npm - @revenuecat/purchases-js - Versions diffs - 0.3.3 → 0.4.0 - Mend

@revenuecat/purchases-js 0.3.3 → 0.4.0

This diff represents the content of publicly available package versions that have been released to one of the supported registries. The information contained in this diff is provided for informational purposes only and reflects changes between package versions as they appear in their respective public registries.

Files changed (5) hide show

package/dist/Purchases.es.js CHANGED Viewed

@@ -1,6 +1,6 @@
 var Kt = Object.defineProperty;
 var qt = (t, e, r) => e in t ? Kt(t, e, { enumerable: !0, configurable: !0, writable: !0, value: r }) : t[e] = r;
-var Q = (t, e, r) => (qt(t, typeof e != "symbol" ? e + "" : e, r), r);
+var P = (t, e, r) => (qt(t, typeof e != "symbol" ? e + "" : e, r), r);
 function jt(t) {
   return t != null;
 }
@@ -46,7 +46,7 @@ class G {
     this.log(e, W.Verbose);
   }
 }
-Q(G, "logLevel", W.Silent);
+P(G, "logLevel", W.Silent);
 var ne = /* @__PURE__ */ ((t) => (t.Year = "year", t.Month = "month", t.Week = "week", t.Day = "day", t))(ne || {});
 function Je(t) {
   const e = t.match(/^PT?([0-9]+)([MDYW])$/);
@@ -239,7 +239,7 @@ function Bt(t) {
 function ot() {
   return /* @__PURE__ */ Object.create(null);
 }
-function we(t) {
+function Ie(t) {
   t.forEach(Bt);
 }
 function ce(t) {
@@ -249,7 +249,7 @@ function T(t, e) {
   return t != t ? e == e : t !== e || t && typeof t == "object" || typeof t == "function";
 }
 let De;
-function Z(t, e) {
+function ee(t, e) {
   return t === e ? !0 : (De || (De = document.createElement("a")), De.href = e, t === De.href);
 }
 function st(t) {
@@ -263,7 +263,7 @@ function on(t, e) {
     // relative URLs inside srcset are not automatically resolved to absolute URLs by
     // browsers (in contrast to img.src). This means both SSR and DOM code could
     // contain relative or absolute URLs.
-    (Z(r[s][0], i) || Z(i, r[s][0]))
+    (ee(r[s][0], i) || ee(i, r[s][0]))
   );
 }
 function sn(t) {
@@ -308,10 +308,10 @@ function V(t) {
   }
   return -1;
 }
-function Ee(t) {
+function Ae(t) {
   return t ?? "";
 }
-function C(t, e) {
+function M(t, e) {
   t.appendChild(e);
 }
 function x(t, e, r) {
@@ -332,7 +332,7 @@ function ln(t) {
   ) : t.ownerDocument;
 }
 function cn(t, e) {
-  return C(
+  return M(
     /** @type {Document} */
     t.head || t,
     e
@@ -350,16 +350,16 @@ function k(t) {
 function L(t) {
   return document.createTextNode(t);
 }
-function P() {
+function Q() {
   return L(" ");
 }
 function te() {
   return L("");
 }
-function ke(t, e, r, n) {
+function we(t, e, r, n) {
   return t.addEventListener(e, r, n), () => t.removeEventListener(e, r, n);
 }
-function Mt(t) {
+function Ct(t) {
   return function(e) {
     return e.preventDefault(), t.call(this, e);
   };
@@ -398,20 +398,23 @@ function lt(t, e) {
 function pn(t, e, { bubbles: r = !1, cancelable: n = !1 } = {}) {
   return new CustomEvent(t, { detail: e, bubbles: r, cancelable: n });
 }
-let be;
-function Ae(t) {
-  be = t;
+let Ee;
+function _e(t) {
+  Ee = t;
 }
-function Se() {
-  if (!be)
+function ke() {
+  if (!Ee)
     throw new Error("Function called outside component initialization");
-  return be;
+  return Ee;
 }
-function Oe(t) {
-  Se().$$.on_mount.push(t);
+function _n(t) {
+  ke().$$.before_update.push(t);
 }
-function _n() {
-  const t = Se();
+function Se(t) {
+  ke().$$.on_mount.push(t);
+}
+function hn() {
+  const t = ke();
   return (e, r, { cancelable: n = !1 } = {}) => {
     const i = t.$$.callbacks[e];
     if (i) {
@@ -429,67 +432,67 @@ function _n() {
   };
 }
 function An(t, e) {
-  return Se().$$.context.set(t, e), e;
+  return ke().$$.context.set(t, e), e;
 }
-function hn(t) {
-  return Se().$$.context.get(t);
+function En(t) {
+  return ke().$$.context.get(t);
 }
-function Ct(t, e) {
+function Pt(t, e) {
   const r = t.$$.callbacks[e.type];
   r && r.slice().forEach((n) => n.call(this, e));
 }
 const se = [], Ue = [];
 let le = [];
-const He = [], En = /* @__PURE__ */ Promise.resolve();
-let Ke = !1;
-function bn() {
-  Ke || (Ke = !0, En.then(Qt));
+const Ye = [], bn = /* @__PURE__ */ Promise.resolve();
+let He = !1;
+function In() {
+  He || (He = !0, bn.then(Mt));
 }
-function qe(t) {
+function Ke(t) {
   le.push(t);
 }
-function In(t) {
-  He.push(t);
+function wn(t) {
+  Ye.push(t);
 }
-const Fe = /* @__PURE__ */ new Set();
+const xe = /* @__PURE__ */ new Set();
 let ie = 0;
-function Qt() {
+function Mt() {
   if (ie !== 0)
     return;
-  const t = be;
+  const t = Ee;
   do {
     try {
       for (; ie < se.length; ) {
         const e = se[ie];
-        ie++, Ae(e), wn(e.$$);
+        ie++, _e(e), kn(e.$$);
       }
     } catch (e) {
       throw se.length = 0, ie = 0, e;
     }
-    for (Ae(null), se.length = 0, ie = 0; Ue.length; )
+    for (_e(null), se.length = 0, ie = 0; Ue.length; )
       Ue.pop()();
     for (let e = 0; e < le.length; e += 1) {
       const r = le[e];
-      Fe.has(r) || (Fe.add(r), r());
+      xe.has(r) || (xe.add(r), r());
     }
     le.length = 0;
   } while (se.length);
-  for (; He.length; )
-    He.pop()();
-  Ke = !1, Fe.clear(), Ae(t);
+  for (; Ye.length; )
+    Ye.pop()();
+  He = !1, xe.clear(), _e(t);
 }
-function wn(t) {
+function kn(t) {
   if (t.fragment !== null) {
-    t.update(), we(t.before_update);
+    t.update(), Ie(t.before_update);
     const e = t.dirty;
-    t.dirty = [-1], t.fragment && t.fragment.p(t.ctx, e), t.after_update.forEach(qe);
+    t.dirty = [-1], t.fragment && t.fragment.p(t.ctx, e), t.after_update.forEach(Ke);
   }
 }
-function kn(t) {
+function yn(t) {
   const e = [], r = [];
   le.forEach((n) => t.indexOf(n) === -1 ? e.push(n) : r.push(n)), r.forEach((n) => n()), le = e;
 }
-const Pe = /* @__PURE__ */ new Set();
+const Qe = /* @__PURE__ */ new Set();
 let re;
 function H() {
   re = {
@@ -500,22 +503,22 @@ function H() {
   };
 }
 function K() {
-  re.r || we(re.c), re = re.p;
+  re.r || Ie(re.c), re = re.p;
 }
 function f(t, e) {
-  t && t.i && (Pe.delete(t), t.i(e));
+  t && t.i && (Qe.delete(t), t.i(e));
 }
-function m(t, e, r, n) {
+function d(t, e, r, n) {
   if (t && t.o) {
-    if (Pe.has(t))
+    if (Qe.has(t))
       return;
-    Pe.add(t), re.c.push(() => {
-      Pe.delete(t), n && (r && t.d(1), n());
+    Qe.add(t), re.c.push(() => {
+      Qe.delete(t), n && (r && t.d(1), n());
     }), t.o(e);
   } else
     n && n();
 }
-function $n(t, e, r) {
+function vn(t, e, r) {
   const n = t.$$.props[e];
   n !== void 0 && (t.$$.bound[n] = r, r(t.$$.ctx[n]));
 }
@@ -524,21 +527,21 @@ function w(t) {
 }
 function b(t, e, r) {
   const { fragment: n, after_update: i } = t.$$;
-  n && n.m(e, r), qe(() => {
+  n && n.m(e, r), Ke(() => {
     const o = t.$$.on_mount.map(Bt).filter(ce);
-    t.$$.on_destroy ? t.$$.on_destroy.push(...o) : we(o), t.$$.on_mount = [];
-  }), i.forEach(qe);
+    t.$$.on_destroy ? t.$$.on_destroy.push(...o) : Ie(o), t.$$.on_mount = [];
+  }), i.forEach(Ke);
 }
 function I(t, e) {
   const r = t.$$;
-  r.fragment !== null && (kn(r.after_update), we(r.on_destroy), r.fragment && r.fragment.d(e), r.on_destroy = r.fragment = null, r.ctx = []);
+  r.fragment !== null && (yn(r.after_update), Ie(r.on_destroy), r.fragment && r.fragment.d(e), r.on_destroy = r.fragment = null, r.ctx = []);
 }
-function vn(t, e) {
-  t.$$.dirty[0] === -1 && (se.push(t), bn(), t.$$.dirty.fill(0)), t.$$.dirty[e / 31 | 0] |= 1 << e % 31;
+function $n(t, e) {
+  t.$$.dirty[0] === -1 && (se.push(t), In(), t.$$.dirty.fill(0)), t.$$.dirty[e / 31 | 0] |= 1 << e % 31;
 }
 function N(t, e, r, n, i, o, s = null, l = [-1]) {
-  const c = be;
-  Ae(t);
+  const c = Ee;
+  _e(t);
   const a = t.$$ = {
     fragment: null,
     ctx: [],
@@ -562,18 +565,18 @@ function N(t, e, r, n, i, o, s = null, l = [-1]) {
   };
   s && s(a.root);
   let u = !1;
-  if (a.ctx = r ? r(t, e.props || {}, (d, h, ...$) => {
-    const E = $.length ? $[0] : h;
-    return a.ctx && i(a.ctx[d], a.ctx[d] = E) && (!a.skip_bound && a.bound[d] && a.bound[d](E), u && vn(t, d)), h;
-  }) : [], a.update(), u = !0, we(a.before_update), a.fragment = n ? n(a.ctx) : !1, e.target) {
+  if (a.ctx = r ? r(t, e.props || {}, (m, h, ...y) => {
+    const E = y.length ? y[0] : h;
+    return a.ctx && i(a.ctx[m], a.ctx[m] = E) && (!a.skip_bound && a.bound[m] && a.bound[m](E), u && $n(t, m)), h;
+  }) : [], a.update(), u = !0, Ie(a.before_update), a.fragment = n ? n(a.ctx) : !1, e.target) {
     if (e.hydrate) {
-      const d = gn(e.target);
-      a.fragment && a.fragment.l(d), d.forEach(g);
+      const m = gn(e.target);
+      a.fragment && a.fragment.l(m), m.forEach(g);
     } else
       a.fragment && a.fragment.c();
-    e.intro && f(t.$$.fragment), b(t, e.target, e.anchor), Qt();
+    e.intro && f(t.$$.fragment), b(t, e.target, e.anchor), Mt();
   }
-  Ae(c);
+  _e(c);
 }
 class U {
   constructor() {
@@ -584,7 +587,7 @@ class U {
      *
      * @type {any}
      */
-    Q(this, "$$");
+    P(this, "$$");
     /**
      * ### PRIVATE API
      *
@@ -592,7 +595,7 @@ class U {
      *
      * @type {any}
      */
-    Q(this, "$$set");
+    P(this, "$$set");
   }
   /** @returns {void} */
   $destroy() {
@@ -621,12 +624,12 @@ class U {
     this.$$set && !sn(e) && (this.$$.skip_bound = !0, this.$$set(e), this.$$.skip_bound = !1);
   }
 }
-const yn = "4";
-typeof window < "u" && (window.__svelte || (window.__svelte = { v: /* @__PURE__ */ new Set() })).v.add(yn);
-function Bn(t) {
+const Bn = "4";
+typeof window < "u" && (window.__svelte || (window.__svelte = { v: /* @__PURE__ */ new Set() })).v.add(Bn);
+function Dn(t) {
   x(t, "svelte-1bzqb13", ".rcb-modal-section.svelte-1bzqb13{padding:8px 0px;display:flex}section.rcb-modal-section.svelte-1bzqb13{flex-grow:1}.rcb-modal-section.svelte-1bzqb13:last-of-type{padding:0}");
 }
-function Ge(t) {
+function Fe(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -647,7 +650,7 @@ function Ge(t) {
         /*as*/
         t[0]
       )(e, {
-        class: Ee("rcb-modal-section") + " svelte-1bzqb13"
+        class: Ae("rcb-modal-section") + " svelte-1bzqb13"
       });
     },
     m(o, s) {
@@ -678,20 +681,20 @@ function Ge(t) {
       r || (f(i, o), r = !0);
     },
     o(o) {
-      m(i, o), r = !1;
+      d(i, o), r = !1;
     },
     d(o) {
       o && g(e), i && i.d(o);
     }
   };
 }
-function Dn(t) {
+function Cn(t) {
   let e = (
     /*as*/
     t[0]
   ), r, n, i = (
     /*as*/
-    t[0] && Ge(t)
+    t[0] && Fe(t)
   );
   return {
     c() {
@@ -706,8 +709,8 @@ function Dn(t) {
         e,
         /*as*/
         o[0]
-      ) ? (i.d(1), i = Ge(o), e = /*as*/
-      o[0], i.c(), i.m(r.parentNode, r)) : i.p(o, s) : (i = Ge(o), e = /*as*/
+      ) ? (i.d(1), i = Fe(o), e = /*as*/
+      o[0], i.c(), i.m(r.parentNode, r)) : i.p(o, s) : (i = Fe(o), e = /*as*/
       o[0], i.c(), i.m(r.parentNode, r)) : e && (i.d(1), i = null, e = /*as*/
       o[0]);
     },
@@ -715,14 +718,14 @@ function Dn(t) {
       n || (f(i, o), n = !0);
     },
     o(o) {
-      m(i, o), n = !1;
+      d(i, o), n = !1;
     },
     d(o) {
       o && g(r), i && i.d(o);
     }
   };
 }
-function Mn(t, e, r) {
+function Pn(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { as: o = "section" } = e;
   return t.$$set = (s) => {
     "as" in s && r(0, o = s.as), "$$scope" in s && r(1, i = s.$$scope);
@@ -730,10 +733,10 @@ function Mn(t, e, r) {
 }
 class ue extends U {
   constructor(e) {
-    super(), N(this, e, Mn, Dn, T, { as: 0 }, Bn);
+    super(), N(this, e, Pn, Cn, T, { as: 0 }, Dn);
   }
 }
-function Cn(t) {
+function Mn(t) {
   x(t, "svelte-gf0gr5", ".rcb-pricing-info.svelte-gf0gr5{display:flex;flex-direction:column;margin-top:102px;font-weight:500}.rcb-product-price.svelte-gf0gr5{font-size:24px;margin:12px 0px}.rcb-product-price-after-trial.svelte-gf0gr5{margin-bottom:12px}.rcb-product-details.svelte-gf0gr5{opacity:0.6;list-style-type:disc;list-style-position:inside;margin:0px;padding:0px}@media screen and (max-width: 960px){.rcb-pricing-info.svelte-gf0gr5{margin-top:48px}}");
 }
 function Qn(t) {
@@ -754,7 +757,7 @@ function Qn(t) {
     }
   };
 }
-function Pn(t) {
+function Tn(t) {
   let e = (
     /*basePrice*/
     (t[2].currency || "") + ""
@@ -766,7 +769,7 @@ function Pn(t) {
   ) + "", o;
   return {
     c() {
-      r = L(e), n = P(), o = L(i);
+      r = L(e), n = Q(), o = L(i);
     },
     m(s, l) {
       p(s, r, l), p(s, n, l), p(s, o, l);
@@ -777,7 +780,7 @@ function Pn(t) {
     }
   };
 }
-function Tn(t) {
+function Nn(t) {
   let e;
   return {
     c() {
@@ -810,7 +813,7 @@ function ct(t) {
       e = k("li"), r = L("Renews "), i = L(n);
     },
     m(o, s) {
-      p(o, e, s), C(e, r), C(e, i);
+      p(o, e, s), M(e, r), M(e, i);
     },
     p(o, s) {
       s & /*productDetails*/
@@ -824,53 +827,53 @@ function ct(t) {
     }
   };
 }
-function Nn(t) {
-  var M, ve;
+function Un(t) {
+  var C, ve;
   let e, r, n = (
     /*productDetails*/
     t[0].displayName + ""
-  ), i, o, s, l, c, a, u, d, h, $, E, B = (
+  ), i, o, s, l, c, a, u, m, h, y, E, B = (
     /*trial*/
-    ((M = t[1]) == null ? void 0 : M.periodDuration) && Qn(t)
+    ((C = t[1]) == null ? void 0 : C.periodDuration) && Qn(t)
   ), A = !/*trial*/
   ((ve = t[1]) != null && ve.periodDuration) && /*basePrice*/
-  t[2] && Pn(t), y = (
+  t[2] && Tn(t), $ = (
     /*trial*/
     t[1] && /*basePrice*/
-    t[2] && Tn(t)
+    t[2] && Nn(t)
   ), R = (
     /*productDetails*/
     t[0].normalPeriodDuration && ct(t)
   );
   return {
     c() {
-      e = k("div"), r = k("span"), i = L(n), o = P(), s = k("span"), B && B.c(), l = P(), A && A.c(), c = P(), y && y.c(), a = P(), u = k("ul"), R && R.c(), d = P(), h = k("li"), h.textContent = "Continues until canceled", $ = P(), E = k("li"), E.textContent = "Cancel anytime", _(s, "class", "rcb-product-price svelte-gf0gr5"), _(u, "class", "rcb-product-details svelte-gf0gr5"), _(e, "class", "rcb-pricing-info svelte-gf0gr5");
+      e = k("div"), r = k("span"), i = L(n), o = Q(), s = k("span"), B && B.c(), l = Q(), A && A.c(), c = Q(), $ && $.c(), a = Q(), u = k("ul"), R && R.c(), m = Q(), h = k("li"), h.textContent = "Continues until canceled", y = Q(), E = k("li"), E.textContent = "Cancel anytime", _(s, "class", "rcb-product-price svelte-gf0gr5"), _(u, "class", "rcb-product-details svelte-gf0gr5"), _(e, "class", "rcb-pricing-info svelte-gf0gr5");
     },
     m(F, S) {
-      p(F, e, S), C(e, r), C(r, i), C(e, o), C(e, s), B && B.m(s, null), C(s, l), A && A.m(s, null), C(e, c), y && y.m(e, null), C(e, a), C(e, u), R && R.m(u, null), C(u, d), C(u, h), C(u, $), C(u, E);
+      p(F, e, S), M(e, r), M(r, i), M(e, o), M(e, s), B && B.m(s, null), M(s, l), A && A.m(s, null), M(e, c), $ && $.m(e, null), M(e, a), M(e, u), R && R.m(u, null), M(u, m), M(u, h), M(u, y), M(u, E);
     },
     p(F, S) {
-      var ye, Be;
+      var $e, Be;
       S & /*productDetails*/
       1 && n !== (n = /*productDetails*/
       F[0].displayName + "") && ae(i, n), /*trial*/
-      (ye = F[1]) != null && ye.periodDuration && B.p(F, S), !/*trial*/
+      ($e = F[1]) != null && $e.periodDuration && B.p(F, S), !/*trial*/
       ((Be = F[1]) != null && Be.periodDuration) && /*basePrice*/
       F[2] && A.p(F, S), /*trial*/
       F[1] && /*basePrice*/
-      F[2] && y.p(F, S), /*productDetails*/
-      F[0].normalPeriodDuration ? R ? R.p(F, S) : (R = ct(F), R.c(), R.m(u, d)) : R && (R.d(1), R = null);
+      F[2] && $.p(F, S), /*productDetails*/
+      F[0].normalPeriodDuration ? R ? R.p(F, S) : (R = ct(F), R.c(), R.m(u, m)) : R && (R.d(1), R = null);
     },
     d(F) {
-      F && g(e), B && B.d(), A && A.d(), y && y.d(), R && R.d();
+      F && g(e), B && B.d(), A && A.d(), $ && $.d(), R && R.d();
     }
   };
 }
-function Un(t) {
+function Rn(t) {
   let e, r;
   return e = new ue({
     props: {
-      $$slots: { default: [Nn] },
+      $$slots: { default: [Un] },
       $$scope: { ctx: t }
     }
   }), {
@@ -889,14 +892,14 @@ function Un(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function Rn(t, e, r) {
+function Sn(t, e, r) {
   var c;
   let { productDetails: n } = e, { purchaseOption: i } = e;
   const o = i, s = o == null ? void 0 : o.trial, l = (c = o == null ? void 0 : o.base) == null ? void 0 : c.price;
@@ -904,17 +907,17 @@ function Rn(t, e, r) {
     "productDetails" in a && r(0, n = a.productDetails), "purchaseOption" in a && r(3, i = a.purchaseOption);
   }, [n, s, l, i];
 }
-class Pt extends U {
+class Qt extends U {
   constructor(e) {
-    super(), N(this, e, Rn, Un, T, { productDetails: 0, purchaseOption: 3 }, Cn);
+    super(), N(this, e, Sn, Rn, T, { productDetails: 0, purchaseOption: 3 }, Mn);
   }
 }
-const Sn = "data:image/gif;base64,R0lGODlhMgAyAPcBAAAAAAD/AAMDAwcHBxERERUVFSoqKi0tLTAwMDg4OD09PURERElJSUtLS1BQUFJSUlVVVVdXV1paWl9fX2NjY2ZmZmlpaWxsbG1tbXNzc3t7e39/f4GBgYKCgoSEhIaGhoeHh4iIiIuLi5KSkpSUlJaWlp2dnaGhoaOjo6SkpKWlpaenp6ioqKqqqqurq6ysrLCwsLGxsbS0tLa2tri4uLm5ub29vb6+vsDAwMHBwcLCwsXFxcjIyMnJyc3Nzc7OztPT09TU1NXV1dfX19nZ2dra2tvb29zc3N7e3uDg4OHh4eLi4uPj4+fn5+np6ezs7O7u7vDw8PHx8fLy8vPz8/X19fb29vj4+Pn5+fz8/P39/f7+/v///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////yH/C05FVFNDQVBFMi4wAwEAAAAh+QQFBAABACwAAAAAMgAyAIcAAAAA/wADAwMHBwcREREVFRUqKiotLS0wMDA4ODg9PT1ERERJSUlLS0tQUFBSUlJVVVVXV1daWlpfX19jY2NmZmZpaWlsbGxtbW1zc3N7e3t/f3+BgYGCgoKEhISGhoaHh4eIiIiLi4uSkpKUlJSWlpadnZ2hoaGjo6OkpKSlpaWnp6eoqKiqqqqrq6usrKywsLCxsbG0tLS2tra4uLi5ubm9vb2+vr7AwMDBwcHCwsLFxcXIyMjJycnNzc3Ozs7T09PU1NTV1dXX19fZ2dna2trb29vc3Nze3t7g4ODh4eHi4uLj4+Pn5+fp6ens7Ozu7u7w8PDx8fHy8vLz8/P19fX29vb4+Pj5+fn8/Pz9/f3+/v7///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////8I/wCzcBFIcKDBgggPKkzIcCEXLlq4bIEokeLEiBcrYrTIcaNHjRobinQ4sqRCkBlTdtR44MBKlR9TmjQJQMBMkgZfdpwSMSYAACgpRtHpcSYSFUIa1mz448UQnAWDfmzSooUVmD9XVnnBwglMlDdvvMjhcOlCHit23CSqcUrVJiizpnTC4sXQmB1vZvmxwgYWhWYLznjRA+rJryqvxGhxxGNLjkVcwMCCN6ZeLkNevDCcRYYKJJfZptyCQwdiijl0CDxdlLPryw2lymY9WzTs17ijVq69mzbM28Bd8x7u23bu46F7i16uXEvw5ziJM5duGbl1k9OLN5cKvfvh7OC3b0jxTv6h+PDUy3unzl67RPXXc56fnz4+/PbofcOHnr9/5f3x4UeffvYVqJuACP5m4IIJ+gfWgusN6KCCAN7WoITVVXjchBxqERAAIfkEBQQAAQAsDQADACAAEAAACKcAAwgcSDDAAwcFEypcSNDAAYYQA2DZstCAAYZOKCqM8uNJxYcKa3DYsVBKECBYFFpU+MTDhiIMkQxBohJkwRYaUkDEEiQIlYQrCyLZ0MFJRCdAkgC1OZBEBxgRJRIBAqXgwYI8NoCwEjWAkyFDoorQ4KOrQCRLoqbQuZCKR7NdqzD5MaQKXIhZmAwBIqTJ3YVYogQZ8oMJ178Kk/A1YhfxQiRHjBYMCAAh+QQFBQABACwNAAMAIAAQAAAInQADCBxIMECGDAUTKlxI8EEEhhADcGEI4QFDJQy5ZJmo0OFCFBFkLNzCRQvHghEgKHQi4cEPhhuzdHyYUMQDDxC5kNSSsGLCIA4x5oxZ0GNBDBFKRAxgkmTBgwVpRJhAZWkAohErPKhhVaLJpR8+YFnohEjXrlB2qHgB5SxELD5etHgBxC1DJC9eqOAxxe5CHSxc0HDilyEOGWYLBgQAIfkEBQQAAQAsGAADABcAFwAACJYAS5AIQLCgwYMINXBAyLDhhg0NtxRpWFBDh4YiDpygGOAhwyUIDOTgqJAhBgMVOHaEeLCHgQMTSV40uKXBAZYcBR5UYSBBFJUNFRhoAbShhZQNi/DYUvRgkxQKmzQlaCVGhw0eakwN4MNDBw0tnmxN8ZAEkq0ET4jYgbat27dw474lMuTHECB1hxBpigRIECBC/AJBEhAAIfkEBQQAAQAsGAADABcAFwAACJIAa9AIQLCgwYMIVbxAyLBhCxYNAwCJSHDFQoYaBIyg6KIFQyQDAMigqJAhBAAMKAZ4iPAGAAETKVpEaECABZUBBB4kAYAAFJwMCwAoAZQhg5QNf4wsajCJhwcRkjANQMVEBAgSVDC9UkNChAcimkz9ADVDkKkEPVRYirat27dw47ad8UKhRYUzitZo8bDjwxoBAQAh+QQFBAABACwYAAMAFwAiAAAIvwCRGAlAsKDBgwh/DEHIsGEQIA0DFIlIEMhChiIOnKAoBCLCJQgM5KCokCEGAxUoBniIsIeBAxMpWkTY4MAGlQEEHlRhIEEUnAwVGGgBlKGFlA1zbCxqkEiFl0SYBojS4YABBCO2MG2RwCqGJFKfGnDQQyrBCgpQaDXLtq3bt3DZkuiggYMGuhxIFC2xoa/fDSXiCh5MuDDBJUSgZGl7ZAiQJFLYbnlCBEiQJFjYXnFiEciTtliSPMzcNspPggEBACH5BAUEAAEALBgAAwAXACIAAAi6ALlsCUCwoMGDCLNwQciwIRctDpU0LKiwIYoIMiYGEMjQiYQHPzRWRCjigQeNGyEeDPIggkSRCw1ywRChBMqNAw3SiDCByk2GFR7U+Mnww4eJMkYQPQiEAQABQJYGgGJBAIABGqSWIGAVghGpTgEcuCGVIIMCSsuqXcu2rdu1NFvKjYCBaAYIEFrifZDhrd+/gAMT1AHjCNsbL1bYYLKWSIwWLXRYUVvlB4sXLISsnYKjBYspbJkgKRgQACH5BAUEAAEALB8ABQAQACgAAAjDAAMIDOBkoMGDAmtw2IEQ4RMPG4o0PNhCQ4qJBpFs6FAQo0ASHWB4FMhjAwgrIwOI0OAjZYAUKbJMzHEiJZEKBg4QwRilwwEDCEZgbJHgJ4YkGHEacNBjZAUFKFxKnUq1qlWBDX5qzdmg4QMDYMMaeHC1rNmzA1WIaJryBAcNJSR61MIjxIYNKqKMnDJj4wYcKZ2cuNuRyRGMQ3xgEUgkyBOXUYAUuZIyCxIgTVxKGQJEZsokQpBWBjJEb2Agj116xhgQACH5BAUFAAEALB8ABQAQACgAAAjFAAMIDBCFy8CDCAP8eDEkYcIqL1g4cYiQx4odFA86YfEiSsaBM170+CiwiAsYWEgGkKECicoAOXRk/CFDZRIPDyIkyUjFRAQIElQYdFhDQoQHIppk/JAzQxCSHirIGPqyqtWrWLEaEACAq1cDDg8AGEsWwIGsaNOqdRiCQo2XHY5m+EEyy4wJECCEmPgxygkIESK0UMmEA4QHTATuuJGxx1uBMFoQeYlkhYwqL2u0oEs4ImaVOlzgeHmFY2KVQFgYqfo5Y0AAIfkEBQQAAQAsGAAFABcAKgAACOUAAwgcSDDAlYIIEw5kMsSJwocCrwgBQgXiQyZAmFhUWAXIkIMbERIZojFkwSdChmQxWfDIjygsCyZJ8rAIj5gDm6TQwKFJTCsxOmzwUIMlFh8eOmho8SRmig0bSCDBGeCEiB1Us2rdyrWryQYHDIQd28DkAwNo0xp44LWt27dtLShYgSUrhbAPsFJVkQDthZIxn3wQe4BEXZxHKKA98pDFiYc2VEAUseHmRiI0CfrQIGLKxokIS2yQsfHHEIRFOGxoCjEIkIQqNjyG6DGhlA0cTj8EndDGhh4QTT98clih662YtwYEACH5BAUEAAEALBgABQAXACoAAAjfAAMIHEgwwJaCCBMOzMIli8KHArdw0cIF4sOGFS0mnMjloEaEDB1+LEhR4siCGE8WlKhFoRMiGVVC2aHiBRSVWHy8aPECiEokL16o4DFFpQ4WLmg4USkQhwwiTKNKnUq16lQMER5k3YphZAYIELSCfZDBqtmzaNMKbFCgxNQFAgAgqCF1BAEAABwkieoEAwABAjZIFbIAr5CHIjp4RBiDBEQKEGZ8nGGjYI0HFKJodNEC4VcTGmsi/BEBAhOLLVgkDBGBg8UVLxI+iRChB0TOClc8oAFRtMLTEFNTpUw1IAAh+QQFBAABACwNAA0AIgAiAAAI5QADCBxIsKDBgwGoPEHIsOHAKkx+DKnisCLBLEyGABHSxKLHKEGG/GBixaPFJBuNUDRpEckRJyxjypxJs6bNmzhvkuiggYMGnhxI5CyxoajRDSVyKl3KtKlTphYUrHhK4YCBBzucqkhgwMAFJk2ffDBw4IDQpkcodD1SEMsSJBUvUGBoQ4VBKECKVFRgwK7HLSFhEiSRlGALAwoWWmQixMiWgkXbPjDgwWIVIj+uGOxpcIdVuA6VAFlyMLLBCwbmNqwiseTmDgeblLXR8EmQjqU3IBxhIIXDlQc5H8QCmqZpp4RrBgQAIfkEBQQAAQAsDQANACIAIgAACOAAAwgcSLCgwYMBuGxByLDhwCxcIGZxSJEgFy0KL1asKDFixI0VL2YEuVEiyZMoU6pcybKly5YzXqh4sULmixkva7RowcLFThY1XgodSrSoUaIhKNSYWLRDhAcZfhidMQEChBBOikY5ASFChBZMhzLhAOEBE4M7cFB0sIBhj6AFjbCIQbEAgBEgs7x4QaQghgwFSwAokLWiDxc0DEaAYPAAgAsVoch8YvBBBIM1BAAYQlFHix0Hyx50AKBtQyczpxy0fFCJAAF0GRJpAQThYoQaAJBwCIUha4ScV4o++ndlQAAh+QQFBAABACwFABgAKgAXAAAI5gADCBxIsKDBgwWJDPkxBMjCIUQQSpxoEAmQIECEXASChKLHjyBDihxJsqTJkyhHbnlSJAlKFSJ6eLyi8McSlCc4aChRBOGVJRmHQMmCUguPEBs2qIhSkElDIky2pBw4ZcaGDhtwDLyCUcmVqQadnEjqZKCTKhJVnPB4gYLEIT5A9tggwqMCAypSXvHQYUfBBg8KtjCg4AnKGBtIaClowIDBBwY8nGziQYNLxgcM7jhgoGPJsSwONj54wYBbkkc0fDBs0EBmg00OHLBBkseGGghHHxxhIEXJJhJdS/QMdqDu4h4BnwwIACH5BAUFAAEALAUAGAAqABcAAAjlAAMIHEiwoMGDBbNwUchwIcKHEA1y2cJFy8SKXCJq3Mixo8ePIEOKHEkSZJEYOUjqgHFE45MZL1TsIHnjxQobTBBW2cHCBQwjJbcQidGihQ4rBX/YfNEjS8mBVX6weMFCyMAoLVjoiPLU4BQcWacMHOIE4ZUQHjSK6PCQCRKnGmk8oKCRAoQZJatIiCCjoAEEBWvM5TrSRIQMBgEASJgBgomRSSQ8GJJYgMEfESDkDOkBgoiDig+GiMAh5I8HEpqAtmzwSYQIPUDKgKACYeiDKx7QCJnkIQDWBrNs7jrwNnGNf0cGBAAh+QQFBAABACwDABgAKgAXAAAI5gCT/BgCZMhAIEkCKFzIsKHDhw2NBAEiBMhEIUYgatzIsaPHjyBDihxJsqTJkygVauEhIsXJJUSgdExCooMGFSePEEwiBeITFhs2gOiR8gkRi0mwNKzxQYMHGFdSKrzipCCQJwudBD3hRGpDLEkmKlW444hGCxU6sjjBBWKUKB9XGFDQUcQGHiinJDiAomGDBw19aBAx5WQHAw6yNDRgwGGJDTJMEkFgwIdDAwccFuGwAStJCgYwPGT8UMWGEyR1GECQ8HJmh1I2cBgy8oSBERBJP7SxgehIIhoxa/TsVaHu4hz/kgwIACH5BAUEAAEALAMAGAAqABcAAAjfAG2oeLHixcAVNgIoXMiwocOHDWm0YOGixUQXNCBq3Mixo8ePIEOKHEmypMmTKBfSoPDhJJctXLRwHIIhwoMQJ7Nw0ZkFohMRDyJMoIHFpZaXMbk0RCHhgYQSVVIq5LlTqUIlEB54UCK1IdKjC2X80NiAQccdNzTq/EgCQIGOMFoQQRmFgIARDTFkaIhkhYyoJi0AOOAwAgSHNVqMLQlkAAAcDoM6ZPKCBeCRCwA8eJj1oQ4XkEfSADDAyEPJDq+weMFk5AgAGiAahgiEhemRQDSiflilZ1eFnX931EsyIAAh+QQFBAABACwDAA0AIgAiAAAI4wADCHwiRaDBgwgTKjyY5ccQJFkWSpxo0AkQIUGaYKHIMWEWJEOAFHHSsaRBKkiABEFi0iSWKEOYtJxJs6bNmzhz6uxYQgMHDR18aiixk8SGo0g3kNjJtKnTp1CjelShwMJTHw0OGLDKdAkGAwYSrGgqAoEBBBumNC0ClkIRqCd0SLRQgSOTIzNXGFDAkUiQJyanJDiAAiEJogejiLxSsoMBBwmPJkzZpCMRsz4S+kwoJWREihQMYFAoOWESIUko6jibWnMHhVmADIky8YSBEQtLJ7QIeCIRiZsXfrap++lhigEBACH5BAUEAAEALAMADQAiACIAAAjgAAMINNJEoMGDCBMqPFhFxYsbVRZKnChQC5AWLlr8uEKxY8IrOV6skDHEo0mDTWq0aIHjpEskL3a4nEmzps2bOHPq9JjhQQSfQDPszADBJ4SiEYTuXMq0qdOnUBOSKMDAKQ4DAgA0YIrkAQAABEgw1TAAwAALUZgC+boAyNMRNCSG8NCRS5aZNB5Q6LiFi5aTVSREkIFwhg2Edu2aNJH078GMCLVw6esxiYQHJRE6TJglcUcPEEQobMFCoeQtFH88kFAw4YoXChPflSgDgoqFkGNLpphE4uaFXHCSjmqYYkAAIfkEBQQAAQAsAwAFABcAKgAACOUAAwgcSDAAloIIEw6M8uOJwocDpQQBchDiQyRDkFh8iCVIECobFToBkqRiSIJYiACBchKhkyFDHmbpQUThFiRLHj7RwMGEw5YDbXTYsEFGFaACpaTgoEHEDqQCj5QgegKqQB8hWFjdyrWr164PDBwQS/bBSQcG0qo14OCr27dw4yZUocACVB8NxtptuQRD2gQrgIpAYADBhilAi6SlUMTqCR0KsaioarXHBhFWr3jo8JQgkSQbY2wggVAIEItNPGgAXfBHTIgnNmhFOBHiEQ0ffhYE8lohjw01FJpG/dA119pbPwcEACH5BAUFAAEALAMABQAXACoAAAjkAAMIHEgwwBQtBRMqFIhEhZCFEAc2adHCSsSIN17kuAhxCsUmHBf+WGEjpMIrMVocMZlwyIsXEWn4gIhDB0QmDyJsYMKS4IoIQE1I6SnwCYgIDyjI2EI0AJAMECB4aCqwxgQRVLNq3cp1KwIAAsCKRWDyAICzaAEc6Mq2rdu3CbXQoPCh6RAMSEP0dCIi5wQaPVFIeCChRJWeSiA88KCEqowfEHfgyGqERQyqWV4SKZiFC0cfLmgwJchlNEQoL1Q8Sdj5oo4WOxRyQQjRiYoXUxS2hkikBZCFpS9Cgbib6mytnQMCACH5BAUEAAEALAMABQAQACgAAAjDAAMIHEgwixOCCBH60IAjoUMiGzpEcZjQRIcUFBE62bDhSEaCMzSU+DiwSogNPUgK3MEhxMAUDR1qOaFCIBIDByYgIZllxAGcHqCQbGLhpwIUKnk8MGCAgsorLRJcUEm1qtWrVpf+3GrggUMHTMMydYC1rNmzaHmIwPgxCYkOGmpSfMKCI4geWSjW+KDBA4wrGTduOHGQ5A6PFJfsVAkFSBGVW4IMKfyRiRAjKqsQ+QGYpBIgSzL/GGJF5ZMgTapWIRgQACH5BAUEAAEALAMABQAQACgAAAjAAAMIHEgwAJOCCAfWeNAiIUIfECI4cVhwQwQQFAkyiQABSMaBJx5k+ChQygQINUgGkBFhwkASMhxm8RBC4BAAAhYMIalhAM4LTz4qcSAAQIERJG0cAACAgcoSBByonEq1qtWMGR5E0Mp1JMIMELRCCBvB69WzaNNO3VIkRo6PT2a8ULGDYpUdLFzAMELxx4sVL3pkoRilBQsdUUgOmZgwC5fBJLlo4RLZMeSMk7dQzmh5c0Yumis/JqlZy9TLAQICACH5BAUEAAEALAMAAwAXACIAAAi+AAMIHEiwoEEkRgwqXPhjyMKBR7IsDALkYQAVBkgsBOLwIQ4DB5goFFLR4oQDFhQ2tBjgyAEDPAxSZBngg4EHVwpypAklgYEVBRHSDIDiQAKLKXA8pJByIRKQE5AMNTji5QEPUKYSbGLhpQIUWgnyeGDAAIWwBFskuIC2rdu3cONaLKGBg4YOdTWUmEpig9+/GzTKHUy4sGGWT4okaXuFyJAfS8JeWQJEyJCsWpkMAUKEyRbJFJXkbOukStuAAAAh+QQFBAABACwDAAMAFwAiAAAItQADCBxIsKDBGjQMKlyo4sXCgUIetmDxMAAJABsWrnD4UAaAAUkUumhRMcACAQ4UNiwpRAAAGwYnlgyAAQACgxtnPiEAoERBhDMDjBBAoCINHw8ZNHjI5EGEDUyCFtSyIoJVE1KkEnwCIsIDCjK0EgSSAQIED2IHYqkxQUTat3Djyp1b0UbDjXdhBqUxcWTfhHQDCx5MuCIXLVy2vOWShTEXsVsOJz6stbHlx1ojI1b8tvHbgAAAIfkEBQQAAQAsAwADABcAFwAACJQAAwgcSLCgwRIkDCpcqIHDwoFHHm7Y8DCACgMJFWroUBGHgQNMFE6sGGDCAQsaHVY8csAAD4MjSX4w8MDgRpIBoCQwsKIgQpwBUBxIULEHkYcUUC580tDEE6AGbXSYKKMKVIJSUnDQIGIHl6sQS0w8AZagjxAsyqpdy7at24pJfgwBMkQukCRQjQQBIgTIXiFGoAYEACH5BAUFAAEALAMAAwAXABcAAAiVAAMIHEiwoMEMGQwqXPggwsKBTLQshPDgYYAaD1owdPjQB4QIThRGgGAxwIYIIBQ2LMlkJBCDFEsGOPEgA5aCK0tKmQChRkGEMgPIiDDhoRYjTR56CPGwiooXN6oENQikhYsWP65MJXglx4sVMoZsJdikRosWOMYSRPJih9q3cOPKnWuRSxa7eO9O3cJFCxe+frdMDQgAIfkEBQUAAQAsBQADACAAEAAACKYAAwgcSLAgwQcODCpcyNDAAYYQAzhpaIDhFYY+NOBY6HAhkyETFRLZ0CGKQgMVDV4RAoQKQxMdUpx8aJAJECYQnWzYcMQgSoNVgAy5CHGGhhI+aRIkMgRnxCohNvQoiLDgEyFDskQUuINDiK1Hfpgc+ETKQi0nVGxNkkSrwCw/hiBxu7XuFidAhARpgqWu3yxIhgApEtLvVipIgARBYthvlKaNFQYEADs=";
-function On(t) {
+const On = "data:image/gif;base64,R0lGODlhMgAyAPcBAAAAAAD/AAMDAwcHBxERERUVFSoqKi0tLTAwMDg4OD09PURERElJSUtLS1BQUFJSUlVVVVdXV1paWl9fX2NjY2ZmZmlpaWxsbG1tbXNzc3t7e39/f4GBgYKCgoSEhIaGhoeHh4iIiIuLi5KSkpSUlJaWlp2dnaGhoaOjo6SkpKWlpaenp6ioqKqqqqurq6ysrLCwsLGxsbS0tLa2tri4uLm5ub29vb6+vsDAwMHBwcLCwsXFxcjIyMnJyc3Nzc7OztPT09TU1NXV1dfX19nZ2dra2tvb29zc3N7e3uDg4OHh4eLi4uPj4+fn5+np6ezs7O7u7vDw8PHx8fLy8vPz8/X19fb29vj4+Pn5+fz8/P39/f7+/v///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////yH/C05FVFNDQVBFMi4wAwEAAAAh+QQFBAABACwAAAAAMgAyAIcAAAAA/wADAwMHBwcREREVFRUqKiotLS0wMDA4ODg9PT1ERERJSUlLS0tQUFBSUlJVVVVXV1daWlpfX19jY2NmZmZpaWlsbGxtbW1zc3N7e3t/f3+BgYGCgoKEhISGhoaHh4eIiIiLi4uSkpKUlJSWlpadnZ2hoaGjo6OkpKSlpaWnp6eoqKiqqqqrq6usrKywsLCxsbG0tLS2tra4uLi5ubm9vb2+vr7AwMDBwcHCwsLFxcXIyMjJycnNzc3Ozs7T09PU1NTV1dXX19fZ2dna2trb29vc3Nze3t7g4ODh4eHi4uLj4+Pn5+fp6ens7Ozu7u7w8PDx8fHy8vLz8/P19fX29vb4+Pj5+fn8/Pz9/f3+/v7///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////8I/wCzcBFIcKDBgggPKkzIcCEXLlq4bIEokeLEiBcrYrTIcaNHjRobinQ4sqRCkBlTdtR44MBKlR9TmjQJQMBMkgZfdpwSMSYAACgpRtHpcSYSFUIa1mz448UQnAWDfmzSooUVmD9XVnnBwglMlDdvvMjhcOlCHit23CSqcUrVJiizpnTC4sXQmB1vZvmxwgYWhWYLznjRA+rJryqvxGhxxGNLjkVcwMCCN6ZeLkNevDCcRYYKJJfZptyCQwdiijl0CDxdlLPryw2lymY9WzTs17ijVq69mzbM28Bd8x7u23bu46F7i16uXEvw5ziJM5duGbl1k9OLN5cKvfvh7OC3b0jxTv6h+PDUy3unzl67RPXXc56fnz4+/PbofcOHnr9/5f3x4UeffvYVqJuACP5m4IIJ+gfWgusN6KCCAN7WoITVVXjchBxqERAAIfkEBQQAAQAsDQADACAAEAAACKcAAwgcSDDAAwcFEypcSNDAAYYQA2DZstCAAYZOKCqM8uNJxYcKa3DYsVBKECBYFFpU+MTDhiIMkQxBohJkwRYaUkDEEiQIlYQrCyLZ0MFJRCdAkgC1OZBEBxgRJRIBAqXgwYI8NoCwEjWAkyFDoorQ4KOrQCRLoqbQuZCKR7NdqzD5MaQKXIhZmAwBIqTJ3YVYogQZ8oMJ178Kk/A1YhfxQiRHjBYMCAAh+QQFBQABACwNAAMAIAAQAAAInQADCBxIMECGDAUTKlxI8EEEhhADcGEI4QFDJQy5ZJmo0OFCFBFkLNzCRQvHghEgKHQi4cEPhhuzdHyYUMQDDxC5kNSSsGLCIA4x5oxZ0GNBDBFKRAxgkmTBgwVpRJhAZWkAohErPKhhVaLJpR8+YFnohEjXrlB2qHgB5SxELD5etHgBxC1DJC9eqOAxxe5CHSxc0HDilyEOGWYLBgQAIfkEBQQAAQAsGAADABcAFwAACJYAS5AIQLCgwYMINXBAyLDhhg0NtxRpWFBDh4YiDpygGOAhwyUIDOTgqJAhBgMVOHaEeLCHgQMTSV40uKXBAZYcBR5UYSBBFJUNFRhoAbShhZQNi/DYUvRgkxQKmzQlaCVGhw0eakwN4MNDBw0tnmxN8ZAEkq0ET4jYgbat27dw474lMuTHECB1hxBpigRIECBC/AJBEhAAIfkEBQQAAQAsGAADABcAFwAACJIAa9AIQLCgwYMIVbxAyLBhCxYNAwCJSHDFQoYaBIyg6KIFQyQDAMigqJAhBAAMKAZ4iPAGAAETKVpEaECABZUBBB4kAYAAFJwMCwAoAZQhg5QNf4wsajCJhwcRkjANQMVEBAgSVDC9UkNChAcimkz9ADVDkKkEPVRYirat27dw47ad8UKhRYUzitZo8bDjwxoBAQAh+QQFBAABACwYAAMAFwAiAAAIvwCRGAlAsKDBgwh/DEHIsGEQIA0DFIlIEMhChiIOnKAoBCLCJQgM5KCokCEGAxUoBniIsIeBAxMpWkTY4MAGlQEEHlRhIEEUnAwVGGgBlKGFlA1zbCxqkEiFl0SYBojS4YABBCO2MG2RwCqGJFKfGnDQQyrBCgpQaDXLtq3bt3DZkuiggYMGuhxIFC2xoa/fDSXiCh5MuDDBJUSgZGl7ZAiQJFLYbnlCBEiQJFjYXnFiEciTtliSPMzcNspPggEBACH5BAUEAAEALBgAAwAXACIAAAi6ALlsCUCwoMGDCLNwQciwIRctDpU0LKiwIYoIMiYGEMjQiYQHPzRWRCjigQeNGyEeDPIggkSRCw1ywRChBMqNAw3SiDCByk2GFR7U+Mnww4eJMkYQPQiEAQABQJYGgGJBAIABGqSWIGAVghGpTgEcuCGVIIMCSsuqXcu2rdu1NFvKjYCBaAYIEFrifZDhrd+/gAMT1AHjCNsbL1bYYLKWSIwWLXRYUVvlB4sXLISsnYKjBYspbJkgKRgQACH5BAUEAAEALB8ABQAQACgAAAjDAAMIDOBkoMGDAmtw2IEQ4RMPG4o0PNhCQ4qJBpFs6FAQo0ASHWB4FMhjAwgrIwOI0OAjZYAUKbJMzHEiJZEKBg4QwRilwwEDCEZgbJHgJ4YkGHEacNBjZAUFKFxKnUq1qlWBDX5qzdmg4QMDYMMaeHC1rNmzA1WIaJryBAcNJSR61MIjxIYNKqKMnDJj4wYcKZ2cuNuRyRGMQ3xgEUgkyBOXUYAUuZIyCxIgTVxKGQJEZsokQpBWBjJEb2Agj116xhgQACH5BAUFAAEALB8ABQAQACgAAAjFAAMIDBCFy8CDCAP8eDEkYcIqL1g4cYiQx4odFA86YfEiSsaBM170+CiwiAsYWEgGkKECicoAOXRk/CFDZRIPDyIkyUjFRAQIElQYdFhDQoQHIppk/JAzQxCSHirIGPqyqtWrWLEaEACAq1cDDg8AGEsWwIGsaNOqdRiCQo2XHY5m+EEyy4wJECCEmPgxygkIESK0UMmEA4QHTATuuJGxx1uBMFoQeYlkhYwqL2u0oEs4ImaVOlzgeHmFY2KVQFgYqfo5Y0AAIfkEBQQAAQAsGAAFABcAKgAACOUAAwgcSDDAlYIIEw5kMsSJwocCrwgBQgXiQyZAmFhUWAXIkIMbERIZojFkwSdChmQxWfDIjygsCyZJ8rAIj5gDm6TQwKFJTCsxOmzwUIMlFh8eOmho8SRmig0bSCDBGeCEiB1Us2rdyrWryQYHDIQd28DkAwNo0xp44LWt27dtLShYgSUrhbAPsFJVkQDthZIxn3wQe4BEXZxHKKA98pDFiYc2VEAUseHmRiI0CfrQIGLKxokIS2yQsfHHEIRFOGxoCjEIkIQqNjyG6DGhlA0cTj8EndDGhh4QTT98clih662YtwYEACH5BAUEAAEALBgABQAXACoAAAjfAAMIHEgwwJaCCBMOzMIli8KHArdw0cIF4sOGFS0mnMjloEaEDB1+LEhR4siCGE8WlKhFoRMiGVVC2aHiBRSVWHy8aPECiEokL16o4DFFpQ4WLmg4USkQhwwiTKNKnUq16lQMER5k3YphZAYIELSCfZDBqtmzaNMKbFCgxNQFAgAgqCF1BAEAABwkieoEAwABAjZIFbIAr5CHIjp4RBiDBEQKEGZ8nGGjYI0HFKJodNEC4VcTGmsi/BEBAhOLLVgkDBGBg8UVLxI+iRChB0TOClc8oAFRtMLTEFNTpUw1IAAh+QQFBAABACwNAA0AIgAiAAAI5QADCBxIsKDBgwGoPEHIsOHAKkx+DKnisCLBLEyGABHSxKLHKEGG/GBixaPFJBuNUDRpEckRJyxjypxJs6bNmzhvkuiggYMGnhxI5CyxoajRDSVyKl3KtKlTphYUrHhK4YCBBzucqkhgwMAFJk2ffDBw4IDQpkcodD1SEMsSJBUvUGBoQ4VBKECKVFRgwK7HLSFhEiSRlGALAwoWWmQixMiWgkXbPjDgwWIVIj+uGOxpcIdVuA6VAFlyMLLBCwbmNqwiseTmDgeblLXR8EmQjqU3IBxhIIXDlQc5H8QCmqZpp4RrBgQAIfkEBQQAAQAsDQANACIAIgAACOAAAwgcSLCgwYMBuGxByLDhwCxcIGZxSJEgFy0KL1asKDFixI0VL2YEuVEiyZMoU6pcybKly5YzXqh4sULmixkva7RowcLFThY1XgodSrSoUaIhKNSYWLRDhAcZfhidMQEChBBOikY5ASFChBZMhzLhAOEBE4M7cFB0sIBhj6AFjbCIQbEAgBEgs7x4QaQghgwFSwAokLWiDxc0DEaAYPAAgAsVoch8YvBBBIM1BAAYQlFHix0Hyx50AKBtQyczpxy0fFCJAAF0GRJpAQThYoQaAJBwCIUha4ScV4o++ndlQAAh+QQFBAABACwFABgAKgAXAAAI5gADCBxIsKDBgwWJDPkxBMjCIUQQSpxoEAmQIECEXASChKLHjyBDihxJsqTJkyhHbnlSJAlKFSJ6eLyi8McSlCc4aChRBOGVJRmHQMmCUguPEBs2qIhSkElDIky2pBw4ZcaGDhtwDLyCUcmVqQadnEjqZKCTKhJVnPB4gYLEIT5A9tggwqMCAypSXvHQYUfBBg8KtjCg4AnKGBtIaClowIDBBwY8nGziQYNLxgcM7jhgoGPJsSwONj54wYBbkkc0fDBs0EBmg00OHLBBkseGGghHHxxhIEXJJhJdS/QMdqDu4h4BnwwIACH5BAUFAAEALAUAGAAqABcAAAjlAAMIHEiwoMGDBbNwUchwIcKHEA1y2cJFy8SKXCJq3Mixo8ePIEOKHEkSZJEYOUjqgHFE45MZL1TsIHnjxQobTBBW2cHCBQwjJbcQidGihQ4rBX/YfNEjS8mBVX6weMFCyMAoLVjoiPLU4BQcWacMHOIE4ZUQHjSK6PCQCRKnGmk8oKCRAoQZJatIiCCjoAEEBWvM5TrSRIQMBgEASJgBgomRSSQ8GJJYgMEfESDkDOkBgoiDig+GiMAh5I8HEpqAtmzwSYQIPUDKgKACYeiDKx7QCJnkIQDWBrNs7jrwNnGNf0cGBAAh+QQFBAABACwDABgAKgAXAAAI5gCT/BgCZMhAIEkCKFzIsKHDhw2NBAEiBMhEIUYgatzIsaPHjyBDihxJsqTJkygVauEhIsXJJUSgdExCooMGFSePEEwiBeITFhs2gOiR8gkRi0mwNKzxQYMHGFdSKrzipCCQJwudBD3hRGpDLEkmKlW444hGCxU6sjjBBWKUKB9XGFDQUcQGHiinJDiAomGDBw19aBAx5WQHAw6yNDRgwGGJDTJMEkFgwIdDAwccFuGwAStJCgYwPGT8UMWGEyR1GECQ8HJmh1I2cBgy8oSBERBJP7SxgehIIhoxa/TsVaHu4hz/kgwIACH5BAUEAAEALAMAGAAqABcAAAjfAG2oeLHixcAVNgIoXMiwocOHDWm0YOGixUQXNCBq3Mixo8ePIEOKHEmypMmTKBfSoPDhJJctXLRwHIIhwoMQJ7Nw0ZkFohMRDyJMoIHFpZaXMbk0RCHhgYQSVVIq5LlTqUIlEB54UCK1IdKjC2X80NiAQccdNzTq/EgCQIGOMFoQQRmFgIARDTFkaIhkhYyoJi0AOOAwAgSHNVqMLQlkAAAcDoM6ZPKCBeCRCwA8eJj1oQ4XkEfSADDAyEPJDq+weMFk5AgAGiAahgiEhemRQDSiflilZ1eFnX931EsyIAAh+QQFBAABACwDAA0AIgAiAAAI4wADCHwiRaDBgwgTKjyY5ccQJFkWSpxo0AkQIUGaYKHIMWEWJEOAFHHSsaRBKkiABEFi0iSWKEOYtJxJs6bNmzhz6uxYQgMHDR18aiixk8SGo0g3kNjJtKnTp1CjelShwMJTHw0OGLDKdAkGAwYSrGgqAoEBBBumNC0ClkIRqCd0SLRQgSOTIzNXGFDAkUiQJyanJDiAAiEJogejiLxSsoMBBwmPJkzZpCMRsz4S+kwoJWREihQMYFAoOWESIUko6jibWnMHhVmADIky8YSBEQtLJ7QIeCIRiZsXfrap++lhigEBACH5BAUEAAEALAMADQAiACIAAAjgAAMINNJEoMGDCBMqPFhFxYsbVRZKnChQC5AWLlr8uEKxY8IrOV6skDHEo0mDTWq0aIHjpEskL3a4nEmzps2bOHPq9JjhQQSfQDPszADBJ4SiEYTuXMq0qdOnUBOSKMDAKQ4DAgA0YIrkAQAABEgw1TAAwAALUZgC+boAyNMRNCSG8NCRS5aZNB5Q6LiFi5aTVSREkIFwhg2Edu2aNJH078GMCLVw6esxiYQHJRE6TJglcUcPEEQobMFCoeQtFH88kFAw4YoXChPflSgDgoqFkGNLpphE4uaFXHCSjmqYYkAAIfkEBQQAAQAsAwAFABcAKgAACOUAAwgcSDAAloIIEw6M8uOJwocDpQQBchDiQyRDkFh8iCVIECobFToBkqRiSIJYiACBchKhkyFDHmbpQUThFiRLHj7RwMGEw5YDbXTYsEFGFaACpaTgoEHEDqQCj5QgegKqQB8hWFjdyrWr164PDBwQS/bBSQcG0qo14OCr27dw4yZUocACVB8NxtptuQRD2gQrgIpAYADBhilAi6SlUMTqCR0KsaioarXHBhFWr3jo8JQgkSQbY2wggVAIEItNPGgAXfBHTIgnNmhFOBHiEQ0ffhYE8lohjw01FJpG/dA119pbPwcEACH5BAUFAAEALAMABQAXACoAAAjkAAMIHEgwwBQtBRMqFIhEhZCFEAc2adHCSsSIN17kuAhxCsUmHBf+WGEjpMIrMVocMZlwyIsXEWn4gIhDB0QmDyJsYMKS4IoIQE1I6SnwCYgIDyjI2EI0AJAMECB4aCqwxgQRVLNq3cp1KwIAAsCKRWDyAICzaAEc6Mq2rdu3CbXQoPCh6RAMSEP0dCIi5wQaPVFIeCChRJWeSiA88KCEqowfEHfgyGqERQyqWV4SKZiFC0cfLmgwJchlNEQoL1Q8Sdj5oo4WOxRyQQjRiYoXUxS2hkikBZCFpS9Cgbib6mytnQMCACH5BAUEAAEALAMABQAQACgAAAjDAAMIHEgwixOCCBH60IAjoUMiGzpEcZjQRIcUFBE62bDhSEaCMzSU+DiwSogNPUgK3MEhxMAUDR1qOaFCIBIDByYgIZllxAGcHqCQbGLhpwIUKnk8MGCAgsorLRJcUEm1qtWrVpf+3GrggUMHTMMydYC1rNmzaHmIwPgxCYkOGmpSfMKCI4geWSjW+KDBA4wrGTduOHGQ5A6PFJfsVAkFSBGVW4IMKfyRiRAjKqsQ+QGYpBIgSzL/GGJF5ZMgTapWIRgQACH5BAUEAAEALAMABQAQACgAAAjAAAMIHEgwAJOCCAfWeNAiIUIfECI4cVhwQwQQFAkyiQABSMaBJx5k+ChQygQINUgGkBFhwkASMhxm8RBC4BAAAhYMIalhAM4LTz4qcSAAQIERJG0cAACAgcoSBByonEq1qtWMGR5E0Mp1JMIMELRCCBvB69WzaNNO3VIkRo6PT2a8ULGDYpUdLFzAMELxx4sVL3pkoRilBQsdUUgOmZgwC5fBJLlo4RLZMeSMk7dQzmh5c0Yumis/JqlZy9TLAQICACH5BAUEAAEALAMAAwAXACIAAAi+AAMIHEiwoEEkRgwqXPhjyMKBR7IsDALkYQAVBkgsBOLwIQ4DB5goFFLR4oQDFhQ2tBjgyAEDPAxSZBngg4EHVwpypAklgYEVBRHSDIDiQAKLKXA8pJByIRKQE5AMNTji5QEPUKYSbGLhpQIUWgnyeGDAAIWwBFskuIC2rdu3cONaLKGBg4YOdTWUmEpig9+/GzTKHUy4sGGWT4okaXuFyJAfS8JeWQJEyJCsWpkMAUKEyRbJFJXkbOukStuAAAAh+QQFBAABACwDAAMAFwAiAAAItQADCBxIsKDBGjQMKlyo4sXCgUIetmDxMAAJABsWrnD4UAaAAUkUumhRMcACAQ4UNiwpRAAAGwYnlgyAAQACgxtnPiEAoERBhDMDjBBAoCINHw8ZNHjI5EGEDUyCFtSyIoJVE1KkEnwCIsIDCjK0EgSSAQIED2IHYqkxQUTat3Djyp1b0UbDjXdhBqUxcWTfhHQDCx5MuCIXLVy2vOWShTEXsVsOJz6stbHlx1ojI1b8tvHbgAAAIfkEBQQAAQAsAwADABcAFwAACJQAAwgcSLCgwRIkDCpcqIHDwoFHHm7Y8DCACgMJFWroUBGHgQNMFE6sGGDCAQsaHVY8csAAD4MjSX4w8MDgRpIBoCQwsKIgQpwBUBxIULEHkYcUUC580tDEE6AGbXSYKKMKVIJSUnDQIGIHl6sQS0w8AZagjxAsyqpdy7at24pJfgwBMkQukCRQjQQBIgTIXiFGoAYEACH5BAUFAAEALAMAAwAXABcAAAiVAAMIHEiwoMEMGQwqXPggwsKBTLQshPDgYYAaD1owdPjQB4QIThRGgGAxwIYIIBQ2LMlkJBCDFEsGOPEgA5aCK0tKmQChRkGEMgPIiDDhoRYjTR56CPGwiooXN6oENQikhYsWP65MJXglx4sVMoZsJdikRosWOMYSRPJih9q3cOPKnWuRSxa7eO9O3cJFCxe+frdMDQgAIfkEBQUAAQAsBQADACAAEAAACKYAAwgcSLAgwQcODCpcyNDAAYYQAzhpaIDhFYY+NOBY6HAhkyETFRLZ0CGKQgMVDV4RAoQKQxMdUpx8aJAJECYQnWzYcMQgSoNVgAy5CHGGhhI+aRIkMgRnxCohNvQoiLDgEyFDskQUuINDiK1Hfpgc+ETKQi0nVGxNkkSrwCw/hiBxu7XuFidAhARpgqWu3yxIhgApEtLvVipIgARBYthvlKaNFQYEADs=";
+function Ln(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), Z(e.src, r = Sn) || _(e, "src", r), _(e, "alt", "spinner");
+      e = k("img"), ee(e.src, r = On) || _(e, "src", r), _(e, "alt", "spinner");
     },
     m(n, i) {
       p(n, e, i);
@@ -927,17 +930,17 @@ function On(t) {
     }
   };
 }
-class Ln extends U {
+class xn extends U {
   constructor(e) {
-    super(), N(this, e, null, On, T, {});
+    super(), N(this, e, null, Ln, T, {});
   }
 }
-function xn(t) {
+function Fn(t) {
   x(t, "svelte-1mxx341", ".rcb-modal-loader.svelte-1mxx341{width:100%;flex-grow:1;min-height:100%;display:flex;justify-content:center;align-items:center}");
 }
-function Fn(t) {
+function Gn(t) {
   let e, r, n;
-  return r = new Ln({}), {
+  return r = new xn({}), {
     c() {
       e = k("div"), w(r.$$.fragment), _(e, "class", "rcb-modal-loader svelte-1mxx341");
     },
@@ -949,7 +952,7 @@ function Fn(t) {
       n || (f(r.$$.fragment, i), n = !0);
     },
     o(i) {
-      m(r.$$.fragment, i), n = !1;
+      d(r.$$.fragment, i), n = !1;
     },
     d(i) {
       i && g(e), I(r);
@@ -958,10 +961,10 @@ function Fn(t) {
 }
 class We extends U {
   constructor(e) {
-    super(), N(this, e, null, Fn, T, {}, xn);
+    super(), N(this, e, null, Gn, T, {}, Fn);
   }
 }
-var ee = /* @__PURE__ */ ((t) => (t[t.UnknownError = 0] = "UnknownError", t[t.UserCancelledError = 1] = "UserCancelledError", t[t.StoreProblemError = 2] = "StoreProblemError", t[t.PurchaseNotAllowedError = 3] = "PurchaseNotAllowedError", t[t.PurchaseInvalidError = 4] = "PurchaseInvalidError", t[t.ProductNotAvailableForPurchaseError = 5] = "ProductNotAvailableForPurchaseError", t[t.ProductAlreadyPurchasedError = 6] = "ProductAlreadyPurchasedError", t[t.ReceiptAlreadyInUseError = 7] = "ReceiptAlreadyInUseError", t[t.InvalidReceiptError = 8] = "InvalidReceiptError", t[t.MissingReceiptFileError = 9] = "MissingReceiptFileError", t[t.NetworkError = 10] = "NetworkError", t[t.InvalidCredentialsError = 11] = "InvalidCredentialsError", t[t.UnexpectedBackendResponseError = 12] = "UnexpectedBackendResponseError", t[t.InvalidAppUserIdError = 14] = "InvalidAppUserIdError", t[t.OperationAlreadyInProgressError = 15] = "OperationAlreadyInProgressError", t[t.UnknownBackendError = 16] = "UnknownBackendError", t[t.InvalidAppleSubscriptionKeyError = 17] = "InvalidAppleSubscriptionKeyError", t[t.IneligibleError = 18] = "IneligibleError", t[t.InsufficientPermissionsError = 19] = "InsufficientPermissionsError", t[t.PaymentPendingError = 20] = "PaymentPendingError", t[t.InvalidSubscriberAttributesError = 21] = "InvalidSubscriberAttributesError", t[t.LogOutWithAnonymousUserError = 22] = "LogOutWithAnonymousUserError", t[t.ConfigurationError = 23] = "ConfigurationError", t[t.UnsupportedError = 24] = "UnsupportedError", t[t.EmptySubscriberAttributesError = 25] = "EmptySubscriberAttributesError", t[t.CustomerInfoError = 28] = "CustomerInfoError", t[t.SignatureVerificationError = 36] = "SignatureVerificationError", t))(ee || {});
+var Z = /* @__PURE__ */ ((t) => (t[t.UnknownError = 0] = "UnknownError", t[t.UserCancelledError = 1] = "UserCancelledError", t[t.StoreProblemError = 2] = "StoreProblemError", t[t.PurchaseNotAllowedError = 3] = "PurchaseNotAllowedError", t[t.PurchaseInvalidError = 4] = "PurchaseInvalidError", t[t.ProductNotAvailableForPurchaseError = 5] = "ProductNotAvailableForPurchaseError", t[t.ProductAlreadyPurchasedError = 6] = "ProductAlreadyPurchasedError", t[t.ReceiptAlreadyInUseError = 7] = "ReceiptAlreadyInUseError", t[t.InvalidReceiptError = 8] = "InvalidReceiptError", t[t.MissingReceiptFileError = 9] = "MissingReceiptFileError", t[t.NetworkError = 10] = "NetworkError", t[t.InvalidCredentialsError = 11] = "InvalidCredentialsError", t[t.UnexpectedBackendResponseError = 12] = "UnexpectedBackendResponseError", t[t.InvalidAppUserIdError = 14] = "InvalidAppUserIdError", t[t.OperationAlreadyInProgressError = 15] = "OperationAlreadyInProgressError", t[t.UnknownBackendError = 16] = "UnknownBackendError", t[t.InvalidAppleSubscriptionKeyError = 17] = "InvalidAppleSubscriptionKeyError", t[t.IneligibleError = 18] = "IneligibleError", t[t.InsufficientPermissionsError = 19] = "InsufficientPermissionsError", t[t.PaymentPendingError = 20] = "PaymentPendingError", t[t.InvalidSubscriberAttributesError = 21] = "InvalidSubscriberAttributesError", t[t.LogOutWithAnonymousUserError = 22] = "LogOutWithAnonymousUserError", t[t.ConfigurationError = 23] = "ConfigurationError", t[t.UnsupportedError = 24] = "UnsupportedError", t[t.EmptySubscriberAttributesError = 25] = "EmptySubscriberAttributesError", t[t.CustomerInfoError = 28] = "CustomerInfoError", t[t.SignatureVerificationError = 36] = "SignatureVerificationError", t[t.InvalidEmailError = 38] = "InvalidEmailError", t))(Z || {});
