@pinia/colada-devtools 0.1.8 → 0.1.9

package/dist-panel/{index-UPnYYHaa.js → index-CIfbEdr_.js}

@@ -1,43 +1,38 @@
-import { DuplexChannel as Ws } from "@pinia/colada-devtools/shared";
-/**
-* @vue/shared v3.5.22
-* (c) 2018-present Yuxi (Evan) You and Vue contributors
-* @license MIT
-**/
+import { DuplexChannel as Gs } from "@pinia/colada-devtools/shared";
 // @__NO_SIDE_EFFECTS__
-function $o(e) {
+function Uo(e) {
   const t = /* @__PURE__ */ Object.create(null);
   for (const r of e.split(",")) t[r] = 1;
   return (r) => r in t;
 }
 const K = {}, Vt = [], Be = () => {
-}, ai = () => !1, $r = (e) => e.charCodeAt(0) === 111 && e.charCodeAt(1) === 110 && // uppercase letter
-(e.charCodeAt(2) > 122 || e.charCodeAt(2) < 97), Ko = (e) => e.startsWith("onUpdate:"), ce = Object.assign, Wo = (e, t) => {
+}, ci = () => !1, $r = (e) => e.charCodeAt(0) === 111 && e.charCodeAt(1) === 110 && // uppercase letter
+(e.charCodeAt(2) > 122 || e.charCodeAt(2) < 97), $o = (e) => e.startsWith("onUpdate:"), ce = Object.assign, Ko = (e, t) => {
   const r = e.indexOf(t);
   r > -1 && e.splice(r, 1);
-}, Gs = Object.prototype.hasOwnProperty, G = (e, t) => Gs.call(e, t), F = Array.isArray, jt = (e) => vr(e) === "[object Map]", Kr = (e) => vr(e) === "[object Set]", fn = (e) => vr(e) === "[object Date]", z = (e) => typeof e == "function", le = (e) => typeof e == "string", Ke = (e) => typeof e == "symbol", Z = (e) => e !== null && typeof e == "object", ci = (e) => (Z(e) || z(e)) && z(e.then) && z(e.catch), ui = Object.prototype.toString, vr = (e) => ui.call(e), qs = (e) => vr(e).slice(8, -1), Wr = (e) => vr(e) === "[object Object]", Go = (e) => le(e) && e !== "NaN" && e[0] !== "-" && "" + parseInt(e, 10) === e, rr = /* @__PURE__ */ $o(
+}, qs = Object.prototype.hasOwnProperty, G = (e, t) => qs.call(e, t), F = Array.isArray, jt = (e) => vr(e) === "[object Map]", Kr = (e) => vr(e) === "[object Set]", fn = (e) => vr(e) === "[object Date]", z = (e) => typeof e == "function", le = (e) => typeof e == "string", Ke = (e) => typeof e == "symbol", Z = (e) => e !== null && typeof e == "object", ui = (e) => (Z(e) || z(e)) && z(e.then) && z(e.catch), fi = Object.prototype.toString, vr = (e) => fi.call(e), Js = (e) => vr(e).slice(8, -1), Wr = (e) => vr(e) === "[object Object]", Wo = (e) => le(e) && e !== "NaN" && e[0] !== "-" && "" + parseInt(e, 10) === e, rr = /* @__PURE__ */ Uo(
   // the leading comma is intentional so empty string "" is also included
   ",key,ref,ref_for,ref_key,onVnodeBeforeMount,onVnodeMounted,onVnodeBeforeUpdate,onVnodeUpdated,onVnodeBeforeUnmount,onVnodeUnmounted"
 ), Gr = (e) => {
   const t = /* @__PURE__ */ Object.create(null);
   return ((r) => t[r] || (t[r] = e(r)));
-}, Js = /-\w/g, xe = Gr(
-  (e) => e.replace(Js, (t) => t.slice(1).toUpperCase())
-), Ys = /\B([A-Z])/g, Fe = Gr(
-  (e) => e.replace(Ys, "-$1").toLowerCase()
+}, Ys = /-\w/g, xe = Gr(
+  (e) => e.replace(Ys, (t) => t.slice(1).toUpperCase())
+), Qs = /\B([A-Z])/g, Fe = Gr(
+  (e) => e.replace(Qs, "-$1").toLowerCase()
 ), qr = Gr((e) => e.charAt(0).toUpperCase() + e.slice(1)), ho = Gr(
   (e) => e ? `on${qr(e)}` : ""
 ), Ne = (e, t) => !Object.is(e, t), Rr = (e, ...t) => {
   for (let r = 0; r < e.length; r++)
     e[r](...t);
-}, fi = (e, t, r, o = !1) => {
+}, di = (e, t, r, o = !1) => {
   Object.defineProperty(e, t, {
     configurable: !0,
     enumerable: !1,
     writable: o,
     value: r
   });
-}, Co = (e) => {
+}, Go = (e) => {
   const t = parseFloat(e);
   return isNaN(t) ? e : t;
 }, dn = (e) => {
@@ -50,7 +45,7 @@ function Yr(e) {
   if (F(e)) {
     const t = {};
     for (let r = 0; r < e.length; r++) {
-      const o = e[r], n = le(o) ? el(o) : Yr(o);
+      const o = e[r], n = le(o) ? tl(o) : Yr(o);
       if (n)
         for (const i in n)
           t[i] = n[i];
@@ -59,12 +54,12 @@ function Yr(e) {
   } else if (le(e) || Z(e))
     return e;
 }
-const Qs = /;(?![^(]*\))/g, Xs = /:([^]+)/, Zs = /\/\*[^]*?\*\//g;
-function el(e) {
+const Xs = /;(?![^(]*\))/g, Zs = /:([^]+)/, el = /\/\*[^]*?\*\//g;
+function tl(e) {
   const t = {};
-  return e.replace(Zs, "").split(Qs).forEach((r) => {
+  return e.replace(el, "").split(Xs).forEach((r) => {
     if (r) {
-      const o = r.split(Xs);
+      const o = r.split(Zs);
       o.length > 1 && (t[o[0].trim()] = o[1].trim());
     }
   }), t;
@@ -83,11 +78,11 @@ function Jt(e) {
       e[r] && (t += r + " ");
   return t.trim();
 }
-const tl = "itemscope,allowfullscreen,formnovalidate,ismap,nomodule,novalidate,readonly", rl = /* @__PURE__ */ $o(tl);
-function di(e) {
+const rl = "itemscope,allowfullscreen,formnovalidate,ismap,nomodule,novalidate,readonly", ol = /* @__PURE__ */ Uo(rl);
+function hi(e) {
   return !!e || e === "";
 }
-function ol(e, t) {
+function nl(e, t) {
   if (e.length !== t.length) return !1;
   let r = !0;
   for (let o = 0; r && o < e.length; o++)
@@ -102,7 +97,7 @@ function Qr(e, t) {
   if (r = Ke(e), o = Ke(t), r || o)
     return e === t;
   if (r = F(e), o = F(t), r || o)
-    return r && o ? ol(e, t) : !1;
+    return r && o ? nl(e, t) : !1;
   if (r = Z(e), o = Z(t), r || o) {
     if (!r || !o)
       return !1;
@@ -117,10 +112,10 @@ function Qr(e, t) {
   }
   return String(e) === String(t);
 }
-function hi(e, t) {
+function pi(e, t) {
   return e.findIndex((r) => Qr(r, t));
 }
-const pi = (e) => !!(e && e.__v_isRef === !0), gi = (e) => le(e) ? e : e == null ? "" : F(e) || Z(e) && (e.toString === ui || !z(e.toString)) ? pi(e) ? gi(e.value) : JSON.stringify(e, mi, 2) : String(e), mi = (e, t) => pi(t) ? mi(e, t.value) : jt(t) ? {
+const gi = (e) => !!(e && e.__v_isRef === !0), mi = (e) => le(e) ? e : e == null ? "" : F(e) || Z(e) && (e.toString === fi || !z(e.toString)) ? gi(e) ? mi(e.value) : JSON.stringify(e, vi, 2) : String(e), vi = (e, t) => gi(t) ? vi(e, t.value) : jt(t) ? {
   [`Map(${t.size})`]: [...t.entries()].reduce(
     (r, [o, n], i) => (r[po(o, i) + " =>"] = n, r),
     {}
@@ -135,16 +130,11 @@ const pi = (e) => !!(e && e.__v_isRef === !0), gi = (e) => le(e) ? e : e == null
     Ke(e) ? `Symbol(${(r = e.description) != null ? r : t})` : e
   );
 };
-function nl(e) {
+function il(e) {
   return e == null ? "initial" : typeof e == "string" ? e === "" ? " " : e : String(e);
 }
-/**
-* @vue/reactivity v3.5.22
-* (c) 2018-present Yuxi (Evan) You and Vue contributors
-* @license MIT
-**/
 let be;
-class il {
+class sl {
   constructor(t = !1) {
     this.detached = t, this._active = !0, this._on = 0, this.effects = [], this.cleanups = [], this._isPaused = !1, this.parent = be, !t && be && (this.index = (be.scopes || (be.scopes = [])).push(
       this
@@ -226,12 +216,12 @@ class il {
 function qo() {
   return be;
 }
-function sl(e, t = !1) {
+function ll(e, t = !1) {
   be && be.cleanups.push(e);
 }
 let te;
 const go = /* @__PURE__ */ new WeakSet();
-class vi {
+class yi {
   constructor(t) {
     this.fn = t, this.deps = void 0, this.depsTail = void 0, this.flags = 5, this.next = void 0, this.cleanup = void 0, this.scheduler = void 0, be && be.active && be.effects.push(this);
   }
@@ -245,18 +235,18 @@ class vi {
    * @internal
    */
   notify() {
-    this.flags & 2 && !(this.flags & 32) || this.flags & 8 || bi(this);
+    this.flags & 2 && !(this.flags & 32) || this.flags & 8 || wi(this);
   }
   run() {
     if (!(this.flags & 1))
       return this.fn();
-    this.flags |= 2, pn(this), wi(this);
+    this.flags |= 2, pn(this), _i(this);
     const t = te, r = Ue;
     te = this, Ue = !0;
     try {
       return this.fn();
     } finally {
-      _i(this), te = t, Ue = r, this.flags &= -3;
+      xi(this), te = t, Ue = r, this.flags &= -3;
     }
   }
   stop() {
@@ -273,14 +263,14 @@ class vi {
    * @internal
    */
   runIfDirty() {
-    To(this) && this.run();
+    Co(this) && this.run();
   }
   get dirty() {
-    return To(this);
+    return Co(this);
   }
 }
-let yi = 0, or, nr;
-function bi(e, t = !1) {
+let bi = 0, or, nr;
+function wi(e, t = !1) {
   if (e.flags |= 8, t) {
     e.next = nr, nr = e;
     return;
@@ -288,10 +278,10 @@ function bi(e, t = !1) {
   e.next = or, or = e;
 }
 function Jo() {
-  yi++;
+  bi++;
 }
 function Yo() {
-  if (--yi > 0)
+  if (--bi > 0)
     return;
   if (nr) {
     let t = nr;
@@ -316,38 +306,38 @@ function Yo() {
   }
   if (e) throw e;
 }
-function wi(e) {
+function _i(e) {
   for (let t = e.deps; t; t = t.nextDep)
     t.version = -1, t.prevActiveLink = t.dep.activeLink, t.dep.activeLink = t;
 }
-function _i(e) {
+function xi(e) {
   let t, r = e.depsTail, o = r;
   for (; o; ) {
     const n = o.prevDep;
-    o.version === -1 ? (o === r && (r = n), Qo(o), ll(o)) : t = o, o.dep.activeLink = o.prevActiveLink, o.prevActiveLink = void 0, o = n;
+    o.version === -1 ? (o === r && (r = n), Qo(o), al(o)) : t = o, o.dep.activeLink = o.prevActiveLink, o.prevActiveLink = void 0, o = n;
   }
   e.deps = t, e.depsTail = r;
 }
-function To(e) {
+function Co(e) {
   for (let t = e.deps; t; t = t.nextDep)
-    if (t.dep.version !== t.version || t.dep.computed && (xi(t.dep.computed) || t.dep.version !== t.version))
+    if (t.dep.version !== t.version || t.dep.computed && (ki(t.dep.computed) || t.dep.version !== t.version))
       return !0;
   return !!e._dirty;
 }
-function xi(e) {
-  if (e.flags & 4 && !(e.flags & 16) || (e.flags &= -17, e.globalVersion === cr) || (e.globalVersion = cr, !e.isSSR && e.flags & 128 && (!e.deps && !e._dirty || !To(e))))
+function ki(e) {
+  if (e.flags & 4 && !(e.flags & 16) || (e.flags &= -17, e.globalVersion === cr) || (e.globalVersion = cr, !e.isSSR && e.flags & 128 && (!e.deps && !e._dirty || !Co(e))))
     return;
   e.flags |= 2;
   const t = e.dep, r = te, o = Ue;
   te = e, Ue = !0;
   try {
-    wi(e);
+    _i(e);
     const n = e.fn(e._value);
     (t.version === 0 || Ne(n, e._value)) && (e.flags |= 128, e._value = n, t.version++);
   } catch (n) {
     throw t.version++, n;
   } finally {
-    te = r, Ue = o, _i(e), e.flags &= -3;
+    te = r, Ue = o, xi(e), e.flags &= -3;
   }
 }
 function Qo(e, t = !1) {
@@ -359,17 +349,17 @@ function Qo(e, t = !1) {
   }
   !t && !--r.sc && r.map && r.map.delete(r.key);
 }
-function ll(e) {
+function al(e) {
   const { prevDep: t, nextDep: r } = e;
   t && (t.nextDep = r, e.prevDep = void 0), r && (r.prevDep = t, e.nextDep = void 0);
 }
 let Ue = !0;
-const ki = [];
+const Ei = [];
 function ut() {
-  ki.push(Ue), Ue = !1;
+  Ei.push(Ue), Ue = !1;
 }
 function ft() {
-  const e = ki.pop();
+  const e = Ei.pop();
   Ue = e === void 0 ? !0 : e;
 }
 function pn(e) {
@@ -385,7 +375,7 @@ function pn(e) {
   }
 }
 let cr = 0;
-class al {
+class cl {
   constructor(t, r) {
     this.sub = t, this.dep = r, this.version = r.version, this.nextDep = this.prevDep = this.nextSub = this.prevSub = this.prevActiveLink = void 0;
   }
@@ -400,7 +390,7 @@ class Xr {
       return;
     let r = this.activeLink;
     if (r === void 0 || r.sub !== te)
-      r = this.activeLink = new al(te, this), te.deps ? (r.prevDep = te.depsTail, te.depsTail.nextDep = r, te.depsTail = r) : te.deps = te.depsTail = r, Ei(r);
+      r = this.activeLink = new cl(te, this), te.deps ? (r.prevDep = te.depsTail, te.depsTail.nextDep = r, te.depsTail = r) : te.deps = te.depsTail = r, Si(r);
     else if (r.version === -1 && (r.version = this.version, r.nextDep)) {
       const o = r.nextDep;
       o.prevDep = r.prevDep, r.prevDep && (r.prevDep.nextDep = o), r.prevDep = te.depsTail, r.nextDep = void 0, te.depsTail.nextDep = r, te.depsTail = r, te.deps === r && (te.deps = o);
@@ -420,13 +410,13 @@ class Xr {
     }
   }
 }
-function Ei(e) {
+function Si(e) {
   if (e.dep.sc++, e.sub.flags & 4) {
     const t = e.dep.computed;
     if (t && !e.dep.subs) {
       t.flags |= 20;
       for (let o = t.deps; o; o = o.nextDep)
-        Ei(o);
+        Si(o);
     }
     const r = e.dep.subs;
     r !== e && (e.prevSub = r, r && (r.nextSub = e)), e.dep.subs = e;
@@ -459,7 +449,7 @@ function st(e, t, r, o, n, i) {
   if (Jo(), t === "clear")
     s.forEach(l);
   else {
-    const a = F(e), u = a && Go(r);
+    const a = F(e), u = a && Wo(r);
     if (a && r === "length") {
       const c = Number(o);
       s.forEach((d, m) => {
@@ -480,7 +470,7 @@ function st(e, t, r, o, n, i) {
   }
   Yo();
 }
-function cl(e, t) {
+function ul(e, t) {
   const r = Or.get(e);
   return r && r.get(t);
 }
@@ -491,7 +481,7 @@ function Mt(e) {
 function Zr(e) {
   return we(e = W(e), "iterate", ur), e;
 }
-const ul = {
+const fl = {
   __proto__: null,
   [Symbol.iterator]() {
     return mo(this, Symbol.iterator, ge);
@@ -587,10 +577,10 @@ function mo(e, t, r) {
     return i.done || (i.value = r(i.value)), i;
   }), n;
 }
-const fl = Array.prototype;
+const dl = Array.prototype;
 function ot(e, t, r, o, n, i) {
   const s = Zr(e), l = s !== e && !ze(e), a = s[t];
-  if (a !== fl[t]) {
+  if (a !== dl[t]) {
     const d = a.apply(e, i);
     return l ? ge(d) : d;
   }
@@ -623,15 +613,15 @@ function Qt(e, t, r = []) {
   const o = W(e)[t].apply(e, r);
   return Yo(), ft(), o;
 }
-const dl = /* @__PURE__ */ $o("__proto__,__v_isRef,__isVue"), Si = new Set(
+const hl = /* @__PURE__ */ Uo("__proto__,__v_isRef,__isVue"), Ai = new Set(
   /* @__PURE__ */ Object.getOwnPropertyNames(Symbol).filter((e) => e !== "arguments" && e !== "caller").map((e) => Symbol[e]).filter(Ke)
 );
-function hl(e) {
+function pl(e) {
   Ke(e) || (e = String(e));
   const t = W(this);
   return we(t, "has", e), t.hasOwnProperty(e);
 }
-class Ai {
+class Ri {
   constructor(t = !1, r = !1) {
     this._isReadonly = t, this._isShallow = r;
   }
@@ -645,16 +635,16 @@ class Ai {
     if (r === "__v_isShallow")
       return i;
     if (r === "__v_raw")
-      return o === (n ? i ? Ni : Oi : i ? Pi : Ti).get(t) || // receiver is not the reactive proxy, but has the same prototype
+      return o === (n ? i ? Ii : Ni : i ? Oi : Ti).get(t) || // receiver is not the reactive proxy, but has the same prototype
       // this means the receiver is a user proxy of the reactive proxy
       Object.getPrototypeOf(t) === Object.getPrototypeOf(o) ? t : void 0;
     const s = F(t);
     if (!n) {
       let a;
-      if (s && (a = ul[r]))
+      if (s && (a = fl[r]))
         return a;
       if (r === "hasOwnProperty")
-        return hl;
+        return pl;
     }
     const l = Reflect.get(
       t,
@@ -664,16 +654,16 @@ class Ai {
       // its class methods
       ue(t) ? t : o
     );
-    if ((Ke(r) ? Si.has(r) : dl(r)) || (n || we(t, "get", r), i))
+    if ((Ke(r) ? Ai.has(r) : hl(r)) || (n || we(t, "get", r), i))
       return l;
     if (ue(l)) {
-      const a = s && Go(r) ? l : l.value;
+      const a = s && Wo(r) ? l : l.value;
       return n && Z(a) ? Kt(a) : a;
     }
     return Z(l) ? n ? Kt(l) : to(l) : l;
   }
 }
-class Ri extends Ai {
+class Ci extends Ri {
   constructor(t = !1) {
     super(!1, t);
   }
@@ -684,7 +674,7 @@ class Ri extends Ai {
       if (!ze(o) && !wt(o) && (i = W(i), o = W(o)), !F(t) && ue(i) && !ue(o))
         return a || (i.value = o), !0;
     }
-    const s = F(t) && Go(r) ? Number(r) < t.length : G(t, r), l = Reflect.set(
+    const s = F(t) && Wo(r) ? Number(r) < t.length : G(t, r), l = Reflect.set(
       t,
       r,
       o,
@@ -700,7 +690,7 @@ class Ri extends Ai {
   }
   has(t, r) {
     const o = Reflect.has(t, r);
-    return (!Ke(r) || !Si.has(r)) && we(t, "has", r), o;
+    return (!Ke(r) || !Ai.has(r)) && we(t, "has", r), o;
   }
   ownKeys(t) {
     return we(
@@ -710,7 +700,7 @@ class Ri extends Ai {
     ), Reflect.ownKeys(t);
   }
 }
-class Ci extends Ai {
+class Pi extends Ri {
   constructor(t = !1) {
     super(!0, t);
   }
@@ -721,10 +711,10 @@ class Ci extends Ai {
     return !0;
   }
 }
-const pl = /* @__PURE__ */ new Ri(), gl = /* @__PURE__ */ new Ci(), ml = /* @__PURE__ */ new Ri(!0), vl = /* @__PURE__ */ new Ci(!0), Oo = (e) => e, xr = (e) => Reflect.getPrototypeOf(e);
-function yl(e, t, r) {
+const gl = /* @__PURE__ */ new Ci(), ml = /* @__PURE__ */ new Pi(), vl = /* @__PURE__ */ new Ci(!0), yl = /* @__PURE__ */ new Pi(!0), To = (e) => e, xr = (e) => Reflect.getPrototypeOf(e);
+function bl(e, t, r) {
   return function(...o) {
-    const n = this.__v_raw, i = W(n), s = jt(i), l = e === "entries" || e === Symbol.iterator && s, a = e === "keys" && s, u = n[e](...o), c = r ? Oo : t ? Nr : ge;
+    const n = this.__v_raw, i = W(n), s = jt(i), l = e === "entries" || e === Symbol.iterator && s, a = e === "keys" && s, u = n[e](...o), c = r ? To : t ? Nr : ge;
     return !t && we(
       i,
       "iterate",
@@ -750,12 +740,12 @@ function kr(e) {
     return e === "delete" ? !1 : e === "clear" ? void 0 : this;
   };
 }
-function bl(e, t) {
+function wl(e, t) {
   const r = {
     get(n) {
       const i = this.__v_raw, s = W(i), l = W(n);
       e || (Ne(n, l) && we(s, "get", n), we(s, "get", l));
-      const { has: a } = xr(s), u = t ? Oo : e ? Nr : ge;
+      const { has: a } = xr(s), u = t ? To : e ? Nr : ge;
       if (a.call(s, n))
         return u(i.get(n));
       if (a.call(s, l))
@@ -771,7 +761,7 @@ function bl(e, t) {
       return e || (Ne(n, l) && we(s, "has", n), we(s, "has", l)), n === l ? i.has(n) : i.has(n) || i.has(l);
     },
     forEach(n, i) {
-      const s = this, l = s.__v_raw, a = W(l), u = t ? Oo : e ? Nr : ge;
+      const s = this, l = s.__v_raw, a = W(l), u = t ? To : e ? Nr : ge;
       return !e && we(a, "iterate", Rt), l.forEach((c, d) => n.call(i, u(c), u(d), s));
     }
   };
@@ -819,27 +809,27 @@ function bl(e, t) {
     "entries",
     Symbol.iterator
   ].forEach((n) => {
-    r[n] = yl(n, e, t);
+    r[n] = bl(n, e, t);
   }), r;
 }
 function eo(e, t) {
-  const r = bl(e, t);
+  const r = wl(e, t);
   return (o, n, i) => n === "__v_isReactive" ? !e : n === "__v_isReadonly" ? e : n === "__v_raw" ? o : Reflect.get(
     G(r, n) && n in o ? r : o,
     n,
     i
   );
 }
-const wl = {
+const _l = {
   get: /* @__PURE__ */ eo(!1, !1)
-}, _l = {
-  get: /* @__PURE__ */ eo(!1, !0)
 }, xl = {
-  get: /* @__PURE__ */ eo(!0, !1)
+  get: /* @__PURE__ */ eo(!1, !0)
 }, kl = {
+  get: /* @__PURE__ */ eo(!0, !1)
+}, El = {
   get: /* @__PURE__ */ eo(!0, !0)
-}, Ti = /* @__PURE__ */ new WeakMap(), Pi = /* @__PURE__ */ new WeakMap(), Oi = /* @__PURE__ */ new WeakMap(), Ni = /* @__PURE__ */ new WeakMap();
-function El(e) {
+}, Ti = /* @__PURE__ */ new WeakMap(), Oi = /* @__PURE__ */ new WeakMap(), Ni = /* @__PURE__ */ new WeakMap(), Ii = /* @__PURE__ */ new WeakMap();
+function Sl(e) {
   switch (e) {
     case "Object":
     case "Array":
@@ -853,49 +843,49 @@ function El(e) {
       return 0;
   }
 }
-function Sl(e) {
-  return e.__v_skip || !Object.isExtensible(e) ? 0 : El(qs(e));
+function Al(e) {
+  return e.__v_skip || !Object.isExtensible(e) ? 0 : Sl(Js(e));
 }
 function to(e) {
   return wt(e) ? e : ro(
     e,
     !1,
-    pl,
-    wl,
+    gl,
+    _l,
     Ti
   );
 }
-function Ii(e) {
+function Mi(e) {
   return ro(
     e,
     !1,
-    ml,
-    _l,
-    Pi
+    vl,
+    xl,
+    Oi
   );
 }
 function Kt(e) {
   return ro(
     e,
     !0,
-    gl,
-    xl,
-    Oi
+    ml,
+    kl,
+    Ni
   );
 }
-function Al(e) {
+function Rl(e) {
   return ro(
     e,
     !0,
-    vl,
-    kl,
-    Ni
+    yl,
+    El,
+    Ii
   );
 }
 function ro(e, t, r, o, n) {
   if (!Z(e) || e.__v_raw && !(t && e.__v_isReactive))
     return e;
-  const i = Sl(e);
+  const i = Al(e);
   if (i === 0)
     return e;
   const s = n.get(e);
@@ -924,22 +914,22 @@ function W(e) {
   return t ? W(t) : e;
 }
 function oo(e) {
-  return !G(e, "__v_skip") && Object.isExtensible(e) && fi(e, "__v_skip", !0), e;
+  return !G(e, "__v_skip") && Object.isExtensible(e) && di(e, "__v_skip", !0), e;
 }
 const ge = (e) => Z(e) ? to(e) : e, Nr = (e) => Z(e) ? Kt(e) : e;
 function ue(e) {
   return e ? e.__v_isRef === !0 : !1;
 }
-function Tt(e) {
-  return Mi(e, !1);
+function Pt(e) {
+  return Di(e, !1);
 }
 function ct(e) {
-  return Mi(e, !0);
+  return Di(e, !0);
 }
-function Mi(e, t) {
-  return ue(e) ? e : new Rl(e, t);
+function Di(e, t) {
+  return ue(e) ? e : new Cl(e, t);
 }
-class Rl {
+class Cl {
   constructor(t, r) {
     this.dep = new Xr(), this.__v_isRef = !0, this.__v_isShallow = !1, this._rawValue = r ? t : W(t), this._value = r ? t : ge(t), this.__v_isShallow = r;
   }
@@ -957,15 +947,15 @@ function et(e) {
 function He(e) {
   return z(e) ? e() : et(e);
 }
-const Cl = {
+const Pl = {
   get: (e, t, r) => t === "__v_raw" ? e : et(Reflect.get(e, t, r)),
   set: (e, t, r, o) => {
     const n = e[t];
     return ue(n) && !ue(r) ? (n.value = r, !0) : Reflect.set(e, t, r, o);
   }
 };
-function Di(e) {
-  return Lt(e) ? e : new Proxy(e, Cl);
+function Fi(e) {
+  return Lt(e) ? e : new Proxy(e, Pl);
 }
 class Tl {
   constructor(t) {
@@ -980,10 +970,10 @@ class Tl {
     this._set(t);
   }
 }
-function Fi(e) {
+function Vi(e) {
   return new Tl(e);
 }
-class Pl {
+class Ol {
   constructor(t, r, o) {
     this._object = t, this._key = r, this._defaultValue = o, this.__v_isRef = !0, this._value = void 0;
   }
@@ -995,10 +985,10 @@ class Pl {
     this._object[this._key] = t;
   }
   get dep() {
-    return cl(W(this._object), this._key);
+    return ul(W(this._object), this._key);
   }
 }
-class Ol {
+class Nl {
   constructor(t) {
     this._getter = t, this.__v_isRef = !0, this.__v_isReadonly = !0, this._value = void 0;
   }
@@ -1006,14 +996,14 @@ class Ol {
     return this._value = this._getter();
   }
 }
-function Nl(e, t, r) {
-  return ue(e) ? e : z(e) ? new Ol(e) : Z(e) && arguments.length > 1 ? Il(e, t, r) : Tt(e);
-}
 function Il(e, t, r) {
+  return ue(e) ? e : z(e) ? new Nl(e) : Z(e) && arguments.length > 1 ? Ml(e, t, r) : Pt(e);
+}
+function Ml(e, t, r) {
   const o = e[t];
-  return ue(o) ? o : new Pl(e, t, r);
+  return ue(o) ? o : new Ol(e, t, r);
 }
-class Ml {
+class Dl {
   constructor(t, r, o) {
     this.fn = t, this.setter = r, this._value = void 0, this.dep = new Xr(this), this.__v_isRef = !0, this.deps = void 0, this.depsTail = void 0, this.flags = 16, this.globalVersion = cr - 1, this.next = void 0, this.effect = this, this.__v_isReadonly = !r, this.isSSR = o;
   }
@@ -1023,29 +1013,29 @@ class Ml {
   notify() {
     if (this.flags |= 16, !(this.flags & 8) && // avoid infinite self recursion
     te !== this)
-      return bi(this, !0), !0;
+      return wi(this, !0), !0;
   }
   get value() {
     const t = this.dep.track();
-    return xi(this), t && (t.version = this.dep.version), this._value;
+    return ki(this), t && (t.version = this.dep.version), this._value;
   }
   set value(t) {
     this.setter && this.setter(t);
   }
 }
-function Dl(e, t, r = !1) {
+function Fl(e, t, r = !1) {
   let o, n;
-  return z(e) ? o = e : (o = e.get, n = e.set), new Ml(o, n, r);
+  return z(e) ? o = e : (o = e.get, n = e.set), new Dl(o, n, r);
 }
 const Er = {}, Ir = /* @__PURE__ */ new WeakMap();
 let Et;
-function Fl(e, t = !1, r = Et) {
+function Vl(e, t = !1, r = Et) {
   if (r) {
     let o = Ir.get(r);
     o || Ir.set(r, o = []), o.push(e);
   }
 }
-function Vl(e, t, r = K) {
+function jl(e, t, r = K) {
   const { immediate: o, deep: n, once: i, scheduler: s, augmentJob: l, call: a } = r, u = (R) => n ? R : ze(R) || n === !1 || n === 0 ? lt(R, 1) : lt(R);
   let c, d, m, g, x = !1, k = !1;
   if (ue(e) ? (d = () => e.value, x = ze(e)) : Lt(e) ? (d = () => u(e), x = !0) : F(e) ? (k = !0, x = e.some((R) => Lt(R) || ze(R)), d = () => e.map((R) => {
@@ -1076,7 +1066,7 @@ function Vl(e, t, r = K) {
     d = () => lt(R(), B);
   }
   const M = qo(), S = () => {
-    c.stop(), M && M.active && Wo(M.effects, c);
+    c.stop(), M && M.active && Ko(M.effects, c);
   };
   if (i && t) {
     const R = t;
@@ -1111,7 +1101,7 @@ function Vl(e, t, r = K) {
       } else
         c.run();
   };
-  return l && l(N), c = new vi(d), c.scheduler = s ? () => s(N, !1) : N, g = (R) => Fl(R, !1, c), m = c.onStop = () => {
+  return l && l(N), c = new yi(d), c.scheduler = s ? () => s(N, !1) : N, g = (R) => Vl(R, !1, c), m = c.onStop = () => {
     const R = Ir.get(c);
     if (R) {
       if (a)
@@ -1142,11 +1132,6 @@ function lt(e, t = 1 / 0, r) {
   }
   return e;
 }
-/**
-* @vue/runtime-core v3.5.22
-* (c) 2018-present Yuxi (Evan) You and Vue contributors
-* @license MIT
-**/
 function yr(e, t, r, o) {
   try {
     return o ? e(...o) : e();
@@ -1157,7 +1142,7 @@ function yr(e, t, r, o) {
 function tt(e, t, r, o) {
   if (z(e)) {
     const n = yr(e, t, r, o);
-    return n && ci(n) && n.catch((i) => {
+    return n && ui(n) && n.catch((i) => {
       no(i, t, r);
     }), n;
   }
@@ -1191,9 +1176,9 @@ function no(e, t, r, o = !0) {
       return;
     }
   }
-  jl(e, r, n, o, s);
+  Ll(e, r, n, o, s);
 }
-function jl(e, t, r, o = !0, n = !1) {
+function Ll(e, t, r, o = !0, n = !1) {
   if (n)
     throw e;
   console.error(e);
@@ -1202,13 +1187,13 @@ const Re = [];
 let Xe = -1;
 const zt = [];
 let vt = null, Dt = 0;
-const Vi = /* @__PURE__ */ Promise.resolve();
+const ji = /* @__PURE__ */ Promise.resolve();
 let Mr = null;
 function br(e) {
-  const t = Mr || Vi;
+  const t = Mr || ji;
   return e ? t.then(this ? e.bind(this) : e) : t;
 }
-function Ll(e) {
+function zl(e) {
   let t = Xe + 1, r = Re.length;
   for (; t < r; ) {
     const o = t + r >>> 1, n = Re[o], i = fr(n);
@@ -1220,14 +1205,14 @@ function Zo(e) {
   if (!(e.flags & 1)) {
     const t = fr(e), r = Re[Re.length - 1];
     !r || // fast path when the job id is larger than the tail
-    !(e.flags & 2) && t >= fr(r) ? Re.push(e) : Re.splice(Ll(t), 0, e), e.flags |= 1, ji();
+    !(e.flags & 2) && t >= fr(r) ? Re.push(e) : Re.splice(zl(t), 0, e), e.flags |= 1, Li();
   }
 }
-function ji() {
-  Mr || (Mr = Vi.then(Hi));
+function Li() {
+  Mr || (Mr = ji.then(Bi));
 }
-function Li(e) {
-  F(e) ? zt.push(...e) : vt && e.id === -1 ? vt.splice(Dt + 1, 0, e) : e.flags & 1 || (zt.push(e), e.flags |= 1), ji();
+function zi(e) {
+  F(e) ? zt.push(...e) : vt && e.id === -1 ? vt.splice(Dt + 1, 0, e) : e.flags & 1 || (zt.push(e), e.flags |= 1), Li();
 }
 function mn(e, t, r = Xe + 1) {
   for (; r < Re.length; r++) {
@@ -1239,7 +1224,7 @@ function mn(e, t, r = Xe + 1) {
     }
   }
 }
-function zi(e) {
+function Hi(e) {
   if (zt.length) {
     const t = [...new Set(zt)].sort(
       (r, o) => fr(r) - fr(o)
@@ -1256,7 +1241,7 @@ function zi(e) {
   }
 }
 const fr = (e) => e.id == null ? e.flags & 2 ? -1 : 1 / 0 : e.id;
-function Hi(e) {
+function Bi(e) {
   try {
     for (Xe = 0; Xe < Re.length; Xe++) {
       const t = Re[Xe];
@@ -1271,13 +1256,13 @@ function Hi(e) {
       const t = Re[Xe];
       t && (t.flags &= -2);
     }
-    Xe = -1, Re.length = 0, zi(), Mr = null, (Re.length || zt.length) && Hi();
+    Xe = -1, Re.length = 0, Hi(), Mr = null, (Re.length || zt.length) && Bi();
   }
 }
-let me = null, Bi = null;
+let me = null, Ui = null;
 function Dr(e) {
   const t = me;
-  return me = e, Bi = e && e.type.__scopeId || null, t;
+  return me = e, Ui = e && e.type.__scopeId || null, t;
 }
 function er(e, t = me, r) {
   if (!t || e._n)
@@ -1295,7 +1280,7 @@ function er(e, t = me, r) {
   };
   return o._n = !0, o._c = !0, o._d = !0, o;
 }
-function Sf(e, t) {
+function Af(e, t) {
   if (me === null)
     return e;
   const r = uo(me), o = e.dirs || (e.dirs = []);
@@ -1329,22 +1314,22 @@ function xt(e, t, r, o) {
     ]), ft());
   }
 }
-const zl = Symbol("_vte"), Hl = (e) => e.__isTeleport, Bl = Symbol("_leaveCb");
+const Hl = Symbol("_vte"), Bl = (e) => e.__isTeleport, Ul = Symbol("_leaveCb");
 function en(e, t) {
   e.shapeFlag & 6 && e.component ? (e.transition = t, en(e.component.subTree, t)) : e.shapeFlag & 128 ? (e.ssContent.transition = t.clone(e.ssContent), e.ssFallback.transition = t.clone(e.ssFallback)) : e.transition = t;
 }
 // @__NO_SIDE_EFFECTS__
-function Pt(e, t) {
+function Tt(e, t) {
   return z(e) ? (
     // #8236: extend call and options.name access are considered side-effects
     // by Rollup, so we have to wrap it in a pure-annotated IIFE.
