@linker-design-plus/timeline-track 2.0.3 → 2.0.4

package/dist/index.es.js

@@ -1,7 +1,7 @@
-var Pn = Object.defineProperty;
-var xn = (a, t, e) => t in a ? Pn(a, t, { enumerable: !0, configurable: !0, writable: !0, value: e }) : a[t] = e;
-var f = (a, t, e) => xn(a, typeof t != "symbol" ? t + "" : t, e);
-const An = {
+var xn = Object.defineProperty;
+var An = (a, t, e) => t in a ? xn(a, t, { enumerable: !0, configurable: !0, writable: !0, value: e }) : a[t] = e;
+var f = (a, t, e) => An(a, typeof t != "symbol" ? t + "" : t, e);
+const En = {
   isDragging: !1,
   isResizing: !1,
   isResizingLeft: !1,
@@ -52,7 +52,7 @@ const wt = {
   mode: "auto-first-added-video",
   width: 16,
   height: 9
-}, El = [
+}, Il = [
   {
     key: "default",
     label: "默认",
@@ -79,20 +79,20 @@ const wt = {
     aspectRatio: { mode: "manual", width: 4, height: 3 }
   }
 ];
-function Ls(a) {
+function Rs(a) {
   return a === "manual" ? "manual" : "auto-first-added-video";
 }
 function pe(a) {
-  return Ls(a) === "auto-first-added-video";
+  return Rs(a) === "auto-first-added-video";
 }
 function Nt(a) {
   return {
-    mode: Ls(a == null ? void 0 : a.mode),
+    mode: Rs(a == null ? void 0 : a.mode),
     width: typeof (a == null ? void 0 : a.width) == "number" && a.width > 0 ? a.width : wt.width,
     height: typeof (a == null ? void 0 : a.height) == "number" && a.height > 0 ? a.height : wt.height
   };
 }
-const Il = {
+const Ml = {
   DEFAULT: 1,
   // 默认层级
   ACTIVE: 2
@@ -103,12 +103,12 @@ const Il = {
   MEDIUM: 30,
   LARGE: 60,
   MAX: 100
-}, En = {
+}, In = {
   DURATION: 300,
   // 动画持续时间（毫秒）
   EASING: "easeOutCubic"
   // 缓动函数
-}, Ml = {
+}, Ll = {
   DEFAULT_HEIGHT: 40,
   // 默认时间刻度高度
   MIN_HEIGHT: 20,
@@ -119,19 +119,19 @@ const Il = {
   AUDIO: 48
   // 音频轨道高度
 };
-function In(a = {}) {
+function Mn(a = {}) {
   const t = Object.fromEntries(
     Object.entries(a).filter(([, e]) => e !== void 0)
   );
   return {
-    ...An,
+    ...En,
     ...t
   };
 }
-function Ds(a, t = {}) {
+function Os(a, t = {}) {
   return {
     ...a,
-    ...In(t)
+    ...Mn(t)
   };
 }
 class z {
@@ -259,19 +259,19 @@ class z {
  * 刻度类型
  */
 f(z, "TICK_TYPE_MAJOR", "major"), f(z, "TICK_TYPE_MINOR", "minor");
-const Mn = Math.PI / 180;
-function Ln() {
+const Ln = Math.PI / 180;
+function Dn() {
   return typeof window < "u" && ({}.toString.call(window) === "[object Window]" || {}.toString.call(window) === "[object global]");
 }
 const Ft = typeof global < "u" ? global : typeof window < "u" ? window : typeof WorkerGlobalScope < "u" ? self : {}, E = {
   _global: Ft,
   version: "10.2.0",
-  isBrowser: Ln(),
+  isBrowser: Dn(),
   isUnminified: /param/.test((function(a) {
   }).toString()),
   dblClickWindow: 400,
   getAngle(a) {
-    return E.angleDeg ? a * Mn : a;
+    return E.angleDeg ? a * Ln : a;
   },
   enableTrace: !1,
   pointerEventsEnabled: !0,
@@ -313,7 +313,7 @@ const Ft = typeof global < "u" ? global : typeof window < "u" ? window : typeof
   E[a.prototype.getClassName()] = a;
 };
 E._injectGlobal(E);
-const Dn = `Konva.js unsupported environment.
+const Rn = `Konva.js unsupported environment.
 
 Looks like you are trying to use Konva.js in Node.js environment. because "document" object is undefined.
 
@@ -328,7 +328,7 @@ bash: npm install skia-canvas
 js: import "konva/skia-backend";
 `, Oi = () => {
   if (typeof document > "u")
-    throw new Error(Dn);
+    throw new Error(Rn);
 };
 class ct {
   constructor(t = [1, 0, 0, 1, 0, 0]) {
@@ -398,10 +398,10 @@ class ct {
       const h = Math.sqrt(i * i + s * s);
       l.rotation = Math.PI / 2 - (s > 0 ? Math.acos(-i / h) : -Math.acos(i / h)), l.scaleX = o / h, l.scaleY = h, l.skewX = 0, l.skewY = (t * i + e * s) / o;
     }
-    return l.rotation = C._getRotation(l.rotation), l;
+    return l.rotation = S._getRotation(l.rotation), l;
   }
 }
-const Rn = "[object Array]", On = "[object Number]", Gn = "[object String]", Bn = "[object Boolean]", Hn = Math.PI / 180, zn = 180 / Math.PI, ee = "#", Nn = "", Fn = "0", Vn = "Konva warning: ", Gi = "Konva error: ", Wn = "rgb(", qe = {
+const On = "[object Array]", Gn = "[object Number]", Bn = "[object String]", Hn = "[object Boolean]", zn = Math.PI / 180, Nn = 180 / Math.PI, ee = "#", Fn = "", Vn = "0", Wn = "Konva warning: ", Gi = "Konva error: ", Yn = "rgb(", qe = {
   aliceblue: [240, 248, 255],
   antiquewhite: [250, 235, 215],
   aqua: [0, 255, 255],
@@ -551,11 +551,11 @@ const Rn = "[object Array]", On = "[object Number]", Gn = "[object String]", Bn
   whitesmoke: [245, 245, 245],
   yellow: [255, 255, 0],
   yellowgreen: [154, 205, 5]
-}, Yn = /rgb\((\d{1,3}),(\d{1,3}),(\d{1,3})\)/;
+}, Xn = /rgb\((\d{1,3}),(\d{1,3}),(\d{1,3})\)/;
 let Pe = [], ie = null;
-const Xn = typeof requestAnimationFrame < "u" && requestAnimationFrame || function(a) {
+const Un = typeof requestAnimationFrame < "u" && requestAnimationFrame || function(a) {
   setTimeout(a, 16);
-}, C = {
+}, S = {
   _isElement(a) {
     return !!(a && a.nodeType == 1);
   },
@@ -566,16 +566,16 @@ const Xn = typeof requestAnimationFrame < "u" && requestAnimationFrame || functi
     return !!a && a.constructor === Object;
   },
   _isArray(a) {
-    return Object.prototype.toString.call(a) === Rn;
+    return Object.prototype.toString.call(a) === On;
   },
   _isNumber(a) {
-    return Object.prototype.toString.call(a) === On && !isNaN(a) && isFinite(a);
+    return Object.prototype.toString.call(a) === Gn && !isNaN(a) && isFinite(a);
   },
   _isString(a) {
-    return Object.prototype.toString.call(a) === Gn;
+    return Object.prototype.toString.call(a) === Bn;
   },
   _isBoolean(a) {
-    return Object.prototype.toString.call(a) === Bn;
+    return Object.prototype.toString.call(a) === Hn;
   },
   isObject(a) {
     return a instanceof Object;
@@ -590,7 +590,7 @@ const Xn = typeof requestAnimationFrame < "u" && requestAnimationFrame || functi
     return a === 0 || a > 0 ? 1 : -1;
   },
   requestAnimFrame(a) {
-    Pe.push(a), Pe.length === 1 && Xn(function() {
+    Pe.push(a), Pe.length === 1 && Un(function() {
       const t = Pe;
       Pe = [], t.forEach(function(e) {
         e();
@@ -616,7 +616,7 @@ const Xn = typeof requestAnimationFrame < "u" && requestAnimationFrame || functi
     return !1;
   },
   _urlToImage(a, t) {
-    const e = C.createImageElement();
+    const e = S.createImageElement();
     e.onload = function() {
       t(e);
     }, e.src = a;
@@ -625,7 +625,7 @@ const Xn = typeof requestAnimationFrame < "u" && requestAnimationFrame || functi
     return ((1 << 24) + (a << 16) + (t << 8) + e).toString(16).slice(1);
   },
   _hexToRgb(a) {
-    a = a.replace(ee, Nn);
+    a = a.replace(ee, Fn);
     const t = parseInt(a, 16);
     return {
       r: t >> 16 & 255,
@@ -636,7 +636,7 @@ const Xn = typeof requestAnimationFrame < "u" && requestAnimationFrame || functi
   getRandomColor() {
     let a = (Math.random() * 16777215 << 0).toString(16);
     for (; a.length < 6; )
-      a = Fn + a;
+      a = Vn + a;
     return ee + a;
   },
   isCanvasFarblingActive() {
@@ -676,7 +676,7 @@ const Xn = typeof requestAnimationFrame < "u" && requestAnimationFrame || functi
       r: t[0],
       g: t[1],
       b: t[2]
-    }) : a[0] === ee ? this._hexToRgb(a.substring(1)) : a.substr(0, 4) === Wn ? (t = Yn.exec(a.replace(/ /g, "")), {
+    }) : a[0] === ee ? this._hexToRgb(a.substring(1)) : a.substr(0, 4) === Yn ? (t = Xn.exec(a.replace(/ /g, "")), {
       r: parseInt(t[1], 10),
       g: parseInt(t[2], 10),
       b: parseInt(t[3], 10)
@@ -687,7 +687,7 @@ const Xn = typeof requestAnimationFrame < "u" && requestAnimationFrame || functi
     };
   },
   colorToRGBA(a) {
-    return a = a || "black", C._namedColorToRBA(a) || C._hex3ColorToRGBA(a) || C._hex4ColorToRGBA(a) || C._hex6ColorToRGBA(a) || C._hex8ColorToRGBA(a) || C._rgbColorToRGBA(a) || C._rgbaColorToRGBA(a) || C._hslColorToRGBA(a);
+    return a = a || "black", S._namedColorToRBA(a) || S._hex3ColorToRGBA(a) || S._hex4ColorToRGBA(a) || S._hex6ColorToRGBA(a) || S._hex8ColorToRGBA(a) || S._rgbColorToRGBA(a) || S._rgbaColorToRGBA(a) || S._hslColorToRGBA(a);
   },
   _namedColorToRBA(a) {
     const t = qe[a.toLowerCase()];
@@ -794,19 +794,19 @@ const Xn = typeof requestAnimationFrame < "u" && requestAnimationFrame || functi
     return a.slice(0);
   },
   degToRad(a) {
-    return a * Hn;
+    return a * zn;
   },
   radToDeg(a) {
-    return a * zn;
+    return a * Nn;
   },
   _degToRad(a) {
-    return C.warn("Util._degToRad is removed. Please use public Util.degToRad instead."), C.degToRad(a);
+    return S.warn("Util._degToRad is removed. Please use public Util.degToRad instead."), S.degToRad(a);
   },
   _radToDeg(a) {
-    return C.warn("Util._radToDeg is removed. Please use public Util.radToDeg instead."), C.radToDeg(a);
+    return S.warn("Util._radToDeg is removed. Please use public Util.radToDeg instead."), S.radToDeg(a);
   },
   _getRotation(a) {
-    return E.angleDeg ? C.radToDeg(a) : a;
+    return E.angleDeg ? S.radToDeg(a) : a;
   },
   _capitalize(a) {
     return a.charAt(0).toUpperCase() + a.slice(1);
@@ -818,7 +818,7 @@ const Xn = typeof requestAnimationFrame < "u" && requestAnimationFrame || functi
     console.error(Gi + a);
   },
   warn(a) {
-    E.showWarnings && console.warn(Vn + a);
+    E.showWarnings && console.warn(Wn + a);
   },
   each(a, t) {
     for (const e in a)
@@ -839,12 +839,12 @@ const Xn = typeof requestAnimationFrame < "u" && requestAnimationFrame || functi
     return [r, o, l];
   },
   _getProjectionToLine(a, t, e) {
-    const i = C.cloneObject(a);
+    const i = S.cloneObject(a);
     let s = Number.MAX_VALUE;
     return t.forEach(function(n, r) {
       if (!e && r === t.length - 1)
         return;
-      const o = t[(r + 1) % t.length], l = C._getProjectionToSegment(n.x, n.y, o.x, o.y, a.x, a.y), h = l[0], c = l[1], d = l[2];
+      const o = t[(r + 1) % t.length], l = S._getProjectionToSegment(n.x, n.y, o.x, o.y, a.x, a.y), h = l[0], c = l[1], d = l[2];
       d < s && (i.x = h, i.y = c, s = d);
     }), i;
   },
@@ -866,7 +866,7 @@ const Xn = typeof requestAnimationFrame < "u" && requestAnimationFrame || functi
       });
     const n = [];
     return s.forEach(function(r) {
-      const o = C._getProjectionToLine(r, i, e);
+      const o = S._getProjectionToLine(r, i, e);
       n.push(o.x), n.push(o.y);
     }), n;
   },
@@ -875,12 +875,12 @@ const Xn = typeof requestAnimationFrame < "u" && requestAnimationFrame || functi
     a.visitedByCircularReferenceRemoval = !0;
     for (const e in a)
       if (a.hasOwnProperty(e) && a[e] && typeof a[e] == "object") {
-        if (t = Object.getOwnPropertyDescriptor(a, e), a[e].visitedByCircularReferenceRemoval || C._isElement(a[e]))
+        if (t = Object.getOwnPropertyDescriptor(a, e), a[e].visitedByCircularReferenceRemoval || S._isElement(a[e]))
           if (t.configurable)
             delete a[e];
           else
             return null;
-        else if (C._prepareToStringify(a[e]) === null)
+        else if (S._prepareToStringify(a[e]) === null)
           if (t.configurable)
             delete a[e];
           else
@@ -913,26 +913,26 @@ const Xn = typeof requestAnimationFrame < "u" && requestAnimationFrame || functi
       const r = t[(n - 1 + e) % e], o = t[n], l = t[(n + 1) % e], h = { x: o.x - r.x, y: o.y - r.y }, c = { x: l.x - o.x, y: l.y - o.y }, d = Math.hypot(h.x, h.y), u = Math.hypot(c.x, c.y);
       let p;
       typeof s == "number" ? p = s : p = n < s.length ? s[n] : 0, p = i * Math.cos(Math.PI / e) * Math.min(1, p / i * 2);
-      const y = { x: h.x / d, y: h.y / d }, T = { x: c.x / u, y: c.y / u }, S = {
+      const y = { x: h.x / d, y: h.y / d }, T = { x: c.x / u, y: c.y / u }, C = {
         x: o.x - y.x * p,
         y: o.y - y.y * p
       }, v = {
         x: o.x + T.x * p,
         y: o.y + T.y * p
       };
-      n === 0 ? a.moveTo(S.x, S.y) : a.lineTo(S.x, S.y), a.arcTo(o.x, o.y, v.x, v.y, p);
+      n === 0 ? a.moveTo(C.x, C.y) : a.lineTo(C.x, C.y), a.arcTo(o.x, o.y, v.x, v.y, p);
     }
   }
 };
-function Un(a) {
-  const t = [], e = a.length, i = C;
+function $n(a) {
+  const t = [], e = a.length, i = S;
   for (let s = 0; s < e; s++) {
     let n = a[s];
     i._isNumber(n) ? n = Math.round(n * 1e3) / 1e3 : i._isString(n) || (n = n + ""), t.push(n);
   }
   return t;
 }
-const Bi = ",", $n = "(", Kn = ")", jn = "([", Zn = "])", qn = ";", Jn = "()", Qn = "=", Hi = [
+const Bi = ",", Kn = "(", jn = ")", Zn = "([", qn = "])", Jn = ";", Qn = "()", tr = "=", Hi = [
   "arc",
   "arcTo",
   "beginPath",
@@ -965,7 +965,7 @@ const Bi = ",", $n = "(", Kn = ")", jn = "([", Zn = "])", qn = ";", Jn = "()", Q
   "strokeText",
   "transform",
   "translate"
-], tr = [
+], er = [
   "fillStyle",
   "strokeStyle",
   "shadowColor",
@@ -986,13 +986,13 @@ const Bi = ",", $n = "(", Kn = ")", jn = "([", Zn = "])", qn = ";", Jn = "()", Q
   "globalCompositeOperation",
   "imageSmoothingEnabled",
   "filter"
-], er = 100;
+], ir = 100;
 let xe = null;
 function zi() {
   if (xe !== null)
     return xe;
   try {
-    const t = C.createCanvasElement().getContext("2d");
+    const t = S.createCanvasElement().getContext("2d");
     return t ? !!t && "filter" in t : (xe = !1, !1);
   } catch {
     return xe = !1, !1;
@@ -1018,7 +1018,7 @@ class Ke {
   getTrace(t, e) {
     let i = this.traceArr, s = i.length, n = "", r, o, l, h;
     for (r = 0; r < s; r++)
-      o = i[r], l = o.method, l ? (h = o.args, n += l, t ? n += Jn : C._isArray(h[0]) ? n += jn + h.join(Bi) + Zn : (e && (h = h.map((c) => typeof c == "number" ? Math.floor(c) : c)), n += $n + h.join(Bi) + Kn)) : (n += o.property, t || (n += Qn + o.val)), n += qn;
+      o = i[r], l = o.method, l ? (h = o.args, n += l, t ? n += Qn : S._isArray(h[0]) ? n += Zn + h.join(Bi) + qn : (e && (h = h.map((c) => typeof c == "number" ? Math.floor(c) : c)), n += Kn + h.join(Bi) + jn)) : (n += o.property, t || (n += tr + o.val)), n += Jn;
     return n;
   }
   clearTrace() {
@@ -1026,7 +1026,7 @@ class Ke {
   }
   _trace(t) {
     let e = this.traceArr, i;
-    e.push(t), i = e.length, i >= er && e.shift();
+    e.push(t), i = e.length, i >= ir && e.shift();
   }
   reset() {
     const t = this.getCanvas().getPixelRatio();
@@ -1179,7 +1179,7 @@ class Ke {
     const r = function(o) {
       let l = t[o], h;
       t[o] = function() {
-        return n = Un(Array.prototype.slice.call(arguments, 0)), h = l.apply(t, arguments), t._trace({
+        return n = $n(Array.prototype.slice.call(arguments, 0)), h = l.apply(t, arguments), t._trace({
           method: o,
           args: n
         }), h;
@@ -1202,7 +1202,7 @@ class Ke {
     !e || e === "source-over" || this.setAttr("globalCompositeOperation", e);
   }
 }
-tr.forEach(function(a) {
+er.forEach(function(a) {
   Object.defineProperty(Ke.prototype, a, {
     get() {
       return this._context[a];
@@ -1212,7 +1212,7 @@ tr.forEach(function(a) {
     }
   });
 });
-class ir extends Ke {
+class sr extends Ke {
   constructor(t, { willReadFrequently: e = !1 } = {}) {
     super(t), this._context = t._canvas.getContext("2d", {
       willReadFrequently: e
@@ -1284,7 +1284,7 @@ class ir extends Ke {
     this.setAttr("shadowColor", n), this.setAttr("shadowBlur", r * Math.min(Math.abs(c), Math.abs(d))), this.setAttr("shadowOffsetX", o.x * c), this.setAttr("shadowOffsetY", o.y * d);
   }
 }
-class sr extends Ke {
+class nr extends Ke {
   constructor(t) {
     super(t), this._context = t._canvas.getContext("2d", {
       willReadFrequently: !0
@@ -1311,20 +1311,20 @@ class sr extends Ke {
   }
 }
 let Ae;
-function nr() {
+function rr() {
   if (Ae)
     return Ae;
-  const a = C.createCanvasElement(), t = a.getContext("2d");
+  const a = S.createCanvasElement(), t = a.getContext("2d");
   return Ae = function() {
     const e = E._global.devicePixelRatio || 1, i = t.webkitBackingStorePixelRatio || t.mozBackingStorePixelRatio || t.msBackingStorePixelRatio || t.oBackingStorePixelRatio || t.backingStorePixelRatio || 1;
     return e / i;
-  }(), C.releaseCanvas(a), Ae;
+  }(), S.releaseCanvas(a), Ae;
 }
 class xi {
   constructor(t) {
     this.pixelRatio = 1, this.width = 0, this.height = 0, this.isCache = !1;
-    const i = (t || {}).pixelRatio || E.pixelRatio || nr();
-    this.pixelRatio = i, this._canvas = C.createCanvasElement(), this._canvas.style.padding = "0", this._canvas.style.margin = "0", this._canvas.style.border = "0", this._canvas.style.background = "transparent", this._canvas.style.position = "absolute", this._canvas.style.top = "0", this._canvas.style.left = "0";
+    const i = (t || {}).pixelRatio || E.pixelRatio || rr();
+    this.pixelRatio = i, this._canvas = S.createCanvasElement(), this._canvas.style.padding = "0", this._canvas.style.margin = "0", this._canvas.style.border = "0", this._canvas.style.background = "transparent", this._canvas.style.position = "absolute", this._canvas.style.top = "0", this._canvas.style.left = "0";
   }
   getContext() {
     return this.context;
@@ -1362,21 +1362,21 @@ class xi {
       try {
         return this._canvas.toDataURL();
       } catch (s) {
-        return C.error("Unable to get data URL. " + s.message + " For more info read https://konvajs.org/docs/posts/Tainted_Canvas.html."), "";
+        return S.error("Unable to get data URL. " + s.message + " For more info read https://konvajs.org/docs/posts/Tainted_Canvas.html."), "";
       }
     }
   }
 }
 class Lt extends xi {
   constructor(t = { width: 0, height: 0, willReadFrequently: !1 }) {
-    super(t), this.context = new ir(this, {
+    super(t), this.context = new sr(this, {
       willReadFrequently: t.willReadFrequently
     }), this.setSize(t.width, t.height);
   }
 }
 class Ai extends xi {
   constructor(t = { width: 0, height: 0 }) {
-    super(t), this.hitCanvas = !0, this.context = new sr(this), this.setSize(t.width, t.height);
+    super(t), this.hitCanvas = !0, this.context = new nr(this), this.setSize(t.width, t.height);
   }
 }
 const $ = {
@@ -1398,7 +1398,7 @@ const $ = {
     const t = [];
     $._dragElements.forEach((e, i) => {
       const { node: s } = e, n = s.getStage();
-      n.setPointersPositions(a), e.pointerId === void 0 && (e.pointerId = C._getFirstPointerId(a));
+      n.setPointersPositions(a), e.pointerId === void 0 && (e.pointerId = S._getFirstPointerId(a));
       const r = n._changedPointerPositions.find((o) => o.id === e.pointerId);
       if (r) {
         if (e.dragStatus !== "dragging") {
@@ -1441,62 +1441,62 @@ const $ = {
 };
 E.isBrowser && (window.addEventListener("mouseup", $._endDragBefore, !0), window.addEventListener("touchend", $._endDragBefore, !0), window.addEventListener("touchcancel", $._endDragBefore, !0), window.addEventListener("mousemove", $._drag), window.addEventListener("touchmove", $._drag), window.addEventListener("mouseup", $._endDragAfter, !1), window.addEventListener("touchend", $._endDragAfter, !1), window.addEventListener("touchcancel", $._endDragAfter, !1));
 function Rt(a) {
-  return C._isString(a) ? '"' + a + '"' : Object.prototype.toString.call(a) === "[object Number]" || C._isBoolean(a) ? a : Object.prototype.toString.call(a);
+  return S._isString(a) ? '"' + a + '"' : Object.prototype.toString.call(a) === "[object Number]" || S._isBoolean(a) ? a : Object.prototype.toString.call(a);
 }
-function Rs(a) {
+function Gs(a) {
   return a > 255 ? 255 : a < 0 ? 0 : Math.round(a);
 }
 function x() {
   if (E.isUnminified)
     return function(a, t) {
-      return C._isNumber(a) || C.warn(Rt(a) + ' is a not valid value for "' + t + '" attribute. The value should be a number.'), a;
+      return S._isNumber(a) || S.warn(Rt(a) + ' is a not valid value for "' + t + '" attribute. The value should be a number.'), a;
     };
 }
 function je(a) {
   if (E.isUnminified)
     return function(t, e) {
-      let i = C._isNumber(t), s = C._isArray(t) && t.length == a;
-      return !i && !s && C.warn(Rt(t) + ' is a not valid value for "' + e + '" attribute. The value should be a number or Array<number>(' + a + ")"), t;
+      let i = S._isNumber(t), s = S._isArray(t) && t.length == a;
+      return !i && !s && S.warn(Rt(t) + ' is a not valid value for "' + e + '" attribute. The value should be a number or Array<number>(' + a + ")"), t;
     };
 }
 function Ei() {
   if (E.isUnminified)
     return function(a, t) {
-      return C._isNumber(a) || a === "auto" || C.warn(Rt(a) + ' is a not valid value for "' + t + '" attribute. The value should be a number or "auto".'), a;
+      return S._isNumber(a) || a === "auto" || S.warn(Rt(a) + ' is a not valid value for "' + t + '" attribute. The value should be a number or "auto".'), a;
     };
 }
 function Wt() {
   if (E.isUnminified)
     return function(a, t) {
-      return C._isString(a) || C.warn(Rt(a) + ' is a not valid value for "' + t + '" attribute. The value should be a string.'), a;
+      return S._isString(a) || S.warn(Rt(a) + ' is a not valid value for "' + t + '" attribute. The value should be a string.'), a;
     };
 }
-function Os() {
+function Bs() {
   if (E.isUnminified)
     return function(a, t) {
-      const e = C._isString(a), i = Object.prototype.toString.call(a) === "[object CanvasGradient]" || a && a.addColorStop;
-      return e || i || C.warn(Rt(a) + ' is a not valid value for "' + t + '" attribute. The value should be a string or a native gradient.'), a;
+      const e = S._isString(a), i = Object.prototype.toString.call(a) === "[object CanvasGradient]" || a && a.addColorStop;
+      return e || i || S.warn(Rt(a) + ' is a not valid value for "' + t + '" attribute. The value should be a string or a native gradient.'), a;
     };
 }
-function rr() {
+function ar() {
   if (E.isUnminified)
     return function(a, t) {
       const e = Int8Array ? Object.getPrototypeOf(Int8Array) : null;
-      return e && a instanceof e || (C._isArray(a) ? a.forEach(function(i) {
-        C._isNumber(i) || C.warn('"' + t + '" attribute has non numeric element ' + i + ". Make sure that all elements are numbers.");
-      }) : C.warn(Rt(a) + ' is a not valid value for "' + t + '" attribute. The value should be a array of numbers.')), a;
+      return e && a instanceof e || (S._isArray(a) ? a.forEach(function(i) {
+        S._isNumber(i) || S.warn('"' + t + '" attribute has non numeric element ' + i + ". Make sure that all elements are numbers.");
+      }) : S.warn(Rt(a) + ' is a not valid value for "' + t + '" attribute. The value should be a array of numbers.')), a;
     };
 }
 function pt() {
   if (E.isUnminified)
     return function(a, t) {
-      return a === !0 || a === !1 || C.warn(Rt(a) + ' is a not valid value for "' + t + '" attribute. The value should be a boolean.'), a;
+      return a === !0 || a === !1 || S.warn(Rt(a) + ' is a not valid value for "' + t + '" attribute. The value should be a boolean.'), a;
     };
 }
-function ar(a) {
+function or(a) {
   if (E.isUnminified)
     return function(t, e) {
-      return t == null || C.isObject(t) || C.warn(Rt(t) + ' is a not valid value for "' + e + '" attribute. The value should be an object with properties ' + a), t;
+      return t == null || S.isObject(t) || S.warn(Rt(t) + ' is a not valid value for "' + e + '" attribute. The value should be an object with properties ' + a), t;
     };
 }
 const se = "get", ne = "set", m = {
@@ -1504,24 +1504,24 @@ const se = "get", ne = "set", m = {
     m.addGetter(a, t, e), m.addSetter(a, t, i, s), m.addOverloadedGetterSetter(a, t);
   },
   addGetter(a, t, e) {
-    const i = se + C._capitalize(t);
+    const i = se + S._capitalize(t);
     a.prototype[i] = a.prototype[i] || function() {
       const s = this.attrs[t];
       return s === void 0 ? e : s;
     };
   },
   addSetter(a, t, e, i) {
-    const s = ne + C._capitalize(t);
+    const s = ne + S._capitalize(t);
     a.prototype[s] || m.overWriteSetter(a, t, e, i);
   },
   overWriteSetter(a, t, e, i) {
-    const s = ne + C._capitalize(t);
+    const s = ne + S._capitalize(t);
     a.prototype[s] = function(n) {
       return e && n !== void 0 && n !== null && (n = e.call(this, n, t)), this._setAttr(t, n), i && i.call(this), this;
     };
   },
   addComponentsGetterSetter(a, t, e, i, s) {
-    const n = e.length, r = C._capitalize, o = se + r(t), l = ne + r(t);
+    const n = e.length, r = S._capitalize, o = se + r(t), l = ne + r(t);
     a.prototype[o] = function() {
       const c = {};
       for (let d = 0; d < n; d++) {
@@ -1530,7 +1530,7 @@ const se = "get", ne = "set", m = {
       }
       return c;
     };
-    const h = ar(e);
+    const h = or(e);
     a.prototype[l] = function(c) {
       const d = this.attrs[t];
       i && (c = i.call(this, c, t)), h && h.call(this, c, t);
@@ -1542,27 +1542,27 @@ const se = "get", ne = "set", m = {
     }, m.addOverloadedGetterSetter(a, t);
   },
   addOverloadedGetterSetter(a, t) {
-    const e = C._capitalize(t), i = ne + e, s = se + e;
+    const e = S._capitalize(t), i = ne + e, s = se + e;
     a.prototype[t] = function() {
       return arguments.length ? (this[i](arguments[0]), this) : this[s]();
     };
   },
   addDeprecatedGetterSetter(a, t, e, i) {
-    C.error("Adding deprecated " + t);
-    const s = se + C._capitalize(t), n = t + " property is deprecated and will be removed soon. Look at Konva change log for more information.";
+    S.error("Adding deprecated " + t);
+    const s = se + S._capitalize(t), n = t + " property is deprecated and will be removed soon. Look at Konva change log for more information.";
     a.prototype[s] = function() {
-      C.error(n);
+      S.error(n);
       const r = this.attrs[t];
       return r === void 0 ? e : r;
     }, m.addSetter(a, t, i, function() {
-      C.error(n);
+      S.error(n);
     }), m.addOverloadedGetterSetter(a, t);
   },
   backCompat(a, t) {
-    C.each(t, function(e, i) {
-      const s = a.prototype[i], n = se + C._capitalize(e), r = ne + C._capitalize(e);
+    S.each(t, function(e, i) {
+      const s = a.prototype[i], n = se + S._capitalize(e), r = ne + S._capitalize(e);
       function o() {
-        s.apply(this, arguments), C.error('"' + e + '" method is deprecated and will be removed soon. Use ""' + i + '" instead.');
+        s.apply(this, arguments), S.error('"' + e + '" method is deprecated and will be removed soon. Use ""' + i + '" instead.');
       }
       a.prototype[e] = o, a.prototype[n] = o, a.prototype[r] = o;
     });
@@ -1571,7 +1571,7 @@ const se = "get", ne = "set", m = {
     this._filterUpToDate = !1;
   }
 };
-function or(a) {
+function lr(a) {
   const t = /(\w+)\(([^)]+)\)/g;
   let e;
   for (; (e = t.exec(a)) !== null; ) {
@@ -1618,14 +1618,14 @@ function or(a) {
           r && r.Invert && r.Invert.call(this, n);
         };
       default:
-        C.warn(`CSS filter "${i}" is not supported in fallback mode. Consider using function filters for better compatibility.`);
+        S.warn(`CSS filter "${i}" is not supported in fallback mode. Consider using function filters for better compatibility.`);
         break;
     }
   }
   return () => {
   };
 }
-const Fe = "absoluteOpacity", Ni = "allEventListeners", kt = "absoluteTransform", Fi = "absoluteScale", Ht = "canvas", lr = "Change", hr = "children", cr = "konva", ui = "listening", dr = "mouseenter", ur = "mouseleave", fr = "pointerenter", gr = "pointerleave", pr = "touchenter", mr = "touchleave", Vi = "set", Wi = "Shape", Ve = " ", Yi = "stage", It = "transform", yr = "Stage", fi = "visible", Cr = [
+const Fe = "absoluteOpacity", Ni = "allEventListeners", kt = "absoluteTransform", Fi = "absoluteScale", Ht = "canvas", hr = "Change", cr = "children", dr = "konva", ui = "listening", ur = "mouseenter", fr = "mouseleave", gr = "pointerenter", pr = "pointerleave", mr = "touchenter", yr = "touchleave", Vi = "set", Wi = "Shape", Ve = " ", Yi = "stage", It = "transform", Sr = "Stage", fi = "visible", Cr = [
   "xChange.konva",
   "yChange.konva",
   "scaleXChange.konva",
@@ -1637,10 +1637,10 @@ const Fe = "absoluteOpacity", Ni = "allEventListeners", kt = "absoluteTransform"
   "offsetYChange.konva",
   "transformsEnabledChange.konva"
 ].join(Ve);
-let Sr = 1;
+let Tr = 1;
 class P {
   constructor(t) {
-    this._id = Sr++, this.eventListeners = {}, this.attrs = {}, this.index = 0, this._allEventListeners = null, this.parent = null, this._cache = /* @__PURE__ */ new Map(), this._attachedDepsListeners = /* @__PURE__ */ new Map(), this._lastPos = null, this._batchingTransformChange = !1, this._needClearTransformCache = !1, this._filterUpToDate = !1, this._isUnderCache = !1, this._dragEventId = null, this._shouldFireChangeEvents = !1, this.setAttrs(t), this._shouldFireChangeEvents = !0;
+    this._id = Tr++, this.eventListeners = {}, this.attrs = {}, this.index = 0, this._allEventListeners = null, this.parent = null, this._cache = /* @__PURE__ */ new Map(), this._attachedDepsListeners = /* @__PURE__ */ new Map(), this._lastPos = null, this._batchingTransformChange = !1, this._needClearTransformCache = !1, this._filterUpToDate = !1, this._isUnderCache = !1, this._dragEventId = null, this._shouldFireChangeEvents = !1, this.setAttrs(t), this._shouldFireChangeEvents = !0;
   }
   hasChildren() {