 class he {
   static getPublicMessage(e) {
     switch (e) {
@@ -1019,6 +1022,8 @@ class he {
         return "There was a problem related to the customer info.";
       case 36:
         return "Request failed signature verification. Please see https://rev.cat/trusted-entitlements for more info.";
+      case 38:
+        return "Email is not valid. Please provide a valid email address.";
     }
   }
   static getErrorCodeForBackendErrorCode(e) {
@@ -1060,6 +1065,9 @@ class he {
         return 12;
       case 7662:
         return 24;
+      case 7012:
+      case 7834:
+        return 38;
     }
   }
   static convertCodeToBackendErrorCode(e) {
@@ -1084,17 +1092,17 @@ class he {
     }
   }
 }
-var Tt = /* @__PURE__ */ ((t) => (t[t.BackendInvalidPlatform = 7e3] = "BackendInvalidPlatform", t[t.BackendStoreProblem = 7101] = "BackendStoreProblem", t[t.BackendCannotTransferPurchase = 7102] = "BackendCannotTransferPurchase", t[t.BackendInvalidReceiptToken = 7103] = "BackendInvalidReceiptToken", t[t.BackendInvalidAppStoreSharedSecret = 7104] = "BackendInvalidAppStoreSharedSecret", t[t.BackendInvalidPaymentModeOrIntroPriceNotProvided = 7105] = "BackendInvalidPaymentModeOrIntroPriceNotProvided", t[t.BackendProductIdForGoogleReceiptNotProvided = 7106] = "BackendProductIdForGoogleReceiptNotProvided", t[t.BackendInvalidPlayStoreCredentials = 7107] = "BackendInvalidPlayStoreCredentials", t[t.BackendInternalServerError = 7110] = "BackendInternalServerError", t[t.BackendEmptyAppUserId = 7220] = "BackendEmptyAppUserId", t[t.BackendInvalidAuthToken = 7224] = "BackendInvalidAuthToken", t[t.BackendInvalidAPIKey = 7225] = "BackendInvalidAPIKey", t[t.BackendBadRequest = 7226] = "BackendBadRequest", t[t.BackendPlayStoreQuotaExceeded = 7229] = "BackendPlayStoreQuotaExceeded", t[t.BackendPlayStoreInvalidPackageName = 7230] = "BackendPlayStoreInvalidPackageName", t[t.BackendPlayStoreGenericError = 7231] = "BackendPlayStoreGenericError", t[t.BackendUserIneligibleForPromoOffer = 7232] = "BackendUserIneligibleForPromoOffer", t[t.BackendInvalidAppleSubscriptionKey = 7234] = "BackendInvalidAppleSubscriptionKey", t[t.BackendInvalidSubscriberAttributes = 7263] = "BackendInvalidSubscriberAttributes", t[t.BackendInvalidSubscriberAttributesBody = 7264] = "BackendInvalidSubscriberAttributesBody", t[t.BackendProductIDsMalformed = 7662] = "BackendProductIDsMalformed", t[t.BackendAlreadySubscribedError = 7772] = "BackendAlreadySubscribedError", t[t.BackendOfferNotFound = 7814] = "BackendOfferNotFound", t))(Tt || {});
-class X extends Error {
+var Tt = /* @__PURE__ */ ((t) => (t[t.BackendInvalidPlatform = 7e3] = "BackendInvalidPlatform", t[t.BackendInvalidEmail = 7012] = "BackendInvalidEmail", t[t.BackendStoreProblem = 7101] = "BackendStoreProblem", t[t.BackendCannotTransferPurchase = 7102] = "BackendCannotTransferPurchase", t[t.BackendInvalidReceiptToken = 7103] = "BackendInvalidReceiptToken", t[t.BackendInvalidAppStoreSharedSecret = 7104] = "BackendInvalidAppStoreSharedSecret", t[t.BackendInvalidPaymentModeOrIntroPriceNotProvided = 7105] = "BackendInvalidPaymentModeOrIntroPriceNotProvided", t[t.BackendProductIdForGoogleReceiptNotProvided = 7106] = "BackendProductIdForGoogleReceiptNotProvided", t[t.BackendInvalidPlayStoreCredentials = 7107] = "BackendInvalidPlayStoreCredentials", t[t.BackendInternalServerError = 7110] = "BackendInternalServerError", t[t.BackendEmptyAppUserId = 7220] = "BackendEmptyAppUserId", t[t.BackendInvalidAuthToken = 7224] = "BackendInvalidAuthToken", t[t.BackendInvalidAPIKey = 7225] = "BackendInvalidAPIKey", t[t.BackendBadRequest = 7226] = "BackendBadRequest", t[t.BackendPlayStoreQuotaExceeded = 7229] = "BackendPlayStoreQuotaExceeded", t[t.BackendPlayStoreInvalidPackageName = 7230] = "BackendPlayStoreInvalidPackageName", t[t.BackendPlayStoreGenericError = 7231] = "BackendPlayStoreGenericError", t[t.BackendUserIneligibleForPromoOffer = 7232] = "BackendUserIneligibleForPromoOffer", t[t.BackendInvalidAppleSubscriptionKey = 7234] = "BackendInvalidAppleSubscriptionKey", t[t.BackendInvalidSubscriberAttributes = 7263] = "BackendInvalidSubscriberAttributes", t[t.BackendInvalidSubscriberAttributesBody = 7264] = "BackendInvalidSubscriberAttributesBody", t[t.BackendProductIDsMalformed = 7662] = "BackendProductIDsMalformed", t[t.BackendAlreadySubscribedError = 7772] = "BackendAlreadySubscribedError", t[t.BackendOfferNotFound = 7814] = "BackendOfferNotFound", t[t.BackendNoMXRecordsFound = 7834] = "BackendNoMXRecordsFound", t))(Tt || {});
+class z extends Error {
   constructor(r, n, i) {
     super(n);
-    Q(this, "toString", () => `PurchasesError(code: ${ee[this.errorCode]}, message: ${this.message})`);
+    P(this, "toString", () => `PurchasesError(code: ${Z[this.errorCode]}, message: ${this.message})`);
     this.errorCode = r, this.underlyingErrorMessage = i;
   }
   /** @internal */
   static getForBackendError(r, n) {
     const i = he.getErrorCodeForBackendErrorCode(r);
-    return new X(
+    return new z(
       i,
       he.getPublicMessage(i),
       n
@@ -1102,7 +1110,7 @@ class X extends Error {
   }
   /** @internal */
   static getForPurchasesFlowError(r) {
-    return new X(
+    return new z(
       he.convertPurchaseFlowErrorCodeToErrorCode(
         r.errorCode
       ),
@@ -1111,31 +1119,31 @@ class X extends Error {
     );
   }
 }
-class Gn extends Error {
+class Yn extends Error {
   constructor() {
     super("Purchases must be configured before calling getInstance");
   }
 }
-var pe = /* @__PURE__ */ ((t) => (t.Started = "started", t.InProgress = "in_progress", t.Succeeded = "succeeded", t.Failed = "failed", t))(pe || {}), Te = /* @__PURE__ */ ((t) => (t[t.SetupIntentCreationFailed = 1] = "SetupIntentCreationFailed", t[t.PaymentMethodCreationFailed = 2] = "PaymentMethodCreationFailed", t[t.PaymentChargeFailed = 3] = "PaymentChargeFailed", t))(Te || {}), O = /* @__PURE__ */ ((t) => (t[t.ErrorSettingUpPurchase = 0] = "ErrorSettingUpPurchase", t[t.ErrorChargingPayment = 1] = "ErrorChargingPayment", t[t.UnknownError = 2] = "UnknownError", t[t.NetworkError = 3] = "NetworkError", t[t.StripeError = 4] = "StripeError", t[t.MissingEmailError = 5] = "MissingEmailError", t[t.AlreadySubscribedError = 6] = "AlreadySubscribedError", t))(O || {});
+var ge = /* @__PURE__ */ ((t) => (t.Started = "started", t.InProgress = "in_progress", t.Succeeded = "succeeded", t.Failed = "failed", t))(ge || {}), Te = /* @__PURE__ */ ((t) => (t[t.SetupIntentCreationFailed = 1] = "SetupIntentCreationFailed", t[t.PaymentMethodCreationFailed = 2] = "PaymentMethodCreationFailed", t[t.PaymentChargeFailed = 3] = "PaymentChargeFailed", t))(Te || {}), O = /* @__PURE__ */ ((t) => (t[t.ErrorSettingUpPurchase = 0] = "ErrorSettingUpPurchase", t[t.ErrorChargingPayment = 1] = "ErrorChargingPayment", t[t.UnknownError = 2] = "UnknownError", t[t.NetworkError = 3] = "NetworkError", t[t.StripeError = 4] = "StripeError", t[t.MissingEmailError = 5] = "MissingEmailError", t[t.AlreadySubscribedError = 6] = "AlreadySubscribedError", t))(O || {});
 class Y extends Error {
   constructor(e, r, n) {
     super(r), this.errorCode = e, this.underlyingErrorMessage = n;
   }
   static fromPurchasesError(e, r) {
     let n;
-    return e.errorCode === ee.ProductAlreadyPurchasedError ? n = 6 : n = r, new Y(
+    return e.errorCode === Z.ProductAlreadyPurchasedError ? n = 6 : e.errorCode === Z.InvalidEmailError ? n = 5 : n = r, new Y(
       n,
       e.message,
       e.underlyingErrorMessage
     );
   }
 }
-class Yn {
+class Hn {
   constructor(e, r = 10) {
-    Q(this, "operationSessionId", null);
-    Q(this, "backend");
-    Q(this, "maxNumberAttempts");
-    Q(this, "waitMSBetweenAttempts", 1e3);
+    P(this, "operationSessionId", null);
+    P(this, "backend");
+    P(this, "maxNumberAttempts");
+    P(this, "waitMSBetweenAttempts", 1e3);
     this.backend = e, this.maxNumberAttempts = r;
   }
   async startPurchase(e, r, n, i, o) {
@@ -1149,7 +1157,7 @@ class Yn {
       );
       return this.operationSessionId = s.operation_session_id, s;
     } catch (s) {
-      if (s instanceof X)
+      if (s instanceof z)
         throw Y.fromPurchasesError(
           s,
           0
@@ -1184,17 +1192,17 @@ class Yn {
         }
         this.backend.getCheckoutStatus(e).then((s) => {
           switch (s.operation.status) {
-            case pe.Started:
-            case pe.InProgress:
+            case ge.Started:
+            case ge.InProgress:
               setTimeout(
                 () => i(o + 1),
                 this.waitMSBetweenAttempts
               );
               break;
-            case pe.Succeeded:
+            case ge.Succeeded:
               this.clearPurchaseInProgress(), r();
               return;
-            case pe.Failed:
+            case ge.Failed:
               this.clearPurchaseInProgress(), this.handlePaymentError(
                 s.operation.error,
                 n
@@ -1253,15 +1261,15 @@ class Yn {
     }
   }
 }
-const Hn = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23767676'/%3e%3cpath%20d='M87.6668%2041.504L82.4968%2036.334L62.0002%2056.8307L41.5035%2036.334L36.3335%2041.504L56.8302%2062.0006L36.3335%2082.4973L41.5035%2087.6673L62.0002%2067.1706L82.4968%2087.6673L87.6668%2082.4973L67.1702%2062.0006L87.6668%2041.504Z'%20fill='white'/%3e%3c/svg%3e";
-function Kn(t) {
+const Kn = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23767676'/%3e%3cpath%20d='M87.6668%2041.504L82.4968%2036.334L62.0002%2056.8307L41.5035%2036.334L36.3335%2041.504L56.8302%2062.0006L36.3335%2082.4973L41.5035%2087.6673L62.0002%2067.1706L82.4968%2087.6673L87.6668%2082.4973L67.1702%2062.0006L87.6668%2041.504Z'%20fill='white'/%3e%3c/svg%3e";
+function qn(t) {
   x(t, "svelte-1609h93", "img.svelte-1609h93{width:124px;height:124px;margin:0 auto}");
 }
-function qn(t) {
+function jn(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), Z(e.src, r = Hn) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon svelte-1609h93");
+      e = k("img"), ee(e.src, r = Kn) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon svelte-1609h93");
     },
     m(n, i) {
       p(n, e, i);
@@ -1274,15 +1282,15 @@ function qn(t) {
     }
   };
 }
-class jn extends U {
+class Jn extends U {
   constructor(e) {
-    super(), N(this, e, null, qn, T, {}, Kn);
+    super(), N(this, e, null, jn, T, {}, qn);
   }
 }
-function Jn(t) {
+function Vn(t) {
   x(t, "svelte-1rmxk7q", "button.svelte-1rmxk7q{border:none;border-radius:56px;font-size:16px;cursor:pointer;height:56px;color:var(--rc-color-grey-text-dark);background-color:var(--rc-color-grey-ui-dark);display:flex;align-items:center;justify-content:center}button.intent-primary.svelte-1rmxk7q{background-color:var(--rc-color-grey-text-dark);color:var(--rc-color-white);font-size:16px}button.svelte-1rmxk7q:disabled{color:var(--rc-color-grey-text-light)}button.intent-primary.svelte-1rmxk7q:disabled{color:var(--rc-color-grey-text-light)}");
 }
-function Vn(t) {
+function Wn(t) {
   let e, r, n, i, o;
   const s = (
     /*#slots*/
@@ -1296,12 +1304,12 @@ function Vn(t) {
   );
   return {
     c() {
-      e = k("button"), l && l.c(), _(e, "class", r = Ee(`intent-${/*intent*/
+      e = k("button"), l && l.c(), _(e, "class", r = Ae(`intent-${/*intent*/
       t[0]}`) + " svelte-1rmxk7q"), e.disabled = /*disabled*/
       t[1];
     },
     m(c, a) {
-      p(c, e, a), l && l.m(e, null), n = !0, i || (o = ke(
+      p(c, e, a), l && l.m(e, null), n = !0, i || (o = we(
         e,
         "click",
         /*click_handler*/
@@ -1328,7 +1336,7 @@ function Vn(t) {
         ),
         null
       ), (!n || a & /*intent*/
-      1 && r !== (r = Ee(`intent-${/*intent*/
+      1 && r !== (r = Ae(`intent-${/*intent*/
       c[0]}`) + " svelte-1rmxk7q")) && _(e, "class", r), (!n || a & /*disabled*/
       2) && (e.disabled = /*disabled*/
       c[1]);
@@ -1337,31 +1345,31 @@ function Vn(t) {
       n || (f(l, c), n = !0);
     },
     o(c) {
-      m(l, c), n = !1;
+      d(l, c), n = !1;
     },
     d(c) {
       c && g(e), l && l.d(c), i = !1, o();
     }
   };
 }
-function Wn(t, e, r) {
+function zn(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { intent: o = "primary" } = e, { disabled: s = !1 } = e;
   function l(c) {
-    Ct.call(this, t, c);
+    Pt.call(this, t, c);
   }
   return t.$$set = (c) => {
     "intent" in c && r(0, o = c.intent), "disabled" in c && r(1, s = c.disabled), "$$scope" in c && r(2, i = c.$$scope);
   }, [o, s, i, n, l];
 }
-class Ie extends U {
+class be extends U {
   constructor(e) {
-    super(), N(this, e, Wn, Vn, T, { intent: 0, disabled: 1 }, Jn);
+    super(), N(this, e, zn, Wn, T, { intent: 0, disabled: 1 }, Vn);
   }
 }
-function zn(t) {
+function Xn(t) {
   x(t, "svelte-1f9z0o8", "footer.svelte-1f9z0o8{display:flex;flex-direction:column}");
 }
-function Xn(t) {
+function Zn(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -1405,14 +1413,14 @@ function Xn(t) {
       r || (f(i, o), r = !0);
     },
     o(o) {
-      m(i, o), r = !1;
+      d(i, o), r = !1;
     },
     d(o) {
       o && g(e), i && i.d(o);
     }
   };
 }
-function Zn(t, e, r) {
+function er(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e;
   return t.$$set = (o) => {
     "$$scope" in o && r(0, i = o.$$scope);
@@ -1420,13 +1428,13 @@ function Zn(t, e, r) {
 }
 class ze extends U {
   constructor(e) {
-    super(), N(this, e, Zn, Xn, T, {}, zn);
+    super(), N(this, e, er, Zn, T, {}, Xn);
   }
 }
-function er(t) {
+function tr(t) {
   x(t, "svelte-6o8e90", '.column.svelte-6o8e90{display:flex;flex-direction:column;justify-content:flex-start;gap:var(--gap, "8px");flex-grow:1}');
 }
-function tr(t) {
+function nr(t) {
   let e, r, n;
   const i = (
     /*#slots*/
@@ -1473,37 +1481,37 @@ function tr(t) {
       n || (f(o, s), n = !0);
     },
     o(s) {
-      m(o, s), n = !1;
+      d(o, s), n = !1;
     },
     d(s) {
       s && g(e), o && o.d(s);
     }
   };
 }
-function nr(t, e, r) {
+function rr(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { gutter: o = "8px" } = e;
   return t.$$set = (s) => {
     "gutter" in s && r(0, o = s.gutter), "$$scope" in s && r(1, i = s.$$scope);
   }, [o, i, n];
 }
-class $e extends U {
+class ye extends U {
   constructor(e) {
-    super(), N(this, e, nr, tr, T, { gutter: 0 }, er);
+    super(), N(this, e, rr, nr, T, { gutter: 0 }, tr);
   }
 }
-const rr = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20id='mdi_close'%3e%3cpath%20id='Vector'%20d='M19%206.41L17.59%205L12%2010.59L6.41%205L5%206.41L10.59%2012L5%2017.59L6.41%2019L12%2013.41L17.59%2019L19%2017.59L13.41%2012L19%206.41Z'%20fill='%23767676'/%3e%3c/g%3e%3c/svg%3e";
-function ir(t) {
+const ir = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20id='mdi_close'%3e%3cpath%20id='Vector'%20d='M19%206.41L17.59%205L12%2010.59L6.41%205L5%206.41L10.59%2012L5%2017.59L6.41%2019L12%2013.41L17.59%2019L19%2017.59L13.41%2012L19%206.41Z'%20fill='%23767676'/%3e%3c/g%3e%3c/svg%3e";
+function or(t) {
   x(t, "svelte-14xreta", ".close-button.svelte-14xreta{border:none;cursor:pointer;background-color:transparent;padding:0px}");
 }
-function or(t) {
+function sr(t) {
   let e, r, n, i, o;
   return {
     c() {
-      e = k("button"), r = k("img"), Z(r.src, n = rr) || _(r, "src", n), _(r, "alt", "close"), _(e, "class", "close-button svelte-14xreta"), e.disabled = /*disabled*/
+      e = k("button"), r = k("img"), ee(r.src, n = ir) || _(r, "src", n), _(r, "alt", "close"), _(e, "class", "close-button svelte-14xreta"), e.disabled = /*disabled*/
       t[0];
     },
     m(s, l) {
-      p(s, e, l), C(e, r), i || (o = ke(
+      p(s, e, l), M(e, r), i || (o = we(
         e,
         "click",
         /*click_handler*/
@@ -1522,24 +1530,24 @@ function or(t) {
     }
   };
 }
-function sr(t, e, r) {
+function lr(t, e, r) {
   let { disabled: n = !1 } = e;
   function i(o) {
-    Ct.call(this, t, o);
+    Pt.call(this, t, o);
   }
   return t.$$set = (o) => {
     "disabled" in o && r(0, n = o.disabled);
   }, [n, i];
 }
-class lr extends U {
+class cr extends U {
   constructor(e) {
-    super(), N(this, e, sr, or, T, { disabled: 0 }, ir);
+    super(), N(this, e, lr, sr, T, { disabled: 0 }, or);
   }
 }
-function cr(t) {
+function ar(t) {
   x(t, "svelte-44qpq9", ".rcb-app-icon.svelte-44qpq9{width:40px;height:40px;border-radius:12px;box-shadow:0px 1px 10px 0px rgba(0, 0, 0, 0.1);margin-right:16px}.rcb-app-icon-picture-container.svelte-44qpq9{height:40px}.rcb-app-icon.loading.svelte-44qpq9{background-color:gray}");
 }
-function ar(t) {
+function ur(t) {
   let e;
   return {
     c() {
@@ -1554,22 +1562,22 @@ function ar(t) {
     }
   };
 }
-function ur(t) {
+function fr(t) {
   let e, r, n, i, o, s;
   return {
     c() {
-      e = k("picture"), r = k("source"), i = P(), o = k("img"), _(r, "type", "image/webp"), on(r, n = /*srcWebp*/
-      t[1]) || _(r, "srcset", n), _(o, "class", "rcb-app-icon svelte-44qpq9"), Z(o.src, s = /*src*/
+      e = k("picture"), r = k("source"), i = Q(), o = k("img"), _(r, "type", "image/webp"), on(r, n = /*srcWebp*/
+      t[1]) || _(r, "srcset", n), _(o, "class", "rcb-app-icon svelte-44qpq9"), ee(o.src, s = /*src*/
       t[0]) || _(o, "src", s), _(o, "alt", "App icon"), _(e, "class", "rcb-app-icon-picture-container svelte-44qpq9");
     },
     m(l, c) {
-      p(l, e, c), C(e, r), C(e, i), C(e, o);
+      p(l, e, c), M(e, r), M(e, i), M(e, o);
     },
     p(l, c) {
       c & /*srcWebp*/
       2 && n !== (n = /*srcWebp*/
       l[1]) && _(r, "srcset", n), c & /*src*/
-      1 && !Z(o.src, s = /*src*/
+      1 && !ee(o.src, s = /*src*/
       l[0]) && _(o, "src", s);
     },
     d(l) {
@@ -1577,12 +1585,12 @@ function ur(t) {
     }
   };
 }
-function fr(t) {
+function dr(t) {
   let e;
   function r(o, s) {
     return (
       /*src*/
-      o[0] !== null ? ur : ar
+      o[0] !== null ? fr : ur
     );
   }
   let n = r(t), i = n(t);
@@ -1603,7 +1611,7 @@ function fr(t) {
     }
   };
 }
-function dr(t, e, r) {
+function mr(t, e, r) {
   let { src: n = null } = e, { srcWebp: i = null } = e;
   return t.$$set = (o) => {
     "src" in o && r(0, n = o.src), "srcWebp" in o && r(1, i = o.srcWebp);
@@ -1611,14 +1619,14 @@ function dr(t, e, r) {
 }
 class Nt extends U {
   constructor(e) {
-    super(), N(this, e, dr, fr, T, { src: 0, srcWebp: 1 }, cr);
+    super(), N(this, e, mr, dr, T, { src: 0, srcWebp: 1 }, ar);
   }
 }
-const Me = (t) => `https://da08ctfrofx1b.cloudfront.net/${t}`;
-function mr(t) {
+const Ce = (t) => `https://da08ctfrofx1b.cloudfront.net/${t}`;
+function gr(t) {
   x(t, "svelte-10uf5fq", ".app-title.svelte-10uf5fq{font-weight:500;margin:8px 0;font-size:16px}.rcb-header-layout__business-info.svelte-10uf5fq{display:flex;align-items:center}");
 }
-function gr(t) {
+function pr(t) {
   let e, r;
   return e = new Nt({}), {
     c() {