     ce({ name: e.name }, t, { setup: e })
   ) : e;
 }
-function Ui(e) {
+function $i(e) {
   e.ids = [e.ids[0] + e.ids[2]++ + "-", 0, 0];
 }
-function Af(e) {
+function Rf(e) {
   const t = pt(), r = ct(null);
   if (t) {
     const n = t.refs === K ? t.refs = {} : t.refs;
@@ -1374,7 +1359,7 @@ function ir(e, t, r, o, n = !1) {
     o.shapeFlag & 512 && o.type.__asyncResolved && o.component.subTree.component && ir(e, t, r, o.component.subTree);
     return;
   }
-  const i = o.shapeFlag & 4 ? uo(o.component) : o.el, s = n ? null : i, { i: l, r: a } = e, u = t && t.r, c = l.refs === K ? l.refs = {} : l.refs, d = l.setupState, m = W(d), g = d === K ? ai : (x) => G(m, x);
+  const i = o.shapeFlag & 4 ? uo(o.component) : o.el, s = n ? null : i, { i: l, r: a } = e, u = t && t.r, c = l.refs === K ? l.refs = {} : l.refs, d = l.setupState, m = W(d), g = d === K ? ci : (x) => G(m, x);
   if (u != null && u !== a) {
     if (vn(t), le(u))
       c[u] = null, g(u) && (d[u] = null);
@@ -1393,7 +1378,7 @@ function ir(e, t, r, o, n = !1) {
         if (e.f) {
           const S = x ? g(a) ? d[a] : c[a] : a.value;
           if (n)
-            F(S) && Wo(S, i);
+            F(S) && Ko(S, i);
           else if (F(S))
             S.includes(i) || S.push(i);
           else if (x)
@@ -1420,14 +1405,14 @@ function vn(e) {
 }
 Jr().requestIdleCallback;
 Jr().cancelIdleCallback;
-const Ht = (e) => !!e.type.__asyncLoader, $i = (e) => e.type.__isKeepAlive;
-function Ul(e, t) {
-  Ki(e, "a", t);
-}
+const Ht = (e) => !!e.type.__asyncLoader, Ki = (e) => e.type.__isKeepAlive;
 function $l(e, t) {
-  Ki(e, "da", t);
+  Wi(e, "a", t);
 }
-function Ki(e, t, r = _e) {
+function Kl(e, t) {
+  Wi(e, "da", t);
+}
+function Wi(e, t, r = _e) {
   const o = e.__wdc || (e.__wdc = () => {
     let n = r;
     for (; n; ) {
@@ -1440,10 +1425,10 @@ function Ki(e, t, r = _e) {
   if (io(t, o, r), r) {
     let n = r.parent;
     for (; n && n.parent; )
-      $i(n.parent.vnode) && Kl(o, t, r, n), n = n.parent;
+      Ki(n.parent.vnode) && Wl(o, t, r, n), n = n.parent;
   }
 }
-function Kl(e, t, r, o) {
+function Wl(e, t, r, o) {
   const n = io(
     t,
     e,
@@ -1452,7 +1437,7 @@ function Kl(e, t, r, o) {
     /* prepend */
   );
   so(() => {
-    Wo(o[t], n);
+    Ko(o[t], n);
   }, r);
 }
 function io(e, t, r = _e, o = !1) {
@@ -1467,30 +1452,30 @@ function io(e, t, r = _e, o = !1) {
 }
 const ht = (e) => (t, r = _e) => {
   (!pr || e === "sp") && io(e, (...o) => t(...o), r);
-}, Wl = ht("bm"), wr = ht("m"), Wi = ht(
+}, Gl = ht("bm"), wr = ht("m"), Gi = ht(
   "bu"
-), Gl = ht("u"), ql = ht(
+), ql = ht("u"), Jl = ht(
   "bum"
-), so = ht("um"), Jl = ht(
+), so = ht("um"), Yl = ht(
   "sp"
-), Yl = ht("rtg"), Ql = ht("rtc");
-function Xl(e, t = _e) {
+), Ql = ht("rtg"), Xl = ht("rtc");
+function Zl(e, t = _e) {
   io("ec", e, t);
 }
-const Gi = "components";
+const qi = "components";
 function yn(e, t) {
-  return Ji(Gi, e, !0, t) || e;
+  return Yi(qi, e, !0, t) || e;
 }
-const qi = Symbol.for("v-ndc");
-function Rf(e) {
-  return le(e) ? Ji(Gi, e, !1) || e : e || qi;
+const Ji = Symbol.for("v-ndc");
+function Cf(e) {
+  return le(e) ? Yi(qi, e, !1) || e : e || Ji;
 }
-function Ji(e, t, r = !0, o = !1) {
+function Yi(e, t, r = !0, o = !1) {
   const n = me || _e;
   if (n) {
     const i = n.type;
     {
-      const l = Ba(
+      const l = Ua(
         i,
         !1
       );
@@ -1509,7 +1494,7 @@ function Ji(e, t, r = !0, o = !1) {
 function bn(e, t) {
   return e && (e[t] || e[xe(t)] || e[qr(xe(t))]);
 }
-function Zl(e, t, r, o) {
+function ea(e, t, r, o) {
   let n;
   const i = r, s = F(e);
   if (s || le(e)) {
@@ -1545,7 +1530,7 @@ function Zl(e, t, r, o) {
     n = [];
   return n;
 }
-function Yi(e, t, r = {}, o, n) {
+function Qi(e, t, r = {}, o, n) {
   if (me.ce || me.parent && Ht(me.parent) && me.parent.ce) {
     const u = Object.keys(r).length > 0;
     return t !== "default" && (r.name = t), je(), Ut(
@@ -1557,7 +1542,7 @@ function Yi(e, t, r = {}, o, n) {
   }
   let i = e[t];
   i && i._c && (i._d = !1), je();
-  const s = i && Qi(i(r)), l = r.key || // slot content array of a dynamic conditional slot may have a branch
+  const s = i && Xi(i(r)), l = r.key || // slot content array of a dynamic conditional slot may have a branch
   // key attached in the `createSlots` helper, respect that
   s && s.key, a = Ut(
     Ce,
@@ -1570,10 +1555,10 @@ function Yi(e, t, r = {}, o, n) {
   );
   return !n && a.scopeId && (a.slotScopeIds = [a.scopeId + "-s"]), i && i._c && (i._d = !0), a;
 }
-function Qi(e) {
-  return e.some((t) => hr(t) ? !(t.type === dt || t.type === Ce && !Qi(t.children)) : !0) ? e : null;
+function Xi(e) {
+  return e.some((t) => hr(t) ? !(t.type === dt || t.type === Ce && !Xi(t.children)) : !0) ? e : null;
 }
-const No = (e) => e ? bs(e) ? uo(e) : No(e.parent) : null, sr = (
+const Oo = (e) => e ? ws(e) ? uo(e) : Oo(e.parent) : null, sr = (
   // Move PURE marker to new line to workaround compiler discarding it
   // due to type annotation
   /* @__PURE__ */ ce(/* @__PURE__ */ Object.create(null), {
@@ -1584,18 +1569,18 @@ const No = (e) => e ? bs(e) ? uo(e) : No(e.parent) : null, sr = (
     $attrs: (e) => e.attrs,
     $slots: (e) => e.slots,
     $refs: (e) => e.refs,
-    $parent: (e) => No(e.parent),
-    $root: (e) => No(e.root),
+    $parent: (e) => Oo(e.parent),
+    $root: (e) => Oo(e.root),
     $host: (e) => e.ce,
     $emit: (e) => e.emit,
-    $options: (e) => Zi(e),
+    $options: (e) => es(e),
     $forceUpdate: (e) => e.f || (e.f = () => {
       Zo(e.update);
     }),
     $nextTick: (e) => e.n || (e.n = br.bind(e.proxy)),
-    $watch: (e) => ka.bind(e)
+    $watch: (e) => Ea.bind(e)
   })
-), yo = (e, t) => e !== K && !e.__isScriptSetup && G(e, t), ea = {
+), yo = (e, t) => e !== K && !e.__isScriptSetup && G(e, t), ta = {
   get({ _: e }, t) {
     if (t === "__v_skip")
       return !0;
@@ -1627,7 +1612,7 @@ const No = (e) => e ? bs(e) ? uo(e) : No(e.parent) : null, sr = (
           return s[t] = 3, i[t];
         if (r !== K && G(r, t))
           return s[t] = 4, r[t];
-        Io && (s[t] = 0);
+        No && (s[t] = 0);
       }
     }
     const c = sr[t];
@@ -1661,12 +1646,12 @@ const No = (e) => e ? bs(e) ? uo(e) : No(e.parent) : null, sr = (
     return r.get != null ? e._.accessCache[t] = 0 : G(r, "value") && this.set(e, t, r.value, null), Reflect.defineProperty(e, t, r);
   }
 };
-function Cf() {
-  return ta().slots;
+function Pf() {
+  return ra().slots;
 }
-function ta(e) {
+function ra(e) {
   const t = pt();
-  return t.setupContext || (t.setupContext = _s(t));
+  return t.setupContext || (t.setupContext = xs(t));
 }
 function Vr(e) {
   return F(e) ? e.reduce(
@@ -1677,10 +1662,10 @@ function Vr(e) {
 function Tf(e, t) {
   return !e || !t ? e || t : F(e) && F(t) ? e.concat(t) : ce({}, Vr(e), Vr(t));
 }
-let Io = !0;
-function ra(e) {
-  const t = Zi(e), r = e.proxy, o = e.ctx;
-  Io = !1, t.beforeCreate && wn(t.beforeCreate, e, "bc");
+let No = !0;
+function oa(e) {
+  const t = es(e), r = e.proxy, o = e.ctx;
+  No = !1, t.beforeCreate && wn(t.beforeCreate, e, "bc");
   const {
     // state
     data: n,
@@ -1714,7 +1699,7 @@ function ra(e) {
     directives: pe,
     filters: H
   } = t;
-  if (u && oa(u, o, null), s)
+  if (u && na(u, o, null), s)
     for (const X in s) {
       const Y = s[X];
       z(Y) && (o[X] = Y.bind(r));
@@ -1723,7 +1708,7 @@ function ra(e) {
     const X = n.call(r, r);
     Z(X) && (e.data = to(X));
   }
-  if (Io = !0, i)
+  if (No = !0, i)
     for (const X in i) {
       const Y = i[X], rt = z(Y) ? Y.bind(r, r) : z(Y.get) ? Y.get.bind(r, r) : Be, gt = !z(Y) && z(Y.set) ? Y.set.bind(r) : Be, Ge = oe({
         get: rt,
@@ -1733,12 +1718,12 @@ function ra(e) {
         enumerable: !0,
         configurable: !0,
         get: () => Ge.value,
-        set: (Te) => Ge.value = Te
+        set: (Pe) => Ge.value = Pe
       });
     }
   if (l)
     for (const X in l)
-      Xi(l[X], o, r, X);
+      Zi(l[X], o, r, X);
   if (a) {
     const X = z(a) ? a.call(r) : a;
     Reflect.ownKeys(X).forEach((Y) => {
@@ -1749,7 +1734,7 @@ function ra(e) {
   function J(X, Y) {
     F(Y) ? Y.forEach((rt) => X(rt.bind(r))) : Y && X(Y.bind(r));
   }
-  if (J(Wl, d), J(wr, m), J(Wi, g), J(Gl, x), J(Ul, k), J($l, M), J(Xl, ve), J(Ql, ne), J(Yl, q), J(ql, O), J(so, R), J(Jl, ke), F(he))
+  if (J(Gl, d), J(wr, m), J(Gi, g), J(ql, x), J($l, k), J(Kl, M), J(Zl, ve), J(Xl, ne), J(Ql, q), J(Jl, O), J(so, R), J(Yl, ke), F(he))
     if (he.length) {
       const X = e.exposed || (e.exposed = {});
       he.forEach((Y) => {
@@ -1760,10 +1745,10 @@ function ra(e) {
         });
       });
     } else e.exposed || (e.exposed = {});
-  B && e.render === Be && (e.render = B), ye != null && (e.inheritAttrs = ye), fe && (e.components = fe), pe && (e.directives = pe), ke && Ui(e);
+  B && e.render === Be && (e.render = B), ye != null && (e.inheritAttrs = ye), fe && (e.components = fe), pe && (e.directives = pe), ke && $i(e);
 }
-function oa(e, t, r = Be) {
-  F(e) && (e = Mo(e));
+function na(e, t, r = Be) {
+  F(e) && (e = Io(e));
   for (const o in e) {
     const n = e[o];
     let i;
@@ -1786,8 +1771,8 @@ function wn(e, t, r) {
     r
   );
 }
-function Xi(e, t, r, o) {
-  let n = o.includes(".") ? ds(r, o) : () => r[o];
+function Zi(e, t, r, o) {
+  let n = o.includes(".") ? hs(r, o) : () => r[o];
   if (le(e)) {
     const i = t[e];
     z(i) && $e(n, i);
@@ -1795,13 +1780,13 @@ function Xi(e, t, r, o) {
     $e(n, e.bind(r));
   else if (Z(e))
     if (F(e))
-      e.forEach((i) => Xi(i, t, r, o));
+      e.forEach((i) => Zi(i, t, r, o));
     else {
       const i = z(e.handler) ? e.handler.bind(r) : t[e.handler];
       z(i) && $e(n, i, e);
     }
 }
-function Zi(e) {
+function es(e) {
   const t = e.type, { mixins: r, extends: o } = t, {
     mixins: n,
     optionsCache: i,
@@ -1819,12 +1804,12 @@ function jr(e, t, r, o = !1) {
   );
   for (const s in t)
     if (!(o && s === "expose")) {
-      const l = na[s] || r && r[s];
+      const l = ia[s] || r && r[s];
       e[s] = l ? l(e[s], t[s]) : t[s];
     }
   return e;
 }
-const na = {
+const ia = {
   data: _n,
   props: xn,
   emits: xn,
@@ -1850,10 +1835,10 @@ const na = {
   components: tr,
   directives: tr,
   // watch
-  watch: sa,
+  watch: la,
   // provide / inject
   provide: _n,
-  inject: ia
+  inject: sa
 };
 function _n(e, t) {
   return t ? e ? function() {
@@ -1863,10 +1848,10 @@ function _n(e, t) {
     );
   } : t : e;
 }
-function ia(e, t) {
-  return tr(Mo(e), Mo(t));
+function sa(e, t) {
+  return tr(Io(e), Io(t));
 }
-function Mo(e) {
+function Io(e) {
   if (F(e)) {
     const t = {};
     for (let r = 0; r < e.length; r++)
@@ -1888,7 +1873,7 @@ function xn(e, t) {
     Vr(t ?? {})
   ) : t;
 }
-function sa(e, t) {
+function la(e, t) {
   if (!e) return t;
   if (!t) return e;
   const r = ce(/* @__PURE__ */ Object.create(null), e);
@@ -1896,11 +1881,11 @@ function sa(e, t) {
     r[o] = Ee(e[o], t[o]);
   return r;
 }
-function es() {
+function ts() {
   return {
     app: null,
     config: {
-      isNativeTag: ai,
+      isNativeTag: ci,
       performance: !1,
       globalProperties: {},
       optionMergeStrategies: {},
@@ -1917,20 +1902,20 @@ function es() {
     emitsCache: /* @__PURE__ */ new WeakMap()
   };
 }
-let la = 0;
-function aa(e, t) {
+let aa = 0;
+function ca(e, t) {
   return function(o, n = null) {
     z(o) || (o = ce({}, o)), n != null && !Z(n) && (n = null);
-    const i = es(), s = /* @__PURE__ */ new WeakSet(), l = [];
+    const i = ts(), s = /* @__PURE__ */ new WeakSet(), l = [];
     let a = !1;
     const u = i.app = {
-      _uid: la++,
+      _uid: aa++,
       _component: o,
       _props: n,
       _container: null,
       _context: i,
       _instance: null,
-      version: $a,
+      version: Ka,
       get config() {
         return i.config;
       },
@@ -1998,18 +1983,18 @@ function Ie(e, t, r = !1) {
       return r && z(t) ? t.call(o && o.proxy) : t;
   }
 }
-function ts() {
+function rs() {
   return !!(pt() || Ct);
 }
-const rs = {}, os = () => Object.create(rs), ns = (e) => Object.getPrototypeOf(e) === rs;
-function ca(e, t, r, o = !1) {
-  const n = {}, i = os();
-  e.propsDefaults = /* @__PURE__ */ Object.create(null), is(e, t, n, i);
+const os = {}, ns = () => Object.create(os), is = (e) => Object.getPrototypeOf(e) === os;
+function ua(e, t, r, o = !1) {
+  const n = {}, i = ns();
+  e.propsDefaults = /* @__PURE__ */ Object.create(null), ss(e, t, n, i);
   for (const s in e.propsOptions[0])
     s in n || (n[s] = void 0);
-  r ? e.props = o ? n : Ii(n) : e.type.props ? e.props = n : e.props = i, e.attrs = i;
+  r ? e.props = o ? n : Mi(n) : e.type.props ? e.props = n : e.props = i, e.attrs = i;
 }
-function ua(e, t, r, o) {
+function fa(e, t, r, o) {
   const {
     props: n,
     attrs: i,
@@ -2034,7 +2019,7 @@ function ua(e, t, r, o) {
             g !== i[m] && (i[m] = g, u = !0);
           else {
             const x = xe(m);
-            n[x] = Do(
+            n[x] = Mo(
               a,
               l,
               x,
@@ -2048,7 +2033,7 @@ function ua(e, t, r, o) {
       }
     }
   } else {
-    is(e, t, n, i) && (u = !0);
+    ss(e, t, n, i) && (u = !0);
     let c;
     for (const d in l)
       (!t || // for camelCase
@@ -2056,7 +2041,7 @@ function ua(e, t, r, o) {
       // and converted to camelCase (#955)
       ((c = Fe(d)) === d || !G(t, c))) && (a ? r && // for camelCase
       (r[d] !== void 0 || // for kebab-case
-      r[c] !== void 0) && (n[d] = Do(
+      r[c] !== void 0) && (n[d] = Mo(
         a,
         l,
         d,
@@ -2070,7 +2055,7 @@ function ua(e, t, r, o) {
   }
   u && st(e.attrs, "set", "");
 }
-function is(e, t, r, o) {
+function ss(e, t, r, o) {
   const [n, i] = e.propsOptions;
   let s = !1, l;
   if (t)
@@ -2085,7 +2070,7 @@ function is(e, t, r, o) {
     const a = W(r), u = l || K;
     for (let c = 0; c < i.length; c++) {
       const d = i[c];
-      r[d] = Do(
+      r[d] = Mo(
         n,
         a,
         d,
@@ -2097,7 +2082,7 @@ function is(e, t, r, o) {
   }
   return s;
 }
-function Do(e, t, r, o, n, i) {
+function Mo(e, t, r, o, n, i) {
   const s = e[r];
   if (s != null) {
     const l = G(s, "default");
@@ -2128,9 +2113,9 @@ function Do(e, t, r, o, n, i) {
   }
   return o;
 }
-const fa = /* @__PURE__ */ new WeakMap();
-function ss(e, t, r = !1) {
-  const o = r ? fa : t.propsCache, n = o.get(e);
+const da = /* @__PURE__ */ new WeakMap();
+function ls(e, t, r = !1) {
+  const o = r ? da : t.propsCache, n = o.get(e);
   if (n)
     return n;
   const i = e.props, s = {}, l = [];
@@ -2138,7 +2123,7 @@ function ss(e, t, r = !1) {
   if (!z(e)) {
     const c = (d) => {
       a = !0;
-      const [m, g] = ss(d, t, !0);
+      const [m, g] = ls(d, t, !0);
       ce(s, m), g && l.push(...g);
     };
     !r && t.mixins.length && t.mixins.forEach(c), e.extends && c(e.extends), e.mixins && e.mixins.forEach(c);
@@ -2181,50 +2166,50 @@ function ss(e, t, r = !1) {
 function kn(e) {
   return e[0] !== "$" && !rr(e);
 }
-const tn = (e) => e === "_" || e === "_ctx" || e === "$stable", rn = (e) => F(e) ? e.map(Ze) : [Ze(e)], da = (e, t, r) => {
+const tn = (e) => e === "_" || e === "_ctx" || e === "$stable", rn = (e) => F(e) ? e.map(Ze) : [Ze(e)], ha = (e, t, r) => {
   if (t._n)
     return t;
   const o = er((...n) => rn(t(...n)), r);
   return o._c = !1, o;
-}, ls = (e, t, r) => {
+}, as = (e, t, r) => {
   const o = e._ctx;
   for (const n in e) {
     if (tn(n)) continue;
     const i = e[n];
     if (z(i))
-      t[n] = da(n, i, o);
+      t[n] = ha(n, i, o);
     else if (i != null) {
       const s = rn(i);
       t[n] = () => s;
     }
   }
-}, as = (e, t) => {
+}, cs = (e, t) => {
   const r = rn(t);
   e.slots.default = () => r;
-}, cs = (e, t, r) => {
+}, us = (e, t, r) => {
   for (const o in t)
     (r || !tn(o)) && (e[o] = t[o]);
-}, ha = (e, t, r) => {
-  const o = e.slots = os();
+}, pa = (e, t, r) => {
+  const o = e.slots = ns();
   if (e.vnode.shapeFlag & 32) {
     const n = t._;
-    n ? (cs(o, t, r), r && fi(o, "_", n, !0)) : ls(t, o);
-  } else t && as(e, t);
-}, pa = (e, t, r) => {
+    n ? (us(o, t, r), r && di(o, "_", n, !0)) : as(t, o);
+  } else t && cs(e, t);
+}, ga = (e, t, r) => {
   const { vnode: o, slots: n } = e;
   let i = !0, s = K;
   if (o.shapeFlag & 32) {
     const l = t._;
-    l ? r && l === 1 ? i = !1 : cs(n, t, r) : (i = !t.$stable, ls(t, n)), s = t;
-  } else t && (as(e, t), s = { default: 1 });
+    l ? r && l === 1 ? i = !1 : us(n, t, r) : (i = !t.$stable, as(t, n)), s = t;
+  } else t && (cs(e, t), s = { default: 1 });
   if (i)
     for (const l in n)
       !tn(l) && s[l] == null && delete n[l];
-}, De = Oa;
-function ga(e) {
-  return ma(e);
+}, De = Na;
+function ma(e) {
+  return va(e);
 }
-function ma(e, t) {
+function va(e, t) {
   const r = Jr();
   r.__VUE__ = !0;
   const {
@@ -2243,8 +2228,8 @@ function ma(e, t) {
   } = e, k = (f, h, p, y = null, w = null, v = null, C = void 0, A = null, E = !!h.dynamicChildren) => {
     if (f === h)
       return;
-    f && !Xt(f, h) && (y = b(f), Te(f, w, v, !0), f = null), h.patchFlag === -2 && (E = !1, h.dynamicChildren = null);
-    const { type: _, ref: j, shapeFlag: P } = h;
+    f && !Xt(f, h) && (y = b(f), Pe(f, w, v, !0), f = null), h.patchFlag === -2 && (E = !1, h.dynamicChildren = null);
+    const { type: _, ref: j, shapeFlag: T } = h;
     switch (_) {
       case co:
         M(f, h, p, y);
@@ -2269,7 +2254,7 @@ function ma(e, t) {
         );
         break;
       default:
-        P & 1 ? B(
+        T & 1 ? B(
           f,
           h,
           p,
@@ -2279,7 +2264,7 @@ function ma(e, t) {
           C,
           A,
           E
-        ) : P & 6 ? pe(
+        ) : T & 6 ? pe(
           f,
           h,
           p,
@@ -2289,7 +2274,7 @@ function ma(e, t) {
           C,
           A,
           E
-        ) : (P & 64 || P & 128) && _.process(
+        ) : (T & 64 || T & 128) && _.process(
           f,
           h,
           p,
@@ -2340,33 +2325,42 @@ function ma(e, t) {
       p = m(f), n(f), f = p;
     n(h);
   }, B = (f, h, p, y, w, v, C, A, E) => {
-    h.type === "svg" ? C = "svg" : h.type === "math" && (C = "mathml"), f == null ? ne(
-      h,
-      p,
-      y,
-      w,
-      v,
-      C,
-      A,
-      E
-    ) : ke(
-      f,
-      h,
-      w,
-      v,
-      C,
-      A,
-      E
-    );
+    if (h.type === "svg" ? C = "svg" : h.type === "math" && (C = "mathml"), f == null)
+      ne(
+        h,
+        p,
+        y,
+        w,
+        v,
+        C,
+        A,
+        E
+      );
+    else {
+      const _ = f.el && f.el._isVueCE ? f.el : null;
+      try {
+        _ && _._beginPatch(), ke(
+          f,
+          h,
+          w,
+          v,
+          C,
+          A,
+          E
+        );
+      } finally {
+        _ && _._endPatch();
+      }
+    }
   }, ne = (f, h, p, y, w, v, C, A) => {
     let E, _;
-    const { props: j, shapeFlag: P, transition: V, dirs: L } = f;
+    const { props: j, shapeFlag: T, transition: V, dirs: L } = f;
     if (E = f.el = s(
       f.type,
       v,
       j && j.is,
       j
-    ), P & 8 ? c(E, f.children) : P & 16 && ve(
+    ), T & 8 ? c(E, f.children) : T & 16 && ve(
       f.children,
       E,
       null,
@@ -2381,7 +2375,7 @@ function ma(e, t) {
       "value" in j && i(E, "value", null, j.value, v), (_ = j.onVnodeBeforeMount) && Qe(_, y, f);
     }
     L && xt(f, null, y, "beforeMount");
-    const $ = va(w, V);
+    const $ = ya(w, V);
     $ && V.beforeEnter(E), o(E, h, p), ((_ = j && j.onVnodeMounted) || $ || L) && De(() => {
       _ && Qe(_, y, f), $ && V.enter(E), L && xt(f, null, y, "mounted");
     }, w);
@@ -2391,7 +2385,7 @@ function ma(e, t) {
         g(f, y[v]);
     if (w) {
       let v = w.subTree;
-      if (h === v || gs(v.type) && (v.ssContent === h || v.ssFallback === h)) {
+      if (h === v || ms(v.type) && (v.ssContent === h || v.ssFallback === h)) {
         const C = w.vnode;
         q(
           f,
@@ -2421,9 +2415,9 @@ function ma(e, t) {
     const A = h.el = f.el;
     let { patchFlag: E, dynamicChildren: _, dirs: j } = h;
     E |= f.patchFlag & 16;
-    const P = f.props || K, V = h.props || K;
+    const T = f.props || K, V = h.props || K;
     let L;
-    if (p && kt(p, !1), (L = V.onVnodeBeforeUpdate) && Qe(L, p, h, f), j && xt(h, f, p, "beforeUpdate"), p && kt(p, !0), (P.innerHTML && V.innerHTML == null || P.textContent && V.textContent == null) && c(A, ""), _ ? he(
+    if (p && kt(p, !1), (L = V.onVnodeBeforeUpdate) && Qe(L, p, h, f), j && xt(h, f, p, "beforeUpdate"), p && kt(p, !0), (T.innerHTML && V.innerHTML == null || T.textContent && V.textContent == null) && c(A, ""), _ ? he(
       f.dynamicChildren,
       _,
       A,
@@ -2443,16 +2437,16 @@ function ma(e, t) {
       !1
     ), E > 0) {
       if (E & 16)
-        ye(A, P, V, p, w);
-      else if (E & 2 && P.class !== V.class && i(A, "class", null, V.class, w), E & 4 && i(A, "style", P.style, V.style, w), E & 8) {
+        ye(A, T, V, p, w);
+      else if (E & 2 && T.class !== V.class && i(A, "class", null, V.class, w), E & 4 && i(A, "style", T.style, V.style, w), E & 8) {
         const $ = h.dynamicProps;
         for (let ee = 0; ee < $.length; ee++) {
-          const Q = $[ee], Pe = P[Q], Oe = V[Q];
-          (Oe !== Pe || Q === "value") && i(A, Q, Pe, Oe, w, p);
+          const Q = $[ee], Te = T[Q], Oe = V[Q];
+          (Oe !== Te || Q === "value") && i(A, Q, Te, Oe, w, p);
         }
       }
       E & 1 && f.children !== h.children && c(A, h.children);
-    } else !C && _ == null && ye(A, P, V, p, w);
+    } else !C && _ == null && ye(A, T, V, p, w);
     ((L = V.onVnodeUpdated) || j) && De(() => {
       L && Qe(L, p, h, f), j && xt(h, f, p, "updated");
     }, y);
@@ -2505,7 +2499,7 @@ function ma(e, t) {
     }
   }, fe = (f, h, p, y, w, v, C, A, E) => {
     const _ = h.el = f ? f.el : l(""), j = h.anchor = f ? f.anchor : l("");
-    let { patchFlag: P, dynamicChildren: V, slotScopeIds: L } = h;
+    let { patchFlag: T, dynamicChildren: V, slotScopeIds: L } = h;
     L && (A = A ? A.concat(L) : L), f == null ? (o(_, p, y), o(j, p, y), ve(
       // #10007
       // such fragment like `<></>` will be compiled into
@@ -2519,7 +2513,7 @@ function ma(e, t) {
       C,
       A,
       E
-    )) : P > 0 && P & 64 && V && // #2715 the previous fragment could've been a BAILed one as a result
+    )) : T > 0 && T & 64 && V && // #2715 the previous fragment could've been a BAILed one as a result
     // of renderSlot() with no valid children
     f.dynamicChildren ? (he(
       f.dynamicChildren,
@@ -2533,7 +2527,7 @@ function ma(e, t) {
     //  get moved around. Make sure all root level vnodes inherit el.
     // #2134 or if it's a component root, it may also get moved around
     // as the component is being moved.
-    (h.key != null || w && h === w.subTree) && us(
+    (h.key != null || w && h === w.subTree) && fs(
       f,
       h,
       !0
@@ -2566,12 +2560,12 @@ function ma(e, t) {
       E
     ) : ie(f, h, E);
   }, H = (f, h, p, y, w, v, C) => {
-    const A = f.component = ja(
+    const A = f.component = La(
       f,
       y,
       w
     );
-    if ($i(f) && (A.ctx.renderer = D), La(A, !1, C), A.asyncDep) {
+    if (Ki(f) && (A.ctx.renderer = D), za(A, !1, C), A.asyncDep) {
       if (w && w.registerDep(A, J, C), !f.el) {
         const E = A.subTree = ae(dt);
         S(null, E, h, p), f.placeholder = E.el;
@@ -2599,18 +2593,18 @@ function ma(e, t) {
   }, J = (f, h, p, y, w, v, C) => {
     const A = () => {
       if (f.isMounted) {
-        let { next: P, bu: V, u: L, parent: $, vnode: ee } = f;
+        let { next: T, bu: V, u: L, parent: $, vnode: ee } = f;
         {
-          const Je = fs(f);
+          const Je = ds(f);
           if (Je) {
-            P && (P.el = ee.el, X(f, P, C)), Je.asyncDep.then(() => {
+            T && (T.el = ee.el, X(f, T, C)), Je.asyncDep.then(() => {
               f.isUnmounted || A();
             });
             return;
           }
         }
-        let Q = P, Pe;
-        kt(f, !1), P ? (P.el = ee.el, X(f, P, C)) : P = ee, V && Rr(V), (Pe = P.props && P.props.onVnodeBeforeUpdate) && Qe(Pe, $, P, ee), kt(f, !0);
+        let Q = T, Te;
+        kt(f, !1), T ? (T.el = ee.el, X(f, T, C)) : T = ee, V && Rr(V), (Te = T.props && T.props.onVnodeBeforeUpdate) && Qe(Te, $, T, ee), kt(f, !0);
         const Oe = Sn(f), qe = f.subTree;
         f.subTree = Oe, k(
           qe,
@@ -2622,17 +2616,17 @@ function ma(e, t) {
           f,
           w,
           v
-        ), P.el = Oe.el, Q === null && Pa(f, Oe.el), L && De(L, w), (Pe = P.props && P.props.onVnodeUpdated) && De(
-          () => Qe(Pe, $, P, ee),
+        ), T.el = Oe.el, Q === null && Oa(f, Oe.el), L && De(L, w), (Te = T.props && T.props.onVnodeUpdated) && De(
+          () => Qe(Te, $, T, ee),
           w
         );
       } else {
-        let P;
-        const { el: V, props: L } = h, { bm: $, m: ee, parent: Q, root: Pe, type: Oe } = f, qe = Ht(h);
-        kt(f, !1), $ && Rr($), !qe && (P = L && L.onVnodeBeforeMount) && Qe(P, Q, h), kt(f, !0);
+        let T;
+        const { el: V, props: L } = h, { bm: $, m: ee, parent: Q, root: Te, type: Oe } = f, qe = Ht(h);
+        kt(f, !1), $ && Rr($), !qe && (T = L && L.onVnodeBeforeMount) && Qe(T, Q, h), kt(f, !0);
         {
-          Pe.ce && // @ts-expect-error _def is private
-          Pe.ce._def.shadowRoot !== !1 && Pe.ce._injectChildStyle(Oe);
+          Te.ce && // @ts-expect-error _def is private
+          Te.ce._def.shadowRoot !== !1 && Te.ce._injectChildStyle(Oe);
           const Je = f.subTree = Sn(f);
           k(
             null,
@@ -2644,10 +2638,10 @@ function ma(e, t) {
             v
           ), h.el = Je.el;
         }
-        if (ee && De(ee, w), !qe && (P = L && L.onVnodeMounted)) {
+        if (ee && De(ee, w), !qe && (T = L && L.onVnodeMounted)) {
           const Je = h;
           De(
-            () => Qe(P, Q, Je),
+            () => Qe(T, Q, Je),
             w
           );
         }
@@ -2655,21 +2649,21 @@ function ma(e, t) {
       }
     };
     f.scope.on();
-    const E = f.effect = new vi(A);
+    const E = f.effect = new yi(A);
     f.scope.off();
     const _ = f.update = E.run.bind(E), j = f.job = E.runIfDirty.bind(E);
     j.i = f, j.id = f.uid, E.scheduler = () => Zo(j), kt(f, !0), _();
   }, X = (f, h, p) => {
     h.component = f;
     const y = f.vnode.props;
-    f.vnode = h, f.next = null, ua(f, h.props, y, p), pa(f, h.children, p), ut(), mn(f), ft();
+    f.vnode = h, f.next = null, fa(f, h.props, y, p), ga(f, h.children, p), ut(), mn(f), ft();
   }, Y = (f, h, p, y, w, v, C, A, E = !1) => {
-    const _ = f && f.children, j = f ? f.shapeFlag : 0, P = h.children, { patchFlag: V, shapeFlag: L } = h;
+    const _ = f && f.children, j = f ? f.shapeFlag : 0, T = h.children, { patchFlag: V, shapeFlag: L } = h;
     if (V > 0) {
       if (V & 128) {
         gt(
           _,
-          P,
+          T,
           p,
           y,
           w,
@@ -2682,7 +2676,7 @@ function ma(e, t) {
       } else if (V & 256) {
         rt(
           _,
-          P,
+          T,
           p,
           y,
           w,
@@ -2694,9 +2688,9 @@ function ma(e, t) {
         return;
       }
     }
-    L & 8 ? (j & 16 && Le(_, w, v), P !== _ && c(p, P)) : j & 16 ? L & 16 ? gt(
+    L & 8 ? (j & 16 && Le(_, w, v), T !== _ && c(p, T)) : j & 16 ? L & 16 ? gt(
       _,
-      P,
+      T,
       p,
       y,
       w,
@@ -2705,7 +2699,7 @@ function ma(e, t) {
       A,
       E
     ) : Le(_, w, v, !0) : (j & 8 && c(p, ""), L & 16 && ve(
-      P,
+      T,
       p,
       y,
       w,
@@ -2716,9 +2710,9 @@ function ma(e, t) {
     ));
   }, rt = (f, h, p, y, w, v, C, A, E) => {
     f = f || Vt, h = h || Vt;
-    const _ = f.length, j = h.length, P = Math.min(_, j);
+    const _ = f.length, j = h.length, T = Math.min(_, j);
     let V;
-    for (V = 0; V < P; V++) {
+    for (V = 0; V < T; V++) {
       const L = h[V] = E ? yt(h[V]) : Ze(h[V]);
       k(
         f[V],
@@ -2738,7 +2732,7 @@ function ma(e, t) {
       v,
       !0,
       !1,
-      P
+      T
     ) : ve(
       h,
       p,
@@ -2748,13 +2742,13 @@ function ma(e, t) {
       C,
       A,
       E,
-      P
+      T
     );
   }, gt = (f, h, p, y, w, v, C, A, E) => {
     let _ = 0;
     const j = h.length;
-    let P = f.length - 1, V = j - 1;
-    for (; _ <= P && _ <= V; ) {
+    let T = f.length - 1, V = j - 1;
+    for (; _ <= T && _ <= V; ) {
       const L = f[_], $ = h[_] = E ? yt(h[_]) : Ze(h[_]);
       if (Xt(L, $))
         k(
@@ -2772,8 +2766,8 @@ function ma(e, t) {
         break;
       _++;
     }
-    for (; _ <= P && _ <= V; ) {
-      const L = f[P], $ = h[V] = E ? yt(h[V]) : Ze(h[V]);
+    for (; _ <= T && _ <= V; ) {
+      const L = f[T], $ = h[V] = E ? yt(h[V]) : Ze(h[V]);
       if (Xt(L, $))
         k(
           L,
@@ -2788,9 +2782,9 @@ function ma(e, t) {
         );
       else
         break;
-      P--, V--;
+      T--, V--;
     }
-    if (_ > P) {
+    if (_ > T) {
       if (_ <= V) {
         const L = V + 1, $ = L < j ? h[L].el : y;
         for (; _ <= V; )
@@ -2807,23 +2801,23 @@ function ma(e, t) {
           ), _++;
       }
     } else if (_ > V)
-      for (; _ <= P; )
-        Te(f[_], w, v, !0), _++;
+      for (; _ <= T; )
+        Pe(f[_], w, v, !0), _++;
     else {
       const L = _, $ = _, ee = /* @__PURE__ */ new Map();
       for (_ = $; _ <= V; _++) {
         const Me = h[_] = E ? yt(h[_]) : Ze(h[_]);
         Me.key != null && ee.set(Me.key, _);
       }
-      let Q, Pe = 0;
+      let Q, Te = 0;
       const Oe = V - $ + 1;
       let qe = !1, Je = 0;
       const Yt = new Array(Oe);
       for (_ = 0; _ < Oe; _++) Yt[_] = 0;
-      for (_ = L; _ <= P; _++) {
+      for (_ = L; _ <= T; _++) {
         const Me = f[_];
-        if (Pe >= Oe) {
-          Te(Me, w, v, !0);
+        if (Te >= Oe) {
+          Pe(Me, w, v, !0);
           continue;
         }
         let Ye;
@@ -2835,7 +2829,7 @@ function ma(e, t) {
               Ye = Q;
               break;
             }
-        Ye === void 0 ? Te(Me, w, v, !0) : (Yt[Ye - $] = _ + 1, Ye >= Je ? Je = Ye : qe = !0, k(
+        Ye === void 0 ? Pe(Me, w, v, !0) : (Yt[Ye - $] = _ + 1, Ye >= Je ? Je = Ye : qe = !0, k(
           Me,
           h[Ye],
           p,
@@ -2845,9 +2839,9 @@ function ma(e, t) {
           C,
           A,
           E
-        ), Pe++);
+        ), Te++);
       }
-      const an = qe ? ya(Yt) : Vt;
+      const an = qe ? ba(Yt) : Vt;
       for (Q = an.length - 1, _ = Oe - 1; _ >= 0; _--) {
         const Me = $ + _, Ye = h[Me], cn = h[Me + 1], un = Me + 1 < j ? (
           // #13559, fallback to el placeholder for unresolved async component
@@ -2882,8 +2876,8 @@ function ma(e, t) {
     }
     if (C === Ce) {
       o(v, h, p);
-      for (let P = 0; P < E.length; P++)
-        Ge(E[P], h, p, y);
+      for (let T = 0; T < E.length; T++)
+        Ge(E[T], h, p, y);
       o(f.anchor, h, p);
       return;
     }
@@ -2895,13 +2889,13 @@ function ma(e, t) {
       if (y === 0)
         A.beforeEnter(v), o(v, h, p), De(() => A.enter(v), w);
       else {
-        const { leave: P, delayLeave: V, afterLeave: L } = A, $ = () => {
+        const { leave: T, delayLeave: V, afterLeave: L } = A, $ = () => {
           f.ctx.isUnmounted ? n(v) : o(v, h, p);
         }, ee = () => {
-          v._isLeaving && v[Bl](
+          v._isLeaving && v[Ul](
             !0
             /* cancelled */
-          ), P(v, () => {
+          ), T(v, () => {
             $(), L && L();
           });
         };
@@ -2909,7 +2903,7 @@ function ma(e, t) {
       }
     else
       o(v, h, p);
-  }, Te = (f, h, p, y = !1, w = !1) => {
+  }, Pe = (f, h, p, y = !1, w = !1) => {
     const {
       type: v,
       props: C,
@@ -2917,11 +2911,11 @@ function ma(e, t) {
       children: E,
       dynamicChildren: _,
       shapeFlag: j,
-      patchFlag: P,
+      patchFlag: T,
       dirs: V,
       cacheIndex: L
     } = f;
-    if (P === -2 && (w = !1), A != null && (ut(), ir(A, null, p, f, !0), ft()), L != null && (h.renderCache[L] = void 0), j & 256) {
+    if (T === -2 && (w = !1), A != null && (ut(), ir(A, null, p, f, !0), ft()), L != null && (h.renderCache[L] = void 0), j & 256) {
       h.ctx.deactivate(f);
       return;
     }
@@ -2946,13 +2940,13 @@ function ma(e, t) {
       // so that it doesn't take the fast path during unmount - otherwise
       // components nested in v-once are never unmounted.