     return !1;
@@ -1670,7 +1670,7 @@ class P {
   clearCache() {
     if (this._cache.has(Ht)) {
       const { scene: t, filter: e, hit: i } = this._cache.get(Ht);
-      C.releaseCanvas(t._canvas, e._canvas, i._canvas), this._cache.delete(Ht);
+      S.releaseCanvas(t._canvas, e._canvas, i._canvas), this._cache.delete(Ht);
     }
     return this._clearSelfAndDescendantCache(), this._requestDraw(), this;
   }
@@ -1683,7 +1683,7 @@ class P {
     }));
     let s = Math.ceil(e.width || i.width), n = Math.ceil(e.height || i.height), r = e.pixelRatio, o = e.x === void 0 ? Math.floor(i.x) : e.x, l = e.y === void 0 ? Math.floor(i.y) : e.y, h = e.offset || 0, c = e.drawBorder || !1, d = e.hitCanvasPixelRatio || 1;
     if (!s || !n) {
-      C.error("Can not cache the node. Width or height of the node equals 0. Caching is skipped.");
+      S.error("Can not cache the node. Width or height of the node equals 0. Caching is skipped.");
       return;
     }
     const u = Math.abs(Math.round(i.x) - o) > 0.5 ? 1 : 0, p = Math.abs(Math.round(i.y) - l) > 0.5 ? 1 : 0;
@@ -1701,12 +1701,12 @@ class P {
       pixelRatio: d,
       width: s,
       height: n
-    }), S = g.getContext(), v = T.getContext(), b = new Lt({
+    }), C = g.getContext(), v = T.getContext(), b = new Lt({
       width: g.width / g.pixelRatio + Math.abs(o),
       height: g.height / g.pixelRatio + Math.abs(l),
       pixelRatio: g.pixelRatio
     }), k = b.getContext();
-    return T.isCache = !0, g.isCache = !0, this._cache.delete(Ht), this._filterUpToDate = !1, e.imageSmoothingEnabled === !1 && (g.getContext()._context.imageSmoothingEnabled = !1, y.getContext()._context.imageSmoothingEnabled = !1), S.save(), v.save(), k.save(), S.translate(-o, -l), v.translate(-o, -l), k.translate(-o, -l), b.x = o, b.y = l, this._isUnderCache = !0, this._clearSelfAndDescendantCache(Fe), this._clearSelfAndDescendantCache(Fi), this.drawScene(g, this, b), this.drawHit(T, this), this._isUnderCache = !1, S.restore(), v.restore(), c && (S.save(), S.beginPath(), S.rect(0, 0, s, n), S.closePath(), S.setAttr("strokeStyle", "red"), S.setAttr("lineWidth", 5), S.stroke(), S.restore()), C.releaseCanvas(b._canvas), this._cache.set(Ht, {
+    return T.isCache = !0, g.isCache = !0, this._cache.delete(Ht), this._filterUpToDate = !1, e.imageSmoothingEnabled === !1 && (g.getContext()._context.imageSmoothingEnabled = !1, y.getContext()._context.imageSmoothingEnabled = !1), C.save(), v.save(), k.save(), C.translate(-o, -l), v.translate(-o, -l), k.translate(-o, -l), b.x = o, b.y = l, this._isUnderCache = !0, this._clearSelfAndDescendantCache(Fe), this._clearSelfAndDescendantCache(Fi), this.drawScene(g, this, b), this.drawHit(T, this), this._isUnderCache = !1, C.restore(), v.restore(), c && (C.save(), C.beginPath(), C.rect(0, 0, s, n), C.closePath(), C.setAttr("strokeStyle", "red"), C.setAttr("lineWidth", 5), C.stroke(), C.restore()), S.releaseCanvas(b._canvas), this._cache.set(Ht, {
       scene: g,
       filter: y,
       hit: T,
@@ -1769,9 +1769,9 @@ class P {
     }
     try {
       for (r = t.length, n.clear(), n.drawImage(i._canvas, 0, 0, i.getWidth() / d, i.getHeight() / d), o = n.getImageData(0, 0, s.getWidth(), s.getHeight()), l = 0; l < r; l++)
-        h = t[l], typeof h == "string" && (h = or(h)), h.call(this, o), n.putImageData(o, 0, 0);
+        h = t[l], typeof h == "string" && (h = lr(h)), h.call(this, o), n.putImageData(o, 0, 0);
     } catch (u) {
-      C.error("Unable to apply filter. " + u.message + " This post my help you https://konvajs.org/docs/posts/Tainted_Canvas.html.");
+      S.error("Unable to apply filter. " + u.message + " This post my help you https://konvajs.org/docs/posts/Tainted_Canvas.html.");
     }
     return this._filterUpToDate = !0, s;
   }
@@ -1819,7 +1819,7 @@ class P {
     this.on(t, function(n) {
       const r = n.target.findAncestors(e, !0, s);
       for (let o = 0; o < r.length; o++)
-        n = C.cloneObject(n), n.currentTarget = r[o], i.call(r[o], n);
+        n = S.cloneObject(n), n.currentTarget = r[o], i.call(r[o], n);
     });
   }
   remove() {
@@ -1837,8 +1837,8 @@ class P {
     return this.remove(), this.clearCache(), this;
   }
   getAttr(t) {
-    const e = "get" + C._capitalize(t);
-    return C._isFunction(this[e]) ? this[e]() : this.attrs[t];
+    const e = "get" + S._capitalize(t);
+    return S._isFunction(this[e]) ? this[e]() : this.attrs[t];
   }
   getAncestors() {
     let t = this.getParent(), e = [];
@@ -1855,7 +1855,7 @@ class P {
       if (!t)
         return this;
       for (e in t)
-        e !== hr && (i = Vi + C._capitalize(e), C._isFunction(this[i]) ? this[i](t[e]) : this._setAttr(e, t[e]));
+        e !== cr && (i = Vi + S._capitalize(e), S._isFunction(this[i]) ? this[i](t[e]) : this._setAttr(e, t[e]));
     }), this;
   }
   isListening() {
@@ -1904,7 +1904,7 @@ class P {
       s.length > 0 && s[0].getDepth() <= t && l(s);
     }
     const h = this.getStage();
-    return e.nodeType !== yr && h && l(h.getChildren()), i;
+    return e.nodeType !== Sr && h && l(h.getChildren()), i;
   }
   getDepth() {
     let t = 0, e = this.parent;
@@ -1995,32 +1995,32 @@ class P {
   }
   moveToTop() {
     if (!this.parent)
-      return C.warn("Node has no parent. moveToTop function is ignored."), !1;
+      return S.warn("Node has no parent. moveToTop function is ignored."), !1;
     const t = this.index, e = this.parent.getChildren().length;
     return t < e - 1 ? (this.parent.children.splice(t, 1), this.parent.children.push(this), this.parent._setChildrenIndices(), !0) : !1;
   }
   moveUp() {
     if (!this.parent)
-      return C.warn("Node has no parent. moveUp function is ignored."), !1;
+      return S.warn("Node has no parent. moveUp function is ignored."), !1;
     const t = this.index, e = this.parent.getChildren().length;
     return t < e - 1 ? (this.parent.children.splice(t, 1), this.parent.children.splice(t + 1, 0, this), this.parent._setChildrenIndices(), !0) : !1;
   }
   moveDown() {
     if (!this.parent)
-      return C.warn("Node has no parent. moveDown function is ignored."), !1;
+      return S.warn("Node has no parent. moveDown function is ignored."), !1;
     const t = this.index;
     return t > 0 ? (this.parent.children.splice(t, 1), this.parent.children.splice(t - 1, 0, this), this.parent._setChildrenIndices(), !0) : !1;
   }
   moveToBottom() {
     if (!this.parent)
-      return C.warn("Node has no parent. moveToBottom function is ignored."), !1;
+      return S.warn("Node has no parent. moveToBottom function is ignored."), !1;
     const t = this.index;
     return t > 0 ? (this.parent.children.splice(t, 1), this.parent.children.unshift(this), this.parent._setChildrenIndices(), !0) : !1;
   }
   setZIndex(t) {
     if (!this.parent)
-      return C.warn("Node has no parent. zIndex parameter is ignored."), this;
-    (t < 0 || t >= this.parent.children.length) && C.warn("Unexpected value " + t + " for zIndex property. zIndex is just index of a node in children of its parent. Expected value is from 0 to " + (this.parent.children.length - 1) + ".");
+      return S.warn("Node has no parent. zIndex parameter is ignored."), this;
+    (t < 0 || t >= this.parent.children.length) && S.warn("Unexpected value " + t + " for zIndex property. zIndex is just index of a node in children of its parent. Expected value is from 0 to " + (this.parent.children.length - 1) + ".");
     const e = this.index;
     return this.parent.children.splice(e, 1), this.parent.children.splice(t, 0, this), this.parent._setChildrenIndices(), this;
   }
@@ -2042,8 +2042,8 @@ class P {
       className: this.getClassName()
     };
     for (e in t)
-      i = t[e], r = C.isObject(i) && !C._isPlainObject(i) && !C._isArray(i), !r && (s = typeof this[e] == "function" && this[e], delete t[e], n = s ? s.call(this) : null, t[e] = i, n !== i && (o.attrs[e] = i));
-    return C._prepareToStringify(o);
+      i = t[e], r = S.isObject(i) && !S._isPlainObject(i) && !S._isArray(i), !r && (s = typeof this[e] == "function" && this[e], delete t[e], n = s ? s.call(this) : null, t[e] = i, n !== i && (o.attrs[e] = i));
+    return S._prepareToStringify(o);
   }
   toJSON() {
     return JSON.stringify(this.toObject());
@@ -2075,7 +2075,7 @@ class P {
       return t(this);
     let e = t.replace(/ /g, "").split(","), i = e.length, s, n;
     for (s = 0; s < i; s++)
-      if (n = e[s], C.isValidSelector(n) || (C.warn('Selector "' + n + '" is invalid. Allowed selectors examples are "#foo", ".bar" or "Group".'), C.warn('If you have a custom shape with such className, please change it to start with upper letter like "Triangle".'), C.warn("Konva is awesome, right?")), n.charAt(0) === "#") {
+      if (n = e[s], S.isValidSelector(n) || (S.warn('Selector "' + n + '" is invalid. Allowed selectors examples are "#foo", ".bar" or "Group".'), S.warn('If you have a custom shape with such className, please change it to start with upper letter like "Triangle".'), S.warn("Konva is awesome, right?")), n.charAt(0) === "#") {
         if (this.id() === n.slice(1))
           return !0;
       } else if (n.charAt(0) === ".") {
@@ -2145,13 +2145,13 @@ class P {
     return (s !== 0 || n !== 0) && i.translate(s, n), r !== 0 && i.rotate(r), (h !== 0 || c !== 0) && i.skew(h, c), (o !== 1 || l !== 1) && i.scale(o, l), (d !== 0 || u !== 0) && i.translate(-1 * d, -1 * u), i.dirty = !1, i;
   }
   clone(t) {
-    let e = C.cloneObject(this.attrs), i, s, n, r, o;
+    let e = S.cloneObject(this.attrs), i, s, n, r, o;
     for (i in t)
       e[i] = t[i];
     const l = new this.constructor(e);
     for (i in this.eventListeners)
       for (s = this.eventListeners[i], n = s.length, r = 0; r < n; r++)
-        o = s[r], o.name.indexOf(cr) < 0 && (l.eventListeners[i] || (l.eventListeners[i] = []), l.eventListeners[i].push(o));
+        o = s[r], o.name.indexOf(dr) < 0 && (l.eventListeners[i] || (l.eventListeners[i] = []), l.eventListeners[i].push(o));
     return l;
   }
   _toKonvaCanvas(t) {
@@ -2179,7 +2179,7 @@ class P {
     return new Promise((e, i) => {
       try {
         const s = t == null ? void 0 : t.callback;
-        s && delete t.callback, C._urlToImage(this.toDataURL(t), function(n) {
+        s && delete t.callback, S._urlToImage(this.toDataURL(t), function(n) {
           e(n), s == null || s(n);
         });
       } catch (s) {
@@ -2229,7 +2229,7 @@ class P {
       }
   }
   _fireChangeEvent(t, e, i) {
-    this._fire(t + lr, {
+    this._fire(t + hr, {
       oldVal: e,
       newVal: i
     });
@@ -2252,8 +2252,8 @@ class P {
     return i !== -1 && (e.splice(i, 1), this.name(e.join(" "))), this;
   }
   setAttr(t, e) {
-    const i = this[Vi + C._capitalize(t)];
-    return C._isFunction(i) ? i.call(this, e) : this._setAttr(t, e), this;
+    const i = this[Vi + S._capitalize(t)];
+    return S._isFunction(i) ? i.call(this, e) : this._setAttr(t, e), this;
   }
   _requestDraw() {
     if (E.autoDrawEnabled) {
@@ -2263,7 +2263,7 @@ class P {
   }
   _setAttr(t, e) {
     const i = this.attrs[t];
-    i === e && !C.isObject(e) || (e == null ? delete this.attrs[t] : this.attrs[t] = e, this._shouldFireChangeEvents && this._fireChangeEvent(t, i, e), this._requestDraw());
+    i === e && !S.isObject(e) || (e == null ? delete this.attrs[t] : this.attrs[t] = e, this._shouldFireChangeEvents && this._fireChangeEvent(t, i, e), this._requestDraw());
   }
   _setComponentAttr(t, e, i) {
     let s;
@@ -2272,12 +2272,12 @@ class P {
   _fireAndBubble(t, e, i) {
     e && this.nodeType === Wi && (e.target = this);
     const s = [
-      dr,
       ur,
       fr,
       gr,
       pr,
-      mr
+      mr,
+      yr
     ];
     if (!(s.indexOf(t) !== -1 && (i && (this === i || this.isAncestorOf && this.isAncestorOf(i)) || this.nodeType === "Stage" && !i))) {
       this._fire(t, e);
@@ -2350,7 +2350,7 @@ class P {
     const n = this.dragBoundFunc();
     if (n !== void 0) {
       const r = n.call(this, s, t);
-      r ? s = r : C.warn("dragBoundFunc did not return any value. That is unexpected behavior. You must return new absolute position from dragBoundFunc.");
+      r ? s = r : S.warn("dragBoundFunc did not return any value. That is unexpected behavior. You must return new absolute position from dragBoundFunc.");
     }
     (!this._lastPos || this._lastPos.x !== s.x || this._lastPos.y !== s.y) && (this.setAbsolutePosition(s), this._requestDraw()), this._lastPos = s;
   }
@@ -2398,14 +2398,14 @@ class P {
       width: e.width() + 2 * t.x,
       height: e.height() + 2 * t.y
     };
-    return C.haveIntersection(i, this.getClientRect());
+    return S.haveIntersection(i, this.getClientRect());
   }
   static create(t, e) {
-    return C._isString(t) && (t = JSON.parse(t)), this._createNode(t, e);
+    return S._isString(t) && (t = JSON.parse(t)), this._createNode(t, e);
   }
   static _createNode(t, e) {
     let i = P.prototype.getClassName.call(t), s = t.children, n, r, o;
-    e && (t.attrs.container = e), E[i] || (C.warn('Can not find a node with class name "' + i + '". Fallback to "Shape".'), i = "Shape");
+    e && (t.attrs.container = e), E[i] || (S.warn('Can not find a node with class name "' + i + '". Fallback to "Shape".'), i = "Shape");
     const l = E[i];
     if (n = new l(t.attrs), s)
       for (r = s.length, o = 0; o < r; o++)
@@ -2608,8 +2608,8 @@ class dt extends P {
       if (h)
         y = h.call(this, r, this);
       else {
-        const T = this.clipX(), S = this.clipY();
-        r.rect(T || 0, S || 0, o, l);
+        const T = this.clipX(), C = this.clipY();
+        r.rect(T || 0, C || 0, o, l);
       }
       r.clip.apply(r, y), g = p.copy().invert().getMatrix(), r.transform(g[0], g[1], g[2], g[3], g[4], g[5]);
     }
@@ -2669,7 +2669,7 @@ m.addGetterSetter(dt, "clipY", void 0, x());
 m.addGetterSetter(dt, "clipWidth", void 0, x());
 m.addGetterSetter(dt, "clipHeight", void 0, x());
 m.addGetterSetter(dt, "clipFunc");
-const be = /* @__PURE__ */ new Map(), Gs = E._global.PointerEvent !== void 0;
+const be = /* @__PURE__ */ new Map(), Hs = E._global.PointerEvent !== void 0;
 function Je(a) {
   return be.get(a);
 }
@@ -2679,30 +2679,30 @@ function Ii(a) {
     pointerId: a.pointerId
   };
 }
-function Bs(a, t) {
+function zs(a, t) {
   return be.get(a) === t;
 }
-function Hs(a, t) {
-  me(a), t.getStage() && (be.set(a, t), Gs && t._fire("gotpointercapture", Ii(new PointerEvent("gotpointercapture"))));
+function Ns(a, t) {
+  me(a), t.getStage() && (be.set(a, t), Hs && t._fire("gotpointercapture", Ii(new PointerEvent("gotpointercapture"))));
 }
 function me(a, t) {
   const e = be.get(a);
   if (!e)
     return;
   const i = e.getStage();
-  i && i.content, be.delete(a), Gs && e._fire("lostpointercapture", Ii(new PointerEvent("lostpointercapture")));
-}
-const Tr = "Stage", vr = "string", Xi = "px", br = "mouseout", zs = "mouseleave", Ns = "mouseover", Fs = "mouseenter", Vs = "mousemove", Ws = "mousedown", Ys = "mouseup", he = "pointermove", ce = "pointerdown", Jt = "pointerup", de = "pointercancel", kr = "lostpointercapture", Ee = "pointerout", ue = "pointerleave", Ie = "pointerover", Me = "pointerenter", gi = "contextmenu", Xs = "touchstart", Us = "touchend", $s = "touchmove", Ks = "touchcancel", pi = "wheel", wr = 5, _r = [
-  [Fs, "_pointerenter"],
-  [Ws, "_pointerdown"],
-  [Vs, "_pointermove"],
-  [Ys, "_pointerup"],
-  [zs, "_pointerleave"],
+  i && i.content, be.delete(a), Hs && e._fire("lostpointercapture", Ii(new PointerEvent("lostpointercapture")));
+}
+const vr = "Stage", br = "string", Xi = "px", kr = "mouseout", Fs = "mouseleave", Vs = "mouseover", Ws = "mouseenter", Ys = "mousemove", Xs = "mousedown", Us = "mouseup", he = "pointermove", ce = "pointerdown", Jt = "pointerup", de = "pointercancel", wr = "lostpointercapture", Ee = "pointerout", ue = "pointerleave", Ie = "pointerover", Me = "pointerenter", gi = "contextmenu", $s = "touchstart", Ks = "touchend", js = "touchmove", Zs = "touchcancel", pi = "wheel", _r = 5, Pr = [
+  [Ws, "_pointerenter"],
   [Xs, "_pointerdown"],
-  [$s, "_pointermove"],
+  [Ys, "_pointermove"],
   [Us, "_pointerup"],
-  [Ks, "_pointercancel"],
-  [Ns, "_pointerover"],
+  [Fs, "_pointerleave"],
+  [$s, "_pointerdown"],
+  [js, "_pointermove"],
+  [Ks, "_pointerup"],
+  [Zs, "_pointercancel"],
+  [Vs, "_pointerover"],
   [pi, "_wheel"],
   [gi, "_contextmenu"],
   [ce, "_pointerdown"],
@@ -2710,16 +2710,16 @@ const Tr = "Stage", vr = "string", Xi = "px", br = "mouseout", zs = "mouseleave"
   [Jt, "_pointerup"],
   [de, "_pointercancel"],
   [ue, "_pointerleave"],
-  [kr, "_lostpointercapture"]
+  [wr, "_lostpointercapture"]
 ], Qe = {
   mouse: {
-    [Ee]: br,
-    [ue]: zs,
-    [Ie]: Ns,
-    [Me]: Fs,
-    [he]: Vs,
-    [ce]: Ws,
-    [Jt]: Ys,
+    [Ee]: kr,
+    [ue]: Fs,
+    [Ie]: Vs,
+    [Me]: Ws,
+    [he]: Ys,
+    [ce]: Xs,
+    [Jt]: Us,
     [de]: "mousecancel",
     pointerclick: "click",
     pointerdblclick: "dblclick"
@@ -2729,10 +2729,10 @@ const Tr = "Stage", vr = "string", Xi = "px", br = "mouseout", zs = "mouseleave"
     [ue]: "touchleave",
     [Ie]: "touchover",
     [Me]: "touchenter",
-    [he]: $s,
-    [ce]: Xs,
-    [Jt]: Us,
-    [de]: Ks,
+    [he]: js,
+    [ce]: $s,
+    [Jt]: Ks,
+    [de]: Zs,
     pointerclick: "tap",
     pointerdblclick: "dbltap"
   },
@@ -2758,9 +2758,9 @@ const Tr = "Stage", vr = "string", Xi = "px", br = "mouseout", zs = "mouseleave"
     return Qe.mouse;
 };
 function Ui(a = {}) {
-  return (a.clipFunc || a.clipWidth || a.clipHeight) && C.warn("Stage does not support clipping. Please use clip for Layers or Groups."), a;
+  return (a.clipFunc || a.clipWidth || a.clipHeight) && S.warn("Stage does not support clipping. Please use clip for Layers or Groups."), a;
 }
-const Pr = "Pointer position is missing and not registered by the stage. Looks like it is outside of the stage container. You can set it manually from event: stage.setPointersPositions(event);", ye = [];
+const xr = "Pointer position is missing and not registered by the stage. Looks like it is outside of the stage container. You can set it manually from event: stage.setPointersPositions(event);", ye = [];
 class Ze extends dt {
   constructor(t) {
     super(Ui(t)), this._pointerPositions = [], this._changedPointerPositions = [], this._buildDOM(), this._bindContentEvents(), ye.push(this), this.on("widthChange.konva heightChange.konva", this._resizeDOM), this.on("visibleChange.konva", this._checkVisibility), this.on("clipWidthChange.konva clipHeightChange.konva clipFuncChange.konva", () => {
@@ -2769,7 +2769,7 @@ class Ze extends dt {
   }
   _validateAdd(t) {
     const e = t.getType() === "Layer", i = t.getType() === "FastLayer";
-    e || i || C.throw("You may only add layers to the stage.");
+    e || i || S.throw("You may only add layers to the stage.");
   }
   _checkVisibility() {
     if (!this.content)
@@ -2778,7 +2778,7 @@ class Ze extends dt {
     this.content.style.display = t;
   }
   setContainer(t) {
-    if (typeof t === vr) {
+    if (typeof t === br) {
       let e;
       if (t.charAt(0) === ".") {
         const i = t.slice(1);
@@ -2805,16 +2805,16 @@ class Ze extends dt {
   destroy() {
     super.destroy();
     const t = this.content;
-    t && C._isInDocument(t) && this.container().removeChild(t);
+    t && S._isInDocument(t) && this.container().removeChild(t);
     const e = ye.indexOf(this);
-    return e > -1 && ye.splice(e, 1), C.releaseCanvas(this.bufferCanvas._canvas, this.bufferHitCanvas._canvas), this;
+    return e > -1 && ye.splice(e, 1), S.releaseCanvas(this.bufferCanvas._canvas, this.bufferHitCanvas._canvas), this;
   }
   getPointerPosition() {
     const t = this._pointerPositions[0] || this._changedPointerPositions[0];
     return t ? {
       x: t.x,
       y: t.y
-    } : (C.warn(Pr), null);
+    } : (S.warn(xr), null);
   }
   _getPointerById(t) {
     return this._pointerPositions.find((e) => e.id === t);
@@ -2867,7 +2867,7 @@ class Ze extends dt {
     }
     super.add(t);
     const i = this.children.length;
-    return i > wr && C.warn("The stage has " + i + " layers. Recommended maximum number of layers is 3-5. Adding more layers into the stage may drop the performance. Rethink your tree structure, you can use Konva.Group."), t.setSize({ width: this.width(), height: this.height() }), t.draw(), E.isBrowser && this.content.appendChild(t.canvas._canvas), this;
+    return i > _r && S.warn("The stage has " + i + " layers. Recommended maximum number of layers is 3-5. Adding more layers into the stage may drop the performance. Rethink your tree structure, you can use Konva.Group."), t.setSize({ width: this.width(), height: this.height() }), t.draw(), E.isBrowser && this.content.appendChild(t.canvas._canvas), this;
   }
   getParent() {
     return null;
@@ -2876,10 +2876,10 @@ class Ze extends dt {
     return null;
   }
   hasPointerCapture(t) {
-    return Bs(t, this);
+    return zs(t, this);
   }
   setPointerCapture(t) {
-    Hs(t, this);
+    Ns(t, this);
   }
   releaseCapture(t) {
     me(t);
@@ -2888,7 +2888,7 @@ class Ze extends dt {
     return this.children;
   }
   _bindContentEvents() {
-    E.isBrowser && _r.forEach(([t, e]) => {
+    E.isBrowser && Pr.forEach(([t, e]) => {
       this.content.addEventListener(t, (i) => {
         this[e](i);
       }, { passive: !1 });
@@ -3076,12 +3076,12 @@ class Ze extends dt {
     })) : (i = (t.clientX - e.left) / e.scaleX, s = (t.clientY - e.top) / e.scaleY, this.pointerPos = {
       x: i,
       y: s
-    }, this._pointerPositions = [{ x: i, y: s, id: C._getFirstPointerId(t) }], this._changedPointerPositions = [
-      { x: i, y: s, id: C._getFirstPointerId(t) }
+    }, this._pointerPositions = [{ x: i, y: s, id: S._getFirstPointerId(t) }], this._changedPointerPositions = [
+      { x: i, y: s, id: S._getFirstPointerId(t) }
     ]);
   }
   _setPointerPosition(t) {
-    C.warn('Method _setPointerPosition is deprecated. Use "stage.setPointersPositions(event)" instead.'), this.setPointersPositions(t);
+    S.warn('Method _setPointerPosition is deprecated. Use "stage.setPointersPositions(event)" instead.'), this.setPointersPositions(t);
   }
   _getContentPosition() {
     if (!this.content || !this.content.getBoundingClientRect)
@@ -3115,7 +3115,7 @@ class Ze extends dt {
     t.innerHTML = "", this.content = document.createElement("div"), this.content.style.position = "relative", this.content.style.userSelect = "none", this.content.className = "konvajs-content", this.content.setAttribute("role", "presentation"), t.appendChild(this.content), this._resizeDOM();
   }
   cache() {
-    return C.warn("Cache function is not allowed for stage. You may use cache only for layers, groups and shapes."), this;
+    return S.warn("Cache function is not allowed for stage. You may use cache only for layers, groups and shapes."), this;
   }
   clearCache() {
     return this;
@@ -3126,7 +3126,7 @@ class Ze extends dt {
     }), this;
   }
 }
-Ze.prototype.nodeType = Tr;
+Ze.prototype.nodeType = vr;
 st(Ze);
 m.addGetterSetter(Ze, "container");
 E.isBrowser && document.addEventListener("visibilitychange", () => {
@@ -3134,57 +3134,57 @@ E.isBrowser && document.addEventListener("visibilitychange", () => {
     a.batchDraw();
   });
 });
-const js = "hasShadow", Zs = "shadowRGBA", qs = "patternImage", Js = "linearGradient", Qs = "radialGradient";
+const qs = "hasShadow", Js = "shadowRGBA", Qs = "patternImage", tn = "linearGradient", en = "radialGradient";
 let Le;
 function ti() {
-  return Le || (Le = C.createCanvasElement().getContext("2d"), Le);
+  return Le || (Le = S.createCanvasElement().getContext("2d"), Le);
 }
-const Ce = {};
-function xr(a) {
+const Se = {};
+function Ar(a) {
   const t = this.attrs.fillRule;
   t ? a.fill(t) : a.fill();
 }
-function Ar(a) {
+function Er(a) {
   a.stroke();
 }
-function Er(a) {
+function Ir(a) {
   const t = this.attrs.fillRule;
   t ? a.fill(t) : a.fill();
 }
-function Ir(a) {
+function Mr(a) {
   a.stroke();
 }
-function Mr() {
-  this._clearCache(js);
-}
 function Lr() {
-  this._clearCache(Zs);
+  this._clearCache(qs);
 }
 function Dr() {
-  this._clearCache(qs);
+  this._clearCache(Js);
 }
 function Rr() {
-  this._clearCache(Js);
+  this._clearCache(Qs);
 }
 function Or() {
-  this._clearCache(Qs);
+  this._clearCache(tn);
+}
+function Gr() {
+  this._clearCache(en);
 }
 class w extends P {
   constructor(t) {
     super(t);
     let e, i = 0;
-    for (; e = C.getHitColor(), !(e && !(e in Ce)); )
+    for (; e = S.getHitColor(), !(e && !(e in Se)); )
       if (i++, i >= 1e4) {
-        C.warn("Failed to find a unique color key for a shape. Konva may work incorrectly. Most likely your browser is using canvas farbling. Consider disabling it."), e = C.getRandomColor();
+        S.warn("Failed to find a unique color key for a shape. Konva may work incorrectly. Most likely your browser is using canvas farbling. Consider disabling it."), e = S.getRandomColor();
         break;
       }
-    this.colorKey = e, Ce[e] = this;
+    this.colorKey = e, Se[e] = this;
   }
   getContext() {
-    return C.warn("shape.getContext() method is deprecated. Please do not use it."), this.getLayer().getContext();
+    return S.warn("shape.getContext() method is deprecated. Please do not use it."), this.getLayer().getContext();
   }
   getCanvas() {
-    return C.warn("shape.getCanvas() method is deprecated. Please do not use it."), this.getLayer().getCanvas();
+    return S.warn("shape.getCanvas() method is deprecated. Please do not use it."), this.getLayer().getCanvas();
   }
   getSceneFunc() {
     return this.attrs.sceneFunc || this._sceneFunc;
@@ -3193,13 +3193,13 @@ class w extends P {
     return this.attrs.hitFunc || this._hitFunc;
   }
   hasShadow() {
-    return this._getCache(js, this._hasShadow);
+    return this._getCache(qs, this._hasShadow);
   }
   _hasShadow() {
     return this.shadowEnabled() && this.shadowOpacity() !== 0 && !!(this.shadowColor() || this.shadowBlur() || this.shadowOffsetX() || this.shadowOffsetY());
   }
   _getFillPattern() {
-    return this._getCache(qs, this.__getFillPattern);
+    return this._getCache(Qs, this.__getFillPattern);
   }
   __getFillPattern() {
     if (this.fillPatternImage()) {
@@ -3221,7 +3221,7 @@ class w extends P {
     }
   }
   _getLinearGradient() {
-    return this._getCache(Js, this.__getLinearGradient);
+    return this._getCache(tn, this.__getLinearGradient);
   }
   __getLinearGradient() {
     const t = this.fillLinearGradientColorStops();
@@ -3233,7 +3233,7 @@ class w extends P {
     }
   }
   _getRadialGradient() {
-    return this._getCache(Qs, this.__getRadialGradient);
+    return this._getCache(en, this.__getRadialGradient);
   }
   __getRadialGradient() {
     const t = this.fillRadialGradientColorStops();
@@ -3245,12 +3245,12 @@ class w extends P {
     }
   }
   getShadowRGBA() {
-    return this._getCache(Zs, this._getShadowRGBA);
+    return this._getCache(Js, this._getShadowRGBA);
   }
   _getShadowRGBA() {
     if (!this.hasShadow())
       return;
-    const t = C.colorToRGBA(this.shadowColor());
+    const t = S.colorToRGBA(this.shadowColor());
     if (t)
       return "rgba(" + t.r + "," + t.g + "," + t.b + "," + t.a * (this.shadowOpacity() || 1) + ")";
   }
@@ -3283,7 +3283,7 @@ class w extends P {
     return i.getContext().clear(), this.drawHit(i, void 0, !0), i.context.getImageData(Math.round(t.x), Math.round(t.y), 1, 1).data[3] > 0;
   }
   destroy() {
-    return P.prototype.destroy.call(this), delete Ce[this.colorKey], delete this.colorKey, this;
+    return P.prototype.destroy.call(this), delete Se[this.colorKey], delete this.colorKey, this;
   }
   _useBufferCanvas(t) {
     var e;
@@ -3296,7 +3296,7 @@ class w extends P {
     return !!(s && n && o && l);
   }
   setStrokeHitEnabled(t) {
-    C.warn("strokeHitEnabled property is deprecated. Please use hitStrokeWidth instead."), t ? this.hitStrokeWidth("auto") : this.hitStrokeWidth(0);
+    S.warn("strokeHitEnabled property is deprecated. Please use hitStrokeWidth instead."), t ? this.hitStrokeWidth("auto") : this.hitStrokeWidth(0);
   }
   getStrokeHitEnabled() {
     return this.hitStrokeWidth() !== 0;
@@ -3319,8 +3319,8 @@ class w extends P {
       }
       i = i.getParent();
     }
-    const s = t.skipTransform, n = t.relativeTo || e && this.getStage() || void 0, r = this.getSelfRect(), l = !t.skipStroke && this.hasStroke() && this.strokeWidth() || 0, h = r.width + l, c = r.height + l, d = !t.skipShadow && this.hasShadow(), u = d ? this.shadowOffsetX() : 0, p = d ? this.shadowOffsetY() : 0, g = h + Math.abs(u), y = c + Math.abs(p), T = d && this.shadowBlur() || 0, S = g + T * 2, v = y + T * 2, b = {
-      width: S,
+    const s = t.skipTransform, n = t.relativeTo || e && this.getStage() || void 0, r = this.getSelfRect(), l = !t.skipStroke && this.hasStroke() && this.strokeWidth() || 0, h = r.width + l, c = r.height + l, d = !t.skipShadow && this.hasShadow(), u = d ? this.shadowOffsetX() : 0, p = d ? this.shadowOffsetY() : 0, g = h + Math.abs(u), y = c + Math.abs(p), T = d && this.shadowBlur() || 0, C = g + T * 2, v = y + T * 2, b = {
+      width: C,
       height: v,
       x: -(l / 2 + T) + Math.min(u, 0) + r.x,
       y: -(l / 2 + T) + Math.min(p, 0) + r.y
@@ -3361,7 +3361,7 @@ class w extends P {
     if (!this.shouldDrawHit(e, i))
       return this;
     const s = this.getLayer(), n = t || s.hitCanvas, r = n && n.getContext(), o = this.hitFunc() || this.sceneFunc(), l = this._getCanvasCache(), h = l && l.hit;
-    if (this.colorKey || C.warn("Looks like your canvas has a destroyed shape in it. Do not reuse shape after you destroyed it. If you want to reuse shape you should call remove() instead of destroy()"), h) {
+    if (this.colorKey || S.warn("Looks like your canvas has a destroyed shape in it. Do not reuse shape after you destroyed it. If you want to reuse shape you should call remove() instead of destroy()"), h) {
       r.save();
       const d = this.getAbsoluteTransform(e).getMatrix();
       return r.transform(d[0], d[1], d[2], d[3], d[4], d[5]), this._drawCachedHitCanvas(r), r.restore(), this;
@@ -3378,39 +3378,39 @@ class w extends P {
     const e = this._getCanvasCache(), i = this._getCachedSceneCanvas(), s = e.hit, n = s.getContext(), r = s.getWidth(), o = s.getHeight();
     n.clear(), n.drawImage(i._canvas, 0, 0, r, o);
     try {
-      const l = n.getImageData(0, 0, r, o), h = l.data, c = h.length, d = C._hexToRgb(this.colorKey);
+      const l = n.getImageData(0, 0, r, o), h = l.data, c = h.length, d = S._hexToRgb(this.colorKey);
       for (let u = 0; u < c; u += 4)
         h[u + 3] > t ? (h[u] = d.r, h[u + 1] = d.g, h[u + 2] = d.b, h[u + 3] = 255) : h[u + 3] = 0;
       n.putImageData(l, 0, 0);
     } catch (l) {
-      C.error("Unable to draw hit graph from cached scene canvas. " + l.message);
+      S.error("Unable to draw hit graph from cached scene canvas. " + l.message);
     }
     return this;
   }
   hasPointerCapture(t) {
-    return Bs(t, this);
+    return zs(t, this);
   }
   setPointerCapture(t) {
-    Hs(t, this);
+    Ns(t, this);
   }
   releaseCapture(t) {
     me(t);
   }
 }
-w.prototype._fillFunc = xr;
-w.prototype._strokeFunc = Ar;
-w.prototype._fillFuncHit = Er;
-w.prototype._strokeFuncHit = Ir;
+w.prototype._fillFunc = Ar;
+w.prototype._strokeFunc = Er;
+w.prototype._fillFuncHit = Ir;
+w.prototype._strokeFuncHit = Mr;
 w.prototype._centroid = !1;
 w.prototype.nodeType = "Shape";
 st(w);
 w.prototype.eventListeners = {};
-w.prototype.on.call(w.prototype, "shadowColorChange.konva shadowBlurChange.konva shadowOffsetChange.konva shadowOpacityChange.konva shadowEnabledChange.konva", Mr);
-w.prototype.on.call(w.prototype, "shadowColorChange.konva shadowOpacityChange.konva shadowEnabledChange.konva", Lr);
-w.prototype.on.call(w.prototype, "fillPriorityChange.konva fillPatternImageChange.konva fillPatternRepeatChange.konva fillPatternScaleXChange.konva fillPatternScaleYChange.konva fillPatternOffsetXChange.konva fillPatternOffsetYChange.konva fillPatternXChange.konva fillPatternYChange.konva fillPatternRotationChange.konva", Dr);
-w.prototype.on.call(w.prototype, "fillPriorityChange.konva fillLinearGradientColorStopsChange.konva fillLinearGradientStartPointXChange.konva fillLinearGradientStartPointYChange.konva fillLinearGradientEndPointXChange.konva fillLinearGradientEndPointYChange.konva", Rr);
-w.prototype.on.call(w.prototype, "fillPriorityChange.konva fillRadialGradientColorStopsChange.konva fillRadialGradientStartPointXChange.konva fillRadialGradientStartPointYChange.konva fillRadialGradientEndPointXChange.konva fillRadialGradientEndPointYChange.konva fillRadialGradientStartRadiusChange.konva fillRadialGradientEndRadiusChange.konva", Or);
-m.addGetterSetter(w, "stroke", void 0, Os());
+w.prototype.on.call(w.prototype, "shadowColorChange.konva shadowBlurChange.konva shadowOffsetChange.konva shadowOpacityChange.konva shadowEnabledChange.konva", Lr);
+w.prototype.on.call(w.prototype, "shadowColorChange.konva shadowOpacityChange.konva shadowEnabledChange.konva", Dr);
+w.prototype.on.call(w.prototype, "fillPriorityChange.konva fillPatternImageChange.konva fillPatternRepeatChange.konva fillPatternScaleXChange.konva fillPatternScaleYChange.konva fillPatternOffsetXChange.konva fillPatternOffsetYChange.konva fillPatternXChange.konva fillPatternYChange.konva fillPatternRotationChange.konva", Rr);
+w.prototype.on.call(w.prototype, "fillPriorityChange.konva fillLinearGradientColorStopsChange.konva fillLinearGradientStartPointXChange.konva fillLinearGradientStartPointYChange.konva fillLinearGradientEndPointXChange.konva fillLinearGradientEndPointYChange.konva", Or);
+w.prototype.on.call(w.prototype, "fillPriorityChange.konva fillRadialGradientColorStopsChange.konva fillRadialGradientStartPointXChange.konva fillRadialGradientStartPointYChange.konva fillRadialGradientEndPointXChange.konva fillRadialGradientEndPointYChange.konva fillRadialGradientStartRadiusChange.konva fillRadialGradientEndRadiusChange.konva", Gr);
+m.addGetterSetter(w, "stroke", void 0, Bs());
 m.addGetterSetter(w, "strokeWidth", 2, x());
 m.addGetterSetter(w, "fillAfterStrokeEnabled", !1);
 m.addGetterSetter(w, "hitStrokeWidth", "auto", Ei());
@@ -3431,7 +3431,7 @@ m.addComponentsGetterSetter(w, "shadowOffset", ["x", "y"]);
 m.addGetterSetter(w, "shadowOffsetX", 0, x());
 m.addGetterSetter(w, "shadowOffsetY", 0, x());
 m.addGetterSetter(w, "fillPatternImage");
-m.addGetterSetter(w, "fill", void 0, Os());
+m.addGetterSetter(w, "fill", void 0, Bs());
 m.addGetterSetter(w, "fillPatternX", 0, x());
 m.addGetterSetter(w, "fillPatternY", 0, x());
 m.addGetterSetter(w, "fillLinearGradientColorStops");
@@ -3501,13 +3501,13 @@ m.backCompat(w, {
   getDrawHitFunc: "getHitFunc",
   setDrawHitFunc: "setHitFunc"
 });
-const Gr = "beforeDraw", Br = "draw", tn = [
+const Br = "beforeDraw", Hr = "draw", sn = [
   { x: 0, y: 0 },
   { x: -1, y: -1 },
   { x: 1, y: -1 },
   { x: 1, y: 1 },
   { x: -1, y: 1 }
-], Hr = tn.length;
+], zr = sn.length;
 class Yt extends dt {
   constructor(t) {
     super(t), this.canvas = new Lt(), this.hitCanvas = new Ai({
@@ -3575,7 +3575,7 @@ class Yt extends dt {
   }
   remove() {
     const t = this.getNativeCanvasElement();
-    return P.prototype.remove.call(this), t && t.parentNode && C._isInDocument(t) && t.parentNode.removeChild(t), this;
+    return P.prototype.remove.call(this), t && t.parentNode && S._isInDocument(t) && t.parentNode.removeChild(t), this;
   }
   getStage() {
     return this.parent;
@@ -3585,7 +3585,7 @@ class Yt extends dt {
   }
   _validateAdd(t) {
     const e = t.getType();
-    e !== "Group" && e !== "Shape" && C.throw("You may only add groups and shapes to a layer.");
+    e !== "Group" && e !== "Shape" && S.throw("You may only add groups and shapes to a layer.");
   }
   _toKonvaCanvas(t) {
     return t = { ...t }, t.width = t.width || this.getWidth(), t.height = t.height || this.getHeight(), t.x = t.x !== void 0 ? t.x : this.x(), t.y = t.y !== void 0 ? t.y : this.y(), P.prototype._toKonvaCanvas.call(this, t);
@@ -3601,17 +3601,17 @@ class Yt extends dt {
       return this.parent.width();
   }
   setWidth() {
-    C.warn('Can not change width of layer. Use "stage.width(value)" function instead.');
+    S.warn('Can not change width of layer. Use "stage.width(value)" function instead.');
   }
   getHeight() {
     if (this.parent)
       return this.parent.height();
   }
   setHeight() {
-    C.warn('Can not change height of layer. Use "stage.height(value)" function instead.');
+    S.warn('Can not change height of layer. Use "stage.height(value)" function instead.');
   }
   batchDraw() {
-    return this._waitingForDraw || (this._waitingForDraw = !0, C.requestAnimFrame(() => {
+    return this._waitingForDraw || (this._waitingForDraw = !0, S.requestAnimFrame(() => {
       this.draw(), this._waitingForDraw = !1;
     })), this;
   }
@@ -3620,8 +3620,8 @@ class Yt extends dt {
       return null;
     let e = 1, i = !1;
     for (; ; ) {
-      for (let s = 0; s < Hr; s++) {
-        const n = tn[s], r = this._getIntersection({
+      for (let s = 0; s < zr; s++) {
+        const n = sn[s], r = this._getIntersection({
           x: t.x + n.x * e,
           y: t.y + n.y * e
         }), o = r.shape;
@@ -3639,7 +3639,7 @@ class Yt extends dt {
   _getIntersection(t) {
     const e = this.hitCanvas.pixelRatio, i = this.hitCanvas.context.getImageData(Math.round(t.x * e), Math.round(t.y * e), 1, 1).data, s = i[3];
     if (s === 255) {
-      const n = C.getHitColorKey(i[0], i[1], i[2]), r = Ce[n];
+      const n = S.getHitColorKey(i[0], i[1], i[2]), r = Se[n];
       return r ? {
         shape: r
       } : {
@@ -3653,9 +3653,9 @@ class Yt extends dt {
   }
   drawScene(t, e, i) {
     const s = this.getLayer(), n = t || s && s.getCanvas();
-    return this._fire(Gr, {
+    return this._fire(Br, {
       node: this
-    }), this.clearBeforeDraw() && n.getContext().clear(), dt.prototype.drawScene.call(this, n, e, i), this._fire(Br, {
+    }), this.clearBeforeDraw() && n.getContext().clear(), dt.prototype.drawScene.call(this, n, e, i), this._fire(Hr, {
       node: this
     }), this;
   }
@@ -3670,10 +3670,10 @@ class Yt extends dt {
     return this.hitGraphEnabled(!1), this;
   }
   setHitGraphEnabled(t) {
-    C.warn("hitGraphEnabled method is deprecated. Please use layer.listening() instead."), this.listening(t);
+    S.warn("hitGraphEnabled method is deprecated. Please use layer.listening() instead."), this.listening(t);
   }
   getHitGraphEnabled(t) {
-    return C.warn("hitGraphEnabled method is deprecated. Please use layer.listening() instead."), this.listening();
+    return S.warn("hitGraphEnabled method is deprecated. Please use layer.listening() instead."), this.listening();
   }
   toggleHitCanvas() {
     if (!this.parent || !this.parent.content)
@@ -3682,7 +3682,7 @@ class Yt extends dt {
     !!this.hitCanvas._canvas.parentNode ? t.content.removeChild(this.hitCanvas._canvas) : t.content.appendChild(this.hitCanvas._canvas);
   }
   destroy() {
-    return C.releaseCanvas(this.getNativeCanvasElement(), this.getHitCanvas()._canvas), super.destroy();
+    return S.releaseCanvas(this.getNativeCanvasElement(), this.getHitCanvas()._canvas), super.destroy();
   }
 }
 Yt.prototype.nodeType = "Layer";
@@ -3692,7 +3692,7 @@ m.addGetterSetter(Yt, "clearBeforeDraw", !0);
 m.addGetterSetter(Yt, "hitGraphEnabled", !0, pt());
 class Mi extends Yt {
   constructor(t) {
-    super(t), this.listening(!1), C.warn('Konva.Fast layer is deprecated. Please use "new Konva.Layer({ listening: false })" instead.');
+    super(t), this.listening(!1), S.warn('Konva.Fast layer is deprecated. Please use "new Konva.Layer({ listening: false })" instead.');
   }
 }
 Mi.prototype.nodeType = "FastLayer";
@@ -3700,7 +3700,7 @@ st(Mi);
 class Qt extends dt {
   _validateAdd(t) {
     const e = t.getType();
-    e !== "Group" && e !== "Shape" && C.throw("You may only add groups and shapes to groups.");
+    e !== "Group" && e !== "Shape" && S.throw("You may only add groups and shapes to groups.");
   }
 }
 Qt.prototype.nodeType = "Group";
@@ -3780,24 +3780,24 @@ class ft {
   }
   static _animationLoop() {
     const t = ft;
-    t.animations.length ? (t._runFrames(), C.requestAnimFrame(t._animationLoop)) : t.animRunning = !1;
+    t.animations.length ? (t._runFrames(), S.requestAnimFrame(t._animationLoop)) : t.animRunning = !1;
   }
   static _handleAnimation() {
-    this.animRunning || (this.animRunning = !0, C.requestAnimFrame(this._animationLoop));
+    this.animRunning || (this.animRunning = !0, S.requestAnimFrame(this._animationLoop));
   }
 }
 ft.animations = [];
 ft.animIdCounter = 0;
 ft.animRunning = !1;
-const zr = {
+const Nr = {
   node: 1,
   duration: 1,
   easing: 1,
   onFinish: 1,
   yoyo: 1
-}, Nr = 1, $i = 2, Ki = 3, ji = ["fill", "stroke", "shadowColor"];
-let Fr = 0;
-class Vr {
+}, Fr = 1, $i = 2, Ki = 3, ji = ["fill", "stroke", "shadowColor"];
+let Vr = 0;
+class Wr {
   constructor(t, e, i, s, n, r, o) {
     this.prop = t, this.propFunc = e, this.begin = s, this._pos = s, this.duration = r, this._change = 0, this.prevPos = 0, this.yoyo = o, this._time = 0, this._position = 0, this._startTime = 0, this._finish = 0, this.func = i, this._change = n - this.begin, this.pause();
   }
@@ -3840,7 +3840,7 @@ class Vr {
     this.state === $i ? this.setTime(t) : this.state === Ki && this.setTime(this.duration - t);
   }
   pause() {
-    this.state = Nr, this.fire("onPause");
+    this.state = Fr, this.fire("onPause");
   }
   getTimer() {
     return (/* @__PURE__ */ new Date()).getTime();
@@ -3848,17 +3848,17 @@ class Vr {
 }
 class Q {
   constructor(t) {
-    const e = this, i = t.node, s = i._id, n = t.easing || Se.Linear, r = !!t.yoyo;
+    const e = this, i = t.node, s = i._id, n = t.easing || Ce.Linear, r = !!t.yoyo;
     let o, l;
-    typeof t.duration > "u" ? o = 0.3 : t.duration === 0 ? o = 1e-3 : o = t.duration, this.node = i, this._id = Fr++;
+    typeof t.duration > "u" ? o = 0.3 : t.duration === 0 ? o = 1e-3 : o = t.duration, this.node = i, this._id = Vr++;
     const h = i.getLayer() || (i instanceof E.Stage ? i.getLayers() : null);
-    h || C.error("Tween constructor have `node` that is not in a layer. Please add node into layer first."), this.anim = new ft(function() {
+    h || S.error("Tween constructor have `node` that is not in a layer. Please add node into layer first."), this.anim = new ft(function() {
       e.tween.onEnterFrame();
-    }, h), this.tween = new Vr(l, function(c) {
+    }, h), this.tween = new Wr(l, function(c) {
       e._tweenFunc(c);
     }, n, 0, 1, o * 1e3, r), this._addListeners(), Q.attrs[s] || (Q.attrs[s] = {}), Q.attrs[s][this._id] || (Q.attrs[s][this._id] = {}), Q.tweens[s] || (Q.tweens[s] = {});
     for (l in t)
-      zr[l] === void 0 && this._addAttr(l, t[l]);
+      Nr[l] === void 0 && this._addAttr(l, t[l]);
     this.reset(), this.onFinish = t.onFinish, this.onReset = t.onReset, this.onUpdate = t.onUpdate;
   }
   _addAttr(t, e) {
@@ -3867,14 +3867,14 @@ class Q {
     const c = Q.tweens[s][t];
     c && delete Q.attrs[s][c][t];
     let d = i.getAttr(t);
-    if (C._isArray(e))
-      if (n = [], r = Math.max(e.length, d.length), t === "points" && e.length !== d.length && (e.length > d.length ? (l = d, d = C._prepareArrayForTween(d, e, i.closed())) : (o = e, e = C._prepareArrayForTween(e, d, i.closed()))), t.indexOf("fill") === 0)
+    if (S._isArray(e))
+      if (n = [], r = Math.max(e.length, d.length), t === "points" && e.length !== d.length && (e.length > d.length ? (l = d, d = S._prepareArrayForTween(d, e, i.closed())) : (o = e, e = S._prepareArrayForTween(e, d, i.closed()))), t.indexOf("fill") === 0)
         for (let u = 0; u < r; u++)
           if (u % 2 === 0)
             n.push(e[u] - d[u]);
           else {
-            const p = C.colorToRGBA(d[u]);
-            h = C.colorToRGBA(e[u]), d[u] = p, n.push({
+            const p = S.colorToRGBA(d[u]);
+            h = S.colorToRGBA(e[u]), d[u] = p, n.push({
               r: h.r - p.r,
               g: h.g - p.g,
               b: h.b - p.b,
@@ -3884,7 +3884,7 @@ class Q {
       else
         for (let u = 0; u < r; u++)
           n.push(e[u] - d[u]);
-    else ji.indexOf(t) !== -1 ? (d = C.colorToRGBA(d), h = C.colorToRGBA(e), n = {
+    else ji.indexOf(t) !== -1 ? (d = S.colorToRGBA(d), h = S.colorToRGBA(e), n = {
       r: h.r - d.r,
       g: h.g - d.g,
       b: h.b - d.b,
@@ -3902,7 +3902,7 @@ class Q {
     const e = this.node, i = Q.attrs[e._id][this._id];
     let s, n, r, o, l, h, c, d;
     for (s in i) {
-      if (n = i[s], r = n.start, o = n.diff, d = n.end, C._isArray(r))
+      if (n = i[s], r = n.start, o = n.diff, d = n.end, S._isArray(r))
         if (l = [], c = Math.max(r.length, d.length), s.indexOf("fill") === 0)
           for (h = 0; h < c; h++)
             h % 2 === 0 ? l.push((r[h] || 0) + o[h] * t) : l.push("rgba(" + Math.round(r[h].r + o[h].r * t) + "," + Math.round(r[h].g + o[h].g * t) + "," + Math.round(r[h].b + o[h].b * t) + "," + (r[h].a + o[h].a * t) + ")");
@@ -3964,7 +3964,7 @@ P.prototype.to = function(a) {
     this.destroy(), t && t();
   }, new Q(a).play();
 };
-const Se = {
+const Ce = {
   BackEaseIn(a, t, e, i) {
     return e * (a /= i) * a * ((1.70158 + 1) * a - 1.70158) + t;
   },
@@ -3991,10 +3991,10 @@ const Se = {
     return (a /= i) < 1 / 2.75 ? e * (7.5625 * a * a) + t : a < 2 / 2.75 ? e * (7.5625 * (a -= 1.5 / 2.75) * a + 0.75) + t : a < 2.5 / 2.75 ? e * (7.5625 * (a -= 2.25 / 2.75) * a + 0.9375) + t : e * (7.5625 * (a -= 2.625 / 2.75) * a + 0.984375) + t;
   },
   BounceEaseIn(a, t, e, i) {
-    return e - Se.BounceEaseOut(i - a, 0, e, i) + t;
+    return e - Ce.BounceEaseOut(i - a, 0, e, i) + t;
   },
   BounceEaseInOut(a, t, e, i) {
-    return a < i / 2 ? Se.BounceEaseIn(a * 2, 0, e, i) * 0.5 + t : Se.BounceEaseOut(a * 2 - i, 0, e, i) * 0.5 + e * 0.5 + t;
+    return a < i / 2 ? Ce.BounceEaseIn(a * 2, 0, e, i) * 0.5 + t : Ce.BounceEaseOut(a * 2 - i, 0, e, i) * 0.5 + e * 0.5 + t;
   },
   EaseIn(a, t, e, i) {
     return e * (a /= i) * a + t;
@@ -4017,8 +4017,8 @@ const Se = {
   Linear(a, t, e, i) {
     return e * a / i + t;
   }
-}, Zi = C._assign(E, {
-  Util: C,
+}, Zi = S._assign(E, {
+  Util: S,
   Transform: ct,
   Node: P,
   Container: dt,
@@ -4029,10 +4029,10 @@ const Se = {
   Group: Qt,
   DD: $,
   Shape: w,
-  shapes: Ce,
+  shapes: Se,
   Animation: ft,
   Tween: Q,
-  Easings: Se,
+  Easings: Ce,
   Context: Ke,
   Canvas: xi
 });
@@ -4088,7 +4088,7 @@ function qi(a, t) {
   }
   return i;
 }
-function Wr(a) {
+function Yr(a) {
   const t = [
     [a[0], a[2], a[4], a[6]],
     [a[1], a[3], a[5], a[7]]
@@ -4177,7 +4177,7 @@ class xt extends w {
     ] : this.bezier() ? t = [
       t[0],
       t[1],
-      ...Wr(this.points()),
+      ...Yr(this.points()),
       t[t.length - 2],
       t[t.length - 1]
     ] : t = this.points();
@@ -4198,8 +4198,8 @@ st(xt);
 m.addGetterSetter(xt, "closed", !1);
 m.addGetterSetter(xt, "bezier", !1);
 m.addGetterSetter(xt, "tension", 0, x());
-m.addGetterSetter(xt, "points", [], rr());
-const Yr = [
+m.addGetterSetter(xt, "points", [], ar());
+const Xr = [
   [],
   [],
   [
@@ -4547,7 +4547,7 @@ const Yr = [
     -0.9951872199970213,
     0.9951872199970213
   ]
-], Xr = [
+], Ur = [
   [],
   [],
   [1, 1],
@@ -4892,12 +4892,12 @@ const Yr = [
     0.0123412297999872,
     0.0123412297999872
   ]
-], Ur = [[1], [1, 1], [1, 2, 1], [1, 3, 3, 1]], Ji = (a, t, e) => {
+], $r = [[1], [1, 1], [1, 2, 1], [1, 3, 3, 1]], Ji = (a, t, e) => {
   let i, s;
   const r = e / 2;
   i = 0;
   for (let o = 0; o < 20; o++)
-    s = r * Yr[20][o] + r, i += Xr[20][o] * $r(a, t, s);
+    s = r * Xr[20][o] + r, i += Ur[20][o] * Kr(a, t, s);
   return r * i;
 }, Qi = (a, t, e) => {
   e === void 0 && (e = 1);
@@ -4907,7 +4907,7 @@ const Yr = [
   const c = l / (2 * o), d = h / o, u = e + c, p = d - c * c, g = u * u + p > 0 ? Math.sqrt(u * u + p) : 0, y = c * c + p > 0 ? Math.sqrt(c * c + p) : 0, T = c + Math.sqrt(c * c + p) !== 0 ? p * Math.log(Math.abs((u + g) / (c + y))) : 0;
   return Math.sqrt(o) / 2 * (u * g - c * y + T);
 };
-function $r(a, t, e) {
+function Kr(a, t, e) {
   const i = yi(1, e, a), s = yi(1, e, t), n = i * i + s * s;
   return Math.sqrt(n);
 }
@@ -4919,7 +4919,7 @@ const yi = (a, t, e) => {
   if (a === 0) {
     n = 0;
     for (let r = 0; r <= i; r++)
-      n += Ur[i][r] * Math.pow(1 - t, i - r) * Math.pow(t, r) * e[r];
+      n += $r[i][r] * Math.pow(1 - t, i - r) * Math.pow(t, r) * e[r];
     return n;
   } else {
     s = new Array(i);
@@ -4971,8 +4971,8 @@ class tt extends w {
           t.quadraticCurveTo(r[0], r[1], r[2], r[3]);
           break;
         case "A":
-          const o = r[0], l = r[1], h = r[2], c = r[3], d = r[4], u = r[5], p = r[6], g = r[7], y = h > c ? h : c, T = h > c ? 1 : h / c, S = h > c ? c / h : 1;
-          t.translate(o, l), t.rotate(p), t.scale(T, S), t.arc(0, 0, y, d, d + u, 1 - g), t.scale(1 / T, 1 / S), t.rotate(-p), t.translate(-o, -l);
+          const o = r[0], l = r[1], h = r[2], c = r[3], d = r[4], u = r[5], p = r[6], g = r[7], y = h > c ? h : c, T = h > c ? 1 : h / c, C = h > c ? c / h : 1;
+          t.translate(o, l), t.rotate(p), t.scale(T, C), t.arc(0, 0, y, d, d + u, 1 - g), t.scale(1 / T, 1 / C), t.rotate(-p), t.translate(-o, -l);
           break;
         case "z":
           i = !0, t.closePath();
@@ -5074,8 +5074,8 @@ class tt extends w {
     const h = (n - i) / (s - e), c = Math.sqrt(t * t / (1 + h * h)) * (s < e ? -1 : 1), d = h * c;
     if (Math.abs(o - i - h * (r - e)) < 1e-10)
       return { x: r + c, y: o + d };
-    const u = ((r - e) * (s - e) + (o - i) * (n - i)) / (l * l), p = e + u * (s - e), g = i + u * (n - i), y = this.getLineLength(r, o, p, g), T = Math.sqrt(t * t - y * y), S = Math.sqrt(T * T / (1 + h * h)) * (s < e ? -1 : 1), v = h * S;
-    return { x: p + S, y: g + v };
+    const u = ((r - e) * (s - e) + (o - i) * (n - i)) / (l * l), p = e + u * (s - e), g = i + u * (n - i), y = this.getLineLength(r, o, p, g), T = Math.sqrt(t * t - y * y), C = Math.sqrt(T * T / (1 + h * h)) * (s < e ? -1 : 1), v = h * C;
+    return { x: p + C, y: g + v };
   }
   static getPointOnCubicBezier(t, e, i, s, n, r, o, l, h) {
     function c(T) {
@@ -5154,7 +5154,7 @@ class tt extends w {
       for (u = u.slice(1), r.length = 0; c = h.exec(u); )
         r.push(c[0]);
       let g = [], y = p === "A" || p === "a" ? 0 : -1;
-      for (let T = 0, S = r.length; T < S; T++) {
+      for (let T = 0, C = r.length; T < C; T++) {
         const v = r[T];
         if (v === "00") {
           g.push(0, 0), y >= 0 && (y += 2, y >= 7 && (y -= 7));
@@ -5192,15 +5192,15 @@ class tt extends w {
         }
       }
       for (; g.length > 0 && !isNaN(g[0]); ) {
-        let T = "", S = [];
+        let T = "", C = [];
         const v = o, b = l;
         let k, M, _, R, A, I, D, N, G, W;
         switch (p) {
           case "l":
-            o += g.shift(), l += g.shift(), T = "L", S.push(o, l);
+            o += g.shift(), l += g.shift(), T = "L", C.push(o, l);
             break;
           case "L":
-            o = g.shift(), l = g.shift(), S.push(o, l);
+            o = g.shift(), l = g.shift(), C.push(o, l);
             break;
           case "m":
             const F = g.shift(), H = g.shift();
@@ -5211,62 +5211,62 @@ class tt extends w {
                   break;
                 }
             }
-            S.push(o, l), p = "l";
+            C.push(o, l), p = "l";
             break;
           case "M":
-            o = g.shift(), l = g.shift(), T = "M", S.push(o, l), p = "L";
+            o = g.shift(), l = g.shift(), T = "M", C.push(o, l), p = "L";
             break;
           case "h":
-            o += g.shift(), T = "L", S.push(o, l);
+            o += g.shift(), T = "L", C.push(o, l);
             break;
           case "H":
-            o = g.shift(), T = "L", S.push(o, l);
+            o = g.shift(), T = "L", C.push(o, l);
             break;
           case "v":
-            l += g.shift(), T = "L", S.push(o, l);
+            l += g.shift(), T = "L", C.push(o, l);
             break;
           case "V":
-            l = g.shift(), T = "L", S.push(o, l);
+            l = g.shift(), T = "L", C.push(o, l);
             break;
           case "C":
-            S.push(g.shift(), g.shift(), g.shift(), g.shift()), o = g.shift(), l = g.shift(), S.push(o, l);
+            C.push(g.shift(), g.shift(), g.shift(), g.shift()), o = g.shift(), l = g.shift(), C.push(o, l);
             break;
           case "c":
-            S.push(o + g.shift(), l + g.shift(), o + g.shift(), l + g.shift()), o += g.shift(), l += g.shift(), T = "C", S.push(o, l);
+            C.push(o + g.shift(), l + g.shift(), o + g.shift(), l + g.shift()), o += g.shift(), l += g.shift(), T = "C", C.push(o, l);
             break;
           case "S":
-            M = o, _ = l, k = n[n.length - 1], k.command === "C" && (M = o + (o - k.points[2]), _ = l + (l - k.points[3])), S.push(M, _, g.shift(), g.shift()), o = g.shift(), l = g.shift(), T = "C", S.push(o, l);
+            M = o, _ = l, k = n[n.length - 1], k.command === "C" && (M = o + (o - k.points[2]), _ = l + (l - k.points[3])), C.push(M, _, g.shift(), g.shift()), o = g.shift(), l = g.shift(), T = "C", C.push(o, l);
             break;
           case "s":
-            M = o, _ = l, k = n[n.length - 1], k.command === "C" && (M = o + (o - k.points[2]), _ = l + (l - k.points[3])), S.push(M, _, o + g.shift(), l + g.shift()), o += g.shift(), l += g.shift(), T = "C", S.push(o, l);
+            M = o, _ = l, k = n[n.length - 1], k.command === "C" && (M = o + (o - k.points[2]), _ = l + (l - k.points[3])), C.push(M, _, o + g.shift(), l + g.shift()), o += g.shift(), l += g.shift(), T = "C", C.push(o, l);
             break;
           case "Q":
-            S.push(g.shift(), g.shift()), o = g.shift(), l = g.shift(), S.push(o, l);
+            C.push(g.shift(), g.shift()), o = g.shift(), l = g.shift(), C.push(o, l);
             break;
           case "q":
-            S.push(o + g.shift(), l + g.shift()), o += g.shift(), l += g.shift(), T = "Q", S.push(o, l);
+            C.push(o + g.shift(), l + g.shift()), o += g.shift(), l += g.shift(), T = "Q", C.push(o, l);
             break;
           case "T":
-            M = o, _ = l, k = n[n.length - 1], k.command === "Q" && (M = o + (o - k.points[0]), _ = l + (l - k.points[1])), o = g.shift(), l = g.shift(), T = "Q", S.push(M, _, o, l);
+            M = o, _ = l, k = n[n.length - 1], k.command === "Q" && (M = o + (o - k.points[0]), _ = l + (l - k.points[1])), o = g.shift(), l = g.shift(), T = "Q", C.push(M, _, o, l);
             break;
           case "t":
-            M = o, _ = l, k = n[n.length - 1], k.command === "Q" && (M = o + (o - k.points[0]), _ = l + (l - k.points[1])), o += g.shift(), l += g.shift(), T = "Q", S.push(M, _, o, l);
+            M = o, _ = l, k = n[n.length - 1], k.command === "Q" && (M = o + (o - k.points[0]), _ = l + (l - k.points[1])), o += g.shift(), l += g.shift(), T = "Q", C.push(M, _, o, l);
             break;
           case "A":
-            R = g.shift(), A = g.shift(), I = g.shift(), D = g.shift(), N = g.shift(), G = o, W = l, o = g.shift(), l = g.shift(), T = "A", S = this.convertEndpointToCenterParameterization(G, W, o, l, D, N, R, A, I);
+            R = g.shift(), A = g.shift(), I = g.shift(), D = g.shift(), N = g.shift(), G = o, W = l, o = g.shift(), l = g.shift(), T = "A", C = this.convertEndpointToCenterParameterization(G, W, o, l, D, N, R, A, I);
             break;
           case "a":
-            R = g.shift(), A = g.shift(), I = g.shift(), D = g.shift(), N = g.shift(), G = o, W = l, o += g.shift(), l += g.shift(), T = "A", S = this.convertEndpointToCenterParameterization(G, W, o, l, D, N, R, A, I);
+            R = g.shift(), A = g.shift(), I = g.shift(), D = g.shift(), N = g.shift(), G = o, W = l, o += g.shift(), l += g.shift(), T = "A", C = this.convertEndpointToCenterParameterization(G, W, o, l, D, N, R, A, I);
             break;
         }
         n.push({
           command: T || p,
-          points: S,
+          points: C,
           start: {
             x: v,
             y: b
           },
-          pathLength: this.calcLength(v, b, T || p, S)
+          pathLength: this.calcLength(v, b, T || p, C)
         });
       }
       (p === "z" || p === "Z") && n.push({
@@ -5307,7 +5307,7 @@ class tt extends w {
     p > 1 && (o *= Math.sqrt(p), l *= Math.sqrt(p));
     let g = Math.sqrt((o * o * (l * l) - o * o * (u * u) - l * l * (d * d)) / (o * o * (u * u) + l * l * (d * d)));
     n === r && (g *= -1), isNaN(g) && (g = 0);
-    const y = g * o * u / l, T = g * -l * d / o, S = (t + i) / 2 + Math.cos(c) * y - Math.sin(c) * T, v = (e + s) / 2 + Math.sin(c) * y + Math.cos(c) * T, b = function(D) {
+    const y = g * o * u / l, T = g * -l * d / o, C = (t + i) / 2 + Math.cos(c) * y - Math.sin(c) * T, v = (e + s) / 2 + Math.sin(c) * y + Math.cos(c) * T, b = function(D) {
       return Math.sqrt(D[0] * D[0] + D[1] * D[1]);
     }, k = function(D, N) {
       return (D[0] * N[0] + D[1] * N[1]) / (b(D) * b(N));
@@ -5315,7 +5315,7 @@ class tt extends w {
       return (D[0] * N[1] < D[1] * N[0] ? -1 : 1) * Math.acos(k(D, N));
     }, _ = M([1, 0], [(d - y) / o, (u - T) / l]), R = [(d - y) / o, (u - T) / l], A = [(-1 * d - y) / o, (-1 * u - T) / l];
     let I = M(R, A);
-    return k(R, A) <= -1 && (I = Math.PI), k(R, A) >= 1 && (I = 0), r === 0 && I > 0 && (I = I - 2 * Math.PI), r === 1 && I < 0 && (I = I + 2 * Math.PI), [S, v, o, l, _, I, c, r];
+    return k(R, A) <= -1 && (I = Math.PI), k(R, A) >= 1 && (I = 0), r === 0 && I > 0 && (I = I - 2 * Math.PI), r === 1 && I < 0 && (I = I + 2 * Math.PI), [C, v, o, l, _, I, c, r];
   }
 }
 tt.prototype.className = "Path";
@@ -5413,7 +5413,7 @@ st(Ot);
 m.addComponentsGetterSetter(Ot, "radius", ["x", "y"]);
 m.addGetterSetter(Ot, "radiusX", 0, x());
 m.addGetterSetter(Ot, "radiusY", 0, x());
-let mt = class en extends w {
+let mt = class nn extends w {
   constructor(t) {
     super(t), this._loadListener = () => {
       this._requestDraw();
@@ -5452,11 +5452,11 @@ let mt = class en extends w {
         i
       ] : r = [n, 0, 0, e, i];
     }
