@on-mission/sdk 0.1.0

package/dist/index.d.ts

@@ -0,0 +1,21 @@
+/**
+ * Mission SDK
+ *
+ * The SDK that plugin runtimes use to interact with the Mission platform.
+ * Communication is HTTP-native: outbound REST calls to the Mission API,
+ * inbound HTTP requests via Daytona Preview URLs.
+ *
+ * See docs/technical-designs/plugin-architecture.md.
+ * See docs/technical-designs/daytona-sandbox-runtime.md.
+ */
+export type { Tool, ToolFunction, ToolFunctionPermission, ToolKind } from '@mission/models';
+export type { ApiClient } from './api';
+export type { AuthCredentials, AuthModule, OAuthCredentials } from './auth';
+export type { ConfigModule } from './config';
+export type { PluginContext } from './context';
+export type { AgentMessage, EventsModule } from './events';
+export type { IngressHandler, IngressModule, IngressRequest, IngressResponse, IngressStreamEvents, IngressUrl } from './ingress';
+export type { MissionSDK, MissionSDKOptions } from './sdk';
+export { createMissionSDK } from './sdk';
+export type { ToolHandler, ToolsModule } from './tool-registry';
+//# sourceMappingURL=index.d.ts.map

package/dist/index.d.ts.map

@@ -0,0 +1 @@
+{"version":3,"file":"index.d.ts","sourceRoot":"","sources":["../src/index.ts"],"names":[],"mappings":"AAAA;;;;;;;;;GASG;AAEH,YAAY,EACV,IAAI,EACJ,YAAY,EACZ,sBAAsB,EACtB,QAAQ,EACT,MAAM,iBAAiB,CAAA;AACxB,YAAY,EAAE,SAAS,EAAE,MAAM,OAAO,CAAA;AACtC,YAAY,EAAE,eAAe,EAAE,UAAU,EAAE,gBAAgB,EAAE,MAAM,QAAQ,CAAA;AAC3E,YAAY,EAAE,YAAY,EAAE,MAAM,UAAU,CAAA;AAC5C,YAAY,EAAE,aAAa,EAAE,MAAM,WAAW,CAAA;AAC9C,YAAY,EAAE,YAAY,EAAE,YAAY,EAAE,MAAM,UAAU,CAAA;AAC1D,YAAY,EACV,cAAc,EACd,aAAa,EACb,cAAc,EACd,eAAe,EACf,mBAAmB,EACnB,UAAU,EACX,MAAM,WAAW,CAAA;AAClB,YAAY,EAAE,UAAU,EAAE,iBAAiB,EAAE,MAAM,OAAO,CAAA;AAC1D,OAAO,EAAE,gBAAgB,EAAE,MAAM,OAAO,CAAA;AACxC,YAAY,EAAE,WAAW,EAAE,WAAW,EAAE,MAAM,iBAAiB,CAAA"}

package/dist/index.js

@@ -0,0 +1,12 @@
+/**
+ * Mission SDK
+ *
+ * The SDK that plugin runtimes use to interact with the Mission platform.
+ * Communication is HTTP-native: outbound REST calls to the Mission API,
+ * inbound HTTP requests via Daytona Preview URLs.
+ *
+ * See docs/technical-designs/plugin-architecture.md.
+ * See docs/technical-designs/daytona-sandbox-runtime.md.
+ */
+export { createMissionSDK } from './sdk';
+//# sourceMappingURL=index.js.map

package/dist/index.js.map

@@ -0,0 +1 @@
+{"version":3,"file":"index.js","sourceRoot":"","sources":["../src/index.ts"],"names":[],"mappings":"AAAA;;;;;;;;;GASG;AAsBH,OAAO,EAAE,gBAAgB,EAAE,MAAM,OAAO,CAAA"}

