@libp2p/daemon-client 9.0.7 → 9.0.8-0f07e3df5

This diff represents the content of publicly available package versions that have been released to one of the supported registries. The information contained in this diff is provided for informational purposes only and reflects changes between package versions as they appear in their respective public registries.
@@ -1,7 +1,7 @@
1
1
  {
2
2
  "version": 3,
3
- "sources": ["../src/index.ts", "../../../node_modules/uint8arrays/src/alloc.node.ts", "../../../node_modules/uint8arrays/src/util/as-uint8array.node.ts", "../../../node_modules/uint8-varint/src/index.ts", "../../../node_modules/protons-runtime/src/utils/float.ts", "../../../node_modules/protons-runtime/src/utils/longbits.ts", "../../../node_modules/protons-runtime/src/utils/utf8.ts", "../../../node_modules/protons-runtime/src/utils/reader.ts", "../../../node_modules/protons-runtime/src/decode.ts", "../../../node_modules/uint8arrays/src/from-string.node.ts", "../../../node_modules/multiformats/src/bases/base10.ts", "../../../node_modules/multiformats/src/bytes.ts", "../../../node_modules/multiformats/src/vendor/base-x.js", "../../../node_modules/multiformats/src/bases/base.ts", "../../../node_modules/multiformats/src/bases/base16.ts", "../../../node_modules/multiformats/src/bases/base2.ts", "../../../node_modules/multiformats/src/bases/base256emoji.ts", "../../../node_modules/multiformats/src/bases/base32.ts", "../../../node_modules/multiformats/src/bases/base36.ts", "../../../node_modules/multiformats/src/bases/base58.ts", "../../../node_modules/multiformats/src/bases/base64.ts", "../../../node_modules/multiformats/src/bases/base8.ts", "../../../node_modules/multiformats/src/bases/identity.ts", "../../../node_modules/multiformats/src/codecs/json.ts", "../../../node_modules/multiformats/src/hashes/identity.ts", "../../../node_modules/multiformats/src/vendor/varint.js", "../../../node_modules/multiformats/src/varint.ts", "../../../node_modules/multiformats/src/hashes/digest.ts", "../../../node_modules/multiformats/src/hashes/sha2.ts", "../../../node_modules/multiformats/src/hashes/hasher.ts", "../../../node_modules/multiformats/src/cid.ts", "../../../node_modules/multiformats/src/basics.ts", "../../../node_modules/uint8arrays/src/util/bases.ts", "../../../node_modules/protons-runtime/src/utils/pool.ts", "../../../node_modules/protons-runtime/src/utils/writer.ts", "../../../node_modules/protons-runtime/src/encode.ts", "../../../node_modules/protons-runtime/src/codec.ts", "../../../node_modules/protons-runtime/src/codecs/enum.ts", "../../../node_modules/protons-runtime/src/codecs/message.ts", "../../libp2p-daemon-protocol/src/index.ts", "../../../node_modules/weald/src/node.ts", "../../../node_modules/weald/node_modules/ms/dist/index.mjs", "../../../node_modules/weald/node_modules/supports-color/index.js", "../../../node_modules/weald/src/common.ts", "../../../node_modules/weald/src/index.ts", "../../../node_modules/@libp2p/logger/src/index.ts", "../../../node_modules/p-defer/index.js", "../../../node_modules/race-signal/src/index.ts", "../../../node_modules/it-queueless-pushable/src/index.ts", "../../../node_modules/uint8arrays/src/concat.node.ts", "../../../node_modules/uint8arrays/src/equals.ts", "../../../node_modules/uint8arraylist/src/index.ts", "../../../node_modules/it-byte-stream/src/errors.ts", "../../../node_modules/it-byte-stream/src/index.ts", "../../../node_modules/it-length-prefixed-stream/src/errors.ts", "../../../node_modules/it-length-prefixed-stream/src/index.ts", "../../libp2p-daemon-protocol/src/stream-handler.ts", "../../../node_modules/any-signal/src/index.ts", "../../libp2p-daemon-protocol/src/upgrader.ts", "../../../node_modules/@libp2p/interface/src/peer-id.ts", "../../../node_modules/@libp2p/interface/src/transport.ts", "../../../node_modules/@libp2p/interface/src/errors.ts", "../../../node_modules/main-event/src/events.ts", "../../../node_modules/main-event/src/index.ts", "../../../node_modules/@libp2p/interface/src/index.ts", "../../../node_modules/uint8arrays/src/to-string.node.ts", "../../../node_modules/@libp2p/crypto/src/keys/rsa/der.ts", "../../../node_modules/@libp2p/crypto/src/keys/ecdsa/index.ts", "../../../node_modules/@libp2p/crypto/src/keys/ecdsa/utils.ts", "../../../node_modules/@libp2p/crypto/src/keys/ecdsa/ecdsa.ts", "../../../node_modules/@libp2p/crypto/src/keys/ed25519/index.ts", "../../../node_modules/@libp2p/crypto/src/util.ts", "../../../node_modules/@libp2p/crypto/src/keys/ed25519/ed25519.ts", "../../../node_modules/@libp2p/crypto/src/keys/ed25519/utils.ts", "../../../node_modules/@libp2p/crypto/src/keys/keys.ts", "../../../node_modules/@noble/hashes/src/cryptoNode.ts", "../../../node_modules/@noble/hashes/src/utils.ts", "../../../node_modules/@noble/hashes/src/_md.ts", "../../../node_modules/@noble/hashes/src/sha2.ts", "../../../node_modules/@libp2p/crypto/src/keys/secp256k1/index.ts", "../../../node_modules/@noble/hashes/src/hmac.ts", "../../../node_modules/@noble/curves/src/utils.ts", "../../../node_modules/@noble/curves/src/abstract/modular.ts", "../../../node_modules/@noble/curves/src/abstract/curve.ts", "../../../node_modules/@noble/curves/src/abstract/weierstrass.ts", "../../../node_modules/@noble/curves/src/_shortw_utils.ts", "../../../node_modules/@noble/curves/src/secp256k1.ts", "../../../node_modules/@libp2p/crypto/src/errors.ts", "../../../node_modules/@libp2p/crypto/src/keys/secp256k1/secp256k1.ts", "../../../node_modules/@libp2p/crypto/src/keys/secp256k1/utils.ts", "../../../node_modules/@libp2p/crypto/src/keys/index.ts", "../../../node_modules/@libp2p/peer-id/src/peer-id.ts", "../../../node_modules/@libp2p/peer-id/src/index.ts", "../../../node_modules/@libp2p/tcp/src/tcp.ts", "../../../node_modules/@multiformats/multiaddr/src/errors.ts", "../../../node_modules/@chainsafe/is-ip/src/is-ip.node.ts", "../../../node_modules/@multiformats/multiaddr/src/utils.ts", "../../../node_modules/@multiformats/multiaddr/src/validation.ts", "../../../node_modules/@multiformats/multiaddr/src/registry.ts", "../../../node_modules/@multiformats/multiaddr/src/components.ts", "../../../node_modules/@multiformats/multiaddr/src/multiaddr.ts", "../../../node_modules/@chainsafe/is-ip/src/parser.ts", "../../../node_modules/@chainsafe/is-ip/src/parse.ts", "../../../node_modules/@chainsafe/netmask/src/ip.ts", "../../../node_modules/@multiformats/multiaddr/src/index.ts", "../../../node_modules/@multiformats/multiaddr-matcher/src/utils.ts", "../../../node_modules/@multiformats/multiaddr-matcher/src/index.ts", "../../../node_modules/progress-events/src/index.ts", "../../../node_modules/@libp2p/tcp/src/listener.ts", "../../../node_modules/@libp2p/utils/src/get-thin-waist-addresses.ts", "../../../node_modules/@libp2p/utils/src/link-local-ip.ts", "../../../node_modules/p-timeout/index.js", "../../../node_modules/p-event/index.js", "../../../node_modules/@libp2p/utils/src/ip-port-to-multiaddr.ts", "../../../node_modules/abort-error/src/index.ts", "../../../node_modules/race-event/src/index.ts", "../../../node_modules/stream-to-it/src/source.ts", "../../../node_modules/stream-to-it/src/sink.ts", "../../../node_modules/stream-to-it/src/duplex.ts", "../../../node_modules/@libp2p/tcp/src/utils.ts", "../../../node_modules/@libp2p/tcp/src/socket-to-conn.ts", "../../../node_modules/@libp2p/tcp/src/index.ts", "../../../node_modules/it-protobuf-stream/src/index.ts", "../src/dht.ts", "../src/pubsub.ts"],
4
- "sourcesContent": ["import { Request, Response, StreamInfo } from '@libp2p/daemon-protocol'\nimport { StreamHandler } from '@libp2p/daemon-protocol/stream-handler'\nimport { PassThroughUpgrader } from '@libp2p/daemon-protocol/upgrader'\nimport { InvalidParametersError, isPeerId } from '@libp2p/interface'\nimport { defaultLogger, logger } from '@libp2p/logger'\nimport { peerIdFromMultihash } from '@libp2p/peer-id'\nimport { tcp } from '@libp2p/tcp'\nimport { multiaddr, isMultiaddr } from '@multiformats/multiaddr'\nimport { pbStream } from 'it-protobuf-stream'\nimport * as Digest from 'multiformats/hashes/digest'\nimport { DHT } from './dht.js'\nimport { Pubsub } from './pubsub.js'\nimport type { PSMessage } from '@libp2p/daemon-protocol'\nimport type { Stream, PeerId, MultiaddrConnection, PeerInfo, Transport, Listener } from '@libp2p/interface'\nimport type { Multiaddr } from '@multiformats/multiaddr'\nimport type { ProtobufStream } from 'it-protobuf-stream'\nimport type { CID } from 'multiformats/cid'\n\nconst log = logger('libp2p:daemon-client')\n\nexport class OperationFailedError extends Error {\n constructor (message = 'Operation failed') {\n super(message)\n this.name = 'OperationFailedError'\n }\n}\n\nclass Client implements DaemonClient {\n private readonly multiaddr: Multiaddr\n public dht: DHT\n public pubsub: Pubsub\n private readonly tcp: Transport\n\n constructor (addr: Multiaddr) {\n this.multiaddr = addr\n this.tcp = tcp()({\n logger: defaultLogger()\n })\n this.dht = new DHT(this)\n this.pubsub = new Pubsub(this)\n }\n\n /**\n * Connects to a daemon at the unix socket path the daemon\n * was created with\n *\n * @async\n * @returns {MultiaddrConnection}\n */\n async connectDaemon (signal?: AbortSignal): Promise<MultiaddrConnection> {\n // @ts-expect-error because we use a passthrough upgrader,\n // this is actually a MultiaddrConnection and not a Connection\n return this.tcp.dial(this.multiaddr, {\n upgrader: new PassThroughUpgrader(),\n signal: signal ?? AbortSignal.timeout(10_000)\n })\n }\n\n /**\n * Sends the request to the daemon and returns a stream. This\n * should only be used when sending daemon requests.\n */\n async send (request: Request): Promise<ProtobufStream<MultiaddrConnection>> {\n const maConn = await this.connectDaemon()\n\n const subtype = request.pubsub?.type ?? request.dht?.type ?? request.peerStore?.type ?? ''\n log('send', request.type, subtype)\n\n const pb = pbStream(maConn)\n await pb.write(request, Request)\n\n return pb\n }\n\n /**\n * Connect requests a connection to a known peer on a given set of addresses\n */\n async connect (peerId: PeerId, addrs: Multiaddr[]): Promise<void> {\n if (!isPeerId(peerId)) {\n throw new InvalidParametersError('invalid peer id received')\n }\n\n if (!Array.isArray(addrs)) {\n throw new InvalidParametersError('addrs received are not in an array')\n }\n\n addrs.forEach((addr) => {\n if (!isMultiaddr(addr)) {\n throw new InvalidParametersError('received an address that is not a multiaddr')\n }\n })\n\n const sh = await this.send({\n type: Request.Type.CONNECT,\n connect: {\n peer: peerId.toMultihash().bytes,\n addrs: addrs.map((a) => a.bytes)\n }\n })\n\n const response = await sh.read(Response)\n\n if (response.type !== Response.Type.OK) {\n const errResponse = response.error ?? { msg: 'unspecified' }\n throw new OperationFailedError(errResponse.msg ?? 'unspecified')\n }\n\n await sh.unwrap().close()\n }\n\n /**\n * @typedef {object} IdentifyResponse\n * @property {PeerId} peerId\n * @property {Array.<multiaddr>} addrs\n */\n\n /**\n * Identify queries the daemon for its peer ID and listen addresses.\n */\n async identify (): Promise<IdentifyResult> {\n const sh = await this.send({\n type: Request.Type.IDENTIFY\n })\n\n const response = await sh.read(Response)\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'Identify failed')\n }\n\n if (response.identify?.addrs == null) {\n throw new OperationFailedError('Invalid response')\n }\n\n const peerId = peerIdFromMultihash(Digest.decode(response.identify?.id))\n const addrs = response.identify.addrs.map((a) => multiaddr(a))\n\n await sh.unwrap().close()\n\n return ({ peerId, addrs })\n }\n\n /**\n * Get a list of IDs of peers the node is connected to\n */\n async listPeers (): Promise<PeerId[]> {\n const sh = await this.send({\n type: Request.Type.LIST_PEERS\n })\n\n const response = await sh.read(Response)\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'List peers failed')\n }\n\n await sh.unwrap().close()\n\n return response.peers.map((peer) => peerIdFromMultihash(Digest.decode(peer.id)))\n }\n\n /**\n * Initiate an outbound stream to a peer on one of a set of protocols.\n */\n async openStream (peerId: PeerId, protocol: string): Promise<MultiaddrConnection> {\n if (!isPeerId(peerId)) {\n throw new InvalidParametersError('invalid peer id received')\n }\n\n if (typeof protocol !== 'string') {\n throw new InvalidParametersError('invalid protocol received')\n }\n\n const sh = await this.send({\n type: Request.Type.STREAM_OPEN,\n streamOpen: {\n peer: peerId.toMultihash().bytes,\n proto: [protocol]\n }\n })\n\n const response = await sh.read(Response)\n\n if (response.type !== Response.Type.OK) {\n await sh.unwrap().close()\n throw new OperationFailedError(response.error?.msg ?? 'Open stream failed')\n }\n\n return sh.unwrap()\n }\n\n /**\n * Register a handler for inbound streams on a given protocol\n */\n async registerStreamHandler (protocol: string, handler: StreamHandlerFunction): Promise<void> {\n if (typeof protocol !== 'string') {\n throw new InvalidParametersError('invalid protocol received')\n }\n\n // open a tcp port, pipe any data from it to the handler function\n const listener = this.tcp.createListener({\n upgrader: new PassThroughUpgrader((maConn) => {\n this.onConnection(protocol, listener, handler, maConn)\n })\n })\n await listener.listen(multiaddr('/ip4/127.0.0.1/tcp/0'))\n const address = listener.getAddrs()[0]\n\n if (address == null) {\n throw new OperationFailedError('Could not listen on port')\n }\n\n const sh = await this.send({\n type: Request.Type.STREAM_HANDLER,\n streamHandler: {\n addr: address.bytes,\n proto: [protocol]\n }\n })\n\n const response = await sh.read(Response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'Register stream handler failed')\n }\n }\n\n private onConnection (protocol: string, listener: Listener, handler: StreamHandlerFunction, connection: MultiaddrConnection): void {\n Promise.resolve()\n .then(async () => {\n const sh = new StreamHandler({\n stream: connection\n })\n const message = await sh.read()\n\n if (message == null) {\n throw new OperationFailedError('Could not read open stream response')\n }\n\n const response = StreamInfo.decode(message)\n\n if (response.proto !== protocol) {\n throw new OperationFailedError('Incorrect protocol')\n }\n\n // @ts-expect-error because we are using a passthrough upgrader, this is a MultiaddrConnection\n await handler(sh.rest())\n })\n .catch(err => {\n connection.abort(err)\n })\n .finally(() => {\n connection.close()\n .catch(err => {\n log.error(err)\n })\n listener.close()\n .catch(err => {\n log.error(err)\n })\n })\n }\n}\n\nexport interface IdentifyResult {\n peerId: PeerId\n addrs: Multiaddr[]\n}\n\nexport interface StreamHandlerFunction {\n (stream: Stream): Promise<void>\n}\n\nexport interface DHTClient {\n put(key: Uint8Array, value: Uint8Array): Promise<void>\n get(key: Uint8Array): Promise<Uint8Array>\n provide(cid: CID): Promise<void>\n findProviders(cid: CID, count?: number): AsyncIterable<PeerInfo>\n findPeer(peerId: PeerId): Promise<PeerInfo>\n getClosestPeers(key: Uint8Array): AsyncIterable<PeerInfo>\n}\n\nexport interface Subscription {\n messages(): AsyncIterable<PSMessage>\n cancel(): Promise<void>\n}\n\nexport interface PubSubClient {\n publish(topic: string, data: Uint8Array): Promise<void>\n subscribe(topic: string): Promise<Subscription>\n getTopics(): Promise<string[]>\n getSubscribers(topic: string): Promise<PeerId[]>\n}\n\nexport interface DaemonClient {\n identify(): Promise<IdentifyResult>\n listPeers(): Promise<PeerId[]>\n connect(peerId: PeerId, addrs: Multiaddr[]): Promise<void>\n dht: DHTClient\n pubsub: PubSubClient\n\n send(request: Request): Promise<ProtobufStream<MultiaddrConnection>>\n openStream(peerId: PeerId, protocol: string): Promise<MultiaddrConnection>\n registerStreamHandler(protocol: string, handler: StreamHandlerFunction): Promise<void>\n}\n\nexport function createClient (multiaddr: Multiaddr): DaemonClient {\n return new Client(multiaddr)\n}\n", "import { Buffer } from 'node:buffer'\nimport { asUint8Array } from '#util/as-uint8array'\n\n/**\n * Returns a `Uint8Array` of the requested size. Referenced memory will\n * be initialized to 0.\n */\nexport function alloc (size: number = 0): Uint8Array {\n return asUint8Array(Buffer.alloc(size))\n}\n\n/**\n * Where possible returns a Uint8Array of the requested size that references\n * uninitialized memory. Only use if you are certain you will immediately\n * overwrite every value in the returned `Uint8Array`.\n */\nexport function allocUnsafe (size: number = 0): Uint8Array {\n return asUint8Array(Buffer.allocUnsafe(size))\n}\n", "/**\n * To guarantee Uint8Array semantics, convert nodejs Buffers\n * into vanilla Uint8Arrays\n */\nexport function asUint8Array (buf: Uint8Array): Uint8Array {\n return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength)\n}\n", "/* eslint-disable no-fallthrough */\nimport { allocUnsafe } from 'uint8arrays/alloc'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nconst N1 = Math.pow(2, 7)\nconst N2 = Math.pow(2, 14)\nconst N3 = Math.pow(2, 21)\nconst N4 = Math.pow(2, 28)\nconst N5 = Math.pow(2, 35)\nconst N6 = Math.pow(2, 42)\nconst N7 = Math.pow(2, 49)\n\n/** Most significant bit of a byte */\nconst MSB = 0x80\n/** Rest of the bits in a byte */\nconst REST = 0x7f\n\nexport function encodingLength (value: number): number {\n if (value < N1) {\n return 1\n }\n\n if (value < N2) {\n return 2\n }\n\n if (value < N3) {\n return 3\n }\n\n if (value < N4) {\n return 4\n }\n\n if (value < N5) {\n return 5\n }\n\n if (value < N6) {\n return 6\n }\n\n if (value < N7) {\n return 7\n }\n\n if (Number.MAX_SAFE_INTEGER != null && value > Number.MAX_SAFE_INTEGER) {\n throw new RangeError('Could not encode varint')\n }\n\n return 8\n}\n\nexport function encodeUint8Array (value: number, buf: Uint8Array, offset: number = 0): Uint8Array {\n switch (encodingLength(value)) {\n case 8: {\n buf[offset++] = (value & 0xFF) | MSB\n value /= 128\n }\n case 7: {\n buf[offset++] = (value & 0xFF) | MSB\n value /= 128\n }\n case 6: {\n buf[offset++] = (value & 0xFF) | MSB\n value /= 128\n }\n case 5: {\n buf[offset++] = (value & 0xFF) | MSB\n value /= 128\n }\n case 4: {\n buf[offset++] = (value & 0xFF) | MSB\n value >>>= 7\n }\n case 3: {\n buf[offset++] = (value & 0xFF) | MSB\n value >>>= 7\n }\n case 2: {\n buf[offset++] = (value & 0xFF) | MSB\n value >>>= 7\n }\n case 1: {\n buf[offset++] = (value & 0xFF)\n value >>>= 7\n break\n }\n default: throw new Error('unreachable')\n }\n return buf\n}\n\nexport function encodeUint8ArrayList (value: number, buf: Uint8ArrayList, offset: number = 0): Uint8ArrayList {\n switch (encodingLength(value)) {\n case 8: {\n buf.set(offset++, (value & 0xFF) | MSB)\n value /= 128\n }\n case 7: {\n buf.set(offset++, (value & 0xFF) | MSB)\n value /= 128\n }\n case 6: {\n buf.set(offset++, (value & 0xFF) | MSB)\n value /= 128\n }\n case 5: {\n buf.set(offset++, (value & 0xFF) | MSB)\n value /= 128\n }\n case 4: {\n buf.set(offset++, (value & 0xFF) | MSB)\n value >>>= 7\n }\n case 3: {\n buf.set(offset++, (value & 0xFF) | MSB)\n value >>>= 7\n }\n case 2: {\n buf.set(offset++, (value & 0xFF) | MSB)\n value >>>= 7\n }\n case 1: {\n buf.set(offset++, (value & 0xFF))\n value >>>= 7\n break\n }\n default: throw new Error('unreachable')\n }\n return buf\n}\n\nexport function decodeUint8Array (buf: Uint8Array, offset: number): number {\n let b = buf[offset]\n let res = 0\n\n res += b & REST\n if (b < MSB) {\n return res\n }\n\n b = buf[offset + 1]\n res += (b & REST) << 7\n if (b < MSB) {\n return res\n }\n\n b = buf[offset + 2]\n res += (b & REST) << 14\n if (b < MSB) {\n return res\n }\n\n b = buf[offset + 3]\n res += (b & REST) << 21\n if (b < MSB) {\n return res\n }\n\n b = buf[offset + 4]\n res += (b & REST) * N4\n if (b < MSB) {\n return res\n }\n\n b = buf[offset + 5]\n res += (b & REST) * N5\n if (b < MSB) {\n return res\n }\n\n b = buf[offset + 6]\n res += (b & REST) * N6\n if (b < MSB) {\n return res\n }\n\n b = buf[offset + 7]\n res += (b & REST) * N7\n if (b < MSB) {\n return res\n }\n\n throw new RangeError('Could not decode varint')\n}\n\nexport function decodeUint8ArrayList (buf: Uint8ArrayList, offset: number): number {\n let b = buf.get(offset)\n let res = 0\n\n res += b & REST\n if (b < MSB) {\n return res\n }\n\n b = buf.get(offset + 1)\n res += (b & REST) << 7\n if (b < MSB) {\n return res\n }\n\n b = buf.get(offset + 2)\n res += (b & REST) << 14\n if (b < MSB) {\n return res\n }\n\n b = buf.get(offset + 3)\n res += (b & REST) << 21\n if (b < MSB) {\n return res\n }\n\n b = buf.get(offset + 4)\n res += (b & REST) * N4\n if (b < MSB) {\n return res\n }\n\n b = buf.get(offset + 5)\n res += (b & REST) * N5\n if (b < MSB) {\n return res\n }\n\n b = buf.get(offset + 6)\n res += (b & REST) * N6\n if (b < MSB) {\n return res\n }\n\n b = buf.get(offset + 7)\n res += (b & REST) * N7\n if (b < MSB) {\n return res\n }\n\n throw new RangeError('Could not decode varint')\n}\n\nexport function encode (value: number): Uint8Array\nexport function encode (value: number, buf: Uint8Array, offset?: number): Uint8Array\nexport function encode (value: number, buf: Uint8ArrayList, offset?: number): Uint8ArrayList\nexport function encode <T extends Uint8Array | Uint8ArrayList = Uint8Array> (value: number, buf?: T, offset: number = 0): T {\n if (buf == null) {\n buf = allocUnsafe(encodingLength(value)) as T\n }\n if (buf instanceof Uint8Array) {\n return encodeUint8Array(value, buf, offset) as T\n } else {\n return encodeUint8ArrayList(value, buf, offset) as T\n }\n}\n\nexport function decode (buf: Uint8ArrayList | Uint8Array, offset: number = 0): number {\n if (buf instanceof Uint8Array) {\n return decodeUint8Array(buf, offset)\n } else {\n return decodeUint8ArrayList(buf, offset)\n }\n}\n", "const f32 = new Float32Array([-0])\nconst f8b = new Uint8Array(f32.buffer)\n\n/**\n * Writes a 32 bit float to a buffer using little endian byte order\n */\nexport function writeFloatLE (val: number, buf: Uint8Array, pos: number): void {\n f32[0] = val\n buf[pos] = f8b[0]\n buf[pos + 1] = f8b[1]\n buf[pos + 2] = f8b[2]\n buf[pos + 3] = f8b[3]\n}\n\n/**\n * Writes a 32 bit float to a buffer using big endian byte order\n */\nexport function writeFloatBE (val: number, buf: Uint8Array, pos: number): void {\n f32[0] = val\n buf[pos] = f8b[3]\n buf[pos + 1] = f8b[2]\n buf[pos + 2] = f8b[1]\n buf[pos + 3] = f8b[0]\n}\n\n/**\n * Reads a 32 bit float from a buffer using little endian byte order\n */\nexport function readFloatLE (buf: Uint8Array, pos: number): number {\n f8b[0] = buf[pos]\n f8b[1] = buf[pos + 1]\n f8b[2] = buf[pos + 2]\n f8b[3] = buf[pos + 3]\n return f32[0]\n}\n\n/**\n * Reads a 32 bit float from a buffer using big endian byte order\n */\nexport function readFloatBE (buf: Uint8Array, pos: number): number {\n f8b[3] = buf[pos]\n f8b[2] = buf[pos + 1]\n f8b[1] = buf[pos + 2]\n f8b[0] = buf[pos + 3]\n return f32[0]\n}\n\nconst f64 = new Float64Array([-0])\nconst d8b = new Uint8Array(f64.buffer)\n\n/**\n * Writes a 64 bit double to a buffer using little endian byte order\n */\nexport function writeDoubleLE (val: number, buf: Uint8Array, pos: number): void {\n f64[0] = val\n buf[pos] = d8b[0]\n buf[pos + 1] = d8b[1]\n buf[pos + 2] = d8b[2]\n buf[pos + 3] = d8b[3]\n buf[pos + 4] = d8b[4]\n buf[pos + 5] = d8b[5]\n buf[pos + 6] = d8b[6]\n buf[pos + 7] = d8b[7]\n}\n\n/**\n * Writes a 64 bit double to a buffer using big endian byte order\n */\nexport function writeDoubleBE (val: number, buf: Uint8Array, pos: number): void {\n f64[0] = val\n buf[pos] = d8b[7]\n buf[pos + 1] = d8b[6]\n buf[pos + 2] = d8b[5]\n buf[pos + 3] = d8b[4]\n buf[pos + 4] = d8b[3]\n buf[pos + 5] = d8b[2]\n buf[pos + 6] = d8b[1]\n buf[pos + 7] = d8b[0]\n}\n\n/**\n * Reads a 64 bit double from a buffer using little endian byte order\n */\nexport function readDoubleLE (buf: Uint8Array, pos: number): number {\n d8b[0] = buf[pos]\n d8b[1] = buf[pos + 1]\n d8b[2] = buf[pos + 2]\n d8b[3] = buf[pos + 3]\n d8b[4] = buf[pos + 4]\n d8b[5] = buf[pos + 5]\n d8b[6] = buf[pos + 6]\n d8b[7] = buf[pos + 7]\n return f64[0]\n}\n\n/**\n * Reads a 64 bit double from a buffer using big endian byte order\n */\nexport function readDoubleBE (buf: Uint8Array, pos: number): number {\n d8b[7] = buf[pos]\n d8b[6] = buf[pos + 1]\n d8b[5] = buf[pos + 2]\n d8b[4] = buf[pos + 3]\n d8b[3] = buf[pos + 4]\n d8b[2] = buf[pos + 5]\n d8b[1] = buf[pos + 6]\n d8b[0] = buf[pos + 7]\n return f64[0]\n}\n", "// the largest BigInt we can safely downcast to a Number\nconst MAX_SAFE_NUMBER_INTEGER = BigInt(Number.MAX_SAFE_INTEGER)\nconst MIN_SAFE_NUMBER_INTEGER = BigInt(Number.MIN_SAFE_INTEGER)\n\n/**\n * Constructs new long bits.\n *\n * @classdesc Helper class for working with the low and high bits of a 64 bit value.\n * @memberof util\n * @function Object() { [native code] }\n * @param {number} lo - Low 32 bits, unsigned\n * @param {number} hi - High 32 bits, unsigned\n */\nexport class LongBits {\n public lo: number\n public hi: number\n\n constructor (lo: number, hi: number) {\n // note that the casts below are theoretically unnecessary as of today, but older statically\n // generated converter code might still call the ctor with signed 32bits. kept for compat.\n\n /**\n * Low bits\n */\n this.lo = lo | 0\n\n /**\n * High bits\n */\n this.hi = hi | 0\n }\n\n /**\n * Converts this long bits to a possibly unsafe JavaScript number\n */\n toNumber (unsigned: boolean = false): number {\n if (!unsigned && (this.hi >>> 31) > 0) {\n const lo = ~this.lo + 1 >>> 0\n let hi = ~this.hi >>> 0\n if (lo === 0) {\n hi = hi + 1 >>> 0\n }\n return -(lo + hi * 4294967296)\n }\n return this.lo + this.hi * 4294967296\n }\n\n /**\n * Converts this long bits to a bigint\n */\n toBigInt (unsigned: boolean = false): bigint {\n if (unsigned) {\n return BigInt(this.lo >>> 0) + (BigInt(this.hi >>> 0) << 32n)\n }\n\n if ((this.hi >>> 31) !== 0) {\n const lo = ~this.lo + 1 >>> 0\n let hi = ~this.hi >>> 0\n if (lo === 0) {\n hi = hi + 1 >>> 0\n }\n return -(BigInt(lo) + (BigInt(hi) << 32n))\n }\n\n return BigInt(this.lo >>> 0) + (BigInt(this.hi >>> 0) << 32n)\n }\n\n /**\n * Converts this long bits to a string\n */\n toString (unsigned: boolean = false): string {\n return this.toBigInt(unsigned).toString()\n }\n\n /**\n * Zig-zag encodes this long bits\n */\n zzEncode (): this {\n const mask = this.hi >> 31\n this.hi = ((this.hi << 1 | this.lo >>> 31) ^ mask) >>> 0\n this.lo = (this.lo << 1 ^ mask) >>> 0\n return this\n }\n\n /**\n * Zig-zag decodes this long bits\n */\n zzDecode (): this {\n const mask = -(this.lo & 1)\n this.lo = ((this.lo >>> 1 | this.hi << 31) ^ mask) >>> 0\n this.hi = (this.hi >>> 1 ^ mask) >>> 0\n return this\n }\n\n /**\n * Calculates the length of this longbits when encoded as a varint.\n */\n length (): number {\n const part0 = this.lo\n const part1 = (this.lo >>> 28 | this.hi << 4) >>> 0\n const part2 = this.hi >>> 24\n return part2 === 0\n ? part1 === 0\n ? part0 < 16384\n ? part0 < 128 ? 1 : 2\n : part0 < 2097152 ? 3 : 4\n : part1 < 16384\n ? part1 < 128 ? 5 : 6\n : part1 < 2097152 ? 7 : 8\n : part2 < 128 ? 9 : 10\n }\n\n /**\n * Constructs new long bits from the specified number\n */\n static fromBigInt (value: bigint): LongBits {\n if (value === 0n) {\n return zero\n }\n\n if (value < MAX_SAFE_NUMBER_INTEGER && value > MIN_SAFE_NUMBER_INTEGER) {\n return this.fromNumber(Number(value))\n }\n\n const negative = value < 0n\n\n if (negative) {\n value = -value\n }\n\n let hi = value >> 32n\n let lo = value - (hi << 32n)\n\n if (negative) {\n hi = ~hi | 0n\n lo = ~lo | 0n\n\n if (++lo > TWO_32) {\n lo = 0n\n if (++hi > TWO_32) { hi = 0n }\n }\n }\n\n return new LongBits(Number(lo), Number(hi))\n }\n\n /**\n * Constructs new long bits from the specified number\n */\n static fromNumber (value: number): LongBits {\n if (value === 0) { return zero }\n const sign = value < 0\n if (sign) { value = -value }\n let lo = value >>> 0\n let hi = (value - lo) / 4294967296 >>> 0\n if (sign) {\n hi = ~hi >>> 0\n lo = ~lo >>> 0\n if (++lo > 4294967295) {\n lo = 0\n if (++hi > 4294967295) { hi = 0 }\n }\n }\n return new LongBits(lo, hi)\n }\n\n /**\n * Constructs new long bits from a number, long or string\n */\n static from (value: bigint | number | string | { low: number, high: number }): LongBits {\n if (typeof value === 'number') {\n return LongBits.fromNumber(value)\n }\n if (typeof value === 'bigint') {\n return LongBits.fromBigInt(value)\n }\n if (typeof value === 'string') {\n return LongBits.fromBigInt(BigInt(value))\n }\n return value.low != null || value.high != null ? new LongBits(value.low >>> 0, value.high >>> 0) : zero\n }\n}\n\nconst zero = new LongBits(0, 0)\nzero.toBigInt = function () { return 0n }\nzero.zzEncode = zero.zzDecode = function () { return this }\nzero.length = function () { return 1 }\n\nconst TWO_32 = 4294967296n\n", "/**\n * Calculates the UTF8 byte length of a string\n */\nexport function length (string: string): number {\n let len = 0\n let c = 0\n for (let i = 0; i < string.length; ++i) {\n c = string.charCodeAt(i)\n\n if (c < 128) {\n len += 1\n } else if (c < 2048) {\n len += 2\n } else if ((c & 0xFC00) === 0xD800 && (string.charCodeAt(i + 1) & 0xFC00) === 0xDC00) {\n ++i\n len += 4\n } else {\n len += 3\n }\n }\n\n return len\n}\n\n/**\n * Reads UTF8 bytes as a string\n */\nexport function read (buffer: Uint8Array, start: number, end: number): string {\n const len = end - start\n\n if (len < 1) {\n return ''\n }\n\n let parts: string[] | undefined\n const chunk: number[] = []\n let i = 0 // char offset\n let t: number // temporary\n\n while (start < end) {\n t = buffer[start++]\n\n if (t < 128) {\n chunk[i++] = t\n } else if (t > 191 && t < 224) {\n chunk[i++] = (t & 31) << 6 | buffer[start++] & 63\n } else if (t > 239 && t < 365) {\n t = ((t & 7) << 18 | (buffer[start++] & 63) << 12 | (buffer[start++] & 63) << 6 | buffer[start++] & 63) - 0x10000\n chunk[i++] = 0xD800 + (t >> 10)\n chunk[i++] = 0xDC00 + (t & 1023)\n } else {\n chunk[i++] = (t & 15) << 12 | (buffer[start++] & 63) << 6 | buffer[start++] & 63\n }\n\n if (i > 8191) {\n (parts ?? (parts = [])).push(String.fromCharCode.apply(String, chunk))\n i = 0\n }\n }\n\n if (parts != null) {\n if (i > 0) {\n parts.push(String.fromCharCode.apply(String, chunk.slice(0, i)))\n }\n\n return parts.join('')\n }\n\n return String.fromCharCode.apply(String, chunk.slice(0, i))\n}\n\n/**\n * Writes a string as UTF8 bytes\n */\nexport function write (string: string, buffer: Uint8Array, offset: number): number {\n const start = offset\n let c1 // character 1\n let c2 // character 2\n\n for (let i = 0; i < string.length; ++i) {\n c1 = string.charCodeAt(i)\n\n if (c1 < 128) {\n buffer[offset++] = c1\n } else if (c1 < 2048) {\n buffer[offset++] = c1 >> 6 | 192\n buffer[offset++] = c1 & 63 | 128\n } else if ((c1 & 0xFC00) === 0xD800 && ((c2 = string.charCodeAt(i + 1)) & 0xFC00) === 0xDC00) {\n c1 = 0x10000 + ((c1 & 0x03FF) << 10) + (c2 & 0x03FF)\n ++i\n buffer[offset++] = c1 >> 18 | 240\n buffer[offset++] = c1 >> 12 & 63 | 128\n buffer[offset++] = c1 >> 6 & 63 | 128\n buffer[offset++] = c1 & 63 | 128\n } else {\n buffer[offset++] = c1 >> 12 | 224\n buffer[offset++] = c1 >> 6 & 63 | 128\n buffer[offset++] = c1 & 63 | 128\n }\n }\n\n return offset - start\n}\n", "import { decodeUint8Array, encodingLength } from 'uint8-varint'\nimport { readFloatLE, readDoubleLE } from './float.js'\nimport { LongBits } from './longbits.js'\nimport * as utf8 from './utf8.js'\nimport type { Reader } from '../index.js'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\n/* istanbul ignore next */\nfunction indexOutOfRange (reader: Reader, writeLength?: number): RangeError {\n return RangeError(`index out of range: ${reader.pos} + ${writeLength ?? 1} > ${reader.len}`)\n}\n\nfunction readFixed32End (buf: Uint8Array, end: number): number { // note that this uses `end`, not `pos`\n return (buf[end - 4] |\n buf[end - 3] << 8 |\n buf[end - 2] << 16 |\n buf[end - 1] << 24) >>> 0\n}\n\n/**\n * Constructs a new reader instance using the specified buffer.\n */\nexport class Uint8ArrayReader implements Reader {\n public buf: Uint8Array\n public pos: number\n public len: number\n\n public _slice = Uint8Array.prototype.subarray\n\n constructor (buffer: Uint8Array) {\n /**\n * Read buffer\n */\n this.buf = buffer\n\n /**\n * Read buffer position\n */\n this.pos = 0\n\n /**\n * Read buffer length\n */\n this.len = buffer.length\n }\n\n /**\n * Reads a varint as an unsigned 32 bit value\n */\n uint32 (): number {\n let value = 4294967295\n\n value = (this.buf[this.pos] & 127) >>> 0; if (this.buf[this.pos++] < 128) { return value }\n value = (value | (this.buf[this.pos] & 127) << 7) >>> 0; if (this.buf[this.pos++] < 128) { return value }\n value = (value | (this.buf[this.pos] & 127) << 14) >>> 0; if (this.buf[this.pos++] < 128) { return value }\n value = (value | (this.buf[this.pos] & 127) << 21) >>> 0; if (this.buf[this.pos++] < 128) { return value }\n value = (value | (this.buf[this.pos] & 15) << 28) >>> 0; if (this.buf[this.pos++] < 128) { return value }\n\n if ((this.pos += 5) > this.len) {\n this.pos = this.len\n throw indexOutOfRange(this, 10)\n }\n\n return value\n }\n\n /**\n * Reads a varint as a signed 32 bit value\n */\n int32 (): number {\n return this.uint32() | 0\n }\n\n /**\n * Reads a zig-zag encoded varint as a signed 32 bit value\n */\n sint32 (): number {\n const value = this.uint32()\n return value >>> 1 ^ -(value & 1) | 0\n }\n\n /**\n * Reads a varint as a boolean\n */\n bool (): boolean {\n return this.uint32() !== 0\n }\n\n /**\n * Reads fixed 32 bits as an unsigned 32 bit integer\n */\n fixed32 (): number {\n if (this.pos + 4 > this.len) { throw indexOutOfRange(this, 4) }\n\n const res = readFixed32End(this.buf, this.pos += 4)\n\n return res\n }\n\n /**\n * Reads fixed 32 bits as a signed 32 bit integer\n */\n sfixed32 (): number {\n if (this.pos + 4 > this.len) {\n throw indexOutOfRange(this, 4)\n }\n\n const res = readFixed32End(this.buf, this.pos += 4) | 0\n\n return res\n }\n\n /**\n * Reads a float (32 bit) as a number\n */\n float (): number {\n if (this.pos + 4 > this.len) {\n throw indexOutOfRange(this, 4)\n }\n\n const value = readFloatLE(this.buf, this.pos)\n this.pos += 4\n return value\n }\n\n /**\n * Reads a double (64 bit float) as a number\n */\n double (): number {\n /* istanbul ignore if */\n if (this.pos + 8 > this.len) { throw indexOutOfRange(this, 4) }\n\n const value = readDoubleLE(this.buf, this.pos)\n this.pos += 8\n return value\n }\n\n /**\n * Reads a sequence of bytes preceded by its length as a varint\n */\n bytes (): Uint8Array {\n const length = this.uint32()\n const start = this.pos\n const end = this.pos + length\n\n /* istanbul ignore if */\n if (end > this.len) {\n throw indexOutOfRange(this, length)\n }\n\n this.pos += length\n\n return start === end // fix for IE 10/Win8 and others' subarray returning array of size 1\n ? new Uint8Array(0)\n : this.buf.subarray(start, end)\n }\n\n /**\n * Reads a string preceded by its byte length as a varint\n */\n string (): string {\n const bytes = this.bytes()\n return utf8.read(bytes, 0, bytes.length)\n }\n\n /**\n * Skips the specified number of bytes if specified, otherwise skips a varint\n */\n skip (length?: number): this {\n if (typeof length === 'number') {\n /* istanbul ignore if */\n if (this.pos + length > this.len) { throw indexOutOfRange(this, length) }\n this.pos += length\n } else {\n do {\n /* istanbul ignore if */\n if (this.pos >= this.len) {\n throw indexOutOfRange(this)\n }\n } while ((this.buf[this.pos++] & 128) !== 0)\n }\n return this\n }\n\n /**\n * Skips the next element of the specified wire type\n */\n skipType (wireType: number): this {\n switch (wireType) {\n case 0:\n this.skip()\n break\n case 1:\n this.skip(8)\n break\n case 2:\n this.skip(this.uint32())\n break\n case 3:\n while ((wireType = this.uint32() & 7) !== 4) {\n this.skipType(wireType)\n }\n break\n case 5:\n this.skip(4)\n break\n\n /* istanbul ignore next */\n default:\n throw Error(`invalid wire type ${wireType} at offset ${this.pos}`)\n }\n return this\n }\n\n private readLongVarint (): LongBits {\n // tends to deopt with local vars for octet etc.\n const bits = new LongBits(0, 0)\n let i = 0\n if (this.len - this.pos > 4) { // fast route (lo)\n for (; i < 4; ++i) {\n // 1st..4th\n bits.lo = (bits.lo | (this.buf[this.pos] & 127) << i * 7) >>> 0\n if (this.buf[this.pos++] < 128) { return bits }\n }\n // 5th\n bits.lo = (bits.lo | (this.buf[this.pos] & 127) << 28) >>> 0\n bits.hi = (bits.hi | (this.buf[this.pos] & 127) >> 4) >>> 0\n if (this.buf[this.pos++] < 128) { return bits }\n i = 0\n } else {\n for (; i < 3; ++i) {\n /* istanbul ignore if */\n if (this.pos >= this.len) { throw indexOutOfRange(this) }\n // 1st..3th\n bits.lo = (bits.lo | (this.buf[this.pos] & 127) << i * 7) >>> 0\n if (this.buf[this.pos++] < 128) { return bits }\n }\n // 4th\n bits.lo = (bits.lo | (this.buf[this.pos++] & 127) << i * 7) >>> 0\n return bits\n }\n if (this.len - this.pos > 4) { // fast route (hi)\n for (; i < 5; ++i) {\n // 6th..10th\n bits.hi = (bits.hi | (this.buf[this.pos] & 127) << i * 7 + 3) >>> 0\n if (this.buf[this.pos++] < 128) { return bits }\n }\n } else {\n for (; i < 5; ++i) {\n if (this.pos >= this.len) {\n throw indexOutOfRange(this)\n }\n\n // 6th..10th\n bits.hi = (bits.hi | (this.buf[this.pos] & 127) << i * 7 + 3) >>> 0\n if (this.buf[this.pos++] < 128) { return bits }\n }\n }\n\n throw Error('invalid varint encoding')\n }\n\n private readFixed64 (): LongBits {\n if (this.pos + 8 > this.len) {\n throw indexOutOfRange(this, 8)\n }\n\n const lo = readFixed32End(this.buf, this.pos += 4)\n const hi = readFixed32End(this.buf, this.pos += 4)\n\n return new LongBits(lo, hi)\n }\n\n /**\n * Reads a varint as a signed 64 bit value\n */\n int64 (): bigint {\n return this.readLongVarint().toBigInt()\n }\n\n /**\n * Reads a varint as a signed 64 bit value returned as a possibly unsafe\n * JavaScript number\n */\n int64Number (): number {\n return this.readLongVarint().toNumber()\n }\n\n /**\n * Reads a varint as a signed 64 bit value returned as a string\n */\n int64String (): string {\n return this.readLongVarint().toString()\n }\n\n /**\n * Reads a varint as an unsigned 64 bit value\n */\n uint64 (): bigint {\n return this.readLongVarint().toBigInt(true)\n }\n\n /**\n * Reads a varint as an unsigned 64 bit value returned as a possibly unsafe\n * JavaScript number\n */\n uint64Number (): number {\n const value = decodeUint8Array(this.buf, this.pos)\n this.pos += encodingLength(value)\n return value\n }\n\n /**\n * Reads a varint as an unsigned 64 bit value returned as a string\n */\n uint64String (): string {\n return this.readLongVarint().toString(true)\n }\n\n /**\n * Reads a zig-zag encoded varint as a signed 64 bit value\n */\n sint64 (): bigint {\n return this.readLongVarint().zzDecode().toBigInt()\n }\n\n /**\n * Reads a zig-zag encoded varint as a signed 64 bit value returned as a\n * possibly unsafe JavaScript number\n */\n sint64Number (): number {\n return this.readLongVarint().zzDecode().toNumber()\n }\n\n /**\n * Reads a zig-zag encoded varint as a signed 64 bit value returned as a\n * string\n */\n sint64String (): string {\n return this.readLongVarint().zzDecode().toString()\n }\n\n /**\n * Reads fixed 64 bits\n */\n fixed64 (): bigint {\n return this.readFixed64().toBigInt()\n }\n\n /**\n * Reads fixed 64 bits returned as a possibly unsafe JavaScript number\n */\n fixed64Number (): number {\n return this.readFixed64().toNumber()\n }\n\n /**\n * Reads fixed 64 bits returned as a string\n */\n fixed64String (): string {\n return this.readFixed64().toString()\n }\n\n /**\n * Reads zig-zag encoded fixed 64 bits\n */\n sfixed64 (): bigint {\n return this.readFixed64().toBigInt()\n }\n\n /**\n * Reads zig-zag encoded fixed 64 bits returned as a possibly unsafe\n * JavaScript number\n */\n sfixed64Number (): number {\n return this.readFixed64().toNumber()\n }\n\n /**\n * Reads zig-zag encoded fixed 64 bits returned as a string\n */\n sfixed64String (): string {\n return this.readFixed64().toString()\n }\n}\n\nexport function createReader (buf: Uint8Array | Uint8ArrayList): Reader {\n return new Uint8ArrayReader(buf instanceof Uint8Array ? buf : buf.subarray())\n}\n", "import { createReader } from './utils/reader.js'\nimport type { Codec, DecodeOptions } from './codec.js'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nexport function decodeMessage <T> (buf: Uint8Array | Uint8ArrayList, codec: Pick<Codec<T>, 'decode'>, opts?: DecodeOptions<T>): T {\n const reader = createReader(buf)\n\n return codec.decode(reader, undefined, opts)\n}\n", "import { Buffer } from 'node:buffer'\nimport bases, { type SupportedEncodings } from './util/bases.js'\nimport { asUint8Array } from '#util/as-uint8array'\n\nexport type { SupportedEncodings }\n\n/**\n * Create a `Uint8Array` from the passed string\n *\n * Supports `utf8`, `utf-8`, `hex`, and any encoding supported by the multiformats module.\n *\n * Also `ascii` which is similar to node's 'binary' encoding.\n */\nexport function fromString (string: string, encoding: SupportedEncodings = 'utf8'): Uint8Array {\n const base = bases[encoding]\n\n if (base == null) {\n throw new Error(`Unsupported encoding \"${encoding}\"`)\n }\n\n if (encoding === 'utf8' || encoding === 'utf-8') {\n return asUint8Array(Buffer.from(string, 'utf-8'))\n }\n\n // add multibase prefix\n return base.decoder.decode(`${base.prefix}${string}`) // eslint-disable-line @typescript-eslint/restrict-template-expressions\n}\n", "import { baseX } from './base.js'\n\nexport const base10 = baseX({\n prefix: '9',\n name: 'base10',\n alphabet: '0123456789'\n})\n", "export const empty = new Uint8Array(0)\n\nexport function toHex (d: Uint8Array): string {\n return d.reduce((hex, byte) => hex + byte.toString(16).padStart(2, '0'), '')\n}\n\nexport function fromHex (hex: string): Uint8Array {\n const hexes = hex.match(/../g)\n return hexes != null ? new Uint8Array(hexes.map(b => parseInt(b, 16))) : empty\n}\n\nexport function equals (aa: Uint8Array, bb: Uint8Array): boolean {\n if (aa === bb) { return true }\n if (aa.byteLength !== bb.byteLength) {\n return false\n }\n\n for (let ii = 0; ii < aa.byteLength; ii++) {\n if (aa[ii] !== bb[ii]) {\n return false\n }\n }\n\n return true\n}\n\nexport function coerce (o: ArrayBufferView | ArrayBuffer | Uint8Array): Uint8Array {\n if (o instanceof Uint8Array && o.constructor.name === 'Uint8Array') { return o }\n if (o instanceof ArrayBuffer) { return new Uint8Array(o) }\n if (ArrayBuffer.isView(o)) {\n return new Uint8Array(o.buffer, o.byteOffset, o.byteLength)\n }\n throw new Error('Unknown type, must be binary type')\n}\n\nexport function isBinary (o: unknown): o is ArrayBuffer | ArrayBufferView {\n return o instanceof ArrayBuffer || ArrayBuffer.isView(o)\n}\n\nexport function fromString (str: string): Uint8Array {\n return new TextEncoder().encode(str)\n}\n\nexport function toString (b: Uint8Array): string {\n return new TextDecoder().decode(b)\n}\n", "/* eslint-disable */\n// base-x encoding / decoding\n// Copyright (c) 2018 base-x contributors\n// Copyright (c) 2014-2018 The Bitcoin Core developers (base58.cpp)\n// Distributed under the MIT software license, see the accompanying\n// file LICENSE or http://www.opensource.org/licenses/mit-license.php.\n/**\n * @param {string} ALPHABET\n * @param {any} name\n */\nfunction base (ALPHABET, name) {\n if (ALPHABET.length >= 255) { throw new TypeError('Alphabet too long') }\n var BASE_MAP = new Uint8Array(256);\n for (var j = 0; j < BASE_MAP.length; j++) {\n BASE_MAP[j] = 255;\n }\n for (var i = 0; i < ALPHABET.length; i++) {\n var x = ALPHABET.charAt(i);\n var xc = x.charCodeAt(0);\n if (BASE_MAP[xc] !== 255) { throw new TypeError(x + ' is ambiguous') }\n BASE_MAP[xc] = i;\n }\n var BASE = ALPHABET.length;\n var LEADER = ALPHABET.charAt(0);\n var FACTOR = Math.log(BASE) / Math.log(256); // log(BASE) / log(256), rounded up\n var iFACTOR = Math.log(256) / Math.log(BASE); // log(256) / log(BASE), rounded up\n /**\n * @param {any[] | Iterable<number>} source\n */\n function encode (source) {\n // @ts-ignore\n if (source instanceof Uint8Array) ; else if (ArrayBuffer.isView(source)) {\n source = new Uint8Array(source.buffer, source.byteOffset, source.byteLength);\n } else if (Array.isArray(source)) {\n source = Uint8Array.from(source);\n }\n if (!(source instanceof Uint8Array)) { throw new TypeError('Expected Uint8Array') }\n if (source.length === 0) { return '' }\n // Skip & count leading zeroes.\n var zeroes = 0;\n var length = 0;\n var pbegin = 0;\n var pend = source.length;\n while (pbegin !== pend && source[pbegin] === 0) {\n pbegin++;\n zeroes++;\n }\n // Allocate enough space in big-endian base58 representation.\n var size = ((pend - pbegin) * iFACTOR + 1) >>> 0;\n var b58 = new Uint8Array(size);\n // Process the bytes.\n while (pbegin !== pend) {\n var carry = source[pbegin];\n // Apply \"b58 = b58 * 256 + ch\".\n var i = 0;\n for (var it1 = size - 1; (carry !== 0 || i < length) && (it1 !== -1); it1--, i++) {\n carry += (256 * b58[it1]) >>> 0;\n b58[it1] = (carry % BASE) >>> 0;\n carry = (carry / BASE) >>> 0;\n }\n if (carry !== 0) { throw new Error('Non-zero carry') }\n length = i;\n pbegin++;\n }\n // Skip leading zeroes in base58 result.\n var it2 = size - length;\n while (it2 !== size && b58[it2] === 0) {\n it2++;\n }\n // Translate the result into a string.\n var str = LEADER.repeat(zeroes);\n for (; it2 < size; ++it2) { str += ALPHABET.charAt(b58[it2]); }\n return str\n }\n /**\n * @param {string | string[]} source\n */\n function decodeUnsafe (source) {\n if (typeof source !== 'string') { throw new TypeError('Expected String') }\n if (source.length === 0) { return new Uint8Array() }\n var psz = 0;\n // Skip leading spaces.\n if (source[psz] === ' ') { return }\n // Skip and count leading '1's.\n var zeroes = 0;\n var length = 0;\n while (source[psz] === LEADER) {\n zeroes++;\n psz++;\n }\n // Allocate enough space in big-endian base256 representation.\n var size = (((source.length - psz) * FACTOR) + 1) >>> 0; // log(58) / log(256), rounded up.\n var b256 = new Uint8Array(size);\n // Process the characters.\n while (source[psz]) {\n // Decode character\n var carry = BASE_MAP[source.charCodeAt(psz)];\n // Invalid character\n if (carry === 255) { return }\n var i = 0;\n for (var it3 = size - 1; (carry !== 0 || i < length) && (it3 !== -1); it3--, i++) {\n carry += (BASE * b256[it3]) >>> 0;\n b256[it3] = (carry % 256) >>> 0;\n carry = (carry / 256) >>> 0;\n }\n if (carry !== 0) { throw new Error('Non-zero carry') }\n length = i;\n psz++;\n }\n // Skip trailing spaces.\n if (source[psz] === ' ') { return }\n // Skip leading zeroes in b256.\n var it4 = size - length;\n while (it4 !== size && b256[it4] === 0) {\n it4++;\n }\n var vch = new Uint8Array(zeroes + (size - it4));\n var j = zeroes;\n while (it4 !== size) {\n vch[j++] = b256[it4++];\n }\n return vch\n }\n /**\n * @param {string | string[]} string\n */\n function decode (string) {\n var buffer = decodeUnsafe(string);\n if (buffer) { return buffer }\n throw new Error(`Non-${name} character`)\n }\n return {\n encode: encode,\n decodeUnsafe: decodeUnsafe,\n decode: decode\n }\n}\nvar src = base;\n\nvar _brrp__multiformats_scope_baseX = src;\n\nexport default _brrp__multiformats_scope_baseX;\n", "import { coerce } from '../bytes.js'\nimport basex from '../vendor/base-x.js'\nimport type { BaseCodec, BaseDecoder, BaseEncoder, CombobaseDecoder, Multibase, MultibaseCodec, MultibaseDecoder, MultibaseEncoder, UnibaseDecoder } from './interface.js'\n\ninterface EncodeFn { (bytes: Uint8Array): string }\ninterface DecodeFn { (text: string): Uint8Array }\n\n/**\n * Class represents both BaseEncoder and MultibaseEncoder meaning it\n * can be used to encode to multibase or base encode without multibase\n * prefix.\n */\nclass Encoder<Base extends string, Prefix extends string> implements MultibaseEncoder<Prefix>, BaseEncoder {\n readonly name: Base\n readonly prefix: Prefix\n readonly baseEncode: EncodeFn\n\n constructor (name: Base, prefix: Prefix, baseEncode: EncodeFn) {\n this.name = name\n this.prefix = prefix\n this.baseEncode = baseEncode\n }\n\n encode (bytes: Uint8Array): Multibase<Prefix> {\n if (bytes instanceof Uint8Array) {\n return `${this.prefix}${this.baseEncode(bytes)}`\n } else {\n throw Error('Unknown type, must be binary type')\n }\n }\n}\n\n/**\n * Class represents both BaseDecoder and MultibaseDecoder so it could be used\n * to decode multibases (with matching prefix) or just base decode strings\n * with corresponding base encoding.\n */\nclass Decoder<Base extends string, Prefix extends string> implements MultibaseDecoder<Prefix>, UnibaseDecoder<Prefix>, BaseDecoder {\n readonly name: Base\n readonly prefix: Prefix\n readonly baseDecode: DecodeFn\n private readonly prefixCodePoint: number\n\n constructor (name: Base, prefix: Prefix, baseDecode: DecodeFn) {\n this.name = name\n this.prefix = prefix\n const prefixCodePoint = prefix.codePointAt(0)\n /* c8 ignore next 3 */\n if (prefixCodePoint === undefined) {\n throw new Error('Invalid prefix character')\n }\n this.prefixCodePoint = prefixCodePoint\n this.baseDecode = baseDecode\n }\n\n decode (text: string): Uint8Array {\n if (typeof text === 'string') {\n if (text.codePointAt(0) !== this.prefixCodePoint) {\n throw Error(`Unable to decode multibase string ${JSON.stringify(text)}, ${this.name} decoder only supports inputs prefixed with ${this.prefix}`)\n }\n return this.baseDecode(text.slice(this.prefix.length))\n } else {\n throw Error('Can only multibase decode strings')\n }\n }\n\n or<OtherPrefix extends string> (decoder: UnibaseDecoder<OtherPrefix> | ComposedDecoder<OtherPrefix>): ComposedDecoder<Prefix | OtherPrefix> {\n return or(this, decoder)\n }\n}\n\ntype Decoders<Prefix extends string> = Record<Prefix, UnibaseDecoder<Prefix>>\n\nclass ComposedDecoder<Prefix extends string> implements MultibaseDecoder<Prefix>, CombobaseDecoder<Prefix> {\n readonly decoders: Decoders<Prefix>\n\n constructor (decoders: Decoders<Prefix>) {\n this.decoders = decoders\n }\n\n or <OtherPrefix extends string> (decoder: UnibaseDecoder<OtherPrefix> | ComposedDecoder<OtherPrefix>): ComposedDecoder<Prefix | OtherPrefix> {\n return or(this, decoder)\n }\n\n decode (input: string): Uint8Array {\n const prefix = input[0] as Prefix\n const decoder = this.decoders[prefix]\n if (decoder != null) {\n return decoder.decode(input)\n } else {\n throw RangeError(`Unable to decode multibase string ${JSON.stringify(input)}, only inputs prefixed with ${Object.keys(this.decoders)} are supported`)\n }\n }\n}\n\nexport function or <L extends string, R extends string> (left: UnibaseDecoder<L> | CombobaseDecoder<L>, right: UnibaseDecoder<R> | CombobaseDecoder<R>): ComposedDecoder<L | R> {\n return new ComposedDecoder({\n ...(left.decoders ?? { [(left as UnibaseDecoder<L>).prefix]: left }),\n ...(right.decoders ?? { [(right as UnibaseDecoder<R>).prefix]: right })\n } as Decoders<L | R>)\n}\n\nexport class Codec<Base extends string, Prefix extends string> implements MultibaseCodec<Prefix>, MultibaseEncoder<Prefix>, MultibaseDecoder<Prefix>, BaseCodec, BaseEncoder, BaseDecoder {\n readonly name: Base\n readonly prefix: Prefix\n readonly baseEncode: EncodeFn\n readonly baseDecode: DecodeFn\n readonly encoder: Encoder<Base, Prefix>\n readonly decoder: Decoder<Base, Prefix>\n\n constructor (name: Base, prefix: Prefix, baseEncode: EncodeFn, baseDecode: DecodeFn) {\n this.name = name\n this.prefix = prefix\n this.baseEncode = baseEncode\n this.baseDecode = baseDecode\n this.encoder = new Encoder(name, prefix, baseEncode)\n this.decoder = new Decoder(name, prefix, baseDecode)\n }\n\n encode (input: Uint8Array): string {\n return this.encoder.encode(input)\n }\n\n decode (input: string): Uint8Array {\n return this.decoder.decode(input)\n }\n}\n\nexport function from <Base extends string, Prefix extends string> ({ name, prefix, encode, decode }: { name: Base, prefix: Prefix, encode: EncodeFn, decode: DecodeFn }): Codec<Base, Prefix> {\n return new Codec(name, prefix, encode, decode)\n}\n\nexport function baseX <Base extends string, Prefix extends string> ({ name, prefix, alphabet }: { name: Base, prefix: Prefix, alphabet: string }): Codec<Base, Prefix> {\n const { encode, decode } = basex(alphabet, name)\n return from({\n prefix,\n name,\n encode,\n decode: (text: string): Uint8Array => coerce(decode(text))\n })\n}\n\nfunction decode (string: string, alphabetIdx: Record<string, number>, bitsPerChar: number, name: string): Uint8Array {\n // Count the padding bytes:\n let end = string.length\n while (string[end - 1] === '=') {\n --end\n }\n\n // Allocate the output:\n const out = new Uint8Array((end * bitsPerChar / 8) | 0)\n\n // Parse the data:\n let bits = 0 // Number of bits currently in the buffer\n let buffer = 0 // Bits waiting to be written out, MSB first\n let written = 0 // Next byte to write\n for (let i = 0; i < end; ++i) {\n // Read one character from the string:\n const value = alphabetIdx[string[i]]\n if (value === undefined) {\n throw new SyntaxError(`Non-${name} character`)\n }\n\n // Append the bits to the buffer:\n buffer = (buffer << bitsPerChar) | value\n bits += bitsPerChar\n\n // Write out some bits if the buffer has a byte's worth:\n if (bits >= 8) {\n bits -= 8\n out[written++] = 0xff & (buffer >> bits)\n }\n }\n\n // Verify that we have received just enough bits:\n if (bits >= bitsPerChar || (0xff & (buffer << (8 - bits))) !== 0) {\n throw new SyntaxError('Unexpected end of data')\n }\n\n return out\n}\n\nfunction encode (data: Uint8Array, alphabet: string, bitsPerChar: number): string {\n const pad = alphabet[alphabet.length - 1] === '='\n const mask = (1 << bitsPerChar) - 1\n let out = ''\n\n let bits = 0 // Number of bits currently in the buffer\n let buffer = 0 // Bits waiting to be written out, MSB first\n for (let i = 0; i < data.length; ++i) {\n // Slurp data into the buffer:\n buffer = (buffer << 8) | data[i]\n bits += 8\n\n // Write out as much as we can:\n while (bits > bitsPerChar) {\n bits -= bitsPerChar\n out += alphabet[mask & (buffer >> bits)]\n }\n }\n\n // Partial character:\n if (bits !== 0) {\n out += alphabet[mask & (buffer << (bitsPerChar - bits))]\n }\n\n // Add padding characters until we hit a byte boundary:\n if (pad) {\n while (((out.length * bitsPerChar) & 7) !== 0) {\n out += '='\n }\n }\n\n return out\n}\n\nfunction createAlphabetIdx (alphabet: string): Record<string, number> {\n // Build the character lookup table:\n const alphabetIdx: Record<string, number> = {}\n for (let i = 0; i < alphabet.length; ++i) {\n alphabetIdx[alphabet[i]] = i\n }\n return alphabetIdx\n}\n\n/**\n * RFC4648 Factory\n */\nexport function rfc4648 <Base extends string, Prefix extends string> ({ name, prefix, bitsPerChar, alphabet }: { name: Base, prefix: Prefix, bitsPerChar: number, alphabet: string }): Codec<Base, Prefix> {\n const alphabetIdx = createAlphabetIdx(alphabet)\n return from({\n prefix,\n name,\n encode (input: Uint8Array): string {\n return encode(input, alphabet, bitsPerChar)\n },\n decode (input: string): Uint8Array {\n return decode(input, alphabetIdx, bitsPerChar, name)\n }\n })\n}\n", "import { rfc4648 } from './base.js'\n\nexport const base16 = rfc4648({\n prefix: 'f',\n name: 'base16',\n alphabet: '0123456789abcdef',\n bitsPerChar: 4\n})\n\nexport const base16upper = rfc4648({\n prefix: 'F',\n name: 'base16upper',\n alphabet: '0123456789ABCDEF',\n bitsPerChar: 4\n})\n", "import { rfc4648 } from './base.js'\n\nexport const base2 = rfc4648({\n prefix: '0',\n name: 'base2',\n alphabet: '01',\n bitsPerChar: 1\n})\n", "import { from } from './base.js'\n\nconst alphabet = Array.from('\uD83D\uDE80\uD83E\uDE90\u2604\uD83D\uDEF0\uD83C\uDF0C\uD83C\uDF11\uD83C\uDF12\uD83C\uDF13\uD83C\uDF14\uD83C\uDF15\uD83C\uDF16\uD83C\uDF17\uD83C\uDF18\uD83C\uDF0D\uD83C\uDF0F\uD83C\uDF0E\uD83D\uDC09\u2600\uD83D\uDCBB\uD83D\uDDA5\uD83D\uDCBE\uD83D\uDCBF\uD83D\uDE02\u2764\uD83D\uDE0D\uD83E\uDD23\uD83D\uDE0A\uD83D\uDE4F\uD83D\uDC95\uD83D\uDE2D\uD83D\uDE18\uD83D\uDC4D\uD83D\uDE05\uD83D\uDC4F\uD83D\uDE01\uD83D\uDD25\uD83E\uDD70\uD83D\uDC94\uD83D\uDC96\uD83D\uDC99\uD83D\uDE22\uD83E\uDD14\uD83D\uDE06\uD83D\uDE44\uD83D\uDCAA\uD83D\uDE09\u263A\uD83D\uDC4C\uD83E\uDD17\uD83D\uDC9C\uD83D\uDE14\uD83D\uDE0E\uD83D\uDE07\uD83C\uDF39\uD83E\uDD26\uD83C\uDF89\uD83D\uDC9E\u270C\u2728\uD83E\uDD37\uD83D\uDE31\uD83D\uDE0C\uD83C\uDF38\uD83D\uDE4C\uD83D\uDE0B\uD83D\uDC97\uD83D\uDC9A\uD83D\uDE0F\uD83D\uDC9B\uD83D\uDE42\uD83D\uDC93\uD83E\uDD29\uD83D\uDE04\uD83D\uDE00\uD83D\uDDA4\uD83D\uDE03\uD83D\uDCAF\uD83D\uDE48\uD83D\uDC47\uD83C\uDFB6\uD83D\uDE12\uD83E\uDD2D\u2763\uD83D\uDE1C\uD83D\uDC8B\uD83D\uDC40\uD83D\uDE2A\uD83D\uDE11\uD83D\uDCA5\uD83D\uDE4B\uD83D\uDE1E\uD83D\uDE29\uD83D\uDE21\uD83E\uDD2A\uD83D\uDC4A\uD83E\uDD73\uD83D\uDE25\uD83E\uDD24\uD83D\uDC49\uD83D\uDC83\uD83D\uDE33\u270B\uD83D\uDE1A\uD83D\uDE1D\uD83D\uDE34\uD83C\uDF1F\uD83D\uDE2C\uD83D\uDE43\uD83C\uDF40\uD83C\uDF37\uD83D\uDE3B\uD83D\uDE13\u2B50\u2705\uD83E\uDD7A\uD83C\uDF08\uD83D\uDE08\uD83E\uDD18\uD83D\uDCA6\u2714\uD83D\uDE23\uD83C\uDFC3\uD83D\uDC90\u2639\uD83C\uDF8A\uD83D\uDC98\uD83D\uDE20\u261D\uD83D\uDE15\uD83C\uDF3A\uD83C\uDF82\uD83C\uDF3B\uD83D\uDE10\uD83D\uDD95\uD83D\uDC9D\uD83D\uDE4A\uD83D\uDE39\uD83D\uDDE3\uD83D\uDCAB\uD83D\uDC80\uD83D\uDC51\uD83C\uDFB5\uD83E\uDD1E\uD83D\uDE1B\uD83D\uDD34\uD83D\uDE24\uD83C\uDF3C\uD83D\uDE2B\u26BD\uD83E\uDD19\u2615\uD83C\uDFC6\uD83E\uDD2B\uD83D\uDC48\uD83D\uDE2E\uD83D\uDE46\uD83C\uDF7B\uD83C\uDF43\uD83D\uDC36\uD83D\uDC81\uD83D\uDE32\uD83C\uDF3F\uD83E\uDDE1\uD83C\uDF81\u26A1\uD83C\uDF1E\uD83C\uDF88\u274C\u270A\uD83D\uDC4B\uD83D\uDE30\uD83E\uDD28\uD83D\uDE36\uD83E\uDD1D\uD83D\uDEB6\uD83D\uDCB0\uD83C\uDF53\uD83D\uDCA2\uD83E\uDD1F\uD83D\uDE41\uD83D\uDEA8\uD83D\uDCA8\uD83E\uDD2C\u2708\uD83C\uDF80\uD83C\uDF7A\uD83E\uDD13\uD83D\uDE19\uD83D\uDC9F\uD83C\uDF31\uD83D\uDE16\uD83D\uDC76\uD83E\uDD74\u25B6\u27A1\u2753\uD83D\uDC8E\uD83D\uDCB8\u2B07\uD83D\uDE28\uD83C\uDF1A\uD83E\uDD8B\uD83D\uDE37\uD83D\uDD7A\u26A0\uD83D\uDE45\uD83D\uDE1F\uD83D\uDE35\uD83D\uDC4E\uD83E\uDD32\uD83E\uDD20\uD83E\uDD27\uD83D\uDCCC\uD83D\uDD35\uD83D\uDC85\uD83E\uDDD0\uD83D\uDC3E\uD83C\uDF52\uD83D\uDE17\uD83E\uDD11\uD83C\uDF0A\uD83E\uDD2F\uD83D\uDC37\u260E\uD83D\uDCA7\uD83D\uDE2F\uD83D\uDC86\uD83D\uDC46\uD83C\uDFA4\uD83D\uDE47\uD83C\uDF51\u2744\uD83C\uDF34\uD83D\uDCA3\uD83D\uDC38\uD83D\uDC8C\uD83D\uDCCD\uD83E\uDD40\uD83E\uDD22\uD83D\uDC45\uD83D\uDCA1\uD83D\uDCA9\uD83D\uDC50\uD83D\uDCF8\uD83D\uDC7B\uD83E\uDD10\uD83E\uDD2E\uD83C\uDFBC\uD83E\uDD75\uD83D\uDEA9\uD83C\uDF4E\uD83C\uDF4A\uD83D\uDC7C\uD83D\uDC8D\uD83D\uDCE3\uD83E\uDD42')\nconst alphabetBytesToChars: string[] = (alphabet.reduce<string[]>((p, c, i) => { p[i] = c; return p }, ([])))\nconst alphabetCharsToBytes: number[] = (alphabet.reduce<number[]>((p, c, i) => {\n const codePoint = c.codePointAt(0)\n if (codePoint == null) {\n throw new Error(`Invalid character: ${c}`)\n }\n p[codePoint] = i\n return p\n}, ([])))\n\nfunction encode (data: Uint8Array): string {\n return data.reduce((p, c) => {\n p += alphabetBytesToChars[c]\n return p\n }, '')\n}\n\nfunction decode (str: string): Uint8Array {\n const byts = []\n for (const char of str) {\n const codePoint = char.codePointAt(0)\n if (codePoint == null) {\n throw new Error(`Invalid character: ${char}`)\n }\n const byt = alphabetCharsToBytes[codePoint]\n if (byt == null) {\n throw new Error(`Non-base256emoji character: ${char}`)\n }\n byts.push(byt)\n }\n return new Uint8Array(byts)\n}\n\nexport const base256emoji = from({\n prefix: '\uD83D\uDE80',\n name: 'base256emoji',\n encode,\n decode\n})\n", "import { rfc4648 } from './base.js'\n\nexport const base32 = rfc4648({\n prefix: 'b',\n name: 'base32',\n alphabet: 'abcdefghijklmnopqrstuvwxyz234567',\n bitsPerChar: 5\n})\n\nexport const base32upper = rfc4648({\n prefix: 'B',\n name: 'base32upper',\n alphabet: 'ABCDEFGHIJKLMNOPQRSTUVWXYZ234567',\n bitsPerChar: 5\n})\n\nexport const base32pad = rfc4648({\n prefix: 'c',\n name: 'base32pad',\n alphabet: 'abcdefghijklmnopqrstuvwxyz234567=',\n bitsPerChar: 5\n})\n\nexport const base32padupper = rfc4648({\n prefix: 'C',\n name: 'base32padupper',\n alphabet: 'ABCDEFGHIJKLMNOPQRSTUVWXYZ234567=',\n bitsPerChar: 5\n})\n\nexport const base32hex = rfc4648({\n prefix: 'v',\n name: 'base32hex',\n alphabet: '0123456789abcdefghijklmnopqrstuv',\n bitsPerChar: 5\n})\n\nexport const base32hexupper = rfc4648({\n prefix: 'V',\n name: 'base32hexupper',\n alphabet: '0123456789ABCDEFGHIJKLMNOPQRSTUV',\n bitsPerChar: 5\n})\n\nexport const base32hexpad = rfc4648({\n prefix: 't',\n name: 'base32hexpad',\n alphabet: '0123456789abcdefghijklmnopqrstuv=',\n bitsPerChar: 5\n})\n\nexport const base32hexpadupper = rfc4648({\n prefix: 'T',\n name: 'base32hexpadupper',\n alphabet: '0123456789ABCDEFGHIJKLMNOPQRSTUV=',\n bitsPerChar: 5\n})\n\nexport const base32z = rfc4648({\n prefix: 'h',\n name: 'base32z',\n alphabet: 'ybndrfg8ejkmcpqxot1uwisza345h769',\n bitsPerChar: 5\n})\n", "import { baseX } from './base.js'\n\nexport const base36 = baseX({\n prefix: 'k',\n name: 'base36',\n alphabet: '0123456789abcdefghijklmnopqrstuvwxyz'\n})\n\nexport const base36upper = baseX({\n prefix: 'K',\n name: 'base36upper',\n alphabet: '0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZ'\n})\n", "import { baseX } from './base.js'\n\nexport const base58btc = baseX({\n name: 'base58btc',\n prefix: 'z',\n alphabet: '123456789ABCDEFGHJKLMNPQRSTUVWXYZabcdefghijkmnopqrstuvwxyz'\n})\n\nexport const base58flickr = baseX({\n name: 'base58flickr',\n prefix: 'Z',\n alphabet: '123456789abcdefghijkmnopqrstuvwxyzABCDEFGHJKLMNPQRSTUVWXYZ'\n})\n", "import { rfc4648 } from './base.js'\n\nexport const base64 = rfc4648({\n prefix: 'm',\n name: 'base64',\n alphabet: 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/',\n bitsPerChar: 6\n})\n\nexport const base64pad = rfc4648({\n prefix: 'M',\n name: 'base64pad',\n alphabet: 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=',\n bitsPerChar: 6\n})\n\nexport const base64url = rfc4648({\n prefix: 'u',\n name: 'base64url',\n alphabet: 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789-_',\n bitsPerChar: 6\n})\n\nexport const base64urlpad = rfc4648({\n prefix: 'U',\n name: 'base64urlpad',\n alphabet: 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789-_=',\n bitsPerChar: 6\n})\n", "import { rfc4648 } from './base.js'\n\nexport const base8 = rfc4648({\n prefix: '7',\n name: 'base8',\n alphabet: '01234567',\n bitsPerChar: 3\n})\n", "import { fromString, toString } from '../bytes.js'\nimport { from } from './base.js'\n\nexport const identity = from({\n prefix: '\\x00',\n name: 'identity',\n encode: (buf) => toString(buf),\n decode: (str) => fromString(str)\n})\n", "import type { ArrayBufferView, ByteView } from './interface.js'\n\nconst textEncoder = new TextEncoder()\nconst textDecoder = new TextDecoder()\n\nexport const name = 'json'\nexport const code = 0x0200\n\nexport function encode <T> (node: T): ByteView<T> {\n return textEncoder.encode(JSON.stringify(node))\n}\n\nexport function decode <T> (data: ByteView<T> | ArrayBufferView<T>): T {\n return JSON.parse(textDecoder.decode(data))\n}\n", "import { coerce } from '../bytes.js'\nimport * as Digest from './digest.js'\nimport type { DigestOptions } from './hasher.js'\n\nconst code: 0x0 = 0x0\nconst name = 'identity'\n\nconst encode: (input: Uint8Array) => Uint8Array = coerce\n\nfunction digest (input: Uint8Array, options?: DigestOptions): Digest.Digest<typeof code, number> {\n if (options?.truncate != null && options.truncate !== input.byteLength) {\n if (options.truncate < 0 || options.truncate > input.byteLength) {\n throw new Error(`Invalid truncate option, must be less than or equal to ${input.byteLength}`)\n }\n\n input = input.subarray(0, options.truncate)\n }\n\n return Digest.create(code, encode(input))\n}\n\nexport const identity = { code, name, encode, digest }\n", "/* eslint-disable */\nvar encode_1 = encode;\n\nvar MSB = 0x80\n , REST = 0x7F\n , MSBALL = ~REST\n , INT = Math.pow(2, 31);\n\n/**\n * @param {number} num\n * @param {number[]} out\n * @param {number} offset\n */\nfunction encode(num, out, offset) {\n out = out || [];\n offset = offset || 0;\n var oldOffset = offset;\n\n while(num >= INT) {\n out[offset++] = (num & 0xFF) | MSB;\n num /= 128;\n }\n while(num & MSBALL) {\n out[offset++] = (num & 0xFF) | MSB;\n num >>>= 7;\n }\n out[offset] = num | 0;\n \n // @ts-ignore\n encode.bytes = offset - oldOffset + 1;\n \n return out\n}\n\nvar decode = read;\n\nvar MSB$1 = 0x80\n , REST$1 = 0x7F;\n\n/**\n * @param {string | any[]} buf\n * @param {number} offset\n */\nfunction read(buf, offset) {\n var res = 0\n , offset = offset || 0\n , shift = 0\n , counter = offset\n , b\n , l = buf.length;\n\n do {\n if (counter >= l) {\n // @ts-ignore\n read.bytes = 0;\n throw new RangeError('Could not decode varint')\n }\n b = buf[counter++];\n res += shift < 28\n ? (b & REST$1) << shift\n : (b & REST$1) * Math.pow(2, shift);\n shift += 7;\n } while (b >= MSB$1)\n\n // @ts-ignore\n read.bytes = counter - offset;\n\n return res\n}\n\nvar N1 = Math.pow(2, 7);\nvar N2 = Math.pow(2, 14);\nvar N3 = Math.pow(2, 21);\nvar N4 = Math.pow(2, 28);\nvar N5 = Math.pow(2, 35);\nvar N6 = Math.pow(2, 42);\nvar N7 = Math.pow(2, 49);\nvar N8 = Math.pow(2, 56);\nvar N9 = Math.pow(2, 63);\n\nvar length = function (/** @type {number} */ value) {\n return (\n value < N1 ? 1\n : value < N2 ? 2\n : value < N3 ? 3\n : value < N4 ? 4\n : value < N5 ? 5\n : value < N6 ? 6\n : value < N7 ? 7\n : value < N8 ? 8\n : value < N9 ? 9\n : 10\n )\n};\n\nvar varint = {\n encode: encode_1\n , decode: decode\n , encodingLength: length\n};\n\nvar _brrp_varint = varint;\n\nexport default _brrp_varint;\n", "import varint from './vendor/varint.js'\n\nexport function decode (data: Uint8Array, offset = 0): [number, number] {\n const code = varint.decode(data, offset)\n return [code, varint.decode.bytes]\n}\n\nexport function encodeTo (int: number, target: Uint8Array, offset = 0): Uint8Array {\n varint.encode(int, target, offset)\n return target\n}\n\nexport function encodingLength (int: number): number {\n return varint.encodingLength(int)\n}\n", "import { coerce, equals as equalBytes } from '../bytes.js'\nimport * as varint from '../varint.js'\nimport type { MultihashDigest } from './interface.js'\n\n/**\n * Creates a multihash digest.\n */\nexport function create <Code extends number> (code: Code, digest: Uint8Array): Digest<Code, number> {\n const size = digest.byteLength\n const sizeOffset = varint.encodingLength(code)\n const digestOffset = sizeOffset + varint.encodingLength(size)\n\n const bytes = new Uint8Array(digestOffset + size)\n varint.encodeTo(code, bytes, 0)\n varint.encodeTo(size, bytes, sizeOffset)\n bytes.set(digest, digestOffset)\n\n return new Digest(code, size, digest, bytes)\n}\n\n/**\n * Turns bytes representation of multihash digest into an instance.\n */\nexport function decode (multihash: Uint8Array): MultihashDigest {\n const bytes = coerce(multihash)\n const [code, sizeOffset] = varint.decode(bytes)\n const [size, digestOffset] = varint.decode(bytes.subarray(sizeOffset))\n const digest = bytes.subarray(sizeOffset + digestOffset)\n\n if (digest.byteLength !== size) {\n throw new Error('Incorrect length')\n }\n\n return new Digest(code, size, digest, bytes)\n}\n\nexport function equals (a: MultihashDigest, b: unknown): b is MultihashDigest {\n if (a === b) {\n return true\n } else {\n const data = b as { code?: unknown, size?: unknown, bytes?: unknown }\n\n return (\n a.code === data.code &&\n a.size === data.size &&\n data.bytes instanceof Uint8Array &&\n equalBytes(a.bytes, data.bytes)\n )\n }\n}\n\n/**\n * Represents a multihash digest which carries information about the\n * hashing algorithm and an actual hash digest.\n */\nexport class Digest<Code extends number, Size extends number> implements MultihashDigest {\n readonly code: Code\n readonly size: Size\n readonly digest: Uint8Array\n readonly bytes: Uint8Array\n\n /**\n * Creates a multihash digest.\n */\n constructor (code: Code, size: Size, digest: Uint8Array, bytes: Uint8Array) {\n this.code = code\n this.size = size\n this.digest = digest\n this.bytes = bytes\n }\n}\n\n/**\n * Used to check that the passed multihash has the passed code\n */\nexport function hasCode <T extends number> (digest: MultihashDigest, code: T): digest is MultihashDigest<T> {\n return digest.code === code\n}\n", "import crypto from 'crypto'\nimport { coerce } from '../bytes.js'\nimport { from } from './hasher.js'\n\nexport const sha256 = from({\n name: 'sha2-256',\n code: 0x12,\n encode: (input) => coerce(crypto.createHash('sha256').update(input).digest())\n})\n\nexport const sha512 = from({\n name: 'sha2-512',\n code: 0x13,\n encode: input => coerce(crypto.createHash('sha512').update(input).digest())\n})\n", "import * as Digest from './digest.js'\nimport type { MultihashHasher } from './interface.js'\n\ntype Await<T> = Promise<T> | T\n\nconst DEFAULT_MIN_DIGEST_LENGTH = 20\n\nexport interface HasherInit <Name extends string, Code extends number> {\n name: Name\n code: Code\n encode(input: Uint8Array): Await<Uint8Array>\n\n /**\n * The minimum length a hash is allowed to be truncated to in bytes\n *\n * @default 20\n */\n minDigestLength?: number\n\n /**\n * The maximum length a hash is allowed to be truncated to in bytes. If not\n * specified it will be inferred from the length of the digest.\n */\n maxDigestLength?: number\n}\n\nexport function from <Name extends string, Code extends number> ({ name, code, encode, minDigestLength, maxDigestLength }: HasherInit<Name, Code>): Hasher<Name, Code> {\n return new Hasher(name, code, encode, minDigestLength, maxDigestLength)\n}\n\nexport interface DigestOptions {\n /**\n * Truncate the returned digest to this number of bytes.\n *\n * This may cause the digest method to throw/reject if the passed value is\n * greater than the digest length or below a threshold under which the risk of\n * hash collisions is significant.\n *\n * The actual value of this threshold can depend on the hashing algorithm in\n * use.\n */\n truncate?: number\n}\n\n/**\n * Hasher represents a hashing algorithm implementation that produces as\n * `MultihashDigest`.\n */\nexport class Hasher<Name extends string, Code extends number> implements MultihashHasher<Code> {\n readonly name: Name\n readonly code: Code\n readonly encode: (input: Uint8Array) => Await<Uint8Array>\n readonly minDigestLength: number\n readonly maxDigestLength?: number\n\n constructor (name: Name, code: Code, encode: (input: Uint8Array) => Await<Uint8Array>, minDigestLength?: number, maxDigestLength?: number) {\n this.name = name\n this.code = code\n this.encode = encode\n this.minDigestLength = minDigestLength ?? DEFAULT_MIN_DIGEST_LENGTH\n this.maxDigestLength = maxDigestLength\n }\n\n digest (input: Uint8Array, options?: DigestOptions): Await<Digest.Digest<Code, number>> {\n if (options?.truncate != null) {\n if (options.truncate < this.minDigestLength) {\n throw new Error(`Invalid truncate option, must be greater than or equal to ${this.minDigestLength}`)\n }\n\n if (this.maxDigestLength != null && options.truncate > this.maxDigestLength) {\n throw new Error(`Invalid truncate option, must be less than or equal to ${this.maxDigestLength}`)\n }\n }\n\n if (input instanceof Uint8Array) {\n const result = this.encode(input)\n\n if (result instanceof Uint8Array) {\n return createDigest(result, this.code, options?.truncate)\n }\n\n return result.then(digest => createDigest(digest, this.code, options?.truncate))\n } else {\n throw Error('Unknown type, must be binary type')\n /* c8 ignore next 1 */\n }\n }\n}\n\n/**\n * Create a Digest from the passed uint8array and code, optionally truncating it\n * first.\n */\nfunction createDigest <Code extends number> (digest: Uint8Array, code: Code, truncate?: number): Digest.Digest<Code, number> {\n if (truncate != null && truncate !== digest.byteLength) {\n if (truncate > digest.byteLength) {\n throw new Error(`Invalid truncate option, must be less than or equal to ${digest.byteLength}`)\n }\n\n digest = digest.subarray(0, truncate)\n }\n\n return Digest.create(code, digest)\n}\n", "import { base32 } from './bases/base32.js'\nimport { base36 } from './bases/base36.js'\nimport { base58btc } from './bases/base58.js'\nimport { coerce } from './bytes.js'\nimport * as Digest from './hashes/digest.js'\nimport * as varint from './varint.js'\nimport type * as API from './link/interface.js'\n\n// This way TS will also expose all the types from module\nexport * from './link/interface.js'\n\nexport function format <T extends API.Link<unknown, number, number, API.Version>, Prefix extends string> (link: T, base?: API.MultibaseEncoder<Prefix>): API.ToString<T, Prefix> {\n const { bytes, version } = link\n switch (version) {\n case 0:\n return toStringV0(\n bytes,\n baseCache(link),\n base as API.MultibaseEncoder<'z'> ?? base58btc.encoder\n )\n default:\n return toStringV1(\n bytes,\n baseCache(link),\n (base ?? base32.encoder) as API.MultibaseEncoder<Prefix>\n )\n }\n}\n\nexport function toJSON <Link extends API.UnknownLink> (link: Link): API.LinkJSON<Link> {\n return {\n '/': format(link)\n }\n}\n\nexport function fromJSON <Link extends API.UnknownLink> (json: API.LinkJSON<Link>): CID<unknown, number, number, API.Version> {\n return CID.parse(json['/'])\n}\n\nconst cache = new WeakMap<API.UnknownLink, Map<string, string>>()\n\nfunction baseCache (cid: API.UnknownLink): Map<string, string> {\n const baseCache = cache.get(cid)\n if (baseCache == null) {\n const baseCache = new Map()\n cache.set(cid, baseCache)\n return baseCache\n }\n return baseCache\n}\n\nexport class CID<Data = unknown, Format extends number = number, Alg extends number = number, Version extends API.Version = API.Version> implements API.Link<Data, Format, Alg, Version> {\n readonly code: Format\n readonly version: Version\n readonly multihash: API.MultihashDigest<Alg>\n readonly bytes: Uint8Array\n readonly '/': Uint8Array\n\n /**\n * @param version - Version of the CID\n * @param code - Code of the codec content is encoded in, see https://github.com/multiformats/multicodec/blob/master/table.csv\n * @param multihash - (Multi)hash of the of the content.\n */\n constructor (version: Version, code: Format, multihash: API.MultihashDigest<Alg>, bytes: Uint8Array) {\n this.code = code\n this.version = version\n this.multihash = multihash\n this.bytes = bytes\n\n // flag to serializers that this is a CID and\n // should be treated specially\n this['/'] = bytes\n }\n\n /**\n * Signalling `cid.asCID === cid` has been replaced with `cid['/'] === cid.bytes`\n * please either use `CID.asCID(cid)` or switch to new signalling mechanism\n *\n * @deprecated\n */\n get asCID (): this {\n return this\n }\n\n // ArrayBufferView\n get byteOffset (): number {\n return this.bytes.byteOffset\n }\n\n // ArrayBufferView\n get byteLength (): number {\n return this.bytes.byteLength\n }\n\n toV0 (): CID<Data, API.DAG_PB, API.SHA_256, 0> {\n switch (this.version) {\n case 0: {\n return this as CID<Data, API.DAG_PB, API.SHA_256, 0>\n }\n case 1: {\n const { code, multihash } = this\n\n if (code !== DAG_PB_CODE) {\n throw new Error('Cannot convert a non dag-pb CID to CIDv0')\n }\n\n // sha2-256\n if (multihash.code !== SHA_256_CODE) {\n throw new Error('Cannot convert non sha2-256 multihash CID to CIDv0')\n }\n\n return (\n CID.createV0(\n multihash as API.MultihashDigest<API.SHA_256>\n )\n )\n }\n default: {\n throw Error(\n `Can not convert CID version ${this.version} to version 0. This is a bug please report`\n )\n }\n }\n }\n\n toV1 (): CID<Data, Format, Alg, 1> {\n switch (this.version) {\n case 0: {\n const { code, digest } = this.multihash\n const multihash = Digest.create(code, digest)\n return (\n CID.createV1(this.code, multihash)\n )\n }\n case 1: {\n return this as CID<Data, Format, Alg, 1>\n }\n default: {\n throw Error(\n `Can not convert CID version ${this.version} to version 1. This is a bug please report`\n )\n }\n }\n }\n\n equals (other: unknown): other is CID<Data, Format, Alg, Version> {\n return CID.equals(this, other)\n }\n\n static equals <Data, Format extends number, Alg extends number, Version extends API.Version>(self: API.Link<Data, Format, Alg, Version>, other: unknown): other is CID {\n const unknown = other as { code?: unknown, version?: unknown, multihash?: unknown }\n return (\n unknown != null &&\n self.code === unknown.code &&\n self.version === unknown.version &&\n Digest.equals(self.multihash, unknown.multihash)\n )\n }\n\n toString (base?: API.MultibaseEncoder<string>): string {\n return format(this, base)\n }\n\n toJSON (): API.LinkJSON<this> {\n return { '/': format(this) }\n }\n\n link (): this {\n return this\n }\n\n readonly [Symbol.toStringTag] = 'CID';\n\n // Legacy\n\n [Symbol.for('nodejs.util.inspect.custom')] (): string {\n return `CID(${this.toString()})`\n }\n\n /**\n * Takes any input `value` and returns a `CID` instance if it was\n * a `CID` otherwise returns `null`. If `value` is instanceof `CID`\n * it will return value back. If `value` is not instance of this CID\n * class, but is compatible CID it will return new instance of this\n * `CID` class. Otherwise returns null.\n *\n * This allows two different incompatible versions of CID library to\n * co-exist and interop as long as binary interface is compatible.\n */\n static asCID <Data, Format extends number, Alg extends number, Version extends API.Version, U>(input: API.Link<Data, Format, Alg, Version> | U): CID<Data, Format, Alg, Version> | null {\n if (input == null) {\n return null\n }\n\n const value = input as any\n if (value instanceof CID) {\n // If value is instance of CID then we're all set.\n return value\n } else if ((value['/'] != null && value['/'] === value.bytes) || value.asCID === value) {\n // If value isn't instance of this CID class but `this.asCID === this` or\n // `value['/'] === value.bytes` is true it is CID instance coming from a\n // different implementation (diff version or duplicate). In that case we\n // rebase it to this `CID` implementation so caller is guaranteed to get\n // instance with expected API.\n const { version, code, multihash, bytes } = value\n return new CID(\n version,\n code,\n multihash as API.MultihashDigest<Alg>,\n bytes ?? encodeCID(version, code, multihash.bytes)\n )\n } else if (value[cidSymbol] === true) {\n // If value is a CID from older implementation that used to be tagged via\n // symbol we still rebase it to the this `CID` implementation by\n // delegating that to a constructor.\n const { version, multihash, code } = value\n const digest = Digest.decode(multihash) as API.MultihashDigest<Alg>\n return CID.create(version, code, digest)\n } else {\n // Otherwise value is not a CID (or an incompatible version of it) in\n // which case we return `null`.\n return null\n }\n }\n\n /**\n * @param version - Version of the CID\n * @param code - Code of the codec content is encoded in, see https://github.com/multiformats/multicodec/blob/master/table.csv\n * @param digest - (Multi)hash of the of the content.\n */\n static create <Data, Format extends number, Alg extends number, Version extends API.Version>(version: Version, code: Format, digest: API.MultihashDigest<Alg>): CID<Data, Format, Alg, Version> {\n if (typeof code !== 'number') {\n throw new Error('String codecs are no longer supported')\n }\n\n if (!(digest.bytes instanceof Uint8Array)) {\n throw new Error('Invalid digest')\n }\n\n switch (version) {\n case 0: {\n if (code !== DAG_PB_CODE) {\n throw new Error(\n `Version 0 CID must use dag-pb (code: ${DAG_PB_CODE}) block encoding`\n )\n } else {\n return new CID(version, code, digest, digest.bytes)\n }\n }\n case 1: {\n const bytes = encodeCID(version, code, digest.bytes)\n return new CID(version, code, digest, bytes)\n }\n default: {\n throw new Error('Invalid version')\n }\n }\n }\n\n /**\n * Simplified version of `create` for CIDv0.\n */\n static createV0 <T = unknown>(digest: API.MultihashDigest<typeof SHA_256_CODE>): CID<T, typeof DAG_PB_CODE, typeof SHA_256_CODE, 0> {\n return CID.create(0, DAG_PB_CODE, digest)\n }\n\n /**\n * Simplified version of `create` for CIDv1.\n *\n * @param code - Content encoding format code.\n * @param digest - Multihash of the content.\n */\n static createV1 <Data, Code extends number, Alg extends number>(code: Code, digest: API.MultihashDigest<Alg>): CID<Data, Code, Alg, 1> {\n return CID.create(1, code, digest)\n }\n\n /**\n * Decoded a CID from its binary representation. The byte array must contain\n * only the CID with no additional bytes.\n *\n * An error will be thrown if the bytes provided do not contain a valid\n * binary representation of a CID.\n */\n static decode <Data, Code extends number, Alg extends number, Version extends API.Version>(bytes: API.ByteView<API.Link<Data, Code, Alg, Version>>): CID<Data, Code, Alg, Version> {\n const [cid, remainder] = CID.decodeFirst(bytes)\n if (remainder.length !== 0) {\n throw new Error('Incorrect length')\n }\n return cid\n }\n\n /**\n * Decoded a CID from its binary representation at the beginning of a byte\n * array.\n *\n * Returns an array with the first element containing the CID and the second\n * element containing the remainder of the original byte array. The remainder\n * will be a zero-length byte array if the provided bytes only contained a\n * binary CID representation.\n */\n static decodeFirst <T, C extends number, A extends number, V extends API.Version>(bytes: API.ByteView<API.Link<T, C, A, V>>): [CID<T, C, A, V>, Uint8Array] {\n const specs = CID.inspectBytes(bytes)\n const prefixSize = specs.size - specs.multihashSize\n const multihashBytes = coerce(\n bytes.subarray(prefixSize, prefixSize + specs.multihashSize)\n )\n if (multihashBytes.byteLength !== specs.multihashSize) {\n throw new Error('Incorrect length')\n }\n const digestBytes = multihashBytes.subarray(\n specs.multihashSize - specs.digestSize\n )\n const digest = new Digest.Digest(\n specs.multihashCode,\n specs.digestSize,\n digestBytes,\n multihashBytes\n )\n const cid =\n specs.version === 0\n ? CID.createV0(digest as API.MultihashDigest<API.SHA_256>)\n : CID.createV1(specs.codec, digest)\n return [cid as CID<T, C, A, V>, bytes.subarray(specs.size)]\n }\n\n /**\n * Inspect the initial bytes of a CID to determine its properties.\n *\n * Involves decoding up to 4 varints. Typically this will require only 4 to 6\n * bytes but for larger multicodec code values and larger multihash digest\n * lengths these varints can be quite large. It is recommended that at least\n * 10 bytes be made available in the `initialBytes` argument for a complete\n * inspection.\n */\n static inspectBytes <T, C extends number, A extends number, V extends API.Version>(initialBytes: API.ByteView<API.Link<T, C, A, V>>): { version: V, codec: C, multihashCode: A, digestSize: number, multihashSize: number, size: number } {\n let offset = 0\n const next = (): number => {\n const [i, length] = varint.decode(initialBytes.subarray(offset))\n offset += length\n return i\n }\n\n let version = next() as V\n let codec = DAG_PB_CODE as C\n if (version as number === 18) {\n // CIDv0\n version = 0 as V\n offset = 0\n } else {\n codec = next() as C\n }\n\n if (version !== 0 && version !== 1) {\n throw new RangeError(`Invalid CID version ${version}`)\n }\n\n const prefixSize = offset\n const multihashCode = next() as A // multihash code\n const digestSize = next() // multihash length\n const size = offset + digestSize\n const multihashSize = size - prefixSize\n\n return { version, codec, multihashCode, digestSize, multihashSize, size }\n }\n\n /**\n * Takes cid in a string representation and creates an instance. If `base`\n * decoder is not provided will use a default from the configuration. It will\n * throw an error if encoding of the CID is not compatible with supplied (or\n * a default decoder).\n */\n static parse <Prefix extends string, Data, Code extends number, Alg extends number, Version extends API.Version>(source: API.ToString<API.Link<Data, Code, Alg, Version>, Prefix>, base?: API.MultibaseDecoder<Prefix>): CID<Data, Code, Alg, Version> {\n const [prefix, bytes] = parseCIDtoBytes(source, base)\n\n const cid = CID.decode(bytes)\n\n if (cid.version === 0 && source[0] !== 'Q') {\n throw Error('Version 0 CID string must not include multibase prefix')\n }\n\n // Cache string representation to avoid computing it on `this.toString()`\n baseCache(cid).set(prefix, source)\n\n return cid\n }\n}\n\nfunction parseCIDtoBytes <Prefix extends string, Data, Code extends number, Alg extends number, Version extends API.Version> (source: API.ToString<API.Link<Data, Code, Alg, Version>, Prefix>, base?: API.MultibaseDecoder<Prefix>): [Prefix, API.ByteView<API.Link<Data, Code, Alg, Version>>] {\n switch (source[0]) {\n // CIDv0 is parsed differently\n case 'Q': {\n const decoder = base ?? base58btc\n return [\n base58btc.prefix as Prefix,\n decoder.decode(`${base58btc.prefix}${source}`)\n ]\n }\n case base58btc.prefix: {\n const decoder = base ?? base58btc\n return [base58btc.prefix as Prefix, decoder.decode(source)]\n }\n case base32.prefix: {\n const decoder = base ?? base32\n return [base32.prefix as Prefix, decoder.decode(source)]\n }\n case base36.prefix: {\n const decoder = base ?? base36\n return [base36.prefix as Prefix, decoder.decode(source)]\n }\n default: {\n if (base == null) {\n throw Error(\n 'To parse non base32, base36 or base58btc encoded CID multibase decoder must be provided'\n )\n }\n return [source[0] as Prefix, base.decode(source)]\n }\n }\n}\n\nfunction toStringV0 (bytes: Uint8Array, cache: Map<string, string>, base: API.MultibaseEncoder<'z'>): string {\n const { prefix } = base\n if (prefix !== base58btc.prefix) {\n throw Error(`Cannot string encode V0 in ${base.name} encoding`)\n }\n\n const cid = cache.get(prefix)\n if (cid == null) {\n const cid = base.encode(bytes).slice(1)\n cache.set(prefix, cid)\n return cid\n } else {\n return cid\n }\n}\n\nfunction toStringV1 <Prefix extends string> (bytes: Uint8Array, cache: Map<string, string>, base: API.MultibaseEncoder<Prefix>): string {\n const { prefix } = base\n const cid = cache.get(prefix)\n if (cid == null) {\n const cid = base.encode(bytes)\n cache.set(prefix, cid)\n return cid\n } else {\n return cid\n }\n}\n\nconst DAG_PB_CODE = 0x70\nconst SHA_256_CODE = 0x12\n\nfunction encodeCID (version: API.Version, code: number, multihash: Uint8Array): Uint8Array {\n const codeOffset = varint.encodingLength(version)\n const hashOffset = codeOffset + varint.encodingLength(code)\n const bytes = new Uint8Array(hashOffset + multihash.byteLength)\n varint.encodeTo(version, bytes, 0)\n varint.encodeTo(code, bytes, codeOffset)\n bytes.set(multihash, hashOffset)\n return bytes\n}\n\nconst cidSymbol = Symbol.for('@ipld/js-cid/CID')\n", "import * as base10 from './bases/base10.js'\nimport * as base16 from './bases/base16.js'\nimport * as base2 from './bases/base2.js'\nimport * as base256emoji from './bases/base256emoji.js'\nimport * as base32 from './bases/base32.js'\nimport * as base36 from './bases/base36.js'\nimport * as base58 from './bases/base58.js'\nimport * as base64 from './bases/base64.js'\nimport * as base8 from './bases/base8.js'\nimport * as identityBase from './bases/identity.js'\nimport * as json from './codecs/json.js'\nimport * as raw from './codecs/raw.js'\nimport * as identity from './hashes/identity.js'\nimport * as sha2 from './hashes/sha2.js'\nimport { CID, hasher, digest, varint, bytes } from './index.js'\n\nexport const bases = { ...identityBase, ...base2, ...base8, ...base10, ...base16, ...base32, ...base36, ...base58, ...base64, ...base256emoji }\nexport const hashes = { ...sha2, ...identity }\nexport const codecs = { raw, json }\n\nexport { CID, hasher, digest, varint, bytes }\n", "import { bases } from 'multiformats/basics'\nimport type { MultibaseCodec } from 'multiformats'\nimport { allocUnsafe } from '#alloc'\n\nfunction createCodec (name: string, prefix: string, encode: (buf: Uint8Array) => string, decode: (str: string) => Uint8Array): MultibaseCodec<any> {\n return {\n name,\n prefix,\n encoder: {\n name,\n prefix,\n encode\n },\n decoder: {\n decode\n }\n }\n}\n\nconst string = createCodec('utf8', 'u', (buf) => {\n const decoder = new TextDecoder('utf8')\n return 'u' + decoder.decode(buf)\n}, (str) => {\n const encoder = new TextEncoder()\n return encoder.encode(str.substring(1))\n})\n\nconst ascii = createCodec('ascii', 'a', (buf) => {\n let string = 'a'\n\n for (let i = 0; i < buf.length; i++) {\n string += String.fromCharCode(buf[i])\n }\n return string\n}, (str) => {\n str = str.substring(1)\n const buf = allocUnsafe(str.length)\n\n for (let i = 0; i < str.length; i++) {\n buf[i] = str.charCodeAt(i)\n }\n\n return buf\n})\n\nexport type SupportedEncodings = 'utf8' | 'utf-8' | 'hex' | 'latin1' | 'ascii' | 'binary' | keyof typeof bases\n\nconst BASES: Record<SupportedEncodings, MultibaseCodec<any>> = {\n utf8: string,\n 'utf-8': string,\n hex: bases.base16,\n latin1: ascii,\n ascii,\n binary: ascii,\n\n ...bases\n}\n\nexport default BASES\n", "import { allocUnsafe } from 'uint8arrays/alloc'\n\n/**\n * A general purpose buffer pool\n */\nexport default function pool (size?: number): (size: number) => Uint8Array {\n const SIZE = size ?? 8192\n const MAX = SIZE >>> 1\n let slab: Uint8Array\n let offset = SIZE\n return function poolAlloc (size: number) {\n if (size < 1 || size > MAX) {\n return allocUnsafe(size)\n }\n\n if (offset + size > SIZE) {\n slab = allocUnsafe(SIZE)\n offset = 0\n }\n\n const buf = slab.subarray(offset, offset += size)\n\n if ((offset & 7) !== 0) {\n // align to 32 bit\n offset = (offset | 7) + 1\n }\n\n return buf\n }\n}\n", "import { encodeUint8Array, encodingLength } from 'uint8-varint'\nimport { allocUnsafe } from 'uint8arrays/alloc'\nimport { fromString as uint8ArrayFromString } from 'uint8arrays/from-string'\nimport { writeFloatLE, writeDoubleLE } from './float.js'\nimport { LongBits } from './longbits.js'\nimport pool from './pool.js'\nimport * as utf8 from './utf8.js'\nimport type { Writer } from '../index.js'\n\ninterface WriterOperation<T> {\n (val: T, buf: Uint8Array, pos: number): any\n}\n\n/**\n * Constructs a new writer operation instance.\n *\n * @classdesc Scheduled writer operation\n */\nclass Op<T> {\n /**\n * Function to call\n */\n public fn: WriterOperation<T>\n\n /**\n * Value byte length\n */\n public len: number\n\n /**\n * Next operation\n */\n public next?: Op<any>\n\n /**\n * Value to write\n */\n public val: T\n\n constructor (fn: WriterOperation<T>, len: number, val: T) {\n this.fn = fn\n this.len = len\n this.next = undefined\n this.val = val // type varies\n }\n}\n\n/* istanbul ignore next */\nfunction noop (): void {}\n\n/**\n * Constructs a new writer state instance\n */\nclass State {\n /**\n * Current head\n */\n public head: Op<any>\n\n /**\n * Current tail\n */\n public tail: Op<any>\n\n /**\n * Current buffer length\n */\n public len: number\n\n /**\n * Next state\n */\n public next?: State\n\n constructor (writer: Uint8ArrayWriter) {\n this.head = writer.head\n this.tail = writer.tail\n this.len = writer.len\n this.next = writer.states\n }\n}\n\nconst bufferPool = pool()\n\n/**\n * Allocates a buffer of the specified size\n */\nfunction alloc (size: number): Uint8Array {\n if (globalThis.Buffer != null) {\n return allocUnsafe(size)\n }\n\n return bufferPool(size)\n}\n\n/**\n * When a value is written, the writer calculates its byte length and puts it into a linked\n * list of operations to perform when finish() is called. This both allows us to allocate\n * buffers of the exact required size and reduces the amount of work we have to do compared\n * to first calculating over objects and then encoding over objects. In our case, the encoding\n * part is just a linked list walk calling operations with already prepared values.\n */\nclass Uint8ArrayWriter implements Writer {\n /**\n * Current length\n */\n public len: number\n\n /**\n * Operations head\n */\n public head: Op<any>\n\n /**\n * Operations tail\n */\n public tail: Op<any>\n\n /**\n * Linked forked states\n */\n public states?: any\n\n constructor () {\n this.len = 0\n this.head = new Op(noop, 0, 0)\n this.tail = this.head\n this.states = null\n }\n\n /**\n * Pushes a new operation to the queue\n */\n _push (fn: WriterOperation<any>, len: number, val: any): this {\n this.tail = this.tail.next = new Op(fn, len, val)\n this.len += len\n\n return this\n }\n\n /**\n * Writes an unsigned 32 bit value as a varint\n */\n uint32 (value: number): this {\n // here, the call to this.push has been inlined and a varint specific Op subclass is used.\n // uint32 is by far the most frequently used operation and benefits significantly from this.\n this.len += (this.tail = this.tail.next = new VarintOp(\n (value = value >>> 0) <\n 128\n ? 1\n : value < 16384\n ? 2\n : value < 2097152\n ? 3\n : value < 268435456\n ? 4\n : 5,\n value)).len\n return this\n }\n\n /**\n * Writes a signed 32 bit value as a varint`\n */\n int32 (value: number): this {\n return value < 0\n ? this._push(writeVarint64, 10, LongBits.fromNumber(value)) // 10 bytes per spec\n : this.uint32(value)\n }\n\n /**\n * Writes a 32 bit value as a varint, zig-zag encoded\n */\n sint32 (value: number): this {\n return this.uint32((value << 1 ^ value >> 31) >>> 0)\n }\n\n /**\n * Writes an unsigned 64 bit value as a varint\n */\n uint64 (value: bigint): this {\n const bits = LongBits.fromBigInt(value)\n return this._push(writeVarint64, bits.length(), bits)\n }\n\n /**\n * Writes an unsigned 64 bit value as a varint\n */\n uint64Number (value: number): this {\n return this._push(encodeUint8Array, encodingLength(value), value)\n }\n\n /**\n * Writes an unsigned 64 bit value as a varint\n */\n uint64String (value: string): this {\n return this.uint64(BigInt(value))\n }\n\n /**\n * Writes a signed 64 bit value as a varint\n */\n int64 (value: bigint): this {\n return this.uint64(value)\n }\n\n /**\n * Writes a signed 64 bit value as a varint\n */\n int64Number (value: number): this {\n return this.uint64Number(value)\n }\n\n /**\n * Writes a signed 64 bit value as a varint\n */\n int64String (value: string): this {\n return this.uint64String(value)\n }\n\n /**\n * Writes a signed 64 bit value as a varint, zig-zag encoded\n */\n sint64 (value: bigint): this {\n const bits = LongBits.fromBigInt(value).zzEncode()\n return this._push(writeVarint64, bits.length(), bits)\n }\n\n /**\n * Writes a signed 64 bit value as a varint, zig-zag encoded\n */\n sint64Number (value: number): this {\n const bits = LongBits.fromNumber(value).zzEncode()\n return this._push(writeVarint64, bits.length(), bits)\n }\n\n /**\n * Writes a signed 64 bit value as a varint, zig-zag encoded\n */\n sint64String (value: string): this {\n return this.sint64(BigInt(value))\n }\n\n /**\n * Writes a boolish value as a varint\n */\n bool (value: boolean): this {\n return this._push(writeByte, 1, value ? 1 : 0)\n }\n\n /**\n * Writes an unsigned 32 bit value as fixed 32 bits\n */\n fixed32 (value: number): this {\n return this._push(writeFixed32, 4, value >>> 0)\n }\n\n /**\n * Writes a signed 32 bit value as fixed 32 bits\n */\n sfixed32 (value: number): this {\n return this.fixed32(value)\n }\n\n /**\n * Writes an unsigned 64 bit value as fixed 64 bits\n */\n fixed64 (value: bigint): this {\n const bits = LongBits.fromBigInt(value)\n return this._push(writeFixed32, 4, bits.lo)._push(writeFixed32, 4, bits.hi)\n }\n\n /**\n * Writes an unsigned 64 bit value as fixed 64 bits\n */\n fixed64Number (value: number): this {\n const bits = LongBits.fromNumber(value)\n return this._push(writeFixed32, 4, bits.lo)._push(writeFixed32, 4, bits.hi)\n }\n\n /**\n * Writes an unsigned 64 bit value as fixed 64 bits\n */\n fixed64String (value: string): this {\n return this.fixed64(BigInt(value))\n }\n\n /**\n * Writes a signed 64 bit value as fixed 64 bits\n */\n sfixed64 (value: bigint): this {\n return this.fixed64(value)\n }\n\n /**\n * Writes a signed 64 bit value as fixed 64 bits\n */\n sfixed64Number (value: number): this {\n return this.fixed64Number(value)\n }\n\n /**\n * Writes a signed 64 bit value as fixed 64 bits\n */\n sfixed64String (value: string): this {\n return this.fixed64String(value)\n }\n\n /**\n * Writes a float (32 bit)\n */\n float (value: number): this {\n return this._push(writeFloatLE, 4, value)\n }\n\n /**\n * Writes a double (64 bit float).\n *\n * @function\n * @param {number} value - Value to write\n * @returns {Writer} `this`\n */\n double (value: number): this {\n return this._push(writeDoubleLE, 8, value)\n }\n\n /**\n * Writes a sequence of bytes\n */\n bytes (value: Uint8Array): this {\n const len = value.length >>> 0\n\n if (len === 0) {\n return this._push(writeByte, 1, 0)\n }\n\n return this.uint32(len)._push(writeBytes, len, value)\n }\n\n /**\n * Writes a string\n */\n string (value: string): this {\n const len = utf8.length(value)\n return len !== 0\n ? this.uint32(len)._push(utf8.write, len, value)\n : this._push(writeByte, 1, 0)\n }\n\n /**\n * Forks this writer's state by pushing it to a stack.\n * Calling {@link Writer#reset|reset} or {@link Writer#ldelim|ldelim} resets the writer to the previous state.\n */\n fork (): this {\n this.states = new State(this)\n this.head = this.tail = new Op(noop, 0, 0)\n this.len = 0\n return this\n }\n\n /**\n * Resets this instance to the last state\n */\n reset (): this {\n if (this.states != null) {\n this.head = this.states.head\n this.tail = this.states.tail\n this.len = this.states.len\n this.states = this.states.next\n } else {\n this.head = this.tail = new Op(noop, 0, 0)\n this.len = 0\n }\n return this\n }\n\n /**\n * Resets to the last state and appends the fork state's current write length as a varint followed by its operations.\n */\n ldelim (): this {\n const head = this.head\n const tail = this.tail\n const len = this.len\n this.reset().uint32(len)\n if (len !== 0) {\n this.tail.next = head.next // skip noop\n this.tail = tail\n this.len += len\n }\n return this\n }\n\n /**\n * Finishes the write operation\n */\n finish (): Uint8Array {\n let head = this.head.next // skip noop\n const buf = alloc(this.len)\n let pos = 0\n while (head != null) {\n head.fn(head.val, buf, pos)\n pos += head.len\n head = head.next\n }\n // this.head = this.tail = null;\n return buf\n }\n}\n\nfunction writeByte (val: number, buf: Uint8Array, pos: number): void {\n buf[pos] = val & 255\n}\n\nfunction writeVarint32 (val: number, buf: Uint8Array, pos: number): void {\n while (val > 127) {\n buf[pos++] = val & 127 | 128\n val >>>= 7\n }\n buf[pos] = val\n}\n\n/**\n * Constructs a new varint writer operation instance.\n *\n * @classdesc Scheduled varint writer operation\n */\nclass VarintOp extends Op<number> {\n public next?: Op<any>\n\n constructor (len: number, val: number) {\n super(writeVarint32, len, val)\n this.next = undefined\n }\n}\n\nfunction writeVarint64 (val: LongBits, buf: Uint8Array, pos: number): void {\n while (val.hi !== 0) {\n buf[pos++] = val.lo & 127 | 128\n val.lo = (val.lo >>> 7 | val.hi << 25) >>> 0\n val.hi >>>= 7\n }\n while (val.lo > 127) {\n buf[pos++] = val.lo & 127 | 128\n val.lo = val.lo >>> 7\n }\n buf[pos++] = val.lo\n}\n\nfunction writeFixed32 (val: number, buf: Uint8Array, pos: number): void {\n buf[pos] = val & 255\n buf[pos + 1] = val >>> 8 & 255\n buf[pos + 2] = val >>> 16 & 255\n buf[pos + 3] = val >>> 24\n}\n\nfunction writeBytes (val: Uint8Array, buf: Uint8Array, pos: number): void {\n buf.set(val, pos)\n}\n\nif (globalThis.Buffer != null) {\n Uint8ArrayWriter.prototype.bytes = function (value: Uint8Array) {\n const len = value.length >>> 0\n\n this.uint32(len)\n\n if (len > 0) {\n this._push(writeBytesBuffer, len, value)\n }\n\n return this\n }\n\n Uint8ArrayWriter.prototype.string = function (value: string) {\n const len = globalThis.Buffer.byteLength(value)\n\n this.uint32(len)\n\n if (len > 0) {\n this._push(writeStringBuffer, len, value)\n }\n\n return this\n }\n}\n\nfunction writeBytesBuffer (val: Uint8Array, buf: Uint8Array, pos: number): void {\n buf.set(val, pos) // faster than copy (requires node >= 4 where Buffers extend Uint8Array and set is properly inherited)\n // also works for plain array values\n}\n\nfunction writeStringBuffer (val: string, buf: Uint8Array, pos: number): void {\n if (val.length < 40) {\n // plain js is faster for short strings (probably due to redundant assertions)\n utf8.write(val, buf, pos)\n // @ts-expect-error buf isn't a Uint8Array?\n } else if (buf.utf8Write != null) {\n // @ts-expect-error buf isn't a Uint8Array?\n buf.utf8Write(val, pos)\n } else {\n buf.set(uint8ArrayFromString(val), pos)\n }\n}\n\n/**\n * Creates a new writer\n */\nexport function createWriter (): Writer {\n return new Uint8ArrayWriter()\n}\n", "import { createWriter } from './utils/writer.js'\nimport type { Codec } from './codec.js'\n\nexport function encodeMessage <T> (message: Partial<T>, codec: Pick<Codec<T>, 'encode'>): Uint8Array {\n const w = createWriter()\n\n codec.encode(message, w, {\n lengthDelimited: false\n })\n\n return w.finish()\n}\n", "import type { Writer, Reader } from './index.js'\n\n// https://developers.google.com/protocol-buffers/docs/encoding#structure\nexport enum CODEC_TYPES {\n VARINT = 0,\n BIT64,\n LENGTH_DELIMITED,\n START_GROUP,\n END_GROUP,\n BIT32\n}\n\nexport interface EncodeOptions {\n lengthDelimited?: boolean\n writeDefaults?: boolean\n}\n\nexport interface EncodeFunction<T> {\n (value: Partial<T>, writer: Writer, opts?: EncodeOptions): void\n}\n\n// protobuf types that contain multiple values\ntype CollectionTypes = any[] | Map<any, any>\n\n// protobuf types that are not collections or messages\ntype PrimitiveTypes = boolean | number | string | bigint | Uint8Array\n\n// recursive array/map field length limits\ntype CollectionLimits <T> = {\n [K in keyof T]: T[K] extends CollectionTypes ? number :\n T[K] extends PrimitiveTypes ? never : Limits<T[K]>\n}\n\n// recursive array member array/map field length limits\ntype ArrayElementLimits <T> = {\n [K in keyof T as `${string & K}$`]: T[K] extends Array<infer ElementType> ?\n (ElementType extends PrimitiveTypes ? never : Limits<ElementType>) :\n (T[K] extends PrimitiveTypes ? never : Limits<T[K]>)\n}\n\n// recursive map value array/map field length limits\ntype MapValueLimits <T> = {\n [K in keyof T as `${string & K}$value`]: T[K] extends Map<any, infer MapValueType> ?\n (MapValueType extends PrimitiveTypes ? never : Limits<MapValueType>) :\n (T[K] extends PrimitiveTypes ? never : Limits<T[K]>)\n}\n\n// union of collection and array elements\ntype Limits<T> = Partial<CollectionLimits<T> & ArrayElementLimits<T> & MapValueLimits<T>>\n\nexport interface DecodeOptions<T> {\n /**\n * Runtime-specified limits for lengths of repeated/map fields\n */\n limits?: Limits<T>\n}\n\nexport interface DecodeFunction<T> {\n (reader: Reader, length?: number, opts?: DecodeOptions<T>): T\n}\n\nexport interface Codec<T> {\n name: string\n type: CODEC_TYPES\n encode: EncodeFunction<T>\n decode: DecodeFunction<T>\n}\n\nexport function createCodec <T> (name: string, type: CODEC_TYPES, encode: EncodeFunction<T>, decode: DecodeFunction<T>): Codec<T> {\n return {\n name,\n type,\n encode,\n decode\n }\n}\n", "import { createCodec, CODEC_TYPES } from '../codec.js'\nimport type { DecodeFunction, EncodeFunction, Codec } from '../codec.js'\n\nexport function enumeration <T> (v: any): Codec<T> {\n function findValue (val: string | number): number {\n // Use the reverse mapping to look up the enum key for the stored value\n // https://www.typescriptlang.org/docs/handbook/enums.html#reverse-mappings\n if (v[val.toString()] == null) {\n throw new Error('Invalid enum value')\n }\n\n return v[val]\n }\n\n const encode: EncodeFunction<number | string> = function enumEncode (val, writer) {\n const enumValue = findValue(val)\n\n writer.int32(enumValue)\n }\n\n const decode: DecodeFunction<number | string> = function enumDecode (reader) {\n const val = reader.int32()\n\n return findValue(val)\n }\n\n // @ts-expect-error yeah yeah\n return createCodec('enum', CODEC_TYPES.VARINT, encode, decode)\n}\n", "import { createCodec, CODEC_TYPES } from '../codec.js'\nimport type { EncodeFunction, DecodeFunction, Codec } from '../codec.js'\n\nexport interface Factory<A, T> {\n new (obj: A): T\n}\n\nexport function message <T> (encode: EncodeFunction<T>, decode: DecodeFunction<T>): Codec<T> {\n return createCodec('message', CODEC_TYPES.LENGTH_DELIMITED, encode, decode)\n}\n", "import { enumeration, encodeMessage, decodeMessage, message } from 'protons-runtime'\nimport type { Codec } from 'protons-runtime'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nexport interface Request {\n type?: Request.Type\n connect?: ConnectRequest\n streamOpen?: StreamOpenRequest\n streamHandler?: StreamHandlerRequest\n dht?: DHTRequest\n connManager?: ConnManagerRequest\n disconnect?: DisconnectRequest\n pubsub?: PSRequest\n peerStore?: PeerstoreRequest\n}\n\nexport namespace Request {\n export enum Type {\n IDENTIFY = 'IDENTIFY',\n CONNECT = 'CONNECT',\n STREAM_OPEN = 'STREAM_OPEN',\n STREAM_HANDLER = 'STREAM_HANDLER',\n DHT = 'DHT',\n LIST_PEERS = 'LIST_PEERS',\n CONNMANAGER = 'CONNMANAGER',\n DISCONNECT = 'DISCONNECT',\n PUBSUB = 'PUBSUB',\n PEERSTORE = 'PEERSTORE'\n }\n\n enum __TypeValues {\n IDENTIFY = 0,\n CONNECT = 1,\n STREAM_OPEN = 2,\n STREAM_HANDLER = 3,\n DHT = 4,\n LIST_PEERS = 5,\n CONNMANAGER = 6,\n DISCONNECT = 7,\n PUBSUB = 8,\n PEERSTORE = 9\n }\n\n export namespace Type {\n export const codec = (): Codec<Type> => {\n return enumeration<Type>(__TypeValues)\n }\n }\n\n let _codec: Codec<Request>\n\n export const codec = (): Codec<Request> => {\n if (_codec == null) {\n _codec = message<Request>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.type != null) {\n w.uint32(8)\n Request.Type.codec().encode(obj.type, w)\n }\n\n if (obj.connect != null) {\n w.uint32(18)\n ConnectRequest.codec().encode(obj.connect, w)\n }\n\n if (obj.streamOpen != null) {\n w.uint32(26)\n StreamOpenRequest.codec().encode(obj.streamOpen, w)\n }\n\n if (obj.streamHandler != null) {\n w.uint32(34)\n StreamHandlerRequest.codec().encode(obj.streamHandler, w)\n }\n\n if (obj.dht != null) {\n w.uint32(42)\n DHTRequest.codec().encode(obj.dht, w)\n }\n\n if (obj.connManager != null) {\n w.uint32(50)\n ConnManagerRequest.codec().encode(obj.connManager, w)\n }\n\n if (obj.disconnect != null) {\n w.uint32(58)\n DisconnectRequest.codec().encode(obj.disconnect, w)\n }\n\n if (obj.pubsub != null) {\n w.uint32(66)\n PSRequest.codec().encode(obj.pubsub, w)\n }\n\n if (obj.peerStore != null) {\n w.uint32(74)\n PeerstoreRequest.codec().encode(obj.peerStore, w)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {}\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.type = Request.Type.codec().decode(reader)\n break\n case 2:\n obj.connect = ConnectRequest.codec().decode(reader, reader.uint32())\n break\n case 3:\n obj.streamOpen = StreamOpenRequest.codec().decode(reader, reader.uint32())\n break\n case 4:\n obj.streamHandler = StreamHandlerRequest.codec().decode(reader, reader.uint32())\n break\n case 5:\n obj.dht = DHTRequest.codec().decode(reader, reader.uint32())\n break\n case 6:\n obj.connManager = ConnManagerRequest.codec().decode(reader, reader.uint32())\n break\n case 7:\n obj.disconnect = DisconnectRequest.codec().decode(reader, reader.uint32())\n break\n case 8:\n obj.pubsub = PSRequest.codec().decode(reader, reader.uint32())\n break\n case 9:\n obj.peerStore = PeerstoreRequest.codec().decode(reader, reader.uint32())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<Request>): Uint8Array => {\n return encodeMessage(obj, Request.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): Request => {\n return decodeMessage(buf, Request.codec())\n }\n}\n\nexport interface Response {\n type?: Response.Type\n error?: ErrorResponse\n streamInfo?: StreamInfo\n identify?: IdentifyResponse\n dht?: DHTResponse\n peers: PeerInfo[]\n pubsub?: PSResponse\n peerStore?: PeerstoreResponse\n}\n\nexport namespace Response {\n export enum Type {\n OK = 'OK',\n ERROR = 'ERROR'\n }\n\n enum __TypeValues {\n OK = 0,\n ERROR = 1\n }\n\n export namespace Type {\n export const codec = (): Codec<Type> => {\n return enumeration<Type>(__TypeValues)\n }\n }\n\n let _codec: Codec<Response>\n\n export const codec = (): Codec<Response> => {\n if (_codec == null) {\n _codec = message<Response>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.type != null) {\n w.uint32(8)\n Response.Type.codec().encode(obj.type, w)\n }\n\n if (obj.error != null) {\n w.uint32(18)\n ErrorResponse.codec().encode(obj.error, w)\n }\n\n if (obj.streamInfo != null) {\n w.uint32(26)\n StreamInfo.codec().encode(obj.streamInfo, w)\n }\n\n if (obj.identify != null) {\n w.uint32(34)\n IdentifyResponse.codec().encode(obj.identify, w)\n }\n\n if (obj.dht != null) {\n w.uint32(42)\n DHTResponse.codec().encode(obj.dht, w)\n }\n\n if (obj.peers != null) {\n for (const value of obj.peers) {\n w.uint32(50)\n PeerInfo.codec().encode(value, w)\n }\n }\n\n if (obj.pubsub != null) {\n w.uint32(58)\n PSResponse.codec().encode(obj.pubsub, w)\n }\n\n if (obj.peerStore != null) {\n w.uint32(66)\n PeerstoreResponse.codec().encode(obj.peerStore, w)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n peers: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.type = Response.Type.codec().decode(reader)\n break\n case 2:\n obj.error = ErrorResponse.codec().decode(reader, reader.uint32())\n break\n case 3:\n obj.streamInfo = StreamInfo.codec().decode(reader, reader.uint32())\n break\n case 4:\n obj.identify = IdentifyResponse.codec().decode(reader, reader.uint32())\n break\n case 5:\n obj.dht = DHTResponse.codec().decode(reader, reader.uint32())\n break\n case 6:\n obj.peers.push(PeerInfo.codec().decode(reader, reader.uint32()))\n break\n case 7:\n obj.pubsub = PSResponse.codec().decode(reader, reader.uint32())\n break\n case 8:\n obj.peerStore = PeerstoreResponse.codec().decode(reader, reader.uint32())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<Response>): Uint8Array => {\n return encodeMessage(obj, Response.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): Response => {\n return decodeMessage(buf, Response.codec())\n }\n}\n\nexport interface IdentifyResponse {\n id: Uint8Array\n addrs: Uint8Array[]\n}\n\nexport namespace IdentifyResponse {\n let _codec: Codec<IdentifyResponse>\n\n export const codec = (): Codec<IdentifyResponse> => {\n if (_codec == null) {\n _codec = message<IdentifyResponse>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.id != null && obj.id.byteLength > 0)) {\n w.uint32(10)\n w.bytes(obj.id)\n }\n\n if (obj.addrs != null) {\n for (const value of obj.addrs) {\n w.uint32(18)\n w.bytes(value)\n }\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n id: new Uint8Array(0),\n addrs: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.id = reader.bytes()\n break\n case 2:\n obj.addrs.push(reader.bytes())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<IdentifyResponse>): Uint8Array => {\n return encodeMessage(obj, IdentifyResponse.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): IdentifyResponse => {\n return decodeMessage(buf, IdentifyResponse.codec())\n }\n}\n\nexport interface ConnectRequest {\n peer: Uint8Array\n addrs: Uint8Array[]\n timeout?: bigint\n}\n\nexport namespace ConnectRequest {\n let _codec: Codec<ConnectRequest>\n\n export const codec = (): Codec<ConnectRequest> => {\n if (_codec == null) {\n _codec = message<ConnectRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.peer != null && obj.peer.byteLength > 0)) {\n w.uint32(10)\n w.bytes(obj.peer)\n }\n\n if (obj.addrs != null) {\n for (const value of obj.addrs) {\n w.uint32(18)\n w.bytes(value)\n }\n }\n\n if (obj.timeout != null) {\n w.uint32(24)\n w.int64(obj.timeout)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n peer: new Uint8Array(0),\n addrs: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.peer = reader.bytes()\n break\n case 2:\n obj.addrs.push(reader.bytes())\n break\n case 3:\n obj.timeout = reader.int64()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<ConnectRequest>): Uint8Array => {\n return encodeMessage(obj, ConnectRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): ConnectRequest => {\n return decodeMessage(buf, ConnectRequest.codec())\n }\n}\n\nexport interface StreamOpenRequest {\n peer: Uint8Array\n proto: string[]\n timeout?: bigint\n}\n\nexport namespace StreamOpenRequest {\n let _codec: Codec<StreamOpenRequest>\n\n export const codec = (): Codec<StreamOpenRequest> => {\n if (_codec == null) {\n _codec = message<StreamOpenRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.peer != null && obj.peer.byteLength > 0)) {\n w.uint32(10)\n w.bytes(obj.peer)\n }\n\n if (obj.proto != null) {\n for (const value of obj.proto) {\n w.uint32(18)\n w.string(value)\n }\n }\n\n if (obj.timeout != null) {\n w.uint32(24)\n w.int64(obj.timeout)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n peer: new Uint8Array(0),\n proto: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.peer = reader.bytes()\n break\n case 2:\n obj.proto.push(reader.string())\n break\n case 3:\n obj.timeout = reader.int64()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<StreamOpenRequest>): Uint8Array => {\n return encodeMessage(obj, StreamOpenRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): StreamOpenRequest => {\n return decodeMessage(buf, StreamOpenRequest.codec())\n }\n}\n\nexport interface StreamHandlerRequest {\n addr: Uint8Array\n proto: string[]\n}\n\nexport namespace StreamHandlerRequest {\n let _codec: Codec<StreamHandlerRequest>\n\n export const codec = (): Codec<StreamHandlerRequest> => {\n if (_codec == null) {\n _codec = message<StreamHandlerRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.addr != null && obj.addr.byteLength > 0)) {\n w.uint32(10)\n w.bytes(obj.addr)\n }\n\n if (obj.proto != null) {\n for (const value of obj.proto) {\n w.uint32(18)\n w.string(value)\n }\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n addr: new Uint8Array(0),\n proto: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.addr = reader.bytes()\n break\n case 2:\n obj.proto.push(reader.string())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<StreamHandlerRequest>): Uint8Array => {\n return encodeMessage(obj, StreamHandlerRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): StreamHandlerRequest => {\n return decodeMessage(buf, StreamHandlerRequest.codec())\n }\n}\n\nexport interface ErrorResponse {\n msg: string\n}\n\nexport namespace ErrorResponse {\n let _codec: Codec<ErrorResponse>\n\n export const codec = (): Codec<ErrorResponse> => {\n if (_codec == null) {\n _codec = message<ErrorResponse>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.msg != null && obj.msg !== '')) {\n w.uint32(10)\n w.string(obj.msg)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n msg: ''\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.msg = reader.string()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<ErrorResponse>): Uint8Array => {\n return encodeMessage(obj, ErrorResponse.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): ErrorResponse => {\n return decodeMessage(buf, ErrorResponse.codec())\n }\n}\n\nexport interface StreamInfo {\n peer: Uint8Array\n addr: Uint8Array\n proto: string\n}\n\nexport namespace StreamInfo {\n let _codec: Codec<StreamInfo>\n\n export const codec = (): Codec<StreamInfo> => {\n if (_codec == null) {\n _codec = message<StreamInfo>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.peer != null && obj.peer.byteLength > 0)) {\n w.uint32(10)\n w.bytes(obj.peer)\n }\n\n if ((obj.addr != null && obj.addr.byteLength > 0)) {\n w.uint32(18)\n w.bytes(obj.addr)\n }\n\n if ((obj.proto != null && obj.proto !== '')) {\n w.uint32(26)\n w.string(obj.proto)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n peer: new Uint8Array(0),\n addr: new Uint8Array(0),\n proto: ''\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.peer = reader.bytes()\n break\n case 2:\n obj.addr = reader.bytes()\n break\n case 3:\n obj.proto = reader.string()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<StreamInfo>): Uint8Array => {\n return encodeMessage(obj, StreamInfo.