-    (this.hasFill() || this.hasStroke() || s) && (t.beginPath(), s ? C.drawRoundedRectPath(t, e, i, s) : t.rect(0, 0, e, i), t.closePath(), t.fillStrokeShape(this)), n && (s && t.clip(), t.drawImage.apply(t, r));
+    (this.hasFill() || this.hasStroke() || s) && (t.beginPath(), s ? S.drawRoundedRectPath(t, e, i, s) : t.rect(0, 0, e, i), t.closePath(), t.fillStrokeShape(this)), n && (s && t.clip(), t.drawImage.apply(t, r));
   }
   _hitFunc(t) {
     const e = this.width(), i = this.height(), s = this.cornerRadius();
-    t.beginPath(), s ? C.drawRoundedRectPath(t, e, i, s) : t.rect(0, 0, e, i), t.closePath(), t.fillStrokeShape(this);
+    t.beginPath(), s ? S.drawRoundedRectPath(t, e, i, s) : t.rect(0, 0, e, i), t.closePath(), t.fillStrokeShape(this);
   }
   getWidth() {
     var t, e, i;
@@ -5467,9 +5467,9 @@ let mt = class en extends w {
     return (i = (t = this.attrs.height) !== null && t !== void 0 ? t : (e = this.image()) === null || e === void 0 ? void 0 : e.height) !== null && i !== void 0 ? i : 0;
   }
   static fromURL(t, e, i = null) {
-    const s = C.createImageElement();
+    const s = S.createImageElement();
     s.onload = function() {
-      const n = new en({
+      const n = new nn({
         image: s
       });
       e(n);
@@ -5486,7 +5486,7 @@ m.addGetterSetter(mt, "cropX", 0, x());
 m.addGetterSetter(mt, "cropY", 0, x());
 m.addGetterSetter(mt, "cropWidth", 0, x());
 m.addGetterSetter(mt, "cropHeight", 0, x());
-const sn = [
+const rn = [
   "fontFamily",
   "fontSize",
   "fontStyle",
@@ -5498,7 +5498,7 @@ const sn = [
   "pointerDirection",
   "pointerWidth",
   "pointerHeight"
-], Kr = "Change.konva", jr = "none", Ci = "up", Si = "right", Ti = "down", vi = "left", Zr = sn.length;
+], jr = "Change.konva", Zr = "none", Si = "up", Ci = "right", Ti = "down", vi = "left", qr = rn.length;
 class Li extends Qt {
   constructor(t) {
     super(t), this.on("add.konva", function(e) {
@@ -5516,8 +5516,8 @@ class Li extends Qt {
     const s = function() {
       e._sync();
     };
-    for (i = 0; i < Zr; i++)
-      t.on(sn[i] + Kr, s);
+    for (i = 0; i < qr; i++)
+      t.on(rn[i] + jr, s);
   }
   getWidth() {
     return this.getText().width();
@@ -5529,10 +5529,10 @@ class Li extends Qt {
     let t = this.getText(), e = this.getTag(), i, s, n, r, o, l, h;
     if (t && e) {
       switch (i = t.width(), s = t.height(), n = e.pointerDirection(), r = e.pointerWidth(), h = e.pointerHeight(), o = 0, l = 0, n) {
-        case Ci:
+        case Si:
           o = i / 2, l = -1 * h;
           break;
-        case Si:
+        case Ci:
           o = i + r, l = s / 2;
           break;
         case Ti:
@@ -5560,11 +5560,11 @@ class Ut extends w {
   _sceneFunc(t) {
     const e = this.width(), i = this.height(), s = this.pointerDirection(), n = this.pointerWidth(), r = this.pointerHeight(), o = this.cornerRadius();
     let l = 0, h = 0, c = 0, d = 0;
-    typeof o == "number" ? l = h = c = d = Math.min(o, e / 2, i / 2) : (l = Math.min(o[0] || 0, e / 2, i / 2), h = Math.min(o[1] || 0, e / 2, i / 2), d = Math.min(o[2] || 0, e / 2, i / 2), c = Math.min(o[3] || 0, e / 2, i / 2)), t.beginPath(), t.moveTo(l, 0), s === Ci && (t.lineTo((e - n) / 2, 0), t.lineTo(e / 2, -1 * r), t.lineTo((e + n) / 2, 0)), t.lineTo(e - h, 0), t.arc(e - h, h, h, Math.PI * 3 / 2, 0, !1), s === Si && (t.lineTo(e, (i - r) / 2), t.lineTo(e + n, i / 2), t.lineTo(e, (i + r) / 2)), t.lineTo(e, i - d), t.arc(e - d, i - d, d, 0, Math.PI / 2, !1), s === Ti && (t.lineTo((e + n) / 2, i), t.lineTo(e / 2, i + r), t.lineTo((e - n) / 2, i)), t.lineTo(c, i), t.arc(c, i - c, c, Math.PI / 2, Math.PI, !1), s === vi && (t.lineTo(0, (i + r) / 2), t.lineTo(-1 * n, i / 2), t.lineTo(0, (i - r) / 2)), t.lineTo(0, l), t.arc(l, l, l, Math.PI, Math.PI * 3 / 2, !1), t.closePath(), t.fillStrokeShape(this);
+    typeof o == "number" ? l = h = c = d = Math.min(o, e / 2, i / 2) : (l = Math.min(o[0] || 0, e / 2, i / 2), h = Math.min(o[1] || 0, e / 2, i / 2), d = Math.min(o[2] || 0, e / 2, i / 2), c = Math.min(o[3] || 0, e / 2, i / 2)), t.beginPath(), t.moveTo(l, 0), s === Si && (t.lineTo((e - n) / 2, 0), t.lineTo(e / 2, -1 * r), t.lineTo((e + n) / 2, 0)), t.lineTo(e - h, 0), t.arc(e - h, h, h, Math.PI * 3 / 2, 0, !1), s === Ci && (t.lineTo(e, (i - r) / 2), t.lineTo(e + n, i / 2), t.lineTo(e, (i + r) / 2)), t.lineTo(e, i - d), t.arc(e - d, i - d, d, 0, Math.PI / 2, !1), s === Ti && (t.lineTo((e + n) / 2, i), t.lineTo(e / 2, i + r), t.lineTo((e - n) / 2, i)), t.lineTo(c, i), t.arc(c, i - c, c, Math.PI / 2, Math.PI, !1), s === vi && (t.lineTo(0, (i + r) / 2), t.lineTo(-1 * n, i / 2), t.lineTo(0, (i - r) / 2)), t.lineTo(0, l), t.arc(l, l, l, Math.PI, Math.PI * 3 / 2, !1), t.closePath(), t.fillStrokeShape(this);
   }
   getSelfRect() {
     let t = 0, e = 0, i = this.pointerWidth(), s = this.pointerHeight(), n = this.pointerDirection(), r = this.width(), o = this.height();
-    return n === Ci ? (e -= s, o += s) : n === Ti ? o += s : n === vi ? (t -= i * 1.5, r += i) : n === Si && (r += i * 1.5), {
+    return n === Si ? (e -= s, o += s) : n === Ti ? o += s : n === vi ? (t -= i * 1.5, r += i) : n === Ci && (r += i * 1.5), {
       x: t,
       y: e,
       width: r,
@@ -5574,14 +5574,14 @@ class Ut extends w {
 }
 Ut.prototype.className = "Tag";
 st(Ut);
-m.addGetterSetter(Ut, "pointerDirection", jr);
+m.addGetterSetter(Ut, "pointerDirection", Zr);
 m.addGetterSetter(Ut, "pointerWidth", 0, x());
 m.addGetterSetter(Ut, "pointerHeight", 0, x());
 m.addGetterSetter(Ut, "cornerRadius", 0, je(4));
 class ke extends w {
   _sceneFunc(t) {
     const e = this.cornerRadius(), i = this.width(), s = this.height();
-    t.beginPath(), e ? C.drawRoundedRectPath(t, i, s, e) : t.rect(0, 0, i, s), t.closePath(), t.fillStrokeShape(this);
+    t.beginPath(), e ? S.drawRoundedRectPath(t, i, s, e) : t.rect(0, 0, i, s), t.closePath(), t.fillStrokeShape(this);
   }
 }
 ke.prototype.className = "Rect";
@@ -5591,7 +5591,7 @@ class Gt extends w {
   _sceneFunc(t) {
     const e = this._getPoints(), i = this.radius(), s = this.sides(), n = this.cornerRadius();
     if (t.beginPath(), n)
-      C.drawRoundedPolygonPath(t, e, s, i, n);
+      S.drawRoundedPolygonPath(t, e, s, i, n);
     else {
       t.moveTo(e[0].x, e[0].y);
       for (let r = 1; r < e.length; r++)
@@ -5773,7 +5773,7 @@ function Mt(a) {
     return t;
   }, []);
 }
-const jt = "auto", qr = "center", nn = "inherit", re = "justify", Jr = "Change.konva", Qr = "2d", is = "-", rn = "left", ta = "text", ea = "Text", ia = "top", sa = "bottom", ss = "middle", an = "normal", na = "px ", De = " ", ra = "right", ns = "rtl", aa = "word", oa = "char", rs = "none", ii = "…", on = [
+const jt = "auto", Jr = "center", an = "inherit", re = "justify", Qr = "Change.konva", ta = "2d", is = "-", on = "left", ea = "text", ia = "Text", sa = "top", na = "bottom", ss = "middle", ln = "normal", ra = "px ", De = " ", aa = "right", ns = "rtl", oa = "word", la = "char", rs = "none", ii = "…", hn = [
   "direction",
   "fontFamily",
   "fontSize",
@@ -5789,8 +5789,8 @@ const jt = "auto", qr = "center", nn = "inherit", re = "justify", Jr = "Change.k
   "wrap",
   "ellipsis",
   "letterSpacing"
-], la = on.length;
-function ha(a) {
+], ha = hn.length;
+function ca(a) {
   return a.split(",").map((t) => {
     t = t.trim();
     const e = t.indexOf(" ") >= 0, i = t.indexOf('"') >= 0 || t.indexOf("'") >= 0;
@@ -5799,22 +5799,22 @@ function ha(a) {
 }
 let Re;
 function si() {
-  return Re || (Re = C.createCanvasElement().getContext(Qr), Re);
+  return Re || (Re = S.createCanvasElement().getContext(ta), Re);
 }
-function ca(a) {
+function da(a) {
   a.fillText(this._partialText, this._partialTextX, this._partialTextY);
 }
-function da(a) {
+function ua(a) {
   a.setAttr("miterLimit", 2), a.strokeText(this._partialText, this._partialTextX, this._partialTextY);
 }
-function ua(a) {
+function fa(a) {
   return a = a || {}, !a.fillLinearGradientColorStops && !a.fillRadialGradientColorStops && !a.fillPatternImage && (a.fill = a.fill || "black"), a;
 }
 class et extends w {
   constructor(t) {
-    super(ua(t)), this._partialTextX = 0, this._partialTextY = 0;
-    for (let e = 0; e < la; e++)
-      this.on(on[e] + Jr, this._setTextData);
+    super(fa(t)), this._partialTextX = 0, this._partialTextY = 0;
+    for (let e = 0; e < ha; e++)
+      this.on(hn[e] + Qr, this._setTextData);
     this._setTextData();
   }
   _sceneFunc(t) {
@@ -5822,8 +5822,8 @@ class et extends w {
     const s = this.textArr, n = s.length;
     if (!this.text())
       return;
-    let r = this.padding(), o = this.fontSize(), l = this.lineHeight() * o, h = this.verticalAlign(), c = this.direction(), d = 0, u = this.align(), p = this.getWidth(), g = this.letterSpacing(), y = this.charRenderFunc(), T = this.fill(), S = this.textDecoration(), v = this.underlineOffset(), b = S.indexOf("underline") !== -1, k = S.indexOf("line-through") !== -1, M;
-    c = c === nn ? t.direction : c;
+    let r = this.padding(), o = this.fontSize(), l = this.lineHeight() * o, h = this.verticalAlign(), c = this.direction(), d = 0, u = this.align(), p = this.getWidth(), g = this.letterSpacing(), y = this.charRenderFunc(), T = this.fill(), C = this.textDecoration(), v = this.underlineOffset(), b = C.indexOf("underline") !== -1, k = C.indexOf("line-through") !== -1, M;
+    c = c === an ? t.direction : c;
     let _ = l / 2, R = ss;
     if (!E.legacyTextRendering) {
       const A = this.measureSize("M");
@@ -5831,10 +5831,10 @@ class et extends w {
       const I = (e = A.fontBoundingBoxAscent) !== null && e !== void 0 ? e : A.actualBoundingBoxAscent, D = (i = A.fontBoundingBoxDescent) !== null && i !== void 0 ? i : A.actualBoundingBoxDescent;
       _ = (I - D) / 2 + l / 2;
     }
-    for (c === ns && t.setAttr("direction", c), t.setAttr("font", this._getContextFont()), t.setAttr("textBaseline", R), t.setAttr("textAlign", rn), h === ss ? d = (this.getHeight() - n * l - r * 2) / 2 : h === sa && (d = this.getHeight() - n * l - r * 2), t.translate(r, d + r), M = 0; M < n; M++) {
+    for (c === ns && t.setAttr("direction", c), t.setAttr("font", this._getContextFont()), t.setAttr("textBaseline", R), t.setAttr("textAlign", on), h === ss ? d = (this.getHeight() - n * l - r * 2) / 2 : h === na && (d = this.getHeight() - n * l - r * 2), t.translate(r, d + r), M = 0; M < n; M++) {
       let A = 0, I = 0;
       const D = s[M], N = D.text, G = D.width, W = D.lastInParagraph;
-      if (t.save(), u === ra ? A += p - G - r * 2 : u === qr && (A += (p - G - r * 2) / 2), b) {
+      if (t.save(), u === aa ? A += p - G - r * 2 : u === Jr && (A += (p - G - r * 2) / 2), b) {
         t.save(), t.beginPath();
         const H = v ?? (E.legacyTextRendering ? Math.round(o / 2) : Math.round(o / 4)), L = A, j = _ + I + H;
         t.moveTo(L, j);
@@ -5884,8 +5884,8 @@ class et extends w {
     t.beginPath(), t.rect(0, 0, e, i), t.closePath(), t.fillStrokeShape(this);
   }
   setText(t) {
-    const e = C._isString(t) ? t : t == null ? "" : t + "";
-    return this._setAttr(ta, e), this;
+    const e = S._isString(t) ? t : t == null ? "" : t + "";
+    return this._setAttr(ea, e), this;
   }
   getWidth() {
     return this.attrs.width === jt || this.attrs.width === void 0 ? this.getTextWidth() + this.padding() * 2 : this.attrs.width;
@@ -5897,7 +5897,7 @@ class et extends w {
     return this.textWidth;
   }
   getTextHeight() {
-    return C.warn("text.getTextHeight() method is deprecated. Use text.height() - for full height and text.fontSize() - for one line height."), this.textHeight;
+    return S.warn("text.getTextHeight() method is deprecated. Use text.height() - for full height and text.fontSize() - for one line height."), this.textHeight;
   }
   measureSize(t) {
     var e, i, s, n, r, o, l, h, c, d, u;
@@ -5921,7 +5921,7 @@ class et extends w {
     };
   }
   _getContextFont() {
-    return this.fontStyle() + De + this.fontVariant() + De + (this.fontSize() + na) + ha(this.fontFamily());
+    return this.fontStyle() + De + this.fontVariant() + De + (this.fontSize() + ra) + ca(this.fontFamily());
   }
   _addTextLine(t) {
     this.align() === re && (t = t.trim());
@@ -5938,9 +5938,9 @@ class et extends w {
   }
   _setTextData() {
     let t = this.text().split(`
-`), e = +this.fontSize(), i = 0, s = this.lineHeight() * e, n = this.attrs.width, r = this.attrs.height, o = n !== jt && n !== void 0, l = r !== jt && r !== void 0, h = this.padding(), c = n - h * 2, d = r - h * 2, u = 0, p = this.wrap(), g = p !== rs, y = p !== oa && g, T = this.ellipsis();
+`), e = +this.fontSize(), i = 0, s = this.lineHeight() * e, n = this.attrs.width, r = this.attrs.height, o = n !== jt && n !== void 0, l = r !== jt && r !== void 0, h = this.padding(), c = n - h * 2, d = r - h * 2, u = 0, p = this.wrap(), g = p !== rs, y = p !== la && g, T = this.ellipsis();
     this.textArr = [], si().font = this._getContextFont();
-    const S = T ? this._getTextWidth(ii) : 0;
+    const C = T ? this._getTextWidth(ii) : 0;
     for (let v = 0, b = t.length; v < b; ++v) {
       let k = t[v], M = this._getTextWidth(k);
       if (o && M > c)
@@ -5948,7 +5948,7 @@ class et extends w {
           let _ = 0, R = Mt(k).length, A = "", I = 0;
           for (; _ < R; ) {
             const D = _ + R >>> 1, N = Mt(k), G = N.slice(0, D + 1).join(""), W = this._getTextWidth(G);
-            (T && l && u + s > d ? W + S : W) <= c ? (_ = D + 1, A = G, I = W) : R = D;
+            (T && l && u + s > d ? W + C : W) <= c ? (_ = D + 1, A = G, I = W) : R = D;
           }
           if (A) {
             if (y) {
@@ -5996,9 +5996,9 @@ class et extends w {
     return t && e ? !0 : super._useBufferCanvas();
   }
 }
-et.prototype._fillFunc = ca;
-et.prototype._strokeFunc = da;
-et.prototype.className = ea;
+et.prototype._fillFunc = da;
+et.prototype._strokeFunc = ua;
+et.prototype.className = ia;
 et.prototype._attrsAffectingSize = [
   "text",
   "fontSize",
@@ -6010,32 +6010,32 @@ et.prototype._attrsAffectingSize = [
 st(et);
 m.overWriteSetter(et, "width", Ei());
 m.overWriteSetter(et, "height", Ei());
-m.addGetterSetter(et, "direction", nn);
+m.addGetterSetter(et, "direction", an);
 m.addGetterSetter(et, "fontFamily", "Arial");
 m.addGetterSetter(et, "fontSize", 12, x());
-m.addGetterSetter(et, "fontStyle", an);
-m.addGetterSetter(et, "fontVariant", an);
+m.addGetterSetter(et, "fontStyle", ln);
+m.addGetterSetter(et, "fontVariant", ln);
 m.addGetterSetter(et, "padding", 0, x());
-m.addGetterSetter(et, "align", rn);
-m.addGetterSetter(et, "verticalAlign", ia);
+m.addGetterSetter(et, "align", on);
+m.addGetterSetter(et, "verticalAlign", sa);
 m.addGetterSetter(et, "lineHeight", 1, x());
-m.addGetterSetter(et, "wrap", aa);
+m.addGetterSetter(et, "wrap", oa);
 m.addGetterSetter(et, "ellipsis", !1, pt());
 m.addGetterSetter(et, "letterSpacing", 0, x());
 m.addGetterSetter(et, "text", "", Wt());
 m.addGetterSetter(et, "textDecoration", "");
 m.addGetterSetter(et, "underlineOffset", void 0, x());
 m.addGetterSetter(et, "charRenderFunc", void 0);
-const fa = "", ln = "normal";
-function hn(a) {
+const ga = "", cn = "normal";
+function dn(a) {
   a.fillText(this.partialText, 0, 0);
 }
-function cn(a) {
+function un(a) {
   a.strokeText(this.partialText, 0, 0);
 }
 class rt extends w {
   constructor(t) {
-    super(t), this.dummyCanvas = C.createCanvasElement(), this.dataArray = [], this._readDataAttribute(), this.on("dataChange.konva", function() {
+    super(t), this.dummyCanvas = S.createCanvasElement(), this.dataArray = [], this._readDataAttribute(), this.on("dataChange.konva", function() {
       this._readDataAttribute(), this._setTextData();
     }), this.on("textChange.konva alignChange.konva letterSpacingChange.konva kerningFuncChange.konva fontSizeChange.konva fontFamilyChange.konva", this._setTextData), this._setTextData();
   }
@@ -6088,7 +6088,7 @@ class rt extends w {
     return this.textWidth;
   }
   getTextHeight() {
-    return C.warn("text.getTextHeight() method is deprecated. Use text.height() - for full height and text.fontSize() - for one line height."), this.textHeight;
+    return S.warn("text.getTextHeight() method is deprecated. Use text.height() - for full height and text.fontSize() - for one line height."), this.textHeight;
   }
   setText(t) {
     return et.prototype.setText.call(this, t);
@@ -6134,15 +6134,15 @@ class rt extends w {
       if (!y)
         return;
       const T = tt.getLineLength(u.x, u.y, y.x, y.y);
-      let S = 0;
+      let C = 0;
       if (o)
         try {
-          S = o(e[d - 1].char, p) * this.fontSize();
+          C = o(e[d - 1].char, p) * this.fontSize();
         } catch {
-          S = 0;
+          C = 0;
         }
-      u.x += S, y.x += S, this.textWidth += S;
-      const v = tt.getPointOnLine(S + T / 2, u.x, u.y, y.x, y.y), b = Math.atan2(y.y - u.y, y.x - u.x);
+      u.x += C, y.x += C, this.textWidth += C;
+      const v = tt.getPointOnLine(C + T / 2, u.x, u.y, y.x, y.y), b = Math.atan2(y.y - u.y, y.x - u.x);
       this.glyphInfo.push({
         transposeX: v.x,
         transposeY: v.y,
@@ -6178,28 +6178,28 @@ class rt extends w {
     };
   }
   destroy() {
-    return C.releaseCanvas(this.dummyCanvas), super.destroy();
+    return S.releaseCanvas(this.dummyCanvas), super.destroy();
   }
 }
-rt.prototype._fillFunc = hn;
-rt.prototype._strokeFunc = cn;
-rt.prototype._fillFuncHit = hn;
-rt.prototype._strokeFuncHit = cn;
+rt.prototype._fillFunc = dn;
+rt.prototype._strokeFunc = un;
+rt.prototype._fillFuncHit = dn;
+rt.prototype._strokeFuncHit = un;
 rt.prototype.className = "TextPath";
 rt.prototype._attrsAffectingSize = ["text", "fontSize", "data"];
 st(rt);
 m.addGetterSetter(rt, "data");
 m.addGetterSetter(rt, "fontFamily", "Arial");
 m.addGetterSetter(rt, "fontSize", 12, x());
-m.addGetterSetter(rt, "fontStyle", ln);
+m.addGetterSetter(rt, "fontStyle", cn);
 m.addGetterSetter(rt, "align", "left");
 m.addGetterSetter(rt, "letterSpacing", 0, x());
 m.addGetterSetter(rt, "textBaseline", "middle");
-m.addGetterSetter(rt, "fontVariant", ln);
-m.addGetterSetter(rt, "text", fa);
+m.addGetterSetter(rt, "fontVariant", cn);
+m.addGetterSetter(rt, "text", ga);
 m.addGetterSetter(rt, "textDecoration", "");
 m.addGetterSetter(rt, "kerningFunc", void 0);
-const dn = "tr-konva", ga = [
+const fn = "tr-konva", pa = [
   "resizeEnabledChange",
   "rotateAnchorOffsetChange",
   "rotateAnchorAngleChange",
@@ -6216,7 +6216,7 @@ const dn = "tr-konva", ga = [
   "anchorCornerRadiusChange",
   "ignoreStrokeChange",
   "anchorStyleFuncChange"
-].map((a) => a + `.${dn}`).join(" "), as = "nodesRect", pa = [
+].map((a) => a + `.${fn}`).join(" "), as = "nodesRect", ma = [
   "widthChange",
   "heightChange",
   "scaleXChange",
@@ -6229,7 +6229,7 @@ const dn = "tr-konva", ga = [
   "transformsEnabledChange",
   "strokeWidthChange",
   "draggableChange"
-], ma = {
+], ya = {
   "top-left": -45,
   "top-center": 0,
   "top-right": 45,
@@ -6238,13 +6238,13 @@ const dn = "tr-konva", ga = [
   "bottom-left": -135,
   "bottom-center": 180,
   "bottom-right": 135
-}, ya = "ontouchstart" in E._global;
+}, Sa = "ontouchstart" in E._global;
 function Ca(a, t, e) {
   if (a === "rotater")
     return e;
-  t += C.degToRad(ma[a] || 0);
-  const i = (C.radToDeg(t) % 360 + 360) % 360;
-  return C._inRange(i, 315 + 22.5, 360) || C._inRange(i, 0, 22.5) ? "ns-resize" : C._inRange(i, 45 - 22.5, 45 + 22.5) ? "nesw-resize" : C._inRange(i, 90 - 22.5, 90 + 22.5) ? "ew-resize" : C._inRange(i, 135 - 22.5, 135 + 22.5) ? "nwse-resize" : C._inRange(i, 180 - 22.5, 180 + 22.5) ? "ns-resize" : C._inRange(i, 225 - 22.5, 225 + 22.5) ? "nesw-resize" : C._inRange(i, 270 - 22.5, 270 + 22.5) ? "ew-resize" : C._inRange(i, 315 - 22.5, 315 + 22.5) ? "nwse-resize" : (C.error("Transformer has unknown angle for cursor detection: " + i), "pointer");
+  t += S.degToRad(ya[a] || 0);
+  const i = (S.radToDeg(t) % 360 + 360) % 360;
+  return S._inRange(i, 315 + 22.5, 360) || S._inRange(i, 0, 22.5) ? "ns-resize" : S._inRange(i, 45 - 22.5, 45 + 22.5) ? "nesw-resize" : S._inRange(i, 90 - 22.5, 90 + 22.5) ? "ew-resize" : S._inRange(i, 135 - 22.5, 135 + 22.5) ? "nwse-resize" : S._inRange(i, 180 - 22.5, 180 + 22.5) ? "ns-resize" : S._inRange(i, 225 - 22.5, 225 + 22.5) ? "nesw-resize" : S._inRange(i, 270 - 22.5, 270 + 22.5) ? "ew-resize" : S._inRange(i, 315 - 22.5, 315 + 22.5) ? "nwse-resize" : (S.error("Transformer has unknown angle for cursor detection: " + i), "pointer");
 }
 const Ue = [
   "top-left",
@@ -6256,13 +6256,13 @@ const Ue = [
   "bottom-center",
   "bottom-right"
 ];
-function Sa(a) {
+function Ta(a) {
   return {
     x: a.x + a.width / 2 * Math.cos(a.rotation) + a.height / 2 * Math.sin(-a.rotation),
     y: a.y + a.height / 2 * Math.cos(a.rotation) + a.width / 2 * Math.sin(a.rotation)
   };
 }
-function un(a, t, e) {
+function gn(a, t, e) {
   const i = e.x + (a.x - e.x) * Math.cos(t) - (a.y - e.y) * Math.sin(t), s = e.y + (a.x - e.x) * Math.sin(t) + (a.y - e.y) * Math.cos(t);
   return {
     ...a,
@@ -6271,11 +6271,11 @@ function un(a, t, e) {
     y: s
   };
 }
-function Ta(a, t) {
-  const e = Sa(a);
-  return un(a, t, e);
+function va(a, t) {
+  const e = Ta(a);
+  return gn(a, t, e);
 }
-function va(a, t, e) {
+function ba(a, t, e) {
   let i = t;
   for (let s = 0; s < a.length; s++) {
     const n = E.getAngle(a[s]), r = Math.abs(n - t) % (Math.PI * 2);
@@ -6286,23 +6286,23 @@ function va(a, t, e) {
 let bi = 0;
 class Y extends Qt {
   constructor(t) {
-    super(t), this._movingAnchorName = null, this._transforming = !1, this._createElements(), this._handleMouseMove = this._handleMouseMove.bind(this), this._handleMouseUp = this._handleMouseUp.bind(this), this.update = this.update.bind(this), this.on(ga, this.update), this.getNode() && this.update();
+    super(t), this._movingAnchorName = null, this._transforming = !1, this._createElements(), this._handleMouseMove = this._handleMouseMove.bind(this), this._handleMouseUp = this._handleMouseUp.bind(this), this.update = this.update.bind(this), this.on(pa, this.update), this.getNode() && this.update();
   }
   attachTo(t) {
     return this.setNode(t), this;
   }
   setNode(t) {
-    return C.warn("tr.setNode(shape), tr.node(shape) and tr.attachTo(shape) methods are deprecated. Please use tr.nodes(nodesArray) instead."), this.setNodes([t]);
+    return S.warn("tr.setNode(shape), tr.node(shape) and tr.attachTo(shape) methods are deprecated. Please use tr.nodes(nodesArray) instead."), this.setNodes([t]);
   }
   getNode() {
     return this._nodes && this._nodes[0];
   }
   _getEventNamespace() {
-    return dn + this._id;
+    return fn + this._id;
   }
   setNodes(t = []) {
     this._nodes && this._nodes.length && this.detach();
-    const e = t.filter((s) => s.isAncestorOf(this) ? (C.error("Konva.Transformer cannot be an a child of the node you are trying to attach"), !1) : !0);
+    const e = t.filter((s) => s.isAncestorOf(this) ? (S.error("Konva.Transformer cannot be an a child of the node you are trying to attach"), !1) : !0);
     return this._nodes = t = e, t.length === 1 && this.useSingleNodeRotation() ? this.rotation(t[0].getAbsoluteRotation()) : this.rotation(0), this._nodes.forEach((s) => {
       const n = () => {
         this.nodes().length === 1 && this.useSingleNodeRotation() && this.rotation(this.nodes()[0].getAbsoluteRotation()), this._resetTransformCache(), !this._transforming && !this.isDragging() && this.update();
@@ -6311,7 +6311,7 @@ class Y extends Qt {
         const r = s._attrsAffectingSize.map((o) => o + "Change." + this._getEventNamespace()).join(" ");
         s.on(r, n);
       }
-      s.on(pa.map((r) => r + `.${this._getEventNamespace()}`).join(" "), n), s.on(`absoluteTransformChange.${this._getEventNamespace()}`, n), this._proxyDrag(s);
+      s.on(ma.map((r) => r + `.${this._getEventNamespace()}`).join(" "), n), s.on(`absoluteTransformChange.${this._getEventNamespace()}`, n), this._proxyDrag(s);
     }), this._resetTransformCache(), !!this.findOne(".top-left") && this.update(), this;
   }
   _proxyDrag(t) {
@@ -6362,7 +6362,7 @@ class Y extends Qt {
       height: s.height * n.y,
       rotation: h
     };
-    return un(c, -E.getAngle(e), {
+    return gn(c, -E.getAngle(e), {
       x: 0,
       y: 0
     });
@@ -6434,7 +6434,7 @@ class Y extends Qt {
       name: t + " _anchor",
       dragDistance: 0,
       draggable: !0,
-      hitStrokeWidth: ya ? 10 : "auto"
+      hitStrokeWidth: Sa ? 10 : "auto"
     }), i = this;
     e.on("mousedown touchstart", function(s) {
       i._handleMouseDown(s);
@@ -6457,11 +6457,11 @@ class Y extends Qt {
       sceneFunc(e, i) {
         const s = i.getParent(), n = s.padding(), r = i.width(), o = i.height();
         if (e.beginPath(), e.rect(-n, -n, r + n * 2, o + n * 2), s.rotateEnabled() && s.rotateLineVisible()) {
-          const l = s.rotateAnchorAngle(), h = s.rotateAnchorOffset(), c = C.degToRad(l), d = Math.sin(c), u = -Math.cos(c), p = r / 2, g = o / 2;
+          const l = s.rotateAnchorAngle(), h = s.rotateAnchorOffset(), c = S.degToRad(l), d = Math.sin(c), u = -Math.cos(c), p = r / 2, g = o / 2;
           let y = 1 / 0;
           u < 0 ? y = Math.min(y, -g / u) : u > 0 && (y = Math.min(y, (o - g) / u)), d < 0 ? y = Math.min(y, -p / d) : d > 0 && (y = Math.min(y, (r - p) / d));
-          const T = p + d * y, S = g + u * y, v = C._sign(o), b = T + d * h * v, k = S + u * h * v;
-          e.moveTo(T, S), e.lineTo(b, k);
+          const T = p + d * y, C = g + u * y, v = S._sign(o), b = T + d * h * v, k = C + u * h * v;
+          e.moveTo(T, C), e.lineTo(b, k);
         }
         e.fillStrokeShape(i);
       },
@@ -6516,7 +6516,7 @@ class Y extends Qt {
       const b = E.getAngle(this.rotateAnchorAngle());
       let k = Math.atan2(-i, e) + Math.PI / 2 - b;
       v.height < 0 && (k -= Math.PI);
-      const _ = E.getAngle(this.rotation()) + k, R = E.getAngle(this.rotationSnapTolerance()), I = va(this.rotationSnaps(), _, R) - v.rotation, D = Ta(v, I);
+      const _ = E.getAngle(this.rotation()) + k, R = E.getAngle(this.rotationSnapTolerance()), I = ba(this.rotationSnaps(), _, R) - v.rotation, D = va(v, I);
       this._fitNodesInto(D, t);
       return;
     }
@@ -6601,12 +6601,12 @@ class Y extends Qt {
     }
     const y = this.findOne(".top-left").getAbsolutePosition();
     e = y.x, i = y.y;
-    const T = this.findOne(".bottom-right").x() - this.findOne(".top-left").x(), S = this.findOne(".bottom-right").y() - this.findOne(".top-left").y();
+    const T = this.findOne(".bottom-right").x() - this.findOne(".top-left").x(), C = this.findOne(".bottom-right").y() - this.findOne(".top-left").y();
     this._fitNodesInto({
       x: e,
       y: i,
       width: T,
-      height: S,
+      height: C,
       rotation: E.getAngle(this.rotation())
     }, t);
   }
@@ -6629,11 +6629,11 @@ class Y extends Qt {
   }
   _fitNodesInto(t, e) {
     const i = this._getNodeRect(), s = 1;
-    if (C._inRange(t.width, -this.padding() * 2 - s, s)) {
+    if (S._inRange(t.width, -this.padding() * 2 - s, s)) {
       this.update();
       return;
     }
-    if (C._inRange(t.height, -this.padding() * 2 - s, s)) {
+    if (S._inRange(t.height, -this.padding() * 2 - s, s)) {
       this.update();
       return;
     }
@@ -6666,7 +6666,7 @@ class Y extends Qt {
     }
     if (this.boundBoxFunc()) {
       const u = this.boundBoxFunc()(i, t);
-      u ? t = u : C.warn("boundBoxFunc returned falsy. You should return new bound rect from it!");
+      u ? t = u : S.warn("boundBoxFunc returned falsy. You should return new bound rect from it!");
     }
     const r = 1e7, o = new ct();
     o.translate(i.x, i.y), o.rotate(i.rotation), o.scale(i.width / r, i.height / r);
@@ -6681,9 +6681,9 @@ class Y extends Qt {
       y.translate(u.offsetX(), u.offsetY());
       const T = new ct();
       T.multiply(g.copy().invert()).multiply(d).multiply(g).multiply(y);
-      const S = T.decompose();
-      u.setAttrs(S), (p = u.getLayer()) === null || p === void 0 || p.batchDraw();
-    }), this.rotation(C._getRotation(t.rotation)), this._nodes.forEach((u) => {
+      const C = T.decompose();
+      u.setAttrs(C), (p = u.getLayer()) === null || p === void 0 || p.batchDraw();
+    }), this.rotation(S._getRotation(t.rotation)), this._nodes.forEach((u) => {
       this._fire("transform", { evt: e, target: u }), u._fire("transform", { evt: e, target: u });
     }), this._resetTransformCache(), this.update(), this.getLayer().batchDraw();
   }
@@ -6696,7 +6696,7 @@ class Y extends Qt {
   update() {
     var t;
     const e = this._getNodeRect();
-    this.rotation(C._getRotation(e.rotation));
+    this.rotation(S._getRotation(e.rotation));
     const i = e.width, s = e.height, n = this.enabledAnchors(), r = this.resizeEnabled(), o = this.padding(), l = this.anchorSize(), h = this.find("._anchor");
     h.forEach((_) => {
       _.setAttrs({
@@ -6754,10 +6754,10 @@ class Y extends Qt {
       offsetY: l / 2 - o,
       visible: r && n.indexOf("bottom-right") >= 0
     });
-    const c = this.rotateAnchorAngle(), d = this.rotateAnchorOffset(), u = C.degToRad(c), p = Math.sin(u), g = -Math.cos(u), y = i / 2, T = s / 2;
