@remotex-labs/xmap 1.1.0 → 2.0.1

package/dist/index.js.map

@@ -1,7 +0,0 @@
-{
-  "version": 3,
-  "sources": ["../src/index.ts", "../src/components/parser.component.ts", "../src/components/base64.component.ts", "../src/components/formatter.component.ts", "../src/components/highlighter.component.ts", "../src/services/source.service.ts"],
-  "sourcesContent": ["// export components interfaces\nexport type * from '@components/interfaces/parse.interface';\nexport type * from '@components/interfaces/formatter.interface';\nexport type * from '@components/interfaces/highlighter.interface';\n\n// export services interfaces\nexport type * from '@services/interfaces/source.interface';\n\n// Export components\nexport * from '@components/parser.component';\nexport * from '@components/base64.component';\nexport * from '@components/formatter.component';\nexport * from '@components/highlighter.component';\n\n// export service\nexport * from '@services/source.service';\n", "/**\n * Import will remove at compile time\n */\n\nimport type { StackEntryInterface } from '@components/interfaces/parse.interface';\n\n/**\n * Parses an error stack trace and returns an object with a message and an array of stack entries.\n *\n * @param stackString - The error stack trace.\n * @returns The parsed stack trace object.\n */\n\nexport function parseErrorStack(stackString: string): Array<StackEntryInterface> {\n    const lines = stackString.split('\\n').slice(1);\n    const regex = /^\\s*at\\s+(.*?)\\s+\\((.*?):(\\d+):(\\d+)\\)$|^\\s*at\\s+(.*?):(\\d+):(\\d+)$/;\n    const evalRegex = /eval\\s+at\\s+([^\\s(]+).+\\((.+):(\\d+):(\\d+)\\),\\s(.+)/;\n    const stack: Array<StackEntryInterface> = [];\n\n    lines.forEach((line) => {\n        const match = line.match(regex);\n        if (!match) return;\n\n        let args: Array<string> = match.slice(1);\n        if(!match[2]) {\n            args = match.slice(4);\n        }\n\n        const [ at, file, lineNum, colNum ] = args;\n        const lineNumber = parseInt(lineNum, 10);\n        const columnNumber = parseInt(colNum, 10);\n\n        if (line.includes('eval')) {\n            const evalMatch = file.match(evalRegex)?.slice(1);\n            if (evalMatch) {\n                const [ evalAt, evalFile, evalLineNum, evalColNum, evalAnonFile ] = evalMatch;\n                stack.push({\n                    at,\n                    file: evalAnonFile,\n                    line: lineNumber,\n                    column: columnNumber,\n                    executor: {\n                        at: evalAt,\n                        file: evalFile,\n                        line: parseInt(evalLineNum, 10),\n                        column: parseInt(evalColNum, 10)\n                    }\n                });\n\n                return;\n            }\n        }\n\n        stack.push({\n            at: at || '<anonymous>',\n            file,\n            line: lineNumber,\n            column: columnNumber,\n            executor: null\n        });\n    });\n\n    return stack;\n}\n", "// Bitmask to extract the lower 5 bits (continuation bit removed) - 0b11111\nconst CONTINUATION_BIT_REMOVE = 0x1F;\n\n// Bitmask to set the continuation bit - 0b100000\nconst CONTINUATION_BIT_POSITION = 0x20;\n\n// Mapping of Base64 characters to their indices\nconst base64Map: { [key: string]: number } = {};\n\n// Array of Base64 characters\nconst base64Chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split('');\n\n// Populate the base64Map with characters and their corresponding indices\nbase64Chars.forEach((char, index) => {\n    base64Map[char] = index;\n});\n\n/**\n * Encodes a given number using Variable-Length Quantity (VLQ) encoding.\n * Negative numbers are encoded by converting to a non-negative representation.\n * The continuation bit is used to indicate if more bytes follow.\n *\n * @param value - The number to be encoded.\n * @returns The VLQ encoded string.\n */\n\nexport function encodeVLQ(value: number): string {\n    const isNegative = value < 0;\n\n    /**\n     * Bit Structure Representation:\n     *\n     * +--------------------------+\n     * | C |   Value       | Sign |\n     * +---+---+---+---+---+------+\n     * | 1 | 1 | 0 | 0 | 1 |   0  |\n     * +---+---+---+---+---+------+\n     */\n\n    let encoded = '';\n    let vlq = isNegative ? ((-value) << 1) + 1 : (value << 1); // Shift left by 1 bit to encode the sign bit\n\n    do {\n        const digit = vlq & CONTINUATION_BIT_REMOVE; // Extract lower 5 bits\n        vlq >>>= 5; // Right shift by 5 bits to process next chunk\n        encoded += base64Chars[digit | (vlq > 0 ? CONTINUATION_BIT_POSITION : 0)]; // Combine digit and continuation bit\n    } while (vlq > 0);\n\n    return encoded;\n}\n\n/**\n * Encodes an array of numbers using VLQ encoding.\n * Each number in the array is individually encoded and the results are concatenated.\n *\n * @param values - The array of numbers to be encoded.\n * @returns The concatenated VLQ encoded string.\n */\n\nexport function encodeArrayVLQ(values: number[]): string {\n    return values.map(encodeVLQ).join('');\n}\n\n/**\n * Decodes a VLQ encoded string back into an array of numbers.\n * Each character is decoded using the Base64 map and continuation bits are processed.\n *\n * @param data - The VLQ encoded string.\n * @returns The array of decoded numbers.\n * @throws Error If the string contains invalid Base64 characters.\n */\n\nexport function decodeVLQ(data: string): number[] {\n    const result = [];\n    let shift = 0;\n    let value = 0;\n\n    for (let i = 0; i < data.length; i++) {\n        const digit = base64Map[data[i]];\n        if (digit === undefined) {\n            throw new Error(`Invalid Base64 character: ${data[i]}`);\n        }\n\n        const continuation = digit & CONTINUATION_BIT_POSITION; // Check if continuation bit is set\n        value += (digit & CONTINUATION_BIT_REMOVE) << shift; // Add lower 5 bits to value\n        if (continuation) {\n            shift += 5; // Shift left by 5 for next chunk\n        } else {\n            const isNegative = (value & 1) === 1; // Check if the number is negative\n            const shifted = value >> 1; // Remove the sign bit\n\n            result.push(isNegative ? -shifted : shifted); // Convert back to signed integer\n            value = shift = 0; // Reset for next number\n        }\n    }\n\n    return result;\n}\n", "/**\n * Import will remove at compile time\n */\n\nimport type { PositionSourceInterface } from '@services/interfaces/source.interface';\nimport type { AnsiOptionInterface, FormatCodeInterface } from '@components/interfaces/formatter.interface';\n\n/**\n * Formats a code snippet with optional line padding and custom actions.\n *\n * This function takes a code string and an options object to format the code snippet.\n * It applies padding to line numbers and can trigger custom actions for specific lines.\n *\n * @param code - The source code | stack to be formatted.\n * @param options - Configuration options for formatting the code.\n *   - `padding` (number, optional): Number of characters for line number padding. Defaults to 10.\n *   - `startLine` (number, optional): The starting line number for formatting. Defaults to 1.\n *   - `action` (object, optional): Custom actions to apply to specific lines.\n *     - `triggerLine` (number): The line number where the action should be triggered.\n *     - `callback` (function): A callback function to format the line string when `triggerLine` is matched.\n *       The callback receives the formatted line string, the padding value, and the current line number as arguments.\n *\n * @returns A formatted string of the code snippet with applied padding and custom actions.\n *\n * @example\n * ```typescript\n * const formattedCode = formatCode(code, {\n *     padding: 8,\n *     startLine: 5,\n *     action: {\n *         triggerLine: 7,\n *         callback: (lineString, padding, lineNumber) => {\n *             return `Custom formatting for line ${lineNumber}: ${lineString}`;\n *         }\n *     }\n * });\n * console.log(formattedCode);\n * ```\n */\n\nexport function formatCode(code: string, options: FormatCodeInterface = {}): string {\n    const lines = code.split('\\n');\n    const padding = options.padding ?? 10;\n    const startLine = options.startLine ?? 0;\n\n    return lines.map((lineContent, index) => {\n        const currentLineNumber = index + startLine + 1;\n        const prefix = `${ currentLineNumber} | `;\n        const string = `${ prefix.padStart(padding) }${ lineContent }`;\n\n        if (options.action && currentLineNumber === options.action.triggerLine) {\n            return options.action.callback(string, padding, currentLineNumber);\n        }\n\n        return string;\n    }).join('\\n');\n}\n\n/**\n * Formats a code snippet around an error location with special highlighting.\n *\n * This function takes a `sourcePosition` object containing information about the source code\n * and error location, then uses `formatCode` to format and highlight the relevant code snippet.\n *\n * @param sourcePosition - An object containing information about the source code and error location.\n *   - `code` (string): The entire source code content.\n *   - `line` (number): The line number where the error occurred (1-based indexing).\n *   - `column` (number): The column number within the line where the error occurred (1-based indexing).\n *   - `startLine` (number, optional): The starting line number of the code snippet (defaults to 1).\n * @param ansiOption - Optional configuration for ANSI color codes.\n *   - `color` (string): The ANSI escape sequence to colorize the error marker and prefix (e.g., `'\\x1b[38;5;160m'`).\n *   - `reset` (string): The ANSI escape sequence to reset the color (e.g., `'\\x1b[0m'`).\n *\n * @throws Error - If the provided `sourcePosition` object has invalid line or column numbers,\n *                  or if the error line is outside the boundaries of the provided code content.\n *\n * @returns A formatted string representing the relevant code snippet around the error location,\n *          including special highlighting for the error line and column.