@pinia/colada-devtools 0.2.0 → 0.3.0

package/dist-panel/{index-CTwvPt67.js → index-BDRe8hqi.js}

@@ -18,7 +18,7 @@ const $ = {}, Ht = [], ze = () => {
   return ((r) => t[r] || (t[r] = e(r)));
 }, Xs = /-\w/g, _e = qr(
   (e) => e.replace(Xs, (t) => t.slice(1).toUpperCase())
-), Zs = /\B([A-Z])/g, De = qr(
+), Zs = /\B([A-Z])/g, Ne = qr(
   (e) => e.replace(Zs, "-$1").toLowerCase()
 ), Jr = qr((e) => e.charAt(0).toUpperCase() + e.slice(1)), go = qr(
   (e) => e ? `on${Jr(e)}` : ""
@@ -263,10 +263,10 @@ class bi {
    * @internal
    */
   runIfDirty() {
-    Po(this) && this.run();
+    Oo(this) && this.run();
   }
   get dirty() {
-    return Po(this);
+    return Oo(this);
   }
 }
 let wi = 0, ir, sr;
@@ -318,14 +318,14 @@ function ki(e) {
   }
   e.deps = t, e.depsTail = r;
 }
-function Po(e) {
+function Oo(e) {
   for (let t = e.deps; t; t = t.nextDep)
     if (t.dep.version !== t.version || t.dep.computed && (Ei(t.dep.computed) || t.dep.version !== t.version))
       return !0;
   return !!e._dirty;
 }
 function Ei(e) {
-  if (e.flags & 4 && !(e.flags & 16) || (e.flags &= -17, e.globalVersion === fr) || (e.globalVersion = fr, !e.isSSR && e.flags & 128 && (!e.deps && !e._dirty || !Po(e))))
+  if (e.flags & 4 && !(e.flags & 16) || (e.flags &= -17, e.globalVersion === fr) || (e.globalVersion = fr, !e.isSSR && e.flags & 128 && (!e.deps && !e._dirty || !Oo(e))))
     return;
   e.flags |= 2;
   const t = e.dep, r = te, o = Be;
@@ -422,11 +422,11 @@ function Ai(e) {
     r !== e && (e.prevSub = r, r && (r.nextSub = e)), e.dep.subs = e;
   }
 }
-const Nr = /* @__PURE__ */ new WeakMap(), Tt = Symbol(
+const Nr = /* @__PURE__ */ new WeakMap(), Tt = /* @__PURE__ */ Symbol(
   ""
-), Oo = Symbol(
+), Po = /* @__PURE__ */ Symbol(
   ""
-), dr = Symbol(
+), dr = /* @__PURE__ */ Symbol(
   ""
 );
 function be(e, t, r) {
@@ -458,10 +458,10 @@ function st(e, t, r, o, n, i) {
     } else
       switch ((r !== void 0 || s.has(void 0)) && l(s.get(r)), f && l(s.get(dr)), t) {
         case "add":
-          a ? f && l(s.get("length")) : (l(s.get(Tt)), zt(e) && l(s.get(Oo)));
+          a ? f && l(s.get("length")) : (l(s.get(Tt)), zt(e) && l(s.get(Po)));
           break;
         case "delete":
-          a || (l(s.get(Tt)), zt(e) && l(s.get(Oo)));
+          a || (l(s.get(Tt)), zt(e) && l(s.get(Po)));
           break;
         case "set":
           zt(e) && l(s.get(Tt));
@@ -482,7 +482,7 @@ function eo(e) {
   return be(e = W(e), "iterate", dr), e;
 }
 function yt(e, t) {
-  return dt(e) ? Pt(e) ? Gt(We(t)) : Gt(t) : We(t);
+  return dt(e) ? Ot(e) ? Gt(We(t)) : Gt(t) : We(t);
 }
 const hl = {
   __proto__: null,
@@ -659,7 +659,7 @@ class Ci {
     if (r === "__v_isShallow")
       return i;
     if (r === "__v_raw")
-      return o === (n ? i ? Mi : Ni : i ? Ii : Oi).get(t) || // receiver is not the reactive proxy, but has the same prototype
+      return o === (n ? i ? Mi : Ni : i ? Ii : Pi).get(t) || // receiver is not the reactive proxy, but has the same prototype
       // this means the receiver is a user proxy of the reactive proxy
       Object.getPrototypeOf(t) === Object.getPrototypeOf(o) ? t : void 0;
     const s = F(t);
@@ -725,7 +725,7 @@ class Ti extends Ci {
     ), Reflect.ownKeys(t);
   }
 }
-class Pi extends Ci {
+class Oi extends Ci {
   constructor(t = !1) {
     super(!0, t);
   }
@@ -736,14 +736,14 @@ class Pi extends Ci {
     return !0;
   }
 }
-const vl = /* @__PURE__ */ new Ti(), yl = /* @__PURE__ */ new Pi(), bl = /* @__PURE__ */ new Ti(!0), wl = /* @__PURE__ */ new Pi(!0), Io = (e) => e, Er = (e) => Reflect.getPrototypeOf(e);
+const vl = /* @__PURE__ */ new Ti(), yl = /* @__PURE__ */ new Oi(), bl = /* @__PURE__ */ new Ti(!0), wl = /* @__PURE__ */ new Oi(!0), Io = (e) => e, Er = (e) => Reflect.getPrototypeOf(e);
 function _l(e, t, r) {
   return function(...o) {
     const n = this.__v_raw, i = W(n), s = zt(i), l = e === "entries" || e === Symbol.iterator && s, a = e === "keys" && s, f = n[e](...o), c = r ? Io : t ? Gt : We;
     return !t && be(
       i,
       "iterate",
-      a ? Oo : Tt
+      a ? Po : Tt
     ), {
       // iterator protocol
       next() {
@@ -853,7 +853,7 @@ const kl = {
   get: /* @__PURE__ */ to(!0, !1)
 }, Al = {
   get: /* @__PURE__ */ to(!0, !0)
-}, Oi = /* @__PURE__ */ new WeakMap(), Ii = /* @__PURE__ */ new WeakMap(), Ni = /* @__PURE__ */ new WeakMap(), Mi = /* @__PURE__ */ new WeakMap();
+}, Pi = /* @__PURE__ */ new WeakMap(), Ii = /* @__PURE__ */ new WeakMap(), Ni = /* @__PURE__ */ new WeakMap(), Mi = /* @__PURE__ */ new WeakMap();
 function Rl(e) {
   switch (e) {
     case "Object":
@@ -877,7 +877,7 @@ function ro(e) {
     !1,
     vl,
     kl,
-    Oi
+    Pi
   );
 }
 function Di(e) {
@@ -922,8 +922,8 @@ function oo(e, t, r, o, n) {
   );
   return n.set(e, l), l;
 }
-function Pt(e) {
-  return dt(e) ? Pt(e.__v_raw) : !!(e && e.__v_isReactive);
+function Ot(e) {
+  return dt(e) ? Ot(e.__v_raw) : !!(e && e.__v_isReactive);
 }
 function dt(e) {
   return !!(e && e.__v_isReadonly);
@@ -952,9 +952,9 @@ function ct(e) {
   return Fi(e, !0);
 }
 function Fi(e, t) {
-  return ue(e) ? e : new Pl(e, t);
+  return ue(e) ? e : new Ol(e, t);
 }
-class Pl {
+class Ol {
   constructor(t, r) {
     this.dep = new Zr(), this.__v_isRef = !0, this.__v_isShallow = !1, this._rawValue = r ? t : W(t), this._value = r ? t : We(t), this.__v_isShallow = r;
   }
@@ -972,7 +972,7 @@ function Ue(e) {
 function He(e) {
   return H(e) ? e() : Ue(e);
 }
-const Ol = {
+const Pl = {
   get: (e, t, r) => t === "__v_raw" ? e : Ue(Reflect.get(e, t, r)),
   set: (e, t, r, o) => {
     const n = e[t];
@@ -980,7 +980,7 @@ const Ol = {
   }
 };
 function Vi(e) {
-  return Pt(e) ? e : new Proxy(e, Ol);
+  return Ot(e) ? e : new Proxy(e, Pl);
 }
 class Il {
   constructor(t) {
@@ -1075,10 +1075,10 @@ function Ll(e, t = !1, r = At) {
 function Hl(e, t, r = $) {
   const { immediate: o, deep: n, once: i, scheduler: s, augmentJob: l, call: a } = r, f = (R) => n ? R : je(R) || n === !1 || n === 0 ? lt(R, 1) : lt(R);
   let c, d, m, g, k = !1, x = !1;
-  if (ue(e) ? (d = () => e.value, k = je(e)) : Pt(e) ? (d = () => f(e), k = !0) : F(e) ? (x = !0, k = e.some((R) => Pt(R) || je(R)), d = () => e.map((R) => {
+  if (ue(e) ? (d = () => e.value, k = je(e)) : Ot(e) ? (d = () => f(e), k = !0) : F(e) ? (x = !0, k = e.some((R) => Ot(R) || je(R)), d = () => e.map((R) => {
     if (ue(R))
       return R.value;
-    if (Pt(R))
+    if (Ot(R))
       return f(R);
     if (H(R))
       return a ? a(R, 2) : R();
@@ -1111,12 +1111,12 @@ function Hl(e, t, r = $) {
       R(...B), S();
     };
   }
-  let P = x ? new Array(e.length).fill(Ar) : Ar;
+  let O = x ? new Array(e.length).fill(Ar) : Ar;
   const I = (R) => {
     if (!(!(c.flags & 1) || !c.dirty && !R))
       if (t) {
         const B = c.run();
-        if (n || k || (x ? B.some((ne, q) => Ie(ne, P[q])) : Ie(B, P))) {
+        if (n || k || (x ? B.some((ne, q) => Ie(ne, O[q])) : Ie(B, O))) {
           m && m();
           const ne = At;
           At = c;
@@ -1124,10 +1124,10 @@ function Hl(e, t, r = $) {
             const q = [
               B,
               // pass undefined as the old value when it's changed for the first time
-              P === Ar ? void 0 : x && P[0] === Ar ? [] : P,
+              O === Ar ? void 0 : x && O[0] === Ar ? [] : O,
               g
             ];
-            P = B, a ? a(t, 3, q) : (
+            O = B, a ? a(t, 3, q) : (
               // @ts-expect-error
               t(...q)
             );
@@ -1147,7 +1147,7 @@ function Hl(e, t, r = $) {
         for (const B of R) B();
       Mr.delete(c);
     }
-  }, t ? o ? I(!0) : P = c.run() : s ? s(I.bind(null, !0), !0) : c.run(), S.pause = c.pause.bind(c), S.resume = c.resume.bind(c), S.stop = S, S;
+  }, t ? o ? I(!0) : O = c.run() : s ? s(I.bind(null, !0), !0) : c.run(), S.pause = c.pause.bind(c), S.resume = c.resume.bind(c), S.stop = S, S;
 }
 function lt(e, t = 1 / 0, r) {
   if (t <= 0 || !Z(e) || e.__v_skip || (r = r || /* @__PURE__ */ new Map(), (r.get(e) || 0) >= t))
@@ -1317,7 +1317,7 @@ function rr(e, t = ge, r) {
   };
   return o._n = !0, o._c = !0, o._d = !0, o;
 }
-function Cf(e, t) {
+function Tf(e, t) {
   if (ge === null)
     return e;
   const r = ho(ge), o = e.dirs || (e.dirs = []);
@@ -1351,7 +1351,7 @@ function Et(e, t, r, o) {
     ]), ft());
   }
 }
-const Ul = Symbol("_vte"), Kl = (e) => e.__isTeleport, $l = Symbol("_leaveCb");
+const Ul = /* @__PURE__ */ Symbol("_vte"), Kl = (e) => e.__isTeleport, $l = /* @__PURE__ */ Symbol("_leaveCb");
 function tn(e, t) {
   e.shapeFlag & 6 && e.component ? (e.transition = t, tn(e.component.subTree, t)) : e.shapeFlag & 128 ? (e.ssContent.transition = t.clone(e.ssContent), e.ssFallback.transition = t.clone(e.ssFallback)) : e.transition = t;
 }
@@ -1366,7 +1366,7 @@ function Nt(e, t) {
 function $i(e) {
   e.ids = [e.ids[0] + e.ids[2]++ + "-", 0, 0];
 }
-function Tf(e) {
+function Of(e) {
   const t = gt(), r = ct(null);
   if (t) {
     const n = t.refs === $ ? t.refs = {} : t.refs;
@@ -1421,8 +1421,8 @@ function lr(e, t, r, o, n = !1) {
           else if (k)
             c[a] = [i], g(a) && (d[a] = c[a]);
           else {
-            const P = [i];
-            a.value = P, e.k && (c[e.k] = P);
+            const O = [i];
+            a.value = O, e.k && (c[e.k] = O);
           }
         } else k ? (c[a] = s, g(a) && (d[a] = s)) : x && (a.value = s, e.k && (c[e.k] = s));
       };
@@ -1430,7 +1430,7 @@ function lr(e, t, r, o, n = !1) {
         const S = () => {
           M(), Vr.delete(e);
         };
-        S.id = -1, Vr.set(e, S), Me(S, r);
+        S.id = -1, Vr.set(e, S), De(S, r);
       } else
         yn(e), M();
     }
@@ -1503,7 +1503,7 @@ const Ji = "components";
 function bn(e, t) {
   return Qi(Ji, e, !0, t) || e;
 }
-const Yi = Symbol.for("v-ndc");
+const Yi = /* @__PURE__ */ Symbol.for("v-ndc");
 function Pf(e) {
   return le(e) ? Qi(Ji, e, !1) || e : e || Yi;
 }
@@ -1535,7 +1535,7 @@ function ra(e, t, r, o) {
   let n;
   const i = r, s = F(e);
   if (s || le(e)) {
-    const l = s && Pt(e);
+    const l = s && Ot(e);
     let a = !1, f = !1;
     l && (a = !je(e), f = dt(e), e = eo(e)), n = new Array(e.length);
     for (let c = 0, d = e.length; c < d; c++)
@@ -1678,7 +1678,7 @@ const No = (e) => e ? _s(e) ? ho(e) : No(e.parent) : null, ar = (
     return r.get != null ? e._.accessCache[t] = 0 : G(r, "value") && this.set(e, t, r.value, null), Reflect.defineProperty(e, t, r);
   }
 };
-function Of() {
+function If() {
   return na().slots;
 }
 function na(e) {
@@ -1691,7 +1691,7 @@ function jr(e) {
     {}
   ) : e;
 }
-function If(e, t) {
+function Nf(e, t) {
   return !e || !t ? e || t : F(e) && F(t) ? e.concat(t) : ce({}, jr(e), jr(t));
 }
 let Mo = !0;
@@ -1715,7 +1715,7 @@ function ia(e) {
     activated: x,
     deactivated: M,
     beforeDestroy: S,
-    beforeUnmount: P,
+    beforeUnmount: O,
     destroyed: I,
     unmounted: R,
     render: B,
@@ -1742,7 +1742,7 @@ function ia(e) {
   }
   if (Mo = !0, i)
     for (const X in i) {
-      const Y = i[X], rt = H(Y) ? Y.bind(r, r) : H(Y.get) ? Y.get.bind(r, r) : ze, mt = !H(Y) && H(Y.set) ? Y.set.bind(r) : ze, qe = oe({
+      const Y = i[X], rt = H(Y) ? Y.bind(r, r) : H(Y.get) ? Y.get.bind(r, r) : ze, mt = !H(Y) && H(Y.set) ? Y.set.bind(r) : ze, qe = re({
         get: rt,
         set: mt
       });
@@ -1766,7 +1766,7 @@ function ia(e) {
   function J(X, Y) {
     F(Y) ? Y.forEach((rt) => X(rt.bind(r))) : Y && X(Y.bind(r));
   }
-  if (J(Jl, d), J(xr, m), J(qi, g), J(Yl, k), J(Wl, x), J(Gl, M), J(ta, me), J(ea, ne), J(Zl, q), J(Ql, P), J(ao, R), J(Xl, xe), F(he))
+  if (J(Jl, d), J(xr, m), J(qi, g), J(Yl, k), J(Wl, x), J(Gl, M), J(ta, me), J(ea, ne), J(Zl, q), J(Ql, O), J(ao, R), J(Xl, xe), F(he))
     if (he.length) {
       const X = e.exposed || (e.exposed = {});
       he.forEach((Y) => {
@@ -1985,19 +1985,19 @@ function fa(e, t) {
         return i.provides[c] = d, f;
       },
       runWithContext(c) {
-        const d = Ot;
-        Ot = f;
+        const d = Pt;
+        Pt = f;
         try {
           return c();
         } finally {
-          Ot = d;
+          Pt = d;
         }
       }
     };
     return f;
   };
 }
-let Ot = null;
+let Pt = null;
 function It(e, t) {
   if (we) {
     let r = we.provides;
@@ -2007,8 +2007,8 @@ function It(e, t) {
 }
 function Ce(e, t, r = !1) {
   const o = gt();
-  if (o || Ot) {
-    let n = Ot ? Ot._context.provides : o ? o.parent == null || o.ce ? o.vnode.appContext && o.vnode.appContext.provides : o.parent.provides : void 0;
+  if (o || Pt) {
+    let n = Pt ? Pt._context.provides : o ? o.parent == null || o.ce ? o.vnode.appContext && o.vnode.appContext.provides : o.parent.provides : void 0;
     if (n && e in n)
       return n[e];
     if (arguments.length > 1)
@@ -2016,9 +2016,9 @@ function Ce(e, t, r = !1) {
   }
 }
 function os() {
-  return !!(gt() || Ot);
+  return !!(gt() || Pt);
 }
-const da = Symbol.for("v-scx"), ha = () => Ce(da);
+const da = /* @__PURE__ */ Symbol.for("v-scx"), ha = () => Ce(da);
 function pa(e, t) {
   return co(e, null, t);
 }
@@ -2049,7 +2049,7 @@ function co(e, t, r = $) {
   l.call = (g, k, x) => tt(g, c, k, x);
   let d = !1;
   i === "post" ? l.scheduler = (g) => {
-    Me(g, c && c.suspense);
+    De(g, c && c.suspense);
   } : i !== "sync" && (d = !0, l.scheduler = (g, k) => {
     k ? g() : en(g);
   }), l.augmentJob = (g) => {
@@ -2075,7 +2075,7 @@ function ns(e, t) {
   };
 }
 function va(e, t, r = $) {
-  const o = gt(), n = _e(t), i = De(t), s = is(e, n), l = ji((a, f) => {
+  const o = gt(), n = _e(t), i = Ne(t), s = is(e, n), l = ji((a, f) => {
     let c, d = $, m;
     return ga(() => {
       const g = e[n];
@@ -2103,7 +2103,7 @@ function va(e, t, r = $) {
     };
   }, l;
 }
-const is = (e, t) => t === "modelValue" || t === "model-value" ? e.modelModifiers : e[`${t}Modifiers`] || e[`${_e(t)}Modifiers`] || e[`${De(t)}Modifiers`];
+const is = (e, t) => t === "modelValue" || t === "model-value" ? e.modelModifiers : e[`${t}Modifiers`] || e[`${_e(t)}Modifiers`] || e[`${Ne(t)}Modifiers`];
 function ya(e, t, ...r) {
   if (e.isUnmounted) return;
   const o = e.vnode.props || $;
@@ -2112,7 +2112,7 @@ function ya(e, t, ...r) {
   s && (s.trim && (n = r.map((c) => le(c) ? c.trim() : c)), s.number && (n = r.map(Jo)));
   let l, a = o[l = go(t)] || // also try camelCase event handler (#2249)
   o[l = go(_e(t))];
-  !a && i && (a = o[l = go(De(t))]), a && tt(
+  !a && i && (a = o[l = go(Ne(t))]), a && tt(
     a,
     e,
     6,
@@ -2149,7 +2149,7 @@ function ss(e, t, r = !1) {
   return !i && !l ? (Z(e) && o.set(e, null), null) : (F(i) ? i.forEach((a) => s[a] = null) : ce(s, i), Z(e) && o.set(e, s), s);
 }
 function uo(e, t) {
-  return !e || !Kr(t) ? !1 : (t = t.slice(2).replace(/Once$/, ""), G(e, t[0].toLowerCase() + t.slice(1)) || G(e, De(t)) || G(e, t));
+  return !e || !Kr(t) ? !1 : (t = t.slice(2).replace(/Once$/, ""), G(e, t[0].toLowerCase() + t.slice(1)) || G(e, Ne(t)) || G(e, t));
 }
 function En(e) {
   const {
@@ -2169,7 +2169,7 @@ function En(e) {
     ctx: k,
     inheritAttrs: x
   } = e, M = Fr(e);
-  let S, P;
+  let S, O;
   try {
     if (r.shapeFlag & 4) {
       const R = n || o, B = R;
@@ -2183,7 +2183,7 @@ function En(e) {
           m,
           k
         )
-      ), P = l;
+      ), O = l;
     } else {
       const R = t;
       S = et(
@@ -2194,18 +2194,18 @@ function En(e) {
           d,
           null
         )
-      ), P = t.props ? l : wa(l);
+      ), O = t.props ? l : wa(l);
     }
   } catch (R) {
     cr.length = 0, so(R, e, 1), S = ae(ht);
   }
   let I = S;
-  if (P && x !== !1) {
-    const R = Object.keys(P), { shapeFlag: B } = I;
-    R.length && B & 7 && (i && R.some(Go) && (P = _a(
-      P,
+  if (O && x !== !1) {
+    const R = Object.keys(O), { shapeFlag: B } = I;
+    R.length && B & 7 && (i && R.some(Go) && (O = _a(
+      O,
       i
-    )), I = qt(I, P, !1, !0));
+    )), I = qt(I, O, !1, !0));
   }
   return r.dirs && (I = qt(I, null, !1, !0), I.dirs = I.dirs ? I.dirs.concat(r.dirs) : r.dirs), r.transition && tn(I, r.transition), S = I, Fr(M), S;
 }
@@ -2314,7 +2314,7 @@ function Sa(e, t, r, o) {
       (!t || // for camelCase
       !G(t, d) && // it's possible the original props was passed in as kebab-case
       // and converted to camelCase (#955)
-      ((c = De(d)) === d || !G(t, c))) && (a ? r && // for camelCase
+      ((c = Ne(d)) === d || !G(t, c))) && (a ? r && // for camelCase
       (r[d] !== void 0 || // for kebab-case
       r[c] !== void 0) && (n[d] = Fo(
         a,
@@ -2384,7 +2384,7 @@ function Fo(e, t, r, o, n, i) {
     ] && (i && !l ? o = !1 : s[
       1
       /* shouldCastTrue */
-    ] && (o === "" || o === De(r)) && (o = !0));
+    ] && (o === "" || o === Ne(r)) && (o = !0));
   }
   return o;
 }
@@ -2418,7 +2418,7 @@ function fs(e, t, r = !1) {
         let x = !1, M = !0;
         if (F(k))
           for (let S = 0; S < k.length; ++S) {
-            const P = k[S], I = H(P) && P.name;
+            const O = k[S], I = H(O) && O.name;
             if (I === "Boolean") {
               x = !0;
               break;
@@ -2480,11 +2480,11 @@ const rn = (e) => e === "_" || e === "_ctx" || e === "$stable", on = (e) => F(e)
   if (i)
     for (const l in n)
       !rn(l) && s[l] == null && delete n[l];
-}, Me = Ma;
-function Pa(e) {
-  return Oa(e);
+}, De = Ma;
+function Oa(e) {
+  return Pa(e);
 }
-function Oa(e, t) {
+function Pa(e, t) {
   const r = Yr();
   r.__VUE__ = !0;
   const {
@@ -2504,7 +2504,7 @@ function Oa(e, t) {
     if (u === h)
       return;
     u && !er(u, h) && (y = b(u), Te(u, w, v, !0), u = null), h.patchFlag === -2 && (E = !1, h.dynamicChildren = null);
-    const { type: _, ref: j, shapeFlag: O } = h;
+    const { type: _, ref: j, shapeFlag: P } = h;
     switch (_) {
       case fo:
         M(u, h, p, y);
@@ -2512,8 +2512,8 @@ function Oa(e, t) {
       case ht:
         S(u, h, p, y);
         break;
-      case Pr:
-        u == null && P(h, p, y, C);
+      case Or:
+        u == null && O(h, p, y, C);
         break;
       case Re:
         fe(
@@ -2529,7 +2529,7 @@ function Oa(e, t) {
         );
         break;
       default:
-        O & 1 ? B(
+        P & 1 ? B(
           u,
           h,
           p,
@@ -2539,7 +2539,7 @@ function Oa(e, t) {
           C,
           A,
           E
-        ) : O & 6 ? pe(
+        ) : P & 6 ? pe(
           u,
           h,
           p,
@@ -2549,7 +2549,7 @@ function Oa(e, t) {
           C,
           A,
           E
-        ) : (O & 64 || O & 128) && _.process(
+        ) : (P & 64 || P & 128) && _.process(
           u,
           h,
           p,
@@ -2580,7 +2580,7 @@ function Oa(e, t) {
       p,
       y
     ) : h.el = u.el;
-  }, P = (u, h, p, y) => {
+  }, O = (u, h, p, y) => {
     [u.el, u.anchor] = k(
       u.children,
       h,
@@ -2629,13 +2629,13 @@ function Oa(e, t) {
     }
   }, ne = (u, h, p, y, w, v, C, A) => {
     let E, _;
-    const { props: j, shapeFlag: O, transition: V, dirs: L } = u;
+    const { props: j, shapeFlag: P, transition: V, dirs: L } = u;
     if (E = u.el = s(
       u.type,
       v,
       j && j.is,
       j
-    ), O & 8 ? c(E, u.children) : O & 16 && me(
+    ), P & 8 ? c(E, u.children) : P & 16 && me(
       u.children,
       E,
       null,
@@ -2651,7 +2651,7 @@ function Oa(e, t) {
     }
     L && Et(u, null, y, "beforeMount");
     const K = Ia(w, V);
-    K && V.beforeEnter(E), o(E, h, p), ((_ = j && j.onVnodeMounted) || K || L) && Me(() => {
+    K && V.beforeEnter(E), o(E, h, p), ((_ = j && j.onVnodeMounted) || K || L) && De(() => {
       _ && Xe(_, y, u), K && V.enter(E), L && Et(u, null, y, "mounted");
     }, w);
   }, q = (u, h, p, y, w) => {
@@ -2690,9 +2690,9 @@ function Oa(e, t) {
     const A = h.el = u.el;
     let { patchFlag: E, dynamicChildren: _, dirs: j } = h;
     E |= u.patchFlag & 16;
-    const O = u.props || $, V = h.props || $;
+    const P = u.props || $, V = h.props || $;
     let L;
-    if (p && St(p, !1), (L = V.onVnodeBeforeUpdate) && Xe(L, p, h, u), j && Et(h, u, p, "beforeUpdate"), p && St(p, !0), (O.innerHTML && V.innerHTML == null || O.textContent && V.textContent == null) && c(A, ""), _ ? he(
+    if (p && St(p, !1), (L = V.onVnodeBeforeUpdate) && Xe(L, p, h, u), j && Et(h, u, p, "beforeUpdate"), p && St(p, !0), (P.innerHTML && V.innerHTML == null || P.textContent && V.textContent == null) && c(A, ""), _ ? he(
       u.dynamicChildren,
       _,
       A,
@@ -2712,17 +2712,17 @@ function Oa(e, t) {
       !1
     ), E > 0) {
       if (E & 16)
-        ve(A, O, V, p, w);
-      else if (E & 2 && O.class !== V.class && i(A, "class", null, V.class, w), E & 4 && i(A, "style", O.style, V.style, w), E & 8) {
+        ve(A, P, V, p, w);
+      else if (E & 2 && P.class !== V.class && i(A, "class", null, V.class, w), E & 4 && i(A, "style", P.style, V.style, w), E & 8) {
         const K = h.dynamicProps;
         for (let ee = 0; ee < K.length; ee++) {
-          const Q = K[ee], Pe = O[Q], Oe = V[Q];
-          (Oe !== Pe || Q === "value") && i(A, Q, Pe, Oe, w, p);
+          const Q = K[ee], Oe = P[Q], Pe = V[Q];
+          (Pe !== Oe || Q === "value") && i(A, Q, Oe, Pe, w, p);
         }
       }
       E & 1 && u.children !== h.children && c(A, h.children);
-    } else !C && _ == null && ve(A, O, V, p, w);
-    ((L = V.onVnodeUpdated) || j) && Me(() => {
+    } else !C && _ == null && ve(A, P, V, p, w);
+    ((L = V.onVnodeUpdated) || j) && De(() => {
       L && Xe(L, p, h, u), j && Et(h, u, p, "updated");
     }, y);
   }, he = (u, h, p, y, w, v, C) => {
@@ -2774,7 +2774,7 @@ function Oa(e, t) {
     }
   }, fe = (u, h, p, y, w, v, C, A, E) => {
     const _ = h.el = u ? u.el : l(""), j = h.anchor = u ? u.anchor : l("");
-    let { patchFlag: O, dynamicChildren: V, slotScopeIds: L } = h;
+    let { patchFlag: P, dynamicChildren: V, slotScopeIds: L } = h;
     L && (A = A ? A.concat(L) : L), u == null ? (o(_, p, y), o(j, p, y), me(
       // #10007
       // such fragment like `<></>` will be compiled into
@@ -2788,7 +2788,7 @@ function Oa(e, t) {
       C,
       A,
       E
-    )) : O > 0 && O & 64 && V && // #2715 the previous fragment could've been a BAILed one as a result
+    )) : P > 0 && P & 64 && V && // #2715 the previous fragment could've been a BAILed one as a result
     // of renderSlot() with no valid children
     u.dynamicChildren ? (he(
       u.dynamicChildren,
@@ -2868,22 +2868,22 @@ function Oa(e, t) {
   }, J = (u, h, p, y, w, v, C) => {
     const A = () => {
       if (u.isMounted) {
-        let { next: O, bu: V, u: L, parent: K, vnode: ee } = u;
+        let { next: P, bu: V, u: L, parent: K, vnode: ee } = u;
         {
           const Ye = ms(u);
           if (Ye) {
-            O && (O.el = ee.el, X(u, O, C)), Ye.asyncDep.then(() => {
+            P && (P.el = ee.el, X(u, P, C)), Ye.asyncDep.then(() => {
               u.isUnmounted || A();
             });
             return;
           }
         }
-        let Q = O, Pe;