@@ -1632,14 +1640,14 @@ function gr(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function pr(t) {
+function _r(t) {
   let e, r, n = (
     /*brandingInfo*/
     t[0].seller_company_name + ""
@@ -1650,16 +1658,16 @@ function pr(t) {
   );
   return {
     c() {
-      s && s.c(), e = P(), r = k("span"), i = L(n), _(r, "class", "app-title svelte-10uf5fq");
+      s && s.c(), e = Q(), r = k("span"), i = L(n), _(r, "class", "app-title svelte-10uf5fq");
     },
     m(l, c) {
-      s && s.m(l, c), p(l, e, c), p(l, r, c), C(r, i), o = !0;
+      s && s.m(l, c), p(l, e, c), p(l, r, c), M(r, i), o = !0;
     },
     p(l, c) {
       /*brandingInfo*/
       l[0].app_icon_webp !== null && /*brandingInfo*/
       l[0].app_icon !== null ? s ? (s.p(l, c), c & /*brandingInfo*/
-      1 && f(s, 1)) : (s = at(l), s.c(), f(s, 1), s.m(e.parentNode, e)) : s && (H(), m(s, 1, 1, () => {
+      1 && f(s, 1)) : (s = at(l), s.c(), f(s, 1), s.m(e.parentNode, e)) : s && (H(), d(s, 1, 1, () => {
         s = null;
       }), K()), (!o || c & /*brandingInfo*/
       1) && n !== (n = /*brandingInfo*/
@@ -1669,7 +1677,7 @@ function pr(t) {
       o || (f(s), o = !0);
     },
     o(l) {
-      m(s), o = !1;
+      d(s), o = !1;
     },
     d(l) {
       l && (g(e), g(r)), s && s.d(l);
@@ -1680,11 +1688,11 @@ function at(t) {
   let e, r;
   return e = new Nt({
     props: {
-      src: Me(
+      src: Ce(
         /*brandingInfo*/
         t[0].app_icon
       ),
-      srcWebp: Me(
+      srcWebp: Ce(
         /*brandingInfo*/
         t[0].app_icon_webp
       )
@@ -1699,11 +1707,11 @@ function at(t) {
     p(n, i) {
       const o = {};
       i & /*brandingInfo*/
-      1 && (o.src = Me(
+      1 && (o.src = Ce(
         /*brandingInfo*/
         n[0].app_icon
       )), i & /*brandingInfo*/
-      1 && (o.srcWebp = Me(
+      1 && (o.srcWebp = Ce(
         /*brandingInfo*/
         n[0].app_icon_webp
       )), e.$set(o);
@@ -1712,16 +1720,16 @@ function at(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function _r(t) {
+function hr(t) {
   let e, r, n, i;
-  const o = [pr, gr], s = [];
+  const o = [_r, pr], s = [];
   function l(c, a) {
     return (
       /*brandingInfo*/
@@ -1737,7 +1745,7 @@ function _r(t) {
     },
     p(c, [a]) {
       let u = r;
-      r = l(c), r === u ? s[r].p(c, a) : (H(), m(s[u], 1, 1, () => {
+      r = l(c), r === u ? s[r].p(c, a) : (H(), d(s[u], 1, 1, () => {
         s[u] = null;
       }), K(), n = s[r], n ? n.p(c, a) : (n = s[r] = o[r](c), n.c()), f(n, 1), n.m(e, null));
     },
@@ -1745,7 +1753,7 @@ function _r(t) {
       i || (f(n), i = !0);
     },
     o(c) {
-      m(n), i = !1;
+      d(n), i = !1;
     },
     d(c) {
       c && g(e), s[r].d();
@@ -1760,30 +1768,30 @@ function Ar(t, e, r) {
 }
 class Ut extends U {
   constructor(e) {
-    super(), N(this, e, Ar, _r, T, { brandingInfo: 0 }, mr);
+    super(), N(this, e, Ar, hr, T, { brandingInfo: 0 }, gr);
   }
 }
-function hr(t) {
+function Er(t) {
   x(t, "svelte-17puakv", ".rcb-post-purchase-header-layout.svelte-17puakv{display:flex;justify-content:space-between;align-items:center;width:100%;margin-top:-4px}");
 }
-function Er(t) {
+function br(t) {
   let e, r, n, i, o;
   return r = new Ut({
     props: { brandingInfo: (
       /*brandingInfo*/
       t[0]
     ) }
-  }), i = new lr({}), i.$on("click", function() {
+  }), i = new cr({}), i.$on("click", function() {
     ce(
       /*onClose*/
       t[1]
     ) && t[1].apply(this, arguments);
   }), {
     c() {
-      e = k("div"), w(r.$$.fragment), n = P(), w(i.$$.fragment), _(e, "class", "rcb-post-purchase-header-layout svelte-17puakv");
+      e = k("div"), w(r.$$.fragment), n = Q(), w(i.$$.fragment), _(e, "class", "rcb-post-purchase-header-layout svelte-17puakv");
     },
     m(s, l) {
-      p(s, e, l), b(r, e, null), C(e, n), b(i, e, null), o = !0;
+      p(s, e, l), b(r, e, null), M(e, n), b(i, e, null), o = !0;
     },
     p(s, l) {
       t = s;
@@ -1796,19 +1804,19 @@ function Er(t) {
       o || (f(r.$$.fragment, s), f(i.$$.fragment, s), o = !0);
     },
     o(s) {
-      m(r.$$.fragment, s), m(i.$$.fragment, s), o = !1;
+      d(r.$$.fragment, s), d(i.$$.fragment, s), o = !1;
     },
     d(s) {
       s && g(e), I(r), I(i);
     }
   };
 }
-function br(t) {
+function Ir(t) {
   let e, r;
   return e = new ue({
     props: {
       as: "header",
-      $$slots: { default: [Er] },
+      $$slots: { default: [br] },
       $$scope: { ctx: t }
     }
   }), {
@@ -1827,29 +1835,29 @@ function br(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function Ir(t, e, r) {
+function wr(t, e, r) {
   let { brandingInfo: n = null } = e, { onClose: i } = e;
   return t.$$set = (o) => {
     "brandingInfo" in o && r(0, n = o.brandingInfo), "onClose" in o && r(1, i = o.onClose);
   }, [n, i];
 }
-class wr extends U {
+class kr extends U {
   constructor(e) {
-    super(), N(this, e, Ir, br, T, { brandingInfo: 0, onClose: 1 }, hr);
+    super(), N(this, e, wr, Ir, T, { brandingInfo: 0, onClose: 1 }, Er);
   }
 }
-function kr(t) {
+function yr(t) {
   x(t, "svelte-10pcqja", ".rcb-modal-message.svelte-10pcqja{width:100%;min-height:160px;display:flex;justify-content:center;align-items:center;flex-direction:column;text-align:center}.title.svelte-10pcqja{font-size:24px;line-height:1.25em}.subtitle.svelte-10pcqja{font-size:16px;line-height:1.25em;overflow-wrap:anywhere}");
 }
-const $r = (t) => ({}), ut = (t) => ({});
-function vr(t) {
+const vr = (t) => ({}), ut = (t) => ({});
+function $r(t) {
   let e, r, n, i, o;
   const s = (
     /*#slots*/
@@ -1866,10 +1874,10 @@ function vr(t) {
       e = k("span"), r = L(
         /*title*/
         t[2]
-      ), n = P(), i = k("span"), l && l.c(), _(e, "class", "title svelte-10pcqja"), _(i, "class", "subtitle svelte-10pcqja");
+      ), n = Q(), i = k("span"), l && l.c(), _(e, "class", "title svelte-10pcqja"), _(i, "class", "subtitle svelte-10pcqja");
     },
     m(c, a) {
-      p(c, e, a), C(e, r), p(c, n, a), p(c, i, a), l && l.m(i, null), o = !0;
+      p(c, e, a), M(e, r), p(c, n, a), p(c, i, a), l && l.m(i, null), o = !0;
     },
     p(c, a) {
       (!o || a & /*title*/
@@ -1901,14 +1909,14 @@ function vr(t) {
       o || (f(l, c), o = !0);
     },
     o(c) {
-      m(l, c), o = !1;
+      d(l, c), o = !1;
     },
     d(c) {
       c && (g(e), g(n), g(i)), l && l.d(c);
     }
   };
 }
-function yr(t) {
+function Br(t) {
   let e, r, n;
   const i = (
     /*#slots*/
@@ -1920,15 +1928,15 @@ function yr(t) {
     t[5],
     ut
   );
-  return r = new $e({
+  return r = new ye({
     props: {
       gutter: "16px",
-      $$slots: { default: [vr] },
+      $$slots: { default: [$r] },
       $$scope: { ctx: t }
     }
   }), {
     c() {
-      o && o.c(), e = P(), w(r.$$.fragment);
+      o && o.c(), e = Q(), w(r.$$.fragment);
     },
     m(s, l) {
       o && o.m(s, l), p(s, e, l), b(r, s, l), n = !0;
@@ -1946,7 +1954,7 @@ function yr(t) {
           /*$$scope*/
           s[5],
           l,
-          $r
+          vr
         ) : V(
           /*$$scope*/
           s[5]
@@ -1961,19 +1969,19 @@ function yr(t) {
       n || (f(o, s), f(r.$$.fragment, s), n = !0);
     },
     o(s) {
-      m(o, s), m(r.$$.fragment, s), n = !1;
+      d(o, s), d(r.$$.fragment, s), n = !1;
     },
     d(s) {
       s && g(e), o && o.d(s), I(r, s);
     }
   };
 }
-function Br(t) {
+function Dr(t) {
   let e, r, n;
-  return r = new $e({
+  return r = new ye({
     props: {
       gutter: "16px",
-      $$slots: { default: [yr] },
+      $$slots: { default: [Br] },
       $$scope: { ctx: t }
     }
   }), {
@@ -2003,14 +2011,14 @@ function Br(t) {
       n || (f(r.$$.fragment, i), n = !0);
     },
     o(i) {
-      m(r.$$.fragment, i), n = !1;
+      d(r.$$.fragment, i), n = !1;
     },
     d(i) {
       i && g(e), I(r);
     }
   };
 }
-function Dr(t) {
+function Cr(t) {
   let e;
   return {
     c() {
@@ -2024,11 +2032,11 @@ function Dr(t) {
     }
   };
 }
-function Mr(t) {
+function Pr(t) {
   let e, r;
-  return e = new Ie({
+  return e = new be({
     props: {
-      $$slots: { default: [Dr] },
+      $$slots: { default: [Cr] },
       $$scope: { ctx: t }
     }
   }), e.$on("click", function() {
@@ -2053,16 +2061,16 @@ function Mr(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function Cr(t) {
+function Mr(t) {
   let e, r, n, i, o, s;
-  return e = new wr({
+  return e = new kr({
     props: {
       brandingInfo: (
         /*brandingInfo*/
@@ -2075,17 +2083,17 @@ function Cr(t) {
     }
   }), n = new ue({
     props: {
-      $$slots: { default: [Br] },
+      $$slots: { default: [Dr] },
       $$scope: { ctx: t }
     }
   }), o = new ze({
     props: {
-      $$slots: { default: [Mr] },
+      $$slots: { default: [Pr] },
       $$scope: { ctx: t }
     }
   }), {
     c() {
-      w(e.$$.fragment), r = P(), w(n.$$.fragment), i = P(), w(o.$$.fragment);
+      w(e.$$.fragment), r = Q(), w(n.$$.fragment), i = Q(), w(o.$$.fragment);
     },
     m(l, c) {
       b(e, l, c), p(l, r, c), b(n, l, c), p(l, i, c), b(o, l, c), s = !0;
@@ -2100,15 +2108,15 @@ function Cr(t) {
       const u = {};
       c & /*$$scope, type, title*/
       44 && (u.$$scope = { dirty: c, ctx: l }), n.$set(u);
-      const d = {};
+      const m = {};
       c & /*$$scope, onContinue*/
-      34 && (d.$$scope = { dirty: c, ctx: l }), o.$set(d);
+      34 && (m.$$scope = { dirty: c, ctx: l }), o.$set(m);
     },
     i(l) {
       s || (f(e.$$.fragment, l), f(n.$$.fragment, l), f(o.$$.fragment, l), s = !0);
     },
     o(l) {
-      m(e.$$.fragment, l), m(n.$$.fragment, l), m(o.$$.fragment, l), s = !1;
+      d(e.$$.fragment, l), d(n.$$.fragment, l), d(o.$$.fragment, l), s = !1;
     },
     d(l) {
       l && (g(r), g(i)), I(e, l), I(n, l), I(o, l);
@@ -2117,10 +2125,10 @@ function Cr(t) {
 }
 function Qr(t) {
   let e, r;
-  return e = new $e({
+  return e = new ye({
     props: {
       gutter: "32px",
-      $$slots: { default: [Cr] },
+      $$slots: { default: [Mr] },
       $$scope: { ctx: t }
     }
   }), {
@@ -2139,14 +2147,14 @@ function Qr(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function Pr(t, e, r) {
+function Tr(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { brandingInfo: o = null } = e, { onContinue: s } = e, { title: l } = e, { type: c } = e;
   return t.$$set = (a) => {
     "brandingInfo" in a && r(0, o = a.brandingInfo), "onContinue" in a && r(1, s = a.onContinue), "title" in a && r(2, l = a.title), "type" in a && r(3, c = a.type), "$$scope" in a && r(5, i = a.$$scope);
@@ -2157,7 +2165,7 @@ class Rt extends U {
     super(), N(
       this,
       e,
-      Pr,
+      Tr,
       Qr,
       T,
       {
@@ -2166,7 +2174,7 @@ class Rt extends U {
         title: 2,
         type: 3
       },
-      kr
+      yr
     );
   }
 }
@@ -2181,7 +2189,7 @@ function ft(t) {
       t[1]);
     },
     m(s, l) {
-      p(s, e, l), p(s, r, l), C(r, n), p(s, o, l);
+      p(s, e, l), p(s, r, l), M(r, n), p(s, o, l);
     },
     p(s, l) {
       l & /*supportEmail*/
@@ -2198,7 +2206,7 @@ function ft(t) {
     }
   };
 }
-function Tr(t) {
+function Nr(t) {
   let e = (
     /*getErrorMessage*/
     t[3]() + ""
@@ -2208,7 +2216,7 @@ function Tr(t) {
   );
   return {
     c() {
-      r = L(e), n = P(), o && o.c(), i = te();
+      r = L(e), n = Q(), o && o.c(), i = te();
     },
     m(s, l) {
       p(s, r, l), p(s, n, l), o && o.m(s, l), p(s, i, l);
@@ -2222,9 +2230,9 @@ function Tr(t) {
     }
   };
 }
-function Nr(t) {
+function Ur(t) {
   let e, r;
-  return e = new jn({ props: { slot: "icon" } }), {
+  return e = new Jn({ props: { slot: "icon" } }), {
     c() {
       w(e.$$.fragment);
     },
@@ -2236,14 +2244,14 @@ function Nr(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function Ur(t) {
+function Rr(t) {
   let e, r;
   return e = new Rt({
     props: {
@@ -2261,8 +2269,8 @@ function Ur(t) {
       ),
       type: "error",
       $$slots: {
-        icon: [Nr],
-        default: [Tr]
+        icon: [Ur],
+        default: [Nr]
       },
       $$scope: { ctx: t }
     }
@@ -2286,16 +2294,16 @@ function Ur(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function Rr(t, e, r) {
+function Sr(t, e, r) {
   let { brandingInfo: n = null } = e, { lastError: i } = e, { supportEmail: o = null } = e, { onContinue: s } = e;
-  Oe(() => {
+  Se(() => {
     G.errorLog(`Displayed error: ${O[i.errorCode]}. Message: ${i.message ?? "None"}. Underlying error: ${i.underlyingErrorMessage ?? "None"}`);
   });
   function l() {
@@ -2336,9 +2344,9 @@ function Rr(t, e, r) {
     i
   ];
 }
-class Sr extends U {
+class Or extends U {
   constructor(e) {
-    super(), N(this, e, Rr, Ur, T, {
+    super(), N(this, e, Sr, Rr, T, {
       brandingInfo: 0,
       lastError: 5,
       supportEmail: 1,
@@ -2346,15 +2354,15 @@ class Sr extends U {
     });
   }
 }
-const Or = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23576CDB'/%3e%3crect%20x='44.1116'%20y='56'%20width='27.5'%20height='11'%20transform='rotate(45%2044.1116%2056)'%20fill='white'/%3e%3crect%20x='79.1133'%20y='44.334'%20width='11'%20height='44'%20transform='rotate(45%2079.1133%2044.334)'%20fill='white'/%3e%3c/svg%3e";
-function Lr(t) {
+const Lr = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23576CDB'/%3e%3crect%20x='44.1116'%20y='56'%20width='27.5'%20height='11'%20transform='rotate(45%2044.1116%2056)'%20fill='white'/%3e%3crect%20x='79.1133'%20y='44.334'%20width='11'%20height='44'%20transform='rotate(45%2079.1133%2044.334)'%20fill='white'/%3e%3c/svg%3e";
+function xr(t) {
   x(t, "svelte-1609h93", "img.svelte-1609h93{width:124px;height:124px;margin:0 auto}");
 }
-function xr(t) {
+function Fr(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), Z(e.src, r = Or) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon svelte-1609h93");
+      e = k("img"), ee(e.src, r = Lr) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon svelte-1609h93");
     },
     m(n, i) {
       p(n, e, i);
@@ -2367,12 +2375,12 @@ function xr(t) {
     }
   };
 }
-class Fr extends U {
+class Gr extends U {
   constructor(e) {
-    super(), N(this, e, null, xr, T, {}, Lr);
+    super(), N(this, e, null, Fr, T, {}, xr);
   }
 }
-function Gr(t) {
+function Yr(t) {
   let e;
   return {
     c() {
@@ -2386,9 +2394,9 @@ function Gr(t) {
     }
   };
 }
-function Yr(t) {
+function Hr(t) {
   let e, r;
-  return e = new Fr({ props: { slot: "icon" } }), {
+  return e = new Gr({ props: { slot: "icon" } }), {
     c() {
       w(e.$$.fragment);
     },
@@ -2400,14 +2408,14 @@ function Yr(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function Hr(t) {
+function Kr(t) {
   let e, r;
   return e = new Rt({
     props: {
@@ -2422,8 +2430,8 @@ function Hr(t) {
         t[1]
       ),
       $$slots: {
-        icon: [Yr],
-        default: [Gr]
+        icon: [Hr],
+        default: [Yr]
       },
       $$scope: { ctx: t }
     }
@@ -2447,37 +2455,37 @@ function Hr(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function Kr(t, e, r) {
+function qr(t, e, r) {
   let { brandingInfo: n = null } = e, { onContinue: i } = e;
   return t.$$set = (o) => {
     "brandingInfo" in o && r(0, n = o.brandingInfo), "onContinue" in o && r(1, i = o.onContinue);
   }, [n, i];
 }
-class qr extends U {
+class jr extends U {
   constructor(e) {
-    super(), N(this, e, Kr, Hr, T, { brandingInfo: 0, onContinue: 1 });
+    super(), N(this, e, qr, Kr, T, { brandingInfo: 0, onContinue: 1 });
   }
 }
-function jr(t, e, r, n, i = {}) {
+function Jr(t, e, r, n, i = {}) {
   const o = r.create(e, i);
   return o.mount(t), o.on("change", (s) => n("change", s)), o.on("ready", (s) => n("ready", s)), o.on("focus", (s) => n("focus", s)), o.on("blur", (s) => n("blur", s)), o.on("escape", (s) => n("escape", s)), o.on("click", (s) => n("click", s)), o.on("loaderror", (s) => n("loaderror", s)), o.on("loaderstart", (s) => n("loaderstart", s)), o.on("networkschange", (s) => n("networkschange", s)), o;
 }
-const Jr = typeof window > "u";
-function Vr(t) {
-  if (!Jr)
+const Vr = typeof window > "u";
+function Wr(t) {
+  if (!Vr)
     return t.registerAppInfo({
       name: "svelte-stripe-js",
       url: "https://svelte-stripe-js.vercel.app"
     });
 }
-function Wr(t) {
+function zr(t) {
   let e;
   return {
     c() {
@@ -2494,11 +2502,11 @@ function Wr(t) {
     }
   };
 }
-function zr(t, e, r) {
+function Xr(t, e, r) {
   let n, i;
-  const o = _n(), { elements: s } = hn("stripe");
+  const o = hn(), { elements: s } = En("stripe");
   let { options: l = void 0 } = e;
-  Oe(() => (n = jr(i, "payment", s, o, l), () => n.destroy()));
+  Se(() => (n = Jr(i, "payment", s, o, l), () => n.destroy()));
   function c() {
     n.blur();
   }
@@ -2508,21 +2516,21 @@ function zr(t, e, r) {
   function u() {
     n.destroy();
   }
-  function d() {
+  function m() {
     n.focus();
   }
-  function h($) {
-    Ue[$ ? "unshift" : "push"](() => {
-      i = $, r(0, i);
+  function h(y) {
+    Ue[y ? "unshift" : "push"](() => {
+      i = y, r(0, i);
     });
   }
-  return t.$$set = ($) => {
-    "options" in $ && r(1, l = $.options);
-  }, [i, l, c, a, u, d, h];
+  return t.$$set = (y) => {
+    "options" in y && r(1, l = y.options);
+  }, [i, l, c, a, u, m, h];
 }
-class Xr extends U {
+class Zr extends U {
   constructor(e) {
-    super(), N(this, e, zr, Wr, T, {
+    super(), N(this, e, Xr, zr, T, {
       options: 1,
       blur: 2,
       clear: 3,
@@ -2587,14 +2595,14 @@ function dt(t) {
       e || (f(n, i), e = !0);
     },
     o(i) {
-      m(n, i), e = !1;
+      d(n, i), e = !1;
     },
     d(i) {
       n && n.d(i);
     }
   };
 }
-function Zr(t) {
+function ei(t) {
   let e, r, n = (
     /*stripe*/
     t[1] && /*elements*/
@@ -2611,7 +2619,7 @@ function Zr(t) {
       /*stripe*/
       i[1] && /*elements*/
       i[0] ? n ? (n.p(i, o), o & /*stripe, elements*/
-      3 && f(n, 1)) : (n = dt(i), n.c(), f(n, 1), n.m(e.parentNode, e)) : n && (H(), m(n, 1, 1, () => {
+      3 && f(n, 1)) : (n = dt(i), n.c(), f(n, 1), n.m(e.parentNode, e)) : n && (H(), d(n, 1, 1, () => {
         n = null;
       }), K());
     },
@@ -2619,30 +2627,30 @@ function Zr(t) {
       r || (f(n), r = !0);
     },
     o(i) {
-      m(n), r = !1;
+      d(n), r = !1;
     },
     d(i) {
       i && g(e), n && n.d(i);
     }
   };
 }
-function ei(t, e, r) {
-  let n, { $$slots: i = {}, $$scope: o } = e, { stripe: s } = e, { mode: l = void 0 } = e, { theme: c = "stripe" } = e, { variables: a = {} } = e, { rules: u = {} } = e, { labels: d = "above" } = e, { loader: h = "auto" } = e, { fonts: $ = [] } = e, { locale: E = "auto" } = e, { currency: B = void 0 } = e, { amount: A = void 0 } = e, { clientSecret: y = void 0 } = e, { elements: R = null } = e;
-  return t.$$set = (M) => {
-    "stripe" in M && r(1, s = M.stripe), "mode" in M && r(2, l = M.mode), "theme" in M && r(3, c = M.theme), "variables" in M && r(4, a = M.variables), "rules" in M && r(5, u = M.rules), "labels" in M && r(6, d = M.labels), "loader" in M && r(7, h = M.loader), "fonts" in M && r(8, $ = M.fonts), "locale" in M && r(9, E = M.locale), "currency" in M && r(10, B = M.currency), "amount" in M && r(11, A = M.amount), "clientSecret" in M && r(12, y = M.clientSecret), "elements" in M && r(0, R = M.elements), "$$scope" in M && r(14, o = M.$$scope);
+function ti(t, e, r) {
+  let n, { $$slots: i = {}, $$scope: o } = e, { stripe: s } = e, { mode: l = void 0 } = e, { theme: c = "stripe" } = e, { variables: a = {} } = e, { rules: u = {} } = e, { labels: m = "above" } = e, { loader: h = "auto" } = e, { fonts: y = [] } = e, { locale: E = "auto" } = e, { currency: B = void 0 } = e, { amount: A = void 0 } = e, { clientSecret: $ = void 0 } = e, { elements: R = null } = e;
