npm - @revenuecat/purchases-js - Versions diffs - 0.1.3 → 0.2.0 - Mend

@revenuecat/purchases-js 0.1.3 → 0.2.0

This diff represents the content of publicly available package versions that have been released to one of the supported registries. The information contained in this diff is provided for informational purposes only and reflects changes between package versions as they appear in their respective public registries.

Files changed (4) hide show

package/dist/Purchases.es.js CHANGED Viewed

@@ -4,23 +4,130 @@ var Q = (t, e, r) => (Lt(t, typeof e != "symbol" ? e + "" : e, r), r);
 function xt(t) {
   return t != null;
 }
-var Ft = /* @__PURE__ */ ((t) => (t.Unknown = "unknown", t.Custom = "custom", t.Lifetime = "$rc_lifetime", t.Annual = "$rc_annual", t.SixMonth = "$rc_six_month", t.ThreeMonth = "$rc_three_month", t.TwoMonth = "$rc_two_month", t.Monthly = "$rc_monthly", t.Weekly = "$rc_weekly", t))(Ft || {});
-const Gt = (t, e) => ({
+var j = /* @__PURE__ */ ((t) => (t[t.Silent = 0] = "Silent", t[t.Error = 1] = "Error", t[t.Warn = 2] = "Warn", t[t.Info = 3] = "Info", t[t.Debug = 4] = "Debug", t[t.Verbose = 5] = "Verbose", t))(j || {});
+class V {
+  static setLogLevel(e) {
+    this.logLevel = e;
+  }
+  static log(e, r = this.logLevel) {
+    const n = `[Purchases] ${e}`;
+    if (!(this.logLevel < r || r === j.Silent))
+      switch (r) {
+        case j.Error:
+          console.error(n);
+          break;
+        case j.Warn:
+          console.warn(n);
+          break;
+        case j.Info:
+          console.info(n);
+          break;
+        case j.Debug:
+          console.debug(n);
+          break;
+        case j.Verbose:
+          console.debug(n);
+          break;
+      }
+  }
+  static errorLog(e) {
+    this.log(e, j.Error);
+  }
+  static warnLog(e) {
+    this.log(e, j.Warn);
+  }
+  static infoLog(e) {
+    this.log(e, j.Info);
+  }
+  static debugLog(e) {
+    this.log(e, j.Debug);
+  }
+  static verboseLog(e) {
+    this.log(e, j.Verbose);
+  }
+}
+Q(V, "logLevel", j.Silent);
+var pe = /* @__PURE__ */ ((t) => (t.Year = "year", t.Month = "month", t.Week = "week", t.Day = "day", t))(pe || {});
+function Ft(t) {
+  const e = t.match(/^PT?([0-9]+)([MDYW])$/);
+  if (!e || e.length < 3)
+    return V.errorLog(`Invalid ISO 8601 duration format: ${t}`), null;
+  const r = parseInt(e[1]);
+  switch (e[2]) {
+    case "Y":
+      return {
+        number: r,
+        unit: "year"
+        /* Year */
+      };
+    case "M":
+      return {
+        number: r,
+        unit: "month"
+        /* Month */
+      };
+    case "W":
+      return {
+        number: r,
+        unit: "week"
+        /* Week */
+      };
+    case "D":
+      return {
+        number: r,
+        unit: "day"
+        /* Day */
+      };
+    default:
+      return V.errorLog(`Invalid ISO 8601 unit duration format: ${t}`), null;
+  }
+}
+const Ye = (t, e) => {
+  const r = t / 100;
+  return new Intl.NumberFormat("en-US", {
+    style: "currency",
+    currency: e
+  }).format(r);
+}, Xe = (t) => {
+  const e = Ft(t);
+  if (!e)
+    return "unknown";
+  const r = e.number;
+  if (r === 1)
+    switch (e.unit) {
+      case pe.Year:
+        return "yearly";
+      case pe.Month:
+        return "monthly";
+      case pe.Week:
+        return "weekly";
+      case pe.Day:
+        return "daily";
+    }
+  else
+    return `every ${r} ${e.unit}s`;
+};
+var Gt = /* @__PURE__ */ ((t) => (t.Unknown = "unknown", t.Custom = "custom", t.Lifetime = "$rc_lifetime", t.Annual = "$rc_annual", t.SixMonth = "$rc_six_month", t.ThreeMonth = "$rc_three_month", t.TwoMonth = "$rc_two_month", t.Monthly = "$rc_monthly", t.Weekly = "$rc_weekly", t))(Gt || {});
+const Yt = (t) => ({
+  amount: t.amount,
+  currency: t.currency,
+  formattedPrice: Ye(t.amount, t.currency)
+}), Ht = (t, e) => ({
   identifier: t.identifier,
   displayName: t.title,
-  currentPrice: t.current_price,
+  currentPrice: Yt(t.current_price),
   normalPeriodDuration: t.normal_period_duration,
   presentedOfferingIdentifier: e
-}), Yt = (t, e, r) => {
+}), Kt = (t, e, r) => {
   const n = r[e.platform_product_identifier];
   return n === void 0 ? null : {
     identifier: e.identifier,
-    rcBillingProduct: Gt(n, t),
-    packageType: Ht(e.identifier)
+    rcBillingProduct: Ht(n, t),
+    packageType: qt(e.identifier)
   };
-}, ze = (t, e) => {
+}, Ze = (t, e) => {
   const r = t.packages.map(
-    (i) => Yt(t.identifier, i, e)
+    (i) => Kt(t.identifier, i, e)
   ).filter(xt), n = {};
   for (const i of r)
     i != null && (n[i.identifier] = i);
@@ -39,7 +146,7 @@ const Gt = (t, e) => ({
     weekly: n.$rc_weekly ?? null
   };
 };
-function Ht(t) {
+function qt(t) {
   switch (t) {
     case "$rc_lifetime":
       return "$rc_lifetime";
@@ -59,9 +166,9 @@ function Ht(t) {
       return t.startsWith("$rc_") ? "unknown" : "custom";
   }
 }
-function B() {
+function y() {
 }
-function Kt(t, e) {
+function jt(t, e) {
   for (const r in e)
     t[r] = e[r];
   return (
@@ -72,7 +179,7 @@ function Kt(t, e) {
 function bt(t) {
   return t();
 }
-function Xe() {
+function et() {
   return /* @__PURE__ */ Object.create(null);
 }
 function ke(t) {
@@ -84,15 +191,15 @@ function ae(t) {
 function P(t, e) {
   return t != t ? e == e : t !== e || t && typeof t == "object" || typeof t == "function";
 }
-let ye;
+let Be;
 function Z(t, e) {
-  return t === e ? !0 : (ye || (ye = document.createElement("a")), ye.href = e, t === ye.href);
+  return t === e ? !0 : (Be || (Be = document.createElement("a")), Be.href = e, t === Be.href);
 }
-function Ze(t) {
+function tt(t) {
   return t.split(",").map((e) => e.trim().split(" ").filter(Boolean));
 }
-function qt(t, e) {
-  const r = Ze(t.srcset), n = Ze(e || "");
+function Jt(t, e) {
+  const r = tt(t.srcset), n = tt(e || "");
   return n.length === r.length && n.every(
     ([i, o], s) => o === r[s][1] && // We need to test both ways because Vite will create an a full URL with
     // `new URL(asset, import.meta.url).href` for the client when `base: './'`, and the
@@ -102,7 +209,7 @@ function qt(t, e) {
     (Z(r[s][0], i) || Z(i, r[s][0]))
   );
 }
-function jt(t) {
+function Vt(t) {
   return Object.keys(t).length === 0;
 }
 function Y(t, e, r, n) {
@@ -112,7 +219,7 @@ function Y(t, e, r, n) {
   }
 }
 function wt(t, e, r, n) {
-  return t[1] && n ? Kt(r.ctx.slice(), t[1](n(e))) : r.ctx;
+  return t[1] && n ? jt(r.ctx.slice(), t[1](n(e))) : r.ctx;
 }
 function H(t, e, r, n) {
   if (t[2] && n) {
@@ -151,13 +258,13 @@ function D(t, e) {
   t.appendChild(e);
 }
 function O(t, e, r) {
-  const n = Jt(t);
+  const n = Wt(t);
   if (!n.getElementById(e)) {
     const i = k("style");
-    i.id = e, i.textContent = r, Vt(n, i);
+    i.id = e, i.textContent = r, zt(n, i);
   }
 }
-function Jt(t) {
+function Wt(t) {
   if (!t)
     return document;
   const e = t.getRootNode ? t.getRootNode() : t.ownerDocument;
@@ -167,7 +274,7 @@ function Jt(t) {
     e
   ) : t.ownerDocument;
 }
-function Vt(t, e) {
+function zt(t, e) {
   return D(
     /** @type {Document} */
     t.head || t,
@@ -203,35 +310,35 @@ function kt(t) {
 function _(t, e, r) {
   r == null ? t.removeAttribute(e) : t.getAttribute(e) !== r && t.setAttribute(e, r);
 }
-const Wt = ["width", "height"];
-function zt(t, e) {
+const Xt = ["width", "height"];
+function Zt(t, e) {
   const r = Object.getOwnPropertyDescriptors(t.__proto__);
   for (const n in e)
-    e[n] == null ? t.removeAttribute(n) : n === "style" ? t.style.cssText = e[n] : n === "__value" ? t.value = t[n] = e[n] : r[n] && r[n].set && Wt.indexOf(n) === -1 ? t[n] = e[n] : _(t, n, e[n]);
+    e[n] == null ? t.removeAttribute(n) : n === "style" ? t.style.cssText = e[n] : n === "__value" ? t.value = t[n] = e[n] : r[n] && r[n].set && Xt.indexOf(n) === -1 ? t[n] = e[n] : _(t, n, e[n]);
 }
-function Xt(t, e) {
+function en(t, e) {
   Object.keys(e).forEach((r) => {
-    Zt(t, r, e[r]);
+    tn(t, r, e[r]);
   });
 }
-function Zt(t, e, r) {
+function tn(t, e, r) {
   const n = e.toLowerCase();
   n in t ? t[n] = typeof t[n] == "boolean" && r === "" ? !0 : r : e in t ? t[e] = typeof t[e] == "boolean" && r === "" ? !0 : r : _(t, e, r);
 }
-function en(t) {
-  return /-/.test(t) ? Xt : zt;
+function nn(t) {
+  return /-/.test(t) ? en : Zt;
 }
-function tn(t) {
+function rn(t) {
   return Array.from(t.childNodes);
 }
 function ne(t, e) {
   e = "" + e, t.data !== e && (t.data = /** @type {string} */
   e);
 }
-function et(t, e) {
+function nt(t, e) {
   t.value = e ?? "";
 }
-function nn(t, e, { bubbles: r = !1, cancelable: n = !1 } = {}) {
+function on(t, e, { bubbles: r = !1, cancelable: n = !1 } = {}) {
   return new CustomEvent(t, { detail: e, bubbles: r, cancelable: n });
 }
 let be;
@@ -246,12 +353,12 @@ function Re() {
 function Se(t) {
   Re().$$.on_mount.push(t);
 }
-function rn() {
+function sn() {
   const t = Re();
   return (e, r, { cancelable: n = !1 } = {}) => {
     const i = t.$$.callbacks[e];
     if (i) {
-      const o = nn(
+      const o = on(
         /** @type {string} */
         e,
         r,
@@ -264,10 +371,10 @@ function rn() {
     return !0;
   };
 }
-function on(t, e) {
+function ln(t, e) {
   return Re().$$.context.set(t, e), e;
 }
-function sn(t) {
+function cn(t) {
   return Re().$$.context.get(t);
 }
 function $t(t, e) {
@@ -276,16 +383,16 @@ function $t(t, e) {
 }
 const le = [], Ne = [];
 let ce = [];
-const Ye = [], ln = /* @__PURE__ */ Promise.resolve();
-let He = !1;
-function cn() {
-  He || (He = !0, ln.then(vt));
+const He = [], an = /* @__PURE__ */ Promise.resolve();
+let Ke = !1;
+function un() {
+  Ke || (Ke = !0, an.then(vt));
 }
-function Ke(t) {
+function qe(t) {
   ce.push(t);
 }
-function an(t) {
-  Ye.push(t);
+function fn(t) {
+  He.push(t);
 }
 const xe = /* @__PURE__ */ new Set();
 let oe = 0;
@@ -297,7 +404,7 @@ function vt() {
     try {
       for (; oe < le.length; ) {
         const e = le[oe];
-        oe++, he(e), un(e.$$);
+        oe++, he(e), dn(e.$$);
       }
     } catch (e) {
       throw le.length = 0, oe = 0, e;
@@ -310,18 +417,18 @@ function vt() {
     }
     ce.length = 0;
   } while (le.length);
-  for (; Ye.length; )
-    Ye.pop()();
-  He = !1, xe.clear(), he(t);
+  for (; He.length; )
+    He.pop()();
+  Ke = !1, xe.clear(), he(t);
 }
-function un(t) {
+function dn(t) {
   if (t.fragment !== null) {
     t.update(), ke(t.before_update);
     const e = t.dirty;
-    t.dirty = [-1], t.fragment && t.fragment.p(t.ctx, e), t.after_update.forEach(Ke);
+    t.dirty = [-1], t.fragment && t.fragment.p(t.ctx, e), t.after_update.forEach(qe);
   }
 }
-function fn(t) {
+function mn(t) {
   const e = [], r = [];
   ce.forEach((n) => t.indexOf(n) === -1 ? e.push(n) : r.push(n)), r.forEach((n) => n()), ce = e;
 }
@@ -351,7 +458,7 @@ function m(t, e, r, n) {
   } else
     n && n();
 }
-function dn(t, e, r) {
+function gn(t, e, r) {
   const n = t.$$.props[e];
   n !== void 0 && (t.$$.bound[n] = r, r(t.$$.ctx[n]));
 }
@@ -360,17 +467,17 @@ function w(t) {
 }
 function I(t, e, r) {
   const { fragment: n, after_update: i } = t.$$;
-  n && n.m(e, r), Ke(() => {
+  n && n.m(e, r), qe(() => {
     const o = t.$$.on_mount.map(bt).filter(ae);
     t.$$.on_destroy ? t.$$.on_destroy.push(...o) : ke(o), t.$$.on_mount = [];
-  }), i.forEach(Ke);
+  }), i.forEach(qe);
 }
 function b(t, e) {
   const r = t.$$;
-  r.fragment !== null && (fn(r.after_update), ke(r.on_destroy), r.fragment && r.fragment.d(e), r.on_destroy = r.fragment = null, r.ctx = []);
+  r.fragment !== null && (mn(r.after_update), ke(r.on_destroy), r.fragment && r.fragment.d(e), r.on_destroy = r.fragment = null, r.ctx = []);
 }
-function mn(t, e) {
-  t.$$.dirty[0] === -1 && (le.push(t), cn(), t.$$.dirty.fill(0)), t.$$.dirty[e / 31 | 0] |= 1 << e % 31;
+function pn(t, e) {
+  t.$$.dirty[0] === -1 && (le.push(t), un(), t.$$.dirty.fill(0)), t.$$.dirty[e / 31 | 0] |= 1 << e % 31;
 }
 function N(t, e, r, n, i, o, s = null, l = [-1]) {
   const c = be;
@@ -380,9 +487,9 @@ function N(t, e, r, n, i, o, s = null, l = [-1]) {
     ctx: [],
     // state
     props: o,
-    update: B,
+    update: y,
     not_equal: i,
-    bound: Xe(),
+    bound: et(),
     // lifecycle
     on_mount: [],
     on_destroy: [],
@@ -391,7 +498,7 @@ function N(t, e, r, n, i, o, s = null, l = [-1]) {
     after_update: [],
     context: new Map(e.context || (c ? c.$$.context : [])),
     // everything else
-    callbacks: Xe(),
+    callbacks: et(),
     dirty: l,
     skip_bound: !1,
     root: e.target || c.$$.root
@@ -400,10 +507,10 @@ function N(t, e, r, n, i, o, s = null, l = [-1]) {
   let f = !1;
   if (a.ctx = r ? r(t, e.props || {}, (d, E, ...v) => {
     const A = v.length ? v[0] : E;
-    return a.ctx && i(a.ctx[d], a.ctx[d] = A) && (!a.skip_bound && a.bound[d] && a.bound[d](A), f && mn(t, d)), E;
+    return a.ctx && i(a.ctx[d], a.ctx[d] = A) && (!a.skip_bound && a.bound[d] && a.bound[d](A), f && pn(t, d)), E;
   }) : [], a.update(), f = !0, ke(a.before_update), a.fragment = n ? n(a.ctx) : !1, e.target) {
     if (e.hydrate) {
-      const d = tn(e.target);
+      const d = rn(e.target);
       a.fragment && a.fragment.l(d), d.forEach(g);
     } else
       a.fragment && a.fragment.c();
@@ -432,7 +539,7 @@ class U {
   }
   /** @returns {void} */
   $destroy() {
-    b(this, 1), this.$destroy = B;
+    b(this, 1), this.$destroy = y;
   }
   /**
    * @template {Extract<keyof Events, string>} K
@@ -442,7 +549,7 @@ class U {
    */
   $on(e, r) {
     if (!ae(r))
-      return B;
+      return y;
     const n = this.$$.callbacks[e] || (this.$$.callbacks[e] = []);
     return n.push(r), () => {
       const i = n.indexOf(r);
@@ -454,12 +561,12 @@ class U {