package/dist/ingress.d.ts

@@ -0,0 +1,133 @@
+/**
+ * Ingress Module
+ *
+ * Handles inbound traffic from external services (webhooks, WebSocket streams).
+ * Plugins register handlers per endpoint name; the HTTP server routes traffic
+ * to them.
+ *
+ * Traffic flow (HTTP-native, no WebSocket control plane):
+ *
+ *   Tool calls from Mission API:
+ *     Mission API → Daytona Standard Preview URL → HTTP server → tool handler
+ *
+ *   Webhooks from external services:
+ *     External service → Daytona Signed Preview URL → HTTP server → ingress handler
+ *
+ *   WebSocket streams (e.g., Twilio media):
+ *     External service → Daytona Signed Preview URL → HTTP server → stream handler
+ *
+ * The HTTP server (started by mission.connect()) dispatches to the registered
+ * handler and sends the response back as a standard HTTP response.
+ *
+ * For WebSocket endpoints: event-based model (connect, message, disconnect).
+ * WebSocket support depends on Daytona Preview URL proxy supporting upgrades.
+ *
+ * Endpoint names are chosen by the plugin author at registration time.
+ * There is no need to pre-declare them in mission.json — the SDK registers
+ * them dynamically and reports them to the control plane at ready().
+ *
+ * See docs/technical-designs/plugin-architecture.md §4.4.
+ * See docs/technical-designs/daytona-sandbox-runtime.md §2-3.
+ */
+import type { ApiClient } from './api';
+export type IngressRequest = {
+    /** HTTP method (GET, POST, etc.). */
+    method: string;
+    /** Request path (relative to the ingress endpoint). */
+    path: string;
+    /** Request headers (lowercased keys). */
+    headers: Record<string, string>;
+    /** Raw request body as a string. */
+    body: string;
+    /** Parsed query parameters. */
+    query: Record<string, string>;
+};
+export type IngressResponse = {
+    /** HTTP status code. */
+    status: number;
+    /** Response headers. */
+    headers?: Record<string, string>;
+    /** Response body. */
+    body?: string;
+};
+export type IngressHandler = (request: IngressRequest) => Promise<IngressResponse>;
+export type IngressStreamEvents = {
+    /** Called when a new WebSocket connection is established. */
+    onConnect: (streamId: string, metadata: Record<string, string>) => void;
+    /** Called when a message is received on the WebSocket. */
+    onMessage: (streamId: string, data: string) => void;
+    /** Called when the WebSocket disconnects. */
+    onDisconnect: (streamId: string) => void;
+};
+/**
+ * Result from requesting a public ingress URL.
+ * The URL is a Daytona Signed Preview URL with a configurable TTL.
+ * The plugin is responsible for monitoring expiry and re-requesting.
+ */
+export type IngressUrl = {
+    /** The public URL to register with external services. */
+    url: string;
+    /** ISO 8601 timestamp when this URL expires. */
+    expiresAt: string;
+};
+export type IngressModule = {
+    /**
+     * Register a handler for an HTTP ingress endpoint.
+     * The endpoint name is chosen by the plugin author.
+     *
+     * @example
+     * ```ts
+     * mission.ingress.on('webhook', async (request) => {
+     *   const payload = JSON.parse(request.body)
+     *   // process webhook...
+     *   return { status: 200 }
+     * })
+     * ```
+     */
+    on: (endpointName: string, handler: IngressHandler) => void;
+    /**
+     * Register handlers for a WebSocket ingress endpoint.
+     * The endpoint name is chosen by the plugin author.
+     *
+     * @example
+     * ```ts
+     * mission.ingress.onStream('media', {
+     *   onConnect: (streamId, meta) => { startSession(streamId) },
+     *   onMessage: (streamId, data) => { processAudio(streamId, data) },
+     *   onDisconnect: (streamId) => { endSession(streamId) }
+     * })
+     * ```
+     */
+    onStream: (endpointName: string, handlers: IngressStreamEvents) => void;
+    /**
+     * Get a public URL for a named ingress endpoint.
+     *
+     * The control plane generates a Daytona Signed Preview URL with a
+     * configurable TTL. The plugin is responsible for:
+     *   1. Registering this URL with the external service.
+     *   2. Monitoring `expiresAt` and calling this again before expiry.
+     *   3. Re-registering the new URL with the external service.
+     *
+     * On sandbox restart, plugin processes restart and naturally
+     * re-register during their startup sequence.
+     *
+     * @example
+     * ```ts
+     * const { url, expiresAt } = await mission.ingress.getPublicUrl('webhook')
+     * await twilio.incomingPhoneNumbers(sid).update({ voiceUrl: url })
+     * ```
+     */
+    getPublicUrl: (endpointName: string) => Promise<IngressUrl>;
+};
+export type IngressRegistry = IngressModule & {
+    /** Dispatch an HTTP request to the registered handler. */
+    dispatch: (endpointName: string, request: IngressRequest) => Promise<IngressResponse>;
+    /** Dispatch WebSocket events to the registered stream handlers. */
+    dispatchStreamEvent: (endpointName: string, event: 'connect' | 'message' | 'disconnect', streamId: string, data?: string, metadata?: Record<string, string>) => void;
+    /** Get all registered HTTP endpoint names. */
+    getHttpEndpointNames: () => string[];
+    /** Get all registered stream endpoint names. */
+    getStreamEndpointNames: () => string[];
+};
+export declare function createIngressRegistry(api: ApiClient): IngressRegistry;
+//# sourceMappingURL=ingress.d.ts.map

