@revenuecat/purchases-js 0.3.0 → 0.3.2

package/dist/Purchases.es.js

@@ -47,8 +47,8 @@ class G {
   }
 }
 Q(G, "logLevel", W.Silent);
-var te = /* @__PURE__ */ ((t) => (t.Year = "year", t.Month = "month", t.Week = "week", t.Day = "day", t))(te || {});
-function yt(t) {
+var ne = /* @__PURE__ */ ((t) => (t.Year = "year", t.Month = "month", t.Week = "week", t.Day = "day", t))(ne || {});
+function Je(t) {
   const e = t.match(/^PT?([0-9]+)([MDYW])$/);
   if (!e || e.length < 3)
     return G.errorLog(`Invalid ISO 8601 duration format: ${t}`), null;
@@ -82,7 +82,7 @@ function yt(t) {
       return G.errorLog(`Invalid ISO 8601 unit duration format: ${t}`), null;
   }
 }
-const Je = (t, e) => {
+const Ve = (t, e) => {
   const r = t / 100;
   return new Intl.NumberFormat("en-US", {
     style: "currency",
@@ -92,13 +92,13 @@ const Je = (t, e) => {
   const e = t.number;
   if (e === 1)
     switch (t.unit) {
-      case te.Year:
+      case ne.Year:
         return "yearly";
-      case te.Month:
+      case ne.Month:
         return "monthly";
-      case te.Week:
+      case ne.Week:
         return "weekly";
-      case te.Day:
+      case ne.Day:
         return "daily";
     }
   else
@@ -107,37 +107,41 @@ const Je = (t, e) => {
   const e = t.number;
   if (e === 1)
     switch (t.unit) {
-      case te.Year:
+      case ne.Year:
         return "1 year";
-      case te.Month:
+      case ne.Month:
         return "1 month";
-      case te.Week:
+      case ne.Week:
         return "1 week";
-      case te.Day:
+      case ne.Day:
         return "1 day";
     }
   else
     return `${e} ${t.unit}s`;
-}, tt = (t) => {
-  const e = yt(t);
+}, nt = (t) => {
+  const e = Je(t);
   return e ? Jt(e) : "unknown";
 }, Wt = (t) => {
-  const e = yt(t);
+  const e = Je(t);
   return e ? Vt(e) : "unknown";
 };
 var zt = /* @__PURE__ */ ((t) => (t.Unknown = "unknown", t.Custom = "custom", t.Lifetime = "$rc_lifetime", t.Annual = "$rc_annual", t.SixMonth = "$rc_six_month", t.ThreeMonth = "$rc_three_month", t.TwoMonth = "$rc_two_month", t.Monthly = "$rc_monthly", t.Weekly = "$rc_weekly", t))(zt || {});
 const Xt = (t) => ({
   amount: t.amount,
   currency: t.currency,
-  formattedPrice: Je(t.amount, t.currency)
-}), nt = (t) => ({
-  periodDuration: t.period_duration,
-  cycleCount: t.cycle_count,
-  price: t.price ? Xt(t.price) : null
-}), Zt = (t) => t.base == null ? (G.debugLog("Missing base phase for subscription option. Ignoring."), null) : {
+  formattedPrice: Ve(t.amount, t.currency)
+}), rt = (t) => {
+  const e = t.period_duration;
+  return {
+    periodDuration: e,
+    period: e ? Je(e) : null,
+    cycleCount: t.cycle_count,
+    price: t.price ? Xt(t.price) : null
+  };
+}, Zt = (t) => t.base == null ? (G.debugLog("Missing base phase for subscription option. Ignoring."), null) : {
   id: t.id,
-  base: nt(t.base),
-  trial: t.trial ? nt(t.trial) : null
+  base: rt(t.base),
+  trial: t.trial ? rt(t.trial) : null
 }, en = (t, e) => {
   const r = {};
   if (Object.entries(t.subscription_options).forEach(
@@ -178,7 +182,7 @@ const Xt = (t) => ({
     rcBillingProduct: i,
     packageType: nn(e.identifier)
   };
-}, rt = (t, e) => {
+}, it = (t, e) => {
   const r = t.packages.map(
     (i) => tn(t.identifier, i, e)
   ).filter(jt), n = {};
@@ -232,7 +236,7 @@ function rn(t, e) {
 function Bt(t) {
   return t();
 }
-function it() {
+function ot() {
   return /* @__PURE__ */ Object.create(null);
 }
 function we(t) {
@@ -248,11 +252,11 @@ let De;
 function Z(t, e) {
   return t === e ? !0 : (De || (De = document.createElement("a")), De.href = e, t === De.href);
 }
-function ot(t) {
+function st(t) {
   return t.split(",").map((e) => e.trim().split(" ").filter(Boolean));
 }
 function on(t, e) {
-  const r = ot(t.srcset), n = ot(e || "");
+  const r = st(t.srcset), n = st(e || "");
   return n.length === r.length && n.every(
     ([i, o], s) => o === r[s][1] && // We need to test both ways because Vite will create an a full URL with
     // `new URL(asset, import.meta.url).href` for the client when `base: './'`, and the
@@ -307,7 +311,7 @@ function V(t) {
 function Ee(t) {
   return t ?? "";
 }
-function M(t, e) {
+function C(t, e) {
   t.appendChild(e);
 }
 function x(t, e, r) {
@@ -328,7 +332,7 @@ function ln(t) {
   ) : t.ownerDocument;
 }
 function cn(t, e) {
-  return M(
+  return C(
     /** @type {Document} */
     t.head || t,
     e
@@ -343,19 +347,19 @@ function g(t) {
 function k(t) {
   return document.createElement(t);
 }
-function S(t) {
+function L(t) {
   return document.createTextNode(t);
 }
 function P() {
-  return S(" ");
+  return L(" ");
 }
-function ee() {
-  return S("");
+function te() {
+  return L("");
 }
 function ke(t, e, r, n) {
   return t.addEventListener(e, r, n), () => t.removeEventListener(e, r, n);
 }
-function Ct(t) {
+function Mt(t) {
   return function(e) {
     return e.preventDefault(), t.call(this, e);
   };
@@ -388,7 +392,7 @@ function ae(t, e) {
   e = "" + e, t.data !== e && (t.data = /** @type {string} */
   e);
 }
-function st(t, e) {
+function lt(t, e) {
   t.value = e ?? "";
 }
 function pn(t, e, { bubbles: r = !1, cancelable: n = !1 } = {}) {
@@ -398,16 +402,16 @@ let be;
 function Ae(t) {
   be = t;
 }
-function Oe() {
+function Se() {
   if (!be)
     throw new Error("Function called outside component initialization");
   return be;
 }
-function Se(t) {
-  Oe().$$.on_mount.push(t);
+function Oe(t) {
+  Se().$$.on_mount.push(t);
 }
 function _n() {
-  const t = Oe();
+  const t = Se();
   return (e, r, { cancelable: n = !1 } = {}) => {
     const i = t.$$.callbacks[e];
     if (i) {
@@ -425,12 +429,12 @@ function _n() {
   };
 }
 function An(t, e) {
-  return Oe().$$.context.set(t, e), e;
+  return Se().$$.context.set(t, e), e;
 }
 function hn(t) {
-  return Oe().$$.context.get(t);
+  return Se().$$.context.get(t);
 }
-function Mt(t, e) {
+function Ct(t, e) {
   const r = t.$$.callbacks[e.type];
   r && r.slice().forEach((n) => n.call(this, e));
 }
@@ -487,7 +491,7 @@ function kn(t) {
 }
 const Pe = /* @__PURE__ */ new Set();
 let re;
-function Y() {
+function H() {
   re = {
     r: 0,
     c: [],
@@ -495,7 +499,7 @@ function Y() {
     // parent group
   };
 }
-function H() {
+function K() {
   re.r || we(re.c), re = re.p;
 }
 function f(t, e) {
@@ -542,7 +546,7 @@ function N(t, e, r, n, i, o, s = null, l = [-1]) {
     props: o,
     update: v,
     not_equal: i,
-    bound: it(),
+    bound: ot(),
     // lifecycle
     on_mount: [],
     on_destroy: [],
@@ -551,7 +555,7 @@ function N(t, e, r, n, i, o, s = null, l = [-1]) {
     after_update: [],
     context: new Map(e.context || (c ? c.$$.context : [])),
     // everything else
-    callbacks: it(),
+    callbacks: ot(),
     dirty: l,
     skip_bound: !1,
     root: e.target || c.$$.root
@@ -691,7 +695,7 @@ function Dn(t) {
   );
   return {
     c() {
-      i && i.c(), r = ee();
+      i && i.c(), r = te();
     },
     m(o, s) {
       i && i.m(o, s), p(o, r, s), n = !0;
@@ -718,7 +722,7 @@ function Dn(t) {
     }
   };
 }
-function Cn(t, e, r) {
+function Mn(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { as: o = "section" } = e;
   return t.$$set = (s) => {
     "as" in s && r(0, o = s.as), "$$scope" in s && r(1, i = s.$$scope);
@@ -726,10 +730,10 @@ function Cn(t, e, r) {
 }
 class ue extends U {
   constructor(e) {
-    super(), N(this, e, Cn, Dn, T, { as: 0 }, Bn);
+    super(), N(this, e, Mn, Dn, T, { as: 0 }, Bn);
   }
 }
-function Mn(t) {
+function Cn(t) {
   x(t, "svelte-gf0gr5", ".rcb-pricing-info.svelte-gf0gr5{display:flex;flex-direction:column;margin-top:102px;font-weight:500}.rcb-product-price.svelte-gf0gr5{font-size:24px;margin:12px 0px}.rcb-product-price-after-trial.svelte-gf0gr5{margin-bottom:12px}.rcb-product-details.svelte-gf0gr5{opacity:0.6;list-style-type:disc;list-style-position:inside;margin:0px;padding:0px}@media screen and (max-width: 960px){.rcb-pricing-info.svelte-gf0gr5{margin-top:48px}}");
 }
 function Qn(t) {
@@ -739,7 +743,7 @@ function Qn(t) {
   ) + "", r, n;
   return {
     c() {
-      r = S(e), n = S(" free trial");
+      r = L(e), n = L(" free trial");
     },
     m(i, o) {
       p(i, r, o), p(i, n, o);
@@ -754,7 +758,7 @@ function Pn(t) {
   let e = (
     /*basePrice*/
     (t[2].currency || "") + ""
-  ), r, n, i = Je(
+  ), r, n, i = Ve(
     /*basePrice*/
     t[2].amount,
     /*basePrice*/
@@ -762,7 +766,7 @@ function Pn(t) {
   ) + "", o;
   return {
     c() {
-      r = S(e), n = P(), o = S(i);
+      r = L(e), n = P(), o = L(i);
     },
     m(s, l) {
       p(s, r, l), p(s, n, l), p(s, o, l);
@@ -780,7 +784,7 @@ function Tn(t) {
       e = k("span"), e.textContent = `${/*trial*/
       t[1] && /*basePrice*/
       t[2] && `${/*basePrice*/
-      t[2].currency} ${Je(
+      t[2].currency} ${Ve(
         /*basePrice*/
         t[2].amount,
         /*basePrice*/
@@ -796,21 +800,21 @@ function Tn(t) {
     }
   };
 }
-function lt(t) {
-  let e, r, n = tt(
+function ct(t) {
+  let e, r, n = nt(
     /*productDetails*/
     t[0].normalPeriodDuration
   ) + "", i;
   return {
     c() {
-      e = k("li"), r = S("Renews "), i = S(n);
+      e = k("li"), r = L("Renews "), i = L(n);
     },
     m(o, s) {
-      p(o, e, s), M(e, r), M(e, i);
+      p(o, e, s), C(e, r), C(e, i);
     },
     p(o, s) {
       s & /*productDetails*/
-      1 && n !== (n = tt(
+      1 && n !== (n = nt(
         /*productDetails*/
         o[0].normalPeriodDuration
       ) + "") && ae(i, n);
@@ -821,13 +825,13 @@ function lt(t) {
   };
 }
 function Nn(t) {
-  var C, ve;
+  var M, ve;
   let e, r, n = (
     /*productDetails*/
     t[0].displayName + ""
   ), i, o, s, l, c, a, u, d, h, $, E, B = (
     /*trial*/
-    ((C = t[1]) == null ? void 0 : C.periodDuration) && Qn(t)
+    ((M = t[1]) == null ? void 0 : M.periodDuration) && Qn(t)
   ), A = !/*trial*/
   ((ve = t[1]) != null && ve.periodDuration) && /*basePrice*/
   t[2] && Pn(t), y = (
@@ -836,26 +840,26 @@ function Nn(t) {
     t[2] && Tn(t)
   ), R = (
     /*productDetails*/
-    t[0].normalPeriodDuration && lt(t)
+    t[0].normalPeriodDuration && ct(t)
   );
   return {
     c() {
-      e = k("div"), r = k("span"), i = S(n), o = P(), s = k("span"), B && B.c(), l = P(), A && A.c(), c = P(), y && y.c(), a = P(), u = k("ul"), R && R.c(), d = P(), h = k("li"), h.textContent = "Continues until canceled", $ = P(), E = k("li"), E.textContent = "Cancel anytime", _(s, "class", "rcb-product-price svelte-gf0gr5"), _(u, "class", "rcb-product-details svelte-gf0gr5"), _(e, "class", "rcb-pricing-info svelte-gf0gr5");
+      e = k("div"), r = k("span"), i = L(n), o = P(), s = k("span"), B && B.c(), l = P(), A && A.c(), c = P(), y && y.c(), a = P(), u = k("ul"), R && R.c(), d = P(), h = k("li"), h.textContent = "Continues until canceled", $ = P(), E = k("li"), E.textContent = "Cancel anytime", _(s, "class", "rcb-product-price svelte-gf0gr5"), _(u, "class", "rcb-product-details svelte-gf0gr5"), _(e, "class", "rcb-pricing-info svelte-gf0gr5");
     },
-    m(F, O) {
-      p(F, e, O), M(e, r), M(r, i), M(e, o), M(e, s), B && B.m(s, null), M(s, l), A && A.m(s, null), M(e, c), y && y.m(e, null), M(e, a), M(e, u), R && R.m(u, null), M(u, d), M(u, h), M(u, $), M(u, E);
+    m(F, S) {
+      p(F, e, S), C(e, r), C(r, i), C(e, o), C(e, s), B && B.m(s, null), C(s, l), A && A.m(s, null), C(e, c), y && y.m(e, null), C(e, a), C(e, u), R && R.m(u, null), C(u, d), C(u, h), C(u, $), C(u, E);
     },
-    p(F, O) {
+    p(F, S) {
       var ye, Be;
-      O & /*productDetails*/
+      S & /*productDetails*/
       1 && n !== (n = /*productDetails*/
       F[0].displayName + "") && ae(i, n), /*trial*/
-      (ye = F[1]) != null && ye.periodDuration && B.p(F, O), !/*trial*/
+      (ye = F[1]) != null && ye.periodDuration && B.p(F, S), !/*trial*/
       ((Be = F[1]) != null && Be.periodDuration) && /*basePrice*/
-      F[2] && A.p(F, O), /*trial*/
+      F[2] && A.p(F, S), /*trial*/
       F[1] && /*basePrice*/
-      F[2] && y.p(F, O), /*productDetails*/
-      F[0].normalPeriodDuration ? R ? R.p(F, O) : (R = lt(F), R.c(), R.m(u, d)) : R && (R.d(1), R = null);
+      F[2] && y.p(F, S), /*productDetails*/
+      F[0].normalPeriodDuration ? R ? R.p(F, S) : (R = ct(F), R.c(), R.m(u, d)) : R && (R.d(1), R = null);
     },
     d(F) {
       F && g(e), B && B.d(), A && A.d(), y && y.d(), R && R.d();
@@ -902,15 +906,15 @@ function Rn(t, e, r) {
 }
 class Pt extends U {
   constructor(e) {
-    super(), N(this, e, Rn, Un, T, { productDetails: 0, purchaseOption: 3 }, Mn);
+    super(), N(this, e, Rn, Un, T, { productDetails: 0, purchaseOption: 3 }, Cn);
   }
 }