    * @returns {void}
    */
   $set(e) {
-    this.$$set && !jt(e) && (this.$$.skip_bound = !0, this.$$set(e), this.$$.skip_bound = !1);
+    this.$$set && !Vt(e) && (this.$$.skip_bound = !0, this.$$set(e), this.$$.skip_bound = !1);
   }
 }
-const gn = "4";
-typeof window < "u" && (window.__svelte || (window.__svelte = { v: /* @__PURE__ */ new Set() })).v.add(gn);
-function pn(t) {
+const _n = "4";
+typeof window < "u" && (window.__svelte || (window.__svelte = { v: /* @__PURE__ */ new Set() })).v.add(_n);
+function An(t) {
   O(t, "svelte-1bzqb13", ".rcb-modal-section.svelte-1bzqb13{padding:8px 0px;display:flex}section.rcb-modal-section.svelte-1bzqb13{flex-grow:1}.rcb-modal-section.svelte-1bzqb13:last-of-type{padding:0}");
 }
 function Fe(t) {
@@ -479,7 +586,7 @@ function Fe(t) {
       e = k(
         /*as*/
         t[0]
-      ), i && i.c(), en(
+      ), i && i.c(), nn(
         /*as*/
         t[0]
       )(e, {
@@ -521,7 +628,7 @@ function Fe(t) {
     }
   };
 }
-function _n(t) {
+function hn(t) {
   let e = (
     /*as*/
     t[0]
@@ -558,7 +665,7 @@ function _n(t) {
     }
   };
 }
-function An(t, e, r) {
+function En(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { as: o = "section" } = e;
   return t.$$set = (s) => {
     "as" in s && r(0, o = s.as), "$$scope" in s && r(1, i = s.$$scope);
@@ -566,137 +673,34 @@ function An(t, e, r) {
 }
 class ue extends U {
   constructor(e) {
-    super(), N(this, e, An, _n, P, { as: 0 }, pn);
-  }
-}
-var j = /* @__PURE__ */ ((t) => (t[t.Silent = 0] = "Silent", t[t.Error = 1] = "Error", t[t.Warn = 2] = "Warn", t[t.Info = 3] = "Info", t[t.Debug = 4] = "Debug", t[t.Verbose = 5] = "Verbose", t))(j || {});
-class V {
-  static setLogLevel(e) {
-    this.logLevel = e;
-  }
-  static log(e, r = this.logLevel) {
-    const n = `[Purchases] ${e}`;
-    if (!(this.logLevel < r || r === j.Silent))
-      switch (r) {
-        case j.Error:
-          console.error(n);
-          break;
-        case j.Warn:
-          console.warn(n);
-          break;
-        case j.Info:
-          console.info(n);
-          break;
-        case j.Debug:
-          console.debug(n);
-          break;
-        case j.Verbose:
-          console.debug(n);
-          break;
-      }
-  }
-  static errorLog(e) {
-    this.log(e, j.Error);
-  }
-  static warnLog(e) {
-    this.log(e, j.Warn);
-  }
-  static infoLog(e) {
-    this.log(e, j.Info);
-  }
-  static debugLog(e) {
-    this.log(e, j.Debug);
-  }
-  static verboseLog(e) {
-    this.log(e, j.Verbose);
-  }
-}
-Q(V, "logLevel", j.Silent);
-var pe = /* @__PURE__ */ ((t) => (t.Year = "year", t.Month = "month", t.Week = "week", t.Day = "day", t))(pe || {});
-function hn(t) {
-  const e = t.match(/^PT?([0-9]+)([MDYW])$/);
-  if (!e || e.length < 3)
-    return V.errorLog(`Invalid ISO 8601 duration format: ${t}`), null;
-  const r = parseInt(e[1]);
-  switch (e[2]) {
-    case "Y":
-      return {
-        number: r,
-        unit: "year"
-        /* Year */
-      };
-    case "M":
-      return {
-        number: r,
-        unit: "month"
-        /* Month */
-      };
-    case "W":
-      return {
-        number: r,
-        unit: "week"
-        /* Week */
-      };
-    case "D":
-      return {
-        number: r,
-        unit: "day"
-        /* Day */
-      };
-    default:
-      return V.errorLog(`Invalid ISO 8601 unit duration format: ${t}`), null;
+    super(), N(this, e, En, hn, P, { as: 0 }, An);
   }
 }
-const tt = (t, e) => {
-  const r = t / 100;
-  return new Intl.NumberFormat("en-US", {
-    style: "currency",
-    currency: e
-  }).format(r);
-}, nt = (t) => {
-  const e = hn(t);
-  if (!e)
-    return "unknown";
-  const r = e.number;
-  if (r === 1)
-    switch (e.unit) {
-      case pe.Year:
-        return "yearly";
-      case pe.Month:
-        return "monthly";
-      case pe.Week:
-        return "weekly";
-      case pe.Day:
-        return "daily";
-    }
-  else
-    return `every ${r} ${e.unit}s`;
-};
-function En(t) {
+function In(t) {
   O(t, "svelte-i5dq8q", ".rcb-pricing-info.svelte-i5dq8q{display:flex;flex-direction:column;margin-top:102px;font-weight:500}.rcb-product-price.svelte-i5dq8q{font-size:24px;margin:12px 0px}.rcb-product-details.svelte-i5dq8q{opacity:0.6;list-style-type:disc;list-style-position:inside;margin:0px;padding:0px}@media screen and (max-width: 960px){.rcb-pricing-info.svelte-i5dq8q{margin-top:48px}}");
 }
-function In(t) {
+function bn(t) {
   let e, r, n = (
     /*productDetails*/
     t[0].displayName + ""
   ), i, o, s, l = (
     /*productDetails*/
     t[0].currentPrice.currency + ""
-  ), c, a = " ", f, d = tt(
+  ), c, a = " ", f, d = Ye(
     /*productDetails*/
     t[0].currentPrice.amount,
     /*productDetails*/
     t[0].currentPrice.currency
-  ) + "", E, v, A, M, h, y = nt(
+  ) + "", E, v, A, M, h, B = Xe(
     /*productDetails*/
     t[0].normalPeriodDuration
-  ) + "", F, $, de, Be, ie;
+  ) + "", F, $, de, ye, ie;
   return {
     c() {
-      e = k("div"), r = k("span"), i = R(n), o = T(), s = k("span"), c = R(l), f = R(a), E = R(d), v = T(), A = k("ul"), M = k("li"), h = R("Billed "), F = R(y), $ = T(), de = k("li"), de.textContent = "Continues until canceled", Be = T(), ie = k("li"), ie.textContent = "Cancel anytime", _(s, "class", "rcb-product-price svelte-i5dq8q"), _(A, "class", "rcb-product-details svelte-i5dq8q"), _(e, "class", "rcb-pricing-info svelte-i5dq8q");
+      e = k("div"), r = k("span"), i = R(n), o = T(), s = k("span"), c = R(l), f = R(a), E = R(d), v = T(), A = k("ul"), M = k("li"), h = R("Billed "), F = R(B), $ = T(), de = k("li"), de.textContent = "Continues until canceled", ye = T(), ie = k("li"), ie.textContent = "Cancel anytime", _(s, "class", "rcb-product-price svelte-i5dq8q"), _(A, "class", "rcb-product-details svelte-i5dq8q"), _(e, "class", "rcb-pricing-info svelte-i5dq8q");
     },
     m(z, W) {
-      p(z, e, W), D(e, r), D(r, i), D(e, o), D(e, s), D(s, c), D(s, f), D(s, E), D(e, v), D(e, A), D(A, M), D(M, h), D(M, F), D(A, $), D(A, de), D(A, Be), D(A, ie);
+      p(z, e, W), D(e, r), D(r, i), D(e, o), D(e, s), D(s, c), D(s, f), D(s, E), D(e, v), D(e, A), D(A, M), D(M, h), D(M, F), D(A, $), D(A, de), D(A, ye), D(A, ie);
     },
     p(z, W) {
       W & /*productDetails*/
@@ -704,27 +708,27 @@ function In(t) {
       z[0].displayName + "") && ne(i, n), W & /*productDetails*/
       1 && l !== (l = /*productDetails*/
       z[0].currentPrice.currency + "") && ne(c, l), W & /*productDetails*/
-      1 && d !== (d = tt(
+      1 && d !== (d = Ye(
         /*productDetails*/
         z[0].currentPrice.amount,
         /*productDetails*/
         z[0].currentPrice.currency
       ) + "") && ne(E, d), W & /*productDetails*/
-      1 && y !== (y = nt(
+      1 && B !== (B = Xe(
         /*productDetails*/
         z[0].normalPeriodDuration
-      ) + "") && ne(F, y);
+      ) + "") && ne(F, B);
     },
     d(z) {
       z && g(e);
     }
   };
 }
-function bn(t) {
+function wn(t) {
   let e, r;
   return e = new ue({
     props: {
-      $$slots: { default: [In] },
+      $$slots: { default: [bn] },
       $$scope: { ctx: t }
     }
   }), {
@@ -750,53 +754,53 @@ function bn(t) {
     }
   };
 }
-function wn(t, e, r) {
+function kn(t, e, r) {
   let { productDetails: n } = e;
   return t.$$set = (i) => {
     "productDetails" in i && r(0, n = i.productDetails);
   }, [n];
 }
-class Bt extends U {
+class yt extends U {
   constructor(e) {
-    super(), N(this, e, wn, bn, P, { productDetails: 0 }, En);
+    super(), N(this, e, kn, wn, P, { productDetails: 0 }, In);
   }
 }
-const kn = "data:image/gif;base64,R0lGODlhMgAyAPcBAAAAAAD/AAMDAwcHBxERERUVFSoqKi0tLTAwMDg4OD09PURERElJSUtLS1BQUFJSUlVVVVdXV1paWl9fX2NjY2ZmZmlpaWxsbG1tbXNzc3t7e39/f4GBgYKCgoSEhIaGhoeHh4iIiIuLi5KSkpSUlJaWlp2dnaGhoaOjo6SkpKWlpaenp6ioqKqqqqurq6ysrLCwsLGxsbS0tLa2tri4uLm5ub29vb6+vsDAwMHBwcLCwsXFxcjIyMnJyc3Nzc7OztPT09TU1NXV1dfX19nZ2dra2tvb29zc3N7e3uDg4OHh4eLi4uPj4+fn5+np6ezs7O7u7vDw8PHx8fLy8vPz8/X19fb29vj4+Pn5+fz8/P39/f7+/v///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////yH/C05FVFNDQVBFMi4wAwEAAAAh+QQFBAABACwAAAAAMgAyAIcAAAAA/wADAwMHBwcREREVFRUqKiotLS0wMDA4ODg9PT1ERERJSUlLS0tQUFBSUlJVVVVXV1daWlpfX19jY2NmZmZpaWlsbGxtbW1zc3N7e3t/f3+BgYGCgoKEhISGhoaHh4eIiIiLi4uSkpKUlJSWlpadnZ2hoaGjo6OkpKSlpaWnp6eoqKiqqqqrq6usrKywsLCxsbG0tLS2tra4uLi5ubm9vb2+vr7AwMDBwcHCwsLFxcXIyMjJycnNzc3Ozs7T09PU1NTV1dXX19fZ2dna2trb29vc3Nze3t7g4ODh4eHi4uLj4+Pn5+fp6ens7Ozu7u7w8PDx8fHy8vLz8/P19fX29vb4+Pj5+fn8/Pz9/f3+/v7///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////8I/wCzcBFIcKDBgggPKkzIcCEXLlq4bIEokeLEiBcrYrTIcaNHjRobinQ4sqRCkBlTdtR44MBKlR9TmjQJQMBMkgZfdpwSMSYAACgpRtHpcSYSFUIa1mz448UQnAWDfmzSooUVmD9XVnnBwglMlDdvvMjhcOlCHit23CSqcUrVJiizpnTC4sXQmB1vZvmxwgYWhWYLznjRA+rJryqvxGhxxGNLjkVcwMCCN6ZeLkNevDCcRYYKJJfZptyCQwdiijl0CDxdlLPryw2lymY9WzTs17ijVq69mzbM28Bd8x7u23bu46F7i16uXEvw5ziJM5duGbl1k9OLN5cKvfvh7OC3b0jxTv6h+PDUy3unzl67RPXXc56fnz4+/PbofcOHnr9/5f3x4UeffvYVqJuACP5m4IIJ+gfWgusN6KCCAN7WoITVVXjchBxqERAAIfkEBQQAAQAsDQADACAAEAAACKcAAwgcSDDAAwcFEypcSNDAAYYQA2DZstCAAYZOKCqM8uNJxYcKa3DYsVBKECBYFFpU+MTDhiIMkQxBohJkwRYaUkDEEiQIlYQrCyLZ0MFJRCdAkgC1OZBEBxgRJRIBAqXgwYI8NoCwEjWAkyFDoorQ4KOrQCRLoqbQuZCKR7NdqzD5MaQKXIhZmAwBIqTJ3YVYogQZ8oMJ178Kk/A1YhfxQiRHjBYMCAAh+QQFBQABACwNAAMAIAAQAAAInQADCBxIMECGDAUTKlxI8EEEhhADcGEI4QFDJQy5ZJmo0OFCFBFkLNzCRQvHghEgKHQi4cEPhhuzdHyYUMQDDxC5kNSSsGLCIA4x5oxZ0GNBDBFKRAxgkmTBgwVpRJhAZWkAohErPKhhVaLJpR8+YFnohEjXrlB2qHgB5SxELD5etHgBxC1DJC9eqOAxxe5CHSxc0HDilyEOGWYLBgQAIfkEBQQAAQAsGAADABcAFwAACJYAS5AIQLCgwYMINXBAyLDhhg0NtxRpWFBDh4YiDpygGOAhwyUIDOTgqJAhBgMVOHaEeLCHgQMTSV40uKXBAZYcBR5UYSBBFJUNFRhoAbShhZQNi/DYUvRgkxQKmzQlaCVGhw0eakwN4MNDBw0tnmxN8ZAEkq0ET4jYgbat27dw474lMuTHECB1hxBpigRIECBC/AJBEhAAIfkEBQQAAQAsGAADABcAFwAACJIAa9AIQLCgwYMIVbxAyLBhCxYNAwCJSHDFQoYaBIyg6KIFQyQDAMigqJAhBAAMKAZ4iPAGAAETKVpEaECABZUBBB4kAYAAFJwMCwAoAZQhg5QNf4wsajCJhwcRkjANQMVEBAgSVDC9UkNChAcimkz9ADVDkKkEPVRYirat27dw47ad8UKhRYUzitZo8bDjwxoBAQAh+QQFBAABACwYAAMAFwAiAAAIvwCRGAlAsKDBgwh/DEHIsGEQIA0DFIlIEMhChiIOnKAoBCLCJQgM5KCokCEGAxUoBniIsIeBAxMpWkTY4MAGlQEEHlRhIEEUnAwVGGgBlKGFlA1zbCxqkEiFl0SYBojS4YABBCO2MG2RwCqGJFKfGnDQQyrBCgpQaDXLtq3bt3DZkuiggYMGuhxIFC2xoa/fDSXiCh5MuDDBJUSgZGl7ZAiQJFLYbnlCBEiQJFjYXnFiEciTtliSPMzcNspPggEBACH5BAUEAAEALBgAAwAXACIAAAi6ALlsCUCwoMGDCLNwQciwIRctDpU0LKiwIYoIMiYGEMjQiYQHPzRWRCjigQeNGyEeDPIggkSRCw1ywRChBMqNAw3SiDCByk2GFR7U+Mnww4eJMkYQPQiEAQABQJYGgGJBAIABGqSWIGAVghGpTgEcuCGVIIMCSsuqXcu2rdu1NFvKjYCBaAYIEFrifZDhrd+/gAMT1AHjCNsbL1bYYLKWSIwWLXRYUVvlB4sXLISsnYKjBYspbJkgKRgQACH5BAUEAAEALB8ABQAQACgAAAjDAAMIDOBkoMGDAmtw2IEQ4RMPG4o0PNhCQ4qJBpFs6FAQo0ASHWB4FMhjAwgrIwOI0OAjZYAUKbJMzHEiJZEKBg4QwRilwwEDCEZgbJHgJ4YkGHEacNBjZAUFKFxKnUq1qlWBDX5qzdmg4QMDYMMaeHC1rNmzA1WIaJryBAcNJSR61MIjxIYNKqKMnDJj4wYcKZ2cuNuRyRGMQ3xgEUgkyBOXUYAUuZIyCxIgTVxKGQJEZsokQpBWBjJEb2Agj116xhgQACH5BAUFAAEALB8ABQAQACgAAAjFAAMIDBCFy8CDCAP8eDEkYcIqL1g4cYiQx4odFA86YfEiSsaBM170+CiwiAsYWEgGkKECicoAOXRk/CFDZRIPDyIkyUjFRAQIElQYdFhDQoQHIppk/JAzQxCSHirIGPqyqtWrWLEaEACAq1cDDg8AGEsWwIGsaNOqdRiCQo2XHY5m+EEyy4wJECCEmPgxygkIESK0UMmEA4QHTATuuJGxx1uBMFoQeYlkhYwqL2u0oEs4ImaVOlzgeHmFY2KVQFgYqfo5Y0AAIfkEBQQAAQAsGAAFABcAKgAACOUAAwgcSDDAlYIIEw5kMsSJwocCrwgBQgXiQyZAmFhUWAXIkIMbERIZojFkwSdChmQxWfDIjygsCyZJ8rAIj5gDm6TQwKFJTCsxOmzwUIMlFh8eOmho8SRmig0bSCDBGeCEiB1Us2rdyrWryQYHDIQd28DkAwNo0xp44LWt27dtLShYgSUrhbAPsFJVkQDthZIxn3wQe4BEXZxHKKA98pDFiYc2VEAUseHmRiI0CfrQIGLKxokIS2yQsfHHEIRFOGxoCjEIkIQqNjyG6DGhlA0cTj8EndDGhh4QTT98clih662YtwYEACH5BAUEAAEALBgABQAXACoAAAjfAAMIHEgwwJaCCBMOzMIli8KHArdw0cIF4sOGFS0mnMjloEaEDB1+LEhR4siCGE8WlKhFoRMiGVVC2aHiBRSVWHy8aPECiEokL16o4DFFpQ4WLmg4USkQhwwiTKNKnUq16lQMER5k3YphZAYIELSCfZDBqtmzaNMKbFCgxNQFAgAgqCF1BAEAABwkieoEAwABAjZIFbIAr5CHIjp4RBiDBEQKEGZ8nGGjYI0HFKJodNEC4VcTGmsi/BEBAhOLLVgkDBGBg8UVLxI+iRChB0TOClc8oAFRtMLTEFNTpUw1IAAh+QQFBAABACwNAA0AIgAiAAAI5QADCBxIsKDBgwGoPEHIsOHAKkx+DKnisCLBLEyGABHSxKLHKEGG/GBixaPFJBuNUDRpEckRJyxjypxJs6bNmzhvkuiggYMGnhxI5CyxoajRDSVyKl3KtKlTphYUrHhK4YCBBzucqkhgwMAFJk2ffDBw4IDQpkcodD1SEMsSJBUvUGBoQ4VBKECKVFRgwK7HLSFhEiSRlGALAwoWWmQixMiWgkXbPjDgwWIVIj+uGOxpcIdVuA6VAFlyMLLBCwbmNqwiseTmDgeblLXR8EmQjqU3IBxhIIXDlQc5H8QCmqZpp4RrBgQAIfkEBQQAAQAsDQANACIAIgAACOAAAwgcSLCgwYMBuGxByLDhwCxcIGZxSJEgFy0KL1asKDFixI0VL2YEuVEiyZMoU6pcybKly5YzXqh4sULmixkva7RowcLFThY1XgodSrSoUaIhKNSYWLRDhAcZfhidMQEChBBOikY5ASFChBZMhzLhAOEBE4M7cFB0sIBhj6AFjbCIQbEAgBEgs7x4QaQghgwFSwAokLWiDxc0DEaAYPAAgAsVoch8YvBBBIM1BAAYQlFHix0Hyx50AKBtQyczpxy0fFCJAAF0GRJpAQThYoQaAJBwCIUha4ScV4o++ndlQAAh+QQFBAABACwFABgAKgAXAAAI5gADCBxIsKDBgwWJDPkxBMjCIUQQSpxoEAmQIECEXASChKLHjyBDihxJsqTJkyhHbnlSJAlKFSJ6eLyi8McSlCc4aChRBOGVJRmHQMmCUguPEBs2qIhSkElDIky2pBw4ZcaGDhtwDLyCUcmVqQadnEjqZKCTKhJVnPB4gYLEIT5A9tggwqMCAypSXvHQYUfBBg8KtjCg4AnKGBtIaClowIDBBwY8nGziQYNLxgcM7jhgoGPJsSwONj54wYBbkkc0fDBs0EBmg00OHLBBkseGGghHHxxhIEXJJhJdS/QMdqDu4h4BnwwIACH5BAUFAAEALAUAGAAqABcAAAjlAAMIHEiwoMGDBbNwUchwIcKHEA1y2cJFy8SKXCJq3Mixo8ePIEOKHEkSZJEYOUjqgHFE45MZL1TsIHnjxQobTBBW2cHCBQwjJbcQidGihQ4rBX/YfNEjS8mBVX6weMFCyMAoLVjoiPLU4BQcWacMHOIE4ZUQHjSK6PCQCRKnGmk8oKCRAoQZJatIiCCjoAEEBWvM5TrSRIQMBgEASJgBgomRSSQ8GJJYgMEfESDkDOkBgoiDig+GiMAh5I8HEpqAtmzwSYQIPUDKgKACYeiDKx7QCJnkIQDWBrNs7jrwNnGNf0cGBAAh+QQFBAABACwDABgAKgAXAAAI5gCT/BgCZMhAIEkCKFzIsKHDhw2NBAEiBMhEIUYgatzIsaPHjyBDihxJsqTJkygVauEhIsXJJUSgdExCooMGFSePEEwiBeITFhs2gOiR8gkRi0mwNKzxQYMHGFdSKrzipCCQJwudBD3hRGpDLEkmKlW444hGCxU6sjjBBWKUKB9XGFDQUcQGHiinJDiAomGDBw19aBAx5WQHAw6yNDRgwGGJDTJMEkFgwIdDAwccFuGwAStJCgYwPGT8UMWGEyR1GECQ8HJmh1I2cBgy8oSBERBJP7SxgehIIhoxa/TsVaHu4hz/kgwIACH5BAUEAAEALAMAGAAqABcAAAjfAG2oeLHixcAVNgIoXMiwocOHDWm0YOGixUQXNCBq3Mixo8ePIEOKHEmypMmTKBfSoPDhJJctXLRwHIIhwoMQJ7Nw0ZkFohMRDyJMoIHFpZaXMbk0RCHhgYQSVVIq5LlTqUIlEB54UCK1IdKjC2X80NiAQccdNzTq/EgCQIGOMFoQQRmFgIARDTFkaIhkhYyoJi0AOOAwAgSHNVqMLQlkAAAcDoM6ZPKCBeCRCwA8eJj1oQ4XkEfSADDAyEPJDq+weMFk5AgAGiAahgiEhemRQDSiflilZ1eFnX931EsyIAAh+QQFBAABACwDAA0AIgAiAAAI4wADCHwiRaDBgwgTKjyY5ccQJFkWSpxo0AkQIUGaYKHIMWEWJEOAFHHSsaRBKkiABEFi0iSWKEOYtJxJs6bNmzhz6uxYQgMHDR18aiixk8SGo0g3kNjJtKnTp1CjelShwMJTHw0OGLDKdAkGAwYSrGgqAoEBBBumNC0ClkIRqCd0SLRQgSOTIzNXGFDAkUiQJyanJDiAAiEJogejiLxSsoMBBwmPJkzZpCMRsz4S+kwoJWREihQMYFAoOWESIUko6jibWnMHhVmADIky8YSBEQtLJ7QIeCIRiZsXfrap++lhigEBACH5BAUEAAEALAMADQAiACIAAAjgAAMINNJEoMGDCBMqPFhFxYsbVRZKnChQC5AWLlr8uEKxY8IrOV6skDHEo0mDTWq0aIHjpEskL3a4nEmzps2bOHPq9JjhQQSfQDPszADBJ4SiEYTuXMq0qdOnUBOSKMDAKQ4DAgA0YIrkAQAABEgw1TAAwAALUZgC+boAyNMRNCSG8NCRS5aZNB5Q6LiFi5aTVSREkIFwhg2Edu2aNJH078GMCLVw6esxiYQHJRE6TJglcUcPEEQobMFCoeQtFH88kFAw4YoXChPflSgDgoqFkGNLpphE4uaFXHCSjmqYYkAAIfkEBQQAAQAsAwAFABcAKgAACOUAAwgcSDAAloIIEw6M8uOJwocDpQQBchDiQyRDkFh8iCVIECobFToBkqRiSIJYiACBchKhkyFDHmbpQUThFiRLHj7RwMGEw5YDbXTYsEFGFaACpaTgoEHEDqQCj5QgegKqQB8hWFjdyrWr164PDBwQS/bBSQcG0qo14OCr27dw4yZUocACVB8NxtptuQRD2gQrgIpAYADBhilAi6SlUMTqCR0KsaioarXHBhFWr3jo8JQgkSQbY2wggVAIEItNPGgAXfBHTIgnNmhFOBHiEQ0ffhYE8lohjw01FJpG/dA119pbPwcEACH5BAUFAAEALAMABQAXACoAAAjkAAMIHEgwwBQtBRMqFIhEhZCFEAc2adHCSsSIN17kuAhxCsUmHBf+WGEjpMIrMVocMZlwyIsXEWn4gIhDB0QmDyJsYMKS4IoIQE1I6SnwCYgIDyjI2EI0AJAMECB4aCqwxgQRVLNq3cp1KwIAAsCKRWDyAICzaAEc6Mq2rdu3CbXQoPCh6RAMSEP0dCIi5wQaPVFIeCChRJWeSiA88KCEqowfEHfgyGqERQyqWV4SKZiFC0cfLmgwJchlNEQoL1Q8Sdj5oo4WOxRyQQjRiYoXUxS2hkikBZCFpS9Cgbib6mytnQMCACH5BAUEAAEALAMABQAQACgAAAjDAAMIHEgwixOCCBH60IAjoUMiGzpEcZjQRIcUFBE62bDhSEaCMzSU+DiwSogNPUgK3MEhxMAUDR1qOaFCIBIDByYgIZllxAGcHqCQbGLhpwIUKnk8MGCAgsorLRJcUEm1qtWrVpf+3GrggUMHTMMydYC1rNmzaHmIwPgxCYkOGmpSfMKCI4geWSjW+KDBA4wrGTduOHGQ5A6PFJfsVAkFSBGVW4IMKfyRiRAjKqsQ+QGYpBIgSzL/GGJF5ZMgTapWIRgQACH5BAUEAAEALAMABQAQACgAAAjAAAMIHEgwAJOCCAfWeNAiIUIfECI4cVhwQwQQFAkyiQABSMaBJx5k+ChQygQINUgGkBFhwkASMhxm8RBC4BAAAhYMIalhAM4LTz4qcSAAQIERJG0cAACAgcoSBByonEq1qtWMGR5E0Mp1JMIMELRCCBvB69WzaNNO3VIkRo6PT2a8ULGDYpUdLFzAMELxx4sVL3pkoRilBQsdUUgOmZgwC5fBJLlo4RLZMeSMk7dQzmh5c0Yumis/JqlZy9TLAQICACH5BAUEAAEALAMAAwAXACIAAAi+AAMIHEiwoEEkRgwqXPhjyMKBR7IsDALkYQAVBkgsBOLwIQ4DB5goFFLR4oQDFhQ2tBjgyAEDPAxSZBngg4EHVwpypAklgYEVBRHSDIDiQAKLKXA8pJByIRKQE5AMNTji5QEPUKYSbGLhpQIUWgnyeGDAAIWwBFskuIC2rdu3cONaLKGBg4YOdTWUmEpig9+/GzTKHUy4sGGWT4okaXuFyJAfS8JeWQJEyJCsWpkMAUKEyRbJFJXkbOukStuAAAAh+QQFBAABACwDAAMAFwAiAAAItQADCBxIsKDBGjQMKlyo4sXCgUIetmDxMAAJABsWrnD4UAaAAUkUumhRMcACAQ4UNiwpRAAAGwYnlgyAAQACgxtnPiEAoERBhDMDjBBAoCINHw8ZNHjI5EGEDUyCFtSyIoJVE1KkEnwCIsIDCjK0EgSSAQIED2IHYqkxQUTat3Djyp1b0UbDjXdhBqUxcWTfhHQDCx5MuCIXLVy2vOWShTEXsVsOJz6stbHlx1ojI1b8tvHbgAAAIfkEBQQAAQAsAwADABcAFwAACJQAAwgcSLCgwRIkDCpcqIHDwoFHHm7Y8DCACgMJFWroUBGHgQNMFE6sGGDCAQsaHVY8csAAD4MjSX4w8MDgRpIBoCQwsKIgQpwBUBxIULEHkYcUUC580tDEE6AGbXSYKKMKVIJSUnDQIGIHl6sQS0w8AZagjxAsyqpdy7at24pJfgwBMkQukCRQjQQBIgTIXiFGoAYEACH5BAUFAAEALAMAAwAXABcAAAiVAAMIHEiwoMEMGQwqXPggwsKBTLQshPDgYYAaD1owdPjQB4QIThRGgGAxwIYIIBQ2LMlkJBCDFEsGOPEgA5aCK0tKmQChRkGEMgPIiDDhoRYjTR56CPGwiooXN6oENQikhYsWP65MJXglx4sVMoZsJdikRosWOMYSRPJih9q3cOPKnWuRSxa7eO9O3cJFCxe+frdMDQgAIfkEBQUAAQAsBQADACAAEAAACKYAAwgcSLAgwQcODCpcyNDAAYYQAzhpaIDhFYY+NOBY6HAhkyETFRLZ0CGKQgMVDV4RAoQKQxMdUpx8aJAJECYQnWzYcMQgSoNVgAy5CHGGhhI+aRIkMgRnxCohNvQoiLDgEyFDskQUuINDiK1Hfpgc+ETKQi0nVGxNkkSrwCw/hiBxu7XuFidAhARpgqWu3yxIhgApEtLvVipIgARBYthvlKaNFQYEADs=";
-function $n(t) {
+const $n = "data:image/gif;base64,R0lGODlhMgAyAPcBAAAAAAD/AAMDAwcHBxERERUVFSoqKi0tLTAwMDg4OD09PURERElJSUtLS1BQUFJSUlVVVVdXV1paWl9fX2NjY2ZmZmlpaWxsbG1tbXNzc3t7e39/f4GBgYKCgoSEhIaGhoeHh4iIiIuLi5KSkpSUlJaWlp2dnaGhoaOjo6SkpKWlpaenp6ioqKqqqqurq6ysrLCwsLGxsbS0tLa2tri4uLm5ub29vb6+vsDAwMHBwcLCwsXFxcjIyMnJyc3Nzc7OztPT09TU1NXV1dfX19nZ2dra2tvb29zc3N7e3uDg4OHh4eLi4uPj4+fn5+np6ezs7O7u7vDw8PHx8fLy8vPz8/X19fb29vj4+Pn5+fz8/P39/f7+/v///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////yH/C05FVFNDQVBFMi4wAwEAAAAh+QQFBAABACwAAAAAMgAyAIcAAAAA/wADAwMHBwcREREVFRUqKiotLS0wMDA4ODg9PT1ERERJSUlLS0tQUFBSUlJVVVVXV1daWlpfX19jY2NmZmZpaWlsbGxtbW1zc3N7e3t/f3+BgYGCgoKEhISGhoaHh4eIiIiLi4uSkpKUlJSWlpadnZ2hoaGjo6OkpKSlpaWnp6eoqKiqqqqrq6usrKywsLCxsbG0tLS2tra4uLi5ubm9vb2+vr7AwMDBwcHCwsLFxcXIyMjJycnNzc3Ozs7T09PU1NTV1dXX19fZ2dna2trb29vc3Nze3t7g4ODh4eHi4uLj4+Pn5+fp6ens7Ozu7u7w8PDx8fHy8vLz8/P19fX29vb4+Pj5+fn8/Pz9/f3+/v7///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////8I/wCzcBFIcKDBgggPKkzIcCEXLlq4bIEokeLEiBcrYrTIcaNHjRobinQ4sqRCkBlTdtR44MBKlR9TmjQJQMBMkgZfdpwSMSYAACgpRtHpcSYSFUIa1mz448UQnAWDfmzSooUVmD9XVnnBwglMlDdvvMjhcOlCHit23CSqcUrVJiizpnTC4sXQmB1vZvmxwgYWhWYLznjRA+rJryqvxGhxxGNLjkVcwMCCN6ZeLkNevDCcRYYKJJfZptyCQwdiijl0CDxdlLPryw2lymY9WzTs17ijVq69mzbM28Bd8x7u23bu46F7i16uXEvw5ziJM5duGbl1k9OLN5cKvfvh7OC3b0jxTv6h+PDUy3unzl67RPXXc56fnz4+/PbofcOHnr9/5f3x4UeffvYVqJuACP5m4IIJ+gfWgusN6KCCAN7WoITVVXjchBxqERAAIfkEBQQAAQAsDQADACAAEAAACKcAAwgcSDDAAwcFEypcSNDAAYYQA2DZstCAAYZOKCqM8uNJxYcKa3DYsVBKECBYFFpU+MTDhiIMkQxBohJkwRYaUkDEEiQIlYQrCyLZ0MFJRCdAkgC1OZBEBxgRJRIBAqXgwYI8NoCwEjWAkyFDoorQ4KOrQCRLoqbQuZCKR7NdqzD5MaQKXIhZmAwBIqTJ3YVYogQZ8oMJ178Kk/A1YhfxQiRHjBYMCAAh+QQFBQABACwNAAMAIAAQAAAInQADCBxIMECGDAUTKlxI8EEEhhADcGEI4QFDJQy5ZJmo0OFCFBFkLNzCRQvHghEgKHQi4cEPhhuzdHyYUMQDDxC5kNSSsGLCIA4x5oxZ0GNBDBFKRAxgkmTBgwVpRJhAZWkAohErPKhhVaLJpR8+YFnohEjXrlB2qHgB5SxELD5etHgBxC1DJC9eqOAxxe5CHSxc0HDilyEOGWYLBgQAIfkEBQQAAQAsGAADABcAFwAACJYAS5AIQLCgwYMINXBAyLDhhg0NtxRpWFBDh4YiDpygGOAhwyUIDOTgqJAhBgMVOHaEeLCHgQMTSV40uKXBAZYcBR5UYSBBFJUNFRhoAbShhZQNi/DYUvRgkxQKmzQlaCVGhw0eakwN4MNDBw0tnmxN8ZAEkq0ET4jYgbat27dw474lMuTHECB1hxBpigRIECBC/AJBEhAAIfkEBQQAAQAsGAADABcAFwAACJIAa9AIQLCgwYMIVbxAyLBhCxYNAwCJSHDFQoYaBIyg6KIFQyQDAMigqJAhBAAMKAZ4iPAGAAETKVpEaECABZUBBB4kAYAAFJwMCwAoAZQhg5QNf4wsajCJhwcRkjANQMVEBAgSVDC9UkNChAcimkz9ADVDkKkEPVRYirat27dw47ad8UKhRYUzitZo8bDjwxoBAQAh+QQFBAABACwYAAMAFwAiAAAIvwCRGAlAsKDBgwh/DEHIsGEQIA0DFIlIEMhChiIOnKAoBCLCJQgM5KCokCEGAxUoBniIsIeBAxMpWkTY4MAGlQEEHlRhIEEUnAwVGGgBlKGFlA1zbCxqkEiFl0SYBojS4YABBCO2MG2RwCqGJFKfGnDQQyrBCgpQaDXLtq3bt3DZkuiggYMGuhxIFC2xoa/fDSXiCh5MuDDBJUSgZGl7ZAiQJFLYbnlCBEiQJFjYXnFiEciTtliSPMzcNspPggEBACH5BAUEAAEALBgAAwAXACIAAAi6ALlsCUCwoMGDCLNwQciwIRctDpU0LKiwIYoIMiYGEMjQiYQHPzRWRCjigQeNGyEeDPIggkSRCw1ywRChBMqNAw3SiDCByk2GFR7U+Mnww4eJMkYQPQiEAQABQJYGgGJBAIABGqSWIGAVghGpTgEcuCGVIIMCSsuqXcu2rdu1NFvKjYCBaAYIEFrifZDhrd+/gAMT1AHjCNsbL1bYYLKWSIwWLXRYUVvlB4sXLISsnYKjBYspbJkgKRgQACH5BAUEAAEALB8ABQAQACgAAAjDAAMIDOBkoMGDAmtw2IEQ4RMPG4o0PNhCQ4qJBpFs6FAQo0ASHWB4FMhjAwgrIwOI0OAjZYAUKbJMzHEiJZEKBg4QwRilwwEDCEZgbJHgJ4YkGHEacNBjZAUFKFxKnUq1qlWBDX5qzdmg4QMDYMMaeHC1rNmzA1WIaJryBAcNJSR61MIjxIYNKqKMnDJj4wYcKZ2cuNuRyRGMQ3xgEUgkyBOXUYAUuZIyCxIgTVxKGQJEZsokQpBWBjJEb2Agj116xhgQACH5BAUFAAEALB8ABQAQACgAAAjFAAMIDBCFy8CDCAP8eDEkYcIqL1g4cYiQx4odFA86YfEiSsaBM170+CiwiAsYWEgGkKECicoAOXRk/CFDZRIPDyIkyUjFRAQIElQYdFhDQoQHIppk/JAzQxCSHirIGPqyqtWrWLEaEACAq1cDDg8AGEsWwIGsaNOqdRiCQo2XHY5m+EEyy4wJECCEmPgxygkIESK0UMmEA4QHTATuuJGxx1uBMFoQeYlkhYwqL2u0oEs4ImaVOlzgeHmFY2KVQFgYqfo5Y0AAIfkEBQQAAQAsGAAFABcAKgAACOUAAwgcSDDAlYIIEw5kMsSJwocCrwgBQgXiQyZAmFhUWAXIkIMbERIZojFkwSdChmQxWfDIjygsCyZJ8rAIj5gDm6TQwKFJTCsxOmzwUIMlFh8eOmho8SRmig0bSCDBGeCEiB1Us2rdyrWryQYHDIQd28DkAwNo0xp44LWt27dtLShYgSUrhbAPsFJVkQDthZIxn3wQe4BEXZxHKKA98pDFiYc2VEAUseHmRiI0CfrQIGLKxokIS2yQsfHHEIRFOGxoCjEIkIQqNjyG6DGhlA0cTj8EndDGhh4QTT98clih662YtwYEACH5BAUEAAEALBgABQAXACoAAAjfAAMIHEgwwJaCCBMOzMIli8KHArdw0cIF4sOGFS0mnMjloEaEDB1+LEhR4siCGE8WlKhFoRMiGVVC2aHiBRSVWHy8aPECiEokL16o4DFFpQ4WLmg4USkQhwwiTKNKnUq16lQMER5k3YphZAYIELSCfZDBqtmzaNMKbFCgxNQFAgAgqCF1BAEAABwkieoEAwABAjZIFbIAr5CHIjp4RBiDBEQKEGZ8nGGjYI0HFKJodNEC4VcTGmsi/BEBAhOLLVgkDBGBg8UVLxI+iRChB0TOClc8oAFRtMLTEFNTpUw1IAAh+QQFBAABACwNAA0AIgAiAAAI5QADCBxIsKDBgwGoPEHIsOHAKkx+DKnisCLBLEyGABHSxKLHKEGG/GBixaPFJBuNUDRpEckRJyxjypxJs6bNmzhvkuiggYMGnhxI5CyxoajRDSVyKl3KtKlTphYUrHhK4YCBBzucqkhgwMAFJk2ffDBw4IDQpkcodD1SEMsSJBUvUGBoQ4VBKECKVFRgwK7HLSFhEiSRlGALAwoWWmQixMiWgkXbPjDgwWIVIj+uGOxpcIdVuA6VAFlyMLLBCwbmNqwiseTmDgeblLXR8EmQjqU3IBxhIIXDlQc5H8QCmqZpp4RrBgQAIfkEBQQAAQAsDQANACIAIgAACOAAAwgcSLCgwYMBuGxByLDhwCxcIGZxSJEgFy0KL1asKDFixI0VL2YEuVEiyZMoU6pcybKly5YzXqh4sULmixkva7RowcLFThY1XgodSrSoUaIhKNSYWLRDhAcZfhidMQEChBBOikY5ASFChBZMhzLhAOEBE4M7cFB0sIBhj6AFjbCIQbEAgBEgs7x4QaQghgwFSwAokLWiDxc0DEaAYPAAgAsVoch8YvBBBIM1BAAYQlFHix0Hyx50AKBtQyczpxy0fFCJAAF0GRJpAQThYoQaAJBwCIUha4ScV4o++ndlQAAh+QQFBAABACwFABgAKgAXAAAI5gADCBxIsKDBgwWJDPkxBMjCIUQQSpxoEAmQIECEXASChKLHjyBDihxJsqTJkyhHbnlSJAlKFSJ6eLyi8McSlCc4aChRBOGVJRmHQMmCUguPEBs2qIhSkElDIky2pBw4ZcaGDhtwDLyCUcmVqQadnEjqZKCTKhJVnPB4gYLEIT5A9tggwqMCAypSXvHQYUfBBg8KtjCg4AnKGBtIaClowIDBBwY8nGziQYNLxgcM7jhgoGPJsSwONj54wYBbkkc0fDBs0EBmg00OHLBBkseGGghHHxxhIEXJJhJdS/QMdqDu4h4BnwwIACH5BAUFAAEALAUAGAAqABcAAAjlAAMIHEiwoMGDBbNwUchwIcKHEA1y2cJFy8SKXCJq3Mixo8ePIEOKHEkSZJEYOUjqgHFE45MZL1TsIHnjxQobTBBW2cHCBQwjJbcQidGihQ4rBX/YfNEjS8mBVX6weMFCyMAoLVjoiPLU4BQcWacMHOIE4ZUQHjSK6PCQCRKnGmk8oKCRAoQZJatIiCCjoAEEBWvM5TrSRIQMBgEASJgBgomRSSQ8GJJYgMEfESDkDOkBgoiDig+GiMAh5I8HEpqAtmzwSYQIPUDKgKACYeiDKx7QCJnkIQDWBrNs7jrwNnGNf0cGBAAh+QQFBAABACwDABgAKgAXAAAI5gCT/BgCZMhAIEkCKFzIsKHDhw2NBAEiBMhEIUYgatzIsaPHjyBDihxJsqTJkygVauEhIsXJJUSgdExCooMGFSePEEwiBeITFhs2gOiR8gkRi0mwNKzxQYMHGFdSKrzipCCQJwudBD3hRGpDLEkmKlW444hGCxU6sjjBBWKUKB9XGFDQUcQGHiinJDiAomGDBw19aBAx5WQHAw6yNDRgwGGJDTJMEkFgwIdDAwccFuGwAStJCgYwPGT8UMWGEyR1GECQ8HJmh1I2cBgy8oSBERBJP7SxgehIIhoxa/TsVaHu4hz/kgwIACH5BAUEAAEALAMAGAAqABcAAAjfAG2oeLHixcAVNgIoXMiwocOHDWm0YOGixUQXNCBq3Mixo8ePIEOKHEmypMmTKBfSoPDhJJctXLRwHIIhwoMQJ7Nw0ZkFohMRDyJMoIHFpZaXMbk0RCHhgYQSVVIq5LlTqUIlEB54UCK1IdKjC2X80NiAQccdNzTq/EgCQIGOMFoQQRmFgIARDTFkaIhkhYyoJi0AOOAwAgSHNVqMLQlkAAAcDoM6ZPKCBeCRCwA8eJj1oQ4XkEfSADDAyEPJDq+weMFk5AgAGiAahgiEhemRQDSiflilZ1eFnX931EsyIAAh+QQFBAABACwDAA0AIgAiAAAI4wADCHwiRaDBgwgTKjyY5ccQJFkWSpxo0AkQIUGaYKHIMWEWJEOAFHHSsaRBKkiABEFi0iSWKEOYtJxJs6bNmzhz6uxYQgMHDR18aiixk8SGo0g3kNjJtKnTp1CjelShwMJTHw0OGLDKdAkGAwYSrGgqAoEBBBumNC0ClkIRqCd0SLRQgSOTIzNXGFDAkUiQJyanJDiAAiEJogejiLxSsoMBBwmPJkzZpCMRsz4S+kwoJWREihQMYFAoOWESIUko6jibWnMHhVmADIky8YSBEQtLJ7QIeCIRiZsXfrap++lhigEBACH5BAUEAAEALAMADQAiACIAAAjgAAMINNJEoMGDCBMqPFhFxYsbVRZKnChQC5AWLlr8uEKxY8IrOV6skDHEo0mDTWq0aIHjpEskL3a4nEmzps2bOHPq9JjhQQSfQDPszADBJ4SiEYTuXMq0qdOnUBOSKMDAKQ4DAgA0YIrkAQAABEgw1TAAwAALUZgC+boAyNMRNCSG8NCRS5aZNB5Q6LiFi5aTVSREkIFwhg2Edu2aNJH078GMCLVw6esxiYQHJRE6TJglcUcPEEQobMFCoeQtFH88kFAw4YoXChPflSgDgoqFkGNLpphE4uaFXHCSjmqYYkAAIfkEBQQAAQAsAwAFABcAKgAACOUAAwgcSDAAloIIEw6M8uOJwocDpQQBchDiQyRDkFh8iCVIECobFToBkqRiSIJYiACBchKhkyFDHmbpQUThFiRLHj7RwMGEw5YDbXTYsEFGFaACpaTgoEHEDqQCj5QgegKqQB8hWFjdyrWr164PDBwQS/bBSQcG0qo14OCr27dw4yZUocACVB8NxtptuQRD2gQrgIpAYADBhilAi6SlUMTqCR0KsaioarXHBhFWr3jo8JQgkSQbY2wggVAIEItNPGgAXfBHTIgnNmhFOBHiEQ0ffhYE8lohjw01FJpG/dA119pbPwcEACH5BAUFAAEALAMABQAXACoAAAjkAAMIHEgwwBQtBRMqFIhEhZCFEAc2adHCSsSIN17kuAhxCsUmHBf+WGEjpMIrMVocMZlwyIsXEWn4gIhDB0QmDyJsYMKS4IoIQE1I6SnwCYgIDyjI2EI0AJAMECB4aCqwxgQRVLNq3cp1KwIAAsCKRWDyAICzaAEc6Mq2rdu3CbXQoPCh6RAMSEP0dCIi5wQaPVFIeCChRJWeSiA88KCEqowfEHfgyGqERQyqWV4SKZiFC0cfLmgwJchlNEQoL1Q8Sdj5oo4WOxRyQQjRiYoXUxS2hkikBZCFpS9Cgbib6mytnQMCACH5BAUEAAEALAMABQAQACgAAAjDAAMIHEgwixOCCBH60IAjoUMiGzpEcZjQRIcUFBE62bDhSEaCMzSU+DiwSogNPUgK3MEhxMAUDR1qOaFCIBIDByYgIZllxAGcHqCQbGLhpwIUKnk8MGCAgsorLRJcUEm1qtWrVpf+3GrggUMHTMMydYC1rNmzaHmIwPgxCYkOGmpSfMKCI4geWSjW+KDBA4wrGTduOHGQ5A6PFJfsVAkFSBGVW4IMKfyRiRAjKqsQ+QGYpBIgSzL/GGJF5ZMgTapWIRgQACH5BAUEAAEALAMABQAQACgAAAjAAAMIHEgwAJOCCAfWeNAiIUIfECI4cVhwQwQQFAkyiQABSMaBJx5k+ChQygQINUgGkBFhwkASMhxm8RBC4BAAAhYMIalhAM4LTz4qcSAAQIERJG0cAACAgcoSBByonEq1qtWMGR5E0Mp1JMIMELRCCBvB69WzaNNO3VIkRo6PT2a8ULGDYpUdLFzAMELxx4sVL3pkoRilBQsdUUgOmZgwC5fBJLlo4RLZMeSMk7dQzmh5c0Yumis/JqlZy9TLAQICACH5BAUEAAEALAMAAwAXACIAAAi+AAMIHEiwoEEkRgwqXPhjyMKBR7IsDALkYQAVBkgsBOLwIQ4DB5goFFLR4oQDFhQ2tBjgyAEDPAxSZBngg4EHVwpypAklgYEVBRHSDIDiQAKLKXA8pJByIRKQE5AMNTji5QEPUKYSbGLhpQIUWgnyeGDAAIWwBFskuIC2rdu3cONaLKGBg4YOdTWUmEpig9+/GzTKHUy4sGGWT4okaXuFyJAfS8JeWQJEyJCsWpkMAUKEyRbJFJXkbOukStuAAAAh+QQFBAABACwDAAMAFwAiAAAItQADCBxIsKDBGjQMKlyo4sXCgUIetmDxMAAJABsWrnD4UAaAAUkUumhRMcACAQ4UNiwpRAAAGwYnlgyAAQACgxtnPiEAoERBhDMDjBBAoCINHw8ZNHjI5EGEDUyCFtSyIoJVE1KkEnwCIsIDCjK0EgSSAQIED2IHYqkxQUTat3Djyp1b0UbDjXdhBqUxcWTfhHQDCx5MuCIXLVy2vOWShTEXsVsOJz6stbHlx1ojI1b8tvHbgAAAIfkEBQQAAQAsAwADABcAFwAACJQAAwgcSLCgwRIkDCpcqIHDwoFHHm7Y8DCACgMJFWroUBGHgQNMFE6sGGDCAQsaHVY8csAAD4MjSX4w8MDgRpIBoCQwsKIgQpwBUBxIULEHkYcUUC580tDEE6AGbXSYKKMKVIJSUnDQIGIHl6sQS0w8AZagjxAsyqpdy7at24pJfgwBMkQukCRQjQQBIgTIXiFGoAYEACH5BAUFAAEALAMAAwAXABcAAAiVAAMIHEiwoMEMGQwqXPggwsKBTLQshPDgYYAaD1owdPjQB4QIThRGgGAxwIYIIBQ2LMlkJBCDFEsGOPEgA5aCK0tKmQChRkGEMgPIiDDhoRYjTR56CPGwiooXN6oENQikhYsWP65MJXglx4sVMoZsJdikRosWOMYSRPJih9q3cOPKnWuRSxa7eO9O3cJFCxe+frdMDQgAIfkEBQUAAQAsBQADACAAEAAACKYAAwgcSLAgwQcODCpcyNDAAYYQAzhpaIDhFYY+NOBY6HAhkyETFRLZ0CGKQgMVDV4RAoQKQxMdUpx8aJAJECYQnWzYcMQgSoNVgAy5CHGGhhI+aRIkMgRnxCohNvQoiLDgEyFDskQUuINDiK1Hfpgc+ETKQi0nVGxNkkSrwCw/hiBxu7XuFidAhARpgqWu3yxIhgApEtLvVipIgARBYthvlKaNFQYEADs=";
+function vn(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), Z(e.src, r = kn) || _(e, "src", r), _(e, "alt", "spinner");
+      e = k("img"), Z(e.src, r = $n) || _(e, "src", r), _(e, "alt", "spinner");
     },
     m(n, i) {
       p(n, e, i);
     },
-    p: B,
-    i: B,
-    o: B,
+    p: y,
+    i: y,
+    o: y,
     d(n) {
       n && g(e);
     }
   };
 }
-class vn extends U {
+class yn extends U {
   constructor(e) {
-    super(), N(this, e, null, $n, P, {});
+    super(), N(this, e, null, vn, P, {});
   }
 }
 function Bn(t) {
   O(t, "svelte-1mxx341", ".rcb-modal-loader.svelte-1mxx341{width:100%;flex-grow:1;min-height:100%;display:flex;justify-content:center;align-items:center}");
 }
-function yn(t) {
+function Dn(t) {
   let e, r, n;
-  return r = new vn({}), {
+  return r = new yn({}), {
     c() {
       e = k("div"), w(r.$$.fragment), _(e, "class", "rcb-modal-loader svelte-1mxx341");
     },
     m(i, o) {
       p(i, e, o), I(r, e, null), n = !0;
     },
-    p: B,
+    p: y,
     i(i) {
       n || (u(r.$$.fragment, i), n = !0);
     },
@@ -808,9 +812,9 @@ function yn(t) {
     }
   };
 }
-class je extends U {
+class Je extends U {
   constructor(e) {
-    super(), N(this, e, null, yn, P, {}, Bn);