-        St(u, !1), O ? (O.el = ee.el, X(u, O, C)) : O = ee, V && Tr(V), (Pe = O.props && O.props.onVnodeBeforeUpdate) && Xe(Pe, K, O, ee), St(u, !0);
-        const Oe = En(u), Je = u.subTree;
-        u.subTree = Oe, x(
+        let Q = P, Oe;
+        St(u, !1), P ? (P.el = ee.el, X(u, P, C)) : P = ee, V && Tr(V), (Oe = P.props && P.props.onVnodeBeforeUpdate) && Xe(Oe, K, P, ee), St(u, !0);
+        const Pe = En(u), Je = u.subTree;
+        u.subTree = Pe, x(
           Je,
-          Oe,
+          Pe,
           // parent may have changed if it's in a teleport
           d(Je.el),
           // anchor may have changed if it's in a fragment
@@ -2891,17 +2891,17 @@ function Oa(e, t) {
           u,
           w,
           v
-        ), O.el = Oe.el, Q === null && ka(u, Oe.el), L && Me(L, w), (Pe = O.props && O.props.onVnodeUpdated) && Me(
-          () => Xe(Pe, K, O, ee),
+        ), P.el = Pe.el, Q === null && ka(u, Pe.el), L && De(L, w), (Oe = P.props && P.props.onVnodeUpdated) && De(
+          () => Xe(Oe, K, P, ee),
           w
         );
       } else {
-        let O;
-        const { el: V, props: L } = h, { bm: K, m: ee, parent: Q, root: Pe, type: Oe } = u, Je = Ut(h);
-        St(u, !1), K && Tr(K), !Je && (O = L && L.onVnodeBeforeMount) && Xe(O, Q, h), St(u, !0);
+        let P;
+        const { el: V, props: L } = h, { bm: K, m: ee, parent: Q, root: Oe, type: Pe } = u, Je = Ut(h);
+        St(u, !1), K && Tr(K), !Je && (P = L && L.onVnodeBeforeMount) && Xe(P, Q, h), St(u, !0);
         {
-          Pe.ce && // @ts-expect-error _def is private
-          Pe.ce._def.shadowRoot !== !1 && Pe.ce._injectChildStyle(Oe);
+          Oe.ce && // @ts-expect-error _def is private
+          Oe.ce._def.shadowRoot !== !1 && Oe.ce._injectChildStyle(Pe);
           const Ye = u.subTree = En(u);
           x(
             null,
@@ -2913,14 +2913,14 @@ function Oa(e, t) {
             v
           ), h.el = Ye.el;
         }
-        if (ee && Me(ee, w), !Je && (O = L && L.onVnodeMounted)) {
+        if (ee && De(ee, w), !Je && (P = L && L.onVnodeMounted)) {
           const Ye = h;
-          Me(
-            () => Xe(O, Q, Ye),
+          De(
+            () => Xe(P, Q, Ye),
             w
           );
         }
-        (h.shapeFlag & 256 || Q && Ut(Q.vnode) && Q.vnode.shapeFlag & 256) && u.a && Me(u.a, w), u.isMounted = !0, h = p = y = null;
+        (h.shapeFlag & 256 || Q && Ut(Q.vnode) && Q.vnode.shapeFlag & 256) && u.a && De(u.a, w), u.isMounted = !0, h = p = y = null;
       }
     };
     u.scope.on();
@@ -2933,12 +2933,12 @@ function Oa(e, t) {
     const y = u.vnode.props;
     u.vnode = h, u.next = null, Sa(u, h.props, y, p), Ta(u, h.children, p), ut(), vn(u), ft();
   }, Y = (u, h, p, y, w, v, C, A, E = !1) => {
-    const _ = u && u.children, j = u ? u.shapeFlag : 0, O = h.children, { patchFlag: V, shapeFlag: L } = h;
+    const _ = u && u.children, j = u ? u.shapeFlag : 0, P = h.children, { patchFlag: V, shapeFlag: L } = h;
     if (V > 0) {
       if (V & 128) {
         mt(
           _,
-          O,
+          P,
           p,
           y,
           w,
@@ -2951,7 +2951,7 @@ function Oa(e, t) {
       } else if (V & 256) {
         rt(
           _,
-          O,
+          P,
           p,
           y,
           w,
@@ -2963,9 +2963,9 @@ function Oa(e, t) {
         return;
       }
     }
-    L & 8 ? (j & 16 && Le(_, w, v), O !== _ && c(p, O)) : j & 16 ? L & 16 ? mt(
+    L & 8 ? (j & 16 && Le(_, w, v), P !== _ && c(p, P)) : j & 16 ? L & 16 ? mt(
       _,
-      O,
+      P,
       p,
       y,
       w,
@@ -2974,7 +2974,7 @@ function Oa(e, t) {
       A,
       E
     ) : Le(_, w, v, !0) : (j & 8 && c(p, ""), L & 16 && me(
-      O,
+      P,
       p,
       y,
       w,
@@ -2985,9 +2985,9 @@ function Oa(e, t) {
     ));
   }, rt = (u, h, p, y, w, v, C, A, E) => {
     u = u || Ht, h = h || Ht;
-    const _ = u.length, j = h.length, O = Math.min(_, j);
+    const _ = u.length, j = h.length, P = Math.min(_, j);
     let V;
-    for (V = 0; V < O; V++) {
+    for (V = 0; V < P; V++) {
       const L = h[V] = E ? wt(h[V]) : et(h[V]);
       x(
         u[V],
@@ -3007,7 +3007,7 @@ function Oa(e, t) {
       v,
       !0,
       !1,
-      O
+      P
     ) : me(
       h,
       p,
@@ -3017,13 +3017,13 @@ function Oa(e, t) {
       C,
       A,
       E,
-      O
+      P
     );
   }, mt = (u, h, p, y, w, v, C, A, E) => {
     let _ = 0;
     const j = h.length;
-    let O = u.length - 1, V = j - 1;
-    for (; _ <= O && _ <= V; ) {
+    let P = u.length - 1, V = j - 1;
+    for (; _ <= P && _ <= V; ) {
       const L = u[_], K = h[_] = E ? wt(h[_]) : et(h[_]);
       if (er(L, K))
         x(
@@ -3041,8 +3041,8 @@ function Oa(e, t) {
         break;
       _++;
     }
-    for (; _ <= O && _ <= V; ) {
-      const L = u[O], K = h[V] = E ? wt(h[V]) : et(h[V]);
+    for (; _ <= P && _ <= V; ) {
+      const L = u[P], K = h[V] = E ? wt(h[V]) : et(h[V]);
       if (er(L, K))
         x(
           L,
@@ -3057,9 +3057,9 @@ function Oa(e, t) {
         );
       else
         break;
-      O--, V--;
+      P--, V--;
     }
-    if (_ > O) {
+    if (_ > P) {
       if (_ <= V) {
         const L = V + 1, K = L < j ? h[L].el : y;
         for (; _ <= V; )
@@ -3076,36 +3076,36 @@ function Oa(e, t) {
           ), _++;
       }
     } else if (_ > V)
-      for (; _ <= O; )
+      for (; _ <= P; )
         Te(u[_], w, v, !0), _++;
     else {
       const L = _, K = _, ee = /* @__PURE__ */ new Map();
       for (_ = K; _ <= V; _++) {
-        const Ne = h[_] = E ? wt(h[_]) : et(h[_]);
-        Ne.key != null && ee.set(Ne.key, _);
+        const Me = h[_] = E ? wt(h[_]) : et(h[_]);
+        Me.key != null && ee.set(Me.key, _);
       }
-      let Q, Pe = 0;
-      const Oe = V - K + 1;
+      let Q, Oe = 0;
+      const Pe = V - K + 1;
       let Je = !1, Ye = 0;
-      const Xt = new Array(Oe);
-      for (_ = 0; _ < Oe; _++) Xt[_] = 0;
-      for (_ = L; _ <= O; _++) {
-        const Ne = u[_];
-        if (Pe >= Oe) {
-          Te(Ne, w, v, !0);
+      const Xt = new Array(Pe);
+      for (_ = 0; _ < Pe; _++) Xt[_] = 0;
+      for (_ = L; _ <= P; _++) {
+        const Me = u[_];
+        if (Oe >= Pe) {
+          Te(Me, w, v, !0);
           continue;
         }
         let Qe;
-        if (Ne.key != null)
-          Qe = ee.get(Ne.key);
+        if (Me.key != null)
+          Qe = ee.get(Me.key);
         else
           for (Q = K; Q <= V; Q++)
-            if (Xt[Q - K] === 0 && er(Ne, h[Q])) {
+            if (Xt[Q - K] === 0 && er(Me, h[Q])) {
               Qe = Q;
               break;
             }
-        Qe === void 0 ? Te(Ne, w, v, !0) : (Xt[Qe - K] = _ + 1, Qe >= Ye ? Ye = Qe : Je = !0, x(
-          Ne,
+        Qe === void 0 ? Te(Me, w, v, !0) : (Xt[Qe - K] = _ + 1, Qe >= Ye ? Ye = Qe : Je = !0, x(
+          Me,
           h[Qe],
           p,
           null,
@@ -3114,11 +3114,11 @@ function Oa(e, t) {
           C,
           A,
           E
-        ), Pe++);
+        ), Oe++);
       }
       const cn = Je ? Na(Xt) : Ht;
-      for (Q = cn.length - 1, _ = Oe - 1; _ >= 0; _--) {
-        const Ne = K + _, Qe = h[Ne], un = h[Ne + 1], fn = Ne + 1 < j ? (
+      for (Q = cn.length - 1, _ = Pe - 1; _ >= 0; _--) {
+        const Me = K + _, Qe = h[Me], un = h[Me + 1], fn = Me + 1 < j ? (
           // #13559, fallback to el placeholder for unresolved async component
           un.el || un.placeholder
         ) : y;
@@ -3151,26 +3151,26 @@ function Oa(e, t) {
     }
     if (C === Re) {
       o(v, h, p);
-      for (let O = 0; O < E.length; O++)
-        qe(E[O], h, p, y);
+      for (let P = 0; P < E.length; P++)
+        qe(E[P], h, p, y);
       o(u.anchor, h, p);
       return;
     }
-    if (C === Pr) {
+    if (C === Or) {
       I(u, h, p);
       return;
     }
     if (y !== 2 && _ & 1 && A)
       if (y === 0)
-        A.beforeEnter(v), o(v, h, p), Me(() => A.enter(v), w);
+        A.beforeEnter(v), o(v, h, p), De(() => A.enter(v), w);
       else {
-        const { leave: O, delayLeave: V, afterLeave: L } = A, K = () => {
+        const { leave: P, delayLeave: V, afterLeave: L } = A, K = () => {
           u.ctx.isUnmounted ? n(v) : o(v, h, p);
         }, ee = () => {
           v._isLeaving && v[$l](
             !0
             /* cancelled */
-          ), O(v, () => {
+          ), P(v, () => {
             K(), L && L();
           });
         };
@@ -3186,11 +3186,11 @@ function Oa(e, t) {
       children: E,
       dynamicChildren: _,
       shapeFlag: j,
-      patchFlag: O,
+      patchFlag: P,
       dirs: V,
       cacheIndex: L
     } = u;
-    if (O === -2 && (w = !1), A != null && (ut(), lr(A, null, p, u, !0), ft()), L != null && (h.renderCache[L] = void 0), j & 256) {
+    if (P === -2 && (w = !1), A != null && (ut(), lr(A, null, p, u, !0), ft()), L != null && (h.renderCache[L] = void 0), j & 256) {
       h.ctx.deactivate(u);
       return;
     }
@@ -3215,15 +3215,15 @@ function Oa(e, t) {
       // so that it doesn't take the fast path during unmount - otherwise
       // components nested in v-once are never unmounted.
       !_.hasOnce && // #1153: fast path should not be taken for non-stable (v-for) fragments
-      (v !== Re || O > 0 && O & 64) ? Le(
+      (v !== Re || P > 0 && P & 64) ? Le(
         _,
         h,
         p,
         !1,
         !0
-      ) : (v === Re && O & 384 || !w && j & 16) && Le(E, h, p), y && Dt(u);
+      ) : (v === Re && P & 384 || !w && j & 16) && Le(E, h, p), y && Dt(u);
     }
-    (ee && (Q = C && C.onVnodeUnmounted) || K) && Me(() => {
+    (ee && (Q = C && C.onVnodeUnmounted) || K) && De(() => {
       Q && Xe(Q, h, u), K && Et(u, null, h, "unmounted");
     }, p);
   }, Dt = (u) => {
@@ -3232,7 +3232,7 @@ function Oa(e, t) {
       Ft(p, y);
       return;
     }
-    if (h === Pr) {
+    if (h === Or) {
       R(u);
       return;
     }
@@ -3251,7 +3251,7 @@ function Oa(e, t) {
     n(h);
   }, kt = (u, h, p) => {
     const { bum: y, scope: w, job: v, subTree: C, um: A, m: E, a: _ } = u;
-    Rn(E), Rn(_), y && Tr(y), w.stop(), v && (v.flags |= 8, Te(C, u, h, p)), A && Me(A, h), Me(() => {
+    Rn(E), Rn(_), y && Tr(y), w.stop(), v && (v.flags |= 8, Te(C, u, h, p)), A && De(A, h), De(() => {
       u.isUnmounted = !0;
     }, h);
   }, Le = (u, h, p, y = !1, w = !1, v = 0) => {
@@ -3347,7 +3347,7 @@ const vs = (e) => e.__isSuspense;
 function Ma(e, t) {
   t && t.pendingBranch ? F(e) ? t.effects.push(...e) : t.effects.push(e) : zi(e);
 }
-const Re = Symbol.for("v-fgt"), fo = Symbol.for("v-txt"), ht = Symbol.for("v-cmt"), Pr = Symbol.for("v-stc"), cr = [];
+const Re = /* @__PURE__ */ Symbol.for("v-fgt"), fo = /* @__PURE__ */ Symbol.for("v-txt"), ht = /* @__PURE__ */ Symbol.for("v-cmt"), Or = /* @__PURE__ */ Symbol.for("v-stc"), cr = [];
 let Fe = null;
 function Ve(e = !1) {
   cr.push(Fe = e ? null : []);
@@ -3393,7 +3393,7 @@ function gr(e) {
 function er(e, t) {
   return e.type === t.type && e.key === t.key;
 }
-const bs = ({ key: e }) => e ?? null, Or = ({
+const bs = ({ key: e }) => e ?? null, Pr = ({
   ref: e,
   ref_key: t,
   ref_for: r
@@ -3405,7 +3405,7 @@ function Se(e, t = null, r = null, o = 0, n = null, i = e === Re ? 0 : 1, s = !1
     type: e,
     props: t,
     key: t && bs(t),
-    ref: t && Or(t),
+    ref: t && Pr(t),
     scopeId: Ki,
     slotScopeIds: null,
     children: r,
@@ -3480,7 +3480,7 @@ function qt(e, t, r = !1, o = !1) {
       // #2078 in the case of <component :is="vnode" ref="extra"/>
       // if the vnode itself already has a ref, cloneVNode will need to merge
       // the refs so the single vnode can be set on multiple refs
-      r && i ? F(i) ? i.concat(Or(t)) : [i, Or(t)] : Or(t)
+      r && i ? F(i) ? i.concat(Pr(t)) : [i, Pr(t)] : Pr(t)
     ) : i,
     scopeId: e.scopeId,
     slotScopeIds: e.slotScopeIds,
@@ -3522,7 +3522,7 @@ function qt(e, t, r = !1, o = !1) {
 function ja(e = " ", t = 0) {
   return ae(fo, null, e, t);
 }
-function Nf(e = "", t = !1) {
+function Mf(e = "", t = !1) {
   return t ? (Ve(), Kt(ht, null, e)) : ae(ht, null, e);
 }
 function et(e) {
@@ -3775,7 +3775,7 @@ function $a(e, t = !0) {
 function Wa(e) {
   return H(e) && "__vccOpts" in e;
 }
-const oe = (e, t) => jl(e, t, mr);
+const re = (e, t) => jl(e, t, mr);
 function Es(e, t, r) {
   try {
     Hr(-1);
@@ -3787,15 +3787,15 @@ function Es(e, t, r) {
 }
 const Ga = "3.5.25";
 let jo;
-const Pn = typeof window < "u" && window.trustedTypes;
-if (Pn)
+const On = typeof window < "u" && window.trustedTypes;
+if (On)
   try {
-    jo = /* @__PURE__ */ Pn.createPolicy("vue", {
+    jo = /* @__PURE__ */ On.createPolicy("vue", {
       createHTML: (e) => e
     });
   } catch {
   }
-const Ss = jo ? (e) => jo.createHTML(e) : (e) => e, qa = "http://www.w3.org/2000/svg", Ja = "http://www.w3.org/1998/Math/MathML", it = typeof document < "u" ? document : null, On = it && /* @__PURE__ */ it.createElement("template"), Ya = {
+const Ss = jo ? (e) => jo.createHTML(e) : (e) => e, qa = "http://www.w3.org/2000/svg", Ja = "http://www.w3.org/1998/Math/MathML", it = typeof document < "u" ? document : null, Pn = it && /* @__PURE__ */ it.createElement("template"), Ya = {
   insert: (e, t, r) => {
     t.insertBefore(e, r || null);
   },
@@ -3831,10 +3831,10 @@ const Ss = jo ? (e) => jo.createHTML(e) : (e) => e, qa = "http://www.w3.org/2000
       for (; t.insertBefore(n.cloneNode(!0), r), !(n === i || !(n = n.nextSibling)); )
         ;
     else {
-      On.innerHTML = Ss(
+      Pn.innerHTML = Ss(
         o === "svg" ? `<svg>${e}</svg>` : o === "mathml" ? `<math>${e}</math>` : e
       );
-      const l = On.content;
+      const l = Pn.content;
       if (o === "svg" || o === "mathml") {
         const a = l.firstChild;
         for (; a.firstChild; )
@@ -3850,13 +3850,13 @@ const Ss = jo ? (e) => jo.createHTML(e) : (e) => e, qa = "http://www.w3.org/2000
       r ? r.previousSibling : t.lastChild
     ];
   }
-}, Qa = Symbol("_vtc");
+}, Qa = /* @__PURE__ */ Symbol("_vtc");
 function Xa(e, t, r) {
   const o = e[Qa];
   o && (t = (t ? [t, ...o] : [...o]).join(" ")), t == null ? e.removeAttribute("class") : r ? e.setAttribute("class", t) : e.className = t;
 }
-const In = Symbol("_vod"), Za = Symbol("_vsh"), As = Symbol("");
-function Mf(e) {
+const In = /* @__PURE__ */ Symbol("_vod"), Za = /* @__PURE__ */ Symbol("_vsh"), As = /* @__PURE__ */ Symbol("");
+function Df(e) {
   const t = gt();
   if (!t)
     return;
@@ -3889,7 +3889,7 @@ function Lo(e, t) {
     Br(e.el, t);
   else if (e.type === Re)
     e.children.forEach((r) => Lo(r, t));
-  else if (e.type === Pr) {
+  else if (e.type === Or) {
     let { el: r, anchor: o } = e;
     for (; r && (Br(r, t), r !== o); )
       r = r.nextSibling;
@@ -3939,7 +3939,7 @@ function Ir(e, t, r) {
   else {
     const o = rc(e, t);
     Nn.test(r) ? e.setProperty(
-      De(o),
+      Ne(o),
       r.replace(Nn, ""),
       "important"
     ) : e[o] = r;
@@ -4001,7 +4001,7 @@ function Rt(e, t, r, o) {
 function oc(e, t, r, o) {
   e.removeEventListener(t, r, o);
 }
-const jn = Symbol("_vei");
+const jn = /* @__PURE__ */ Symbol("_vei");
 function nc(e, t, r, o, n = null) {
   const i = e[jn] || (e[jn] = {}), s = i[t];
   if (o && s)
@@ -4026,7 +4026,7 @@ function ic(e) {
     for (; o = e.match(Ln); )
       e = e.slice(0, e.length - o[0].length), t[o[0].toLowerCase()] = !0;
   }
-  return [e[2] === ":" ? e.slice(3) : De(e.slice(2)), t];
+  return [e[2] === ":" ? e.slice(3) : Ne(e.slice(2)), t];
 }
 let ko = 0;
 const sc = /* @__PURE__ */ Promise.resolve(), lc = () => ko || (sc.then(() => ko = 0), ko = Date.now());
@@ -4193,12 +4193,12 @@ class sn extends hc {
   _setProp(t, r, o = !0, n = !1) {
     if (r !== this._props[t] && (this._dirty = !0, r === zn ? delete this._props[t] : (this._props[t] = r, t === "key" && this._app && (this._app._ceVNode.key = r)), n && this._instance && this._update(), o)) {
       const i = this._ob;
-      i && (this._processMutations(i.takeRecords()), i.disconnect()), r === !0 ? this.setAttribute(De(t), "") : typeof r == "string" || typeof r == "number" ? this.setAttribute(De(t), r + "") : r || this.removeAttribute(De(t)), i && i.observe(this, { attributes: !0 });
+      i && (this._processMutations(i.takeRecords()), i.disconnect()), r === !0 ? this.setAttribute(Ne(t), "") : typeof r == "string" || typeof r == "number" ? this.setAttribute(Ne(t), r + "") : r || this.removeAttribute(Ne(t)), i && i.observe(this, { attributes: !0 });
     }
   }
   _update() {
     const t = this._createVNode();
-    this._app && (t.appContext = this._app._context), wc(t, this._root);
+    this._app && (t.appContext = this._app._context), _c(t, this._root);
   }
   _createVNode() {
     const t = {};
@@ -4215,7 +4215,7 @@ class sn extends hc {
         );
       };
       o.emit = (i, ...s) => {
-        n(i, s), De(i) !== i && n(De(i), s);
+        n(i, s), Ne(i) !== i && n(Ne(i), s);
       }, this._setParent();
     }), r;
   }
@@ -4315,11 +4315,11 @@ function Bn(e) {
   const t = e.target;
   t.composing && (t.composing = !1, t.dispatchEvent(new Event("input")));
 }
-const $t = Symbol("_assign");
+const $t = /* @__PURE__ */ Symbol("_assign");
 function Un(e, t, r) {
   return t && (e = e.trim()), r && (e = Jo(e)), e;
 }
-const Df = {
+const Ff = {
   created(e, { modifiers: { lazy: t, trim: r, number: o } }, n) {
     e[$t] = Ur(n);
     const i = o || n.props && n.props.type === "number";
@@ -4338,7 +4338,7 @@ const Df = {
     const l = (i || e.type === "number") && !/^0\d/.test(e.value) ? Jo(e.value) : e.value, a = t ?? "";
     l !== a && (document.activeElement === e && e.type !== "range" && (o && t === r || n && e.value.trim() === a) || (e.value = a));
   }
-}, Ff = {
+}, Vf = {
   // #4096 array checkboxes need to be deep traversed
   deep: !0,
   created(e, t, r) {
@@ -4406,54 +4406,73 @@ const mc = ["ctrl", "shift", "alt", "meta"], vc = {
     }
     return e(n, ...i);
   }));
-}, bc = /* @__PURE__ */ ce({ patchProp: uc }, Ya);
+}, bc = {
+  esc: "escape",
+  space: " ",
+  up: "arrow-up",
+  left: "arrow-left",
+  right: "arrow-right",
+  down: "arrow-down",
+  delete: "backspace"
+}, jf = (e, t) => {
+  const r = e._withKeys || (e._withKeys = {}), o = t.join(".");
+  return r[o] || (r[o] = ((n) => {
+    if (!("key" in n))
+      return;
+    const i = Ne(n.key);
+    if (t.some(
+      (s) => s === i || bc[s] === i
+    ))
+      return e(n);
+  }));
+}, wc = /* @__PURE__ */ ce({ patchProp: uc }, Ya);
 let $n;
 function Cs() {
-  return $n || ($n = Pa(bc));
+  return $n || ($n = Oa(wc));
 }
-const wc = ((...e) => {
+const _c = ((...e) => {
   Cs().render(...e);
 }), Wn = ((...e) => {
   const t = Cs().createApp(...e), { mount: r } = t;
   return t.mount = (o) => {
-    const n = xc(o);
+    const n = kc(o);
     if (!n) return;
     const i = t._component;
     !H(i) && !i.render && !i.template && (i.template = n.innerHTML), n.nodeType === 1 && (n.textContent = "");
-    const s = r(n, !1, _c(n));
+    const s = r(n, !1, xc(n));
     return n instanceof Element && (n.removeAttribute("v-cloak"), n.setAttribute("data-v-app", "")), s;
   }, t;
 });
-function _c(e) {
+function xc(e) {
   if (e instanceof SVGElement)
     return "svg";
   if (typeof MathMLElement == "function" && e instanceof MathMLElement)
     return "mathml";
 }
-function xc(e) {
+function kc(e) {
   return le(e) ? document.querySelector(e) : e;
 }
 function Ho(e, t) {
   return Yo() ? (cl(e, t), !0) : !1;
 }
-const Eo = /* @__PURE__ */ new WeakMap(), kc = /* @__NO_SIDE_EFFECTS__ */ (...e) => {
+const Eo = /* @__PURE__ */ new WeakMap(), Ec = /* @__NO_SIDE_EFFECTS__ */ (...e) => {
   var t;
   const r = e[0], o = (t = gt()) === null || t === void 0 ? void 0 : t.proxy, n = o ?? Yo();
   if (n == null && !os()) throw new Error("injectLocal must be called in setup");
   return n && Eo.has(n) && r in Eo.get(n) ? Eo.get(n)[r] : Ce(...e);
 }, zo = typeof window < "u" && typeof document < "u";
 typeof WorkerGlobalScope < "u" && globalThis instanceof WorkerGlobalScope;
-const Ec = Object.prototype.toString, Sc = (e) => Ec.call(e) === "[object Object]", Ac = () => {
+const Sc = Object.prototype.toString, Ac = (e) => Sc.call(e) === "[object Object]", Rc = () => {
 };
 function Ts(...e) {
   if (e.length !== 1) return Dl(...e);
   const t = e[0];
   return typeof t == "function" ? Wt(ji(() => ({
     get: t,
-    set: Ac
+    set: Rc
   }))) : xt(t);
 }
-function Rc(e, t) {
+function Cc(e, t) {
   function r(...o) {
     return new Promise((n, i) => {
       Promise.resolve(e(() => t.apply(this, o), {
@@ -4465,8 +4484,8 @@ function Rc(e, t) {
   }
   return r;
 }
-const Ps = (e) => e();
-function Cc(e = Ps, t = {}) {
+const Os = (e) => e();
+function Tc(e = Os, t = {}) {
   const { initialState: r = "active" } = t, o = Ts(r === "active");
   function n() {
     o.value = !1;
@@ -4490,15 +4509,15 @@ function Gn(e) {
 function So(e) {
   return Array.isArray(e) ? e : [e];
 }
-function Tc(e) {
+function Oc(e) {
   return gt();
 }
 function Pc(e, t, r = {}) {
-  const { eventFilter: o = Ps, ...n } = r;
-  return Ke(e, Rc(o, t), n);
+  const { eventFilter: o = Os, ...n } = r;
+  return Ke(e, Cc(o, t), n);
 }
-function Oc(e, t, r = {}) {
-  const { eventFilter: o, initialState: n = "active", ...i } = r, { eventFilter: s, pause: l, resume: a, isActive: f } = Cc(o, { initialState: n });
+function Ic(e, t, r = {}) {
+  const { eventFilter: o, initialState: n = "active", ...i } = r, { eventFilter: s, pause: l, resume: a, isActive: f } = Tc(o, { initialState: n });
   return {
     stop: Pc(e, t, {
       ...i,
@@ -4509,11 +4528,11 @@ function Oc(e, t, r = {}) {
     isActive: f
   };
 }
-const Ic = Oc;
-function Os(e, t = !0, r) {
-  Tc() ? xr(e, r) : t ? e() : _r(e);
+const Nc = Ic;
+function Ps(e, t = !0, r) {
+  Oc() ? xr(e, r) : t ? e() : _r(e);
 }
-function Nc(e, t = 1e3, r = {}) {
+function Mc(e, t = 1e3, r = {}) {
   const { immediate: o = !0, immediateCallback: n = !1 } = r;
   let i = null;
   const s = ct(!1);
@@ -4535,7 +4554,7 @@ function Nc(e, t = 1e3, r = {}) {
     resume: f
   };
 }
-function Mc(e, t, r) {
+function Dc(e, t, r) {
   return Ke(e, t, {
     ...r,
     immediate: !0
@@ -4548,11 +4567,11 @@ function Is(e) {
   return (t = r?.$el) !== null && t !== void 0 ? t : r;
 }
 function vr(...e) {
-  const t = (o, n, i, s) => (o.addEventListener(n, i, s), () => o.removeEventListener(n, i, s)), r = oe(() => {
+  const t = (o, n, i, s) => (o.addEventListener(n, i, s), () => o.removeEventListener(n, i, s)), r = re(() => {
     const o = So(He(e[0])).filter((n) => n != null);
     return o.every((n) => typeof n != "string") ? o : void 0;
   });
-  return Mc(() => {
+  return Dc(() => {
     var o, n;
     return [
       (o = (n = r.value) === null || n === void 0 ? void 0 : n.map((i) => Is(i))) !== null && o !== void 0 ? o : [at].filter((i) => i != null),
@@ -4562,26 +4581,26 @@ function vr(...e) {
     ];
   }, ([o, n, i, s], l, a) => {
     if (!o?.length || !n?.length || !i?.length) return;
-    const f = Sc(s) ? { ...s } : s, c = o.flatMap((d) => n.flatMap((m) => i.map((g) => t(d, m, g, f))));