-const On = "data:image/gif;base64,R0lGODlhMgAyAPcBAAAAAAD/AAMDAwcHBxERERUVFSoqKi0tLTAwMDg4OD09PURERElJSUtLS1BQUFJSUlVVVVdXV1paWl9fX2NjY2ZmZmlpaWxsbG1tbXNzc3t7e39/f4GBgYKCgoSEhIaGhoeHh4iIiIuLi5KSkpSUlJaWlp2dnaGhoaOjo6SkpKWlpaenp6ioqKqqqqurq6ysrLCwsLGxsbS0tLa2tri4uLm5ub29vb6+vsDAwMHBwcLCwsXFxcjIyMnJyc3Nzc7OztPT09TU1NXV1dfX19nZ2dra2tvb29zc3N7e3uDg4OHh4eLi4uPj4+fn5+np6ezs7O7u7vDw8PHx8fLy8vPz8/X19fb29vj4+Pn5+fz8/P39/f7+/v///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////yH/C05FVFNDQVBFMi4wAwEAAAAh+QQFBAABACwAAAAAMgAyAIcAAAAA/wADAwMHBwcREREVFRUqKiotLS0wMDA4ODg9PT1ERERJSUlLS0tQUFBSUlJVVVVXV1daWlpfX19jY2NmZmZpaWlsbGxtbW1zc3N7e3t/f3+BgYGCgoKEhISGhoaHh4eIiIiLi4uSkpKUlJSWlpadnZ2hoaGjo6OkpKSlpaWnp6eoqKiqqqqrq6usrKywsLCxsbG0tLS2tra4uLi5ubm9vb2+vr7AwMDBwcHCwsLFxcXIyMjJycnNzc3Ozs7T09PU1NTV1dXX19fZ2dna2trb29vc3Nze3t7g4ODh4eHi4uLj4+Pn5+fp6ens7Ozu7u7w8PDx8fHy8vLz8/P19fX29vb4+Pj5+fn8/Pz9/f3+/v7///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////8I/wCzcBFIcKDBgggPKkzIcCEXLlq4bIEokeLEiBcrYrTIcaNHjRobinQ4sqRCkBlTdtR44MBKlR9TmjQJQMBMkgZfdpwSMSYAACgpRtHpcSYSFUIa1mz448UQnAWDfmzSooUVmD9XVnnBwglMlDdvvMjhcOlCHit23CSqcUrVJiizpnTC4sXQmB1vZvmxwgYWhWYLznjRA+rJryqvxGhxxGNLjkVcwMCCN6ZeLkNevDCcRYYKJJfZptyCQwdiijl0CDxdlLPryw2lymY9WzTs17ijVq69mzbM28Bd8x7u23bu46F7i16uXEvw5ziJM5duGbl1k9OLN5cKvfvh7OC3b0jxTv6h+PDUy3unzl67RPXXc56fnz4+/PbofcOHnr9/5f3x4UeffvYVqJuACP5m4IIJ+gfWgusN6KCCAN7WoITVVXjchBxqERAAIfkEBQQAAQAsDQADACAAEAAACKcAAwgcSDDAAwcFEypcSNDAAYYQA2DZstCAAYZOKCqM8uNJxYcKa3DYsVBKECBYFFpU+MTDhiIMkQxBohJkwRYaUkDEEiQIlYQrCyLZ0MFJRCdAkgC1OZBEBxgRJRIBAqXgwYI8NoCwEjWAkyFDoorQ4KOrQCRLoqbQuZCKR7NdqzD5MaQKXIhZmAwBIqTJ3YVYogQZ8oMJ178Kk/A1YhfxQiRHjBYMCAAh+QQFBQABACwNAAMAIAAQAAAInQADCBxIMECGDAUTKlxI8EEEhhADcGEI4QFDJQy5ZJmo0OFCFBFkLNzCRQvHghEgKHQi4cEPhhuzdHyYUMQDDxC5kNSSsGLCIA4x5oxZ0GNBDBFKRAxgkmTBgwVpRJhAZWkAohErPKhhVaLJpR8+YFnohEjXrlB2qHgB5SxELD5etHgBxC1DJC9eqOAxxe5CHSxc0HDilyEOGWYLBgQAIfkEBQQAAQAsGAADABcAFwAACJYAS5AIQLCgwYMINXBAyLDhhg0NtxRpWFBDh4YiDpygGOAhwyUIDOTgqJAhBgMVOHaEeLCHgQMTSV40uKXBAZYcBR5UYSBBFJUNFRhoAbShhZQNi/DYUvRgkxQKmzQlaCVGhw0eakwN4MNDBw0tnmxN8ZAEkq0ET4jYgbat27dw474lMuTHECB1hxBpigRIECBC/AJBEhAAIfkEBQQAAQAsGAADABcAFwAACJIAa9AIQLCgwYMIVbxAyLBhCxYNAwCJSHDFQoYaBIyg6KIFQyQDAMigqJAhBAAMKAZ4iPAGAAETKVpEaECABZUBBB4kAYAAFJwMCwAoAZQhg5QNf4wsajCJhwcRkjANQMVEBAgSVDC9UkNChAcimkz9ADVDkKkEPVRYirat27dw47ad8UKhRYUzitZo8bDjwxoBAQAh+QQFBAABACwYAAMAFwAiAAAIvwCRGAlAsKDBgwh/DEHIsGEQIA0DFIlIEMhChiIOnKAoBCLCJQgM5KCokCEGAxUoBniIsIeBAxMpWkTY4MAGlQEEHlRhIEEUnAwVGGgBlKGFlA1zbCxqkEiFl0SYBojS4YABBCO2MG2RwCqGJFKfGnDQQyrBCgpQaDXLtq3bt3DZkuiggYMGuhxIFC2xoa/fDSXiCh5MuDDBJUSgZGl7ZAiQJFLYbnlCBEiQJFjYXnFiEciTtliSPMzcNspPggEBACH5BAUEAAEALBgAAwAXACIAAAi6ALlsCUCwoMGDCLNwQciwIRctDpU0LKiwIYoIMiYGEMjQiYQHPzRWRCjigQeNGyEeDPIggkSRCw1ywRChBMqNAw3SiDCByk2GFR7U+Mnww4eJMkYQPQiEAQABQJYGgGJBAIABGqSWIGAVghGpTgEcuCGVIIMCSsuqXcu2rdu1NFvKjYCBaAYIEFrifZDhrd+/gAMT1AHjCNsbL1bYYLKWSIwWLXRYUVvlB4sXLISsnYKjBYspbJkgKRgQACH5BAUEAAEALB8ABQAQACgAAAjDAAMIDOBkoMGDAmtw2IEQ4RMPG4o0PNhCQ4qJBpFs6FAQo0ASHWB4FMhjAwgrIwOI0OAjZYAUKbJMzHEiJZEKBg4QwRilwwEDCEZgbJHgJ4YkGHEacNBjZAUFKFxKnUq1qlWBDX5qzdmg4QMDYMMaeHC1rNmzA1WIaJryBAcNJSR61MIjxIYNKqKMnDJj4wYcKZ2cuNuRyRGMQ3xgEUgkyBOXUYAUuZIyCxIgTVxKGQJEZsokQpBWBjJEb2Agj116xhgQACH5BAUFAAEALB8ABQAQACgAAAjFAAMIDBCFy8CDCAP8eDEkYcIqL1g4cYiQx4odFA86YfEiSsaBM170+CiwiAsYWEgGkKECicoAOXRk/CFDZRIPDyIkyUjFRAQIElQYdFhDQoQHIppk/JAzQxCSHirIGPqyqtWrWLEaEACAq1cDDg8AGEsWwIGsaNOqdRiCQo2XHY5m+EEyy4wJECCEmPgxygkIESK0UMmEA4QHTATuuJGxx1uBMFoQeYlkhYwqL2u0oEs4ImaVOlzgeHmFY2KVQFgYqfo5Y0AAIfkEBQQAAQAsGAAFABcAKgAACOUAAwgcSDDAlYIIEw5kMsSJwocCrwgBQgXiQyZAmFhUWAXIkIMbERIZojFkwSdChmQxWfDIjygsCyZJ8rAIj5gDm6TQwKFJTCsxOmzwUIMlFh8eOmho8SRmig0bSCDBGeCEiB1Us2rdyrWryQYHDIQd28DkAwNo0xp44LWt27dtLShYgSUrhbAPsFJVkQDthZIxn3wQe4BEXZxHKKA98pDFiYc2VEAUseHmRiI0CfrQIGLKxokIS2yQsfHHEIRFOGxoCjEIkIQqNjyG6DGhlA0cTj8EndDGhh4QTT98clih662YtwYEACH5BAUEAAEALBgABQAXACoAAAjfAAMIHEgwwJaCCBMOzMIli8KHArdw0cIF4sOGFS0mnMjloEaEDB1+LEhR4siCGE8WlKhFoRMiGVVC2aHiBRSVWHy8aPECiEokL16o4DFFpQ4WLmg4USkQhwwiTKNKnUq16lQMER5k3YphZAYIELSCfZDBqtmzaNMKbFCgxNQFAgAgqCF1BAEAABwkieoEAwABAjZIFbIAr5CHIjp4RBiDBEQKEGZ8nGGjYI0HFKJodNEC4VcTGmsi/BEBAhOLLVgkDBGBg8UVLxI+iRChB0TOClc8oAFRtMLTEFNTpUw1IAAh+QQFBAABACwNAA0AIgAiAAAI5QADCBxIsKDBgwGoPEHIsOHAKkx+DKnisCLBLEyGABHSxKLHKEGG/GBixaPFJBuNUDRpEckRJyxjypxJs6bNmzhvkuiggYMGnhxI5CyxoajRDSVyKl3KtKlTphYUrHhK4YCBBzucqkhgwMAFJk2ffDBw4IDQpkcodD1SEMsSJBUvUGBoQ4VBKECKVFRgwK7HLSFhEiSRlGALAwoWWmQixMiWgkXbPjDgwWIVIj+uGOxpcIdVuA6VAFlyMLLBCwbmNqwiseTmDgeblLXR8EmQjqU3IBxhIIXDlQc5H8QCmqZpp4RrBgQAIfkEBQQAAQAsDQANACIAIgAACOAAAwgcSLCgwYMBuGxByLDhwCxcIGZxSJEgFy0KL1asKDFixI0VL2YEuVEiyZMoU6pcybKly5YzXqh4sULmixkva7RowcLFThY1XgodSrSoUaIhKNSYWLRDhAcZfhidMQEChBBOikY5ASFChBZMhzLhAOEBE4M7cFB0sIBhj6AFjbCIQbEAgBEgs7x4QaQghgwFSwAokLWiDxc0DEaAYPAAgAsVoch8YvBBBIM1BAAYQlFHix0Hyx50AKBtQyczpxy0fFCJAAF0GRJpAQThYoQaAJBwCIUha4ScV4o++ndlQAAh+QQFBAABACwFABgAKgAXAAAI5gADCBxIsKDBgwWJDPkxBMjCIUQQSpxoEAmQIECEXASChKLHjyBDihxJsqTJkyhHbnlSJAlKFSJ6eLyi8McSlCc4aChRBOGVJRmHQMmCUguPEBs2qIhSkElDIky2pBw4ZcaGDhtwDLyCUcmVqQadnEjqZKCTKhJVnPB4gYLEIT5A9tggwqMCAypSXvHQYUfBBg8KtjCg4AnKGBtIaClowIDBBwY8nGziQYNLxgcM7jhgoGPJsSwONj54wYBbkkc0fDBs0EBmg00OHLBBkseGGghHHxxhIEXJJhJdS/QMdqDu4h4BnwwIACH5BAUFAAEALAUAGAAqABcAAAjlAAMIHEiwoMGDBbNwUchwIcKHEA1y2cJFy8SKXCJq3Mixo8ePIEOKHEkSZJEYOUjqgHFE45MZL1TsIHnjxQobTBBW2cHCBQwjJbcQidGihQ4rBX/YfNEjS8mBVX6weMFCyMAoLVjoiPLU4BQcWacMHOIE4ZUQHjSK6PCQCRKnGmk8oKCRAoQZJatIiCCjoAEEBWvM5TrSRIQMBgEASJgBgomRSSQ8GJJYgMEfESDkDOkBgoiDig+GiMAh5I8HEpqAtmzwSYQIPUDKgKACYeiDKx7QCJnkIQDWBrNs7jrwNnGNf0cGBAAh+QQFBAABACwDABgAKgAXAAAI5gCT/BgCZMhAIEkCKFzIsKHDhw2NBAEiBMhEIUYgatzIsaPHjyBDihxJsqTJkygVauEhIsXJJUSgdExCooMGFSePEEwiBeITFhs2gOiR8gkRi0mwNKzxQYMHGFdSKrzipCCQJwudBD3hRGpDLEkmKlW444hGCxU6sjjBBWKUKB9XGFDQUcQGHiinJDiAomGDBw19aBAx5WQHAw6yNDRgwGGJDTJMEkFgwIdDAwccFuGwAStJCgYwPGT8UMWGEyR1GECQ8HJmh1I2cBgy8oSBERBJP7SxgehIIhoxa/TsVaHu4hz/kgwIACH5BAUEAAEALAMAGAAqABcAAAjfAG2oeLHixcAVNgIoXMiwocOHDWm0YOGixUQXNCBq3Mixo8ePIEOKHEmypMmTKBfSoPDhJJctXLRwHIIhwoMQJ7Nw0ZkFohMRDyJMoIHFpZaXMbk0RCHhgYQSVVIq5LlTqUIlEB54UCK1IdKjC2X80NiAQccdNzTq/EgCQIGOMFoQQRmFgIARDTFkaIhkhYyoJi0AOOAwAgSHNVqMLQlkAAAcDoM6ZPKCBeCRCwA8eJj1oQ4XkEfSADDAyEPJDq+weMFk5AgAGiAahgiEhemRQDSiflilZ1eFnX931EsyIAAh+QQFBAABACwDAA0AIgAiAAAI4wADCHwiRaDBgwgTKjyY5ccQJFkWSpxo0AkQIUGaYKHIMWEWJEOAFHHSsaRBKkiABEFi0iSWKEOYtJxJs6bNmzhz6uxYQgMHDR18aiixk8SGo0g3kNjJtKnTp1CjelShwMJTHw0OGLDKdAkGAwYSrGgqAoEBBBumNC0ClkIRqCd0SLRQgSOTIzNXGFDAkUiQJyanJDiAAiEJogejiLxSsoMBBwmPJkzZpCMRsz4S+kwoJWREihQMYFAoOWESIUko6jibWnMHhVmADIky8YSBEQtLJ7QIeCIRiZsXfrap++lhigEBACH5BAUEAAEALAMADQAiACIAAAjgAAMINNJEoMGDCBMqPFhFxYsbVRZKnChQC5AWLlr8uEKxY8IrOV6skDHEo0mDTWq0aIHjpEskL3a4nEmzps2bOHPq9JjhQQSfQDPszADBJ4SiEYTuXMq0qdOnUBOSKMDAKQ4DAgA0YIrkAQAABEgw1TAAwAALUZgC+boAyNMRNCSG8NCRS5aZNB5Q6LiFi5aTVSREkIFwhg2Edu2aNJH078GMCLVw6esxiYQHJRE6TJglcUcPEEQobMFCoeQtFH88kFAw4YoXChPflSgDgoqFkGNLpphE4uaFXHCSjmqYYkAAIfkEBQQAAQAsAwAFABcAKgAACOUAAwgcSDAAloIIEw6M8uOJwocDpQQBchDiQyRDkFh8iCVIECobFToBkqRiSIJYiACBchKhkyFDHmbpQUThFiRLHj7RwMGEw5YDbXTYsEFGFaACpaTgoEHEDqQCj5QgegKqQB8hWFjdyrWr164PDBwQS/bBSQcG0qo14OCr27dw4yZUocACVB8NxtptuQRD2gQrgIpAYADBhilAi6SlUMTqCR0KsaioarXHBhFWr3jo8JQgkSQbY2wggVAIEItNPGgAXfBHTIgnNmhFOBHiEQ0ffhYE8lohjw01FJpG/dA119pbPwcEACH5BAUFAAEALAMABQAXACoAAAjkAAMIHEgwwBQtBRMqFIhEhZCFEAc2adHCSsSIN17kuAhxCsUmHBf+WGEjpMIrMVocMZlwyIsXEWn4gIhDB0QmDyJsYMKS4IoIQE1I6SnwCYgIDyjI2EI0AJAMECB4aCqwxgQRVLNq3cp1KwIAAsCKRWDyAICzaAEc6Mq2rdu3CbXQoPCh6RAMSEP0dCIi5wQaPVFIeCChRJWeSiA88KCEqowfEHfgyGqERQyqWV4SKZiFC0cfLmgwJchlNEQoL1Q8Sdj5oo4WOxRyQQjRiYoXUxS2hkikBZCFpS9Cgbib6mytnQMCACH5BAUEAAEALAMABQAQACgAAAjDAAMIHEgwixOCCBH60IAjoUMiGzpEcZjQRIcUFBE62bDhSEaCMzSU+DiwSogNPUgK3MEhxMAUDR1qOaFCIBIDByYgIZllxAGcHqCQbGLhpwIUKnk8MGCAgsorLRJcUEm1qtWrVpf+3GrggUMHTMMydYC1rNmzaHmIwPgxCYkOGmpSfMKCI4geWSjW+KDBA4wrGTduOHGQ5A6PFJfsVAkFSBGVW4IMKfyRiRAjKqsQ+QGYpBIgSzL/GGJF5ZMgTapWIRgQACH5BAUEAAEALAMABQAQACgAAAjAAAMIHEgwAJOCCAfWeNAiIUIfECI4cVhwQwQQFAkyiQABSMaBJx5k+ChQygQINUgGkBFhwkASMhxm8RBC4BAAAhYMIalhAM4LTz4qcSAAQIERJG0cAACAgcoSBByonEq1qtWMGR5E0Mp1JMIMELRCCBvB69WzaNNO3VIkRo6PT2a8ULGDYpUdLFzAMELxx4sVL3pkoRilBQsdUUgOmZgwC5fBJLlo4RLZMeSMk7dQzmh5c0Yumis/JqlZy9TLAQICACH5BAUEAAEALAMAAwAXACIAAAi+AAMIHEiwoEEkRgwqXPhjyMKBR7IsDALkYQAVBkgsBOLwIQ4DB5goFFLR4oQDFhQ2tBjgyAEDPAxSZBngg4EHVwpypAklgYEVBRHSDIDiQAKLKXA8pJByIRKQE5AMNTji5QEPUKYSbGLhpQIUWgnyeGDAAIWwBFskuIC2rdu3cONaLKGBg4YOdTWUmEpig9+/GzTKHUy4sGGWT4okaXuFyJAfS8JeWQJEyJCsWpkMAUKEyRbJFJXkbOukStuAAAAh+QQFBAABACwDAAMAFwAiAAAItQADCBxIsKDBGjQMKlyo4sXCgUIetmDxMAAJABsWrnD4UAaAAUkUumhRMcACAQ4UNiwpRAAAGwYnlgyAAQACgxtnPiEAoERBhDMDjBBAoCINHw8ZNHjI5EGEDUyCFtSyIoJVE1KkEnwCIsIDCjK0EgSSAQIED2IHYqkxQUTat3Djyp1b0UbDjXdhBqUxcWTfhHQDCx5MuCIXLVy2vOWShTEXsVsOJz6stbHlx1ojI1b8tvHbgAAAIfkEBQQAAQAsAwADABcAFwAACJQAAwgcSLCgwRIkDCpcqIHDwoFHHm7Y8DCACgMJFWroUBGHgQNMFE6sGGDCAQsaHVY8csAAD4MjSX4w8MDgRpIBoCQwsKIgQpwBUBxIULEHkYcUUC580tDEE6AGbXSYKKMKVIJSUnDQIGIHl6sQS0w8AZagjxAsyqpdy7at24pJfgwBMkQukCRQjQQBIgTIXiFGoAYEACH5BAUFAAEALAMAAwAXABcAAAiVAAMIHEiwoMEMGQwqXPggwsKBTLQshPDgYYAaD1owdPjQB4QIThRGgGAxwIYIIBQ2LMlkJBCDFEsGOPEgA5aCK0tKmQChRkGEMgPIiDDhoRYjTR56CPGwiooXN6oENQikhYsWP65MJXglx4sVMoZsJdikRosWOMYSRPJih9q3cOPKnWuRSxa7eO9O3cJFCxe+frdMDQgAIfkEBQUAAQAsBQADACAAEAAACKYAAwgcSLAgwQcODCpcyNDAAYYQAzhpaIDhFYY+NOBY6HAhkyETFRLZ0CGKQgMVDV4RAoQKQxMdUpx8aJAJECYQnWzYcMQgSoNVgAy5CHGGhhI+aRIkMgRnxCohNvQoiLDgEyFDskQUuINDiK1Hfpgc+ETKQi0nVGxNkkSrwCw/hiBxu7XuFidAhARpgqWu3yxIhgApEtLvVipIgARBYthvlKaNFQYEADs=";
-function Sn(t) {
+const Sn = "data:image/gif;base64,R0lGODlhMgAyAPcBAAAAAAD/AAMDAwcHBxERERUVFSoqKi0tLTAwMDg4OD09PURERElJSUtLS1BQUFJSUlVVVVdXV1paWl9fX2NjY2ZmZmlpaWxsbG1tbXNzc3t7e39/f4GBgYKCgoSEhIaGhoeHh4iIiIuLi5KSkpSUlJaWlp2dnaGhoaOjo6SkpKWlpaenp6ioqKqqqqurq6ysrLCwsLGxsbS0tLa2tri4uLm5ub29vb6+vsDAwMHBwcLCwsXFxcjIyMnJyc3Nzc7OztPT09TU1NXV1dfX19nZ2dra2tvb29zc3N7e3uDg4OHh4eLi4uPj4+fn5+np6ezs7O7u7vDw8PHx8fLy8vPz8/X19fb29vj4+Pn5+fz8/P39/f7+/v///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////yH/C05FVFNDQVBFMi4wAwEAAAAh+QQFBAABACwAAAAAMgAyAIcAAAAA/wADAwMHBwcREREVFRUqKiotLS0wMDA4ODg9PT1ERERJSUlLS0tQUFBSUlJVVVVXV1daWlpfX19jY2NmZmZpaWlsbGxtbW1zc3N7e3t/f3+BgYGCgoKEhISGhoaHh4eIiIiLi4uSkpKUlJSWlpadnZ2hoaGjo6OkpKSlpaWnp6eoqKiqqqqrq6usrKywsLCxsbG0tLS2tra4uLi5ubm9vb2+vr7AwMDBwcHCwsLFxcXIyMjJycnNzc3Ozs7T09PU1NTV1dXX19fZ2dna2trb29vc3Nze3t7g4ODh4eHi4uLj4+Pn5+fp6ens7Ozu7u7w8PDx8fHy8vLz8/P19fX29vb4+Pj5+fn8/Pz9/f3+/v7///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////8I/wCzcBFIcKDBgggPKkzIcCEXLlq4bIEokeLEiBcrYrTIcaNHjRobinQ4sqRCkBlTdtR44MBKlR9TmjQJQMBMkgZfdpwSMSYAACgpRtHpcSYSFUIa1mz448UQnAWDfmzSooUVmD9XVnnBwglMlDdvvMjhcOlCHit23CSqcUrVJiizpnTC4sXQmB1vZvmxwgYWhWYLznjRA+rJryqvxGhxxGNLjkVcwMCCN6ZeLkNevDCcRYYKJJfZptyCQwdiijl0CDxdlLPryw2lymY9WzTs17ijVq69mzbM28Bd8x7u23bu46F7i16uXEvw5ziJM5duGbl1k9OLN5cKvfvh7OC3b0jxTv6h+PDUy3unzl67RPXXc56fnz4+/PbofcOHnr9/5f3x4UeffvYVqJuACP5m4IIJ+gfWgusN6KCCAN7WoITVVXjchBxqERAAIfkEBQQAAQAsDQADACAAEAAACKcAAwgcSDDAAwcFEypcSNDAAYYQA2DZstCAAYZOKCqM8uNJxYcKa3DYsVBKECBYFFpU+MTDhiIMkQxBohJkwRYaUkDEEiQIlYQrCyLZ0MFJRCdAkgC1OZBEBxgRJRIBAqXgwYI8NoCwEjWAkyFDoorQ4KOrQCRLoqbQuZCKR7NdqzD5MaQKXIhZmAwBIqTJ3YVYogQZ8oMJ178Kk/A1YhfxQiRHjBYMCAAh+QQFBQABACwNAAMAIAAQAAAInQADCBxIMECGDAUTKlxI8EEEhhADcGEI4QFDJQy5ZJmo0OFCFBFkLNzCRQvHghEgKHQi4cEPhhuzdHyYUMQDDxC5kNSSsGLCIA4x5oxZ0GNBDBFKRAxgkmTBgwVpRJhAZWkAohErPKhhVaLJpR8+YFnohEjXrlB2qHgB5SxELD5etHgBxC1DJC9eqOAxxe5CHSxc0HDilyEOGWYLBgQAIfkEBQQAAQAsGAADABcAFwAACJYAS5AIQLCgwYMINXBAyLDhhg0NtxRpWFBDh4YiDpygGOAhwyUIDOTgqJAhBgMVOHaEeLCHgQMTSV40uKXBAZYcBR5UYSBBFJUNFRhoAbShhZQNi/DYUvRgkxQKmzQlaCVGhw0eakwN4MNDBw0tnmxN8ZAEkq0ET4jYgbat27dw474lMuTHECB1hxBpigRIECBC/AJBEhAAIfkEBQQAAQAsGAADABcAFwAACJIAa9AIQLCgwYMIVbxAyLBhCxYNAwCJSHDFQoYaBIyg6KIFQyQDAMigqJAhBAAMKAZ4iPAGAAETKVpEaECABZUBBB4kAYAAFJwMCwAoAZQhg5QNf4wsajCJhwcRkjANQMVEBAgSVDC9UkNChAcimkz9ADVDkKkEPVRYirat27dw47ad8UKhRYUzitZo8bDjwxoBAQAh+QQFBAABACwYAAMAFwAiAAAIvwCRGAlAsKDBgwh/DEHIsGEQIA0DFIlIEMhChiIOnKAoBCLCJQgM5KCokCEGAxUoBniIsIeBAxMpWkTY4MAGlQEEHlRhIEEUnAwVGGgBlKGFlA1zbCxqkEiFl0SYBojS4YABBCO2MG2RwCqGJFKfGnDQQyrBCgpQaDXLtq3bt3DZkuiggYMGuhxIFC2xoa/fDSXiCh5MuDDBJUSgZGl7ZAiQJFLYbnlCBEiQJFjYXnFiEciTtliSPMzcNspPggEBACH5BAUEAAEALBgAAwAXACIAAAi6ALlsCUCwoMGDCLNwQciwIRctDpU0LKiwIYoIMiYGEMjQiYQHPzRWRCjigQeNGyEeDPIggkSRCw1ywRChBMqNAw3SiDCByk2GFR7U+Mnww4eJMkYQPQiEAQABQJYGgGJBAIABGqSWIGAVghGpTgEcuCGVIIMCSsuqXcu2rdu1NFvKjYCBaAYIEFrifZDhrd+/gAMT1AHjCNsbL1bYYLKWSIwWLXRYUVvlB4sXLISsnYKjBYspbJkgKRgQACH5BAUEAAEALB8ABQAQACgAAAjDAAMIDOBkoMGDAmtw2IEQ4RMPG4o0PNhCQ4qJBpFs6FAQo0ASHWB4FMhjAwgrIwOI0OAjZYAUKbJMzHEiJZEKBg4QwRilwwEDCEZgbJHgJ4YkGHEacNBjZAUFKFxKnUq1qlWBDX5qzdmg4QMDYMMaeHC1rNmzA1WIaJryBAcNJSR61MIjxIYNKqKMnDJj4wYcKZ2cuNuRyRGMQ3xgEUgkyBOXUYAUuZIyCxIgTVxKGQJEZsokQpBWBjJEb2Agj116xhgQACH5BAUFAAEALB8ABQAQACgAAAjFAAMIDBCFy8CDCAP8eDEkYcIqL1g4cYiQx4odFA86YfEiSsaBM170+CiwiAsYWEgGkKECicoAOXRk/CFDZRIPDyIkyUjFRAQIElQYdFhDQoQHIppk/JAzQxCSHirIGPqyqtWrWLEaEACAq1cDDg8AGEsWwIGsaNOqdRiCQo2XHY5m+EEyy4wJECCEmPgxygkIESK0UMmEA4QHTATuuJGxx1uBMFoQeYlkhYwqL2u0oEs4ImaVOlzgeHmFY2KVQFgYqfo5Y0AAIfkEBQQAAQAsGAAFABcAKgAACOUAAwgcSDDAlYIIEw5kMsSJwocCrwgBQgXiQyZAmFhUWAXIkIMbERIZojFkwSdChmQxWfDIjygsCyZJ8rAIj5gDm6TQwKFJTCsxOmzwUIMlFh8eOmho8SRmig0bSCDBGeCEiB1Us2rdyrWryQYHDIQd28DkAwNo0xp44LWt27dtLShYgSUrhbAPsFJVkQDthZIxn3wQe4BEXZxHKKA98pDFiYc2VEAUseHmRiI0CfrQIGLKxokIS2yQsfHHEIRFOGxoCjEIkIQqNjyG6DGhlA0cTj8EndDGhh4QTT98clih662YtwYEACH5BAUEAAEALBgABQAXACoAAAjfAAMIHEgwwJaCCBMOzMIli8KHArdw0cIF4sOGFS0mnMjloEaEDB1+LEhR4siCGE8WlKhFoRMiGVVC2aHiBRSVWHy8aPECiEokL16o4DFFpQ4WLmg4USkQhwwiTKNKnUq16lQMER5k3YphZAYIELSCfZDBqtmzaNMKbFCgxNQFAgAgqCF1BAEAABwkieoEAwABAjZIFbIAr5CHIjp4RBiDBEQKEGZ8nGGjYI0HFKJodNEC4VcTGmsi/BEBAhOLLVgkDBGBg8UVLxI+iRChB0TOClc8oAFRtMLTEFNTpUw1IAAh+QQFBAABACwNAA0AIgAiAAAI5QADCBxIsKDBgwGoPEHIsOHAKkx+DKnisCLBLEyGABHSxKLHKEGG/GBixaPFJBuNUDRpEckRJyxjypxJs6bNmzhvkuiggYMGnhxI5CyxoajRDSVyKl3KtKlTphYUrHhK4YCBBzucqkhgwMAFJk2ffDBw4IDQpkcodD1SEMsSJBUvUGBoQ4VBKECKVFRgwK7HLSFhEiSRlGALAwoWWmQixMiWgkXbPjDgwWIVIj+uGOxpcIdVuA6VAFlyMLLBCwbmNqwiseTmDgeblLXR8EmQjqU3IBxhIIXDlQc5H8QCmqZpp4RrBgQAIfkEBQQAAQAsDQANACIAIgAACOAAAwgcSLCgwYMBuGxByLDhwCxcIGZxSJEgFy0KL1asKDFixI0VL2YEuVEiyZMoU6pcybKly5YzXqh4sULmixkva7RowcLFThY1XgodSrSoUaIhKNSYWLRDhAcZfhidMQEChBBOikY5ASFChBZMhzLhAOEBE4M7cFB0sIBhj6AFjbCIQbEAgBEgs7x4QaQghgwFSwAokLWiDxc0DEaAYPAAgAsVoch8YvBBBIM1BAAYQlFHix0Hyx50AKBtQyczpxy0fFCJAAF0GRJpAQThYoQaAJBwCIUha4ScV4o++ndlQAAh+QQFBAABACwFABgAKgAXAAAI5gADCBxIsKDBgwWJDPkxBMjCIUQQSpxoEAmQIECEXASChKLHjyBDihxJsqTJkyhHbnlSJAlKFSJ6eLyi8McSlCc4aChRBOGVJRmHQMmCUguPEBs2qIhSkElDIky2pBw4ZcaGDhtwDLyCUcmVqQadnEjqZKCTKhJVnPB4gYLEIT5A9tggwqMCAypSXvHQYUfBBg8KtjCg4AnKGBtIaClowIDBBwY8nGziQYNLxgcM7jhgoGPJsSwONj54wYBbkkc0fDBs0EBmg00OHLBBkseGGghHHxxhIEXJJhJdS/QMdqDu4h4BnwwIACH5BAUFAAEALAUAGAAqABcAAAjlAAMIHEiwoMGDBbNwUchwIcKHEA1y2cJFy8SKXCJq3Mixo8ePIEOKHEkSZJEYOUjqgHFE45MZL1TsIHnjxQobTBBW2cHCBQwjJbcQidGihQ4rBX/YfNEjS8mBVX6weMFCyMAoLVjoiPLU4BQcWacMHOIE4ZUQHjSK6PCQCRKnGmk8oKCRAoQZJatIiCCjoAEEBWvM5TrSRIQMBgEASJgBgomRSSQ8GJJYgMEfESDkDOkBgoiDig+GiMAh5I8HEpqAtmzwSYQIPUDKgKACYeiDKx7QCJnkIQDWBrNs7jrwNnGNf0cGBAAh+QQFBAABACwDABgAKgAXAAAI5gCT/BgCZMhAIEkCKFzIsKHDhw2NBAEiBMhEIUYgatzIsaPHjyBDihxJsqTJkygVauEhIsXJJUSgdExCooMGFSePEEwiBeITFhs2gOiR8gkRi0mwNKzxQYMHGFdSKrzipCCQJwudBD3hRGpDLEkmKlW444hGCxU6sjjBBWKUKB9XGFDQUcQGHiinJDiAomGDBw19aBAx5WQHAw6yNDRgwGGJDTJMEkFgwIdDAwccFuGwAStJCgYwPGT8UMWGEyR1GECQ8HJmh1I2cBgy8oSBERBJP7SxgehIIhoxa/TsVaHu4hz/kgwIACH5BAUEAAEALAMAGAAqABcAAAjfAG2oeLHixcAVNgIoXMiwocOHDWm0YOGixUQXNCBq3Mixo8ePIEOKHEmypMmTKBfSoPDhJJctXLRwHIIhwoMQJ7Nw0ZkFohMRDyJMoIHFpZaXMbk0RCHhgYQSVVIq5LlTqUIlEB54UCK1IdKjC2X80NiAQccdNzTq/EgCQIGOMFoQQRmFgIARDTFkaIhkhYyoJi0AOOAwAgSHNVqMLQlkAAAcDoM6ZPKCBeCRCwA8eJj1oQ4XkEfSADDAyEPJDq+weMFk5AgAGiAahgiEhemRQDSiflilZ1eFnX931EsyIAAh+QQFBAABACwDAA0AIgAiAAAI4wADCHwiRaDBgwgTKjyY5ccQJFkWSpxo0AkQIUGaYKHIMWEWJEOAFHHSsaRBKkiABEFi0iSWKEOYtJxJs6bNmzhz6uxYQgMHDR18aiixk8SGo0g3kNjJtKnTp1CjelShwMJTHw0OGLDKdAkGAwYSrGgqAoEBBBumNC0ClkIRqCd0SLRQgSOTIzNXGFDAkUiQJyanJDiAAiEJogejiLxSsoMBBwmPJkzZpCMRsz4S+kwoJWREihQMYFAoOWESIUko6jibWnMHhVmADIky8YSBEQtLJ7QIeCIRiZsXfrap++lhigEBACH5BAUEAAEALAMADQAiACIAAAjgAAMINNJEoMGDCBMqPFhFxYsbVRZKnChQC5AWLlr8uEKxY8IrOV6skDHEo0mDTWq0aIHjpEskL3a4nEmzps2bOHPq9JjhQQSfQDPszADBJ4SiEYTuXMq0qdOnUBOSKMDAKQ4DAgA0YIrkAQAABEgw1TAAwAALUZgC+boAyNMRNCSG8NCRS5aZNB5Q6LiFi5aTVSREkIFwhg2Edu2aNJH078GMCLVw6esxiYQHJRE6TJglcUcPEEQobMFCoeQtFH88kFAw4YoXChPflSgDgoqFkGNLpphE4uaFXHCSjmqYYkAAIfkEBQQAAQAsAwAFABcAKgAACOUAAwgcSDAAloIIEw6M8uOJwocDpQQBchDiQyRDkFh8iCVIECobFToBkqRiSIJYiACBchKhkyFDHmbpQUThFiRLHj7RwMGEw5YDbXTYsEFGFaACpaTgoEHEDqQCj5QgegKqQB8hWFjdyrWr164PDBwQS/bBSQcG0qo14OCr27dw4yZUocACVB8NxtptuQRD2gQrgIpAYADBhilAi6SlUMTqCR0KsaioarXHBhFWr3jo8JQgkSQbY2wggVAIEItNPGgAXfBHTIgnNmhFOBHiEQ0ffhYE8lohjw01FJpG/dA119pbPwcEACH5BAUFAAEALAMABQAXACoAAAjkAAMIHEgwwBQtBRMqFIhEhZCFEAc2adHCSsSIN17kuAhxCsUmHBf+WGEjpMIrMVocMZlwyIsXEWn4gIhDB0QmDyJsYMKS4IoIQE1I6SnwCYgIDyjI2EI0AJAMECB4aCqwxgQRVLNq3cp1KwIAAsCKRWDyAICzaAEc6Mq2rdu3CbXQoPCh6RAMSEP0dCIi5wQaPVFIeCChRJWeSiA88KCEqowfEHfgyGqERQyqWV4SKZiFC0cfLmgwJchlNEQoL1Q8Sdj5oo4WOxRyQQjRiYoXUxS2hkikBZCFpS9Cgbib6mytnQMCACH5BAUEAAEALAMABQAQACgAAAjDAAMIHEgwixOCCBH60IAjoUMiGzpEcZjQRIcUFBE62bDhSEaCMzSU+DiwSogNPUgK3MEhxMAUDR1qOaFCIBIDByYgIZllxAGcHqCQbGLhpwIUKnk8MGCAgsorLRJcUEm1qtWrVpf+3GrggUMHTMMydYC1rNmzaHmIwPgxCYkOGmpSfMKCI4geWSjW+KDBA4wrGTduOHGQ5A6PFJfsVAkFSBGVW4IMKfyRiRAjKqsQ+QGYpBIgSzL/GGJF5ZMgTapWIRgQACH5BAUEAAEALAMABQAQACgAAAjAAAMIHEgwAJOCCAfWeNAiIUIfECI4cVhwQwQQFAkyiQABSMaBJx5k+ChQygQINUgGkBFhwkASMhxm8RBC4BAAAhYMIalhAM4LTz4qcSAAQIERJG0cAACAgcoSBByonEq1qtWMGR5E0Mp1JMIMELRCCBvB69WzaNNO3VIkRo6PT2a8ULGDYpUdLFzAMELxx4sVL3pkoRilBQsdUUgOmZgwC5fBJLlo4RLZMeSMk7dQzmh5c0Yumis/JqlZy9TLAQICACH5BAUEAAEALAMAAwAXACIAAAi+AAMIHEiwoEEkRgwqXPhjyMKBR7IsDALkYQAVBkgsBOLwIQ4DB5goFFLR4oQDFhQ2tBjgyAEDPAxSZBngg4EHVwpypAklgYEVBRHSDIDiQAKLKXA8pJByIRKQE5AMNTji5QEPUKYSbGLhpQIUWgnyeGDAAIWwBFskuIC2rdu3cONaLKGBg4YOdTWUmEpig9+/GzTKHUy4sGGWT4okaXuFyJAfS8JeWQJEyJCsWpkMAUKEyRbJFJXkbOukStuAAAAh+QQFBAABACwDAAMAFwAiAAAItQADCBxIsKDBGjQMKlyo4sXCgUIetmDxMAAJABsWrnD4UAaAAUkUumhRMcACAQ4UNiwpRAAAGwYnlgyAAQACgxtnPiEAoERBhDMDjBBAoCINHw8ZNHjI5EGEDUyCFtSyIoJVE1KkEnwCIsIDCjK0EgSSAQIED2IHYqkxQUTat3Djyp1b0UbDjXdhBqUxcWTfhHQDCx5MuCIXLVy2vOWShTEXsVsOJz6stbHlx1ojI1b8tvHbgAAAIfkEBQQAAQAsAwADABcAFwAACJQAAwgcSLCgwRIkDCpcqIHDwoFHHm7Y8DCACgMJFWroUBGHgQNMFE6sGGDCAQsaHVY8csAAD4MjSX4w8MDgRpIBoCQwsKIgQpwBUBxIULEHkYcUUC580tDEE6AGbXSYKKMKVIJSUnDQIGIHl6sQS0w8AZagjxAsyqpdy7at24pJfgwBMkQukCRQjQQBIgTIXiFGoAYEACH5BAUFAAEALAMAAwAXABcAAAiVAAMIHEiwoMEMGQwqXPggwsKBTLQshPDgYYAaD1owdPjQB4QIThRGgGAxwIYIIBQ2LMlkJBCDFEsGOPEgA5aCK0tKmQChRkGEMgPIiDDhoRYjTR56CPGwiooXN6oENQikhYsWP65MJXglx4sVMoZsJdikRosWOMYSRPJih9q3cOPKnWuRSxa7eO9O3cJFCxe+frdMDQgAIfkEBQUAAQAsBQADACAAEAAACKYAAwgcSLAgwQcODCpcyNDAAYYQAzhpaIDhFYY+NOBY6HAhkyETFRLZ0CGKQgMVDV4RAoQKQxMdUpx8aJAJECYQnWzYcMQgSoNVgAy5CHGGhhI+aRIkMgRnxCohNvQoiLDgEyFDskQUuINDiK1Hfpgc+ETKQi0nVGxNkkSrwCw/hiBxu7XuFidAhARpgqWu3yxIhgApEtLvVipIgARBYthvlKaNFQYEADs=";
