@revenuecat/purchases-js 0.3.0 → 0.3.1

package/dist/Purchases.es.js

@@ -48,7 +48,7 @@ class G {
 }
 Q(G, "logLevel", W.Silent);
 var te = /* @__PURE__ */ ((t) => (t.Year = "year", t.Month = "month", t.Week = "week", t.Day = "day", t))(te || {});
-function yt(t) {
+function Je(t) {
   const e = t.match(/^PT?([0-9]+)([MDYW])$/);
   if (!e || e.length < 3)
     return G.errorLog(`Invalid ISO 8601 duration format: ${t}`), null;
@@ -82,7 +82,7 @@ function yt(t) {
       return G.errorLog(`Invalid ISO 8601 unit duration format: ${t}`), null;
   }
 }
-const Je = (t, e) => {
+const Ve = (t, e) => {
   const r = t / 100;
   return new Intl.NumberFormat("en-US", {
     style: "currency",
@@ -118,26 +118,30 @@ const Je = (t, e) => {
     }
   else
     return `${e} ${t.unit}s`;
-}, tt = (t) => {
-  const e = yt(t);
+}, nt = (t) => {
+  const e = Je(t);
   return e ? Jt(e) : "unknown";
 }, Wt = (t) => {
-  const e = yt(t);
+  const e = Je(t);
   return e ? Vt(e) : "unknown";
 };
 var zt = /* @__PURE__ */ ((t) => (t.Unknown = "unknown", t.Custom = "custom", t.Lifetime = "$rc_lifetime", t.Annual = "$rc_annual", t.SixMonth = "$rc_six_month", t.ThreeMonth = "$rc_three_month", t.TwoMonth = "$rc_two_month", t.Monthly = "$rc_monthly", t.Weekly = "$rc_weekly", t))(zt || {});
 const Xt = (t) => ({
   amount: t.amount,
   currency: t.currency,
-  formattedPrice: Je(t.amount, t.currency)
-}), nt = (t) => ({
-  periodDuration: t.period_duration,
-  cycleCount: t.cycle_count,
-  price: t.price ? Xt(t.price) : null
-}), Zt = (t) => t.base == null ? (G.debugLog("Missing base phase for subscription option. Ignoring."), null) : {
+  formattedPrice: Ve(t.amount, t.currency)
+}), rt = (t) => {
+  const e = t.period_duration;
+  return {
+    periodDuration: e,
+    period: e ? Je(e) : null,
+    cycleCount: t.cycle_count,
+    price: t.price ? Xt(t.price) : null
+  };
+}, Zt = (t) => t.base == null ? (G.debugLog("Missing base phase for subscription option. Ignoring."), null) : {
   id: t.id,
-  base: nt(t.base),
-  trial: t.trial ? nt(t.trial) : null
+  base: rt(t.base),
+  trial: t.trial ? rt(t.trial) : null
 }, en = (t, e) => {
   const r = {};
   if (Object.entries(t.subscription_options).forEach(
@@ -178,7 +182,7 @@ const Xt = (t) => ({
     rcBillingProduct: i,
     packageType: nn(e.identifier)
   };
-}, rt = (t, e) => {
+}, it = (t, e) => {
   const r = t.packages.map(
     (i) => tn(t.identifier, i, e)
   ).filter(jt), n = {};
@@ -232,7 +236,7 @@ function rn(t, e) {
 function Bt(t) {
   return t();
 }
-function it() {
+function ot() {
   return /* @__PURE__ */ Object.create(null);
 }
 function we(t) {
@@ -248,11 +252,11 @@ let De;
 function Z(t, e) {
   return t === e ? !0 : (De || (De = document.createElement("a")), De.href = e, t === De.href);
 }
-function ot(t) {
+function st(t) {
   return t.split(",").map((e) => e.trim().split(" ").filter(Boolean));
 }
 function on(t, e) {
-  const r = ot(t.srcset), n = ot(e || "");
+  const r = st(t.srcset), n = st(e || "");
   return n.length === r.length && n.every(
     ([i, o], s) => o === r[s][1] && // We need to test both ways because Vite will create an a full URL with
     // `new URL(asset, import.meta.url).href` for the client when `base: './'`, and the
@@ -307,10 +311,10 @@ function V(t) {
 function Ee(t) {
   return t ?? "";
 }
-function M(t, e) {
+function C(t, e) {
   t.appendChild(e);
 }
-function x(t, e, r) {
+function F(t, e, r) {
   const n = ln(t);
   if (!n.getElementById(e)) {
     const i = k("style");
@@ -328,7 +332,7 @@ function ln(t) {
   ) : t.ownerDocument;
 }
 function cn(t, e) {
-  return M(
+  return C(
     /** @type {Document} */
     t.head || t,
     e
@@ -355,7 +359,7 @@ function ee() {
 function ke(t, e, r, n) {
   return t.addEventListener(e, r, n), () => t.removeEventListener(e, r, n);
 }
-function Ct(t) {
+function Mt(t) {
   return function(e) {
     return e.preventDefault(), t.call(this, e);
   };
@@ -388,7 +392,7 @@ function ae(t, e) {
   e = "" + e, t.data !== e && (t.data = /** @type {string} */
   e);
 }
-function st(t, e) {
+function lt(t, e) {
   t.value = e ?? "";
 }
 function pn(t, e, { bubbles: r = !1, cancelable: n = !1 } = {}) {
@@ -430,7 +434,7 @@ function An(t, e) {
 function hn(t) {
   return Oe().$$.context.get(t);
 }
-function Mt(t, e) {
+function Ct(t, e) {
   const r = t.$$.callbacks[e.type];
   r && r.slice().forEach((n) => n.call(this, e));
 }
@@ -447,7 +451,7 @@ function qe(t) {
 function In(t) {
   He.push(t);
 }
-const Fe = /* @__PURE__ */ new Set();
+const xe = /* @__PURE__ */ new Set();
 let ie = 0;
 function Qt() {
   if (ie !== 0)
@@ -466,13 +470,13 @@ function Qt() {
       Ue.pop()();
     for (let e = 0; e < le.length; e += 1) {
       const r = le[e];
-      Fe.has(r) || (Fe.add(r), r());
+      xe.has(r) || (xe.add(r), r());
     }
     le.length = 0;
   } while (se.length);
   for (; He.length; )
     He.pop()();
-  Ke = !1, Fe.clear(), Ae(t);
+  Ke = !1, xe.clear(), Ae(t);
 }
 function wn(t) {
   if (t.fragment !== null) {
@@ -542,7 +546,7 @@ function N(t, e, r, n, i, o, s = null, l = [-1]) {
     props: o,
     update: v,
     not_equal: i,
-    bound: it(),
+    bound: ot(),
     // lifecycle
     on_mount: [],
     on_destroy: [],
@@ -551,7 +555,7 @@ function N(t, e, r, n, i, o, s = null, l = [-1]) {
     after_update: [],
     context: new Map(e.context || (c ? c.$$.context : [])),
     // everything else
-    callbacks: it(),
+    callbacks: ot(),
     dirty: l,
     skip_bound: !1,
     root: e.target || c.$$.root
@@ -620,7 +624,7 @@ class U {
 const yn = "4";
 typeof window < "u" && (window.__svelte || (window.__svelte = { v: /* @__PURE__ */ new Set() })).v.add(yn);
 function Bn(t) {
-  x(t, "svelte-1bzqb13", ".rcb-modal-section.svelte-1bzqb13{padding:8px 0px;display:flex}section.rcb-modal-section.svelte-1bzqb13{flex-grow:1}.rcb-modal-section.svelte-1bzqb13:last-of-type{padding:0}");
+  F(t, "svelte-1bzqb13", ".rcb-modal-section.svelte-1bzqb13{padding:8px 0px;display:flex}section.rcb-modal-section.svelte-1bzqb13{flex-grow:1}.rcb-modal-section.svelte-1bzqb13:last-of-type{padding:0}");
 }
 function Ge(t) {
   let e, r;
@@ -718,7 +722,7 @@ function Dn(t) {
     }
   };
 }
-function Cn(t, e, r) {
+function Mn(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { as: o = "section" } = e;
   return t.$$set = (s) => {
     "as" in s && r(0, o = s.as), "$$scope" in s && r(1, i = s.$$scope);
@@ -726,11 +730,11 @@ function Cn(t, e, r) {
 }
 class ue extends U {
   constructor(e) {
-    super(), N(this, e, Cn, Dn, T, { as: 0 }, Bn);
+    super(), N(this, e, Mn, Dn, T, { as: 0 }, Bn);
   }
 }
-function Mn(t) {
-  x(t, "svelte-gf0gr5", ".rcb-pricing-info.svelte-gf0gr5{display:flex;flex-direction:column;margin-top:102px;font-weight:500}.rcb-product-price.svelte-gf0gr5{font-size:24px;margin:12px 0px}.rcb-product-price-after-trial.svelte-gf0gr5{margin-bottom:12px}.rcb-product-details.svelte-gf0gr5{opacity:0.6;list-style-type:disc;list-style-position:inside;margin:0px;padding:0px}@media screen and (max-width: 960px){.rcb-pricing-info.svelte-gf0gr5{margin-top:48px}}");
+function Cn(t) {
+  F(t, "svelte-gf0gr5", ".rcb-pricing-info.svelte-gf0gr5{display:flex;flex-direction:column;margin-top:102px;font-weight:500}.rcb-product-price.svelte-gf0gr5{font-size:24px;margin:12px 0px}.rcb-product-price-after-trial.svelte-gf0gr5{margin-bottom:12px}.rcb-product-details.svelte-gf0gr5{opacity:0.6;list-style-type:disc;list-style-position:inside;margin:0px;padding:0px}@media screen and (max-width: 960px){.rcb-pricing-info.svelte-gf0gr5{margin-top:48px}}");
 }
 function Qn(t) {
   let e = Wt(
@@ -754,7 +758,7 @@ function Pn(t) {
   let e = (
     /*basePrice*/
     (t[2].currency || "") + ""
-  ), r, n, i = Je(
+  ), r, n, i = Ve(
     /*basePrice*/
     t[2].amount,
     /*basePrice*/
@@ -780,7 +784,7 @@ function Tn(t) {
       e = k("span"), e.textContent = `${/*trial*/
       t[1] && /*basePrice*/
       t[2] && `${/*basePrice*/
-      t[2].currency} ${Je(
+      t[2].currency} ${Ve(
         /*basePrice*/
         t[2].amount,
         /*basePrice*/
@@ -796,8 +800,8 @@ function Tn(t) {
     }
   };
 }
-function lt(t) {
-  let e, r, n = tt(
+function ct(t) {
+  let e, r, n = nt(
     /*productDetails*/
     t[0].normalPeriodDuration
   ) + "", i;
@@ -806,11 +810,11 @@ function lt(t) {
       e = k("li"), r = S("Renews "), i = S(n);
     },
     m(o, s) {
-      p(o, e, s), M(e, r), M(e, i);
+      p(o, e, s), C(e, r), C(e, i);
     },
     p(o, s) {
       s & /*productDetails*/
-      1 && n !== (n = tt(
+      1 && n !== (n = nt(
         /*productDetails*/
         o[0].normalPeriodDuration
       ) + "") && ae(i, n);
@@ -821,13 +825,13 @@ function lt(t) {
   };
 }
 function Nn(t) {
-  var C, ve;
+  var M, ve;
   let e, r, n = (
     /*productDetails*/
     t[0].displayName + ""
   ), i, o, s, l, c, a, u, d, h, $, E, B = (
     /*trial*/
-    ((C = t[1]) == null ? void 0 : C.periodDuration) && Qn(t)
+    ((M = t[1]) == null ? void 0 : M.periodDuration) && Qn(t)