+    super(), N(this, e, null, Dn, P, {}, Bn);
   }
 }
 var _e = /* @__PURE__ */ ((t) => (t.Started = "started", t.InProgress = "in_progress", t.Succeeded = "succeeded", t.Failed = "failed", t))(_e || {}), Pe = /* @__PURE__ */ ((t) => (t[t.SetupIntentCreationFailed = 1] = "SetupIntentCreationFailed", t[t.PaymentMethodCreationFailed = 2] = "PaymentMethodCreationFailed", t[t.PaymentChargeFailed = 3] = "PaymentChargeFailed", t))(Pe || {}), S = /* @__PURE__ */ ((t) => (t[t.ErrorSettingUpPurchase = 0] = "ErrorSettingUpPurchase", t[t.ErrorChargingPayment = 1] = "ErrorChargingPayment", t[t.UnknownError = 2] = "UnknownError", t[t.NetworkError = 3] = "NetworkError", t[t.StripeError = 4] = "StripeError", t[t.MissingEmailError = 5] = "MissingEmailError", t))(S || {});
@@ -819,7 +823,7 @@ class G extends Error {
     super(r), this.errorCode = e, this.underlyingErrorMessage = n;
   }
 }
-class Dn {
+class Cn {
   constructor(e, r = 10) {
     Q(this, "operationSessionId", null);
     Q(this, "backend");
@@ -925,36 +929,36 @@ class Dn {
     }
   }
 }
-const Cn = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23767676'/%3e%3cpath%20d='M87.6668%2041.504L82.4968%2036.334L62.0002%2056.8307L41.5035%2036.334L36.3335%2041.504L56.8302%2062.0006L36.3335%2082.4973L41.5035%2087.6673L62.0002%2067.1706L82.4968%2087.6673L87.6668%2082.4973L67.1702%2062.0006L87.6668%2041.504Z'%20fill='white'/%3e%3c/svg%3e";
-function Mn(t) {
+const Mn = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23767676'/%3e%3cpath%20d='M87.6668%2041.504L82.4968%2036.334L62.0002%2056.8307L41.5035%2036.334L36.3335%2041.504L56.8302%2062.0006L36.3335%2082.4973L41.5035%2087.6673L62.0002%2067.1706L82.4968%2087.6673L87.6668%2082.4973L67.1702%2062.0006L87.6668%2041.504Z'%20fill='white'/%3e%3c/svg%3e";
+function Qn(t) {
   O(t, "svelte-1609h93", "img.svelte-1609h93{width:124px;height:124px;margin:0 auto}");
 }
-function Qn(t) {
+function Pn(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), Z(e.src, r = Cn) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon svelte-1609h93");
+      e = k("img"), Z(e.src, r = Mn) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon svelte-1609h93");
     },
     m(n, i) {
       p(n, e, i);
     },
-    p: B,
-    i: B,
-    o: B,
+    p: y,
+    i: y,
+    o: y,
     d(n) {
       n && g(e);
     }
   };
 }
-class Pn extends U {
+class Tn extends U {
   constructor(e) {
-    super(), N(this, e, null, Qn, P, {}, Mn);
+    super(), N(this, e, null, Pn, P, {}, Qn);
   }
 }
-function Tn(t) {
+function Nn(t) {
   O(t, "svelte-1rmxk7q", "button.svelte-1rmxk7q{border:none;border-radius:56px;font-size:16px;cursor:pointer;height:56px;color:var(--rc-color-grey-text-dark);background-color:var(--rc-color-grey-ui-dark);display:flex;align-items:center;justify-content:center}button.intent-primary.svelte-1rmxk7q{background-color:var(--rc-color-grey-text-dark);color:var(--rc-color-white);font-size:16px}button.svelte-1rmxk7q:disabled{color:var(--rc-color-grey-text-light)}button.intent-primary.svelte-1rmxk7q:disabled{color:var(--rc-color-grey-text-light)}");
 }
-function Nn(t) {
+function Un(t) {
   let e, r, n, i, o;
   const s = (
     /*#slots*/
@@ -1016,7 +1020,7 @@ function Nn(t) {
     }
   };
 }
-function Un(t, e, r) {
+function Rn(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { intent: o = "primary" } = e, { disabled: s = !1 } = e;
   function l(c) {
     $t.call(this, t, c);
@@ -1027,13 +1031,13 @@ function Un(t, e, r) {
 }
 class we extends U {
   constructor(e) {
-    super(), N(this, e, Un, Nn, P, { intent: 0, disabled: 1 }, Tn);
+    super(), N(this, e, Rn, Un, P, { intent: 0, disabled: 1 }, Nn);
   }
 }
-function Rn(t) {
+function Sn(t) {
   O(t, "svelte-1f9z0o8", "footer.svelte-1f9z0o8{display:flex;flex-direction:column}");
 }
-function Sn(t) {
+function On(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -1084,21 +1088,21 @@ function Sn(t) {
     }
   };
 }
-function On(t, e, r) {
+function Ln(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e;
   return t.$$set = (o) => {
     "$$scope" in o && r(0, i = o.$$scope);
   }, [i, n];
 }
-class Je extends U {
+class Ve extends U {
   constructor(e) {
-    super(), N(this, e, On, Sn, P, {}, Rn);
+    super(), N(this, e, Ln, On, P, {}, Sn);
   }
 }
-function Ln(t) {
+function xn(t) {
   O(t, "svelte-6o8e90", '.column.svelte-6o8e90{display:flex;flex-direction:column;justify-content:flex-start;gap:var(--gap, "8px");flex-grow:1}');
 }
-function xn(t) {
+function Fn(t) {
   let e, r, n;
   const i = (
     /*#slots*/
@@ -1152,7 +1156,7 @@ function xn(t) {
     }
   };
 }
-function Fn(t, e, r) {
+function Gn(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { gutter: o = "8px" } = e;
   return t.$$set = (s) => {
     "gutter" in s && r(0, o = s.gutter), "$$scope" in s && r(1, i = s.$$scope);
@@ -1160,18 +1164,18 @@ function Fn(t, e, r) {
 }
 class ve extends U {
   constructor(e) {
-    super(), N(this, e, Fn, xn, P, { gutter: 0 }, Ln);
+    super(), N(this, e, Gn, Fn, P, { gutter: 0 }, xn);
   }
 }
-const Gn = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20id='mdi_close'%3e%3cpath%20id='Vector'%20d='M19%206.41L17.59%205L12%2010.59L6.41%205L5%206.41L10.59%2012L5%2017.59L6.41%2019L12%2013.41L17.59%2019L19%2017.59L13.41%2012L19%206.41Z'%20fill='%23767676'/%3e%3c/g%3e%3c/svg%3e";
-function Yn(t) {
+const Yn = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20id='mdi_close'%3e%3cpath%20id='Vector'%20d='M19%206.41L17.59%205L12%2010.59L6.41%205L5%206.41L10.59%2012L5%2017.59L6.41%2019L12%2013.41L17.59%2019L19%2017.59L13.41%2012L19%206.41Z'%20fill='%23767676'/%3e%3c/g%3e%3c/svg%3e";
+function Hn(t) {
   O(t, "svelte-14xreta", ".close-button.svelte-14xreta{border:none;cursor:pointer;background-color:transparent;padding:0px}");
 }
-function Hn(t) {
+function Kn(t) {
   let e, r, n, i, o;
   return {
     c() {
-      e = k("button"), r = k("img"), Z(r.src, n = Gn) || _(r, "src", n), _(r, "alt", "close"), _(e, "class", "close-button svelte-14xreta"), e.disabled = /*disabled*/
+      e = k("button"), r = k("img"), Z(r.src, n = Yn) || _(r, "src", n), _(r, "alt", "close"), _(e, "class", "close-button svelte-14xreta"), e.disabled = /*disabled*/
       t[0];
     },
     m(s, l) {
@@ -1187,14 +1191,14 @@ function Hn(t) {
       1 && (e.disabled = /*disabled*/
       s[0]);
     },
-    i: B,
-    o: B,
+    i: y,
+    o: y,
     d(s) {
       s && g(e), i = !1, o();
     }
   };
 }
-function Kn(t, e, r) {
+function qn(t, e, r) {
   let { disabled: n = !1 } = e;
   function i(o) {
     $t.call(this, t, o);
@@ -1203,15 +1207,15 @@ function Kn(t, e, r) {
     "disabled" in o && r(0, n = o.disabled);
   }, [n, i];
 }
-class qn extends U {
+class jn extends U {
   constructor(e) {
-    super(), N(this, e, Kn, Hn, P, { disabled: 0 }, Yn);
+    super(), N(this, e, qn, Kn, P, { disabled: 0 }, Hn);
   }
 }
-function jn(t) {
+function Jn(t) {
   O(t, "svelte-44qpq9", ".rcb-app-icon.svelte-44qpq9{width:40px;height:40px;border-radius:12px;box-shadow:0px 1px 10px 0px rgba(0, 0, 0, 0.1);margin-right:16px}.rcb-app-icon-picture-container.svelte-44qpq9{height:40px}.rcb-app-icon.loading.svelte-44qpq9{background-color:gray}");
 }
-function Jn(t) {
+function Vn(t) {
   let e;
   return {
     c() {
@@ -1220,17 +1224,17 @@ function Jn(t) {
     m(r, n) {
       p(r, e, n);
     },
-    p: B,
+    p: y,
     d(r) {
       r && g(e);
     }
   };
 }
-function Vn(t) {
+function Wn(t) {
   let e, r, n, i, o, s;
   return {
     c() {
-      e = k("picture"), r = k("source"), i = T(), o = k("img"), _(r, "type", "image/webp"), qt(r, n = /*srcWebp*/
+      e = k("picture"), r = k("source"), i = T(), o = k("img"), _(r, "type", "image/webp"), Jt(r, n = /*srcWebp*/
       t[1]) || _(r, "srcset", n), _(o, "class", "rcb-app-icon svelte-44qpq9"), Z(o.src, s = /*src*/
       t[0]) || _(o, "src", s), _(o, "alt", "App icon"), _(e, "class", "rcb-app-icon-picture-container svelte-44qpq9");
     },
@@ -1249,12 +1253,12 @@ function Vn(t) {
     }
   };
 }
-function Wn(t) {
+function zn(t) {
   let e;
   function r(o, s) {
     return (
       /*src*/
-      o[0] !== null ? Vn : Jn
+      o[0] !== null ? Wn : Vn
     );
   }
   let n = r(t), i = n(t);
@@ -1268,38 +1272,38 @@ function Wn(t) {
     p(o, [s]) {
       n === (n = r(o)) && i ? i.p(o, s) : (i.d(1), i = n(o), i && (i.c(), i.m(e.parentNode, e)));
     },
-    i: B,
-    o: B,
+    i: y,
+    o: y,
     d(o) {
       o && g(e), i.d(o);
     }
   };
 }
-function zn(t, e, r) {
+function Xn(t, e, r) {
   let { src: n = null } = e, { srcWebp: i = null } = e;
   return t.$$set = (o) => {
     "src" in o && r(0, n = o.src), "srcWebp" in o && r(1, i = o.srcWebp);
   }, [n, i];
 }
-class yt extends U {
+class Bt extends U {
   constructor(e) {
-    super(), N(this, e, zn, Wn, P, { src: 0, srcWebp: 1 }, jn);
+    super(), N(this, e, Xn, zn, P, { src: 0, srcWebp: 1 }, Jn);
   }
 }
 const De = (t) => `https://da08ctfrofx1b.cloudfront.net/${t}`;
-function Xn(t) {
+function Zn(t) {
   O(t, "svelte-10uf5fq", ".app-title.svelte-10uf5fq{font-weight:500;margin:8px 0;font-size:16px}.rcb-header-layout__business-info.svelte-10uf5fq{display:flex;align-items:center}");
 }
-function Zn(t) {
+function er(t) {
   let e, r;
-  return e = new yt({}), {
+  return e = new Bt({}), {
     c() {
       w(e.$$.fragment);
     },
     m(n, i) {
       I(e, n, i), r = !0;
     },
-    p: B,
+    p: y,
     i(n) {
       r || (u(e.$$.fragment, n), r = !0);
     },
@@ -1311,7 +1315,7 @@ function Zn(t) {
     }
   };
 }
-function er(t) {
+function tr(t) {
   let e, r, n = (
     /*brandingInfo*/
     t[0].seller_company_name + ""
@@ -1350,7 +1354,7 @@ function er(t) {
 }
 function rt(t) {
   let e, r;
-  return e = new yt({
+  return e = new Bt({
     props: {
       src: De(
         /*brandingInfo*/
@@ -1391,9 +1395,9 @@ function rt(t) {
     }
   };
 }
-function tr(t) {
+function nr(t) {
   let e, r, n, i;
-  const o = [er, Zn], s = [];
+  const o = [tr, er], s = [];
   function l(c, a) {
     return (
       /*brandingInfo*/
@@ -1424,7 +1428,7 @@ function tr(t) {
     }
   };
 }
-function nr(t, e, r) {
+function rr(t, e, r) {
   let { brandingInfo: n = null } = e;
   return t.$$set = (i) => {
     "brandingInfo" in i && r(0, n = i.brandingInfo);
@@ -1432,20 +1436,20 @@ function nr(t, e, r) {
 }
 class Dt extends U {
   constructor(e) {
-    super(), N(this, e, nr, tr, P, { brandingInfo: 0 }, Xn);
+    super(), N(this, e, rr, nr, P, { brandingInfo: 0 }, Zn);
   }
 }
-function rr(t) {
+function ir(t) {
   O(t, "svelte-17puakv", ".rcb-post-purchase-header-layout.svelte-17puakv{display:flex;justify-content:space-between;align-items:center;width:100%;margin-top:-4px}");
 }
-function ir(t) {
+function or(t) {
   let e, r, n, i, o;
   return r = new Dt({
     props: { brandingInfo: (
       /*brandingInfo*/
       t[0]
     ) }
-  }), i = new qn({}), i.$on("click", function() {
+  }), i = new jn({}), i.$on("click", function() {
     ae(
       /*onClose*/
       t[1]
@@ -1475,12 +1479,12 @@ function ir(t) {
     }
   };
 }
-function or(t) {
+function sr(t) {
   let e, r;
   return e = new ue({
     props: {
       as: "header",
-      $$slots: { default: [ir] },
+      $$slots: { default: [or] },
       $$scope: { ctx: t }
     }
   }), {
@@ -1506,22 +1510,22 @@ function or(t) {
     }
   };
 }
-function sr(t, e, r) {
+function lr(t, e, r) {
   let { brandingInfo: n = null } = e, { onClose: i } = e;
   return t.$$set = (o) => {
     "brandingInfo" in o && r(0, n = o.brandingInfo), "onClose" in o && r(1, i = o.onClose);
   }, [n, i];
 }
-class lr extends U {
+class cr extends U {
   constructor(e) {
-    super(), N(this, e, sr, or, P, { brandingInfo: 0, onClose: 1 }, rr);
+    super(), N(this, e, lr, sr, P, { brandingInfo: 0, onClose: 1 }, ir);
   }
 }
-function cr(t) {
+function ar(t) {
   O(t, "svelte-10pcqja", ".rcb-modal-message.svelte-10pcqja{width:100%;min-height:160px;display:flex;justify-content:center;align-items:center;flex-direction:column;text-align:center}.title.svelte-10pcqja{font-size:24px;line-height:1.25em}.subtitle.svelte-10pcqja{font-size:16px;line-height:1.25em;overflow-wrap:anywhere}");
 }
-const ar = (t) => ({}), it = (t) => ({});
-function ur(t) {
+const ur = (t) => ({}), it = (t) => ({});
+function fr(t) {
   let e, r, n, i, o;
   const s = (
     /*#slots*/
@@ -1580,7 +1584,7 @@ function ur(t) {
     }
   };
 }
-function fr(t) {
+function dr(t) {
   let e, r, n;
   const i = (
     /*#slots*/
@@ -1595,7 +1599,7 @@ function fr(t) {
   return r = new ve({
     props: {
       gutter: "16px",
-      $$slots: { default: [ur] },
+      $$slots: { default: [fr] },
       $$scope: { ctx: t }
     }
   }), {
@@ -1618,7 +1622,7 @@ function fr(t) {
           /*$$scope*/
           s[5],
           l,
-          ar
+          ur
         ) : q(
           /*$$scope*/
           s[5]
@@ -1640,12 +1644,12 @@ function fr(t) {
     }
   };
 }
-function dr(t) {
+function mr(t) {
   let e, r, n;
   return r = new ve({
     props: {
       gutter: "16px",
-      $$slots: { default: [fr] },
+      $$slots: { default: [dr] },
       $$scope: { ctx: t }
     }
   }), {
@@ -1682,7 +1686,7 @@ function dr(t) {
     }
   };
 }
-function mr(t) {
+function gr(t) {
   let e;
   return {
     c() {
@@ -1696,11 +1700,11 @@ function mr(t) {
     }
   };
 }
-function gr(t) {
+function pr(t) {
   let e, r;
   return e = new we({
     props: {
-      $$slots: { default: [mr] },
+      $$slots: { default: [gr] },
       $$scope: { ctx: t }
     }
   }), e.$on("click", function() {
@@ -1732,9 +1736,9 @@ function gr(t) {
     }
   };
 }
-function pr(t) {
+function _r(t) {
   let e, r, n, i, o, s;
-  return e = new lr({
+  return e = new cr({