-    let S = 1 / 0;
-    g < 0 ? S = Math.min(S, -T / g) : g > 0 && (S = Math.min(S, (s - T) / g)), p < 0 ? S = Math.min(S, -y / p) : p > 0 && (S = Math.min(S, (i - y) / p));
-    const v = y + p * S, b = T + g * S, k = C._sign(s);
+    const c = this.rotateAnchorAngle(), d = this.rotateAnchorOffset(), u = S.degToRad(c), p = Math.sin(u), g = -Math.cos(u), y = i / 2, T = s / 2;
+    let C = 1 / 0;
+    g < 0 ? C = Math.min(C, -T / g) : g > 0 && (C = Math.min(C, (s - T) / g)), p < 0 ? C = Math.min(C, -y / p) : p > 0 && (C = Math.min(C, (i - y) / p));
+    const v = y + p * C, b = T + g * C, k = S._sign(s);
     this._batchChangeChild(".rotater", {
       x: v + p * d * k,
       y: b + g * d * k - o * g,
@@ -6802,14 +6802,14 @@ class Y extends Qt {
   }
 }
 Y.isTransforming = () => bi > 0;
-function ba(a) {
-  return a instanceof Array || C.warn("enabledAnchors value should be an array"), a instanceof Array && a.forEach(function(t) {
-    Ue.indexOf(t) === -1 && C.warn("Unknown anchor name: " + t + ". Available names are: " + Ue.join(", "));
+function ka(a) {
+  return a instanceof Array || S.warn("enabledAnchors value should be an array"), a instanceof Array && a.forEach(function(t) {
+    Ue.indexOf(t) === -1 && S.warn("Unknown anchor name: " + t + ". Available names are: " + Ue.join(", "));
   }), a || [];
 }
 Y.prototype.className = "Transformer";
 st(Y);
-m.addGetterSetter(Y, "enabledAnchors", Ue, ba);
+m.addGetterSetter(Y, "enabledAnchors", Ue, ka);
 m.addGetterSetter(Y, "flipEnabled", !0, pt());
 m.addGetterSetter(Y, "resizeEnabled", !0);
 m.addGetterSetter(Y, "anchorSize", 10, x());
@@ -6877,7 +6877,7 @@ m.backCompat(At, {
 function os() {
   this.r = 0, this.g = 0, this.b = 0, this.a = 0, this.next = null;
 }
-const ka = [
+const wa = [
   512,
   512,
   456,
@@ -7133,7 +7133,7 @@ const ka = [
   263,
   261,
   259
-], wa = [
+], _a = [
   9,
   11,
   12,
@@ -7390,60 +7390,60 @@ const ka = [
   24,
   24
 ];
-function _a(a, t) {
+function Pa(a, t) {
   const e = a.data, i = a.width, s = a.height;
-  let n, r, o, l, h, c, d, u, p, g, y, T, S, v, b, k, M, _, R, A;
-  const I = t + t + 1, D = i - 1, N = s - 1, G = t + 1, W = G * (G + 1) / 2, F = new os(), H = ka[t], L = wa[t];
+  let n, r, o, l, h, c, d, u, p, g, y, T, C, v, b, k, M, _, R, A;
+  const I = t + t + 1, D = i - 1, N = s - 1, G = t + 1, W = G * (G + 1) / 2, F = new os(), H = wa[t], L = _a[t];
   let j = null, B = F, U = null, q = null;
   for (let K = 1; K < I; K++)
     B = B.next = new os(), K === G && (j = B);
   B.next = F, o = r = 0;
   for (let K = 0; K < s; K++) {
-    T = S = v = b = l = h = c = d = 0, u = G * (k = e[r]), p = G * (M = e[r + 1]), g = G * (_ = e[r + 2]), y = G * (R = e[r + 3]), l += W * k, h += W * M, c += W * _, d += W * R, B = F;
+    T = C = v = b = l = h = c = d = 0, u = G * (k = e[r]), p = G * (M = e[r + 1]), g = G * (_ = e[r + 2]), y = G * (R = e[r + 3]), l += W * k, h += W * M, c += W * _, d += W * R, B = F;
     for (let nt = 0; nt < G; nt++)
       B.r = k, B.g = M, B.b = _, B.a = R, B = B.next;
     for (let nt = 1; nt < G; nt++)
-      n = r + ((D < nt ? D : nt) << 2), l += (B.r = k = e[n]) * (A = G - nt), h += (B.g = M = e[n + 1]) * A, c += (B.b = _ = e[n + 2]) * A, d += (B.a = R = e[n + 3]) * A, T += k, S += M, v += _, b += R, B = B.next;
+      n = r + ((D < nt ? D : nt) << 2), l += (B.r = k = e[n]) * (A = G - nt), h += (B.g = M = e[n + 1]) * A, c += (B.b = _ = e[n + 2]) * A, d += (B.a = R = e[n + 3]) * A, T += k, C += M, v += _, b += R, B = B.next;
     U = F, q = j;
     for (let nt = 0; nt < i; nt++)
-      e[r + 3] = R = d * H >> L, R !== 0 ? (R = 255 / R, e[r] = (l * H >> L) * R, e[r + 1] = (h * H >> L) * R, e[r + 2] = (c * H >> L) * R) : e[r] = e[r + 1] = e[r + 2] = 0, l -= u, h -= p, c -= g, d -= y, u -= U.r, p -= U.g, g -= U.b, y -= U.a, n = o + ((n = nt + t + 1) < D ? n : D) << 2, T += U.r = e[n], S += U.g = e[n + 1], v += U.b = e[n + 2], b += U.a = e[n + 3], l += T, h += S, c += v, d += b, U = U.next, u += k = q.r, p += M = q.g, g += _ = q.b, y += R = q.a, T -= k, S -= M, v -= _, b -= R, q = q.next, r += 4;
+      e[r + 3] = R = d * H >> L, R !== 0 ? (R = 255 / R, e[r] = (l * H >> L) * R, e[r + 1] = (h * H >> L) * R, e[r + 2] = (c * H >> L) * R) : e[r] = e[r + 1] = e[r + 2] = 0, l -= u, h -= p, c -= g, d -= y, u -= U.r, p -= U.g, g -= U.b, y -= U.a, n = o + ((n = nt + t + 1) < D ? n : D) << 2, T += U.r = e[n], C += U.g = e[n + 1], v += U.b = e[n + 2], b += U.a = e[n + 3], l += T, h += C, c += v, d += b, U = U.next, u += k = q.r, p += M = q.g, g += _ = q.b, y += R = q.a, T -= k, C -= M, v -= _, b -= R, q = q.next, r += 4;
     o += i;
   }
   for (let K = 0; K < i; K++) {
-    S = v = b = T = h = c = d = l = 0, r = K << 2, u = G * (k = e[r]), p = G * (M = e[r + 1]), g = G * (_ = e[r + 2]), y = G * (R = e[r + 3]), l += W * k, h += W * M, c += W * _, d += W * R, B = F;
+    C = v = b = T = h = c = d = l = 0, r = K << 2, u = G * (k = e[r]), p = G * (M = e[r + 1]), g = G * (_ = e[r + 2]), y = G * (R = e[r + 3]), l += W * k, h += W * M, c += W * _, d += W * R, B = F;
     for (let lt = 0; lt < G; lt++)
       B.r = k, B.g = M, B.b = _, B.a = R, B = B.next;
     let nt = i;
     for (let lt = 1; lt <= t; lt++)
-      r = nt + K << 2, l += (B.r = k = e[r]) * (A = G - lt), h += (B.g = M = e[r + 1]) * A, c += (B.b = _ = e[r + 2]) * A, d += (B.a = R = e[r + 3]) * A, T += k, S += M, v += _, b += R, B = B.next, lt < N && (nt += i);
+      r = nt + K << 2, l += (B.r = k = e[r]) * (A = G - lt), h += (B.g = M = e[r + 1]) * A, c += (B.b = _ = e[r + 2]) * A, d += (B.a = R = e[r + 3]) * A, T += k, C += M, v += _, b += R, B = B.next, lt < N && (nt += i);
     r = K, U = F, q = j;
     for (let lt = 0; lt < s; lt++)
-      n = r << 2, e[n + 3] = R = d * H >> L, R > 0 ? (R = 255 / R, e[n] = (l * H >> L) * R, e[n + 1] = (h * H >> L) * R, e[n + 2] = (c * H >> L) * R) : e[n] = e[n + 1] = e[n + 2] = 0, l -= u, h -= p, c -= g, d -= y, u -= U.r, p -= U.g, g -= U.b, y -= U.a, n = K + ((n = lt + G) < N ? n : N) * i << 2, l += T += U.r = e[n], h += S += U.g = e[n + 1], c += v += U.b = e[n + 2], d += b += U.a = e[n + 3], U = U.next, u += k = q.r, p += M = q.g, g += _ = q.b, y += R = q.a, T -= k, S -= M, v -= _, b -= R, q = q.next, r += i;
+      n = r << 2, e[n + 3] = R = d * H >> L, R > 0 ? (R = 255 / R, e[n] = (l * H >> L) * R, e[n + 1] = (h * H >> L) * R, e[n + 2] = (c * H >> L) * R) : e[n] = e[n + 1] = e[n + 2] = 0, l -= u, h -= p, c -= g, d -= y, u -= U.r, p -= U.g, g -= U.b, y -= U.a, n = K + ((n = lt + G) < N ? n : N) * i << 2, l += T += U.r = e[n], h += C += U.g = e[n + 1], c += v += U.b = e[n + 2], d += b += U.a = e[n + 3], U = U.next, u += k = q.r, p += M = q.g, g += _ = q.b, y += R = q.a, T -= k, C -= M, v -= _, b -= R, q = q.next, r += i;
   }
 }
-const Pa = function(t) {
+const xa = function(t) {
   const e = Math.round(this.blurRadius());
-  e > 0 && _a(t, e);
+  e > 0 && Pa(t, e);
 };
 m.addGetterSetter(P, "blurRadius", 0, x(), m.afterSetFilter);
-const xa = function(a) {
+const Aa = function(a) {
   const t = this.brightness() * 255, e = a.data, i = e.length;
   for (let s = 0; s < i; s += 4)
     e[s] += t, e[s + 1] += t, e[s + 2] += t;
 };
 m.addGetterSetter(P, "brightness", 0, x(), m.afterSetFilter);
-const Aa = function(a) {
+const Ea = function(a) {
   const t = this.brightness(), e = a.data, i = e.length;
   for (let s = 0; s < i; s += 4)
     e[s] = Math.min(255, e[s] * t), e[s + 1] = Math.min(255, e[s + 1] * t), e[s + 2] = Math.min(255, e[s + 2] * t);
-}, Ea = function(a) {
+}, Ia = function(a) {
   const t = Math.pow((this.contrast() + 100) / 100, 2), e = a.data, i = e.length;
   let s = 150, n = 150, r = 150;
   for (let o = 0; o < i; o += 4)
     s = e[o], n = e[o + 1], r = e[o + 2], s /= 255, s -= 0.5, s *= t, s += 0.5, s *= 255, n /= 255, n -= 0.5, n *= t, n += 0.5, n *= 255, r /= 255, r -= 0.5, r *= t, r += 0.5, r *= 255, s = s < 0 ? 0 : s > 255 ? 255 : s, n = n < 0 ? 0 : n > 255 ? 255 : n, r = r < 0 ? 0 : r > 255 ? 255 : r, e[o] = s, e[o + 1] = n, e[o + 2] = r;
 };
 m.addGetterSetter(P, "contrast", 0, x(), m.afterSetFilter);
-const Ia = function(a) {
+const Ma = function(a) {
   var t, e, i, s, n, r, o, l, h;
   const c = a.data, d = a.width, u = a.height, p = Math.min(1, Math.max(0, (e = (t = this.embossStrength) === null || t === void 0 ? void 0 : t.call(this)) !== null && e !== void 0 ? e : 0.5)), g = Math.min(1, Math.max(0, (s = (i = this.embossWhiteLevel) === null || i === void 0 ? void 0 : i.call(this)) !== null && s !== void 0 ? s : 0.5)), T = (o = {
     "top-left": 315,
@@ -7454,7 +7454,7 @@ const Ia = function(a) {
     bottom: 90,
     "bottom-left": 45,
     left: 0
-  }[(r = (n = this.embossDirection) === null || n === void 0 ? void 0 : n.call(this)) !== null && r !== void 0 ? r : "top-left"]) !== null && o !== void 0 ? o : 315, S = !!((h = (l = this.embossBlend) === null || l === void 0 ? void 0 : l.call(this)) !== null && h !== void 0 && h), v = p * 10, b = g * 255, k = T * Math.PI / 180, M = Math.cos(k), _ = Math.sin(k), R = 128 / 1020 * v, A = new Uint8ClampedArray(c), I = new Float32Array(d * u);
+  }[(r = (n = this.embossDirection) === null || n === void 0 ? void 0 : n.call(this)) !== null && r !== void 0 ? r : "top-left"]) !== null && o !== void 0 ? o : 315, C = !!((h = (l = this.embossBlend) === null || l === void 0 ? void 0 : l.call(this)) !== null && h !== void 0 && h), v = p * 10, b = g * 255, k = T * Math.PI / 180, M = Math.cos(k), _ = Math.sin(k), R = 128 / 1020 * v, A = new Uint8ClampedArray(c), I = new Float32Array(d * u);
   for (let F = 0, H = 0; H < c.length; H += 4, F++)
     I[F] = 0.2126 * A[H] + 0.7152 * A[H + 1] + 0.0722 * A[H + 2];
   const D = [-1, 0, 1, -2, 0, 2, -1, 0, 1], N = [-1, -2, -1, 0, 0, 0, 1, 2, 1], G = [-d - 1, -d, -d + 1, -1, 0, 1, d - 1, d, d + 1], W = (F) => F < 0 ? 0 : F > 255 ? 255 : F;
@@ -7464,7 +7464,7 @@ const Ia = function(a) {
       let j = 0, B = 0;
       j += I[L + G[0]] * D[0], B += I[L + G[0]] * N[0], j += I[L + G[1]] * D[1], B += I[L + G[1]] * N[1], j += I[L + G[2]] * D[2], B += I[L + G[2]] * N[2], j += I[L + G[3]] * D[3], B += I[L + G[3]] * N[3], j += I[L + G[5]] * D[5], B += I[L + G[5]] * N[5], j += I[L + G[6]] * D[6], B += I[L + G[6]] * N[6], j += I[L + G[7]] * D[7], B += I[L + G[7]] * N[7], j += I[L + G[8]] * D[8], B += I[L + G[8]] * N[8];
       const U = M * j + _ * B, q = W(b + U * R), K = L * 4;
-      if (S) {
+      if (C) {
         const nt = q - b;
         c[K] = W(A[K] + nt), c[K + 1] = W(A[K + 1] + nt), c[K + 2] = W(A[K + 2] + nt), c[K + 3] = A[K + 3];
       } else
@@ -7493,7 +7493,7 @@ function ni(a, t, e, i, s) {
   let o = (a - t) / n;
   return o = r * o + i, o;
 }
-const Ma = function(a) {
+const La = function(a) {
   const t = a.data, e = t.length;
   let i = t[0], s = i, n, r = t[1], o = r, l, h = t[2], c = h, d;
   const u = this.enhance();
@@ -7502,22 +7502,22 @@ const Ma = function(a) {
   for (let b = 0; b < e; b += 4)
     n = t[b + 0], n < i ? i = n : n > s && (s = n), l = t[b + 1], l < r ? r = l : l > o && (o = l), d = t[b + 2], d < h ? h = d : d > c && (c = d);
   s === i && (s = 255, i = 0), o === r && (o = 255, r = 0), c === h && (c = 255, h = 0);
-  let p, g, y, T, S, v;
+  let p, g, y, T, C, v;
   if (u > 0)
-    p = s + u * (255 - s), g = i - u * (i - 0), y = o + u * (255 - o), T = r - u * (r - 0), S = c + u * (255 - c), v = h - u * (h - 0);
+    p = s + u * (255 - s), g = i - u * (i - 0), y = o + u * (255 - o), T = r - u * (r - 0), C = c + u * (255 - c), v = h - u * (h - 0);
   else {
     const b = (s + i) * 0.5;
     p = s + u * (s - b), g = i + u * (i - b);
     const k = (o + r) * 0.5;
     y = o + u * (o - k), T = r + u * (r - k);
     const M = (c + h) * 0.5;
-    S = c + u * (c - M), v = h + u * (h - M);
+    C = c + u * (c - M), v = h + u * (h - M);
   }
   for (let b = 0; b < e; b += 4)
-    t[b + 0] = ni(t[b + 0], i, s, g, p), t[b + 1] = ni(t[b + 1], r, o, T, y), t[b + 2] = ni(t[b + 2], h, c, v, S);
+    t[b + 0] = ni(t[b + 0], i, s, g, p), t[b + 1] = ni(t[b + 1], r, o, T, y), t[b + 2] = ni(t[b + 2], h, c, v, C);
 };
 m.addGetterSetter(P, "enhance", 0, x(), m.afterSetFilter);
-const La = function(a) {
+const Da = function(a) {
   const t = a.data, e = t.length;
   for (let i = 0; i < e; i += 4) {
     const s = 0.34 * t[i] + 0.5 * t[i + 1] + 0.16 * t[i + 2];
@@ -7527,66 +7527,66 @@ const La = function(a) {
 m.addGetterSetter(P, "hue", 0, x(), m.afterSetFilter);
 m.addGetterSetter(P, "saturation", 0, x(), m.afterSetFilter);
 m.addGetterSetter(P, "luminance", 0, x(), m.afterSetFilter);
-const Da = function(a) {
-  const t = a.data, e = t.length, i = 1, s = Math.pow(2, this.saturation()), n = Math.abs(this.hue() + 360) % 360, r = this.luminance() * 127, o = i * s * Math.cos(n * Math.PI / 180), l = i * s * Math.sin(n * Math.PI / 180), h = 0.299 * i + 0.701 * o + 0.167 * l, c = 0.587 * i - 0.587 * o + 0.33 * l, d = 0.114 * i - 0.114 * o - 0.497 * l, u = 0.299 * i - 0.299 * o - 0.328 * l, p = 0.587 * i + 0.413 * o + 0.035 * l, g = 0.114 * i - 0.114 * o + 0.293 * l, y = 0.299 * i - 0.3 * o + 1.25 * l, T = 0.587 * i - 0.586 * o - 1.05 * l, S = 0.114 * i + 0.886 * o - 0.2 * l;
+const Ra = function(a) {
+  const t = a.data, e = t.length, i = 1, s = Math.pow(2, this.saturation()), n = Math.abs(this.hue() + 360) % 360, r = this.luminance() * 127, o = i * s * Math.cos(n * Math.PI / 180), l = i * s * Math.sin(n * Math.PI / 180), h = 0.299 * i + 0.701 * o + 0.167 * l, c = 0.587 * i - 0.587 * o + 0.33 * l, d = 0.114 * i - 0.114 * o - 0.497 * l, u = 0.299 * i - 0.299 * o - 0.328 * l, p = 0.587 * i + 0.413 * o + 0.035 * l, g = 0.114 * i - 0.114 * o + 0.293 * l, y = 0.299 * i - 0.3 * o + 1.25 * l, T = 0.587 * i - 0.586 * o - 1.05 * l, C = 0.114 * i + 0.886 * o - 0.2 * l;
   let v, b, k, M;
   for (let _ = 0; _ < e; _ += 4)
-    v = t[_ + 0], b = t[_ + 1], k = t[_ + 2], M = t[_ + 3], t[_ + 0] = h * v + c * b + d * k + r, t[_ + 1] = u * v + p * b + g * k + r, t[_ + 2] = y * v + T * b + S * k + r, t[_ + 3] = M;
-}, Ra = function(a) {
+    v = t[_ + 0], b = t[_ + 1], k = t[_ + 2], M = t[_ + 3], t[_ + 0] = h * v + c * b + d * k + r, t[_ + 1] = u * v + p * b + g * k + r, t[_ + 2] = y * v + T * b + C * k + r, t[_ + 3] = M;
+}, Oa = function(a) {
   const t = a.data, e = t.length, i = Math.pow(2, this.value()), s = Math.pow(2, this.saturation()), n = Math.abs(this.hue() + 360) % 360, r = i * s * Math.cos(n * Math.PI / 180), o = i * s * Math.sin(n * Math.PI / 180), l = 0.299 * i + 0.701 * r + 0.167 * o, h = 0.587 * i - 0.587 * r + 0.33 * o, c = 0.114 * i - 0.114 * r - 0.497 * o, d = 0.299 * i - 0.299 * r - 0.328 * o, u = 0.587 * i + 0.413 * r + 0.035 * o, p = 0.114 * i - 0.114 * r + 0.293 * o, g = 0.299 * i - 0.3 * r + 1.25 * o, y = 0.587 * i - 0.586 * r - 1.05 * o, T = 0.114 * i + 0.886 * r - 0.2 * o;
-  for (let S = 0; S < e; S += 4) {
-    const v = t[S + 0], b = t[S + 1], k = t[S + 2], M = t[S + 3];
-    t[S + 0] = l * v + h * b + c * k, t[S + 1] = d * v + u * b + p * k, t[S + 2] = g * v + y * b + T * k, t[S + 3] = M;
+  for (let C = 0; C < e; C += 4) {
+    const v = t[C + 0], b = t[C + 1], k = t[C + 2], M = t[C + 3];
+    t[C + 0] = l * v + h * b + c * k, t[C + 1] = d * v + u * b + p * k, t[C + 2] = g * v + y * b + T * k, t[C + 3] = M;
   }
 };
 m.addGetterSetter(P, "hue", 0, x(), m.afterSetFilter);
 m.addGetterSetter(P, "saturation", 0, x(), m.afterSetFilter);
 m.addGetterSetter(P, "value", 0, x(), m.afterSetFilter);
-const Oa = function(a) {
+const Ga = function(a) {
   const t = a.data, e = t.length;
   for (let i = 0; i < e; i += 4)
     t[i] = 255 - t[i], t[i + 1] = 255 - t[i + 1], t[i + 2] = 255 - t[i + 2];
-}, Ga = function(a, t, e) {
+}, Ba = function(a, t, e) {
   const i = a.data, s = t.data, n = a.width, r = a.height, o = e.polarCenterX || n / 2, l = e.polarCenterY || r / 2;
   let h = Math.sqrt(o * o + l * l), c = n - o, d = r - l;
   const u = Math.sqrt(c * c + d * d);
   h = u > h ? u : h;
   const p = r, g = n, y = 360 / g * Math.PI / 180;
   for (let T = 0; T < g; T += 1) {
-    const S = Math.sin(T * y), v = Math.cos(T * y);
+    const C = Math.sin(T * y), v = Math.cos(T * y);
     for (let b = 0; b < p; b += 1) {
-      c = Math.floor(o + h * b / p * v), d = Math.floor(l + h * b / p * S);
+      c = Math.floor(o + h * b / p * v), d = Math.floor(l + h * b / p * C);
       let k = (d * n + c) * 4;
       const M = i[k + 0], _ = i[k + 1], R = i[k + 2], A = i[k + 3];
       k = (T + b * n) * 4, s[k + 0] = M, s[k + 1] = _, s[k + 2] = R, s[k + 3] = A;
     }
   }
-}, Ba = function(a, t, e) {
+}, Ha = function(a, t, e) {
   const i = a.data, s = t.data, n = a.width, r = a.height, o = e.polarCenterX || n / 2, l = e.polarCenterY || r / 2;
   let h = Math.sqrt(o * o + l * l), c = n - o, d = r - l;
   const u = Math.sqrt(c * c + d * d);
   h = u > h ? u : h;
   const p = r, g = n, y = 0;
-  let T, S;
+  let T, C;
   for (c = 0; c < n; c += 1)
     for (d = 0; d < r; d += 1) {
       const v = c - o, b = d - l, k = Math.sqrt(v * v + b * b) * p / h;
       let M = (Math.atan2(b, v) * 180 / Math.PI + 360 + y) % 360;
-      M = M * g / 360, T = Math.floor(M), S = Math.floor(k);
-      let _ = (S * n + T) * 4;
+      M = M * g / 360, T = Math.floor(M), C = Math.floor(k);
+      let _ = (C * n + T) * 4;
       const R = i[_ + 0], A = i[_ + 1], I = i[_ + 2], D = i[_ + 3];
       _ = (d * n + c) * 4, s[_ + 0] = R, s[_ + 1] = A, s[_ + 2] = I, s[_ + 3] = D;
     }
-}, Ha = function(a) {
+}, za = function(a) {
   const t = a.width, e = a.height;
   let i, s, n, r, o, l, h, c, d, u, p = Math.round(this.kaleidoscopePower());
   const g = Math.round(this.kaleidoscopeAngle()), y = Math.floor(t * (g % 360) / 360);
   if (p < 1)
     return;
-  const T = C.createCanvasElement();
+  const T = S.createCanvasElement();
   T.width = t, T.height = e;
-  const S = T.getContext("2d").getImageData(0, 0, t, e);
-  C.releaseCanvas(T), Ga(a, S, {
+  const C = T.getContext("2d").getImageData(0, 0, t, e);
+  S.releaseCanvas(T), Ba(a, C, {
     polarCenterX: t / 2,
     polarCenterY: e / 2
   });
@@ -7597,14 +7597,14 @@ const Oa = function(a) {
   let b = v, k = 0, M = b, _ = 1;
   for (y + v > t && (k = b, M = 0, _ = -1), s = 0; s < e; s += 1)
     for (i = k; i !== M; i += _)
-      n = Math.round(i + y) % t, d = (t * s + n) * 4, o = S.data[d + 0], l = S.data[d + 1], h = S.data[d + 2], c = S.data[d + 3], u = (t * s + i) * 4, S.data[u + 0] = o, S.data[u + 1] = l, S.data[u + 2] = h, S.data[u + 3] = c;
+      n = Math.round(i + y) % t, d = (t * s + n) * 4, o = C.data[d + 0], l = C.data[d + 1], h = C.data[d + 2], c = C.data[d + 3], u = (t * s + i) * 4, C.data[u + 0] = o, C.data[u + 1] = l, C.data[u + 2] = h, C.data[u + 3] = c;
   for (s = 0; s < e; s += 1)
     for (b = Math.floor(v), r = 0; r < p; r += 1) {
       for (i = 0; i < b + 1; i += 1)
-        d = (t * s + i) * 4, o = S.data[d + 0], l = S.data[d + 1], h = S.data[d + 2], c = S.data[d + 3], u = (t * s + b * 2 - i - 1) * 4, S.data[u + 0] = o, S.data[u + 1] = l, S.data[u + 2] = h, S.data[u + 3] = c;
+        d = (t * s + i) * 4, o = C.data[d + 0], l = C.data[d + 1], h = C.data[d + 2], c = C.data[d + 3], u = (t * s + b * 2 - i - 1) * 4, C.data[u + 0] = o, C.data[u + 1] = l, C.data[u + 2] = h, C.data[u + 3] = c;
       b *= 2;
     }
-  Ba(S, a, {});
+  Ha(C, a, {});
 };
 m.addGetterSetter(P, "kaleidoscopePower", 2, x(), m.afterSetFilter);
 m.addGetterSetter(P, "kaleidoscopeAngle", 0, x(), m.afterSetFilter);
@@ -7616,16 +7616,16 @@ function Oe(a, t, e) {
 function ae(a, t) {
   return Math.sqrt(Math.pow(a[0] - t[0], 2) + Math.pow(a[1] - t[1], 2) + Math.pow(a[2] - t[2], 2));
 }
-function za(a) {
+function Na(a) {
   const t = [0, 0, 0];
   for (let e = 0; e < a.length; e++)
     t[0] += a[e][0], t[1] += a[e][1], t[2] += a[e][2];
   return t[0] /= a.length, t[1] /= a.length, t[2] /= a.length, t;
 }
-function Na(a, t) {
+function Fa(a, t) {
   const e = Oe(a, 0, 0), i = Oe(a, a.width - 1, 0), s = Oe(a, 0, a.height - 1), n = Oe(a, a.width - 1, a.height - 1), r = t || 10;
   if (ae(e, i) < r && ae(i, n) < r && ae(n, s) < r && ae(s, e) < r) {
-    const o = za([i, e, n, s]), l = [];
+    const o = Na([i, e, n, s]), l = [];
     for (let h = 0; h < a.width * a.height; h++) {
       const c = ae(o, [
         a.data[h * 4],
@@ -7637,11 +7637,11 @@ function Na(a, t) {
     return l;
   }
 }
-function Fa(a, t) {
+function Va(a, t) {
   for (let e = 0; e < a.width * a.height; e++)
     a.data[4 * e + 3] = t[e];
 }
-function Va(a, t, e) {
+function Wa(a, t, e) {
   const i = [1, 1, 1, 1, 0, 1, 1, 1, 1], s = Math.round(Math.sqrt(i.length)), n = Math.floor(s / 2), r = [];
   for (let o = 0; o < e; o++)
     for (let l = 0; l < t; l++) {
@@ -7659,7 +7659,7 @@ function Va(a, t, e) {
     }
   return r;
 }
-function Wa(a, t, e) {
+function Ya(a, t, e) {
   const i = [1, 1, 1, 1, 1, 1, 1, 1, 1], s = Math.round(Math.sqrt(i.length)), n = Math.floor(s / 2), r = [];
   for (let o = 0; o < e; o++)
     for (let l = 0; l < t; l++) {
@@ -7677,7 +7677,7 @@ function Wa(a, t, e) {
     }
   return r;
 }
-function Ya(a, t, e) {
+function Xa(a, t, e) {
   const i = [
     0.1111111111111111,
     0.1111111111111111,
@@ -7705,38 +7705,38 @@ function Ya(a, t, e) {
     }
   return r;
 }
-const Xa = function(a) {
+const Ua = function(a) {
   const t = this.threshold();
-  let e = Na(a, t);
-  return e && (e = Va(e, a.width, a.height), e = Wa(e, a.width, a.height), e = Ya(e, a.width, a.height), Fa(a, e)), a;
+  let e = Fa(a, t);
+  return e && (e = Wa(e, a.width, a.height), e = Ya(e, a.width, a.height), e = Xa(e, a.width, a.height), Va(a, e)), a;
 };
 m.addGetterSetter(P, "threshold", 0, x(), m.afterSetFilter);
-const Ua = function(a) {
+const $a = function(a) {
   const t = this.noise() * 255, e = a.data, i = e.length, s = t / 2;
   for (let n = 0; n < i; n += 4)
     e[n + 0] += s - 2 * s * Math.random(), e[n + 1] += s - 2 * s * Math.random(), e[n + 2] += s - 2 * s * Math.random();
 };
 m.addGetterSetter(P, "noise", 0.2, x(), m.afterSetFilter);
-const $a = function(a) {
+const Ka = function(a) {
   let t = Math.ceil(this.pixelSize()), e = a.width, i = a.height, s = Math.ceil(e / t), n = Math.ceil(i / t), r = a.data;
   if (t <= 0) {
-    C.error("pixelSize value can not be <= 0");
+    S.error("pixelSize value can not be <= 0");
     return;
   }
   for (let o = 0; o < s; o += 1)
     for (let l = 0; l < n; l += 1) {
       let h = 0, c = 0, d = 0, u = 0;
       const p = o * t, g = p + t, y = l * t, T = y + t;
-      let S = 0;
+      let C = 0;
       for (let v = p; v < g; v += 1)
         if (!(v >= e))
           for (let b = y; b < T; b += 1) {
             if (b >= i)
               continue;
             const k = (e * b + v) * 4;
-            h += r[k + 0], c += r[k + 1], d += r[k + 2], u += r[k + 3], S += 1;
+            h += r[k + 0], c += r[k + 1], d += r[k + 2], u += r[k + 3], C += 1;
           }
-      h = h / S, c = c / S, d = d / S, u = u / S;
+      h = h / C, c = c / C, d = d / C, u = u / C;
       for (let v = p; v < g; v += 1)
         if (!(v >= e))
           for (let b = y; b < T; b += 1) {
@@ -7748,13 +7748,13 @@ const $a = function(a) {
     }
 };
 m.addGetterSetter(P, "pixelSize", 8, x(), m.afterSetFilter);
-const Ka = function(a) {
+const ja = function(a) {
   const t = Math.round(this.levels() * 254) + 1, e = a.data, i = e.length, s = 255 / t;
   for (let n = 0; n < i; n += 1)
     e[n] = Math.floor(e[n] / s) * s;
 };
 m.addGetterSetter(P, "levels", 0.5, x(), m.afterSetFilter);
-const ja = function(a) {
+const Za = function(a) {
   const t = a.data, e = t.length, i = this.red(), s = this.green(), n = this.blue();
   for (let r = 0; r < e; r += 4) {
     const o = (0.34 * t[r] + 0.5 * t[r + 1] + 0.16 * t[r + 2]) / 255;
@@ -7767,8 +7767,8 @@ m.addGetterSetter(P, "red", 0, function(a) {
 m.addGetterSetter(P, "green", 0, function(a) {
   return this._filterUpToDate = !1, a > 255 ? 255 : a < 0 ? 0 : Math.round(a);
 });
-m.addGetterSetter(P, "blue", 0, Rs, m.afterSetFilter);
-const Za = function(a) {
+m.addGetterSetter(P, "blue", 0, Gs, m.afterSetFilter);
+const qa = function(a) {
   const t = a.data, e = t.length, i = this.red(), s = this.green(), n = this.blue(), r = this.alpha();
   for (let o = 0; o < e; o += 4) {
     const l = 1 - r;
@@ -7781,24 +7781,24 @@ m.addGetterSetter(P, "red", 0, function(a) {
 m.addGetterSetter(P, "green", 0, function(a) {
   return this._filterUpToDate = !1, a > 255 ? 255 : a < 0 ? 0 : Math.round(a);
 });
-m.addGetterSetter(P, "blue", 0, Rs, m.afterSetFilter);
+m.addGetterSetter(P, "blue", 0, Gs, m.afterSetFilter);
 m.addGetterSetter(P, "alpha", 1, function(a) {
   return this._filterUpToDate = !1, a > 1 ? 1 : a < 0 ? 0 : a;
 });
-const qa = function(a) {
+const Ja = function(a) {
   const t = a.data, e = t.length;
   for (let i = 0; i < e; i += 4) {
     const s = t[i + 0], n = t[i + 1], r = t[i + 2];
     t[i + 0] = Math.min(255, s * 0.393 + n * 0.769 + r * 0.189), t[i + 1] = Math.min(255, s * 0.349 + n * 0.686 + r * 0.168), t[i + 2] = Math.min(255, s * 0.272 + n * 0.534 + r * 0.131);
   }
-}, Ja = function(a) {
+}, Qa = function(a) {
   const e = a.data;
   for (let i = 0; i < e.length; i += 4) {
     const s = e[i], n = e[i + 1], r = e[i + 2];
     0.2126 * s + 0.7152 * n + 0.0722 * r >= 128 && (e[i] = 255 - s, e[i + 1] = 255 - n, e[i + 2] = 255 - r);
   }
   return a;
-}, Qa = function(a) {
+}, to = function(a) {
   const t = this.threshold() * 255, e = a.data, i = e.length;
   for (let s = 0; s < i; s += 1)
     e[s] = e[s] < t ? 0 : 255;
@@ -7824,26 +7824,26 @@ const X = Zi.Util._assign(Zi, {
   Transformer: Y,
   Wedge: At,
   Filters: {
-    Blur: Pa,
-    Brightness: Aa,
-    Brighten: xa,
-    Contrast: Ea,
-    Emboss: Ia,
-    Enhance: Ma,
-    Grayscale: La,
-    HSL: Da,
-    HSV: Ra,
-    Invert: Oa,
-    Kaleidoscope: Ha,
-    Mask: Xa,
-    Noise: Ua,
-    Pixelate: $a,
-    Posterize: Ka,
-    RGB: ja,
-    RGBA: Za,
-    Sepia: qa,
-    Solarize: Ja,
-    Threshold: Qa
+    Blur: xa,
+    Brightness: Ea,
+    Brighten: Aa,
+    Contrast: Ia,
+    Emboss: Ma,
+    Enhance: La,
+    Grayscale: Da,
+    HSL: Ra,
+    HSV: Oa,
+    Invert: Ga,
+    Kaleidoscope: za,
+    Mask: Ua,
+    Noise: $a,
+    Pixelate: Ka,
+    Posterize: ja,
+    RGB: Za,
+    RGBA: qa,
+    Sepia: Ja,
+    Solarize: Qa,
+    Threshold: to
   }
 }), ls = {
   debug: 10,
@@ -7855,13 +7855,13 @@ const X = Zi.Util._assign(Zi, {
   level: "warn",
   moduleLevels: {}
 }, hs = 400;
-function to(a, t) {
+function eo(a, t) {
   return a.moduleLevels[t] ?? a.level;
 }
 function zt(a, t, e) {
   if (!a.enabled)
     return !1;
-  const i = to(a, e);
+  const i = eo(a, e);
   return ls[t] >= ls[i];
 }
 function cs(a) {
@@ -7882,7 +7882,7 @@ function cs(a) {
     altKey: !!a.altKey
   };
 }
-function eo(a) {
+function io(a) {
   if (a === void 0)
     return;
   const t = cs(a);
@@ -7898,8 +7898,8 @@ function eo(a) {
   }
   return a;
 }
-function io(a, t, e, i) {
-  const s = eo(i);
+function so(a, t, e, i) {
+  const s = io(i);
   s === void 0 ? a(`${t} ${e}`) : a(`${t} ${e}`, s);
 }
 class O {
@@ -7969,14 +7969,14 @@ class O {
     const l = (o == null ? void 0 : o.suppressed) ?? 0, h = l > 0 ? `${i} (+${l} repeats)` : i;
     this.dedupeState.set(r, { lastPrintedAt: n, suppressed: 0 });
     const c = `[${t.toUpperCase()}] [${e}]`, d = this.resolveConsoleMethod(t);
-    io(d, c, h, s);
+    so(d, c, h, s);
   }
   static resolveConsoleMethod(t) {
     return t === "debug" ? console.log.bind(console) : t === "info" ? console.info.bind(console) : t === "warn" ? console.warn.bind(console) : console.error.bind(console);
   }
 }
 f(O, "config", { ...Ge }), f(O, "dedupeWindowMs", hs), f(O, "dedupeState", /* @__PURE__ */ new Map());
-class Ct {
+class St {
   static clearImageCache() {
     this.imageCache = {}, this.keyframeDimensionsCache = {}, this.keyframeDimensionsPromiseCache = {};
   }
@@ -8023,7 +8023,7 @@ class Ct {
         p.push(Math.round(y * (n - 1) / (d - 1)));
     const g = [];
     for (let y = 0; y < d; y++) {
-      const T = t[p[y]], S = await this.getSafeKeyframeDimensions(r, T), v = S.width / S.height;
+      const T = t[p[y]], C = await this.getSafeKeyframeDimensions(r, T), v = C.width / C.height;
       g.push({
         coverUrl: T,
         singleImageWidth: i * v,
@@ -8048,10 +8048,10 @@ class Ct {
         p.push(Math.round(y * (n - 1) / (d - 1)));
     const g = [];
     for (let y = 0; y < d; y++) {
-      const T = t[p[y]], S = this.getCachedKeyframeDimensions(r, T);
-      if (!S)
+      const T = t[p[y]], C = this.getCachedKeyframeDimensions(r, T);
+      if (!C)
         return null;
-      const v = S.width / S.height;
+      const v = C.width / C.height;
       g.push({
         coverUrl: T,
         singleImageWidth: i * v,
@@ -8089,7 +8089,7 @@ class Ct {
       });
       u.src || (u.src = n);
       for (let g = 0; g < c; g++) {
-        const y = g * d, T = l - y, S = i - o - y, v = Math.min(d, T, S);
+        const y = g * d, T = l - y, C = i - o - y, v = Math.min(d, T, C);
         if (v <= 0)
           continue;
         const b = new X.Image({
@@ -8171,12 +8171,12 @@ class Ct {
     }
   }
 }