   ), A = !/*trial*/
   ((ve = t[1]) != null && ve.periodDuration) && /*basePrice*/
   t[2] && Pn(t), y = (
@@ -836,29 +840,29 @@ function Nn(t) {
     t[2] && Tn(t)
   ), R = (
     /*productDetails*/
-    t[0].normalPeriodDuration && lt(t)
+    t[0].normalPeriodDuration && ct(t)
   );
   return {
     c() {
       e = k("div"), r = k("span"), i = S(n), o = P(), s = k("span"), B && B.c(), l = P(), A && A.c(), c = P(), y && y.c(), a = P(), u = k("ul"), R && R.c(), d = P(), h = k("li"), h.textContent = "Continues until canceled", $ = P(), E = k("li"), E.textContent = "Cancel anytime", _(s, "class", "rcb-product-price svelte-gf0gr5"), _(u, "class", "rcb-product-details svelte-gf0gr5"), _(e, "class", "rcb-pricing-info svelte-gf0gr5");
     },
-    m(F, O) {
-      p(F, e, O), M(e, r), M(r, i), M(e, o), M(e, s), B && B.m(s, null), M(s, l), A && A.m(s, null), M(e, c), y && y.m(e, null), M(e, a), M(e, u), R && R.m(u, null), M(u, d), M(u, h), M(u, $), M(u, E);
+    m(x, O) {
+      p(x, e, O), C(e, r), C(r, i), C(e, o), C(e, s), B && B.m(s, null), C(s, l), A && A.m(s, null), C(e, c), y && y.m(e, null), C(e, a), C(e, u), R && R.m(u, null), C(u, d), C(u, h), C(u, $), C(u, E);
     },
-    p(F, O) {
+    p(x, O) {
       var ye, Be;
       O & /*productDetails*/
       1 && n !== (n = /*productDetails*/
-      F[0].displayName + "") && ae(i, n), /*trial*/
-      (ye = F[1]) != null && ye.periodDuration && B.p(F, O), !/*trial*/
-      ((Be = F[1]) != null && Be.periodDuration) && /*basePrice*/
-      F[2] && A.p(F, O), /*trial*/
-      F[1] && /*basePrice*/
-      F[2] && y.p(F, O), /*productDetails*/
-      F[0].normalPeriodDuration ? R ? R.p(F, O) : (R = lt(F), R.c(), R.m(u, d)) : R && (R.d(1), R = null);
+      x[0].displayName + "") && ae(i, n), /*trial*/
+      (ye = x[1]) != null && ye.periodDuration && B.p(x, O), !/*trial*/
+      ((Be = x[1]) != null && Be.periodDuration) && /*basePrice*/
+      x[2] && A.p(x, O), /*trial*/
+      x[1] && /*basePrice*/
+      x[2] && y.p(x, O), /*productDetails*/
+      x[0].normalPeriodDuration ? R ? R.p(x, O) : (R = ct(x), R.c(), R.m(u, d)) : R && (R.d(1), R = null);
     },
-    d(F) {
-      F && g(e), B && B.d(), A && A.d(), y && y.d(), R && R.d();
+    d(x) {
+      x && g(e), B && B.d(), A && A.d(), y && y.d(), R && R.d();
     }
   };
 }
@@ -902,7 +906,7 @@ function Rn(t, e, r) {
 }
 class Pt extends U {
   constructor(e) {
-    super(), N(this, e, Rn, Un, T, { productDetails: 0, purchaseOption: 3 }, Mn);
+    super(), N(this, e, Rn, Un, T, { productDetails: 0, purchaseOption: 3 }, Cn);
   }
 }
 const On = "data:image/gif;base64,R0lGODlhMgAyAPcBAAAAAAD/AAMDAwcHBxERERUVFSoqKi0tLTAwMDg4OD09PURERElJSUtLS1BQUFJSUlVVVVdXV1paWl9fX2NjY2ZmZmlpaWxsbG1tbXNzc3t7e39/f4GBgYKCgoSEhIaGhoeHh4iIiIuLi5KSkpSUlJaWlp2dnaGhoaOjo6SkpKWlpaenp6ioqKqqqqurq6ysrLCwsLGxsbS0tLa2tri4uLm5ub29vb6+vsDAwMHBwcLCwsXFxcjIyMnJyc3Nzc7OztPT09TU1NXV1dfX19nZ2dra2tvb29zc3N7e3uDg4OHh4eLi4uPj4+fn5+np6ezs7O7u7vDw8PHx8fLy8vPz8/X19fb29vj4+Pn5+fz8/P39/f7+/v///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////yH/C05FVFNDQVBFMi4wAwEAAAAh+QQFBAABACwAAAAAMgAyAIcAAAAA/wADAwMHBwcREREVFRUqKiotLS0wMDA4ODg9PT1ERERJSUlLS0tQUFBSUlJVVVVXV1daWlpfX19jY2NmZmZpaWlsbGxtbW1zc3N7e3t/f3+BgYGCgoKEhISGhoaHh4eIiIiLi4uSkpKUlJSWlpadnZ2hoaGjo6OkpKSlpaWnp6eoqKiqqqqrq6usrKywsLCxsbG0tLS2tra4uLi5ubm9vb2+vr7AwMDBwcHCwsLFxcXIyMjJycnNzc3Ozs7T09PU1NTV1dXX19fZ2dna2trb29vc3Nze3t7g4ODh4eHi4uLj4+Pn5+fp6ens7Ozu7u7w8PDx8fHy8vLz8/P19fX29vb4+Pj5+fn8/Pz9/f3+/v7///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////8I/wCzcBFIcKDBgggPKkzIcCEXLlq4bIEokeLEiBcrYrTIcaNHjRobinQ4sqRCkBlTdtR44MBKlR9TmjQJQMBMkgZfdpwSMSYAACgpRtHpcSYSFUIa1mz448UQnAWDfmzSooUVmD9XVnnBwglMlDdvvMjhcOlCHit23CSqcUrVJiizpnTC4sXQmB1vZvmxwgYWhWYLznjRA+rJryqvxGhxxGNLjkVcwMCCN6ZeLkNevDCcRYYKJJfZptyCQwdiijl0CDxdlLPryw2lymY9WzTs17ijVq69mzbM28Bd8x7u23bu46F7i16uXEvw5ziJM5duGbl1k9OLN5cKvfvh7OC3b0jxTv6h+PDUy3unzl67RPXXc56fnz4+/PbofcOHnr9/5f3x4UeffvYVqJuACP5m4IIJ+gfWgusN6KCCAN7WoITVVXjchBxqERAAIfkEBQQAAQAsDQADACAAEAAACKcAAwgcSDDAAwcFEypcSNDAAYYQA2DZstCAAYZOKCqM8uNJxYcKa3DYsVBKECBYFFpU+MTDhiIMkQxBohJkwRYaUkDEEiQIlYQrCyLZ0MFJRCdAkgC1OZBEBxgRJRIBAqXgwYI8NoCwEjWAkyFDoorQ4KOrQCRLoqbQuZCKR7NdqzD5MaQKXIhZmAwBIqTJ3YVYogQZ8oMJ178Kk/A1YhfxQiRHjBYMCAAh+QQFBQABACwNAAMAIAAQAAAInQADCBxIMECGDAUTKlxI8EEEhhADcGEI4QFDJQy5ZJmo0OFCFBFkLNzCRQvHghEgKHQi4cEPhhuzdHyYUMQDDxC5kNSSsGLCIA4x5oxZ0GNBDBFKRAxgkmTBgwVpRJhAZWkAohErPKhhVaLJpR8+YFnohEjXrlB2qHgB5SxELD5etHgBxC1DJC9eqOAxxe5CHSxc0HDilyEOGWYLBgQAIfkEBQQAAQAsGAADABcAFwAACJYAS5AIQLCgwYMINXBAyLDhhg0NtxRpWFBDh4YiDpygGOAhwyUIDOTgqJAhBgMVOHaEeLCHgQMTSV40uKXBAZYcBR5UYSBBFJUNFRhoAbShhZQNi/DYUvRgkxQKmzQlaCVGhw0eakwN4MNDBw0tnmxN8ZAEkq0ET4jYgbat27dw474lMuTHECB1hxBpigRIECBC/AJBEhAAIfkEBQQAAQAsGAADABcAFwAACJIAa9AIQLCgwYMIVbxAyLBhCxYNAwCJSHDFQoYaBIyg6KIFQyQDAMigqJAhBAAMKAZ4iPAGAAETKVpEaECABZUBBB4kAYAAFJwMCwAoAZQhg5QNf4wsajCJhwcRkjANQMVEBAgSVDC9UkNChAcimkz9ADVDkKkEPVRYirat27dw47ad8UKhRYUzitZo8bDjwxoBAQAh+QQFBAABACwYAAMAFwAiAAAIvwCRGAlAsKDBgwh/DEHIsGEQIA0DFIlIEMhChiIOnKAoBCLCJQgM5KCokCEGAxUoBniIsIeBAxMpWkTY4MAGlQEEHlRhIEEUnAwVGGgBlKGFlA1zbCxqkEiFl0SYBojS4YABBCO2MG2RwCqGJFKfGnDQQyrBCgpQaDXLtq3bt3DZkuiggYMGuhxIFC2xoa/fDSXiCh5MuDDBJUSgZGl7ZAiQJFLYbnlCBEiQJFjYXnFiEciTtliSPMzcNspPggEBACH5BAUEAAEALBgAAwAXACIAAAi6ALlsCUCwoMGDCLNwQciwIRctDpU0LKiwIYoIMiYGEMjQiYQHPzRWRCjigQeNGyEeDPIggkSRCw1ywRChBMqNAw3SiDCByk2GFR7U+Mnww4eJMkYQPQiEAQABQJYGgGJBAIABGqSWIGAVghGpTgEcuCGVIIMCSsuqXcu2rdu1NFvKjYCBaAYIEFrifZDhrd+/gAMT1AHjCNsbL1bYYLKWSIwWLXRYUVvlB4sXLISsnYKjBYspbJkgKRgQACH5BAUEAAEALB8ABQAQACgAAAjDAAMIDOBkoMGDAmtw2IEQ4RMPG4o0PNhCQ4qJBpFs6FAQo0ASHWB4FMhjAwgrIwOI0OAjZYAUKbJMzHEiJZEKBg4QwRilwwEDCEZgbJHgJ4YkGHEacNBjZAUFKFxKnUq1qlWBDX5qzdmg4QMDYMMaeHC1rNmzA1WIaJryBAcNJSR61MIjxIYNKqKMnDJj4wYcKZ2cuNuRyRGMQ3xgEUgkyBOXUYAUuZIyCxIgTVxKGQJEZsokQpBWBjJEb2Agj116xhgQACH5BAUFAAEALB8ABQAQACgAAAjFAAMIDBCFy8CDCAP8eDEkYcIqL1g4cYiQx4odFA86YfEiSsaBM170+CiwiAsYWEgGkKECicoAOXRk/CFDZRIPDyIkyUjFRAQIElQYdFhDQoQHIppk/JAzQxCSHirIGPqyqtWrWLEaEACAq1cDDg8AGEsWwIGsaNOqdRiCQo2XHY5m+EEyy4wJECCEmPgxygkIESK0UMmEA4QHTATuuJGxx1uBMFoQeYlkhYwqL2u0oEs4ImaVOlzgeHmFY2KVQFgYqfo5Y0AAIfkEBQQAAQAsGAAFABcAKgAACOUAAwgcSDDAlYIIEw5kMsSJwocCrwgBQgXiQyZAmFhUWAXIkIMbERIZojFkwSdChmQxWfDIjygsCyZJ8rAIj5gDm6TQwKFJTCsxOmzwUIMlFh8eOmho8SRmig0bSCDBGeCEiB1Us2rdyrWryQYHDIQd28DkAwNo0xp44LWt27dtLShYgSUrhbAPsFJVkQDthZIxn3wQe4BEXZxHKKA98pDFiYc2VEAUseHmRiI0CfrQIGLKxokIS2yQsfHHEIRFOGxoCjEIkIQqNjyG6DGhlA0cTj8EndDGhh4QTT98clih662YtwYEACH5BAUEAAEALBgABQAXACoAAAjfAAMIHEgwwJaCCBMOzMIli8KHArdw0cIF4sOGFS0mnMjloEaEDB1+LEhR4siCGE8WlKhFoRMiGVVC2aHiBRSVWHy8aPECiEokL16o4DFFpQ4WLmg4USkQhwwiTKNKnUq16lQMER5k3YphZAYIELSCfZDBqtmzaNMKbFCgxNQFAgAgqCF1BAEAABwkieoEAwABAjZIFbIAr5CHIjp4RBiDBEQKEGZ8nGGjYI0HFKJodNEC4VcTGmsi/BEBAhOLLVgkDBGBg8UVLxI+iRChB0TOClc8oAFRtMLTEFNTpUw1IAAh+QQFBAABACwNAA0AIgAiAAAI5QADCBxIsKDBgwGoPEHIsOHAKkx+DKnisCLBLEyGABHSxKLHKEGG/GBixaPFJBuNUDRpEckRJyxjypxJs6bNmzhvkuiggYMGnhxI5CyxoajRDSVyKl3KtKlTphYUrHhK4YCBBzucqkhgwMAFJk2ffDBw4IDQpkcodD1SEMsSJBUvUGBoQ4VBKECKVFRgwK7HLSFhEiSRlGALAwoWWmQixMiWgkXbPjDgwWIVIj+uGOxpcIdVuA6VAFlyMLLBCwbmNqwiseTmDgeblLXR8EmQjqU3IBxhIIXDlQc5H8QCmqZpp4RrBgQAIfkEBQQAAQAsDQANACIAIgAACOAAAwgcSLCgwYMBuGxByLDhwCxcIGZxSJEgFy0KL1asKDFixI0VL2YEuVEiyZMoU6pcybKly5YzXqh4sULmixkva7RowcLFThY1XgodSrSoUaIhKNSYWLRDhAcZfhidMQEChBBOikY5ASFChBZMhzLhAOEBE4M7cFB0sIBhj6AFjbCIQbEAgBEgs7x4QaQghgwFSwAokLWiDxc0DEaAYPAAgAsVoch8YvBBBIM1BAAYQlFHix0Hyx50AKBtQyczpxy0fFCJAAF0GRJpAQThYoQaAJBwCIUha4ScV4o++ndlQAAh+QQFBAABACwFABgAKgAXAAAI5gADCBxIsKDBgwWJDPkxBMjCIUQQSpxoEAmQIECEXASChKLHjyBDihxJsqTJkyhHbnlSJAlKFSJ6eLyi8McSlCc4aChRBOGVJRmHQMmCUguPEBs2qIhSkElDIky2pBw4ZcaGDhtwDLyCUcmVqQadnEjqZKCTKhJVnPB4gYLEIT5A9tggwqMCAypSXvHQYUfBBg8KtjCg4AnKGBtIaClowIDBBwY8nGziQYNLxgcM7jhgoGPJsSwONj54wYBbkkc0fDBs0EBmg00OHLBBkseGGghHHxxhIEXJJhJdS/QMdqDu4h4BnwwIACH5BAUFAAEALAUAGAAqABcAAAjlAAMIHEiwoMGDBbNwUchwIcKHEA1y2cJFy8SKXCJq3Mixo8ePIEOKHEkSZJEYOUjqgHFE45MZL1TsIHnjxQobTBBW2cHCBQwjJbcQidGihQ4rBX/YfNEjS8mBVX6weMFCyMAoLVjoiPLU4BQcWacMHOIE4ZUQHjSK6PCQCRKnGmk8oKCRAoQZJatIiCCjoAEEBWvM5TrSRIQMBgEASJgBgomRSSQ8GJJYgMEfESDkDOkBgoiDig+GiMAh5I8HEpqAtmzwSYQIPUDKgKACYeiDKx7QCJnkIQDWBrNs7jrwNnGNf0cGBAAh+QQFBAABACwDABgAKgAXAAAI5gCT/BgCZMhAIEkCKFzIsKHDhw2NBAEiBMhEIUYgatzIsaPHjyBDihxJsqTJkygVauEhIsXJJUSgdExCooMGFSePEEwiBeITFhs2gOiR8gkRi0mwNKzxQYMHGFdSKrzipCCQJwudBD3hRGpDLEkmKlW444hGCxU6sjjBBWKUKB9XGFDQUcQGHiinJDiAomGDBw19aBAx5WQHAw6yNDRgwGGJDTJMEkFgwIdDAwccFuGwAStJCgYwPGT8UMWGEyR1GECQ8HJmh1I2cBgy8oSBERBJP7SxgehIIhoxa/TsVaHu4hz/kgwIACH5BAUEAAEALAMAGAAqABcAAAjfAG2oeLHixcAVNgIoXMiwocOHDWm0YOGixUQXNCBq3Mixo8ePIEOKHEmypMmTKBfSoPDhJJctXLRwHIIhwoMQJ7Nw0ZkFohMRDyJMoIHFpZaXMbk0RCHhgYQSVVIq5LlTqUIlEB54UCK1IdKjC2X80NiAQccdNzTq/EgCQIGOMFoQQRmFgIARDTFkaIhkhYyoJi0AOOAwAgSHNVqMLQlkAAAcDoM6ZPKCBeCRCwA8eJj1oQ4XkEfSADDAyEPJDq+weMFk5AgAGiAahgiEhemRQDSiflilZ1eFnX931EsyIAAh+QQFBAABACwDAA0AIgAiAAAI4wADCHwiRaDBgwgTKjyY5ccQJFkWSpxo0AkQIUGaYKHIMWEWJEOAFHHSsaRBKkiABEFi0iSWKEOYtJxJs6bNmzhz6uxYQgMHDR18aiixk8SGo0g3kNjJtKnTp1CjelShwMJTHw0OGLDKdAkGAwYSrGgqAoEBBBumNC0ClkIRqCd0SLRQgSOTIzNXGFDAkUiQJyanJDiAAiEJogejiLxSsoMBBwmPJkzZpCMRsz4S+kwoJWREihQMYFAoOWESIUko6jibWnMHhVmADIky8YSBEQtLJ7QIeCIRiZsXfrap++lhigEBACH5BAUEAAEALAMADQAiACIAAAjgAAMINNJEoMGDCBMqPFhFxYsbVRZKnChQC5AWLlr8uEKxY8IrOV6skDHEo0mDTWq0aIHjpEskL3a4nEmzps2bOHPq9JjhQQSfQDPszADBJ4SiEYTuXMq0qdOnUBOSKMDAKQ4DAgA0YIrkAQAABEgw1TAAwAALUZgC+boAyNMRNCSG8NCRS5aZNB5Q6LiFi5aTVSREkIFwhg2Edu2aNJH078GMCLVw6esxiYQHJRE6TJglcUcPEEQobMFCoeQtFH88kFAw4YoXChPflSgDgoqFkGNLpphE4uaFXHCSjmqYYkAAIfkEBQQAAQAsAwAFABcAKgAACOUAAwgcSDAAloIIEw6M8uOJwocDpQQBchDiQyRDkFh8iCVIECobFToBkqRiSIJYiACBchKhkyFDHmbpQUThFiRLHj7RwMGEw5YDbXTYsEFGFaACpaTgoEHEDqQCj5QgegKqQB8hWFjdyrWr164PDBwQS/bBSQcG0qo14OCr27dw4yZUocACVB8NxtptuQRD2gQrgIpAYADBhilAi6SlUMTqCR0KsaioarXHBhFWr3jo8JQgkSQbY2wggVAIEItNPGgAXfBHTIgnNmhFOBHiEQ0ffhYE8lohjw01FJpG/dA119pbPwcEACH5BAUFAAEALAMABQAXACoAAAjkAAMIHEgwwBQtBRMqFIhEhZCFEAc2adHCSsSIN17kuAhxCsUmHBf+WGEjpMIrMVocMZlwyIsXEWn4gIhDB0QmDyJsYMKS4IoIQE1I6SnwCYgIDyjI2EI0AJAMECB4aCqwxgQRVLNq3cp1KwIAAsCKRWDyAICzaAEc6Mq2rdu3CbXQoPCh6RAMSEP0dCIi5wQaPVFIeCChRJWeSiA88KCEqowfEHfgyGqERQyqWV4SKZiFC0cfLmgwJchlNEQoL1Q8Sdj5oo4WOxRyQQjRiYoXUxS2hkikBZCFpS9Cgbib6mytnQMCACH5BAUEAAEALAMABQAQACgAAAjDAAMIHEgwixOCCBH60IAjoUMiGzpEcZjQRIcUFBE62bDhSEaCMzSU+DiwSogNPUgK3MEhxMAUDR1qOaFCIBIDByYgIZllxAGcHqCQbGLhpwIUKnk8MGCAgsorLRJcUEm1qtWrVpf+3GrggUMHTMMydYC1rNmzaHmIwPgxCYkOGmpSfMKCI4geWSjW+KDBA4wrGTduOHGQ5A6PFJfsVAkFSBGVW4IMKfyRiRAjKqsQ+QGYpBIgSzL/GGJF5ZMgTapWIRgQACH5BAUEAAEALAMABQAQACgAAAjAAAMIHEgwAJOCCAfWeNAiIUIfECI4cVhwQwQQFAkyiQABSMaBJx5k+ChQygQINUgGkBFhwkASMhxm8RBC4BAAAhYMIalhAM4LTz4qcSAAQIERJG0cAACAgcoSBByonEq1qtWMGR5E0Mp1JMIMELRCCBvB69WzaNNO3VIkRo6PT2a8ULGDYpUdLFzAMELxx4sVL3pkoRilBQsdUUgOmZgwC5fBJLlo4RLZMeSMk7dQzmh5c0Yumis/JqlZy9TLAQICACH5BAUEAAEALAMAAwAXACIAAAi+AAMIHEiwoEEkRgwqXPhjyMKBR7IsDALkYQAVBkgsBOLwIQ4DB5goFFLR4oQDFhQ2tBjgyAEDPAxSZBngg4EHVwpypAklgYEVBRHSDIDiQAKLKXA8pJByIRKQE5AMNTji5QEPUKYSbGLhpQIUWgnyeGDAAIWwBFskuIC2rdu3cONaLKGBg4YOdTWUmEpig9+/GzTKHUy4sGGWT4okaXuFyJAfS8JeWQJEyJCsWpkMAUKEyRbJFJXkbOukStuAAAAh+QQFBAABACwDAAMAFwAiAAAItQADCBxIsKDBGjQMKlyo4sXCgUIetmDxMAAJABsWrnD4UAaAAUkUumhRMcACAQ4UNiwpRAAAGwYnlgyAAQACgxtnPiEAoERBhDMDjBBAoCINHw8ZNHjI5EGEDUyCFtSyIoJVE1KkEnwCIsIDCjK0EgSSAQIED2IHYqkxQUTat3Djyp1b0UbDjXdhBqUxcWTfhHQDCx5MuCIXLVy2vOWShTEXsVsOJz6stbHlx1ojI1b8tvHbgAAAIfkEBQQAAQAsAwADABcAFwAACJQAAwgcSLCgwRIkDCpcqIHDwoFHHm7Y8DCACgMJFWroUBGHgQNMFE6sGGDCAQsaHVY8csAAD4MjSX4w8MDgRpIBoCQwsKIgQpwBUBxIULEHkYcUUC580tDEE6AGbXSYKKMKVIJSUnDQIGIHl6sQS0w8AZagjxAsyqpdy7at24pJfgwBMkQukCRQjQQBIgTIXiFGoAYEACH5BAUFAAEALAMAAwAXABcAAAiVAAMIHEiwoMEMGQwqXPggwsKBTLQshPDgYYAaD1owdPjQB4QIThRGgGAxwIYIIBQ2LMlkJBCDFEsGOPEgA5aCK0tKmQChRkGEMgPIiDDhoRYjTR56CPGwiooXN6oENQikhYsWP65MJXglx4sVMoZsJdikRosWOMYSRPJih9q3cOPKnWuRSxa7eO9O3cJFCxe+frdMDQgAIfkEBQUAAQAsBQADACAAEAAACKYAAwgcSLAgwQcODCpcyNDAAYYQAzhpaIDhFYY+NOBY6HAhkyETFRLZ0CGKQgMVDV4RAoQKQxMdUpx8aJAJECYQnWzYcMQgSoNVgAy5CHGGhhI+aRIkMgRnxCohNvQoiLDgEyFDskQUuINDiK1Hfpgc+ETKQi0nVGxNkkSrwCw/hiBxu7XuFidAhARpgqWu3yxIhgApEtLvVipIgARBYthvlKaNFQYEADs=";
@@ -928,10 +932,10 @@ class Ln extends U {
     super(), N(this, e, null, Sn, T, {});
   }
 }
-function xn(t) {
-  x(t, "svelte-1mxx341", ".rcb-modal-loader.svelte-1mxx341{width:100%;flex-grow:1;min-height:100%;display:flex;justify-content:center;align-items:center}");
-}
 function Fn(t) {
+  F(t, "svelte-1mxx341", ".rcb-modal-loader.svelte-1mxx341{width:100%;flex-grow:1;min-height:100%;display:flex;justify-content:center;align-items:center}");
+}
+function xn(t) {
   let e, r, n;
   return r = new Ln({}), {
     c() {
@@ -952,9 +956,9 @@ function Fn(t) {
     }
   };
 }
-class Ve extends U {
+class We extends U {
   constructor(e) {
-    super(), N(this, e, null, Fn, T, {}, xn);
+    super(), N(this, e, null, xn, T, {}, Fn);
   }
 }
 var pe = /* @__PURE__ */ ((t) => (t.Started = "started", t.InProgress = "in_progress", t.Succeeded = "succeeded", t.Failed = "failed", t))(pe || {}), Te = /* @__PURE__ */ ((t) => (t[t.SetupIntentCreationFailed = 1] = "SetupIntentCreationFailed", t[t.PaymentMethodCreationFailed = 2] = "PaymentMethodCreationFailed", t[t.PaymentChargeFailed = 3] = "PaymentChargeFailed", t))(Te || {}), L = /* @__PURE__ */ ((t) => (t[t.ErrorSettingUpPurchase = 0] = "ErrorSettingUpPurchase", t[t.ErrorChargingPayment = 1] = "ErrorChargingPayment", t[t.UnknownError = 2] = "UnknownError", t[t.NetworkError = 3] = "NetworkError", t[t.StripeError = 4] = "StripeError", t[t.MissingEmailError = 5] = "MissingEmailError", t))(L || {});
@@ -1072,7 +1076,7 @@ class Gn {
 }
 const Yn = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23767676'/%3e%3cpath%20d='M87.6668%2041.504L82.4968%2036.334L62.0002%2056.8307L41.5035%2036.334L36.3335%2041.504L56.8302%2062.0006L36.3335%2082.4973L41.5035%2087.6673L62.0002%2067.1706L82.4968%2087.6673L87.6668%2082.4973L67.1702%2062.0006L87.6668%2041.504Z'%20fill='white'/%3e%3c/svg%3e";
 function Hn(t) {
-  x(t, "svelte-1609h93", "img.svelte-1609h93{width:124px;height:124px;margin:0 auto}");
+  F(t, "svelte-1609h93", "img.svelte-1609h93{width:124px;height:124px;margin:0 auto}");
 }
 function Kn(t) {
   let e, r;
@@ -1097,7 +1101,7 @@ class qn extends U {
   }
 }
 function jn(t) {
-  x(t, "svelte-1rmxk7q", "button.svelte-1rmxk7q{border:none;border-radius:56px;font-size:16px;cursor:pointer;height:56px;color:var(--rc-color-grey-text-dark);background-color:var(--rc-color-grey-ui-dark);display:flex;align-items:center;justify-content:center}button.intent-primary.svelte-1rmxk7q{background-color:var(--rc-color-grey-text-dark);color:var(--rc-color-white);font-size:16px}button.svelte-1rmxk7q:disabled{color:var(--rc-color-grey-text-light)}button.intent-primary.svelte-1rmxk7q:disabled{color:var(--rc-color-grey-text-light)}");
+  F(t, "svelte-1rmxk7q", "button.svelte-1rmxk7q{border:none;border-radius:56px;font-size:16px;cursor:pointer;height:56px;color:var(--rc-color-grey-text-dark);background-color:var(--rc-color-grey-ui-dark);display:flex;align-items:center;justify-content:center}button.intent-primary.svelte-1rmxk7q{background-color:var(--rc-color-grey-text-dark);color:var(--rc-color-white);font-size:16px}button.svelte-1rmxk7q:disabled{color:var(--rc-color-grey-text-light)}button.intent-primary.svelte-1rmxk7q:disabled{color:var(--rc-color-grey-text-light)}");
 }
 function Jn(t) {
   let e, r, n, i, o;
@@ -1164,7 +1168,7 @@ function Jn(t) {
 function Vn(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { intent: o = "primary" } = e, { disabled: s = !1 } = e;
   function l(c) {
-    Mt.call(this, t, c);
+    Ct.call(this, t, c);
   }
   return t.$$set = (c) => {
     "intent" in c && r(0, o = c.intent), "disabled" in c && r(1, s = c.disabled), "$$scope" in c && r(2, i = c.$$scope);
@@ -1176,7 +1180,7 @@ class Ie extends U {
   }
 }
 function Wn(t) {
-  x(t, "svelte-1f9z0o8", "footer.svelte-1f9z0o8{display:flex;flex-direction:column}");
+  F(t, "svelte-1f9z0o8", "footer.svelte-1f9z0o8{display:flex;flex-direction:column}");
 }
 function zn(t) {
   let e, r;
@@ -1235,13 +1239,13 @@ function Xn(t, e, r) {
     "$$scope" in o && r(0, i = o.$$scope);
   }, [i, n];
 }
-class We extends U {
+class ze extends U {
   constructor(e) {
     super(), N(this, e, Xn, zn, T, {}, Wn);
   }
 }
 function Zn(t) {
-  x(t, "svelte-6o8e90", '.column.svelte-6o8e90{display:flex;flex-direction:column;justify-content:flex-start;gap:var(--gap, "8px");flex-grow:1}');
+  F(t, "svelte-6o8e90", '.column.svelte-6o8e90{display:flex;flex-direction:column;justify-content:flex-start;gap:var(--gap, "8px");flex-grow:1}');
 }
 function er(t) {
   let e, r, n;
@@ -1310,7 +1314,7 @@ class $e extends U {
 }
 const nr = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20id='mdi_close'%3e%3cpath%20id='Vector'%20d='M19%206.41L17.59%205L12%2010.59L6.41%205L5%206.41L10.59%2012L5%2017.59L6.41%2019L12%2013.41L17.59%2019L19%2017.59L13.41%2012L19%206.41Z'%20fill='%23767676'/%3e%3c/g%3e%3c/svg%3e";
 function rr(t) {
-  x(t, "svelte-14xreta", ".close-button.svelte-14xreta{border:none;cursor:pointer;background-color:transparent;padding:0px}");
+  F(t, "svelte-14xreta", ".close-button.svelte-14xreta{border:none;cursor:pointer;background-color:transparent;padding:0px}");
 }
 function ir(t) {
   let e, r, n, i, o;
@@ -1320,7 +1324,7 @@ function ir(t) {
       t[0];
     },
     m(s, l) {
-      p(s, e, l), M(e, r), i || (o = ke(
+      p(s, e, l), C(e, r), i || (o = ke(
         e,
         "click",
         /*click_handler*/
@@ -1342,7 +1346,7 @@ function ir(t) {
 function or(t, e, r) {
   let { disabled: n = !1 } = e;
   function i(o) {
-    Mt.call(this, t, o);
+    Ct.call(this, t, o);
   }
   return t.$$set = (o) => {
     "disabled" in o && r(0, n = o.disabled);
@@ -1354,7 +1358,7 @@ class sr extends U {
   }
 }
 function lr(t) {
-  x(t, "svelte-44qpq9", ".rcb-app-icon.svelte-44qpq9{width:40px;height:40px;border-radius:12px;box-shadow:0px 1px 10px 0px rgba(0, 0, 0, 0.1);margin-right:16px}.rcb-app-icon-picture-container.svelte-44qpq9{height:40px}.rcb-app-icon.loading.svelte-44qpq9{background-color:gray}");
+  F(t, "svelte-44qpq9", ".rcb-app-icon.svelte-44qpq9{width:40px;height:40px;border-radius:12px;box-shadow:0px 1px 10px 0px rgba(0, 0, 0, 0.1);margin-right:16px}.rcb-app-icon-picture-container.svelte-44qpq9{height:40px}.rcb-app-icon.loading.svelte-44qpq9{background-color:gray}");