package/dist/ingress.d.ts.map

@@ -0,0 +1 @@
+{"version":3,"file":"ingress.d.ts","sourceRoot":"","sources":["../src/ingress.ts"],"names":[],"mappings":"AAAA;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;GA8BG;AAEH,OAAO,KAAK,EAAE,SAAS,EAAE,MAAM,OAAO,CAAA;AAItC,MAAM,MAAM,cAAc,GAAG;IAC3B,qCAAqC;IACrC,MAAM,EAAE,MAAM,CAAA;IACd,uDAAuD;IACvD,IAAI,EAAE,MAAM,CAAA;IACZ,yCAAyC;IACzC,OAAO,EAAE,MAAM,CAAC,MAAM,EAAE,MAAM,CAAC,CAAA;IAC/B,oCAAoC;IACpC,IAAI,EAAE,MAAM,CAAA;IACZ,+BAA+B;IAC/B,KAAK,EAAE,MAAM,CAAC,MAAM,EAAE,MAAM,CAAC,CAAA;CAC9B,CAAA;AAED,MAAM,MAAM,eAAe,GAAG;IAC5B,wBAAwB;IACxB,MAAM,EAAE,MAAM,CAAA;IACd,wBAAwB;IACxB,OAAO,CAAC,EAAE,MAAM,CAAC,MAAM,EAAE,MAAM,CAAC,CAAA;IAChC,qBAAqB;IACrB,IAAI,CAAC,EAAE,MAAM,CAAA;CACd,CAAA;AAED,MAAM,MAAM,cAAc,GAAG,CAC3B,OAAO,EAAE,cAAc,KACpB,OAAO,CAAC,eAAe,CAAC,CAAA;AAI7B,MAAM,MAAM,mBAAmB,GAAG;IAChC,6DAA6D;IAC7D,SAAS,EAAE,CAAC,QAAQ,EAAE,MAAM,EAAE,QAAQ,EAAE,MAAM,CAAC,MAAM,EAAE,MAAM,CAAC,KAAK,IAAI,CAAA;IACvE,0DAA0D;IAC1D,SAAS,EAAE,CAAC,QAAQ,EAAE,MAAM,EAAE,IAAI,EAAE,MAAM,KAAK,IAAI,CAAA;IACnD,6CAA6C;IAC7C,YAAY,EAAE,CAAC,QAAQ,EAAE,MAAM,KAAK,IAAI,CAAA;CACzC,CAAA;AAID;;;;GAIG;AACH,MAAM,MAAM,UAAU,GAAG;IACvB,yDAAyD;IACzD,GAAG,EAAE,MAAM,CAAA;IACX,gDAAgD;IAChD,SAAS,EAAE,MAAM,CAAA;CAClB,CAAA;AAED,MAAM,MAAM,aAAa,GAAG;IAC1B;;;;;;;;;;;;OAYG;IACH,EAAE,EAAE,CAAC,YAAY,EAAE,MAAM,EAAE,OAAO,EAAE,cAAc,KAAK,IAAI,CAAA;IAE3D;;;;;;;;;;;;OAYG;IACH,QAAQ,EAAE,CAAC,YAAY,EAAE,MAAM,EAAE,QAAQ,EAAE,mBAAmB,KAAK,IAAI,CAAA;IAEvE;;;;;;;;;;;;;;;;;OAiBG;IACH,YAAY,EAAE,CAAC,YAAY,EAAE,MAAM,KAAK,OAAO,CAAC,UAAU,CAAC,CAAA;CAC5D,CAAA;AAID,MAAM,MAAM,eAAe,GAAG,aAAa,GAAG;IAC5C,0DAA0D;IAC1D,QAAQ,EAAE,CACR,YAAY,EAAE,MAAM,EACpB,OAAO,EAAE,cAAc,KACpB,OAAO,CAAC,eAAe,CAAC,CAAA;IAC7B,mEAAmE;IACnE,mBAAmB,EAAE,CACnB,YAAY,EAAE,MAAM,EACpB,KAAK,EAAE,SAAS,GAAG,SAAS,GAAG,YAAY,EAC3C,QAAQ,EAAE,MAAM,EAChB,IAAI,CAAC,EAAE,MAAM,EACb,QAAQ,CAAC,EAAE,MAAM,CAAC,MAAM,EAAE,MAAM,CAAC,KAC9B,IAAI,CAAA;IACT,8CAA8C;IAC9C,oBAAoB,EAAE,MAAM,MAAM,EAAE,CAAA;IACpC,gDAAgD;IAChD,sBAAsB,EAAE,MAAM,MAAM,EAAE,CAAA;CACvC,CAAA;AAID,wBAAgB,qBAAqB,CAAC,GAAG,EAAE,SAAS,GAAG,eAAe,CA+ErE"}

