt]: "application/json",
+    [Gt]: "application/json",
+    [Ht]: "web",
+    [Kt]: Eo,
+    [qt]: `${qe(t)}`
   };
-  return e != null && (r = { ...r, ...e }), r;
+  return e && (n = { ...n, ...e }), r && (n = { ...r, ...n }), n;
 }
-const Gt = "/v1/subscribers", Le = "/rcbilling/v1";
-class Ao {
+const jt = "/v1/subscribers", Oe = "/rcbilling/v1";
+class vo {
   constructor(e) {
     P(this, "appUserId");
     P(this, "method", "GET");
     P(this, "name", "getOfferings");
     this.appUserId = e;
   }
-  url() {
+  urlPath() {
     const e = encodeURIComponent(this.appUserId);
-    return `${fe}${Gt}/${e}/offerings`;
+    return `${jt}/${e}/offerings`;
   }
 }
-class ho {
+class $o {
   constructor() {
     P(this, "method", "POST");
     P(this, "name", "subscribe");
   }
-  url() {
-    return `${fe}${Le}/subscribe`;
+  urlPath() {
+    return `${Oe}/subscribe`;
   }
 }
-class Eo {
+class Bo {
   constructor(e, r) {
     P(this, "method", "GET");
     P(this, "name", "getProducts");
@@ -4260,70 +4276,84 @@ class Eo {
     P(this, "productIds");
     this.appUserId = e, this.productIds = r;
   }
-  url() {
+  urlPath() {
     const e = encodeURIComponent(this.appUserId), r = this.productIds.map(encodeURIComponent).join("&id=");
-    return `${fe}${Le}/subscribers/${e}/products?id=${r}`;
+    return `${Oe}/subscribers/${e}/products?id=${r}`;
   }
 }
-class bo {
+class Do {
   constructor(e) {
     P(this, "method", "GET");
     P(this, "name", "getCustomerInfo");
     P(this, "appUserId");
     this.appUserId = e;
   }
-  url() {
+  urlPath() {
     const e = encodeURIComponent(this.appUserId);
-    return `${fe}${Gt}/${e}`;
+    return `${jt}/${e}`;
   }
 }
-class Io {
+class Co {
   constructor() {
     P(this, "method", "GET");
     P(this, "name", "getBrandingInfo");
   }
-  url() {
-    return `${fe}${Le}/branding`;
+  urlPath() {
+    return `${Oe}/branding`;
   }
 }
-class wo {
+class Po {
   constructor(e) {
     P(this, "method", "GET");
     P(this, "name", "getCheckoutStatus");
     P(this, "operationSessionId");
     this.operationSessionId = e;
   }
-  url() {
-    return `${fe}${Le}/checkout/${this.operationSessionId}`;
+  urlPath() {
+    return `${Oe}/checkout/${this.operationSessionId}`;
   }
 }
-class ko {
-  constructor(e) {
+const je = {};
+class Mo {
+  constructor(e, r = je) {
     P(this, "API_KEY");
-    this.API_KEY = e;
+    P(this, "httpConfig");
+    this.API_KEY = e, this.httpConfig = r;
   }
   async getOfferings(e) {
     return await oe(
-      new Ao(e),
-      this.API_KEY
+      new vo(e),
+      {
+        apiKey: this.API_KEY,
+        httpConfig: this.httpConfig
+      }
     );
   }
   async getCustomerInfo(e) {
     return await oe(
-      new bo(e),
-      this.API_KEY
+      new Do(e),
+      {
+        apiKey: this.API_KEY,
+        httpConfig: this.httpConfig
+      }
     );
   }
   async getProducts(e, r) {
     return await oe(
-      new Eo(e, r),
-      this.API_KEY
+      new Bo(e, r),
+      {
+        apiKey: this.API_KEY,
+        httpConfig: this.httpConfig
+      }
     );
   }
   async getBrandingInfo() {
     return await oe(
-      new Io(),
-      this.API_KEY
+      new Co(),
+      {
+        apiKey: this.API_KEY,
+        httpConfig: this.httpConfig
+      }
     );
   }
   async postSubscribe(e, r, n, i, o) {
@@ -4331,27 +4361,36 @@ class ko {
       app_user_id: e,
       product_id: r,
       email: n,
-      presented_offering_identifier: i
+      presented_offering_identifier: i.offeringIdentifier
     };
-    return o && o !== "base_option" && (s.offer_id = o), await oe(
-      new ho(),
-      this.API_KEY,
-      s
+    return o && o !== "base_option" && (s.offer_id = o), i.targetingContext && (s.applied_targeting_rule = {
+      rule_id: i.targetingContext.ruleId,
+      revision: i.targetingContext.revision
+    }), await oe(
+      new $o(),
+      {
+        apiKey: this.API_KEY,
+        body: s,
+        httpConfig: this.httpConfig
+      }
     );
   }
   async getCheckoutStatus(e) {
     return await oe(
-      new wo(e),
-      this.API_KEY
+      new Po(e),
+      {
+        apiKey: this.API_KEY,
+        httpConfig: this.httpConfig
+      }
     );
   }
 }