       !_.hasOnce && // #1153: fast path should not be taken for non-stable (v-for) fragments
-      (v !== Ce || P > 0 && P & 64) ? Le(
+      (v !== Ce || T > 0 && T & 64) ? Le(
         _,
         h,
         p,
         !1,
         !0
-      ) : (v === Ce && P & 384 || !w && j & 16) && Le(E, h, p), y && Nt(f);
+      ) : (v === Ce && T & 384 || !w && j & 16) && Le(E, h, p), y && Nt(f);
     }
     (ee && (Q = C && C.onVnodeUnmounted) || $) && De(() => {
       Q && Qe(Q, h, f), $ && xt(f, null, h, "unmounted");
@@ -2982,23 +2976,23 @@ function ma(e, t) {
     n(h);
   }, _t = (f, h, p) => {
     const { bum: y, scope: w, job: v, subTree: C, um: A, m: E, a: _ } = f;
-    En(E), En(_), y && Rr(y), w.stop(), v && (v.flags |= 8, Te(C, f, h, p)), A && De(A, h), De(() => {
+    En(E), En(_), y && Rr(y), w.stop(), v && (v.flags |= 8, Pe(C, f, h, p)), A && De(A, h), De(() => {
       f.isUnmounted = !0;
     }, h);
   }, Le = (f, h, p, y = !1, w = !1, v = 0) => {
     for (let C = v; C < f.length; C++)
-      Te(f[C], h, p, y, w);
+      Pe(f[C], h, p, y, w);
   }, b = (f) => {
     if (f.shapeFlag & 6)
       return b(f.component.subTree);
     if (f.shapeFlag & 128)
       return f.suspense.next();
-    const h = m(f.anchor || f.el), p = h && h[zl];
+    const h = m(f.anchor || f.el), p = h && h[Hl];
     return p ? m(p) : h;
   };
   let I = !1;
-  const T = (f, h, p) => {
-    f == null ? h._vnode && Te(h._vnode, null, null, !0) : k(
+  const P = (f, h, p) => {
+    f == null ? h._vnode && Pe(h._vnode, null, null, !0) : k(
       h._vnode || null,
       f,
       h,
@@ -3006,10 +3000,10 @@ function ma(e, t) {
       null,
       null,
       p
-    ), h._vnode = f, I || (I = !0, mn(), zi(), I = !1);
+    ), h._vnode = f, I || (I = !0, mn(), Hi(), I = !1);
   }, D = {
     p: k,
-    um: Te,
+    um: Pe,
     m: Ge,
     r: Nt,
     mt: H,
@@ -3020,9 +3014,9 @@ function ma(e, t) {
     o: e
   };
   return {
-    render: T,
+    render: P,
     hydrate: void 0,
-    createApp: aa(T)
+    createApp: ca(P)
   };
 }
 function bo({ type: e, props: t }, r) {
@@ -3031,20 +3025,20 @@ function bo({ type: e, props: t }, r) {
 function kt({ effect: e, job: t }, r) {
   r ? (e.flags |= 32, t.flags |= 4) : (e.flags &= -33, t.flags &= -5);
 }
-function va(e, t) {
+function ya(e, t) {
   return (!e || e && !e.pendingBranch) && t && !t.persisted;
 }
-function us(e, t, r = !1) {
+function fs(e, t, r = !1) {
   const o = e.children, n = t.children;
   if (F(o) && F(n))
     for (let i = 0; i < o.length; i++) {
       const s = o[i];
       let l = n[i];
-      l.shapeFlag & 1 && !l.dynamicChildren && ((l.patchFlag <= 0 || l.patchFlag === 32) && (l = n[i] = yt(n[i]), l.el = s.el), !r && l.patchFlag !== -2 && us(s, l)), l.type === co && // avoid cached text nodes retaining detached dom nodes
+      l.shapeFlag & 1 && !l.dynamicChildren && ((l.patchFlag <= 0 || l.patchFlag === 32) && (l = n[i] = yt(n[i]), l.el = s.el), !r && l.patchFlag !== -2 && fs(s, l)), l.type === co && // avoid cached text nodes retaining detached dom nodes
       l.patchFlag !== -1 && (l.el = s.el), l.type === dt && !l.el && (l.el = s.el);
     }
 }
-function ya(e) {
+function ba(e) {
   const t = e.slice(), r = [0];
   let o, n, i, s, l;
   const a = e.length;
@@ -3064,21 +3058,21 @@ function ya(e) {
     r[i] = s, s = t[s];
   return r;
 }
-function fs(e) {
+function ds(e) {
   const t = e.subTree.component;
   if (t)
-    return t.asyncDep && !t.asyncResolved ? t : fs(t);
+    return t.asyncDep && !t.asyncResolved ? t : ds(t);
 }
 function En(e) {
   if (e)
     for (let t = 0; t < e.length; t++)
       e[t].flags |= 8;
 }
-const ba = Symbol.for("v-scx"), wa = () => Ie(ba);
-function _a(e, t) {
+const wa = Symbol.for("v-scx"), _a = () => Ie(wa);
+function xa(e, t) {
   return lo(e, null, t);
 }
-function xa(e, t) {
+function ka(e, t) {
   return lo(
     e,
     null,
@@ -3093,7 +3087,7 @@ function lo(e, t, r = K) {
   let u;
   if (pr) {
     if (i === "sync") {
-      const g = wa();
+      const g = _a();
       u = g.__watcherHandles || (g.__watcherHandles = []);
     } else if (!a) {
       const g = () => {
@@ -3111,17 +3105,17 @@ function lo(e, t, r = K) {
   }), l.augmentJob = (g) => {
     t && (g.flags |= 4), d && (g.flags |= 2, c && (g.id = c.uid, g.i = c));
   };
-  const m = Vl(e, t, l);
+  const m = jl(e, t, l);
   return pr && (u ? u.push(m) : a && m()), m;
 }
-function ka(e, t, r) {
-  const o = this.proxy, n = le(e) ? e.includes(".") ? ds(o, e) : () => o[e] : e.bind(o, o);
+function Ea(e, t, r) {
+  const o = this.proxy, n = le(e) ? e.includes(".") ? hs(o, e) : () => o[e] : e.bind(o, o);
   let i;
   z(t) ? i = t : (i = t.handler, r = t);
   const s = _r(this), l = lo(n, i.bind(o), r);
   return s(), l;
 }
-function ds(e, t) {
+function hs(e, t) {
   const r = t.split(".");
   return () => {
     let o = e;
@@ -3130,10 +3124,10 @@ function ds(e, t) {
     return o;
   };
 }
-function Ea(e, t, r = K) {
-  const o = pt(), n = xe(t), i = Fe(t), s = hs(e, n), l = Fi((a, u) => {
+function Sa(e, t, r = K) {
+  const o = pt(), n = xe(t), i = Fe(t), s = ps(e, n), l = Vi((a, u) => {
     let c, d = K, m;
-    return xa(() => {
+    return ka(() => {
       const g = e[n];
       Ne(c, g) && (c = g, u());
     }), {
@@ -3159,13 +3153,13 @@ function Ea(e, t, r = K) {
     };
   }, l;
 }
-const hs = (e, t) => t === "modelValue" || t === "model-value" ? e.modelModifiers : e[`${t}Modifiers`] || e[`${xe(t)}Modifiers`] || e[`${Fe(t)}Modifiers`];
-function Sa(e, t, ...r) {
+const ps = (e, t) => t === "modelValue" || t === "model-value" ? e.modelModifiers : e[`${t}Modifiers`] || e[`${xe(t)}Modifiers`] || e[`${Fe(t)}Modifiers`];
+function Aa(e, t, ...r) {
   if (e.isUnmounted) return;
   const o = e.vnode.props || K;
   let n = r;
-  const i = t.startsWith("update:"), s = i && hs(o, t.slice(7));
-  s && (s.trim && (n = r.map((c) => le(c) ? c.trim() : c)), s.number && (n = r.map(Co)));
+  const i = t.startsWith("update:"), s = i && ps(o, t.slice(7));
+  s && (s.trim && (n = r.map((c) => le(c) ? c.trim() : c)), s.number && (n = r.map(Go)));
   let l, a = o[l = ho(t)] || // also try camelCase event handler (#2249)
   o[l = ho(xe(t))];
   !a && i && (a = o[l = ho(Fe(t))]), a && tt(
@@ -3188,16 +3182,16 @@ function Sa(e, t, ...r) {
     );
   }
 }
-const Aa = /* @__PURE__ */ new WeakMap();
-function ps(e, t, r = !1) {
-  const o = r ? Aa : t.emitsCache, n = o.get(e);
+const Ra = /* @__PURE__ */ new WeakMap();
+function gs(e, t, r = !1) {
+  const o = r ? Ra : t.emitsCache, n = o.get(e);
   if (n !== void 0)
     return n;
   const i = e.emits;
   let s = {}, l = !1;
   if (!z(e)) {
     const a = (u) => {
-      const c = ps(u, t, !0);
+      const c = gs(u, t, !0);
       c && (l = !0, ce(s, c));
     };
     !r && t.mixins.length && t.mixins.forEach(a), e.extends && a(e.extends), e.mixins && e.mixins.forEach(a);
@@ -3250,7 +3244,7 @@ function Sn(e) {
           d,
           null
         )
-      ), O = t.props ? l : Ra(l);
+      ), O = t.props ? l : Ca(l);
     }
   } catch (R) {
     lr.length = 0, no(R, e, 1), S = ae(dt);
@@ -3258,22 +3252,22 @@ function Sn(e) {
   let N = S;
   if (O && k !== !1) {
     const R = Object.keys(O), { shapeFlag: B } = N;
-    R.length && B & 7 && (i && R.some(Ko) && (O = Ca(
+    R.length && B & 7 && (i && R.some($o) && (O = Pa(
       O,
       i
     )), N = Wt(N, O, !1, !0));
   }
   return r.dirs && (N = Wt(N, null, !1, !0), N.dirs = N.dirs ? N.dirs.concat(r.dirs) : r.dirs), r.transition && en(N, r.transition), S = N, Dr(M), S;
 }
-const Ra = (e) => {
+const Ca = (e) => {
   let t;
   for (const r in e)
     (r === "class" || r === "style" || $r(r)) && ((t || (t = {}))[r] = e[r]);
   return t;
-}, Ca = (e, t) => {
+}, Pa = (e, t) => {
   const r = {};
   for (const o in e)
-    (!Ko(o) || !(o.slice(9) in t)) && (r[o] = e[o]);
+    (!$o(o) || !(o.slice(9) in t)) && (r[o] = e[o]);
   return r;
 };
 function Ta(e, t, r) {
@@ -3308,7 +3302,7 @@ function An(e, t, r) {
   }
   return !1;
 }
-function Pa({ vnode: e, parent: t }, r) {
+function Oa({ vnode: e, parent: t }, r) {
   for (; t; ) {
     const o = t.subTree;
     if (o.suspense && o.suspense.activeBranch === e && (o.el = e.el), o === e)
@@ -3317,27 +3311,27 @@ function Pa({ vnode: e, parent: t }, r) {
       break;
   }
 }
-const gs = (e) => e.__isSuspense;
-function Oa(e, t) {
-  t && t.pendingBranch ? F(e) ? t.effects.push(...e) : t.effects.push(e) : Li(e);
+const ms = (e) => e.__isSuspense;
+function Na(e, t) {
+  t && t.pendingBranch ? F(e) ? t.effects.push(...e) : t.effects.push(e) : zi(e);
 }
 const Ce = Symbol.for("v-fgt"), co = Symbol.for("v-txt"), dt = Symbol.for("v-cmt"), Cr = Symbol.for("v-stc"), lr = [];
 let Ve = null;
 function je(e = !1) {
   lr.push(Ve = e ? null : []);
 }
-function Na() {
+function Ia() {
   lr.pop(), Ve = lr[lr.length - 1] || null;
 }
 let dr = 1;
 function Lr(e, t = !1) {
   dr += e, e < 0 && Ve && t && (Ve.hasOnce = !0);
 }
-function ms(e) {
-  return e.dynamicChildren = dr > 0 ? Ve || Vt : null, Na(), dr > 0 && Ve && Ve.push(e), e;
+function vs(e) {
+  return e.dynamicChildren = dr > 0 ? Ve || Vt : null, Ia(), dr > 0 && Ve && Ve.push(e), e;
 }
 function Ot(e, t, r, o, n, i) {
-  return ms(
+  return vs(
     Ae(
       e,
       t,
@@ -3350,7 +3344,7 @@ function Ot(e, t, r, o, n, i) {
   );
 }
 function Ut(e, t, r, o, n) {
-  return ms(
+  return vs(
     ae(
       e,
       t,
@@ -3367,7 +3361,7 @@ function hr(e) {
 function Xt(e, t) {
   return e.type === t.type && e.key === t.key;
 }
-const vs = ({ key: e }) => e ?? null, Tr = ({
+const ys = ({ key: e }) => e ?? null, Pr = ({
   ref: e,
   ref_key: t,
   ref_for: r
@@ -3378,9 +3372,9 @@ function Ae(e, t = null, r = null, o = 0, n = null, i = e === Ce ? 0 : 1, s = !1
     __v_skip: !0,
     type: e,
     props: t,
-    key: t && vs(t),
-    ref: t && Tr(t),
-    scopeId: Bi,
+    key: t && ys(t),
+    ref: t && Pr(t),
+    scopeId: Ui,
     slotScopeIds: null,
     children: r,
     component: null,
@@ -3412,9 +3406,9 @@ function Ae(e, t = null, r = null, o = 0, n = null, i = e === Ce ? 0 : 1, s = !1
   // vnode should not be considered dynamic due to handler caching.
   a.patchFlag !== 32 && Ve.push(a), a;
 }
-const ae = Ia;
-function Ia(e, t = null, r = null, o = 0, n = null, i = !1) {
-  if ((!e || e === qi) && (e = dt), hr(e)) {
+const ae = Ma;
+function Ma(e, t = null, r = null, o = 0, n = null, i = !1) {
+  if ((!e || e === Ji) && (e = dt), hr(e)) {
     const l = Wt(
       e,
       t,
@@ -3423,12 +3417,12 @@ function Ia(e, t = null, r = null, o = 0, n = null, i = !1) {
     );
     return r && on(l, r), dr > 0 && !i && Ve && (l.shapeFlag & 6 ? Ve[Ve.indexOf(e)] = l : Ve.push(l)), l.patchFlag = -2, l;
   }
-  if (Ua(e) && (e = e.__vccOpts), t) {
-    t = Ma(t);
+  if ($a(e) && (e = e.__vccOpts), t) {
+    t = Da(t);
     let { class: l, style: a } = t;
     l && !le(l) && (t.class = Jt(l)), Z(a) && (Xo(a) && !F(a) && (a = ce({}, a)), t.style = Yr(a));
   }
-  const s = le(e) ? 1 : gs(e) ? 128 : Hl(e) ? 64 : Z(e) ? 4 : z(e) ? 2 : 0;
+  const s = le(e) ? 1 : ms(e) ? 128 : Bl(e) ? 64 : Z(e) ? 4 : z(e) ? 2 : 0;
   return Ae(
     e,
     t,
@@ -3440,21 +3434,21 @@ function Ia(e, t = null, r = null, o = 0, n = null, i = !1) {
     !0
   );
 }
-function Ma(e) {
-  return e ? Xo(e) || ns(e) ? ce({}, e) : e : null;
+function Da(e) {
+  return e ? Xo(e) || is(e) ? ce({}, e) : e : null;
 }
 function Wt(e, t, r = !1, o = !1) {
-  const { props: n, ref: i, patchFlag: s, children: l, transition: a } = e, u = t ? ys(n || {}, t) : n, c = {
+  const { props: n, ref: i, patchFlag: s, children: l, transition: a } = e, u = t ? bs(n || {}, t) : n, c = {
     __v_isVNode: !0,
     __v_skip: !0,
     type: e.type,
     props: u,
-    key: u && vs(u),
+    key: u && ys(u),
     ref: t && t.ref ? (
       // #2078 in the case of <component :is="vnode" ref="extra"/>
       // if the vnode itself already has a ref, cloneVNode will need to merge
       // the refs so the single vnode can be set on multiple refs
-      r && i ? F(i) ? i.concat(Tr(t)) : [i, Tr(t)] : Tr(t)
+      r && i ? F(i) ? i.concat(Pr(t)) : [i, Pr(t)] : Pr(t)
     ) : i,
     scopeId: e.scopeId,
     slotScopeIds: e.slotScopeIds,
@@ -3493,10 +3487,10 @@ function Wt(e, t, r = !1, o = !1) {
     a.clone(c)
   ), c;
 }
-function Da(e = " ", t = 0) {
+function Fa(e = " ", t = 0) {
   return ae(co, null, e, t);
 }
-function Pf(e = "", t = !1) {
+function Of(e = "", t = !1) {
   return t ? (je(), Ut(dt, null, e)) : ae(dt, null, e);
 }
 function Ze(e) {
@@ -3525,12 +3519,12 @@ function on(e, t) {
     } else {
       r = 32;
       const n = t._;
-      !n && !ns(t) ? t._ctx = me : n === 3 && me && (me.slots._ === 1 ? t._ = 1 : (t._ = 2, e.patchFlag |= 1024));
+      !n && !is(t) ? t._ctx = me : n === 3 && me && (me.slots._ === 1 ? t._ = 1 : (t._ = 2, e.patchFlag |= 1024));
     }
-  else z(t) ? (t = { default: t, _ctx: me }, r = 32) : (t = String(t), o & 64 ? (r = 16, t = [Da(t)]) : r = 8);
+  else z(t) ? (t = { default: t, _ctx: me }, r = 32) : (t = String(t), o & 64 ? (r = 16, t = [Fa(t)]) : r = 8);
   e.children = t, e.shapeFlag |= r;
 }
-function ys(...e) {
+function bs(...e) {
   const t = {};
   for (let r = 0; r < e.length; r++) {
     const o = e[r];
@@ -3552,11 +3546,11 @@ function Qe(e, t, r, o = null) {
     o
   ]);
 }
-const Fa = es();
-let Va = 0;
-function ja(e, t, r) {
-  const o = e.type, n = (t ? t.appContext : e.appContext) || Fa, i = {
-    uid: Va++,
+const Va = ts();
+let ja = 0;
+function La(e, t, r) {
+  const o = e.type, n = (t ? t.appContext : e.appContext) || Va, i = {
+    uid: ja++,
     vnode: e,
     type: o,
     parent: t,
@@ -3570,7 +3564,7 @@ function ja(e, t, r) {
     update: null,
     // will be set synchronously right after creation
     job: null,
-    scope: new il(
+    scope: new sl(
       !0
       /* detached */
     ),
@@ -3587,8 +3581,8 @@ function ja(e, t, r) {
     components: null,
     directives: null,
     // resolved props and emits options
-    propsOptions: ss(o, n),
-    emitsOptions: ps(o, n),
+    propsOptions: ls(o, n),
+    emitsOptions: gs(o, n),
     // emit
     emit: null,
     // to be set immediately
@@ -3631,11 +3625,11 @@ function ja(e, t, r) {
     ec: null,
     sp: null
   };
-  return i.ctx = { _: i }, i.root = t ? t.root : i, i.emit = Sa.bind(null, i), e.ce && e.ce(i), i;
+  return i.ctx = { _: i }, i.root = t ? t.root : i, i.emit = Aa.bind(null, i), e.ce && e.ce(i), i;
 }
 let _e = null;
 const pt = () => _e || me;
-let zr, Fo;
+let zr, Do;
 {
   const e = Jr(), t = (r, o) => {
     let n;
@@ -3646,7 +3640,7 @@ let zr, Fo;
   zr = t(
     "__VUE_INSTANCE_SETTERS__",
     (r) => _e = r
-  ), Fo = t(
+  ), Do = t(
     "__VUE_SSR_SETTERS__",
     (r) => pr = r
   );
@@ -3659,24 +3653,24 @@ const _r = (e) => {
 }, Rn = () => {
   _e && _e.scope.off(), zr(null);
 };
-function bs(e) {
+function ws(e) {
   return e.vnode.shapeFlag & 4;
 }
 let pr = !1;
-function La(e, t = !1, r = !1) {
-  t && Fo(t);
-  const { props: o, children: n } = e.vnode, i = bs(e);
-  ca(e, o, i, t), ha(e, n, r || t);
-  const s = i ? za(e, t) : void 0;
-  return t && Fo(!1), s;
-}
-function za(e, t) {
+function za(e, t = !1, r = !1) {
+  t && Do(t);
+  const { props: o, children: n } = e.vnode, i = ws(e);
+  ua(e, o, i, t), pa(e, n, r || t);
+  const s = i ? Ha(e, t) : void 0;
+  return t && Do(!1), s;
+}
+function Ha(e, t) {
   const r = e.type;
-  e.accessCache = /* @__PURE__ */ Object.create(null), e.proxy = new Proxy(e.ctx, ea);
+  e.accessCache = /* @__PURE__ */ Object.create(null), e.proxy = new Proxy(e.ctx, ta);
   const { setup: o } = r;
   if (o) {
     ut();
-    const n = e.setupContext = o.length > 1 ? _s(e) : null, i = _r(e), s = yr(
+    const n = e.setupContext = o.length > 1 ? xs(e) : null, i = _r(e), s = yr(
       o,
       e,
       0,
@@ -3684,8 +3678,8 @@ function za(e, t) {
         e.props,
         n
       ]
-    ), l = ci(s);
-    if (ft(), i(), (l || e.sp) && !Ht(e) && Ui(e), l) {
+    ), l = ui(s);
+    if (ft(), i(), (l || e.sp) && !Ht(e) && $i(e), l) {
       if (s.then(Rn, Rn), t)
         return s.then((a) => {
           Cn(e, a);
@@ -3696,42 +3690,42 @@ function za(e, t) {
     } else
       Cn(e, s);
   } else
-    ws(e);
+    _s(e);
 }
 function Cn(e, t, r) {
-  z(t) ? e.type.__ssrInlineRender ? e.ssrRender = t : e.render = t : Z(t) && (e.setupState = Di(t)), ws(e);
+  z(t) ? e.type.__ssrInlineRender ? e.ssrRender = t : e.render = t : Z(t) && (e.setupState = Fi(t)), _s(e);
 }
-function ws(e, t, r) {
+function _s(e, t, r) {
   const o = e.type;
   e.render || (e.render = o.render || Be);
   {
     const n = _r(e);
     ut();
     try {
-      ra(e);
+      oa(e);
     } finally {
       ft(), n();
     }
   }
 }
-const Ha = {
+const Ba = {
   get(e, t) {
     return we(e, "get", ""), e[t];
   }
 };
-function _s(e) {
+function xs(e) {
   const t = (r) => {
     e.exposed = r || {};
   };
   return {
-    attrs: new Proxy(e.attrs, Ha),
+    attrs: new Proxy(e.attrs, Ba),
     slots: e.slots,
     emit: e.emit,
     expose: t
   };
 }
 function uo(e) {
-  return e.exposed ? e.exposeProxy || (e.exposeProxy = new Proxy(Di(oo(e.exposed)), {
+  return e.exposed ? e.exposeProxy || (e.exposeProxy = new Proxy(Fi(oo(e.exposed)), {
     get(t, r) {
       if (r in t)
         return t[r];
@@ -3743,14 +3737,14 @@ function uo(e) {
     }
   })) : e.proxy;
 }
-function Ba(e, t = !0) {
+function Ua(e, t = !0) {
   return z(e) ? e.displayName || e.name : e.name || t && e.__name;
 }
-function Ua(e) {
+function $a(e) {
   return z(e) && "__vccOpts" in e;
 }
-const oe = (e, t) => Dl(e, t, pr);
-function xs(e, t, r) {
+const oe = (e, t) => Fl(e, t, pr);
+function ks(e, t, r) {
   try {
     Lr(-1);
     const o = arguments.length;
@@ -3759,22 +3753,17 @@ function xs(e, t, r) {
     Lr(1);
   }
 }
-const $a = "3.5.22";
-/**
-* @vue/runtime-dom v3.5.22
-* (c) 2018-present Yuxi (Evan) You and Vue contributors
-* @license MIT
-**/
-let Vo;
-const Tn = typeof window < "u" && window.trustedTypes;
-if (Tn)
+const Ka = "3.5.24";
+let Fo;
+const Pn = typeof window < "u" && window.trustedTypes;
+if (Pn)
   try {
-    Vo = /* @__PURE__ */ Tn.createPolicy("vue", {
+    Fo = /* @__PURE__ */ Pn.createPolicy("vue", {
       createHTML: (e) => e
     });
   } catch {
   }
-const ks = Vo ? (e) => Vo.createHTML(e) : (e) => e, Ka = "http://www.w3.org/2000/svg", Wa = "http://www.w3.org/1998/Math/MathML", it = typeof document < "u" ? document : null, Pn = it && /* @__PURE__ */ it.createElement("template"), Ga = {
+const Es = Fo ? (e) => Fo.createHTML(e) : (e) => e, Wa = "http://www.w3.org/2000/svg", Ga = "http://www.w3.org/1998/Math/MathML", it = typeof document < "u" ? document : null, Tn = it && /* @__PURE__ */ it.createElement("template"), qa = {
   insert: (e, t, r) => {
     t.insertBefore(e, r || null);
   },
@@ -3783,7 +3772,7 @@ const ks = Vo ? (e) => Vo.createHTML(e) : (e) => e, Ka = "http://www.w3.org/2000
     t && t.removeChild(e);
   },
   createElement: (e, t, r, o) => {
-    const n = t === "svg" ? it.createElementNS(Ka, e) : t === "mathml" ? it.createElementNS(Wa, e) : r ? it.createElement(e, { is: r }) : it.createElement(e);
+    const n = t === "svg" ? it.createElementNS(Wa, e) : t === "mathml" ? it.createElementNS(Ga, e) : r ? it.createElement(e, { is: r }) : it.createElement(e);
     return e === "select" && o && o.multiple != null && n.setAttribute("multiple", o.multiple), n;
   },
   createText: (e) => it.createTextNode(e),
@@ -3810,10 +3799,10 @@ const ks = Vo ? (e) => Vo.createHTML(e) : (e) => e, Ka = "http://www.w3.org/2000
       for (; t.insertBefore(n.cloneNode(!0), r), !(n === i || !(n = n.nextSibling)); )
         ;
     else {
-      Pn.innerHTML = ks(
+      Tn.innerHTML = Es(
         o === "svg" ? `<svg>${e}</svg>` : o === "mathml" ? `<math>${e}</math>` : e
       );
-      const l = Pn.content;
+      const l = Tn.content;
       if (o === "svg" || o === "mathml") {
         const a = l.firstChild;
         for (; a.firstChild; )
@@ -3829,13 +3818,13 @@ const ks = Vo ? (e) => Vo.createHTML(e) : (e) => e, Ka = "http://www.w3.org/2000
       r ? r.previousSibling : t.lastChild
     ];
   }
-}, qa = Symbol("_vtc");
-function Ja(e, t, r) {
-  const o = e[qa];
+}, Ja = Symbol("_vtc");
+function Ya(e, t, r) {
+  const o = e[Ja];
   o && (t = (t ? [t, ...o] : [...o]).join(" ")), t == null ? e.removeAttribute("class") : r ? e.setAttribute("class", t) : e.className = t;
 }
-const On = Symbol("_vod"), Ya = Symbol("_vsh"), Es = Symbol("");
-function Of(e) {
+const On = Symbol("_vod"), Qa = Symbol("_vsh"), Ss = Symbol("");
+function Nf(e) {
   const t = pt();
   if (!t)
     return;
@@ -3845,21 +3834,21 @@ function Of(e) {
     ).forEach((i) => Hr(i, n));
   }, o = () => {
     const n = e(t.proxy);
-    t.ce ? Hr(t.ce, n) : jo(t.subTree, n), r(n);
+    t.ce ? Hr(t.ce, n) : Vo(t.subTree, n), r(n);
   };
-  Wi(() => {
-    Li(o);
+  Gi(() => {
+    zi(o);
   }), wr(() => {
     $e(o, Be, { flush: "post" });
     const n = new MutationObserver(o);
     n.observe(t.subTree.el.parentNode, { childList: !0 }), so(() => n.disconnect());
   });
 }
-function jo(e, t) {
+function Vo(e, t) {
   if (e.shapeFlag & 128) {
     const r = e.suspense;
     e = r.activeBranch, r.pendingBranch && !r.isHydrating && r.effects.push(() => {
-      jo(r.activeBranch, t);
+      Vo(r.activeBranch, t);
     });
   }
   for (; e.component; )
@@ -3867,7 +3856,7 @@ function jo(e, t) {
   if (e.shapeFlag & 1 && e.el)
     Hr(e.el, t);
   else if (e.type === Ce)
-    e.children.forEach((r) => jo(r, t));
+    e.children.forEach((r) => Vo(r, t));
   else if (e.type === Cr) {
     let { el: r, anchor: o } = e;
     for (; r && (Hr(r, t), r !== o); )
@@ -3879,14 +3868,14 @@ function Hr(e, t) {
     const r = e.style;
     let o = "";
     for (const n in t) {
-      const i = nl(t[n]);
+      const i = il(t[n]);
       r.setProperty(`--${n}`, i), o += `--${n}: ${i};`;
     }
-    r[Es] = o;
+    r[Ss] = o;
   }
 }
-const Qa = /(?:^|;)\s*display\s*:/;
-function Xa(e, t, r) {
+const Xa = /(?:^|;)\s*display\s*:/;
+function Za(e, t, r) {
   const o = e.style, n = le(r);
   let i = !1;
   if (r && !n) {
@@ -3894,29 +3883,29 @@ function Xa(e, t, r) {
       if (le(t))
         for (const s of t.split(";")) {
           const l = s.slice(0, s.indexOf(":")).trim();
-          r[l] == null && Pr(o, l, "");
+          r[l] == null && Tr(o, l, "");
         }
       else
         for (const s in t)
-          r[s] == null && Pr(o, s, "");
+          r[s] == null && Tr(o, s, "");
     for (const s in r)
-      s === "display" && (i = !0), Pr(o, s, r[s]);
+      s === "display" && (i = !0), Tr(o, s, r[s]);
   } else if (n) {
     if (t !== r) {
-      const s = o[Es];
-      s && (r += ";" + s), o.cssText = r, i = Qa.test(r);
+      const s = o[Ss];
+      s && (r += ";" + s), o.cssText = r, i = Xa.test(r);
     }
   } else t && e.removeAttribute("style");
-  On in e && (e[On] = i ? o.display : "", e[Ya] && (o.display = "none"));
+  On in e && (e[On] = i ? o.display : "", e[Qa] && (o.display = "none"));
 }
 const Nn = /\s*!important$/;
-function Pr(e, t, r) {
+function Tr(e, t, r) {
   if (F(r))
-    r.forEach((o) => Pr(e, t, o));
+    r.forEach((o) => Tr(e, t, o));
   else if (r == null && (r = ""), t.startsWith("--"))
     e.setProperty(t, r);
   else {
-    const o = Za(e, t);
+    const o = ec(e, t);
     Nn.test(r) ? e.setProperty(
       Fe(o),
       r.replace(Nn, ""),
@@ -3925,7 +3914,7 @@ function Pr(e, t, r) {
   }
 }
 const In = ["Webkit", "Moz", "ms"], wo = {};
-function Za(e, t) {
+function ec(e, t) {
   const r = wo[t];
   if (r)
     return r;
@@ -3941,15 +3930,15 @@ function Za(e, t) {
   return t;
 }
 const Mn = "http://www.w3.org/1999/xlink";
-function Dn(e, t, r, o, n, i = rl(t)) {
-  o && t.startsWith("xlink:") ? r == null ? e.removeAttributeNS(Mn, t.slice(6, t.length)) : e.setAttributeNS(Mn, t, r) : r == null || i && !di(r) ? e.removeAttribute(t) : e.setAttribute(
+function Dn(e, t, r, o, n, i = ol(t)) {
+  o && t.startsWith("xlink:") ? r == null ? e.removeAttributeNS(Mn, t.slice(6, t.length)) : e.setAttributeNS(Mn, t, r) : r == null || i && !hi(r) ? e.removeAttribute(t) : e.setAttribute(
     t,
     i ? "" : Ke(r) ? String(r) : r
   );
 }
 function Fn(e, t, r, o, n) {
   if (t === "innerHTML" || t === "textContent") {
-    r != null && (e[t] = t === "innerHTML" ? ks(r) : r);
+    r != null && (e[t] = t === "innerHTML" ? Es(r) : r);
     return;
   }
   const i = e.tagName;
@@ -3966,7 +3955,7 @@ function Fn(e, t, r, o, n) {
   let s = !1;
   if (r === "" || r == null) {
     const l = typeof e[t];
-    l === "boolean" ? r = di(r) : r == null && l === "string" ? (r = "", s = !0) : l === "number" && (r = 0, s = !0);
+    l === "boolean" ? r = hi(r) : r == null && l === "string" ? (r = "", s = !0) : l === "number" && (r = 0, s = !0);
   }
   try {
     e[t] = r;
@@ -3977,27 +3966,27 @@ function Fn(e, t, r, o, n) {
 function St(e, t, r, o) {
   e.addEventListener(t, r, o);
 }
-function ec(e, t, r, o) {
+function tc(e, t, r, o) {
   e.removeEventListener(t, r, o);
 }
 const Vn = Symbol("_vei");
-function tc(e, t, r, o, n = null) {
+function rc(e, t, r, o, n = null) {
   const i = e[Vn] || (e[Vn] = {}), s = i[t];
   if (o && s)
     s.value = o;
   else {
-    const [l, a] = rc(t);
+    const [l, a] = oc(t);
     if (o) {
-      const u = i[t] = ic(
+      const u = i[t] = sc(
         o,
         n
       );
       St(e, l, u, a);
-    } else s && (ec(e, l, s, a), i[t] = void 0);
+    } else s && (tc(e, l, s, a), i[t] = void 0);
   }
 }
 const jn = /(?:Once|Passive|Capture)$/;
-function rc(e) {
+function oc(e) {
   let t;
   if (jn.test(e)) {
     t = {};
@@ -4008,23 +3997,23 @@ function rc(e) {
   return [e[2] === ":" ? e.slice(3) : Fe(e.slice(2)), t];
 }
 let _o = 0;
-const oc = /* @__PURE__ */ Promise.resolve(), nc = () => _o || (oc.then(() => _o = 0), _o = Date.now());
-function ic(e, t) {
+const nc = /* @__PURE__ */ Promise.resolve(), ic = () => _o || (nc.then(() => _o = 0), _o = Date.now());
+function sc(e, t) {
   const r = (o) => {
     if (!o._vts)
       o._vts = Date.now();
     else if (o._vts <= r.attached)
       return;
     tt(
-      sc(o, r.value),
+      lc(o, r.value),
       t,
       5,
       [o]
     );
   };
-  return r.value = e, r.attached = nc(), r;
+  return r.value = e, r.attached = ic(), r;
 }
-function sc(e, t) {
+function lc(e, t) {
   if (F(t)) {
     const r = e.stopImmediatePropagation;
     return e.stopImmediatePropagation = () => {
@@ -4036,14 +4025,14 @@ function sc(e, t) {
     return t;
 }
 const Ln = (e) => e.charCodeAt(0) === 111 && e.charCodeAt(1) === 110 && // lowercase letter
-e.charCodeAt(2) > 96 && e.charCodeAt(2) < 123, lc = (e, t, r, o, n, i) => {
+e.charCodeAt(2) > 96 && e.charCodeAt(2) < 123, ac = (e, t, r, o, n, i) => {
   const s = n === "svg";
-  t === "class" ? Ja(e, o, s) : t === "style" ? Xa(e, r, o) : $r(t) ? Ko(t) || tc(e, t, r, o, i) : (t[0] === "." ? (t = t.slice(1), !0) : t[0] === "^" ? (t = t.slice(1), !1) : ac(e, t, o, s)) ? (Fn(e, t, o), !e.tagName.includes("-") && (t === "value" || t === "checked" || t === "selected") && Dn(e, t, o, s, i, t !== "value")) : /* #11081 force set props for possible async custom element */ e._isVueCE && (/[A-Z]/.test(t) || !le(o)) ? Fn(e, xe(t), o, i, t) : (t === "true-value" ? e._trueValue = o : t === "false-value" && (e._falseValue = o), Dn(e, t, o, s));
+  t === "class" ? Ya(e, o, s) : t === "style" ? Za(e, r, o) : $r(t) ? $o(t) || rc(e, t, r, o, i) : (t[0] === "." ? (t = t.slice(1), !0) : t[0] === "^" ? (t = t.slice(1), !1) : cc(e, t, o, s)) ? (Fn(e, t, o), !e.tagName.includes("-") && (t === "value" || t === "checked" || t === "selected") && Dn(e, t, o, s, i, t !== "value")) : /* #11081 force set props for possible async custom element */ e._isVueCE && (/[A-Z]/.test(t) || !le(o)) ? Fn(e, xe(t), o, i, t) : (t === "true-value" ? e._trueValue = o : t === "false-value" && (e._falseValue = o), Dn(e, t, o, s));
 };
-function ac(e, t, r, o) {
+function cc(e, t, r, o) {
   if (o)
     return !!(t === "innerHTML" || t === "textContent" || t in e && Ln(t) && z(r));
-  if (t === "spellcheck" || t === "draggable" || t === "translate" || t === "autocorrect" || t === "form" || t === "list" && e.tagName === "INPUT" || t === "type" && e.tagName === "TEXTAREA")
+  if (t === "spellcheck" || t === "draggable" || t === "translate" || t === "autocorrect" || t === "sandbox" && e.tagName === "IFRAME" || t === "form" || t === "list" && e.tagName === "INPUT" || t === "type" && e.tagName === "TEXTAREA")
     return !1;
   if (t === "width" || t === "height") {
     const n = e.tagName;