\n *\n * @example\n * ```typescript\n * const formattedErrorCode = formatErrorCode(sourcePosition);\n * console.log(formattedErrorCode);\n * ```\n */\n\nexport function formatErrorCode(sourcePosition: PositionSourceInterface, ansiOption?: AnsiOptionInterface): string {\n    const { code, line: errorLine, column: errorColumn, startLine } = sourcePosition;\n\n    // Validate line and column numbers\n    if (errorLine < startLine || errorColumn < 1) {\n        throw new Error('Invalid line or column number.');\n    }\n\n    return formatCode(code, {\n        startLine,\n        action: {\n            triggerLine: errorLine,\n            callback: (lineString, padding, line) => {\n                let pointer = '^';\n                let ansiPadding = padding - 1; // 1 size of the char we added\n                let prefixPointer = '>';\n\n                if (ansiOption) {\n                    pointer = `${ ansiOption.color }${ pointer }${ ansiOption.reset }`;\n                    ansiPadding += (ansiOption.color.length + ansiOption.reset.length);\n                    prefixPointer = `${ ansiOption.color }>${ ansiOption.reset }`;\n                }\n\n                const errorMarker = ' | '.padStart(padding) + ' '.repeat(errorColumn - 1) + `${ pointer }`;\n                lineString = `${ prefixPointer } ${ line } |`.padStart(ansiPadding) + lineString.split('|')[1];\n\n                return lineString + `\\n${ errorMarker }`;\n            }\n        }\n    });\n}\n", "/**\n * Import will remove at compile time\n */\n\nimport type { HighlightSchemeInterface, HighlightNodeSegmentInterface } from '@components/interfaces/highlighter.interface';\n\n/**\n * Imports\n */\n\nimport * as ts from 'typescript';\nimport { SyntaxKind } from 'typescript';\n\n/**\n * An enum containing ANSI escape sequences for various colors.\n *\n * This enum is primarily intended for terminal output and won't work directly in JavaScript for web development.\n * It defines color codes for various colors and a reset code to return to\n * the default text color.\n *\n * @example\n * ```typescript\n * console.log(`${Colors.red}This the text will be red in the terminal.${Colors.reset}`);\n * ```\n *\n * This functionality is limited to terminal environments.\n * Consider alternative methods\n * for color highlighting in web development contexts, such as CSS classes.\n */\n\nexport const enum Colors {\n    reset = '\\x1b[0m',\n    gray = '\\x1b[38;5;243m',\n    darkGray = '\\x1b[38;5;238m',\n    lightCoral = '\\x1b[38;5;203m',\n    lightOrange = '\\x1b[38;5;215m',\n    oliveGreen = '\\x1b[38;5;149m',\n    burntOrange = '\\x1b[38;5;208m',\n    lightGoldenrodYellow = '\\x1b[38;5;221m',\n    lightYellow = '\\x1b[38;5;230m',\n    canaryYellow = '\\x1b[38;5;227m',\n    deepOrange = '\\x1b[38;5;166m',\n    lightGray = '\\x1b[38;5;252m',\n    brightPink = '\\x1b[38;5;197m'\n}\n\n/**\n * Default color scheme for semantic highlighting.\n * This scheme uses red color for all code elements.\n *\n * @example\n * const scheme = defaultScheme;\n * console.log(scheme.typeColor); // Outputs: the red color code\n */\n\n\nconst defaultScheme: HighlightSchemeInterface = {\n    enumColor: Colors.burntOrange,\n    typeColor: Colors.lightGoldenrodYellow,\n    classColor: Colors.lightOrange,\n    stringColor: Colors.oliveGreen,\n    keywordColor: Colors.lightCoral,\n    commentColor: Colors.darkGray,\n    functionColor: Colors.lightOrange,\n    variableColor: Colors.burntOrange,\n    interfaceColor: Colors.lightGoldenrodYellow,\n    parameterColor: Colors.deepOrange,\n    getAccessorColor: Colors.lightYellow,\n    numericLiteralColor: Colors.lightGray,\n    methodSignatureColor: Colors.burntOrange,\n    regularExpressionColor: Colors.oliveGreen,\n    propertyAssignmentColor: Colors.canaryYellow,\n    propertyAccessExpressionColor: Colors.lightYellow,\n    expressionWithTypeArgumentsColor: Colors.lightOrange\n};\n\n/**\n * Class responsible for applying semantic highlighting to a source code string based on a given color scheme.\n *\n * @class\n *\n * @param sourceFile - The TypeScript AST node representing the source file.\n * @param code - The source code string to be highlighted.\n * @param schema - The color scheme used for highlighting different elements in the code.\n *\n * const highlighter = new CodeHighlighter(sourceFile, code, schema);\n */\n\nexport class CodeHighlighter {\n\n    /**\n     * A Map of segments where the key is a combination of start and end positions,\n     * and the value is an object containing the color and reset code.\n     * This structure ensures unique segments and allows for fast lookups and updates.\n     *\n     * @example\n     * this.segments = new Map([\n     *   ['0-10', { start: 1, end: 11, color: '\\x1b[31m', reset: '\\x1b[0m' }],\n     *   ['11-20', { start: 12, end: 20, color: '\\x1b[32m', reset: '\\x1b[0m' }]\n     * ]);\n     */\n\n    private segments: Map<string, HighlightNodeSegmentInterface> = new Map();\n\n    /**\n     * Creates an instance of the CodeHighlighter class.\n     *\n     * @param sourceFile - The TypeScript AST node representing the source file.\n     * @param code - The source code string to be highlighted.\n     * @param schema - The color scheme used for highlighting different elements in the code.\n     */\n\n    constructor(private sourceFile: ts.Node, private code: string, private schema: HighlightSchemeInterface) {\n    }\n\n    /**\n     * Parses a TypeScript AST node and processes its comments to identify segments that need highlighting.\n     *\n     * @param node - The TypeScript AST node to be parsed.\n     */\n\n    parseNode(node: ts.Node): void {\n        this.processComments(node);\n        this.processKeywords(node);\n        this.processNode(node);\n    }\n\n    /**\n     * Generates a string with highlighted code segments based on the provided color scheme.\n     *\n     * This method processes the stored segments, applies the appropriate colors to each segment,\n     * and returns the resulting highlighted code as a single string.\n     *\n     * @returns The highlighted code as a string, with ANSI color codes applied to the segments.\n     */\n\n    highlight(): string {\n        let previousSegmentEnd = 0;\n        let parent: HighlightNodeSegmentInterface | undefined;\n\n        const result: Array<string> = [];\n        const segments = Array.from(\n            this.segments.values()\n        ).sort((a, b) => a.start - b.start || a.end - b.end);\n\n        segments.forEach((segment) => {\n            if (parent && segment.start < parent.end) {\n                const lastSegment = result.pop();\n                if (!lastSegment) return;\n\n                const source = this.getSegmentSource(segment.start, segment.end);\n                const combinedSource = `${ segment.color }${ source }${ parent.color }`;\n                result.push(lastSegment.replace(source, combinedSource));\n\n                return;\n            }\n\n            result.push(this.getSegmentSource(previousSegmentEnd, segment.start));\n            result.push(`${ segment.color }${ this.getSegmentSource(segment.start, segment.end) }${ segment.reset }`);\n            previousSegmentEnd = segment.end;\n            parent = segment;\n        });\n\n        return result.join('') + this.getSegmentSource(previousSegmentEnd);\n    }\n\n    /**\n     * Extracts a substring from the code based on the specified start and end positions.\n     *\n     * This method is used to retrieve the source code segment that corresponds to the\n     * given start and end positions. It is primarily used for highlighting specific\n     * segments of the code.\n     *\n     * @param start - The starting index of the segment to be extracted.\n     * @param end - The ending index of the segment to be extracted.\n     * @returns The extracted substring from the code.\n     */\n\n    private getSegmentSource(start: number, end?: number): string {\n        return this.code.slice(start, end);\n    }\n\n    /**\n     * Adds a new segment to the list of segments to be highlighted.\n     * The segment is defined by its start and end positions, the color to apply, and an optional reset code.\n     *\n     * @param start - The starting index of the segment in the code string.\n     * @param end - The ending index of the segment in the code string.\n     * @param color - The color code to apply to the segment.\n     * @param reset - The color reset code to apply after the segment, Defaults to the reset code defined in `Colors.reset`.\n     */\n\n    private addSegment(start: number, end: number, color: string, reset: string = Colors.reset) {\n        const key = `${ start }-${ end }`;\n        this.segments.set(key, { start, end, color, reset });\n    }\n\n    /**\n     * Processes comments within a TypeScript AST node and adds segments for highlighting.\n     * Extracts trailing and leading comments from the node and adds them as segments using the color defined in `this.colorSchema.comments`.\n     *\n     * @param node - The TypeScript AST node whose comments are to be processed.\n     */\n\n    private processComments(node: ts.Node): void {\n        const comments = [\n            ...ts.getTrailingCommentRanges(this.sourceFile.getFullText(), node.getFullStart()) || [],\n            ...ts.getLeadingCommentRanges(this.sourceFile.getFullText(), node.getFullStart()) || []\n        ];\n\n        comments.forEach(comment => this.addSegment(comment.pos, comment.end, this.schema.commentColor));\n    }\n\n    /**\n     * Processes the keywords within a TypeScript AST node and adds them as segments for highlighting.\n     *\n     * This method identifies potential keyword tokens within the provided node and adds them to the\n     * list of segments with the color defined in `this.schema.keywordColor`.\n     * The method considers the current node, its first token, and its last token to determine if they should be highlighted\n     * as keywords.\n     *\n     * The method checks if the node's kind falls within the range of keyword kinds defined by TypeScript.\n     * If the node or any of its tokens are identified as keywords, a segment is added to `this.segments`\n     * with the start and end positions of the node and the specified color for keywords.\n     *\n     * @param  node - The TypeScript AST node to be processed for keywords.\n     */\n\n    private processKeywords(node: ts.Node): void {\n        if ([\n            SyntaxKind.NullKeyword,\n            SyntaxKind.VoidKeyword,\n            SyntaxKind.StringKeyword,\n            SyntaxKind.NumberKeyword,\n            SyntaxKind.BooleanKeyword,\n            SyntaxKind.UndefinedKeyword\n        ].includes(node.kind)) {\n            return this.addSegment(node.getStart(), node.getEnd(), this.schema.typeColor);\n        }\n\n        if (node && node.kind >= ts.SyntaxKind.FirstKeyword && node.kind <= ts.SyntaxKind.LastKeyword) {\n            this.addSegment(node.getStart(), node.getEnd(), this.schema.keywordColor);\n        }\n    }\n\n    /**\n     * Processes identifiers within a TypeScript AST node and adds them as segments for highlighting\n     * based on the node's parent type.\n     *\n     * This method determines the appropriate color for an identifier based on its parent node's kind.\n     * If the parent node matches one of the specified kinds, the identifier is highlighted with a cyan color.\n     * Supported parent kinds include various declarations, expressions, and signatures.\n     *\n     * @param node - The TypeScript AST node representing the identifier to be processed.