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): StreamInfo => {\n return decodeMessage(buf, StreamInfo.codec())\n }\n}\n\nexport interface DHTRequest {\n type?: DHTRequest.Type\n peer?: Uint8Array\n cid?: Uint8Array\n key?: Uint8Array\n value?: Uint8Array\n count?: number\n timeout?: bigint\n}\n\nexport namespace DHTRequest {\n export enum Type {\n FIND_PEER = 'FIND_PEER',\n FIND_PEERS_CONNECTED_TO_PEER = 'FIND_PEERS_CONNECTED_TO_PEER',\n FIND_PROVIDERS = 'FIND_PROVIDERS',\n GET_CLOSEST_PEERS = 'GET_CLOSEST_PEERS',\n GET_PUBLIC_KEY = 'GET_PUBLIC_KEY',\n GET_VALUE = 'GET_VALUE',\n SEARCH_VALUE = 'SEARCH_VALUE',\n PUT_VALUE = 'PUT_VALUE',\n PROVIDE = 'PROVIDE'\n }\n\n enum __TypeValues {\n FIND_PEER = 0,\n FIND_PEERS_CONNECTED_TO_PEER = 1,\n FIND_PROVIDERS = 2,\n GET_CLOSEST_PEERS = 3,\n GET_PUBLIC_KEY = 4,\n GET_VALUE = 5,\n SEARCH_VALUE = 6,\n PUT_VALUE = 7,\n PROVIDE = 8\n }\n\n export namespace Type {\n export const codec = (): Codec<Type> => {\n return enumeration<Type>(__TypeValues)\n }\n }\n\n let _codec: Codec<DHTRequest>\n\n export const codec = (): Codec<DHTRequest> => {\n if (_codec == null) {\n _codec = message<DHTRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.type != null) {\n w.uint32(8)\n DHTRequest.Type.codec().encode(obj.type, w)\n }\n\n if (obj.peer != null) {\n w.uint32(18)\n w.bytes(obj.peer)\n }\n\n if (obj.cid != null) {\n w.uint32(26)\n w.bytes(obj.cid)\n }\n\n if (obj.key != null) {\n w.uint32(34)\n w.bytes(obj.key)\n }\n\n if (obj.value != null) {\n w.uint32(42)\n w.bytes(obj.value)\n }\n\n if (obj.count != null) {\n w.uint32(48)\n w.int32(obj.count)\n }\n\n if (obj.timeout != null) {\n w.uint32(56)\n w.int64(obj.timeout)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {}\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.type = DHTRequest.Type.codec().decode(reader)\n break\n case 2:\n obj.peer = reader.bytes()\n break\n case 3:\n obj.cid = reader.bytes()\n break\n case 4:\n obj.key = reader.bytes()\n break\n case 5:\n obj.value = reader.bytes()\n break\n case 6:\n obj.count = reader.int32()\n break\n case 7:\n obj.timeout = reader.int64()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<DHTRequest>): Uint8Array => {\n return encodeMessage(obj, DHTRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): DHTRequest => {\n return decodeMessage(buf, DHTRequest.codec())\n }\n}\n\nexport interface DHTResponse {\n type?: DHTResponse.Type\n peer?: PeerInfo\n value?: Uint8Array\n}\n\nexport namespace DHTResponse {\n export enum Type {\n BEGIN = 'BEGIN',\n VALUE = 'VALUE',\n END = 'END'\n }\n\n enum __TypeValues {\n BEGIN = 0,\n VALUE = 1,\n END = 2\n }\n\n export namespace Type {\n export const codec = (): Codec<Type> => {\n return enumeration<Type>(__TypeValues)\n }\n }\n\n let _codec: Codec<DHTResponse>\n\n export const codec = (): Codec<DHTResponse> => {\n if (_codec == null) {\n _codec = message<DHTResponse>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.type != null) {\n w.uint32(8)\n DHTResponse.Type.codec().encode(obj.type, w)\n }\n\n if (obj.peer != null) {\n w.uint32(18)\n PeerInfo.codec().encode(obj.peer, w)\n }\n\n if (obj.value != null) {\n w.uint32(26)\n w.bytes(obj.value)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {}\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.type = DHTResponse.Type.codec().decode(reader)\n break\n case 2:\n obj.peer = PeerInfo.codec().decode(reader, reader.uint32())\n break\n case 3:\n obj.value = reader.bytes()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<DHTResponse>): Uint8Array => {\n return encodeMessage(obj, DHTResponse.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): DHTResponse => {\n return decodeMessage(buf, DHTResponse.codec())\n }\n}\n\nexport interface PeerInfo {\n id: Uint8Array\n addrs: Uint8Array[]\n}\n\nexport namespace PeerInfo {\n let _codec: Codec<PeerInfo>\n\n export const codec = (): Codec<PeerInfo> => {\n if (_codec == null) {\n _codec = message<PeerInfo>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.id != null && obj.id.byteLength > 0)) {\n w.uint32(10)\n w.bytes(obj.id)\n }\n\n if (obj.addrs != null) {\n for (const value of obj.addrs) {\n w.uint32(18)\n w.bytes(value)\n }\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n id: new Uint8Array(0),\n addrs: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.id = reader.bytes()\n break\n case 2:\n obj.addrs.push(reader.bytes())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PeerInfo>): Uint8Array => {\n return encodeMessage(obj, PeerInfo.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): PeerInfo => {\n return decodeMessage(buf, PeerInfo.codec())\n }\n}\n\nexport interface ConnManagerRequest {\n type?: ConnManagerRequest.Type\n peer?: Uint8Array\n tag?: string\n weight?: bigint\n}\n\nexport namespace ConnManagerRequest {\n export enum Type {\n TAG_PEER = 'TAG_PEER',\n UNTAG_PEER = 'UNTAG_PEER',\n TRIM = 'TRIM'\n }\n\n enum __TypeValues {\n TAG_PEER = 0,\n UNTAG_PEER = 1,\n TRIM = 2\n }\n\n export namespace Type {\n export const codec = (): Codec<Type> => {\n return enumeration<Type>(__TypeValues)\n }\n }\n\n let _codec: Codec<ConnManagerRequest>\n\n export const codec = (): Codec<ConnManagerRequest> => {\n if (_codec == null) {\n _codec = message<ConnManagerRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.type != null) {\n w.uint32(8)\n ConnManagerRequest.Type.codec().encode(obj.type, w)\n }\n\n if (obj.peer != null) {\n w.uint32(18)\n w.bytes(obj.peer)\n }\n\n if (obj.tag != null) {\n w.uint32(26)\n w.string(obj.tag)\n }\n\n if (obj.weight != null) {\n w.uint32(32)\n w.int64(obj.weight)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {}\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.type = ConnManagerRequest.Type.codec().decode(reader)\n break\n case 2:\n obj.peer = reader.bytes()\n break\n case 3:\n obj.tag = reader.string()\n break\n case 4:\n obj.weight = reader.int64()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<ConnManagerRequest>): Uint8Array => {\n return encodeMessage(obj, ConnManagerRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): ConnManagerRequest => {\n return decodeMessage(buf, ConnManagerRequest.codec())\n }\n}\n\nexport interface DisconnectRequest {\n peer: Uint8Array\n}\n\nexport namespace DisconnectRequest {\n let _codec: Codec<DisconnectRequest>\n\n export const codec = (): Codec<DisconnectRequest> => {\n if (_codec == null) {\n _codec = message<DisconnectRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.peer != null && obj.peer.byteLength > 0)) {\n w.uint32(10)\n w.bytes(obj.peer)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n peer: new Uint8Array(0)\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.peer = reader.bytes()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<DisconnectRequest>): Uint8Array => {\n return encodeMessage(obj, DisconnectRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): DisconnectRequest => {\n return decodeMessage(buf, DisconnectRequest.codec())\n }\n}\n\nexport interface PSRequest {\n type?: PSRequest.Type\n topic?: string\n data?: Uint8Array\n}\n\nexport namespace PSRequest {\n export enum Type {\n GET_TOPICS = 'GET_TOPICS',\n LIST_PEERS = 'LIST_PEERS',\n PUBLISH = 'PUBLISH',\n SUBSCRIBE = 'SUBSCRIBE'\n }\n\n enum __TypeValues {\n GET_TOPICS = 0,\n LIST_PEERS = 1,\n PUBLISH = 2,\n SUBSCRIBE = 3\n }\n\n export namespace Type {\n export const codec = (): Codec<Type> => {\n return enumeration<Type>(__TypeValues)\n }\n }\n\n let _codec: Codec<PSRequest>\n\n export const codec = (): Codec<PSRequest> => {\n if (_codec == null) {\n _codec = message<PSRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.type != null) {\n w.uint32(8)\n PSRequest.Type.codec().encode(obj.type, w)\n }\n\n if (obj.topic != null) {\n w.uint32(18)\n w.string(obj.topic)\n }\n\n if (obj.data != null) {\n w.uint32(26)\n w.bytes(obj.data)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {}\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.type = PSRequest.Type.codec().decode(reader)\n break\n case 2:\n obj.topic = reader.string()\n break\n case 3:\n obj.data = reader.bytes()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PSRequest>): Uint8Array => {\n return encodeMessage(obj, PSRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): PSRequest => {\n return decodeMessage(buf, PSRequest.codec())\n }\n}\n\nexport interface PSMessage {\n from?: Uint8Array\n data?: Uint8Array\n seqno?: Uint8Array\n topicIDs: string[]\n signature?: Uint8Array\n key?: Uint8Array\n}\n\nexport namespace PSMessage {\n let _codec: Codec<PSMessage>\n\n export const codec = (): Codec<PSMessage> => {\n if (_codec == null) {\n _codec = message<PSMessage>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.from != null) {\n w.uint32(10)\n w.bytes(obj.from)\n }\n\n if (obj.data != null) {\n w.uint32(18)\n w.bytes(obj.data)\n }\n\n if (obj.seqno != null) {\n w.uint32(26)\n w.bytes(obj.seqno)\n }\n\n if (obj.topicIDs != null) {\n for (const value of obj.topicIDs) {\n w.uint32(34)\n w.string(value)\n }\n }\n\n if (obj.signature != null) {\n w.uint32(42)\n w.bytes(obj.signature)\n }\n\n if (obj.key != null) {\n w.uint32(50)\n w.bytes(obj.key)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n topicIDs: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.from = reader.bytes()\n break\n case 2:\n obj.data = reader.bytes()\n break\n case 3:\n obj.seqno = reader.bytes()\n break\n case 4:\n obj.topicIDs.push(reader.string())\n break\n case 5:\n obj.signature = reader.bytes()\n break\n case 6:\n obj.key = reader.bytes()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PSMessage>): Uint8Array => {\n return encodeMessage(obj, PSMessage.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): PSMessage => {\n return decodeMessage(buf, PSMessage.codec())\n }\n}\n\nexport interface PSResponse {\n topics: string[]\n peerIDs: Uint8Array[]\n}\n\nexport namespace PSResponse {\n let _codec: Codec<PSResponse>\n\n export const codec = (): Codec<PSResponse> => {\n if (_codec == null) {\n _codec = message<PSResponse>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.topics != null) {\n for (const value of obj.topics) {\n w.uint32(10)\n w.string(value)\n }\n }\n\n if (obj.peerIDs != null) {\n for (const value of obj.peerIDs) {\n w.uint32(18)\n w.bytes(value)\n }\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n topics: [],\n peerIDs: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.topics.push(reader.string())\n break\n case 2:\n obj.peerIDs.push(reader.bytes())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PSResponse>): Uint8Array => {\n return encodeMessage(obj, PSResponse.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): PSResponse => {\n return decodeMessage(buf, PSResponse.codec())\n }\n}\n\nexport interface PeerstoreRequest {\n type?: PeerstoreRequest.Type\n id?: Uint8Array\n protos: string[]\n}\n\nexport namespace PeerstoreRequest {\n export enum Type {\n UNSPECIFIED = 'UNSPECIFIED',\n GET_PROTOCOLS = 'GET_PROTOCOLS',\n GET_PEER_INFO = 'GET_PEER_INFO'\n }\n\n enum __TypeValues {\n UNSPECIFIED = 0,\n GET_PROTOCOLS = 1,\n GET_PEER_INFO = 2\n }\n\n export namespace Type {\n export const codec = (): Codec<Type> => {\n return enumeration<Type>(__TypeValues)\n }\n }\n\n let _codec: Codec<PeerstoreRequest>\n\n export const codec = (): Codec<PeerstoreRequest> => {\n if (_codec == null) {\n _codec = message<PeerstoreRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.type != null) {\n w.uint32(8)\n PeerstoreRequest.Type.codec().encode(obj.type, w)\n }\n\n if (obj.id != null) {\n w.uint32(18)\n w.bytes(obj.id)\n }\n\n if (obj.protos != null) {\n for (const value of obj.protos) {\n w.uint32(26)\n w.string(value)\n }\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n protos: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.type = PeerstoreRequest.Type.codec().decode(reader)\n break\n case 2:\n obj.id = reader.bytes()\n break\n case 3:\n obj.protos.push(reader.string())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PeerstoreRequest>): Uint8Array => {\n return encodeMessage(obj, PeerstoreRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): PeerstoreRequest => {\n return decodeMessage(buf, PeerstoreRequest.codec())\n }\n}\n\nexport interface PeerstoreResponse {\n peer?: PeerInfo\n protos: string[]\n}\n\nexport namespace PeerstoreResponse {\n let _codec: Codec<PeerstoreResponse>\n\n export const codec = (): Codec<PeerstoreResponse> => {\n if (_codec == null) {\n _codec = message<PeerstoreResponse>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.peer != null) {\n w.uint32(10)\n PeerInfo.codec().encode(obj.peer, w)\n }\n\n if (obj.protos != null) {\n for (const value of obj.protos) {\n w.uint32(18)\n w.string(value)\n }\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n protos: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.peer = PeerInfo.codec().decode(reader, reader.uint32())\n break\n case 2:\n obj.protos.push(reader.string())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PeerstoreResponse>): Uint8Array => {\n return encodeMessage(obj, PeerstoreResponse.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): PeerstoreResponse => {\n return decodeMessage(buf, PeerstoreResponse.codec())\n }\n}\n", "/**\n * @packageDocumentation\n *\n * This module is a fork of the [debug](https://www.npmjs.com/package/debug) module. It has been converted to TypeScript and the output is ESM.\n *\n * It is API compatible with no extra features or bug fixes, it should only be used if you want a 100% ESM application.\n *\n * ESM should be arriving in `debug@5.x.x` so this module can be retired after that.\n *\n * Please see [debug](https://www.npmjs.com/package/debug) for API details.\n */\n\n/**\n * Module dependencies.\n */\n\nimport tty from 'node:tty'\nimport util from 'node:util'\nimport humanize from 'ms'\nimport supportsColor from 'supports-color'\nimport setup from './common.js'\n\n/**\n * This is the Node.js implementation of `debug()`.\n */\n\n/**\n * Colors.\n */\n\nlet colors = [6, 2, 3, 4, 5, 1]\n\nif (supportsColor.stderr !== false && (supportsColor.stderr ?? supportsColor).level >= 2) {\n colors = [\n 20,\n 21,\n 26,\n 27,\n 32,\n 33,\n 38,\n 39,\n 40,\n 41,\n 42,\n 43,\n 44,\n 45,\n 56,\n 57,\n 62,\n 63,\n 68,\n 69,\n 74,\n 75,\n 76,\n 77,\n 78,\n 79,\n 80,\n 81,\n 92,\n 93,\n 98,\n 99,\n 112,\n 113,\n 128,\n 129,\n 134,\n 135,\n 148,\n 149,\n 160,\n 161,\n 162,\n 163,\n 164,\n 165,\n 166,\n 167,\n 168,\n 169,\n 170,\n 171,\n 172,\n 173,\n 178,\n 179,\n 184,\n 185,\n 196,\n 197,\n 198,\n 199,\n 200,\n 201,\n 202,\n 203,\n 204,\n 205,\n 206,\n 207,\n 208,\n 209,\n 214,\n 215,\n 220,\n 221\n ]\n}\n\n/**\n * Build up the default `inspectOpts` object from the environment variables.\n *\n * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js\n */\n\nconst inspectOpts = Object.keys(process.env).filter(key => {\n return /^debug_/i.test(key)\n}).reduce<Record<string, any>>((obj, key) => {\n // Camel-case\n const prop = key\n .substring(6)\n .toLowerCase()\n .replace(/_([a-z])/g, (_, k) => {\n return k.toUpperCase()\n })\n\n // Coerce string value into JS value\n let val: any = process.env[key]\n if (/^(yes|on|true|enabled)$/i.test(val)) {\n val = true\n } else if (/^(no|off|false|disabled)$/i.test(val)) {\n val = false\n } else if (val === 'null') {\n val = null\n } else {\n val = Number(val)\n }\n\n obj[prop] = val\n return obj\n}, {})\n\n/**\n * Is stdout a TTY? Colored output is enabled when `true`.\n */\n\nfunction useColors (): boolean {\n return 'colors' in inspectOpts\n ? Boolean(inspectOpts.colors)\n : tty.isatty(process.stderr.fd)\n}\n\n/**\n * Adds ANSI color escape codes if enabled.\n */\nfunction formatArgs (this: any, args: any[]): void {\n const {\n namespace: name, useColors\n } = this\n\n if (useColors === true) {\n const c = this.color\n const colorCode = '\\u001B[3' + (c < 8 ? c : '8;5;' + c)\n const prefix = ` ${colorCode};1m${name} \\u001B[0m`\n\n args[0] = prefix + args[0].split('\\n').join('\\n' + prefix)\n args.push(colorCode + 'm+' + humanize(this.diff) + '\\u001B[0m')\n } else {\n args[0] = getDate() + name + ' ' + args[0]\n }\n}\n\nfunction getDate (): string {\n if (inspectOpts.hideDate != null) {\n return ''\n }\n return new Date().toISOString() + ' '\n}\n\n/**\n * Invokes `util.format()` with the specified arguments and writes to stderr.\n */\nfunction log (...args: any[]): boolean {\n return process.stderr.write(util.format(...args) + '\\n')\n}\n\n/**\n * Save `namespaces`.\n *\n * @param {string} namespaces\n */\nfunction save (namespaces: string): void {\n if (namespaces != null) {\n process.env.DEBUG = namespaces\n } else {\n // If you set a process.env field to null or undefined, it gets cast to the\n // string 'null' or 'undefined'. Just delete instead.\n delete process.env.DEBUG\n }\n}\n\n/**\n * Load `namespaces`.\n *\n * @returns {string} returns the previously persisted debug modes\n */\nfunction load (): string | undefined {\n return process.env.DEBUG\n}\n\n/**\n * Init logic for `debug` instances.\n *\n * Create a new `inspectOpts` object in case `useColors` is set\n * differently for a particular `debug` instance.\n */\n\nfunction init (debug: any): void {\n debug.inspectOpts = {}\n\n const keys = Object.keys(inspectOpts)\n for (let i = 0; i < keys.length; i++) {\n debug.inspectOpts[keys[i]] = inspectOpts[keys[i]]\n }\n}\n\nfunction setupFormatters (formatters: any): void {\n /**\n * Map %o to `util.inspect()`, all on a single line.\n */\n formatters.o = function (v: any): string {\n this.inspectOpts.colors = this.useColors\n return util.inspect(v, this.inspectOpts)\n .split('\\n')\n .map(str => str.trim())\n .join(' ')\n }\n\n /**\n * Map %O to `util.inspect()`, allowing multiple lines if needed.\n */\n formatters.O = function (v: any): string {\n this.inspectOpts.colors = this.useColors\n return util.inspect(v, this.inspectOpts)\n }\n}\n\nexport default setup({ init, log, formatArgs, save, load, useColors, setupFormatters, colors, inspectOpts })\n", "// Helpers.\nconst s = 1000;\nconst m = s * 60;\nconst h = m * 60;\nconst d = h * 24;\nconst w = d * 7;\nconst y = d * 365.25;\nfunction ms(value, options) {\n try {\n if (typeof value === 'string' && value.length > 0) {\n return parse(value);\n }\n else if (typeof value === 'number' && isFinite(value)) {\n return options?.long ? fmtLong(value) : fmtShort(value);\n }\n throw new Error('Value is not a string or number.');\n }\n catch (error) {\n const message = isError(error)\n ? `${error.message}. value=${JSON.stringify(value)}`\n : 'An unknown error has occured.';\n throw new Error(message);\n }\n}\n/**\n * Parse the given `str` and return milliseconds.\n */\nfunction parse(str) {\n str = String(str);\n if (str.length > 100) {\n throw new Error('Value exceeds the maximum length of 100 characters.');\n }\n const match = /^(-?(?:\\d+)?\\.?\\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec(str);\n if (!match) {\n return NaN;\n }\n const n = parseFloat(match[1]);\n const type = (match[2] || 'ms').toLowerCase();\n switch (type) {\n case 'years':\n case 'year':\n case 'yrs':\n case 'yr':\n case 'y':\n return n * y;\n case 'weeks':\n case 'week':\n case 'w':\n return n * w;\n case 'days':\n case 'day':\n case 'd':\n return n * d;\n case 'hours':\n case 'hour':\n case 'hrs':\n case 'hr':\n case 'h':\n return n * h;\n case 'minutes':\n case 'minute':\n case 'mins':\n case 'min':\n case 'm':\n return n * m;\n case 'seconds':\n case 'second':\n case 'secs':\n case 'sec':\n case 's':\n return n * s;\n case 'milliseconds':\n case 'millisecond':\n case 'msecs':\n case 'msec':\n case 'ms':\n return n;\n default:\n // This should never occur.\n throw new Error(`The unit ${type} was matched, but no matching case exists.`);\n }\n}\nexport default ms;\n/**\n * Short format for `ms`.\n */\nfunction fmtShort(ms) {\n const msAbs = Math.abs(ms);\n if (msAbs >= d) {\n return `${Math.round(ms / d)}d`;\n }\n if (msAbs >= h) {\n return `${Math.round(ms / h)}h`;\n }\n if (msAbs >= m) {\n return `${Math.round(ms / m)}m`;\n }\n if (msAbs >= s) {\n return `${Math.round(ms / s)}s`;\n }\n return `${ms}ms`;\n}\n/**\n * Long format for `ms`.\n */\nfunction fmtLong(ms) {\n const msAbs = Math.abs(ms);\n if (msAbs >= d) {\n return plural(ms, msAbs, d, 'day');\n }\n if (msAbs >= h) {\n return plural(ms, msAbs, h, 'hour');\n }\n if (msAbs >= m) {\n return plural(ms, msAbs, m, 'minute');\n }\n if (msAbs >= s) {\n return plural(ms, msAbs, s, 'second');\n }\n return `${ms} ms`;\n}\n/**\n * Pluralization helper.\n */\nfunction plural(ms, msAbs, n, name) {\n const isPlural = msAbs >= n * 1.5;\n return `${Math.round(ms / n)} ${name}${isPlural ? 's' : ''}`;\n}\n/**\n * A type guard for errors.\n */\nfunction isError(error) {\n return typeof error === 'object' && error !== null && 'message' in error;\n}\n", "import process from 'node:process';\nimport os from 'node:os';\nimport tty from 'node:tty';\n\n// From: https://github.com/sindresorhus/has-flag/blob/main/index.js\n/// function hasFlag(flag, argv = globalThis.Deno?.args ?? process.argv) {\nfunction hasFlag(flag, argv = globalThis.Deno ? globalThis.Deno.args : process.argv) {\n\tconst prefix = flag.startsWith('-') ? '' : (flag.length === 1 ? '-' : '--');\n\tconst position = argv.indexOf(prefix + flag);\n\tconst terminatorPosition = argv.indexOf('--');\n\treturn position !== -1 && (terminatorPosition === -1 || position < terminatorPosition);\n}\n\nconst {env} = process;\n\nlet flagForceColor;\nif (\n\thasFlag('no-color')\n\t|| hasFlag('no-colors')\n\t|| hasFlag('color=false')\n\t|| hasFlag('color=never')\n) {\n\tflagForceColor = 0;\n} else if (\n\thasFlag('color')\n\t|| hasFlag('colors')\n\t|| hasFlag('color=true')\n\t|| hasFlag('color=always')\n) {\n\tflagForceColor = 1;\n}\n\nfunction envForceColor() {\n\tif ('FORCE_COLOR' in env) {\n\t\tif (env.FORCE_COLOR === 'true') {\n\t\t\treturn 1;\n\t\t}\n\n\t\tif (env.FORCE_COLOR === 'false') {\n\t\t\treturn 0;\n\t\t}\n\n\t\treturn env.FORCE_COLOR.length === 0 ? 1 : Math.min(Number.parseInt(env.FORCE_COLOR, 10), 3);\n\t}\n}\n\nfunction translateLevel(level) {\n\tif (level === 0) {\n\t\treturn false;\n\t}\n\n\treturn {\n\t\tlevel,\n\t\thasBasic: true,\n\t\thas256: level >= 2,\n\t\thas16m: level >= 3,\n\t};\n}\n\nfunction _supportsColor(haveStream, {streamIsTTY, sniffFlags = true} = {}) {\n\tconst noFlagForceColor = envForceColor();\n\tif (noFlagForceColor !== undefined) {\n\t\tflagForceColor = noFlagForceColor;\n\t}\n\n\tconst forceColor = sniffFlags ? flagForceColor : noFlagForceColor;\n\n\tif (forceColor === 0) {\n\t\treturn 0;\n\t}\n\n\tif (sniffFlags) {\n\t\tif (hasFlag('color=16m')\n\t\t\t|| hasFlag('color=full')\n\t\t\t|| hasFlag('color=truecolor')) {\n\t\t\treturn 3;\n\t\t}\n\n\t\tif (hasFlag('color=256')) {\n\t\t\treturn 2;\n\t\t}\n\t}\n\n\t// Check for Azure DevOps pipelines.\n\t// Has to be above the `!streamIsTTY` check.\n\tif ('TF_BUILD' in env && 'AGENT_NAME' in env) {\n\t\treturn 1;\n\t}\n\n\tif (haveStream && !streamIsTTY && forceColor === undefined) {\n\t\treturn 0;\n\t}\n\n\tconst min = forceColor || 0;\n\n\tif (env.TERM === 'dumb') {\n\t\treturn min;\n\t}\n\n\tif (process.platform === 'win32') {\n\t\t// Windows 10 build 10586 is the first Windows release that supports 256 colors.\n\t\t// Windows 10 build 14931 is the first release that supports 16m/TrueColor.\n\t\tconst osRelease = os.release().split('.');\n\t\tif (\n\t\t\tNumber(osRelease[0]) >= 10\n\t\t\t&& Number(osRelease[2]) >= 10_586\n\t\t) {\n\t\t\treturn Number(osRelease[2]) >= 14_931 ? 3 : 2;\n\t\t}\n\n\t\treturn 1;\n\t}\n\n\tif ('CI' in env) {\n\t\tif ('GITHUB_ACTIONS' in env || 'GITEA_ACTIONS' in env) {\n\t\t\treturn 3;\n\t\t}\n\n\t\tif (['TRAVIS', 'CIRCLECI', 'APPVEYOR', 'GITLAB_CI', 'BUILDKITE', 'DRONE'].some(sign => sign in env) || env.CI_NAME === 'codeship') {\n\t\t\treturn 1;\n\t\t}\n\n\t\treturn min;\n\t}\n\n\tif ('TEAMCITY_VERSION' in env) {\n\t\treturn /^(9\\.(0*[1-9]\\d*)\\.|\\d{2,}\\.)/.test(env.TEAMCITY_VERSION) ? 1 : 0;\n\t}\n\n\tif (env.COLORTERM === 'truecolor') {\n\t\treturn 3;\n\t}\n\n\tif (env.TERM === 'xterm-kitty') {\n\t\treturn 3;\n\t}\n\n\tif ('TERM_PROGRAM' in env) {\n\t\tconst version = Number.parseInt((env.TERM_PROGRAM_VERSION || '').split('.')[0], 10);\n\n\t\tswitch (env.TERM_PROGRAM) {\n\t\t\tcase 'iTerm.app': {\n\t\t\t\treturn version >= 3 ? 3 : 2;\n\t\t\t}\n\n\t\t\tcase 'Apple_Terminal': {\n\t\t\t\treturn 2;\n\t\t\t}\n\t\t\t// No default\n\t\t}\n\t}\n\n\tif (/-256(color)?$/i.test(env.TERM)) {\n\t\treturn 2;\n\t}\n\n\tif (/^screen|^xterm|^vt100|^vt220|^rxvt|color|ansi|cygwin|linux/i.test(env.TERM)) {\n\t\treturn 1;\n\t}\n\n\tif ('COLORTERM' in env) {\n\t\treturn 1;\n\t}\n\n\treturn min;\n}\n\nexport function createSupportsColor(stream, options = {}) {\n\tconst level = _supportsColor(stream, {\n\t\tstreamIsTTY: stream && stream.isTTY,\n\t\t...options,\n\t});\n\n\treturn translateLevel(level);\n}\n\nconst supportsColor = {\n\tstdout: createSupportsColor({isTTY: tty.isatty(1)}),\n\tstderr: createSupportsColor({isTTY: tty.isatty(2)}),\n};\n\nexport default supportsColor;\n", "/* eslint-disable no-console */\n/* eslint-disable @typescript-eslint/strict-boolean-expressions */\n\n/**\n * This is the common logic for both the Node.js and web browser\n * implementations of `debug()`.\n */\nimport humanize from 'ms'\nimport type { Debug, Debugger } from './index.js'\n\nexport default function setup (env: any): Debug {\n createDebug.debug = createDebug\n createDebug.default = createDebug\n createDebug.coerce = coerce\n createDebug.disable = disable\n createDebug.enable = enable\n createDebug.enabled = enabled\n createDebug.humanize = humanize\n createDebug.destroy = destroy\n\n Object.keys(env).forEach(key => {\n // @ts-expect-error cannot use string to index type\n createDebug[key] = env[key]\n })\n\n /**\n * The currently active debug mode names, and names to skip.\n */\n\n createDebug.names = [] as any[]\n createDebug.skips = [] as any[]\n\n /**\n * Map of special \"%n\" handling functions, for the debug \"format\" argument.\n *\n * Valid key names are a single, lower or upper-case letter, i.e. \"n\" and \"N\".\n */\n createDebug.formatters = {} satisfies Record<string, any>\n\n /**\n * Selects a color for a debug namespace\n *\n * @param {string} namespace - The namespace string for the debug instance to be colored\n * @returns {number | string} An ANSI color code for the given namespace\n */\n function selectColor (namespace: string): number | string {\n let hash = 0\n\n for (let i = 0; i < namespace.length; i++) {\n hash = ((hash << 5) - hash) + namespace.charCodeAt(i)\n hash |= 0 // Convert to 32bit integer\n }\n\n // @ts-expect-error colors is not in the types\n return createDebug.colors[Math.abs(hash) % createDebug.colors.length]\n }\n createDebug.selectColor = selectColor\n\n /**\n * Create a debugger with the given `namespace`.\n *\n * @param {string} namespace\n * @returns {Function}\n */\n function createDebug (namespace: string): Debugger {\n let prevTime: any\n let enableOverride: any = null\n let namespacesCache: any\n let enabledCache: any\n\n function debug (...args: any[]): void {\n // Disabled?\n // @ts-expect-error enabled is not in the types\n if (!debug.enabled) {\n return\n }\n\n const self: any = debug\n\n // Set `diff` timestamp\n const curr = Number(new Date())\n const ms = curr - (prevTime || curr)\n self.diff = ms\n self.prev = prevTime\n self.curr = curr\n prevTime = curr\n\n args[0] = createDebug.coerce(args[0])\n\n if (typeof args[0] !== 'string') {\n // Anything else let's inspect with %O\n args.unshift('%O')\n }\n\n // Apply any `formatters` transformations\n let index = 0\n args[0] = args[0].replace(/%([a-zA-Z%])/g, (match: any, format: any): any => {\n // If we encounter an escaped % then don't increase the array index\n if (match === '%%') {\n return '%'\n }\n index++\n // @ts-expect-error formatters is not in the types\n const formatter = createDebug.formatters[format]\n if (typeof formatter === 'function') {\n const val = args[index]\n match = formatter.call(self, val)\n\n // Now we need to remove `args[index]` since it's inlined in the `format`\n args.splice(index, 1)\n index--\n }\n return match\n })\n\n // Apply env-specific formatting (colors, etc.)\n // @ts-expect-error formatArgs is not in the types\n createDebug.formatArgs.call(self, args)\n\n // @ts-expect-error log is not in the types\n const logFn = self.log || createDebug.log\n logFn.apply(self, args)\n }\n\n debug.namespace = namespace\n // @ts-expect-error useColors is not in the types\n debug.useColors = createDebug.useColors()\n debug.color = createDebug.selectColor(namespace)\n debug.extend = extend\n debug.destroy = createDebug.destroy // XXX Temporary. Will be removed in the next major release.\n\n Object.defineProperty(debug, 'enabled', {\n enumerable: true,\n configurable: false,\n get: () => {\n if (enableOverride !== null) {\n return enableOverride\n }\n // @ts-expect-error namespaces is not in the types\n if (namespacesCache !== createDebug.namespaces) {\n // @ts-expect-error namespaces is not in the types\n namespacesCache = createDebug.namespaces\n enabledCache = createDebug.enabled(namespace)\n }\n\n return enabledCache\n },\n set: v => {\n enableOverride = v\n }\n })\n\n // Env-specific initialization logic for debug instances\n // @ts-expect-error init is not in the types\n if (typeof createDebug.init === 'function') {\n // @ts-expect-error init is not in the types\n createDebug.init(debug)\n }\n\n // @ts-expect-error some properties are added dynamically\n return debug\n }\n\n function extend (this: any, namespace: string, delimiter: string): any {\n const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace)\n newDebug.log = this.log\n return newDebug\n }\n\n /**\n * Enables a debug mode by namespaces. This can include modes\n * separated by a colon and wildcards.\n *\n * @param {string} namespaces\n */\n function enable (namespaces: string): void {\n // @ts-expect-error save is not in the types\n createDebug.save(namespaces)\n // @ts-expect-error namespaces is not in the types\n createDebug.namespaces = namespaces\n\n createDebug.names = []\n createDebug.skips = []\n\n let i\n const split = (typeof namespaces === 'string' ? namespaces : '').split(/[\\s,]+/)\n const len = split.length\n\n for (i = 0; i < len; i++) {\n if (!split[i]) {\n // ignore empty strings\n continue\n }\n\n namespaces = split[i].replace(/\\*/g, '.*?')\n\n if (namespaces[0] === '-') {\n createDebug.skips.push(new RegExp('^' + namespaces.substr(1) + '$'))\n } else {\n createDebug.names.push(new RegExp('^' + namespaces + '$'))\n }\n }\n }\n\n /**\n * Disable debug output.\n *\n * @returns {string} namespaces\n */\n function disable (): string {\n const namespaces = [\n ...createDebug.names.map(toNamespace),\n ...createDebug.skips.map(toNamespace).map(namespace => '-' + namespace)\n ].join(',')\n createDebug.enable('')\n return namespaces\n }\n\n /**\n * Returns true if the given mode name is enabled, false otherwise.\n *\n * @param {string} name\n * @returns {boolean}\n */\n function enabled (name: string): boolean {\n if (name[name.length - 1] === '*') {\n return true\n }\n\n let i\n let len\n\n for (i = 0, len = createDebug.skips.length; i < len; i++) {\n if (createDebug.skips[i].test(name)) {\n return false\n }\n }\n\n for (i = 0, len = createDebug.names.length; i < len; i++) {\n if (createDebug.names[i].test(name)) {\n return true\n }\n }\n\n return false\n }\n\n /**\n * Convert regexp to namespace\n */\n function toNamespace (regexp: RegExp): string {\n return regexp.toString()\n .substring(2, regexp.toString().length - 2)\n .replace(/\\.\\*\\?$/, '*')\n }\n\n /**\n * Coerce `val`.\n */\n function coerce (val: any): any {\n if (val instanceof Error) {\n return val.stack ?? val.message\n }\n return val\n }\n\n /**\n * XXX DO NOT USE. This is a temporary stub function.\n * XXX It WILL be removed in the next major release.\n */\n function destroy (): void {\n console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.')\n }\n\n // @ts-expect-error setupFormatters is not in the types\n createDebug.setupFormatters(createDebug.formatters)\n\n // @ts-expect-error load is not in the types\n createDebug.enable(createDebug.load())\n\n // @ts-expect-error some properties are added dynamically\n return createDebug\n}\n", "/**\n * @packageDocumentation\n *\n * This module is a fork of the [debug](https://www.npmjs.com/package/debug) module. It has been converted to TypeScript and the output is ESM.\n *\n * It is API compatible with no extra features or bug fixes, it should only be used if you want a 100% ESM application.\n *\n * ESM should be arriving in `debug@5.x.x` so this module can be retired after that.\n *\n * Please see [debug](https://www.npmjs.com/package/debug) for API details.\n */\n\n/**\n * Module dependencies.\n */\nimport weald from './node.js'\nimport type ms from 'ms'\n\nexport interface Debug {\n (namespace: string): Debugger\n coerce(val: any): any\n disable(...args: string[]): string\n enable(namespaces: string | boolean): void\n enabled(namespaces: string): boolean\n formatArgs(this: Debugger, args: any[]): void\n log(...args: any[]): any\n selectColor(namespace: string): string | number\n humanize: typeof ms\n\n names: RegExp[]\n skips: RegExp[]\n\n formatters: Formatters\n\n inspectOpts?: {\n hideDate?: boolean | number | null\n colors?: boolean | number | null\n depth?: boolean | number | null\n showHidden?: boolean | number | null\n }\n}\n\nexport type Formatters = Record<string, (v: any) => string>\n\nexport interface Debugger {\n (formatter: any, ...args: any[]): void\n\n color: string\n diff: number\n enabled: boolean\n log(...args: any[]): any\n namespace: string\n destroy(): boolean\n extend(namespace: string, delimiter?: string): Debugger\n}\n\nexport default weald\n", "/**\n * @packageDocumentation\n *\n * A logger for libp2p based on [weald](https://www.npmjs.com/package/weald), a TypeScript port of the venerable [debug](https://www.npmjs.com/package/debug) module.\n *\n * @example\n *\n * ```TypeScript\n * import { logger } from '@libp2p/logger'\n *\n * const log = logger('libp2p:my:component:name')\n *\n * try {\n * // an operation\n * log('something happened: %s', 'it was ok')\n * } catch (err) {\n * log.error('something bad happened: %o', err)\n * }\n *\n * log('with this peer: %p', {})\n * log('and this base58btc: %b', Uint8Array.from([0, 1, 2, 3]))\n * log('and this base32: %t', Uint8Array.from([4, 5, 6, 7]))\n * ```\n *\n * ```console\n * $ DEBUG=libp2p:* node index.js\n * something happened: it was ok\n * something bad happened: <stack trace>\n * with this peer: 12D3Foo\n * with this base58btc: Qmfoo\n * with this base32: bafyfoo\n * ```\n */\n\nimport { base32 } from 'multiformats/bases/base32'\nimport { base58btc } from 'multiformats/bases/base58'\nimport { base64 } from 'multiformats/bases/base64'\nimport debug from 'weald'\nimport { truncatePeerId } from './utils.js'\nimport type { PeerId } from '@libp2p/interface'\nimport type { Multiaddr } from '@multiformats/multiaddr'\nimport type { Key } from 'interface-datastore'\nimport type { CID } from 'multiformats/cid'\n\n// Add a formatter for converting to a base58 string\ndebug.formatters.b = (v?: Uint8Array): string => {\n return v == null ? 'undefined' : base58btc.baseEncode(v)\n}\n\n// Add a formatter for converting to a base32 string\ndebug.formatters.t = (v?: Uint8Array): string => {\n return v == null ? 'undefined' : base32.baseEncode(v)\n}\n\n// Add a formatter for converting to a base64 string\ndebug.formatters.m = (v?: Uint8Array): string => {\n return v == null ? 'undefined' : base64.baseEncode(v)\n}\n\n// Add a formatter for stringifying peer ids\ndebug.formatters.p = (v?: PeerId): string => {\n return v == null ? 'undefined' : v.toString()\n}\n\n// Add a formatter for stringifying CIDs\ndebug.formatters.c = (v?: CID): string => {\n return v == null ? 'undefined' : v.toString()\n}\n\n// Add a formatter for stringifying Datastore keys\ndebug.formatters.k = (v: Key): string => {\n return v == null ? 'undefined' : v.toString()\n}\n\n// Add a formatter for stringifying Multiaddrs\ndebug.formatters.a = (v?: Multiaddr): string => {\n return v == null ? 'undefined' : v.toString()\n}\n\n// Add a formatter for stringifying Errors\ndebug.formatters.e = (v?: Error): string => {\n return v == null ? 'undefined' : notEmpty(v.stack) ?? notEmpty(v.message) ?? v.toString()\n}\n\nexport interface Logger {\n (formatter: any, ...args: any[]): void\n error(formatter: any, ...args: any[]): void\n trace(formatter: any, ...args: any[]): void\n enabled: boolean\n}\n\nexport interface ComponentLogger {\n forComponent(name: string): Logger\n}\n\nfunction createDisabledLogger (namespace: string): debug.Debugger {\n const logger = (): void => {}\n logger.enabled = false\n logger.color = ''\n logger.diff = 0\n logger.log = (): void => {}\n logger.namespace = namespace\n logger.destroy = () => true\n logger.extend = () => logger\n\n return logger\n}\n\nexport interface PeerLoggerOptions {\n prefixLength: number\n suffixLength: number\n}\n\n/**\n * Create a component logger that will prefix any log messages with a truncated\n * peer id.\n *\n * @example\n *\n * ```TypeScript\n * import { peerLogger } from '@libp2p/logger'\n * import { peerIdFromString } from '@libp2p/peer-id'\n *\n * const peerId = peerIdFromString('12D3FooBar')\n * const logger = peerLogger(peerId)\n *\n * const log = logger.forComponent('my-component')\n * log.info('hello world')\n * // logs \"12\u2026oBar:my-component hello world\"\n * ```\n */\nexport function peerLogger (peerId: PeerId, options: Partial<PeerLoggerOptions> = {}): ComponentLogger {\n return prefixLogger(truncatePeerId(peerId, options))\n}\n\n/**\n * Create a component logger that will prefix any log messages with the passed\n * string.\n *\n * @example\n *\n * ```TypeScript\n * import { prefixLogger } from '@libp2p/logger'\n *\n * const logger = prefixLogger('my-node')\n *\n * const log = logger.forComponent('my-component')\n * log.info('hello world')\n * // logs \"my-node:my-component hello world\"\n * ```\n */\nexport function prefixLogger (prefix: string): ComponentLogger {\n return {\n forComponent (name: string) {\n return logger(`${prefix}:${name}`)\n }\n }\n}\n\n/**\n * Create a component logger\n *\n * @example\n *\n * ```TypeScript\n * import { defaultLogger } from '@libp2p/logger'\n * import { peerIdFromString } from '@libp2p/peer-id'\n *\n * const logger = defaultLogger()\n *\n * const log = logger.forComponent('my-component')\n * log.info('hello world')\n * // logs \"my-component hello world\"\n * ```\n */\nexport function defaultLogger (): ComponentLogger {\n return {\n forComponent (name: string) {\n return logger(name)\n }\n }\n}\n\n/**\n * Creates a logger for the passed component name.\n *\n * @example\n *\n * ```TypeScript\n * import { logger } from '@libp2p/logger'\n *\n * const log = logger('my-component')\n * log.info('hello world')\n * // logs \"my-component hello world\"\n * ```\n */\nexport function logger (name: string): Logger {\n // trace logging is a no-op by default\n let trace: debug.Debugger = createDisabledLogger(`${name}:trace`)\n\n // look at all the debug names and see if trace logging has explicitly been enabled\n if (debug.enabled(`${name}:trace`) && debug.names.map((r: any) => r.toString()).find((n: string) => n.includes(':trace')) != null) {\n trace = debug(`${name}:trace`)\n }\n\n return Object.assign(debug(name), {\n error: debug(`${name}:error`),\n trace\n })\n}\n\nexport function disable (): void {\n debug.disable()\n}\n\nexport function enable (namespaces: string): void {\n debug.enable(namespaces)\n}\n\nexport function enabled (namespaces: string): boolean {\n return debug.enabled(namespaces)\n}\n\nfunction notEmpty (str?: string): string | undefined {\n if (str == null) {\n return\n }\n\n str = str.trim()\n\n if (str.length === 0) {\n return\n }\n\n return str\n}\n", "export default function pDefer() {\n\tconst deferred = {};\n\n\tdeferred.promise = new Promise((resolve, reject) => {\n\t\tdeferred.resolve = resolve;\n\t\tdeferred.reject = reject;\n\t});\n\n\treturn deferred;\n}\n", "/**\n * An abort error class that extends error\n */\nexport class AbortError extends Error {\n public type: string\n public code: string | string\n\n constructor (message?: string, code?: string, name?: string) {\n super(message ?? 'The operation was aborted')\n this.type = 'aborted'\n this.name = name ?? 'AbortError'\n this.code = code ?? 'ABORT_ERR'\n }\n}\n\nexport interface RaceSignalOptions {\n /**\n * The message for the error thrown if the signal aborts\n */\n errorMessage?: string\n\n /**\n * The code for the error thrown if the signal aborts\n */\n errorCode?: string\n\n /**\n * The name for the error thrown if the signal aborts\n */\n errorName?: string\n}\n\n/**\n * Race a promise against an abort signal\n */\nexport async function raceSignal <T> (promise: Promise<T>, signal?: AbortSignal, opts?: RaceSignalOptions): Promise<T> {\n if (signal == null) {\n return promise\n }\n\n if (signal.aborted) {\n // the passed promise may yet resolve or reject but the use has signalled\n // they are no longer interested so smother the error\n promise.catch(() => {})\n return Promise.reject(new AbortError(opts?.errorMessage, opts?.errorCode, opts?.errorName))\n }\n\n let listener\n\n // create the error here so we have more context in the stack trace\n const error = new AbortError(opts?.errorMessage, opts?.errorCode, opts?.errorName)\n\n try {\n return await Promise.race([\n promise,\n new Promise<T>((resolve, reject) => {\n listener = () => {\n reject(error)\n }\n signal.addEventListener('abort', listener)\n })\n ])\n } finally {\n if (listener != null) {\n signal.removeEventListener('abort', listener)\n }\n }\n}\n", "/**\n * @packageDocumentation\n *\n * A pushable async generator that waits until the current value is consumed\n * before allowing a new value to be pushed.\n *\n * Useful for when you don't want to keep memory usage under control and/or\n * allow a downstream consumer to dictate how fast data flows through a pipe,\n * but you want to be able to apply a transform to that data.\n *\n * @example\n *\n * ```typescript\n * import { queuelessPushable } from 'it-queueless-pushable'\n *\n * const pushable = queuelessPushable<string>()\n *\n * // run asynchronously\n * Promise.resolve().then(async () => {\n * // push a value - the returned promise will not resolve until the value is\n * // read from the pushable\n * await pushable.push('hello')\n * })\n *\n * // read a value\n * const result = await pushable.next()\n * console.info(result) // { done: false, value: 'hello' }\n * ```\n */\n\nimport deferred from 'p-defer'\nimport { raceSignal } from 'race-signal'\nimport type { AbortOptions } from 'abort-error'\nimport type { RaceSignalOptions } from 'race-signal'\n\nexport interface Pushable<T> extends AsyncGenerator<T, void, unknown> {\n /**\n * End the iterable after all values in the buffer (if any) have been yielded. If an\n * error is passed the buffer is cleared immediately and the next iteration will\n * throw the passed error\n */\n end(err?: Error, options?: AbortOptions & RaceSignalOptions): Promise<void>\n\n /**\n * Push a value into the iterable. Values are yielded from the iterable in the order\n * they are pushed. Values not yet consumed from the iterable are buffered.\n */\n push(value: T, options?: AbortOptions & RaceSignalOptions): Promise<void>\n}\n\nclass QueuelessPushable <T> implements Pushable<T> {\n private readNext: PromiseWithResolvers<void>\n private haveNext: PromiseWithResolvers<void>\n private ended: boolean\n private nextResult: IteratorResult<T> | undefined\n private error?: Error\n\n constructor () {\n this.ended = false\n\n this.readNext = deferred()\n this.haveNext = deferred()\n }\n\n [Symbol.asyncIterator] (): AsyncGenerator<T, void, unknown> {\n return this\n }\n\n async next (): Promise<IteratorResult<T, void>> {\n if (this.nextResult == null) {\n // wait for the supplier to push a value\n await this.haveNext.promise\n }\n\n if (this.nextResult == null) {\n throw new Error('HaveNext promise resolved but nextResult was undefined')\n }\n\n const nextResult = this.nextResult\n this.nextResult = undefined\n\n // signal to the supplier that we read the value\n this.readNext.resolve()\n this.readNext = deferred()\n\n return nextResult\n }\n\n async throw (err?: Error): Promise<IteratorReturnResult<undefined>> {\n this.ended = true\n this.error = err\n\n if (err != null) {\n // this can cause unhandled promise rejections if nothing is awaiting the\n // next value so attach a dummy catch listener to the promise\n this.haveNext.promise.catch(() => {})\n this.haveNext.reject(err)\n }\n\n const result: IteratorReturnResult<undefined> = {\n done: true,\n value: undefined\n }\n\n return result\n }\n\n async return (): Promise<IteratorResult<T>> {\n const result: IteratorReturnResult<undefined> = {\n done: true,\n value: undefined\n }\n\n this.ended = true\n this.nextResult = result\n\n // let the consumer know we have a new value\n this.haveNext.resolve()\n\n return result\n }\n\n async push (value: T, options?: AbortOptions & RaceSignalOptions): Promise<void> {\n await this._push(value, options)\n }\n\n async end (err?: Error, options?: AbortOptions & RaceSignalOptions): Promise<void> {\n if (err != null) {\n await this.throw(err)\n } else {\n // abortable return\n await this._push(undefined, options)\n }\n }\n\n private async _push (value?: T, options?: AbortOptions & RaceSignalOptions): Promise<void> {\n if (value != null && this.ended) {\n throw this.error ?? new Error('Cannot push value onto an ended pushable')\n }\n\n // wait for all values to be read\n while (this.nextResult != null) {\n await this.readNext.promise\n }\n\n if (value != null) {\n this.nextResult = { done: false, value }\n } else {\n this.ended = true\n this.nextResult = { done: true, value: undefined }\n }\n\n // let the consumer know we have a new value\n this.haveNext.resolve()\n this.haveNext = deferred()\n\n // wait for the consumer to have finished processing the value and requested\n // the next one or for the passed signal to abort the waiting\n await raceSignal(\n this.readNext.promise,\n options?.signal,\n options\n )\n }\n}\n\nexport function queuelessPushable <T> (): Pushable<T> {\n return new QueuelessPushable<T>()\n}\n", "import { Buffer } from 'node:buffer'\nimport { asUint8Array } from '#util/as-uint8array'\n\n/**\n * Returns a new Uint8Array created by concatenating the passed Uint8Arrays\n */\nexport function concat (arrays: Uint8Array[], length?: number): Uint8Array {\n return asUint8Array(Buffer.concat(arrays, length))\n}\n", "/**\n * Returns true if the two passed Uint8Arrays have the same content\n */\nexport function equals (a: Uint8Array, b: Uint8Array): boolean {\n if (a === b) {\n return true\n }\n\n if (a.byteLength !== b.byteLength) {\n return false\n }\n\n for (let i = 0; i < a.byteLength; i++) {\n if (a[i] !== b[i]) {\n return false\n }\n }\n\n return true\n}\n", "/**\n * @packageDocumentation\n *\n * A class that lets you do operations over a list of Uint8Arrays without\n * copying them.\n *\n * ```js\n * import { Uint8ArrayList } from 'uint8arraylist'\n *\n * const list = new Uint8ArrayList()\n * list.append(Uint8Array.from([0, 1, 2]))\n * list.append(Uint8Array.from([3, 4, 5]))\n *\n * list.subarray()\n * // -> Uint8Array([0, 1, 2, 3, 4, 5])\n *\n * list.consume(3)\n * list.subarray()\n * // -> Uint8Array([3, 4, 5])\n *\n * // you can also iterate over the list\n * for (const buf of list) {\n * // ..do something with `buf`\n * }\n *\n * list.subarray(0, 1)\n * // -> Uint8Array([0])\n * ```\n *\n * ## Converting Uint8ArrayLists to Uint8Arrays\n *\n * There are two ways to turn a `Uint8ArrayList` into a `Uint8Array` - `.slice` and `.subarray` and one way to turn a `Uint8ArrayList` into a `Uint8ArrayList` with different contents - `.sublist`.\n *\n * ### slice\n *\n * Slice follows the same semantics as [Uint8Array.slice](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/TypedArray/slice) in that it creates a new `Uint8Array` and copies bytes into it using an optional offset & length.\n *\n * ```js\n * const list = new Uint8ArrayList()\n * list.append(Uint8Array.from([0, 1, 2]))\n * list.append(Uint8Array.from([3, 4, 5]))\n *\n * list.slice(0, 1)\n * // -> Uint8Array([0])\n * ```\n *\n * ### subarray\n *\n * Subarray attempts to follow the same semantics as [Uint8Array.subarray](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/TypedArray/subarray) with one important different - this is a no-copy operation, unless the requested bytes span two internal buffers in which case it is a copy operation.\n *\n * ```js\n * const list = new Uint8ArrayList()\n * list.append(Uint8Array.from([0, 1, 2]))\n * list.append(Uint8Array.from([3, 4, 5]))\n *\n * list.subarray(0, 1)\n * // -> Uint8Array([0]) - no-copy\n *\n * list.subarray(2, 5)\n * // -> Uint8Array([2, 3, 4]) - copy\n * ```\n *\n * ### sublist\n *\n * Sublist creates and returns a new `Uint8ArrayList` that shares the underlying buffers with the original so is always a no-copy operation.\n *\n * ```js\n * const list = new Uint8ArrayList()\n * list.append(Uint8Array.from([0, 1, 2]))\n * list.append(Uint8Array.from([3, 4, 5]))\n *\n * list.sublist(0, 1)\n * // -> Uint8ArrayList([0]) - no-copy\n *\n * list.sublist(2, 5)\n * // -> Uint8ArrayList([2], [3, 4]) - no-copy\n * ```\n *\n * ## Inspiration\n *\n * Borrows liberally from [bl](https://www.npmjs.com/package/bl) but only uses native JS types.\n */\nimport { allocUnsafe, alloc } from 'uint8arrays/alloc'\nimport { concat } from 'uint8arrays/concat'\nimport { equals } from 'uint8arrays/equals'\n\nconst symbol = Symbol.for('@achingbrain/uint8arraylist')\n\nexport type Appendable = Uint8ArrayList | Uint8Array\n\nfunction findBufAndOffset (bufs: Uint8Array[], index: number): { buf: Uint8Array, index: number } {\n if (index == null || index < 0) {\n throw new RangeError('index is out of bounds')\n }\n\n let offset = 0\n\n for (const buf of bufs) {\n const bufEnd = offset + buf.byteLength\n\n if (index < bufEnd) {\n return {\n buf,\n index: index - offset\n }\n }\n\n offset = bufEnd\n }\n\n throw new RangeError('index is out of bounds')\n}\n\n/**\n * Check if object is a CID instance\n *\n * @example\n *\n * ```js\n * import { isUint8ArrayList, Uint8ArrayList } from 'uint8arraylist'\n *\n * isUint8ArrayList(true) // false\n * isUint8ArrayList([]) // false\n * isUint8ArrayList(new Uint8ArrayList()) // true\n * ```\n */\nexport function isUint8ArrayList (value: any): value is Uint8ArrayList {\n return Boolean(value?.[symbol])\n}\n\nexport class Uint8ArrayList implements Iterable<Uint8Array> {\n private bufs: Uint8Array[]\n public length: number\n public readonly [symbol] = true\n\n constructor (...data: Appendable[]) {\n this.bufs = []\n this.length = 0\n\n if (data.length > 0) {\n this.appendAll(data)\n }\n }\n\n * [Symbol.iterator] (): Iterator<Uint8Array> {\n yield * this.bufs\n }\n\n get byteLength (): number {\n return this.length\n }\n\n /**\n * Add one or more `bufs` to the end of this Uint8ArrayList\n */\n append (...bufs: Appendable[]): void {\n this.appendAll(bufs)\n }\n\n /**\n * Add all `bufs` to the end of this Uint8ArrayList\n */\n appendAll (bufs: Appendable[]): void {\n let length = 0\n\n for (const buf of bufs) {\n if (buf instanceof Uint8Array) {\n length += buf.byteLength\n this.bufs.push(buf)\n } else if (isUint8ArrayList(buf)) {\n length += buf.byteLength\n this.bufs.push(...buf.bufs)\n } else {\n throw new Error('Could not append value, must be an Uint8Array or a Uint8ArrayList')\n }\n }\n\n this.length += length\n }\n\n /**\n * Add one or more `bufs` to the start of this Uint8ArrayList\n */\n prepend (...bufs: Appendable[]): void {\n this.prependAll(bufs)\n }\n\n /**\n * Add all `bufs` to the start of this Uint8ArrayList\n */\n prependAll (bufs: Appendable[]): void {\n let length = 0\n\n for (const buf of bufs.reverse()) {\n if (buf instanceof Uint8Array) {\n length += buf.byteLength\n this.bufs.unshift(buf)\n } else if (isUint8ArrayList(buf)) {\n length += buf.byteLength\n this.bufs.unshift(...buf.bufs)\n } else {\n throw new Error('Could not prepend value, must be an Uint8Array or a Uint8ArrayList')\n }\n }\n\n this.length += length\n }\n\n /**\n * Read the value at `index`\n */\n get (index: number): number {\n const res = findBufAndOffset(this.bufs, index)\n\n return res.buf[res.index]\n }\n\n /**\n * Set the value at `index` to `value`\n */\n set (index: number, value: number): void {\n const res = findBufAndOffset(this.bufs, index)\n\n res.buf[res.index] = value\n }\n\n /**\n * Copy bytes from `buf` to the index specified by `offset`\n */\n write (buf: Appendable, offset: number = 0): void {\n if (buf instanceof Uint8Array) {\n for (let i = 0; i < buf.length; i++) {\n this.set(offset + i, buf[i])\n }\n } else if (isUint8ArrayList(buf)) {\n for (let i = 0; i < buf.length; i++) {\n this.set(offset + i, buf.get(i))\n }\n } else {\n throw new Error('Could not write value, must be an Uint8Array or a Uint8ArrayList')\n }\n }\n\n /**\n * Remove bytes from the front of the pool\n */\n consume (bytes: number): void {\n // first, normalize the argument, in accordance with how Buffer does it\n bytes = Math.trunc(bytes)\n\n // do nothing if not a positive number\n if (Number.isNaN(bytes) || bytes <= 0) {\n return\n }\n\n // if consuming all bytes, skip iterating\n if (bytes === this.byteLength) {\n this.bufs = []\n this.length = 0\n return\n }\n\n while (this.bufs.length > 0) {\n if (bytes >= this.bufs[0].byteLength) {\n bytes -= this.bufs[0].byteLength\n this.length -= this.bufs[0].byteLength\n this.bufs.shift()\n } else {\n this.bufs[0] = this.bufs[0].subarray(bytes)\n this.length -= bytes\n break\n }\n }\n }\n\n /**\n * Extracts a section of an array and returns a new array.\n *\n * This is a copy operation as it is with Uint8Arrays and Arrays\n * - note this is different to the behaviour of Node Buffers.\n */\n slice (beginInclusive?: number, endExclusive?: number): Uint8Array {\n const { bufs, length } = this._subList(beginInclusive, endExclusive)\n\n return concat(bufs, length)\n }\n\n /**\n * Returns a alloc from the given start and end element index.\n *\n * In the best case where the data extracted comes from a single Uint8Array\n * internally this is a no-copy operation otherwise it is a copy operation.\n */\n subarray (beginInclusive?: number, endExclusive?: number): Uint8Array {\n const { bufs, length } = this._subList(beginInclusive, endExclusive)\n\n if (bufs.length === 1) {\n return bufs[0]\n }\n\n return concat(bufs, length)\n }\n\n /**\n * Returns a allocList from the given start and end element index.\n *\n * This is a no-copy operation.\n */\n sublist (beginInclusive?: number, endExclusive?: number): Uint8ArrayList {\n const { bufs, length } = this._subList(beginInclusive, endExclusive)\n\n const list = new Uint8ArrayList()\n list.length = length\n // don't loop, just set the bufs\n list.bufs = [...bufs]\n\n return list\n }\n\n private _subList (beginInclusive?: number, endExclusive?: number): { bufs: Uint8Array[], length: number } {\n beginInclusive = beginInclusive ?? 0\n endExclusive = endExclusive ?? this.length\n\n if (beginInclusive < 0) {\n beginInclusive = this.length + beginInclusive\n }\n\n if (endExclusive < 0) {\n endExclusive = this.length + endExclusive\n }\n\n if (beginInclusive < 0 || endExclusive > this.length) {\n throw new RangeError('index is out of bounds')\n }\n\n if (beginInclusive === endExclusive) {\n return { bufs: [], length: 0 }\n }\n\n if (beginInclusive === 0 && endExclusive === this.length) {\n return { bufs: this.bufs, length: this.length }\n }\n\n const bufs: Uint8Array[] = []\n let offset = 0\n\n for (let i = 0; i < this.bufs.length; i++) {\n const buf = this.bufs[i]\n const bufStart = offset\n const bufEnd = bufStart + buf.byteLength\n\n // for next loop\n offset = bufEnd\n\n if (beginInclusive >= bufEnd) {\n // start after this buf\n continue\n }\n\n const sliceStartInBuf = beginInclusive >= bufStart && beginInclusive < bufEnd\n const sliceEndsInBuf = endExclusive > bufStart && endExclusive <= bufEnd\n\n if (sliceStartInBuf && sliceEndsInBuf) {\n // slice is wholly contained within this buffer\n if (beginInclusive === bufStart && endExclusive === bufEnd) {\n // requested whole buffer\n bufs.push(buf)\n break\n }\n\n // requested part of buffer\n const start = beginInclusive - bufStart\n bufs.push(buf.subarray(start, start + (endExclusive - beginInclusive)))\n break\n }\n\n if (sliceStartInBuf) {\n // slice starts in this buffer\n if (beginInclusive === 0) {\n // requested whole buffer\n bufs.push(buf)\n continue\n }\n\n // requested part of buffer\n bufs.push(buf.subarray(beginInclusive - bufStart))\n continue\n }\n\n if (sliceEndsInBuf) {\n if (endExclusive === bufEnd) {\n // requested whole buffer\n bufs.push(buf)\n break\n }\n\n // requested part of buffer\n bufs.push(buf.subarray(0, endExclusive - bufStart))\n break\n }\n\n // slice started before this buffer and ends after it\n bufs.push(buf)\n }\n\n return { bufs, length: endExclusive - beginInclusive }\n }\n\n indexOf (search: Uint8ArrayList | Uint8Array, offset: number = 0): number {\n if (!isUint8ArrayList(search) && !(search instanceof Uint8Array)) {\n throw new TypeError('The \"value\" argument must be a Uint8ArrayList or Uint8Array')\n }\n\n const needle = search instanceof Uint8Array ? search : search.subarray()\n\n offset = Number(offset ?? 0)\n\n if (isNaN(offset)) {\n offset = 0\n }\n\n if (offset < 0) {\n offset = this.length + offset\n }\n\n if (offset < 0) {\n offset = 0\n }\n\n if (search.length === 0) {\n return offset > this.length ? this.length : offset\n }\n\n // https://en.wikipedia.org/wiki/Boyer%E2%80%93Moore_string-search_algorithm\n const M: number = needle.byteLength\n\n if (M === 0) {\n throw new TypeError('search must be at least 1 byte long')\n }\n\n // radix\n const radix: number = 256\n const rightmostPositions: Int32Array = new Int32Array(radix)\n\n // position of the rightmost occurrence of the byte c in the pattern\n for (let c: number = 0; c < radix; c++) {\n // -1 for bytes not in pattern\n rightmostPositions[c] = -1\n }\n\n for (let j = 0; j < M; j++) {\n // rightmost position for bytes in pattern\n rightmostPositions[needle[j]] = j\n }\n\n // Return offset of first match, -1 if no match\n const right = rightmostPositions\n const lastIndex = this.byteLength - needle.byteLength\n const lastPatIndex = needle.byteLength - 1\n let skip: number\n\n for (let i = offset; i <= lastIndex; i += skip) {\n skip = 0\n\n for (let j = lastPatIndex; j >= 0; j--) {\n const char: number = this.get(i + j)\n\n if (needle[j] !== char) {\n skip = Math.max(1, j - right[char])\n break\n }\n }\n\n if (skip === 0) {\n return i\n }\n }\n\n return -1\n }\n\n getInt8 (byteOffset: number): number {\n const buf = this.subarray(byteOffset, byteOffset + 1)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getInt8(0)\n }\n\n setInt8 (byteOffset: number, value: number): void {\n const buf = allocUnsafe(1)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setInt8(0, value)\n\n this.write(buf, byteOffset)\n }\n\n getInt16 (byteOffset: number, littleEndian?: boolean): number {\n const buf = this.subarray(byteOffset, byteOffset + 2)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getInt16(0, littleEndian)\n }\n\n setInt16 (byteOffset: number, value: number, littleEndian?: boolean): void {\n const buf = alloc(2)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setInt16(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n getInt32 (byteOffset: number, littleEndian?: boolean): number {\n const buf = this.subarray(byteOffset, byteOffset + 4)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getInt32(0, littleEndian)\n }\n\n setInt32 (byteOffset: number, value: number, littleEndian?: boolean): void {\n const buf = alloc(4)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setInt32(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n getBigInt64 (byteOffset: number, littleEndian?: boolean): bigint {\n const buf = this.subarray(byteOffset, byteOffset + 8)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getBigInt64(0, littleEndian)\n }\n\n setBigInt64 (byteOffset: number, value: bigint, littleEndian?: boolean): void {\n const buf = alloc(8)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setBigInt64(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n getUint8 (byteOffset: number): number {\n const buf = this.subarray(byteOffset, byteOffset + 1)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getUint8(0)\n }\n\n setUint8 (byteOffset: number, value: number): void {\n const buf = allocUnsafe(1)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setUint8(0, value)\n\n this.write(buf, byteOffset)\n }\n\n getUint16 (byteOffset: number, littleEndian?: boolean): number {\n const buf = this.subarray(byteOffset, byteOffset + 2)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getUint16(0, littleEndian)\n }\n\n setUint16 (byteOffset: number, value: number, littleEndian?: boolean): void {\n const buf = alloc(2)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setUint16(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n getUint32 (byteOffset: number, littleEndian?: boolean): number {\n const buf = this.subarray(byteOffset, byteOffset + 4)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getUint32(0, littleEndian)\n }\n\n setUint32 (byteOffset: number, value: number, littleEndian?: boolean): void {\n const buf = alloc(4)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setUint32(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n getBigUint64 (byteOffset: number, littleEndian?: boolean): bigint {\n const buf = this.subarray(byteOffset, byteOffset + 8)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getBigUint64(0, littleEndian)\n }\n\n setBigUint64 (byteOffset: number, value: bigint, littleEndian?: boolean): void {\n const buf = alloc(8)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setBigUint64(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n getFloat32 (byteOffset: number, littleEndian?: boolean): number {\n const buf = this.subarray(byteOffset, byteOffset + 4)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getFloat32(0, littleEndian)\n }\n\n setFloat32 (byteOffset: number, value: number, littleEndian?: boolean): void {\n const buf = alloc(4)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setFloat32(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n getFloat64 (byteOffset: number, littleEndian?: boolean): number {\n const buf = this.subarray(byteOffset, byteOffset + 8)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getFloat64(0, littleEndian)\n }\n\n setFloat64 (byteOffset: number, value: number, littleEndian?: boolean): void {\n const buf = alloc(8)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setFloat64(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n equals (other: any): other is Uint8ArrayList {\n if (other == null) {\n return false\n }\n\n if (!(other instanceof Uint8ArrayList)) {\n return false\n }\n\n if (other.bufs.length !== this.bufs.length) {\n return false\n }\n\n for (let i = 0; i < this.bufs.length; i++) {\n if (!equals(this.bufs[i], other.bufs[i])) {\n return false\n }\n }\n\n return true\n }\n\n /**\n * Create a Uint8ArrayList from a pre-existing list of Uint8Arrays. Use this\n * method if you know the total size of all the Uint8Arrays ahead of time.\n */\n static fromUint8Arrays (bufs: Uint8Array[], length?: number): Uint8ArrayList {\n const list = new Uint8ArrayList()\n list.bufs = bufs\n\n if (length == null) {\n length = bufs.reduce((acc, curr) => acc + curr.byteLength, 0)\n }\n\n list.length = length\n\n return list\n }\n}\n\n/*\nfunction indexOf (needle: Uint8Array, haystack: Uint8Array, offset = 0) {\n for (let i = offset; i < haystack.byteLength; i++) {\n for (let j = 0; j < needle.length; j++) {\n if (haystack[i + j] !== needle[j]) {\n break\n }\n\n if (j === needle.byteLength -1) {\n return i\n }\n }\n\n if (haystack.byteLength - i < needle.byteLength) {\n break\n }\n }\n\n return -1\n}\n*/\n", "/**\n * The incoming stream ended before the expected number of bytes were read\n */\nexport class UnexpectedEOFError extends Error {\n name = 'UnexpectedEOFError'\n code = 'ERR_UNEXPECTED_EOF'\n}\n", "/**\n * @packageDocumentation\n *\n * This module makes it easy to send and receive bytes over streams.\n *\n * @example\n *\n * ```typescript\n * import { byteStream } from 'it-byte-stream'\n *\n * const stream = byteStream(duplex)\n *\n * // read the next chunk\n * const bytes = await stream.read()\n *\n * // read the next five bytes\n * const fiveBytes = await stream.read(5)\n *\n * // write bytes into the stream\n * await stream.write(Uint8Array.from([0, 1, 2, 3, 4]))\n * ```\n */\n\nimport { queuelessPushable } from 'it-queueless-pushable'\nimport { raceSignal } from 'race-signal'\nimport { Uint8ArrayList } from 'uint8arraylist'\nimport { UnexpectedEOFError } from './errors.js'\nimport type { AbortOptions } from 'abort-error'\nimport type { Duplex } from 'it-stream-types'\n\nexport interface ReadOptions extends AbortOptions {\n bytes: number\n}\n\nexport interface ByteStream <Stream = unknown> {\n /**\n * Read bytes from the stream.\n *\n * If a required number of bytes is passed as an option, this will wait for\n * the underlying stream to supply that number of bytes, throwing an\n * `UnexpectedEOFError` if the stream closes before this happens.\n *\n * If no required number of bytes is passed, this will return `null` if the\n * underlying stream closes before supplying any bytes.\n */\n read(options: ReadOptions): Promise<Uint8ArrayList>\n read(options?: AbortOptions): Promise<Uint8ArrayList | null>\n\n /**\n * Write the passed bytes to the stream\n */\n write(input: Uint8Array | Uint8ArrayList, options?: AbortOptions): Promise<void>\n\n /**\n * Returns the underlying stream\n */\n unwrap(): Stream\n}\n\nexport interface ByteStreamOpts {\n /**\n * After the stream is unwrapped, any bytes that have been read from the\n * incoming stream will be yielded in-order as `Uint8Array`(s).\n *\n * To yield a single `Uint8ArrayList` with all unread bytes instead, pass\n * `false` here.\n */\n yieldBytes?: boolean\n}\n\nexport function byteStream <Stream extends Duplex<any, any, any>> (duplex: Stream, opts?: ByteStreamOpts): ByteStream<Stream> {\n const write = queuelessPushable()\n\n duplex.sink(write).catch(async (err: Error) => {\n await write.end(err)\n })\n\n duplex.sink = async (source: any) => {\n for await (const buf of source) {\n await write.push(buf)\n }\n\n await write.end()\n }\n\n let source: AsyncGenerator<any> = duplex.source\n\n if (duplex.source[Symbol.iterator] != null) {\n source = duplex.source[Symbol.iterator]()\n } else if (duplex.source[Symbol.asyncIterator] != null) {\n source = duplex.source[Symbol.asyncIterator]()\n }\n\n const readBuffer = new Uint8ArrayList()\n\n const W: ByteStream<Stream> = {\n read: async (options?: ReadOptions) => {\n options?.signal?.throwIfAborted()\n\n if (options?.bytes == null) {\n // just read whatever arrives\n const { done, value } = await raceSignal(source.next(), options?.signal)\n\n if (done === true) {\n return null\n }\n\n return value\n }\n\n while (readBuffer.byteLength < options.bytes) {\n const { value, done } = await raceSignal(source.next(), options?.signal)\n\n if (done === true) {\n throw new UnexpectedEOFError('unexpected end of input')\n }\n\n readBuffer.append(value)\n }\n\n const buf = readBuffer.sublist(0, options.bytes)\n readBuffer.consume(options.bytes)\n\n return buf\n },\n write: async (data, options?: AbortOptions) => {\n options?.signal?.throwIfAborted()\n\n // just write\n if (data instanceof Uint8Array) {\n await write.push(data, options)\n } else {\n await write.push(data.subarray(), options)\n }\n },\n unwrap: () => {\n if (readBuffer.byteLength > 0) {\n const originalStream = duplex.source\n duplex.source = (async function * () {\n if (opts?.yieldBytes === false) {\n yield readBuffer\n } else {\n yield * readBuffer\n }\n\n yield * originalStream\n }())\n }\n\n return duplex\n }\n }\n\n return W\n}\n", "/**\n * The reported length of the next data message was not a positive integer\n */\nexport class InvalidMessageLengthError extends Error {\n name = 'InvalidMessageLengthError'\n code = 'ERR_INVALID_MSG_LENGTH'\n}\n\n/**\n * The reported length of the next data message was larger than the configured\n * max allowable value\n */\nexport class InvalidDataLengthError extends Error {\n name = 'InvalidDataLengthError'\n code = 'ERR_MSG_DATA_TOO_LONG'\n}\n\n/**\n * The varint used to specify the length of the next data message contained more\n * bytes than the configured max allowable value\n */\nexport class InvalidDataLengthLengthError extends Error {\n name = 'InvalidDataLengthLengthError'\n code = 'ERR_MSG_LENGTH_TOO_LONG'\n}\n", "/**\n * @packageDocumentation\n *\n * This module makes it easy to send and receive length-prefixed byte arrays over streams.\n *\n * @example\n *\n * ```typescript\n * import { lpStream } from 'it-length-prefixed-stream'\n *\n * const stream = lpStream(duplex)\n *\n * // read the next length-prefixed chunk\n * const bytes = await stream.read()\n *\n * // write a length-prefixed chunk\n * await stream.write(Uint8Array.from([0, 1, 2, 3, 4]))\n *\n * // write several chunks, all individually length-prefixed\n * await stream.writeV([\n * Uint8Array.from([0, 1, 2, 3, 4]),\n * Uint8Array.from([5, 6, 7, 8, 9])\n * ])\n * ```\n */\nimport { byteStream } from 'it-byte-stream'\nimport * as varint from 'uint8-varint'\nimport { Uint8ArrayList } from 'uint8arraylist'\nimport { InvalidDataLengthError, InvalidDataLengthLengthError, InvalidMessageLengthError } from './errors.js'\nimport type { AbortOptions } from 'abort-error'\nimport type { ByteStreamOpts } from 'it-byte-stream'\nimport type { Duplex } from 'it-stream-types'\n\nexport interface LengthPrefixedStream <Stream = unknown> {\n /**\n * Read the next length-prefixed number of bytes from the stream\n */\n read(options?: AbortOptions): Promise<Uint8ArrayList>\n\n /**\n * Write the passed bytes to the stream prefixed by their length\n */\n write(input: Uint8Array | Uint8ArrayList, options?: AbortOptions): Promise<void>\n\n /**\n * Write passed list of bytes, prefix by their individual lengths to the stream as a single write\n */\n writeV(input: Array<Uint8Array | Uint8ArrayList>, options?: AbortOptions): Promise<void>\n\n /**\n * Returns the underlying stream\n */\n unwrap(): Stream\n}\n\nexport interface LengthPrefixedStreamOpts extends ByteStreamOpts {\n // encoding opts\n lengthEncoder (value: number): Uint8ArrayList | Uint8Array\n\n // decoding opts\n lengthDecoder (data: Uint8ArrayList): number\n maxLengthLength: number\n maxDataLength: number\n}\n\nexport function lpStream <Stream extends Duplex<any, any, any>> (duplex: Stream, opts: Partial<LengthPrefixedStreamOpts> = {}): LengthPrefixedStream<Stream> {\n const bytes = byteStream(duplex, opts)\n\n if (opts.maxDataLength != null && opts.maxLengthLength == null) {\n // if max data length is set but max length length is not, calculate the\n // max length length needed to encode max data length\n opts.maxLengthLength = varint.encodingLength(opts.maxDataLength)\n }\n\n const decodeLength = opts?.lengthDecoder ?? varint.decode\n const encodeLength = opts?.lengthEncoder ?? varint.encode\n\n const W: LengthPrefixedStream<Stream> = {\n read: async (options?: AbortOptions) => {\n let dataLength: number = -1\n const lengthBuffer = new Uint8ArrayList()\n\n while (true) {\n // read one byte at a time until we can decode a varint\n lengthBuffer.append(await bytes.read({\n ...options,\n bytes: 1\n }))\n\n try {\n dataLength = decodeLength(lengthBuffer)\n } catch (err) {\n if (err instanceof RangeError) {\n continue\n }\n\n throw err\n }\n\n if (dataLength < 0) {\n throw new InvalidMessageLengthError('Invalid message length')\n }\n\n if (opts?.maxLengthLength != null && lengthBuffer.byteLength > opts.maxLengthLength) {\n throw new InvalidDataLengthLengthError('message length length too long')\n }\n\n if (dataLength > -1) {\n break\n }\n }\n\n if (opts?.maxDataLength != null && dataLength > opts.maxDataLength) {\n throw new InvalidDataLengthError('message length too long')\n }\n\n return bytes.read({\n ...options,\n bytes: dataLength\n })\n },\n write: async (data, options?: AbortOptions) => {\n // encode, write\n await bytes.write(new Uint8ArrayList(encodeLength(data.byteLength), data), options)\n },\n writeV: async (data, options?: AbortOptions) => {\n const list = new Uint8ArrayList(\n ...data.flatMap(buf => ([encodeLength(buf.byteLength), buf]))\n )\n\n // encode, write\n await bytes.write(list, options)\n },\n unwrap: () => {\n return bytes.unwrap()\n }\n }\n\n return W\n}\n", "import { logger } from '@libp2p/logger'\nimport { lpStream } from 'it-length-prefixed-stream'\nimport type { MultiaddrConnection } from '@libp2p/interface'\nimport type { LengthPrefixedStream } from 'it-length-prefixed-stream'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nconst log = logger('libp2p:daemon-protocol:stream-handler')\n\nexport interface StreamHandlerOptions {\n stream: MultiaddrConnection\n maxLength?: number\n}\n\nexport class StreamHandler {\n private readonly stream: MultiaddrConnection\n private readonly lp: LengthPrefixedStream<MultiaddrConnection>\n\n /**\n * Create a stream handler for connection\n */\n constructor (opts: StreamHandlerOptions) {\n const { stream, maxLength } = opts\n\n this.stream = stream\n this.lp = lpStream(this.stream, { maxDataLength: maxLength ?? 4096 })\n }\n\n /**\n * Read and decode message\n */\n async read (): Promise<Uint8ArrayList | undefined> {\n try {\n return await this.lp.read()\n } catch (err) {\n log.error('read received no value', err)\n }\n }\n\n async write (msg: Uint8Array | Uint8ArrayList): Promise<void> {\n log('write message')\n await this.lp.write(msg)\n }\n\n /**\n * Return the handshake rest stream and invalidate handler\n */\n rest (): MultiaddrConnection {\n return this.lp.unwrap()\n }\n\n /**\n * Close the stream\n */\n async close (): Promise<void> {\n log('closing the stream')\n await this.rest().close()\n }\n}\n", "\nexport interface ClearableSignal extends AbortSignal {\n clear: () => void\n}\n\n/**\n * Takes an array of AbortSignals and returns a single signal.\n * If any signals are aborted, the returned signal will be aborted.\n */\nexport function anySignal (signals: Array<AbortSignal | undefined | null>): ClearableSignal {\n const controller = new globalThis.AbortController()\n\n function onAbort (): void {\n controller.abort()\n\n for (const signal of signals) {\n if (signal?.removeEventListener != null) {\n signal.removeEventListener('abort', onAbort)\n }\n }\n }\n\n for (const signal of signals) {\n if (signal?.aborted === true) {\n onAbort()\n break\n }\n\n if (signal?.addEventListener != null) {\n signal.addEventListener('abort', onAbort)\n }\n }\n\n function clear (): void {\n for (const signal of signals) {\n if (signal?.removeEventListener != null) {\n signal.removeEventListener('abort', onAbort)\n }\n }\n }\n\n const signal = controller.signal as ClearableSignal\n signal.clear = clear\n\n return signal\n}\n", "import { anySignal } from 'any-signal'\nimport type { ClearableSignal, Connection, ConnectionEncrypter, MultiaddrConnection, StreamMuxerFactory, Upgrader } from '@libp2p/interface'\n\nexport interface OnConnection {\n (conn: MultiaddrConnection): void\n}\n\nexport class PassThroughUpgrader implements Upgrader {\n private readonly onConnection?: OnConnection\n\n constructor (handler?: OnConnection) {\n this.onConnection = handler\n }\n\n async upgradeInbound (maConn: MultiaddrConnection): Promise<void> {\n this.onConnection?.(maConn)\n }\n\n async upgradeOutbound (maConn: MultiaddrConnection): Promise<Connection> {\n // @ts-expect-error should return a connection\n return maConn\n }\n\n createInboundAbortSignal (signal: AbortSignal): ClearableSignal {\n return anySignal([signal])\n }\n\n getStreamMuxers (): Map<string, StreamMuxerFactory> {\n return new Map()\n }\n\n getConnectionEncrypters (): Map<string, ConnectionEncrypter<unknown>> {\n return new Map()\n }\n}\n", "import type { Ed25519PublicKey, KeyType, RSAPublicKey, Secp256k1PublicKey } from './keys.js'\nimport type { CID } from 'multiformats/cid'\nimport type { MultihashDigest } from 'multiformats/hashes/interface'\n\nexport type PeerIdType = KeyType | string\n\n/**\n * A PeerId generated from an RSA public key - it is a base58btc encoded sha-256\n * hash of the public key.\n *\n * RSA public keys are too large to pass around freely, instead Ed25519 or\n * secp256k1 should be preferred as they can embed their public key in the\n * PeerId itself.\n *\n * @deprecated Ed25519 or secp256k1 keys are preferred to RSA\n */\nexport interface RSAPeerId {\n readonly type: 'RSA'\n\n /**\n * RSA public keys are too large to embed in the multihash commonly used to\n * refer to peers, so this will only be defined if the public key has\n * previously been found through a routing query or during normal protocol\n * operations\n */\n readonly publicKey?: RSAPublicKey\n\n /**\n * Returns the multihash from `toMultihash()` as a base58btc encoded string\n */\n toString(): string\n\n /**\n * Returns a multihash, the digest of which is the SHA2-256 hash of the public\n * key\n */\n toMultihash(): MultihashDigest<0x12>\n\n /**\n * Returns a CID with the libp2p key code and the same multihash as\n * `toMultihash()`\n */\n toCID(): CID<Uint8Array, 0x72, 0x12, 1>\n\n /**\n * Returns true if the passed argument is equivalent to this PeerId\n */\n equals(other?: any): boolean\n}\n\nexport interface Ed25519PeerId {\n readonly type: 'Ed25519'\n\n /**\n * This will always be defined as the public key is embedded in the multihash\n * of this PeerId\n */\n readonly publicKey: Ed25519PublicKey\n\n /**\n * Returns the multihash from `toMultihash()` as a base58btc encoded string\n */\n toString(): string\n\n /**\n * Returns a multihash, the digest of which is the protobuf-encoded public key\n * encoded as an identity hash\n */\n toMultihash(): MultihashDigest<0x0>\n\n /**\n * Returns a CID with the libp2p key code and the same multihash as\n * `toMultihash()`\n */\n toCID(): CID<Uint8Array, 0x72, 0x0, 1>\n\n /**\n * Returns true if the passed argument is equivalent to this PeerId\n */\n equals(other?: any): boolean\n}\n\nexport interface Secp256k1PeerId {\n readonly type: 'secp256k1'\n\n /**\n * This will always be defined as the public key is embedded in the multihash\n * of this PeerId\n */\n readonly publicKey: Secp256k1PublicKey\n\n /**\n * Returns the multihash from `toMultihash()` as a base58btc encoded string\n */\n toString(): string\n\n /**\n * Returns a multihash, the digest of which is the protobuf-encoded public key\n * encoded as an identity hash\n */\n toMultihash(): MultihashDigest<0x0>\n\n /**\n * Returns a CID with the libp2p key code and the same multihash as\n * `toMultihash()`\n */\n toCID(): CID<Uint8Array, 0x72, 0x0, 1>\n\n /**\n * Returns true if the passed argument is equivalent to this PeerId\n */\n equals(other?: any): boolean\n}\n\nexport interface URLPeerId {\n readonly type: 'url'\n\n /**\n * This will always be undefined as URL Peers do not have public keys\n */\n readonly publicKey: undefined\n\n /**\n * Returns CID from `toCID()` encoded as a base36 string\n */\n toString(): string\n\n /**\n * Returns a multihash, the digest of which is the URL encoded as an identity\n * hash\n */\n toMultihash(): MultihashDigest<0x0>\n\n /**\n * Returns a CID with the Transport IPFS Gateway HTTP code and the same\n * multihash as `toMultihash()`\n */\n toCID(): CID<Uint8Array, 0x0920, 0x0, 1>\n\n /**\n * Returns true if the passed argument is equivalent to this PeerId\n */\n equals(other?: any): boolean\n}\n\n/**\n * This is a union of all known PeerId types - use the `.type` field to\n * disambiguate them\n */\nexport type PeerId = RSAPeerId | Ed25519PeerId | Secp256k1PeerId | URLPeerId\n\n/**\n * All PeerId implementations must use this symbol as the name of a property\n * with a boolean `true` value\n */\nexport const peerIdSymbol = Symbol.for('@libp2p/peer-id')\n\n/**\n * Returns true if the passed argument is a PeerId implementation\n */\nexport function isPeerId (other?: any): other is PeerId {\n return Boolean(other?.[peerIdSymbol])\n}\n", "import type { Connection, ConnectionLimits, MultiaddrConnection } from './connection.js'\nimport type { AbortOptions, ClearableSignal, ConnectionEncrypter } from './index.js'\nimport type { StreamMuxerFactory } from './stream-muxer.js'\nimport type { Multiaddr } from '@multiformats/multiaddr'\nimport type { TypedEventTarget } from 'main-event'\nimport type { ProgressOptions, ProgressEvent } from 'progress-events'\n\nexport interface ListenerEvents {\n /**\n * This event signals to the transport manager that the listening addresses\n * have changed and may be emitted at any point and/or multiple times\n */\n listening: CustomEvent\n\n /**\n * Emitted if listening on an address failed\n */\n error: CustomEvent<Error>\n\n /**\n * Emitted when the listener has been shut down, has no open connections and\n * will no longer accept new connections\n */\n close: CustomEvent\n}\n\nexport interface Listener extends TypedEventTarget<ListenerEvents> {\n /**\n * Start a listener\n */\n listen(multiaddr: Multiaddr): Promise<void>\n /**\n * Get listen addresses\n */\n getAddrs(): Multiaddr[]\n /**\n * Close listener\n *\n * @returns {Promise<void>}\n */\n close(): Promise<void>\n /**\n * Allows transports to amend announce addresses - to add certificate hashes\n * or other metadata that cannot be known before runtime\n */\n updateAnnounceAddrs(addrs: Multiaddr[]): void\n}\n\nexport const transportSymbol = Symbol.for('@libp2p/transport')\n\n/**\n * A filter that acts on a list of multiaddrs\n */\nexport interface MultiaddrFilter {\n (multiaddrs: Multiaddr[]): Multiaddr[]\n}\n\nexport interface CreateListenerOptions {\n /**\n * The upgrader turns a MultiaddrConnection into a Connection and notifies\n * other libp2p components about a new incoming connection.\n */\n upgrader: Upgrader\n}\n\nexport interface DialTransportOptions<DialEvents extends ProgressEvent = ProgressEvent> extends Required<AbortOptions>, ProgressOptions<DialEvents> {\n /**\n * The upgrader turns a MultiaddrConnection into a Connection which should be\n * returned by the transport's dial method\n */\n upgrader: Upgrader\n}\n\n/**\n * A libp2p transport offers dial and listen methods to establish connections.\n */\nexport interface Transport<DialEvents extends ProgressEvent = ProgressEvent> {\n /**\n * Used to identify the transport\n */\n [Symbol.toStringTag]: string\n\n /**\n * Used by the isTransport function\n */\n [transportSymbol]: true\n\n /**\n * Dial a given multiaddr.\n */\n dial(ma: Multiaddr, options: DialTransportOptions<DialEvents>): Promise<Connection>\n\n /**\n * Create transport listeners.\n */\n createListener(options: CreateListenerOptions): Listener\n\n /**\n * Takes a list of `Multiaddr`s and returns only addresses that are valid for\n * the transport to listen on\n */\n listenFilter: MultiaddrFilter\n\n /**\n * Takes a list of `Multiaddr`s and returns only addresses that are valid for\n * the transport to dial\n */\n dialFilter: MultiaddrFilter\n}\n\n/**\n * Used to disambiguate transport implementations\n */\nexport function isTransport (other?: any): other is Transport {\n return other != null && Boolean(other[transportSymbol])\n}\n\n/**\n * Enum Transport Manager Fault Tolerance values\n */\nexport enum FaultTolerance {\n /**\n * should be used for failing in any listen circumstance\n */\n FATAL_ALL = 0,\n\n /**\n * should be used for not failing when not listening\n */\n NO_FATAL\n}\n\n/**\n * Options accepted by the upgrader during connection establishment\n */\nexport interface UpgraderOptions<ConnectionUpgradeEvents extends ProgressEvent = ProgressEvent> extends ProgressOptions<ConnectionUpgradeEvents>, Required<AbortOptions> {\n /**\n * If true the invoking transport is expected to implement it's own encryption\n * and an encryption protocol will not attempted to be negotiated via\n * multi-stream select\n *\n * @default false\n */\n skipEncryption?: boolean\n\n /**\n * If true no connection protection will be performed on the connection.\n */\n skipProtection?: boolean\n\n /**\n * By default a stream muxer protocol will be negotiated via multi-stream\n * select after an encryption protocol has been agreed on.\n *\n * If a transport provides it's own stream muxing facility pass a muxer\n * factory instance here to skip muxer negotiation.\n */\n muxerFactory?: StreamMuxerFactory\n\n /**\n * If the connection is to have limits applied to it, pass them here\n */\n limits?: ConnectionLimits\n\n /**\n * Multi-stream select is a initiator/responder protocol. By default a\n * connection returned from `upgrader.upgradeOutbound` will be the initiator\n * and one returned from `upgrader.upgradeInbound` will be the responder.\n *\n * Pass a value here to override the default.\n */\n initiator?: boolean\n}\n\nexport type InboundConnectionUpgradeEvents =\nProgressEvent<'upgrader:encrypt-inbound-connection'> |\nProgressEvent<'upgrader:multiplex-inbound-connection'>\n\nexport type OutboundConnectionUpgradeEvents =\nProgressEvent<'upgrader:encrypt-outbound-connection'> |\nProgressEvent<'upgrader:multiplex-outbound-connection'>\n\nexport interface Upgrader {\n /**\n * Upgrades an outbound connection created by the `dial` method of a transport\n */\n upgradeOutbound(maConn: MultiaddrConnection, opts?: UpgraderOptions<OutboundConnectionUpgradeEvents>): Promise<Connection>\n\n /**\n * Upgrades an inbound connection received by a transport listener and\n * notifies other libp2p components about the new connection\n */\n upgradeInbound(maConn: MultiaddrConnection, opts?: UpgraderOptions<InboundConnectionUpgradeEvents>): Promise<void>\n\n /**\n * Used by transports that perform part of the upgrade process themselves and\n * do some async work. This allows configuring inbound upgrade timeouts from a\n * single location.\n *\n * Regular transports should just pass the signal from their shutdown\n * controller to `upgradeInbound`.\n */\n createInboundAbortSignal (signal: AbortSignal): ClearableSignal\n\n /**\n * Returns configured stream muxers\n */\n getStreamMuxers (): Map<string, StreamMuxerFactory>\n\n /**\n * Returns configured connection encrypters\n */\n getConnectionEncrypters (): Map<string, ConnectionEncrypter>\n}\n", "/**\n * When this error is thrown it means an operation was aborted,\n * usually in response to the `abort` event being emitted by an\n * AbortSignal.\n */\nexport class AbortError extends Error {\n static name = 'AbortError'\n\n constructor (message: string = 'The operation was aborted') {\n super(message)\n this.name = 'AbortError'\n }\n}\n\n/**\n * Thrown when a remote Peer ID does not match the expected one\n */\nexport class UnexpectedPeerError extends Error {\n static name = 'UnexpectedPeerError'\n\n constructor (message = 'Unexpected Peer') {\n super(message)\n this.name = 'UnexpectedPeerError'\n }\n}\n\n/**\n * Thrown when a crypto exchange fails\n */\nexport class InvalidCryptoExchangeError extends Error {\n static name = 'InvalidCryptoExchangeError'\n\n constructor (message = 'Invalid crypto exchange') {\n super(message)\n this.name = 'InvalidCryptoExchangeError'\n }\n}\n\n/**\n * Thrown when invalid parameters are passed to a function or method call\n */\nexport class InvalidParametersError extends Error {\n static name = 'InvalidParametersError'\n\n constructor (message = 'Invalid parameters') {\n super(message)\n this.name = 'InvalidParametersError'\n }\n}\n\n/**\n * Thrown when a public key is invalid\n */\nexport class InvalidPublicKeyError extends Error {\n static name = 'InvalidPublicKeyError'\n\n constructor (message = 'Invalid public key') {\n super(message)\n this.name = 'InvalidPublicKeyError'\n }\n}\n\n/**\n * Thrown when a private key is invalid\n */\nexport class InvalidPrivateKeyError extends Error {\n static name = 'InvalidPrivateKeyError'\n\n constructor (message = 'Invalid private key') {\n super(message)\n this.name = 'InvalidPrivateKeyError'\n }\n}\n\n/**\n * Thrown when a operation is unsupported\n */\nexport class UnsupportedOperationError extends Error {\n static name = 'UnsupportedOperationError'\n\n constructor (message = 'Unsupported operation') {\n super(message)\n this.name = 'UnsupportedOperationError'\n }\n}\n\n/**\n * Thrown when a connection is closing\n */\nexport class ConnectionClosingError extends Error {\n static name = 'ConnectionClosingError'\n\n constructor (message = 'The connection is closing') {\n super(message)\n this.name = 'ConnectionClosingError'\n }\n}\n\n/**\n * Thrown when a connection is closed\n */\nexport class ConnectionClosedError extends Error {\n static name = 'ConnectionClosedError'\n\n constructor (message = 'The connection is closed') {\n super(message)\n this.name = 'ConnectionClosedError'\n }\n}\n\n/**\n * Thrown when a connection fails\n */\nexport class ConnectionFailedError extends Error {\n static name = 'ConnectionFailedError'\n\n constructor (message = 'Connection failed') {\n super(message)\n this.name = 'ConnectionFailedError'\n }\n}\n\n/**\n * Thrown when the muxer is closed and an attempt to open a stream occurs\n */\nexport class MuxerClosedError extends Error {\n static name = 'MuxerClosedError'\n\n constructor (message = 'The muxer is closed') {\n super(message)\n this.name = 'MuxerClosedError'\n }\n}\n\n/**\n * Thrown when a protocol stream is reset by the remote muxer\n */\nexport class StreamResetError extends Error {\n static name = 'StreamResetError'\n\n constructor (message = 'The stream has been reset') {\n super(message)\n this.name = 'StreamResetError'\n }\n}\n\n/**\n * Thrown when a stream is in an invalid state\n */\nexport class StreamStateError extends Error {\n static name = 'StreamStateError'\n\n constructor (message = 'The stream is in an invalid state') {\n super(message)\n this.name = 'StreamStateError'\n }\n}\n\n/**\n * Thrown when a value could not be found\n */\nexport class NotFoundError extends Error {\n static name = 'NotFoundError'\n\n constructor (message = 'Not found') {\n super(message)\n this.name = 'NotFoundError'\n }\n}\n\n/**\n * Thrown when an invalid peer ID is encountered\n */\nexport class InvalidPeerIdError extends Error {\n static name = 'InvalidPeerIdError'\n\n constructor (message = 'Invalid PeerID') {\n super(message)\n this.name = 'InvalidPeerIdError'\n }\n}\n\n/**\n * Thrown when an invalid multiaddr is encountered\n */\nexport class InvalidMultiaddrError extends Error {\n static name = 'InvalidMultiaddrError'\n\n constructor (message = 'Invalid multiaddr') {\n super(message)\n this.name = 'InvalidMultiaddrError'\n }\n}\n\n/**\n * Thrown when an invalid CID is encountered\n */\nexport class InvalidCIDError extends Error {\n static name = 'InvalidCIDError'\n\n constructor (message = 'Invalid CID') {\n super(message)\n this.name = 'InvalidCIDError'\n }\n}\n\n/**\n * Thrown when an invalid multihash is encountered\n */\nexport class InvalidMultihashError extends Error {\n static name = 'InvalidMultihashError'\n\n constructor (message = 'Invalid Multihash') {\n super(message)\n this.name = 'InvalidMultihashError'\n }\n}\n\n/**\n * Thrown when a protocol is not supported\n */\nexport class UnsupportedProtocolError extends Error {\n static name = 'UnsupportedProtocolError'\n\n constructor (message = 'Unsupported protocol error') {\n super(message)\n this.name = 'UnsupportedProtocolError'\n }\n}\n\n/**\n * An invalid or malformed message was encountered during a protocol exchange\n */\nexport class InvalidMessageError extends Error {\n static name = 'InvalidMessageError'\n\n constructor (message = 'Invalid message') {\n super(message)\n this.name = 'InvalidMessageError'\n }\n}\n\n/**\n * Thrown when a remote peer sends a structurally valid message that does not\n * comply with the protocol\n */\nexport class ProtocolError extends Error {\n static name = 'ProtocolError'\n\n constructor (message = 'Protocol error') {\n super(message)\n this.name = 'ProtocolError'\n }\n}\n\n/**\n * Throw when an operation times out\n */\nexport class TimeoutError extends Error {\n static name = 'TimeoutError'\n\n constructor (message = 'Timed out') {\n super(message)\n this.name = 'TimeoutError'\n }\n}\n\n/**\n * Thrown when a startable component is interacted with but it has not been\n * started yet\n */\nexport class NotStartedError extends Error {\n static name = 'NotStartedError'\n\n constructor (message = 'Not started') {\n super(message)\n this.name = 'NotStartedError'\n }\n}\n\n/**\n * Thrown when a component is started that has already been started\n */\nexport class AlreadyStartedError extends Error {\n static name = 'AlreadyStartedError'\n\n constructor (message = 'Already started') {\n super(message)\n this.name = 'AlreadyStartedError'\n }\n}\n\n/**\n * Thrown when dialing an address failed\n */\nexport class DialError extends Error {\n static name = 'DialError'\n\n constructor (message = 'Dial error') {\n super(message)\n this.name = 'DialError'\n }\n}\n\n/**\n * Thrown when listening on an address failed\n */\nexport class ListenError extends Error {\n static name = 'ListenError'\n\n constructor (message = 'Listen error') {\n super(message)\n this.name = 'ListenError'\n }\n}\n\n/**\n * This error is thrown when a limited connection is encountered, i.e. if the\n * user tried to open a stream on a connection for a protocol that is not\n * configured to run over limited connections.\n */\nexport class LimitedConnectionError extends Error {\n static name = 'LimitedConnectionError'\n\n constructor (message = 'Limited connection') {\n super(message)\n this.name = 'LimitedConnectionError'\n }\n}\n\n/**\n * This error is thrown where there are too many inbound protocols streams open\n */\nexport class TooManyInboundProtocolStreamsError extends Error {\n static name = 'TooManyInboundProtocolStreamsError'\n\n constructor (message = 'Too many inbound protocol streams') {\n super(message)\n this.name = 'TooManyInboundProtocolStreamsError'\n }\n}\n\n/**\n * This error is thrown where there are too many outbound protocols streams open\n */\nexport class TooManyOutboundProtocolStreamsError extends Error {\n static name = 'TooManyOutboundProtocolStreamsError'\n\n constructor (message = 'Too many outbound protocol streams') {\n super(message)\n this.name = 'TooManyOutboundProtocolStreamsError'\n }\n}\n\n/**\n * Thrown when an attempt to operate on an unsupported key was made\n */\nexport class UnsupportedKeyTypeError extends Error {\n static name = 'UnsupportedKeyTypeError'\n\n constructor (message = 'Unsupported key type') {\n super(message)\n this.name = 'UnsupportedKeyTypeError'\n }\n}\n\n/**\n * Thrown when an operation has not been implemented\n */\nexport class NotImplementedError extends Error {\n static name = 'NotImplementedError'\n\n constructor (message = 'Not implemented') {\n super(message)\n this.name = 'NotImplementedError'\n }\n}\n", "import { setMaxListeners as nodeSetMaxListeners } from 'node:events'\n\n/**\n * Create a setMaxListeners that doesn't break browser usage\n */\nexport const setMaxListeners: typeof nodeSetMaxListeners = (n, ...eventTargets) => {\n try {\n nodeSetMaxListeners(n, ...eventTargets)\n } catch {\n // swallow error, gulp\n }\n}\n", "/**\n * @packageDocumentation\n *\n * Adds types to the EventTarget class.\n *\n * Hopefully this won't be necessary\n * forever:\n *\n * - https://github.com/microsoft/TypeScript/issues/28357\n * - https://github.com/microsoft/TypeScript/issues/43477\n * - https://github.com/microsoft/TypeScript/issues/299\n * - https://www.npmjs.com/package/typed-events\n * - https://www.npmjs.com/package/typed-event-emitter\n * - https://www.npmjs.com/package/typed-event-target\n * - etc\n *\n * In addition to types, a `safeDispatchEvent` method is available which\n * prevents dispatching events that aren't in the event map, and a\n * `listenerCount` method which reports the number of listeners that are\n * currently registered for a given event.\n *\n * @example\n *\n * ```ts\n * import { TypedEventEmitter } from 'main-event'\n * import type { TypedEventTarget } from 'main-event'\n *\n * interface EventTypes {\n * 'test': CustomEvent<string>\n * }\n *\n * const target = new TypedEventEmitter<EventTypes>()\n *\n * // it's a regular EventTarget\n * console.info(target instanceof EventTarget) // true\n *\n * // register listeners normally\n * target.addEventListener('test', (evt) => {\n * // evt is CustomEvent<string>\n * })\n *\n * // @ts-expect-error 'derp' is not in the event map\n * target.addEventListener('derp', () => {})\n *\n * // use normal dispatchEvent method\n * target.dispatchEvent(new CustomEvent('test', {\n * detail: 'hello'\n * }))\n *\n * // use type safe dispatch method\n * target.safeDispatchEvent('test', {\n * detail: 'world'\n * })\n *\n * // report listener count\n * console.info(target.listenerCount('test')) // 0\n *\n * // event emitters can be used purely as interfaces too\n * function acceptTarget (target: TypedEventTarget<EventTypes>) {\n * // ...\n * }\n * ```\n */\n\nimport { setMaxListeners } from './events.js'\n\nexport interface EventCallback<EventType> { (evt: EventType): void }\nexport interface EventObject<EventType> { handleEvent: EventCallback<EventType> }\nexport type EventHandler<EventType> = EventCallback<EventType> | EventObject<EventType>\n\ninterface Listener {\n once: boolean\n callback: any\n}\n\n/**\n *\n */\nexport interface TypedEventTarget <EventMap extends Record<string, any>> extends EventTarget {\n addEventListener<K extends keyof EventMap>(type: K, listener: EventHandler<EventMap[K]> | null, options?: boolean | AddEventListenerOptions): void\n\n listenerCount (type: string): number\n\n removeEventListener<K extends keyof EventMap>(type: K, listener?: EventHandler<EventMap[K]> | null, options?: boolean | EventListenerOptions): void\n\n removeEventListener (type: string, listener?: EventHandler<Event>, options?: boolean | EventListenerOptions): void\n\n safeDispatchEvent<Detail>(type: keyof EventMap, detail?: CustomEventInit<Detail>): boolean\n}\n\n/**\n * An implementation of a typed event target\n */\nexport class TypedEventEmitter<EventMap extends Record<string, any>> extends EventTarget implements TypedEventTarget<EventMap> {\n readonly #listeners = new Map<any, Listener[]>()\n\n constructor () {\n super()\n\n // silence MaxListenersExceededWarning warning on Node.js, this is a red\n // herring almost all of the time\n setMaxListeners(Infinity, this)\n }\n\n listenerCount (type: string): number {\n const listeners = this.#listeners.get(type)\n\n if (listeners == null) {\n return 0\n }\n\n return listeners.length\n }\n\n addEventListener<K extends keyof EventMap>(type: K, listener: EventHandler<EventMap[K]> | null, options?: boolean | AddEventListenerOptions): void\n addEventListener (type: string, listener: EventHandler<Event>, options?: boolean | AddEventListenerOptions): void {\n super.addEventListener(type, listener, options)\n\n let list = this.#listeners.get(type)\n\n if (list == null) {\n list = []\n this.#listeners.set(type, list)\n }\n\n list.push({\n callback: listener,\n once: (options !== true && options !== false && options?.once) ?? false\n })\n }\n\n removeEventListener<K extends keyof EventMap>(type: K, listener?: EventHandler<EventMap[K]> | null, options?: boolean | EventListenerOptions): void\n removeEventListener (type: string, listener?: EventHandler<Event>, options?: boolean | EventListenerOptions): void {\n super.removeEventListener(type.toString(), listener ?? null, options)\n\n let list = this.#listeners.get(type)\n\n if (list == null) {\n return\n }\n\n list = list.filter(({ callback }) => callback !== listener)\n this.#listeners.set(type, list)\n }\n\n dispatchEvent (event: Event): boolean {\n const result = super.dispatchEvent(event)\n\n let list = this.#listeners.get(event.type)\n\n if (list == null) {\n return result\n }\n\n list = list.filter(({ once }) => !once)\n this.#listeners.set(event.type, list)\n\n return result\n }\n\n safeDispatchEvent<Detail>(type: keyof EventMap, detail: CustomEventInit<Detail> = {}): boolean {\n return this.dispatchEvent(new CustomEvent<Detail>(type as string, detail))\n }\n}\n\nexport { setMaxListeners }\n", "/**\n * @packageDocumentation\n *\n * Exports a `Libp2p` type for modules to use as a type argument.\n *\n * @example\n *\n * ```typescript\n * import type { Libp2p } from '@libp2p/interface'\n *\n * function doSomethingWithLibp2p (node: Libp2p) {\n * // ...\n * }\n * ```\n */\n\nimport type { Connection, NewStreamOptions, Stream } from './connection.js'\nimport type { ContentRouting } from './content-routing.js'\nimport type { Ed25519PublicKey, PublicKey, RSAPublicKey, Secp256k1PublicKey } from './keys.js'\nimport type { Metrics } from './metrics.js'\nimport type { Ed25519PeerId, PeerId, RSAPeerId, Secp256k1PeerId, URLPeerId } from './peer-id.js'\nimport type { PeerInfo } from './peer-info.js'\nimport type { PeerRouting } from './peer-routing.js'\nimport type { Address, Peer, PeerStore } from './peer-store.js'\nimport type { Startable } from './startable.js'\nimport type { StreamHandler, StreamHandlerOptions } from './stream-handler.js'\nimport type { Topology } from './topology.js'\nimport type { Listener, OutboundConnectionUpgradeEvents } from './transport.js'\nimport type { DNS } from '@multiformats/dns'\nimport type { Multiaddr } from '@multiformats/multiaddr'\nimport type { TypedEventTarget } from 'main-event'\nimport type { ProgressOptions, ProgressEvent } from 'progress-events'\n\n/**\n * Used by the connection manager to sort addresses into order before dialling\n */\nexport interface AddressSorter {\n (a: Address, b: Address): -1 | 0 | 1\n}\n\n/**\n * Event detail emitted when peer data changes\n */\nexport interface PeerUpdate {\n peer: Peer\n previous?: Peer\n}\n\n/**\n * Peer data signed by the remote Peer's public key\n */\nexport interface SignedPeerRecord {\n addresses: Multiaddr[]\n seq: bigint\n}\n\n/**\n * A certificate that can be used to secure connections\n */\nexport interface TLSCertificate {\n /**\n * The private key that corresponds to the certificate in PEM format\n */\n key: string\n\n /**\n * The certificate chain in PEM format\n */\n cert: string\n}\n\n/**\n * Data returned from a successful identify response\n */\nexport interface IdentifyResult {\n /**\n * The remote Peer's PeerId\n */\n peerId: PeerId\n\n /**\n * The unsigned addresses they are listening on. Note - any multiaddrs present\n * in the signed peer record should be preferred to the value here.\n */\n listenAddrs: Multiaddr[]\n\n /**\n * The protocols the remote peer supports\n */\n protocols: string[]\n\n /**\n * The remote protocol version\n */\n protocolVersion?: string\n\n /**\n * The remote agent version\n */\n agentVersion?: string\n\n /**\n * The public key part of the remote PeerId - this is only useful for older\n * RSA-based PeerIds, the more modern Ed25519 and secp256k1 types have the\n * public key embedded in them\n */\n publicKey?: Uint8Array\n\n /**\n * If set this is the address that the remote peer saw the identify request\n * originate from\n */\n observedAddr?: Multiaddr\n\n /**\n * If sent by the remote peer this is the deserialized signed peer record\n */\n signedPeerRecord?: SignedPeerRecord\n\n /**\n * The connection that the identify protocol ran over\n */\n connection: Connection\n}\n\n/**\n * Logger component for libp2p\n */\nexport interface Logger {\n (formatter: any, ...args: any[]): void\n error(formatter: any, ...args: any[]): void\n trace(formatter: any, ...args: any[]): void\n enabled: boolean\n}\n\n/**\n * Peer logger component for libp2p. This can be used to create loggers that are\n * scoped to individual system components or services.\n *\n * To see logs, run your app with `DEBUG` set as an env var or for browsers, in\n * `localStorage`:\n *\n * ```console\n * $ DEBUG=libp2p* node index.js\n * libp2p:my-service hello +0ms\n * ```\n */\nexport interface ComponentLogger {\n /**\n * Returns a logger for the specified component.\n *\n * @example\n *\n * ```TypeScript\n * import { ComponentLogger, Logger } from '@libp2p/interface'\n *\n * interface MyServiceComponents {\n * logger: ComponentLogger\n * }\n *\n * class MyService {\n * private readonly log: Logger\n *\n * constructor (components) {\n * this.log = components.logger.forComponent('libp2p:my-service')\n *\n * this.log('hello')\n * // logs:\n * // libp2p:my-service hello +0ms\n * }\n * }\n * ```\n */\n forComponent(name: string): Logger\n}\n\nexport interface MultiaddrResolveOptions extends AbortOptions, LoggerOptions {\n /**\n * An optional DNS resolver\n */\n dns?: DNS\n}\n\n/**\n * `MultiaddrResolver`s perform resolution of multiaddr components that require\n * translation by external systems (for example DNSADDR to TXT records).\n */\nexport interface MultiaddrResolver {\n /**\n * Returns true if this resolver can resolve components of this multiaddr\n */\n canResolve (address: Multiaddr): boolean\n\n /**\n * Returns one or more multiaddrs with components resolved to other values\n */\n resolve (address: Multiaddr, options: MultiaddrResolveOptions): Promise<Multiaddr[]>\n}\n\n/**\n * Once you have a libp2p instance, you can listen to several events it emits,\n * so that you can be notified of relevant network events.\n *\n * Event names are `noun:verb` so the first part is the name of the object\n * being acted on and the second is the action.\n */\nexport interface Libp2pEvents<T extends ServiceMap = ServiceMap> {\n /**\n * This event is dispatched when a new network peer is discovered.\n *\n * @example\n *\n * ```TypeScript\n * libp2p.addEventListener('peer:discovery', (event) => {\n * const peerInfo = event.detail\n * // ...\n * })\n * ```\n */\n 'peer:discovery': CustomEvent<PeerInfo>\n\n /**\n * This event will be triggered any time a new peer connects.\n *\n * @example\n *\n * ```TypeScript\n * libp2p.addEventListener('peer:connect', (event) => {\n * const peerId = event.detail\n * // ...\n * })\n * ```\n */\n 'peer:connect': CustomEvent<PeerId>\n\n /**\n * This event will be triggered any time we are disconnected from another\n * peer, regardless of the circumstances of that disconnection. If we happen\n * to have multiple connections to a peer, this event will **only** be\n * triggered when the last connection is closed.\n *\n * @example\n *\n * ```TypeScript\n * libp2p.addEventListener('peer:disconnect', (event) => {\n * const peerId = event.detail\n * // ...\n * })\n * ```\n */\n 'peer:disconnect': CustomEvent<PeerId>\n\n /**\n * When a peer tagged with `keep-alive` disconnects, we will make multiple\n * attempts to reconnect to it with a backoff factor (see the connection\n * manager settings for details). If these all fail, the `keep-alive` tag will\n * be removed and this event will be emitted.\n *\n * @example\n *\n * ```TypeScript\n * libp2p.addEventListener('peer:reconnect-failure', (event) => {\n * const peerId = event.detail\n * // ...\n * })\n * ```\n */\n 'peer:reconnect-failure': CustomEvent<PeerId>\n\n /**\n * This event is dispatched after a remote peer has successfully responded to\n * the identify protocol. Note that for this to be emitted, both peers must\n * have an identify service configured.\n *\n * @example\n *\n * ```TypeScript\n * libp2p.addEventListener('peer:identify', (event) => {\n * const identifyResult = event.detail\n * // ...\n * })\n * ```\n */\n 'peer:identify': CustomEvent<IdentifyResult>\n\n /**\n * This event is dispatched when the peer store data for a peer has been\n * updated - e.g. their multiaddrs, protocols etc have changed.\n *\n * If they were previously known to this node, the old peer data will be\n * set in the `previous` field.\n *\n * This may be in response to the identify protocol running, a manual\n * update or some other event.\n */\n 'peer:update': CustomEvent<PeerUpdate>\n\n /**\n * This event is dispatched when the current node's peer record changes -\n * for example a transport started listening on a new address or a new\n * protocol handler was registered.\n *\n * @example\n *\n * ```TypeScript\n * libp2p.addEventListener('self:peer:update', (event) => {\n * const { peer } = event.detail\n * // ...\n * })\n * ```\n */\n 'self:peer:update': CustomEvent<PeerUpdate>\n\n /**\n * This event is dispatched when a transport begins listening on a new address\n */\n 'transport:listening': CustomEvent<Listener>\n\n /**\n * This event is dispatched when a transport stops listening on an address\n */\n 'transport:close': CustomEvent<Listener>\n\n /**\n * This event is dispatched when the connection manager has more than the\n * configured allowable max connections and has closed some connections to\n * bring the node back under the limit.\n */\n 'connection:prune': CustomEvent<Connection[]>\n\n /**\n * This event notifies listeners when new incoming or outgoing connections\n * are opened.\n */\n 'connection:open': CustomEvent<Connection>\n\n /**\n * This event notifies listeners when incoming or outgoing connections are\n * closed.\n */\n 'connection:close': CustomEvent<Connection>\n\n /**\n * This event notifies listeners that a TLS certificate is available for use\n */\n 'certificate:provision': CustomEvent<TLSCertificate>\n\n /**\n * This event notifies listeners that a new TLS certificate is available for\n * use. Any previous certificate may no longer be valid.\n */\n 'certificate:renew': CustomEvent<TLSCertificate>\n\n /**\n * This event notifies listeners that the node has started\n *\n * ```TypeScript\n * libp2p.addEventListener('start', (event) => {\n * console.info(libp2p.isStarted()) // true\n * })\n * ```\n */\n start: CustomEvent<Libp2p<T>>\n\n /**\n * This event notifies listeners that the node has stopped\n *\n * ```TypeScript\n * libp2p.addEventListener('stop', (event) => {\n * console.info(libp2p.isStarted()) // false\n * })\n * ```\n */\n stop: CustomEvent<Libp2p<T>>\n}\n\n/**\n * A map of user defined services available on the libp2p node via the\n * `services` key\n *\n * @example\n *\n * ```TypeScript\n * const node = await createLibp2p({\n * // ...other options\n * services: {\n * myService: myService({\n * // ...service options\n * })\n * }\n * })\n *\n * // invoke methods on the service\n * node.services.myService.anOperation()\n * ```\n */\nexport type ServiceMap = Record<string, unknown>\n\nexport type PendingDialStatus = 'queued' | 'active' | 'error' | 'success'\n\n/**\n * An item in the dial queue\n */\nexport interface PendingDial {\n /**\n * A unique identifier for this dial\n */\n id: string\n\n /**\n * The current status of the dial\n */\n status: PendingDialStatus\n\n /**\n * If known, this is the peer id that libp2p expects to be dialling\n */\n peerId?: PeerId\n\n /**\n * The list of multiaddrs that will be dialled. The returned connection will\n * use the first address that succeeds, all other dials part of this pending\n * dial will be cancelled.\n */\n multiaddrs: Multiaddr[]\n}\n\nexport type Libp2pStatus = 'starting' | 'started' | 'stopping' | 'stopped'\n\nexport interface IsDialableOptions extends AbortOptions {\n /**\n * If the dial attempt would open a protocol, and the multiaddr being dialed\n * is a circuit relay address, passing true here would cause the test to fail\n * because that protocol would not be allowed to run over a data/time limited\n * connection.\n */\n runOnLimitedConnection?: boolean\n}\n\nexport type TransportManagerDialProgressEvents =\n ProgressEvent<'transport-manager:selected-transport', string>\n\nexport type OpenConnectionProgressEvents =\n TransportManagerDialProgressEvents |\n ProgressEvent<'dial-queue:already-connected'> |\n ProgressEvent<'dial-queue:already-in-dial-queue'> |\n ProgressEvent<'dial-queue:add-to-dial-queue'> |\n ProgressEvent<'dial-queue:start-dial'> |\n ProgressEvent<'dial-queue:calculated-addresses', Address[]> |\n OutboundConnectionUpgradeEvents\n\nexport interface DialOptions extends AbortOptions, ProgressOptions {\n /**\n * If true, open a new connection to the remote even if one already exists\n */\n force?: boolean\n}\n\nexport interface DialProtocolOptions extends NewStreamOptions {\n\n}\n\n/**\n * Libp2p nodes implement this interface.\n */\nexport interface Libp2p<T extends ServiceMap = ServiceMap> extends Startable, TypedEventTarget<Libp2pEvents<T>> {\n /**\n * The PeerId is a unique identifier for a node on the network.\n *\n * It is the hash of an RSA public key or, for Ed25519 or secp256k1 keys,\n * the key itself.\n *\n * @example\n *\n * ```TypeScript\n * console.info(libp2p.peerId)\n * // PeerId(12D3Foo...)\n * ````\n */\n peerId: PeerId\n\n /**\n * The peer store holds information we know about other peers on the network.\n * - multiaddrs, supported protocols, etc.\n *\n * @example\n *\n * ```TypeScript\n * const peer = await libp2p.peerStore.get(peerId)\n * console.info(peer)\n * // { id: PeerId(12D3Foo...), addresses: [] ... }\n * ```\n */\n peerStore: PeerStore\n\n /**\n * The peer routing subsystem allows the user to find peers on the network\n * or to find peers close to binary keys.\n *\n * @example\n *\n * ```TypeScript\n * const peerInfo = await libp2p.peerRouting.findPeer(peerId)\n * console.info(peerInfo)\n * // { id: PeerId(12D3Foo...), multiaddrs: [] ... }\n * ```\n *\n * @example\n *\n * ```TypeScript\n * for await (const peerInfo of libp2p.peerRouting.getClosestPeers(key)) {\n * console.info(peerInfo)\n * // { id: PeerId(12D3Foo...), multiaddrs: [] ... }\n * }\n * ```\n */\n peerRouting: PeerRouting\n\n /**\n * The content routing subsystem allows the user to find providers for content,\n * let the network know they are providers for content, and get/put values to\n * the DHT.\n *\n * @example\n *\n * ```TypeScript\n * for await (const peerInfo of libp2p.contentRouting.findProviders(cid)) {\n * console.info(peerInfo)\n * // { id: PeerId(12D3Foo...), multiaddrs: [] ... }\n * }\n * ```\n */\n contentRouting: ContentRouting\n\n /**\n * The metrics subsystem allows recording values to assess the health/performance\n * of the running node.\n *\n * @example\n *\n * ```TypeScript\n * const metric = libp2p.metrics.registerMetric({\n * 'my-metric'\n * })\n *\n * // later\n * metric.update(5)\n * ```\n */\n metrics?: Metrics\n\n /**\n * The logger used by this libp2p node\n */\n logger: ComponentLogger\n\n /**\n * The current status of the libp2p node\n */\n status: Libp2pStatus\n\n /**\n * Get a deduplicated list of peer advertising multiaddrs by concatenating\n * the listen addresses used by transports with any configured\n * announce addresses as well as observed addresses reported by peers.\n *\n * If Announce addrs are specified, configured listen addresses will be\n * ignored though observed addresses will still be included.\n *\n * @example\n *\n * ```TypeScript\n * const listenMa = libp2p.getMultiaddrs()\n * // [ <Multiaddr 047f00000106f9ba - /ip4/127.0.0.1/tcp/63930> ]\n * ```\n */\n getMultiaddrs(): Multiaddr[]\n\n /**\n * Returns a list of supported protocols\n *\n * @example\n *\n * ```TypeScript\n * const protocols = libp2p.getProtocols()\n * // [ '/ipfs/ping/1.0.0', '/ipfs/id/1.0.0' ]\n * ```\n */\n getProtocols(): string[]\n\n /**\n * Return a list of all connections this node has open, optionally filtering\n * by a PeerId\n *\n * @example\n *\n * ```TypeScript\n * for (const connection of libp2p.getConnections()) {\n * console.log(peerId, connection.remoteAddr.toString())\n * // Logs the PeerId string and the observed remote multiaddr of each Connection\n * }\n * ```\n */\n getConnections(peerId?: PeerId): Connection[]\n\n /**\n * Return the list of dials currently in progress or queued to start\n *\n * @example\n *\n * ```TypeScript\n * for (const pendingDial of libp2p.getDialQueue()) {\n * console.log(pendingDial)\n * }\n * ```\n */\n getDialQueue(): PendingDial[]\n\n /**\n * Return a list of all peers we currently have a connection open to\n */\n getPeers(): PeerId[]\n\n /**\n * Dials to the provided peer. If successful, the known metadata of the\n * peer will be added to the nodes `peerStore`.\n *\n * If a PeerId is passed as the first argument, the peer will need to have known multiaddrs for it in the PeerStore.\n *\n * @example\n *\n * ```TypeScript\n * const conn = await libp2p.dial(remotePeerId)\n *\n * // create a new stream within the connection\n * const stream = await conn.newStream(['/echo/1.1.0', '/echo/1.0.0'])\n *\n * // protocol negotiated: 'echo/1.0.0' means that the other party only supports the older version\n *\n * // ...\n * await conn.close()\n * ```\n */\n dial(peer: PeerId | Multiaddr | Multiaddr[], options?: DialOptions): Promise<Connection>\n\n /**\n * Dials to the provided peer and tries to handshake with the given protocols in order.\n * If successful, the known metadata of the peer will be added to the nodes `peerStore`,\n * and the `MuxedStream` will be returned together with the successful negotiated protocol.\n *\n * @example\n *\n * ```TypeScript\n * import { pipe } from 'it-pipe'\n *\n * const { stream, protocol } = await libp2p.dialProtocol(remotePeerId, protocols)\n *\n * // Use this new stream like any other duplex stream\n * pipe([1, 2, 3], stream, consume)\n * ```\n */\n dialProtocol(peer: PeerId | Multiaddr | Multiaddr[], protocols: string | string[], options?: DialProtocolOptions): Promise<Stream>\n\n /**\n * Attempts to gracefully close an open connection to the given peer. If the\n * connection is not closed in the grace period, it will be forcefully closed.