 }
 function cr(t) {
   let e;
@@ -1380,7 +1384,7 @@ function ar(t) {
       t[0]) || _(o, "src", s), _(o, "alt", "App icon"), _(e, "class", "rcb-app-icon-picture-container svelte-44qpq9");
     },
     m(l, c) {
-      p(l, e, c), M(e, r), M(e, i), M(e, o);
+      p(l, e, c), C(e, r), C(e, i), C(e, o);
     },
     p(l, c) {
       c & /*srcWebp*/
@@ -1431,9 +1435,9 @@ class Tt extends U {
     super(), N(this, e, fr, ur, T, { src: 0, srcWebp: 1 }, lr);
   }
 }
-const Ce = (t) => `https://da08ctfrofx1b.cloudfront.net/${t}`;
+const Me = (t) => `https://da08ctfrofx1b.cloudfront.net/${t}`;
 function dr(t) {
-  x(t, "svelte-10uf5fq", ".app-title.svelte-10uf5fq{font-weight:500;margin:8px 0;font-size:16px}.rcb-header-layout__business-info.svelte-10uf5fq{display:flex;align-items:center}");
+  F(t, "svelte-10uf5fq", ".app-title.svelte-10uf5fq{font-weight:500;margin:8px 0;font-size:16px}.rcb-header-layout__business-info.svelte-10uf5fq{display:flex;align-items:center}");
 }
 function mr(t) {
   let e, r;
@@ -1463,20 +1467,20 @@ function gr(t) {
   ), i, o, s = (
     /*brandingInfo*/
     t[0].app_icon_webp !== null && /*brandingInfo*/
-    t[0].app_icon !== null && ct(t)
+    t[0].app_icon !== null && at(t)
   );
   return {
     c() {
       s && s.c(), e = P(), r = k("span"), i = S(n), _(r, "class", "app-title svelte-10uf5fq");
     },
     m(l, c) {
-      s && s.m(l, c), p(l, e, c), p(l, r, c), M(r, i), o = !0;
+      s && s.m(l, c), p(l, e, c), p(l, r, c), C(r, i), o = !0;
     },
     p(l, c) {
       /*brandingInfo*/
       l[0].app_icon_webp !== null && /*brandingInfo*/
       l[0].app_icon !== null ? s ? (s.p(l, c), c & /*brandingInfo*/
-      1 && f(s, 1)) : (s = ct(l), s.c(), f(s, 1), s.m(e.parentNode, e)) : s && (Y(), m(s, 1, 1, () => {
+      1 && f(s, 1)) : (s = at(l), s.c(), f(s, 1), s.m(e.parentNode, e)) : s && (Y(), m(s, 1, 1, () => {
         s = null;
       }), H()), (!o || c & /*brandingInfo*/
       1) && n !== (n = /*brandingInfo*/
@@ -1493,15 +1497,15 @@ function gr(t) {
     }
   };
 }
-function ct(t) {
+function at(t) {
   let e, r;
   return e = new Tt({
     props: {
-      src: Ce(
+      src: Me(
         /*brandingInfo*/
         t[0].app_icon
       ),
-      srcWebp: Ce(
+      srcWebp: Me(
         /*brandingInfo*/
         t[0].app_icon_webp
       )
@@ -1516,11 +1520,11 @@ function ct(t) {
     p(n, i) {
       const o = {};
       i & /*brandingInfo*/
-      1 && (o.src = Ce(
+      1 && (o.src = Me(
         /*brandingInfo*/
         n[0].app_icon
       )), i & /*brandingInfo*/
-      1 && (o.srcWebp = Ce(
+      1 && (o.srcWebp = Me(
         /*brandingInfo*/
         n[0].app_icon_webp
       )), e.$set(o);
@@ -1581,7 +1585,7 @@ class Nt extends U {
   }
 }
 function Ar(t) {
-  x(t, "svelte-17puakv", ".rcb-post-purchase-header-layout.svelte-17puakv{display:flex;justify-content:space-between;align-items:center;width:100%;margin-top:-4px}");
+  F(t, "svelte-17puakv", ".rcb-post-purchase-header-layout.svelte-17puakv{display:flex;justify-content:space-between;align-items:center;width:100%;margin-top:-4px}");
 }
 function hr(t) {
   let e, r, n, i, o;
@@ -1600,7 +1604,7 @@ function hr(t) {
       e = k("div"), w(r.$$.fragment), n = P(), w(i.$$.fragment), _(e, "class", "rcb-post-purchase-header-layout svelte-17puakv");
     },
     m(s, l) {
-      p(s, e, l), b(r, e, null), M(e, n), b(i, e, null), o = !0;
+      p(s, e, l), b(r, e, null), C(e, n), b(i, e, null), o = !0;
     },
     p(s, l) {
       t = s;
@@ -1663,9 +1667,9 @@ class Ir extends U {
   }
 }
 function wr(t) {
-  x(t, "svelte-10pcqja", ".rcb-modal-message.svelte-10pcqja{width:100%;min-height:160px;display:flex;justify-content:center;align-items:center;flex-direction:column;text-align:center}.title.svelte-10pcqja{font-size:24px;line-height:1.25em}.subtitle.svelte-10pcqja{font-size:16px;line-height:1.25em;overflow-wrap:anywhere}");
+  F(t, "svelte-10pcqja", ".rcb-modal-message.svelte-10pcqja{width:100%;min-height:160px;display:flex;justify-content:center;align-items:center;flex-direction:column;text-align:center}.title.svelte-10pcqja{font-size:24px;line-height:1.25em}.subtitle.svelte-10pcqja{font-size:16px;line-height:1.25em;overflow-wrap:anywhere}");
 }
-const kr = (t) => ({}), at = (t) => ({});
+const kr = (t) => ({}), ut = (t) => ({});
 function $r(t) {
   let e, r, n, i, o;
   const s = (
@@ -1686,7 +1690,7 @@ function $r(t) {
       ), n = P(), i = k("span"), l && l.c(), _(e, "class", "title svelte-10pcqja"), _(i, "class", "subtitle svelte-10pcqja");
     },
     m(c, a) {
-      p(c, e, a), M(e, r), p(c, n, a), p(c, i, a), l && l.m(i, null), o = !0;
+      p(c, e, a), C(e, r), p(c, n, a), p(c, i, a), l && l.m(i, null), o = !0;
     },
     p(c, a) {
       (!o || a & /*title*/
@@ -1735,7 +1739,7 @@ function vr(t) {
     t,
     /*$$scope*/
     t[5],
-    at
+    ut
   );
   return r = new $e({
     props: {
@@ -1768,7 +1772,7 @@ function vr(t) {
           /*$$scope*/
           s[5]
         ),
-        at
+        ut
       );
       const c = {};
       l & /*$$scope, title*/
@@ -1877,7 +1881,7 @@ function Dr(t) {
     }
   };
 }
-function Cr(t) {
+function Mr(t) {
   let e, r, n, i, o, s;
   return e = new Ir({
     props: {
@@ -1895,7 +1899,7 @@ function Cr(t) {
       $$slots: { default: [yr] },
       $$scope: { ctx: t }
     }
-  }), o = new We({
+  }), o = new ze({
     props: {
       $$slots: { default: [Dr] },
       $$scope: { ctx: t }
@@ -1932,12 +1936,12 @@ function Cr(t) {
     }
   };
 }
-function Mr(t) {
+function Cr(t) {
   let e, r;
   return e = new $e({
     props: {
       gutter: "32px",
-      $$slots: { default: [Cr] },
+      $$slots: { default: [Mr] },
       $$scope: { ctx: t }
     }
   }), {
@@ -1975,7 +1979,7 @@ class Ut extends U {
       this,
       e,
       Qr,
-      Mr,
+      Cr,
       T,
       {
         brandingInfo: 0,
@@ -1987,7 +1991,7 @@ class Ut extends U {
     );
   }
 }
-function ut(t) {
+function ft(t) {
   let e, r, n, i, o;
   return {
     c() {
@@ -1998,7 +2002,7 @@ function ut(t) {
       t[1]);
     },
     m(s, l) {
-      p(s, e, l), p(s, r, l), M(r, n), p(s, o, l);
+      p(s, e, l), p(s, r, l), C(r, n), p(s, o, l);
     },
     p(s, l) {
       l & /*supportEmail*/
@@ -2021,7 +2025,7 @@ function Pr(t) {
     t[3]() + ""
   ), r, n, i, o = (
     /*supportEmail*/
-    t[1] && ut(t)
+    t[1] && ft(t)
   );
   return {
     c() {
@@ -2032,7 +2036,7 @@ function Pr(t) {
     },
     p(s, l) {
       /*supportEmail*/
-      s[1] ? o ? o.p(s, l) : (o = ut(s), o.c(), o.m(i.parentNode, i)) : o && (o.d(1), o = null);
+      s[1] ? o ? o.p(s, l) : (o = ft(s), o.c(), o.m(i.parentNode, i)) : o && (o.d(1), o = null);
     },
     d(s) {
       s && (g(r), g(n), g(i)), o && o.d(s);
@@ -2145,7 +2149,7 @@ class Rr extends U {
 }
 const Or = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23576CDB'/%3e%3crect%20x='44.1116'%20y='56'%20width='27.5'%20height='11'%20transform='rotate(45%2044.1116%2056)'%20fill='white'/%3e%3crect%20x='79.1133'%20y='44.334'%20width='11'%20height='44'%20transform='rotate(45%2079.1133%2044.334)'%20fill='white'/%3e%3c/svg%3e";
 function Sr(t) {
-  x(t, "svelte-1609h93", "img.svelte-1609h93{width:124px;height:124px;margin:0 auto}");
+  F(t, "svelte-1609h93", "img.svelte-1609h93{width:124px;height:124px;margin:0 auto}");
 }
 function Lr(t) {
   let e, r;
@@ -2164,12 +2168,12 @@ function Lr(t) {
     }
   };
 }
-class xr extends U {
+class Fr extends U {
   constructor(e) {
     super(), N(this, e, null, Lr, T, {}, Sr);
   }
 }
-function Fr(t) {
+function xr(t) {
   let e;
   return {
     c() {
@@ -2185,7 +2189,7 @@ function Fr(t) {
 }
 function Gr(t) {
   let e, r;
-  return e = new xr({ props: { slot: "icon" } }), {
+  return e = new Fr({ props: { slot: "icon" } }), {
     c() {
       w(e.$$.fragment);
     },
@@ -2220,7 +2224,7 @@ function Yr(t) {
       ),
       $$slots: {
         icon: [Gr],
-        default: [Fr]
+        default: [xr]
       },
       $$scope: { ctx: t }
     }
@@ -2340,7 +2344,7 @@ class zr extends U {
     return this.$$.ctx[5];
   }
 }
-function ft(t) {
+function dt(t) {
   let e;
   const r = (
     /*#slots*/
@@ -2395,7 +2399,7 @@ function Xr(t) {
   let e, r, n = (
     /*stripe*/
     t[1] && /*elements*/
-    t[0] && ft(t)
+    t[0] && dt(t)
   );
   return {
     c() {
@@ -2408,7 +2412,7 @@ function Xr(t) {
       /*stripe*/
       i[1] && /*elements*/
       i[0] ? n ? (n.p(i, o), o & /*stripe, elements*/
-      3 && f(n, 1)) : (n = ft(i), n.c(), f(n, 1), n.m(e.parentNode, e)) : n && (Y(), m(n, 1, 1, () => {
+      3 && f(n, 1)) : (n = dt(i), n.c(), f(n, 1), n.m(e.parentNode, e)) : n && (Y(), m(n, 1, 1, () => {
         n = null;
       }), H());
     },
@@ -2425,8 +2429,8 @@ function Xr(t) {
 }
 function Zr(t, e, r) {