@@ -4054,8 +4043,8 @@ function ac(e, t, r, o) {
 }
 const zn = {};
 // @__NO_SIDE_EFFECTS__
-function cc(e, t, r) {
-  let o = /* @__PURE__ */ Pt(e, t);
+function uc(e, t, r) {
+  let o = /* @__PURE__ */ Tt(e, t);
   Wr(o) && (o = ce({}, o, t));
   class n extends nn {
     constructor(s) {
@@ -4064,11 +4053,11 @@ function cc(e, t, r) {
   }
   return n.def = o, n;
 }
-const uc = typeof HTMLElement < "u" ? HTMLElement : class {
+const fc = typeof HTMLElement < "u" ? HTMLElement : class {
 };
-class nn extends uc {
-  constructor(t, r = {}, o = $n) {
-    super(), this._def = t, this._props = r, this._createApp = o, this._isVueCE = !0, this._instance = null, this._app = null, this._nonce = this._def.nonce, this._connected = !1, this._resolved = !1, this._numberProps = null, this._styleChildren = /* @__PURE__ */ new WeakSet(), this._ob = null, this.shadowRoot && o !== $n ? this._root = this.shadowRoot : t.shadowRoot !== !1 ? (this.attachShadow(
+class nn extends fc {
+  constructor(t, r = {}, o = Kn) {
+    super(), this._def = t, this._props = r, this._createApp = o, this._isVueCE = !0, this._instance = null, this._app = null, this._nonce = this._def.nonce, this._connected = !1, this._resolved = !1, this._patching = !1, this._dirty = !1, this._numberProps = null, this._styleChildren = /* @__PURE__ */ new WeakSet(), this._ob = null, this.shadowRoot && o !== Kn ? this._root = this.shadowRoot : t.shadowRoot !== !1 ? (this.attachShadow(
       ce({}, t.shadowRootOptions, {
         mode: "open"
       })
@@ -4149,7 +4138,7 @@ class nn extends uc {
           return this._getProp(n);
         },
         set(i) {
-          this._setProp(n, i, !0, !0);
+          this._setProp(n, i, !0, !this._patching);
         }
       });
   }
@@ -4170,14 +4159,14 @@ class nn extends uc {
    * @internal
    */
   _setProp(t, r, o = !0, n = !1) {
-    if (r !== this._props[t] && (r === zn ? delete this._props[t] : (this._props[t] = r, t === "key" && this._app && (this._app._ceVNode.key = r)), n && this._instance && this._update(), o)) {
+    if (r !== this._props[t] && (this._dirty = !0, r === zn ? delete this._props[t] : (this._props[t] = r, t === "key" && this._app && (this._app._ceVNode.key = r)), n && this._instance && this._update(), o)) {
       const i = this._ob;
       i && (this._processMutations(i.takeRecords()), i.disconnect()), r === !0 ? this.setAttribute(Fe(t), "") : typeof r == "string" || typeof r == "number" ? this.setAttribute(Fe(t), r + "") : r || this.removeAttribute(Fe(t)), i && i.observe(this, { attributes: !0 });
     }
   }
   _update() {
     const t = this._createVNode();
-    this._app && (t.appContext = this._app._context), vc(t, this._root);
+    this._app && (t.appContext = this._app._context), yc(t, this._root);
   }
   _createVNode() {
     const t = {};
@@ -4250,7 +4239,14 @@ class nn extends uc {
    */
   _getSlots() {
     const t = [this];
-    return this._teleportTargets && t.push(...this._teleportTargets), t.reduce((r, o) => (r.push(...Array.from(o.querySelectorAll("slot"))), r), []);
+    this._teleportTargets && t.push(...this._teleportTargets);
+    const r = /* @__PURE__ */ new Set();
+    for (const o of t) {
+      const n = o.querySelectorAll("slot");
+      for (let i = 0; i < n.length; i++)
+        r.add(n[i]);
+    }
+    return Array.from(r);
   }
   /**
    * @internal
@@ -4258,6 +4254,18 @@ class nn extends uc {
   _injectChildStyle(t) {
     this._applyStyles(t.styles, t);
   }
+  /**
+   * @internal
+   */
+  _beginPatch() {
+    this._patching = !0, this._dirty = !1;
+  }
+  /**
+   * @internal
+   */
+  _endPatch() {
+    this._patching = !1, this._dirty && this._instance && this._update();
+  }
   /**
    * @internal
    */
@@ -4268,24 +4276,26 @@ const Br = (e) => {
   const t = e.props["onUpdate:modelValue"] || !1;
   return F(t) ? (r) => Rr(t, r) : t;
 };
-function fc(e) {
+function dc(e) {
   e.target.composing = !0;
 }
 function Hn(e) {
   const t = e.target;
   t.composing && (t.composing = !1, t.dispatchEvent(new Event("input")));
 }
-const $t = Symbol("_assign"), Nf = {
+const $t = Symbol("_assign");
+function Bn(e, t, r) {
+  return t && (e = e.trim()), r && (e = Go(e)), e;
+}
+const If = {
   created(e, { modifiers: { lazy: t, trim: r, number: o } }, n) {
     e[$t] = Br(n);
     const i = o || n.props && n.props.type === "number";
     St(e, t ? "change" : "input", (s) => {
-      if (s.target.composing) return;
-      let l = e.value;
-      r && (l = l.trim()), i && (l = Co(l)), e[$t](l);
-    }), r && St(e, "change", () => {
-      e.value = e.value.trim();
-    }), t || (St(e, "compositionstart", fc), St(e, "compositionend", Hn), St(e, "change", Hn));
+      s.target.composing || e[$t](Bn(e.value, r, i));
+    }), (r || i) && St(e, "change", () => {
+      e.value = Bn(e.value, r, i);
+    }), t || (St(e, "compositionstart", dc), St(e, "compositionend", Hn), St(e, "change", Hn));
   },
   // set value on mounted so it's after min/max for type="range"
   mounted(e, { value: t }) {
@@ -4293,17 +4303,17 @@ const $t = Symbol("_assign"), Nf = {
   },
   beforeUpdate(e, { value: t, oldValue: r, modifiers: { lazy: o, trim: n, number: i } }, s) {
     if (e[$t] = Br(s), e.composing) return;
-    const l = (i || e.type === "number") && !/^0\d/.test(e.value) ? Co(e.value) : e.value, a = t ?? "";
+    const l = (i || e.type === "number") && !/^0\d/.test(e.value) ? Go(e.value) : e.value, a = t ?? "";
     l !== a && (document.activeElement === e && e.type !== "range" && (o && t === r || n && e.value.trim() === a) || (e.value = a));
   }
-}, If = {
+}, Mf = {
   // #4096 array checkboxes need to be deep traversed
   deep: !0,
   created(e, t, r) {
     e[$t] = Br(r), St(e, "change", () => {
-      const o = e._modelValue, n = dc(e), i = e.checked, s = e[$t];
+      const o = e._modelValue, n = hc(e), i = e.checked, s = e[$t];
       if (F(o)) {
-        const l = hi(o, n), a = l !== -1;
+        const l = pi(o, n), a = l !== -1;
         if (i && !a)
           s(o.concat(n));
         else if (!i && a) {
@@ -4314,36 +4324,36 @@ const $t = Symbol("_assign"), Nf = {
         const l = new Set(o);
         i ? l.add(n) : l.delete(n), s(l);
       } else
-        s(Ss(e, i));
+        s(As(e, i));
     });
   },
   // set initial checked on mount to wait for true-value/false-value
-  mounted: Bn,
+  mounted: Un,
   beforeUpdate(e, t, r) {
-    e[$t] = Br(r), Bn(e, t, r);
+    e[$t] = Br(r), Un(e, t, r);
   }
 };
-function Bn(e, { value: t, oldValue: r }, o) {
+function Un(e, { value: t, oldValue: r }, o) {
   e._modelValue = t;
   let n;
   if (F(t))
-    n = hi(t, o.props.value) > -1;
+    n = pi(t, o.props.value) > -1;
   else if (Kr(t))
     n = t.has(o.props.value);
   else {
     if (t === r) return;
-    n = Qr(t, Ss(e, !0));
+    n = Qr(t, As(e, !0));
   }
   e.checked !== n && (e.checked = n);
 }
-function dc(e) {
+function hc(e) {
   return "_value" in e ? e._value : e.value;
 }
-function Ss(e, t) {
+function As(e, t) {
   const r = t ? "_trueValue" : "_falseValue";
   return r in e ? e[r] : t;
 }
-const hc = ["ctrl", "shift", "alt", "meta"], pc = {
+const pc = ["ctrl", "shift", "alt", "meta"], gc = {
   stop: (e) => e.stopPropagation(),
   prevent: (e) => e.preventDefault(),
   self: (e) => e.target !== e.currentTarget,
@@ -4354,64 +4364,64 @@ const hc = ["ctrl", "shift", "alt", "meta"], pc = {
   left: (e) => "button" in e && e.button !== 0,
   middle: (e) => "button" in e && e.button !== 1,
   right: (e) => "button" in e && e.button !== 2,
-  exact: (e, t) => hc.some((r) => e[`${r}Key`] && !t.includes(r))
-}, gc = (e, t) => {
+  exact: (e, t) => pc.some((r) => e[`${r}Key`] && !t.includes(r))
+}, mc = (e, t) => {
   const r = e._withMods || (e._withMods = {}), o = t.join(".");
   return r[o] || (r[o] = ((n, ...i) => {
     for (let s = 0; s < t.length; s++) {
-      const l = pc[t[s]];
+      const l = gc[t[s]];
       if (l && l(n, t)) return;
     }
     return e(n, ...i);
   }));
-}, mc = /* @__PURE__ */ ce({ patchProp: lc }, Ga);
-let Un;
-function As() {
-  return Un || (Un = ga(mc));
-}
-const vc = ((...e) => {
-  As().render(...e);
-}), $n = ((...e) => {
-  const t = As().createApp(...e), { mount: r } = t;
+}, vc = /* @__PURE__ */ ce({ patchProp: ac }, qa);
+let $n;
+function Rs() {
+  return $n || ($n = ma(vc));
+}
+const yc = ((...e) => {
+  Rs().render(...e);
+}), Kn = ((...e) => {
+  const t = Rs().createApp(...e), { mount: r } = t;
   return t.mount = (o) => {
-    const n = bc(o);
+    const n = wc(o);
     if (!n) return;
     const i = t._component;
     !z(i) && !i.render && !i.template && (i.template = n.innerHTML), n.nodeType === 1 && (n.textContent = "");
-    const s = r(n, !1, yc(n));
+    const s = r(n, !1, bc(n));
     return n instanceof Element && (n.removeAttribute("v-cloak"), n.setAttribute("data-v-app", "")), s;
   }, t;
 });
-function yc(e) {
+function bc(e) {
   if (e instanceof SVGElement)
     return "svg";
   if (typeof MathMLElement == "function" && e instanceof MathMLElement)
     return "mathml";
 }
-function bc(e) {
+function wc(e) {
   return le(e) ? document.querySelector(e) : e;
 }
 function Ur(e, t) {
-  return qo() ? (sl(e, t), !0) : !1;
+  return qo() ? (ll(e, t), !0) : !1;
 }
-const xo = /* @__PURE__ */ new WeakMap(), wc = /* @__NO_SIDE_EFFECTS__ */ (...e) => {
+const xo = /* @__PURE__ */ new WeakMap(), _c = /* @__NO_SIDE_EFFECTS__ */ (...e) => {
   var t;
   const r = e[0], o = (t = pt()) === null || t === void 0 ? void 0 : t.proxy, n = o ?? qo();
-  if (n == null && !ts()) throw new Error("injectLocal must be called in setup");
+  if (n == null && !rs()) throw new Error("injectLocal must be called in setup");
   return n && xo.has(n) && r in xo.get(n) ? xo.get(n)[r] : Ie(...e);
-}, Lo = typeof window < "u" && typeof document < "u";
+}, jo = typeof window < "u" && typeof document < "u";
 typeof WorkerGlobalScope < "u" && globalThis instanceof WorkerGlobalScope;
-const _c = Object.prototype.toString, xc = (e) => _c.call(e) === "[object Object]", kc = () => {
+const xc = Object.prototype.toString, kc = (e) => xc.call(e) === "[object Object]", Ec = () => {
 };
-function Rs(...e) {
-  if (e.length !== 1) return Nl(...e);
+function Cs(...e) {
+  if (e.length !== 1) return Il(...e);
   const t = e[0];
-  return typeof t == "function" ? Kt(Fi(() => ({
+  return typeof t == "function" ? Kt(Vi(() => ({
     get: t,
-    set: kc
-  }))) : Tt(t);
+    set: Ec
+  }))) : Pt(t);
 }
-function Ec(e, t) {
+function Sc(e, t) {
   function r(...o) {
     return new Promise((n, i) => {
       Promise.resolve(e(() => t.apply(this, o), {
@@ -4423,9 +4433,9 @@ function Ec(e, t) {
   }
   return r;
 }
-const Cs = (e) => e();
-function Sc(e = Cs, t = {}) {
-  const { initialState: r = "active" } = t, o = Rs(r === "active");
+const Ps = (e) => e();
+function Ac(e = Ps, t = {}) {
+  const { initialState: r = "active" } = t, o = Cs(r === "active");
   function n() {
     o.value = !1;
   }
@@ -4442,23 +4452,23 @@ function Sc(e = Cs, t = {}) {
     eventFilter: s
   };
 }
-function Kn(e) {
+function Wn(e) {
   return e.endsWith("rem") ? Number.parseFloat(e) * 16 : Number.parseFloat(e);
 }
 function ko(e) {
   return Array.isArray(e) ? e : [e];
 }
-function Ac(e) {
+function Rc(e) {
   return pt();
 }
-function Rc(e, t, r = {}) {
-  const { eventFilter: o = Cs, ...n } = r;
-  return $e(e, Ec(o, t), n);
-}
 function Cc(e, t, r = {}) {
-  const { eventFilter: o, initialState: n = "active", ...i } = r, { eventFilter: s, pause: l, resume: a, isActive: u } = Sc(o, { initialState: n });
+  const { eventFilter: o = Ps, ...n } = r;
+  return $e(e, Sc(o, t), n);
+}
+function Pc(e, t, r = {}) {
+  const { eventFilter: o, initialState: n = "active", ...i } = r, { eventFilter: s, pause: l, resume: a, isActive: u } = Ac(o, { initialState: n });
   return {
-    stop: Rc(e, t, {
+    stop: Cc(e, t, {
       ...i,
       eventFilter: s
     }),
@@ -4467,11 +4477,11 @@ function Cc(e, t, r = {}) {
     isActive: u
   };
 }
-const Tc = Cc;
+const Tc = Pc;
 function Ts(e, t = !0, r) {
-  Ac() ? wr(e, r) : t ? e() : br(e);
+  Rc() ? wr(e, r) : t ? e() : br(e);
 }
-function Pc(e, t = 1e3, r = {}) {
+function Oc(e, t = 1e3, r = {}) {
   const { immediate: o = !0, immediateCallback: n = !1 } = r;
   let i = null;
   const s = ct(!1);
@@ -4485,22 +4495,22 @@ function Pc(e, t = 1e3, r = {}) {
     const c = He(t);
     c <= 0 || (s.value = !0, n && e(), l(), s.value && (i = setInterval(e, c)));
   }
-  return o && Lo && u(), (ue(t) || typeof t == "function") && Ur($e(t, () => {
-    s.value && Lo && u();
+  return o && jo && u(), (ue(t) || typeof t == "function") && Ur($e(t, () => {
+    s.value && jo && u();
   })), Ur(a), {
-    isActive: Al(s),
+    isActive: Rl(s),
     pause: a,
     resume: u
   };
 }
-function Oc(e, t, r) {
+function Nc(e, t, r) {
   return $e(e, t, {
     ...r,
     immediate: !0
   });
 }
-const at = Lo ? window : void 0;
-function Ps(e) {
+const at = jo ? window : void 0;
+function Os(e) {
   var t;
   const r = He(e);
   return (t = r?.$el) !== null && t !== void 0 ? t : r;
@@ -4511,17 +4521,17 @@ function gr(...e) {
   }, o = (l, a, u, c) => (l.addEventListener(a, u, c), () => l.removeEventListener(a, u, c)), n = oe(() => {
     const l = ko(He(e[0])).filter((a) => a != null);
     return l.every((a) => typeof a != "string") ? l : void 0;
-  }), i = Oc(() => {
+  }), i = Nc(() => {
     var l, a;
     return [
-      (l = (a = n.value) === null || a === void 0 ? void 0 : a.map((u) => Ps(u))) !== null && l !== void 0 ? l : [at].filter((u) => u != null),
+      (l = (a = n.value) === null || a === void 0 ? void 0 : a.map((u) => Os(u))) !== null && l !== void 0 ? l : [at].filter((u) => u != null),
       ko(He(n.value ? e[1] : e[0])),
       ko(et(n.value ? e[2] : e[1])),
       He(n.value ? e[3] : e[2])
     ];
   }, ([l, a, u, c]) => {
     if (r(), !l?.length || !a?.length || !u?.length) return;
-    const d = xc(c) ? { ...c } : c;
+    const d = kc(c) ? { ...c } : c;
     t.push(...l.flatMap((m) => a.flatMap((g) => u.map((x) => o(m, g, x, d)))));
   }, { flush: "post" }), s = () => {
     i(), r();
@@ -4529,18 +4539,18 @@ function gr(...e) {
   return Ur(r), s;
 }
 // @__NO_SIDE_EFFECTS__
-function Nc() {
+function Ic() {
   const e = ct(!1), t = pt();
   return t && wr(() => {
     e.value = !0;
   }, t), e;
 }
 // @__NO_SIDE_EFFECTS__
-function Ic(e) {
-  const t = /* @__PURE__ */ Nc();
+function Mc(e) {
+  const t = /* @__PURE__ */ Ic();
   return oe(() => (t.value, !!e()));
 }
-function Mc(e, t = {}) {
+function Dc(e, t = {}) {
   const { immediate: r = !0, fpsLimit: o = void 0, window: n = at, once: i = !1 } = t, s = ct(!1), l = oe(() => o ? 1e3 / He(o) : null);
   let a = 0, u = null;
   function c(g) {
@@ -4572,43 +4582,43 @@ function Mc(e, t = {}) {
     resume: d
   };
 }
-const Dc = Symbol("vueuse-ssr-width");
+const Fc = Symbol("vueuse-ssr-width");
 // @__NO_SIDE_EFFECTS__
-function Fc() {
-  const e = ts() ? /* @__PURE__ */ wc(Dc, null) : null;
+function Vc() {
+  const e = rs() ? /* @__PURE__ */ _c(Fc, null) : null;
   return typeof e == "number" ? e : void 0;
 }
-function Vc(e, t = {}) {
-  const { window: r = at, ssrWidth: o = /* @__PURE__ */ Fc() } = t, n = /* @__PURE__ */ Ic(() => r && "matchMedia" in r && typeof r.matchMedia == "function"), i = ct(typeof o == "number"), s = ct(), l = ct(!1), a = (u) => {
+function jc(e, t = {}) {
+  const { window: r = at, ssrWidth: o = /* @__PURE__ */ Vc() } = t, n = /* @__PURE__ */ Mc(() => r && "matchMedia" in r && typeof r.matchMedia == "function"), i = ct(typeof o == "number"), s = ct(), l = ct(!1), a = (u) => {
     l.value = u.matches;
   };
-  return _a(() => {
+  return xa(() => {
     if (i.value) {
       i.value = !n.value, l.value = He(e).split(",").some((u) => {
         const c = u.includes("not all"), d = u.match(/\(\s*min-width:\s*(-?\d+(?:\.\d*)?[a-z]+\s*)\)/), m = u.match(/\(\s*max-width:\s*(-?\d+(?:\.\d*)?[a-z]+\s*)\)/);
         let g = !!(d || m);
-        return d && g && (g = o >= Kn(d[1])), m && g && (g = o <= Kn(m[1])), c ? !g : g;
+        return d && g && (g = o >= Wn(d[1])), m && g && (g = o <= Wn(m[1])), c ? !g : g;
       });
       return;
     }
     n.value && (s.value = r.matchMedia(He(e)), l.value = s.value.matches);
   }), gr(s, "change", a, { passive: !0 }), oe(() => l.value);
 }
-const Sr = typeof globalThis < "u" ? globalThis : typeof window < "u" ? window : typeof global < "u" ? global : typeof self < "u" ? self : {}, Ar = "__vueuse_ssr_handlers__", jc = /* @__PURE__ */ Lc();
-function Lc() {
+const Sr = typeof globalThis < "u" ? globalThis : typeof window < "u" ? window : typeof global < "u" ? global : typeof self < "u" ? self : {}, Ar = "__vueuse_ssr_handlers__", Lc = /* @__PURE__ */ zc();
+function zc() {
   return Ar in Sr || (Sr[Ar] = Sr[Ar] || {}), Sr[Ar];
 }
-function Os(e, t) {
-  return jc[e] || t;
+function Ns(e, t) {
+  return Lc[e] || t;
 }
 // @__NO_SIDE_EFFECTS__
-function zc(e) {
-  return Vc("(prefers-color-scheme: dark)", e);
-}
 function Hc(e) {
+  return jc("(prefers-color-scheme: dark)", e);
+}
+function Bc(e) {
   return e == null ? "any" : e instanceof Set ? "set" : e instanceof Map ? "map" : e instanceof Date ? "date" : typeof e == "boolean" ? "boolean" : typeof e == "string" ? "string" : typeof e == "object" ? "object" : Number.isNaN(e) ? "any" : "number";
 }
-const Bc = {
+const Uc = {
   boolean: {
     read: (e) => e === "true",
     write: (e) => String(e)
@@ -4641,19 +4651,19 @@ const Bc = {
     read: (e) => new Date(e),
     write: (e) => e.toISOString()
   }
-}, Wn = "vueuse-storage";
-function Ns(e, t, r, o = {}) {
+}, Gn = "vueuse-storage";
+function Is(e, t, r, o = {}) {
   var n;
   const { flush: i = "pre", deep: s = !0, listenToStorageChanges: l = !0, writeDefaults: a = !0, mergeDefaults: u = !1, shallow: c, window: d = at, eventFilter: m, onError: g = (H) => {
     console.error(H);
-  }, initOnMounted: x } = o, k = (c ? ct : Tt)(typeof t == "function" ? t() : t), M = oe(() => He(e));
+  }, initOnMounted: x } = o, k = (c ? ct : Pt)(typeof t == "function" ? t() : t), M = oe(() => He(e));
   if (!r) try {
-    r = Os("getDefaultStorage", () => at?.localStorage)();
+    r = Ns("getDefaultStorage", () => at?.localStorage)();
   } catch (H) {
     g(H);
   }
   if (!r) return k;
-  const S = He(t), O = Hc(S), N = (n = o.serializer) !== null && n !== void 0 ? n : Bc[O], { pause: R, resume: B } = Tc(k, (H) => he(H), {
+  const S = He(t), O = Bc(S), N = (n = o.serializer) !== null && n !== void 0 ? n : Uc[O], { pause: R, resume: B } = Tc(k, (H) => he(H), {
     flush: i,
     deep: s,
     eventFilter: m
@@ -4665,7 +4675,7 @@ function Ns(e, t, r, o = {}) {
   }, ve = (H) => {
     x && !ne || pe(H);
   };
-  d && l && (r instanceof Storage ? gr(d, "storage", q, { passive: !0 }) : gr(d, Wn, ve)), x ? Ts(() => {
+  d && l && (r instanceof Storage ? gr(d, "storage", q, { passive: !0 }) : gr(d, Gn, ve)), x ? Ts(() => {
     ne = !0, fe();
   }) : fe();
   function ke(H, ie) {
@@ -4676,7 +4686,7 @@ function Ns(e, t, r, o = {}) {
         newValue: ie,
         storageArea: r
       };
-      d.dispatchEvent(r instanceof Storage ? new StorageEvent("storage", J) : new CustomEvent(Wn, { detail: J }));
+      d.dispatchEvent(r instanceof Storage ? new StorageEvent("storage", J) : new CustomEvent(Gn, { detail: J }));
     }
   }
   function he(H) {
@@ -4728,18 +4738,18 @@ function Ns(e, t, r, o = {}) {
   }
   return k;
 }
-const Uc = "*,*::before,*::after{-webkit-transition:none!important;-moz-transition:none!important;-o-transition:none!important;-ms-transition:none!important;transition:none!important}";
-function $c(e = {}) {
+const $c = "*,*::before,*::after{-webkit-transition:none!important;-moz-transition:none!important;-o-transition:none!important;-ms-transition:none!important;transition:none!important}";
+function Kc(e = {}) {
   const { selector: t = "html", attribute: r = "class", initialValue: o = "auto", window: n = at, storage: i, storageKey: s = "vueuse-color-scheme", listenToStorageChanges: l = !0, storageRef: a, emitAuto: u, disableTransition: c = !0 } = e, d = {
     auto: "",
     light: "light",
     dark: "dark",
     ...e.modes || {}
-  }, m = /* @__PURE__ */ zc({ window: n }), g = oe(() => m.value ? "dark" : "light"), x = a || (s == null ? Rs(o) : Ns(s, o, i, {
+  }, m = /* @__PURE__ */ Hc({ window: n }), g = oe(() => m.value ? "dark" : "light"), x = a || (s == null ? Cs(o) : Is(s, o, i, {
     window: n,
     listenToStorageChanges: l
-  })), k = oe(() => x.value === "auto" ? g.value : x.value), M = Os("updateHTMLAttrs", (R, B, ne) => {
-    const q = typeof R == "string" ? n?.document.querySelector(R) : Ps(R);
+  })), k = oe(() => x.value === "auto" ? g.value : x.value), M = Ns("updateHTMLAttrs", (R, B, ne) => {
+    const q = typeof R == "string" ? n?.document.querySelector(R) : Os(R);
     if (!q) return;
     const ve = /* @__PURE__ */ new Set(), ke = /* @__PURE__ */ new Set();
     let he = null;
@@ -4754,7 +4764,7 @@ function $c(e = {}) {
     };
     if (ve.size === 0 && ke.size === 0 && he === null) return;
     let ye;
-    c && (ye = n.document.createElement("style"), ye.appendChild(document.createTextNode(Uc)), n.document.head.appendChild(ye));
+    c && (ye = n.document.createElement("style"), ye.appendChild(document.createTextNode($c)), n.document.head.appendChild(ye));
     for (const fe of ve) q.classList.add(fe);
     for (const fe of ke) q.classList.remove(fe);
     he && q.setAttribute(he.key, he.value), c && (n.getComputedStyle(ye).opacity, document.head.removeChild(ye));
@@ -4784,19 +4794,19 @@ function $c(e = {}) {
     state: k
   });
 }
-function Kc(e, t, r = {}) {
+function Wc(e, t, r = {}) {
   const { window: o = at } = r;
-  return Ns(e, t, o?.localStorage, r);
+  return Is(e, t, o?.localStorage, r);
 }
 // @__NO_SIDE_EFFECTS__
-function Wc(e = {}) {
-  const { controls: t = !1, interval: r = "requestAnimationFrame", immediate: o = !0 } = e, n = Tt(/* @__PURE__ */ new Date()), i = () => n.value = /* @__PURE__ */ new Date(), s = r === "requestAnimationFrame" ? Mc(i, { immediate: o }) : Pc(i, r, { immediate: o });
+function Gc(e = {}) {
+  const { controls: t = !1, interval: r = "requestAnimationFrame", immediate: o = !0 } = e, n = Pt(/* @__PURE__ */ new Date()), i = () => n.value = /* @__PURE__ */ new Date(), s = r === "requestAnimationFrame" ? Dc(i, { immediate: o }) : Oc(i, r, { immediate: o });
   return t ? {
     now: n,
     ...s
   } : n;
 }
-const Gc = [
+const qc = [
   {
     max: 6e4,
     value: 1e3,
@@ -4832,7 +4842,7 @@ const Gc = [
     value: 31536e6,
     name: "year"
   }
-], qc = {
+], Jc = {
   justNow: "just now",
   past: (e) => e.match(/\d/) ? `${e} ago` : e,
   future: (e) => e.match(/\d/) ? `in ${e}` : e,
@@ -4845,22 +4855,22 @@ const Gc = [
   second: (e) => `${e} second${e > 1 ? "s" : ""}`,
   invalid: ""
 };
-function Jc(e) {
+function Yc(e) {
   return e.toISOString().slice(0, 10);
 }
 // @__NO_SIDE_EFFECTS__
-function Mf(e, t = {}) {
-  const { controls: r = !1, updateInterval: o = 3e4 } = t, { now: n, ...i } = /* @__PURE__ */ Wc({
+function Df(e, t = {}) {
+  const { controls: r = !1, updateInterval: o = 3e4 } = t, { now: n, ...i } = /* @__PURE__ */ Gc({
     interval: o,
     controls: !0
-  }), s = oe(() => Yc(new Date(He(e)), t, He(n)));
+  }), s = oe(() => Qc(new Date(He(e)), t, He(n)));
   return r ? {
     timeAgo: s,
     ...i
   } : s;
 }
-function Yc(e, t = {}, r = Date.now()) {
-  const { max: o, messages: n = qc, fullDateFormatter: i = Jc, units: s = Gc, showSecond: l = !1, rounding: a = "round" } = t, u = typeof a == "number" ? (M) => +M.toFixed(a) : Math[a], c = +r - +e, d = Math.abs(c);
+function Qc(e, t = {}, r = Date.now()) {
+  const { max: o, messages: n = Jc, fullDateFormatter: i = Yc, units: s = qc, showSecond: l = !1, rounding: a = "round" } = t, u = typeof a == "number" ? (M) => +M.toFixed(a) : Math[a], c = +r - +e, d = Math.abs(c);
   function m(M, S) {
     return u(Math.abs(M) / S.value);
   }
@@ -4885,7 +4895,7 @@ function Yc(e, t = {}, r = Date.now()) {
   }
   return n.invalid;
 }
-const Qc = /* @__PURE__ */ Pt({
+const Xc = /* @__PURE__ */ Tt({
   __name: "ResizablePanel",
   props: {
     translate: {
@@ -4896,7 +4906,7 @@ const Qc = /* @__PURE__ */ Pt({
   },
   emits: ["update:translate"],
   setup(e) {
-    const t = Ea(e, "translate"), r = Tt(!1), o = oe(() => ({
+    const t = Sa(e, "translate"), r = Pt(!1), o = oe(() => ({
       transform: `translateY(-${t.value - 5}px)`
     }));
     function n() {
@@ -4916,18 +4926,18 @@ const Qc = /* @__PURE__ */ Pt({
     }), (i, s) => (je(), Ot("div", {
       class: Jt(["h-[8px] w-full fixed left-0 bottom-0 z-9999 cursor-row-resize hover:bg-(--ui-border) transition-[background-color] duration-200 select-none touch-none resize-handle", [r.value && "bg-(--ui-border) cursor-col-resize"]]),
       style: Yr(o.value),
-      onMousedown: gc(n, ["prevent"])
+      onMousedown: mc(n, ["prevent"])
     }, null, 38));
   }
-}), Xc = /* @__PURE__ */ Pt({
+}), Zc = /* @__PURE__ */ Tt({
   __name: "PiPContainer",
   props: {
     isPip: { type: Boolean }
   },
   setup(e) {
-    const t = $c({
+    const t = Kc({
       selector: "#root"
-    }), r = oe(() => t.value === "auto" ? [] : t.value), o = Kc("pinia-colada-devtools-pip-container-height", 400);
+    }), r = oe(() => t.value === "auto" ? [] : t.value), o = Wc("pinia-colada-devtools-pip-container-height", 400);
     o.value = Math.min(o.value, window.innerHeight * 0.8);
     const n = oe(() => ({ height: `${o.value}px` })), i = oe(() => e.isPip ? ["h-full"] : [
       "fixed",
@@ -4942,25 +4952,25 @@ const Qc = /* @__PURE__ */ Pt({
       "border-(--ui-border)"
     ]);
     return (s, l) => (je(), Ot(Ce, null, [
-      Ae("aside", ys({
+      Ae("aside", bs({
         class: [[r.value, i.value], "w-full pip-container"],
         style: n.value
       }, s.$attrs), [
-        Yi(s.$slots, "default")
+        Qi(s.$slots, "default")
       ], 16),
-      ae(Qc, {
+      ae(Xc, {
         translate: et(o),
         "onUpdate:translate": l[0] || (l[0] = (a) => ue(o) ? o.value = a : null)
       }, null, 8, ["translate"])
     ], 64));
   }
-}), Zc = {
+}), eu = {
   viewBox: "0 0 24 24",
   width: "1.2em",
   height: "1.2em"
 };
-function eu(e, t) {
-  return je(), Ot("svg", Zc, [...t[0] || (t[0] = [
+function tu(e, t) {
+  return je(), Ot("svg", eu, [...t[0] || (t[0] = [
     Ae("path", {
       fill: "none",
       stroke: "currentColor",
@@ -4971,7 +4981,7 @@ function eu(e, t) {
     }, null, -1)
   ])]);
 }
-const tu = oo({ name: "lucide-x", render: eu }), ru = /* @__PURE__ */ Pt({
+const ru = oo({ name: "lucide-x", render: tu }), ou = /* @__PURE__ */ Tt({
   __name: "UButton.ce",
   props: {
     size: { default: "md", type: String }
@@ -4994,16 +5004,16 @@ const tu = oo({ name: "lucide-x", render: eu }), ru = /* @__PURE__ */ Pt({
       type: "button",
       class: Jt(["bg-theme-400 hover:bg-theme-600 dark:bg-theme-400 dark:hover:bg-theme-300 font-medium hover:cursor-pointer focus-visible:outline-theme focus-visible:outline-offset-2 focus-visible:outline-2 transition-colors text-(--color-gray-900) flex items-center disabled:cursor-not-allowed disabled:text-(--color-gray-700)", [`text-${e.size}`, t.value, `rounded-${e.size}`]])
     }, [
-      Yi(r.$slots, "default")
+      Qi(r.$slots, "default")
     ], 2));
   }
-}), ou = {
+}), nu = {
   viewBox: "0 0 24 24",
   width: "1.2em",
   height: "1.2em"
 };
-function nu(e, t) {
-  return je(), Ot("svg", ou, [...t[0] || (t[0] = [
+function iu(e, t) {
+  return je(), Ot("svg", nu, [...t[0] || (t[0] = [
     Ae("path", {
       fill: "none",
       stroke: "currentColor",
@@ -5014,13 +5024,13 @@ function nu(e, t) {
     }, null, -1)
   ])]);
 }
-const iu = oo({ name: "lucide-minimize2", render: nu }), su = {
+const su = oo({ name: "lucide-minimize2", render: iu }), lu = {
   viewBox: "0 0 24 24",
   width: "1.2em",
   height: "1.2em"
 };
-function lu(e, t) {
-  return je(), Ot("svg", su, [...t[0] || (t[0] = [
+function au(e, t) {
+  return je(), Ot("svg", lu, [...t[0] || (t[0] = [
     Ae("g", {
       fill: "none",
       stroke: "currentColor",
@@ -5039,25 +5049,25 @@ function lu(e, t) {
     ], -1)
   ])]);
 }
-const au = oo({ name: "lucide-picture-in-picture", render: lu }), Is = Symbol("duplex-channel");
-function Df() {
-  const e = Ie(Is);
+const cu = oo({ name: "lucide-picture-in-picture", render: au }), Ms = Symbol("duplex-channel");
+function Ff() {
+  const e = Ie(Ms);
   if (!e)
     throw new Error(
       "The duplex channel is not provided. Make sure to use it inside the context of a component that provides it."