     props: {
       brandingInfo: (
         /*brandingInfo*/
@@ -1747,12 +1751,12 @@ function pr(t) {
     }
   }), n = new ue({
     props: {
-      $$slots: { default: [dr] },
+      $$slots: { default: [mr] },
       $$scope: { ctx: t }
     }
-  }), o = new Je({
+  }), o = new Ve({
     props: {
-      $$slots: { default: [gr] },
+      $$slots: { default: [pr] },
       $$scope: { ctx: t }
     }
   }), {
@@ -1787,12 +1791,12 @@ function pr(t) {
     }
   };
 }
-function _r(t) {
+function Ar(t) {
   let e, r;
   return e = new ve({
     props: {
       gutter: "32px",
-      $$slots: { default: [pr] },
+      $$slots: { default: [_r] },
       $$scope: { ctx: t }
     }
   }), {
@@ -1818,7 +1822,7 @@ function _r(t) {
     }
   };
 }
-function Ar(t, e, r) {
+function hr(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { brandingInfo: o = null } = e, { onContinue: s } = e, { title: l } = e, { type: c } = e;
   return t.$$set = (a) => {
     "brandingInfo" in a && r(0, o = a.brandingInfo), "onContinue" in a && r(1, s = a.onContinue), "title" in a && r(2, l = a.title), "type" in a && r(3, c = a.type), "$$scope" in a && r(5, i = a.$$scope);
@@ -1829,8 +1833,8 @@ class Ct extends U {
     super(), N(
       this,
       e,
+      hr,
       Ar,
-      _r,
       P,
       {
         brandingInfo: 0,
@@ -1838,7 +1842,7 @@ class Ct extends U {
         title: 2,
         type: 3
       },
-      cr
+      ar
     );
   }
 }
@@ -1870,7 +1874,7 @@ function ot(t) {
     }
   };
 }
-function hr(t) {
+function Er(t) {
   let e = (
     /*getErrorMessage*/
     t[3]() + ""
@@ -1894,16 +1898,16 @@ function hr(t) {
     }
   };
 }
-function Er(t) {
+function Ir(t) {
   let e, r;
-  return e = new Pn({ props: { slot: "icon" } }), {
+  return e = new Tn({ props: { slot: "icon" } }), {
     c() {
       w(e.$$.fragment);
     },
     m(n, i) {
       I(e, n, i), r = !0;
     },
-    p: B,
+    p: y,
     i(n) {
       r || (u(e.$$.fragment, n), r = !0);
     },
@@ -1915,7 +1919,7 @@ function Er(t) {
     }
   };
 }
-function Ir(t) {
+function br(t) {
   let e, r;
   return e = new Ct({
     props: {
@@ -1930,8 +1934,8 @@ function Ir(t) {
       ),
       type: "error",
       $$slots: {
-        icon: [Er],
-        default: [hr]
+        icon: [Ir],
+        default: [Er]
       },
       $$scope: { ctx: t }
     }
@@ -1962,7 +1966,7 @@ function Ir(t) {
     }
   };
 }
-function br(t, e, r) {
+function wr(t, e, r) {
   let { brandingInfo: n = null } = e, { lastError: i } = e, { supportEmail: o = null } = e, { onContinue: s } = e;
   Se(() => {
     V.errorLog(`Displayed error: ${S[i.errorCode]}. Message: ${i.message ?? "None"}. Underlying error: ${i.underlyingErrorMessage ?? "None"}`);
@@ -1988,9 +1992,9 @@ function br(t, e, r) {
     "brandingInfo" in c && r(0, n = c.brandingInfo), "lastError" in c && r(4, i = c.lastError), "supportEmail" in c && r(1, o = c.supportEmail), "onContinue" in c && r(2, s = c.onContinue);
   }, [n, o, s, l, i];
 }
-class wr extends U {
+class kr extends U {
   constructor(e) {
-    super(), N(this, e, br, Ir, P, {
+    super(), N(this, e, wr, br, P, {
       brandingInfo: 0,
       lastError: 4,
       supportEmail: 1,
@@ -1998,22 +2002,22 @@ class wr extends U {
     });
   }
 }
-const kr = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23576CDB'/%3e%3crect%20x='44.1116'%20y='56'%20width='27.5'%20height='11'%20transform='rotate(45%2044.1116%2056)'%20fill='white'/%3e%3crect%20x='79.1133'%20y='44.334'%20width='11'%20height='44'%20transform='rotate(45%2079.1133%2044.334)'%20fill='white'/%3e%3c/svg%3e";
-function $r(t) {
+const $r = "data:image/svg+xml,%3csvg%20width='124'%20height='124'%20viewBox='0%200%20124%20124'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3ccircle%20cx='62'%20cy='62'%20r='62'%20fill='%23576CDB'/%3e%3crect%20x='44.1116'%20y='56'%20width='27.5'%20height='11'%20transform='rotate(45%2044.1116%2056)'%20fill='white'/%3e%3crect%20x='79.1133'%20y='44.334'%20width='11'%20height='44'%20transform='rotate(45%2079.1133%2044.334)'%20fill='white'/%3e%3c/svg%3e";
+function vr(t) {
   O(t, "svelte-1609h93", "img.svelte-1609h93{width:124px;height:124px;margin:0 auto}");
 }
-function vr(t) {
+function yr(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), Z(e.src, r = kr) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon svelte-1609h93");
+      e = k("img"), Z(e.src, r = $r) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon svelte-1609h93");
     },
     m(n, i) {
       p(n, e, i);
     },
-    p: B,
-    i: B,
-    o: B,
+    p: y,
+    i: y,
+    o: y,
     d(n) {
       n && g(e);
     }
@@ -2021,10 +2025,10 @@ function vr(t) {
 }
 class Br extends U {
   constructor(e) {
-    super(), N(this, e, null, vr, P, {}, $r);
+    super(), N(this, e, null, yr, P, {}, vr);
   }
 }
-function yr(t) {
+function Dr(t) {
   let e;
   return {
     c() {
@@ -2038,7 +2042,7 @@ function yr(t) {
     }
   };
 }
-function Dr(t) {
+function Cr(t) {
   let e, r;
   return e = new Br({ props: { slot: "icon" } }), {
     c() {
@@ -2047,7 +2051,7 @@ function Dr(t) {
     m(n, i) {
       I(e, n, i), r = !0;
     },
-    p: B,
+    p: y,
     i(n) {
       r || (u(e.$$.fragment, n), r = !0);
     },
@@ -2059,7 +2063,7 @@ function Dr(t) {
     }
   };
 }
-function Cr(t) {
+function Mr(t) {
   let e, r;
   return e = new Ct({
     props: {
@@ -2074,8 +2078,8 @@ function Cr(t) {
         t[1]
       ),
       $$slots: {
-        icon: [Dr],
-        default: [yr]
+        icon: [Cr],
+        default: [Dr]
       },
       $$scope: { ctx: t }
     }
@@ -2106,30 +2110,30 @@ function Cr(t) {
     }
   };
 }
-function Mr(t, e, r) {
+function Qr(t, e, r) {
   let { brandingInfo: n = null } = e, { onContinue: i } = e;
   return t.$$set = (o) => {
     "brandingInfo" in o && r(0, n = o.brandingInfo), "onContinue" in o && r(1, i = o.onContinue);
   }, [n, i];
 }
-class Qr extends U {
+class Pr extends U {
   constructor(e) {
-    super(), N(this, e, Mr, Cr, P, { brandingInfo: 0, onContinue: 1 });
+    super(), N(this, e, Qr, Mr, P, { brandingInfo: 0, onContinue: 1 });
   }
 }
-function Pr(t, e, r, n, i = {}) {
+function Tr(t, e, r, n, i = {}) {
   const o = r.create(e, i);
   return o.mount(t), o.on("change", (s) => n("change", s)), o.on("ready", (s) => n("ready", s)), o.on("focus", (s) => n("focus", s)), o.on("blur", (s) => n("blur", s)), o.on("escape", (s) => n("escape", s)), o.on("click", (s) => n("click", s)), o.on("loaderror", (s) => n("loaderror", s)), o.on("loaderstart", (s) => n("loaderstart", s)), o.on("networkschange", (s) => n("networkschange", s)), o;
 }
-const Tr = typeof window > "u";
-function Nr(t) {
-  if (!Tr)
+const Nr = typeof window > "u";
+function Ur(t) {
+  if (!Nr)
     return t.registerAppInfo({
       name: "svelte-stripe-js",
       url: "https://svelte-stripe-js.vercel.app"
     });
 }
-function Ur(t) {
+function Rr(t) {
   let e;
   return {
     c() {
@@ -2138,19 +2142,19 @@ function Ur(t) {
     m(r, n) {
       p(r, e, n), t[6](e);
     },
-    p: B,
-    i: B,
-    o: B,
+    p: y,
+    i: y,
+    o: y,
     d(r) {
       r && g(e), t[6](null);
     }
   };
 }
-function Rr(t, e, r) {
+function Sr(t, e, r) {
   let n, i;
-  const o = rn(), { elements: s } = sn("stripe");
+  const o = sn(), { elements: s } = cn("stripe");
   let { options: l = void 0 } = e;
-  Se(() => (n = Pr(i, "payment", s, o, l), () => n.destroy()));
+  Se(() => (n = Tr(i, "payment", s, o, l), () => n.destroy()));
   function c() {
     n.blur();
   }
@@ -2172,9 +2176,9 @@ function Rr(t, e, r) {
     "options" in v && r(1, l = v.options);
   }, [i, l, c, a, f, d, E];
 }
-class Sr extends U {
+class Or extends U {
   constructor(e) {
-    super(), N(this, e, Rr, Ur, P, {
+    super(), N(this, e, Sr, Rr, P, {
       options: 1,
       blur: 2,
       clear: 3,
@@ -2246,7 +2250,7 @@ function st(t) {
     }
   };
 }
-function Or(t) {
+function Lr(t) {
   let e, r, n = (
     /*stripe*/
     t[1] && /*elements*/
@@ -2278,10 +2282,10 @@ function Or(t) {
     }
   };
 }
-function Lr(t, e, r) {
-  let n, { $$slots: i = {}, $$scope: o } = e, { stripe: s } = e, { mode: l = void 0 } = e, { theme: c = "stripe" } = e, { variables: a = {} } = e, { rules: f = {} } = e, { labels: d = "above" } = e, { loader: E = "auto" } = e, { fonts: v = [] } = e, { locale: A = "auto" } = e, { currency: M = void 0 } = e, { amount: h = void 0 } = e, { clientSecret: y = void 0 } = e, { elements: F = null } = e;
+function xr(t, e, r) {
+  let n, { $$slots: i = {}, $$scope: o } = e, { stripe: s } = e, { mode: l = void 0 } = e, { theme: c = "stripe" } = e, { variables: a = {} } = e, { rules: f = {} } = e, { labels: d = "above" } = e, { loader: E = "auto" } = e, { fonts: v = [] } = e, { locale: A = "auto" } = e, { currency: M = void 0 } = e, { amount: h = void 0 } = e, { clientSecret: B = void 0 } = e, { elements: F = null } = e;
   return t.$$set = ($) => {
-    "stripe" in $ && r(1, s = $.stripe), "mode" in $ && r(2, l = $.mode), "theme" in $ && r(3, c = $.theme), "variables" in $ && r(4, a = $.variables), "rules" in $ && r(5, f = $.rules), "labels" in $ && r(6, d = $.labels), "loader" in $ && r(7, E = $.loader), "fonts" in $ && r(8, v = $.fonts), "locale" in $ && r(9, A = $.locale), "currency" in $ && r(10, M = $.currency), "amount" in $ && r(11, h = $.amount), "clientSecret" in $ && r(12, y = $.clientSecret), "elements" in $ && r(0, F = $.elements), "$$scope" in $ && r(14, o = $.$$scope);
+    "stripe" in $ && r(1, s = $.stripe), "mode" in $ && r(2, l = $.mode), "theme" in $ && r(3, c = $.theme), "variables" in $ && r(4, a = $.variables), "rules" in $ && r(5, f = $.rules), "labels" in $ && r(6, d = $.labels), "loader" in $ && r(7, E = $.loader), "fonts" in $ && r(8, v = $.fonts), "locale" in $ && r(9, A = $.locale), "currency" in $ && r(10, M = $.currency), "amount" in $ && r(11, h = $.amount), "clientSecret" in $ && r(12, B = $.clientSecret), "elements" in $ && r(0, F = $.elements), "$$scope" in $ && r(14, o = $.$$scope);
   }, t.$$.update = () => {
     t.$$.dirty & /*theme, variables, rules, labels*/
     120 && r(13, n = { theme: c, variables: a, rules: f, labels: d }), t.$$.dirty & /*stripe, elements, mode, currency, amount, appearance, clientSecret, fonts, loader, locale*/
@@ -2290,11 +2294,11 @@ function Lr(t, e, r) {
       currency: M,
       amount: h,
       appearance: n,
-      clientSecret: y,
+      clientSecret: B,
       fonts: v,
       loader: E,
       locale: A
-    })), Nr(s), on("stripe", { stripe: s, elements: F })), t.$$.dirty & /*elements, appearance, locale*/
+    })), Ur(s), ln("stripe", { stripe: s, elements: F })), t.$$.dirty & /*elements, appearance, locale*/
     8705 && F && F.update({ appearance: n, locale: A });
   }, [
     F,
@@ -2309,15 +2313,15 @@ function Lr(t, e, r) {
     A,
     M,
     h,
-    y,
+    B,
     n,
     o,
     i
   ];
 }
-class xr extends U {
+class Fr extends U {
   constructor(e) {
-    super(), N(this, e, Lr, Or, P, {
+    super(), N(this, e, xr, Lr, P, {
       stripe: 1,
       mode: 2,
       theme: 3,
@@ -2334,10 +2338,10 @@ class xr extends U {
     });
   }
 }
-var Mt = "https://js.stripe.com/v3", Fr = /^https:\/\/js\.stripe\.com\/v3\/?(\?.*)?$/, lt = "loadStripe.setLoadParameters was called but an existing Stripe.js script already exists in the document; existing script parameters will be used", Gr = function() {
+var Mt = "https://js.stripe.com/v3", Gr = /^https:\/\/js\.stripe\.com\/v3\/?(\?.*)?$/, lt = "loadStripe.setLoadParameters was called but an existing Stripe.js script already exists in the document; existing script parameters will be used", Yr = function() {
   for (var e = document.querySelectorAll('script[src^="'.concat(Mt, '"]')), r = 0; r < e.length; r++) {
     var n = e[r];
-    if (Fr.test(n.src))
+    if (Gr.test(n.src))
       return n;
   }
   return null;
@@ -2348,21 +2352,21 @@ var Mt = "https://js.stripe.com/v3", Fr = /^https:\/\/js\.stripe\.com\/v3\/?(\?.
   if (!i)
     throw new Error("Expected document.body not to be null. Stripe.js requires a <body> element.");
   return i.appendChild(n), n;
-}, Yr = function(e, r) {
+}, Hr = function(e, r) {
   !e || !e._registerWrapper || e._registerWrapper({
     name: "stripe-js",
     version: "2.4.0",
     startTime: r
   });
-}, me = null, Ce = null, Me = null, Hr = function(e) {
+}, me = null, Ce = null, Me = null, Kr = function(e) {
   return function() {
     e(new Error("Failed to load Stripe.js"));
   };
-}, Kr = function(e, r) {
+}, qr = function(e, r) {
   return function() {
     window.Stripe ? e(window.Stripe) : r(new Error("Stripe.js not available"));
   };
-}, qr = function(e) {
+}, jr = function(e) {
   return me !== null ? me : (me = new Promise(function(r, n) {
     if (typeof window > "u" || typeof document > "u") {
       r(null);
@@ -2373,7 +2377,7 @@ var Mt = "https://js.stripe.com/v3", Fr = /^https:\/\/js\.stripe\.com\/v3\/?(\?.
       return;
     }
     try {
-      var i = Gr();
+      var i = Yr();
       if (i && e)
         console.warn(lt);
       else if (!i)
@@ -2382,7 +2386,7 @@ var Mt = "https://js.stripe.com/v3", Fr = /^https:\/\/js\.stripe\.com\/v3\/?(\?.
         var o;
         i.removeEventListener("load", Me), i.removeEventListener("error", Ce), (o = i.parentNode) === null || o === void 0 || o.removeChild(i), i = ct(e);
       }
-      Me = Kr(r, n), Ce = Hr(n), i.addEventListener("load", Me), i.addEventListener("error", Ce);
+      Me = qr(r, n), Ce = Kr(n), i.addEventListener("load", Me), i.addEventListener("error", Ce);
     } catch (s) {
       n(s);
       return;
@@ -2390,13 +2394,13 @@ var Mt = "https://js.stripe.com/v3", Fr = /^https:\/\/js\.stripe\.com\/v3\/?(\?.