package/dist/ingress.js

@@ -0,0 +1,89 @@
+/**
+ * Ingress Module
+ *
+ * Handles inbound traffic from external services (webhooks, WebSocket streams).
+ * Plugins register handlers per endpoint name; the HTTP server routes traffic
+ * to them.
+ *
+ * Traffic flow (HTTP-native, no WebSocket control plane):
+ *
+ *   Tool calls from Mission API:
+ *     Mission API → Daytona Standard Preview URL → HTTP server → tool handler
+ *
+ *   Webhooks from external services:
+ *     External service → Daytona Signed Preview URL → HTTP server → ingress handler
+ *
+ *   WebSocket streams (e.g., Twilio media):
+ *     External service → Daytona Signed Preview URL → HTTP server → stream handler
+ *
+ * The HTTP server (started by mission.connect()) dispatches to the registered
+ * handler and sends the response back as a standard HTTP response.
+ *
+ * For WebSocket endpoints: event-based model (connect, message, disconnect).
+ * WebSocket support depends on Daytona Preview URL proxy supporting upgrades.
+ *
+ * Endpoint names are chosen by the plugin author at registration time.
+ * There is no need to pre-declare them in mission.json — the SDK registers
+ * them dynamically and reports them to the control plane at ready().
+ *
+ * See docs/technical-designs/plugin-architecture.md §4.4.
+ * See docs/technical-designs/daytona-sandbox-runtime.md §2-3.
+ */
+// ─── Factory ─────────────────────────────────────────────────────────────────
+export function createIngressRegistry(api) {
+    const httpHandlers = new Map();
+    const streamHandlers = new Map();
+    return {
+        on(endpointName, handler) {
+            if (httpHandlers.has(endpointName)) {
+                console.error(`[Ingress] Warning: overwriting handler for '${endpointName}'`);
+            }
+            httpHandlers.set(endpointName, handler);
+        },
+        onStream(endpointName, handlers) {
+            if (streamHandlers.has(endpointName)) {
+                console.error(`[Ingress] Warning: overwriting stream handlers for '${endpointName}'`);
+            }
+            streamHandlers.set(endpointName, handlers);
+        },
+        getPublicUrl: async (endpointName) => {
+            const result = (await api.trpc.plugin.getIngressUrl.query({
+                name: endpointName
+            }));
+            return result;
+        },
+        async dispatch(endpointName, request) {
+            const handler = httpHandlers.get(endpointName);
+            if (!handler) {
+                console.error(`[Ingress] No handler registered for endpoint '${endpointName}'`);
+                return { status: 404, body: `No handler for endpoint: ${endpointName}` };
+            }
+            return handler(request);
+        },
+        dispatchStreamEvent(endpointName, event, streamId, data, metadata) {
+            const handlers = streamHandlers.get(endpointName);
+            if (!handlers) {
+                console.error(`[Ingress] No stream handlers for endpoint '${endpointName}'`);
+                return;
+            }
+            switch (event) {
+                case 'connect':
+                    handlers.onConnect(streamId, metadata ?? {});
+                    break;
+                case 'message':
+                    handlers.onMessage(streamId, data ?? '');
+                    break;
+                case 'disconnect':
+                    handlers.onDisconnect(streamId);
+                    break;
+            }
+        },
+        getHttpEndpointNames() {
+            return Array.from(httpHandlers.keys());
+        },
+        getStreamEndpointNames() {
+            return Array.from(streamHandlers.keys());
+        }
+    };
+}
+//# sourceMappingURL=ingress.js.map