\n     */\n\n    private processIdentifier(node: ts.Node): void {\n        const end = node.getEnd();\n        const start = node.getStart();\n\n        switch (node.parent.kind) {\n            case ts.SyntaxKind.EnumMember:\n                return this.addSegment(start, end, this.schema.enumColor);\n            case ts.SyntaxKind.CallExpression:\n            case ts.SyntaxKind.EnumDeclaration:\n            case ts.SyntaxKind.PropertySignature:\n            case ts.SyntaxKind.ModuleDeclaration:\n                return this.addSegment(start, end, this.schema.variableColor);\n            case ts.SyntaxKind.InterfaceDeclaration:\n                return this.addSegment(start, end, this.schema.interfaceColor);\n            case ts.SyntaxKind.GetAccessor:\n                return this.addSegment(start, end, this.schema.getAccessorColor);\n            case ts.SyntaxKind.PropertyAssignment:\n                return this.addSegment(start, end, this.schema.propertyAssignmentColor);\n            case ts.SyntaxKind.MethodSignature:\n                return this.addSegment(start, end, this.schema.methodSignatureColor);\n            case ts.SyntaxKind.MethodDeclaration:\n            case ts.SyntaxKind.FunctionDeclaration:\n                return this.addSegment(start, end, this.schema.functionColor);\n            case ts.SyntaxKind.ClassDeclaration:\n                return this.addSegment(start, end, this.schema.classColor);\n            case ts.SyntaxKind.Parameter:\n                return this.addSegment(start, end, this.schema.parameterColor);\n            case ts.SyntaxKind.VariableDeclaration:\n                return this.addSegment(start, end, this.schema.variableColor);\n            case ts.SyntaxKind.PropertyDeclaration:\n                return this.addSegment(start, end, this.schema.variableColor);\n            case ts.SyntaxKind.PropertyAccessExpression: {\n                if (node.parent.getChildAt(0).getText() === node.getText()) {\n                    return this.addSegment(start, end, this.schema.variableColor);\n                }\n\n                return this.addSegment(start, end, this.schema.propertyAccessExpressionColor);\n            }\n            case ts.SyntaxKind.ExpressionWithTypeArguments:\n                return this.addSegment(start, end, this.schema.expressionWithTypeArgumentsColor);\n            case ts.SyntaxKind.BreakStatement:\n            case ts.SyntaxKind.ShorthandPropertyAssignment:\n            case ts.SyntaxKind.BindingElement:\n                return this.addSegment(start, end, this.schema.variableColor);\n            case ts.SyntaxKind.BinaryExpression:\n            case ts.SyntaxKind.SwitchStatement:\n            case ts.SyntaxKind.TemplateSpan:\n                return this.addSegment(start, end, this.schema.variableColor);\n            case ts.SyntaxKind.TypeReference:\n            case ts.SyntaxKind.TypeAliasDeclaration:\n                return this.addSegment(start, end, this.schema.typeColor);\n            case ts.SyntaxKind.NewExpression:\n                return this.addSegment(start, end, this.schema.variableColor);\n        }\n    }\n\n    /**\n     * Processes a TypeScript template expression and adds segments for highlighting its literal parts.\n     *\n     * This method adds a segment for the head of the template expression with the color specified in `this.schema.stringColor`.\n     * It also processes each template span within the expression, adding\n     * segments for each span's literal part.\n     *\n     * @param templateExpression - The TypeScript template expression to be processed.\n     */\n\n    private processTemplateExpression(templateExpression: ts.TemplateExpression): void {\n        const start = templateExpression.head.getStart();\n        const end = templateExpression.head.getEnd();\n        this.addSegment(start, end, this.schema.stringColor);\n\n        templateExpression.templateSpans.forEach(span => {\n            const spanStart = span.literal.getStart();\n            const spanEnd = span.literal.getEnd();\n            this.addSegment(spanStart, spanEnd, this.schema.stringColor);\n        });\n    }\n\n    /**\n     * Processes a TypeScript AST node and adds segments for highlighting based on the node's kind.\n     *\n     * This method identifies the kind of the node and determines the appropriate color for highlighting.\n     * It handles various node kinds including string literals, regular expressions, template expressions, and identifiers.\n     * Specific methods are invoked for more complex node kinds, such as template expressions and identifiers.\n     *\n     * @param  node - The TypeScript AST node to be processed.\n     */\n\n    private processNode(node: ts.Node): void {\n        const start = node.getStart();\n        const end = node.getEnd();\n\n        switch (node.kind) {\n            case ts.SyntaxKind.TypeParameter:\n                return this.addSegment(start, start + (node as ts.TypeParameterDeclaration).name.text.length, this.schema.typeColor);\n            case ts.SyntaxKind.TypeReference:\n                return this.addSegment(start, end, this.schema.typeColor);\n            case ts.SyntaxKind.StringLiteral:\n            case ts.SyntaxKind.NoSubstitutionTemplateLiteral:\n                return this.addSegment(start, end, this.schema.stringColor);\n            case ts.SyntaxKind.RegularExpressionLiteral:\n                return this.addSegment(start, end, this.schema.regularExpressionColor);\n            case ts.SyntaxKind.TemplateExpression:\n                return this.processTemplateExpression(node as ts.TemplateExpression);\n            case ts.SyntaxKind.Identifier:\n                return this.processIdentifier(node);\n            case ts.SyntaxKind.BigIntLiteral:\n            case ts.SyntaxKind.NumericLiteral:\n                return this.addSegment(start, end, this.schema.numericLiteralColor);\n        }\n    }\n}\n\n/**\n * Applies semantic highlighting to the provided code string using the specified color scheme.\n *\n * @param code - The source code to be highlighted.\n * @param schema - An optional partial schema defining the color styles for various code elements.\n *                 Defaults to an empty object, which means no specific highlighting will be applied.\n *\n * @returns A string with the code elements wrapped in the appropriate color styles as specified by the schema.\n *\n * @example\n * const code = 'const x: number = 42;';\n * const schema = {\n *   keywordColor: '\\x1b[34m', // Blue\n *   stringColor: '\\x1b[32m',  // Green\n *   numberColor: '\\x1b[31m',  // Red\n *   reset: '\\x1b[0m'          // Reset\n * };\n * const highlightedCode = highlightCode(code, schema);\n * console.log(highlightedCode);\n */\n\nexport function highlightCode(code: string, schema: Partial<HighlightSchemeInterface> = {}) {\n    const sourceFile = ts.createSourceFile('temp.ts', code, ts.ScriptTarget.Latest, true, ts.ScriptKind.TS);\n    const codeHighlighter = new CodeHighlighter(sourceFile, code, Object.assign(defaultScheme, schema));\n\n    function walk(node: ts.Node): void {\n        codeHighlighter.parseNode(node);\n\n        for (let i = 0; i < node.getChildCount(); i++) {\n            walk(node.getChildAt(i));\n        }\n    } ts.forEachChild(sourceFile, walk);\n\n    return codeHighlighter.highlight();\n}\n", "/**\n * Import will remove at compile time\n */\n\nimport type {\n    MappingInterface,\n    PositionInterface,\n    SourceMapInterface,\n    ShiftSegmentInterface,\n    SourceOptionsInterface,\n    PositionSourceInterface,\n    ThresholdSegmentInterface\n} from '@services/interfaces/source.interface';\n\n/**\n * Imports\n */\n\nimport { Bias } from '@services/interfaces/source.interface';\nimport { decodeVLQ, encodeArrayVLQ } from '@components/base64.component';\n\n/**\n * A service for validating and processing source maps.\n */\n\nexport class SourceService {\n    /**\n     * The name of the generated file (bundle) that this source map applies to.\n     */\n\n    readonly file: string | null;\n\n    /**\n     * The root URL for the sources, if present in the source map.\n     */\n\n    readonly sourceRoot: string | null;\n\n    /**\n     * A list of symbol names used by the \u201Cmappings\u201D entry.\n     */\n\n    private readonly names: Array<string>;\n\n    /**\n     * An array of source file paths.\n     */\n\n    private readonly sources: Array<string>;\n\n    /**\n     * A string of base64 VLQ-encoded mappings.\n     */\n\n    private readonly mappings: Array<MappingInterface>;\n\n    /**\n     * An array of source files contents.\n     */\n\n    private readonly sourcesContent: Array<string>;\n\n    /**\n     * Creates a new instance of the SourceService class.\n     *\n     * This constructor initializes a `SourceService` instance using the provided source map object.\n     * It performs validation to ensure that the source map contains all required properties.\n     *\n     * @param source - An object conforming to the `SourceMapInterface` representing the source map to be validated and processed.\n     * @throws Error If any required property is missing from the source map object.\n     */\n\n    constructor(source: SourceMapInterface) {\n        this.validateSourceMap(source);\n\n        this.file = source.file ?? null;\n        this.names = source.names ?? [];\n        this.sources = source.sources ?? [];\n        this.mappings = [];\n        this.sourceRoot = source.sourceRoot ?? null;\n        this.sourcesContent = source.sourcesContent ?? [];\n        this.decodeMappings(source.mappings);\n    }\n\n    /**\n     * Returns a plain object representation of the source map data.\n     *\n     * This method constructs and returns an object that includes key properties of the source map:\n     * - `version`: The version of the source map specification (typically 3).\n     * - `file`: The name of the generated file (optional).\n     * - `names`: An array of function or variable names extracted from the original source code.\n     * - `sources`: An array of file paths for the source files referenced in the mappings.\n     * - `sourceRoot`: An optional root URL for resolving source file paths.\n     * - `mappings`: A base64 VLQ-encoded string representing the source map mappings, generated by `encodeMappings`.\n     * - `sourcesContent`: An optional array containing the content of the source files. This property may not be present in all source maps.\n     *\n     * @returns A plain object conforming to the `SourceMapInterface` structure,\n     *                               representing the source map data.\n     */\n\n    getMapObject(): SourceMapInterface {\n        const sourceMap: SourceMapInterface = {\n            version: 3,\n            names: this.names,\n            sources: this.sources,\n            mappings: this.encodeMappings(this.mappings),\n            sourcesContent: this.sourcesContent\n        };\n\n        if(this.file)\n            sourceMap.file = this.file;\n\n        if (this.sourceRoot)\n            sourceMap.sourceRoot = this.sourceRoot;\n\n        return sourceMap;\n    }\n\n    /**\n     * Retrieves the source code snippet from the original source based on the specified\n     * file index, line number, and column number. This method provides context for the\n     * specified location in the source code, useful for debugging or inspection purposes.