-const $o = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20opacity='0.5'%20clip-path='url(%23clip0_344_3390)'%3e%3cpath%20d='M7%2018C5.9%2018%205.01%2018.9%205.01%2020C5.01%2021.1%205.9%2022%207%2022C8.1%2022%209%2021.1%209%2020C9%2018.9%208.1%2018%207%2018ZM1%202V4H3L6.6%2011.59L5.25%2014.04C5.09%2014.32%205%2014.65%205%2015C5%2016.1%205.9%2017%207%2017H19V15H7.42C7.28%2015%207.17%2014.89%207.17%2014.75L7.2%2014.63L8.1%2013H15.55C16.3%2013%2016.96%2012.59%2017.3%2011.97L20.88%205.48C20.96%205.34%2021%205.17%2021%205C21%204.45%2020.55%204%2020%204H5.21L4.27%202H1ZM17%2018C15.9%2018%2015.01%2018.9%2015.01%2020C15.01%2021.1%2015.9%2022%2017%2022C18.1%2022%2019%2021.1%2019%2020C19%2018.9%2018.1%2018%2017%2018Z'%20fill='white'/%3e%3c/g%3e%3cdefs%3e%3cclipPath%20id='clip0_344_3390'%3e%3crect%20width='24'%20height='24'%20fill='white'/%3e%3c/clipPath%3e%3c/defs%3e%3c/svg%3e";
-function vo(t) {
+const Qo = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20opacity='0.5'%20clip-path='url(%23clip0_344_3390)'%3e%3cpath%20d='M7%2018C5.9%2018%205.01%2018.9%205.01%2020C5.01%2021.1%205.9%2022%207%2022C8.1%2022%209%2021.1%209%2020C9%2018.9%208.1%2018%207%2018ZM1%202V4H3L6.6%2011.59L5.25%2014.04C5.09%2014.32%205%2014.65%205%2015C5%2016.1%205.9%2017%207%2017H19V15H7.42C7.28%2015%207.17%2014.89%207.17%2014.75L7.2%2014.63L8.1%2013H15.55C16.3%2013%2016.96%2012.59%2017.3%2011.97L20.88%205.48C20.96%205.34%2021%205.17%2021%205C21%204.45%2020.55%204%2020%204H5.21L4.27%202H1ZM17%2018C15.9%2018%2015.01%2018.9%2015.01%2020C15.01%2021.1%2015.9%2022%2017%2022C18.1%2022%2019%2021.1%2019%2020C19%2018.9%2018.1%2018%2017%2018Z'%20fill='white'/%3e%3c/g%3e%3cdefs%3e%3cclipPath%20id='clip0_344_3390'%3e%3crect%20width='24'%20height='24'%20fill='white'/%3e%3c/clipPath%3e%3c/defs%3e%3c/svg%3e";
+function To(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), ee(e.src, r = $o) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
+      e = k("img"), ee(e.src, r = Qo) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
     },
     m(n, i) {
       p(n, e, i);
@@ -4364,15 +4403,15 @@ function vo(t) {
     }
   };
 }
-class yo extends U {
+class No extends R {
   constructor(e) {
-    super(), N(this, e, null, vo, T, {});
+    super(), N(this, e, null, To, T, {});
   }
 }
-function Bo(t) {
+function Ro(t) {
   F(t, "svelte-1rhrjxe", "div.svelte-1rhrjxe{background-color:var(--rc-color-warning);color:var(--rc-color-grey-text-dark);font-size:10px;font-weight:bold;text-transform:uppercase;padding:4px 10px;line-height:10px;border-radius:9px;margin:0px;margin-left:16px}");
 }
-function Do(t) {
+function Uo(t) {
   let e;
   return {
     c() {
@@ -4389,23 +4428,23 @@ function Do(t) {
     }
   };
 }
-class Mo extends U {
+class So extends R {
   constructor(e) {
-    super(), N(this, e, null, Do, T, {}, Bo);
+    super(), N(this, e, null, Uo, T, {}, Ro);
   }
 }
-function Qo(t) {
+function Oo(t) {
   F(t, "svelte-1qect5g", `.rcb-ui-container.svelte-1qect5g{color-scheme:none;font-size:16px;line-height:1.5em;font-weight:400;font-family:-apple-system, "system-ui", "Segoe UI", Roboto, Oxygen, Ubuntu,
         Cantarell, "Open Sans", "Helvetica Neue", sans-serif}.rcb-ui-layout.svelte-1qect5g{width:100vw;width:100 dvw;margin-right:auto;display:flex;justify-content:center;align-items:flex-start;position:relative;padding:0px 80px;box-sizing:border-box}.rcb-ui-aside.svelte-1qect5g{margin-right:16px;flex:320px 1 0;max-width:480px}.rcb-ui-main.svelte-1qect5g{flex:480px 1 0;max-width:640px}@media screen and (max-width: 960px){.rcb-ui-layout.svelte-1qect5g{flex-direction:column;align-items:center;justify-content:center;height:100%;min-width:100%}.rcb-ui-aside.svelte-1qect5g{margin-right:0;margin-bottom:16px;min-width:100%;display:flex;flex-direction:column;align-items:center;flex:none;max-width:none}.rcb-ui-main.svelte-1qect5g{flex:none;max-width:none;min-width:100%}}@media screen and (max-width: 960px) and (max-height: 960px){.rcb-ui-layout.svelte-1qect5g{overflow-y:scroll;justify-content:flex-start;padding:16px 0px}}`);
 }
-function At(t) {
+function _t(t) {
   let e, r, n;
-  return r = new xt({
+  return r = new Ft({
     props: {
       dark: !0,
       $$slots: {
-        header: [Uo],
-        default: [Po]
+        header: [Go],
+        default: [Lo]
       },
       $$scope: { ctx: t }
     }
@@ -4434,7 +4473,7 @@ function At(t) {
 }
 function ht(t) {
   let e, r;
-  return e = new Ct({
+  return e = new Mt({
     props: {
       productDetails: (
         /*productDetails*/
@@ -4469,7 +4508,7 @@ function ht(t) {
     }
   };
 }
-function Po(t) {
+function Lo(t) {
   let e, r, n = (
     /*productDetails*/
     t[2] && /*purchaseOptionToUse*/
@@ -4501,9 +4540,9 @@ function Po(t) {
     }
   };
 }
-function Co(t) {
+function Fo(t) {
   let e, r;
-  return e = new yo({}), {