+function On(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), Z(e.src, r = On) || _(e, "src", r), _(e, "alt", "spinner");
+      e = k("img"), Z(e.src, r = Sn) || _(e, "src", r), _(e, "alt", "spinner");
     },
     m(n, i) {
       p(n, e, i);
@@ -925,7 +929,7 @@ function Sn(t) {
 }
 class Ln extends U {
   constructor(e) {
-    super(), N(this, e, null, Sn, T, {});
+    super(), N(this, e, null, On, T, {});
   }
 }
 function xn(t) {
@@ -952,18 +956,181 @@ function Fn(t) {
     }
   };
 }
-class Ve extends U {
+class We extends U {
   constructor(e) {
     super(), N(this, e, null, Fn, T, {}, xn);
   }
 }
-var pe = /* @__PURE__ */ ((t) => (t.Started = "started", t.InProgress = "in_progress", t.Succeeded = "succeeded", t.Failed = "failed", t))(pe || {}), Te = /* @__PURE__ */ ((t) => (t[t.SetupIntentCreationFailed = 1] = "SetupIntentCreationFailed", t[t.PaymentMethodCreationFailed = 2] = "PaymentMethodCreationFailed", t[t.PaymentChargeFailed = 3] = "PaymentChargeFailed", t))(Te || {}), L = /* @__PURE__ */ ((t) => (t[t.ErrorSettingUpPurchase = 0] = "ErrorSettingUpPurchase", t[t.ErrorChargingPayment = 1] = "ErrorChargingPayment", t[t.UnknownError = 2] = "UnknownError", t[t.NetworkError = 3] = "NetworkError", t[t.StripeError = 4] = "StripeError", t[t.MissingEmailError = 5] = "MissingEmailError", t))(L || {});
-class K extends Error {
+var ee = /* @__PURE__ */ ((t) => (t[t.UnknownError = 0] = "UnknownError", t[t.UserCancelledError = 1] = "UserCancelledError", t[t.StoreProblemError = 2] = "StoreProblemError", t[t.PurchaseNotAllowedError = 3] = "PurchaseNotAllowedError", t[t.PurchaseInvalidError = 4] = "PurchaseInvalidError", t[t.ProductNotAvailableForPurchaseError = 5] = "ProductNotAvailableForPurchaseError", t[t.ProductAlreadyPurchasedError = 6] = "ProductAlreadyPurchasedError", t[t.ReceiptAlreadyInUseError = 7] = "ReceiptAlreadyInUseError", t[t.InvalidReceiptError = 8] = "InvalidReceiptError", t[t.MissingReceiptFileError = 9] = "MissingReceiptFileError", t[t.NetworkError = 10] = "NetworkError", t[t.InvalidCredentialsError = 11] = "InvalidCredentialsError", t[t.UnexpectedBackendResponseError = 12] = "UnexpectedBackendResponseError", t[t.InvalidAppUserIdError = 14] = "InvalidAppUserIdError", t[t.OperationAlreadyInProgressError = 15] = "OperationAlreadyInProgressError", t[t.UnknownBackendError = 16] = "UnknownBackendError", t[t.InvalidAppleSubscriptionKeyError = 17] = "InvalidAppleSubscriptionKeyError", t[t.IneligibleError = 18] = "IneligibleError", t[t.InsufficientPermissionsError = 19] = "InsufficientPermissionsError", t[t.PaymentPendingError = 20] = "PaymentPendingError", t[t.InvalidSubscriberAttributesError = 21] = "InvalidSubscriberAttributesError", t[t.LogOutWithAnonymousUserError = 22] = "LogOutWithAnonymousUserError", t[t.ConfigurationError = 23] = "ConfigurationError", t[t.UnsupportedError = 24] = "UnsupportedError", t[t.EmptySubscriberAttributesError = 25] = "EmptySubscriberAttributesError", t[t.CustomerInfoError = 28] = "CustomerInfoError", t[t.SignatureVerificationError = 36] = "SignatureVerificationError", t))(ee || {});
+class he {
+  static getPublicMessage(e) {
+    switch (e) {
+      case 0:
+        return "Unknown error.";
+      case 1:
+        return "Purchase was cancelled.";
+      case 2:
+        return "There was a problem with the store.";
+      case 3:
+        return "The device or user is not allowed to make the purchase.";
+      case 4:
+        return "One or more of the arguments provided are invalid.";
+      case 5:
+        return "The product is not available for purchase.";
+      case 6:
+        return "This product is already active for the user.";
+      case 7:
+        return "There is already another active subscriber using the same receipt.";
+      case 8:
+        return "The receipt is not valid.";
+      case 9:
+        return "The receipt is missing.";
+      case 10:
+        return "Error performing request.";
+      case 11:
+        return "There was a credentials issue. Check the underlying error for more details.";
+      case 12:
+        return "Received unexpected response from the backend.";
+      case 14:
+        return "The app user id is not valid.";
+      case 15:
+        return "The operation is already in progress.";
+      case 16:
+        return "There was an unknown backend error.";
+      case 17:
+        return "Apple Subscription Key is invalid or not present. In order to provide subscription offers, you must first generate a subscription key. Please see https://docs.revenuecat.com/docs/ios-subscription-offers for more info.";
+      case 18:
+        return "The User is ineligible for that action.";
+      case 19:
+        return "App does not have sufficient permissions to make purchases.";
+      case 20:
+        return "The payment is pending.";
+      case 21:
+        return "One or more of the attributes sent could not be saved.";
+      case 22:
+        return "Called logOut but the current user is anonymous.";
+      case 23:
+        return "There is an issue with your configuration. Check the underlying error for more details.";
+      case 24:
+        return "There was a problem with the operation. Looks like we doesn't support that yet. Check the underlying error for more details.";
+      case 25:
+        return "A request for subscriber attributes returned none.";
+      case 28:
+        return "There was a problem related to the customer info.";
+      case 36:
+        return "Request failed signature verification. Please see https://rev.cat/trusted-entitlements for more info.";
+    }
+  }
+  static getErrorCodeForBackendErrorCode(e) {
+    switch (e) {
+      case 7101:
+        return 2;
+      case 7102:
+        return 7;
+      case 7103:
+        return 8;
+      case 7107:
+      case 7224:
+      case 7225:
+        return 11;
+      case 7105:
+      case 7106:
+      case 7814:
+        return 4;
+      case 7772:
+        return 6;
+      case 7220:
+        return 14;
+      case 7229:
+        return 2;
+      case 7230:
+      case 7e3:
+        return 23;
+      case 7231:
+        return 2;
+      case 7232:
+        return 18;
+      case 7263:
+      case 7264:
+        return 21;
+      case 7104:
+      case 7234:
+      case 7226:
+      case 7110:
+        return 12;
+      case 7662:
+        return 24;
+    }
+  }
+  static convertCodeToBackendErrorCode(e) {
+    return e in Tt ? e : null;
+  }
+  static convertPurchaseFlowErrorCodeToErrorCode(e) {
+    switch (e) {
+      case O.ErrorSettingUpPurchase:
+        return 2;
+      case O.ErrorChargingPayment:
+        return 20;
+      case O.NetworkError:
+        return 10;
+      case O.MissingEmailError:
+        return 4;
+      case O.StripeError:
+        return 2;
+      case O.UnknownError:
+        return 0;
+      case O.AlreadySubscribedError:
+        return 6;
+    }
+  }
+}
+var Tt = /* @__PURE__ */ ((t) => (t[t.BackendInvalidPlatform = 7e3] = "BackendInvalidPlatform", t[t.BackendStoreProblem = 7101] = "BackendStoreProblem", t[t.BackendCannotTransferPurchase = 7102] = "BackendCannotTransferPurchase", t[t.BackendInvalidReceiptToken = 7103] = "BackendInvalidReceiptToken", t[t.BackendInvalidAppStoreSharedSecret = 7104] = "BackendInvalidAppStoreSharedSecret", t[t.BackendInvalidPaymentModeOrIntroPriceNotProvided = 7105] = "BackendInvalidPaymentModeOrIntroPriceNotProvided", t[t.BackendProductIdForGoogleReceiptNotProvided = 7106] = "BackendProductIdForGoogleReceiptNotProvided", t[t.BackendInvalidPlayStoreCredentials = 7107] = "BackendInvalidPlayStoreCredentials", t[t.BackendInternalServerError = 7110] = "BackendInternalServerError", t[t.BackendEmptyAppUserId = 7220] = "BackendEmptyAppUserId", t[t.BackendInvalidAuthToken = 7224] = "BackendInvalidAuthToken", t[t.BackendInvalidAPIKey = 7225] = "BackendInvalidAPIKey", t[t.BackendBadRequest = 7226] = "BackendBadRequest", t[t.BackendPlayStoreQuotaExceeded = 7229] = "BackendPlayStoreQuotaExceeded", t[t.BackendPlayStoreInvalidPackageName = 7230] = "BackendPlayStoreInvalidPackageName", t[t.BackendPlayStoreGenericError = 7231] = "BackendPlayStoreGenericError", t[t.BackendUserIneligibleForPromoOffer = 7232] = "BackendUserIneligibleForPromoOffer", t[t.BackendInvalidAppleSubscriptionKey = 7234] = "BackendInvalidAppleSubscriptionKey", t[t.BackendInvalidSubscriberAttributes = 7263] = "BackendInvalidSubscriberAttributes", t[t.BackendInvalidSubscriberAttributesBody = 7264] = "BackendInvalidSubscriberAttributesBody", t[t.BackendProductIDsMalformed = 7662] = "BackendProductIDsMalformed", t[t.BackendAlreadySubscribedError = 7772] = "BackendAlreadySubscribedError", t[t.BackendOfferNotFound = 7814] = "BackendOfferNotFound", t))(Tt || {});
+class X extends Error {
+  constructor(r, n, i) {
+    super(n);
+    Q(this, "toString", () => `PurchasesError(code: ${ee[this.errorCode]}, message: ${this.message})`);
+    this.errorCode = r, this.underlyingErrorMessage = i;
+  }
+  /** @internal */
+  static getForBackendError(r, n) {
+    const i = he.getErrorCodeForBackendErrorCode(r);
+    return new X(
+      i,
+      he.getPublicMessage(i),
+      n
+    );
+  }
+  /** @internal */
+  static getForPurchasesFlowError(r) {
+    return new X(
+      he.convertPurchaseFlowErrorCodeToErrorCode(
+        r.errorCode
+      ),
+      r.message,
+      r.underlyingErrorMessage
+    );
+  }
+}
+class Gn extends Error {
+  constructor() {
+    super("Purchases must be configured before calling getInstance");
+  }
+}
+var pe = /* @__PURE__ */ ((t) => (t.Started = "started", t.InProgress = "in_progress", t.Succeeded = "succeeded", t.Failed = "failed", t))(pe || {}), Te = /* @__PURE__ */ ((t) => (t[t.SetupIntentCreationFailed = 1] = "SetupIntentCreationFailed", t[t.PaymentMethodCreationFailed = 2] = "PaymentMethodCreationFailed", t[t.PaymentChargeFailed = 3] = "PaymentChargeFailed", t))(Te || {}), O = /* @__PURE__ */ ((t) => (t[t.ErrorSettingUpPurchase = 0] = "ErrorSettingUpPurchase", t[t.ErrorChargingPayment = 1] = "ErrorChargingPayment", t[t.UnknownError = 2] = "UnknownError", t[t.NetworkError = 3] = "NetworkError", t[t.StripeError = 4] = "StripeError", t[t.MissingEmailError = 5] = "MissingEmailError", t[t.AlreadySubscribedError = 6] = "AlreadySubscribedError", t))(O || {});
+class Y extends Error {
   constructor(e, r, n) {
     super(r), this.errorCode = e, this.underlyingErrorMessage = n;
   }
+  static fromPurchasesError(e, r) {
+    let n;
+    return e.errorCode === ee.ProductAlreadyPurchasedError ? n = 6 : n = r, new Y(
+      n,
+      e.message,
+      e.underlyingErrorMessage
+    );
+  }
 }
-class Gn {
+class Yn {
   constructor(e, r = 10) {
     Q(this, "operationSessionId", null);
     Q(this, "backend");
@@ -972,19 +1139,35 @@ class Gn {
     this.backend = e, this.maxNumberAttempts = r;
   }
   async startPurchase(e, r, n, i, o) {
-    const s = await this.backend.postSubscribe(
-      e,
-      r,
-      i,
-      o,
-      n == null ? void 0 : n.id
-    );
-    return this.operationSessionId = s.operation_session_id, s;
+    try {
+      const s = await this.backend.postSubscribe(
+        e,
+        r,
+        i,
+        o,
+        n == null ? void 0 : n.id
+      );
+      return this.operationSessionId = s.operation_session_id, s;
+    } catch (s) {
+      if (s instanceof X)
+        throw Y.fromPurchasesError(
+          s,
+          0
+          /* ErrorSettingUpPurchase */
+        );
+      {
+        const l = "Unknown error starting purchase: " + String(s);
+        throw G.errorLog(l), new Y(
+          2,
+          l
+        );
+      }
+    }
   }
   async pollCurrentPurchaseForCompletion() {
     const e = this.operationSessionId;
     if (!e)
-      throw new K(
+      throw new Y(
         0,
         "No purchase in progress"
       );
@@ -992,7 +1175,7 @@ class Gn {
       const i = (o = 1) => {
         if (o > this.maxNumberAttempts) {
           this.clearPurchaseInProgress(), n(
-            new K(
+            new Y(
               2,
               "Max attempts reached trying to get successful purchase status"
             )
@@ -1018,12 +1201,12 @@ class Gn {
               );
           }
         }).catch((s) => {
-          n(
-            new K(
-              3,
-              s.message
-            )
+          const l = Y.fromPurchasesError(
+            s,
+            3
+            /* NetworkError */
           );
+          n(l);
         });
       };
       i();
@@ -1035,7 +1218,7 @@ class Gn {
   handlePaymentError(e, r) {
     if (e == null) {
       r(
-        new K(
+        new Y(
           2,
           "Got an error status but error field is empty."