     );
   return e;
 }
-const Ms = Symbol("queries");
-function Ff() {
-  const e = Ie(Ms);
+const Ds = Symbol("queries");
+function Vf() {
+  const e = Ie(Ds);
   if (!e)
     throw new Error(
       "The query entries are not provided. Make sure to use it inside the context of a component that provides it."
     );
   return e;
 }
-const cu = { class: "w-full h-full grid grid-rows-[auto_1fr] bg-ui-bg text-ui-text font-sans" }, uu = { class: "flex items-center border-b border-(--ui-border) select-none" }, fu = ["href", "onClick"], du = { class: "flex items-center py-1 gap-1 pr-1" }, hu = /* @__PURE__ */ Pt({
+const uu = { class: "w-full h-full grid grid-rows-[auto_1fr] bg-ui-bg text-ui-text font-sans" }, fu = { class: "flex items-center border-b border-(--ui-border) select-none" }, du = ["href", "onClick"], hu = { class: "flex items-center py-1 gap-1 pr-1" }, pu = /* @__PURE__ */ Tt({
   __name: "DevtoolsPanel.ce",
   props: {
     port: { type: null },
@@ -5065,8 +5075,8 @@ const cu = { class: "w-full h-full grid grid-rows-[auto_1fr] bg-ui-bg text-ui-te
   },
   emits: ["togglePip", "closePip", "ready", "close"],
   setup(e, { emit: t }) {
-    const r = t, o = new Ws(e.port);
-    Bt(Is, o), $e(
+    const r = t, o = new Gs(e.port);
+    Bt(Ms, o), $e(
       () => e.port,
       (i, s) => {
         o.setPort(i);
@@ -5078,8 +5088,8 @@ const cu = { class: "w-full h-full grid grid-rows-[auto_1fr] bg-ui-bg text-ui-te
         r("ready");
       });
     });
-    const n = Tt([]);
-    return Bt(Ms, n), o.on("queries:all", (i) => {
+    const n = Pt([]);
+    return Bt(Ds, n), o.on("queries:all", (i) => {
       n.value = i;
     }), o.on("queries:update", (i) => {
       const s = n.value.findIndex((l) => l.keyHash === i.keyHash);
@@ -5088,18 +5098,18 @@ const cu = { class: "w-full h-full grid grid-rows-[auto_1fr] bg-ui-bg text-ui-te
       const s = n.value.findIndex((l) => l.keyHash === i.keyHash);
       s !== -1 && n.value.splice(s, 1);
     }), (i, s) => {
-      const l = yn("RouterLink"), a = au, u = iu, c = ru, d = tu, m = yn("RouterView"), g = Xc;
+      const l = yn("RouterLink"), a = cu, u = su, c = ou, d = ru, m = yn("RouterView"), g = Zc;
       return je(), Ut(g, {
         id: "root",
         "is-pip": e.isPip
       }, {
         default: er(() => [
-          Ae("main", cu, [
-            Ae("div", uu, [
+          Ae("main", uu, [
+            Ae("div", fu, [
               s[2] || (s[2] = Ae("div", { class: "flex items-center p-2 mr-2" }, [
                 Ae("span", { class: "text-xl" }, "🍹")
               ], -1)),
-              (je(), Ot(Ce, null, Zl(["/queries", "/mutations"], (x) => ae(l, {
+              (je(), Ot(Ce, null, ea(["/queries", "/mutations"], (x) => ae(l, {
                 key: x,
                 custom: "",
                 to: x
@@ -5109,12 +5119,12 @@ const cu = { class: "w-full h-full grid grid-rows-[auto_1fr] bg-ui-bg text-ui-te
                     href: M,
                     class: Jt([k ? "border-theme" : "border-transparent text-(--ui-text-dimmed)", "px-4 py-2 font-medium transition-colors hover:bg-theme-400 relative theme-primary border-b-2 hover:border-theme-300"]),
                     onClick: S
-                  }, gi(x.slice(1, 2).toUpperCase() + x.slice(2)), 11, fu)
+                  }, mi(x.slice(1, 2).toUpperCase() + x.slice(2)), 11, du)
                 ]),
                 _: 2
               }, 1032, ["to"])), 64)),
               s[3] || (s[3] = Ae("div", { class: "flex-grow" }, null, -1)),
-              Ae("div", du, [
+              Ae("div", hu, [
                 ae(c, {
                   class: "variant-ghost theme-neutral",
                   title: e.isPip ? "Restore window" : "Open in a new window",
@@ -5150,23 +5160,18 @@ const cu = { class: "w-full h-full grid grid-rows-[auto_1fr] bg-ui-bg text-ui-te
       }, 8, ["is-pip"]);
     };
   }
-}), pu = '/*! tailwindcss v4.1.13 | MIT License | https://tailwindcss.com */@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-translate-x:0;--tw-translate-y:0;--tw-translate-z:0;--tw-rotate-x:initial;--tw-rotate-y:initial;--tw-rotate-z:initial;--tw-skew-x:initial;--tw-skew-y:initial;--tw-space-y-reverse:0;--tw-space-x-reverse:0;--tw-divide-y-reverse:0;--tw-border-style:solid;--tw-leading:initial;--tw-font-weight:initial;--tw-shadow:0 0 #0000;--tw-shadow-color:initial;--tw-shadow-alpha:100%;--tw-inset-shadow:0 0 #0000;--tw-inset-shadow-color:initial;--tw-inset-shadow-alpha:100%;--tw-ring-color:initial;--tw-ring-shadow:0 0 #0000;--tw-inset-ring-color:initial;--tw-inset-ring-shadow:0 0 #0000;--tw-ring-inset:initial;--tw-ring-offset-width:0px;--tw-ring-offset-color:#fff;--tw-ring-offset-shadow:0 0 #0000;--tw-blur:initial;--tw-brightness:initial;--tw-contrast:initial;--tw-grayscale:initial;--tw-hue-rotate:initial;--tw-invert:initial;--tw-opacity:initial;--tw-saturate:initial;--tw-sepia:initial;--tw-drop-shadow:initial;--tw-drop-shadow-color:initial;--tw-drop-shadow-alpha:100%;--tw-drop-shadow-size:initial;--tw-duration:initial;--tw-outline-style:solid;--progress-value:0}}}.splitpanes{width:100%;height:100%;display:flex}.splitpanes--vertical{flex-direction:row}.splitpanes--horizontal{flex-direction:column}.splitpanes--dragging .splitpanes__pane{-webkit-user-select:none;user-select:none;pointer-events:none}.splitpanes__pane{width:100%;height:100%;overflow:auto}.splitpanes--vertical .splitpanes__pane{transition:width .2s ease-out}.splitpanes--horizontal .splitpanes__pane{transition:height .2s ease-out}.splitpanes--dragging .splitpanes__pane{transition:none}.splitpanes__splitter{touch-action:none;-webkit-user-select:none;user-select:none}.splitpanes--vertical>.splitpanes__splitter{cursor:col-resize;min-width:1px}.splitpanes--horizontal>.splitpanes__splitter{cursor:row-resize;min-height:1px}.splitpanes.default-theme .splitpanes__pane{background-color:#f2f2f2}.splitpanes.default-theme .splitpanes__splitter{box-sizing:border-box;background-color:#fff;flex-shrink:0;position:relative}.splitpanes.default-theme .splitpanes__splitter:before,.splitpanes.default-theme .splitpanes__splitter:after{content:"";background-color:#00000026;transition:background-color .3s;position:absolute;top:50%;left:50%}.splitpanes.default-theme .splitpanes__splitter:hover:before,.splitpanes.default-theme .splitpanes__splitter:hover:after{background-color:#00000040}.splitpanes.default-theme .splitpanes__splitter:first-child{cursor:auto}.default-theme.splitpanes .splitpanes .splitpanes__splitter{z-index:1}.default-theme.splitpanes--vertical>.splitpanes__splitter,.default-theme .splitpanes--vertical>.splitpanes__splitter{border-left:1px solid #eee;width:7px;margin-left:-1px}.default-theme.splitpanes--vertical>.splitpanes__splitter:before,.default-theme.splitpanes--vertical>.splitpanes__splitter:after,.default-theme .splitpanes--vertical>.splitpanes__splitter:before,.default-theme .splitpanes--vertical>.splitpanes__splitter:after{width:1px;height:30px;transform:translateY(-50%)}.default-theme.splitpanes--vertical>.splitpanes__splitter:before,.default-theme .splitpanes--vertical>.splitpanes__splitter:before{margin-left:-2px}.default-theme.splitpanes--vertical>.splitpanes__splitter:after,.default-theme .splitpanes--vertical>.splitpanes__splitter:after{margin-left:1px}.default-theme.splitpanes--horizontal>.splitpanes__splitter,.default-theme .splitpanes--horizontal>.splitpanes__splitter{border-top:1px solid #eee;height:7px;margin-top:-1px}.default-theme.splitpanes--horizontal>.splitpanes__splitter:before,.default-theme.splitpanes--horizontal>.splitpanes__splitter:after,.default-theme .splitpanes--horizontal>.splitpanes__splitter:before,.default-theme .splitpanes--horizontal>.splitpanes__splitter:after{width:30px;height:1px;transform:translate(-50%)}.default-theme.splitpanes--horizontal>.splitpanes__splitter:before,.default-theme .splitpanes--horizontal>.splitpanes__splitter:before{margin-top:-2px}.default-theme.splitpanes--horizontal>.splitpanes__splitter:after,.default-theme .splitpanes--horizontal>.splitpanes__splitter:after{margin-top:1px}.splitpanes__splitter{--grab-size:-4px;background-color:var(--ui-text);transition:background-color .2s;position:relative}@supports (color:color-mix(in lab,red,red)){.splitpanes__splitter{background-color:color-mix(in lab,var(--ui-text)20%,var(--ui-bg))}}.splitpanes--vertical>.splitpanes__splitter:before{left:var(--grab-size);right:var(--grab-size);height:100%}.splitpanes--horizontal>.splitpanes__splitter:before{top:var(--grab-size);bottom:var(--grab-size);width:100%}.splitpanes__splitter:before{content:"";z-index:10000;transition:background-color .25s ease-out;position:absolute;inset:0}.splitpanes__splitter:hover:before{background-color:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){.splitpanes__splitter:hover:before{background-color:color-mix(in lab,var(--ui-text),transparent 75%)}}.splitpanes__splitter:hover:before{opacity:1}@layer theme{:root,:host{--font-sans:ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--font-mono:ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--color-red-50:oklch(97.1% .013 17.38);--color-red-100:oklch(93.6% .032 17.717);--color-red-200:oklch(88.5% .062 18.334);--color-red-300:oklch(80.8% .114 19.571);--color-red-400:oklch(70.4% .191 22.216);--color-red-500:oklch(63.7% .237 25.331);--color-red-600:oklch(57.7% .245 27.325);--color-red-700:oklch(50.5% .213 27.518);--color-red-800:oklch(44.4% .177 26.899);--color-red-900:oklch(39.6% .141 25.723);--color-red-950:oklch(25.8% .092 26.042);--color-orange-50:oklch(98% .016 73.684);--color-orange-100:oklch(95.4% .038 75.164);--color-orange-200:oklch(90.1% .076 70.697);--color-orange-300:oklch(83.7% .128 66.29);--color-orange-400:oklch(75% .183 55.934);--color-orange-500:oklch(70.5% .213 47.604);--color-orange-600:oklch(64.6% .222 41.116);--color-orange-700:oklch(55.3% .195 38.402);--color-orange-800:oklch(47% .157 37.304);--color-orange-900:oklch(40.8% .123 38.172);--color-orange-950:oklch(26.6% .079 36.259);--color-yellow-50:oklch(98.7% .026 102.212);--color-yellow-100:oklch(97.3% .071 103.193);--color-yellow-200:oklch(94.5% .129 101.54);--color-yellow-300:oklch(90.5% .182 98.111);--color-yellow-400:oklch(85.2% .199 91.936);--color-yellow-500:oklch(79.5% .184 86.047);--color-yellow-600:oklch(68.1% .162 75.834);--color-yellow-700:oklch(55.4% .135 66.442);--color-yellow-800:oklch(47.6% .114 61.907);--color-yellow-900:oklch(42.1% .095 57.708);--color-yellow-950:oklch(28.6% .066 53.813);--color-lime-50:oklch(98.6% .031 120.757);--color-lime-100:oklch(96.7% .067 122.328);--color-lime-200:oklch(93.8% .127 124.321);--color-lime-300:oklch(89.7% .196 126.665);--color-lime-400:oklch(84.1% .238 128.85);--color-lime-500:oklch(76.8% .233 130.85);--color-lime-600:oklch(64.8% .2 131.684);--color-lime-700:oklch(53.2% .157 131.589);--color-lime-800:oklch(45.3% .124 130.933);--color-lime-900:oklch(40.5% .101 131.063);--color-lime-950:oklch(27.4% .072 132.109);--color-green-50:oklch(98.2% .018 155.826);--color-green-100:oklch(96.2% .044 156.743);--color-green-200:oklch(92.5% .084 155.995);--color-green-300:oklch(87.1% .15 154.449);--color-green-400:oklch(79.2% .209 151.711);--color-green-500:oklch(72.3% .219 149.579);--color-green-600:oklch(62.7% .194 149.214);--color-green-700:oklch(52.7% .154 150.069);--color-green-800:oklch(44.8% .119 151.328);--color-green-900:oklch(39.3% .095 152.535);--color-green-950:oklch(26.6% .065 152.934);--color-blue-50:oklch(97% .014 254.604);--color-blue-100:oklch(93.2% .032 255.585);--color-blue-200:oklch(88.2% .059 254.128);--color-blue-300:oklch(80.9% .105 251.813);--color-blue-400:oklch(70.7% .165 254.624);--color-blue-500:oklch(62.3% .214 259.815);--color-blue-600:oklch(54.6% .245 262.881);--color-blue-700:oklch(48.8% .243 264.376);--color-blue-800:oklch(42.4% .199 265.638);--color-blue-900:oklch(37.9% .146 265.522);--color-blue-950:oklch(28.2% .091 267.935);--color-purple-50:oklch(97.7% .014 308.299);--color-purple-100:oklch(94.6% .033 307.174);--color-purple-200:oklch(90.2% .063 306.703);--color-purple-300:oklch(82.7% .119 306.383);--color-purple-400:oklch(71.4% .203 305.504);--color-purple-500:oklch(62.7% .265 303.9);--color-purple-600:oklch(55.8% .288 302.321);--color-purple-700:oklch(49.6% .265 301.924);--color-purple-800:oklch(43.8% .218 303.724);--color-purple-900:oklch(38.1% .176 304.987);--color-purple-950:oklch(29.1% .149 302.717);--color-gray-50:oklch(98.5% .002 247.839);--color-gray-100:oklch(96.7% .003 264.542);--color-gray-200:oklch(92.8% .006 264.531);--color-gray-300:oklch(87.2% .01 258.338);--color-gray-400:oklch(70.7% .022 261.325);--color-gray-500:oklch(55.1% .027 264.364);--color-gray-600:oklch(44.6% .03 256.802);--color-gray-700:oklch(37.3% .034 259.733);--color-gray-800:oklch(27.8% .033 256.848);--color-gray-900:oklch(21% .034 264.665);--color-gray-950:oklch(13% .028 261.692);--color-neutral-50:var(--color-gray-50);--color-neutral-100:var(--color-gray-100);--color-neutral-200:var(--color-gray-200);--color-neutral-300:var(--color-gray-300);--color-neutral-400:var(--color-gray-400);--color-neutral-500:var(--color-gray-500);--color-neutral-600:var(--color-gray-600);--color-neutral-700:var(--color-gray-700);--color-neutral-800:var(--color-gray-800);--color-neutral-900:var(--color-gray-900);--color-neutral-950:var(--color-gray-950);--color-white:#fff;--spacing:.25rem;--container-md:28rem;--text-xs:.75rem;--text-xs--line-height:calc(1/.75);--text-sm:.875rem;--text-sm--line-height:calc(1.25/.875);--text-lg:1.125rem;--text-lg--line-height:calc(1.75/1.125);--text-xl:1.25rem;--text-xl--line-height:calc(1.75/1.25);--text-2xl:1.5rem;--text-2xl--line-height:calc(2/1.5);--font-weight-medium:500;--font-weight-semibold:600;--font-weight-bold:700;--font-weight-extrabold:800;--leading-snug:1.375;--radius-xs:.125rem;--radius-sm:.25rem;--radius-md:.375rem;--radius-lg:.5rem;--animate-spin:spin 1s linear infinite;--default-transition-duration:.15s;--default-transition-timing-function:cubic-bezier(.4,0,.2,1);--default-font-family:var(--font-sans);--default-mono-font-family:var(--font-mono);--color-primary-50:var(--color-lime-50);--color-primary-100:var(--color-lime-100);--color-primary-200:var(--color-lime-200);--color-primary-300:var(--color-lime-300);--color-primary-400:var(--color-lime-400);--color-primary-500:var(--color-lime-500);--color-primary-600:var(--color-lime-600);--color-primary-700:var(--color-lime-700);--color-primary-800:var(--color-lime-800);--color-primary-900:var(--color-lime-900);--color-primary-950:var(--color-lime-950);--color-secondary-50:var(--color-yellow-50);--color-secondary-100:var(--color-yellow-100);--color-secondary-200:var(--color-yellow-200);--color-secondary-300:var(--color-yellow-300);--color-secondary-400:var(--color-yellow-400);--color-secondary-500:var(--color-yellow-500);--color-secondary-600:var(--color-yellow-600);--color-secondary-700:var(--color-yellow-700);--color-secondary-800:var(--color-yellow-800);--color-secondary-900:var(--color-yellow-900);--color-success-50:var(--color-green-50);--color-success-100:var(--color-green-100);--color-success-200:var(--color-green-200);--color-success-300:var(--color-green-300);--color-success-400:var(--color-green-400);--color-success-500:var(--color-green-500);--color-success-600:var(--color-green-600);--color-success-700:var(--color-green-700);--color-success-800:var(--color-green-800);--color-success-900:var(--color-green-900);--color-success-950:var(--color-green-950);--color-warning-50:var(--color-orange-50);--color-warning-100:var(--color-orange-100);--color-warning-200:var(--color-orange-200);--color-warning-300:var(--color-orange-300);--color-warning-400:var(--color-orange-400);--color-warning-500:var(--color-orange-500);--color-warning-600:var(--color-orange-600);--color-warning-700:var(--color-orange-700);--color-warning-800:var(--color-orange-800);--color-warning-900:var(--color-orange-900);--color-warning-950:var(--color-orange-950);--color-error-50:var(--color-red-50);--color-error-100:var(--color-red-100);--color-error-200:var(--color-red-200);--color-error-300:var(--color-red-300);--color-error-400:var(--color-red-400);--color-error-500:var(--color-red-500);--color-error-600:var(--color-red-600);--color-error-700:var(--color-red-700);--color-error-800:var(--color-red-800);--color-error-900:var(--color-red-900);--color-error-950:var(--color-red-950);--color-info-50:var(--color-blue-50);--color-info-100:var(--color-blue-100);--color-info-200:var(--color-blue-200);--color-info-300:var(--color-blue-300);--color-info-400:var(--color-blue-400);--color-info-500:var(--color-blue-500);--color-info-600:var(--color-blue-600);--color-info-700:var(--color-blue-700);--color-info-800:var(--color-blue-800);--color-info-900:var(--color-blue-900);--color-info-950:var(--color-blue-950);--color-theme:var(--ui-neutral);--color-theme-50:var(--color-neutral-50);--color-theme-100:var(--color-neutral-100);--color-theme-200:var(--color-neutral-200);--color-theme-300:var(--color-neutral-300);--color-theme-400:var(--color-neutral-400);--color-theme-500:var(--color-neutral-500);--color-theme-600:var(--color-neutral-600);--color-theme-700:var(--color-neutral-700);--color-theme-800:var(--color-neutral-800);--color-theme-900:var(--color-neutral-900);--color-theme-950:var(--color-neutral-950)}}@layer base{*,:after,:before,::backdrop{box-sizing:border-box;border:0 solid;margin:0;padding:0}::file-selector-button{box-sizing:border-box;border:0 solid;margin:0;padding:0}html,:host{-webkit-text-size-adjust:100%;tab-size:4;line-height:1.5;font-family:var(--default-font-family,ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji");font-feature-settings:var(--default-font-feature-settings,normal);font-variation-settings:var(--default-font-variation-settings,normal);-webkit-tap-highlight-color:transparent}hr{height:0;color:inherit;border-top-width:1px}abbr:where([title]){-webkit-text-decoration:underline dotted;text-decoration:underline dotted}h1,h2,h3,h4,h5,h6{font-size:inherit;font-weight:inherit}a{color:inherit;-webkit-text-decoration:inherit;text-decoration:inherit}b,strong{font-weight:bolder}code,kbd,samp,pre{font-family:var(--default-mono-font-family,ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace);font-feature-settings:var(--default-mono-font-feature-settings,normal);font-variation-settings:var(--default-mono-font-variation-settings,normal);font-size:1em}small{font-size:80%}sub,sup{vertical-align:baseline;font-size:75%;line-height:0;position:relative}sub{bottom:-.25em}sup{top:-.5em}table{text-indent:0;border-color:inherit;border-collapse:collapse}:-moz-focusring{outline:auto}progress{vertical-align:baseline}summary{display:list-item}ol,ul,menu{list-style:none}img,svg,video,canvas,audio,iframe,embed,object{vertical-align:middle;display:block}img,video{max-width:100%;height:auto}button,input,select,optgroup,textarea{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}::file-selector-button{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}:where(select:is([multiple],[size])) optgroup{font-weight:bolder}:where(select:is([multiple],[size])) optgroup option{padding-inline-start:20px}::file-selector-button{margin-inline-end:4px}::placeholder{opacity:1}@supports (not ((-webkit-appearance:-apple-pay-button))) or (contain-intrinsic-size:1px){::placeholder{color:currentColor}@supports (color:color-mix(in lab,red,red)){::placeholder{color:color-mix(in oklab,currentcolor 50%,transparent)}}}textarea{resize:vertical}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-date-and-time-value{min-height:1lh;text-align:inherit}::-webkit-datetime-edit{display:inline-flex}::-webkit-datetime-edit-fields-wrapper{padding:0}::-webkit-datetime-edit{padding-block:0}::-webkit-datetime-edit-year-field{padding-block:0}::-webkit-datetime-edit-month-field{padding-block:0}::-webkit-datetime-edit-day-field{padding-block:0}::-webkit-datetime-edit-hour-field{padding-block:0}::-webkit-datetime-edit-minute-field{padding-block:0}::-webkit-datetime-edit-second-field{padding-block:0}::-webkit-datetime-edit-millisecond-field{padding-block:0}::-webkit-datetime-edit-meridiem-field{padding-block:0}::-webkit-calendar-picker-indicator{line-height:1}:-moz-ui-invalid{box-shadow:none}button,input:where([type=button],[type=reset],[type=submit]){appearance:button}::file-selector-button{appearance:button}::-webkit-inner-spin-button{height:auto}::-webkit-outer-spin-button{height:auto}[hidden]:where(:not([hidden=until-found])){display:none!important}}@layer components;@layer utilities{.\\@container{container-type:inline-size}.collapse{visibility:collapse}.absolute{position:absolute}.fixed{position:fixed}.relative{position:relative}.static{position:static}.-inset-1{inset:calc(var(--spacing)*-1)}.top-1\\/2{top:50%}.right-0{right:calc(var(--spacing)*0)}.bottom-0{bottom:calc(var(--spacing)*0)}.left-0{left:calc(var(--spacing)*0)}.left-2{left:calc(var(--spacing)*2)}.z-9999,.z-\\[9999\\]{z-index:9999}.container{width:100%}@media(min-width:40rem){.container{max-width:40rem}}@media(min-width:48rem){.container{max-width:48rem}}@media(min-width:64rem){.container{max-width:64rem}}@media(min-width:80rem){.container{max-width:80rem}}@media(min-width:96rem){.container{max-width:96rem}}.m-0{margin:calc(var(--spacing)*0)}.mx-auto{margin-inline:auto}.my-2{margin-block:calc(var(--spacing)*2)}.mt-1{margin-top:calc(var(--spacing)*1)}.mr-2{margin-right:calc(var(--spacing)*2)}.mb-12{margin-bottom:calc(var(--spacing)*12)}.ml-5{margin-left:calc(var(--spacing)*5)}.block{display:block}.flex{display:flex}.grid{display:grid}.inline{display:inline}.inline-block{display:inline-block}.size-2{width:calc(var(--spacing)*2);height:calc(var(--spacing)*2)}.size-3{width:calc(var(--spacing)*3);height:calc(var(--spacing)*3)}.size-3\\.5{width:calc(var(--spacing)*3.5);height:calc(var(--spacing)*3.5)}.size-4{width:calc(var(--spacing)*4);height:calc(var(--spacing)*4)}.size-\\[1em\\]{width:1em;height:1em}.h-5{height:calc(var(--spacing)*5)}.h-40{height:calc(var(--spacing)*40)}.h-\\[8px\\]{height:8px}.h-full{height:100%}.max-h-\\[80\\%\\]{max-height:80%}.max-h-\\[1200px\\]{max-height:1200px}.min-h-\\[20vh\\]{min-height:20vh}.w-5{width:calc(var(--spacing)*5)}.w-6{width:calc(var(--spacing)*6)}.w-8{width:calc(var(--spacing)*8)}.w-40{width:calc(var(--spacing)*40)}.w-full{width:100%}.max-w-md{max-width:var(--container-md)}.min-w-\\[1\\.65em\\]{min-width:1.65em}.flex-grow{flex-grow:1}.-translate-y-1\\/2{--tw-translate-y: -50% ;translate:var(--tw-translate-x)var(--tw-translate-y)}.rotate-90{rotate:90deg}.transform{transform:var(--tw-rotate-x,)var(--tw-rotate-y,)var(--tw-rotate-z,)var(--tw-skew-x,)var(--tw-skew-y,)}.animate-spin{animation:var(--animate-spin)}.cursor-col-resize{cursor:col-resize}.cursor-pointer{cursor:pointer}.cursor-row-resize{cursor:row-resize}.touch-none{touch-action:none}.grid-flow-col{grid-auto-flow:column}.grid-cols-\\[auto_1fr\\]{grid-template-columns:auto 1fr}.grid-cols-\\[minmax\\(0\\,auto\\)_1fr\\]{grid-template-columns:minmax(0,auto) 1fr}.grid-rows-\\[auto_1fr\\]{grid-template-rows:auto 1fr}.flex-col{flex-direction:column}.flex-wrap{flex-wrap:wrap}.items-center{align-items:center}.justify-center{justify-content:center}.justify-end{justify-content:flex-end}.justify-items-start{justify-items:start}.gap-0\\.5{gap:calc(var(--spacing)*.5)}.gap-1{gap:calc(var(--spacing)*1)}.gap-1\\.5{gap:calc(var(--spacing)*1.5)}.gap-2{gap:calc(var(--spacing)*2)}.gap-4{gap:calc(var(--spacing)*4)}:where(.space-y-1>:not(:last-child)){--tw-space-y-reverse:0;margin-block-start:calc(calc(var(--spacing)*1)*var(--tw-space-y-reverse));margin-block-end:calc(calc(var(--spacing)*1)*calc(1 - var(--tw-space-y-reverse)))}:where(.space-y-2>:not(:last-child)){--tw-space-y-reverse:0;margin-block-start:calc(calc(var(--spacing)*2)*var(--tw-space-y-reverse));margin-block-end:calc(calc(var(--spacing)*2)*calc(1 - var(--tw-space-y-reverse)))}:where(.space-y-6>:not(:last-child)){--tw-space-y-reverse:0;margin-block-start:calc(calc(var(--spacing)*6)*var(--tw-space-y-reverse));margin-block-end:calc(calc(var(--spacing)*6)*calc(1 - var(--tw-space-y-reverse)))}.gap-x-0\\.5{column-gap:calc(var(--spacing)*.5)}.gap-x-1{column-gap:calc(var(--spacing)*1)}.gap-x-2{column-gap:calc(var(--spacing)*2)}:where(.space-x-2>:not(:last-child)){--tw-space-x-reverse:0;margin-inline-start:calc(calc(var(--spacing)*2)*var(--tw-space-x-reverse));margin-inline-end:calc(calc(var(--spacing)*2)*calc(1 - var(--tw-space-x-reverse)))}:where(.divide-y>:not(:last-child)){--tw-divide-y-reverse:0;border-bottom-style:var(--tw-border-style);border-top-style:var(--tw-border-style);border-top-width:calc(1px*var(--tw-divide-y-reverse));border-bottom-width:calc(1px*calc(1 - var(--tw-divide-y-reverse)))}:where(.divide-\\(--ui-border\\)>:not(:last-child)){border-color:var(--ui-border)}:where(.divide-\\(--ui-border-accented\\)>:not(:last-child)){border-color:var(--ui-border-accented)}.overflow-auto{overflow:auto}.overflow-hidden{overflow:hidden}.rounded{border-radius:.25rem}.rounded-full{border-radius:3.40282e38px}.rounded-lg{border-radius:var(--radius-lg)}.rounded-md{border-radius:var(--radius-md)}.rounded-sm{border-radius:var(--radius-sm)}.rounded-xs{border-radius:var(--radius-xs)}.rounded-l{border-top-left-radius:.25rem;border-bottom-left-radius:.25rem}.rounded-tl{border-top-left-radius:.25rem}.border{border-style:var(--tw-border-style);border-width:1px}.border-t{border-top-style:var(--tw-border-style);border-top-width:1px}.border-b{border-bottom-style:var(--tw-border-style);border-bottom-width:1px}.border-b-2{border-bottom-style:var(--tw-border-style);border-bottom-width:2px}.border-\\(--ui-border\\){border-color:var(--ui-border)}.border-theme{border-color:var(--color-theme)}.border-transparent{border-color:#0000}.bg-\\(--ui-bg-accented\\){background-color:var(--ui-bg-accented)}.bg-\\(--ui-bg-muted\\){background-color:var(--ui-bg-muted)}.bg-\\(--ui-border\\){background-color:var(--ui-border)}.bg-\\(--ui-text\\)\\/5{background-color:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){.bg-\\(--ui-text\\)\\/5{background-color:color-mix(in oklab,var(--ui-text)5%,transparent)}}.bg-error-200{background-color:var(--color-error-200)}.bg-error-500{background-color:var(--color-error-500)}.bg-gray-200{background-color:var(--color-gray-200)}.bg-gray-400{background-color:var(--color-gray-400)}.bg-info-200{background-color:var(--color-info-200)}.bg-info-500{background-color:var(--color-info-500)}.bg-neutral-200{background-color:var(--color-neutral-200)}.bg-neutral-400{background-color:var(--color-neutral-400)}.bg-neutral-500\\/20{background-color:#6a728233}@supports (color:color-mix(in lab,red,red)){.bg-neutral-500\\/20{background-color:color-mix(in oklab,var(--color-neutral-500)20%,transparent)}}.bg-purple-200{background-color:var(--color-purple-200)}.bg-purple-400{background-color:var(--color-purple-400)}.bg-success-200{background-color:var(--color-success-200)}.bg-success-500{background-color:var(--color-success-500)}.bg-theme-400{background-color:var(--color-theme-400)}.bg-theme\\/70{background-color:var(--color-theme)}@supports (color:color-mix(in lab,red,red)){.bg-theme\\/70{background-color:color-mix(in oklab,var(--color-theme)70%,transparent)}}.bg-transparent{background-color:#0000}.bg-warning-200{background-color:var(--color-warning-200)}.bg-warning-500{background-color:var(--color-warning-500)}.p-0\\.5{padding:calc(var(--spacing)*.5)}.p-1{padding:calc(var(--spacing)*1)}.p-2{padding:calc(var(--spacing)*2)}.px-0\\.5{padding-inline:calc(var(--spacing)*.5)}.px-1{padding-inline:calc(var(--spacing)*1)}.px-1\\.5{padding-inline:calc(var(--spacing)*1.5)}.px-2{padding-inline:calc(var(--spacing)*2)}.px-3{padding-inline:calc(var(--spacing)*3)}.px-4{padding-inline:calc(var(--spacing)*4)}.px-6{padding-inline:calc(var(--spacing)*6)}.py-0\\.5{padding-block:calc(var(--spacing)*.5)}.py-1{padding-block:calc(var(--spacing)*1)}.py-1\\.5{padding-block:calc(var(--spacing)*1.5)}.py-2{padding-block:calc(var(--spacing)*2)}.py-6{padding-block:calc(var(--spacing)*6)}.pt-6{padding-top:calc(var(--spacing)*6)}.pr-1{padding-right:calc(var(--spacing)*1)}.pr-2{padding-right:calc(var(--spacing)*2)}.pl-8{padding-left:calc(var(--spacing)*8)}.text-center{text-align:center}.font-mono{font-family:var(--font-mono)}.font-sans{font-family:var(--font-sans)}.text-2xl{font-size:var(--text-2xl);line-height:var(--tw-leading,var(--text-2xl--line-height))}.text-lg{font-size:var(--text-lg);line-height:var(--tw-leading,var(--text-lg--line-height))}.text-sm{font-size:var(--text-sm);line-height:var(--tw-leading,var(--text-sm--line-height))}.text-xl{font-size:var(--text-xl);line-height:var(--tw-leading,var(--text-xl--line-height))}.text-xs{font-size:var(--text-xs);line-height:var(--tw-leading,var(--text-xs--line-height))}.leading-6{--tw-leading:calc(var(--spacing)*6);line-height:calc(var(--spacing)*6)}.leading-snug{--tw-leading:var(--leading-snug);line-height:var(--leading-snug)}.font-bold{--tw-font-weight:var(--font-weight-bold);font-weight:var(--font-weight-bold)}.font-extrabold{--tw-font-weight:var(--font-weight-extrabold);font-weight:var(--font-weight-extrabold)}.font-medium{--tw-font-weight:var(--font-weight-medium);font-weight:var(--font-weight-medium)}.font-semibold{--tw-font-weight:var(--font-weight-semibold);font-weight:var(--font-weight-semibold)}.text-wrap{text-wrap:wrap}.break-words{overflow-wrap:break-word}.text-\\(--color-gray-900\\){color:var(--color-gray-900)}.text-\\(--devtools-syntax-gray\\){color:var(--devtools-syntax-gray)}.text-\\(--devtools-syntax-green\\){color:var(--devtools-syntax-green)}.text-\\(--devtools-syntax-orange\\){color:var(--devtools-syntax-orange)}.text-\\(--devtools-syntax-purple\\){color:var(--devtools-syntax-purple)}.text-\\(--devtools-syntax-red\\){color:var(--devtools-syntax-red)}.text-\\(--devtools-syntax-sapphire\\){color:var(--devtools-syntax-sapphire)}.text-\\(--ui-text\\),.text-\\(--ui-text\\)\\/50{color:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){.text-\\(--ui-text\\)\\/50{color:color-mix(in oklab,var(--ui-text)50%,transparent)}}.text-\\(--ui-text-dimmed\\){color:var(--ui-text-dimmed)}.text-\\(--ui-text-muted\\){color:var(--ui-text-muted)}.text-error-100{color:var(--color-error-100)}.text-gray-100{color:var(--color-gray-100)}.text-info-100{color:var(--color-info-100)}.text-neutral-100{color:var(--color-neutral-100)}.text-neutral-400{color:var(--color-neutral-400)}.text-neutral-500\\/50{color:#6a728280}@supports (color:color-mix(in lab,red,red)){.text-neutral-500\\/50{color:color-mix(in oklab,var(--color-neutral-500)50%,transparent)}}.text-purple-100{color:var(--color-purple-100)}.text-success-100{color:var(--color-success-100)}.text-warning-100{color:var(--color-warning-100)}.shadow{--tw-shadow:0 1px 3px 0 var(--tw-shadow-color,#0000001a),0 1px 2px -1px var(--tw-shadow-color,#0000001a);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}.ring-\\(--ui-bg-muted\\){--tw-ring-color:var(--ui-bg-muted)}.filter{filter:var(--tw-blur,)var(--tw-brightness,)var(--tw-contrast,)var(--tw-grayscale,)var(--tw-hue-rotate,)var(--tw-invert,)var(--tw-saturate,)var(--tw-sepia,)var(--tw-drop-shadow,)}.transition{transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to,opacity,box-shadow,transform,translate,scale,rotate,filter,-webkit-backdrop-filter,backdrop-filter,display,content-visibility,overlay,pointer-events;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-\\[background-color\\]{transition-property:background-color;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-colors{transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-transform{transition-property:transform,translate,scale,rotate;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.duration-200{--tw-duration:.2s;transition-duration:.2s}.select-none{-webkit-user-select:none;user-select:none}@media(hover:hover){.hover\\:cursor-pointer:hover{cursor:pointer}.hover\\:border-theme-300:hover{border-color:var(--color-theme-300)}.hover\\:bg-\\(--ui-bg-elevated\\):hover{background-color:var(--ui-bg-elevated)}.hover\\:bg-\\(--ui-bg-muted\\):hover{background-color:var(--ui-bg-muted)}.hover\\:bg-\\(--ui-border\\):hover{background-color:var(--ui-border)}.hover\\:bg-theme-400:hover{background-color:var(--color-theme-400)}.hover\\:bg-theme-600:hover{background-color:var(--color-theme-600)}.hover\\:ring:hover{--tw-ring-shadow:var(--tw-ring-inset,)0 0 0 calc(1px + var(--tw-ring-offset-width))var(--tw-ring-color,currentcolor);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}}.focus\\:ring-1:focus{--tw-ring-shadow:var(--tw-ring-inset,)0 0 0 calc(1px + var(--tw-ring-offset-width))var(--tw-ring-color,currentcolor);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}.focus\\:ring-theme:focus{--tw-ring-color:var(--color-theme)}.focus\\:outline-none:focus{--tw-outline-style:none;outline-style:none}.focus-visible\\:outline-2:focus-visible{outline-style:var(--tw-outline-style);outline-width:2px}.focus-visible\\:outline-offset-2:focus-visible{outline-offset:2px}.focus-visible\\:outline-theme:focus-visible{outline-color:var(--color-theme)}.disabled\\:cursor-not-allowed:disabled{cursor:not-allowed}.disabled\\:text-\\(--color-gray-700\\):disabled{color:var(--color-gray-700)}@media(min-width:48rem){.md\\:flex{display:flex}.md\\:pt-0{padding-top:calc(var(--spacing)*0)}}@container not (min-width:750px){.