+    const f = Ac(s) ? { ...s } : s, c = o.flatMap((d) => n.flatMap((m) => i.map((g) => t(d, m, g, f))));
     a(() => {
       c.forEach((d) => d());
     });
   }, { flush: "post" });
 }
 // @__NO_SIDE_EFFECTS__
-function Dc() {
+function Fc() {
   const e = ct(!1), t = gt();
   return t && xr(() => {
     e.value = !0;
   }, t), e;
 }
 // @__NO_SIDE_EFFECTS__
-function Fc(e) {
-  const t = /* @__PURE__ */ Dc();
-  return oe(() => (t.value, !!e()));
+function Vc(e) {
+  const t = /* @__PURE__ */ Fc();
+  return re(() => (t.value, !!e()));
 }
-function Vc(e, t = {}) {
-  const { immediate: r = !0, fpsLimit: o = void 0, window: n = at, once: i = !1 } = t, s = ct(!1), l = oe(() => o ? 1e3 / He(o) : null);
+function jc(e, t = {}) {
+  const { immediate: r = !0, fpsLimit: o = void 0, window: n = at, once: i = !1 } = t, s = ct(!1), l = re(() => o ? 1e3 / He(o) : null);
   let a = 0, f = null;
   function c(g) {
     if (!s.value || !n) return;
@@ -4612,14 +4631,14 @@ function Vc(e, t = {}) {
     resume: d
   };
 }
-const jc = Symbol("vueuse-ssr-width");
+const Lc = /* @__PURE__ */ Symbol("vueuse-ssr-width");
 // @__NO_SIDE_EFFECTS__
-function Lc() {
-  const e = os() ? /* @__PURE__ */ kc(jc, null) : null;
+function Hc() {
+  const e = os() ? /* @__PURE__ */ Ec(Lc, null) : null;
   return typeof e == "number" ? e : void 0;
 }
-function Hc(e, t = {}) {
-  const { window: r = at, ssrWidth: o = /* @__PURE__ */ Lc() } = t, n = /* @__PURE__ */ Fc(() => r && "matchMedia" in r && typeof r.matchMedia == "function"), i = ct(typeof o == "number"), s = ct(), l = ct(!1), a = (f) => {
+function zc(e, t = {}) {
+  const { window: r = at, ssrWidth: o = /* @__PURE__ */ Hc() } = t, n = /* @__PURE__ */ Vc(() => r && "matchMedia" in r && typeof r.matchMedia == "function"), i = ct(typeof o == "number"), s = ct(), l = ct(!1), a = (f) => {
     l.value = f.matches;
   };
   return pa(() => {
@@ -4632,23 +4651,23 @@ function Hc(e, t = {}) {
       return;
     }
     n.value && (s.value = r.matchMedia(He(e)), l.value = s.value.matches);
-  }), vr(s, "change", a, { passive: !0 }), oe(() => l.value);
+  }), vr(s, "change", a, { passive: !0 }), re(() => l.value);
 }
-const Rr = typeof globalThis < "u" ? globalThis : typeof window < "u" ? window : typeof global < "u" ? global : typeof self < "u" ? self : {}, Cr = "__vueuse_ssr_handlers__", zc = /* @__PURE__ */ Bc();
-function Bc() {
+const Rr = typeof globalThis < "u" ? globalThis : typeof window < "u" ? window : typeof global < "u" ? global : typeof self < "u" ? self : {}, Cr = "__vueuse_ssr_handlers__", Bc = /* @__PURE__ */ Uc();
+function Uc() {
   return Cr in Rr || (Rr[Cr] = Rr[Cr] || {}), Rr[Cr];
 }
 function Ns(e, t) {
-  return zc[e] || t;
+  return Bc[e] || t;
 }
 // @__NO_SIDE_EFFECTS__
-function Uc(e) {
-  return Hc("(prefers-color-scheme: dark)", e);
-}
 function Kc(e) {
+  return zc("(prefers-color-scheme: dark)", e);
+}
+function $c(e) {
   return e == null ? "any" : e instanceof Set ? "set" : e instanceof Map ? "map" : e instanceof Date ? "date" : typeof e == "boolean" ? "boolean" : typeof e == "string" ? "string" : typeof e == "object" ? "object" : Number.isNaN(e) ? "any" : "number";
 }
-const $c = {
+const Wc = {
   boolean: {
     read: (e) => e === "true",
     write: (e) => String(e)
@@ -4686,14 +4705,14 @@ function Ms(e, t, r, o = {}) {
   var n;
   const { flush: i = "pre", deep: s = !0, listenToStorageChanges: l = !0, writeDefaults: a = !0, mergeDefaults: f = !1, shallow: c, window: d = at, eventFilter: m, onError: g = (z) => {
     console.error(z);
-  }, initOnMounted: k } = o, x = (c ? ct : xt)(typeof t == "function" ? t() : t), M = oe(() => He(e));
+  }, initOnMounted: k } = o, x = (c ? ct : xt)(typeof t == "function" ? t() : t), M = re(() => He(e));
   if (!r) try {
     r = Ns("getDefaultStorage", () => at?.localStorage)();
   } catch (z) {
     g(z);
   }
   if (!r) return x;
-  const S = He(t), P = Kc(S), I = (n = o.serializer) !== null && n !== void 0 ? n : $c[P], { pause: R, resume: B } = Ic(x, (z) => he(z), {
+  const S = He(t), O = $c(S), I = (n = o.serializer) !== null && n !== void 0 ? n : Wc[O], { pause: R, resume: B } = Nc(x, (z) => he(z), {
     flush: i,
     deep: s,
     eventFilter: m
@@ -4705,7 +4724,7 @@ function Ms(e, t, r, o = {}) {
   }, me = (z) => {
     k && !ne || pe(z);
   };
-  d && l && (r instanceof Storage ? vr(d, "storage", q, { passive: !0 }) : vr(d, qn, me)), k ? Os(() => {
+  d && l && (r instanceof Storage ? vr(d, "storage", q, { passive: !0 }) : vr(d, qn, me)), k ? Ps(() => {
     ne = !0, fe();
   }) : fe();
   function xe(z, ie) {
@@ -4738,7 +4757,7 @@ function Ms(e, t, r, o = {}) {
       return a && S != null && r.setItem(M.value, I.write(S)), S;
     if (!z && f) {
       const J = I.read(ie);
-      return typeof f == "function" ? f(J, S) : P === "object" && !Array.isArray(J) ? {
+      return typeof f == "function" ? f(J, S) : O === "object" && !Array.isArray(J) ? {
         ...S,
         ...J
       } : J;
@@ -4768,17 +4787,17 @@ function Ms(e, t, r, o = {}) {
   }
   return x;
 }
-const Wc = "*,*::before,*::after{-webkit-transition:none!important;-moz-transition:none!important;-o-transition:none!important;-ms-transition:none!important;transition:none!important}";
-function Gc(e = {}) {
+const Gc = "*,*::before,*::after{-webkit-transition:none!important;-moz-transition:none!important;-o-transition:none!important;-ms-transition:none!important;transition:none!important}";
+function qc(e = {}) {
   const { selector: t = "html", attribute: r = "class", initialValue: o = "auto", window: n = at, storage: i, storageKey: s = "vueuse-color-scheme", listenToStorageChanges: l = !0, storageRef: a, emitAuto: f, disableTransition: c = !0 } = e, d = {
     auto: "",
     light: "light",
     dark: "dark",
     ...e.modes || {}
-  }, m = /* @__PURE__ */ Uc({ window: n }), g = oe(() => m.value ? "dark" : "light"), k = a || (s == null ? Ts(o) : Ms(s, o, i, {
+  }, m = /* @__PURE__ */ Kc({ window: n }), g = re(() => m.value ? "dark" : "light"), k = a || (s == null ? Ts(o) : Ms(s, o, i, {
     window: n,
     listenToStorageChanges: l
-  })), x = oe(() => k.value === "auto" ? g.value : k.value), M = Ns("updateHTMLAttrs", (R, B, ne) => {
+  })), x = re(() => k.value === "auto" ? g.value : k.value), M = Ns("updateHTMLAttrs", (R, B, ne) => {
     const q = typeof R == "string" ? n?.document.querySelector(R) : Is(R);
     if (!q) return;
     const me = /* @__PURE__ */ new Set(), xe = /* @__PURE__ */ new Set();
@@ -4794,7 +4813,7 @@ function Gc(e = {}) {
     };
     if (me.size === 0 && xe.size === 0 && he === null) return;
     let ve;
-    c && (ve = n.document.createElement("style"), ve.appendChild(document.createTextNode(Wc)), n.document.head.appendChild(ve));
+    c && (ve = n.document.createElement("style"), ve.appendChild(document.createTextNode(Gc)), n.document.head.appendChild(ve));
     for (const fe of me) q.classList.add(fe);
     for (const fe of xe) q.classList.remove(fe);
     he && q.setAttribute(he.key, he.value), c && (n.getComputedStyle(ve).opacity, document.head.removeChild(ve));
@@ -4803,14 +4822,14 @@ function Gc(e = {}) {
     var B;
     M(t, r, (B = d[R]) !== null && B !== void 0 ? B : R);
   }
-  function P(R) {
+  function O(R) {
     e.onChanged ? e.onChanged(R, S) : S(R);
   }
-  Ke(x, P, {
+  Ke(x, O, {
     flush: "post",
     immediate: !0
-  }), Os(() => P(x.value));
-  const I = oe({
+  }), Ps(() => O(x.value));
+  const I = re({
     get() {
       return f ? k.value : x.value;
     },
@@ -4824,19 +4843,19 @@ function Gc(e = {}) {
     state: x
   });
 }
-function qc(e, t, r = {}) {
+function Jc(e, t, r = {}) {
   const { window: o = at } = r;
   return Ms(e, t, o?.localStorage, r);
 }
 // @__NO_SIDE_EFFECTS__
-function Jc(e = {}) {
-  const { controls: t = !1, interval: r = "requestAnimationFrame", immediate: o = !0 } = e, n = xt(/* @__PURE__ */ new Date()), i = () => n.value = /* @__PURE__ */ new Date(), s = r === "requestAnimationFrame" ? Vc(i, { immediate: o }) : Nc(i, r, { immediate: o });
+function Yc(e = {}) {
+  const { controls: t = !1, interval: r = "requestAnimationFrame", immediate: o = !0 } = e, n = xt(/* @__PURE__ */ new Date()), i = () => n.value = /* @__PURE__ */ new Date(), s = r === "requestAnimationFrame" ? jc(i, { immediate: o }) : Mc(i, r, { immediate: o });
   return t ? {
     now: n,
     ...s
   } : n;
 }
-const Yc = [
+const Qc = [
   {
     max: 6e4,
     value: 1e3,
@@ -4872,7 +4891,7 @@ const Yc = [
     value: 31536e6,
     name: "year"
   }
-], Qc = {
+], Xc = {
   justNow: "just now",
   past: (e) => e.match(/\d/) ? `${e} ago` : e,
   future: (e) => e.match(/\d/) ? `in ${e}` : e,
@@ -4885,32 +4904,32 @@ const Yc = [
   second: (e) => `${e} second${e > 1 ? "s" : ""}`,
   invalid: ""
 };
-function Xc(e) {
+function Zc(e) {
   return e.toISOString().slice(0, 10);
 }
 // @__NO_SIDE_EFFECTS__
-function Vf(e, t = {}) {
-  const { controls: r = !1, updateInterval: o = 3e4 } = t, { now: n, ...i } = /* @__PURE__ */ Jc({
+function Lf(e, t = {}) {
+  const { controls: r = !1, updateInterval: o = 3e4 } = t, { now: n, ...i } = /* @__PURE__ */ Yc({
     interval: o,
     controls: !0
-  }), s = oe(() => Zc(new Date(He(e)), t, He(n)));
+  }), s = re(() => eu(new Date(He(e)), t, He(n)));
   return r ? {
     timeAgo: s,
     ...i
   } : s;
 }
-function Zc(e, t = {}, r = Date.now()) {
-  const { max: o, messages: n = Qc, fullDateFormatter: i = Xc, units: s = Yc, showSecond: l = !1, rounding: a = "round" } = t, f = typeof a == "number" ? (M) => +M.toFixed(a) : Math[a], c = +r - +e, d = Math.abs(c);
+function eu(e, t = {}, r = Date.now()) {
+  const { max: o, messages: n = Xc, fullDateFormatter: i = Zc, units: s = Qc, showSecond: l = !1, rounding: a = "round" } = t, f = typeof a == "number" ? (M) => +M.toFixed(a) : Math[a], c = +r - +e, d = Math.abs(c);
   function m(M, S) {
     return f(Math.abs(M) / S.value);
   }
   function g(M, S) {
-    const P = m(M, S), I = M > 0, R = k(S.name, P, I);
+    const O = m(M, S), I = M > 0, R = k(S.name, O, I);
     return k(I ? "past" : "future", R, I);
   }
-  function k(M, S, P) {
+  function k(M, S, O) {
     const I = n[M];
-    return typeof I == "function" ? I(S, P) : I.replace("{0}", S.toString());
+    return typeof I == "function" ? I(S, O) : I.replace("{0}", S.toString());
   }
   if (d < 6e4 && !l) return n.justNow;
   if (typeof o == "number" && d > o) return i(new Date(e));
@@ -4925,7 +4944,7 @@ function Zc(e, t = {}, r = Date.now()) {
   }
   return n.invalid;
 }
-const eu = /* @__PURE__ */ Nt({
+const tu = /* @__PURE__ */ Nt({
   __name: "ResizablePanel",
   props: {
     translate: {
@@ -4936,7 +4955,7 @@ const eu = /* @__PURE__ */ Nt({
   },
   emits: ["update:translate"],
   setup(e) {
-    const t = va(e, "translate"), r = xt(!1), o = oe(() => ({
+    const t = va(e, "translate"), r = xt(!1), o = re(() => ({
       transform: `translateY(-${t.value - 5}px)`
     }));
     function n() {
@@ -4959,17 +4978,18 @@ const eu = /* @__PURE__ */ Nt({
       onMousedown: yc(n, ["prevent"])
     }, null, 38));
   }
-}), tu = /* @__PURE__ */ Nt({
+}), ru = /* @__PURE__ */ Nt({
   __name: "PiPContainer",
   props: {
     isPip: { type: Boolean }
   },
   setup(e) {
-    const t = Gc({
+    const t = qc({
+      storageKey: "pc:color-scheme",
       selector: "#root"
-    }), r = oe(() => t.value === "auto" ? [] : t.value), o = qc("pinia-colada-devtools-pip-container-height", 400);
+    }), r = re(() => t.value === "auto" ? [] : t.value), o = Jc("pinia-colada-devtools-pip-container-height", 400);
     o.value = Math.min(o.value, window.innerHeight * 0.8);
-    const n = oe(() => ({ height: `${o.value}px` })), i = oe(() => e.isPip ? ["h-full"] : [
+    const n = re(() => ({ height: `${o.value}px` })), i = re(() => e.isPip ? ["h-full"] : [
       "fixed",
       "max-h-[80%]",
       "min-h-[20vh]",
@@ -4988,19 +5008,19 @@ const eu = /* @__PURE__ */ Nt({
       }, s.$attrs), [
         Xi(s.$slots, "default")
       ], 16),
-      ae(eu, {
+      ae(tu, {
         translate: Ue(o),
         "onUpdate:translate": l[0] || (l[0] = (a) => ue(o) ? o.value = a : null)
       }, null, 8, ["translate"])
     ], 64));
   }
-}), ru = {
+}), ou = {
   viewBox: "0 0 24 24",
   width: "1.2em",
   height: "1.2em"
 };
-function ou(e, t) {
-  return Ve(), Mt("svg", ru, [...t[0] || (t[0] = [
+function nu(e, t) {
+  return Ve(), Mt("svg", ou, [...t[0] || (t[0] = [
     Se("path", {
       fill: "none",
       stroke: "currentColor",
@@ -5011,13 +5031,14 @@ function ou(e, t) {
     }, null, -1)
   ])]);
 }
-const nu = io({ name: "lucide-x", render: ou }), iu = /* @__PURE__ */ Nt({
+const iu = io({ name: "lucide-x", render: nu }), su = /* @__PURE__ */ Nt({
   __name: "UButton.ce",
   props: {
-    size: { default: "md", type: String }
+    size: { default: "md", type: String },
+    variant: { default: "normal", type: String }
   },
   setup(e) {
-    const t = oe(() => {
+    const t = re(() => {
       switch (e.size) {
         case "xs":
           return "px-1 py-0.5 gap-1";
@@ -5025,25 +5046,30 @@ const nu = io({ name: "lucide-x", render: ou }), iu = /* @__PURE__ */ Nt({
           return "px-1.5 py-1 gap-1";
         case "lg":
           return "px-3 py-1 gap-2";
-        case "md":
         default:
           return "px-2 py-1 gap-1.5";
       }
-    });
-    return (r, o) => (Ve(), Mt("button", {
+    }), r = re(() => e.variant === "outline" ? "bg-transparent border border-(--ui-border) text-(--ui-text-muted) hover:bg-(--ui-bg-muted) hover:text-(--ui-text)" : "bg-theme-400 hover:bg-theme-600 dark:bg-theme-400 dark:hover:bg-theme-300 text-gray-900");
+    return (o, n) => (Ve(), Mt("button", {
       type: "button",
-      class: Qt(["bg-theme-400 hover:bg-theme-600 dark:bg-theme-400 dark:hover:bg-theme-300 font-medium hover:cursor-pointer focus-visible:outline-theme focus-visible:outline-offset-2 focus-visible:outline-2 transition-colors text-(--color-gray-900) flex items-center disabled:cursor-not-allowed disabled:text-(--color-gray-700)", [`text-${e.size}`, t.value, `rounded-${e.size}`]])
+      class: Qt(["font-medium hover:cursor-pointer focus-visible:outline-theme focus-visible:outline-offset-2 focus-visible:outline-2 transition-colors flex items-center disabled:cursor-not-allowed disabled:text-gray-700", [
+        // @sourced in tailwind css
+        `text-${e.size}`,
+        `rounded-${e.size}`,
+        t.value,
+        r.value
+      ]])
     }, [
-      Xi(r.$slots, "default")
+      Xi(o.$slots, "default")
     ], 2));
   }
-}), su = {
+}), lu = {
   viewBox: "0 0 24 24",
   width: "1.2em",
   height: "1.2em"
 };
-function lu(e, t) {
-  return Ve(), Mt("svg", su, [...t[0] || (t[0] = [
+function au(e, t) {
+  return Ve(), Mt("svg", lu, [...t[0] || (t[0] = [
     Se("path", {
       fill: "none",
       stroke: "currentColor",
@@ -5054,13 +5080,13 @@ function lu(e, t) {
     }, null, -1)
   ])]);
 }
-const au = io({ name: "lucide-minimize2", render: lu }), cu = {
+const cu = io({ name: "lucide-minimize2", render: au }), uu = {
   viewBox: "0 0 24 24",
   width: "1.2em",
   height: "1.2em"
 };
-function uu(e, t) {
-  return Ve(), Mt("svg", cu, [...t[0] || (t[0] = [
+function fu(e, t) {
+  return Ve(), Mt("svg", uu, [...t[0] || (t[0] = [
     Se("g", {
       fill: "none",
       stroke: "currentColor",
@@ -5079,8 +5105,8 @@ function uu(e, t) {
     ], -1)
   ])]);
 }
-const fu = io({ name: "lucide-picture-in-picture", render: uu }), Ds = Symbol("duplex-channel");
-function jf() {
+const du = io({ name: "lucide-picture-in-picture", render: fu }), Ds = /* @__PURE__ */ Symbol("duplex-channel");
+function Hf() {
   const e = Ce(Ds);
   if (!e)
     throw new Error(
@@ -5088,8 +5114,8 @@ function jf() {
     );
   return e;
 }
-const Fs = Symbol("queries");
-function Lf() {
+const Fs = /* @__PURE__ */ Symbol("queries");
+function zf() {
   const e = Ce(Fs);
   if (!e)
     throw new Error(
@@ -5097,8 +5123,8 @@ function Lf() {
     );
   return e;
 }
-const Vs = Symbol("mutations");
-function Hf() {
+const Vs = /* @__PURE__ */ Symbol("mutations");
+function Bf() {
   const e = Ce(Vs);
   if (!e)
     throw new Error(
@@ -5106,7 +5132,7 @@ function Hf() {
     );
   return e;
 }
-const du = { class: "w-full h-full grid grid-rows-[auto_1fr] bg-ui-bg text-ui-text font-sans" }, hu = { class: "flex items-center border-b border-(--ui-border) select-none" }, pu = ["href", "onClick"], gu = { class: "flex items-center py-1 gap-1 pr-1" }, mu = /* @__PURE__ */ Nt({
+const hu = { class: "w-full h-full grid grid-rows-[auto_1fr] bg-ui-bg text-ui-text font-sans" }, pu = { class: "flex items-center border-b border-(--ui-border) select-none" }, gu = ["href", "onClick"], mu = { class: "flex items-center py-1 gap-1 pr-1" }, vu = /* @__PURE__ */ Nt({
   __name: "DevtoolsPanel.ce",
   props: {
     port: { type: null },
@@ -5147,14 +5173,14 @@ const du = { class: "w-full h-full grid grid-rows-[auto_1fr] bg-ui-bg text-ui-te
       const l = i.value.findIndex((a) => a.id === s.id);
       l !== -1 && i.value.splice(l, 1);
     }), (s, l) => {
-      const a = bn("RouterLink"), f = fu, c = au, d = iu, m = nu, g = bn("RouterView"), k = tu;
+      const a = bn("RouterLink"), f = du, c = cu, d = su, m = iu, g = bn("RouterView"), k = ru;
       return Ve(), Kt(k, {
         id: "root",
         "is-pip": e.isPip
       }, {
         default: rr(() => [
-          Se("main", du, [
-            Se("div", hu, [
+          Se("main", hu, [
+            Se("div", pu, [
               l[2] || (l[2] = Se("div", { class: "flex items-center p-2 mr-2" }, [
                 Se("span", { class: "text-xl" }, "🍹")
               ], -1)),
@@ -5163,17 +5189,17 @@ const du = { class: "w-full h-full grid grid-rows-[auto_1fr] bg-ui-bg text-ui-te
                 custom: "",
                 to: x
               }, {
-                default: rr(({ isActive: M, href: S, navigate: P }) => [
+                default: rr(({ isActive: M, href: S, navigate: O }) => [
                   Se("a", {
                     href: S,
                     class: Qt([M ? "border-theme" : "border-transparent text-(--ui-text-dimmed)", "px-4 py-2 font-medium transition-colors hover:bg-theme-400 relative theme-primary border-b-2 hover:border-theme-300"]),
-                    onClick: P
-                  }, vi(x.slice(1, 2).toUpperCase() + x.slice(2)), 11, pu)
+                    onClick: O
+                  }, vi(x.slice(1, 2).toUpperCase() + x.slice(2)), 11, gu)
                 ]),
                 _: 2
               }, 1032, ["to"])), 64)),
               l[3] || (l[3] = Se("div", { class: "flex-grow" }, null, -1)),
-              Se("div", gu, [
+              Se("div", mu, [
                 ae(d, {
                   class: "variant-ghost theme-neutral",
                   title: e.isPip ? "Restore window" : "Open in a new window",
@@ -5209,20 +5235,20 @@ const du = { class: "w-full h-full grid grid-rows-[auto_1fr] bg-ui-bg text-ui-te
       }, 8, ["is-pip"]);
     };
   }
-}), vu = '@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-translate-x:0;--tw-translate-y:0;--tw-translate-z:0;--tw-rotate-x:initial;--tw-rotate-y:initial;--tw-rotate-z:initial;--tw-skew-x:initial;--tw-skew-y:initial;--tw-space-y-reverse:0;--tw-space-x-reverse:0;--tw-divide-y-reverse:0;--tw-border-style:solid;--tw-leading:initial;--tw-font-weight:initial;--tw-shadow:0 0 #0000;--tw-shadow-color:initial;--tw-shadow-alpha:100%;--tw-inset-shadow:0 0 #0000;--tw-inset-shadow-color:initial;--tw-inset-shadow-alpha:100%;--tw-ring-color:initial;--tw-ring-shadow:0 0 #0000;--tw-inset-ring-color:initial;--tw-inset-ring-shadow:0 0 #0000;--tw-ring-inset:initial;--tw-ring-offset-width:0px;--tw-ring-offset-color:#fff;--tw-ring-offset-shadow:0 0 #0000;--tw-blur:initial;--tw-brightness:initial;--tw-contrast:initial;--tw-grayscale:initial;--tw-hue-rotate:initial;--tw-invert:initial;--tw-opacity:initial;--tw-saturate:initial;--tw-sepia:initial;--tw-drop-shadow:initial;--tw-drop-shadow-color:initial;--tw-drop-shadow-alpha:100%;--tw-drop-shadow-size:initial;--tw-duration:initial;--tw-outline-style:solid;--progress-value:0}}}.splitpanes{width:100%;height:100%;display:flex}.splitpanes--vertical{flex-direction:row}.splitpanes--horizontal{flex-direction:column}.splitpanes--dragging .splitpanes__pane{-webkit-user-select:none;user-select:none;pointer-events:none}.splitpanes__pane{width:100%;height:100%;overflow:auto}.splitpanes--vertical .splitpanes__pane{transition:width .2s ease-out}.splitpanes--horizontal .splitpanes__pane{transition:height .2s ease-out}.splitpanes--dragging .splitpanes__pane{transition:none}.splitpanes__splitter{touch-action:none;-webkit-user-select:none;user-select:none}.splitpanes--vertical>.splitpanes__splitter{cursor:col-resize;min-width:1px}.splitpanes--horizontal>.splitpanes__splitter{cursor:row-resize;min-height:1px}.splitpanes.default-theme .splitpanes__pane{background-color:#f2f2f2}.splitpanes.default-theme .splitpanes__splitter{box-sizing:border-box;background-color:#fff;flex-shrink:0;position:relative}.splitpanes.default-theme .splitpanes__splitter:before,.splitpanes.default-theme .splitpanes__splitter:after{content:"";background-color:#00000026;transition:background-color .3s;position:absolute;top:50%;left:50%}.splitpanes.default-theme .splitpanes__splitter:hover:before,.splitpanes.default-theme .splitpanes__splitter:hover:after{background-color:#00000040}.splitpanes.default-theme .splitpanes__splitter:first-child{cursor:auto}.default-theme.splitpanes .splitpanes .splitpanes__splitter{z-index:1}.default-theme.splitpanes--vertical>.splitpanes__splitter,.default-theme .splitpanes--vertical>.splitpanes__splitter{border-left:1px solid #eee;width:7px;margin-left:-1px}.default-theme.splitpanes--vertical>.splitpanes__splitter:before,.default-theme.splitpanes--vertical>.splitpanes__splitter:after,.default-theme .splitpanes--vertical>.splitpanes__splitter:before,.default-theme .splitpanes--vertical>.splitpanes__splitter:after{width:1px;height:30px;transform:translateY(-50%)}.default-theme.splitpanes--vertical>.splitpanes__splitter:before,.default-theme .splitpanes--vertical>.splitpanes__splitter:before{margin-left:-2px}.default-theme.splitpanes--vertical>.splitpanes__splitter:after,.default-theme .splitpanes--vertical>.splitpanes__splitter:after{margin-left:1px}.default-theme.splitpanes--horizontal>.splitpanes__splitter,.default-theme .splitpanes--horizontal>.splitpanes__splitter{border-top:1px solid #eee;height:7px;margin-top:-1px}.default-theme.splitpanes--horizontal>.splitpanes__splitter:before,.default-theme.splitpanes--horizontal>.splitpanes__splitter:after,.default-theme .splitpanes--horizontal>.splitpanes__splitter:before,.default-theme .splitpanes--horizontal>.splitpanes__splitter:after{width:30px;height:1px;transform:translate(-50%)}.default-theme.splitpanes--horizontal>.splitpanes__splitter:before,.default-theme .splitpanes--horizontal>.splitpanes__splitter:before{margin-top:-2px}.default-theme.splitpanes--horizontal>.splitpanes__splitter:after,.default-theme .splitpanes--horizontal>.splitpanes__splitter:after{margin-top:1px}.splitpanes__splitter{--grab-size:-4px;background-color:var(--ui-text);transition:background-color .2s;position:relative}@supports (color:color-mix(in lab,red,red)){.splitpanes__splitter{background-color:color-mix(in lab,var(--ui-text)20%,var(--ui-bg))}}.splitpanes--vertical>.splitpanes__splitter:before{left:var(--grab-size);right:var(--grab-size);height:100%}.splitpanes--horizontal>.splitpanes__splitter:before{top:var(--grab-size);bottom:var(--grab-size);width:100%}.splitpanes__splitter:before{content:"";z-index:10000;transition:background-color .25s ease-out;position:absolute;inset:0}.splitpanes__splitter:hover:before{background-color:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){.splitpanes__splitter:hover:before{background-color:color-mix(in lab,var(--ui-text),transparent 75%)}}.splitpanes__splitter:hover:before{opacity:1}@layer theme{:root,:host{--font-sans:ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--font-mono:ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--color-red-50:oklch(97.1% .013 17.38);--color-red-100:oklch(93.6% .032 17.717);--color-red-200:oklch(88.5% .062 18.334);--color-red-300:oklch(80.8% .114 19.571);--color-red-400:oklch(70.4% .191 22.216);--color-red-500:oklch(63.7% .237 25.331);--color-red-600:oklch(57.7% .245 27.325);--color-red-700:oklch(50.5% .213 27.518);--color-red-800:oklch(44.4% .177 26.899);--color-red-900:oklch(39.6% .141 25.723);--color-red-950:oklch(25.8% .092 26.042);--color-orange-50:oklch(98% .016 73.684);--color-orange-100:oklch(95.4% .038 75.164);--color-orange-200:oklch(90.1% .076 70.697);--color-orange-300:oklch(83.7% .128 66.29);--color-orange-400:oklch(75% .183 55.934);--color-orange-500:oklch(70.5% .213 47.604);--color-orange-600:oklch(64.6% .222 41.116);--color-orange-700:oklch(55.3% .195 38.402);--color-orange-800:oklch(47% .157 37.304);--color-orange-900:oklch(40.8% .123 38.172);--color-orange-950:oklch(26.6% .079 36.259);--color-yellow-50:oklch(98.7% .026 102.212);--color-yellow-100:oklch(97.3% .071 103.193);--color-yellow-200:oklch(94.5% .129 101.54);--color-yellow-300:oklch(90.5% .182 98.111);--color-yellow-400:oklch(85.2% .199 91.936);--color-yellow-500:oklch(79.5% .184 86.047);--color-yellow-600:oklch(68.1% .162 75.834);--color-yellow-700:oklch(55.4% .135 66.442);--color-yellow-800:oklch(47.6% .114 61.907);--color-yellow-900:oklch(42.1% .095 57.708);--color-yellow-950:oklch(28.6% .066 53.813);--color-lime-50:oklch(98.6% .031 120.757);--color-lime-100:oklch(96.7% .067 122.328);--color-lime-200:oklch(93.8% .127 124.321);--color-lime-300:oklch(89.7% .196 126.665);--color-lime-400:oklch(84.1% .238 128.85);--color-lime-500:oklch(76.8% .233 130.85);--color-lime-600:oklch(64.8% .2 131.684);--color-lime-700:oklch(53.2% .157 131.589);--color-lime-800:oklch(45.3% .124 130.933);--color-lime-900:oklch(40.5% .101 131.063);--color-lime-950:oklch(27.4% .072 132.109);--color-green-50:oklch(98.2% .018 155.826);--color-green-100:oklch(96.2% .044 156.743);--color-green-200:oklch(92.5% .084 155.995);--color-green-300:oklch(87.1% .15 154.449);--color-green-400:oklch(79.2% .209 151.711);--color-green-500:oklch(72.3% .219 149.579);--color-green-600:oklch(62.7% .194 149.214);--color-green-700:oklch(52.7% .154 150.069);--color-green-800:oklch(44.8% .119 151.328);--color-green-900:oklch(39.3% .095 152.535);--color-green-950:oklch(26.6% .065 152.934);--color-blue-50:oklch(97% .014 254.604);--color-blue-100:oklch(93.2% .032 255.585);--color-blue-200:oklch(88.2% .059 254.128);--color-blue-300:oklch(80.9% .105 251.813);--color-blue-400:oklch(70.7% .165 254.624);--color-blue-500:oklch(62.3% .214 259.815);--color-blue-600:oklch(54.6% .245 262.881);--color-blue-700:oklch(48.8% .243 264.376);--color-blue-800:oklch(42.4% .199 265.638);--color-blue-900:oklch(37.9% .146 265.522);--color-blue-950:oklch(28.2% .091 267.935);--color-purple-50:oklch(97.7% .014 308.299);--color-purple-100:oklch(94.6% .033 307.174);--color-purple-200:oklch(90.2% .063 306.703);--color-purple-300:oklch(82.7% .119 306.383);--color-purple-400:oklch(71.4% .203 305.504);--color-purple-500:oklch(62.7% .265 303.9);--color-purple-600:oklch(55.8% .288 302.321);--color-purple-700:oklch(49.6% .265 301.924);--color-purple-800:oklch(43.8% .218 303.724);--color-purple-900:oklch(38.1% .176 304.987);--color-purple-950:oklch(29.1% .149 302.717);--color-gray-50:oklch(98.5% .002 247.839);--color-gray-100:oklch(96.7% .003 264.542);--color-gray-200:oklch(92.8% .006 264.531);--color-gray-300:oklch(87.2% .01 258.338);--color-gray-400:oklch(70.7% .022 261.325);--color-gray-500:oklch(55.1% .027 264.364);--color-gray-600:oklch(44.6% .03 256.802);--color-gray-700:oklch(37.3% .034 259.733);--color-gray-800:oklch(27.8% .033 256.848);--color-gray-900:oklch(21% .034 264.665);--color-gray-950:oklch(13% .028 261.692);--color-neutral-50:var(--color-gray-50);--color-neutral-100:var(--color-gray-100);--color-neutral-200:var(--color-gray-200);--color-neutral-300:var(--color-gray-300);--color-neutral-400:var(--color-gray-400);--color-neutral-500:var(--color-gray-500);--color-neutral-600:var(--color-gray-600);--color-neutral-700:var(--color-gray-700);--color-neutral-800:var(--color-gray-800);--color-neutral-900:var(--color-gray-900);--color-neutral-950:var(--color-gray-950);--color-white:#fff;--spacing:.25rem;--container-md:28rem;--container-3xl:48rem;--text-xs:.75rem;--text-xs--line-height:calc(1/.75);--text-sm:.875rem;--text-sm--line-height:calc(1.25/.875);--text-lg:1.125rem;--text-lg--line-height:calc(1.75/1.125);--text-xl:1.25rem;--text-xl--line-height:calc(1.75/1.25);--font-weight-medium:500;--font-weight-semibold:600;--font-weight-bold:700;--leading-snug:1.375;--radius-xs:.125rem;--radius-sm:.25rem;--radius-md:.375rem;--radius-lg:.5rem;--animate-spin:spin 1s linear infinite;--default-transition-duration:.15s;--default-transition-timing-function:cubic-bezier(.4,0,.2,1);--default-font-family:var(--font-sans);--default-mono-font-family:var(--font-mono);--color-primary-50:var(--color-lime-50);--color-primary-100:var(--color-lime-100);--color-primary-200:var(--color-lime-200);--color-primary-300:var(--color-lime-300);--color-primary-400:var(--color-lime-400);--color-primary-500:var(--color-lime-500);--color-primary-600:var(--color-lime-600);--color-primary-700:var(--color-lime-700);--color-primary-800:var(--color-lime-800);--color-primary-900:var(--color-lime-900);--color-primary-950:var(--color-lime-950);--color-secondary-50:var(--color-yellow-50);--color-secondary-100:var(--color-yellow-100);--color-secondary-200:var(--color-yellow-200);--color-secondary-300:var(--color-yellow-300);--color-secondary-400:var(--color-yellow-400);--color-secondary-500:var(--color-yellow-500);--color-secondary-600:var(--color-yellow-600);--color-secondary-700:var(--color-yellow-700);--color-secondary-800:var(--color-yellow-800);--color-secondary-900:var(--color-yellow-900);--color-success-50:var(--color-green-50);--color-success-100:var(--color-green-100);--color-success-200:var(--color-green-200);--color-success-300:var(--color-green-300);--color-success-400:var(--color-green-400);--color-success-500:var(--color-green-500);--color-success-600:var(--color-green-600);--color-success-700:var(--color-green-700);--color-success-800:var(--color-green-800);--color-success-900:var(--color-green-900);--color-success-950:var(--color-green-950);--color-warning-50:var(--color-orange-50);--color-warning-100:var(--color-orange-100);--color-warning-200:var(--color-orange-200);--color-warning-300:var(--color-orange-300);--color-warning-400:var(--color-orange-400);--color-warning-500:var(--color-orange-500);--color-warning-600:var(--color-orange-600);--color-warning-700:var(--color-orange-700);--color-warning-800:var(--color-orange-800);--color-warning-900:var(--color-orange-900);--color-warning-950:var(--color-orange-950);--color-error-50:var(--color-red-50);--color-error-100:var(--color-red-100);--color-error-200:var(--color-red-200);--color-error-300:var(--color-red-300);--color-error-400:var(--color-red-400);--color-error-500:var(--color-red-500);--color-error-600:var(--color-red-600);--color-error-700:var(--color-red-700);--color-error-800:var(--color-red-800);--color-error-900:var(--color-red-900);--color-error-950:var(--color-red-950);--color-info-50:var(--color-blue-50);--color-info-100:var(--color-blue-100);--color-info-200:var(--color-blue-200);--color-info-300:var(--color-blue-300);--color-info-400:var(--color-blue-400);--color-info-500:var(--color-blue-500);--color-info-600:var(--color-blue-600);--color-info-700:var(--color-blue-700);--color-info-800:var(--color-blue-800);--color-info-900:var(--color-blue-900);--color-info-950:var(--color-blue-950);--color-theme:var(--ui-neutral);--color-theme-50:var(--color-neutral-50);--color-theme-100:var(--color-neutral-100);--color-theme-200:var(--color-neutral-200);--color-theme-300:var(--color-neutral-300);--color-theme-400:var(--color-neutral-400);--color-theme-500:var(--color-neutral-500);--color-theme-600:var(--color-neutral-600);--color-theme-700:var(--color-neutral-700);--color-theme-800:var(--color-neutral-800);--color-theme-900:var(--color-neutral-900);--color-theme-950:var(--color-neutral-950)}}@layer base{*,:after,:before,::backdrop{box-sizing:border-box;border:0 solid;margin:0;padding:0}::file-selector-button{box-sizing:border-box;border:0 solid;margin:0;padding:0}html,:host{-webkit-text-size-adjust:100%;tab-size:4;line-height:1.5;font-family:var(--default-font-family,ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji");font-feature-settings:var(--default-font-feature-settings,normal);font-variation-settings:var(--default-font-variation-settings,normal);-webkit-tap-highlight-color:transparent}hr{height:0;color:inherit;border-top-width:1px}abbr:where([title]){-webkit-text-decoration:underline dotted;text-decoration:underline dotted}h1,h2,h3,h4,h5,h6{font-size:inherit;font-weight:inherit}a{color:inherit;-webkit-text-decoration:inherit;text-decoration:inherit}b,strong{font-weight:bolder}code,kbd,samp,pre{font-family:var(--default-mono-font-family,ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace);font-feature-settings:var(--default-mono-font-feature-settings,normal);font-variation-settings:var(--default-mono-font-variation-settings,normal);font-size:1em}small{font-size:80%}sub,sup{vertical-align:baseline;font-size:75%;line-height:0;position:relative}sub{bottom:-.25em}sup{top:-.5em}table{text-indent:0;border-color:inherit;border-collapse:collapse}:-moz-focusring{outline:auto}progress{vertical-align:baseline}summary{display:list-item}ol,ul,menu{list-style:none}img,svg,video,canvas,audio,iframe,embed,object{vertical-align:middle;display:block}img,video{max-width:100%;height:auto}button,input,select,optgroup,textarea{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}::file-selector-button{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}:where(select:is([multiple],[size])) optgroup{font-weight:bolder}:where(select:is([multiple],[size])) optgroup option{padding-inline-start:20px}::file-selector-button{margin-inline-end:4px}::placeholder{opacity:1}@supports (not ((-webkit-appearance:-apple-pay-button))) or (contain-intrinsic-size:1px){::placeholder{color:currentColor}@supports (color:color-mix(in lab,red,red)){::placeholder{color:color-mix(in oklab,currentcolor 50%,transparent)}}}textarea{resize:vertical}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-date-and-time-value{min-height:1lh;text-align:inherit}::-webkit-datetime-edit{display:inline-flex}::-webkit-datetime-edit-fields-wrapper{padding:0}::-webkit-datetime-edit{padding-block:0}::-webkit-datetime-edit-year-field{padding-block:0}::-webkit-datetime-edit-month-field{padding-block:0}::-webkit-datetime-edit-day-field{padding-block:0}::-webkit-datetime-edit-hour-field{padding-block:0}::-webkit-datetime-edit-minute-field{padding-block:0}::-webkit-datetime-edit-second-field{padding-block:0}::-webkit-datetime-edit-millisecond-field{padding-block:0}::-webkit-datetime-edit-meridiem-field{padding-block:0}::-webkit-calendar-picker-indicator{line-height:1}:-moz-ui-invalid{box-shadow:none}button,input:where([type=button],[type=reset],[type=submit]){appearance:button}::file-selector-button{appearance:button}::-webkit-inner-spin-button{height:auto}::-webkit-outer-spin-button{height:auto}[hidden]:where(:not([hidden=until-found])){display:none!important}}@layer components;@layer utilities{.\\@container{container-type:inline-size}.collapse{visibility:collapse}.absolute{position:absolute}.fixed{position:fixed}.relative{position:relative}.static{position:static}.-inset-1{inset:calc(var(--spacing)*-1)}.top-1\\/2{top:50%}.right-0{right:calc(var(--spacing)*0)}.bottom-0{bottom:calc(var(--spacing)*0)}.left-0{left:calc(var(--spacing)*0)}.left-2{left:calc(var(--spacing)*2)}.z-9999,.z-\\[9999\\]{z-index:9999}.container{width:100%}@media(min-width:40rem){.container{max-width:40rem}}@media(min-width:48rem){.container{max-width:48rem}}@media(min-width:64rem){.container{max-width:64rem}}@media(min-width:80rem){.container{max-width:80rem}}@media(min-width:96rem){.container{max-width:96rem}}.m-0{margin:calc(var(--spacing)*0)}.mx-auto{margin-inline:auto}.mt-1{margin-top:calc(var(--spacing)*1)}.mt-4{margin-top:calc(var(--spacing)*4)}.mr-2{margin-right:calc(var(--spacing)*2)}.mb-6{margin-bottom:calc(var(--spacing)*6)}.mb-8{margin-bottom:calc(var(--spacing)*8)}.mb-12{margin-bottom:calc(var(--spacing)*12)}.mb-\\[700px\\]{margin-bottom:700px}.ml-5{margin-left:calc(var(--spacing)*5)}.block{display:block}.flex{display:flex}.grid{display:grid}.inline{display:inline}.inline-block{display:inline-block}.size-2{width:calc(var(--spacing)*2);height:calc(var(--spacing)*2)}.size-3{width:calc(var(--spacing)*3);height:calc(var(--spacing)*3)}.size-3\\.5{width:calc(var(--spacing)*3.5);height:calc(var(--spacing)*3.5)}.size-4{width:calc(var(--spacing)*4);height:calc(var(--spacing)*4)}.size-8{width:calc(var(--spacing)*8);height:calc(var(--spacing)*8)}.size-\\[1em\\]{width:1em;height:1em}.h-5{height:calc(var(--spacing)*5)}.h-40{height:calc(var(--spacing)*40)}.h-\\[8px\\]{height:8px}.h-full{height:100%}.max-h-\\[80\\%\\]{max-height:80%}.max-h-\\[1200px\\]{max-height:1200px}.min-h-\\[20vh\\]{min-height:20vh}.w-5{width:calc(var(--spacing)*5)}.w-6{width:calc(var(--spacing)*6)}.w-8{width:calc(var(--spacing)*8)}.w-40{width:calc(var(--spacing)*40)}.w-full{width:100%}.max-w-3xl{max-width:var(--container-3xl)}.max-w-md{max-width:var(--container-md)}.min-w-\\[1\\.65em\\]{min-width:1.65em}.flex-grow,.grow{flex-grow:1}.-translate-y-1\\/2{--tw-translate-y: -50% ;translate:var(--tw-translate-x)var(--tw-translate-y)}.rotate-90{rotate:90deg}.transform{transform:var(--tw-rotate-x,)var(--tw-rotate-y,)var(--tw-rotate-z,)var(--tw-skew-x,)var(--tw-skew-y,)}.animate-spin{animation:var(--animate-spin)}.cursor-col-resize{cursor:col-resize}.cursor-help{cursor:help}.cursor-pointer{cursor:pointer}.cursor-row-resize{cursor:row-resize}.touch-none{touch-action:none}.grid-flow-col{grid-auto-flow:column}.grid-cols-\\[auto_1fr\\]{grid-template-columns:auto 1fr}.grid-cols-\\[auto_auto_1fr\\]{grid-template-columns:auto auto 1fr}.grid-cols-\\[minmax\\(0\\,auto\\)_1fr\\]{grid-template-columns:minmax(0,auto) 1fr}.grid-rows-\\[auto_1fr\\]{grid-template-rows:auto 1fr}.flex-col{flex-direction:column}.flex-wrap{flex-wrap:wrap}.items-center{align-items:center}.justify-center{justify-content:center}.justify-end{justify-content:flex-end}.justify-items-start{justify-items:start}.gap-0\\.5{gap:calc(var(--spacing)*.5)}.gap-1{gap:calc(var(--spacing)*1)}.gap-1\\.5{gap:calc(var(--spacing)*1.5)}.gap-2{gap:calc(var(--spacing)*2)}.gap-4{gap:calc(var(--spacing)*4)}.gap-6{gap:calc(var(--spacing)*6)}:where(.space-y-1>:not(:last-child)){--tw-space-y-reverse:0;margin-block-start:calc(calc(var(--spacing)*1)*var(--tw-space-y-reverse));margin-block-end:calc(calc(var(--spacing)*1)*calc(1 - var(--tw-space-y-reverse)))}:where(.space-y-2>:not(:last-child)){--tw-space-y-reverse:0;margin-block-start:calc(calc(var(--spacing)*2)*var(--tw-space-y-reverse));margin-block-end:calc(calc(var(--spacing)*2)*calc(1 - var(--tw-space-y-reverse)))}:where(.space-y-6>:not(:last-child)){--tw-space-y-reverse:0;margin-block-start:calc(calc(var(--spacing)*6)*var(--tw-space-y-reverse));margin-block-end:calc(calc(var(--spacing)*6)*calc(1 - var(--tw-space-y-reverse)))}.gap-x-0\\.5{column-gap:calc(var(--spacing)*.5)}.gap-x-1{column-gap:calc(var(--spacing)*1)}.gap-x-2{column-gap:calc(var(--spacing)*2)}:where(.space-x-2>:not(:last-child)){--tw-space-x-reverse:0;margin-inline-start:calc(calc(var(--spacing)*2)*var(--tw-space-x-reverse));margin-inline-end:calc(calc(var(--spacing)*2)*calc(1 - var(--tw-space-x-reverse)))}:where(.divide-y>:not(:last-child)){--tw-divide-y-reverse:0;border-bottom-style:var(--tw-border-style);border-top-style:var(--tw-border-style);border-top-width:calc(1px*var(--tw-divide-y-reverse));border-bottom-width:calc(1px*calc(1 - var(--tw-divide-y-reverse)))}:where(.divide-\\(--ui-border\\)>:not(:last-child)){border-color:var(--ui-border)}:where(.divide-\\(--ui-border-accented\\)>:not(:last-child)){border-color:var(--ui-border-accented)}.overflow-auto{overflow:auto}.overflow-hidden{overflow:hidden}.rounded{border-radius:.25rem}.rounded-full{border-radius:3.40282e38px}.rounded-lg{border-radius:var(--radius-lg)}.rounded-md{border-radius:var(--radius-md)}.rounded-sm{border-radius:var(--radius-sm)}.rounded-xs{border-radius:var(--radius-xs)}.rounded-l{border-top-left-radius:.25rem;border-bottom-left-radius:.25rem}.rounded-tl{border-top-left-radius:.25rem}.border{border-style:var(--tw-border-style);border-width:1px}.border-t{border-top-style:var(--tw-border-style);border-top-width:1px}.border-b{border-bottom-style:var(--tw-border-style);border-bottom-width:1px}.border-b-2{border-bottom-style:var(--tw-border-style);border-bottom-width:2px}.border-\\(--ui-border\\){border-color:var(--ui-border)}.border-theme{border-color:var(--color-theme)}.border-transparent{border-color:#0000}.bg-\\(--ui-bg-accented\\){background-color:var(--ui-bg-accented)}.bg-\\(--ui-bg-muted\\){background-color:var(--ui-bg-muted)}.bg-\\(--ui-border\\){background-color:var(--ui-border)}.bg-\\(--ui-text\\)\\/5{background-color:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){.bg-\\(--ui-text\\)\\/5{background-color:color-mix(in oklab,var(--ui-text)5%,transparent)}}.bg-\\(--ui-text\\)\\/8{background-color:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){.bg-\\(--ui-text\\)\\/8{background-color:color-mix(in oklab,var(--ui-text)8%,transparent)}}.bg-error-200{background-color:var(--color-error-200)}.bg-error-500{background-color:var(--color-error-500)}.bg-gray-200{background-color:var(--color-gray-200)}.bg-gray-400{background-color:var(--color-gray-400)}.bg-info-200{background-color:var(--color-info-200)}.bg-info-500{background-color:var(--color-info-500)}.bg-neutral-200{background-color:var(--color-neutral-200)}.bg-neutral-400{background-color:var(--color-neutral-400)}.bg-neutral-500\\/20{background-color:#6a728233}@supports (color:color-mix(in lab,red,red)){.bg-neutral-500\\/20{background-color:color-mix(in oklab,var(--color-neutral-500)20%,transparent)}}.bg-purple-200{background-color:var(--color-purple-200)}.bg-purple-400{background-color:var(--color-purple-400)}.bg-success-200{background-color:var(--color-success-200)}.bg-success-500{background-color:var(--color-success-500)}.bg-theme-400{background-color:var(--color-theme-400)}.bg-theme\\/70{background-color:var(--color-theme)}@supports (color:color-mix(in lab,red,red)){.bg-theme\\/70{background-color:color-mix(in oklab,var(--color-theme)70%,transparent)}}.bg-transparent{background-color:#0000}.bg-warning-200{background-color:var(--color-warning-200)}.bg-warning-500{background-color:var(--color-warning-500)}.p-0\\.5{padding:calc(var(--spacing)*.5)}.p-1{padding:calc(var(--spacing)*1)}.p-2{padding:calc(var(--spacing)*2)}.p-4{padding:calc(var(--spacing)*4)}.px-0\\.5{padding-inline:calc(var(--spacing)*.5)}.px-1{padding-inline:calc(var(--spacing)*1)}.px-1\\.5{padding-inline:calc(var(--spacing)*1.5)}.px-2{padding-inline:calc(var(--spacing)*2)}.px-3{padding-inline:calc(var(--spacing)*3)}.px-4{padding-inline:calc(var(--spacing)*4)}.px-6{padding-inline:calc(var(--spacing)*6)}.py-0\\.5{padding-block:calc(var(--spacing)*.5)}.py-1{padding-block:calc(var(--spacing)*1)}.py-1\\.5{padding-block:calc(var(--spacing)*1.5)}.py-2{padding-block:calc(var(--spacing)*2)}.py-6{padding-block:calc(var(--spacing)*6)}.pt-6{padding-top:calc(var(--spacing)*6)}.pr-1{padding-right:calc(var(--spacing)*1)}.pr-2{padding-right:calc(var(--spacing)*2)}.pl-8{padding-left:calc(var(--spacing)*8)}.text-center{text-align:center}.font-mono{font-family:var(--font-mono)}.font-sans{font-family:var(--font-sans)}.text-lg{font-size:var(--text-lg);line-height:var(--tw-leading,var(--text-lg--line-height))}.text-sm{font-size:var(--text-sm);line-height:var(--tw-leading,var(--text-sm--line-height))}.text-xl{font-size:var(--text-xl);line-height:var(--tw-leading,var(--text-xl--line-height))}.text-xs{font-size:var(--text-xs);line-height:var(--tw-leading,var(--text-xs--line-height))}.leading-6{--tw-leading:calc(var(--spacing)*6);line-height:calc(var(--spacing)*6)}.leading-snug{--tw-leading:var(--leading-snug);line-height:var(--leading-snug)}.font-bold{--tw-font-weight:var(--font-weight-bold);font-weight:var(--font-weight-bold)}.font-medium{--tw-font-weight:var(--font-weight-medium);font-weight:var(--font-weight-medium)}.font-semibold{--tw-font-weight:var(--font-weight-semibold);font-weight:var(--font-weight-semibold)}.text-wrap{text-wrap:wrap}.wrap-break-word{overflow-wrap:break-word}.text-\\(--color-gray-900\\){color:var(--color-gray-900)}.text-\\(--devtools-syntax-gray\\){color:var(--devtools-syntax-gray)}.text-\\(--devtools-syntax-green\\){color:var(--devtools-syntax-green)}.text-\\(--devtools-syntax-orange\\){color:var(--devtools-syntax-orange)}.text-\\(--devtools-syntax-purple\\){color:var(--devtools-syntax-purple)}.text-\\(--devtools-syntax-red\\){color:var(--devtools-syntax-red)}.text-\\(--devtools-syntax-sapphire\\){color:var(--devtools-syntax-sapphire)}.text-\\(--ui-text\\),.text-\\(--ui-text\\)\\/50{color:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){.text-\\(--ui-text\\)\\/50{color:color-mix(in oklab,var(--ui-text)50%,transparent)}}.text-\\(--ui-text-dimmed\\){color:var(--ui-text-dimmed)}.text-\\(--ui-text-muted\\){color:var(--ui-text-muted)}.text-error-100{color:var(--color-error-100)}.text-gray-100{color:var(--color-gray-100)}.text-info-100{color:var(--color-info-100)}.text-neutral-100{color:var(--color-neutral-100)}.text-neutral-400{color:var(--color-neutral-400)}.text-neutral-500{color:var(--color-neutral-500)}.text-neutral-500\\/50{color:#6a728280}@supports (color:color-mix(in lab,red,red)){.text-neutral-500\\/50{color:color-mix(in oklab,var(--color-neutral-500)50%,transparent)}}.text-purple-100{color:var(--color-purple-100)}.text-success-100{color:var(--color-success-100)}.text-warning-100{color:var(--color-warning-100)}.italic{font-style:italic}.shadow{--tw-shadow:0 1px 3px 0 var(--tw-shadow-color,#0000001a),0 1px 2px -1px var(--tw-shadow-color,#0000001a);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}.ring-\\(--ui-bg-muted\\){--tw-ring-color:var(--ui-bg-muted)}.filter{filter:var(--tw-blur,)var(--tw-brightness,)var(--tw-contrast,)var(--tw-grayscale,)var(--tw-hue-rotate,)var(--tw-invert,)var(--tw-saturate,)var(--tw-sepia,)var(--tw-drop-shadow,)}.transition{transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to,opacity,box-shadow,transform,translate,scale,rotate,filter,-webkit-backdrop-filter,backdrop-filter,display,content-visibility,overlay,pointer-events;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-\\[background-color\\]{transition-property:background-color;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-colors{transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-transform{transition-property:transform,translate,scale,rotate;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.duration-200{--tw-duration:.2s;transition-duration:.2s}.select-none{-webkit-user-select:none;user-select:none}@media(hover:hover){.hover\\:cursor-pointer:hover{cursor:pointer}.hover\\:border-theme-300:hover{border-color:var(--color-theme-300)}.hover\\:bg-\\(--ui-bg-elevated\\):hover{background-color:var(--ui-bg-elevated)}.hover\\:bg-\\(--ui-bg-muted\\):hover{background-color:var(--ui-bg-muted)}.hover\\:bg-\\(--ui-border\\):hover{background-color:var(--ui-border)}.hover\\:bg-theme-400:hover{background-color:var(--color-theme-400)}.hover\\:bg-theme-600:hover{background-color:var(--color-theme-600)}.hover\\:ring:hover{--tw-ring-shadow:var(--tw-ring-inset,)0 0 0 calc(1px + var(--tw-ring-offset-width))var(--tw-ring-color,currentcolor);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}}.focus\\:ring-1:focus{--tw-ring-shadow:var(--tw-ring-inset,)0 0 0 calc(1px + var(--tw-ring-offset-width))var(--tw-ring-color,currentcolor);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}.focus\\:ring-theme:focus{--tw-ring-color:var(--color-theme)}.focus\\:outline-none:focus{--tw-outline-style:none;outline-style:none}.focus-visible\\:outline-2:focus-visible{outline-style:var(--tw-outline-style);outline-width:2px}.focus-visible\\:outline-offset-2:focus-visible{outline-offset:2px}.focus-visible\\:outline-theme:focus-visible{outline-color:var(--color-theme)}.disabled\\:cursor-not-allowed:disabled{cursor:not-allowed}.disabled\\:text-\\(--color-gray-700\\):disabled{color:var(--color-gray-700)}@media(min-width:48rem){.md\\:flex{display:flex}.md\\:pt-0{padding-top:calc(var(--spacing)*0)}}@container not (min-width:750px){.