   }), me.catch(function(r) {
     return me = null, Promise.reject(r);
   }));
-}, jr = function(e, r, n) {
+}, Jr = function(e, r, n) {
   if (e === null)
     return null;
   var i = e.apply(void 0, r);
-  return Yr(i, n), i;
+  return Hr(i, n), i;
 }, ge, Qt = !1, Pt = function() {
-  return ge || (ge = qr(null).catch(function(e) {
+  return ge || (ge = jr(null).catch(function(e) {
     return ge = null, Promise.reject(e);
   }), ge);
 };
@@ -2405,19 +2409,19 @@ Promise.resolve().then(function() {
 }).catch(function(t) {
   Qt || console.warn(t);
 });
-var Jr = function() {
+var Vr = function() {
   for (var e = arguments.length, r = new Array(e), n = 0; n < e; n++)
     r[n] = arguments[n];
   Qt = !0;
   var i = Date.now();
   return Pt().then(function(o) {
-    return jr(o, r, i);
+    return Jr(o, r, i);
   });
 };
-function Vr(t) {
+function Wr(t) {
   O(t, "svelte-1xe711j", ".rcb-header-layout.svelte-1xe711j{display:flex;justify-content:space-between;align-items:center;width:100%;font-size:24px;margin:0;font-weight:500}");
 }
-function Wr(t) {
+function zr(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -2468,12 +2472,12 @@ function Wr(t) {
     }
   };
 }
-function zr(t) {
+function Xr(t) {
   let e, r;
   return e = new ue({
     props: {
       as: "header",
-      $$slots: { default: [Wr] },
+      $$slots: { default: [zr] },
       $$scope: { ctx: t }
     }
   }), {
@@ -2499,38 +2503,38 @@ function zr(t) {
     }
   };
 }
-function Xr(t, e, r) {
+function Zr(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e;
   return t.$$set = (o) => {
     "$$scope" in o && r(1, i = o.$$scope);
   }, [n, i];
 }
-class Ve extends U {
+class We extends U {
   constructor(e) {
-    super(), N(this, e, Xr, zr, P, {}, Vr);
+    super(), N(this, e, Zr, Xr, P, {}, Wr);
   }
 }
-const Zr = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cpath%20d='M18%208H17V6C17%203.24%2014.76%201%2012%201C9.24%201%207%203.24%207%206V8H6C4.9%208%204%208.9%204%2010V20C4%2021.1%204.9%2022%206%2022H18C19.1%2022%2020%2021.1%2020%2020V10C20%208.9%2019.1%208%2018%208ZM12%2017C10.9%2017%2010%2016.1%2010%2015C10%2013.9%2010.9%2013%2012%2013C13.1%2013%2014%2013.9%2014%2015C14%2016.1%2013.1%2017%2012%2017ZM15.1%208H8.9V6C8.9%204.29%2010.29%202.9%2012%202.9C13.71%202.9%2015.1%204.29%2015.1%206V8Z'%20fill='%2311D483'/%3e%3c/svg%3e";
-function ei(t) {
+const ei = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cpath%20d='M18%208H17V6C17%203.24%2014.76%201%2012%201C9.24%201%207%203.24%207%206V8H6C4.9%208%204%208.9%204%2010V20C4%2021.1%204.9%2022%206%2022H18C19.1%2022%2020%2021.1%2020%2020V10C20%208.9%2019.1%208%2018%208ZM12%2017C10.9%2017%2010%2016.1%2010%2015C10%2013.9%2010.9%2013%2012%2013C13.1%2013%2014%2013.9%2014%2015C14%2016.1%2013.1%2017%2012%2017ZM15.1%208H8.9V6C8.9%204.29%2010.29%202.9%2012%202.9C13.71%202.9%2015.1%204.29%2015.1%206V8Z'%20fill='%2311D483'/%3e%3c/svg%3e";
+function ti(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), Z(e.src, r = Zr) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
+      e = k("img"), Z(e.src, r = ei) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
     },
     m(n, i) {
       p(n, e, i);
     },
-    p: B,
-    i: B,
-    o: B,
+    p: y,
+    i: y,
+    o: y,
     d(n) {
       n && g(e);
     }
   };
 }
-class ti extends U {
+class ni extends U {
   constructor(e) {
-    super(), N(this, e, null, ei, P, {});
+    super(), N(this, e, null, ti, P, {});
   }
 }
 const Ae = {
@@ -2542,7 +2546,7 @@ const Ae = {
   "grey-ui-dark": "#dfdfdf",
   white: "#ffffff"
 };
-function ni(t) {
+function ri(t) {
   O(t, "svelte-rjmul6", `.processing.svelte-rjmul6{width:12px;aspect-ratio:1;border-radius:50%;animation:svelte-rjmul6-l5 1.5s infinite linear}@keyframes svelte-rjmul6-l5{0%{box-shadow:20px 0 #fff2,
         -20px 0 #fff2;background:#fff2}25%{box-shadow:20px 0 #fff2,
         -20px 0 #ffff;background:#fff2}50%{box-shadow:20px 0 #fff2,
@@ -2550,7 +2554,7 @@ function ni(t) {
         -20px 0 #fff2;background:#fff2}100%{box-shadow:20px 0 #fff2,
         -20px 0 #fff2;background:#fff2}}`);
 }
-function ri(t) {
+function ii(t) {
   let e;
   return {
     c() {
@@ -2559,9 +2563,9 @@ function ri(t) {
     m(r, n) {
       p(r, e, n);
     },
-    p: B,
-    i: B,
-    o: B,
+    p: y,
+    i: y,
+    o: y,
     d(r) {
       r && g(e);
     }
@@ -2569,22 +2573,22 @@ function ri(t) {
 }
 class Tt extends U {
   constructor(e) {
-    super(), N(this, e, null, ri, P, {}, ni);
+    super(), N(this, e, null, ii, P, {}, ri);
   }
 }
-function ii(t) {
+function oi(t) {
   O(t, "svelte-1wxt892", ".rcb-stripe-elements-container.svelte-1wxt892{width:100%;margin-top:32px;margin-bottom:24px}");
 }
-function oi(t) {
+function si(t) {
   let e, r;
-  return e = new je({}), {
+  return e = new Je({}), {
     c() {
       w(e.$$.fragment);
     },
     m(n, i) {
       I(e, n, i), r = !0;
     },
-    p: B,
+    p: y,
     i(n) {
       r || (u(e.$$.fragment, n), r = !0);
     },
@@ -2596,7 +2600,7 @@ function oi(t) {
     }
   };
 }
-function si(t) {
+function li(t) {
   let e, r, n, i, o, s;
   function l(a) {
     t[9](a);
@@ -2637,13 +2641,13 @@ function si(t) {
       },
       ".Input--invalid": { boxShadow: "none" }
     },
-    $$slots: { default: [pi] },
+    $$slots: { default: [_i] },
     $$scope: { ctx: t }
   };
   return (
     /*elements*/
     t[2] !== void 0 && (c.elements = /*elements*/
-    t[2]), r = new xr({ props: c }), Ne.push(() => dn(r, "elements", l)), {
+    t[2]), r = new Fr({ props: c }), Ne.push(() => gn(r, "elements", l)), {
       c() {
         e = k("form"), w(r.$$.fragment);
       },
@@ -2660,7 +2664,7 @@ function si(t) {
         a[3]), f & /*$$scope, processing, onClose*/
         2051 && (d.$$scope = { dirty: f, ctx: a }), !n && f & /*elements*/
         4 && (n = !0, d.elements = /*elements*/
-        a[2], an(() => n = !1)), r.$set(d);
+        a[2], fn(() => n = !1)), r.$set(d);
       },
       i(a) {
         i || (u(r.$$.fragment, a), i = !0);
@@ -2674,16 +2678,16 @@ function si(t) {
     }
   );
 }
-function li(t) {
+function ci(t) {
   let e, r, n, i;
-  return n = new ti({}), {
+  return n = new ni({}), {
     c() {
       e = k("div"), e.textContent = "Secure Checkout", r = T(), w(n.$$.fragment);
     },
     m(o, s) {
       p(o, e, s), p(o, r, s), I(n, o, s), i = !0;
     },
-    p: B,
+    p: y,
     i(o) {
       i || (u(n.$$.fragment, o), i = !0);
     },
@@ -2695,16 +2699,16 @@ function li(t) {
     }
   };
 }
-function ci(t) {
+function ai(t) {
   let e, r, n;
-  return r = new Sr({}), {
+  return r = new Or({}), {
     c() {
       e = k("div"), w(r.$$.fragment), _(e, "class", "rcb-stripe-elements-container svelte-1wxt892");
     },
     m(i, o) {
       p(i, e, o), I(r, e, null), n = !0;
     },
-    p: B,
+    p: y,
     i(i) {
       n || (u(r.$$.fragment, i), n = !0);
     },
@@ -2716,7 +2720,7 @@ function ci(t) {
     }
   };
 }
-function ai(t) {
+function ui(t) {
   let e;
   return {
     c() {
@@ -2725,14 +2729,14 @@ function ai(t) {
     m(r, n) {
       p(r, e, n);
     },
-    i: B,
-    o: B,
+    i: y,
+    o: y,
     d(r) {
       r && g(e);
     }
   };
 }
-function ui(t) {
+function fi(t) {
   let e, r;
   return e = new Tt({}), {
     c() {
@@ -2752,9 +2756,9 @@ function ui(t) {
     }
   };
 }
-function fi(t) {
+function di(t) {
   let e, r, n, i;
-  const o = [ui, ai], s = [];
+  const o = [fi, ui], s = [];
   function l(c, a) {
     return (
       /*processing*/
@@ -2785,7 +2789,7 @@ function fi(t) {
     }
   };
 }
-function di(t) {
+function mi(t) {
   let e;
   return {
     c() {
@@ -2799,7 +2803,7 @@ function di(t) {
     }
   };
 }
-function mi(t) {
+function gi(t) {
   let e, r, n, i;
   return e = new we({
     props: {
@@ -2807,7 +2811,7 @@ function mi(t) {
         /*processing*/
         t[0]
       ),
-      $$slots: { default: [fi] },
+      $$slots: { default: [di] },
       $$scope: { ctx: t }
     }
   }), n = new we({
@@ -2817,7 +2821,7 @@ function mi(t) {
         t[0]
       ),
       intent: "secondary",
-      $$slots: { default: [di] },
+      $$slots: { default: [mi] },
       $$scope: { ctx: t }
     }
   }), n.$on("click", function() {
@@ -2856,11 +2860,11 @@ function mi(t) {
     }
   };
 }
-function gi(t) {
+function pi(t) {
   let e, r;
   return e = new ve({
     props: {
-      $$slots: { default: [mi] },
+      $$slots: { default: [gi] },
       $$scope: { ctx: t }
     }
   }), {
@@ -2886,21 +2890,21 @@ function gi(t) {
     }
   };
 }
-function pi(t) {
+function _i(t) {
   let e, r, n, i, o, s;
-  return e = new Ve({
+  return e = new We({
     props: {
-      $$slots: { default: [li] },
+      $$slots: { default: [ci] },
       $$scope: { ctx: t }
     }
   }), n = new ue({
     props: {
-      $$slots: { default: [ci] },
+      $$slots: { default: [ai] },
       $$scope: { ctx: t }
     }
-  }), o = new Je({
+  }), o = new Ve({
     props: {
-      $$slots: { default: [gi] },
+      $$slots: { default: [pi] },
       $$scope: { ctx: t }
     }
   }), {
@@ -2932,9 +2936,9 @@ function pi(t) {
     }
   };
 }
-function _i(t) {
+function Ai(t) {
   let e, r, n, i;
-  const o = [si, oi], s = [];
+  const o = [li, si], s = [];
   function l(c, a) {
     return (
       /*stripe*/
@@ -2966,7 +2970,7 @@ function _i(t) {
     }
   };
 }
-function Ai(t, e, r) {
+function hi(t, e, r) {
   let { onClose: n } = e, { onContinue: i } = e, { onError: o } = e, { paymentInfoCollectionMetadata: s } = e, { processing: l = !1 } = e;
   const c = s.data.client_secret;
   let a = null, f, d;
@@ -2974,7 +2978,7 @@ function Ai(t, e, r) {
     const A = s.data.publishable_api_key, M = s.data.stripe_account_id;
     if (!A || !M)
       throw new Error("Stripe publishable key or account ID not found");
-    r(3, a = await Jr(A, { stripeAccount: M }));
+    r(3, a = await Vr(A, { stripeAccount: M }));
   });
   const E = async () => {
     if (l || !a || !d)
@@ -3007,13 +3011,13 @@ function Ai(t, e, r) {
     v
   ];
 }
-class hi extends U {
+class Ei extends U {
   constructor(e) {
     super(), N(
       this,
       e,
+      hi,
       Ai,
-      _i,
       P,
       {
         onClose: 1,
@@ -3022,14 +3026,14 @@ class hi extends U {
         paymentInfoCollectionMetadata: 8,
         processing: 0
       },
-      ii
+      oi
     );
   }
 }
-function Ei(t) {
+function Ii(t) {
   O(t, "svelte-favd20", "form.svelte-favd20.svelte-favd20{display:flex;flex-direction:column;min-height:100%;flex-grow:1}.form-container.svelte-favd20.svelte-favd20{display:flex;flex-direction:column;width:100%;margin-top:32px;margin-bottom:16px}.form-label.svelte-favd20.svelte-favd20{margin-top:8px;margin-bottom:8px;display:block;font-weight:500;line-height:22px}.form-input.error.svelte-favd20 input.svelte-favd20{border-color:var(--rc-color-error)}.form-error.svelte-favd20.svelte-favd20{margin-top:4px;font-size:16px;line-height:20px;min-height:40px;color:var(--rc-color-error)}input.svelte-favd20.svelte-favd20{width:100%;box-sizing:border-box;padding:8px;border:2px solid var(--rc-color-grey-ui-dark);border-radius:12px;font-size:16px;height:48px;padding:6px 14px}input.svelte-favd20.svelte-favd20:focus{outline:none;border:2px solid var(--rc-color-focus)}");
 }
-function Ii(t) {
+function bi(t) {
   let e;
   return {
     c() {
@@ -3068,7 +3072,7 @@ function at(t) {
     }
   };
 }
-function bi(t) {
+function wi(t) {
   let e, r, n, i, o, s, l, c, a, f = (
     /*error*/
     t[2] && at(t)
@@ -3079,7 +3083,7 @@ function bi(t) {
       t[4] + " svelte-favd20"), _(e, "class", "form-container svelte-favd20");
     },
     m(d, E) {
-      p(d, e, E), D(e, r), D(e, n), D(e, i), D(i, o), et(
+      p(d, e, E), D(e, r), D(e, n), D(e, i), D(i, o), nt(
         o,
         /*email*/
         t[3]
@@ -3093,7 +3097,7 @@ function bi(t) {
     p(d, E) {
       E & /*email*/
       8 && o.value !== /*email*/
-      d[3] && et(
+      d[3] && nt(
         o,
         /*email*/
         d[3]
@@ -3107,7 +3111,7 @@ function bi(t) {
     }
   };
 }
-function wi(t) {
+function ki(t) {
   let e;
   return {
     c() {
@@ -3116,14 +3120,14 @@ function wi(t) {
     m(r, n) {
       p(r, e, n);
     },
-    i: B,
-    o: B,
+    i: y,
+    o: y,
     d(r) {
       r && g(e);
     }
   };
 }
-function ki(t) {
+function $i(t) {
   let e, r;
   return e = new Tt({}), {
     c() {
@@ -3143,9 +3147,9 @@ function ki(t) {
     }
   };
 }
-function $i(t) {
+function vi(t) {
   let e, r, n, i;
-  const o = [ki, wi], s = [];
+  const o = [$i, ki], s = [];
   function l(c, a) {
     return (
       /*processing*/
@@ -3176,7 +3180,7 @@ function $i(t) {
     }
   };
 }
-function vi(t) {
+function yi(t) {
   let e;
   return {
     c() {
@@ -3198,7 +3202,7 @@ function Bi(t) {
         /*processing*/
         t[1]
       ),
-      $$slots: { default: [$i] },
+      $$slots: { default: [vi] },
       $$scope: { ctx: t }
     }
   }), n = new we({
@@ -3208,7 +3212,7 @@ function Bi(t) {
         /*processing*/
         t[1]
       ),
-      $$slots: { default: [vi] },
+      $$slots: { default: [yi] },
       $$scope: { ctx: t }
     }
   }), n.$on("click", function() {
@@ -3247,7 +3251,7 @@ function Bi(t) {
     }
   };
 }
-function yi(t) {
+function Di(t) {
   let e, r;
   return e = new ve({
     props: {
@@ -3277,21 +3281,21 @@ function yi(t) {
     }
   };
 }
-function Di(t) {
+function Ci(t) {
   let e, r, n, i, o, s, l, c, a;
-  return r = new Ve({
+  return r = new We({
     props: {
-      $$slots: { default: [Ii] },
+      $$slots: { default: [bi] },
       $$scope: { ctx: t }
     }
   }), i = new ue({
     props: {
-      $$slots: { default: [bi] },
+      $$slots: { default: [wi] },
       $$scope: { ctx: t }
     }
-  }), s = new Je({
+  }), s = new Ve({
     props: {
-      $$slots: { default: [yi] },
+      $$slots: { default: [Di] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3326,7 +3330,7 @@ function Di(t) {
     }
   };
 }
-function Ci(t, e, r) {
+function Mi(t, e, r) {
   let n, i, o, { onContinue: s } = e, { onClose: l } = e, { processing: c } = e;
   const a = async () => {
     n.trim() === "" ? r(2, i = "You need to provide your email address to continue.") : s({ email: n });
@@ -3350,15 +3354,15 @@ function Ci(t, e, r) {
     f
   ];
 }
-class Mi extends U {
+class Qi extends U {
   constructor(e) {
-    super(), N(this, e, Ci, Di, P, { onContinue: 6, onClose: 0, processing: 1 }, Ei);
+    super(), N(this, e, Mi, Ci, P, { onContinue: 6, onClose: 0, processing: 1 }, Ii);
   }
 }
-function Qi(t) {
+function Pi(t) {
   O(t, "svelte-17tslso", ".rcb-modal-backdrop.svelte-17tslso{position:fixed;top:0;left:0;right:0;min-width:100%;width:100vw;width:100dvw;min-height:100%;height:100vh;height:100dvh;background-color:rgba(40, 40, 40, 0.75);display:flex;flex-direction:column;justify-content:space-around;z-index:1000001}");
 }
-function Pi(t) {
+function Ti(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -3409,21 +3413,21 @@ function Pi(t) {
     }
   };
 }
-function Ti(t, e, r) {
+function Ni(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e;
   return t.$$set = (o) => {
     "$$scope" in o && r(0, i = o.$$scope);
   }, [i, n];
 }
-class Ni extends U {
+class Ui extends U {
   constructor(e) {
-    super(), N(this, e, Ti, Pi, P, {}, Qi);
+    super(), N(this, e, Ni, Ti, P, {}, Pi);
   }
 }
-function Ui(t) {
+function Ri(t) {
   O(t, "svelte-ioxu5d", ".rcb-modal-container.svelte-ioxu5d{width:100%}.rcb-modal-main.svelte-ioxu5d{box-sizing:border-box;border-radius:8px;background-color:var(--rc-color-white);color:var(--rc-color-grey-text-dark);min-height:460px;padding:40px;flex-direction:column;display:flex}.rcb-modal-dark.svelte-ioxu5d{background-color:var(--rc-color-grey-text-dark);color:var(--rc-color-white);min-height:0px}@media screen and (max-width: 960px){.rcb-modal-container.svelte-ioxu5d{width:calc(100% - 32px);min-width:300px;max-width:640px;margin:auto}.rcb-modal-main.svelte-ioxu5d,.rcb-modal-dark.svelte-ioxu5d{min-width:300px;max-width:640px;padding:32px}}");