   let n, { $$slots: i = {}, $$scope: o } = e, { stripe: s } = e, { mode: l = void 0 } = e, { theme: c = "stripe" } = e, { variables: a = {} } = e, { rules: u = {} } = e, { labels: d = "above" } = e, { loader: h = "auto" } = e, { fonts: $ = [] } = e, { locale: E = "auto" } = e, { currency: B = void 0 } = e, { amount: A = void 0 } = e, { clientSecret: y = void 0 } = e, { elements: R = null } = e;
-  return t.$$set = (C) => {
-    "stripe" in C && r(1, s = C.stripe), "mode" in C && r(2, l = C.mode), "theme" in C && r(3, c = C.theme), "variables" in C && r(4, a = C.variables), "rules" in C && r(5, u = C.rules), "labels" in C && r(6, d = C.labels), "loader" in C && r(7, h = C.loader), "fonts" in C && r(8, $ = C.fonts), "locale" in C && r(9, E = C.locale), "currency" in C && r(10, B = C.currency), "amount" in C && r(11, A = C.amount), "clientSecret" in C && r(12, y = C.clientSecret), "elements" in C && r(0, R = C.elements), "$$scope" in C && r(14, o = C.$$scope);
+  return t.$$set = (M) => {
+    "stripe" in M && r(1, s = M.stripe), "mode" in M && r(2, l = M.mode), "theme" in M && r(3, c = M.theme), "variables" in M && r(4, a = M.variables), "rules" in M && r(5, u = M.rules), "labels" in M && r(6, d = M.labels), "loader" in M && r(7, h = M.loader), "fonts" in M && r(8, $ = M.fonts), "locale" in M && r(9, E = M.locale), "currency" in M && r(10, B = M.currency), "amount" in M && r(11, A = M.amount), "clientSecret" in M && r(12, y = M.clientSecret), "elements" in M && r(0, R = M.elements), "$$scope" in M && r(14, o = M.$$scope);
   }, t.$$.update = () => {
     t.$$.dirty & /*theme, variables, rules, labels*/
     120 && r(13, n = { theme: c, variables: a, rules: u, labels: d }), t.$$.dirty & /*stripe, elements, mode, currency, amount, appearance, clientSecret, fonts, loader, locale*/
@@ -2479,14 +2483,14 @@ class ei extends U {
     });
   }
 }
-var Rt = "https://js.stripe.com/v3", ti = /^https:\/\/js\.stripe\.com\/v3\/?(\?.*)?$/, dt = "loadStripe.setLoadParameters was called but an existing Stripe.js script already exists in the document; existing script parameters will be used", ni = function() {
+var Rt = "https://js.stripe.com/v3", ti = /^https:\/\/js\.stripe\.com\/v3\/?(\?.*)?$/, mt = "loadStripe.setLoadParameters was called but an existing Stripe.js script already exists in the document; existing script parameters will be used", ni = function() {
   for (var e = document.querySelectorAll('script[src^="'.concat(Rt, '"]')), r = 0; r < e.length; r++) {
     var n = e[r];
     if (ti.test(n.src))
       return n;
   }
   return null;
-}, mt = function(e) {
+}, gt = function(e) {
   var r = e && !e.advancedFraudSignals ? "?advancedFraudSignals=false" : "", n = document.createElement("script");
   n.src = "".concat(Rt).concat(r);
   var i = document.head || document.body;
@@ -2499,7 +2503,7 @@ var Rt = "https://js.stripe.com/v3", ti = /^https:\/\/js\.stripe\.com\/v3\/?(\?.
     version: "2.4.0",
     startTime: r
   });
-}, me = null, Me = null, Qe = null, ii = function(e) {
+}, me = null, Ce = null, Qe = null, ii = function(e) {
   return function() {
     e(new Error("Failed to load Stripe.js"));
   };
@@ -2513,21 +2517,21 @@ var Rt = "https://js.stripe.com/v3", ti = /^https:\/\/js\.stripe\.com\/v3\/?(\?.
       r(null);
       return;
     }
-    if (window.Stripe && e && console.warn(dt), window.Stripe) {
+    if (window.Stripe && e && console.warn(mt), window.Stripe) {
       r(window.Stripe);
       return;
     }
     try {
       var i = ni();
       if (i && e)
-        console.warn(dt);
+        console.warn(mt);
       else if (!i)
-        i = mt(e);
-      else if (i && Qe !== null && Me !== null) {
+        i = gt(e);
+      else if (i && Qe !== null && Ce !== null) {
         var o;
-        i.removeEventListener("load", Qe), i.removeEventListener("error", Me), (o = i.parentNode) === null || o === void 0 || o.removeChild(i), i = mt(e);
+        i.removeEventListener("load", Qe), i.removeEventListener("error", Ce), (o = i.parentNode) === null || o === void 0 || o.removeChild(i), i = gt(e);
       }
-      Qe = oi(r, n), Me = ii(n), i.addEventListener("load", Qe), i.addEventListener("error", Me);
+      Qe = oi(r, n), Ce = ii(n), i.addEventListener("load", Qe), i.addEventListener("error", Ce);
     } catch (s) {
       n(s);
       return;
@@ -2560,7 +2564,7 @@ var ci = function() {
   });
 };
 function ai(t) {
-  x(t, "svelte-1xe711j", ".rcb-header-layout.svelte-1xe711j{display:flex;justify-content:space-between;align-items:center;width:100%;font-size:24px;margin:0;font-weight:500}");
+  F(t, "svelte-1xe711j", ".rcb-header-layout.svelte-1xe711j{display:flex;justify-content:space-between;align-items:center;width:100%;font-size:24px;margin:0;font-weight:500}");
 }
 function ui(t) {
   let e, r;
@@ -2650,7 +2654,7 @@ function di(t, e, r) {
     "$$scope" in o && r(1, i = o.$$scope);
   }, [n, i];
 }
-class ze extends U {
+class Xe extends U {
   constructor(e) {
     super(), N(this, e, di, fi, T, {}, ai);
   }
@@ -2688,7 +2692,7 @@ const _e = {
   white: "#ffffff"
 };
 function _i(t) {
-  x(t, "svelte-rjmul6", `.processing.svelte-rjmul6{width:12px;aspect-ratio:1;border-radius:50%;animation:svelte-rjmul6-l5 1.5s infinite linear}@keyframes svelte-rjmul6-l5{0%{box-shadow:20px 0 #fff2,
+  F(t, "svelte-rjmul6", `.processing.svelte-rjmul6{width:12px;aspect-ratio:1;border-radius:50%;animation:svelte-rjmul6-l5 1.5s infinite linear}@keyframes svelte-rjmul6-l5{0%{box-shadow:20px 0 #fff2,
         -20px 0 #fff2;background:#fff2}25%{box-shadow:20px 0 #fff2,
         -20px 0 #ffff;background:#fff2}50%{box-shadow:20px 0 #fff2,
         -20px 0 #fff2;background:#ffff}75%{box-shadow:20px 0 #ffff,
@@ -2718,11 +2722,11 @@ class Lt extends U {
   }
 }
 function hi(t) {
-  x(t, "svelte-1wxt892", ".rcb-stripe-elements-container.svelte-1wxt892{width:100%;margin-top:32px;margin-bottom:24px}");
+  F(t, "svelte-1wxt892", ".rcb-stripe-elements-container.svelte-1wxt892{width:100%;margin-top:32px;margin-bottom:24px}");
 }
 function Ei(t) {
   let e, r;
-  return e = new Ve({}), {
+  return e = new We({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -2782,7 +2786,7 @@ function bi(t) {
       },
       ".Input--invalid": { boxShadow: "none" }
     },
-    $$slots: { default: [Ci] },
+    $$slots: { default: [Mi] },
     $$scope: { ctx: t }
   };
   return (
@@ -2793,7 +2797,7 @@ function bi(t) {
         e = k("form"), w(r.$$.fragment);
       },
       m(a, u) {
-        p(a, e, u), b(r, e, null), i = !0, o || (s = ke(e, "submit", Ct(
+        p(a, e, u), b(r, e, null), i = !0, o || (s = ke(e, "submit", Mt(
           /*handleContinue*/
           t[5]
         )), o = !0);
@@ -3031,9 +3035,9 @@ function Di(t) {
     }
   };
 }
-function Ci(t) {
+function Mi(t) {
   let e, r, n, i, o, s;
-  return e = new ze({
+  return e = new Xe({
     props: {
       $$slots: { default: [Ii] },
       $$scope: { ctx: t }
@@ -3043,7 +3047,7 @@ function Ci(t) {
       $$slots: { default: [wi] },
       $$scope: { ctx: t }
     }
-  }), o = new We({
+  }), o = new ze({
     props: {
       $$slots: { default: [Di] },
       $$scope: { ctx: t }
@@ -3077,7 +3081,7 @@ function Ci(t) {
     }
   };
 }
-function Mi(t) {
+function Ci(t) {
   let e, r, n, i;
   const o = [bi, Ei], s = [];
   function l(c, a) {
@@ -3158,7 +3162,7 @@ class Pi extends U {
       this,
       e,
       Qi,
-      Mi,
+      Ci,
       T,
       {
         onClose: 1,
@@ -3172,7 +3176,7 @@ class Pi extends U {
   }
 }
 function Ti(t) {
-  x(t, "svelte-favd20", "form.svelte-favd20.svelte-favd20{display:flex;flex-direction:column;min-height:100%;flex-grow:1}.form-container.svelte-favd20.svelte-favd20{display:flex;flex-direction:column;width:100%;margin-top:32px;margin-bottom:16px}.form-label.svelte-favd20.svelte-favd20{margin-top:8px;margin-bottom:8px;display:block;font-weight:500;line-height:22px}.form-input.error.svelte-favd20 input.svelte-favd20{border-color:var(--rc-color-error)}.form-error.svelte-favd20.svelte-favd20{margin-top:4px;font-size:16px;line-height:20px;min-height:40px;color:var(--rc-color-error)}input.svelte-favd20.svelte-favd20{width:100%;box-sizing:border-box;padding:8px;border:2px solid var(--rc-color-grey-ui-dark);border-radius:12px;font-size:16px;height:48px;padding:6px 14px}input.svelte-favd20.svelte-favd20:focus{outline:none;border:2px solid var(--rc-color-focus)}");
+  F(t, "svelte-favd20", "form.svelte-favd20.svelte-favd20{display:flex;flex-direction:column;min-height:100%;flex-grow:1}.form-container.svelte-favd20.svelte-favd20{display:flex;flex-direction:column;width:100%;margin-top:32px;margin-bottom:16px}.form-label.svelte-favd20.svelte-favd20{margin-top:8px;margin-bottom:8px;display:block;font-weight:500;line-height:22px}.form-input.error.svelte-favd20 input.svelte-favd20{border-color:var(--rc-color-error)}.form-error.svelte-favd20.svelte-favd20{margin-top:4px;font-size:16px;line-height:20px;min-height:40px;color:var(--rc-color-error)}input.svelte-favd20.svelte-favd20{width:100%;box-sizing:border-box;padding:8px;border:2px solid var(--rc-color-grey-ui-dark);border-radius:12px;font-size:16px;height:48px;padding:6px 14px}input.svelte-favd20.svelte-favd20:focus{outline:none;border:2px solid var(--rc-color-focus)}");