\\@max-\\[750px\\]\\:hidden{display:none}}@container not (min-width:28rem){.\\@max-md\\:hidden{display:none}}@media(prefers-color-scheme:dark){:where(.dark\\:divide-\\(--ui-border\\)>:not(:last-child)){border-color:var(--ui-border)}.dark\\:bg-neutral-700{background-color:var(--color-neutral-700)}.dark\\:bg-neutral-800{background-color:var(--color-neutral-800)}.dark\\:bg-theme-400{background-color:var(--color-theme-400)}.dark\\:text-neutral-500{color:var(--color-neutral-500)}@media(hover:hover){.dark\\:hover\\:bg-theme-300:hover{background-color:var(--color-theme-300)}}}}:host{color-scheme:light dark;--ui-radius:var(--radius-sm);--ui-primary:light-dark(var(--color-secondary-500),var(--color-primary-400));--ui-secondary:light-dark(var(--color-secondary-500),var(--color-secondary-400));--ui-success:light-dark(var(--color-success-500),var(--color-success-400));--ui-info:light-dark(var(--color-info-500),var(--color-info-400));--ui-warning:light-dark(var(--color-warning-500),var(--color-warning-400));--ui-error:light-dark(var(--color-error-500),var(--color-error-400));--ui-neutral:light-dark(var(--color-neutral-500),var(--color-neutral-400));--ui-text-dimmed:light-dark(var(--color-gray-400),var(--color-gray-500));--ui-text-muted:light-dark(var(--color-gray-500),var(--color-gray-400));--ui-text-toned:light-dark(var(--color-gray-600),var(--color-gray-300));--ui-text:light-dark(var(--color-gray-900),var(--color-gray-50));--ui-text-inverted:light-dark(var(--color-gray-50),var(--color-gray-900));--ui-bg:light-dark(var(--color-white),var(--color-gray-900));--ui-bg-muted:light-dark(var(--color-gray-50),var(--color-gray-800));--ui-bg-elevated:light-dark(var(--color-gray-100),var(--color-gray-700));--ui-bg-accented:light-dark(var(--color-gray-200),var(--color-gray-600));--ui-bg-inverted:light-dark(var(--color-gray-900),var(--color-white));--ui-border:var(--ui-text);font-family:sans-serif}@supports (color:color-mix(in lab,red,red)){:host{--ui-border:color-mix(in hsl,var(--ui-text)20%,transparent)}}:host{--ui-border-muted:var(--ui-text-muted)}@supports (color:color-mix(in lab,red,red)){:host{--ui-border-muted:color-mix(in hsl,var(--ui-text-muted)10%,transparent)}}:host{--ui-border-accented:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){:host{--ui-border-accented:color-mix(in hsl,var(--ui-text)35%,transparent)}}:host{--ui-border-inverted:var(--ui-text-inverted)}@supports (color:color-mix(in lab,red,red)){:host{--ui-border-inverted:color-mix(in hsl,var(--ui-text-inverted)50%,transparent)}}:host{--devtools-syntax-orange:light-dark(#fe640b,#fab387);--devtools-syntax-purple:light-dark(#8839ef,#cba6f7);--devtools-syntax-gray:light-dark(#4c4f69,#cdd6f4);--devtools-syntax-green:light-dark(#40a02b,#a6e3a1);--devtools-syntax-red:light-dark(#d20f39,#f38ba8);--devtools-syntax-yellow:light-dark(#df8e1d,#f9e2af);--devtools-syntax-sapphire:light-dark(#209fb5,#74c7ec)}@media(prefers-color-scheme:dark){:host{--color-primary-50:var(--color-yellow-50);--color-primary-100:var(--color-yellow-100);--color-primary-200:var(--color-yellow-200);--color-primary-300:var(--color-yellow-300);--color-primary-400:var(--color-yellow-400);--color-primary-500:var(--color-yellow-500);--color-primary-600:var(--color-yellow-600);--color-primary-700:var(--color-yellow-700);--color-primary-800:var(--color-yellow-800);--color-primary-900:var(--color-yellow-900);--color-primary-950:var(--color-yellow-950);--color-secondary-50:var(--color-lime-50);--color-secondary-100:var(--color-lime-100);--color-secondary-200:var(--color-lime-200);--color-secondary-300:var(--color-lime-300);--color-secondary-400:var(--color-lime-400);--color-secondary-500:var(--color-lime-500);--color-secondary-600:var(--color-lime-600);--color-secondary-700:var(--color-lime-700);--color-secondary-800:var(--color-lime-800);--color-secondary-900:var(--color-lime-900);--color-secondary-950:var(--color-lime-950)}}:host:has(.dark){color-scheme:dark}:host:has(.light){color-scheme:light}#root{color:var(--ui-text);background-color:var(--ui-bg);-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}[class~=bg-theme]{color:var(--ui-text);--ui-text:var(--ui-text-inverted)}@media(hover:hover){[class*=bg-theme][class*="hover:"]:hover{color:var(--ui-text);--ui-text:var(--ui-text-inverted)}}.theme-primary{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-secondary);--color-theme-50:var(--color-secondary-50);--color-theme-100:var(--color-secondary-100);--color-theme-200:var(--color-secondary-200);--color-theme-300:var(--color-secondary-300);--color-theme-400:var(--color-secondary-400);--color-theme-500:var(--color-secondary-500);--color-theme-600:var(--color-secondary-600);--color-theme-700:var(--color-secondary-700);--color-theme-800:var(--color-secondary-800);--color-theme-900:var(--color-secondary-900);--color-theme-950:var(--color-secondary-950)}@media(prefers-color-scheme:dark){.theme-primary{--color-theme:var(--ui-primary);--color-theme-50:var(--color-primary-50);--color-theme-100:var(--color-primary-100);--color-theme-200:var(--color-primary-200);--color-theme-300:var(--color-primary-300);--color-theme-400:var(--color-primary-400);--color-theme-500:var(--color-primary-500);--color-theme-600:var(--color-primary-600);--color-theme-700:var(--color-primary-700);--color-theme-800:var(--color-primary-800);--color-theme-900:var(--color-primary-900);--color-theme-950:var(--color-primary-950)}}.theme-secondary{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-secondary);--color-theme-50:var(--color-secondary-50);--color-theme-100:var(--color-secondary-100);--color-theme-200:var(--color-secondary-200);--color-theme-300:var(--color-secondary-300);--color-theme-400:var(--color-secondary-400);--color-theme-500:var(--color-secondary-500);--color-theme-600:var(--color-secondary-600);--color-theme-700:var(--color-secondary-700);--color-theme-800:var(--color-secondary-800);--color-theme-900:var(--color-secondary-900);--color-theme-950:var(--color-secondary-950)}.theme-success{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-success);--color-theme-50:var(--color-success-50);--color-theme-100:var(--color-success-100);--color-theme-200:var(--color-success-200);--color-theme-300:var(--color-success-300);--color-theme-400:var(--color-success-400);--color-theme-500:var(--color-success-500);--color-theme-600:var(--color-success-600);--color-theme-700:var(--color-success-700);--color-theme-800:var(--color-success-800);--color-theme-900:var(--color-success-900);--color-theme-950:var(--color-success-950)}.theme-info{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-info);--color-theme-50:var(--color-info-50);--color-theme-100:var(--color-info-100);--color-theme-200:var(--color-info-200);--color-theme-300:var(--color-info-300);--color-theme-400:var(--color-info-400);--color-theme-500:var(--color-info-500);--color-theme-600:var(--color-info-600);--color-theme-700:var(--color-info-700);--color-theme-800:var(--color-info-800);--color-theme-900:var(--color-info-900);--color-theme-950:var(--color-info-950)}.theme-warning{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-warning);--color-theme-50:var(--color-warning-50);--color-theme-100:var(--color-warning-100);--color-theme-200:var(--color-warning-200);--color-theme-300:var(--color-warning-300);--color-theme-400:var(--color-warning-400);--color-theme-500:var(--color-warning-500);--color-theme-600:var(--color-warning-600);--color-theme-700:var(--color-warning-700);--color-theme-800:var(--color-warning-800);--color-theme-900:var(--color-warning-900);--color-theme-950:var(--color-warning-950)}.theme-error{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-error);--color-theme-50:var(--color-error-50);--color-theme-100:var(--color-error-100);--color-theme-200:var(--color-error-200);--color-theme-300:var(--color-error-300);--color-theme-400:var(--color-error-400);--color-theme-500:var(--color-error-500);--color-theme-600:var(--color-error-600);--color-theme-700:var(--color-error-700);--color-theme-800:var(--color-error-800);--color-theme-900:var(--color-error-900);--color-theme-950:var(--color-error-950)}.theme-neutral{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-neutral);--color-theme-50:var(--color-neutral-50);--color-theme-100:var(--color-neutral-100);--color-theme-200:var(--color-neutral-200);--color-theme-300:var(--color-neutral-300);--color-theme-400:var(--color-neutral-400);--color-theme-500:var(--color-neutral-500);--color-theme-600:var(--color-neutral-600);--color-theme-700:var(--color-neutral-700);--color-theme-800:var(--color-neutral-800);--color-theme-900:var(--color-neutral-900);--color-theme-950:var(--color-neutral-950)}.theme-purple{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--color-purple-400);--color-theme-50:var(--color-purple-50);--color-theme-100:var(--color-purple-100);--color-theme-200:var(--color-purple-200);--color-theme-300:var(--color-purple-300);--color-theme-400:var(--color-purple-400);--color-theme-500:var(--color-purple-500);--color-theme-600:var(--color-purple-600);--color-theme-700:var(--color-purple-700);--color-theme-800:var(--color-purple-800);--color-theme-900:var(--color-purple-900);--color-theme-950:var(--color-purple-950)}.variant-ghost.variant-ghost{--ui-text:var(--color-theme);color:var(--color-theme);background-color:#0000}.variant-ghost.variant-ghost:hover{color:var(--color-theme);background-color:var(--ui-bg)}@supports (color:color-mix(in lab,red,red)){.variant-ghost.variant-ghost:hover{background-color:color-mix(in hsl,var(--ui-bg)10%,transparent)}}@property --progress-value{syntax:"<number>";inherits:false;initial-value:0}@property --tw-translate-x{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-y{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-z{syntax:"*";inherits:false;initial-value:0}@property --tw-rotate-x{syntax:"*";inherits:false}@property --tw-rotate-y{syntax:"*";inherits:false}@property --tw-rotate-z{syntax:"*";inherits:false}@property --tw-skew-x{syntax:"*";inherits:false}@property --tw-skew-y{syntax:"*";inherits:false}@property --tw-space-y-reverse{syntax:"*";inherits:false;initial-value:0}@property --tw-space-x-reverse{syntax:"*";inherits:false;initial-value:0}@property --tw-divide-y-reverse{syntax:"*";inherits:false;initial-value:0}@property --tw-border-style{syntax:"*";inherits:false;initial-value:solid}@property --tw-leading{syntax:"*";inherits:false}@property --tw-font-weight{syntax:"*";inherits:false}@property --tw-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-shadow-color{syntax:"*";inherits:false}@property --tw-shadow-alpha{syntax:"<percentage>";inherits:false;initial-value:100%}@property --tw-inset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-shadow-color{syntax:"*";inherits:false}@property --tw-inset-shadow-alpha{syntax:"<percentage>";inherits:false;initial-value:100%}@property --tw-ring-color{syntax:"*";inherits:false}@property --tw-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-ring-color{syntax:"*";inherits:false}@property --tw-inset-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-ring-inset{syntax:"*";inherits:false}@property --tw-ring-offset-width{syntax:"<length>";inherits:false;initial-value:0}@property --tw-ring-offset-color{syntax:"*";inherits:false;initial-value:#fff}@property --tw-ring-offset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-blur{syntax:"*";inherits:false}@property --tw-brightness{syntax:"*";inherits:false}@property --tw-contrast{syntax:"*";inherits:false}@property --tw-grayscale{syntax:"*";inherits:false}@property --tw-hue-rotate{syntax:"*";inherits:false}@property --tw-invert{syntax:"*";inherits:false}@property --tw-opacity{syntax:"*";inherits:false}@property --tw-saturate{syntax:"*";inherits:false}@property --tw-sepia{syntax:"*";inherits:false}@property --tw-drop-shadow{syntax:"*";inherits:false}@property --tw-drop-shadow-color{syntax:"*";inherits:false}@property --tw-drop-shadow-alpha{syntax:"<percentage>";inherits:false;initial-value:100%}@property --tw-drop-shadow-size{syntax:"*";inherits:false}@property --tw-duration{syntax:"*";inherits:false}@property --tw-outline-style{syntax:"*";inherits:false;initial-value:solid}@keyframes spin{to{transform:rotate(360deg)}}', yu = (e, t) => {
+}), yu = '@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-translate-x:0;--tw-translate-y:0;--tw-translate-z:0;--tw-rotate-x:initial;--tw-rotate-y:initial;--tw-rotate-z:initial;--tw-skew-x:initial;--tw-skew-y:initial;--tw-space-y-reverse:0;--tw-space-x-reverse:0;--tw-divide-y-reverse:0;--tw-border-style:solid;--tw-leading:initial;--tw-font-weight:initial;--tw-shadow:0 0 #0000;--tw-shadow-color:initial;--tw-shadow-alpha:100%;--tw-inset-shadow:0 0 #0000;--tw-inset-shadow-color:initial;--tw-inset-shadow-alpha:100%;--tw-ring-color:initial;--tw-ring-shadow:0 0 #0000;--tw-inset-ring-color:initial;--tw-inset-ring-shadow:0 0 #0000;--tw-ring-inset:initial;--tw-ring-offset-width:0px;--tw-ring-offset-color:#fff;--tw-ring-offset-shadow:0 0 #0000;--tw-outline-style:solid;--tw-blur:initial;--tw-brightness:initial;--tw-contrast:initial;--tw-grayscale:initial;--tw-hue-rotate:initial;--tw-invert:initial;--tw-opacity:initial;--tw-saturate:initial;--tw-sepia:initial;--tw-drop-shadow:initial;--tw-drop-shadow-color:initial;--tw-drop-shadow-alpha:100%;--tw-drop-shadow-size:initial;--tw-duration:initial;--progress-value:0}}}.splitpanes{width:100%;height:100%;display:flex}.splitpanes--vertical{flex-direction:row}.splitpanes--horizontal{flex-direction:column}.splitpanes--dragging .splitpanes__pane{-webkit-user-select:none;user-select:none;pointer-events:none}.splitpanes__pane{width:100%;height:100%;overflow:auto}.splitpanes--vertical .splitpanes__pane{transition:width .2s ease-out}.splitpanes--horizontal .splitpanes__pane{transition:height .2s ease-out}.splitpanes--dragging .splitpanes__pane{transition:none}.splitpanes__splitter{touch-action:none;-webkit-user-select:none;user-select:none}.splitpanes--vertical>.splitpanes__splitter{cursor:col-resize;min-width:1px}.splitpanes--horizontal>.splitpanes__splitter{cursor:row-resize;min-height:1px}.splitpanes.default-theme .splitpanes__pane{background-color:#f2f2f2}.splitpanes.default-theme .splitpanes__splitter{box-sizing:border-box;background-color:#fff;flex-shrink:0;position:relative}.splitpanes.default-theme .splitpanes__splitter:before,.splitpanes.default-theme .splitpanes__splitter:after{content:"";background-color:#00000026;transition:background-color .3s;position:absolute;top:50%;left:50%}.splitpanes.default-theme .splitpanes__splitter:hover:before,.splitpanes.default-theme .splitpanes__splitter:hover:after{background-color:#00000040}.splitpanes.default-theme .splitpanes__splitter:first-child{cursor:auto}.default-theme.splitpanes .splitpanes .splitpanes__splitter{z-index:1}.default-theme.splitpanes--vertical>.splitpanes__splitter,.default-theme .splitpanes--vertical>.splitpanes__splitter{border-left:1px solid #eee;width:7px;margin-left:-1px}.default-theme.splitpanes--vertical>.splitpanes__splitter:before,.default-theme.splitpanes--vertical>.splitpanes__splitter:after,.default-theme .splitpanes--vertical>.splitpanes__splitter:before,.default-theme .splitpanes--vertical>.splitpanes__splitter:after{width:1px;height:30px;transform:translateY(-50%)}.default-theme.splitpanes--vertical>.splitpanes__splitter:before,.default-theme .splitpanes--vertical>.splitpanes__splitter:before{margin-left:-2px}.default-theme.splitpanes--vertical>.splitpanes__splitter:after,.default-theme .splitpanes--vertical>.splitpanes__splitter:after{margin-left:1px}.default-theme.splitpanes--horizontal>.splitpanes__splitter,.default-theme .splitpanes--horizontal>.splitpanes__splitter{border-top:1px solid #eee;height:7px;margin-top:-1px}.default-theme.splitpanes--horizontal>.splitpanes__splitter:before,.default-theme.splitpanes--horizontal>.splitpanes__splitter:after,.default-theme .splitpanes--horizontal>.splitpanes__splitter:before,.default-theme .splitpanes--horizontal>.splitpanes__splitter:after{width:30px;height:1px;transform:translate(-50%)}.default-theme.splitpanes--horizontal>.splitpanes__splitter:before,.default-theme .splitpanes--horizontal>.splitpanes__splitter:before{margin-top:-2px}.default-theme.splitpanes--horizontal>.splitpanes__splitter:after,.default-theme .splitpanes--horizontal>.splitpanes__splitter:after{margin-top:1px}.splitpanes__splitter{--grab-size:-4px;background-color:var(--ui-text);transition:background-color .2s;position:relative}@supports (color:color-mix(in lab,red,red)){.splitpanes__splitter{background-color:color-mix(in lab,var(--ui-text)20%,var(--ui-bg))}}.splitpanes--vertical>.splitpanes__splitter:before{left:var(--grab-size);right:var(--grab-size);height:100%}.splitpanes--horizontal>.splitpanes__splitter:before{top:var(--grab-size);bottom:var(--grab-size);width:100%}.splitpanes__splitter:before{content:"";z-index:10000;transition:background-color .25s ease-out;position:absolute;inset:0}.splitpanes__splitter:hover:before{background-color:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){.splitpanes__splitter:hover:before{background-color:color-mix(in lab,var(--ui-text),transparent 75%)}}.splitpanes__splitter:hover:before{opacity:1}@layer theme{:root,:host{--font-sans:ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--font-mono:ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--color-red-50:oklch(97.1% .013 17.38);--color-red-100:oklch(93.6% .032 17.717);--color-red-200:oklch(88.5% .062 18.334);--color-red-300:oklch(80.8% .114 19.571);--color-red-400:oklch(70.4% .191 22.216);--color-red-500:oklch(63.7% .237 25.331);--color-red-600:oklch(57.7% .245 27.325);--color-red-700:oklch(50.5% .213 27.518);--color-red-800:oklch(44.4% .177 26.899);--color-red-900:oklch(39.6% .141 25.723);--color-red-950:oklch(25.8% .092 26.042);--color-orange-50:oklch(98% .016 73.684);--color-orange-100:oklch(95.4% .038 75.164);--color-orange-200:oklch(90.1% .076 70.697);--color-orange-300:oklch(83.7% .128 66.29);--color-orange-400:oklch(75% .183 55.934);--color-orange-500:oklch(70.5% .213 47.604);--color-orange-600:oklch(64.6% .222 41.116);--color-orange-700:oklch(55.3% .195 38.402);--color-orange-800:oklch(47% .157 37.304);--color-orange-900:oklch(40.8% .123 38.172);--color-orange-950:oklch(26.6% .079 36.259);--color-yellow-50:oklch(98.7% .026 102.212);--color-yellow-100:oklch(97.3% .071 103.193);--color-yellow-200:oklch(94.5% .129 101.54);--color-yellow-300:oklch(90.5% .182 98.111);--color-yellow-400:oklch(85.2% .199 91.936);--color-yellow-500:oklch(79.5% .184 86.047);--color-yellow-600:oklch(68.1% .162 75.834);--color-yellow-700:oklch(55.4% .135 66.442);--color-yellow-800:oklch(47.6% .114 61.907);--color-yellow-900:oklch(42.1% .095 57.708);--color-yellow-950:oklch(28.6% .066 53.813);--color-lime-50:oklch(98.6% .031 120.757);--color-lime-100:oklch(96.7% .067 122.328);--color-lime-200:oklch(93.8% .127 124.321);--color-lime-300:oklch(89.7% .196 126.665);--color-lime-400:oklch(84.1% .238 128.85);--color-lime-500:oklch(76.8% .233 130.85);--color-lime-600:oklch(64.8% .2 131.684);--color-lime-700:oklch(53.2% .157 131.589);--color-lime-800:oklch(45.3% .124 130.933);--color-lime-900:oklch(40.5% .101 131.063);--color-lime-950:oklch(27.4% .072 132.109);--color-green-50:oklch(98.2% .018 155.826);--color-green-100:oklch(96.2% .044 156.743);--color-green-200:oklch(92.5% .084 155.995);--color-green-300:oklch(87.1% .15 154.449);--color-green-400:oklch(79.2% .209 151.711);--color-green-500:oklch(72.3% .219 149.579);--color-green-600:oklch(62.7% .194 149.214);--color-green-700:oklch(52.7% .154 150.069);--color-green-800:oklch(44.8% .119 151.328);--color-green-900:oklch(39.3% .095 152.535);--color-green-950:oklch(26.6% .065 152.934);--color-blue-50:oklch(97% .014 254.604);--color-blue-100:oklch(93.2% .032 255.585);--color-blue-200:oklch(88.2% .059 254.128);--color-blue-300:oklch(80.9% .105 251.813);--color-blue-400:oklch(70.7% .165 254.624);--color-blue-500:oklch(62.3% .214 259.815);--color-blue-600:oklch(54.6% .245 262.881);--color-blue-700:oklch(48.8% .243 264.376);--color-blue-800:oklch(42.4% .199 265.638);--color-blue-900:oklch(37.9% .146 265.522);--color-blue-950:oklch(28.2% .091 267.935);--color-purple-50:oklch(97.7% .014 308.299);--color-purple-100:oklch(94.6% .033 307.174);--color-purple-200:oklch(90.2% .063 306.703);--color-purple-300:oklch(82.7% .119 306.383);--color-purple-400:oklch(71.4% .203 305.504);--color-purple-500:oklch(62.7% .265 303.9);--color-purple-600:oklch(55.8% .288 302.321);--color-purple-700:oklch(49.6% .265 301.924);--color-purple-800:oklch(43.8% .218 303.724);--color-purple-900:oklch(38.1% .176 