package/dist/ingress.js.map

@@ -0,0 +1 @@
+{"version":3,"file":"ingress.js","sourceRoot":"","sources":["../src/ingress.ts"],"names":[],"mappings":"AAAA;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;GA8BG;AAmIH,gFAAgF;AAEhF,MAAM,UAAU,qBAAqB,CAAC,GAAc;IAClD,MAAM,YAAY,GAAG,IAAI,GAAG,EAA0B,CAAA;IACtD,MAAM,cAAc,GAAG,IAAI,GAAG,EAA+B,CAAA;IAE7D,OAAO;QACL,EAAE,CAAC,YAAoB,EAAE,OAAuB;YAC9C,IAAI,YAAY,CAAC,GAAG,CAAC,YAAY,CAAC,EAAE,CAAC;gBACnC,OAAO,CAAC,KAAK,CACX,+CAA+C,YAAY,GAAG,CAC/D,CAAA;YACH,CAAC;YACD,YAAY,CAAC,GAAG,CAAC,YAAY,EAAE,OAAO,CAAC,CAAA;QACzC,CAAC;QAED,QAAQ,CAAC,YAAoB,EAAE,QAA6B;YAC1D,IAAI,cAAc,CAAC,GAAG,CAAC,YAAY,CAAC,EAAE,CAAC;gBACrC,OAAO,CAAC,KAAK,CACX,uDAAuD,YAAY,GAAG,CACvE,CAAA;YACH,CAAC;YACD,cAAc,CAAC,GAAG,CAAC,YAAY,EAAE,QAAQ,CAAC,CAAA;QAC5C,CAAC;QAED,YAAY,EAAE,KAAK,EAAE,YAAoB,EAAuB,EAAE;YAChE,MAAM,MAAM,GAAG,CAAC,MAAM,GAAG,CAAC,IAAI,CAAC,MAAM,CAAC,aAAa,CAAC,KAAK,CAAC;gBACxD,IAAI,EAAE,YAAY;aACnB,CAAC,CAAe,CAAA;YACjB,OAAO,MAAM,CAAA;QACf,CAAC;QAED,KAAK,CAAC,QAAQ,CACZ,YAAoB,EACpB,OAAuB;YAEvB,MAAM,OAAO,GAAG,YAAY,CAAC,GAAG,CAAC,YAAY,CAAC,CAAA;YAC9C,IAAI,CAAC,OAAO,EAAE,CAAC;gBACb,OAAO,CAAC,KAAK,CACX,iDAAiD,YAAY,GAAG,CACjE,CAAA;gBACD,OAAO,EAAE,MAAM,EAAE,GAAG,EAAE,IAAI,EAAE,4BAA4B,YAAY,EAAE,EAAE,CAAA;YAC1E,CAAC;YACD,OAAO,OAAO,CAAC,OAAO,CAAC,CAAA;QACzB,CAAC;QAED,mBAAmB,CACjB,YAAoB,EACpB,KAA2C,EAC3C,QAAgB,EAChB,IAAa,EACb,QAAiC;YAEjC,MAAM,QAAQ,GAAG,cAAc,CAAC,GAAG,CAAC,YAAY,CAAC,CAAA;YACjD,IAAI,CAAC,QAAQ,EAAE,CAAC;gBACd,OAAO,CAAC,KAAK,CACX,8CAA8C,YAAY,GAAG,CAC9D,CAAA;gBACD,OAAM;YACR,CAAC;YACD,QAAQ,KAAK,EAAE,CAAC;gBACd,KAAK,SAAS;oBACZ,QAAQ,CAAC,SAAS,CAAC,QAAQ,EAAE,QAAQ,IAAI,EAAE,CAAC,CAAA;oBAC5C,MAAK;gBACP,KAAK,SAAS;oBACZ,QAAQ,CAAC,SAAS,CAAC,QAAQ,EAAE,IAAI,IAAI,EAAE,CAAC,CAAA;oBACxC,MAAK;gBACP,KAAK,YAAY;oBACf,QAAQ,CAAC,YAAY,CAAC,QAAQ,CAAC,CAAA;oBAC/B,MAAK;YACT,CAAC;QACH,CAAC;QAED,oBAAoB;YAClB,OAAO,KAAK,CAAC,IAAI,CAAC,YAAY,CAAC,IAAI,EAAE,CAAC,CAAA;QACxC,CAAC;QAED,sBAAsB;YACpB,OAAO,KAAK,CAAC,IAAI,CAAC,cAAc,CAAC,IAAI,EAAE,CAAC,CAAA;QAC1C,CAAC;KACF,CAAA;AACH,CAAC"}

package/dist/logging.d.ts

@@ -0,0 +1,31 @@
+/**
+ * Logging Module
+ *
+ * Overrides the global `console` object to capture ALL log output.
+ * This means plugin authors use `console.log()` naturally and we
+ * automatically capture, structure, enrich, and forward logs.
+ *
+ * Each log entry is:
+ *  1. Written to stdout/stderr (so it appears in the sandbox terminal)
+ *  2. Sent to the platform's logging pipeline via tRPC
+ *
+ * The platform receives structured logs with:
+ *  - level (log, error, warn, info, debug)
+ *  - message (the formatted log content)
+ *  - timestamp (ISO 8601)
+ *
+ * Transport: plugin.ingestLogs tRPC mutation (fire-and-forget).
+ *
+ * This approach ensures we never lose logs from developers who use
+ * `console.log` instead of a custom logging function.
+ */
+import type { ApiClient } from './api';
+/**
+ * Override the global console to capture and forward all log output.
+ *
+ * This should be called once during SDK initialization (in connect()).
+ * After this call, all console.log/error/warn/info/debug calls will
+ * be intercepted, enriched with metadata, and sent to the API.
+ */
+export declare function installLogging(api: ApiClient): void;
+//# sourceMappingURL=logging.d.ts.map