+  return e = new No({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -4521,9 +4560,9 @@ function Co(t) {
     }
   };
 }
-function To(t) {
+function xo(t) {
   let e, r;
-  return e = new Mo({}), {
+  return e = new So({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -4541,34 +4580,34 @@ function To(t) {
     }
   };
 }
-function No(t) {
+function Yo(t) {
   let e, r, n, i, o, s, l;
-  e = new Ut({
+  e = new Nt({
     props: { brandingInfo: (
       /*brandingInfo*/
       t[3]
     ) }
   });
-  const c = [To, Co], a = [];
-  function u(m, A) {
-    return A & /*purchases*/
+  const c = [xo, Fo], a = [];
+  function u(m, h) {
+    return h & /*purchases*/
     2 && (n = null), n == null && (n = !!/*purchases*/
     m[1].isSandbox()), n ? 0 : 1;
   }
   return i = u(t, -1), o = a[i] = c[i](t), {
     c() {
-      w(e.$$.fragment), r = C(), o.c(), s = te();
+      w(e.$$.fragment), r = Q(), o.c(), s = te();
     },
-    m(m, A) {
-      b(e, m, A), p(m, r, A), a[i].m(m, A), p(m, s, A), l = !0;
+    m(m, h) {
+      b(e, m, h), p(m, r, h), a[i].m(m, h), p(m, s, h), l = !0;
     },
-    p(m, A) {
-      const $ = {};
-      A & /*brandingInfo*/
-      8 && ($.brandingInfo = /*brandingInfo*/
-      m[3]), e.$set($);
+    p(m, h) {
+      const y = {};
+      h & /*brandingInfo*/
+      8 && (y.brandingInfo = /*brandingInfo*/
+      m[3]), e.$set(y);
       let E = i;
-      i = u(m, A), i !== E && (H(), d(a[E], 1, 1, () => {
+      i = u(m, h), i !== E && (H(), d(a[E], 1, 1, () => {
         a[E] = null;
       }), K(), o = a[i], o || (o = a[i] = c[i](m), o.c()), f(o, 1), o.m(s.parentNode, s));
     },
@@ -4583,12 +4622,12 @@ function No(t) {
     }
   };
 }
-function Uo(t) {
+function Go(t) {
   let e, r;
   return e = new Xe({
     props: {
       slot: "header",
-      $$slots: { default: [No] },
+      $$slots: { default: [Yo] },
       $$scope: { ctx: t }
     }
   }), {
@@ -4614,9 +4653,9 @@ function Uo(t) {
     }
   };
 }
-function Et(t) {
+function At(t) {
   let e, r;
-  return e = new Ct({
+  return e = new Mt({
     props: {
       productDetails: (
         /*productDetails*/
@@ -4651,7 +4690,7 @@ function Et(t) {
     }
   };
 }
-function bt(t) {
+function Et(t) {
   let e, r;
   return e = new We({}), {
     c() {
@@ -4671,9 +4710,9 @@ function bt(t) {
     }
   };
 }
-function It(t) {
+function bt(t) {
   let e, r;
-  return e = new ji({
+  return e = new Zi({
     props: {
       onContinue: (
         /*handleContinue*/
@@ -4718,9 +4757,9 @@ function It(t) {
     }
   };
 }
-function wt(t) {
+function It(t) {
   let e, r;
-  return e = new Ni({
+  return e = new Fi({
     props: {
       paymentInfoCollectionMetadata: (
         /*paymentInfoCollectionMetadata*/
@@ -4769,7 +4808,7 @@ function wt(t) {
     }
   };
 }
-function kt(t) {
+function wt(t) {
   let e, r;
   return e = new We({}), {
     c() {
@@ -4789,10 +4828,10 @@ function kt(t) {
     }
   };
 }
-function $t(t) {
+function kt(t) {
   var n;
   let e, r;
-  return e = new Or({
+  return e = new Hr({
     props: {
       brandingInfo: (
         /*brandingInfo*/
@@ -4800,7 +4839,7 @@ function $t(t) {
       ),
       lastError: (
         /*lastError*/
-        t[5] ?? new Y(O.UnknownError, "Unknown error without state set.")
+        t[5] ?? new G(O.UnknownError, "Unknown error without state set.")
       ),
       supportEmail: (
         /*brandingInfo*/
@@ -4825,7 +4864,7 @@ function $t(t) {
       8 && (s.brandingInfo = /*brandingInfo*/
       i[3]), o & /*lastError*/
       32 && (s.lastError = /*lastError*/
-      i[5] ?? new Y(O.UnknownError, "Unknown error without state set.")), o & /*brandingInfo*/
+      i[5] ?? new G(O.UnknownError, "Unknown error without state set.")), o & /*brandingInfo*/
       8 && (s.supportEmail = /*brandingInfo*/
       (l = i[3]) == null ? void 0 : l.seller_company_support_email), e.$set(s);
     },
@@ -4840,9 +4879,9 @@ function $t(t) {
     }
   };
 }
-function vt(t) {
+function yt(t) {
   let e, r;
-  return e = new jr({
+  return e = new Zr({
     props: {
       brandingInfo: (
         /*brandingInfo*/
@@ -4877,106 +4916,106 @@ function vt(t) {
     }
   };
 }
-function Ro(t) {
+function Ho(t) {
   let e, r, n, i, o, s, l, c, a = (
     /*state*/
     t[6] === "present-offer" && /*productDetails*/
     t[2] && /*purchaseOptionToUse*/
-    t[8] && Et(t)
+    t[8] && At(t)
   ), u = (
     /*state*/
     t[6] === "present-offer" && !/*productDetails*/
-    t[2] && bt()
+    t[2] && Et()
   ), m = (
     /*state*/
     (t[6] === "needs-auth-info" || /*state*/