         )
@@ -1045,7 +1228,7 @@ class Gn {
     switch (e.code) {
       case Te.SetupIntentCreationFailed:
         r(
-          new K(
+          new Y(
             0,
             "Setup intent creation failed"
           )
@@ -1053,7 +1236,7 @@ class Gn {
         return;
       case Te.PaymentMethodCreationFailed:
         r(
-          new K(
+          new Y(
             0,
             "Payment method creation failed"
           )
@@ -1061,7 +1244,7 @@ class Gn {
         return;
       case Te.PaymentChargeFailed:
         r(
-          new K(
+          new Y(
             1,
             "Payment charge failed"
           )
@@ -1070,15 +1253,15 @@ class Gn {
     }
   }
 }
-const Yn = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23767676'/%3e%3cpath%20d='M87.6668%2041.504L82.4968%2036.334L62.0002%2056.8307L41.5035%2036.334L36.3335%2041.504L56.8302%2062.0006L36.3335%2082.4973L41.5035%2087.6673L62.0002%2067.1706L82.4968%2087.6673L87.6668%2082.4973L67.1702%2062.0006L87.6668%2041.504Z'%20fill='white'/%3e%3c/svg%3e";
-function Hn(t) {
+const Hn = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23767676'/%3e%3cpath%20d='M87.6668%2041.504L82.4968%2036.334L62.0002%2056.8307L41.5035%2036.334L36.3335%2041.504L56.8302%2062.0006L36.3335%2082.4973L41.5035%2087.6673L62.0002%2067.1706L82.4968%2087.6673L87.6668%2082.4973L67.1702%2062.0006L87.6668%2041.504Z'%20fill='white'/%3e%3c/svg%3e";
+function Kn(t) {
   x(t, "svelte-1609h93", "img.svelte-1609h93{width:124px;height:124px;margin:0 auto}");
 }
-function Kn(t) {
+function qn(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), Z(e.src, r = Yn) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon svelte-1609h93");
+      e = k("img"), Z(e.src, r = Hn) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon svelte-1609h93");
     },
     m(n, i) {
       p(n, e, i);
@@ -1091,15 +1274,15 @@ function Kn(t) {
     }
   };
 }
-class qn extends U {
+class jn extends U {
   constructor(e) {
-    super(), N(this, e, null, Kn, T, {}, Hn);
+    super(), N(this, e, null, qn, T, {}, Kn);
   }
 }
-function jn(t) {
+function Jn(t) {
   x(t, "svelte-1rmxk7q", "button.svelte-1rmxk7q{border:none;border-radius:56px;font-size:16px;cursor:pointer;height:56px;color:var(--rc-color-grey-text-dark);background-color:var(--rc-color-grey-ui-dark);display:flex;align-items:center;justify-content:center}button.intent-primary.svelte-1rmxk7q{background-color:var(--rc-color-grey-text-dark);color:var(--rc-color-white);font-size:16px}button.svelte-1rmxk7q:disabled{color:var(--rc-color-grey-text-light)}button.intent-primary.svelte-1rmxk7q:disabled{color:var(--rc-color-grey-text-light)}");
 }
-function Jn(t) {
+function Vn(t) {
   let e, r, n, i, o;
   const s = (
     /*#slots*/
@@ -1161,10 +1344,10 @@ function Jn(t) {
     }
   };
 }
-function Vn(t, e, r) {
+function Wn(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { intent: o = "primary" } = e, { disabled: s = !1 } = e;
   function l(c) {
-    Mt.call(this, t, c);
+    Ct.call(this, t, c);
   }
   return t.$$set = (c) => {
     "intent" in c && r(0, o = c.intent), "disabled" in c && r(1, s = c.disabled), "$$scope" in c && r(2, i = c.$$scope);
@@ -1172,13 +1355,13 @@ function Vn(t, e, r) {
 }
 class Ie extends U {
   constructor(e) {
-    super(), N(this, e, Vn, Jn, T, { intent: 0, disabled: 1 }, jn);
+    super(), N(this, e, Wn, Vn, T, { intent: 0, disabled: 1 }, Jn);
   }
 }
-function Wn(t) {
+function zn(t) {
   x(t, "svelte-1f9z0o8", "footer.svelte-1f9z0o8{display:flex;flex-direction:column}");
 }
-function zn(t) {
+function Xn(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -1229,21 +1412,21 @@ function zn(t) {
     }
   };
 }
-function Xn(t, e, r) {
+function Zn(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e;
   return t.$$set = (o) => {
     "$$scope" in o && r(0, i = o.$$scope);
   }, [i, n];
 }
-class We extends U {
+class ze extends U {
   constructor(e) {
-    super(), N(this, e, Xn, zn, T, {}, Wn);
+    super(), N(this, e, Zn, Xn, T, {}, zn);
   }
 }
-function Zn(t) {
+function er(t) {
   x(t, "svelte-6o8e90", '.column.svelte-6o8e90{display:flex;flex-direction:column;justify-content:flex-start;gap:var(--gap, "8px");flex-grow:1}');
 }
-function er(t) {
+function tr(t) {
   let e, r, n;
   const i = (
     /*#slots*/
@@ -1297,7 +1480,7 @@ function er(t) {
     }
   };
 }
-function tr(t, e, r) {
+function nr(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { gutter: o = "8px" } = e;
   return t.$$set = (s) => {
     "gutter" in s && r(0, o = s.gutter), "$$scope" in s && r(1, i = s.$$scope);
@@ -1305,22 +1488,22 @@ function tr(t, e, r) {
 }
 class $e extends U {
   constructor(e) {
-    super(), N(this, e, tr, er, T, { gutter: 0 }, Zn);
+    super(), N(this, e, nr, tr, T, { gutter: 0 }, er);
   }
 }
-const nr = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20id='mdi_close'%3e%3cpath%20id='Vector'%20d='M19%206.41L17.59%205L12%2010.59L6.41%205L5%206.41L10.59%2012L5%2017.59L6.41%2019L12%2013.41L17.59%2019L19%2017.59L13.41%2012L19%206.41Z'%20fill='%23767676'/%3e%3c/g%3e%3c/svg%3e";
-function rr(t) {
+const rr = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20id='mdi_close'%3e%3cpath%20id='Vector'%20d='M19%206.41L17.59%205L12%2010.59L6.41%205L5%206.41L10.59%2012L5%2017.59L6.41%2019L12%2013.41L17.59%2019L19%2017.59L13.41%2012L19%206.41Z'%20fill='%23767676'/%3e%3c/g%3e%3c/svg%3e";
+function ir(t) {
   x(t, "svelte-14xreta", ".close-button.svelte-14xreta{border:none;cursor:pointer;background-color:transparent;padding:0px}");
 }
-function ir(t) {
+function or(t) {
   let e, r, n, i, o;
   return {
     c() {
-      e = k("button"), r = k("img"), Z(r.src, n = nr) || _(r, "src", n), _(r, "alt", "close"), _(e, "class", "close-button svelte-14xreta"), e.disabled = /*disabled*/
+      e = k("button"), r = k("img"), Z(r.src, n = rr) || _(r, "src", n), _(r, "alt", "close"), _(e, "class", "close-button svelte-14xreta"), e.disabled = /*disabled*/
       t[0];
     },
     m(s, l) {
-      p(s, e, l), M(e, r), i || (o = ke(
+      p(s, e, l), C(e, r), i || (o = ke(
         e,
         "click",
         /*click_handler*/
@@ -1339,24 +1522,24 @@ function ir(t) {
     }
   };
 }
-function or(t, e, r) {
+function sr(t, e, r) {
   let { disabled: n = !1 } = e;
   function i(o) {
-    Mt.call(this, t, o);
+    Ct.call(this, t, o);
   }
   return t.$$set = (o) => {
     "disabled" in o && r(0, n = o.disabled);
   }, [n, i];
 }
-class sr extends U {
+class lr extends U {
   constructor(e) {
-    super(), N(this, e, or, ir, T, { disabled: 0 }, rr);
+    super(), N(this, e, sr, or, T, { disabled: 0 }, ir);
   }
 }
-function lr(t) {
+function cr(t) {
   x(t, "svelte-44qpq9", ".rcb-app-icon.svelte-44qpq9{width:40px;height:40px;border-radius:12px;box-shadow:0px 1px 10px 0px rgba(0, 0, 0, 0.1);margin-right:16px}.rcb-app-icon-picture-container.svelte-44qpq9{height:40px}.rcb-app-icon.loading.svelte-44qpq9{background-color:gray}");
 }
-function cr(t) {
+function ar(t) {
   let e;
   return {
     c() {
@@ -1371,7 +1554,7 @@ function cr(t) {
     }
   };
 }
-function ar(t) {
+function ur(t) {
   let e, r, n, i, o, s;
   return {
     c() {
@@ -1380,7 +1563,7 @@ function ar(t) {
       t[0]) || _(o, "src", s), _(o, "alt", "App icon"), _(e, "class", "rcb-app-icon-picture-container svelte-44qpq9");
     },
     m(l, c) {
-      p(l, e, c), M(e, r), M(e, i), M(e, o);
+      p(l, e, c), C(e, r), C(e, i), C(e, o);
     },
     p(l, c) {
       c & /*srcWebp*/
@@ -1394,18 +1577,18 @@ function ar(t) {
     }
   };
 }
-function ur(t) {
+function fr(t) {
   let e;
   function r(o, s) {
     return (
       /*src*/
-      o[0] !== null ? ar : cr
+      o[0] !== null ? ur : ar
     );
   }
   let n = r(t), i = n(t);
   return {
     c() {
-      i.c(), e = ee();
+      i.c(), e = te();
     },
     m(o, s) {
       i.m(o, s), p(o, e, s);
@@ -1420,24 +1603,24 @@ function ur(t) {
     }
   };
 }
-function fr(t, e, r) {
+function dr(t, e, r) {
   let { src: n = null } = e, { srcWebp: i = null } = e;
   return t.$$set = (o) => {
     "src" in o && r(0, n = o.src), "srcWebp" in o && r(1, i = o.srcWebp);
   }, [n, i];
 }
-class Tt extends U {
+class Nt extends U {
   constructor(e) {
-    super(), N(this, e, fr, ur, T, { src: 0, srcWebp: 1 }, lr);
+    super(), N(this, e, dr, fr, T, { src: 0, srcWebp: 1 }, cr);
   }
 }
-const Ce = (t) => `https://da08ctfrofx1b.cloudfront.net/${t}`;
-function dr(t) {
+const Me = (t) => `https://da08ctfrofx1b.cloudfront.net/${t}`;
+function mr(t) {
   x(t, "svelte-10uf5fq", ".app-title.svelte-10uf5fq{font-weight:500;margin:8px 0;font-size:16px}.rcb-header-layout__business-info.svelte-10uf5fq{display:flex;align-items:center}");
 }
-function mr(t) {
+function gr(t) {
   let e, r;
-  return e = new Tt({}), {
+  return e = new Nt({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -1456,29 +1639,29 @@ function mr(t) {
     }
   };
 }
-function gr(t) {
+function pr(t) {
   let e, r, n = (
     /*brandingInfo*/
     t[0].seller_company_name + ""
   ), i, o, s = (
     /*brandingInfo*/
     t[0].app_icon_webp !== null && /*brandingInfo*/
-    t[0].app_icon !== null && ct(t)
+    t[0].app_icon !== null && at(t)
   );
   return {
     c() {
-      s && s.c(), e = P(), r = k("span"), i = S(n), _(r, "class", "app-title svelte-10uf5fq");
+      s && s.c(), e = P(), r = k("span"), i = L(n), _(r, "class", "app-title svelte-10uf5fq");
     },
     m(l, c) {
-      s && s.m(l, c), p(l, e, c), p(l, r, c), M(r, i), o = !0;
+      s && s.m(l, c), p(l, e, c), p(l, r, c), C(r, i), o = !0;
     },
     p(l, c) {
       /*brandingInfo*/
       l[0].app_icon_webp !== null && /*brandingInfo*/
       l[0].app_icon !== null ? s ? (s.p(l, c), c & /*brandingInfo*/
-      1 && f(s, 1)) : (s = ct(l), s.c(), f(s, 1), s.m(e.parentNode, e)) : s && (Y(), m(s, 1, 1, () => {
+      1 && f(s, 1)) : (s = at(l), s.c(), f(s, 1), s.m(e.parentNode, e)) : s && (H(), m(s, 1, 1, () => {
         s = null;
-      }), H()), (!o || c & /*brandingInfo*/
+      }), K()), (!o || c & /*brandingInfo*/
       1) && n !== (n = /*brandingInfo*/
       l[0].seller_company_name + "") && ae(i, n);
     },
@@ -1493,15 +1676,15 @@ function gr(t) {
     }
   };
 }
-function ct(t) {
+function at(t) {
   let e, r;
-  return e = new Tt({
+  return e = new Nt({
     props: {
-      src: Ce(
+      src: Me(
         /*brandingInfo*/
         t[0].app_icon
       ),
-      srcWebp: Ce(
+      srcWebp: Me(
         /*brandingInfo*/
         t[0].app_icon_webp
       )
@@ -1516,11 +1699,11 @@ function ct(t) {
     p(n, i) {
       const o = {};
       i & /*brandingInfo*/
-      1 && (o.src = Ce(
+      1 && (o.src = Me(
         /*brandingInfo*/
         n[0].app_icon
       )), i & /*brandingInfo*/
-      1 && (o.srcWebp = Ce(
+      1 && (o.srcWebp = Me(
         /*brandingInfo*/
         n[0].app_icon_webp
       )), e.$set(o);
@@ -1536,9 +1719,9 @@ function ct(t) {
     }
   };
 }
-function pr(t) {
+function _r(t) {
   let e, r, n, i;
-  const o = [gr, mr], s = [];
+  const o = [pr, gr], s = [];
   function l(c, a) {
     return (
       /*brandingInfo*/
@@ -1554,9 +1737,9 @@ function pr(t) {
     },
     p(c, [a]) {
       let u = r;
-      r = l(c), r === u ? s[r].p(c, a) : (Y(), m(s[u], 1, 1, () => {
+      r = l(c), r === u ? s[r].p(c, a) : (H(), m(s[u], 1, 1, () => {
         s[u] = null;
-      }), H(), n = s[r], n ? n.p(c, a) : (n = s[r] = o[r](c), n.c()), f(n, 1), n.m(e, null));
+      }), K(), n = s[r], n ? n.p(c, a) : (n = s[r] = o[r](c), n.c()), f(n, 1), n.m(e, null));
     },
     i(c) {
       i || (f(n), i = !0);
@@ -1569,28 +1752,28 @@ function pr(t) {
     }
   };
 }
-function _r(t, e, r) {
+function Ar(t, e, r) {
   let { brandingInfo: n = null } = e;
   return t.$$set = (i) => {
     "brandingInfo" in i && r(0, n = i.brandingInfo);
   }, [n];
 }
-class Nt extends U {
+class Ut extends U {
   constructor(e) {
-    super(), N(this, e, _r, pr, T, { brandingInfo: 0 }, dr);
+    super(), N(this, e, Ar, _r, T, { brandingInfo: 0 }, mr);
   }
 }
-function Ar(t) {
+function hr(t) {
   x(t, "svelte-17puakv", ".rcb-post-purchase-header-layout.svelte-17puakv{display:flex;justify-content:space-between;align-items:center;width:100%;margin-top:-4px}");
 }
-function hr(t) {
+function Er(t) {
   let e, r, n, i, o;
-  return r = new Nt({
+  return r = new Ut({
     props: { brandingInfo: (
       /*brandingInfo*/
       t[0]
     ) }
-  }), i = new sr({}), i.$on("click", function() {
+  }), i = new lr({}), i.$on("click", function() {
     ce(
       /*onClose*/
       t[1]
@@ -1600,7 +1783,7 @@ function hr(t) {
       e = k("div"), w(r.$$.fragment), n = P(), w(i.$$.fragment), _(e, "class", "rcb-post-purchase-header-layout svelte-17puakv");
     },
     m(s, l) {
-      p(s, e, l), b(r, e, null), M(e, n), b(i, e, null), o = !0;
+      p(s, e, l), b(r, e, null), C(e, n), b(i, e, null), o = !0;
     },
     p(s, l) {
       t = s;
@@ -1620,12 +1803,12 @@ function hr(t) {
     }
   };
 }
-function Er(t) {
+function br(t) {
   let e, r;
   return e = new ue({
     props: {
       as: "header",
-      $$slots: { default: [hr] },
+      $$slots: { default: [Er] },
       $$scope: { ctx: t }
     }
   }), {
@@ -1651,22 +1834,22 @@ function Er(t) {
     }
   };
 }
-function br(t, e, r) {
+function Ir(t, e, r) {
   let { brandingInfo: n = null } = e, { onClose: i } = e;
   return t.$$set = (o) => {
     "brandingInfo" in o && r(0, n = o.brandingInfo), "onClose" in o && r(1, i = o.onClose);
   }, [n, i];
 }
-class Ir extends U {
+class wr extends U {
   constructor(e) {
-    super(), N(this, e, br, Er, T, { brandingInfo: 0, onClose: 1 }, Ar);
+    super(), N(this, e, Ir, br, T, { brandingInfo: 0, onClose: 1 }, hr);
   }
 }
-function wr(t) {
+function kr(t) {
   x(t, "svelte-10pcqja", ".rcb-modal-message.svelte-10pcqja{width:100%;min-height:160px;display:flex;justify-content:center;align-items:center;flex-direction:column;text-align:center}.title.svelte-10pcqja{font-size:24px;line-height:1.25em}.subtitle.svelte-10pcqja{font-size:16px;line-height:1.25em;overflow-wrap:anywhere}");
 }
-const kr = (t) => ({}), at = (t) => ({});
-function $r(t) {
+const $r = (t) => ({}), ut = (t) => ({});
+function vr(t) {
   let e, r, n, i, o;
   const s = (
     /*#slots*/
@@ -1680,13 +1863,13 @@ function $r(t) {
   );
   return {
     c() {
-      e = k("span"), r = S(
+      e = k("span"), r = L(
         /*title*/
         t[2]
       ), n = P(), i = k("span"), l && l.c(), _(e, "class", "title svelte-10pcqja"), _(i, "class", "subtitle svelte-10pcqja");
     },
     m(c, a) {
-      p(c, e, a), M(e, r), p(c, n, a), p(c, i, a), l && l.m(i, null), o = !0;
+      p(c, e, a), C(e, r), p(c, n, a), p(c, i, a), l && l.m(i, null), o = !0;
     },
     p(c, a) {
       (!o || a & /*title*/
@@ -1725,7 +1908,7 @@ function $r(t) {
     }
   };
 }
-function vr(t) {
+function yr(t) {
   let e, r, n;
   const i = (
     /*#slots*/
@@ -1735,12 +1918,12 @@ function vr(t) {
     t,
     /*$$scope*/
     t[5],
-    at
+    ut
   );
   return r = new $e({
     props: {
       gutter: "16px",
-      $$slots: { default: [$r] },
+      $$slots: { default: [vr] },
       $$scope: { ctx: t }
     }
   }), {
@@ -1763,12 +1946,12 @@ function vr(t) {
           /*$$scope*/
           s[5],
           l,
-          kr
+          $r
         ) : V(
           /*$$scope*/
           s[5]
         ),
-        at
+        ut
       );
       const c = {};
       l & /*$$scope, title*/
@@ -1785,12 +1968,12 @@ function vr(t) {
     }
   };
 }
-function yr(t) {
+function Br(t) {
   let e, r, n;
   return r = new $e({
     props: {
       gutter: "16px",
-      $$slots: { default: [vr] },
+      $$slots: { default: [yr] },
       $$scope: { ctx: t }
     }
   }), {
@@ -1827,11 +2010,11 @@ function yr(t) {
     }
   };
 }
-function Br(t) {
+function Dr(t) {
   let e;
   return {
     c() {
-      e = S("Go back to app");
+      e = L("Go back to app");
     },
     m(r, n) {
       p(r, e, n);
@@ -1841,11 +2024,11 @@ function Br(t) {
     }
   };
 }
-function Dr(t) {
+function Mr(t) {
   let e, r;
   return e = new Ie({
     props: {
-      $$slots: { default: [Br] },
+      $$slots: { default: [Dr] },
       $$scope: { ctx: t }
     }
   }), e.$on("click", function() {
@@ -1879,7 +2062,7 @@ function Dr(t) {
 }
 function Cr(t) {
   let e, r, n, i, o, s;
-  return e = new Ir({
+  return e = new wr({
     props: {
       brandingInfo: (
         /*brandingInfo*/
@@ -1892,12 +2075,12 @@ function Cr(t) {
     }
   }), n = new ue({
     props: {
-      $$slots: { default: [yr] },
+      $$slots: { default: [Br] },
       $$scope: { ctx: t }
     }
-  }), o = new We({
+  }), o = new ze({
     props: {
-      $$slots: { default: [Dr] },
+      $$slots: { default: [Mr] },
       $$scope: { ctx: t }
     }
   }), {
@@ -1932,7 +2115,7 @@ function Cr(t) {
     }
   };
 }
-function Mr(t) {
+function Qr(t) {
   let e, r;
   return e = new $e({
     props: {
@@ -1963,19 +2146,19 @@ function Mr(t) {
     }
   };
 }
-function Qr(t, e, r) {
+function Pr(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { brandingInfo: o = null } = e, { onContinue: s } = e, { title: l } = e, { type: c } = e;
   return t.$$set = (a) => {
     "brandingInfo" in a && r(0, o = a.brandingInfo), "onContinue" in a && r(1, s = a.onContinue), "title" in a && r(2, l = a.title), "type" in a && r(3, c = a.type), "$$scope" in a && r(5, i = a.$$scope);
   }, [o, s, l, c, n, i];
 }
-class Ut extends U {
+class Rt extends U {
   constructor(e) {
     super(), N(
       this,
       e,
+      Pr,
       Qr,
-      Mr,
       T,
       {
         brandingInfo: 0,
@@ -1983,22 +2166,22 @@ class Ut extends U {
         title: 2,
         type: 3
       },
-      wr
+      kr
     );
   }
 }
-function ut(t) {
+function ft(t) {
   let e, r, n, i, o;
   return {
     c() {
-      e = S("If this error persists, please contact "), r = k("a"), n = S(
+      e = L("If this error persists, please contact "), r = k("a"), n = L(
         /*supportEmail*/
         t[1]
-      ), o = S("."), _(r, "href", i = "mailto:" + /*supportEmail*/
+      ), o = L("."), _(r, "href", i = "mailto:" + /*supportEmail*/
       t[1]);
     },
     m(s, l) {
-      p(s, e, l), p(s, r, l), M(r, n), p(s, o, l);
+      p(s, e, l), p(s, r, l), C(r, n), p(s, o, l);
     },
     p(s, l) {
       l & /*supportEmail*/
@@ -2015,33 +2198,33 @@ function ut(t) {
     }
   };
 }
-function Pr(t) {
+function Tr(t) {
   let e = (
     /*getErrorMessage*/
     t[3]() + ""
   ), r, n, i, o = (
     /*supportEmail*/
-    t[1] && ut(t)
+    t[1] && ft(t)
   );
   return {
     c() {
-      r = S(e), n = P(), o && o.c(), i = ee();
+      r = L(e), n = P(), o && o.c(), i = te();
     },
     m(s, l) {
       p(s, r, l), p(s, n, l), o && o.m(s, l), p(s, i, l);
     },
     p(s, l) {
       /*supportEmail*/
-      s[1] ? o ? o.p(s, l) : (o = ut(s), o.c(), o.m(i.parentNode, i)) : o && (o.d(1), o = null);
+      s[1] ? o ? o.p(s, l) : (o = ft(s), o.c(), o.m(i.parentNode, i)) : o && (o.d(1), o = null);
     },
     d(s) {
       s && (g(r), g(n), g(i)), o && o.d(s);
     }
   };
 }
-function Tr(t) {
+function Nr(t) {
   let e, r;
-  return e = new qn({ props: { slot: "icon" } }), {
+  return e = new jn({ props: { slot: "icon" } }), {
     c() {
       w(e.$$.fragment);
     },
@@ -2060,11 +2243,14 @@ function Tr(t) {
     }
   };
 }
-function Nr(t) {
+function Ur(t) {
   let e, r;
-  return e = new Ut({
+  return e = new Rt({
     props: {
-      title: "Something went wrong",
+      title: (
+        /*getErrorTitle*/
+        t[4]()
+      ),
       brandingInfo: (
         /*brandingInfo*/
         t[0]
@@ -2075,8 +2261,8 @@ function Nr(t) {
       ),
       type: "error",
       $$slots: {
-        icon: [Tr],
-        default: [Pr]
+        icon: [Nr],
+        default: [Tr]
       },
       $$scope: { ctx: t }
     }
@@ -2094,7 +2280,7 @@ function Nr(t) {
       n[0]), i & /*onContinue*/