304.987);--color-purple-950:oklch(29.1% .149 302.717);--color-gray-50:oklch(98.5% .002 247.839);--color-gray-100:oklch(96.7% .003 264.542);--color-gray-200:oklch(92.8% .006 264.531);--color-gray-300:oklch(87.2% .01 258.338);--color-gray-400:oklch(70.7% .022 261.325);--color-gray-500:oklch(55.1% .027 264.364);--color-gray-600:oklch(44.6% .03 256.802);--color-gray-700:oklch(37.3% .034 259.733);--color-gray-800:oklch(27.8% .033 256.848);--color-gray-900:oklch(21% .034 264.665);--color-gray-950:oklch(13% .028 261.692);--color-neutral-50:var(--color-gray-50);--color-neutral-100:var(--color-gray-100);--color-neutral-200:var(--color-gray-200);--color-neutral-300:var(--color-gray-300);--color-neutral-400:var(--color-gray-400);--color-neutral-500:var(--color-gray-500);--color-neutral-600:var(--color-gray-600);--color-neutral-700:var(--color-gray-700);--color-neutral-800:var(--color-gray-800);--color-neutral-900:var(--color-gray-900);--color-neutral-950:var(--color-gray-950);--color-white:#fff;--spacing:.25rem;--container-md:28rem;--container-3xl:48rem;--text-xs:.75rem;--text-xs--line-height:calc(1/.75);--text-sm:.875rem;--text-sm--line-height:calc(1.25/.875);--text-lg:1.125rem;--text-lg--line-height:calc(1.75/1.125);--text-xl:1.25rem;--text-xl--line-height:calc(1.75/1.25);--font-weight-medium:500;--font-weight-semibold:600;--font-weight-bold:700;--leading-snug:1.375;--radius-xs:.125rem;--radius-sm:.25rem;--radius-md:.375rem;--radius-lg:.5rem;--animate-spin:spin 1s linear infinite;--default-transition-duration:.15s;--default-transition-timing-function:cubic-bezier(.4,0,.2,1);--default-font-family:var(--font-sans);--default-mono-font-family:var(--font-mono);--color-primary-50:var(--color-lime-50);--color-primary-100:var(--color-lime-100);--color-primary-200:var(--color-lime-200);--color-primary-300:var(--color-lime-300);--color-primary-400:var(--color-lime-400);--color-primary-500:var(--color-lime-500);--color-primary-600:var(--color-lime-600);--color-primary-700:var(--color-lime-700);--color-primary-800:var(--color-lime-800);--color-primary-900:var(--color-lime-900);--color-primary-950:var(--color-lime-950);--color-secondary-50:var(--color-yellow-50);--color-secondary-100:var(--color-yellow-100);--color-secondary-200:var(--color-yellow-200);--color-secondary-300:var(--color-yellow-300);--color-secondary-400:var(--color-yellow-400);--color-secondary-500:var(--color-yellow-500);--color-secondary-600:var(--color-yellow-600);--color-secondary-700:var(--color-yellow-700);--color-secondary-800:var(--color-yellow-800);--color-secondary-900:var(--color-yellow-900);--color-success-50:var(--color-green-50);--color-success-100:var(--color-green-100);--color-success-200:var(--color-green-200);--color-success-300:var(--color-green-300);--color-success-400:var(--color-green-400);--color-success-500:var(--color-green-500);--color-success-600:var(--color-green-600);--color-success-700:var(--color-green-700);--color-success-800:var(--color-green-800);--color-success-900:var(--color-green-900);--color-success-950:var(--color-green-950);--color-warning-50:var(--color-orange-50);--color-warning-100:var(--color-orange-100);--color-warning-200:var(--color-orange-200);--color-warning-300:var(--color-orange-300);--color-warning-400:var(--color-orange-400);--color-warning-500:var(--color-orange-500);--color-warning-600:var(--color-orange-600);--color-warning-700:var(--color-orange-700);--color-warning-800:var(--color-orange-800);--color-warning-900:var(--color-orange-900);--color-warning-950:var(--color-orange-950);--color-error-50:var(--color-red-50);--color-error-100:var(--color-red-100);--color-error-200:var(--color-red-200);--color-error-300:var(--color-red-300);--color-error-400:var(--color-red-400);--color-error-500:var(--color-red-500);--color-error-600:var(--color-red-600);--color-error-700:var(--color-red-700);--color-error-800:var(--color-red-800);--color-error-900:var(--color-red-900);--color-error-950:var(--color-red-950);--color-info-50:var(--color-blue-50);--color-info-100:var(--color-blue-100);--color-info-200:var(--color-blue-200);--color-info-300:var(--color-blue-300);--color-info-400:var(--color-blue-400);--color-info-500:var(--color-blue-500);--color-info-600:var(--color-blue-600);--color-info-700:var(--color-blue-700);--color-info-800:var(--color-blue-800);--color-info-900:var(--color-blue-900);--color-info-950:var(--color-blue-950);--color-theme:var(--ui-neutral);--color-theme-50:var(--color-neutral-50);--color-theme-100:var(--color-neutral-100);--color-theme-200:var(--color-neutral-200);--color-theme-300:var(--color-neutral-300);--color-theme-400:var(--color-neutral-400);--color-theme-500:var(--color-neutral-500);--color-theme-600:var(--color-neutral-600);--color-theme-700:var(--color-neutral-700);--color-theme-800:var(--color-neutral-800);--color-theme-900:var(--color-neutral-900);--color-theme-950:var(--color-neutral-950)}}@layer base{*,:after,:before,::backdrop{box-sizing:border-box;border:0 solid;margin:0;padding:0}::file-selector-button{box-sizing:border-box;border:0 solid;margin:0;padding:0}html,:host{-webkit-text-size-adjust:100%;tab-size:4;line-height:1.5;font-family:var(--default-font-family,ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji");font-feature-settings:var(--default-font-feature-settings,normal);font-variation-settings:var(--default-font-variation-settings,normal);-webkit-tap-highlight-color:transparent}hr{height:0;color:inherit;border-top-width:1px}abbr:where([title]){-webkit-text-decoration:underline dotted;text-decoration:underline dotted}h1,h2,h3,h4,h5,h6{font-size:inherit;font-weight:inherit}a{color:inherit;-webkit-text-decoration:inherit;text-decoration:inherit}b,strong{font-weight:bolder}code,kbd,samp,pre{font-family:var(--default-mono-font-family,ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace);font-feature-settings:var(--default-mono-font-feature-settings,normal);font-variation-settings:var(--default-mono-font-variation-settings,normal);font-size:1em}small{font-size:80%}sub,sup{vertical-align:baseline;font-size:75%;line-height:0;position:relative}sub{bottom:-.25em}sup{top:-.5em}table{text-indent:0;border-color:inherit;border-collapse:collapse}:-moz-focusring{outline:auto}progress{vertical-align:baseline}summary{display:list-item}ol,ul,menu{list-style:none}img,svg,video,canvas,audio,iframe,embed,object{vertical-align:middle;display:block}img,video{max-width:100%;height:auto}button,input,select,optgroup,textarea{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}::file-selector-button{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}:where(select:is([multiple],[size])) optgroup{font-weight:bolder}:where(select:is([multiple],[size])) optgroup option{padding-inline-start:20px}::file-selector-button{margin-inline-end:4px}::placeholder{opacity:1}@supports (not ((-webkit-appearance:-apple-pay-button))) or (contain-intrinsic-size:1px){::placeholder{color:currentColor}@supports (color:color-mix(in lab,red,red)){::placeholder{color:color-mix(in oklab,currentcolor 50%,transparent)}}}textarea{resize:vertical}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-date-and-time-value{min-height:1lh;text-align:inherit}::-webkit-datetime-edit{display:inline-flex}::-webkit-datetime-edit-fields-wrapper{padding:0}::-webkit-datetime-edit{padding-block:0}::-webkit-datetime-edit-year-field{padding-block:0}::-webkit-datetime-edit-month-field{padding-block:0}::-webkit-datetime-edit-day-field{padding-block:0}::-webkit-datetime-edit-hour-field{padding-block:0}::-webkit-datetime-edit-minute-field{padding-block:0}::-webkit-datetime-edit-second-field{padding-block:0}::-webkit-datetime-edit-millisecond-field{padding-block:0}::-webkit-datetime-edit-meridiem-field{padding-block:0}::-webkit-calendar-picker-indicator{line-height:1}:-moz-ui-invalid{box-shadow:none}button,input:where([type=button],[type=reset],[type=submit]){appearance:button}::file-selector-button{appearance:button}::-webkit-inner-spin-button{height:auto}::-webkit-outer-spin-button{height:auto}[hidden]:where(:not([hidden=until-found])){display:none!important}}@layer components;@layer utilities{.\\@container{container-type:inline-size}.collapse{visibility:collapse}.absolute{position:absolute}.fixed{position:fixed}.relative{position:relative}.static{position:static}.-inset-1{inset:calc(var(--spacing)*-1)}.top-1\\/2{top:50%}.right-0{right:calc(var(--spacing)*0)}.bottom-0{bottom:calc(var(--spacing)*0)}.left-0{left:calc(var(--spacing)*0)}.left-2{left:calc(var(--spacing)*2)}.z-9999,.z-\\[9999\\]{z-index:9999}.container{width:100%}@media(min-width:40rem){.container{max-width:40rem}}@media(min-width:48rem){.container{max-width:48rem}}@media(min-width:64rem){.container{max-width:64rem}}@media(min-width:80rem){.container{max-width:80rem}}@media(min-width:96rem){.container{max-width:96rem}}.m-0{margin:calc(var(--spacing)*0)}.mx-auto{margin-inline:auto}.mt-1{margin-top:calc(var(--spacing)*1)}.mt-4{margin-top:calc(var(--spacing)*4)}.mr-2{margin-right:calc(var(--spacing)*2)}.mb-6{margin-bottom:calc(var(--spacing)*6)}.mb-8{margin-bottom:calc(var(--spacing)*8)}.mb-12{margin-bottom:calc(var(--spacing)*12)}.mb-\\[700px\\]{margin-bottom:700px}.ml-1{margin-left:calc(var(--spacing)*1)}.ml-5{margin-left:calc(var(--spacing)*5)}.block{display:block}.flex{display:flex}.grid{display:grid}.hidden{display:none}.inline{display:inline}.inline-block{display:inline-block}.inline-flex{display:inline-flex}.size-2{width:calc(var(--spacing)*2);height:calc(var(--spacing)*2)}.size-3{width:calc(var(--spacing)*3);height:calc(var(--spacing)*3)}.size-3\\.5{width:calc(var(--spacing)*3.5);height:calc(var(--spacing)*3.5)}.size-4{width:calc(var(--spacing)*4);height:calc(var(--spacing)*4)}.size-8{width:calc(var(--spacing)*8);height:calc(var(--spacing)*8)}.size-\\[1em\\]{width:1em;height:1em}.h-5{height:calc(var(--spacing)*5)}.h-40{height:calc(var(--spacing)*40)}.h-\\[8px\\]{height:8px}.h-full{height:100%}.max-h-\\[80\\%\\]{max-height:80%}.max-h-\\[1200px\\]{max-height:1200px}.min-h-\\[20vh\\]{min-height:20vh}.w-5{width:calc(var(--spacing)*5)}.w-6{width:calc(var(--spacing)*6)}.w-8{width:calc(var(--spacing)*8)}.w-40{width:calc(var(--spacing)*40)}.w-full{width:100%}.max-w-3xl{max-width:var(--container-3xl)}.max-w-md{max-width:var(--container-md)}.min-w-\\[1\\.65em\\]{min-width:1.65em}.flex-grow,.grow{flex-grow:1}.-translate-y-1\\/2{--tw-translate-y: -50% ;translate:var(--tw-translate-x)var(--tw-translate-y)}.rotate-90{rotate:90deg}.transform{transform:var(--tw-rotate-x,)var(--tw-rotate-y,)var(--tw-rotate-z,)var(--tw-skew-x,)var(--tw-skew-y,)}.animate-spin{animation:var(--animate-spin)}.cursor-col-resize{cursor:col-resize}.cursor-help{cursor:help}.cursor-pointer{cursor:pointer}.cursor-row-resize{cursor:row-resize}.touch-none{touch-action:none}.grid-flow-col{grid-auto-flow:column}.grid-cols-\\[auto_1fr\\]{grid-template-columns:auto 1fr}.grid-cols-\\[auto_auto_1fr\\]{grid-template-columns:auto auto 1fr}.grid-cols-\\[minmax\\(0\\,auto\\)_1fr\\]{grid-template-columns:minmax(0,auto) 1fr}.grid-rows-\\[auto_1fr\\]{grid-template-rows:auto 1fr}.flex-col{flex-direction:column}.flex-wrap{flex-wrap:wrap}.items-center{align-items:center}.justify-center{justify-content:center}.justify-end{justify-content:flex-end}.justify-items-start{justify-items:start}.gap-0\\.5{gap:calc(var(--spacing)*.5)}.gap-1{gap:calc(var(--spacing)*1)}.gap-1\\.5{gap:calc(var(--spacing)*1.5)}.gap-2{gap:calc(var(--spacing)*2)}.gap-4{gap:calc(var(--spacing)*4)}.gap-6{gap:calc(var(--spacing)*6)}:where(.space-y-1>:not(:last-child)){--tw-space-y-reverse:0;margin-block-start:calc(calc(var(--spacing)*1)*var(--tw-space-y-reverse));margin-block-end:calc(calc(var(--spacing)*1)*calc(1 - var(--tw-space-y-reverse)))}:where(.space-y-2>:not(:last-child)){--tw-space-y-reverse:0;margin-block-start:calc(calc(var(--spacing)*2)*var(--tw-space-y-reverse));margin-block-end:calc(calc(var(--spacing)*2)*calc(1 - var(--tw-space-y-reverse)))}:where(.space-y-6>:not(:last-child)){--tw-space-y-reverse:0;margin-block-start:calc(calc(var(--spacing)*6)*var(--tw-space-y-reverse));margin-block-end:calc(calc(var(--spacing)*6)*calc(1 - var(--tw-space-y-reverse)))}.gap-x-0\\.5{column-gap:calc(var(--spacing)*.5)}.gap-x-1{column-gap:calc(var(--spacing)*1)}.gap-x-2{column-gap:calc(var(--spacing)*2)}:where(.space-x-2>:not(:last-child)){--tw-space-x-reverse:0;margin-inline-start:calc(calc(var(--spacing)*2)*var(--tw-space-x-reverse));margin-inline-end:calc(calc(var(--spacing)*2)*calc(1 - var(--tw-space-x-reverse)))}:where(.divide-y>:not(:last-child)){--tw-divide-y-reverse:0;border-bottom-style:var(--tw-border-style);border-top-style:var(--tw-border-style);border-top-width:calc(1px*var(--tw-divide-y-reverse));border-bottom-width:calc(1px*calc(1 - var(--tw-divide-y-reverse)))}:where(.divide-\\(--ui-border\\)>:not(:last-child)){border-color:var(--ui-border)}:where(.divide-\\(--ui-border-accented\\)>:not(:last-child)){border-color:var(--ui-border-accented)}.overflow-auto{overflow:auto}.overflow-hidden{overflow:hidden}.rounded{border-radius:.25rem}.rounded-full{border-radius:3.40282e38px}.rounded-lg{border-radius:var(--radius-lg)}.rounded-md{border-radius:var(--radius-md)}.rounded-sm{border-radius:var(--radius-sm)}.rounded-xs{border-radius:var(--radius-xs)}.rounded-l{border-top-left-radius:.25rem;border-bottom-left-radius:.25rem}.rounded-tl{border-top-left-radius:.25rem}.border{border-style:var(--tw-border-style);border-width:1px}.border-t{border-top-style:var(--tw-border-style);border-top-width:1px}.border-b{border-bottom-style:var(--tw-border-style);border-bottom-width:1px}.border-b-2{border-bottom-style:var(--tw-border-style);border-bottom-width:2px}.border-\\(--ui-border\\){border-color:var(--ui-border)}.border-neutral-200{border-color:var(--color-neutral-200)}.border-theme{border-color:var(--color-theme)}.border-transparent{border-color:#0000}.bg-\\(--ui-bg-accented\\){background-color:var(--ui-bg-accented)}.bg-\\(--ui-bg-muted\\){background-color:var(--ui-bg-muted)}.bg-\\(--ui-border\\){background-color:var(--ui-border)}.bg-\\(--ui-text\\)\\/5{background-color:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){.bg-\\(--ui-text\\)\\/5{background-color:color-mix(in oklab,var(--ui-text)5%,transparent)}}.bg-\\(--ui-text\\)\\/8{background-color:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){.bg-\\(--ui-text\\)\\/8{background-color:color-mix(in oklab,var(--ui-text)8%,transparent)}}.bg-error-200{background-color:var(--color-error-200)}.bg-error-500{background-color:var(--color-error-500)}.bg-gray-200{background-color:var(--color-gray-200)}.bg-gray-400{background-color:var(--color-gray-400)}.bg-info-200{background-color:var(--color-info-200)}.bg-info-500{background-color:var(--color-info-500)}.bg-neutral-200{background-color:var(--color-neutral-200)}.bg-neutral-400{background-color:var(--color-neutral-400)}.bg-neutral-500\\/20{background-color:#6a728233}@supports (color:color-mix(in lab,red,red)){.bg-neutral-500\\/20{background-color:color-mix(in oklab,var(--color-neutral-500)20%,transparent)}}.bg-purple-200{background-color:var(--color-purple-200)}.bg-purple-400{background-color:var(--color-purple-400)}.bg-success-200{background-color:var(--color-success-200)}.bg-success-500{background-color:var(--color-success-500)}.bg-theme-400{background-color:var(--color-theme-400)}.bg-theme\\/70{background-color:var(--color-theme)}@supports (color:color-mix(in lab,red,red)){.bg-theme\\/70{background-color:color-mix(in oklab,var(--color-theme)70%,transparent)}}.bg-transparent{background-color:#0000}.bg-warning-200{background-color:var(--color-warning-200)}.bg-warning-500{background-color:var(--color-warning-500)}.p-0\\.5{padding:calc(var(--spacing)*.5)}.p-1{padding:calc(var(--spacing)*1)}.p-2{padding:calc(var(--spacing)*2)}.p-4{padding:calc(var(--spacing)*4)}.px-0\\.5{padding-inline:calc(var(--spacing)*.5)}.px-1{padding-inline:calc(var(--spacing)*1)}.px-1\\.5{padding-inline:calc(var(--spacing)*1.5)}.px-2{padding-inline:calc(var(--spacing)*2)}.px-3{padding-inline:calc(var(--spacing)*3)}.px-4{padding-inline:calc(var(--spacing)*4)}.px-6{padding-inline:calc(var(--spacing)*6)}.py-0\\.5{padding-block:calc(var(--spacing)*.5)}.py-1{padding-block:calc(var(--spacing)*1)}.py-1\\.5{padding-block:calc(var(--spacing)*1.5)}.py-2{padding-block:calc(var(--spacing)*2)}.py-6{padding-block:calc(var(--spacing)*6)}.pt-6{padding-top:calc(var(--spacing)*6)}.pr-1{padding-right:calc(var(--spacing)*1)}.pr-2{padding-right:calc(var(--spacing)*2)}.pl-8{padding-left:calc(var(--spacing)*8)}.text-center{text-align:center}.align-middle{vertical-align:middle}.font-mono{font-family:var(--font-mono)}.font-sans{font-family:var(--font-sans)}.text-lg{font-size:var(--text-lg);line-height:var(--tw-leading,var(--text-lg--line-height))}.text-sm{font-size:var(--text-sm);line-height:var(--tw-leading,var(--text-sm--line-height))}.text-xl{font-size:var(--text-xl);line-height:var(--tw-leading,var(--text-xl--line-height))}.text-xs{font-size:var(--text-xs);line-height:var(--tw-leading,var(--text-xs--line-height))}.leading-6{--tw-leading:calc(var(--spacing)*6);line-height:calc(var(--spacing)*6)}.leading-snug{--tw-leading:var(--leading-snug);line-height:var(--leading-snug)}.font-bold{--tw-font-weight:var(--font-weight-bold);font-weight:var(--font-weight-bold)}.font-medium{--tw-font-weight:var(--font-weight-medium);font-weight:var(--font-weight-medium)}.font-semibold{--tw-font-weight:var(--font-weight-semibold);font-weight:var(--font-weight-semibold)}.text-wrap{text-wrap:wrap}.wrap-break-word{overflow-wrap:break-word}.text-\\(--devtools-syntax-gray\\){color:var(--devtools-syntax-gray)}.text-\\(--devtools-syntax-green\\){color:var(--devtools-syntax-green)}.text-\\(--devtools-syntax-orange\\){color:var(--devtools-syntax-orange)}.text-\\(--devtools-syntax-purple\\){color:var(--devtools-syntax-purple)}.text-\\(--devtools-syntax-red\\){color:var(--devtools-syntax-red)}.text-\\(--devtools-syntax-sapphire\\){color:var(--devtools-syntax-sapphire)}.text-\\(--ui-text\\),.text-\\(--ui-text\\)\\/50{color:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){.text-\\(--ui-text\\)\\/50{color:color-mix(in oklab,var(--ui-text)50%,transparent)}}.text-\\(--ui-text-dimmed\\){color:var(--ui-text-dimmed)}.text-\\(--ui-text-muted\\),.text-\\(--ui-text-muted\\)\\/50{color:var(--ui-text-muted)}@supports (color:color-mix(in lab,red,red)){.text-\\(--ui-text-muted\\)\\/50{color:color-mix(in oklab,var(--ui-text-muted)50%,transparent)}}.text-error-100{color:var(--color-error-100)}.text-gray-100{color:var(--color-gray-100)}.text-gray-900{color:var(--color-gray-900)}.text-info-100{color:var(--color-info-100)}.text-neutral-100{color:var(--color-neutral-100)}.text-neutral-400{color:var(--color-neutral-400)}.text-neutral-500{color:var(--color-neutral-500)}.text-neutral-500\\/50{color:#6a728280}@supports (color:color-mix(in lab,red,red)){.text-neutral-500\\/50{color:color-mix(in oklab,var(--color-neutral-500)50%,transparent)}}.text-purple-100{color:var(--color-purple-100)}.text-success-100{color:var(--color-success-100)}.text-warning-100{color:var(--color-warning-100)}.italic{font-style:italic}.shadow{--tw-shadow:0 1px 3px 0 var(--tw-shadow-color,#0000001a),0 1px 2px -1px var(--tw-shadow-color,#0000001a);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}.ring-\\(--ui-bg-muted\\){--tw-ring-color:var(--ui-bg-muted)}.outline{outline-style:var(--tw-outline-style);outline-width:1px}.filter{filter:var(--tw-blur,)var(--tw-brightness,)var(--tw-contrast,)var(--tw-grayscale,)var(--tw-hue-rotate,)var(--tw-invert,)var(--tw-saturate,)var(--tw-sepia,)var(--tw-drop-shadow,)}.transition{transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to,opacity,box-shadow,transform,translate,scale,rotate,filter,-webkit-backdrop-filter,backdrop-filter,display,content-visibility,overlay,pointer-events;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-\\[background-color\\]{transition-property:background-color;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-colors{transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-transform{transition-property:transform,translate,scale,rotate;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.duration-200{--tw-duration:.2s;transition-duration:.2s}.select-none{-webkit-user-select:none;user-select:none}@media(hover:hover){.group-hover\\:flex:is(:where(.group):hover *){display:flex}.group-hover\\:inline-flex:is(:where(.group):hover *){display:inline-flex}.hover\\:cursor-pointer:hover{cursor:pointer}.hover\\:border-theme-300:hover{border-color:var(--color-theme-300)}.hover\\:bg-\\(--ui-bg-elevated\\):hover{background-color:var(--ui-bg-elevated)}.hover\\:bg-\\(--ui-bg-muted\\):hover{background-color:var(--ui-bg-muted)}.hover\\:bg-\\(--ui-border\\):hover{background-color:var(--ui-border)}.hover\\:bg-theme-400:hover{background-color:var(--color-theme-400)}.hover\\:bg-theme-600:hover{background-color:var(--color-theme-600)}.hover\\:text-\\(--ui-text\\):hover{color:var(--ui-text)}.hover\\:ring:hover{--tw-ring-shadow:var(--tw-ring-inset,)0 0 0 calc(1px + var(--tw-ring-offset-width))var(--tw-ring-color,currentcolor);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}}.focus\\:ring-1:focus{--tw-ring-shadow:var(--tw-ring-inset,)0 0 0 calc(1px + var(--tw-ring-offset-width))var(--tw-ring-color,currentcolor);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}.focus\\:ring-theme:focus{--tw-ring-color:var(--color-theme)}.focus\\:outline-none:focus{--tw-outline-style:none;outline-style:none}.focus-visible\\:outline-2:focus-visible{outline-style:var(--tw-outline-style);outline-width:2px}.focus-visible\\:outline-offset-2:focus-visible{outline-offset:2px}.focus-visible\\:outline-theme:focus-visible{outline-color:var(--color-theme)}.disabled\\:cursor-not-allowed:disabled{cursor:not-allowed}.disabled\\:text-gray-700:disabled{color:var(--color-gray-700)}@media(min-width:48rem){.md\\:flex{display:flex}.md\\:pt-0{padding-top:calc(var(--spacing)*0)}}@container not (min-width:750px){.\\@max-\\[750px\\]\\:hidden{display:none}}@container not (min-width:28rem){.