-f(Ct, "MIN_IMAGE_DISPLAY_WIDTH", 24), f(Ct, "COVER_RENDER_VERSION_KEY", "_coverRenderVersion"), f(Ct, "MAX_CACHE_SIZE", 1e3), f(Ct, "DEFAULT_DIMENSIONS", { width: 160, height: 90 }), f(Ct, "keyframeDimensionsCache", {}), f(Ct, "keyframeDimensionsPromiseCache", {}), f(Ct, "imageCache", {});
-const at = 3, ds = 10, so = 8, no = 8, ro = 10, ri = 4, us = 14, ao = [4, 10, 14, 10, 4], fs = [3, 7, 11, 15, 11, 7, 3], Di = 28, oo = 14, fn = 8, lo = [4, 9, 14, 9, 4];
+f(St, "MIN_IMAGE_DISPLAY_WIDTH", 24), f(St, "COVER_RENDER_VERSION_KEY", "_coverRenderVersion"), f(St, "MAX_CACHE_SIZE", 1e3), f(St, "DEFAULT_DIMENSIONS", { width: 160, height: 90 }), f(St, "keyframeDimensionsCache", {}), f(St, "keyframeDimensionsPromiseCache", {}), f(St, "imageCache", {});
+const at = 3, ds = 10, no = 8, ro = 8, ao = 10, ri = 4, us = 14, pn = 10, oo = [4, 10, 14, 10, 4], fs = [3, 7, 11, 15, 11, 7, 3], Di = 28, lo = 14, mn = 8, ho = [4, 9, 14, 9, 4];
 function Tt(a, t, e, i, s = "#ffffff", n = "#000000", r = 1) {
   return new X.Rect({ x: a, y: t, width: e, height: i, fill: s, stroke: n, strokeWidth: r });
 }
-function gn(a, t, e, i = 12, s = "Arial", n = "#000000", r = "left", o = "top") {
+function yn(a, t, e, i = 12, s = "Arial", n = "#000000", r = "left", o = "top") {
   return new X.Text({ text: a, x: t, y: e, fontSize: i, fontFamily: s, fill: n, align: r, verticalAlign: o });
 }
 function _t(a = 0, t = 0) {
@@ -8189,11 +8189,11 @@ function Ri(a, t, e, i) {
   }
   a.add(new X.Rect({ x: 0, y: 0, width: at, height: e, name: "clip-resize-left" })), a.add(new X.Rect({ x: t - at, y: 0, width: at, height: e, name: "clip-resize-right" }));
 }
-function ho(a, t, e, i) {
+function co(a, t, e, i) {
   const s = a.findOne(".clip-resize-left"), n = a.findOne(".clip-resize-right");
   return !s || !n ? !1 : (s.x(0), s.y(0), s.width(at), s.height(e), n.x(t - at), n.y(0), n.width(at), n.height(e), !0);
 }
-function pn(a, t, e) {
+function Sn(a, t, e) {
   return e === "audio" ? {
     background: t ? a.clipSelectedBackground || a.audioClipBackground || a.clipBackground : a.audioClipBackground || a.clipBackground,
     label: t ? a.clipSelectedName || a.audioClipText || a.clipName : a.audioClipText || a.clipName,
@@ -8206,11 +8206,11 @@ function pn(a, t, e) {
     coverBackground: t ? a.clipSelectedCoverBackground || a.clipCoverBackground || "#FFF2A0" : a.clipCoverBackground || "#FFF2A0"
   };
 }
-function co(a, t, e, i) {
+function uo(a, t, e, i) {
   const s = Tt(0, 0, t, e, i.background, "transparent", 0);
   s.cornerRadius(Math.min(4, Math.floor(t / 2))), s.name("clip-background"), a.add(s), Ri(a, t, e, !0);
 }
-function uo(a, t, e) {
+function fo(a, t, e) {
   const i = Tt(0, 0, t.width, t.height, e.background, "transparent", 0);
   i.cornerRadius(4), i.name("clip-background"), a.add(i), Ri(a, t.width, t.height, !1);
   const s = 15, n = t.height - s - 4, r = t.width - at * 2, o = _t(at, 2);
@@ -8218,7 +8218,7 @@ function uo(a, t, e) {
   const l = Tt(0, 0, r, n, e.coverBackground, "transparent", 0);
   l.cornerRadius(2), l.name("clip-cover-background"), o.add(l);
   const h = _t(0, 0);
-  h.name("clip-covers-group"), o.add(h), Ct.renderClipCovers(
+  h.name("clip-covers-group"), o.add(h), St.renderClipCovers(
     h,
     t.thumbnails ?? [],
     r,
@@ -8226,24 +8226,24 @@ function uo(a, t, e) {
     t.videoSrc,
     t.deferCoverRender
   );
-  const c = r >= 120 ? Di + fn : 0, d = gn(
+  const c = r >= 120 ? Di + mn : 0, d = yn(
     `${t.clipName}  ${z.formatDuration(t.duration)}`,
     at,
     t.height - s,
-    10,
+    pn,
     "Arial",
     e.label,
     "left",
     "middle"
   );
-  d.ellipsis(!0), d.width(Math.max(0, r - c)), d.height(s), d.name("clip-label"), a.add(d), c > 0 && mn(a, t.width, t.height, e.label, t.hasSeparatedAudio);
+  d.ellipsis(!0), d.width(Math.max(0, r - c)), d.height(s), d.name("clip-label"), a.add(d), c > 0 && Cn(a, t.width, t.height, e.label, t.hasSeparatedAudio);
 }
-function fo(a, t, e) {
+function go(a, t, e) {
   const i = a.findOne(".clip-background"), s = a.findOne(".clip-cover-container"), n = a.findOne(".clip-cover-background"), r = a.findOne(".clip-covers-group"), o = a.findOne(".clip-label");
-  if (!i || !s || !n || !r || !o || (i.width(t.width), i.height(t.height), i.fill(e.background), i.stroke("transparent"), i.strokeWidth(0), i.cornerRadius(4), !ho(a, t.width, t.height)))
+  if (!i || !s || !n || !r || !o || (i.width(t.width), i.height(t.height), i.fill(e.background), i.stroke("transparent"), i.strokeWidth(0), i.cornerRadius(4), !co(a, t.width, t.height)))
     return !1;
   const l = 15, h = t.height - l - 4, c = t.width - at * 2;
-  s.x(at), s.y(2), s.clip({ x: 0, y: 0, width: c, height: h }), n.width(c), n.height(h), n.fill(e.coverBackground), n.cornerRadius(2), Ct.renderClipCovers(
+  s.x(at), s.y(2), s.clip({ x: 0, y: 0, width: c, height: h }), n.width(c), n.height(h), n.fill(e.coverBackground), n.cornerRadius(2), St.renderClipCovers(
     r,
     t.thumbnails ?? [],
     c,
@@ -8251,10 +8251,10 @@ function fo(a, t, e) {
     t.videoSrc,
     t.deferCoverRender
   );
-  const d = c >= 120 ? Di + fn : 0;
+  const d = c >= 120 ? Di + mn : 0;
   o.text(`${t.clipName}  ${z.formatDuration(t.duration)}`), o.x(at), o.y(t.height - l), o.fill(e.label), o.width(Math.max(0, c - d)), o.height(l), o.ellipsis(!0);
   const u = a.findOne(".video-audio-status");
-  return u == null || u.destroy(), d > 0 && mn(a, t.width, t.height, e.label, t.hasSeparatedAudio), !0;
+  return u == null || u.destroy(), d > 0 && Cn(a, t.width, t.height, e.label, t.hasSeparatedAudio), !0;
 }
 function ki(a, t, e, i, s, n, r) {
   return a.name(s), t.forEach((o, l) => {
@@ -8270,7 +8270,7 @@ function ki(a, t, e, i, s, n, r) {
     h.cornerRadius(1), h.name(`${s}-bar-${l}`), a.add(h);
   }), t.length * n + Math.max(0, t.length - 1) * r;
 }
-function mn(a, t, e, i, s) {
+function Cn(a, t, e, i, s) {
   const n = _t(
     Math.max(at, t - at - Di),
     Math.max(0, e - 15)
@@ -8291,16 +8291,16 @@ function mn(a, t, e, i, s) {
   const o = Tt(0, 5, 3, 3, i, "transparent", 0);
   o.cornerRadius(1.5), o.name("video-audio-status-active-left-dot"), r.add(o);
   const l = _t(5, 0);
-  ki(l, lo, oo, i, "video-audio-status-active-bars", 2, 2), r.add(l);
+  ki(l, ho, lo, i, "video-audio-status-active-bars", 2, 2), r.add(l);
   const h = Tt(25, 5, 3, 3, i, "transparent", 0);
   h.cornerRadius(1.5), h.name("video-audio-status-active-right-dot"), r.add(h), n.add(r), a.add(n);
 }
-function go(a, t, e) {
+function po(a, t, e) {
   const i = Tt(0, 0, t.width, t.height, e.background, "transparent", 0);
   i.cornerRadius(6), i.name("clip-background"), a.add(i), Ri(a, t.width, t.height, !1);
-  const s = at + ds, n = Math.max(0, t.width - at * 2 - ds * 2), r = so, o = _t(s, r), l = ki(o, ao, 14, e.accent, "audio-clip-icon", 2, 2);
+  const s = at + ds, n = Math.max(0, t.width - at * 2 - ds * 2), r = no, o = _t(s, r), l = ki(o, oo, 14, e.accent, "audio-clip-icon", 2, 2);
   a.add(o);
-  const h = s + l + ro, c = Math.max(0, s + n - h), d = 3 + ri, u = Math.min(fs.length, Math.floor((c + ri) / d));
+  const h = s + l + ao, c = Math.max(0, s + n - h), d = 3 + ri, u = Math.min(fs.length, Math.floor((c + ri) / d));
   if (u > 0) {
     const g = _t(h, r);
     ki(
@@ -8313,11 +8313,11 @@ function go(a, t, e) {
       ri
     ), a.add(g);
   }
-  const p = gn(
+  const p = yn(
     t.clipName,
     s,
-    t.height - no - us,
-    12,
+    t.height - ro - us,
+    pn,
     "Arial",
     e.label,
     "left",
@@ -8325,27 +8325,27 @@ function go(a, t, e) {
   );
   p.ellipsis(!0), p.width(n), p.height(us), p.name("clip-label"), a.add(p);
 }
-function yn(a, t) {
-  const e = t.width <= Xe, i = pn(t.theme, t.isSelected, t.clipType);
+function Tn(a, t) {
+  const e = t.width <= Xe, i = Sn(t.theme, t.isSelected, t.clipType);
   if (a.destroyChildren(), e) {
-    co(a, t.width, t.height, i);
+    uo(a, t.width, t.height, i);
     return;
   }
   if (t.clipType === "audio") {
-    go(a, t, i);
+    po(a, t, i);
     return;
   }
-  uo(a, t, i);
+  fo(a, t, i);
 }
-function po(a, t) {
+function mo(a, t) {
   if (t.width <= Xe || t.clipType !== "video")
     return !1;
-  const i = pn(t.theme, t.isSelected, t.clipType);
-  return fo(a, t, i);
+  const i = Sn(t.theme, t.isSelected, t.clipType);
+  return go(a, t, i);
 }
-function mo(a, t, e, i, s, n, r, o = !1, l, h, c = "video", d = !1, u = !1) {
+function yo(a, t, e, i, s, n, r, o = !1, l, h, c = "video", d = !1, u = !1) {
   const p = _t(a, t);
-  return p.clip({ x: 0, y: 0, width: e, height: i }), yn(p, {
+  return p.clip({ x: 0, y: 0, width: e, height: i }), Tn(p, {
     width: e,
     height: i,
     clipName: s,
@@ -8359,7 +8359,7 @@ function mo(a, t, e, i, s, n, r, o = !1, l, h, c = "video", d = !1, u = !1) {
     deferCoverRender: u
   }), p;
 }
-function yo(a, t, e, i, s, n, r = !1, o, l, h = "video", c = !1, d = !1) {
+function So(a, t, e, i, s, n, r = !1, o, l, h = "video", c = !1, d = !1) {
   a.clip({ x: 0, y: 0, width: t, height: e });
   const u = {
     width: t,
@@ -8374,7 +8374,7 @@ function yo(a, t, e, i, s, n, r = !1, o, l, h = "video", c = !1, d = !1) {
     hasSeparatedAudio: c,
     deferCoverRender: d
   };
-  po(a, u) || yn(a, u);
+  mo(a, u) || Tn(a, u);
 }
 function Co(a, t, e, i) {
   return new X.Rect({
@@ -8397,7 +8397,7 @@ function wi(a, t = "#000000", e = 1) {
     lineJoin: "round"
   });
 }
-function So(a, t, e, i = 12, s = "Arial", n = "#000000", r = "left", o = "top") {
+function To(a, t, e, i = 12, s = "Arial", n = "#000000", r = "left", o = "top") {
   return new X.Text({
     text: a,
     x: t,
@@ -8409,17 +8409,17 @@ function So(a, t, e, i = 12, s = "Arial", n = "#000000", r = "left", o = "top")
     verticalAlign: o
   });
 }
-function To(a = 0, t = 0) {
+function vo(a = 0, t = 0) {
   return new X.Group({ x: a, y: t });
 }
-function vo(a, t, e, i, s, n, r, o) {
+function bo(a, t, e, i, s, n, r, o) {
   const l = o || i, h = r === "major" ? l * 0.6 : l * 0.3, c = wi(
     [t, e, t, e + h],
     n.timeTick,
     r === "major" ? 1 : 0.5
   );
   if (c.name("time-tick-line"), a.add(c), r === "major") {
-    const d = e + h + 5, u = So(
+    const d = e + h + 5, u = To(
       z.formatTime(s),
       t,
       d,
@@ -8431,8 +8431,8 @@ function vo(a, t, e, i, s, n, r, o) {
     u.name("time-tick-text"), a.add(u);
   }
 }
-function bo(a, t, e, i, s, n) {
-  const r = To(t, e);
+function ko(a, t, e, i, s, n) {
+  const r = vo(t, e);
   for (let o = 0; o <= i; o += n)
     r.add(wi([o, 0, o, s], "#E0E0E0", 0.5));
   for (let o = 0; o <= s; o += n)
@@ -8529,25 +8529,25 @@ class it {
    * 绘制时间刻度
    */
   static drawTimeTick(t, e, i, s, n, r, o, l) {
-    vo(t, e, i, s, n, r, o, l);
+    bo(t, e, i, s, n, r, o, l);
   }
   /**
    * 绘制网格线
    */
   static drawGrid(t, e, i, s, n, r) {
-    bo(t, e, i, s, n, r);
+    ko(t, e, i, s, n, r);
   }
   /**
    * 清空图片缓存
    */
   static clearImageCache() {
-    Ct.clearImageCache();
+    St.clearImageCache();
   }
   /**
    * 创建片段组
    */
   static createClipGroup(t, e, i, s, n, r, o, l = !1, h, c, d = "video", u = !1, p = !1) {
-    return mo(
+    return yo(
       t,
       e,
       i,
@@ -8567,7 +8567,7 @@ class it {
    * 更新片段组
    */
   static updateClipGroup(t, e, i, s, n, r, o = !1, l, h, c = "video", d = !1, u = !1) {
-    yo(
+    So(
       t,
       e,
       i,
@@ -8610,7 +8610,7 @@ function we(a) {
 function _e(a) {
   typeof window < "u" && (window.removeEventListener("mousemove", a.onPointerMove), window.removeEventListener("mouseup", a.onPointerEnd), window.removeEventListener("blur", a.onWindowBlur || a.onPointerEnd)), typeof document < "u" && document.removeEventListener("visibilitychange", a.onVisibilityChange);
 }
-class Ll {
+class Dl {
   constructor(t, e, i, s, n, r) {
     f(this, "stage");
     f(this, "gridLayer");
@@ -8727,7 +8727,7 @@ class Ll {
     }
   }
   animateZoom(t, e) {
-    const i = this.config.zoom, s = En.DURATION, n = Date.now(), r = this.pixelToTime(e), o = () => {
+    const i = this.config.zoom, s = In.DURATION, n = Date.now(), r = this.pixelToTime(e), o = () => {
       const l = Date.now() - n, h = Math.min(l / s, 1), c = this.easeOutCubic(h), d = i + (t - i) * c, u = z.timeToPixels(r, d), p = Math.max(0, u - (e - this.leftPadding));
       if (this.scrollLeft = p, this.config.zoom = d, this.onZoomChange(d), this.onScrollChange(p), this.render(), h < 1)
         this.animationFrameId = requestAnimationFrame(o);
@@ -8822,10 +8822,10 @@ class Ll {
     let g = 0;
     const y = 20;
     for (const T of p) {
-      const S = this.timeToPixel(T.time);
-      S >= -y && S <= t + y && (it.drawTimeTick(
+      const C = this.timeToPixel(T.time);
+      C >= -y && C <= t + y && (it.drawTimeTick(
         this.gridLayer,
-        S,
+        C,
         0,
         this.timeScaleHeight,
         T.time,
@@ -8925,17 +8925,17 @@ const ge = 8;
 function ht(a, t, e) {
   return it.timeToPixels(a, t) - e + ot;
 }
-function St(a, t) {
+function Ct(a, t) {
   const e = it.timeToPixels(a, t);
   return a <= 1e3 || e <= Xe ? Xe : e;
 }
 function gs(a, t) {
-  const e = ht(a.startTime, a.zoom, a.scrollLeft), i = St(a.duration, a.zoom);
+  const e = ht(a.startTime, a.zoom, a.scrollLeft), i = Ct(a.duration, a.zoom);
   return e + i > 0 && e < t;
 }
-function ko(a) {
+function wo(a) {
   for (const t of a.clips) {
-    const e = ht(t.startTime, a.zoom, a.scrollLeft), i = St(t.duration, a.zoom), s = a.y >= a.trackY && a.y <= a.trackY + a.trackHeight;
+    const e = ht(t.startTime, a.zoom, a.scrollLeft), i = Ct(t.duration, a.zoom), s = a.y >= a.trackY && a.y <= a.trackY + a.trackHeight;
     if (a.x >= e && a.x <= e + ge && s || a.x >= e + i - ge && a.x <= e + i && s)
       return "ew-resize";
     if (a.x > e + ge && a.x < e + i - ge && s)
@@ -8948,7 +8948,7 @@ class ai {
     f(this, "clip");
     f(this, "onUpdate");
     f(this, "onSplit");
-    this.clip = Ds(
+    this.clip = Os(
       {
         ...t,
         endTime: z.calculateEndTime(t.startTime, t.duration)
@@ -8981,7 +8981,7 @@ class ai {
     }, this.onUpdate(this.clip);
   }
   isPointInResizeHandle(t, e, i, s, n, r) {
-    const o = ht(this.clip.startTime, i, r), l = St(this.clip.duration, i), h = ge;
+    const o = ht(this.clip.startTime, i, r), l = Ct(this.clip.duration, i), h = ge;
     return e < s || e > s + n ? (this.setResizeHandleState(!1, !1), !1) : t >= o && t <= o + h ? (this.setResizeHandleState(!0, !1), !0) : t >= o + l - h && t <= o + l ? (this.setResizeHandleState(!1, !0), !0) : (this.setResizeHandleState(!1, !1), !1);
   }
   startDrag(t) {
@@ -9035,7 +9035,7 @@ function Zt(a) {
 function ve(a) {
   return !a || a.kind === "idle" || a.kind === "boxSelecting" ? null : a.kind === "pressed" ? a.operation : a.kind === "draggingResizeLeft" ? "resize-left" : a.kind === "draggingResizeRight" ? "resize-right" : "move";
 }
-function wo(a) {
+function _o(a) {
   const t = ve(a);
   return t ? t === "move" ? "grabbing" : "ew-resize" : null;
 }
@@ -9111,9 +9111,9 @@ function Be(a, t) {
       }
     } : { state: a, effects: {} };
   if (t.type === "POINTER_MOVE") {
-    const i = Po(a.context, t, ve(a) || "move");
-    return a.kind === "pressed" ? xo(a.context, t.activationThreshold, t.clientX, t.clientY) ? {
-      state: _o(a.operation, i),
+    const i = xo(a.context, t, ve(a) || "move");
+    return a.kind === "pressed" ? Ao(a.context, t.activationThreshold, t.clientX, t.clientY) ? {
+      state: Po(a.operation, i),
       effects: {
         updatePreview: !0
       }
@@ -9150,7 +9150,7 @@ function Be(a, t) {
     }
   };
 }
-function _o(a, t) {
+function Po(a, t) {
   return a === "resize-left" ? {
     kind: "draggingResizeLeft",
     context: t
@@ -9162,7 +9162,7 @@ function _o(a, t) {
     context: t
   };
 }
-function Po(a, t, e) {
+function xo(a, t, e) {
   const i = e === "move";
   return {
     ...a,
@@ -9172,12 +9172,12 @@ function Po(a, t, e) {
     crossTrackDragOffsetY: i ? t.localY - a.pointerStartY : 0
   };
 }
-function xo(a, t, e, i) {
+function Ao(a, t, e, i) {
   const s = e - a.pointerStartClientX, n = i - a.pointerStartClientY;
   return Math.hypot(s, n) >= Math.max(0, t);
 }
 const yt = class yt {
-  constructor(t, e, i, s, n, r, o, l, h, c, d, u, p, g, y, T, S, v, b, k, M, _, R, A, I, D = yt.DEFAULT_DRAG_ACTIVATION_THRESHOLD, N = !1, G = yt.DEFAULT_CLIP_SNAP_THRESHOLD) {
+  constructor(t, e, i, s, n, r, o, l, h, c, d, u, p, g, y, T, C, v, b, k, M, _, R, A, I, D = yt.DEFAULT_DRAG_ACTIVATION_THRESHOLD, N = !1, G = yt.DEFAULT_CLIP_SNAP_THRESHOLD) {
     f(this, "layer");
     f(this, "trackGroup");
     f(this, "dragOverlayLayer", null);
@@ -9258,7 +9258,7 @@ const yt = class yt {
       }
       this.startEdgeAutoScroll();
     });
-    this.layer = t, this.config = e, this.theme = o, this.trackType = i, this.zoom = s, this.trackY = n, this.trackHeight = r, this.onClipUpdate = l, this.onClipAdd = h, this.onClipRemove = c, this.onClipSplit = d, this.onClipSelect = u, this.onTimeJump = p, this.onHorizontalDragAutoScroll = g, this.onClipOverlap = y, this.onClipCrossTrackPreview = T, this.onClipCrossTrack = S, this.onClearDropPreview = v, this.onClearSelection = b, this.onSnapGuideChange = k, this.onClipToggleSelection = M, this.onSetSingleSelection = _, this.getMultiDragClipIds = R, this.onMultiDragMove = A, this.onMultiDragInteractionEnd = I, this.dragActivationThreshold = Math.max(0, D), this.enableClipSnap = N, this.clipSnapThreshold = Math.max(0, G), this.trackGroup = it.createGroup(0, n), this.layer.add(this.trackGroup), this.initClips(), this.initEventListeners(), this.render();
+    this.layer = t, this.config = e, this.theme = o, this.trackType = i, this.zoom = s, this.trackY = n, this.trackHeight = r, this.onClipUpdate = l, this.onClipAdd = h, this.onClipRemove = c, this.onClipSplit = d, this.onClipSelect = u, this.onTimeJump = p, this.onHorizontalDragAutoScroll = g, this.onClipOverlap = y, this.onClipCrossTrackPreview = T, this.onClipCrossTrack = C, this.onClearDropPreview = v, this.onClearSelection = b, this.onSnapGuideChange = k, this.onClipToggleSelection = M, this.onSetSingleSelection = _, this.getMultiDragClipIds = R, this.onMultiDragMove = A, this.onMultiDragInteractionEnd = I, this.dragActivationThreshold = Math.max(0, D), this.enableClipSnap = N, this.clipSnapThreshold = Math.max(0, G), this.trackGroup = it.createGroup(0, n), this.layer.add(this.trackGroup), this.initClips(), this.initEventListeners(), this.render();
   }
   initClips() {
     this.clips = this.config.clips.map((t) => {
@@ -9277,7 +9277,7 @@ const yt = class yt {
     return t.name("clip-drop-preview"), t.visible(!1), t.listening(!1), this.trackGroup.add(t), this.dropPreviewGroup = t, t;
   }
   createDropPreviewRect(t) {
-    const e = this.trackType === "video" ? "rgba(80, 227, 194, 0.18)" : "rgba(181, 186, 255, 0.18)", i = this.trackType === "video" ? "#50e3c2" : "#b5baff", s = ht(t.startTime, this.zoom, this.scrollLeft), n = St(t.duration, this.zoom), r = it.createRect(s, 2, Math.max(n, 1), Math.max(this.trackHeight - 4, 1), e, i, 1);
+    const e = this.trackType === "video" ? "rgba(80, 227, 194, 0.18)" : "rgba(181, 186, 255, 0.18)", i = this.trackType === "video" ? "#50e3c2" : "#b5baff", s = ht(t.startTime, this.zoom, this.scrollLeft), n = Ct(t.duration, this.zoom), r = it.createRect(s, 2, Math.max(n, 1), Math.max(this.trackHeight - 4, 1), e, i, 1);
     return r.dash([6, 4]), r.cornerRadius(4), r.listening(!1), r.visible(s + n > 0 && s < this.layer.width()), r;
   }
   showDropPreview(t) {
@@ -9327,12 +9327,11 @@ const yt = class yt {
   handleTrackBackgroundMouseDown(t) {
   }
   updateClipSelection(t, e) {
-    var s;
-    const i = this.clips.find((n) => n.getClip().id === t);
-    i && (this.isVisualUpdate = !0, i.setSelected(e), this.isVisualUpdate = !1, e ? (this.selectedClipIds.add(t), this.selectedClip = i, this.hasSelectedClip = !0) : (this.selectedClipIds.delete(t), ((s = this.selectedClip) == null ? void 0 : s.getClip().id) === t && (this.selectedClip = null, this.hasSelectedClip = !1)), this.updateClipGroup(i.getClip()), this.layer.batchDraw());
+    const i = this.clips.find((s) => s.getClip().id === t);
+    i && (this.isVisualUpdate = !0, i.setSelected(e), this.isVisualUpdate = !1, e ? this.selectedClipIds.add(t) : this.selectedClipIds.delete(t), this.syncSelectionState(t), this.updateClipGroup(i.getClip()), this.render(!1), this.layer.batchDraw());
   }
   createClipGroup(t) {
-    const e = ht(t.startTime, this.zoom, this.scrollLeft), i = St(t.duration, this.zoom), s = 2, n = this.trackHeight - 4, r = it.createClipGroup(
+    const e = ht(t.startTime, this.zoom, this.scrollLeft), i = Ct(t.duration, this.zoom), s = 2, n = this.trackHeight - 4, r = it.createClipGroup(
       e,
       s,
       i,
@@ -9392,11 +9391,11 @@ const yt = class yt {
       const p = u.getBoundingClientRect(), g = e.clientX - p.left, y = e.clientY - p.top;
       if (s) {
         this.multiDragOriginalPositions.clear();
-        for (const S of this.selectedClipIds) {
-          const v = this.clips.find((b) => b.getClip().id === S);
+        for (const C of this.selectedClipIds) {
+          const v = this.clips.find((b) => b.getClip().id === C);
           if (v) {
             const b = v.getClip();
-            this.multiDragOriginalPositions.set(S, {
+            this.multiDragOriginalPositions.set(C, {
               startTime: b.startTime,
               duration: b.duration
             });
@@ -9458,7 +9457,7 @@ const yt = class yt {
   applyInteractionTransition(t) {
     var i, s;
     this.interactionState = t.state, this.syncLegacyInteractionMirror(t.state), t.effects.bindGlobalListeners && this.bindGlobalPointerListenersForDrag();
-    const e = wo(t.state);
+    const e = _o(t.state);
     e && this.lockPointerCursor(e), t.effects.cleanup && (this.releasePointerCursor(), this.hideDropPreview(), (i = this.onClearDropPreview) == null || i.call(this), this.updateSnapGuideLine(null), this.stopEdgeAutoScroll(), this.clearClipDragOverlay(), this.multiDragOriginalPositions.size > 0 && ((s = this.onMultiDragInteractionEnd) == null || s.call(this), this.multiDragOriginalPositions.clear())), t.effects.unbindGlobalListeners && this.unbindGlobalPointerListenersForDrag();
   }
   resolveInteractionState(t = this.interactionState) {
@@ -9494,7 +9493,7 @@ const yt = class yt {
     e.hasDragMoved = Te(t), e.activePointerOperation = ve(t), e.originalClipsState = (i == null ? void 0 : i.originalClipsState) ?? [], e.nonDraggedClips = (i == null ? void 0 : i.nonDraggedClips) ?? [], e.snapCandidateClips = (i == null ? void 0 : i.snapCandidateClips) ?? [], e.dragStartY = (i == null ? void 0 : i.pointerStartY) ?? 0, e.dragTargetTrackY = (i == null ? void 0 : i.dragTargetTrackY) ?? 0, e.crossTrackDragOffsetY = (i == null ? void 0 : i.crossTrackDragOffsetY) ?? 0, e.crossTrackDragStartX = (i == null ? void 0 : i.pointerStartX) ?? 0, e.dragStartScrollLeft = (i == null ? void 0 : i.dragStartScrollLeft) ?? 0, e.dragGestureStartClientX = (i == null ? void 0 : i.pointerStartClientX) ?? null, e.dragGestureStartClientY = (i == null ? void 0 : i.pointerStartClientY) ?? null, e.lastDragClientX = (i == null ? void 0 : i.lastPointerClientX) ?? null, e.lastDragClientY = (i == null ? void 0 : i.lastPointerClientY) ?? null;
   }
   handleClipMoveEnd(t, e) {
-    var T, S, v;
+    var T, C, v;
     const i = this.resolveInteractionState(e), s = this, n = Zt(i) || {
       clipId: t.id,
       originalClipsState: Array.isArray(s.originalClipsState) ? s.originalClipsState : [t],
@@ -9515,7 +9514,7 @@ const yt = class yt {
         isFinal: !0
       })) {
         for (const D of this.selectedClipIds) {
-          const N = (S = this.clipGroups) == null ? void 0 : S.get(D);
+          const N = (C = this.clipGroups) == null ? void 0 : C.get(D);
           N == null || N.y(2);
         }
         this.multiDragOriginalPositions.clear();
@@ -9632,7 +9631,7 @@ const yt = class yt {
     if (!s || this.isDragSessionActive())
       return;
     const n = s.getBoundingClientRect(), r = t - n.left, o = e - n.top;
-    s.style.cursor = ko({
+    s.style.cursor = wo({
       clips: this.clips.map((l) => l.getClip()),
       zoom: this.zoom,
       scrollLeft: this.scrollLeft,
@@ -9675,7 +9674,7 @@ const yt = class yt {
   updateClipGroup(t, e = !1) {
     const i = this.clipGroups.get(t.id);
     if (i) {
-      const s = ht(t.startTime, this.zoom, this.scrollLeft), n = St(t.duration, this.zoom);
+      const s = ht(t.startTime, this.zoom, this.scrollLeft), n = Ct(t.duration, this.zoom);
       i.x(s), i.visible(gs({
         startTime: t.startTime,
         duration: t.duration,
@@ -9700,20 +9699,19 @@ const yt = class yt {
     }
   }
   handleClipUpdate(t) {
-    var i, s;
-    const e = this.clips.findIndex((n) => n.getClip().id === t.id);
+    const e = this.clips.findIndex((i) => i.getClip().id === t.id);
     if (e !== -1) {
-      const n = this.clips[e].getClip(), r = {
+      const i = this.clips[e].getClip(), s = {
         ...t,
-        isSelected: this.isVisualUpdate || ((i = this.selectedClip) == null ? void 0 : i.getClip().id) === t.id ? t.isSelected : !1
+        isSelected: this.isVisualUpdate ? t.isSelected : this.selectedClipIds.has(t.id)
       };
       this.clips[e] = new ai(
-        r,
+        s,
         this.handleClipUpdate.bind(this),
         this.handleClipSplit.bind(this)
-      ), ((s = this.selectedClip) == null ? void 0 : s.getClip().id) === t.id && (this.selectedClip = this.clips[e]), this.updateClipGroup(r);
-      const o = this.clipGroups.get(t.id);
-      o && o.opacity(r.opacity), this.isVisualUpdate || this.onClipUpdate(r, n), this.layer.batchDraw();
+      ), this.syncSelectionState(t.id), this.updateClipGroup(s);
+      const n = this.clipGroups.get(t.id);
+      n && n.opacity(s.opacity), this.isVisualUpdate || this.onClipUpdate(s, i), this.layer.batchDraw();
     }
   }
   handleClipSplit(t, e) {
@@ -9749,12 +9747,11 @@ const yt = class yt {
     this.clips.push(i), this.createClipGroup(e), this.onClipAdd(e), this.layer.batchDraw();
   }
   removeClip(t) {
-    var i;
-    const e = this.clips.findIndex((s) => s.getClip().id === t);
+    const e = this.clips.findIndex((i) => i.getClip().id === t);
     if (e !== -1) {
-      this.clips.splice(e, 1), ((i = this.selectedClip) == null ? void 0 : i.getClip().id) === t && (this.selectedClip = null);
-      const s = this.clipGroups.get(t);
-      s && (this.getPromotedClipParents().delete(t), s.remove(), this.clipGroups.delete(t)), this.onClipRemove(t), this.hideDropPreview(), this.layer.batchDraw();
+      this.clips.splice(e, 1), this.selectedClipIds.delete(t), this.syncSelectionState();
+      const i = this.clipGroups.get(t);
+      i && (this.getPromotedClipParents().delete(t), i.remove(), this.clipGroups.delete(t)), this.onClipRemove(t), this.hideDropPreview(), this.render(!1), this.layer.batchDraw();
     }
   }
   updateClip(t, e) {
@@ -9848,15 +9845,10 @@ const yt = class yt {
     return this.selectedClip ? this.selectedClip.getClip() : null;
   }
   clearSelection() {
-    this.selectedClipIds.clear(), this.updateSelectionVisual(null);
+    this.selectedClipIds.clear(), this.applySelectionVisual(null), this.syncSelectionState(), this.render();
   }
   updateSelectionVisual(t) {
-    if (this.applySelectionVisual(t), t) {
-      const e = this.clips.find((i) => i.getClip().id === t);
-      this.selectedClip = e || null, this.hasSelectedClip = !!e;
-    } else
-      this.selectedClip = null, this.hasSelectedClip = !1;
-    this.render();
+    this.applySelectionVisual(t), this.selectedClipIds = t ? /* @__PURE__ */ new Set([t]) : /* @__PURE__ */ new Set(), this.syncSelectionState(t ?? void 0), this.render();
   }
   selectClip(t) {
     const e = this.clips.find((i) => i.getClip().id === t);
@@ -9873,6 +9865,16 @@ const yt = class yt {
       this.isVisualUpdate = !1;
     }
   }
+  syncSelectionState(t) {
+    var r;
+    const e = this.clips.filter((o) => this.selectedClipIds.has(o.getClip().id)), s = e.length > 0 ? e : this.clips.filter((o) => o.getClip().isSelected);
+    if (this.selectedClipIds = new Set(s.map((o) => o.getClip().id)), this.hasSelectedClip = s.length > 0, !this.hasSelectedClip) {
+      this.selectedClip = null;
+      return;
+    }
+    const n = t ?? ((r = this.selectedClip) == null ? void 0 : r.getClip().id) ?? null;
+    this.selectedClip = s.find((o) => o.getClip().id === n) ?? s[s.length - 1] ?? null;
+  }
   splitSelectedClip(t) {
     const e = this.clips.find((i) => {
       const s = i.getClip();
@@ -9916,7 +9918,7 @@ const yt = class yt {
       const h = ht(e, this.zoom, this.scrollLeft);
       o.x(h), o.y(this.resolveClipRenderY(t, s)), o.moveToTop(), it.updateClipGroup(
         o,
-        St(r.duration, this.zoom),
+        Ct(r.duration, this.zoom),
         this.trackHeight - 4,
         r.name,
         r.duration,
@@ -9978,7 +9980,7 @@ const yt = class yt {
     this.resolveSnapTargetClips = t;
   }
   updateDraggedClipFromPointer(t, e, i) {
-    var T, S, v, b, k;
+    var T, C, v, b, k;
     const s = this.resolveInteractionState(), n = Zt(s), r = ve(s), o = this.layer.getStage();
     if (!o || !this.selectedClip || !n || !r) return;
     const l = o.container();
@@ -9998,10 +10000,10 @@ const yt = class yt {