 }
 function Ni(t) {
   let e;
@@ -3188,7 +3192,7 @@ function Ni(t) {
     }
   };
 }
-function gt(t) {
+function pt(t) {
   let e, r;
   return {
     c() {
@@ -3198,7 +3202,7 @@ function gt(t) {
       ), _(e, "class", "form-error svelte-favd20");
     },
     m(n, i) {
-      p(n, e, i), M(e, r);
+      p(n, e, i), C(e, r);
     },
     p(n, i) {
       i & /*error*/
@@ -3216,7 +3220,7 @@ function gt(t) {
 function Ui(t) {
   let e, r, n, i, o, s, l, c, a, u = (
     /*error*/
-    t[2] && gt(t)
+    t[2] && pt(t)
   );
   return {
     c() {
@@ -3224,11 +3228,11 @@ function Ui(t) {
       t[4] + " svelte-favd20"), _(e, "class", "form-container svelte-favd20");
     },
     m(d, h) {
-      p(d, e, h), M(e, r), M(e, n), M(e, i), M(i, o), st(
+      p(d, e, h), C(e, r), C(e, n), C(e, i), C(i, o), lt(
         o,
         /*email*/
         t[3]
-      ), M(e, l), u && u.m(e, null), c || (a = ke(
+      ), C(e, l), u && u.m(e, null), c || (a = ke(
         o,
         "input",
         /*input_input_handler*/
@@ -3238,14 +3242,14 @@ function Ui(t) {
     p(d, h) {
       h & /*email*/
       8 && o.value !== /*email*/
-      d[3] && st(
+      d[3] && lt(
         o,
         /*email*/
         d[3]
       ), h & /*inputClass*/
       16 && s !== (s = "form-input " + /*inputClass*/
       d[4] + " svelte-favd20") && _(i, "class", s), /*error*/
-      d[2] ? u ? u.p(d, h) : (u = gt(d), u.c(), u.m(e, null)) : u && (u.d(1), u = null);
+      d[2] ? u ? u.p(d, h) : (u = pt(d), u.c(), u.m(e, null)) : u && (u.d(1), u = null);
     },
     d(d) {
       d && g(e), u && u.d(), c = !1, a();
@@ -3335,7 +3339,7 @@ function Li(t) {
     }
   };
 }
-function xi(t) {
+function Fi(t) {
   let e, r, n, i;
   return e = new Ie({
     props: {
@@ -3392,11 +3396,11 @@ function xi(t) {
     }
   };
 }
-function Fi(t) {
+function xi(t) {
   let e, r;
   return e = new $e({
     props: {
-      $$slots: { default: [xi] },
+      $$slots: { default: [Fi] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3424,7 +3428,7 @@ function Fi(t) {
 }
 function Gi(t) {
   let e, r, n, i, o, s, l, c, a;
-  return r = new ze({
+  return r = new Xe({
     props: {
       $$slots: { default: [Ni] },
       $$scope: { ctx: t }
@@ -3434,9 +3438,9 @@ function Gi(t) {
       $$slots: { default: [Ui] },
       $$scope: { ctx: t }
     }
-  }), s = new We({
+  }), s = new ze({
     props: {
-      $$slots: { default: [Fi] },
+      $$slots: { default: [xi] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3444,7 +3448,7 @@ function Gi(t) {
       e = k("form"), w(r.$$.fragment), n = P(), w(i.$$.fragment), o = P(), w(s.$$.fragment), _(e, "class", "svelte-favd20");
     },
     m(u, d) {
-      p(u, e, d), b(r, e, null), M(e, n), b(i, e, null), M(e, o), b(s, e, null), l = !0, c || (a = ke(e, "submit", Ct(
+      p(u, e, d), b(r, e, null), C(e, n), b(i, e, null), C(e, o), b(s, e, null), l = !0, c || (a = ke(e, "submit", Mt(
         /*handleContinue*/
         t[5]
       )), c = !0);
@@ -3501,7 +3505,7 @@ class Hi extends U {
   }
 }
 function Ki(t) {
-  x(t, "svelte-17tslso", ".rcb-modal-backdrop.svelte-17tslso{position:fixed;top:0;left:0;right:0;min-width:100%;width:100vw;width:100dvw;min-height:100%;height:100vh;height:100dvh;background-color:rgba(40, 40, 40, 0.75);display:flex;flex-direction:column;justify-content:space-around;z-index:1000001}");
+  F(t, "svelte-17tslso", ".rcb-modal-backdrop.svelte-17tslso{position:fixed;top:0;left:0;right:0;min-width:100%;width:100vw;width:100dvw;min-height:100%;height:100vh;height:100dvh;background-color:rgba(40, 40, 40, 0.75);display:flex;flex-direction:column;justify-content:space-around;z-index:1000001}");
 }
 function qi(t) {
   let e, r;
@@ -3566,7 +3570,7 @@ class Ji extends U {
   }
 }
 function Vi(t) {
-  x(t, "svelte-ioxu5d", ".rcb-modal-container.svelte-ioxu5d{width:100%}.rcb-modal-main.svelte-ioxu5d{box-sizing:border-box;border-radius:8px;background-color:var(--rc-color-white);color:var(--rc-color-grey-text-dark);min-height:460px;padding:40px;flex-direction:column;display:flex}.rcb-modal-dark.svelte-ioxu5d{background-color:var(--rc-color-grey-text-dark);color:var(--rc-color-white);min-height:0px}@media screen and (max-width: 960px){.rcb-modal-container.svelte-ioxu5d{width:calc(100% - 32px);min-width:300px;max-width:640px;margin:auto}.rcb-modal-main.svelte-ioxu5d,.rcb-modal-dark.svelte-ioxu5d{min-width:300px;max-width:640px;padding:32px}}");
+  F(t, "svelte-ioxu5d", ".rcb-modal-container.svelte-ioxu5d{width:100%}.rcb-modal-main.svelte-ioxu5d{box-sizing:border-box;border-radius:8px;background-color:var(--rc-color-white);color:var(--rc-color-grey-text-dark);min-height:460px;padding:40px;flex-direction:column;display:flex}.rcb-modal-dark.svelte-ioxu5d{background-color:var(--rc-color-grey-text-dark);color:var(--rc-color-white);min-height:0px}@media screen and (max-width: 960px){.rcb-modal-container.svelte-ioxu5d{width:calc(100% - 32px);min-width:300px;max-width:640px;margin:auto}.rcb-modal-main.svelte-ioxu5d,.rcb-modal-dark.svelte-ioxu5d{min-width:300px;max-width:640px;padding:32px}}");
 }
 function Wi(t) {
   let e, r, n, i;
@@ -3586,7 +3590,7 @@ function Wi(t) {
       t[0] ? "rcb-modal-dark" : ""}`) + " svelte-ioxu5d"), _(e, "class", "rcb-modal-container svelte-ioxu5d");
     },
     m(l, c) {
-      p(l, e, c), M(e, r), s && s.m(r, null), i = !0;
+      p(l, e, c), C(e, r), s && s.m(r, null), i = !0;
     },
     p(l, [c]) {
       s && s.p && (!i || c & /*$$scope*/
@@ -3809,7 +3813,7 @@ class io extends U {
     super(), N(this, e, ro, no, T, { condition: 0 });
   }
 }
-const oo = (t) => ({}), pt = (t) => ({});
+const oo = (t) => ({}), _t = (t) => ({});
 function so(t) {
   let e, r;
   const n = (
@@ -3820,7 +3824,7 @@ function so(t) {
     t,
     /*$$scope*/
     t[2],
-    pt
+    _t
   ), o = (
     /*#slots*/
     t[1].default
@@ -3856,7 +3860,7 @@ function so(t) {
           /*$$scope*/
           l[2]
         ),
-        pt
+        _t
       ), s && s.p && (!r || c & /*$$scope*/
       4) && J(
         s,
@@ -3930,7 +3934,7 @@ function co(t, e, r) {
     "dark" in s && r(0, o = s.dark), "$$scope" in s && r(2, i = s.$$scope);
   }, [o, n, i];
 }
-class xt extends U {
+class Ft extends U {
   constructor(e) {
     super(), N(this, e, co, lo, T, { dark: 0 });
   }
@@ -4009,6 +4013,7 @@ class he {
         return 11;
       case 7105:
       case 7106:
+      case 7814:
         return 4;
       case 7220:
         return 14;
@@ -4034,7 +4039,7 @@ class he {
     }
   }
   static convertCodeToBackendErrorCode(e) {
-    return e in Ft ? e : null;
+    return e in xt ? e : null;
   }
   static convertPurchaseFlowErrorCodeToErrorCode(e) {
     switch (e) {
@@ -4053,7 +4058,7 @@ class he {
     }
   }
 }
-var Ft = /* @__PURE__ */ ((t) => (t[t.BackendInvalidPlatform = 7e3] = "BackendInvalidPlatform", t[t.BackendStoreProblem = 7101] = "BackendStoreProblem", t[t.BackendCannotTransferPurchase = 7102] = "BackendCannotTransferPurchase", t[t.BackendInvalidReceiptToken = 7103] = "BackendInvalidReceiptToken", t[t.BackendInvalidAppStoreSharedSecret = 7104] = "BackendInvalidAppStoreSharedSecret", t[t.BackendInvalidPaymentModeOrIntroPriceNotProvided = 7105] = "BackendInvalidPaymentModeOrIntroPriceNotProvided", t[t.BackendProductIdForGoogleReceiptNotProvided = 7106] = "BackendProductIdForGoogleReceiptNotProvided", t[t.BackendInvalidPlayStoreCredentials = 7107] = "BackendInvalidPlayStoreCredentials", t[t.BackendInternalServerError = 7110] = "BackendInternalServerError", t[t.BackendEmptyAppUserId = 7220] = "BackendEmptyAppUserId", t[t.BackendInvalidAuthToken = 7224] = "BackendInvalidAuthToken", t[t.BackendInvalidAPIKey = 7225] = "BackendInvalidAPIKey", t[t.BackendBadRequest = 7226] = "BackendBadRequest", t[t.BackendPlayStoreQuotaExceeded = 7229] = "BackendPlayStoreQuotaExceeded", t[t.BackendPlayStoreInvalidPackageName = 7230] = "BackendPlayStoreInvalidPackageName", t[t.BackendPlayStoreGenericError = 7231] = "BackendPlayStoreGenericError", t[t.BackendUserIneligibleForPromoOffer = 7232] = "BackendUserIneligibleForPromoOffer", t[t.BackendInvalidAppleSubscriptionKey = 7234] = "BackendInvalidAppleSubscriptionKey", t[t.BackendInvalidSubscriberAttributes = 7263] = "BackendInvalidSubscriberAttributes", t[t.BackendInvalidSubscriberAttributesBody = 7264] = "BackendInvalidSubscriberAttributesBody", t[t.BackendProductIDsMalformed = 7662] = "BackendProductIDsMalformed", t))(Ft || {});