\n     *\n     * This method can accept both string and numeric file indices. If a string is provided,\n     * it will search for the corresponding index in the list of source file names. If the\n     * index is not found or if an invalid location is provided, it will return null.\n     *\n     * @param fileIndex - The index of the source file (as a number) or the name of the\n     *                    source file (as a string) from which to retrieve the code.\n     *                    If a string is provided, the method will search through the\n     *                    available sources to find the corresponding index.\n     * @param line - The line number in the original source file from which to retrieve\n     *               the code snippet.\n     * @param column - The column number in the original source file that indicates the\n     *                 specific position for the code snippet.\n     * @param options - Optional settings that can customize the behavior of the method:\n     *   - `bias`: Specifies the bias for the mapping retrieval (default is `Bias.LOWER_BOUND`).\n     *   - `linesAfter`: The number of lines to include after the specified line (default is 4).\n     *   - `linesBefore`: The number of lines to include before the specified line (default is 3).\n     *\n     * @returns A `PositionSourceInterface` object containing:\n     *   - `code`: A snippet of the original source code surrounding the specified line and column.\n     *   - `line`: The line number in the original source code.\n     *   - `column`: The column number in the original source code.\n     *   - `startLine`: The starting line number of the returned source code snippet.\n     *   - `endLine`: The ending line number of the returned source code snippet.\n     *   - `name`: The name of the function or variable at the matched position, if available.\n     *   - `source`: The file name of the original source.\n     *   - `sourceRoot`: The root directory of the original source file.\n     *\n     * @returns Null if no valid source file is found or if no matching position is found\n     *          in the source file.\n     *\n     * @example\n     * ```typescript\n     * const sourceCode = getSourceCodeByLocation('app.js', 10, 15);\n     * if (sourceCode) {\n     *     console.log(sourceCode);\n     *     // {\n     *     //   code: 'function example() {...}',\n     *     //   line: 10,\n     *     //   column: 15,\n     *     //   startLine: 7,\n     *     //   endLine: 11,\n     *     //   name: 'example',\n     *     //   source: 'app.js',\n     *     //   sourceRoot: '/src'\n     *     // }\n     * }\n     * ```\n     */\n\n    getSourceCodeByLocation(fileIndex: string, line: number, column: number, options?: SourceOptionsInterface): PositionSourceInterface | null;\n    getSourceCodeByLocation(fileIndex: number, line: number, column: number, options?: SourceOptionsInterface): PositionSourceInterface | null;\n    getSourceCodeByLocation(fileIndex: number | string, line: number, column: number, options?: SourceOptionsInterface): PositionSourceInterface | null {\n        let index  = <number> fileIndex;\n        if (typeof fileIndex === 'string')\n            index = this.sources.findIndex(str => str.includes(fileIndex));\n\n        if (index < 0)\n            return null;\n\n        const settings = Object.assign({\n            bias: Bias.LOWER_BOUND,\n            linesAfter: 4,\n            linesBefore: 3\n        }, options);\n\n        const map = this.retrieveMapping(line, column, settings.bias, index, 'sourceLine', 'sourceColumn');\n        \n        return this.getPositionWithSource(map, settings);\n    }\n\n    /**\n     * Retrieves the original source location and optional source code snippet for a given line and column in the generated code.\n     *\n     * This function uses the source map to locate the corresponding position in the original source code. Depending on the `options` provided,\n     * it can include a snippet of the original source code surrounding the located position, offering context for debugging purposes.\n     *\n     * @param line - The line number in the generated code.\n     * @param column - The column number in the generated code.\n     * @param options - Optional settings for retrieving the source position and context:\n     *   - `linesBefore` (default: 3): Number of lines before the matched source line to include in the returned snippet.\n     *   - `linesAfter` (default: 4): Number of lines after the matched source line to include in the returned snippet.\n     *   - `includeSourceContent` (default: false): When true, includes a snippet of the source code in the result.\n     *   - `bias` (optional): Determines how to resolve ambiguous mappings (e.g., when there are multiple possible matches for the line/column).\n     *\n     * @returns An object containing detailed source information, including:\n     *   - `line`: The line number in the original source code.\n     *   - `column`: The column number in the original source code.\n     *   - `startLine`: The starting line number of the returned source code snippet.\n     *   - `endLine`: The ending line number of the returned source code snippet.\n     *   - `name`: The name of the function or variable at the matched position, if available.\n     *   - `source`: The file name of the original source.\n     *   - `sourceRoot`: The root directory of the original source file.\n     *   - `code` (if `includeSourceContent` is true): A snippet of the original source code surrounding the specified line and column.\n     *\n     * @returns Null if no matching source position is found.\n     *\n     * @example\n     * ```typescript\n     * const position = getSourcePosition(10, 5, { linesBefore: 2, linesAfter: 2, includeSourceContent: true });\n     * console.log(position);\n     * // {\n     * //   line: 7,\n     * //   column: 15,\n     * //   startLine: 5,\n     * //   endLine: 9,\n     * //   name: 'myFunction',\n     * //   source: 'app.js',\n     * //   sourceRoot: '/src',\n     * //   code: 'function myFunction() {...}'\n     * // }\n     * ```\n     */\n\n    getSourcePosition(line: number, column: number, options?: SourceOptionsInterface): PositionSourceInterface | null {\n        const settings = Object.assign({\n            bias: Bias.LOWER_BOUND,\n            linesAfter: 4,\n            linesBefore: 3\n        }, options);\n\n        const map = this.retrieveMapping(line, column, settings.bias);\n        \n        return this.getPositionWithSource(map, settings);\n    }\n\n    /**\n     * Retrieves the position information in the original source code for a given line and column in the generated code.\n     *\n     * This function locates the corresponding position in the original source code based on the provided line and column in the generated code.\n     * It uses the specified bias to determine the best match when multiple mappings are possible.\n     *\n     * @param line - The line number in the generated code.\n     * @param column - The column number in the generated code.\n     * @param bias - Optional parameter specifying how to handle cases where only the line number matches:\n     *   - `Bias.LOWER_BOUND` (default): If the line number matches but the column is less, returns the closest mapping with a lower column.\n     *   - `Bias.UPPER_BOUND`: If the line number matches but the column is greater, returns the closest mapping with a higher column.\n     *   - `Bias.BOUND`: If the line number matches but the column doesn't, returns null.\n     *\n     * @returns A `PositionInterface` object representing the position in the original source code, including:\n     *   - `line`: The line number in the original source code.\n     *   - `column`: The column number in the original source code.\n     *   - `name`: The function or variable name at the source position, if available.\n     *   - `source`: The file name of the original source code.\n     *   - `sourceRoot`: The root path of the original source code.\n     *   Returns `null` if no matching position is found.\n     *\n     * @example\n     * ```typescript\n     * const position = getPosition(10, 5, Bias.LOWER_BOUND);\n     * console.log(position);\n     * // {\n     * //   line: 7,\n     * //   column: 15,\n     * //   name: 'myFunction',\n     * //   source: 'app.js',\n     * //   sourceRoot: '/src'\n     * // }\n     * ```\n     */\n\n    getPosition(line: number, column: number, bias: Bias = Bias.LOWER_BOUND): PositionInterface | null {\n        const map = this.retrieveMapping(line, column, bias);\n        if (!map) {\n            return map;\n        }\n\n        return {\n            line: map.sourceLine,\n            name: this.names[map.nameIndex ?? -1] ?? null,\n            column: map.sourceColumn,\n            source: this.sources[map.fileIndex],\n            sourceRoot: this.sourceRoot\n        };\n    }\n\n    /**\n     * Merges multiple source maps into this source map object.\n     * The order of the provided source maps must correspond to the order in which the source files were concatenated.\n     *\n     * This method appends the names, sources, and source contents from each provided source map to the current source map.\n     * It also adjusts the mappings to account for the concatenation of the source files.\n     *\n     * @param maps - An array of `SourceMapInterface` instances representing the source maps to be merged.\n     * @throws Error If no source maps are provided for concatenation.\n     *\n     * @example\n     * // Merging two source maps\n     * const map1: SourceMapInterface = { /* ... *\\/ };\n     * const map2: SourceMapInterface = { /* ... *\\/ };\n     * sourceMapService.concat(map1, map2);\n     */\n\n    concat(...maps: Array<SourceMapInterface>): void {\n        if (maps.length < 1) {\n            throw new Error('At least one map must be provided for concatenation.');\n        }\n\n        for (const map of maps) {\n            this.names.push(...map.names);\n            this.sources.push(...map.sources);\n            this.sourcesContent.push(...map.sourcesContent);\n\n            const lastSegment = this.mappings[this.mappings.length - 1];\n            const lines = this.sourcesContent[lastSegment.fileIndex].split('\\n').length;\n\n            this.decodeMappings(maps[0].mappings, {\n                nameIndex: this.names.length - 1,\n                fileIndex: this.sources.length - 1,\n                generatedLine: lines < 2 ? 2 : lines\n            });\n        }\n    }\n\n    /**\n     * Converts the source map object to a JSON string representation.\n     *\n     * This method performs the following steps:\n     * 1. Creates a plain object representation of the source map using the `getMapObject` method.\n     * 2. Converts the plain object to a JSON string using `JSON.stringify`.