-    t[6] === "processing-auth-info") && It(t)
-  ), A = (
+    t[6] === "processing-auth-info") && bt(t)
+  ), h = (
     /*paymentInfoCollectionMetadata*/
     t[4] && /*state*/
     (t[6] === "needs-payment-info" || /*state*/
-    t[6] === "polling-purchase-status") && wt(t)
-  ), $ = (
+    t[6] === "polling-purchase-status") && It(t)
+  ), y = (
     /*state*/
-    t[6] === "loading" && kt()
+    t[6] === "loading" && wt()
   ), E = (
     /*state*/
-    t[6] === "error" && $t(t)
+    t[6] === "error" && kt(t)
   ), B = (
     /*state*/
-    t[6] === "success" && vt(t)
+    t[6] === "success" && yt(t)
   );
   return {
     c() {
-      a && a.c(), e = C(), u && u.c(), r = C(), m && m.c(), n = C(), A && A.c(), i = C(), $ && $.c(), o = C(), E && E.c(), s = C(), B && B.c(), l = te();
+      a && a.c(), e = Q(), u && u.c(), r = Q(), m && m.c(), n = Q(), h && h.c(), i = Q(), y && y.c(), o = Q(), E && E.c(), s = Q(), B && B.c(), l = te();
     },
-    m(h, y) {
-      a && a.m(h, y), p(h, e, y), u && u.m(h, y), p(h, r, y), m && m.m(h, y), p(h, n, y), A && A.m(h, y), p(h, i, y), $ && $.m(h, y), p(h, o, y), E && E.m(h, y), p(h, s, y), B && B.m(h, y), p(h, l, y), c = !0;
+    m(A, $) {
+      a && a.m(A, $), p(A, e, $), u && u.m(A, $), p(A, r, $), m && m.m(A, $), p(A, n, $), h && h.m(A, $), p(A, i, $), y && y.m(A, $), p(A, o, $), E && E.m(A, $), p(A, s, $), B && B.m(A, $), p(A, l, $), c = !0;
     },
-    p(h, y) {
+    p(A, $) {
       /*state*/
-      h[6] === "present-offer" && /*productDetails*/
-      h[2] && /*purchaseOptionToUse*/
-      h[8] ? a ? (a.p(h, y), y & /*state, productDetails*/
-      68 && f(a, 1)) : (a = Et(h), a.c(), f(a, 1), a.m(e.parentNode, e)) : a && (H(), d(a, 1, 1, () => {
+      A[6] === "present-offer" && /*productDetails*/
+      A[2] && /*purchaseOptionToUse*/
+      A[8] ? a ? (a.p(A, $), $ & /*state, productDetails*/
+      68 && f(a, 1)) : (a = At(A), a.c(), f(a, 1), a.m(e.parentNode, e)) : a && (H(), d(a, 1, 1, () => {
         a = null;
       }), K()), /*state*/
-      h[6] === "present-offer" && !/*productDetails*/
-      h[2] ? u ? y & /*state, productDetails*/
-      68 && f(u, 1) : (u = bt(), u.c(), f(u, 1), u.m(r.parentNode, r)) : u && (H(), d(u, 1, 1, () => {
+      A[6] === "present-offer" && !/*productDetails*/
+      A[2] ? u ? $ & /*state, productDetails*/
+      68 && f(u, 1) : (u = Et(), u.c(), f(u, 1), u.m(r.parentNode, r)) : u && (H(), d(u, 1, 1, () => {
         u = null;
       }), K()), /*state*/
-      h[6] === "needs-auth-info" || /*state*/
-      h[6] === "processing-auth-info" ? m ? (m.p(h, y), y & /*state*/
-      64 && f(m, 1)) : (m = It(h), m.c(), f(m, 1), m.m(n.parentNode, n)) : m && (H(), d(m, 1, 1, () => {
+      A[6] === "needs-auth-info" || /*state*/
+      A[6] === "processing-auth-info" ? m ? (m.p(A, $), $ & /*state*/
+      64 && f(m, 1)) : (m = bt(A), m.c(), f(m, 1), m.m(n.parentNode, n)) : m && (H(), d(m, 1, 1, () => {
         m = null;
       }), K()), /*paymentInfoCollectionMetadata*/
-      h[4] && /*state*/
-      (h[6] === "needs-payment-info" || /*state*/
-      h[6] === "polling-purchase-status") ? A ? (A.p(h, y), y & /*paymentInfoCollectionMetadata, state*/
-      80 && f(A, 1)) : (A = wt(h), A.c(), f(A, 1), A.m(i.parentNode, i)) : A && (H(), d(A, 1, 1, () => {
-        A = null;
+      A[4] && /*state*/
+      (A[6] === "needs-payment-info" || /*state*/
+      A[6] === "polling-purchase-status") ? h ? (h.p(A, $), $ & /*paymentInfoCollectionMetadata, state*/
+      80 && f(h, 1)) : (h = It(A), h.c(), f(h, 1), h.m(i.parentNode, i)) : h && (H(), d(h, 1, 1, () => {
+        h = null;
       }), K()), /*state*/
-      h[6] === "loading" ? $ ? y & /*state*/
-      64 && f($, 1) : ($ = kt(), $.c(), f($, 1), $.m(o.parentNode, o)) : $ && (H(), d($, 1, 1, () => {
-        $ = null;
+      A[6] === "loading" ? y ? $ & /*state*/
+      64 && f(y, 1) : (y = wt(), y.c(), f(y, 1), y.m(o.parentNode, o)) : y && (H(), d(y, 1, 1, () => {
+        y = null;
       }), K()), /*state*/
-      h[6] === "error" ? E ? (E.p(h, y), y & /*state*/
-      64 && f(E, 1)) : (E = $t(h), E.c(), f(E, 1), E.m(s.parentNode, s)) : E && (H(), d(E, 1, 1, () => {
+      A[6] === "error" ? E ? (E.p(A, $), $ & /*state*/
+      64 && f(E, 1)) : (E = kt(A), E.c(), f(E, 1), E.m(s.parentNode, s)) : E && (H(), d(E, 1, 1, () => {
         E = null;
       }), K()), /*state*/
-      h[6] === "success" ? B ? (B.p(h, y), y & /*state*/
-      64 && f(B, 1)) : (B = vt(h), B.c(), f(B, 1), B.m(l.parentNode, l)) : B && (H(), d(B, 1, 1, () => {