+  return t.$$set = (C) => {
+    "stripe" in C && r(1, s = C.stripe), "mode" in C && r(2, l = C.mode), "theme" in C && r(3, c = C.theme), "variables" in C && r(4, a = C.variables), "rules" in C && r(5, u = C.rules), "labels" in C && r(6, m = C.labels), "loader" in C && r(7, h = C.loader), "fonts" in C && r(8, y = C.fonts), "locale" in C && r(9, E = C.locale), "currency" in C && r(10, B = C.currency), "amount" in C && r(11, A = C.amount), "clientSecret" in C && r(12, $ = C.clientSecret), "elements" in C && r(0, R = C.elements), "$$scope" in C && r(14, o = C.$$scope);
   }, t.$$.update = () => {
     t.$$.dirty & /*theme, variables, rules, labels*/
-    120 && r(13, n = { theme: c, variables: a, rules: u, labels: d }), t.$$.dirty & /*stripe, elements, mode, currency, amount, appearance, clientSecret, fonts, loader, locale*/
+    120 && r(13, n = { theme: c, variables: a, rules: u, labels: m }), t.$$.dirty & /*stripe, elements, mode, currency, amount, appearance, clientSecret, fonts, loader, locale*/
     16263 && s && !R && (r(0, R = s.elements({
       mode: l,
       currency: B,
       amount: A,
       appearance: n,
-      clientSecret: y,
-      fonts: $,
+      clientSecret: $,
+      fonts: y,
       loader: h,
       locale: E
-    })), Vr(s), An("stripe", { stripe: s, elements: R })), t.$$.dirty & /*elements, appearance, locale*/
+    })), Wr(s), An("stripe", { stripe: s, elements: R })), t.$$.dirty & /*elements, appearance, locale*/
     8705 && R && R.update({ appearance: n, locale: E });
   }, [
     R,
@@ -2651,21 +2659,21 @@ function ei(t, e, r) {
     c,
     a,
     u,
-    d,
+    m,
     h,
-    $,
+    y,
     E,
     B,
     A,
-    y,
+    $,
     n,
     o,
     i
   ];
 }
-class ti extends U {
+class ni extends U {
   constructor(e) {
-    super(), N(this, e, ei, Zr, T, {
+    super(), N(this, e, ti, ei, T, {
       stripe: 1,
       mode: 2,
       theme: 3,
@@ -2682,10 +2690,10 @@ class ti extends U {
     });
   }
 }
-var St = "https://js.stripe.com/v3", ni = /^https:\/\/js\.stripe\.com\/v3\/?(\?.*)?$/, mt = "loadStripe.setLoadParameters was called but an existing Stripe.js script already exists in the document; existing script parameters will be used", ri = function() {
+var St = "https://js.stripe.com/v3", ri = /^https:\/\/js\.stripe\.com\/v3\/?(\?.*)?$/, mt = "loadStripe.setLoadParameters was called but an existing Stripe.js script already exists in the document; existing script parameters will be used", ii = function() {
   for (var e = document.querySelectorAll('script[src^="'.concat(St, '"]')), r = 0; r < e.length; r++) {
     var n = e[r];
-    if (ni.test(n.src))
+    if (ri.test(n.src))
       return n;
   }
   return null;
@@ -2696,22 +2704,22 @@ var St = "https://js.stripe.com/v3", ni = /^https:\/\/js\.stripe\.com\/v3\/?(\?.
   if (!i)
     throw new Error("Expected document.body not to be null. Stripe.js requires a <body> element.");
   return i.appendChild(n), n;
-}, ii = function(e, r) {
+}, oi = function(e, r) {
   !e || !e._registerWrapper || e._registerWrapper({
     name: "stripe-js",
     version: "2.4.0",
     startTime: r
   });
-}, me = null, Ce = null, Qe = null, oi = function(e) {
+}, de = null, Pe = null, Me = null, si = function(e) {
   return function() {
     e(new Error("Failed to load Stripe.js"));
   };
-}, si = function(e, r) {
+}, li = function(e, r) {
   return function() {
     window.Stripe ? e(window.Stripe) : r(new Error("Stripe.js not available"));
   };
-}, li = function(e) {
-  return me !== null ? me : (me = new Promise(function(r, n) {
+}, ci = function(e) {
+  return de !== null ? de : (de = new Promise(function(r, n) {
     if (typeof window > "u" || typeof document > "u") {
       r(null);
       return;
@@ -2721,51 +2729,51 @@ var St = "https://js.stripe.com/v3", ni = /^https:\/\/js\.stripe\.com\/v3\/?(\?.
       return;
     }
     try {
-      var i = ri();
+      var i = ii();
       if (i && e)
         console.warn(mt);
       else if (!i)
         i = gt(e);
-      else if (i && Qe !== null && Ce !== null) {
+      else if (i && Me !== null && Pe !== null) {
         var o;
-        i.removeEventListener("load", Qe), i.removeEventListener("error", Ce), (o = i.parentNode) === null || o === void 0 || o.removeChild(i), i = gt(e);
+        i.removeEventListener("load", Me), i.removeEventListener("error", Pe), (o = i.parentNode) === null || o === void 0 || o.removeChild(i), i = gt(e);
       }
-      Qe = si(r, n), Ce = oi(n), i.addEventListener("load", Qe), i.addEventListener("error", Ce);
+      Me = li(r, n), Pe = si(n), i.addEventListener("load", Me), i.addEventListener("error", Pe);
     } catch (s) {
       n(s);
       return;
     }
-  }), me.catch(function(r) {
-    return me = null, Promise.reject(r);
+  }), de.catch(function(r) {
+    return de = null, Promise.reject(r);
   }));
-}, ci = function(e, r, n) {
+}, ai = function(e, r, n) {
   if (e === null)
     return null;
   var i = e.apply(void 0, r);
-  return ii(i, n), i;
-}, ge, Ot = !1, Lt = function() {
-  return ge || (ge = li(null).catch(function(e) {
-    return ge = null, Promise.reject(e);
-  }), ge);
+  return oi(i, n), i;
+}, me, Ot = !1, Lt = function() {
+  return me || (me = ci(null).catch(function(e) {
+    return me = null, Promise.reject(e);
+  }), me);
 };
 Promise.resolve().then(function() {
   return Lt();
 }).catch(function(t) {
   Ot || console.warn(t);
 });
-var ai = function() {
+var ui = function() {
   for (var e = arguments.length, r = new Array(e), n = 0; n < e; n++)
     r[n] = arguments[n];
   Ot = !0;
   var i = Date.now();
   return Lt().then(function(o) {
-    return ci(o, r, i);
+    return ai(o, r, i);
   });
 };
-function ui(t) {
+function fi(t) {
   x(t, "svelte-1xe711j", ".rcb-header-layout.svelte-1xe711j{display:flex;justify-content:space-between;align-items:center;width:100%;font-size:24px;margin:0;font-weight:500}");
 }
-function fi(t) {
+function di(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -2809,19 +2817,19 @@ function fi(t) {
       r || (f(i, o), r = !0);
     },
     o(o) {
-      m(i, o), r = !1;
+      d(i, o), r = !1;
     },
     d(o) {
       o && g(e), i && i.d(o);
     }
   };
 }
-function di(t) {
+function mi(t) {
   let e, r;
   return e = new ue({
     props: {
       as: "header",
-      $$slots: { default: [fi] },
+      $$slots: { default: [di] },
       $$scope: { ctx: t }
     }
   }), {
@@ -2840,14 +2848,14 @@ function di(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function mi(t, e, r) {
+function gi(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e;
   return t.$$set = (o) => {
     "$$scope" in o && r(1, i = o.$$scope);
@@ -2855,15 +2863,15 @@ function mi(t, e, r) {
 }
 class Xe extends U {
   constructor(e) {
-    super(), N(this, e, mi, di, T, {}, ui);
+    super(), N(this, e, gi, mi, T, {}, fi);
   }
 }
-const gi = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cpath%20d='M18%208H17V6C17%203.24%2014.76%201%2012%201C9.24%201%207%203.24%207%206V8H6C4.9%208%204%208.9%204%2010V20C4%2021.1%204.9%2022%206%2022H18C19.1%2022%2020%2021.1%2020%2020V10C20%208.9%2019.1%208%2018%208ZM12%2017C10.9%2017%2010%2016.1%2010%2015C10%2013.9%2010.9%2013%2012%2013C13.1%2013%2014%2013.9%2014%2015C14%2016.1%2013.1%2017%2012%2017ZM15.1%208H8.9V6C8.9%204.29%2010.29%202.9%2012%202.9C13.71%202.9%2015.1%204.29%2015.1%206V8Z'%20fill='%2311D483'/%3e%3c/svg%3e";
-function pi(t) {
+const pi = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cpath%20d='M18%208H17V6C17%203.24%2014.76%201%2012%201C9.24%201%207%203.24%207%206V8H6C4.9%208%204%208.9%204%2010V20C4%2021.1%204.9%2022%206%2022H18C19.1%2022%2020%2021.1%2020%2020V10C20%208.9%2019.1%208%2018%208ZM12%2017C10.9%2017%2010%2016.1%2010%2015C10%2013.9%2010.9%2013%2012%2013C13.1%2013%2014%2013.9%2014%2015C14%2016.1%2013.1%2017%2012%2017ZM15.1%208H8.9V6C8.9%204.29%2010.29%202.9%2012%202.9C13.71%202.9%2015.1%204.29%2015.1%206V8Z'%20fill='%2311D483'/%3e%3c/svg%3e";
+function _i(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), Z(e.src, r = gi) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
+      e = k("img"), ee(e.src, r = pi) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
     },
     m(n, i) {
       p(n, e, i);
@@ -2876,12 +2884,12 @@ function pi(t) {
     }
   };
 }
-class _i extends U {
+class hi extends U {
   constructor(e) {
-    super(), N(this, e, null, pi, T, {});
+    super(), N(this, e, null, _i, T, {});
   }
 }
-const _e = {
+const pe = {
   error: "#f2545b",
   warning: "#f4e971",
   focus: "#000080",
@@ -2898,7 +2906,7 @@ function Ai(t) {
         -20px 0 #fff2;background:#fff2}100%{box-shadow:20px 0 #fff2,
         -20px 0 #fff2;background:#fff2}}`);
 }
-function hi(t) {
+function Ei(t) {
   let e;
   return {
     c() {
@@ -2917,13 +2925,13 @@ function hi(t) {
 }
 class xt extends U {
   constructor(e) {
-    super(), N(this, e, null, hi, T, {}, Ai);
+    super(), N(this, e, null, Ei, T, {}, Ai);
   }
 }
-function Ei(t) {
+function bi(t) {
   x(t, "svelte-1wxt892", ".rcb-stripe-elements-container.svelte-1wxt892{width:100%;margin-top:32px;margin-bottom:24px}");
 }
-function bi(t) {
+function Ii(t) {
   let e, r;
   return e = new We({}), {
     c() {
@@ -2937,14 +2945,14 @@ function bi(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function Ii(t) {
+function wi(t) {
   let e, r, n, i, o, s;
   function l(a) {
     t[9](a);
@@ -2965,17 +2973,17 @@ function Ii(t) {
       fontSizeBase: "16px",
       fontSizeSm: "16px",
       spacingGridRow: "16px",
-      colorText: _e["grey-text-dark"],
+      colorText: pe["grey-text-dark"],
       focusBoxShadow: "none",
-      colorDanger: _e.error
+      colorDanger: pe.error
     },
     rules: {
       ".Input": {
         boxShadow: "none",
-        border: `2px solid ${_e["grey-ui-dark"]}`
+        border: `2px solid ${pe["grey-ui-dark"]}`
       },
       ".Input:focus": {
-        border: `2px solid ${_e.focus}`,
+        border: `2px solid ${pe.focus}`,
         outline: "none"
       },
       ".Label": {
@@ -2985,36 +2993,36 @@ function Ii(t) {
       },
       ".Input--invalid": { boxShadow: "none" }
     },
-    $$slots: { default: [Ci] },
+    $$slots: { default: [Mi] },
     $$scope: { ctx: t }
   };
   return (
     /*elements*/
     t[2] !== void 0 && (c.elements = /*elements*/
-    t[2]), r = new ti({ props: c }), Ue.push(() => $n(r, "elements", l)), {
+    t[2]), r = new ni({ props: c }), Ue.push(() => vn(r, "elements", l)), {
       c() {
         e = k("form"), w(r.$$.fragment);
       },
       m(a, u) {
-        p(a, e, u), b(r, e, null), i = !0, o || (s = ke(e, "submit", Mt(
+        p(a, e, u), b(r, e, null), i = !0, o || (s = we(e, "submit", Ct(
           /*handleContinue*/
           t[5]
         )), o = !0);
       },
       p(a, u) {
-        const d = {};
+        const m = {};
         u & /*stripe*/
-        8 && (d.stripe = /*stripe*/
+        8 && (m.stripe = /*stripe*/
         a[3]), u & /*$$scope, processing, onClose*/
-        2051 && (d.$$scope = { dirty: u, ctx: a }), !n && u & /*elements*/
-        4 && (n = !0, d.elements = /*elements*/
-        a[2], In(() => n = !1)), r.$set(d);
+        2051 && (m.$$scope = { dirty: u, ctx: a }), !n && u & /*elements*/
+        4 && (n = !0, m.elements = /*elements*/
+        a[2], wn(() => n = !1)), r.$set(m);
       },
       i(a) {
         i || (f(r.$$.fragment, a), i = !0);
       },
       o(a) {
-        m(r.$$.fragment, a), i = !1;
+        d(r.$$.fragment, a), i = !1;
       },
       d(a) {
         a && g(e), I(r), o = !1, s();
@@ -3022,11 +3030,11 @@ function Ii(t) {
     }
   );
 }
-function wi(t) {
+function ki(t) {
   let e, r, n, i;
-  return n = new _i({}), {
+  return n = new hi({}), {
     c() {
-      e = k("div"), e.textContent = "Secure Checkout", r = P(), w(n.$$.fragment);
+      e = k("div"), e.textContent = "Secure Checkout", r = Q(), w(n.$$.fragment);
     },
     m(o, s) {
       p(o, e, s), p(o, r, s), b(n, o, s), i = !0;
@@ -3036,16 +3044,16 @@ function wi(t) {
       i || (f(n.$$.fragment, o), i = !0);
     },
     o(o) {
-      m(n.$$.fragment, o), i = !1;
+      d(n.$$.fragment, o), i = !1;
     },
     d(o) {
       o && (g(e), g(r)), I(n, o);
     }
   };
 }
-function ki(t) {
+function yi(t) {
   let e, r, n;
-  return r = new Xr({}), {
+  return r = new Zr({}), {
     c() {
       e = k("div"), w(r.$$.fragment), _(e, "class", "rcb-stripe-elements-container svelte-1wxt892");
     },
@@ -3057,14 +3065,14 @@ function ki(t) {
       n || (f(r.$$.fragment, i), n = !0);
     },
     o(i) {
-      m(r.$$.fragment, i), n = !1;
+      d(r.$$.fragment, i), n = !1;
     },
     d(i) {
       i && g(e), I(r);
     }
   };
 }
-function $i(t) {
+function vi(t) {
   let e;
   return {
     c() {
@@ -3080,7 +3088,7 @@ function $i(t) {
     }
   };
 }
-function vi(t) {
+function $i(t) {
   let e, r;
   return e = new xt({}), {
     c() {
@@ -3093,16 +3101,16 @@ function vi(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function yi(t) {
+function Bi(t) {
   let e, r, n, i;
-  const o = [vi, $i], s = [];
+  const o = [$i, vi], s = [];
   function l(c, a) {
     return (
       /*processing*/
@@ -3118,7 +3126,7 @@ function yi(t) {
     },
     p(c, a) {
       let u = e;
-      e = l(c), e !== u && (H(), m(s[u], 1, 1, () => {
+      e = l(c), e !== u && (H(), d(s[u], 1, 1, () => {
         s[u] = null;
       }), K(), r = s[e], r || (r = s[e] = o[e](c), r.c()), f(r, 1), r.m(n.parentNode, n));
     },
@@ -3126,14 +3134,14 @@ function yi(t) {
       i || (f(r), i = !0);
     },
     o(c) {
-      m(r), i = !1;
+      d(r), i = !1;
     },
     d(c) {
       c && g(n), s[e].d(c);
     }
   };
 }
-function Bi(t) {
+function Di(t) {
   let e;
   return {
     c() {
@@ -3147,25 +3155,25 @@ function Bi(t) {
     }
   };
 }
-function Di(t) {
+function Ci(t) {
   let e, r, n, i;
-  return e = new Ie({
+  return e = new be({
     props: {
       disabled: (
         /*processing*/
         t[0]
       ),
-      $$slots: { default: [yi] },
+      $$slots: { default: [Bi] },
       $$scope: { ctx: t }
     }
-  }), n = new Ie({
+  }), n = new be({
     props: {
       disabled: (
         /*processing*/
         t[0]
       ),
       intent: "secondary",
-      $$slots: { default: [Bi] },
+      $$slots: { default: [Di] },
       $$scope: { ctx: t }
     }
   }), n.$on("click", function() {
@@ -3175,7 +3183,7 @@ function Di(t) {
     ) && t[1].apply(this, arguments);
   }), {
     c() {
-      w(e.$$.fragment), r = P(), w(n.$$.fragment);
+      w(e.$$.fragment), r = Q(), w(n.$$.fragment);
     },
     m(o, s) {
       b(e, o, s), p(o, r, s), b(n, o, s), i = !0;
@@ -3197,18 +3205,18 @@ function Di(t) {
       i || (f(e.$$.fragment, o), f(n.$$.fragment, o), i = !0);
     },
     o(o) {
-      m(e.$$.fragment, o), m(n.$$.fragment, o), i = !1;
+      d(e.$$.fragment, o), d(n.$$.fragment, o), i = !1;
     },
     d(o) {
       o && g(r), I(e, o), I(n, o);
     }
   };
 }
-function Mi(t) {
+function Pi(t) {
   let e, r;
-  return e = new $e({
+  return e = new ye({
     props: {
-      $$slots: { default: [Di] },
+      $$slots: { default: [Ci] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3227,33 +3235,33 @@ function Mi(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function Ci(t) {
+function Mi(t) {
   let e, r, n, i, o, s;
   return e = new Xe({
     props: {
-      $$slots: { default: [wi] },
+      $$slots: { default: [ki] },
       $$scope: { ctx: t }
     }
   }), n = new ue({
     props: {
-      $$slots: { default: [ki] },
+      $$slots: { default: [yi] },
       $$scope: { ctx: t }
     }
   }), o = new ze({
     props: {
-      $$slots: { default: [Mi] },
+      $$slots: { default: [Pi] },
       $$scope: { ctx: t }
     }
   }), {
     c() {
-      w(e.$$.fragment), r = P(), w(n.$$.fragment), i = P(), w(o.$$.fragment);
+      w(e.$$.fragment), r = Q(), w(n.$$.fragment), i = Q(), w(o.$$.fragment);
     },
     m(l, c) {
       b(e, l, c), p(l, r, c), b(n, l, c), p(l, i, c), b(o, l, c), s = !0;
@@ -3265,15 +3273,15 @@ function Ci(t) {
       const u = {};
       c & /*$$scope*/
       2048 && (u.$$scope = { dirty: c, ctx: l }), n.$set(u);
-      const d = {};
+      const m = {};
       c & /*$$scope, processing, onClose*/
-      2051 && (d.$$scope = { dirty: c, ctx: l }), o.$set(d);
+      2051 && (m.$$scope = { dirty: c, ctx: l }), o.$set(m);
     },
     i(l) {
       s || (f(e.$$.fragment, l), f(n.$$.fragment, l), f(o.$$.fragment, l), s = !0);
     },
     o(l) {
-      m(e.$$.fragment, l), m(n.$$.fragment, l), m(o.$$.fragment, l), s = !1;
+      d(e.$$.fragment, l), d(n.$$.fragment, l), d(o.$$.fragment, l), s = !1;
     },
     d(l) {
       l && (g(r), g(i)), I(e, l), I(n, l), I(o, l);
@@ -3282,7 +3290,7 @@ function Ci(t) {
 }
 function Qi(t) {
   let e, r, n, i;
-  const o = [Ii, bi], s = [];
+  const o = [wi, Ii], s = [];
   function l(c, a) {
     return (
       /*stripe*/
@@ -3299,7 +3307,7 @@ function Qi(t) {
     },
     p(c, [a]) {
       let u = r;
-      r = l(c), r === u ? s[r].p(c, a) : (H(), m(s[u], 1, 1, () => {
+      r = l(c), r === u ? s[r].p(c, a) : (H(), d(s[u], 1, 1, () => {
         s[u] = null;
       }), K(), n = s[r], n ? n.p(c, a) : (n = s[r] = o[r](c), n.c()), f(n, 1), n.m(e, null));
     },
@@ -3307,41 +3315,41 @@ function Qi(t) {
       i || (f(n), i = !0);
     },
     o(c) {
-      m(n), i = !1;
+      d(n), i = !1;
     },
     d(c) {
       c && g(e), s[r].d();
     }
   };
 }
-function Pi(t, e, r) {
+function Ti(t, e, r) {
   let { onClose: n } = e, { onContinue: i } = e, { onError: o } = e, { paymentInfoCollectionMetadata: s } = e, { processing: l = !1 } = e;
   const c = s.data.client_secret;
-  let a = null, u, d;
-  Oe(async () => {
+  let a = null, u, m;
+  Se(async () => {
     const E = s.data.publishable_api_key, B = s.data.stripe_account_id;
     if (!E || !B)
       throw new Error("Stripe publishable key or account ID not found");
-    r(3, a = await ai(E, { stripeAccount: B }));
+    r(3, a = await ui(E, { stripeAccount: B }));
   });
   const h = async () => {
-    if (l || !a || !d)
+    if (l || !a || !m)
       return;
     r(0, l = !0);
     const E = await a.confirmSetup({
-      elements: d,
+      elements: m,
       redirect: "if_required"
     });
     E.error ? (r(0, l = !1), o(new Y(O.StripeError, E.error.message))) : i();
   };
-  function $(E) {
+  function y(E) {
     u = E, r(2, u);
   }
   return t.$$set = (E) => {
     "onClose" in E && r(1, n = E.onClose), "onContinue" in E && r(6, i = E.onContinue), "onError" in E && r(7, o = E.onError), "paymentInfoCollectionMetadata" in E && r(8, s = E.paymentInfoCollectionMetadata), "processing" in E && r(0, l = E.processing);
   }, t.$$.update = () => {
     t.$$.dirty & /*elements*/
-    4 && u && u._elements.length > 0 && (d = u);
+    4 && u && u._elements.length > 0 && (m = u);
   }, [
     l,
     n,
@@ -3352,15 +3360,15 @@ function Pi(t, e, r) {
     i,
     o,
     s,
-    $
+    y
   ];
 }
-class Ti extends U {
+class Ni extends U {
   constructor(e) {
     super(), N(
       this,
       e,
-      Pi,
+      Ti,
       Qi,
       T,
       {
@@ -3370,17 +3378,17 @@ class Ti extends U {
         paymentInfoCollectionMetadata: 8,
         processing: 0
       },
-      Ei
+      bi
     );
   }
 }
-function Ni(t) {
+function Ui(t) {
   return t.trim() === "" ? "You need to provide your email address to continue." : t.match(/^[^@]+@[^@]+\.[^@]+$/) ? null : "Email is not valid. Please provide a valid email address.";