+var xt = /* @__PURE__ */ ((t) => (t[t.BackendInvalidPlatform = 7e3] = "BackendInvalidPlatform", t[t.BackendStoreProblem = 7101] = "BackendStoreProblem", t[t.BackendCannotTransferPurchase = 7102] = "BackendCannotTransferPurchase", t[t.BackendInvalidReceiptToken = 7103] = "BackendInvalidReceiptToken", t[t.BackendInvalidAppStoreSharedSecret = 7104] = "BackendInvalidAppStoreSharedSecret", t[t.BackendInvalidPaymentModeOrIntroPriceNotProvided = 7105] = "BackendInvalidPaymentModeOrIntroPriceNotProvided", t[t.BackendProductIdForGoogleReceiptNotProvided = 7106] = "BackendProductIdForGoogleReceiptNotProvided", t[t.BackendInvalidPlayStoreCredentials = 7107] = "BackendInvalidPlayStoreCredentials", t[t.BackendInternalServerError = 7110] = "BackendInternalServerError", t[t.BackendEmptyAppUserId = 7220] = "BackendEmptyAppUserId", t[t.BackendInvalidAuthToken = 7224] = "BackendInvalidAuthToken", t[t.BackendInvalidAPIKey = 7225] = "BackendInvalidAPIKey", t[t.BackendBadRequest = 7226] = "BackendBadRequest", t[t.BackendPlayStoreQuotaExceeded = 7229] = "BackendPlayStoreQuotaExceeded", t[t.BackendPlayStoreInvalidPackageName = 7230] = "BackendPlayStoreInvalidPackageName", t[t.BackendPlayStoreGenericError = 7231] = "BackendPlayStoreGenericError", t[t.BackendUserIneligibleForPromoOffer = 7232] = "BackendUserIneligibleForPromoOffer", t[t.BackendInvalidAppleSubscriptionKey = 7234] = "BackendInvalidAppleSubscriptionKey", t[t.BackendInvalidSubscriberAttributes = 7263] = "BackendInvalidSubscriberAttributes", t[t.BackendInvalidSubscriberAttributesBody = 7264] = "BackendInvalidSubscriberAttributesBody", t[t.BackendProductIDsMalformed = 7662] = "BackendProductIDsMalformed", t[t.BackendOfferNotFound = 7814] = "BackendOfferNotFound", t))(xt || {});
 class X extends Error {
   constructor(r, n, i) {
     super(n);
@@ -4085,7 +4090,7 @@ class ao extends Error {
     super("Purchases must be configured before calling getInstance");
   }
 }
-const uo = "0.3.0", fe = "https://api.revenuecat.com";
+const uo = "0.3.1", fe = "https://api.revenuecat.com";
 var Re;
 (function(t) {
   t[t.CONTINUE = 100] = "CONTINUE", t[t.SWITCHING_PROTOCOLS = 101] = "SWITCHING_PROTOCOLS", t[t.PROCESSING = 102] = "PROCESSING", t[t.EARLY_HINTS = 103] = "EARLY_HINTS", t[t.OK = 200] = "OK", t[t.CREATED = 201] = "CREATED", t[t.ACCEPTED = 202] = "ACCEPTED", t[t.NON_AUTHORITATIVE_INFORMATION = 203] = "NON_AUTHORITATIVE_INFORMATION", t[t.NO_CONTENT = 204] = "NO_CONTENT", t[t.RESET_CONTENT = 205] = "RESET_CONTENT", t[t.PARTIAL_CONTENT = 206] = "PARTIAL_CONTENT", t[t.MULTI_STATUS = 207] = "MULTI_STATUS", t[t.MULTIPLE_CHOICES = 300] = "MULTIPLE_CHOICES", t[t.MOVED_PERMANENTLY = 301] = "MOVED_PERMANENTLY", t[t.MOVED_TEMPORARILY = 302] = "MOVED_TEMPORARILY", t[t.SEE_OTHER = 303] = "SEE_OTHER", t[t.NOT_MODIFIED = 304] = "NOT_MODIFIED", t[t.USE_PROXY = 305] = "USE_PROXY", t[t.TEMPORARY_REDIRECT = 307] = "TEMPORARY_REDIRECT", t[t.PERMANENT_REDIRECT = 308] = "PERMANENT_REDIRECT", t[t.BAD_REQUEST = 400] = "BAD_REQUEST", t[t.UNAUTHORIZED = 401] = "UNAUTHORIZED", t[t.PAYMENT_REQUIRED = 402] = "PAYMENT_REQUIRED", t[t.FORBIDDEN = 403] = "FORBIDDEN", t[t.NOT_FOUND = 404] = "NOT_FOUND", t[t.METHOD_NOT_ALLOWED = 405] = "METHOD_NOT_ALLOWED", t[t.NOT_ACCEPTABLE = 406] = "NOT_ACCEPTABLE", t[t.PROXY_AUTHENTICATION_REQUIRED = 407] = "PROXY_AUTHENTICATION_REQUIRED", t[t.REQUEST_TIMEOUT = 408] = "REQUEST_TIMEOUT", t[t.CONFLICT = 409] = "CONFLICT", t[t.GONE = 410] = "GONE", t[t.LENGTH_REQUIRED = 411] = "LENGTH_REQUIRED", t[t.PRECONDITION_FAILED = 412] = "PRECONDITION_FAILED", t[t.REQUEST_TOO_LONG = 413] = "REQUEST_TOO_LONG", t[t.REQUEST_URI_TOO_LONG = 414] = "REQUEST_URI_TOO_LONG", t[t.UNSUPPORTED_MEDIA_TYPE = 415] = "UNSUPPORTED_MEDIA_TYPE", t[t.REQUESTED_RANGE_NOT_SATISFIABLE = 416] = "REQUESTED_RANGE_NOT_SATISFIABLE", t[t.EXPECTATION_FAILED = 417] = "EXPECTATION_FAILED", t[t.IM_A_TEAPOT = 418] = "IM_A_TEAPOT", t[t.INSUFFICIENT_SPACE_ON_RESOURCE = 419] = "INSUFFICIENT_SPACE_ON_RESOURCE", t[t.METHOD_FAILURE = 420] = "METHOD_FAILURE", t[t.MISDIRECTED_REQUEST = 421] = "MISDIRECTED_REQUEST", t[t.UNPROCESSABLE_ENTITY = 422] = "UNPROCESSABLE_ENTITY", t[t.LOCKED = 423] = "LOCKED", t[t.FAILED_DEPENDENCY = 424] = "FAILED_DEPENDENCY", t[t.UPGRADE_REQUIRED = 426] = "UPGRADE_REQUIRED", t[t.PRECONDITION_REQUIRED = 428] = "PRECONDITION_REQUIRED", t[t.TOO_MANY_REQUESTS = 429] = "TOO_MANY_REQUESTS", t[t.REQUEST_HEADER_FIELDS_TOO_LARGE = 431] = "REQUEST_HEADER_FIELDS_TOO_LARGE", t[t.UNAVAILABLE_FOR_LEGAL_REASONS = 451] = "UNAVAILABLE_FOR_LEGAL_REASONS", t[t.INTERNAL_SERVER_ERROR = 500] = "INTERNAL_SERVER_ERROR", t[t.NOT_IMPLEMENTED = 501] = "NOT_IMPLEMENTED", t[t.BAD_GATEWAY = 502] = "BAD_GATEWAY", t[t.SERVICE_UNAVAILABLE = 503] = "SERVICE_UNAVAILABLE", t[t.GATEWAY_TIMEOUT = 504] = "GATEWAY_TIMEOUT", t[t.HTTP_VERSION_NOT_SUPPORTED = 505] = "HTTP_VERSION_NOT_SUPPORTED", t[t.INSUFFICIENT_STORAGE = 507] = "INSUFFICIENT_STORAGE", t[t.NETWORK_AUTHENTICATION_REQUIRED = 511] = "NETWORK_AUTHENTICATION_REQUIRED";
@@ -4288,7 +4293,7 @@ class $o extends U {
   }
 }
 function vo(t) {
-  x(t, "svelte-1rhrjxe", "div.svelte-1rhrjxe{background-color:var(--rc-color-warning);color:var(--rc-color-grey-text-dark);font-size:10px;font-weight:bold;text-transform:uppercase;padding:4px 10px;line-height:10px;border-radius:9px;margin:0px;margin-left:16px}");
+  F(t, "svelte-1rhrjxe", "div.svelte-1rhrjxe{background-color:var(--rc-color-warning);color:var(--rc-color-grey-text-dark);font-size:10px;font-weight:bold;text-transform:uppercase;padding:4px 10px;line-height:10px;border-radius:9px;margin:0px;margin-left:16px}");
 }
 function yo(t) {
   let e;
@@ -4313,17 +4318,17 @@ class Bo extends U {
   }
 }
 function Do(t) {
-  x(t, "svelte-1qect5g", `.rcb-ui-container.svelte-1qect5g{color-scheme:none;font-size:16px;line-height:1.5em;font-weight:400;font-family:-apple-system, "system-ui", "Segoe UI", Roboto, Oxygen, Ubuntu,
+  F(t, "svelte-1qect5g", `.rcb-ui-container.svelte-1qect5g{color-scheme:none;font-size:16px;line-height:1.5em;font-weight:400;font-family:-apple-system, "system-ui", "Segoe UI", Roboto, Oxygen, Ubuntu,
         Cantarell, "Open Sans", "Helvetica Neue", sans-serif}.rcb-ui-layout.svelte-1qect5g{width:100vw;width:100 dvw;margin-right:auto;display:flex;justify-content:center;align-items:flex-start;position:relative;padding:0px 80px;box-sizing:border-box}.rcb-ui-aside.svelte-1qect5g{margin-right:16px;flex:320px 1 0;max-width:480px}.rcb-ui-main.svelte-1qect5g{flex:480px 1 0;max-width:640px}@media screen and (max-width: 960px){.rcb-ui-layout.svelte-1qect5g{flex-direction:column;align-items:center;justify-content:center;height:100%;min-width:100%}.rcb-ui-aside.svelte-1qect5g{margin-right:0;margin-bottom:16px;min-width:100%;display:flex;flex-direction:column;align-items:center;flex:none;max-width:none}.rcb-ui-main.svelte-1qect5g{flex:none;max-width:none;min-width:100%}}@media screen and (max-width: 960px) and (max-height: 960px){.rcb-ui-layout.svelte-1qect5g{overflow-y:scroll;justify-content:flex-start;padding:16px 0px}}`);
 }
-function _t(t) {
+function At(t) {
   let e, r, n;
-  return r = new xt({
+  return r = new Ft({
     props: {
       dark: !0,
       $$slots: {
         header: [To],
-        default: [Co]
+        default: [Mo]
       },
       $$scope: { ctx: t }
     }
@@ -4350,7 +4355,7 @@ function _t(t) {
     }
   };
 }
-function At(t) {
+function ht(t) {
   let e, r;
   return e = new Pt({
     props: {
@@ -4389,11 +4394,11 @@ function At(t) {
     }
   };
 }
-function Co(t) {
+function Mo(t) {
   let e, r, n = (
     /*productDetails*/
     t[3] && /*purchaseOption*/
-    t[1] && At(t)
+    t[1] && ht(t)
   );
   return {
     c() {
@@ -4406,7 +4411,7 @@ function Co(t) {
       /*productDetails*/
       i[3] && /*purchaseOption*/
       i[1] ? n ? (n.p(i, o), o & /*productDetails, purchaseOption*/
-      10 && f(n, 1)) : (n = At(i), n.c(), f(n, 1), n.m(e.parentNode, e)) : n && (Y(), m(n, 1, 1, () => {
+      10 && f(n, 1)) : (n = ht(i), n.c(), f(n, 1), n.m(e.parentNode, e)) : n && (Y(), m(n, 1, 1, () => {
         n = null;
       }), H());
     },
@@ -4421,7 +4426,7 @@ function Co(t) {
     }
   };
 }
-function Mo(t) {
+function Co(t) {
   let e, r;
   return e = new $o({}), {
     c() {
@@ -4469,7 +4474,7 @@ function Po(t) {
       t[4]
     ) }
   });
-  const c = [Qo, Mo], a = [];
+  const c = [Qo, Co], a = [];
   function u(d, h) {
     return h & /*purchases*/
     4 && (n = null), n == null && (n = !!/*purchases*/
@@ -4505,7 +4510,7 @@ function Po(t) {
 }
 function To(t) {
   let e, r;
-  return e = new ze({
+  return e = new Xe({
     props: {
       slot: "header",
       $$slots: { default: [Po] },
@@ -4534,7 +4539,7 @@ function To(t) {
     }
   };
 }
-function ht(t) {
+function Et(t) {
   let e, r;
   return e = new Pt({
     props: {
@@ -4573,9 +4578,9 @@ function ht(t) {
     }
   };
 }
-function Et(t) {
+function bt(t) {
   let e, r;
-  return e = new Ve({}), {
+  return e = new We({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -4593,7 +4598,7 @@ function Et(t) {
     }
   };
 }
-function bt(t) {
+function It(t) {
   let e, r;
   return e = new Hi({
     props: {
@@ -4634,7 +4639,7 @@ function bt(t) {
     }
   };
 }
-function It(t) {
+function wt(t) {
   let e, r;
   return e = new Pi({
     props: {
@@ -4685,9 +4690,9 @@ function It(t) {
     }
   };
 }
-function wt(t) {
+function kt(t) {
   let e, r;
-  return e = new Ve({}), {
+  return e = new We({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -4705,7 +4710,7 @@ function wt(t) {