\n *\n * An AbortSignal can optionally be passed to control when the connection is\n * forcefully closed.\n *\n * @example\n *\n * ```TypeScript\n * await libp2p.hangUp(remotePeerId)\n * ```\n */\n hangUp(peer: PeerId | Multiaddr, options?: AbortOptions): Promise<void>\n\n /**\n * Sets up [multistream-select routing](https://github.com/multiformats/multistream-select) of protocols to their application handlers. Whenever a stream is opened on one of the provided protocols, the handler will be called. `handle` must be called in order to register a handler and support for a given protocol. This also informs other peers of the protocols you support.\n *\n * `libp2p.handle(protocols, handler, options)`\n *\n * In the event of a new handler for the same protocol being added and error\n * will be thrown. Pass `force: true` to override this.\n *\n * @example\n *\n * ```TypeScript\n * const handler = ({ connection, stream, protocol }) => {\n * // use stream or connection according to the needs\n * }\n *\n * libp2p.handle('/echo/1.0.0', handler, {\n * maxInboundStreams: 5,\n * maxOutboundStreams: 5\n * })\n * ```\n */\n handle(protocol: string | string[], handler: StreamHandler, options?: StreamHandlerOptions): Promise<void>\n\n /**\n * Removes the handler for each protocol. The protocol\n * will no longer be supported on streams.\n *\n * @example\n *\n * ```TypeScript\n * libp2p.unhandle(['/echo/1.0.0'])\n * ```\n */\n unhandle(protocols: string[] | string, options?: AbortOptions): Promise<void>\n\n /**\n * Register a topology to be informed when peers are encountered that\n * support the specified protocol\n *\n * @example\n *\n * ```TypeScript\n * const id = await libp2p.register('/echo/1.0.0', {\n * onConnect: (peer, connection) => {\n * // handle connect\n * },\n * onDisconnect: (peer, connection) => {\n * // handle disconnect\n * }\n * })\n * ```\n */\n register(protocol: string, topology: Topology, options?: AbortOptions): Promise<string>\n\n /**\n * Unregister topology to no longer be informed when peers connect or\n * disconnect.\n *\n * @example\n *\n * ```TypeScript\n * const id = await libp2p.register(...)\n *\n * libp2p.unregister(id)\n * ```\n */\n unregister(id: string): void\n\n /**\n * Returns the public key for the passed PeerId. If the PeerId is of the 'RSA'\n * type this may mean searching the routing if the peer's key is not present\n * in the peer store.\n */\n getPublicKey(peer: Ed25519PeerId, options?: AbortOptions): Promise<Ed25519PublicKey>\n getPublicKey(peer: Secp256k1PeerId, options?: AbortOptions): Promise<Secp256k1PublicKey>\n getPublicKey(peer: RSAPeerId, options?: AbortOptions): Promise<RSAPublicKey>\n getPublicKey(peer: URLPeerId, options?: AbortOptions): Promise<never>\n getPublicKey(peer: PeerId, options?: AbortOptions): Promise<PublicKey>\n\n /**\n * Given the current node configuration, returns a promise of `true` or\n * `false` if the node would attempt to dial the passed multiaddr.\n *\n * This means a relevant transport is configured, and the connection gater\n * would not block the dial attempt.\n *\n * This may involve resolving DNS addresses so you should pass an AbortSignal.\n */\n isDialable(multiaddr: Multiaddr | Multiaddr[], options?: IsDialableOptions): Promise<boolean>\n\n /**\n * A set of user defined services\n */\n services: T\n}\n\n/**\n * Metadata about the current node\n */\nexport interface NodeInfo {\n /**\n * The implementation name\n */\n name: string\n\n /**\n * The implementation version\n */\n version: string\n\n /**\n * A string that contains information about the implementation and runtime\n */\n userAgent: string\n}\n\n/**\n * An object that contains an AbortSignal as\n * the optional `signal` property.\n *\n * @example\n *\n * ```TypeScript\n * const controller = new AbortController()\n *\n * aLongRunningOperation({\n * signal: controller.signal\n * })\n *\n * // later\n *\n * controller.abort()\n */\nexport interface AbortOptions {\n signal?: AbortSignal\n}\n\n/**\n * An object that contains a Logger as the `log` property.\n */\nexport interface LoggerOptions {\n log: Logger\n}\n\n/**\n * An object that includes a trace object that is passed onwards.\n *\n * This is used by metrics method tracing to link function calls together.\n */\nexport interface TraceOptions {\n trace?: any\n}\n\n/**\n * A signal that needs to be cleared when no longer in use\n */\nexport interface ClearableSignal extends AbortSignal {\n clear(): void\n}\n\n/**\n * When a routing operation involves reading values, these options allow\n * controlling where the values are read from. By default libp2p will check\n * local caches but may not use the network if a valid local value is found,\n * these options allow tuning that behavior.\n */\nexport interface RoutingOptions extends AbortOptions, ProgressOptions, TraceOptions {\n /**\n * Pass `false` to not use the network\n *\n * @default true\n */\n useNetwork?: boolean\n\n /**\n * Pass `false` to not use cached values\n *\n * @default true\n */\n useCache?: boolean\n}\n\n/**\n * This symbol is used by libp2p services to define the capabilities they can\n * provide to other libp2p services.\n *\n * The service should define a property with this symbol as the key and the\n * value should be a string array of provided capabilities.\n */\nexport const serviceCapabilities = Symbol.for('@libp2p/service-capabilities')\n\n/**\n * This symbol is used by libp2p services to define the capabilities they\n * require from other libp2p services.\n *\n * The service should define a property with this symbol as the key and the\n * value should be a string array of required capabilities.\n */\nexport const serviceDependencies = Symbol.for('@libp2p/service-dependencies')\n\nexport * from './connection.js'\nexport * from './connection-encrypter.js'\nexport * from './connection-gater.js'\nexport * from './content-routing.js'\nexport * from './keys.js'\nexport * from './metrics.js'\nexport * from './peer-discovery.js'\nexport * from './peer-id.js'\nexport * from './peer-info.js'\nexport * from './peer-routing.js'\nexport * from './peer-store.js'\nexport * from './pubsub.js'\nexport * from './record.js'\nexport * from './stream-handler.js'\nexport * from './stream-muxer.js'\nexport * from './topology.js'\nexport * from './transport.js'\nexport * from './errors.js'\nexport * from 'main-event'\nexport * from './startable.js'\n", "import { Buffer } from 'node:buffer'\nimport bases, { type SupportedEncodings } from './util/bases.js'\n\nexport type { SupportedEncodings }\n\n/**\n * Turns a `Uint8Array` into a string.\n *\n * Supports `utf8`, `utf-8` and any encoding supported by the multibase module.\n *\n * Also `ascii` which is similar to node's 'binary' encoding.\n */\nexport function toString (array: Uint8Array, encoding: SupportedEncodings = 'utf8'): string {\n const base = bases[encoding]\n\n if (base == null) {\n throw new Error(`Unsupported encoding \"${encoding}\"`)\n }\n\n if (encoding === 'utf8' || encoding === 'utf-8') {\n return Buffer.from(array.buffer, array.byteOffset, array.byteLength).toString('utf8')\n }\n\n // strip multibase prefix\n return base.encoder.encode(array).substring(1)\n}\n", "import { Uint8ArrayList } from 'uint8arraylist'\n\ninterface Context {\n offset: number\n}\n\nconst TAG_MASK = parseInt('11111', 2)\nconst LONG_LENGTH_MASK = parseInt('10000000', 2)\nconst LONG_LENGTH_BYTES_MASK = parseInt('01111111', 2)\n\ninterface Decoder {\n (buf: Uint8Array, context: Context): any\n}\n\nconst decoders: Record<number, Decoder> = {\n 0x0: readSequence,\n 0x1: readSequence,\n 0x2: readInteger,\n 0x3: readBitString,\n 0x4: readOctetString,\n 0x5: readNull,\n 0x6: readObjectIdentifier,\n 0x10: readSequence,\n 0x16: readSequence,\n 0x30: readSequence\n}\n\nexport function decodeDer (buf: Uint8Array, context: Context = { offset: 0 }): any {\n const tag = buf[context.offset] & TAG_MASK\n context.offset++\n\n if (decoders[tag] != null) {\n return decoders[tag](buf, context)\n }\n\n throw new Error('No decoder for tag ' + tag)\n}\n\nfunction readLength (buf: Uint8Array, context: Context): number {\n let length = 0\n\n if ((buf[context.offset] & LONG_LENGTH_MASK) === LONG_LENGTH_MASK) {\n // long length\n const count = buf[context.offset] & LONG_LENGTH_BYTES_MASK\n let str = '0x'\n context.offset++\n\n for (let i = 0; i < count; i++, context.offset++) {\n str += buf[context.offset].toString(16).padStart(2, '0')\n }\n\n length = parseInt(str, 16)\n } else {\n length = buf[context.offset]\n context.offset++\n }\n\n return length\n}\n\nfunction readSequence (buf: Uint8Array, context: Context): any[] {\n readLength(buf, context)\n const entries: any[] = []\n\n while (true) {\n if (context.offset >= buf.byteLength) {\n break\n }\n\n const result = decodeDer(buf, context)\n\n if (result === null) {\n break\n }\n\n entries.push(result)\n }\n\n return entries\n}\n\nfunction readInteger (buf: Uint8Array, context: Context): Uint8Array {\n const length = readLength(buf, context)\n const start = context.offset\n const end = context.offset + length\n\n const vals: number[] = []\n\n for (let i = start; i < end; i++) {\n if (i === start && buf[i] === 0) {\n continue\n }\n\n vals.push(buf[i])\n }\n\n context.offset += length\n\n return Uint8Array.from(vals)\n}\n\nfunction readObjectIdentifier (buf: Uint8Array, context: Context): string {\n const count = readLength(buf, context)\n const finalOffset = context.offset + count\n\n const byte = buf[context.offset]\n context.offset++\n\n let val1 = 0\n let val2 = 0\n\n if (byte < 40) {\n val1 = 0\n val2 = byte\n } else if (byte < 80) {\n val1 = 1\n val2 = byte - 40\n } else {\n val1 = 2\n val2 = byte - 80\n }\n\n let oid = `${val1}.${val2}`\n let num: number[] = []\n\n while (context.offset < finalOffset) {\n const byte = buf[context.offset]\n context.offset++\n\n // remove msb\n num.push(byte & 0b01111111)\n\n if (byte < 128) {\n num.reverse()\n\n // reached the end of the encoding\n let val = 0\n\n for (let i = 0; i < num.length; i++) {\n val += num[i] << (i * 7)\n }\n\n oid += `.${val}`\n num = []\n }\n }\n\n return oid\n}\n\nfunction readNull (buf: Uint8Array, context: Context): null {\n context.offset++\n\n return null\n}\n\nfunction readBitString (buf: Uint8Array, context: Context): any {\n const length = readLength(buf, context)\n const unusedBits = buf[context.offset]\n context.offset++\n const bytes = buf.subarray(context.offset, context.offset + length - 1)\n context.offset += length\n\n if (unusedBits !== 0) {\n // need to shift all bytes along by this many bits\n throw new Error('Unused bits in bit string is unimplemented')\n }\n\n return bytes\n}\n\nfunction readOctetString (buf: Uint8Array, context: Context): any {\n const length = readLength(buf, context)\n const bytes = buf.subarray(context.offset, context.offset + length)\n context.offset += length\n\n return bytes\n}\n\nfunction encodeNumber (value: number): Uint8ArrayList {\n let number = value.toString(16)\n\n if (number.length % 2 === 1) {\n number = '0' + number\n }\n\n const array = new Uint8ArrayList()\n\n for (let i = 0; i < number.length; i += 2) {\n array.append(Uint8Array.from([parseInt(`${number[i]}${number[i + 1]}`, 16)]))\n }\n\n return array\n}\n\nfunction encodeLength (bytes: { byteLength: number }): Uint8Array | Uint8ArrayList {\n if (bytes.byteLength < 128) {\n return Uint8Array.from([bytes.byteLength])\n }\n\n // long length\n const length = encodeNumber(bytes.byteLength)\n\n return new Uint8ArrayList(\n Uint8Array.from([\n length.byteLength | LONG_LENGTH_MASK\n ]),\n length\n )\n}\n\nexport function encodeInteger (value: Uint8Array | Uint8ArrayList): Uint8ArrayList {\n const contents = new Uint8ArrayList()\n\n const mask = 0b10000000\n const positive = (value.subarray()[0] & mask) === mask\n\n if (positive) {\n contents.append(Uint8Array.from([0]))\n }\n\n contents.append(value)\n\n return new Uint8ArrayList(\n Uint8Array.from([0x02]),\n encodeLength(contents),\n contents\n )\n}\n\nexport function encodeBitString (value: Uint8Array | Uint8ArrayList): Uint8ArrayList {\n // unused bits is always 0 with full-byte-only values\n const unusedBits = Uint8Array.from([0])\n\n const contents = new Uint8ArrayList(\n unusedBits,\n value\n )\n\n return new Uint8ArrayList(\n Uint8Array.from([0x03]),\n encodeLength(contents),\n contents\n )\n}\n\nexport function encodeOctetString (value: Uint8Array | Uint8ArrayList): Uint8ArrayList {\n return new Uint8ArrayList(\n Uint8Array.from([0x04]),\n encodeLength(value),\n value\n )\n}\n\nexport function encodeSequence (values: Array<Uint8Array | Uint8ArrayList>, tag = 0x30): Uint8ArrayList {\n const output = new Uint8ArrayList()\n\n for (const buf of values) {\n output.append(\n buf\n )\n }\n\n return new Uint8ArrayList(\n Uint8Array.from([tag]),\n encodeLength(output),\n output\n )\n}\n", "import type { JWKKeyPair } from '../interface.js'\nimport type { AbortOptions } from '@libp2p/interface'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nexport type Curve = 'P-256' | 'P-384' | 'P-521'\n\nexport const ECDSA_P_256_OID = '1.2.840.10045.3.1.7'\nexport const ECDSA_P_384_OID = '1.3.132.0.34'\nexport const ECDSA_P_521_OID = '1.3.132.0.35'\n\nexport async function generateECDSAKey (curve: Curve = 'P-256'): Promise<JWKKeyPair> {\n const keyPair = await crypto.subtle.generateKey({\n name: 'ECDSA',\n namedCurve: curve\n }, true, ['sign', 'verify'])\n\n return {\n publicKey: await crypto.subtle.exportKey('jwk', keyPair.publicKey),\n privateKey: await crypto.subtle.exportKey('jwk', keyPair.privateKey)\n }\n}\n\nexport async function hashAndSign (key: JsonWebKey, msg: Uint8Array | Uint8ArrayList, options?: AbortOptions): Promise<Uint8Array> {\n const privateKey = await crypto.subtle.importKey('jwk', key, {\n name: 'ECDSA',\n namedCurve: key.crv ?? 'P-256'\n }, false, ['sign'])\n options?.signal?.throwIfAborted()\n\n const signature = await crypto.subtle.sign({\n name: 'ECDSA',\n hash: {\n name: 'SHA-256'\n }\n }, privateKey, msg.subarray())\n options?.signal?.throwIfAborted()\n\n return new Uint8Array(signature, 0, signature.byteLength)\n}\n\nexport async function hashAndVerify (key: JsonWebKey, sig: Uint8Array, msg: Uint8Array | Uint8ArrayList, options?: AbortOptions): Promise<boolean> {\n const publicKey = await crypto.subtle.importKey('jwk', key, {\n name: 'ECDSA',\n namedCurve: key.crv ?? 'P-256'\n }, false, ['verify'])\n options?.signal?.throwIfAborted()\n\n const result = await crypto.subtle.verify({\n name: 'ECDSA',\n hash: {\n name: 'SHA-256'\n }\n }, publicKey, sig, msg.subarray())\n options?.signal?.throwIfAborted()\n\n return result\n}\n", "import { InvalidParametersError } from '@libp2p/interface'\nimport { Uint8ArrayList } from 'uint8arraylist'\nimport { fromString as uint8ArrayFromString } from 'uint8arrays/from-string'\nimport { toString as uint8ArrayToString } from 'uint8arrays/to-string'\nimport { decodeDer, encodeBitString, encodeInteger, encodeOctetString, encodeSequence } from '../rsa/der.js'\nimport { ECDSAPrivateKey as ECDSAPrivateKeyClass, ECDSAPublicKey as ECDSAPublicKeyClass } from './ecdsa.js'\nimport { generateECDSAKey } from './index.js'\nimport type { Curve } from '../ecdh/index.js'\nimport type { ECDSAPublicKey, ECDSAPrivateKey } from '@libp2p/interface'\n\n// 1.2.840.10045.3.1.7 prime256v1 (ANSI X9.62 named elliptic curve)\nconst OID_256 = Uint8Array.from([0x06, 0x08, 0x2A, 0x86, 0x48, 0xCE, 0x3D, 0x03, 0x01, 0x07])\n// 1.3.132.0.34 secp384r1 (SECG (Certicom) named elliptic curve)\nconst OID_384 = Uint8Array.from([0x06, 0x05, 0x2B, 0x81, 0x04, 0x00, 0x22])\n// 1.3.132.0.35 secp521r1 (SECG (Certicom) named elliptic curve)\nconst OID_521 = Uint8Array.from([0x06, 0x05, 0x2B, 0x81, 0x04, 0x00, 0x23])\n\nconst P_256_KEY_JWK = {\n ext: true,\n kty: 'EC',\n crv: 'P-256'\n}\n\nconst P_384_KEY_JWK = {\n ext: true,\n kty: 'EC',\n crv: 'P-384'\n}\n\nconst P_521_KEY_JWK = {\n ext: true,\n kty: 'EC',\n crv: 'P-521'\n}\n\nconst P_256_KEY_LENGTH = 32\nconst P_384_KEY_LENGTH = 48\nconst P_521_KEY_LENGTH = 66\n\nexport function unmarshalECDSAPrivateKey (bytes: Uint8Array): ECDSAPrivateKey {\n const message = decodeDer(bytes)\n\n return pkiMessageToECDSAPrivateKey(message)\n}\n\nexport function pkiMessageToECDSAPrivateKey (message: any): ECDSAPrivateKey {\n const privateKey = message[1]\n const d = uint8ArrayToString(privateKey, 'base64url')\n const coordinates: Uint8Array = message[2][1][0]\n const offset = 1\n let x: string\n let y: string\n\n if (privateKey.byteLength === P_256_KEY_LENGTH) {\n x = uint8ArrayToString(coordinates.subarray(offset, offset + P_256_KEY_LENGTH), 'base64url')\n y = uint8ArrayToString(coordinates.subarray(offset + P_256_KEY_LENGTH), 'base64url')\n\n return new ECDSAPrivateKeyClass({\n ...P_256_KEY_JWK,\n key_ops: ['sign'],\n d,\n x,\n y\n })\n }\n\n if (privateKey.byteLength === P_384_KEY_LENGTH) {\n x = uint8ArrayToString(coordinates.subarray(offset, offset + P_384_KEY_LENGTH), 'base64url')\n y = uint8ArrayToString(coordinates.subarray(offset + P_384_KEY_LENGTH), 'base64url')\n\n return new ECDSAPrivateKeyClass({\n ...P_384_KEY_JWK,\n key_ops: ['sign'],\n d,\n x,\n y\n })\n }\n\n if (privateKey.byteLength === P_521_KEY_LENGTH) {\n x = uint8ArrayToString(coordinates.subarray(offset, offset + P_521_KEY_LENGTH), 'base64url')\n y = uint8ArrayToString(coordinates.subarray(offset + P_521_KEY_LENGTH), 'base64url')\n\n return new ECDSAPrivateKeyClass({\n ...P_521_KEY_JWK,\n key_ops: ['sign'],\n d,\n x,\n y\n })\n }\n\n throw new InvalidParametersError(`Private key length was wrong length, got ${privateKey.byteLength}, expected 32, 48 or 66`)\n}\n\nexport function unmarshalECDSAPublicKey (bytes: Uint8Array): ECDSAPublicKey {\n const message = decodeDer(bytes)\n\n return pkiMessageToECDSAPublicKey(message)\n}\n\nexport function pkiMessageToECDSAPublicKey (message: any): ECDSAPublicKey {\n const coordinates = message[1][1][0]\n const offset = 1\n let x: string\n let y: string\n\n if (coordinates.byteLength === ((P_256_KEY_LENGTH * 2) + 1)) {\n x = uint8ArrayToString(coordinates.subarray(offset, offset + P_256_KEY_LENGTH), 'base64url')\n y = uint8ArrayToString(coordinates.subarray(offset + P_256_KEY_LENGTH), 'base64url')\n\n return new ECDSAPublicKeyClass({\n ...P_256_KEY_JWK,\n key_ops: ['verify'],\n x,\n y\n })\n }\n\n if (coordinates.byteLength === ((P_384_KEY_LENGTH * 2) + 1)) {\n x = uint8ArrayToString(coordinates.subarray(offset, offset + P_384_KEY_LENGTH), 'base64url')\n y = uint8ArrayToString(coordinates.subarray(offset + P_384_KEY_LENGTH), 'base64url')\n\n return new ECDSAPublicKeyClass({\n ...P_384_KEY_JWK,\n key_ops: ['verify'],\n x,\n y\n })\n }\n\n if (coordinates.byteLength === ((P_521_KEY_LENGTH * 2) + 1)) {\n x = uint8ArrayToString(coordinates.subarray(offset, offset + P_521_KEY_LENGTH), 'base64url')\n y = uint8ArrayToString(coordinates.subarray(offset + P_521_KEY_LENGTH), 'base64url')\n\n return new ECDSAPublicKeyClass({\n ...P_521_KEY_JWK,\n key_ops: ['verify'],\n x,\n y\n })\n }\n\n throw new InvalidParametersError(`coordinates were wrong length, got ${coordinates.byteLength}, expected 65, 97 or 133`)\n}\n\nexport function privateKeyToPKIMessage (privateKey: JsonWebKey): Uint8Array {\n return encodeSequence([\n encodeInteger(Uint8Array.from([1])), // header\n encodeOctetString(uint8ArrayFromString(privateKey.d ?? '', 'base64url')), // body\n encodeSequence([ // PKIProtection\n getOID(privateKey.crv)\n ], 0xA0),\n encodeSequence([ // extraCerts\n encodeBitString(\n new Uint8ArrayList(\n Uint8Array.from([0x04]),\n uint8ArrayFromString(privateKey.x ?? '', 'base64url'),\n uint8ArrayFromString(privateKey.y ?? '', 'base64url')\n )\n )\n ], 0xA1)\n ]).subarray()\n}\n\nexport function publicKeyToPKIMessage (publicKey: JsonWebKey): Uint8Array {\n return encodeSequence([\n encodeInteger(Uint8Array.from([1])), // header\n encodeSequence([ // PKIProtection\n getOID(publicKey.crv)\n ], 0xA0),\n encodeSequence([ // extraCerts\n encodeBitString(\n new Uint8ArrayList(\n Uint8Array.from([0x04]),\n uint8ArrayFromString(publicKey.x ?? '', 'base64url'),\n uint8ArrayFromString(publicKey.y ?? '', 'base64url')\n )\n )\n ], 0xA1)\n ]).subarray()\n}\n\nfunction getOID (curve?: string): Uint8Array {\n if (curve === 'P-256') {\n return OID_256\n }\n\n if (curve === 'P-384') {\n return OID_384\n }\n\n if (curve === 'P-521') {\n return OID_521\n }\n\n throw new InvalidParametersError(`Invalid curve ${curve}`)\n}\n\nexport async function generateECDSAKeyPair (curve: Curve = 'P-256'): Promise<ECDSAPrivateKey> {\n const key = await generateECDSAKey(curve)\n\n return new ECDSAPrivateKeyClass(key.privateKey)\n}\n\nexport function ensureECDSAKey (key: Uint8Array, length: number): Uint8Array {\n key = Uint8Array.from(key ?? [])\n if (key.length !== length) {\n throw new InvalidParametersError(`Key must be a Uint8Array of length ${length}, got ${key.length}`)\n }\n return key\n}\n", "import { base58btc } from 'multiformats/bases/base58'\nimport { CID } from 'multiformats/cid'\nimport { identity } from 'multiformats/hashes/identity'\nimport { equals as uint8ArrayEquals } from 'uint8arrays/equals'\nimport { publicKeyToProtobuf } from '../index.js'\nimport { privateKeyToPKIMessage, publicKeyToPKIMessage } from './utils.js'\nimport { hashAndVerify, hashAndSign } from './index.js'\nimport type { ECDSAPublicKey as ECDSAPublicKeyInterface, ECDSAPrivateKey as ECDSAPrivateKeyInterface, AbortOptions } from '@libp2p/interface'\nimport type { Digest } from 'multiformats/hashes/digest'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nexport class ECDSAPublicKey implements ECDSAPublicKeyInterface {\n public readonly type = 'ECDSA'\n public readonly jwk: JsonWebKey\n private _raw?: Uint8Array\n\n constructor (jwk: JsonWebKey) {\n this.jwk = jwk\n }\n\n get raw (): Uint8Array {\n if (this._raw == null) {\n this._raw = publicKeyToPKIMessage(this.jwk)\n }\n\n return this._raw\n }\n\n toMultihash (): Digest<0x0, number> {\n return identity.digest(publicKeyToProtobuf(this))\n }\n\n toCID (): CID<unknown, 114, 0x0, 1> {\n return CID.createV1(114, this.toMultihash())\n }\n\n toString (): string {\n return base58btc.encode(this.toMultihash().bytes).substring(1)\n }\n\n equals (key?: any): boolean {\n if (key == null || !(key.raw instanceof Uint8Array)) {\n return false\n }\n\n return uint8ArrayEquals(this.raw, key.raw)\n }\n\n async verify (data: Uint8Array | Uint8ArrayList, sig: Uint8Array, options?: AbortOptions): Promise<boolean> {\n return hashAndVerify(this.jwk, sig, data, options)\n }\n}\n\nexport class ECDSAPrivateKey implements ECDSAPrivateKeyInterface {\n public readonly type = 'ECDSA'\n public readonly jwk: JsonWebKey\n public readonly publicKey: ECDSAPublicKey\n private _raw?: Uint8Array\n\n constructor (jwk: JsonWebKey) {\n this.jwk = jwk\n this.publicKey = new ECDSAPublicKey({\n crv: jwk.crv,\n ext: jwk.ext,\n key_ops: ['verify'],\n kty: 'EC',\n x: jwk.x,\n y: jwk.y\n })\n }\n\n get raw (): Uint8Array {\n if (this._raw == null) {\n this._raw = privateKeyToPKIMessage(this.jwk)\n }\n\n return this._raw\n }\n\n equals (key?: any): boolean {\n if (key == null || !(key.raw instanceof Uint8Array)) {\n return false\n }\n\n return uint8ArrayEquals(this.raw, key.raw)\n }\n\n async sign (message: Uint8Array | Uint8ArrayList, options?: AbortOptions): Promise<Uint8Array> {\n return hashAndSign(this.jwk, message, options)\n }\n}\n", "import crypto from 'crypto'\nimport { concat as uint8arrayConcat } from 'uint8arrays/concat'\nimport { fromString as uint8arrayFromString } from 'uint8arrays/from-string'\nimport { toString as uint8arrayToString } from 'uint8arrays/to-string'\nimport type { Uint8ArrayKeyPair } from '../interface.js'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nconst keypair = crypto.generateKeyPairSync\n\nconst PUBLIC_KEY_BYTE_LENGTH = 32\nconst PRIVATE_KEY_BYTE_LENGTH = 64 // private key is actually 32 bytes but for historical reasons we concat private and public keys\nconst KEYS_BYTE_LENGTH = 32\nconst SIGNATURE_BYTE_LENGTH = 64\n\nexport { PUBLIC_KEY_BYTE_LENGTH as publicKeyLength }\nexport { PRIVATE_KEY_BYTE_LENGTH as privateKeyLength }\n\nfunction derivePublicKey (privateKey: Uint8Array): Uint8Array {\n const keyObject = crypto.createPrivateKey({\n format: 'jwk',\n key: {\n crv: 'Ed25519',\n x: '',\n d: uint8arrayToString(privateKey, 'base64url'),\n kty: 'OKP'\n }\n })\n const jwk = keyObject.export({\n format: 'jwk'\n })\n\n if (jwk.x == null || jwk.x === '') {\n throw new Error('Could not export JWK public key')\n }\n\n return uint8arrayFromString(jwk.x, 'base64url')\n}\n\nexport function generateKey (): Uint8ArrayKeyPair {\n const key = keypair('ed25519', {\n publicKeyEncoding: { type: 'spki', format: 'jwk' },\n privateKeyEncoding: { type: 'pkcs8', format: 'jwk' }\n })\n\n // @ts-expect-error node types are missing jwk as a format\n const privateKeyRaw = uint8arrayFromString(key.privateKey.d, 'base64url')\n // @ts-expect-error node types are missing jwk as a format\n const publicKeyRaw = uint8arrayFromString(key.publicKey.x, 'base64url')\n\n return {\n privateKey: uint8arrayConcat([privateKeyRaw, publicKeyRaw], privateKeyRaw.byteLength + publicKeyRaw.byteLength),\n publicKey: publicKeyRaw\n }\n}\n\n/**\n * Generate keypair from a 32 byte uint8array\n */\nexport function generateKeyFromSeed (seed: Uint8Array): Uint8ArrayKeyPair {\n if (seed.length !== KEYS_BYTE_LENGTH) {\n throw new TypeError('\"seed\" must be 32 bytes in length.')\n } else if (!(seed instanceof Uint8Array)) {\n throw new TypeError('\"seed\" must be a node.js Buffer, or Uint8Array.')\n }\n\n // based on node forges algorithm, the seed is used directly as private key\n const publicKeyRaw = derivePublicKey(seed)\n\n return {\n privateKey: uint8arrayConcat([seed, publicKeyRaw], seed.byteLength + publicKeyRaw.byteLength),\n publicKey: publicKeyRaw\n }\n}\n\nexport function hashAndSign (key: Uint8Array, msg: Uint8Array | Uint8ArrayList): Uint8Array {\n if (!(key instanceof Uint8Array)) {\n throw new TypeError('\"key\" must be a node.js Buffer, or Uint8Array.')\n }\n\n let privateKey: Uint8Array\n let publicKey: Uint8Array\n\n if (key.byteLength === PRIVATE_KEY_BYTE_LENGTH) {\n privateKey = key.subarray(0, 32)\n publicKey = key.subarray(32)\n } else if (key.byteLength === KEYS_BYTE_LENGTH) {\n privateKey = key.subarray(0, 32)\n publicKey = derivePublicKey(privateKey)\n } else {\n throw new TypeError('\"key\" must be 64 or 32 bytes in length.')\n }\n\n const obj = crypto.createPrivateKey({\n format: 'jwk',\n key: {\n crv: 'Ed25519',\n d: uint8arrayToString(privateKey, 'base64url'),\n x: uint8arrayToString(publicKey, 'base64url'),\n kty: 'OKP'\n }\n })\n\n return crypto.sign(null, msg instanceof Uint8Array ? msg : msg.subarray(), obj)\n}\n\nexport function hashAndVerify (key: Uint8Array, sig: Uint8Array, msg: Uint8Array | Uint8ArrayList): boolean {\n if (key.byteLength !== PUBLIC_KEY_BYTE_LENGTH) {\n throw new TypeError('\"key\" must be 32 bytes in length.')\n } else if (!(key instanceof Uint8Array)) {\n throw new TypeError('\"key\" must be a node.js Buffer, or Uint8Array.')\n }\n\n if (sig.byteLength !== SIGNATURE_BYTE_LENGTH) {\n throw new TypeError('\"sig\" must be 64 bytes in length.')\n } else if (!(sig instanceof Uint8Array)) {\n throw new TypeError('\"sig\" must be a node.js Buffer, or Uint8Array.')\n }\n\n const obj = crypto.createPublicKey({\n format: 'jwk',\n key: {\n crv: 'Ed25519',\n x: uint8arrayToString(key, 'base64url'),\n kty: 'OKP'\n }\n })\n\n return crypto.verify(null, msg instanceof Uint8Array ? msg : msg.subarray(), obj, sig)\n}\n", "import { concat as uint8ArrayConcat } from 'uint8arrays/concat'\nimport { fromString as uint8ArrayFromString } from 'uint8arrays/from-string'\n\nexport function base64urlToBuffer (str: string, len?: number): Uint8Array {\n let buf = uint8ArrayFromString(str, 'base64urlpad')\n\n if (len != null) {\n if (buf.length > len) {\n throw new Error('byte array longer than desired length')\n }\n\n buf = uint8ArrayConcat([new Uint8Array(len - buf.length), buf])\n }\n\n return buf\n}\n\nexport function isPromise <T = unknown> (thing: any): thing is Promise<T> {\n if (thing == null) {\n return false\n }\n\n return typeof thing.then === 'function' &&\n typeof thing.catch === 'function' &&\n typeof thing.finally === 'function'\n}\n", "import { base58btc } from 'multiformats/bases/base58'\nimport { CID } from 'multiformats/cid'\nimport { identity } from 'multiformats/hashes/identity'\nimport { equals as uint8ArrayEquals } from 'uint8arrays/equals'\nimport { isPromise } from '../../util.ts'\nimport { publicKeyToProtobuf } from '../index.js'\nimport { ensureEd25519Key } from './utils.js'\nimport * as crypto from './index.js'\nimport type { Ed25519PublicKey as Ed25519PublicKeyInterface, Ed25519PrivateKey as Ed25519PrivateKeyInterface, AbortOptions } from '@libp2p/interface'\nimport type { Digest } from 'multiformats/hashes/digest'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nexport class Ed25519PublicKey implements Ed25519PublicKeyInterface {\n public readonly type = 'Ed25519'\n public readonly raw: Uint8Array\n\n constructor (key: Uint8Array) {\n this.raw = ensureEd25519Key(key, crypto.publicKeyLength)\n }\n\n toMultihash (): Digest<0x0, number> {\n return identity.digest(publicKeyToProtobuf(this))\n }\n\n toCID (): CID<unknown, 114, 0x0, 1> {\n return CID.createV1(114, this.toMultihash())\n }\n\n toString (): string {\n return base58btc.encode(this.toMultihash().bytes).substring(1)\n }\n\n equals (key?: any): boolean {\n if (key == null || !(key.raw instanceof Uint8Array)) {\n return false\n }\n\n return uint8ArrayEquals(this.raw, key.raw)\n }\n\n verify (data: Uint8Array | Uint8ArrayList, sig: Uint8Array, options?: AbortOptions): boolean | Promise<boolean> {\n options?.signal?.throwIfAborted()\n const result = crypto.hashAndVerify(this.raw, sig, data)\n\n if (isPromise<boolean>(result)) {\n return result.then(res => {\n options?.signal?.throwIfAborted()\n return res\n })\n }\n\n return result\n }\n}\n\nexport class Ed25519PrivateKey implements Ed25519PrivateKeyInterface {\n public readonly type = 'Ed25519'\n public readonly raw: Uint8Array\n public readonly publicKey: Ed25519PublicKey\n\n // key - 64 byte Uint8Array containing private key\n // publicKey - 32 byte Uint8Array containing public key\n constructor (key: Uint8Array, publicKey: Uint8Array) {\n this.raw = ensureEd25519Key(key, crypto.privateKeyLength)\n this.publicKey = new Ed25519PublicKey(publicKey)\n }\n\n equals (key?: any): boolean {\n if (key == null || !(key.raw instanceof Uint8Array)) {\n return false\n }\n\n return uint8ArrayEquals(this.raw, key.raw)\n }\n\n sign (message: Uint8Array | Uint8ArrayList, options?: AbortOptions): Uint8Array | Promise<Uint8Array> {\n options?.signal?.throwIfAborted()\n const sig = crypto.hashAndSign(this.raw, message)\n\n if (isPromise<Uint8Array>(sig)) {\n return sig.then(res => {\n options?.signal?.throwIfAborted()\n return res\n })\n }\n\n options?.signal?.throwIfAborted()\n return sig\n }\n}\n", "import { InvalidParametersError } from '@libp2p/interface'\nimport { Ed25519PublicKey as Ed25519PublicKeyClass, Ed25519PrivateKey as Ed25519PrivateKeyClass } from './ed25519.js'\nimport * as crypto from './index.js'\nimport type { Ed25519PublicKey, Ed25519PrivateKey } from '@libp2p/interface'\n\nexport function unmarshalEd25519PrivateKey (bytes: Uint8Array): Ed25519PrivateKey {\n // Try the old, redundant public key version\n if (bytes.length > crypto.privateKeyLength) {\n bytes = ensureEd25519Key(bytes, crypto.privateKeyLength + crypto.publicKeyLength)\n const privateKeyBytes = bytes.subarray(0, crypto.privateKeyLength)\n const publicKeyBytes = bytes.subarray(crypto.privateKeyLength, bytes.length)\n return new Ed25519PrivateKeyClass(privateKeyBytes, publicKeyBytes)\n }\n\n bytes = ensureEd25519Key(bytes, crypto.privateKeyLength)\n const privateKeyBytes = bytes.subarray(0, crypto.privateKeyLength)\n const publicKeyBytes = bytes.subarray(crypto.publicKeyLength)\n return new Ed25519PrivateKeyClass(privateKeyBytes, publicKeyBytes)\n}\n\nexport function unmarshalEd25519PublicKey (bytes: Uint8Array): Ed25519PublicKey {\n bytes = ensureEd25519Key(bytes, crypto.publicKeyLength)\n return new Ed25519PublicKeyClass(bytes)\n}\n\nexport async function generateEd25519KeyPair (): Promise<Ed25519PrivateKey> {\n const { privateKey, publicKey } = crypto.generateKey()\n return new Ed25519PrivateKeyClass(privateKey, publicKey)\n}\n\nexport async function generateEd25519KeyPairFromSeed (seed: Uint8Array): Promise<Ed25519PrivateKey> {\n const { privateKey, publicKey } = crypto.generateKeyFromSeed(seed)\n return new Ed25519PrivateKeyClass(privateKey, publicKey)\n}\n\nexport function ensureEd25519Key (key: Uint8Array, length: number): Uint8Array {\n key = Uint8Array.from(key ?? [])\n if (key.length !== length) {\n throw new InvalidParametersError(`Key must be a Uint8Array of length ${length}, got ${key.length}`)\n }\n return key\n}\n", "import { decodeMessage, encodeMessage, enumeration, message } from 'protons-runtime'\nimport type { Codec, DecodeOptions } from 'protons-runtime'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nexport enum KeyType {\n RSA = 'RSA',\n Ed25519 = 'Ed25519',\n secp256k1 = 'secp256k1',\n ECDSA = 'ECDSA'\n}\n\nenum __KeyTypeValues {\n RSA = 0,\n Ed25519 = 1,\n secp256k1 = 2,\n ECDSA = 3\n}\n\nexport namespace KeyType {\n export const codec = (): Codec<KeyType> => {\n return enumeration<KeyType>(__KeyTypeValues)\n }\n}\nexport interface PublicKey {\n Type?: KeyType\n Data?: Uint8Array\n}\n\nexport namespace PublicKey {\n let _codec: Codec<PublicKey>\n\n export const codec = (): Codec<PublicKey> => {\n if (_codec == null) {\n _codec = message<PublicKey>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.Type != null) {\n w.uint32(8)\n KeyType.codec().encode(obj.Type, w)\n }\n\n if (obj.Data != null) {\n w.uint32(18)\n w.bytes(obj.Data)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length, opts = {}) => {\n const obj: any = {}\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1: {\n obj.Type = KeyType.codec().decode(reader)\n break\n }\n case 2: {\n obj.Data = reader.bytes()\n break\n }\n default: {\n reader.skipType(tag & 7)\n break\n }\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PublicKey>): Uint8Array => {\n return encodeMessage(obj, PublicKey.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList, opts?: DecodeOptions<PublicKey>): PublicKey => {\n return decodeMessage(buf, PublicKey.codec(), opts)\n }\n}\n\nexport interface PrivateKey {\n Type?: KeyType\n Data?: Uint8Array\n}\n\nexport namespace PrivateKey {\n let _codec: Codec<PrivateKey>\n\n export const codec = (): Codec<PrivateKey> => {\n if (_codec == null) {\n _codec = message<PrivateKey>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.Type != null) {\n w.uint32(8)\n KeyType.codec().encode(obj.Type, w)\n }\n\n if (obj.Data != null) {\n w.uint32(18)\n w.bytes(obj.Data)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length, opts = {}) => {\n const obj: any = {}\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1: {\n obj.Type = KeyType.codec().decode(reader)\n break\n }\n case 2: {\n obj.Data = reader.bytes()\n break\n }\n default: {\n reader.skipType(tag & 7)\n break\n }\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PrivateKey>): Uint8Array => {\n return encodeMessage(obj, PrivateKey.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList, opts?: DecodeOptions<PrivateKey>): PrivateKey => {\n return decodeMessage(buf, PrivateKey.codec(), opts)\n }\n}\n", "/**\n * Internal webcrypto alias.\n * We prefer WebCrypto aka globalThis.crypto, which exists in node.js 16+.\n * Falls back to Node.js built-in crypto for Node.js <=v14.\n * See utils.ts for details.\n * @module\n */\n// @ts-ignore\nimport * as nc from 'node:crypto';\nexport const crypto: any =\n nc && typeof nc === 'object' && 'webcrypto' in nc\n ? (nc.webcrypto as any)\n : nc && typeof nc === 'object' && 'randomBytes' in nc\n ? nc\n : undefined;\n", "/**\n * Utilities for hex, bytes, CSPRNG.\n * @module\n */\n/*! noble-hashes - MIT License (c) 2022 Paul Miller (paulmillr.com) */\n\n// We use WebCrypto aka globalThis.crypto, which exists in browsers and node.js 16+.\n// node.js versions earlier than v19 don't declare it in global scope.\n// For node.js, package.json#exports field mapping rewrites import\n// from `crypto` to `cryptoNode`, which imports native module.\n// Makes the utils un-importable in browsers without a bundler.\n// Once node.js 18 is deprecated (2025-04-30), we can just drop the import.\nimport { crypto } from '@noble/hashes/crypto';\n\n/** Checks if something is Uint8Array. Be careful: nodejs Buffer will return true. */\nexport function isBytes(a: unknown): a is Uint8Array {\n return a instanceof Uint8Array || (ArrayBuffer.isView(a) && a.constructor.name === 'Uint8Array');\n}\n\n/** Asserts something is positive integer. */\nexport function anumber(n: number): void {\n if (!Number.isSafeInteger(n) || n < 0) throw new Error('positive integer expected, got ' + n);\n}\n\n/** Asserts something is Uint8Array. */\nexport function abytes(b: Uint8Array | undefined, ...lengths: number[]): void {\n if (!isBytes(b)) throw new Error('Uint8Array expected');\n if (lengths.length > 0 && !lengths.includes(b.length))\n throw new Error('Uint8Array expected of length ' + lengths + ', got length=' + b.length);\n}\n\n/** Asserts something is hash */\nexport function ahash(h: IHash): void {\n if (typeof h !== 'function' || typeof h.create !== 'function')\n throw new Error('Hash should be wrapped by utils.createHasher');\n anumber(h.outputLen);\n anumber(h.blockLen);\n}\n\n/** Asserts a hash instance has not been destroyed / finished */\nexport function aexists(instance: any, checkFinished = true): void {\n if (instance.destroyed) throw new Error('Hash instance has been destroyed');\n if (checkFinished && instance.finished) throw new Error('Hash#digest() has already been called');\n}\n\n/** Asserts output is properly-sized byte array */\nexport function aoutput(out: any, instance: any): void {\n abytes(out);\n const min = instance.outputLen;\n if (out.length < min) {\n throw new Error('digestInto() expects output buffer of length at least ' + min);\n }\n}\n\n/** Generic type encompassing 8/16/32-byte arrays - but not 64-byte. */\n// prettier-ignore\nexport type TypedArray = Int8Array | Uint8ClampedArray | Uint8Array |\n Uint16Array | Int16Array | Uint32Array | Int32Array;\n\n/** Cast u8 / u16 / u32 to u8. */\nexport function u8(arr: TypedArray): Uint8Array {\n return new Uint8Array(arr.buffer, arr.byteOffset, arr.byteLength);\n}\n\n/** Cast u8 / u16 / u32 to u32. */\nexport function u32(arr: TypedArray): Uint32Array {\n return new Uint32Array(arr.buffer, arr.byteOffset, Math.floor(arr.byteLength / 4));\n}\n\n/** Zeroize a byte array. Warning: JS provides no guarantees. */\nexport function clean(...arrays: TypedArray[]): void {\n for (let i = 0; i < arrays.length; i++) {\n arrays[i].fill(0);\n }\n}\n\n/** Create DataView of an array for easy byte-level manipulation. */\nexport function createView(arr: TypedArray): DataView {\n return new DataView(arr.buffer, arr.byteOffset, arr.byteLength);\n}\n\n/** The rotate right (circular right shift) operation for uint32 */\nexport function rotr(word: number, shift: number): number {\n return (word << (32 - shift)) | (word >>> shift);\n}\n\n/** The rotate left (circular left shift) operation for uint32 */\nexport function rotl(word: number, shift: number): number {\n return (word << shift) | ((word >>> (32 - shift)) >>> 0);\n}\n\n/** Is current platform little-endian? Most are. Big-Endian platform: IBM */\nexport const isLE: boolean = /* @__PURE__ */ (() =>\n new Uint8Array(new Uint32Array([0x11223344]).buffer)[0] === 0x44)();\n\n/** The byte swap operation for uint32 */\nexport function byteSwap(word: number): number {\n return (\n ((word << 24) & 0xff000000) |\n ((word << 8) & 0xff0000) |\n ((word >>> 8) & 0xff00) |\n ((word >>> 24) & 0xff)\n );\n}\n/** Conditionally byte swap if on a big-endian platform */\nexport const swap8IfBE: (n: number) => number = isLE\n ? (n: number) => n\n : (n: number) => byteSwap(n);\n\n/** @deprecated */\nexport const byteSwapIfBE: typeof swap8IfBE = swap8IfBE;\n/** In place byte swap for Uint32Array */\nexport function byteSwap32(arr: Uint32Array): Uint32Array {\n for (let i = 0; i < arr.length; i++) {\n arr[i] = byteSwap(arr[i]);\n }\n return arr;\n}\n\nexport const swap32IfBE: (u: Uint32Array) => Uint32Array = isLE\n ? (u: Uint32Array) => u\n : byteSwap32;\n\n// Built-in hex conversion https://caniuse.com/mdn-javascript_builtins_uint8array_fromhex\nconst hasHexBuiltin: boolean = /* @__PURE__ */ (() =>\n // @ts-ignore\n typeof Uint8Array.from([]).toHex === 'function' && typeof Uint8Array.fromHex === 'function')();\n\n// Array where index 0xf0 (240) is mapped to string 'f0'\nconst hexes = /* @__PURE__ */ Array.from({ length: 256 }, (_, i) =>\n i.toString(16).padStart(2, '0')\n);\n\n/**\n * Convert byte array to hex string. Uses built-in function, when available.\n * @example bytesToHex(Uint8Array.from([0xca, 0xfe, 0x01, 0x23])) // 'cafe0123'\n */\nexport function bytesToHex(bytes: Uint8Array): string {\n abytes(bytes);\n // @ts-ignore\n if (hasHexBuiltin) return bytes.toHex();\n // pre-caching improves the speed 6x\n let hex = '';\n for (let i = 0; i < bytes.length; i++) {\n hex += hexes[bytes[i]];\n }\n return hex;\n}\n\n// We use optimized technique to convert hex string to byte array\nconst asciis = { _0: 48, _9: 57, A: 65, F: 70, a: 97, f: 102 } as const;\nfunction asciiToBase16(ch: number): number | undefined {\n if (ch >= asciis._0 && ch <= asciis._9) return ch - asciis._0; // '2' => 50-48\n if (ch >= asciis.A && ch <= asciis.F) return ch - (asciis.A - 10); // 'B' => 66-(65-10)\n if (ch >= asciis.a && ch <= asciis.f) return ch - (asciis.a - 10); // 'b' => 98-(97-10)\n return;\n}\n\n/**\n * Convert hex string to byte array. Uses built-in function, when available.\n * @example hexToBytes('cafe0123') // Uint8Array.from([0xca, 0xfe, 0x01, 0x23])\n */\nexport function hexToBytes(hex: string): Uint8Array {\n if (typeof hex !== 'string') throw new Error('hex string expected, got ' + typeof hex);\n // @ts-ignore\n if (hasHexBuiltin) return Uint8Array.fromHex(hex);\n const hl = hex.length;\n const al = hl / 2;\n if (hl % 2) throw new Error('hex string expected, got unpadded hex of length ' + hl);\n const array = new Uint8Array(al);\n for (let ai = 0, hi = 0; ai < al; ai++, hi += 2) {\n const n1 = asciiToBase16(hex.charCodeAt(hi));\n const n2 = asciiToBase16(hex.charCodeAt(hi + 1));\n if (n1 === undefined || n2 === undefined) {\n const char = hex[hi] + hex[hi + 1];\n throw new Error('hex string expected, got non-hex character \"' + char + '\" at index ' + hi);\n }\n array[ai] = n1 * 16 + n2; // multiply first octet, e.g. 'a3' => 10*16+3 => 160 + 3 => 163\n }\n return array;\n}\n\n/**\n * There is no setImmediate in browser and setTimeout is slow.\n * Call of async fn will return Promise, which will be fullfiled only on\n * next scheduler queue processing step and this is exactly what we need.\n */\nexport const nextTick = async (): Promise<void> => {};\n\n/** Returns control to thread each 'tick' ms to avoid blocking. */\nexport async function asyncLoop(\n iters: number,\n tick: number,\n cb: (i: number) => void\n): Promise<void> {\n let ts = Date.now();\n for (let i = 0; i < iters; i++) {\n cb(i);\n // Date.now() is not monotonic, so in case if clock goes backwards we return return control too\n const diff = Date.now() - ts;\n if (diff >= 0 && diff < tick) continue;\n await nextTick();\n ts += diff;\n }\n}\n\n// Global symbols, but ts doesn't see them: https://github.com/microsoft/TypeScript/issues/31535\ndeclare const TextEncoder: any;\ndeclare const TextDecoder: any;\n\n/**\n * Converts string to bytes using UTF8 encoding.\n * @example utf8ToBytes('abc') // Uint8Array.from([97, 98, 99])\n */\nexport function utf8ToBytes(str: string): Uint8Array {\n if (typeof str !== 'string') throw new Error('string expected');\n return new Uint8Array(new TextEncoder().encode(str)); // https://bugzil.la/1681809\n}\n\n/**\n * Converts bytes to string using UTF8 encoding.\n * @example bytesToUtf8(Uint8Array.from([97, 98, 99])) // 'abc'\n */\nexport function bytesToUtf8(bytes: Uint8Array): string {\n return new TextDecoder().decode(bytes);\n}\n\n/** Accepted input of hash functions. Strings are converted to byte arrays. */\nexport type Input = string | Uint8Array;\n/**\n * Normalizes (non-hex) string or Uint8Array to Uint8Array.\n * Warning: when Uint8Array is passed, it would NOT get copied.\n * Keep in mind for future mutable operations.\n */\nexport function toBytes(data: Input): Uint8Array {\n if (typeof data === 'string') data = utf8ToBytes(data);\n abytes(data);\n return data;\n}\n\n/** KDFs can accept string or Uint8Array for user convenience. */\nexport type KDFInput = string | Uint8Array;\n/**\n * Helper for KDFs: consumes uint8array or string.\n * When string is passed, does utf8 decoding, using TextDecoder.\n */\nexport function kdfInputToBytes(data: KDFInput): Uint8Array {\n if (typeof data === 'string') data = utf8ToBytes(data);\n abytes(data);\n return data;\n}\n\n/** Copies several Uint8Arrays into one. */\nexport function concatBytes(...arrays: Uint8Array[]): Uint8Array {\n let sum = 0;\n for (let i = 0; i < arrays.length; i++) {\n const a = arrays[i];\n abytes(a);\n sum += a.length;\n }\n const res = new Uint8Array(sum);\n for (let i = 0, pad = 0; i < arrays.length; i++) {\n const a = arrays[i];\n res.set(a, pad);\n pad += a.length;\n }\n return res;\n}\n\ntype EmptyObj = {};\nexport function checkOpts<T1 extends EmptyObj, T2 extends EmptyObj>(\n defaults: T1,\n opts?: T2\n): T1 & T2 {\n if (opts !== undefined && {}.toString.call(opts) !== '[object Object]')\n throw new Error('options should be object or undefined');\n const merged = Object.assign(defaults, opts);\n return merged as T1 & T2;\n}\n\n/** Hash interface. */\nexport type IHash = {\n (data: Uint8Array): Uint8Array;\n blockLen: number;\n outputLen: number;\n create: any;\n};\n\n/** For runtime check if class implements interface */\nexport abstract class Hash<T extends Hash<T>> {\n abstract blockLen: number; // Bytes per block\n abstract outputLen: number; // Bytes in output\n abstract update(buf: Input): this;\n // Writes digest into buf\n abstract digestInto(buf: Uint8Array): void;\n abstract digest(): Uint8Array;\n /**\n * Resets internal state. Makes Hash instance unusable.\n * Reset is impossible for keyed hashes if key is consumed into state. If digest is not consumed\n * by user, they will need to manually call `destroy()` when zeroing is necessary.\n */\n abstract destroy(): void;\n /**\n * Clones hash instance. Unsafe: doesn't check whether `to` is valid. Can be used as `clone()`\n * when no options are passed.\n * Reasons to use `_cloneInto` instead of clone: 1) performance 2) reuse instance => all internal\n * buffers are overwritten => causes buffer overwrite which is used for digest in some cases.\n * There are no guarantees for clean-up because it's impossible in JS.\n */\n abstract _cloneInto(to?: T): T;\n // Safe version that clones internal state\n abstract clone(): T;\n}\n\n/**\n * XOF: streaming API to read digest in chunks.\n * Same as 'squeeze' in keccak/k12 and 'seek' in blake3, but more generic name.\n * When hash used in XOF mode it is up to user to call '.destroy' afterwards, since we cannot\n * destroy state, next call can require more bytes.\n */\nexport type HashXOF<T extends Hash<T>> = Hash<T> & {\n xof(bytes: number): Uint8Array; // Read 'bytes' bytes from digest stream\n xofInto(buf: Uint8Array): Uint8Array; // read buf.length bytes from digest stream into buf\n};\n\n/** Hash function */\nexport type CHash = ReturnType<typeof createHasher>;\n/** Hash function with output */\nexport type CHashO = ReturnType<typeof createOptHasher>;\n/** XOF with output */\nexport type CHashXO = ReturnType<typeof createXOFer>;\n\n/** Wraps hash function, creating an interface on top of it */\nexport function createHasher<T extends Hash<T>>(\n hashCons: () => Hash<T>\n): {\n (msg: Input): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(): Hash<T>;\n} {\n const hashC = (msg: Input): Uint8Array => hashCons().update(toBytes(msg)).digest();\n const tmp = hashCons();\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = () => hashCons();\n return hashC;\n}\n\nexport function createOptHasher<H extends Hash<H>, T extends Object>(\n hashCons: (opts?: T) => Hash<H>\n): {\n (msg: Input, opts?: T): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(opts?: T): Hash<H>;\n} {\n const hashC = (msg: Input, opts?: T): Uint8Array => hashCons(opts).update(toBytes(msg)).digest();\n const tmp = hashCons({} as T);\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = (opts?: T) => hashCons(opts);\n return hashC;\n}\n\nexport function createXOFer<H extends HashXOF<H>, T extends Object>(\n hashCons: (opts?: T) => HashXOF<H>\n): {\n (msg: Input, opts?: T): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(opts?: T): HashXOF<H>;\n} {\n const hashC = (msg: Input, opts?: T): Uint8Array => hashCons(opts).update(toBytes(msg)).digest();\n const tmp = hashCons({} as T);\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = (opts?: T) => hashCons(opts);\n return hashC;\n}\nexport const wrapConstructor: typeof createHasher = createHasher;\nexport const wrapConstructorWithOpts: typeof createOptHasher = createOptHasher;\nexport const wrapXOFConstructorWithOpts: typeof createXOFer = createXOFer;\n\n/** Cryptographically secure PRNG. Uses internal OS-level `crypto.getRandomValues`. */\nexport function randomBytes(bytesLength = 32): Uint8Array {\n if (crypto && typeof crypto.getRandomValues === 'function') {\n return crypto.getRandomValues(new Uint8Array(bytesLength));\n }\n // Legacy Node.js compatibility\n if (crypto && typeof crypto.randomBytes === 'function') {\n return Uint8Array.from(crypto.randomBytes(bytesLength));\n }\n throw new Error('crypto.getRandomValues must be defined');\n}\n", "/**\n * Internal Merkle-Damgard hash utils.\n * @module\n */\nimport { type Input, Hash, abytes, aexists, aoutput, clean, createView, toBytes } from './utils.ts';\n\n/** Polyfill for Safari 14. https://caniuse.com/mdn-javascript_builtins_dataview_setbiguint64 */\nexport function setBigUint64(\n view: DataView,\n byteOffset: number,\n value: bigint,\n isLE: boolean\n): void {\n if (typeof view.setBigUint64 === 'function') return view.setBigUint64(byteOffset, value, isLE);\n const _32n = BigInt(32);\n const _u32_max = BigInt(0xffffffff);\n const wh = Number((value >> _32n) & _u32_max);\n const wl = Number(value & _u32_max);\n const h = isLE ? 4 : 0;\n const l = isLE ? 0 : 4;\n view.setUint32(byteOffset + h, wh, isLE);\n view.setUint32(byteOffset + l, wl, isLE);\n}\n\n/** Choice: a ? b : c */\nexport function Chi(a: number, b: number, c: number): number {\n return (a & b) ^ (~a & c);\n}\n\n/** Majority function, true if any two inputs is true. */\nexport function Maj(a: number, b: number, c: number): number {\n return (a & b) ^ (a & c) ^ (b & c);\n}\n\n/**\n * Merkle-Damgard hash construction base class.\n * Could be used to create MD5, RIPEMD, SHA1, SHA2.\n */\nexport abstract class HashMD<T extends HashMD<T>> extends Hash<T> {\n protected abstract process(buf: DataView, offset: number): void;\n protected abstract get(): number[];\n protected abstract set(...args: number[]): void;\n abstract destroy(): void;\n protected abstract roundClean(): void;\n\n readonly blockLen: number;\n readonly outputLen: number;\n readonly padOffset: number;\n readonly isLE: boolean;\n\n // For partial updates less than block size\n protected buffer: Uint8Array;\n protected view: DataView;\n protected finished = false;\n protected length = 0;\n protected pos = 0;\n protected destroyed = false;\n\n constructor(blockLen: number, outputLen: number, padOffset: number, isLE: boolean) {\n super();\n this.blockLen = blockLen;\n this.outputLen = outputLen;\n this.padOffset = padOffset;\n this.isLE = isLE;\n this.buffer = new Uint8Array(blockLen);\n this.view = createView(this.buffer);\n }\n update(data: Input): this {\n aexists(this);\n data = toBytes(data);\n abytes(data);\n const { view, buffer, blockLen } = this;\n const len = data.length;\n for (let pos = 0; pos < len; ) {\n const take = Math.min(blockLen - this.pos, len - pos);\n // Fast path: we have at least one block in input, cast it to view and process\n if (take === blockLen) {\n const dataView = createView(data);\n for (; blockLen <= len - pos; pos += blockLen) this.process(dataView, pos);\n continue;\n }\n buffer.set(data.subarray(pos, pos + take), this.pos);\n this.pos += take;\n pos += take;\n if (this.pos === blockLen) {\n this.process(view, 0);\n this.pos = 0;\n }\n }\n this.length += data.length;\n this.roundClean();\n return this;\n }\n digestInto(out: Uint8Array): void {\n aexists(this);\n aoutput(out, this);\n this.finished = true;\n // Padding\n // We can avoid allocation of buffer for padding completely if it\n // was previously not allocated here. But it won't change performance.\n const { buffer, view, blockLen, isLE } = this;\n let { pos } = this;\n // append the bit '1' to the message\n buffer[pos++] = 0b10000000;\n clean(this.buffer.subarray(pos));\n // we have less than padOffset left in buffer, so we cannot put length in\n // current block, need process it and pad again\n if (this.padOffset > blockLen - pos) {\n this.process(view, 0);\n pos = 0;\n }\n // Pad until full block byte with zeros\n for (let i = pos; i < blockLen; i++) buffer[i] = 0;\n // Note: sha512 requires length to be 128bit integer, but length in JS will overflow before that\n // You need to write around 2 exabytes (u64_max / 8 / (1024**6)) for this to happen.\n // So we just write lowest 64 bits of that value.\n setBigUint64(view, blockLen - 8, BigInt(this.length * 8), isLE);\n this.process(view, 0);\n const oview = createView(out);\n const len = this.outputLen;\n // NOTE: we do division by 4 later, which should be fused in single op with modulo by JIT\n if (len % 4) throw new Error('_sha2: outputLen should be aligned to 32bit');\n const outLen = len / 4;\n const state = this.get();\n if (outLen > state.length) throw new Error('_sha2: outputLen bigger than state');\n for (let i = 0; i < outLen; i++) oview.setUint32(4 * i, state[i], isLE);\n }\n digest(): Uint8Array {\n const { buffer, outputLen } = this;\n this.digestInto(buffer);\n const res = buffer.slice(0, outputLen);\n this.destroy();\n return res;\n }\n _cloneInto(to?: T): T {\n to ||= new (this.constructor as any)() as T;\n to.set(...this.get());\n const { blockLen, buffer, length, finished, destroyed, pos } = this;\n to.destroyed = destroyed;\n to.finished = finished;\n to.length = length;\n to.pos = pos;\n if (length % blockLen) to.buffer.set(buffer);\n return to;\n }\n clone(): T {\n return this._cloneInto();\n }\n}\n\n/**\n * Initial SHA-2 state: fractional parts of square roots of first 16 primes 2..53.\n * Check out `test/misc/sha2-gen-iv.js` for recomputation guide.\n */\n\n/** Initial SHA256 state. Bits 0..32 of frac part of sqrt of primes 2..19 */\nexport const SHA256_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0x6a09e667, 0xbb67ae85, 0x3c6ef372, 0xa54ff53a, 0x510e527f, 0x9b05688c, 0x1f83d9ab, 0x5be0cd19,\n]);\n\n/** Initial SHA224 state. Bits 32..64 of frac part of sqrt of primes 23..53 */\nexport const SHA224_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0xc1059ed8, 0x367cd507, 0x3070dd17, 0xf70e5939, 0xffc00b31, 0x68581511, 0x64f98fa7, 0xbefa4fa4,\n]);\n\n/** Initial SHA384 state. Bits 0..64 of frac part of sqrt of primes 23..53 */\nexport const SHA384_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0xcbbb9d5d, 0xc1059ed8, 0x629a292a, 0x367cd507, 0x9159015a, 0x3070dd17, 0x152fecd8, 0xf70e5939,\n 0x67332667, 0xffc00b31, 0x8eb44a87, 0x68581511, 0xdb0c2e0d, 0x64f98fa7, 0x47b5481d, 0xbefa4fa4,\n]);\n\n/** Initial SHA512 state. Bits 0..64 of frac part of sqrt of primes 2..19 */\nexport const SHA512_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0x6a09e667, 0xf3bcc908, 0xbb67ae85, 0x84caa73b, 0x3c6ef372, 0xfe94f82b, 0xa54ff53a, 0x5f1d36f1,\n 0x510e527f, 0xade682d1, 0x9b05688c, 0x2b3e6c1f, 0x1f83d9ab, 0xfb41bd6b, 0x5be0cd19, 0x137e2179,\n]);\n", "/**\n * SHA2 hash function. A.k.a. sha256, sha384, sha512, sha512_224, sha512_256.\n * SHA256 is the fastest hash implementable in JS, even faster than Blake3.\n * Check out [RFC 4634](https://datatracker.ietf.org/doc/html/rfc4634) and\n * [FIPS 180-4](https://nvlpubs.nist.gov/nistpubs/FIPS/NIST.FIPS.180-4.pdf).\n * @module\n */\nimport { Chi, HashMD, Maj, SHA224_IV, SHA256_IV, SHA384_IV, SHA512_IV } from './_md.ts';\nimport * as u64 from './_u64.ts';\nimport { type CHash, clean, createHasher, rotr } from './utils.ts';\n\n/**\n * Round constants:\n * First 32 bits of fractional parts of the cube roots of the first 64 primes 2..311)\n */\n// prettier-ignore\nconst SHA256_K = /* @__PURE__ */ Uint32Array.from([\n 0x428a2f98, 0x71374491, 0xb5c0fbcf, 0xe9b5dba5, 0x3956c25b, 0x59f111f1, 0x923f82a4, 0xab1c5ed5,\n 0xd807aa98, 0x12835b01, 0x243185be, 0x550c7dc3, 0x72be5d74, 0x80deb1fe, 0x9bdc06a7, 0xc19bf174,\n 0xe49b69c1, 0xefbe4786, 0x0fc19dc6, 0x240ca1cc, 0x2de92c6f, 0x4a7484aa, 0x5cb0a9dc, 0x76f988da,\n 0x983e5152, 0xa831c66d, 0xb00327c8, 0xbf597fc7, 0xc6e00bf3, 0xd5a79147, 0x06ca6351, 0x14292967,\n 0x27b70a85, 0x2e1b2138, 0x4d2c6dfc, 0x53380d13, 0x650a7354, 0x766a0abb, 0x81c2c92e, 0x92722c85,\n 0xa2bfe8a1, 0xa81a664b, 0xc24b8b70, 0xc76c51a3, 0xd192e819, 0xd6990624, 0xf40e3585, 0x106aa070,\n 0x19a4c116, 0x1e376c08, 0x2748774c, 0x34b0bcb5, 0x391c0cb3, 0x4ed8aa4a, 0x5b9cca4f, 0x682e6ff3,\n 0x748f82ee, 0x78a5636f, 0x84c87814, 0x8cc70208, 0x90befffa, 0xa4506ceb, 0xbef9a3f7, 0xc67178f2\n]);\n\n/** Reusable temporary buffer. \"W\" comes straight from spec. */\nconst SHA256_W = /* @__PURE__ */ new Uint32Array(64);\nexport class SHA256 extends HashMD<SHA256> {\n // We cannot use array here since array allows indexing by variable\n // which means optimizer/compiler cannot use registers.\n protected A: number = SHA256_IV[0] | 0;\n protected B: number = SHA256_IV[1] | 0;\n protected C: number = SHA256_IV[2] | 0;\n protected D: number = SHA256_IV[3] | 0;\n protected E: number = SHA256_IV[4] | 0;\n protected F: number = SHA256_IV[5] | 0;\n protected G: number = SHA256_IV[6] | 0;\n protected H: number = SHA256_IV[7] | 0;\n\n constructor(outputLen: number = 32) {\n super(64, outputLen, 8, false);\n }\n protected get(): [number, number, number, number, number, number, number, number] {\n const { A, B, C, D, E, F, G, H } = this;\n return [A, B, C, D, E, F, G, H];\n }\n // prettier-ignore\n protected set(\n A: number, B: number, C: number, D: number, E: number, F: number, G: number, H: number\n ): void {\n this.A = A | 0;\n this.B = B | 0;\n this.C = C | 0;\n this.D = D | 0;\n this.E = E | 0;\n this.F = F | 0;\n this.G = G | 0;\n this.H = H | 0;\n }\n protected process(view: DataView, offset: number): void {\n // Extend the first 16 words into the remaining 48 words w[16..63] of the message schedule array\n for (let i = 0; i < 16; i++, offset += 4) SHA256_W[i] = view.getUint32(offset, false);\n for (let i = 16; i < 64; i++) {\n const W15 = SHA256_W[i - 15];\n const W2 = SHA256_W[i - 2];\n const s0 = rotr(W15, 7) ^ rotr(W15, 18) ^ (W15 >>> 3);\n const s1 = rotr(W2, 17) ^ rotr(W2, 19) ^ (W2 >>> 10);\n SHA256_W[i] = (s1 + SHA256_W[i - 7] + s0 + SHA256_W[i - 16]) | 0;\n }\n // Compression function main loop, 64 rounds\n let { A, B, C, D, E, F, G, H } = this;\n for (let i = 0; i < 64; i++) {\n const sigma1 = rotr(E, 6) ^ rotr(E, 11) ^ rotr(E, 25);\n const T1 = (H + sigma1 + Chi(E, F, G) + SHA256_K[i] + SHA256_W[i]) | 0;\n const sigma0 = rotr(A, 2) ^ rotr(A, 13) ^ rotr(A, 22);\n const T2 = (sigma0 + Maj(A, B, C)) | 0;\n H = G;\n G = F;\n F = E;\n E = (D + T1) | 0;\n D = C;\n C = B;\n B = A;\n A = (T1 + T2) | 0;\n }\n // Add the compressed chunk to the current hash value\n A = (A + this.A) | 0;\n B = (B + this.B) | 0;\n C = (C + this.C) | 0;\n D = (D + this.D) | 0;\n E = (E + this.E) | 0;\n F = (F + this.F) | 0;\n G = (G + this.G) | 0;\n H = (H + this.H) | 0;\n this.set(A, B, C, D, E, F, G, H);\n }\n protected roundClean(): void {\n clean(SHA256_W);\n }\n destroy(): void {\n this.set(0, 0, 0, 0, 0, 0, 0, 0);\n clean(this.buffer);\n }\n}\n\nexport class SHA224 extends SHA256 {\n protected A: number = SHA224_IV[0] | 0;\n protected B: number = SHA224_IV[1] | 0;\n protected C: number = SHA224_IV[2] | 0;\n protected D: number = SHA224_IV[3] | 0;\n protected E: number = SHA224_IV[4] | 0;\n protected F: number = SHA224_IV[5] | 0;\n protected G: number = SHA224_IV[6] | 0;\n protected H: number = SHA224_IV[7] | 0;\n constructor() {\n super(28);\n }\n}\n\n// SHA2-512 is slower than sha256 in js because u64 operations are slow.\n\n// Round contants\n// First 32 bits of the fractional parts of the cube roots of the first 80 primes 2..409\n// prettier-ignore\nconst K512 = /* @__PURE__ */ (() => u64.split([\n '0x428a2f98d728ae22', '0x7137449123ef65cd', '0xb5c0fbcfec4d3b2f', '0xe9b5dba58189dbbc',\n '0x3956c25bf348b538', '0x59f111f1b605d019', '0x923f82a4af194f9b', '0xab1c5ed5da6d8118',\n '0xd807aa98a3030242', '0x12835b0145706fbe', '0x243185be4ee4b28c', '0x550c7dc3d5ffb4e2',\n '0x72be5d74f27b896f', '0x80deb1fe3b1696b1', '0x9bdc06a725c71235', '0xc19bf174cf692694',\n '0xe49b69c19ef14ad2', '0xefbe4786384f25e3', '0x0fc19dc68b8cd5b5', '0x240ca1cc77ac9c65',\n '0x2de92c6f592b0275', '0x4a7484aa6ea6e483', '0x5cb0a9dcbd41fbd4', '0x76f988da831153b5',\n '0x983e5152ee66dfab', '0xa831c66d2db43210', '0xb00327c898fb213f', '0xbf597fc7beef0ee4',\n '0xc6e00bf33da88fc2', '0xd5a79147930aa725', '0x06ca6351e003826f', '0x142929670a0e6e70',\n '0x27b70a8546d22ffc', '0x2e1b21385c26c926', '0x4d2c6dfc5ac42aed', '0x53380d139d95b3df',\n '0x650a73548baf63de', '0x766a0abb3c77b2a8', '0x81c2c92e47edaee6', '0x92722c851482353b',\n '0xa2bfe8a14cf10364', '0xa81a664bbc423001', '0xc24b8b70d0f89791', '0xc76c51a30654be30',\n '0xd192e819d6ef5218', '0xd69906245565a910', '0xf40e35855771202a', '0x106aa07032bbd1b8',\n '0x19a4c116b8d2d0c8', '0x1e376c085141ab53', '0x2748774cdf8eeb99', '0x34b0bcb5e19b48a8',\n '0x391c0cb3c5c95a63', '0x4ed8aa4ae3418acb', '0x5b9cca4f7763e373', '0x682e6ff3d6b2b8a3',\n '0x748f82ee5defb2fc', '0x78a5636f43172f60', '0x84c87814a1f0ab72', '0x8cc702081a6439ec',\n '0x90befffa23631e28', '0xa4506cebde82bde9', '0xbef9a3f7b2c67915', '0xc67178f2e372532b',\n '0xca273eceea26619c', '0xd186b8c721c0c207', '0xeada7dd6cde0eb1e', '0xf57d4f7fee6ed178',\n '0x06f067aa72176fba', '0x0a637dc5a2c898a6', '0x113f9804bef90dae', '0x1b710b35131c471b',\n '0x28db77f523047d84', '0x32caab7b40c72493', '0x3c9ebe0a15c9bebc', '0x431d67c49c100d4c',\n '0x4cc5d4becb3e42b6', '0x597f299cfc657e2a', '0x5fcb6fab3ad6faec', '0x6c44198c4a475817'\n].map(n => BigInt(n))))();\nconst SHA512_Kh = /* @__PURE__ */ (() => K512[0])();\nconst SHA512_Kl = /* @__PURE__ */ (() => K512[1])();\n\n// Reusable temporary buffers\nconst SHA512_W_H = /* @__PURE__ */ new Uint32Array(80);\nconst SHA512_W_L = /* @__PURE__ */ new Uint32Array(80);\n\nexport class SHA512 extends HashMD<SHA512> {\n // We cannot use array here since array allows indexing by variable\n // which means optimizer/compiler cannot use registers.\n // h -- high 32 bits, l -- low 32 bits\n protected Ah: number = SHA512_IV[0] | 0;\n protected Al: number = SHA512_IV[1] | 0;\n protected Bh: number = SHA512_IV[2] | 0;\n protected Bl: number = SHA512_IV[3] | 0;\n protected Ch: number = SHA512_IV[4] | 0;\n protected Cl: number = SHA512_IV[5] | 0;\n protected Dh: number = SHA512_IV[6] | 0;\n protected Dl: number = SHA512_IV[7] | 0;\n protected Eh: number = SHA512_IV[8] | 0;\n protected El: number = SHA512_IV[9] | 0;\n protected Fh: number = SHA512_IV[10] | 0;\n protected Fl: number = SHA512_IV[11] | 0;\n protected Gh: number = SHA512_IV[12] | 0;\n protected Gl: number = SHA512_IV[13] | 0;\n protected Hh: number = SHA512_IV[14] | 0;\n protected Hl: number = SHA512_IV[15] | 0;\n\n constructor(outputLen: number = 64) {\n super(128, outputLen, 16, false);\n }\n // prettier-ignore\n protected get(): [\n number, number, number, number, number, number, number, number,\n number, number, number, number, number, number, number, number\n ] {\n const { Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl } = this;\n return [Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl];\n }\n // prettier-ignore\n protected set(\n Ah: number, Al: number, Bh: number, Bl: number, Ch: number, Cl: number, Dh: number, Dl: number,\n Eh: number, El: number, Fh: number, Fl: number, Gh: number, Gl: number, Hh: number, Hl: number\n ): void {\n this.Ah = Ah | 0;\n this.Al = Al | 0;\n this.Bh = Bh | 0;\n this.Bl = Bl | 0;\n this.Ch = Ch | 0;\n this.Cl = Cl | 0;\n this.Dh = Dh | 0;\n this.Dl = Dl | 0;\n this.Eh = Eh | 0;\n this.El = El | 0;\n this.Fh = Fh | 0;\n this.Fl = Fl | 0;\n this.Gh = Gh | 0;\n this.Gl = Gl | 0;\n this.Hh = Hh | 0;\n this.Hl = Hl | 0;\n }\n protected process(view: DataView, offset: number): void {\n // Extend the first 16 words into the remaining 64 words w[16..79] of the message schedule array\n for (let i = 0; i < 16; i++, offset += 4) {\n SHA512_W_H[i] = view.getUint32(offset);\n SHA512_W_L[i] = view.getUint32((offset += 4));\n }\n for (let i = 16; i < 80; i++) {\n // s0 := (w[i-15] rightrotate 1) xor (w[i-15] rightrotate 8) xor (w[i-15] rightshift 7)\n const W15h = SHA512_W_H[i - 15] | 0;\n const W15l = SHA512_W_L[i - 15] | 0;\n const s0h = u64.rotrSH(W15h, W15l, 1) ^ u64.rotrSH(W15h, W15l, 8) ^ u64.shrSH(W15h, W15l, 7);\n const s0l = u64.rotrSL(W15h, W15l, 1) ^ u64.rotrSL(W15h, W15l, 8) ^ u64.shrSL(W15h, W15l, 7);\n // s1 := (w[i-2] rightrotate 19) xor (w[i-2] rightrotate 61) xor (w[i-2] rightshift 6)\n const W2h = SHA512_W_H[i - 2] | 0;\n const W2l = SHA512_W_L[i - 2] | 0;\n const s1h = u64.rotrSH(W2h, W2l, 19) ^ u64.rotrBH(W2h, W2l, 61) ^ u64.shrSH(W2h, W2l, 6);\n const s1l = u64.rotrSL(W2h, W2l, 19) ^ u64.rotrBL(W2h, W2l, 61) ^ u64.shrSL(W2h, W2l, 6);\n // SHA256_W[i] = s0 + s1 + SHA256_W[i - 7] + SHA256_W[i - 16];\n const SUMl = u64.add4L(s0l, s1l, SHA512_W_L[i - 7], SHA512_W_L[i - 16]);\n const SUMh = u64.add4H(SUMl, s0h, s1h, SHA512_W_H[i - 7], SHA512_W_H[i - 16]);\n SHA512_W_H[i] = SUMh | 0;\n SHA512_W_L[i] = SUMl | 0;\n }\n let { Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl } = this;\n // Compression function main loop, 80 rounds\n for (let i = 0; i < 80; i++) {\n // S1 := (e rightrotate 14) xor (e rightrotate 18) xor (e rightrotate 41)\n const sigma1h = u64.rotrSH(Eh, El, 14) ^ u64.rotrSH(Eh, El, 18) ^ u64.rotrBH(Eh, El, 41);\n const sigma1l = u64.rotrSL(Eh, El, 14) ^ u64.rotrSL(Eh, El, 18) ^ u64.rotrBL(Eh, El, 41);\n //const T1 = (H + sigma1 + Chi(E, F, G) + SHA256_K[i] + SHA256_W[i]) | 0;\n const CHIh = (Eh & Fh) ^ (~Eh & Gh);\n const CHIl = (El & Fl) ^ (~El & Gl);\n // T1 = H + sigma1 + Chi(E, F, G) + SHA512_K[i] + SHA512_W[i]\n // prettier-ignore\n const T1ll = u64.add5L(Hl, sigma1l, CHIl, SHA512_Kl[i], SHA512_W_L[i]);\n const T1h = u64.add5H(T1ll, Hh, sigma1h, CHIh, SHA512_Kh[i], SHA512_W_H[i]);\n const T1l = T1ll | 0;\n // S0 := (a rightrotate 28) xor (a rightrotate 34) xor (a rightrotate 39)\n const sigma0h = u64.rotrSH(Ah, Al, 28) ^ u64.rotrBH(Ah, Al, 34) ^ u64.rotrBH(Ah, Al, 39);\n const sigma0l = u64.rotrSL(Ah, Al, 28) ^ u64.rotrBL(Ah, Al, 34) ^ u64.rotrBL(Ah, Al, 39);\n const MAJh = (Ah & Bh) ^ (Ah & Ch) ^ (Bh & Ch);\n const MAJl = (Al & Bl) ^ (Al & Cl) ^ (Bl & Cl);\n Hh = Gh | 0;\n Hl = Gl | 0;\n Gh = Fh | 0;\n Gl = Fl | 0;\n Fh = Eh | 0;\n Fl = El | 0;\n ({ h: Eh, l: El } = u64.add(Dh | 0, Dl | 0, T1h | 0, T1l | 0));\n Dh = Ch | 0;\n Dl = Cl | 0;\n Ch = Bh | 0;\n Cl = Bl | 0;\n Bh = Ah | 0;\n Bl = Al | 0;\n const All = u64.add3L(T1l, sigma0l, MAJl);\n Ah = u64.add3H(All, T1h, sigma0h, MAJh);\n Al = All | 0;\n }\n // Add the compressed chunk to the current hash value\n ({ h: Ah, l: Al } = u64.add(this.Ah | 0, this.Al | 0, Ah | 0, Al | 0));\n ({ h: Bh, l: Bl } = u64.add(this.Bh | 0, this.Bl | 0, Bh | 0, Bl | 0));\n ({ h: Ch, l: Cl } = u64.add(this.Ch | 0, this.Cl | 0, Ch | 0, Cl | 0));\n ({ h: Dh, l: Dl } = u64.add(this.Dh | 0, this.Dl | 0, Dh | 0, Dl | 0));\n ({ h: Eh, l: El } = u64.add(this.Eh | 0, this.El | 0, Eh | 0, El | 0));\n ({ h: Fh, l: Fl } = u64.add(this.Fh | 0, this.Fl | 0, Fh | 0, Fl | 0));\n ({ h: Gh, l: Gl } = u64.add(this.Gh | 0, this.Gl | 0, Gh | 0, Gl | 0));\n ({ h: Hh, l: Hl } = u64.add(this.Hh | 0, this.Hl | 0, Hh | 0, Hl | 0));\n this.set(Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl);\n }\n protected roundClean(): void {\n clean(SHA512_W_H, SHA512_W_L);\n }\n destroy(): void {\n clean(this.buffer);\n this.set(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0);\n }\n}\n\nexport class SHA384 extends SHA512 {\n protected Ah: number = SHA384_IV[0] | 0;\n protected Al: number = SHA384_IV[1] | 0;\n protected Bh: number = SHA384_IV[2] | 0;\n protected Bl: number = SHA384_IV[3] | 0;\n protected Ch: number = SHA384_IV[4] | 0;\n protected Cl: number = SHA384_IV[5] | 0;\n protected Dh: number = SHA384_IV[6] | 0;\n protected Dl: number = SHA384_IV[7] | 0;\n protected Eh: number = SHA384_IV[8] | 0;\n protected El: number = SHA384_IV[9] | 0;\n protected Fh: number = SHA384_IV[10] | 0;\n protected Fl: number = SHA384_IV[11] | 0;\n protected Gh: number = SHA384_IV[12] | 0;\n protected Gl: number = SHA384_IV[13] | 0;\n protected Hh: number = SHA384_IV[14] | 0;\n protected Hl: number = SHA384_IV[15] | 0;\n\n constructor() {\n super(48);\n }\n}\n\n/**\n * Truncated SHA512/256 and SHA512/224.\n * SHA512_IV is XORed with 0xa5a5a5a5a5a5a5a5, then used as \"intermediary\" IV of SHA512/t.\n * Then t hashes string to produce result IV.\n * See `test/misc/sha2-gen-iv.js`.\n */\n\n/** SHA512/224 IV */\nconst T224_IV = /* @__PURE__ */ Uint32Array.from([\n 0x8c3d37c8, 0x19544da2, 0x73e19966, 0x89dcd4d6, 0x1dfab7ae, 0x32ff9c82, 0x679dd514, 0x582f9fcf,\n 0x0f6d2b69, 0x7bd44da8, 0x77e36f73, 0x04c48942, 0x3f9d85a8, 0x6a1d36c8, 0x1112e6ad, 0x91d692a1,\n]);\n\n/** SHA512/256 IV */\nconst T256_IV = /* @__PURE__ */ Uint32Array.from([\n 0x22312194, 0xfc2bf72c, 0x9f555fa3, 0xc84c64c2, 0x2393b86b, 0x6f53b151, 0x96387719, 0x5940eabd,\n 0x96283ee2, 0xa88effe3, 0xbe5e1e25, 0x53863992, 0x2b0199fc, 0x2c85b8aa, 0x0eb72ddc, 0x81c52ca2,\n]);\n\nexport class SHA512_224 extends SHA512 {\n protected Ah: number = T224_IV[0] | 0;\n protected Al: number = T224_IV[1] | 0;\n protected Bh: number = T224_IV[2] | 0;\n protected Bl: number = T224_IV[3] | 0;\n protected Ch: number = T224_IV[4] | 0;\n protected Cl: number = T224_IV[5] | 0;\n protected Dh: number = T224_IV[6] | 0;\n protected Dl: number = T224_IV[7] | 0;\n protected Eh: number = T224_IV[8] | 0;\n protected El: number = T224_IV[9] | 0;\n protected Fh: number = T224_IV[10] | 0;\n protected Fl: number = T224_IV[11] | 0;\n protected Gh: number = T224_IV[12] | 0;\n protected Gl: number = T224_IV[13] | 0;\n protected Hh: number = T224_IV[14] | 0;\n protected Hl: number = T224_IV[15] | 0;\n\n constructor() {\n super(28);\n }\n}\n\nexport class SHA512_256 extends SHA512 {\n protected Ah: number = T256_IV[0] | 0;\n protected Al: number = T256_IV[1] | 0;\n protected Bh: number = T256_IV[2] | 0;\n protected Bl: number = T256_IV[3] | 0;\n protected Ch: number = T256_IV[4] | 0;\n protected Cl: number = T256_IV[5] | 0;\n protected Dh: number = T256_IV[6] | 0;\n protected Dl: number = T256_IV[7] | 0;\n protected Eh: number = T256_IV[8] | 0;\n protected El: number = T256_IV[9] | 0;\n protected Fh: number = T256_IV[10] | 0;\n protected Fl: number = T256_IV[11] | 0;\n protected Gh: number = T256_IV[12] | 0;\n protected Gl: number = T256_IV[13] | 0;\n protected Hh: number = T256_IV[14] | 0;\n protected Hl: number = T256_IV[15] | 0;\n\n constructor() {\n super(32);\n }\n}\n\n/**\n * SHA2-256 hash function from RFC 4634.\n *\n * It is the fastest JS hash, even faster than Blake3.\n * To break sha256 using birthday attack, attackers need to try 2^128 hashes.\n * BTC network is doing 2^70 hashes/sec (2^95 hashes/year) as per 2025.\n */\nexport const sha256: CHash = /* @__PURE__ */ createHasher(() => new SHA256());\n/** SHA2-224 hash function from RFC 4634 */\nexport const sha224: CHash = /* @__PURE__ */ createHasher(() => new SHA224());\n\n/** SHA2-512 hash function from RFC 4634. */\nexport const sha512: CHash = /* @__PURE__ */ createHasher(() => new SHA512());\n/** SHA2-384 hash function from RFC 4634. */\nexport const sha384: CHash = /* @__PURE__ */ createHasher(() => new SHA384());\n\n/**\n * SHA2-512/256 \"truncated\" hash function, with improved resistance to length extension attacks.\n * See the paper on [truncated SHA512](https://eprint.iacr.org/2010/548.pdf).\n */\nexport const sha512_256: CHash = /* @__PURE__ */ createHasher(() => new SHA512_256());\n/**\n * SHA2-512/224 \"truncated\" hash function, with improved resistance to length extension attacks.\n * See the paper on [truncated SHA512](https://eprint.iacr.org/2010/548.pdf).\n */\nexport const sha512_224: CHash = /* @__PURE__ */ createHasher(() => new SHA512_224());\n", "import crypto from 'node:crypto'\nimport { secp256k1 as secp } from '@noble/curves/secp256k1'\nimport { SigningError, VerificationError } from '../../errors.js'\nimport type { AbortOptions } from '@libp2p/interface'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nconst PUBLIC_KEY_BYTE_LENGTH = 33\nconst PRIVATE_KEY_BYTE_LENGTH = 32\n\nexport { PUBLIC_KEY_BYTE_LENGTH as publicKeyLength }\nexport { PRIVATE_KEY_BYTE_LENGTH as privateKeyLength }\n\n/**\n * Hash and sign message with private key\n */\nexport function hashAndSign (key: Uint8Array, msg: Uint8Array | Uint8ArrayList, options?: AbortOptions): Uint8Array {\n options?.signal?.throwIfAborted()\n\n const hash = crypto.createHash('sha256')\n\n if (msg instanceof Uint8Array) {\n hash.update(msg)\n } else {\n for (const buf of msg) {\n hash.update(buf)\n }\n }\n\n const digest = hash.digest()\n\n try {\n const signature = secp.sign(digest, key)\n return signature.toDERRawBytes()\n } catch (err) {\n throw new SigningError(String(err))\n }\n}\n\n/**\n * Hash message and verify signature with public key\n */\nexport function hashAndVerify (key: Uint8Array, sig: Uint8Array, msg: Uint8Array | Uint8ArrayList, options?: AbortOptions): boolean {\n options?.signal?.throwIfAborted()\n const hash = crypto.createHash('sha256')\n\n if (msg instanceof Uint8Array) {\n hash.update(msg)\n } else {\n for (const buf of msg) {\n hash.update(buf)\n }\n }\n\n const digest = hash.digest()\n\n try {\n return secp.verify(sig, digest, key)\n } catch (err) {\n throw new VerificationError(String(err))\n }\n}\n", "/**\n * HMAC: RFC2104 message authentication code.\n * @module\n */\nimport { abytes, aexists, ahash, clean, Hash, toBytes, type CHash, type Input } from './utils.ts';\n\nexport class HMAC<T extends Hash<T>> extends Hash<HMAC<T>> {\n oHash: T;\n iHash: T;\n blockLen: number;\n outputLen: number;\n private finished = false;\n private destroyed = false;\n\n constructor(hash: CHash, _key: Input) {\n super();\n ahash(hash);\n const key = toBytes(_key);\n this.iHash = hash.create() as T;\n if (typeof this.iHash.update !== 'function')\n throw new Error('Expected instance of class which extends utils.Hash');\n this.blockLen = this.iHash.blockLen;\n this.outputLen = this.iHash.outputLen;\n const blockLen = this.blockLen;\n const pad = new Uint8Array(blockLen);\n // blockLen can be bigger than outputLen\n pad.set(key.length > blockLen ? hash.create().update(key).digest() : key);\n for (let i = 0; i < pad.length; i++) pad[i] ^= 0x36;\n this.iHash.update(pad);\n // By doing update (processing of first block) of outer hash here we can re-use it between multiple calls via clone\n this.oHash = hash.create() as T;\n // Undo internal XOR && apply outer XOR\n for (let i = 0; i < pad.length; i++) pad[i] ^= 0x36 ^ 0x5c;\n this.oHash.update(pad);\n clean(pad);\n }\n update(buf: Input): this {\n aexists(this);\n this.iHash.update(buf);\n return this;\n }\n digestInto(out: Uint8Array): void {\n aexists(this);\n abytes(out, this.outputLen);\n this.finished = true;\n this.iHash.digestInto(out);\n this.oHash.update(out);\n this.oHash.digestInto(out);\n this.destroy();\n }\n digest(): Uint8Array {\n const out = new Uint8Array(this.oHash.outputLen);\n this.digestInto(out);\n return out;\n }\n _cloneInto(to?: HMAC<T>): HMAC<T> {\n // Create new instance without calling constructor since key already in state and we don't know it.\n to ||= Object.create(Object.getPrototypeOf(this), {});\n const { oHash, iHash, finished, destroyed, blockLen, outputLen } = this;\n to = to as this;\n to.finished = finished;\n to.destroyed = destroyed;\n to.blockLen = blockLen;\n to.outputLen = outputLen;\n to.oHash = oHash._cloneInto(to.oHash);\n to.iHash = iHash._cloneInto(to.iHash);\n return to;\n }\n clone(): HMAC<T> {\n return this._cloneInto();\n }\n destroy(): void {\n this.destroyed = true;\n this.oHash.destroy();\n this.iHash.destroy();\n }\n}\n\n/**\n * HMAC: RFC2104 message authentication code.\n * @param hash - function that would be used e.g. sha256\n * @param key - message key\n * @param message - message data\n * @example\n * import { hmac } from '@noble/hashes/hmac';\n * import { sha256 } from '@noble/hashes/sha2';\n * const mac1 = hmac(sha256, 'key', 'message');\n */\nexport const hmac: {\n (hash: CHash, key: Input, message: Input): Uint8Array;\n create(hash: CHash, key: Input): HMAC<any>;\n} = (hash: CHash, key: Input, message: Input): Uint8Array =>\n new HMAC<any>(hash, key).update(message).digest();\nhmac.create = (hash: CHash, key: Input) => new HMAC<any>(hash, key);\n", "/**\n * Hex, bytes and number utilities.\n * @module\n */\n/*! noble-curves - MIT License (c) 2022 Paul Miller (paulmillr.com) */\nimport {\n abytes as abytes_,\n bytesToHex as bytesToHex_,\n concatBytes as concatBytes_,\n hexToBytes as hexToBytes_,\n isBytes as isBytes_,\n} from '@noble/hashes/utils.js';\nexport {\n abytes,\n anumber,\n bytesToHex,\n bytesToUtf8,\n concatBytes,\n hexToBytes,\n isBytes,\n randomBytes,\n utf8ToBytes,\n} from '@noble/hashes/utils.js';\nconst _0n = /* @__PURE__ */ BigInt(0);\nconst _1n = /* @__PURE__ */ BigInt(1);\nexport type Hex = Uint8Array | string; // hex strings are accepted for simplicity\nexport type PrivKey = Hex | bigint; // bigints are accepted to ease learning curve\nexport type CHash = {\n (message: Uint8Array | string): Uint8Array;\n blockLen: number;\n outputLen: number;\n create(opts?: { dkLen?: number }): any; // For shake\n};\nexport type FHash = (message: Uint8Array | string) => Uint8Array;\n\nexport function abool(title: string, value: boolean): void {\n if (typeof value !== 'boolean') throw new Error(title + ' boolean expected, got ' + value);\n}\n\n// tmp name until v2\nexport function _abool2(value: boolean, title: string = ''): boolean {\n if (typeof value !== 'boolean') {\n const prefix = title && `\"${title}\"`;\n throw new Error(prefix + 'expected boolean, got type=' + typeof value);\n }\n return value;\n}\n\n// tmp name until v2\n/** Asserts something is Uint8Array. */\nexport function _abytes2(value: Uint8Array, length?: number, title: string = ''): Uint8Array {\n const bytes = isBytes_(value);\n const len = value?.length;\n const needsLen = length !== undefined;\n if (!bytes || (needsLen && len !== length)) {\n const prefix = title && `\"${title}\" `;\n const ofLen = needsLen ? ` of length ${length}` : '';\n const got = bytes ? `length=${len}` : `type=${typeof value}`;\n throw new Error(prefix + 'expected Uint8Array' + ofLen + ', got ' + got);\n }\n return value;\n}\n\n// Used in weierstrass, der\nexport function numberToHexUnpadded(num: number | bigint): string {\n const hex = num.toString(16);\n return hex.length & 1 ? '0' + hex : hex;\n}\n\nexport function hexToNumber(hex: string): bigint {\n if (typeof hex !== 'string') throw new Error('hex string expected, got ' + typeof hex);\n return hex === '' ? _0n : BigInt('0x' + hex); // Big Endian\n}\n\n// BE: Big Endian, LE: Little Endian\nexport function bytesToNumberBE(bytes: Uint8Array): bigint {\n return hexToNumber(bytesToHex_(bytes));\n}\nexport function bytesToNumberLE(bytes: Uint8Array): bigint {\n abytes_(bytes);\n return hexToNumber(bytesToHex_(Uint8Array.from(bytes).reverse()));\n}\n\nexport function numberToBytesBE(n: number | bigint, len: number): Uint8Array {\n return hexToBytes_(n.toString(16).padStart(len * 2, '0'));\n}\nexport function numberToBytesLE(n: number | bigint, len: number): Uint8Array {\n return numberToBytesBE(n, len).reverse();\n}\n// Unpadded, rarely used\nexport function numberToVarBytesBE(n: number | bigint): Uint8Array {\n return hexToBytes_(numberToHexUnpadded(n));\n}\n\n/**\n * Takes hex string or Uint8Array, converts to Uint8Array.\n * Validates output length.\n * Will throw error for other types.\n * @param title descriptive title for an error e.g. 'secret key'\n * @param hex hex string or Uint8Array\n * @param expectedLength optional, will compare to result array's length\n * @returns\n */\nexport function ensureBytes(title: string, hex: Hex, expectedLength?: number): Uint8Array {\n let res: Uint8Array;\n if (typeof hex === 'string') {\n try {\n res = hexToBytes_(hex);\n } catch (e) {\n throw new Error(title + ' must be hex string or Uint8Array, cause: ' + e);\n }\n } else if (isBytes_(hex)) {\n // Uint8Array.from() instead of hash.slice() because node.js Buffer\n // is instance of Uint8Array, and its slice() creates **mutable** copy\n res = Uint8Array.from(hex);\n } else {\n throw new Error(title + ' must be hex string or Uint8Array');\n }\n const len = res.length;\n if (typeof expectedLength === 'number' && len !== expectedLength)\n throw new Error(title + ' of length ' + expectedLength + ' expected, got ' + len);\n return res;\n}\n\n// Compares 2 u8a-s in kinda constant time\nexport function equalBytes(a: Uint8Array, b: Uint8Array): boolean {\n if (a.length !== b.length) return false;\n let diff = 0;\n for (let i = 0; i < a.length; i++) diff |= a[i] ^ b[i];\n return diff === 0;\n}\n/**\n * Copies Uint8Array. We can't use u8a.slice(), because u8a can be Buffer,\n * and Buffer#slice creates mutable copy. Never use Buffers!\n */\nexport function copyBytes(bytes: Uint8Array): Uint8Array {\n return Uint8Array.from(bytes);\n}\n\n/**\n * Decodes 7-bit ASCII string to Uint8Array, throws on non-ascii symbols\n * Should be safe to use for things expected to be ASCII.\n * Returns exact same result as utf8ToBytes for ASCII or throws.\n */\nexport function asciiToBytes(ascii: string): Uint8Array {\n return Uint8Array.from(ascii, (c, i) => {\n const charCode = c.charCodeAt(0);\n if (c.length !== 1 || charCode > 127) {\n throw new Error(\n `string contains non-ASCII character \"${ascii[i]}\" with code ${charCode} at position ${i}`\n );\n }\n return charCode;\n });\n}\n\n/**\n * @example utf8ToBytes('abc') // new Uint8Array([97, 98, 99])\n */\n// export const utf8ToBytes: typeof utf8ToBytes_ = utf8ToBytes_;\n/**\n * Converts bytes to string using UTF8 encoding.\n * @example bytesToUtf8(Uint8Array.from([97, 98, 99])) // 'abc'\n */\n// export const bytesToUtf8: typeof bytesToUtf8_ = bytesToUtf8_;\n\n// Is positive bigint\nconst isPosBig = (n: bigint) => typeof n === 'bigint' && _0n <= n;\n\nexport function inRange(n: bigint, min: bigint, max: bigint): boolean {\n return isPosBig(n) && isPosBig(min) && isPosBig(max) && min <= n && n < max;\n}\n\n/**\n * Asserts min <= n < max. NOTE: It's < max and not <= max.\n * @example\n * aInRange('x', x, 1n, 256n); // would assume x is in (1n..255n)\n */\nexport function aInRange(title: string, n: bigint, min: bigint, max: bigint): void {\n // Why min <= n < max and not a (min < n < max) OR b (min <= n <= max)?\n // consider P=256n, min=0n, max=P\n // - a for min=0 would require -1: `inRange('x', x, -1n, P)`\n // - b would commonly require subtraction: `inRange('x', x, 0n, P - 1n)`\n // - our way is the cleanest: `inRange('x', x, 0n, P)\n if (!inRange(n, min, max))\n throw new Error('expected valid ' + title + ': ' + min + ' <= n < ' + max + ', got ' + n);\n}\n\n// Bit operations\n\n/**\n * Calculates amount of bits in a bigint.\n * Same as `n.toString(2).length`\n * TODO: merge with nLength in modular\n */\nexport function bitLen(n: bigint): number {\n let len;\n for (len = 0; n > _0n; n >>= _1n, len += 1);\n return len;\n}\n\n/**\n * Gets single bit at position.\n * NOTE: first bit position is 0 (same as arrays)\n * Same as `!!+Array.from(n.toString(2)).reverse()[pos]`\n */\nexport function bitGet(n: bigint, pos: number): bigint {\n return (n >> BigInt(pos)) & _1n;\n}\n\n/**\n * Sets single bit at position.\n */\nexport function bitSet(n: bigint, pos: number, value: boolean): bigint {\n return n | ((value ? _1n : _0n) << BigInt(pos));\n}\n\n/**\n * Calculate mask for N bits. Not using ** operator with bigints because of old engines.\n * Same as BigInt(`0b${Array(i).fill('1').join('')}`)\n */\nexport const bitMask = (n: number): bigint => (_1n << BigInt(n)) - _1n;\n\n// DRBG\n\ntype Pred<T> = (v: Uint8Array) => T | undefined;\n/**\n * Minimal HMAC-DRBG from NIST 800-90 for RFC6979 sigs.\n * @returns function that will call DRBG until 2nd arg returns something meaningful\n * @example\n * const drbg = createHmacDRBG<Key>(32, 32, hmac);\n * drbg(seed, bytesToKey); // bytesToKey must return Key or undefined\n */\nexport function createHmacDrbg<T>(\n hashLen: number,\n qByteLen: number,\n hmacFn: (key: Uint8Array, ...messages: Uint8Array[]) => Uint8Array\n): (seed: Uint8Array, predicate: Pred<T>) => T {\n if (typeof hashLen !== 'number' || hashLen < 2) throw new Error('hashLen must be a number');\n if (typeof qByteLen !== 'number' || qByteLen < 2) throw new Error('qByteLen must be a number');\n if (typeof hmacFn !== 'function') throw new Error('hmacFn must be a function');\n // Step B, Step C: set hashLen to 8*ceil(hlen/8)\n const u8n = (len: number) => new Uint8Array(len); // creates Uint8Array\n const u8of = (byte: number) => Uint8Array.of(byte); // another shortcut\n let v = u8n(hashLen); // Minimal non-full-spec HMAC-DRBG from NIST 800-90 for RFC6979 sigs.\n let k = u8n(hashLen); // Steps B and C of RFC6979 3.2: set hashLen, in our case always same\n let i = 0; // Iterations counter, will throw when over 1000\n const reset = () => {\n v.fill(1);\n k.fill(0);\n i = 0;\n };\n const h = (...b: Uint8Array[]) => hmacFn(k, v, ...b); // hmac(k)(v, ...values)\n const reseed = (seed = u8n(0)) => {\n // HMAC-DRBG reseed() function. Steps D-G\n k = h(u8of(0x00), seed); // k = hmac(k || v || 0x00 || seed)\n v = h(); // v = hmac(k || v)\n if (seed.length === 0) return;\n k = h(u8of(0x01), seed); // k = hmac(k || v || 0x01 || seed)\n v = h(); // v = hmac(k || v)\n };\n const gen = () => {\n // HMAC-DRBG generate() function\n if (i++ >= 1000) throw new Error('drbg: tried 1000 values');\n let len = 0;\n const out: Uint8Array[] = [];\n while (len < qByteLen) {\n v = h();\n const sl = v.slice();\n out.push(sl);\n len += v.length;\n }\n return concatBytes_(...out);\n };\n const genUntil = (seed: Uint8Array, pred: Pred<T>): T => {\n reset();\n reseed(seed); // Steps D-G\n let res: T | undefined = undefined; // Step H: grind until k is in [1..n-1]\n while (!(res = pred(gen()))) reseed();\n reset();\n return res;\n };\n return genUntil;\n}\n\n// Validating curves and fields\n\nconst validatorFns = {\n bigint: (val: any): boolean => typeof val === 'bigint',\n function: (val: any): boolean => typeof val === 'function',\n boolean: (val: any): boolean => typeof val === 'boolean',\n string: (val: any): boolean => typeof val === 'string',\n stringOrUint8Array: (val: any): boolean => typeof val === 'string' || isBytes_(val),\n isSafeInteger: (val: any): boolean => Number.isSafeInteger(val),\n array: (val: any): boolean => Array.isArray(val),\n field: (val: any, object: any): any => (object as any).Fp.isValid(val),\n hash: (val: any): boolean => typeof val === 'function' && Number.isSafeInteger(val.outputLen),\n} as const;\ntype Validator = keyof typeof validatorFns;\ntype ValMap<T extends Record<string, any>> = { [K in keyof T]?: Validator };\n// type Record<K extends string | number | symbol, T> = { [P in K]: T; }\n\nexport function validateObject<T extends Record<string, any>>(\n object: T,\n validators: ValMap<T>,\n optValidators: ValMap<T> = {}\n): T {\n const checkField = (fieldName: keyof T, type: Validator, isOptional: boolean) => {\n const checkVal = validatorFns[type];\n if (typeof checkVal !== 'function') throw new Error('invalid validator function');\n\n const val = object[fieldName as keyof typeof object];\n if (isOptional && val === undefined) return;\n if (!checkVal(val, object)) {\n throw new Error(\n 'param ' + String(fieldName) + ' is invalid. Expected ' + type + ', got ' + val\n );\n }\n };\n for (const [fieldName, type] of Object.entries(validators)) checkField(fieldName, type!, false);\n for (const [fieldName, type] of Object.entries(optValidators)) checkField(fieldName, type!, true);\n return object;\n}\n// validate type tests\n// const o: { a: number; b: number; c: number } = { a: 1, b: 5, c: 6 };\n// const z0 = validateObject(o, { a: 'isSafeInteger' }, { c: 'bigint' }); // Ok!\n// // Should fail type-check\n// const z1 = validateObject(o, { a: 'tmp' }, { c: 'zz' });\n// const z2 = validateObject(o, { a: 'isSafeInteger' }, { c: 'zz' });\n// const z3 = validateObject(o, { test: 'boolean', z: 'bug' });\n// const z4 = validateObject(o, { a: 'boolean', z: 'bug' });\n\nexport function isHash(val: CHash): boolean {\n return typeof val === 'function' && Number.isSafeInteger(val.outputLen);\n}\nexport function _validateObject(\n object: Record<string, any>,\n fields: Record<string, string>,\n optFields: Record<string, string> = {}\n): void {\n if (!object || typeof object !== 'object') throw new Error('expected valid options object');\n type Item = keyof typeof object;\n function checkField(fieldName: Item, expectedType: string, isOpt: boolean) {\n const val = object[fieldName];\n if (isOpt && val === undefined) return;\n const current = typeof val;\n if (current !== expectedType || val === null)\n throw new Error(`param \"${fieldName}\" is invalid: expected ${expectedType}, got ${current}`);\n }\n Object.entries(fields).forEach(([k, v]) => checkField(k, v, false));\n Object.entries(optFields).forEach(([k, v]) => checkField(k, v, true));\n}\n\n/**\n * throws not implemented error\n */\nexport const notImplemented = (): never => {\n throw new Error('not implemented');\n};\n\n/**\n * Memoizes (caches) computation result.\n * Uses WeakMap: the value is going auto-cleaned by GC after last reference is removed.\n */\nexport function memoized<T extends object, R, O extends any[]>(\n fn: (arg: T, ...args: O) => R\n): (arg: T, ...args: O) => R {\n const map = new WeakMap<T, R>();\n return (arg: T, ...args: O): R => {\n const val = map.get(arg);\n if (val !== undefined) return val;\n const computed = fn(arg, ...args);\n map.set(arg, computed);\n return computed;\n };\n}\n", "/**\n * Utils for modular division and fields.\n * Field over 11 is a finite (Galois) field is integer number operations `mod 11`.\n * There is no division: it is replaced by modular multiplicative inverse.\n * @module\n */\n/*! noble-curves - MIT License (c) 2022 Paul Miller (paulmillr.com) */\nimport {\n _validateObject,\n anumber,\n bitMask,\n bytesToNumberBE,\n bytesToNumberLE,\n ensureBytes,\n numberToBytesBE,\n numberToBytesLE,\n} from '../utils.ts';\n\n// prettier-ignore\nconst _0n = BigInt(0), _1n = BigInt(1), _2n = /* @__PURE__ */ BigInt(2), _3n = /* @__PURE__ */ BigInt(3);\n// prettier-ignore\nconst _4n = /* @__PURE__ */ BigInt(4), _5n = /* @__PURE__ */ BigInt(5), _7n = /* @__PURE__ */ BigInt(7);\n// prettier-ignore\nconst _8n = /* @__PURE__ */ BigInt(8), _9n = /* @__PURE__ */ BigInt(9), _16n = /* @__PURE__ */ BigInt(16);\n\n// Calculates a modulo b\nexport function mod(a: bigint, b: bigint): bigint {\n const result = a % b;\n return result >= _0n ? result : b + result;\n}\n/**\n * Efficiently raise num to power and do modular division.\n * Unsafe in some contexts: uses ladder, so can expose bigint bits.\n * @example\n * pow(2n, 6n, 11n) // 64n % 11n == 9n\n */\nexport function pow(num: bigint, power: bigint, modulo: bigint): bigint {\n return FpPow(Field(modulo), num, power);\n}\n\n/** Does `x^(2^power)` mod p. `pow2(30, 4)` == `30^(2^4)` */\nexport function pow2(x: bigint, power: bigint, modulo: bigint): bigint {\n let res = x;\n while (power-- > _0n) {\n res *= res;\n res %= modulo;\n }\n return res;\n}\n\n/**\n * Inverses number over modulo.\n * Implemented using [Euclidean GCD](https://brilliant.org/wiki/extended-euclidean-algorithm/).\n */\nexport function invert(number: bigint, modulo: bigint): bigint {\n if (number === _0n) throw new Error('invert: expected non-zero number');\n if (modulo <= _0n) throw new Error('invert: expected positive modulus, got ' + modulo);\n // Fermat's little theorem \"CT-like\" version inv(n) = n^(m-2) mod m is 30x slower.\n let a = mod(number, modulo);\n let b = modulo;\n // prettier-ignore\n let x = _0n, y = _1n, u = _1n, v = _0n;\n while (a !== _0n) {\n // JIT applies optimization if those two lines follow each other\n const q = b / a;\n const r = b % a;\n const m = x - u * q;\n const n = y - v * q;\n // prettier-ignore\n b = a, a = r, x = u, y = v, u = m, v = n;\n }\n const gcd = b;\n if (gcd !== _1n) throw new Error('invert: does not exist');\n return mod(x, modulo);\n}\n\nfunction assertIsSquare<T>(Fp: IField<T>, root: T, n: T): void {\n if (!Fp.eql(Fp.sqr(root), n)) throw new Error('Cannot find square root');\n}\n\n// Not all roots are possible! Example which will throw:\n// const NUM =\n// n = 72057594037927816n;\n// Fp = Field(BigInt('0x1a0111ea397fe69a4b1ba7b6434bacd764774b84f38512bf6730d2a0f6b0f6241eabfffeb153ffffb9feffffffffaaab'));\nfunction sqrt3mod4<T>(Fp: IField<T>, n: T) {\n const p1div4 = (Fp.ORDER + _1n) / _4n;\n const root = Fp.pow(n, p1div4);\n assertIsSquare(Fp, root, n);\n return root;\n}\n\nfunction sqrt5mod8<T>(Fp: IField<T>, n: T) {\n const p5div8 = (Fp.ORDER - _5n) / _8n;\n const n2 = Fp.mul(n, _2n);\n const v = Fp.pow(n2, p5div8);\n const nv = Fp.mul(n, v);\n const i = Fp.mul(Fp.mul(nv, _2n), v);\n const root = Fp.mul(nv, Fp.sub(i, Fp.ONE));\n assertIsSquare(Fp, root, n);\n return root;\n}\n\n// Based on RFC9380, Kong algorithm\n// prettier-ignore\nfunction sqrt9mod16(P: bigint): <T>(Fp: IField<T>, n: T) => T {\n const Fp_ = Field(P);\n const tn = tonelliShanks(P);\n const c1 = tn(Fp_, Fp_.neg(Fp_.ONE));// 1. c1 = sqrt(-1) in F, i.e., (c1^2) == -1 in F\n const c2 = tn(Fp_, c1); // 2. c2 = sqrt(c1) in F, i.e., (c2^2) == c1 in F\n const c3 = tn(Fp_, Fp_.neg(c1)); // 3. c3 = sqrt(-c1) in F, i.e., (c3^2) == -c1 in F\n const c4 = (P + _7n) / _16n; // 4. c4 = (q + 7) / 16 # Integer arithmetic\n return <T>(Fp: IField<T>, n: T) => {\n let tv1 = Fp.pow(n, c4); // 1. tv1 = x^c4\n let tv2 = Fp.mul(tv1, c1); // 2. tv2 = c1 * tv1\n const tv3 = Fp.mul(tv1, c2); // 3. tv3 = c2 * tv1\n const tv4 = Fp.mul(tv1, c3); // 4. tv4 = c3 * tv1\n const e1 = Fp.eql(Fp.sqr(tv2), n); // 5. e1 = (tv2^2) == x\n const e2 = Fp.eql(Fp.sqr(tv3), n); // 6. e2 = (tv3^2) == x\n tv1 = Fp.cmov(tv1, tv2, e1); // 7. tv1 = CMOV(tv1, tv2, e1) # Select tv2 if (tv2^2) == x\n tv2 = Fp.cmov(tv4, tv3, e2); // 8. tv2 = CMOV(tv4, tv3, e2) # Select tv3 if (tv3^2) == x\n const e3 = Fp.eql(Fp.sqr(tv2), n); // 9. e3 = (tv2^2) == x\n const root = Fp.cmov(tv1, tv2, e3);// 10. z = CMOV(tv1, tv2, e3) # Select sqrt from tv1 & tv2\n assertIsSquare(Fp, root, n);\n return root;\n };\n}\n\n/**\n * Tonelli-Shanks square root search algorithm.\n * 1. https://eprint.iacr.org/2012/685.pdf (page 12)\n * 2. Square Roots from 1; 24, 51, 10 to Dan Shanks\n * @param P field order\n * @returns function that takes field Fp (created from P) and number n\n */\nexport function tonelliShanks(P: bigint): <T>(Fp: IField<T>, n: T) => T {\n // Initialization (precomputation).\n // Caching initialization could boost perf by 7%.\n if (P < _3n) throw new Error('sqrt is not defined for small field');\n // Factor P - 1 = Q * 2^S, where Q is odd\n let Q = P - _1n;\n let S = 0;\n while (Q % _2n === _0n) {\n Q /= _2n;\n S++;\n }\n\n // Find the first quadratic non-residue Z >= 2\n let Z = _2n;\n const _Fp = Field(P);\n while (FpLegendre(_Fp, Z) === 1) {\n // Basic primality test for P. After x iterations, chance of\n // not finding quadratic non-residue is 2^x, so 2^1000.\n if (Z++ > 1000) throw new Error('Cannot find square root: probably non-prime P');\n }\n // Fast-path; usually done before Z, but we do \"primality test\".\n if (S === 1) return sqrt3mod4;\n\n // Slow-path\n // TODO: test on Fp2 and others\n let cc = _Fp.pow(Z, Q); // c = z^Q\n const Q1div2 = (Q + _1n) / _2n;\n return function tonelliSlow<T>(Fp: IField<T>, n: T): T {\n if (Fp.is0(n)) return n;\n // Check if n is a quadratic residue using Legendre symbol\n if (FpLegendre(Fp, n) !== 1) throw new Error('Cannot find square root');\n\n // Initialize variables for the main loop\n let M = S;\n let c = Fp.mul(Fp.ONE, cc); // c = z^Q, move cc from field _Fp into field Fp\n let t = Fp.pow(n, Q); // t = n^Q, first guess at the fudge factor\n let R = Fp.pow(n, Q1div2); // R = n^((Q+1)/2), first guess at the square root\n\n // Main loop\n // while t != 1\n while (!Fp.eql(t, Fp.ONE)) {\n if (Fp.is0(t)) return Fp.ZERO; // if t=0 return R=0\n let i = 1;\n\n // Find the smallest i >= 1 such that t^(2^i) \u2261 1 (mod P)\n let t_tmp = Fp.sqr(t); // t^(2^1)\n while (!Fp.eql(t_tmp, Fp.ONE)) {\n i++;\n t_tmp = Fp.sqr(t_tmp); // t^(2^2)...\n if (i === M) throw new Error('Cannot find square root');\n }\n\n // Calculate the exponent for b: 2^(M - i - 1)\n const exponent = _1n << BigInt(M - i - 1); // bigint is important\n const b = Fp.pow(c, exponent); // b = 2^(M - i - 1)\n\n // Update variables\n M = i;\n c = Fp.sqr(b); // c = b^2\n t = Fp.mul(t, c); // t = (t * b^2)\n R = Fp.mul(R, b); // R = R*b\n }\n return R;\n };\n}\n\n/**\n * Square root for a finite field. Will try optimized versions first:\n *\n * 1. P \u2261 3 (mod 4)\n * 2. P \u2261 5 (mod 8)\n * 3. P \u2261 9 (mod 16)\n * 4. Tonelli-Shanks algorithm\n *\n * Different algorithms can give different roots, it is up to user to decide which one they want.\n * For example there is FpSqrtOdd/FpSqrtEven to choice root based on oddness (used for hash-to-curve).\n */\nexport function FpSqrt(P: bigint): <T>(Fp: IField<T>, n: T) => T {\n // P \u2261 3 (mod 4) => \u221An = n^((P+1)/4)\n if (P % _4n === _3n) return sqrt3mod4;\n // P \u2261 5 (mod 8) => Atkin algorithm, page 10 of https://eprint.iacr.org/2012/685.pdf\n if (P % _8n === _5n) return sqrt5mod8;\n // P \u2261 9 (mod 16) => Kong algorithm, page 11 of https://eprint.iacr.org/2012/685.pdf (algorithm 4)\n if (P % _16n === _9n) return sqrt9mod16(P);\n // Tonelli-Shanks algorithm\n return tonelliShanks(P);\n}\n\n// Little-endian check for first LE bit (last BE bit);\nexport const isNegativeLE = (num: bigint, modulo: bigint): boolean =>\n (mod(num, modulo) & _1n) === _1n;\n\n/** Field is not always over prime: for example, Fp2 has ORDER(q)=p^m. */\nexport interface IField<T> {\n ORDER: bigint;\n isLE: boolean;\n BYTES: number;\n BITS: number;\n MASK: bigint;\n ZERO: T;\n ONE: T;\n // 1-arg\n create: (num: T) => T;\n isValid: (num: T) => boolean;\n is0: (num: T) => boolean;\n isValidNot0: (num: T) => boolean;\n neg(num: T): T;\n inv(num: T): T;\n sqrt(num: T): T;\n sqr(num: T): T;\n // 2-args\n eql(lhs: T, rhs: T): boolean;\n add(lhs: T, rhs: T): T;\n sub(lhs: T, rhs: T): T;\n mul(lhs: T, rhs: T | bigint): T;\n pow(lhs: T, power: bigint): T;\n div(lhs: T, rhs: T | bigint): T;\n // N for NonNormalized (for now)\n addN(lhs: T, rhs: T): T;\n subN(lhs: T, rhs: T): T;\n mulN(lhs: T, rhs: T | bigint): T;\n sqrN(num: T): T;\n\n // Optional\n // Should be same as sgn0 function in\n // [RFC9380](https://www.rfc-editor.org/rfc/rfc9380#section-4.1).\n // NOTE: sgn0 is 'negative in LE', which is same as odd. And negative in LE is kinda strange definition anyway.\n isOdd?(num: T): boolean; // Odd instead of even since we have it for Fp2\n allowedLengths?: number[];\n // legendre?(num: T): T;\n invertBatch: (lst: T[]) => T[];\n toBytes(num: T): Uint8Array;\n fromBytes(bytes: Uint8Array, skipValidation?: boolean): T;\n // If c is False, CMOV returns a, otherwise it returns b.\n cmov(a: T, b: T, c: boolean): T;\n}\n// prettier-ignore\nconst FIELD_FIELDS = [\n 'create', 'isValid', 'is0', 'neg', 'inv', 'sqrt', 'sqr',\n 'eql', 'add', 'sub', 'mul', 'pow', 'div',\n 'addN', 'subN', 'mulN', 'sqrN'\n] as const;\nexport function validateField<T>(field: IField<T>): IField<T> {\n const initial = {\n ORDER: 'bigint',\n MASK: 'bigint',\n BYTES: 'number',\n BITS: 'number',\n } as Record<string, string>;\n const opts = FIELD_FIELDS.reduce((map, val: string) => {\n map[val] = 'function';\n return map;\n }, initial);\n _validateObject(field, opts);\n // const max = 16384;\n // if (field.BYTES < 1 || field.BYTES > max) throw new Error('invalid field');\n // if (field.BITS < 1 || field.BITS > 8 * max) throw new Error('invalid field');\n return field;\n}\n\n// Generic field functions\n\n/**\n * Same as `pow` but for Fp: non-constant-time.\n * Unsafe in some contexts: uses ladder, so can expose bigint bits.\n */\nexport function FpPow<T>(Fp: IField<T>, num: T, power: bigint): T {\n if (power < _0n) throw new Error('invalid exponent, negatives unsupported');\n if (power === _0n) return Fp.ONE;\n if (power === _1n) return num;\n let p = Fp.ONE;\n let d = num;\n while (power > _0n) {\n if (power & _1n) p = Fp.mul(p, d);\n d = Fp.sqr(d);\n power >>= _1n;\n }\n return p;\n}\n\n/**\n * Efficiently invert an array of Field elements.\n * Exception-free. Will return `undefined` for 0 elements.\n * @param passZero map 0 to 0 (instead of undefined)\n */\nexport function FpInvertBatch<T>(Fp: IField<T>, nums: T[], passZero = false): T[] {\n const inverted = new Array(nums.length).fill(passZero ? Fp.ZERO : undefined);\n // Walk from first to last, multiply them by each other MOD p\n const multipliedAcc = nums.reduce((acc, num, i) => {\n if (Fp.is0(num)) return acc;\n inverted[i] = acc;\n return Fp.mul(acc, num);\n }, Fp.ONE);\n // Invert last element\n const invertedAcc = Fp.inv(multipliedAcc);\n // Walk from last to first, multiply them by inverted each other MOD p\n nums.reduceRight((acc, num, i) => {\n if (Fp.is0(num)) return acc;\n inverted[i] = Fp.mul(acc, inverted[i]);\n return Fp.mul(acc, num);\n }, invertedAcc);\n return inverted;\n}\n\n// TODO: remove\nexport function FpDiv<T>(Fp: IField<T>, lhs: T, rhs: T | bigint): T {\n return Fp.mul(lhs, typeof rhs === 'bigint' ? invert(rhs, Fp.ORDER) : Fp.inv(rhs));\n}\n\n/**\n * Legendre symbol.\n * Legendre constant is used to calculate Legendre symbol (a | p)\n * which denotes the value of a^((p-1)/2) (mod p).\n *\n * * (a | p) \u2261 1 if a is a square (mod p), quadratic residue\n * * (a | p) \u2261 -1 if a is not a square (mod p), quadratic non residue\n * * (a | p) \u2261 0 if a \u2261 0 (mod p)\n */\nexport function FpLegendre<T>(Fp: IField<T>, n: T): -1 | 0 | 1 {\n // We can use 3rd argument as optional cache of this value\n // but seems unneeded for now. The operation is very fast.\n const p1mod2 = (Fp.ORDER - _1n) / _2n;\n const powered = Fp.pow(n, p1mod2);\n const yes = Fp.eql(powered, Fp.ONE);\n const zero = Fp.eql(powered, Fp.ZERO);\n const no = Fp.eql(powered, Fp.neg(Fp.ONE));\n if (!yes && !zero && !no) throw new Error('invalid Legendre symbol result');\n return yes ? 1 : zero ? 0 : -1;\n}\n\n// This function returns True whenever the value x is a square in the field F.\nexport function FpIsSquare<T>(Fp: IField<T>, n: T): boolean {\n const l = FpLegendre(Fp, n);\n return l === 1;\n}\n\nexport type NLength = { nByteLength: number; nBitLength: number };\n// CURVE.n lengths\nexport function nLength(n: bigint, nBitLength?: number): NLength {\n // Bit size, byte size of CURVE.n\n if (nBitLength !== undefined) anumber(nBitLength);\n const _nBitLength = nBitLength !== undefined ? nBitLength : n.toString(2).length;\n const nByteLength = Math.ceil(_nBitLength / 8);\n return { nBitLength: _nBitLength, nByteLength };\n}\n\ntype FpField = IField<bigint> & Required<Pick<IField<bigint>, 'isOdd'>>;\ntype SqrtFn = (n: bigint) => bigint;\ntype FieldOpts = Partial<{\n sqrt: SqrtFn;\n isLE: boolean;\n BITS: number;\n modFromBytes: boolean; // bls12-381 requires mod(n) instead of rejecting keys >= n\n allowedLengths?: readonly number[]; // for P521 (adds padding for smaller sizes)\n}>;\n/**\n * Creates a finite field. Major performance optimizations:\n * * 1. Denormalized operations like mulN instead of mul.\n * * 2. Identical object shape: never add or remove keys.\n * * 3. `Object.freeze`.\n * Fragile: always run a benchmark on a change.\n * Security note: operations don't check 'isValid' for all elements for performance reasons,\n * it is caller responsibility to check this.\n * This is low-level code, please make sure you know what you're doing.\n *\n * Note about field properties:\n * * CHARACTERISTIC p = prime number, number of elements in main subgroup.\n * * ORDER q = similar to cofactor in curves, may be composite `q = p^m`.\n *\n * @param ORDER field order, probably prime, or could be composite\n * @param bitLen how many bits the field consumes\n * @param isLE (default: false) if encoding / decoding should be in little-endian\n * @param redef optional faster redefinitions of sqrt and other methods\n */\nexport function Field(\n ORDER: bigint,\n bitLenOrOpts?: number | FieldOpts, // TODO: use opts only in v2?\n isLE = false,\n opts: { sqrt?: SqrtFn } = {}\n): Readonly<FpField> {\n if (ORDER <= _0n) throw new Error('invalid field: expected ORDER > 0, got ' + ORDER);\n let _nbitLength: number | undefined = undefined;\n let _sqrt: SqrtFn | undefined = undefined;\n let modFromBytes: boolean = false;\n let allowedLengths: undefined | readonly number[] = undefined;\n if (typeof bitLenOrOpts === 'object' && bitLenOrOpts != null) {\n if (opts.sqrt || isLE) throw new Error('cannot specify opts in two arguments');\n const _opts = bitLenOrOpts;\n if (_opts.BITS) _nbitLength = _opts.BITS;\n if (_opts.sqrt) _sqrt = _opts.sqrt;\n if (typeof _opts.isLE === 'boolean') isLE = _opts.isLE;\n if (typeof _opts.modFromBytes === 'boolean') modFromBytes = _opts.modFromBytes;\n allowedLengths = _opts.allowedLengths;\n } else {\n if (typeof bitLenOrOpts === 'number') _nbitLength = bitLenOrOpts;\n if (opts.sqrt) _sqrt = opts.sqrt;\n }\n const { nBitLength: BITS, nByteLength: BYTES } = nLength(ORDER, _nbitLength);\n if (BYTES > 2048) throw new Error('invalid field: expected ORDER of <= 2048 bytes');\n let sqrtP: ReturnType<typeof FpSqrt>; // cached sqrtP\n const f: Readonly<FpField> = Object.freeze({\n ORDER,\n isLE,\n BITS,\n BYTES,\n MASK: bitMask(BITS),\n ZERO: _0n,\n ONE: _1n,\n allowedLengths: allowedLengths,\n create: (num) => mod(num, ORDER),\n isValid: (num) => {\n if (typeof num !== 'bigint')\n throw new Error('invalid field element: expected bigint, got ' + typeof num);\n return _0n <= num && num < ORDER; // 0 is valid element, but it's not invertible\n },\n is0: (num) => num === _0n,\n // is valid and invertible\n isValidNot0: (num: bigint) => !f.is0(num) && f.isValid(num),\n isOdd: (num) => (num & _1n) === _1n,\n neg: (num) => mod(-num, ORDER),\n eql: (lhs, rhs) => lhs === rhs,\n\n sqr: (num) => mod(num * num, ORDER),\n add: (lhs, rhs) => mod(lhs + rhs, ORDER),\n sub: (lhs, rhs) => mod(lhs - rhs, ORDER),\n mul: (lhs, rhs) => mod(lhs * rhs, ORDER),\n pow: (num, power) => FpPow(f, num, power),\n div: (lhs, rhs) => mod(lhs * invert(rhs, ORDER), ORDER),\n\n // Same as above, but doesn't normalize\n sqrN: (num) => num * num,\n addN: (lhs, rhs) => lhs + rhs,\n subN: (lhs, rhs) => lhs - rhs,\n mulN: (lhs, rhs) => lhs * rhs,\n\n inv: (num) => invert(num, ORDER),\n sqrt:\n _sqrt ||\n ((n) => {\n if (!sqrtP) sqrtP = FpSqrt(ORDER);\n return sqrtP(f, n);\n }),\n toBytes: (num) => (isLE ? numberToBytesLE(num, BYTES) : numberToBytesBE(num, BYTES)),\n fromBytes: (bytes, skipValidation = true) => {\n if (allowedLengths) {\n if (!allowedLengths.includes(bytes.length) || bytes.length > BYTES) {\n throw new Error(\n 'Field.fromBytes: expected ' + allowedLengths + ' bytes, got ' + bytes.length\n );\n }\n const padded = new Uint8Array(BYTES);\n // isLE add 0 to right, !isLE to the left.\n padded.set(bytes, isLE ? 0 : padded.length - bytes.length);\n bytes = padded;\n }\n if (bytes.length !== BYTES)\n throw new Error('Field.fromBytes: expected ' + BYTES + ' bytes, got ' + bytes.length);\n let scalar = isLE ? bytesToNumberLE(bytes) : bytesToNumberBE(bytes);\n if (modFromBytes) scalar = mod(scalar, ORDER);\n if (!skipValidation)\n if (!f.isValid(scalar)) throw new Error('invalid field element: outside of range 0..ORDER');\n // NOTE: we don't validate scalar here, please use isValid. This done such way because some\n // protocol may allow non-reduced scalar that reduced later or changed some other way.\n return scalar;\n },\n // TODO: we don't need it here, move out to separate fn\n invertBatch: (lst) => FpInvertBatch(f, lst),\n // We can't move this out because Fp6, Fp12 implement it\n // and it's unclear what to return in there.\n cmov: (a, b, c) => (c ? b : a),\n } as FpField);\n return Object.freeze(f);\n}\n\n// Generic random scalar, we can do same for other fields if via Fp2.mul(Fp2.ONE, Fp2.random)?\n// This allows unsafe methods like ignore bias or zero. These unsafe, but often used in different protocols (if deterministic RNG).\n// which mean we cannot force this via opts.\n// Not sure what to do with randomBytes, we can accept it inside opts if wanted.\n// Probably need to export getMinHashLength somewhere?\n// random(bytes?: Uint8Array, unsafeAllowZero = false, unsafeAllowBias = false) {\n// const LEN = !unsafeAllowBias ? getMinHashLength(ORDER) : BYTES;\n// if (bytes === undefined) bytes = randomBytes(LEN); // _opts.randomBytes?\n// const num = isLE ? bytesToNumberLE(bytes) : bytesToNumberBE(bytes);\n// // `mod(x, 11)` can sometimes produce 0. `mod(x, 10) + 1` is the same, but no 0\n// const reduced = unsafeAllowZero ? mod(num, ORDER) : mod(num, ORDER - _1n) + _1n;\n// return reduced;\n// },\n\nexport function FpSqrtOdd<T>(Fp: IField<T>, elm: T): T {\n if (!Fp.isOdd) throw new Error(\"Field doesn't have isOdd\");\n const root = Fp.sqrt(elm);\n return Fp.isOdd(root) ? root : Fp.neg(root);\n}\n\nexport function FpSqrtEven<T>(Fp: IField<T>, elm: T): T {\n if (!Fp.isOdd) throw new Error(\"Field doesn't have isOdd\");\n const root = Fp.sqrt(elm);\n return Fp.isOdd(root) ? Fp.neg(root) : root;\n}\n\n/**\n * \"Constant-time\" private key generation utility.\n * Same as mapKeyToField, but accepts less bytes (40 instead of 48 for 32-byte field).\n * Which makes it slightly more biased, less secure.\n * @deprecated use `mapKeyToField` instead\n */\nexport function hashToPrivateScalar(\n hash: string | Uint8Array,\n groupOrder: bigint,\n isLE = false\n): bigint {\n hash = ensureBytes('privateHash', hash);\n const hashLen = hash.length;\n const minLen = nLength(groupOrder).nByteLength + 8;\n if (minLen < 24 || hashLen < minLen || hashLen > 1024)\n throw new Error(\n 'hashToPrivateScalar: expected ' + minLen + '-1024 bytes of input, got ' + hashLen\n );\n const num = isLE ? bytesToNumberLE(hash) : bytesToNumberBE(hash);\n return mod(num, groupOrder - _1n) + _1n;\n}\n\n/**\n * Returns total number of bytes consumed by the field element.\n * For example, 32 bytes for usual 256-bit weierstrass curve.\n * @param fieldOrder number of field elements, usually CURVE.n\n * @returns byte length of field\n */\nexport function getFieldBytesLength(fieldOrder: bigint): number {\n if (typeof fieldOrder !== 'bigint') throw new Error('field order must be bigint');\n const bitLength = fieldOrder.toString(2).length;\n return Math.ceil(bitLength / 8);\n}\n\n/**\n * Returns minimal amount of bytes that can be safely reduced\n * by field order.\n * Should be 2^-128 for 128-bit curve such as P256.\n * @param fieldOrder number of field elements, usually CURVE.n\n * @returns byte length of target hash\n */\nexport function getMinHashLength(fieldOrder: bigint): number {\n const length = getFieldBytesLength(fieldOrder);\n return length + Math.ceil(length / 2);\n}\n\n/**\n * \"Constant-time\" private key generation utility.\n * Can take (n + n/2) or more bytes of uniform input e.g. from CSPRNG or KDF\n * and convert them into private scalar, with the modulo bias being negligible.\n * Needs at least 48 bytes of input for 32-byte private key.\n * https://research.kudelskisecurity.com/2020/07/28/the-definitive-guide-to-modulo-bias-and-how-to-avoid-it/\n * FIPS 186-5, A.2 https://csrc.nist.gov/publications/detail/fips/186/5/final\n * RFC 9380, https://www.rfc-editor.org/rfc/rfc9380#section-5\n * @param hash hash output from SHA3 or a similar function\n * @param groupOrder size of subgroup - (e.g. secp256k1.CURVE.n)\n * @param isLE interpret hash bytes as LE num\n * @returns valid private scalar\n */\nexport function mapHashToField(key: Uint8Array, fieldOrder: bigint, isLE = false): Uint8Array {\n const len = key.length;\n const fieldLen = getFieldBytesLength(fieldOrder);\n const minLen = getMinHashLength(fieldOrder);\n // No small numbers: need to understand bias story. No huge numbers: easier to detect JS timings.\n if (len < 16 || len < minLen || len > 1024)\n throw new Error('expected ' + minLen + '-1024 bytes of input, got ' + len);\n const num = isLE ? bytesToNumberLE(key) : bytesToNumberBE(key);\n // `mod(x, 11)` can sometimes produce 0. `mod(x, 10) + 1` is the same, but no 0\n const reduced = mod(num, fieldOrder - _1n) + _1n;\n return isLE ? numberToBytesLE(reduced, fieldLen) : numberToBytesBE(reduced, fieldLen);\n}\n", "/**\n * Methods for elliptic curve multiplication by scalars.\n * Contains wNAF, pippenger.\n * @module\n */\n/*! noble-curves - MIT License (c) 2022 Paul Miller (paulmillr.com) */\nimport { bitLen, bitMask, validateObject } from '../utils.ts';\nimport { Field, FpInvertBatch, nLength, validateField, type IField } from './modular.ts';\n\nconst _0n = BigInt(0);\nconst _1n = BigInt(1);\n\nexport type AffinePoint<T> = {\n x: T;\n y: T;\n} & { Z?: never };\n\n// This was initialy do this way to re-use montgomery ladder in field (add->mul,double->sqr), but\n// that didn't happen and there is probably not much reason to have separate Group like this?\nexport interface Group<T extends Group<T>> {\n double(): T;\n negate(): T;\n add(other: T): T;\n subtract(other: T): T;\n equals(other: T): boolean;\n multiply(scalar: bigint): T;\n toAffine?(invertedZ?: any): AffinePoint<any>;\n}\n\n// We can't \"abstract out\" coordinates (X, Y, Z; and T in Edwards): argument names of constructor\n// are not accessible. See Typescript gh-56093, gh-41594.\n//\n// We have to use recursive types, so it will return actual point, not constained `CurvePoint`.\n// If, at any point, P is `any`, it will erase all types and replace it\n// with `any`, because of recursion, `any implements CurvePoint`,\n// but we lose all constrains on methods.\n\n/** Base interface for all elliptic curve Points. */\nexport interface CurvePoint<F, P extends CurvePoint<F, P>> extends Group<P> {\n /** Affine x coordinate. Different from projective / extended X coordinate. */\n x: F;\n /** Affine y coordinate. Different from projective / extended Y coordinate. */\n y: F;\n Z?: F;\n double(): P;\n negate(): P;\n add(other: P): P;\n subtract(other: P): P;\n equals(other: P): boolean;\n multiply(scalar: bigint): P;\n assertValidity(): void;\n clearCofactor(): P;\n is0(): boolean;\n isTorsionFree(): boolean;\n isSmallOrder(): boolean;\n multiplyUnsafe(scalar: bigint): P;\n /**\n * Massively speeds up `p.multiply(n)` by using precompute tables (caching). See {@link wNAF}.\n * @param isLazy calculate cache now. Default (true) ensures it's deferred to first `multiply()`\n */\n precompute(windowSize?: number, isLazy?: boolean): P;\n /** Converts point to 2D xy affine coordinates */\n toAffine(invertedZ?: F): AffinePoint<F>;\n toBytes(): Uint8Array;\n toHex(): string;\n}\n\n/** Base interface for all elliptic curve Point constructors. */\nexport interface CurvePointCons<P extends CurvePoint<any, P>> {\n [Symbol.hasInstance]: (item: unknown) => boolean;\n BASE: P;\n ZERO: P;\n /** Field for basic curve math */\n Fp: IField<P_F<P>>;\n /** Scalar field, for scalars in multiply and others */\n Fn: IField<bigint>;\n /** Creates point from x, y. Does NOT validate if the point is valid. Use `.assertValidity()`. */\n fromAffine(p: AffinePoint<P_F<P>>): P;\n fromBytes(bytes: Uint8Array): P;\n fromHex(hex: Uint8Array | string): P;\n}\n\n// Type inference helpers: PC - PointConstructor, P - Point, Fp - Field element\n// Short names, because we use them a lot in result types:\n// * we can't do 'P = GetCurvePoint<PC>': this is default value and doesn't constrain anything\n// * we can't do 'type X = GetCurvePoint<PC>': it won't be accesible for arguments/return types\n// * `CurvePointCons<P extends CurvePoint<any, P>>` constraints from interface definition\n// won't propagate, if `PC extends CurvePointCons<any>`: the P would be 'any', which is incorrect\n// * PC could be super specific with super specific P, which implements CurvePoint<any, P>.