\n     *\n     * @returns A JSON string representation of the source map.\n     *\n     * @example\n     * const sourceMapString = sourceMapService.toString();\n     * // sourceMapString contains the JSON string representation of the source map.\n     */\n\n    toString(): string {\n        return JSON.stringify(this.getMapObject());\n    }\n\n    /**\n     * Retrieves the position information in the original source code along with a snippet\n     * of the surrounding source code based on the provided mapping.\n     *\n     * This method takes a mapping object that represents a position in the generated code\n     * and locates the corresponding position in the original source code. It extracts a\n     * relevant code snippet surrounding the identified position, providing context for\n     * debugging or inspection purposes.\n     *\n     * @param map - A `MappingInterface` object representing the mapping from the generated\n     *              code to the original source code. If the mapping is null or invalid,\n     *              the method will return null.\n     * @param settings - An object containing configuration options for retrieving the\n     *                   surrounding code snippet, including:\n     *   - `linesAfter`: The number of lines to include after the specified line (default is 4).\n     *   - `linesBefore`: The number of lines to include before the specified line (default is 3).\n     *\n     * @returns An object containing detailed source information, including:\n     *   - `line`: The line number in the original source code.\n     *   - `column`: The column number in the original source code.\n     *   - `startLine`: The starting line number of the returned source code snippet.\n     *   - `endLine`: The ending line number of the returned source code snippet.\n     *   - `name`: The name of the function or variable at the matched position, if available.\n     *   - `source`: The file name of the original source.\n     *   - `sourceRoot`: The root directory of the original source file.\n     *   - `code`: A snippet of the original source code surrounding the specified line and column.\n     *\n     * @returns Null if no valid mapping is provided or if no matching source position is found.\n     *\n     * @example\n     * ```typescript\n     * const positionInfo = getPositionWithSource(mapping, { linesAfter: 4, linesBefore: 3 });\n     * if (positionInfo) {\n     *     console.log(positionInfo);\n     *     // {\n     *     //   code: 'function myFunction() {...}',\n     *     //   line: 7,\n     *     //   column: 15,\n     *     //   startLine: 5,\n     *     //   endLine: 9,\n     *     //   name: 'myFunction',\n     *     //   source: 'app.js',\n     *     //   sourceRoot: '/src'\n     *     // }\n     * }\n     * ```\n     */\n\n    private getPositionWithSource(map: MappingInterface | null, settings: Required<SourceOptionsInterface>): PositionSourceInterface | null  {\n        if (!map || isNaN(map.fileIndex)) {\n            return null;\n        }\n\n        const code = this.sourcesContent[map.fileIndex].split('\\n');\n        const endLine = (map.sourceLine ?? 1) + settings.linesAfter;\n        const startLine = Math.max((map.sourceLine ?? 1) - settings.linesBefore, 0);\n        const relevantCode = code.slice(startLine, Math.min(endLine + 1, code.length)).join('\\n');\n\n        return {\n            code: relevantCode,\n            line: map.sourceLine,\n            name:this.names[map.nameIndex ?? -1] ?? null,\n            column: map.sourceColumn,\n            endLine: endLine,\n            startLine: startLine,\n            source: this.sources[map.fileIndex],\n            sourceRoot: this.sourceRoot\n        };\n    }\n\n    /**\n     * Validates the provided source map object.\n     *\n     * This method checks whether all required keys are present in the source map object.\n     * It throws an error if any required keys are missing.\n     *\n     * @private\n     * @param input - The source map object to be validated.\n     * @throws Error If any required key is missing from the source map.\n     *\n     * @example\n     * const sourceMap = {\n     *     version: 3,\n     *     file: 'example.js',\n     *     names: ['src', 'maps', 'example', 'function', 'line', 'column'],\n     *     sources: ['source1.js', 'source2.js'],\n     *     mappings: 'AAAA,SAASA,CAAC,CAAC,CAAC;AAAA,CAAC,CAAC;AAAC,CAAC',\n     *     sourcesContent: ['console.log(\"Hello world\");', 'console.log(\"Another file\");']\n     * };\n     *\n     * try {\n     *     validateSourceMap(sourceMap);\n     *     console.log('Source map is valid.');\n     * } catch (error) {\n     *     console.error('Invalid source map:', error.message);\n     * }\n     */\n\n    private validateSourceMap(input: SourceMapInterface): void {\n        const requiredKeys: (keyof SourceMapInterface)[] = [ 'version', 'sources', 'sourcesContent', 'mappings', 'names' ];\n        if (!requiredKeys.every(key => key in input)) {\n            throw new Error('Missing required keys in SourceMap.');\n        }\n    }\n\n    /**\n     * Decodes and processes the base64 VLQ-encoded mappings from a source map.\n     *\n     * This method interprets the encoded mappings from the `mappings` property of a source map. It adjusts\n     * the shift state for both generated and original positions in the source code, and processes each\n     * decoded mapping segment using the `decodedSegment` method.\n     *\n     * The decoding process involves:\n     * 1. Parsing the base64 VLQ-encoded mappings.\n     * 2. Adjusting the shift state based on the provided `thresholdSegment` or default values.\n     * 3. Handling each decoded mapping segment with the `decodedSegment` method.\n     *\n     * @param encodedMappings - A string representing the encoded mappings in base64 VLQ format. This string\n     *                          is typically found in the `mappings` property of a source map.\n     * @param thresholdSegment - Optional. An object containing offset information that adjusts the starting\n     *                           point for decoding. This can include offsets for line, column, or file index.\n     *                           If not provided, default values are used.\n     * @throws Error - Throws an error if the decoding process encounters an issue, such as an invalid\n     *                 encoding or unexpected format.\n     *\n     * @example\n     * const encodedMappings = 'AAAA,CAAC,CAAC,CAAC,CAAC;AAAA,CAAC,CAAC,CAAC,CAAC';\n     * const threshold = {\n     *     fileIndex: 0,\n     *     nameIndex: 0,\n     *     sourceLine: 1,\n     *     sourceColumn: 1,\n     *     generatedLine: 1,\n     *     generatedColumn: 1\n     * };\n     * try {\n     *     decodeMappings(encodedMappings, threshold);\n     * } catch (error) {\n     *     console.error('Failed to decode mappings:', error.message);\n     * }\n     */\n\n    private decodeMappings(encodedMappings: string, thresholdSegment?: ThresholdSegmentInterface): void {\n        // Note: Line and column numbers in source maps start at 1,\n        // unlike arrays which start at 0. Therefore, the initial shift for lines is set to 1.\n        const shift = Object.assign({\n            fileIndex: 0,\n            nameIndex: 0,\n            sourceLine: 1,\n            sourceColumn: 1,\n            generatedLine: 1,\n            generatedColumn: 1\n        }, thresholdSegment);\n\n        try {\n            for (const [ generatedLine, stringSegments ] of encodedMappings.split(';').entries()) {\n                if (!stringSegments) continue;\n                shift.generatedColumn = 1;\n                const segments = stringSegments.split(',');\n\n                for (const segment of segments) {\n                    if (segment.length < 4) continue;\n                    const decodedSegment = decodeVLQ(segment);\n\n                    this.decodedSegment(shift, decodedSegment, generatedLine + shift.generatedLine);\n                }\n            }\n        } catch (error) {\n            throw new Error(`Error decoding mappings: ${ (<Error>error).message }`);\n        }\n    }\n\n    /**\n     * Processes a decoded VLQ segment and updates the mapping information.\n     *\n     * This method adjusts the current mapping state based on the decoded VLQ segment and the current\n     * line in the generated code. It then updates the internal mappings list with the new information.\n     *\n     * The decoding process involves:\n     * 1. Extracting the mapping details from the `decodedSegment` array.\n     * 2. Updating the shift values for file index, name index, source line, source column, and generated column.\n     * 3. Adding the processed mapping to the internal `mappings` array.\n     *\n     * @param shift - The current state of mapping information. This object tracks the cumulative state\n     *                of file index, name index, source line, source column, and generated column.\n     * @param decodedSegment - An array representing the decoded VLQ segment, containing:\n     *   - `generatedColumn`: The column number in the generated code.\n     *   - `fileIndex`: The index in the sources array.\n     *   - `sourceLine`: The line number in the original source code.\n     *   - `sourceColumn`: The column number in the original source code.\n     *   - `nameIndex`: The index in the names array.\n     * @param generatedLine - The line index in the generated code where this segment applies.\n     *\n     * @example\n     * const shift = {\n     *     fileIndex: 0,\n     *     nameIndex: 0,\n     *     sourceLine: 1,\n     *     sourceColumn: 1,\n     *     generatedLine: 1,\n     *     generatedColumn: 1\n     * };\n     * const decodedSegment = [2, 1, 3, 4, 5];\n     * const generatedLine = 1;\n     * this.decodedSegment(shift, decodedSegment, generatedLine);\n     *\n     * @see ShiftSegmentInterface for details on the `shift` parameter.\n     * @see SourceMapInterface for details on the mapping properties.\n     */\n\n    private decodedSegment(shift: ShiftSegmentInterface, decodedSegment: Array<number>, generatedLine: number): void {\n        const [ generatedColumn, fileIndex, sourceLine, sourceColumn, nameIndex ] = decodedSegment;\n        shift.fileIndex += fileIndex;\n        shift.nameIndex += nameIndex ?? 0;\n        shift.sourceLine += sourceLine;\n        shift.sourceColumn += sourceColumn;\n        shift.generatedColumn += generatedColumn;\n\n        this.mappings.push({\n            nameIndex: (nameIndex !== undefined) ? shift.nameIndex : null,\n            fileIndex: shift.fileIndex,\n            sourceLine: shift.sourceLine,\n            sourceColumn: shift.sourceColumn,\n            generatedLine: generatedLine,\n            generatedColumn: shift.generatedColumn\n        });\n    }\n\n    /**\n     * Encodes an array of mappings into a VLQ-encoded string representation.