       4 && (o.onContinue = /*onContinue*/
       n[2]), i & /*$$scope, supportEmail*/
-      34 && (o.$$scope = { dirty: i, ctx: n }), e.$set(o);
+      66 && (o.$$scope = { dirty: i, ctx: n }), e.$set(o);
     },
     i(n) {
       r || (f(e.$$.fragment, n), r = !0);
@@ -2107,47 +2293,64 @@ function Nr(t) {
     }
   };
 }
-function Ur(t, e, r) {
+function Rr(t, e, r) {
   let { brandingInfo: n = null } = e, { lastError: i } = e, { supportEmail: o = null } = e, { onContinue: s } = e;
-  Se(() => {
-    G.errorLog(`Displayed error: ${L[i.errorCode]}. Message: ${i.message ?? "None"}. Underlying error: ${i.underlyingErrorMessage ?? "None"}`);
+  Oe(() => {
+    G.errorLog(`Displayed error: ${O[i.errorCode]}. Message: ${i.message ?? "None"}. Underlying error: ${i.underlyingErrorMessage ?? "None"}`);
   });
   function l() {
     switch (i.errorCode) {
-      case L.UnknownError:
+      case O.UnknownError:
         return "An unknown error occurred.";
-      case L.ErrorSettingUpPurchase:
+      case O.ErrorSettingUpPurchase:
         return "Purchase not started due to an error.";
-      case L.ErrorChargingPayment:
+      case O.ErrorChargingPayment:
         return "Payment failed.";
-      case L.NetworkError:
+      case O.NetworkError:
         return "Network error. Please check your internet connection.";
-      case L.StripeError:
+      case O.StripeError:
         return i.message;
-      case L.MissingEmailError:
+      case O.MissingEmailError:
         return "Email is required to complete the purchase.";
+      case O.AlreadySubscribedError:
+        return "You are already subscribed to this product.";
     }
     return i.message;
   }
-  return t.$$set = (c) => {
-    "brandingInfo" in c && r(0, n = c.brandingInfo), "lastError" in c && r(4, i = c.lastError), "supportEmail" in c && r(1, o = c.supportEmail), "onContinue" in c && r(2, s = c.onContinue);
-  }, [n, o, s, l, i];
+  function c() {
+    switch (i.errorCode) {
+      case O.AlreadySubscribedError:
+        return "Already subscribed";
+      default:
+        return "Something went wrong";
+    }
+  }
+  return t.$$set = (a) => {
+    "brandingInfo" in a && r(0, n = a.brandingInfo), "lastError" in a && r(5, i = a.lastError), "supportEmail" in a && r(1, o = a.supportEmail), "onContinue" in a && r(2, s = a.onContinue);
+  }, [
+    n,
+    o,
+    s,
+    l,
+    c,
+    i
+  ];
 }
-class Rr extends U {
+class Sr extends U {
   constructor(e) {
-    super(), N(this, e, Ur, Nr, T, {
+    super(), N(this, e, Rr, Ur, T, {
       brandingInfo: 0,
-      lastError: 4,
+      lastError: 5,
       supportEmail: 1,
       onContinue: 2
     });
   }
 }
 const Or = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23576CDB'/%3e%3crect%20x='44.1116'%20y='56'%20width='27.5'%20height='11'%20transform='rotate(45%2044.1116%2056)'%20fill='white'/%3e%3crect%20x='79.1133'%20y='44.334'%20width='11'%20height='44'%20transform='rotate(45%2079.1133%2044.334)'%20fill='white'/%3e%3c/svg%3e";
-function Sr(t) {
+function Lr(t) {
   x(t, "svelte-1609h93", "img.svelte-1609h93{width:124px;height:124px;margin:0 auto}");
 }
-function Lr(t) {
+function xr(t) {
   let e, r;
   return {
     c() {
@@ -2164,16 +2367,16 @@ function Lr(t) {
     }
   };
 }
-class xr extends U {
+class Fr extends U {
   constructor(e) {
-    super(), N(this, e, null, Lr, T, {}, Sr);
+    super(), N(this, e, null, xr, T, {}, Lr);
   }
 }
-function Fr(t) {
+function Gr(t) {
   let e;
   return {
     c() {
-      e = S("Your plan is now active.");
+      e = L("Your plan is now active.");
     },
     m(r, n) {
       p(r, e, n);
@@ -2183,9 +2386,9 @@ function Fr(t) {
     }
   };
 }
-function Gr(t) {
+function Yr(t) {
   let e, r;
-  return e = new xr({ props: { slot: "icon" } }), {
+  return e = new Fr({ props: { slot: "icon" } }), {
     c() {
       w(e.$$.fragment);
     },
@@ -2204,9 +2407,9 @@ function Gr(t) {
     }
   };
 }
-function Yr(t) {
+function Hr(t) {
   let e, r;
-  return e = new Ut({
+  return e = new Rt({
     props: {
       type: "success",
       title: "Purchase successful",
@@ -2219,8 +2422,8 @@ function Yr(t) {
         t[1]
       ),
       $$slots: {
-        icon: [Gr],
-        default: [Fr]
+        icon: [Yr],
+        default: [Gr]
       },
       $$scope: { ctx: t }
     }
@@ -2251,30 +2454,30 @@ function Yr(t) {
     }
   };
 }
-function Hr(t, e, r) {
+function Kr(t, e, r) {
   let { brandingInfo: n = null } = e, { onContinue: i } = e;
   return t.$$set = (o) => {
     "brandingInfo" in o && r(0, n = o.brandingInfo), "onContinue" in o && r(1, i = o.onContinue);
   }, [n, i];
 }
-class Kr extends U {
+class qr extends U {
   constructor(e) {
-    super(), N(this, e, Hr, Yr, T, { brandingInfo: 0, onContinue: 1 });
+    super(), N(this, e, Kr, Hr, T, { brandingInfo: 0, onContinue: 1 });
   }
 }
-function qr(t, e, r, n, i = {}) {
+function jr(t, e, r, n, i = {}) {
   const o = r.create(e, i);
   return o.mount(t), o.on("change", (s) => n("change", s)), o.on("ready", (s) => n("ready", s)), o.on("focus", (s) => n("focus", s)), o.on("blur", (s) => n("blur", s)), o.on("escape", (s) => n("escape", s)), o.on("click", (s) => n("click", s)), o.on("loaderror", (s) => n("loaderror", s)), o.on("loaderstart", (s) => n("loaderstart", s)), o.on("networkschange", (s) => n("networkschange", s)), o;
 }
-const jr = typeof window > "u";
-function Jr(t) {
-  if (!jr)
+const Jr = typeof window > "u";
+function Vr(t) {
+  if (!Jr)
     return t.registerAppInfo({
       name: "svelte-stripe-js",
       url: "https://svelte-stripe-js.vercel.app"
     });
 }
-function Vr(t) {
+function Wr(t) {
   let e;
   return {
     c() {
@@ -2291,11 +2494,11 @@ function Vr(t) {
     }
   };
 }
-function Wr(t, e, r) {
+function zr(t, e, r) {
   let n, i;
   const o = _n(), { elements: s } = hn("stripe");
   let { options: l = void 0 } = e;
-  Se(() => (n = qr(i, "payment", s, o, l), () => n.destroy()));
+  Oe(() => (n = jr(i, "payment", s, o, l), () => n.destroy()));
   function c() {
     n.blur();
   }
@@ -2317,9 +2520,9 @@ function Wr(t, e, r) {
     "options" in $ && r(1, l = $.options);
   }, [i, l, c, a, u, d, h];
 }
-class zr extends U {
+class Xr extends U {
   constructor(e) {
-    super(), N(this, e, Wr, Vr, T, {
+    super(), N(this, e, zr, Wr, T, {
       options: 1,
       blur: 2,
       clear: 3,
@@ -2340,7 +2543,7 @@ class zr extends U {
     return this.$$.ctx[5];
   }
 }
-function ft(t) {
+function dt(t) {
   let e;
   const r = (
     /*#slots*/
@@ -2391,15 +2594,15 @@ function ft(t) {
     }
   };
 }
-function Xr(t) {
+function Zr(t) {
   let e, r, n = (
     /*stripe*/
     t[1] && /*elements*/
-    t[0] && ft(t)
+    t[0] && dt(t)
   );
   return {
     c() {
-      n && n.c(), e = ee();
+      n && n.c(), e = te();
     },
     m(i, o) {
       n && n.m(i, o), p(i, e, o), r = !0;
@@ -2408,9 +2611,9 @@ function Xr(t) {
       /*stripe*/
       i[1] && /*elements*/
       i[0] ? n ? (n.p(i, o), o & /*stripe, elements*/
-      3 && f(n, 1)) : (n = ft(i), n.c(), f(n, 1), n.m(e.parentNode, e)) : n && (Y(), m(n, 1, 1, () => {
+      3 && f(n, 1)) : (n = dt(i), n.c(), f(n, 1), n.m(e.parentNode, e)) : n && (H(), m(n, 1, 1, () => {
         n = null;
-      }), H());
+      }), K());
     },
     i(i) {
       r || (f(n), r = !0);
@@ -2423,10 +2626,10 @@ function Xr(t) {
     }
   };
 }
-function Zr(t, e, r) {
+function ei(t, e, r) {
   let n, { $$slots: i = {}, $$scope: o } = e, { stripe: s } = e, { mode: l = void 0 } = e, { theme: c = "stripe" } = e, { variables: a = {} } = e, { rules: u = {} } = e, { labels: d = "above" } = e, { loader: h = "auto" } = e, { fonts: $ = [] } = e, { locale: E = "auto" } = e, { currency: B = void 0 } = e, { amount: A = void 0 } = e, { clientSecret: y = void 0 } = e, { elements: R = null } = e;
-  return t.$$set = (C) => {
-    "stripe" in C && r(1, s = C.stripe), "mode" in C && r(2, l = C.mode), "theme" in C && r(3, c = C.theme), "variables" in C && r(4, a = C.variables), "rules" in C && r(5, u = C.rules), "labels" in C && r(6, d = C.labels), "loader" in C && r(7, h = C.loader), "fonts" in C && r(8, $ = C.fonts), "locale" in C && r(9, E = C.locale), "currency" in C && r(10, B = C.currency), "amount" in C && r(11, A = C.amount), "clientSecret" in C && r(12, y = C.clientSecret), "elements" in C && r(0, R = C.elements), "$$scope" in C && r(14, o = C.$$scope);
+  return t.$$set = (M) => {
+    "stripe" in M && r(1, s = M.stripe), "mode" in M && r(2, l = M.mode), "theme" in M && r(3, c = M.theme), "variables" in M && r(4, a = M.variables), "rules" in M && r(5, u = M.rules), "labels" in M && r(6, d = M.labels), "loader" in M && r(7, h = M.loader), "fonts" in M && r(8, $ = M.fonts), "locale" in M && r(9, E = M.locale), "currency" in M && r(10, B = M.currency), "amount" in M && r(11, A = M.amount), "clientSecret" in M && r(12, y = M.clientSecret), "elements" in M && r(0, R = M.elements), "$$scope" in M && r(14, o = M.$$scope);
   }, t.$$.update = () => {
     t.$$.dirty & /*theme, variables, rules, labels*/
     120 && r(13, n = { theme: c, variables: a, rules: u, labels: d }), t.$$.dirty & /*stripe, elements, mode, currency, amount, appearance, clientSecret, fonts, loader, locale*/
@@ -2439,7 +2642,7 @@ function Zr(t, e, r) {
       fonts: $,
       loader: h,
       locale: E
-    })), Jr(s), An("stripe", { stripe: s, elements: R })), t.$$.dirty & /*elements, appearance, locale*/
+    })), Vr(s), An("stripe", { stripe: s, elements: R })), t.$$.dirty & /*elements, appearance, locale*/
     8705 && R && R.update({ appearance: n, locale: E });
   }, [
     R,
@@ -2460,9 +2663,9 @@ function Zr(t, e, r) {
     i
   ];
 }
-class ei extends U {
+class ti extends U {
   constructor(e) {
-    super(), N(this, e, Zr, Xr, T, {
+    super(), N(this, e, ei, Zr, T, {
       stripe: 1,
       mode: 2,
       theme: 3,
@@ -2479,55 +2682,55 @@ class ei extends U {
     });
   }
 }
-var Rt = "https://js.stripe.com/v3", ti = /^https:\/\/js\.stripe\.com\/v3\/?(\?.*)?$/, dt = "loadStripe.setLoadParameters was called but an existing Stripe.js script already exists in the document; existing script parameters will be used", ni = function() {
-  for (var e = document.querySelectorAll('script[src^="'.concat(Rt, '"]')), r = 0; r < e.length; r++) {
+var St = "https://js.stripe.com/v3", ni = /^https:\/\/js\.stripe\.com\/v3\/?(\?.*)?$/, mt = "loadStripe.setLoadParameters was called but an existing Stripe.js script already exists in the document; existing script parameters will be used", ri = function() {
+  for (var e = document.querySelectorAll('script[src^="'.concat(St, '"]')), r = 0; r < e.length; r++) {
     var n = e[r];
-    if (ti.test(n.src))
+    if (ni.test(n.src))
       return n;
   }
   return null;
-}, mt = function(e) {
+}, gt = function(e) {
   var r = e && !e.advancedFraudSignals ? "?advancedFraudSignals=false" : "", n = document.createElement("script");
-  n.src = "".concat(Rt).concat(r);
+  n.src = "".concat(St).concat(r);
   var i = document.head || document.body;
   if (!i)
     throw new Error("Expected document.body not to be null. Stripe.js requires a <body> element.");
   return i.appendChild(n), n;
-}, ri = function(e, r) {
+}, ii = function(e, r) {
   !e || !e._registerWrapper || e._registerWrapper({
     name: "stripe-js",
     version: "2.4.0",
     startTime: r
   });
-}, me = null, Me = null, Qe = null, ii = function(e) {
+}, me = null, Ce = null, Qe = null, oi = function(e) {
   return function() {
     e(new Error("Failed to load Stripe.js"));
   };
-}, oi = function(e, r) {
+}, si = function(e, r) {
   return function() {
     window.Stripe ? e(window.Stripe) : r(new Error("Stripe.js not available"));
   };
-}, si = function(e) {
+}, li = function(e) {
   return me !== null ? me : (me = new Promise(function(r, n) {
     if (typeof window > "u" || typeof document > "u") {
       r(null);
       return;
     }
-    if (window.Stripe && e && console.warn(dt), window.Stripe) {
+    if (window.Stripe && e && console.warn(mt), window.Stripe) {
       r(window.Stripe);
       return;
     }
     try {
-      var i = ni();
+      var i = ri();
       if (i && e)
-        console.warn(dt);
+        console.warn(mt);
       else if (!i)
-        i = mt(e);
-      else if (i && Qe !== null && Me !== null) {
+        i = gt(e);
+      else if (i && Qe !== null && Ce !== null) {
         var o;
-        i.removeEventListener("load", Qe), i.removeEventListener("error", Me), (o = i.parentNode) === null || o === void 0 || o.removeChild(i), i = mt(e);
+        i.removeEventListener("load", Qe), i.removeEventListener("error", Ce), (o = i.parentNode) === null || o === void 0 || o.removeChild(i), i = gt(e);
       }
-      Qe = oi(r, n), Me = ii(n), i.addEventListener("load", Qe), i.addEventListener("error", Me);
+      Qe = si(r, n), Ce = oi(n), i.addEventListener("load", Qe), i.addEventListener("error", Ce);
     } catch (s) {
       n(s);
       return;
@@ -2535,34 +2738,34 @@ var Rt = "https://js.stripe.com/v3", ti = /^https:\/\/js\.stripe\.com\/v3\/?(\?.
   }), me.catch(function(r) {
     return me = null, Promise.reject(r);
   }));
-}, li = function(e, r, n) {
+}, ci = function(e, r, n) {
   if (e === null)
     return null;
   var i = e.apply(void 0, r);
-  return ri(i, n), i;
-}, ge, Ot = !1, St = function() {
-  return ge || (ge = si(null).catch(function(e) {
+  return ii(i, n), i;
+}, ge, Ot = !1, Lt = function() {
+  return ge || (ge = li(null).catch(function(e) {
     return ge = null, Promise.reject(e);
   }), ge);
 };
 Promise.resolve().then(function() {
-  return St();
+  return Lt();
 }).catch(function(t) {
   Ot || console.warn(t);
 });
-var ci = function() {
+var ai = function() {
   for (var e = arguments.length, r = new Array(e), n = 0; n < e; n++)
     r[n] = arguments[n];
   Ot = !0;
   var i = Date.now();
-  return St().then(function(o) {
-    return li(o, r, i);
+  return Lt().then(function(o) {
+    return ci(o, r, i);
   });
 };
-function ai(t) {
+function ui(t) {
   x(t, "svelte-1xe711j", ".rcb-header-layout.svelte-1xe711j{display:flex;justify-content:space-between;align-items:center;width:100%;font-size:24px;margin:0;font-weight:500}");
 }
-function ui(t) {
+function fi(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -2613,12 +2816,12 @@ function ui(t) {
     }
   };
 }
-function fi(t) {
+function di(t) {
   let e, r;
   return e = new ue({
     props: {
       as: "header",
-      $$slots: { default: [ui] },
+      $$slots: { default: [fi] },
       $$scope: { ctx: t }
     }
   }), {
@@ -2644,23 +2847,23 @@ function fi(t) {
     }
   };
 }
-function di(t, e, r) {
+function mi(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e;
   return t.$$set = (o) => {
     "$$scope" in o && r(1, i = o.$$scope);
   }, [n, i];
 }
-class ze extends U {
+class Xe extends U {
   constructor(e) {
-    super(), N(this, e, di, fi, T, {}, ai);
+    super(), N(this, e, mi, di, T, {}, ui);
   }
 }
-const mi = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cpath%20d='M18%208H17V6C17%203.24%2014.76%201%2012%201C9.24%201%207%203.24%207%206V8H6C4.9%208%204%208.9%204%2010V20C4%2021.1%204.9%2022%206%2022H18C19.1%2022%2020%2021.1%2020%2020V10C20%208.9%2019.1%208%2018%208ZM12%2017C10.9%2017%2010%2016.1%2010%2015C10%2013.9%2010.9%2013%2012%2013C13.1%2013%2014%2013.9%2014%2015C14%2016.1%2013.1%2017%2012%2017ZM15.1%208H8.9V6C8.9%204.29%2010.29%202.9%2012%202.9C13.71%202.9%2015.1%204.29%2015.1%206V8Z'%20fill='%2311D483'/%3e%3c/svg%3e";
-function gi(t) {
+const gi = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cpath%20d='M18%208H17V6C17%203.24%2014.76%201%2012%201C9.24%201%207%203.24%207%206V8H6C4.9%208%204%208.9%204%2010V20C4%2021.1%204.9%2022%206%2022H18C19.1%2022%2020%2021.1%2020%2020V10C20%208.9%2019.1%208%2018%208ZM12%2017C10.9%2017%2010%2016.1%2010%2015C10%2013.9%2010.9%2013%2012%2013C13.1%2013%2014%2013.9%2014%2015C14%2016.1%2013.1%2017%2012%2017ZM15.1%208H8.9V6C8.9%204.29%2010.29%202.9%2012%202.9C13.71%202.9%2015.1%204.29%2015.1%206V8Z'%20fill='%2311D483'/%3e%3c/svg%3e";
+function pi(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), Z(e.src, r = mi) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
+      e = k("img"), Z(e.src, r = gi) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
     },
     m(n, i) {
       p(n, e, i);
@@ -2673,9 +2876,9 @@ function gi(t) {
     }
   };
 }
-class pi extends U {
+class _i extends U {
   constructor(e) {
-    super(), N(this, e, null, gi, T, {});
+    super(), N(this, e, null, pi, T, {});
   }
 }
 const _e = {
@@ -2687,7 +2890,7 @@ const _e = {
   "grey-ui-dark": "#dfdfdf",
   white: "#ffffff"
 };
-function _i(t) {
+function Ai(t) {
   x(t, "svelte-rjmul6", `.processing.svelte-rjmul6{width:12px;aspect-ratio:1;border-radius:50%;animation:svelte-rjmul6-l5 1.5s infinite linear}@keyframes svelte-rjmul6-l5{0%{box-shadow:20px 0 #fff2,
         -20px 0 #fff2;background:#fff2}25%{box-shadow:20px 0 #fff2,
         -20px 0 #ffff;background:#fff2}50%{box-shadow:20px 0 #fff2,
@@ -2695,7 +2898,7 @@ function _i(t) {
         -20px 0 #fff2;background:#fff2}100%{box-shadow:20px 0 #fff2,
         -20px 0 #fff2;background:#fff2}}`);
 }
-function Ai(t) {
+function hi(t) {
   let e;
   return {
     c() {
@@ -2712,17 +2915,17 @@ function Ai(t) {
     }
   };
 }
-class Lt extends U {
+class xt extends U {
   constructor(e) {
-    super(), N(this, e, null, Ai, T, {}, _i);
+    super(), N(this, e, null, hi, T, {}, Ai);
   }
 }
-function hi(t) {
+function Ei(t) {
   x(t, "svelte-1wxt892", ".rcb-stripe-elements-container.svelte-1wxt892{width:100%;margin-top:32px;margin-bottom:24px}");
 }
-function Ei(t) {
+function bi(t) {
   let e, r;
-  return e = new Ve({}), {
+  return e = new We({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -2741,7 +2944,7 @@ function Ei(t) {
     }
   };
 }
-function bi(t) {
+function Ii(t) {
   let e, r, n, i, o, s;
   function l(a) {
     t[9](a);
@@ -2788,12 +2991,12 @@ function bi(t) {
   return (
     /*elements*/
     t[2] !== void 0 && (c.elements = /*elements*/
-    t[2]), r = new ei({ props: c }), Ue.push(() => $n(r, "elements", l)), {
+    t[2]), r = new ti({ props: c }), Ue.push(() => $n(r, "elements", l)), {
       c() {
         e = k("form"), w(r.$$.fragment);
       },
       m(a, u) {
-        p(a, e, u), b(r, e, null), i = !0, o || (s = ke(e, "submit", Ct(
+        p(a, e, u), b(r, e, null), i = !0, o || (s = ke(e, "submit", Mt(
           /*handleContinue*/
           t[5]
         )), o = !0);
@@ -2819,9 +3022,9 @@ function bi(t) {
     }
   );
 }
-function Ii(t) {
+function wi(t) {
   let e, r, n, i;
-  return n = new pi({}), {
+  return n = new _i({}), {
     c() {
       e = k("div"), e.textContent = "Secure Checkout", r = P(), w(n.$$.fragment);
     },
@@ -2840,9 +3043,9 @@ function Ii(t) {
     }
   };
 }
-function wi(t) {
+function ki(t) {
   let e, r, n;
-  return r = new zr({}), {
+  return r = new Xr({}), {
     c() {
       e = k("div"), w(r.$$.fragment), _(e, "class", "rcb-stripe-elements-container svelte-1wxt892");
     },
@@ -2861,11 +3064,11 @@ function wi(t) {
     }
   };
 }
-function ki(t) {
+function $i(t) {
   let e;
   return {
     c() {
-      e = S("Pay");
+      e = L("Pay");
     },
     m(r, n) {
       p(r, e, n);
@@ -2877,9 +3080,9 @@ function ki(t) {
     }
   };
 }
-function $i(t) {
+function vi(t) {
   let e, r;
-  return e = new Lt({}), {
+  return e = new xt({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -2897,9 +3100,9 @@ function $i(t) {
     }
   };
 }
-function vi(t) {
+function yi(t) {
   let e, r, n, i;
-  const o = [$i, ki], s = [];
+  const o = [vi, $i], s = [];
   function l(c, a) {
     return (
       /*processing*/
@@ -2908,16 +3111,16 @@ function vi(t) {
   }
   return e = l(t), r = s[e] = o[e](t), {
     c() {
-      r.c(), n = ee();
+      r.c(), n = te();
     },
     m(c, a) {
       s[e].m(c, a), p(c, n, a), i = !0;
     },
     p(c, a) {
       let u = e;