\n// this means we need to do stuff like\n// `function test<P extends CurvePoint<any, P>, PC extends CurvePointCons<P>>(`\n// if we want type safety around P, otherwise PC_P<PC> will be any\n\n/** Returns Fp type from Point (P_F<P> == P.F) */\nexport type P_F<P extends CurvePoint<any, P>> = P extends CurvePoint<infer F, P> ? F : never;\n/** Returns Fp type from PointCons (PC_F<PC> == PC.P.F) */\nexport type PC_F<PC extends CurvePointCons<CurvePoint<any, any>>> = PC['Fp']['ZERO'];\n/** Returns Point type from PointCons (PC_P<PC> == PC.P) */\nexport type PC_P<PC extends CurvePointCons<CurvePoint<any, any>>> = PC['ZERO'];\n\n// Ugly hack to get proper type inference, because in typescript fails to infer resursively.\n// The hack allows to do up to 10 chained operations without applying type erasure.\n//\n// Types which won't work:\n// * `CurvePointCons<CurvePoint<any, any>>`, will return `any` after 1 operation\n// * `CurvePointCons<any>: WeierstrassPointCons<bigint> extends CurvePointCons<any> = false`\n// * `P extends CurvePoint, PC extends CurvePointCons<P>`\n// * It can't infer P from PC alone\n// * Too many relations between F, P & PC\n// * It will infer P/F if `arg: CurvePointCons<F, P>`, but will fail if PC is generic\n// * It will work correctly if there is an additional argument of type P\n// * But generally, we don't want to parametrize `CurvePointCons` over `F`: it will complicate\n// types, making them un-inferable\n// prettier-ignore\nexport type PC_ANY = CurvePointCons<\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any, any>\n >>>>>>>>>\n>;\n\nexport interface CurveLengths {\n secretKey?: number;\n publicKey?: number;\n publicKeyUncompressed?: number;\n publicKeyHasPrefix?: boolean;\n signature?: number;\n seed?: number;\n}\nexport type GroupConstructor<T> = {\n BASE: T;\n ZERO: T;\n};\n/** @deprecated */\nexport type ExtendedGroupConstructor<T> = GroupConstructor<T> & {\n Fp: IField<any>;\n Fn: IField<bigint>;\n fromAffine(ap: AffinePoint<any>): T;\n};\nexport type Mapper<T> = (i: T[]) => T[];\n\nexport function negateCt<T extends { negate: () => T }>(condition: boolean, item: T): T {\n const neg = item.negate();\n return condition ? neg : item;\n}\n\n/**\n * Takes a bunch of Projective Points but executes only one\n * inversion on all of them. Inversion is very slow operation,\n * so this improves performance massively.\n * Optimization: converts a list of projective points to a list of identical points with Z=1.\n */\nexport function normalizeZ<P extends CurvePoint<any, P>, PC extends CurvePointCons<P>>(\n c: PC,\n points: P[]\n): P[] {\n const invertedZs = FpInvertBatch(\n c.Fp,\n points.map((p) => p.Z!)\n );\n return points.map((p, i) => c.fromAffine(p.toAffine(invertedZs[i])));\n}\n\nfunction validateW(W: number, bits: number) {\n if (!Number.isSafeInteger(W) || W <= 0 || W > bits)\n throw new Error('invalid window size, expected [1..' + bits + '], got W=' + W);\n}\n\n/** Internal wNAF opts for specific W and scalarBits */\nexport type WOpts = {\n windows: number;\n windowSize: number;\n mask: bigint;\n maxNumber: number;\n shiftBy: bigint;\n};\n\nfunction calcWOpts(W: number, scalarBits: number): WOpts {\n validateW(W, scalarBits);\n const windows = Math.ceil(scalarBits / W) + 1; // W=8 33. Not 32, because we skip zero\n const windowSize = 2 ** (W - 1); // W=8 128. Not 256, because we skip zero\n const maxNumber = 2 ** W; // W=8 256\n const mask = bitMask(W); // W=8 255 == mask 0b11111111\n const shiftBy = BigInt(W); // W=8 8\n return { windows, windowSize, mask, maxNumber, shiftBy };\n}\n\nfunction calcOffsets(n: bigint, window: number, wOpts: WOpts) {\n const { windowSize, mask, maxNumber, shiftBy } = wOpts;\n let wbits = Number(n & mask); // extract W bits.\n let nextN = n >> shiftBy; // shift number by W bits.\n\n // What actually happens here:\n // const highestBit = Number(mask ^ (mask >> 1n));\n // let wbits2 = wbits - 1; // skip zero\n // if (wbits2 & highestBit) { wbits2 ^= Number(mask); // (~);\n\n // split if bits > max: +224 => 256-32\n if (wbits > windowSize) {\n // we skip zero, which means instead of `>= size-1`, we do `> size`\n wbits -= maxNumber; // -32, can be maxNumber - wbits, but then we need to set isNeg here.\n nextN += _1n; // +256 (carry)\n }\n const offsetStart = window * windowSize;\n const offset = offsetStart + Math.abs(wbits) - 1; // -1 because we skip zero\n const isZero = wbits === 0; // is current window slice a 0?\n const isNeg = wbits < 0; // is current window slice negative?\n const isNegF = window % 2 !== 0; // fake random statement for noise\n const offsetF = offsetStart; // fake offset for noise\n return { nextN, offset, isZero, isNeg, isNegF, offsetF };\n}\n\nfunction validateMSMPoints(points: any[], c: any) {\n if (!Array.isArray(points)) throw new Error('array expected');\n points.forEach((p, i) => {\n if (!(p instanceof c)) throw new Error('invalid point at index ' + i);\n });\n}\nfunction validateMSMScalars(scalars: any[], field: any) {\n if (!Array.isArray(scalars)) throw new Error('array of scalars expected');\n scalars.forEach((s, i) => {\n if (!field.isValid(s)) throw new Error('invalid scalar at index ' + i);\n });\n}\n\n// Since points in different groups cannot be equal (different object constructor),\n// we can have single place to store precomputes.\n// Allows to make points frozen / immutable.\nconst pointPrecomputes = new WeakMap<any, any[]>();\nconst pointWindowSizes = new WeakMap<any, number>();\n\nfunction getW(P: any): number {\n // To disable precomputes:\n // return 1;\n return pointWindowSizes.get(P) || 1;\n}\n\nfunction assert0(n: bigint): void {\n if (n !== _0n) throw new Error('invalid wNAF');\n}\n\n/**\n * Elliptic curve multiplication of Point by scalar. Fragile.\n * Table generation takes **30MB of ram and 10ms on high-end CPU**,\n * but may take much longer on slow devices. Actual generation will happen on\n * first call of `multiply()`. By default, `BASE` point is precomputed.\n *\n * Scalars should always be less than curve order: this should be checked inside of a curve itself.\n * Creates precomputation tables for fast multiplication:\n * - private scalar is split by fixed size windows of W bits\n * - every window point is collected from window's table & added to accumulator\n * - since windows are different, same point inside tables won't be accessed more than once per calc\n * - each multiplication is 'Math.ceil(CURVE_ORDER / \uD835\uDC4A) + 1' point additions (fixed for any scalar)\n * - +1 window is neccessary for wNAF\n * - wNAF reduces table size: 2x less memory + 2x faster generation, but 10% slower multiplication\n *\n * @todo Research returning 2d JS array of windows, instead of a single window.\n * This would allow windows to be in different memory locations\n */\nexport class wNAF<PC extends PC_ANY> {\n private readonly BASE: PC_P<PC>;\n private readonly ZERO: PC_P<PC>;\n private readonly Fn: PC['Fn'];\n readonly bits: number;\n\n // Parametrized with a given Point class (not individual point)\n constructor(Point: PC, bits: number) {\n this.BASE = Point.BASE;\n this.ZERO = Point.ZERO;\n this.Fn = Point.Fn;\n this.bits = bits;\n }\n\n // non-const time multiplication ladder\n _unsafeLadder(elm: PC_P<PC>, n: bigint, p: PC_P<PC> = this.ZERO): PC_P<PC> {\n let d: PC_P<PC> = elm;\n while (n > _0n) {\n if (n & _1n) p = p.add(d);\n d = d.double();\n n >>= _1n;\n }\n return p;\n }\n\n /**\n * Creates a wNAF precomputation window. Used for caching.\n * Default window size is set by `utils.precompute()` and is equal to 8.\n * Number of precomputed points depends on the curve size:\n * 2^(\uD835\uDC4A\u22121) * (Math.ceil(\uD835\uDC5B / \uD835\uDC4A) + 1), where:\n * - \uD835\uDC4A is the window size\n * - \uD835\uDC5B is the bitlength of the curve order.\n * For a 256-bit curve and window size 8, the number of precomputed points is 128 * 33 = 4224.\n * @param point Point instance\n * @param W window size\n * @returns precomputed point tables flattened to a single array\n */\n private precomputeWindow(point: PC_P<PC>, W: number): PC_P<PC>[] {\n const { windows, windowSize } = calcWOpts(W, this.bits);\n const points: PC_P<PC>[] = [];\n let p: PC_P<PC> = point;\n let base = p;\n for (let window = 0; window < windows; window++) {\n base = p;\n points.push(base);\n // i=1, bc we skip 0\n for (let i = 1; i < windowSize; i++) {\n base = base.add(p);\n points.push(base);\n }\n p = base.double();\n }\n return points;\n }\n\n /**\n * Implements ec multiplication using precomputed tables and w-ary non-adjacent form.\n * More compact implementation:\n * https://github.com/paulmillr/noble-secp256k1/blob/47cb1669b6e506ad66b35fe7d76132ae97465da2/index.ts#L502-L541\n * @returns real and fake (for const-time) points\n */\n private wNAF(W: number, precomputes: PC_P<PC>[], n: bigint): { p: PC_P<PC>; f: PC_P<PC> } {\n // Scalar should be smaller than field order\n if (!this.Fn.isValid(n)) throw new Error('invalid scalar');\n // Accumulators\n let p = this.ZERO;\n let f = this.BASE;\n // This code was first written with assumption that 'f' and 'p' will never be infinity point:\n // since each addition is multiplied by 2 ** W, it cannot cancel each other. However,\n // there is negate now: it is possible that negated element from low value\n // would be the same as high element, which will create carry into next window.\n // It's not obvious how this can fail, but still worth investigating later.\n const wo = calcWOpts(W, this.bits);\n for (let window = 0; window < wo.windows; window++) {\n // (n === _0n) is handled and not early-exited. isEven and offsetF are used for noise\n const { nextN, offset, isZero, isNeg, isNegF, offsetF } = calcOffsets(n, window, wo);\n n = nextN;\n if (isZero) {\n // bits are 0: add garbage to fake point\n // Important part for const-time getPublicKey: add random \"noise\" point to f.\n f = f.add(negateCt(isNegF, precomputes[offsetF]));\n } else {\n // bits are 1: add to result point\n p = p.add(negateCt(isNeg, precomputes[offset]));\n }\n }\n assert0(n);\n // Return both real and fake points: JIT won't eliminate f.\n // At this point there is a way to F be infinity-point even if p is not,\n // which makes it less const-time: around 1 bigint multiply.\n return { p, f };\n }\n\n /**\n * Implements ec unsafe (non const-time) multiplication using precomputed tables and w-ary non-adjacent form.\n * @param acc accumulator point to add result of multiplication\n * @returns point\n */\n private wNAFUnsafe(\n W: number,\n precomputes: PC_P<PC>[],\n n: bigint,\n acc: PC_P<PC> = this.ZERO\n ): PC_P<PC> {\n const wo = calcWOpts(W, this.bits);\n for (let window = 0; window < wo.windows; window++) {\n if (n === _0n) break; // Early-exit, skip 0 value\n const { nextN, offset, isZero, isNeg } = calcOffsets(n, window, wo);\n n = nextN;\n if (isZero) {\n // Window bits are 0: skip processing.\n // Move to next window.\n continue;\n } else {\n const item = precomputes[offset];\n acc = acc.add(isNeg ? item.negate() : item); // Re-using acc allows to save adds in MSM\n }\n }\n assert0(n);\n return acc;\n }\n\n private getPrecomputes(W: number, point: PC_P<PC>, transform?: Mapper<PC_P<PC>>): PC_P<PC>[] {\n // Calculate precomputes on a first run, reuse them after\n let comp = pointPrecomputes.get(point);\n if (!comp) {\n comp = this.precomputeWindow(point, W) as PC_P<PC>[];\n if (W !== 1) {\n // Doing transform outside of if brings 15% perf hit\n if (typeof transform === 'function') comp = transform(comp);\n pointPrecomputes.set(point, comp);\n }\n }\n return comp;\n }\n\n cached(\n point: PC_P<PC>,\n scalar: bigint,\n transform?: Mapper<PC_P<PC>>\n ): { p: PC_P<PC>; f: PC_P<PC> } {\n const W = getW(point);\n return this.wNAF(W, this.getPrecomputes(W, point, transform), scalar);\n }\n\n unsafe(point: PC_P<PC>, scalar: bigint, transform?: Mapper<PC_P<PC>>, prev?: PC_P<PC>): PC_P<PC> {\n const W = getW(point);\n if (W === 1) return this._unsafeLadder(point, scalar, prev); // For W=1 ladder is ~x2 faster\n return this.wNAFUnsafe(W, this.getPrecomputes(W, point, transform), scalar, prev);\n }\n\n // We calculate precomputes for elliptic curve point multiplication\n // using windowed method. This specifies window size and\n // stores precomputed values. Usually only base point would be precomputed.\n createCache(P: PC_P<PC>, W: number): void {\n validateW(W, this.bits);\n pointWindowSizes.set(P, W);\n pointPrecomputes.delete(P);\n }\n\n hasCache(elm: PC_P<PC>): boolean {\n return getW(elm) !== 1;\n }\n}\n\n/**\n * Endomorphism-specific multiplication for Koblitz curves.\n * Cost: 128 dbl, 0-256 adds.\n */\nexport function mulEndoUnsafe<P extends CurvePoint<any, P>, PC extends CurvePointCons<P>>(\n Point: PC,\n point: P,\n k1: bigint,\n k2: bigint\n): { p1: P; p2: P } {\n let acc = point;\n let p1 = Point.ZERO;\n let p2 = Point.ZERO;\n while (k1 > _0n || k2 > _0n) {\n if (k1 & _1n) p1 = p1.add(acc);\n if (k2 & _1n) p2 = p2.add(acc);\n acc = acc.double();\n k1 >>= _1n;\n k2 >>= _1n;\n }\n return { p1, p2 };\n}\n\n/**\n * Pippenger algorithm for multi-scalar multiplication (MSM, Pa + Qb + Rc + ...).\n * 30x faster vs naive addition on L=4096, 10x faster than precomputes.\n * For N=254bit, L=1, it does: 1024 ADD + 254 DBL. For L=5: 1536 ADD + 254 DBL.\n * Algorithmically constant-time (for same L), even when 1 point + scalar, or when scalar = 0.\n * @param c Curve Point constructor\n * @param fieldN field over CURVE.N - important that it's not over CURVE.P\n * @param points array of L curve points\n * @param scalars array of L scalars (aka secret keys / bigints)\n */\nexport function pippenger<P extends CurvePoint<any, P>, PC extends CurvePointCons<P>>(\n c: PC,\n fieldN: IField<bigint>,\n points: P[],\n scalars: bigint[]\n): P {\n // If we split scalars by some window (let's say 8 bits), every chunk will only\n // take 256 buckets even if there are 4096 scalars, also re-uses double.\n // TODO:\n // - https://eprint.iacr.org/2024/750.pdf\n // - https://tches.iacr.org/index.php/TCHES/article/view/10287\n // 0 is accepted in scalars\n validateMSMPoints(points, c);\n validateMSMScalars(scalars, fieldN);\n const plength = points.length;\n const slength = scalars.length;\n if (plength !== slength) throw new Error('arrays of points and scalars must have equal length');\n // if (plength === 0) throw new Error('array must be of length >= 2');\n const zero = c.ZERO;\n const wbits = bitLen(BigInt(plength));\n let windowSize = 1; // bits\n if (wbits > 12) windowSize = wbits - 3;\n else if (wbits > 4) windowSize = wbits - 2;\n else if (wbits > 0) windowSize = 2;\n const MASK = bitMask(windowSize);\n const buckets = new Array(Number(MASK) + 1).fill(zero); // +1 for zero array\n const lastBits = Math.floor((fieldN.BITS - 1) / windowSize) * windowSize;\n let sum = zero;\n for (let i = lastBits; i >= 0; i -= windowSize) {\n buckets.fill(zero);\n for (let j = 0; j < slength; j++) {\n const scalar = scalars[j];\n const wbits = Number((scalar >> BigInt(i)) & MASK);\n buckets[wbits] = buckets[wbits].add(points[j]);\n }\n let resI = zero; // not using this will do small speed-up, but will lose ct\n // Skip first bucket, because it is zero\n for (let j = buckets.length - 1, sumI = zero; j > 0; j--) {\n sumI = sumI.add(buckets[j]);\n resI = resI.add(sumI);\n }\n sum = sum.add(resI);\n if (i !== 0) for (let j = 0; j < windowSize; j++) sum = sum.double();\n }\n return sum as P;\n}\n/**\n * Precomputed multi-scalar multiplication (MSM, Pa + Qb + Rc + ...).\n * @param c Curve Point constructor\n * @param fieldN field over CURVE.N - important that it's not over CURVE.P\n * @param points array of L curve points\n * @returns function which multiplies points with scaars\n */\nexport function precomputeMSMUnsafe<P extends CurvePoint<any, P>, PC extends CurvePointCons<P>>(\n c: PC,\n fieldN: IField<bigint>,\n points: P[],\n windowSize: number\n): (scalars: bigint[]) => P {\n /**\n * Performance Analysis of Window-based Precomputation\n *\n * Base Case (256-bit scalar, 8-bit window):\n * - Standard precomputation requires:\n * - 31 additions per scalar \u00D7 256 scalars = 7,936 ops\n * - Plus 255 summary additions = 8,191 total ops\n * Note: Summary additions can be optimized via accumulator\n *\n * Chunked Precomputation Analysis:\n * - Using 32 chunks requires:\n * - 255 additions per chunk\n * - 256 doublings\n * - Total: (255 \u00D7 32) + 256 = 8,416 ops\n *\n * Memory Usage Comparison:\n * Window Size | Standard Points | Chunked Points\n * ------------|-----------------|---------------\n * 4-bit | 520 | 15\n * 8-bit | 4,224 | 255\n * 10-bit | 13,824 | 1,023\n * 16-bit | 557,056 | 65,535\n *\n * Key Advantages:\n * 1. Enables larger window sizes due to reduced memory overhead\n * 2. More efficient for smaller scalar counts:\n * - 16 chunks: (16 \u00D7 255) + 256 = 4,336 ops\n * - ~2x faster than standard 8,191 ops\n *\n * Limitations:\n * - Not suitable for plain precomputes (requires 256 constant doublings)\n * - Performance degrades with larger scalar counts:\n * - Optimal for ~256 scalars\n * - Less efficient for 4096+ scalars (Pippenger preferred)\n */\n validateW(windowSize, fieldN.BITS);\n validateMSMPoints(points, c);\n const zero = c.ZERO;\n const tableSize = 2 ** windowSize - 1; // table size (without zero)\n const chunks = Math.ceil(fieldN.BITS / windowSize); // chunks of item\n const MASK = bitMask(windowSize);\n const tables = points.map((p: P) => {\n const res = [];\n for (let i = 0, acc = p; i < tableSize; i++) {\n res.push(acc);\n acc = acc.add(p);\n }\n return res;\n });\n return (scalars: bigint[]): P => {\n validateMSMScalars(scalars, fieldN);\n if (scalars.length > points.length)\n throw new Error('array of scalars must be smaller than array of points');\n let res = zero;\n for (let i = 0; i < chunks; i++) {\n // No need to double if accumulator is still zero.\n if (res !== zero) for (let j = 0; j < windowSize; j++) res = res.double();\n const shiftBy = BigInt(chunks * windowSize - (i + 1) * windowSize);\n for (let j = 0; j < scalars.length; j++) {\n const n = scalars[j];\n const curr = Number((n >> shiftBy) & MASK);\n if (!curr) continue; // skip zero scalars chunks\n res = res.add(tables[j][curr - 1]);\n }\n }\n return res;\n };\n}\n\n// TODO: remove\n/**\n * Generic BasicCurve interface: works even for polynomial fields (BLS): P, n, h would be ok.\n * Though generator can be different (Fp2 / Fp6 for BLS).\n */\nexport type BasicCurve<T> = {\n Fp: IField<T>; // Field over which we'll do calculations (Fp)\n n: bigint; // Curve order, total count of valid points in the field\n nBitLength?: number; // bit length of curve order\n nByteLength?: number; // byte length of curve order\n h: bigint; // cofactor. we can assign default=1, but users will just ignore it w/o validation\n hEff?: bigint; // Number to multiply to clear cofactor\n Gx: T; // base point X coordinate\n Gy: T; // base point Y coordinate\n allowInfinityPoint?: boolean; // bls12-381 requires it. ZERO point is valid, but invalid pubkey\n};\n\n// TODO: remove\n/** @deprecated */\nexport function validateBasic<FP, T>(\n curve: BasicCurve<FP> & T\n): Readonly<\n {\n readonly nBitLength: number;\n readonly nByteLength: number;\n } & BasicCurve<FP> &\n T & {\n p: bigint;\n }\n> {\n validateField(curve.Fp);\n validateObject(\n curve,\n {\n n: 'bigint',\n h: 'bigint',\n Gx: 'field',\n Gy: 'field',\n },\n {\n nBitLength: 'isSafeInteger',\n nByteLength: 'isSafeInteger',\n }\n );\n // Set defaults\n return Object.freeze({\n ...nLength(curve.n, curve.nBitLength),\n ...curve,\n ...{ p: curve.Fp.ORDER },\n } as const);\n}\n\nexport type ValidCurveParams<T> = {\n p: bigint;\n n: bigint;\n h: bigint;\n a: T;\n b?: T;\n d?: T;\n Gx: T;\n Gy: T;\n};\n\nfunction createField<T>(order: bigint, field?: IField<T>, isLE?: boolean): IField<T> {\n if (field) {\n if (field.ORDER !== order) throw new Error('Field.ORDER must match order: Fp == p, Fn == n');\n validateField(field);\n return field;\n } else {\n return Field(order, { isLE }) as unknown as IField<T>;\n }\n}\nexport type FpFn<T> = { Fp: IField<T>; Fn: IField<bigint> };\n\n/** Validates CURVE opts and creates fields */\nexport function _createCurveFields<T>(\n type: 'weierstrass' | 'edwards',\n CURVE: ValidCurveParams<T>,\n curveOpts: Partial<FpFn<T>> = {},\n FpFnLE?: boolean\n): FpFn<T> & { CURVE: ValidCurveParams<T> } {\n if (FpFnLE === undefined) FpFnLE = type === 'edwards';\n if (!CURVE || typeof CURVE !== 'object') throw new Error(`expected valid ${type} CURVE object`);\n for (const p of ['p', 'n', 'h'] as const) {\n const val = CURVE[p];\n if (!(typeof val === 'bigint' && val > _0n))\n throw new Error(`CURVE.${p} must be positive bigint`);\n }\n const Fp = createField(CURVE.p, curveOpts.Fp, FpFnLE);\n const Fn = createField(CURVE.n, curveOpts.Fn, FpFnLE);\n const _b: 'b' | 'd' = type === 'weierstrass' ? 'b' : 'd';\n const params = ['Gx', 'Gy', 'a', _b] as const;\n for (const p of params) {\n // @ts-ignore\n if (!Fp.isValid(CURVE[p]))\n throw new Error(`CURVE.${p} must be valid field element of CURVE.Fp`);\n }\n CURVE = Object.freeze(Object.assign({}, CURVE));\n return { CURVE, Fp, Fn };\n}\n", "/**\n * Short Weierstrass curve methods. The formula is: y\u00B2 = x\u00B3 + ax + b.\n *\n * ### Design rationale for types\n *\n * * Interaction between classes from different curves should fail:\n * `k256.Point.BASE.add(p256.Point.BASE)`\n * * For this purpose we want to use `instanceof` operator, which is fast and works during runtime\n * * Different calls of `curve()` would return different classes -\n * `curve(params) !== curve(params)`: if somebody decided to monkey-patch their curve,\n * it won't affect others\n *\n * TypeScript can't infer types for classes created inside a function. Classes is one instance\n * of nominative types in TypeScript and interfaces only check for shape, so it's hard to create\n * unique type for every function call.\n *\n * We can use generic types via some param, like curve opts, but that would:\n * 1. Enable interaction between `curve(params)` and `curve(params)` (curves of same params)\n * which is hard to debug.\n * 2. Params can be generic and we can't enforce them to be constant value:\n * if somebody creates curve from non-constant params,\n * it would be allowed to interact with other curves with non-constant params\n *\n * @todo https://www.typescriptlang.org/docs/handbook/release-notes/typescript-2-7.html#unique-symbol\n * @module\n */\n/*! noble-curves - MIT License (c) 2022 Paul Miller (paulmillr.com) */\nimport { hmac as nobleHmac } from '@noble/hashes/hmac.js';\nimport { ahash } from '@noble/hashes/utils';\nimport {\n _validateObject,\n _abool2 as abool,\n _abytes2 as abytes,\n aInRange,\n bitLen,\n bitMask,\n bytesToHex,\n bytesToNumberBE,\n concatBytes,\n createHmacDrbg,\n ensureBytes,\n hexToBytes,\n inRange,\n isBytes,\n memoized,\n numberToHexUnpadded,\n randomBytes as randomBytesWeb,\n type CHash,\n type Hex,\n type PrivKey,\n} from '../utils.ts';\nimport {\n _createCurveFields,\n mulEndoUnsafe,\n negateCt,\n normalizeZ,\n pippenger,\n wNAF,\n type AffinePoint,\n type BasicCurve,\n type CurveLengths,\n type CurvePoint,\n type CurvePointCons,\n} from './curve.ts';\nimport {\n Field,\n FpInvertBatch,\n getMinHashLength,\n mapHashToField,\n nLength,\n validateField,\n type IField,\n type NLength,\n} from './modular.ts';\n\nexport type { AffinePoint };\nexport type HmacFnSync = (key: Uint8Array, ...messages: Uint8Array[]) => Uint8Array;\n\ntype EndoBasis = [[bigint, bigint], [bigint, bigint]];\n/**\n * When Weierstrass curve has `a=0`, it becomes Koblitz curve.\n * Koblitz curves allow using **efficiently-computable GLV endomorphism \u03C8**.\n * Endomorphism uses 2x less RAM, speeds up precomputation by 2x and ECDH / key recovery by 20%.\n * For precomputed wNAF it trades off 1/2 init time & 1/3 ram for 20% perf hit.\n *\n * Endomorphism consists of beta, lambda and splitScalar:\n *\n * 1. GLV endomorphism \u03C8 transforms a point: `P = (x, y) \u21A6 \u03C8(P) = (\u03B2\u00B7x mod p, y)`\n * 2. GLV scalar decomposition transforms a scalar: `k \u2261 k\u2081 + k\u2082\u00B7\u03BB (mod n)`\n * 3. Then these are combined: `k\u00B7P = k\u2081\u00B7P + k\u2082\u00B7\u03C8(P)`\n * 4. Two 128-bit point-by-scalar multiplications + one point addition is faster than\n * one 256-bit multiplication.\n *\n * where\n * * beta: \u03B2 \u2208 F\u209A with \u03B2\u00B3 = 1, \u03B2 \u2260 1\n * * lambda: \u03BB \u2208 F\u2099 with \u03BB\u00B3 = 1, \u03BB \u2260 1\n * * splitScalar decomposes k \u21A6 k\u2081, k\u2082, by using reduced basis vectors.\n * Gauss lattice reduction calculates them from initial basis vectors `(n, 0), (-\u03BB, 0)`\n *\n * Check out `test/misc/endomorphism.js` and\n * [gist](https://gist.github.com/paulmillr/eb670806793e84df628a7c434a873066).\n */\nexport type EndomorphismOpts = {\n beta: bigint;\n basises?: EndoBasis;\n splitScalar?: (k: bigint) => { k1neg: boolean; k1: bigint; k2neg: boolean; k2: bigint };\n};\n\n// We construct basis in such way that den is always positive and equals n, but num sign depends on basis (not on secret value)\nconst divNearest = (num: bigint, den: bigint) => (num + (num >= 0 ? den : -den) / _2n) / den;\n\nexport type ScalarEndoParts = { k1neg: boolean; k1: bigint; k2neg: boolean; k2: bigint };\n\n/**\n * Splits scalar for GLV endomorphism.\n */\nexport function _splitEndoScalar(k: bigint, basis: EndoBasis, n: bigint): ScalarEndoParts {\n // Split scalar into two such that part is ~half bits: `abs(part) < sqrt(N)`\n // Since part can be negative, we need to do this on point.\n // TODO: verifyScalar function which consumes lambda\n const [[a1, b1], [a2, b2]] = basis;\n const c1 = divNearest(b2 * k, n);\n const c2 = divNearest(-b1 * k, n);\n // |k1|/|k2| is < sqrt(N), but can be negative.\n // If we do `k1 mod N`, we'll get big scalar (`> sqrt(N)`): so, we do cheaper negation instead.\n let k1 = k - c1 * a1 - c2 * a2;\n let k2 = -c1 * b1 - c2 * b2;\n const k1neg = k1 < _0n;\n const k2neg = k2 < _0n;\n if (k1neg) k1 = -k1;\n if (k2neg) k2 = -k2;\n // Double check that resulting scalar less than half bits of N: otherwise wNAF will fail.\n // This should only happen on wrong basises. Also, math inside is too complex and I don't trust it.\n const MAX_NUM = bitMask(Math.ceil(bitLen(n) / 2)) + _1n; // Half bits of N\n if (k1 < _0n || k1 >= MAX_NUM || k2 < _0n || k2 >= MAX_NUM) {\n throw new Error('splitScalar (endomorphism): failed, k=' + k);\n }\n return { k1neg, k1, k2neg, k2 };\n}\n\nexport type ECDSASigFormat = 'compact' | 'recovered' | 'der';\nexport type ECDSARecoverOpts = {\n prehash?: boolean;\n};\nexport type ECDSAVerifyOpts = {\n prehash?: boolean;\n lowS?: boolean;\n format?: ECDSASigFormat;\n};\nexport type ECDSASignOpts = {\n prehash?: boolean;\n lowS?: boolean;\n format?: ECDSASigFormat;\n extraEntropy?: Uint8Array | boolean;\n};\n\nfunction validateSigFormat(format: string): ECDSASigFormat {\n if (!['compact', 'recovered', 'der'].includes(format))\n throw new Error('Signature format must be \"compact\", \"recovered\", or \"der\"');\n return format as ECDSASigFormat;\n}\n\nfunction validateSigOpts<T extends ECDSASignOpts, D extends Required<ECDSASignOpts>>(\n opts: T,\n def: D\n): Required<ECDSASignOpts> {\n const optsn: ECDSASignOpts = {};\n for (let optName of Object.keys(def)) {\n // @ts-ignore\n optsn[optName] = opts[optName] === undefined ? def[optName] : opts[optName];\n }\n abool(optsn.lowS!, 'lowS');\n abool(optsn.prehash!, 'prehash');\n if (optsn.format !== undefined) validateSigFormat(optsn.format);\n return optsn as Required<ECDSASignOpts>;\n}\n\n/** Instance methods for 3D XYZ projective points. */\nexport interface WeierstrassPoint<T> extends CurvePoint<T, WeierstrassPoint<T>> {\n /** projective X coordinate. Different from affine x. */\n readonly X: T;\n /** projective Y coordinate. Different from affine y. */\n readonly Y: T;\n /** projective z coordinate */\n readonly Z: T;\n /** affine x coordinate. Different from projective X. */\n get x(): T;\n /** affine y coordinate. Different from projective Y. */\n get y(): T;\n /** Encodes point using IEEE P1363 (DER) encoding. First byte is 2/3/4. Default = isCompressed. */\n toBytes(isCompressed?: boolean): Uint8Array;\n toHex(isCompressed?: boolean): string;\n\n /** @deprecated use `.X` */\n readonly px: T;\n /** @deprecated use `.Y` */\n readonly py: T;\n /** @deprecated use `.Z` */\n readonly pz: T;\n /** @deprecated use `toBytes` */\n toRawBytes(isCompressed?: boolean): Uint8Array;\n /** @deprecated use `multiplyUnsafe` */\n multiplyAndAddUnsafe(\n Q: WeierstrassPoint<T>,\n a: bigint,\n b: bigint\n ): WeierstrassPoint<T> | undefined;\n /** @deprecated use `p.y % 2n === 0n` */\n hasEvenY(): boolean;\n /** @deprecated use `p.precompute(windowSize)` */\n _setWindowSize(windowSize: number): void;\n}\n\n/** Static methods for 3D XYZ projective points. */\nexport interface WeierstrassPointCons<T> extends CurvePointCons<WeierstrassPoint<T>> {\n /** Does NOT validate if the point is valid. Use `.assertValidity()`. */\n new (X: T, Y: T, Z: T): WeierstrassPoint<T>;\n CURVE(): WeierstrassOpts<T>;\n /** @deprecated use `Point.BASE.multiply(Point.Fn.fromBytes(privateKey))` */\n fromPrivateKey(privateKey: PrivKey): WeierstrassPoint<T>;\n /** @deprecated use `import { normalizeZ } from '@noble/curves/abstract/curve.js';` */\n normalizeZ(points: WeierstrassPoint<T>[]): WeierstrassPoint<T>[];\n /** @deprecated use `import { pippenger } from '@noble/curves/abstract/curve.js';` */\n msm(points: WeierstrassPoint<T>[], scalars: bigint[]): WeierstrassPoint<T>;\n}\n\n/**\n * Weierstrass curve options.\n *\n * * p: prime characteristic (order) of finite field, in which arithmetics is done\n * * n: order of prime subgroup a.k.a total amount of valid curve points\n * * h: cofactor, usually 1. h*n is group order; n is subgroup order\n * * a: formula param, must be in field of p\n * * b: formula param, must be in field of p\n * * Gx: x coordinate of generator point a.k.a. base point\n * * Gy: y coordinate of generator point\n */\nexport type WeierstrassOpts<T> = Readonly<{\n p: bigint;\n n: bigint;\n h: bigint;\n a: T;\n b: T;\n Gx: T;\n Gy: T;\n}>;\n\n// When a cofactor != 1, there can be an effective methods to:\n// 1. Determine whether a point is torsion-free\n// 2. Clear torsion component\n// wrapPrivateKey: bls12-381 requires mod(n) instead of rejecting keys >= n\nexport type WeierstrassExtraOpts<T> = Partial<{\n Fp: IField<T>;\n Fn: IField<bigint>;\n allowInfinityPoint: boolean;\n endo: EndomorphismOpts;\n isTorsionFree: (c: WeierstrassPointCons<T>, point: WeierstrassPoint<T>) => boolean;\n clearCofactor: (c: WeierstrassPointCons<T>, point: WeierstrassPoint<T>) => WeierstrassPoint<T>;\n fromBytes: (bytes: Uint8Array) => AffinePoint<T>;\n toBytes: (\n c: WeierstrassPointCons<T>,\n point: WeierstrassPoint<T>,\n isCompressed: boolean\n ) => Uint8Array;\n}>;\n\n/**\n * Options for ECDSA signatures over a Weierstrass curve.\n *\n * * lowS: (default: true) whether produced / verified signatures occupy low half of ecdsaOpts.p. Prevents malleability.\n * * hmac: (default: noble-hashes hmac) function, would be used to init hmac-drbg for k generation.\n * * randomBytes: (default: webcrypto os-level CSPRNG) custom method for fetching secure randomness.\n * * bits2int, bits2int_modN: used in sigs, sometimes overridden by curves\n */\nexport type ECDSAOpts = Partial<{\n lowS: boolean;\n hmac: HmacFnSync;\n randomBytes: (bytesLength?: number) => Uint8Array;\n bits2int: (bytes: Uint8Array) => bigint;\n bits2int_modN: (bytes: Uint8Array) => bigint;\n}>;\n\n/**\n * Elliptic Curve Diffie-Hellman interface.\n * Provides keygen, secret-to-public conversion, calculating shared secrets.\n */\nexport interface ECDH {\n keygen: (seed?: Uint8Array) => { secretKey: Uint8Array; publicKey: Uint8Array };\n getPublicKey: (secretKey: PrivKey, isCompressed?: boolean) => Uint8Array;\n getSharedSecret: (secretKeyA: PrivKey, publicKeyB: Hex, isCompressed?: boolean) => Uint8Array;\n Point: WeierstrassPointCons<bigint>;\n utils: {\n isValidSecretKey: (secretKey: PrivKey) => boolean;\n isValidPublicKey: (publicKey: Uint8Array, isCompressed?: boolean) => boolean;\n randomSecretKey: (seed?: Uint8Array) => Uint8Array;\n /** @deprecated use `randomSecretKey` */\n randomPrivateKey: (seed?: Uint8Array) => Uint8Array;\n /** @deprecated use `isValidSecretKey` */\n isValidPrivateKey: (secretKey: PrivKey) => boolean;\n /** @deprecated use `Point.Fn.fromBytes()` */\n normPrivateKeyToScalar: (key: PrivKey) => bigint;\n /** @deprecated use `point.precompute()` */\n precompute: (windowSize?: number, point?: WeierstrassPoint<bigint>) => WeierstrassPoint<bigint>;\n };\n lengths: CurveLengths;\n}\n\n/**\n * ECDSA interface.\n * Only supported for prime fields, not Fp2 (extension fields).\n */\nexport interface ECDSA extends ECDH {\n sign: (message: Hex, secretKey: PrivKey, opts?: ECDSASignOpts) => ECDSASigRecovered;\n verify: (\n signature: Uint8Array,\n message: Uint8Array,\n publicKey: Uint8Array,\n opts?: ECDSAVerifyOpts\n ) => boolean;\n recoverPublicKey(signature: Uint8Array, message: Uint8Array, opts?: ECDSARecoverOpts): Uint8Array;\n Signature: ECDSASignatureCons;\n}\nexport class DERErr extends Error {\n constructor(m = '') {\n super(m);\n }\n}\nexport type IDER = {\n // asn.1 DER encoding utils\n Err: typeof DERErr;\n // Basic building block is TLV (Tag-Length-Value)\n _tlv: {\n encode: (tag: number, data: string) => string;\n // v - value, l - left bytes (unparsed)\n decode(tag: number, data: Uint8Array): { v: Uint8Array; l: Uint8Array };\n };\n // https://crypto.stackexchange.com/a/57734 Leftmost bit of first byte is 'negative' flag,\n // since we always use positive integers here. It must always be empty:\n // - add zero byte if exists\n // - if next byte doesn't have a flag, leading zero is not allowed (minimal encoding)\n _int: {\n encode(num: bigint): string;\n decode(data: Uint8Array): bigint;\n };\n toSig(hex: string | Uint8Array): { r: bigint; s: bigint };\n hexFromSig(sig: { r: bigint; s: bigint }): string;\n};\n/**\n * ASN.1 DER encoding utilities. ASN is very complex & fragile. Format:\n *\n * [0x30 (SEQUENCE), bytelength, 0x02 (INTEGER), intLength, R, 0x02 (INTEGER), intLength, S]\n *\n * Docs: https://letsencrypt.org/docs/a-warm-welcome-to-asn1-and-der/, https://luca.ntop.org/Teaching/Appunti/asn1.html\n */\nexport const DER: IDER = {\n // asn.1 DER encoding utils\n Err: DERErr,\n // Basic building block is TLV (Tag-Length-Value)\n _tlv: {\n encode: (tag: number, data: string): string => {\n const { Err: E } = DER;\n if (tag < 0 || tag > 256) throw new E('tlv.encode: wrong tag');\n if (data.length & 1) throw new E('tlv.encode: unpadded data');\n const dataLen = data.length / 2;\n const len = numberToHexUnpadded(dataLen);\n if ((len.length / 2) & 0b1000_0000) throw new E('tlv.encode: long form length too big');\n // length of length with long form flag\n const lenLen = dataLen > 127 ? numberToHexUnpadded((len.length / 2) | 0b1000_0000) : '';\n const t = numberToHexUnpadded(tag);\n return t + lenLen + len + data;\n },\n // v - value, l - left bytes (unparsed)\n decode(tag: number, data: Uint8Array): { v: Uint8Array; l: Uint8Array } {\n const { Err: E } = DER;\n let pos = 0;\n if (tag < 0 || tag > 256) throw new E('tlv.encode: wrong tag');\n if (data.length < 2 || data[pos++] !== tag) throw new E('tlv.decode: wrong tlv');\n const first = data[pos++];\n const isLong = !!(first & 0b1000_0000); // First bit of first length byte is flag for short/long form\n let length = 0;\n if (!isLong) length = first;\n else {\n // Long form: [longFlag(1bit), lengthLength(7bit), length (BE)]\n const lenLen = first & 0b0111_1111;\n if (!lenLen) throw new E('tlv.decode(long): indefinite length not supported');\n if (lenLen > 4) throw new E('tlv.decode(long): byte length is too big'); // this will overflow u32 in js\n const lengthBytes = data.subarray(pos, pos + lenLen);\n if (lengthBytes.length !== lenLen) throw new E('tlv.decode: length bytes not complete');\n if (lengthBytes[0] === 0) throw new E('tlv.decode(long): zero leftmost byte');\n for (const b of lengthBytes) length = (length << 8) | b;\n pos += lenLen;\n if (length < 128) throw new E('tlv.decode(long): not minimal encoding');\n }\n const v = data.subarray(pos, pos + length);\n if (v.length !== length) throw new E('tlv.decode: wrong value length');\n return { v, l: data.subarray(pos + length) };\n },\n },\n // https://crypto.stackexchange.com/a/57734 Leftmost bit of first byte is 'negative' flag,\n // since we always use positive integers here. It must always be empty:\n // - add zero byte if exists\n // - if next byte doesn't have a flag, leading zero is not allowed (minimal encoding)\n _int: {\n encode(num: bigint): string {\n const { Err: E } = DER;\n if (num < _0n) throw new E('integer: negative integers are not allowed');\n let hex = numberToHexUnpadded(num);\n // Pad with zero byte if negative flag is present\n if (Number.parseInt(hex[0], 16) & 0b1000) hex = '00' + hex;\n if (hex.length & 1) throw new E('unexpected DER parsing assertion: unpadded hex');\n return hex;\n },\n decode(data: Uint8Array): bigint {\n const { Err: E } = DER;\n if (data[0] & 0b1000_0000) throw new E('invalid signature integer: negative');\n if (data[0] === 0x00 && !(data[1] & 0b1000_0000))\n throw new E('invalid signature integer: unnecessary leading zero');\n return bytesToNumberBE(data);\n },\n },\n toSig(hex: string | Uint8Array): { r: bigint; s: bigint } {\n // parse DER signature\n const { Err: E, _int: int, _tlv: tlv } = DER;\n const data = ensureBytes('signature', hex);\n const { v: seqBytes, l: seqLeftBytes } = tlv.decode(0x30, data);\n if (seqLeftBytes.length) throw new E('invalid signature: left bytes after parsing');\n const { v: rBytes, l: rLeftBytes } = tlv.decode(0x02, seqBytes);\n const { v: sBytes, l: sLeftBytes } = tlv.decode(0x02, rLeftBytes);\n if (sLeftBytes.length) throw new E('invalid signature: left bytes after parsing');\n return { r: int.decode(rBytes), s: int.decode(sBytes) };\n },\n hexFromSig(sig: { r: bigint; s: bigint }): string {\n const { _tlv: tlv, _int: int } = DER;\n const rs = tlv.encode(0x02, int.encode(sig.r));\n const ss = tlv.encode(0x02, int.encode(sig.s));\n const seq = rs + ss;\n return tlv.encode(0x30, seq);\n },\n};\n\n// Be friendly to bad ECMAScript parsers by not using bigint literals\n// prettier-ignore\nconst _0n = BigInt(0), _1n = BigInt(1), _2n = BigInt(2), _3n = BigInt(3), _4n = BigInt(4);\n\nexport function _normFnElement(Fn: IField<bigint>, key: PrivKey): bigint {\n const { BYTES: expected } = Fn;\n let num: bigint;\n if (typeof key === 'bigint') {\n num = key;\n } else {\n let bytes = ensureBytes('private key', key);\n try {\n num = Fn.fromBytes(bytes);\n } catch (error) {\n throw new Error(`invalid private key: expected ui8a of size ${expected}, got ${typeof key}`);\n }\n }\n if (!Fn.isValidNot0(num)) throw new Error('invalid private key: out of range [1..N-1]');\n return num;\n}\n\n/**\n * Creates weierstrass Point constructor, based on specified curve options.\n *\n * @example\n```js\nconst opts = {\n p: BigInt('0xffffffff00000001000000000000000000000000ffffffffffffffffffffffff'),\n n: BigInt('0xffffffff00000000ffffffffffffffffbce6faada7179e84f3b9cac2fc632551'),\n h: BigInt(1),\n a: BigInt('0xffffffff00000001000000000000000000000000fffffffffffffffffffffffc'),\n b: BigInt('0x5ac635d8aa3a93e7b3ebbd55769886bc651d06b0cc53b0f63bce3c3e27d2604b'),\n Gx: BigInt('0x6b17d1f2e12c4247f8bce6e563a440f277037d812deb33a0f4a13945d898c296'),\n Gy: BigInt('0x4fe342e2fe1a7f9b8ee7eb4a7c0f9e162bce33576b315ececbb6406837bf51f5'),\n};\nconst p256_Point = weierstrass(opts);\n```\n */\nexport function weierstrassN<T>(\n params: WeierstrassOpts<T>,\n extraOpts: WeierstrassExtraOpts<T> = {}\n): WeierstrassPointCons<T> {\n const validated = _createCurveFields('weierstrass', params, extraOpts);\n const { Fp, Fn } = validated;\n let CURVE = validated.CURVE as WeierstrassOpts<T>;\n const { h: cofactor, n: CURVE_ORDER } = CURVE;\n _validateObject(\n extraOpts,\n {},\n {\n allowInfinityPoint: 'boolean',\n clearCofactor: 'function',\n isTorsionFree: 'function',\n fromBytes: 'function',\n toBytes: 'function',\n endo: 'object',\n wrapPrivateKey: 'boolean',\n }\n );\n\n const { endo } = extraOpts;\n if (endo) {\n // validateObject(endo, { beta: 'bigint', splitScalar: 'function' });\n if (!Fp.is0(CURVE.a) || typeof endo.beta !== 'bigint' || !Array.isArray(endo.basises)) {\n throw new Error('invalid endo: expected \"beta\": bigint and \"basises\": array');\n }\n }\n\n const lengths = getWLengths(Fp, Fn);\n\n function assertCompressionIsSupported() {\n if (!Fp.isOdd) throw new Error('compression is not supported: Field does not have .isOdd()');\n }\n\n // Implements IEEE P1363 point encoding\n function pointToBytes(\n _c: WeierstrassPointCons<T>,\n point: WeierstrassPoint<T>,\n isCompressed: boolean\n ): Uint8Array {\n const { x, y } = point.toAffine();\n const bx = Fp.toBytes(x);\n abool(isCompressed, 'isCompressed');\n if (isCompressed) {\n assertCompressionIsSupported();\n const hasEvenY = !Fp.isOdd!(y);\n return concatBytes(pprefix(hasEvenY), bx);\n } else {\n return concatBytes(Uint8Array.of(0x04), bx, Fp.toBytes(y));\n }\n }\n function pointFromBytes(bytes: Uint8Array) {\n abytes(bytes, undefined, 'Point');\n const { publicKey: comp, publicKeyUncompressed: uncomp } = lengths; // e.g. for 32-byte: 33, 65\n const length = bytes.length;\n const head = bytes[0];\n const tail = bytes.subarray(1);\n // No actual validation is done here: use .assertValidity()\n if (length === comp && (head === 0x02 || head === 0x03)) {\n const x = Fp.fromBytes(tail);\n if (!Fp.isValid(x)) throw new Error('bad point: is not on curve, wrong x');\n const y2 = weierstrassEquation(x); // y\u00B2 = x\u00B3 + ax + b\n let y: T;\n try {\n y = Fp.sqrt(y2); // y = y\u00B2 ^ (p+1)/4\n } catch (sqrtError) {\n const err = sqrtError instanceof Error ? ': ' + sqrtError.message : '';\n throw new Error('bad point: is not on curve, sqrt error' + err);\n }\n assertCompressionIsSupported();\n const isYOdd = Fp.isOdd!(y); // (y & _1n) === _1n;\n const isHeadOdd = (head & 1) === 1; // ECDSA-specific\n if (isHeadOdd !== isYOdd) y = Fp.neg(y);\n return { x, y };\n } else if (length === uncomp && head === 0x04) {\n // TODO: more checks\n const L = Fp.BYTES;\n const x = Fp.fromBytes(tail.subarray(0, L));\n const y = Fp.fromBytes(tail.subarray(L, L * 2));\n if (!isValidXY(x, y)) throw new Error('bad point: is not on curve');\n return { x, y };\n } else {\n throw new Error(\n `bad point: got length ${length}, expected compressed=${comp} or uncompressed=${uncomp}`\n );\n }\n }\n\n const encodePoint = extraOpts.toBytes || pointToBytes;\n const decodePoint = extraOpts.fromBytes || pointFromBytes;\n function weierstrassEquation(x: T): T {\n const x2 = Fp.sqr(x); // x * x\n const x3 = Fp.mul(x2, x); // x\u00B2 * x\n return Fp.add(Fp.add(x3, Fp.mul(x, CURVE.a)), CURVE.b); // x\u00B3 + a * x + b\n }\n\n // TODO: move top-level\n /** Checks whether equation holds for given x, y: y\u00B2 == x\u00B3 + ax + b */\n function isValidXY(x: T, y: T): boolean {\n const left = Fp.sqr(y); // y\u00B2\n const right = weierstrassEquation(x); // x\u00B3 + ax + b\n return Fp.eql(left, right);\n }\n\n // Validate whether the passed curve params are valid.\n // Test 1: equation y\u00B2 = x\u00B3 + ax + b should work for generator point.\n if (!isValidXY(CURVE.Gx, CURVE.Gy)) throw new Error('bad curve params: generator point');\n\n // Test 2: discriminant \u0394 part should be non-zero: 4a\u00B3 + 27b\u00B2 != 0.\n // Guarantees curve is genus-1, smooth (non-singular).\n const _4a3 = Fp.mul(Fp.pow(CURVE.a, _3n), _4n);\n const _27b2 = Fp.mul(Fp.sqr(CURVE.b), BigInt(27));\n if (Fp.is0(Fp.add(_4a3, _27b2))) throw new Error('bad curve params: a or b');\n\n /** Asserts coordinate is valid: 0 <= n < Fp.ORDER. */\n function acoord(title: string, n: T, banZero = false) {\n if (!Fp.isValid(n) || (banZero && Fp.is0(n))) throw new Error(`bad point coordinate ${title}`);\n return n;\n }\n\n function aprjpoint(other: unknown) {\n if (!(other instanceof Point)) throw new Error('ProjectivePoint expected');\n }\n\n function splitEndoScalarN(k: bigint) {\n if (!endo || !endo.basises) throw new Error('no endo');\n return _splitEndoScalar(k, endo.basises, Fn.ORDER);\n }\n\n // Memoized toAffine / validity check. They are heavy. Points are immutable.\n\n // Converts Projective point to affine (x, y) coordinates.\n // Can accept precomputed Z^-1 - for example, from invertBatch.\n // (X, Y, Z) \u220B (x=X/Z, y=Y/Z)\n const toAffineMemo = memoized((p: Point, iz?: T): AffinePoint<T> => {\n const { X, Y, Z } = p;\n // Fast-path for normalized points\n if (Fp.eql(Z, Fp.ONE)) return { x: X, y: Y };\n const is0 = p.is0();\n // If invZ was 0, we return zero point. However we still want to execute\n // all operations, so we replace invZ with a random number, 1.\n if (iz == null) iz = is0 ? Fp.ONE : Fp.inv(Z);\n const x = Fp.mul(X, iz);\n const y = Fp.mul(Y, iz);\n const zz = Fp.mul(Z, iz);\n if (is0) return { x: Fp.ZERO, y: Fp.ZERO };\n if (!Fp.eql(zz, Fp.ONE)) throw new Error('invZ was invalid');\n return { x, y };\n });\n // NOTE: on exception this will crash 'cached' and no value will be set.\n // Otherwise true will be return\n const assertValidMemo = memoized((p: Point) => {\n if (p.is0()) {\n // (0, 1, 0) aka ZERO is invalid in most contexts.\n // In BLS, ZERO can be serialized, so we allow it.\n // (0, 0, 0) is invalid representation of ZERO.\n if (extraOpts.allowInfinityPoint && !Fp.is0(p.Y)) return;\n throw new Error('bad point: ZERO');\n }\n // Some 3rd-party test vectors require different wording between here & `fromCompressedHex`\n const { x, y } = p.toAffine();\n if (!Fp.isValid(x) || !Fp.isValid(y)) throw new Error('bad point: x or y not field elements');\n if (!isValidXY(x, y)) throw new Error('bad point: equation left != right');\n if (!p.isTorsionFree()) throw new Error('bad point: not in prime-order subgroup');\n return true;\n });\n\n function finishEndo(\n endoBeta: EndomorphismOpts['beta'],\n k1p: Point,\n k2p: Point,\n k1neg: boolean,\n k2neg: boolean\n ) {\n k2p = new Point(Fp.mul(k2p.X, endoBeta), k2p.Y, k2p.Z);\n k1p = negateCt(k1neg, k1p);\n k2p = negateCt(k2neg, k2p);\n return k1p.add(k2p);\n }\n\n /**\n * Projective Point works in 3d / projective (homogeneous) coordinates:(X, Y, Z) \u220B (x=X/Z, y=Y/Z).\n * Default Point works in 2d / affine coordinates: (x, y).\n * We're doing calculations in projective, because its operations don't require costly inversion.\n */\n class Point implements WeierstrassPoint<T> {\n // base / generator point\n static readonly BASE = new Point(CURVE.Gx, CURVE.Gy, Fp.ONE);\n // zero / infinity / identity point\n static readonly ZERO = new Point(Fp.ZERO, Fp.ONE, Fp.ZERO); // 0, 1, 0\n // math field\n static readonly Fp = Fp;\n // scalar field\n static readonly Fn = Fn;\n\n readonly X: T;\n readonly Y: T;\n readonly Z: T;\n\n /** Does NOT validate if the point is valid. Use `.assertValidity()`. */\n constructor(X: T, Y: T, Z: T) {\n this.X = acoord('x', X);\n this.Y = acoord('y', Y, true);\n this.Z = acoord('z', Z);\n Object.freeze(this);\n }\n\n static CURVE(): WeierstrassOpts<T> {\n return CURVE;\n }\n\n /** Does NOT validate if the point is valid. Use `.assertValidity()`. */\n static fromAffine(p: AffinePoint<T>): Point {\n const { x, y } = p || {};\n if (!p || !Fp.isValid(x) || !Fp.isValid(y)) throw new Error('invalid affine point');\n if (p instanceof Point) throw new Error('projective point not allowed');\n // (0, 0) would've produced (0, 0, 1) - instead, we need (0, 1, 0)\n if (Fp.is0(x) && Fp.is0(y)) return Point.ZERO;\n return new Point(x, y, Fp.ONE);\n }\n\n static fromBytes(bytes: Uint8Array): Point {\n const P = Point.fromAffine(decodePoint(abytes(bytes, undefined, 'point')));\n P.assertValidity();\n return P;\n }\n static fromHex(hex: Hex): Point {\n return Point.fromBytes(ensureBytes('pointHex', hex));\n }\n\n get x(): T {\n return this.toAffine().x;\n }\n get y(): T {\n return this.toAffine().y;\n }\n\n /**\n *\n * @param windowSize\n * @param isLazy true will defer table computation until the first multiplication\n * @returns\n */\n precompute(windowSize: number = 8, isLazy = true): Point {\n wnaf.createCache(this, windowSize);\n if (!isLazy) this.multiply(_3n); // random number\n return this;\n }\n\n // TODO: return `this`\n /** A point on curve is valid if it conforms to equation. */\n assertValidity(): void {\n assertValidMemo(this);\n }\n\n hasEvenY(): boolean {\n const { y } = this.toAffine();\n if (!Fp.isOdd) throw new Error(\"Field doesn't support isOdd\");\n return !Fp.isOdd(y);\n }\n\n /** Compare one point to another. */\n equals(other: Point): boolean {\n aprjpoint(other);\n const { X: X1, Y: Y1, Z: Z1 } = this;\n const { X: X2, Y: Y2, Z: Z2 } = other;\n const U1 = Fp.eql(Fp.mul(X1, Z2), Fp.mul(X2, Z1));\n const U2 = Fp.eql(Fp.mul(Y1, Z2), Fp.mul(Y2, Z1));\n return U1 && U2;\n }\n\n /** Flips point to one corresponding to (x, -y) in Affine coordinates. */\n negate(): Point {\n return new Point(this.X, Fp.neg(this.Y), this.Z);\n }\n\n // Renes-Costello-Batina exception-free doubling formula.\n // There is 30% faster Jacobian formula, but it is not complete.\n // https://eprint.iacr.org/2015/1060, algorithm 3\n // Cost: 8M + 3S + 3*a + 2*b3 + 15add.\n double() {\n const { a, b } = CURVE;\n const b3 = Fp.mul(b, _3n);\n const { X: X1, Y: Y1, Z: Z1 } = this;\n let X3 = Fp.ZERO, Y3 = Fp.ZERO, Z3 = Fp.ZERO; // prettier-ignore\n let t0 = Fp.mul(X1, X1); // step 1\n let t1 = Fp.mul(Y1, Y1);\n let t2 = Fp.mul(Z1, Z1);\n let t3 = Fp.mul(X1, Y1);\n t3 = Fp.add(t3, t3); // step 5\n Z3 = Fp.mul(X1, Z1);\n Z3 = Fp.add(Z3, Z3);\n X3 = Fp.mul(a, Z3);\n Y3 = Fp.mul(b3, t2);\n Y3 = Fp.add(X3, Y3); // step 10\n X3 = Fp.sub(t1, Y3);\n Y3 = Fp.add(t1, Y3);\n Y3 = Fp.mul(X3, Y3);\n X3 = Fp.mul(t3, X3);\n Z3 = Fp.mul(b3, Z3); // step 15\n t2 = Fp.mul(a, t2);\n t3 = Fp.sub(t0, t2);\n t3 = Fp.mul(a, t3);\n t3 = Fp.add(t3, Z3);\n Z3 = Fp.add(t0, t0); // step 20\n t0 = Fp.add(Z3, t0);\n t0 = Fp.add(t0, t2);\n t0 = Fp.mul(t0, t3);\n Y3 = Fp.add(Y3, t0);\n t2 = Fp.mul(Y1, Z1); // step 25\n t2 = Fp.add(t2, t2);\n t0 = Fp.mul(t2, t3);\n X3 = Fp.sub(X3, t0);\n Z3 = Fp.mul(t2, t1);\n Z3 = Fp.add(Z3, Z3); // step 30\n Z3 = Fp.add(Z3, Z3);\n return new Point(X3, Y3, Z3);\n }\n\n // Renes-Costello-Batina exception-free addition formula.\n // There is 30% faster Jacobian formula, but it is not complete.\n // https://eprint.iacr.org/2015/1060, algorithm 1\n // Cost: 12M + 0S + 3*a + 3*b3 + 23add.\n add(other: Point): Point {\n aprjpoint(other);\n const { X: X1, Y: Y1, Z: Z1 } = this;\n const { X: X2, Y: Y2, Z: Z2 } = other;\n let X3 = Fp.ZERO, Y3 = Fp.ZERO, Z3 = Fp.ZERO; // prettier-ignore\n const a = CURVE.a;\n const b3 = Fp.mul(CURVE.b, _3n);\n let t0 = Fp.mul(X1, X2); // step 1\n let t1 = Fp.mul(Y1, Y2);\n let t2 = Fp.mul(Z1, Z2);\n let t3 = Fp.add(X1, Y1);\n let t4 = Fp.add(X2, Y2); // step 5\n t3 = Fp.mul(t3, t4);\n t4 = Fp.add(t0, t1);\n t3 = Fp.sub(t3, t4);\n t4 = Fp.add(X1, Z1);\n let t5 = Fp.add(X2, Z2); // step 10\n t4 = Fp.mul(t4, t5);\n t5 = Fp.add(t0, t2);\n t4 = Fp.sub(t4, t5);\n t5 = Fp.add(Y1, Z1);\n X3 = Fp.add(Y2, Z2); // step 15\n t5 = Fp.mul(t5, X3);\n X3 = Fp.add(t1, t2);\n t5 = Fp.sub(t5, X3);\n Z3 = Fp.mul(a, t4);\n X3 = Fp.mul(b3, t2); // step 20\n Z3 = Fp.add(X3, Z3);\n X3 = Fp.sub(t1, Z3);\n Z3 = Fp.add(t1, Z3);\n Y3 = Fp.mul(X3, Z3);\n t1 = Fp.add(t0, t0); // step 25\n t1 = Fp.add(t1, t0);\n t2 = Fp.mul(a, t2);\n t4 = Fp.mul(b3, t4);\n t1 = Fp.add(t1, t2);\n t2 = Fp.sub(t0, t2); // step 30\n t2 = Fp.mul(a, t2);\n t4 = Fp.add(t4, t2);\n t0 = Fp.mul(t1, t4);\n Y3 = Fp.add(Y3, t0);\n t0 = Fp.mul(t5, t4); // step 35\n X3 = Fp.mul(t3, X3);\n X3 = Fp.sub(X3, t0);\n t0 = Fp.mul(t3, t1);\n Z3 = Fp.mul(t5, Z3);\n Z3 = Fp.add(Z3, t0); // step 40\n return new Point(X3, Y3, Z3);\n }\n\n subtract(other: Point) {\n return this.add(other.negate());\n }\n\n is0(): boolean {\n return this.equals(Point.ZERO);\n }\n\n /**\n * Constant time multiplication.\n * Uses wNAF method. Windowed method may be 10% faster,\n * but takes 2x longer to generate and consumes 2x memory.\n * Uses precomputes when available.\n * Uses endomorphism for Koblitz curves.\n * @param scalar by which the point would be multiplied\n * @returns New point\n */\n multiply(scalar: bigint): Point {\n const { endo } = extraOpts;\n if (!Fn.isValidNot0(scalar)) throw new Error('invalid scalar: out of range'); // 0 is invalid\n let point: Point, fake: Point; // Fake point is used to const-time mult\n const mul = (n: bigint) => wnaf.cached(this, n, (p) => normalizeZ(Point, p));\n /** See docs for {@link EndomorphismOpts} */\n if (endo) {\n const { k1neg, k1, k2neg, k2 } = splitEndoScalarN(scalar);\n const { p: k1p, f: k1f } = mul(k1);\n const { p: k2p, f: k2f } = mul(k2);\n fake = k1f.add(k2f);\n point = finishEndo(endo.beta, k1p, k2p, k1neg, k2neg);\n } else {\n const { p, f } = mul(scalar);\n point = p;\n fake = f;\n }\n // Normalize `z` for both points, but return only real one\n return normalizeZ(Point, [point, fake])[0];\n }\n\n /**\n * Non-constant-time multiplication. Uses double-and-add algorithm.\n * It's faster, but should only be used when you don't care about\n * an exposed secret key e.g. sig verification, which works over *public* keys.\n */\n multiplyUnsafe(sc: bigint): Point {\n const { endo } = extraOpts;\n const p = this as Point;\n if (!Fn.isValid(sc)) throw new Error('invalid scalar: out of range'); // 0 is valid\n if (sc === _0n || p.is0()) return Point.ZERO;\n if (sc === _1n) return p; // fast-path\n if (wnaf.hasCache(this)) return this.multiply(sc);\n if (endo) {\n const { k1neg, k1, k2neg, k2 } = splitEndoScalarN(sc);\n const { p1, p2 } = mulEndoUnsafe(Point, p, k1, k2); // 30% faster vs wnaf.unsafe\n return finishEndo(endo.beta, p1, p2, k1neg, k2neg);\n } else {\n return wnaf.unsafe(p, sc);\n }\n }\n\n multiplyAndAddUnsafe(Q: Point, a: bigint, b: bigint): Point | undefined {\n const sum = this.multiplyUnsafe(a).add(Q.multiplyUnsafe(b));\n return sum.is0() ? undefined : sum;\n }\n\n /**\n * Converts Projective point to affine (x, y) coordinates.\n * @param invertedZ Z^-1 (inverted zero) - optional, precomputation is useful for invertBatch\n */\n toAffine(invertedZ?: T): AffinePoint<T> {\n return toAffineMemo(this, invertedZ);\n }\n\n /**\n * Checks whether Point is free of torsion elements (is in prime subgroup).\n * Always torsion-free for cofactor=1 curves.\n */\n isTorsionFree(): boolean {\n const { isTorsionFree } = extraOpts;\n if (cofactor === _1n) return true;\n if (isTorsionFree) return isTorsionFree(Point, this);\n return wnaf.unsafe(this, CURVE_ORDER).is0();\n }\n\n clearCofactor(): Point {\n const { clearCofactor } = extraOpts;\n if (cofactor === _1n) return this; // Fast-path\n if (clearCofactor) return clearCofactor(Point, this) as Point;\n return this.multiplyUnsafe(cofactor);\n }\n\n isSmallOrder(): boolean {\n // can we use this.clearCofactor()?\n return this.multiplyUnsafe(cofactor).is0();\n }\n\n toBytes(isCompressed = true): Uint8Array {\n abool(isCompressed, 'isCompressed');\n this.assertValidity();\n return encodePoint(Point, this, isCompressed);\n }\n\n toHex(isCompressed = true): string {\n return bytesToHex(this.toBytes(isCompressed));\n }\n\n toString() {\n return `<Point ${this.is0() ? 'ZERO' : this.toHex()}>`;\n }\n\n // TODO: remove\n get px(): T {\n return this.X;\n }\n get py(): T {\n return this.X;\n }\n get pz(): T {\n return this.Z;\n }\n toRawBytes(isCompressed = true): Uint8Array {\n return this.toBytes(isCompressed);\n }\n _setWindowSize(windowSize: number) {\n this.precompute(windowSize);\n }\n static normalizeZ(points: Point[]): Point[] {\n return normalizeZ(Point, points);\n }\n static msm(points: Point[], scalars: bigint[]): Point {\n return pippenger(Point, Fn, points, scalars);\n }\n static fromPrivateKey(privateKey: PrivKey) {\n return Point.BASE.multiply(_normFnElement(Fn, privateKey));\n }\n }\n const bits = Fn.BITS;\n const wnaf = new wNAF(Point, extraOpts.endo ? Math.ceil(bits / 2) : bits);\n Point.BASE.precompute(8); // Enable precomputes. Slows down first publicKey computation by 20ms.\n return Point;\n}\n\n/** Methods of ECDSA signature instance. */\nexport interface ECDSASignature {\n readonly r: bigint;\n readonly s: bigint;\n readonly recovery?: number;\n addRecoveryBit(recovery: number): ECDSASigRecovered;\n hasHighS(): boolean;\n toBytes(format?: string): Uint8Array;\n toHex(format?: string): string;\n\n /** @deprecated */\n assertValidity(): void;\n /** @deprecated */\n normalizeS(): ECDSASignature;\n /** @deprecated use standalone method `curve.recoverPublicKey(sig.toBytes('recovered'), msg)` */\n recoverPublicKey(msgHash: Hex): WeierstrassPoint<bigint>;\n /** @deprecated use `.toBytes('compact')` */\n toCompactRawBytes(): Uint8Array;\n /** @deprecated use `.toBytes('compact')` */\n toCompactHex(): string;\n /** @deprecated use `.toBytes('der')` */\n toDERRawBytes(): Uint8Array;\n /** @deprecated use `.toBytes('der')` */\n toDERHex(): string;\n}\nexport type ECDSASigRecovered = ECDSASignature & {\n readonly recovery: number;\n};\n/** Methods of ECDSA signature constructor. */\nexport type ECDSASignatureCons = {\n new (r: bigint, s: bigint, recovery?: number): ECDSASignature;\n fromBytes(bytes: Uint8Array, format?: ECDSASigFormat): ECDSASignature;\n fromHex(hex: string, format?: ECDSASigFormat): ECDSASignature;\n\n /** @deprecated use `.fromBytes(bytes, 'compact')` */\n fromCompact(hex: Hex): ECDSASignature;\n /** @deprecated use `.fromBytes(bytes, 'der')` */\n fromDER(hex: Hex): ECDSASignature;\n};\n\n// Points start with byte 0x02 when y is even; otherwise 0x03\nfunction pprefix(hasEvenY: boolean): Uint8Array {\n return Uint8Array.of(hasEvenY ? 0x02 : 0x03);\n}\n\n/**\n * Implementation of the Shallue and van de Woestijne method for any weierstrass curve.\n * TODO: check if there is a way to merge this with uvRatio in Edwards; move to modular.\n * b = True and y = sqrt(u / v) if (u / v) is square in F, and\n * b = False and y = sqrt(Z * (u / v)) otherwise.\n * @param Fp\n * @param Z\n * @returns\n */\nexport function SWUFpSqrtRatio<T>(\n Fp: IField<T>,\n Z: T\n): (u: T, v: T) => { isValid: boolean; value: T } {\n // Generic implementation\n const q = Fp.ORDER;\n let l = _0n;\n for (let o = q - _1n; o % _2n === _0n; o /= _2n) l += _1n;\n const c1 = l; // 1. c1, the largest integer such that 2^c1 divides q - 1.\n // We need 2n ** c1 and 2n ** (c1-1). We can't use **; but we can use <<.\n // 2n ** c1 == 2n << (c1-1)\n const _2n_pow_c1_1 = _2n << (c1 - _1n - _1n);\n const _2n_pow_c1 = _2n_pow_c1_1 * _2n;\n const c2 = (q - _1n) / _2n_pow_c1; // 2. c2 = (q - 1) / (2^c1) # Integer arithmetic\n const c3 = (c2 - _1n) / _2n; // 3. c3 = (c2 - 1) / 2 # Integer arithmetic\n const c4 = _2n_pow_c1 - _1n; // 4. c4 = 2^c1 - 1 # Integer arithmetic\n const c5 = _2n_pow_c1_1; // 5. c5 = 2^(c1 - 1) # Integer arithmetic\n const c6 = Fp.pow(Z, c2); // 6. c6 = Z^c2\n const c7 = Fp.pow(Z, (c2 + _1n) / _2n); // 7. c7 = Z^((c2 + 1) / 2)\n let sqrtRatio = (u: T, v: T): { isValid: boolean; value: T } => {\n let tv1 = c6; // 1. tv1 = c6\n let tv2 = Fp.pow(v, c4); // 2. tv2 = v^c4\n let tv3 = Fp.sqr(tv2); // 3. tv3 = tv2^2\n tv3 = Fp.mul(tv3, v); // 4. tv3 = tv3 * v\n let tv5 = Fp.mul(u, tv3); // 5. tv5 = u * tv3\n tv5 = Fp.pow(tv5, c3); // 6. tv5 = tv5^c3\n tv5 = Fp.mul(tv5, tv2); // 7. tv5 = tv5 * tv2\n tv2 = Fp.mul(tv5, v); // 8. tv2 = tv5 * v\n tv3 = Fp.mul(tv5, u); // 9. tv3 = tv5 * u\n let tv4 = Fp.mul(tv3, tv2); // 10. tv4 = tv3 * tv2\n tv5 = Fp.pow(tv4, c5); // 11. tv5 = tv4^c5\n let isQR = Fp.eql(tv5, Fp.ONE); // 12. isQR = tv5 == 1\n tv2 = Fp.mul(tv3, c7); // 13. tv2 = tv3 * c7\n tv5 = Fp.mul(tv4, tv1); // 14. tv5 = tv4 * tv1\n tv3 = Fp.cmov(tv2, tv3, isQR); // 15. tv3 = CMOV(tv2, tv3, isQR)\n tv4 = Fp.cmov(tv5, tv4, isQR); // 16. tv4 = CMOV(tv5, tv4, isQR)\n // 17. for i in (c1, c1 - 1, ..., 2):\n for (let i = c1; i > _1n; i--) {\n let tv5 = i - _2n; // 18. tv5 = i - 2\n tv5 = _2n << (tv5 - _1n); // 19. tv5 = 2^tv5\n let tvv5 = Fp.pow(tv4, tv5); // 20. tv5 = tv4^tv5\n const e1 = Fp.eql(tvv5, Fp.ONE); // 21. e1 = tv5 == 1\n tv2 = Fp.mul(tv3, tv1); // 22. tv2 = tv3 * tv1\n tv1 = Fp.mul(tv1, tv1); // 23. tv1 = tv1 * tv1\n tvv5 = Fp.mul(tv4, tv1); // 24. tv5 = tv4 * tv1\n tv3 = Fp.cmov(tv2, tv3, e1); // 25. tv3 = CMOV(tv2, tv3, e1)\n tv4 = Fp.cmov(tvv5, tv4, e1); // 26. tv4 = CMOV(tv5, tv4, e1)\n }\n return { isValid: isQR, value: tv3 };\n };\n if (Fp.ORDER % _4n === _3n) {\n // sqrt_ratio_3mod4(u, v)\n const c1 = (Fp.ORDER - _3n) / _4n; // 1. c1 = (q - 3) / 4 # Integer arithmetic\n const c2 = Fp.sqrt(Fp.neg(Z)); // 2. c2 = sqrt(-Z)\n sqrtRatio = (u: T, v: T) => {\n let tv1 = Fp.sqr(v); // 1. tv1 = v^2\n const tv2 = Fp.mul(u, v); // 2. tv2 = u * v\n tv1 = Fp.mul(tv1, tv2); // 3. tv1 = tv1 * tv2\n let y1 = Fp.pow(tv1, c1); // 4. y1 = tv1^c1\n y1 = Fp.mul(y1, tv2); // 5. y1 = y1 * tv2\n const y2 = Fp.mul(y1, c2); // 6. y2 = y1 * c2\n const tv3 = Fp.mul(Fp.sqr(y1), v); // 7. tv3 = y1^2; 8. tv3 = tv3 * v\n const isQR = Fp.eql(tv3, u); // 9. isQR = tv3 == u\n let y = Fp.cmov(y2, y1, isQR); // 10. y = CMOV(y2, y1, isQR)\n return { isValid: isQR, value: y }; // 11. return (isQR, y) isQR ? y : y*c2\n };\n }\n // No curves uses that\n // if (Fp.ORDER % _8n === _5n) // sqrt_ratio_5mod8\n return sqrtRatio;\n}\n/**\n * Simplified Shallue-van de Woestijne-Ulas Method\n * https://www.rfc-editor.org/rfc/rfc9380#section-6.6.2\n */\nexport function mapToCurveSimpleSWU<T>(\n Fp: IField<T>,\n opts: {\n A: T;\n B: T;\n Z: T;\n }\n): (u: T) => { x: T; y: T } {\n validateField(Fp);\n const { A, B, Z } = opts;\n if (!Fp.isValid(A) || !Fp.isValid(B) || !Fp.isValid(Z))\n throw new Error('mapToCurveSimpleSWU: invalid opts');\n const sqrtRatio = SWUFpSqrtRatio(Fp, Z);\n if (!Fp.isOdd) throw new Error('Field does not have .isOdd()');\n // Input: u, an element of F.\n // Output: (x, y), a point on E.\n return (u: T): { x: T; y: T } => {\n // prettier-ignore\n let tv1, tv2, tv3, tv4, tv5, tv6, x, y;\n tv1 = Fp.sqr(u); // 1. tv1 = u^2\n tv1 = Fp.mul(tv1, Z); // 2. tv1 = Z * tv1\n tv2 = Fp.sqr(tv1); // 3. tv2 = tv1^2\n tv2 = Fp.add(tv2, tv1); // 4. tv2 = tv2 + tv1\n tv3 = Fp.add(tv2, Fp.ONE); // 5. tv3 = tv2 + 1\n tv3 = Fp.mul(tv3, B); // 6. tv3 = B * tv3\n tv4 = Fp.cmov(Z, Fp.neg(tv2), !Fp.eql(tv2, Fp.ZERO)); // 7. tv4 = CMOV(Z, -tv2, tv2 != 0)\n tv4 = Fp.mul(tv4, A); // 8. tv4 = A * tv4\n tv2 = Fp.sqr(tv3); // 9. tv2 = tv3^2\n tv6 = Fp.sqr(tv4); // 10. tv6 = tv4^2\n tv5 = Fp.mul(tv6, A); // 11. tv5 = A * tv6\n tv2 = Fp.add(tv2, tv5); // 12. tv2 = tv2 + tv5\n tv2 = Fp.mul(tv2, tv3); // 13. tv2 = tv2 * tv3\n tv6 = Fp.mul(tv6, tv4); // 14. tv6 = tv6 * tv4\n tv5 = Fp.mul(tv6, B); // 15. tv5 = B * tv6\n tv2 = Fp.add(tv2, tv5); // 16. tv2 = tv2 + tv5\n x = Fp.mul(tv1, tv3); // 17. x = tv1 * tv3\n const { isValid, value } = sqrtRatio(tv2, tv6); // 18. (is_gx1_square, y1) = sqrt_ratio(tv2, tv6)\n y = Fp.mul(tv1, u); // 19. y = tv1 * u -> Z * u^3 * y1\n y = Fp.mul(y, value); // 20. y = y * y1\n x = Fp.cmov(x, tv3, isValid); // 21. x = CMOV(x, tv3, is_gx1_square)\n y = Fp.cmov(y, value, isValid); // 22. y = CMOV(y, y1, is_gx1_square)\n const e1 = Fp.isOdd!(u) === Fp.isOdd!(y); // 23. e1 = sgn0(u) == sgn0(y)\n y = Fp.cmov(Fp.neg(y), y, e1); // 24. y = CMOV(-y, y, e1)\n const tv4_inv = FpInvertBatch(Fp, [tv4], true)[0];\n x = Fp.mul(x, tv4_inv); // 25. x = x / tv4\n return { x, y };\n };\n}\n\nfunction getWLengths<T>(Fp: IField<T>, Fn: IField<bigint>) {\n return {\n secretKey: Fn.BYTES,\n publicKey: 1 + Fp.BYTES,\n publicKeyUncompressed: 1 + 2 * Fp.BYTES,\n publicKeyHasPrefix: true,\n signature: 2 * Fn.BYTES,\n };\n}\n\n/**\n * Sometimes users only need getPublicKey, getSharedSecret, and secret key handling.\n * This helper ensures no signature functionality is present. Less code, smaller bundle size.\n */\nexport function ecdh(\n Point: WeierstrassPointCons<bigint>,\n ecdhOpts: { randomBytes?: (bytesLength?: number) => Uint8Array } = {}\n): ECDH {\n const { Fn } = Point;\n const randomBytes_ = ecdhOpts.randomBytes || randomBytesWeb;\n const lengths = Object.assign(getWLengths(Point.Fp, Fn), { seed: getMinHashLength(Fn.ORDER) });\n\n function isValidSecretKey(secretKey: PrivKey) {\n try {\n return !!_normFnElement(Fn, secretKey);\n } catch (error) {\n return false;\n }\n }\n\n function isValidPublicKey(publicKey: Uint8Array, isCompressed?: boolean): boolean {\n const { publicKey: comp, publicKeyUncompressed } = lengths;\n try {\n const l = publicKey.length;\n if (isCompressed === true && l !== comp) return false;\n if (isCompressed === false && l !== publicKeyUncompressed) return false;\n return !!Point.fromBytes(publicKey);\n } catch (error) {\n return false;\n }\n }\n\n /**\n * Produces cryptographically secure secret key from random of size\n * (groupLen + ceil(groupLen / 2)) with modulo bias being negligible.\n */\n function randomSecretKey(seed = randomBytes_(lengths.seed)): Uint8Array {\n return mapHashToField(abytes(seed, lengths.seed, 'seed'), Fn.ORDER);\n }\n\n /**\n * Computes public key for a secret key. Checks for validity of the secret key.\n * @param isCompressed whether to return compact (default), or full key\n * @returns Public key, full when isCompressed=false; short when isCompressed=true\n */\n function getPublicKey(secretKey: PrivKey, isCompressed = true): Uint8Array {\n return Point.BASE.multiply(_normFnElement(Fn, secretKey)).toBytes(isCompressed);\n }\n\n function keygen(seed?: Uint8Array) {\n const secretKey = randomSecretKey(seed);\n return { secretKey, publicKey: getPublicKey(secretKey) };\n }\n\n /**\n * Quick and dirty check for item being public key. Does not validate hex, or being on-curve.\n */\n function isProbPub(item: PrivKey | PubKey): boolean | undefined {\n if (typeof item === 'bigint') return false;\n if (item instanceof Point) return true;\n const { secretKey, publicKey, publicKeyUncompressed } = lengths;\n if (Fn.allowedLengths || secretKey === publicKey) return undefined;\n const l = ensureBytes('key', item).length;\n return l === publicKey || l === publicKeyUncompressed;\n }\n\n /**\n * ECDH (Elliptic Curve Diffie Hellman).\n * Computes shared public key from secret key A and public key B.\n * Checks: 1) secret key validity 2) shared key is on-curve.\n * Does NOT hash the result.\n * @param isCompressed whether to return compact (default), or full key\n * @returns shared public key\n */\n function getSharedSecret(secretKeyA: PrivKey, publicKeyB: Hex, isCompressed = true): Uint8Array {\n if (isProbPub(secretKeyA) === true) throw new Error('first arg must be private key');\n if (isProbPub(publicKeyB) === false) throw new Error('second arg must be public key');\n const s = _normFnElement(Fn, secretKeyA);\n const b = Point.fromHex(publicKeyB); // checks for being on-curve\n return b.multiply(s).toBytes(isCompressed);\n }\n\n const utils = {\n isValidSecretKey,\n isValidPublicKey,\n randomSecretKey,\n\n // TODO: remove\n isValidPrivateKey: isValidSecretKey,\n randomPrivateKey: randomSecretKey,\n normPrivateKeyToScalar: (key: PrivKey) => _normFnElement(Fn, key),\n precompute(windowSize = 8, point = Point.BASE): WeierstrassPoint<bigint> {\n return point.precompute(windowSize, false);\n },\n };\n\n return Object.freeze({ getPublicKey, getSharedSecret, keygen, Point, utils, lengths });\n}\n\n/**\n * Creates ECDSA signing interface for given elliptic curve `Point` and `hash` function.\n * We need `hash` for 2 features:\n * 1. Message prehash-ing. NOT used if `sign` / `verify` are called with `prehash: false`\n * 2. k generation in `sign`, using HMAC-drbg(hash)\n *\n * ECDSAOpts are only rarely needed.\n *\n * @example\n * ```js\n * const p256_Point = weierstrass(...);\n * const p256_sha256 = ecdsa(p256_Point, sha256);\n * const p256_sha224 = ecdsa(p256_Point, sha224);\n * const p256_sha224_r = ecdsa(p256_Point, sha224, { randomBytes: (length) => { ... } });\n * ```\n */\nexport function ecdsa(\n Point: WeierstrassPointCons<bigint>,\n hash: CHash,\n ecdsaOpts: ECDSAOpts = {}\n): ECDSA {\n ahash(hash);\n _validateObject(\n ecdsaOpts,\n {},\n {\n hmac: 'function',\n lowS: 'boolean',\n randomBytes: 'function',\n bits2int: 'function',\n bits2int_modN: 'function',\n }\n );\n\n const randomBytes = ecdsaOpts.randomBytes || randomBytesWeb;\n const hmac: HmacFnSync =\n ecdsaOpts.hmac ||\n (((key, ...msgs) => nobleHmac(hash, key, concatBytes(...msgs))) satisfies HmacFnSync);\n\n const { Fp, Fn } = Point;\n const { ORDER: CURVE_ORDER, BITS: fnBits } = Fn;\n const { keygen, getPublicKey, getSharedSecret, utils, lengths } = ecdh(Point, ecdsaOpts);\n const defaultSigOpts: Required<ECDSASignOpts> = {\n prehash: false,\n lowS: typeof ecdsaOpts.lowS === 'boolean' ? ecdsaOpts.lowS : false,\n format: undefined as any, //'compact' as ECDSASigFormat,\n extraEntropy: false,\n };\n const defaultSigOpts_format = 'compact';\n\n function isBiggerThanHalfOrder(number: bigint) {\n const HALF = CURVE_ORDER >> _1n;\n return number > HALF;\n }\n function validateRS(title: string, num: bigint): bigint {\n if (!Fn.isValidNot0(num))\n throw new Error(`invalid signature ${title}: out of range 1..Point.Fn.ORDER`);\n return num;\n }\n function validateSigLength(bytes: Uint8Array, format: ECDSASigFormat) {\n validateSigFormat(format);\n const size = lengths.signature!;\n const sizer = format === 'compact' ? size : format === 'recovered' ? size + 1 : undefined;\n return abytes(bytes, sizer, `${format} signature`);\n }\n\n /**\n * ECDSA signature with its (r, s) properties. Supports compact, recovered & DER representations.\n */\n class Signature implements ECDSASignature {\n readonly r: bigint;\n readonly s: bigint;\n readonly recovery?: number;\n constructor(r: bigint, s: bigint, recovery?: number) {\n this.r = validateRS('r', r); // r in [1..N-1];\n this.s = validateRS('s', s); // s in [1..N-1];\n if (recovery != null) this.recovery = recovery;\n Object.freeze(this);\n }\n\n static fromBytes(bytes: Uint8Array, format: ECDSASigFormat = defaultSigOpts_format): Signature {\n validateSigLength(bytes, format);\n let recid: number | undefined;\n if (format === 'der') {\n const { r, s } = DER.toSig(abytes(bytes));\n return new Signature(r, s);\n }\n if (format === 'recovered') {\n recid = bytes[0];\n format = 'compact';\n bytes = bytes.subarray(1);\n }\n const L = Fn.BYTES;\n const r = bytes.subarray(0, L);\n const s = bytes.subarray(L, L * 2);\n return new Signature(Fn.fromBytes(r), Fn.fromBytes(s), recid);\n }\n\n static fromHex(hex: string, format?: ECDSASigFormat) {\n return this.fromBytes(hexToBytes(hex), format);\n }\n\n addRecoveryBit(recovery: number): RecoveredSignature {\n return new Signature(this.r, this.s, recovery) as RecoveredSignature;\n }\n\n recoverPublicKey(messageHash: Hex): WeierstrassPoint<bigint> {\n const FIELD_ORDER = Fp.ORDER;\n const { r, s, recovery: rec } = this;\n if (rec == null || ![0, 1, 2, 3].includes(rec)) throw new Error('recovery id invalid');\n\n // ECDSA recovery is hard for cofactor > 1 curves.\n // In sign, `r = q.x mod n`, and here we recover q.x from r.\n // While recovering q.x >= n, we need to add r+n for cofactor=1 curves.\n // However, for cofactor>1, r+n may not get q.x:\n // r+n*i would need to be done instead where i is unknown.\n // To easily get i, we either need to:\n // a. increase amount of valid recid values (4, 5...); OR\n // b. prohibit non-prime-order signatures (recid > 1).\n const hasCofactor = CURVE_ORDER * _2n < FIELD_ORDER;\n if (hasCofactor && rec > 1) throw new Error('recovery id is ambiguous for h>1 curve');\n\n const radj = rec === 2 || rec === 3 ? r + CURVE_ORDER : r;\n if (!Fp.isValid(radj)) throw new Error('recovery id 2 or 3 invalid');\n const x = Fp.toBytes(radj);\n const R = Point.fromBytes(concatBytes(pprefix((rec & 1) === 0), x));\n const ir = Fn.inv(radj); // r^-1\n const h = bits2int_modN(ensureBytes('msgHash', messageHash)); // Truncate hash\n const u1 = Fn.create(-h * ir); // -hr^-1\n const u2 = Fn.create(s * ir); // sr^-1\n // (sr^-1)R-(hr^-1)G = -(hr^-1)G + (sr^-1). unsafe is fine: there is no private data.\n const Q = Point.BASE.multiplyUnsafe(u1).add(R.multiplyUnsafe(u2));\n if (Q.is0()) throw new Error('point at infinify');\n Q.assertValidity();\n return Q;\n }\n\n // Signatures should be low-s, to prevent malleability.\n hasHighS(): boolean {\n return isBiggerThanHalfOrder(this.s);\n }\n\n toBytes(format: ECDSASigFormat = defaultSigOpts_format) {\n validateSigFormat(format);\n if (format === 'der') return hexToBytes(DER.hexFromSig(this));\n const r = Fn.toBytes(this.r);\n const s = Fn.toBytes(this.s);\n if (format === 'recovered') {\n if (this.recovery == null) throw new Error('recovery bit must be present');\n return concatBytes(Uint8Array.of(this.recovery), r, s);\n }\n return concatBytes(r, s);\n }\n\n toHex(format?: ECDSASigFormat) {\n return bytesToHex(this.toBytes(format));\n }\n\n // TODO: remove\n assertValidity(): void {}\n static fromCompact(hex: Hex) {\n return Signature.fromBytes(ensureBytes('sig', hex), 'compact');\n }\n static fromDER(hex: Hex) {\n return Signature.fromBytes(ensureBytes('sig', hex), 'der');\n }\n normalizeS() {\n return this.hasHighS() ? new Signature(this.r, Fn.neg(this.s), this.recovery) : this;\n }\n toDERRawBytes() {\n return this.toBytes('der');\n }\n toDERHex() {\n return bytesToHex(this.toBytes('der'));\n }\n toCompactRawBytes() {\n return this.toBytes('compact');\n }\n toCompactHex() {\n return bytesToHex(this.toBytes('compact'));\n }\n }\n type RecoveredSignature = Signature & { recovery: number };\n\n // RFC6979: ensure ECDSA msg is X bytes and < N. RFC suggests optional truncating via bits2octets.\n // FIPS 186-4 4.6 suggests the leftmost min(nBitLen, outLen) bits, which matches bits2int.\n // bits2int can produce res>N, we can do mod(res, N) since the bitLen is the same.\n // int2octets can't be used; pads small msgs with 0: unacceptatble for trunc as per RFC vectors\n const bits2int =\n ecdsaOpts.bits2int ||\n function bits2int_def(bytes: Uint8Array): bigint {\n // Our custom check \"just in case\", for protection against DoS\n if (bytes.length > 8192) throw new Error('input is too large');\n // For curves with nBitLength % 8 !== 0: bits2octets(bits2octets(m)) !== bits2octets(m)\n // for some cases, since bytes.length * 8 is not actual bitLength.\n const num = bytesToNumberBE(bytes); // check for == u8 done here\n const delta = bytes.length * 8 - fnBits; // truncate to nBitLength leftmost bits\n return delta > 0 ? num >> BigInt(delta) : num;\n };\n const bits2int_modN =\n ecdsaOpts.bits2int_modN ||\n function bits2int_modN_def(bytes: Uint8Array): bigint {\n return Fn.create(bits2int(bytes)); // can't use bytesToNumberBE here\n };\n // Pads output with zero as per spec\n const ORDER_MASK = bitMask(fnBits);\n /** Converts to bytes. Checks if num in `[0..ORDER_MASK-1]` e.g.: `[0..2^256-1]`. */\n function int2octets(num: bigint): Uint8Array {\n // IMPORTANT: the check ensures working for case `Fn.BYTES != Fn.BITS * 8`\n aInRange('num < 2^' + fnBits, num, _0n, ORDER_MASK);\n return Fn.toBytes(num);\n }\n\n function validateMsgAndHash(message: Uint8Array, prehash: boolean) {\n abytes(message, undefined, 'message');\n return prehash ? abytes(hash(message), undefined, 'prehashed message') : message;\n }\n\n /**\n * Steps A, D of RFC6979 3.2.\n * Creates RFC6979 seed; converts msg/privKey to numbers.\n * Used only in sign, not in verify.\n *\n * Warning: we cannot assume here that message has same amount of bytes as curve order,\n * this will be invalid at least for P521. Also it can be bigger for P224 + SHA256.\n */\n function prepSig(message: Uint8Array, privateKey: PrivKey, opts: ECDSASignOpts) {\n if (['recovered', 'canonical'].some((k) => k in opts))\n throw new Error('sign() legacy options not supported');\n const { lowS, prehash, extraEntropy } = validateSigOpts(opts, defaultSigOpts);\n message = validateMsgAndHash(message, prehash); // RFC6979 3.2 A: h1 = H(m)\n // We can't later call bits2octets, since nested bits2int is broken for curves\n // with fnBits % 8 !== 0. Because of that, we unwrap it here as int2octets call.\n // const bits2octets = (bits) => int2octets(bits2int_modN(bits))\n const h1int = bits2int_modN(message);\n const d = _normFnElement(Fn, privateKey); // validate secret key, convert to bigint\n const seedArgs = [int2octets(d), int2octets(h1int)];\n // extraEntropy. RFC6979 3.6: additional k' (optional).\n if (extraEntropy != null && extraEntropy !== false) {\n // K = HMAC_K(V || 0x00 || int2octets(x) || bits2octets(h1) || k')\n // gen random bytes OR pass as-is\n const e = extraEntropy === true ? randomBytes(lengths.secretKey) : extraEntropy;\n seedArgs.push(ensureBytes('extraEntropy', e)); // check for being bytes\n }\n const seed = concatBytes(...seedArgs); // Step D of RFC6979 3.2\n const m = h1int; // NOTE: no need to call bits2int second time here, it is inside truncateHash!\n // Converts signature params into point w r/s, checks result for validity.\n // To transform k => Signature:\n // q = k\u22C5G\n // r = q.x mod n\n // s = k^-1(m + rd) mod n\n // Can use scalar blinding b^-1(bm + bdr) where b \u2208 [1,q\u22121] according to\n // https://tches.iacr.org/index.php/TCHES/article/view/7337/6509. We've decided against it:\n // a) dependency on CSPRNG b) 15% slowdown c) doesn't really help since bigints are not CT\n function k2sig(kBytes: Uint8Array): RecoveredSignature | undefined {\n // RFC 6979 Section 3.2, step 3: k = bits2int(T)\n // Important: all mod() calls here must be done over N\n const k = bits2int(kBytes); // mod n, not mod p\n if (!Fn.isValidNot0(k)) return; // Valid scalars (including k) must be in 1..N-1\n const ik = Fn.inv(k); // k^-1 mod n\n const q = Point.BASE.multiply(k).toAffine(); // q = k\u22C5G\n const r = Fn.create(q.x); // r = q.x mod n\n if (r === _0n) return;\n const s = Fn.create(ik * Fn.create(m + r * d)); // Not using blinding here, see comment above\n if (s === _0n) return;\n let recovery = (q.x === r ? 0 : 2) | Number(q.y & _1n); // recovery bit (2 or 3, when q.x > n)\n let normS = s;\n if (lowS && isBiggerThanHalfOrder(s)) {\n normS = Fn.neg(s); // if lowS was passed, ensure s is always\n recovery ^= 1; // // in the bottom half of N\n }\n return new Signature(r, normS, recovery) as RecoveredSignature; // use normS, not s\n }\n return { seed, k2sig };\n }\n\n /**\n * Signs message hash with a secret key.\n *\n * ```\n * sign(m, d) where\n * k = rfc6979_hmac_drbg(m, d)\n * (x, y) = G \u00D7 k\n * r = x mod n\n * s = (m + dr) / k mod n\n * ```\n */\n function sign(message: Hex, secretKey: PrivKey, opts: ECDSASignOpts = {}): RecoveredSignature {\n message = ensureBytes('message', message);\n const { seed, k2sig } = prepSig(message, secretKey, opts); // Steps A, D of RFC6979 3.2.\n const drbg = createHmacDrbg<RecoveredSignature>(hash.outputLen, Fn.BYTES, hmac);\n const sig = drbg(seed, k2sig); // Steps B, C, D, E, F, G\n return sig;\n }\n\n function tryParsingSig(sg: Hex | SignatureLike) {\n // Try to deduce format\n let sig: Signature | undefined = undefined;\n const isHex = typeof sg === 'string' || isBytes(sg);\n const isObj =\n !isHex &&\n sg !== null &&\n typeof sg === 'object' &&\n typeof sg.r === 'bigint' &&\n typeof sg.s === 'bigint';\n if (!isHex && !isObj)\n throw new Error('invalid signature, expected Uint8Array, hex string or Signature instance');\n if (isObj) {\n sig = new Signature(sg.r, sg.s);\n } else if (isHex) {\n try {\n sig = Signature.fromBytes(ensureBytes('sig', sg), 'der');\n } catch (derError) {\n if (!(derError instanceof DER.Err)) throw derError;\n }\n if (!sig) {\n try {\n sig = Signature.fromBytes(ensureBytes('sig', sg), 'compact');\n } catch (error) {\n return false;\n }\n }\n }\n if (!sig) return false;\n return sig;\n }\n\n /**\n * Verifies a signature against message and public key.\n * Rejects lowS signatures by default: see {@link ECDSAVerifyOpts}.\n * Implements section 4.1.4 from https://www.secg.org/sec1-v2.pdf:\n *\n * ```\n * verify(r, s, h, P) where\n * u1 = hs^-1 mod n\n * u2 = rs^-1 mod n\n * R = u1\u22C5G + u2\u22C5P\n * mod(R.x, n) == r\n * ```\n */\n function verify(\n signature: Hex | SignatureLike,\n message: Hex,\n publicKey: Hex,\n opts: ECDSAVerifyOpts = {}\n ): boolean {\n const { lowS, prehash, format } = validateSigOpts(opts, defaultSigOpts);\n publicKey = ensureBytes('publicKey', publicKey);\n message = validateMsgAndHash(ensureBytes('message', message), prehash);\n if ('strict' in opts) throw new Error('options.strict was renamed to lowS');\n const sig =\n format === undefined\n ? tryParsingSig(signature)\n : Signature.fromBytes(ensureBytes('sig', signature as Hex), format);\n if (sig === false) return false;\n try {\n const P = Point.fromBytes(publicKey);\n if (lowS && sig.hasHighS()) return false;\n const { r, s } = sig;\n const h = bits2int_modN(message); // mod n, not mod p\n const is = Fn.inv(s); // s^-1 mod n\n const u1 = Fn.create(h * is); // u1 = hs^-1 mod n\n const u2 = Fn.create(r * is); // u2 = rs^-1 mod n\n const R = Point.BASE.multiplyUnsafe(u1).add(P.multiplyUnsafe(u2)); // u1\u22C5G + u2\u22C5P\n if (R.is0()) return false;\n const v = Fn.create(R.x); // v = r.x mod n\n return v === r;\n } catch (e) {\n return false;\n }\n }\n\n function recoverPublicKey(\n signature: Uint8Array,\n message: Uint8Array,\n opts: ECDSARecoverOpts = {}\n ): Uint8Array {\n const { prehash } = validateSigOpts(opts, defaultSigOpts);\n message = validateMsgAndHash(message, prehash);\n return Signature.fromBytes(signature, 'recovered').recoverPublicKey(message).toBytes();\n }\n\n return Object.freeze({\n keygen,\n getPublicKey,\n getSharedSecret,\n utils,\n lengths,\n Point,\n sign,\n verify,\n recoverPublicKey,\n Signature,\n hash,\n });\n}\n\n// TODO: remove everything below\n/** @deprecated */\nexport type SignatureType = ECDSASignature;\n/** @deprecated */\nexport type RecoveredSignatureType = ECDSASigRecovered;\n/** @deprecated */\nexport type SignatureLike = { r: bigint; s: bigint };\n/** @deprecated use `Uint8Array | boolean` */\nexport type Entropy = Hex | boolean;\nexport type BasicWCurve<T> = BasicCurve<T> & {\n // Params: a, b\n a: T;\n b: T;\n\n // Optional params\n allowedPrivateKeyLengths?: readonly number[]; // for P521\n wrapPrivateKey?: boolean; // bls12-381 requires mod(n) instead of rejecting keys >= n\n endo?: EndomorphismOpts;\n // When a cofactor != 1, there can be an effective methods to:\n // 1. Determine whether a point is torsion-free\n isTorsionFree?: (c: WeierstrassPointCons<T>, point: WeierstrassPoint<T>) => boolean;\n // 2. Clear torsion component\n clearCofactor?: (c: WeierstrassPointCons<T>, point: WeierstrassPoint<T>) => WeierstrassPoint<T>;\n};\n/** @deprecated use ECDSASignOpts */\nexport type SignOpts = ECDSASignOpts;\n/** @deprecated use ECDSASignOpts */\nexport type VerOpts = ECDSAVerifyOpts;\n\n/** @deprecated use WeierstrassPoint */\nexport type ProjPointType<T> = WeierstrassPoint<T>;\n/** @deprecated use WeierstrassPointCons */\nexport type ProjConstructor<T> = WeierstrassPointCons<T>;\n\n// TODO: remove\nexport type CurvePointsType<T> = BasicWCurve<T> & {\n fromBytes?: (bytes: Uint8Array) => AffinePoint<T>;\n toBytes?: (\n c: WeierstrassPointCons<T>,\n point: WeierstrassPoint<T>,\n isCompressed: boolean\n ) => Uint8Array;\n};\n\n// LegacyWeierstrassOpts\nexport type CurvePointsTypeWithLength<T> = Readonly<CurvePointsType<T> & Partial<NLength>>;\n\n// LegacyWeierstrass\nexport type CurvePointsRes<T> = {\n Point: WeierstrassPointCons<T>;\n\n /** @deprecated use `Point.CURVE()` */\n CURVE: CurvePointsType<T>;\n /** @deprecated use `Point` */\n ProjectivePoint: WeierstrassPointCons<T>;\n /** @deprecated use `Point.Fn.fromBytes(privateKey)` */\n normPrivateKeyToScalar: (key: PrivKey) => bigint;\n /** @deprecated */\n weierstrassEquation: (x: T) => T;\n /** @deprecated use `Point.Fn.isValidNot0(num)` */\n isWithinCurveOrder: (num: bigint) => boolean;\n};\n\n// Aliases to legacy types\n// export type CurveType = LegacyECDSAOpts;\n// export type CurveFn = LegacyECDSA;\n// export type CurvePointsRes<T> = LegacyWeierstrass<T>;\n// export type CurvePointsType<T> = LegacyWeierstrassOpts<T>;\n// export type CurvePointsTypeWithLength<T> = LegacyWeierstrassOpts<T>;\n// export type BasicWCurve<T> = LegacyWeierstrassOpts<T>;\n\n/** @deprecated use `Uint8Array` */\nexport type PubKey = Hex | WeierstrassPoint<bigint>;\nexport type CurveType = BasicWCurve<bigint> & {\n hash: CHash; // CHash not FHash because we need outputLen for DRBG\n hmac?: HmacFnSync;\n randomBytes?: (bytesLength?: number) => Uint8Array;\n lowS?: boolean;\n bits2int?: (bytes: Uint8Array) => bigint;\n bits2int_modN?: (bytes: Uint8Array) => bigint;\n};\nexport type CurveFn = {\n /** @deprecated use `Point.CURVE()` */\n CURVE: CurvePointsType<bigint>;\n keygen: ECDSA['keygen'];\n getPublicKey: ECDSA['getPublicKey'];\n getSharedSecret: ECDSA['getSharedSecret'];\n sign: ECDSA['sign'];\n verify: ECDSA['verify'];\n Point: WeierstrassPointCons<bigint>;\n /** @deprecated use `Point` */\n ProjectivePoint: WeierstrassPointCons<bigint>;\n Signature: ECDSASignatureCons;\n utils: ECDSA['utils'];\n lengths: ECDSA['lengths'];\n};\n/** @deprecated use `weierstrass` in newer releases */\nexport function weierstrassPoints<T>(c: CurvePointsTypeWithLength<T>): CurvePointsRes<T> {\n const { CURVE, curveOpts } = _weierstrass_legacy_opts_to_new(c);\n const Point = weierstrassN(CURVE, curveOpts);\n return _weierstrass_new_output_to_legacy(c, Point);\n}\nexport type WsPointComposed<T> = {\n CURVE: WeierstrassOpts<T>;\n curveOpts: WeierstrassExtraOpts<T>;\n};\nexport type WsComposed = {\n /** @deprecated use `Point.CURVE()` */\n CURVE: WeierstrassOpts<bigint>;\n hash: CHash;\n curveOpts: WeierstrassExtraOpts<bigint>;\n ecdsaOpts: ECDSAOpts;\n};\nfunction _weierstrass_legacy_opts_to_new<T>(c: CurvePointsType<T>): WsPointComposed<T> {\n const CURVE: WeierstrassOpts<T> = {\n a: c.a,\n b: c.b,\n p: c.Fp.ORDER,\n n: c.n,\n h: c.h,\n Gx: c.Gx,\n Gy: c.Gy,\n };\n const Fp = c.Fp;\n let allowedLengths = c.allowedPrivateKeyLengths\n ? Array.from(new Set(c.allowedPrivateKeyLengths.map((l) => Math.ceil(l / 2))))\n : undefined;\n const Fn = Field(CURVE.n, {\n BITS: c.nBitLength,\n allowedLengths: allowedLengths,\n modFromBytes: c.wrapPrivateKey,\n });\n const curveOpts: WeierstrassExtraOpts<T> = {\n Fp,\n Fn,\n allowInfinityPoint: c.allowInfinityPoint,\n endo: c.endo,\n isTorsionFree: c.isTorsionFree,\n clearCofactor: c.clearCofactor,\n fromBytes: c.fromBytes,\n toBytes: c.toBytes,\n };\n return { CURVE, curveOpts };\n}\nfunction _ecdsa_legacy_opts_to_new(c: CurveType): WsComposed {\n const { CURVE, curveOpts } = _weierstrass_legacy_opts_to_new(c);\n const ecdsaOpts: ECDSAOpts = {\n hmac: c.hmac,\n randomBytes: c.randomBytes,\n lowS: c.lowS,\n bits2int: c.bits2int,\n bits2int_modN: c.bits2int_modN,\n };\n return { CURVE, curveOpts, hash: c.hash, ecdsaOpts };\n}\nexport function _legacyHelperEquat<T>(Fp: IField<T>, a: T, b: T): (x: T) => T {\n /**\n * y\u00B2 = x\u00B3 + ax + b: Short weierstrass curve formula. Takes x, returns y\u00B2.\n * @returns y\u00B2\n */\n function weierstrassEquation(x: T): T {\n const x2 = Fp.sqr(x); // x * x\n const x3 = Fp.mul(x2, x); // x\u00B2 * x\n return Fp.add(Fp.add(x3, Fp.mul(x, a)), b); // x\u00B3 + a * x + b\n }\n return weierstrassEquation;\n}\nfunction _weierstrass_new_output_to_legacy<T>(\n c: CurvePointsType<T>,\n Point: WeierstrassPointCons<T>\n): CurvePointsRes<T> {\n const { Fp, Fn } = Point;\n function isWithinCurveOrder(num: bigint): boolean {\n return inRange(num, _1n, Fn.ORDER);\n }\n const weierstrassEquation = _legacyHelperEquat(Fp, c.a, c.b);\n return Object.assign(\n {},\n {\n CURVE: c,\n Point: Point,\n ProjectivePoint: Point,\n normPrivateKeyToScalar: (key: PrivKey) => _normFnElement(Fn, key),\n weierstrassEquation,\n isWithinCurveOrder,\n }\n );\n}\nfunction _ecdsa_new_output_to_legacy(c: CurveType, _ecdsa: ECDSA): CurveFn {\n const Point = _ecdsa.Point;\n return Object.assign({}, _ecdsa, {\n ProjectivePoint: Point,\n CURVE: Object.assign({}, c, nLength(Point.Fn.ORDER, Point.Fn.BITS)),\n });\n}\n\n// _ecdsa_legacy\nexport function weierstrass(c: CurveType): CurveFn {\n const { CURVE, curveOpts, hash, ecdsaOpts } = _ecdsa_legacy_opts_to_new(c);\n const Point = weierstrassN(CURVE, curveOpts);\n const signs = ecdsa(Point, hash, ecdsaOpts);\n return _ecdsa_new_output_to_legacy(c, signs);\n}\n", "/**\n * Utilities for short weierstrass curves, combined with noble-hashes.\n * @module\n */\n/*! noble-curves - MIT License (c) 2022 Paul Miller (paulmillr.com) */\nimport { type CurveFn, type CurveType, weierstrass } from './abstract/weierstrass.ts';\nimport type { CHash } from './utils.ts';\n\n/** connects noble-curves to noble-hashes */\nexport function getHash(hash: CHash): { hash: CHash } {\n return { hash };\n}\n/** Same API as @noble/hashes, with ability to create curve with custom hash */\nexport type CurveDef = Readonly<Omit<CurveType, 'hash'>>;\nexport type CurveFnWithCreate = CurveFn & { create: (hash: CHash) => CurveFn };\n\n/** @deprecated use new `weierstrass()` and `ecdsa()` methods */\nexport function createCurve(curveDef: CurveDef, defHash: CHash): CurveFnWithCreate {\n const create = (hash: CHash): CurveFn => weierstrass({ ...curveDef, hash: hash });\n return { ...create(defHash), create };\n}\n", "/**\n * SECG secp256k1. See [pdf](https://www.secg.org/sec2-v2.pdf).\n *\n * Belongs to Koblitz curves: it has efficiently-computable GLV endomorphism \u03C8,\n * check out {@link EndomorphismOpts}. Seems to be rigid (not backdoored).\n * @module\n */\n/*! noble-curves - MIT License (c) 2022 Paul Miller (paulmillr.com) */\nimport { sha256 } from '@noble/hashes/sha2.js';\nimport { randomBytes } from '@noble/hashes/utils.js';\nimport { createCurve, type CurveFnWithCreate } from './_shortw_utils.ts';\nimport type { CurveLengths } from './abstract/curve.ts';\nimport {\n createHasher,\n type H2CHasher,\n type H2CMethod,\n isogenyMap,\n} from './abstract/hash-to-curve.ts';\nimport { Field, mapHashToField, mod, pow2 } from './abstract/modular.ts';\nimport {\n _normFnElement,\n type EndomorphismOpts,\n mapToCurveSimpleSWU,\n type WeierstrassPoint as PointType,\n type WeierstrassOpts,\n type WeierstrassPointCons,\n} from './abstract/weierstrass.ts';\nimport type { Hex, PrivKey } from './utils.ts';\nimport {\n bytesToNumberBE,\n concatBytes,\n ensureBytes,\n inRange,\n numberToBytesBE,\n utf8ToBytes,\n} from './utils.ts';\n\n// Seems like generator was produced from some seed:\n// `Point.BASE.multiply(Point.Fn.inv(2n, N)).toAffine().x`\n// // gives short x 0x3b78ce563f89a0ed9414f5aa28ad0d96d6795f9c63n\nconst secp256k1_CURVE: WeierstrassOpts<bigint> = {\n p: BigInt('0xfffffffffffffffffffffffffffffffffffffffffffffffffffffffefffffc2f'),\n n: BigInt('0xfffffffffffffffffffffffffffffffebaaedce6af48a03bbfd25e8cd0364141'),\n h: BigInt(1),\n a: BigInt(0),\n b: BigInt(7),\n Gx: BigInt('0x79be667ef9dcbbac55a06295ce870b07029bfcdb2dce28d959f2815b16f81798'),\n Gy: BigInt('0x483ada7726a3c4655da4fbfc0e1108a8fd17b448a68554199c47d08ffb10d4b8'),\n};\n\nconst secp256k1_ENDO: EndomorphismOpts = {\n beta: BigInt('0x7ae96a2b657c07106e64479eac3434e99cf0497512f58995c1396c28719501ee'),\n basises: [\n [BigInt('0x3086d221a7d46bcde86c90e49284eb15'), -BigInt('0xe4437ed6010e88286f547fa90abfe4c3')],\n [BigInt('0x114ca50f7a8e2f3f657c1108d9d44cfd8'), BigInt('0x3086d221a7d46bcde86c90e49284eb15')],\n ],\n};\n\nconst _0n = /* @__PURE__ */ BigInt(0);\nconst _1n = /* @__PURE__ */ BigInt(1);\nconst _2n = /* @__PURE__ */ BigInt(2);\n\n/**\n * \u221An = n^((p+1)/4) for fields p = 3 mod 4. We unwrap the loop and multiply bit-by-bit.\n * (P+1n/4n).toString(2) would produce bits [223x 1, 0, 22x 1, 4x 0, 11, 00]\n */\nfunction sqrtMod(y: bigint): bigint {\n const P = secp256k1_CURVE.p;\n // prettier-ignore\n const _3n = BigInt(3), _6n = BigInt(6), _11n = BigInt(11), _22n = BigInt(22);\n // prettier-ignore\n const _23n = BigInt(23), _44n = BigInt(44), _88n = BigInt(88);\n const b2 = (y * y * y) % P; // x^3, 11\n const b3 = (b2 * b2 * y) % P; // x^7\n const b6 = (pow2(b3, _3n, P) * b3) % P;\n const b9 = (pow2(b6, _3n, P) * b3) % P;\n const b11 = (pow2(b9, _2n, P) * b2) % P;\n const b22 = (pow2(b11, _11n, P) * b11) % P;\n const b44 = (pow2(b22, _22n, P) * b22) % P;\n const b88 = (pow2(b44, _44n, P) * b44) % P;\n const b176 = (pow2(b88, _88n, P) * b88) % P;\n const b220 = (pow2(b176, _44n, P) * b44) % P;\n const b223 = (pow2(b220, _3n, P) * b3) % P;\n const t1 = (pow2(b223, _23n, P) * b22) % P;\n const t2 = (pow2(t1, _6n, P) * b2) % P;\n const root = pow2(t2, _2n, P);\n if (!Fpk1.eql(Fpk1.sqr(root), y)) throw new Error('Cannot find square root');\n return root;\n}\n\nconst Fpk1 = Field(secp256k1_CURVE.p, { sqrt: sqrtMod });\n\n/**\n * secp256k1 curve, ECDSA and ECDH methods.\n *\n * Field: `2n**256n - 2n**32n - 2n**9n - 2n**8n - 2n**7n - 2n**6n - 2n**4n - 1n`\n *\n * @example\n * ```js\n * import { secp256k1 } from '@noble/curves/secp256k1';\n * const { secretKey, publicKey } = secp256k1.keygen();\n * const msg = new TextEncoder().encode('hello');\n * const sig = secp256k1.sign(msg, secretKey);\n * const isValid = secp256k1.verify(sig, msg, publicKey) === true;\n * ```\n */\nexport const secp256k1: CurveFnWithCreate = createCurve(\n { ...secp256k1_CURVE, Fp: Fpk1, lowS: true, endo: secp256k1_ENDO },\n sha256\n);\n\n// Schnorr signatures are superior to ECDSA from above. Below is Schnorr-specific BIP0340 code.\n// https://github.com/bitcoin/bips/blob/master/bip-0340.mediawiki\n/** An object mapping tags to their tagged hash prefix of [SHA256(tag) | SHA256(tag)] */\nconst TAGGED_HASH_PREFIXES: { [tag: string]: Uint8Array } = {};\nfunction taggedHash(tag: string, ...messages: Uint8Array[]): Uint8Array {\n let tagP = TAGGED_HASH_PREFIXES[tag];\n if (tagP === undefined) {\n const tagH = sha256(utf8ToBytes(tag));\n tagP = concatBytes(tagH, tagH);\n TAGGED_HASH_PREFIXES[tag] = tagP;\n }\n return sha256(concatBytes(tagP, ...messages));\n}\n\n// ECDSA compact points are 33-byte. Schnorr is 32: we strip first byte 0x02 or 0x03\nconst pointToBytes = (point: PointType<bigint>) => point.toBytes(true).slice(1);\nconst Pointk1 = /* @__PURE__ */ (() => secp256k1.Point)();\nconst hasEven = (y: bigint) => y % _2n === _0n;\n\n// Calculate point, scalar and bytes\nfunction schnorrGetExtPubKey(priv: PrivKey) {\n const { Fn, BASE } = Pointk1;\n const d_ = _normFnElement(Fn, priv);\n const p = BASE.multiply(d_); // P = d'\u22C5G; 0 < d' < n check is done inside\n const scalar = hasEven(p.y) ? d_ : Fn.neg(d_);\n return { scalar, bytes: pointToBytes(p) };\n}\n/**\n * lift_x from BIP340. Convert 32-byte x coordinate to elliptic curve point.\n * @returns valid point checked for being on-curve\n */\nfunction lift_x(x: bigint): PointType<bigint> {\n const Fp = Fpk1;\n if (!Fp.isValidNot0(x)) throw new Error('invalid x: Fail if x \u2265 p');\n const xx = Fp.create(x * x);\n const c = Fp.create(xx * x + BigInt(7)); // Let c = x\u00B3 + 7 mod p.\n let y = Fp.sqrt(c); // Let y = c^(p+1)/4 mod p. Same as sqrt().\n // Return the unique point P such that x(P) = x and\n // y(P) = y if y mod 2 = 0 or y(P) = p-y otherwise.\n if (!hasEven(y)) y = Fp.neg(y);\n const p = Pointk1.fromAffine({ x, y });\n p.assertValidity();\n return p;\n}\nconst num = bytesToNumberBE;\n/**\n * Create tagged hash, convert it to bigint, reduce modulo-n.\n */\nfunction challenge(...args: Uint8Array[]): bigint {\n return Pointk1.Fn.create(num(taggedHash('BIP0340/challenge', ...args)));\n}\n\n/**\n * Schnorr public key is just `x` coordinate of Point as per BIP340.\n */\nfunction schnorrGetPublicKey(secretKey: Hex): Uint8Array {\n return schnorrGetExtPubKey(secretKey).bytes; // d'=int(sk). Fail if d'=0 or d'\u2265n. Ret bytes(d'\u22C5G)\n}\n\n/**\n * Creates Schnorr signature as per BIP340. Verifies itself before returning anything.\n * auxRand is optional and is not the sole source of k generation: bad CSPRNG won't be dangerous.\n */\nfunction schnorrSign(message: Hex, secretKey: PrivKey, auxRand: Hex = randomBytes(32)): Uint8Array {\n const { Fn } = Pointk1;\n const m = ensureBytes('message', message);\n const { bytes: px, scalar: d } = schnorrGetExtPubKey(secretKey); // checks for isWithinCurveOrder\n const a = ensureBytes('auxRand', auxRand, 32); // Auxiliary random data a: a 32-byte array\n const t = Fn.toBytes(d ^ num(taggedHash('BIP0340/aux', a))); // Let t be the byte-wise xor of bytes(d) and hash/aux(a)\n const rand = taggedHash('BIP0340/nonce', t, px, m); // Let rand = hash/nonce(t || bytes(P) || m)\n // Let k' = int(rand) mod n. Fail if k' = 0. Let R = k'\u22C5G\n const { bytes: rx, scalar: k } = schnorrGetExtPubKey(rand);\n const e = challenge(rx, px, m); // Let e = int(hash/challenge(bytes(R) || bytes(P) || m)) mod n.\n const sig = new Uint8Array(64); // Let sig = bytes(R) || bytes((k + ed) mod n).\n sig.set(rx, 0);\n sig.set(Fn.toBytes(Fn.create(k + e * d)), 32);\n // If Verify(bytes(P), m, sig) (see below) returns failure, abort\n if (!schnorrVerify(sig, m, px)) throw new Error('sign: Invalid signature produced');\n return sig;\n}\n\n/**\n * Verifies Schnorr signature.\n * Will swallow errors & return false except for initial type validation of arguments.\n */\nfunction schnorrVerify(signature: Hex, message: Hex, publicKey: Hex): boolean {\n const { Fn, BASE } = Pointk1;\n const sig = ensureBytes('signature', signature, 64);\n const m = ensureBytes('message', message);\n const pub = ensureBytes('publicKey', publicKey, 32);\n try {\n const P = lift_x(num(pub)); // P = lift_x(int(pk)); fail if that fails\n const r = num(sig.subarray(0, 32)); // Let r = int(sig[0:32]); fail if r \u2265 p.\n if (!inRange(r, _1n, secp256k1_CURVE.p)) return false;\n const s = num(sig.subarray(32, 64)); // Let s = int(sig[32:64]); fail if s \u2265 n.\n if (!inRange(s, _1n, secp256k1_CURVE.n)) return false;\n // int(challenge(bytes(r)||bytes(P)||m))%n\n const e = challenge(Fn.toBytes(r), pointToBytes(P), m);\n // R = s\u22C5G - e\u22C5P, where -eP == (n-e)P\n const R = BASE.multiplyUnsafe(s).add(P.multiplyUnsafe(Fn.neg(e)));\n const { x, y } = R.toAffine();\n // Fail if is_infinite(R) / not has_even_y(R) / x(R) \u2260 r.\n if (R.is0() || !hasEven(y) || x !== r) return false;\n return true;\n } catch (error) {\n return false;\n }\n}\n\nexport type SecpSchnorr = {\n keygen: (seed?: Uint8Array) => { secretKey: Uint8Array; publicKey: Uint8Array };\n getPublicKey: typeof schnorrGetPublicKey;\n sign: typeof schnorrSign;\n verify: typeof schnorrVerify;\n Point: WeierstrassPointCons<bigint>;\n utils: {\n randomSecretKey: (seed?: Uint8Array) => Uint8Array;\n pointToBytes: (point: PointType<bigint>) => Uint8Array;\n lift_x: typeof lift_x;\n taggedHash: typeof taggedHash;\n\n /** @deprecated use `randomSecretKey` */\n randomPrivateKey: (seed?: Uint8Array) => Uint8Array;\n /** @deprecated use `utils` */\n numberToBytesBE: typeof numberToBytesBE;\n /** @deprecated use `utils` */\n bytesToNumberBE: typeof bytesToNumberBE;\n /** @deprecated use `modular` */\n mod: typeof mod;\n };\n lengths: CurveLengths;\n};\n/**\n * Schnorr signatures over secp256k1.\n * https://github.com/bitcoin/bips/blob/master/bip-0340.mediawiki\n * @example\n * ```js\n * import { schnorr } from '@noble/curves/secp256k1';\n * const { secretKey, publicKey } = schnorr.keygen();\n * // const publicKey = schnorr.getPublicKey(secretKey);\n * const msg = new TextEncoder().encode('hello');\n * const sig = schnorr.sign(msg, secretKey);\n * const isValid = schnorr.verify(sig, msg, publicKey);\n * ```\n */\nexport const schnorr: SecpSchnorr = /* @__PURE__ */ (() => {\n const size = 32;\n const seedLength = 48;\n const randomSecretKey = (seed = randomBytes(seedLength)): Uint8Array => {\n return mapHashToField(seed, secp256k1_CURVE.n);\n };\n // TODO: remove\n secp256k1.utils.randomSecretKey;\n function keygen(seed?: Uint8Array) {\n const secretKey = randomSecretKey(seed);\n return { secretKey, publicKey: schnorrGetPublicKey(secretKey) };\n }\n return {\n keygen,\n getPublicKey: schnorrGetPublicKey,\n sign: schnorrSign,\n verify: schnorrVerify,\n Point: Pointk1,\n utils: {\n randomSecretKey: randomSecretKey,\n randomPrivateKey: randomSecretKey,\n taggedHash,\n\n // TODO: remove\n lift_x,\n pointToBytes,\n numberToBytesBE,\n bytesToNumberBE,\n mod,\n },\n lengths: {\n secretKey: size,\n publicKey: size,\n publicKeyHasPrefix: false,\n signature: size * 2,\n seed: seedLength,\n },\n };\n})();\n\nconst isoMap = /* @__PURE__ */ (() =>\n isogenyMap(\n Fpk1,\n [\n // xNum\n [\n '0x8e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38daaaaa8c7',\n '0x7d3d4c80bc321d5b9f315cea7fd44c5d595d2fc0bf63b92dfff1044f17c6581',\n '0x534c328d23f234e6e2a413deca25caece4506144037c40314ecbd0b53d9dd262',\n '0x8e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38daaaaa88c',\n ],\n // xDen\n [\n '0xd35771193d94918a9ca34ccbb7b640dd86cd409542f8487d9fe6b745781eb49b',\n '0xedadc6f64383dc1df7c4b2d51b54225406d36b641f5e41bbc52a56612a8c6d14',\n '0x0000000000000000000000000000000000000000000000000000000000000001', // LAST 1\n ],\n // yNum\n [\n '0x4bda12f684bda12f684bda12f684bda12f684bda12f684bda12f684b8e38e23c',\n '0xc75e0c32d5cb7c0fa9d0a54b12a0a6d5647ab046d686da6fdffc90fc201d71a3',\n '0x29a6194691f91a73715209ef6512e576722830a201be2018a765e85a9ecee931',\n '0x2f684bda12f684bda12f684bda12f684bda12f684bda12f684bda12f38e38d84',\n ],\n // yDen\n [\n '0xfffffffffffffffffffffffffffffffffffffffffffffffffffffffefffff93b',\n '0x7a06534bb8bdb49fd5e9e6632722c2989467c1bfc8e8d978dfb425d2685c2573',\n '0x6484aa716545ca2cf3a70c3fa8fe337e0a3d21162f0d6299a7bf8192bfd2a76f',\n '0x0000000000000000000000000000000000000000000000000000000000000001', // LAST 1\n ],\n ].map((i) => i.map((j) => BigInt(j))) as [bigint[], bigint[], bigint[], bigint[]]\n ))();\nconst mapSWU = /* @__PURE__ */ (() =>\n mapToCurveSimpleSWU(Fpk1, {\n A: BigInt('0x3f8731abdd661adca08a5558f0f5d272e953d363cb6f0e5d405447c01a444533'),\n B: BigInt('1771'),\n Z: Fpk1.create(BigInt('-11')),\n }))();\n\n/** Hashing / encoding to secp256k1 points / field. RFC 9380 methods. */\nexport const secp256k1_hasher: H2CHasher<bigint> = /* @__PURE__ */ (() =>\n createHasher(\n secp256k1.Point,\n (scalars: bigint[]) => {\n const { x, y } = mapSWU(Fpk1.create(scalars[0]));\n return isoMap(x, y);\n },\n {\n DST: 'secp256k1_XMD:SHA-256_SSWU_RO_',\n encodeDST: 'secp256k1_XMD:SHA-256_SSWU_NU_',\n p: Fpk1.ORDER,\n m: 1,\n k: 128,\n expand: 'xmd',\n hash: sha256,\n }\n ))();\n\n/** @deprecated use `import { secp256k1_hasher } from '@noble/curves/secp256k1.js';` */\nexport const hashToCurve: H2CMethod<bigint> = /* @__PURE__ */ (() =>\n secp256k1_hasher.hashToCurve)();\n\n/** @deprecated use `import { secp256k1_hasher } from '@noble/curves/secp256k1.js';` */\nexport const encodeToCurve: H2CMethod<bigint> = /* @__PURE__ */ (() =>\n secp256k1_hasher.encodeToCurve)();\n", "/**\n * Signing a message failed\n */\nexport class SigningError extends Error {\n constructor (message = 'An error occurred while signing a message') {\n super(message)\n this.name = 'SigningError'\n }\n}\n\n/**\n * Verifying a message signature failed\n */\nexport class VerificationError extends Error {\n constructor (message = 'An error occurred while verifying a message') {\n super(message)\n this.name = 'VerificationError'\n }\n}\n\n/**\n * WebCrypto was not available in the current context\n */\nexport class WebCryptoMissingError extends Error {\n constructor (message = 'Missing Web Crypto API') {\n super(message)\n this.name = 'WebCryptoMissingError'\n }\n}\n", "import { base58btc } from 'multiformats/bases/base58'\nimport { CID } from 'multiformats/cid'\nimport { identity } from 'multiformats/hashes/identity'\nimport { equals as uint8ArrayEquals } from 'uint8arrays/equals'\nimport { publicKeyToProtobuf } from '../index.js'\nimport { validateSecp256k1PublicKey, compressSecp256k1PublicKey, computeSecp256k1PublicKey, validateSecp256k1PrivateKey } from './utils.js'\nimport { hashAndVerify, hashAndSign } from './index.js'\nimport type { Secp256k1PublicKey as Secp256k1PublicKeyInterface, Secp256k1PrivateKey as Secp256k1PrivateKeyInterface, AbortOptions } from '@libp2p/interface'\nimport type { Digest } from 'multiformats/hashes/digest'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nexport class Secp256k1PublicKey implements Secp256k1PublicKeyInterface {\n public readonly type = 'secp256k1'\n public readonly raw: Uint8Array\n public readonly _key: Uint8Array\n\n constructor (key: Uint8Array) {\n this._key = validateSecp256k1PublicKey(key)\n this.raw = compressSecp256k1PublicKey(this._key)\n }\n\n toMultihash (): Digest<0x0, number> {\n return identity.digest(publicKeyToProtobuf(this))\n }\n\n toCID (): CID<unknown, 114, 0x0, 1> {\n return CID.createV1(114, this.toMultihash())\n }\n\n toString (): string {\n return base58btc.encode(this.toMultihash().bytes).substring(1)\n }\n\n equals (key: any): boolean {\n if (key == null || !(key.raw instanceof Uint8Array)) {\n return false\n }\n\n return uint8ArrayEquals(this.raw, key.raw)\n }\n\n verify (data: Uint8Array | Uint8ArrayList, sig: Uint8Array, options?: AbortOptions): boolean {\n return hashAndVerify(this._key, sig, data, options)\n }\n}\n\nexport class Secp256k1PrivateKey implements Secp256k1PrivateKeyInterface {\n public readonly type = 'secp256k1'\n public readonly raw: Uint8Array\n public readonly publicKey: Secp256k1PublicKey\n\n constructor (key: Uint8Array, publicKey?: Uint8Array) {\n this.raw = validateSecp256k1PrivateKey(key)\n this.publicKey = new Secp256k1PublicKey(publicKey ?? computeSecp256k1PublicKey(key))\n }\n\n equals (key?: any): boolean {\n if (key == null || !(key.raw instanceof Uint8Array)) {\n return false\n }\n\n return uint8ArrayEquals(this.raw, key.raw)\n }\n\n sign (message: Uint8Array | Uint8ArrayList, options?: AbortOptions): Uint8Array | Promise<Uint8Array> {\n return hashAndSign(this.raw, message, options)\n }\n}\n", "import { InvalidPrivateKeyError, InvalidPublicKeyError } from '@libp2p/interface'\nimport { secp256k1 as secp } from '@noble/curves/secp256k1'\nimport { Secp256k1PublicKey as Secp256k1PublicKeyClass, Secp256k1PrivateKey as Secp256k1PrivateKeyClass } from './secp256k1.js'\nimport type { Secp256k1PublicKey, Secp256k1PrivateKey } from '@libp2p/interface'\n\nconst PRIVATE_KEY_BYTE_LENGTH = 32\n\nexport { PRIVATE_KEY_BYTE_LENGTH as privateKeyLength }\n\nexport function unmarshalSecp256k1PrivateKey (bytes: Uint8Array): Secp256k1PrivateKey {\n return new Secp256k1PrivateKeyClass(bytes)\n}\n\nexport function unmarshalSecp256k1PublicKey (bytes: Uint8Array): Secp256k1PublicKey {\n return new Secp256k1PublicKeyClass(bytes)\n}\n\nexport async function generateSecp256k1KeyPair (): Promise<Secp256k1PrivateKey> {\n const privateKeyBytes = generateSecp256k1PrivateKey()\n return new Secp256k1PrivateKeyClass(privateKeyBytes)\n}\n\nexport function compressSecp256k1PublicKey (key: Uint8Array): Uint8Array {\n const point = secp.ProjectivePoint.fromHex(key).toRawBytes(true)\n return point\n}\n\nexport function decompressSecp256k1PublicKey (key: Uint8Array): Uint8Array {\n const point = secp.ProjectivePoint.fromHex(key).toRawBytes(false)\n return point\n}\n\nexport function validateSecp256k1PrivateKey (key: Uint8Array): Uint8Array {\n try {\n secp.getPublicKey(key, true)\n\n return key\n } catch (err) {\n throw new InvalidPrivateKeyError(String(err))\n }\n}\n\nexport function validateSecp256k1PublicKey (key: Uint8Array): Uint8Array {\n try {\n secp.ProjectivePoint.fromHex(key)\n\n return key\n } catch (err) {\n throw new InvalidPublicKeyError(String(err))\n }\n}\n\nexport function computeSecp256k1PublicKey (privateKey: Uint8Array): Uint8Array {\n try {\n return secp.getPublicKey(privateKey, true)\n } catch (err) {\n throw new InvalidPrivateKeyError(String(err))\n }\n}\n\nexport function generateSecp256k1PrivateKey (): Uint8Array {\n return secp.utils.randomPrivateKey()\n}\n", "/**\n * @packageDocumentation\n *\n * ## Supported Key Types\n *\n * Currently the `'RSA'`, `'ed25519'`, and `secp256k1` types are supported, although ed25519 and secp256k1 keys support only signing and verification of messages.\n *\n * For encryption / decryption support, RSA keys should be used.\n */\n\nimport { InvalidParametersError, UnsupportedKeyTypeError } from '@libp2p/interface'\nimport { ECDSAPrivateKey as ECDSAPrivateKeyClass } from './ecdsa/ecdsa.js'\nimport { ECDSA_P_256_OID, ECDSA_P_384_OID, ECDSA_P_521_OID } from './ecdsa/index.js'\nimport { generateECDSAKeyPair, pkiMessageToECDSAPrivateKey, pkiMessageToECDSAPublicKey, unmarshalECDSAPrivateKey, unmarshalECDSAPublicKey } from './ecdsa/utils.js'\nimport { privateKeyLength as ed25519PrivateKeyLength, publicKeyLength as ed25519PublicKeyLength } from './ed25519/index.js'\nimport { generateEd25519KeyPair, generateEd25519KeyPairFromSeed, unmarshalEd25519PrivateKey, unmarshalEd25519PublicKey } from './ed25519/utils.js'\nimport * as pb from './keys.js'\nimport { decodeDer } from './rsa/der.js'\nimport { RSAES_PKCS1_V1_5_OID } from './rsa/index.js'\nimport { pkcs1ToRSAPrivateKey, pkixToRSAPublicKey, generateRSAKeyPair, pkcs1MessageToRSAPrivateKey, pkixMessageToRSAPublicKey, jwkToRSAPrivateKey } from './rsa/utils.js'\nimport { privateKeyLength as secp256k1PrivateKeyLength, publicKeyLength as secp256k1PublicKeyLength } from './secp256k1/index.js'\nimport { generateSecp256k1KeyPair, unmarshalSecp256k1PrivateKey, unmarshalSecp256k1PublicKey } from './secp256k1/utils.js'\nimport type { Curve } from './ecdsa/index.js'\nimport type { PrivateKey, PublicKey, KeyType, RSAPrivateKey, Secp256k1PrivateKey, Ed25519PrivateKey, Secp256k1PublicKey, Ed25519PublicKey, ECDSAPrivateKey, ECDSAPublicKey } from '@libp2p/interface'\nimport type { MultihashDigest } from 'multiformats'\nimport type { Digest } from 'multiformats/hashes/digest'\n\nexport { generateEphemeralKeyPair } from './ecdh/index.js'\nexport type { Curve } from './ecdh/index.js'\nexport type { ECDHKey, EnhancedKey, EnhancedKeyPair, ECDHKeyPair } from './interface.js'\nexport { keyStretcher } from './key-stretcher.js'\n\n/**\n * Generates a keypair of the given type and bitsize\n */\nexport async function generateKeyPair (type: 'Ed25519'): Promise<Ed25519PrivateKey>\nexport async function generateKeyPair (type: 'secp256k1'): Promise<Secp256k1PrivateKey>\nexport async function generateKeyPair (type: 'ECDSA', curve?: Curve): Promise<ECDSAPrivateKey>\nexport async function generateKeyPair (type: 'RSA', bits?: number): Promise<RSAPrivateKey>\nexport async function generateKeyPair (type: KeyType, bits?: number): Promise<PrivateKey>\nexport async function generateKeyPair (type: KeyType, bits?: number | string): Promise<unknown> {\n if (type === 'Ed25519') {\n return generateEd25519KeyPair()\n }\n\n if (type === 'secp256k1') {\n return generateSecp256k1KeyPair()\n }\n\n if (type === 'RSA') {\n return generateRSAKeyPair(toBits(bits))\n }\n\n if (type === 'ECDSA') {\n return generateECDSAKeyPair(toCurve(bits))\n }\n\n throw new UnsupportedKeyTypeError()\n}\n\n/**\n * Generates a keypair of the given type from the passed seed. Currently only\n * supports Ed25519 keys.\n *\n * Seed is a 32 byte uint8array\n */\nexport async function generateKeyPairFromSeed (type: 'Ed25519', seed: Uint8Array): Promise<Ed25519PrivateKey>\nexport async function generateKeyPairFromSeed <T extends KeyType> (type: T, seed: Uint8Array, bits?: number): Promise<never>\nexport async function generateKeyPairFromSeed (type: string, seed: Uint8Array): Promise<unknown> {\n if (type !== 'Ed25519') {\n throw new UnsupportedKeyTypeError('Seed key derivation only supported for Ed25519 keys')\n }\n\n return generateEd25519KeyPairFromSeed(seed)\n}\n\n/**\n * Converts a protobuf serialized public key into its representative object.\n *\n * For RSA public keys optionally pass the multihash digest of the public key if\n * it is known. If the digest is omitted it will be calculated which can be\n * expensive.\n *\n * For other key types the digest option is ignored.\n */\nexport function publicKeyFromProtobuf (buf: Uint8Array, digest?: Digest<18, number>): PublicKey {\n const { Type, Data } = pb.PublicKey.decode(buf)\n const data = Data ?? new Uint8Array()\n\n switch (Type) {\n case pb.KeyType.RSA:\n return pkixToRSAPublicKey(data, digest)\n case pb.KeyType.Ed25519:\n return unmarshalEd25519PublicKey(data)\n case pb.KeyType.secp256k1:\n return unmarshalSecp256k1PublicKey(data)\n case pb.KeyType.ECDSA:\n return unmarshalECDSAPublicKey(data)\n default:\n throw new UnsupportedKeyTypeError()\n }\n}\n\n/**\n * Creates a public key from the raw key bytes\n */\nexport function publicKeyFromRaw (buf: Uint8Array): PublicKey {\n if (buf.byteLength === ed25519PublicKeyLength) {\n return unmarshalEd25519PublicKey(buf)\n } else if (buf.byteLength === secp256k1PublicKeyLength) {\n return unmarshalSecp256k1PublicKey(buf)\n }\n\n const message = decodeDer(buf)\n const ecdsaOid = message[1]?.[0]\n\n if (ecdsaOid === ECDSA_P_256_OID || ecdsaOid === ECDSA_P_384_OID || ecdsaOid === ECDSA_P_521_OID) {\n return pkiMessageToECDSAPublicKey(message)\n }\n\n if (message[0]?.[0] === RSAES_PKCS1_V1_5_OID) {\n return pkixMessageToRSAPublicKey(message, buf)\n }\n\n throw new InvalidParametersError('Could not extract public key from raw bytes')\n}\n\n/**\n * Creates a public key from an identity multihash which contains a protobuf\n * encoded Ed25519 or secp256k1 public key.\n *\n * RSA keys are not supported as in practice we they are not stored in identity\n * multihash since the hash would be very large.\n */\nexport function publicKeyFromMultihash (digest: MultihashDigest<0x0>): Ed25519PublicKey | Secp256k1PublicKey | ECDSAPublicKey {\n const { Type, Data } = pb.PublicKey.decode(digest.digest)\n const data = Data ?? new Uint8Array()\n\n switch (Type) {\n case pb.KeyType.Ed25519:\n return unmarshalEd25519PublicKey(data)\n case pb.KeyType.secp256k1:\n return unmarshalSecp256k1PublicKey(data)\n case pb.KeyType.ECDSA:\n return unmarshalECDSAPublicKey(data)\n default:\n throw new UnsupportedKeyTypeError()\n }\n}\n\n/**\n * Converts a public key object into a protobuf serialized public key\n */\nexport function publicKeyToProtobuf (key: PublicKey): Uint8Array {\n return pb.PublicKey.encode({\n Type: pb.KeyType[key.type],\n Data: key.raw\n })\n}\n\n/**\n * Converts a protobuf serialized private key into its representative object\n */\nexport function privateKeyFromProtobuf (buf: Uint8Array): Ed25519PrivateKey | Secp256k1PrivateKey | RSAPrivateKey | ECDSAPrivateKey {\n const decoded = pb.PrivateKey.decode(buf)\n const data = decoded.Data ?? new Uint8Array()\n\n switch (decoded.Type) {\n case pb.KeyType.RSA:\n return pkcs1ToRSAPrivateKey(data)\n case pb.KeyType.Ed25519:\n return unmarshalEd25519PrivateKey(data)\n case pb.KeyType.secp256k1:\n return unmarshalSecp256k1PrivateKey(data)\n case pb.KeyType.ECDSA:\n return unmarshalECDSAPrivateKey(data)\n default:\n throw new UnsupportedKeyTypeError()\n }\n}\n\n/**\n * Creates a private key from the raw key bytes. For Ed25519 keys this requires\n * the public key to be appended to the private key otherwise we can't\n * differentiate between Ed25519 and secp256k1 keys as they are the same length.\n */\nexport function privateKeyFromRaw (buf: Uint8Array): PrivateKey {\n if (buf.byteLength === ed25519PrivateKeyLength) {\n return unmarshalEd25519PrivateKey(buf)\n } else if (buf.byteLength === secp256k1PrivateKeyLength) {\n return unmarshalSecp256k1PrivateKey(buf)\n }\n\n const message = decodeDer(buf)\n const ecdsaOid = message[2]?.[0]\n\n if (ecdsaOid === ECDSA_P_256_OID || ecdsaOid === ECDSA_P_384_OID || ecdsaOid === ECDSA_P_521_OID) {\n return pkiMessageToECDSAPrivateKey(message)\n }\n\n if (message.length > 8) {\n return pkcs1MessageToRSAPrivateKey(message)\n }\n\n throw new InvalidParametersError('Could not extract private key from raw bytes')\n}\n\n/**\n * Converts a private key object into a protobuf serialized private key\n */\nexport function privateKeyToProtobuf (key: PrivateKey): Uint8Array {\n return pb.PrivateKey.encode({\n Type: pb.KeyType[key.type],\n Data: key.raw\n })\n}\n\nfunction toBits (bits: any): number {\n if (bits == null) {\n return 2048\n }\n\n return parseInt(bits, 10)\n}\n\nfunction toCurve (curve: any): Curve {\n if (curve === 'P-256' || curve == null) {\n return 'P-256'\n }\n\n if (curve === 'P-384') {\n return 'P-384'\n }\n\n if (curve === 'P-521') {\n return 'P-521'\n }\n\n throw new InvalidParametersError('Unsupported curve, should be P-256, P-384 or P-521')\n}\n\n/**\n * Convert a libp2p RSA or ECDSA private key to a WebCrypto CryptoKeyPair\n */\nexport async function privateKeyToCryptoKeyPair (privateKey: PrivateKey): Promise<CryptoKeyPair> {\n if (privateKey.type === 'RSA') {\n return {\n privateKey: await crypto.subtle.importKey('jwk', privateKey.jwk, {\n name: 'RSASSA-PKCS1-v1_5',\n hash: { name: 'SHA-256' }\n }, true, ['sign']),\n publicKey: await crypto.subtle.importKey('jwk', privateKey.publicKey.jwk, {\n name: 'RSASSA-PKCS1-v1_5',\n hash: { name: 'SHA-256' }\n }, true, ['verify'])\n }\n }\n\n if (privateKey.type === 'ECDSA') {\n return {\n privateKey: await crypto.subtle.importKey('jwk', privateKey.jwk, {\n name: 'ECDSA',\n namedCurve: privateKey.jwk.crv ?? 