\n     *\n     * This method converts an array of `MappingInterface` objects into a base64 VLQ-encoded string,\n     * which is used in source maps to represent the mapping between generated and original source code positions.\n     *\n     * The encoding process involves:\n     * 1. Initializing the shift state to track the current line and column in the generated code.\n     * 2. Iterating through the mappings to group them by line number and encode each segment.\n     * 3. Concatenating encoded segments with the appropriate separator characters (`,` and `;`).\n     *\n     * @param mappings - An array of `MappingInterface` objects representing the mappings to encode. Each mapping object contains:\n     *   - `nameIndex`: The index in the names array.\n     *   - `fileIndex`: The index in the sources array.\n     *   - `sourceLine`: The line number in the original source code.\n     *   - `sourceColumn`: The column number in the original source code.\n     *   - `generatedLine`: The line number in the generated code.\n     *   - `generatedColumn`: The column number in the generated code.\n     * @returns A VLQ-encoded string representing the mappings, with segments separated by commas and lines by semicolons.\n     *\n     * @example\n     * const mappings = [\n     *     { nameIndex: 0, fileIndex: 1, sourceLine: 2, sourceColumn: 3, generatedLine: 1, generatedColumn: 4 },\n     *     { nameIndex: 1, fileIndex: 1, sourceLine: 3, sourceColumn: 4, generatedLine: 2, generatedColumn: 5 }\n     * ];\n     * const encodedMappings = this.encodeMappings(mappings);\n     * console.log(encodedMappings); // Outputs the VLQ-encoded string\n     *\n     * @see MappingInterface for details on the mapping properties.\n     */\n\n    private encodeMappings(mappings: Array<MappingInterface>): string {\n        let resultMapping = '';\n        let segments: Array<string> = [];\n\n        const shift = {\n            fileIndex: 0,\n            nameIndex: 0,\n            sourceLine: 1,\n            sourceColumn: 1,\n            generatedLine: 1,\n            generatedColumn: 1\n        };\n\n        shift.generatedLine = mappings[0].generatedLine;\n        resultMapping += ';'.repeat(shift.generatedLine - 1);\n\n        for (const map of mappings) {\n            if (map.generatedLine !== shift.generatedLine) {\n                resultMapping += segments.join(',');\n                resultMapping += ';'.repeat(Math.max(1, map.generatedLine - shift.generatedLine));\n\n                segments = [];\n                shift.generatedLine = map.generatedLine;\n                shift.generatedColumn = 1;\n            }\n\n            this.encodeSegment(map, segments, shift);\n        }\n\n        return resultMapping + segments.join(',') + ';';\n    }\n\n    /**\n     * Encodes a single segment of the mappings into VLQ format.\n     *\n     * This method processes a `MappingInterface` object and updates the list of encoded segments. It calculates the differences\n     * between the current and previous mapping states, then encodes these differences using VLQ (Variable-Length Quantity) encoding.\n     * The encoded segment is added to the provided `segments` array.\n     *\n     * The encoding process involves:\n     * 1. Calculating the delta values for the file index, source line, source column, and generated column.\n     * 2. Updating the `shift` state to reflect the current mapping information.\n     * 3. Encoding the segment using VLQ and adding it to the `segments` array.\n     *\n     * @param map - The `MappingInterface` object representing a single mapping to encode. This object contains:\n     *   - `nameIndex`: The index in the names array.\n     *   - `fileIndex`: The index in the sources array.\n     *   - `sourceLine`: The line number in the original source code.\n     *   - `sourceColumn`: The column number in the original source code.\n     *   - `generatedColumn`: The column number in the generated code.\n     * @param segments - An array of encoded segments that will be updated with the new encoded segment.\n     * @param shift - The current state of the mapping information, including the latest file index, name index, source line,\n     *                source column, and generated column. This state is updated as new mappings are processed.\n     *\n     * @example\n     * const map: MappingInterface = { nameIndex: 0, fileIndex: 1, sourceLine: 2, sourceColumn: 3, generatedLine: 1, generatedColumn: 4 };\n     * const segments: Array<string> = [];\n     * const shift: ShiftSegmentInterface = { fileIndex: 0, nameIndex: 0, sourceLine: 1, sourceColumn: 1, generatedLine: 1, generatedColumn: 1 };\n     * this.encodeSegment(map, segments, shift);\n     * console.log(segments); // Outputs the encoded VLQ segment\n     *\n     * @see MappingInterface for details on the mapping properties.\n     * @see encodeArrayVLQ for the encoding function used.\n     */\n\n\n\n    private encodeSegment(map: MappingInterface, segments: Array<string>, shift: ShiftSegmentInterface): void {\n        const segment: Array<number> = [];\n        const sourceIndex = map.fileIndex;\n\n        segment[1] = 0;\n        segment[2] = map.sourceLine - shift.sourceLine;\n        segment[3] = map.sourceColumn - shift.sourceColumn;\n        segment[0] = map.generatedColumn - shift.generatedColumn;\n\n        if (sourceIndex !== shift.fileIndex) {\n            segment[1] = sourceIndex - shift.fileIndex;\n            shift.fileIndex = sourceIndex;\n        }\n\n        if (map.nameIndex) {\n            const nameIndex = map.nameIndex;\n            segment[4] = nameIndex - shift.nameIndex;\n            shift.nameIndex = nameIndex;\n        }\n\n        shift.sourceLine = map.sourceLine;\n        shift.sourceColumn = map.sourceColumn;\n        shift.generatedColumn = map.generatedColumn;\n        segments.push(encodeArrayVLQ(segment));\n    }\n\n    /**\n     * Determines whether a mapping should be skipped based on the specified file index.\n     *\n     * This function checks if the given mapping's file index matches the provided file index.\n     * If the file index is not -1 (which indicates that filtering is desired),\n     * the function returns true if the mapping's file index does not match the specified file index.\n     *\n     * @param mapping - The mapping object to evaluate.\n     * @param fileIndex - The file index to compare against the mapping's file index.\n     *                   A value of -1 indicates that no filtering should occur.\n     *\n     * @returns True if the mapping should be skipped, otherwise false.\n     */\n\n    private shouldSkipMapping(mapping: MappingInterface, fileIndex: number): boolean {\n        return fileIndex !== -1 && mapping.fileIndex !== fileIndex;\n    }\n\n    /**\n     * Retrieves the closest mapping from the mappings array based on the specified line and column.\n     *\n     * This function performs a binary search to find the mapping that corresponds to the given line and column\n     * parameters. It takes into account the specified bias for the column in case of a tie in the line number,\n     * and can also filter results by a specific file index if provided.\n     *\n     * @param line - The target line number to search for in the mappings.\n     * @param column - The target column number to search for in the mappings.\n     * @param bias - The bias to use when the line matches; it can be:\n     *               - Bias.BOUND (default): No preference for column matching.\n     *               - Bias.LOWER_BOUND: Prefer the closest mapping with a lower column value.\n     *               - Bias.UPPER_BOUND: Prefer the closest mapping with a higher column value.\n     * @param fileIndex - The index of the file to filter the mappings by. If set to -1, no filtering is applied.\n     * @param lineKey - The key to access the line number in the mapping object.\n     *                  Can be either 'generatedLine' or 'sourceLine'.\n     * @param columnKey - The key to access the column number in the mapping object.\n     *                    Can be either 'generatedColumn' or 'sourceColumn'.\n     *\n     * @returns The closest matching MappingInterface object, or null if no matching mapping is found.\n     */\n\n    private retrieveMapping(\n        line: number,\n        column: number,\n        bias: Bias = Bias.BOUND,\n        fileIndex: number = -1,\n        lineKey: 'generatedLine' | 'sourceLine' = 'generatedLine',\n        columnKey: 'generatedColumn' | 'sourceColumn' = 'generatedColumn'\n    ): MappingInterface | null {\n        let startIndex = 0;\n        let endIndex = this.mappings.length - 1;\n        let closestMapping: MappingInterface | null = null;\n\n        while (startIndex <= endIndex) {\n            const middleIndex = Math.floor((startIndex + endIndex) / 2);\n            const currentMapping = this.mappings[middleIndex];\n\n            if (this.shouldSkipMapping(currentMapping, fileIndex)) {\n                startIndex = middleIndex + 1;\n                continue;\n            }\n\n            const currentLine = currentMapping[lineKey];\n            const currentColumn = currentMapping[columnKey];\n\n            if (currentLine < line) {\n                startIndex = middleIndex + 1;\n            } else if (currentLine > line) {\n                endIndex = middleIndex - 1;\n            } else {\n                // Handle column bias when line matches\n                if (currentColumn < column) {\n                    closestMapping = bias === Bias.LOWER_BOUND ? currentMapping : closestMapping;\n                    startIndex = middleIndex + 1;\n                } else if (currentColumn > column) {\n                    closestMapping = bias === Bias.UPPER_BOUND ? currentMapping : closestMapping;\n                    endIndex = middleIndex - 1;\n                } else {\n                    return currentMapping; // Exact match found\n                }\n            }\n        }\n\n        // Return the closest mapping if it matches the specified line\n        return closestMapping && closestMapping[lineKey] === line ? closestMapping : null;\n    }\n}\n"],