\\@max-\\[750px\\]\\:hidden{display:none}}@container not (min-width:28rem){.\\@max-md\\:hidden{display:none}}@media(prefers-color-scheme:dark){:where(.dark\\:divide-\\(--ui-border\\)>:not(:last-child)){border-color:var(--ui-border)}.dark\\:bg-neutral-700{background-color:var(--color-neutral-700)}.dark\\:bg-neutral-800{background-color:var(--color-neutral-800)}.dark\\:bg-theme-400{background-color:var(--color-theme-400)}.dark\\:text-neutral-500{color:var(--color-neutral-500)}@media(hover:hover){.dark\\:hover\\:bg-theme-300:hover{background-color:var(--color-theme-300)}}}}:host{color-scheme:light dark;--ui-radius:var(--radius-sm);--ui-primary:light-dark(var(--color-secondary-500),var(--color-primary-400));--ui-secondary:light-dark(var(--color-secondary-500),var(--color-secondary-400));--ui-success:light-dark(var(--color-success-500),var(--color-success-400));--ui-info:light-dark(var(--color-info-500),var(--color-info-400));--ui-warning:light-dark(var(--color-warning-500),var(--color-warning-400));--ui-error:light-dark(var(--color-error-500),var(--color-error-400));--ui-neutral:light-dark(var(--color-neutral-500),var(--color-neutral-400));--ui-text-dimmed:light-dark(var(--color-gray-400),var(--color-gray-500));--ui-text-muted:light-dark(var(--color-gray-500),var(--color-gray-400));--ui-text-toned:light-dark(var(--color-gray-600),var(--color-gray-300));--ui-text:light-dark(var(--color-gray-900),var(--color-gray-50));--ui-text-inverted:light-dark(var(--color-gray-50),var(--color-gray-900));--ui-bg:light-dark(var(--color-white),var(--color-gray-900));--ui-bg-muted:light-dark(var(--color-gray-50),var(--color-gray-800));--ui-bg-elevated:light-dark(var(--color-gray-100),var(--color-gray-700));--ui-bg-accented:light-dark(var(--color-gray-200),var(--color-gray-600));--ui-bg-inverted:light-dark(var(--color-gray-900),var(--color-white));--ui-border:var(--ui-text);font-family:sans-serif}@supports (color:color-mix(in lab,red,red)){:host{--ui-border:color-mix(in hsl,var(--ui-text)20%,transparent)}}:host{--ui-border-muted:var(--ui-text-muted)}@supports (color:color-mix(in lab,red,red)){:host{--ui-border-muted:color-mix(in hsl,var(--ui-text-muted)10%,transparent)}}:host{--ui-border-accented:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){:host{--ui-border-accented:color-mix(in hsl,var(--ui-text)35%,transparent)}}:host{--ui-border-inverted:var(--ui-text-inverted)}@supports (color:color-mix(in lab,red,red)){:host{--ui-border-inverted:color-mix(in hsl,var(--ui-text-inverted)50%,transparent)}}:host{--devtools-syntax-orange:light-dark(#fe640b,#fab387);--devtools-syntax-purple:light-dark(#8839ef,#cba6f7);--devtools-syntax-gray:light-dark(#4c4f69,#cdd6f4);--devtools-syntax-green:light-dark(#40a02b,#a6e3a1);--devtools-syntax-red:light-dark(#d20f39,#f38ba8);--devtools-syntax-yellow:light-dark(#df8e1d,#f9e2af);--devtools-syntax-sapphire:light-dark(#209fb5,#74c7ec)}@media(prefers-color-scheme:dark){:host{--color-primary-50:var(--color-yellow-50);--color-primary-100:var(--color-yellow-100);--color-primary-200:var(--color-yellow-200);--color-primary-300:var(--color-yellow-300);--color-primary-400:var(--color-yellow-400);--color-primary-500:var(--color-yellow-500);--color-primary-600:var(--color-yellow-600);--color-primary-700:var(--color-yellow-700);--color-primary-800:var(--color-yellow-800);--color-primary-900:var(--color-yellow-900);--color-primary-950:var(--color-yellow-950);--color-secondary-50:var(--color-lime-50);--color-secondary-100:var(--color-lime-100);--color-secondary-200:var(--color-lime-200);--color-secondary-300:var(--color-lime-300);--color-secondary-400:var(--color-lime-400);--color-secondary-500:var(--color-lime-500);--color-secondary-600:var(--color-lime-600);--color-secondary-700:var(--color-lime-700);--color-secondary-800:var(--color-lime-800);--color-secondary-900:var(--color-lime-900);--color-secondary-950:var(--color-lime-950)}}:host:has(.dark){color-scheme:dark}:host:has(.light){color-scheme:light}#root{color:var(--ui-text);background-color:var(--ui-bg);-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}[class~=bg-theme]{color:var(--ui-text);--ui-text:var(--ui-text-inverted)}@media(hover:hover){[class*=bg-theme][class*="hover:"]:hover{color:var(--ui-text);--ui-text:var(--ui-text-inverted)}}.theme-primary{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-secondary);--color-theme-50:var(--color-secondary-50);--color-theme-100:var(--color-secondary-100);--color-theme-200:var(--color-secondary-200);--color-theme-300:var(--color-secondary-300);--color-theme-400:var(--color-secondary-400);--color-theme-500:var(--color-secondary-500);--color-theme-600:var(--color-secondary-600);--color-theme-700:var(--color-secondary-700);--color-theme-800:var(--color-secondary-800);--color-theme-900:var(--color-secondary-900);--color-theme-950:var(--color-secondary-950)}@media(prefers-color-scheme:dark){.theme-primary{--color-theme:var(--ui-primary);--color-theme-50:var(--color-primary-50);--color-theme-100:var(--color-primary-100);--color-theme-200:var(--color-primary-200);--color-theme-300:var(--color-primary-300);--color-theme-400:var(--color-primary-400);--color-theme-500:var(--color-primary-500);--color-theme-600:var(--color-primary-600);--color-theme-700:var(--color-primary-700);--color-theme-800:var(--color-primary-800);--color-theme-900:var(--color-primary-900);--color-theme-950:var(--color-primary-950)}}.theme-secondary{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-secondary);--color-theme-50:var(--color-secondary-50);--color-theme-100:var(--color-secondary-100);--color-theme-200:var(--color-secondary-200);--color-theme-300:var(--color-secondary-300);--color-theme-400:var(--color-secondary-400);--color-theme-500:var(--color-secondary-500);--color-theme-600:var(--color-secondary-600);--color-theme-700:var(--color-secondary-700);--color-theme-800:var(--color-secondary-800);--color-theme-900:var(--color-secondary-900);--color-theme-950:var(--color-secondary-950)}.theme-success{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-success);--color-theme-50:var(--color-success-50);--color-theme-100:var(--color-success-100);--color-theme-200:var(--color-success-200);--color-theme-300:var(--color-success-300);--color-theme-400:var(--color-success-400);--color-theme-500:var(--color-success-500);--color-theme-600:var(--color-success-600);--color-theme-700:var(--color-success-700);--color-theme-800:var(--color-success-800);--color-theme-900:var(--color-success-900);--color-theme-950:var(--color-success-950)}.theme-info{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-info);--color-theme-50:var(--color-info-50);--color-theme-100:var(--color-info-100);--color-theme-200:var(--color-info-200);--color-theme-300:var(--color-info-300);--color-theme-400:var(--color-info-400);--color-theme-500:var(--color-info-500);--color-theme-600:var(--color-info-600);--color-theme-700:var(--color-info-700);--color-theme-800:var(--color-info-800);--color-theme-900:var(--color-info-900);--color-theme-950:var(--color-info-950)}.theme-warning{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-warning);--color-theme-50:var(--color-warning-50);--color-theme-100:var(--color-warning-100);--color-theme-200:var(--color-warning-200);--color-theme-300:var(--color-warning-300);--color-theme-400:var(--color-warning-400);--color-theme-500:var(--color-warning-500);--color-theme-600:var(--color-warning-600);--color-theme-700:var(--color-warning-700);--color-theme-800:var(--color-warning-800);--color-theme-900:var(--color-warning-900);--color-theme-950:var(--color-warning-950)}.theme-error{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-error);--color-theme-50:var(--color-error-50);--color-theme-100:var(--color-error-100);--color-theme-200:var(--color-error-200);--color-theme-300:var(--color-error-300);--color-theme-400:var(--color-error-400);--color-theme-500:var(--color-error-500);--color-theme-600:var(--color-error-600);--color-theme-700:var(--color-error-700);--color-theme-800:var(--color-error-800);--color-theme-900:var(--color-error-900);--color-theme-950:var(--color-error-950)}.theme-neutral{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-neutral);--color-theme-50:var(--color-neutral-50);--color-theme-100:var(--color-neutral-100);--color-theme-200:var(--color-neutral-200);--color-theme-300:var(--color-neutral-300);--color-theme-400:var(--color-neutral-400);--color-theme-500:var(--color-neutral-500);--color-theme-600:var(--color-neutral-600);--color-theme-700:var(--color-neutral-700);--color-theme-800:var(--color-neutral-800);--color-theme-900:var(--color-neutral-900);--color-theme-950:var(--color-neutral-950)}.theme-purple{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--color-purple-400);--color-theme-50:var(--color-purple-50);--color-theme-100:var(--color-purple-100);--color-theme-200:var(--color-purple-200);--color-theme-300:var(--color-purple-300);--color-theme-400:var(--color-purple-400);--color-theme-500:var(--color-purple-500);--color-theme-600:var(--color-purple-600);--color-theme-700:var(--color-purple-700);--color-theme-800:var(--color-purple-800);--color-theme-900:var(--color-purple-900);--color-theme-950:var(--color-purple-950)}.variant-ghost.variant-ghost{--ui-text:var(--color-theme);color:var(--color-theme);background-color:#0000}.variant-ghost.variant-ghost:hover{color:var(--color-theme);background-color:var(--ui-bg)}@supports (color:color-mix(in lab,red,red)){.variant-ghost.variant-ghost:hover{background-color:color-mix(in hsl,var(--ui-bg)10%,transparent)}}@property --progress-value{syntax:"<number>";inherits:false;initial-value:0}@property --tw-translate-x{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-y{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-z{syntax:"*";inherits:false;initial-value:0}@property --tw-rotate-x{syntax:"*";inherits:false}@property --tw-rotate-y{syntax:"*";inherits:false}@property --tw-rotate-z{syntax:"*";inherits:false}@property --tw-skew-x{syntax:"*";inherits:false}@property --tw-skew-y{syntax:"*";inherits:false}@property --tw-space-y-reverse{syntax:"*";inherits:false;initial-value:0}@property --tw-space-x-reverse{syntax:"*";inherits:false;initial-value:0}@property --tw-divide-y-reverse{syntax:"*";inherits:false;initial-value:0}@property --tw-border-style{syntax:"*";inherits:false;initial-value:solid}@property --tw-leading{syntax:"*";inherits:false}@property --tw-font-weight{syntax:"*";inherits:false}@property --tw-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-shadow-color{syntax:"*";inherits:false}@property --tw-shadow-alpha{syntax:"<percentage>";inherits:false;initial-value:100%}@property --tw-inset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-shadow-color{syntax:"*";inherits:false}@property --tw-inset-shadow-alpha{syntax:"<percentage>";inherits:false;initial-value:100%}@property --tw-ring-color{syntax:"*";inherits:false}@property --tw-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-ring-color{syntax:"*";inherits:false}@property --tw-inset-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-ring-inset{syntax:"*";inherits:false}@property --tw-ring-offset-width{syntax:"<length>";inherits:false;initial-value:0}@property --tw-ring-offset-color{syntax:"*";inherits:false;initial-value:#fff}@property --tw-ring-offset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-blur{syntax:"*";inherits:false}@property --tw-brightness{syntax:"*";inherits:false}@property --tw-contrast{syntax:"*";inherits:false}@property --tw-grayscale{syntax:"*";inherits:false}@property --tw-hue-rotate{syntax:"*";inherits:false}@property --tw-invert{syntax:"*";inherits:false}@property --tw-opacity{syntax:"*";inherits:false}@property --tw-saturate{syntax:"*";inherits:false}@property --tw-sepia{syntax:"*";inherits:false}@property --tw-drop-shadow{syntax:"*";inherits:false}@property --tw-drop-shadow-color{syntax:"*";inherits:false}@property --tw-drop-shadow-alpha{syntax:"<percentage>";inherits:false;initial-value:100%}@property --tw-drop-shadow-size{syntax:"*";inherits:false}@property --tw-duration{syntax:"*";inherits:false}@property --tw-outline-style{syntax:"*";inherits:false;initial-value:solid}@keyframes spin{to{transform:rotate(360deg)}}', gu = (e, t) => {
+}), gu = '@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-translate-x:0;--tw-translate-y:0;--tw-translate-z:0;--tw-rotate-x:initial;--tw-rotate-y:initial;--tw-rotate-z:initial;--tw-skew-x:initial;--tw-skew-y:initial;--tw-space-y-reverse:0;--tw-space-x-reverse:0;--tw-divide-y-reverse:0;--tw-border-style:solid;--tw-leading:initial;--tw-font-weight:initial;--tw-shadow:0 0 #0000;--tw-shadow-color:initial;--tw-shadow-alpha:100%;--tw-inset-shadow:0 0 #0000;--tw-inset-shadow-color:initial;--tw-inset-shadow-alpha:100%;--tw-ring-color:initial;--tw-ring-shadow:0 0 #0000;--tw-inset-ring-color:initial;--tw-inset-ring-shadow:0 0 #0000;--tw-ring-inset:initial;--tw-ring-offset-width:0px;--tw-ring-offset-color:#fff;--tw-ring-offset-shadow:0 0 #0000;--tw-blur:initial;--tw-brightness:initial;--tw-contrast:initial;--tw-grayscale:initial;--tw-hue-rotate:initial;--tw-invert:initial;--tw-opacity:initial;--tw-saturate:initial;--tw-sepia:initial;--tw-drop-shadow:initial;--tw-drop-shadow-color:initial;--tw-drop-shadow-alpha:100%;--tw-drop-shadow-size:initial;--tw-duration:initial;--tw-outline-style:solid;--progress-value:0}}}.splitpanes{width:100%;height:100%;display:flex}.splitpanes--vertical{flex-direction:row}.splitpanes--horizontal{flex-direction:column}.splitpanes--dragging .splitpanes__pane{-webkit-user-select:none;user-select:none;pointer-events:none}.splitpanes__pane{width:100%;height:100%;overflow:auto}.splitpanes--vertical .splitpanes__pane{transition:width .2s ease-out}.splitpanes--horizontal .splitpanes__pane{transition:height .2s ease-out}.splitpanes--dragging .splitpanes__pane{transition:none}.splitpanes__splitter{touch-action:none;-webkit-user-select:none;user-select:none}.splitpanes--vertical>.splitpanes__splitter{cursor:col-resize;min-width:1px}.splitpanes--horizontal>.splitpanes__splitter{cursor:row-resize;min-height:1px}.splitpanes.default-theme .splitpanes__pane{background-color:#f2f2f2}.splitpanes.default-theme .splitpanes__splitter{box-sizing:border-box;background-color:#fff;flex-shrink:0;position:relative}.splitpanes.default-theme .splitpanes__splitter:before,.splitpanes.default-theme .splitpanes__splitter:after{content:"";background-color:#00000026;transition:background-color .3s;position:absolute;top:50%;left:50%}.splitpanes.default-theme .splitpanes__splitter:hover:before,.splitpanes.default-theme .splitpanes__splitter:hover:after{background-color:#00000040}.splitpanes.default-theme .splitpanes__splitter:first-child{cursor:auto}.default-theme.splitpanes .splitpanes .splitpanes__splitter{z-index:1}.default-theme.splitpanes--vertical>.splitpanes__splitter,.default-theme .splitpanes--vertical>.splitpanes__splitter{border-left:1px solid #eee;width:7px;margin-left:-1px}.default-theme.splitpanes--vertical>.splitpanes__splitter:before,.default-theme.splitpanes--vertical>.splitpanes__splitter:after,.default-theme .splitpanes--vertical>.splitpanes__splitter:before,.default-theme .splitpanes--vertical>.splitpanes__splitter:after{width:1px;height:30px;transform:translateY(-50%)}.default-theme.splitpanes--vertical>.splitpanes__splitter:before,.default-theme .splitpanes--vertical>.splitpanes__splitter:before{margin-left:-2px}.default-theme.splitpanes--vertical>.splitpanes__splitter:after,.default-theme .splitpanes--vertical>.splitpanes__splitter:after{margin-left:1px}.default-theme.splitpanes--horizontal>.splitpanes__splitter,.default-theme .splitpanes--horizontal>.splitpanes__splitter{border-top:1px solid #eee;height:7px;margin-top:-1px}.default-theme.splitpanes--horizontal>.splitpanes__splitter:before,.default-theme.splitpanes--horizontal>.splitpanes__splitter:after,.default-theme .splitpanes--horizontal>.splitpanes__splitter:before,.default-theme .splitpanes--horizontal>.splitpanes__splitter:after{width:30px;height:1px;transform:translate(-50%)}.default-theme.splitpanes--horizontal>.splitpanes__splitter:before,.default-theme .splitpanes--horizontal>.splitpanes__splitter:before{margin-top:-2px}.default-theme.splitpanes--horizontal>.splitpanes__splitter:after,.default-theme .splitpanes--horizontal>.splitpanes__splitter:after{margin-top:1px}.splitpanes__splitter{--grab-size:-4px;background-color:var(--ui-text);transition:background-color .2s;position:relative}@supports (color:color-mix(in lab,red,red)){.splitpanes__splitter{background-color:color-mix(in lab,var(--ui-text)20%,var(--ui-bg))}}.splitpanes--vertical>.splitpanes__splitter:before{left:var(--grab-size);right:var(--grab-size);height:100%}.splitpanes--horizontal>.splitpanes__splitter:before{top:var(--grab-size);bottom:var(--grab-size);width:100%}.splitpanes__splitter:before{content:"";z-index:10000;transition:background-color .25s ease-out;position:absolute;inset:0}.splitpanes__splitter:hover:before{background-color:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){.splitpanes__splitter:hover:before{background-color:color-mix(in lab,var(--ui-text),transparent 75%)}}.splitpanes__splitter:hover:before{opacity:1}@layer theme{:root,:host{--font-sans:ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--font-mono:ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--color-red-50:oklch(97.1% .013 17.38);--color-red-100:oklch(93.6% .032 17.717);--color-red-200:oklch(88.5% .062 18.334);--color-red-300:oklch(80.8% .114 19.571);--color-red-400:oklch(70.4% .191 22.216);--color-red-500:oklch(63.7% .237 25.331);--color-red-600:oklch(57.7% .245 27.325);--color-red-700:oklch(50.5% .213 27.518);--color-red-800:oklch(44.4% .177 26.899);--color-red-900:oklch(39.6% .141 25.723);--color-red-950:oklch(25.8% .092 26.042);--color-orange-50:oklch(98% .016 73.684);--color-orange-100:oklch(95.4% .038 75.164);--color-orange-200:oklch(90.1% .076 70.697);--color-orange-300:oklch(83.7% .128 66.29);--color-orange-400:oklch(75% .183 55.934);--color-orange-500:oklch(70.5% .213 47.604);--color-orange-600:oklch(64.6% .222 41.116);--color-orange-700:oklch(55.3% .195 38.402);--color-orange-800:oklch(47% .157 37.304);--color-orange-900:oklch(40.8% .123 38.172);--color-orange-950:oklch(26.6% .079 36.259);--color-yellow-50:oklch(98.7% .026 102.212);--color-yellow-100:oklch(97.3% .071 103.193);--color-yellow-200:oklch(94.5% .129 101.54);--color-yellow-300:oklch(90.5% .182 98.111);--color-yellow-400:oklch(85.2% .199 91.936);--color-yellow-500:oklch(79.5% .184 86.047);--color-yellow-600:oklch(68.1% .162 75.834);--color-yellow-700:oklch(55.4% .135 66.442);--color-yellow-800:oklch(47.6% .114 61.907);--color-yellow-900:oklch(42.1% .095 57.708);--color-yellow-950:oklch(28.6% .066 53.813);--color-lime-50:oklch(98.6% .031 120.757);--color-lime-100:oklch(96.7% .067 122.328);--color-lime-200:oklch(93.8% .127 124.321);--color-lime-300:oklch(89.7% .196 126.665);--color-lime-400:oklch(84.1% .238 128.85);--color-lime-500:oklch(76.8% .233 130.85);--color-lime-600:oklch(64.8% .2 131.684);--color-lime-700:oklch(53.2% .157 131.589);--color-lime-800:oklch(45.3% .124 130.933);--color-lime-900:oklch(40.5% .101 131.063);--color-lime-950:oklch(27.4% .072 132.109);--color-green-50:oklch(98.2% .018 155.826);--color-green-100:oklch(96.2% .044 156.743);--color-green-200:oklch(92.5% .084 155.995);--color-green-300:oklch(87.1% .15 154.449);--color-green-400:oklch(79.2% .209 151.711);--color-green-500:oklch(72.3% .219 149.579);--color-green-600:oklch(62.7% .194 149.214);--color-green-700:oklch(52.7% .154 150.069);--color-green-800:oklch(44.8% .119 151.328);--color-green-900:oklch(39.3% .095 152.535);--color-green-950:oklch(26.6% .065 152.934);--color-blue-50:oklch(97% .014 254.604);--color-blue-100:oklch(93.2% .032 255.585);--color-blue-200:oklch(88.2% .059 254.128);--color-blue-300:oklch(80.9% .105 251.813);--color-blue-400:oklch(70.7% .165 254.624);--color-blue-500:oklch(62.3% .214 259.815);--color-blue-600:oklch(54.6% .245 262.881);--color-blue-700:oklch(48.8% .243 264.376);--color-blue-800:oklch(42.4% .199 265.638);--color-blue-900:oklch(37.9% .146 265.522);--color-blue-950:oklch(28.2% .091 267.935);--color-purple-50:oklch(97.7% .014 308.299);--color-purple-100:oklch(94.6% .033 307.174);--color-purple-200:oklch(90.2% .063 306.703);--color-purple-300:oklch(82.7% .119 306.383);--color-purple-400:oklch(71.4% .203 305.504);--color-purple-500:oklch(62.7% .265 303.9);--color-purple-600:oklch(55.8% .288 302.321);--color-purple-700:oklch(49.6% .265 301.924);--color-purple-800:oklch(43.8% .218 303.724);--color-purple-900:oklch(38.1% .176 304.987);--color-purple-950:oklch(29.1% .149 302.717);--color-gray-50:oklch(98.5% .002 247.839);--color-gray-100:oklch(96.7% .003 264.542);--color-gray-200:oklch(92.8% .006 264.531);--color-gray-300:oklch(87.2% .01 258.338);--color-gray-400:oklch(70.7% .022 261.325);--color-gray-500:oklch(55.1% .027 264.364);--color-gray-600:oklch(44.6% .03 256.802);--color-gray-700:oklch(37.3% .034 259.733);--color-gray-800:oklch(27.8% .033 256.848);--color-gray-900:oklch(21% .034 264.665);--color-gray-950:oklch(13% .028 261.692);--color-neutral-50:var(--color-gray-50);--color-neutral-100:var(--color-gray-100);--color-neutral-200:var(--color-gray-200);--color-neutral-300:var(--color-gray-300);--color-neutral-400:var(--color-gray-400);--color-neutral-500:var(--color-gray-500);--color-neutral-600:var(--color-gray-600);--color-neutral-700:var(--color-gray-700);--color-neutral-800:var(--color-gray-800);--color-neutral-900:var(--color-gray-900);--color-neutral-950:var(--color-gray-950);--color-white:#fff;--spacing:.25rem;--container-md:28rem;--text-xs:.75rem;--text-xs--line-height:calc(1/.75);--text-sm:.875rem;--text-sm--line-height:calc(1.25/.875);--text-lg:1.125rem;--text-lg--line-height:calc(1.75/1.125);--text-xl:1.25rem;--text-xl--line-height:calc(1.75/1.25);--text-2xl:1.5rem;--text-2xl--line-height:calc(2/1.5);--font-weight-medium:500;--font-weight-semibold:600;--font-weight-bold:700;--font-weight-extrabold:800;--leading-snug:1.375;--radius-xs:.125rem;--radius-sm:.25rem;--radius-md:.375rem;--radius-lg:.5rem;--animate-spin:spin 1s linear infinite;--default-transition-duration:.15s;--default-transition-timing-function:cubic-bezier(.4,0,.2,1);--default-font-family:var(--font-sans);--default-mono-font-family:var(--font-mono);--color-primary-50:var(--color-lime-50);--color-primary-100:var(--color-lime-100);--color-primary-200:var(--color-lime-200);--color-primary-300:var(--color-lime-300);--color-primary-400:var(--color-lime-400);--color-primary-500:var(--color-lime-500);--color-primary-600:var(--color-lime-600);--color-primary-700:var(--color-lime-700);--color-primary-800:var(--color-lime-800);--color-primary-900:var(--color-lime-900);--color-primary-950:var(--color-lime-950);--color-secondary-50:var(--color-yellow-50);--color-secondary-100:var(--color-yellow-100);--color-secondary-200:var(--color-yellow-200);--color-secondary-300:var(--color-yellow-300);--color-secondary-400:var(--color-yellow-400);--color-secondary-500:var(--color-yellow-500);--color-secondary-600:var(--color-yellow-600);--color-secondary-700:var(--color-yellow-700);--color-secondary-800:var(--color-yellow-800);--color-secondary-900:var(--color-yellow-900);--color-success-50:var(--color-green-50);--color-success-100:var(--color-green-100);--color-success-200:var(--color-green-200);--color-success-300:var(--color-green-300);--color-success-400:var(--color-green-400);--color-success-500:var(--color-green-500);--color-success-600:var(--color-green-600);--color-success-700:var(--color-green-700);--color-success-800:var(--color-green-800);--color-success-900:var(--color-green-900);--color-success-950:var(--color-green-950);--color-warning-50:var(--color-orange-50);--color-warning-100:var(--color-orange-100);--color-warning-200:var(--color-orange-200);--color-warning-300:var(--color-orange-300);--color-warning-400:var(--color-orange-400);--color-warning-500:var(--color-orange-500);--color-warning-600:var(--color-orange-600);--color-warning-700:var(--color-orange-700);--color-warning-800:var(--color-orange-800);--color-warning-900:var(--color-orange-900);--color-warning-950:var(--color-orange-950);--color-error-50:var(--color-red-50);--color-error-100:var(--color-red-100);--color-error-200:var(--color-red-200);--color-error-300:var(--color-red-300);--color-error-400:var(--color-red-400);--color-error-500:var(--color-red-500);--color-error-600:var(--color-red-600);--color-error-700:var(--color-red-700);--color-error-800:var(--color-red-800);--color-error-900:var(--color-red-900);--color-error-950:var(--color-red-950);--color-info-50:var(--color-blue-50);--color-info-100:var(--color-blue-100);--color-info-200:var(--color-blue-200);--color-info-300:var(--color-blue-300);--color-info-400:var(--color-blue-400);--color-info-500:var(--color-blue-500);--color-info-600:var(--color-blue-600);--color-info-700:var(--color-blue-700);--color-info-800:var(--color-blue-800);--color-info-900:var(--color-blue-900);--color-info-950:var(--color-blue-950);--color-theme:var(--ui-neutral);--color-theme-50:var(--color-neutral-50);--color-theme-100:var(--color-neutral-100);--color-theme-200:var(--color-neutral-200);--color-theme-300:var(--color-neutral-300);--color-theme-400:var(--color-neutral-400);--color-theme-500:var(--color-neutral-500);--color-theme-600:var(--color-neutral-600);--color-theme-700:var(--color-neutral-700);--color-theme-800:var(--color-neutral-800);--color-theme-900:var(--color-neutral-900);--color-theme-950:var(--color-neutral-950)}}@layer base{*,:after,:before,::backdrop{box-sizing:border-box;border:0 solid;margin:0;padding:0}::file-selector-button{box-sizing:border-box;border:0 solid;margin:0;padding:0}html,:host{-webkit-text-size-adjust:100%;tab-size:4;line-height:1.5;font-family:var(--default-font-family,ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji");font-feature-settings:var(--default-font-feature-settings,normal);font-variation-settings:var(--default-font-variation-settings,normal);-webkit-tap-highlight-color:transparent}hr{height:0;color:inherit;border-top-width:1px}abbr:where([title]){-webkit-text-decoration:underline dotted;text-decoration:underline dotted}h1,h2,h3,h4,h5,h6{font-size:inherit;font-weight:inherit}a{color:inherit;-webkit-text-decoration:inherit;text-decoration:inherit}b,strong{font-weight:bolder}code,kbd,samp,pre{font-family:var(--default-mono-font-family,ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace);font-feature-settings:var(--default-mono-font-feature-settings,normal);font-variation-settings:var(--default-mono-font-variation-settings,normal);font-size:1em}small{font-size:80%}sub,sup{vertical-align:baseline;font-size:75%;line-height:0;position:relative}sub{bottom:-.25em}sup{top:-.5em}table{text-indent:0;border-color:inherit;border-collapse:collapse}:-moz-focusring{outline:auto}progress{vertical-align:baseline}summary{display:list-item}ol,ul,menu{list-style:none}img,svg,video,canvas,audio,iframe,embed,object{vertical-align:middle;display:block}img,video{max-width:100%;height:auto}button,input,select,optgroup,textarea{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}::file-selector-button{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}:where(select:is([multiple],[size])) optgroup{font-weight:bolder}:where(select:is([multiple],[size])) optgroup option{padding-inline-start:20px}::file-selector-button{margin-inline-end:4px}::placeholder{opacity:1}@supports (not ((-webkit-appearance:-apple-pay-button))) or (contain-intrinsic-size:1px){::placeholder{color:currentColor}@supports (color:color-mix(in lab,red,red)){::placeholder{color:color-mix(in oklab,currentcolor 50%,transparent)}}}textarea{resize:vertical}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-date-and-time-value{min-height:1lh;text-align:inherit}::-webkit-datetime-edit{display:inline-flex}::-webkit-datetime-edit-fields-wrapper{padding:0}::-webkit-datetime-edit{padding-block:0}::-webkit-datetime-edit-year-field{padding-block:0}::-webkit-datetime-edit-month-field{padding-block:0}::-webkit-datetime-edit-day-field{padding-block:0}::-webkit-datetime-edit-hour-field{padding-block:0}::-webkit-datetime-edit-minute-field{padding-block:0}::-webkit-datetime-edit-second-field{padding-block:0}::-webkit-datetime-edit-millisecond-field{padding-block:0}::-webkit-datetime-edit-meridiem-field{padding-block:0}::-webkit-calendar-picker-indicator{line-height:1}:-moz-ui-invalid{box-shadow:none}button,input:where([type=button],[type=reset],[type=submit]){appearance:button}::file-selector-button{appearance:button}::-webkit-inner-spin-button{height:auto}::-webkit-outer-spin-button{height:auto}[hidden]:where(:not([hidden=until-found])){display:none!important}}@layer components;@layer utilities{.\\@container{container-type:inline-size}.collapse{visibility:collapse}.absolute{position:absolute}.fixed{position:fixed}.relative{position:relative}.static{position:static}.-inset-1{inset:calc(var(--spacing)*-1)}.top-1\\/2{top:50%}.right-0{right:calc(var(--spacing)*0)}.bottom-0{bottom:calc(var(--spacing)*0)}.left-0{left:calc(var(--spacing)*0)}.left-2{left:calc(var(--spacing)*2)}.z-9999,.z-\\[9999\\]{z-index:9999}.container{width:100%}@media(min-width:40rem){.container{max-width:40rem}}@media(min-width:48rem){.container{max-width:48rem}}@media(min-width:64rem){.container{max-width:64rem}}@media(min-width:80rem){.container{max-width:80rem}}@media(min-width:96rem){.container{max-width:96rem}}.m-0{margin:calc(var(--spacing)*0)}.mx-auto{margin-inline:auto}.my-2{margin-block:calc(var(--spacing)*2)}.mt-1{margin-top:calc(var(--spacing)*1)}.mr-2{margin-right:calc(var(--spacing)*2)}.mb-12{margin-bottom:calc(var(--spacing)*12)}.ml-5{margin-left:calc(var(--spacing)*5)}.block{display:block}.flex{display:flex}.grid{display:grid}.inline{display:inline}.inline-block{display:inline-block}.size-2{width:calc(var(--spacing)*2);height:calc(var(--spacing)*2)}.size-3{width:calc(var(--spacing)*3);height:calc(var(--spacing)*3)}.size-3\\.5{width:calc(var(--spacing)*3.5);height:calc(var(--spacing)*3.5)}.size-4{width:calc(var(--spacing)*4);height:calc(var(--spacing)*4)}.size-\\[1em\\]{width:1em;height:1em}.h-5{height:calc(var(--spacing)*5)}.h-40{height:calc(var(--spacing)*40)}.h-\\[8px\\]{height:8px}.h-full{height:100%}.max-h-\\[80\\%\\]{max-height:80%}.max-h-\\[1200px\\]{max-height:1200px}.min-h-\\[20vh\\]{min-height:20vh}.w-5{width:calc(var(--spacing)*5)}.w-6{width:calc(var(--spacing)*6)}.w-8{width:calc(var(--spacing)*8)}.w-40{width:calc(var(--spacing)*40)}.w-full{width:100%}.max-w-md{max-width:var(--container-md)}.min-w-\\[1\\.65em\\]{min-width:1.65em}.flex-grow{flex-grow:1}.