'P-256'\n }, true, ['sign']),\n publicKey: await crypto.subtle.importKey('jwk', privateKey.publicKey.jwk, {\n name: 'ECDSA',\n namedCurve: privateKey.publicKey.jwk.crv ?? 'P-256'\n }, true, ['verify'])\n }\n }\n\n throw new InvalidParametersError('Only RSA and ECDSA keys are supported')\n}\n\n/**\n * Convert a RSA or ECDSA WebCrypto CryptoKeyPair to a libp2p private key\n */\nexport async function privateKeyFromCryptoKeyPair (keyPair: CryptoKeyPair): Promise<PrivateKey> {\n if (keyPair.privateKey.algorithm.name === 'RSASSA-PKCS1-v1_5') {\n const jwk = await crypto.subtle.exportKey('jwk', keyPair.privateKey)\n\n return jwkToRSAPrivateKey(jwk)\n }\n\n if (keyPair.privateKey.algorithm.name === 'ECDSA') {\n const jwk = await crypto.subtle.exportKey('jwk', keyPair.privateKey)\n\n return new ECDSAPrivateKeyClass(jwk)\n }\n\n throw new InvalidParametersError('Only RSA and ECDSA keys are supported')\n}\n", "/**\n * @packageDocumentation\n *\n * An implementation of a peer id\n *\n * @example\n *\n * ```TypeScript\n * import { peerIdFromString } from '@libp2p/peer-id'\n * const peer = peerIdFromString('k51qzi5uqu5dkwkqm42v9j9kqcam2jiuvloi16g72i4i4amoo2m8u3ol3mqu6s')\n *\n * console.log(peer.toCID()) // CID(bafzaa...)\n * console.log(peer.toString()) // \"12D3K...\"\n * ```\n */\n\nimport { peerIdSymbol } from '@libp2p/interface'\nimport { base58btc } from 'multiformats/bases/base58'\nimport { CID } from 'multiformats/cid'\nimport { identity } from 'multiformats/hashes/identity'\nimport { equals as uint8ArrayEquals } from 'uint8arrays/equals'\nimport { fromString as uint8ArrayFromString } from 'uint8arrays/from-string'\nimport { toString as uint8ArrayToString } from 'uint8arrays/to-string'\nimport type { Ed25519PeerId as Ed25519PeerIdInterface, PeerIdType, RSAPeerId as RSAPeerIdInterface, URLPeerId as URLPeerIdInterface, Secp256k1PeerId as Secp256k1PeerIdInterface, PeerId, PublicKey, Ed25519PublicKey, Secp256k1PublicKey, RSAPublicKey } from '@libp2p/interface'\nimport type { MultihashDigest } from 'multiformats/hashes/interface'\n\nconst inspect = Symbol.for('nodejs.util.inspect.custom')\n\n// these values are from https://github.com/multiformats/multicodec/blob/master/table.csv\nconst LIBP2P_KEY_CODE = 0x72\n\ninterface PeerIdInit <DigestCode extends number> {\n type: PeerIdType\n multihash: MultihashDigest<DigestCode>\n}\n\ninterface RSAPeerIdInit {\n multihash: MultihashDigest<0x12>\n publicKey?: RSAPublicKey\n}\n\ninterface Ed25519PeerIdInit {\n multihash: MultihashDigest<0x0>\n publicKey: Ed25519PublicKey\n}\n\ninterface Secp256k1PeerIdInit {\n multihash: MultihashDigest<0x0>\n publicKey: Secp256k1PublicKey\n}\n\nclass PeerIdImpl <DigestCode extends number> {\n public type: PeerIdType\n private readonly multihash: MultihashDigest<DigestCode>\n public readonly publicKey?: PublicKey\n private string?: string\n\n constructor (init: PeerIdInit<DigestCode>) {\n this.type = init.type\n this.multihash = init.multihash\n\n // mark string cache as non-enumerable\n Object.defineProperty(this, 'string', {\n enumerable: false,\n writable: true\n })\n }\n\n get [Symbol.toStringTag] (): string {\n return `PeerId(${this.toString()})`\n }\n\n readonly [peerIdSymbol] = true\n\n toString (): string {\n if (this.string == null) {\n this.string = base58btc.encode(this.multihash.bytes).slice(1)\n }\n\n return this.string\n }\n\n toMultihash (): MultihashDigest<DigestCode> {\n return this.multihash\n }\n\n // return self-describing String representation\n // in default format from RFC 0001: https://github.com/libp2p/specs/pull/209\n toCID (): CID<Uint8Array, 0x72, DigestCode, 1> {\n return CID.createV1(LIBP2P_KEY_CODE, this.multihash)\n }\n\n toJSON (): string {\n return this.toString()\n }\n\n /**\n * Checks the equality of `this` peer against a given PeerId\n */\n equals (id?: PeerId | Uint8Array | string): boolean {\n if (id == null) {\n return false\n }\n\n if (id instanceof Uint8Array) {\n return uint8ArrayEquals(this.multihash.bytes, id)\n } else if (typeof id === 'string') {\n return this.toString() === id\n } else if (id?.toMultihash()?.bytes != null) {\n return uint8ArrayEquals(this.multihash.bytes, id.toMultihash().bytes)\n } else {\n throw new Error('not valid Id')\n }\n }\n\n /**\n * Returns PeerId as a human-readable string\n * https://nodejs.org/api/util.html#utilinspectcustom\n *\n * @example\n * ```TypeScript\n * import { peerIdFromString } from '@libp2p/peer-id'\n *\n * console.info(peerIdFromString('QmFoo'))\n * // 'PeerId(QmFoo)'\n * ```\n */\n [inspect] (): string {\n return `PeerId(${this.toString()})`\n }\n}\n\nexport class RSAPeerId extends PeerIdImpl<0x12> implements RSAPeerIdInterface {\n public readonly type = 'RSA'\n public readonly publicKey?: RSAPublicKey\n\n constructor (init: RSAPeerIdInit) {\n super({ ...init, type: 'RSA' })\n\n this.publicKey = init.publicKey\n }\n}\n\nexport class Ed25519PeerId extends PeerIdImpl<0x0> implements Ed25519PeerIdInterface {\n public readonly type = 'Ed25519'\n public readonly publicKey: Ed25519PublicKey\n\n constructor (init: Ed25519PeerIdInit) {\n super({ ...init, type: 'Ed25519' })\n\n this.publicKey = init.publicKey\n }\n}\n\nexport class Secp256k1PeerId extends PeerIdImpl<0x0> implements Secp256k1PeerIdInterface {\n public readonly type = 'secp256k1'\n public readonly publicKey: Secp256k1PublicKey\n\n constructor (init: Secp256k1PeerIdInit) {\n super({ ...init, type: 'secp256k1' })\n\n this.publicKey = init.publicKey\n }\n}\n\n// these values are from https://github.com/multiformats/multicodec/blob/master/table.csv\nconst TRANSPORT_IPFS_GATEWAY_HTTP_CODE = 0x0920\n\nexport class URLPeerId implements URLPeerIdInterface {\n readonly type = 'url'\n readonly multihash: MultihashDigest<0x0>\n readonly publicKey: undefined\n readonly url: string\n\n constructor (url: URL) {\n this.url = url.toString()\n this.multihash = identity.digest(uint8ArrayFromString(this.url))\n }\n\n [inspect] (): string {\n return `PeerId(${this.url})`\n }\n\n readonly [peerIdSymbol] = true\n\n toString (): string {\n return this.toCID().toString()\n }\n\n toMultihash (): MultihashDigest<0x0> {\n return this.multihash\n }\n\n toCID (): CID<Uint8Array, 0x0920, 0x0, 1> {\n return CID.createV1(TRANSPORT_IPFS_GATEWAY_HTTP_CODE, this.toMultihash())\n }\n\n toJSON (): string {\n return this.toString()\n }\n\n equals (other?: PeerId | Uint8Array | string): boolean {\n if (other == null) {\n return false\n }\n\n if (other instanceof Uint8Array) {\n other = uint8ArrayToString(other)\n }\n\n return other.toString() === this.toString()\n }\n}\n", "/**\n * @packageDocumentation\n *\n * An implementation of a peer id\n *\n * @example\n *\n * ```TypeScript\n * import { peerIdFromString } from '@libp2p/peer-id'\n * const peer = peerIdFromString('12D3KooWKnDdG3iXw9eTFijk3EWSunZcFi54Zka4wmtqtt6rPxc8')\n *\n * console.log(peer.toCID()) // CID(bafzaa...)\n * console.log(peer.toString()) // \"12D3K...\"\n * ```\n */\n\nimport { publicKeyFromMultihash } from '@libp2p/crypto/keys'\nimport { InvalidCIDError, InvalidMultihashError, InvalidParametersError, UnsupportedKeyTypeError } from '@libp2p/interface'\nimport { base58btc } from 'multiformats/bases/base58'\nimport { CID } from 'multiformats/cid'\nimport * as Digest from 'multiformats/hashes/digest'\nimport { identity } from 'multiformats/hashes/identity'\nimport { sha256 } from 'multiformats/hashes/sha2'\nimport { toString as uint8ArrayToString } from 'uint8arrays/to-string'\nimport { RSAPeerId as RSAPeerIdClass, Ed25519PeerId as Ed25519PeerIdClass, Secp256k1PeerId as Secp256k1PeerIdClass, URLPeerId as URLPeerIdClass } from './peer-id.js'\nimport type { Ed25519PeerId, RSAPeerId, URLPeerId, Secp256k1PeerId, PeerId, PublicKey, Ed25519PublicKey, Secp256k1PublicKey, RSAPublicKey, Ed25519PrivateKey, Secp256k1PrivateKey, RSAPrivateKey, PrivateKey } from '@libp2p/interface'\nimport type { MultibaseDecoder } from 'multiformats/cid'\nimport type { MultihashDigest } from 'multiformats/hashes/interface'\n\n// these values are from https://github.com/multiformats/multicodec/blob/master/table.csv\nconst LIBP2P_KEY_CODE = 0x72\nconst TRANSPORT_IPFS_GATEWAY_HTTP_CODE = 0x0920\n\nexport function peerIdFromString (str: string, decoder?: MultibaseDecoder<any>): Ed25519PeerId | Secp256k1PeerId | RSAPeerId | URLPeerId {\n let multihash: MultihashDigest\n\n if (str.charAt(0) === '1' || str.charAt(0) === 'Q') {\n // identity hash ed25519/secp256k1 key or sha2-256 hash of\n // rsa public key - base58btc encoded either way\n multihash = Digest.decode(base58btc.decode(`z${str}`))\n } else if (str.startsWith('k51qzi5uqu5') || str.startsWith('kzwfwjn5ji4') || str.startsWith('k2k4r8') || str.startsWith('bafz')) {\n // base36 encoded CIDv1 with libp2p-key and identity hash (for ed25519/secp256k1/rsa) or base32 encoded CIDv1 with libp2p-key and identity hash (for ed25519/secp256k1/rsa)\n return peerIdFromCID(CID.parse(str))\n } else {\n if (decoder == null) {\n throw new InvalidParametersError('Please pass a multibase decoder for strings that do not start with \"1\" or \"Q\"')\n }\n\n multihash = Digest.decode(decoder.decode(str))\n }\n\n return peerIdFromMultihash(multihash)\n}\n\nexport function peerIdFromPublicKey (publicKey: Ed25519PublicKey): Ed25519PeerId\nexport function peerIdFromPublicKey (publicKey: Secp256k1PublicKey): Secp256k1PeerId\nexport function peerIdFromPublicKey (publicKey: RSAPublicKey): RSAPeerId\nexport function peerIdFromPublicKey (publicKey: PublicKey): PeerId\nexport function peerIdFromPublicKey (publicKey: PublicKey): PeerId {\n if (publicKey.type === 'Ed25519') {\n return new Ed25519PeerIdClass({\n multihash: publicKey.toCID().multihash,\n publicKey\n })\n } else if (publicKey.type === 'secp256k1') {\n return new Secp256k1PeerIdClass({\n multihash: publicKey.toCID().multihash,\n publicKey\n })\n } else if (publicKey.type === 'RSA') {\n return new RSAPeerIdClass({\n multihash: publicKey.toCID().multihash,\n publicKey\n })\n }\n\n throw new UnsupportedKeyTypeError()\n}\n\nexport function peerIdFromPrivateKey (privateKey: Ed25519PrivateKey): Ed25519PeerId\nexport function peerIdFromPrivateKey (privateKey: Secp256k1PrivateKey): Secp256k1PeerId\nexport function peerIdFromPrivateKey (privateKey: RSAPrivateKey): RSAPeerId\nexport function peerIdFromPrivateKey (privateKey: PrivateKey): PeerId\nexport function peerIdFromPrivateKey (privateKey: PrivateKey): PeerId {\n return peerIdFromPublicKey(privateKey.publicKey)\n}\n\nexport function peerIdFromMultihash (multihash: MultihashDigest): PeerId {\n if (isSha256Multihash(multihash)) {\n return new RSAPeerIdClass({ multihash })\n } else if (isIdentityMultihash(multihash)) {\n try {\n const publicKey = publicKeyFromMultihash(multihash)\n\n if (publicKey.type === 'Ed25519') {\n return new Ed25519PeerIdClass({ multihash, publicKey })\n } else if (publicKey.type === 'secp256k1') {\n return new Secp256k1PeerIdClass({ multihash, publicKey })\n }\n } catch (err) {\n // was not Ed or secp key, try URL\n const url = uint8ArrayToString(multihash.digest)\n\n return new URLPeerIdClass(new URL(url))\n }\n }\n\n throw new InvalidMultihashError('Supplied PeerID Multihash is invalid')\n}\n\nexport function peerIdFromCID (cid: CID): Ed25519PeerId | Secp256k1PeerId | RSAPeerId | URLPeerId {\n if (cid?.multihash == null || cid.version == null || (cid.version === 1 && (cid.code !== LIBP2P_KEY_CODE) && cid.code !== TRANSPORT_IPFS_GATEWAY_HTTP_CODE)) {\n throw new InvalidCIDError('Supplied PeerID CID is invalid')\n }\n\n if (cid.code === TRANSPORT_IPFS_GATEWAY_HTTP_CODE) {\n const url = uint8ArrayToString(cid.multihash.digest)\n\n return new URLPeerIdClass(new URL(url))\n }\n\n return peerIdFromMultihash(cid.multihash)\n}\n\nfunction isIdentityMultihash (multihash: MultihashDigest): multihash is MultihashDigest<0x0> {\n return multihash.code === identity.code\n}\n\nfunction isSha256Multihash (multihash: MultihashDigest): multihash is MultihashDigest<0x12> {\n return multihash.code === sha256.code\n}\n", "/**\n * @packageDocumentation\n *\n * A [libp2p transport](https://docs.libp2p.io/concepts/transports/overview/) based on the TCP networking stack.\n *\n * @example\n *\n * ```TypeScript\n * import { createLibp2p } from 'libp2p'\n * import { tcp } from '@libp2p/tcp'\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const node = await createLibp2p({\n * transports: [\n * tcp()\n * ]\n * })\n *\n * const ma = multiaddr('/ip4/123.123.123.123/tcp/1234')\n *\n * // dial a TCP connection, timing out after 10 seconds\n * const connection = await node.dial(ma, {\n * signal: AbortSignal.timeout(10_000)\n * })\n *\n * // use connection...\n * ```\n */\n\nimport net from 'net'\nimport { AbortError, TimeoutError, serviceCapabilities, transportSymbol } from '@libp2p/interface'\nimport { TCP as TCPMatcher } from '@multiformats/multiaddr-matcher'\nimport { CustomProgressEvent } from 'progress-events'\nimport { TCPListener } from './listener.js'\nimport { toMultiaddrConnection } from './socket-to-conn.js'\nimport { multiaddrToNetConfig } from './utils.js'\nimport type { TCPComponents, TCPCreateListenerOptions, TCPDialEvents, TCPDialOptions, TCPMetrics, TCPOptions } from './index.js'\nimport type { Logger, Connection, Transport, Listener, MultiaddrConnection } from '@libp2p/interface'\nimport type { Multiaddr } from '@multiformats/multiaddr'\nimport type { Socket, IpcSocketConnectOpts, TcpSocketConnectOpts } from 'net'\n\nexport class TCP implements Transport<TCPDialEvents> {\n private readonly opts: TCPOptions\n private readonly metrics?: TCPMetrics\n private readonly components: TCPComponents\n private readonly log: Logger\n\n constructor (components: TCPComponents, options: TCPOptions = {}) {\n this.log = components.logger.forComponent('libp2p:tcp')\n this.opts = options\n this.components = components\n\n if (components.metrics != null) {\n this.metrics = {\n events: components.metrics.registerCounterGroup('libp2p_tcp_dialer_events_total', {\n label: 'event',\n help: 'Total count of TCP dialer events by type'\n }),\n errors: components.metrics.registerCounterGroup('libp2p_tcp_dialer_errors_total', {\n label: 'event',\n help: 'Total count of TCP dialer events by type'\n })\n }\n }\n }\n\n readonly [transportSymbol] = true\n\n readonly [Symbol.toStringTag] = '@libp2p/tcp'\n\n readonly [serviceCapabilities]: string[] = [\n '@libp2p/transport'\n ]\n\n async dial (ma: Multiaddr, options: TCPDialOptions): Promise<Connection> {\n options.keepAlive = options.keepAlive ?? true\n options.noDelay = options.noDelay ?? true\n\n // options.signal destroys the socket before 'connect' event\n const socket = await this._connect(ma, options)\n\n let maConn: MultiaddrConnection\n\n try {\n maConn = toMultiaddrConnection(socket, {\n remoteAddr: ma,\n socketInactivityTimeout: this.opts.outboundSocketInactivityTimeout,\n socketCloseTimeout: this.opts.socketCloseTimeout,\n metrics: this.metrics?.events,\n logger: this.components.logger,\n direction: 'outbound'\n })\n } catch (err: any) {\n this.metrics?.errors.increment({ outbound_to_connection: true })\n socket.destroy(err)\n throw err\n }\n\n try {\n this.log('new outbound connection %s', maConn.remoteAddr)\n return await options.upgrader.upgradeOutbound(maConn, options)\n } catch (err: any) {\n this.metrics?.errors.increment({ outbound_upgrade: true })\n this.log.error('error upgrading outbound connection', err)\n maConn.abort(err)\n throw err\n }\n }\n\n async _connect (ma: Multiaddr, options: TCPDialOptions): Promise<Socket> {\n options.signal.throwIfAborted()\n options.onProgress?.(new CustomProgressEvent('tcp:open-connection'))\n\n let rawSocket: Socket\n\n return new Promise<Socket>((resolve, reject) => {\n const start = Date.now()\n const cOpts = multiaddrToNetConfig(ma, {\n ...(this.opts.dialOpts ?? {}),\n ...options\n }) as (IpcSocketConnectOpts & TcpSocketConnectOpts)\n\n this.log('dialing %a', ma)\n rawSocket = net.connect(cOpts)\n\n const onError = (err: Error): void => {\n this.log.error('dial to %a errored - %e', ma, err)\n const cOptsStr = cOpts.path ?? `${cOpts.host ?? ''}:${cOpts.port}`\n err.message = `connection error ${cOptsStr}: ${err.message}`\n this.metrics?.events.increment({ error: true })\n done(err)\n }\n\n const onTimeout = (): void => {\n this.log('connection timeout %a', ma)\n this.metrics?.events.increment({ timeout: true })\n\n const err = new TimeoutError(`Connection timeout after ${Date.now() - start}ms`)\n // Note: this will result in onError() being called\n rawSocket.emit('error', err)\n }\n\n const onConnect = (): void => {\n this.log('connection opened %a', ma)\n this.metrics?.events.increment({ connect: true })\n done()\n }\n\n const onAbort = (): void => {\n this.log('connection aborted %a', ma)\n this.metrics?.events.increment({ abort: true })\n done(new AbortError())\n }\n\n const done = (err?: Error): void => {\n rawSocket.removeListener('error', onError)\n rawSocket.removeListener('timeout', onTimeout)\n rawSocket.removeListener('connect', onConnect)\n\n if (options.signal != null) {\n options.signal.removeEventListener('abort', onAbort)\n }\n\n if (err != null) {\n reject(err); return\n }\n\n resolve(rawSocket)\n }\n\n rawSocket.on('error', onError)\n rawSocket.on('timeout', onTimeout)\n rawSocket.on('connect', onConnect)\n\n options.signal.addEventListener('abort', onAbort)\n })\n .catch(err => {\n rawSocket?.destroy()\n throw err\n })\n }\n\n /**\n * Creates a TCP listener. The provided `handler` function will be called\n * anytime a new incoming Connection has been successfully upgraded via\n * `upgrader.upgradeInbound`.\n */\n createListener (options: TCPCreateListenerOptions): Listener {\n return new TCPListener({\n ...(this.opts.listenOpts ?? {}),\n ...options,\n maxConnections: this.opts.maxConnections,\n backlog: this.opts.backlog,\n closeServerOnMaxConnections: this.opts.closeServerOnMaxConnections,\n socketInactivityTimeout: this.opts.inboundSocketInactivityTimeout,\n socketCloseTimeout: this.opts.socketCloseTimeout,\n metrics: this.components.metrics,\n logger: this.components.logger\n })\n }\n\n /**\n * Takes a list of `Multiaddr`s and returns only valid TCP addresses\n */\n listenFilter (multiaddrs: Multiaddr[]): Multiaddr[] {\n return multiaddrs.filter(ma => TCPMatcher.exactMatch(ma) || ma.toString().startsWith('/unix/'))\n }\n\n /**\n * Filter check for all Multiaddrs that this transport can dial\n */\n dialFilter (multiaddrs: Multiaddr[]): Multiaddr[] {\n return this.listenFilter(multiaddrs)\n }\n}\n", "/**\n * Thrown when an invalid multiaddr is encountered\n */\nexport class InvalidMultiaddrError extends Error {\n static name = 'InvalidMultiaddrError'\n name = 'InvalidMultiaddrError'\n}\n\nexport class ValidationError extends Error {\n static name = 'ValidationError'\n name = 'ValidationError'\n}\n\nexport class InvalidParametersError extends Error {\n static name = 'InvalidParametersError'\n name = 'InvalidParametersError'\n}\n\nexport class UnknownProtocolError extends Error {\n static name = 'UnknownProtocolError'\n name = 'UnknownProtocolError'\n}\n", "import { isIPv4, isIPv6, isIP as ipVersion } from \"node:net\";\n\nexport { isIPv4, isIPv6, ipVersion };\n\n/** Check if `input` is IPv4 or IPv6. */\nexport function isIP(input: string): boolean {\n return Boolean(ipVersion(input));\n}\n", "import { isIPv4 } from '@chainsafe/is-ip'\nimport { base32 } from 'multiformats/bases/base32'\nimport { bases } from 'multiformats/basics'\nimport { concat as uint8ArrayConcat } from 'uint8arrays/concat'\nimport { fromString as uint8ArrayFromString } from 'uint8arrays/from-string'\nimport { toString as uint8ArrayToString } from 'uint8arrays/to-string'\nimport { InvalidMultiaddrError } from './errors.ts'\nimport type { MultibaseCodec } from 'multiformats'\nimport type { SupportedEncodings } from 'uint8arrays/to-string'\n\nexport function bytesToString (base: SupportedEncodings): (buf: Uint8Array) => string {\n return (buf) => {\n return uint8ArrayToString(buf, base)\n }\n}\n\nexport function stringToBytes (base: SupportedEncodings): (value: string) => Uint8Array {\n return (buf) => {\n return uint8ArrayFromString(buf, base)\n }\n}\n\nexport function bytes2port (buf: Uint8Array): string {\n const view = new DataView(buf.buffer)\n return view.getUint16(buf.byteOffset).toString()\n}\n\nexport function port2bytes (port: string | number): Uint8Array {\n const buf = new ArrayBuffer(2)\n const view = new DataView(buf)\n view.setUint16(0, typeof port === 'string' ? parseInt(port) : port)\n\n return new Uint8Array(buf)\n}\n\nexport function onion2bytes (str: string): Uint8Array {\n const addr = str.split(':')\n\n if (addr.length !== 2) {\n throw new Error(`failed to parse onion addr: [\"'${addr.join('\", \"')}'\"]' does not contain a port number`)\n }\n\n if (addr[0].length !== 16) {\n throw new Error(`failed to parse onion addr: ${addr[0]} not a Tor onion address.`)\n }\n\n // onion addresses do not include the multibase prefix, add it before decoding\n const buf = uint8ArrayFromString(addr[0], 'base32')\n\n // onion port number\n const port = parseInt(addr[1], 10)\n\n if (port < 1 || port > 65536) {\n throw new Error('Port number is not in range(1, 65536)')\n }\n\n const portBuf = port2bytes(port)\n\n return uint8ArrayConcat([buf, portBuf], buf.length + portBuf.length)\n}\n\nexport function onion32bytes (str: string): Uint8Array {\n const addr = str.split(':')\n\n if (addr.length !== 2) {\n throw new Error(`failed to parse onion addr: [\"'${addr.join('\", \"')}'\"]' does not contain a port number`)\n }\n\n if (addr[0].length !== 56) {\n throw new Error(`failed to parse onion addr: ${addr[0]} not a Tor onion3 address.`)\n }\n\n // onion addresses do not include the multibase prefix, add it before decoding\n const buf = base32.decode(`b${addr[0]}`)\n\n // onion port number\n const port = parseInt(addr[1], 10)\n\n if (port < 1 || port > 65536) {\n throw new Error('Port number is not in range(1, 65536)')\n }\n\n const portBuf = port2bytes(port)\n\n return uint8ArrayConcat([buf, portBuf], buf.length + portBuf.length)\n}\n\nexport function bytes2onion (buf: Uint8Array): string {\n const addrBytes = buf.subarray(0, buf.length - 2)\n const portBytes = buf.subarray(buf.length - 2)\n const addr = uint8ArrayToString(addrBytes, 'base32')\n const port = bytes2port(portBytes)\n return `${addr}:${port}`\n}\n\n// Copied from https://github.com/indutny/node-ip/blob/master/lib/ip.js#L7\n// but with buf/offset args removed because we don't use them\nexport const ip4ToBytes = function (ip: string): Uint8Array {\n ip = ip.toString().trim()\n\n const bytes = new Uint8Array(4)\n\n ip.split(/\\./g).forEach((byte, index) => {\n const value = parseInt(byte, 10)\n\n if (isNaN(value) || value < 0 || value > 0xff) {\n throw new InvalidMultiaddrError('Invalid byte value in IP address')\n }\n\n bytes[index] = value\n })\n\n return bytes\n}\n\n// Copied from https://github.com/indutny/node-ip/blob/master/lib/ip.js#L7\n// but with buf/offset args removed because we don't use them\nexport const ip6ToBytes = function (ip: string): Uint8Array {\n let offset = 0\n ip = ip.toString().trim()\n\n const sections = ip.split(':', 8)\n\n let i\n for (i = 0; i < sections.length; i++) {\n const isv4 = isIPv4(sections[i])\n let v4Buffer: Uint8Array | undefined\n\n if (isv4) {\n v4Buffer = ip4ToBytes(sections[i])\n sections[i] = uint8ArrayToString(v4Buffer.subarray(0, 2), 'base16')\n }\n\n if (v4Buffer != null && ++i < 8) {\n sections.splice(i, 0, uint8ArrayToString(v4Buffer.subarray(2, 4), 'base16'))\n }\n }\n\n if (sections[0] === '') {\n while (sections.length < 8) { sections.unshift('0') }\n } else if (sections[sections.length - 1] === '') {\n while (sections.length < 8) { sections.push('0') }\n } else if (sections.length < 8) {\n for (i = 0; i < sections.length && sections[i] !== ''; i++) { }\n const argv: [number, number, ...string[]] = [i, 1]\n for (i = 9 - sections.length; i > 0; i--) {\n argv.push('0')\n }\n sections.splice.apply(sections, argv)\n }\n\n const bytes = new Uint8Array(offset + 16)\n\n for (i = 0; i < sections.length; i++) {\n if (sections[i] === '') {\n sections[i] = '0'\n }\n\n const word = parseInt(sections[i], 16)\n\n if (isNaN(word) || word < 0 || word > 0xffff) {\n throw new InvalidMultiaddrError('Invalid byte value in IP address')\n }\n\n bytes[offset++] = (word >> 8) & 0xff\n bytes[offset++] = word & 0xff\n }\n\n return bytes\n}\n\n// Copied from https://github.com/indutny/node-ip/blob/master/lib/ip.js#L63\nexport const ip4ToString = function (buf: Uint8Array): string {\n if (buf.byteLength !== 4) {\n throw new InvalidMultiaddrError('IPv4 address was incorrect length')\n }\n\n const result = []\n\n for (let i = 0; i < buf.byteLength; i++) {\n result.push(buf[i])\n }\n\n return result.join('.')\n}\n\nexport const ip6ToString = function (buf: Uint8Array): string {\n if (buf.byteLength !== 16) {\n throw new InvalidMultiaddrError('IPv6 address was incorrect length')\n }\n\n const result: string[] = []\n\n for (let i = 0; i < buf.byteLength; i += 2) {\n const byte1 = buf[i]\n const byte2 = buf[i + 1]\n\n const tuple = `${byte1.toString(16).padStart(2, '0')}${byte2.toString(16).padStart(2, '0')}`\n\n result.push(tuple)\n }\n\n const ip = result.join(':')\n\n try {\n const url = new URL(`http://[${ip}]`)\n\n return url.hostname.substring(1, url.hostname.length - 1)\n } catch {\n throw new InvalidMultiaddrError(`Invalid IPv6 address \"${ip}\"`)\n }\n}\n\nexport function ip6StringToValue (str: string): string {\n try {\n const url = new URL(`http://[${str}]`)\n\n return url.hostname.substring(1, url.hostname.length - 1)\n } catch {\n throw new InvalidMultiaddrError(`Invalid IPv6 address \"${str}\"`)\n }\n}\n\nconst decoders = Object.values(bases).map((c) => c.decoder)\nconst anybaseDecoder = (function () {\n let acc = decoders[0].or(decoders[1])\n decoders.slice(2).forEach((d) => (acc = acc.or(d)))\n return acc\n})()\n\nexport function mb2bytes (mbstr: string): Uint8Array {\n return anybaseDecoder.decode(mbstr)\n}\n\nexport function bytes2mb (base: MultibaseCodec<any>): (buf: Uint8Array) => string {\n return (buf) => {\n return base.encoder.encode(buf)\n }\n}\n", "import { ValidationError } from './errors.ts'\n\nexport function integer (value: string): void {\n const int = parseInt(value)\n\n if (int.toString() !== value) {\n throw new ValidationError('Value must be an integer')\n }\n}\n\nexport function positive (value: any): void {\n if (value < 0) {\n throw new ValidationError('Value must be a positive integer, or zero')\n }\n}\n\nexport function maxValue (max: number): (value: any) => void {\n return (value) => {\n if (value > max) {\n throw new ValidationError(`Value must be smaller than or equal to ${max}`)\n }\n }\n}\n\nexport function validate (...funcs: Array<(value: string) => void>): (value: string) => void {\n return (value) => {\n for (const fn of funcs) {\n fn(value)\n }\n }\n}\n\nexport const validatePort = validate(\n integer,\n positive,\n maxValue(65_535)\n)\n", "import { isIPv4, isIPv6 } from '@chainsafe/is-ip'\nimport { CID } from 'multiformats'\nimport { base64url } from 'multiformats/bases/base64'\nimport { CODE_CERTHASH, CODE_DCCP, CODE_DNS, CODE_DNS4, CODE_DNS6, CODE_DNSADDR, CODE_GARLIC32, CODE_GARLIC64, CODE_HTTP, CODE_HTTP_PATH, CODE_HTTPS, CODE_IP4, CODE_IP6, CODE_IP6ZONE, CODE_IPCIDR, CODE_MEMORY, CODE_NOISE, CODE_ONION, CODE_ONION3, CODE_P2P, CODE_P2P_CIRCUIT, CODE_P2P_STARDUST, CODE_P2P_WEBRTC_DIRECT, CODE_P2P_WEBRTC_STAR, CODE_P2P_WEBSOCKET_STAR, CODE_QUIC, CODE_QUIC_V1, CODE_SCTP, CODE_SNI, CODE_TCP, CODE_TLS, CODE_UDP, CODE_UDT, CODE_UNIX, CODE_UTP, CODE_WEBRTC, CODE_WEBRTC_DIRECT, CODE_WEBTRANSPORT, CODE_WS, CODE_WSS } from './constants.ts'\nimport { UnknownProtocolError, ValidationError } from './errors.ts'\nimport { bytes2mb, bytes2onion, bytes2port, bytesToString, ip4ToBytes, ip4ToString, ip6StringToValue, ip6ToBytes, ip6ToString, mb2bytes, onion2bytes, onion32bytes, port2bytes, stringToBytes } from './utils.ts'\nimport { validatePort } from './validation.ts'\nimport type { Registry as RegistryInterface } from './index.ts'\n\nexport const V = -1\n\nexport interface ProtocolCodec {\n /**\n * A numeric code that will be used in the binary representation of the tuple.\n */\n code: number\n\n /**\n * A string name that will be used in the string representation of the addr.\n */\n name: string\n\n /**\n * Size defines the expected length of the address part of the tuple - valid\n * values are `-1` (or the `V` constant) for variable length (this will be\n * varint encoded in the binary representation), `0` for no address part or a\n * number that represents a fixed-length address.\n */\n size?: number\n\n /**\n * If this protocol is a path protocol.\n *\n * @deprecated This will be removed in a future release\n */\n path?: boolean\n\n /**\n * If this protocol can be resolved using configured resolvers.\n *\n * @deprecated This will be removed in a future release\n */\n resolvable?: boolean\n\n /**\n * If specified this protocol codec will also be used to decode tuples with\n * these names from string multiaddrs.\n */\n aliases?: string[]\n\n /**\n * Where the multiaddr has been encoded as a string, decode the value if\n * necessary, unescaping any escaped values\n */\n stringToValue?(value: string): string\n\n /**\n * To encode the multiaddr as a string, escape any necessary values\n */\n valueToString?(value: string): string\n\n /**\n * To encode the multiaddr as bytes, convert the value to bytes\n */\n valueToBytes?(value: string): Uint8Array\n\n /**\n * To decode bytes to a multiaddr, convert the value bytes to a string\n */\n bytesToValue?(bytes: Uint8Array): string\n\n /**\n * Perform any necessary validation on the string value\n */\n validate?(value: string): void\n}\n\nclass Registry implements RegistryInterface {\n private protocolsByCode = new Map<number, ProtocolCodec>()\n private protocolsByName = new Map<string, ProtocolCodec>()\n\n getProtocol (key: string | number): ProtocolCodec {\n let codec: ProtocolCodec | undefined\n\n if (typeof key === 'string') {\n codec = this.protocolsByName.get(key)\n } else {\n codec = this.protocolsByCode.get(key)\n }\n\n if (codec == null) {\n throw new UnknownProtocolError(`Protocol ${key} was unknown`)\n }\n\n return codec\n }\n\n addProtocol (codec: ProtocolCodec): void {\n this.protocolsByCode.set(codec.code, codec)\n this.protocolsByName.set(codec.name, codec)\n\n codec.aliases?.forEach(alias => {\n this.protocolsByName.set(alias, codec)\n })\n }\n\n removeProtocol (code: number): void {\n const codec = this.protocolsByCode.get(code)\n\n if (codec == null) {\n return\n }\n\n this.protocolsByCode.delete(codec.code)\n this.protocolsByName.delete(codec.name)\n\n codec.aliases?.forEach(alias => {\n this.protocolsByName.delete(alias)\n })\n }\n}\n\nexport const registry = new Registry()\n\nconst codecs: ProtocolCodec[] = [{\n code: CODE_IP4,\n name: 'ip4',\n size: 32,\n valueToBytes: ip4ToBytes,\n bytesToValue: ip4ToString,\n validate: (value) => {\n if (!isIPv4(value)) {\n throw new ValidationError(`Invalid IPv4 address \"${value}\"`)\n }\n }\n}, {\n code: CODE_TCP,\n name: 'tcp',\n size: 16,\n valueToBytes: port2bytes,\n bytesToValue: bytes2port,\n validate: validatePort\n}, {\n code: CODE_UDP,\n name: 'udp',\n size: 16,\n valueToBytes: port2bytes,\n bytesToValue: bytes2port,\n validate: validatePort\n}, {\n code: CODE_DCCP,\n name: 'dccp',\n size: 16,\n valueToBytes: port2bytes,\n bytesToValue: bytes2port,\n validate: validatePort\n}, {\n code: CODE_IP6,\n name: 'ip6',\n size: 128,\n valueToBytes: ip6ToBytes,\n bytesToValue: ip6ToString,\n stringToValue: ip6StringToValue,\n validate: (value) => {\n if (!isIPv6(value)) {\n throw new ValidationError(`Invalid IPv6 address \"${value}\"`)\n }\n }\n}, {\n code: CODE_IP6ZONE,\n name: 'ip6zone',\n size: V\n}, {\n code: CODE_IPCIDR,\n name: 'ipcidr',\n size: 8,\n bytesToValue: bytesToString('base10'),\n valueToBytes: stringToBytes('base10')\n}, {\n code: CODE_DNS,\n name: 'dns',\n size: V,\n resolvable: true\n}, {\n code: CODE_DNS4,\n name: 'dns4',\n size: V,\n resolvable: true\n}, {\n code: CODE_DNS6,\n name: 'dns6',\n size: V,\n resolvable: true\n}, {\n code: CODE_DNSADDR,\n name: 'dnsaddr',\n size: V,\n resolvable: true\n}, {\n code: CODE_SCTP,\n name: 'sctp',\n size: 16,\n valueToBytes: port2bytes,\n bytesToValue: bytes2port,\n validate: validatePort\n}, {\n code: CODE_UDT,\n name: 'udt'\n}, {\n code: CODE_UTP,\n name: 'utp'\n}, {\n code: CODE_UNIX,\n name: 'unix',\n size: V,\n path: true,\n stringToValue: (str) => decodeURIComponent(str),\n valueToString: (val) => encodeURIComponent(val)\n}, {\n code: CODE_P2P,\n name: 'p2p',\n aliases: ['ipfs'],\n size: V,\n bytesToValue: bytesToString('base58btc'),\n valueToBytes: (val) => {\n if (val.startsWith('Q') || val.startsWith('1')) {\n return stringToBytes('base58btc')(val)\n }\n\n return CID.parse(val).multihash.bytes\n }\n}, {\n code: CODE_ONION,\n name: 'onion',\n size: 96,\n bytesToValue: bytes2onion,\n valueToBytes: onion2bytes\n}, {\n code: CODE_ONION3,\n name: 'onion3',\n size: 296,\n bytesToValue: bytes2onion,\n valueToBytes: onion32bytes\n}, {\n code: CODE_GARLIC64,\n name: 'garlic64',\n size: V\n}, {\n code: CODE_GARLIC32,\n name: 'garlic32',\n size: V\n}, {\n code: CODE_TLS,\n name: 'tls'\n}, {\n code: CODE_SNI,\n name: 'sni',\n size: V\n}, {\n code: CODE_NOISE,\n name: 'noise'\n}, {\n code: CODE_QUIC,\n name: 'quic'\n}, {\n code: CODE_QUIC_V1,\n name: 'quic-v1'\n}, {\n code: CODE_WEBTRANSPORT,\n name: 'webtransport'\n}, {\n code: CODE_CERTHASH,\n name: 'certhash',\n size: V,\n bytesToValue: bytes2mb(base64url),\n valueToBytes: mb2bytes\n}, {\n code: CODE_HTTP,\n name: 'http'\n}, {\n code: CODE_HTTP_PATH,\n name: 'http-path',\n size: V,\n stringToValue: (str) => `/${decodeURIComponent(str)}`,\n valueToString: (val) => encodeURIComponent(val.substring(1))\n}, {\n code: CODE_HTTPS,\n name: 'https'\n}, {\n code: CODE_WS,\n name: 'ws'\n}, {\n code: CODE_WSS,\n name: 'wss'\n}, {\n code: CODE_P2P_WEBSOCKET_STAR,\n name: 'p2p-websocket-star'\n}, {\n code: CODE_P2P_STARDUST,\n name: 'p2p-stardust'\n}, {\n code: CODE_P2P_WEBRTC_STAR,\n name: 'p2p-webrtc-star'\n}, {\n code: CODE_P2P_WEBRTC_DIRECT,\n name: 'p2p-webrtc-direct'\n}, {\n code: CODE_WEBRTC_DIRECT,\n name: 'webrtc-direct'\n}, {\n code: CODE_WEBRTC,\n name: 'webrtc'\n}, {\n code: CODE_P2P_CIRCUIT,\n name: 'p2p-circuit'\n}, {\n code: CODE_MEMORY,\n name: 'memory',\n size: V\n}]\n\ncodecs.forEach(codec => {\n registry.addProtocol(codec)\n})\n", "import * as varint from 'uint8-varint'\nimport { concat as uint8ArrayConcat } from 'uint8arrays/concat'\nimport { fromString as uint8ArrayFromString } from 'uint8arrays/from-string'\nimport { toString as uint8ArrayToString } from 'uint8arrays/to-string'\nimport { InvalidMultiaddrError } from './errors.ts'\nimport { registry, V } from './registry.ts'\nimport type { Component } from './index.js'\nimport type { ProtocolCodec } from './registry.ts'\n\nexport function bytesToComponents (bytes: Uint8Array): Component[] {\n const components: Component[] = []\n\n let i = 0\n while (i < bytes.length) {\n const code = varint.decode(bytes, i)\n const codec = registry.getProtocol(code)\n const codeLength = varint.encodingLength(code)\n const size = sizeForAddr(codec, bytes, i + codeLength)\n let sizeLength = 0\n\n if (size > 0 && codec.size === V) {\n sizeLength = varint.encodingLength(size)\n }\n\n const componentLength = codeLength + sizeLength + size\n\n const component: Component = {\n code,\n name: codec.name,\n bytes: bytes.subarray(i, i + componentLength)\n }\n\n if (size > 0) {\n const valueOffset = i + codeLength + sizeLength\n const valueBytes = bytes.subarray(valueOffset, valueOffset + size)\n\n component.value = codec.bytesToValue?.(valueBytes) ?? uint8ArrayToString(valueBytes)\n }\n\n components.push(component)\n\n i += componentLength\n }\n\n return components\n}\n\nexport function componentsToBytes (components: Component[]): Uint8Array {\n let length = 0\n const bytes: Uint8Array[] = []\n\n for (const component of components) {\n if (component.bytes == null) {\n const codec = registry.getProtocol(component.code)\n const codecLength = varint.encodingLength(component.code)\n let valueBytes: Uint8Array | undefined\n let valueLength = 0\n let valueLengthLength = 0\n\n if (component.value != null) {\n valueBytes = codec.valueToBytes?.(component.value) ?? uint8ArrayFromString(component.value)\n valueLength = valueBytes.byteLength\n\n if (codec.size === V) {\n valueLengthLength = varint.encodingLength(valueLength)\n }\n }\n\n const bytes = new Uint8Array(codecLength + valueLengthLength + valueLength)\n\n // encode the protocol code\n let offset = 0\n varint.encodeUint8Array(component.code, bytes, offset)\n offset += codecLength\n\n // if there is a value\n if (valueBytes != null) {\n // if the value has variable length, encode the length\n if (codec.size === V) {\n varint.encodeUint8Array(valueLength, bytes, offset)\n offset += valueLengthLength\n }\n\n // finally encode the value\n bytes.set(valueBytes, offset)\n }\n\n component.bytes = bytes\n }\n\n bytes.push(component.bytes)\n length += component.bytes.byteLength\n }\n\n return uint8ArrayConcat(bytes, length)\n}\n\nexport function stringToComponents (string: string): Component[] {\n if (string.charAt(0) !== '/') {\n throw new InvalidMultiaddrError('String multiaddr must start with \"/\"')\n }\n\n const components: Component[] = []\n let collecting: 'protocol' | 'value' = 'protocol'\n let value = ''\n let protocol = ''\n\n for (let i = 1; i < string.length; i++) {\n const char = string.charAt(i)\n\n if (char !== '/') {\n if (collecting === 'protocol') {\n protocol += string.charAt(i)\n } else {\n value += string.charAt(i)\n }\n }\n\n const ended = i === string.length - 1\n\n if (char === '/' || ended) {\n const codec = registry.getProtocol(protocol)\n\n if (collecting === 'protocol') {\n if (codec.size == null || codec.size === 0) {\n // a protocol without an address, eg. `/tls`\n components.push({\n code: codec.code,\n name: codec.name\n })\n\n value = ''\n protocol = ''\n collecting = 'protocol'\n\n continue\n } else if (ended) {\n throw new InvalidMultiaddrError(`Component ${protocol} was missing value`)\n }\n\n // continue collecting value\n collecting = 'value'\n } else if (collecting === 'value') {\n const component: Component = {\n code: codec.code,\n name: codec.name\n }\n\n if (codec.size != null && codec.size !== 0) {\n if (value === '') {\n throw new InvalidMultiaddrError(`Component ${protocol} was missing value`)\n }\n\n component.value = codec.stringToValue?.(value) ?? value\n }\n\n components.push(component)\n\n value = ''\n protocol = ''\n collecting = 'protocol'\n }\n }\n }\n\n if (protocol !== '' && value !== '') {\n throw new InvalidMultiaddrError('Incomplete multiaddr')\n }\n\n return components\n}\n\nexport function componentsToString (components: Component[]): string {\n return `/${components.flatMap(component => {\n if (component.value == null) {\n return component.name\n }\n\n const codec = registry.getProtocol(component.code)\n\n if (codec == null) {\n throw new InvalidMultiaddrError(`Unknown protocol code ${component.code}`)\n }\n\n return [\n component.name,\n codec.valueToString?.(component.value) ?? component.value\n ]\n }).join('/')}`\n}\n\n/**\n * For the passed address, return the serialized size\n */\nfunction sizeForAddr (codec: ProtocolCodec, bytes: Uint8Array, offset: number): number {\n if (codec.size == null || codec.size === 0) {\n return 0\n }\n\n if (codec.size > 0) {\n return codec.size / 8\n }\n\n return varint.decode(bytes, offset)\n}\n", "import { base58btc } from 'multiformats/bases/base58'\nimport { CID } from 'multiformats/cid'\nimport { equals as uint8ArrayEquals } from 'uint8arrays/equals'\nimport { fromString as uint8ArrayFromString } from 'uint8arrays/from-string'\nimport { toString as uint8ArrayToString } from 'uint8arrays/to-string'\nimport { bytesToComponents, componentsToBytes, componentsToString, stringToComponents } from './components.js'\nimport { CODE_DNS, CODE_DNS4, CODE_DNS6, CODE_DNSADDR, CODE_IP4, CODE_IP6, CODE_IP6ZONE, CODE_P2P, CODE_P2P_CIRCUIT, CODE_TCP, CODE_UDP } from './constants.ts'\nimport { InvalidMultiaddrError, InvalidParametersError } from './errors.ts'\nimport { registry } from './registry.ts'\nimport { isMultiaddr, multiaddr, resolvers } from './index.js'\nimport type { MultiaddrInput, Multiaddr as MultiaddrInterface, MultiaddrObject, Protocol, Tuple, NodeAddress, ResolveOptions, Component } from './index.js'\n\nconst inspect = Symbol.for('nodejs.util.inspect.custom')\nexport const symbol = Symbol.for('@multiformats/multiaddr')\n\nconst DNS_CODES = [\n CODE_DNS,\n CODE_DNS4,\n CODE_DNS6,\n CODE_DNSADDR\n]\n\nclass NoAvailableResolverError extends Error {\n constructor (message = 'No available resolver') {\n super(message)\n this.name = 'NoAvailableResolverError'\n }\n}\n\nfunction toComponents (addr: MultiaddrInput): Component[] {\n if (addr == null) {\n addr = '/'\n }\n\n if (isMultiaddr(addr)) {\n return addr.getComponents()\n }\n\n if (addr instanceof Uint8Array) {\n return bytesToComponents(addr)\n }\n\n if (typeof addr === 'string') {\n addr = addr\n .replace(/\\/(\\/)+/, '/')\n .replace(/(\\/)+$/, '')\n\n if (addr === '') {\n addr = '/'\n }\n\n return stringToComponents(addr)\n }\n\n if (Array.isArray(addr)) {\n return addr\n }\n\n throw new InvalidMultiaddrError('Must be a string, Uint8Array, Component[], or another Multiaddr')\n}\n\ninterface MultiaddrOptions {\n validate?: boolean\n}\n\n/**\n * Creates a {@link Multiaddr} from a {@link MultiaddrInput}\n */\nexport class Multiaddr implements MultiaddrInterface {\n [symbol]: boolean = true\n readonly #components: Component[]\n\n // cache string representation\n #string: string | undefined\n // cache byte representation\n #bytes: Uint8Array | undefined\n\n constructor (addr: MultiaddrInput | Component[] = '/', options: MultiaddrOptions = {}) {\n this.#components = toComponents(addr)\n\n if (options.validate !== false) {\n validate(this)\n }\n }\n\n get bytes (): Uint8Array {\n if (this.#bytes == null) {\n this.#bytes = componentsToBytes(this.#components)\n }\n\n return this.#bytes\n }\n\n toString (): string {\n if (this.#string == null) {\n this.#string = componentsToString(this.#components)\n }\n\n return this.#string\n }\n\n toJSON (): string {\n return this.toString()\n }\n\n toOptions (): MultiaddrObject {\n let family: 4 | 6 | undefined\n let transport: 'tcp' | 'udp' | undefined\n let host: string | undefined\n let port: number | undefined\n let zone = ''\n\n for (const { code, name, value } of this.#components) {\n if (code === CODE_IP6ZONE) {\n zone = `%${value ?? ''}`\n }\n\n // default to https when protocol & port are omitted from DNS addrs\n if (DNS_CODES.includes(code)) {\n transport = 'tcp'\n port = 443\n host = `${value ?? ''}${zone}`\n family = code === CODE_DNS6 ? 6 : 4\n }\n\n if (code === CODE_TCP || code === CODE_UDP) {\n transport = name === 'tcp' ? 'tcp' : 'udp'\n port = parseInt(value ?? '')\n }\n\n if (code === CODE_IP4 || code === CODE_IP6) {\n transport = 'tcp'\n host = `${value ?? ''}${zone}`\n family = code === CODE_IP6 ? 6 : 4\n }\n }\n\n if (family == null || transport == null || host == null || port == null) {\n throw new Error('multiaddr must have a valid format: \"/{ip4, ip6, dns4, dns6, dnsaddr}/{address}/{tcp, udp}/{port}\".')\n }\n\n const opts: MultiaddrObject = {\n family,\n host,\n transport,\n port\n }\n\n return opts\n }\n\n getComponents (): Component[] {\n return [\n ...this.#components\n ]\n }\n\n protos (): Protocol[] {\n return this.#components.map(({ code, value }) => {\n const codec = registry.getProtocol(code)\n\n return {\n code,\n size: codec.size ?? 0,\n name: codec.name,\n resolvable: Boolean(codec.resolvable),\n path: Boolean(codec.path)\n }\n })\n }\n\n protoCodes (): number[] {\n return this.#components.map(({ code }) => code)\n }\n\n protoNames (): string[] {\n return this.#components.map(({ name }) => name)\n }\n\n tuples (): Tuple[] {\n return this.#components.map(({ code, value }) => {\n if (value == null) {\n return [code]\n }\n\n const codec = registry.getProtocol(code)\n const output: Tuple = [code]\n\n if (value != null) {\n output.push(codec.valueToBytes?.(value) ?? uint8ArrayFromString(value))\n }\n\n return output\n })\n }\n\n stringTuples (): Array<[number, string?]> {\n return this.#components.map(({ code, value }) => {\n if (value == null) {\n return [code]\n }\n\n return [code, value]\n })\n }\n\n encapsulate (addr: MultiaddrInput): MultiaddrInterface {\n const ma = new Multiaddr(addr)\n\n return new Multiaddr([\n ...this.#components,\n ...ma.getComponents()\n ], {\n validate: false\n })\n }\n\n decapsulate (addr: Multiaddr | string): MultiaddrInterface {\n const addrString = addr.toString()\n const s = this.toString()\n const i = s.lastIndexOf(addrString)\n\n if (i < 0) {\n throw new InvalidParametersError(`Address ${this.toString()} does not contain subaddress: ${addr.toString()}`)\n }\n\n return new Multiaddr(s.slice(0, i), {\n validate: false\n })\n }\n\n decapsulateCode (code: number): Multiaddr {\n let index\n\n for (let i = this.#components.length - 1; i > -1; i--) {\n if (this.#components[i].code === code) {\n index = i\n break\n }\n }\n\n return new Multiaddr(this.#components.slice(0, index), {\n validate: false\n })\n }\n\n getPeerId (): string | null {\n try {\n let tuples: Array<[number, string | undefined]> = []\n\n this.#components.forEach(({ code, value }) => {\n if (code === CODE_P2P) {\n tuples.push([code, value])\n }\n\n // if this is a p2p-circuit address, return the target peer id if present\n // not the peer id of the relay\n if (code === CODE_P2P_CIRCUIT) {\n tuples = []\n }\n })\n\n // Get the last ipfs tuple ['p2p', 'peerid string']\n const tuple = tuples.pop()\n if (tuple?.[1] != null) {\n const peerIdStr = tuple[1]\n\n // peer id is base58btc encoded string but not multibase encoded so add the `z`\n // prefix so we can validate that it is correctly encoded\n if (peerIdStr[0] === 'Q' || peerIdStr[0] === '1') {\n return uint8ArrayToString(base58btc.decode(`z${peerIdStr}`), 'base58btc')\n }\n\n // try to parse peer id as CID\n return uint8ArrayToString(CID.parse(peerIdStr).multihash.bytes, 'base58btc')\n }\n\n return null\n } catch (e) {\n return null\n }\n }\n\n getPath (): string | null {\n for (const component of this.#components) {\n const codec = registry.getProtocol(component.code)\n\n if (!codec.path) {\n continue\n }\n\n return component.value ?? null\n }\n\n return null\n }\n\n equals (addr: { bytes: Uint8Array }): boolean {\n return uint8ArrayEquals(this.bytes, addr.bytes)\n }\n\n async resolve (options?: ResolveOptions): Promise<MultiaddrInterface[]> {\n const resolvableProto = this.protos().find((p) => p.resolvable)\n\n // Multiaddr is not resolvable?\n if (resolvableProto == null) {\n return [this]\n }\n\n const resolver = resolvers.get(resolvableProto.name)\n if (resolver == null) {\n throw new NoAvailableResolverError(`no available resolver for ${resolvableProto.name}`)\n }\n\n const result = await resolver(this, options)\n\n return result.map(str => multiaddr(str))\n }\n\n nodeAddress (): NodeAddress {\n const options = this.toOptions()\n\n if (options.transport !== 'tcp' && options.transport !== 'udp') {\n throw new Error(`multiaddr must have a valid format - no protocol with name: \"${options.transport}\". Must have a valid transport protocol: \"{tcp, udp}\"`)\n }\n\n return {\n family: options.family,\n address: options.host,\n port: options.port\n }\n }\n\n isThinWaistAddress (): boolean {\n if (this.#components.length !== 2) {\n return false\n }\n\n if (this.#components[0].code !== CODE_IP4 && this.#components[0].code !== CODE_IP6) {\n return false\n }\n\n if (this.#components[1].code !== CODE_TCP && this.#components[1].code !== CODE_UDP) {\n return false\n }\n\n return true\n }\n\n /**\n * Returns Multiaddr as a human-readable string\n * https://nodejs.org/api/util.html#utilinspectcustom\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * console.info(multiaddr('/ip4/127.0.0.1/tcp/4001'))\n * // 'Multiaddr(/ip4/127.0.0.1/tcp/4001)'\n * ```\n */\n [inspect] (): string {\n return `Multiaddr(${this.toString()})`\n }\n}\n\n/**\n * Ensures all multiaddr tuples are correct. Throws if any invalid protocols or\n * values are encountered.\n */\nexport function validate (addr: Multiaddr): void {\n addr.getComponents()\n .forEach(component => {\n const codec = registry.getProtocol(component.code)\n\n if (component.value == null) {\n return\n }\n\n codec.validate?.(component.value)\n })\n}\n", "/* eslint-disable @typescript-eslint/no-unsafe-return */\n\n// Heavily inspired by https://doc.rust-lang.org/src/std/net/parser.rs.html\n\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\ntype Fn = (...foo: any) => any;\n\nexport class Parser {\n private index = 0;\n private input = \"\";\n\n new(input: string): this {\n this.index = 0;\n this.input = input;\n return this;\n }\n\n /** Run a parser, and restore the pre-parse state if it fails. */\n readAtomically<T extends Fn>(fn: T): ReturnType<T> {\n const index = this.index;\n const result = fn();\n if (result === undefined) {\n this.index = index;\n }\n return result;\n }\n\n /** Run a parser, but fail if the entire input wasn't consumed. Doesn't run atomically. */\n parseWith<T extends Fn>(fn: T): ReturnType<T> | undefined {\n const result = fn();\n if (this.index !== this.input.length) {\n return undefined;\n }\n return result;\n }\n\n /** Peek the next character from the input */\n peekChar(): string | undefined {\n if (this.index >= this.input.length) {\n return undefined;\n }\n return this.input[this.index];\n }\n\n /** Read the next character from the input */\n readChar(): string | undefined {\n if (this.index >= this.input.length) {\n return undefined;\n }\n return this.input[this.index++];\n }\n\n /** Read the next character from the input if it matches the target. */\n readGivenChar(target: string): string | undefined {\n return this.readAtomically(() => {\n const char = this.readChar();\n if (char !== target) {\n return undefined;\n }\n return char;\n });\n }\n\n /**\n * Helper for reading separators in an indexed loop. Reads the separator\n * character iff index > 0, then runs the parser. When used in a loop,\n * the separator character will only be read on index > 0 (see\n * readIPv4Addr for an example)\n */\n readSeparator<T extends Fn>(sep: string, index: number, inner: T): ReturnType<T> {\n return this.readAtomically(() => {\n if (index > 0) {\n if (this.readGivenChar(sep) === undefined) {\n return undefined;\n }\n }\n return inner();\n });\n }\n\n /**\n * Read a number off the front of the input in the given radix, stopping\n * at the first non-digit character or eof. Fails if the number has more\n * digits than max_digits or if there is no number.\n */\n readNumber(\n radix: number,\n maxDigits: number | undefined,\n allowZeroPrefix: boolean,\n maxBytes: number\n ): number | undefined {\n return this.readAtomically(() => {\n let result = 0;\n let digitCount = 0;\n\n const leadingChar = this.peekChar();\n if (leadingChar === undefined) {\n return undefined;\n }\n const hasLeadingZero = leadingChar === \"0\";\n const maxValue = 2 ** (8 * maxBytes) - 1;\n\n // eslint-disable-next-line no-constant-condition\n while (true) {\n const digit = this.readAtomically(() => {\n const char = this.readChar();\n if (char === undefined) {\n return undefined;\n }\n const num = Number.parseInt(char, radix);\n if (Number.isNaN(num)) {\n return undefined;\n }\n return num;\n });\n if (digit === undefined) {\n break;\n }\n result *= radix;\n result += digit;\n if (result > maxValue) {\n return undefined;\n }\n digitCount += 1;\n if (maxDigits !== undefined) {\n if (digitCount > maxDigits) {\n return undefined;\n }\n }\n }\n\n if (digitCount === 0) {\n return undefined;\n } else if (!allowZeroPrefix && hasLeadingZero && digitCount > 1) {\n return undefined;\n } else {\n return result;\n }\n });\n }\n\n /** Read an IPv4 address. */\n readIPv4Addr(): Uint8Array | undefined {\n return this.readAtomically(() => {\n const out = new Uint8Array(4);\n\n for (let i = 0; i < out.length; i++) {\n const ix = this.readSeparator(\".\", i, () => this.readNumber(10, 3, false, 1));\n if (ix === undefined) {\n return undefined;\n }\n out[i] = ix;\n }\n\n return out;\n });\n }\n\n /** Read an IPv6 Address. */\n readIPv6Addr(): Uint8Array | undefined {\n /**\n * Read a chunk of an IPv6 address into `groups`. Returns the number\n * of groups read, along with a bool indicating if an embedded\n * trailing IPv4 address was read. Specifically, read a series of\n * colon-separated IPv6 groups (0x0000 - 0xFFFF), with an optional\n * trailing embedded IPv4 address.\n */\n const readGroups = (groups: Uint8Array): [number, boolean] => {\n for (let i = 0; i < groups.length / 2; i++) {\n const ix = i * 2;\n // Try to read a trailing embedded IPv4 address. There must be at least 4 groups left.\n if (i < groups.length - 3) {\n const ipv4 = this.readSeparator(\":\", i, () => this.readIPv4Addr());\n if (ipv4 !== undefined) {\n groups[ix] = ipv4[0];\n groups[ix + 1] = ipv4[1];\n groups[ix + 2] = ipv4[2];\n groups[ix + 3] = ipv4[3];\n\n return [ix + 4, true];\n }\n }\n\n const group = this.readSeparator(\":\", i, () => this.readNumber(16, 4, true, 2));\n if (group === undefined) {\n return [ix, false];\n }\n groups[ix] = group >> 8;\n groups[ix + 1] = group & 255;\n }\n return [groups.length, false];\n };\n\n return this.readAtomically(() => {\n // Read the front part of the address; either the whole thing, or up to the first ::\n const head = new Uint8Array(16);\n const [headSize, headIp4] = readGroups(head);\n\n if (headSize === 16) {\n return head;\n }\n\n // IPv4 part is not allowed before `::`\n if (headIp4) {\n return undefined;\n }\n\n // Read `::` if previous code parsed less than 8 groups.\n // `::` indicates one or more groups of 16 bits of zeros.\n if (this.readGivenChar(\":\") === undefined) {\n return undefined;\n }\n if (this.readGivenChar(\":\") === undefined) {\n return undefined;\n }\n\n // Read the back part of the address. The :: must contain at least one\n // set of zeroes, so our max length is 7.\n const tail = new Uint8Array(14);\n const limit = 16 - (headSize + 2);\n const [tailSize] = readGroups(tail.subarray(0, limit));\n\n // Concat the head and tail of the IP address\n head.set(tail.subarray(0, tailSize), 16 - tailSize);\n\n return head;\n });\n }\n\n /** Read an IP Address, either IPv4 or IPv6. */\n readIPAddr(): Uint8Array | undefined {\n return this.readIPv4Addr() ?? this.readIPv6Addr();\n }\n}\n", "import { Parser } from \"./parser.js\";\n\n// See https://stackoverflow.com/questions/166132/maximum-length-of-the-textual-representation-of-an-ipv6-address\nconst MAX_IPV6_LENGTH = 45;\nconst MAX_IPV4_LENGTH = 15;\n\nconst parser = new Parser();\n\n/** Parse `input` into IPv4 bytes. */\nexport function parseIPv4(input: string): Uint8Array | undefined {\n if (input.length > MAX_IPV4_LENGTH) {\n return undefined;\n }\n return parser.new(input).parseWith(() => parser.readIPv4Addr());\n}\n\n/** Parse IPv4 `input` into IPv6 with IPv4-mapped bytes, eg ::ffff:1.2.3.4 */\nexport function parseIPv4Mapped(input: string): Uint8Array | undefined {\n if (input.length > MAX_IPV4_LENGTH) {\n return undefined;\n }\n\n const ipv4 = parser.new(input).parseWith(() => parser.readIPv4Addr());\n if (ipv4 === undefined) {\n return undefined;\n }\n\n return Uint8Array.from([0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0xff, 0xff, ipv4[0], ipv4[1], ipv4[2], ipv4[3]]);\n}\n\n/** Parse `input` into IPv6 bytes. */\nexport function parseIPv6(input: string): Uint8Array | undefined {\n // strip zone index if it is present\n if (input.includes(\"%\")) {\n input = input.split(\"%\")[0];\n }\n if (input.length > MAX_IPV6_LENGTH) {\n return undefined;\n }\n return parser.new(input).parseWith(() => parser.readIPv6Addr());\n}\n\n/** Parse `input` into IPv4 or IPv6 bytes. */\nexport function parseIP(input: string, mapIPv4ToIPv6 = false): Uint8Array | undefined {\n // strip zone index if it is present\n if (input.includes(\"%\")) {\n input = input.split(\"%\")[0];\n }\n\n if (input.length > MAX_IPV6_LENGTH) {\n return undefined;\n }\n\n const addr = parser.new(input).parseWith(() => parser.readIPAddr());\n if (!addr) {\n return undefined;\n }\n\n if (mapIPv4ToIPv6 && addr.length === 4) {\n return Uint8Array.from([0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0xff, 0xff, addr[0], addr[1], addr[2], addr[3]]);\n }\n\n return addr;\n}\n", "import { parseIP } from \"@chainsafe/is-ip/parse\";\nimport { allFF, deepEqual } from \"./util.js\";\n\nexport const IPv4Len = 4;\nexport const IPv6Len = 16;\n\nexport const maxIPv6Octet = parseInt(\"0xFFFF\", 16);\nexport const ipv4Prefix = new Uint8Array([\n 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 255, 255,\n]);\n\nexport interface IpNetRaw {\n network: Uint8Array;\n mask: Uint8Array;\n}\n\nexport function maskIp(ip: Uint8Array, mask: Uint8Array): Uint8Array {\n if (mask.length === IPv6Len && ip.length === IPv4Len && allFF(mask, 0, 11)) {\n mask = mask.slice(12);\n }\n if (\n mask.length === IPv4Len &&\n ip.length === IPv6Len &&\n deepEqual(ip, ipv4Prefix, 0, 11)\n ) {\n ip = ip.slice(12);\n }\n const n = ip.length;\n if (n != mask.length) {\n throw new Error(\"Failed to mask ip\");\n }\n const out = new Uint8Array(n);\n for (let i = 0; i < n; i++) {\n out[i] = ip[i] & mask[i];\n }\n return out;\n}\n\nexport function containsIp(\n net: IpNetRaw,\n ip: Uint8Array | number[] | string\n): boolean {\n if (typeof ip === \"string\") {\n ip = parseIP(ip)!;\n }\n if (ip == null) throw new Error(\"Invalid ip\");\n if (ip.length !== net.network.length) {\n return false;\n }\n for (let i = 0; i < ip.length; i++) {\n if ((net.network[i] & net.mask[i]) !== (ip[i] & net.mask[i])) {\n return false;\n }\n }\n return true;\n}\n\nexport function iPv4FromIPv6(ip: Uint8Array): Uint8Array {\n if (!isIPv4mappedIPv6(ip)) {\n throw new Error(\"Must have 0xffff prefix\");\n }\n return ip.slice(12);\n}\n\nexport function isIPv4mappedIPv6(ip: Uint8Array | number[]): boolean {\n return deepEqual(ip, ipv4Prefix, 0, 11);\n}\n", "/**\n * @packageDocumentation\n *\n * A standard way to represent addresses that\n *\n * - support any standard network protocol\n * - are self-describing\n * - have a binary packed format\n * - have a nice string representation\n * - encapsulate well\n *\n * @example\n *\n * ```TypeScript\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const addr = multiaddr('/ip4/127.0.0.1/udp/1234')\n * // Multiaddr(/ip4/127.0.0.1/udp/1234)\n *\n * addr.bytes\n * // <Uint8Array 04 7f 00 00 01 11 04 d2>\n *\n * addr.toString()\n * // '/ip4/127.0.0.1/udp/1234'\n *\n * addr.protos()\n * // [\n * // {code: 4, name: 'ip4', size: 32},\n * // {code: 273, name: 'udp', size: 16}\n * // ]\n *\n * // gives you an object that is friendly with what Node.js core modules expect for addresses\n * addr.nodeAddress()\n * // {\n * // family: 4,\n * // port: 1234,\n * // address: \"127.0.0.1\"\n * // }\n *\n * addr.encapsulate('/sctp/5678')\n * // Multiaddr(/ip4/127.0.0.1/udp/1234/sctp/5678)\n * ```\n *\n * ## Resolving DNSADDR addresses\n *\n * [DNSADDR](https://github.com/multiformats/multiaddr/blob/master/protocols/DNSADDR.md) is a spec that allows storing a TXT DNS record that contains a Multiaddr.\n *\n * To resolve DNSADDR addresses, call the `.resolve()` function the multiaddr, optionally passing a `DNS` resolver.\n *\n * DNSADDR addresses can resolve to multiple multiaddrs, since there is no limit to the number of TXT records that can be stored.\n *\n * @example Resolving DNSADDR Multiaddrs\n *\n * ```TypeScript\n * import { multiaddr, resolvers } from '@multiformats/multiaddr'\n * import { dnsaddrResolver } from '@multiformats/multiaddr/resolvers'\n *\n * resolvers.set('dnsaddr', dnsaddrResolver)\n *\n * const ma = multiaddr('/dnsaddr/bootstrap.libp2p.io')\n *\n * // resolve with a 5s timeout\n * const resolved = await ma.resolve({\n * signal: AbortSignal.timeout(5000)\n * })\n *\n * console.info(resolved)\n * // [Multiaddr('/ip4/147.75...'), Multiaddr('/ip4/147.75...'), Multiaddr('/ip4/147.75...')...]\n * ```\n *\n * @example Using a custom DNS resolver to resolve DNSADDR Multiaddrs\n *\n * See the docs for [@multiformats/dns](https://www.npmjs.com/package/@multiformats/dns) for a full breakdown of how to specify multiple resolvers or resolvers that can be used for specific TLDs.\n *\n * ```TypeScript\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { dns } from '@multiformats/dns'\n * import { dnsJsonOverHttps } from '@multiformats/dns/resolvers'\n *\n * const resolver = dns({\n * resolvers: {\n * '.': dnsJsonOverHttps('https://cloudflare-dns.com/dns-query')\n * }\n * })\n *\n * const ma = multiaddr('/dnsaddr/bootstrap.libp2p.io')\n * const resolved = await ma.resolve({\n * dns: resolver\n * })\n *\n * console.info(resolved)\n * // [Multiaddr('/ip4/147.75...'), Multiaddr('/ip4/147.75...'), Multiaddr('/ip4/147.75...')...]\n * ```\n *\n * @example Adding custom protocols\n *\n * To add application-specific or experimental protocols, add a protocol codec\n * to the protocol registry:\n *\n * ```ts\n * import { registry, V, multiaddr } from '@multiformats/multiaddr'\n * import type { ProtocolCodec } from '@multiformats/multiaddr'\n *\n * const maWithCustomTuple = '/custom-protocol/hello'\n *\n * // throws UnknownProtocolError\n * multiaddr(maWithCustomTuple)\n *\n * const protocol: ProtocolCodec = {\n * code: 2059,\n * name: 'custom-protocol',\n * size: V\n * // V means variable length, can also be 0, a positive integer (e.g. a fixed\n * // length or omitted\n * }\n *\n * registry.addProtocol(protocol)\n *\n * // does not throw UnknownProtocolError\n * multiaddr(maWithCustomTuple)\n *\n * // protocols can also be removed\n * registry.removeProtocol(protocol.code)\n * ```\n */\n\nimport { toString as uint8ArrayToString } from 'uint8arrays/to-string'\nimport { InvalidParametersError } from './errors.ts'\nimport { Multiaddr as MultiaddrClass, symbol } from './multiaddr.js'\nimport { registry, V } from './registry.ts'\nimport type { ProtocolCodec } from './registry.ts'\nimport type { Resolver } from './resolvers/index.js'\nimport type { DNS } from '@multiformats/dns'\nimport type { AbortOptions } from 'abort-error'\n\n/**\n * Protocols are present in the protocol table\n *\n * @deprecated\n */\nexport interface Protocol {\n code: number\n size: number\n name: string\n resolvable?: boolean | undefined\n path?: boolean | undefined\n}\n\n/**\n * A plain JavaScript object representation of a {@link Multiaddr}\n */\nexport interface MultiaddrObject {\n family: 4 | 6\n host: string\n transport: 'tcp' | 'udp'\n port: number\n}\n\n/**\n * The protocol registry stores protocol codecs that allow transformation of\n * multiaddr tuples from bytes to string and back again, and also validation of\n * the address values.\n */\nexport interface Registry {\n /**\n * Retrieve a protocol definition by it's code or name\n */\n getProtocol (key: string | number): ProtocolCodec\n\n /**\n * Add a new protocol definition\n */\n addProtocol (codec: ProtocolCodec): void\n\n /**\n * Remove a protocol definition by it's code\n */\n removeProtocol (code: number): void\n}\n\n/**\n * A NodeAddress is an IPv4/IPv6 address/TCP port combination\n */\nexport interface NodeAddress {\n family: 4 | 6\n address: string\n port: number\n}\n\n/**\n * These types can be parsed into a {@link Multiaddr} object\n */\nexport type MultiaddrInput = string | Multiaddr | Uint8Array | null | Component[]\n\n/**\n * A code/value pair\n *\n * @deprecated Use Component instead\n */\nexport type Tuple = [number, Uint8Array?]\n\n/**\n * A code/value pair with the value as a string\n *\n * @deprecated Use Component instead\n */\nexport type StringTuple = [number, string?]\n\n/**\n * Allows aborting long-lived operations\n *\n * @deprecated Import from `abort-error` instead\n */\nexport type { AbortOptions }\n\n/**\n * All configured {@link Resolver}s\n *\n * @deprecated DNS resolving will be removed in a future release\n */\nexport const resolvers = new Map<string, Resolver>()\n\nexport type { Resolver }\n\nexport { MultiaddrFilter } from './filter/multiaddr-filter.js'\n\n/**\n * @deprecated DNS resolving will be removed in a future release\n */\nexport interface ResolveOptions extends AbortOptions {\n /**\n * An optional DNS resolver\n */\n dns?: DNS\n\n /**\n * When resolving DNSADDR Multiaddrs that resolve to other DNSADDR Multiaddrs,\n * limit how many times we will recursively resolve them.\n *\n * @default 32\n */\n maxRecursiveDepth?: number\n}\n\n/**\n * A Component is a section of a multiaddr with a name/code, possibly with a\n * value.\n *\n * Component names/codes are defined in the protocol table.\n *\n * @see https://github.com/multiformats/multiaddr/blob/master/protocols.csv\n */\nexport interface Component {\n /**\n * The code of the component as defined in the protocol table\n */\n code: number\n\n /**\n * The name of the component as defined in the protocol table\n */\n name: string\n\n /**\n * The component value, if one is present\n */\n value?: string\n\n /**\n * The bytes that make up the component. This will be set if the multiaddr\n * was parsed from a `Uint8Array`, or if `.bytes` has been accessed on it.\n */\n bytes?: Uint8Array\n}\n\nexport interface Multiaddr {\n bytes: Uint8Array\n\n /**\n * Returns Multiaddr as a String\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * multiaddr('/ip4/127.0.0.1/tcp/4001').toString()\n * // '/ip4/127.0.0.1/tcp/4001'\n * ```\n */\n toString(): string\n\n /**\n * Returns Multiaddr as a JSON encoded object\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * JSON.stringify(multiaddr('/ip4/127.0.0.1/tcp/4001'))\n * // '/ip4/127.0.0.1/tcp/4001'\n * ```\n */\n toJSON(): string\n\n /**\n * Returns the components that make up this Multiaddr\n *\n * @example\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * multiaddr('/ip4/127.0.0.1/tcp/4001').getComponents()\n * // [{ name: 'ip4', code: 4, value: '127.0.0.1' }, { name: 'tcp', code: 6, value: '4001' }]\n * ```\n */\n getComponents(): Component[]\n\n /**\n * Returns Multiaddr as a convenient options object to be used with\n * `createConnection` from `node:net`\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * multiaddr('/ip4/127.0.0.1/tcp/4001').toOptions()\n * // { family: 4, host: '127.0.0.1', transport: 'tcp', port: 4001 }\n * ```\n */\n toOptions(): MultiaddrObject\n\n /**\n * Returns the protocols the Multiaddr is defined with, as an array of\n * objects, in left-to-right order. Each object contains the protocol code,\n * protocol name, and the size of its address space in bits.\n * [See list of protocols](https://github.com/multiformats/multiaddr/blob/master/protocols.csv)\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * multiaddr('/ip4/127.0.0.1/tcp/4001').protos()\n * // [ { code: 4, size: 32, name: 'ip4' },\n * // { code: 6, size: 16, name: 'tcp' } ]\n * ```\n *\n * @deprecated Use `getComponents()` instead\n */\n protos(): Protocol[]\n\n /**\n * Returns the codes of the protocols in left-to-right order.\n * [See list of protocols](https://github.com/multiformats/multiaddr/blob/master/protocols.csv)\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * multiaddr('/ip4/127.0.0.1/tcp/4001').protoCodes()\n * // [ 4, 6 ]\n * ```\n *\n * @deprecated Use `getComponents()` instead\n */\n protoCodes(): number[]\n\n /**\n * Returns the names of the protocols in left-to-right order.\n * [See list of protocols](https://github.com/multiformats/multiaddr/blob/master/protocols.csv)\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * multiaddr('/ip4/127.0.0.1/tcp/4001').protoNames()\n * // [ 'ip4', 'tcp' ]\n * ```\n *\n * @deprecated Use `getComponents()` instead\n */\n protoNames(): string[]\n\n /**\n * Returns a tuple of parts\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * multiaddr('/ip4/127.0.0.1/tcp/4001').tuples()\n * // [ [ 4, <Buffer 7f 00 00 01> ], [ 6, <Buffer 0f a1> ] ]\n * ```\n *\n * @deprecated Use `getComponents()` instead\n */\n tuples(): Tuple[]\n\n /**\n * Returns a tuple of string/number parts\n * - tuples[][0] = code of protocol\n * - tuples[][1] = contents of address\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * multiaddr('/ip4/127.0.0.1/tcp/4001').stringTuples()\n * // [ [ 4, '127.0.0.1' ], [ 6, '4001' ] ]\n * ```\n *\n * @deprecated Use `getComponents()` instead\n */\n stringTuples(): StringTuple[]\n\n /**\n * Encapsulates a Multiaddr in another Multiaddr\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const mh1 = multiaddr('/ip4/8.8.8.8/tcp/1080')\n * // Multiaddr(/ip4/8.8.8.8/tcp/1080)\n *\n * const mh2 = multiaddr('/ip4/127.0.0.1/tcp/4001')\n * // Multiaddr(/ip4/127.0.0.1/tcp/4001)\n *\n * const mh3 = mh1.encapsulate(mh2)\n * // Multiaddr(/ip4/8.8.8.8/tcp/1080/ip4/127.0.0.1/tcp/4001)\n *\n * mh3.toString()\n * // '/ip4/8.8.8.8/tcp/1080/ip4/127.0.0.1/tcp/4001'\n * ```\n *\n * @param {MultiaddrInput} addr - Multiaddr to add into this Multiaddr\n */\n encapsulate(addr: MultiaddrInput): Multiaddr\n\n /**\n * Decapsulates a Multiaddr from another Multiaddr\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const mh1 = multiaddr('/ip4/8.8.8.8/tcp/1080')\n * // Multiaddr(/ip4/8.8.8.8/tcp/1080)\n *\n * const mh2 = multiaddr('/ip4/127.0.0.1/tcp/4001')\n * // Multiaddr(/ip4/127.0.0.1/tcp/4001)\n *\n * const mh3 = mh1.encapsulate(mh2)\n * // Multiaddr(/ip4/8.8.8.8/tcp/1080/ip4/127.0.0.1/tcp/4001)\n *\n * mh3.decapsulate(mh2).toString()\n * // '/ip4/8.8.8.8/tcp/1080'\n * ```\n *\n * @param {Multiaddr | string} addr - Multiaddr to remove from this Multiaddr\n */\n decapsulate(addr: Multiaddr | string): Multiaddr\n\n /**\n * A more reliable version of `decapsulate` if you are targeting a specific\n * code, such as 421 (the `p2p` protocol code). The last index of the code\n * will be removed from the `Multiaddr`, and a new instance will be returned.\n * If the code is not present, the original `Multiaddr` is returned.\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const addr = multiaddr('/ip4/0.0.0.0/tcp/8080/p2p/QmcgpsyWgH8Y8ajJz1Cu72KnS5uo2Aa2LpzU7kinSupNKC')\n * // Multiaddr(/ip4/0.0.0.0/tcp/8080/p2p/QmcgpsyWgH8Y8ajJz1Cu72KnS5uo2Aa2LpzU7kinSupNKC)\n *\n * addr.decapsulateCode(421).toString()\n * // '/ip4/0.0.0.0/tcp/8080'\n *\n * multiaddr('/ip4/127.0.0.1/tcp/8080').decapsulateCode(421).toString()\n * // '/ip4/127.0.0.1/tcp/8080'\n * ```\n */\n decapsulateCode(code: number): Multiaddr\n\n /**\n * Extract the peerId if the multiaddr contains one\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const mh1 = multiaddr('/ip4/8.8.8.8/tcp/1080/ipfs/QmValidBase58string')\n * // Multiaddr(/ip4/8.8.8.8/tcp/1080/ipfs/QmValidBase58string)\n *\n * // should return QmValidBase58string or null if the id is missing or invalid\n * const peerId = mh1.getPeerId()\n * ```\n *\n * @deprecated A multiaddr can contain multiple PeerIds, use stringTuples() to get a specific one\n */\n getPeerId(): string | null\n\n /**\n * Extract the path if the multiaddr contains one\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const mh1 = multiaddr('/ip4/8.8.8.8/tcp/1080/unix/tmp/p2p.sock')\n * // Multiaddr(/ip4/8.8.8.8/tcp/1080/unix/tmp/p2p.sock)\n *\n * // should return utf8 string or null if the id is missing or invalid\n * const path = mh1.getPath()\n * ```\n *\n * @deprecated A multiaddr can contain multiple tuples that could be interpreted as paths, use stringTuples() to get a specific one\n */\n getPath(): string | null\n\n /**\n * Checks if two Multiaddrs are the same\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const mh1 = multiaddr('/ip4/8.8.8.8/tcp/1080')\n * // Multiaddr(/ip4/8.8.8.8/tcp/1080)\n *\n * const mh2 = multiaddr('/ip4/127.0.0.1/tcp/4001')\n * // Multiaddr(/ip4/127.0.0.1/tcp/4001)\n *\n * mh1.equals(mh1)\n * // true\n *\n * mh1.equals(mh2)\n * // false\n * ```\n */\n equals(addr: { bytes: Uint8Array }): boolean\n\n /**\n * Resolve multiaddr if containing resolvable hostname.\n *\n * @example\n * ```js\n * import { multiaddr, resolvers } from '@multiformats/multiaddr'\n *\n * resolvers.set('dnsaddr', resolverFunction)\n * const mh1 = multiaddr('/dnsaddr/bootstrap.libp2p.io/p2p/QmbLHAnMoJPWSCR5Zhtx6BHJX9KiKNN6tpvbUcqanj75Nb')\n * const resolvedMultiaddrs = await mh1.resolve()\n * // [\n * // Multiaddr(/ip4/147.75.83.83/tcp/4001/p2p/QmbLHAnMoJPWSCR5Zhtx6BHJX9KiKNN6tpvbUcqanj75Nb),\n * // Multiaddr(/ip4/147.75.83.83/tcp/443/wss/p2p/QmbLHAnMoJPWSCR5Zhtx6BHJX9KiKNN6tpvbUcqanj75Nb),\n * // Multiaddr(/ip4/147.75.83.83/udp/4001/quic/p2p/QmbLHAnMoJPWSCR5Zhtx6BHJX9KiKNN6tpvbUcqanj75Nb)\n * // ]\n * ```\n *\n * @deprecated If you need to resolve `dnsaddr` addresses, use `getComponents()` to extract them and perform the resolution yourself\n */\n resolve(options?: ResolveOptions): Promise<Multiaddr[]>\n\n /**\n * Gets a Multiaddrs node-friendly address object. Note that protocol\n * information is left out: in Node (and most network systems) the protocol is\n * unknowable given only the address.\n *\n * Has to be a ThinWaist Address, otherwise throws error\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * multiaddr('/ip4/127.0.0.1/tcp/4001').nodeAddress()\n * // {family: 4, address: '127.0.0.1', port: 4001}\n * ```\n */\n nodeAddress(): NodeAddress\n\n /**\n * Returns if a Multiaddr is a Thin Waist address or not.\n *\n * Thin Waist is if a Multiaddr adheres to the standard combination of:\n *\n * `{IPv4, IPv6}/{TCP, UDP}`\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const mh1 = multiaddr('/ip4/127.0.0.1/tcp/4001')\n * // Multiaddr(/ip4/127.0.0.1/tcp/4001)\n * const mh2 = multiaddr('/ip4/192.168.2.1/tcp/5001')\n * // Multiaddr(/ip4/192.168.2.1/tcp/5001)\n * const mh3 = mh1.encapsulate(mh2)\n * // Multiaddr(/ip4/127.0.0.1/tcp/4001/ip4/192.168.2.1/tcp/5001)\n * const mh4 = multiaddr('/ip4/127.0.0.1/tcp/2000/wss/p2p-webrtc-star/p2p/QmcgpsyWgH8Y8ajJz1Cu72KnS5uo2Aa2LpzU7kinSooo2a')\n * // Multiaddr(/ip4/127.0.0.1/tcp/2000/wss/p2p-webrtc-star/p2p/QmcgpsyWgH8Y8ajJz1Cu72KnS5uo2Aa2LpzU7kinSooo2a)\n * mh1.isThinWaistAddress()\n * // true\n * mh2.isThinWaistAddress()\n * // true\n * mh3.isThinWaistAddress()\n * // false\n * mh4.isThinWaistAddress()\n * // false\n * ```\n */\n isThinWaistAddress(addr?: Multiaddr): boolean\n}\n\n/**\n * Creates a Multiaddr from a node-friendly address object\n *\n * @example\n * ```js\n * import { fromNodeAddress } from '@multiformats/multiaddr'\n *\n * fromNodeAddress({address: '127.0.0.1', port: '4001'}, 'tcp')\n * // Multiaddr(/ip4/127.0.0.1/tcp/4001)\n * ```\n */\nexport function fromNodeAddress (addr: NodeAddress, transport: string): Multiaddr {\n if (addr == null) {\n throw new InvalidParametersError('requires node address object')\n }\n if (transport == null) {\n throw new InvalidParametersError('requires transport protocol')\n }\n let ip: string | undefined\n let host = addr.address\n switch (addr.family) {\n case 4:\n ip = 'ip4'\n break\n case 6:\n ip = 'ip6'\n\n if (host.includes('%')) {\n const parts = host.split('%')\n\n if (parts.length !== 2) {\n throw Error('Multiple ip6 zones in multiaddr')\n }\n\n host = parts[0]\n const zone = parts[1]\n ip = `ip6zone/${zone}/ip6`\n }\n break\n default:\n throw Error('Invalid addr family, should be 4 or 6.')\n }\n\n return new MultiaddrClass('/' + [ip, host, transport, addr.port].join('/'))\n}\n\n/**\n * Create a {@link Multiaddr} from an array of {@link Tuple}s\n *\n * @example\n *\n * ```ts\n * import { fromTuples, multiaddr } from '@multiformats/multiaddr'\n *\n * const ma = multiaddr('/ip4/127.0.0.1')\n * const tuples = ma.tuples()\n *\n * const ma2 = fromTuples(tuples)\n *\n * console.info(ma2)\n * // '/ip4/127.0.0.1'\n * ```\n *\n * @deprecated Will be removed in a future release\n */\nexport function fromTuples (tuples: Tuple[]): Multiaddr {\n return multiaddr(tuples.map(([code, value]) => {\n const codec = registry.getProtocol(code)\n\n const component: Component = {\n code,\n name: codec.name\n }\n\n if (value != null) {\n component.value = codec.bytesToValue?.(value) ?? uint8ArrayToString(value)\n }\n\n return component\n }))\n}\n\n/**\n * Create a {@link Multiaddr} from an array of {@link StringTuple}s\n *\n * @example\n *\n * ```ts\n * import { fromStringTuples, multiaddr } from '@multiformats/multiaddr'\n *\n * const ma = multiaddr('/ip4/127.0.0.1')\n * const tuples = ma.stringTuples()\n *\n * const ma2 = fromStringTuples(tuples)\n *\n * console.info(ma2)\n * // '/ip4/127.0.0.1'\n * ```\n *\n * @deprecated Will be removed in a future release\n */\nexport function fromStringTuples (tuples: StringTuple[]): Multiaddr {\n return multiaddr(tuples.map(([code, value]) => {\n const codec = registry.getProtocol(code)\n\n const component: Component = {\n code,\n name: codec.name\n }\n\n if (value != null) {\n component.value = value\n }\n\n return component\n }))\n}\n\n/**\n * Returns if something is a {@link Multiaddr} that is a resolvable name\n *\n * @example\n *\n * ```js\n * import { isName, multiaddr } from '@multiformats/multiaddr'\n *\n * isName(multiaddr('/ip4/127.0.0.1'))\n * // false\n * isName(multiaddr('/dns/ipfs.io'))\n * // true\n * ```\n *\n * @deprecated DNS resolving will be removed in a future release\n */\nexport function isName (addr: Multiaddr): boolean {\n if (!isMultiaddr(addr)) {\n return false\n }\n\n // if a part of the multiaddr is resolvable, then return true\n return addr.protos().some((proto) => proto.resolvable)\n}\n\n/**\n * Check if object is a {@link Multiaddr} instance\n *\n * @example\n *\n * ```js\n * import { isMultiaddr, multiaddr } from '@multiformats/multiaddr'\n *\n * isMultiaddr(5)\n * // false\n * isMultiaddr(multiaddr('/ip4/127.0.0.1'))\n * // true\n * ```\n */\nexport function isMultiaddr (value: any): value is Multiaddr {\n return Boolean(value?.[symbol])\n}\n\n/**\n * A function that takes a {@link MultiaddrInput} and returns a {@link Multiaddr}\n *\n * @example\n * ```js\n * import { multiaddr } from '@libp2p/multiaddr'\n *\n * multiaddr('/ip4/127.0.0.1/tcp/4001')\n * // Multiaddr(/ip4/127.0.0.1/tcp/4001)\n * ```\n *\n * @param {MultiaddrInput} [addr] - If String or Uint8Array, needs to adhere to the address format of a [multiaddr](https://github.com/multiformats/multiaddr#string-format)\n */\nexport function multiaddr (addr?: MultiaddrInput): Multiaddr {\n return new MultiaddrClass(addr)\n}\n\n/**\n * For the passed proto string or number, return a {@link Protocol}\n *\n * @example\n *\n * ```js\n * import { protocol } from '@multiformats/multiaddr'\n *\n * console.info(protocol(4))\n * // { code: 4, size: 32, name: 'ip4', resolvable: false, path: false }\n * ```\n *\n * @deprecated This will be removed in a future version\n */\nexport function protocols (proto: number | string): Protocol {\n const codec = registry.getProtocol(proto)\n\n return {\n code: codec.code,\n size: codec.size ?? 0,\n name: codec.name,\n resolvable: Boolean(codec.resolvable),\n path: Boolean(codec.path)\n }\n}\n\n/**\n * Export all table.csv codes. These are all named exports so can be tree-shaken\n * out by bundlers.\n */\nexport * from './constants.ts'\nexport { registry, V }\nexport type { ProtocolCodec }\n", "import type { Matcher, MultiaddrMatcher } from './index.js'\nimport type { Multiaddr, Component } from '@multiformats/multiaddr'\n\n/**\n * Matches a multiaddr component with the specified code but no value\n */\nexport const code = (code: number): Matcher => {\n return {\n match: (vals) => {\n const component = vals[0]\n\n if (component == null) {\n return false\n }\n\n if (component.code !== code) {\n return false\n }\n\n if (component.value != null) {\n return false\n }\n\n return vals.slice(1)\n }\n }\n}\n\n/**\n * Matches a multiaddr component with the specified code and value. If the value\n * is omitted any non-undefined value is matched.\n */\nexport const value = (code: number, value?: string): Matcher => {\n return {\n match: (vals) => {\n const component = vals[0]\n\n if (component?.code !== code) {\n return false\n }\n\n if (component.value == null) {\n return false\n }\n\n if (value != null && component.value !== value) {\n return false\n }\n\n return vals.slice(1)\n }\n }\n}\n\n/**\n * An optional matcher\n */\nexport const optional = (matcher: Matcher): Matcher => {\n return {\n match: (vals) => {\n const result = matcher.match(vals)\n\n if (result === false) {\n return vals\n }\n\n return result\n }\n }\n}\n\n/**\n * Matches any one of the passed matches\n */\nexport const or = (...matchers: Matcher[]): Matcher => {\n return {\n match: (vals) => {\n let matches: Component[] | undefined\n\n for (const matcher of matchers) {\n const result = matcher.match(vals)\n\n // no match\n if (result === false) {\n continue\n }\n\n // choose greediest matcher\n if (matches == null || result.length < matches.length) {\n matches = result\n }\n }\n\n if (matches == null) {\n return false\n }\n\n return matches\n }\n }\n}\n\n/**\n * Matches all of the passed matchers\n */\nexport const and = (...matchers: Matcher[]): Matcher => {\n return {\n match: (vals) => {\n for (const matcher of matchers) {\n // pass what's left of the array\n const result = matcher.match(vals)\n\n // no match\n if (result === false) {\n return false\n }\n\n vals = result\n }\n\n return vals\n }\n }\n}\n\n/**\n * Create a multiaddr matcher from the passed component matchers\n */\nexport function fmt (...matchers: Matcher[]): MultiaddrMatcher {\n function match (ma?: Multiaddr): Component[] | false {\n if (ma == null) {\n return false\n }\n\n let parts = ma.getComponents()\n\n for (const matcher of matchers) {\n const result = matcher.match(parts)\n\n if (result === false) {\n return false\n }\n\n parts = result\n }\n\n return parts\n }\n\n function matches (ma?: Multiaddr): boolean {\n const result = match(ma)\n\n return result !== false\n }\n\n function exactMatch (ma?: Multiaddr): boolean {\n const result = match(ma)\n\n if (result === false) {\n return false\n }\n\n return result.length === 0\n }\n\n return {\n matchers,\n matches,\n exactMatch\n }\n}\n", "/**\n * @packageDocumentation\n *\n * This module exports various matchers that can be used to infer the type of a\n * passed multiaddr.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { DNS } from '@multiformats/multiaddr-matcher'\n *\n * const ma = multiaddr('/dnsaddr/example.org')\n *\n * DNS.matches(ma) // true - this is a multiaddr with a DNS address at the start\n * ```\n *\n * @example\n *\n * The default matching behaviour ignores any subsequent tuples in the multiaddr.\n * If you want stricter matching you can use `.exactMatch`:\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { DNS, Circuit } from '@multiformats/multiaddr-matcher'\n *\n * const ma = multiaddr('/dnsaddr/example.org/p2p/QmFoo/p2p-circuit/p2p/QmBar')\n *\n * DNS.exactMatch(ma) // false - this address has extra tuples after the DNS component\n * Circuit.matches(ma) // true\n * Circuit.exactMatch(ma) // true - the extra tuples are circuit relay related\n * ```\n */\n\nimport { CODE_P2P, CODE_DNS4, CODE_DNS6, CODE_DNSADDR, CODE_DNS, CODE_IP4, CODE_IP6, CODE_TCP, CODE_UDP, CODE_QUIC, CODE_QUIC_V1, CODE_WS, CODE_WSS, CODE_TLS, CODE_SNI, CODE_WEBRTC_DIRECT, CODE_CERTHASH, CODE_WEBTRANSPORT, CODE_P2P_CIRCUIT, CODE_WEBRTC, CODE_HTTP, CODE_UNIX, CODE_HTTPS, CODE_MEMORY, CODE_IP6ZONE, CODE_IPCIDR } from '@multiformats/multiaddr'\nimport { and, or, optional, fmt, code, value } from './utils.js'\nimport type { Multiaddr, Component } from '@multiformats/multiaddr'\n\n/**\n * A matcher accepts multiaddr components and either fails to match and returns\n * false or returns a sublist of unmatched components\n */\nexport interface Matcher {\n match(parts: Component[]): Component[] | false\n}\n\n/**\n * A MultiaddrMatcher allows interpreting a multiaddr as a certain type of\n * multiaddr\n */\nexport interface MultiaddrMatcher {\n /**\n * The matchers that make up this MultiaddrMatcher - useful if you want to\n * make your own custom matchers\n */\n matchers: Matcher[]\n\n /**\n * Returns true if the passed multiaddr can be treated as this type of\n * multiaddr\n */\n matches(ma?: Multiaddr): boolean\n\n /**\n * Returns true if the passed multiaddr terminates as this type of\n * multiaddr\n */\n exactMatch(ma?: Multiaddr): boolean\n}\n\n/**\n * Matches PeerId addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { PEER_ID } from '@multiformats/multiaddr-matcher'\n *\n * PEER_ID.matches(multiaddr('/p2p/Qmfoo')) // true\n * PEER_ID.matches(multiaddr('/ipfs/Qmfoo')) // true\n * ```\n */\nconst _PEER_ID = value(CODE_P2P)\n\nexport const PEER_ID = fmt(_PEER_ID)\n\n/**\n * DNS matchers\n */\nconst _DNS4 = value(CODE_DNS4)\nconst _DNS6 = value(CODE_DNS6)\nconst _DNSADDR = value(CODE_DNSADDR)\nconst _DNS = value(CODE_DNS)\n\n/**\n * Matches dns4 addresses.\n *\n * Use {@link DNS DNS} instead to match any type of DNS address.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { DNS4 } from '@multiformats/multiaddr-matcher'\n *\n * DNS4.matches(multiaddr('/dns4/example.org')) // true\n * ```\n */\nexport const DNS4 = fmt(_DNS4, optional(value(CODE_P2P)))\n\n/**\n * Matches dns6 addresses.\n *\n * Use {@link DNS DNS} instead to match any type of DNS address.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { DNS6 } from '@multiformats/multiaddr-matcher'\n *\n * DNS6.matches(multiaddr('/dns6/example.org')) // true\n * ```\n */\nexport const DNS6 = fmt(_DNS6, optional(value(CODE_P2P)))\n\n/**\n * Matches dnsaddr addresses.\n *\n * Use {@link DNS DNS} instead to match any type of DNS address.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { DNSADDR } from '@multiformats/multiaddr-matcher'\n *\n * DNSADDR.matches(multiaddr('/dnsaddr/example.org')) // true\n * DNSADDR.matches(multiaddr('/dnsaddr/example.org/p2p/Qmfoo')) // true\n * ```\n */\nexport const DNSADDR = fmt(_DNSADDR, optional(value(CODE_P2P)))\n\n/**\n * Matches any dns address.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { DNS } from '@multiformats/multiaddr-matcher'\n *\n * DNS.matches(multiaddr('/dnsaddr/example.org')) // true\n * DNS.matches(multiaddr('/dns4/example.org')) // true\n * DNS.matches(multiaddr('/dns6/example.org')) // true\n * DNS.matches(multiaddr('/dns6/example.org/p2p/Qmfoo')) // true\n * ```\n */\nexport const DNS = fmt(or(_DNS, _DNSADDR, _DNS4, _DNS6), optional(value(CODE_P2P)))\n\nconst _IP4 = and(\n value(CODE_IP4),\n optional(value(CODE_IPCIDR))\n)\nconst _IP6 = and(\n optional(value(CODE_IP6ZONE)),\n value(CODE_IP6),\n optional(value(CODE_IPCIDR))\n)\nconst _IP = or(_IP4, _IP6)\n\nconst _IP_OR_DOMAIN = or(_IP, _DNS, _DNS4, _DNS6, _DNSADDR)\n\n/**\n * A matcher for addresses that start with IP or DNS tuples.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { IP_OR_DOMAIN } from '@multiformats/multiaddr-matcher'\n *\n * IP_OR_DOMAIN.matches(multiaddr('/ip4/123.123.123.123')) // true\n * IP_OR_DOMAIN.matches(multiaddr('/ip4/123.123.123.123/p2p/QmFoo')) // true\n * IP_OR_DOMAIN.matches(multiaddr('/dns/example.com/p2p/QmFoo')) // true\n * IP_OR_DOMAIN.matches(multiaddr('/p2p/QmFoo')) // false\n * ```\n */\nexport const IP_OR_DOMAIN = fmt(or(_IP, and(or(_DNS, _DNSADDR, _DNS4, _DNS6), optional(value(CODE_P2P)))))\n\n/**\n * Matches ip4 addresses.\n *\n * Use {@link IP IP} instead to match any ip4/ip6 address.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { IP4 } from '@multiformats/multiaddr-matcher'\n *\n * const ma = multiaddr('/ip4/123.123.123.123')\n *\n * IP4.matches(ma) // true\n * ```\n */\nexport const IP4 = fmt(_IP4)\n\n/**\n * Matches ip6 addresses.\n *\n * Use {@link IP IP} instead to match any ip4/ip6 address.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { IP6 } from '@multiformats/multiaddr-matcher'\n *\n * const ma = multiaddr('/ip6/fe80::1cc1:a3b8:322f:cf22')\n *\n * IP6.matches(ma) // true\n * ```\n */\nexport const IP6 = fmt(_IP6)\n\n/**\n * Matches ip4 or ip6 addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { IP } from '@multiformats/multiaddr-matcher'\n *\n * IP.matches(multiaddr('/ip4/123.123.123.123')) // true\n * IP.matches(multiaddr('/ip6/fe80::1cc1:a3b8:322f:cf22')) // true\n * ```\n */\nexport const IP = fmt(_IP)\n\nconst _TCP = and(_IP_OR_DOMAIN, value(CODE_TCP))\nconst _UDP = and(_IP_OR_DOMAIN, value(CODE_UDP))\n\n/**\n * Matches TCP addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { TCP } from '@multiformats/multiaddr-matcher'\n *\n * TCP.matches(multiaddr('/ip4/123.123.123.123/tcp/1234')) // true\n * ```\n */\nexport const TCP = fmt(and(_TCP, optional(value(CODE_P2P))))\n\n/**\n * Matches UDP addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { UDP } from '@multiformats/multiaddr-matcher'\n *\n * UDP.matches(multiaddr('/ip4/123.123.123.123/udp/1234')) // true\n * ```\n */\nexport const UDP = fmt(_UDP)\n\nconst _QUIC = and(_UDP, code(CODE_QUIC), optional(value(CODE_P2P)))\nconst _QUIC_V1 = and(_UDP, code(CODE_QUIC_V1), optional(value(CODE_P2P)))\n\nconst QUIC_V0_OR_V1 = or(_QUIC, _QUIC_V1)\n\n/**\n * Matches QUIC addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { QUIC } from '@multiformats/multiaddr-matcher'\n *\n * QUIC.matches(multiaddr('/ip4/123.123.123.123/udp/1234/quic')) // true\n * ```\n */\nexport const QUIC = fmt(_QUIC)\n\n/**\n * Matches QUICv1 addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { QUIC_V1 } from '@multiformats/multiaddr-matcher'\n *\n * QUIC_V1.matches(multiaddr('/ip4/123.123.123.123/udp/1234/quic-v1')) // true\n * ```\n */\nexport const QUIC_V1 = fmt(_QUIC_V1)\n\nconst _WEB = or(\n _IP_OR_DOMAIN,\n _TCP,\n _UDP,\n _QUIC,\n _QUIC_V1\n)\n\nconst _WebSockets = or(\n and(_WEB, code(CODE_WS), optional(value(CODE_P2P)))\n)\n\n/**\n * Matches WebSocket addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { WebSockets } from '@multiformats/multiaddr-matcher'\n *\n * WebSockets.matches(multiaddr('/ip4/123.123.123.123/tcp/1234/ws')) // true\n * ```\n */\nexport const WebSockets = fmt(_WebSockets)\n\nconst _WebSocketsSecure = or(\n and(_WEB, code(CODE_WSS), optional(value(CODE_P2P))),\n and(_WEB, code(CODE_TLS), optional(value(CODE_SNI)), code(CODE_WS), optional(value(CODE_P2P)))\n)\n\n/**\n * Matches secure WebSocket addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { WebSocketsSecure } from '@multiformats/multiaddr-matcher'\n *\n * WebSocketsSecure.matches(multiaddr('/ip4/123.123.123.123/tcp/1234/wss')) // true\n * ```\n */\nexport const WebSocketsSecure = fmt(_WebSocketsSecure)\n\nconst _WebRTCDirect = and(_UDP, code(CODE_WEBRTC_DIRECT), optional(value(CODE_CERTHASH)), optional(value(CODE_CERTHASH)), optional(value(CODE_P2P)))\n\n/**\n * Matches WebRTC-direct addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { WebRTCDirect } from '@multiformats/multiaddr-matcher'\n *\n * WebRTCDirect.matches(multiaddr('/ip4/123.123.123.123/tcp/1234/p2p/QmFoo/webrtc-direct/certhash/u....')) // true\n * ```\n */\nexport const WebRTCDirect = fmt(_WebRTCDirect)\n\nconst _WebTransport = and(_QUIC_V1, code(CODE_WEBTRANSPORT), optional(value(CODE_CERTHASH)), optional(value(CODE_CERTHASH)), optional(value(CODE_P2P)))\n\n/**\n * Matches WebTransport addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { WebRTCDirect } from '@multiformats/multiaddr-matcher'\n *\n * WebRTCDirect.matches(multiaddr('/ip4/123.123.123.123/udp/1234/quic-v1/webtransport/certhash/u..../certhash/u..../p2p/QmFoo')) // true\n * ```\n */\nexport const WebTransport = fmt(_WebTransport)\n\nconst _P2P = or(\n _WebSockets,\n _WebSocketsSecure,\n and(_TCP, optional(value(CODE_P2P))),\n and(QUIC_V0_OR_V1, optional(value(CODE_P2P))),\n and(_IP_OR_DOMAIN, optional(value(CODE_P2P))),\n _WebRTCDirect,\n _WebTransport,\n value(CODE_P2P)\n)\n\n/**\n * Matches peer addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { P2P } from '@multiformats/multiaddr-matcher'\n *\n * P2P.matches(multiaddr('/ip4/123.123.123.123/tcp/1234/p2p/QmFoo')) // true\n * ```\n */\nexport const P2P = fmt(_P2P)\n\nconst _Circuit = and(_P2P, code(CODE_P2P_CIRCUIT), value(CODE_P2P))\n\n/**\n * Matches circuit relay addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { Circuit } from '@multiformats/multiaddr-matcher'\n *\n * Circuit.matches(multiaddr('/ip4/123.123.123.123/tcp/1234/p2p/QmRelay/p2p-circuit/p2p/QmTarget')) // true\n * ```\n */\nexport const Circuit = fmt(_Circuit)\n\nconst _WebRTC = or(\n and(_P2P, code(CODE_P2P_CIRCUIT), code(CODE_WEBRTC), optional(value(CODE_P2P))),\n and(_P2P, code(CODE_WEBRTC), optional(value(CODE_P2P))),\n and(code(CODE_WEBRTC), optional(value(CODE_P2P)))\n)\n\n/**\n * Matches WebRTC addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { WebRTC } from '@multiformats/multiaddr-matcher'\n *\n * WebRTC.matches(multiaddr('/ip4/123.123.123.123/tcp/1234/p2p/QmRelay/p2p-circuit/webrtc/p2p/QmTarget')) // true\n * ```\n */\nexport const WebRTC = fmt(_WebRTC)\n\nconst _HTTP = or(\n and(_IP_OR_DOMAIN, value(CODE_TCP), code(CODE_HTTP), optional(value(CODE_P2P))),\n and(_IP_OR_DOMAIN, code(CODE_HTTP), optional(value(CODE_P2P)))\n)\n\n/**\n * Matches HTTP addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { HTTP } from '@multiformats/multiaddr-matcher'\n *\n * HTTP.matches(multiaddr('/dns/example.org/http')) // true\n * ```\n */\nexport const HTTP = fmt(_HTTP)\n\nconst _HTTPS = and(_IP_OR_DOMAIN, or(\n and(value(CODE_TCP, '443'), code(CODE_HTTP)),\n and(value(CODE_TCP), code(CODE_HTTPS)),\n and(value(CODE_TCP), code(CODE_TLS), code(CODE_HTTP)),\n and(code(CODE_TLS), code(CODE_HTTP)),\n code(CODE_TLS),\n code(CODE_HTTPS)\n),\noptional(value(CODE_P2P))\n)\n\n/**\n * Matches HTTPS addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { HTTP } from '@multiformats/multiaddr-matcher'\n *\n * HTTP.matches(multiaddr('/dns/example.org/tls/http')) // true\n * ```\n */\nexport const HTTPS = fmt(_HTTPS)\n\nconst _Memory = or(\n and(value(CODE_MEMORY), optional(value(CODE_P2P)))\n)\n\n/**\n * Matches Memory addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { Memory } from '@multiformats/multiaddr-matcher'\n *\n * Memory.matches(multiaddr('/memory/0xDEADBEEF')) // true\n * ```\n */\nexport const Memory = fmt(_Memory)\n\nconst _Unix = or(\n and(value(CODE_UNIX), optional(value(CODE_P2P)))\n)\n\n/**\n * Matches Unix addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { Unix } from '@multiformats/multiaddr-matcher'\n *\n * Unix.matches(multiaddr('/unix/%2Fpath%2Fto%2Funix.socket')) // true\n * ```\n */\nexport const Unix = fmt(_Unix)\n", "/**\n * Progress events are emitted during long running operations\n */\nexport interface ProgressEvent<T extends string = any, D = unknown> {\n /**\n * The event type\n */\n type: T\n\n /**\n * Context-specific event information\n */\n detail: D\n}\n\n/**\n * An implementation of the ProgressEvent interface, this is essentially\n * a typed `CustomEvent` with a `type` property that lets us disambiguate\n * events passed to `progress` callbacks.\n */\nexport class CustomProgressEvent<D = unknown, T extends string = any> extends Event implements ProgressEvent<T, D> {\n public type: T\n public detail: D\n\n constructor (type: T, detail?: D) {\n super(type)\n\n this.type = type\n // @ts-expect-error detail may be undefined\n this.detail = detail\n }\n}\n\n/**\n * Define an `onProgress` callback that can be invoked with `ProgressEvent`s\n *\n * @example\n *\n * ```typescript\n * type MyOperationProgressEvents =\n * ProgressEvent<'operation:start'> |\n * ProgressEvent<'operation:success', Result> |\n * ProgressEvent<'operation:error', Error>\n *\n * export interface MyOperationOptions extends ProgressOptions<MyOperationProgressEvents> {\n * // define options here\n * }\n * ```\n */\nexport interface ProgressOptions<Event extends ProgressEvent = any> {\n onProgress?: (evt: Event) => void\n}\n", "import net from 'net'\nimport { AlreadyStartedError, InvalidParametersError, NotStartedError } from '@libp2p/interface'\nimport { getThinWaistAddresses } from '@libp2p/utils/get-thin-waist-addresses'\nimport { multiaddr } from '@multiformats/multiaddr'\nimport { TypedEventEmitter, setMaxListeners } from 'main-event'\nimport { pEvent } from 'p-event'\nimport { toMultiaddrConnection } from './socket-to-conn.js'\nimport { multiaddrToNetConfig } from './utils.js'\nimport type { CloseServerOnMaxConnectionsOpts, TCPCreateListenerOptions } from './index.js'\nimport type { NetConfig } from './utils.js'\nimport type { ComponentLogger, Logger, MultiaddrConnection, CounterGroup, MetricGroup, Metrics, Listener, ListenerEvents, Upgrader } from '@libp2p/interface'\nimport type { Multiaddr } from '@multiformats/multiaddr'\n\ninterface Context extends TCPCreateListenerOptions {\n upgrader: Upgrader\n socketInactivityTimeout?: number\n socketCloseTimeout?: number\n maxConnections?: number\n backlog?: number\n metrics?: Metrics\n closeServerOnMaxConnections?: CloseServerOnMaxConnectionsOpts\n logger: ComponentLogger\n}\n\ninterface TCPListenerMetrics {\n status?: MetricGroup\n errors?: CounterGroup\n events?: CounterGroup\n}\n\nenum TCPListenerStatusCode {\n /**\n * When server object is initialized but we don't know the listening address\n * yet or the server object is stopped manually, can be resumed only by\n * calling listen()\n */\n INACTIVE = 0,\n ACTIVE = 1,\n /* During the connection limits */\n PAUSED = 2\n}\n\ntype Status = { code: TCPListenerStatusCode.INACTIVE } | {\n code: Exclude<TCPListenerStatusCode, TCPListenerStatusCode.INACTIVE>\n listeningAddr: Multiaddr\n netConfig: NetConfig\n}\n\nexport class TCPListener extends TypedEventEmitter<ListenerEvents> implements Listener {\n private readonly server: net.Server\n /** Keep track of open sockets to destroy in case of timeout */\n private readonly sockets = new Set<net.Socket>()\n private status: Status = { code: TCPListenerStatusCode.INACTIVE }\n private metrics: TCPListenerMetrics\n private addr: string\n private readonly log: Logger\n private readonly shutdownController: AbortController\n\n constructor (private readonly context: Context) {\n super()\n\n context.keepAlive = context.keepAlive ?? true\n context.noDelay = context.noDelay ?? true\n\n this.shutdownController = new AbortController()\n setMaxListeners(Infinity, this.shutdownController.signal)\n\n this.log = context.logger.forComponent('libp2p:tcp:listener')\n this.addr = 'unknown'\n this.server = net.createServer(context, this.onSocket.bind(this))\n\n // https://nodejs.org/api/net.html#servermaxconnections\n // If set reject connections when the server's connection count gets high\n // Useful to prevent too resource exhaustion via many open connections on\n // high bursts of activity\n if (context.maxConnections !== undefined) {\n this.server.maxConnections = context.maxConnections\n }\n\n if (context.closeServerOnMaxConnections != null) {\n // Sanity check options\n if (context.closeServerOnMaxConnections.closeAbove < context.closeServerOnMaxConnections.listenBelow) {\n throw new InvalidParametersError('closeAbove must be >= listenBelow')\n }\n }\n\n context.metrics?.registerMetricGroup('libp2p_tcp_inbound_connections_total', {\n label: 'address',\n help: 'Current active connections in TCP listener',\n calculate: () => {\n return {\n [this.addr]: this.sockets.size\n }\n }\n })\n\n this.metrics = {\n status: context.metrics?.registerMetricGroup('libp2p_tcp_listener_status_info', {\n label: 'address',\n help: 'Current status of the TCP listener socket'\n }),\n errors: context.metrics?.registerMetricGroup('libp2p_tcp_listener_errors_total', {\n label: 'address',\n help: 'Total count of TCP listener errors by type'\n }),\n events: context.metrics?.registerMetricGroup('libp2p_tcp_listener_events_total', {\n label: 'address',\n help: 'Total count of TCP listener events by type'\n })\n }\n\n this.server\n .on('listening', () => {\n // we are listening, register metrics for our port\n const address = this.server.address()\n\n if (address == null) {\n this.addr = 'unknown'\n } else if (typeof address === 'string') {\n // unix socket\n this.addr = address\n } else {\n this.addr = `${address.address}:${address.port}`\n }\n\n this.metrics.status?.update({\n [this.addr]: TCPListenerStatusCode.ACTIVE\n })\n\n this.safeDispatchEvent('listening')\n })\n .on('error', err => {\n this.metrics.errors?.increment({ [`${this.addr} listen_error`]: true })\n this.safeDispatchEvent('error', { detail: err })\n })\n .on('close', () => {\n this.metrics.status?.update({\n [this.addr]: this.status.code\n })\n\n // If this event is emitted, the transport manager will remove the\n // listener from it's cache in the meanwhile if the connections are\n // dropped then listener will start listening again and the transport\n // manager will not be able to close the server\n if (this.status.code !== TCPListenerStatusCode.PAUSED) {\n this.safeDispatchEvent('close')\n }\n })\n .on('drop', () => {\n this.metrics.events?.increment({ [`${this.addr} drop`]: true })\n })\n }\n\n private onSocket (socket: net.Socket): void {\n this.metrics.events?.increment({ [`${this.addr} connection`]: true })\n\n if (this.status.code !== TCPListenerStatusCode.ACTIVE) {\n socket.destroy()\n throw new NotStartedError('Server is not listening yet')\n }\n\n let maConn: MultiaddrConnection\n try {\n maConn = toMultiaddrConnection(socket, {\n listeningAddr: this.status.listeningAddr,\n socketInactivityTimeout: this.context.socketInactivityTimeout,\n socketCloseTimeout: this.context.socketCloseTimeout,\n metrics: this.metrics?.events,\n metricPrefix: `${this.addr} `,\n logger: this.context.logger,\n direction: 'inbound'\n })\n } catch (err: any) {\n this.log.error('inbound connection failed', err)\n this.metrics.errors?.increment({ [`${this.addr} inbound_to_connection`]: true })\n socket.destroy()\n return\n }\n\n this.log('new inbound connection %s', maConn.remoteAddr)\n this.sockets.add(socket)\n\n this.context.upgrader.upgradeInbound(maConn, {\n signal: this.shutdownController.signal\n })\n .then(() => {\n this.log('inbound connection upgraded %s', maConn.remoteAddr)\n\n socket.once('close', () => {\n this.sockets.delete(socket)\n\n if (\n this.context.closeServerOnMaxConnections != null &&\n this.sockets.size < this.context.closeServerOnMaxConnections.listenBelow\n ) {\n // The most likely case of error is if the port taken by this\n // application is bound by another process during the time the\n // server if closed. In that case there's not much we can do.\n // resume() will be called again every time a connection is\n // dropped, which acts as an eventual retry mechanism.\n // onListenError allows the consumer act on this.\n this.resume().catch(e => {\n this.log.error('error attempting to listen server once connection count under limit', e)\n this.context.closeServerOnMaxConnections?.onListenError?.(e as Error)\n })\n }\n })\n\n if (\n this.context.closeServerOnMaxConnections != null &&\n this.sockets.size >= this.context.closeServerOnMaxConnections.closeAbove\n ) {\n this.pause()\n }\n })\n .catch(async err => {\n this.log.error('inbound connection upgrade failed', err)\n this.metrics.errors?.increment({ [`${this.addr} inbound_upgrade`]: true })\n this.sockets.delete(socket)\n maConn.abort(err)\n })\n }\n\n getAddrs (): Multiaddr[] {\n if (this.status.code === TCPListenerStatusCode.INACTIVE) {\n return []\n }\n\n const address = this.server.address()\n\n if (address == null) {\n return []\n }\n\n if (typeof address === 'string') {\n return [\n multiaddr(`/unix/${encodeURIComponent(address)}`)\n ]\n }\n\n return getThinWaistAddresses(this.status.listeningAddr, address.port)\n }\n\n updateAnnounceAddrs (): void {\n\n }\n\n async listen (ma: Multiaddr): Promise<void> {\n if (this.status.code === TCPListenerStatusCode.ACTIVE || this.status.code === TCPListenerStatusCode.PAUSED) {\n throw new AlreadyStartedError('server is already listening')\n }\n\n try {\n this.status = {\n code: TCPListenerStatusCode.ACTIVE,\n listeningAddr: ma,\n netConfig: multiaddrToNetConfig(ma, this.context)\n }\n\n await this.resume()\n } catch (err) {\n this.status = { code: TCPListenerStatusCode.INACTIVE }\n throw err\n }\n }\n\n async close (): Promise<void> {\n const events: Array<Promise<void>> = []\n\n if (this.server.listening) {\n events.push(pEvent(this.server, 'close'))\n }\n\n // shut down the server socket, permanently\n this.pause(true)\n\n // stop any in-progress connection upgrades\n this.shutdownController.abort()\n\n // synchronously close any open connections - should be done after closing\n // the server socket in case new sockets are opened during the shutdown\n this.sockets.forEach(socket => {\n if (socket.readable) {\n events.push(pEvent(socket, 'close'))\n socket.destroy()\n }\n })\n\n await Promise.all(events)\n }\n\n /**\n * Can resume a stopped or start an inert server\n */\n private async resume (): Promise<void> {\n if (this.server.listening || this.status.code === TCPListenerStatusCode.INACTIVE) {\n return\n }\n\n const netConfig = this.status.netConfig\n\n await new Promise<void>((resolve, reject) => {\n // NOTE: 'listening' event is only fired on success. Any error such as\n // port already bound, is emitted via 'error'\n this.server.once('error', reject)\n this.server.listen(netConfig, resolve)\n })\n\n this.status = { ...this.status, code: TCPListenerStatusCode.ACTIVE }\n this.log('listening on %s', this.server.address())\n }\n\n private pause (permanent: boolean = false): void {\n if (!this.server.listening && this.status.code === TCPListenerStatusCode.PAUSED && permanent) {\n this.status = { code: TCPListenerStatusCode.INACTIVE }\n return\n }\n\n if (!this.server.listening || this.status.code !== TCPListenerStatusCode.ACTIVE) {\n return\n }\n\n this.log('closing server on %s', this.server.address())\n\n // NodeJS implementation tracks listening status with `this._handle` property.\n // - Server.close() sets this._handle to null immediately. If this._handle is null, NotStartedError is thrown\n // - Server.listening returns `this._handle !== null` https://github.com/nodejs/node/blob/386d761943bb1b217fba27d6b80b658c23009e60/lib/net.js#L1675\n // - Server.listen() if `this._handle !== null` throws AlreadyStartedError\n //\n // NOTE: Both listen and close are technically not async actions, so it's not necessary to track\n // states 'pending-close' or 'pending-listen'\n\n // From docs https://nodejs.org/api/net.html#serverclosecallback\n // Stops the server from accepting new connections and keeps existing connections.\n // 'close' event is emitted only emitted when all connections are ended.\n // The optional callback will be called once the 'close' event occurs.\n\n // We need to set this status before closing server, so other procedures are aware\n // during the time the server is closing\n this.status = permanent ? { code: TCPListenerStatusCode.INACTIVE } : { ...this.status, code: TCPListenerStatusCode.PAUSED }\n\n // stop accepting incoming connections - existing connections are maintained\n // - any callback passed here would be invoked after existing connections\n // close, we want to maintain them so no callback is passed otherwise his\n // method will never return\n this.server.close()\n }\n}\n", "import os from 'node:os'\nimport { multiaddr } from '@multiformats/multiaddr'\nimport { isLinkLocalIp } from './link-local-ip.js'\nimport type { Multiaddr } from '@multiformats/multiaddr'\n\nconst FAMILIES = { 4: 'IPv4', 6: 'IPv6' }\n\nfunction isWildcard (ip: string): boolean {\n return ['0.0.0.0', '::'].includes(ip)\n}\n\nfunction getNetworkAddrs (family: 4 | 6): string[] {\n const addresses: string[] = []\n const networks = os.networkInterfaces()\n\n for (const [, netAddrs] of Object.entries(networks)) {\n if (netAddrs != null) {\n for (const netAddr of netAddrs) {\n if (isLinkLocalIp(netAddr.address)) {\n continue\n }\n\n if (netAddr.family === FAMILIES[family]) {\n addresses.push(netAddr.address)\n }\n }\n }\n }\n\n return addresses\n}\n\n/**\n * Get all thin waist addresses on the current host that match the family of the\n * passed multiaddr and optionally override the port.\n *\n * Wildcard IP4/6 addresses will be expanded into all available interfaces.\n */\nexport function getThinWaistAddresses (ma?: Multiaddr, port?: number): Multiaddr[] {\n if (ma == null) {\n return []\n }\n\n const options = ma.toOptions()\n\n if (isWildcard(options.host)) {\n const addrs = []\n\n for (const host of getNetworkAddrs(options.family)) {\n addrs.push(multiaddr(`/ip${options.family}/${host}/${options.transport}/${port ?? options.port}`))\n }\n\n return addrs\n }\n\n return [\n multiaddr(`/ip${options.family}/${options.host}/${options.transport}/${port ?? options.port}`)\n ]\n}\n", "export function isLinkLocalIp (ip: string): boolean {\n if (ip.startsWith('169.254.')) {\n return true\n }\n\n if (ip.toLowerCase().startsWith('fe80')) {\n return true\n }\n\n return false\n}\n", "export class TimeoutError extends Error {\n\tconstructor(message) {\n\t\tsuper(message);\n\t\tthis.name = 'TimeoutError';\n\t}\n}\n\n/**\nAn error to be thrown when the request is aborted by AbortController.\nDOMException is thrown instead of this Error when DOMException is available.\n*/\nexport class AbortError extends Error {\n\tconstructor(message) {\n\t\tsuper();\n\t\tthis.name = 'AbortError';\n\t\tthis.message = message;\n\t}\n}\n\n/**\nTODO: Remove AbortError and just throw DOMException when targeting Node 18.\n*/\nconst getDOMException = errorMessage => globalThis.DOMException === undefined\n\t? new AbortError(errorMessage)\n\t: new DOMException(errorMessage);\n\n/**\nTODO: Remove below function and just 'reject(signal.reason)' when targeting Node 18.\n*/\nconst getAbortedReason = signal => {\n\tconst reason = signal.reason === undefined\n\t\t? getDOMException('This operation was aborted.')\n\t\t: signal.reason;\n\n\treturn reason instanceof Error ? reason : getDOMException(reason);\n};\n\nexport default function pTimeout(promise, options) {\n\tconst {\n\t\tmilliseconds,\n\t\tfallback,\n\t\tmessage,\n\t\tcustomTimers = {setTimeout, clearTimeout},\n\t} = options;\n\n\tlet timer;\n\tlet abortHandler;\n\n\tconst wrappedPromise = new Promise((resolve, reject) => {\n\t\tif (typeof milliseconds !== 'number' || Math.sign(milliseconds) !== 1) {\n\t\t\tthrow new TypeError(`Expected \\`milliseconds\\` to be a positive number, got \\`${milliseconds}\\``);\n\t\t}\n\n\t\tif (options.signal) {\n\t\t\tconst {signal} = options;\n\t\t\tif (signal.aborted) {\n\t\t\t\treject(getAbortedReason(signal));\n\t\t\t}\n\n\t\t\tabortHandler = () => {\n\t\t\t\treject(getAbortedReason(signal));\n\t\t\t};\n\n\t\t\tsignal.addEventListener('abort', abortHandler, {once: true});\n\t\t}\n\n\t\tif (milliseconds === Number.POSITIVE_INFINITY) {\n\t\t\tpromise.then(resolve, reject);\n\t\t\treturn;\n\t\t}\n\n\t\t// We create the error outside of `setTimeout` to preserve the stack trace.\n\t\tconst timeoutError = new TimeoutError();\n\n\t\ttimer = customTimers.setTimeout.call(undefined, () => {\n\t\t\tif (fallback) {\n\t\t\t\ttry {\n\t\t\t\t\tresolve(fallback());\n\t\t\t\t} catch (error) {\n\t\t\t\t\treject(error);\n\t\t\t\t}\n\n\t\t\t\treturn;\n\t\t\t}\n\n\t\t\tif (typeof promise.cancel === 'function') {\n\t\t\t\tpromise.cancel();\n\t\t\t}\n\n\t\t\tif (message === false) {\n\t\t\t\tresolve();\n\t\t\t} else if (message instanceof Error) {\n\t\t\t\treject(message);\n\t\t\t} else {\n\t\t\t\ttimeoutError.message = message ?? `Promise timed out after ${milliseconds} milliseconds`;\n\t\t\t\treject(timeoutError);\n\t\t\t}\n\t\t}, milliseconds);\n\n\t\t(async () => {\n\t\t\ttry {\n\t\t\t\tresolve(await promise);\n\t\t\t} catch (error) {\n\t\t\t\treject(error);\n\t\t\t}\n\t\t})();\n\t});\n\n\tconst cancelablePromise = wrappedPromise.finally(() => {\n\t\tcancelablePromise.clear();\n\t\tif (abortHandler && options.signal) {\n\t\t\toptions.signal.removeEventListener('abort', abortHandler);\n\t\t}\n\t});\n\n\tcancelablePromise.clear = () => {\n\t\tcustomTimers.clearTimeout.call(undefined, timer);\n\t\ttimer = undefined;\n\t};\n\n\treturn cancelablePromise;\n}\n", "import pTimeout from 'p-timeout';\n\nconst normalizeEmitter = emitter => {\n\tconst addListener = emitter.addEventListener || emitter.on || emitter.addListener;\n\tconst removeListener = emitter.removeEventListener || emitter.off || emitter.removeListener;\n\n\tif (!addListener || !removeListener) {\n\t\tthrow new TypeError('Emitter is not compatible');\n\t}\n\n\treturn {\n\t\taddListener: addListener.bind(emitter),\n\t\tremoveListener: removeListener.bind(emitter),\n\t};\n};\n\nexport function pEventMultiple(emitter, event, options) {\n\tlet cancel;\n\tconst returnValue = new Promise((resolve, reject) => {\n\t\toptions = {\n\t\t\trejectionEvents: ['error'],\n\t\t\tmultiArgs: false,\n\t\t\tresolveImmediately: false,\n\t\t\t...options,\n\t\t};\n\n\t\tif (!(options.count >= 0 && (options.count === Number.POSITIVE_INFINITY || Number.isInteger(options.count)))) {\n\t\t\tthrow new TypeError('The `count` option should be at least 0 or more');\n\t\t}\n\n\t\toptions.signal?.throwIfAborted();\n\n\t\t// Allow multiple events\n\t\tconst events = [event].flat();\n\n\t\tconst items = [];\n\t\tconst {addListener, removeListener} = normalizeEmitter(emitter);\n\n\t\tconst onItem = (...arguments_) => {\n\t\t\tconst value = options.multiArgs ? arguments_ : arguments_[0];\n\n\t\t\t// eslint-disable-next-line unicorn/no-array-callback-reference\n\t\t\tif (options.filter && !options.filter(value)) {\n\t\t\t\treturn;\n\t\t\t}\n\n\t\t\titems.push(value);\n\n\t\t\tif (options.count === items.length) {\n\t\t\t\tcancel();\n\t\t\t\tresolve(items);\n\t\t\t}\n\t\t};\n\n\t\tconst rejectHandler = error => {\n\t\t\tcancel();\n\t\t\treject(error);\n\t\t};\n\n\t\tcancel = () => {\n\t\t\tfor (const event of events) {\n\t\t\t\tremoveListener(event, onItem);\n\t\t\t}\n\n\t\t\tfor (const rejectionEvent of options.rejectionEvents) {\n\t\t\t\tremoveListener(rejectionEvent, rejectHandler);\n\t\t\t}\n\t\t};\n\n\t\tfor (const event of events) {\n\t\t\taddListener(event, onItem);\n\t\t}\n\n\t\tfor (const rejectionEvent of options.rejectionEvents) {\n\t\t\taddListener(rejectionEvent, rejectHandler);\n\t\t}\n\n\t\tif (options.signal) {\n\t\t\toptions.signal.addEventListener('abort', () => {\n\t\t\t\trejectHandler(options.signal.reason);\n\t\t\t}, {once: true});\n\t\t}\n\n\t\tif (options.resolveImmediately) {\n\t\t\tresolve(items);\n\t\t}\n\t});\n\n\treturnValue.cancel = cancel;\n\n\tif (typeof options.timeout === 'number') {\n\t\tconst timeout = pTimeout(returnValue, {milliseconds: options.timeout});\n\t\ttimeout.cancel = cancel;\n\t\treturn timeout;\n\t}\n\n\treturn returnValue;\n}\n\nexport function pEvent(emitter, event, options) {\n\tif (typeof options === 'function') {\n\t\toptions = {filter: options};\n\t}\n\n\toptions = {\n\t\t...options,\n\t\tcount: 1,\n\t\tresolveImmediately: false,\n\t};\n\n\tconst arrayPromise = pEventMultiple(emitter, event, options);\n\tconst promise = arrayPromise.then(array => array[0]);\n\tpromise.cancel = arrayPromise.cancel;\n\n\treturn promise;\n}\n\nexport function pEventIterator(emitter, event, options) {\n\tif (typeof options === 'function') {\n\t\toptions = {filter: options};\n\t}\n\n\t// Allow multiple events\n\tconst events = [event].flat();\n\n\toptions = {\n\t\trejectionEvents: ['error'],\n\t\tresolutionEvents: [],\n\t\tlimit: Number.POSITIVE_INFINITY,\n\t\tmultiArgs: false,\n\t\t...options,\n\t};\n\n\tconst {limit} = options;\n\tconst isValidLimit = limit >= 0 && (limit === Number.POSITIVE_INFINITY || Number.isInteger(limit));\n\tif (!isValidLimit) {\n\t\tthrow new TypeError('The `limit` option should be a non-negative integer or Infinity');\n\t}\n\n\toptions.signal?.throwIfAborted();\n\n\tif (limit === 0) {\n\t\t// Return an empty async iterator to avoid any further cost\n\t\treturn {\n\t\t\t[Symbol.asyncIterator]() {\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\tasync next() {\n\t\t\t\treturn {\n\t\t\t\t\tdone: true,\n\t\t\t\t\tvalue: undefined,\n\t\t\t\t};\n\t\t\t},\n\t\t};\n\t}\n\n\tconst {addListener, removeListener} = normalizeEmitter(emitter);\n\n\tlet isDone = false;\n\tlet error;\n\tlet hasPendingError = false;\n\tconst nextQueue = [];\n\tconst valueQueue = [];\n\tlet eventCount = 0;\n\tlet isLimitReached = false;\n\n\tconst valueHandler = (...arguments_) => {\n\t\teventCount++;\n\t\tisLimitReached = eventCount === limit;\n\n\t\tconst value = options.multiArgs ? arguments_ : arguments_[0];\n\n\t\tif (nextQueue.length > 0) {\n\t\t\tconst {resolve} = nextQueue.shift();\n\n\t\t\tresolve({done: false, value});\n\n\t\t\tif (isLimitReached) {\n\t\t\t\tcancel();\n\t\t\t}\n\n\t\t\treturn;\n\t\t}\n\n\t\tvalueQueue.push(value);\n\n\t\tif (isLimitReached) {\n\t\t\tcancel();\n\t\t}\n\t};\n\n\tconst cancel = () => {\n\t\tisDone = true;\n\n\t\tfor (const event of events) {\n\t\t\tremoveListener(event, valueHandler);\n\t\t}\n\n\t\tfor (const rejectionEvent of options.rejectionEvents) {\n\t\t\tremoveListener(rejectionEvent, rejectHandler);\n\t\t}\n\n\t\tfor (const resolutionEvent of options.resolutionEvents) {\n\t\t\tremoveListener(resolutionEvent, resolveHandler);\n\t\t}\n\n\t\twhile (nextQueue.length > 0) {\n\t\t\tconst {resolve} = nextQueue.shift();\n\t\t\tresolve({done: true, value: undefined});\n\t\t}\n\t};\n\n\tconst rejectHandler = (...arguments_) => {\n\t\terror = options.multiArgs ? arguments_ : arguments_[0];\n\n\t\tif (nextQueue.length > 0) {\n\t\t\tconst {reject} = nextQueue.shift();\n\t\t\treject(error);\n\t\t} else {\n\t\t\thasPendingError = true;\n\t\t}\n\n\t\tcancel();\n\t};\n\n\tconst resolveHandler = (...arguments_) => {\n\t\tconst value = options.multiArgs ? arguments_ : arguments_[0];\n\n\t\t// eslint-disable-next-line unicorn/no-array-callback-reference\n\t\tif (options.filter && !options.filter(value)) {\n\t\t\tcancel();\n\t\t\treturn;\n\t\t}\n\n\t\tif (nextQueue.length > 0) {\n\t\t\tconst {resolve} = nextQueue.shift();\n\t\t\tresolve({done: true, value});\n\t\t} else {\n\t\t\tvalueQueue.push(value);\n\t\t}\n\n\t\tcancel();\n\t};\n\n\tfor (const event of events) {\n\t\taddListener(event, valueHandler);\n\t}\n\n\tfor (const rejectionEvent of options.rejectionEvents) {\n\t\taddListener(rejectionEvent, rejectHandler);\n\t}\n\n\tfor (const resolutionEvent of options.resolutionEvents) {\n\t\taddListener(resolutionEvent, resolveHandler);\n\t}\n\n\tif (options.signal) {\n\t\toptions.signal.addEventListener('abort', () => {\n\t\t\trejectHandler(options.signal.reason);\n\t\t}, {once: true});\n\t}\n\n\treturn {\n\t\t[Symbol.asyncIterator]() {\n\t\t\treturn this;\n\t\t},\n\t\tasync next() {\n\t\t\tif (valueQueue.length > 0) {\n\t\t\t\tconst value = valueQueue.shift();\n\t\t\t\treturn {\n\t\t\t\t\tdone: isDone && valueQueue.length === 0 && !isLimitReached,\n\t\t\t\t\tvalue,\n\t\t\t\t};\n\t\t\t}\n\n\t\t\tif (hasPendingError) {\n\t\t\t\thasPendingError = false;\n\t\t\t\tthrow error;\n\t\t\t}\n\n\t\t\tif (isDone) {\n\t\t\t\treturn {\n\t\t\t\t\tdone: true,\n\t\t\t\t\tvalue: undefined,\n\t\t\t\t};\n\t\t\t}\n\n\t\t\treturn new Promise((resolve, reject) => {\n\t\t\t\tnextQueue.push({resolve, reject});\n\t\t\t});\n\t\t},\n\t\tasync return(value) {\n\t\t\tcancel();\n\t\t\treturn {\n\t\t\t\tdone: isDone,\n\t\t\t\tvalue,\n\t\t\t};\n\t\t},\n\t};\n}\n\nexport {TimeoutError} from 'p-timeout';\n", "import { isIPv4, isIPv6 } from '@chainsafe/is-ip'\nimport { InvalidParametersError } from '@libp2p/interface'\nimport { multiaddr } from '@multiformats/multiaddr'\nimport type { Multiaddr } from '@multiformats/multiaddr'\n\n/**\n * Transform an IP, Port pair into a multiaddr\n */\nexport function ipPortToMultiaddr (ip: string, port: number | string): Multiaddr {\n if (typeof ip !