 }
-function Ri(t) {
+function Si(t) {
   let e, r, n, i;
   const o = (
     /*#slots*/
@@ -3477,18 +3481,18 @@ function Ri(t) {
     }
   };
 }
-function Si(t, e, r) {
+function Oi(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { dark: o = !1 } = e;
   return t.$$set = (s) => {
     "dark" in s && r(0, o = s.dark), "$$scope" in s && r(1, i = s.$$scope);
   }, [o, i, n];
 }
-class Oi extends U {
+class Li extends U {
   constructor(e) {
-    super(), N(this, e, Si, Ri, P, { dark: 0 }, Ui);
+    super(), N(this, e, Oi, Si, P, { dark: 0 }, Ri);
   }
 }
-function Li(t) {
+function xi(t) {
   let e;
   const r = (
     /*#slots*/
@@ -3539,11 +3543,11 @@ function Li(t) {
     }
   };
 }
-function xi(t) {
+function Fi(t) {
   let e, r;
-  return e = new Ni({
+  return e = new Ui({
     props: {
-      $$slots: { default: [Fi] },
+      $$slots: { default: [Gi] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3569,7 +3573,7 @@ function xi(t) {
     }
   };
 }
-function Fi(t) {
+function Gi(t) {
   let e;
   const r = (
     /*#slots*/
@@ -3620,9 +3624,9 @@ function Fi(t) {
     }
   };
 }
-function Gi(t) {
+function Yi(t) {
   let e, r, n, i;
-  const o = [xi, Li], s = [];
+  const o = [Fi, xi], s = [];
   function l(c, a) {
     return (
       /*condition*/
@@ -3653,19 +3657,19 @@ function Gi(t) {
     }
   };
 }
-function Yi(t, e, r) {
+function Hi(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { condition: o = !1 } = e;
   return t.$$set = (s) => {
     "condition" in s && r(0, o = s.condition), "$$scope" in s && r(2, i = s.$$scope);
   }, [o, n, i];
 }
-class Hi extends U {
+class Ki extends U {
   constructor(e) {
-    super(), N(this, e, Yi, Gi, P, { condition: 0 });
+    super(), N(this, e, Hi, Yi, P, { condition: 0 });
   }
 }
-const Ki = (t) => ({}), ut = (t) => ({});
-function qi(t) {
+const qi = (t) => ({}), ut = (t) => ({});
+function ji(t) {
   let e, r;
   const n = (
     /*#slots*/
@@ -3706,7 +3710,7 @@ function qi(t) {
           /*$$scope*/
           l[2],
           c,
-          Ki
+          qi
         ) : q(
           /*$$scope*/
           l[2]
@@ -3743,15 +3747,15 @@ function qi(t) {
     }
   };
 }
-function ji(t) {
+function Ji(t) {
   let e, r;
-  return e = new Oi({
+  return e = new Li({
     props: {
       dark: (
         /*dark*/
         t[0]
       ),
-      $$slots: { default: [qi] },
+      $$slots: { default: [ji] },
       $$scope: { ctx: t }
     }
   }), {
@@ -3779,7 +3783,7 @@ function ji(t) {
     }
   };
 }
-function Ji(t, e, r) {
+function Vi(t, e, r) {
   let { $$slots: n = {}, $$scope: i } = e, { dark: o = !1 } = e;
   return t.$$set = (s) => {
     "dark" in s && r(0, o = s.dark), "$$scope" in s && r(2, i = s.$$scope);
@@ -3787,7 +3791,7 @@ function Ji(t, e, r) {
 }
 class Nt extends U {
   constructor(e) {
-    super(), N(this, e, Ji, ji, P, { dark: 0 });
+    super(), N(this, e, Vi, Ji, P, { dark: 0 });
   }
 }
 var te = /* @__PURE__ */ ((t) => (t[t.UnknownError = 0] = "UnknownError", t[t.UserCancelledError = 1] = "UserCancelledError", t[t.StoreProblemError = 2] = "StoreProblemError", t[t.PurchaseNotAllowedError = 3] = "PurchaseNotAllowedError", t[t.PurchaseInvalidError = 4] = "PurchaseInvalidError", t[t.ProductNotAvailableForPurchaseError = 5] = "ProductNotAvailableForPurchaseError", t[t.ProductAlreadyPurchasedError = 6] = "ProductAlreadyPurchasedError", t[t.ReceiptAlreadyInUseError = 7] = "ReceiptAlreadyInUseError", t[t.InvalidReceiptError = 8] = "InvalidReceiptError", t[t.MissingReceiptFileError = 9] = "MissingReceiptFileError", t[t.NetworkError = 10] = "NetworkError", t[t.InvalidCredentialsError = 11] = "InvalidCredentialsError", t[t.UnexpectedBackendResponseError = 12] = "UnexpectedBackendResponseError", t[t.InvalidAppUserIdError = 14] = "InvalidAppUserIdError", t[t.OperationAlreadyInProgressError = 15] = "OperationAlreadyInProgressError", t[t.UnknownBackendError = 16] = "UnknownBackendError", t[t.InvalidAppleSubscriptionKeyError = 17] = "InvalidAppleSubscriptionKeyError", t[t.IneligibleError = 18] = "IneligibleError", t[t.InsufficientPermissionsError = 19] = "InsufficientPermissionsError", t[t.PaymentPendingError = 20] = "PaymentPendingError", t[t.InvalidSubscriberAttributesError = 21] = "InvalidSubscriberAttributesError", t[t.LogOutWithAnonymousUserError = 22] = "LogOutWithAnonymousUserError", t[t.ConfigurationError = 23] = "ConfigurationError", t[t.UnsupportedError = 24] = "UnsupportedError", t[t.EmptySubscriberAttributesError = 25] = "EmptySubscriberAttributesError", t[t.CustomerInfoError = 28] = "CustomerInfoError", t[t.SignatureVerificationError = 36] = "SignatureVerificationError", t))(te || {});
@@ -3935,27 +3939,27 @@ class X extends Error {
     );
   }
 }
-class Vi extends Error {
+class Wi extends Error {
   constructor() {
     super("Purchases must be configured before calling getInstance");
   }
 }
-const Wi = "0.1.3", fe = "https://api.revenuecat.com";
+const zi = "0.2.0", fe = "https://api.revenuecat.com";
 var Ue;
 (function(t) {
   t[t.CONTINUE = 100] = "CONTINUE", t[t.SWITCHING_PROTOCOLS = 101] = "SWITCHING_PROTOCOLS", t[t.PROCESSING = 102] = "PROCESSING", t[t.EARLY_HINTS = 103] = "EARLY_HINTS", t[t.OK = 200] = "OK", t[t.CREATED = 201] = "CREATED", t[t.ACCEPTED = 202] = "ACCEPTED", t[t.NON_AUTHORITATIVE_INFORMATION = 203] = "NON_AUTHORITATIVE_INFORMATION", t[t.NO_CONTENT = 204] = "NO_CONTENT", t[t.RESET_CONTENT = 205] = "RESET_CONTENT", t[t.PARTIAL_CONTENT = 206] = "PARTIAL_CONTENT", t[t.MULTI_STATUS = 207] = "MULTI_STATUS", t[t.MULTIPLE_CHOICES = 300] = "MULTIPLE_CHOICES", t[t.MOVED_PERMANENTLY = 301] = "MOVED_PERMANENTLY", t[t.MOVED_TEMPORARILY = 302] = "MOVED_TEMPORARILY", t[t.SEE_OTHER = 303] = "SEE_OTHER", t[t.NOT_MODIFIED = 304] = "NOT_MODIFIED", t[t.USE_PROXY = 305] = "USE_PROXY", t[t.TEMPORARY_REDIRECT = 307] = "TEMPORARY_REDIRECT", t[t.PERMANENT_REDIRECT = 308] = "PERMANENT_REDIRECT", t[t.BAD_REQUEST = 400] = "BAD_REQUEST", t[t.UNAUTHORIZED = 401] = "UNAUTHORIZED", t[t.PAYMENT_REQUIRED = 402] = "PAYMENT_REQUIRED", t[t.FORBIDDEN = 403] = "FORBIDDEN", t[t.NOT_FOUND = 404] = "NOT_FOUND", t[t.METHOD_NOT_ALLOWED = 405] = "METHOD_NOT_ALLOWED", t[t.NOT_ACCEPTABLE = 406] = "NOT_ACCEPTABLE", t[t.PROXY_AUTHENTICATION_REQUIRED = 407] = "PROXY_AUTHENTICATION_REQUIRED", t[t.REQUEST_TIMEOUT = 408] = "REQUEST_TIMEOUT", t[t.CONFLICT = 409] = "CONFLICT", t[t.GONE = 410] = "GONE", t[t.LENGTH_REQUIRED = 411] = "LENGTH_REQUIRED", t[t.PRECONDITION_FAILED = 412] = "PRECONDITION_FAILED", t[t.REQUEST_TOO_LONG = 413] = "REQUEST_TOO_LONG", t[t.REQUEST_URI_TOO_LONG = 414] = "REQUEST_URI_TOO_LONG", t[t.UNSUPPORTED_MEDIA_TYPE = 415] = "UNSUPPORTED_MEDIA_TYPE", t[t.REQUESTED_RANGE_NOT_SATISFIABLE = 416] = "REQUESTED_RANGE_NOT_SATISFIABLE", t[t.EXPECTATION_FAILED = 417] = "EXPECTATION_FAILED", t[t.IM_A_TEAPOT = 418] = "IM_A_TEAPOT", t[t.INSUFFICIENT_SPACE_ON_RESOURCE = 419] = "INSUFFICIENT_SPACE_ON_RESOURCE", t[t.METHOD_FAILURE = 420] = "METHOD_FAILURE", t[t.MISDIRECTED_REQUEST = 421] = "MISDIRECTED_REQUEST", t[t.UNPROCESSABLE_ENTITY = 422] = "UNPROCESSABLE_ENTITY", t[t.LOCKED = 423] = "LOCKED", t[t.FAILED_DEPENDENCY = 424] = "FAILED_DEPENDENCY", t[t.UPGRADE_REQUIRED = 426] = "UPGRADE_REQUIRED", t[t.PRECONDITION_REQUIRED = 428] = "PRECONDITION_REQUIRED", t[t.TOO_MANY_REQUESTS = 429] = "TOO_MANY_REQUESTS", t[t.REQUEST_HEADER_FIELDS_TOO_LARGE = 431] = "REQUEST_HEADER_FIELDS_TOO_LARGE", t[t.UNAVAILABLE_FOR_LEGAL_REASONS = 451] = "UNAVAILABLE_FOR_LEGAL_REASONS", t[t.INTERNAL_SERVER_ERROR = 500] = "INTERNAL_SERVER_ERROR", t[t.NOT_IMPLEMENTED = 501] = "NOT_IMPLEMENTED", t[t.BAD_GATEWAY = 502] = "BAD_GATEWAY", t[t.SERVICE_UNAVAILABLE = 503] = "SERVICE_UNAVAILABLE", t[t.GATEWAY_TIMEOUT = 504] = "GATEWAY_TIMEOUT", t[t.HTTP_VERSION_NOT_SUPPORTED = 505] = "HTTP_VERSION_NOT_SUPPORTED", t[t.INSUFFICIENT_STORAGE = 507] = "INSUFFICIENT_STORAGE", t[t.NETWORK_AUTHENTICATION_REQUIRED = 511] = "NETWORK_AUTHENTICATION_REQUIRED";
 })(Ue || (Ue = {}));
-function qe(t) {
+function je(t) {
   return t ? t.startsWith("rcb_sb_") : !1;
 }
 async function se(t, e, r, n) {
   try {
     const i = await fetch(t.url(), {
       method: t.method,
-      headers: Zi(e, n),
-      body: Xi(r)
+      headers: eo(e, n),
+      body: Zi(r)
     });
-    return await zi(i, t), await i.json();
+    return await Xi(i, t), await i.json();
   } catch (i) {
     throw i instanceof TypeError ? new X(
       te.NetworkError,
@@ -3964,7 +3968,7 @@ async function se(t, e, r, n) {
     ) : i;
   }
 }
-async function zi(t, e) {
+async function Xi(t, e) {
   const r = t.status;
   if (r >= Ue.INTERNAL_SERVER_ERROR)
     Ge(e, r, await t.text());
@@ -3989,22 +3993,22 @@ function Ge(t, e, r) {
     `Unknown backend error. Request: ${t.name}. Status code: ${e}. Body: ${r}.`
   );
 }
-function Xi(t) {
+function Zi(t) {
   return t == null ? null : JSON.stringify(t);
 }
-function Zi(t, e) {
+function eo(t, e) {
   let r = {
     Authorization: `Bearer ${t}`,
     "Content-Type": "application/json",
     Accept: "application/json",
     "X-Platform": "web",
-    "X-Version": Wi,
-    "X-Is-Sandbox": `${qe(t)}`
+    "X-Version": zi,
+    "X-Is-Sandbox": `${je(t)}`
   };
   return e != null && (r = { ...r, ...e }), r;
 }
 const Rt = "/v1/subscribers", Oe = "/rcbilling/v1";
-class eo {
+class to {
   constructor(e) {
     Q(this, "appUserId");
     Q(this, "method", "GET");
@@ -4016,7 +4020,7 @@ class eo {
     return `${fe}${Rt}/${e}/offerings`;
   }
 }
-class to {
+class no {
   constructor() {
     Q(this, "method", "POST");
     Q(this, "name", "subscribe");
@@ -4025,7 +4029,7 @@ class to {
     return `${fe}${Oe}/subscribe`;
   }
 }
-class no {
+class ro {
   constructor(e, r) {
     Q(this, "method", "GET");
     Q(this, "name", "getProducts");
@@ -4038,7 +4042,7 @@ class no {
     return `${fe}${Oe}/subscribers/${e}/products?id=${r}`;
   }
 }
-class ro {
+class io {
   constructor(e) {
     Q(this, "method", "GET");
     Q(this, "name", "getCustomerInfo");
@@ -4050,7 +4054,7 @@ class ro {
     return `${fe}${Rt}/${e}`;
   }
 }
-class io {
+class oo {
   constructor() {
     Q(this, "method", "GET");
     Q(this, "name", "getBrandingInfo");
@@ -4059,7 +4063,7 @@ class io {
     return `${fe}${Oe}/branding`;
   }
 }
-class oo {
+class so {
   constructor(e) {
     Q(this, "method", "GET");
     Q(this, "name", "getCheckoutStatus");
@@ -4070,38 +4074,38 @@ class oo {
     return `${fe}${Oe}/checkout/${this.operationSessionId}`;
   }
 }
-class so {
+class lo {
   constructor(e) {
     Q(this, "API_KEY");
     this.API_KEY = e;
   }
   async getOfferings(e) {
     return await se(
-      new eo(e),
+      new to(e),
       this.API_KEY
     );
   }
   async getCustomerInfo(e) {
     return await se(
-      new ro(e),
+      new io(e),
       this.API_KEY
     );
   }
   async getProducts(e, r) {
     return await se(
-      new no(e, r),
+      new ro(e, r),
       this.API_KEY
     );
   }
   async getBrandingInfo() {
     return await se(
-      new io(),
+      new oo(),
       this.API_KEY
     );
   }
   async postSubscribe(e, r, n, i) {
     return await se(
-      new to(),
+      new no(),
       this.API_KEY,
       {
         app_user_id: e,
@@ -4113,38 +4117,38 @@ class so {
   }
   async getCheckoutStatus(e) {
     return await se(
-      new oo(e),
+      new so(e),
       this.API_KEY
     );
   }
 }
-const lo = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20opacity='0.5'%20clip-path='url(%23clip0_344_3390)'%3e%3cpath%20d='M7%2018C5.9%2018%205.01%2018.9%205.01%2020C5.01%2021.1%205.9%2022%207%2022C8.1%2022%209%2021.1%209%2020C9%2018.9%208.1%2018%207%2018ZM1%202V4H3L6.6%2011.59L5.25%2014.04C5.09%2014.32%205%2014.65%205%2015C5%2016.1%205.9%2017%207%2017H19V15H7.42C7.28%2015%207.17%2014.89%207.17%2014.75L7.2%2014.63L8.1%2013H15.55C16.3%2013%2016.96%2012.59%2017.3%2011.97L20.88%205.48C20.96%205.34%2021%205.17%2021%205C21%204.45%2020.55%204%2020%204H5.21L4.27%202H1ZM17%2018C15.9%2018%2015.01%2018.9%2015.01%2020C15.01%2021.1%2015.9%2022%2017%2022C18.1%2022%2019%2021.1%2019%2020C19%2018.9%2018.1%2018%2017%2018Z'%20fill='white'/%3e%3c/g%3e%3cdefs%3e%3cclipPath%20id='clip0_344_3390'%3e%3crect%20width='24'%20height='24'%20fill='white'/%3e%3c/clipPath%3e%3c/defs%3e%3c/svg%3e";
-function co(t) {
+const co = "data:image/svg+xml,%3csvg%20width='24'%20height='24'%20viewBox='0%200%2024%2024'%20fill='none'%20xmlns='http://www.w3.org/2000/svg'%3e%3cg%20opacity='0.5'%20clip-path='url(%23clip0_344_3390)'%3e%3cpath%20d='M7%2018C5.9%2018%205.01%2018.9%205.01%2020C5.01%2021.1%205.9%2022%207%2022C8.1%2022%209%2021.1%209%2020C9%2018.9%208.1%2018%207%2018ZM1%202V4H3L6.6%2011.59L5.25%2014.04C5.09%2014.32%205%2014.65%205%2015C5%2016.1%205.9%2017%207%2017H19V15H7.42C7.28%2015%207.17%2014.89%207.17%2014.75L7.2%2014.63L8.1%2013H15.55C16.3%2013%2016.96%2012.59%2017.3%2011.97L20.88%205.48C20.96%205.34%2021%205.17%2021%205C21%204.45%2020.55%204%2020%204H5.21L4.27%202H1ZM17%2018C15.9%2018%2015.01%2018.9%2015.01%2020C15.01%2021.1%2015.9%2022%2017%2022C18.1%2022%2019%2021.1%2019%2020C19%2018.9%2018.1%2018%2017%2018Z'%20fill='white'/%3e%3c/g%3e%3cdefs%3e%3cclipPath%20id='clip0_344_3390'%3e%3crect%20width='24'%20height='24'%20fill='white'/%3e%3c/clipPath%3e%3c/defs%3e%3c/svg%3e";
+function ao(t) {
   let e, r;
   return {
     c() {
-      e = k("img"), Z(e.src, r = lo) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
+      e = k("img"), Z(e.src, r = co) || _(e, "src", r), _(e, "alt", "icon"), _(e, "class", "rcb-ui-asset-icon");
     },
     m(n, i) {
       p(n, e, i);
     },
-    p: B,
-    i: B,
-    o: B,
+    p: y,
+    i: y,
+    o: y,
     d(n) {
       n && g(e);
     }
   };
 }
-class ao extends U {
+class uo extends U {
   constructor(e) {
-    super(), N(this, e, null, co, P, {});
+    super(), N(this, e, null, ao, P, {});
   }
 }
-function uo(t) {
+function fo(t) {
   O(t, "svelte-1rhrjxe", "div.svelte-1rhrjxe{background-color:var(--rc-color-warning);color:var(--rc-color-grey-text-dark);font-size:10px;font-weight:bold;text-transform:uppercase;padding:4px 10px;line-height:10px;border-radius:9px;margin:0px;margin-left:16px}");
 }
-function fo(t) {
+function mo(t) {
   let e;
   return {
     c() {
@@ -4153,20 +4157,20 @@ function fo(t) {
     m(r, n) {
       p(r, e, n);
     },
-    p: B,
-    i: B,
-    o: B,
+    p: y,
+    i: y,
+    o: y,
     d(r) {
       r && g(e);
     }
   };
 }
-class mo extends U {
+class go extends U {
   constructor(e) {
-    super(), N(this, e, null, fo, P, {}, uo);
+    super(), N(this, e, null, mo, P, {}, fo);
   }
 }
-function go(t) {
+function po(t) {
   O(t, "svelte-13pdaik", `.rcb-ui-container.svelte-13pdaik{color-scheme:none;font-size:16px;line-height:1.5em;font-weight:400;font-family:-apple-system, "system-ui", "Segoe UI", Roboto, Oxygen, Ubuntu,
       Cantarell, "Open Sans", "Helvetica Neue", sans-serif}.rcb-ui-layout.svelte-13pdaik{width:100vw;width:100dvw;margin-right:auto;display:flex;justify-content:center;align-items:flex-start;position:relative;padding:0px 80px;box-sizing:border-box}.rcb-ui-aside.svelte-13pdaik{margin-right:16px;flex:320px 1 0;max-width:480px}.rcb-ui-main.svelte-13pdaik{flex:480px 1 0;max-width:640px}@media screen and (max-width: 960px){.rcb-ui-layout.svelte-13pdaik{flex-direction:column;align-items:center;justify-content:center;height:100%;min-width:100%}.rcb-ui-aside.svelte-13pdaik{margin-right:0;margin-bottom:16px;min-width:100%;display:flex;flex-direction:column;align-items:center;flex:none;max-width:none}.rcb-ui-main.svelte-13pdaik{flex:none;max-width:none;min-width:100%}}@media screen and (max-width: 960px) and (max-height: 960px){.rcb-ui-layout.svelte-13pdaik{overflow-y:scroll;justify-content:flex-start;padding:16px 0px}}`);