+      A[6] === "success" ? B ? (B.p(A, $), $ & /*state*/
+      64 && f(B, 1)) : (B = yt(A), B.c(), f(B, 1), B.m(l.parentNode, l)) : B && (H(), d(B, 1, 1, () => {
         B = null;
       }), K());
     },
-    i(h) {
-      c || (f(a), f(u), f(m), f(A), f($), f(E), f(B), c = !0);
+    i(A) {
+      c || (f(a), f(u), f(m), f(h), f(y), f(E), f(B), c = !0);
     },
-    o(h) {
-      d(a), d(u), d(m), d(A), d($), d(E), d(B), c = !1;
+    o(A) {
+      d(a), d(u), d(m), d(h), d(y), d(E), d(B), c = !1;
     },
-    d(h) {
-      h && (g(e), g(r), g(n), g(i), g(o), g(s), g(l)), a && a.d(h), u && u.d(h), m && m.d(h), A && A.d(h), $ && $.d(h), E && E.d(h), B && B.d(h);
+    d(A) {
+      A && (g(e), g(r), g(n), g(i), g(o), g(s), g(l)), a && a.d(A), u && u.d(A), m && m.d(A), h && h.d(A), y && y.d(A), E && E.d(A), B && B.d(A);
     }
   };
 }
-function So(t) {
+function Ko(t) {
   let e, r = (
     /*statesWhereOfferDetailsAreShown*/
     t[9].includes(
       /*state*/
       t[6]
     )
-  ), n, i, o, s, l = r && At(t);
-  return o = new xt({
+  ), n, i, o, s, l = r && _t(t);
+  return o = new Ft({
     props: {
-      $$slots: { default: [Ro] },
+      $$slots: { default: [Ho] },
       $$scope: { ctx: t }
     }
   }), {
     c() {
-      e = k("div"), l && l.c(), n = C(), i = k("div"), w(o.$$.fragment), _(i, "class", "rcb-ui-main svelte-1qect5g"), _(e, "class", "rcb-ui-layout svelte-1qect5g"), _(
+      e = k("div"), l && l.c(), n = Q(), i = k("div"), w(o.$$.fragment), _(i, "class", "rcb-ui-main svelte-1qect5g"), _(e, "class", "rcb-ui-layout svelte-1qect5g"), _(
         e,
         "style",
         /*colorVariables*/
@@ -4984,7 +5023,7 @@ function So(t) {
       );
     },
     m(c, a) {
-      p(c, e, a), l && l.m(e, null), Q(e, n), Q(e, i), b(o, i, null), s = !0;
+      p(c, e, a), l && l.m(e, null), M(e, n), M(e, i), b(o, i, null), s = !0;
     },
     p(c, a) {
       a & /*state*/
@@ -4993,7 +5032,7 @@ function So(t) {
         /*state*/
         c[6]
       )), r ? l ? (l.p(c, a), a & /*state*/
-      64 && f(l, 1)) : (l = At(c), l.c(), f(l, 1), l.m(e, n)) : l && (H(), d(l, 1, 1, () => {
+      64 && f(l, 1)) : (l = _t(c), l.c(), f(l, 1), l.m(e, n)) : l && (H(), d(l, 1, 1, () => {
         l = null;
       }), K());
       const u = {};
@@ -5011,15 +5050,15 @@ function So(t) {
     }
   };
 }
-function Oo(t) {
+function qo(t) {
   let e, r, n;
-  return r = new lo({
+  return r = new go({
     props: {
       condition: (
         /*asModal*/
         t[0]
       ),
-      $$slots: { default: [So] },
+      $$slots: { default: [Ko] },
       $$scope: { ctx: t }
     }
   }), {
@@ -5047,14 +5086,14 @@ function Oo(t) {
     }
   };
 }
-function Lo(t, e, r) {
+function jo(t, e, r) {
   var et, tt;
-  let { asModal: n = !0 } = e, { customerEmail: i } = e, { appUserId: o } = e, { rcPackage: s } = e, { purchaseOption: l } = e, { onFinished: c } = e, { onError: a } = e, { onClose: u } = e, { purchases: m } = e, { backend: A } = e, { purchaseOperationHelper: $ } = e;
-  const E = Object.entries(_e).map(([D, Fe]) => `--rc-color-${D}: ${Fe}`).join("; ");
-  let B = null, h = null, y = null, R = null;
-  const M = ((et = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : et.identifier) ?? null, ye = (tt = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : tt.defaultSubscriptionOption, x = l || ye;
+  let { asModal: n = !0 } = e, { customerEmail: i } = e, { appUserId: o } = e, { rcPackage: s } = e, { purchaseOption: l } = e, { onFinished: c } = e, { onError: a } = e, { onClose: u } = e, { purchases: m } = e, { backend: h } = e, { purchaseOperationHelper: y } = e;
+  const E = Object.entries(pe).map(([D, Le]) => `--rc-color-${D}: ${Le}`).join("; ");
+  let B = null, A = null, $ = null, U = null;
+  const C = ((et = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : et.identifier) ?? null, ve = (tt = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : tt.defaultSubscriptionOption, x = l || ve;
   let S = "present-offer";
-  const Be = [
+  const $e = [
     "present-offer",
     "needs-auth-info",
     "processing-auth-info",
@@ -5062,46 +5101,46 @@ function Lo(t, e, r) {
     "polling-purchase-status",
     "loading"
   ];
-  Oe(async () => {
-    if (r(2, B = s.rcBillingProduct), r(3, h = await A.getBrandingInfo()), S === "present-offer") {
+  Se(async () => {
+    if (r(2, B = s.rcBillingProduct), r(3, A = await h.getBrandingInfo()), S === "present-offer") {
       i ? Ze() : r(6, S = "needs-auth-info");