-  "mappings": "0jBAAA,IAAAA,EAAA,GAAAC,EAAAD,EAAA,qBAAAE,EAAA,WAAAC,EAAA,kBAAAC,EAAA,cAAAC,EAAA,mBAAAC,EAAA,cAAAC,EAAA,eAAAC,EAAA,oBAAAC,EAAA,kBAAAC,EAAA,oBAAAC,IAAA,eAAAC,EAAAZ,GCaO,SAASa,EAAgBC,EAAiD,CAC7E,IAAMC,EAAQD,EAAY,MAAM;AAAA,CAAI,EAAE,MAAM,CAAC,EACvCE,EAAQ,sEACRC,EAAY,qDACZC,EAAoC,CAAC,EAE3C,OAAAH,EAAM,QAASI,GAAS,CACpB,IAAMC,EAAQD,EAAK,MAAMH,CAAK,EAC9B,GAAI,CAACI,EAAO,OAEZ,IAAIC,EAAsBD,EAAM,MAAM,CAAC,EACnCA,EAAM,CAAC,IACPC,EAAOD,EAAM,MAAM,CAAC,GAGxB,GAAM,CAAEE,EAAIC,EAAMC,EAASC,CAAO,EAAIJ,EAChCK,EAAa,SAASF,EAAS,EAAE,EACjCG,EAAe,SAASF,EAAQ,EAAE,EAExC,GAAIN,EAAK,SAAS,MAAM,EAAG,CACvB,IAAMS,EAAYL,EAAK,MAAMN,CAAS,GAAG,MAAM,CAAC,EAChD,GAAIW,EAAW,CACX,GAAM,CAAEC,EAAQC,EAAUC,EAAaC,EAAYC,CAAa,EAAIL,EACpEV,EAAM,KAAK,CACP,GAAAI,EACA,KAAMW,EACN,KAAMP,EACN,OAAQC,EACR,SAAU,CACN,GAAIE,EACJ,KAAMC,EACN,KAAM,SAASC,EAAa,EAAE,EAC9B,OAAQ,SAASC,EAAY,EAAE,CACnC,CACJ,CAAC,EAED,MACJ,CACJ,CAEAd,EAAM,KAAK,CACP,GAAII,GAAM,cACV,KAAAC,EACA,KAAMG,EACN,OAAQC,EACR,SAAU,IACd,CAAC,CACL,CAAC,EAEMT,CACX,CCxDA,IAAMgB,EAAuC,CAAC,EAGxCC,EAAc,mEAAmE,MAAM,EAAE,EAG/FA,EAAY,QAAQ,CAACC,EAAMC,IAAU,CACjCH,EAAUE,CAAI,EAAIC,CACtB,CAAC,EAWM,SAASC,EAAUC,EAAuB,CAC7C,IAAMC,EAAaD,EAAQ,EAYvBE,EAAU,GACVC,EAAMF,GAAe,CAACD,GAAU,GAAK,EAAKA,GAAS,EAEvD,EAAG,CACC,IAAMI,EAAQD,EAAM,GACpBA,KAAS,EACTD,GAAWN,EAAYQ,GAASD,EAAM,EAAI,GAA4B,EAAE,CAC5E,OAASA,EAAM,GAEf,OAAOD,CACX,CAUO,SAASG,EAAeC,EAA0B,CACrD,OAAOA,EAAO,IAAIP,CAAS,EAAE,KAAK,EAAE,CACxC,CAWO,SAASQ,EAAUC,EAAwB,CAC9C,IAAMC,EAAS,CAAC,EACZC,EAAQ,EACRV,EAAQ,EAEZ,QAASW,EAAI,EAAGA,EAAIH,EAAK,OAAQG,IAAK,CAClC,IAAMP,EAAQT,EAAUa,EAAKG,CAAC,CAAC,EAC/B,GAAIP,IAAU,OACV,MAAM,IAAI,MAAM,6BAA6BI,EAAKG,CAAC,CAAC,EAAE,EAG1D,IAAMC,EAAeR,EAAQ,GAE7B,GADAJ,IAAUI,EAAQ,KAA4BM,EAC1CE,EACAF,GAAS,MACN,CACH,IAAMT,GAAcD,EAAQ,KAAO,EAC7Ba,EAAUb,GAAS,EAEzBS,EAAO,KAAKR,EAAa,CAACY,EAAUA,CAAO,EAC3Cb,EAAQU,EAAQ,CACpB,CACJ,CAEA,OAAOD,CACX,CCzDO,SAASK,EAAWC,EAAcC,EAA+B,CAAC,EAAW,CAChF,IAAMC,EAAQF,EAAK,MAAM;AAAA,CAAI,EACvBG,EAAUF,EAAQ,SAAW,GAC7BG,EAAYH,EAAQ,WAAa,EAEvC,OAAOC,EAAM,IAAI,CAACG,EAAaC,IAAU,CACrC,IAAMC,EAAoBD,EAAQF,EAAY,EAExCI,EAAS,GADA,GAAID,CAAiB,MACV,SAASJ,CAAO,CAAE,GAAIE,CAAY,GAE5D,OAAIJ,EAAQ,QAAUM,IAAsBN,EAAQ,OAAO,YAChDA,EAAQ,OAAO,SAASO,EAAQL,EAASI,CAAiB,EAG9DC,CACX,CAAC,EAAE,KAAK;AAAA,CAAI,CAChB,CA8BO,SAASC,EAAgBC,EAAyCC,EAA0C,CAC/G,GAAM,CAAE,KAAAX,EAAM,KAAMY,EAAW,OAAQC,EAAa,UAAAT,CAAU,EAAIM,EAGlE,GAAIE,EAAYR,GAAaS,EAAc,EACvC,MAAM,IAAI,MAAM,gCAAgC,EAGpD,OAAOd,EAAWC,EAAM,CACpB,UAAAI,EACA,OAAQ,CACJ,YAAaQ,EACb,SAAU,CAACE,EAAYX,EAASY,IAAS,CACrC,IAAIC,EAAU,IACVC,EAAcd,EAAU,EACxBe,EAAgB,IAEhBP,IACAK,EAAU,GAAIL,EAAW,KAAM,GAAIK,CAAQ,GAAIL,EAAW,KAAM,GAChEM,GAAgBN,EAAW,MAAM,OAASA,EAAW,MAAM,OAC3DO,EAAgB,GAAIP,EAAW,KAAM,IAAKA,EAAW,KAAM,IAG/D,IAAMQ,EAAc,MAAM,SAAShB,CAAO,EAAI,IAAI,OAAOU,EAAc,CAAC,EAAI,GAAIG,CAAQ,GACxF,OAAAF,EAAa,GAAII,CAAc,IAAKH,CAAK,KAAK,SAASE,CAAW,EAAIH,EAAW,MAAM,GAAG,EAAE,CAAC,EAEtFA,EAAa;AAAA,EAAMK,CAAY,EAC1C,CACJ,CACJ,CAAC,CACL,CC1GA,IAAAC,EAAoB,yBACpBC,EAA2B,sBAmBTC,OACdA,EAAA,MAAQ,UACRA,EAAA,KAAO,iBACPA,EAAA,SAAW,iBACXA,EAAA,WAAa,iBACbA,EAAA,YAAc,iBACdA,EAAA,WAAa,iBACbA,EAAA,YAAc,iBACdA,EAAA,qBAAuB,iBACvBA,EAAA,YAAc,iBACdA,EAAA,aAAe,iBACfA,EAAA,WAAa,iBACbA,EAAA,UAAY,iBACZA,EAAA,WAAa,iBAbCA,OAAA,IA0BZC,EAA0C,CAC5C,UAAW,iBACX,UAAW,iBACX,WAAY,iBACZ,YAAa,iBACb,aAAc,iBACd,aAAc,iBACd,cAAe,iBACf,cAAe,iBACf,eAAgB,iBAChB,eAAgB,iBAChB,iBAAkB,iBAClB,oBAAqB,iBACrB,qBAAsB,iBACtB,uBAAwB,iBACxB,wBAAyB,iBACzB,8BAA+B,iBAC/B,iCAAkC,gBACtC,EAcaC,EAAN,KAAsB,CAwBzB,YAAoBC,EAA6BC,EAAsBC,EAAkC,CAArF,gBAAAF,EAA6B,UAAAC,EAAsB,YAAAC,CACvE,CAXQ,SAAuD,IAAI,IAmBnE,UAAUC,EAAqB,CAC3B,KAAK,gBAAgBA,CAAI,EACzB,KAAK,gBAAgBA,CAAI,EACzB,KAAK,YAAYA,CAAI,CACzB,CAWA,WAAoB,CAChB,IAAIC,EAAqB,EACrBC,EAEEC,EAAwB,CAAC,EAK/B,OAJiB,MAAM,KACnB,KAAK,SAAS,OAAO,CACzB,EAAE,KAAK,CAACC,EAAGC,IAAMD,EAAE,MAAQC,EAAE,OAASD,EAAE,IAAMC,EAAE,GAAG,EAE1C,QAASC,GAAY,CAC1B,GAAIJ,GAAUI,EAAQ,MAAQJ,EAAO,IAAK,CACtC,IAAMK,EAAcJ,EAAO,IAAI,EAC/B,GAAI,CAACI,EAAa,OAElB,IAAMC,EAAS,KAAK,iBAAiBF,EAAQ,MAAOA,EAAQ,GAAG,EACzDG,EAAiB,GAAIH,EAAQ,KAAM,GAAIE,CAAO,GAAIN,EAAO,KAAM,GACrEC,EAAO,KAAKI,EAAY,QAAQC,EAAQC,CAAc,CAAC,EAEvD,MACJ,CAEAN,EAAO,KAAK,KAAK,iBAAiBF,EAAoBK,EAAQ,KAAK,CAAC,EACpEH,EAAO,KAAK,GAAIG,EAAQ,KAAM,GAAI,KAAK,iBAAiBA,EAAQ,MAAOA,EAAQ,GAAG,CAAE,GAAIA,EAAQ,KAAM,EAAE,EACxGL,EAAqBK,EAAQ,IAC7BJ,EAASI,CACb,CAAC,EAEMH,EAAO,KAAK,EAAE,EAAI,KAAK,iBAAiBF,CAAkB,CACrE,CAcQ,iBAAiBS,EAAeC,EAAsB,CAC1D,OAAO,KAAK,KAAK,MAAMD,EAAOC,CAAG,CACrC,CAYQ,WAAWD,EAAeC,EAAaC,EAAeC,EAAgB,UAAc,CACxF,IAAMC,EAAM,GAAIJ,CAAM,IAAKC,CAAI,GAC/B,KAAK,SAAS,IAAIG,EAAK,CAAE,MAAAJ,EAAO,IAAAC,EAAK,MAAAC,EAAO,MAAAC,CAAM,CAAC,CACvD,CASQ,gBAAgBb,EAAqB,CACxB,CACb,GAAM,2BAAyB,KAAK,WAAW,YAAY,EAAGA,EAAK,aAAa,CAAC,GAAK,CAAC,EACvF,GAAM,0BAAwB,KAAK,WAAW,YAAY,EAAGA,EAAK,aAAa,CAAC,GAAK,CAAC,CAC1F,EAES,QAAQe,GAAW,KAAK,WAAWA,EAAQ,IAAKA,EAAQ,IAAK,KAAK,OAAO,YAAY,CAAC,CACnG,CAiBQ,gBAAgBf,EAAqB,CACzC,GAAI,CACA,aAAW,YACX,aAAW,YACX,aAAW,cACX,aAAW,cACX,aAAW,eACX,aAAW,gBACf,EAAE,SAASA,EAAK,IAAI,EAChB,OAAO,KAAK,WAAWA,EAAK,SAAS,EAAGA,EAAK,OAAO,EAAG,KAAK,OAAO,SAAS,EAG5EA,GAAQA,EAAK,MAAW,aAAW,cAAgBA,EAAK,MAAW,aAAW,aAC9E,KAAK,WAAWA,EAAK,SAAS,EAAGA,EAAK,OAAO,EAAG,KAAK,OAAO,YAAY,CAEhF,CAaQ,kBAAkBA,EAAqB,CAC3C,IAAMW,EAAMX,EAAK,OAAO,EAClBU,EAAQV,EAAK,SAAS,EAE5B,OAAQA,EAAK,OAAO,KAAM,CACtB,KAAQ,aAAW,WACf,OAAO,KAAK,WAAWU,EAAOC,EAAK,KAAK,OAAO,SAAS,EAC5D,KAAQ,aAAW,eACnB,KAAQ,aAAW,gBACnB,KAAQ,aAAW,kBACnB,KAAQ,aAAW,kBACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,aAAa,EAChE,KAAQ,aAAW,qBACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,cAAc,EACjE,KAAQ,aAAW,YACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,gBAAgB,EACnE,KAAQ,aAAW,mBACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,uBAAuB,EAC1E,KAAQ,aAAW,gBACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,oBAAoB,EACvE,KAAQ,aAAW,kBACnB,KAAQ,aAAW,oBACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,aAAa,EAChE,KAAQ,aAAW,iBACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,UAAU,EAC7D,KAAQ,aAAW,UACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,cAAc,EACjE,KAAQ,aAAW,oBACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,aAAa,EAChE,KAAQ,aAAW,oBACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,aAAa,EAChE,KAAQ,aAAW,yBACf,OAAIX,EAAK,OAAO,WAAW,CAAC,EAAE,QAAQ,IAAMA,EAAK,QAAQ,EAC9C,KAAK,WAAWU,EAAOC,EAAK,KAAK,OAAO,aAAa,EAGzD,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,6BAA6B,EAEhF,KAAQ,aAAW,4BACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,gCAAgC,EACnF,KAAQ,aAAW,eACnB,KAAQ,aAAW,4BACnB,KAAQ,aAAW,eACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,aAAa,EAChE,KAAQ,aAAW,iBACnB,KAAQ,aAAW,gBACnB,KAAQ,aAAW,aACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,aAAa,EAChE,KAAQ,aAAW,cACnB,KAAQ,aAAW,qBACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,SAAS,EAC5D,KAAQ,aAAW,cACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,aAAa,CACpE,CACJ,CAYQ,0BAA0BK,EAAiD,CAC/E,IAAMN,EAAQM,EAAmB,KAAK,SAAS,EACzCL,EAAMK,EAAmB,KAAK,OAAO,EAC3C,KAAK,WAAWN,EAAOC,EAAK,KAAK,OAAO,WAAW,EAEnDK,EAAmB,cAAc,QAAQC,GAAQ,CAC7C,IAAMC,EAAYD,EAAK,QAAQ,SAAS,EAClCE,EAAUF,EAAK,QAAQ,OAAO,EACpC,KAAK,WAAWC,EAAWC,EAAS,KAAK,OAAO,WAAW,CAC/D,CAAC,CACL,CAYQ,YAAYnB,EAAqB,CACrC,IAAMU,EAAQV,EAAK,SAAS,EACtBW,EAAMX,EAAK,OAAO,EAExB,OAAQA,EAAK,KAAM,CACf,KAAQ,aAAW,cACf,OAAO,KAAK,WAAWU,EAAOA,EAASV,EAAqC,KAAK,KAAK,OAAQ,KAAK,OAAO,SAAS,EACvH,KAAQ,aAAW,cACf,OAAO,KAAK,WAAWU,EAAOC,EAAK,KAAK,OAAO,SAAS,EAC5D,KAAQ,aAAW,cACnB,KAAQ,aAAW,8BACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,WAAW,EAC9D,KAAQ,aAAW,yBACf,OAAO,KAAK,WAAWD,EAAOC,EAAK,KAAK,OAAO,sBAAsB,EACzE,KAAQ,aAAW,mBACf,OAAO,KAAK,0BAA0BX,CAA6B,EACvE,KAAQ,aAAW,WACf,OAAO,KAAK,kBAAkBA,CAAI,EACtC,KAAQ,aAAW,cACnB,KAAQ,aAAW,eACf,OAAO,KAAK,WAAWU,EAAOC,EAAK,KAAK,OAAO,mBAAmB,CAC1E,CACJ,CACJ,EAuBO,SAASS,EAActB,EAAcC,EAA4C,CAAC,EAAG,CACxF,IAAMF,EAAgB,mBAAiB,UAAWC,EAAS,eAAa,OAAQ,GAAS,aAAW,EAAE,EAChGuB,EAAkB,IAAIzB,EAAgBC,EAAYC,EAAM,OAAO,OAAOH,EAAeI,CAAM,CAAC,EAElG,SAASuB,EAAKtB,EAAqB,CAC/BqB,EAAgB,UAAUrB,CAAI,EAE9B,QAASuB,EAAI,EAAGA,EAAIvB,EAAK,cAAc,EAAGuB,IACtCD,EAAKtB,EAAK,WAAWuB,CAAC,CAAC,CAE/B,CAAE,OAAG,eAAa1B,EAAYyB,CAAI,EAE3BD,EAAgB,UAAU,CACrC,CC1XO,IAAMG,EAAN,KAAoB,CAKd,KAMA,WAMQ,MAMA,QAMA,SAMA,eAYjB,YAAYC,EAA4B,CACpC,KAAK,kBAAkBA,CAAM,EAE7B,KAAK,KAAOA,EAAO,MAAQ,KAC3B,KAAK,MAAQA,EAAO,OAAS,CAAC,EAC9B,KAAK,QAAUA,EAAO,SAAW,CAAC,EAClC,KAAK,SAAW,CAAC,EACjB,KAAK,WAAaA,EAAO,YAAc,KACvC,KAAK,eAAiBA,EAAO,gBAAkB,CAAC,EAChD,KAAK,eAAeA,EAAO,QAAQ,CACvC,CAkBA,cAAmC,CAC/B,IAAMC,EAAgC,CAClC,QAAS,EACT,MAAO,KAAK,MACZ,QAAS,KAAK,QACd,SAAU,KAAK,eAAe,KAAK,QAAQ,EAC3C,eAAgB,KAAK,cACzB,EAEA,OAAG,KAAK,OACJA,EAAU,KAAO,KAAK,MAEtB,KAAK,aACLA,EAAU,WAAa,KAAK,YAEzBA,CACX,CA0DA,wBAAwBC,EAA4BC,EAAcC,EAAgBC,EAAkE,CAChJ,IAAIC,EAAkBJ,EAItB,GAHI,OAAOA,GAAc,WACrBI,EAAQ,KAAK,QAAQ,UAAUC,GAAOA,EAAI,SAASL,CAAS,CAAC,GAE7DI,EAAQ,EACR,OAAO,KAEX,IAAME,EAAW,OAAO,OAAO,CAC3B,OACA,WAAY,EACZ,YAAa,CACjB,EAAGH,CAAO,EAEJI,EAAM,KAAK,gBAAgBN,EAAMC,EAAQI,EAAS,KAAMF,EAAO,aAAc,cAAc,EAEjG,OAAO,KAAK,sBAAsBG,EAAKD,CAAQ,CACnD,CA6CA,kBAAkBL,EAAcC,EAAgBC,EAAkE,CAC9G,IAAMG,EAAW,OAAO,OAAO,CAC3B,OACA,WAAY,EACZ,YAAa,CACjB,EAAGH,CAAO,EAEJI,EAAM,KAAK,gBAAgBN,EAAMC,EAAQI,EAAS,IAAI,EAE5D,OAAO,KAAK,sBAAsBC,EAAKD,CAAQ,CACnD,CAqCA,YAAYL,EAAcC,EAAgBM,IAAyD,CAC/F,IAAMD,EAAM,KAAK,gBAAgBN,EAAMC,EAAQM,CAAI,EACnD,OAAKD,GAIE,CACH,KAAMA,EAAI,WACV,KAAM,KAAK,MAAMA,EAAI,WAAa,EAAE,GAAK,KACzC,OAAQA,EAAI,aACZ,OAAQ,KAAK,QAAQA,EAAI,SAAS,EAClC,WAAY,KAAK,UACrB,CACJ,CAmBA,UAAUE,EAAuC,CAC7C,GAAIA,EAAK,OAAS,EACd,MAAM,IAAI,MAAM,sDAAsD,EAG1E,QAAWF,KAAOE,EAAM,CACpB,KAAK,MAAM,KAAK,GAAGF,EAAI,KAAK,EAC5B,KAAK,QAAQ,KAAK,GAAGA,EAAI,OAAO,EAChC,KAAK,eAAe,KAAK,GAAGA,EAAI,cAAc,EAE9C,IAAMG,EAAc,KAAK,SAAS,KAAK,SAAS,OAAS,CAAC,EACpDC,EAAQ,KAAK,eAAeD,EAAY,SAAS,EAAE,MAAM;AAAA,CAAI,EAAE,OAErE,KAAK,eAAeD,EAAK,CAAC,EAAE,SAAU,CAClC,UAAW,KAAK,MAAM,OAAS,EAC/B,UAAW,KAAK,QAAQ,OAAS,EACjC,cAAeE,EAAQ,EAAI,EAAIA,CACnC,CAAC,CACL,CACJ,CAgBA,UAAmB,CACf,OAAO,KAAK,UAAU,KAAK,aAAa,CAAC,CAC7C,CAkDQ,sBAAsBJ,EAA8BD,EAA6E,CACrI,GAAI,CAACC,GAAO,MAAMA,EAAI,SAAS,EAC3B,OAAO,KAGX,IAAMK,EAAO,KAAK,eAAeL,EAAI,SAAS,EAAE,MAAM;AAAA,CAAI,EACpDM,GAAWN,EAAI,YAAc,GAAKD,EAAS,WAC3CQ,EAAY,KAAK,KAAKP,EAAI,YAAc,GAAKD,EAAS,YAAa,CAAC,EAG1E,MAAO,CACH,KAHiBM,EAAK,MAAME,EAAW,KAAK,IAAID,EAAU,EAAGD,EAAK,MAAM,CAAC,EAAE,KAAK;AAAA,CAAI,EAIpF,KAAML,EAAI,WACV,KAAK,KAAK,MAAMA,EAAI,WAAa,EAAE,GAAK,KACxC,OAAQA,EAAI,aACZ,QAASM,EACT,UAAWC,EACX,OAAQ,KAAK,QAAQP,EAAI,SAAS,EAClC,WAAY,KAAK,UACrB,CACJ,CA8BQ,kBAAkBQ,EAAiC,CAEvD,GAAI,CAD+C,CAAE,UAAW,UAAW,iBAAkB,WAAY,OAAQ,EAC/F,MAAMC,GAAOA,KAAOD,CAAK,EACvC,MAAM,IAAI,MAAM,qCAAqC,CAE7D,CAuCQ,eAAeE,EAAyBC,EAAoD,CAGhG,IAAMC,EAAQ,OAAO,OAAO,CACxB,UAAW,EACX,UAAW,EACX,WAAY,EACZ,aAAc,EACd,cAAe,EACf,gBAAiB,CACrB,EAAGD,CAAgB,EAEnB,GAAI,CACA,OAAW,CAAEE,EAAeC,CAAe,IAAKJ,EAAgB,MAAM,GAAG,EAAE,QAAQ,EAAG,CAClF,GAAI,CAACI,EAAgB,SACrBF,EAAM,gBAAkB,EACxB,IAAMG,EAAWD,EAAe,MAAM,GAAG,EAEzC,QAAWE,KAAWD,EAAU,CAC5B,GAAIC,EAAQ,OAAS,EAAG,SACxB,IAAMC,EAAiBC,EAAUF,CAAO,EAExC,KAAK,eAAeJ,EAAOK,EAAgBJ,EAAgBD,EAAM,aAAa,CAClF,CACJ,CACJ,OAASO,EAAO,CACZ,MAAM,IAAI,MAAM,4BAAqCA,EAAO,OAAQ,EAAE,CAC1E,CACJ,CAwCQ,eAAeP,EAA8BK,EAA+BJ,EAA6B,CAC7G,GAAM,CAAEO,EAAiB3B,EAAW4B,EAAYC,EAAcC,CAAU,EAAIN,EAC5EL,EAAM,WAAanB,EACnBmB,EAAM,WAAaW,GAAa,EAChCX,EAAM,YAAcS,EACpBT,EAAM,cAAgBU,EACtBV,EAAM,iBAAmBQ,EAEzB,KAAK,SAAS,KAAK,CACf,UAAYG,IAAc,OAAaX,EAAM,UAAY,KACzD,UAAWA,EAAM,UACjB,WAAYA,EAAM,WAClB,aAAcA,EAAM,aACpB,cAAeC,EACf,gBAAiBD,EAAM,eAC3B,CAAC,CACL,CAiCQ,eAAeY,EAA2C,CAC9D,IAAIC,EAAgB,GAChBV,EAA0B,CAAC,EAEzBH,EAAQ,CACV,UAAW,EACX,UAAW,EACX,WAAY,EACZ,aAAc,EACd,cAAe,EACf,gBAAiB,CACrB,EAEAA,EAAM,cAAgBY,EAAS,CAAC,EAAE,cAClCC,GAAiB,IAAI,OAAOb,EAAM,cAAgB,CAAC,EAEnD,QAAWZ,KAAOwB,EACVxB,EAAI,gBAAkBY,EAAM,gBAC5Ba,GAAiBV,EAAS,KAAK,GAAG,EAClCU,GAAiB,IAAI,OAAO,KAAK,IAAI,EAAGzB,EAAI,cAAgBY,EAAM,aAAa,CAAC,EAEhFG,EAAW,CAAC,EACZH,EAAM,cAAgBZ,EAAI,cAC1BY,EAAM,gBAAkB,GAG5B,KAAK,cAAcZ,EAAKe,EAAUH,CAAK,EAG3C,OAAOa,EAAgBV,EAAS,KAAK,GAAG,EAAI,GAChD,CAqCQ,cAAcf,EAAuBe,EAAyBH,EAAoC,CACtG,IAAMI,EAAyB,CAAC,EAC1BU,EAAc1B,EAAI,UAYxB,GAVAgB,EAAQ,CAAC,EAAI,EACbA,EAAQ,CAAC,EAAIhB,EAAI,WAAaY,EAAM,WACpCI,EAAQ,CAAC,EAAIhB,EAAI,aAAeY,EAAM,aACtCI,EAAQ,CAAC,EAAIhB,EAAI,gBAAkBY,EAAM,gBAErCc,IAAgBd,EAAM,YACtBI,EAAQ,CAAC,EAAIU,EAAcd,EAAM,UACjCA,EAAM,UAAYc,GAGlB1B,EAAI,UAAW,CACf,IAAMuB,EAAYvB,EAAI,UACtBgB,EAAQ,CAAC,EAAIO,EAAYX,EAAM,UAC/BA,EAAM,UAAYW,CACtB,CAEAX,EAAM,WAAaZ,EAAI,WACvBY,EAAM,aAAeZ,EAAI,aACzBY,EAAM,gBAAkBZ,EAAI,gBAC5Be,EAAS,KAAKY,EAAeX,CAAO,CAAC,CACzC,CAgBQ,kBAAkBY,EAA2BnC,EAA4B,CAC7E,OAAOA,IAAc,IAAMmC,EAAQ,YAAcnC,CACrD,CAwBQ,gBACJC,EACAC,EACAM,IACAR,EAAoB,GACpBoC,EAA0C,gBAC1CC,EAAgD,kBACzB,CACvB,IAAIC,EAAa,EACbC,EAAW,KAAK,SAAS,OAAS,EAClCC,EAA0C,KAE9C,KAAOF,GAAcC,GAAU,CAC3B,IAAME,EAAc,KAAK,OAAOH,EAAaC,GAAY,CAAC,EACpDG,EAAiB,KAAK,SAASD,CAAW,EAEhD,GAAI,KAAK,kBAAkBC,EAAgB1C,CAAS,EAAG,CACnDsC,EAAaG,EAAc,EAC3B,QACJ,CAEA,IAAME,EAAcD,EAAeN,CAAO,EACpCQ,EAAgBF,EAAeL,CAAS,EAE9C,GAAIM,EAAc1C,EACdqC,EAAaG,EAAc,UACpBE,EAAc1C,EACrBsC,EAAWE,EAAc,UAGrBG,EAAgB1C,EAChBsC,EAAiBhC,IAAS,EAAmBkC,EAAiBF,EAC9DF,EAAaG,EAAc,UACpBG,EAAgB1C,EACvBsC,EAAiBhC,IAAS,EAAmBkC,EAAiBF,EAC9DD,EAAWE,EAAc,MAEzB,QAAOC,CAGnB,CAGA,OAAOF,GAAkBA,EAAeJ,CAAO,IAAMnC,EAAOuC,EAAiB,IACjF,CACJ",