-translate-y-1\\/2{--tw-translate-y: -50% ;translate:var(--tw-translate-x)var(--tw-translate-y)}.rotate-90{rotate:90deg}.transform{transform:var(--tw-rotate-x,)var(--tw-rotate-y,)var(--tw-rotate-z,)var(--tw-skew-x,)var(--tw-skew-y,)}.animate-spin{animation:var(--animate-spin)}.cursor-col-resize{cursor:col-resize}.cursor-pointer{cursor:pointer}.cursor-row-resize{cursor:row-resize}.touch-none{touch-action:none}.grid-flow-col{grid-auto-flow:column}.grid-cols-\\[auto_1fr\\]{grid-template-columns:auto 1fr}.grid-cols-\\[minmax\\(0\\,auto\\)_1fr\\]{grid-template-columns:minmax(0,auto) 1fr}.grid-rows-\\[auto_1fr\\]{grid-template-rows:auto 1fr}.flex-col{flex-direction:column}.flex-wrap{flex-wrap:wrap}.items-center{align-items:center}.justify-center{justify-content:center}.justify-end{justify-content:flex-end}.justify-items-start{justify-items:start}.gap-0\\.5{gap:calc(var(--spacing)*.5)}.gap-1{gap:calc(var(--spacing)*1)}.gap-1\\.5{gap:calc(var(--spacing)*1.5)}.gap-2{gap:calc(var(--spacing)*2)}.gap-4{gap:calc(var(--spacing)*4)}:where(.space-y-1>:not(:last-child)){--tw-space-y-reverse:0;margin-block-start:calc(calc(var(--spacing)*1)*var(--tw-space-y-reverse));margin-block-end:calc(calc(var(--spacing)*1)*calc(1 - var(--tw-space-y-reverse)))}:where(.space-y-2>:not(:last-child)){--tw-space-y-reverse:0;margin-block-start:calc(calc(var(--spacing)*2)*var(--tw-space-y-reverse));margin-block-end:calc(calc(var(--spacing)*2)*calc(1 - var(--tw-space-y-reverse)))}:where(.space-y-6>:not(:last-child)){--tw-space-y-reverse:0;margin-block-start:calc(calc(var(--spacing)*6)*var(--tw-space-y-reverse));margin-block-end:calc(calc(var(--spacing)*6)*calc(1 - var(--tw-space-y-reverse)))}.gap-x-0\\.5{column-gap:calc(var(--spacing)*.5)}.gap-x-1{column-gap:calc(var(--spacing)*1)}.gap-x-2{column-gap:calc(var(--spacing)*2)}:where(.space-x-2>:not(:last-child)){--tw-space-x-reverse:0;margin-inline-start:calc(calc(var(--spacing)*2)*var(--tw-space-x-reverse));margin-inline-end:calc(calc(var(--spacing)*2)*calc(1 - var(--tw-space-x-reverse)))}:where(.divide-y>:not(:last-child)){--tw-divide-y-reverse:0;border-bottom-style:var(--tw-border-style);border-top-style:var(--tw-border-style);border-top-width:calc(1px*var(--tw-divide-y-reverse));border-bottom-width:calc(1px*calc(1 - var(--tw-divide-y-reverse)))}:where(.divide-\\(--ui-border\\)>:not(:last-child)){border-color:var(--ui-border)}:where(.divide-\\(--ui-border-accented\\)>:not(:last-child)){border-color:var(--ui-border-accented)}.overflow-auto{overflow:auto}.overflow-hidden{overflow:hidden}.rounded{border-radius:.25rem}.rounded-full{border-radius:3.40282e38px}.rounded-lg{border-radius:var(--radius-lg)}.rounded-md{border-radius:var(--radius-md)}.rounded-sm{border-radius:var(--radius-sm)}.rounded-xs{border-radius:var(--radius-xs)}.rounded-l{border-top-left-radius:.25rem;border-bottom-left-radius:.25rem}.rounded-tl{border-top-left-radius:.25rem}.border{border-style:var(--tw-border-style);border-width:1px}.border-t{border-top-style:var(--tw-border-style);border-top-width:1px}.border-b{border-bottom-style:var(--tw-border-style);border-bottom-width:1px}.border-b-2{border-bottom-style:var(--tw-border-style);border-bottom-width:2px}.border-\\(--ui-border\\){border-color:var(--ui-border)}.border-theme{border-color:var(--color-theme)}.border-transparent{border-color:#0000}.bg-\\(--ui-bg-accented\\){background-color:var(--ui-bg-accented)}.bg-\\(--ui-bg-muted\\){background-color:var(--ui-bg-muted)}.bg-\\(--ui-border\\){background-color:var(--ui-border)}.bg-\\(--ui-text\\)\\/5{background-color:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){.bg-\\(--ui-text\\)\\/5{background-color:color-mix(in oklab,var(--ui-text)5%,transparent)}}.bg-error-200{background-color:var(--color-error-200)}.bg-error-500{background-color:var(--color-error-500)}.bg-gray-200{background-color:var(--color-gray-200)}.bg-gray-400{background-color:var(--color-gray-400)}.bg-info-200{background-color:var(--color-info-200)}.bg-info-500{background-color:var(--color-info-500)}.bg-neutral-200{background-color:var(--color-neutral-200)}.bg-neutral-400{background-color:var(--color-neutral-400)}.bg-neutral-500\\/20{background-color:#6a728233}@supports (color:color-mix(in lab,red,red)){.bg-neutral-500\\/20{background-color:color-mix(in oklab,var(--color-neutral-500)20%,transparent)}}.bg-purple-200{background-color:var(--color-purple-200)}.bg-purple-400{background-color:var(--color-purple-400)}.bg-success-200{background-color:var(--color-success-200)}.bg-success-500{background-color:var(--color-success-500)}.bg-theme-400{background-color:var(--color-theme-400)}.bg-theme\\/70{background-color:var(--color-theme)}@supports (color:color-mix(in lab,red,red)){.bg-theme\\/70{background-color:color-mix(in oklab,var(--color-theme)70%,transparent)}}.bg-transparent{background-color:#0000}.bg-warning-200{background-color:var(--color-warning-200)}.bg-warning-500{background-color:var(--color-warning-500)}.p-0\\.5{padding:calc(var(--spacing)*.5)}.p-1{padding:calc(var(--spacing)*1)}.p-2{padding:calc(var(--spacing)*2)}.px-0\\.5{padding-inline:calc(var(--spacing)*.5)}.px-1{padding-inline:calc(var(--spacing)*1)}.px-1\\.5{padding-inline:calc(var(--spacing)*1.5)}.px-2{padding-inline:calc(var(--spacing)*2)}.px-3{padding-inline:calc(var(--spacing)*3)}.px-4{padding-inline:calc(var(--spacing)*4)}.px-6{padding-inline:calc(var(--spacing)*6)}.py-0\\.5{padding-block:calc(var(--spacing)*.5)}.py-1{padding-block:calc(var(--spacing)*1)}.py-1\\.5{padding-block:calc(var(--spacing)*1.5)}.py-2{padding-block:calc(var(--spacing)*2)}.py-6{padding-block:calc(var(--spacing)*6)}.pt-6{padding-top:calc(var(--spacing)*6)}.pr-1{padding-right:calc(var(--spacing)*1)}.pr-2{padding-right:calc(var(--spacing)*2)}.pl-8{padding-left:calc(var(--spacing)*8)}.text-center{text-align:center}.font-mono{font-family:var(--font-mono)}.font-sans{font-family:var(--font-sans)}.text-2xl{font-size:var(--text-2xl);line-height:var(--tw-leading,var(--text-2xl--line-height))}.text-lg{font-size:var(--text-lg);line-height:var(--tw-leading,var(--text-lg--line-height))}.text-sm{font-size:var(--text-sm);line-height:var(--tw-leading,var(--text-sm--line-height))}.text-xl{font-size:var(--text-xl);line-height:var(--tw-leading,var(--text-xl--line-height))}.text-xs{font-size:var(--text-xs);line-height:var(--tw-leading,var(--text-xs--line-height))}.leading-6{--tw-leading:calc(var(--spacing)*6);line-height:calc(var(--spacing)*6)}.leading-snug{--tw-leading:var(--leading-snug);line-height:var(--leading-snug)}.font-bold{--tw-font-weight:var(--font-weight-bold);font-weight:var(--font-weight-bold)}.font-extrabold{--tw-font-weight:var(--font-weight-extrabold);font-weight:var(--font-weight-extrabold)}.font-medium{--tw-font-weight:var(--font-weight-medium);font-weight:var(--font-weight-medium)}.font-semibold{--tw-font-weight:var(--font-weight-semibold);font-weight:var(--font-weight-semibold)}.text-wrap{text-wrap:wrap}.break-words{overflow-wrap:break-word}.text-\\(--color-gray-900\\){color:var(--color-gray-900)}.text-\\(--devtools-syntax-gray\\){color:var(--devtools-syntax-gray)}.text-\\(--devtools-syntax-green\\){color:var(--devtools-syntax-green)}.text-\\(--devtools-syntax-orange\\){color:var(--devtools-syntax-orange)}.text-\\(--devtools-syntax-purple\\){color:var(--devtools-syntax-purple)}.text-\\(--devtools-syntax-red\\){color:var(--devtools-syntax-red)}.text-\\(--devtools-syntax-sapphire\\){color:var(--devtools-syntax-sapphire)}.text-\\(--ui-text\\),.text-\\(--ui-text\\)\\/50{color:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){.text-\\(--ui-text\\)\\/50{color:color-mix(in oklab,var(--ui-text)50%,transparent)}}.text-\\(--ui-text-dimmed\\){color:var(--ui-text-dimmed)}.text-\\(--ui-text-muted\\){color:var(--ui-text-muted)}.text-error-100{color:var(--color-error-100)}.text-gray-100{color:var(--color-gray-100)}.text-info-100{color:var(--color-info-100)}.text-neutral-100{color:var(--color-neutral-100)}.text-neutral-400{color:var(--color-neutral-400)}.text-neutral-500\\/50{color:#6a728280}@supports (color:color-mix(in lab,red,red)){.text-neutral-500\\/50{color:color-mix(in oklab,var(--color-neutral-500)50%,transparent)}}.text-purple-100{color:var(--color-purple-100)}.text-success-100{color:var(--color-success-100)}.text-warning-100{color:var(--color-warning-100)}.shadow{--tw-shadow:0 1px 3px 0 var(--tw-shadow-color,#0000001a),0 1px 2px -1px var(--tw-shadow-color,#0000001a);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}.ring-\\(--ui-bg-muted\\){--tw-ring-color:var(--ui-bg-muted)}.filter{filter:var(--tw-blur,)var(--tw-brightness,)var(--tw-contrast,)var(--tw-grayscale,)var(--tw-hue-rotate,)var(--tw-invert,)var(--tw-saturate,)var(--tw-sepia,)var(--tw-drop-shadow,)}.transition{transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to,opacity,box-shadow,transform,translate,scale,rotate,filter,-webkit-backdrop-filter,backdrop-filter,display,content-visibility,overlay,pointer-events;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-\\[background-color\\]{transition-property:background-color;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-colors{transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-transform{transition-property:transform,translate,scale,rotate;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.duration-200{--tw-duration:.2s;transition-duration:.2s}.select-none{-webkit-user-select:none;user-select:none}@media(hover:hover){.hover\\:cursor-pointer:hover{cursor:pointer}.hover\\:border-theme-300:hover{border-color:var(--color-theme-300)}.hover\\:bg-\\(--ui-bg-elevated\\):hover{background-color:var(--ui-bg-elevated)}.hover\\:bg-\\(--ui-bg-muted\\):hover{background-color:var(--ui-bg-muted)}.hover\\:bg-\\(--ui-border\\):hover{background-color:var(--ui-border)}.hover\\:bg-theme-400:hover{background-color:var(--color-theme-400)}.hover\\:bg-theme-600:hover{background-color:var(--color-theme-600)}.hover\\:ring:hover{--tw-ring-shadow:var(--tw-ring-inset,)0 0 0 calc(1px + var(--tw-ring-offset-width))var(--tw-ring-color,currentcolor);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}}.focus\\:ring-1:focus{--tw-ring-shadow:var(--tw-ring-inset,)0 0 0 calc(1px + var(--tw-ring-offset-width))var(--tw-ring-color,currentcolor);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}.focus\\:ring-theme:focus{--tw-ring-color:var(--color-theme)}.focus\\:outline-none:focus{--tw-outline-style:none;outline-style:none}.focus-visible\\:outline-2:focus-visible{outline-style:var(--tw-outline-style);outline-width:2px}.focus-visible\\:outline-offset-2:focus-visible{outline-offset:2px}.focus-visible\\:outline-theme:focus-visible{outline-color:var(--color-theme)}.disabled\\:cursor-not-allowed:disabled{cursor:not-allowed}.disabled\\:text-\\(--color-gray-700\\):disabled{color:var(--color-gray-700)}@media(min-width:48rem){.md\\:flex{display:flex}.md\\:pt-0{padding-top:calc(var(--spacing)*0)}}@container not (min-width:750px){.\\@max-\\[750px\\]\\:hidden{display:none}}@container not (min-width:28rem){.\\@max-md\\:hidden{display:none}}@media(prefers-color-scheme:dark){:where(.dark\\:divide-\\(--ui-border\\)>:not(:last-child)){border-color:var(--ui-border)}.dark\\:bg-neutral-700{background-color:var(--color-neutral-700)}.dark\\:bg-neutral-800{background-color:var(--color-neutral-800)}.dark\\:bg-theme-400{background-color:var(--color-theme-400)}.dark\\:text-neutral-500{color:var(--color-neutral-500)}@media(hover:hover){.dark\\:hover\\:bg-theme-300:hover{background-color:var(--color-theme-300)}}}}:host{color-scheme:light dark;--ui-radius:var(--radius-sm);--ui-primary:light-dark(var(--color-secondary-500),var(--color-primary-400));--ui-secondary:light-dark(var(--color-secondary-500),var(--color-secondary-400));--ui-success:light-dark(var(--color-success-500),var(--color-success-400));--ui-info:light-dark(var(--color-info-500),var(--color-info-400));--ui-warning:light-dark(var(--color-warning-500),var(--color-warning-400));--ui-error:light-dark(var(--color-error-500),var(--color-error-400));--ui-neutral:light-dark(var(--color-neutral-500),var(--color-neutral-400));--ui-text-dimmed:light-dark(var(--color-gray-400),var(--color-gray-500));--ui-text-muted:light-dark(var(--color-gray-500),var(--color-gray-400));--ui-text-toned:light-dark(var(--color-gray-600),var(--color-gray-300));--ui-text:light-dark(var(--color-gray-900),var(--color-gray-50));--ui-text-inverted:light-dark(var(--color-gray-50),var(--color-gray-900));--ui-bg:light-dark(var(--color-white),var(--color-gray-900));--ui-bg-muted:light-dark(var(--color-gray-50),var(--color-gray-800));--ui-bg-elevated:light-dark(var(--color-gray-100),var(--color-gray-700));--ui-bg-accented:light-dark(var(--color-gray-200),var(--color-gray-600));--ui-bg-inverted:light-dark(var(--color-gray-900),var(--color-white));--ui-border:var(--ui-text);font-family:sans-serif}@supports (color:color-mix(in lab,red,red)){:host{--ui-border:color-mix(in hsl,var(--ui-text)20%,transparent)}}:host{--ui-border-muted:var(--ui-text-muted)}@supports (color:color-mix(in lab,red,red)){:host{--ui-border-muted:color-mix(in hsl,var(--ui-text-muted)10%,transparent)}}:host{--ui-border-accented:var(--ui-text)}@supports (color:color-mix(in lab,red,red)){:host{--ui-border-accented:color-mix(in hsl,var(--ui-text)35%,transparent)}}:host{--ui-border-inverted:var(--ui-text-inverted)}@supports (color:color-mix(in lab,red,red)){:host{--ui-border-inverted:color-mix(in hsl,var(--ui-text-inverted)50%,transparent)}}:host{--devtools-syntax-orange:light-dark(#fe640b,#fab387);--devtools-syntax-purple:light-dark(#8839ef,#cba6f7);--devtools-syntax-gray:light-dark(#4c4f69,#cdd6f4);--devtools-syntax-green:light-dark(#40a02b,#a6e3a1);--devtools-syntax-red:light-dark(#d20f39,#f38ba8);--devtools-syntax-yellow:light-dark(#df8e1d,#f9e2af);--devtools-syntax-sapphire:light-dark(#209fb5,#74c7ec)}@media(prefers-color-scheme:dark){:host{--color-primary-50:var(--color-yellow-50);--color-primary-100:var(--color-yellow-100);--color-primary-200:var(--color-yellow-200);--color-primary-300:var(--color-yellow-300);--color-primary-400:var(--color-yellow-400);--color-primary-500:var(--color-yellow-500);--color-primary-600:var(--color-yellow-600);--color-primary-700:var(--color-yellow-700);--color-primary-800:var(--color-yellow-800);--color-primary-900:var(--color-yellow-900);--color-primary-950:var(--color-yellow-950);--color-secondary-50:var(--color-lime-50);--color-secondary-100:var(--color-lime-100);--color-secondary-200:var(--color-lime-200);--color-secondary-300:var(--color-lime-300);--color-secondary-400:var(--color-lime-400);--color-secondary-500:var(--color-lime-500);--color-secondary-600:var(--color-lime-600);--color-secondary-700:var(--color-lime-700);--color-secondary-800:var(--color-lime-800);--color-secondary-900:var(--color-lime-900);--color-secondary-950:var(--color-lime-950)}}:host:has(.dark){color-scheme:dark}:host:has(.light){color-scheme:light}#root{color:var(--ui-text);background-color:var(--ui-bg);-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}[class~=bg-theme]{color:var(--ui-text);--ui-text:var(--ui-text-inverted)}@media(hover:hover){[class*=bg-theme][class*="hover:"]:hover{color:var(--ui-text);--ui-text:var(--ui-text-inverted)}}.theme-primary{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-secondary);--color-theme-50:var(--color-secondary-50);--color-theme-100:var(--color-secondary-100);--color-theme-200:var(--color-secondary-200);--color-theme-300:var(--color-secondary-300);--color-theme-400:var(--color-secondary-400);--color-theme-500:var(--color-secondary-500);--color-theme-600:var(--color-secondary-600);--color-theme-700:var(--color-secondary-700);--color-theme-800:var(--color-secondary-800);--color-theme-900:var(--color-secondary-900);--color-theme-950:var(--color-secondary-950)}@media(prefers-color-scheme:dark){.theme-primary{--color-theme:var(--ui-primary);--color-theme-50:var(--color-primary-50);--color-theme-100:var(--color-primary-100);--color-theme-200:var(--color-primary-200);--color-theme-300:var(--color-primary-300);--color-theme-400:var(--color-primary-400);--color-theme-500:var(--color-primary-500);--color-theme-600:var(--color-primary-600);--color-theme-700:var(--color-primary-700);--color-theme-800:var(--color-primary-800);--color-theme-900:var(--color-primary-900);--color-theme-950:var(--color-primary-950)}}.theme-secondary{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-secondary);--color-theme-50:var(--color-secondary-50);--color-theme-100:var(--color-secondary-100);--color-theme-200:var(--color-secondary-200);--color-theme-300:var(--color-secondary-300);--color-theme-400:var(--color-secondary-400);--color-theme-500:var(--color-secondary-500);--color-theme-600:var(--color-secondary-600);--color-theme-700:var(--color-secondary-700);--color-theme-800:var(--color-secondary-800);--color-theme-900:var(--color-secondary-900);--color-theme-950:var(--color-secondary-950)}.theme-success{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-success);--color-theme-50:var(--color-success-50);--color-theme-100:var(--color-success-100);--color-theme-200:var(--color-success-200);--color-theme-300:var(--color-success-300);--color-theme-400:var(--color-success-400);--color-theme-500:var(--color-success-500);--color-theme-600:var(--color-success-600);--color-theme-700:var(--color-success-700);--color-theme-800:var(--color-success-800);--color-theme-900:var(--color-success-900);--color-theme-950:var(--color-success-950)}.theme-info{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-info);--color-theme-50:var(--color-info-50);--color-theme-100:var(--color-info-100);--color-theme-200:var(--color-info-200);--color-theme-300:var(--color-info-300);--color-theme-400:var(--color-info-400);--color-theme-500:var(--color-info-500);--color-theme-600:var(--color-info-600);--color-theme-700:var(--color-info-700);--color-theme-800:var(--color-info-800);--color-theme-900:var(--color-info-900);--color-theme-950:var(--color-info-950)}.theme-warning{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-warning);--color-theme-50:var(--color-warning-50);--color-theme-100:var(--color-warning-100);--color-theme-200:var(--color-warning-200);--color-theme-300:var(--color-warning-300);--color-theme-400:var(--color-warning-400);--color-theme-500:var(--color-warning-500);--color-theme-600:var(--color-warning-600);--color-theme-700:var(--color-warning-700);--color-theme-800:var(--color-warning-800);--color-theme-900:var(--color-warning-900);--color-theme-950:var(--color-warning-950)}.theme-error{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-error);--color-theme-50:var(--color-error-50);--color-theme-100:var(--color-error-100);--color-theme-200:var(--color-error-200);--color-theme-300:var(--color-error-300);--color-theme-400:var(--color-error-400);--color-theme-500:var(--color-error-500);--color-theme-600:var(--color-error-600);--color-theme-700:var(--color-error-700);--color-theme-800:var(--color-error-800);--color-theme-900:var(--color-error-900);--color-theme-950:var(--color-error-950)}.theme-neutral{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--ui-neutral);--color-theme-50:var(--color-neutral-50);--color-theme-100:var(--color-neutral-100);--color-theme-200:var(--color-neutral-200);--color-theme-300:var(--color-neutral-300);--color-theme-400:var(--color-neutral-400);--color-theme-500:var(--color-neutral-500);--color-theme-600:var(--color-neutral-600);--color-theme-700:var(--color-neutral-700);--color-theme-800:var(--color-neutral-800);--color-theme-900:var(--color-neutral-900);--color-theme-950:var(--color-neutral-950)}.theme-purple{--ui-text:var(--ui-text-inverted);--ui-bg:var(--color-theme);--color-theme:var(--color-purple-400);--color-theme-50:var(--color-purple-50);--color-theme-100:var(--color-purple-100);--color-theme-200:var(--color-purple-200);--color-theme-300:var(--color-purple-300);--color-theme-400:var(--color-purple-400);--color-theme-500:var(--color-purple-500);--color-theme-600:var(--color-purple-600);--color-theme-700:var(--color-purple-700);--color-theme-800:var(--color-purple-800);--color-theme-900:var(--color-purple-900);--color-theme-950:var(--color-purple-950)}.variant-ghost.variant-ghost{--ui-text:var(--color-theme);color:var(--color-theme);background-color:#0000}.variant-ghost.variant-ghost:hover{color:var(--color-theme);background-color:var(--ui-bg)}@supports (color:color-mix(in lab,red,red)){.variant-ghost.variant-ghost:hover{background-color:color-mix(in hsl,var(--ui-bg)10%,transparent)}}@property --progress-value{syntax:"<number>";inherits:false;initial-value:0}@property --tw-translate-x{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-y{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-z{syntax:"*";inherits:false;initial-value:0}@property --tw-rotate-x{syntax:"*";inherits:false}@property --tw-rotate-y{syntax:"*";inherits:false}@property --tw-rotate-z{syntax:"*";inherits:false}@property --tw-skew-x{syntax:"*";inherits:false}@property --tw-skew-y{syntax:"*";inherits:false}@property --tw-space-y-reverse{syntax:"*";inherits:false;initial-value:0}@property --tw-space-x-reverse{syntax:"*";inherits:false;initial-value:0}@property --tw-divide-y-reverse{syntax:"*";inherits:false;initial-value:0}@property --tw-border-style{syntax:"*";inherits:false;initial-value:solid}@property --tw-leading{syntax:"*";inherits:false}@property --tw-font-weight{syntax:"*";inherits:false}@property --tw-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-shadow-color{syntax:"*";inherits:false}@property --tw-shadow-alpha{syntax:"<percentage>";inherits:false;initial-value:100%}@property --tw-inset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-shadow-color{syntax:"*";inherits:false}@property --tw-inset-shadow-alpha{syntax:"<percentage>";inherits:false;initial-value:100%}@property --tw-ring-color{syntax:"*";inherits:false}@property --tw-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-ring-color{syntax:"*";inherits:false}@property --tw-inset-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-ring-inset{syntax:"*";inherits:false}@property --tw-ring-offset-width{syntax:"<length>";inherits:false;initial-value:0}@property --tw-ring-offset-color{syntax:"*";inherits:false;initial-value:#fff}@property --tw-ring-offset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-blur{syntax:"*";inherits:false}@property --tw-brightness{syntax:"*";inherits:false}@property --tw-contrast{syntax:"*";inherits:false}@property --tw-grayscale{syntax:"*";inherits:false}@property --tw-hue-rotate{syntax:"*";inherits:false}@property --tw-invert{syntax:"*";inherits:false}@property --tw-opacity{syntax:"*";inherits:false}@property --tw-saturate{syntax:"*";inherits:false}@property --tw-sepia{syntax:"*";inherits:false}@property --tw-drop-shadow{syntax:"*";inherits:false}@property --tw-drop-shadow-color{syntax:"*";inherits:false}@property --tw-drop-shadow-alpha{syntax:"<percentage>";inherits:false;initial-value:100%}@property --tw-drop-shadow-size{syntax:"*";inherits:false}@property --tw-duration{syntax:"*";inherits:false}@property --tw-outline-style{syntax:"*";inherits:false;initial-value:solid}@keyframes spin{to{transform:rotate(360deg)}}', mu = (e, t) => {
   const r = e.__vccOpts || e;
   for (const [o, n] of t)
     r[o] = n;
   return r;
-}, mu = /* @__PURE__ */ gu(hu, [["styles", [pu]]]);
-/*!
- * vue-router v4.6.3
- * (c) 2025 Eduardo San Martin Morote
- * @license MIT
- */
+}, vu = /* @__PURE__ */ mu(pu, [["styles", [gu]]]);
 const Ft = typeof document < "u";
-function Ds(e) {
+function Fs(e) {
   return typeof e == "object" || "displayName" in e || "props" in e || "__vccOpts" in e;
 }
-function vu(e) {
-  return e.__esModule || e[Symbol.toStringTag] === "Module" || e.default && Ds(e.default);
+function yu(e) {
+  return e.__esModule || e[Symbol.toStringTag] === "Module" || e.default && Fs(e.default);
 }
 const re = Object.assign;
 function Eo(e, t) {
@@ -5179,29 +5184,29 @@ function Eo(e, t) {
 }
 const ar = () => {
 }, We = Array.isArray;
-function Gn(e, t) {
+function qn(e, t) {
   const r = {};
   for (const o in e) r[o] = o in t ? t[o] : e[o];
   return r;
 }
-const Fs = /#/g, yu = /&/g, bu = /\//g, wu = /=/g, _u = /\?/g, Vs = /\+/g, xu = /%5B/g, ku = /%5D/g, js = /%5E/g, Eu = /%60/g, Ls = /%7B/g, Su = /%7C/g, zs = /%7D/g, Au = /%20/g;
+const Vs = /#/g, bu = /&/g, wu = /\//g, _u = /=/g, xu = /\?/g, js = /\+/g, ku = /%5B/g, Eu = /%5D/g, Ls = /%5E/g, Su = /%60/g, zs = /%7B/g, Au = /%7C/g, Hs = /%7D/g, Ru = /%20/g;
 function sn(e) {
-  return e == null ? "" : encodeURI("" + e).replace(Su, "|").replace(xu, "[").replace(ku, "]");
+  return e == null ? "" : encodeURI("" + e).replace(Au, "|").replace(ku, "[").replace(Eu, "]");
 }
-function Ru(e) {
-  return sn(e).replace(Ls, "{").replace(zs, "}").replace(js, "^");
+function Cu(e) {
+  return sn(e).replace(zs, "{").replace(Hs, "}").replace(Ls, "^");
 }
-function zo(e) {
-  return sn(e).replace(Vs, "%2B").replace(Au, "+").replace(Fs, "%23").replace(yu, "%26").replace(Eu, "`").replace(Ls, "{").replace(zs, "}").replace(js, "^");
+function Lo(e) {
+  return sn(e).replace(js, "%2B").replace(Ru, "+").replace(Vs, "%23").replace(bu, "%26").replace(Su, "`").replace(zs, "{").replace(Hs, "}").replace(Ls, "^");
 }
-function Cu(e) {
-  return zo(e).replace(wu, "%3D");
+function Pu(e) {
+  return Lo(e).replace(_u, "%3D");
 }
 function Tu(e) {
-  return sn(e).replace(Fs, "%23").replace(_u, "%3F");
+  return sn(e).replace(Vs, "%23").replace(xu, "%3F");
 }
-function Pu(e) {
-  return Tu(e).replace(bu, "%2F");
+function Ou(e) {
+  return Tu(e).replace(wu, "%2F");
 }
 function mr(e) {
   if (e == null) return null;
@@ -5211,41 +5216,41 @@ function mr(e) {
   }
   return "" + e;
 }
-const Ou = /\/$/, Nu = (e) => e.replace(Ou, "");
+const Nu = /\/$/, Iu = (e) => e.replace(Nu, "");
 function So(e, t, r = "/") {
   let o, n = {}, i = "", s = "";
   const l = t.indexOf("#");
   let a = t.indexOf("?");
-  return a = l >= 0 && a > l ? -1 : a, a >= 0 && (o = t.slice(0, a), i = t.slice(a, l > 0 ? l : t.length), n = e(i.slice(1))), l >= 0 && (o = o || t.slice(0, l), s = t.slice(l, t.length)), o = Fu(o ?? t, r), {
+  return a = l >= 0 && a > l ? -1 : a, a >= 0 && (o = t.slice(0, a), i = t.slice(a, l > 0 ? l : t.length), n = e(i.slice(1))), l >= 0 && (o = o || t.slice(0, l), s = t.slice(l, t.length)), o = Vu(o ?? t, r), {
     fullPath: o + i + s,
     path: o,
     query: n,
     hash: mr(s)
   };
 }
-function Iu(e, t) {
+function Mu(e, t) {
   const r = t.query ? e(t.query) : "";
   return t.path + (r && "?") + r + (t.hash || "");
 }
-function Mu(e, t, r) {
+function Du(e, t, r) {
   const o = t.matched.length - 1, n = r.matched.length - 1;
-  return o > -1 && o === n && Gt(t.matched[o], r.matched[n]) && Hs(t.params, r.params) && e(t.query) === e(r.query) && t.hash === r.hash;
+  return o > -1 && o === n && Gt(t.matched[o], r.matched[n]) && Bs(t.params, r.params) && e(t.query) === e(r.query) && t.hash === r.hash;
 }
 function Gt(e, t) {
   return (e.aliasOf || e) === (t.aliasOf || t);
 }
-function Hs(e, t) {
+function Bs(e, t) {
   if (Object.keys(e).length !== Object.keys(t).length) return !1;
-  for (const r in e) if (!Du(e[r], t[r])) return !1;
+  for (const r in e) if (!Fu(e[r], t[r])) return !1;
   return !0;
 }
-function Du(e, t) {
-  return We(e) ? qn(e, t) : We(t) ? qn(t, e) : e === t;
+function Fu(e, t) {
+  return We(e) ? Jn(e, t) : We(t) ? Jn(t, e) : e === t;
 }
-function qn(e, t) {
+function Jn(e, t) {
   return We(t) ? e.length === t.length && e.every((r, o) => r === t[o]) : e.length === 1 && e[0] === t;
 }
-function Fu(e, t) {
+function Vu(e, t) {
   if (e.startsWith("/")) return e;
   if (!e) return t;
   const r = t.split("/"), o = e.split("/"), n = o[o.length - 1];
@@ -5269,24 +5274,24 @@ const mt = {
   meta: {},
   redirectedFrom: void 0
 };
-let Ho = /* @__PURE__ */ (function(e) {
+let zo = /* @__PURE__ */ (function(e) {
   return e.pop = "pop", e.push = "push", e;
-})({}), Jn = /* @__PURE__ */ (function(e) {
+})({}), Yn = /* @__PURE__ */ (function(e) {
   return e.back = "back", e.forward = "forward", e.unknown = "", e;
 })({});
 const Ao = "";
-function Vu(e) {
+function ju(e) {
   if (!e) if (Ft) {
     const t = document.querySelector("base");
     e = t && t.getAttribute("href") || "/", e = e.replace(/^\w+:\/\/[^\/]+/, "");
   } else e = "/";
-  return e[0] !== "/" && e[0] !== "#" && (e = "/" + e), Nu(e);
-}
-const ju = /^[^#]+#/;
-function Lu(e, t) {
-  return e.replace(ju, "#") + t;
+  return e[0] !== "/" && e[0] !== "#" && (e = "/" + e), Iu(e);
 }
+const Lu = /^[^#]+#/;
 function zu(e, t) {
+  return e.replace(Lu, "#") + t;
+}
+function Hu(e, t) {
   const r = document.documentElement.getBoundingClientRect(), o = e.getBoundingClientRect();
   return {
     behavior: t.behavior,
@@ -5294,69 +5299,69 @@ function zu(e, t) {
     top: o.top - r.top - (t.top || 0)
   };
 }
-const Hu = () => ({
+const Bu = () => ({
   left: window.scrollX,
   top: window.scrollY
 });
-function Bu(e) {
+function Uu(e) {
   let t;
   if ("el" in e) {
     const r = e.el, o = typeof r == "string" && r.startsWith("#"), n = typeof r == "string" ? o ? document.getElementById(r.slice(1)) : document.querySelector(r) : r;
     if (!n)
       return;
-    t = zu(n, e);
+    t = Hu(n, e);
   } else t = e;
   "scrollBehavior" in document.documentElement.style ? window.scrollTo(t) : window.scrollTo(t.left != null ? t.left : window.scrollX, t.top != null ? t.top : window.scrollY);
 }
-function Yn(e, t) {
+function Qn(e, t) {
   return (history.state ? history.state.position - t : -1) + e;
 }
-const Bo = /* @__PURE__ */ new Map();
-function Uu(e, t) {
-  Bo.set(e, t);
-}
-function $u(e) {
-  const t = Bo.get(e);
-  return Bo.delete(e), t;
+const Ho = /* @__PURE__ */ new Map();
+function $u(e, t) {
+  Ho.set(e, t);
 }
 function Ku(e) {
+  const t = Ho.get(e);
+  return Ho.delete(e), t;
+}
+function Wu(e) {
   return typeof e == "string" || e && typeof e == "object";
 }
-function Bs(e) {
+function Us(e) {
   return typeof e == "string" || typeof e == "symbol";
 }
 let se = /* @__PURE__ */ (function(e) {
   return e[e.MATCHER_NOT_FOUND = 1] = "MATCHER_NOT_FOUND", e[e.NAVIGATION_GUARD_REDIRECT = 2] = "NAVIGATION_GUARD_REDIRECT", e[e.NAVIGATION_ABORTED = 4] = "NAVIGATION_ABORTED", e[e.NAVIGATION_CANCELLED = 8] = "NAVIGATION_CANCELLED", e[e.NAVIGATION_DUPLICATED = 16] = "NAVIGATION_DUPLICATED", e;
 })({});
-const Us = Symbol("");
+const $s = Symbol("");
 se.MATCHER_NOT_FOUND + "", se.NAVIGATION_GUARD_REDIRECT + "", se.NAVIGATION_ABORTED + "", se.NAVIGATION_CANCELLED + "", se.NAVIGATION_DUPLICATED + "";
 function qt(e, t) {
   return re(/* @__PURE__ */ new Error(), {
     type: e,
-    [Us]: !0
+    [$s]: !0
   }, t);
 }
 function nt(e, t) {
-  return e instanceof Error && Us in e && (t == null || !!(e.type & t));
+  return e instanceof Error && $s in e && (t == null || !!(e.type & t));
 }
-const Wu = [
+const Gu = [
   "params",
   "query",
   "hash"
 ];
-function Gu(e) {
+function qu(e) {
   if (typeof e == "string") return e;
   if (e.path != null) return e.path;
   const t = {};
-  for (const r of Wu) r in e && (t[r] = e[r]);
+  for (const r of Gu) r in e && (t[r] = e[r]);
   return JSON.stringify(t, null, 2);
 }
-function qu(e) {
+function Ju(e) {
   const t = {};
   if (e === "" || e === "?") return t;
   const r = (e[0] === "?" ? e.slice(1) : e).split("&");
   for (let o = 0; o < r.length; ++o) {
-    const n = r[o].replace(Vs, " "), i = n.indexOf("="), s = mr(i < 0 ? n : n.slice(0, i)), l = i < 0 ? null : mr(n.slice(i + 1));
+    const n = r[o].replace(js, " "), i = n.indexOf("="), s = mr(i < 0 ? n : n.slice(0, i)), l = i < 0 ? null : mr(n.slice(i + 1));
     if (s in t) {
       let a = t[s];
       We(a) || (a = t[s] = [a]), a.push(l);
@@ -5364,21 +5369,21 @@ function qu(e) {
   }
   return t;
 }
-function Qn(e) {
+function Xn(e) {
   let t = "";
   for (let r in e) {
     const o = e[r];
-    if (r = Cu(r), o == null) {
+    if (r = Pu(r), o == null) {
       o !== void 0 && (t += (t.length ? "&" : "") + r);
       continue;
     }
-    (We(o) ? o.map((n) => n && zo(n)) : [o && zo(o)]).forEach((n) => {
+    (We(o) ? o.map((n) => n && Lo(n)) : [o && Lo(o)]).forEach((n) => {
       n !== void 0 && (t += (t.length ? "&" : "") + r, n != null && (t += "=" + n));
     });
   }
   return t;
 }
-function Ju(e) {
+function Yu(e) {
   const t = {};
   for (const r in e) {
     const o = e[r];
@@ -5386,7 +5391,7 @@ function Ju(e) {
   }
   return t;
 }
-const Yu = Symbol(""), Xn = Symbol(""), fo = Symbol(""), ln = Symbol(""), Uo = Symbol("");
+const Qu = Symbol(""), Zn = Symbol(""), fo = Symbol(""), ln = Symbol(""), Bo = Symbol("");
 function Zt() {
   let e = [];
   function t(o) {
@@ -5411,7 +5416,7 @@ function bt(e, t, r, o, n, i = (s) => s()) {
       m === !1 ? a(qt(se.NAVIGATION_ABORTED, {
         from: r,
         to: t
-      })) : m instanceof Error ? a(m) : Ku(m) ? a(qt(se.NAVIGATION_GUARD_REDIRECT, {
+      })) : m instanceof Error ? a(m) : Wu(m) ? a(qt(se.NAVIGATION_GUARD_REDIRECT, {
         from: t,
         to: m
       })) : (s && o.enterCallbacks[n] === s && typeof m == "function" && s.push(m), l());
@@ -5426,14 +5431,14 @@ function Ro(e, t, r, o, n = (i) => i()) {
     for (const l in s.components) {
       let a = s.components[l];
       if (!(t !== "beforeRouteEnter" && !s.instances[l]))
-        if (Ds(a)) {
+        if (Fs(a)) {
           const u = (a.__vccOpts || a)[t];
           u && i.push(bt(u, r, o, s, l, n));
         } else {
           let u = a();
           i.push(() => u.then((c) => {
             if (!c) throw new Error(`Couldn't resolve component "${l}" at "${s.path}"`);
-            const d = vu(c) ? c.default : c;
+            const d = yu(c) ? c.default : c;
             s.mods[l] = c, s.components[l] = d;
             const m = (d.__vccOpts || d)[t];
             return m && bt(m, r, o, s, l, n)();
@@ -5442,7 +5447,7 @@ function Ro(e, t, r, o, n = (i) => i()) {
     }
   return i;
 }
-function Qu(e, t) {
+function Xu(e, t) {
   const r = [], o = [], n = [], i = Math.max(t.matched.length, e.matched.length);
   for (let s = 0; s < i; s++) {
     const l = t.matched[s];
@@ -5456,14 +5461,9 @@ function Qu(e, t) {
     n
   ];
 }
-/*!