       return;
     }
   });
-  const De = () => {
+  const Be = () => {
     u();
   }, Ze = () => {
-    if (M === null) {
-      de(new Y(O.ErrorSettingUpPurchase, "Product ID was not set before purchase."));
+    if (C === null) {
+      fe(new G(O.ErrorSettingUpPurchase, "Product ID was not set before purchase."));
       return;
     } else
       S === "present-offer" && r(6, S = "loading");
     if (!i) {
-      de(new Y(O.MissingEmailError));
+      fe(new G(O.MissingEmailError));
       return;
     }
-    $.startPurchase(o, M, x, i, s.rcBillingProduct.presentedOfferingIdentifier).then((D) => {
+    y.startPurchase(o, C, x, i, s.rcBillingProduct.presentedOfferingContext).then((D) => {
       if (D.next_action === "collect_payment_info") {
-        r(5, R = null), r(6, S = "needs-payment-info"), r(4, y = D);
+        r(5, U = null), r(6, S = "needs-payment-info"), r(4, $ = D);
         return;
       }
       if (D.next_action === "completed") {
-        r(5, R = null), r(6, S = "success");
+        r(5, U = null), r(6, S = "success");
         return;
       }
     }).catch((D) => {
-      de(D);
+      fe(D);
     });
-  }, Yt = (D) => {
+  }, Jt = (D) => {
     if (S === "needs-auth-info") {
       D && (r(14, i = D.email), r(6, S = "processing-auth-info")), Ze();
       return;
     }
     if (S === "needs-payment-info") {
-      r(6, S = "polling-purchase-status"), $.pollCurrentPurchaseForCompletion().then(() => {
+      r(6, S = "polling-purchase-status"), y.pollCurrentPurchaseForCompletion().then(() => {
         r(6, S = "success");
-      }).catch((Fe) => {
-        de(Fe);
+      }).catch((Le) => {
+        fe(Le);
       });
       return;
     }
@@ -5110,32 +5149,32 @@ function Lo(t, e, r) {
       return;
     }
     r(6, S = "success");
-  }, de = (D) => {
+  }, fe = (D) => {
     if (S === "processing-auth-info") {
-      r(5, R = D), r(6, S = "needs-auth-info");
+      r(5, U = D), r(6, S = "needs-auth-info");
       return;
     }
-    r(5, R = D), r(6, S = "error");
-  }, Ht = () => {
-    a(R ?? new Y(O.UnknownError, "Unknown error without state set."));
+    r(5, U = D), r(6, S = "error");
+  }, Vt = () => {
+    a(U ?? new G(O.UnknownError, "Unknown error without state set."));
   };
   return t.$$set = (D) => {
-    "asModal" in D && r(0, n = D.asModal), "customerEmail" in D && r(14, i = D.customerEmail), "appUserId" in D && r(15, o = D.appUserId), "rcPackage" in D && r(16, s = D.rcPackage), "purchaseOption" in D && r(17, l = D.purchaseOption), "onFinished" in D && r(18, c = D.onFinished), "onError" in D && r(19, a = D.onError), "onClose" in D && r(20, u = D.onClose), "purchases" in D && r(1, m = D.purchases), "backend" in D && r(21, A = D.backend), "purchaseOperationHelper" in D && r(22, $ = D.purchaseOperationHelper);
+    "asModal" in D && r(0, n = D.asModal), "customerEmail" in D && r(14, i = D.customerEmail), "appUserId" in D && r(15, o = D.appUserId), "rcPackage" in D && r(16, s = D.rcPackage), "purchaseOption" in D && r(17, l = D.purchaseOption), "onFinished" in D && r(18, c = D.onFinished), "onError" in D && r(19, a = D.onError), "onClose" in D && r(20, u = D.onClose), "purchases" in D && r(1, m = D.purchases), "backend" in D && r(21, h = D.backend), "purchaseOperationHelper" in D && r(22, y = D.purchaseOperationHelper);
   }, [
     n,
     m,
     B,
-    h,
-    y,
-    R,
+    A,
+    $,
+    U,
     S,
     E,
     x,
+    $e,
     Be,
-    De,
-    Yt,
-    de,
-    Ht,
+    Jt,
+    fe,
+    Vt,
     i,
     o,
     s,
@@ -5143,17 +5182,17 @@ function Lo(t, e, r) {
     c,
     a,
     u,
-    A,
-    $
+    h,
+    y
   ];
 }
-class Fo extends U {
+class Jo extends R {
   constructor(e) {
     super(), N(
       this,
       e,
-      Lo,
-      Oo,
+      jo,
+      qo,
       T,
       {
         asModal: 0,
@@ -5168,53 +5207,53 @@ class Fo extends U {
         backend: 21,
         purchaseOperationHelper: 22
       },
-      Qo
+      Oo
     );
   }
 }
-function xo(t) {
+function Vo(t) {
   return t.expires_date == null ? !0 : new Date(t.expires_date) > /* @__PURE__ */ new Date();
 }
-function Go(t, e, r, n) {
+function Wo(t, e, r, n) {
   const i = e.product_identifier;
   if (i in r)
-    return Yo(
+    return zo(
       t,
       e,
       r[i]
     );
   if (i in n)
-    return Ho(
+    return Xo(
       t,
       e,
       n[i]
     );
-  throw new X(
-    Z.CustomerInfoError,
+  throw new W(
+    X.CustomerInfoError,
     "Could not find entitlement product in subscriptions or non-subscriptions."