-      e = l(c), e !== u && (Y(), m(s[u], 1, 1, () => {
+      e = l(c), e !== u && (H(), m(s[u], 1, 1, () => {
         s[u] = null;
-      }), H(), r = s[e], r || (r = s[e] = o[e](c), r.c()), f(r, 1), r.m(n.parentNode, n));
+      }), K(), r = s[e], r || (r = s[e] = o[e](c), r.c()), f(r, 1), r.m(n.parentNode, n));
     },
     i(c) {
       i || (f(r), i = !0);
@@ -2930,11 +3133,11 @@ function vi(t) {
     }
   };
 }
-function yi(t) {
+function Bi(t) {
   let e;
   return {
     c() {
-      e = S("Close");
+      e = L("Close");
     },
     m(r, n) {
       p(r, e, n);
@@ -2944,7 +3147,7 @@ function yi(t) {
     }
   };
 }
-function Bi(t) {
+function Di(t) {
   let e, r, n, i;
   return e = new Ie({
     props: {
@@ -2952,7 +3155,7 @@ function Bi(t) {
         /*processing*/
         t[0]
       ),
-      $$slots: { default: [vi] },
+      $$slots: { default: [yi] },
       $$scope: { ctx: t }
     }
   }), n = new Ie({
@@ -2962,7 +3165,7 @@ function Bi(t) {
         t[0]
       ),
       intent: "secondary",
-      $$slots: { default: [yi] },
+      $$slots: { default: [Bi] },
       $$scope: { ctx: t }
     }
   }), n.$on("click", function() {
@@ -3001,11 +3204,11 @@ function Bi(t) {
     }
   };
 }
-function Di(t) {
+function Mi(t) {
   let e, r;
   return e = new $e({
     props: {
-      $$slots: { default: [Bi] },
+      $$slots: { default: [Di] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3033,19 +3236,19 @@ function Di(t) {
 }
 function Ci(t) {
   let e, r, n, i, o, s;
-  return e = new ze({
+  return e = new Xe({
     props: {
-      $$slots: { default: [Ii] },
+      $$slots: { default: [wi] },
       $$scope: { ctx: t }
     }
   }), n = new ue({
     props: {
-      $$slots: { default: [wi] },
+      $$slots: { default: [ki] },
       $$scope: { ctx: t }
     }
-  }), o = new We({
+  }), o = new ze({
     props: {
-      $$slots: { default: [Di] },
+      $$slots: { default: [Mi] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3077,9 +3280,9 @@ function Ci(t) {
     }
   };
 }
-function Mi(t) {
+function Qi(t) {
   let e, r, n, i;
-  const o = [bi, Ei], s = [];
+  const o = [Ii, bi], s = [];
   function l(c, a) {
     return (
       /*stripe*/
@@ -3096,9 +3299,9 @@ function Mi(t) {
     },
     p(c, [a]) {
       let u = r;
-      r = l(c), r === u ? s[r].p(c, a) : (Y(), m(s[u], 1, 1, () => {
+      r = l(c), r === u ? s[r].p(c, a) : (H(), m(s[u], 1, 1, () => {
         s[u] = null;
-      }), H(), n = s[r], n ? n.p(c, a) : (n = s[r] = o[r](c), n.c()), f(n, 1), n.m(e, null));
+      }), K(), n = s[r], n ? n.p(c, a) : (n = s[r] = o[r](c), n.c()), f(n, 1), n.m(e, null));
     },
     i(c) {
       i || (f(n), i = !0);
@@ -3111,15 +3314,15 @@ function Mi(t) {
     }
   };
 }
-function Qi(t, e, r) {
+function Pi(t, e, r) {
   let { onClose: n } = e, { onContinue: i } = e, { onError: o } = e, { paymentInfoCollectionMetadata: s } = e, { processing: l = !1 } = e;
   const c = s.data.client_secret;
   let a = null, u, d;
-  Se(async () => {
+  Oe(async () => {
     const E = s.data.publishable_api_key, B = s.data.stripe_account_id;
     if (!E || !B)
       throw new Error("Stripe publishable key or account ID not found");
-    r(3, a = await ci(E, { stripeAccount: B }));
+    r(3, a = await ai(E, { stripeAccount: B }));
   });
   const h = async () => {
     if (l || !a || !d)
@@ -3129,7 +3332,7 @@ function Qi(t, e, r) {
       elements: d,
       redirect: "if_required"
     });
-    E.error ? (r(0, l = !1), o(new K(L.StripeError, E.error.message))) : i();
+    E.error ? (r(0, l = !1), o(new Y(O.StripeError, E.error.message))) : i();
   };
   function $(E) {
     u = E, r(2, u);
@@ -3152,13 +3355,13 @@ function Qi(t, e, r) {
     $
   ];
 }
-class Pi extends U {
+class Ti extends U {
   constructor(e) {
     super(), N(
       this,
       e,
+      Pi,
       Qi,
-      Mi,
       T,
       {
         onClose: 1,
@@ -3167,18 +3370,21 @@ class Pi extends U {
         paymentInfoCollectionMetadata: 8,
         processing: 0
       },
-      hi
+      Ei
     );
   }
 }
-function Ti(t) {
+function Ni(t) {
+  return t.trim() === "" ? "You need to provide your email address to continue." : t.match(/^[^@]+@[^@]+\.[^@]+$/) ? null : "Email is not valid. Please provide a valid email address.";
+}
+function Ui(t) {
   x(t, "svelte-favd20", "form.svelte-favd20.svelte-favd20{display:flex;flex-direction:column;min-height:100%;flex-grow:1}.form-container.svelte-favd20.svelte-favd20{display:flex;flex-direction:column;width:100%;margin-top:32px;margin-bottom:16px}.form-label.svelte-favd20.svelte-favd20{margin-top:8px;margin-bottom:8px;display:block;font-weight:500;line-height:22px}.form-input.error.svelte-favd20 input.svelte-favd20{border-color:var(--rc-color-error)}.form-error.svelte-favd20.svelte-favd20{margin-top:4px;font-size:16px;line-height:20px;min-height:40px;color:var(--rc-color-error)}input.svelte-favd20.svelte-favd20{width:100%;box-sizing:border-box;padding:8px;border:2px solid var(--rc-color-grey-ui-dark);border-radius:12px;font-size:16px;height:48px;padding:6px 14px}input.svelte-favd20.svelte-favd20:focus{outline:none;border:2px solid var(--rc-color-focus)}");
 }
-function Ni(t) {
+function Ri(t) {
   let e;
   return {
     c() {
-      e = S("Billing email address");
+      e = L("Billing email address");
     },
     m(r, n) {
       p(r, e, n);
@@ -3188,17 +3394,17 @@ function Ni(t) {
     }
   };
 }
-function gt(t) {
+function pt(t) {
   let e, r;
   return {
     c() {
-      e = k("div"), r = S(
+      e = k("div"), r = L(
         /*error*/
         t[2]
       ), _(e, "class", "form-error svelte-favd20");
     },
     m(n, i) {
-      p(n, e, i), M(e, r);
+      p(n, e, i), C(e, r);
     },
     p(n, i) {
       i & /*error*/
@@ -3213,10 +3419,10 @@ function gt(t) {
     }
   };
 }
-function Ui(t) {
+function Si(t) {
   let e, r, n, i, o, s, l, c, a, u = (
     /*error*/
-    t[2] && gt(t)
+    t[2] && pt(t)
   );
   return {
     c() {
@@ -3224,11 +3430,11 @@ function Ui(t) {
       t[4] + " svelte-favd20"), _(e, "class", "form-container svelte-favd20");
     },
     m(d, h) {
-      p(d, e, h), M(e, r), M(e, n), M(e, i), M(i, o), st(
+      p(d, e, h), C(e, r), C(e, n), C(e, i), C(i, o), lt(
         o,
         /*email*/
         t[3]
-      ), M(e, l), u && u.m(e, null), c || (a = ke(
+      ), C(e, l), u && u.m(e, null), c || (a = ke(
         o,
         "input",
         /*input_input_handler*/
@@ -3238,25 +3444,25 @@ function Ui(t) {
     p(d, h) {
       h & /*email*/
       8 && o.value !== /*email*/
-      d[3] && st(
+      d[3] && lt(
         o,
         /*email*/
         d[3]
       ), h & /*inputClass*/
       16 && s !== (s = "form-input " + /*inputClass*/
       d[4] + " svelte-favd20") && _(i, "class", s), /*error*/
-      d[2] ? u ? u.p(d, h) : (u = gt(d), u.c(), u.m(e, null)) : u && (u.d(1), u = null);
+      d[2] ? u ? u.p(d, h) : (u = pt(d), u.c(), u.m(e, null)) : u && (u.d(1), u = null);
     },
     d(d) {
       d && g(e), u && u.d(), c = !1, a();
     }
   };
 }
-function Ri(t) {
+function Oi(t) {
   let e;
   return {
     c() {
-      e = S("Continue");
+      e = L("Continue");
     },
     m(r, n) {
       p(r, e, n);
@@ -3268,9 +3474,9 @@ function Ri(t) {
     }
   };
 }
-function Oi(t) {
+function Li(t) {
   let e, r;
-  return e = new Lt({}), {
+  return e = new xt({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -3288,9 +3494,9 @@ function Oi(t) {
     }
   };
 }
-function Si(t) {
+function xi(t) {
   let e, r, n, i;
-  const o = [Oi, Ri], s = [];
+  const o = [Li, Oi], s = [];
   function l(c, a) {
     return (
       /*processing*/
@@ -3299,16 +3505,16 @@ function Si(t) {
   }
   return e = l(t), r = s[e] = o[e](t), {
     c() {
-      r.c(), n = ee();
+      r.c(), n = te();
     },
     m(c, a) {
       s[e].m(c, a), p(c, n, a), i = !0;
     },
     p(c, a) {
       let u = e;
-      e = l(c), e !== u && (Y(), m(s[u], 1, 1, () => {
+      e = l(c), e !== u && (H(), m(s[u], 1, 1, () => {
         s[u] = null;
-      }), H(), r = s[e], r || (r = s[e] = o[e](c), r.c()), f(r, 1), r.m(n.parentNode, n));
+      }), K(), r = s[e], r || (r = s[e] = o[e](c), r.c()), f(r, 1), r.m(n.parentNode, n));
     },
     i(c) {
       i || (f(r), i = !0);
@@ -3321,11 +3527,11 @@ function Si(t) {
     }
   };
 }
-function Li(t) {
+function Fi(t) {
   let e;
   return {
     c() {
-      e = S("Close");
+      e = L("Close");
     },
     m(r, n) {
       p(r, e, n);
@@ -3335,7 +3541,7 @@ function Li(t) {
     }
   };
 }
-function xi(t) {
+function Gi(t) {
   let e, r, n, i;
   return e = new Ie({
     props: {
@@ -3343,7 +3549,7 @@ function xi(t) {
         /*processing*/
         t[1]
       ),
-      $$slots: { default: [Si] },
+      $$slots: { default: [xi] },
       $$scope: { ctx: t }
     }
   }), n = new Ie({
@@ -3353,7 +3559,7 @@ function xi(t) {
         /*processing*/
         t[1]
       ),
-      $$slots: { default: [Li] },
+      $$slots: { default: [Fi] },
       $$scope: { ctx: t }
     }
   }), n.$on("click", function() {
@@ -3392,11 +3598,11 @@ function xi(t) {
     }
   };
 }
-function Fi(t) {
+function Yi(t) {
   let e, r;
   return e = new $e({
     props: {
-      $$slots: { default: [xi] },
+      $$slots: { default: [Gi] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3422,21 +3628,21 @@ function Fi(t) {
     }
   };
 }
-function Gi(t) {
+function Hi(t) {
   let e, r, n, i, o, s, l, c, a;
-  return r = new ze({
+  return r = new Xe({
     props: {
-      $$slots: { default: [Ni] },
+      $$slots: { default: [Ri] },
       $$scope: { ctx: t }
     }
   }), i = new ue({
     props: {
-      $$slots: { default: [Ui] },
+      $$slots: { default: [Si] },
       $$scope: { ctx: t }
     }
-  }), s = new We({
+  }), s = new ze({
     props: {
-      $$slots: { default: [Fi] },
+      $$slots: { default: [Yi] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3444,7 +3650,7 @@ function Gi(t) {
       e = k("form"), w(r.$$.fragment), n = P(), w(i.$$.fragment), o = P(), w(s.$$.fragment), _(e, "class", "svelte-favd20");
     },
     m(u, d) {
-      p(u, e, d), b(r, e, null), M(e, n), b(i, e, null), M(e, o), b(s, e, null), l = !0, c || (a = ke(e, "submit", Ct(
+      p(u, e, d), b(r, e, null), C(e, n), b(i, e, null), C(e, o), b(s, e, null), l = !0, c || (a = ke(e, "submit", Mt(
         /*handleContinue*/
         t[5]
       )), c = !0);
@@ -3471,10 +3677,11 @@ function Gi(t) {
     }
   };
 }
-function Yi(t, e, r) {
+function Ki(t, e, r) {
   let n, i, o, { onContinue: s } = e, { onClose: l } = e, { processing: c } = e;
   const a = async () => {
-    n.trim() === "" ? r(2, i = "You need to provide your email address to continue.") : s({ email: n });
+    const d = Ni(n);
+    d ? r(2, i = d) : s({ email: n });
   };
   function u() {
     n = this.value, r(3, n);
@@ -3495,15 +3702,15 @@ function Yi(t, e, r) {
     u
   ];
 }
-class Hi extends U {
+class qi extends U {
   constructor(e) {
-    super(), N(this, e, Yi, Gi, T, { onContinue: 6, onClose: 0, processing: 1 }, Ti);
+    super(), N(this, e, Ki, Hi, T, { onContinue: 6, onClose: 0, processing: 1 }, Ui);
   }
 }
-function Ki(t) {
+function ji(t) {
   x(t, "svelte-17tslso", ".rcb-modal-backdrop.svelte-17tslso{position:fixed;top:0;left:0;right:0;min-width:100%;width:100vw;width:100dvw;min-height:100%;height:100vh;height:100dvh;background-color:rgba(40, 40, 40, 0.75);display:flex;flex-direction:column;justify-content:space-around;z-index:1000001}");
 }
-function qi(t) {
+function Ji(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -3554,21 +3761,21 @@ function qi(t) {
     }
   };
 }
-function ji(t, e, r) {
+function Vi(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e;
   return t.$$set = (o) => {
     "$$scope" in o && r(0, i = o.$$scope);
   }, [i, n];
 }
-class Ji extends U {
+class Wi extends U {
   constructor(e) {
-    super(), N(this, e, ji, qi, T, {}, Ki);
+    super(), N(this, e, Vi, Ji, T, {}, ji);
   }
 }
-function Vi(t) {
+function zi(t) {
   x(t, "svelte-ioxu5d", ".rcb-modal-container.svelte-ioxu5d{width:100%}.rcb-modal-main.svelte-ioxu5d{box-sizing:border-box;border-radius:8px;background-color:var(--rc-color-white);color:var(--rc-color-grey-text-dark);min-height:460px;padding:40px;flex-direction:column;display:flex}.rcb-modal-dark.svelte-ioxu5d{background-color:var(--rc-color-grey-text-dark);color:var(--rc-color-white);min-height:0px}@media screen and (max-width: 960px){.rcb-modal-container.svelte-ioxu5d{width:calc(100% - 32px);min-width:300px;max-width:640px;margin:auto}.rcb-modal-main.svelte-ioxu5d,.rcb-modal-dark.svelte-ioxu5d{min-width:300px;max-width:640px;padding:32px}}");
 }
-function Wi(t) {
+function Xi(t) {
   let e, r, n, i;
   const o = (
     /*#slots*/
@@ -3586,7 +3793,7 @@ function Wi(t) {
       t[0] ? "rcb-modal-dark" : ""}`) + " svelte-ioxu5d"), _(e, "class", "rcb-modal-container svelte-ioxu5d");
     },
     m(l, c) {
-      p(l, e, c), M(e, r), s && s.m(r, null), i = !0;
+      p(l, e, c), C(e, r), s && s.m(r, null), i = !0;
     },
     p(l, [c]) {
       s && s.p && (!i || c & /*$$scope*/
@@ -3622,18 +3829,18 @@ function Wi(t) {
     }
   };
 }
-function zi(t, e, r) {
+function Zi(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { dark: o = !1 } = e;
   return t.$$set = (s) => {
     "dark" in s && r(0, o = s.dark), "$$scope" in s && r(1, i = s.$$scope);
   }, [o, i, n];
 }
-class Xi extends U {
+class eo extends U {
   constructor(e) {
-    super(), N(this, e, zi, Wi, T, { dark: 0 }, Vi);
+    super(), N(this, e, Zi, Xi, T, { dark: 0 }, zi);
   }
 }
-function Zi(t) {
+function to(t) {
   let e;
   const r = (
     /*#slots*/
@@ -3684,11 +3891,11 @@ function Zi(t) {
     }
   };
 }
-function eo(t) {
+function no(t) {
   let e, r;
-  return e = new Ji({
+  return e = new Wi({
     props: {
-      $$slots: { default: [to] },
+      $$slots: { default: [ro] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3714,7 +3921,7 @@ function eo(t) {
     }
   };
 }
-function to(t) {
+function ro(t) {
   let e;
   const r = (
     /*#slots*/
@@ -3765,9 +3972,9 @@ function to(t) {
     }
   };
 }
-function no(t) {
+function io(t) {
   let e, r, n, i;
-  const o = [eo, Zi], s = [];
+  const o = [no, to], s = [];
   function l(c, a) {
     return (
       /*condition*/
@@ -3776,16 +3983,16 @@ function no(t) {
   }
   return e = l(t), r = s[e] = o[e](t), {
     c() {
-      r.c(), n = ee();
+      r.c(), n = te();
     },
     m(c, a) {
       s[e].m(c, a), p(c, n, a), i = !0;
     },
     p(c, [a]) {
       let u = e;
-      e = l(c), e === u ? s[e].p(c, a) : (Y(), m(s[u], 1, 1, () => {
+      e = l(c), e === u ? s[e].p(c, a) : (H(), m(s[u], 1, 1, () => {
         s[u] = null;
-      }), H(), r = s[e], r ? r.p(c, a) : (r = s[e] = o[e](c), r.c()), f(r, 1), r.m(n.parentNode, n));
+      }), K(), r = s[e], r ? r.p(c, a) : (r = s[e] = o[e](c), r.c()), f(r, 1), r.m(n.parentNode, n));
     },
     i(c) {
       i || (f(r), i = !0);
@@ -3798,19 +4005,19 @@ function no(t) {
     }
   };
 }
-function ro(t, e, r) {
+function oo(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { condition: o = !1 } = e;
   return t.$$set = (s) => {
     "condition" in s && r(0, o = s.condition), "$$scope" in s && r(2, i = s.$$scope);
   }, [o, n, i];
 }
-class io extends U {
+class so extends U {
   constructor(e) {
-    super(), N(this, e, ro, no, T, { condition: 0 });
+    super(), N(this, e, oo, io, T, { condition: 0 });
   }
 }
-const oo = (t) => ({}), pt = (t) => ({});
-function so(t) {
+const lo = (t) => ({}), _t = (t) => ({});
+function co(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -3820,7 +4027,7 @@ function so(t) {
     t,
     /*$$scope*/
     t[2],
-    pt
+    _t
   ), o = (
     /*#slots*/
     t[1].default
@@ -3851,12 +4058,12 @@ function so(t) {
           /*$$scope*/
           l[2],
           c,
-          oo
+          lo
         ) : V(
           /*$$scope*/
           l[2]
         ),
-        pt
+        _t
       ), s && s.p && (!r || c & /*$$scope*/
       4) && J(
         s,
@@ -3888,15 +4095,15 @@ function so(t) {
     }
   };
 }
-function lo(t) {
+function ao(t) {
   let e, r;
-  return e = new Xi({
+  return e = new eo({
     props: {
       dark: (
         /*dark*/
         t[0]
       ),
-      $$slots: { default: [so] },
+      $$slots: { default: [co] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3924,168 +4131,18 @@ function lo(t) {
     }
   };
 }
-function co(t, e, r) {
+function uo(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { dark: o = !1 } = e;
   return t.$$set = (s) => {
     "dark" in s && r(0, o = s.dark), "$$scope" in s && r(2, i = s.$$scope);
   }, [o, n, i];
 }
-class xt extends U {
+class Ft extends U {
   constructor(e) {
-    super(), N(this, e, co, lo, T, { dark: 0 });
+    super(), N(this, e, uo, ao, T, { dark: 0 });
   }
 }
-var ne = /* @__PURE__ */ ((t) => (t[t.UnknownError = 0] = "UnknownError", t[t.UserCancelledError = 1] = "UserCancelledError", t[t.StoreProblemError = 2] = "StoreProblemError", t[t.PurchaseNotAllowedError = 3] = "PurchaseNotAllowedError", t[t.PurchaseInvalidError = 4] = "PurchaseInvalidError", t[t.ProductNotAvailableForPurchaseError = 5] = "ProductNotAvailableForPurchaseError", t[t.ProductAlreadyPurchasedError = 6] = "ProductAlreadyPurchasedError", t[t.ReceiptAlreadyInUseError = 7] = "ReceiptAlreadyInUseError", t[t.InvalidReceiptError = 8] = "InvalidReceiptError", t[t.MissingReceiptFileError = 9] = "MissingReceiptFileError", t[t.NetworkError = 10] = "NetworkError", t[t.InvalidCredentialsError = 11] = "InvalidCredentialsError", t[t.UnexpectedBackendResponseError = 12] = "UnexpectedBackendResponseError", t[t.InvalidAppUserIdError = 14] = "InvalidAppUserIdError", t[t.OperationAlreadyInProgressError = 15] = "OperationAlreadyInProgressError", t[t.UnknownBackendError = 16] = "UnknownBackendError", t[t.InvalidAppleSubscriptionKeyError = 17] = "InvalidAppleSubscriptionKeyError", t[t.IneligibleError = 18] = "IneligibleError", t[t.InsufficientPermissionsError = 19] = "InsufficientPermissionsError", t[t.PaymentPendingError = 20] = "PaymentPendingError", t[t.InvalidSubscriberAttributesError = 21] = "InvalidSubscriberAttributesError", t[t.LogOutWithAnonymousUserError = 22] = "LogOutWithAnonymousUserError", t[t.ConfigurationError = 23] = "ConfigurationError", t[t.UnsupportedError = 24] = "UnsupportedError", t[t.EmptySubscriberAttributesError = 25] = "EmptySubscriberAttributesError", t[t.CustomerInfoError = 28] = "CustomerInfoError", t[t.SignatureVerificationError = 36] = "SignatureVerificationError", t))(ne || {});
-class he {
-  static getPublicMessage(e) {
-    switch (e) {
-      case 0:
-        return "Unknown error.";
-      case 1:
-        return "Purchase was cancelled.";
-      case 2:
-        return "There was a problem with the store.";
-      case 3:
-        return "The device or user is not allowed to make the purchase.";
-      case 4:
-        return "One or more of the arguments provided are invalid.";
-      case 5:
-        return "The product is not available for purchase.";
-      case 6:
-        return "This product is already active for the user.";
-      case 7:
-        return "There is already another active subscriber using the same receipt.";
-      case 8:
-        return "The receipt is not valid.";
-      case 9:
-        return "The receipt is missing.";
-      case 10:
-        return "Error performing request.";
-      case 11:
-        return "There was a credentials issue. Check the underlying error for more details.";
-      case 12:
-        return "Received unexpected response from the backend.";
-      case 14:
-        return "The app user id is not valid.";
-      case 15:
-        return "The operation is already in progress.";
-      case 16:
-        return "There was an unknown backend error.";
-      case 17:
-        return "Apple Subscription Key is invalid or not present. In order to provide subscription offers, you must first generate a subscription key. Please see https://docs.revenuecat.com/docs/ios-subscription-offers for more info.";
-      case 18:
-        return "The User is ineligible for that action.";
-      case 19:
-        return "App does not have sufficient permissions to make purchases.";
-      case 20:
-        return "The payment is pending.";
-      case 21:
-        return "One or more of the attributes sent could not be saved.";
-      case 22:
-        return "Called logOut but the current user is anonymous.";
-      case 23:
-        return "There is an issue with your configuration. Check the underlying error for more details.";
-      case 24:
-        return "There was a problem with the operation. Looks like we doesn't support that yet. Check the underlying error for more details.";
-      case 25:
-        return "A request for subscriber attributes returned none.";
-      case 28:
-        return "There was a problem related to the customer info.";
-      case 36:
-        return "Request failed signature verification. Please see https://rev.cat/trusted-entitlements for more info.";
-    }
-  }
-  static getErrorCodeForBackendErrorCode(e) {
-    switch (e) {
-      case 7101:
-        return 2;
-      case 7102:
-        return 7;
-      case 7103:
-        return 8;
-      case 7107:
-      case 7224:
-      case 7225:
-        return 11;
-      case 7105:
-      case 7106:
-        return 4;
-      case 7220:
-        return 14;
-      case 7229:
-        return 2;
-      case 7230:
-      case 7e3:
-        return 23;
-      case 7231:
-        return 2;
-      case 7232:
-        return 18;
-      case 7263:
-      case 7264:
-        return 21;
-      case 7104:
-      case 7234:
-      case 7226:
-      case 7110:
-        return 12;
-      case 7662:
-        return 24;
-    }
-  }
-  static convertCodeToBackendErrorCode(e) {
-    return e in Ft ? e : null;
-  }
-  static convertPurchaseFlowErrorCodeToErrorCode(e) {
-    switch (e) {
-      case L.ErrorSettingUpPurchase:
-        return 2;
-      case L.ErrorChargingPayment:
-        return 20;
-      case L.NetworkError:
-        return 10;
-      case L.MissingEmailError:
-        return 4;
-      case L.StripeError:
-        return 2;
-      case L.UnknownError:
-        return 0;
-    }
-  }
-}
-var Ft = /* @__PURE__ */ ((t) => (t[t.BackendInvalidPlatform = 7e3] = "BackendInvalidPlatform", t[t.BackendStoreProblem = 7101] = "BackendStoreProblem", t[t.BackendCannotTransferPurchase = 7102] = "BackendCannotTransferPurchase", t[t.BackendInvalidReceiptToken = 7103] = "BackendInvalidReceiptToken", t[t.BackendInvalidAppStoreSharedSecret = 7104] = "BackendInvalidAppStoreSharedSecret", t[t.BackendInvalidPaymentModeOrIntroPriceNotProvided = 7105] = "BackendInvalidPaymentModeOrIntroPriceNotProvided", t[t.BackendProductIdForGoogleReceiptNotProvided = 7106] = "BackendProductIdForGoogleReceiptNotProvided", t[t.BackendInvalidPlayStoreCredentials = 7107] = "BackendInvalidPlayStoreCredentials", t[t.BackendInternalServerError = 7110] = "BackendInternalServerError", t[t.BackendEmptyAppUserId = 7220] = "BackendEmptyAppUserId", t[t.BackendInvalidAuthToken = 7224] = "BackendInvalidAuthToken", t[t.BackendInvalidAPIKey = 7225] = "BackendInvalidAPIKey", t[t.BackendBadRequest = 7226] = "BackendBadRequest", t[t.BackendPlayStoreQuotaExceeded = 7229] = "BackendPlayStoreQuotaExceeded", t[t.BackendPlayStoreInvalidPackageName = 7230] = "BackendPlayStoreInvalidPackageName", t[t.BackendPlayStoreGenericError = 7231] = "BackendPlayStoreGenericError", t[t.BackendUserIneligibleForPromoOffer = 7232] = "BackendUserIneligibleForPromoOffer", t[t.BackendInvalidAppleSubscriptionKey = 7234] = "BackendInvalidAppleSubscriptionKey", t[t.BackendInvalidSubscriberAttributes = 7263] = "BackendInvalidSubscriberAttributes", t[t.BackendInvalidSubscriberAttributesBody = 7264] = "BackendInvalidSubscriberAttributesBody", t[t.BackendProductIDsMalformed = 7662] = "BackendProductIDsMalformed", t))(Ft || {});
-class X extends Error {
-  constructor(r, n, i) {
-    super(n);
-    Q(this, "toString", () => `PurchasesError(code: ${ne[this.errorCode]}, message: ${this.message})`);
-    this.errorCode = r, this.underlyingErrorMessage = i;
-  }
-  /** @internal */
-  static getForBackendError(r, n) {
-    const i = he.getErrorCodeForBackendErrorCode(r);
-    return new X(
-      i,
-      he.getPublicMessage(i),
-      n
-    );
-  }
-  /** @internal */
-  static getForPurchasesFlowError(r) {
-    return new X(
-      he.convertPurchaseFlowErrorCodeToErrorCode(
-        r.errorCode
-      ),
-      r.message,
-      r.underlyingErrorMessage
-    );
-  }
-}
-class ao extends Error {
-  constructor() {
-    super("Purchases must be configured before calling getInstance");
-  }
-}
-const uo = "0.3.0", fe = "https://api.revenuecat.com";
+const fo = "0.3.2", fe = "https://api.revenuecat.com";
 var Re;
 (function(t) {
   t[t.CONTINUE = 100] = "CONTINUE", t[t.SWITCHING_PROTOCOLS = 101] = "SWITCHING_PROTOCOLS", t[t.PROCESSING = 102] = "PROCESSING", t[t.EARLY_HINTS = 103] = "EARLY_HINTS", t[t.OK = 200] = "OK", t[t.CREATED = 201] = "CREATED", t[t.ACCEPTED = 202] = "ACCEPTED", t[t.NON_AUTHORITATIVE_INFORMATION = 203] = "NON_AUTHORITATIVE_INFORMATION", t[t.NO_CONTENT = 204] = "NO_CONTENT", t[t.RESET_CONTENT = 205] = "RESET_CONTENT", t[t.PARTIAL_CONTENT = 206] = "PARTIAL_CONTENT", t[t.MULTI_STATUS = 207] = "MULTI_STATUS", t[t.MULTIPLE_CHOICES = 300] = "MULTIPLE_CHOICES", t[t.MOVED_PERMANENTLY = 301] = "MOVED_PERMANENTLY", t[t.MOVED_TEMPORARILY = 302] = "MOVED_TEMPORARILY", t[t.SEE_OTHER = 303] = "SEE_OTHER", t[t.NOT_MODIFIED = 304] = "NOT_MODIFIED", t[t.USE_PROXY = 305] = "USE_PROXY", t[t.TEMPORARY_REDIRECT = 307] = "TEMPORARY_REDIRECT", t[t.PERMANENT_REDIRECT = 308] = "PERMANENT_REDIRECT", t[t.BAD_REQUEST = 400] = "BAD_REQUEST", t[t.UNAUTHORIZED = 401] = "UNAUTHORIZED", t[t.PAYMENT_REQUIRED = 402] = "PAYMENT_REQUIRED", t[t.FORBIDDEN = 403] = "FORBIDDEN", t[t.NOT_FOUND = 404] = "NOT_FOUND", t[t.METHOD_NOT_ALLOWED = 405] = "METHOD_NOT_ALLOWED", t[t.NOT_ACCEPTABLE = 406] = "NOT_ACCEPTABLE", t[t.PROXY_AUTHENTICATION_REQUIRED = 407] = "PROXY_AUTHENTICATION_REQUIRED", t[t.REQUEST_TIMEOUT = 408] = "REQUEST_TIMEOUT", t[t.CONFLICT = 409] = "CONFLICT", t[t.GONE = 410] = "GONE", t[t.LENGTH_REQUIRED = 411] = "LENGTH_REQUIRED", t[t.PRECONDITION_FAILED = 412] = "PRECONDITION_FAILED", t[t.REQUEST_TOO_LONG = 413] = "REQUEST_TOO_LONG", t[t.REQUEST_URI_TOO_LONG = 414] = "REQUEST_URI_TOO_LONG", t[t.UNSUPPORTED_MEDIA_TYPE = 415] = "UNSUPPORTED_MEDIA_TYPE", t[t.REQUESTED_RANGE_NOT_SATISFIABLE = 416] = "REQUESTED_RANGE_NOT_SATISFIABLE", t[t.EXPECTATION_FAILED = 417] = "EXPECTATION_FAILED", t[t.IM_A_TEAPOT = 418] = "IM_A_TEAPOT", t[t.INSUFFICIENT_SPACE_ON_RESOURCE = 419] = "INSUFFICIENT_SPACE_ON_RESOURCE", t[t.METHOD_FAILURE = 420] = "METHOD_FAILURE", t[t.MISDIRECTED_REQUEST = 421] = "MISDIRECTED_REQUEST", t[t.UNPROCESSABLE_ENTITY = 422] = "UNPROCESSABLE_ENTITY", t[t.LOCKED = 423] = "LOCKED", t[t.FAILED_DEPENDENCY = 424] = "FAILED_DEPENDENCY", t[t.UPGRADE_REQUIRED = 426] = "UPGRADE_REQUIRED", t[t.PRECONDITION_REQUIRED = 428] = "PRECONDITION_REQUIRED", t[t.TOO_MANY_REQUESTS = 429] = "TOO_MANY_REQUESTS", t[t.REQUEST_HEADER_FIELDS_TOO_LARGE = 431] = "REQUEST_HEADER_FIELDS_TOO_LARGE", t[t.UNAVAILABLE_FOR_LEGAL_REASONS = 451] = "UNAVAILABLE_FOR_LEGAL_REASONS", t[t.INTERNAL_SERVER_ERROR = 500] = "INTERNAL_SERVER_ERROR", t[t.NOT_IMPLEMENTED = 501] = "NOT_IMPLEMENTED", t[t.BAD_GATEWAY = 502] = "BAD_GATEWAY", t[t.SERVICE_UNAVAILABLE = 503] = "SERVICE_UNAVAILABLE", t[t.GATEWAY_TIMEOUT = 504] = "GATEWAY_TIMEOUT", t[t.HTTP_VERSION_NOT_SUPPORTED = 505] = "HTTP_VERSION_NOT_SUPPORTED", t[t.INSUFFICIENT_STORAGE = 507] = "INSUFFICIENT_STORAGE", t[t.NETWORK_AUTHENTICATION_REQUIRED = 511] = "NETWORK_AUTHENTICATION_REQUIRED";
@@ -4097,19 +4154,19 @@ async function oe(t, e, r, n) {
   try {
     const i = await fetch(t.url(), {
       method: t.method,
-      headers: go(e, n),
-      body: mo(r)
+      headers: po(e, n),
+      body: go(r)
     });
-    return await fo(i, t), await i.json();
+    return await mo(i, t), await i.json();
   } catch (i) {
     throw i instanceof TypeError ? new X(
-      ne.NetworkError,
-      he.getPublicMessage(ne.NetworkError),
+      ee.NetworkError,
+      he.getPublicMessage(ee.NetworkError),
       i.message
     ) : i;
   }
 }
-async function fo(t, e) {
+async function mo(t, e) {
   const r = t.status;
   if (r >= Re.INTERNAL_SERVER_ERROR)
     Ye(e, r, await t.text());
@@ -4130,26 +4187,26 @@ async function fo(t, e) {
 }
 function Ye(t, e, r) {
   throw new X(
-    ne.UnknownBackendError,
+    ee.UnknownBackendError,
     `Unknown backend error. Request: ${t.name}. Status code: ${e}. Body: ${r}.`
   );
 }
-function mo(t) {
+function go(t) {
   return t == null ? null : JSON.stringify(t);
 }
-function go(t, e) {
+function po(t, e) {
   let r = {
     Authorization: `Bearer ${t}`,
     "Content-Type": "application/json",
     Accept: "application/json",
     "X-Platform": "web",
-    "X-Version": uo,
+    "X-Version": fo,
     "X-Is-Sandbox": `${je(t)}`
   };
   return e != null && (r = { ...r, ...e }), r;
 }
 const Gt = "/v1/subscribers", Le = "/rcbilling/v1";
-class po {
+class _o {
   constructor(e) {
     Q(this, "appUserId");
     Q(this, "method", "GET");
@@ -4161,7 +4218,7 @@ class po {
     return `${fe}${Gt}/${e}/offerings`;
   }
 }
-class _o {
+class Ao {
   constructor() {
     Q(this, "method", "POST");
     Q(this, "name", "subscribe");
@@ -4170,7 +4227,7 @@ class _o {
     return `${fe}${Le}/subscribe`;
   }
 }
-class Ao {
+class ho {
   constructor(e, r) {
     Q(this, "method", "GET");
     Q(this, "name", "getProducts");
@@ -4183,7 +4240,7 @@ class Ao {
     return `${fe}${Le}/subscribers/${e}/products?id=${r}`;
   }
 }
-class ho {
+class Eo {
   constructor(e) {
     Q(this, "method", "GET");
     Q(this, "name", "getCustomerInfo");
@@ -4195,7 +4252,7 @@ class ho {
     return `${fe}${Gt}/${e}`;
   }
 }
-class Eo {
+class bo {
   constructor() {
     Q(this, "method", "GET");
     Q(this, "name", "getBrandingInfo");
@@ -4204,7 +4261,7 @@ class Eo {
     return `${fe}${Le}/branding`;
   }
 }
-class bo {
+class Io {
   constructor(e) {
     Q(this, "method", "GET");
     Q(this, "name", "getCheckoutStatus");
@@ -4215,32 +4272,32 @@ class bo {
     return `${fe}${Le}/checkout/${this.operationSessionId}`;
   }
 }
-class Io {
+class wo {
   constructor(e) {
     Q(this, "API_KEY");
     this.API_KEY = e;
   }
   async getOfferings(e) {
     return await oe(
-      new po(e),
+      new _o(e),
       this.API_KEY
     );
   }
   async getCustomerInfo(e) {
     return await oe(
-      new ho(e),
+      new Eo(e),
       this.API_KEY
     );
   }
   async getProducts(e, r) {
     return await oe(
-      new Ao(e, r),
+      new ho(e, r),
       this.API_KEY
     );
   }
   async getBrandingInfo() {
     return await oe(
-      new Eo(),
+      new bo(),
       this.API_KEY
     );
   }
@@ -4252,24 +4309,24 @@ class Io {
       presented_offering_identifier: i
     };
     return o && o !== "base_option" && (s.offer_id = o), await oe(
-      new _o(),
+      new Ao(),
       this.API_KEY,
       s
     );
   }
   async getCheckoutStatus(e) {
     return await oe(
-      new bo(e),
+      new Io(e),
       this.API_KEY
     );
   }
 }
-const wo = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20opacity='0.5'%20clip-path='url(%23clip0_344_3390)'%3e%3cpath%20d='M7%2018C5.9%2018%205.01%2018.9%205.01%2020C5.01%2021.1%205.9%2022%207%2022C8.1%2022%209%2021.1%209%2020C9%2018.9%208.1%2018%207%2018ZM1%202V4H3L6.6%2011.59L5.25%2014.04C5.09%2014.32%205%2014.65%205%2015C5%2016.1%205.9%2017%207%2017H19V15H7.42C7.28%2015%207.17%2014.89%207.17%2014.75L7.2%2014.63L8.1%2013H15.55C16.3%2013%2016.96%2012.59%2017.3%2011.97L20.88%205.48C20.96%205.34%2021%205.17%2021%205C21%204.45%2020.55%204%2020%204H5.21L4.27%202H1ZM17%2018C15.9%2018%2015.01%2018.9%2015.01%2020C15.01%2021.1%2015.9%2022%2017%2022C18.1%2022%2019%2021.1%2019%2020C19%2018.9%2018.1%2018%2017%2018Z'%20fill='white'/%3e%3c/g%3e%3cdefs%3e%3cclipPath%20id='clip0_344_3390'%3e%3crect%20width='24'%20height='24'%20fill='white'/%3e%3c/clipPath%3e%3c/defs%3e%3c/svg%3e";
-function ko(t) {
+const ko = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20opacity='0.5'%20clip-path='url(%23clip0_344_3390)'%3e%3cpath%20d='M7%2018C5.9%2018%205.01%2018.9%205.01%2020C5.01%2021.1%205.9%2022%207%2022C8.1%2022%209%2021.1%209%2020C9%2018.9%208.1%2018%207%2018ZM1%202V4H3L6.6%2011.59L5.25%2014.04C5.09%2014.32%205%2014.65%205%2015C5%2016.1%205.9%2017%207%2017H19V15H7.42C7.28%2015%207.17%2014.89%207.17%2014.75L7.2%2014.63L8.1%2013H15.55C16.3%2013%2016.96%2012.59%2017.3%2011.97L20.88%205.48C20.96%205.34%2021%205.17%2021%205C21%204.45%2020.55%204%2020%204H5.21L4.27%202H1ZM17%2018C15.9%2018%2015.01%2018.9%2015.01%2020C15.01%2021.1%2015.9%2022%2017%2022C18.1%2022%2019%2021.1%2019%2020C19%2018.9%2018.1%2018%2017%2018Z'%20fill='white'/%3e%3c/g%3e%3cdefs%3e%3cclipPath%20id='clip0_344_3390'%3e%3crect%20width='24'%20height='24'%20fill='white'/%3e%3c/clipPath%3e%3c/defs%3e%3c/svg%3e";
+function $o(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), Z(e.src, r = wo) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
+      e = k("img"), Z(e.src, r = ko) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
     },
     m(n, i) {
       p(n, e, i);
@@ -4282,15 +4339,15 @@ function ko(t) {
     }
   };
 }
-class $o extends U {
+class vo extends U {
   constructor(e) {
-    super(), N(this, e, null, ko, T, {});
+    super(), N(this, e, null, $o, T, {});
   }
 }
-function vo(t) {
+function yo(t) {
   x(t, "svelte-1rhrjxe", "div.svelte-1rhrjxe{background-color:var(--rc-color-warning);color:var(--rc-color-grey-text-dark);font-size:10px;font-weight:bold;text-transform:uppercase;padding:4px 10px;line-height:10px;border-radius:9px;margin:0px;margin-left:16px}");
 }
-function yo(t) {
+function Bo(t) {
   let e;
   return {
     c() {
@@ -4307,22 +4364,22 @@ function yo(t) {
     }
   };
 }
-class Bo extends U {
+class Do extends U {
   constructor(e) {
-    super(), N(this, e, null, yo, T, {}, vo);
+    super(), N(this, e, null, Bo, T, {}, yo);
   }
 }
-function Do(t) {
+function Mo(t) {
   x(t, "svelte-1qect5g", `.rcb-ui-container.svelte-1qect5g{color-scheme:none;font-size:16px;line-height:1.5em;font-weight:400;font-family:-apple-system, "system-ui", "Segoe UI", Roboto, Oxygen, Ubuntu,
         Cantarell, "Open Sans", "Helvetica Neue", sans-serif}.rcb-ui-layout.svelte-1qect5g{width:100vw;width:100 dvw;margin-right:auto;display:flex;justify-content:center;align-items:flex-start;position:relative;padding:0px 80px;box-sizing:border-box}.rcb-ui-aside.svelte-1qect5g{margin-right:16px;flex:320px 1 0;max-width:480px}.rcb-ui-main.svelte-1qect5g{flex:480px 1 0;max-width:640px}@media screen and (max-width: 960px){.rcb-ui-layout.svelte-1qect5g{flex-direction:column;align-items:center;justify-content:center;height:100%;min-width:100%}.rcb-ui-aside.svelte-1qect5g{margin-right:0;margin-bottom:16px;min-width:100%;display:flex;flex-direction:column;align-items:center;flex:none;max-width:none}.rcb-ui-main.svelte-1qect5g{flex:none;max-width:none;min-width:100%}}@media screen and (max-width: 960px) and (max-height: 960px){.rcb-ui-layout.svelte-1qect5g{overflow-y:scroll;justify-content:flex-start;padding:16px 0px}}`);
 }
-function _t(t) {
+function At(t) {
   let e, r, n;
-  return r = new xt({
+  return r = new Ft({
     props: {
       dark: !0,
       $$slots: {
-        header: [To],
+        header: [No],
         default: [Co]
       },
       $$scope: { ctx: t }
@@ -4350,7 +4407,7 @@ function _t(t) {
     }
   };
 }
-function At(t) {
+function ht(t) {
   let e, r;
   return e = new Pt({
     props: {
@@ -4393,11 +4450,11 @@ function Co(t) {
   let e, r, n = (
     /*productDetails*/
     t[3] && /*purchaseOption*/
-    t[1] && At(t)
+    t[1] && ht(t)
   );
   return {
     c() {
-      n && n.c(), e = ee();
+      n && n.c(), e = te();
     },
     m(i, o) {
       n && n.m(i, o), p(i, e, o), r = !0;
@@ -4406,9 +4463,9 @@ function Co(t) {
       /*productDetails*/
       i[3] && /*purchaseOption*/
       i[1] ? n ? (n.p(i, o), o & /*productDetails, purchaseOption*/
-      10 && f(n, 1)) : (n = At(i), n.c(), f(n, 1), n.m(e.parentNode, e)) : n && (Y(), m(n, 1, 1, () => {
+      10 && f(n, 1)) : (n = ht(i), n.c(), f(n, 1), n.m(e.parentNode, e)) : n && (H(), m(n, 1, 1, () => {
         n = null;
-      }), H());
+      }), K());
     },
     i(i) {
       r || (f(n), r = !0);
@@ -4421,9 +4478,9 @@ function Co(t) {
     }
   };
 }
-function Mo(t) {
+function Qo(t) {
   let e, r;
-  return e = new $o({}), {
+  return e = new vo({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -4441,9 +4498,9 @@ function Mo(t) {
     }
   };
 }
-function Qo(t) {
+function Po(t) {
   let e, r;
-  return e = new Bo({}), {
+  return e = new Do({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -4461,15 +4518,15 @@ function Qo(t) {
     }
   };
 }
-function Po(t) {
+function To(t) {
   let e, r, n, i, o, s, l;
-  e = new Nt({
+  e = new Ut({
     props: { brandingInfo: (
       /*brandingInfo*/
       t[4]
     ) }
   });
-  const c = [Qo, Mo], a = [];
+  const c = [Po, Qo], a = [];
   function u(d, h) {
     return h & /*purchases*/
     4 && (n = null), n == null && (n = !!/*purchases*/
@@ -4477,7 +4534,7 @@ function Po(t) {
   }
   return i = u(t, -1), o = a[i] = c[i](t), {
     c() {
-      w(e.$$.fragment), r = P(), o.c(), s = ee();
+      w(e.$$.fragment), r = P(), o.c(), s = te();
     },
     m(d, h) {
       b(e, d, h), p(d, r, h), a[i].m(d, h), p(d, s, h), l = !0;
@@ -4488,9 +4545,9 @@ function Po(t) {
       16 && ($.brandingInfo = /*brandingInfo*/
       d[4]), e.$set($);
       let E = i;
-      i = u(d, h), i !== E && (Y(), m(a[E], 1, 1, () => {
+      i = u(d, h), i !== E && (H(), m(a[E], 1, 1, () => {
         a[E] = null;
-      }), H(), o = a[i], o || (o = a[i] = c[i](d), o.c()), f(o, 1), o.m(s.parentNode, s));
+      }), K(), o = a[i], o || (o = a[i] = c[i](d), o.c()), f(o, 1), o.m(s.parentNode, s));
     },
     i(d) {
       l || (f(e.$$.fragment, d), f(o), l = !0);
@@ -4503,12 +4560,12 @@ function Po(t) {
     }
   };
 }
-function To(t) {
+function No(t) {
   let e, r;
-  return e = new ze({
+  return e = new Xe({
     props: {
       slot: "header",
-      $$slots: { default: [Po] },
+      $$slots: { default: [To] },
       $$scope: { ctx: t }
     }
   }), {
@@ -4534,7 +4591,7 @@ function To(t) {
     }
   };
 }
-function ht(t) {
+function Et(t) {
   let e, r;
   return e = new Pt({
     props: {
@@ -4573,9 +4630,9 @@ function ht(t) {
     }
   };
 }
-function Et(t) {
+function bt(t) {
   let e, r;
-  return e = new Ve({}), {
+  return e = new We({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -4593,9 +4650,9 @@ function Et(t) {
     }
   };
 }
-function bt(t) {
+function It(t) {
   let e, r;
-  return e = new Hi({
+  return e = new qi({
     props: {
       onContinue: (
         /*handleContinue*/
@@ -4634,9 +4691,9 @@ function bt(t) {
     }
   };
 }
-function It(t) {
+function wt(t) {
   let e, r;
-  return e = new Pi({
+  return e = new Ti({
     props: {
       paymentInfoCollectionMetadata: (
         /*paymentInfoCollectionMetadata*/
@@ -4685,9 +4742,9 @@ function It(t) {
     }
   };
 }
-function wt(t) {
+function kt(t) {
   let e, r;
-  return e = new Ve({}), {
+  return e = new We({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -4705,10 +4762,10 @@ function wt(t) {
     }
   };
 }
-function kt(t) {
+function $t(t) {
   var n;
   let e, r;
-  return e = new Rr({
+  return e = new Sr({
     props: {
       brandingInfo: (
         /*brandingInfo*/
@@ -4716,7 +4773,7 @@ function kt(t) {
       ),
       lastError: (
         /*lastError*/
-        t[6] ?? new K(L.UnknownError, "Unknown error without state set.")