 }
@@ -4176,8 +4180,8 @@ function ft(t) {
     props: {
       dark: !0,
       $$slots: {
-        header: [Eo],
-        default: [po]
+        header: [Io],
+        default: [_o]
       },
       $$scope: { ctx: t }
     }
@@ -4206,7 +4210,7 @@ function ft(t) {
 }
 function dt(t) {
   let e, r;
-  return e = new Bt({
+  return e = new yt({
     props: {
       productDetails: (
         /*productDetails*/
@@ -4237,7 +4241,7 @@ function dt(t) {
     }
   };
 }
-function po(t) {
+function _o(t) {
   let e, r, n = (
     /*productDetails*/
     t[2] && dt(t)
@@ -4267,9 +4271,9 @@ function po(t) {
     }
   };
 }
-function _o(t) {
+function Ao(t) {
   let e, r;
-  return e = new ao({}), {
+  return e = new uo({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -4287,9 +4291,9 @@ function _o(t) {
     }
   };
 }
-function Ao(t) {
+function ho(t) {
   let e, r;
-  return e = new mo({}), {
+  return e = new go({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -4307,7 +4311,7 @@ function Ao(t) {
     }
   };
 }
-function ho(t) {
+function Eo(t) {
   let e, r, n, i, o, s, l;
   e = new Dt({
     props: { brandingInfo: (
@@ -4315,7 +4319,7 @@ function ho(t) {
       t[3]
     ) }
   });
-  const c = [Ao, _o], a = [];
+  const c = [ho, Ao], a = [];
   function f(d, E) {
     return E & /*purchases*/
     2 && (n = null), n == null && (n = !!/*purchases*/
@@ -4349,12 +4353,12 @@ function ho(t) {
     }
   };
 }
-function Eo(t) {
+function Io(t) {
   let e, r;
-  return e = new Ve({
+  return e = new We({
     props: {
       slot: "header",
-      $$slots: { default: [ho] },
+      $$slots: { default: [Eo] },
       $$scope: { ctx: t }
     }
   }), {
@@ -4382,7 +4386,7 @@ function Eo(t) {
 }
 function mt(t) {
   let e, r;
-  return e = new Bt({
+  return e = new yt({
     props: {
       productDetails: (
         /*productDetails*/
@@ -4415,7 +4419,7 @@ function mt(t) {
 }
 function gt(t) {
   let e, r;
-  return e = new je({}), {
+  return e = new Je({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -4435,7 +4439,7 @@ function gt(t) {
 }
 function pt(t) {
   let e, r;
-  return e = new Mi({
+  return e = new Qi({
     props: {
       onContinue: (
         /*handleContinue*/
@@ -4476,7 +4480,7 @@ function pt(t) {
 }
 function _t(t) {
   let e, r;
-  return e = new hi({
+  return e = new Ei({
     props: {
       paymentInfoCollectionMetadata: (
         /*paymentInfoCollectionMetadata*/
@@ -4527,7 +4531,7 @@ function _t(t) {
 }
 function At(t) {
   let e, r;
-  return e = new je({}), {
+  return e = new Je({}), {
     c() {
       w(e.$$.fragment);
     },
@@ -4548,7 +4552,7 @@ function At(t) {
 function ht(t) {
   var n;
   let e, r;
-  return e = new wr({
+  return e = new kr({
     props: {
       brandingInfo: (
         /*brandingInfo*/
@@ -4598,7 +4602,7 @@ function ht(t) {
 }
 function Et(t) {
   let e, r;
-  return e = new Qr({
+  return e = new Pr({
     props: {
       brandingInfo: (
         /*brandingInfo*/
@@ -4633,7 +4637,7 @@ function Et(t) {
     }
   };
 }
-function Io(t) {
+function bo(t) {
   let e, r, n, i, o, s, l, c, a = (
     /*state*/
     t[6] === "present-offer" && /*productDetails*/
@@ -4665,41 +4669,41 @@ function Io(t) {
     c() {
       a && a.c(), e = T(), f && f.c(), r = T(), d && d.c(), n = T(), E && E.c(), i = T(), v && v.c(), o = T(), A && A.c(), s = T(), M && M.c(), l = ee();
     },
-    m(h, y) {
-      a && a.m(h, y), p(h, e, y), f && f.m(h, y), p(h, r, y), d && d.m(h, y), p(h, n, y), E && E.m(h, y), p(h, i, y), v && v.m(h, y), p(h, o, y), A && A.m(h, y), p(h, s, y), M && M.m(h, y), p(h, l, y), c = !0;
+    m(h, B) {
+      a && a.m(h, B), p(h, e, B), f && f.m(h, B), p(h, r, B), d && d.m(h, B), p(h, n, B), E && E.m(h, B), p(h, i, B), v && v.m(h, B), p(h, o, B), A && A.m(h, B), p(h, s, B), M && M.m(h, B), p(h, l, B), c = !0;
     },
-    p(h, y) {
+    p(h, B) {
       /*state*/
       h[6] === "present-offer" && /*productDetails*/
-      h[2] ? a ? (a.p(h, y), y & /*state, productDetails*/
+      h[2] ? a ? (a.p(h, B), B & /*state, productDetails*/
       68 && u(a, 1)) : (a = mt(h), a.c(), u(a, 1), a.m(e.parentNode, e)) : a && (L(), m(a, 1, 1, () => {
         a = null;
       }), x()), /*state*/
       h[6] === "present-offer" && !/*productDetails*/
-      h[2] ? f ? y & /*state, productDetails*/
+      h[2] ? f ? B & /*state, productDetails*/
       68 && u(f, 1) : (f = gt(), f.c(), u(f, 1), f.m(r.parentNode, r)) : f && (L(), m(f, 1, 1, () => {
         f = null;
       }), x()), /*state*/
       h[6] === "needs-auth-info" || /*state*/
-      h[6] === "processing-auth-info" ? d ? (d.p(h, y), y & /*state*/
+      h[6] === "processing-auth-info" ? d ? (d.p(h, B), B & /*state*/
       64 && u(d, 1)) : (d = pt(h), d.c(), u(d, 1), d.m(n.parentNode, n)) : d && (L(), m(d, 1, 1, () => {
         d = null;
       }), x()), /*paymentInfoCollectionMetadata*/
       h[4] && /*state*/
       (h[6] === "needs-payment-info" || /*state*/
-      h[6] === "polling-purchase-status") ? E ? (E.p(h, y), y & /*paymentInfoCollectionMetadata, state*/
+      h[6] === "polling-purchase-status") ? E ? (E.p(h, B), B & /*paymentInfoCollectionMetadata, state*/
       80 && u(E, 1)) : (E = _t(h), E.c(), u(E, 1), E.m(i.parentNode, i)) : E && (L(), m(E, 1, 1, () => {
         E = null;
       }), x()), /*state*/
-      h[6] === "loading" ? v ? y & /*state*/
+      h[6] === "loading" ? v ? B & /*state*/
       64 && u(v, 1) : (v = At(), v.c(), u(v, 1), v.m(o.parentNode, o)) : v && (L(), m(v, 1, 1, () => {
         v = null;
       }), x()), /*state*/
-      h[6] === "error" ? A ? (A.p(h, y), y & /*state*/
+      h[6] === "error" ? A ? (A.p(h, B), B & /*state*/
       64 && u(A, 1)) : (A = ht(h), A.c(), u(A, 1), A.m(s.parentNode, s)) : A && (L(), m(A, 1, 1, () => {
         A = null;
       }), x()), /*state*/
-      h[6] === "success" ? M ? (M.p(h, y), y & /*state*/
+      h[6] === "success" ? M ? (M.p(h, B), B & /*state*/
       64 && u(M, 1)) : (M = Et(h), M.c(), u(M, 1), M.m(l.parentNode, l)) : M && (L(), m(M, 1, 1, () => {
         M = null;
       }), x());
@@ -4715,7 +4719,7 @@ function Io(t) {
     }
   };
 }
-function bo(t) {
+function wo(t) {
   let e, r = (
     /*statesWhereOfferDetailsAreShown*/
     t[8].includes(
@@ -4725,7 +4729,7 @@ function bo(t) {
   ), n, i, o, s, l = r && ft(t);
   return o = new Nt({
     props: {
-      $$slots: { default: [Io] },
+      $$slots: { default: [bo] },
       $$scope: { ctx: t }
     }
   }), {
@@ -4765,15 +4769,15 @@ function bo(t) {
     }
   };
 }
-function wo(t) {
+function ko(t) {
   let e, r, n;
-  return r = new Hi({
+  return r = new Ki({
     props: {
       condition: (
         /*asModal*/
         t[0]
       ),
-      $$slots: { default: [bo] },
+      $$slots: { default: [wo] },
       $$scope: { ctx: t }
     }
   }), {
@@ -4801,12 +4805,12 @@ function wo(t) {
     }
   };
 }
-function ko(t, e, r) {
-  var We;
+function $o(t, e, r) {
+  var ze;
   let { asModal: n = !0 } = e, { customerEmail: i } = e, { appUserId: o } = e, { rcPackage: s } = e, { onFinished: l } = e, { onError: c } = e, { onClose: a } = e, { purchases: f } = e, { backend: d } = e, { purchaseOperationHelper: E } = e;
   const v = Object.entries(Ae).map(([C, Le]) => `--rc-color-${C}: ${Le}`).join("; ");
-  let A = null, M = null, h = null, y = null;
-  const F = ((We = s.rcBillingProduct) == null ? void 0 : We.identifier) ?? null;
+  let A = null, M = null, h = null, B = null;
+  const F = ((ze = s.rcBillingProduct) == null ? void 0 : ze.identifier) ?? null;
   let $ = "present-offer";
   const de = [
     "present-offer",
@@ -4822,7 +4826,7 @@ function ko(t, e, r) {
       return;
     }
   });
-  const Be = () => {
+  const ye = () => {
     a();
   }, ie = () => {
     if (F === null) {
@@ -4865,9 +4869,9 @@ function ko(t, e, r) {
     }
     r(6, $ = "success");
   }, W = (C) => {
-    r(5, y = C), r(6, $ = "error");
+    r(5, B = C), r(6, $ = "error");
   }, St = () => {
-    c(y ?? new G(S.UnknownError, "Unknown error without state set."));
+    c(B ?? new G(S.UnknownError, "Unknown error without state set."));
   };
   return t.$$set = (C) => {
     "asModal" in C && r(0, n = C.asModal), "customerEmail" in C && r(13, i = C.customerEmail), "appUserId" in C && r(14, o = C.appUserId), "rcPackage" in C && r(15, s = C.rcPackage), "onFinished" in C && r(16, l = C.onFinished), "onError" in C && r(17, c = C.onError), "onClose" in C && r(18, a = C.onClose), "purchases" in C && r(1, f = C.purchases), "backend" in C && r(19, d = C.backend), "purchaseOperationHelper" in C && r(20, E = C.purchaseOperationHelper);
@@ -4877,11 +4881,11 @@ function ko(t, e, r) {
     A,
     M,
     h,
-    y,
+    B,
     $,
     v,
     de,
-    Be,
+    ye,
     z,
     W,
     St,
@@ -4895,13 +4899,13 @@ function ko(t, e, r) {
     E
   ];
 }
-class $o extends U {
+class vo extends U {
   constructor(e) {
     super(), N(
       this,
       e,
+      $o,
       ko,
-      wo,
       P,
       {
         asModal: 0,
@@ -4915,23 +4919,23 @@ class $o extends U {
         backend: 19,
         purchaseOperationHelper: 20
       },
-      go
+      po
     );
   }
 }
-function vo(t) {
+function yo(t) {
   return t.expires_date == null ? !0 : new Date(t.expires_date) > /* @__PURE__ */ new Date();
 }
 function Bo(t, e, r, n) {
   const i = e.product_identifier;
   if (i in r)
-    return yo(
+    return Do(
       t,
       e,
       r[i]
     );
   if (i in n)
-    return Do(
+    return Co(
       t,
       e,
       n[i]
@@ -4941,11 +4945,11 @@ function Bo(t, e, r, n) {
     "Could not find entitlement product in subscriptions or non-subscriptions."
   );
 }
-function yo(t, e, r) {
+function Do(t, e, r) {
   return {
     identifier: t,
-    isActive: vo(e),
-    willRenew: Qo(e, r),
+    isActive: yo(e),
+    willRenew: Po(e, r),
     store: (r == null ? void 0 : r.store) ?? "unknown",
     latestPurchaseDate: new Date(e.purchase_date),
     originalPurchaseDate: new Date(e.purchase_date),
@@ -4961,7 +4965,7 @@ function yo(t, e, r) {
     periodType: (r == null ? void 0 : r.period_type) ?? "normal"
   };
 }
-function Do(t, e, r) {
+function Co(t, e, r) {
   return {
     identifier: t,
     isActive: !0,
@@ -4979,7 +4983,7 @@ function Do(t, e, r) {
     periodType: "normal"
   };
 }
-function Co(t, e, r) {
+function Mo(t, e, r) {
   const n = {}, i = {};
   for (const o in t) {
     const s = Bo(
@@ -4998,22 +5002,22 @@ function Co(t, e, r) {
 function Te(t) {
   return t == null ? null : new Date(t);
 }
-function Mo(t) {
-  const e = To(t), r = t.subscriber, n = Uo(
+function Qo(t) {
+  const e = No(t), r = t.subscriber, n = Ro(
     r.non_subscriptions
   );
   return {
-    entitlements: Co(
+    entitlements: Mo(
       r.entitlements,
       r.subscriptions,
       n
     ),
     allExpirationDatesByProduct: e,
-    allPurchaseDatesByProduct: Po(
+    allPurchaseDatesByProduct: To(
       t,
       n
     ),
-    activeSubscriptions: No(e),
+    activeSubscriptions: Uo(e),
     managementURL: r.management_url,
     requestDate: new Date(t.request_date),
     firstSeenDate: new Date(r.first_seen),
@@ -5023,13 +5027,13 @@ function Mo(t) {
     originalAppUserId: t.subscriber.original_app_user_id
   };
 }
-function Qo(t, e) {
+function Po(t, e) {
   if (e == null)
     return !1;
   const r = e.store == "promotional", n = t.expires_date == null, i = e.unsubscribe_detected_at != null, o = e.billing_issues_detected_at != null;
   return !(r || n || i || o);
 }
-function Po(t, e) {
+function To(t, e) {
   const r = {};
   for (const n in t.subscriber.subscriptions) {
     const i = t.subscriber.subscriptions[n];
@@ -5043,7 +5047,7 @@ function Po(t, e) {
   }
   return r;
 }
-function To(t) {
+function No(t) {
   const e = {};
   for (const r in t.subscriber.subscriptions) {
     const n = t.subscriber.subscriptions[r];
@@ -5053,7 +5057,7 @@ function To(t) {
   }
   return e;
 }
-function No(t) {
+function Uo(t) {
   const e = /* @__PURE__ */ new Set(), r = /* @__PURE__ */ new Date();
   for (const n in t) {
     const i = t[n];
@@ -5061,7 +5065,7 @@ function No(t) {
   }
   return e;
 }
-function Uo(t) {
+function Ro(t) {
   const e = {};
   for (const r in t) {
     if (t[r].length === 0)
@@ -5071,14 +5075,14 @@ function Uo(t) {
   }
   return e;
 }
-function Ro(t) {
+function So(t) {
   if (!t.startsWith("rcb_"))
     throw new X(
       te.InvalidCredentialsError,
       "Invalid API key. Use your RevenueCat Billing API key."
     );
 }
-function So(t) {
+function Oo(t) {
   if ((/* @__PURE__ */ new Set([
     "no_user",
     "null",
@@ -5116,9 +5120,9 @@ const J = class J {
       r.product_details.forEach((l) => {
         i[l.identifier] = l;
       });
-      const o = n == null ? null : ze(n, i), s = {};
+      const o = n == null ? null : Ze(n, i), s = {};
       return e.offerings.forEach((l) => {
-        const c = ze(l, i);
+        const c = Ze(l, i);
         c != null && (s[l.identifier] = c);
       }), Object.keys(s).length == 0 && V.debugLog(
         "Empty offerings. Please make sure you've configured offerings correctly in the RevenueCat dashboard and that the products are properly configured."
@@ -5127,7 +5131,7 @@ const J = class J {
         current: o
       };
     });
-    this._API_KEY = e, this._appUserId = r, qe(e) && V.debugLog("Initializing Purchases SDK with sandbox API Key"), this.backend = new so(this._API_KEY), this.purchaseOperationHelper = new Dn(this.backend);
+    this._API_KEY = e, this._appUserId = r, je(e) && V.debugLog("Initializing Purchases SDK with sandbox API Key"), this.backend = new lo(this._API_KEY), this.purchaseOperationHelper = new Cn(this.backend);
   }
   /**
    * Set the log level. Logs of the given level and below will be printed
@@ -5146,7 +5150,7 @@ const J = class J {
   static getSharedInstance() {
     if (J.isConfigured())
       return J.instance;
-    throw new Vi();
+    throw new Wi();
   }
   /**
    * Returns whether the Purchases SDK is configured or not.
@@ -5165,7 +5169,7 @@ const J = class J {
   static configure(e, r) {
     return J.instance !== void 0 ? (V.warnLog(
       "Purchases is already initialized. Ignoring and returning existing instance."
-    ), J.getSharedInstance()) : (Ro(e), So(r), J.instance = new J(e, r), J.getSharedInstance());
+    ), J.getSharedInstance()) : (So(e), Oo(r), J.instance = new J(e, r), J.getSharedInstance());
   }
   /**
    * Fetch the configured offerings for this user. You can configure these
@@ -5215,7 +5219,7 @@ const J = class J {
     return V.debugLog(
       `Presenting purchase form for package ${e.identifier}`
     ), new Promise((c, a) => {
-      new $o({
+      new vo({
         target: o,
         props: {
           appUserId: l,
@@ -5281,7 +5285,7 @@ const J = class J {
    * @returns Whether the SDK is using a sandbox API Key.
    */
   isSandbox() {
-    return qe(this._API_KEY);
+    return je(this._API_KEY);
   }
   /**
    * Closes the Purchases instance. You should never have to do this normally.
@@ -5294,7 +5298,7 @@ const J = class J {
   /** @internal */
   async _getCustomerInfoForUserId(e) {
     const r = await this.backend.getCustomerInfo(e);
-    return Mo(r);
+    return Qo(r);
   }
 };
 /** @internal */
@@ -5303,8 +5307,8 @@ let It = J;
 export {
   te as ErrorCode,
   j as LogLevel,
-  Ft as PackageType,
+  Gt as PackageType,
   It as Purchases,
   X as PurchasesError,
-  Vi as UninitializedPurchasesError
+  Wi as UninitializedPurchasesError
 };