         return;
       const R = this.buildPreviewClip(g, _, c, n, r);
       if (!R) {
-        this.hideDropPreview(), (S = this.onClearDropPreview) == null || S.call(this), this.updateSnapGuideLine(null);
+        this.hideDropPreview(), (C = this.onClearDropPreview) == null || C.call(this), this.updateSnapGuideLine(null);
         return;
       }
-      const A = R.clip, I = A.startTime - _.startTime, D = this.applyPreviewClipState(A), N = ht(A.startTime, this.zoom, this.scrollLeft), G = St(A.duration, this.zoom);
+      const A = R.clip, I = A.startTime - _.startTime, D = this.applyPreviewClipState(A), N = ht(A.startTime, this.zoom, this.scrollLeft), G = Ct(A.duration, this.zoom);
       y.x(N), y.y(this.resolveClipRenderY(g.id, n.crossTrackDragOffsetY)), y.visible(N + G > 0 && N < this.layer.width()), D && (this.updateClipGroup(A), y.y(this.resolveClipRenderY(g.id, n.crossTrackDragOffsetY)));
       let W = !1;
       if (p) {
@@ -10021,12 +10023,12 @@ const yt = class yt {
           if (B) {
             const U = ht(j, this.zoom, this.scrollLeft);
             B.x(U), B.y(this.resolveClipRenderY(F, n.crossTrackDragOffsetY)), B.visible(
-              U + St(H.duration, this.zoom) > 0 && U < this.layer.width()
+              U + Ct(H.duration, this.zoom) > 0 && U < this.layer.width()
             );
             const q = L.getClip();
             it.updateClipGroup(
               B,
-              St(q.duration, this.zoom),
+              Ct(q.duration, this.zoom),
               this.trackHeight - 4,
               q.name,
               q.duration,
@@ -10279,7 +10281,7 @@ const yt = class yt {
 };
 f(yt, "DEFAULT_DRAG_ACTIVATION_THRESHOLD", 4), f(yt, "DEFAULT_CLIP_SNAP_THRESHOLD", 8), f(yt, "AUTO_SCROLL_EDGE_THRESHOLD", 48), f(yt, "AUTO_SCROLL_MAX_SPEED", 18);
 let _i = yt;
-class Dl {
+class Rl {
   constructor(t, e, i, s, n, r) {
     f(this, "layer");
     f(this, "playheadGroup");
@@ -10351,7 +10353,7 @@ class Dl {
     return this.playheadGroup;
   }
 }
-class Ao {
+class Eo {
   constructor(t, e, i, s) {
     f(this, "container");
     f(this, "tracks", []);
@@ -10421,7 +10423,7 @@ class Ao {
     this.trackList = null, this.container.innerHTML = "";
   }
 }
-const Eo = {
+const Io = {
   backgroundColor: "#1e1e1e",
   borderColor: "#333",
   textColor: "#e0e0e0",
@@ -10452,11 +10454,11 @@ const Eo = {
   presetButton: "clip-config-preset-button",
   resetButton: "clip-config-reset-button",
   emptyState: "clip-config-empty-state"
-}, Io = {
+}, Mo = {
   visual: "画面",
   audio: "音频"
 };
-class Mo {
+class Lo {
   constructor(t) {
     f(this, "container");
     f(this, "rootElement", null);
@@ -10476,7 +10478,7 @@ class Mo {
     f(this, "scaleInput", null);
     f(this, "volumeSlider", null);
     f(this, "volumeInput", null);
-    this.container = t.container, this.theme = t.theme ?? Eo, this.onClipUpdate = t.onClipUpdate, this.render();
+    this.container = t.container, this.theme = t.theme ?? Io, this.onClipUpdate = t.onClipUpdate, this.render();
   }
   setClip(t) {
     this.currentClip = t, (t == null ? void 0 : t.type) === "video" ? this.activeTab = "visual" : (t == null ? void 0 : t.type) === "audio" && (this.activeTab = "audio"), this.render();
@@ -10508,7 +10510,7 @@ class Mo {
     const t = this.getAvailableTabs();
     this.tabBar = document.createElement("div"), this.tabBar.className = Z.tabBar, this.tabBar.style.display = "flex", this.tabBar.style.gap = "12px", this.tabBar.style.padding = "4px", this.tabBar.style.backgroundColor = "#2a2a2a", this.tabBar.style.borderRadius = "4px 4px 0 0", t.forEach((e) => {
       const i = document.createElement("button");
-      i.className = Z.tabButton, i.textContent = Io[e], i.style.lineHeight = "22px", i.style.padding = "0 6px", i.style.border = "none", i.style.cursor = "pointer", i.style.fontSize = "13px", i.style.fontFamily = "inherit", i.style.transition = "background-color 0.15s, color 0.15s";
+      i.className = Z.tabButton, i.textContent = Mo[e], i.style.lineHeight = "22px", i.style.padding = "0 6px", i.style.border = "none", i.style.cursor = "pointer", i.style.fontSize = "13px", i.style.fontFamily = "inherit", i.style.transition = "background-color 0.15s, color 0.15s";
       const s = this.activeTab === e;
       i.style.backgroundColor = s ? "#595A5D" : "transparent", i.style.color = s ? "#fff" : "#b5b6bf", i.style.borderRadius = "4px", i.addEventListener("click", () => {
         this.activeTab = e, this.updateTabBarState(), this.updateContentVisibility();
@@ -10552,7 +10554,7 @@ class Mo {
     t.className = Z.actionBar, t.style.borderTop = `1px solid ${this.theme.borderColor}`, t.style.borderRadius = "0 0 4px 4px", t.style.minHeight = "36px", t.style.backgroundColor = "#2a2a2a", this.rootElement.appendChild(t);
   }
   renderPositionControl(t, e, i) {
-    var u, p, g, y, T, S;
+    var u, p, g, y, T, C;
     const s = document.createElement("div");
     s.className = Z.row, s.style.display = "flex", s.style.alignItems = "center", s.style.gap = "8px", s.style.marginBottom = "8px";
     const n = document.createElement("label");
@@ -10563,7 +10565,7 @@ class Mo {
       this.handleTransformChange(i, b);
     }), s.appendChild(c);
     const d = document.createElement("input");
-    d.type = "number", d.className = Z.input, d.min = String(l), d.max = String(h), d.step = "0.01", d.value = String(((S = (T = this.currentClip) == null ? void 0 : T.visualTransform) == null ? void 0 : S[i]) ?? 0.5), d.style.width = "60px", d.style.padding = "4px 6px", d.style.border = `1px solid ${this.theme.inputBorder}`, d.style.borderRadius = "4px", d.style.fontSize = "12px", d.style.backgroundColor = this.theme.inputBackground, d.style.color = this.theme.textColor, d.addEventListener("change", (v) => {
+    d.type = "number", d.className = Z.input, d.min = String(l), d.max = String(h), d.step = "0.01", d.value = String(((C = (T = this.currentClip) == null ? void 0 : T.visualTransform) == null ? void 0 : C[i]) ?? 0.5), d.style.width = "60px", d.style.padding = "4px 6px", d.style.border = `1px solid ${this.theme.inputBorder}`, d.style.borderRadius = "4px", d.style.fontSize = "12px", d.style.backgroundColor = this.theme.inputBackground, d.style.color = this.theme.textColor, d.addEventListener("change", (v) => {
       const b = parseFloat(v.target.value);
       this.handleTransformChange(i, b);
     }), s.appendChild(d), i === "x" ? (this.xSlider = c, this.xInput = d) : (this.ySlider = c, this.yInput = d), t.appendChild(s);
@@ -10837,9 +10839,9 @@ class ps {
             targetTrackId: v
           };
       }
-      const S = p + y;
-      if (S < u.length) {
-        const v = u[S], b = r.find((k) => this.resolveTrackId(k) === v);
+      const C = p + y;
+      if (C < u.length) {
+        const v = u[C], b = r.find((k) => this.resolveTrackId(k) === v);
         if (b && !this.hasOverlapOnTrack(t, b))
           return {
             status: "move_to_track",
@@ -11342,7 +11344,7 @@ class ys {
     } : null;
   }
 }
-const Lo = [
+const Do = [
   "type",
   "externalId",
   "src",
@@ -11359,11 +11361,11 @@ const Lo = [
   "visualTransform",
   "separatedAudioClipId",
   "separatedFromVideoClipId"
-], Do = /* @__PURE__ */ new Set(["thumbnails"]);
-function Ro(a, t) {
+], Ro = /* @__PURE__ */ new Set(["thumbnails"]);
+function Oo(a, t) {
   return Object.is(a, t) ? !0 : a === void 0 || t === void 0 ? !1 : typeof a == "object" && typeof t == "object" ? JSON.stringify(a) === JSON.stringify(t) : !1;
 }
-class Cs {
+class Ss {
   constructor(t) {
     this.history = t;
   }
@@ -11446,34 +11448,34 @@ class Cs {
         e.startTime
       );
     const r = {}, o = {};
-    return Lo.forEach((h) => {
-      Ro(t[h], e[h]) || (r[h] = t[h], o[h] = e[h]);
-    }), Object.keys(r).length === 0 || Object.keys(r).every((h) => Do.has(h)) ? null : this.history.createUpdateClipAction(t.id, r, o);
+    return Do.forEach((h) => {
+      Oo(t[h], e[h]) || (r[h] = t[h], o[h] = e[h]);
+    }), Object.keys(r).length === 0 || Object.keys(r).every((h) => Ro.has(h)) ? null : this.history.createUpdateClipAction(t.id, r, o);
   }
 }
 function He(a) {
   a.notifySelectionChange(), a.emitSelectedClipChangeIfNeeded(), a.handleClipChange();
 }
-function Oo(a) {
+function Go(a) {
   var t, e;
   a.notifySelectionChange(), (t = a.reloadClipThumbnailsIfNeeded) == null || t.call(a), (e = a.checkTrackDurationChange) == null || e.call(a), a.emitSelectedClipChangeIfNeeded(), a.handleClipChange();
 }
-function Go(a, t, e = !1) {
+function Bo(a, t, e = !1) {
   if (!t || !e || a.type === "audio")
     return !1;
   const i = t.duration !== a.duration, s = t.startTimeAtSource !== a.startTimeAtSource || t.endTimeAtSource !== a.endTimeAtSource;
   return i || s;
 }
-function Bo(a, t) {
+function Ho(a, t) {
   if (a.length === 0)
     return !1;
   const e = Math.max(...a.map((i) => i.endTime));
   return t < e;
 }
-function Ho(a) {
+function zo(a) {
   return a.currentCanPlay === a.nextCanPlay ? a.currentCanPlay : (a.setCanPlay(a.nextCanPlay), a.currentCanPlay && !a.nextCanPlay && a.playState === "playing" && (a.pauseTimeline(), a.setCurrentTime(a.clipEndTime || 1)), a.emitCanPlayChange(a.nextCanPlay), a.nextCanPlay);
 }
-function zo(a) {
+function No(a) {
   const t = !a.id && a.startTime > 0;
   return {
     shouldJumpToTime: t,
@@ -11485,7 +11487,7 @@ function We(a) {
   var t;
   return a.applied ? (a.isExecutingHistoryAction || (t = a.recordHistory) == null || t.call(a), a.applyEffects(), !0) : !1;
 }
-function No(a) {
+function Fo(a) {
   return We({
     applied: a.applied,
     isExecutingHistoryAction: a.isExecutingHistoryAction,
@@ -11505,7 +11507,7 @@ function No(a) {
     applyEffects: a.applyEffects
   });
 }
-function Fo(a) {
+function Vo(a) {
   var t;
   a.isExecutingHistoryAction || (t = a.recordSplitClip) == null || t.call(a, a.clip1, a.clip2), a.emitClipUpdated(a.clip1), a.emitClipAdded(a.clip2), a.applyEffects();
 }
@@ -11513,25 +11515,25 @@ const li = {
   x: 0.5,
   y: 0.5,
   scale: 1
-}, Vo = 0.1, Wo = 8;
+}, Wo = 0.1, Yo = 8;
 function hi(a, t) {
   return typeof a == "number" && Number.isFinite(a) ? a : t;
 }
-function Yo(a) {
-  return Math.min(Wo, Math.max(Vo, a));
+function Xo(a) {
+  return Math.min(Yo, Math.max(Wo, a));
 }
 function gt(a) {
   return {
     x: hi(a == null ? void 0 : a.x, li.x),
     y: hi(a == null ? void 0 : a.y, li.y),
-    scale: Yo(hi(a == null ? void 0 : a.scale, li.scale))
+    scale: Xo(hi(a == null ? void 0 : a.scale, li.scale))
   };
 }
-function Cn(a, t, e = 1e-4) {
+function vn(a, t, e = 1e-4) {
   const i = gt(a), s = gt(t);
   return Math.abs(i.x - s.x) <= e && Math.abs(i.y - s.y) <= e && Math.abs(i.scale - s.scale) <= e;
 }
-function Sn(a, t) {
+function bn(a, t) {
   if (a.width <= 0 || a.height <= 0)
     return {
       left: 0,
@@ -11554,8 +11556,8 @@ function Sn(a, t) {
     centerY: h + o / 2
   };
 }
-function Ss(a, t, e) {
-  const i = Sn(a, t), s = gt(e), n = i.width * s.scale, r = i.height * s.scale, o = a.width * s.x, l = a.height * s.y;
+function Cs(a, t, e) {
+  const i = bn(a, t), s = gt(e), n = i.width * s.scale, r = i.height * s.scale, o = a.width * s.x, l = a.height * s.y;
   return {
     left: o - n / 2,
     top: l - r / 2,
@@ -11565,7 +11567,7 @@ function Ss(a, t, e) {
     centerY: l
   };
 }
-function Xo(a, t, e, i) {
+function Uo(a, t, e, i) {
   const s = gt(a), n = i.width > 0 ? i.width : 1, r = i.height > 0 ? i.height : 1;
   return gt({
     x: s.x + t / n,
@@ -11573,7 +11575,7 @@ function Xo(a, t, e, i) {
     scale: s.scale
   });
 }
-function Uo(a, t, e, i, s, n) {
+function $o(a, t, e, i, s, n) {
   const r = gt(n), o = Math.max(s.width / 2, 1), l = Math.max(s.height / 2, 1), h = Math.abs(e - a) / o, c = Math.abs(i - t) / l;
   return gt({
     x: r.x,
@@ -11587,7 +11589,7 @@ function Ts(a) {
   const t = Number.parseFloat(a);
   return Number.isFinite(t) ? t : 0;
 }
-class $o {
+class Ko {
   constructor(t = {}) {
     f(this, "frameElement", null);
     f(this, "overlayElement", null);
@@ -11700,7 +11702,7 @@ class $o {
     const i = this.toLocalPoint(e);
     let s = this.interaction.startTransform;
     if (this.interaction.mode === "move")
-      s = Xo(
+      s = Uo(
         this.interaction.startTransform,
         i.x - this.interaction.pointerStart.x,
         i.y - this.interaction.pointerStart.y,
@@ -11708,7 +11710,7 @@ class $o {
       );
     else {
       const l = this.interaction.startTransform.x * this.interaction.frameSize.width, h = this.interaction.startTransform.y * this.interaction.frameSize.height;
-      s = Uo(
+      s = $o(
         l,
         h,
         i.x,
@@ -11717,7 +11719,7 @@ class $o {
         this.interaction.startTransform
       );
     }
-    this.interaction.nextTransform = s, this.interaction.changed = !Cn(this.interaction.startTransform, s), (o = (r = this.callbacks).onPreviewTransformChange) == null || o.call(r, this.interaction.clipId, s);
+    this.interaction.nextTransform = s, this.interaction.changed = !vn(this.interaction.startTransform, s), (o = (r = this.callbacks).onPreviewTransformChange) == null || o.call(r, this.interaction.clipId, s);
   }
   finishInteraction(t) {
     var i, s, n, r;
@@ -11774,14 +11776,14 @@ class $o {
     e && (e.style.cursor = t || "");
   }
 }
-function Ko(a, t) {
+function jo(a, t) {
   return !pe(a.mode) || !t ? a : {
     mode: wt.mode,
     width: t.width,
     height: t.height
   };
 }
-function jo(a) {
+function Zo(a) {
   return a.getAttribute("src") || a.currentSrc || a.src || "";
 }
 function vs(a) {
@@ -11799,7 +11801,7 @@ function qt(a) {
   } catch {
   }
 }
-function Zo(a) {
+function qo(a) {
   var t;
   try {
     const e = a.play();
@@ -11825,7 +11827,7 @@ function ks(a) {
   const t = Number.parseFloat(a);
   return Number.isFinite(t) ? t : 0;
 }
-class qo {
+class Jo {
   constructor(t = {}, e = {}) {
     f(this, "container", null);
     f(this, "rootElement", null);
@@ -11851,7 +11853,7 @@ class qo {
     f(this, "aspectRatioProbeSrc", null);
     f(this, "isAspectRatioProbeLoading", !1);
     f(this, "pendingState", null);
-    this.callbacks = t, this.dependencies = e, this.transformOverlay = new $o({
+    this.callbacks = t, this.dependencies = e, this.transformOverlay = new Ko({
       onPreviewTransformChange: this.handlePreviewTransformChange.bind(this),
       onPreviewTransformCommit: (i, s) => {
         var n, r;
@@ -11914,7 +11916,7 @@ class qo {
     this.requestedAspectRatio = Nt(t), this.updateFrameLayout();
   }
   getAspectRatio() {
-    return Ko(this.requestedAspectRatio, this.resolvedAutoAspectRatio);
+    return jo(this.requestedAspectRatio, this.resolvedAutoAspectRatio);
   }
   createMediaElement(t, e) {
     const i = this.dependencies.createMediaElement, s = i ? i(t, e) : document.createElement(t === "video" ? "video" : "audio");
@@ -11992,32 +11994,33 @@ class qo {
   }
   assignClipToSlot(t, e) {
     t.entry = e, t.isActive = t.role === "current";
-    const i = e.clip.src, s = t.attachedSrc || jo(t.element);
+    const i = e.clip.src, s = t.attachedSrc || Zo(t.element);
     (t.attachedClipId !== e.clip.id || s !== i) && (t.attachedClipId = e.clip.id, t.attachedSrc = i, t.isLoading = !0, t.isBuffering = !1, t.element.setAttribute("src", i), oe(t.element)), this.configureAudioRouting(t, e);
   }
   configureAudioRouting(t, e) {
+    const i = Math.max(0, Math.min(1, e.clip.volume ?? 1)), s = e.muted ? 0 : i;
     if (!e.hasAudio) {
-      t.element.muted = !0;
+      t.element.muted = !0, t.element.volume = 0;
       return;
     }
-    const i = this.getAudioContext();
-    if (!i || t.audioRoutingFailed) {
-      t.element.muted = e.muted;
+    const n = this.getAudioContext();
+    if (!n || t.audioRoutingFailed) {
+      t.element.muted = e.muted, t.element.volume = s;
       return;
     }
     if (!t.sourceNode || !t.gainNode)
       try {
-        t.sourceNode = i.createMediaElementSource(t.element), t.gainNode = i.createGain(), t.sourceNode.connect(t.gainNode), t.gainNode.connect(this.getMasterGainNode(i));
+        t.sourceNode = n.createMediaElementSource(t.element), t.gainNode = n.createGain(), t.sourceNode.connect(t.gainNode), t.gainNode.connect(this.getMasterGainNode(n));
       } catch {
-        t.audioRoutingFailed = !0, t.element.muted = e.muted;
+        t.audioRoutingFailed = !0, t.element.muted = e.muted, t.element.volume = s;
         return;
       }
-    t.element.muted = !1, t.gainNode.gain.value = e.muted ? 0 : 1;
+    t.element.muted = !1, t.element.volume = 1, t.gainNode.gain.value = s;
   }
   syncCurrentSlot(t, e, i, s) {
     t.isActive = !0, t.entry = e, t.element.playbackRate = i;
     const n = e.mediaTime / 1e3, r = Math.max(0.1, i * 0.15);
-    Math.abs(t.element.currentTime - n) > r && (t.isSeeking = !0, t.isBuffering = !0, bs(t.element, n), this.refreshBufferingState()), s === "playing" ? (this.resumeAudioContext(), Zo(t.element)) : qt(t.element), this.setSlotVisible(t, e.hasVisual, 1e3 - e.trackOrder);
+    Math.abs(t.element.currentTime - n) > r && (t.isSeeking = !0, t.isBuffering = !0, bs(t.element, n), this.refreshBufferingState()), s === "playing" ? (this.resumeAudioContext(), qo(t.element)) : qt(t.element), this.setSlotVisible(t, e.hasVisual, 1e3 - e.trackOrder);
   }
   preparePreloadSlot(t, e) {
     if (t.isActive = !1, t.isBuffering = !1, t.isSeeking = !1, !e) {
@@ -12153,7 +12156,7 @@ class qo {
     const e = this.getFrameSize();
     if (e.width <= 0 || e.height <= 0)
       return;
-    const i = this.getMediaSize(t, t.entry, e), s = this.getEffectiveVisualTransform(t.entry), n = Ss(e, i, s);
+    const i = this.getMediaSize(t, t.entry, e), s = this.getEffectiveVisualTransform(t.entry), n = Cs(e, i, s);
     t.wrapper.style.left = `${n.left}px`, t.wrapper.style.top = `${n.top}px`, t.wrapper.style.width = `${n.width}px`, t.wrapper.style.height = `${n.height}px`;
   }
   buildSelectedOverlayState() {
@@ -12170,8 +12173,8 @@ class qo {
         clipId: e.entry.clip.id,
         transform: s,
         frameSize: t,
-        baseRect: Sn(t, i),
-        displayRect: Ss(t, i, s)
+        baseRect: bn(t, i),
+        displayRect: Cs(t, i, s)
       };
     }
     return null;
@@ -12204,26 +12207,28 @@ class qo {
     return ((e = this.transientVisualTransform) == null ? void 0 : e.clipId) === t.clip.id ? this.transientVisualTransform.transform : gt(t.clip.visualTransform);
   }
 }
-class Jo extends qo {
+class Qo extends Jo {
   destroy() {
     this.detach();
   }
 }
-function Qo(a) {
+function tl(a) {
   return "dom";
 }
-const tl = 36e5, el = 3e5;
-function Tn(a) {
+const el = 36e5, il = 3e5;
+function sl(a) {
   return a.length === 0 ? 0 : a.reduce((t, e) => Math.max(t, e.startTime + e.duration), 0);
 }
-function vn(a) {
-  return Math.max(a + el, tl);
+function ws(a) {
+  if (a.length === 0)
+    return 0;
+  const t = a.reduce((i, s) => Math.min(i, s.startTime), Number.POSITIVE_INFINITY), e = a.reduce((i, s) => Math.max(i, s.startTime + s.duration), 0);
+  return Math.max(0, e - t);
 }
-function il(a) {
-  const t = Tn(a.clips);
-  return t === a.lastTrackDuration ? a.lastTrackDuration : (a.setLastTrackDuration(t), a.setTimelineDuration(vn(t)), a.emitTrackDurationChange(t), t);
+function _s(a) {
+  return Math.max(a + il, el);
 }
-class ws {
+class Ps {
   constructor(t = {}) {
     f(this, "listeners", /* @__PURE__ */ new Map());
     this.initialPayloadProviders = t;
@@ -12249,10 +12254,10 @@ class ws {
     this.listeners.clear();
   }
 }
-function sl(a) {
+function nl(a) {
   return [...a].sort((t, e) => t.order - e.order);
 }
-function nl(a) {
+function rl(a) {
   return [...a].sort((t, e) => t.startTime - e.startTime);
 }
 function ci(a, t, e) {
@@ -12268,15 +12273,15 @@ function ci(a, t, e) {
     hasAudio: !0
   };
 }
-class rl {
+class al {
   resolveActiveClipsAtTime(t, e) {
     return this.resolvePlaybackPlan(t, e).activeClips;
   }
   resolvePlaybackPlan(t, e) {
-    const i = sl(t), s = [], n = [];
+    const i = nl(t), s = [], n = [];
     let r = null;
     for (const o of i) {
-      const l = nl(o.clips), h = l.find((d) => e >= d.startTime && e < d.endTime);
+      const l = rl(o.clips), h = l.find((d) => e >= d.startTime && e < d.endTime);
       if (h) {
         const d = h.startTimeAtSource + (e - h.startTime);
         s.push(ci(o, h, d));
@@ -12294,7 +12299,7 @@ class rl {
     };
   }
 }
-function al(a) {
+function ol(a) {
   var e;
   const t = a.getSelectedClip() || ((e = a.findFallbackSelectedClip) == null ? void 0 : e.call(a)) || null;
   return {
@@ -12302,51 +12307,51 @@ function al(a) {
     hasSelectedClip: !!t
   };
 }
-function ol(a) {
+function ll(a) {
   var i;
   const t = a.resolveSelectedClip(), e = ((i = t.clip) == null ? void 0 : i.id) || null;
   return e === a.lastSelectedClipId ? a.lastSelectedClipId : (a.emitSelectedClipChange(t), e);
 }
-function bn(a, t) {
+function kn(a, t) {
   var e, i, s, n;
   return ((i = (e = a.findById(t)) == null ? void 0 : e.getId) == null ? void 0 : i.call(e)) || ((n = (s = a.getLastTrack()) == null ? void 0 : s.getId) == null ? void 0 : n.call(s)) || t;
 }
-function ll(a) {
+function hl(a) {
   if (a.placement.status === "use_existing_track")
     return a.trackCollection.addClipToTrack(a.placement.trackId, a.clip);
-  const t = a.createTrack(a.placement.trackType, a.placement.suggestedTrackName), e = bn(a.trackCollection, t);
+  const t = a.createTrack(a.placement.trackType, a.placement.suggestedTrackName), e = kn(a.trackCollection, t);
   return e ? a.trackCollection.addClipToTrack(e, a.clip) : !1;
 }
-function _s(a, t, e) {
+function xs(a, t, e) {
   return t.trackId ? a.removeClipFromTrack(t.trackId, e) : !1;
 }
-function hl(a) {
+function cl(a) {
   return a.trackCollection.moveClipToTrack(
     a.command.clip,
     a.command.sourceTrackId,
     a.command.targetTrackId
   );
 }
-function cl(a) {
-  const t = a.createTrack(a.trackType, a.trackName), e = bn(a.trackCollection, t);
+function dl(a) {
+  const t = a.createTrack(a.trackType, a.trackName), e = kn(a.trackCollection, t);
   return e ? a.trackCollection.moveClipToTrack(a.clip, a.currentTrackId, e) : !1;
 }
 function Et(a) {
   var t, e, i, s, n;
   (t = a.checkTrackDurationChange) == null || t.call(a), (e = a.updateCanPlayState) == null || e.call(a), (i = a.updateTrackInfoPanel) == null || i.call(a), (s = a.handleClipChange) == null || s.call(a), (n = a.cleanupEmptyTracks) == null || n.call(a);
 }
-function dl(a) {
+function ul(a) {
   var t, e;
   a.notifySelectionChange(), (t = a.cleanupEmptyTracks) == null || t.call(a), a.updateTrackInfoPanel(), (e = a.batchDraw) == null || e.call(a), a.syncPreviewSession();
 }
-class ul {
+class fl {
   constructor() {
     f(this, "panel", null);
   }
   init(t) {
     var i, s, n, r;
     const e = ((i = t.theme) == null ? void 0 : i.background) || "#1a1a1a";
-    this.panel = new Ao(
+    this.panel = new Eo(
       {
         container: t.container,
         theme: {
@@ -12382,7 +12387,7 @@ class ul {
     (t = this.panel) == null || t.destroy(), this.panel = null;
   }
 }
-class Ps {
+class As {
   syncCurrentTime(t, e, i, s) {
     t == null || t.setCurrentTime(s), e == null || e.setCurrentTime(s), i.syncCurrentTime(s);
   }
@@ -12437,7 +12442,7 @@ class Ps {
     return null;
   }
 }
-class xs {
+class Es {
   constructor(t, e = _i) {
     this.handlers = t, this.TrackCtor = e;
   }
@@ -12474,7 +12479,7 @@ class xs {
     );
   }
 }
-class fl {
+class gl {
   constructor(t) {
     this.tracks = t;
   }
@@ -12596,7 +12601,7 @@ class fl {
     return typeof t.getId == "function" ? t.getId() : typeof t.id == "string" ? t.id : null;
   }
 }
-class gl {
+class pl {
   constructor(t = []) {
     f(this, "tracks", []);
     f(this, "trackCounter", 0);
@@ -12696,10 +12701,10 @@ function le(a, t, e) {
   }
   return i;
 }
-function As(a, t) {
+function Is(a, t) {
   return a.reduce((e, i) => e + Vt(i.type), t);
 }
-function pl(a, t) {
+function ml(a, t) {
   let e = t;
   return a.map((i) => {
     const s = Vt(i.type), n = {
@@ -12710,12 +12715,12 @@ function pl(a, t) {
     return e += s, n;
   });
 }
-const kn = 200, wn = 8, Es = "timeline-manager-managed-layout-styles";
-function ml() {
-  if (typeof document > "u" || document.getElementById(Es))
+const wn = 200, _n = 8, Ms = "timeline-manager-managed-layout-styles";
+function yl() {
+  if (typeof document > "u" || document.getElementById(Ms))
     return;
   const a = document.createElement("style");
-  a.id = Es, a.textContent = `
+  a.id = Ms, a.textContent = `
     .timeline-manager-root {
       position: relative;
       overflow: hidden;
@@ -12743,9 +12748,9 @@ function ml() {
     }
   `, document.head.appendChild(a);
 }
-function yl(a, t) {
-  ml();
-  const e = t.leftPanelWidth ?? kn, i = t.scrollbarSize ?? wn;
+function Sl(a, t) {
+  yl();
+  const e = t.leftPanelWidth ?? wn, i = t.scrollbarSize ?? _n;
   a.innerHTML = "", a.classList.add("timeline-manager-root"), a.style.gridTemplateColumns = `${e}px minmax(0, 1fr)`, a.style.gridTemplateRows = `${t.timeScaleHeight}px minmax(0, 1fr)`, a.style.background = t.theme.background;
   const s = bt("div");
   s.className = "timeline-manager-header-corner", Ne(s, t.theme), s.style.gridColumn = "1", s.style.gridRow = "1", s.style.borderBottom = `1px solid ${t.theme.border}`;
@@ -12808,7 +12813,7 @@ class Cl {
     this.speed = t;
   }
 }
-class _n {
+class Pn {
   constructor() {
     f(this, "selectedClipIds", /* @__PURE__ */ new Set());
   }
@@ -12846,7 +12851,7 @@ class _n {
     return this.selectedClipIds.size;
   }
 }
-class Sl {
+class Tl {
   constructor(t) {
     f(this, "zoom");
     f(this, "duration");
@@ -12900,16 +12905,16 @@ class Sl {
     this.contentHeight = t;
   }
 }
-class Is {
+class Ls {
   constructor(t) {
     f(this, "selectionStore");
     f(this, "playbackStore");
     f(this, "viewportStore");
-    this.selectionStore = new _n(), this.playbackStore = new Cl({
+    this.selectionStore = new Pn(), this.playbackStore = new Cl({
       currentTime: t.currentTime,
       playState: t.playState,
       speed: t.speed
-    }), this.viewportStore = new Sl({
+    }), this.viewportStore = new Tl({
       zoom: t.zoom,
       duration: t.duration,
       scrollLeft: t.scrollLeft,
@@ -12992,7 +12997,7 @@ class Is {
     this.viewportStore.setContentHeight(t);
   }
 }
-class Tl {
+class vl {
   constructor(t, e, i, s, n) {
     f(this, "stage");
     f(this, "layer");
@@ -13297,7 +13302,7 @@ const V = class V {
 };
 f(V, "SVG_NS", "http://www.w3.org/2000/svg"), f(V, "VISUAL_WIDTH", 14), f(V, "HANDLE_HEIGHT", 16), f(V, "HANDLE_LINE_START", 13), f(V, "LINE_WIDTH", 2), f(V, "LINE_HIT_WIDTH", 12), f(V, "END_CAP_WIDTH", 14), f(V, "END_CAP_HEIGHT", 10), f(V, "AUTO_SCROLL_EDGE_THRESHOLD", 48), f(V, "AUTO_SCROLL_MAX_SPEED", 18);
 let Pi = V;
-class Ms {
+class Ds {
   constructor(t) {
     f(this, "container");
     f(this, "orientation");
@@ -13434,7 +13439,7 @@ class Ms {
     return this.scrollOffset / i * s;
   }
 }
-class vl {
+class bl {
   constructor() {
     f(this, "entries", /* @__PURE__ */ new Map());
   }
@@ -13450,7 +13455,7 @@ class vl {
     this.entries.clear();
   }
 }
-class bl {
+class kl {
   constructor() {
     f(this, "panel", null);
     f(this, "config", null);
@@ -13459,7 +13464,7 @@ class bl {
   init(t) {
     this.config = t;
     const e = this.convertTheme(t.theme);
-    this.panel = new Mo({
+    this.panel = new Lo({
       container: t.container,
       theme: e,
       onClipUpdate: (i, s) => {
@@ -13497,10 +13502,10 @@ class bl {
     };
   }
 }
-const kl = "2.0.3", wl = {
-  version: kl
-}, _l = 1, Pl = 2, xl = 8e3;
-class Rl {
+const wl = "2.0.3", _l = {
+  version: wl
+}, Pl = 1, xl = 2, Al = 8e3;
+class Ol {
   constructor(t = {}) {
     f(this, "timeline", null);
     f(this, "tracks", []);
@@ -13537,6 +13542,7 @@ class Rl {
     f(this, "verticalScrollbar", null);
     f(this, "isExecutingHistoryAction", !1);
     f(this, "lastTrackDuration", 0);
+    f(this, "lastEffectiveTrackDuration", 0);
     f(this, "thumbnailProvider", null);
     f(this, "canPlay", !1);
     f(this, "sourceLoadingCount", 0);
@@ -13567,9 +13573,9 @@ class Rl {
     f(this, "rootWheelListener", (t) => {
       this.handleUnifiedWheel(t);
     });
-    f(this, "mountManager", new vl());
+    f(this, "mountManager", new bl());
     f(this, "pendingDraftData", null);
-    f(this, "selectionStore", new _n());
+    f(this, "selectionStore", new Pn());
     f(this, "multiDragSession", null);
     f(this, "clipRemovalBatchDepth", 0);
     this.config = {
@@ -13588,7 +13594,7 @@ class Rl {
       thumbnailProvider: t.thumbnailProvider,
       previewBackend: t.previewBackend ?? "dom",
       previewSourceResolver: t.previewSourceResolver
-    }, O.setConfig(this.config.logConfig), O.debug("TimelineManager", "日志系统初始化完成", { logConfig: this.config.logConfig }), this.thumbnailProvider = t.thumbnailProvider || null, this.trackInfoPanelController = new ul(), this.eventDispatcher = new ws({
+    }, O.setConfig(this.config.logConfig), O.debug("TimelineManager", "日志系统初始化完成", { logConfig: this.config.logConfig }), this.thumbnailProvider = t.thumbnailProvider || null, this.trackInfoPanelController = new fl(), this.eventDispatcher = new Ps({