+        t[6] ?? new Y(O.UnknownError, "Unknown error without state set.")
       ),
       supportEmail: (
         /*brandingInfo*/
@@ -4741,7 +4798,7 @@ function kt(t) {
       16 && (s.brandingInfo = /*brandingInfo*/
       i[4]), o & /*lastError*/
       64 && (s.lastError = /*lastError*/
-      i[6] ?? new K(L.UnknownError, "Unknown error without state set.")), o & /*brandingInfo*/
+      i[6] ?? new Y(O.UnknownError, "Unknown error without state set.")), o & /*brandingInfo*/
       16 && (s.supportEmail = /*brandingInfo*/
       (l = i[4]) == null ? void 0 : l.seller_company_support_email), e.$set(s);
     },
@@ -4756,9 +4813,9 @@ function kt(t) {
     }
   };
 }
-function $t(t) {
+function vt(t) {
   let e, r;
-  return e = new Kr({
+  return e = new qr({
     props: {
       brandingInfo: (
         /*brandingInfo*/
@@ -4793,38 +4850,38 @@ function $t(t) {
     }
   };
 }
-function No(t) {
+function Uo(t) {
   let e, r, n, i, o, s, l, c, a = (
     /*state*/
     t[7] === "present-offer" && /*productDetails*/
     t[3] && /*purchaseOption*/
-    t[1] && ht(t)
+    t[1] && Et(t)
   ), u = (
     /*state*/
     t[7] === "present-offer" && !/*productDetails*/
-    t[3] && Et()
+    t[3] && bt()
   ), d = (
     /*state*/
     (t[7] === "needs-auth-info" || /*state*/
-    t[7] === "processing-auth-info") && bt(t)
+    t[7] === "processing-auth-info") && It(t)
   ), h = (
     /*paymentInfoCollectionMetadata*/
     t[5] && /*state*/
     (t[7] === "needs-payment-info" || /*state*/
-    t[7] === "polling-purchase-status") && It(t)
+    t[7] === "polling-purchase-status") && wt(t)
   ), $ = (
     /*state*/
-    t[7] === "loading" && wt()
+    t[7] === "loading" && kt()
   ), E = (
     /*state*/
-    t[7] === "error" && kt(t)
+    t[7] === "error" && $t(t)
   ), B = (
     /*state*/
-    t[7] === "success" && $t(t)
+    t[7] === "success" && vt(t)
   );
   return {
     c() {
-      a && a.c(), e = P(), u && u.c(), r = P(), d && d.c(), n = P(), h && h.c(), i = P(), $ && $.c(), o = P(), E && E.c(), s = P(), B && B.c(), l = ee();
+      a && a.c(), e = P(), u && u.c(), r = P(), d && d.c(), n = P(), h && h.c(), i = P(), $ && $.c(), o = P(), E && E.c(), s = P(), B && B.c(), l = te();
     },
     m(A, y) {
       a && a.m(A, y), p(A, e, y), u && u.m(A, y), p(A, r, y), d && d.m(A, y), p(A, n, y), h && h.m(A, y), p(A, i, y), $ && $.m(A, y), p(A, o, y), E && E.m(A, y), p(A, s, y), B && B.m(A, y), p(A, l, y), c = !0;
@@ -4834,37 +4891,37 @@ function No(t) {
       A[7] === "present-offer" && /*productDetails*/
       A[3] && /*purchaseOption*/
       A[1] ? a ? (a.p(A, y), y & /*state, productDetails, purchaseOption*/
-      138 && f(a, 1)) : (a = ht(A), a.c(), f(a, 1), a.m(e.parentNode, e)) : a && (Y(), m(a, 1, 1, () => {
+      138 && f(a, 1)) : (a = Et(A), a.c(), f(a, 1), a.m(e.parentNode, e)) : a && (H(), m(a, 1, 1, () => {
         a = null;
-      }), H()), /*state*/
+      }), K()), /*state*/
       A[7] === "present-offer" && !/*productDetails*/
       A[3] ? u ? y & /*state, productDetails*/
-      136 && f(u, 1) : (u = Et(), u.c(), f(u, 1), u.m(r.parentNode, r)) : u && (Y(), m(u, 1, 1, () => {
+      136 && f(u, 1) : (u = bt(), u.c(), f(u, 1), u.m(r.parentNode, r)) : u && (H(), m(u, 1, 1, () => {
         u = null;
-      }), H()), /*state*/
+      }), K()), /*state*/
       A[7] === "needs-auth-info" || /*state*/
       A[7] === "processing-auth-info" ? d ? (d.p(A, y), y & /*state*/
-      128 && f(d, 1)) : (d = bt(A), d.c(), f(d, 1), d.m(n.parentNode, n)) : d && (Y(), m(d, 1, 1, () => {
+      128 && f(d, 1)) : (d = It(A), d.c(), f(d, 1), d.m(n.parentNode, n)) : d && (H(), m(d, 1, 1, () => {
         d = null;
-      }), H()), /*paymentInfoCollectionMetadata*/
+      }), K()), /*paymentInfoCollectionMetadata*/
       A[5] && /*state*/
       (A[7] === "needs-payment-info" || /*state*/
       A[7] === "polling-purchase-status") ? h ? (h.p(A, y), y & /*paymentInfoCollectionMetadata, state*/
-      160 && f(h, 1)) : (h = It(A), h.c(), f(h, 1), h.m(i.parentNode, i)) : h && (Y(), m(h, 1, 1, () => {
+      160 && f(h, 1)) : (h = wt(A), h.c(), f(h, 1), h.m(i.parentNode, i)) : h && (H(), m(h, 1, 1, () => {
         h = null;
-      }), H()), /*state*/
+      }), K()), /*state*/
       A[7] === "loading" ? $ ? y & /*state*/
-      128 && f($, 1) : ($ = wt(), $.c(), f($, 1), $.m(o.parentNode, o)) : $ && (Y(), m($, 1, 1, () => {
+      128 && f($, 1) : ($ = kt(), $.c(), f($, 1), $.m(o.parentNode, o)) : $ && (H(), m($, 1, 1, () => {
         $ = null;
-      }), H()), /*state*/
+      }), K()), /*state*/
       A[7] === "error" ? E ? (E.p(A, y), y & /*state*/
-      128 && f(E, 1)) : (E = kt(A), E.c(), f(E, 1), E.m(s.parentNode, s)) : E && (Y(), m(E, 1, 1, () => {
+      128 && f(E, 1)) : (E = $t(A), E.c(), f(E, 1), E.m(s.parentNode, s)) : E && (H(), m(E, 1, 1, () => {
         E = null;
-      }), H()), /*state*/
+      }), K()), /*state*/
       A[7] === "success" ? B ? (B.p(A, y), y & /*state*/
-      128 && f(B, 1)) : (B = $t(A), B.c(), f(B, 1), B.m(l.parentNode, l)) : B && (Y(), m(B, 1, 1, () => {
+      128 && f(B, 1)) : (B = vt(A), B.c(), f(B, 1), B.m(l.parentNode, l)) : B && (H(), m(B, 1, 1, () => {
         B = null;
-      }), H());
+      }), K());
     },
     i(A) {
       c || (f(a), f(u), f(d), f(h), f($), f(E), f(B), c = !0);
@@ -4877,17 +4934,17 @@ function No(t) {
     }
   };
 }
-function Uo(t) {
+function Ro(t) {
   let e, r = (
     /*statesWhereOfferDetailsAreShown*/
     t[9].includes(
       /*state*/
       t[7]
     )
-  ), n, i, o, s, l = r && _t(t);
-  return o = new xt({
+  ), n, i, o, s, l = r && At(t);
+  return o = new Ft({
     props: {
-      $$slots: { default: [No] },
+      $$slots: { default: [Uo] },
       $$scope: { ctx: t }
     }
   }), {
@@ -4900,7 +4957,7 @@ function Uo(t) {
       );
     },
     m(c, a) {
-      p(c, e, a), l && l.m(e, null), M(e, n), M(e, i), b(o, i, null), s = !0;
+      p(c, e, a), l && l.m(e, null), C(e, n), C(e, i), b(o, i, null), s = !0;
     },
     p(c, a) {
       a & /*state*/
@@ -4909,9 +4966,9 @@ function Uo(t) {
         /*state*/
         c[7]
       )), r ? l ? (l.p(c, a), a & /*state*/
-      128 && f(l, 1)) : (l = _t(c), l.c(), f(l, 1), l.m(e, n)) : l && (Y(), m(l, 1, 1, () => {
+      128 && f(l, 1)) : (l = At(c), l.c(), f(l, 1), l.m(e, n)) : l && (H(), m(l, 1, 1, () => {
         l = null;
-      }), H());
+      }), K());
       const u = {};
       a & /*$$scope, brandingInfo, state, lastError, paymentInfoCollectionMetadata, productDetails, purchaseOption*/
       67109114 && (u.$$scope = { dirty: a, ctx: c }), o.$set(u);
@@ -4927,15 +4984,15 @@ function Uo(t) {
     }
   };
 }
-function Ro(t) {
+function So(t) {
   let e, r, n;
-  return r = new io({
+  return r = new so({
     props: {
       condition: (
         /*asModal*/
         t[0]
       ),
-      $$slots: { default: [Uo] },
+      $$slots: { default: [Ro] },
       $$scope: { ctx: t }
     }
   }), {
@@ -4964,12 +5021,12 @@ function Ro(t) {
   };
 }
 function Oo(t, e, r) {
-  var Ze, et;
+  var et, tt;
   let { asModal: n = !0 } = e, { customerEmail: i } = e, { appUserId: o } = e, { rcPackage: s } = e, { purchaseOption: l } = e, { onFinished: c } = e, { onError: a } = e, { onClose: u } = e, { purchases: d } = e, { backend: h } = e, { purchaseOperationHelper: $ } = e;
   const E = Object.entries(_e).map(([D, xe]) => `--rc-color-${D}: ${xe}`).join("; ");
   let B = null, A = null, y = null, R = null;
-  const C = ((Ze = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : Ze.identifier) ?? null, ve = (et = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : et.defaultSubscriptionOption, F = l || ve;
-  let O = "present-offer";
+  const M = ((et = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : et.identifier) ?? null, ve = (tt = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : tt.defaultSubscriptionOption, F = l || ve;
+  let S = "present-offer";
   const ye = [
     "present-offer",
     "needs-auth-info",
@@ -4978,58 +5035,58 @@ function Oo(t, e, r) {
     "polling-purchase-status",
     "loading"
   ];
-  Se(async () => {
-    if (r(3, B = s.rcBillingProduct), r(4, A = await h.getBrandingInfo()), O === "present-offer") {
-      i ? Xe() : r(7, O = "needs-auth-info");
+  Oe(async () => {
+    if (r(3, B = s.rcBillingProduct), r(4, A = await h.getBrandingInfo()), S === "present-offer") {
+      i ? Ze() : r(7, S = "needs-auth-info");
       return;
     }
   });
   const Be = () => {
     u();
-  }, Xe = () => {
-    if (C === null) {
-      de(new K(L.ErrorSettingUpPurchase, "Product ID was not set before purchase."));
+  }, Ze = () => {
+    if (M === null) {
+      de(new Y(O.ErrorSettingUpPurchase, "Product ID was not set before purchase."));
       return;
     } else
-      O === "present-offer" && r(7, O = "loading");
+      S === "present-offer" && r(7, S = "loading");
     if (!i) {
-      de(new K(L.MissingEmailError));
+      de(new Y(O.MissingEmailError));
       return;
     }
-    $.startPurchase(o, C, F, i, s.rcBillingProduct.presentedOfferingIdentifier).then((D) => {
+    $.startPurchase(o, M, F, i, s.rcBillingProduct.presentedOfferingIdentifier).then((D) => {
       if (D.next_action === "collect_payment_info") {
-        r(7, O = "needs-payment-info"), r(5, y = D);
+        r(7, S = "needs-payment-info"), r(5, y = D);
         return;
       }
       if (D.next_action === "completed") {
-        r(7, O = "success");
+        r(7, S = "success");
         return;
       }
     }).catch((D) => {
-      de(new K(L.ErrorSettingUpPurchase, D.message, D.underlyingErrorMessage));
+      de(D);
     });
   }, Yt = (D) => {
-    if (O === "needs-auth-info") {
-      D && (r(14, i = D.email), r(7, O = "processing-auth-info")), Xe();
+    if (S === "needs-auth-info") {
+      D && (r(14, i = D.email), r(7, S = "processing-auth-info")), Ze();
       return;
     }
-    if (O === "needs-payment-info") {
-      r(7, O = "polling-purchase-status"), $.pollCurrentPurchaseForCompletion().then(() => {
-        r(7, O = "success");
+    if (S === "needs-payment-info") {
+      r(7, S = "polling-purchase-status"), $.pollCurrentPurchaseForCompletion().then(() => {
+        r(7, S = "success");
       }).catch((xe) => {
         de(xe);
       });
       return;
     }
-    if (O === "success" || O === "error") {
+    if (S === "success" || S === "error") {
       c();
       return;
     }
-    r(7, O = "success");
+    r(7, S = "success");
   }, de = (D) => {
-    r(6, R = D), r(7, O = "error");
+    r(6, R = D), r(7, S = "error");
   }, Ht = () => {
-    a(R ?? new K(L.UnknownError, "Unknown error without state set."));
+    a(R ?? new Y(O.UnknownError, "Unknown error without state set."));
   };
   return t.$$set = (D) => {
     "asModal" in D && r(0, n = D.asModal), "customerEmail" in D && r(14, i = D.customerEmail), "appUserId" in D && r(15, o = D.appUserId), "rcPackage" in D && r(16, s = D.rcPackage), "purchaseOption" in D && r(1, l = D.purchaseOption), "onFinished" in D && r(17, c = D.onFinished), "onError" in D && r(18, a = D.onError), "onClose" in D && r(19, u = D.onClose), "purchases" in D && r(2, d = D.purchases), "backend" in D && r(20, h = D.backend), "purchaseOperationHelper" in D && r(21, $ = D.purchaseOperationHelper);
@@ -5041,7 +5098,7 @@ function Oo(t, e, r) {
     A,
     y,
     R,
-    O,
+    S,
     E,
     ye,
     Be,
@@ -5058,13 +5115,13 @@ function Oo(t, e, r) {
     $
   ];
 }
-class So extends U {
+class Lo extends U {
   constructor(e) {
     super(), N(
       this,
       e,
       Oo,
-      Ro,
+      So,
       T,
       {
         asModal: 0,
@@ -5079,37 +5136,37 @@ class So extends U {
         backend: 20,
         purchaseOperationHelper: 21
       },
-      Do
+      Mo
     );
   }
 }
-function Lo(t) {
+function xo(t) {
   return t.expires_date == null ? !0 : new Date(t.expires_date) > /* @__PURE__ */ new Date();
 }
-function xo(t, e, r, n) {
+function Fo(t, e, r, n) {
   const i = e.product_identifier;
   if (i in r)
-    return Fo(
+    return Go(
       t,
       e,
       r[i]
     );
   if (i in n)
-    return Go(
+    return Yo(
       t,
       e,
       n[i]
     );
   throw new X(
-    ne.CustomerInfoError,
+    ee.CustomerInfoError,
     "Could not find entitlement product in subscriptions or non-subscriptions."
   );
 }
-function Fo(t, e, r) {
+function Go(t, e, r) {
   return {
     identifier: t,
-    isActive: Lo(e),
-    willRenew: Ko(e, r),
+    isActive: xo(e),
+    willRenew: qo(e, r),
     store: (r == null ? void 0 : r.store) ?? "unknown",
     latestPurchaseDate: new Date(e.purchase_date),
     originalPurchaseDate: new Date(e.purchase_date),
@@ -5125,7 +5182,7 @@ function Fo(t, e, r) {
     periodType: (r == null ? void 0 : r.period_type) ?? "normal"
   };
 }
-function Go(t, e, r) {
+function Yo(t, e, r) {
   return {
     identifier: t,
     isActive: !0,
@@ -5143,10 +5200,10 @@ function Go(t, e, r) {
     periodType: "normal"
   };
 }
-function Yo(t, e, r) {
+function Ho(t, e, r) {
   const n = {}, i = {};
   for (const o in t) {
-    const s = xo(
+    const s = Fo(
       o,
       t[o],
       e,
@@ -5162,22 +5219,22 @@ function Yo(t, e, r) {
 function Ne(t) {
   return t == null ? null : new Date(t);
 }
-function Ho(t) {
-  const e = jo(t), r = t.subscriber, n = Vo(
+function Ko(t) {
+  const e = Jo(t), r = t.subscriber, n = Wo(
     r.non_subscriptions
   );
   return {
-    entitlements: Yo(
+    entitlements: Ho(
       r.entitlements,
       r.subscriptions,
       n
     ),
     allExpirationDatesByProduct: e,
-    allPurchaseDatesByProduct: qo(
+    allPurchaseDatesByProduct: jo(
       t,
       n
     ),
-    activeSubscriptions: Jo(e),
+    activeSubscriptions: Vo(e),
     managementURL: r.management_url,
     requestDate: new Date(t.request_date),
     firstSeenDate: new Date(r.first_seen),
@@ -5187,13 +5244,13 @@ function Ho(t) {
     originalAppUserId: t.subscriber.original_app_user_id
   };
 }
-function Ko(t, e) {
+function qo(t, e) {
   if (e == null)
     return !1;
   const r = e.store == "promotional", n = t.expires_date == null, i = e.unsubscribe_detected_at != null, o = e.billing_issues_detected_at != null;
   return !(r || n || i || o);
 }
-function qo(t, e) {
+function jo(t, e) {
   const r = {};
   for (const n in t.subscriber.subscriptions) {
     const i = t.subscriber.subscriptions[n];
@@ -5207,7 +5264,7 @@ function qo(t, e) {
   }
   return r;
 }
-function jo(t) {
+function Jo(t) {
   const e = {};
   for (const r in t.subscriber.subscriptions) {
     const n = t.subscriber.subscriptions[r];
@@ -5217,7 +5274,7 @@ function jo(t) {
   }
   return e;
 }
-function Jo(t) {
+function Vo(t) {
   const e = /* @__PURE__ */ new Set(), r = /* @__PURE__ */ new Date();
   for (const n in t) {
     const i = t[n];
@@ -5225,7 +5282,7 @@ function Jo(t) {
   }
   return e;
 }
-function Vo(t) {
+function Wo(t) {
   const e = {};
   for (const r in t) {
     if (t[r].length === 0)
@@ -5235,14 +5292,14 @@ function Vo(t) {
   }
   return e;
 }
-function Wo(t) {
+function zo(t) {
   if (!/^rcb_[a-zA-Z0-9_.-]+$/.test(t))
     throw new X(
-      ne.InvalidCredentialsError,
+      ee.InvalidCredentialsError,
       "Invalid API key. Use your RevenueCat Billing API key."
     );
 }
-function zo(t) {
+function Xo(t) {
   if ((/* @__PURE__ */ new Set([
     "no_user",
     "null",
@@ -5257,7 +5314,7 @@ function zo(t) {
     "unknown"
   ])).has(t) || t.includes("/"))
     throw new X(
-      ne.InvalidAppUserIdError,
+      ee.InvalidAppUserIdError,
       'Provided user id: "' + t + '" is not valid. See https://www.revenuecat.com/docs/customers/user-ids#tips-for-setting-app-user-ids for more information.'
     );
 }
@@ -5280,9 +5337,9 @@ const z = class z {
       r.product_details.forEach((l) => {
         i[l.identifier] = l;
       });
-      const o = n == null ? null : rt(n, i), s = {};
+      const o = n == null ? null : it(n, i), s = {};
       return e.offerings.forEach((l) => {
-        const c = rt(l, i);
+        const c = it(l, i);
         c != null && (s[l.identifier] = c);
       }), Object.keys(s).length == 0 && G.debugLog(
         "Empty offerings. Please make sure you've configured offerings correctly in the RevenueCat dashboard and that the products are properly configured."
@@ -5291,7 +5348,7 @@ const z = class z {
         current: o
       };
     });
-    this._API_KEY = e, this._appUserId = r, je(e) && G.debugLog("Initializing Purchases SDK with sandbox API Key"), this.backend = new Io(this._API_KEY), this.purchaseOperationHelper = new Gn(this.backend);
+    this._API_KEY = e, this._appUserId = r, je(e) && G.debugLog("Initializing Purchases SDK with sandbox API Key"), this.backend = new wo(this._API_KEY), this.purchaseOperationHelper = new Yn(this.backend);
   }
   /**
    * Set the log level. Logs of the given level and below will be printed
@@ -5310,7 +5367,7 @@ const z = class z {
   static getSharedInstance() {
     if (z.isConfigured())
       return z.instance;
-    throw new ao();
+    throw new Gn();
   }
   /**
    * Returns whether the Purchases SDK is configured or not.
@@ -5329,7 +5386,7 @@ const z = class z {
   static configure(e, r) {
     return z.instance !== void 0 && G.warnLog(
       "Purchases is already initialized. You normally should only configure Purchases once. Creating and returning new instance."
-    ), Wo(e), zo(r), z.instance = new z(e, r), z.getSharedInstance();
+    ), zo(e), Xo(r), z.instance = new z(e, r), z.getSharedInstance();
   }
   /**
    * Fetch the configured offerings for this user. You can configure these
@@ -5397,7 +5454,7 @@ const z = class z {
     return G.debugLog(
       `Presenting purchase form for package ${r.identifier}`
     ), new Promise((u, d) => {
-      new So({
+      new Lo({
         target: l,
         props: {
           appUserId: a,
@@ -5410,7 +5467,7 @@ const z = class z {
             });
           },
           onClose: () => {
-            l.innerHTML = "", G.debugLog("Purchase cancelled by user"), d(new X(ne.UserCancelledError));
+            l.innerHTML = "", G.debugLog("Purchase cancelled by user"), d(new X(ee.UserCancelledError));
           },
           onError: (h) => {
             l.innerHTML = "", d(X.getForPurchasesFlowError(h));
@@ -5477,17 +5534,17 @@ const z = class z {
   /** @internal */
   async _getCustomerInfoForUserId(e) {
     const r = await this.backend.getCustomerInfo(e);
-    return Ho(r);
+    return Ko(r);
   }
 };
 /** @internal */
 Q(z, "instance");
-let vt = z;
+let yt = z;
 export {
-  ne as ErrorCode,
+  ee as ErrorCode,
   W as LogLevel,
   zt as PackageType,
-  vt as Purchases,
+  yt as Purchases,
   X as PurchasesError,
-  ao as UninitializedPurchasesError
+  Gn as UninitializedPurchasesError
 };