 }
-function Ui(t) {
+function Ri(t) {
   x(t, "svelte-favd20", "form.svelte-favd20.svelte-favd20{display:flex;flex-direction:column;min-height:100%;flex-grow:1}.form-container.svelte-favd20.svelte-favd20{display:flex;flex-direction:column;width:100%;margin-top:32px;margin-bottom:16px}.form-label.svelte-favd20.svelte-favd20{margin-top:8px;margin-bottom:8px;display:block;font-weight:500;line-height:22px}.form-input.error.svelte-favd20 input.svelte-favd20{border-color:var(--rc-color-error)}.form-error.svelte-favd20.svelte-favd20{margin-top:4px;font-size:16px;line-height:20px;min-height:40px;color:var(--rc-color-error)}input.svelte-favd20.svelte-favd20{width:100%;box-sizing:border-box;padding:8px;border:2px solid var(--rc-color-grey-ui-dark);border-radius:12px;font-size:16px;height:48px;padding:6px 14px}input.svelte-favd20.svelte-favd20:focus{outline:none;border:2px solid var(--rc-color-focus)}");
 }
-function Ri(t) {
+function Si(t) {
   let e;
   return {
     c() {
@@ -3404,7 +3412,7 @@ function pt(t) {
       ), _(e, "class", "form-error svelte-favd20");
     },
     m(n, i) {
-      p(n, e, i), C(e, r);
+      p(n, e, i), M(e, r);
     },
     p(n, i) {
       i & /*error*/
@@ -3419,46 +3427,46 @@ function pt(t) {
     }
   };
 }
-function Si(t) {
+function Oi(t) {
   let e, r, n, i, o, s, l, c, a, u = (
     /*error*/
     t[2] && pt(t)
   );
   return {
     c() {
-      e = k("div"), r = k("div"), r.innerHTML = '<label for="email">Email</label>', n = P(), i = k("div"), o = k("input"), l = P(), u && u.c(), _(r, "class", "form-label svelte-favd20"), _(o, "name", "email"), _(o, "placeholder", "john@appleseed.com"), _(o, "autocapitalize", "off"), _(o, "class", "svelte-favd20"), _(i, "class", s = "form-input " + /*inputClass*/
+      e = k("div"), r = k("div"), r.innerHTML = '<label for="email">Email</label>', n = Q(), i = k("div"), o = k("input"), l = Q(), u && u.c(), _(r, "class", "form-label svelte-favd20"), _(o, "name", "email"), _(o, "placeholder", "john@appleseed.com"), _(o, "autocapitalize", "off"), _(o, "class", "svelte-favd20"), _(i, "class", s = "form-input " + /*inputClass*/
       t[4] + " svelte-favd20"), _(e, "class", "form-container svelte-favd20");
     },
-    m(d, h) {
-      p(d, e, h), C(e, r), C(e, n), C(e, i), C(i, o), lt(
+    m(m, h) {
+      p(m, e, h), M(e, r), M(e, n), M(e, i), M(i, o), lt(
         o,
         /*email*/
         t[3]
-      ), C(e, l), u && u.m(e, null), c || (a = ke(
+      ), M(e, l), u && u.m(e, null), c || (a = we(
         o,
         "input",
         /*input_input_handler*/
-        t[7]
+        t[8]
       ), c = !0);
     },
-    p(d, h) {
+    p(m, h) {
       h & /*email*/
       8 && o.value !== /*email*/
-      d[3] && lt(
+      m[3] && lt(
         o,
         /*email*/
-        d[3]
+        m[3]
       ), h & /*inputClass*/
       16 && s !== (s = "form-input " + /*inputClass*/
-      d[4] + " svelte-favd20") && _(i, "class", s), /*error*/
-      d[2] ? u ? u.p(d, h) : (u = pt(d), u.c(), u.m(e, null)) : u && (u.d(1), u = null);
+      m[4] + " svelte-favd20") && _(i, "class", s), /*error*/
+      m[2] ? u ? u.p(m, h) : (u = pt(m), u.c(), u.m(e, null)) : u && (u.d(1), u = null);
     },
-    d(d) {
-      d && g(e), u && u.d(), c = !1, a();
+    d(m) {
+      m && g(e), u && u.d(), c = !1, a();
     }
   };
 }
-function Oi(t) {
+function Li(t) {
   let e;
   return {
     c() {
@@ -3474,7 +3482,7 @@ function Oi(t) {
     }
   };
 }
-function Li(t) {
+function xi(t) {
   let e, r;
   return e = new xt({}), {
     c() {
@@ -3487,16 +3495,16 @@ function Li(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function xi(t) {
+function Fi(t) {
   let e, r, n, i;
-  const o = [Li, Oi], s = [];
+  const o = [xi, Li], s = [];
   function l(c, a) {
     return (
       /*processing*/
@@ -3512,7 +3520,7 @@ function xi(t) {
     },
     p(c, a) {
       let u = e;
-      e = l(c), e !== u && (H(), m(s[u], 1, 1, () => {
+      e = l(c), e !== u && (H(), d(s[u], 1, 1, () => {
         s[u] = null;
       }), K(), r = s[e], r || (r = s[e] = o[e](c), r.c()), f(r, 1), r.m(n.parentNode, n));
     },
@@ -3520,14 +3528,14 @@ function xi(t) {
       i || (f(r), i = !0);
     },
     o(c) {
-      m(r), i = !1;
+      d(r), i = !1;
     },
     d(c) {
       c && g(n), s[e].d(c);
     }
   };
 }
-function Fi(t) {
+function Gi(t) {
   let e;
   return {
     c() {
@@ -3541,25 +3549,25 @@ function Fi(t) {
     }
   };
 }
-function Gi(t) {
+function Yi(t) {
   let e, r, n, i;
-  return e = new Ie({
+  return e = new be({
     props: {
       disabled: (
         /*processing*/
         t[1]
       ),
-      $$slots: { default: [xi] },
+      $$slots: { default: [Fi] },
       $$scope: { ctx: t }
     }
-  }), n = new Ie({
+  }), n = new be({
     props: {
       intent: "secondary",
       disabled: (
         /*processing*/
         t[1]
       ),
-      $$slots: { default: [Fi] },
+      $$slots: { default: [Gi] },
       $$scope: { ctx: t }
     }
   }), n.$on("click", function() {
@@ -3569,7 +3577,7 @@ function Gi(t) {
     ) && t[0].apply(this, arguments);
   }), {
     c() {
-      w(e.$$.fragment), r = P(), w(n.$$.fragment);
+      w(e.$$.fragment), r = Q(), w(n.$$.fragment);
     },
     m(o, s) {
       b(e, o, s), p(o, r, s), b(n, o, s), i = !0;
@@ -3580,29 +3588,29 @@ function Gi(t) {
       s & /*processing*/
       2 && (l.disabled = /*processing*/
       t[1]), s & /*$$scope, processing*/
-      258 && (l.$$scope = { dirty: s, ctx: t }), e.$set(l);
+      514 && (l.$$scope = { dirty: s, ctx: t }), e.$set(l);
       const c = {};
       s & /*processing*/
       2 && (c.disabled = /*processing*/
       t[1]), s & /*$$scope*/
-      256 && (c.$$scope = { dirty: s, ctx: t }), n.$set(c);
+      512 && (c.$$scope = { dirty: s, ctx: t }), n.$set(c);
     },
     i(o) {
       i || (f(e.$$.fragment, o), f(n.$$.fragment, o), i = !0);
     },
     o(o) {
-      m(e.$$.fragment, o), m(n.$$.fragment, o), i = !1;
+      d(e.$$.fragment, o), d(n.$$.fragment, o), i = !1;
     },
     d(o) {
       o && g(r), I(e, o), I(n, o);
     }
   };
 }
-function Yi(t) {
+function Hi(t) {
   let e, r;
-  return e = new $e({
+  return e = new ye({
     props: {
-      $$slots: { default: [Gi] },
+      $$slots: { default: [Yi] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3615,79 +3623,82 @@ function Yi(t) {
     p(n, i) {
       const o = {};
       i & /*$$scope, processing, onClose*/
-      259 && (o.$$scope = { dirty: i, ctx: n }), e.$set(o);
+      515 && (o.$$scope = { dirty: i, ctx: n }), e.$set(o);
     },
     i(n) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function Hi(t) {
+function Ki(t) {
   let e, r, n, i, o, s, l, c, a;
   return r = new Xe({
     props: {
-      $$slots: { default: [Ri] },
+      $$slots: { default: [Si] },
       $$scope: { ctx: t }
     }
   }), i = new ue({
     props: {
-      $$slots: { default: [Si] },
+      $$slots: { default: [Oi] },
       $$scope: { ctx: t }
     }
   }), s = new ze({
     props: {
-      $$slots: { default: [Yi] },
+      $$slots: { default: [Hi] },
       $$scope: { ctx: t }
     }
   }), {
     c() {
-      e = k("form"), w(r.$$.fragment), n = P(), w(i.$$.fragment), o = P(), w(s.$$.fragment), _(e, "class", "svelte-favd20");
+      e = k("form"), w(r.$$.fragment), n = Q(), w(i.$$.fragment), o = Q(), w(s.$$.fragment), _(e, "class", "svelte-favd20");
     },
-    m(u, d) {
-      p(u, e, d), b(r, e, null), C(e, n), b(i, e, null), C(e, o), b(s, e, null), l = !0, c || (a = ke(e, "submit", Mt(
+    m(u, m) {
+      p(u, e, m), b(r, e, null), M(e, n), b(i, e, null), M(e, o), b(s, e, null), l = !0, c || (a = we(e, "submit", Ct(
         /*handleContinue*/
         t[5]
       )), c = !0);
     },
-    p(u, [d]) {
+    p(u, [m]) {
       const h = {};
-      d & /*$$scope*/
-      256 && (h.$$scope = { dirty: d, ctx: u }), r.$set(h);
-      const $ = {};
-      d & /*$$scope, error, inputClass, email*/
-      284 && ($.$$scope = { dirty: d, ctx: u }), i.$set($);
+      m & /*$$scope*/
+      512 && (h.$$scope = { dirty: m, ctx: u }), r.$set(h);
+      const y = {};
+      m & /*$$scope, error, inputClass, email*/
+      540 && (y.$$scope = { dirty: m, ctx: u }), i.$set(y);
       const E = {};
-      d & /*$$scope, processing, onClose*/
-      259 && (E.$$scope = { dirty: d, ctx: u }), s.$set(E);
+      m & /*$$scope, processing, onClose*/
+      515 && (E.$$scope = { dirty: m, ctx: u }), s.$set(E);
     },
     i(u) {
       l || (f(r.$$.fragment, u), f(i.$$.fragment, u), f(s.$$.fragment, u), l = !0);
     },
     o(u) {
-      m(r.$$.fragment, u), m(i.$$.fragment, u), m(s.$$.fragment, u), l = !1;
+      d(r.$$.fragment, u), d(i.$$.fragment, u), d(s.$$.fragment, u), l = !1;
     },
     d(u) {
       u && g(e), I(r), I(i), I(s), c = !1, a();
     }
   };
 }
-function Ki(t, e, r) {
-  let n, i, o, { onContinue: s } = e, { onClose: l } = e, { processing: c } = e;
-  const a = async () => {
-    const d = Ni(n);
-    d ? r(2, i = d) : s({ email: n });
+function qi(t, e, r) {
+  let n, i, o, { onContinue: s } = e, { onClose: l } = e, { processing: c } = e, { lastError: a } = e;
+  const u = async () => {
+    const h = Ui(n);
+    h ? r(2, i = h) : s({ email: n });
   };
-  function u() {
+  _n(async () => {
+    r(2, i = (a == null ? void 0 : a.message) ?? "");
+  });
+  function m() {
     n = this.value, r(3, n);
   }
-  return t.$$set = (d) => {
-    "onContinue" in d && r(6, s = d.onContinue), "onClose" in d && r(0, l = d.onClose), "processing" in d && r(1, c = d.processing);
+  return t.$$set = (h) => {
+    "onContinue" in h && r(6, s = h.onContinue), "onClose" in h && r(0, l = h.onClose), "processing" in h && r(1, c = h.processing), "lastError" in h && r(7, a = h.lastError);
   }, t.$$.update = () => {
     t.$$.dirty & /*error*/
     4 && r(4, o = i ? "error" : "");
@@ -3697,20 +3708,34 @@ function Ki(t, e, r) {
     i,
     n,
     o,
-    a,
+    u,
     s,
-    u
+    a,
+    m
   ];
 }
-class qi extends U {
+class ji extends U {
   constructor(e) {
-    super(), N(this, e, Ki, Hi, T, { onContinue: 6, onClose: 0, processing: 1 }, Ui);
+    super(), N(
+      this,
+      e,
+      qi,
+      Ki,
+      T,
+      {
+        onContinue: 6,
+        onClose: 0,
+        processing: 1,
+        lastError: 7
+      },
+      Ri
+    );
   }
 }
-function ji(t) {
+function Ji(t) {
   x(t, "svelte-17tslso", ".rcb-modal-backdrop.svelte-17tslso{position:fixed;top:0;left:0;right:0;min-width:100%;width:100vw;width:100dvw;min-height:100%;height:100vh;height:100dvh;background-color:rgba(40, 40, 40, 0.75);display:flex;flex-direction:column;justify-content:space-around;z-index:1000001}");
 }
-function Ji(t) {
+function Vi(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -3754,28 +3779,28 @@ function Ji(t) {
       r || (f(i, o), r = !0);
     },
     o(o) {
-      m(i, o), r = !1;
+      d(i, o), r = !1;
     },
     d(o) {
       o && g(e), i && i.d(o);
     }
   };
 }
-function Vi(t, e, r) {
+function Wi(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e;
   return t.$$set = (o) => {
     "$$scope" in o && r(0, i = o.$$scope);
   }, [i, n];
 }
-class Wi extends U {
+class zi extends U {
   constructor(e) {
-    super(), N(this, e, Vi, Ji, T, {}, ji);
+    super(), N(this, e, Wi, Vi, T, {}, Ji);
   }
 }
-function zi(t) {
+function Xi(t) {
   x(t, "svelte-ioxu5d", ".rcb-modal-container.svelte-ioxu5d{width:100%}.rcb-modal-main.svelte-ioxu5d{box-sizing:border-box;border-radius:8px;background-color:var(--rc-color-white);color:var(--rc-color-grey-text-dark);min-height:460px;padding:40px;flex-direction:column;display:flex}.rcb-modal-dark.svelte-ioxu5d{background-color:var(--rc-color-grey-text-dark);color:var(--rc-color-white);min-height:0px}@media screen and (max-width: 960px){.rcb-modal-container.svelte-ioxu5d{width:calc(100% - 32px);min-width:300px;max-width:640px;margin:auto}.rcb-modal-main.svelte-ioxu5d,.rcb-modal-dark.svelte-ioxu5d{min-width:300px;max-width:640px;padding:32px}}");
 }
-function Xi(t) {
+function Zi(t) {
   let e, r, n, i;
   const o = (
     /*#slots*/
@@ -3789,11 +3814,11 @@ function Xi(t) {
   );
   return {
     c() {
-      e = k("div"), r = k("main"), s && s.c(), _(r, "class", n = Ee(`rcb-modal-main ${/*dark*/
+      e = k("div"), r = k("main"), s && s.c(), _(r, "class", n = Ae(`rcb-modal-main ${/*dark*/
       t[0] ? "rcb-modal-dark" : ""}`) + " svelte-ioxu5d"), _(e, "class", "rcb-modal-container svelte-ioxu5d");
     },
     m(l, c) {
-      p(l, e, c), C(e, r), s && s.m(r, null), i = !0;
+      p(l, e, c), M(e, r), s && s.m(r, null), i = !0;
     },
     p(l, [c]) {
       s && s.p && (!i || c & /*$$scope*/
@@ -3815,32 +3840,32 @@ function Xi(t) {
         ),
         null
       ), (!i || c & /*dark*/
-      1 && n !== (n = Ee(`rcb-modal-main ${/*dark*/
+      1 && n !== (n = Ae(`rcb-modal-main ${/*dark*/
       l[0] ? "rcb-modal-dark" : ""}`) + " svelte-ioxu5d")) && _(r, "class", n);
     },
     i(l) {
       i || (f(s, l), i = !0);
     },
     o(l) {
-      m(s, l), i = !1;
+      d(s, l), i = !1;
     },
     d(l) {
       l && g(e), s && s.d(l);
     }
   };
 }
-function Zi(t, e, r) {
+function eo(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { dark: o = !1 } = e;
   return t.$$set = (s) => {
     "dark" in s && r(0, o = s.dark), "$$scope" in s && r(1, i = s.$$scope);
   }, [o, i, n];
 }
-class eo extends U {
+class to extends U {
   constructor(e) {
-    super(), N(this, e, Zi, Xi, T, { dark: 0 }, zi);
+    super(), N(this, e, eo, Zi, T, { dark: 0 }, Xi);
   }
 }
-function to(t) {
+function no(t) {
   let e;
   const r = (
     /*#slots*/
@@ -3884,18 +3909,18 @@ function to(t) {
       e || (f(n, i), e = !0);
     },
     o(i) {
-      m(n, i), e = !1;
+      d(n, i), e = !1;
     },
     d(i) {
       n && n.d(i);
     }
   };
 }
-function no(t) {
+function ro(t) {
   let e, r;
-  return e = new Wi({
+  return e = new zi({
     props: {
-      $$slots: { default: [ro] },
+      $$slots: { default: [io] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3914,14 +3939,14 @@ function no(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function ro(t) {
+function io(t) {
   let e;
   const r = (
     /*#slots*/
@@ -3965,16 +3990,16 @@ function ro(t) {
       e || (f(n, i), e = !0);
     },
     o(i) {
-      m(n, i), e = !1;
+      d(n, i), e = !1;
     },
     d(i) {
       n && n.d(i);
     }
   };
 }
-function io(t) {
+function oo(t) {
   let e, r, n, i;
-  const o = [no, to], s = [];
+  const o = [ro, no], s = [];
   function l(c, a) {
     return (
       /*condition*/
@@ -3990,7 +4015,7 @@ function io(t) {
     },
     p(c, [a]) {
       let u = e;
-      e = l(c), e === u ? s[e].p(c, a) : (H(), m(s[u], 1, 1, () => {
+      e = l(c), e === u ? s[e].p(c, a) : (H(), d(s[u], 1, 1, () => {
         s[u] = null;
       }), K(), r = s[e], r ? r.p(c, a) : (r = s[e] = o[e](c), r.c()), f(r, 1), r.m(n.parentNode, n));
     },
@@ -3998,26 +4023,26 @@ function io(t) {
       i || (f(r), i = !0);
     },
     o(c) {
-      m(r), i = !1;
+      d(r), i = !1;
     },
     d(c) {
       c && g(n), s[e].d(c);
     }
   };
 }
-function oo(t, e, r) {
+function so(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { condition: o = !1 } = e;
   return t.$$set = (s) => {
     "condition" in s && r(0, o = s.condition), "$$scope" in s && r(2, i = s.$$scope);
   }, [o, n, i];
 }
-class so extends U {
+class lo extends U {
   constructor(e) {
-    super(), N(this, e, oo, io, T, { condition: 0 });
+    super(), N(this, e, so, oo, T, { condition: 0 });
   }
 }
-const lo = (t) => ({}), _t = (t) => ({});
-function co(t) {
+const co = (t) => ({}), _t = (t) => ({});
+function ao(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -4040,7 +4065,7 @@ function co(t) {
   );
   return {
     c() {
-      i && i.c(), e = P(), s && s.c();
+      i && i.c(), e = Q(), s && s.c();
     },
     m(l, c) {
       i && i.m(l, c), p(l, e, c), s && s.m(l, c), r = !0;
@@ -4058,7 +4083,7 @@ function co(t) {
           /*$$scope*/
           l[2],
           c,
-          lo
+          co
         ) : V(
           /*$$scope*/
           l[2]
@@ -4088,22 +4113,22 @@ function co(t) {
       r || (f(i, l), f(s, l), r = !0);
     },
     o(l) {
-      m(i, l), m(s, l), r = !1;
+      d(i, l), d(s, l), r = !1;
     },
     d(l) {
       l && g(e), i && i.d(l), s && s.d(l);
     }
   };
 }
-function ao(t) {
+function uo(t) {
   let e, r;
-  return e = new eo({
+  return e = new to({
     props: {
       dark: (
         /*dark*/
         t[0]
       ),
-      $$slots: { default: [co] },
+      $$slots: { default: [ao] },
       $$scope: { ctx: t }
     }
   }), {
@@ -4124,14 +4149,14 @@ function ao(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function uo(t, e, r) {
+function fo(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { dark: o = !1 } = e;
   return t.$$set = (s) => {
     "dark" in s && r(0, o = s.dark), "$$scope" in s && r(2, i = s.$$scope);
@@ -4139,166 +4164,181 @@ function uo(t, e, r) {
 }
 class Ft extends U {
   constructor(e) {
-    super(), N(this, e, uo, ao, T, { dark: 0 });
+    super(), N(this, e, fo, uo, T, { dark: 0 });
   }
 }
-const fo = "0.3.3", fe = "https://api.revenuecat.com";
+const mo = "0.4.0", go = "https://api.revenuecat.com";
 var Re;
 (function(t) {
   t[t.CONTINUE = 100] = "CONTINUE", t[t.SWITCHING_PROTOCOLS = 101] = "SWITCHING_PROTOCOLS", t[t.PROCESSING = 102] = "PROCESSING", t[t.EARLY_HINTS = 103] = "EARLY_HINTS", t[t.OK = 200] = "OK", t[t.CREATED = 201] = "CREATED", t[t.ACCEPTED = 202] = "ACCEPTED", t[t.NON_AUTHORITATIVE_INFORMATION = 203] = "NON_AUTHORITATIVE_INFORMATION", t[t.NO_CONTENT = 204] = "NO_CONTENT", t[t.RESET_CONTENT = 205] = "RESET_CONTENT", t[t.PARTIAL_CONTENT = 206] = "PARTIAL_CONTENT", t[t.MULTI_STATUS = 207] = "MULTI_STATUS", t[t.MULTIPLE_CHOICES = 300] = "MULTIPLE_CHOICES", t[t.MOVED_PERMANENTLY = 301] = "MOVED_PERMANENTLY", t[t.MOVED_TEMPORARILY = 302] = "MOVED_TEMPORARILY", t[t.SEE_OTHER = 303] = "SEE_OTHER", t[t.NOT_MODIFIED = 304] = "NOT_MODIFIED", t[t.USE_PROXY = 305] = "USE_PROXY", t[t.TEMPORARY_REDIRECT = 307] = "TEMPORARY_REDIRECT", t[t.PERMANENT_REDIRECT = 308] = "PERMANENT_REDIRECT", t[t.BAD_REQUEST = 400] = "BAD_REQUEST", t[t.UNAUTHORIZED = 401] = "UNAUTHORIZED", t[t.PAYMENT_REQUIRED = 402] = "PAYMENT_REQUIRED", t[t.FORBIDDEN = 403] = "FORBIDDEN", t[t.NOT_FOUND = 404] = "NOT_FOUND", t[t.METHOD_NOT_ALLOWED = 405] = "METHOD_NOT_ALLOWED", t[t.NOT_ACCEPTABLE = 406] = "NOT_ACCEPTABLE", t[t.PROXY_AUTHENTICATION_REQUIRED = 407] = "PROXY_AUTHENTICATION_REQUIRED", t[t.REQUEST_TIMEOUT = 408] = "REQUEST_TIMEOUT", t[t.CONFLICT = 409] = "CONFLICT", t[t.GONE = 410] = "GONE", t[t.LENGTH_REQUIRED = 411] = "LENGTH_REQUIRED", t[t.PRECONDITION_FAILED = 412] = "PRECONDITION_FAILED", t[t.REQUEST_TOO_LONG = 413] = "REQUEST_TOO_LONG", t[t.REQUEST_URI_TOO_LONG = 414] = "REQUEST_URI_TOO_LONG", t[t.UNSUPPORTED_MEDIA_TYPE = 415] = "UNSUPPORTED_MEDIA_TYPE", t[t.REQUESTED_RANGE_NOT_SATISFIABLE = 416] = "REQUESTED_RANGE_NOT_SATISFIABLE", t[t.EXPECTATION_FAILED = 417] = "EXPECTATION_FAILED", t[t.IM_A_TEAPOT = 418] = "IM_A_TEAPOT", t[t.INSUFFICIENT_SPACE_ON_RESOURCE = 419] = "INSUFFICIENT_SPACE_ON_RESOURCE", t[t.METHOD_FAILURE = 420] = "METHOD_FAILURE", t[t.MISDIRECTED_REQUEST = 421] = "MISDIRECTED_REQUEST", t[t.UNPROCESSABLE_ENTITY = 422] = "UNPROCESSABLE_ENTITY", t[t.LOCKED = 423] = "LOCKED", t[t.FAILED_DEPENDENCY = 424] = "FAILED_DEPENDENCY", t[t.UPGRADE_REQUIRED = 426] = "UPGRADE_REQUIRED", t[t.PRECONDITION_REQUIRED = 428] = "PRECONDITION_REQUIRED", t[t.TOO_MANY_REQUESTS = 429] = "TOO_MANY_REQUESTS", t[t.REQUEST_HEADER_FIELDS_TOO_LARGE = 431] = "REQUEST_HEADER_FIELDS_TOO_LARGE", t[t.UNAVAILABLE_FOR_LEGAL_REASONS = 451] = "UNAVAILABLE_FOR_LEGAL_REASONS", t[t.INTERNAL_SERVER_ERROR = 500] = "INTERNAL_SERVER_ERROR", t[t.NOT_IMPLEMENTED = 501] = "NOT_IMPLEMENTED", t[t.BAD_GATEWAY = 502] = "BAD_GATEWAY", t[t.SERVICE_UNAVAILABLE = 503] = "SERVICE_UNAVAILABLE", t[t.GATEWAY_TIMEOUT = 504] = "GATEWAY_TIMEOUT", t[t.HTTP_VERSION_NOT_SUPPORTED = 505] = "HTTP_VERSION_NOT_SUPPORTED", t[t.INSUFFICIENT_STORAGE = 507] = "INSUFFICIENT_STORAGE", t[t.NETWORK_AUTHENTICATION_REQUIRED = 511] = "NETWORK_AUTHENTICATION_REQUIRED";