   );
 }
-function Yo(t, e, r) {
+function zo(t, e, r) {
   return {
     identifier: t,
-    isActive: xo(e),
-    willRenew: jo(e, r),
+    isActive: Vo(e),
+    willRenew: ts(e, r),
     store: (r == null ? void 0 : r.store) ?? "unknown",
     latestPurchaseDate: new Date(e.purchase_date),
     originalPurchaseDate: new Date(e.purchase_date),
-    expirationDate: Ue(e.expires_date),
+    expirationDate: Ne(e.expires_date),
     productIdentifier: e.product_identifier,
-    unsubscribeDetectedAt: Ue(
+    unsubscribeDetectedAt: Ne(
       r == null ? void 0 : r.unsubscribe_detected_at
     ),
-    billingIssueDetectedAt: Ue(
+    billingIssueDetectedAt: Ne(
       r == null ? void 0 : r.billing_issues_detected_at
     ),
     isSandbox: (r == null ? void 0 : r.is_sandbox) ?? !1,
     periodType: (r == null ? void 0 : r.period_type) ?? "normal"
   };
 }
-function Ho(t, e, r) {
+function Xo(t, e, r) {
   return {
     identifier: t,
     isActive: !0,
@@ -5232,10 +5271,10 @@ function Ho(t, e, r) {
     periodType: "normal"
   };
 }
-function Ko(t, e, r) {
+function Zo(t, e, r) {
   const n = {}, i = {};
   for (const o in t) {
-    const s = Go(
+    const s = Wo(
       o,
       t[o],
       e,
@@ -5248,41 +5287,41 @@ function Ko(t, e, r) {
     active: i
   };
 }
-function Ue(t) {
+function Ne(t) {
   return t == null ? null : new Date(t);
 }
-function qo(t) {
-  const e = Vo(t), r = t.subscriber, n = zo(
+function es(t) {
+  const e = rs(t), r = t.subscriber, n = os(
     r.non_subscriptions
   );
   return {
-    entitlements: Ko(
+    entitlements: Zo(
       r.entitlements,
       r.subscriptions,
       n
     ),
     allExpirationDatesByProduct: e,
-    allPurchaseDatesByProduct: Jo(
+    allPurchaseDatesByProduct: ns(
       t,
       n
     ),
-    activeSubscriptions: Wo(e),
+    activeSubscriptions: is(e),
     managementURL: r.management_url,
     requestDate: new Date(t.request_date),
     firstSeenDate: new Date(r.first_seen),
-    originalPurchaseDate: Ue(
+    originalPurchaseDate: Ne(
       r.original_purchase_date
     ),
     originalAppUserId: t.subscriber.original_app_user_id
   };
 }
-function jo(t, e) {
+function ts(t, e) {
   if (e == null)
     return !1;
   const r = e.store == "promotional", n = t.expires_date == null, i = e.unsubscribe_detected_at != null, o = e.billing_issues_detected_at != null;
   return !(r || n || i || o);
 }
-function Jo(t, e) {
+function ns(t, e) {
   const r = {};
   for (const n in t.subscriber.subscriptions) {
     const i = t.subscriber.subscriptions[n];
@@ -5296,7 +5335,7 @@ function Jo(t, e) {
   }
   return r;
 }
-function Vo(t) {
+function rs(t) {
   const e = {};
   for (const r in t.subscriber.subscriptions) {
     const n = t.subscriber.subscriptions[r];
@@ -5306,7 +5345,7 @@ function Vo(t) {
   }
   return e;
 }
-function Wo(t) {
+function is(t) {
   const e = /* @__PURE__ */ new Set(), r = /* @__PURE__ */ new Date();
   for (const n in t) {
     const i = t[n];
@@ -5314,7 +5353,7 @@ function Wo(t) {
   }
   return e;
 }
-function zo(t) {
+function os(t) {
   const e = {};
   for (const r in t) {
     if (t[r].length === 0)
@@ -5324,14 +5363,14 @@ function zo(t) {
   }
   return e;
 }
-function Xo(t) {
+function ss(t) {
   if (!/^rcb_[a-zA-Z0-9_.-]+$/.test(t))
-    throw new X(
-      Z.InvalidCredentialsError,
+    throw new W(
+      X.InvalidCredentialsError,
       "Invalid API key. Use your RevenueCat Billing API key."
     );
 }
-function Zo(t) {
+function ls(t) {
   if ((/* @__PURE__ */ new Set([
     "no_user",
     "null",
@@ -5345,14 +5384,31 @@ function Zo(t) {
     "undefined",
     "unknown"
   ])).has(t) || t.includes("/"))
-    throw new X(
-      Z.InvalidAppUserIdError,
+    throw new W(
+      X.InvalidAppUserIdError,
       'Provided user id: "' + t + '" is not valid. See https://www.revenuecat.com/docs/customers/user-ids#tips-for-setting-app-user-ids for more information.'
     );
 }
-const z = class z {
+function cs(t) {
+  if (t != null && t.endsWith("/"))
+    throw new W(
+      X.ConfigurationError,
+      "Invalid proxy URL. The proxy URL should not end with a trailing slash."
+    );
+}
+function as(t) {
+  if (t) {
+    for (const e in t)
+      if (ko.has(e))
+        throw new W(
+          X.ConfigurationError,
+          "Invalid additional headers. Some headers are reserved for internal use."
+        );
+  }
+}
+const Z = class Z {
   /** @internal */
-  constructor(e, r) {
+  constructor(e, r, n = je) {
     /** @internal */
     P(this, "_API_KEY");
     /** @internal */
@@ -5363,24 +5419,29 @@ const z = class z {
     P(this, "purchaseOperationHelper");
     /** @internal */
     P(this, "toOfferings", (e, r) => {
-      const n = e.offerings.find(
-        (l) => l.identifier === e.current_offering_id
-      ) ?? null, i = {};
-      r.product_details.forEach((l) => {
-        i[l.identifier] = l;
+      const n = {};
+      r.product_details.forEach((s) => {
+        n[s.identifier] = s;
+      });
+      const i = {};
+      e.offerings.forEach((s) => {
+        const l = s.identifier === e.current_offering_id, c = cn(
+          l,
+          s,
+          n,
+          e.targeting
+        );
+        c != null && (i[s.identifier] = c);
       });
-      const o = n == null ? null : it(n, i), s = {};
-      return e.offerings.forEach((l) => {
-        const c = it(l, i);
-        c != null && (s[l.identifier] = c);
-      }), Object.keys(s).length == 0 && G.debugLog(
+      const o = e.current_offering_id ? i[e.current_offering_id] ?? null : null;
+      return Object.keys(i).length == 0 && Y.debugLog(
         "Empty offerings. Please make sure you've configured offerings correctly in the RevenueCat dashboard and that the products are properly configured."