package/dist/logging.d.ts.map

@@ -0,0 +1 @@
+{"version":3,"file":"logging.d.ts","sourceRoot":"","sources":["../src/logging.ts"],"names":[],"mappings":"AAAA;;;;;;;;;;;;;;;;;;;;GAoBG;AAEH,OAAO,KAAK,EAAE,SAAS,EAAE,MAAM,OAAO,CAAA;AAYtC;;;;;;GAMG;AACH,wBAAgB,cAAc,CAAC,GAAG,EAAE,SAAS,GAAG,IAAI,CA+CnD"}

package/dist/logging.js

@@ -0,0 +1,77 @@
+/**
+ * Logging Module
+ *
+ * Overrides the global `console` object to capture ALL log output.
+ * This means plugin authors use `console.log()` naturally and we
+ * automatically capture, structure, enrich, and forward logs.
+ *
+ * Each log entry is:
+ *  1. Written to stdout/stderr (so it appears in the sandbox terminal)
+ *  2. Sent to the platform's logging pipeline via tRPC
+ *
+ * The platform receives structured logs with:
+ *  - level (log, error, warn, info, debug)
+ *  - message (the formatted log content)
+ *  - timestamp (ISO 8601)
+ *
+ * Transport: plugin.ingestLogs tRPC mutation (fire-and-forget).
+ *
+ * This approach ensures we never lose logs from developers who use
+ * `console.log` instead of a custom logging function.
+ */
+// ─── Install ─────────────────────────────────────────────────────────────────
+/**
+ * Override the global console to capture and forward all log output.
+ *
+ * This should be called once during SDK initialization (in connect()).
+ * After this call, all console.log/error/warn/info/debug calls will
+ * be intercepted, enriched with metadata, and sent to the API.
+ */
+export function installLogging(api) {
+    // Preserve original console methods
+    const original = {
+        log: console.log.bind(console),
+        error: console.error.bind(console),
+        warn: console.warn.bind(console),
+        info: console.info.bind(console),
+        debug: console.debug.bind(console)
+    };
+    const levels = ['log', 'error', 'warn', 'info', 'debug'];
+    for (const level of levels) {
+        console[level] = (...args) => {
+            // 1. Still output to stdout/stderr for local visibility
+            original[level](...args);
+            // 2. Format the message
+            const message = args
+                .map(arg => {
+                if (typeof arg === 'string')
+                    return arg;
+                if (arg instanceof Error)
+                    return `${arg.name}: ${arg.message}`;
+                try {
+                    return JSON.stringify(arg);
+                }
+                catch {
+                    return String(arg);
+                }
+            })
+                .join(' ');
+            // 3. Send structured log to the platform (fire-and-forget)
+            void api.trpc.plugin.ingestLogs
+                .mutate({
+                entries: [
+                    {
+                        level,
+                        message,
+                        args,
+                        timestamp: new Date().toISOString()
+                    }
+                ]
+            })
+                .catch((err) => {
+                original.error('[Logging] ingest failed:', err);
+            });
+        };
+    }
+}
+//# sourceMappingURL=logging.js.map