 })(Re || (Re = {}));
-function je(t) {
+function qe(t) {
   return t ? t.startsWith("rcb_sb_") : !1;
 }
-async function oe(t, e, r, n) {
+async function oe(t, e) {
+  const { apiKey: r, body: n, headers: i, httpConfig: o } = e, l = `${(o == null ? void 0 : o.proxyURL) ?? go}${t.urlPath()}`;
   try {
-    const i = await fetch(t.url(), {
+    const c = await fetch(l, {
       method: t.method,
-      headers: po(e, n),
-      body: go(r)
+      headers: ho(r, i, o == null ? void 0 : o.additionalHeaders),
+      body: _o(n)
     });
-    return await mo(i, t), await i.json();
-  } catch (i) {
-    throw i instanceof TypeError ? new X(
-      ee.NetworkError,
-      he.getPublicMessage(ee.NetworkError),
-      i.message
-    ) : i;
+    return await po(c, t), await c.json();
+  } catch (c) {
+    throw c instanceof TypeError ? new z(
+      Z.NetworkError,
+      he.getPublicMessage(Z.NetworkError),
+      c.message
+    ) : c;
   }
 }
-async function mo(t, e) {
+async function po(t, e) {
   const r = t.status;
   if (r >= Re.INTERNAL_SERVER_ERROR)
-    Ye(e, r, await t.text());
+    Ge(e, r, await t.text());
   else if (r >= Re.BAD_REQUEST) {
     const n = await t.json(), i = n ? JSON.stringify(n) : null, o = n == null ? void 0 : n.code, s = n == null ? void 0 : n.message;
     if (o != null) {
       const l = he.convertCodeToBackendErrorCode(o);
       if (l == null)
-        Ye(e, r, i);
+        Ge(e, r, i);
       else
-        throw X.getForBackendError(
+        throw z.getForBackendError(
           l,
           s
         );
     } else
-      Ye(e, r, i);
+      Ge(e, r, i);
   }
 }
-function Ye(t, e, r) {
-  throw new X(
-    ee.UnknownBackendError,
+function Ge(t, e, r) {
+  throw new z(
+    Z.UnknownBackendError,
     `Unknown backend error. Request: ${t.name}. Status code: ${e}. Body: ${r}.`
   );
 }
-function go(t) {
+function _o(t) {
   return t == null ? null : JSON.stringify(t);
 }
-function po(t, e) {
-  let r = {
+function ho(t, e, r) {
+  let n = {
     Authorization: `Bearer ${t}`,
     "Content-Type": "application/json",
     Accept: "application/json",
     "X-Platform": "web",
-    "X-Version": fo,
-    "X-Is-Sandbox": `${je(t)}`
+    "X-Version": mo,
+    "X-Is-Sandbox": `${qe(t)}`
   };
-  return e != null && (r = { ...r, ...e }), r;
+  return e && (n = { ...n, ...e }), r && (n = { ...r, ...n }), n;
 }
-const Gt = "/v1/subscribers", Le = "/rcbilling/v1";
-class _o {
+const Gt = "/v1/subscribers", Oe = "/rcbilling/v1";
+class Ao {
   constructor(e) {
-    Q(this, "appUserId");
-    Q(this, "method", "GET");
-    Q(this, "name", "getOfferings");
+    P(this, "appUserId");
+    P(this, "method", "GET");
+    P(this, "name", "getOfferings");
     this.appUserId = e;
   }
-  url() {
+  urlPath() {
     const e = encodeURIComponent(this.appUserId);
-    return `${fe}${Gt}/${e}/offerings`;
+    return `${Gt}/${e}/offerings`;
   }
 }
-class Ao {
+class Eo {
   constructor() {
-    Q(this, "method", "POST");
-    Q(this, "name", "subscribe");
+    P(this, "method", "POST");
+    P(this, "name", "subscribe");
   }
-  url() {
-    return `${fe}${Le}/subscribe`;
+  urlPath() {
+    return `${Oe}/subscribe`;
   }
 }
-class ho {
+class bo {
   constructor(e, r) {
-    Q(this, "method", "GET");
-    Q(this, "name", "getProducts");
-    Q(this, "appUserId");
-    Q(this, "productIds");
+    P(this, "method", "GET");
+    P(this, "name", "getProducts");
+    P(this, "appUserId");
+    P(this, "productIds");
     this.appUserId = e, this.productIds = r;
   }
-  url() {
+  urlPath() {
     const e = encodeURIComponent(this.appUserId), r = this.productIds.map(encodeURIComponent).join("&id=");
-    return `${fe}${Le}/subscribers/${e}/products?id=${r}`;
+    return `${Oe}/subscribers/${e}/products?id=${r}`;
   }
 }
-class Eo {
+class Io {
   constructor(e) {
-    Q(this, "method", "GET");
-    Q(this, "name", "getCustomerInfo");
-    Q(this, "appUserId");
+    P(this, "method", "GET");
+    P(this, "name", "getCustomerInfo");
+    P(this, "appUserId");
     this.appUserId = e;
   }
-  url() {
+  urlPath() {
     const e = encodeURIComponent(this.appUserId);
-    return `${fe}${Gt}/${e}`;
+    return `${Gt}/${e}`;
   }
 }
-class bo {
+class wo {
   constructor() {
-    Q(this, "method", "GET");
-    Q(this, "name", "getBrandingInfo");
+    P(this, "method", "GET");
+    P(this, "name", "getBrandingInfo");
   }
-  url() {
-    return `${fe}${Le}/branding`;
+  urlPath() {
+    return `${Oe}/branding`;
   }
 }
-class Io {
+class ko {
   constructor(e) {
-    Q(this, "method", "GET");
-    Q(this, "name", "getCheckoutStatus");
-    Q(this, "operationSessionId");
+    P(this, "method", "GET");
+    P(this, "name", "getCheckoutStatus");
+    P(this, "operationSessionId");
     this.operationSessionId = e;
   }
-  url() {
-    return `${fe}${Le}/checkout/${this.operationSessionId}`;
+  urlPath() {
+    return `${Oe}/checkout/${this.operationSessionId}`;
   }
 }
-class wo {
-  constructor(e) {
-    Q(this, "API_KEY");
-    this.API_KEY = e;
+const je = {};
+class yo {
+  constructor(e, r = je) {
+    P(this, "API_KEY");
+    P(this, "httpConfig");
+    this.API_KEY = e, this.httpConfig = r;
   }
   async getOfferings(e) {
     return await oe(
-      new _o(e),
-      this.API_KEY
+      new Ao(e),
+      {
+        apiKey: this.API_KEY,
+        httpConfig: this.httpConfig
+      }
     );
   }
   async getCustomerInfo(e) {
     return await oe(
-      new Eo(e),
-      this.API_KEY
+      new Io(e),
+      {
+        apiKey: this.API_KEY,
+        httpConfig: this.httpConfig
+      }
     );
   }
   async getProducts(e, r) {
     return await oe(
-      new ho(e, r),
-      this.API_KEY
+      new bo(e, r),
+      {
+        apiKey: this.API_KEY,
+        httpConfig: this.httpConfig
+      }
     );
   }
   async getBrandingInfo() {
     return await oe(
-      new bo(),
-      this.API_KEY
+      new wo(),
+      {
+        apiKey: this.API_KEY,
+        httpConfig: this.httpConfig
+      }
     );
   }
   async postSubscribe(e, r, n, i, o) {
@@ -4309,24 +4349,30 @@ class wo {
       presented_offering_identifier: i
     };
     return o && o !== "base_option" && (s.offer_id = o), await oe(
-      new Ao(),
-      this.API_KEY,
-      s
+      new Eo(),
+      {
+        apiKey: this.API_KEY,
+        body: s,
+        httpConfig: this.httpConfig
+      }
     );
   }
   async getCheckoutStatus(e) {
     return await oe(
-      new Io(e),
-      this.API_KEY
+      new ko(e),
+      {
+        apiKey: this.API_KEY,
+        httpConfig: this.httpConfig
+      }
     );
   }
 }
-const ko = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20opacity='0.5'%20clip-path='url(%23clip0_344_3390)'%3e%3cpath%20d='M7%2018C5.9%2018%205.01%2018.9%205.01%2020C5.01%2021.1%205.9%2022%207%2022C8.1%2022%209%2021.1%209%2020C9%2018.9%208.1%2018%207%2018ZM1%202V4H3L6.6%2011.59L5.25%2014.04C5.09%2014.32%205%2014.65%205%2015C5%2016.1%205.9%2017%207%2017H19V15H7.42C7.28%2015%207.17%2014.89%207.17%2014.75L7.2%2014.63L8.1%2013H15.55C16.3%2013%2016.96%2012.59%2017.3%2011.97L20.88%205.48C20.96%205.34%2021%205.17%2021%205C21%204.45%2020.55%204%2020%204H5.21L4.27%202H1ZM17%2018C15.9%2018%2015.01%2018.9%2015.01%2020C15.01%2021.1%2015.9%2022%2017%2022C18.1%2022%2019%2021.1%2019%2020C19%2018.9%2018.1%2018%2017%2018Z'%20fill='white'/%3e%3c/g%3e%3cdefs%3e%3cclipPath%20id='clip0_344_3390'%3e%3crect%20width='24'%20height='24'%20fill='white'/%3e%3c/clipPath%3e%3c/defs%3e%3c/svg%3e";
+const vo = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20opacity='0.5'%20clip-path='url(%23clip0_344_3390)'%3e%3cpath%20d='M7%2018C5.9%2018%205.01%2018.9%205.01%2020C5.01%2021.1%205.9%2022%207%2022C8.1%2022%209%2021.1%209%2020C9%2018.9%208.1%2018%207%2018ZM1%202V4H3L6.6%2011.59L5.25%2014.04C5.09%2014.32%205%2014.65%205%2015C5%2016.1%205.9%2017%207%2017H19V15H7.42C7.28%2015%207.17%2014.89%207.17%2014.75L7.2%2014.63L8.1%2013H15.55C16.3%2013%2016.96%2012.59%2017.3%2011.97L20.88%205.48C20.96%205.34%2021%205.17%2021%205C21%204.45%2020.55%204%2020%204H5.21L4.27%202H1ZM17%2018C15.9%2018%2015.01%2018.9%2015.01%2020C15.01%2021.1%2015.9%2022%2017%2022C18.1%2022%2019%2021.1%2019%2020C19%2018.9%2018.1%2018%2017%2018Z'%20fill='white'/%3e%3c/g%3e%3cdefs%3e%3cclipPath%20id='clip0_344_3390'%3e%3crect%20width='24'%20height='24'%20fill='white'/%3e%3c/clipPath%3e%3c/defs%3e%3c/svg%3e";
 function $o(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), Z(e.src, r = ko) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
+      e = k("img"), ee(e.src, r = vo) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
     },
     m(n, i) {
       p(n, e, i);
@@ -4339,15 +4385,15 @@ function $o(t) {
     }
   };
 }
-class vo extends U {
+class Bo extends U {
   constructor(e) {
     super(), N(this, e, null, $o, T, {});
   }
 }
-function yo(t) {
+function Do(t) {
   x(t, "svelte-1rhrjxe", "div.svelte-1rhrjxe{background-color:var(--rc-color-warning);color:var(--rc-color-grey-text-dark);font-size:10px;font-weight:bold;text-transform:uppercase;padding:4px 10px;line-height:10px;border-radius:9px;margin:0px;margin-left:16px}");
 }
-function Bo(t) {
+function Co(t) {
   let e;
   return {
     c() {
@@ -4364,23 +4410,23 @@ function Bo(t) {
     }
   };
 }
-class Do extends U {
+class Po extends U {
   constructor(e) {
-    super(), N(this, e, null, Bo, T, {}, yo);
+    super(), N(this, e, null, Co, T, {}, Do);
   }
 }
 function Mo(t) {
   x(t, "svelte-1qect5g", `.rcb-ui-container.svelte-1qect5g{color-scheme:none;font-size:16px;line-height:1.5em;font-weight:400;font-family:-apple-system, "system-ui", "Segoe UI", Roboto, Oxygen, Ubuntu,
         Cantarell, "Open Sans", "Helvetica Neue", sans-serif}.rcb-ui-layout.svelte-1qect5g{width:100vw;width:100 dvw;margin-right:auto;display:flex;justify-content:center;align-items:flex-start;position:relative;padding:0px 80px;box-sizing:border-box}.rcb-ui-aside.svelte-1qect5g{margin-right:16px;flex:320px 1 0;max-width:480px}.rcb-ui-main.svelte-1qect5g{flex:480px 1 0;max-width:640px}@media screen and (max-width: 960px){.rcb-ui-layout.svelte-1qect5g{flex-direction:column;align-items:center;justify-content:center;height:100%;min-width:100%}.rcb-ui-aside.svelte-1qect5g{margin-right:0;margin-bottom:16px;min-width:100%;display:flex;flex-direction:column;align-items:center;flex:none;max-width:none}.rcb-ui-main.svelte-1qect5g{flex:none;max-width:none;min-width:100%}}@media screen and (max-width: 960px) and (max-height: 960px){.rcb-ui-layout.svelte-1qect5g{overflow-y:scroll;justify-content:flex-start;padding:16px 0px}}`);
 }
-function At(t) {
+function ht(t) {
   let e, r, n;
   return r = new Ft({
     props: {
       dark: !0,
       $$slots: {
-        header: [No],
-        default: [Co]
+        header: [Ro],
+        default: [Qo]
       },
       $$scope: { ctx: t }
     }
@@ -4400,16 +4446,16 @@ function At(t) {
       n || (f(r.$$.fragment, i), n = !0);
     },
     o(i) {
-      m(r.$$.fragment, i), n = !1;
+      d(r.$$.fragment, i), n = !1;
     },
     d(i) {
       i && g(e), I(r);
     }
   };
 }
-function ht(t) {
+function At(t) {
   let e, r;
-  return e = new Pt({
+  return e = new Qt({
     props: {
       productDetails: (
         /*productDetails*/
@@ -4437,18 +4483,18 @@ function ht(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function Co(t) {
+function Qo(t) {
   let e, r, n = (
     /*productDetails*/
     t[2] && /*purchaseOptionToUse*/
-    t[8] && ht(t)
+    t[8] && At(t)
   );
   return {
     c() {
@@ -4461,7 +4507,7 @@ function Co(t) {
       /*productDetails*/
       i[2] && /*purchaseOptionToUse*/
       i[8] ? n ? (n.p(i, o), o & /*productDetails*/
-      4 && f(n, 1)) : (n = ht(i), n.c(), f(n, 1), n.m(e.parentNode, e)) : n && (H(), m(n, 1, 1, () => {
+      4 && f(n, 1)) : (n = At(i), n.c(), f(n, 1), n.m(e.parentNode, e)) : n && (H(), d(n, 1, 1, () => {
         n = null;
       }), K());
     },
@@ -4469,16 +4515,16 @@ function Co(t) {
       r || (f(n), r = !0);
     },
     o(i) {
-      m(n), r = !1;
+      d(n), r = !1;
     },
     d(i) {
       i && g(e), n && n.d(i);
     }
   };
 }
-function Qo(t) {
+function To(t) {
   let e, r;
-  return e = new vo({}), {
+  return e = new Bo({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -4489,16 +4535,16 @@ function Qo(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function Po(t) {
+function No(t) {
   let e, r;
-  return e = new Do({}), {
+  return e = new Po({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -4509,14 +4555,14 @@ function Po(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function To(t) {
+function Uo(t) {
   let e, r, n, i, o, s, l;
   e = new Ut({
     props: { brandingInfo: (
@@ -4524,46 +4570,46 @@ function To(t) {
       t[3]
     ) }
   });
-  const c = [Po, Qo], a = [];
-  function u(d, h) {
+  const c = [No, To], a = [];
+  function u(m, h) {
     return h & /*purchases*/
     2 && (n = null), n == null && (n = !!/*purchases*/
-    d[1].isSandbox()), n ? 0 : 1;
+    m[1].isSandbox()), n ? 0 : 1;
   }
   return i = u(t, -1), o = a[i] = c[i](t), {
     c() {
-      w(e.$$.fragment), r = P(), o.c(), s = te();
+      w(e.$$.fragment), r = Q(), o.c(), s = te();
     },
-    m(d, h) {
-      b(e, d, h), p(d, r, h), a[i].m(d, h), p(d, s, h), l = !0;
+    m(m, h) {
+      b(e, m, h), p(m, r, h), a[i].m(m, h), p(m, s, h), l = !0;
     },
-    p(d, h) {
-      const $ = {};
+    p(m, h) {
+      const y = {};
       h & /*brandingInfo*/
-      8 && ($.brandingInfo = /*brandingInfo*/
-      d[3]), e.$set($);
+      8 && (y.brandingInfo = /*brandingInfo*/
+      m[3]), e.$set(y);
       let E = i;
-      i = u(d, h), i !== E && (H(), m(a[E], 1, 1, () => {
+      i = u(m, h), i !== E && (H(), d(a[E], 1, 1, () => {
         a[E] = null;
-      }), K(), o = a[i], o || (o = a[i] = c[i](d), o.c()), f(o, 1), o.m(s.parentNode, s));
+      }), K(), o = a[i], o || (o = a[i] = c[i](m), o.c()), f(o, 1), o.m(s.parentNode, s));
     },
-    i(d) {
-      l || (f(e.$$.fragment, d), f(o), l = !0);
+    i(m) {
+      l || (f(e.$$.fragment, m), f(o), l = !0);
     },
-    o(d) {
-      m(e.$$.fragment, d), m(o), l = !1;
+    o(m) {
+      d(e.$$.fragment, m), d(o), l = !1;
     },
-    d(d) {
-      d && (g(r), g(s)), I(e, d), a[i].d(d);
+    d(m) {
+      m && (g(r), g(s)), I(e, m), a[i].d(m);
     }
   };
 }
-function No(t) {
+function Ro(t) {
   let e, r;
   return e = new Xe({
     props: {
       slot: "header",
-      $$slots: { default: [To] },
+      $$slots: { default: [Uo] },
       $$scope: { ctx: t }
     }
   }), {
@@ -4582,7 +4628,7 @@ function No(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
@@ -4591,7 +4637,7 @@ function No(t) {
 }
 function Et(t) {
   let e, r;
-  return e = new Pt({
+  return e = new Qt({
     props: {
       productDetails: (
         /*productDetails*/
@@ -4619,7 +4665,7 @@ function Et(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
@@ -4639,7 +4685,7 @@ function bt(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
@@ -4648,7 +4694,7 @@ function bt(t) {
 }
 function It(t) {
   let e, r;
-  return e = new qi({
+  return e = new ji({
     props: {
       onContinue: (
         /*handleContinue*/
@@ -4661,6 +4707,10 @@ function It(t) {
       processing: (
         /*state*/
         t[6] === "processing-auth-info"
+      ),
+      lastError: (
+        /*lastError*/
+        t[5]
       )
     }
   }), {
@@ -4674,13 +4724,15 @@ function It(t) {
       const o = {};
       i & /*state*/
       64 && (o.processing = /*state*/
-      n[6] === "processing-auth-info"), e.$set(o);
+      n[6] === "processing-auth-info"), i & /*lastError*/
+      32 && (o.lastError = /*lastError*/
+      n[5]), e.$set(o);
     },
     i(n) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
@@ -4689,7 +4741,7 @@ function It(t) {
 }
 function wt(t) {
   let e, r;
-  return e = new Ti({
+  return e = new Ni({
     props: {
       paymentInfoCollectionMetadata: (
         /*paymentInfoCollectionMetadata*/
@@ -4731,7 +4783,7 @@ function wt(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
@@ -4751,17 +4803,17 @@ function kt(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function $t(t) {
+function yt(t) {
   var n;
   let e, r;
-  return e = new Sr({
+  return e = new Or({
     props: {
       brandingInfo: (
         /*brandingInfo*/
@@ -4802,7 +4854,7 @@ function $t(t) {
       r || (f(e.$$.fragment, i), r = !0);
     },
     o(i) {
-      m(e.$$.fragment, i), r = !1;
+      d(e.$$.fragment, i), r = !1;
     },
     d(i) {
       I(e, i);
@@ -4811,7 +4863,7 @@ function $t(t) {
 }
 function vt(t) {
   let e, r;
-  return e = new qr({
+  return e = new jr({
     props: {
       brandingInfo: (
         /*brandingInfo*/
@@ -4839,14 +4891,14 @@ function vt(t) {
       r || (f(e.$$.fragment, n), r = !0);
     },
     o(n) {
-      m(e.$$.fragment, n), r = !1;
+      d(e.$$.fragment, n), r = !1;
     },
     d(n) {
       I(e, n);
     }
   };
 }
-function Uo(t) {
+function So(t) {
   let e, r, n, i, o, s, l, c, a = (
     /*state*/
     t[6] === "present-offer" && /*productDetails*/
@@ -4856,7 +4908,7 @@ function Uo(t) {
     /*state*/
     t[6] === "present-offer" && !/*productDetails*/
     t[2] && bt()
-  ), d = (
+  ), m = (
     /*state*/
     (t[6] === "needs-auth-info" || /*state*/
     t[6] === "processing-auth-info") && It(t)
@@ -4865,87 +4917,87 @@ function Uo(t) {
     t[4] && /*state*/
     (t[6] === "needs-payment-info" || /*state*/
     t[6] === "polling-purchase-status") && wt(t)
-  ), $ = (
+  ), y = (
     /*state*/
     t[6] === "loading" && kt()
   ), E = (
     /*state*/
-    t[6] === "error" && $t(t)
+    t[6] === "error" && yt(t)
   ), B = (
     /*state*/
     t[6] === "success" && vt(t)
   );
   return {
     c() {
-      a && a.c(), e = P(), u && u.c(), r = P(), d && d.c(), n = P(), h && h.c(), i = P(), $ && $.c(), o = P(), E && E.c(), s = P(), B && B.c(), l = te();
+      a && a.c(), e = Q(), u && u.c(), r = Q(), m && m.c(), n = Q(), h && h.c(), i = Q(), y && y.c(), o = Q(), E && E.c(), s = Q(), B && B.c(), l = te();
     },
-    m(A, y) {
-      a && a.m(A, y), p(A, e, y), u && u.m(A, y), p(A, r, y), d && d.m(A, y), p(A, n, y), h && h.m(A, y), p(A, i, y), $ && $.m(A, y), p(A, o, y), E && E.m(A, y), p(A, s, y), B && B.m(A, y), p(A, l, y), c = !0;
+    m(A, $) {
+      a && a.m(A, $), p(A, e, $), u && u.m(A, $), p(A, r, $), m && m.m(A, $), p(A, n, $), h && h.m(A, $), p(A, i, $), y && y.m(A, $), p(A, o, $), E && E.m(A, $), p(A, s, $), B && B.m(A, $), p(A, l, $), c = !0;
     },
-    p(A, y) {
+    p(A, $) {
       /*state*/
       A[6] === "present-offer" && /*productDetails*/
       A[2] && /*purchaseOptionToUse*/
-      A[8] ? a ? (a.p(A, y), y & /*state, productDetails*/
-      68 && f(a, 1)) : (a = Et(A), a.c(), f(a, 1), a.m(e.parentNode, e)) : a && (H(), m(a, 1, 1, () => {
+      A[8] ? a ? (a.p(A, $), $ & /*state, productDetails*/
+      68 && f(a, 1)) : (a = Et(A), a.c(), f(a, 1), a.m(e.parentNode, e)) : a && (H(), d(a, 1, 1, () => {
         a = null;