-  "names": ["src_exports", "__export", "CodeHighlighter", "Colors", "SourceService", "decodeVLQ", "encodeArrayVLQ", "encodeVLQ", "formatCode", "formatErrorCode", "highlightCode", "parseErrorStack", "__toCommonJS", "parseErrorStack", "stackString", "lines", "regex", "evalRegex", "stack", "line", "match", "args", "at", "file", "lineNum", "colNum", "lineNumber", "columnNumber", "evalMatch", "evalAt", "evalFile", "evalLineNum", "evalColNum", "evalAnonFile", "base64Map", "base64Chars", "char", "index", "encodeVLQ", "value", "isNegative", "encoded", "vlq", "digit", "encodeArrayVLQ", "values", "decodeVLQ", "data", "result", "shift", "i", "continuation", "shifted", "formatCode", "code", "options", "lines", "padding", "startLine", "lineContent", "index", "currentLineNumber", "string", "formatErrorCode", "sourcePosition", "ansiOption", "errorLine", "errorColumn", "lineString", "line", "pointer", "ansiPadding", "prefixPointer", "errorMarker", "ts", "import_typescript", "Colors", "defaultScheme", "CodeHighlighter", "sourceFile", "code", "schema", "node", "previousSegmentEnd", "parent", "result", "a", "b", "segment", "lastSegment", "source", "combinedSource", "start", "end", "color", "reset", "key", "comment", "templateExpression", "span", "spanStart", "spanEnd", "highlightCode", "codeHighlighter", "walk", "i", "SourceService", "source", "sourceMap", "fileIndex", "line", "column", "options", "index", "str", "settings", "map", "bias", "maps", "lastSegment", "lines", "code", "endLine", "startLine", "input", "key", "encodedMappings", "thresholdSegment", "shift", "generatedLine", "stringSegments", "segments", "segment", "decodedSegment", "decodeVLQ", "error", "generatedColumn", "sourceLine", "sourceColumn", "nameIndex", "mappings", "resultMapping", "sourceIndex", "encodeArrayVLQ", "mapping", "lineKey", "columnKey", "startIndex", "endIndex", "closestMapping", "middleIndex", "currentMapping", "currentLine", "currentColumn"]
-}

package/dist/services/interfaces/source.interface.d.ts

@@ -1,252 +0,0 @@
-/**
- * Interface representing a source map object, which is used to map
- * transformed or compiled code back to its original source.
- * This is typically used in debugging to trace errors or logs in the
- * compiled code back to the original source code.
- */
-export interface SourceMapInterface {
-    /**
-     * The version of the source map specification.
-     * This field is a required number that indicates which version of the source map format is used.
-     *
-     * @example
-     * 3
-     */
-    version: number;
-    /**
-     * The name of the generated file (bundle) that this source map applies to.
-     * This field is optional, and it might not always be present in the source map.
-     *
-     * @example
-     * "bundle.js"
-     */
-    file?: string | null;
-    /**
-     * A VLQ (Variable-Length Quantity) encoded string representing the mapping information
-     * between the transformed code and the original source code. This field is mandatory
-     * and stores the actual mapping data in a compact format.
-     *
-     * @example
-     * "AAAA,QAASA,IAAIC;..."
-     */
-    mappings: string;
-    /**
-     * A list of variable or function names used in the transformed code,
-     * corresponding to their references in the source code.
-     *
-     * @example
-     * ["myFunction", "myVariable", "otherSymbol"]
-     */
-    names: Array<string>;
-    /**
-     * An array of source file paths. Each path corresponds to a source file that was part of the original code,
-     * allowing for a reverse mapping to the source files.
-     *
-     * @example
-     * ["src/file1.ts", "src/file2.ts"]
-     */
-    sources: Array<string>;
-    /**
-     * An array of the contents of the source files, corresponding to the paths in the `sources` array.
-     * If available, this field allows viewing the original source code within the source map file.
-     *
-     * @example
-     * ["function myFunction() {...}", "const myVariable = 10;"]
-     */
-    sourcesContent: Array<string>;
-    /**
-     * An optional prefix that is added to the source file paths in the `sources` array.
-     * This is useful when the paths in the `sources` field are relative and need to be resolved
-     * against a common root directory. It helps organize and locate the original source files.
-     *
-     * @example
-     * "/source/root"
-     */
-    sourceRoot?: string | null;
-}
-/**
- * Interface representing a mapping between generated and original source code.
- * This is used to connect positions in the compiled/generated code to their
- * corresponding positions in the original source code, allowing for debugging
- * and error tracking.
- */
-export interface MappingInterface {
-    /**
-     * The index in the `names` array that refers to a symbol (such as a function or variable name)
-     * in the original source. If there is no corresponding name, this will be `null`.
-     *
-     * @example
-     * 3
-     */
-    nameIndex: number | null;
-    /**
-     * The index in the `sources` array that refers to the file in which the original code is located.
-     *
-     * @example
-     * 1
-     */
-    fileIndex: number;
-    /**
-     * The line number in the original source code (1-based index).
-     *
-     * @example
-     * 25
-     */
-    sourceLine: number;
-    /**
-     * The column number in the original source code (0-based index).
-     *
-     * @example
-     * 12
-     */
-    sourceColumn: number;
-    /**
-     * The line number in the generated (compiled/transpiled) code (1-based index).
-     *
-     * @example
-     * 32
-     */
-    generatedLine: number;
-    /**
-     * The column number in the generated (compiled/transpiled) code (0-based index).
-     *
-     * @example
-     * 8
-     */
-    generatedColumn: number;
-}
-/**
- * Internal interface used to track the current state during decoding and encoding mappings.
- * This interface keeps track of the current mapping segment and is primarily used in the
- * process of transforming source maps. Not intended for external use.
- */
-export interface ShiftSegmentInterface {
-    /**
-     * The index of the source file in the `sources` array.
-     */
-    fileIndex: number;
-    /**
-     * The index of the name in the `names` array. May be `null` if there is no associated name.
-     */
-    nameIndex: number;
-    /**
-     * The line number in the original source code.
-     */
-    sourceLine: number;
-    /**
-     * The column number in the original source code.
-     */
-    sourceColumn: number;
-    /**
-     * The line number in the generated code.
-     */
-    generatedLine: number;
-    /**
-     * The column number in the generated code.
-     */
-    generatedColumn: number;
-}
-/**
- * Internal interface used to track offsets during source map concatenation.
- * This interface helps handle transitions between different source maps
- * and offsets. Not intended for external use.
- */
-export interface ThresholdSegmentInterface {
-    /**
-     * Optional index of the source file in the `sources` array, used for tracking offsets.
-     */
-    fileIndex?: number;
-    /**
-     * Optional index of the name in the `names` array, used for tracking name offsets.
-     */
-    nameIndex?: number;
-    /**
-     * Optional line number in the generated code, used for tracking line offsets.
-     */
-    generatedLine?: number;
-}
-/**
- * Interface representing a position in the source code.
- * This is used to pinpoint an exact location in the source code (line, column),
- * along with the name and the file path (source) where the position occurs.
- */
-export interface PositionInterface {
-    /**
-     * The line number in the source code (1-based index).
-     */
-    line: number;
-    /**
-     * The column number in the source code (0-based index).
-     */
-    column: number;
-    /**
-     * The name associated with this position, if any.
-     * If no name is associated, this will be `null`.
-     */
-    name: string | null;
-    /**
-     * The path or name of the source file.
-     */
-    source: string;
-    /**
-     * The root URL for the sources, if present in the source map.
-     */
-    sourceRoot: string | null;
-}
-/**
- * Interface representing a position in the source code with additional context.
- * Extends `PositionInterface` by adding the actual code snippet and range information.
- */
-export interface PositionSourceInterface extends PositionInterface {
-    /**
-     * A snippet of the actual code at this position.
-     */
-    code: string;
-    /**
-     * The ending line number (1-based index) of the code range.
-     */
-    endLine: number;
-    /**
-     * The starting line number (0-based index) of the code range.
-     */
-    startLine: number;
-}
-/**
- * Interface representing options for retrieving source positions.
- * This interface defines options that can modify how source positions
- * are retrieved, including bias settings and surrounding line context.
- */
-export interface SourceOptionsInterface {
-    /**
-     * The bias option for controlling how mappings are searched.
-     * This determines how to handle ambiguities in the source map (e.g., when multiple mappings exist).
-     */
-    bias?: Bias;
-    /**
-     * The number of lines after the target position to include for additional context.
-     */
-    linesAfter?: number;
-    /**
-     * The number of lines before the target position to include for additional context.
-     */
-    linesBefore?: number;
-}
-/**
- * Enumeration representing bias options for searching in mappings.
- * This can control whether the search favors the closest lower-bound or upper-bound
- * mapping when looking for a corresponding position in the source map.
- */
-export declare const enum Bias {
-    /**
-     * No specific bias is applied when searching for a mapping.
-     */
-    BOUND = 0,
-    /**
-     * Search for the closest lower-bound mapping.
-     */
-    LOWER_BOUND = 1,
-    /**
-     * Search for the closest upper-bound mapping.
-     */
-    UPPER_BOUND = 2
-}