package/dist/logging.js.map

@@ -0,0 +1 @@
+{"version":3,"file":"logging.js","sourceRoot":"","sources":["../src/logging.ts"],"names":[],"mappings":"AAAA;;;;;;;;;;;;;;;;;;;;GAoBG;AAYH,gFAAgF;AAEhF;;;;;;GAMG;AACH,MAAM,UAAU,cAAc,CAAC,GAAc;IAC3C,oCAAoC;IACpC,MAAM,QAAQ,GAAoB;QAChC,GAAG,EAAE,OAAO,CAAC,GAAG,CAAC,IAAI,CAAC,OAAO,CAAC;QAC9B,KAAK,EAAE,OAAO,CAAC,KAAK,CAAC,IAAI,CAAC,OAAO,CAAC;QAClC,IAAI,EAAE,OAAO,CAAC,IAAI,CAAC,IAAI,CAAC,OAAO,CAAC;QAChC,IAAI,EAAE,OAAO,CAAC,IAAI,CAAC,IAAI,CAAC,OAAO,CAAC;QAChC,KAAK,EAAE,OAAO,CAAC,KAAK,CAAC,IAAI,CAAC,OAAO,CAAC;KACnC,CAAA;IAED,MAAM,MAAM,GAAe,CAAC,KAAK,EAAE,OAAO,EAAE,MAAM,EAAE,MAAM,EAAE,OAAO,CAAC,CAAA;IAEpE,KAAK,MAAM,KAAK,IAAI,MAAM,EAAE,CAAC;QAC3B,OAAO,CAAC,KAAK,CAAC,GAAG,CAAC,GAAG,IAAe,EAAE,EAAE;YACtC,wDAAwD;YACxD,QAAQ,CAAC,KAAK,CAAC,CAAC,GAAG,IAAI,CAAC,CAAA;YAExB,wBAAwB;YACxB,MAAM,OAAO,GAAG,IAAI;iBACjB,GAAG,CAAC,GAAG,CAAC,EAAE;gBACT,IAAI,OAAO,GAAG,KAAK,QAAQ;oBAAE,OAAO,GAAG,CAAA;gBACvC,IAAI,GAAG,YAAY,KAAK;oBAAE,OAAO,GAAG,GAAG,CAAC,IAAI,KAAK,GAAG,CAAC,OAAO,EAAE,CAAA;gBAC9D,IAAI,CAAC;oBACH,OAAO,IAAI,CAAC,SAAS,CAAC,GAAG,CAAC,CAAA;gBAC5B,CAAC;gBAAC,MAAM,CAAC;oBACP,OAAO,MAAM,CAAC,GAAG,CAAC,CAAA;gBACpB,CAAC;YACH,CAAC,CAAC;iBACD,IAAI,CAAC,GAAG,CAAC,CAAA;YAEZ,2DAA2D;YAC3D,KAAK,GAAG,CAAC,IAAI,CAAC,MAAM,CAAC,UAAU;iBAC5B,MAAM,CAAC;gBACN,OAAO,EAAE;oBACP;wBACE,KAAK;wBACL,OAAO;wBACP,IAAI;wBACJ,SAAS,EAAE,IAAI,IAAI,EAAE,CAAC,WAAW,EAAE;qBACpC;iBACF;aACF,CAAC;iBACD,KAAK,CAAC,CAAC,GAAY,EAAE,EAAE;gBACtB,QAAQ,CAAC,KAAK,CAAC,0BAA0B,EAAE,GAAG,CAAC,CAAA;YACjD,CAAC,CAAC,CAAA;QACN,CAAC,CAAA;IACH,CAAC;AACH,CAAC"}

package/dist/sdk.d.ts

@@ -0,0 +1,116 @@
+/**
+ * Mission SDK — Main Entry
+ *
+ * Creates the SDK instance that a plugin uses to interact with the
+ * Mission platform. Communication is HTTP-native:
+ *
+ *   Outbound (Plugin → Mission API):
+ *     Standard REST calls via the API client.
+ *
+ *   Inbound (Mission API → Plugin):
+ *     HTTP requests to the plugin's HTTP server, exposed via
+ *     Daytona Preview URLs.
+ *
+ * Lifecycle:
+ *   1. const mission = createMissionSDK()     — create SDK (no connection yet)
+ *   2. await mission.connect()                — start HTTP server, install logging
+ *   3. // auth, config, events are now usable
+ *   4. mission.tools.registerAll(handlers)    — register tool handlers
+ *   5. mission.ingress.on('name', handler)    — register ingress handlers
+ *   6. mission.onShutdown(() => cleanup())    — register shutdown hooks
+ *   7. await mission.ready()                  — signal readiness, accept traffic
+ *
+ * See docs/technical-designs/plugin-architecture.md §4 and §6.
+ * See docs/technical-designs/daytona-sandbox-runtime.md.
+ */
+import { type AuthModule } from './auth';
+import { type ConfigModule } from './config';
+import { type PluginContext } from './context';
+import { type EventsModule } from './events';
+import { type IngressModule } from './ingress';
+import { type ToolsModule } from './tool-registry';
+export type MissionSDKOptions = {
+    /**
+     * Override the plugin context instead of reading from env.
+     * Useful for testing or local development.
+     */
+    context?: Partial<PluginContext>;
+    /**
+     * Override the plugin HTTP server port. Normally read from
+     * MISSION_PLUGIN_PORT (assigned by the control plane).
+     * Must be in the Daytona Preview URL range (3000-9999).
+     */
+    port?: number;
+};
+export type MissionSDK = {
+    /** The resolved plugin context. */
+    context: PluginContext;
+    /** Get authentication credentials (user-provided secrets and/or OAuth tokens). */
+    auth: AuthModule;
+    /** Fetch per-installation configuration. */
+    config: ConfigModule;
+    /** Send messages to the agent about external events. */
+    events: EventsModule;
+    /** Register ingress handlers and discover public URLs. */
+    ingress: IngressModule;
+    /** Register tool handlers that the platform can invoke. */
+    tools: ToolsModule;
+    /**
+     * Connect to the Mission platform.
+     *
+     * This starts the plugin's HTTP server (for inbound tool calls and
+     * ingress traffic), installs the console override for structured
+     * logging, and begins the keep-alive heartbeat loop.
+     *
+     * After this call, `auth`, `config`, `events`, and `ingress.getPublicUrl`
+     * are usable.
+     */
+    connect: () => Promise<void>;
+    /**
+     * Signal readiness and start accepting tool calls and ingress traffic.
+     *
+     * Call this AFTER registering all tools and ingress handlers.
+     * The returned promise resolves when the process receives a shutdown
+     * signal (SIGTERM/SIGINT) and graceful shutdown completes.
+     */
+    ready: () => Promise<void>;
+    /**
+     * Register a callback to run during graceful shutdown.
+     * Multiple handlers can be registered; they run in order.
+     *
+     * Shutdown is triggered by SIGTERM or SIGINT (standard container signals).
+     * The SDK stops the HTTP server, drains in-flight requests, runs
+     * shutdown handlers, then exits.
+     *
+     * @example
+     * ```ts
+     * mission.onShutdown(async () => {
+     *   await database.close()
+     *   await cache.flush()
+     * })
+     * ```
+     */
+    onShutdown: (handler: () => Promise<void> | void) => void;
+};
+/**
+ * Create a Mission SDK instance.
+ *
+ * @example
+ * ```ts
+ * import { createMissionSDK } from '@mission/sdk'
+ *
+ * const mission = createMissionSDK()
+ * await mission.connect()
+ *
+ * const auth = await mission.auth.get()
+ * const config = await mission.config.get<MyConfig>(defaults)
+ *
+ * mission.tools.registerAll(handlers)
+ * mission.ingress.on('webhook', handler)
+ * mission.onShutdown(() => cleanup())
+ *
+ * await mission.ready()
+ * ```
+ */
+export declare function createMissionSDK(options?: MissionSDKOptions): MissionSDK;
+//# sourceMappingURL=sdk.d.ts.map