- * vue-router v4.6.3
- * (c) 2025 Eduardo San Martin Morote
- * @license MIT
- */
-function Xu(e = "") {
+function Zu(e = "") {
   let t = [], r = [[Ao, {}]], o = 0;
-  e = Vu(e);
+  e = ju(e);
   function n(l, a = {}) {
     o++, o !== r.length && r.splice(o), r.push([l, a]);
   }
@@ -5471,7 +5471,7 @@ function Xu(e = "") {
     const d = {
       direction: u,
       delta: c,
-      type: Ho.pop
+      type: zo.pop
     };
     for (const m of t) m(l, a, d);
   }
@@ -5479,7 +5479,7 @@ function Xu(e = "") {
     location: Ao,
     state: {},
     base: e,
-    createHref: Lu.bind(null, e),
+    createHref: zu.bind(null, e),
     replace(l, a) {
       r.splice(o--, 1), n(l, a);
     },
@@ -5496,7 +5496,7 @@ function Xu(e = "") {
       t = [], r = [[Ao, {}]], o = 0;
     },
     go(l, a = !0) {
-      const u = this.location, c = l < 0 ? Jn.back : Jn.forward;
+      const u = this.location, c = l < 0 ? Yn.back : Yn.forward;
       o = Math.max(0, Math.min(o + l, r.length - 1)), a && i(this.location, u, {
         direction: c,
         delta: l
@@ -5517,13 +5517,13 @@ let At = /* @__PURE__ */ (function(e) {
 var de = /* @__PURE__ */ (function(e) {
   return e[e.Static = 0] = "Static", e[e.Param = 1] = "Param", e[e.ParamRegExp = 2] = "ParamRegExp", e[e.ParamRegExpEnd = 3] = "ParamRegExpEnd", e[e.EscapeNext = 4] = "EscapeNext", e;
 })(de || {});
-const Zu = {
+const ef = {
   type: At.Static,
   value: ""
-}, ef = /[a-zA-Z0-9_]/;
-function tf(e) {
+}, tf = /[a-zA-Z0-9_]/;
+function rf(e) {
   if (!e) return [[]];
-  if (e === "/") return [[Zu]];
+  if (e === "/") return [[ef]];
   if (!e.startsWith("/")) throw new Error(`Invalid path "${e}"`);
   function t(g) {
     throw new Error(`ERR (${r})/"${u}": ${g}`);
@@ -5563,7 +5563,7 @@ function tf(e) {
         m(), r = o;
         break;
       case de.Param:
-        a === "(" ? r = de.ParamRegExp : ef.test(a) ? m() : (d(), r = de.Static, a !== "*" && a !== "?" && a !== "+" && l--);
+        a === "(" ? r = de.ParamRegExp : tf.test(a) ? m() : (d(), r = de.Static, a !== "*" && a !== "?" && a !== "+" && l--);
         break;
       case de.ParamRegExp:
         a === ")" ? c[c.length - 1] == "\\" ? c = c.slice(0, -1) + a : r = de.ParamRegExpEnd : c += a;
@@ -5578,7 +5578,7 @@ function tf(e) {
   }
   return r === de.ParamRegExp && t(`Unfinished custom RegExp for param "${u}"`), d(), s(), n;
 }
-const Zn = "[^/]+?", rf = {
+const ei = "[^/]+?", of = {
   sensitive: !1,
   strict: !1,
   start: !0,
@@ -5587,9 +5587,9 @@ const Zn = "[^/]+?", rf = {
 var Se = /* @__PURE__ */ (function(e) {
   return e[e._multiplier = 10] = "_multiplier", e[e.Root = 90] = "Root", e[e.Segment = 40] = "Segment", e[e.SubSegment = 30] = "SubSegment", e[e.Static = 40] = "Static", e[e.Dynamic = 20] = "Dynamic", e[e.BonusCustomRegExp = 10] = "BonusCustomRegExp", e[e.BonusWildcard = -50] = "BonusWildcard", e[e.BonusRepeatable = -20] = "BonusRepeatable", e[e.BonusOptional = -8] = "BonusOptional", e[e.BonusStrict = 0.7000000000000001] = "BonusStrict", e[e.BonusCaseSensitive = 0.25] = "BonusCaseSensitive", e;
 })(Se || {});
-const of = /[.+*?^${}()[\]/\\]/g;
-function nf(e, t) {
-  const r = re({}, rf, t), o = [];
+const nf = /[.+*?^${}()[\]/\\]/g;
+function sf(e, t) {
+  const r = re({}, of, t), o = [];
   let n = r.start ? "^" : "";
   const i = [];
   for (const u of e) {
@@ -5599,7 +5599,7 @@ function nf(e, t) {
       const m = u[d];
       let g = Se.Segment + (r.sensitive ? Se.BonusCaseSensitive : 0);
       if (m.type === At.Static)
-        d || (n += "/"), n += m.value.replace(of, "\\$&"), g += Se.Static;
+        d || (n += "/"), n += m.value.replace(nf, "\\$&"), g += Se.Static;
       else if (m.type === At.Param) {
         const { value: x, repeatable: k, optional: M, regexp: S } = m;
         i.push({
@@ -5607,8 +5607,8 @@ function nf(e, t) {
           repeatable: k,
           optional: M
         });
-        const O = S || Zn;
-        if (O !== Zn) {
+        const O = S || ei;
+        if (O !== ei) {
           g += Se.BonusCustomRegExp;
           try {
             `${O}`;
@@ -5663,7 +5663,7 @@ function nf(e, t) {
     stringify: a
   };
 }
-function sf(e, t) {
+function lf(e, t) {
   let r = 0;
   for (; r < e.length && r < t.length; ) {
     const o = t[r] - e[r];
@@ -5672,31 +5672,31 @@ function sf(e, t) {
   }
   return e.length < t.length ? e.length === 1 && e[0] === Se.Static + Se.Segment ? -1 : 1 : e.length > t.length ? t.length === 1 && t[0] === Se.Static + Se.Segment ? 1 : -1 : 0;
 }
-function $s(e, t) {
+function Ks(e, t) {
   let r = 0;
   const o = e.score, n = t.score;
   for (; r < o.length && r < n.length; ) {
-    const i = sf(o[r], n[r]);
+    const i = lf(o[r], n[r]);
     if (i) return i;
     r++;
   }
   if (Math.abs(n.length - o.length) === 1) {
-    if (ei(o)) return 1;
-    if (ei(n)) return -1;
+    if (ti(o)) return 1;
+    if (ti(n)) return -1;
   }
   return n.length - o.length;
 }
-function ei(e) {
+function ti(e) {
   const t = e[e.length - 1];
   return e.length > 0 && t[t.length - 1] < 0;
 }
-const lf = {
+const af = {
   strict: !1,
   end: !0,
   sensitive: !1
 };
-function af(e, t, r) {
-  const o = nf(tf(e.path), r), n = re(o, {
+function cf(e, t, r) {
+  const o = sf(rf(e.path), r), n = re(o, {
     record: e,
     parent: t,
     children: [],
@@ -5704,19 +5704,19 @@ function af(e, t, r) {
   });
   return t && !n.record.aliasOf == !t.record.aliasOf && t.children.push(n), n;
 }
-function cf(e, t) {
+function uf(e, t) {
   const r = [], o = /* @__PURE__ */ new Map();
-  t = Gn(lf, t);
+  t = qn(af, t);
   function n(d) {
     return o.get(d);
   }
   function i(d, m, g) {
-    const x = !g, k = ri(d);
+    const x = !g, k = oi(d);
     k.aliasOf = g && g.record;
-    const M = Gn(t, d), S = [k];
+    const M = qn(t, d), S = [k];
     if ("alias" in d) {
       const R = typeof d.alias == "string" ? [d.alias] : d.alias;
-      for (const B of R) S.push(ri(re({}, k, {
+      for (const B of R) S.push(oi(re({}, k, {
         components: g ? g.record.components : k.components,
         path: B,
         aliasOf: g ? g.record : k
@@ -5729,7 +5729,7 @@ function cf(e, t) {
         const ne = m.record.path, q = ne[ne.length - 1] === "/" ? "" : "/";
         R.path = m.record.path + (B && q + B);
       }
-      if (O = af(R, m, M), g ? g.alias.push(O) : (N = N || O, N !== O && N.alias.push(O), x && d.name && !oi(O) && s(d.name)), Ks(O) && a(O), k.children) {
+      if (O = cf(R, m, M), g ? g.alias.push(O) : (N = N || O, N !== O && N.alias.push(O), x && d.name && !ni(O) && s(d.name)), Ws(O) && a(O), k.children) {
         const ne = k.children;
         for (let q = 0; q < ne.length; q++) i(ne[q], O, g && g.children[q]);
       }
@@ -5740,7 +5740,7 @@ function cf(e, t) {
     } : ar;
   }
   function s(d) {
-    if (Bs(d)) {
+    if (Us(d)) {
       const m = o.get(d);
       m && (o.delete(d), r.splice(r.indexOf(m), 1), m.children.forEach(s), m.alias.forEach(s));
     } else {
@@ -5752,14 +5752,14 @@ function cf(e, t) {
     return r;
   }
   function a(d) {
-    const m = df(d, r);
-    r.splice(m, 0, d), d.record.name && !oi(d) && o.set(d.record.name, d);
+    const m = hf(d, r);
+    r.splice(m, 0, d), d.record.name && !ni(d) && o.set(d.record.name, d);
   }
   function u(d, m) {
     let g, x = {}, k, M;
     if ("name" in d && d.name) {
       if (g = o.get(d.name), !g) throw qt(se.MATCHER_NOT_FOUND, { location: d });
-      M = g.record.name, x = re(ti(m.params, g.keys.filter((N) => !N.optional).concat(g.parent ? g.parent.keys.filter((N) => N.optional) : []).map((N) => N.name)), d.params && ti(d.params, g.keys.map((N) => N.name))), k = g.stringify(x);
+      M = g.record.name, x = re(ri(m.params, g.keys.filter((N) => !N.optional).concat(g.parent ? g.parent.keys.filter((N) => N.optional) : []).map((N) => N.name)), d.params && ri(d.params, g.keys.map((N) => N.name))), k = g.stringify(x);
     } else if (d.path != null)
       k = d.path, g = r.find((N) => N.re.test(k)), g && (x = g.parse(k), M = g.record.name);
     else {
@@ -5778,7 +5778,7 @@ function cf(e, t) {
       path: k,
       params: x,
       matched: S,
-      meta: ff(S)
+      meta: df(S)
     };
   }
   e.forEach((d) => i(d));
@@ -5794,12 +5794,12 @@ function cf(e, t) {
     getRecordMatcher: n
   };
 }
-function ti(e, t) {
+function ri(e, t) {
   const r = {};
   for (const o of t) o in e && (r[o] = e[o]);
   return r;
 }
-function ri(e) {
+function oi(e) {
   const t = {
     path: e.path,
     redirect: e.redirect,
@@ -5807,7 +5807,7 @@ function ri(e) {
     meta: e.meta || {},
     aliasOf: e.aliasOf,
     beforeEnter: e.beforeEnter,
-    props: uf(e),
+    props: ff(e),
     children: e.children || [],
     instances: {},
     leaveGuards: /* @__PURE__ */ new Set(),
@@ -5817,39 +5817,39 @@ function ri(e) {
   };
   return Object.defineProperty(t, "mods", { value: {} }), t;
 }
-function uf(e) {
+function ff(e) {
   const t = {}, r = e.props || !1;
   if ("component" in e) t.default = r;
   else for (const o in e.components) t[o] = typeof r == "object" ? r[o] : r;
   return t;
 }
-function oi(e) {
+function ni(e) {
   for (; e; ) {
     if (e.record.aliasOf) return !0;
     e = e.parent;
   }
   return !1;
 }
-function ff(e) {
+function df(e) {
   return e.reduce((t, r) => re(t, r.meta), {});
 }
-function df(e, t) {
+function hf(e, t) {
   let r = 0, o = t.length;
   for (; r !== o; ) {
     const i = r + o >> 1;
-    $s(e, t[i]) < 0 ? o = i : r = i + 1;
+    Ks(e, t[i]) < 0 ? o = i : r = i + 1;
   }
-  const n = hf(e);
+  const n = pf(e);
   return n && (o = t.lastIndexOf(n, o - 1)), o;
 }
-function hf(e) {
+function pf(e) {
   let t = e;
-  for (; t = t.parent; ) if (Ks(t) && $s(e, t) === 0) return t;
+  for (; t = t.parent; ) if (Ws(t) && Ks(e, t) === 0) return t;
 }
-function Ks({ record: e }) {
+function Ws({ record: e }) {
   return !!(e.name || e.components && Object.keys(e.components).length || e.redirect);
 }
-function ni(e) {
+function ii(e) {
   const t = Ie(fo), r = Ie(ln), o = oe(() => {
     const a = et(e.to);
     return t.resolve(a);
@@ -5858,11 +5858,11 @@ function ni(e) {
     if (!c || !d.length) return -1;
     const m = d.findIndex(Gt.bind(null, c));
     if (m > -1) return m;
-    const g = ii(a[u - 2]);
-    return u > 1 && ii(c) === g && d[d.length - 1].path !== g ? d.findIndex(Gt.bind(null, a[u - 2])) : m;
-  }), i = oe(() => n.value > -1 && yf(r.params, o.value.params)), s = oe(() => n.value > -1 && n.value === r.matched.length - 1 && Hs(r.params, o.value.params));
+    const g = si(a[u - 2]);
+    return u > 1 && si(c) === g && d[d.length - 1].path !== g ? d.findIndex(Gt.bind(null, a[u - 2])) : m;
+  }), i = oe(() => n.value > -1 && bf(r.params, o.value.params)), s = oe(() => n.value > -1 && n.value === r.matched.length - 1 && Bs(r.params, o.value.params));
   function l(a = {}) {
-    if (vf(a)) {
+    if (yf(a)) {
       const u = t[et(e.replace) ? "replace" : "push"](et(e.to)).catch(ar);
       return e.viewTransition && typeof document < "u" && "startViewTransition" in document && document.startViewTransition(() => u), u;
     }
@@ -5876,10 +5876,10 @@ function ni(e) {
     navigate: l
   };
 }
-function pf(e) {
+function gf(e) {
   return e.length === 1 ? e[0] : e;
 }
-const gf = /* @__PURE__ */ Pt({
+const mf = /* @__PURE__ */ Tt({
   name: "RouterLink",
   compatConfig: { MODE: 3 },
   props: {
@@ -5897,15 +5897,15 @@ const gf = /* @__PURE__ */ Pt({
     },
     viewTransition: Boolean
   },
-  useLink: ni,
+  useLink: ii,
   setup(e, { slots: t }) {
-    const r = to(ni(e)), { options: o } = Ie(fo), n = oe(() => ({
-      [si(e.activeClass, o.linkActiveClass, "router-link-active")]: r.isActive,
-      [si(e.exactActiveClass, o.linkExactActiveClass, "router-link-exact-active")]: r.isExactActive
+    const r = to(ii(e)), { options: o } = Ie(fo), n = oe(() => ({
+      [li(e.activeClass, o.linkActiveClass, "router-link-active")]: r.isActive,
+      [li(e.exactActiveClass, o.linkExactActiveClass, "router-link-exact-active")]: r.isExactActive
     }));
     return () => {
-      const i = t.default && pf(t.default(r));
-      return e.custom ? i : xs("a", {
+      const i = t.default && gf(t.default(r));
+      return e.custom ? i : ks("a", {
         "aria-current": r.isExactActive ? e.ariaCurrentValue : null,
         href: r.href,
         onClick: r.navigate,
@@ -5913,8 +5913,8 @@ const gf = /* @__PURE__ */ Pt({
       }, i);
     };
   }
-}), mf = gf;
-function vf(e) {
+}), vf = mf;
+function yf(e) {
   if (!(e.metaKey || e.altKey || e.ctrlKey || e.shiftKey) && !e.defaultPrevented && !(e.button !== void 0 && e.button !== 0)) {
     if (e.currentTarget && e.currentTarget.getAttribute) {
       const t = e.currentTarget.getAttribute("target");
@@ -5923,7 +5923,7 @@ function vf(e) {
     return e.preventDefault && e.preventDefault(), !0;
   }
 }
-function yf(e, t) {
+function bf(e, t) {
   for (const r in t) {
     const o = t[r], n = e[r];
     if (typeof o == "string") {
@@ -5932,10 +5932,10 @@ function yf(e, t) {
   }
   return !0;
 }
-function ii(e) {
+function si(e) {
   return e ? e.aliasOf ? e.aliasOf.path : e.path : "";
 }
-const si = (e, t, r) => e ?? t ?? r, bf = /* @__PURE__ */ Pt({
+const li = (e, t, r) => e ?? t ?? r, wf = /* @__PURE__ */ Tt({
   name: "RouterView",
   inheritAttrs: !1,
   props: {
@@ -5947,15 +5947,15 @@ const si = (e, t, r) => e ?? t ?? r, bf = /* @__PURE__ */ Pt({
   },
   compatConfig: { MODE: 3 },
   setup(e, { attrs: t, slots: r }) {
-    const o = Ie(Uo), n = oe(() => e.route || o.value), i = Ie(Xn, 0), s = oe(() => {
+    const o = Ie(Bo), n = oe(() => e.route || o.value), i = Ie(Zn, 0), s = oe(() => {
       let u = et(i);
       const { matched: c } = n.value;
       let d;
       for (; (d = c[u]) && !d.components; ) u++;
       return u;
     }), l = oe(() => n.value.matched[s.value]);
-    Bt(Xn, oe(() => s.value + 1)), Bt(Yu, l), Bt(Uo, n);
-    const a = Tt();
+    Bt(Zn, oe(() => s.value + 1)), Bt(Qu, l), Bt(Bo, n);
+    const a = Pt();
     return $e(() => [
       a.value,
       l.value,
@@ -5964,37 +5964,37 @@ const si = (e, t, r) => e ?? t ?? r, bf = /* @__PURE__ */ Pt({
       c && (c.instances[d] = u, g && g !== c && u && u === m && (c.leaveGuards.size || (c.leaveGuards = g.leaveGuards), c.updateGuards.size || (c.updateGuards = g.updateGuards))), u && c && (!g || !Gt(c, g) || !m) && (c.enterCallbacks[d] || []).forEach((k) => k(u));
     }, { flush: "post" }), () => {
       const u = n.value, c = e.name, d = l.value, m = d && d.components[c];
-      if (!m) return li(r.default, {
+      if (!m) return ai(r.default, {
         Component: m,
         route: u
       });
-      const g = d.props[c], x = g ? g === !0 ? u.params : typeof g == "function" ? g(u) : g : null, M = xs(m, re({}, x, t, {
+      const g = d.props[c], x = g ? g === !0 ? u.params : typeof g == "function" ? g(u) : g : null, M = ks(m, re({}, x, t, {
         onVnodeUnmounted: (S) => {
           S.component.isUnmounted && (d.instances[c] = null);
         },
         ref: a
       }));
-      return li(r.default, {
+      return ai(r.default, {
         Component: M,
         route: u
       }) || M;
     };
   }
 });
-function li(e, t) {
+function ai(e, t) {
   if (!e) return null;
   const r = e(t);
   return r.length === 1 ? r[0] : r;
 }
-const wf = bf;
-function _f(e) {
-  const t = cf(e.routes, e), r = e.parseQuery || qu, o = e.stringifyQuery || Qn, n = e.history, i = Zt(), s = Zt(), l = Zt(), a = ct(mt);
+const _f = wf;
+function xf(e) {
+  const t = uf(e.routes, e), r = e.parseQuery || Ju, o = e.stringifyQuery || Xn, n = e.history, i = Zt(), s = Zt(), l = Zt(), a = ct(mt);
   let u = mt;
   Ft && e.scrollBehavior && "scrollRestoration" in history && (history.scrollRestoration = "manual");
-  const c = Eo.bind(null, (b) => "" + b), d = Eo.bind(null, Pu), m = Eo.bind(null, mr);
+  const c = Eo.bind(null, (b) => "" + b), d = Eo.bind(null, Ou), m = Eo.bind(null, mr);
   function g(b, I) {
-    let T, D;
-    return Bs(b) ? (T = t.getRecordMatcher(b), D = I) : D = b, t.addRoute(D, T);
+    let P, D;
+    return Us(b) ? (P = t.getRecordMatcher(b), D = I) : D = b, t.addRoute(D, P);
   }
   function x(b) {
     const I = t.getRecordMatcher(b);
@@ -6016,24 +6016,24 @@ function _f(e) {
         href: w
       });
     }
-    let T;
+    let P;
     if (b.path != null)
-      T = re({}, b, { path: So(r, b.path, I.path).path });
+      P = re({}, b, { path: So(r, b.path, I.path).path });
     else {
       const p = re({}, b.params);
       for (const y in p) p[y] == null && delete p[y];
-      T = re({}, b, { params: d(p) }), I.params = d(I.params);
+      P = re({}, b, { params: d(p) }), I.params = d(I.params);
     }
-    const D = t.resolve(T, I), U = b.hash || "";
+    const D = t.resolve(P, I), U = b.hash || "";
     D.params = c(m(D.params));
-    const f = Iu(o, re({}, b, {
-      hash: Ru(U),
+    const f = Mu(o, re({}, b, {
+      hash: Cu(U),
       path: D.path
     })), h = n.createHref(f);
     return re({
       fullPath: f,
       hash: U,
-      query: o === Qn ? Ju(b.query) : b.query || {}
+      query: o === Xn ? Yu(b.query) : b.query || {}
     }, D, {
       redirectedFrom: void 0,
       href: h
@@ -6055,9 +6055,9 @@ function _f(e) {
     return R(re(O(b), { replace: !0 }));
   }
   function ne(b, I) {
-    const T = b.matched[b.matched.length - 1];
-    if (T && T.redirect) {
-      const { redirect: D } = T;
+    const P = b.matched[b.matched.length - 1];
+    if (P && P.redirect) {
+      const { redirect: D } = P;
       let U = typeof D == "function" ? D(b, I) : D;
       return typeof U == "string" && (U = U.includes("?") || U.includes("#") ? U = O(U) : { path: U }, U.params = {}), re({
         query: b.query,
@@ -6067,16 +6067,16 @@ function _f(e) {
     }
   }
   function q(b, I) {
-    const T = u = S(b), D = a.value, U = b.state, f = b.force, h = b.replace === !0, p = ne(T, D);
+    const P = u = S(b), D = a.value, U = b.state, f = b.force, h = b.replace === !0, p = ne(P, D);
     if (p) return q(re(O(p), {
       state: typeof p == "object" ? re({}, U, p.state) : U,
       force: f,
       replace: h
-    }), I || T);
-    const y = T;
+    }), I || P);
+    const y = P;
     y.redirectedFrom = I;
     let w;
-    return !f && Mu(o, D, T) && (w = qt(se.NAVIGATION_DUPLICATED, {
+    return !f && Du(o, D, P) && (w = qt(se.NAVIGATION_DUPLICATED, {
       to: y,
       from: D
     }), Ge(D, D, !0, !1)), (w ? Promise.resolve(w) : he(y, D)).catch((v) => nt(v) ? nt(v, se.NAVIGATION_GUARD_REDIRECT) ? v : gt(v) : Y(v, y, D)).then((v) => {
@@ -6091,54 +6091,54 @@ function _f(e) {
     });
   }
   function ve(b, I) {
-    const T = N(b, I);
-    return T ? Promise.reject(T) : Promise.resolve();
+    const P = N(b, I);
+    return P ? Promise.reject(P) : Promise.resolve();
   }
   function ke(b) {
     const I = It.values().next().value;
     return I && typeof I.runWithContext == "function" ? I.runWithContext(b) : b();
   }
   function he(b, I) {
-    let T;
-    const [D, U, f] = Qu(b, I);
-    T = Ro(D.reverse(), "beforeRouteLeave", b, I);
+    let P;
+    const [D, U, f] = Xu(b, I);
+    P = Ro(D.reverse(), "beforeRouteLeave", b, I);
     for (const p of D) p.leaveGuards.forEach((y) => {
-      T.push(bt(y, b, I));
+      P.push(bt(y, b, I));
     });
     const h = ve.bind(null, b, I);
-    return T.push(h), Le(T).then(() => {
-      T = [];
-      for (const p of i.list()) T.push(bt(p, b, I));
-      return T.push(h), Le(T);
+    return P.push(h), Le(P).then(() => {
+      P = [];
+      for (const p of i.list()) P.push(bt(p, b, I));
+      return P.push(h), Le(P);
     }).then(() => {
-      T = Ro(U, "beforeRouteUpdate", b, I);
+      P = Ro(U, "beforeRouteUpdate", b, I);
       for (const p of U) p.updateGuards.forEach((y) => {
-        T.push(bt(y, b, I));
+        P.push(bt(y, b, I));
       });
-      return T.push(h), Le(T);
+      return P.push(h), Le(P);
     }).then(() => {
-      T = [];
-      for (const p of f) if (p.beforeEnter) if (We(p.beforeEnter)) for (const y of p.beforeEnter) T.push(bt(y, b, I));
-      else T.push(bt(p.beforeEnter, b, I));
-      return T.push(h), Le(T);
-    }).then(() => (b.matched.forEach((p) => p.enterCallbacks = {}), T = Ro(f, "beforeRouteEnter", b, I, ke), T.push(h), Le(T))).then(() => {
-      T = [];
-      for (const p of s.list()) T.push(bt(p, b, I));
-      return T.push(h), Le(T);
+      P = [];
+      for (const p of f) if (p.beforeEnter) if (We(p.beforeEnter)) for (const y of p.beforeEnter) P.push(bt(y, b, I));
+      else P.push(bt(p.beforeEnter, b, I));
+      return P.push(h), Le(P);
+    }).then(() => (b.matched.forEach((p) => p.enterCallbacks = {}), P = Ro(f, "beforeRouteEnter", b, I, ke), P.push(h), Le(P))).then(() => {
+      P = [];
+      for (const p of s.list()) P.push(bt(p, b, I));
+      return P.push(h), Le(P);
     }).catch((p) => nt(p, se.NAVIGATION_CANCELLED) ? p : Promise.reject(p));
   }
-  function ye(b, I, T) {
-    l.list().forEach((D) => ke(() => D(b, I, T)));
+  function ye(b, I, P) {
+    l.list().forEach((D) => ke(() => D(b, I, P)));
   }
-  function fe(b, I, T, D, U) {
+  function fe(b, I, P, D, U) {
     const f = N(b, I);
     if (f) return f;
     const h = I === mt, p = Ft ? history.state : {};
-    T && (D || h ? n.replace(b.fullPath, re({ scroll: h && p && p.scroll }, U)) : n.push(b.fullPath, U)), a.value = b, Ge(b, I, T, h), gt();
+    P && (D || h ? n.replace(b.fullPath, re({ scroll: h && p && p.scroll }, U)) : n.push(b.fullPath, U)), a.value = b, Ge(b, I, P, h), gt();
   }
   let pe;
   function H() {
-    pe || (pe = n.listen((b, I, T) => {
+    pe || (pe = n.listen((b, I, P) => {
       if (!_t.listening) return;
       const D = S(b), U = ne(D, _t.currentRoute.value);
       if (U) {
@@ -6150,18 +6150,18 @@ function _f(e) {
       }
       u = D;
       const f = a.value;
-      Ft && Uu(Yn(f.fullPath, T.delta), Hu()), he(D, f).catch((h) => nt(h, se.NAVIGATION_ABORTED | se.NAVIGATION_CANCELLED) ? h : nt(h, se.NAVIGATION_GUARD_REDIRECT) ? (q(re(O(h.to), { force: !0 }), D).then((p) => {
-        nt(p, se.NAVIGATION_ABORTED | se.NAVIGATION_DUPLICATED) && !T.delta && T.type === Ho.pop && n.go(-1, !1);
-      }).catch(ar), Promise.reject()) : (T.delta && n.go(-T.delta, !1), Y(h, D, f))).then((h) => {
-        h = h || fe(D, f, !1), h && (T.delta && !nt(h, se.NAVIGATION_CANCELLED) ? n.go(-T.delta, !1) : T.type === Ho.pop && nt(h, se.NAVIGATION_ABORTED | se.NAVIGATION_DUPLICATED) && n.go(-1, !1)), ye(D, f, h);
+      Ft && $u(Qn(f.fullPath, P.delta), Bu()), he(D, f).catch((h) => nt(h, se.NAVIGATION_ABORTED | se.NAVIGATION_CANCELLED) ? h : nt(h, se.NAVIGATION_GUARD_REDIRECT) ? (q(re(O(h.to), { force: !0 }), D).then((p) => {
+        nt(p, se.NAVIGATION_ABORTED | se.NAVIGATION_DUPLICATED) && !P.delta && P.type === zo.pop && n.go(-1, !1);
+      }).catch(ar), Promise.reject()) : (P.delta && n.go(-P.delta, !1), Y(h, D, f))).then((h) => {
+        h = h || fe(D, f, !1), h && (P.delta && !nt(h, se.NAVIGATION_CANCELLED) ? n.go(-P.delta, !1) : P.type === zo.pop && nt(h, se.NAVIGATION_ABORTED | se.NAVIGATION_DUPLICATED) && n.go(-1, !1)), ye(D, f, h);
       }).catch(ar);
     }));
   }
   let ie = Zt(), J = Zt(), X;
-  function Y(b, I, T) {
+  function Y(b, I, P) {
     gt(b);
     const D = J.list();
-    return D.length ? D.forEach((U) => U(b, I, T)) : console.error(b), Promise.reject(b);
+    return D.length ? D.forEach((U) => U(b, I, P)) : console.error(b), Promise.reject(b);
   }
   function rt() {
     return X && a.value !== mt ? Promise.resolve() : new Promise((b, I) => {
@@ -6169,15 +6169,15 @@ function _f(e) {
     });
   }
   function gt(b) {
-    return X || (X = !b, H(), ie.list().forEach(([I, T]) => b ? T(b) : I()), ie.reset()), b;
+    return X || (X = !b, H(), ie.list().forEach(([I, P]) => b ? P(b) : I()), ie.reset()), b;
   }
-  function Ge(b, I, T, D) {
+  function Ge(b, I, P, D) {
     const { scrollBehavior: U } = e;
     if (!Ft || !U) return Promise.resolve();
-    const f = !T && $u(Yn(b.fullPath, 0)) || (D || !T) && history.state && history.state.scroll || null;
-    return br().then(() => U(b, I, f)).then((h) => h && Bu(h)).catch((h) => Y(h, b, I));
+    const f = !P && Ku(Qn(b.fullPath, 0)) || (D || !P) && history.state && history.state.scroll || null;
+    return br().then(() => U(b, I, f)).then((h) => h && Uu(h)).catch((h) => Y(h, b, I));
   }
-  const Te = (b) => n.go(b);
+  const Pe = (b) => n.go(b);
   let Nt;
   const It = /* @__PURE__ */ new Set(), _t = {
     currentRoute: a,
@@ -6191,16 +6191,16 @@ function _f(e) {
     options: e,
     push: R,
     replace: B,
-    go: Te,
-    back: () => Te(-1),
-    forward: () => Te(1),
+    go: Pe,
+    back: () => Pe(-1),
+    forward: () => Pe(1),
     beforeEach: i.add,
     beforeResolve: s.add,
     afterEach: l.add,
     onError: J.add,
     isReady: rt,
     install(b) {
-      b.component("RouterLink", mf), b.component("RouterView", wf), b.config.globalProperties.$router = _t, Object.defineProperty(b.config.globalProperties, "$route", {
+      b.component("RouterLink", vf), b.component("RouterView", _f), b.config.globalProperties.$router = _t, Object.defineProperty(b.config.globalProperties, "$route", {
         enumerable: !0,
         get: () => et(a)
       }), Ft && !Nt && a.value === mt && (Nt = !0, R(n.location).catch((D) => {
@@ -6210,52 +6210,52 @@ function _f(e) {
         get: () => a.value[D],
         enumerable: !0
       });
-      b.provide(fo, _t), b.provide(ln, Ii(I)), b.provide(Uo, a);
-      const T = b.unmount;
+      b.provide(fo, _t), b.provide(ln, Mi(I)), b.provide(Bo, a);
+      const P = b.unmount;
       It.add(b), b.unmount = function() {
-        It.delete(b), It.size < 1 && (u = mt, pe && pe(), pe = null, a.value = mt, Nt = !1, X = !1), T();
+        It.delete(b), It.size < 1 && (u = mt, pe && pe(), pe = null, a.value = mt, Nt = !1, X = !1), P();
       };
     }
   };
   function Le(b) {
-    return b.reduce((I, T) => I.then(() => ke(T)), Promise.resolve());
+    return b.reduce((I, P) => I.then(() => ke(P)), Promise.resolve());
   }
   return _t;
 }
-function Vf() {
+function jf() {
   return Ie(fo);
 }
-function jf(e) {
+function Lf(e) {
   return Ie(ln);
 }
-const xf = [
+const kf = [
   {
     path: "/",
     name: "/",
-    component: () => import("./index-CWKID_IB.js")
+    component: () => import("./index-goOYcO8U.js")
     /* no children */
   },
   {
     path: "/mutations",
     name: "/mutations",
-    component: () => import("./mutations-DJc8p7YC.js")
+    component: () => import("./mutations-BNe8aMZH.js")
     /* no children */
   },
   {
     path: "/queries",
     name: "/queries",
-    component: () => import("./queries-CLrIueL2.js"),
+    component: () => import("./queries-0xQLbzuX.js"),
     children: [
       {
         path: "",
         name: "/queries/",
-        component: () => import("./index-oPdQg_Hb.js")
+        component: () => import("./index-BNGmSTu0.js")
         /* no children */
       },
       {
         path: ":queryId",
         name: "/queries/[queryId]",
-        component: () => import("./_queryId_-B8mNYXBL.js")
+        component: () => import("./_queryId_-BizYY_I8.js")
         /* no children */
       }
     ]
@@ -6263,14 +6263,14 @@ const xf = [
   {
     path: "/settings",
     name: "/settings",
-    component: () => import("./settings-T9huR8_1.js")
+    component: () => import("./settings-BRfTfxFz.js")
     /* no children */
   }
 ];
-function kf(e) {
-  const t = _f({
-    history: Xu(),
-    routes: [{ path: "/", redirect: "/queries" }, ...xf]
+function Ef(e) {
+  const t = xf({
+    history: Zu(),
+    routes: [{ path: "/", redirect: "/queries" }, ...kf]
   });
   t.afterEach((o) => {
     localStorage.setItem("pc-devtools-route", o.fullPath);
@@ -6278,63 +6278,63 @@ function kf(e) {
   const r = localStorage.getItem("pc-devtools-route") || "/queries";
   return t.push(r), e;
 }
-const Lf = /* @__PURE__ */ cc(mu, {
-  configureApp: kf,
+const zf = /* @__PURE__ */ uc(vu, {
+  configureApp: Ef,
   shadowRoot: !0
 });
 export {
-  ql as A,
+  Jl as A,
   Bt as B,
-  Yi as C,
+  Qi as C,
   br as D,
   Ie as E,
   Ce as F,
   pt as G,
   Yr as H,
-  _a as I,
+  xa as I,
   gr as J,
-  Ic as K,
+  Mc as K,
   He as L,
-  Ff as M,
-  Af as N,
-  Kc as O,
-  Da as P,
+  Vf as M,
+  Rf as N,
+  Wc as O,
+  Fa as P,
   Tf as Q,
-  If as R,
-  Rf as S,
-  Df as T,
+  Mf as R,
+  Cf as S,
+  Ff as T,
   ue as U,
-  jf as V,
-  Mf as W,
-  Yc as X,
-  ru as Y,
-  Lf as Z,
-  gu as _,
+  Lf as V,
+  Df as W,
+  Qc as X,
+  ou as Y,
+  zf as Z,
+  mu as _,
   Ae as a,
   oe as b,
   Ot as c,
-  Pt as d,
-  sl as e,
-  Vf as f,
+  Tt as d,
+  ll as e,
+  jf as f,
   Ut as g,
-  Pf as h,
+  Of as h,
   et as i,
-  Zl as j,
+  ea as j,
   ae as k,
-  Ea as l,
+  Sa as l,
   oo as m,
   Jt as n,
   je as o,
-  Sf as p,
-  Cf as q,
+  Af as p,
+  Pf as q,
   yn as r,
   ct as s,
-  gi as t,
-  Of as u,
-  Nf as v,
+  mi as t,
+  Nf as u,
+  If as v,
   er as w,
-  Tt as x,
+  Pt as x,
   $e as y,
   wr as z
 };
-//# sourceMappingURL=index-UPnYYHaa.js.map
+//# sourceMappingURL=index-CIfbEdr_.js.map