       can_play_change: () => ({ canPlay: this.canPlay }),
       selected_clip_change: () => this.resolveSelectedClipSnapshot(),
       source_loading_change: () => this.getSourceLoadingState(),
@@ -13602,7 +13608,7 @@ class Rl {
           canRedo: this.history.canRedo()
         });
       }
-    ), this.timelineHistoryRecorder = new Cs(this.history), this.timelineHistoryExecutor = new ys({
+    ), this.timelineHistoryRecorder = new Ss(this.history), this.timelineHistoryExecutor = new ys({
       removeClip: this.removeClip.bind(this),
       addClipToTrack: this.addClipToTrack.bind(this),
       updateClip: this.updateClip.bind(this),
@@ -13613,13 +13619,13 @@ class Rl {
       findTrackByClipId: this.findTrackByClipId.bind(this),
       getDefaultTrack: () => this.getDefaultTrackForHistory(),
       loadClipThumbnails: this.loadClipThumbnails.bind(this)
-    }), this.trackManager = new gl(), this.timelineStore = new Is({
+    }), this.trackManager = new pl(), this.timelineStore = new Ls({
       currentTime: this.config.currentTime,
       playState: this.config.playState,
       speed: this.config.speed || 1,
       zoom: this.config.zoom,
       duration: this.config.duration
-    }), this.timelineCommands = new ps(this.timelineStore), this.timelinePresentationAdapter = new Ps(), this.timelineTrackBridge = new xs({
+    }), this.timelineCommands = new ps(this.timelineStore), this.timelinePresentationAdapter = new As(), this.timelineTrackBridge = new Es({
       onClipUpdate: (e, i, s) => this.handleClipUpdate(e, i, s),
       onClipAdd: this.handleClipAdd.bind(this),
       onClipRemove: this.handleClipRemove.bind(this),
@@ -13644,7 +13650,7 @@ class Rl {
     var t, e, i, s, n;
     if (!this.timelineStore) {
       const r = ((t = this.config) == null ? void 0 : t.currentTime) ?? 0, o = ((e = this.config) == null ? void 0 : e.playState) ?? "paused", l = ((i = this.config) == null ? void 0 : i.speed) || 1, h = ((s = this.config) == null ? void 0 : s.zoom) || ut.MEDIUM, c = ((n = this.config) == null ? void 0 : n.duration) || 36e5;
-      this.timelineStore = new Is({
+      this.timelineStore = new Ls({
         currentTime: r,
         playState: o,
         speed: l,
@@ -13658,13 +13664,13 @@ class Rl {
     return this.timelineCommands || (this.timelineCommands = new ps(this.getTimelineStore())), this.timelineCommands;
   }
   getTrackCollection() {
-    return new fl(this.tracks);
+    return new gl(this.tracks);
   }
   getTimelinePresentationAdapter() {
-    return this.timelinePresentationAdapter || (this.timelinePresentationAdapter = new Ps()), this.timelinePresentationAdapter;
+    return this.timelinePresentationAdapter || (this.timelinePresentationAdapter = new As()), this.timelinePresentationAdapter;
   }
   getTimelineTrackBridge() {
-    return this.timelineTrackBridge || (this.timelineTrackBridge = new xs({
+    return this.timelineTrackBridge || (this.timelineTrackBridge = new Es({
       onClipUpdate: (t, e, i) => this.handleClipUpdate(t, e, i),
       onClipAdd: this.handleClipAdd.bind(this),
       onClipRemove: this.handleClipRemove.bind(this),
@@ -13685,10 +13691,10 @@ class Rl {
     })), this.timelineTrackBridge;
   }
   getTimelinePlaybackResolver() {
-    return this.timelinePlaybackResolver || (this.timelinePlaybackResolver = new rl()), this.timelinePlaybackResolver;
+    return this.timelinePlaybackResolver || (this.timelinePlaybackResolver = new al()), this.timelinePlaybackResolver;
   }
   resolveConfiguredPreviewBackend() {
-    return this.runtimePreviewBackendOverride ? (this.resolvedPreviewBackend = this.runtimePreviewBackendOverride, this.resolvedPreviewBackend) : (this.resolvedPreviewBackend = Qo(this.config.previewBackend), this.resolvedPreviewBackend);
+    return this.runtimePreviewBackendOverride ? (this.resolvedPreviewBackend = this.runtimePreviewBackendOverride, this.resolvedPreviewBackend) : (this.resolvedPreviewBackend = tl(this.config.previewBackend), this.resolvedPreviewBackend);
   }
   createPreviewBackendCallbacks(t = this.activePreviewCallbackToken) {
     return {
@@ -13717,7 +13723,7 @@ class Rl {
   }
   createPreviewBackend(t = this.resolveConfiguredPreviewBackend()) {
     const e = this.createPreviewBackendCallbacks(++this.activePreviewCallbackToken);
-    return new Jo(e);
+    return new Qo(e);
   }
   isActivePreviewCallbackToken(t) {
     return t === this.activePreviewCallbackToken;
@@ -13726,7 +13732,7 @@ class Rl {
     return this.previewSession || (this.previewSession = this.createPreviewBackend()), this.previewSession;
   }
   getEventDispatcher() {
-    return this.eventDispatcher || (this.eventDispatcher = new ws({
+    return this.eventDispatcher || (this.eventDispatcher = new Ps({
       can_play_change: () => ({ canPlay: this.canPlay ?? !1 }),
       selected_clip_change: () => this.resolveSelectedClipSnapshot(),
       source_loading_change: () => this.getSourceLoadingState(),
@@ -13739,7 +13745,7 @@ class Rl {
   getTimelineHistoryRecorder() {
     return this.timelineHistoryRecorder || (this.history || (this.history = new ms(() => {
     }, () => {
-    })), this.timelineHistoryRecorder = new Cs(this.history)), this.timelineHistoryRecorder;
+    })), this.timelineHistoryRecorder = new Ss(this.history)), this.timelineHistoryRecorder;
   }
   getTimelineHistoryExecutor() {
     return this.timelineHistoryExecutor || (this.timelineHistoryExecutor = new ys({
@@ -14010,7 +14016,7 @@ class Rl {
     this.pendingPreviewState.timeoutId = setTimeout(() => {
       var e, i;
       !this.pendingPreviewState || this.pendingPreviewState.syncRequestId !== t || (this.pendingPreviewState.errorMessage = "资源加载异常，请刷新重试", this.clearPendingPreviewTimeout(), (i = (e = this.previewSession) == null ? void 0 : e.setPendingState) == null || i.call(e, this.buildPreviewPendingState()));
-    }, xl);
+    }, Al);
   }
   clearPendingPreviewTimeout() {
     var t;
@@ -14050,11 +14056,11 @@ class Rl {
       O.warn("TimelineManager", "TimelineManager has already been initialized");
       return;
     }
-    this.rootContainer = t, this.layout = yl(t, {
+    this.rootContainer = t, this.layout = Sl(t, {
       theme: this.config.theme,
       timeScaleHeight: this.getTimeScaleHeight(),
-      leftPanelWidth: kn,
-      scrollbarSize: wn
+      leftPanelWidth: wn,
+      scrollbarSize: _n
     }), this.layout.bodyViewport.addEventListener("scroll", this.bodyViewportScrollListener), (s = (i = this.layout.bodyCanvasHost).addEventListener) == null || s.call(i, "click", this.bodyCanvasHostClickListener), (r = (n = this.rootContainer) == null ? void 0 : n.addEventListener) == null || r.call(n, "wheel", this.rootWheelListener, { passive: !1 }), this.headerStage = new X.Stage({
       container: this.layout.headerCanvasHost,
       width: this.layout.headerViewport.clientWidth,
@@ -14065,7 +14071,7 @@ class Rl {
       height: 0
     }), this.backgroundLayer = new X.Layer({ name: "trackBackgroundLayer" }), this.trackLayer = new X.Layer({ name: "trackLayer" }), this.dragOverlayLayer = new X.Layer({ name: "trackDragOverlayLayer", listening: !1 }), this.snapGuideLayer = new X.Layer({ name: "trackSnapGuideLayer", listening: !1 }), this.selectionBoxLayer = new X.Layer({ name: "selectionBoxLayer", listening: !1 }), this.stage.add(this.backgroundLayer), this.stage.add(this.trackLayer), this.stage.add(this.dragOverlayLayer), this.stage.add(this.snapGuideLayer), this.stage.add(this.selectionBoxLayer);
     const e = (l = (o = this.stage) == null ? void 0 : o.container) == null ? void 0 : l.call(o);
-    if (e && e.addEventListener("mousedown", this.handleStageMouseDown.bind(this)), this.timeline = new Tl(
+    if (e && e.addEventListener("mousedown", this.handleStageMouseDown.bind(this)), this.timeline = new vl(
       this.headerStage,
       this.headerLayer,
       this.config,
@@ -14079,13 +14085,13 @@ class Rl {
       this.config.theme,
       this.handleTimeChange.bind(this),
       this.handleHorizontalDragAutoScroll.bind(this)
-    ), this.horizontalScrollbar = new Ms({
+    ), this.horizontalScrollbar = new Ds({
       container: this.layout.horizontalScrollbarCanvasHost,
       orientation: "horizontal",
       theme: this.config.theme,
       leadingInset: ot,
       onScrollChange: this.handleScrollChange.bind(this)
-    }), this.verticalScrollbar = new Ms({
+    }), this.verticalScrollbar = new Ds({
       container: this.layout.verticalScrollbarCanvasHost,
       orientation: "vertical",
       theme: this.config.theme,
@@ -14168,11 +14174,11 @@ class Rl {
     return le(this.trackManager.getTracks(), t, this.getTrackContentTopOffset());
   }
   calculateTotalHeight() {
-    return As(this.trackManager.getTracks(), this.getTrackContentTopOffset());
+    return Is(this.trackManager.getTracks(), this.getTrackContentTopOffset());
   }
   updateAllTrackPositions() {
     var e, i;
-    const t = pl(this.trackManager.getTracks(), this.getTrackContentTopOffset());
+    const t = ml(this.trackManager.getTracks(), this.getTrackContentTopOffset());
     for (const s of t) {
       const n = this.getTrackCollection().findById(s.trackId);
       n && ((e = n.setTrackY) == null || e.call(n, s.y), (i = n.setTrackHeight) == null || i.call(n, s.height));
@@ -14260,7 +14266,7 @@ class Rl {
     if (e === "bottom_of_type_region" && o)
       return le(s, o.id, this.getTrackContentTopOffset()) + Vt(o.type);
     if (!n)
-      return t === "video" ? this.getTrackContentTopOffset() : As(s, this.getTrackContentTopOffset());
+      return t === "video" ? this.getTrackContentTopOffset() : Is(s, this.getTrackContentTopOffset());
     const l = le(s, n.id, this.getTrackContentTopOffset());
     return t === "video" ? l : l + Vt(n.type);
   }
@@ -14365,9 +14371,9 @@ class Rl {
   normalizeWheelDelta(t, e, i) {
     if (!Number.isFinite(t) || t === 0)
       return 0;
-    if (e === _l)
+    if (e === Pl)
       return t * 16;
-    if (e === Pl) {
+    if (e === xl) {
       const s = i === "x" ? this.getViewportWidth() : this.getViewportHeight();
       return t * (s || 1);
     }
@@ -14632,7 +14638,7 @@ class Rl {
         O.error("TimelineManager", "Failed to get video duration:", { error: u }), r = n;
       }
     let o = t.thumbnails;
-    const l = t.id || `clip_${t.name}_${Date.now()}_${Math.random().toString(36).substr(2, 9)}`, h = t.type || "video", c = Ds({
+    const l = t.id || `clip_${t.name}_${Date.now()}_${Math.random().toString(36).substr(2, 9)}`, h = t.type || "video", c = Os({
       id: l,
       type: h,
       externalId: t.externalId,
@@ -14649,7 +14655,8 @@ class Rl {
       style: t.style,
       visualTransform: t.visualTransform,
       separatedAudioClipId: t.separatedAudioClipId,
-      separatedFromVideoClipId: t.separatedFromVideoClipId
+      separatedFromVideoClipId: t.separatedFromVideoClipId,
+      volume: t.volume ?? 1
     });
     if (O.debugLazy("TimelineManager", () => "添加的片段", () => ({ clipId: c.id, type: c.type, startTime: c.startTime, duration: c.duration })), this.tracks.length > 0) {
       if (t.trackId) {
@@ -14676,7 +14683,7 @@ class Rl {
           return c.id;
         }
       }
-      const u = this.getTimelineCommands().planTrackPlacement(c, this.tracks), p = this.getTrackCollection(), g = ll({
+      const u = this.getTimelineCommands().planTrackPlacement(c, this.tracks), p = this.getTrackCollection(), g = hl({
         clip: c,
         placement: u,
         trackCollection: p,
@@ -14707,7 +14714,7 @@ class Rl {
   removeClip(t) {
     const e = this.getTimelineCommands().prepareRemoveClip(t, this.tracks);
     e.exists && (e.shouldClearSelection && this.clearSelection(), We({
-      applied: _s(this.getTrackCollection(), e, t),
+      applied: xs(this.getTrackCollection(), e, t),
       isExecutingHistoryAction: this.isExecutingHistoryAction,
       recordHistory: () => {
         this.getTimelineHistoryRecorder().recordRemoveClip(
@@ -14737,7 +14744,7 @@ class Rl {
     return this.withClipRemovalBatch(() => {
       for (const n of e) {
         const r = this.getTimelineCommands().prepareRemoveClip(n, this.tracks);
-        r.exists && (s = _s(this.getTrackCollection(), r, n) || s);
+        r.exists && (s = xs(this.getTrackCollection(), r, n) || s);
       }
     }), s ? (He({
       notifySelectionChange: this.notifySelectionChange.bind(this),
@@ -14807,7 +14814,8 @@ class Rl {
         thumbnails: l.thumbnails,
         visualTransform: l.type === "video" ? gt(l.visualTransform) : void 0,
         separatedAudioClipId: l.separatedAudioClipId,
-        separatedFromVideoClipId: l.separatedFromVideoClipId
+        separatedFromVideoClipId: l.separatedFromVideoClipId,
+        volume: l.volume ?? 1
       })).sort((l, h) => l.startTime - h.startTime);
       return {
         id: r.id,
@@ -14866,6 +14874,7 @@ class Rl {
               visualTransform: h.visualTransform,
               separatedAudioClipId: c,
               separatedFromVideoClipId: d,
+              volume: h.volume,
               trackId: l
             }, p = await this.addClip(u);
             s.set(h.id, p);
@@ -14884,7 +14893,7 @@ class Rl {
   * 获取插件版本号
   */
   getVersion() {
-    return wl.version;
+    return _l.version;
   }
   undo() {
     return this.history.undo();
@@ -14920,7 +14929,7 @@ class Rl {
     this.syncScrollLeft(t);
   }
   handleClipUpdate(t, e, i) {
-    this.isExecutingHistoryAction || this.getTimelineHistoryRecorder().recordClipUpdate(t, e, i), this.emitEvent("clip_updated", { clip: t }), Oo({
+    this.isExecutingHistoryAction || this.getTimelineHistoryRecorder().recordClipUpdate(t, e, i), this.emitEvent("clip_updated", { clip: t }), Go({
       notifySelectionChange: this.notifySelectionChange.bind(this),
       reloadClipThumbnailsIfNeeded: () => this.reloadClipThumbnailsIfNeeded(t, e),
       checkTrackDurationChange: this.checkTrackDurationChange.bind(this),
@@ -14948,7 +14957,7 @@ class Rl {
    * @param originalClip 原始片段
    */
   reloadClipThumbnailsIfNeeded(t, e) {
-    Go(t, e, !!this.thumbnailProvider) && this.loadClipThumbnails(t).catch((i) => {
+    Bo(t, e, !!this.thumbnailProvider) && this.loadClipThumbnails(t).catch((i) => {
       O.warn("TimelineManager", "Error reloading clip thumbnails during update:", { error: i, clipId: t.id });
     });
   }
@@ -14957,8 +14966,8 @@ class Rl {
    */
   updateCanPlayState() {
     var n;
-    const t = this.getClips(), e = this.getCurrentTime(), i = Bo(t, e), s = this.canPlay;
-    this.canPlay = Ho({
+    const t = this.getClips(), e = this.getCurrentTime(), i = Ho(t, e), s = this.canPlay;
+    this.canPlay = zo({
       currentCanPlay: this.canPlay,
       nextCanPlay: i,
       playState: this.getPlayStateState(),
@@ -14974,7 +14983,7 @@ class Rl {
     }), s !== this.canPlay && O.debugLazy("TimelineManager", () => "Can play state changed", () => ({ oldState: s, newState: this.canPlay }));
   }
   handleClipSplit(t, e) {
-    Fo({
+    Vo({
       clip1: t,
       clip2: e,
       isExecutingHistoryAction: this.isExecutingHistoryAction,
@@ -14993,7 +15002,7 @@ class Rl {
     });
   }
   handleClipSelect(t) {
-    const e = zo(t);
+    const e = No(t);
     e.shouldJumpToTime && e.jumpTime !== null ? (this.setCurrentTime(e.jumpTime), this.emitEvent("clip_selected", { clip: t }), O.debugLazy("TimelineManager", () => "Empty track clicked, jumping to time", () => ({ time: t.startTime }))) : e.shouldSelectClip && this.selectClip(t.id, t);
   }
   handleActionUndo(t) {
@@ -15012,7 +15021,7 @@ class Rl {
     this.getEventDispatcher().emit(t, e);
   }
   emitSelectedClipChangeIfNeeded() {
-    this.lastSelectedClipId = ol({
+    this.lastSelectedClipId = ll({
       lastSelectedClipId: this.lastSelectedClipId,
       resolveSelectedClip: () => this.resolveSelectedClipSnapshot(),
       emitSelectedClipChange: (t) => this.emitEvent("selected_clip_change", t)
@@ -15035,7 +15044,7 @@ class Rl {
     const i = this.getTrackCollection();
     if (!i.findById(e)) return;
     const s = t.type, n = this.trackManager.getTracksByType(s).length + 1, r = s === "video" ? `视频轨道 ${n}` : `音频轨道 ${n}`;
-    cl({
+    dl({
       clip: t,
       currentTrackId: e,
       trackType: s,
@@ -15087,28 +15096,41 @@ class Rl {
     const t = ((e = this.selectionStore) == null ? void 0 : e.getSelectedClipIds()) ?? [];
     this.getTimelinePresentationAdapter().syncSelection(this.getTrackCollection(), this.selectedClipId, t);
   }
+  syncPrimarySelectionFromSelectionStore(t) {
+    const e = this.selectionStore.getSelectedClipIds();
+    if (e.length === 0) {
+      this.selectedClipId = null;
+      return;
+    }
+    if (t && e.includes(t)) {
+      this.selectedClipId = t;
+      return;
+    }
+    const i = this.selectedClipId;
+    i && e.includes(i) || (this.selectedClipId = e[0] ?? null);
+  }
   selectClip(t, e) {
     var s;
     const i = e || ((s = this.getTimelineCommands().findClipById(this.tracks, t)) == null ? void 0 : s.clip);
-    this.getTimelineCommands().selectClip(t), this.notifySelectionChange(), i && this.emitEvent("clip_selected", { clip: i }), this.emitSelectedClipChangeIfNeeded(), this.syncPreviewSession();
+    this.getTimelineCommands().selectClip(t), this.selectionStore.setSelection([t]), this.notifySelectionChange(), this.emitSelectionChangeEvent(), i && this.emitEvent("clip_selected", { clip: i }), this.emitSelectedClipChangeIfNeeded(), this.syncPreviewSession();
   }
   /**
    * 清空所有轨道的选中状态
    */
   clearSelection() {
-    this.resetMultiDragSession(), this.getTimelineCommands().clearSelection(), this.selectionStore.clear(), this.notifySelectionChange(), this.emitSelectedClipChangeIfNeeded(), this.updateAllTracksSelectionVisual(), this.syncPreviewSession();
+    this.resetMultiDragSession(), this.getTimelineCommands().clearSelection(), this.selectionStore.clear(), this.notifySelectionChange(), this.emitSelectionChangeEvent(), this.emitSelectedClipChangeIfNeeded(), this.syncPreviewSession();
   }
   getSelectedClipIds() {
     return this.selectionStore.getSelectedClipIds();
   }
   addToSelection(t) {
-    this.resetMultiDragSession(), this.selectionStore.addToSelection(t), this.emitSelectionChangeEvent();
+    this.resetMultiDragSession(), this.selectionStore.addToSelection(t), this.syncPrimarySelectionFromSelectionStore(this.selectedClipId ?? t), this.notifySelectionChange(), this.emitSelectionChangeEvent(), this.emitSelectedClipChangeIfNeeded(), this.syncPreviewSession();
   }
   removeFromSelection(t) {
-    this.resetMultiDragSession(), this.selectionStore.removeFromSelection(t), this.emitSelectionChangeEvent();
+    this.resetMultiDragSession(), this.selectionStore.removeFromSelection(t), this.syncPrimarySelectionFromSelectionStore(), this.notifySelectionChange(), this.emitSelectionChangeEvent(), this.emitSelectedClipChangeIfNeeded(), this.syncPreviewSession();
   }
   toggleSelection(t) {
-    this.resetMultiDragSession(), this.selectionStore.toggleSelection(t), this.emitSelectionChangeEvent(), this.updateAllTracksSelectionVisual();
+    this.resetMultiDragSession(), this.selectionStore.toggleSelection(t), this.syncPrimarySelectionFromSelectionStore(t), this.notifySelectionChange(), this.emitSelectionChangeEvent(), this.emitSelectedClipChangeIfNeeded(), this.syncPreviewSession();
   }
   isClipSelected(t) {
     return this.selectionStore.isSelected(t);
@@ -15145,7 +15167,7 @@ class Rl {
     for (const t of this.tracks)
       for (const e of t.getClips())
         this.selectionStore.addToSelection(e.id);
-    this.updateAllTracksSelectionVisual(), this.emitSelectionChangeEvent();
+    this.syncPrimarySelectionFromSelectionStore(this.selectedClipId), this.notifySelectionChange(), this.emitSelectionChangeEvent(), this.emitSelectedClipChangeIfNeeded(), this.syncPreviewSession();
   }
   emitSelectionChangeEvent() {
     this.resetMultiDragSession(), this.emitEvent("selection_change", {
@@ -15228,7 +15250,7 @@ class Rl {
     (t = this.previewSession) != null && t.hasPreview() && (this.clearPendingPreviewState(), this.destroyPreviewSession(), this.recreateDetachedPreviewSession(), this.previewMountContainer = null, O.debugLazy("TimelineManager", () => "TimelineManager detached from preview container"));
   }
   attachClipConfig(t) {
-    const e = new bl();
+    const e = new kl();
     e.init({
       container: t,
       theme: this.config.theme,
@@ -15285,45 +15307,66 @@ class Rl {
     const e = this.getClips().find((i) => i.id === t);
     return !!e && e.type === "video" && !!e.separatedAudioClipId;
   }
+  resolvePreferredSeparatedAudioTrackId(t, e) {
+    var l;
+    if (!this.trackManager || typeof this.trackManager.getTracks != "function")
+      return null;
+    const i = this.resolveTrackIdByClipId(t);
+    if (!i)
+      return null;
+    const s = [...this.getResolvedTracksSnapshot()].sort((h, c) => h.order - c.order), n = s.findIndex((h) => h.id === i);
+    if (n === -1)
+      return null;
+    const r = e.startTime + e.duration, o = s.map((h, c) => ({ track: h, index: c })).filter(({ track: h }) => h.type === "audio").filter(({ track: h }) => !h.clips.some((c) => e.startTime < c.endTime && r > c.startTime));
+    return o.length === 0 ? null : (o.sort((h, c) => {
+      const d = Math.abs(h.index - n) - Math.abs(c.index - n);
+      return d !== 0 ? d : h.index - c.index;
+    }), ((l = o[0]) == null ? void 0 : l.track.id) ?? null);
+  }
   async separateClipAudio(t) {
     if (!this.canSeparateClipAudio(t))
       return null;
-    const e = this.getClips().find((l) => l.id === t);
+    const e = this.getClips().find((h) => h.id === t);
     if (!e || e.type !== "video")
       return null;
-    const i = this.isExecutingHistoryAction;
-    let s = null;
+    const i = this.isExecutingHistoryAction, s = this.resolvePreferredSeparatedAudioTrackId(e.id, {
+      startTime: e.startTime,
+      duration: e.duration
+    });
+    let n = null;
     this.isExecutingHistoryAction = !0;
     try {
-      if (s = await this.addClip({
+      if (n = await this.addClip({
         type: "audio",
         src: e.src,
-        name: `${e.name} 原声`,
+        name: e.name,
         startTime: e.startTime,
         duration: e.duration,
         startTimeAtSource: e.startTimeAtSource,
         endTimeAtSource: e.endTimeAtSource,
         sourceDuration: e.sourceDuration,
         separatedFromVideoClipId: e.id,
-        isMuted: !1
-      }), !s)
+        isMuted: !1,
+        volume: e.volume ?? 1,
+        trackId: s ?? void 0
+      }), !n)
         return null;
       this.updateClip(t, {
         isMuted: !0,
-        separatedAudioClipId: s
+        separatedAudioClipId: n
       });
     } finally {
       this.isExecutingHistoryAction = i;
     }
-    if (!s)
+    if (!n)
       return null;
-    const n = this.getClips().find((l) => l.id === t), r = this.getClips().find((l) => l.id === s) ?? null, o = this.resolveTrackIdByClipId(s);
-    return n ? (i || this.getTimelineHistoryRecorder().recordSeparateClipAudio(
+    const r = this.getClips().find((h) => h.id === t), o = this.getClips().find((h) => h.id === n) ?? null, l = this.resolveTrackIdByClipId(n);
+    return r ? (i || this.getTimelineHistoryRecorder().recordSeparateClipAudio(
       e,
-      n,
       r,
-      o
-    ), s) : null;
+      o,
+      l
+    ), n) : null;
   }
   restoreClipAudio(t) {
     if (!this.canRestoreClipAudio(t))
@@ -15418,14 +15461,14 @@ class Rl {
       }), !1;
     if (n.status !== "ready")
       return !1;
-    const { sourceTrackId: r, targetTrackId: o } = n, l = i ? { ...i } : { ...n.clip }, h = s ? { ...s } : { ...n.clip }, c = this.cloneTrackSnapshot(r), d = this.cloneTrackSnapshot(o), u = hl({
+    const { sourceTrackId: r, targetTrackId: o } = n, l = i ? { ...i } : { ...n.clip }, h = s ? { ...s } : { ...n.clip }, c = this.cloneTrackSnapshot(r), d = this.cloneTrackSnapshot(o), u = cl({
       command: {
         ...n,
         clip: h
       },
       trackCollection: this.getTrackCollection()
     }), p = this.getClips().find((g) => g.id === t) ?? null;
-    return No({
+    return Fo({
       applied: u,
       clipId: t,
       sourceTrackId: r,
@@ -15436,7 +15479,7 @@ class Rl {
       targetTrackSnapshot: d,
       isExecutingHistoryAction: this.isExecutingHistoryAction,
       recordMoveClipBetweenTracks: this.getTimelineHistoryRecorder().recordMoveClipBetweenTracks.bind(this.getTimelineHistoryRecorder()),
-      applyEffects: () => dl({
+      applyEffects: () => ul({
         notifySelectionChange: this.notifySelectionChange.bind(this),
         cleanupEmptyTracks: this.cleanupEmptyTracks.bind(this),
         updateTrackInfoPanel: this.updateTrackInfoPanel.bind(this),
@@ -15449,11 +15492,11 @@ class Rl {
     }) ? (this.clearAllTrackDropPreviews(), !0) : !1;
   }
   /**
-   * 获取轨道内的总时长（包含空隙）
-   * @returns 从0到最后一个clip结束时间的总时长（毫秒）
+   * 获取轨道内的有效总时长（去除首尾空白）
+   * @returns 最早 clip 起点到最晚 clip 终点的时长（毫秒）
    */
   getTrackTotalDuration() {
-    return Tn(this.getClips());
+    return ws(this.getClips());
   }
   destroy() {
     var t, e, i, s, n, r, o, l, h, c, d;
@@ -15500,10 +15543,10 @@ class Rl {
     return null;
   }
   handleClipToggleSelection(t) {
-    this.resetMultiDragSession(), this.selectionStore.toggleSelection(t), this.emitSelectionChangeEvent(), this.updateAllTracksSelectionVisual();
+    this.resetMultiDragSession(), this.selectionStore.toggleSelection(t), this.syncPrimarySelectionFromSelectionStore(t), this.notifySelectionChange(), this.emitSelectionChangeEvent(), this.emitSelectedClipChangeIfNeeded(), this.syncPreviewSession();
   }
   handleSetSingleSelection(t) {
-    this.resetMultiDragSession(), this.selectionStore.setSelection([t]), this.emitSelectionChangeEvent(), this.updateAllTracksSelectionVisual();
+    this.resetMultiDragSession(), this.selectionStore.setSelection([t]), this.syncPrimarySelectionFromSelectionStore(t), this.notifySelectionChange(), this.emitSelectionChangeEvent(), this.emitSelectedClipChangeIfNeeded(), this.syncPreviewSession();
   }
   getMultiDragClipIds(t) {
     return this.selectionStore.isSelected(t) && this.selectionStore.getSelectionCount() > 1 ? this.selectionStore.getSelectedClipIds() : null;
@@ -16010,27 +16053,20 @@ class Rl {
    * 检查轨道总时长是否变化，如果变化则触发事件并更新时间轴时长
    */
   checkTrackDurationChange() {
-    const t = this.lastTrackDuration, e = il({
-      clips: this.getClips(),
-      lastTrackDuration: this.lastTrackDuration,
-      setLastTrackDuration: (i) => {
-        this.lastTrackDuration = i;
-      },
-      setTimelineDuration: (i) => {
-        var s;
-        this.setDurationState(i), (s = this.timeline) == null || s.setDuration(i), this.updateViewportLayout();
-      },
-      emitTrackDurationChange: (i) => {
-        this.emitEvent("track_duration_change", { duration: i });
-      }
-    });
-    e !== t && O.debugLazy(
+    var r;
+    const t = this.getClips(), e = this.lastTrackDuration, i = this.lastEffectiveTrackDuration, s = sl(t), n = ws(t);
+    if (s !== e) {
+      this.lastTrackDuration = s;
+      const o = _s(s);
+      this.setDurationState(o), (r = this.timeline) == null || r.setDuration(o), this.updateViewportLayout();
+    }
+    n !== i && (this.lastEffectiveTrackDuration = n, this.emitEvent("track_duration_change", { duration: n })), !(s === e && n === i) && O.debugLazy(
       "TimelineManager",
-      () => `Track duration changed: ${e}ms, setting timeline duration to ${vn(e)}ms`
+      () => `Track duration changed: effective=${n}ms, extent=${s}ms, timeline=${_s(s)}ms`
     );
   }
   resolveSelectedClipSnapshot() {
-    return al({
+    return ol({
       getSelectedClip: () => {
         var t;
         return ((t = this.getSelectedClip) == null ? void 0 : t.call(this)) || null;
@@ -16043,7 +16079,7 @@ class Rl {
     if (!i || i.type !== "video")
       return;
     const s = gt(i.visualTransform), n = gt(e);
-    Cn(s, n) || this.updateClip(t, {
+    vn(s, n) || this.updateClip(t, {
       visualTransform: n
     });
   }
@@ -16068,31 +16104,31 @@ class Rl {
   }
 }
 export {
-  Il as CLIP_LAYER,
+  Ml as CLIP_LAYER,
   ai as Clip,
-  Mo as ClipConfigPanel,
-  An as DEFAULT_CLIP_VIEW_STATE,
+  Lo as ClipConfigPanel,
+  En as DEFAULT_CLIP_VIEW_STATE,
   wt as DEFAULT_PREVIEW_ASPECT_RATIO,
   ms as HistoryManager,
   Xe as MIN_CLIP_LINE_WIDTH,
-  El as PREVIEW_ASPECT_RATIO_PRESETS,
-  Dl as Playhead,
+  Il as PREVIEW_ASPECT_RATIO_PRESETS,
+  Rl as Playhead,
   ot as TIMELINE_LEFT_PADDING,
-  Ml as TIME_SCALE,
+  Ll as TIME_SCALE,
   Dt as TRACK_HEIGHT,
   z as TimeUtils,
-  Ll as Timeline,
-  Rl as TimelineManager,
+  Dl as Timeline,
+  Ol as TimelineManager,
   _i as Track,
-  Ao as TrackInfoPanel,
-  gl as TrackManager,
-  En as ZOOM_ANIMATION,
+  Eo as TrackInfoPanel,
+  pl as TrackManager,
+  In as ZOOM_ANIMATION,
   ut as ZOOM_PRESETS,
-  In as createClipViewState,
-  Ds as createClipWithViewState,
+  Mn as createClipViewState,
+  Os as createClipWithViewState,
   di as defaultDarkTheme,
   pe as isAutoPreviewAspectRatioMode,
   Nt as normalizePreviewAspectRatio,
-  Ls as normalizePreviewAspectRatioMode,
+  Rs as normalizePreviewAspectRatioMode,
   Ye as resolveTheme
 };