== 'string') {\n throw new InvalidParametersError(`invalid ip provided: ${ip}`)\n }\n\n if (typeof port === 'string') {\n port = parseInt(port)\n }\n\n if (isNaN(port)) {\n throw new InvalidParametersError(`invalid port provided: ${port}`)\n }\n\n if (isIPv4(ip)) {\n return multiaddr(`/ip4/${ip}/tcp/${port}`)\n }\n\n if (isIPv6(ip)) {\n return multiaddr(`/ip6/${ip}/tcp/${port}`)\n }\n\n throw new InvalidParametersError(`invalid ip:port for creating a multiaddr: ${ip}:${port}`)\n}\n", "/**\n * @packageDocumentation\n *\n * A simple error class and options interface that seems to get copied from\n * project to project.\n *\n * @example Using `AbortError`\n *\n * ```JavaScript\n * import { AbortError } from 'abort-error'\n *\n * // a promise that will be settled later\n * const deferred = Promise.withResolvers()\n *\n * const signal = AbortSignal.timeout(1000)\n * signal.addEventListener('abort', () => {\n * deferred.reject(new AbortError())\n * })\n * ```\n *\n * @example Using `AbortOptions`\n *\n * ```TypeScript\n * import type { AbortOptions } from 'abort-error'\n *\n * async function myFunction (options?: AbortOptions) {\n * return fetch('https://example.com', {\n * signal: options?.signal\n * })\n * }\n * ```\n */\n\nexport interface AbortOptions {\n signal?: AbortSignal\n}\n\nexport class AbortError extends Error {\n static name = 'AbortError'\n name = 'AbortError'\n\n constructor (message: string = 'The operation was aborted', ...rest: any[]) {\n super(message, ...rest)\n }\n}\n", "/**\n * @packageDocumentation\n *\n * Race an event against an AbortSignal, taking care to remove any event\n * listeners that were added.\n *\n * @example Getting started\n *\n * ```TypeScript\n * import { raceEvent } from 'race-event'\n *\n * const controller = new AbortController()\n * const emitter = new EventTarget()\n *\n * setTimeout(() => {\n * controller.abort()\n * }, 500)\n *\n * setTimeout(() => {\n * // too late\n * emitter.dispatchEvent(new CustomEvent('event'))\n * }, 1000)\n *\n * // throws an AbortError\n * const resolve = await raceEvent(emitter, 'event', controller.signal)\n * ```\n *\n * @example Aborting the promise with an error event\n *\n * ```TypeScript\n * import { raceEvent } from 'race-event'\n *\n * const emitter = new EventTarget()\n *\n * setTimeout(() => {\n * emitter.dispatchEvent(new CustomEvent('failure', {\n * detail: new Error('Oh no!')\n * }))\n * }, 1000)\n *\n * // throws 'Oh no!' error\n * const resolve = await raceEvent(emitter, 'success', AbortSignal.timeout(5000), {\n * errorEvent: 'failure'\n * })\n * ```\n *\n * @example Customising the thrown AbortError\n *\n * The error message and `.code` property of the thrown `AbortError` can be\n * specified by passing options:\n *\n * ```TypeScript\n * import { raceEvent } from 'race-event'\n *\n * const controller = new AbortController()\n * const emitter = new EventTarget()\n *\n * setTimeout(() => {\n * controller.abort()\n * }, 500)\n *\n * // throws a Error: Oh no!\n * const resolve = await raceEvent(emitter, 'event', controller.signal, {\n * errorMessage: 'Oh no!',\n * errorCode: 'ERR_OH_NO'\n * })\n * ```\n *\n * @example Only resolving on specific events\n *\n * Where multiple events with the same type are emitted, a `filter` function can\n * be passed to only resolve on one of them:\n *\n * ```TypeScript\n * import { raceEvent } from 'race-event'\n *\n * const controller = new AbortController()\n * const emitter = new EventTarget()\n *\n * // throws a Error: Oh no!\n * const resolve = await raceEvent(emitter, 'event', controller.signal, {\n * filter: (evt: Event) => {\n * return evt.detail.foo === 'bar'\n * }\n * })\n * ```\n *\n * @example Terminating early by throwing from the filter\n *\n * You can cause listening for the event to cease and all event listeners to be\n * removed by throwing from the filter:\n *\n * ```TypeScript\n * import { raceEvent } from 'race-event'\n *\n * const controller = new AbortController()\n * const emitter = new EventTarget()\n *\n * // throws Error: Cannot continue\n * const resolve = await raceEvent(emitter, 'event', controller.signal, {\n * filter: (evt) => {\n * if (...reasons) {\n * throw new Error('Cannot continue')\n * }\n *\n * return true\n * }\n * })\n * ```\n */\n\nimport { AbortError } from 'abort-error'\nimport type { EventEmitter } from 'node:events'\n\nexport interface RaceEventOptions<T> {\n /**\n * The message for the error thrown if the signal aborts\n */\n errorMessage?: string\n\n /**\n * The code for the error thrown if the signal aborts\n */\n errorCode?: string\n\n /**\n * The name of an event emitted on the emitter that should cause the returned\n * promise to reject. The rejection reason will be the `.detail` field of the\n * event.\n *\n * @default \"error\"\n */\n errorEvent?: string\n\n /**\n * If the 'errorEvent' option has been passed, and the emitted event has no\n * `.detail` field, reject the promise with this error instead.\n */\n error?: Error\n\n /**\n * When multiple events with the same name may be emitted, pass a filter\n * function here to allow ignoring ones that should not cause the returned\n * promise to resolve.\n */\n filter?(evt: T): boolean\n}\n\n/**\n * Race a promise against an abort signal\n */\nexport async function raceEvent <T> (emitter: EventTarget | EventEmitter, eventName: string, signal?: AbortSignal, opts?: RaceEventOptions<T>): Promise<T> {\n // create the error here so we have more context in the stack trace\n const error = new AbortError(opts?.errorMessage)\n\n if (opts?.errorCode != null) {\n // @ts-expect-error not a field of AbortError\n error.code = opts.errorCode\n }\n\n const errorEvent = opts?.errorEvent ?? 'error'\n\n if (signal?.aborted === true) {\n return Promise.reject(error)\n }\n\n return new Promise((resolve, reject) => {\n function removeListeners (): void {\n removeListener(signal, 'abort', abortListener)\n removeListener(emitter, eventName, eventListener)\n removeListener(emitter, errorEvent, errorEventListener)\n }\n\n const eventListener = (evt: any): void => {\n try {\n if (opts?.filter?.(evt) === false) {\n return\n }\n } catch (err: any) {\n removeListeners()\n reject(err)\n return\n }\n\n removeListeners()\n resolve(evt)\n }\n\n const errorEventListener = (evt: any): void => {\n removeListeners()\n\n if (evt instanceof Error) {\n reject(evt)\n return\n }\n\n reject(evt.detail ?? opts?.error ?? new Error(`The \"${opts?.errorEvent}\" event was emitted but the event had no '.detail' field. Pass an 'error' option to race-event to change this message.`))\n }\n\n const abortListener = (): void => {\n removeListeners()\n reject(error)\n }\n\n addListener(signal, 'abort', abortListener)\n addListener(emitter, eventName, eventListener)\n addListener(emitter, errorEvent, errorEventListener)\n })\n}\n\nfunction addListener (emitter: EventEmitter | EventTarget | undefined, event: string, listener: any): void {\n if (emitter == null) {\n return\n }\n\n if (isEventTarget(emitter)) {\n emitter.addEventListener(event, listener)\n } else {\n emitter.addListener(event, listener)\n }\n}\n\nfunction removeListener (emitter: EventEmitter | EventTarget | undefined, event: string, listener: any): void {\n if (emitter == null) {\n return\n }\n\n if (isEventTarget(emitter)) {\n emitter.removeEventListener(event, listener)\n } else {\n emitter.removeListener(event, listener)\n }\n}\n\nfunction isEventTarget (emitter: any): emitter is EventTarget {\n return typeof emitter.addEventListener === 'function' && typeof emitter.removeEventListener === 'function'\n}\n", "import type { Readable } from 'node:stream'\n\n/**\n * Convert a Node.js [`Readable`](https://nodejs.org/dist/latest/docs/api/stream.html#class-streamreadable)\n * stream or a browser [`ReadableStream`](https://developer.mozilla.org/en-US/docs/Web/API/ReadableStream)\n * to an [iterable source](https://achingbrain.github.io/it-stream-types/types/Source.html).\n */\nexport function source <T = Uint8Array> (readable: Readable | ReadableStream<T>): AsyncGenerator<T> {\n // Browser ReadableStream\n if (isReadableStream(readable)) {\n return (async function * () {\n const reader = readable.getReader()\n\n try {\n while (true) {\n const { done, value } = await reader.read()\n\n if (done) {\n return\n }\n\n yield value\n }\n } finally {\n reader.releaseLock()\n }\n })()\n }\n\n if (isNodeStream<T>(readable)) {\n return readable\n }\n\n throw new Error('unknown stream')\n}\n\nfunction isNodeStream <T = any> (obj?: any): obj is AsyncGenerator<T> {\n return obj[Symbol.asyncIterator] != null\n}\n\nfunction isReadableStream (obj?: any): obj is ReadableStream {\n return typeof obj?.getReader === 'function'\n}\n", "import type { Sink, Source } from 'it-stream-types'\nimport type { Writable } from 'node:stream'\n\n/**\n * Convert a Node.js [`Writable`](https://nodejs.org/dist/latest/docs/api/stream.html#class-streamwritable)\n * stream to a [sink](https://achingbrain.github.io/it-stream-types/interfaces/Sink.html).\n */\nexport function sink <T> (writable: Writable): Sink<Source<T>, Promise<void>> {\n return async (source: Source<T>): Promise<void> => {\n const maybeEndSource = async (): Promise<void> => {\n if (isAsyncGenerator(source)) {\n await source.return(undefined)\n }\n }\n\n let error: Error | undefined\n let errCb: ((err: Error) => void) | undefined\n const errorHandler = (err: Error): void => {\n error = err\n\n // When the writable errors, try to end the source to exit iteration early\n maybeEndSource()\n .catch(err => {\n err = new AggregateError([\n error,\n err\n ], 'The Writable emitted an error, additionally an error occurred while ending the Source')\n })\n .finally(() => {\n errCb?.(err)\n })\n }\n\n let closeCb: (() => void) | undefined\n let closed = false\n const closeHandler = (): void => {\n closed = true\n closeCb?.()\n }\n\n let finishCb: (() => void) | undefined\n let finished = false\n const finishHandler = (): void => {\n finished = true\n finishCb?.()\n }\n\n let drainCb: (() => void) | undefined\n const drainHandler = (): void => {\n drainCb?.()\n }\n\n const waitForDrainOrClose = async (): Promise<void> => {\n return new Promise<void>((resolve, reject) => {\n closeCb = drainCb = resolve\n errCb = reject\n\n writable.once('drain', drainHandler)\n })\n }\n\n const waitForDone = async (): Promise<void> => {\n // Immediately try to end the source\n await maybeEndSource()\n\n return new Promise<void>((resolve, reject) => {\n if (closed || finished || (error != null)) {\n resolve()\n return\n }\n\n finishCb = closeCb = resolve\n errCb = reject\n })\n }\n\n const cleanup = (): void => {\n writable.removeListener('error', errorHandler)\n writable.removeListener('close', closeHandler)\n writable.removeListener('finish', finishHandler)\n writable.removeListener('drain', drainHandler)\n }\n\n writable.once('error', errorHandler)\n writable.once('close', closeHandler)\n writable.once('finish', finishHandler)\n\n try {\n for await (const value of source) {\n if (!writable.writable || writable.destroyed || (error != null)) {\n break\n }\n\n if (!writable.write(value as any)) {\n await waitForDrainOrClose()\n }\n }\n } catch (err: any) {\n // error is set by stream error handler so only destroy stream if source\n // threw\n if (error == null) {\n writable.destroy(err)\n }\n\n // could we be obscuring an error here?\n error = err\n }\n\n try {\n // We're done writing, end everything (n.b. stream may be destroyed at this\n // point but then this is a no-op)\n if (writable.writable) {\n writable.end()\n }\n\n // Wait until we close or finish. This supports halfClosed streams\n await waitForDone()\n\n // Notify the user an error occurred\n if (error != null) throw error\n } finally {\n // Clean up listeners\n cleanup()\n }\n }\n}\n\nfunction isAsyncGenerator <T = any> (obj?: any): obj is AsyncGenerator<T> {\n return obj.return != null\n}\n", "import { sink } from './sink.js'\nimport { source } from './source.js'\nimport type { Source, Duplex as ItDuplex } from 'it-stream-types'\nimport type { Duplex } from 'node:stream'\n\n/**\n * Convert a Node.js [`Duplex`](https://nodejs.org/dist/latest/docs/api/stream.html#class-streamduplex)\n * stream to a [duplex iterable](https://achingbrain.github.io/it-stream-types/interfaces/Duplex.html).\n */\nexport function duplex <TSource = Uint8Array, TSink = TSource> (duplex: Duplex): ItDuplex<AsyncGenerator<TSource>, Source<TSink>, Promise<void>> {\n return {\n sink: sink(duplex),\n source: source(duplex)\n }\n}\n", "import os from 'os'\nimport path from 'path'\nimport type { Multiaddr } from '@multiformats/multiaddr'\nimport type { ListenOptions, IpcSocketConnectOpts, TcpSocketConnectOpts } from 'net'\n\nexport type NetConfig = ListenOptions | (IpcSocketConnectOpts & TcpSocketConnectOpts)\n\nexport function multiaddrToNetConfig (addr: Multiaddr, config: NetConfig = {}): NetConfig {\n const listenPath = addr.getPath()\n\n // unix socket listening\n if (listenPath != null) {\n if (os.platform() === 'win32') {\n // Use named pipes on Windows systems.\n return { path: path.join('\\\\\\\\.\\\\pipe\\\\', listenPath) }\n } else {\n return { path: listenPath }\n }\n }\n\n const options = addr.toOptions()\n\n // tcp listening\n return {\n ...config,\n ...options,\n ipv6Only: options.family === 6\n }\n}\n", "import { InvalidParametersError, TimeoutError } from '@libp2p/interface'\nimport { ipPortToMultiaddr as toMultiaddr } from '@libp2p/utils/ip-port-to-multiaddr'\nimport pDefer from 'p-defer'\nimport { raceEvent } from 'race-event'\nimport { duplex } from 'stream-to-it'\nimport { CLOSE_TIMEOUT, SOCKET_TIMEOUT } from './constants.js'\nimport { multiaddrToNetConfig } from './utils.js'\nimport type { ComponentLogger, MultiaddrConnection, CounterGroup } from '@libp2p/interface'\nimport type { AbortOptions, Multiaddr } from '@multiformats/multiaddr'\nimport type { Socket } from 'net'\nimport type { DeferredPromise } from 'p-defer'\n\ninterface ToConnectionOptions {\n listeningAddr?: Multiaddr\n remoteAddr?: Multiaddr\n localAddr?: Multiaddr\n socketInactivityTimeout?: number\n socketCloseTimeout?: number\n metrics?: CounterGroup\n metricPrefix?: string\n logger: ComponentLogger\n direction: 'inbound' | 'outbound'\n}\n\n/**\n * Convert a socket into a MultiaddrConnection\n * https://github.com/libp2p/interface-transport#multiaddrconnection\n */\nexport const toMultiaddrConnection = (socket: Socket, options: ToConnectionOptions): MultiaddrConnection => {\n let closePromise: DeferredPromise<void>\n const log = options.logger.forComponent('libp2p:tcp:socket')\n const direction = options.direction\n const metrics = options.metrics\n const metricPrefix = options.metricPrefix ?? ''\n const inactivityTimeout = options.socketInactivityTimeout ?? SOCKET_TIMEOUT\n const closeTimeout = options.socketCloseTimeout ?? CLOSE_TIMEOUT\n let timedOut = false\n let errored = false\n\n // Check if we are connected on a unix path\n if (options.listeningAddr?.getPath() != null) {\n options.remoteAddr = options.listeningAddr\n }\n\n if (options.remoteAddr?.getPath() != null) {\n options.localAddr = options.remoteAddr\n }\n\n // handle socket errors\n socket.on('error', err => {\n errored = true\n\n if (!timedOut) {\n log.error('%s socket error - %e', direction, err)\n metrics?.increment({ [`${metricPrefix}error`]: true })\n }\n\n socket.destroy()\n maConn.timeline.close = Date.now()\n })\n\n let remoteAddr: Multiaddr\n\n if (options.remoteAddr != null) {\n remoteAddr = options.remoteAddr\n } else {\n if (socket.remoteAddress == null || socket.remotePort == null) {\n // this can be undefined if the socket is destroyed (for example, if the client disconnected)\n // https://nodejs.org/dist/latest-v16.x/docs/api/net.html#socketremoteaddress\n throw new InvalidParametersError('Could not determine remote address or port')\n }\n\n remoteAddr = toMultiaddr(socket.remoteAddress, socket.remotePort)\n }\n\n const lOpts = multiaddrToNetConfig(remoteAddr)\n const lOptsStr = lOpts.path ?? `${lOpts.host ?? ''}:${lOpts.port ?? ''}`\n const { sink, source } = duplex(socket)\n\n // by default there is no timeout\n // https://nodejs.org/dist/latest-v16.x/docs/api/net.html#socketsettimeouttimeout-callback\n socket.setTimeout(inactivityTimeout)\n\n socket.once('timeout', () => {\n timedOut = true\n log('%s %s socket read timeout', direction, lOptsStr)\n metrics?.increment({ [`${metricPrefix}timeout`]: true })\n\n // if the socket times out due to inactivity we must manually close the connection\n // https://nodejs.org/dist/latest-v16.x/docs/api/net.html#event-timeout\n socket.destroy(new TimeoutError())\n maConn.timeline.close = Date.now()\n })\n\n socket.once('close', () => {\n // record metric for clean exit\n if (!timedOut && !errored) {\n log('%s %s socket close', direction, lOptsStr)\n metrics?.increment({ [`${metricPrefix}close`]: true })\n }\n\n // In instances where `close` was not explicitly called,\n // such as an iterable stream ending, ensure we have set the close\n // timeline\n socket.destroy()\n maConn.timeline.close = Date.now()\n })\n\n socket.once('end', () => {\n // the remote sent a FIN packet which means no more data will be sent\n // https://nodejs.org/dist/latest-v16.x/docs/api/net.html#event-end\n log('%s %s socket end', direction, lOptsStr)\n metrics?.increment({ [`${metricPrefix}end`]: true })\n })\n\n const maConn: MultiaddrConnection = {\n async sink (source) {\n try {\n await sink((async function * () {\n for await (const buf of source) {\n if (buf instanceof Uint8Array) {\n yield buf\n } else {\n yield buf.subarray()\n }\n }\n })())\n } catch (err: any) {\n // If aborted we can safely ignore\n if (err.type !== 'aborted') {\n // If the source errored the socket will already have been destroyed by\n // duplex(). If the socket errored it will already be\n // destroyed. There's nothing to do here except log the error & return.\n log.error('%s %s error in sink - %e', direction, lOptsStr, err)\n }\n }\n\n // we have finished writing, send the FIN message\n socket.end()\n },\n\n source,\n\n // If the remote address was passed, use it - it may have the peer ID encapsulated\n remoteAddr,\n\n timeline: { open: Date.now() },\n\n async close (options: AbortOptions = {}) {\n if (socket.closed) {\n log('the %s %s socket is already closed', direction, lOptsStr)\n return\n }\n\n if (socket.destroyed) {\n log('the %s %s socket is already destroyed', direction, lOptsStr)\n return\n }\n\n if (closePromise != null) {\n return closePromise.promise\n }\n\n try {\n closePromise = pDefer()\n\n // close writable end of socket\n socket.end()\n\n // convert EventEmitter to EventTarget\n const eventTarget = socketToEventTarget(socket)\n\n // don't wait forever to close\n const signal = options.signal ?? AbortSignal.timeout(closeTimeout)\n\n // wait for any unsent data to be sent\n if (socket.writableLength > 0) {\n log('%s %s draining socket', direction, lOptsStr)\n await raceEvent(eventTarget, 'drain', signal, {\n errorEvent: 'error'\n })\n log('%s %s socket drained', direction, lOptsStr)\n }\n\n await Promise.all([\n raceEvent(eventTarget, 'close', signal, {\n errorEvent: 'error'\n }),\n\n // all bytes have been sent we can destroy the socket\n socket.destroy()\n ])\n } catch (err: any) {\n this.abort(err)\n } finally {\n closePromise.resolve()\n }\n },\n\n abort: (err: Error) => {\n log('%s %s socket abort due to error - %e', direction, lOptsStr, err)\n\n // the abortSignalListener may already destroyed the socket with an error\n socket.destroy()\n\n // closing a socket is always asynchronous (must wait for \"close\" event)\n // but the tests expect this to be a synchronous operation so we have to\n // set the close time here. the tests should be refactored to reflect\n // reality.\n maConn.timeline.close = Date.now()\n },\n\n log\n }\n\n return maConn\n}\n\nfunction socketToEventTarget (obj?: any): EventTarget {\n const eventTarget = {\n addEventListener: (type: any, cb: any) => {\n obj.addListener(type, cb)\n },\n removeEventListener: (type: any, cb: any) => {\n obj.removeListener(type, cb)\n }\n }\n\n // @ts-expect-error partial implementation\n return eventTarget\n}\n", "/**\n * @packageDocumentation\n *\n * A [libp2p transport](https://docs.libp2p.io/concepts/transports/overview/) based on the TCP networking stack.\n *\n * @example\n *\n * ```TypeScript\n * import { createLibp2p } from 'libp2p'\n * import { tcp } from '@libp2p/tcp'\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const node = await createLibp2p({\n * transports: [\n * tcp()\n * ]\n * })\n *\n * const ma = multiaddr('/ip4/123.123.123.123/tcp/1234')\n *\n * // dial a TCP connection, timing out after 10 seconds\n * const connection = await node.dial(ma, {\n * signal: AbortSignal.timeout(10_000)\n * })\n *\n * // use connection...\n * ```\n */\n\nimport { TCP } from './tcp.js'\nimport type { ComponentLogger, CounterGroup, Metrics, CreateListenerOptions, DialTransportOptions, Transport, OutboundConnectionUpgradeEvents } from '@libp2p/interface'\nimport type { ProgressEvent } from 'progress-events'\n\nexport interface CloseServerOnMaxConnectionsOpts {\n /**\n * Server listens once connection count is less than `listenBelow`\n */\n listenBelow: number\n\n /**\n * Close server once connection count is greater than or equal to `closeAbove`\n */\n closeAbove: number\n\n /**\n * Invoked when there was an error listening on a socket\n */\n onListenError?(err: Error): void\n}\n\nexport interface TCPOptions {\n /**\n * An optional number in ms that is used as an inactivity timeout after which the socket will be closed\n */\n inboundSocketInactivityTimeout?: number\n\n /**\n * An optional number in ms that is used as an inactivity timeout after which the socket will be closed\n */\n outboundSocketInactivityTimeout?: number\n\n /**\n * When closing a socket, wait this long for it to close gracefully before it is closed more forcibly\n */\n socketCloseTimeout?: number\n\n /**\n * Set this property to reject connections when the server's connection count gets high.\n * https://nodejs.org/api/net.html#servermaxconnections\n */\n maxConnections?: number\n\n /**\n * Parameter to specify the maximum length of the queue of pending connections\n * https://nodejs.org/dist/latest-v18.x/docs/api/net.html#serverlisten\n */\n backlog?: number\n\n /**\n * Close server (stop listening for new connections) if connections exceed a limit.\n * Open server (start listening for new connections) if connections fall below a limit.\n */\n closeServerOnMaxConnections?: CloseServerOnMaxConnectionsOpts\n\n /**\n * Options passed to `net.connect` for every opened TCP socket\n */\n dialOpts?: TCPSocketOptions\n\n /**\n * Options passed to every `net.createServer` for every TCP server\n */\n listenOpts?: TCPSocketOptions\n}\n\n/**\n * Expose a subset of net.connect options\n */\nexport interface TCPSocketOptions {\n /**\n * @see https://nodejs.org/api/net.html#socketconnectoptions-connectlistener\n */\n noDelay?: boolean\n\n /**\n * @see https://nodejs.org/api/net.html#socketconnectoptions-connectlistener\n */\n keepAlive?: boolean\n\n /**\n * @see https://nodejs.org/api/net.html#socketconnectoptions-connectlistener\n */\n keepAliveInitialDelay?: number\n\n /**\n * @see https://nodejs.org/api/net.html#new-netsocketoptions\n */\n allowHalfOpen?: boolean\n}\n\nexport type TCPDialEvents =\n OutboundConnectionUpgradeEvents |\n ProgressEvent<'tcp:open-connection'>\n\nexport interface TCPDialOptions extends DialTransportOptions<TCPDialEvents>, TCPSocketOptions {\n\n}\n\nexport interface TCPCreateListenerOptions extends CreateListenerOptions, TCPSocketOptions {\n\n}\n\nexport interface TCPComponents {\n metrics?: Metrics\n logger: ComponentLogger\n}\n\nexport interface TCPMetrics {\n events: CounterGroup<'error' | 'timeout' | 'connect' | 'abort'>\n errors: CounterGroup<'outbound_to_connection' | 'outbound_upgrade'>\n}\n\nexport function tcp (init: TCPOptions = {}): (components: TCPComponents) => Transport {\n return (components: TCPComponents) => {\n return new TCP(components, init)\n }\n}\n", "/**\n * @packageDocumentation\n *\n * This module makes it easy to send and receive length-prefixed Protobuf encoded\n * messages over streams.\n *\n * @example\n *\n * ```typescript\n * import { pbStream } from 'it-protobuf-stream'\n * import { MessageType } from './src/my-message-type.js'\n *\n * // RequestType and ResponseType have been generate from `.proto` files and have\n * // `.encode` and `.decode` methods for serialization/deserialization\n *\n * const stream = pbStream(duplex)\n *\n * // write a message to the stream\n * stream.write({\n * foo: 'bar'\n * }, MessageType)\n *\n * // read a message from the stream\n * const res = await stream.read(MessageType)\n * ```\n */\n\nimport { lpStream } from 'it-length-prefixed-stream'\nimport type { AbortOptions } from 'abort-error'\nimport type { LengthPrefixedStreamOpts } from 'it-length-prefixed-stream'\nimport type { Duplex } from 'it-stream-types'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\n/**\n * A protobuf decoder - takes a byte array and returns an object\n */\nexport interface Decoder<T> {\n (data: Uint8Array | Uint8ArrayList): T\n}\n\n/**\n * A protobuf encoder - takes an object and returns a byte array\n */\nexport interface Encoder<T> {\n (data: T): Uint8Array\n}\n\n/**\n * Convenience methods for working with protobuf streams\n */\nexport interface ProtobufStream <Stream = unknown> {\n /**\n * Read the next length-prefixed byte array from the stream and decode it as the passed protobuf format\n */\n read<T>(proto: { decode: Decoder<T> }, options?: AbortOptions): Promise<T>\n\n /**\n * Encode the passed object as a protobuf message and write it's length-prefixed bytes to the stream\n */\n write<T>(data: T, proto: { encode: Encoder<T> }, options?: AbortOptions): Promise<void>\n\n /**\n * Encode the passed objects as protobuf messages and write their length-prefixed bytes to the stream as a single write\n */\n writeV<T>(input: T[], proto: { encode: Encoder<T> }, options?: AbortOptions): Promise<void>\n\n /**\n * Returns an object with read/write methods for operating on one specific type of protobuf message\n */\n pb<T>(proto: { encode: Encoder<T>, decode: Decoder<T> }): MessageStream<T, Stream>\n\n /**\n * Returns the underlying stream\n */\n unwrap(): Stream\n}\n\n/**\n * A message reader/writer that only uses one type of message\n */\nexport interface MessageStream <T, S = unknown> {\n /**\n * Read a message from the stream\n */\n read(options?: AbortOptions): Promise<T>\n\n /**\n * Write a message to the stream\n */\n write(d: T, options?: AbortOptions): Promise<void>\n\n /**\n * Write several messages to the stream\n */\n writeV(d: T[], options?: AbortOptions): Promise<void>\n\n /**\n * Unwrap the underlying protobuf stream\n */\n unwrap(): ProtobufStream<S>\n}\n\nexport interface ProtobufStreamOpts extends LengthPrefixedStreamOpts {\n\n}\n\nexport function pbStream <Stream extends Duplex<any, any, any>> (duplex: Stream, opts?: Partial<ProtobufStreamOpts>): ProtobufStream<Stream> {\n const lp = lpStream(duplex, opts)\n\n const W: ProtobufStream<Stream> = {\n read: async (proto, options?: AbortOptions) => {\n // readLP, decode\n const value = await lp.read(options)\n\n return proto.decode(value)\n },\n write: async (message, proto, options?: AbortOptions) => {\n // encode, writeLP\n await lp.write(proto.encode(message), options)\n },\n writeV: async (messages, proto, options?: AbortOptions) => {\n // encode, writeLP\n await lp.writeV(messages.map(message => proto.encode(message)), options)\n },\n pb: (proto) => {\n return {\n read: async (options) => W.read(proto, options),\n write: async (d, options) => W.write(d, proto, options),\n writeV: async (d, options) => W.writeV(d, proto, options),\n unwrap: () => W\n }\n },\n unwrap: () => {\n return lp.unwrap()\n }\n }\n\n return W\n}\n", "import {\n Request,\n Response,\n DHTRequest,\n DHTResponse\n} from '@libp2p/daemon-protocol'\nimport { InvalidMessageError, InvalidParametersError, ProtocolError, isPeerId } from '@libp2p/interface'\nimport { logger } from '@libp2p/logger'\nimport { peerIdFromMultihash } from '@libp2p/peer-id'\nimport { multiaddr } from '@multiformats/multiaddr'\nimport { CID } from 'multiformats/cid'\nimport * as Digest from 'multiformats/hashes/digest'\nimport { OperationFailedError } from './index.js'\nimport type { DaemonClient } from './index.js'\nimport type { PeerId, PeerInfo } from '@libp2p/interface'\n\nconst log = logger('libp2p:daemon-client:dht')\n\nexport class DHT {\n private readonly client: DaemonClient\n\n constructor (client: DaemonClient) {\n this.client = client\n }\n\n /**\n * Write a value to a key in the DHT\n */\n async put (key: Uint8Array, value: Uint8Array): Promise<void> {\n if (!(key instanceof Uint8Array)) {\n throw new InvalidParametersError('invalid key received')\n }\n\n if (!(value instanceof Uint8Array)) {\n throw new InvalidParametersError('value received is not a Uint8Array')\n }\n\n const sh = await this.client.send({\n type: Request.Type.DHT,\n dht: {\n type: DHTRequest.Type.PUT_VALUE,\n key,\n value\n }\n })\n\n const response = await sh.read(Response)\n\n log('read', response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new ProtocolError(response.error?.msg ?? 'DHT put failed')\n }\n }\n\n /**\n * Query the DHT for a value stored at a key in the DHT\n */\n async get (key: Uint8Array): Promise<Uint8Array> {\n if (!(key instanceof Uint8Array)) {\n throw new InvalidParametersError('invalid key received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.DHT,\n dht: {\n type: DHTRequest.Type.GET_VALUE,\n key\n }\n })\n\n const response = await sh.read(Response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'DHT get failed')\n }\n\n if (response.dht?.value == null) {\n throw new OperationFailedError('Invalid DHT get response')\n }\n\n return response.dht.value\n }\n\n /**\n * Query the DHT for a given peer's known addresses.\n */\n async findPeer (peerId: PeerId): Promise<PeerInfo> {\n if (!isPeerId(peerId)) {\n throw new InvalidParametersError('invalid peer id received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.DHT,\n dht: {\n type: DHTRequest.Type.FIND_PEER,\n peer: peerId.toMultihash().bytes\n }\n })\n\n const response = await sh.read(Response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'DHT find peer failed')\n }\n\n if (response.dht?.peer?.addrs == null) {\n throw new OperationFailedError('Invalid response')\n }\n\n return {\n id: peerIdFromMultihash(Digest.decode(response.dht.peer.id)),\n multiaddrs: response.dht.peer.addrs.map((a) => multiaddr(a))\n }\n }\n\n /**\n * Announce to the network that the peer have data addressed by the provided CID\n */\n async provide (cid: CID): Promise<void> {\n if (cid == null || CID.asCID(cid) == null) {\n throw new InvalidParametersError('invalid cid received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.DHT,\n dht: {\n type: DHTRequest.Type.PROVIDE,\n cid: cid.bytes\n }\n })\n\n const response = await sh.read(Response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'DHT provide failed')\n }\n }\n\n /**\n * Query the DHT for peers that have a piece of content, identified by a CID\n */\n async * findProviders (cid: CID, count: number = 1): AsyncIterable<PeerInfo> {\n if (cid == null || CID.asCID(cid) == null) {\n throw new InvalidParametersError('invalid cid received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.DHT,\n dht: {\n type: DHTRequest.Type.FIND_PROVIDERS,\n cid: cid.bytes,\n count\n }\n })\n\n // stream begin message\n const response = await sh.read(Response)\n\n if (response.type !== Response.Type.OK) {\n await sh.unwrap().close()\n throw new OperationFailedError(response.error?.msg ?? 'DHT find providers failed')\n }\n\n while (true) {\n const dhtResponse = await sh.read(DHTResponse)\n\n // Stream end\n if (dhtResponse.type === DHTResponse.Type.END) {\n await sh.unwrap().close()\n return\n }\n\n // Stream values\n if (dhtResponse.type === DHTResponse.Type.VALUE && dhtResponse.peer?.addrs != null) {\n yield {\n id: peerIdFromMultihash(Digest.decode(dhtResponse.peer.id)),\n multiaddrs: dhtResponse.peer.addrs.map((a) => multiaddr(a))\n }\n } else {\n // Unexpected message received\n await sh.unwrap().close()\n throw new ProtocolError('unexpected message received')\n }\n }\n }\n\n /**\n * Query the DHT routing table for peers that are closest to a provided key.\n */\n async * getClosestPeers (key: Uint8Array): AsyncIterable<PeerInfo> {\n if (!(key instanceof Uint8Array)) {\n throw new InvalidParametersError('invalid key received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.DHT,\n dht: {\n type: DHTRequest.Type.GET_CLOSEST_PEERS,\n key\n }\n })\n\n // stream begin message\n const response = await sh.read(Response)\n\n if (response.type !== Response.Type.OK) {\n await sh.unwrap().close()\n throw new OperationFailedError(response.error?.msg ?? 'DHT find providers failed')\n }\n\n while (true) {\n const dhtResponse = await sh.read(DHTResponse)\n\n // Stream end\n if (dhtResponse.type === DHTResponse.Type.END) {\n await sh.unwrap().close()\n return\n }\n\n // Stream values\n if (dhtResponse.type === DHTResponse.Type.VALUE && dhtResponse.value != null) {\n const peerId = peerIdFromMultihash(Digest.decode(dhtResponse.value))\n\n yield {\n id: peerId,\n multiaddrs: []\n }\n } else {\n // Unexpected message received\n await sh.unwrap().close()\n throw new InvalidMessageError('unexpected message received')\n }\n }\n }\n\n /**\n * Query the DHT routing table for a given peer's public key.\n */\n async getPublicKey (peerId: PeerId): Promise<Uint8Array | undefined> {\n if (!isPeerId(peerId)) {\n throw new InvalidParametersError('invalid peer id received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.DHT,\n dht: {\n type: DHTRequest.Type.GET_PUBLIC_KEY,\n peer: peerId.toMultihash().bytes\n }\n })\n\n const response = await sh.read(Response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'DHT get public key failed')\n }\n\n if (response.dht == null) {\n throw new InvalidMessageError('Invalid response')\n }\n\n return response.dht.value\n }\n}\n", "import {\n Request,\n Response,\n PSRequest,\n PSMessage\n} from '@libp2p/daemon-protocol'\nimport { InvalidParametersError } from '@libp2p/interface'\nimport { peerIdFromMultihash } from '@libp2p/peer-id'\nimport * as Digest from 'multiformats/hashes/digest'\nimport { OperationFailedError } from './index.js'\nimport type { DaemonClient, Subscription } from './index.js'\nimport type { PeerId } from '@libp2p/interface'\n\nexport class Pubsub {\n private readonly client: DaemonClient\n\n constructor (client: DaemonClient) {\n this.client = client\n }\n\n /**\n * Get a list of topics the node is subscribed to.\n *\n * @returns {Array<string>} topics\n */\n async getTopics (): Promise<string[]> {\n const sh = await this.client.send({\n type: Request.Type.PUBSUB,\n pubsub: {\n type: PSRequest.Type.GET_TOPICS\n }\n })\n\n const response = await sh.read(Response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'Pubsub get topics failed')\n }\n\n if (response.pubsub?.topics == null) {\n throw new OperationFailedError('Invalid response')\n }\n\n return response.pubsub.topics\n }\n\n /**\n * Publish data under a topic\n */\n async publish (topic: string, data: Uint8Array): Promise<void> {\n if (typeof topic !== 'string') {\n throw new InvalidParametersError('invalid topic received')\n }\n\n if (!(data instanceof Uint8Array)) {\n throw new InvalidParametersError('data received is not a Uint8Array')\n }\n\n const sh = await this.client.send({\n type: Request.Type.PUBSUB,\n pubsub: {\n type: PSRequest.Type.PUBLISH,\n topic,\n data\n }\n })\n\n const response = await sh.read(Response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'Pubsub publish failed')\n }\n }\n\n /**\n * Request to subscribe a certain topic\n */\n async subscribe (topic: string): Promise<Subscription> {\n if (typeof topic !== 'string') {\n throw new InvalidParametersError('invalid topic received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.PUBSUB,\n pubsub: {\n type: PSRequest.Type.SUBSCRIBE,\n topic\n }\n })\n\n const response = await sh.read(Response)\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'Pubsub publish failed')\n }\n\n let subscribed = true\n\n const subscription: Subscription = {\n async * messages () {\n while (subscribed) { // eslint-disable-line no-unmodified-loop-condition\n yield await sh.read(PSMessage)\n }\n },\n async cancel () {\n subscribed = false\n await sh.unwrap().close()\n }\n }\n\n return subscription\n }\n\n async getSubscribers (topic: string): Promise<PeerId[]> {\n if (typeof topic !== 'string') {\n throw new InvalidParametersError('invalid topic received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.PUBSUB,\n pubsub: {\n type: PSRequest.Type.LIST_PEERS,\n topic\n }\n })\n\n const response = await sh.read(Response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'Pubsub get subscribers failed')\n }\n\n if (response.pubsub?.topics == null) {\n throw new OperationFailedError('Invalid response')\n }\n\n return response.pubsub.peerIDs.map(buf => peerIdFromMultihash(Digest.decode(buf)))\n }\n}\n"],
5
- "mappings": ";s2BAAA,IAAAA,GAAA,GAAAC,GAAAD,GAAA,0BAAAE,EAAA,iBAAAC,KCAA,IAAAC,GAAuB,kBCIjB,SAAUC,GAAcC,EAAe,CAC3C,OAAO,IAAI,WAAWA,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,CAClE,CDCM,SAAUC,GAAOC,EAAe,EAAC,CACrC,OAAOC,GAAa,UAAO,MAAMD,CAAI,CAAC,CACxC,CAOM,SAAUE,GAAaF,EAAe,EAAC,CAC3C,OAAOC,GAAa,UAAO,YAAYD,CAAI,CAAC,CAC9C,CEdA,IAAMG,GAAK,KAAK,IAAI,EAAG,CAAC,EAClBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EAGnBC,EAAM,IAENC,GAAO,IAEP,SAAUC,GAAgBC,EAAa,CAC3C,GAAIA,EAAQV,GACV,MAAO,GAGT,GAAIU,EAAQT,GACV,MAAO,GAGT,GAAIS,EAAQR,GACV,MAAO,GAGT,GAAIQ,EAAQP,GACV,MAAO,GAGT,GAAIO,EAAQN,GACV,MAAO,GAGT,GAAIM,EAAQL,GACV,MAAO,GAGT,GAAIK,EAAQJ,GACV,MAAO,GAGT,GAAI,OAAO,kBAAoB,MAAQI,EAAQ,OAAO,iBACpD,MAAM,IAAI,WAAW,yBAAyB,EAGhD,MAAO,EACT,CAEM,SAAUC,GAAkBD,EAAeE,EAAiBC,EAAiB,EAAC,CAClF,OAAQJ,GAAeC,CAAK,EAAG,CAC7B,IAAK,GACHE,EAAIC,GAAQ,EAAKH,EAAQ,IAAQH,EACjCG,GAAS,IAEX,IAAK,GACHE,EAAIC,GAAQ,EAAKH,EAAQ,IAAQH,EACjCG,GAAS,IAEX,IAAK,GACHE,EAAIC,GAAQ,EAAKH,EAAQ,IAAQH,EACjCG,GAAS,IAEX,IAAK,GACHE,EAAIC,GAAQ,EAAKH,EAAQ,IAAQH,EACjCG,GAAS,IAEX,IAAK,GACHE,EAAIC,GAAQ,EAAKH,EAAQ,IAAQH,EACjCG,KAAW,EAEb,IAAK,GACHE,EAAIC,GAAQ,EAAKH,EAAQ,IAAQH,EACjCG,KAAW,EAEb,IAAK,GACHE,EAAIC,GAAQ,EAAKH,EAAQ,IAAQH,EACjCG,KAAW,EAEb,IAAK,GAAG,CACNE,EAAIC,GAAQ,EAAKH,EAAQ,IACzBA,KAAW,EACX,KACF,CACA,QAAS,MAAM,IAAI,MAAM,aAAa,CACxC,CACA,OAAOE,CACT,CAEM,SAAUE,GAAsBJ,EAAeE,EAAqBC,EAAiB,EAAC,CAC1F,OAAQJ,GAAeC,CAAK,EAAG,CAC7B,IAAK,GACHE,EAAI,IAAIC,IAAWH,EAAQ,IAAQH,CAAG,EACtCG,GAAS,IAEX,IAAK,GACHE,EAAI,IAAIC,IAAWH,EAAQ,IAAQH,CAAG,EACtCG,GAAS,IAEX,IAAK,GACHE,EAAI,IAAIC,IAAWH,EAAQ,IAAQH,CAAG,EACtCG,GAAS,IAEX,IAAK,GACHE,EAAI,IAAIC,IAAWH,EAAQ,IAAQH,CAAG,EACtCG,GAAS,IAEX,IAAK,GACHE,EAAI,IAAIC,IAAWH,EAAQ,IAAQH,CAAG,EACtCG,KAAW,EAEb,IAAK,GACHE,EAAI,IAAIC,IAAWH,EAAQ,IAAQH,CAAG,EACtCG,KAAW,EAEb,IAAK,GACHE,EAAI,IAAIC,IAAWH,EAAQ,IAAQH,CAAG,EACtCG,KAAW,EAEb,IAAK,GAAG,CACNE,EAAI,IAAIC,IAAWH,EAAQ,GAAK,EAChCA,KAAW,EACX,KACF,CACA,QAAS,MAAM,IAAI,MAAM,aAAa,CACxC,CACA,OAAOE,CACT,CAEM,SAAUG,GAAkBH,EAAiBC,EAAc,CAC/D,IAAIG,EAAIJ,EAAIC,CAAM,EACdI,EAAM,EA6CV,GA3CAA,GAAOD,EAAIR,GACPQ,EAAIT,IAIRS,EAAIJ,EAAIC,EAAS,CAAC,EAClBI,IAAQD,EAAIR,KAAS,EACjBQ,EAAIT,KAIRS,EAAIJ,EAAIC,EAAS,CAAC,EAClBI,IAAQD,EAAIR,KAAS,GACjBQ,EAAIT,KAIRS,EAAIJ,EAAIC,EAAS,CAAC,EAClBI,IAAQD,EAAIR,KAAS,GACjBQ,EAAIT,KAIRS,EAAIJ,EAAIC,EAAS,CAAC,EAClBI,IAAQD,EAAIR,IAAQL,GAChBa,EAAIT,KAIRS,EAAIJ,EAAIC,EAAS,CAAC,EAClBI,IAAQD,EAAIR,IAAQJ,GAChBY,EAAIT,KAIRS,EAAIJ,EAAIC,EAAS,CAAC,EAClBI,IAAQD,EAAIR,IAAQH,GAChBW,EAAIT,KAIRS,EAAIJ,EAAIC,EAAS,CAAC,EAClBI,IAAQD,EAAIR,IAAQF,GAChBU,EAAIT,GACN,OAAOU,EAGT,MAAM,IAAI,WAAW,yBAAyB,CAChD,CAEM,SAAUC,GAAsBN,EAAqBC,EAAc,CACvE,IAAIG,EAAIJ,EAAI,IAAIC,CAAM,EAClBI,EAAM,EA6CV,GA3CAA,GAAOD,EAAIR,GACPQ,EAAIT,IAIRS,EAAIJ,EAAI,IAAIC,EAAS,CAAC,EACtBI,IAAQD,EAAIR,KAAS,EACjBQ,EAAIT,KAIRS,EAAIJ,EAAI,IAAIC,EAAS,CAAC,EACtBI,IAAQD,EAAIR,KAAS,GACjBQ,EAAIT,KAIRS,EAAIJ,EAAI,IAAIC,EAAS,CAAC,EACtBI,IAAQD,EAAIR,KAAS,GACjBQ,EAAIT,KAIRS,EAAIJ,EAAI,IAAIC,EAAS,CAAC,EACtBI,IAAQD,EAAIR,IAAQL,GAChBa,EAAIT,KAIRS,EAAIJ,EAAI,IAAIC,EAAS,CAAC,EACtBI,IAAQD,EAAIR,IAAQJ,GAChBY,EAAIT,KAIRS,EAAIJ,EAAI,IAAIC,EAAS,CAAC,EACtBI,IAAQD,EAAIR,IAAQH,GAChBW,EAAIT,KAIRS,EAAIJ,EAAI,IAAIC,EAAS,CAAC,EACtBI,IAAQD,EAAIR,IAAQF,GAChBU,EAAIT,GACN,OAAOU,EAGT,MAAM,IAAI,WAAW,yBAAyB,CAChD,CAKM,SAAUE,GAA6DT,EAAeE,EAASC,EAAiB,EAAC,CAIrH,OAHID,GAAO,OACTA,EAAMQ,GAAYX,GAAeC,CAAK,CAAC,GAErCE,aAAe,WACVD,GAAiBD,EAAOE,EAAKC,CAAM,EAEnCC,GAAqBJ,EAAOE,EAAKC,CAAM,CAElD,CAEM,SAAUQ,GAAQT,EAAkCC,EAAiB,EAAC,CAC1E,OAAID,aAAe,WACVG,GAAiBH,EAAKC,CAAM,EAE5BK,GAAqBN,EAAKC,CAAM,CAE3C,CCrQA,IAAMS,GAAM,IAAI,aAAa,CAAC,EAAE,CAAC,EAC3BC,GAAM,IAAI,WAAWD,GAAI,MAAM,EAK/B,SAAUE,GAAcC,EAAaC,EAAiBC,EAAW,CACrEL,GAAI,CAAC,EAAIG,EACTC,EAAIC,CAAG,EAAIJ,GAAI,CAAC,EAChBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,CACtB,CAgBM,SAAUK,GAAaC,EAAiBC,EAAW,CACvD,OAAAC,GAAI,CAAC,EAAIF,EAAIC,CAAG,EAChBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACbE,GAAI,CAAC,CACd,CAaA,IAAMC,GAAM,IAAI,aAAa,CAAC,EAAE,CAAC,EAC3BC,GAAM,IAAI,WAAWD,GAAI,MAAM,EAK/B,SAAUE,GAAeC,EAAaC,EAAiBC,EAAW,CACtEL,GAAI,CAAC,EAAIG,EACTC,EAAIC,CAAG,EAAIJ,GAAI,CAAC,EAChBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,CACtB,CAoBM,SAAUK,GAAcC,EAAiBC,EAAW,CACxD,OAAAC,GAAI,CAAC,EAAIF,EAAIC,CAAG,EAChBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACbE,GAAI,CAAC,CACd,CC5FA,IAAMC,GAA0B,OAAO,OAAO,gBAAgB,EACxDC,GAA0B,OAAO,OAAO,gBAAgB,EAWjDC,GAAP,MAAOC,CAAQ,CACZ,GACA,GAEP,YAAaC,EAAYC,EAAU,CAOjC,KAAK,GAAKD,EAAK,EAKf,KAAK,GAAKC,EAAK,CACjB,CAKA,SAAUC,EAAoB,GAAK,CACjC,GAAI,CAACA,GAAa,KAAK,KAAO,GAAM,EAAG,CACrC,IAAMF,EAAK,CAAC,KAAK,GAAK,IAAM,EACxBC,EAAK,CAAC,KAAK,KAAO,EACtB,OAAID,IAAO,IACTC,EAAKA,EAAK,IAAM,GAEX,EAAED,EAAKC,EAAK,WACrB,CACA,OAAO,KAAK,GAAK,KAAK,GAAK,UAC7B,CAKA,SAAUC,EAAoB,GAAK,CACjC,GAAIA,EACF,OAAO,OAAO,KAAK,KAAO,CAAC,GAAK,OAAO,KAAK,KAAO,CAAC,GAAK,KAG3D,GAAK,KAAK,KAAO,GAAW,CAC1B,IAAMF,EAAK,CAAC,KAAK,GAAK,IAAM,EACxBC,EAAK,CAAC,KAAK,KAAO,EACtB,OAAID,IAAO,IACTC,EAAKA,EAAK,IAAM,GAEX,EAAE,OAAOD,CAAE,GAAK,OAAOC,CAAE,GAAK,KACvC,CAEA,OAAO,OAAO,KAAK,KAAO,CAAC,GAAK,OAAO,KAAK,KAAO,CAAC,GAAK,IAC3D,CAKA,SAAUC,EAAoB,GAAK,CACjC,OAAO,KAAK,SAASA,CAAQ,EAAE,SAAQ,CACzC,CAKA,UAAQ,CACN,IAAMC,EAAO,KAAK,IAAM,GACxB,YAAK,KAAO,KAAK,IAAM,EAAI,KAAK,KAAO,IAAMA,KAAU,EACvD,KAAK,IAAM,KAAK,IAAM,EAAIA,KAAU,EAC7B,IACT,CAKA,UAAQ,CACN,IAAMA,EAAO,EAAE,KAAK,GAAK,GACzB,YAAK,KAAO,KAAK,KAAO,EAAI,KAAK,IAAM,IAAMA,KAAU,EACvD,KAAK,IAAM,KAAK,KAAO,EAAIA,KAAU,EAC9B,IACT,CAKA,QAAM,CACJ,IAAMC,EAAQ,KAAK,GACbC,GAAS,KAAK,KAAO,GAAK,KAAK,IAAM,KAAO,EAC5CC,EAAQ,KAAK,KAAO,GAC1B,OAAOA,IAAU,EACbD,IAAU,EACRD,EAAQ,MACNA,EAAQ,IAAM,EAAI,EAClBA,EAAQ,QAAU,EAAI,EACxBC,EAAQ,MACNA,EAAQ,IAAM,EAAI,EAClBA,EAAQ,QAAU,EAAI,EAC1BC,EAAQ,IAAM,EAAI,EACxB,CAKA,OAAO,WAAYC,EAAa,CAC9B,GAAIA,IAAU,GACZ,OAAOC,GAGT,GAAID,EAAQX,IAA2BW,EAAQV,GAC7C,OAAO,KAAK,WAAW,OAAOU,CAAK,CAAC,EAGtC,IAAME,EAAWF,EAAQ,GAErBE,IACFF,EAAQ,CAACA,GAGX,IAAIN,EAAKM,GAAS,IACdP,EAAKO,GAASN,GAAM,KAExB,OAAIQ,IACFR,EAAK,CAACA,EAAK,GACXD,EAAK,CAACA,EAAK,GAEP,EAAEA,EAAKU,KACTV,EAAK,GACD,EAAEC,EAAKS,KAAUT,EAAK,MAIvB,IAAIF,EAAS,OAAOC,CAAE,EAAG,OAAOC,CAAE,CAAC,CAC5C,CAKA,OAAO,WAAYM,EAAa,CAC9B,GAAIA,IAAU,EAAK,OAAOC,GAC1B,IAAMG,EAAOJ,EAAQ,EACjBI,IAAQJ,EAAQ,CAACA,GACrB,IAAIP,EAAKO,IAAU,EACfN,GAAMM,EAAQP,GAAM,aAAe,EACvC,OAAIW,IACFV,EAAK,CAACA,IAAO,EACbD,EAAK,CAACA,IAAO,EACT,EAAEA,EAAK,aACTA,EAAK,EACD,EAAEC,EAAK,aAAcA,EAAK,KAG3B,IAAIF,EAASC,EAAIC,CAAE,CAC5B,CAKA,OAAO,KAAMM,EAA+D,CAC1E,OAAI,OAAOA,GAAU,SACZR,EAAS,WAAWQ,CAAK,EAE9B,OAAOA,GAAU,SACZR,EAAS,WAAWQ,CAAK,EAE9B,OAAOA,GAAU,SACZR,EAAS,WAAW,OAAOQ,CAAK,CAAC,EAEnCA,EAAM,KAAO,MAAQA,EAAM,MAAQ,KAAO,IAAIR,EAASQ,EAAM,MAAQ,EAAGA,EAAM,OAAS,CAAC,EAAIC,EACrG,GAGIA,GAAO,IAAIV,GAAS,EAAG,CAAC,EAC9BU,GAAK,SAAW,UAAA,CAAc,OAAO,EAAG,EACxCA,GAAK,SAAWA,GAAK,SAAW,UAAA,CAAc,OAAO,IAAK,EAC1DA,GAAK,OAAS,UAAA,CAAc,MAAO,EAAE,EAErC,IAAME,GAAS,YCzLT,SAAUE,GAAQC,EAAc,CACpC,IAAIC,EAAM,EACNC,EAAI,EACR,QAASC,EAAI,EAAGA,EAAIH,EAAO,OAAQ,EAAEG,EACnCD,EAAIF,EAAO,WAAWG,CAAC,EAEnBD,EAAI,IACND,GAAO,EACEC,EAAI,KACbD,GAAO,GACGC,EAAI,SAAY,QAAWF,EAAO,WAAWG,EAAI,CAAC,EAAI,SAAY,OAC5E,EAAEA,EACFF,GAAO,GAEPA,GAAO,EAIX,OAAOA,CACT,CAKM,SAAUG,GAAMC,EAAoBC,EAAeC,EAAW,CAGlE,GAFYA,EAAMD,EAER,EACR,MAAO,GAGT,IAAIE,EACEC,EAAkB,CAAA,EACpBN,EAAI,EACJO,EAEJ,KAAOJ,EAAQC,GACbG,EAAIL,EAAOC,GAAO,EAEdI,EAAI,IACND,EAAMN,GAAG,EAAIO,EACJA,EAAI,KAAOA,EAAI,IACxBD,EAAMN,GAAG,GAAKO,EAAI,KAAO,EAAIL,EAAOC,GAAO,EAAI,GACtCI,EAAI,KAAOA,EAAI,KACxBA,IAAMA,EAAI,IAAM,IAAML,EAAOC,GAAO,EAAI,KAAO,IAAMD,EAAOC,GAAO,EAAI,KAAO,EAAID,EAAOC,GAAO,EAAI,IAAM,MAC1GG,EAAMN,GAAG,EAAI,OAAUO,GAAK,IAC5BD,EAAMN,GAAG,EAAI,OAAUO,EAAI,OAE3BD,EAAMN,GAAG,GAAKO,EAAI,KAAO,IAAML,EAAOC,GAAO,EAAI,KAAO,EAAID,EAAOC,GAAO,EAAI,GAG5EH,EAAI,QACLK,IAAUA,EAAQ,CAAA,IAAK,KAAK,OAAO,aAAa,MAAM,OAAQC,CAAK,CAAC,EACrEN,EAAI,GAIR,OAAIK,GAAS,MACPL,EAAI,GACNK,EAAM,KAAK,OAAO,aAAa,MAAM,OAAQC,EAAM,MAAM,EAAGN,CAAC,CAAC,CAAC,EAG1DK,EAAM,KAAK,EAAE,GAGf,OAAO,aAAa,MAAM,OAAQC,EAAM,MAAM,EAAGN,CAAC,CAAC,CAC5D,CAKM,SAAUQ,GAAOX,EAAgBK,EAAoBO,EAAc,CACvE,IAAMN,EAAQM,EACVC,EACAC,EAEJ,QAASX,EAAI,EAAGA,EAAIH,EAAO,OAAQ,EAAEG,EACnCU,EAAKb,EAAO,WAAWG,CAAC,EAEpBU,EAAK,IACPR,EAAOO,GAAQ,EAAIC,EACVA,EAAK,MACdR,EAAOO,GAAQ,EAAIC,GAAM,EAAI,IAC7BR,EAAOO,GAAQ,EAAIC,EAAK,GAAK,MACnBA,EAAK,SAAY,SAAYC,EAAKd,EAAO,WAAWG,EAAI,CAAC,GAAK,SAAY,OACpFU,EAAK,QAAYA,EAAK,OAAW,KAAOC,EAAK,MAC7C,EAAEX,EACFE,EAAOO,GAAQ,EAAIC,GAAM,GAAK,IAC9BR,EAAOO,GAAQ,EAAIC,GAAM,GAAK,GAAK,IACnCR,EAAOO,GAAQ,EAAIC,GAAM,EAAI,GAAK,IAClCR,EAAOO,GAAQ,EAAIC,EAAK,GAAK,MAE7BR,EAAOO,GAAQ,EAAIC,GAAM,GAAK,IAC9BR,EAAOO,GAAQ,EAAIC,GAAM,EAAI,GAAK,IAClCR,EAAOO,GAAQ,EAAIC,EAAK,GAAK,KAIjC,OAAOD,EAASN,CAClB,CC9FA,SAASS,GAAiBC,EAAgBC,EAAoB,CAC5D,OAAO,WAAW,uBAAuBD,EAAO,GAAG,MAAMC,GAAe,CAAC,MAAMD,EAAO,GAAG,EAAE,CAC7F,CAEA,SAASE,GAAgBC,EAAiBC,EAAW,CACnD,OAAQD,EAAIC,EAAM,CAAC,EACbD,EAAIC,EAAM,CAAC,GAAK,EAChBD,EAAIC,EAAM,CAAC,GAAK,GAChBD,EAAIC,EAAM,CAAC,GAAK,MAAQ,CAChC,CAKM,IAAOC,GAAP,KAAuB,CACpB,IACA,IACA,IAEA,OAAS,WAAW,UAAU,SAErC,YAAaC,EAAkB,CAI7B,KAAK,IAAMA,EAKX,KAAK,IAAM,EAKX,KAAK,IAAMA,EAAO,MACpB,CAKA,QAAM,CACJ,IAAIC,EAAQ,WAM6C,GAJzDA,GAAS,KAAK,IAAI,KAAK,GAAG,EAAI,OAAS,EAAO,KAAK,IAAI,KAAK,KAAK,EAAI,MACrEA,GAASA,GAAS,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQ,KAAO,EAAO,KAAK,IAAI,KAAK,KAAK,EAAI,OACpFA,GAASA,GAAS,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQ,MAAQ,EAAO,KAAK,IAAI,KAAK,KAAK,EAAI,OACrFA,GAASA,GAAS,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQ,MAAQ,EAAO,KAAK,IAAI,KAAK,KAAK,EAAI,OACrFA,GAASA,GAAS,KAAK,IAAI,KAAK,GAAG,EAAI,KAAO,MAAQ,EAAO,KAAK,IAAI,KAAK,KAAK,EAAI,KAAO,OAAOA,EAElG,IAAK,KAAK,KAAO,GAAK,KAAK,IACzB,WAAK,IAAM,KAAK,IACVR,GAAgB,KAAM,EAAE,EAGhC,OAAOQ,CACT,CAKA,OAAK,CACH,OAAO,KAAK,OAAM,EAAK,CACzB,CAKA,QAAM,CACJ,IAAMA,EAAQ,KAAK,OAAM,EACzB,OAAOA,IAAU,EAAI,EAAEA,EAAQ,GAAK,CACtC,CAKA,MAAI,CACF,OAAO,KAAK,OAAM,IAAO,CAC3B,CAKA,SAAO,CACL,GAAI,KAAK,IAAM,EAAI,KAAK,IAAO,MAAMR,GAAgB,KAAM,CAAC,EAI5D,OAFYG,GAAe,KAAK,IAAK,KAAK,KAAO,CAAC,CAGpD,CAKA,UAAQ,CACN,GAAI,KAAK,IAAM,EAAI,KAAK,IACtB,MAAMH,GAAgB,KAAM,CAAC,EAK/B,OAFYG,GAAe,KAAK,IAAK,KAAK,KAAO,CAAC,EAAI,CAGxD,CAKA,OAAK,CACH,GAAI,KAAK,IAAM,EAAI,KAAK,IACtB,MAAMH,GAAgB,KAAM,CAAC,EAG/B,IAAMQ,EAAQC,GAAY,KAAK,IAAK,KAAK,GAAG,EAC5C,YAAK,KAAO,EACLD,CACT,CAKA,QAAM,CAEJ,GAAI,KAAK,IAAM,EAAI,KAAK,IAAO,MAAMR,GAAgB,KAAM,CAAC,EAE5D,IAAMQ,EAAQE,GAAa,KAAK,IAAK,KAAK,GAAG,EAC7C,YAAK,KAAO,EACLF,CACT,CAKA,OAAK,CACH,IAAMG,EAAS,KAAK,OAAM,EACpBC,EAAQ,KAAK,IACbP,EAAM,KAAK,IAAMM,EAGvB,GAAIN,EAAM,KAAK,IACb,MAAML,GAAgB,KAAMW,CAAM,EAGpC,YAAK,KAAOA,EAELC,IAAUP,EACb,IAAI,WAAW,CAAC,EAChB,KAAK,IAAI,SAASO,EAAOP,CAAG,CAClC,CAKA,QAAM,CACJ,IAAMQ,EAAQ,KAAK,MAAK,EACxB,OAAYC,GAAKD,EAAO,EAAGA,EAAM,MAAM,CACzC,CAKA,KAAMF,EAAe,CACnB,GAAI,OAAOA,GAAW,SAAU,CAE9B,GAAI,KAAK,IAAMA,EAAS,KAAK,IAAO,MAAMX,GAAgB,KAAMW,CAAM,EACtE,KAAK,KAAOA,CACd,KACE,GAEE,IAAI,KAAK,KAAO,KAAK,IACnB,MAAMX,GAAgB,IAAI,SAEpB,KAAK,IAAI,KAAK,KAAK,EAAI,OAAS,GAE5C,OAAO,IACT,CAKA,SAAUe,EAAgB,CACxB,OAAQA,EAAU,CAChB,IAAK,GACH,KAAK,KAAI,EACT,MACF,IAAK,GACH,KAAK,KAAK,CAAC,EACX,MACF,IAAK,GACH,KAAK,KAAK,KAAK,OAAM,CAAE,EACvB,MACF,IAAK,GACH,MAAQA,EAAW,KAAK,OAAM,EAAK,KAAO,GACxC,KAAK,SAASA,CAAQ,EAExB,MACF,IAAK,GACH,KAAK,KAAK,CAAC,EACX,MAGF,QACE,MAAM,MAAM,qBAAqBA,CAAQ,cAAc,KAAK,GAAG,EAAE,CACrE,CACA,OAAO,IACT,CAEQ,gBAAc,CAEpB,IAAMC,EAAO,IAAIC,GAAS,EAAG,CAAC,EAC1BC,EAAI,EACR,GAAI,KAAK,IAAM,KAAK,IAAM,EAAG,CAC3B,KAAOA,EAAI,EAAG,EAAEA,EAGd,GADAF,EAAK,IAAMA,EAAK,IAAM,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQE,EAAI,KAAO,EAC1D,KAAK,IAAI,KAAK,KAAK,EAAI,IAAO,OAAOF,EAK3C,GAFAA,EAAK,IAAMA,EAAK,IAAM,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQ,MAAQ,EAC3DA,EAAK,IAAMA,EAAK,IAAM,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQ,KAAO,EACtD,KAAK,IAAI,KAAK,KAAK,EAAI,IAAO,OAAOA,EACzCE,EAAI,CACN,KAAO,CACL,KAAOA,EAAI,EAAG,EAAEA,EAAG,CAEjB,GAAI,KAAK,KAAO,KAAK,IAAO,MAAMlB,GAAgB,IAAI,EAGtD,GADAgB,EAAK,IAAMA,EAAK,IAAM,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQE,EAAI,KAAO,EAC1D,KAAK,IAAI,KAAK,KAAK,EAAI,IAAO,OAAOF,CAC3C,CAEA,OAAAA,EAAK,IAAMA,EAAK,IAAM,KAAK,IAAI,KAAK,KAAK,EAAI,MAAQE,EAAI,KAAO,EACzDF,CACT,CACA,GAAI,KAAK,IAAM,KAAK,IAAM,GACxB,KAAOE,EAAI,EAAG,EAAEA,EAGd,GADAF,EAAK,IAAMA,EAAK,IAAM,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQE,EAAI,EAAI,KAAO,EAC9D,KAAK,IAAI,KAAK,KAAK,EAAI,IAAO,OAAOF,MAG3C,MAAOE,EAAI,EAAG,EAAEA,EAAG,CACjB,GAAI,KAAK,KAAO,KAAK,IACnB,MAAMlB,GAAgB,IAAI,EAK5B,GADAgB,EAAK,IAAMA,EAAK,IAAM,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQE,EAAI,EAAI,KAAO,EAC9D,KAAK,IAAI,KAAK,KAAK,EAAI,IAAO,OAAOF,CAC3C,CAGF,MAAM,MAAM,yBAAyB,CACvC,CAEQ,aAAW,CACjB,GAAI,KAAK,IAAM,EAAI,KAAK,IACtB,MAAMhB,GAAgB,KAAM,CAAC,EAG/B,IAAMmB,EAAKhB,GAAe,KAAK,IAAK,KAAK,KAAO,CAAC,EAC3CiB,EAAKjB,GAAe,KAAK,IAAK,KAAK,KAAO,CAAC,EAEjD,OAAO,IAAIc,GAASE,EAAIC,CAAE,CAC5B,CAKA,OAAK,CACH,OAAO,KAAK,eAAc,EAAG,SAAQ,CACvC,CAMA,aAAW,CACT,OAAO,KAAK,eAAc,EAAG,SAAQ,CACvC,CAKA,aAAW,CACT,OAAO,KAAK,eAAc,EAAG,SAAQ,CACvC,CAKA,QAAM,CACJ,OAAO,KAAK,eAAc,EAAG,SAAS,EAAI,CAC5C,CAMA,cAAY,CACV,IAAMZ,EAAQa,GAAiB,KAAK,IAAK,KAAK,GAAG,EACjD,YAAK,KAAOC,GAAed,CAAK,EACzBA,CACT,CAKA,cAAY,CACV,OAAO,KAAK,eAAc,EAAG,SAAS,EAAI,CAC5C,CAKA,QAAM,CACJ,OAAO,KAAK,eAAc,EAAG,SAAQ,EAAG,SAAQ,CAClD,CAMA,cAAY,CACV,OAAO,KAAK,eAAc,EAAG,SAAQ,EAAG,SAAQ,CAClD,CAMA,cAAY,CACV,OAAO,KAAK,eAAc,EAAG,SAAQ,EAAG,SAAQ,CAClD,CAKA,SAAO,CACL,OAAO,KAAK,YAAW,EAAG,SAAQ,CACpC,CAKA,eAAa,CACX,OAAO,KAAK,YAAW,EAAG,SAAQ,CACpC,CAKA,eAAa,CACX,OAAO,KAAK,YAAW,EAAG,SAAQ,CACpC,CAKA,UAAQ,CACN,OAAO,KAAK,YAAW,EAAG,SAAQ,CACpC,CAMA,gBAAc,CACZ,OAAO,KAAK,YAAW,EAAG,SAAQ,CACpC,CAKA,gBAAc,CACZ,OAAO,KAAK,YAAW,EAAG,SAAQ,CACpC,GAGI,SAAUe,GAAcnB,EAAgC,CAC5D,OAAO,IAAIE,GAAiBF,aAAe,WAAaA,EAAMA,EAAI,SAAQ,CAAE,CAC9E,CChYM,SAAUoB,EAAmBC,EAAkCC,EAAiCC,EAAuB,CAC3H,IAAMC,EAASC,GAAaJ,CAAG,EAE/B,OAAOC,EAAM,OAAOE,EAAQ,OAAWD,CAAI,CAC7C,CCRA,IAAAG,GAAuB,kBCAvB,IAAAC,GAAA,GAAAC,GAAAD,GAAA,YAAAE,KCAO,IAAMC,GAAQ,IAAI,WAAW,CAAC,EAW/B,SAAUC,GAAQC,EAAgBC,EAAc,CACpD,GAAID,IAAOC,EAAM,MAAO,GACxB,GAAID,EAAG,aAAeC,EAAG,WACvB,MAAO,GAGT,QAASC,EAAK,EAAGA,EAAKF,EAAG,WAAYE,IACnC,GAAIF,EAAGE,CAAE,IAAMD,EAAGC,CAAE,EAClB,MAAO,GAIX,MAAO,EACT,CAEM,SAAUC,GAAQC,EAA6C,CACnE,GAAIA,aAAa,YAAcA,EAAE,YAAY,OAAS,aAAgB,OAAOA,EAC7E,GAAIA,aAAa,YAAe,OAAO,IAAI,WAAWA,CAAC,EACvD,GAAI,YAAY,OAAOA,CAAC,EACtB,OAAO,IAAI,WAAWA,EAAE,OAAQA,EAAE,WAAYA,EAAE,UAAU,EAE5D,MAAM,IAAI,MAAM,mCAAmC,CACrD,CAMM,SAAUC,GAAYC,EAAW,CACrC,OAAO,IAAI,YAAW,EAAG,OAAOA,CAAG,CACrC,CAEM,SAAUC,GAAUC,EAAa,CACrC,OAAO,IAAI,YAAW,EAAG,OAAOA,CAAC,CACnC,CCnCA,SAASC,GAAMC,EAAUC,EAAI,CAC3B,GAAID,EAAS,QAAU,IAAO,MAAM,IAAI,UAAU,mBAAmB,EAErE,QADIE,EAAW,IAAI,WAAW,GAAG,EACxBC,EAAI,EAAGA,EAAID,EAAS,OAAQC,IACnCD,EAASC,CAAC,EAAI,IAEhB,QAASC,EAAI,EAAGA,EAAIJ,EAAS,OAAQI,IAAK,CACxC,IAAIC,EAAIL,EAAS,OAAOI,CAAC,EACrBE,EAAKD,EAAE,WAAW,CAAC,EACvB,GAAIH,EAASI,CAAE,IAAM,IAAO,MAAM,IAAI,UAAUD,EAAI,eAAe,EACnEH,EAASI,CAAE,EAAIF,CACjB,CACA,IAAIG,EAAOP,EAAS,OAChBQ,EAASR,EAAS,OAAO,CAAC,EAC1BS,EAAS,KAAK,IAAIF,CAAI,EAAI,KAAK,IAAI,GAAG,EACtCG,EAAU,KAAK,IAAI,GAAG,EAAI,KAAK,IAAIH,CAAI,EAI3C,SAASI,EAAQC,EAAM,CAOrB,GALIA,aAAkB,aAAuB,YAAY,OAAOA,CAAM,EACpEA,EAAS,IAAI,WAAWA,EAAO,OAAQA,EAAO,WAAYA,EAAO,UAAU,EAClE,MAAM,QAAQA,CAAM,IAC7BA,EAAS,WAAW,KAAKA,CAAM,IAE7B,EAAEA,aAAkB,YAAe,MAAM,IAAI,UAAU,qBAAqB,EAChF,GAAIA,EAAO,SAAW,EAAK,MAAO,GAMlC,QAJIC,EAAS,EACTC,EAAS,EACTC,EAAS,EACTC,EAAOJ,EAAO,OACXG,IAAWC,GAAQJ,EAAOG,CAAM,IAAM,GAC3CA,IACAF,IAMF,QAHII,GAASD,EAAOD,GAAUL,EAAU,IAAO,EAC3CQ,EAAM,IAAI,WAAWD,CAAI,EAEtBF,IAAWC,GAAM,CAItB,QAHIG,GAAQP,EAAOG,CAAM,EAErBX,GAAI,EACCgB,GAAMH,EAAO,GAAIE,KAAU,GAAKf,GAAIU,IAAYM,KAAQ,GAAKA,KAAOhB,KAC3Ee,IAAU,IAAMD,EAAIE,EAAG,IAAO,EAC9BF,EAAIE,EAAG,EAAKD,GAAQZ,IAAU,EAC9BY,GAASA,GAAQZ,IAAU,EAE7B,GAAIY,KAAU,EAAK,MAAM,IAAI,MAAM,gBAAgB,EACnDL,EAASV,GACTW,GACF,CAGA,QADIM,GAAMJ,EAAOH,EACVO,KAAQJ,GAAQC,EAAIG,EAAG,IAAM,GAClCA,KAIF,QADIC,EAAMd,EAAO,OAAOK,CAAM,EACvBQ,GAAMJ,EAAM,EAAEI,GAAOC,GAAOtB,EAAS,OAAOkB,EAAIG,EAAG,CAAC,EAC3D,OAAOC,CACT,CAIA,SAASC,EAAcX,EAAM,CAC3B,GAAI,OAAOA,GAAW,SAAY,MAAM,IAAI,UAAU,iBAAiB,EACvE,GAAIA,EAAO,SAAW,EAAK,OAAO,IAAI,WACtC,IAAIY,EAAM,EAEV,GAAIZ,EAAOY,CAAG,IAAM,IAIpB,SAFIX,EAAS,EACTC,EAAS,EACNF,EAAOY,CAAG,IAAMhB,GACrBK,IACAW,IAMF,QAHIP,GAAUL,EAAO,OAASY,GAAOf,EAAU,IAAO,EAClDgB,EAAO,IAAI,WAAWR,CAAI,EAEvBL,EAAOY,CAAG,GAAG,CAElB,IAAIL,EAAQjB,EAASU,EAAO,WAAWY,CAAG,CAAC,EAE3C,GAAIL,IAAU,IAAO,OAErB,QADIf,GAAI,EACCsB,GAAMT,EAAO,GAAIE,IAAU,GAAKf,GAAIU,IAAYY,KAAQ,GAAKA,KAAOtB,KAC3Ee,GAAUZ,EAAOkB,EAAKC,EAAG,IAAO,EAChCD,EAAKC,EAAG,EAAKP,EAAQ,MAAS,EAC9BA,EAASA,EAAQ,MAAS,EAE5B,GAAIA,IAAU,EAAK,MAAM,IAAI,MAAM,gBAAgB,EACnDL,EAASV,GACToB,GACF,CAEA,GAAIZ,EAAOY,CAAG,IAAM,IAGpB,SADIG,GAAMV,EAAOH,EACVa,KAAQV,GAAQQ,EAAKE,EAAG,IAAM,GACnCA,KAIF,QAFIC,GAAM,IAAI,WAAWf,GAAUI,EAAOU,GAAI,EAC1CxB,EAAIU,EACDc,KAAQV,GACbW,GAAIzB,GAAG,EAAIsB,EAAKE,IAAK,EAEvB,OAAOC,IACT,CAIA,SAASC,EAAQC,EAAM,CACrB,IAAIC,EAASR,EAAaO,CAAM,EAChC,GAAIC,EAAU,OAAOA,EACrB,MAAM,IAAI,MAAM,OAAO9B,CAAI,YAAY,CACzC,CACA,MAAO,CACL,OAAQU,EACR,aAAcY,EACd,OAAQM,EAEZ,CACA,IAAIG,GAAMjC,GAENkC,GAAkCD,GAEtCE,GAAeD,GCjIf,IAAME,GAAN,KAAa,CACF,KACA,OACA,WAET,YAAaC,EAAYC,EAAgBC,EAAoB,CAC3D,KAAK,KAAOF,EACZ,KAAK,OAASC,EACd,KAAK,WAAaC,CACpB,CAEA,OAAQC,EAAiB,CACvB,GAAIA,aAAiB,WACnB,MAAO,GAAG,KAAK,MAAM,GAAG,KAAK,WAAWA,CAAK,CAAC,GAE9C,MAAM,MAAM,mCAAmC,CAEnD,GAQIC,GAAN,KAAa,CACF,KACA,OACA,WACQ,gBAEjB,YAAaJ,EAAYC,EAAgBI,EAAoB,CAC3D,KAAK,KAAOL,EACZ,KAAK,OAASC,EACd,IAAMK,EAAkBL,EAAO,YAAY,CAAC,EAE5C,GAAIK,IAAoB,OACtB,MAAM,IAAI,MAAM,0BAA0B,EAE5C,KAAK,gBAAkBA,EACvB,KAAK,WAAaD,CACpB,CAEA,OAAQE,EAAY,CAClB,GAAI,OAAOA,GAAS,SAAU,CAC5B,GAAIA,EAAK,YAAY,CAAC,IAAM,KAAK,gBAC/B,MAAM,MAAM,qCAAqC,KAAK,UAAUA,CAAI,CAAC,KAAK,KAAK,IAAI,+CAA+C,KAAK,MAAM,EAAE,EAEjJ,OAAO,KAAK,WAAWA,EAAK,MAAM,KAAK,OAAO,MAAM,CAAC,CACvD,KACE,OAAM,MAAM,mCAAmC,CAEnD,CAEA,GAAgCC,EAAmE,CACjG,OAAOC,GAAG,KAAMD,CAAO,CACzB,GAKIE,GAAN,KAAqB,CACV,SAET,YAAaC,EAA0B,CACrC,KAAK,SAAWA,CAClB,CAEA,GAAiCH,EAAmE,CAClG,OAAOC,GAAG,KAAMD,CAAO,CACzB,CAEA,OAAQI,EAAa,CACnB,IAAMX,EAASW,EAAM,CAAC,EAChBJ,EAAU,KAAK,SAASP,CAAM,EACpC,GAAIO,GAAW,KACb,OAAOA,EAAQ,OAAOI,CAAK,EAE3B,MAAM,WAAW,qCAAqC,KAAK,UAAUA,CAAK,CAAC,+BAA+B,OAAO,KAAK,KAAK,QAAQ,CAAC,gBAAgB,CAExJ,GAGI,SAAUH,GAAyCI,EAA+CC,EAA8C,CACpJ,OAAO,IAAIJ,GAAgB,CACzB,GAAIG,EAAK,UAAY,CAAE,CAAEA,EAA2B,MAAM,EAAGA,CAAI,EACjE,GAAIC,EAAM,UAAY,CAAE,CAAEA,EAA4B,MAAM,EAAGA,CAAK,EAClD,CACtB,CAEM,IAAOC,GAAP,KAAY,CACP,KACA,OACA,WACA,WACA,QACA,QAET,YAAaf,EAAYC,EAAgBC,EAAsBG,EAAoB,CACjF,KAAK,KAAOL,EACZ,KAAK,OAASC,EACd,KAAK,WAAaC,EAClB,KAAK,WAAaG,EAClB,KAAK,QAAU,IAAIN,GAAQC,EAAMC,EAAQC,CAAU,EACnD,KAAK,QAAU,IAAIE,GAAQJ,EAAMC,EAAQI,CAAU,CACrD,CAEA,OAAQO,EAAiB,CACvB,OAAO,KAAK,QAAQ,OAAOA,CAAK,CAClC,CAEA,OAAQA,EAAa,CACnB,OAAO,KAAK,QAAQ,OAAOA,CAAK,CAClC,GAGI,SAAUI,GAAmD,CAAE,KAAAhB,EAAM,OAAAC,EAAQ,OAAAgB,EAAQ,OAAAC,CAAM,EAAsE,CACrK,OAAO,IAAIH,GAAMf,EAAMC,EAAQgB,EAAQC,CAAM,CAC/C,CAEM,SAAUC,GAAoD,CAAE,KAAAnB,EAAM,OAAAC,EAAQ,SAAAmB,CAAQ,EAAoD,CAC9I,GAAM,CAAE,OAAAH,EAAQ,OAAAC,CAAM,EAAKG,GAAMD,EAAUpB,CAAI,EAC/C,OAAOgB,GAAK,CACV,OAAAf,EACA,KAAAD,EACA,OAAAiB,EACA,OAASV,GAA6Be,GAAOJ,EAAOX,CAAI,CAAC,EAC1D,CACH,CAEA,SAASW,GAAQK,EAAgBC,EAAqCC,EAAqBzB,EAAY,CAErG,IAAI0B,EAAMH,EAAO,OACjB,KAAOA,EAAOG,EAAM,CAAC,IAAM,KACzB,EAAEA,EAIJ,IAAMC,EAAM,IAAI,WAAYD,EAAMD,EAAc,EAAK,CAAC,EAGlDG,EAAO,EACPC,EAAS,EACTC,EAAU,EACd,QAASC,EAAI,EAAGA,EAAIL,EAAK,EAAEK,EAAG,CAE5B,IAAMC,EAAQR,EAAYD,EAAOQ,CAAC,CAAC,EACnC,GAAIC,IAAU,OACZ,MAAM,IAAI,YAAY,OAAOhC,CAAI,YAAY,EAI/C6B,EAAUA,GAAUJ,EAAeO,EACnCJ,GAAQH,EAGJG,GAAQ,IACVA,GAAQ,EACRD,EAAIG,GAAS,EAAI,IAAQD,GAAUD,EAEvC,CAGA,GAAIA,GAAQH,IAAgB,IAAQI,GAAW,EAAID,KAAY,EAC7D,MAAM,IAAI,YAAY,wBAAwB,EAGhD,OAAOD,CACT,CAEA,SAASV,GAAQgB,EAAkBb,EAAkBK,EAAmB,CACtE,IAAMS,EAAMd,EAASA,EAAS,OAAS,CAAC,IAAM,IACxCe,GAAQ,GAAKV,GAAe,EAC9BE,EAAM,GAENC,EAAO,EACPC,EAAS,EACb,QAASE,EAAI,EAAGA,EAAIE,EAAK,OAAQ,EAAEF,EAMjC,IAJAF,EAAUA,GAAU,EAAKI,EAAKF,CAAC,EAC/BH,GAAQ,EAGDA,EAAOH,GACZG,GAAQH,EACRE,GAAOP,EAASe,EAAQN,GAAUD,CAAK,EAU3C,GALIA,IAAS,IACXD,GAAOP,EAASe,EAAQN,GAAWJ,EAAcG,CAAM,GAIrDM,EACF,MAASP,EAAI,OAASF,EAAe,KAAO,GAC1CE,GAAO,IAIX,OAAOA,CACT,CAEA,SAASS,GAAmBhB,EAAgB,CAE1C,IAAMI,EAAsC,CAAA,EAC5C,QAASO,EAAI,EAAGA,EAAIX,EAAS,OAAQ,EAAEW,EACrCP,EAAYJ,EAASW,CAAC,CAAC,EAAIA,EAE7B,OAAOP,CACT,CAKM,SAAUa,EAAsD,CAAE,KAAArC,EAAM,OAAAC,EAAQ,YAAAwB,EAAa,SAAAL,CAAQ,EAAyE,CAClL,IAAMI,EAAcY,GAAkBhB,CAAQ,EAC9C,OAAOJ,GAAK,CACV,OAAAf,EACA,KAAAD,EACA,OAAQY,EAAiB,CACvB,OAAOK,GAAOL,EAAOQ,EAAUK,CAAW,CAC5C,EACA,OAAQb,EAAa,CACnB,OAAOM,GAAON,EAAOY,EAAaC,EAAazB,CAAI,CACrD,EACD,CACH,CH9OO,IAAMsC,GAASC,GAAM,CAC1B,OAAQ,IACR,KAAM,SACN,SAAU,aACX,EIND,IAAAC,GAAA,GAAAC,GAAAD,GAAA,YAAAE,GAAA,gBAAAC,KAEO,IAAMC,GAASC,EAAQ,CAC5B,OAAQ,IACR,KAAM,SACN,SAAU,mBACV,YAAa,EACd,EAEYC,GAAcD,EAAQ,CACjC,OAAQ,IACR,KAAM,cACN,SAAU,mBACV,YAAa,EACd,ECdD,IAAAE,GAAA,GAAAC,GAAAD,GAAA,WAAAE,KAEO,IAAMC,GAAQC,EAAQ,CAC3B,OAAQ,IACR,KAAM,QACN,SAAU,KACV,YAAa,EACd,ECPD,IAAAC,GAAA,GAAAC,GAAAD,GAAA,kBAAAE,KAEA,IAAMC,GAAW,MAAM,KAAK,orEAAwe,EAC9fC,GAAkCD,GAAS,OAAiB,CAACE,EAAGC,EAAGC,KAAQF,EAAEE,CAAC,EAAID,EAAUD,GAAM,CAAA,CAAG,EACrGG,GAAkCL,GAAS,OAAiB,CAACE,EAAGC,EAAGC,IAAK,CAC5E,IAAME,EAAYH,EAAE,YAAY,CAAC,EACjC,GAAIG,GAAa,KACf,MAAM,IAAI,MAAM,sBAAsBH,CAAC,EAAE,EAE3C,OAAAD,EAAEI,CAAS,EAAIF,EACRF,CACT,EAAI,CAAA,CAAG,EAEP,SAASK,GAAQC,EAAgB,CAC/B,OAAOA,EAAK,OAAO,CAACN,EAAGC,KACrBD,GAAKD,GAAqBE,CAAC,EACpBD,GACN,EAAE,CACP,CAEA,SAASO,GAAQC,EAAW,CAC1B,IAAMC,EAAO,CAAA,EACb,QAAWC,KAAQF,EAAK,CACtB,IAAMJ,EAAYM,EAAK,YAAY,CAAC,EACpC,GAAIN,GAAa,KACf,MAAM,IAAI,MAAM,sBAAsBM,CAAI,EAAE,EAE9C,IAAMC,EAAMR,GAAqBC,CAAS,EAC1C,GAAIO,GAAO,KACT,MAAM,IAAI,MAAM,+BAA+BD,CAAI,EAAE,EAEvDD,EAAK,KAAKE,CAAG,CACf,CACA,OAAO,IAAI,WAAWF,CAAI,CAC5B,CAEO,IAAMG,GAAeC,GAAK,CAC/B,OAAQ,YACR,KAAM,eACN,OAAAR,GACA,OAAAE,GACD,ECzCD,IAAAO,GAAA,GAAAC,GAAAD,GAAA,YAAAE,GAAA,cAAAC,GAAA,iBAAAC,GAAA,sBAAAC,GAAA,mBAAAC,GAAA,cAAAC,GAAA,mBAAAC,GAAA,gBAAAC,GAAA,YAAAC,KAEO,IAAMC,GAASC,EAAQ,CAC5B,OAAQ,IACR,KAAM,SACN,SAAU,mCACV,YAAa,EACd,EAEYC,GAAcD,EAAQ,CACjC,OAAQ,IACR,KAAM,cACN,SAAU,mCACV,YAAa,EACd,EAEYE,GAAYF,EAAQ,CAC/B,OAAQ,IACR,KAAM,YACN,SAAU,oCACV,YAAa,EACd,EAEYG,GAAiBH,EAAQ,CACpC,OAAQ,IACR,KAAM,iBACN,SAAU,oCACV,YAAa,EACd,EAEYI,GAAYJ,EAAQ,CAC/B,OAAQ,IACR,KAAM,YACN,SAAU,mCACV,YAAa,EACd,EAEYK,GAAiBL,EAAQ,CACpC,OAAQ,IACR,KAAM,iBACN,SAAU,mCACV,YAAa,EACd,EAEYM,GAAeN,EAAQ,CAClC,OAAQ,IACR,KAAM,eACN,SAAU,oCACV,YAAa,EACd,EAEYO,GAAoBP,EAAQ,CACvC,OAAQ,IACR,KAAM,oBACN,SAAU,oCACV,YAAa,EACd,EAEYQ,GAAUR,EAAQ,CAC7B,OAAQ,IACR,KAAM,UACN,SAAU,mCACV,YAAa,EACd,EC/DD,IAAAS,GAAA,GAAAC,GAAAD,GAAA,YAAAE,GAAA,gBAAAC,KAEO,IAAMC,GAASC,GAAM,CAC1B,OAAQ,IACR,KAAM,SACN,SAAU,uCACX,EAEYC,GAAcD,GAAM,CAC/B,OAAQ,IACR,KAAM,cACN,SAAU,uCACX,ECZD,IAAAE,GAAA,GAAAC,GAAAD,GAAA,eAAAE,EAAA,iBAAAC,KAEO,IAAMC,EAAYC,GAAM,CAC7B,KAAM,YACN,OAAQ,IACR,SAAU,6DACX,EAEYC,GAAeD,GAAM,CAChC,KAAM,eACN,OAAQ,IACR,SAAU,6DACX,ECZD,IAAAE,GAAA,GAAAC,GAAAD,GAAA,YAAAE,GAAA,cAAAC,GAAA,cAAAC,GAAA,iBAAAC,KAEO,IAAMC,GAASC,EAAQ,CAC5B,OAAQ,IACR,KAAM,SACN,SAAU,mEACV,YAAa,EACd,EAEYC,GAAYD,EAAQ,CAC/B,OAAQ,IACR,KAAM,YACN,SAAU,oEACV,YAAa,EACd,EAEYE,GAAYF,EAAQ,CAC/B,OAAQ,IACR,KAAM,YACN,SAAU,mEACV,YAAa,EACd,EAEYG,GAAeH,EAAQ,CAClC,OAAQ,IACR,KAAM,eACN,SAAU,oEACV,YAAa,EACd,EC5BD,IAAAI,GAAA,GAAAC,GAAAD,GAAA,WAAAE,KAEO,IAAMC,GAAQC,EAAQ,CAC3B,OAAQ,IACR,KAAM,QACN,SAAU,WACV,YAAa,EACd,ECPD,IAAAC,GAAA,GAAAC,GAAAD,GAAA,cAAAE,KAGO,IAAMC,GAAWC,GAAK,CAC3B,OAAQ,KACR,KAAM,WACN,OAASC,GAAQC,GAASD,CAAG,EAC7B,OAASE,GAAQC,GAAWD,CAAG,EAChC,ECND,IAAME,GAAc,IAAI,YAClBC,GAAc,IAAI,YCHxB,IAAAC,GAAA,GAAAC,GAAAD,GAAA,cAAAE,KCCA,IAAIC,GAAWC,GAEXC,GAAM,IACNC,GAAO,IACPC,GAAS,CAACD,GACVE,GAAM,KAAK,IAAI,EAAG,EAAE,EAOxB,SAASJ,GAAOK,EAAKC,EAAKC,EAAM,CAC9BD,EAAMA,GAAO,CAAA,EACbC,EAASA,GAAU,EAGnB,QAFIC,EAAYD,EAEVF,GAAOD,IACXE,EAAIC,GAAQ,EAAKF,EAAM,IAAQJ,GAC/BI,GAAO,IAET,KAAMA,EAAMF,IACVG,EAAIC,GAAQ,EAAKF,EAAM,IAAQJ,GAC/BI,KAAS,EAEX,OAAAC,EAAIC,CAAM,EAAIF,EAAM,EAGpBL,GAAO,MAAQO,EAASC,EAAY,EAE7BF,CACT,CAEA,IAAIG,GAASC,GAETC,GAAQ,IACRC,GAAS,IAMb,SAASF,GAAKG,EAAKN,EAAM,CACvB,IAAIO,EAAS,EACTP,EAASA,GAAU,EACnBQ,EAAS,EACTC,EAAUT,EACVU,EACAC,EAAIL,EAAI,OAEZ,EAAG,CACD,GAAIG,GAAWE,EAEb,MAAAR,GAAK,MAAQ,EACP,IAAI,WAAW,yBAAyB,EAEhDO,EAAIJ,EAAIG,GAAS,EACjBF,GAAOC,EAAQ,IACVE,EAAIL,KAAWG,GACfE,EAAIL,IAAU,KAAK,IAAI,EAAGG,CAAK,EACpCA,GAAS,CACX,OAASE,GAAKN,IAGd,OAAAD,GAAK,MAAQM,EAAUT,EAEhBO,CACT,CAEA,IAAIK,GAAK,KAAK,IAAI,EAAI,CAAC,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EAEnBC,GAAS,SAAgCC,EAAK,CAChD,OACEA,EAAQV,GAAK,EACbU,EAAQT,GAAK,EACbS,EAAQR,GAAK,EACbQ,EAAQP,GAAK,EACbO,EAAQN,GAAK,EACbM,EAAQL,GAAK,EACbK,EAAQJ,GAAK,EACbI,EAAQH,GAAK,EACbG,EAAQF,GAAK,EACA,EAEjB,EAEIG,GAAS,CACT,OAAQ/B,GACR,OAAQU,GACR,eAAgBmB,IAGhBG,GAAeD,GAEnBE,GAAeD,GCrGT,SAAUE,GAAQC,EAAkBC,EAAS,EAAC,CAElD,MAAO,CADMC,GAAO,OAAOF,EAAMC,CAAM,EACzBC,GAAO,OAAO,KAAK,CACnC,CAEM,SAAUC,GAAUC,EAAaC,EAAoBJ,EAAS,EAAC,CACnE,OAAAC,GAAO,OAAOE,EAAKC,EAAQJ,CAAM,EAC1BI,CACT,CAEM,SAAUC,GAAgBF,EAAW,CACzC,OAAOF,GAAO,eAAeE,CAAG,CAClC,CCPM,SAAUG,GAA8BC,EAAYC,EAAkB,CAC1E,IAAMC,EAAOD,EAAO,WACdE,EAAoBC,GAAeJ,CAAI,EACvCK,EAAeF,EAAoBC,GAAeF,CAAI,EAEtDI,EAAQ,IAAI,WAAWD,EAAeH,CAAI,EAChD,OAAOK,GAASP,EAAMM,EAAO,CAAC,EACvBC,GAASL,EAAMI,EAAOH,CAAU,EACvCG,EAAM,IAAIL,EAAQI,CAAY,EAEvB,IAAIG,GAAOR,EAAME,EAAMD,EAAQK,CAAK,CAC7C,CAKM,SAAUG,GAAQC,EAAqB,CAC3C,IAAMJ,EAAQK,GAAOD,CAAS,EACxB,CAACV,EAAMG,CAAU,EAAWM,GAAOH,CAAK,EACxC,CAACJ,EAAMG,CAAY,EAAWI,GAAOH,EAAM,SAASH,CAAU,CAAC,EAC/DF,EAASK,EAAM,SAASH,EAAaE,CAAY,EAEvD,GAAIJ,EAAO,aAAeC,EACxB,MAAM,IAAI,MAAM,kBAAkB,EAGpC,OAAO,IAAIM,GAAOR,EAAME,EAAMD,EAAQK,CAAK,CAC7C,CAEM,SAAUM,GAAQC,EAAoBC,EAAU,CACpD,GAAID,IAAMC,EACR,MAAO,GACF,CACL,IAAMC,EAAOD,EAEb,OACED,EAAE,OAASE,EAAK,MAChBF,EAAE,OAASE,EAAK,MAChBA,EAAK,iBAAiB,YACtBH,GAAWC,EAAE,MAAOE,EAAK,KAAK,CAElC,CACF,CAMM,IAAOP,GAAP,KAAa,CACR,KACA,KACA,OACA,MAKT,YAAaR,EAAYE,EAAYD,EAAoBK,EAAiB,CACxE,KAAK,KAAON,EACZ,KAAK,KAAOE,EACZ,KAAK,OAASD,EACd,KAAK,MAAQK,CACf,GHjEF,IAAMU,GAAY,EACZC,GAAO,WAEPC,GAA4CC,GAElD,SAASC,GAAQC,EAAmBC,EAAuB,CACzD,GAAIA,GAAS,UAAY,MAAQA,EAAQ,WAAaD,EAAM,WAAY,CACtE,GAAIC,EAAQ,SAAW,GAAKA,EAAQ,SAAWD,EAAM,WACnD,MAAM,IAAI,MAAM,0DAA0DA,EAAM,UAAU,EAAE,EAG9FA,EAAQA,EAAM,SAAS,EAAGC,EAAQ,QAAQ,CAC5C,CAEA,OAAcC,GAAOP,GAAME,GAAOG,CAAK,CAAC,CAC1C,CAEO,IAAMG,GAAW,CAAE,KAAAR,GAAM,KAAAC,GAAM,OAAAC,GAAQ,OAAAE,EAAM,EIrBpD,IAAAK,GAAA,GAAAC,GAAAD,GAAA,YAAAE,GAAA,WAAAC,KAAA,IAAAC,GAAmB,mBCKnB,IAAMC,GAA4B,GAqB5B,SAAUC,GAAiD,CAAE,KAAAC,EAAM,KAAAC,EAAM,OAAAC,EAAQ,gBAAAC,EAAiB,gBAAAC,CAAe,EAA0B,CAC/I,OAAO,IAAIC,GAAOL,EAAMC,EAAMC,EAAQC,EAAiBC,CAAe,CACxE,CAoBM,IAAOC,GAAP,KAAa,CACR,KACA,KACA,OACA,gBACA,gBAET,YAAaL,EAAYC,EAAYC,EAAkDC,EAA0BC,EAAwB,CACvI,KAAK,KAAOJ,EACZ,KAAK,KAAOC,EACZ,KAAK,OAASC,EACd,KAAK,gBAAkBC,GAAmBL,GAC1C,KAAK,gBAAkBM,CACzB,CAEA,OAAQE,EAAmBC,EAAuB,CAChD,GAAIA,GAAS,UAAY,KAAM,CAC7B,GAAIA,EAAQ,SAAW,KAAK,gBAC1B,MAAM,IAAI,MAAM,6DAA6D,KAAK,eAAe,EAAE,EAGrG,GAAI,KAAK,iBAAmB,MAAQA,EAAQ,SAAW,KAAK,gBAC1D,MAAM,IAAI,MAAM,0DAA0D,KAAK,eAAe,EAAE,CAEpG,CAEA,GAAID,aAAiB,WAAY,CAC/B,IAAME,EAAS,KAAK,OAAOF,CAAK,EAEhC,OAAIE,aAAkB,WACbC,GAAaD,EAAQ,KAAK,KAAMD,GAAS,QAAQ,EAGnDC,EAAO,KAAKE,GAAUD,GAAaC,EAAQ,KAAK,KAAMH,GAAS,QAAQ,CAAC,CACjF,KACE,OAAM,MAAM,mCAAmC,CAGnD,GAOF,SAASE,GAAoCC,EAAoBT,EAAYU,EAAiB,CAC5F,GAAIA,GAAY,MAAQA,IAAaD,EAAO,WAAY,CACtD,GAAIC,EAAWD,EAAO,WACpB,MAAM,IAAI,MAAM,0DAA0DA,EAAO,UAAU,EAAE,EAG/FA,EAASA,EAAO,SAAS,EAAGC,CAAQ,CACtC,CAEA,OAAcC,GAAOX,EAAMS,CAAM,CACnC,CDnGO,IAAMG,GAASC,GAAK,CACzB,KAAM,WACN,KAAM,GACN,OAASC,GAAUC,GAAO,GAAAC,QAAO,WAAW,QAAQ,EAAE,OAAOF,CAAK,EAAE,OAAM,CAAE,EAC7E,EAEYG,GAASJ,GAAK,CACzB,KAAM,WACN,KAAM,GACN,OAAQC,GAASC,GAAO,GAAAC,QAAO,WAAW,QAAQ,EAAE,OAAOF,CAAK,EAAE,OAAM,CAAE,EAC3E,EEHK,SAAUI,GAA0FC,EAASC,EAAmC,CACpJ,GAAM,CAAE,MAAAC,EAAO,QAAAC,CAAO,EAAKH,EAC3B,OAAQG,EAAS,CACf,IAAK,GACH,OAAOC,GACLF,EACAG,GAAUL,CAAI,EACdC,GAAqCK,EAAU,OAAO,EAE1D,QACE,OAAOC,GACLL,EACAG,GAAUL,CAAI,EACbC,GAAQO,GAAO,OAAwC,CAE9D,CACF,CAYA,IAAMC,GAAQ,IAAI,QAElB,SAASC,GAAWC,EAAoB,CACtC,IAAMD,EAAYD,GAAM,IAAIE,CAAG,EAC/B,GAAID,GAAa,KAAM,CACrB,IAAMA,EAAY,IAAI,IACtB,OAAAD,GAAM,IAAIE,EAAKD,CAAS,EACjBA,CACT,CACA,OAAOA,CACT,CAEM,IAAOE,GAAP,MAAOC,CAAG,CACL,KACA,QACA,UACA,MACA,IAOT,YAAaC,EAAkBC,EAAcC,EAAqCC,EAAiB,CACjG,KAAK,KAAOF,EACZ,KAAK,QAAUD,EACf,KAAK,UAAYE,EACjB,KAAK,MAAQC,EAIb,KAAK,GAAG,EAAIA,CACd,CAQA,IAAI,OAAK,CACP,OAAO,IACT,CAGA,IAAI,YAAU,CACZ,OAAO,KAAK,MAAM,UACpB,CAGA,IAAI,YAAU,CACZ,OAAO,KAAK,MAAM,UACpB,CAEA,MAAI,CACF,OAAQ,KAAK,QAAS,CACpB,IAAK,GACH,OAAO,KAET,IAAK,GAAG,CACN,GAAM,CAAE,KAAAF,EAAM,UAAAC,CAAS,EAAK,KAE5B,GAAID,IAASG,GACX,MAAM,IAAI,MAAM,0CAA0C,EAI5D,GAAIF,EAAU,OAASG,GACrB,MAAM,IAAI,MAAM,oDAAoD,EAGtE,OACEN,EAAI,SACFG,CAA6C,CAGnD,CACA,QACE,MAAM,MACJ,+BAA+B,KAAK,OAAO,4CAA4C,CAG7F,CACF,CAEA,MAAI,CACF,OAAQ,KAAK,QAAS,CACpB,IAAK,GAAG,CACN,GAAM,CAAE,KAAAD,EAAM,OAAAK,CAAM,EAAK,KAAK,UACxBJ,EAAmBK,GAAON,EAAMK,CAAM,EAC5C,OACEP,EAAI,SAAS,KAAK,KAAMG,CAAS,CAErC,CACA,IAAK,GACH,OAAO,KAET,QACE,MAAM,MACJ,+BAA+B,KAAK,OAAO,4CAA4C,CAG7F,CACF,CAEA,OAAQM,EAAc,CACpB,OAAOT,EAAI,OAAO,KAAMS,CAAK,CAC/B,CAEA,OAAO,OAAsFC,EAA4CD,EAAc,CACrJ,IAAME,EAAUF,EAChB,OACEE,GAAW,MACXD,EAAK,OAASC,EAAQ,MACtBD,EAAK,UAAYC,EAAQ,SAClBC,GAAOF,EAAK,UAAWC,EAAQ,SAAS,CAEnD,CAEA,SAAUE,EAAmC,CAC3C,OAAOC,GAAO,KAAMD,CAAI,CAC1B,CAEA,QAAM,CACJ,MAAO,CAAE,IAAKC,GAAO,IAAI,CAAC,CAC5B,CAEA,MAAI,CACF,OAAO,IACT,CAES,CAAC,OAAO,WAAW,EAAI,MAIhC,CAAC,OAAO,IAAI,4BAA4B,CAAC,GAAC,CACxC,MAAO,OAAO,KAAK,SAAQ,CAAE,GAC/B,CAYA,OAAO,MAAwFC,EAA+C,CAC5I,GAAIA,GAAS,KACX,OAAO,KAGT,IAAMC,EAAQD,EACd,GAAIC,aAAiBhB,EAEnB,OAAOgB,EACF,GAAKA,EAAM,GAAG,GAAK,MAAQA,EAAM,GAAG,IAAMA,EAAM,OAAUA,EAAM,QAAUA,EAAO,CAMtF,GAAM,CAAE,QAAAf,EAAS,KAAAC,EAAM,UAAAC,EAAW,MAAAC,CAAK,EAAKY,EAC5C,OAAO,IAAIhB,EACTC,EACAC,EACAC,EACAC,GAASa,GAAUhB,EAASC,EAAMC,EAAU,KAAK,CAAC,CAEtD,SAAWa,EAAME,EAAS,IAAM,GAAM,CAIpC,GAAM,CAAE,QAAAjB,EAAS,UAAAE,EAAW,KAAAD,CAAI,EAAKc,EAC/BT,EAAgBY,GAAOhB,CAAS,EACtC,OAAOH,EAAI,OAAOC,EAASC,EAAMK,CAAM,CACzC,KAGE,QAAO,IAEX,CAOA,OAAO,OAAsFN,EAAkBC,EAAcK,EAAgC,CAC3J,GAAI,OAAOL,GAAS,SAClB,MAAM,IAAI,MAAM,uCAAuC,EAGzD,GAAI,EAAEK,EAAO,iBAAiB,YAC5B,MAAM,IAAI,MAAM,gBAAgB,EAGlC,OAAQN,EAAS,CACf,IAAK,GAAG,CACN,GAAIC,IAASG,GACX,MAAM,IAAI,MACR,wCAAwCA,EAAW,kBAAkB,EAGvE,OAAO,IAAIL,EAAIC,EAASC,EAAMK,EAAQA,EAAO,KAAK,CAEtD,CACA,IAAK,GAAG,CACN,IAAMH,EAAQa,GAAUhB,EAASC,EAAMK,EAAO,KAAK,EACnD,OAAO,IAAIP,EAAIC,EAASC,EAAMK,EAAQH,CAAK,CAC7C,CACA,QACE,MAAM,IAAI,MAAM,iBAAiB,CAErC,CACF,CAKA,OAAO,SAAuBG,EAAgD,CAC5E,OAAOP,EAAI,OAAO,EAAGK,GAAaE,CAAM,CAC1C,CAQA,OAAO,SAAyDL,EAAYK,EAAgC,CAC1G,OAAOP,EAAI,OAAO,EAAGE,EAAMK,CAAM,CACnC,CASA,OAAO,OAAoFH,EAAuD,CAChJ,GAAM,CAACN,EAAKsB,CAAS,EAAIpB,EAAI,YAAYI,CAAK,EAC9C,GAAIgB,EAAU,SAAW,EACvB,MAAM,IAAI,MAAM,kBAAkB,EAEpC,OAAOtB,CACT,CAWA,OAAO,YAA2EM,EAAyC,CACzH,IAAMiB,EAAQrB,EAAI,aAAaI,CAAK,EAC9BkB,EAAaD,EAAM,KAAOA,EAAM,cAChCE,EAAiBC,GACrBpB,EAAM,SAASkB,EAAYA,EAAaD,EAAM,aAAa,CAAC,EAE9D,GAAIE,EAAe,aAAeF,EAAM,cACtC,MAAM,IAAI,MAAM,kBAAkB,EAEpC,IAAMI,EAAcF,EAAe,SACjCF,EAAM,cAAgBA,EAAM,UAAU,EAElCd,EAAS,IAAWmB,GACxBL,EAAM,cACNA,EAAM,WACNI,EACAF,CAAc,EAMhB,MAAO,CAHLF,EAAM,UAAY,EACdrB,EAAI,SAASO,CAA0C,EACvDP,EAAI,SAASqB,EAAM,MAAOd,CAAM,EACNH,EAAM,SAASiB,EAAM,IAAI,CAAC,CAC5D,CAWA,OAAO,aAA4EM,EAAgD,CACjI,IAAIC,EAAS,EACPC,EAAO,IAAa,CACxB,GAAM,CAACC,EAAGC,CAAM,EAAWZ,GAAOQ,EAAa,SAASC,CAAM,CAAC,EAC/D,OAAAA,GAAUG,EACHD,CACT,EAEI7B,EAAU4B,EAAI,EACdG,EAAQ3B,GASZ,GARIJ,IAAsB,IAExBA,EAAU,EACV2B,EAAS,GAETI,EAAQH,EAAI,EAGV5B,IAAY,GAAKA,IAAY,EAC/B,MAAM,IAAI,WAAW,uBAAuBA,CAAO,EAAE,EAGvD,IAAMqB,EAAaM,EACbK,EAAgBJ,EAAI,EACpBK,EAAaL,EAAI,EACjBM,EAAOP,EAASM,EAChBE,EAAgBD,EAAOb,EAE7B,MAAO,CAAE,QAAArB,EAAS,MAAA+B,EAAO,cAAAC,EAAe,WAAAC,EAAY,cAAAE,EAAe,KAAAD,CAAI,CACzE,CAQA,OAAO,MAA0GE,EAAkExB,EAAmC,CACpN,GAAM,CAACyB,EAAQlC,CAAK,EAAImC,GAAgBF,EAAQxB,CAAI,EAE9Cf,EAAME,EAAI,OAAOI,CAAK,EAE5B,GAAIN,EAAI,UAAY,GAAKuC,EAAO,CAAC,IAAM,IACrC,MAAM,MAAM,wDAAwD,EAItE,OAAAxC,GAAUC,CAAG,EAAE,IAAIwC,EAAQD,CAAM,EAE1BvC,CACT,GAGF,SAASyC,GAAqHF,EAAkExB,EAAmC,CACjO,OAAQwB,EAAO,CAAC,EAAG,CAEjB,IAAK,IAAK,CACR,IAAMG,EAAU3B,GAAQ4B,EACxB,MAAO,CACLA,EAAU,OACVD,EAAQ,OAAO,GAAGC,EAAU,MAAM,GAAGJ,CAAM,EAAE,EAEjD,CACA,KAAKI,EAAU,OAAQ,CACrB,IAAMD,EAAU3B,GAAQ4B,EACxB,MAAO,CAACA,EAAU,OAAkBD,EAAQ,OAAOH,CAAM,CAAC,CAC5D,CACA,KAAKK,GAAO,OAAQ,CAClB,IAAMF,EAAU3B,GAAQ6B,GACxB,MAAO,CAACA,GAAO,OAAkBF,EAAQ,OAAOH,CAAM,CAAC,CACzD,CACA,KAAKM,GAAO,OAAQ,CAClB,IAAMH,EAAU3B,GAAQ8B,GACxB,MAAO,CAACA,GAAO,OAAkBH,EAAQ,OAAOH,CAAM,CAAC,CACzD,CACA,QAAS,CACP,GAAIxB,GAAQ,KACV,MAAM,MACJ,yFAAyF,EAG7F,MAAO,CAACwB,EAAO,CAAC,EAAaxB,EAAK,OAAOwB,CAAM,CAAC,CAClD,CACF,CACF,CAEA,SAASO,GAAYxC,EAAmBR,EAA4BiB,EAA+B,CACjG,GAAM,CAAE,OAAAyB,CAAM,EAAKzB,EACnB,GAAIyB,IAAWG,EAAU,OACvB,MAAM,MAAM,8BAA8B5B,EAAK,IAAI,WAAW,EAGhE,IAAMf,EAAMF,EAAM,IAAI0C,CAAM,EAC5B,GAAIxC,GAAO,KAAM,CACf,IAAMA,EAAMe,EAAK,OAAOT,CAAK,EAAE,MAAM,CAAC,EACtC,OAAAR,EAAM,IAAI0C,EAAQxC,CAAG,EACdA,CACT,KACE,QAAOA,CAEX,CAEA,SAAS+C,GAAoCzC,EAAmBR,EAA4BiB,EAAkC,CAC5H,GAAM,CAAE,OAAAyB,CAAM,EAAKzB,EACbf,EAAMF,EAAM,IAAI0C,CAAM,EAC5B,GAAIxC,GAAO,KAAM,CACf,IAAMA,EAAMe,EAAK,OAAOT,CAAK,EAC7B,OAAAR,EAAM,IAAI0C,EAAQxC,CAAG,EACdA,CACT,KACE,QAAOA,CAEX,CAEA,IAAMO,GAAc,IACdC,GAAe,GAErB,SAASW,GAAWhB,EAAsBC,EAAcC,EAAqB,CAC3E,IAAM2C,EAAoBC,GAAe9C,CAAO,EAC1C+C,EAAaF,EAAoBC,GAAe7C,CAAI,EACpDE,EAAQ,IAAI,WAAW4C,EAAa7C,EAAU,UAAU,EAC9D,OAAO8C,GAAShD,EAASG,EAAO,CAAC,EAC1B6C,GAAS/C,EAAME,EAAO0C,CAAU,EACvC1C,EAAM,IAAID,EAAW6C,CAAU,EACxB5C,CACT,CAEA,IAAMc,GAAY,OAAO,IAAI,kBAAkB,EC7bxC,IAAMgC,GAAQ,CAAE,GAAGC,GAAc,GAAGC,GAAO,GAAGC,GAAO,GAAGC,GAAQ,GAAGC,GAAQ,GAAGC,GAAQ,GAAGC,GAAQ,GAAGC,GAAQ,GAAGC,GAAQ,GAAGC,EAAY,EAChIC,GAAS,CAAE,GAAGC,GAAM,GAAGX,EAAQ,ECb5C,SAASY,GAAaC,EAAcC,EAAgBC,EAAqCC,EAAmC,CAC1H,MAAO,CACL,KAAAH,EACA,OAAAC,EACA,QAAS,CACP,KAAAD,EACA,OAAAC,EACA,OAAAC,GAEF,QAAS,CACP,OAAAC,GAGN,CAEA,IAAMC,GAASL,GAAY,OAAQ,IAAMM,GAEhC,IADS,IAAI,YAAY,MAAM,EACjB,OAAOA,CAAG,EAC7BC,GACc,IAAI,YAAW,EAChB,OAAOA,EAAI,UAAU,CAAC,CAAC,CACvC,EAEKC,GAAQR,GAAY,QAAS,IAAMM,GAAO,CAC9C,IAAID,EAAS,IAEb,QAASI,EAAI,EAAGA,EAAIH,EAAI,OAAQG,IAC9BJ,GAAU,OAAO,aAAaC,EAAIG,CAAC,CAAC,EAEtC,OAAOJ,CACT,EAAIE,GAAO,CACTA,EAAMA,EAAI,UAAU,CAAC,EACrB,IAAMD,EAAMI,GAAYH,EAAI,MAAM,EAElC,QAASE,EAAI,EAAGA,EAAIF,EAAI,OAAQE,IAC9BH,EAAIG,CAAC,EAAIF,EAAI,WAAWE,CAAC,EAG3B,OAAOH,CACT,CAAC,EAIKK,GAAyD,CAC7D,KAAMN,GACN,QAASA,GACT,IAAKO,GAAM,OACX,OAAQJ,GACR,MAAAA,GACA,OAAQA,GAER,GAAGI,IAGLC,GAAeF,GvB7CT,SAAUG,GAAYC,EAAgBC,EAA+B,OAAM,CAC/E,IAAMC,EAAOC,GAAMF,CAAQ,EAE3B,GAAIC,GAAQ,KACV,MAAM,IAAI,MAAM,yBAAyBD,CAAQ,GAAG,EAGtD,OAAIA,IAAa,QAAUA,IAAa,QAC/BG,GAAa,UAAO,KAAKJ,EAAQ,OAAO,CAAC,EAI3CE,EAAK,QAAQ,OAAO,GAAGA,EAAK,MAAM,GAAGF,CAAM,EAAE,CACtD,CwBrBc,SAAPK,GAAuBC,EAAa,CACzC,IAAMC,EAAOD,GAAQ,KACfE,EAAMD,IAAS,EACjBE,EACAC,EAASH,EACb,OAAO,SAAoBD,EAAY,CACrC,GAAIA,EAAO,GAAKA,EAAOE,EACrB,OAAOG,GAAYL,CAAI,EAGrBI,EAASJ,EAAOC,IAClBE,EAAOE,GAAYJ,CAAI,EACvBG,EAAS,GAGX,IAAME,EAAMH,EAAK,SAASC,EAAQA,GAAUJ,CAAI,EAEhD,OAAKI,EAAS,KAAO,IAEnBA,GAAUA,EAAS,GAAK,GAGnBE,CACT,CACF,CCXA,IAAMC,GAAN,KAAQ,CAIC,GAKA,IAKA,KAKA,IAEP,YAAaC,EAAwBC,EAAaC,EAAM,CACtD,KAAK,GAAKF,EACV,KAAK,IAAMC,EACX,KAAK,KAAO,OACZ,KAAK,IAAMC,CACb,GAIF,SAASC,IAAI,CAAW,CAKxB,IAAMC,GAAN,KAAW,CAIF,KAKA,KAKA,IAKA,KAEP,YAAaC,EAAwB,CACnC,KAAK,KAAOA,EAAO,KACnB,KAAK,KAAOA,EAAO,KACnB,KAAK,IAAMA,EAAO,IAClB,KAAK,KAAOA,EAAO,MACrB,GAGIC,GAAaC,GAAI,EAKvB,SAASC,GAAOC,EAAY,CAC1B,OAAI,WAAW,QAAU,KAChBC,GAAYD,CAAI,EAGlBH,GAAWG,CAAI,CACxB,CASA,IAAME,GAAN,KAAsB,CAIb,IAKA,KAKA,KAKA,OAEP,aAAA,CACE,KAAK,IAAM,EACX,KAAK,KAAO,IAAIZ,GAAGI,GAAM,EAAG,CAAC,EAC7B,KAAK,KAAO,KAAK,KACjB,KAAK,OAAS,IAChB,CAKA,MAAOH,EAA0BC,EAAaC,EAAQ,CACpD,YAAK,KAAO,KAAK,KAAK,KAAO,IAAIH,GAAGC,EAAIC,EAAKC,CAAG,EAChD,KAAK,KAAOD,EAEL,IACT,CAKA,OAAQW,EAAa,CAGnB,YAAK,MAAQ,KAAK,KAAO,KAAK,KAAK,KAAO,IAAIC,IAC3CD,EAAQA,IAAU,GACT,IACN,EACAA,EAAQ,MACN,EACAA,EAAQ,QACN,EACAA,EAAQ,UACN,EACA,EACVA,CAAK,GAAG,IACH,IACT,CAKA,MAAOA,EAAa,CAClB,OAAOA,EAAQ,EACX,KAAK,MAAME,GAAe,GAAIC,GAAS,WAAWH,CAAK,CAAC,EACxD,KAAK,OAAOA,CAAK,CACvB,CAKA,OAAQA,EAAa,CACnB,OAAO,KAAK,QAAQA,GAAS,EAAIA,GAAS,MAAQ,CAAC,CACrD,CAKA,OAAQA,EAAa,CACnB,IAAMI,EAAOD,GAAS,WAAWH,CAAK,EACtC,OAAO,KAAK,MAAME,GAAeE,EAAK,OAAM,EAAIA,CAAI,CACtD,CAKA,aAAcJ,EAAa,CACzB,OAAO,KAAK,MAAMK,GAAkBC,GAAeN,CAAK,EAAGA,CAAK,CAClE,CAKA,aAAcA,EAAa,CACzB,OAAO,KAAK,OAAO,OAAOA,CAAK,CAAC,CAClC,CAKA,MAAOA,EAAa,CAClB,OAAO,KAAK,OAAOA,CAAK,CAC1B,CAKA,YAAaA,EAAa,CACxB,OAAO,KAAK,aAAaA,CAAK,CAChC,CAKA,YAAaA,EAAa,CACxB,OAAO,KAAK,aAAaA,CAAK,CAChC,CAKA,OAAQA,EAAa,CACnB,IAAMI,EAAOD,GAAS,WAAWH,CAAK,EAAE,SAAQ,EAChD,OAAO,KAAK,MAAME,GAAeE,EAAK,OAAM,EAAIA,CAAI,CACtD,CAKA,aAAcJ,EAAa,CACzB,IAAMI,EAAOD,GAAS,WAAWH,CAAK,EAAE,SAAQ,EAChD,OAAO,KAAK,MAAME,GAAeE,EAAK,OAAM,EAAIA,CAAI,CACtD,CAKA,aAAcJ,EAAa,CACzB,OAAO,KAAK,OAAO,OAAOA,CAAK,CAAC,CAClC,CAKA,KAAMA,EAAc,CAClB,OAAO,KAAK,MAAMO,GAAW,EAAGP,EAAQ,EAAI,CAAC,CAC/C,CAKA,QAASA,EAAa,CACpB,OAAO,KAAK,MAAMQ,GAAc,EAAGR,IAAU,CAAC,CAChD,CAKA,SAAUA,EAAa,CACrB,OAAO,KAAK,QAAQA,CAAK,CAC3B,CAKA,QAASA,EAAa,CACpB,IAAMI,EAAOD,GAAS,WAAWH,CAAK,EACtC,OAAO,KAAK,MAAMQ,GAAc,EAAGJ,EAAK,EAAE,EAAE,MAAMI,GAAc,EAAGJ,EAAK,EAAE,CAC5E,CAKA,cAAeJ,EAAa,CAC1B,IAAMI,EAAOD,GAAS,WAAWH,CAAK,EACtC,OAAO,KAAK,MAAMQ,GAAc,EAAGJ,EAAK,EAAE,EAAE,MAAMI,GAAc,EAAGJ,EAAK,EAAE,CAC5E,CAKA,cAAeJ,EAAa,CAC1B,OAAO,KAAK,QAAQ,OAAOA,CAAK,CAAC,CACnC,CAKA,SAAUA,EAAa,CACrB,OAAO,KAAK,QAAQA,CAAK,CAC3B,CAKA,eAAgBA,EAAa,CAC3B,OAAO,KAAK,cAAcA,CAAK,CACjC,CAKA,eAAgBA,EAAa,CAC3B,OAAO,KAAK,cAAcA,CAAK,CACjC,CAKA,MAAOA,EAAa,CAClB,OAAO,KAAK,MAAMS,GAAc,EAAGT,CAAK,CAC1C,CASA,OAAQA,EAAa,CACnB,OAAO,KAAK,MAAMU,GAAe,EAAGV,CAAK,CAC3C,CAKA,MAAOA,EAAiB,CACtB,IAAMX,EAAMW,EAAM,SAAW,EAE7B,OAAIX,IAAQ,EACH,KAAK,MAAMkB,GAAW,EAAG,CAAC,EAG5B,KAAK,OAAOlB,CAAG,EAAE,MAAMsB,GAAYtB,EAAKW,CAAK,CACtD,CAKA,OAAQA,EAAa,CACnB,IAAMX,EAAWuB,GAAOZ,CAAK,EAC7B,OAAOX,IAAQ,EACX,KAAK,OAAOA,CAAG,EAAE,MAAWwB,GAAOxB,EAAKW,CAAK,EAC7C,KAAK,MAAMO,GAAW,EAAG,CAAC,CAChC,CAMA,MAAI,CACF,YAAK,OAAS,IAAIf,GAAM,IAAI,EAC5B,KAAK,KAAO,KAAK,KAAO,IAAIL,GAAGI,GAAM,EAAG,CAAC,EACzC,KAAK,IAAM,EACJ,IACT,CAKA,OAAK,CACH,OAAI,KAAK,QAAU,MACjB,KAAK,KAAO,KAAK,OAAO,KACxB,KAAK,KAAO,KAAK,OAAO,KACxB,KAAK,IAAM,KAAK,OAAO,IACvB,KAAK,OAAS,KAAK,OAAO,OAE1B,KAAK,KAAO,KAAK,KAAO,IAAIJ,GAAGI,GAAM,EAAG,CAAC,EACzC,KAAK,IAAM,GAEN,IACT,CAKA,QAAM,CACJ,IAAMuB,EAAO,KAAK,KACZC,EAAO,KAAK,KACZ1B,EAAM,KAAK,IACjB,YAAK,MAAK,EAAG,OAAOA,CAAG,EACnBA,IAAQ,IACV,KAAK,KAAK,KAAOyB,EAAK,KACtB,KAAK,KAAOC,EACZ,KAAK,KAAO1B,GAEP,IACT,CAKA,QAAM,CACJ,IAAIyB,EAAO,KAAK,KAAK,KACfE,EAAMpB,GAAM,KAAK,GAAG,EACtBqB,EAAM,EACV,KAAOH,GAAQ,MACbA,EAAK,GAAGA,EAAK,IAAKE,EAAKC,CAAG,EAC1BA,GAAOH,EAAK,IACZA,EAAOA,EAAK,KAGd,OAAOE,CACT,GAGF,SAAST,GAAWjB,EAAa0B,EAAiBC,EAAW,CAC3DD,EAAIC,CAAG,EAAI3B,EAAM,GACnB,CAEA,SAAS4B,GAAe5B,EAAa0B,EAAiBC,EAAW,CAC/D,KAAO3B,EAAM,KACX0B,EAAIC,GAAK,EAAI3B,EAAM,IAAM,IACzBA,KAAS,EAEX0B,EAAIC,CAAG,EAAI3B,CACb,CAOA,IAAMW,GAAN,cAAuBd,EAAU,CACxB,KAEP,YAAaE,EAAaC,EAAW,CACnC,MAAM4B,GAAe7B,EAAKC,CAAG,EAC7B,KAAK,KAAO,MACd,GAGF,SAASY,GAAeZ,EAAe0B,EAAiBC,EAAW,CACjE,KAAO3B,EAAI,KAAO,GAChB0B,EAAIC,GAAK,EAAI3B,EAAI,GAAK,IAAM,IAC5BA,EAAI,IAAMA,EAAI,KAAO,EAAIA,EAAI,IAAM,MAAQ,EAC3CA,EAAI,MAAQ,EAEd,KAAOA,EAAI,GAAK,KACd0B,EAAIC,GAAK,EAAI3B,EAAI,GAAK,IAAM,IAC5BA,EAAI,GAAKA,EAAI,KAAO,EAEtB0B,EAAIC,GAAK,EAAI3B,EAAI,EACnB,CAEA,SAASkB,GAAclB,EAAa0B,EAAiBC,EAAW,CAC9DD,EAAIC,CAAG,EAAI3B,EAAM,IACjB0B,EAAIC,EAAM,CAAC,EAAI3B,IAAQ,EAAI,IAC3B0B,EAAIC,EAAM,CAAC,EAAI3B,IAAQ,GAAK,IAC5B0B,EAAIC,EAAM,CAAC,EAAI3B,IAAQ,EACzB,CAEA,SAASqB,GAAYrB,EAAiB0B,EAAiBC,EAAW,CAChED,EAAI,IAAI1B,EAAK2B,CAAG,CAClB,CAEI,WAAW,QAAU,OACvBlB,GAAiB,UAAU,MAAQ,SAAUC,EAAiB,CAC5D,IAAMX,EAAMW,EAAM,SAAW,EAE7B,YAAK,OAAOX,CAAG,EAEXA,EAAM,GACR,KAAK,MAAM8B,GAAkB9B,EAAKW,CAAK,EAGlC,IACT,EAEAD,GAAiB,UAAU,OAAS,SAAUC,EAAa,CACzD,IAAMX,EAAM,WAAW,OAAO,WAAWW,CAAK,EAE9C,YAAK,OAAOX,CAAG,EAEXA,EAAM,GACR,KAAK,MAAM+B,GAAmB/B,EAAKW,CAAK,EAGnC,IACT,GAGF,SAASmB,GAAkB7B,EAAiB0B,EAAiBC,EAAW,CACtED,EAAI,IAAI1B,EAAK2B,CAAG,CAElB,CAEA,SAASG,GAAmB9B,EAAa0B,EAAiBC,EAAW,CAC/D3B,EAAI,OAAS,GAEVuB,GAAMvB,EAAK0B,EAAKC,CAAG,EAEfD,EAAI,WAAa,KAE1BA,EAAI,UAAU1B,EAAK2B,CAAG,EAEtBD,EAAI,IAAIK,GAAqB/B,CAAG,EAAG2B,CAAG,CAE1C,CAKM,SAAUK,IAAY,CAC1B,OAAO,IAAIvB,EACb,CCzfM,SAAUwB,EAAmBC,EAAqBC,EAA+B,CACrF,IAAMC,EAAIC,GAAY,EAEtB,OAAAF,EAAM,OAAOD,EAASE,EAAG,CACvB,gBAAiB,GAClB,EAEMA,EAAE,OAAM,CACjB,CCRA,IAAYE,IAAZ,SAAYA,EAAW,CACrBA,EAAAA,EAAA,OAAA,CAAA,EAAA,SACAA,EAAAA,EAAA,MAAA,CAAA,EAAA,QACAA,EAAAA,EAAA,iBAAA,CAAA,EAAA,mBACAA,EAAAA,EAAA,YAAA,CAAA,EAAA,cACAA,EAAAA,EAAA,UAAA,CAAA,EAAA,YACAA,EAAAA,EAAA,MAAA,CAAA,EAAA,OACF,GAPYA,KAAAA,GAAW,CAAA,EAAA,EAiEjB,SAAUC,GAAiBC,EAAcC,EAAmBC,EAA2BC,EAAyB,CACpH,MAAO,CACL,KAAAH,EACA,KAAAC,EACA,OAAAC,EACA,OAAAC,EAEJ,CCxEM,SAAUC,GAAiBC,EAAM,CACrC,SAASC,EAAWC,EAAoB,CAGtC,GAAIF,EAAEE,EAAI,SAAQ,CAAE,GAAK,KACvB,MAAM,IAAI,MAAM,oBAAoB,EAGtC,OAAOF,EAAEE,CAAG,CACd,CAEA,IAAMC,EAA0C,SAAqBD,EAAKE,EAAM,CAC9E,IAAMC,EAAYJ,EAAUC,CAAG,EAE/BE,EAAO,MAAMC,CAAS,CACxB,EAEMC,EAA0C,SAAqBC,EAAM,CACzE,IAAML,EAAMK,EAAO,MAAK,EAExB,OAAON,EAAUC,CAAG,CACtB,EAGA,OAAOM,GAAY,OAAQC,GAAY,OAAQN,EAAQG,CAAM,CAC/D,CCrBM,SAAUI,EAAaC,EAA2BC,EAAyB,CAC/E,OAAOC,GAAY,UAAWC,GAAY,iBAAkBH,EAAQC,CAAM,CAC5E,CCOM,IAAWG,IAAjB,SAAiBA,EAAO,CACtB,IAAYC,GAAZ,SAAYA,EAAI,CACdA,EAAA,SAAA,WACAA,EAAA,QAAA,UACAA,EAAA,YAAA,cACAA,EAAA,eAAA,iBACAA,EAAA,IAAA,MACAA,EAAA,WAAA,aACAA,EAAA,YAAA,cACAA,EAAA,WAAA,aACAA,EAAA,OAAA,SACAA,EAAA,UAAA,WACF,GAXYA,EAAAD,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAahB,IAAKE,GAAL,SAAKA,EAAY,CACfA,EAAAA,EAAA,SAAA,CAAA,EAAA,WACAA,EAAAA,EAAA,QAAA,CAAA,EAAA,UACAA,EAAAA,EAAA,YAAA,CAAA,EAAA,cACAA,EAAAA,EAAA,eAAA,CAAA,EAAA,iBACAA,EAAAA,EAAA,IAAA,CAAA,EAAA,MACAA,EAAAA,EAAA,WAAA,CAAA,EAAA,aACAA,EAAAA,EAAA,YAAA,CAAA,EAAA,cACAA,EAAAA,EAAA,WAAA,CAAA,EAAA,aACAA,EAAAA,EAAA,OAAA,CAAA,EAAA,SACAA,EAAAA,EAAA,UAAA,CAAA,EAAA,WACF,GAXKA,IAAAA,EAAY,CAAA,EAAA,GAajB,SAAiBD,EAAI,CACNA,EAAA,MAAQ,IACZE,GAAkBD,CAAY,CAEzC,GAJiBD,EAAAD,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMrB,IAAII,EAESJ,EAAA,MAAQ,KACfI,GAAU,OACZA,EAASC,EAAiB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAC1CA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVP,EAAQ,KAAK,MAAK,EAAG,OAAOM,EAAI,KAAMC,CAAC,GAGrCD,EAAI,SAAW,OACjBC,EAAE,OAAO,EAAE,EACXE,GAAe,MAAK,EAAG,OAAOH,EAAI,QAASC,CAAC,GAG1CD,EAAI,YAAc,OACpBC,EAAE,OAAO,EAAE,EACXG,GAAkB,MAAK,EAAG,OAAOJ,EAAI,WAAYC,CAAC,GAGhDD,EAAI,eAAiB,OACvBC,EAAE,OAAO,EAAE,EACXI,GAAqB,MAAK,EAAG,OAAOL,EAAI,cAAeC,CAAC,GAGtDD,EAAI,KAAO,OACbC,EAAE,OAAO,EAAE,EACXK,GAAW,MAAK,EAAG,OAAON,EAAI,IAAKC,CAAC,GAGlCD,EAAI,aAAe,OACrBC,EAAE,OAAO,EAAE,EACXM,GAAmB,MAAK,EAAG,OAAOP,EAAI,YAAaC,CAAC,GAGlDD,EAAI,YAAc,OACpBC,EAAE,OAAO,EAAE,EACXO,GAAkB,MAAK,EAAG,OAAOR,EAAI,WAAYC,CAAC,GAGhDD,EAAI,QAAU,OAChBC,EAAE,OAAO,EAAE,EACXQ,GAAU,MAAK,EAAG,OAAOT,EAAI,OAAQC,CAAC,GAGpCD,EAAI,WAAa,OACnBC,EAAE,OAAO,EAAE,EACXS,GAAiB,MAAK,EAAG,OAAOV,EAAI,UAAWC,CAAC,GAG9CC,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CAAA,EAEXa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAON,EAAQ,KAAK,MAAK,EAAG,OAAOiB,CAAM,EAC7C,MACF,IAAK,GACHX,EAAI,QAAUG,GAAe,MAAK,EAAG,OAAOQ,EAAQA,EAAO,OAAM,CAAE,EACnE,MACF,IAAK,GACHX,EAAI,WAAaI,GAAkB,MAAK,EAAG,OAAOO,EAAQA,EAAO,OAAM,CAAE,EACzE,MACF,IAAK,GACHX,EAAI,cAAgBK,GAAqB,MAAK,EAAG,OAAOM,EAAQA,EAAO,OAAM,CAAE,EAC/E,MACF,IAAK,GACHX,EAAI,IAAMM,GAAW,MAAK,EAAG,OAAOK,EAAQA,EAAO,OAAM,CAAE,EAC3D,MACF,IAAK,GACHX,EAAI,YAAcO,GAAmB,MAAK,EAAG,OAAOI,EAAQA,EAAO,OAAM,CAAE,EAC3E,MACF,IAAK,GACHX,EAAI,WAAaQ,GAAkB,MAAK,EAAG,OAAOG,EAAQA,EAAO,OAAM,CAAE,EACzE,MACF,IAAK,GACHX,EAAI,OAASS,GAAU,MAAK,EAAG,OAAOE,EAAQA,EAAO,OAAM,CAAE,EAC7D,MACF,IAAK,GACHX,EAAI,UAAYU,GAAiB,MAAK,EAAG,OAAOC,EAAQA,EAAO,OAAM,CAAE,EACvE,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIJ,EAAA,OAAUM,GACde,EAAcf,EAAKN,EAAQ,MAAK,CAAE,EAG9BA,EAAA,OAAUsB,GACdC,EAAcD,EAAKtB,EAAQ,MAAK,CAAE,CAE7C,GAlJiBA,KAAAA,GAAO,CAAA,EAAA,EA+JlB,IAAWwB,GAAjB,SAAiBA,EAAQ,CACvB,IAAYvB,GAAZ,SAAYA,EAAI,CACdA,EAAA,GAAA,KACAA,EAAA,MAAA,OACF,GAHYA,EAAAuB,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAKhB,IAAKtB,GAAL,SAAKA,EAAY,CACfA,EAAAA,EAAA,GAAA,CAAA,EAAA,KACAA,EAAAA,EAAA,MAAA,CAAA,EAAA,OACF,GAHKA,IAAAA,EAAY,CAAA,EAAA,GAKjB,SAAiBD,EAAI,CACNA,EAAA,MAAQ,IACZE,GAAkBD,CAAY,CAEzC,GAJiBD,EAAAuB,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMrB,IAAIpB,EAESoB,EAAA,MAAQ,KACfpB,GAAU,OACZA,EAASC,EAAkB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CA8B/C,GA7BIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACViB,EAAS,KAAK,MAAK,EAAG,OAAOlB,EAAI,KAAMC,CAAC,GAGtCD,EAAI,OAAS,OACfC,EAAE,OAAO,EAAE,EACXkB,GAAc,MAAK,EAAG,OAAOnB,EAAI,MAAOC,CAAC,GAGvCD,EAAI,YAAc,OACpBC,EAAE,OAAO,EAAE,EACXmB,GAAW,MAAK,EAAG,OAAOpB,EAAI,WAAYC,CAAC,GAGzCD,EAAI,UAAY,OAClBC,EAAE,OAAO,EAAE,EACXoB,GAAiB,MAAK,EAAG,OAAOrB,EAAI,SAAUC,CAAC,GAG7CD,EAAI,KAAO,OACbC,EAAE,OAAO,EAAE,EACXqB,GAAY,MAAK,EAAG,OAAOtB,EAAI,IAAKC,CAAC,GAGnCD,EAAI,OAAS,KACf,QAAWuB,KAASvB,EAAI,MACtBC,EAAE,OAAO,EAAE,EACXuB,GAAS,MAAK,EAAG,OAAOD,EAAOtB,CAAC,EAIhCD,EAAI,QAAU,OAChBC,EAAE,OAAO,EAAE,EACXwB,GAAW,MAAK,EAAG,OAAOzB,EAAI,OAAQC,CAAC,GAGrCD,EAAI,WAAa,OACnBC,EAAE,OAAO,EAAE,EACXyB,GAAkB,MAAK,EAAG,OAAO1B,EAAI,UAAWC,CAAC,GAG/CC,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,MAAO,CAAA,GAGHa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOkB,EAAS,KAAK,MAAK,EAAG,OAAOP,CAAM,EAC9C,MACF,IAAK,GACHX,EAAI,MAAQmB,GAAc,MAAK,EAAG,OAAOR,EAAQA,EAAO,OAAM,CAAE,EAChE,MACF,IAAK,GACHX,EAAI,WAAaoB,GAAW,MAAK,EAAG,OAAOT,EAAQA,EAAO,OAAM,CAAE,EAClE,MACF,IAAK,GACHX,EAAI,SAAWqB,GAAiB,MAAK,EAAG,OAAOV,EAAQA,EAAO,OAAM,CAAE,EACtE,MACF,IAAK,GACHX,EAAI,IAAMsB,GAAY,MAAK,EAAG,OAAOX,EAAQA,EAAO,OAAM,CAAE,EAC5D,MACF,IAAK,GACHX,EAAI,MAAM,KAAKwB,GAAS,MAAK,EAAG,OAAOb,EAAQA,EAAO,OAAM,CAAE,CAAC,EAC/D,MACF,IAAK,GACHX,EAAI,OAASyB,GAAW,MAAK,EAAG,OAAOd,EAAQA,EAAO,OAAM,CAAE,EAC9D,MACF,IAAK,GACHX,EAAI,UAAY0B,GAAkB,MAAK,EAAG,OAAOf,EAAQA,EAAO,OAAM,CAAE,EACxE,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIoB,EAAA,OAAUlB,GACde,EAAcf,EAAKkB,EAAS,MAAK,CAAE,EAG/BA,EAAA,OAAUF,GACdC,EAAcD,EAAKE,EAAS,MAAK,CAAE,CAE9C,GA9HiBA,IAAAA,EAAQ,CAAA,EAAA,EAqInB,IAAWG,IAAjB,SAAiBA,EAAgB,CAC/B,IAAIvB,EAESuB,EAAA,MAAQ,KACfvB,GAAU,OACZA,EAASC,EAA0B,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAUvD,GATIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,IAAM,MAAQA,EAAI,GAAG,WAAa,IACzCC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,EAAE,GAGZA,EAAI,OAAS,KACf,QAAWuB,KAASvB,EAAI,MACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMsB,CAAK,EAIbrB,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,GAAI,IAAI,WAAW,CAAC,EACpB,MAAO,CAAA,GAGHa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,GAAKW,EAAO,MAAK,EACrB,MACF,IAAK,GACHX,EAAI,MAAM,KAAKW,EAAO,MAAK,CAAE,EAC7B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIuB,EAAA,OAAUrB,GACde,EAAcf,EAAKqB,EAAiB,MAAK,CAAE,EAGvCA,EAAA,OAAUL,GACdC,EAAcD,EAAKK,EAAiB,MAAK,CAAE,CAEtD,GA/DiBA,KAAAA,GAAgB,CAAA,EAAA,EAuE3B,IAAWlB,IAAjB,SAAiBA,EAAc,CAC7B,IAAIL,EAESK,EAAA,MAAQ,KACfL,GAAU,OACZA,EAASC,EAAwB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAUrD,GATIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,MAAQ,MAAQA,EAAI,KAAK,WAAa,IAC7CC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdA,EAAI,OAAS,KACf,QAAWuB,KAASvB,EAAI,MACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMsB,CAAK,EAIbvB,EAAI,SAAW,OACjBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,OAAO,GAGjBE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,KAAM,IAAI,WAAW,CAAC,EACtB,MAAO,CAAA,GAGHa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,MAAM,KAAKW,EAAO,MAAK,CAAE,EAC7B,MACF,IAAK,GACHX,EAAI,QAAUW,EAAO,MAAK,EAC1B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIK,EAAA,OAAUH,GACde,EAAcf,EAAKG,EAAe,MAAK,CAAE,EAGrCA,EAAA,OAAUa,GACdC,EAAcD,EAAKb,EAAe,MAAK,CAAE,CAEpD,GAvEiBA,KAAAA,GAAc,CAAA,EAAA,EA+EzB,IAAWC,IAAjB,SAAiBA,EAAiB,CAChC,IAAIN,EAESM,EAAA,MAAQ,KACfN,GAAU,OACZA,EAASC,EAA2B,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAUxD,GATIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,MAAQ,MAAQA,EAAI,KAAK,WAAa,IAC7CC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdA,EAAI,OAAS,KACf,QAAWuB,KAASvB,EAAI,MACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOsB,CAAK,EAIdvB,EAAI,SAAW,OACjBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,OAAO,GAGjBE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,KAAM,IAAI,WAAW,CAAC,EACtB,MAAO,CAAA,GAGHa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,MAAM,KAAKW,EAAO,OAAM,CAAE,EAC9B,MACF,IAAK,GACHX,EAAI,QAAUW,EAAO,MAAK,EAC1B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIM,EAAA,OAAUJ,GACde,EAAcf,EAAKI,EAAkB,MAAK,CAAE,EAGxCA,EAAA,OAAUY,GACdC,EAAcD,EAAKZ,EAAkB,MAAK,CAAE,CAEvD,GAvEiBA,KAAAA,GAAiB,CAAA,EAAA,EA8E5B,IAAWC,IAAjB,SAAiBA,EAAoB,CACnC,IAAIP,EAESO,EAAA,MAAQ,KACfP,GAAU,OACZA,EAASC,EAA8B,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAU3D,GATIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,MAAQ,MAAQA,EAAI,KAAK,WAAa,IAC7CC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdA,EAAI,OAAS,KACf,QAAWuB,KAASvB,EAAI,MACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOsB,CAAK,EAIdrB,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,KAAM,IAAI,WAAW,CAAC,EACtB,MAAO,CAAA,GAGHa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,MAAM,KAAKW,EAAO,OAAM,CAAE,EAC9B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIO,EAAA,OAAUL,GACde,EAAcf,EAAKK,EAAqB,MAAK,CAAE,EAG3CA,EAAA,OAAUW,GACdC,EAAcD,EAAKX,EAAqB,MAAK,CAAE,CAE1D,GA/DiBA,KAAAA,GAAoB,CAAA,EAAA,EAqE/B,IAAWc,IAAjB,SAAiBA,EAAa,CAC5B,IAAIrB,EAESqB,EAAA,MAAQ,KACfrB,GAAU,OACZA,EAASC,EAAuB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAChDA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,KAAO,MAAQA,EAAI,MAAQ,KAClCC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOD,EAAI,GAAG,GAGdE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,IAAK,IAGDa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,IAAMW,EAAO,OAAM,EACvB,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIqB,EAAA,OAAUnB,GACde,EAAcf,EAAKmB,EAAc,MAAK,CAAE,EAGpCA,EAAA,OAAUH,GACdC,EAAcD,EAAKG,EAAc,MAAK,CAAE,CAEnD,GApDiBA,KAAAA,GAAa,CAAA,EAAA,EA4DxB,IAAWC,IAAjB,SAAiBA,EAAU,CACzB,IAAItB,EAESsB,EAAA,MAAQ,KACftB,GAAU,OACZA,EAASC,EAAoB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAC7CA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,MAAQ,MAAQA,EAAI,KAAK,WAAa,IAC7CC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGbA,EAAI,MAAQ,MAAQA,EAAI,KAAK,WAAa,IAC7CC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGbA,EAAI,OAAS,MAAQA,EAAI,QAAU,KACtCC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOD,EAAI,KAAK,GAGhBE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,KAAM,IAAI,WAAW,CAAC,EACtB,KAAM,IAAI,WAAW,CAAC,EACtB,MAAO,IAGHa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,MAAQW,EAAO,OAAM,EACzB,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIsB,EAAA,OAAUpB,GACde,EAAcf,EAAKoB,EAAW,MAAK,CAAE,EAGjCA,EAAA,OAAUJ,GACdC,EAAcD,EAAKI,EAAW,MAAK,CAAE,CAEhD,GAtEiBA,KAAAA,GAAU,CAAA,EAAA,EAkFrB,IAAWd,IAAjB,SAAiBA,EAAU,CACzB,IAAYX,GAAZ,SAAYA,EAAI,CACdA,EAAA,UAAA,YACAA,EAAA,6BAAA,+BACAA,EAAA,eAAA,iBACAA,EAAA,kBAAA,oBACAA,EAAA,eAAA,iBACAA,EAAA,UAAA,YACAA,EAAA,aAAA,eACAA,EAAA,UAAA,YACAA,EAAA,QAAA,SACF,GAVYA,EAAAW,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAYhB,IAAKV,GAAL,SAAKA,EAAY,CACfA,EAAAA,EAAA,UAAA,CAAA,EAAA,YACAA,EAAAA,EAAA,6BAAA,CAAA,EAAA,+BACAA,EAAAA,EAAA,eAAA,CAAA,EAAA,iBACAA,EAAAA,EAAA,kBAAA,CAAA,EAAA,oBACAA,EAAAA,EAAA,eAAA,CAAA,EAAA,iBACAA,EAAAA,EAAA,UAAA,CAAA,EAAA,YACAA,EAAAA,EAAA,aAAA,CAAA,EAAA,eACAA,EAAAA,EAAA,UAAA,CAAA,EAAA,YACAA,EAAAA,EAAA,QAAA,CAAA,EAAA,SACF,GAVKA,IAAAA,EAAY,CAAA,EAAA,GAYjB,SAAiBD,EAAI,CACNA,EAAA,MAAQ,IACZE,GAAkBD,CAAY,CAEzC,GAJiBD,EAAAW,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMrB,IAAIR,EAESQ,EAAA,MAAQ,KACfR,GAAU,OACZA,EAASC,EAAoB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAC7CA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVK,EAAW,KAAK,MAAK,EAAG,OAAON,EAAI,KAAMC,CAAC,GAGxCD,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdA,EAAI,KAAO,OACbC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,GAAG,GAGbA,EAAI,KAAO,OACbC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,GAAG,GAGbA,EAAI,OAAS,OACfC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,KAAK,GAGfA,EAAI,OAAS,OACfC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,KAAK,GAGfA,EAAI,SAAW,OACjBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,OAAO,GAGjBE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CAAA,EAEXa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOM,EAAW,KAAK,MAAK,EAAG,OAAOK,CAAM,EAChD,MACF,IAAK,GACHX,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,IAAMW,EAAO,MAAK,EACtB,MACF,IAAK,GACHX,EAAI,IAAMW,EAAO,MAAK,EACtB,MACF,IAAK,GACHX,EAAI,MAAQW,EAAO,MAAK,EACxB,MACF,IAAK,GACHX,EAAI,MAAQW,EAAO,MAAK,EACxB,MACF,IAAK,GACHX,EAAI,QAAUW,EAAO,MAAK,EAC1B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIQ,EAAA,OAAUN,GACde,EAAcf,EAAKM,EAAW,MAAK,CAAE,EAGjCA,EAAA,OAAUU,GACdC,EAAcD,EAAKV,EAAW,MAAK,CAAE,CAEhD,GAhIiBA,KAAAA,GAAU,CAAA,EAAA,EAwIrB,IAAWgB,IAAjB,SAAiBA,EAAW,CAC1B,IAAY3B,GAAZ,SAAYA,EAAI,CACdA,EAAA,MAAA,QACAA,EAAA,MAAA,QACAA,EAAA,IAAA,KACF,GAJYA,EAAA2B,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMhB,IAAK1B,GAAL,SAAKA,EAAY,CACfA,EAAAA,EAAA,MAAA,CAAA,EAAA,QACAA,EAAAA,EAAA,MAAA,CAAA,EAAA,QACAA,EAAAA,EAAA,IAAA,CAAA,EAAA,KACF,GAJKA,IAAAA,EAAY,CAAA,EAAA,GAMjB,SAAiBD,EAAI,CACNA,EAAA,MAAQ,IACZE,GAAkBD,CAAY,CAEzC,GAJiBD,EAAA2B,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMrB,IAAIxB,EAESwB,EAAA,MAAQ,KACfxB,GAAU,OACZA,EAASC,EAAqB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAC9CA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVqB,EAAY,KAAK,MAAK,EAAG,OAAOtB,EAAI,KAAMC,CAAC,GAGzCD,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXuB,GAAS,MAAK,EAAG,OAAOxB,EAAI,KAAMC,CAAC,GAGjCD,EAAI,OAAS,OACfC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,KAAK,GAGfE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CAAA,EAEXa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOsB,EAAY,KAAK,MAAK,EAAG,OAAOX,CAAM,EACjD,MACF,IAAK,GACHX,EAAI,KAAOwB,GAAS,MAAK,EAAG,OAAOb,EAAQA,EAAO,OAAM,CAAE,EAC1D,MACF,IAAK,GACHX,EAAI,MAAQW,EAAO,MAAK,EACxB,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIwB,EAAA,OAAUtB,GACde,EAAcf,EAAKsB,EAAY,MAAK,CAAE,EAGlCA,EAAA,OAAUN,GACdC,EAAcD,EAAKM,EAAY,MAAK,CAAE,CAEjD,GApFiBA,KAAAA,GAAW,CAAA,EAAA,EA2FtB,IAAWE,IAAjB,SAAiBA,EAAQ,CACvB,IAAI1B,EAES0B,EAAA,MAAQ,KACf1B,GAAU,OACZA,EAASC,EAAkB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAU/C,GATIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,IAAM,MAAQA,EAAI,GAAG,WAAa,IACzCC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,EAAE,GAGZA,EAAI,OAAS,KACf,QAAWuB,KAASvB,EAAI,MACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMsB,CAAK,EAIbrB,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,GAAI,IAAI,WAAW,CAAC,EACpB,MAAO,CAAA,GAGHa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,GAAKW,EAAO,MAAK,EACrB,MACF,IAAK,GACHX,EAAI,MAAM,KAAKW,EAAO,MAAK,CAAE,EAC7B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGI0B,EAAA,OAAUxB,GACde,EAAcf,EAAKwB,EAAS,MAAK,CAAE,EAG/BA,EAAA,OAAUR,GACdC,EAAcD,EAAKQ,EAAS,MAAK,CAAE,CAE9C,GA/DiBA,KAAAA,GAAQ,CAAA,EAAA,EAwEnB,IAAWjB,IAAjB,SAAiBA,EAAkB,CACjC,IAAYZ,GAAZ,SAAYA,EAAI,CACdA,EAAA,SAAA,WACAA,EAAA,WAAA,aACAA,EAAA,KAAA,MACF,GAJYA,EAAAY,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMhB,IAAKX,GAAL,SAAKA,EAAY,CACfA,EAAAA,EAAA,SAAA,CAAA,EAAA,WACAA,EAAAA,EAAA,WAAA,CAAA,EAAA,aACAA,EAAAA,EAAA,KAAA,CAAA,EAAA,MACF,GAJKA,IAAAA,EAAY,CAAA,EAAA,GAMjB,SAAiBD,EAAI,CACNA,EAAA,MAAQ,IACZE,GAAkBD,CAAY,CAEzC,GAJiBD,EAAAY,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMrB,IAAIT,EAESS,EAAA,MAAQ,KACfT,GAAU,OACZA,EAASC,EAA4B,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CACrDA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVM,EAAmB,KAAK,MAAK,EAAG,OAAOP,EAAI,KAAMC,CAAC,GAGhDD,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdA,EAAI,KAAO,OACbC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOD,EAAI,GAAG,GAGdA,EAAI,QAAU,OAChBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,MAAM,GAGhBE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CAAA,EAEXa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOO,EAAmB,KAAK,MAAK,EAAG,OAAOI,CAAM,EACxD,MACF,IAAK,GACHX,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,IAAMW,EAAO,OAAM,EACvB,MACF,IAAK,GACHX,EAAI,OAASW,EAAO,MAAK,EACzB,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIS,EAAA,OAAUP,GACde,EAAcf,EAAKO,EAAmB,MAAK,CAAE,EAGzCA,EAAA,OAAUS,GACdC,EAAcD,EAAKT,EAAmB,MAAK,CAAE,CAExD,GA5FiBA,KAAAA,GAAkB,CAAA,EAAA,EAkG7B,IAAWC,IAAjB,SAAiBA,EAAiB,CAChC,IAAIV,EAESU,EAAA,MAAQ,KACfV,GAAU,OACZA,EAASC,EAA2B,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CACpDA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,MAAQ,MAAQA,EAAI,KAAK,WAAa,IAC7CC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,KAAM,IAAI,WAAW,CAAC,GAGlBa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIU,EAAA,OAAUR,GACde,EAAcf,EAAKQ,EAAkB,MAAK,CAAE,EAGxCA,EAAA,OAAUQ,GACdC,EAAcD,EAAKR,EAAkB,MAAK,CAAE,CAEvD,GApDiBA,KAAAA,GAAiB,CAAA,EAAA,EA4D5B,IAAWC,IAAjB,SAAiBA,EAAS,CACxB,IAAYd,GAAZ,SAAYA,EAAI,CACdA,EAAA,WAAA,aACAA,EAAA,WAAA,aACAA,EAAA,QAAA,UACAA,EAAA,UAAA,WACF,GALYA,EAAAc,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAOhB,IAAKb,GAAL,SAAKA,EAAY,CACfA,EAAAA,EAAA,WAAA,CAAA,EAAA,aACAA,EAAAA,EAAA,WAAA,CAAA,EAAA,aACAA,EAAAA,EAAA,QAAA,CAAA,EAAA,UACAA,EAAAA,EAAA,UAAA,CAAA,EAAA,WACF,GALKA,IAAAA,EAAY,CAAA,EAAA,GAOjB,SAAiBD,EAAI,CACNA,EAAA,MAAQ,IACZE,GAAkBD,CAAY,CAEzC,GAJiBD,EAAAc,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMrB,IAAIX,EAESW,EAAA,MAAQ,KACfX,GAAU,OACZA,EAASC,EAAmB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAC5CA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVQ,EAAU,KAAK,MAAK,EAAG,OAAOT,EAAI,KAAMC,CAAC,GAGvCD,EAAI,OAAS,OACfC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOD,EAAI,KAAK,GAGhBA,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CAAA,EAEXa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOS,EAAU,KAAK,MAAK,EAAG,OAAOE,CAAM,EAC/C,MACF,IAAK,GACHX,EAAI,MAAQW,EAAO,OAAM,EACzB,MACF,IAAK,GACHX,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIW,EAAA,OAAUT,GACde,EAAcf,EAAKS,EAAU,MAAK,CAAE,EAGhCA,EAAA,OAAUO,GACdC,EAAcD,EAAKP,EAAU,MAAK,CAAE,CAE/C,GAtFiBA,KAAAA,GAAS,CAAA,EAAA,EAiGpB,IAAWkB,IAAjB,SAAiBA,EAAS,CACxB,IAAI7B,EAES6B,EAAA,MAAQ,KACf7B,GAAU,OACZA,EAASC,EAAmB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAoBhD,GAnBIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdA,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdA,EAAI,OAAS,OACfC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,KAAK,GAGfA,EAAI,UAAY,KAClB,QAAWuB,KAASvB,EAAI,SACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOsB,CAAK,EAIdvB,EAAI,WAAa,OACnBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,SAAS,GAGnBA,EAAI,KAAO,OACbC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,GAAG,GAGbE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,SAAU,CAAA,GAGNa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,MAAQW,EAAO,MAAK,EACxB,MACF,IAAK,GACHX,EAAI,SAAS,KAAKW,EAAO,OAAM,CAAE,EACjC,MACF,IAAK,GACHX,EAAI,UAAYW,EAAO,MAAK,EAC5B,MACF,IAAK,GACHX,EAAI,IAAMW,EAAO,MAAK,EACtB,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGI6B,EAAA,OAAU3B,GACde,EAAcf,EAAK2B,EAAU,MAAK,CAAE,EAGhCA,EAAA,OAAUX,GACdC,EAAcD,EAAKW,EAAU,MAAK,CAAE,CAE/C,GA9FiBA,KAAAA,GAAS,CAAA,EAAA,EAqGpB,IAAWF,IAAjB,SAAiBA,EAAU,CACzB,IAAI3B,EAES2B,EAAA,MAAQ,KACf3B,GAAU,OACZA,EAASC,EAAoB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAKjD,GAJIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,QAAU,KAChB,QAAWuB,KAASvB,EAAI,OACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOsB,CAAK,EAIlB,GAAIvB,EAAI,SAAW,KACjB,QAAWuB,KAASvB,EAAI,QACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMsB,CAAK,EAIbrB,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,OAAQ,CAAA,EACR,QAAS,CAAA,GAGLa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,OAAO,KAAKW,EAAO,OAAM,CAAE,EAC/B,MACF,IAAK,GACHX,EAAI,QAAQ,KAAKW,EAAO,MAAK,CAAE,EAC/B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGI2B,EAAA,OAAUzB,GACde,EAAcf,EAAKyB,EAAW,MAAK,CAAE,EAGjCA,EAAA,OAAUT,GACdC,EAAcD,EAAKS,EAAW,MAAK,CAAE,CAEhD,GAjEiBA,KAAAA,GAAU,CAAA,EAAA,EAyErB,IAAWf,IAAjB,SAAiBA,EAAgB,CAC/B,IAAYf,GAAZ,SAAYA,EAAI,CACdA,EAAA,YAAA,cACAA,EAAA,cAAA,gBACAA,EAAA,cAAA,eACF,GAJYA,EAAAe,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMhB,IAAKd,GAAL,SAAKA,EAAY,CACfA,EAAAA,EAAA,YAAA,CAAA,EAAA,cACAA,EAAAA,EAAA,cAAA,CAAA,EAAA,gBACAA,EAAAA,EAAA,cAAA,CAAA,EAAA,eACF,GAJKA,IAAAA,EAAY,CAAA,EAAA,GAMjB,SAAiBD,EAAI,CACNA,EAAA,MAAQ,IACZE,GAAkBD,CAAY,CAEzC,GAJiBD,EAAAe,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMrB,IAAIZ,EAESY,EAAA,MAAQ,KACfZ,GAAU,OACZA,EAASC,EAA0B,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAevD,GAdIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVS,EAAiB,KAAK,MAAK,EAAG,OAAOV,EAAI,KAAMC,CAAC,GAG9CD,EAAI,IAAM,OACZC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,EAAE,GAGZA,EAAI,QAAU,KAChB,QAAWuB,KAASvB,EAAI,OACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOsB,CAAK,EAIdrB,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,OAAQ,CAAA,GAGJa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOU,EAAiB,KAAK,MAAK,EAAG,OAAOC,CAAM,EACtD,MACF,IAAK,GACHX,EAAI,GAAKW,EAAO,MAAK,EACrB,MACF,IAAK,GACHX,EAAI,OAAO,KAAKW,EAAO,OAAM,CAAE,EAC/B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIY,EAAA,OAAUV,GACde,EAAcf,EAAKU,EAAiB,MAAK,CAAE,EAGvCA,EAAA,OAAUM,GACdC,EAAcD,EAAKN,EAAiB,MAAK,CAAE,CAEtD,GAxFiBA,KAAAA,GAAgB,CAAA,EAAA,EA+F3B,IAAWgB,IAAjB,SAAiBA,EAAiB,CAChC,IAAI5B,EAES4B,EAAA,MAAQ,KACf5B,GAAU,OACZA,EAASC,EAA2B,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAUxD,GATIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXuB,GAAS,MAAK,EAAG,OAAOxB,EAAI,KAAMC,CAAC,GAGjCD,EAAI,QAAU,KAChB,QAAWuB,KAASvB,EAAI,OACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOsB,CAAK,EAIdrB,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,OAAQ,CAAA,GAGJa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOwB,GAAS,MAAK,EAAG,OAAOb,EAAQA,EAAO,OAAM,CAAE,EAC1D,MACF,IAAK,GACHX,EAAI,OAAO,KAAKW,EAAO,OAAM,CAAE,EAC/B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGI4B,EAAA,OAAU1B,GACde,EAAcf,EAAK0B,EAAkB,MAAK,CAAE,EAGxCA,EAAA,OAAUV,GACdC,EAAcD,EAAKU,EAAkB,MAAK,CAAE,CAEvD,GA9DiBA,KAAAA,GAAiB,CAAA,EAAA,EClhDlC,IAAAE,GAAgB,qBAChBC,GAAiB,sBCVjB,SAASC,GAAGC,EAAOC,EAAS,CACxB,GAAI,CACA,GAAI,OAAOD,GAAU,UAAYA,EAAM,OAAS,EAC5C,OAAOE,GAAMF,CAAK,EAEjB,GAAI,OAAOA,GAAU,UAAY,SAASA,CAAK,EAChD,OAAOC,GAAS,KAAOE,GAAQH,CAAK,EAAII,GAASJ,CAAK,EAE1D,MAAM,IAAI,MAAM,kCAAkC,CACtD,OACOK,EAAO,CACV,IAAMC,EAAUC,GAAQF,CAAK,EACvB,GAAGA,EAAM,OAAO,WAAW,KAAK,UAAUL,CAAK,CAAC,GAChD,gCACN,MAAM,IAAI,MAAMM,CAAO,CAC3B,CACJ,CAIA,SAASJ,GAAMM,EAAK,CAEhB,GADAA,EAAM,OAAOA,CAAG,EACZA,EAAI,OAAS,IACb,MAAM,IAAI,MAAM,qDAAqD,EAEzE,IAAMC,EAAQ,mIAAmI,KAAKD,CAAG,EACzJ,GAAI,CAACC,EACD,MAAO,KAEX,IAAMC,EAAI,WAAWD,EAAM,CAAC,CAAC,EACvBE,GAAQF,EAAM,CAAC,GAAK,MAAM,YAAY,EAC5C,OAAQE,EAAM,CACV,IAAK,QACL,IAAK,OACL,IAAK,MACL,IAAK,KACL,IAAK,IACD,OAAOD,EAAI,SACf,IAAK,QACL,IAAK,OACL,IAAK,IACD,OAAOA,EAAI,OACf,IAAK,OACL,IAAK,MACL,IAAK,IACD,OAAOA,EAAI,MACf,IAAK,QACL,IAAK,OACL,IAAK,MACL,IAAK,KACL,IAAK,IACD,OAAOA,EAAI,KACf,IAAK,UACL,IAAK,SACL,IAAK,OACL,IAAK,MACL,IAAK,IACD,OAAOA,EAAI,IACf,IAAK,UACL,IAAK,SACL,IAAK,OACL,IAAK,MACL,IAAK,IACD,OAAOA,EAAI,IACf,IAAK,eACL,IAAK,cACL,IAAK,QACL,IAAK,OACL,IAAK,KACD,OAAOA,EACX,QAEI,MAAM,IAAI,MAAM,YAAYC,CAAI,4CAA4C,CACpF,CACJ,CACA,IAAOC,GAAQb,GAIf,SAASK,GAASL,EAAI,CAClB,IAAMc,EAAQ,KAAK,IAAId,CAAE,EACzB,OAAIc,GAAS,MACF,GAAG,KAAK,MAAMd,EAAK,KAAC,CAAC,IAE5Bc,GAAS,KACF,GAAG,KAAK,MAAMd,EAAK,IAAC,CAAC,IAE5Bc,GAAS,IACF,GAAG,KAAK,MAAMd,EAAK,GAAC,CAAC,IAE5Bc,GAAS,IACF,GAAG,KAAK,MAAMd,EAAK,GAAC,CAAC,IAEzB,GAAGA,CAAE,IAChB,CAIA,SAASI,GAAQJ,EAAI,CACjB,IAAMc,EAAQ,KAAK,IAAId,CAAE,EACzB,OAAIc,GAAS,MACFC,GAAOf,EAAIc,EAAO,MAAG,KAAK,EAEjCA,GAAS,KACFC,GAAOf,EAAIc,EAAO,KAAG,MAAM,EAElCA,GAAS,IACFC,GAAOf,EAAIc,EAAO,IAAG,QAAQ,EAEpCA,GAAS,IACFC,GAAOf,EAAIc,EAAO,IAAG,QAAQ,EAEjC,GAAGd,CAAE,KAChB,CAIA,SAASe,GAAOf,EAAIc,EAAOH,EAAGK,EAAM,CAChC,IAAMC,EAAWH,GAASH,EAAI,IAC9B,MAAO,GAAG,KAAK,MAAMX,EAAKW,CAAC,CAAC,IAAIK,CAAI,GAAGC,EAAW,IAAM,EAAE,EAC9D,CAIA,SAAST,GAAQF,EAAO,CACpB,OAAO,OAAOA,GAAU,UAAYA,IAAU,MAAQ,YAAaA,CACvE,CCrIA,IAAAY,GAAoB,yBACpBC,GAAe,oBACfC,GAAgB,qBAIhB,SAASC,GAAQC,EAAMC,EAAO,WAAW,KAAO,WAAW,KAAK,KAAO,GAAAC,QAAQ,KAAM,CACpF,IAAMC,EAASH,EAAK,WAAW,GAAG,EAAI,GAAMA,EAAK,SAAW,EAAI,IAAM,KAChEI,EAAWH,EAAK,QAAQE,EAASH,CAAI,EACrCK,EAAqBJ,EAAK,QAAQ,IAAI,EAC5C,OAAOG,IAAa,KAAOC,IAAuB,IAAMD,EAAWC,EACpE,CAEA,GAAM,CAAC,IAAAC,CAAG,EAAI,GAAAJ,QAEVK,GAEHR,GAAQ,UAAU,GACfA,GAAQ,WAAW,GACnBA,GAAQ,aAAa,GACrBA,GAAQ,aAAa,EAExBQ,GAAiB,GAEjBR,GAAQ,OAAO,GACZA,GAAQ,QAAQ,GAChBA,GAAQ,YAAY,GACpBA,GAAQ,cAAc,KAEzBQ,GAAiB,GAGlB,SAASC,IAAgB,CACxB,GAAI,gBAAiBF,EACpB,OAAIA,EAAI,cAAgB,OAChB,EAGJA,EAAI,cAAgB,QAChB,EAGDA,EAAI,YAAY,SAAW,EAAI,EAAI,KAAK,IAAI,OAAO,SAASA,EAAI,YAAa,EAAE,EAAG,CAAC,CAE5F,CAEA,SAASG,GAAeC,EAAO,CAC9B,OAAIA,IAAU,EACN,GAGD,CACN,MAAAA,EACA,SAAU,GACV,OAAQA,GAAS,EACjB,OAAQA,GAAS,CAClB,CACD,CAEA,SAASC,GAAeC,EAAY,CAAC,YAAAC,EAAa,WAAAC,EAAa,EAAI,EAAI,CAAC,EAAG,CAC1E,IAAMC,EAAmBP,GAAc,EACnCO,IAAqB,SACxBR,GAAiBQ,GAGlB,IAAMC,EAAaF,EAAaP,GAAiBQ,EAEjD,GAAIC,IAAe,EAClB,MAAO,GAGR,GAAIF,EAAY,CACf,GAAIf,GAAQ,WAAW,GACnBA,GAAQ,YAAY,GACpBA,GAAQ,iBAAiB,EAC5B,MAAO,GAGR,GAAIA,GAAQ,WAAW,EACtB,MAAO,EAET,CAIA,GAAI,aAAcO,GAAO,eAAgBA,EACxC,MAAO,GAGR,GAAIM,GAAc,CAACC,GAAeG,IAAe,OAChD,MAAO,GAGR,IAAMC,EAAMD,GAAc,EAE1B,GAAIV,EAAI,OAAS,OAChB,OAAOW,EAGR,GAAI,GAAAf,QAAQ,WAAa,QAAS,CAGjC,IAAMgB,EAAY,GAAAC,QAAG,QAAQ,EAAE,MAAM,GAAG,EACxC,OACC,OAAOD,EAAU,CAAC,CAAC,GAAK,IACrB,OAAOA,EAAU,CAAC,CAAC,GAAK,MAEpB,OAAOA,EAAU,CAAC,CAAC,GAAK,MAAS,EAAI,EAGtC,CACR,CAEA,GAAI,OAAQZ,EACX,MAAI,mBAAoBA,GAAO,kBAAmBA,EAC1C,EAGJ,CAAC,SAAU,WAAY,WAAY,YAAa,YAAa,OAAO,EAAE,KAAKc,GAAQA,KAAQd,CAAG,GAAKA,EAAI,UAAY,WAC/G,EAGDW,EAGR,GAAI,qBAAsBX,EACzB,MAAO,gCAAgC,KAAKA,EAAI,gBAAgB,EAAI,EAAI,EAOzE,GAJIA,EAAI,YAAc,aAIlBA,EAAI,OAAS,cAChB,MAAO,GAGR,GAAI,iBAAkBA,EAAK,CAC1B,IAAMe,EAAU,OAAO,UAAUf,EAAI,sBAAwB,IAAI,MAAM,GAAG,EAAE,CAAC,EAAG,EAAE,EAElF,OAAQA,EAAI,aAAc,CACzB,IAAK,YACJ,OAAOe,GAAW,EAAI,EAAI,EAG3B,IAAK,iBACJ,MAAO,EAGT,CACD,CAEA,MAAI,iBAAiB,KAAKf,EAAI,IAAI,EAC1B,EAGJ,8DAA8D,KAAKA,EAAI,IAAI,GAI3E,cAAeA,EACX,EAGDW,CACR,CAEO,SAASK,GAAoBC,EAAQC,EAAU,CAAC,EAAG,CACzD,IAAMd,EAAQC,GAAeY,EAAQ,CACpC,YAAaA,GAAUA,EAAO,MAC9B,GAAGC,CACJ,CAAC,EAED,OAAOf,GAAeC,CAAK,CAC5B,CAEA,IAAMe,GAAgB,CACrB,OAAQH,GAAoB,CAAC,MAAO,GAAAI,QAAI,OAAO,CAAC,CAAC,CAAC,EAClD,OAAQJ,GAAoB,CAAC,MAAO,GAAAI,QAAI,OAAO,CAAC,CAAC,CAAC,CACnD,EAEOC,GAAQF,GC3KD,SAAPG,GAAwBC,EAAQ,CACrCC,EAAY,MAAQA,EACpBA,EAAY,QAAUA,EACtBA,EAAY,OAASC,EACrBD,EAAY,QAAUE,EACtBF,EAAY,OAASG,EACrBH,EAAY,QAAUI,EACtBJ,EAAY,SAAWK,GACvBL,EAAY,QAAUM,EAEtB,OAAO,KAAKP,CAAG,EAAE,QAAQQ,GAAM,CAE7BP,EAAYO,CAAG,EAAIR,EAAIQ,CAAG,CAC5B,CAAC,EAMDP,EAAY,MAAQ,CAAA,EACpBA,EAAY,MAAQ,CAAA,EAOpBA,EAAY,WAAa,CAAA,EAQzB,SAASQ,EAAaC,EAAiB,CACrC,IAAIC,EAAO,EAEX,QAASC,EAAI,EAAGA,EAAIF,EAAU,OAAQE,IACpCD,GAASA,GAAQ,GAAKA,EAAQD,EAAU,WAAWE,CAAC,EACpDD,GAAQ,EAIV,OAAOV,EAAY,OAAO,KAAK,IAAIU,CAAI,EAAIV,EAAY,OAAO,MAAM,CACtE,CACAA,EAAY,YAAcQ,EAQ1B,SAASR,EAAaS,EAAiB,CACrC,IAAIG,EACAC,EAAsB,KACtBC,EACAC,EAEJ,SAASC,KAAUC,EAAW,CAG5B,GAAI,CAACD,EAAM,QACT,OAGF,IAAME,EAAYF,EAGZG,EAAO,OAAO,IAAI,IAAM,EACxBC,EAAKD,GAAQP,GAAYO,GAC/BD,EAAK,KAAOE,EACZF,EAAK,KAAON,EACZM,EAAK,KAAOC,EACZP,EAAWO,EAEXF,EAAK,CAAC,EAAIjB,EAAY,OAAOiB,EAAK,CAAC,CAAC,EAEhC,OAAOA,EAAK,CAAC,GAAM,UAErBA,EAAK,QAAQ,IAAI,EAInB,IAAII,EAAQ,EACZJ,EAAK,CAAC,EAAIA,EAAK,CAAC,EAAE,QAAQ,gBAAiB,CAACK,GAAYC,KAAoB,CAE1E,GAAID,KAAU,KACZ,MAAO,IAETD,IAEA,IAAMG,GAAYxB,EAAY,WAAWuB,EAAM,EAC/C,GAAI,OAAOC,IAAc,WAAY,CACnC,IAAMC,EAAMR,EAAKI,CAAK,EACtBC,GAAQE,GAAU,KAAKN,EAAMO,CAAG,EAGhCR,EAAK,OAAOI,EAAO,CAAC,EACpBA,GACF,CACA,OAAOC,EACT,CAAC,EAIDtB,EAAY,WAAW,KAAKkB,EAAMD,CAAI,GAGxBC,EAAK,KAAOlB,EAAY,KAChC,MAAMkB,EAAMD,CAAI,CACxB,CAEA,OAAAD,EAAM,UAAYP,EAElBO,EAAM,UAAYhB,EAAY,UAAS,EACvCgB,EAAM,MAAQhB,EAAY,YAAYS,CAAS,EAC/CO,EAAM,OAASU,EACfV,EAAM,QAAUhB,EAAY,QAE5B,OAAO,eAAegB,EAAO,UAAW,CACtC,WAAY,GACZ,aAAc,GACd,IAAK,IACCH,IAAmB,KACdA,GAGLC,IAAoBd,EAAY,aAElCc,EAAkBd,EAAY,WAC9Be,EAAef,EAAY,QAAQS,CAAS,GAGvCM,GAET,IAAKY,GAAI,CACPd,EAAiBc,CACnB,EACD,EAIG,OAAO3B,EAAY,MAAS,YAE9BA,EAAY,KAAKgB,CAAK,EAIjBA,CACT,CAEA,SAASU,EAAmBjB,EAAmBmB,EAAiB,CAC9D,IAAMC,EAAW7B,EAAY,KAAK,WAAa,OAAO4B,EAAc,IAAc,IAAMA,GAAanB,CAAS,EAC9G,OAAAoB,EAAS,IAAM,KAAK,IACbA,CACT,CAQA,SAAS1B,EAAQ2B,EAAkB,CAEjC9B,EAAY,KAAK8B,CAAU,EAE3B9B,EAAY,WAAa8B,EAEzB9B,EAAY,MAAQ,CAAA,EACpBA,EAAY,MAAQ,CAAA,EAEpB,IAAIW,EACEoB,GAAS,OAAOD,GAAe,SAAWA,EAAa,IAAI,MAAM,QAAQ,EACzEE,EAAMD,EAAM,OAElB,IAAKpB,EAAI,EAAGA,EAAIqB,EAAKrB,IACdoB,EAAMpB,CAAC,IAKZmB,EAAaC,EAAMpB,CAAC,EAAE,QAAQ,MAAO,KAAK,EAEtCmB,EAAW,CAAC,IAAM,IACpB9B,EAAY,MAAM,KAAK,IAAI,OAAO,IAAM8B,EAAW,OAAO,CAAC,EAAI,GAAG,CAAC,EAEnE9B,EAAY,MAAM,KAAK,IAAI,OAAO,IAAM8B,EAAa,GAAG,CAAC,EAG/D,CAOA,SAAS5B,GAAO,CACd,IAAM4B,EAAa,CACjB,GAAG9B,EAAY,MAAM,IAAIiC,CAAW,EACpC,GAAGjC,EAAY,MAAM,IAAIiC,CAAW,EAAE,IAAIxB,GAAa,IAAMA,CAAS,GACtE,KAAK,GAAG,EACV,OAAAT,EAAY,OAAO,EAAE,EACd8B,CACT,CAQA,SAAS1B,EAAS8B,EAAY,CAC5B,GAAIA,EAAKA,EAAK,OAAS,CAAC,IAAM,IAC5B,MAAO,GAGT,IAAIvB,EACAqB,EAEJ,IAAKrB,EAAI,EAAGqB,EAAMhC,EAAY,MAAM,OAAQW,EAAIqB,EAAKrB,IACnD,GAAIX,EAAY,MAAMW,CAAC,EAAE,KAAKuB,CAAI,EAChC,MAAO,GAIX,IAAKvB,EAAI,EAAGqB,EAAMhC,EAAY,MAAM,OAAQW,EAAIqB,EAAKrB,IACnD,GAAIX,EAAY,MAAMW,CAAC,EAAE,KAAKuB,CAAI,EAChC,MAAO,GAIX,MAAO,EACT,CAKA,SAASD,EAAaE,EAAc,CAClC,OAAOA,EAAO,SAAQ,EACnB,UAAU,EAAGA,EAAO,SAAQ,EAAG,OAAS,CAAC,EACzC,QAAQ,UAAW,GAAG,CAC3B,CAKA,SAASlC,EAAQwB,EAAQ,CACvB,OAAIA,aAAe,MACVA,EAAI,OAASA,EAAI,QAEnBA,CACT,CAMA,SAASnB,GAAO,CACd,QAAQ,KAAK,uIAAuI,CACtJ,CAGA,OAAAN,EAAY,gBAAgBA,EAAY,UAAU,EAGlDA,EAAY,OAAOA,EAAY,KAAI,CAAE,EAG9BA,CACT,CH5PA,IAAIoC,GAAS,CAAC,EAAG,EAAG,EAAG,EAAG,EAAG,CAAC,EAE1BC,GAAc,SAAW,KAAUA,GAAc,QAAUA,IAAe,OAAS,IACrFD,GAAS,CACP,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,MAUJ,IAAME,GAAc,OAAO,KAAK,QAAQ,GAAG,EAAE,OAAOC,GAC3C,WAAW,KAAKA,CAAG,CAC3B,EAAE,OAA4B,CAACC,EAAKD,IAAO,CAE1C,IAAME,EAAOF,EACV,UAAU,CAAC,EACX,YAAW,EACX,QAAQ,YAAa,CAACG,EAAGC,IACjBA,EAAE,YAAW,CACrB,EAGCC,EAAW,QAAQ,IAAIL,CAAG,EAC9B,MAAI,2BAA2B,KAAKK,CAAG,EACrCA,EAAM,GACG,6BAA6B,KAAKA,CAAG,EAC9CA,EAAM,GACGA,IAAQ,OACjBA,EAAM,KAENA,EAAM,OAAOA,CAAG,EAGlBJ,EAAIC,CAAI,EAAIG,EACLJ,CACT,EAAG,CAAA,CAAE,EAML,SAASK,IAAS,CAChB,MAAO,WAAYP,GACf,EAAQA,GAAY,OACpB,GAAAQ,QAAI,OAAO,QAAQ,OAAO,EAAE,CAClC,CAKA,SAASC,GAAuBC,EAAW,CACzC,GAAM,CACJ,UAAWC,EAAM,UAAAJ,CAAS,EACxB,KAEJ,GAAIA,IAAc,GAAM,CACtB,IAAMK,EAAI,KAAK,MACTC,EAAY,UAAcD,EAAI,EAAIA,EAAI,OAASA,GAC/CE,EAAS,KAAKD,CAAS,MAAMF,CAAI,WAEvCD,EAAK,CAAC,EAAII,EAASJ,EAAK,CAAC,EAAE,MAAM;CAAI,EAAE,KAAK;EAAOI,CAAM,EACzDJ,EAAK,KAAKG,EAAY,KAAOE,GAAS,KAAK,IAAI,EAAI,SAAW,CAChE,MACEL,EAAK,CAAC,EAAIM,GAAO,EAAKL,EAAO,IAAMD,EAAK,CAAC,CAE7C,CAEA,SAASM,IAAO,CACd,OAAIhB,GAAY,UAAY,KACnB,GAEF,IAAI,KAAI,EAAG,YAAW,EAAK,GACpC,CAKA,SAASiB,MAAQP,EAAW,CAC1B,OAAO,QAAQ,OAAO,MAAM,GAAAQ,QAAK,OAAO,GAAGR,CAAI,EAAI;CAAI,CACzD,CAOA,SAASS,GAAMC,EAAkB,CAC3BA,GAAc,KAChB,QAAQ,IAAI,MAAQA,EAIpB,OAAO,QAAQ,IAAI,KAEvB,CAOA,SAASC,IAAI,CACX,OAAO,QAAQ,IAAI,KACrB,CASA,SAASC,GAAMC,EAAU,CACvBA,EAAM,YAAc,CAAA,EAEpB,IAAMC,EAAO,OAAO,KAAKxB,EAAW,EACpC,QAASyB,EAAI,EAAGA,EAAID,EAAK,OAAQC,IAC/BF,EAAM,YAAYC,EAAKC,CAAC,CAAC,EAAIzB,GAAYwB,EAAKC,CAAC,CAAC,CAEpD,CAEA,SAASC,GAAiBC,EAAe,CAIvCA,EAAW,EAAI,SAAUC,EAAM,CAC7B,YAAK,YAAY,OAAS,KAAK,UACxB,GAAAV,QAAK,QAAQU,EAAG,KAAK,WAAW,EACpC,MAAM;CAAI,EACV,IAAIC,GAAOA,EAAI,KAAI,CAAE,EACrB,KAAK,GAAG,CACb,EAKAF,EAAW,EAAI,SAAUC,EAAM,CAC7B,YAAK,YAAY,OAAS,KAAK,UACxB,GAAAV,QAAK,QAAQU,EAAG,KAAK,WAAW,CACzC,CACF,CAEA,IAAAE,GAAeC,GAAM,CAAE,KAAAT,GAAM,IAAAL,GAAK,WAAAR,GAAY,KAAAU,GAAM,KAAAE,GAAM,UAAAd,GAAW,gBAAAmB,GAAiB,OAAA5B,GAAQ,YAAAE,EAAW,CAAE,EInM3G,IAAAgC,GAAeC,GCXfC,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcC,EAAU,WAAWD,CAAC,EAIzDD,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcE,GAAO,WAAWF,CAAC,EAItDD,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcG,GAAO,WAAWH,CAAC,EAItDD,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcA,EAAE,SAAQ,EAI7CD,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcA,EAAE,SAAQ,EAI7CD,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcA,EAAE,SAAQ,EAI7CD,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcA,EAAE,SAAQ,EAI7CD,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcI,GAASJ,EAAE,KAAK,GAAKI,GAASJ,EAAE,OAAO,GAAKA,EAAE,SAAQ,EAczF,SAASK,GAAsBC,EAAiB,CAC9C,IAAMC,EAAS,IAAW,CAAE,EAC5B,OAAAA,EAAO,QAAU,GACjBA,EAAO,MAAQ,GACfA,EAAO,KAAO,EACdA,EAAO,IAAM,IAAW,CAAE,EAC1BA,EAAO,UAAYD,EACnBC,EAAO,QAAU,IAAM,GACvBA,EAAO,OAAS,IAAMA,EAEfA,CACT,CAqEM,SAAUC,IAAa,CAC3B,MAAO,CACL,aAAcC,EAAY,CACxB,OAAOC,GAAOD,CAAI,CACpB,EAEJ,CAeM,SAAUC,GAAQD,EAAY,CAElC,IAAIE,EAAwBC,GAAqB,GAAGH,CAAI,QAAQ,EAGhE,OAAII,GAAM,QAAQ,GAAGJ,CAAI,QAAQ,GAAKI,GAAM,MAAM,IAAKC,GAAWA,EAAE,SAAQ,CAAE,EAAE,KAAMC,GAAcA,EAAE,SAAS,QAAQ,CAAC,GAAK,OAC3HJ,EAAQE,GAAM,GAAGJ,CAAI,QAAQ,GAGxB,OAAO,OAAOI,GAAMJ,CAAI,EAAG,CAChC,MAAOI,GAAM,GAAGJ,CAAI,QAAQ,EAC5B,MAAAE,EACD,CACH,CAcA,SAASK,GAAUC,EAAY,CAC7B,GAAIA,GAAO,OAIXA,EAAMA,EAAI,KAAI,EAEVA,EAAI,SAAW,GAInB,OAAOA,CACT,CC3Oe,SAARC,IAA0B,CAChC,IAAMC,EAAW,CAAC,EAElB,OAAAA,EAAS,QAAU,IAAI,QAAQ,CAACC,EAASC,IAAW,CACnDF,EAAS,QAAUC,EACnBD,EAAS,OAASE,CACnB,CAAC,EAEMF,CACR,CCNM,IAAOG,GAAP,cAA0B,KAAK,CAC5B,KACA,KAEP,YAAaC,EAAkBC,EAAeC,EAAa,CACzD,MAAMF,GAAW,2BAA2B,EAC5C,KAAK,KAAO,UACZ,KAAK,KAAOE,GAAQ,aACpB,KAAK,KAAOD,GAAQ,WACtB,GAuBF,eAAsBE,GAAgBC,EAAqBC,EAAsBC,EAAwB,CACvG,GAAID,GAAU,KACZ,OAAOD,EAGT,GAAIC,EAAO,QAGT,OAAAD,EAAQ,MAAM,IAAK,CAAE,CAAC,EACf,QAAQ,OAAO,IAAIL,GAAWO,GAAM,aAAcA,GAAM,UAAWA,GAAM,SAAS,CAAC,EAG5F,IAAIC,EAGEC,EAAQ,IAAIT,GAAWO,GAAM,aAAcA,GAAM,UAAWA,GAAM,SAAS,EAEjF,GAAI,CACF,OAAO,MAAM,QAAQ,KAAK,CACxBF,EACA,IAAI,QAAW,CAACK,EAASC,IAAU,CACjCH,EAAW,IAAK,CACdG,EAAOF,CAAK,CACd,EACAH,EAAO,iBAAiB,QAASE,CAAQ,CAC3C,CAAC,EACF,CACH,SACMA,GAAY,MACdF,EAAO,oBAAoB,QAASE,CAAQ,CAEhD,CACF,CCjBA,IAAMI,GAAN,KAAuB,CACb,SACA,SACA,MACA,WACA,MAER,aAAA,CACE,KAAK,MAAQ,GAEb,KAAK,SAAWC,GAAQ,EACxB,KAAK,SAAWA,GAAQ,CAC1B,CAEA,CAAC,OAAO,aAAa,GAAC,CACpB,OAAO,IACT,CAEA,MAAM,MAAI,CAMR,GALI,KAAK,YAAc,MAErB,MAAM,KAAK,SAAS,QAGlB,KAAK,YAAc,KACrB,MAAM,IAAI,MAAM,wDAAwD,EAG1E,IAAMC,EAAa,KAAK,WACxB,YAAK,WAAa,OAGlB,KAAK,SAAS,QAAO,EACrB,KAAK,SAAWD,GAAQ,EAEjBC,CACT,CAEA,MAAM,MAAOC,EAAW,CACtB,YAAK,MAAQ,GACb,KAAK,MAAQA,EAETA,GAAO,OAGT,KAAK,SAAS,QAAQ,MAAM,IAAK,CAAE,CAAC,EACpC,KAAK,SAAS,OAAOA,CAAG,GAGsB,CAC9C,KAAM,GACN,MAAO,OAIX,CAEA,MAAM,QAAM,CACV,IAAMC,EAA0C,CAC9C,KAAM,GACN,MAAO,QAGT,YAAK,MAAQ,GACb,KAAK,WAAaA,EAGlB,KAAK,SAAS,QAAO,EAEdA,CACT,CAEA,MAAM,KAAMC,EAAUC,EAA0C,CAC9D,MAAM,KAAK,MAAMD,EAAOC,CAAO,CACjC,CAEA,MAAM,IAAKH,EAAaG,EAA0C,CAC5DH,GAAO,KACT,MAAM,KAAK,MAAMA,CAAG,EAGpB,MAAM,KAAK,MAAM,OAAWG,CAAO,CAEvC,CAEQ,MAAM,MAAOD,EAAWC,EAA0C,CACxE,GAAID,GAAS,MAAQ,KAAK,MACxB,MAAM,KAAK,OAAS,IAAI,MAAM,0CAA0C,EAI1E,KAAO,KAAK,YAAc,MACxB,MAAM,KAAK,SAAS,QAGlBA,GAAS,KACX,KAAK,WAAa,CAAE,KAAM,GAAO,MAAAA,CAAK,GAEtC,KAAK,MAAQ,GACb,KAAK,WAAa,CAAE,KAAM,GAAM,MAAO,MAAS,GAIlD,KAAK,SAAS,QAAO,EACrB,KAAK,SAAWJ,GAAQ,EAIxB,MAAMM,GACJ,KAAK,SAAS,QACdD,GAAS,OACTA,CAAO,CAEX,GAGI,SAAUE,IAAiB,CAC/B,OAAO,IAAIR,EACb,CCxKA,IAAAS,GAAuB,kBAMjB,SAAUC,GAAQC,EAAsBC,EAAe,CAC3D,OAAOC,GAAa,UAAO,OAAOF,EAAQC,CAAM,CAAC,CACnD,CCLM,SAAUE,GAAQC,EAAeC,EAAa,CAClD,GAAID,IAAMC,EACR,MAAO,GAGT,GAAID,EAAE,aAAeC,EAAE,WACrB,MAAO,GAGT,QAASC,EAAI,EAAGA,EAAIF,EAAE,WAAYE,IAChC,GAAIF,EAAEE,CAAC,IAAMD,EAAEC,CAAC,EACd,MAAO,GAIX,MAAO,EACT,CCmEA,IAAMC,GAAS,OAAO,IAAI,6BAA6B,EAIvD,SAASC,GAAkBC,EAAoBC,EAAa,CAC1D,GAAIA,GAAS,MAAQA,EAAQ,EAC3B,MAAM,IAAI,WAAW,wBAAwB,EAG/C,IAAIC,EAAS,EAEb,QAAWC,KAAOH,EAAM,CACtB,IAAMI,EAASF,EAASC,EAAI,WAE5B,GAAIF,EAAQG,EACV,MAAO,CACL,IAAAD,EACA,MAAOF,EAAQC,GAInBA,EAASE,CACX,CAEA,MAAM,IAAI,WAAW,wBAAwB,CAC/C,CAeM,SAAUC,GAAkBC,EAAU,CAC1C,MAAO,EAAQA,IAAQR,EAAM,CAC/B,CAEM,IAAOS,GAAP,MAAOC,CAAc,CACjB,KACD,OACS,CAACV,EAAM,EAAI,GAE3B,eAAgBW,EAAkB,CAChC,KAAK,KAAO,CAAA,EACZ,KAAK,OAAS,EAEVA,EAAK,OAAS,GAChB,KAAK,UAAUA,CAAI,CAEvB,CAEA,EAAG,OAAO,QAAQ,GAAC,CACjB,MAAQ,KAAK,IACf,CAEA,IAAI,YAAU,CACZ,OAAO,KAAK,MACd,CAKA,UAAWT,EAAkB,CAC3B,KAAK,UAAUA,CAAI,CACrB,CAKA,UAAWA,EAAkB,CAC3B,IAAIU,EAAS,EAEb,QAAWP,KAAOH,EAChB,GAAIG,aAAe,WACjBO,GAAUP,EAAI,WACd,KAAK,KAAK,KAAKA,CAAG,UACTE,GAAiBF,CAAG,EAC7BO,GAAUP,EAAI,WACd,KAAK,KAAK,KAAK,GAAGA,EAAI,IAAI,MAE1B,OAAM,IAAI,MAAM,mEAAmE,EAIvF,KAAK,QAAUO,CACjB,CAKA,WAAYV,EAAkB,CAC5B,KAAK,WAAWA,CAAI,CACtB,CAKA,WAAYA,EAAkB,CAC5B,IAAIU,EAAS,EAEb,QAAWP,KAAOH,EAAK,QAAO,EAC5B,GAAIG,aAAe,WACjBO,GAAUP,EAAI,WACd,KAAK,KAAK,QAAQA,CAAG,UACZE,GAAiBF,CAAG,EAC7BO,GAAUP,EAAI,WACd,KAAK,KAAK,QAAQ,GAAGA,EAAI,IAAI,MAE7B,OAAM,IAAI,MAAM,oEAAoE,EAIxF,KAAK,QAAUO,CACjB,CAKA,IAAKT,EAAa,CAChB,IAAMU,EAAMZ,GAAiB,KAAK,KAAME,CAAK,EAE7C,OAAOU,EAAI,IAAIA,EAAI,KAAK,CAC1B,CAKA,IAAKV,EAAeK,EAAa,CAC/B,IAAMK,EAAMZ,GAAiB,KAAK,KAAME,CAAK,EAE7CU,EAAI,IAAIA,EAAI,KAAK,EAAIL,CACvB,CAKA,MAAOH,EAAiBD,EAAiB,EAAC,CACxC,GAAIC,aAAe,WACjB,QAASS,EAAI,EAAGA,EAAIT,EAAI,OAAQS,IAC9B,KAAK,IAAIV,EAASU,EAAGT,EAAIS,CAAC,CAAC,UAEpBP,GAAiBF,CAAG,EAC7B,QAASS,EAAI,EAAGA,EAAIT,EAAI,OAAQS,IAC9B,KAAK,IAAIV,EAASU,EAAGT,EAAI,IAAIS,CAAC,CAAC,MAGjC,OAAM,IAAI,MAAM,kEAAkE,CAEtF,CAKA,QAASC,EAAa,CAKpB,GAHAA,EAAQ,KAAK,MAAMA,CAAK,EAGpB,SAAO,MAAMA,CAAK,GAAKA,GAAS,GAKpC,IAAIA,IAAU,KAAK,WAAY,CAC7B,KAAK,KAAO,CAAA,EACZ,KAAK,OAAS,EACd,MACF,CAEA,KAAO,KAAK,KAAK,OAAS,GACxB,GAAIA,GAAS,KAAK,KAAK,CAAC,EAAE,WACxBA,GAAS,KAAK,KAAK,CAAC,EAAE,WACtB,KAAK,QAAU,KAAK,KAAK,CAAC,EAAE,WAC5B,KAAK,KAAK,MAAK,MACV,CACL,KAAK,KAAK,CAAC,EAAI,KAAK,KAAK,CAAC,EAAE,SAASA,CAAK,EAC1C,KAAK,QAAUA,EACf,KACF,EAEJ,CAQA,MAAOC,EAAyBC,EAAqB,CACnD,GAAM,CAAE,KAAAf,EAAM,OAAAU,CAAM,EAAK,KAAK,SAASI,EAAgBC,CAAY,EAEnE,OAAOC,GAAOhB,EAAMU,CAAM,CAC5B,CAQA,SAAUI,EAAyBC,EAAqB,CACtD,GAAM,CAAE,KAAAf,EAAM,OAAAU,CAAM,EAAK,KAAK,SAASI,EAAgBC,CAAY,EAEnE,OAAIf,EAAK,SAAW,EACXA,EAAK,CAAC,EAGRgB,GAAOhB,EAAMU,CAAM,CAC5B,CAOA,QAASI,EAAyBC,EAAqB,CACrD,GAAM,CAAE,KAAAf,EAAM,OAAAU,CAAM,EAAK,KAAK,SAASI,EAAgBC,CAAY,EAE7DE,EAAO,IAAIT,EACjB,OAAAS,EAAK,OAASP,EAEdO,EAAK,KAAO,CAAC,GAAGjB,CAAI,EAEbiB,CACT,CAEQ,SAAUH,EAAyBC,EAAqB,CAY9D,GAXAD,EAAiBA,GAAkB,EACnCC,EAAeA,GAAgB,KAAK,OAEhCD,EAAiB,IACnBA,EAAiB,KAAK,OAASA,GAG7BC,EAAe,IACjBA,EAAe,KAAK,OAASA,GAG3BD,EAAiB,GAAKC,EAAe,KAAK,OAC5C,MAAM,IAAI,WAAW,wBAAwB,EAG/C,GAAID,IAAmBC,EACrB,MAAO,CAAE,KAAM,CAAA,EAAI,OAAQ,CAAC,EAG9B,GAAID,IAAmB,GAAKC,IAAiB,KAAK,OAChD,MAAO,CAAE,KAAM,KAAK,KAAM,OAAQ,KAAK,MAAM,EAG/C,IAAMf,EAAqB,CAAA,EACvBE,EAAS,EAEb,QAAS,EAAI,EAAG,EAAI,KAAK,KAAK,OAAQ,IAAK,CACzC,IAAMC,EAAM,KAAK,KAAK,CAAC,EACjBe,EAAWhB,EACXE,EAASc,EAAWf,EAAI,WAK9B,GAFAD,EAASE,EAELU,GAAkBV,EAEpB,SAGF,IAAMe,EAAkBL,GAAkBI,GAAYJ,EAAiBV,EACjEgB,EAAiBL,EAAeG,GAAYH,GAAgBX,EAElE,GAAIe,GAAmBC,EAAgB,CAErC,GAAIN,IAAmBI,GAAYH,IAAiBX,EAAQ,CAE1DJ,EAAK,KAAKG,CAAG,EACb,KACF,CAGA,IAAMkB,EAAQP,EAAiBI,EAC/BlB,EAAK,KAAKG,EAAI,SAASkB,EAAOA,GAASN,EAAeD,EAAe,CAAC,EACtE,KACF,CAEA,GAAIK,EAAiB,CAEnB,GAAIL,IAAmB,EAAG,CAExBd,EAAK,KAAKG,CAAG,EACb,QACF,CAGAH,EAAK,KAAKG,EAAI,SAASW,EAAiBI,CAAQ,CAAC,EACjD,QACF,CAEA,GAAIE,EAAgB,CAClB,GAAIL,IAAiBX,EAAQ,CAE3BJ,EAAK,KAAKG,CAAG,EACb,KACF,CAGAH,EAAK,KAAKG,EAAI,SAAS,EAAGY,EAAeG,CAAQ,CAAC,EAClD,KACF,CAGAlB,EAAK,KAAKG,CAAG,CACf,CAEA,MAAO,CAAE,KAAAH,EAAM,OAAQe,EAAeD,CAAc,CACtD,CAEA,QAASQ,EAAqCpB,EAAiB,EAAC,CAC9D,GAAI,CAACG,GAAiBiB,CAAM,GAAK,EAAEA,aAAkB,YACnD,MAAM,IAAI,UAAU,6DAA6D,EAGnF,IAAMC,EAASD,aAAkB,WAAaA,EAASA,EAAO,SAAQ,EAgBtE,GAdApB,EAAS,OAAOA,GAAU,CAAC,EAEvB,MAAMA,CAAM,IACdA,EAAS,GAGPA,EAAS,IACXA,EAAS,KAAK,OAASA,GAGrBA,EAAS,IACXA,EAAS,GAGPoB,EAAO,SAAW,EACpB,OAAOpB,EAAS,KAAK,OAAS,KAAK,OAASA,EAI9C,IAAMsB,EAAYD,EAAO,WAEzB,GAAIC,IAAM,EACR,MAAM,IAAI,UAAU,qCAAqC,EAI3D,IAAMC,EAAgB,IAChBC,EAAiC,IAAI,WAAWD,CAAK,EAG3D,QAASE,EAAY,EAAGA,EAAIF,EAAOE,IAEjCD,EAAmBC,CAAC,EAAI,GAG1B,QAASC,EAAI,EAAGA,EAAIJ,EAAGI,IAErBF,EAAmBH,EAAOK,CAAC,CAAC,EAAIA,EAIlC,IAAMC,EAAQH,EACRI,EAAY,KAAK,WAAaP,EAAO,WACrCQ,EAAeR,EAAO,WAAa,EACrCS,EAEJ,QAASpB,EAAIV,EAAQU,GAAKkB,EAAWlB,GAAKoB,EAAM,CAC9CA,EAAO,EAEP,QAASJ,EAAIG,EAAcH,GAAK,EAAGA,IAAK,CACtC,IAAMK,EAAe,KAAK,IAAIrB,EAAIgB,CAAC,EAEnC,GAAIL,EAAOK,CAAC,IAAMK,EAAM,CACtBD,EAAO,KAAK,IAAI,EAAGJ,EAAIC,EAAMI,CAAI,CAAC,EAClC,KACF,CACF,CAEA,GAAID,IAAS,EACX,OAAOpB,CAEX,CAEA,MAAO,EACT,CAEA,QAASsB,EAAkB,CACzB,IAAM/B,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,QAAQ,CAAC,CACvB,CAEA,QAAS+B,EAAoB5B,EAAa,CACxC,IAAMH,EAAMgC,GAAY,CAAC,EACZ,IAAI,SAAShC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,QAAQ,EAAGG,CAAK,EAErB,KAAK,MAAMH,EAAK+B,CAAU,CAC5B,CAEA,SAAUA,EAAoBE,EAAsB,CAClD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,SAAS,EAAGiC,CAAY,CACtC,CAEA,SAAUF,EAAoB5B,EAAe8B,EAAsB,CACjE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,SAAS,EAAGG,EAAO8B,CAAY,EAEpC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,SAAUA,EAAoBE,EAAsB,CAClD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,SAAS,EAAGiC,CAAY,CACtC,CAEA,SAAUF,EAAoB5B,EAAe8B,EAAsB,CACjE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,SAAS,EAAGG,EAAO8B,CAAY,EAEpC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,YAAaA,EAAoBE,EAAsB,CACrD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,YAAY,EAAGiC,CAAY,CACzC,CAEA,YAAaF,EAAoB5B,EAAe8B,EAAsB,CACpE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,YAAY,EAAGG,EAAO8B,CAAY,EAEvC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,SAAUA,EAAkB,CAC1B,IAAM/B,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,SAAS,CAAC,CACxB,CAEA,SAAU+B,EAAoB5B,EAAa,CACzC,IAAMH,EAAMgC,GAAY,CAAC,EACZ,IAAI,SAAShC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,SAAS,EAAGG,CAAK,EAEtB,KAAK,MAAMH,EAAK+B,CAAU,CAC5B,CAEA,UAAWA,EAAoBE,EAAsB,CACnD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,UAAU,EAAGiC,CAAY,CACvC,CAEA,UAAWF,EAAoB5B,EAAe8B,EAAsB,CAClE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,UAAU,EAAGG,EAAO8B,CAAY,EAErC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,UAAWA,EAAoBE,EAAsB,CACnD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,UAAU,EAAGiC,CAAY,CACvC,CAEA,UAAWF,EAAoB5B,EAAe8B,EAAsB,CAClE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,UAAU,EAAGG,EAAO8B,CAAY,EAErC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,aAAcA,EAAoBE,EAAsB,CACtD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,aAAa,EAAGiC,CAAY,CAC1C,CAEA,aAAcF,EAAoB5B,EAAe8B,EAAsB,CACrE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,aAAa,EAAGG,EAAO8B,CAAY,EAExC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,WAAYA,EAAoBE,EAAsB,CACpD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,WAAW,EAAGiC,CAAY,CACxC,CAEA,WAAYF,EAAoB5B,EAAe8B,EAAsB,CACnE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,WAAW,EAAGG,EAAO8B,CAAY,EAEtC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,WAAYA,EAAoBE,EAAsB,CACpD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,WAAW,EAAGiC,CAAY,CACxC,CAEA,WAAYF,EAAoB5B,EAAe8B,EAAsB,CACnE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,WAAW,EAAGG,EAAO8B,CAAY,EAEtC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,OAAQI,EAAU,CAShB,GARIA,GAAS,MAIT,EAAEA,aAAiB9B,IAInB8B,EAAM,KAAK,SAAW,KAAK,KAAK,OAClC,MAAO,GAGT,QAAS1B,EAAI,EAAGA,EAAI,KAAK,KAAK,OAAQA,IACpC,GAAI,CAAC2B,GAAO,KAAK,KAAK3B,CAAC,EAAG0B,EAAM,KAAK1B,CAAC,CAAC,EACrC,MAAO,GAIX,MAAO,EACT,CAMA,OAAO,gBAAiBZ,EAAoBU,EAAe,CACzD,IAAMO,EAAO,IAAIT,EACjB,OAAAS,EAAK,KAAOjB,EAERU,GAAU,OACZA,EAASV,EAAK,OAAO,CAACwC,EAAKC,IAASD,EAAMC,EAAK,WAAY,CAAC,GAG9DxB,EAAK,OAASP,EAEPO,CACT,GCzpBI,IAAOyB,GAAP,cAAkC,KAAK,CAC3C,KAAO,qBACP,KAAO,sBCiEH,SAAUC,GAAmDC,EAAgBC,EAAqB,CACtG,IAAMC,EAAQC,GAAiB,EAE/BH,EAAO,KAAKE,CAAK,EAAE,MAAM,MAAOE,GAAc,CAC5C,MAAMF,EAAM,IAAIE,CAAG,CACrB,CAAC,EAEDJ,EAAO,KAAO,MAAOK,GAAe,CAClC,cAAiBC,KAAOD,EACtB,MAAMH,EAAM,KAAKI,CAAG,EAGtB,MAAMJ,EAAM,IAAG,CACjB,EAEA,IAAIG,EAA8BL,EAAO,OAErCA,EAAO,OAAO,OAAO,QAAQ,GAAK,KACpCK,EAASL,EAAO,OAAO,OAAO,QAAQ,EAAC,EAC9BA,EAAO,OAAO,OAAO,aAAa,GAAK,OAChDK,EAASL,EAAO,OAAO,OAAO,aAAa,EAAC,GAG9C,IAAMO,EAAa,IAAIC,GA4DvB,MA1D8B,CAC5B,KAAM,MAAOC,GAAyB,CAGpC,GAFAA,GAAS,QAAQ,eAAc,EAE3BA,GAAS,OAAS,KAAM,CAE1B,GAAM,CAAE,KAAAC,EAAM,MAAAC,CAAK,EAAK,MAAMC,GAAWP,EAAO,KAAI,EAAII,GAAS,MAAM,EAEvE,OAAIC,IAAS,GACJ,KAGFC,CACT,CAEA,KAAOJ,EAAW,WAAaE,EAAQ,OAAO,CAC5C,GAAM,CAAE,MAAAE,EAAO,KAAAD,CAAI,EAAK,MAAME,GAAWP,EAAO,KAAI,EAAII,GAAS,MAAM,EAEvE,GAAIC,IAAS,GACX,MAAM,IAAIG,GAAmB,yBAAyB,EAGxDN,EAAW,OAAOI,CAAK,CACzB,CAEA,IAAML,EAAMC,EAAW,QAAQ,EAAGE,EAAQ,KAAK,EAC/C,OAAAF,EAAW,QAAQE,EAAQ,KAAK,EAEzBH,CACT,EACA,MAAO,MAAOQ,EAAML,IAA0B,CAC5CA,GAAS,QAAQ,eAAc,EAG3BK,aAAgB,WAClB,MAAMZ,EAAM,KAAKY,EAAML,CAAO,EAE9B,MAAMP,EAAM,KAAKY,EAAK,SAAQ,EAAIL,CAAO,CAE7C,EACA,OAAQ,IAAK,CACX,GAAIF,EAAW,WAAa,EAAG,CAC7B,IAAMQ,EAAiBf,EAAO,OAC9BA,EAAO,QAAU,iBAAgB,CAC3BC,GAAM,aAAe,GACvB,MAAMM,EAEN,MAAQA,EAGV,MAAQQ,CACV,GAAC,CACH,CAEA,OAAOf,CACT,EAIJ,CCvJM,IAAOgB,GAAP,cAAyC,KAAK,CAClD,KAAO,4BACP,KAAO,0BAOIC,GAAP,cAAsC,KAAK,CAC/C,KAAO,yBACP,KAAO,yBAOIC,GAAP,cAA4C,KAAK,CACrD,KAAO,+BACP,KAAO,2BC0CH,SAAUC,GAAiDC,EAAgBC,EAA0C,CAAA,EAAE,CAC3H,IAAMC,EAAQC,GAAWH,EAAQC,CAAI,EAEjCA,EAAK,eAAiB,MAAQA,EAAK,iBAAmB,OAGxDA,EAAK,gBAAyBG,GAAeH,EAAK,aAAa,GAGjE,IAAMI,EAAeJ,GAAM,eAAwBK,GAC7CC,EAAeN,GAAM,eAAwBO,GA+DnD,MA7DwC,CACtC,KAAM,MAAOC,GAA0B,CACrC,IAAIC,EAAqB,GACnBC,EAAe,IAAIC,GAEzB,OAAa,CAEXD,EAAa,OAAO,MAAMT,EAAM,KAAK,CACnC,GAAGO,EACH,MAAO,EACR,CAAC,EAEF,GAAI,CACFC,EAAaL,EAAaM,CAAY,CACxC,OAASE,EAAK,CACZ,GAAIA,aAAe,WACjB,SAGF,MAAMA,CACR,CAEA,GAAIH,EAAa,EACf,MAAM,IAAII,GAA0B,wBAAwB,EAG9D,GAAIb,GAAM,iBAAmB,MAAQU,EAAa,WAAaV,EAAK,gBAClE,MAAM,IAAIc,GAA6B,gCAAgC,EAGzE,GAAIL,EAAa,GACf,KAEJ,CAEA,GAAIT,GAAM,eAAiB,MAAQS,EAAaT,EAAK,cACnD,MAAM,IAAIe,GAAuB,yBAAyB,EAG5D,OAAOd,EAAM,KAAK,CAChB,GAAGO,EACH,MAAOC,EACR,CACH,EACA,MAAO,MAAOO,EAAMR,IAA0B,CAE5C,MAAMP,EAAM,MAAM,IAAIU,GAAeL,EAAaU,EAAK,UAAU,EAAGA,CAAI,EAAGR,CAAO,CACpF,EACA,OAAQ,MAAOQ,EAAMR,IAA0B,CAC7C,IAAMS,EAAO,IAAIN,GACf,GAAGK,EAAK,QAAQE,GAAQ,CAACZ,EAAaY,EAAI,UAAU,EAAGA,CAAG,CAAE,CAAC,EAI/D,MAAMjB,EAAM,MAAMgB,EAAMT,CAAO,CACjC,EACA,OAAQ,IACCP,EAAM,OAAM,EAKzB,CCrIA,IAAMkB,GAAMC,GAAO,uCAAuC,EAO7CC,GAAP,KAAoB,CACP,OACA,GAKjB,YAAaC,EAA0B,CACrC,GAAM,CAAE,OAAAC,EAAQ,UAAAC,CAAS,EAAKF,EAE9B,KAAK,OAASC,EACd,KAAK,GAAKE,GAAS,KAAK,OAAQ,CAAE,cAAeD,GAAa,IAAI,CAAE,CACtE,CAKA,MAAM,MAAI,CACR,GAAI,CACF,OAAO,MAAM,KAAK,GAAG,KAAI,CAC3B,OAASE,EAAK,CACZP,GAAI,MAAM,yBAA0BO,CAAG,CACzC,CACF,CAEA,MAAM,MAAOC,EAAgC,CAC3CR,GAAI,eAAe,EACnB,MAAM,KAAK,GAAG,MAAMQ,CAAG,CACzB,CAKA,MAAI,CACF,OAAO,KAAK,GAAG,OAAM,CACvB,CAKA,MAAM,OAAK,CACTR,GAAI,oBAAoB,EACxB,MAAM,KAAK,KAAI,EAAG,MAAK,CACzB,GC/CI,SAAUS,GAAWC,EAA8C,CACvE,IAAMC,EAAa,IAAI,WAAW,gBAElC,SAASC,GAAO,CACdD,EAAW,MAAK,EAEhB,QAAWE,KAAUH,EACfG,GAAQ,qBAAuB,MACjCA,EAAO,oBAAoB,QAASD,CAAO,CAGjD,CAEA,QAAWC,KAAUH,EAAS,CAC5B,GAAIG,GAAQ,UAAY,GAAM,CAC5BD,EAAO,EACP,MAGEC,GAAQ,kBAAoB,MAC9BA,EAAO,iBAAiB,QAASD,CAAO,EAI5C,SAASE,GAAK,CACZ,QAAWD,KAAUH,EACfG,GAAQ,qBAAuB,MACjCA,EAAO,oBAAoB,QAASD,CAAO,CAGjD,CAEA,IAAMC,EAASF,EAAW,OAC1B,OAAAE,EAAO,MAAQC,EAERD,CACT,CCtCM,IAAOE,GAAP,KAA0B,CACb,aAEjB,YAAaC,EAAsB,CACjC,KAAK,aAAeA,CACtB,CAEA,MAAM,eAAgBC,EAA2B,CAC/C,KAAK,eAAeA,CAAM,CAC5B,CAEA,MAAM,gBAAiBA,EAA2B,CAEhD,OAAOA,CACT,CAEA,yBAA0BC,EAAmB,CAC3C,OAAOC,GAAU,CAACD,CAAM,CAAC,CAC3B,CAEA,iBAAe,CACb,OAAO,IAAI,GACb,CAEA,yBAAuB,CACrB,OAAO,IAAI,GACb,GC0HK,IAAME,GAAe,OAAO,IAAI,iBAAiB,EAKlD,SAAUC,GAAUC,EAAW,CACnC,MAAO,EAAQA,IAAQF,EAAY,CACrC,CClHO,IAAMG,GAAkB,OAAO,IAAI,mBAAmB,EAwE7D,IAAYC,IAAZ,SAAYA,EAAc,CAIxBA,EAAAA,EAAA,UAAA,CAAA,EAAA,YAKAA,EAAAA,EAAA,SAAA,CAAA,EAAA,UACF,GAVYA,KAAAA,GAAc,CAAA,EAAA,ECnHpB,IAAOC,GAAP,cAA0B,KAAK,CACnC,OAAO,KAAO,aAEd,YAAaC,EAAkB,4BAA2B,CACxD,MAAMA,CAAO,EACb,KAAK,KAAO,YACd,GA8BI,IAAOC,EAAP,cAAsC,KAAK,CAC/C,OAAO,KAAO,yBAEd,YAAaC,EAAU,qBAAoB,CACzC,MAAMA,CAAO,EACb,KAAK,KAAO,wBACd,GAMWC,GAAP,cAAqC,KAAK,CAC9C,OAAO,KAAO,wBAEd,YAAaD,EAAU,qBAAoB,CACzC,MAAMA,CAAO,EACb,KAAK,KAAO,uBACd,GAsJI,IAAOE,GAAP,cAAqC,KAAK,CAC9C,OAAO,KAAO,wBAEd,YAAaC,EAAU,oBAAmB,CACxC,MAAMA,CAAO,EACb,KAAK,KAAO,uBACd,GAkBI,IAAOC,GAAP,cAAmC,KAAK,CAC5C,OAAO,KAAO,sBAEd,YAAaC,EAAU,kBAAiB,CACtC,MAAMA,CAAO,EACb,KAAK,KAAO,qBACd,GAOWC,GAAP,cAA6B,KAAK,CACtC,OAAO,KAAO,gBAEd,YAAaD,EAAU,iBAAgB,CACrC,MAAMA,CAAO,EACb,KAAK,KAAO,eACd,GAMWE,GAAP,cAA4B,KAAK,CACrC,OAAO,KAAO,eAEd,YAAaF,EAAU,YAAW,CAChC,MAAMA,CAAO,EACb,KAAK,KAAO,cACd,GAOWG,GAAP,cAA+B,KAAK,CACxC,OAAO,KAAO,kBAEd,YAAaH,EAAU,cAAa,CAClC,MAAMA,CAAO,EACb,KAAK,KAAO,iBACd,GAMWI,GAAP,cAAmC,KAAK,CAC5C,OAAO,KAAO,sBAEd,YAAaJ,EAAU,kBAAiB,CACtC,MAAMA,CAAO,EACb,KAAK,KAAO,qBACd,GAoEI,IAAOK,GAAP,cAAuC,KAAK,CAChD,OAAO,KAAO,0BAEd,YAAaC,EAAU,uBAAsB,CAC3C,MAAMA,CAAO,EACb,KAAK,KAAO,yBACd,GC3WF,IAAAC,GAAuD,kBAK1CC,GAA8C,CAACC,KAAMC,IAAgB,CAChF,GAAI,IACF,GAAAC,iBAAoBF,EAAG,GAAGC,CAAY,CACxC,MAAQ,CAER,CACF,ECkFM,IAAOE,GAAP,cAAuE,WAAW,CAC7EC,GAAa,IAAI,IAE1B,aAAA,CACE,MAAK,EAILC,GAAgB,IAAU,IAAI,CAChC,CAEA,cAAeC,EAAY,CACzB,IAAMC,EAAY,KAAKH,GAAW,IAAIE,CAAI,EAE1C,OAAIC,GAAa,KACR,EAGFA,EAAU,MACnB,CAGA,iBAAkBD,EAAcE,EAA+BC,EAA2C,CACxG,MAAM,iBAAiBH,EAAME,EAAUC,CAAO,EAE9C,IAAIC,EAAO,KAAKN,GAAW,IAAIE,CAAI,EAE/BI,GAAQ,OACVA,EAAO,CAAA,EACP,KAAKN,GAAW,IAAIE,EAAMI,CAAI,GAGhCA,EAAK,KAAK,CACR,SAAUF,EACV,MAAOC,IAAY,IAAQA,IAAY,IAASA,GAAS,OAAS,GACnE,CACH,CAGA,oBAAqBH,EAAcE,EAAgCC,EAAwC,CACzG,MAAM,oBAAoBH,EAAK,SAAQ,EAAIE,GAAY,KAAMC,CAAO,EAEpE,IAAIC,EAAO,KAAKN,GAAW,IAAIE,CAAI,EAE/BI,GAAQ,OAIZA,EAAOA,EAAK,OAAO,CAAC,CAAE,SAAAC,CAAQ,IAAOA,IAAaH,CAAQ,EAC1D,KAAKJ,GAAW,IAAIE,EAAMI,CAAI,EAChC,CAEA,cAAeE,EAAY,CACzB,IAAMC,EAAS,MAAM,cAAcD,CAAK,EAEpCF,EAAO,KAAKN,GAAW,IAAIQ,EAAM,IAAI,EAEzC,OAAIF,GAAQ,OAIZA,EAAOA,EAAK,OAAO,CAAC,CAAE,KAAAI,CAAI,IAAO,CAACA,CAAI,EACtC,KAAKV,GAAW,IAAIQ,EAAM,KAAMF,CAAI,GAE7BG,CACT,CAEA,kBAA0BP,EAAsBS,EAAkC,CAAA,EAAE,CAClF,OAAO,KAAK,cAAc,IAAI,YAAoBT,EAAgBS,CAAM,CAAC,CAC3E,GCisBK,IAAMC,GAAsB,OAAO,IAAI,8BAA8B,EAS/DC,GAAsB,OAAO,IAAI,8BAA8B,EC52B5E,IAAAC,GAAuB,kBAYjB,SAAUC,EAAUC,EAAmBC,EAA+B,OAAM,CAChF,IAAMC,EAAOC,GAAMF,CAAQ,EAE3B,GAAIC,GAAQ,KACV,MAAM,IAAI,MAAM,yBAAyBD,CAAQ,GAAG,EAGtD,OAAIA,IAAa,QAAUA,IAAa,QAC/B,UAAO,KAAKD,EAAM,OAAQA,EAAM,WAAYA,EAAM,UAAU,EAAE,SAAS,MAAM,EAI/EE,EAAK,QAAQ,OAAOF,CAAK,EAAE,UAAU,CAAC,CAC/C,CCnBA,IAAMI,GAAW,SAAS,QAAS,CAAC,EAC9BC,GAAmB,SAAS,WAAY,CAAC,EACzCC,GAAyB,SAAS,WAAY,CAAC,EAM/CC,GAAoC,CACxC,EAAKC,GACL,EAAKA,GACL,EAAKC,GACL,EAAKC,GACL,EAAKC,GACL,EAAKC,GACL,EAAKC,GACL,GAAML,GACN,GAAMA,GACN,GAAMA,IAGF,SAAUM,GAAWC,EAAiBC,EAAmB,CAAE,OAAQ,CAAC,EAAE,CAC1E,IAAMC,EAAMF,EAAIC,EAAQ,MAAM,EAAIZ,GAGlC,GAFAY,EAAQ,SAEJT,GAASU,CAAG,GAAK,KACnB,OAAOV,GAASU,CAAG,EAAEF,EAAKC,CAAO,EAGnC,MAAM,IAAI,MAAM,sBAAwBC,CAAG,CAC7C,CAEA,SAASC,GAAYH,EAAiBC,EAAgB,CACpD,IAAIG,EAAS,EAEb,IAAKJ,EAAIC,EAAQ,MAAM,EAAIX,MAAsBA,GAAkB,CAEjE,IAAMe,EAAQL,EAAIC,EAAQ,MAAM,EAAIV,GAChCe,EAAM,KACVL,EAAQ,SAER,QAAS,EAAI,EAAG,EAAII,EAAO,IAAKJ,EAAQ,SACtCK,GAAON,EAAIC,EAAQ,MAAM,EAAE,SAAS,EAAE,EAAE,SAAS,EAAG,GAAG,EAGzDG,EAAS,SAASE,EAAK,EAAE,CAC3B,MACEF,EAASJ,EAAIC,EAAQ,MAAM,EAC3BA,EAAQ,SAGV,OAAOG,CACT,CAEA,SAASX,GAAcO,EAAiBC,EAAgB,CACtDE,GAAWH,EAAKC,CAAO,EACvB,IAAMM,EAAiB,CAAA,EAEvB,KACM,EAAAN,EAAQ,QAAUD,EAAI,aADf,CAKX,IAAMQ,EAAST,GAAUC,EAAKC,CAAO,EAErC,GAAIO,IAAW,KACb,MAGFD,EAAQ,KAAKC,CAAM,CACrB,CAEA,OAAOD,CACT,CAEA,SAASb,GAAaM,EAAiBC,EAAgB,CACrD,IAAMG,EAASD,GAAWH,EAAKC,CAAO,EAChCQ,EAAQR,EAAQ,OAChBS,EAAMT,EAAQ,OAASG,EAEvBO,EAAiB,CAAA,EAEvB,QAASC,EAAIH,EAAOG,EAAIF,EAAKE,IACvBA,IAAMH,GAAST,EAAIY,CAAC,IAAM,GAI9BD,EAAK,KAAKX,EAAIY,CAAC,CAAC,EAGlB,OAAAX,EAAQ,QAAUG,EAEX,WAAW,KAAKO,CAAI,CAC7B,CAEA,SAASb,GAAsBE,EAAiBC,EAAgB,CAC9D,IAAMI,EAAQF,GAAWH,EAAKC,CAAO,EAC/BY,EAAcZ,EAAQ,OAASI,EAE/BS,EAAOd,EAAIC,EAAQ,MAAM,EAC/BA,EAAQ,SAER,IAAIc,EAAO,EACPC,EAAO,EAEPF,EAAO,IACTC,EAAO,EACPC,EAAOF,GACEA,EAAO,IAChBC,EAAO,EACPC,EAAOF,EAAO,KAEdC,EAAO,EACPC,EAAOF,EAAO,IAGhB,IAAIG,EAAM,GAAGF,CAAI,IAAIC,CAAI,GACrBE,EAAgB,CAAA,EAEpB,KAAOjB,EAAQ,OAASY,GAAa,CACnC,IAAMC,EAAOd,EAAIC,EAAQ,MAAM,EAM/B,GALAA,EAAQ,SAGRiB,EAAI,KAAKJ,EAAO,GAAU,EAEtBA,EAAO,IAAK,CACdI,EAAI,QAAO,EAGX,IAAIC,EAAM,EAEV,QAASP,EAAI,EAAGA,EAAIM,EAAI,OAAQN,IAC9BO,GAAOD,EAAIN,CAAC,GAAMA,EAAI,EAGxBK,GAAO,IAAIE,CAAG,GACdD,EAAM,CAAA,CACR,CACF,CAEA,OAAOD,CACT,CAEA,SAASpB,GAAUG,EAAiBC,EAAgB,CAClD,OAAAA,EAAQ,SAED,IACT,CAEA,SAASN,GAAeK,EAAiBC,EAAgB,CACvD,IAAMG,EAASD,GAAWH,EAAKC,CAAO,EAChCmB,EAAapB,EAAIC,EAAQ,MAAM,EACrCA,EAAQ,SACR,IAAMoB,EAAQrB,EAAI,SAASC,EAAQ,OAAQA,EAAQ,OAASG,EAAS,CAAC,EAGtE,GAFAH,EAAQ,QAAUG,EAEdgB,IAAe,EAEjB,MAAM,IAAI,MAAM,4CAA4C,EAG9D,OAAOC,CACT,CAEA,SAASzB,GAAiBI,EAAiBC,EAAgB,CACzD,IAAMG,EAASD,GAAWH,EAAKC,CAAO,EAChCoB,EAAQrB,EAAI,SAASC,EAAQ,OAAQA,EAAQ,OAASG,CAAM,EAClE,OAAAH,EAAQ,QAAUG,EAEXiB,CACT,CAEA,SAASC,GAAcC,EAAa,CAClC,IAAIC,EAASD,EAAM,SAAS,EAAE,EAE1BC,EAAO,OAAS,IAAM,IACxBA,EAAS,IAAMA,GAGjB,IAAMC,EAAQ,IAAIC,GAElB,QAASd,EAAI,EAAGA,EAAIY,EAAO,OAAQZ,GAAK,EACtCa,EAAM,OAAO,WAAW,KAAK,CAAC,SAAS,GAAGD,EAAOZ,CAAC,CAAC,GAAGY,EAAOZ,EAAI,CAAC,CAAC,GAAI,EAAE,CAAC,CAAC,CAAC,EAG9E,OAAOa,CACT,CAEA,SAASE,GAAcN,EAA6B,CAClD,GAAIA,EAAM,WAAa,IACrB,OAAO,WAAW,KAAK,CAACA,EAAM,UAAU,CAAC,EAI3C,IAAMjB,EAASkB,GAAaD,EAAM,UAAU,EAE5C,OAAO,IAAIK,GACT,WAAW,KAAK,CACdtB,EAAO,WAAad,GACrB,EACDc,CAAM,CAEV,CAEM,SAAUwB,GAAeL,EAAkC,CAC/D,IAAMM,EAAW,IAAIH,GAEfI,EAAO,IAGb,OAFkBP,EAAM,SAAQ,EAAG,CAAC,EAAIO,KAAUA,GAGhDD,EAAS,OAAO,WAAW,KAAK,CAAC,CAAC,CAAC,CAAC,EAGtCA,EAAS,OAAON,CAAK,EAEd,IAAIG,GACT,WAAW,KAAK,CAAC,CAAI,CAAC,EACtBC,GAAaE,CAAQ,EACrBA,CAAQ,CAEZ,CAEM,SAAUE,GAAiBR,EAAkC,CAEjE,IAAMH,EAAa,WAAW,KAAK,CAAC,CAAC,CAAC,EAEhCS,EAAW,IAAIH,GACnBN,EACAG,CAAK,EAGP,OAAO,IAAIG,GACT,WAAW,KAAK,CAAC,CAAI,CAAC,EACtBC,GAAaE,CAAQ,EACrBA,CAAQ,CAEZ,CAUM,SAAUG,GAAgBC,EAA4CC,EAAM,GAAI,CACpF,IAAMC,EAAS,IAAIC,GAEnB,QAAWC,KAAOJ,EAChBE,EAAO,OACLE,CAAG,EAIP,OAAO,IAAID,GACT,WAAW,KAAK,CAACF,CAAG,CAAC,EACrBI,GAAaH,CAAM,EACnBA,CAAM,CAEV,CCpOA,eAAsBI,GAAeC,EAAiBC,EAAiBC,EAAkCC,EAAsB,CAC7H,IAAMC,EAAY,MAAM,OAAO,OAAO,UAAU,MAAOJ,EAAK,CAC1D,KAAM,QACN,WAAYA,EAAI,KAAO,SACtB,GAAO,CAAC,QAAQ,CAAC,EACpBG,GAAS,QAAQ,eAAc,EAE/B,IAAME,EAAS,MAAM,OAAO,OAAO,OAAO,CACxC,KAAM,QACN,KAAM,CACJ,KAAM,YAEPD,EAAWH,EAAKC,EAAI,SAAQ,CAAE,EACjC,OAAAC,GAAS,QAAQ,eAAc,EAExBE,CACT,CC7CA,IAAMC,GAAU,WAAW,KAAK,CAAC,EAAM,EAAM,GAAM,IAAM,GAAM,IAAM,GAAM,EAAM,EAAM,CAAI,CAAC,EAEtFC,GAAU,WAAW,KAAK,CAAC,EAAM,EAAM,GAAM,IAAM,EAAM,EAAM,EAAI,CAAC,EAEpEC,GAAU,WAAW,KAAK,CAAC,EAAM,EAAM,GAAM,IAAM,EAAM,EAAM,EAAI,CAAC,EAEpEC,GAAgB,CACpB,IAAK,GACL,IAAK,KACL,IAAK,SAGDC,GAAgB,CACpB,IAAK,GACL,IAAK,KACL,IAAK,SAGDC,GAAgB,CACpB,IAAK,GACL,IAAK,KACL,IAAK,SAGDC,GAAmB,GACnBC,GAAmB,GACnBC,GAAmB,GA0DnB,SAAUC,GAAyBC,EAAiB,CACxD,IAAMC,EAAUC,GAAUF,CAAK,EAE/B,OAAOG,GAA2BF,CAAO,CAC3C,CAEM,SAAUE,GAA4BF,EAAY,CACtD,IAAMG,EAAcH,EAAQ,CAAC,EAAE,CAAC,EAAE,CAAC,EAC7BI,EAAS,EACXC,EACAC,EAEJ,GAAIH,EAAY,aAAiBI,GAAmB,EAAK,EACvD,OAAAF,EAAIG,EAAmBL,EAAY,SAASC,EAAQA,EAASG,EAAgB,EAAG,WAAW,EAC3FD,EAAIE,EAAmBL,EAAY,SAASC,EAASG,EAAgB,EAAG,WAAW,EAE5E,IAAIE,GAAoB,CAC7B,GAAGC,GACH,QAAS,CAAC,QAAQ,EAClB,EAAAL,EACA,EAAAC,EACD,EAGH,GAAIH,EAAY,aAAiBQ,GAAmB,EAAK,EACvD,OAAAN,EAAIG,EAAmBL,EAAY,SAASC,EAAQA,EAASO,EAAgB,EAAG,WAAW,EAC3FL,EAAIE,EAAmBL,EAAY,SAASC,EAASO,EAAgB,EAAG,WAAW,EAE5E,IAAIF,GAAoB,CAC7B,GAAGG,GACH,QAAS,CAAC,QAAQ,EAClB,EAAAP,EACA,EAAAC,EACD,EAGH,GAAIH,EAAY,aAAiBU,GAAmB,EAAK,EACvD,OAAAR,EAAIG,EAAmBL,EAAY,SAASC,EAAQA,EAASS,EAAgB,EAAG,WAAW,EAC3FP,EAAIE,EAAmBL,EAAY,SAASC,EAASS,EAAgB,EAAG,WAAW,EAE5E,IAAIJ,GAAoB,CAC7B,GAAGK,GACH,QAAS,CAAC,QAAQ,EAClB,EAAAT,EACA,EAAAC,EACD,EAGH,MAAM,IAAIS,EAAuB,sCAAsCZ,EAAY,UAAU,0BAA0B,CACzH,CAqBM,SAAUa,GAAuBC,EAAqB,CAC1D,OAAOC,GAAe,CACpBC,GAAc,WAAW,KAAK,CAAC,CAAC,CAAC,CAAC,EAClCD,GAAe,CACbE,GAAOH,EAAU,GAAG,GACnB,GAAI,EACPC,GAAe,CACbG,GACE,IAAIC,GACF,WAAW,KAAK,CAAC,CAAI,CAAC,EACtBC,GAAqBN,EAAU,GAAK,GAAI,WAAW,EACnDM,GAAqBN,EAAU,GAAK,GAAI,WAAW,CAAC,CACrD,GAEF,GAAI,EACR,EAAE,SAAQ,CACb,CAEA,SAASG,GAAQI,EAAc,CAC7B,GAAIA,IAAU,QACZ,OAAOC,GAGT,GAAID,IAAU,QACZ,OAAOE,GAGT,GAAIF,IAAU,QACZ,OAAOG,GAGT,MAAM,IAAIC,EAAuB,iBAAiBJ,CAAK,EAAE,CAC3D,CC1LM,IAAOK,GAAP,KAAqB,CACT,KAAO,QACP,IACR,KAER,YAAaC,EAAe,CAC1B,KAAK,IAAMA,CACb,CAEA,IAAI,KAAG,CACL,OAAI,KAAK,MAAQ,OACf,KAAK,KAAOC,GAAsB,KAAK,GAAG,GAGrC,KAAK,IACd,CAEA,aAAW,CACT,OAAOC,GAAS,OAAOC,GAAoB,IAAI,CAAC,CAClD,CAEA,OAAK,CACH,OAAOC,GAAI,SAAS,IAAK,KAAK,YAAW,CAAE,CAC7C,CAEA,UAAQ,CACN,OAAOC,EAAU,OAAO,KAAK,YAAW,EAAG,KAAK,EAAE,UAAU,CAAC,CAC/D,CAEA,OAAQC,EAAS,CACf,OAAIA,GAAO,MAAQ,EAAEA,EAAI,eAAe,YAC/B,GAGFC,GAAiB,KAAK,IAAKD,EAAI,GAAG,CAC3C,CAEA,MAAM,OAAQE,EAAmCC,EAAiBC,EAAsB,CACtF,OAAOC,GAAc,KAAK,IAAKF,EAAKD,EAAME,CAAO,CACnD,GClDF,IAAAE,GAAmB,mBAOnB,IAAMC,GAAU,GAAAC,QAAO,oBAEjBC,GAAyB,GAG/B,IAAMC,GAAwB,GA6FxB,SAAUC,GAAeC,EAAiBC,EAAiBC,EAAgC,CAC/F,GAAIF,EAAI,aAAeG,GACrB,MAAM,IAAI,UAAU,mCAAmC,EAClD,GAAI,EAAEH,aAAe,YAC1B,MAAM,IAAI,UAAU,gDAAgD,EAGtE,GAAIC,EAAI,aAAeG,GACrB,MAAM,IAAI,UAAU,mCAAmC,EAClD,GAAI,EAAEH,aAAe,YAC1B,MAAM,IAAI,UAAU,gDAAgD,EAGtE,IAAMI,EAAM,GAAAC,QAAO,gBAAgB,CACjC,OAAQ,MACR,IAAK,CACH,IAAK,UACL,EAAGC,EAAmBP,EAAK,WAAW,EACtC,IAAK,OAER,EAED,OAAO,GAAAM,QAAO,OAAO,KAAMJ,aAAe,WAAaA,EAAMA,EAAI,SAAQ,EAAIG,EAAKJ,CAAG,CACvF,CC/GM,SAAUO,GAAyBC,EAAU,CACjD,OAAIA,GAAS,KACJ,GAGF,OAAOA,EAAM,MAAS,YAC3B,OAAOA,EAAM,OAAU,YACvB,OAAOA,EAAM,SAAY,UAC7B,CCbM,IAAOC,GAAP,KAAuB,CACX,KAAO,UACP,IAEhB,YAAaC,EAAe,CAC1B,KAAK,IAAMC,GAAiBD,EAAYE,EAAe,CACzD,CAEA,aAAW,CACT,OAAOC,GAAS,OAAOC,GAAoB,IAAI,CAAC,CAClD,CAEA,OAAK,CACH,OAAOC,GAAI,SAAS,IAAK,KAAK,YAAW,CAAE,CAC7C,CAEA,UAAQ,CACN,OAAOC,EAAU,OAAO,KAAK,YAAW,EAAG,KAAK,EAAE,UAAU,CAAC,CAC/D,CAEA,OAAQN,EAAS,CACf,OAAIA,GAAO,MAAQ,EAAEA,EAAI,eAAe,YAC/B,GAGFO,GAAiB,KAAK,IAAKP,EAAI,GAAG,CAC3C,CAEA,OAAQQ,EAAmCC,EAAiBC,EAAsB,CAChFA,GAAS,QAAQ,eAAc,EAC/B,IAAMC,EAAgBC,GAAc,KAAK,IAAKH,EAAKD,CAAI,EAEvD,OAAIK,GAAmBF,CAAM,EACpBA,EAAO,KAAKG,IACjBJ,GAAS,QAAQ,eAAc,EACxBI,EACR,EAGIH,CACT,GChCI,SAAUI,GAA2BC,EAAiB,CAC1D,OAAAA,EAAQC,GAAiBD,EAAcE,EAAe,EAC/C,IAAIC,GAAsBH,CAAK,CACxC,CAYM,SAAUI,GAAkBC,EAAiBC,EAAc,CAE/D,GADAD,EAAM,WAAW,KAAKA,GAAO,CAAA,CAAE,EAC3BA,EAAI,SAAWC,EACjB,MAAM,IAAIC,EAAuB,sCAAsCD,CAAM,SAASD,EAAI,MAAM,EAAE,EAEpG,OAAOA,CACT,CCrCA,IAAYG,IAAZ,SAAYA,EAAO,CACjBA,EAAA,IAAA,MACAA,EAAA,QAAA,UACAA,EAAA,UAAA,YACAA,EAAA,MAAA,OACF,GALYA,KAAAA,GAAO,CAAA,EAAA,EAOnB,IAAKC,IAAL,SAAKA,EAAe,CAClBA,EAAAA,EAAA,IAAA,CAAA,EAAA,MACAA,EAAAA,EAAA,QAAA,CAAA,EAAA,UACAA,EAAAA,EAAA,UAAA,CAAA,EAAA,YACAA,EAAAA,EAAA,MAAA,CAAA,EAAA,OACF,GALKA,KAAAA,GAAe,CAAA,EAAA,GAOpB,SAAiBD,EAAO,CACTA,EAAA,MAAQ,IACZE,GAAqBD,EAAe,CAE/C,GAJiBD,KAAAA,GAAO,CAAA,EAAA,EAUlB,IAAWG,IAAjB,SAAiBA,EAAS,CACxB,IAAIC,EAESD,EAAA,MAAQ,KACfC,GAAU,OACZA,EAASC,EAAmB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAC5CA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVP,GAAQ,MAAK,EAAG,OAAOM,EAAI,KAAMC,CAAC,GAGhCD,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACE,EAAQC,EAAQF,EAAO,CAAA,IAAM,CAC/B,IAAMF,EAAW,CAAA,EAEXK,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GAAG,CACNN,EAAI,KAAON,GAAQ,MAAK,EAAG,OAAOS,CAAM,EACxC,KACF,CACA,IAAK,GAAG,CACNH,EAAI,KAAOG,EAAO,MAAK,EACvB,KACF,CACA,QAAS,CACPA,EAAO,SAASG,EAAM,CAAC,EACvB,KACF,CACF,CACF,CAEA,OAAON,CACT,CAAC,GAGIF,GAGID,EAAA,OAAUG,GACdO,EAAcP,EAAKH,EAAU,MAAK,CAAE,EAGhCA,EAAA,OAAS,CAACW,EAAkCN,IAChDO,EAAcD,EAAKX,EAAU,MAAK,EAAIK,CAAI,CAErD,GA7DiBL,KAAAA,GAAS,CAAA,EAAA,EAoEpB,IAAWa,IAAjB,SAAiBA,EAAU,CACzB,IAAIZ,EAESY,EAAA,MAAQ,KACfZ,GAAU,OACZA,EAASC,EAAoB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAC7CA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVP,GAAQ,MAAK,EAAG,OAAOM,EAAI,KAAMC,CAAC,GAGhCD,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACE,EAAQC,EAAQF,EAAO,CAAA,IAAM,CAC/B,IAAMF,EAAW,CAAA,EAEXK,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GAAG,CACNN,EAAI,KAAON,GAAQ,MAAK,EAAG,OAAOS,CAAM,EACxC,KACF,CACA,IAAK,GAAG,CACNH,EAAI,KAAOG,EAAO,MAAK,EACvB,KACF,CACA,QAAS,CACPA,EAAO,SAASG,EAAM,CAAC,EACvB,KACF,CACF,CACF,CAEA,OAAON,CACT,CAAC,GAGIF,GAGIY,EAAA,OAAUV,GACdO,EAAcP,EAAKU,EAAW,MAAK,CAAE,EAGjCA,EAAA,OAAS,CAACF,EAAkCN,IAChDO,EAAcD,EAAKE,EAAW,MAAK,EAAIR,CAAI,CAEtD,GA7DiBQ,KAAAA,GAAU,CAAA,EAAA,ECxF3B,IAAAC,GAAoB,wBACPC,GACXD,IAAM,OAAOA,IAAO,UAAY,cAAeA,GACvC,aACJA,IAAM,OAAOA,IAAO,UAAY,gBAAiBA,GAC/CA,GACA,OCCF,SAAUE,GAAQC,EAAU,CAChC,OAAOA,aAAa,YAAe,YAAY,OAAOA,CAAC,GAAKA,EAAE,YAAY,OAAS,YACrF,CAGM,SAAUC,GAAQC,EAAS,CAC/B,GAAI,CAAC,OAAO,cAAcA,CAAC,GAAKA,EAAI,EAAG,MAAM,IAAI,MAAM,kCAAoCA,CAAC,CAC9F,CAGM,SAAUC,GAAOC,KAA8BC,EAAiB,CACpE,GAAI,CAACN,GAAQK,CAAC,EAAG,MAAM,IAAI,MAAM,qBAAqB,EACtD,GAAIC,EAAQ,OAAS,GAAK,CAACA,EAAQ,SAASD,EAAE,MAAM,EAClD,MAAM,IAAI,MAAM,iCAAmCC,EAAU,gBAAkBD,EAAE,MAAM,CAC3F,CAGM,SAAUE,GAAMC,EAAQ,CAC5B,GAAI,OAAOA,GAAM,YAAc,OAAOA,EAAE,QAAW,WACjD,MAAM,IAAI,MAAM,8CAA8C,EAChEN,GAAQM,EAAE,SAAS,EACnBN,GAAQM,EAAE,QAAQ,CACpB,CAGM,SAAUC,GAAQC,EAAeC,EAAgB,GAAI,CACzD,GAAID,EAAS,UAAW,MAAM,IAAI,MAAM,kCAAkC,EAC1E,GAAIC,GAAiBD,EAAS,SAAU,MAAM,IAAI,MAAM,uCAAuC,CACjG,CAGM,SAAUE,GAAQC,EAAUH,EAAa,CAC7CN,GAAOS,CAAG,EACV,IAAMC,EAAMJ,EAAS,UACrB,GAAIG,EAAI,OAASC,EACf,MAAM,IAAI,MAAM,yDAA2DA,CAAG,CAElF,CAkBM,SAAUC,MAASC,EAAoB,CAC3C,QAASC,EAAI,EAAGA,EAAID,EAAO,OAAQC,IACjCD,EAAOC,CAAC,EAAE,KAAK,CAAC,CAEpB,CAGM,SAAUC,GAAWC,EAAe,CACxC,OAAO,IAAI,SAASA,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,CAChE,CAGM,SAAUC,GAAKC,EAAcC,EAAa,CAC9C,OAAQD,GAAS,GAAKC,EAAWD,IAASC,CAC5C,CAwCA,IAAMC,GAEJ,OAAO,WAAW,KAAK,CAAA,CAAE,EAAE,OAAU,YAAc,OAAO,WAAW,SAAY,WAG7EC,GAAwB,MAAM,KAAK,CAAE,OAAQ,GAAG,EAAI,CAACC,EAAGC,IAC5DA,EAAE,SAAS,EAAE,EAAE,SAAS,EAAG,GAAG,CAAC,EAO3B,SAAUC,GAAWC,EAAiB,CAG1C,GAFAC,GAAOD,CAAK,EAERL,GAAe,OAAOK,EAAM,MAAK,EAErC,IAAIE,EAAM,GACV,QAASJ,EAAI,EAAGA,EAAIE,EAAM,OAAQF,IAChCI,GAAON,GAAMI,EAAMF,CAAC,CAAC,EAEvB,OAAOI,CACT,CAGA,IAAMC,GAAS,CAAE,GAAI,GAAI,GAAI,GAAI,EAAG,GAAI,EAAG,GAAI,EAAG,GAAI,EAAG,GAAG,EAC5D,SAASC,GAAcC,EAAU,CAC/B,GAAIA,GAAMF,GAAO,IAAME,GAAMF,GAAO,GAAI,OAAOE,EAAKF,GAAO,GAC3D,GAAIE,GAAMF,GAAO,GAAKE,GAAMF,GAAO,EAAG,OAAOE,GAAMF,GAAO,EAAI,IAC9D,GAAIE,GAAMF,GAAO,GAAKE,GAAMF,GAAO,EAAG,OAAOE,GAAMF,GAAO,EAAI,GAEhE,CAMM,SAAUG,GAAWJ,EAAW,CACpC,GAAI,OAAOA,GAAQ,SAAU,MAAM,IAAI,MAAM,4BAA8B,OAAOA,CAAG,EAErF,GAAIP,GAAe,OAAO,WAAW,QAAQO,CAAG,EAChD,IAAMK,EAAKL,EAAI,OACTM,EAAKD,EAAK,EAChB,GAAIA,EAAK,EAAG,MAAM,IAAI,MAAM,mDAAqDA,CAAE,EACnF,IAAME,EAAQ,IAAI,WAAWD,CAAE,EAC/B,QAASE,EAAK,EAAGC,EAAK,EAAGD,EAAKF,EAAIE,IAAMC,GAAM,EAAG,CAC/C,IAAMC,EAAKR,GAAcF,EAAI,WAAWS,CAAE,CAAC,EACrCE,EAAKT,GAAcF,EAAI,WAAWS,EAAK,CAAC,CAAC,EAC/C,GAAIC,IAAO,QAAaC,IAAO,OAAW,CACxC,IAAMC,EAAOZ,EAAIS,CAAE,EAAIT,EAAIS,EAAK,CAAC,EACjC,MAAM,IAAI,MAAM,+CAAiDG,EAAO,cAAgBH,CAAE,CAC5F,CACAF,EAAMC,CAAE,EAAIE,EAAK,GAAKC,CACxB,CACA,OAAOJ,CACT,CAkCM,SAAUM,GAAYC,EAAW,CACrC,GAAI,OAAOA,GAAQ,SAAU,MAAM,IAAI,MAAM,iBAAiB,EAC9D,OAAO,IAAI,WAAW,IAAI,YAAW,EAAG,OAAOA,CAAG,CAAC,CACrD,CAiBM,SAAUC,GAAQC,EAAW,CACjC,OAAI,OAAOA,GAAS,WAAUA,EAAOC,GAAYD,CAAI,GACrDE,GAAOF,CAAI,EACJA,CACT,CAeM,SAAUG,MAAeC,EAAoB,CACjD,IAAIC,EAAM,EACV,QAASC,EAAI,EAAGA,EAAIF,EAAO,OAAQE,IAAK,CACtC,IAAMC,EAAIH,EAAOE,CAAC,EAClBE,GAAOD,CAAC,EACRF,GAAOE,EAAE,MACX,CACA,IAAME,EAAM,IAAI,WAAWJ,CAAG,EAC9B,QAASC,EAAI,EAAGI,EAAM,EAAGJ,EAAIF,EAAO,OAAQE,IAAK,CAC/C,IAAMC,EAAIH,EAAOE,CAAC,EAClBG,EAAI,IAAIF,EAAGG,CAAG,EACdA,GAAOH,EAAE,MACX,CACA,OAAOE,CACT,CAsBM,IAAgBE,GAAhB,KAAoB,GA4CpB,SAAUC,GACdC,EAAuB,CAOvB,IAAMC,EAASC,GAA2BF,EAAQ,EAAG,OAAOG,GAAQD,CAAG,CAAC,EAAE,OAAM,EAC1EE,EAAMJ,EAAQ,EACpB,OAAAC,EAAM,UAAYG,EAAI,UACtBH,EAAM,SAAWG,EAAI,SACrBH,EAAM,OAAS,IAAMD,EAAQ,EACtBC,CACT,CAsCM,SAAUI,GAAYC,EAAc,GAAE,CAC1C,GAAIC,IAAU,OAAOA,GAAO,iBAAoB,WAC9C,OAAOA,GAAO,gBAAgB,IAAI,WAAWD,CAAW,CAAC,EAG3D,GAAIC,IAAU,OAAOA,GAAO,aAAgB,WAC1C,OAAO,WAAW,KAAKA,GAAO,YAAYD,CAAW,CAAC,EAExD,MAAM,IAAI,MAAM,wCAAwC,CAC1D,CCnYM,SAAUE,GACdC,EACAC,EACAC,EACAC,EAAa,CAEb,GAAI,OAAOH,EAAK,cAAiB,WAAY,OAAOA,EAAK,aAAaC,EAAYC,EAAOC,CAAI,EAC7F,IAAMC,EAAO,OAAO,EAAE,EAChBC,EAAW,OAAO,UAAU,EAC5BC,EAAK,OAAQJ,GAASE,EAAQC,CAAQ,EACtCE,EAAK,OAAOL,EAAQG,CAAQ,EAC5BG,EAAIL,EAAO,EAAI,EACfM,EAAIN,EAAO,EAAI,EACrBH,EAAK,UAAUC,EAAaO,EAAGF,EAAIH,CAAI,EACvCH,EAAK,UAAUC,EAAaQ,EAAGF,EAAIJ,CAAI,CACzC,CAGM,SAAUO,GAAIC,EAAWC,EAAWC,EAAS,CACjD,OAAQF,EAAIC,EAAM,CAACD,EAAIE,CACzB,CAGM,SAAUC,GAAIH,EAAWC,EAAWC,EAAS,CACjD,OAAQF,EAAIC,EAAMD,EAAIE,EAAMD,EAAIC,CAClC,CAMM,IAAgBE,GAAhB,cAAoDC,EAAO,CAoB/D,YAAYC,EAAkBC,EAAmBC,EAAmBhB,EAAa,CAC/E,MAAK,EANG,KAAA,SAAW,GACX,KAAA,OAAS,EACT,KAAA,IAAM,EACN,KAAA,UAAY,GAIpB,KAAK,SAAWc,EAChB,KAAK,UAAYC,EACjB,KAAK,UAAYC,EACjB,KAAK,KAAOhB,EACZ,KAAK,OAAS,IAAI,WAAWc,CAAQ,EACrC,KAAK,KAAOG,GAAW,KAAK,MAAM,CACpC,CACA,OAAOC,EAAW,CAChBC,GAAQ,IAAI,EACZD,EAAOE,GAAQF,CAAI,EACnBG,GAAOH,CAAI,EACX,GAAM,CAAE,KAAArB,EAAM,OAAAyB,EAAQ,SAAAR,CAAQ,EAAK,KAC7BS,EAAML,EAAK,OACjB,QAASM,EAAM,EAAGA,EAAMD,GAAO,CAC7B,IAAME,EAAO,KAAK,IAAIX,EAAW,KAAK,IAAKS,EAAMC,CAAG,EAEpD,GAAIC,IAASX,EAAU,CACrB,IAAMY,EAAWT,GAAWC,CAAI,EAChC,KAAOJ,GAAYS,EAAMC,EAAKA,GAAOV,EAAU,KAAK,QAAQY,EAAUF,CAAG,EACzE,QACF,CACAF,EAAO,IAAIJ,EAAK,SAASM,EAAKA,EAAMC,CAAI,EAAG,KAAK,GAAG,EACnD,KAAK,KAAOA,EACZD,GAAOC,EACH,KAAK,MAAQX,IACf,KAAK,QAAQjB,EAAM,CAAC,EACpB,KAAK,IAAM,EAEf,CACA,YAAK,QAAUqB,EAAK,OACpB,KAAK,WAAU,EACR,IACT,CACA,WAAWS,EAAe,CACxBR,GAAQ,IAAI,EACZS,GAAQD,EAAK,IAAI,EACjB,KAAK,SAAW,GAIhB,GAAM,CAAE,OAAAL,EAAQ,KAAAzB,EAAM,SAAAiB,EAAU,KAAAd,CAAI,EAAK,KACrC,CAAE,IAAAwB,CAAG,EAAK,KAEdF,EAAOE,GAAK,EAAI,IAChBK,GAAM,KAAK,OAAO,SAASL,CAAG,CAAC,EAG3B,KAAK,UAAYV,EAAWU,IAC9B,KAAK,QAAQ3B,EAAM,CAAC,EACpB2B,EAAM,GAGR,QAASM,EAAIN,EAAKM,EAAIhB,EAAUgB,IAAKR,EAAOQ,CAAC,EAAI,EAIjDlC,GAAaC,EAAMiB,EAAW,EAAG,OAAO,KAAK,OAAS,CAAC,EAAGd,CAAI,EAC9D,KAAK,QAAQH,EAAM,CAAC,EACpB,IAAMkC,EAAQd,GAAWU,CAAG,EACtBJ,EAAM,KAAK,UAEjB,GAAIA,EAAM,EAAG,MAAM,IAAI,MAAM,6CAA6C,EAC1E,IAAMS,EAAST,EAAM,EACfU,EAAQ,KAAK,IAAG,EACtB,GAAID,EAASC,EAAM,OAAQ,MAAM,IAAI,MAAM,oCAAoC,EAC/E,QAASH,EAAI,EAAGA,EAAIE,EAAQF,IAAKC,EAAM,UAAU,EAAID,EAAGG,EAAMH,CAAC,EAAG9B,CAAI,CACxE,CACA,QAAM,CACJ,GAAM,CAAE,OAAAsB,EAAQ,UAAAP,CAAS,EAAK,KAC9B,KAAK,WAAWO,CAAM,EACtB,IAAMY,EAAMZ,EAAO,MAAM,EAAGP,CAAS,EACrC,YAAK,QAAO,EACLmB,CACT,CACA,WAAWC,EAAM,CACfA,IAAAA,EAAO,IAAK,KAAK,aACjBA,EAAG,IAAI,GAAG,KAAK,IAAG,CAAE,EACpB,GAAM,CAAE,SAAArB,EAAU,OAAAQ,EAAQ,OAAAc,EAAQ,SAAAC,EAAU,UAAAC,EAAW,IAAAd,CAAG,EAAK,KAC/D,OAAAW,EAAG,UAAYG,EACfH,EAAG,SAAWE,EACdF,EAAG,OAASC,EACZD,EAAG,IAAMX,EACLY,EAAStB,GAAUqB,EAAG,OAAO,IAAIb,CAAM,EACpCa,CACT,CACA,OAAK,CACH,OAAO,KAAK,WAAU,CACxB,GASWI,GAAyC,YAAY,KAAK,CACrE,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UAAY,WACrF,EC9ID,IAAMC,GAA2B,YAAY,KAAK,CAChD,WAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,WAAY,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,UAAY,UAAY,UAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UAAY,UACpF,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UACpF,UAAY,UAAY,UAAY,UAAY,UAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACrF,EAGKC,GAA2B,IAAI,YAAY,EAAE,EACtCC,GAAP,cAAsBC,EAAc,CAYxC,YAAYC,EAAoB,GAAE,CAChC,MAAM,GAAIA,EAAW,EAAG,EAAK,EAVrB,KAAA,EAAYC,GAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,GAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,GAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,GAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,GAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,GAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,GAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,GAAU,CAAC,EAAI,CAIrC,CACU,KAAG,CACX,GAAM,CAAE,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,CAAC,EAAK,KACnC,MAAO,CAACP,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,CAAC,CAChC,CAEU,IACRP,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAS,CAEtF,KAAK,EAAIP,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,CACf,CACU,QAAQC,EAAgBC,EAAc,CAE9C,QAASC,EAAI,EAAGA,EAAI,GAAIA,IAAKD,GAAU,EAAGd,GAASe,CAAC,EAAIF,EAAK,UAAUC,EAAQ,EAAK,EACpF,QAASC,EAAI,GAAIA,EAAI,GAAIA,IAAK,CAC5B,IAAMC,EAAMhB,GAASe,EAAI,EAAE,EACrBE,EAAKjB,GAASe,EAAI,CAAC,EACnBG,EAAKC,GAAKH,EAAK,CAAC,EAAIG,GAAKH,EAAK,EAAE,EAAKA,IAAQ,EAC7CI,EAAKD,GAAKF,EAAI,EAAE,EAAIE,GAAKF,EAAI,EAAE,EAAKA,IAAO,GACjDjB,GAASe,CAAC,EAAKK,EAAKpB,GAASe,EAAI,CAAC,EAAIG,EAAKlB,GAASe,EAAI,EAAE,EAAK,CACjE,CAEA,GAAI,CAAE,EAAAV,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,CAAC,EAAK,KACjC,QAASG,EAAI,EAAGA,EAAI,GAAIA,IAAK,CAC3B,IAAMM,EAASF,GAAKV,EAAG,CAAC,EAAIU,GAAKV,EAAG,EAAE,EAAIU,GAAKV,EAAG,EAAE,EAC9Ca,EAAMV,EAAIS,EAASE,GAAId,EAAGC,EAAGC,CAAC,EAAIZ,GAASgB,CAAC,EAAIf,GAASe,CAAC,EAAK,EAE/DS,GADSL,GAAKd,EAAG,CAAC,EAAIc,GAAKd,EAAG,EAAE,EAAIc,GAAKd,EAAG,EAAE,GAC/BoB,GAAIpB,EAAGC,EAAGC,CAAC,EAAK,EACrCK,EAAID,EACJA,EAAID,EACJA,EAAID,EACJA,EAAKD,EAAIc,EAAM,EACfd,EAAID,EACJA,EAAID,EACJA,EAAID,EACJA,EAAKiB,EAAKE,EAAM,CAClB,CAEAnB,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnB,KAAK,IAAIP,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,CAAC,CACjC,CACU,YAAU,CAClBc,GAAM1B,EAAQ,CAChB,CACA,SAAO,CACL,KAAK,IAAI,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,CAAC,EAC/B0B,GAAM,KAAK,MAAM,CACnB,GAuRK,IAAMC,GAAgCC,GAAa,IAAM,IAAIC,EAAQ,EC/X5E,IAAAC,GAAmB,wBCMb,IAAOC,GAAP,cAAuCC,EAAa,CAQxD,YAAYC,EAAaC,EAAW,CAClC,MAAK,EAJC,KAAA,SAAW,GACX,KAAA,UAAY,GAIlBC,GAAMF,CAAI,EACV,IAAMG,EAAMC,GAAQH,CAAI,EAExB,GADA,KAAK,MAAQD,EAAK,OAAM,EACpB,OAAO,KAAK,MAAM,QAAW,WAC/B,MAAM,IAAI,MAAM,qDAAqD,EACvE,KAAK,SAAW,KAAK,MAAM,SAC3B,KAAK,UAAY,KAAK,MAAM,UAC5B,IAAMK,EAAW,KAAK,SAChBC,EAAM,IAAI,WAAWD,CAAQ,EAEnCC,EAAI,IAAIH,EAAI,OAASE,EAAWL,EAAK,OAAM,EAAG,OAAOG,CAAG,EAAE,OAAM,EAAKA,CAAG,EACxE,QAASI,EAAI,EAAGA,EAAID,EAAI,OAAQC,IAAKD,EAAIC,CAAC,GAAK,GAC/C,KAAK,MAAM,OAAOD,CAAG,EAErB,KAAK,MAAQN,EAAK,OAAM,EAExB,QAASO,EAAI,EAAGA,EAAID,EAAI,OAAQC,IAAKD,EAAIC,CAAC,GAAK,IAC/C,KAAK,MAAM,OAAOD,CAAG,EACrBE,GAAMF,CAAG,CACX,CACA,OAAOG,EAAU,CACf,OAAAC,GAAQ,IAAI,EACZ,KAAK,MAAM,OAAOD,CAAG,EACd,IACT,CACA,WAAWE,EAAe,CACxBD,GAAQ,IAAI,EACZE,GAAOD,EAAK,KAAK,SAAS,EAC1B,KAAK,SAAW,GAChB,KAAK,MAAM,WAAWA,CAAG,EACzB,KAAK,MAAM,OAAOA,CAAG,EACrB,KAAK,MAAM,WAAWA,CAAG,EACzB,KAAK,QAAO,CACd,CACA,QAAM,CACJ,IAAMA,EAAM,IAAI,WAAW,KAAK,MAAM,SAAS,EAC/C,YAAK,WAAWA,CAAG,EACZA,CACT,CACA,WAAWE,EAAY,CAErBA,IAAAA,EAAO,OAAO,OAAO,OAAO,eAAe,IAAI,EAAG,CAAA,CAAE,GACpD,GAAM,CAAE,MAAAC,EAAO,MAAAC,EAAO,SAAAC,EAAU,UAAAC,EAAW,SAAAZ,EAAU,UAAAa,CAAS,EAAK,KACnE,OAAAL,EAAKA,EACLA,EAAG,SAAWG,EACdH,EAAG,UAAYI,EACfJ,EAAG,SAAWR,EACdQ,EAAG,UAAYK,EACfL,EAAG,MAAQC,EAAM,WAAWD,EAAG,KAAK,EACpCA,EAAG,MAAQE,EAAM,WAAWF,EAAG,KAAK,EAC7BA,CACT,CACA,OAAK,CACH,OAAO,KAAK,WAAU,CACxB,CACA,SAAO,CACL,KAAK,UAAY,GACjB,KAAK,MAAM,QAAO,EAClB,KAAK,MAAM,QAAO,CACpB,GAaWM,GAGT,CAACnB,EAAaG,EAAYiB,IAC5B,IAAItB,GAAUE,EAAMG,CAAG,EAAE,OAAOiB,CAAO,EAAE,OAAM,EACjDD,GAAK,OAAS,CAACnB,EAAaG,IAAe,IAAIL,GAAUE,EAAMG,CAAG,ECtElE,IAAMkB,GAAsB,OAAO,CAAC,EAC9BC,GAAsB,OAAO,CAAC,EAgB9B,SAAUC,GAAQC,EAAgBC,EAAgB,GAAE,CACxD,GAAI,OAAOD,GAAU,UAAW,CAC9B,IAAME,EAASD,GAAS,IAAIA,CAAK,IACjC,MAAM,IAAI,MAAMC,EAAS,8BAAgC,OAAOF,CAAK,CACvE,CACA,OAAOA,CACT,CAIM,SAAUG,GAASH,EAAmBI,EAAiBH,EAAgB,GAAE,CAC7E,IAAMI,EAAQC,GAASN,CAAK,EACtBO,EAAMP,GAAO,OACbQ,EAAWJ,IAAW,OAC5B,GAAI,CAACC,GAAUG,GAAYD,IAAQH,EAAS,CAC1C,IAAMF,EAASD,GAAS,IAAIA,CAAK,KAC3BQ,EAAQD,EAAW,cAAcJ,CAAM,GAAK,GAC5CM,EAAML,EAAQ,UAAUE,CAAG,GAAK,QAAQ,OAAOP,CAAK,GAC1D,MAAM,IAAI,MAAME,EAAS,sBAAwBO,EAAQ,SAAWC,CAAG,CACzE,CACA,OAAOV,CACT,CAGM,SAAUW,GAAoBC,EAAoB,CACtD,IAAMC,EAAMD,EAAI,SAAS,EAAE,EAC3B,OAAOC,EAAI,OAAS,EAAI,IAAMA,EAAMA,CACtC,CAEM,SAAUC,GAAYD,EAAW,CACrC,GAAI,OAAOA,GAAQ,SAAU,MAAM,IAAI,MAAM,4BAA8B,OAAOA,CAAG,EACrF,OAAOA,IAAQ,GAAKE,GAAM,OAAO,KAAOF,CAAG,CAC7C,CAGM,SAAUG,GAAgBX,EAAiB,CAC/C,OAAOS,GAAYG,GAAYZ,CAAK,CAAC,CACvC,CACM,SAAUa,GAAgBb,EAAiB,CAC/C,OAAAc,GAAQd,CAAK,EACNS,GAAYG,GAAY,WAAW,KAAKZ,CAAK,EAAE,QAAO,CAAE,CAAC,CAClE,CAEM,SAAUe,GAAgBC,EAAoBd,EAAW,CAC7D,OAAOe,GAAYD,EAAE,SAAS,EAAE,EAAE,SAASd,EAAM,EAAG,GAAG,CAAC,CAC1D,CACM,SAAUgB,GAAgBF,EAAoBd,EAAW,CAC7D,OAAOa,GAAgBC,EAAGd,CAAG,EAAE,QAAO,CACxC,CAeM,SAAUiB,GAAYC,EAAeC,EAAUC,EAAuB,CAC1E,IAAIC,EACJ,GAAI,OAAOF,GAAQ,SACjB,GAAI,CACFE,EAAMC,GAAYH,CAAG,CACvB,OAASI,EAAG,CACV,MAAM,IAAI,MAAML,EAAQ,6CAA+CK,CAAC,CAC1E,SACSC,GAASL,CAAG,EAGrBE,EAAM,WAAW,KAAKF,CAAG,MAEzB,OAAM,IAAI,MAAMD,EAAQ,mCAAmC,EAE7D,IAAMO,EAAMJ,EAAI,OAChB,GAAI,OAAOD,GAAmB,UAAYK,IAAQL,EAChD,MAAM,IAAI,MAAMF,EAAQ,cAAgBE,EAAiB,kBAAoBK,CAAG,EAClF,OAAOJ,CACT,CA6CA,IAAMK,GAAYC,GAAc,OAAOA,GAAM,UAAYC,IAAOD,EAE1D,SAAUE,GAAQF,EAAWG,EAAaC,EAAW,CACzD,OAAOL,GAASC,CAAC,GAAKD,GAASI,CAAG,GAAKJ,GAASK,CAAG,GAAKD,GAAOH,GAAKA,EAAII,CAC1E,CAOM,SAAUC,GAASC,EAAeN,EAAWG,EAAaC,EAAW,CAMzE,GAAI,CAACF,GAAQF,EAAGG,EAAKC,CAAG,EACtB,MAAM,IAAI,MAAM,kBAAoBE,EAAQ,KAAOH,EAAM,WAAaC,EAAM,SAAWJ,CAAC,CAC5F,CASM,SAAUO,GAAOP,EAAS,CAC9B,IAAIQ,EACJ,IAAKA,EAAM,EAAGR,EAAIC,GAAKD,IAAMS,GAAKD,GAAO,EAAE,CAC3C,OAAOA,CACT,CAsBO,IAAME,GAAWC,IAAuBC,IAAO,OAAOD,CAAC,GAAKC,GAY7D,SAAUC,GACdC,EACAC,EACAC,EAAkE,CAElE,GAAI,OAAOF,GAAY,UAAYA,EAAU,EAAG,MAAM,IAAI,MAAM,0BAA0B,EAC1F,GAAI,OAAOC,GAAa,UAAYA,EAAW,EAAG,MAAM,IAAI,MAAM,2BAA2B,EAC7F,GAAI,OAAOC,GAAW,WAAY,MAAM,IAAI,MAAM,2BAA2B,EAE7E,IAAMC,EAAOC,GAAgB,IAAI,WAAWA,CAAG,EACzCC,EAAQC,GAAiB,WAAW,GAAGA,CAAI,EAC7CC,EAAIJ,EAAIH,CAAO,EACfQ,EAAIL,EAAIH,CAAO,EACfS,EAAI,EACFC,EAAQ,IAAK,CACjBH,EAAE,KAAK,CAAC,EACRC,EAAE,KAAK,CAAC,EACRC,EAAI,CACN,EACME,EAAI,IAAIC,IAAoBV,EAAOM,EAAGD,EAAG,GAAGK,CAAC,EAC7CC,EAAS,CAACC,EAAOX,EAAI,CAAC,IAAK,CAE/BK,EAAIG,EAAEN,EAAK,CAAI,EAAGS,CAAI,EACtBP,EAAII,EAAC,EACDG,EAAK,SAAW,IACpBN,EAAIG,EAAEN,EAAK,CAAI,EAAGS,CAAI,EACtBP,EAAII,EAAC,EACP,EACMI,EAAM,IAAK,CAEf,GAAIN,KAAO,IAAM,MAAM,IAAI,MAAM,yBAAyB,EAC1D,IAAIL,EAAM,EACJY,EAAoB,CAAA,EAC1B,KAAOZ,EAAMH,GAAU,CACrBM,EAAII,EAAC,EACL,IAAMM,EAAKV,EAAE,MAAK,EAClBS,EAAI,KAAKC,CAAE,EACXb,GAAOG,EAAE,MACX,CACA,OAAOW,GAAa,GAAGF,CAAG,CAC5B,EASA,MARiB,CAACF,EAAkBK,IAAoB,CACtDT,EAAK,EACLG,EAAOC,CAAI,EACX,IAAIM,EACJ,KAAO,EAAEA,EAAMD,EAAKJ,EAAG,CAAE,IAAIF,EAAM,EACnC,OAAAH,EAAK,EACEU,CACT,CAEF,CAoDM,SAAUC,GACdC,EACAC,EACAC,EAAoC,CAAA,EAAE,CAEtC,GAAI,CAACF,GAAU,OAAOA,GAAW,SAAU,MAAM,IAAI,MAAM,+BAA+B,EAE1F,SAASG,EAAWC,EAAiBC,EAAsBC,EAAc,CACvE,IAAMC,EAAMP,EAAOI,CAAS,EAC5B,GAAIE,GAASC,IAAQ,OAAW,OAChC,IAAMC,EAAU,OAAOD,EACvB,GAAIC,IAAYH,GAAgBE,IAAQ,KACtC,MAAM,IAAI,MAAM,UAAUH,CAAS,0BAA0BC,CAAY,SAASG,CAAO,EAAE,CAC/F,CACA,OAAO,QAAQP,CAAM,EAAE,QAAQ,CAAC,CAACQ,EAAGC,CAAC,IAAMP,EAAWM,EAAGC,EAAG,EAAK,CAAC,EAClE,OAAO,QAAQR,CAAS,EAAE,QAAQ,CAAC,CAACO,EAAGC,CAAC,IAAMP,EAAWM,EAAGC,EAAG,EAAI,CAAC,CACtE,CAaM,SAAUC,GACdC,EAA6B,CAE7B,IAAMC,EAAM,IAAI,QAChB,MAAO,CAACC,KAAWC,IAAc,CAC/B,IAAMC,EAAMH,EAAI,IAAIC,CAAG,EACvB,GAAIE,IAAQ,OAAW,OAAOA,EAC9B,IAAMC,EAAWL,EAAGE,EAAK,GAAGC,CAAI,EAChC,OAAAF,EAAI,IAAIC,EAAKG,CAAQ,EACdA,CACT,CACF,CCpWA,IAAMC,GAAM,OAAO,CAAC,EAAGC,GAAM,OAAO,CAAC,EAAGC,GAAsB,OAAO,CAAC,EAAGC,GAAsB,OAAO,CAAC,EAEjGC,GAAsB,OAAO,CAAC,EAAGC,GAAsB,OAAO,CAAC,EAAGC,GAAsB,OAAO,CAAC,EAEhGC,GAAsB,OAAO,CAAC,EAAGC,GAAsB,OAAO,CAAC,EAAGC,GAAuB,OAAO,EAAE,EAGlG,SAAUC,GAAIC,EAAWC,EAAS,CACtC,IAAMC,EAASF,EAAIC,EACnB,OAAOC,GAAUb,GAAMa,EAASD,EAAIC,CACtC,CAYM,SAAUC,GAAKC,EAAWC,EAAeC,EAAc,CAC3D,IAAIC,EAAMH,EACV,KAAOC,KAAUG,IACfD,GAAOA,EACPA,GAAOD,EAET,OAAOC,CACT,CAMM,SAAUE,GAAOC,EAAgBJ,EAAc,CACnD,GAAII,IAAWF,GAAK,MAAM,IAAI,MAAM,kCAAkC,EACtE,GAAIF,GAAUE,GAAK,MAAM,IAAI,MAAM,0CAA4CF,CAAM,EAErF,IAAIK,EAAIC,GAAIF,EAAQJ,CAAM,EACtBO,EAAIP,EAEJF,EAAII,GAAKM,EAAIC,GAAKC,EAAID,GAAKE,EAAIT,GACnC,KAAOG,IAAMH,IAAK,CAEhB,IAAMU,EAAIL,EAAIF,EACRQ,EAAIN,EAAIF,EACRS,EAAIhB,EAAIY,EAAIE,EACZG,EAAIP,EAAIG,EAAIC,EAElBL,EAAIF,EAAGA,EAAIQ,EAAGf,EAAIY,EAAGF,EAAIG,EAAGD,EAAII,EAAGH,EAAII,CACzC,CAEA,GADYR,IACAE,GAAK,MAAM,IAAI,MAAM,wBAAwB,EACzD,OAAOH,GAAIR,EAAGE,CAAM,CACtB,CAEA,SAASgB,GAAkBC,EAAeC,EAASH,EAAI,CACrD,GAAI,CAACE,EAAG,IAAIA,EAAG,IAAIC,CAAI,EAAGH,CAAC,EAAG,MAAM,IAAI,MAAM,yBAAyB,CACzE,CAMA,SAASI,GAAaF,EAAeF,EAAI,CACvC,IAAMK,GAAUH,EAAG,MAAQR,IAAOY,GAC5BH,EAAOD,EAAG,IAAIF,EAAGK,CAAM,EAC7B,OAAAJ,GAAeC,EAAIC,EAAMH,CAAC,EACnBG,CACT,CAEA,SAASI,GAAaL,EAAeF,EAAI,CACvC,IAAMQ,GAAUN,EAAG,MAAQO,IAAOC,GAC5BC,EAAKT,EAAG,IAAIF,EAAGY,EAAG,EAClBhB,EAAIM,EAAG,IAAIS,EAAIH,CAAM,EACrBK,EAAKX,EAAG,IAAIF,EAAGJ,CAAC,EAChBkB,EAAIZ,EAAG,IAAIA,EAAG,IAAIW,EAAID,EAAG,EAAGhB,CAAC,EAC7BO,EAAOD,EAAG,IAAIW,EAAIX,EAAG,IAAIY,EAAGZ,EAAG,GAAG,CAAC,EACzC,OAAAD,GAAeC,EAAIC,EAAMH,CAAC,EACnBG,CACT,CAIA,SAASY,GAAWC,EAAS,CAC3B,IAAMC,EAAMC,GAAMF,CAAC,EACbG,EAAKC,GAAcJ,CAAC,EACpBK,EAAKF,EAAGF,EAAKA,EAAI,IAAIA,EAAI,GAAG,CAAC,EAC7BK,EAAKH,EAAGF,EAAKI,CAAE,EACfE,EAAKJ,EAAGF,EAAKA,EAAI,IAAII,CAAE,CAAC,EACxBG,GAAMR,EAAIS,IAAOC,GACvB,MAAO,CAAIxB,EAAeF,IAAQ,CAChC,IAAI2B,EAAMzB,EAAG,IAAIF,EAAGwB,CAAE,EAClBI,EAAM1B,EAAG,IAAIyB,EAAKN,CAAE,EAClBQ,EAAM3B,EAAG,IAAIyB,EAAKL,CAAE,EACpBQ,EAAM5B,EAAG,IAAIyB,EAAKJ,CAAE,EACpBQ,EAAK7B,EAAG,IAAIA,EAAG,IAAI0B,CAAG,EAAG5B,CAAC,EAC1BgC,EAAK9B,EAAG,IAAIA,EAAG,IAAI2B,CAAG,EAAG7B,CAAC,EAChC2B,EAAMzB,EAAG,KAAKyB,EAAKC,EAAKG,CAAE,EAC1BH,EAAM1B,EAAG,KAAK4B,EAAKD,EAAKG,CAAE,EAC1B,IAAMC,EAAK/B,EAAG,IAAIA,EAAG,IAAI0B,CAAG,EAAG5B,CAAC,EAC1BG,EAAOD,EAAG,KAAKyB,EAAKC,EAAKK,CAAE,EACjC,OAAAhC,GAAeC,EAAIC,EAAMH,CAAC,EACnBG,CACT,CACF,CASM,SAAUiB,GAAcJ,EAAS,CAGrC,GAAIA,EAAIkB,GAAK,MAAM,IAAI,MAAM,qCAAqC,EAElE,IAAIC,EAAInB,EAAItB,GACR0C,EAAI,EACR,KAAOD,EAAIvB,KAAQzB,IACjBgD,GAAKvB,GACLwB,IAIF,IAAIC,EAAIzB,GACF0B,EAAMpB,GAAMF,CAAC,EACnB,KAAOuB,GAAWD,EAAKD,CAAC,IAAM,GAG5B,GAAIA,IAAM,IAAM,MAAM,IAAI,MAAM,+CAA+C,EAGjF,GAAID,IAAM,EAAG,OAAOhC,GAIpB,IAAIoC,EAAKF,EAAI,IAAID,EAAGF,CAAC,EACfM,GAAUN,EAAIzC,IAAOkB,GAC3B,OAAO,SAAwBV,EAAeF,EAAI,CAChD,GAAIE,EAAG,IAAIF,CAAC,EAAG,OAAOA,EAEtB,GAAIuC,GAAWrC,EAAIF,CAAC,IAAM,EAAG,MAAM,IAAI,MAAM,yBAAyB,EAGtE,IAAI0C,EAAIN,EACJO,EAAIzC,EAAG,IAAIA,EAAG,IAAKsC,CAAE,EACrBI,EAAI1C,EAAG,IAAIF,EAAGmC,CAAC,EACfU,EAAI3C,EAAG,IAAIF,EAAGyC,CAAM,EAIxB,KAAO,CAACvC,EAAG,IAAI0C,EAAG1C,EAAG,GAAG,GAAG,CACzB,GAAIA,EAAG,IAAI0C,CAAC,EAAG,OAAO1C,EAAG,KACzB,IAAIY,EAAI,EAGJgC,EAAQ5C,EAAG,IAAI0C,CAAC,EACpB,KAAO,CAAC1C,EAAG,IAAI4C,EAAO5C,EAAG,GAAG,GAG1B,GAFAY,IACAgC,EAAQ5C,EAAG,IAAI4C,CAAK,EAChBhC,IAAM4B,EAAG,MAAM,IAAI,MAAM,yBAAyB,EAIxD,IAAMK,EAAWrD,IAAO,OAAOgD,EAAI5B,EAAI,CAAC,EAClCtB,EAAIU,EAAG,IAAIyC,EAAGI,CAAQ,EAG5BL,EAAI5B,EACJ6B,EAAIzC,EAAG,IAAIV,CAAC,EACZoD,EAAI1C,EAAG,IAAI0C,EAAGD,CAAC,EACfE,EAAI3C,EAAG,IAAI2C,EAAGrD,CAAC,CACjB,CACA,OAAOqD,CACT,CACF,CAaM,SAAUG,GAAOhC,EAAS,CAE9B,OAAIA,EAAIV,KAAQ4B,GAAY9B,GAExBY,EAAIN,KAAQD,GAAYF,GAExBS,EAAIU,KAASuB,GAAYlC,GAAWC,CAAC,EAElCI,GAAcJ,CAAC,CACxB,CAmDA,IAAMkC,GAAe,CACnB,SAAU,UAAW,MAAO,MAAO,MAAO,OAAQ,MAClD,MAAO,MAAO,MAAO,MAAO,MAAO,MACnC,OAAQ,OAAQ,OAAQ,QAEpB,SAAUC,GAAiBC,EAAgB,CAC/C,IAAMC,EAAU,CACd,MAAO,SACP,KAAM,SACN,MAAO,SACP,KAAM,UAEFC,EAAOJ,GAAa,OAAO,CAACK,EAAKC,KACrCD,EAAIC,CAAG,EAAI,WACJD,GACNF,CAAO,EACV,OAAAI,GAAgBL,EAAOE,CAAI,EAIpBF,CACT,CAQM,SAAUM,GAASC,EAAeC,EAAQC,EAAa,CAC3D,GAAIA,EAAQC,GAAK,MAAM,IAAI,MAAM,yCAAyC,EAC1E,GAAID,IAAUC,GAAK,OAAOH,EAAG,IAC7B,GAAIE,IAAUE,GAAK,OAAOH,EAC1B,IAAII,EAAIL,EAAG,IACPM,EAAIL,EACR,KAAOC,EAAQC,IACTD,EAAQE,KAAKC,EAAIL,EAAG,IAAIK,EAAGC,CAAC,GAChCA,EAAIN,EAAG,IAAIM,CAAC,EACZJ,IAAUE,GAEZ,OAAOC,CACT,CAOM,SAAUE,GAAiBP,EAAeQ,EAAWC,EAAW,GAAK,CACzE,IAAMC,EAAW,IAAI,MAAMF,EAAK,MAAM,EAAE,KAAKC,EAAWT,EAAG,KAAO,MAAS,EAErEW,EAAgBH,EAAK,OAAO,CAACI,EAAKX,EAAKY,IACvCb,EAAG,IAAIC,CAAG,EAAUW,GACxBF,EAASG,CAAC,EAAID,EACPZ,EAAG,IAAIY,EAAKX,CAAG,GACrBD,EAAG,GAAG,EAEHc,EAAcd,EAAG,IAAIW,CAAa,EAExC,OAAAH,EAAK,YAAY,CAACI,EAAKX,EAAKY,IACtBb,EAAG,IAAIC,CAAG,EAAUW,GACxBF,EAASG,CAAC,EAAIb,EAAG,IAAIY,EAAKF,EAASG,CAAC,CAAC,EAC9Bb,EAAG,IAAIY,EAAKX,CAAG,GACrBa,CAAW,EACPJ,CACT,CAgBM,SAAUK,GAAcC,EAAeC,EAAI,CAG/C,IAAMC,GAAUF,EAAG,MAAQG,IAAOC,GAC5BC,EAAUL,EAAG,IAAIC,EAAGC,CAAM,EAC1BI,EAAMN,EAAG,IAAIK,EAASL,EAAG,GAAG,EAC5BO,EAAOP,EAAG,IAAIK,EAASL,EAAG,IAAI,EAC9BQ,EAAKR,EAAG,IAAIK,EAASL,EAAG,IAAIA,EAAG,GAAG,CAAC,EACzC,GAAI,CAACM,GAAO,CAACC,GAAQ,CAACC,EAAI,MAAM,IAAI,MAAM,gCAAgC,EAC1E,OAAOF,EAAM,EAAIC,EAAO,EAAI,EAC9B,CAUM,SAAUE,GAAQC,EAAWC,EAAmB,CAEhDA,IAAe,QAAWC,GAAQD,CAAU,EAChD,IAAME,EAAcF,IAAe,OAAYA,EAAaD,EAAE,SAAS,CAAC,EAAE,OACpEI,EAAc,KAAK,KAAKD,EAAc,CAAC,EAC7C,MAAO,CAAE,WAAYA,EAAa,YAAAC,CAAW,CAC/C,CA8BM,SAAUC,GACdC,EACAC,EACAC,EAAO,GACPC,EAA0B,CAAA,EAAE,CAE5B,GAAIH,GAASI,GAAK,MAAM,IAAI,MAAM,0CAA4CJ,CAAK,EACnF,IAAIK,EACAC,EACAC,EAAwB,GACxBC,EACJ,GAAI,OAAOP,GAAiB,UAAYA,GAAgB,KAAM,CAC5D,GAAIE,EAAK,MAAQD,EAAM,MAAM,IAAI,MAAM,sCAAsC,EAC7E,IAAMO,EAAQR,EACVQ,EAAM,OAAMJ,EAAcI,EAAM,MAChCA,EAAM,OAAMH,EAAQG,EAAM,MAC1B,OAAOA,EAAM,MAAS,YAAWP,EAAOO,EAAM,MAC9C,OAAOA,EAAM,cAAiB,YAAWF,EAAeE,EAAM,cAClED,EAAiBC,EAAM,cACzB,MACM,OAAOR,GAAiB,WAAUI,EAAcJ,GAChDE,EAAK,OAAMG,EAAQH,EAAK,MAE9B,GAAM,CAAE,WAAYO,EAAM,YAAaC,CAAK,EAAKlB,GAAQO,EAAOK,CAAW,EAC3E,GAAIM,EAAQ,KAAM,MAAM,IAAI,MAAM,gDAAgD,EAClF,IAAIC,EACEC,EAAuB,OAAO,OAAO,CACzC,MAAAb,EACA,KAAAE,EACA,KAAAQ,EACA,MAAAC,EACA,KAAMG,GAAQJ,CAAI,EAClB,KAAMN,GACN,IAAKW,GACL,eAAgBP,EAChB,OAASQ,GAAQC,GAAID,EAAKhB,CAAK,EAC/B,QAAUgB,GAAO,CACf,GAAI,OAAOA,GAAQ,SACjB,MAAM,IAAI,MAAM,+CAAiD,OAAOA,CAAG,EAC7E,OAAOZ,IAAOY,GAAOA,EAAMhB,CAC7B,EACA,IAAMgB,GAAQA,IAAQZ,GAEtB,YAAcY,GAAgB,CAACH,EAAE,IAAIG,CAAG,GAAKH,EAAE,QAAQG,CAAG,EAC1D,MAAQA,IAASA,EAAMD,MAASA,GAChC,IAAMC,GAAQC,GAAI,CAACD,EAAKhB,CAAK,EAC7B,IAAK,CAACkB,EAAKC,IAAQD,IAAQC,EAE3B,IAAMH,GAAQC,GAAID,EAAMA,EAAKhB,CAAK,EAClC,IAAK,CAACkB,EAAKC,IAAQF,GAAIC,EAAMC,EAAKnB,CAAK,EACvC,IAAK,CAACkB,EAAKC,IAAQF,GAAIC,EAAMC,EAAKnB,CAAK,EACvC,IAAK,CAACkB,EAAKC,IAAQF,GAAIC,EAAMC,EAAKnB,CAAK,EACvC,IAAK,CAACgB,EAAKI,IAAUC,GAAMR,EAAGG,EAAKI,CAAK,EACxC,IAAK,CAACF,EAAKC,IAAQF,GAAIC,EAAMI,GAAOH,EAAKnB,CAAK,EAAGA,CAAK,EAGtD,KAAOgB,GAAQA,EAAMA,EACrB,KAAM,CAACE,EAAKC,IAAQD,EAAMC,EAC1B,KAAM,CAACD,EAAKC,IAAQD,EAAMC,EAC1B,KAAM,CAACD,EAAKC,IAAQD,EAAMC,EAE1B,IAAMH,GAAQM,GAAON,EAAKhB,CAAK,EAC/B,KACEM,IACEZ,IACKkB,IAAOA,EAAQW,GAAOvB,CAAK,GACzBY,EAAMC,EAAGnB,CAAC,IAErB,QAAUsB,GAASd,EAAOsB,GAAgBR,EAAKL,CAAK,EAAIc,GAAgBT,EAAKL,CAAK,EAClF,UAAW,CAACe,EAAOC,EAAiB,KAAQ,CAC1C,GAAInB,EAAgB,CAClB,GAAI,CAACA,EAAe,SAASkB,EAAM,MAAM,GAAKA,EAAM,OAASf,EAC3D,MAAM,IAAI,MACR,6BAA+BH,EAAiB,eAAiBkB,EAAM,MAAM,EAGjF,IAAME,EAAS,IAAI,WAAWjB,CAAK,EAEnCiB,EAAO,IAAIF,EAAOxB,EAAO,EAAI0B,EAAO,OAASF,EAAM,MAAM,EACzDA,EAAQE,CACV,CACA,GAAIF,EAAM,SAAWf,EACnB,MAAM,IAAI,MAAM,6BAA+BA,EAAQ,eAAiBe,EAAM,MAAM,EACtF,IAAIG,EAAS3B,EAAO4B,GAAgBJ,CAAK,EAAIK,GAAgBL,CAAK,EAElE,GADInB,IAAcsB,EAASZ,GAAIY,EAAQ7B,CAAK,GACxC,CAAC2B,GACC,CAACd,EAAE,QAAQgB,CAAM,EAAG,MAAM,IAAI,MAAM,kDAAkD,EAG5F,OAAOA,CACT,EAEA,YAAcG,GAAQC,GAAcpB,EAAGmB,CAAG,EAG1C,KAAM,CAACE,EAAGC,EAAGC,IAAOA,EAAID,EAAID,EAClB,EACZ,OAAO,OAAO,OAAOrB,CAAC,CACxB,CAwDM,SAAUwB,GAAoBC,EAAkB,CACpD,GAAI,OAAOA,GAAe,SAAU,MAAM,IAAI,MAAM,4BAA4B,EAChF,IAAMC,EAAYD,EAAW,SAAS,CAAC,EAAE,OACzC,OAAO,KAAK,KAAKC,EAAY,CAAC,CAChC,CASM,SAAUC,GAAiBF,EAAkB,CACjD,IAAMG,EAASJ,GAAoBC,CAAU,EAC7C,OAAOG,EAAS,KAAK,KAAKA,EAAS,CAAC,CACtC,CAeM,SAAUC,GAAeC,EAAiBL,EAAoBM,EAAO,GAAK,CAC9E,IAAMC,EAAMF,EAAI,OACVG,EAAWT,GAAoBC,CAAU,EACzCS,EAASP,GAAiBF,CAAU,EAE1C,GAAIO,EAAM,IAAMA,EAAME,GAAUF,EAAM,KACpC,MAAM,IAAI,MAAM,YAAcE,EAAS,6BAA+BF,CAAG,EAC3E,IAAMG,EAAMJ,EAAOK,GAAgBN,CAAG,EAAIO,GAAgBP,CAAG,EAEvDQ,EAAUC,GAAIJ,EAAKV,EAAae,EAAG,EAAIA,GAC7C,OAAOT,EAAOU,GAAgBH,EAASL,CAAQ,EAAIS,GAAgBJ,EAASL,CAAQ,CACtF,CCnlBA,IAAMU,GAAM,OAAO,CAAC,EACdC,GAAM,OAAO,CAAC,EA0Id,SAAUC,GAAwCC,EAAoBC,EAAO,CACjF,IAAMC,EAAMD,EAAK,OAAM,EACvB,OAAOD,EAAYE,EAAMD,CAC3B,CAQM,SAAUE,GACdC,EACAC,EAAW,CAEX,IAAMC,EAAaC,GACjBH,EAAE,GACFC,EAAO,IAAKG,GAAMA,EAAE,CAAE,CAAC,EAEzB,OAAOH,EAAO,IAAI,CAACG,EAAGC,IAAML,EAAE,WAAWI,EAAE,SAASF,EAAWG,CAAC,CAAC,CAAC,CAAC,CACrE,CAEA,SAASC,GAAUC,EAAWC,EAAY,CACxC,GAAI,CAAC,OAAO,cAAcD,CAAC,GAAKA,GAAK,GAAKA,EAAIC,EAC5C,MAAM,IAAI,MAAM,qCAAuCA,EAAO,YAAcD,CAAC,CACjF,CAWA,SAASE,GAAUF,EAAWG,EAAkB,CAC9CJ,GAAUC,EAAGG,CAAU,EACvB,IAAMC,EAAU,KAAK,KAAKD,EAAaH,CAAC,EAAI,EACtCK,EAAa,IAAML,EAAI,GACvBM,EAAY,GAAKN,EACjBO,EAAOC,GAAQR,CAAC,EAChBS,EAAU,OAAOT,CAAC,EACxB,MAAO,CAAE,QAAAI,EAAS,WAAAC,EAAY,KAAAE,EAAM,UAAAD,EAAW,QAAAG,CAAO,CACxD,CAEA,SAASC,GAAYC,EAAWC,EAAgBC,EAAY,CAC1D,GAAM,CAAE,WAAAR,EAAY,KAAAE,EAAM,UAAAD,EAAW,QAAAG,CAAO,EAAKI,EAC7CC,EAAQ,OAAOH,EAAIJ,CAAI,EACvBQ,EAAQJ,GAAKF,EAQbK,EAAQT,IAEVS,GAASR,EACTS,GAAS5B,IAEX,IAAM6B,EAAcJ,EAASP,EACvBY,EAASD,EAAc,KAAK,IAAIF,CAAK,EAAI,EACzCI,EAASJ,IAAU,EACnBK,EAAQL,EAAQ,EAChBM,EAASR,EAAS,IAAM,EAE9B,MAAO,CAAE,MAAAG,EAAO,OAAAE,EAAQ,OAAAC,EAAQ,MAAAC,EAAO,OAAAC,EAAQ,QAD/BJ,CACsC,CACxD,CAEA,SAASK,GAAkB3B,EAAeD,EAAM,CAC9C,GAAI,CAAC,MAAM,QAAQC,CAAM,EAAG,MAAM,IAAI,MAAM,gBAAgB,EAC5DA,EAAO,QAAQ,CAACG,EAAGC,IAAK,CACtB,GAAI,EAAED,aAAaJ,GAAI,MAAM,IAAI,MAAM,0BAA4BK,CAAC,CACtE,CAAC,CACH,CACA,SAASwB,GAAmBC,EAAgBC,EAAU,CACpD,GAAI,CAAC,MAAM,QAAQD,CAAO,EAAG,MAAM,IAAI,MAAM,2BAA2B,EACxEA,EAAQ,QAAQ,CAACE,EAAG3B,IAAK,CACvB,GAAI,CAAC0B,EAAM,QAAQC,CAAC,EAAG,MAAM,IAAI,MAAM,2BAA6B3B,CAAC,CACvE,CAAC,CACH,CAKA,IAAM4B,GAAmB,IAAI,QACvBC,GAAmB,IAAI,QAE7B,SAASC,GAAKC,EAAM,CAGlB,OAAOF,GAAiB,IAAIE,CAAC,GAAK,CACpC,CAEA,SAASC,GAAQnB,EAAS,CACxB,GAAIA,IAAMzB,GAAK,MAAM,IAAI,MAAM,cAAc,CAC/C,CAoBM,IAAO6C,GAAP,KAAW,CAOf,YAAYC,EAAW/B,EAAY,CACjC,KAAK,KAAO+B,EAAM,KAClB,KAAK,KAAOA,EAAM,KAClB,KAAK,GAAKA,EAAM,GAChB,KAAK,KAAO/B,CACd,CAGA,cAAcgC,EAAetB,EAAWd,EAAc,KAAK,KAAI,CAC7D,IAAIqC,EAAcD,EAClB,KAAOtB,EAAIzB,IACLyB,EAAIxB,KAAKU,EAAIA,EAAE,IAAIqC,CAAC,GACxBA,EAAIA,EAAE,OAAM,EACZvB,IAAMxB,GAER,OAAOU,CACT,CAcQ,iBAAiBsC,EAAiBnC,EAAS,CACjD,GAAM,CAAE,QAAAI,EAAS,WAAAC,CAAU,EAAKH,GAAUF,EAAG,KAAK,IAAI,EAChDN,EAAqB,CAAA,EACvBG,EAAcsC,EACdC,EAAOvC,EACX,QAASe,EAAS,EAAGA,EAASR,EAASQ,IAAU,CAC/CwB,EAAOvC,EACPH,EAAO,KAAK0C,CAAI,EAEhB,QAAStC,EAAI,EAAGA,EAAIO,EAAYP,IAC9BsC,EAAOA,EAAK,IAAIvC,CAAC,EACjBH,EAAO,KAAK0C,CAAI,EAElBvC,EAAIuC,EAAK,OAAM,CACjB,CACA,OAAO1C,CACT,CAQQ,KAAKM,EAAWqC,EAAyB,EAAS,CAExD,GAAI,CAAC,KAAK,GAAG,QAAQ,CAAC,EAAG,MAAM,IAAI,MAAM,gBAAgB,EAEzD,IAAIxC,EAAI,KAAK,KACTyC,EAAI,KAAK,KAMPC,EAAKrC,GAAUF,EAAG,KAAK,IAAI,EACjC,QAASY,EAAS,EAAGA,EAAS2B,EAAG,QAAS3B,IAAU,CAElD,GAAM,CAAE,MAAAG,EAAO,OAAAE,EAAQ,OAAAC,EAAQ,MAAAC,EAAO,OAAAC,EAAQ,QAAAoB,CAAO,EAAK9B,GAAY,EAAGE,EAAQ2B,CAAE,EACnF,EAAIxB,EACAG,EAGFoB,EAAIA,EAAE,IAAIlD,GAASgC,EAAQiB,EAAYG,CAAO,CAAC,CAAC,EAGhD3C,EAAIA,EAAE,IAAIT,GAAS+B,EAAOkB,EAAYpB,CAAM,CAAC,CAAC,CAElD,CACA,OAAAa,GAAQ,CAAC,EAIF,CAAE,EAAAjC,EAAG,EAAAyC,CAAC,CACf,CAOQ,WACNtC,EACAqC,EACA,EACAI,EAAgB,KAAK,KAAI,CAEzB,IAAMF,EAAKrC,GAAUF,EAAG,KAAK,IAAI,EACjC,QAASY,EAAS,EAAGA,EAAS2B,EAAG,SAC3B,IAAMrD,GAD8B0B,IAAU,CAElD,GAAM,CAAE,MAAAG,EAAO,OAAAE,EAAQ,OAAAC,EAAQ,MAAAC,CAAK,EAAKT,GAAY,EAAGE,EAAQ2B,CAAE,EAElE,GADA,EAAIxB,EACA,CAAAG,EAIG,CACL,IAAM5B,EAAO+C,EAAYpB,CAAM,EAC/BwB,EAAMA,EAAI,IAAItB,EAAQ7B,EAAK,OAAM,EAAKA,CAAI,CAC5C,CACF,CACA,OAAAwC,GAAQ,CAAC,EACFW,CACT,CAEQ,eAAezC,EAAWmC,EAAiBO,EAA4B,CAE7E,IAAIC,EAAOjB,GAAiB,IAAIS,CAAK,EACrC,OAAKQ,IACHA,EAAO,KAAK,iBAAiBR,EAAOnC,CAAC,EACjCA,IAAM,IAEJ,OAAO0C,GAAc,aAAYC,EAAOD,EAAUC,CAAI,GAC1DjB,GAAiB,IAAIS,EAAOQ,CAAI,IAG7BA,CACT,CAEA,OACER,EACAS,EACAF,EAA4B,CAE5B,IAAM1C,EAAI4B,GAAKO,CAAK,EACpB,OAAO,KAAK,KAAKnC,EAAG,KAAK,eAAeA,EAAGmC,EAAOO,CAAS,EAAGE,CAAM,CACtE,CAEA,OAAOT,EAAiBS,EAAgBF,EAA8BG,EAAe,CACnF,IAAM7C,EAAI4B,GAAKO,CAAK,EACpB,OAAInC,IAAM,EAAU,KAAK,cAAcmC,EAAOS,EAAQC,CAAI,EACnD,KAAK,WAAW7C,EAAG,KAAK,eAAeA,EAAGmC,EAAOO,CAAS,EAAGE,EAAQC,CAAI,CAClF,CAKA,YAAYhB,EAAa7B,EAAS,CAChCD,GAAUC,EAAG,KAAK,IAAI,EACtB2B,GAAiB,IAAIE,EAAG7B,CAAC,EACzB0B,GAAiB,OAAOG,CAAC,CAC3B,CAEA,SAASI,EAAa,CACpB,OAAOL,GAAKK,CAAG,IAAM,CACvB,GAOI,SAAUa,GACdd,EACAG,EACAY,EACAC,EAAU,CAEV,IAAIP,EAAMN,EACNc,EAAKjB,EAAM,KACXkB,EAAKlB,EAAM,KACf,KAAOe,EAAK7D,IAAO8D,EAAK9D,IAClB6D,EAAK5D,KAAK8D,EAAKA,EAAG,IAAIR,CAAG,GACzBO,EAAK7D,KAAK+D,EAAKA,EAAG,IAAIT,CAAG,GAC7BA,EAAMA,EAAI,OAAM,EAChBM,IAAO5D,GACP6D,IAAO7D,GAET,MAAO,CAAE,GAAA8D,EAAI,GAAAC,CAAE,CACjB,CAYM,SAAUC,GACd1D,EACA2D,EACA1D,EACA6B,EAAiB,CAQjBF,GAAkB3B,EAAQD,CAAC,EAC3B6B,GAAmBC,EAAS6B,CAAM,EAClC,IAAMC,EAAU3D,EAAO,OACjB4D,EAAU/B,EAAQ,OACxB,GAAI8B,IAAYC,EAAS,MAAM,IAAI,MAAM,qDAAqD,EAE9F,IAAMC,EAAO9D,EAAE,KACTqB,EAAQ0C,GAAO,OAAOH,CAAO,CAAC,EAChChD,EAAa,EACbS,EAAQ,GAAIT,EAAaS,EAAQ,EAC5BA,EAAQ,EAAGT,EAAaS,EAAQ,EAChCA,EAAQ,IAAGT,EAAa,GACjC,IAAMoD,EAAOjD,GAAQH,CAAU,EACzBqD,EAAU,IAAI,MAAM,OAAOD,CAAI,EAAI,CAAC,EAAE,KAAKF,CAAI,EAC/CI,EAAW,KAAK,OAAOP,EAAO,KAAO,GAAK/C,CAAU,EAAIA,EAC1DuD,EAAML,EACV,QAASzD,EAAI6D,EAAU7D,GAAK,EAAGA,GAAKO,EAAY,CAC9CqD,EAAQ,KAAKH,CAAI,EACjB,QAASM,EAAI,EAAGA,EAAIP,EAASO,IAAK,CAChC,IAAMjB,EAASrB,EAAQsC,CAAC,EAClB/C,EAAQ,OAAQ8B,GAAU,OAAO9C,CAAC,EAAK2D,CAAI,EACjDC,EAAQ5C,CAAK,EAAI4C,EAAQ5C,CAAK,EAAE,IAAIpB,EAAOmE,CAAC,CAAC,CAC/C,CACA,IAAIC,EAAOP,EAEX,QAASM,EAAIH,EAAQ,OAAS,EAAGK,EAAOR,EAAMM,EAAI,EAAGA,IACnDE,EAAOA,EAAK,IAAIL,EAAQG,CAAC,CAAC,EAC1BC,EAAOA,EAAK,IAAIC,CAAI,EAGtB,GADAH,EAAMA,EAAI,IAAIE,CAAI,EACdhE,IAAM,EAAG,QAAS+D,EAAI,EAAGA,EAAIxD,EAAYwD,IAAKD,EAAMA,EAAI,OAAM,CACpE,CACA,OAAOA,CACT,CAkJA,SAASI,GAAeC,EAAeC,EAAmBC,EAAc,CACtE,GAAID,EAAO,CACT,GAAIA,EAAM,QAAUD,EAAO,MAAM,IAAI,MAAM,gDAAgD,EAC3F,OAAAG,GAAcF,CAAK,EACZA,CACT,KACE,QAAOG,GAAMJ,EAAO,CAAE,KAAAE,CAAI,CAAE,CAEhC,CAIM,SAAUG,GACdC,EACAC,EACAC,EAA8B,CAAA,EAC9BC,EAAgB,CAGhB,GADIA,IAAW,SAAWA,EAASH,IAAS,WACxC,CAACC,GAAS,OAAOA,GAAU,SAAU,MAAM,IAAI,MAAM,kBAAkBD,CAAI,eAAe,EAC9F,QAAWI,IAAK,CAAC,IAAK,IAAK,GAAG,EAAY,CACxC,IAAMC,EAAMJ,EAAMG,CAAC,EACnB,GAAI,EAAE,OAAOC,GAAQ,UAAYA,EAAMC,IACrC,MAAM,IAAI,MAAM,SAASF,CAAC,0BAA0B,CACxD,CACA,IAAMG,EAAKd,GAAYQ,EAAM,EAAGC,EAAU,GAAIC,CAAM,EAC9CK,EAAKf,GAAYQ,EAAM,EAAGC,EAAU,GAAIC,CAAM,EAE9CM,EAAS,CAAC,KAAM,KAAM,IADNT,IAAS,cAAgB,IAAM,GAClB,EACnC,QAAWI,KAAKK,EAEd,GAAI,CAACF,EAAG,QAAQN,EAAMG,CAAC,CAAC,EACtB,MAAM,IAAI,MAAM,SAASA,CAAC,0CAA0C,EAExE,OAAAH,EAAQ,OAAO,OAAO,OAAO,OAAO,CAAA,EAAIA,CAAK,CAAC,EACvC,CAAE,MAAAA,EAAO,GAAAM,EAAI,GAAAC,CAAE,CACxB,CCtkBA,IAAME,GAAa,CAACC,EAAaC,KAAiBD,GAAOA,GAAO,EAAIC,EAAM,CAACA,GAAOC,IAAOD,EAOnF,SAAUE,GAAiBC,EAAWC,EAAkBC,EAAS,CAIrE,GAAM,CAAC,CAACC,EAAIC,CAAE,EAAG,CAACC,EAAIC,CAAE,CAAC,EAAIL,EACvBM,EAAKZ,GAAWW,EAAKN,EAAGE,CAAC,EACzBM,EAAKb,GAAW,CAACS,EAAKJ,EAAGE,CAAC,EAG5BO,EAAKT,EAAIO,EAAKJ,EAAKK,EAAKH,EACxBK,EAAK,CAACH,EAAKH,EAAKI,EAAKF,EACnBK,EAAQF,EAAKG,GACbC,EAAQH,EAAKE,GACfD,IAAOF,EAAK,CAACA,GACbI,IAAOH,EAAK,CAACA,GAGjB,IAAMI,EAAUC,GAAQ,KAAK,KAAKC,GAAOd,CAAC,EAAI,CAAC,CAAC,EAAIe,GACpD,GAAIR,EAAKG,IAAOH,GAAMK,GAAWJ,EAAKE,IAAOF,GAAMI,EACjD,MAAM,IAAI,MAAM,yCAA2Cd,CAAC,EAE9D,MAAO,CAAE,MAAAW,EAAO,GAAAF,EAAI,MAAAI,EAAO,GAAAH,CAAE,CAC/B,CAkBA,SAASQ,GAAkBC,EAAc,CACvC,GAAI,CAAC,CAAC,UAAW,YAAa,KAAK,EAAE,SAASA,CAAM,EAClD,MAAM,IAAI,MAAM,2DAA2D,EAC7E,OAAOA,CACT,CAEA,SAASC,GACPC,EACAC,EAAM,CAEN,IAAMC,EAAuB,CAAA,EAC7B,QAASC,KAAW,OAAO,KAAKF,CAAG,EAEjCC,EAAMC,CAAO,EAAIH,EAAKG,CAAO,IAAM,OAAYF,EAAIE,CAAO,EAAIH,EAAKG,CAAO,EAE5E,OAAAC,GAAMF,EAAM,KAAO,MAAM,EACzBE,GAAMF,EAAM,QAAU,SAAS,EAC3BA,EAAM,SAAW,QAAWL,GAAkBK,EAAM,MAAM,EACvDA,CACT,CAmJM,IAAOG,GAAP,cAAsB,KAAK,CAC/B,YAAYC,EAAI,GAAE,CAChB,MAAMA,CAAC,CACT,GA6BWC,GAAY,CAEvB,IAAKF,GAEL,KAAM,CACJ,OAAQ,CAACG,EAAaC,IAAwB,CAC5C,GAAM,CAAE,IAAKC,CAAC,EAAKH,GACnB,GAAIC,EAAM,GAAKA,EAAM,IAAK,MAAM,IAAIE,EAAE,uBAAuB,EAC7D,GAAID,EAAK,OAAS,EAAG,MAAM,IAAIC,EAAE,2BAA2B,EAC5D,IAAMC,EAAUF,EAAK,OAAS,EACxBG,EAAMC,GAAoBF,CAAO,EACvC,GAAKC,EAAI,OAAS,EAAK,IAAa,MAAM,IAAIF,EAAE,sCAAsC,EAEtF,IAAMI,EAASH,EAAU,IAAME,GAAqBD,EAAI,OAAS,EAAK,GAAW,EAAI,GAErF,OADUC,GAAoBL,CAAG,EACtBM,EAASF,EAAMH,CAC5B,EAEA,OAAOD,EAAaC,EAAgB,CAClC,GAAM,CAAE,IAAKC,CAAC,EAAKH,GACfQ,EAAM,EACV,GAAIP,EAAM,GAAKA,EAAM,IAAK,MAAM,IAAIE,EAAE,uBAAuB,EAC7D,GAAID,EAAK,OAAS,GAAKA,EAAKM,GAAK,IAAMP,EAAK,MAAM,IAAIE,EAAE,uBAAuB,EAC/E,IAAMM,EAAQP,EAAKM,GAAK,EAClBE,EAAS,CAAC,EAAED,EAAQ,KACtBE,EAAS,EACb,GAAI,CAACD,EAAQC,EAASF,MACjB,CAEH,IAAMF,EAASE,EAAQ,IACvB,GAAI,CAACF,EAAQ,MAAM,IAAIJ,EAAE,mDAAmD,EAC5E,GAAII,EAAS,EAAG,MAAM,IAAIJ,EAAE,0CAA0C,EACtE,IAAMS,EAAcV,EAAK,SAASM,EAAKA,EAAMD,CAAM,EACnD,GAAIK,EAAY,SAAWL,EAAQ,MAAM,IAAIJ,EAAE,uCAAuC,EACtF,GAAIS,EAAY,CAAC,IAAM,EAAG,MAAM,IAAIT,EAAE,sCAAsC,EAC5E,QAAWU,KAAKD,EAAaD,EAAUA,GAAU,EAAKE,EAEtD,GADAL,GAAOD,EACHI,EAAS,IAAK,MAAM,IAAIR,EAAE,wCAAwC,CACxE,CACA,IAAMW,EAAIZ,EAAK,SAASM,EAAKA,EAAMG,CAAM,EACzC,GAAIG,EAAE,SAAWH,EAAQ,MAAM,IAAIR,EAAE,gCAAgC,EACrE,MAAO,CAAE,EAAAW,EAAG,EAAGZ,EAAK,SAASM,EAAMG,CAAM,CAAC,CAC5C,GAMF,KAAM,CACJ,OAAO3C,EAAW,CAChB,GAAM,CAAE,IAAKmC,CAAC,EAAKH,GACnB,GAAIhC,EAAMgB,GAAK,MAAM,IAAImB,EAAE,4CAA4C,EACvE,IAAIY,EAAMT,GAAoBtC,CAAG,EAGjC,GADI,OAAO,SAAS+C,EAAI,CAAC,EAAG,EAAE,EAAI,IAAQA,EAAM,KAAOA,GACnDA,EAAI,OAAS,EAAG,MAAM,IAAIZ,EAAE,gDAAgD,EAChF,OAAOY,CACT,EACA,OAAOb,EAAgB,CACrB,GAAM,CAAE,IAAKC,CAAC,EAAKH,GACnB,GAAIE,EAAK,CAAC,EAAI,IAAa,MAAM,IAAIC,EAAE,qCAAqC,EAC5E,GAAID,EAAK,CAAC,IAAM,GAAQ,EAAEA,EAAK,CAAC,EAAI,KAClC,MAAM,IAAIC,EAAE,qDAAqD,EACnE,OAAOa,GAAgBd,CAAI,CAC7B,GAEF,MAAMa,EAAwB,CAE5B,GAAM,CAAE,IAAKZ,EAAG,KAAMc,EAAK,KAAMC,CAAG,EAAKlB,GACnCE,EAAOiB,GAAY,YAAaJ,CAAG,EACnC,CAAE,EAAGK,EAAU,EAAGC,CAAY,EAAKH,EAAI,OAAO,GAAMhB,CAAI,EAC9D,GAAImB,EAAa,OAAQ,MAAM,IAAIlB,EAAE,6CAA6C,EAClF,GAAM,CAAE,EAAGmB,EAAQ,EAAGC,CAAU,EAAKL,EAAI,OAAO,EAAME,CAAQ,EACxD,CAAE,EAAGI,EAAQ,EAAGC,CAAU,EAAKP,EAAI,OAAO,EAAMK,CAAU,EAChE,GAAIE,EAAW,OAAQ,MAAM,IAAItB,EAAE,6CAA6C,EAChF,MAAO,CAAE,EAAGc,EAAI,OAAOK,CAAM,EAAG,EAAGL,EAAI,OAAOO,CAAM,CAAC,CACvD,EACA,WAAWE,EAA6B,CACtC,GAAM,CAAE,KAAMR,EAAK,KAAMD,CAAG,EAAKjB,GAC3B2B,EAAKT,EAAI,OAAO,EAAMD,EAAI,OAAOS,EAAI,CAAC,CAAC,EACvCE,EAAKV,EAAI,OAAO,EAAMD,EAAI,OAAOS,EAAI,CAAC,CAAC,EACvCG,EAAMF,EAAKC,EACjB,OAAOV,EAAI,OAAO,GAAMW,CAAG,CAC7B,GAKI7C,GAAM,OAAO,CAAC,EAAGK,GAAM,OAAO,CAAC,EAAGnB,GAAM,OAAO,CAAC,EAAG4D,GAAM,OAAO,CAAC,EAAGC,GAAM,OAAO,CAAC,EAElF,SAAUC,GAAeC,EAAoBC,EAAY,CAC7D,GAAM,CAAE,MAAOC,CAAQ,EAAKF,EACxBjE,EACJ,GAAI,OAAOkE,GAAQ,SACjBlE,EAAMkE,MACD,CACL,IAAIE,EAAQjB,GAAY,cAAee,CAAG,EAC1C,GAAI,CACFlE,EAAMiE,EAAG,UAAUG,CAAK,CAC1B,MAAgB,CACd,MAAM,IAAI,MAAM,8CAA8CD,CAAQ,SAAS,OAAOD,CAAG,EAAE,CAC7F,CACF,CACA,GAAI,CAACD,EAAG,YAAYjE,CAAG,EAAG,MAAM,IAAI,MAAM,4CAA4C,EACtF,OAAOA,CACT,CAmBM,SAAUqE,GACdC,EACAC,EAAqC,CAAA,EAAE,CAEvC,IAAMC,EAAYC,GAAmB,cAAeH,EAAQC,CAAS,EAC/D,CAAE,GAAAG,EAAI,GAAAT,CAAE,EAAKO,EACfG,EAAQH,EAAU,MAChB,CAAE,EAAGI,EAAU,EAAGC,CAAW,EAAKF,EACxCG,GACEP,EACA,CAAA,EACA,CACE,mBAAoB,UACpB,cAAe,WACf,cAAe,WACf,UAAW,WACX,QAAS,WACT,KAAM,SACN,eAAgB,UACjB,EAGH,GAAM,CAAE,KAAAQ,CAAI,EAAKR,EACjB,GAAIQ,IAEE,CAACL,EAAG,IAAIC,EAAM,CAAC,GAAK,OAAOI,EAAK,MAAS,UAAY,CAAC,MAAM,QAAQA,EAAK,OAAO,GAClF,MAAM,IAAI,MAAM,4DAA4D,EAIhF,IAAMC,EAAUC,GAAYP,EAAIT,CAAE,EAElC,SAASiB,GAA4B,CACnC,GAAI,CAACR,EAAG,MAAO,MAAM,IAAI,MAAM,4DAA4D,CAC7F,CAGA,SAASS,EACPC,EACAC,EACAC,EAAqB,CAErB,GAAM,CAAE,EAAAC,EAAG,EAAAC,CAAC,EAAKH,EAAM,SAAQ,EACzBI,EAAKf,EAAG,QAAQa,CAAC,EAEvB,GADA1D,GAAMyD,EAAc,cAAc,EAC9BA,EAAc,CAChBJ,EAA4B,EAC5B,IAAMQ,EAAW,CAAChB,EAAG,MAAOc,CAAC,EAC7B,OAAOG,GAAYC,GAAQF,CAAQ,EAAGD,CAAE,CAC1C,KACE,QAAOE,GAAY,WAAW,GAAG,CAAI,EAAGF,EAAIf,EAAG,QAAQc,CAAC,CAAC,CAE7D,CACA,SAASK,EAAezB,EAAiB,CACvC0B,GAAO1B,EAAO,OAAW,OAAO,EAChC,GAAM,CAAE,UAAW2B,EAAM,sBAAuBC,CAAM,EAAKhB,EACrDrC,EAASyB,EAAM,OACf6B,EAAO7B,EAAM,CAAC,EACd8B,EAAO9B,EAAM,SAAS,CAAC,EAE7B,GAAIzB,IAAWoD,IAASE,IAAS,GAAQA,IAAS,GAAO,CACvD,IAAMV,EAAIb,EAAG,UAAUwB,CAAI,EAC3B,GAAI,CAACxB,EAAG,QAAQa,CAAC,EAAG,MAAM,IAAI,MAAM,qCAAqC,EACzE,IAAMY,EAAKC,EAAoBb,CAAC,EAC5BC,EACJ,GAAI,CACFA,EAAId,EAAG,KAAKyB,CAAE,CAChB,OAASE,GAAW,CAClB,IAAMC,EAAMD,cAAqB,MAAQ,KAAOA,GAAU,QAAU,GACpE,MAAM,IAAI,MAAM,yCAA2CC,CAAG,CAChE,CACApB,EAA4B,EAC5B,IAAMqB,EAAS7B,EAAG,MAAOc,CAAC,EAE1B,OADmBS,EAAO,KAAO,IACfM,IAAQf,EAAId,EAAG,IAAIc,CAAC,GAC/B,CAAE,EAAAD,EAAG,EAAAC,CAAC,CACf,SAAW7C,IAAWqD,GAAUC,IAAS,EAAM,CAE7C,IAAMO,EAAI9B,EAAG,MACPa,EAAIb,EAAG,UAAUwB,EAAK,SAAS,EAAGM,CAAC,CAAC,EACpChB,EAAId,EAAG,UAAUwB,EAAK,SAASM,EAAGA,EAAI,CAAC,CAAC,EAC9C,GAAI,CAACC,EAAUlB,EAAGC,CAAC,EAAG,MAAM,IAAI,MAAM,4BAA4B,EAClE,MAAO,CAAE,EAAAD,EAAG,EAAAC,CAAC,CACf,KACE,OAAM,IAAI,MACR,yBAAyB7C,CAAM,yBAAyBoD,CAAI,oBAAoBC,CAAM,EAAE,CAG9F,CAEA,IAAMU,EAAcnC,EAAU,SAAWY,EACnCwB,EAAcpC,EAAU,WAAasB,EAC3C,SAASO,EAAoBb,EAAI,CAC/B,IAAMqB,EAAKlC,EAAG,IAAIa,CAAC,EACbsB,EAAKnC,EAAG,IAAIkC,EAAIrB,CAAC,EACvB,OAAOb,EAAG,IAAIA,EAAG,IAAImC,EAAInC,EAAG,IAAIa,EAAGZ,EAAM,CAAC,CAAC,EAAGA,EAAM,CAAC,CACvD,CAIA,SAAS8B,EAAUlB,EAAMC,EAAI,CAC3B,IAAMsB,EAAOpC,EAAG,IAAIc,CAAC,EACfuB,EAAQX,EAAoBb,CAAC,EACnC,OAAOb,EAAG,IAAIoC,EAAMC,CAAK,CAC3B,CAIA,GAAI,CAACN,EAAU9B,EAAM,GAAIA,EAAM,EAAE,EAAG,MAAM,IAAI,MAAM,mCAAmC,EAIvF,IAAMqC,EAAOtC,EAAG,IAAIA,EAAG,IAAIC,EAAM,EAAGb,EAAG,EAAGC,EAAG,EACvCkD,EAAQvC,EAAG,IAAIA,EAAG,IAAIC,EAAM,CAAC,EAAG,OAAO,EAAE,CAAC,EAChD,GAAID,EAAG,IAAIA,EAAG,IAAIsC,EAAMC,CAAK,CAAC,EAAG,MAAM,IAAI,MAAM,0BAA0B,EAG3E,SAASC,EAAOC,EAAe7G,EAAM8G,EAAU,GAAK,CAClD,GAAI,CAAC1C,EAAG,QAAQpE,CAAC,GAAM8G,GAAW1C,EAAG,IAAIpE,CAAC,EAAI,MAAM,IAAI,MAAM,wBAAwB6G,CAAK,EAAE,EAC7F,OAAO7G,CACT,CAEA,SAAS+G,EAAUC,EAAc,CAC/B,GAAI,EAAEA,aAAiBC,GAAQ,MAAM,IAAI,MAAM,0BAA0B,CAC3E,CAEA,SAASC,GAAiBpH,EAAS,CACjC,GAAI,CAAC2E,GAAQ,CAACA,EAAK,QAAS,MAAM,IAAI,MAAM,SAAS,EACrD,OAAO5E,GAAiBC,EAAG2E,EAAK,QAASd,EAAG,KAAK,CACnD,CAOA,IAAMwD,GAAeC,GAAS,CAACC,EAAUC,IAA0B,CACjE,GAAM,CAAE,EAAAC,EAAG,EAAAC,EAAG,EAAAC,CAAC,EAAKJ,EAEpB,GAAIjD,EAAG,IAAIqD,EAAGrD,EAAG,GAAG,EAAG,MAAO,CAAE,EAAGmD,EAAG,EAAGC,CAAC,EAC1C,IAAME,EAAML,EAAE,IAAG,EAGbC,GAAM,OAAMA,EAAKI,EAAMtD,EAAG,IAAMA,EAAG,IAAIqD,CAAC,GAC5C,IAAMxC,EAAIb,EAAG,IAAImD,EAAGD,CAAE,EAChBpC,EAAId,EAAG,IAAIoD,EAAGF,CAAE,EAChBK,EAAKvD,EAAG,IAAIqD,EAAGH,CAAE,EACvB,GAAII,EAAK,MAAO,CAAE,EAAGtD,EAAG,KAAM,EAAGA,EAAG,IAAI,EACxC,GAAI,CAACA,EAAG,IAAIuD,EAAIvD,EAAG,GAAG,EAAG,MAAM,IAAI,MAAM,kBAAkB,EAC3D,MAAO,CAAE,EAAAa,EAAG,EAAAC,CAAC,CACf,CAAC,EAGK0C,GAAkBR,GAAUC,GAAY,CAC5C,GAAIA,EAAE,IAAG,EAAI,CAIX,GAAIpD,EAAU,oBAAsB,CAACG,EAAG,IAAIiD,EAAE,CAAC,EAAG,OAClD,MAAM,IAAI,MAAM,iBAAiB,CACnC,CAEA,GAAM,CAAE,EAAApC,EAAG,EAAAC,CAAC,EAAKmC,EAAE,SAAQ,EAC3B,GAAI,CAACjD,EAAG,QAAQa,CAAC,GAAK,CAACb,EAAG,QAAQc,CAAC,EAAG,MAAM,IAAI,MAAM,sCAAsC,EAC5F,GAAI,CAACiB,EAAUlB,EAAGC,CAAC,EAAG,MAAM,IAAI,MAAM,mCAAmC,EACzE,GAAI,CAACmC,EAAE,cAAa,EAAI,MAAM,IAAI,MAAM,wCAAwC,EAChF,MAAO,EACT,CAAC,EAED,SAASQ,GACPC,EACAC,EACAC,EACAvH,EACAE,EAAc,CAEd,OAAAqH,EAAM,IAAIf,EAAM7C,EAAG,IAAI4D,EAAI,EAAGF,CAAQ,EAAGE,EAAI,EAAGA,EAAI,CAAC,EACrDD,EAAME,GAASxH,EAAOsH,CAAG,EACzBC,EAAMC,GAAStH,EAAOqH,CAAG,EAClBD,EAAI,IAAIC,CAAG,CACpB,CAOA,MAAMf,CAAK,CAeT,YAAYM,EAAMC,EAAMC,EAAI,CAC1B,KAAK,EAAIb,EAAO,IAAKW,CAAC,EACtB,KAAK,EAAIX,EAAO,IAAKY,EAAG,EAAI,EAC5B,KAAK,EAAIZ,EAAO,IAAKa,CAAC,EACtB,OAAO,OAAO,IAAI,CACpB,CAEA,OAAO,OAAK,CACV,OAAOpD,CACT,CAGA,OAAO,WAAWgD,EAAiB,CACjC,GAAM,CAAE,EAAApC,EAAG,EAAAC,CAAC,EAAKmC,GAAK,CAAA,EACtB,GAAI,CAACA,GAAK,CAACjD,EAAG,QAAQa,CAAC,GAAK,CAACb,EAAG,QAAQc,CAAC,EAAG,MAAM,IAAI,MAAM,sBAAsB,EAClF,GAAImC,aAAaJ,EAAO,MAAM,IAAI,MAAM,8BAA8B,EAEtE,OAAI7C,EAAG,IAAIa,CAAC,GAAKb,EAAG,IAAIc,CAAC,EAAU+B,EAAM,KAClC,IAAIA,EAAMhC,EAAGC,EAAGd,EAAG,GAAG,CAC/B,CAEA,OAAO,UAAUN,EAAiB,CAChC,IAAMoE,EAAIjB,EAAM,WAAWZ,EAAYb,GAAO1B,EAAO,OAAW,OAAO,CAAC,CAAC,EACzE,OAAAoE,EAAE,eAAc,EACTA,CACT,CACA,OAAO,QAAQzF,EAAQ,CACrB,OAAOwE,EAAM,UAAUpE,GAAY,WAAYJ,CAAG,CAAC,CACrD,CAEA,IAAI,GAAC,CACH,OAAO,KAAK,SAAQ,EAAG,CACzB,CACA,IAAI,GAAC,CACH,OAAO,KAAK,SAAQ,EAAG,CACzB,CAQA,WAAW0F,EAAqB,EAAGC,EAAS,GAAI,CAC9C,OAAAC,GAAK,YAAY,KAAMF,CAAU,EAC5BC,GAAQ,KAAK,SAAS5E,EAAG,EACvB,IACT,CAIA,gBAAc,CACZoE,GAAgB,IAAI,CACtB,CAEA,UAAQ,CACN,GAAM,CAAE,EAAA1C,CAAC,EAAK,KAAK,SAAQ,EAC3B,GAAI,CAACd,EAAG,MAAO,MAAM,IAAI,MAAM,6BAA6B,EAC5D,MAAO,CAACA,EAAG,MAAMc,CAAC,CACpB,CAGA,OAAO8B,EAAY,CACjBD,EAAUC,CAAK,EACf,GAAM,CAAE,EAAGsB,EAAI,EAAGC,EAAI,EAAGC,CAAE,EAAK,KAC1B,CAAE,EAAGC,EAAI,EAAGC,EAAI,EAAGC,CAAE,EAAK3B,EAC1B4B,EAAKxE,EAAG,IAAIA,EAAG,IAAIkE,EAAIK,CAAE,EAAGvE,EAAG,IAAIqE,EAAID,CAAE,CAAC,EAC1CK,EAAKzE,EAAG,IAAIA,EAAG,IAAImE,EAAII,CAAE,EAAGvE,EAAG,IAAIsE,EAAIF,CAAE,CAAC,EAChD,OAAOI,GAAMC,CACf,CAGA,QAAM,CACJ,OAAO,IAAI5B,EAAM,KAAK,EAAG7C,EAAG,IAAI,KAAK,CAAC,EAAG,KAAK,CAAC,CACjD,CAMA,QAAM,CACJ,GAAM,CAAE,EAAA0E,EAAG,EAAAvG,CAAC,EAAK8B,EACX0E,EAAK3E,EAAG,IAAI7B,EAAGiB,EAAG,EAClB,CAAE,EAAG8E,EAAI,EAAGC,EAAI,EAAGC,CAAE,EAAK,KAC5BQ,EAAK5E,EAAG,KAAM6E,EAAK7E,EAAG,KAAM8E,EAAK9E,EAAG,KACpC+E,EAAK/E,EAAG,IAAIkE,EAAIA,CAAE,EAClBc,GAAKhF,EAAG,IAAImE,EAAIA,CAAE,EAClBc,EAAKjF,EAAG,IAAIoE,EAAIA,CAAE,EAClBc,EAAKlF,EAAG,IAAIkE,EAAIC,CAAE,EACtB,OAAAe,EAAKlF,EAAG,IAAIkF,EAAIA,CAAE,EAClBJ,EAAK9E,EAAG,IAAIkE,EAAIE,CAAE,EAClBU,EAAK9E,EAAG,IAAI8E,EAAIA,CAAE,EAClBF,EAAK5E,EAAG,IAAI0E,EAAGI,CAAE,EACjBD,EAAK7E,EAAG,IAAI2E,EAAIM,CAAE,EAClBJ,EAAK7E,EAAG,IAAI4E,EAAIC,CAAE,EAClBD,EAAK5E,EAAG,IAAIgF,GAAIH,CAAE,EAClBA,EAAK7E,EAAG,IAAIgF,GAAIH,CAAE,EAClBA,EAAK7E,EAAG,IAAI4E,EAAIC,CAAE,EAClBD,EAAK5E,EAAG,IAAIkF,EAAIN,CAAE,EAClBE,EAAK9E,EAAG,IAAI2E,EAAIG,CAAE,EAClBG,EAAKjF,EAAG,IAAI0E,EAAGO,CAAE,EACjBC,EAAKlF,EAAG,IAAI+E,EAAIE,CAAE,EAClBC,EAAKlF,EAAG,IAAI0E,EAAGQ,CAAE,EACjBA,EAAKlF,EAAG,IAAIkF,EAAIJ,CAAE,EAClBA,EAAK9E,EAAG,IAAI+E,EAAIA,CAAE,EAClBA,EAAK/E,EAAG,IAAI8E,EAAIC,CAAE,EAClBA,EAAK/E,EAAG,IAAI+E,EAAIE,CAAE,EAClBF,EAAK/E,EAAG,IAAI+E,EAAIG,CAAE,EAClBL,EAAK7E,EAAG,IAAI6E,EAAIE,CAAE,EAClBE,EAAKjF,EAAG,IAAImE,EAAIC,CAAE,EAClBa,EAAKjF,EAAG,IAAIiF,EAAIA,CAAE,EAClBF,EAAK/E,EAAG,IAAIiF,EAAIC,CAAE,EAClBN,EAAK5E,EAAG,IAAI4E,EAAIG,CAAE,EAClBD,EAAK9E,EAAG,IAAIiF,EAAID,EAAE,EAClBF,EAAK9E,EAAG,IAAI8E,EAAIA,CAAE,EAClBA,EAAK9E,EAAG,IAAI8E,EAAIA,CAAE,EACX,IAAIjC,EAAM+B,EAAIC,EAAIC,CAAE,CAC7B,CAMA,IAAIlC,EAAY,CACdD,EAAUC,CAAK,EACf,GAAM,CAAE,EAAGsB,EAAI,EAAGC,EAAI,EAAGC,CAAE,EAAK,KAC1B,CAAE,EAAGC,EAAI,EAAGC,EAAI,EAAGC,CAAE,EAAK3B,EAC5BgC,EAAK5E,EAAG,KAAM6E,EAAK7E,EAAG,KAAM8E,EAAK9E,EAAG,KAClC0E,GAAIzE,EAAM,EACV0E,EAAK3E,EAAG,IAAIC,EAAM,EAAGb,EAAG,EAC1B2F,EAAK/E,EAAG,IAAIkE,EAAIG,CAAE,EAClBW,EAAKhF,EAAG,IAAImE,EAAIG,CAAE,EAClBW,GAAKjF,EAAG,IAAIoE,EAAIG,CAAE,EAClBW,GAAKlF,EAAG,IAAIkE,EAAIC,CAAE,EAClBgB,EAAKnF,EAAG,IAAIqE,EAAIC,CAAE,EACtBY,GAAKlF,EAAG,IAAIkF,GAAIC,CAAE,EAClBA,EAAKnF,EAAG,IAAI+E,EAAIC,CAAE,EAClBE,GAAKlF,EAAG,IAAIkF,GAAIC,CAAE,EAClBA,EAAKnF,EAAG,IAAIkE,EAAIE,CAAE,EAClB,IAAIgB,GAAKpF,EAAG,IAAIqE,EAAIE,CAAE,EACtB,OAAAY,EAAKnF,EAAG,IAAImF,EAAIC,EAAE,EAClBA,GAAKpF,EAAG,IAAI+E,EAAIE,EAAE,EAClBE,EAAKnF,EAAG,IAAImF,EAAIC,EAAE,EAClBA,GAAKpF,EAAG,IAAImE,EAAIC,CAAE,EAClBQ,EAAK5E,EAAG,IAAIsE,EAAIC,CAAE,EAClBa,GAAKpF,EAAG,IAAIoF,GAAIR,CAAE,EAClBA,EAAK5E,EAAG,IAAIgF,EAAIC,EAAE,EAClBG,GAAKpF,EAAG,IAAIoF,GAAIR,CAAE,EAClBE,EAAK9E,EAAG,IAAI0E,GAAGS,CAAE,EACjBP,EAAK5E,EAAG,IAAI2E,EAAIM,EAAE,EAClBH,EAAK9E,EAAG,IAAI4E,EAAIE,CAAE,EAClBF,EAAK5E,EAAG,IAAIgF,EAAIF,CAAE,EAClBA,EAAK9E,EAAG,IAAIgF,EAAIF,CAAE,EAClBD,EAAK7E,EAAG,IAAI4E,EAAIE,CAAE,EAClBE,EAAKhF,EAAG,IAAI+E,EAAIA,CAAE,EAClBC,EAAKhF,EAAG,IAAIgF,EAAID,CAAE,EAClBE,GAAKjF,EAAG,IAAI0E,GAAGO,EAAE,EACjBE,EAAKnF,EAAG,IAAI2E,EAAIQ,CAAE,EAClBH,EAAKhF,EAAG,IAAIgF,EAAIC,EAAE,EAClBA,GAAKjF,EAAG,IAAI+E,EAAIE,EAAE,EAClBA,GAAKjF,EAAG,IAAI0E,GAAGO,EAAE,EACjBE,EAAKnF,EAAG,IAAImF,EAAIF,EAAE,EAClBF,EAAK/E,EAAG,IAAIgF,EAAIG,CAAE,EAClBN,EAAK7E,EAAG,IAAI6E,EAAIE,CAAE,EAClBA,EAAK/E,EAAG,IAAIoF,GAAID,CAAE,EAClBP,EAAK5E,EAAG,IAAIkF,GAAIN,CAAE,EAClBA,EAAK5E,EAAG,IAAI4E,EAAIG,CAAE,EAClBA,EAAK/E,EAAG,IAAIkF,GAAIF,CAAE,EAClBF,EAAK9E,EAAG,IAAIoF,GAAIN,CAAE,EAClBA,EAAK9E,EAAG,IAAI8E,EAAIC,CAAE,EACX,IAAIlC,EAAM+B,EAAIC,EAAIC,CAAE,CAC7B,CAEA,SAASlC,EAAY,CACnB,OAAO,KAAK,IAAIA,EAAM,OAAM,CAAE,CAChC,CAEA,KAAG,CACD,OAAO,KAAK,OAAOC,EAAM,IAAI,CAC/B,CAWA,SAASwC,EAAc,CACrB,GAAM,CAAE,KAAAhF,CAAI,EAAKR,EACjB,GAAI,CAACN,EAAG,YAAY8F,CAAM,EAAG,MAAM,IAAI,MAAM,8BAA8B,EAC3E,IAAI1E,EAAc2E,EACZC,EAAO3J,GAAcqI,GAAK,OAAO,KAAMrI,EAAIqH,GAAMuC,GAAW3C,EAAOI,CAAC,CAAC,EAE3E,GAAI5C,EAAM,CACR,GAAM,CAAE,MAAAhE,EAAO,GAAAF,EAAI,MAAAI,EAAO,GAAAH,CAAE,EAAK0G,GAAiBuC,CAAM,EAClD,CAAE,EAAG1B,EAAK,EAAG8B,EAAG,EAAKF,EAAIpJ,CAAE,EAC3B,CAAE,EAAGyH,EAAK,EAAG8B,CAAG,EAAKH,EAAInJ,CAAE,EACjCkJ,EAAOG,GAAI,IAAIC,CAAG,EAClB/E,EAAQ8C,GAAWpD,EAAK,KAAMsD,EAAKC,EAAKvH,EAAOE,CAAK,CACtD,KAAO,CACL,GAAM,CAAE,EAAA0G,EAAG,EAAA0C,CAAC,EAAKJ,EAAIF,CAAM,EAC3B1E,EAAQsC,EACRqC,EAAOK,CACT,CAEA,OAAOH,GAAW3C,EAAO,CAAClC,EAAO2E,CAAI,CAAC,EAAE,CAAC,CAC3C,CAOA,eAAeM,EAAU,CACvB,GAAM,CAAE,KAAAvF,CAAI,EAAKR,EACX,EAAI,KACV,GAAI,CAACN,EAAG,QAAQqG,CAAE,EAAG,MAAM,IAAI,MAAM,8BAA8B,EACnE,GAAIA,IAAOtJ,IAAO,EAAE,IAAG,EAAI,OAAOuG,EAAM,KACxC,GAAI+C,IAAOjJ,GAAK,OAAO,EACvB,GAAIsH,GAAK,SAAS,IAAI,EAAG,OAAO,KAAK,SAAS2B,CAAE,EAChD,GAAIvF,EAAM,CACR,GAAM,CAAE,MAAAhE,EAAO,GAAAF,EAAI,MAAAI,EAAO,GAAAH,CAAE,EAAK0G,GAAiB8C,CAAE,EAC9C,CAAE,GAAAC,EAAI,GAAAC,CAAE,EAAKC,GAAclD,EAAO,EAAG1G,EAAIC,CAAE,EACjD,OAAOqH,GAAWpD,EAAK,KAAMwF,EAAIC,EAAIzJ,EAAOE,CAAK,CACnD,KACE,QAAO0H,GAAK,OAAO,EAAG2B,CAAE,CAE5B,CAEA,qBAAqBI,EAAUtB,EAAWvG,EAAS,CACjD,IAAM8H,EAAM,KAAK,eAAevB,CAAC,EAAE,IAAIsB,EAAE,eAAe7H,CAAC,CAAC,EAC1D,OAAO8H,EAAI,IAAG,EAAK,OAAYA,CACjC,CAMA,SAASC,EAAa,CACpB,OAAOnD,GAAa,KAAMmD,CAAS,CACrC,CAMA,eAAa,CACX,GAAM,CAAE,cAAAC,CAAa,EAAKtG,EAC1B,OAAIK,IAAavD,GAAY,GACzBwJ,EAAsBA,EAActD,EAAO,IAAI,EAC5CoB,GAAK,OAAO,KAAM9D,CAAW,EAAE,IAAG,CAC3C,CAEA,eAAa,CACX,GAAM,CAAE,cAAAiG,CAAa,EAAKvG,EAC1B,OAAIK,IAAavD,GAAY,KACzByJ,EAAsBA,EAAcvD,EAAO,IAAI,EAC5C,KAAK,eAAe3C,CAAQ,CACrC,CAEA,cAAY,CAEV,OAAO,KAAK,eAAeA,CAAQ,EAAE,IAAG,CAC1C,CAEA,QAAQU,EAAe,GAAI,CACzB,OAAAzD,GAAMyD,EAAc,cAAc,EAClC,KAAK,eAAc,EACZoB,EAAYa,EAAO,KAAMjC,CAAY,CAC9C,CAEA,MAAMA,EAAe,GAAI,CACvB,OAAOyF,GAAW,KAAK,QAAQzF,CAAY,CAAC,CAC9C,CAEA,UAAQ,CACN,MAAO,UAAU,KAAK,IAAG,EAAK,OAAS,KAAK,MAAK,CAAE,GACrD,CAGA,IAAI,IAAE,CACJ,OAAO,KAAK,CACd,CACA,IAAI,IAAE,CACJ,OAAO,KAAK,CACd,CACA,IAAI,IAAE,CACJ,OAAO,KAAK,CACd,CACA,WAAWA,EAAe,GAAI,CAC5B,OAAO,KAAK,QAAQA,CAAY,CAClC,CACA,eAAemD,EAAkB,CAC/B,KAAK,WAAWA,CAAU,CAC5B,CACA,OAAO,WAAWuC,EAAe,CAC/B,OAAOd,GAAW3C,EAAOyD,CAAM,CACjC,CACA,OAAO,IAAIA,EAAiBC,EAAiB,CAC3C,OAAOC,GAAU3D,EAAOtD,EAAI+G,EAAQC,CAAO,CAC7C,CACA,OAAO,eAAeE,EAAmB,CACvC,OAAO5D,EAAM,KAAK,SAASvD,GAAeC,EAAIkH,CAAU,CAAC,CAC3D,EA/TgB5D,EAAA,KAAO,IAAIA,EAAM5C,EAAM,GAAIA,EAAM,GAAID,EAAG,GAAG,EAE3C6C,EAAA,KAAO,IAAIA,EAAM7C,EAAG,KAAMA,EAAG,IAAKA,EAAG,IAAI,EAEzC6C,EAAA,GAAK7C,EAEL6C,EAAA,GAAKtD,EA2TvB,IAAMmH,GAAOnH,EAAG,KACV0E,GAAO,IAAI0C,GAAK9D,EAAOhD,EAAU,KAAO,KAAK,KAAK6G,GAAO,CAAC,EAAIA,EAAI,EACxE,OAAA7D,EAAM,KAAK,WAAW,CAAC,EAChBA,CACT,CA2CA,SAAS3B,GAAQF,EAAiB,CAChC,OAAO,WAAW,GAAGA,EAAW,EAAO,CAAI,CAC7C,CAuIA,SAAS4F,GAAeC,EAAeC,EAAkB,CACvD,MAAO,CACL,UAAWA,EAAG,MACd,UAAW,EAAID,EAAG,MAClB,sBAAuB,EAAI,EAAIA,EAAG,MAClC,mBAAoB,GACpB,UAAW,EAAIC,EAAG,MAEtB,CAMM,SAAUC,GACdC,EACAC,EAAmE,CAAA,EAAE,CAErE,GAAM,CAAE,GAAAH,CAAE,EAAKE,EACTE,EAAeD,EAAS,aAAeE,GACvCC,EAAU,OAAO,OAAOR,GAAYI,EAAM,GAAIF,CAAE,EAAG,CAAE,KAAMO,GAAiBP,EAAG,KAAK,CAAC,CAAE,EAE7F,SAASQ,EAAiBC,EAAkB,CAC1C,GAAI,CACF,MAAO,CAAC,CAACC,GAAeV,EAAIS,CAAS,CACvC,MAAgB,CACd,MAAO,EACT,CACF,CAEA,SAASE,EAAiBC,EAAuBC,EAAsB,CACrE,GAAM,CAAE,UAAWC,EAAM,sBAAAC,CAAqB,EAAKT,EACnD,GAAI,CACF,IAAMU,EAAIJ,EAAU,OAEpB,OADIC,IAAiB,IAAQG,IAAMF,GAC/BD,IAAiB,IAASG,IAAMD,EAA8B,GAC3D,CAAC,CAACb,EAAM,UAAUU,CAAS,CACpC,MAAgB,CACd,MAAO,EACT,CACF,CAMA,SAASK,EAAgBC,EAAOd,EAAaE,EAAQ,IAAI,EAAC,CACxD,OAAOa,GAAeC,GAAOF,EAAMZ,EAAQ,KAAM,MAAM,EAAGN,EAAG,KAAK,CACpE,CAOA,SAASqB,EAAaZ,EAAoBI,EAAe,GAAI,CAC3D,OAAOX,EAAM,KAAK,SAASQ,GAAeV,EAAIS,CAAS,CAAC,EAAE,QAAQI,CAAY,CAChF,CAEA,SAASS,EAAOJ,EAAiB,CAC/B,IAAMT,EAAYQ,EAAgBC,CAAI,EACtC,MAAO,CAAE,UAAAT,EAAW,UAAWY,EAAaZ,CAAS,CAAC,CACxD,CAKA,SAASc,EAAUC,EAAsB,CACvC,GAAI,OAAOA,GAAS,SAAU,MAAO,GACrC,GAAIA,aAAgBtB,EAAO,MAAO,GAClC,GAAM,CAAE,UAAAO,EAAW,UAAAG,EAAW,sBAAAG,CAAqB,EAAKT,EACxD,GAAIN,EAAG,gBAAkBS,IAAcG,EAAW,OAClD,IAAMI,EAAIS,GAAY,MAAOD,CAAI,EAAE,OACnC,OAAOR,IAAMJ,GAAaI,IAAMD,CAClC,CAUA,SAASW,EAAgBC,EAAqBC,EAAiBf,EAAe,GAAI,CAChF,GAAIU,EAAUI,CAAU,IAAM,GAAM,MAAM,IAAI,MAAM,+BAA+B,EACnF,GAAIJ,EAAUK,CAAU,IAAM,GAAO,MAAM,IAAI,MAAM,+BAA+B,EACpF,IAAMC,EAAInB,GAAeV,EAAI2B,CAAU,EAEvC,OADUzB,EAAM,QAAQ0B,CAAU,EACzB,SAASC,CAAC,EAAE,QAAQhB,CAAY,CAC3C,CAgBA,OAAO,OAAO,OAAO,CAAE,aAAAQ,EAAc,gBAAAK,EAAiB,OAAAJ,EAAQ,MAAApB,EAAO,MAdvD,CACZ,iBAAAM,EACA,iBAAAG,EACA,gBAAAM,EAGA,kBAAmBT,EACnB,iBAAkBS,EAClB,uBAAyBa,GAAiBpB,GAAeV,EAAI8B,CAAG,EAChE,WAAWC,EAAa,EAAGC,EAAQ9B,EAAM,KAAI,CAC3C,OAAO8B,EAAM,WAAWD,EAAY,EAAK,CAC3C,GAG0E,QAAAzB,CAAO,CAAE,CACvF,CAkBM,SAAU2B,GACd/B,EACAgC,EACAC,EAAuB,CAAA,EAAE,CAEzBC,GAAMF,CAAI,EACVG,GACEF,EACA,CAAA,EACA,CACE,KAAM,WACN,KAAM,UACN,YAAa,WACb,SAAU,WACV,cAAe,WAChB,EAGH,IAAM9B,EAAc8B,EAAU,aAAe9B,GACvCiC,EACJH,EAAU,OACR,CAACL,KAAQS,IAASD,GAAUJ,EAAMJ,EAAKU,GAAY,GAAGD,CAAI,CAAC,GAEzD,CAAE,GAAAxC,EAAI,GAAAC,CAAE,EAAKE,EACb,CAAE,MAAOuC,EAAa,KAAMC,CAAM,EAAK1C,EACvC,CAAE,OAAAsB,EAAQ,aAAAD,EAAc,gBAAAK,EAAiB,MAAAiB,EAAO,QAAArC,CAAO,EAAKL,GAAKC,EAAOiC,CAAS,EACjFS,EAA0C,CAC9C,QAAS,GACT,KAAM,OAAOT,EAAU,MAAS,UAAYA,EAAU,KAAO,GAC7D,OAAQ,OACR,aAAc,IAEVU,EAAwB,UAE9B,SAASC,EAAsBC,EAAc,CAC3C,IAAMC,EAAOP,GAAeQ,GAC5B,OAAOF,EAASC,CAClB,CACA,SAASE,EAAWC,EAAeC,EAAW,CAC5C,GAAI,CAACpD,EAAG,YAAYoD,CAAG,EACrB,MAAM,IAAI,MAAM,qBAAqBD,CAAK,kCAAkC,EAC9E,OAAOC,CACT,CACA,SAASC,EAAkBC,EAAmBC,EAAsB,CAClEC,GAAkBD,CAAM,EACxB,IAAME,EAAOnD,EAAQ,UACfoD,EAAQH,IAAW,UAAYE,EAAOF,IAAW,YAAcE,EAAO,EAAI,OAChF,OAAOrC,GAAOkC,EAAOI,EAAO,GAAGH,CAAM,YAAY,CACnD,CAKA,MAAMI,CAAS,CAIb,YAAYC,EAAW/B,EAAWgC,EAAiB,CACjD,KAAK,EAAIX,EAAW,IAAKU,CAAC,EAC1B,KAAK,EAAIV,EAAW,IAAKrB,CAAC,EACtBgC,GAAY,OAAM,KAAK,SAAWA,GACtC,OAAO,OAAO,IAAI,CACpB,CAEA,OAAO,UAAUP,EAAmBC,EAAyBV,EAAqB,CAChFQ,EAAkBC,EAAOC,CAAM,EAC/B,IAAIO,EACJ,GAAIP,IAAW,MAAO,CACpB,GAAM,CAAE,EAAAK,EAAG,EAAA/B,CAAC,EAAKkC,GAAI,MAAM3C,GAAOkC,CAAK,CAAC,EACxC,OAAO,IAAIK,EAAUC,EAAG/B,CAAC,CAC3B,CACI0B,IAAW,cACbO,EAAQR,EAAM,CAAC,EACfC,EAAS,UACTD,EAAQA,EAAM,SAAS,CAAC,GAE1B,IAAMU,EAAIhE,EAAG,MACP4D,EAAIN,EAAM,SAAS,EAAGU,CAAC,EACvBnC,EAAIyB,EAAM,SAASU,EAAGA,EAAI,CAAC,EACjC,OAAO,IAAIL,EAAU3D,EAAG,UAAU4D,CAAC,EAAG5D,EAAG,UAAU6B,CAAC,EAAGiC,CAAK,CAC9D,CAEA,OAAO,QAAQG,EAAaV,EAAuB,CACjD,OAAO,KAAK,UAAUW,GAAWD,CAAG,EAAGV,CAAM,CAC/C,CAEA,eAAeM,EAAgB,CAC7B,OAAO,IAAIF,EAAU,KAAK,EAAG,KAAK,EAAGE,CAAQ,CAC/C,CAEA,iBAAiBM,EAAgB,CAC/B,IAAMC,EAAcrE,EAAG,MACjB,CAAE,EAAA6D,EAAG,EAAA/B,EAAG,SAAUwC,CAAG,EAAK,KAChC,GAAIA,GAAO,MAAQ,CAAC,CAAC,EAAG,EAAG,EAAG,CAAC,EAAE,SAASA,CAAG,EAAG,MAAM,IAAI,MAAM,qBAAqB,EAWrF,GADoB5B,EAAc6B,GAAMF,GACrBC,EAAM,EAAG,MAAM,IAAI,MAAM,wCAAwC,EAEpF,IAAME,EAAOF,IAAQ,GAAKA,IAAQ,EAAIT,EAAInB,EAAcmB,EACxD,GAAI,CAAC7D,EAAG,QAAQwE,CAAI,EAAG,MAAM,IAAI,MAAM,4BAA4B,EACnE,IAAMC,EAAIzE,EAAG,QAAQwE,CAAI,EACnBE,GAAIvE,EAAM,UAAUsC,GAAYkC,IAASL,EAAM,KAAO,CAAC,EAAGG,CAAC,CAAC,EAC5DG,EAAK3E,EAAG,IAAIuE,CAAI,EAChBK,EAAIC,GAAcpD,GAAY,UAAW0C,CAAW,CAAC,EACrDW,EAAK9E,EAAG,OAAO,CAAC4E,EAAID,CAAE,EACtBI,GAAK/E,EAAG,OAAO6B,EAAI8C,CAAE,EAErBK,GAAI9E,EAAM,KAAK,eAAe4E,CAAE,EAAE,IAAIL,GAAE,eAAeM,EAAE,CAAC,EAChE,GAAIC,GAAE,IAAG,EAAI,MAAM,IAAI,MAAM,mBAAmB,EAChD,OAAAA,GAAE,eAAc,EACTA,EACT,CAGA,UAAQ,CACN,OAAOlC,EAAsB,KAAK,CAAC,CACrC,CAEA,QAAQS,EAAyBV,EAAqB,CAEpD,GADAW,GAAkBD,CAAM,EACpBA,IAAW,MAAO,OAAOW,GAAWH,GAAI,WAAW,IAAI,CAAC,EAC5D,IAAMH,EAAI5D,EAAG,QAAQ,KAAK,CAAC,EACrB6B,EAAI7B,EAAG,QAAQ,KAAK,CAAC,EAC3B,GAAIuD,IAAW,YAAa,CAC1B,GAAI,KAAK,UAAY,KAAM,MAAM,IAAI,MAAM,8BAA8B,EACzE,OAAOf,GAAY,WAAW,GAAG,KAAK,QAAQ,EAAGoB,EAAG/B,CAAC,CACvD,CACA,OAAOW,GAAYoB,EAAG/B,CAAC,CACzB,CAEA,MAAM0B,EAAuB,CAC3B,OAAO0B,GAAW,KAAK,QAAQ1B,CAAM,CAAC,CACxC,CAGA,gBAAc,CAAU,CACxB,OAAO,YAAYU,EAAQ,CACzB,OAAON,EAAU,UAAUlC,GAAY,MAAOwC,CAAG,EAAG,SAAS,CAC/D,CACA,OAAO,QAAQA,EAAQ,CACrB,OAAON,EAAU,UAAUlC,GAAY,MAAOwC,CAAG,EAAG,KAAK,CAC3D,CACA,YAAU,CACR,OAAO,KAAK,SAAQ,EAAK,IAAIN,EAAU,KAAK,EAAG3D,EAAG,IAAI,KAAK,CAAC,EAAG,KAAK,QAAQ,EAAI,IAClF,CACA,eAAa,CACX,OAAO,KAAK,QAAQ,KAAK,CAC3B,CACA,UAAQ,CACN,OAAOiF,GAAW,KAAK,QAAQ,KAAK,CAAC,CACvC,CACA,mBAAiB,CACf,OAAO,KAAK,QAAQ,SAAS,CAC/B,CACA,cAAY,CACV,OAAOA,GAAW,KAAK,QAAQ,SAAS,CAAC,CAC3C,EAQF,IAAMC,EACJ/C,EAAU,UACV,SAAsBmB,EAAiB,CAErC,GAAIA,EAAM,OAAS,KAAM,MAAM,IAAI,MAAM,oBAAoB,EAG7D,IAAMF,EAAM+B,GAAgB7B,CAAK,EAC3B8B,EAAQ9B,EAAM,OAAS,EAAIZ,EACjC,OAAO0C,EAAQ,EAAIhC,GAAO,OAAOgC,CAAK,EAAIhC,CAC5C,EACIyB,GACJ1C,EAAU,eACV,SAA2BmB,EAAiB,CAC1C,OAAOtD,EAAG,OAAOkF,EAAS5B,CAAK,CAAC,CAClC,EAEI+B,GAAaC,GAAQ5C,CAAM,EAEjC,SAAS6C,GAAWnC,EAAW,CAE7B,OAAAoC,GAAS,WAAa9C,EAAQU,EAAKqC,GAAKJ,EAAU,EAC3CrF,EAAG,QAAQoD,CAAG,CACvB,CAEA,SAASsC,GAAmBC,EAAqBC,EAAgB,CAC/D,OAAAxE,GAAOuE,EAAS,OAAW,SAAS,EAC7BC,EAAUxE,GAAOc,EAAKyD,CAAO,EAAG,OAAW,mBAAmB,EAAIA,CAC3E,CAUA,SAASE,EAAQF,EAAqBG,EAAqBC,EAAmB,CAC5E,GAAI,CAAC,YAAa,WAAW,EAAE,KAAMC,GAAMA,KAAKD,CAAI,EAClD,MAAM,IAAI,MAAM,qCAAqC,EACvD,GAAM,CAAE,KAAAE,EAAM,QAAAL,EAAS,aAAAM,CAAY,EAAKC,GAAgBJ,EAAMnD,CAAc,EAC5E+C,EAAUD,GAAmBC,EAASC,CAAO,EAI7C,IAAMQ,EAAQvB,GAAcc,CAAO,EAC7BU,EAAI3F,GAAeV,EAAI8F,CAAU,EACjCQ,EAAW,CAACf,GAAWc,CAAC,EAAGd,GAAWa,CAAK,CAAC,EAElD,GAAIF,GAAgB,MAAQA,IAAiB,GAAO,CAGlD,IAAMK,EAAIL,IAAiB,GAAO7F,EAAYC,EAAQ,SAAS,EAAI4F,EACnEI,EAAS,KAAK7E,GAAY,eAAgB8E,CAAC,CAAC,CAC9C,CACA,IAAMrF,GAAOsB,GAAY,GAAG8D,CAAQ,EAC9BE,EAAIJ,EASV,SAASK,EAAMC,EAAkB,CAG/B,IAAMV,GAAId,EAASwB,CAAM,EACzB,GAAI,CAAC1G,EAAG,YAAYgG,EAAC,EAAG,OACxB,IAAMW,GAAK3G,EAAG,IAAIgG,EAAC,EACbY,EAAI1G,EAAM,KAAK,SAAS8F,EAAC,EAAE,SAAQ,EACnCpC,GAAI5D,EAAG,OAAO4G,EAAE,CAAC,EACvB,GAAIhD,KAAM6B,GAAK,OACf,IAAM5D,GAAI7B,EAAG,OAAO2G,GAAK3G,EAAG,OAAOwG,EAAI5C,GAAIyC,CAAC,CAAC,EAC7C,GAAIxE,KAAM4D,GAAK,OACf,IAAI5B,IAAY+C,EAAE,IAAMhD,GAAI,EAAI,GAAK,OAAOgD,EAAE,EAAI3D,EAAG,EACjD4D,GAAQhF,GACZ,OAAIoE,GAAQnD,EAAsBjB,EAAC,IACjCgF,GAAQ7G,EAAG,IAAI6B,EAAC,EAChBgC,IAAY,GAEP,IAAIF,EAAUC,GAAGiD,GAAOhD,EAAQ,CACzC,CACA,MAAO,CAAE,KAAA3C,GAAM,MAAAuF,CAAK,CACtB,CAaA,SAASK,GAAKnB,EAAclF,EAAoBsF,EAAsB,CAAA,EAAE,CACtEJ,EAAUlE,GAAY,UAAWkE,CAAO,EACxC,GAAM,CAAE,KAAAzE,EAAM,MAAAuF,CAAK,EAAKZ,EAAQF,EAASlF,EAAWsF,CAAI,EAGxD,OAFagB,GAAmC7E,EAAK,UAAWlC,EAAG,MAAOsC,CAAI,EAC7DpB,EAAMuF,CAAK,CAE9B,CAEA,SAASO,GAAcC,EAAuB,CAE5C,IAAIC,EACEC,EAAQ,OAAOF,GAAO,UAAYG,GAAQH,CAAE,EAC5CI,EACJ,CAACF,GACDF,IAAO,MACP,OAAOA,GAAO,UACd,OAAOA,EAAG,GAAM,UAChB,OAAOA,EAAG,GAAM,SAClB,GAAI,CAACE,GAAS,CAACE,EACb,MAAM,IAAI,MAAM,0EAA0E,EAC5F,GAAIA,EACFH,EAAM,IAAIvD,EAAUsD,EAAG,EAAGA,EAAG,CAAC,UACrBE,EAAO,CAChB,GAAI,CACFD,EAAMvD,EAAU,UAAUlC,GAAY,MAAOwF,CAAE,EAAG,KAAK,CACzD,OAASK,EAAU,CACjB,GAAI,EAAEA,aAAoBvD,GAAI,KAAM,MAAMuD,CAC5C,CACA,GAAI,CAACJ,EACH,GAAI,CACFA,EAAMvD,EAAU,UAAUlC,GAAY,MAAOwF,CAAE,EAAG,SAAS,CAC7D,MAAgB,CACd,MAAO,EACT,CAEJ,CACA,OAAKC,GAAY,EAEnB,CAeA,SAASK,EACPC,EACA7B,EACA/E,EACAmF,EAAwB,CAAA,EAAE,CAE1B,GAAM,CAAE,KAAAE,EAAM,QAAAL,EAAS,OAAArC,CAAM,EAAK4C,GAAgBJ,EAAMnD,CAAc,EAGtE,GAFAhC,EAAYa,GAAY,YAAab,CAAS,EAC9C+E,EAAUD,GAAmBjE,GAAY,UAAWkE,CAAO,EAAGC,CAAO,EACjE,WAAYG,EAAM,MAAM,IAAI,MAAM,oCAAoC,EAC1E,IAAMmB,EACJ3D,IAAW,OACPyD,GAAcQ,CAAS,EACvB7D,EAAU,UAAUlC,GAAY,MAAO+F,CAAgB,EAAGjE,CAAM,EACtE,GAAI2D,IAAQ,GAAO,MAAO,GAC1B,GAAI,CACF,IAAMO,EAAIvH,EAAM,UAAUU,CAAS,EACnC,GAAIqF,GAAQiB,EAAI,SAAQ,EAAI,MAAO,GACnC,GAAM,CAAE,EAAAtD,GAAG,EAAA/B,CAAC,EAAKqF,EACXtC,EAAIC,GAAcc,CAAO,EACzB+B,EAAK1H,EAAG,IAAI6B,CAAC,EACbiD,GAAK9E,EAAG,OAAO4E,EAAI8C,CAAE,EACrB3C,GAAK/E,EAAG,OAAO4D,GAAI8D,CAAE,EACrBjD,EAAIvE,EAAM,KAAK,eAAe4E,EAAE,EAAE,IAAI2C,EAAE,eAAe1C,EAAE,CAAC,EAChE,OAAIN,EAAE,IAAG,EAAW,GACVzE,EAAG,OAAOyE,EAAE,CAAC,IACVb,EACf,MAAY,CACV,MAAO,EACT,CACF,CAEA,SAAS+D,EACPH,EACA7B,EACAI,EAAyB,CAAA,EAAE,CAE3B,GAAM,CAAE,QAAAH,CAAO,EAAKO,GAAgBJ,EAAMnD,CAAc,EACxD,OAAA+C,EAAUD,GAAmBC,EAASC,CAAO,EACtCjC,EAAU,UAAU6D,EAAW,WAAW,EAAE,iBAAiB7B,CAAO,EAAE,QAAO,CACtF,CAEA,OAAO,OAAO,OAAO,CACnB,OAAArE,EACA,aAAAD,EACA,gBAAAK,EACA,MAAAiB,EACA,QAAArC,EACA,MAAAJ,EACA,KAAA4G,GACA,OAAAS,EACA,iBAAAI,EACA,UAAAhE,EACA,KAAAzB,EACD,CACH,CAmHA,SAAS0F,GAAmCC,EAAqB,CAC/D,IAAMC,EAA4B,CAChC,EAAGD,EAAE,EACL,EAAGA,EAAE,EACL,EAAGA,EAAE,GAAG,MACR,EAAGA,EAAE,EACL,EAAGA,EAAE,EACL,GAAIA,EAAE,GACN,GAAIA,EAAE,IAEFE,EAAKF,EAAE,GACTG,EAAiBH,EAAE,yBACnB,MAAM,KAAK,IAAI,IAAIA,EAAE,yBAAyB,IAAKI,GAAM,KAAK,KAAKA,EAAI,CAAC,CAAC,CAAC,CAAC,EAC3E,OACEC,EAAKC,GAAML,EAAM,EAAG,CACxB,KAAMD,EAAE,WACR,eAAgBG,EAChB,aAAcH,EAAE,eACjB,EACKO,EAAqC,CACzC,GAAAL,EACA,GAAAG,EACA,mBAAoBL,EAAE,mBACtB,KAAMA,EAAE,KACR,cAAeA,EAAE,cACjB,cAAeA,EAAE,cACjB,UAAWA,EAAE,UACb,QAASA,EAAE,SAEb,MAAO,CAAE,MAAAC,EAAO,UAAAM,CAAS,CAC3B,CACA,SAASC,GAA0BR,EAAY,CAC7C,GAAM,CAAE,MAAAC,EAAO,UAAAM,CAAS,EAAKR,GAAgCC,CAAC,EACxDS,EAAuB,CAC3B,KAAMT,EAAE,KACR,YAAaA,EAAE,YACf,KAAMA,EAAE,KACR,SAAUA,EAAE,SACZ,cAAeA,EAAE,eAEnB,MAAO,CAAE,MAAAC,EAAO,UAAAM,EAAW,KAAMP,EAAE,KAAM,UAAAS,CAAS,CACpD,CAkCA,SAASC,GAA4BC,EAAcC,EAAa,CAC9D,IAAMC,EAAQD,EAAO,MACrB,OAAO,OAAO,OAAO,CAAA,EAAIA,EAAQ,CAC/B,gBAAiBC,EACjB,MAAO,OAAO,OAAO,CAAA,EAAIF,EAAGG,GAAQD,EAAM,GAAG,MAAOA,EAAM,GAAG,IAAI,CAAC,EACnE,CACH,CAGM,SAAUE,GAAYJ,EAAY,CACtC,GAAM,CAAE,MAAAK,EAAO,UAAAC,EAAW,KAAAC,EAAM,UAAAC,CAAS,EAAKC,GAA0BT,CAAC,EACnEE,EAAQQ,GAAaL,EAAOC,CAAS,EACrCK,EAAQC,GAAMV,EAAOK,EAAMC,CAAS,EAC1C,OAAOT,GAA4BC,EAAGW,CAAK,CAC7C,CCv0DM,SAAUE,GAAYC,EAAoBC,EAAc,CAC5D,IAAMC,EAAUC,GAAyBC,GAAY,CAAE,GAAGJ,EAAU,KAAMG,CAAI,CAAE,EAChF,MAAO,CAAE,GAAGD,EAAOD,CAAO,EAAG,OAAAC,CAAM,CACrC,CCoBA,IAAMG,GAA2C,CAC/C,EAAG,OAAO,oEAAoE,EAC9E,EAAG,OAAO,oEAAoE,EAC9E,EAAG,OAAO,CAAC,EACX,EAAG,OAAO,CAAC,EACX,EAAG,OAAO,CAAC,EACX,GAAI,OAAO,oEAAoE,EAC/E,GAAI,OAAO,oEAAoE,GAG3EC,GAAmC,CACvC,KAAM,OAAO,oEAAoE,EACjF,QAAS,CACP,CAAC,OAAO,oCAAoC,EAAG,CAAC,OAAO,oCAAoC,CAAC,EAC5F,CAAC,OAAO,qCAAqC,EAAG,OAAO,oCAAoC,CAAC,IAMhG,IAAMC,GAAsB,OAAO,CAAC,EAMpC,SAASC,GAAQC,EAAS,CACxB,IAAMC,EAAIC,GAAgB,EAEpBC,EAAM,OAAO,CAAC,EAAGC,EAAM,OAAO,CAAC,EAAGC,EAAO,OAAO,EAAE,EAAGC,EAAO,OAAO,EAAE,EAErEC,EAAO,OAAO,EAAE,EAAGC,EAAO,OAAO,EAAE,EAAGC,EAAO,OAAO,EAAE,EACtDC,EAAMV,EAAIA,EAAIA,EAAKC,EACnBU,EAAMD,EAAKA,EAAKV,EAAKC,EACrBW,EAAMC,GAAKF,EAAIR,EAAKF,CAAC,EAAIU,EAAMV,EAC/Ba,EAAMD,GAAKD,EAAIT,EAAKF,CAAC,EAAIU,EAAMV,EAC/Bc,EAAOF,GAAKC,EAAIhB,GAAKG,CAAC,EAAIS,EAAMT,EAChCe,EAAOH,GAAKE,EAAKV,EAAMJ,CAAC,EAAIc,EAAOd,EACnCgB,EAAOJ,GAAKG,EAAKV,EAAML,CAAC,EAAIe,EAAOf,EACnCiB,EAAOL,GAAKI,EAAKT,EAAMP,CAAC,EAAIgB,EAAOhB,EACnCkB,EAAQN,GAAKK,EAAKT,EAAMR,CAAC,EAAIiB,EAAOjB,EACpCmB,EAAQP,GAAKM,EAAMX,EAAMP,CAAC,EAAIgB,EAAOhB,EACrCoB,EAAQR,GAAKO,EAAMjB,EAAKF,CAAC,EAAIU,EAAMV,EACnCqB,EAAMT,GAAKQ,EAAMd,EAAMN,CAAC,EAAIe,EAAOf,EACnCsB,GAAMV,GAAKS,EAAIlB,EAAKH,CAAC,EAAIS,EAAMT,EAC/BuB,GAAOX,GAAKU,GAAIzB,GAAKG,CAAC,EAC5B,GAAI,CAACwB,GAAK,IAAIA,GAAK,IAAID,EAAI,EAAGxB,CAAC,EAAG,MAAM,IAAI,MAAM,yBAAyB,EAC3E,OAAOwB,EACT,CAEA,IAAMC,GAAOC,GAAMxB,GAAgB,EAAG,CAAE,KAAMH,EAAO,CAAE,EAgB1C4B,GAA+BC,GAC1C,CAAE,GAAG1B,GAAiB,GAAIuB,GAAM,KAAM,GAAM,KAAMI,EAAc,EAChEC,EAAM,EC/FF,IAAOC,GAAP,cAAiC,KAAK,CAC1C,YAAaC,EAAU,8CAA6C,CAClE,MAAMA,CAAO,EACb,KAAK,KAAO,mBACd,GRwBI,SAAUC,GAAeC,EAAiBC,EAAiBC,EAAkCC,EAAsB,CACvHA,GAAS,QAAQ,eAAc,EAC/B,IAAMC,EAAO,GAAAC,QAAO,WAAW,QAAQ,EAEvC,GAAIH,aAAe,WACjBE,EAAK,OAAOF,CAAG,MAEf,SAAWI,KAAOJ,EAChBE,EAAK,OAAOE,CAAG,EAInB,IAAMC,EAASH,EAAK,OAAM,EAE1B,GAAI,CACF,OAAOI,GAAK,OAAOP,EAAKM,EAAQP,CAAG,CACrC,OAASS,EAAK,CACZ,MAAM,IAAIC,GAAkB,OAAOD,CAAG,CAAC,CACzC,CACF,CSjDM,IAAOE,GAAP,KAAyB,CACb,KAAO,YACP,IACA,KAEhB,YAAaC,EAAe,CAC1B,KAAK,KAAOC,GAA2BD,CAAG,EAC1C,KAAK,IAAME,GAA2B,KAAK,IAAI,CACjD,CAEA,aAAW,CACT,OAAOC,GAAS,OAAOC,GAAoB,IAAI,CAAC,CAClD,CAEA,OAAK,CACH,OAAOC,GAAI,SAAS,IAAK,KAAK,YAAW,CAAE,CAC7C,CAEA,UAAQ,CACN,OAAOC,EAAU,OAAO,KAAK,YAAW,EAAG,KAAK,EAAE,UAAU,CAAC,CAC/D,CAEA,OAAQN,EAAQ,CACd,OAAIA,GAAO,MAAQ,EAAEA,EAAI,eAAe,YAC/B,GAGFO,GAAiB,KAAK,IAAKP,EAAI,GAAG,CAC3C,CAEA,OAAQQ,EAAmCC,EAAiBC,EAAsB,CAChF,OAAOC,GAAc,KAAK,KAAMF,EAAKD,EAAME,CAAO,CACpD,GC9BI,SAAUE,GAA6BC,EAAiB,CAC5D,OAAO,IAAIC,GAAwBD,CAAK,CAC1C,CAOM,SAAUE,GAA4BC,EAAe,CAEzD,OADcC,GAAK,gBAAgB,QAAQD,CAAG,EAAE,WAAW,EAAI,CAEjE,CAiBM,SAAUE,GAA4BC,EAAe,CACzD,GAAI,CACF,OAAAC,GAAK,gBAAgB,QAAQD,CAAG,EAEzBA,CACT,OAASE,EAAK,CACZ,MAAM,IAAIC,GAAsB,OAAOD,CAAG,CAAC,CAC7C,CACF,CCoFM,SAAUE,GAAwBC,EAA4B,CAClE,GAAM,CAAE,KAAAC,EAAM,KAAAC,CAAI,EAAQC,GAAU,OAAOH,EAAO,MAAM,EAClDI,EAAOF,GAAQ,IAAI,WAEzB,OAAQD,EAAM,CACZ,KAAQI,GAAQ,QACd,OAAOC,GAA0BF,CAAI,EACvC,KAAQC,GAAQ,UACd,OAAOE,GAA4BH,CAAI,EACzC,KAAQC,GAAQ,MACd,OAAOG,GAAwBJ,CAAI,EACrC,QACE,MAAM,IAAIK,EACd,CACF,CAKM,SAAUC,GAAqBC,EAAc,CACjD,OAAUR,GAAU,OAAO,CACzB,KAASE,GAAQM,EAAI,IAAI,EACzB,KAAMA,EAAI,IACX,CACH,CCpIA,IAAMC,GAAU,OAAO,IAAI,4BAA4B,EAGjDC,GAAkB,IAsBlBC,GAAN,KAAgB,CACP,KACU,UACD,UACR,OAER,YAAaC,EAA4B,CACvC,KAAK,KAAOA,EAAK,KACjB,KAAK,UAAYA,EAAK,UAGtB,OAAO,eAAe,KAAM,SAAU,CACpC,WAAY,GACZ,SAAU,GACX,CACH,CAEA,IAAK,OAAO,WAAW,GAAC,CACtB,MAAO,UAAU,KAAK,SAAQ,CAAE,GAClC,CAES,CAACC,EAAY,EAAI,GAE1B,UAAQ,CACN,OAAI,KAAK,QAAU,OACjB,KAAK,OAASC,EAAU,OAAO,KAAK,UAAU,KAAK,EAAE,MAAM,CAAC,GAGvD,KAAK,MACd,CAEA,aAAW,CACT,OAAO,KAAK,SACd,CAIA,OAAK,CACH,OAAOC,GAAI,SAASL,GAAiB,KAAK,SAAS,CACrD,CAEA,QAAM,CACJ,OAAO,KAAK,SAAQ,CACtB,CAKA,OAAQM,EAAiC,CACvC,GAAIA,GAAM,KACR,MAAO,GAGT,GAAIA,aAAc,WAChB,OAAOC,GAAiB,KAAK,UAAU,MAAOD,CAAE,EAC3C,GAAI,OAAOA,GAAO,SACvB,OAAO,KAAK,SAAQ,IAAOA,EACtB,GAAIA,GAAI,YAAW,GAAI,OAAS,KACrC,OAAOC,GAAiB,KAAK,UAAU,MAAOD,EAAG,YAAW,EAAG,KAAK,EAEpE,MAAM,IAAI,MAAM,cAAc,CAElC,CAcA,CAACP,EAAO,GAAC,CACP,MAAO,UAAU,KAAK,SAAQ,CAAE,GAClC,GAGWS,GAAP,cAAyBP,EAAgB,CAC7B,KAAO,MACP,UAEhB,YAAaC,EAAmB,CAC9B,MAAM,CAAE,GAAGA,EAAM,KAAM,KAAK,CAAE,EAE9B,KAAK,UAAYA,EAAK,SACxB,GAGWO,GAAP,cAA6BR,EAAe,CAChC,KAAO,UACP,UAEhB,YAAaC,EAAuB,CAClC,MAAM,CAAE,GAAGA,EAAM,KAAM,SAAS,CAAE,EAElC,KAAK,UAAYA,EAAK,SACxB,GAGWQ,GAAP,cAA+BT,EAAe,CAClC,KAAO,YACP,UAEhB,YAAaC,EAAyB,CACpC,MAAM,CAAE,GAAGA,EAAM,KAAM,WAAW,CAAE,EAEpC,KAAK,UAAYA,EAAK,SACxB,GAIIS,GAAmC,KAE5BC,GAAP,KAAgB,CACX,KAAO,MACP,UACA,UACA,IAET,YAAaC,EAAQ,CACnB,KAAK,IAAMA,EAAI,SAAQ,EACvB,KAAK,UAAYC,GAAS,OAAOC,GAAqB,KAAK,GAAG,CAAC,CACjE,CAEA,CAAChB,EAAO,GAAC,CACP,MAAO,UAAU,KAAK,GAAG,GAC3B,CAES,CAACI,EAAY,EAAI,GAE1B,UAAQ,CACN,OAAO,KAAK,MAAK,EAAG,SAAQ,CAC9B,CAEA,aAAW,CACT,OAAO,KAAK,SACd,CAEA,OAAK,CACH,OAAOE,GAAI,SAASM,GAAkC,KAAK,YAAW,CAAE,CAC1E,CAEA,QAAM,CACJ,OAAO,KAAK,SAAQ,CACtB,CAEA,OAAQK,EAAoC,CAC1C,OAAIA,GAAS,KACJ,IAGLA,aAAiB,aACnBA,EAAQC,EAAmBD,CAAK,GAG3BA,EAAM,SAAQ,IAAO,KAAK,SAAQ,EAC3C,GC5HI,SAAUE,GAAqBC,EAA0B,CAC7D,GAAIC,GAAkBD,CAAS,EAC7B,OAAO,IAAIE,GAAe,CAAE,UAAAF,CAAS,CAAE,EAClC,GAAIG,GAAoBH,CAAS,EACtC,GAAI,CACF,IAAMI,EAAYC,GAAuBL,CAAS,EAElD,GAAII,EAAU,OAAS,UACrB,OAAO,IAAIE,GAAmB,CAAE,UAAAN,EAAW,UAAAI,CAAS,CAAE,EACjD,GAAIA,EAAU,OAAS,YAC5B,OAAO,IAAIG,GAAqB,CAAE,UAAAP,EAAW,UAAAI,CAAS,CAAE,CAE5D,MAAc,CAEZ,IAAMI,EAAMC,EAAmBT,EAAU,MAAM,EAE/C,OAAO,IAAIU,GAAe,IAAI,IAAIF,CAAG,CAAC,CACxC,CAGF,MAAM,IAAIG,GAAsB,sCAAsC,CACxE,CAgBA,SAASC,GAAqBC,EAA0B,CACtD,OAAOA,EAAU,OAASC,GAAS,IACrC,CAEA,SAASC,GAAmBF,EAA0B,CACpD,OAAOA,EAAU,OAASG,GAAO,IACnC,CCrGA,IAAAC,GAAgB,gBC1BV,IAAOC,GAAP,cAAqC,KAAK,CAC9C,OAAO,KAAO,wBACd,KAAO,yBAGIC,GAAP,cAA+B,KAAK,CACxC,OAAO,KAAO,kBACd,KAAO,mBAGIC,GAAP,cAAsC,KAAK,CAC/C,OAAO,KAAO,yBACd,KAAO,0BAGIC,GAAP,cAAoC,KAAK,CAC7C,OAAO,KAAO,uBACd,KAAO,wBCpBT,IAAAC,GAAkD,eCU5C,SAAUC,GAAeC,EAAwB,CACrD,OAAQC,GACCC,EAAmBD,EAAKD,CAAI,CAEvC,CAEM,SAAUG,GAAeH,EAAwB,CACrD,OAAQC,GACCG,GAAqBH,EAAKD,CAAI,CAEzC,CAEM,SAAUK,GAAYJ,EAAe,CAEzC,OADa,IAAI,SAASA,EAAI,MAAM,EACxB,UAAUA,EAAI,UAAU,EAAE,SAAQ,CAChD,CAEM,SAAUK,GAAYC,EAAqB,CAC/C,IAAMN,EAAM,IAAI,YAAY,CAAC,EAE7B,OADa,IAAI,SAASA,CAAG,EACxB,UAAU,EAAG,OAAOM,GAAS,SAAW,SAASA,CAAI,EAAIA,CAAI,EAE3D,IAAI,WAAWN,CAAG,CAC3B,CAEM,SAAUO,GAAaC,EAAW,CACtC,IAAMC,EAAOD,EAAI,MAAM,GAAG,EAE1B,GAAIC,EAAK,SAAW,EAClB,MAAM,IAAI,MAAM,kCAAkCA,EAAK,KAAK,MAAM,CAAC,qCAAqC,EAG1G,GAAIA,EAAK,CAAC,EAAE,SAAW,GACrB,MAAM,IAAI,MAAM,+BAA+BA,EAAK,CAAC,CAAC,2BAA2B,EAInF,IAAMT,EAAMG,GAAqBM,EAAK,CAAC,EAAG,QAAQ,EAG5CH,EAAO,SAASG,EAAK,CAAC,EAAG,EAAE,EAEjC,GAAIH,EAAO,GAAKA,EAAO,MACrB,MAAM,IAAI,MAAM,uCAAuC,EAGzD,IAAMI,EAAUL,GAAWC,CAAI,EAE/B,OAAOK,GAAiB,CAACX,EAAKU,CAAO,EAAGV,EAAI,OAASU,EAAQ,MAAM,CACrE,CAEM,SAAUE,GAAcJ,EAAW,CACvC,IAAMC,EAAOD,EAAI,MAAM,GAAG,EAE1B,GAAIC,EAAK,SAAW,EAClB,MAAM,IAAI,MAAM,kCAAkCA,EAAK,KAAK,MAAM,CAAC,qCAAqC,EAG1G,GAAIA,EAAK,CAAC,EAAE,SAAW,GACrB,MAAM,IAAI,MAAM,+BAA+BA,EAAK,CAAC,CAAC,4BAA4B,EAIpF,IAAMT,EAAMa,GAAO,OAAO,IAAIJ,EAAK,CAAC,CAAC,EAAE,EAGjCH,EAAO,SAASG,EAAK,CAAC,EAAG,EAAE,EAEjC,GAAIH,EAAO,GAAKA,EAAO,MACrB,MAAM,IAAI,MAAM,uCAAuC,EAGzD,IAAMI,EAAUL,GAAWC,CAAI,EAE/B,OAAOK,GAAiB,CAACX,EAAKU,CAAO,EAAGV,EAAI,OAASU,EAAQ,MAAM,CACrE,CAEM,SAAUI,GAAad,EAAe,CAC1C,IAAMe,EAAYf,EAAI,SAAS,EAAGA,EAAI,OAAS,CAAC,EAC1CgB,EAAYhB,EAAI,SAASA,EAAI,OAAS,CAAC,EACvCS,EAAOR,EAAmBc,EAAW,QAAQ,EAC7CT,EAAOF,GAAWY,CAAS,EACjC,MAAO,GAAGP,CAAI,IAAIH,CAAI,EACxB,CAIO,IAAMW,GAAa,SAAUC,EAAU,CAC5CA,EAAKA,EAAG,SAAQ,EAAG,KAAI,EAEvB,IAAMC,EAAQ,IAAI,WAAW,CAAC,EAE9B,OAAAD,EAAG,MAAM,KAAK,EAAE,QAAQ,CAACE,EAAMC,IAAS,CACtC,IAAMC,EAAQ,SAASF,EAAM,EAAE,EAE/B,GAAI,MAAME,CAAK,GAAKA,EAAQ,GAAKA,EAAQ,IACvC,MAAM,IAAIC,GAAsB,kCAAkC,EAGpEJ,EAAME,CAAK,EAAIC,CACjB,CAAC,EAEMH,CACT,EAIaK,GAAa,SAAUN,EAAU,CAC5C,IAAIO,EAAS,EACbP,EAAKA,EAAG,SAAQ,EAAG,KAAI,EAEvB,IAAMQ,EAAWR,EAAG,MAAM,IAAK,CAAC,EAE5BS,EACJ,IAAKA,EAAI,EAAGA,EAAID,EAAS,OAAQC,IAAK,CACpC,IAAMC,KAAO,WAAOF,EAASC,CAAC,CAAC,EAC3BE,EAEAD,IACFC,EAAWZ,GAAWS,EAASC,CAAC,CAAC,EACjCD,EAASC,CAAC,EAAI1B,EAAmB4B,EAAS,SAAS,EAAG,CAAC,EAAG,QAAQ,GAGhEA,GAAY,MAAQ,EAAEF,EAAI,GAC5BD,EAAS,OAAOC,EAAG,EAAG1B,EAAmB4B,EAAS,SAAS,EAAG,CAAC,EAAG,QAAQ,CAAC,CAE/E,CAEA,GAAIH,EAAS,CAAC,IAAM,GAClB,KAAOA,EAAS,OAAS,GAAKA,EAAS,QAAQ,GAAG,UACzCA,EAASA,EAAS,OAAS,CAAC,IAAM,GAC3C,KAAOA,EAAS,OAAS,GAAKA,EAAS,KAAK,GAAG,UACtCA,EAAS,OAAS,EAAG,CAC9B,IAAKC,EAAI,EAAGA,EAAID,EAAS,QAAUA,EAASC,CAAC,IAAM,GAAIA,IAAK,CAC5D,IAAMG,EAAsC,CAACH,EAAG,CAAC,EACjD,IAAKA,EAAI,EAAID,EAAS,OAAQC,EAAI,EAAGA,IACnCG,EAAK,KAAK,GAAG,EAEfJ,EAAS,OAAO,MAAMA,EAAUI,CAAI,CACtC,CAEA,IAAMX,EAAQ,IAAI,WAAWM,EAAS,EAAE,EAExC,IAAKE,EAAI,EAAGA,EAAID,EAAS,OAAQC,IAAK,CAChCD,EAASC,CAAC,IAAM,KAClBD,EAASC,CAAC,EAAI,KAGhB,IAAMI,EAAO,SAASL,EAASC,CAAC,EAAG,EAAE,EAErC,GAAI,MAAMI,CAAI,GAAKA,EAAO,GAAKA,EAAO,MACpC,MAAM,IAAIR,GAAsB,kCAAkC,EAGpEJ,EAAMM,GAAQ,EAAKM,GAAQ,EAAK,IAChCZ,EAAMM,GAAQ,EAAIM,EAAO,GAC3B,CAEA,OAAOZ,CACT,EAGaa,GAAc,SAAUhC,EAAe,CAClD,GAAIA,EAAI,aAAe,EACrB,MAAM,IAAIuB,GAAsB,mCAAmC,EAGrE,IAAMU,EAAS,CAAA,EAEf,QAASN,EAAI,EAAGA,EAAI3B,EAAI,WAAY2B,IAClCM,EAAO,KAAKjC,EAAI2B,CAAC,CAAC,EAGpB,OAAOM,EAAO,KAAK,GAAG,CACxB,EAEaC,GAAc,SAAUlC,EAAe,CAClD,GAAIA,EAAI,aAAe,GACrB,MAAM,IAAIuB,GAAsB,mCAAmC,EAGrE,IAAMU,EAAmB,CAAA,EAEzB,QAASN,EAAI,EAAGA,EAAI3B,EAAI,WAAY2B,GAAK,EAAG,CAC1C,IAAMQ,EAAQnC,EAAI2B,CAAC,EACbS,EAAQpC,EAAI2B,EAAI,CAAC,EAEjBU,EAAQ,GAAGF,EAAM,SAAS,EAAE,EAAE,SAAS,EAAG,GAAG,CAAC,GAAGC,EAAM,SAAS,EAAE,EAAE,SAAS,EAAG,GAAG,CAAC,GAE1FH,EAAO,KAAKI,CAAK,CACnB,CAEA,IAAMnB,EAAKe,EAAO,KAAK,GAAG,EAE1B,GAAI,CACF,IAAMK,EAAM,IAAI,IAAI,WAAWpB,CAAE,GAAG,EAEpC,OAAOoB,EAAI,SAAS,UAAU,EAAGA,EAAI,SAAS,OAAS,CAAC,CAC1D,MAAQ,CACN,MAAM,IAAIf,GAAsB,yBAAyBL,CAAE,GAAG,CAChE,CACF,EAEM,SAAUqB,GAAkB/B,EAAW,CAC3C,GAAI,CACF,IAAM8B,EAAM,IAAI,IAAI,WAAW9B,CAAG,GAAG,EAErC,OAAO8B,EAAI,SAAS,UAAU,EAAGA,EAAI,SAAS,OAAS,CAAC,CAC1D,MAAQ,CACN,MAAM,IAAIf,GAAsB,yBAAyBf,CAAG,GAAG,CACjE,CACF,CAEA,IAAMgC,GAAW,OAAO,OAAOC,EAAK,EAAE,IAAKC,GAAMA,EAAE,OAAO,EACpDC,IAAkB,UAAA,CACtB,IAAIC,EAAMJ,GAAS,CAAC,EAAE,GAAGA,GAAS,CAAC,CAAC,EACpC,OAAAA,GAAS,MAAM,CAAC,EAAE,QAASK,GAAOD,EAAMA,EAAI,GAAGC,CAAC,CAAE,EAC3CD,CACT,GAAE,EAEI,SAAUE,GAAUC,EAAa,CACrC,OAAOJ,GAAe,OAAOI,CAAK,CACpC,CAEM,SAAUC,GAAUjD,EAAyB,CACjD,OAAQC,GACCD,EAAK,QAAQ,OAAOC,CAAG,CAElC,CC5OM,SAAUiD,GAASC,EAAa,CAGpC,GAFY,SAASA,CAAK,EAElB,SAAQ,IAAOA,EACrB,MAAM,IAAIC,GAAgB,0BAA0B,CAExD,CAEM,SAAUC,GAAUF,EAAU,CAClC,GAAIA,EAAQ,EACV,MAAM,IAAIC,GAAgB,2CAA2C,CAEzE,CAEM,SAAUE,GAAUC,EAAW,CACnC,OAAQJ,GAAS,CACf,GAAIA,EAAQI,EACV,MAAM,IAAIH,GAAgB,0CAA0CG,CAAG,EAAE,CAE7E,CACF,CAEM,SAAUC,MAAaC,EAAqC,CAChE,OAAQN,GAAS,CACf,QAAWO,KAAMD,EACfC,EAAGP,CAAK,CAEZ,CACF,CAEO,IAAMQ,GAAeH,GAC1BN,GACAG,GACAC,GAAS,KAAM,CAAC,EC1BX,IAAMM,GAAI,GAoEXC,GAAN,KAAc,CACJ,gBAAkB,IAAI,IACtB,gBAAkB,IAAI,IAE9B,YAAaC,EAAoB,CAC/B,IAAIC,EAQJ,GANI,OAAOD,GAAQ,SACjBC,EAAQ,KAAK,gBAAgB,IAAID,CAAG,EAEpCC,EAAQ,KAAK,gBAAgB,IAAID,CAAG,EAGlCC,GAAS,KACX,MAAM,IAAIC,GAAqB,YAAYF,CAAG,cAAc,EAG9D,OAAOC,CACT,CAEA,YAAaA,EAAoB,CAC/B,KAAK,gBAAgB,IAAIA,EAAM,KAAMA,CAAK,EAC1C,KAAK,gBAAgB,IAAIA,EAAM,KAAMA,CAAK,EAE1CA,EAAM,SAAS,QAAQE,GAAQ,CAC7B,KAAK,gBAAgB,IAAIA,EAAOF,CAAK,CACvC,CAAC,CACH,CAEA,eAAgBG,EAAY,CAC1B,IAAMH,EAAQ,KAAK,gBAAgB,IAAIG,CAAI,EAEvCH,GAAS,OAIb,KAAK,gBAAgB,OAAOA,EAAM,IAAI,EACtC,KAAK,gBAAgB,OAAOA,EAAM,IAAI,EAEtCA,EAAM,SAAS,QAAQE,GAAQ,CAC7B,KAAK,gBAAgB,OAAOA,CAAK,CACnC,CAAC,EACH,GAGWE,GAAW,IAAIN,GAEtBO,GAA0B,CAAC,CAC/B,KAAM,EACN,KAAM,MACN,KAAM,GACN,aAAcC,GACd,aAAcC,GACd,SAAWC,GAAS,CAClB,GAAI,IAAC,WAAOA,CAAK,EACf,MAAM,IAAIC,GAAgB,yBAAyBD,CAAK,GAAG,CAE/D,GACC,CACD,KAAM,EACN,KAAM,MACN,KAAM,GACN,aAAcE,GACd,aAAcC,GACd,SAAUC,IACT,CACD,KAAM,IACN,KAAM,MACN,KAAM,GACN,aAAcF,GACd,aAAcC,GACd,SAAUC,IACT,CACD,KAAM,GACN,KAAM,OACN,KAAM,GACN,aAAcF,GACd,aAAcC,GACd,SAAUC,IACT,CACD,KAAM,GACN,KAAM,MACN,KAAM,IACN,aAAcC,GACd,aAAcC,GACd,cAAeC,GACf,SAAWP,GAAS,CAClB,GAAI,IAAC,WAAOA,CAAK,EACf,MAAM,IAAIC,GAAgB,yBAAyBD,CAAK,GAAG,CAE/D,GACC,CACD,KAAM,GACN,KAAM,UACN,KAAMX,IACL,CACD,KAAM,GACN,KAAM,SACN,KAAM,EACN,aAAcmB,GAAc,QAAQ,EACpC,aAAcC,GAAc,QAAQ,GACnC,CACD,KAAM,GACN,KAAM,MACN,KAAMpB,GACN,WAAY,IACX,CACD,KAAM,GACN,KAAM,OACN,KAAMA,GACN,WAAY,IACX,CACD,KAAM,GACN,KAAM,OACN,KAAMA,GACN,WAAY,IACX,CACD,KAAM,GACN,KAAM,UACN,KAAMA,GACN,WAAY,IACX,CACD,KAAM,IACN,KAAM,OACN,KAAM,GACN,aAAca,GACd,aAAcC,GACd,SAAUC,IACT,CACD,KAAM,IACN,KAAM,OACL,CACD,KAAM,IACN,KAAM,OACL,CACD,KAAM,IACN,KAAM,OACN,KAAMf,GACN,KAAM,GACN,cAAgBqB,GAAQ,mBAAmBA,CAAG,EAC9C,cAAgBC,GAAQ,mBAAmBA,CAAG,GAC7C,CACD,KAAM,IACN,KAAM,MACN,QAAS,CAAC,MAAM,EAChB,KAAMtB,GACN,aAAcmB,GAAc,WAAW,EACvC,aAAeG,GACTA,EAAI,WAAW,GAAG,GAAKA,EAAI,WAAW,GAAG,EACpCF,GAAc,WAAW,EAAEE,CAAG,EAGhCC,GAAI,MAAMD,CAAG,EAAE,UAAU,OAEjC,CACD,KAAM,IACN,KAAM,QACN,KAAM,GACN,aAAcE,GACd,aAAcC,IACb,CACD,KAAM,IACN,KAAM,SACN,KAAM,IACN,aAAcD,GACd,aAAcE,IACb,CACD,KAAM,IACN,KAAM,WACN,KAAM1B,IACL,CACD,KAAM,IACN,KAAM,WACN,KAAMA,IACL,CACD,KAAM,IACN,KAAM,OACL,CACD,KAAM,IACN,KAAM,MACN,KAAMA,IACL,CACD,KAAM,IACN,KAAM,SACL,CACD,KAAM,IACN,KAAM,QACL,CACD,KAAM,IACN,KAAM,WACL,CACD,KAAM,IACN,KAAM,gBACL,CACD,KAAM,IACN,KAAM,WACN,KAAMA,GACN,aAAc2B,GAASC,EAAS,EAChC,aAAcC,IACb,CACD,KAAM,IACN,KAAM,QACL,CACD,KAAM,IACN,KAAM,YACN,KAAM7B,GACN,cAAgBqB,GAAQ,IAAI,mBAAmBA,CAAG,CAAC,GACnD,cAAgBC,GAAQ,mBAAmBA,EAAI,UAAU,CAAC,CAAC,GAC1D,CACD,KAAM,IACN,KAAM,SACL,CACD,KAAM,IACN,KAAM,MACL,CACD,KAAM,IACN,KAAM,OACL,CACD,KAAM,IACN,KAAM,sBACL,CACD,KAAM,IACN,KAAM,gBACL,CACD,KAAM,IACN,KAAM,mBACL,CACD,KAAM,IACN,KAAM,qBACL,CACD,KAAM,IACN,KAAM,iBACL,CACD,KAAM,IACN,KAAM,UACL,CACD,KAAM,IACN,KAAM,eACL,CACD,KAAM,IACN,KAAM,SACN,KAAMtB,GACP,EAEDQ,GAAO,QAAQL,GAAQ,CACrBI,GAAS,YAAYJ,CAAK,CAC5B,CAAC,EC1TK,SAAU2B,GAAmBC,EAAiB,CAClD,IAAMC,EAA0B,CAAA,EAE5BC,EAAI,EACR,KAAOA,EAAIF,EAAM,QAAQ,CACvB,IAAMG,EAAcC,GAAOJ,EAAOE,CAAC,EAC7BG,EAAQC,GAAS,YAAYH,CAAI,EACjCI,EAAoBC,GAAeL,CAAI,EACvCM,EAAOC,GAAYL,EAAOL,EAAOE,EAAIK,CAAU,EACjDI,EAAa,EAEbF,EAAO,GAAKJ,EAAM,OAASO,KAC7BD,EAAoBH,GAAeC,CAAI,GAGzC,IAAMI,EAAkBN,EAAaI,EAAaF,EAE5CK,EAAuB,CAC3B,KAAAX,EACA,KAAME,EAAM,KACZ,MAAOL,EAAM,SAASE,EAAGA,EAAIW,CAAe,GAG9C,GAAIJ,EAAO,EAAG,CACZ,IAAMM,EAAcb,EAAIK,EAAaI,EAC/BK,EAAahB,EAAM,SAASe,EAAaA,EAAcN,CAAI,EAEjEK,EAAU,MAAQT,EAAM,eAAeW,CAAU,GAAKC,EAAmBD,CAAU,CACrF,CAEAf,EAAW,KAAKa,CAAS,EAEzBZ,GAAKW,CACP,CAEA,OAAOZ,CACT,CAEM,SAAUiB,GAAmBjB,EAAuB,CACxD,IAAIkB,EAAS,EACPnB,EAAsB,CAAA,EAE5B,QAAWc,KAAab,EAAY,CAClC,GAAIa,EAAU,OAAS,KAAM,CAC3B,IAAMT,EAAQC,GAAS,YAAYQ,EAAU,IAAI,EAC3CM,EAAqBZ,GAAeM,EAAU,IAAI,EACpDE,EACAK,EAAc,EACdC,EAAoB,EAEpBR,EAAU,OAAS,OACrBE,EAAaX,EAAM,eAAeS,EAAU,KAAK,GAAKS,GAAqBT,EAAU,KAAK,EAC1FO,EAAcL,EAAW,WAErBX,EAAM,OAASO,KACjBU,EAA2Bd,GAAea,CAAW,IAIzD,IAAMrB,EAAQ,IAAI,WAAWoB,EAAcE,EAAoBD,CAAW,EAGtEG,EAAS,EACNC,GAAiBX,EAAU,KAAMd,EAAOwB,CAAM,EACrDA,GAAUJ,EAGNJ,GAAc,OAEZX,EAAM,OAASO,KACVa,GAAiBJ,EAAarB,EAAOwB,CAAM,EAClDA,GAAUF,GAIZtB,EAAM,IAAIgB,EAAYQ,CAAM,GAG9BV,EAAU,MAAQd,CACpB,CAEAA,EAAM,KAAKc,EAAU,KAAK,EAC1BK,GAAUL,EAAU,MAAM,UAC5B,CAEA,OAAOY,GAAiB1B,EAAOmB,CAAM,CACvC,CAEM,SAAUQ,GAAoBC,EAAc,CAChD,GAAIA,EAAO,OAAO,CAAC,IAAM,IACvB,MAAM,IAAIC,GAAsB,sCAAsC,EAGxE,IAAM5B,EAA0B,CAAA,EAC5B6B,EAAmC,WACnCC,EAAQ,GACRC,EAAW,GAEf,QAAS,EAAI,EAAG,EAAIJ,EAAO,OAAQ,IAAK,CACtC,IAAMK,EAAOL,EAAO,OAAO,CAAC,EAExBK,IAAS,MACPH,IAAe,WACjBE,GAAYJ,EAAO,OAAO,CAAC,EAE3BG,GAASH,EAAO,OAAO,CAAC,GAI5B,IAAMM,EAAQ,IAAMN,EAAO,OAAS,EAEpC,GAAIK,IAAS,KAAOC,EAAO,CACzB,IAAM7B,EAAQC,GAAS,YAAY0B,CAAQ,EAE3C,GAAIF,IAAe,WAAY,CAC7B,GAAIzB,EAAM,MAAQ,MAAQA,EAAM,OAAS,EAAG,CAE1CJ,EAAW,KAAK,CACd,KAAMI,EAAM,KACZ,KAAMA,EAAM,KACb,EAED0B,EAAQ,GACRC,EAAW,GACXF,EAAa,WAEb,QACF,SAAWI,EACT,MAAM,IAAIL,GAAsB,aAAaG,CAAQ,oBAAoB,EAI3EF,EAAa,OACf,SAAWA,IAAe,QAAS,CACjC,IAAMhB,EAAuB,CAC3B,KAAMT,EAAM,KACZ,KAAMA,EAAM,MAGd,GAAIA,EAAM,MAAQ,MAAQA,EAAM,OAAS,EAAG,CAC1C,GAAI0B,IAAU,GACZ,MAAM,IAAIF,GAAsB,aAAaG,CAAQ,oBAAoB,EAG3ElB,EAAU,MAAQT,EAAM,gBAAgB0B,CAAK,GAAKA,CACpD,CAEA9B,EAAW,KAAKa,CAAS,EAEzBiB,EAAQ,GACRC,EAAW,GACXF,EAAa,UACf,CACF,CACF,CAEA,GAAIE,IAAa,IAAMD,IAAU,GAC/B,MAAM,IAAIF,GAAsB,sBAAsB,EAGxD,OAAO5B,CACT,CAEM,SAAUkC,GAAoBlC,EAAuB,CACzD,MAAO,IAAIA,EAAW,QAAQa,GAAY,CACtC,GAAIA,EAAU,OAAS,KACrB,OAAOA,EAAU,KAGnB,IAAMT,EAAQC,GAAS,YAAYQ,EAAU,IAAI,EAEjD,GAAIT,GAAS,KACX,MAAM,IAAIwB,GAAsB,yBAAyBf,EAAU,IAAI,EAAE,EAG3E,MAAO,CACLA,EAAU,KACVT,EAAM,gBAAgBS,EAAU,KAAK,GAAKA,EAAU,MAExD,CAAC,EAAE,KAAK,GAAG,CAAC,EAChB,CAKA,SAASJ,GAAaL,EAAsBL,EAAmBwB,EAAc,CAC3E,OAAInB,EAAM,MAAQ,MAAQA,EAAM,OAAS,EAChC,EAGLA,EAAM,KAAO,EACRA,EAAM,KAAO,EAGRD,GAAOJ,EAAOwB,CAAM,CACpC,CChMA,IAAMY,GAAU,OAAO,IAAI,4BAA4B,EAC1CC,GAAS,OAAO,IAAI,yBAAyB,EAEpDC,GAAY,CAChB,GACA,GACA,GACA,IAGIC,GAAN,cAAuC,KAAK,CAC1C,YAAaC,EAAU,wBAAuB,CAC5C,MAAMA,CAAO,EACb,KAAK,KAAO,0BACd,GAGF,SAASC,GAAcC,EAAoB,CAKzC,GAJIA,GAAQ,OACVA,EAAO,KAGLC,GAAYD,CAAI,EAClB,OAAOA,EAAK,cAAa,EAG3B,GAAIA,aAAgB,WAClB,OAAOE,GAAkBF,CAAI,EAG/B,GAAI,OAAOA,GAAS,SAClB,OAAAA,EAAOA,EACJ,QAAQ,UAAW,GAAG,EACtB,QAAQ,SAAU,EAAE,EAEnBA,IAAS,KACXA,EAAO,KAGFG,GAAmBH,CAAI,EAGhC,GAAI,MAAM,QAAQA,CAAI,EACpB,OAAOA,EAGT,MAAM,IAAII,GAAsB,iEAAiE,CACnG,CASM,IAAOC,GAAP,MAAOC,CAAS,CACpB,CAACX,EAAM,EAAa,GACXY,GAGTC,GAEAC,GAEA,YAAaT,EAAqC,IAAKU,EAA4B,CAAA,EAAE,CACnF,KAAKH,GAAcR,GAAaC,CAAI,EAEhCU,EAAQ,WAAa,IACvBC,GAAS,IAAI,CAEjB,CAEA,IAAI,OAAK,CACP,OAAI,KAAKF,IAAU,OACjB,KAAKA,GAASG,GAAkB,KAAKL,EAAW,GAG3C,KAAKE,EACd,CAEA,UAAQ,CACN,OAAI,KAAKD,IAAW,OAClB,KAAKA,GAAUK,GAAmB,KAAKN,EAAW,GAG7C,KAAKC,EACd,CAEA,QAAM,CACJ,OAAO,KAAK,SAAQ,CACtB,CAEA,WAAS,CACP,IAAIM,EACAC,EACAC,EACAC,EACAC,EAAO,GAEX,OAAW,CAAE,KAAAC,EAAM,KAAAC,EAAM,MAAAC,CAAK,IAAM,KAAKd,GACnCY,IAAS,KACXD,EAAO,IAAIG,GAAS,EAAE,IAIpBzB,GAAU,SAASuB,CAAI,IACzBJ,EAAY,MACZE,EAAO,IACPD,EAAO,GAAGK,GAAS,EAAE,GAAGH,CAAI,GAC5BJ,EAASK,IAAS,GAAY,EAAI,IAGhCA,IAAS,GAAYA,IAAS,OAChCJ,EAAYK,IAAS,MAAQ,MAAQ,MACrCH,EAAO,SAASI,GAAS,EAAE,IAGzBF,IAAS,GAAYA,IAAS,MAChCJ,EAAY,MACZC,EAAO,GAAGK,GAAS,EAAE,GAAGH,CAAI,GAC5BJ,EAASK,IAAS,GAAW,EAAI,GAIrC,GAAIL,GAAU,MAAQC,GAAa,MAAQC,GAAQ,MAAQC,GAAQ,KACjE,MAAM,IAAI,MAAM,qGAAqG,EAUvH,MAP8B,CAC5B,OAAAH,EACA,KAAAE,EACA,UAAAD,EACA,KAAAE,EAIJ,CAEA,eAAa,CACX,MAAO,CACL,GAAG,KAAKV,GAEZ,CAEA,QAAM,CACJ,OAAO,KAAKA,GAAY,IAAI,CAAC,CAAE,KAAAY,EAAM,MAAAE,CAAK,IAAM,CAC9C,IAAMC,EAAQC,GAAS,YAAYJ,CAAI,EAEvC,MAAO,CACL,KAAAA,EACA,KAAMG,EAAM,MAAQ,EACpB,KAAMA,EAAM,KACZ,WAAY,EAAQA,EAAM,WAC1B,KAAM,EAAQA,EAAM,KAExB,CAAC,CACH,CAEA,YAAU,CACR,OAAO,KAAKf,GAAY,IAAI,CAAC,CAAE,KAAAY,CAAI,IAAOA,CAAI,CAChD,CAEA,YAAU,CACR,OAAO,KAAKZ,GAAY,IAAI,CAAC,CAAE,KAAAa,CAAI,IAAOA,CAAI,CAChD,CAEA,QAAM,CACJ,OAAO,KAAKb,GAAY,IAAI,CAAC,CAAE,KAAAY,EAAM,MAAAE,CAAK,IAAM,CAC9C,GAAIA,GAAS,KACX,MAAO,CAACF,CAAI,EAGd,IAAMG,EAAQC,GAAS,YAAYJ,CAAI,EACjCK,EAAgB,CAACL,CAAI,EAE3B,OAAIE,GAAS,MACXG,EAAO,KAAKF,EAAM,eAAeD,CAAK,GAAKI,GAAqBJ,CAAK,CAAC,EAGjEG,CACT,CAAC,CACH,CAEA,cAAY,CACV,OAAO,KAAKjB,GAAY,IAAI,CAAC,CAAE,KAAAY,EAAM,MAAAE,CAAK,IACpCA,GAAS,KACJ,CAACF,CAAI,EAGP,CAACA,EAAME,CAAK,CACpB,CACH,CAEA,YAAarB,EAAoB,CAC/B,IAAM0B,EAAK,IAAIpB,EAAUN,CAAI,EAE7B,OAAO,IAAIM,EAAU,CACnB,GAAG,KAAKC,GACR,GAAGmB,EAAG,cAAa,GAClB,CACD,SAAU,GACX,CACH,CAEA,YAAa1B,EAAwB,CACnC,IAAM2B,EAAa3B,EAAK,SAAQ,EAC1B4B,EAAI,KAAK,SAAQ,EACjBC,EAAID,EAAE,YAAYD,CAAU,EAElC,GAAIE,EAAI,EACN,MAAM,IAAIC,GAAuB,WAAW,KAAK,SAAQ,CAAE,iCAAiC9B,EAAK,SAAQ,CAAE,EAAE,EAG/G,OAAO,IAAIM,EAAUsB,EAAE,MAAM,EAAGC,CAAC,EAAG,CAClC,SAAU,GACX,CACH,CAEA,gBAAiBV,EAAY,CAC3B,IAAIY,EAEJ,QAASF,EAAI,KAAKtB,GAAY,OAAS,EAAGsB,EAAI,GAAIA,IAChD,GAAI,KAAKtB,GAAYsB,CAAC,EAAE,OAASV,EAAM,CACrCY,EAAQF,EACR,KACF,CAGF,OAAO,IAAIvB,EAAU,KAAKC,GAAY,MAAM,EAAGwB,CAAK,EAAG,CACrD,SAAU,GACX,CACH,CAEA,WAAS,CACP,GAAI,CACF,IAAIC,EAA8C,CAAA,EAElD,KAAKzB,GAAY,QAAQ,CAAC,CAAE,KAAAY,EAAM,MAAAE,CAAK,IAAM,CACvCF,IAAS,KACXa,EAAO,KAAK,CAACb,EAAME,CAAK,CAAC,EAKvBF,IAAS,MACXa,EAAS,CAAA,EAEb,CAAC,EAGD,IAAMC,EAAQD,EAAO,IAAG,EACxB,GAAIC,IAAQ,CAAC,GAAK,KAAM,CACtB,IAAMC,EAAYD,EAAM,CAAC,EAIzB,OAAIC,EAAU,CAAC,IAAM,KAAOA,EAAU,CAAC,IAAM,IACpCC,EAAmBC,EAAU,OAAO,IAAIF,CAAS,EAAE,EAAG,WAAW,EAInEC,EAAmBE,GAAI,MAAMH,CAAS,EAAE,UAAU,MAAO,WAAW,CAC7E,CAEA,OAAO,IACT,MAAY,CACV,OAAO,IACT,CACF,CAEA,SAAO,CACL,QAAWI,KAAa,KAAK/B,GAG3B,GAFcgB,GAAS,YAAYe,EAAU,IAAI,EAEtC,KAIX,OAAOA,EAAU,OAAS,KAG5B,OAAO,IACT,CAEA,OAAQtC,EAA2B,CACjC,OAAOuC,GAAiB,KAAK,MAAOvC,EAAK,KAAK,CAChD,CAEA,MAAM,QAASU,EAAwB,CACrC,IAAM8B,EAAkB,KAAK,OAAM,EAAG,KAAMC,GAAMA,EAAE,UAAU,EAG9D,GAAID,GAAmB,KACrB,MAAO,CAAC,IAAI,EAGd,IAAME,EAAWC,GAAU,IAAIH,EAAgB,IAAI,EACnD,GAAIE,GAAY,KACd,MAAM,IAAI7C,GAAyB,6BAA6B2C,EAAgB,IAAI,EAAE,EAKxF,OAFe,MAAME,EAAS,KAAMhC,CAAO,GAE7B,IAAIkC,GAAOC,GAAUD,CAAG,CAAC,CACzC,CAEA,aAAW,CACT,IAAMlC,EAAU,KAAK,UAAS,EAE9B,GAAIA,EAAQ,YAAc,OAASA,EAAQ,YAAc,MACvD,MAAM,IAAI,MAAM,gEAAgEA,EAAQ,SAAS,uDAAuD,EAG1J,MAAO,CACL,OAAQA,EAAQ,OAChB,QAASA,EAAQ,KACjB,KAAMA,EAAQ,KAElB,CAEA,oBAAkB,CAShB,MARI,OAAKH,GAAY,SAAW,GAI5B,KAAKA,GAAY,CAAC,EAAE,OAAS,GAAY,KAAKA,GAAY,CAAC,EAAE,OAAS,IAItE,KAAKA,GAAY,CAAC,EAAE,OAAS,GAAY,KAAKA,GAAY,CAAC,EAAE,OAAS,IAK5E,CAcA,CAACb,EAAO,GAAC,CACP,MAAO,aAAa,KAAK,SAAQ,CAAE,GACrC,GAOI,SAAUiB,GAAUX,EAAe,CACvCA,EAAK,cAAa,EACf,QAAQsC,GAAY,CACnB,IAAMhB,EAAQC,GAAS,YAAYe,EAAU,IAAI,EAE7CA,EAAU,OAAS,MAIvBhB,EAAM,WAAWgB,EAAU,KAAK,CAClC,CAAC,CACL,CCtXM,IAAOQ,GAAP,KAAa,CACT,MAAQ,EACR,MAAQ,GAEhB,IAAIC,EAAa,CACf,YAAK,MAAQ,EACb,KAAK,MAAQA,EACN,IACT,CAGA,eAA6BC,EAAK,CAChC,IAAMC,EAAQ,KAAK,MACbC,EAASF,EAAE,EACjB,OAAIE,IAAW,SACb,KAAK,MAAQD,GAERC,CACT,CAGA,UAAwBF,EAAK,CAC3B,IAAME,EAASF,EAAE,EACjB,GAAI,KAAK,QAAU,KAAK,MAAM,OAG9B,OAAOE,CACT,CAGA,UAAQ,CACN,GAAI,OAAK,OAAS,KAAK,MAAM,QAG7B,OAAO,KAAK,MAAM,KAAK,KAAK,CAC9B,CAGA,UAAQ,CACN,GAAI,OAAK,OAAS,KAAK,MAAM,QAG7B,OAAO,KAAK,MAAM,KAAK,OAAO,CAChC,CAGA,cAAcC,EAAc,CAC1B,OAAO,KAAK,eAAe,IAAK,CAC9B,IAAMC,EAAO,KAAK,SAAQ,EAC1B,GAAIA,IAASD,EAGb,OAAOC,CACT,CAAC,CACH,CAQA,cAA4BC,EAAaJ,EAAeK,EAAQ,CAC9D,OAAO,KAAK,eAAe,IAAK,CAC9B,GAAI,EAAAL,EAAQ,GACN,KAAK,cAAcI,CAAG,IAAM,QAIlC,OAAOC,EAAK,CACd,CAAC,CACH,CAOA,WACEC,EACAC,EACAC,EACAC,EAAgB,CAEhB,OAAO,KAAK,eAAe,IAAK,CAC9B,IAAIR,EAAS,EACTS,EAAa,EAEXC,EAAc,KAAK,SAAQ,EACjC,GAAIA,IAAgB,OAClB,OAEF,IAAMC,EAAiBD,IAAgB,IACjCE,EAAW,IAAM,EAAIJ,GAAY,EAGvC,OAAa,CACX,IAAMK,EAAQ,KAAK,eAAe,IAAK,CACrC,IAAMX,EAAO,KAAK,SAAQ,EAC1B,GAAIA,IAAS,OACX,OAEF,IAAMY,EAAM,OAAO,SAASZ,EAAMG,CAAK,EACvC,GAAI,QAAO,MAAMS,CAAG,EAGpB,OAAOA,CACT,CAAC,EACD,GAAID,IAAU,OACZ,MAQF,GANAb,GAAUK,EACVL,GAAUa,EACNb,EAASY,IAGbH,GAAc,EACVH,IAAc,QACZG,EAAaH,GACf,OAKN,GAAIG,IAAe,EAEZ,MAAI,CAACF,GAAmBI,GAAkBF,EAAa,EAC5D,OAEOT,CAEX,CAAC,CACH,CAGA,cAAY,CACV,OAAO,KAAK,eAAe,IAAK,CAC9B,IAAMe,EAAM,IAAI,WAAW,CAAC,EAE5B,QAASC,EAAI,EAAGA,EAAID,EAAI,OAAQC,IAAK,CACnC,IAAMC,EAAK,KAAK,cAAc,IAAKD,EAAG,IAAM,KAAK,WAAW,GAAI,EAAG,GAAO,CAAC,CAAC,EAC5E,GAAIC,IAAO,OACT,OAEFF,EAAIC,CAAC,EAAIC,EAGX,OAAOF,CACT,CAAC,CACH,CAGA,cAAY,CAQV,IAAMG,EAAcC,GAAyC,CAC3D,QAASH,EAAI,EAAGA,EAAIG,EAAO,OAAS,EAAGH,IAAK,CAC1C,IAAMC,EAAKD,EAAI,EAEf,GAAIA,EAAIG,EAAO,OAAS,EAAG,CACzB,IAAMC,EAAO,KAAK,cAAc,IAAKJ,EAAG,IAAM,KAAK,aAAY,CAAE,EACjE,GAAII,IAAS,OACX,OAAAD,EAAOF,CAAE,EAAIG,EAAK,CAAC,EACnBD,EAAOF,EAAK,CAAC,EAAIG,EAAK,CAAC,EACvBD,EAAOF,EAAK,CAAC,EAAIG,EAAK,CAAC,EACvBD,EAAOF,EAAK,CAAC,EAAIG,EAAK,CAAC,EAEhB,CAACH,EAAK,EAAG,EAAI,EAIxB,IAAMI,EAAQ,KAAK,cAAc,IAAKL,EAAG,IAAM,KAAK,WAAW,GAAI,EAAG,GAAM,CAAC,CAAC,EAC9E,GAAIK,IAAU,OACZ,MAAO,CAACJ,EAAI,EAAK,EAEnBE,EAAOF,CAAE,EAAII,GAAS,EACtBF,EAAOF,EAAK,CAAC,EAAII,EAAQ,IAE3B,MAAO,CAACF,EAAO,OAAQ,EAAK,CAC9B,EAEA,OAAO,KAAK,eAAe,IAAK,CAE9B,IAAMG,EAAO,IAAI,WAAW,EAAE,EACxB,CAACC,EAAUC,CAAO,EAAIN,EAAWI,CAAI,EAE3C,GAAIC,IAAa,GACf,OAAOD,EAaT,GATIE,GAMA,KAAK,cAAc,GAAG,IAAM,QAG5B,KAAK,cAAc,GAAG,IAAM,OAC9B,OAKF,IAAMC,EAAO,IAAI,WAAW,EAAE,EACxBC,EAAQ,IAAMH,EAAW,GACzB,CAACI,CAAQ,EAAIT,EAAWO,EAAK,SAAS,EAAGC,CAAK,CAAC,EAGrD,OAAAJ,EAAK,IAAIG,EAAK,SAAS,EAAGE,CAAQ,EAAG,GAAKA,CAAQ,EAE3CL,CACT,CAAC,CACH,CAGA,YAAU,CACR,OAAO,KAAK,aAAY,GAAM,KAAK,aAAY,CACjD,GClOF,IAAMM,GAAS,IAAIC,GCAZ,IAAMC,GAAe,SAAS,SAAU,EAAE,EACpCC,GAAa,IAAI,WAAW,CACvC,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,IAAK,IACpC,ECmNM,IAAMC,GAAY,IAAI,IAqiBvB,SAAUC,GAAaC,EAAU,CACrC,MAAO,EAAQA,IAAQC,EAAM,CAC/B,CAeM,SAAUC,GAAWC,EAAqB,CAC9C,OAAO,IAAIC,GAAeD,CAAI,CAChC,CC9wBO,IAAME,EAAQA,IACZ,CACL,MAAQC,GAAQ,CACd,IAAMC,EAAYD,EAAK,CAAC,EAUxB,OARIC,GAAa,MAIbA,EAAU,OAASF,GAInBE,EAAU,OAAS,KACd,GAGFD,EAAK,MAAM,CAAC,CACrB,IAQSE,EAAQ,CAACH,EAAcG,KAC3B,CACL,MAAQF,GAAQ,CACd,IAAMC,EAAYD,EAAK,CAAC,EAUxB,OARIC,GAAW,OAASF,GAIpBE,EAAU,OAAS,MAInBC,GAAS,MAAQD,EAAU,QAAUC,EAChC,GAGFF,EAAK,MAAM,CAAC,CACrB,IAOSG,EAAYC,IAChB,CACL,MAAQJ,GAAQ,CACd,IAAMK,EAASD,EAAQ,MAAMJ,CAAI,EAEjC,OAAIK,IAAW,GACNL,EAGFK,CACT,IAOSC,GAAK,IAAIC,KACb,CACL,MAAQP,GAAQ,CACd,IAAIQ,EAEJ,QAAWJ,KAAWG,EAAU,CAC9B,IAAMF,EAASD,EAAQ,MAAMJ,CAAI,EAG7BK,IAAW,KAKXG,GAAW,MAAQH,EAAO,OAASG,EAAQ,UAC7CA,EAAUH,EAEd,CAEA,OAAIG,GACK,EAIX,IAOSC,EAAM,IAAIF,KACd,CACL,MAAQP,GAAQ,CACd,QAAWI,KAAWG,EAAU,CAE9B,IAAMF,EAASD,EAAQ,MAAMJ,CAAI,EAGjC,GAAIK,IAAW,GACb,MAAO,GAGTL,EAAOK,CACT,CAEA,OAAOL,CACT,IAOE,SAAUU,KAAQH,EAAmB,CACzC,SAASI,EAAOC,EAAc,CAC5B,GAAIA,GAAM,KACR,MAAO,GAGT,IAAIC,EAAQD,EAAG,cAAa,EAE5B,QAAWR,KAAWG,EAAU,CAC9B,IAAMF,EAASD,EAAQ,MAAMS,CAAK,EAElC,GAAIR,IAAW,GACb,MAAO,GAGTQ,EAAQR,CACV,CAEA,OAAOQ,CACT,CAEA,SAASL,EAASI,EAAc,CAG9B,OAFeD,EAAMC,CAAE,IAEL,EACpB,CAEA,SAASE,EAAYF,EAAc,CACjC,IAAMP,EAASM,EAAMC,CAAE,EAEvB,OAAIP,IAAW,GACN,GAGFA,EAAO,SAAW,CAC3B,CAEA,MAAO,CACL,SAAAE,EACA,QAAAC,EACA,WAAAM,EAEJ,CCvFA,IAAMC,GAAWC,EAAM,GAAQ,EAElBC,GAAUC,EAAIH,EAAQ,EAK7BI,GAAQH,EAAM,EAAS,EACvBI,GAAQJ,EAAM,EAAS,EACvBK,GAAWL,EAAM,EAAY,EAC7BM,GAAON,EAAM,EAAQ,EAgBdO,GAAOL,EAAIC,GAAOK,EAASR,EAAM,GAAQ,CAAC,CAAC,EAgB3CS,GAAOP,EAAIE,GAAOI,EAASR,EAAM,GAAQ,CAAC,CAAC,EAiB3CU,GAAUR,EAAIG,GAAUG,EAASR,EAAM,GAAQ,CAAC,CAAC,EAiBjDW,GAAMT,EAAIU,GAAGN,GAAMD,GAAUF,GAAOC,EAAK,EAAGI,EAASR,EAAM,GAAQ,CAAC,CAAC,EAE5Ea,GAAOC,EACXd,EAAM,CAAQ,EACdQ,EAASR,EAAM,EAAW,CAAC,CAAC,EAExBe,GAAOD,EACXN,EAASR,EAAM,EAAY,CAAC,EAC5BA,EAAM,EAAQ,EACdQ,EAASR,EAAM,EAAW,CAAC,CAAC,EAExBgB,GAAMJ,GAAGC,GAAME,EAAI,EAEnBE,GAAgBL,GAAGI,GAAKV,GAAMH,GAAOC,GAAOC,EAAQ,EAiB7Ca,GAAehB,EAAIU,GAAGI,GAAKF,EAAIF,GAAGN,GAAMD,GAAUF,GAAOC,EAAK,EAAGI,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,CAAC,EAkB5FmB,GAAMjB,EAAIW,EAAI,EAkBdO,GAAMlB,EAAIa,EAAI,EAedM,GAAKnB,EAAIc,EAAG,EAEnBM,GAAOR,EAAIG,GAAejB,EAAM,CAAQ,CAAC,EACzCuB,GAAOT,EAAIG,GAAejB,EAAM,GAAQ,CAAC,EAclCwB,GAAMtB,EAAIY,EAAIQ,GAAMd,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,EAc9CyB,GAAMvB,EAAIqB,EAAI,EAErBG,GAAQZ,EAAIS,GAAMI,EAAK,GAAS,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,EAC5D4B,GAAWd,EAAIS,GAAMI,EAAK,GAAY,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,EAElE6B,GAAgBjB,GAAGc,GAAOE,EAAQ,EAc3BE,GAAO5B,EAAIwB,EAAK,EAchBK,GAAU7B,EAAI0B,EAAQ,EAE7BI,GAAOpB,GACXK,GACAK,GACAC,GACAG,GACAE,EAAQ,EAGJK,GAAcrB,GAClBE,EAAIkB,GAAML,EAAK,GAAO,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,EAexCkC,GAAahC,EAAI+B,EAAW,EAEnCE,GAAoBvB,GACxBE,EAAIkB,GAAML,EAAK,GAAQ,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,EACnDc,EAAIkB,GAAML,EAAK,GAAQ,EAAGnB,EAASR,EAAM,GAAQ,CAAC,EAAG2B,EAAK,GAAO,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,EAenFoC,GAAmBlC,EAAIiC,EAAiB,EAE/CE,GAAgBvB,EAAIS,GAAMI,EAAK,GAAkB,EAAGnB,EAASR,EAAM,GAAa,CAAC,EAAGQ,EAASR,EAAM,GAAa,CAAC,EAAGQ,EAASR,EAAM,GAAQ,CAAC,CAAC,EActIsC,GAAepC,EAAImC,EAAa,EAEvCE,GAAgBzB,EAAIc,GAAUD,EAAK,GAAiB,EAAGnB,EAASR,EAAM,GAAa,CAAC,EAAGQ,EAASR,EAAM,GAAa,CAAC,EAAGQ,EAASR,EAAM,GAAQ,CAAC,CAAC,EAczIwC,GAAetC,EAAIqC,EAAa,EAEvCE,GAAO7B,GACXqB,GACAE,GACArB,EAAIQ,GAAMd,EAASR,EAAM,GAAQ,CAAC,CAAC,EACnCc,EAAIe,GAAerB,EAASR,EAAM,GAAQ,CAAC,CAAC,EAC5Cc,EAAIG,GAAeT,EAASR,EAAM,GAAQ,CAAC,CAAC,EAC5CqC,GACAE,GACAvC,EAAM,GAAQ,CAAC,EAeJ0C,GAAMxC,EAAIuC,EAAI,EAErBE,GAAW7B,EAAI2B,GAAMd,EAAK,GAAgB,EAAG3B,EAAM,GAAQ,CAAC,EAcrD4C,GAAU1C,EAAIyC,EAAQ,EAE7BE,GAAUjC,GACdE,EAAI2B,GAAMd,EAAK,GAAgB,EAAGA,EAAK,GAAW,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,EAC9Ec,EAAI2B,GAAMd,EAAK,GAAW,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,EACtDc,EAAIa,EAAK,GAAW,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,EAetC8C,GAAS5C,EAAI2C,EAAO,EAE3BE,GAAQnC,GACZE,EAAIG,GAAejB,EAAM,CAAQ,EAAG2B,EAAK,GAAS,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,EAC9Ec,EAAIG,GAAeU,EAAK,GAAS,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,EAenDgD,GAAO9C,EAAI6C,EAAK,EAEvBE,GAASnC,EAAIG,GAAeL,GAChCE,EAAId,EAAM,EAAU,KAAK,EAAG2B,EAAK,GAAS,CAAC,EAC3Cb,EAAId,EAAM,CAAQ,EAAG2B,EAAK,GAAU,CAAC,EACrCb,EAAId,EAAM,CAAQ,EAAG2B,EAAK,GAAQ,EAAGA,EAAK,GAAS,CAAC,EACpDb,EAAIa,EAAK,GAAQ,EAAGA,EAAK,GAAS,CAAC,EACnCA,EAAK,GAAQ,EACbA,EAAK,GAAU,CAAC,EAElBnB,EAASR,EAAM,GAAQ,CAAC,CAAC,EAeZkD,GAAQhD,EAAI+C,EAAM,EAEzBE,GAAUvC,GACdE,EAAId,EAAM,GAAW,EAAGQ,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,EAevCoD,GAASlD,EAAIiD,EAAO,EAE3BE,GAAQzC,GACZE,EAAId,EAAM,GAAS,EAAGQ,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,EAerCsD,GAAOpD,EAAImD,EAAK,ECtfvB,IAAOE,GAAP,cAAwE,KAAK,CAC1E,KACA,OAEP,YAAaC,EAASC,EAAU,CAC9B,MAAMD,CAAI,EAEV,KAAK,KAAOA,EAEZ,KAAK,OAASC,CAChB,GC9BF,IAAAC,GAAgB,gBCAhB,IAAAC,GAAe,oBCAT,SAAUC,GAAeC,EAAU,CAKvC,MAJI,GAAAA,EAAG,WAAW,UAAU,GAIxBA,EAAG,YAAW,EAAG,WAAW,MAAM,EAKxC,CDLA,IAAMC,GAAW,CAAE,EAAG,OAAQ,EAAG,MAAM,EAEvC,SAASC,GAAYC,EAAU,CAC7B,MAAO,CAAC,UAAW,IAAI,EAAE,SAASA,CAAE,CACtC,CAEA,SAASC,GAAiBC,EAAa,CACrC,IAAMC,EAAsB,CAAA,EACtBC,EAAW,GAAAC,QAAG,kBAAiB,EAErC,OAAW,CAAC,CAAEC,CAAQ,IAAK,OAAO,QAAQF,CAAQ,EAChD,GAAIE,GAAY,KACd,QAAWC,KAAWD,EAChBE,GAAcD,EAAQ,OAAO,GAI7BA,EAAQ,SAAWT,GAASI,CAAM,GACpCC,EAAU,KAAKI,EAAQ,OAAO,EAMtC,OAAOJ,CACT,CAQM,SAAUM,GAAuBC,EAAgBC,EAAa,CAClE,GAAID,GAAM,KACR,MAAO,CAAA,EAGT,IAAME,EAAUF,EAAG,UAAS,EAE5B,GAAIX,GAAWa,EAAQ,IAAI,EAAG,CAC5B,IAAMC,EAAQ,CAAA,EAEd,QAAWC,KAAQb,GAAgBW,EAAQ,MAAM,EAC/CC,EAAM,KAAKE,GAAU,MAAMH,EAAQ,MAAM,IAAIE,CAAI,IAAIF,EAAQ,SAAS,IAAID,GAAQC,EAAQ,IAAI,EAAE,CAAC,EAGnG,OAAOC,CACT,CAEA,MAAO,CACLE,GAAU,MAAMH,EAAQ,MAAM,IAAIA,EAAQ,IAAI,IAAIA,EAAQ,SAAS,IAAID,GAAQC,EAAQ,IAAI,EAAE,EAEjG,CE1DO,IAAMI,GAAN,cAA2B,KAAM,CACvC,YAAYC,EAAS,CACpB,MAAMA,CAAO,EACb,KAAK,KAAO,cACb,CACD,EAMaC,GAAN,cAAyB,KAAM,CACrC,YAAYD,EAAS,CACpB,MAAM,EACN,KAAK,KAAO,aACZ,KAAK,QAAUA,CAChB,CACD,EAKME,GAAkBC,GAAgB,WAAW,eAAiB,OACjE,IAAIF,GAAWE,CAAY,EAC3B,IAAI,aAAaA,CAAY,EAK1BC,GAAmBC,GAAU,CAClC,IAAMC,EAASD,EAAO,SAAW,OAC9BH,GAAgB,6BAA6B,EAC7CG,EAAO,OAEV,OAAOC,aAAkB,MAAQA,EAASJ,GAAgBI,CAAM,CACjE,EAEe,SAARC,GAA0BC,EAASC,EAAS,CAClD,GAAM,CACL,aAAAC,EACA,SAAAC,EACA,QAAAX,EACA,aAAAY,EAAe,CAAC,WAAY,YAAY,CACzC,EAAIH,EAEAI,EACAC,EA8DEC,EA5DiB,IAAI,QAAQ,CAACC,EAASC,IAAW,CACvD,GAAI,OAAOP,GAAiB,UAAY,KAAK,KAAKA,CAAY,IAAM,EACnE,MAAM,IAAI,UAAU,4DAA4DA,CAAY,IAAI,EAGjG,GAAID,EAAQ,OAAQ,CACnB,GAAM,CAAC,OAAAJ,CAAM,EAAII,EACbJ,EAAO,SACVY,EAAOb,GAAiBC,CAAM,CAAC,EAGhCS,EAAe,IAAM,CACpBG,EAAOb,GAAiBC,CAAM,CAAC,CAChC,EAEAA,EAAO,iBAAiB,QAASS,EAAc,CAAC,KAAM,EAAI,CAAC,CAC5D,CAEA,GAAIJ,IAAiB,OAAO,kBAAmB,CAC9CF,EAAQ,KAAKQ,EAASC,CAAM,EAC5B,MACD,CAGA,IAAMC,EAAe,IAAInB,GAEzBc,EAAQD,EAAa,WAAW,KAAK,OAAW,IAAM,CACrD,GAAID,EAAU,CACb,GAAI,CACHK,EAAQL,EAAS,CAAC,CACnB,OAASQ,EAAO,CACfF,EAAOE,CAAK,CACb,CAEA,MACD,CAEI,OAAOX,EAAQ,QAAW,YAC7BA,EAAQ,OAAO,EAGZR,IAAY,GACfgB,EAAQ,EACEhB,aAAmB,MAC7BiB,EAAOjB,CAAO,GAEdkB,EAAa,QAAUlB,GAAW,2BAA2BU,CAAY,gBACzEO,EAAOC,CAAY,EAErB,EAAGR,CAAY,GAEd,SAAY,CACZ,GAAI,CACHM,EAAQ,MAAMR,CAAO,CACtB,OAASW,EAAO,CACfF,EAAOE,CAAK,CACb,CACD,GAAG,CACJ,CAAC,EAEwC,QAAQ,IAAM,CACtDJ,EAAkB,MAAM,EACpBD,GAAgBL,EAAQ,QAC3BA,EAAQ,OAAO,oBAAoB,QAASK,CAAY,CAE1D,CAAC,EAED,OAAAC,EAAkB,MAAQ,IAAM,CAC/BH,EAAa,aAAa,KAAK,OAAWC,CAAK,EAC/CA,EAAQ,MACT,EAEOE,CACR,CCvHA,IAAMK,GAAmBC,GAAW,CACnC,IAAMC,EAAcD,EAAQ,kBAAoBA,EAAQ,IAAMA,EAAQ,YAChEE,EAAiBF,EAAQ,qBAAuBA,EAAQ,KAAOA,EAAQ,eAE7E,GAAI,CAACC,GAAe,CAACC,EACpB,MAAM,IAAI,UAAU,2BAA2B,EAGhD,MAAO,CACN,YAAaD,EAAY,KAAKD,CAAO,EACrC,eAAgBE,EAAe,KAAKF,CAAO,CAC5C,CACD,EAEO,SAASG,GAAeH,EAASI,EAAOC,EAAS,CACvD,IAAIC,EACEC,EAAc,IAAI,QAAQ,CAACC,EAASC,IAAW,CAQpD,GAPAJ,EAAU,CACT,gBAAiB,CAAC,OAAO,EACzB,UAAW,GACX,mBAAoB,GACpB,GAAGA,CACJ,EAEI,EAAEA,EAAQ,OAAS,IAAMA,EAAQ,QAAU,OAAO,mBAAqB,OAAO,UAAUA,EAAQ,KAAK,IACxG,MAAM,IAAI,UAAU,iDAAiD,EAGtEA,EAAQ,QAAQ,eAAe,EAG/B,IAAMK,EAAS,CAACN,CAAK,EAAE,KAAK,EAEtBO,EAAQ,CAAC,EACT,CAAC,YAAAV,EAAa,eAAAC,CAAc,EAAIH,GAAiBC,CAAO,EAExDY,EAAS,IAAIC,IAAe,CACjC,IAAMC,EAAQT,EAAQ,UAAYQ,EAAaA,EAAW,CAAC,EAGvDR,EAAQ,QAAU,CAACA,EAAQ,OAAOS,CAAK,IAI3CH,EAAM,KAAKG,CAAK,EAEZT,EAAQ,QAAUM,EAAM,SAC3BL,EAAO,EACPE,EAAQG,CAAK,GAEf,EAEMI,EAAgBC,GAAS,CAC9BV,EAAO,EACPG,EAAOO,CAAK,CACb,EAEAV,EAAS,IAAM,CACd,QAAWF,KAASM,EACnBR,EAAeE,EAAOQ,CAAM,EAG7B,QAAWK,KAAkBZ,EAAQ,gBACpCH,EAAee,EAAgBF,CAAa,CAE9C,EAEA,QAAWX,KAASM,EACnBT,EAAYG,EAAOQ,CAAM,EAG1B,QAAWK,KAAkBZ,EAAQ,gBACpCJ,EAAYgB,EAAgBF,CAAa,EAGtCV,EAAQ,QACXA,EAAQ,OAAO,iBAAiB,QAAS,IAAM,CAC9CU,EAAcV,EAAQ,OAAO,MAAM,CACpC,EAAG,CAAC,KAAM,EAAI,CAAC,EAGZA,EAAQ,oBACXG,EAAQG,CAAK,CAEf,CAAC,EAID,GAFAJ,EAAY,OAASD,EAEjB,OAAOD,EAAQ,SAAY,SAAU,CACxC,IAAMa,EAAUC,GAASZ,EAAa,CAAC,aAAcF,EAAQ,OAAO,CAAC,EACrE,OAAAa,EAAQ,OAASZ,EACVY,CACR,CAEA,OAAOX,CACR,CAEO,SAASa,GAAOpB,EAASI,EAAOC,EAAS,CAC3C,OAAOA,GAAY,aACtBA,EAAU,CAAC,OAAQA,CAAO,GAG3BA,EAAU,CACT,GAAGA,EACH,MAAO,EACP,mBAAoB,EACrB,EAEA,IAAMgB,EAAelB,GAAeH,EAASI,EAAOC,CAAO,EACrDiB,EAAUD,EAAa,KAAKE,GAASA,EAAM,CAAC,CAAC,EACnD,OAAAD,EAAQ,OAASD,EAAa,OAEvBC,CACR,CC3GM,SAAUE,GAAmBC,EAAYC,EAAqB,CAClE,GAAI,OAAOD,GAAO,SAChB,MAAM,IAAIE,EAAuB,wBAAwBF,CAAE,EAAE,EAO/D,GAJI,OAAOC,GAAS,WAClBA,EAAO,SAASA,CAAI,GAGlB,MAAMA,CAAI,EACZ,MAAM,IAAIC,EAAuB,0BAA0BD,CAAI,EAAE,EAGnE,MAAI,WAAOD,CAAE,EACX,OAAOG,GAAU,QAAQH,CAAE,QAAQC,CAAI,EAAE,EAG3C,MAAI,WAAOD,CAAE,EACX,OAAOG,GAAU,QAAQH,CAAE,QAAQC,CAAI,EAAE,EAG3C,MAAM,IAAIC,EAAuB,6CAA6CF,CAAE,IAAIC,CAAI,EAAE,CAC5F,CCOM,IAAOG,GAAP,cAA0B,KAAK,CACnC,OAAO,KAAO,aACd,KAAO,aAEP,YAAaC,EAAkB,+BAAgCC,EAAW,CACxE,MAAMD,EAAS,GAAGC,CAAI,CACxB,GC4GF,eAAsBC,GAAeC,EAAqCC,EAAmBC,EAAsBC,EAA0B,CAE3I,IAAMC,EAAQ,IAAIC,GAAWF,GAAM,YAAY,EAE3CA,GAAM,WAAa,OAErBC,EAAM,KAAOD,EAAK,WAGpB,IAAMG,EAAaH,GAAM,YAAc,QAEvC,OAAID,GAAQ,UAAY,GACf,QAAQ,OAAOE,CAAK,EAGtB,IAAI,QAAQ,CAACG,EAASC,IAAU,CACrC,SAASC,GAAe,CACtBC,GAAeR,EAAQ,QAASS,CAAa,EAC7CD,GAAeV,EAASC,EAAWW,CAAa,EAChDF,GAAeV,EAASM,EAAYO,CAAkB,CACxD,CAEA,IAAMD,EAAiBE,GAAkB,CACvC,GAAI,CACF,GAAIX,GAAM,SAASW,CAAG,IAAM,GAC1B,MAEJ,OAASC,EAAU,CACjBN,EAAe,EACfD,EAAOO,CAAG,EACV,MACF,CAEAN,EAAe,EACfF,EAAQO,CAAG,CACb,EAEMD,EAAsBC,GAAkB,CAG5C,GAFAL,EAAe,EAEXK,aAAe,MAAO,CACxBN,EAAOM,CAAG,EACV,MACF,CAEAN,EAAOM,EAAI,QAAUX,GAAM,OAAS,IAAI,MAAM,QAAQA,GAAM,UAAU,wHAAwH,CAAC,CACjM,EAEMQ,EAAgB,IAAW,CAC/BF,EAAe,EACfD,EAAOJ,CAAK,CACd,EAEAY,GAAYd,EAAQ,QAASS,CAAa,EAC1CK,GAAYhB,EAASC,EAAWW,CAAa,EAC7CI,GAAYhB,EAASM,EAAYO,CAAkB,CACrD,CAAC,CACH,CAEA,SAASG,GAAahB,EAAiDiB,EAAeC,EAAa,CAC7FlB,GAAW,OAIXmB,GAAcnB,CAAO,EACvBA,EAAQ,iBAAiBiB,EAAOC,CAAQ,EAExClB,EAAQ,YAAYiB,EAAOC,CAAQ,EAEvC,CAEA,SAASR,GAAgBV,EAAiDiB,EAAeC,EAAa,CAChGlB,GAAW,OAIXmB,GAAcnB,CAAO,EACvBA,EAAQ,oBAAoBiB,EAAOC,CAAQ,EAE3ClB,EAAQ,eAAeiB,EAAOC,CAAQ,EAE1C,CAEA,SAASC,GAAenB,EAAY,CAClC,OAAO,OAAOA,EAAQ,kBAAqB,YAAc,OAAOA,EAAQ,qBAAwB,UAClG,CCrOM,SAAUoB,GAAyBC,EAAsC,CAE7E,GAAIC,GAAiBD,CAAQ,EAC3B,OAAQ,iBAAgB,CACtB,IAAME,EAASF,EAAS,UAAS,EAEjC,GAAI,CACF,OAAa,CACX,GAAM,CAAE,KAAAG,EAAM,MAAAC,CAAK,EAAK,MAAMF,EAAO,KAAI,EAEzC,GAAIC,EACF,OAGF,MAAMC,CACR,CACF,SACEF,EAAO,YAAW,CACpB,CACF,GAAE,EAGJ,GAAIG,GAAgBL,CAAQ,EAC1B,OAAOA,EAGT,MAAM,IAAI,MAAM,gBAAgB,CAClC,CAEA,SAASK,GAAwBC,EAAS,CACxC,OAAOA,EAAI,OAAO,aAAa,GAAK,IACtC,CAEA,SAASL,GAAkBK,EAAS,CAClC,OAAO,OAAOA,GAAK,WAAc,UACnC,CCnCM,SAAUC,GAAUC,EAAkB,CAC1C,MAAO,OAAOC,GAAoC,CAChD,IAAMC,EAAiB,SAA0B,CAC3CC,GAAiBF,CAAM,GACzB,MAAMA,EAAO,OAAO,MAAS,CAEjC,EAEIG,EACAC,EACEC,EAAgBC,GAAoB,CACxCH,EAAQG,EAGRL,EAAc,EACX,MAAMK,GAAM,CACXA,EAAM,IAAI,eAAe,CACvBH,EACAG,GACC,uFAAuF,CAC5F,CAAC,EACA,QAAQ,IAAK,CACZF,IAAQE,CAAG,CACb,CAAC,CACL,EAEIC,EACAC,EAAS,GACPC,EAAe,IAAW,CAC9BD,EAAS,GACTD,IAAS,CACX,EAEIG,EACAC,EAAW,GACTC,EAAgB,IAAW,CAC/BD,EAAW,GACXD,IAAU,CACZ,EAEIG,EACEC,EAAe,IAAW,CAC9BD,IAAS,CACX,EAEME,EAAsB,SACnB,IAAI,QAAc,CAACC,EAASC,IAAU,CAC3CV,EAAUM,EAAUG,EACpBZ,EAAQa,EAERlB,EAAS,KAAK,QAASe,CAAY,CACrC,CAAC,EAGGI,EAAc,UAElB,MAAMjB,EAAc,EAEb,IAAI,QAAc,CAACe,EAASC,IAAU,CAC3C,GAAIT,GAAUG,GAAaR,GAAS,KAAO,CACzCa,EAAO,EACP,MACF,CAEAN,EAAWH,EAAUS,EACrBZ,EAAQa,CACV,CAAC,GAGGE,EAAU,IAAW,CACzBpB,EAAS,eAAe,QAASM,CAAY,EAC7CN,EAAS,eAAe,QAASU,CAAY,EAC7CV,EAAS,eAAe,SAAUa,CAAa,EAC/Cb,EAAS,eAAe,QAASe,CAAY,CAC/C,EAEAf,EAAS,KAAK,QAASM,CAAY,EACnCN,EAAS,KAAK,QAASU,CAAY,EACnCV,EAAS,KAAK,SAAUa,CAAa,EAErC,GAAI,CACF,cAAiBQ,KAASpB,EAAQ,CAChC,GAAI,CAACD,EAAS,UAAYA,EAAS,WAAcI,GAAS,KACxD,MAGGJ,EAAS,MAAMqB,CAAY,GAC9B,MAAML,EAAmB,CAE7B,CACF,OAAST,EAAU,CAGbH,GAAS,MACXJ,EAAS,QAAQO,CAAG,EAItBH,EAAQG,CACV,CAEA,GAAI,CAWF,GARIP,EAAS,UACXA,EAAS,IAAG,EAId,MAAMmB,EAAW,EAGbf,GAAS,KAAM,MAAMA,CAC3B,SAEEgB,EAAO,CACT,CACF,CACF,CAEA,SAASjB,GAA4BmB,EAAS,CAC5C,OAAOA,EAAI,QAAU,IACvB,CCxHM,SAAUC,GAAgDA,EAAc,CAC5E,MAAO,CACL,KAAMC,GAAKD,CAAM,EACjB,OAAQE,GAAOF,CAAM,EAEzB,CCdA,IAAAG,GAAe,eACfC,GAAiB,iBAMX,SAAUC,GAAsBC,EAAiBC,EAAoB,CAAA,EAAE,CAC3E,IAAMC,EAAaF,EAAK,QAAO,EAG/B,GAAIE,GAAc,KAChB,OAAI,GAAAC,QAAG,SAAQ,IAAO,QAEb,CAAE,KAAM,GAAAC,QAAK,KAAK,gBAAiBF,CAAU,CAAC,EAE9C,CAAE,KAAMA,CAAU,EAI7B,IAAMG,EAAUL,EAAK,UAAS,EAG9B,MAAO,CACL,GAAGC,EACH,GAAGI,EACH,SAAUA,EAAQ,SAAW,EAEjC,CCAO,IAAMC,GAAwB,CAACC,EAAgBC,IAAqD,CACzG,IAAIC,EACEC,EAAMF,EAAQ,OAAO,aAAa,mBAAmB,EACrDG,EAAYH,EAAQ,UACpBI,EAAUJ,EAAQ,QAClBK,EAAeL,EAAQ,cAAgB,GACvCM,EAAoBN,EAAQ,yBAA2B,KACvDO,EAAeP,EAAQ,oBAAsB,IAC/CQ,EAAW,GACXC,EAAU,GAGVT,EAAQ,eAAe,QAAO,GAAM,OACtCA,EAAQ,WAAaA,EAAQ,eAG3BA,EAAQ,YAAY,QAAO,GAAM,OACnCA,EAAQ,UAAYA,EAAQ,YAI9BD,EAAO,GAAG,QAASW,GAAM,CACvBD,EAAU,GAELD,IACHN,EAAI,MAAM,uBAAwBC,EAAWO,CAAG,EAChDN,GAAS,UAAU,CAAE,CAAC,GAAGC,CAAY,OAAO,EAAG,EAAI,CAAE,GAGvDN,EAAO,QAAO,EACdY,EAAO,SAAS,MAAQ,KAAK,IAAG,CAClC,CAAC,EAED,IAAIC,EAEJ,GAAIZ,EAAQ,YAAc,KACxBY,EAAaZ,EAAQ,eAChB,CACL,GAAID,EAAO,eAAiB,MAAQA,EAAO,YAAc,KAGvD,MAAM,IAAIc,EAAuB,4CAA4C,EAG/ED,EAAaE,GAAYf,EAAO,cAAeA,EAAO,UAAU,CAClE,CAEA,IAAMgB,EAAQC,GAAqBJ,CAAU,EACvCK,EAAWF,EAAM,MAAQ,GAAGA,EAAM,MAAQ,EAAE,IAAIA,EAAM,MAAQ,EAAE,GAChE,CAAE,KAAAG,EAAM,OAAAC,CAAM,EAAKC,GAAOrB,CAAM,EAItCA,EAAO,WAAWO,CAAiB,EAEnCP,EAAO,KAAK,UAAW,IAAK,CAC1BS,EAAW,GACXN,EAAI,4BAA6BC,EAAWc,CAAQ,EACpDb,GAAS,UAAU,CAAE,CAAC,GAAGC,CAAY,SAAS,EAAG,EAAI,CAAE,EAIvDN,EAAO,QAAQ,IAAIsB,EAAc,EACjCV,EAAO,SAAS,MAAQ,KAAK,IAAG,CAClC,CAAC,EAEDZ,EAAO,KAAK,QAAS,IAAK,CAEpB,CAACS,GAAY,CAACC,IAChBP,EAAI,qBAAsBC,EAAWc,CAAQ,EAC7Cb,GAAS,UAAU,CAAE,CAAC,GAAGC,CAAY,OAAO,EAAG,EAAI,CAAE,GAMvDN,EAAO,QAAO,EACdY,EAAO,SAAS,MAAQ,KAAK,IAAG,CAClC,CAAC,EAEDZ,EAAO,KAAK,MAAO,IAAK,CAGtBG,EAAI,mBAAoBC,EAAWc,CAAQ,EAC3Cb,GAAS,UAAU,CAAE,CAAC,GAAGC,CAAY,KAAK,EAAG,EAAI,CAAE,CACrD,CAAC,EAED,IAAMM,EAA8B,CAClC,MAAM,KAAMQ,EAAM,CAChB,GAAI,CACF,MAAMD,GAAM,iBAAgB,CAC1B,cAAiBI,KAAOH,EAClBG,aAAe,WACjB,MAAMA,EAEN,MAAMA,EAAI,SAAQ,CAGxB,GAAE,CAAE,CACN,OAASZ,EAAU,CAEbA,EAAI,OAAS,WAIfR,EAAI,MAAM,2BAA4BC,EAAWc,EAAUP,CAAG,CAElE,CAGAX,EAAO,IAAG,CACZ,EAEA,OAAAoB,EAGA,WAAAP,EAEA,SAAU,CAAE,KAAM,KAAK,IAAG,CAAE,EAE5B,MAAM,MAAOZ,EAAwB,CAAA,EAAE,CACrC,GAAID,EAAO,OAAQ,CACjBG,EAAI,qCAAsCC,EAAWc,CAAQ,EAC7D,MACF,CAEA,GAAIlB,EAAO,UAAW,CACpBG,EAAI,wCAAyCC,EAAWc,CAAQ,EAChE,MACF,CAEA,GAAIhB,GAAgB,KAClB,OAAOA,EAAa,QAGtB,GAAI,CACFA,EAAesB,GAAM,EAGrBxB,EAAO,IAAG,EAGV,IAAMyB,EAAcC,GAAoB1B,CAAM,EAGxC2B,EAAS1B,EAAQ,QAAU,YAAY,QAAQO,CAAY,EAG7DR,EAAO,eAAiB,IAC1BG,EAAI,wBAAyBC,EAAWc,CAAQ,EAChD,MAAMU,GAAUH,EAAa,QAASE,EAAQ,CAC5C,WAAY,QACb,EACDxB,EAAI,uBAAwBC,EAAWc,CAAQ,GAGjD,MAAM,QAAQ,IAAI,CAChBU,GAAUH,EAAa,QAASE,EAAQ,CACtC,WAAY,QACb,EAGD3B,EAAO,QAAO,EACf,CACH,OAASW,EAAU,CACjB,KAAK,MAAMA,CAAG,CAChB,SACET,EAAa,QAAO,CACtB,CACF,EAEA,MAAQS,GAAc,CACpBR,EAAI,uCAAwCC,EAAWc,EAAUP,CAAG,EAGpEX,EAAO,QAAO,EAMdY,EAAO,SAAS,MAAQ,KAAK,IAAG,CAClC,EAEA,IAAAT,GAGF,OAAOS,CACT,EAEA,SAASc,GAAqBG,EAAS,CAWrC,MAVoB,CAClB,iBAAkB,CAACC,EAAWC,IAAW,CACvCF,EAAI,YAAYC,EAAMC,CAAE,CAC1B,EACA,oBAAqB,CAACD,EAAWC,IAAW,CAC1CF,EAAI,eAAeC,EAAMC,CAAE,CAC7B,EAKJ,CZxMA,IAAKC,IAAL,SAAKA,EAAqB,CAMxBA,EAAAA,EAAA,SAAA,CAAA,EAAA,WACAA,EAAAA,EAAA,OAAA,CAAA,EAAA,SAEAA,EAAAA,EAAA,OAAA,CAAA,EAAA,QACF,GAVKA,KAAAA,GAAqB,CAAA,EAAA,EAkBpB,IAAOC,GAAP,cAA2BC,EAAiC,CAUlC,QATb,OAEA,QAAU,IAAI,IACvB,OAAiB,CAAE,KAAMF,GAAsB,QAAQ,EACvD,QACA,KACS,IACA,mBAEjB,YAA8BG,EAAgB,CAqB5C,GApBA,MAAK,EADuB,KAAA,QAAAA,EAG5BA,EAAQ,UAAYA,EAAQ,WAAa,GACzCA,EAAQ,QAAUA,EAAQ,SAAW,GAErC,KAAK,mBAAqB,IAAI,gBAC9BC,GAAgB,IAAU,KAAK,mBAAmB,MAAM,EAExD,KAAK,IAAMD,EAAQ,OAAO,aAAa,qBAAqB,EAC5D,KAAK,KAAO,UACZ,KAAK,OAAS,GAAAE,QAAI,aAAaF,EAAS,KAAK,SAAS,KAAK,IAAI,CAAC,EAM5DA,EAAQ,iBAAmB,SAC7B,KAAK,OAAO,eAAiBA,EAAQ,gBAGnCA,EAAQ,6BAA+B,MAErCA,EAAQ,4BAA4B,WAAaA,EAAQ,4BAA4B,YACvF,MAAM,IAAIG,EAAuB,mCAAmC,EAIxEH,EAAQ,SAAS,oBAAoB,uCAAwC,CAC3E,MAAO,UACP,KAAM,6CACN,UAAW,KACF,CACL,CAAC,KAAK,IAAI,EAAG,KAAK,QAAQ,OAG/B,EAED,KAAK,QAAU,CACb,OAAQA,EAAQ,SAAS,oBAAoB,kCAAmC,CAC9E,MAAO,UACP,KAAM,4CACP,EACD,OAAQA,EAAQ,SAAS,oBAAoB,mCAAoC,CAC/E,MAAO,UACP,KAAM,6CACP,EACD,OAAQA,EAAQ,SAAS,oBAAoB,mCAAoC,CAC/E,MAAO,UACP,KAAM,6CACP,GAGH,KAAK,OACF,GAAG,YAAa,IAAK,CAEpB,IAAMI,EAAU,KAAK,OAAO,QAAO,EAE/BA,GAAW,KACb,KAAK,KAAO,UACH,OAAOA,GAAY,SAE5B,KAAK,KAAOA,EAEZ,KAAK,KAAO,GAAGA,EAAQ,OAAO,IAAIA,EAAQ,IAAI,GAGhD,KAAK,QAAQ,QAAQ,OAAO,CAC1B,CAAC,KAAK,IAAI,EAAGP,GAAsB,OACpC,EAED,KAAK,kBAAkB,WAAW,CACpC,CAAC,EACA,GAAG,QAASQ,GAAM,CACjB,KAAK,QAAQ,QAAQ,UAAU,CAAE,CAAC,GAAG,KAAK,IAAI,eAAe,EAAG,EAAI,CAAE,EACtE,KAAK,kBAAkB,QAAS,CAAE,OAAQA,CAAG,CAAE,CACjD,CAAC,EACA,GAAG,QAAS,IAAK,CAChB,KAAK,QAAQ,QAAQ,OAAO,CAC1B,CAAC,KAAK,IAAI,EAAG,KAAK,OAAO,KAC1B,EAMG,KAAK,OAAO,OAASR,GAAsB,QAC7C,KAAK,kBAAkB,OAAO,CAElC,CAAC,EACA,GAAG,OAAQ,IAAK,CACf,KAAK,QAAQ,QAAQ,UAAU,CAAE,CAAC,GAAG,KAAK,IAAI,OAAO,EAAG,EAAI,CAAE,CAChE,CAAC,CACL,CAEQ,SAAUS,EAAkB,CAGlC,GAFA,KAAK,QAAQ,QAAQ,UAAU,CAAE,CAAC,GAAG,KAAK,IAAI,aAAa,EAAG,EAAI,CAAE,EAEhE,KAAK,OAAO,OAAST,GAAsB,OAC7C,MAAAS,EAAO,QAAO,EACR,IAAIC,GAAgB,6BAA6B,EAGzD,IAAIC,EACJ,GAAI,CACFA,EAASC,GAAsBH,EAAQ,CACrC,cAAe,KAAK,OAAO,cAC3B,wBAAyB,KAAK,QAAQ,wBACtC,mBAAoB,KAAK,QAAQ,mBACjC,QAAS,KAAK,SAAS,OACvB,aAAc,GAAG,KAAK,IAAI,IAC1B,OAAQ,KAAK,QAAQ,OACrB,UAAW,UACZ,CACH,OAASD,EAAU,CACjB,KAAK,IAAI,MAAM,4BAA6BA,CAAG,EAC/C,KAAK,QAAQ,QAAQ,UAAU,CAAE,CAAC,GAAG,KAAK,IAAI,wBAAwB,EAAG,EAAI,CAAE,EAC/EC,EAAO,QAAO,EACd,MACF,CAEA,KAAK,IAAI,4BAA6BE,EAAO,UAAU,EACvD,KAAK,QAAQ,IAAIF,CAAM,EAEvB,KAAK,QAAQ,SAAS,eAAeE,EAAQ,CAC3C,OAAQ,KAAK,mBAAmB,OACjC,EACE,KAAK,IAAK,CACT,KAAK,IAAI,iCAAkCA,EAAO,UAAU,EAE5DF,EAAO,KAAK,QAAS,IAAK,CACxB,KAAK,QAAQ,OAAOA,CAAM,EAGxB,KAAK,QAAQ,6BAA+B,MAC5C,KAAK,QAAQ,KAAO,KAAK,QAAQ,4BAA4B,aAQ7D,KAAK,OAAM,EAAG,MAAMI,GAAI,CACtB,KAAK,IAAI,MAAM,sEAAuEA,CAAC,EACvF,KAAK,QAAQ,6BAA6B,gBAAgBA,CAAU,CACtE,CAAC,CAEL,CAAC,EAGC,KAAK,QAAQ,6BAA+B,MAC5C,KAAK,QAAQ,MAAQ,KAAK,QAAQ,4BAA4B,YAE9D,KAAK,MAAK,CAEd,CAAC,EACA,MAAM,MAAML,GAAM,CACjB,KAAK,IAAI,MAAM,oCAAqCA,CAAG,EACvD,KAAK,QAAQ,QAAQ,UAAU,CAAE,CAAC,GAAG,KAAK,IAAI,kBAAkB,EAAG,EAAI,CAAE,EACzE,KAAK,QAAQ,OAAOC,CAAM,EAC1BE,EAAO,MAAMH,CAAG,CAClB,CAAC,CACL,CAEA,UAAQ,CACN,GAAI,KAAK,OAAO,OAASR,GAAsB,SAC7C,MAAO,CAAA,EAGT,IAAMO,EAAU,KAAK,OAAO,QAAO,EAEnC,OAAIA,GAAW,KACN,CAAA,EAGL,OAAOA,GAAY,SACd,CACLO,GAAU,SAAS,mBAAmBP,CAAO,CAAC,EAAE,GAI7CQ,GAAsB,KAAK,OAAO,cAAeR,EAAQ,IAAI,CACtE,CAEA,qBAAmB,CAEnB,CAEA,MAAM,OAAQS,EAAa,CACzB,GAAI,KAAK,OAAO,OAAShB,GAAsB,QAAU,KAAK,OAAO,OAASA,GAAsB,OAClG,MAAM,IAAIiB,GAAoB,6BAA6B,EAG7D,GAAI,CACF,KAAK,OAAS,CACZ,KAAMjB,GAAsB,OAC5B,cAAegB,EACf,UAAWE,GAAqBF,EAAI,KAAK,OAAO,GAGlD,MAAM,KAAK,OAAM,CACnB,OAASR,EAAK,CACZ,WAAK,OAAS,CAAE,KAAMR,GAAsB,QAAQ,EAC9CQ,CACR,CACF,CAEA,MAAM,OAAK,CACT,IAAMW,EAA+B,CAAA,EAEjC,KAAK,OAAO,WACdA,EAAO,KAAKC,GAAO,KAAK,OAAQ,OAAO,CAAC,EAI1C,KAAK,MAAM,EAAI,EAGf,KAAK,mBAAmB,MAAK,EAI7B,KAAK,QAAQ,QAAQX,GAAS,CACxBA,EAAO,WACTU,EAAO,KAAKC,GAAOX,EAAQ,OAAO,CAAC,EACnCA,EAAO,QAAO,EAElB,CAAC,EAED,MAAM,QAAQ,IAAIU,CAAM,CAC1B,CAKQ,MAAM,QAAM,CAClB,GAAI,KAAK,OAAO,WAAa,KAAK,OAAO,OAASnB,GAAsB,SACtE,OAGF,IAAMqB,EAAY,KAAK,OAAO,UAE9B,MAAM,IAAI,QAAc,CAACC,EAASC,IAAU,CAG1C,KAAK,OAAO,KAAK,QAASA,CAAM,EAChC,KAAK,OAAO,OAAOF,EAAWC,CAAO,CACvC,CAAC,EAED,KAAK,OAAS,CAAE,GAAG,KAAK,OAAQ,KAAMtB,GAAsB,MAAM,EAClE,KAAK,IAAI,kBAAmB,KAAK,OAAO,QAAO,CAAE,CACnD,CAEQ,MAAOwB,EAAqB,GAAK,CACvC,GAAI,CAAC,KAAK,OAAO,WAAa,KAAK,OAAO,OAASxB,GAAsB,QAAUwB,EAAW,CAC5F,KAAK,OAAS,CAAE,KAAMxB,GAAsB,QAAQ,EACpD,MACF,CAEI,CAAC,KAAK,OAAO,WAAa,KAAK,OAAO,OAASA,GAAsB,SAIzE,KAAK,IAAI,uBAAwB,KAAK,OAAO,QAAO,CAAE,EAiBtD,KAAK,OAASwB,EAAY,CAAE,KAAMxB,GAAsB,QAAQ,EAAK,CAAE,GAAG,KAAK,OAAQ,KAAMA,GAAsB,MAAM,EAMzH,KAAK,OAAO,MAAK,EACnB,GfjTI,IAAOyB,GAAP,KAAU,CACG,KACA,QACA,WACA,IAEjB,YAAaC,EAA2BC,EAAsB,CAAA,EAAE,CAC9D,KAAK,IAAMD,EAAW,OAAO,aAAa,YAAY,EACtD,KAAK,KAAOC,EACZ,KAAK,WAAaD,EAEdA,EAAW,SAAW,OACxB,KAAK,QAAU,CACb,OAAQA,EAAW,QAAQ,qBAAqB,iCAAkC,CAChF,MAAO,QACP,KAAM,2CACP,EACD,OAAQA,EAAW,QAAQ,qBAAqB,iCAAkC,CAChF,MAAO,QACP,KAAM,2CACP,GAGP,CAES,CAACE,EAAe,EAAI,GAEpB,CAAC,OAAO,WAAW,EAAI,cAEvB,CAACC,EAAmB,EAAc,CACzC,qBAGF,MAAM,KAAMC,EAAeH,EAAuB,CAChDA,EAAQ,UAAYA,EAAQ,WAAa,GACzCA,EAAQ,QAAUA,EAAQ,SAAW,GAGrC,IAAMI,EAAS,MAAM,KAAK,SAASD,EAAIH,CAAO,EAE1CK,EAEJ,GAAI,CACFA,EAASC,GAAsBF,EAAQ,CACrC,WAAYD,EACZ,wBAAyB,KAAK,KAAK,gCACnC,mBAAoB,KAAK,KAAK,mBAC9B,QAAS,KAAK,SAAS,OACvB,OAAQ,KAAK,WAAW,OACxB,UAAW,WACZ,CACH,OAASI,EAAU,CACjB,WAAK,SAAS,OAAO,UAAU,CAAE,uBAAwB,EAAI,CAAE,EAC/DH,EAAO,QAAQG,CAAG,EACZA,CACR,CAEA,GAAI,CACF,YAAK,IAAI,6BAA8BF,EAAO,UAAU,EACjD,MAAML,EAAQ,SAAS,gBAAgBK,EAAQL,CAAO,CAC/D,OAASO,EAAU,CACjB,WAAK,SAAS,OAAO,UAAU,CAAE,iBAAkB,EAAI,CAAE,EACzD,KAAK,IAAI,MAAM,sCAAuCA,CAAG,EACzDF,EAAO,MAAME,CAAG,EACVA,CACR,CACF,CAEA,MAAM,SAAUJ,EAAeH,EAAuB,CACpDA,EAAQ,OAAO,eAAc,EAC7BA,EAAQ,aAAa,IAAIQ,GAAoB,qBAAqB,CAAC,EAEnE,IAAIC,EAEJ,OAAO,IAAI,QAAgB,CAACC,EAASC,IAAU,CAC7C,IAAMC,EAAQ,KAAK,IAAG,EAChBC,EAAQC,GAAqBX,EAAI,CACrC,GAAI,KAAK,KAAK,UAAY,CAAA,EAC1B,GAAGH,EACJ,EAED,KAAK,IAAI,aAAcG,CAAE,EACzBM,EAAY,GAAAM,QAAI,QAAQF,CAAK,EAE7B,IAAMG,EAAWT,GAAoB,CACnC,KAAK,IAAI,MAAM,0BAA2BJ,EAAII,CAAG,EACjD,IAAMU,EAAWJ,EAAM,MAAQ,GAAGA,EAAM,MAAQ,EAAE,IAAIA,EAAM,IAAI,GAChEN,EAAI,QAAU,oBAAoBU,CAAQ,KAAKV,EAAI,OAAO,GAC1D,KAAK,SAAS,OAAO,UAAU,CAAE,MAAO,EAAI,CAAE,EAC9CW,EAAKX,CAAG,CACV,EAEMY,EAAY,IAAW,CAC3B,KAAK,IAAI,wBAAyBhB,CAAE,EACpC,KAAK,SAAS,OAAO,UAAU,CAAE,QAAS,EAAI,CAAE,EAEhD,IAAMI,EAAM,IAAIa,GAAa,4BAA4B,KAAK,IAAG,EAAKR,CAAK,IAAI,EAE/EH,EAAU,KAAK,QAASF,CAAG,CAC7B,EAEMc,EAAY,IAAW,CAC3B,KAAK,IAAI,uBAAwBlB,CAAE,EACnC,KAAK,SAAS,OAAO,UAAU,CAAE,QAAS,EAAI,CAAE,EAChDe,EAAI,CACN,EAEMI,EAAU,IAAW,CACzB,KAAK,IAAI,wBAAyBnB,CAAE,EACpC,KAAK,SAAS,OAAO,UAAU,CAAE,MAAO,EAAI,CAAE,EAC9Ce,EAAK,IAAIK,EAAY,CACvB,EAEML,EAAQX,GAAqB,CASjC,GARAE,EAAU,eAAe,QAASO,CAAO,EACzCP,EAAU,eAAe,UAAWU,CAAS,EAC7CV,EAAU,eAAe,UAAWY,CAAS,EAEzCrB,EAAQ,QAAU,MACpBA,EAAQ,OAAO,oBAAoB,QAASsB,CAAO,EAGjDf,GAAO,KAAM,CACfI,EAAOJ,CAAG,EAAG,MACf,CAEAG,EAAQD,CAAS,CACnB,EAEAA,EAAU,GAAG,QAASO,CAAO,EAC7BP,EAAU,GAAG,UAAWU,CAAS,EACjCV,EAAU,GAAG,UAAWY,CAAS,EAEjCrB,EAAQ,OAAO,iBAAiB,QAASsB,CAAO,CAClD,CAAC,EACE,MAAMf,GAAM,CACX,MAAAE,GAAW,QAAO,EACZF,CACR,CAAC,CACL,CAOA,eAAgBP,EAAiC,CAC/C,OAAO,IAAIwB,GAAY,CACrB,GAAI,KAAK,KAAK,YAAc,CAAA,EAC5B,GAAGxB,EACH,eAAgB,KAAK,KAAK,eAC1B,QAAS,KAAK,KAAK,QACnB,4BAA6B,KAAK,KAAK,4BACvC,wBAAyB,KAAK,KAAK,+BACnC,mBAAoB,KAAK,KAAK,mBAC9B,QAAS,KAAK,WAAW,QACzB,OAAQ,KAAK,WAAW,OACzB,CACH,CAKA,aAAcyB,EAAuB,CACnC,OAAOA,EAAW,OAAOtB,GAAML,GAAW,WAAWK,CAAE,GAAKA,EAAG,SAAQ,EAAG,WAAW,QAAQ,CAAC,CAChG,CAKA,WAAYsB,EAAuB,CACjC,OAAO,KAAK,aAAaA,CAAU,CACrC,G4BvEI,SAAUC,GAAKC,EAAmB,CAAA,EAAE,CACxC,OAAQC,GACC,IAAIC,GAAID,EAAYD,CAAI,CAEnC,CCxCM,SAAUG,GAAiDC,EAAgBC,EAAkC,CACjH,IAAMC,EAAKC,GAASH,EAAQC,CAAI,EAE1BG,EAA4B,CAChC,KAAM,MAAOC,EAAOC,IAA0B,CAE5C,IAAMC,EAAQ,MAAML,EAAG,KAAKI,CAAO,EAEnC,OAAOD,EAAM,OAAOE,CAAK,CAC3B,EACA,MAAO,MAAOC,EAASH,EAAOC,IAA0B,CAEtD,MAAMJ,EAAG,MAAMG,EAAM,OAAOG,CAAO,EAAGF,CAAO,CAC/C,EACA,OAAQ,MAAOG,EAAUJ,EAAOC,IAA0B,CAExD,MAAMJ,EAAG,OAAOO,EAAS,IAAID,GAAWH,EAAM,OAAOG,CAAO,CAAC,EAAGF,CAAO,CACzE,EACA,GAAKD,IACI,CACL,KAAM,MAAOC,GAAYF,EAAE,KAAKC,EAAOC,CAAO,EAC9C,MAAO,MAAOI,EAAGJ,IAAYF,EAAE,MAAMM,EAAGL,EAAOC,CAAO,EACtD,OAAQ,MAAOI,EAAGJ,IAAYF,EAAE,OAAOM,EAAGL,EAAOC,CAAO,EACxD,OAAQ,IAAMF,IAGlB,OAAQ,IACCF,EAAG,OAAM,GAIpB,OAAOE,CACT,CC1HA,IAAMO,GAAMC,GAAO,0BAA0B,EAEhCC,GAAP,KAAU,CACG,OAEjB,YAAaC,EAAoB,CAC/B,KAAK,OAASA,CAChB,CAKA,MAAM,IAAKC,EAAiBC,EAAiB,CAC3C,GAAI,EAAED,aAAe,YACnB,MAAM,IAAIE,EAAuB,sBAAsB,EAGzD,GAAI,EAAED,aAAiB,YACrB,MAAM,IAAIC,EAAuB,oCAAoC,EAGvE,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,GAAQ,KAAK,IACnB,IAAK,CACH,KAAMC,GAAW,KAAK,UACtB,IAAAL,EACA,MAAAC,GAEH,EAEKK,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAMvC,GAJAX,GAAI,OAAQU,CAAQ,EAEpB,MAAMH,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIC,GAAcF,EAAS,OAAO,KAAO,gBAAgB,CAEnE,CAKA,MAAM,IAAKN,EAAe,CACxB,GAAI,EAAEA,aAAe,YACnB,MAAM,IAAIE,EAAuB,sBAAsB,EAGzD,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,GAAQ,KAAK,IACnB,IAAK,CACH,KAAMC,GAAW,KAAK,UACtB,IAAAL,GAEH,EAEKM,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAIvC,GAFA,MAAMJ,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIE,EAAqBH,EAAS,OAAO,KAAO,gBAAgB,EAGxE,GAAIA,EAAS,KAAK,OAAS,KACzB,MAAM,IAAIG,EAAqB,0BAA0B,EAG3D,OAAOH,EAAS,IAAI,KACtB,CAKA,MAAM,SAAUI,EAAc,CAC5B,GAAI,CAACC,GAASD,CAAM,EAClB,MAAM,IAAIR,EAAuB,0BAA0B,EAG7D,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,GAAQ,KAAK,IACnB,IAAK,CACH,KAAMC,GAAW,KAAK,UACtB,KAAMK,EAAO,YAAW,EAAG,OAE9B,EAEKJ,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAIvC,GAFA,MAAMJ,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIE,EAAqBH,EAAS,OAAO,KAAO,sBAAsB,EAG9E,GAAIA,EAAS,KAAK,MAAM,OAAS,KAC/B,MAAM,IAAIG,EAAqB,kBAAkB,EAGnD,MAAO,CACL,GAAIG,GAA2BC,GAAOP,EAAS,IAAI,KAAK,EAAE,CAAC,EAC3D,WAAYA,EAAS,IAAI,KAAK,MAAM,IAAKQ,GAAMC,GAAUD,CAAC,CAAC,EAE/D,CAKA,MAAM,QAASE,EAAQ,CACrB,GAAIA,GAAO,MAAQC,GAAI,MAAMD,CAAG,GAAK,KACnC,MAAM,IAAId,EAAuB,sBAAsB,EAGzD,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,GAAQ,KAAK,IACnB,IAAK,CACH,KAAMC,GAAW,KAAK,QACtB,IAAKW,EAAI,OAEZ,EAEKV,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAIvC,GAFA,MAAMJ,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIE,EAAqBH,EAAS,OAAO,KAAO,oBAAoB,CAE9E,CAKA,MAAQ,cAAeU,EAAUE,EAAgB,EAAC,CAChD,GAAIF,GAAO,MAAQC,GAAI,MAAMD,CAAG,GAAK,KACnC,MAAM,IAAId,EAAuB,sBAAsB,EAGzD,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,GAAQ,KAAK,IACnB,IAAK,CACH,KAAMC,GAAW,KAAK,eACtB,IAAKW,EAAI,MACT,MAAAE,GAEH,EAGKZ,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAEvC,GAAID,EAAS,OAASC,EAAS,KAAK,GAClC,YAAMJ,EAAG,OAAM,EAAG,MAAK,EACjB,IAAIM,EAAqBH,EAAS,OAAO,KAAO,2BAA2B,EAGnF,OAAa,CACX,IAAMa,EAAc,MAAMhB,EAAG,KAAKiB,EAAW,EAG7C,GAAID,EAAY,OAASC,GAAY,KAAK,IAAK,CAC7C,MAAMjB,EAAG,OAAM,EAAG,MAAK,EACvB,MACF,CAGA,GAAIgB,EAAY,OAASC,GAAY,KAAK,OAASD,EAAY,MAAM,OAAS,KAC5E,KAAM,CACJ,GAAIP,GAA2BC,GAAOM,EAAY,KAAK,EAAE,CAAC,EAC1D,WAAYA,EAAY,KAAK,MAAM,IAAKL,GAAMC,GAAUD,CAAC,CAAC,OAI5D,aAAMX,EAAG,OAAM,EAAG,MAAK,EACjB,IAAIK,GAAc,6BAA6B,CAEzD,CACF,CAKA,MAAQ,gBAAiBR,EAAe,CACtC,GAAI,EAAEA,aAAe,YACnB,MAAM,IAAIE,EAAuB,sBAAsB,EAGzD,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,GAAQ,KAAK,IACnB,IAAK,CACH,KAAMC,GAAW,KAAK,kBACtB,IAAAL,GAEH,EAGKM,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAEvC,GAAID,EAAS,OAASC,EAAS,KAAK,GAClC,YAAMJ,EAAG,OAAM,EAAG,MAAK,EACjB,IAAIM,EAAqBH,EAAS,OAAO,KAAO,2BAA2B,EAGnF,OAAa,CACX,IAAMa,EAAc,MAAMhB,EAAG,KAAKiB,EAAW,EAG7C,GAAID,EAAY,OAASC,GAAY,KAAK,IAAK,CAC7C,MAAMjB,EAAG,OAAM,EAAG,MAAK,EACvB,MACF,CAGA,GAAIgB,EAAY,OAASC,GAAY,KAAK,OAASD,EAAY,OAAS,KAGtE,KAAM,CACJ,GAHaP,GAA2BC,GAAOM,EAAY,KAAK,CAAC,EAIjE,WAAY,CAAA,OAId,aAAMhB,EAAG,OAAM,EAAG,MAAK,EACjB,IAAIkB,GAAoB,6BAA6B,CAE/D,CACF,CAKA,MAAM,aAAcX,EAAc,CAChC,GAAI,CAACC,GAASD,CAAM,EAClB,MAAM,IAAIR,EAAuB,0BAA0B,EAG7D,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,GAAQ,KAAK,IACnB,IAAK,CACH,KAAMC,GAAW,KAAK,eACtB,KAAMK,EAAO,YAAW,EAAG,OAE9B,EAEKJ,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAIvC,GAFA,MAAMJ,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIE,EAAqBH,EAAS,OAAO,KAAO,2BAA2B,EAGnF,GAAIA,EAAS,KAAO,KAClB,MAAM,IAAIe,GAAoB,kBAAkB,EAGlD,OAAOf,EAAS,IAAI,KACtB,GCpQI,IAAOgB,GAAP,KAAa,CACA,OAEjB,YAAaC,EAAoB,CAC/B,KAAK,OAASA,CAChB,CAOA,MAAM,WAAS,CACb,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,GAAQ,KAAK,OACnB,OAAQ,CACN,KAAMC,GAAU,KAAK,YAExB,EAEKC,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAIvC,GAFA,MAAMJ,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIC,EAAqBF,EAAS,OAAO,KAAO,0BAA0B,EAGlF,GAAIA,EAAS,QAAQ,QAAU,KAC7B,MAAM,IAAIE,EAAqB,kBAAkB,EAGnD,OAAOF,EAAS,OAAO,MACzB,CAKA,MAAM,QAASG,EAAeC,EAAgB,CAC5C,GAAI,OAAOD,GAAU,SACnB,MAAM,IAAIE,EAAuB,wBAAwB,EAG3D,GAAI,EAAED,aAAgB,YACpB,MAAM,IAAIC,EAAuB,mCAAmC,EAGtE,IAAMR,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,GAAQ,KAAK,OACnB,OAAQ,CACN,KAAMC,GAAU,KAAK,QACrB,MAAAI,EACA,KAAAC,GAEH,EAEKJ,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAIvC,GAFA,MAAMJ,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIC,EAAqBF,EAAS,OAAO,KAAO,uBAAuB,CAEjF,CAKA,MAAM,UAAWG,EAAa,CAC5B,GAAI,OAAOA,GAAU,SACnB,MAAM,IAAIE,EAAuB,wBAAwB,EAG3D,IAAMR,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,GAAQ,KAAK,OACnB,OAAQ,CACN,KAAMC,GAAU,KAAK,UACrB,MAAAI,GAEH,EAEKH,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAEvC,GAAID,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIC,EAAqBF,EAAS,OAAO,KAAO,uBAAuB,EAG/E,IAAIM,EAAa,GAcjB,MAZmC,CACjC,MAAQ,UAAQ,CACd,KAAOA,GACL,MAAM,MAAMT,EAAG,KAAKU,EAAS,CAEjC,EACA,MAAM,QAAM,CACVD,EAAa,GACb,MAAMT,EAAG,OAAM,EAAG,MAAK,CACzB,EAIJ,CAEA,MAAM,eAAgBM,EAAa,CACjC,GAAI,OAAOA,GAAU,SACnB,MAAM,IAAIE,EAAuB,wBAAwB,EAG3D,IAAMR,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,GAAQ,KAAK,OACnB,OAAQ,CACN,KAAMC,GAAU,KAAK,WACrB,MAAAI,GAEH,EAEKH,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAIvC,GAFA,MAAMJ,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIC,EAAqBF,EAAS,OAAO,KAAO,+BAA+B,EAGvF,GAAIA,EAAS,QAAQ,QAAU,KAC7B,MAAM,IAAIE,EAAqB,kBAAkB,EAGnD,OAAOF,EAAS,OAAO,QAAQ,IAAIQ,GAAOC,GAA2BC,GAAOF,CAAG,CAAC,CAAC,CACnF,G5H7HF,IAAMG,GAAMC,GAAO,sBAAsB,EAE5BC,EAAP,cAAoC,KAAK,CAC7C,YAAaC,EAAU,mBAAkB,CACvC,MAAMA,CAAO,EACb,KAAK,KAAO,sBACd,GAGIC,GAAN,KAAY,CACO,UACV,IACA,OACU,IAEjB,YAAaC,EAAe,CAC1B,KAAK,UAAYA,EACjB,KAAK,IAAMC,GAAG,EAAG,CACf,OAAQC,GAAa,EACtB,EACD,KAAK,IAAM,IAAIC,GAAI,IAAI,EACvB,KAAK,OAAS,IAAIC,GAAO,IAAI,CAC/B,CASA,MAAM,cAAeC,EAAoB,CAGvC,OAAO,KAAK,IAAI,KAAK,KAAK,UAAW,CACnC,SAAU,IAAIC,GACd,OAAQD,GAAU,YAAY,QAAQ,GAAM,EAC7C,CACH,CAMA,MAAM,KAAME,EAAgB,CAC1B,IAAMC,EAAS,MAAM,KAAK,cAAa,EAEjCC,EAAUF,EAAQ,QAAQ,MAAQA,EAAQ,KAAK,MAAQA,EAAQ,WAAW,MAAQ,GACxFZ,GAAI,OAAQY,EAAQ,KAAME,CAAO,EAEjC,IAAMC,EAAKC,GAASH,CAAM,EAC1B,aAAME,EAAG,MAAMH,EAASK,EAAO,EAExBF,CACT,CAKA,MAAM,QAASG,EAAgBC,EAAkB,CAC/C,GAAI,CAACC,GAASF,CAAM,EAClB,MAAM,IAAIG,EAAuB,0BAA0B,EAG7D,GAAI,CAAC,MAAM,QAAQF,CAAK,EACtB,MAAM,IAAIE,EAAuB,oCAAoC,EAGvEF,EAAM,QAASd,GAAQ,CACrB,GAAI,CAACiB,GAAYjB,CAAI,EACnB,MAAM,IAAIgB,EAAuB,6CAA6C,CAElF,CAAC,EAED,IAAME,EAAK,MAAM,KAAK,KAAK,CACzB,KAAMN,GAAQ,KAAK,QACnB,QAAS,CACP,KAAMC,EAAO,YAAW,EAAG,MAC3B,MAAOC,EAAM,IAAKK,GAAMA,EAAE,KAAK,GAElC,EAEKC,EAAW,MAAMF,EAAG,KAAKG,CAAQ,EAEvC,GAAID,EAAS,OAASC,EAAS,KAAK,GAAI,CACtC,IAAMC,EAAcF,EAAS,OAAS,CAAE,IAAK,aAAa,EAC1D,MAAM,IAAIvB,EAAqByB,EAAY,KAAO,aAAa,CACjE,CAEA,MAAMJ,EAAG,OAAM,EAAG,MAAK,CACzB,CAWA,MAAM,UAAQ,CACZ,IAAMA,EAAK,MAAM,KAAK,KAAK,CACzB,KAAMN,GAAQ,KAAK,SACpB,EAEKQ,EAAW,MAAMF,EAAG,KAAKG,CAAQ,EAEvC,GAAID,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIxB,EAAqBuB,EAAS,OAAO,KAAO,iBAAiB,EAGzE,GAAIA,EAAS,UAAU,OAAS,KAC9B,MAAM,IAAIvB,EAAqB,kBAAkB,EAGnD,IAAMgB,EAASU,GAA2BC,GAAOJ,EAAS,UAAU,EAAE,CAAC,EACjEN,EAAQM,EAAS,SAAS,MAAM,IAAKD,GAAMM,GAAUN,CAAC,CAAC,EAE7D,aAAMD,EAAG,OAAM,EAAG,MAAK,EAEf,CAAE,OAAAL,EAAQ,MAAAC,CAAK,CACzB,CAKA,MAAM,WAAS,CACb,IAAMI,EAAK,MAAM,KAAK,KAAK,CACzB,KAAMN,GAAQ,KAAK,WACpB,EAEKQ,EAAW,MAAMF,EAAG,KAAKG,CAAQ,EAEvC,GAAID,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIxB,EAAqBuB,EAAS,OAAO,KAAO,mBAAmB,EAG3E,aAAMF,EAAG,OAAM,EAAG,MAAK,EAEhBE,EAAS,MAAM,IAAKM,GAASH,GAA2BC,GAAOE,EAAK,EAAE,CAAC,CAAC,CACjF,CAKA,MAAM,WAAYb,EAAgBc,EAAgB,CAChD,GAAI,CAACZ,GAASF,CAAM,EAClB,MAAM,IAAIG,EAAuB,0BAA0B,EAG7D,GAAI,OAAOW,GAAa,SACtB,MAAM,IAAIX,EAAuB,2BAA2B,EAG9D,IAAME,EAAK,MAAM,KAAK,KAAK,CACzB,KAAMN,GAAQ,KAAK,YACnB,WAAY,CACV,KAAMC,EAAO,YAAW,EAAG,MAC3B,MAAO,CAACc,CAAQ,GAEnB,EAEKP,EAAW,MAAMF,EAAG,KAAKG,CAAQ,EAEvC,GAAID,EAAS,OAASC,EAAS,KAAK,GAClC,YAAMH,EAAG,OAAM,EAAG,MAAK,EACjB,IAAIrB,EAAqBuB,EAAS,OAAO,KAAO,oBAAoB,EAG5E,OAAOF,EAAG,OAAM,CAClB,CAKA,MAAM,sBAAuBS,EAAkBC,EAA8B,CAC3E,GAAI,OAAOD,GAAa,SACtB,MAAM,IAAIX,EAAuB,2BAA2B,EAI9D,IAAMa,EAAW,KAAK,IAAI,eAAe,CACvC,SAAU,IAAIvB,GAAqBE,GAAU,CAC3C,KAAK,aAAamB,EAAUE,EAAUD,EAASpB,CAAM,CACvD,CAAC,EACF,EACD,MAAMqB,EAAS,OAAOJ,GAAU,sBAAsB,CAAC,EACvD,IAAMK,EAAUD,EAAS,SAAQ,EAAG,CAAC,EAErC,GAAIC,GAAW,KACb,MAAM,IAAIjC,EAAqB,0BAA0B,EAG3D,IAAMqB,EAAK,MAAM,KAAK,KAAK,CACzB,KAAMN,GAAQ,KAAK,eACnB,cAAe,CACb,KAAMkB,EAAQ,MACd,MAAO,CAACH,CAAQ,GAEnB,EAEKP,EAAW,MAAMF,EAAG,KAAKG,CAAQ,EAIvC,GAFA,MAAMH,EAAG,OAAM,EAAG,MAAK,EAEnBE,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIxB,EAAqBuB,EAAS,OAAO,KAAO,gCAAgC,CAE1F,CAEQ,aAAcO,EAAkBE,EAAoBD,EAAgCG,EAA+B,CACzH,QAAQ,QAAO,EACZ,KAAK,SAAW,CACf,IAAMb,EAAK,IAAIc,GAAc,CAC3B,OAAQD,EACT,EACKjC,EAAU,MAAMoB,EAAG,KAAI,EAE7B,GAAIpB,GAAW,KACb,MAAM,IAAID,EAAqB,qCAAqC,EAKtE,GAFiBoC,GAAW,OAAOnC,CAAO,EAE7B,QAAU6B,EACrB,MAAM,IAAI9B,EAAqB,oBAAoB,EAIrD,MAAM+B,EAAQV,EAAG,KAAI,CAAE,CACzB,CAAC,EACA,MAAMgB,GAAM,CACXH,EAAW,MAAMG,CAAG,CACtB,CAAC,EACA,QAAQ,IAAK,CACZH,EAAW,MAAK,EACb,MAAMG,GAAM,CACXvC,GAAI,MAAMuC,CAAG,CACf,CAAC,EACHL,EAAS,MAAK,EACX,MAAMK,GAAM,CACXvC,GAAI,MAAMuC,CAAG,CACf,CAAC,CACL,CAAC,CACL,GA6CI,SAAUC,GAAcV,EAAoB,CAChD,OAAO,IAAI1B,GAAO0B,CAAS,CAC7B",