     }
   };
 }
-function kt(t) {
+function $t(t) {
   var n;
   let e, r;
   return e = new Rr({
@@ -4756,7 +4761,7 @@ function kt(t) {
     }
   };
 }
-function $t(t) {
+function vt(t) {
   let e, r;
   return e = new Kr({
     props: {
@@ -4798,29 +4803,29 @@ function No(t) {
     /*state*/
     t[7] === "present-offer" && /*productDetails*/
     t[3] && /*purchaseOption*/
-    t[1] && ht(t)
+    t[1] && Et(t)
   ), u = (
     /*state*/
     t[7] === "present-offer" && !/*productDetails*/
-    t[3] && Et()
+    t[3] && bt()
   ), d = (
     /*state*/
     (t[7] === "needs-auth-info" || /*state*/
-    t[7] === "processing-auth-info") && bt(t)
+    t[7] === "processing-auth-info") && It(t)
   ), h = (
     /*paymentInfoCollectionMetadata*/
     t[5] && /*state*/
     (t[7] === "needs-payment-info" || /*state*/
-    t[7] === "polling-purchase-status") && It(t)
+    t[7] === "polling-purchase-status") && wt(t)
   ), $ = (
     /*state*/
-    t[7] === "loading" && wt()
+    t[7] === "loading" && kt()
   ), E = (
     /*state*/
-    t[7] === "error" && kt(t)
+    t[7] === "error" && $t(t)
   ), B = (
     /*state*/
-    t[7] === "success" && $t(t)
+    t[7] === "success" && vt(t)
   );
   return {
     c() {
@@ -4834,35 +4839,35 @@ function No(t) {
       A[7] === "present-offer" && /*productDetails*/
       A[3] && /*purchaseOption*/
       A[1] ? a ? (a.p(A, y), y & /*state, productDetails, purchaseOption*/
-      138 && f(a, 1)) : (a = ht(A), a.c(), f(a, 1), a.m(e.parentNode, e)) : a && (Y(), m(a, 1, 1, () => {
+      138 && f(a, 1)) : (a = Et(A), a.c(), f(a, 1), a.m(e.parentNode, e)) : a && (Y(), m(a, 1, 1, () => {
         a = null;
       }), H()), /*state*/
       A[7] === "present-offer" && !/*productDetails*/
       A[3] ? u ? y & /*state, productDetails*/
-      136 && f(u, 1) : (u = Et(), u.c(), f(u, 1), u.m(r.parentNode, r)) : u && (Y(), m(u, 1, 1, () => {
+      136 && f(u, 1) : (u = bt(), u.c(), f(u, 1), u.m(r.parentNode, r)) : u && (Y(), m(u, 1, 1, () => {
         u = null;
       }), H()), /*state*/
       A[7] === "needs-auth-info" || /*state*/
       A[7] === "processing-auth-info" ? d ? (d.p(A, y), y & /*state*/
-      128 && f(d, 1)) : (d = bt(A), d.c(), f(d, 1), d.m(n.parentNode, n)) : d && (Y(), m(d, 1, 1, () => {
+      128 && f(d, 1)) : (d = It(A), d.c(), f(d, 1), d.m(n.parentNode, n)) : d && (Y(), m(d, 1, 1, () => {
         d = null;
       }), H()), /*paymentInfoCollectionMetadata*/
       A[5] && /*state*/
       (A[7] === "needs-payment-info" || /*state*/
       A[7] === "polling-purchase-status") ? h ? (h.p(A, y), y & /*paymentInfoCollectionMetadata, state*/
-      160 && f(h, 1)) : (h = It(A), h.c(), f(h, 1), h.m(i.parentNode, i)) : h && (Y(), m(h, 1, 1, () => {
+      160 && f(h, 1)) : (h = wt(A), h.c(), f(h, 1), h.m(i.parentNode, i)) : h && (Y(), m(h, 1, 1, () => {
         h = null;
       }), H()), /*state*/
       A[7] === "loading" ? $ ? y & /*state*/
-      128 && f($, 1) : ($ = wt(), $.c(), f($, 1), $.m(o.parentNode, o)) : $ && (Y(), m($, 1, 1, () => {
+      128 && f($, 1) : ($ = kt(), $.c(), f($, 1), $.m(o.parentNode, o)) : $ && (Y(), m($, 1, 1, () => {
         $ = null;
       }), H()), /*state*/
       A[7] === "error" ? E ? (E.p(A, y), y & /*state*/
-      128 && f(E, 1)) : (E = kt(A), E.c(), f(E, 1), E.m(s.parentNode, s)) : E && (Y(), m(E, 1, 1, () => {
+      128 && f(E, 1)) : (E = $t(A), E.c(), f(E, 1), E.m(s.parentNode, s)) : E && (Y(), m(E, 1, 1, () => {
         E = null;
       }), H()), /*state*/
       A[7] === "success" ? B ? (B.p(A, y), y & /*state*/
-      128 && f(B, 1)) : (B = $t(A), B.c(), f(B, 1), B.m(l.parentNode, l)) : B && (Y(), m(B, 1, 1, () => {
+      128 && f(B, 1)) : (B = vt(A), B.c(), f(B, 1), B.m(l.parentNode, l)) : B && (Y(), m(B, 1, 1, () => {
         B = null;
       }), H());
     },
@@ -4884,8 +4889,8 @@ function Uo(t) {
       /*state*/
       t[7]
     )
-  ), n, i, o, s, l = r && _t(t);
-  return o = new xt({
+  ), n, i, o, s, l = r && At(t);
+  return o = new Ft({
     props: {
       $$slots: { default: [No] },
       $$scope: { ctx: t }
@@ -4900,7 +4905,7 @@ function Uo(t) {
       );
     },
     m(c, a) {
-      p(c, e, a), l && l.m(e, null), M(e, n), M(e, i), b(o, i, null), s = !0;
+      p(c, e, a), l && l.m(e, null), C(e, n), C(e, i), b(o, i, null), s = !0;
     },
     p(c, a) {
       a & /*state*/
@@ -4909,7 +4914,7 @@ function Uo(t) {
         /*state*/
         c[7]
       )), r ? l ? (l.p(c, a), a & /*state*/
-      128 && f(l, 1)) : (l = _t(c), l.c(), f(l, 1), l.m(e, n)) : l && (Y(), m(l, 1, 1, () => {
+      128 && f(l, 1)) : (l = At(c), l.c(), f(l, 1), l.m(e, n)) : l && (Y(), m(l, 1, 1, () => {
         l = null;
       }), H());
       const u = {};
@@ -4964,11 +4969,11 @@ function Ro(t) {
   };
 }
 function Oo(t, e, r) {
-  var Ze, et;
+  var et, tt;
   let { asModal: n = !0 } = e, { customerEmail: i } = e, { appUserId: o } = e, { rcPackage: s } = e, { purchaseOption: l } = e, { onFinished: c } = e, { onError: a } = e, { onClose: u } = e, { purchases: d } = e, { backend: h } = e, { purchaseOperationHelper: $ } = e;
-  const E = Object.entries(_e).map(([D, xe]) => `--rc-color-${D}: ${xe}`).join("; ");
+  const E = Object.entries(_e).map(([D, Fe]) => `--rc-color-${D}: ${Fe}`).join("; ");
   let B = null, A = null, y = null, R = null;
-  const C = ((Ze = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : Ze.identifier) ?? null, ve = (et = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : et.defaultSubscriptionOption, F = l || ve;
+  const M = ((et = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : et.identifier) ?? null, ve = (tt = s == null ? void 0 : s.rcBillingProduct) == null ? void 0 : tt.defaultSubscriptionOption, x = l || ve;
   let O = "present-offer";
   const ye = [
     "present-offer",
@@ -4980,14 +4985,14 @@ function Oo(t, e, r) {
   ];
   Se(async () => {
     if (r(3, B = s.rcBillingProduct), r(4, A = await h.getBrandingInfo()), O === "present-offer") {
-      i ? Xe() : r(7, O = "needs-auth-info");
+      i ? Ze() : r(7, O = "needs-auth-info");
       return;
     }
   });
   const Be = () => {
     u();
-  }, Xe = () => {
-    if (C === null) {
+  }, Ze = () => {
+    if (M === null) {
       de(new K(L.ErrorSettingUpPurchase, "Product ID was not set before purchase."));
       return;
     } else
@@ -4996,7 +5001,7 @@ function Oo(t, e, r) {
       de(new K(L.MissingEmailError));
       return;
     }
-    $.startPurchase(o, C, F, i, s.rcBillingProduct.presentedOfferingIdentifier).then((D) => {
+    $.startPurchase(o, M, x, i, s.rcBillingProduct.presentedOfferingIdentifier).then((D) => {
       if (D.next_action === "collect_payment_info") {
         r(7, O = "needs-payment-info"), r(5, y = D);
         return;
@@ -5010,14 +5015,14 @@ function Oo(t, e, r) {
     });
   }, Yt = (D) => {
     if (O === "needs-auth-info") {
-      D && (r(14, i = D.email), r(7, O = "processing-auth-info")), Xe();
+      D && (r(14, i = D.email), r(7, O = "processing-auth-info")), Ze();
       return;
     }
     if (O === "needs-payment-info") {
       r(7, O = "polling-purchase-status"), $.pollCurrentPurchaseForCompletion().then(() => {
         r(7, O = "success");
-      }).catch((xe) => {
-        de(xe);
+      }).catch((Fe) => {
+        de(Fe);
       });
       return;
     }
@@ -5086,10 +5091,10 @@ class So extends U {
 function Lo(t) {
   return t.expires_date == null ? !0 : new Date(t.expires_date) > /* @__PURE__ */ new Date();
 }
-function xo(t, e, r, n) {
+function Fo(t, e, r, n) {
   const i = e.product_identifier;
   if (i in r)
-    return Fo(
+    return xo(
       t,
       e,
       r[i]
@@ -5105,7 +5110,7 @@ function xo(t, e, r, n) {
     "Could not find entitlement product in subscriptions or non-subscriptions."
   );
 }
-function Fo(t, e, r) {
+function xo(t, e, r) {
   return {
     identifier: t,
     isActive: Lo(e),
@@ -5146,7 +5151,7 @@ function Go(t, e, r) {
 function Yo(t, e, r) {
   const n = {}, i = {};
   for (const o in t) {
-    const s = xo(
+    const s = Fo(
       o,
       t[o],
       e,
@@ -5280,9 +5285,9 @@ const z = class z {
       r.product_details.forEach((l) => {
         i[l.identifier] = l;
       });
-      const o = n == null ? null : rt(n, i), s = {};
+      const o = n == null ? null : it(n, i), s = {};
       return e.offerings.forEach((l) => {
-        const c = rt(l, i);
+        const c = it(l, i);
         c != null && (s[l.identifier] = c);
       }), Object.keys(s).length == 0 && G.debugLog(
         "Empty offerings. Please make sure you've configured offerings correctly in the RevenueCat dashboard and that the products are properly configured."
@@ -5482,12 +5487,12 @@ const z = class z {
 };
 /** @internal */
 Q(z, "instance");
-let vt = z;
+let yt = z;
 export {
   ne as ErrorCode,
   W as LogLevel,
   zt as PackageType,
-  vt as Purchases,
+  yt as Purchases,
   X as PurchasesError,
   ao as UninitializedPurchasesError
 };