       ), {
-        all: s,
+        all: i,
         current: o
       };
     });
-    this._API_KEY = e, this._appUserId = r, je(e) && G.debugLog("Initializing Purchases SDK with sandbox API Key"), this.backend = new ko(this._API_KEY), this.purchaseOperationHelper = new Hn(this.backend);
+    this._API_KEY = e, this._appUserId = r, qe(e) && Y.debugLog("Initializing Purchases SDK with sandbox API Key"), this.backend = new Mo(this._API_KEY, n), this.purchaseOperationHelper = new Wn(this.backend);
   }
   /**
    * Set the log level. Logs of the given level and below will be printed
@@ -5389,7 +5450,7 @@ const z = class z {
    * @param logLevel - LogLevel to set.
    */
   static setLogLevel(e) {
-    G.setLogLevel(e);
+    Y.setLogLevel(e);
   }
   /**
    * Get the singleton instance of Purchases. It's preferred to use the instance
@@ -5397,15 +5458,15 @@ const z = class z {
    * @throws {@link UninitializedPurchasesError} if the instance has not been initialized yet.
    */
   static getSharedInstance() {
-    if (z.isConfigured())
-      return z.instance;
-    throw new Yn();
+    if (Z.isConfigured())
+      return Z.instance;
+    throw new Vn();
   }
   /**
    * Returns whether the Purchases SDK is configured or not.
    */
   static isConfigured() {
-    return z.instance !== void 0;
+    return Z.instance !== void 0;
   }
   /**
    * Configures the Purchases SDK. This should be called as soon as your app
@@ -5413,12 +5474,13 @@ const z = class z {
    * keep the returned instance around for use throughout your application.
    * @param apiKey - RevenueCat API Key. Can be obtained from the RevenueCat dashboard.
    * @param appUserId - Your unique id for identifying the user.
+   * @param httpConfig - Advanced http configuration to customise the SDK usage {@link HttpConfig}.
    * @throws {@link PurchasesError} if the API key or user id are invalid.
    */
-  static configure(e, r) {
-    return z.instance !== void 0 && G.warnLog(
+  static configure(e, r, n = je) {
+    return Z.instance !== void 0 && Y.warnLog(
       "Purchases is already initialized. You normally should only configure Purchases once. Creating and returning new instance."
-    ), Xo(e), Zo(r), z.instance = new z(e, r), z.getSharedInstance();
+    ), ss(e), ls(r), cs(n.proxyURL), as(n.additionalHeaders), Z.instance = new Z(e, r, n), Z.getSharedInstance();
   }
   /**
    * Fetch the configured offerings for this user. You can configure these
@@ -5483,10 +5545,10 @@ const z = class z {
         "Could not generate a mount point for the billing widget"
       );
     const l = s, c = !i, a = this._appUserId;
-    return G.debugLog(
+    return Y.debugLog(
       `Presenting purchase form for package ${r.identifier}`
     ), new Promise((u, m) => {
-      new Fo({
+      new Jo({
         target: l,
         props: {
           appUserId: a,
@@ -5494,15 +5556,15 @@ const z = class z {
           purchaseOption: n,
           customerEmail: o,
           onFinished: async () => {
-            G.debugLog("Purchase finished"), l.innerHTML = "", u({
+            Y.debugLog("Purchase finished"), l.innerHTML = "", u({
               customerInfo: await this._getCustomerInfoForUserId(a)
             });
           },
           onClose: () => {
-            l.innerHTML = "", G.debugLog("Purchase cancelled by user"), m(new X(Z.UserCancelledError));
+            l.innerHTML = "", Y.debugLog("Purchase cancelled by user"), m(new W(X.UserCancelledError));
           },
-          onError: (A) => {
-            l.innerHTML = "", m(X.getForPurchasesFlowError(A));
+          onError: (h) => {
+            l.innerHTML = "", m(W.getForPurchasesFlowError(h));
           },
           purchases: this,
           backend: this.backend,
@@ -5543,7 +5605,7 @@ const z = class z {
     const i = [];
     e.forEach((o) => {
       n[o] === void 0 && i.push(o);
-    }), i.length > 0 && G.debugLog(
+    }), i.length > 0 && Y.debugLog(
       `Could not find product data for product ids: 
         ${i.join()}. 
         Please check that your product configuration is correct.`
@@ -5553,30 +5615,30 @@ const z = class z {
    * @returns Whether the SDK is using a sandbox API Key.
    */
   isSandbox() {
-    return je(this._API_KEY);
+    return qe(this._API_KEY);
   }
   /**
    * Closes the Purchases instance. You should never have to do this normally.
    */
   close() {
-    z.instance === this ? z.instance = void 0 : G.warnLog(
+    Z.instance === this ? Z.instance = void 0 : Y.warnLog(
       "Trying to close a Purchases instance that is not the current instance. Ignoring."
     );
   }
   /** @internal */
   async _getCustomerInfoForUserId(e) {
     const r = await this.backend.getCustomerInfo(e);
-    return qo(r);
+    return es(r);
   }
 };
 /** @internal */
-P(z, "instance");
-let yt = z;
+P(Z, "instance");
+let vt = Z;
 export {
-  Z as ErrorCode,
-  W as LogLevel,
-  zt as PackageType,
-  yt as Purchases,
-  X as PurchasesError,
-  Yn as UninitializedPurchasesError
+  X as ErrorCode,
+  z as LogLevel,
+  nn as PackageType,
+  vt as Purchases,
+  W as PurchasesError,
+  Vn as UninitializedPurchasesError
 };