       }), K()), /*state*/
       A[6] === "present-offer" && !/*productDetails*/
-      A[2] ? u ? y & /*state, productDetails*/
-      68 && f(u, 1) : (u = bt(), u.c(), f(u, 1), u.m(r.parentNode, r)) : u && (H(), m(u, 1, 1, () => {
+      A[2] ? u ? $ & /*state, productDetails*/
+      68 && f(u, 1) : (u = bt(), u.c(), f(u, 1), u.m(r.parentNode, r)) : u && (H(), d(u, 1, 1, () => {
         u = null;
       }), K()), /*state*/
       A[6] === "needs-auth-info" || /*state*/
-      A[6] === "processing-auth-info" ? d ? (d.p(A, y), y & /*state*/
-      64 && f(d, 1)) : (d = It(A), d.c(), f(d, 1), d.m(n.parentNode, n)) : d && (H(), m(d, 1, 1, () => {
-        d = null;
+      A[6] === "processing-auth-info" ? m ? (m.p(A, $), $ & /*state*/
+      64 && f(m, 1)) : (m = It(A), m.c(), f(m, 1), m.m(n.parentNode, n)) : m && (H(), d(m, 1, 1, () => {
+        m = null;
       }), K()), /*paymentInfoCollectionMetadata*/
       A[4] && /*state*/
       (A[6] === "needs-payment-info" || /*state*/
-      A[6] === "polling-purchase-status") ? h ? (h.p(A, y), y & /*paymentInfoCollectionMetadata, state*/
-      80 && f(h, 1)) : (h = wt(A), h.c(), f(h, 1), h.m(i.parentNode, i)) : h && (H(), m(h, 1, 1, () => {
+      A[6] === "polling-purchase-status") ? h ? (h.p(A, $), $ & /*paymentInfoCollectionMetadata, state*/
+      80 && f(h, 1)) : (h = wt(A), h.c(), f(h, 1), h.m(i.parentNode, i)) : h && (H(), d(h, 1, 1, () => {
         h = null;
       }), K()), /*state*/
-      A[6] === "loading" ? $ ? y & /*state*/
-      64 && f($, 1) : ($ = kt(), $.c(), f($, 1), $.m(o.parentNode, o)) : $ && (H(), m($, 1, 1, () => {
-        $ = null;
+      A[6] === "loading" ? y ? $ & /*state*/
+      64 && f(y, 1) : (y = kt(), y.c(), f(y, 1), y.m(o.parentNode, o)) : y && (H(), d(y, 1, 1, () => {
+        y = null;
       }), K()), /*state*/
-      A[6] === "error" ? E ? (E.p(A, y), y & /*state*/
-      64 && f(E, 1)) : (E = $t(A), E.c(), f(E, 1), E.m(s.parentNode, s)) : E && (H(), m(E, 1, 1, () => {
+      A[6] === "error" ? E ? (E.p(A, $), $ & /*state*/
+      64 && f(E, 1)) : (E = yt(A), E.c(), f(E, 1), E.m(s.parentNode, s)) : E && (H(), d(E, 1, 1, () => {
         E = null;
       }), K()), /*state*/
-      A[6] === "success" ? B ? (B.p(A, y), y & /*state*/
-      64 && f(B, 1)) : (B = vt(A), B.c(), f(B, 1), B.m(l.parentNode, l)) : B && (H(), m(B, 1, 1, () => {
+      A[6] === "success" ? B ? (B.p(A, $), $ & /*state*/
+      64 && f(B, 1)) : (B = vt(A), B.c(), f(B, 1), B.m(l.parentNode, l)) : B && (H(), d(B, 1, 1, () => {
         B = null;
       }), K());
     },
     i(A) {
-      c || (f(a), f(u), f(d), f(h), f($), f(E), f(B), c = !0);
+      c || (f(a), f(u), f(m), f(h), f(y), f(E), f(B), c = !0);
     },
     o(A) {
-      m(a), m(u), m(d), m(h), m($), m(E), m(B), c = !1;
+      d(a), d(u), d(m), d(h), d(y), d(E), d(B), c = !1;
     },
     d(A) {
-      A && (g(e), g(r), g(n), g(i), g(o), g(s), g(l)), a && a.d(A), u && u.d(A), d && d.d(A), h && h.d(A), $ && $.d(A), E && E.d(A), B && B.d(A);
+      A && (g(e), g(r), g(n), g(i), g(o), g(s), g(l)), a && a.d(A), u && u.d(A), m && m.d(A), h && h.d(A), y && y.d(A), E && E.d(A), B && B.d(A);
     }
   };
 }
-function Ro(t) {
+function Oo(t) {
   let e, r = (
     /*statesWhereOfferDetailsAreShown*/
     t[9].includes(
       /*state*/
       t[6]
     )
-  ), n, i, o, s, l = r && At(t);
+  ), n, i, o, s, l = r && ht(t);
   return o = new Ft({
     props: {
-      $$slots: { default: [Uo] },
+      $$slots: { default: [So] },
       $$scope: { ctx: t }
     }
   }), {
     c() {
-      e = k("div"), l && l.c(), n = P(), i = k("div"), w(o.$$.fragment), _(i, "class", "rcb-ui-main svelte-1qect5g"), _(e, "class", "rcb-ui-layout svelte-1qect5g"), _(
+      e = k("div"), l && l.c(), n = Q(), i = k("div"), w(o.$$.fragment), _(i, "class", "rcb-ui-main svelte-1qect5g"), _(e, "class", "rcb-ui-layout svelte-1qect5g"), _(
         e,
         "style",
         /*colorVariables*/
@@ -4953,7 +5005,7 @@ function Ro(t) {
       );
     },
     m(c, a) {
-      p(c, e, a), l && l.m(e, null), C(e, n), C(e, i), b(o, i, null), s = !0;
+      p(c, e, a), l && l.m(e, null), M(e, n), M(e, i), b(o, i, null), s = !0;
     },
     p(c, a) {
       a & /*state*/
@@ -4962,7 +5014,7 @@ function Ro(t) {
         /*state*/
         c[6]
       )), r ? l ? (l.p(c, a), a & /*state*/
-      64 && f(l, 1)) : (l = At(c), l.c(), f(l, 1), l.m(e, n)) : l && (H(), m(l, 1, 1, () => {
+      64 && f(l, 1)) : (l = ht(c), l.c(), f(l, 1), l.m(e, n)) : l && (H(), d(l, 1, 1, () => {
         l = null;
       }), K());
       const u = {};
@@ -4973,22 +5025,22 @@ function Ro(t) {
       s || (f(l), f(o.$$.fragment, c), s = !0);
     },
     o(c) {
-      m(l), m(o.$$.fragment, c), s = !1;
+      d(l), d(o.$$.fragment, c), s = !1;
     },
     d(c) {
       c && g(e), l && l.d(), I(o);
     }
   };
 }
-function So(t) {
+function Lo(t) {
   let e, r, n;
-  return r = new so({
+  return r = new lo({
     props: {
       condition: (
         /*asModal*/
         t[0]
       ),
-      $$slots: { default: [Ro] },
+      $$slots: { default: [Oo] },
       $$scope: { ctx: t }
     }
   }), {
@@ -5009,21 +5061,21 @@ function So(t) {
       n || (f(r.$$.fragment, i), n = !0);
     },
     o(i) {
-      m(r.$$.fragment, i), n = !1;
+      d(r.$$.fragment, i), n = !1;
     },
     d(i) {
       i && g(e), I(r);
     }
   };
 }
-function Oo(t, e, r) {
+function xo(t, e, r) {
   var et, tt;
-  let { asModal: n = !0 } = e, { customerEmail: i } = e, { appUserId: o } = e, { rcPackage: s } = e, { purchaseOption: l } = e, { onFinished: c } = e, { onError: a } = e, { onClose: u } = e, { purchases: d } = e, { backend: h } = e, { purchaseOperationHelper: $ } = e;
-  const E = Object.entries(_e).map(([D, xe]) => `--rc-color-${D}: ${xe}`).join("; ");
-  let B = null, A = null, y = null, R = null;
-  const M = ((et = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : et.identifier) ?? null, ve = (tt = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : tt.defaultSubscriptionOption, F = l || ve;
+  let { asModal: n = !0 } = e, { customerEmail: i } = e, { appUserId: o } = e, { rcPackage: s } = e, { purchaseOption: l } = e, { onFinished: c } = e, { onError: a } = e, { onClose: u } = e, { purchases: m } = e, { backend: h } = e, { purchaseOperationHelper: y } = e;
+  const E = Object.entries(pe).map(([D, Le]) => `--rc-color-${D}: ${Le}`).join("; ");
+  let B = null, A = null, $ = null, R = null;
+  const C = ((et = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : et.identifier) ?? null, ve = (tt = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : tt.defaultSubscriptionOption, F = l || ve;
   let S = "present-offer";
-  const ye = [
+  const $e = [
     "present-offer",
     "needs-auth-info",
     "processing-auth-info",
@@ -5031,7 +5083,7 @@ function Oo(t, e, r) {
     "polling-purchase-status",
     "loading"
   ];
-  Oe(async () => {
+  Se(async () => {
     if (r(2, B = s.rcBillingProduct), r(3, A = await h.getBrandingInfo()), S === "present-offer") {
       i ? Ze() : r(6, S = "needs-auth-info");
       return;
@@ -5040,26 +5092,26 @@ function Oo(t, e, r) {
   const Be = () => {
     u();
   }, Ze = () => {
-    if (M === null) {
-      de(new Y(O.ErrorSettingUpPurchase, "Product ID was not set before purchase."));
+    if (C === null) {
+      fe(new Y(O.ErrorSettingUpPurchase, "Product ID was not set before purchase."));
       return;
     } else
       S === "present-offer" && r(6, S = "loading");
     if (!i) {
-      de(new Y(O.MissingEmailError));
+      fe(new Y(O.MissingEmailError));
       return;
     }
-    $.startPurchase(o, M, F, i, s.rcBillingProduct.presentedOfferingIdentifier).then((D) => {
+    y.startPurchase(o, C, F, i, s.rcBillingProduct.presentedOfferingIdentifier).then((D) => {
       if (D.next_action === "collect_payment_info") {
-        r(6, S = "needs-payment-info"), r(4, y = D);
+        r(5, R = null), r(6, S = "needs-payment-info"), r(4, $ = D);
         return;
       }
       if (D.next_action === "completed") {
-        r(6, S = "success");
+        r(5, R = null), r(6, S = "success");
         return;
       }
     }).catch((D) => {
-      de(D);
+      fe(D);
     });
   }, Yt = (D) => {
     if (S === "needs-auth-info") {
@@ -5067,10 +5119,10 @@ function Oo(t, e, r) {
       return;
     }
     if (S === "needs-payment-info") {
-      r(6, S = "polling-purchase-status"), $.pollCurrentPurchaseForCompletion().then(() => {
+      r(6, S = "polling-purchase-status"), y.pollCurrentPurchaseForCompletion().then(() => {
         r(6, S = "success");
-      }).catch((xe) => {
-        de(xe);
+      }).catch((Le) => {
+        fe(Le);
       });
       return;
     }
@@ -5079,27 +5131,31 @@ function Oo(t, e, r) {
       return;
     }
     r(6, S = "success");
-  }, de = (D) => {
+  }, fe = (D) => {
+    if (S === "processing-auth-info") {
+      r(5, R = D), r(6, S = "needs-auth-info");
+      return;
+    }
     r(5, R = D), r(6, S = "error");
   }, Ht = () => {
     a(R ?? new Y(O.UnknownError, "Unknown error without state set."));
   };
   return t.$$set = (D) => {
-    "asModal" in D && r(0, n = D.asModal), "customerEmail" in D && r(14, i = D.customerEmail), "appUserId" in D && r(15, o = D.appUserId), "rcPackage" in D && r(16, s = D.rcPackage), "purchaseOption" in D && r(17, l = D.purchaseOption), "onFinished" in D && r(18, c = D.onFinished), "onError" in D && r(19, a = D.onError), "onClose" in D && r(20, u = D.onClose), "purchases" in D && r(1, d = D.purchases), "backend" in D && r(21, h = D.backend), "purchaseOperationHelper" in D && r(22, $ = D.purchaseOperationHelper);
+    "asModal" in D && r(0, n = D.asModal), "customerEmail" in D && r(14, i = D.customerEmail), "appUserId" in D && r(15, o = D.appUserId), "rcPackage" in D && r(16, s = D.rcPackage), "purchaseOption" in D && r(17, l = D.purchaseOption), "onFinished" in D && r(18, c = D.onFinished), "onError" in D && r(19, a = D.onError), "onClose" in D && r(20, u = D.onClose), "purchases" in D && r(1, m = D.purchases), "backend" in D && r(21, h = D.backend), "purchaseOperationHelper" in D && r(22, y = D.purchaseOperationHelper);
   }, [
     n,
-    d,
+    m,
     B,
     A,
-    y,
+    $,
     R,
     S,
     E,
     F,
-    ye,
+    $e,
     Be,
     Yt,
-    de,
+    fe,
     Ht,
     i,
     o,
@@ -5109,16 +5165,16 @@ function Oo(t, e, r) {
     a,
     u,
     h,
-    $
+    y
   ];
 }
-class Lo extends U {
+class Fo extends U {
   constructor(e) {
     super(), N(
       this,
       e,
-      Oo,
-      So,
+      xo,
+      Lo,
       T,
       {
         asModal: 0,
@@ -5137,33 +5193,33 @@ class Lo extends U {
     );
   }
 }
-function xo(t) {
+function Go(t) {
   return t.expires_date == null ? !0 : new Date(t.expires_date) > /* @__PURE__ */ new Date();
 }
-function Fo(t, e, r, n) {
+function Yo(t, e, r, n) {
   const i = e.product_identifier;
   if (i in r)
-    return Go(
+    return Ho(
       t,
       e,
       r[i]
     );
   if (i in n)
-    return Yo(
+    return Ko(
       t,
       e,
       n[i]
     );
-  throw new X(
-    ee.CustomerInfoError,
+  throw new z(
+    Z.CustomerInfoError,
     "Could not find entitlement product in subscriptions or non-subscriptions."
   );
 }
-function Go(t, e, r) {
+function Ho(t, e, r) {
   return {
     identifier: t,
-    isActive: xo(e),
-    willRenew: qo(e, r),
+    isActive: Go(e),
+    willRenew: Jo(e, r),
     store: (r == null ? void 0 : r.store) ?? "unknown",
     latestPurchaseDate: new Date(e.purchase_date),
     originalPurchaseDate: new Date(e.purchase_date),
@@ -5179,7 +5235,7 @@ function Go(t, e, r) {
     periodType: (r == null ? void 0 : r.period_type) ?? "normal"
   };
 }
-function Yo(t, e, r) {
+function Ko(t, e, r) {
   return {
     identifier: t,
     isActive: !0,
@@ -5197,10 +5253,10 @@ function Yo(t, e, r) {
     periodType: "normal"
   };
 }
-function Ho(t, e, r) {
+function qo(t, e, r) {
   const n = {}, i = {};
   for (const o in t) {
-    const s = Fo(
+    const s = Yo(
       o,
       t[o],
       e,
@@ -5216,22 +5272,22 @@ function Ho(t, e, r) {
 function Ne(t) {
   return t == null ? null : new Date(t);
 }
-function Ko(t) {
-  const e = Jo(t), r = t.subscriber, n = Wo(
+function jo(t) {
+  const e = Wo(t), r = t.subscriber, n = Xo(
     r.non_subscriptions
   );
   return {
-    entitlements: Ho(
+    entitlements: qo(
       r.entitlements,
       r.subscriptions,
       n
     ),
     allExpirationDatesByProduct: e,
-    allPurchaseDatesByProduct: jo(
+    allPurchaseDatesByProduct: Vo(
       t,
       n
     ),
-    activeSubscriptions: Vo(e),
+    activeSubscriptions: zo(e),
     managementURL: r.management_url,
     requestDate: new Date(t.request_date),
     firstSeenDate: new Date(r.first_seen),
@@ -5241,13 +5297,13 @@ function Ko(t) {
     originalAppUserId: t.subscriber.original_app_user_id
   };
 }
-function qo(t, e) {
+function Jo(t, e) {
   if (e == null)
     return !1;
   const r = e.store == "promotional", n = t.expires_date == null, i = e.unsubscribe_detected_at != null, o = e.billing_issues_detected_at != null;
   return !(r || n || i || o);
 }
-function jo(t, e) {
+function Vo(t, e) {
   const r = {};
   for (const n in t.subscriber.subscriptions) {
     const i = t.subscriber.subscriptions[n];
@@ -5261,7 +5317,7 @@ function jo(t, e) {
   }
   return r;
 }
-function Jo(t) {
+function Wo(t) {
   const e = {};
   for (const r in t.subscriber.subscriptions) {
     const n = t.subscriber.subscriptions[r];
@@ -5271,7 +5327,7 @@ function Jo(t) {
   }
   return e;
 }
-function Vo(t) {
+function zo(t) {
   const e = /* @__PURE__ */ new Set(), r = /* @__PURE__ */ new Date();
   for (const n in t) {
     const i = t[n];
@@ -5279,7 +5335,7 @@ function Vo(t) {
   }
   return e;
 }
-function Wo(t) {
+function Xo(t) {
   const e = {};
   for (const r in t) {
     if (t[r].length === 0)
@@ -5289,14 +5345,14 @@ function Wo(t) {
   }
   return e;
 }
-function zo(t) {
+function Zo(t) {
   if (!/^rcb_[a-zA-Z0-9_.-]+$/.test(t))
-    throw new X(
-      ee.InvalidCredentialsError,
+    throw new z(
+      Z.InvalidCredentialsError,
       "Invalid API key. Use your RevenueCat Billing API key."
     );
 }
-function Xo(t) {
+function es(t) {
   if ((/* @__PURE__ */ new Set([
     "no_user",
     "null",
@@ -5310,24 +5366,31 @@ function Xo(t) {
     "undefined",
     "unknown"
   ])).has(t) || t.includes("/"))
-    throw new X(
-      ee.InvalidAppUserIdError,
+    throw new z(
+      Z.InvalidAppUserIdError,
       'Provided user id: "' + t + '" is not valid. See https://www.revenuecat.com/docs/customers/user-ids#tips-for-setting-app-user-ids for more information.'
     );
 }
-const z = class z {
+function ts(t) {
+  if (t != null && t.endsWith("/"))
+    throw new z(
+      Z.ConfigurationError,
+      "Invalid proxy URL. The proxy URL should not end with a trailing slash."
+    );
+}
+const X = class X {
   /** @internal */
-  constructor(e, r) {
+  constructor(e, r, n = je) {
     /** @internal */
-    Q(this, "_API_KEY");
+    P(this, "_API_KEY");
     /** @internal */
-    Q(this, "_appUserId");
+    P(this, "_appUserId");
     /** @internal */
-    Q(this, "backend");
+    P(this, "backend");
     /** @internal */
-    Q(this, "purchaseOperationHelper");
+    P(this, "purchaseOperationHelper");
     /** @internal */
-    Q(this, "toOfferings", (e, r) => {
+    P(this, "toOfferings", (e, r) => {
       const n = e.offerings.find(
         (l) => l.identifier === e.current_offering_id
       ) ?? null, i = {};
@@ -5345,7 +5408,7 @@ const z = class z {
         current: o
       };
     });
-    this._API_KEY = e, this._appUserId = r, je(e) && G.debugLog("Initializing Purchases SDK with sandbox API Key"), this.backend = new wo(this._API_KEY), this.purchaseOperationHelper = new Yn(this.backend);
+    this._API_KEY = e, this._appUserId = r, qe(e) && G.debugLog("Initializing Purchases SDK with sandbox API Key"), this.backend = new yo(this._API_KEY, n), this.purchaseOperationHelper = new Hn(this.backend);
   }
   /**
    * Set the log level. Logs of the given level and below will be printed
@@ -5362,15 +5425,15 @@ const z = class z {
    * @throws {@link UninitializedPurchasesError} if the instance has not been initialized yet.
    */
   static getSharedInstance() {
-    if (z.isConfigured())
-      return z.instance;
-    throw new Gn();
+    if (X.isConfigured())
+      return X.instance;
+    throw new Yn();
   }
   /**
    * Returns whether the Purchases SDK is configured or not.
    */
   static isConfigured() {
-    return z.instance !== void 0;
+    return X.instance !== void 0;
   }
   /**
    * Configures the Purchases SDK. This should be called as soon as your app
@@ -5378,12 +5441,13 @@ const z = class z {
    * keep the returned instance around for use throughout your application.
    * @param apiKey - RevenueCat API Key. Can be obtained from the RevenueCat dashboard.
    * @param appUserId - Your unique id for identifying the user.
+   * @param httpConfig - Advanced http configuration to customise the SDK usage {@link HttpConfig}.
    * @throws {@link PurchasesError} if the API key or user id are invalid.
    */
-  static configure(e, r) {
-    return z.instance !== void 0 && G.warnLog(
+  static configure(e, r, n = je) {
+    return X.instance !== void 0 && G.warnLog(
       "Purchases is already initialized. You normally should only configure Purchases once. Creating and returning new instance."
-    ), zo(e), Xo(r), z.instance = new z(e, r), z.getSharedInstance();
+    ), Zo(e), es(r), ts(n.proxyURL), X.instance = new X(e, r, n), X.getSharedInstance();
   }
   /**
    * Fetch the configured offerings for this user. You can configure these
@@ -5450,8 +5514,8 @@ const z = class z {
     const l = s, c = !i, a = this._appUserId;
     return G.debugLog(
       `Presenting purchase form for package ${r.identifier}`
-    ), new Promise((u, d) => {
-      new Lo({
+    ), new Promise((u, m) => {
+      new Fo({
         target: l,
         props: {
           appUserId: a,
@@ -5464,10 +5528,10 @@ const z = class z {
             });
           },
           onClose: () => {
-            l.innerHTML = "", G.debugLog("Purchase cancelled by user"), d(new X(ee.UserCancelledError));
+            l.innerHTML = "", G.debugLog("Purchase cancelled by user"), m(new z(Z.UserCancelledError));
           },
           onError: (h) => {
-            l.innerHTML = "", d(X.getForPurchasesFlowError(h));
+            l.innerHTML = "", m(z.getForPurchasesFlowError(h));
           },
           purchases: this,
           backend: this.backend,
@@ -5518,30 +5582,30 @@ const z = class z {
    * @returns Whether the SDK is using a sandbox API Key.
    */
   isSandbox() {
-    return je(this._API_KEY);
+    return qe(this._API_KEY);
   }
   /**
    * Closes the Purchases instance. You should never have to do this normally.
    */
   close() {
-    z.instance === this ? z.instance = void 0 : G.warnLog(
+    X.instance === this ? X.instance = void 0 : G.warnLog(
       "Trying to close a Purchases instance that is not the current instance. Ignoring."
     );
   }
   /** @internal */
   async _getCustomerInfoForUserId(e) {
     const r = await this.backend.getCustomerInfo(e);
-    return Ko(r);
+    return jo(r);
   }
 };
 /** @internal */
-Q(z, "instance");
-let yt = z;
+P(X, "instance");
+let $t = X;
 export {
-  ee as ErrorCode,
+  Z as ErrorCode,
   W as LogLevel,
   zt as PackageType,
-  yt as Purchases,
-  X as PurchasesError,
-  Gn as UninitializedPurchasesError
+  $t as Purchases,
+  z as PurchasesError,
+  Yn as UninitializedPurchasesError
 };