package/dist/sdk.d.ts.map

@@ -0,0 +1 @@
+{"version":3,"file":"sdk.d.ts","sourceRoot":"","sources":["../src/sdk.ts"],"names":[],"mappings":"AAAA;;;;;;;;;;;;;;;;;;;;;;;;GAwBG;AAGH,OAAO,EAAE,KAAK,UAAU,EAAoB,MAAM,QAAQ,CAAA;AAC1D,OAAO,EAAE,KAAK,YAAY,EAAsB,MAAM,UAAU,CAAA;AAChE,OAAO,EAAE,KAAK,aAAa,EAAsB,MAAM,WAAW,CAAA;AAClE,OAAO,EAAsB,KAAK,YAAY,EAAE,MAAM,UAAU,CAAA;AAEhE,OAAO,EAEL,KAAK,aAAa,EAEnB,MAAM,WAAW,CAAA;AAElB,OAAO,EAGL,KAAK,WAAW,EACjB,MAAM,iBAAiB,CAAA;AAIxB,MAAM,MAAM,iBAAiB,GAAG;IAC9B;;;OAGG;IACH,OAAO,CAAC,EAAE,OAAO,CAAC,aAAa,CAAC,CAAA;IAChC;;;;OAIG;IACH,IAAI,CAAC,EAAE,MAAM,CAAA;CACd,CAAA;AAED,MAAM,MAAM,UAAU,GAAG;IACvB,mCAAmC;IACnC,OAAO,EAAE,aAAa,CAAA;IACtB,kFAAkF;IAClF,IAAI,EAAE,UAAU,CAAA;IAChB,4CAA4C;IAC5C,MAAM,EAAE,YAAY,CAAA;IACpB,wDAAwD;IACxD,MAAM,EAAE,YAAY,CAAA;IACpB,0DAA0D;IAC1D,OAAO,EAAE,aAAa,CAAA;IACtB,2DAA2D;IAC3D,KAAK,EAAE,WAAW,CAAA;IAElB;;;;;;;;;OASG;IACH,OAAO,EAAE,MAAM,OAAO,CAAC,IAAI,CAAC,CAAA;IAE5B;;;;;;OAMG;IACH,KAAK,EAAE,MAAM,OAAO,CAAC,IAAI,CAAC,CAAA;IAE1B;;;;;;;;;;;;;;;OAeG;IACH,UAAU,EAAE,CAAC,OAAO,EAAE,MAAM,OAAO,CAAC,IAAI,CAAC,GAAG,IAAI,KAAK,IAAI,CAAA;CAC1D,CAAA;AAaD;;;;;;;;;;;;;;;;;;;GAmBG;AACH,wBAAgB,gBAAgB,CAAC,OAAO,CAAC,EAAE,iBAAiB,GAAG,UAAU,CAqTxE"}