\\@max-md\\:hidden{display:none}}@media(prefers-color-scheme:dark){:where(.dark\\:divide-\\(--ui-border\\)>:not(:last-child)){border-color:var(--ui-border)}.dark\\:border-neutral-800{border-color:var(--color-neutral-800)}.dark\\:bg-neutral-700{background-color:var(--color-neutral-700)}.dark\\:bg-neutral-800{background-color:var(--color-neutral-800)}.dark\\:bg-theme-400{background-color:var(--color-theme-400)}.dark\\:text-neutral-500{color:var(--color-neutral-500)}@media(hover:hover){.dark\\:hover\\:bg-theme-300:hover{background-color:var(--color-theme-300)}}}}:host{color-scheme:light dark;--ui-radius:var(--radius-sm);--ui-primary:light-dark(var(--color-secondary-500),var(--color-primary-400));--ui-secondary:light-dark(var(--color-secondary-500),var(--color-secondary-400));--ui-success:light-dark(var(--color-success-500),var(--color-success-400));--ui-info:light-dark(var(--color-info-500),var(--color-info-400));--ui-warning:light-dark(var(--color-warning-500),var(--color-warning-400));--ui-error:light-dark(var(--color-error-500),var(--color-error-400));--ui-neutral:light-dark(var(--color-neutral-500),var(--color-neutral-400));--ui-text-dimmed:light-dark(var(--color-gray-400),var(--color-gray-500));--ui-text-muted:light-dark(var(--color-gray-500),var(--color-gray-400));--ui-text-toned:light-dark(var(--color-gray-600),var(--color-gray-300));--ui-text:light-dark(var(--color-gray-900),var(--color-gray-50));--ui-text-inverted:light-dark(var(--color-gray-50),var(--color-gray-900));--ui-bg:light-dark(var(--color-white),var(--color-gray-900));--ui-bg-muted:light-dark(var(--color-gray-50),var(--color-gray-800));--ui-bg-elevated:light-dark(var(--color-gray-100),var(--color-gray-700));--ui-bg-accented:light-dark(var(--color-gray-200),var(--color-gray-600));--ui-bg-inverted:light-dark(var(--color-gray-900),var(--color-white));--ui-border:var(--ui-text);font-family:sans-serif}@supports (color:color-mix(in lab,red,red)){:host{--ui-border:color-mix(in hsl,var(--ui-text)20%,transparent)}}:host{--ui-border-muted:var(--ui-text-muted)}@supports (color:color-mix(in lab,red,red)){:host{--ui-border-muted:color-mix(in hsl,var(--ui-text-muted)10%,transparent)}}:host{--ui-border-accented:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){:host{--ui-border-accented:color-mix(in hsl,var(--ui-text)35%,transparent)}}:host{--ui-border-inverted:var(--ui-text-inverted)}@supports (color:color-mix(in lab,red,red)){:host{--ui-border-inverted:color-mix(in hsl,var(--ui-text-inverted)50%,transparent)}}:host{--devtools-syntax-orange:light-dark(#fe640b,#fab387);--devtools-syntax-purple:light-dark(#8839ef,#cba6f7);--devtools-syntax-gray:light-dark(#4c4f69,#cdd6f4);--devtools-syntax-green:light-dark(#40a02b,#a6e3a1);--devtools-syntax-red:light-dark(#d20f39,#f38ba8);--devtools-syntax-yellow:light-dark(#df8e1d,#f9e2af);--devtools-syntax-sapphire:light-dark(#209fb5,#74c7ec)}@media(prefers-color-scheme:dark){:host{--color-primary-50:var(--color-yellow-50);--color-primary-100:var(--color-yellow-100);--color-primary-200:var(--color-yellow-200);--color-primary-300:var(--color-yellow-300);--color-primary-400:var(--color-yellow-400);--color-primary-500:var(--color-yellow-500);--color-primary-600:var(--color-yellow-600);--color-primary-700:var(--color-yellow-700);--color-primary-800:var(--color-yellow-800);--color-primary-900:var(--color-yellow-900);--color-primary-950:var(--color-yellow-950);--color-secondary-50:var(--color-lime-50);--color-secondary-100:var(--color-lime-100);--color-secondary-200:var(--color-lime-200);--color-secondary-300:var(--color-lime-300);--color-secondary-400:var(--color-lime-400);--color-secondary-500:var(--color-lime-500);--color-secondary-600:var(--color-lime-600);--color-secondary-700:var(--color-lime-700);--color-secondary-800:var(--color-lime-800);--color-secondary-900:var(--color-lime-900);--color-secondary-950:var(--color-lime-950)}}:host:has(.dark){color-scheme:dark}:host:has(.light){color-scheme:light}#root{color:var(--ui-text);background-color:var(--ui-bg);-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}#root *{scrollbar-width:thin}[class~=bg-theme]{color:var(--ui-text);--ui-text:var(--ui-text-inverted)}@media(hover:hover){[class*=bg-theme][class*="hover:"]:hover{color:var(--ui-text);--ui-text:var(--ui-text-inverted)}}.theme-primary{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-secondary);--color-theme-50:var(--color-secondary-50);--color-theme-100:var(--color-secondary-100);--color-theme-200:var(--color-secondary-200);--color-theme-300:var(--color-secondary-300);--color-theme-400:var(--color-secondary-400);--color-theme-500:var(--color-secondary-500);--color-theme-600:var(--color-secondary-600);--color-theme-700:var(--color-secondary-700);--color-theme-800:var(--color-secondary-800);--color-theme-900:var(--color-secondary-900);--color-theme-950:var(--color-secondary-950)}@media(prefers-color-scheme:dark){.theme-primary{--color-theme:var(--ui-primary);--color-theme-50:var(--color-primary-50);--color-theme-100:var(--color-primary-100);--color-theme-200:var(--color-primary-200);--color-theme-300:var(--color-primary-300);--color-theme-400:var(--color-primary-400);--color-theme-500:var(--color-primary-500);--color-theme-600:var(--color-primary-600);--color-theme-700:var(--color-primary-700);--color-theme-800:var(--color-primary-800);--color-theme-900:var(--color-primary-900);--color-theme-950:var(--color-primary-950)}}.theme-secondary{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-secondary);--color-theme-50:var(--color-secondary-50);--color-theme-100:var(--color-secondary-100);--color-theme-200:var(--color-secondary-200);--color-theme-300:var(--color-secondary-300);--color-theme-400:var(--color-secondary-400);--color-theme-500:var(--color-secondary-500);--color-theme-600:var(--color-secondary-600);--color-theme-700:var(--color-secondary-700);--color-theme-800:var(--color-secondary-800);--color-theme-900:var(--color-secondary-900);--color-theme-950:var(--color-secondary-950)}.theme-success{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-success);--color-theme-50:var(--color-success-50);--color-theme-100:var(--color-success-100);--color-theme-200:var(--color-success-200);--color-theme-300:var(--color-success-300);--color-theme-400:var(--color-success-400);--color-theme-500:var(--color-success-500);--color-theme-600:var(--color-success-600);--color-theme-700:var(--color-success-700);--color-theme-800:var(--color-success-800);--color-theme-900:var(--color-success-900);--color-theme-950:var(--color-success-950)}.theme-info{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-info);--color-theme-50:var(--color-info-50);--color-theme-100:var(--color-info-100);--color-theme-200:var(--color-info-200);--color-theme-300:var(--color-info-300);--color-theme-400:var(--color-info-400);--color-theme-500:var(--color-info-500);--color-theme-600:var(--color-info-600);--color-theme-700:var(--color-info-700);--color-theme-800:var(--color-info-800);--color-theme-900:var(--color-info-900);--color-theme-950:var(--color-info-950)}.theme-warning{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-warning);--color-theme-50:var(--color-warning-50);--color-theme-100:var(--color-warning-100);--color-theme-200:var(--color-warning-200);--color-theme-300:var(--color-warning-300);--color-theme-400:var(--color-warning-400);--color-theme-500:var(--color-warning-500);--color-theme-600:var(--color-warning-600);--color-theme-700:var(--color-warning-700);--color-theme-800:var(--color-warning-800);--color-theme-900:var(--color-warning-900);--color-theme-950:var(--color-warning-950)}.theme-error{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-error);--color-theme-50:var(--color-error-50);--color-theme-100:var(--color-error-100);--color-theme-200:var(--color-error-200);--color-theme-300:var(--color-error-300);--color-theme-400:var(--color-error-400);--color-theme-500:var(--color-error-500);--color-theme-600:var(--color-error-600);--color-theme-700:var(--color-error-700);--color-theme-800:var(--color-error-800);--color-theme-900:var(--color-error-900);--color-theme-950:var(--color-error-950)}.theme-neutral{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-neutral);--color-theme-50:var(--color-neutral-50);--color-theme-100:var(--color-neutral-100);--color-theme-200:var(--color-neutral-200);--color-theme-300:var(--color-neutral-300);--color-theme-400:var(--color-neutral-400);--color-theme-500:var(--color-neutral-500);--color-theme-600:var(--color-neutral-600);--color-theme-700:var(--color-neutral-700);--color-theme-800:var(--color-neutral-800);--color-theme-900:var(--color-neutral-900);--color-theme-950:var(--color-neutral-950)}.theme-purple{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--color-purple-400);--color-theme-50:var(--color-purple-50);--color-theme-100:var(--color-purple-100);--color-theme-200:var(--color-purple-200);--color-theme-300:var(--color-purple-300);--color-theme-400:var(--color-purple-400);--color-theme-500:var(--color-purple-500);--color-theme-600:var(--color-purple-600);--color-theme-700:var(--color-purple-700);--color-theme-800:var(--color-purple-800);--color-theme-900:var(--color-purple-900);--color-theme-950:var(--color-purple-950)}.variant-ghost.variant-ghost{--ui-text:var(--color-theme);color:var(--color-theme);background-color:#0000}.variant-ghost.variant-ghost:hover{color:var(--color-theme);background-color:var(--ui-bg)}@supports (color:color-mix(in lab,red,red)){.variant-ghost.variant-ghost:hover{background-color:color-mix(in hsl,var(--ui-bg)10%,transparent)}}@property --progress-value{syntax:"<number>";inherits:false;initial-value:0}@property --tw-translate-x{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-y{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-z{syntax:"*";inherits:false;initial-value:0}@property --tw-rotate-x{syntax:"*";inherits:false}@property --tw-rotate-y{syntax:"*";inherits:false}@property --tw-rotate-z{syntax:"*";inherits:false}@property --tw-skew-x{syntax:"*";inherits:false}@property --tw-skew-y{syntax:"*";inherits:false}@property --tw-space-y-reverse{syntax:"*";inherits:false;initial-value:0}@property --tw-space-x-reverse{syntax:"*";inherits:false;initial-value:0}@property --tw-divide-y-reverse{syntax:"*";inherits:false;initial-value:0}@property --tw-border-style{syntax:"*";inherits:false;initial-value:solid}@property --tw-leading{syntax:"*";inherits:false}@property --tw-font-weight{syntax:"*";inherits:false}@property --tw-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-shadow-color{syntax:"*";inherits:false}@property --tw-shadow-alpha{syntax:"<percentage>";inherits:false;initial-value:100%}@property --tw-inset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-shadow-color{syntax:"*";inherits:false}@property --tw-inset-shadow-alpha{syntax:"<percentage>";inherits:false;initial-value:100%}@property --tw-ring-color{syntax:"*";inherits:false}@property --tw-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-ring-color{syntax:"*";inherits:false}@property --tw-inset-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-ring-inset{syntax:"*";inherits:false}@property --tw-ring-offset-width{syntax:"<length>";inherits:false;initial-value:0}@property --tw-ring-offset-color{syntax:"*";inherits:false;initial-value:#fff}@property --tw-ring-offset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-outline-style{syntax:"*";inherits:false;initial-value:solid}@property --tw-blur{syntax:"*";inherits:false}@property --tw-brightness{syntax:"*";inherits:false}@property --tw-contrast{syntax:"*";inherits:false}@property --tw-grayscale{syntax:"*";inherits:false}@property --tw-hue-rotate{syntax:"*";inherits:false}@property --tw-invert{syntax:"*";inherits:false}@property --tw-opacity{syntax:"*";inherits:false}@property --tw-saturate{syntax:"*";inherits:false}@property --tw-sepia{syntax:"*";inherits:false}@property --tw-drop-shadow{syntax:"*";inherits:false}@property --tw-drop-shadow-color{syntax:"*";inherits:false}@property --tw-drop-shadow-alpha{syntax:"<percentage>";inherits:false;initial-value:100%}@property --tw-drop-shadow-size{syntax:"*";inherits:false}@property --tw-duration{syntax:"*";inherits:false}@keyframes spin{to{transform:rotate(360deg)}}', bu = (e, t) => {
   const r = e.__vccOpts || e;
   for (const [o, n] of t)
     r[o] = n;
   return r;
-}, bu = /* @__PURE__ */ yu(mu, [["styles", [vu]]]);
+}, wu = /* @__PURE__ */ bu(vu, [["styles", [yu]]]);
 const Lt = typeof document < "u";
 function js(e) {
   return typeof e == "object" || "displayName" in e || "props" in e || "__vccOpts" in e;
 }
-function wu(e) {
+function _u(e) {
   return e.__esModule || e[Symbol.toStringTag] === "Module" || e.default && js(e.default);
 }
-const re = Object.assign;
+const oe = Object.assign;
 function Ao(e, t) {
   const r = {};
   for (const o in t) {
@@ -5238,24 +5264,24 @@ function Jn(e, t) {
   for (const o in e) r[o] = o in t ? t[o] : e[o];
   return r;
 }
-const Ls = /#/g, _u = /&/g, xu = /\//g, ku = /=/g, Eu = /\?/g, Hs = /\+/g, Su = /%5B/g, Au = /%5D/g, zs = /%5E/g, Ru = /%60/g, Bs = /%7B/g, Cu = /%7C/g, Us = /%7D/g, Tu = /%20/g;
+const Ls = /#/g, xu = /&/g, ku = /\//g, Eu = /=/g, Su = /\?/g, Hs = /\+/g, Au = /%5B/g, Ru = /%5D/g, zs = /%5E/g, Cu = /%60/g, Bs = /%7B/g, Tu = /%7C/g, Us = /%7D/g, Ou = /%20/g;
 function ln(e) {
-  return e == null ? "" : encodeURI("" + e).replace(Cu, "|").replace(Su, "[").replace(Au, "]");
+  return e == null ? "" : encodeURI("" + e).replace(Tu, "|").replace(Au, "[").replace(Ru, "]");
 }
 function Pu(e) {
   return ln(e).replace(Bs, "{").replace(Us, "}").replace(zs, "^");
 }
 function Bo(e) {
-  return ln(e).replace(Hs, "%2B").replace(Tu, "+").replace(Ls, "%23").replace(_u, "%26").replace(Ru, "`").replace(Bs, "{").replace(Us, "}").replace(zs, "^");
-}
-function Ou(e) {
-  return Bo(e).replace(ku, "%3D");
+  return ln(e).replace(Hs, "%2B").replace(Ou, "+").replace(Ls, "%23").replace(xu, "%26").replace(Cu, "`").replace(Bs, "{").replace(Us, "}").replace(zs, "^");
 }
 function Iu(e) {
-  return ln(e).replace(Ls, "%23").replace(Eu, "%3F");
+  return Bo(e).replace(Eu, "%3D");
 }
 function Nu(e) {
-  return Iu(e).replace(xu, "%2F");
+  return ln(e).replace(Ls, "%23").replace(Su, "%3F");
+}
+function Mu(e) {
+  return Nu(e).replace(ku, "%2F");
 }
 function yr(e) {
   if (e == null) return null;
@@ -5265,23 +5291,23 @@ function yr(e) {
   }
   return "" + e;
 }
-const Mu = /\/$/, Du = (e) => e.replace(Mu, "");
+const Du = /\/$/, Fu = (e) => e.replace(Du, "");
 function Ro(e, t, r = "/") {
   let o, n = {}, i = "", s = "";
   const l = t.indexOf("#");
   let a = t.indexOf("?");
-  return a = l >= 0 && a > l ? -1 : a, a >= 0 && (o = t.slice(0, a), i = t.slice(a, l > 0 ? l : t.length), n = e(i.slice(1))), l >= 0 && (o = o || t.slice(0, l), s = t.slice(l, t.length)), o = Lu(o ?? t, r), {
+  return a = l >= 0 && a > l ? -1 : a, a >= 0 && (o = t.slice(0, a), i = t.slice(a, l > 0 ? l : t.length), n = e(i.slice(1))), l >= 0 && (o = o || t.slice(0, l), s = t.slice(l, t.length)), o = Hu(o ?? t, r), {
     fullPath: o + i + s,
     path: o,
     query: n,
     hash: yr(s)
   };
 }
-function Fu(e, t) {
+function Vu(e, t) {
   const r = t.query ? e(t.query) : "";
   return t.path + (r && "?") + r + (t.hash || "");
 }
-function Vu(e, t, r) {
+function ju(e, t, r) {
   const o = t.matched.length - 1, n = r.matched.length - 1;
   return o > -1 && o === n && Jt(t.matched[o], r.matched[n]) && Ks(t.params, r.params) && e(t.query) === e(r.query) && t.hash === r.hash;
 }
@@ -5290,16 +5316,16 @@ function Jt(e, t) {
 }
 function Ks(e, t) {
   if (Object.keys(e).length !== Object.keys(t).length) return !1;
-  for (const r in e) if (!ju(e[r], t[r])) return !1;
+  for (var r in e) if (!Lu(e[r], t[r])) return !1;
   return !0;
 }
-function ju(e, t) {
-  return Ge(e) ? Yn(e, t) : Ge(t) ? Yn(t, e) : e === t;
+function Lu(e, t) {
+  return Ge(e) ? Yn(e, t) : Ge(t) ? Yn(t, e) : e?.valueOf() === t?.valueOf();
 }
 function Yn(e, t) {
   return Ge(t) ? e.length === t.length && e.every((r, o) => r === t[o]) : e.length === 1 && e[0] === t;
 }
-function Lu(e, t) {
+function Hu(e, t) {
   if (e.startsWith("/")) return e;
   if (!e) return t;
   const r = t.split("/"), o = e.split("/"), n = o[o.length - 1];
@@ -5329,18 +5355,18 @@ let Uo = /* @__PURE__ */ (function(e) {
   return e.back = "back", e.forward = "forward", e.unknown = "", e;
 })({});
 const Co = "";
-function Hu(e) {
+function zu(e) {
   if (!e) if (Lt) {
     const t = document.querySelector("base");
     e = t && t.getAttribute("href") || "/", e = e.replace(/^\w+:\/\/[^\/]+/, "");
   } else e = "/";
-  return e[0] !== "/" && e[0] !== "#" && (e = "/" + e), Du(e);
-}
-const zu = /^[^#]+#/;
-function Bu(e, t) {
-  return e.replace(zu, "#") + t;
+  return e[0] !== "/" && e[0] !== "#" && (e = "/" + e), Fu(e);
 }
+const Bu = /^[^#]+#/;
 function Uu(e, t) {
+  return e.replace(Bu, "#") + t;
+}
+function Ku(e, t) {
   const r = document.documentElement.getBoundingClientRect(), o = e.getBoundingClientRect();
   return {
     behavior: t.behavior,
@@ -5348,17 +5374,17 @@ function Uu(e, t) {
     top: o.top - r.top - (t.top || 0)
   };
 }
-const Ku = () => ({
+const $u = () => ({
   left: window.scrollX,
   top: window.scrollY
 });
-function $u(e) {
+function Wu(e) {
   let t;
   if ("el" in e) {
     const r = e.el, o = typeof r == "string" && r.startsWith("#"), n = typeof r == "string" ? o ? document.getElementById(r.slice(1)) : document.querySelector(r) : r;
     if (!n)
       return;
-    t = Uu(n, e);
+    t = Ku(n, e);
   } else t = e;
   "scrollBehavior" in document.documentElement.style ? window.scrollTo(t) : window.scrollTo(t.left != null ? t.left : window.scrollX, t.top != null ? t.top : window.scrollY);
 }
@@ -5366,14 +5392,14 @@ function Xn(e, t) {
   return (history.state ? history.state.position - t : -1) + e;
 }
 const Ko = /* @__PURE__ */ new Map();
-function Wu(e, t) {
+function Gu(e, t) {
   Ko.set(e, t);
 }
-function Gu(e) {
+function qu(e) {
   const t = Ko.get(e);
   return Ko.delete(e), t;
 }
-function qu(e) {
+function Ju(e) {
   return typeof e == "string" || e && typeof e == "object";
 }
 function $s(e) {
@@ -5382,10 +5408,10 @@ function $s(e) {
 let se = /* @__PURE__ */ (function(e) {
   return e[e.MATCHER_NOT_FOUND = 1] = "MATCHER_NOT_FOUND", e[e.NAVIGATION_GUARD_REDIRECT = 2] = "NAVIGATION_GUARD_REDIRECT", e[e.NAVIGATION_ABORTED = 4] = "NAVIGATION_ABORTED", e[e.NAVIGATION_CANCELLED = 8] = "NAVIGATION_CANCELLED", e[e.NAVIGATION_DUPLICATED = 16] = "NAVIGATION_DUPLICATED", e;
 })({});
-const Ws = Symbol("");
+const Ws = /* @__PURE__ */ Symbol("");
 se.MATCHER_NOT_FOUND + "", se.NAVIGATION_GUARD_REDIRECT + "", se.NAVIGATION_ABORTED + "", se.NAVIGATION_CANCELLED + "", se.NAVIGATION_DUPLICATED + "";
 function Yt(e, t) {
-  return re(/* @__PURE__ */ new Error(), {
+  return oe(/* @__PURE__ */ new Error(), {
     type: e,
     [Ws]: !0
   }, t);
@@ -5393,19 +5419,19 @@ function Yt(e, t) {
 function nt(e, t) {
   return e instanceof Error && Ws in e && (t == null || !!(e.type & t));
 }
-const Ju = [
+const Yu = [
   "params",
   "query",
   "hash"
 ];
-function Yu(e) {
+function Qu(e) {
   if (typeof e == "string") return e;
   if (e.path != null) return e.path;
   const t = {};
-  for (const r of Ju) r in e && (t[r] = e[r]);
+  for (const r of Yu) r in e && (t[r] = e[r]);
   return JSON.stringify(t, null, 2);
 }
-function Qu(e) {
+function Xu(e) {
   const t = {};
   if (e === "" || e === "?") return t;
   const r = (e[0] === "?" ? e.slice(1) : e).split("&");
@@ -5422,7 +5448,7 @@ function Zn(e) {
   let t = "";
   for (let r in e) {
     const o = e[r];
-    if (r = Ou(r), o == null) {
+    if (r = Iu(r), o == null) {
       o !== void 0 && (t += (t.length ? "&" : "") + r);
       continue;
     }
@@ -5432,7 +5458,7 @@ function Zn(e) {
   }
   return t;
 }
-function Xu(e) {
+function Zu(e) {
   const t = {};
   for (const r in e) {
     const o = e[r];
@@ -5440,7 +5466,7 @@ function Xu(e) {
   }
   return t;
 }
-const Zu = Symbol(""), ei = Symbol(""), po = Symbol(""), an = Symbol(""), $o = Symbol("");
+const ef = /* @__PURE__ */ Symbol(""), ei = /* @__PURE__ */ Symbol(""), po = /* @__PURE__ */ Symbol(""), an = /* @__PURE__ */ Symbol(""), $o = /* @__PURE__ */ Symbol("");
 function tr() {
   let e = [];
   function t(o) {
@@ -5465,7 +5491,7 @@ function _t(e, t, r, o, n, i = (s) => s()) {
       m === !1 ? a(Yt(se.NAVIGATION_ABORTED, {
         from: r,
         to: t
-      })) : m instanceof Error ? a(m) : qu(m) ? a(Yt(se.NAVIGATION_GUARD_REDIRECT, {
+      })) : m instanceof Error ? a(m) : Ju(m) ? a(Yt(se.NAVIGATION_GUARD_REDIRECT, {
         from: t,
         to: m
       })) : (s && o.enterCallbacks[n] === s && typeof m == "function" && s.push(m), l());
@@ -5487,7 +5513,7 @@ function To(e, t, r, o, n = (i) => i()) {
           let f = a();
           i.push(() => f.then((c) => {
             if (!c) throw new Error(`Couldn't resolve component "${l}" at "${s.path}"`);
-            const d = wu(c) ? c.default : c;
+            const d = _u(c) ? c.default : c;
             s.mods[l] = c, s.components[l] = d;
             const m = (d.__vccOpts || d)[t];
             return m && _t(m, r, o, s, l, n)();
@@ -5496,7 +5522,7 @@ function To(e, t, r, o, n = (i) => i()) {
     }
   return i;
 }
-function ef(e, t) {
+function tf(e, t) {
   const r = [], o = [], n = [], i = Math.max(t.matched.length, e.matched.length);
   for (let s = 0; s < i; s++) {
     const l = t.matched[s];
@@ -5510,9 +5536,9 @@ function ef(e, t) {
     n
   ];
 }
-function tf(e = "") {
+function rf(e = "") {
   let t = [], r = [[Co, {}]], o = 0;
-  e = Hu(e);
+  e = zu(e);
   function n(l, a = {}) {
     o++, o !== r.length && r.splice(o), r.push([l, a]);
   }
@@ -5528,7 +5554,7 @@ function tf(e = "") {
     location: Co,
     state: {},
     base: e,
-    createHref: Bu.bind(null, e),
+    createHref: Uu.bind(null, e),
     replace(l, a) {
       r.splice(o--, 1), n(l, a);
     },
@@ -5566,13 +5592,13 @@ let Ct = /* @__PURE__ */ (function(e) {
 var de = /* @__PURE__ */ (function(e) {
   return e[e.Static = 0] = "Static", e[e.Param = 1] = "Param", e[e.ParamRegExp = 2] = "ParamRegExp", e[e.ParamRegExpEnd = 3] = "ParamRegExpEnd", e[e.EscapeNext = 4] = "EscapeNext", e;
 })(de || {});
-const rf = {
+const of = {
   type: Ct.Static,
   value: ""
-}, of = /[a-zA-Z0-9_]/;
-function nf(e) {
+}, nf = /[a-zA-Z0-9_]/;
+function sf(e) {
   if (!e) return [[]];
-  if (e === "/") return [[rf]];
+  if (e === "/") return [[of]];
   if (!e.startsWith("/")) throw new Error(`Invalid path "${e}"`);
   function t(g) {
     throw new Error(`ERR (${r})/"${f}": ${g}`);
@@ -5612,7 +5638,7 @@ function nf(e) {
         m(), r = o;
         break;
       case de.Param:
-        a === "(" ? r = de.ParamRegExp : of.test(a) ? m() : (d(), r = de.Static, a !== "*" && a !== "?" && a !== "+" && l--);
+        a === "(" ? r = de.ParamRegExp : nf.test(a) ? m() : (d(), r = de.Static, a !== "*" && a !== "?" && a !== "+" && l--);
         break;
       case de.ParamRegExp:
         a === ")" ? c[c.length - 1] == "\\" ? c = c.slice(0, -1) + a : r = de.ParamRegExpEnd : c += a;
@@ -5627,7 +5653,7 @@ function nf(e) {
   }
   return r === de.ParamRegExp && t(`Unfinished custom RegExp for param "${f}"`), d(), s(), n;
 }
-const ti = "[^/]+?", sf = {
+const ti = "[^/]+?", lf = {
   sensitive: !1,
   strict: !1,
   start: !0,
@@ -5636,9 +5662,9 @@ const ti = "[^/]+?", sf = {
 var Ee = /* @__PURE__ */ (function(e) {
   return e[e._multiplier = 10] = "_multiplier", e[e.Root = 90] = "Root", e[e.Segment = 40] = "Segment", e[e.SubSegment = 30] = "SubSegment", e[e.Static = 40] = "Static", e[e.Dynamic = 20] = "Dynamic", e[e.BonusCustomRegExp = 10] = "BonusCustomRegExp", e[e.BonusWildcard = -50] = "BonusWildcard", e[e.BonusRepeatable = -20] = "BonusRepeatable", e[e.BonusOptional = -8] = "BonusOptional", e[e.BonusStrict = 0.7000000000000001] = "BonusStrict", e[e.BonusCaseSensitive = 0.25] = "BonusCaseSensitive", e;
 })(Ee || {});
-const lf = /[.+*?^${}()[\]/\\]/g;
-function af(e, t) {
-  const r = re({}, sf, t), o = [];
+const af = /[.+*?^${}()[\]/\\]/g;
+function cf(e, t) {
+  const r = oe({}, lf, t), o = [];
   let n = r.start ? "^" : "";
   const i = [];
   for (const f of e) {
@@ -5648,7 +5674,7 @@ function af(e, t) {
       const m = f[d];
       let g = Ee.Segment + (r.sensitive ? Ee.BonusCaseSensitive : 0);
       if (m.type === Ct.Static)
-        d || (n += "/"), n += m.value.replace(lf, "\\$&"), g += Ee.Static;
+        d || (n += "/"), n += m.value.replace(af, "\\$&"), g += Ee.Static;
       else if (m.type === Ct.Param) {
         const { value: k, repeatable: x, optional: M, regexp: S } = m;
         i.push({
@@ -5656,17 +5682,17 @@ function af(e, t) {
           repeatable: x,
           optional: M
         });
-        const P = S || ti;
-        if (P !== ti) {
+        const O = S || ti;
+        if (O !== ti) {
           g += Ee.BonusCustomRegExp;
           try {
-            `${P}`;
+            `${O}`;
           } catch (R) {
-            throw new Error(`Invalid custom RegExp for param "${k}" (${P}): ` + R.message);
+            throw new Error(`Invalid custom RegExp for param "${k}" (${O}): ` + R.message);
           }
         }
-        let I = x ? `((?:${P})(?:/(?:${P}))*)` : `(${P})`;
-        d || (I = M && f.length < 2 ? `(?:/${I})` : "/" + I), M && (I += "?"), n += I, g += Ee.Dynamic, M && (g += Ee.BonusOptional), x && (g += Ee.BonusRepeatable), P === ".*" && (g += Ee.BonusWildcard);
+        let I = x ? `((?:${O})(?:/(?:${O}))*)` : `(${O})`;
+        d || (I = M && f.length < 2 ? `(?:/${I})` : "/" + I), M && (I += "?"), n += I, g += Ee.Dynamic, M && (g += Ee.BonusOptional), x && (g += Ee.BonusRepeatable), O === ".*" && (g += Ee.BonusWildcard);
       }
       c.push(g);
     }
@@ -5695,11 +5721,11 @@ function af(e, t) {
       else if (g.type === Ct.Param) {
         const { value: k, repeatable: x, optional: M } = g, S = k in f ? f[k] : "";
         if (Ge(S) && !x) throw new Error(`Provided param "${k}" is an array but it is not repeatable (* or + modifiers)`);
-        const P = Ge(S) ? S.join("/") : S;
-        if (!P) if (M)
+        const O = Ge(S) ? S.join("/") : S;
+        if (!O) if (M)
           m.length < 2 && (c.endsWith("/") ? c = c.slice(0, -1) : d = !0);
         else throw new Error(`Missing required param "${k}"`);
-        c += P;
+        c += O;
       }
     }
     return c || "/";
@@ -5712,7 +5738,7 @@ function af(e, t) {
     stringify: a
   };
 }
-function cf(e, t) {
+function uf(e, t) {
   let r = 0;
   for (; r < e.length && r < t.length; ) {
     const o = t[r] - e[r];
@@ -5725,7 +5751,7 @@ function Gs(e, t) {
   let r = 0;
   const o = e.score, n = t.score;
   for (; r < o.length && r < n.length; ) {
-    const i = cf(o[r], n[r]);
+    const i = uf(o[r], n[r]);
     if (i) return i;
     r++;
   }
@@ -5739,13 +5765,13 @@ function ri(e) {
   const t = e[e.length - 1];
   return e.length > 0 && t[t.length - 1] < 0;
 }
-const uf = {
+const ff = {
   strict: !1,
   end: !0,
   sensitive: !1
 };
-function ff(e, t, r) {
-  const o = af(nf(e.path), r), n = re(o, {
+function df(e, t, r) {
+  const o = cf(sf(e.path), r), n = oe(o, {
     record: e,
     parent: t,
     children: [],
@@ -5753,9 +5779,9 @@ function ff(e, t, r) {
   });
   return t && !n.record.aliasOf == !t.record.aliasOf && t.children.push(n), n;
 }
-function df(e, t) {
+function hf(e, t) {
   const r = [], o = /* @__PURE__ */ new Map();
-  t = Jn(uf, t);
+  t = Jn(ff, t);
   function n(d) {
     return o.get(d);
   }
@@ -5765,24 +5791,24 @@ function df(e, t) {
     const M = Jn(t, d), S = [x];
     if ("alias" in d) {
       const R = typeof d.alias == "string" ? [d.alias] : d.alias;
-      for (const B of R) S.push(ni(re({}, x, {
+      for (const B of R) S.push(ni(oe({}, x, {
         components: g ? g.record.components : x.components,
         path: B,
         aliasOf: g ? g.record : x
       })));
     }
-    let P, I;
+    let O, I;
     for (const R of S) {
       const { path: B } = R;
       if (m && B[0] !== "/") {
         const ne = m.record.path, q = ne[ne.length - 1] === "/" ? "" : "/";
         R.path = m.record.path + (B && q + B);
       }
-      if (P = ff(R, m, M), g ? g.alias.push(P) : (I = I || P, I !== P && I.alias.push(P), k && d.name && !ii(P) && s(d.name)), qs(P) && a(P), x.children) {
+      if (O = df(R, m, M), g ? g.alias.push(O) : (I = I || O, I !== O && I.alias.push(O), k && d.name && !ii(O) && s(d.name)), qs(O) && a(O), x.children) {
         const ne = x.children;
-        for (let q = 0; q < ne.length; q++) i(ne[q], P, g && g.children[q]);
+        for (let q = 0; q < ne.length; q++) i(ne[q], O, g && g.children[q]);
       }
-      g = g || P;
+      g = g || O;
     }
     return I ? () => {
       s(I);
@@ -5801,14 +5827,14 @@ function df(e, t) {
     return r;
   }
   function a(d) {
-    const m = gf(d, r);
+    const m = mf(d, r);
     r.splice(m, 0, d), d.record.name && !ii(d) && o.set(d.record.name, d);
   }
   function f(d, m) {
     let g, k = {}, x, M;
     if ("name" in d && d.name) {
       if (g = o.get(d.name), !g) throw Yt(se.MATCHER_NOT_FOUND, { location: d });
-      M = g.record.name, k = re(oi(m.params, g.keys.filter((I) => !I.optional).concat(g.parent ? g.parent.keys.filter((I) => I.optional) : []).map((I) => I.name)), d.params && oi(d.params, g.keys.map((I) => I.name))), x = g.stringify(k);
+      M = g.record.name, k = oe(oi(m.params, g.keys.filter((I) => !I.optional).concat(g.parent ? g.parent.keys.filter((I) => I.optional) : []).map((I) => I.name)), d.params && oi(d.params, g.keys.map((I) => I.name))), x = g.stringify(k);
     } else if (d.path != null)
       x = d.path, g = r.find((I) => I.re.test(x)), g && (k = g.parse(x), M = g.record.name);
     else {
@@ -5816,18 +5842,18 @@ function df(e, t) {
         location: d,
         currentLocation: m
       });
-      M = g.record.name, k = re({}, m.params, d.params), x = g.stringify(k);
+      M = g.record.name, k = oe({}, m.params, d.params), x = g.stringify(k);
     }
     const S = [];
-    let P = g;
-    for (; P; )
-      S.unshift(P.record), P = P.parent;
+    let O = g;
+    for (; O; )
+      S.unshift(O.record), O = O.parent;
     return {
       name: M,
       path: x,
       params: k,
       matched: S,
-      meta: pf(S)
+      meta: gf(S)
     };
   }
   e.forEach((d) => i(d));
@@ -5856,7 +5882,7 @@ function ni(e) {
     meta: e.meta || {},
     aliasOf: e.aliasOf,
     beforeEnter: e.beforeEnter,
-    props: hf(e),
+    props: pf(e),
     children: e.children || [],
     instances: {},
     leaveGuards: /* @__PURE__ */ new Set(),
@@ -5866,7 +5892,7 @@ function ni(e) {
   };
   return Object.defineProperty(t, "mods", { value: {} }), t;
 }
-function hf(e) {
+function pf(e) {
   const t = {}, r = e.props || !1;
   if ("component" in e) t.default = r;
   else for (const o in e.components) t[o] = typeof r == "object" ? r[o] : r;
@@ -5879,19 +5905,19 @@ function ii(e) {
   }
   return !1;
 }
-function pf(e) {
-  return e.reduce((t, r) => re(t, r.meta), {});
+function gf(e) {
+  return e.reduce((t, r) => oe(t, r.meta), {});
 }
-function gf(e, t) {
+function mf(e, t) {
   let r = 0, o = t.length;
   for (; r !== o; ) {
     const i = r + o >> 1;
     Gs(e, t[i]) < 0 ? o = i : r = i + 1;
   }
-  const n = mf(e);
+  const n = vf(e);
   return n && (o = t.lastIndexOf(n, o - 1)), o;
 }
-function mf(e) {
+function vf(e) {
   let t = e;
   for (; t = t.parent; ) if (qs(t) && Gs(e, t) === 0) return t;
 }
@@ -5899,19 +5925,19 @@ function qs({ record: e }) {
   return !!(e.name || e.components && Object.keys(e.components).length || e.redirect);
 }
 function si(e) {
-  const t = Ce(po), r = Ce(an), o = oe(() => {
+  const t = Ce(po), r = Ce(an), o = re(() => {
     const a = Ue(e.to);
     return t.resolve(a);
-  }), n = oe(() => {
+  }), n = re(() => {
     const { matched: a } = o.value, { length: f } = a, c = a[f - 1], d = r.matched;
     if (!c || !d.length) return -1;
     const m = d.findIndex(Jt.bind(null, c));
     if (m > -1) return m;
     const g = li(a[f - 2]);
     return f > 1 && li(c) === g && d[d.length - 1].path !== g ? d.findIndex(Jt.bind(null, a[f - 2])) : m;
-  }), i = oe(() => n.value > -1 && _f(r.params, o.value.params)), s = oe(() => n.value > -1 && n.value === r.matched.length - 1 && Ks(r.params, o.value.params));
+  }), i = re(() => n.value > -1 && xf(r.params, o.value.params)), s = re(() => n.value > -1 && n.value === r.matched.length - 1 && Ks(r.params, o.value.params));
   function l(a = {}) {
-    if (wf(a)) {
+    if (_f(a)) {
       const f = t[Ue(e.replace) ? "replace" : "push"](Ue(e.to)).catch(ur);
       return e.viewTransition && typeof document < "u" && "startViewTransition" in document && document.startViewTransition(() => f), f;
     }
@@ -5919,16 +5945,16 @@ function si(e) {
   }
   return {
     route: o,
-    href: oe(() => o.value.href),
+    href: re(() => o.value.href),
     isActive: i,
     isExactActive: s,
     navigate: l
   };
 }
-function vf(e) {
+function yf(e) {
   return e.length === 1 ? e[0] : e;
 }
-const yf = /* @__PURE__ */ Nt({
+const bf = /* @__PURE__ */ Nt({
   name: "RouterLink",
   compatConfig: { MODE: 3 },
   props: {
@@ -5948,12 +5974,12 @@ const yf = /* @__PURE__ */ Nt({
   },
   useLink: si,
   setup(e, { slots: t }) {
-    const r = ro(si(e)), { options: o } = Ce(po), n = oe(() => ({
+    const r = ro(si(e)), { options: o } = Ce(po), n = re(() => ({
       [ai(e.activeClass, o.linkActiveClass, "router-link-active")]: r.isActive,
       [ai(e.exactActiveClass, o.linkExactActiveClass, "router-link-exact-active")]: r.isExactActive
     }));
     return () => {
-      const i = t.default && vf(t.default(r));
+      const i = t.default && yf(t.default(r));
       return e.custom ? i : Es("a", {
         "aria-current": r.isExactActive ? e.ariaCurrentValue : null,
         href: r.href,
@@ -5962,8 +5988,8 @@ const yf = /* @__PURE__ */ Nt({
       }, i);
     };
   }
-}), bf = yf;
-function wf(e) {
+}), wf = bf;
+function _f(e) {
   if (!(e.metaKey || e.altKey || e.ctrlKey || e.shiftKey) && !e.defaultPrevented && !(e.button !== void 0 && e.button !== 0)) {
     if (e.currentTarget && e.currentTarget.getAttribute) {
       const t = e.currentTarget.getAttribute("target");
@@ -5972,19 +5998,19 @@ function wf(e) {
     return e.preventDefault && e.preventDefault(), !0;
   }
 }
-function _f(e, t) {
+function xf(e, t) {
   for (const r in t) {
     const o = t[r], n = e[r];
     if (typeof o == "string") {
       if (o !== n) return !1;
-    } else if (!Ge(n) || n.length !== o.length || o.some((i, s) => i !== n[s])) return !1;
+    } else if (!Ge(n) || n.length !== o.length || o.some((i, s) => i.valueOf() !== n[s].valueOf())) return !1;
   }
   return !0;
 }
 function li(e) {
   return e ? e.aliasOf ? e.aliasOf.path : e.path : "";
 }
-const ai = (e, t, r) => e ?? t ?? r, xf = /* @__PURE__ */ Nt({
+const ai = (e, t, r) => e ?? t ?? r, kf = /* @__PURE__ */ Nt({
   name: "RouterView",
   inheritAttrs: !1,
   props: {
@@ -5996,14 +6022,14 @@ const ai = (e, t, r) => e ?? t ?? r, xf = /* @__PURE__ */ Nt({
   },
   compatConfig: { MODE: 3 },
   setup(e, { attrs: t, slots: r }) {
-    const o = Ce($o), n = oe(() => e.route || o.value), i = Ce(ei, 0), s = oe(() => {
+    const o = Ce($o), n = re(() => e.route || o.value), i = Ce(ei, 0), s = re(() => {
       let f = Ue(i);
       const { matched: c } = n.value;
       let d;
       for (; (d = c[f]) && !d.components; ) f++;
       return f;
-    }), l = oe(() => n.value.matched[s.value]);
-    It(ei, oe(() => s.value + 1)), It(Zu, l), It($o, n);
+    }), l = re(() => n.value.matched[s.value]);
+    It(ei, re(() => s.value + 1)), It(ef, l), It($o, n);
     const a = xt();
     return Ke(() => [
       a.value,
@@ -6017,7 +6043,7 @@ const ai = (e, t, r) => e ?? t ?? r, xf = /* @__PURE__ */ Nt({
         Component: m,
         route: f
       });
-      const g = d.props[c], k = g ? g === !0 ? f.params : typeof g == "function" ? g(f) : g : null, M = Es(m, re({}, k, t, {
+      const g = d.props[c], k = g ? g === !0 ? f.params : typeof g == "function" ? g(f) : g : null, M = Es(m, oe({}, k, t, {
         onVnodeUnmounted: (S) => {
           S.component.isUnmounted && (d.instances[c] = null);
         },
@@ -6035,12 +6061,12 @@ function ci(e, t) {
   const r = e(t);
   return r.length === 1 ? r[0] : r;
 }
-const kf = xf;
-function Ef(e) {
-  const t = df(e.routes, e), r = e.parseQuery || Qu, o = e.stringifyQuery || Zn, n = e.history, i = tr(), s = tr(), l = tr(), a = ct(vt);
+const Ef = kf;
+function Sf(e) {
+  const t = hf(e.routes, e), r = e.parseQuery || Xu, o = e.stringifyQuery || Zn, n = e.history, i = tr(), s = tr(), l = tr(), a = ct(vt);
   let f = vt;
   Lt && e.scrollBehavior && "scrollRestoration" in history && (history.scrollRestoration = "manual");
-  const c = Ao.bind(null, (b) => "" + b), d = Ao.bind(null, Nu), m = Ao.bind(null, yr);
+  const c = Ao.bind(null, (b) => "" + b), d = Ao.bind(null, Mu), m = Ao.bind(null, yr);
   function g(b, N) {
     let T, D;
     return $s(b) ? (T = t.getRecordMatcher(b), D = N) : D = b, t.addRoute(D, T);
@@ -6056,9 +6082,9 @@ function Ef(e) {
     return !!t.getRecordMatcher(b);
   }
   function S(b, N) {
-    if (N = re({}, N || a.value), typeof b == "string") {
+    if (N = oe({}, N || a.value), typeof b == "string") {
       const p = Ro(r, b, N.path), y = t.resolve({ path: p.path }, N), w = n.createHref(p.fullPath);
-      return re(p, y, {
+      return oe(p, y, {
         params: m(y.params),
         hash: yr(p.hash),
         redirectedFrom: void 0,
@@ -6067,29 +6093,29 @@ function Ef(e) {
     }
     let T;
     if (b.path != null)
-      T = re({}, b, { path: Ro(r, b.path, N.path).path });
+      T = oe({}, b, { path: Ro(r, b.path, N.path).path });
     else {
-      const p = re({}, b.params);
+      const p = oe({}, b.params);
       for (const y in p) p[y] == null && delete p[y];
-      T = re({}, b, { params: d(p) }), N.params = d(N.params);
+      T = oe({}, b, { params: d(p) }), N.params = d(N.params);
     }
     const D = t.resolve(T, N), U = b.hash || "";
     D.params = c(m(D.params));
-    const u = Fu(o, re({}, b, {
+    const u = Vu(o, oe({}, b, {
       hash: Pu(U),
       path: D.path
     })), h = n.createHref(u);
-    return re({
+    return oe({
       fullPath: u,
       hash: U,
-      query: o === Zn ? Xu(b.query) : b.query || {}
+      query: o === Zn ? Zu(b.query) : b.query || {}
     }, D, {
       redirectedFrom: void 0,
       href: h
     });
   }
-  function P(b) {
-    return typeof b == "string" ? Ro(r, b, a.value.path) : re({}, b);
+  function O(b) {
+    return typeof b == "string" ? Ro(r, b, a.value.path) : oe({}, b);
   }
   function I(b, N) {
     if (f !== b) return Yt(se.NAVIGATION_CANCELLED, {
@@ -6101,14 +6127,14 @@ function Ef(e) {
     return q(b);
   }
   function B(b) {
-    return R(re(P(b), { replace: !0 }));
+    return R(oe(O(b), { replace: !0 }));
   }
   function ne(b, N) {
     const T = b.matched[b.matched.length - 1];
     if (T && T.redirect) {
       const { redirect: D } = T;
       let U = typeof D == "function" ? D(b, N) : D;
-      return typeof U == "string" && (U = U.includes("?") || U.includes("#") ? U = P(U) : { path: U }, U.params = {}), re({
+      return typeof U == "string" && (U = U.includes("?") || U.includes("#") ? U = O(U) : { path: U }, U.params = {}), oe({
         query: b.query,
         hash: b.hash,
         params: U.path != null ? {} : b.params
@@ -6117,22 +6143,22 @@ function Ef(e) {
   }
   function q(b, N) {
     const T = f = S(b), D = a.value, U = b.state, u = b.force, h = b.replace === !0, p = ne(T, D);
-    if (p) return q(re(P(p), {
-      state: typeof p == "object" ? re({}, U, p.state) : U,
+    if (p) return q(oe(O(p), {
+      state: typeof p == "object" ? oe({}, U, p.state) : U,
       force: u,
       replace: h
     }), N || T);
     const y = T;
     y.redirectedFrom = N;
     let w;
-    return !u && Vu(o, D, T) && (w = Yt(se.NAVIGATION_DUPLICATED, {
+    return !u && ju(o, D, T) && (w = Yt(se.NAVIGATION_DUPLICATED, {
       to: y,
       from: D
     }), qe(D, D, !0, !1)), (w ? Promise.resolve(w) : he(y, D)).catch((v) => nt(v) ? nt(v, se.NAVIGATION_GUARD_REDIRECT) ? v : mt(v) : Y(v, y, D)).then((v) => {
       if (v) {
         if (nt(v, se.NAVIGATION_GUARD_REDIRECT))
-          return q(re({ replace: h }, P(v.to), {
-            state: typeof v.to == "object" ? re({}, U, v.to.state) : U,
+          return q(oe({ replace: h }, O(v.to), {
+            state: typeof v.to == "object" ? oe({}, U, v.to.state) : U,
             force: u
           }), N || y);
       } else v = fe(y, D, !0, h, U);
@@ -6149,7 +6175,7 @@ function Ef(e) {
   }
   function he(b, N) {
     let T;
-    const [D, U, u] = ef(b, N);
+    const [D, U, u] = tf(b, N);
     T = To(D.reverse(), "beforeRouteLeave", b, N);
     for (const p of D) p.leaveGuards.forEach((y) => {
       T.push(_t(y, b, N));
@@ -6183,7 +6209,7 @@ function Ef(e) {
     const u = I(b, N);
     if (u) return u;
     const h = N === vt, p = Lt ? history.state : {};
-    T && (D || h ? n.replace(b.fullPath, re({ scroll: h && p && p.scroll }, U)) : n.push(b.fullPath, U)), a.value = b, qe(b, N, T, h), mt();
+    T && (D || h ? n.replace(b.fullPath, oe({ scroll: h && p && p.scroll }, U)) : n.push(b.fullPath, U)), a.value = b, qe(b, N, T, h), mt();
   }
   let pe;
   function z() {
@@ -6191,7 +6217,7 @@ function Ef(e) {
       if (!kt.listening) return;
       const D = S(b), U = ne(D, kt.currentRoute.value);
       if (U) {
-        q(re(U, {
+        q(oe(U, {
           replace: !0,
           force: !0
         }), D).catch(ur);
@@ -6199,7 +6225,7 @@ function Ef(e) {
       }
       f = D;
       const u = a.value;
-      Lt && Wu(Xn(u.fullPath, T.delta), Ku()), he(D, u).catch((h) => nt(h, se.NAVIGATION_ABORTED | se.NAVIGATION_CANCELLED) ? h : nt(h, se.NAVIGATION_GUARD_REDIRECT) ? (q(re(P(h.to), { force: !0 }), D).then((p) => {
+      Lt && Gu(Xn(u.fullPath, T.delta), $u()), he(D, u).catch((h) => nt(h, se.NAVIGATION_ABORTED | se.NAVIGATION_CANCELLED) ? h : nt(h, se.NAVIGATION_GUARD_REDIRECT) ? (q(oe(O(h.to), { force: !0 }), D).then((p) => {
         nt(p, se.NAVIGATION_ABORTED | se.NAVIGATION_DUPLICATED) && !T.delta && T.type === Uo.pop && n.go(-1, !1);
       }).catch(ur), Promise.reject()) : (T.delta && n.go(-T.delta, !1), Y(h, D, u))).then((h) => {
         h = h || fe(D, u, !1), h && (T.delta && !nt(h, se.NAVIGATION_CANCELLED) ? n.go(-T.delta, !1) : T.type === Uo.pop && nt(h, se.NAVIGATION_ABORTED | se.NAVIGATION_DUPLICATED) && n.go(-1, !1)), ve(D, u, h);
@@ -6223,8 +6249,8 @@ function Ef(e) {
   function qe(b, N, T, D) {
     const { scrollBehavior: U } = e;
     if (!Lt || !U) return Promise.resolve();
-    const u = !T && Gu(Xn(b.fullPath, 0)) || (D || !T) && history.state && history.state.scroll || null;
-    return _r().then(() => U(b, N, u)).then((h) => h && $u(h)).catch((h) => Y(h, b, N));
+    const u = !T && qu(Xn(b.fullPath, 0)) || (D || !T) && history.state && history.state.scroll || null;
+    return _r().then(() => U(b, N, u)).then((h) => h && Wu(h)).catch((h) => Y(h, b, N));
   }
   const Te = (b) => n.go(b);
   let Dt;
@@ -6249,7 +6275,7 @@ function Ef(e) {
     onError: J.add,
     isReady: rt,
     install(b) {
-      b.component("RouterLink", bf), b.component("RouterView", kf), b.config.globalProperties.$router = kt, Object.defineProperty(b.config.globalProperties, "$route", {
+      b.component("RouterLink", wf), b.component("RouterView", Ef), b.config.globalProperties.$router = kt, Object.defineProperty(b.config.globalProperties, "$route", {
         enumerable: !0,
         get: () => Ue(a)
       }), Lt && !Dt && a.value === vt && (Dt = !0, R(n.location).catch((D) => {
@@ -6271,34 +6297,34 @@ function Ef(e) {
   }
   return kt;
 }
-function zf() {
+function Uf() {
   return Ce(po);
 }
-function Bf(e) {
+function Kf(e) {
   return Ce(an);
 }
-const Sf = [
+const Af = [
   {
     path: "/",
     name: "/",
-    component: () => import("./index-kHk614RY.js")
+    component: () => import("./index-CbhK8baV.js")
     /* no children */
   },
   {
     path: "/mutations",
     name: "/mutations",
-    component: () => import("./mutations-BZWQwG2S.js"),
+    component: () => import("./mutations-DbP2-xaA.js"),
     children: [
       {
         path: "",
         name: "/mutations/(unselected)",
-        component: () => import("./(unselected)-B-_Xdo2t.js")
+        component: () => import("./(unselected)-BvYXA0-7.js")
         /* no children */
       },
       {
         path: ":mutationId",
         name: "/mutations/[mutationId]",
-        component: () => import("./_mutationId_-BG1E7StK.js")
+        component: () => import("./_mutationId_-DJZUO9uK.js")
         /* no children */
       }
     ]
@@ -6306,18 +6332,18 @@ const Sf = [
   {
     path: "/queries",
     name: "/queries",
-    component: () => import("./queries-D3ybdTKc.js"),
+    component: () => import("./queries-CfTVwyNe.js"),
     children: [
       {
         path: "",
         name: "/queries/(unselected)",
-        component: () => import("./(unselected)-BFwQCIEo.js")
+        component: () => import("./(unselected)-De_qnqOP.js")
         /* no children */
       },
       {
         path: ":queryId",
         name: "/queries/[queryId]",
-        component: () => import("./_queryId_-BHPtMxoe.js")
+        component: () => import("./_queryId_-OYxjQ3wF.js")
         /* no children */
       }
     ]
@@ -6325,14 +6351,14 @@ const Sf = [
   {
     path: "/settings",
     name: "/settings",
-    component: () => import("./settings-DddAyvXJ.js")
+    component: () => import("./settings--jMqFgqF.js")
     /* no children */
   }
 ];
-function Af(e) {
-  const t = Ef({
-    history: tf(),
-    routes: [{ path: "/", redirect: "/queries" }, ...Sf]
+function Rf(e) {
+  const t = Sf({
+    history: rf(),
+    routes: [{ path: "/", redirect: "/queries" }, ...Af]
   });
   t.afterEach((o) => {
     localStorage.setItem("pc-devtools-route", o.fullPath);
@@ -6340,24 +6366,24 @@ function Af(e) {
   const r = localStorage.getItem("pc-devtools-route") || "/queries";
   return t.push(r), e;
 }
-const Uf = /* @__PURE__ */ dc(bu, {
-  configureApp: Af,
+const $f = /* @__PURE__ */ dc(wu, {
+  configureApp: Rf,
   shadowRoot: !0
 });
 export {
-  Uf as $,
-  Zc as A,
-  iu as B,
-  Lf as C,
-  Mf as D,
+  Nf as $,
+  eu as A,
+  su as B,
+  zf as C,
+  Df as D,
   ct as E,
   Re as F,
   cl as G,
   He as H,
   va as I,
-  Cf as J,
-  Df as K,
-  Of as L,
+  Tf as J,
+  Ff as K,
+  If as L,
   xr as M,
   Ql as N,
   It as O,
@@ -6368,36 +6394,38 @@ export {
   Qr as T,
   pa as U,
   vr as V,
-  Fc as W,
-  If as X,
-  Ff as Y,
+  Vc as W,
+  jf as X,
+  yc as Y,
   Pf as Z,
-  yu as _,
+  bu as _,
   Se as a,
-  oe as b,
+  Vf as a0,
+  $f as a1,
+  re as b,
   Mt as c,
   Nt as d,
   Kt as e,
-  Nf as f,
+  Mf as f,
   Ue as g,
   ra as h,
   ae as i,
   xt as j,
-  Hf as k,
-  Tf as l,
+  Bf as k,
+  Of as l,
   io as m,
   Qt as n,
   Ve as o,
-  qc as p,
+  Jc as p,
   ja as q,
   bn as r,
-  jf as s,
+  Hf as s,
   vi as t,
-  zf as u,
+  Uf as u,
   Ke as v,
   rr as w,
   ue as x,
-  Bf as y,
-  Vf as z
+  Kf as y,
+  Lf as z
 };
-//# sourceMappingURL=index-CTwvPt67.js.map
+//# sourceMappingURL=index-BDRe8hqi.js.map