6
- "names": ["index_exports", "__export", "OperationFailedError", "createClient", "import_node_buffer", "asUint8Array", "buf", "alloc", "size", "asUint8Array", "allocUnsafe", "N1", "N2", "N3", "N4", "N5", "N6", "N7", "MSB", "REST", "encodingLength", "value", "encodeUint8Array", "buf", "offset", "encodeUint8ArrayList", "decodeUint8Array", "b", "res", "decodeUint8ArrayList", "encode", "allocUnsafe", "decode", "f32", "f8b", "writeFloatLE", "val", "buf", "pos", "readFloatLE", "buf", "pos", "f8b", "f32", "f64", "d8b", "writeDoubleLE", "val", "buf", "pos", "readDoubleLE", "buf", "pos", "d8b", "f64", "MAX_SAFE_NUMBER_INTEGER", "MIN_SAFE_NUMBER_INTEGER", "LongBits", "_LongBits", "lo", "hi", "unsigned", "mask", "part0", "part1", "part2", "value", "zero", "negative", "TWO_32", "sign", "length", "string", "len", "c", "i", "read", "buffer", "start", "end", "parts", "chunk", "t", "write", "offset", "c1", "c2", "indexOutOfRange", "reader", "writeLength", "readFixed32End", "buf", "end", "Uint8ArrayReader", "buffer", "value", "readFloatLE", "readDoubleLE", "length", "start", "bytes", "read", "wireType", "bits", "LongBits", "i", "lo", "hi", "decodeUint8Array", "encodingLength", "createReader", "decodeMessage", "buf", "codec", "opts", "reader", "createReader", "import_node_buffer", "base10_exports", "__export", "base10", "empty", "equals", "aa", "bb", "ii", "coerce", "o", "fromString", "str", "toString", "b", "base", "ALPHABET", "name", "BASE_MAP", "j", "i", "x", "xc", "BASE", "LEADER", "FACTOR", "iFACTOR", "encode", "source", "zeroes", "length", "pbegin", "pend", "size", "b58", "carry", "it1", "it2", "str", "decodeUnsafe", "psz", "b256", "it3", "it4", "vch", "decode", "string", "buffer", "src", "_brrp__multiformats_scope_baseX", "base_x_default", "Encoder", "name", "prefix", "baseEncode", "bytes", "Decoder", "baseDecode", "prefixCodePoint", "text", "decoder", "or", "ComposedDecoder", "decoders", "input", "left", "right", "Codec", "from", "encode", "decode", "baseX", "alphabet", "base_x_default", "coerce", "string", "alphabetIdx", "bitsPerChar", "end", "out", "bits", "buffer", "written", "i", "value", "data", "pad", "mask", "createAlphabetIdx", "rfc4648", "base10", "baseX", "base16_exports", "__export", "base16", "base16upper", "base16", "rfc4648", "base16upper", "base2_exports", "__export", "base2", "base2", "rfc4648", "base256emoji_exports", "__export", "base256emoji", "alphabet", "alphabetBytesToChars", "p", "c", "i", "alphabetCharsToBytes", "codePoint", "encode", "data", "decode", "str", "byts", "char", "byt", "base256emoji", "from", "base32_exports", "__export", "base32", "base32hex", "base32hexpad", "base32hexpadupper", "base32hexupper", "base32pad", "base32padupper", "base32upper", "base32z", "base32", "rfc4648", "base32upper", "base32pad", "base32padupper", "base32hex", "base32hexupper", "base32hexpad", "base32hexpadupper", "base32z", "base36_exports", "__export", "base36", "base36upper", "base36", "baseX", "base36upper", "base58_exports", "__export", "base58btc", "base58flickr", "base58btc", "baseX", "base58flickr", "base64_exports", "__export", "base64", "base64pad", "base64url", "base64urlpad", "base64", "rfc4648", "base64pad", "base64url", "base64urlpad", "base8_exports", "__export", "base8", "base8", "rfc4648", "identity_exports", "__export", "identity", "identity", "from", "buf", "toString", "str", "fromString", "textEncoder", "textDecoder", "identity_exports", "__export", "identity", "encode_1", "encode", "MSB", "REST", "MSBALL", "INT", "num", "out", "offset", "oldOffset", "decode", "read", "MSB$1", "REST$1", "buf", "res", "shift", "counter", "b", "l", "N1", "N2", "N3", "N4", "N5", "N6", "N7", "N8", "N9", "length", "value", "varint", "_brrp_varint", "varint_default", "decode", "data", "offset", "varint_default", "encodeTo", "int", "target", "encodingLength", "create", "code", "digest", "size", "sizeOffset", "encodingLength", "digestOffset", "bytes", "encodeTo", "Digest", "decode", "multihash", "coerce", "equals", "a", "b", "data", "code", "name", "encode", "coerce", "digest", "input", "options", "create", "identity", "sha2_exports", "__export", "sha256", "sha512", "import_crypto", "DEFAULT_MIN_DIGEST_LENGTH", "from", "name", "code", "encode", "minDigestLength", "maxDigestLength", "Hasher", "input", "options", "result", "createDigest", "digest", "truncate", "create", "sha256", "from", "input", "coerce", "crypto", "sha512", "format", "link", "base", "bytes", "version", "toStringV0", "baseCache", "base58btc", "toStringV1", "base32", "cache", "baseCache", "cid", "CID", "_CID", "version", "code", "multihash", "bytes", "DAG_PB_CODE", "SHA_256_CODE", "digest", "create", "other", "self", "unknown", "equals", "base", "format", "input", "value", "encodeCID", "cidSymbol", "decode", "remainder", "specs", "prefixSize", "multihashBytes", "coerce", "digestBytes", "Digest", "initialBytes", "offset", "next", "i", "length", "codec", "multihashCode", "digestSize", "size", "multihashSize", "source", "prefix", "parseCIDtoBytes", "decoder", "base58btc", "base32", "base36", "toStringV0", "toStringV1", "codeOffset", "encodingLength", "hashOffset", "encodeTo", "bases", "identity_exports", "base2_exports", "base8_exports", "base10_exports", "base16_exports", "base32_exports", "base36_exports", "base58_exports", "base64_exports", "base256emoji_exports", "hashes", "sha2_exports", "createCodec", "name", "prefix", "encode", "decode", "string", "buf", "str", "ascii", "i", "allocUnsafe", "BASES", "bases", "bases_default", "fromString", "string", "encoding", "base", "bases_default", "asUint8Array", "pool", "size", "SIZE", "MAX", "slab", "offset", "allocUnsafe", "buf", "Op", "fn", "len", "val", "noop", "State", "writer", "bufferPool", "pool", "alloc", "size", "allocUnsafe", "Uint8ArrayWriter", "value", "VarintOp", "writeVarint64", "LongBits", "bits", "encodeUint8Array", "encodingLength", "writeByte", "writeFixed32", "writeFloatLE", "writeDoubleLE", "writeBytes", "length", "write", "head", "tail", "buf", "pos", "writeVarint32", "writeBytesBuffer", "writeStringBuffer", "fromString", "createWriter", "encodeMessage", "message", "codec", "w", "createWriter", "CODEC_TYPES", "createCodec", "name", "type", "encode", "decode", "enumeration", "v", "findValue", "val", "encode", "writer", "enumValue", "decode", "reader", "createCodec", "CODEC_TYPES", "message", "encode", "decode", "createCodec", "CODEC_TYPES", "Request", "Type", "__TypeValues", "enumeration", "_codec", "message", "obj", "w", "opts", "ConnectRequest", "StreamOpenRequest", "StreamHandlerRequest", "DHTRequest", "ConnManagerRequest", "DisconnectRequest", "PSRequest", "PeerstoreRequest", "reader", "length", "end", "tag", "encodeMessage", "buf", "decodeMessage", "Response", "ErrorResponse", "StreamInfo", "IdentifyResponse", "DHTResponse", "value", "PeerInfo", "PSResponse", "PeerstoreResponse", "PSMessage", "import_node_tty", "import_node_util", "ms", "value", "options", "parse", "fmtLong", "fmtShort", "error", "message", "isError", "str", "match", "n", "type", "dist_default", "msAbs", "plural", "name", "isPlural", "import_node_process", "import_node_os", "import_node_tty", "hasFlag", "flag", "argv", "process", "prefix", "position", "terminatorPosition", "env", "flagForceColor", "envForceColor", "translateLevel", "level", "_supportsColor", "haveStream", "streamIsTTY", "sniffFlags", "noFlagForceColor", "forceColor", "min", "osRelease", "os", "sign", "version", "createSupportsColor", "stream", "options", "supportsColor", "tty", "supports_color_default", "setup", "env", "createDebug", "coerce", "disable", "enable", "enabled", "dist_default", "destroy", "key", "selectColor", "namespace", "hash", "i", "prevTime", "enableOverride", "namespacesCache", "enabledCache", "debug", "args", "self", "curr", "ms", "index", "match", "format", "formatter", "val", "extend", "v", "delimiter", "newDebug", "namespaces", "split", "len", "toNamespace", "name", "regexp", "colors", "supports_color_default", "inspectOpts", "key", "obj", "prop", "_", "k", "val", "useColors", "tty", "formatArgs", "args", "name", "c", "colorCode", "prefix", "dist_default", "getDate", "log", "util", "save", "namespaces", "load", "init", "debug", "keys", "i", "setupFormatters", "formatters", "v", "str", "node_default", "setup", "src_default", "node_default", "src_default", "v", "base58btc", "base32", "base64", "notEmpty", "createDisabledLogger", "namespace", "logger", "defaultLogger", "name", "logger", "trace", "createDisabledLogger", "src_default", "r", "n", "notEmpty", "str", "pDefer", "deferred", "resolve", "reject", "AbortError", "message", "code", "name", "raceSignal", "promise", "signal", "opts", "listener", "error", "resolve", "reject", "QueuelessPushable", "pDefer", "nextResult", "err", "result", "value", "options", "raceSignal", "queuelessPushable", "import_node_buffer", "concat", "arrays", "length", "asUint8Array", "equals", "a", "b", "i", "symbol", "findBufAndOffset", "bufs", "index", "offset", "buf", "bufEnd", "isUint8ArrayList", "value", "Uint8ArrayList", "_Uint8ArrayList", "data", "length", "res", "i", "bytes", "beginInclusive", "endExclusive", "concat", "list", "bufStart", "sliceStartInBuf", "sliceEndsInBuf", "start", "search", "needle", "M", "radix", "rightmostPositions", "c", "j", "right", "lastIndex", "lastPatIndex", "skip", "char", "byteOffset", "allocUnsafe", "littleEndian", "alloc", "other", "equals", "acc", "curr", "UnexpectedEOFError", "byteStream", "duplex", "opts", "write", "queuelessPushable", "err", "source", "buf", "readBuffer", "Uint8ArrayList", "options", "done", "value", "raceSignal", "UnexpectedEOFError", "data", "originalStream", "InvalidMessageLengthError", "InvalidDataLengthError", "InvalidDataLengthLengthError", "lpStream", "duplex", "opts", "bytes", "byteStream", "encodingLength", "decodeLength", "decode", "encodeLength", "encode", "options", "dataLength", "lengthBuffer", "Uint8ArrayList", "err", "InvalidMessageLengthError", "InvalidDataLengthLengthError", "InvalidDataLengthError", "data", "list", "buf", "log", "logger", "StreamHandler", "opts", "stream", "maxLength", "lpStream", "err", "msg", "anySignal", "signals", "controller", "onAbort", "signal", "clear", "PassThroughUpgrader", "handler", "maConn", "signal", "anySignal", "peerIdSymbol", "isPeerId", "other", "transportSymbol", "FaultTolerance", "AbortError", "message", "InvalidParametersError", "message", "InvalidPublicKeyError", "InvalidMultihashError", "message", "InvalidMessageError", "message", "ProtocolError", "TimeoutError", "NotStartedError", "AlreadyStartedError", "UnsupportedKeyTypeError", "message", "import_node_events", "setMaxListeners", "n", "eventTargets", "nodeSetMaxListeners", "TypedEventEmitter", "#listeners", "setMaxListeners", "type", "listeners", "listener", "options", "list", "callback", "event", "result", "once", "detail", "serviceCapabilities", "serviceDependencies", "import_node_buffer", "toString", "array", "encoding", "base", "bases_default", "TAG_MASK", "LONG_LENGTH_MASK", "LONG_LENGTH_BYTES_MASK", "decoders", "readSequence", "readInteger", "readBitString", "readOctetString", "readNull", "readObjectIdentifier", "decodeDer", "buf", "context", "tag", "readLength", "length", "count", "str", "entries", "result", "start", "end", "vals", "i", "finalOffset", "byte", "val1", "val2", "oid", "num", "val", "unusedBits", "bytes", "encodeNumber", "value", "number", "array", "Uint8ArrayList", "encodeLength", "encodeInteger", "contents", "mask", "encodeBitString", "encodeSequence", "values", "tag", "output", "Uint8ArrayList", "buf", "encodeLength", "hashAndVerify", "key", "sig", "msg", "options", "publicKey", "result", "OID_256", "OID_384", "OID_521", "P_256_KEY_JWK", "P_384_KEY_JWK", "P_521_KEY_JWK", "P_256_KEY_LENGTH", "P_384_KEY_LENGTH", "P_521_KEY_LENGTH", "unmarshalECDSAPublicKey", "bytes", "message", "decodeDer", "pkiMessageToECDSAPublicKey", "coordinates", "offset", "x", "y", "P_256_KEY_LENGTH", "toString", "ECDSAPublicKey", "P_256_KEY_JWK", "P_384_KEY_LENGTH", "P_384_KEY_JWK", "P_521_KEY_LENGTH", "P_521_KEY_JWK", "InvalidParametersError", "publicKeyToPKIMessage", "publicKey", "encodeSequence", "encodeInteger", "getOID", "encodeBitString", "Uint8ArrayList", "fromString", "curve", "OID_256", "OID_384", "OID_521", "InvalidParametersError", "ECDSAPublicKey", "jwk", "publicKeyToPKIMessage", "identity", "publicKeyToProtobuf", "CID", "base58btc", "key", "equals", "data", "sig", "options", "hashAndVerify", "import_crypto", "keypair", "crypto", "PUBLIC_KEY_BYTE_LENGTH", "SIGNATURE_BYTE_LENGTH", "hashAndVerify", "key", "sig", "msg", "PUBLIC_KEY_BYTE_LENGTH", "SIGNATURE_BYTE_LENGTH", "obj", "crypto", "toString", "isPromise", "thing", "Ed25519PublicKey", "key", "ensureEd25519Key", "PUBLIC_KEY_BYTE_LENGTH", "identity", "publicKeyToProtobuf", "CID", "base58btc", "equals", "data", "sig", "options", "result", "hashAndVerify", "isPromise", "res", "unmarshalEd25519PublicKey", "bytes", "ensureEd25519Key", "PUBLIC_KEY_BYTE_LENGTH", "Ed25519PublicKey", "ensureEd25519Key", "key", "length", "InvalidParametersError", "KeyType", "__KeyTypeValues", "enumeration", "PublicKey", "_codec", "message", "obj", "w", "opts", "reader", "length", "end", "tag", "encodeMessage", "buf", "decodeMessage", "PrivateKey", "nc", "crypto", "isBytes", "a", "anumber", "n", "abytes", "b", "lengths", "ahash", "h", "aexists", "instance", "checkFinished", "aoutput", "out", "min", "clean", "arrays", "i", "createView", "arr", "rotr", "word", "shift", "hasHexBuiltin", "hexes", "_", "i", "bytesToHex", "bytes", "abytes", "hex", "asciis", "asciiToBase16", "ch", "hexToBytes", "hl", "al", "array", "ai", "hi", "n1", "n2", "char", "utf8ToBytes", "str", "toBytes", "data", "utf8ToBytes", "abytes", "concatBytes", "arrays", "sum", "i", "a", "abytes", "res", "pad", "Hash", "createHasher", "hashCons", "hashC", "msg", "toBytes", "tmp", "randomBytes", "bytesLength", "crypto", "setBigUint64", "view", "byteOffset", "value", "isLE", "_32n", "_u32_max", "wh", "wl", "h", "l", "Chi", "a", "b", "c", "Maj", "HashMD", "Hash", "blockLen", "outputLen", "padOffset", "createView", "data", "aexists", "toBytes", "abytes", "buffer", "len", "pos", "take", "dataView", "out", "aoutput", "clean", "i", "oview", "outLen", "state", "res", "to", "length", "finished", "destroyed", "SHA256_IV", "SHA256_K", "SHA256_W", "SHA256", "HashMD", "outputLen", "SHA256_IV", "A", "B", "C", "D", "E", "F", "G", "H", "view", "offset", "i", "W15", "W2", "s0", "rotr", "s1", "sigma1", "T1", "Chi", "T2", "Maj", "clean", "sha256", "createHasher", "SHA256", "import_node_crypto", "HMAC", "Hash", "hash", "_key", "ahash", "key", "toBytes", "blockLen", "pad", "i", "clean", "buf", "aexists", "out", "abytes", "to", "oHash", "iHash", "finished", "destroyed", "outputLen", "hmac", "message", "_0n", "_1n", "_abool2", "value", "title", "prefix", "_abytes2", "length", "bytes", "isBytes", "len", "needsLen", "ofLen", "got", "numberToHexUnpadded", "num", "hex", "hexToNumber", "_0n", "bytesToNumberBE", "bytesToHex", "bytesToNumberLE", "abytes", "numberToBytesBE", "n", "hexToBytes", "numberToBytesLE", "ensureBytes", "title", "hex", "expectedLength", "res", "hexToBytes", "e", "isBytes", "len", "isPosBig", "n", "_0n", "inRange", "min", "max", "aInRange", "title", "bitLen", "len", "_1n", "bitMask", "n", "_1n", "createHmacDrbg", "hashLen", "qByteLen", "hmacFn", "u8n", "len", "u8of", "byte", "v", "k", "i", "reset", "h", "b", "reseed", "seed", "gen", "out", "sl", "concatBytes", "pred", "res", "_validateObject", "object", "fields", "optFields", "checkField", "fieldName", "expectedType", "isOpt", "val", "current", "k", "v", "memoized", "fn", "map", "arg", "args", "val", "computed", "_0n", "_1n", "_2n", "_3n", "_4n", "_5n", "_7n", "_8n", "_9n", "_16n", "mod", "a", "b", "result", "pow2", "x", "power", "modulo", "res", "_0n", "invert", "number", "a", "mod", "b", "y", "_1n", "u", "v", "q", "r", "m", "n", "assertIsSquare", "Fp", "root", "sqrt3mod4", "p1div4", "_4n", "sqrt5mod8", "p5div8", "_5n", "_8n", "n2", "_2n", "nv", "i", "sqrt9mod16", "P", "Fp_", "Field", "tn", "tonelliShanks", "c1", "c2", "c3", "c4", "_7n", "_16n", "tv1", "tv2", "tv3", "tv4", "e1", "e2", "e3", "_3n", "Q", "S", "Z", "_Fp", "FpLegendre", "cc", "Q1div2", "M", "c", "t", "R", "t_tmp", "exponent", "FpSqrt", "_9n", "FIELD_FIELDS", "validateField", "field", "initial", "opts", "map", "val", "_validateObject", "FpPow", "Fp", "num", "power", "_0n", "_1n", "p", "d", "FpInvertBatch", "nums", "passZero", "inverted", "multipliedAcc", "acc", "i", "invertedAcc", "FpLegendre", "Fp", "n", "p1mod2", "_1n", "_2n", "powered", "yes", "zero", "no", "nLength", "n", "nBitLength", "anumber", "_nBitLength", "nByteLength", "Field", "ORDER", "bitLenOrOpts", "isLE", "opts", "_0n", "_nbitLength", "_sqrt", "modFromBytes", "allowedLengths", "_opts", "BITS", "BYTES", "sqrtP", "f", "bitMask", "_1n", "num", "mod", "lhs", "rhs", "power", "FpPow", "invert", "FpSqrt", "numberToBytesLE", "numberToBytesBE", "bytes", "skipValidation", "padded", "scalar", "bytesToNumberLE", "bytesToNumberBE", "lst", "FpInvertBatch", "a", "b", "c", "getFieldBytesLength", "fieldOrder", "bitLength", "getMinHashLength", "length", "mapHashToField", "key", "isLE", "len", "fieldLen", "minLen", "num", "bytesToNumberLE", "bytesToNumberBE", "reduced", "mod", "_1n", "numberToBytesLE", "numberToBytesBE", "_0n", "_1n", "negateCt", "condition", "item", "neg", "normalizeZ", "c", "points", "invertedZs", "FpInvertBatch", "p", "i", "validateW", "W", "bits", "calcWOpts", "scalarBits", "windows", "windowSize", "maxNumber", "mask", "bitMask", "shiftBy", "calcOffsets", "n", "window", "wOpts", "wbits", "nextN", "offsetStart", "offset", "isZero", "isNeg", "isNegF", "validateMSMPoints", "validateMSMScalars", "scalars", "field", "s", "pointPrecomputes", "pointWindowSizes", "getW", "P", "assert0", "wNAF", "Point", "elm", "d", "point", "base", "precomputes", "f", "wo", "offsetF", "acc", "transform", "comp", "scalar", "prev", "mulEndoUnsafe", "k1", "k2", "p1", "p2", "pippenger", "fieldN", "plength", "slength", "zero", "bitLen", "MASK", "buckets", "lastBits", "sum", "j", "resI", "sumI", "createField", "order", "field", "isLE", "validateField", "Field", "_createCurveFields", "type", "CURVE", "curveOpts", "FpFnLE", "p", "val", "_0n", "Fp", "Fn", "params", "divNearest", "num", "den", "_2n", "_splitEndoScalar", "k", "basis", "n", "a1", "b1", "a2", "b2", "c1", "c2", "k1", "k2", "k1neg", "_0n", "k2neg", "MAX_NUM", "bitMask", "bitLen", "_1n", "validateSigFormat", "format", "validateSigOpts", "opts", "def", "optsn", "optName", "_abool2", "DERErr", "m", "DER", "tag", "data", "E", "dataLen", "len", "numberToHexUnpadded", "lenLen", "pos", "first", "isLong", "length", "lengthBytes", "b", "v", "hex", "bytesToNumberBE", "int", "tlv", "ensureBytes", "seqBytes", "seqLeftBytes", "rBytes", "rLeftBytes", "sBytes", "sLeftBytes", "sig", "rs", "ss", "seq", "_3n", "_4n", "_normFnElement", "Fn", "key", "expected", "bytes", "weierstrassN", "params", "extraOpts", "validated", "_createCurveFields", "Fp", "CURVE", "cofactor", "CURVE_ORDER", "_validateObject", "endo", "lengths", "getWLengths", "assertCompressionIsSupported", "pointToBytes", "_c", "point", "isCompressed", "x", "y", "bx", "hasEvenY", "concatBytes", "pprefix", "pointFromBytes", "_abytes2", "comp", "uncomp", "head", "tail", "y2", "weierstrassEquation", "sqrtError", "err", "isYOdd", "L", "isValidXY", "encodePoint", "decodePoint", "x2", "x3", "left", "right", "_4a3", "_27b2", "acoord", "title", "banZero", "aprjpoint", "other", "Point", "splitEndoScalarN", "toAffineMemo", "memoized", "p", "iz", "X", "Y", "Z", "is0", "zz", "assertValidMemo", "finishEndo", "endoBeta", "k1p", "k2p", "negateCt", "P", "windowSize", "isLazy", "wnaf", "X1", "Y1", "Z1", "X2", "Y2", "Z2", "U1", "U2", "a", "b3", "X3", "Y3", "Z3", "t0", "t1", "t2", "t3", "t4", "t5", "scalar", "fake", "mul", "normalizeZ", "k1f", "k2f", "f", "sc", "p1", "p2", "mulEndoUnsafe", "Q", "sum", "invertedZ", "isTorsionFree", "clearCofactor", "bytesToHex", "points", "scalars", "pippenger", "privateKey", "bits", "wNAF", "getWLengths", "Fp", "Fn", "ecdh", "Point", "ecdhOpts", "randomBytes_", "randomBytes", "lengths", "getMinHashLength", "isValidSecretKey", "secretKey", "_normFnElement", "isValidPublicKey", "publicKey", "isCompressed", "comp", "publicKeyUncompressed", "l", "randomSecretKey", "seed", "mapHashToField", "_abytes2", "getPublicKey", "keygen", "isProbPub", "item", "ensureBytes", "getSharedSecret", "secretKeyA", "publicKeyB", "s", "key", "windowSize", "point", "ecdsa", "hash", "ecdsaOpts", "ahash", "_validateObject", "hmac", "msgs", "concatBytes", "CURVE_ORDER", "fnBits", "utils", "defaultSigOpts", "defaultSigOpts_format", "isBiggerThanHalfOrder", "number", "HALF", "_1n", "validateRS", "title", "num", "validateSigLength", "bytes", "format", "validateSigFormat", "size", "sizer", "Signature", "r", "recovery", "recid", "DER", "L", "hex", "hexToBytes", "messageHash", "FIELD_ORDER", "rec", "_2n", "radj", "x", "R", "pprefix", "ir", "h", "bits2int_modN", "u1", "u2", "Q", "bytesToHex", "bits2int", "bytesToNumberBE", "delta", "ORDER_MASK", "bitMask", "int2octets", "aInRange", "_0n", "validateMsgAndHash", "message", "prehash", "prepSig", "privateKey", "opts", "k", "lowS", "extraEntropy", "validateSigOpts", "h1int", "d", "seedArgs", "e", "m", "k2sig", "kBytes", "ik", "q", "normS", "sign", "createHmacDrbg", "tryParsingSig", "sg", "sig", "isHex", "isBytes", "isObj", "derError", "verify", "signature", "P", "is", "recoverPublicKey", "_weierstrass_legacy_opts_to_new", "c", "CURVE", "Fp", "allowedLengths", "l", "Fn", "Field", "curveOpts", "_ecdsa_legacy_opts_to_new", "ecdsaOpts", "_ecdsa_new_output_to_legacy", "c", "_ecdsa", "Point", "nLength", "weierstrass", "CURVE", "curveOpts", "hash", "ecdsaOpts", "_ecdsa_legacy_opts_to_new", "weierstrassN", "signs", "ecdsa", "createCurve", "curveDef", "defHash", "create", "hash", "weierstrass", "secp256k1_CURVE", "secp256k1_ENDO", "_2n", "sqrtMod", "y", "P", "secp256k1_CURVE", "_3n", "_6n", "_11n", "_22n", "_23n", "_44n", "_88n", "b2", "b3", "b6", "pow2", "b9", "b11", "b22", "b44", "b88", "b176", "b220", "b223", "t1", "t2", "root", "Fpk1", "Field", "secp256k1", "createCurve", "secp256k1_ENDO", "sha256", "VerificationError", "message", "hashAndVerify", "key", "sig", "msg", "options", "hash", "crypto", "buf", "digest", "secp256k1", "err", "VerificationError", "Secp256k1PublicKey", "key", "validateSecp256k1PublicKey", "compressSecp256k1PublicKey", "identity", "publicKeyToProtobuf", "CID", "base58btc", "equals", "data", "sig", "options", "hashAndVerify", "unmarshalSecp256k1PublicKey", "bytes", "Secp256k1PublicKey", "compressSecp256k1PublicKey", "key", "secp256k1", "validateSecp256k1PublicKey", "key", "secp256k1", "err", "InvalidPublicKeyError", "publicKeyFromMultihash", "digest", "Type", "Data", "PublicKey", "data", "KeyType", "unmarshalEd25519PublicKey", "unmarshalSecp256k1PublicKey", "unmarshalECDSAPublicKey", "UnsupportedKeyTypeError", "publicKeyToProtobuf", "key", "inspect", "LIBP2P_KEY_CODE", "PeerIdImpl", "init", "peerIdSymbol", "base58btc", "CID", "id", "equals", "RSAPeerId", "Ed25519PeerId", "Secp256k1PeerId", "TRANSPORT_IPFS_GATEWAY_HTTP_CODE", "URLPeerId", "url", "identity", "fromString", "other", "toString", "peerIdFromMultihash", "multihash", "isSha256Multihash", "RSAPeerId", "isIdentityMultihash", "publicKey", "publicKeyFromMultihash", "Ed25519PeerId", "Secp256k1PeerId", "url", "toString", "URLPeerId", "InvalidMultihashError", "isIdentityMultihash", "multihash", "identity", "isSha256Multihash", "sha256", "import_net", "InvalidMultiaddrError", "ValidationError", "InvalidParametersError", "UnknownProtocolError", "import_node_net", "bytesToString", "base", "buf", "toString", "stringToBytes", "fromString", "bytes2port", "port2bytes", "port", "onion2bytes", "str", "addr", "portBuf", "concat", "onion32bytes", "base32", "bytes2onion", "addrBytes", "portBytes", "ip4ToBytes", "ip", "bytes", "byte", "index", "value", "InvalidMultiaddrError", "ip6ToBytes", "offset", "sections", "i", "isv4", "v4Buffer", "argv", "word", "ip4ToString", "result", "ip6ToString", "byte1", "byte2", "tuple", "url", "ip6StringToValue", "decoders", "bases", "c", "anybaseDecoder", "acc", "d", "mb2bytes", "mbstr", "bytes2mb", "integer", "value", "ValidationError", "positive", "maxValue", "max", "validate", "funcs", "fn", "validatePort", "V", "Registry", "key", "codec", "UnknownProtocolError", "alias", "code", "registry", "codecs", "ip4ToBytes", "ip4ToString", "value", "ValidationError", "port2bytes", "bytes2port", "validatePort", "ip6ToBytes", "ip6ToString", "ip6StringToValue", "bytesToString", "stringToBytes", "str", "val", "CID", "bytes2onion", "onion2bytes", "onion32bytes", "bytes2mb", "base64url", "mb2bytes", "bytesToComponents", "bytes", "components", "i", "code", "decode", "codec", "registry", "codeLength", "encodingLength", "size", "sizeForAddr", "sizeLength", "V", "componentLength", "component", "valueOffset", "valueBytes", "toString", "componentsToBytes", "length", "codecLength", "valueLength", "valueLengthLength", "fromString", "offset", "encodeUint8Array", "concat", "stringToComponents", "string", "InvalidMultiaddrError", "collecting", "value", "protocol", "char", "ended", "componentsToString", "inspect", "symbol", "DNS_CODES", "NoAvailableResolverError", "message", "toComponents", "addr", "isMultiaddr", "bytesToComponents", "stringToComponents", "InvalidMultiaddrError", "Multiaddr", "_Multiaddr", "#components", "#string", "#bytes", "options", "validate", "componentsToBytes", "componentsToString", "family", "transport", "host", "port", "zone", "code", "name", "value", "codec", "registry", "output", "fromString", "ma", "addrString", "s", "i", "InvalidParametersError", "index", "tuples", "tuple", "peerIdStr", "toString", "base58btc", "CID", "component", "equals", "resolvableProto", "p", "resolver", "resolvers", "str", "multiaddr", "Parser", "input", "fn", "index", "result", "target", "char", "sep", "inner", "radix", "maxDigits", "allowZeroPrefix", "maxBytes", "digitCount", "leadingChar", "hasLeadingZero", "maxValue", "digit", "num", "out", "i", "ix", "readGroups", "groups", "ipv4", "group", "head", "headSize", "headIp4", "tail", "limit", "tailSize", "parser", "Parser", "maxIPv6Octet", "ipv4Prefix", "resolvers", "isMultiaddr", "value", "symbol", "multiaddr", "addr", "Multiaddr", "code", "vals", "component", "value", "optional", "matcher", "result", "or", "matchers", "matches", "and", "fmt", "match", "ma", "parts", "exactMatch", "_PEER_ID", "value", "PEER_ID", "fmt", "_DNS4", "_DNS6", "_DNSADDR", "_DNS", "DNS4", "optional", "DNS6", "DNSADDR", "DNS", "or", "_IP4", "and", "_IP6", "_IP", "_IP_OR_DOMAIN", "IP_OR_DOMAIN", "IP4", "IP6", "IP", "_TCP", "_UDP", "TCP", "UDP", "_QUIC", "code", "_QUIC_V1", "QUIC_V0_OR_V1", "QUIC", "QUIC_V1", "_WEB", "_WebSockets", "WebSockets", "_WebSocketsSecure", "WebSocketsSecure", "_WebRTCDirect", "WebRTCDirect", "_WebTransport", "WebTransport", "_P2P", "P2P", "_Circuit", "Circuit", "_WebRTC", "WebRTC", "_HTTP", "HTTP", "_HTTPS", "HTTPS", "_Memory", "Memory", "_Unix", "Unix", "CustomProgressEvent", "type", "detail", "import_net", "import_node_os", "isLinkLocalIp", "ip", "FAMILIES", "isWildcard", "ip", "getNetworkAddrs", "family", "addresses", "networks", "os", "netAddrs", "netAddr", "isLinkLocalIp", "getThinWaistAddresses", "ma", "port", "options", "addrs", "host", "multiaddr", "TimeoutError", "message", "AbortError", "getDOMException", "errorMessage", "getAbortedReason", "signal", "reason", "pTimeout", "promise", "options", "milliseconds", "fallback", "customTimers", "timer", "abortHandler", "cancelablePromise", "resolve", "reject", "timeoutError", "error", "normalizeEmitter", "emitter", "addListener", "removeListener", "pEventMultiple", "event", "options", "cancel", "returnValue", "resolve", "reject", "events", "items", "onItem", "arguments_", "value", "rejectHandler", "error", "rejectionEvent", "timeout", "pTimeout", "pEvent", "arrayPromise", "promise", "array", "ipPortToMultiaddr", "ip", "port", "InvalidParametersError", "multiaddr", "AbortError", "message", "rest", "raceEvent", "emitter", "eventName", "signal", "opts", "error", "AbortError", "errorEvent", "resolve", "reject", "removeListeners", "removeListener", "abortListener", "eventListener", "errorEventListener", "evt", "err", "addListener", "event", "listener", "isEventTarget", "source", "readable", "isReadableStream", "reader", "done", "value", "isNodeStream", "obj", "sink", "writable", "source", "maybeEndSource", "isAsyncGenerator", "error", "errCb", "errorHandler", "err", "closeCb", "closed", "closeHandler", "finishCb", "finished", "finishHandler", "drainCb", "drainHandler", "waitForDrainOrClose", "resolve", "reject", "waitForDone", "cleanup", "value", "obj", "duplex", "sink", "source", "import_os", "import_path", "multiaddrToNetConfig", "addr", "config", "listenPath", "os", "path", "options", "toMultiaddrConnection", "socket", "options", "closePromise", "log", "direction", "metrics", "metricPrefix", "inactivityTimeout", "closeTimeout", "timedOut", "errored", "err", "maConn", "remoteAddr", "InvalidParametersError", "ipPortToMultiaddr", "lOpts", "multiaddrToNetConfig", "lOptsStr", "sink", "source", "duplex", "TimeoutError", "buf", "pDefer", "eventTarget", "socketToEventTarget", "signal", "raceEvent", "obj", "type", "cb", "TCPListenerStatusCode", "TCPListener", "TypedEventEmitter", "context", "setMaxListeners", "net", "InvalidParametersError", "address", "err", "socket", "NotStartedError", "maConn", "toMultiaddrConnection", "e", "multiaddr", "getThinWaistAddresses", "ma", "AlreadyStartedError", "multiaddrToNetConfig", "events", "pEvent", "netConfig", "resolve", "reject", "permanent", "TCP", "components", "options", "transportSymbol", "serviceCapabilities", "ma", "socket", "maConn", "toMultiaddrConnection", "err", "CustomProgressEvent", "rawSocket", "resolve", "reject", "start", "cOpts", "multiaddrToNetConfig", "net", "onError", "cOptsStr", "done", "onTimeout", "TimeoutError", "onConnect", "onAbort", "AbortError", "TCPListener", "multiaddrs", "tcp", "init", "components", "TCP", "pbStream", "duplex", "opts", "lp", "lpStream", "W", "proto", "options", "value", "message", "messages", "d", "log", "logger", "DHT", "client", "key", "value", "InvalidParametersError", "sh", "Request", "DHTRequest", "response", "Response", "ProtocolError", "OperationFailedError", "peerId", "isPeerId", "peerIdFromMultihash", "decode", "a", "multiaddr", "cid", "CID", "count", "dhtResponse", "DHTResponse", "InvalidMessageError", "Pubsub", "client", "sh", "Request", "PSRequest", "response", "Response", "OperationFailedError", "topic", "data", "InvalidParametersError", "subscribed", "PSMessage", "buf", "peerIdFromMultihash", "decode", "log", "logger", "OperationFailedError", "message", "Client", "addr", "tcp", "defaultLogger", "DHT", "Pubsub", "signal", "PassThroughUpgrader", "request", "maConn", "subtype", "pb", "pbStream", "Request", "peerId", "addrs", "isPeerId", "InvalidParametersError", "isMultiaddr", "sh", "a", "response", "Response", "errResponse", "peerIdFromMultihash", "decode", "multiaddr", "peer", "protocol", "handler", "listener", "address", "connection", "StreamHandler", "StreamInfo", "err", "createClient"]
3
+ "sources": ["../src/index.ts", "../../../node_modules/uint8arrays/src/alloc.node.ts", "../../../node_modules/uint8arrays/src/util/as-uint8array.node.ts", "../../../node_modules/uint8-varint/src/index.ts", "../../../node_modules/protons-runtime/src/utils/float.ts", "../../../node_modules/protons-runtime/src/utils/longbits.ts", "../../../node_modules/protons-runtime/src/utils/utf8.ts", "../../../node_modules/protons-runtime/src/utils/reader.ts", "../../../node_modules/protons-runtime/src/decode.ts", "../../../node_modules/uint8arrays/src/from-string.node.ts", "../../../node_modules/multiformats/src/bases/base10.ts", "../../../node_modules/multiformats/src/bytes.ts", "../../../node_modules/multiformats/src/vendor/base-x.js", "../../../node_modules/multiformats/src/bases/base.ts", "../../../node_modules/multiformats/src/bases/base16.ts", "../../../node_modules/multiformats/src/bases/base2.ts", "../../../node_modules/multiformats/src/bases/base256emoji.ts", "../../../node_modules/multiformats/src/bases/base32.ts", "../../../node_modules/multiformats/src/bases/base36.ts", "../../../node_modules/multiformats/src/bases/base58.ts", "../../../node_modules/multiformats/src/bases/base64.ts", "../../../node_modules/multiformats/src/bases/base8.ts", "../../../node_modules/multiformats/src/bases/identity.ts", "../../../node_modules/multiformats/src/codecs/json.ts", "../../../node_modules/multiformats/src/hashes/identity.ts", "../../../node_modules/multiformats/src/vendor/varint.js", "../../../node_modules/multiformats/src/varint.ts", "../../../node_modules/multiformats/src/hashes/digest.ts", "../../../node_modules/multiformats/src/hashes/sha2.ts", "../../../node_modules/multiformats/src/hashes/hasher.ts", "../../../node_modules/multiformats/src/cid.ts", "../../../node_modules/multiformats/src/basics.ts", "../../../node_modules/uint8arrays/src/util/bases.ts", "../../../node_modules/protons-runtime/src/utils/pool.ts", "../../../node_modules/protons-runtime/src/utils/writer.ts", "../../../node_modules/protons-runtime/src/encode.ts", "../../../node_modules/protons-runtime/src/codec.ts", "../../../node_modules/protons-runtime/src/codecs/enum.ts", "../../../node_modules/protons-runtime/src/codecs/message.ts", "../../libp2p-daemon-protocol/src/index.ts", "../../../node_modules/any-signal/src/index.ts", "../../libp2p-daemon-protocol/src/upgrader.ts", "../../interface/src/errors.ts", "../../interface/src/events.ts", "../../interface/src/peer-id.ts", "../../interface/src/transport.ts", "../../../node_modules/main-event/src/events.ts", "../../../node_modules/main-event/src/index.ts", "../../interface/src/index.ts", "../../../node_modules/weald/src/node.ts", "../../../node_modules/weald/node_modules/ms/src/index.ts", "../../../node_modules/weald/node_modules/supports-color/index.js", "../../../node_modules/weald/src/common.ts", "../../../node_modules/weald/src/index.ts", "../../logger/src/index.ts", "../../../node_modules/uint8arrays/src/equals.ts", "../../../node_modules/uint8arrays/src/concat.node.ts", "../../../node_modules/uint8arraylist/src/index.ts", "../../../node_modules/uint8arrays/src/to-string.node.ts", "../../crypto/src/keys/rsa/der.ts", "../../crypto/src/keys/ecdsa/index.ts", "../../crypto/src/keys/ecdsa/utils.ts", "../../crypto/src/keys/ecdsa/ecdsa.ts", "../../crypto/src/keys/ed25519/index.ts", "../../crypto/src/util.ts", "../../crypto/src/keys/ed25519/ed25519.ts", "../../crypto/src/keys/ed25519/utils.ts", "../../crypto/src/keys/keys.ts", "../../../node_modules/@noble/hashes/src/cryptoNode.ts", "../../../node_modules/@noble/hashes/src/utils.ts", "../../../node_modules/@noble/hashes/src/_md.ts", "../../../node_modules/@noble/hashes/src/sha2.ts", "../../crypto/src/keys/secp256k1/index.ts", "../../../node_modules/@noble/hashes/src/hmac.ts", "../../../node_modules/@noble/curves/src/utils.ts", "../../../node_modules/@noble/curves/src/abstract/modular.ts", "../../../node_modules/@noble/curves/src/abstract/curve.ts", "../../../node_modules/@noble/curves/src/abstract/weierstrass.ts", "../../../node_modules/@noble/curves/src/_shortw_utils.ts", "../../../node_modules/@noble/curves/src/secp256k1.ts", "../../crypto/src/errors.ts", "../../crypto/src/keys/secp256k1/secp256k1.ts", "../../crypto/src/keys/secp256k1/utils.ts", "../../crypto/src/keys/index.ts", "../../peer-id/src/peer-id.ts", "../../peer-id/src/index.ts", "../../transport-tcp/src/tcp.ts", "../../../node_modules/@multiformats/multiaddr/src/errors.ts", "../../../node_modules/@chainsafe/is-ip/src/is-ip.node.ts", "../../../node_modules/@multiformats/multiaddr/src/utils.ts", "../../../node_modules/@multiformats/multiaddr/src/validation.ts", "../../../node_modules/@multiformats/multiaddr/src/registry.ts", "../../../node_modules/@multiformats/multiaddr/src/components.ts", "../../../node_modules/@multiformats/multiaddr/src/multiaddr.ts", "../../../node_modules/@multiformats/multiaddr/src/index.ts", "../../../node_modules/@multiformats/multiaddr-matcher/src/utils.ts", "../../../node_modules/@multiformats/multiaddr-matcher/src/index.ts", "../../../node_modules/progress-events/src/index.ts", "../../transport-tcp/src/listener.ts", "../../utils/src/multiaddr/get-net-config.ts", "../../../node_modules/p-defer/index.js", "../../../node_modules/it-pushable/src/fifo.ts", "../../../node_modules/it-pushable/src/index.ts", "../../../node_modules/p-timeout/index.js", "../../../node_modules/p-event/index.js", "../../utils/src/errors.ts", "../../../node_modules/race-signal/src/index.ts", "../../utils/src/abstract-message-stream.ts", "../../utils/src/abstract-multiaddr-connection.ts", "../../utils/src/get-thin-waist-addresses.ts", "../../utils/src/link-local-ip.ts", "../../utils/src/multiaddr/utils.ts", "../../utils/src/ip-port-to-multiaddr.ts", "../../utils/src/stream-utils.ts", "../../transport-tcp/src/socket-to-conn.ts", "../../transport-tcp/src/utils.ts", "../../transport-tcp/src/index.ts", "../src/dht.ts", "../src/pubsub.ts"],
4
+ "sourcesContent": ["import { Request, Response, StreamInfo } from '@libp2p/daemon-protocol'\nimport { PassThroughUpgrader } from '@libp2p/daemon-protocol/upgrader'\nimport { InvalidParametersError, isPeerId } from '@libp2p/interface'\nimport { defaultLogger, logger } from '@libp2p/logger'\nimport { peerIdFromMultihash } from '@libp2p/peer-id'\nimport { tcp } from '@libp2p/tcp'\nimport { pbStream } from '@libp2p/utils'\nimport { multiaddr, isMultiaddr } from '@multiformats/multiaddr'\nimport * as Digest from 'multiformats/hashes/digest'\nimport { DHT } from './dht.js'\nimport { Pubsub } from './pubsub.js'\nimport type { PSMessage } from '@libp2p/daemon-protocol'\nimport type { Stream, PeerId, MultiaddrConnection, PeerInfo, Transport, Listener } from '@libp2p/interface'\nimport type { ProtobufStream } from '@libp2p/utils'\nimport type { Multiaddr } from '@multiformats/multiaddr'\nimport type { CID } from 'multiformats/cid'\n\nconst log = logger('libp2p:daemon-client')\n\nexport class OperationFailedError extends Error {\n constructor (message = 'Operation failed') {\n super(message)\n this.name = 'OperationFailedError'\n }\n}\n\nclass Client implements DaemonClient {\n private readonly multiaddr: Multiaddr\n public dht: DHT\n public pubsub: Pubsub\n private readonly tcp: Transport\n\n constructor (addr: Multiaddr) {\n this.multiaddr = addr\n this.tcp = tcp()({\n logger: defaultLogger()\n })\n this.dht = new DHT(this)\n this.pubsub = new Pubsub(this)\n }\n\n /**\n * Connects to a daemon at the unix socket path the daemon\n * was created with\n *\n * @async\n * @returns {MultiaddrConnection}\n */\n async connectDaemon (signal?: AbortSignal): Promise<MultiaddrConnection> {\n // @ts-expect-error because we use a passthrough upgrader,\n // this is actually a MultiaddrConnection and not a Connection\n return this.tcp.dial(this.multiaddr, {\n upgrader: new PassThroughUpgrader(),\n signal: signal ?? AbortSignal.timeout(10_000)\n })\n }\n\n /**\n * Sends the request to the daemon and returns a stream. This\n * should only be used when sending daemon requests.\n */\n async send (request: Request): Promise<ProtobufStream<MultiaddrConnection>> {\n const maConn = await this.connectDaemon()\n\n const subtype = request.pubsub?.type ?? request.dht?.type ?? request.peerStore?.type ?? ''\n log('send', request.type, subtype)\n\n const pb = pbStream(maConn)\n await pb.write(request, Request)\n\n return pb\n }\n\n /**\n * Connect requests a connection to a known peer on a given set of addresses\n */\n async connect (peerId: PeerId, addrs: Multiaddr[]): Promise<void> {\n if (!isPeerId(peerId)) {\n throw new InvalidParametersError('invalid peer id received')\n }\n\n if (!Array.isArray(addrs)) {\n throw new InvalidParametersError('addrs received are not in an array')\n }\n\n addrs.forEach((addr) => {\n if (!isMultiaddr(addr)) {\n throw new InvalidParametersError('received an address that is not a multiaddr')\n }\n })\n\n const sh = await this.send({\n type: Request.Type.CONNECT,\n connect: {\n peer: peerId.toMultihash().bytes,\n addrs: addrs.map((a) => a.bytes)\n }\n })\n\n const response = await sh.read(Response)\n\n log('%s response %s', Request.Type.CONNECT, response.type)\n\n if (response.type !== Response.Type.OK) {\n const errResponse = response.error ?? { msg: 'unspecified' }\n throw new OperationFailedError(errResponse.msg ?? 'unspecified')\n }\n\n await sh.unwrap().close()\n }\n\n /**\n * @typedef {object} IdentifyResponse\n * @property {PeerId} peerId\n * @property {Array.<multiaddr>} addrs\n */\n\n /**\n * Identify queries the daemon for its peer ID and listen addresses.\n */\n async identify (): Promise<IdentifyResult> {\n const sh = await this.send({\n type: Request.Type.IDENTIFY\n })\n\n const response = await sh.read(Response)\n\n log('%s response %s', Request.Type.IDENTIFY, response.type)\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'Identify failed')\n }\n\n if (response.identify?.addrs == null) {\n throw new OperationFailedError('Invalid response')\n }\n\n const peerId = peerIdFromMultihash(Digest.decode(response.identify?.id))\n const addrs = response.identify.addrs.map((a) => multiaddr(a))\n\n await sh.unwrap().close()\n\n return ({ peerId, addrs })\n }\n\n /**\n * Get a list of IDs of peers the node is connected to\n */\n async listPeers (): Promise<PeerId[]> {\n const sh = await this.send({\n type: Request.Type.LIST_PEERS\n })\n\n const response = await sh.read(Response)\n\n log('%s response %s', Request.Type.LIST_PEERS, response.type)\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'List peers failed')\n }\n\n await sh.unwrap().close()\n\n return response.peers.map((peer) => peerIdFromMultihash(Digest.decode(peer.id)))\n }\n\n /**\n * Initiate an outbound stream to a peer on one of a set of protocols.\n */\n async openStream (peerId: PeerId, protocol: string): Promise<MultiaddrConnection> {\n if (!isPeerId(peerId)) {\n throw new InvalidParametersError('invalid peer id received')\n }\n\n if (typeof protocol !== 'string') {\n throw new InvalidParametersError('invalid protocol received')\n }\n\n const sh = await this.send({\n type: Request.Type.STREAM_OPEN,\n streamOpen: {\n peer: peerId.toMultihash().bytes,\n proto: [protocol]\n }\n })\n\n const response = await sh.read(Response)\n\n log('%s response %s', Request.Type.STREAM_OPEN, response.type)\n\n if (response.type !== Response.Type.OK) {\n const err = new OperationFailedError(response.error?.msg ?? 'Open stream failed')\n sh.unwrap().abort(err)\n throw err\n }\n\n return sh.unwrap()\n }\n\n /**\n * Register a handler for inbound streams on a given protocol\n */\n async registerStreamHandler (protocol: string, handler: StreamHandlerFunction): Promise<void> {\n if (typeof protocol !== 'string') {\n throw new InvalidParametersError('invalid protocol received')\n }\n\n // open a tcp port, pipe any data from it to the handler function\n const listener = this.tcp.createListener({\n upgrader: new PassThroughUpgrader((maConn) => {\n this.onConnection(protocol, listener, handler, maConn)\n })\n })\n await listener.listen(multiaddr('/ip4/127.0.0.1/tcp/0'))\n const address = listener.getAddrs()[0]\n\n if (address == null) {\n throw new OperationFailedError('Could not listen on port')\n }\n\n const sh = await this.send({\n type: Request.Type.STREAM_HANDLER,\n streamHandler: {\n addr: address.bytes,\n proto: [protocol]\n }\n })\n\n const response = await sh.read(Response)\n\n log('%s response %s', Request.Type.STREAM_HANDLER, response.type)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'Register stream handler failed')\n }\n }\n\n private onConnection (protocol: string, listener: Listener, handler: StreamHandlerFunction, connection: MultiaddrConnection): void {\n Promise.resolve()\n .then(async () => {\n const pb = pbStream(connection).pb(StreamInfo)\n const message = await pb.read()\n\n if (message.proto !== protocol) {\n throw new OperationFailedError('Incorrect protocol')\n }\n\n // @ts-expect-error because we are using a passthrough upgrader, this is a MultiaddrConnection\n await handler(pb.unwrap().unwrap())\n })\n .catch(err => {\n connection.abort(err)\n })\n .finally(() => {\n connection.close()\n .catch(err => {\n log.error(err)\n })\n listener.close()\n .catch(err => {\n log.error(err)\n })\n })\n }\n}\n\nexport interface IdentifyResult {\n peerId: PeerId\n addrs: Multiaddr[]\n}\n\nexport interface StreamHandlerFunction {\n (stream: Stream): Promise<void>\n}\n\nexport interface DHTClient {\n put(key: Uint8Array, value: Uint8Array): Promise<void>\n get(key: Uint8Array): Promise<Uint8Array>\n provide(cid: CID): Promise<void>\n findProviders(cid: CID, count?: number): AsyncIterable<PeerInfo>\n findPeer(peerId: PeerId): Promise<PeerInfo>\n getClosestPeers(key: Uint8Array): AsyncIterable<PeerInfo>\n}\n\nexport interface Subscription {\n messages(): AsyncIterable<PSMessage>\n cancel(): Promise<void>\n}\n\nexport interface PubSubClient {\n publish(topic: string, data: Uint8Array): Promise<void>\n subscribe(topic: string): Promise<Subscription>\n getTopics(): Promise<string[]>\n getSubscribers(topic: string): Promise<PeerId[]>\n}\n\nexport interface DaemonClient {\n identify(): Promise<IdentifyResult>\n listPeers(): Promise<PeerId[]>\n connect(peerId: PeerId, addrs: Multiaddr[]): Promise<void>\n dht: DHTClient\n pubsub: PubSubClient\n\n send(request: Request): Promise<ProtobufStream<MultiaddrConnection>>\n openStream(peerId: PeerId, protocol: string): Promise<MultiaddrConnection>\n registerStreamHandler(protocol: string, handler: StreamHandlerFunction): Promise<void>\n}\n\nexport function createClient (multiaddr: Multiaddr): DaemonClient {\n return new Client(multiaddr)\n}\n", "import { Buffer } from 'node:buffer'\nimport { asUint8Array } from '#util/as-uint8array'\n\n/**\n * Returns a `Uint8Array` of the requested size. Referenced memory will\n * be initialized to 0.\n */\nexport function alloc (size: number = 0): Uint8Array {\n return asUint8Array(Buffer.alloc(size))\n}\n\n/**\n * Where possible returns a Uint8Array of the requested size that references\n * uninitialized memory. Only use if you are certain you will immediately\n * overwrite every value in the returned `Uint8Array`.\n */\nexport function allocUnsafe (size: number = 0): Uint8Array {\n return asUint8Array(Buffer.allocUnsafe(size))\n}\n", "/**\n * To guarantee Uint8Array semantics, convert nodejs Buffers\n * into vanilla Uint8Arrays\n */\nexport function asUint8Array (buf: Uint8Array): Uint8Array {\n return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength)\n}\n", "/* eslint-disable no-fallthrough */\nimport { allocUnsafe } from 'uint8arrays/alloc'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nconst N1 = Math.pow(2, 7)\nconst N2 = Math.pow(2, 14)\nconst N3 = Math.pow(2, 21)\nconst N4 = Math.pow(2, 28)\nconst N5 = Math.pow(2, 35)\nconst N6 = Math.pow(2, 42)\nconst N7 = Math.pow(2, 49)\n\n/** Most significant bit of a byte */\nconst MSB = 0x80\n/** Rest of the bits in a byte */\nconst REST = 0x7f\n\nexport function encodingLength (value: number): number {\n if (value < N1) {\n return 1\n }\n\n if (value < N2) {\n return 2\n }\n\n if (value < N3) {\n return 3\n }\n\n if (value < N4) {\n return 4\n }\n\n if (value < N5) {\n return 5\n }\n\n if (value < N6) {\n return 6\n }\n\n if (value < N7) {\n return 7\n }\n\n if (Number.MAX_SAFE_INTEGER != null && value > Number.MAX_SAFE_INTEGER) {\n throw new RangeError('Could not encode varint')\n }\n\n return 8\n}\n\nexport function encodeUint8Array (value: number, buf: Uint8Array, offset: number = 0): Uint8Array {\n switch (encodingLength(value)) {\n case 8: {\n buf[offset++] = (value & 0xFF) | MSB\n value /= 128\n }\n case 7: {\n buf[offset++] = (value & 0xFF) | MSB\n value /= 128\n }\n case 6: {\n buf[offset++] = (value & 0xFF) | MSB\n value /= 128\n }\n case 5: {\n buf[offset++] = (value & 0xFF) | MSB\n value /= 128\n }\n case 4: {\n buf[offset++] = (value & 0xFF) | MSB\n value >>>= 7\n }\n case 3: {\n buf[offset++] = (value & 0xFF) | MSB\n value >>>= 7\n }\n case 2: {\n buf[offset++] = (value & 0xFF) | MSB\n value >>>= 7\n }\n case 1: {\n buf[offset++] = (value & 0xFF)\n value >>>= 7\n break\n }\n default: throw new Error('unreachable')\n }\n return buf\n}\n\nexport function encodeUint8ArrayList (value: number, buf: Uint8ArrayList, offset: number = 0): Uint8ArrayList {\n switch (encodingLength(value)) {\n case 8: {\n buf.set(offset++, (value & 0xFF) | MSB)\n value /= 128\n }\n case 7: {\n buf.set(offset++, (value & 0xFF) | MSB)\n value /= 128\n }\n case 6: {\n buf.set(offset++, (value & 0xFF) | MSB)\n value /= 128\n }\n case 5: {\n buf.set(offset++, (value & 0xFF) | MSB)\n value /= 128\n }\n case 4: {\n buf.set(offset++, (value & 0xFF) | MSB)\n value >>>= 7\n }\n case 3: {\n buf.set(offset++, (value & 0xFF) | MSB)\n value >>>= 7\n }\n case 2: {\n buf.set(offset++, (value & 0xFF) | MSB)\n value >>>= 7\n }\n case 1: {\n buf.set(offset++, (value & 0xFF))\n value >>>= 7\n break\n }\n default: throw new Error('unreachable')\n }\n return buf\n}\n\nexport function decodeUint8Array (buf: Uint8Array, offset: number): number {\n let b = buf[offset]\n let res = 0\n\n res += b & REST\n if (b < MSB) {\n return res\n }\n\n b = buf[offset + 1]\n res += (b & REST) << 7\n if (b < MSB) {\n return res\n }\n\n b = buf[offset + 2]\n res += (b & REST) << 14\n if (b < MSB) {\n return res\n }\n\n b = buf[offset + 3]\n res += (b & REST) << 21\n if (b < MSB) {\n return res\n }\n\n b = buf[offset + 4]\n res += (b & REST) * N4\n if (b < MSB) {\n return res\n }\n\n b = buf[offset + 5]\n res += (b & REST) * N5\n if (b < MSB) {\n return res\n }\n\n b = buf[offset + 6]\n res += (b & REST) * N6\n if (b < MSB) {\n return res\n }\n\n b = buf[offset + 7]\n res += (b & REST) * N7\n if (b < MSB) {\n return res\n }\n\n throw new RangeError('Could not decode varint')\n}\n\nexport function decodeUint8ArrayList (buf: Uint8ArrayList, offset: number): number {\n let b = buf.get(offset)\n let res = 0\n\n res += b & REST\n if (b < MSB) {\n return res\n }\n\n b = buf.get(offset + 1)\n res += (b & REST) << 7\n if (b < MSB) {\n return res\n }\n\n b = buf.get(offset + 2)\n res += (b & REST) << 14\n if (b < MSB) {\n return res\n }\n\n b = buf.get(offset + 3)\n res += (b & REST) << 21\n if (b < MSB) {\n return res\n }\n\n b = buf.get(offset + 4)\n res += (b & REST) * N4\n if (b < MSB) {\n return res\n }\n\n b = buf.get(offset + 5)\n res += (b & REST) * N5\n if (b < MSB) {\n return res\n }\n\n b = buf.get(offset + 6)\n res += (b & REST) * N6\n if (b < MSB) {\n return res\n }\n\n b = buf.get(offset + 7)\n res += (b & REST) * N7\n if (b < MSB) {\n return res\n }\n\n throw new RangeError('Could not decode varint')\n}\n\nexport function encode (value: number): Uint8Array\nexport function encode (value: number, buf: Uint8Array, offset?: number): Uint8Array\nexport function encode (value: number, buf: Uint8ArrayList, offset?: number): Uint8ArrayList\nexport function encode <T extends Uint8Array | Uint8ArrayList = Uint8Array> (value: number, buf?: T, offset: number = 0): T {\n if (buf == null) {\n buf = allocUnsafe(encodingLength(value)) as T\n }\n if (buf instanceof Uint8Array) {\n return encodeUint8Array(value, buf, offset) as T\n } else {\n return encodeUint8ArrayList(value, buf, offset) as T\n }\n}\n\nexport function decode (buf: Uint8ArrayList | Uint8Array, offset: number = 0): number {\n if (buf instanceof Uint8Array) {\n return decodeUint8Array(buf, offset)\n } else {\n return decodeUint8ArrayList(buf, offset)\n }\n}\n", "const f32 = new Float32Array([-0])\nconst f8b = new Uint8Array(f32.buffer)\n\n/**\n * Writes a 32 bit float to a buffer using little endian byte order\n */\nexport function writeFloatLE (val: number, buf: Uint8Array, pos: number): void {\n f32[0] = val\n buf[pos] = f8b[0]\n buf[pos + 1] = f8b[1]\n buf[pos + 2] = f8b[2]\n buf[pos + 3] = f8b[3]\n}\n\n/**\n * Writes a 32 bit float to a buffer using big endian byte order\n */\nexport function writeFloatBE (val: number, buf: Uint8Array, pos: number): void {\n f32[0] = val\n buf[pos] = f8b[3]\n buf[pos + 1] = f8b[2]\n buf[pos + 2] = f8b[1]\n buf[pos + 3] = f8b[0]\n}\n\n/**\n * Reads a 32 bit float from a buffer using little endian byte order\n */\nexport function readFloatLE (buf: Uint8Array, pos: number): number {\n f8b[0] = buf[pos]\n f8b[1] = buf[pos + 1]\n f8b[2] = buf[pos + 2]\n f8b[3] = buf[pos + 3]\n return f32[0]\n}\n\n/**\n * Reads a 32 bit float from a buffer using big endian byte order\n */\nexport function readFloatBE (buf: Uint8Array, pos: number): number {\n f8b[3] = buf[pos]\n f8b[2] = buf[pos + 1]\n f8b[1] = buf[pos + 2]\n f8b[0] = buf[pos + 3]\n return f32[0]\n}\n\nconst f64 = new Float64Array([-0])\nconst d8b = new Uint8Array(f64.buffer)\n\n/**\n * Writes a 64 bit double to a buffer using little endian byte order\n */\nexport function writeDoubleLE (val: number, buf: Uint8Array, pos: number): void {\n f64[0] = val\n buf[pos] = d8b[0]\n buf[pos + 1] = d8b[1]\n buf[pos + 2] = d8b[2]\n buf[pos + 3] = d8b[3]\n buf[pos + 4] = d8b[4]\n buf[pos + 5] = d8b[5]\n buf[pos + 6] = d8b[6]\n buf[pos + 7] = d8b[7]\n}\n\n/**\n * Writes a 64 bit double to a buffer using big endian byte order\n */\nexport function writeDoubleBE (val: number, buf: Uint8Array, pos: number): void {\n f64[0] = val\n buf[pos] = d8b[7]\n buf[pos + 1] = d8b[6]\n buf[pos + 2] = d8b[5]\n buf[pos + 3] = d8b[4]\n buf[pos + 4] = d8b[3]\n buf[pos + 5] = d8b[2]\n buf[pos + 6] = d8b[1]\n buf[pos + 7] = d8b[0]\n}\n\n/**\n * Reads a 64 bit double from a buffer using little endian byte order\n */\nexport function readDoubleLE (buf: Uint8Array, pos: number): number {\n d8b[0] = buf[pos]\n d8b[1] = buf[pos + 1]\n d8b[2] = buf[pos + 2]\n d8b[3] = buf[pos + 3]\n d8b[4] = buf[pos + 4]\n d8b[5] = buf[pos + 5]\n d8b[6] = buf[pos + 6]\n d8b[7] = buf[pos + 7]\n return f64[0]\n}\n\n/**\n * Reads a 64 bit double from a buffer using big endian byte order\n */\nexport function readDoubleBE (buf: Uint8Array, pos: number): number {\n d8b[7] = buf[pos]\n d8b[6] = buf[pos + 1]\n d8b[5] = buf[pos + 2]\n d8b[4] = buf[pos + 3]\n d8b[3] = buf[pos + 4]\n d8b[2] = buf[pos + 5]\n d8b[1] = buf[pos + 6]\n d8b[0] = buf[pos + 7]\n return f64[0]\n}\n", "// the largest BigInt we can safely downcast to a Number\nconst MAX_SAFE_NUMBER_INTEGER = BigInt(Number.MAX_SAFE_INTEGER)\nconst MIN_SAFE_NUMBER_INTEGER = BigInt(Number.MIN_SAFE_INTEGER)\n\n/**\n * Constructs new long bits.\n *\n * @classdesc Helper class for working with the low and high bits of a 64 bit value.\n * @memberof util\n * @function Object() { [native code] }\n * @param {number} lo - Low 32 bits, unsigned\n * @param {number} hi - High 32 bits, unsigned\n */\nexport class LongBits {\n public lo: number\n public hi: number\n\n constructor (lo: number, hi: number) {\n // note that the casts below are theoretically unnecessary as of today, but older statically\n // generated converter code might still call the ctor with signed 32bits. kept for compat.\n\n /**\n * Low bits\n */\n this.lo = lo | 0\n\n /**\n * High bits\n */\n this.hi = hi | 0\n }\n\n /**\n * Converts this long bits to a possibly unsafe JavaScript number\n */\n toNumber (unsigned: boolean = false): number {\n if (!unsigned && (this.hi >>> 31) > 0) {\n const lo = ~this.lo + 1 >>> 0\n let hi = ~this.hi >>> 0\n if (lo === 0) {\n hi = hi + 1 >>> 0\n }\n return -(lo + hi * 4294967296)\n }\n return this.lo + this.hi * 4294967296\n }\n\n /**\n * Converts this long bits to a bigint\n */\n toBigInt (unsigned: boolean = false): bigint {\n if (unsigned) {\n return BigInt(this.lo >>> 0) + (BigInt(this.hi >>> 0) << 32n)\n }\n\n if ((this.hi >>> 31) !== 0) {\n const lo = ~this.lo + 1 >>> 0\n let hi = ~this.hi >>> 0\n if (lo === 0) {\n hi = hi + 1 >>> 0\n }\n return -(BigInt(lo) + (BigInt(hi) << 32n))\n }\n\n return BigInt(this.lo >>> 0) + (BigInt(this.hi >>> 0) << 32n)\n }\n\n /**\n * Converts this long bits to a string\n */\n toString (unsigned: boolean = false): string {\n return this.toBigInt(unsigned).toString()\n }\n\n /**\n * Zig-zag encodes this long bits\n */\n zzEncode (): this {\n const mask = this.hi >> 31\n this.hi = ((this.hi << 1 | this.lo >>> 31) ^ mask) >>> 0\n this.lo = (this.lo << 1 ^ mask) >>> 0\n return this\n }\n\n /**\n * Zig-zag decodes this long bits\n */\n zzDecode (): this {\n const mask = -(this.lo & 1)\n this.lo = ((this.lo >>> 1 | this.hi << 31) ^ mask) >>> 0\n this.hi = (this.hi >>> 1 ^ mask) >>> 0\n return this\n }\n\n /**\n * Calculates the length of this longbits when encoded as a varint.\n */\n length (): number {\n const part0 = this.lo\n const part1 = (this.lo >>> 28 | this.hi << 4) >>> 0\n const part2 = this.hi >>> 24\n return part2 === 0\n ? part1 === 0\n ? part0 < 16384\n ? part0 < 128 ? 1 : 2\n : part0 < 2097152 ? 3 : 4\n : part1 < 16384\n ? part1 < 128 ? 5 : 6\n : part1 < 2097152 ? 7 : 8\n : part2 < 128 ? 9 : 10\n }\n\n /**\n * Constructs new long bits from the specified number\n */\n static fromBigInt (value: bigint): LongBits {\n if (value === 0n) {\n return zero\n }\n\n if (value < MAX_SAFE_NUMBER_INTEGER && value > MIN_SAFE_NUMBER_INTEGER) {\n return this.fromNumber(Number(value))\n }\n\n const negative = value < 0n\n\n if (negative) {\n value = -value\n }\n\n let hi = value >> 32n\n let lo = value - (hi << 32n)\n\n if (negative) {\n hi = ~hi | 0n\n lo = ~lo | 0n\n\n if (++lo > TWO_32) {\n lo = 0n\n if (++hi > TWO_32) { hi = 0n }\n }\n }\n\n return new LongBits(Number(lo), Number(hi))\n }\n\n /**\n * Constructs new long bits from the specified number\n */\n static fromNumber (value: number): LongBits {\n if (value === 0) { return zero }\n const sign = value < 0\n if (sign) { value = -value }\n let lo = value >>> 0\n let hi = (value - lo) / 4294967296 >>> 0\n if (sign) {\n hi = ~hi >>> 0\n lo = ~lo >>> 0\n if (++lo > 4294967295) {\n lo = 0\n if (++hi > 4294967295) { hi = 0 }\n }\n }\n return new LongBits(lo, hi)\n }\n\n /**\n * Constructs new long bits from a number, long or string\n */\n static from (value: bigint | number | string | { low: number, high: number }): LongBits {\n if (typeof value === 'number') {\n return LongBits.fromNumber(value)\n }\n if (typeof value === 'bigint') {\n return LongBits.fromBigInt(value)\n }\n if (typeof value === 'string') {\n return LongBits.fromBigInt(BigInt(value))\n }\n return value.low != null || value.high != null ? new LongBits(value.low >>> 0, value.high >>> 0) : zero\n }\n}\n\nconst zero = new LongBits(0, 0)\nzero.toBigInt = function () { return 0n }\nzero.zzEncode = zero.zzDecode = function () { return this }\nzero.length = function () { return 1 }\n\nconst TWO_32 = 4294967296n\n", "/**\n * Calculates the UTF8 byte length of a string\n */\nexport function length (string: string): number {\n let len = 0\n let c = 0\n for (let i = 0; i < string.length; ++i) {\n c = string.charCodeAt(i)\n\n if (c < 128) {\n len += 1\n } else if (c < 2048) {\n len += 2\n } else if ((c & 0xFC00) === 0xD800 && (string.charCodeAt(i + 1) & 0xFC00) === 0xDC00) {\n ++i\n len += 4\n } else {\n len += 3\n }\n }\n\n return len\n}\n\n/**\n * Reads UTF8 bytes as a string\n */\nexport function read (buffer: Uint8Array, start: number, end: number): string {\n const len = end - start\n\n if (len < 1) {\n return ''\n }\n\n let parts: string[] | undefined\n const chunk: number[] = []\n let i = 0 // char offset\n let t: number // temporary\n\n while (start < end) {\n t = buffer[start++]\n\n if (t < 128) {\n chunk[i++] = t\n } else if (t > 191 && t < 224) {\n chunk[i++] = (t & 31) << 6 | buffer[start++] & 63\n } else if (t > 239 && t < 365) {\n t = ((t & 7) << 18 | (buffer[start++] & 63) << 12 | (buffer[start++] & 63) << 6 | buffer[start++] & 63) - 0x10000\n chunk[i++] = 0xD800 + (t >> 10)\n chunk[i++] = 0xDC00 + (t & 1023)\n } else {\n chunk[i++] = (t & 15) << 12 | (buffer[start++] & 63) << 6 | buffer[start++] & 63\n }\n\n if (i > 8191) {\n (parts ?? (parts = [])).push(String.fromCharCode.apply(String, chunk))\n i = 0\n }\n }\n\n if (parts != null) {\n if (i > 0) {\n parts.push(String.fromCharCode.apply(String, chunk.slice(0, i)))\n }\n\n return parts.join('')\n }\n\n return String.fromCharCode.apply(String, chunk.slice(0, i))\n}\n\n/**\n * Writes a string as UTF8 bytes\n */\nexport function write (string: string, buffer: Uint8Array, offset: number): number {\n const start = offset\n let c1 // character 1\n let c2 // character 2\n\n for (let i = 0; i < string.length; ++i) {\n c1 = string.charCodeAt(i)\n\n if (c1 < 128) {\n buffer[offset++] = c1\n } else if (c1 < 2048) {\n buffer[offset++] = c1 >> 6 | 192\n buffer[offset++] = c1 & 63 | 128\n } else if ((c1 & 0xFC00) === 0xD800 && ((c2 = string.charCodeAt(i + 1)) & 0xFC00) === 0xDC00) {\n c1 = 0x10000 + ((c1 & 0x03FF) << 10) + (c2 & 0x03FF)\n ++i\n buffer[offset++] = c1 >> 18 | 240\n buffer[offset++] = c1 >> 12 & 63 | 128\n buffer[offset++] = c1 >> 6 & 63 | 128\n buffer[offset++] = c1 & 63 | 128\n } else {\n buffer[offset++] = c1 >> 12 | 224\n buffer[offset++] = c1 >> 6 & 63 | 128\n buffer[offset++] = c1 & 63 | 128\n }\n }\n\n return offset - start\n}\n", "import { decodeUint8Array, encodingLength } from 'uint8-varint'\nimport { readFloatLE, readDoubleLE } from './float.js'\nimport { LongBits } from './longbits.js'\nimport * as utf8 from './utf8.js'\nimport type { Reader } from '../index.js'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\n/* istanbul ignore next */\nfunction indexOutOfRange (reader: Reader, writeLength?: number): RangeError {\n return RangeError(`index out of range: ${reader.pos} + ${writeLength ?? 1} > ${reader.len}`)\n}\n\nfunction readFixed32End (buf: Uint8Array, end: number): number { // note that this uses `end`, not `pos`\n return (buf[end - 4] |\n buf[end - 3] << 8 |\n buf[end - 2] << 16 |\n buf[end - 1] << 24) >>> 0\n}\n\n/**\n * Constructs a new reader instance using the specified buffer.\n */\nexport class Uint8ArrayReader implements Reader {\n public buf: Uint8Array\n public pos: number\n public len: number\n\n public _slice = Uint8Array.prototype.subarray\n\n constructor (buffer: Uint8Array) {\n /**\n * Read buffer\n */\n this.buf = buffer\n\n /**\n * Read buffer position\n */\n this.pos = 0\n\n /**\n * Read buffer length\n */\n this.len = buffer.length\n }\n\n /**\n * Reads a varint as an unsigned 32 bit value\n */\n uint32 (): number {\n let value = 4294967295\n\n value = (this.buf[this.pos] & 127) >>> 0; if (this.buf[this.pos++] < 128) { return value }\n value = (value | (this.buf[this.pos] & 127) << 7) >>> 0; if (this.buf[this.pos++] < 128) { return value }\n value = (value | (this.buf[this.pos] & 127) << 14) >>> 0; if (this.buf[this.pos++] < 128) { return value }\n value = (value | (this.buf[this.pos] & 127) << 21) >>> 0; if (this.buf[this.pos++] < 128) { return value }\n value = (value | (this.buf[this.pos] & 15) << 28) >>> 0; if (this.buf[this.pos++] < 128) { return value }\n\n if ((this.pos += 5) > this.len) {\n this.pos = this.len\n throw indexOutOfRange(this, 10)\n }\n\n return value\n }\n\n /**\n * Reads a varint as a signed 32 bit value\n */\n int32 (): number {\n return this.uint32() | 0\n }\n\n /**\n * Reads a zig-zag encoded varint as a signed 32 bit value\n */\n sint32 (): number {\n const value = this.uint32()\n return value >>> 1 ^ -(value & 1) | 0\n }\n\n /**\n * Reads a varint as a boolean\n */\n bool (): boolean {\n return this.uint32() !== 0\n }\n\n /**\n * Reads fixed 32 bits as an unsigned 32 bit integer\n */\n fixed32 (): number {\n if (this.pos + 4 > this.len) { throw indexOutOfRange(this, 4) }\n\n const res = readFixed32End(this.buf, this.pos += 4)\n\n return res\n }\n\n /**\n * Reads fixed 32 bits as a signed 32 bit integer\n */\n sfixed32 (): number {\n if (this.pos + 4 > this.len) {\n throw indexOutOfRange(this, 4)\n }\n\n const res = readFixed32End(this.buf, this.pos += 4) | 0\n\n return res\n }\n\n /**\n * Reads a float (32 bit) as a number\n */\n float (): number {\n if (this.pos + 4 > this.len) {\n throw indexOutOfRange(this, 4)\n }\n\n const value = readFloatLE(this.buf, this.pos)\n this.pos += 4\n return value\n }\n\n /**\n * Reads a double (64 bit float) as a number\n */\n double (): number {\n /* istanbul ignore if */\n if (this.pos + 8 > this.len) { throw indexOutOfRange(this, 4) }\n\n const value = readDoubleLE(this.buf, this.pos)\n this.pos += 8\n return value\n }\n\n /**\n * Reads a sequence of bytes preceded by its length as a varint\n */\n bytes (): Uint8Array {\n const length = this.uint32()\n const start = this.pos\n const end = this.pos + length\n\n /* istanbul ignore if */\n if (end > this.len) {\n throw indexOutOfRange(this, length)\n }\n\n this.pos += length\n\n return start === end // fix for IE 10/Win8 and others' subarray returning array of size 1\n ? new Uint8Array(0)\n : this.buf.subarray(start, end)\n }\n\n /**\n * Reads a string preceded by its byte length as a varint\n */\n string (): string {\n const bytes = this.bytes()\n return utf8.read(bytes, 0, bytes.length)\n }\n\n /**\n * Skips the specified number of bytes if specified, otherwise skips a varint\n */\n skip (length?: number): this {\n if (typeof length === 'number') {\n /* istanbul ignore if */\n if (this.pos + length > this.len) { throw indexOutOfRange(this, length) }\n this.pos += length\n } else {\n do {\n /* istanbul ignore if */\n if (this.pos >= this.len) {\n throw indexOutOfRange(this)\n }\n } while ((this.buf[this.pos++] & 128) !== 0)\n }\n return this\n }\n\n /**\n * Skips the next element of the specified wire type\n */\n skipType (wireType: number): this {\n switch (wireType) {\n case 0:\n this.skip()\n break\n case 1:\n this.skip(8)\n break\n case 2:\n this.skip(this.uint32())\n break\n case 3:\n while ((wireType = this.uint32() & 7) !== 4) {\n this.skipType(wireType)\n }\n break\n case 5:\n this.skip(4)\n break\n\n /* istanbul ignore next */\n default:\n throw Error(`invalid wire type ${wireType} at offset ${this.pos}`)\n }\n return this\n }\n\n private readLongVarint (): LongBits {\n // tends to deopt with local vars for octet etc.\n const bits = new LongBits(0, 0)\n let i = 0\n if (this.len - this.pos > 4) { // fast route (lo)\n for (; i < 4; ++i) {\n // 1st..4th\n bits.lo = (bits.lo | (this.buf[this.pos] & 127) << i * 7) >>> 0\n if (this.buf[this.pos++] < 128) { return bits }\n }\n // 5th\n bits.lo = (bits.lo | (this.buf[this.pos] & 127) << 28) >>> 0\n bits.hi = (bits.hi | (this.buf[this.pos] & 127) >> 4) >>> 0\n if (this.buf[this.pos++] < 128) { return bits }\n i = 0\n } else {\n for (; i < 3; ++i) {\n /* istanbul ignore if */\n if (this.pos >= this.len) { throw indexOutOfRange(this) }\n // 1st..3th\n bits.lo = (bits.lo | (this.buf[this.pos] & 127) << i * 7) >>> 0\n if (this.buf[this.pos++] < 128) { return bits }\n }\n // 4th\n bits.lo = (bits.lo | (this.buf[this.pos++] & 127) << i * 7) >>> 0\n return bits\n }\n if (this.len - this.pos > 4) { // fast route (hi)\n for (; i < 5; ++i) {\n // 6th..10th\n bits.hi = (bits.hi | (this.buf[this.pos] & 127) << i * 7 + 3) >>> 0\n if (this.buf[this.pos++] < 128) { return bits }\n }\n } else {\n for (; i < 5; ++i) {\n if (this.pos >= this.len) {\n throw indexOutOfRange(this)\n }\n\n // 6th..10th\n bits.hi = (bits.hi | (this.buf[this.pos] & 127) << i * 7 + 3) >>> 0\n if (this.buf[this.pos++] < 128) { return bits }\n }\n }\n\n throw Error('invalid varint encoding')\n }\n\n private readFixed64 (): LongBits {\n if (this.pos + 8 > this.len) {\n throw indexOutOfRange(this, 8)\n }\n\n const lo = readFixed32End(this.buf, this.pos += 4)\n const hi = readFixed32End(this.buf, this.pos += 4)\n\n return new LongBits(lo, hi)\n }\n\n /**\n * Reads a varint as a signed 64 bit value\n */\n int64 (): bigint {\n return this.readLongVarint().toBigInt()\n }\n\n /**\n * Reads a varint as a signed 64 bit value returned as a possibly unsafe\n * JavaScript number\n */\n int64Number (): number {\n return this.readLongVarint().toNumber()\n }\n\n /**\n * Reads a varint as a signed 64 bit value returned as a string\n */\n int64String (): string {\n return this.readLongVarint().toString()\n }\n\n /**\n * Reads a varint as an unsigned 64 bit value\n */\n uint64 (): bigint {\n return this.readLongVarint().toBigInt(true)\n }\n\n /**\n * Reads a varint as an unsigned 64 bit value returned as a possibly unsafe\n * JavaScript number\n */\n uint64Number (): number {\n const value = decodeUint8Array(this.buf, this.pos)\n this.pos += encodingLength(value)\n return value\n }\n\n /**\n * Reads a varint as an unsigned 64 bit value returned as a string\n */\n uint64String (): string {\n return this.readLongVarint().toString(true)\n }\n\n /**\n * Reads a zig-zag encoded varint as a signed 64 bit value\n */\n sint64 (): bigint {\n return this.readLongVarint().zzDecode().toBigInt()\n }\n\n /**\n * Reads a zig-zag encoded varint as a signed 64 bit value returned as a\n * possibly unsafe JavaScript number\n */\n sint64Number (): number {\n return this.readLongVarint().zzDecode().toNumber()\n }\n\n /**\n * Reads a zig-zag encoded varint as a signed 64 bit value returned as a\n * string\n */\n sint64String (): string {\n return this.readLongVarint().zzDecode().toString()\n }\n\n /**\n * Reads fixed 64 bits\n */\n fixed64 (): bigint {\n return this.readFixed64().toBigInt()\n }\n\n /**\n * Reads fixed 64 bits returned as a possibly unsafe JavaScript number\n */\n fixed64Number (): number {\n return this.readFixed64().toNumber()\n }\n\n /**\n * Reads fixed 64 bits returned as a string\n */\n fixed64String (): string {\n return this.readFixed64().toString()\n }\n\n /**\n * Reads zig-zag encoded fixed 64 bits\n */\n sfixed64 (): bigint {\n return this.readFixed64().toBigInt()\n }\n\n /**\n * Reads zig-zag encoded fixed 64 bits returned as a possibly unsafe\n * JavaScript number\n */\n sfixed64Number (): number {\n return this.readFixed64().toNumber()\n }\n\n /**\n * Reads zig-zag encoded fixed 64 bits returned as a string\n */\n sfixed64String (): string {\n return this.readFixed64().toString()\n }\n}\n\nexport function createReader (buf: Uint8Array | Uint8ArrayList): Reader {\n return new Uint8ArrayReader(buf instanceof Uint8Array ? buf : buf.subarray())\n}\n", "import { createReader } from './utils/reader.js'\nimport type { Codec, DecodeOptions } from './codec.js'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nexport function decodeMessage <T> (buf: Uint8Array | Uint8ArrayList, codec: Pick<Codec<T>, 'decode'>, opts?: DecodeOptions<T>): T {\n const reader = createReader(buf)\n\n return codec.decode(reader, undefined, opts)\n}\n", "import { Buffer } from 'node:buffer'\nimport bases, { type SupportedEncodings } from './util/bases.js'\nimport { asUint8Array } from '#util/as-uint8array'\n\nexport type { SupportedEncodings }\n\n/**\n * Create a `Uint8Array` from the passed string\n *\n * Supports `utf8`, `utf-8`, `hex`, and any encoding supported by the multiformats module.\n *\n * Also `ascii` which is similar to node's 'binary' encoding.\n */\nexport function fromString (string: string, encoding: SupportedEncodings = 'utf8'): Uint8Array {\n const base = bases[encoding]\n\n if (base == null) {\n throw new Error(`Unsupported encoding \"${encoding}\"`)\n }\n\n if (encoding === 'utf8' || encoding === 'utf-8') {\n return asUint8Array(Buffer.from(string, 'utf-8'))\n }\n\n // add multibase prefix\n return base.decoder.decode(`${base.prefix}${string}`) // eslint-disable-line @typescript-eslint/restrict-template-expressions\n}\n", "import { baseX } from './base.js'\n\nexport const base10 = baseX({\n prefix: '9',\n name: 'base10',\n alphabet: '0123456789'\n})\n", "export const empty = new Uint8Array(0)\n\nexport function toHex (d: Uint8Array): string {\n return d.reduce((hex, byte) => hex + byte.toString(16).padStart(2, '0'), '')\n}\n\nexport function fromHex (hex: string): Uint8Array {\n const hexes = hex.match(/../g)\n return hexes != null ? new Uint8Array(hexes.map(b => parseInt(b, 16))) : empty\n}\n\nexport function equals (aa: Uint8Array, bb: Uint8Array): boolean {\n if (aa === bb) { return true }\n if (aa.byteLength !== bb.byteLength) {\n return false\n }\n\n for (let ii = 0; ii < aa.byteLength; ii++) {\n if (aa[ii] !== bb[ii]) {\n return false\n }\n }\n\n return true\n}\n\nexport function coerce (o: ArrayBufferView | ArrayBuffer | Uint8Array): Uint8Array {\n if (o instanceof Uint8Array && o.constructor.name === 'Uint8Array') { return o }\n if (o instanceof ArrayBuffer) { return new Uint8Array(o) }\n if (ArrayBuffer.isView(o)) {\n return new Uint8Array(o.buffer, o.byteOffset, o.byteLength)\n }\n throw new Error('Unknown type, must be binary type')\n}\n\nexport function isBinary (o: unknown): o is ArrayBuffer | ArrayBufferView {\n return o instanceof ArrayBuffer || ArrayBuffer.isView(o)\n}\n\nexport function fromString (str: string): Uint8Array {\n return new TextEncoder().encode(str)\n}\n\nexport function toString (b: Uint8Array): string {\n return new TextDecoder().decode(b)\n}\n", "/* eslint-disable */\n// base-x encoding / decoding\n// Copyright (c) 2018 base-x contributors\n// Copyright (c) 2014-2018 The Bitcoin Core developers (base58.cpp)\n// Distributed under the MIT software license, see the accompanying\n// file LICENSE or http://www.opensource.org/licenses/mit-license.php.\n/**\n * @param {string} ALPHABET\n * @param {any} name\n */\nfunction base (ALPHABET, name) {\n if (ALPHABET.length >= 255) { throw new TypeError('Alphabet too long') }\n var BASE_MAP = new Uint8Array(256);\n for (var j = 0; j < BASE_MAP.length; j++) {\n BASE_MAP[j] = 255;\n }\n for (var i = 0; i < ALPHABET.length; i++) {\n var x = ALPHABET.charAt(i);\n var xc = x.charCodeAt(0);\n if (BASE_MAP[xc] !== 255) { throw new TypeError(x + ' is ambiguous') }\n BASE_MAP[xc] = i;\n }\n var BASE = ALPHABET.length;\n var LEADER = ALPHABET.charAt(0);\n var FACTOR = Math.log(BASE) / Math.log(256); // log(BASE) / log(256), rounded up\n var iFACTOR = Math.log(256) / Math.log(BASE); // log(256) / log(BASE), rounded up\n /**\n * @param {any[] | Iterable<number>} source\n */\n function encode (source) {\n // @ts-ignore\n if (source instanceof Uint8Array) ; else if (ArrayBuffer.isView(source)) {\n source = new Uint8Array(source.buffer, source.byteOffset, source.byteLength);\n } else if (Array.isArray(source)) {\n source = Uint8Array.from(source);\n }\n if (!(source instanceof Uint8Array)) { throw new TypeError('Expected Uint8Array') }\n if (source.length === 0) { return '' }\n // Skip & count leading zeroes.\n var zeroes = 0;\n var length = 0;\n var pbegin = 0;\n var pend = source.length;\n while (pbegin !== pend && source[pbegin] === 0) {\n pbegin++;\n zeroes++;\n }\n // Allocate enough space in big-endian base58 representation.\n var size = ((pend - pbegin) * iFACTOR + 1) >>> 0;\n var b58 = new Uint8Array(size);\n // Process the bytes.\n while (pbegin !== pend) {\n var carry = source[pbegin];\n // Apply \"b58 = b58 * 256 + ch\".\n var i = 0;\n for (var it1 = size - 1; (carry !== 0 || i < length) && (it1 !== -1); it1--, i++) {\n carry += (256 * b58[it1]) >>> 0;\n b58[it1] = (carry % BASE) >>> 0;\n carry = (carry / BASE) >>> 0;\n }\n if (carry !== 0) { throw new Error('Non-zero carry') }\n length = i;\n pbegin++;\n }\n // Skip leading zeroes in base58 result.\n var it2 = size - length;\n while (it2 !== size && b58[it2] === 0) {\n it2++;\n }\n // Translate the result into a string.\n var str = LEADER.repeat(zeroes);\n for (; it2 < size; ++it2) { str += ALPHABET.charAt(b58[it2]); }\n return str\n }\n /**\n * @param {string | string[]} source\n */\n function decodeUnsafe (source) {\n if (typeof source !== 'string') { throw new TypeError('Expected String') }\n if (source.length === 0) { return new Uint8Array() }\n var psz = 0;\n // Skip leading spaces.\n if (source[psz] === ' ') { return }\n // Skip and count leading '1's.\n var zeroes = 0;\n var length = 0;\n while (source[psz] === LEADER) {\n zeroes++;\n psz++;\n }\n // Allocate enough space in big-endian base256 representation.\n var size = (((source.length - psz) * FACTOR) + 1) >>> 0; // log(58) / log(256), rounded up.\n var b256 = new Uint8Array(size);\n // Process the characters.\n while (source[psz]) {\n // Decode character\n var carry = BASE_MAP[source.charCodeAt(psz)];\n // Invalid character\n if (carry === 255) { return }\n var i = 0;\n for (var it3 = size - 1; (carry !== 0 || i < length) && (it3 !== -1); it3--, i++) {\n carry += (BASE * b256[it3]) >>> 0;\n b256[it3] = (carry % 256) >>> 0;\n carry = (carry / 256) >>> 0;\n }\n if (carry !== 0) { throw new Error('Non-zero carry') }\n length = i;\n psz++;\n }\n // Skip trailing spaces.\n if (source[psz] === ' ') { return }\n // Skip leading zeroes in b256.\n var it4 = size - length;\n while (it4 !== size && b256[it4] === 0) {\n it4++;\n }\n var vch = new Uint8Array(zeroes + (size - it4));\n var j = zeroes;\n while (it4 !== size) {\n vch[j++] = b256[it4++];\n }\n return vch\n }\n /**\n * @param {string | string[]} string\n */\n function decode (string) {\n var buffer = decodeUnsafe(string);\n if (buffer) { return buffer }\n throw new Error(`Non-${name} character`)\n }\n return {\n encode: encode,\n decodeUnsafe: decodeUnsafe,\n decode: decode\n }\n}\nvar src = base;\n\nvar _brrp__multiformats_scope_baseX = src;\n\nexport default _brrp__multiformats_scope_baseX;\n", "import { coerce } from '../bytes.js'\nimport basex from '../vendor/base-x.js'\nimport type { BaseCodec, BaseDecoder, BaseEncoder, CombobaseDecoder, Multibase, MultibaseCodec, MultibaseDecoder, MultibaseEncoder, UnibaseDecoder } from './interface.js'\n\ninterface EncodeFn { (bytes: Uint8Array): string }\ninterface DecodeFn { (text: string): Uint8Array }\n\n/**\n * Class represents both BaseEncoder and MultibaseEncoder meaning it\n * can be used to encode to multibase or base encode without multibase\n * prefix.\n */\nclass Encoder<Base extends string, Prefix extends string> implements MultibaseEncoder<Prefix>, BaseEncoder {\n readonly name: Base\n readonly prefix: Prefix\n readonly baseEncode: EncodeFn\n\n constructor (name: Base, prefix: Prefix, baseEncode: EncodeFn) {\n this.name = name\n this.prefix = prefix\n this.baseEncode = baseEncode\n }\n\n encode (bytes: Uint8Array): Multibase<Prefix> {\n if (bytes instanceof Uint8Array) {\n return `${this.prefix}${this.baseEncode(bytes)}`\n } else {\n throw Error('Unknown type, must be binary type')\n }\n }\n}\n\n/**\n * Class represents both BaseDecoder and MultibaseDecoder so it could be used\n * to decode multibases (with matching prefix) or just base decode strings\n * with corresponding base encoding.\n */\nclass Decoder<Base extends string, Prefix extends string> implements MultibaseDecoder<Prefix>, UnibaseDecoder<Prefix>, BaseDecoder {\n readonly name: Base\n readonly prefix: Prefix\n readonly baseDecode: DecodeFn\n private readonly prefixCodePoint: number\n\n constructor (name: Base, prefix: Prefix, baseDecode: DecodeFn) {\n this.name = name\n this.prefix = prefix\n const prefixCodePoint = prefix.codePointAt(0)\n /* c8 ignore next 3 */\n if (prefixCodePoint === undefined) {\n throw new Error('Invalid prefix character')\n }\n this.prefixCodePoint = prefixCodePoint\n this.baseDecode = baseDecode\n }\n\n decode (text: string): Uint8Array {\n if (typeof text === 'string') {\n if (text.codePointAt(0) !== this.prefixCodePoint) {\n throw Error(`Unable to decode multibase string ${JSON.stringify(text)}, ${this.name} decoder only supports inputs prefixed with ${this.prefix}`)\n }\n return this.baseDecode(text.slice(this.prefix.length))\n } else {\n throw Error('Can only multibase decode strings')\n }\n }\n\n or<OtherPrefix extends string> (decoder: UnibaseDecoder<OtherPrefix> | ComposedDecoder<OtherPrefix>): ComposedDecoder<Prefix | OtherPrefix> {\n return or(this, decoder)\n }\n}\n\ntype Decoders<Prefix extends string> = Record<Prefix, UnibaseDecoder<Prefix>>\n\nclass ComposedDecoder<Prefix extends string> implements MultibaseDecoder<Prefix>, CombobaseDecoder<Prefix> {\n readonly decoders: Decoders<Prefix>\n\n constructor (decoders: Decoders<Prefix>) {\n this.decoders = decoders\n }\n\n or <OtherPrefix extends string> (decoder: UnibaseDecoder<OtherPrefix> | ComposedDecoder<OtherPrefix>): ComposedDecoder<Prefix | OtherPrefix> {\n return or(this, decoder)\n }\n\n decode (input: string): Uint8Array {\n const prefix = input[0] as Prefix\n const decoder = this.decoders[prefix]\n if (decoder != null) {\n return decoder.decode(input)\n } else {\n throw RangeError(`Unable to decode multibase string ${JSON.stringify(input)}, only inputs prefixed with ${Object.keys(this.decoders)} are supported`)\n }\n }\n}\n\nexport function or <L extends string, R extends string> (left: UnibaseDecoder<L> | CombobaseDecoder<L>, right: UnibaseDecoder<R> | CombobaseDecoder<R>): ComposedDecoder<L | R> {\n return new ComposedDecoder({\n ...(left.decoders ?? { [(left as UnibaseDecoder<L>).prefix]: left }),\n ...(right.decoders ?? { [(right as UnibaseDecoder<R>).prefix]: right })\n } as Decoders<L | R>)\n}\n\nexport class Codec<Base extends string, Prefix extends string> implements MultibaseCodec<Prefix>, MultibaseEncoder<Prefix>, MultibaseDecoder<Prefix>, BaseCodec, BaseEncoder, BaseDecoder {\n readonly name: Base\n readonly prefix: Prefix\n readonly baseEncode: EncodeFn\n readonly baseDecode: DecodeFn\n readonly encoder: Encoder<Base, Prefix>\n readonly decoder: Decoder<Base, Prefix>\n\n constructor (name: Base, prefix: Prefix, baseEncode: EncodeFn, baseDecode: DecodeFn) {\n this.name = name\n this.prefix = prefix\n this.baseEncode = baseEncode\n this.baseDecode = baseDecode\n this.encoder = new Encoder(name, prefix, baseEncode)\n this.decoder = new Decoder(name, prefix, baseDecode)\n }\n\n encode (input: Uint8Array): string {\n return this.encoder.encode(input)\n }\n\n decode (input: string): Uint8Array {\n return this.decoder.decode(input)\n }\n}\n\nexport function from <Base extends string, Prefix extends string> ({ name, prefix, encode, decode }: { name: Base, prefix: Prefix, encode: EncodeFn, decode: DecodeFn }): Codec<Base, Prefix> {\n return new Codec(name, prefix, encode, decode)\n}\n\nexport function baseX <Base extends string, Prefix extends string> ({ name, prefix, alphabet }: { name: Base, prefix: Prefix, alphabet: string }): Codec<Base, Prefix> {\n const { encode, decode } = basex(alphabet, name)\n return from({\n prefix,\n name,\n encode,\n decode: (text: string): Uint8Array => coerce(decode(text))\n })\n}\n\nfunction decode (string: string, alphabetIdx: Record<string, number>, bitsPerChar: number, name: string): Uint8Array {\n // Count the padding bytes:\n let end = string.length\n while (string[end - 1] === '=') {\n --end\n }\n\n // Allocate the output:\n const out = new Uint8Array((end * bitsPerChar / 8) | 0)\n\n // Parse the data:\n let bits = 0 // Number of bits currently in the buffer\n let buffer = 0 // Bits waiting to be written out, MSB first\n let written = 0 // Next byte to write\n for (let i = 0; i < end; ++i) {\n // Read one character from the string:\n const value = alphabetIdx[string[i]]\n if (value === undefined) {\n throw new SyntaxError(`Non-${name} character`)\n }\n\n // Append the bits to the buffer:\n buffer = (buffer << bitsPerChar) | value\n bits += bitsPerChar\n\n // Write out some bits if the buffer has a byte's worth:\n if (bits >= 8) {\n bits -= 8\n out[written++] = 0xff & (buffer >> bits)\n }\n }\n\n // Verify that we have received just enough bits:\n if (bits >= bitsPerChar || (0xff & (buffer << (8 - bits))) !== 0) {\n throw new SyntaxError('Unexpected end of data')\n }\n\n return out\n}\n\nfunction encode (data: Uint8Array, alphabet: string, bitsPerChar: number): string {\n const pad = alphabet[alphabet.length - 1] === '='\n const mask = (1 << bitsPerChar) - 1\n let out = ''\n\n let bits = 0 // Number of bits currently in the buffer\n let buffer = 0 // Bits waiting to be written out, MSB first\n for (let i = 0; i < data.length; ++i) {\n // Slurp data into the buffer:\n buffer = (buffer << 8) | data[i]\n bits += 8\n\n // Write out as much as we can:\n while (bits > bitsPerChar) {\n bits -= bitsPerChar\n out += alphabet[mask & (buffer >> bits)]\n }\n }\n\n // Partial character:\n if (bits !== 0) {\n out += alphabet[mask & (buffer << (bitsPerChar - bits))]\n }\n\n // Add padding characters until we hit a byte boundary:\n if (pad) {\n while (((out.length * bitsPerChar) & 7) !== 0) {\n out += '='\n }\n }\n\n return out\n}\n\nfunction createAlphabetIdx (alphabet: string): Record<string, number> {\n // Build the character lookup table:\n const alphabetIdx: Record<string, number> = {}\n for (let i = 0; i < alphabet.length; ++i) {\n alphabetIdx[alphabet[i]] = i\n }\n return alphabetIdx\n}\n\n/**\n * RFC4648 Factory\n */\nexport function rfc4648 <Base extends string, Prefix extends string> ({ name, prefix, bitsPerChar, alphabet }: { name: Base, prefix: Prefix, bitsPerChar: number, alphabet: string }): Codec<Base, Prefix> {\n const alphabetIdx = createAlphabetIdx(alphabet)\n return from({\n prefix,\n name,\n encode (input: Uint8Array): string {\n return encode(input, alphabet, bitsPerChar)\n },\n decode (input: string): Uint8Array {\n return decode(input, alphabetIdx, bitsPerChar, name)\n }\n })\n}\n", "import { rfc4648 } from './base.js'\n\nexport const base16 = rfc4648({\n prefix: 'f',\n name: 'base16',\n alphabet: '0123456789abcdef',\n bitsPerChar: 4\n})\n\nexport const base16upper = rfc4648({\n prefix: 'F',\n name: 'base16upper',\n alphabet: '0123456789ABCDEF',\n bitsPerChar: 4\n})\n", "import { rfc4648 } from './base.js'\n\nexport const base2 = rfc4648({\n prefix: '0',\n name: 'base2',\n alphabet: '01',\n bitsPerChar: 1\n})\n", "import { from } from './base.js'\n\nconst alphabet = Array.from('\uD83D\uDE80\uD83E\uDE90\u2604\uD83D\uDEF0\uD83C\uDF0C\uD83C\uDF11\uD83C\uDF12\uD83C\uDF13\uD83C\uDF14\uD83C\uDF15\uD83C\uDF16\uD83C\uDF17\uD83C\uDF18\uD83C\uDF0D\uD83C\uDF0F\uD83C\uDF0E\uD83D\uDC09\u2600\uD83D\uDCBB\uD83D\uDDA5\uD83D\uDCBE\uD83D\uDCBF\uD83D\uDE02\u2764\uD83D\uDE0D\uD83E\uDD23\uD83D\uDE0A\uD83D\uDE4F\uD83D\uDC95\uD83D\uDE2D\uD83D\uDE18\uD83D\uDC4D\uD83D\uDE05\uD83D\uDC4F\uD83D\uDE01\uD83D\uDD25\uD83E\uDD70\uD83D\uDC94\uD83D\uDC96\uD83D\uDC99\uD83D\uDE22\uD83E\uDD14\uD83D\uDE06\uD83D\uDE44\uD83D\uDCAA\uD83D\uDE09\u263A\uD83D\uDC4C\uD83E\uDD17\uD83D\uDC9C\uD83D\uDE14\uD83D\uDE0E\uD83D\uDE07\uD83C\uDF39\uD83E\uDD26\uD83C\uDF89\uD83D\uDC9E\u270C\u2728\uD83E\uDD37\uD83D\uDE31\uD83D\uDE0C\uD83C\uDF38\uD83D\uDE4C\uD83D\uDE0B\uD83D\uDC97\uD83D\uDC9A\uD83D\uDE0F\uD83D\uDC9B\uD83D\uDE42\uD83D\uDC93\uD83E\uDD29\uD83D\uDE04\uD83D\uDE00\uD83D\uDDA4\uD83D\uDE03\uD83D\uDCAF\uD83D\uDE48\uD83D\uDC47\uD83C\uDFB6\uD83D\uDE12\uD83E\uDD2D\u2763\uD83D\uDE1C\uD83D\uDC8B\uD83D\uDC40\uD83D\uDE2A\uD83D\uDE11\uD83D\uDCA5\uD83D\uDE4B\uD83D\uDE1E\uD83D\uDE29\uD83D\uDE21\uD83E\uDD2A\uD83D\uDC4A\uD83E\uDD73\uD83D\uDE25\uD83E\uDD24\uD83D\uDC49\uD83D\uDC83\uD83D\uDE33\u270B\uD83D\uDE1A\uD83D\uDE1D\uD83D\uDE34\uD83C\uDF1F\uD83D\uDE2C\uD83D\uDE43\uD83C\uDF40\uD83C\uDF37\uD83D\uDE3B\uD83D\uDE13\u2B50\u2705\uD83E\uDD7A\uD83C\uDF08\uD83D\uDE08\uD83E\uDD18\uD83D\uDCA6\u2714\uD83D\uDE23\uD83C\uDFC3\uD83D\uDC90\u2639\uD83C\uDF8A\uD83D\uDC98\uD83D\uDE20\u261D\uD83D\uDE15\uD83C\uDF3A\uD83C\uDF82\uD83C\uDF3B\uD83D\uDE10\uD83D\uDD95\uD83D\uDC9D\uD83D\uDE4A\uD83D\uDE39\uD83D\uDDE3\uD83D\uDCAB\uD83D\uDC80\uD83D\uDC51\uD83C\uDFB5\uD83E\uDD1E\uD83D\uDE1B\uD83D\uDD34\uD83D\uDE24\uD83C\uDF3C\uD83D\uDE2B\u26BD\uD83E\uDD19\u2615\uD83C\uDFC6\uD83E\uDD2B\uD83D\uDC48\uD83D\uDE2E\uD83D\uDE46\uD83C\uDF7B\uD83C\uDF43\uD83D\uDC36\uD83D\uDC81\uD83D\uDE32\uD83C\uDF3F\uD83E\uDDE1\uD83C\uDF81\u26A1\uD83C\uDF1E\uD83C\uDF88\u274C\u270A\uD83D\uDC4B\uD83D\uDE30\uD83E\uDD28\uD83D\uDE36\uD83E\uDD1D\uD83D\uDEB6\uD83D\uDCB0\uD83C\uDF53\uD83D\uDCA2\uD83E\uDD1F\uD83D\uDE41\uD83D\uDEA8\uD83D\uDCA8\uD83E\uDD2C\u2708\uD83C\uDF80\uD83C\uDF7A\uD83E\uDD13\uD83D\uDE19\uD83D\uDC9F\uD83C\uDF31\uD83D\uDE16\uD83D\uDC76\uD83E\uDD74\u25B6\u27A1\u2753\uD83D\uDC8E\uD83D\uDCB8\u2B07\uD83D\uDE28\uD83C\uDF1A\uD83E\uDD8B\uD83D\uDE37\uD83D\uDD7A\u26A0\uD83D\uDE45\uD83D\uDE1F\uD83D\uDE35\uD83D\uDC4E\uD83E\uDD32\uD83E\uDD20\uD83E\uDD27\uD83D\uDCCC\uD83D\uDD35\uD83D\uDC85\uD83E\uDDD0\uD83D\uDC3E\uD83C\uDF52\uD83D\uDE17\uD83E\uDD11\uD83C\uDF0A\uD83E\uDD2F\uD83D\uDC37\u260E\uD83D\uDCA7\uD83D\uDE2F\uD83D\uDC86\uD83D\uDC46\uD83C\uDFA4\uD83D\uDE47\uD83C\uDF51\u2744\uD83C\uDF34\uD83D\uDCA3\uD83D\uDC38\uD83D\uDC8C\uD83D\uDCCD\uD83E\uDD40\uD83E\uDD22\uD83D\uDC45\uD83D\uDCA1\uD83D\uDCA9\uD83D\uDC50\uD83D\uDCF8\uD83D\uDC7B\uD83E\uDD10\uD83E\uDD2E\uD83C\uDFBC\uD83E\uDD75\uD83D\uDEA9\uD83C\uDF4E\uD83C\uDF4A\uD83D\uDC7C\uD83D\uDC8D\uD83D\uDCE3\uD83E\uDD42')\nconst alphabetBytesToChars: string[] = (alphabet.reduce<string[]>((p, c, i) => { p[i] = c; return p }, ([])))\nconst alphabetCharsToBytes: number[] = (alphabet.reduce<number[]>((p, c, i) => {\n const codePoint = c.codePointAt(0)\n if (codePoint == null) {\n throw new Error(`Invalid character: ${c}`)\n }\n p[codePoint] = i\n return p\n}, ([])))\n\nfunction encode (data: Uint8Array): string {\n return data.reduce((p, c) => {\n p += alphabetBytesToChars[c]\n return p\n }, '')\n}\n\nfunction decode (str: string): Uint8Array {\n const byts = []\n for (const char of str) {\n const codePoint = char.codePointAt(0)\n if (codePoint == null) {\n throw new Error(`Invalid character: ${char}`)\n }\n const byt = alphabetCharsToBytes[codePoint]\n if (byt == null) {\n throw new Error(`Non-base256emoji character: ${char}`)\n }\n byts.push(byt)\n }\n return new Uint8Array(byts)\n}\n\nexport const base256emoji = from({\n prefix: '\uD83D\uDE80',\n name: 'base256emoji',\n encode,\n decode\n})\n", "import { rfc4648 } from './base.js'\n\nexport const base32 = rfc4648({\n prefix: 'b',\n name: 'base32',\n alphabet: 'abcdefghijklmnopqrstuvwxyz234567',\n bitsPerChar: 5\n})\n\nexport const base32upper = rfc4648({\n prefix: 'B',\n name: 'base32upper',\n alphabet: 'ABCDEFGHIJKLMNOPQRSTUVWXYZ234567',\n bitsPerChar: 5\n})\n\nexport const base32pad = rfc4648({\n prefix: 'c',\n name: 'base32pad',\n alphabet: 'abcdefghijklmnopqrstuvwxyz234567=',\n bitsPerChar: 5\n})\n\nexport const base32padupper = rfc4648({\n prefix: 'C',\n name: 'base32padupper',\n alphabet: 'ABCDEFGHIJKLMNOPQRSTUVWXYZ234567=',\n bitsPerChar: 5\n})\n\nexport const base32hex = rfc4648({\n prefix: 'v',\n name: 'base32hex',\n alphabet: '0123456789abcdefghijklmnopqrstuv',\n bitsPerChar: 5\n})\n\nexport const base32hexupper = rfc4648({\n prefix: 'V',\n name: 'base32hexupper',\n alphabet: '0123456789ABCDEFGHIJKLMNOPQRSTUV',\n bitsPerChar: 5\n})\n\nexport const base32hexpad = rfc4648({\n prefix: 't',\n name: 'base32hexpad',\n alphabet: '0123456789abcdefghijklmnopqrstuv=',\n bitsPerChar: 5\n})\n\nexport const base32hexpadupper = rfc4648({\n prefix: 'T',\n name: 'base32hexpadupper',\n alphabet: '0123456789ABCDEFGHIJKLMNOPQRSTUV=',\n bitsPerChar: 5\n})\n\nexport const base32z = rfc4648({\n prefix: 'h',\n name: 'base32z',\n alphabet: 'ybndrfg8ejkmcpqxot1uwisza345h769',\n bitsPerChar: 5\n})\n", "import { baseX } from './base.js'\n\nexport const base36 = baseX({\n prefix: 'k',\n name: 'base36',\n alphabet: '0123456789abcdefghijklmnopqrstuvwxyz'\n})\n\nexport const base36upper = baseX({\n prefix: 'K',\n name: 'base36upper',\n alphabet: '0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZ'\n})\n", "import { baseX } from './base.js'\n\nexport const base58btc = baseX({\n name: 'base58btc',\n prefix: 'z',\n alphabet: '123456789ABCDEFGHJKLMNPQRSTUVWXYZabcdefghijkmnopqrstuvwxyz'\n})\n\nexport const base58flickr = baseX({\n name: 'base58flickr',\n prefix: 'Z',\n alphabet: '123456789abcdefghijkmnopqrstuvwxyzABCDEFGHJKLMNPQRSTUVWXYZ'\n})\n", "import { rfc4648 } from './base.js'\n\nexport const base64 = rfc4648({\n prefix: 'm',\n name: 'base64',\n alphabet: 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/',\n bitsPerChar: 6\n})\n\nexport const base64pad = rfc4648({\n prefix: 'M',\n name: 'base64pad',\n alphabet: 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=',\n bitsPerChar: 6\n})\n\nexport const base64url = rfc4648({\n prefix: 'u',\n name: 'base64url',\n alphabet: 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789-_',\n bitsPerChar: 6\n})\n\nexport const base64urlpad = rfc4648({\n prefix: 'U',\n name: 'base64urlpad',\n alphabet: 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789-_=',\n bitsPerChar: 6\n})\n", "import { rfc4648 } from './base.js'\n\nexport const base8 = rfc4648({\n prefix: '7',\n name: 'base8',\n alphabet: '01234567',\n bitsPerChar: 3\n})\n", "import { fromString, toString } from '../bytes.js'\nimport { from } from './base.js'\n\nexport const identity = from({\n prefix: '\\x00',\n name: 'identity',\n encode: (buf) => toString(buf),\n decode: (str) => fromString(str)\n})\n", "import type { ArrayBufferView, ByteView } from './interface.js'\n\nconst textEncoder = new TextEncoder()\nconst textDecoder = new TextDecoder()\n\nexport const name = 'json'\nexport const code = 0x0200\n\nexport function encode <T> (node: T): ByteView<T> {\n return textEncoder.encode(JSON.stringify(node))\n}\n\nexport function decode <T> (data: ByteView<T> | ArrayBufferView<T>): T {\n return JSON.parse(textDecoder.decode(data))\n}\n", "import { coerce } from '../bytes.js'\nimport * as Digest from './digest.js'\nimport type { DigestOptions } from './hasher.js'\n\nconst code: 0x0 = 0x0\nconst name = 'identity'\n\nconst encode: (input: Uint8Array) => Uint8Array = coerce\n\nfunction digest (input: Uint8Array, options?: DigestOptions): Digest.Digest<typeof code, number> {\n if (options?.truncate != null && options.truncate !== input.byteLength) {\n if (options.truncate < 0 || options.truncate > input.byteLength) {\n throw new Error(`Invalid truncate option, must be less than or equal to ${input.byteLength}`)\n }\n\n input = input.subarray(0, options.truncate)\n }\n\n return Digest.create(code, encode(input))\n}\n\nexport const identity = { code, name, encode, digest }\n", "/* eslint-disable */\nvar encode_1 = encode;\n\nvar MSB = 0x80\n , REST = 0x7F\n , MSBALL = ~REST\n , INT = Math.pow(2, 31);\n\n/**\n * @param {number} num\n * @param {number[]} out\n * @param {number} offset\n */\nfunction encode(num, out, offset) {\n out = out || [];\n offset = offset || 0;\n var oldOffset = offset;\n\n while(num >= INT) {\n out[offset++] = (num & 0xFF) | MSB;\n num /= 128;\n }\n while(num & MSBALL) {\n out[offset++] = (num & 0xFF) | MSB;\n num >>>= 7;\n }\n out[offset] = num | 0;\n \n // @ts-ignore\n encode.bytes = offset - oldOffset + 1;\n \n return out\n}\n\nvar decode = read;\n\nvar MSB$1 = 0x80\n , REST$1 = 0x7F;\n\n/**\n * @param {string | any[]} buf\n * @param {number} offset\n */\nfunction read(buf, offset) {\n var res = 0\n , offset = offset || 0\n , shift = 0\n , counter = offset\n , b\n , l = buf.length;\n\n do {\n if (counter >= l) {\n // @ts-ignore\n read.bytes = 0;\n throw new RangeError('Could not decode varint')\n }\n b = buf[counter++];\n res += shift < 28\n ? (b & REST$1) << shift\n : (b & REST$1) * Math.pow(2, shift);\n shift += 7;\n } while (b >= MSB$1)\n\n // @ts-ignore\n read.bytes = counter - offset;\n\n return res\n}\n\nvar N1 = Math.pow(2, 7);\nvar N2 = Math.pow(2, 14);\nvar N3 = Math.pow(2, 21);\nvar N4 = Math.pow(2, 28);\nvar N5 = Math.pow(2, 35);\nvar N6 = Math.pow(2, 42);\nvar N7 = Math.pow(2, 49);\nvar N8 = Math.pow(2, 56);\nvar N9 = Math.pow(2, 63);\n\nvar length = function (/** @type {number} */ value) {\n return (\n value < N1 ? 1\n : value < N2 ? 2\n : value < N3 ? 3\n : value < N4 ? 4\n : value < N5 ? 5\n : value < N6 ? 6\n : value < N7 ? 7\n : value < N8 ? 8\n : value < N9 ? 9\n : 10\n )\n};\n\nvar varint = {\n encode: encode_1\n , decode: decode\n , encodingLength: length\n};\n\nvar _brrp_varint = varint;\n\nexport default _brrp_varint;\n", "import varint from './vendor/varint.js'\n\nexport function decode (data: Uint8Array, offset = 0): [number, number] {\n const code = varint.decode(data, offset)\n return [code, varint.decode.bytes]\n}\n\nexport function encodeTo (int: number, target: Uint8Array, offset = 0): Uint8Array {\n varint.encode(int, target, offset)\n return target\n}\n\nexport function encodingLength (int: number): number {\n return varint.encodingLength(int)\n}\n", "import { coerce, equals as equalBytes } from '../bytes.js'\nimport * as varint from '../varint.js'\nimport type { MultihashDigest } from './interface.js'\n\n/**\n * Creates a multihash digest.\n */\nexport function create <Code extends number> (code: Code, digest: Uint8Array): Digest<Code, number> {\n const size = digest.byteLength\n const sizeOffset = varint.encodingLength(code)\n const digestOffset = sizeOffset + varint.encodingLength(size)\n\n const bytes = new Uint8Array(digestOffset + size)\n varint.encodeTo(code, bytes, 0)\n varint.encodeTo(size, bytes, sizeOffset)\n bytes.set(digest, digestOffset)\n\n return new Digest(code, size, digest, bytes)\n}\n\n/**\n * Turns bytes representation of multihash digest into an instance.\n */\nexport function decode (multihash: Uint8Array): MultihashDigest {\n const bytes = coerce(multihash)\n const [code, sizeOffset] = varint.decode(bytes)\n const [size, digestOffset] = varint.decode(bytes.subarray(sizeOffset))\n const digest = bytes.subarray(sizeOffset + digestOffset)\n\n if (digest.byteLength !== size) {\n throw new Error('Incorrect length')\n }\n\n return new Digest(code, size, digest, bytes)\n}\n\nexport function equals (a: MultihashDigest, b: unknown): b is MultihashDigest {\n if (a === b) {\n return true\n } else {\n const data = b as { code?: unknown, size?: unknown, bytes?: unknown }\n\n return (\n a.code === data.code &&\n a.size === data.size &&\n data.bytes instanceof Uint8Array &&\n equalBytes(a.bytes, data.bytes)\n )\n }\n}\n\n/**\n * Represents a multihash digest which carries information about the\n * hashing algorithm and an actual hash digest.\n */\nexport class Digest<Code extends number, Size extends number> implements MultihashDigest {\n readonly code: Code\n readonly size: Size\n readonly digest: Uint8Array\n readonly bytes: Uint8Array\n\n /**\n * Creates a multihash digest.\n */\n constructor (code: Code, size: Size, digest: Uint8Array, bytes: Uint8Array) {\n this.code = code\n this.size = size\n this.digest = digest\n this.bytes = bytes\n }\n}\n\n/**\n * Used to check that the passed multihash has the passed code\n */\nexport function hasCode <T extends number> (digest: MultihashDigest, code: T): digest is MultihashDigest<T> {\n return digest.code === code\n}\n", "import crypto from 'crypto'\nimport { coerce } from '../bytes.js'\nimport { from } from './hasher.js'\n\nexport const sha256 = from({\n name: 'sha2-256',\n code: 0x12,\n encode: (input) => coerce(crypto.createHash('sha256').update(input).digest())\n})\n\nexport const sha512 = from({\n name: 'sha2-512',\n code: 0x13,\n encode: input => coerce(crypto.createHash('sha512').update(input).digest())\n})\n", "import * as Digest from './digest.js'\nimport type { MultihashHasher } from './interface.js'\n\ntype Await<T> = Promise<T> | T\n\nconst DEFAULT_MIN_DIGEST_LENGTH = 20\n\nexport interface HasherInit <Name extends string, Code extends number> {\n name: Name\n code: Code\n encode(input: Uint8Array): Await<Uint8Array>\n\n /**\n * The minimum length a hash is allowed to be truncated to in bytes\n *\n * @default 20\n */\n minDigestLength?: number\n\n /**\n * The maximum length a hash is allowed to be truncated to in bytes. If not\n * specified it will be inferred from the length of the digest.\n */\n maxDigestLength?: number\n}\n\nexport function from <Name extends string, Code extends number> ({ name, code, encode, minDigestLength, maxDigestLength }: HasherInit<Name, Code>): Hasher<Name, Code> {\n return new Hasher(name, code, encode, minDigestLength, maxDigestLength)\n}\n\nexport interface DigestOptions {\n /**\n * Truncate the returned digest to this number of bytes.\n *\n * This may cause the digest method to throw/reject if the passed value is\n * greater than the digest length or below a threshold under which the risk of\n * hash collisions is significant.\n *\n * The actual value of this threshold can depend on the hashing algorithm in\n * use.\n */\n truncate?: number\n}\n\n/**\n * Hasher represents a hashing algorithm implementation that produces as\n * `MultihashDigest`.\n */\nexport class Hasher<Name extends string, Code extends number> implements MultihashHasher<Code> {\n readonly name: Name\n readonly code: Code\n readonly encode: (input: Uint8Array) => Await<Uint8Array>\n readonly minDigestLength: number\n readonly maxDigestLength?: number\n\n constructor (name: Name, code: Code, encode: (input: Uint8Array) => Await<Uint8Array>, minDigestLength?: number, maxDigestLength?: number) {\n this.name = name\n this.code = code\n this.encode = encode\n this.minDigestLength = minDigestLength ?? DEFAULT_MIN_DIGEST_LENGTH\n this.maxDigestLength = maxDigestLength\n }\n\n digest (input: Uint8Array, options?: DigestOptions): Await<Digest.Digest<Code, number>> {\n if (options?.truncate != null) {\n if (options.truncate < this.minDigestLength) {\n throw new Error(`Invalid truncate option, must be greater than or equal to ${this.minDigestLength}`)\n }\n\n if (this.maxDigestLength != null && options.truncate > this.maxDigestLength) {\n throw new Error(`Invalid truncate option, must be less than or equal to ${this.maxDigestLength}`)\n }\n }\n\n if (input instanceof Uint8Array) {\n const result = this.encode(input)\n\n if (result instanceof Uint8Array) {\n return createDigest(result, this.code, options?.truncate)\n }\n\n return result.then(digest => createDigest(digest, this.code, options?.truncate))\n } else {\n throw Error('Unknown type, must be binary type')\n /* c8 ignore next 1 */\n }\n }\n}\n\n/**\n * Create a Digest from the passed uint8array and code, optionally truncating it\n * first.\n */\nfunction createDigest <Code extends number> (digest: Uint8Array, code: Code, truncate?: number): Digest.Digest<Code, number> {\n if (truncate != null && truncate !== digest.byteLength) {\n if (truncate > digest.byteLength) {\n throw new Error(`Invalid truncate option, must be less than or equal to ${digest.byteLength}`)\n }\n\n digest = digest.subarray(0, truncate)\n }\n\n return Digest.create(code, digest)\n}\n", "import { base32 } from './bases/base32.js'\nimport { base36 } from './bases/base36.js'\nimport { base58btc } from './bases/base58.js'\nimport { coerce } from './bytes.js'\nimport * as Digest from './hashes/digest.js'\nimport * as varint from './varint.js'\nimport type * as API from './link/interface.js'\n\n// This way TS will also expose all the types from module\nexport * from './link/interface.js'\n\nexport function format <T extends API.Link<unknown, number, number, API.Version>, Prefix extends string> (link: T, base?: API.MultibaseEncoder<Prefix>): API.ToString<T, Prefix> {\n const { bytes, version } = link\n switch (version) {\n case 0:\n return toStringV0(\n bytes,\n baseCache(link),\n base as API.MultibaseEncoder<'z'> ?? base58btc.encoder\n )\n default:\n return toStringV1(\n bytes,\n baseCache(link),\n (base ?? base32.encoder) as API.MultibaseEncoder<Prefix>\n )\n }\n}\n\nexport function toJSON <Link extends API.UnknownLink> (link: Link): API.LinkJSON<Link> {\n return {\n '/': format(link)\n }\n}\n\nexport function fromJSON <Link extends API.UnknownLink> (json: API.LinkJSON<Link>): CID<unknown, number, number, API.Version> {\n return CID.parse(json['/'])\n}\n\nconst cache = new WeakMap<API.UnknownLink, Map<string, string>>()\n\nfunction baseCache (cid: API.UnknownLink): Map<string, string> {\n const baseCache = cache.get(cid)\n if (baseCache == null) {\n const baseCache = new Map()\n cache.set(cid, baseCache)\n return baseCache\n }\n return baseCache\n}\n\nexport class CID<Data = unknown, Format extends number = number, Alg extends number = number, Version extends API.Version = API.Version> implements API.Link<Data, Format, Alg, Version> {\n readonly code: Format\n readonly version: Version\n readonly multihash: API.MultihashDigest<Alg>\n readonly bytes: Uint8Array\n readonly '/': Uint8Array\n\n /**\n * @param version - Version of the CID\n * @param code - Code of the codec content is encoded in, see https://github.com/multiformats/multicodec/blob/master/table.csv\n * @param multihash - (Multi)hash of the of the content.\n */\n constructor (version: Version, code: Format, multihash: API.MultihashDigest<Alg>, bytes: Uint8Array) {\n this.code = code\n this.version = version\n this.multihash = multihash\n this.bytes = bytes\n\n // flag to serializers that this is a CID and\n // should be treated specially\n this['/'] = bytes\n }\n\n /**\n * Signalling `cid.asCID === cid` has been replaced with `cid['/'] === cid.bytes`\n * please either use `CID.asCID(cid)` or switch to new signalling mechanism\n *\n * @deprecated\n */\n get asCID (): this {\n return this\n }\n\n // ArrayBufferView\n get byteOffset (): number {\n return this.bytes.byteOffset\n }\n\n // ArrayBufferView\n get byteLength (): number {\n return this.bytes.byteLength\n }\n\n toV0 (): CID<Data, API.DAG_PB, API.SHA_256, 0> {\n switch (this.version) {\n case 0: {\n return this as CID<Data, API.DAG_PB, API.SHA_256, 0>\n }\n case 1: {\n const { code, multihash } = this\n\n if (code !== DAG_PB_CODE) {\n throw new Error('Cannot convert a non dag-pb CID to CIDv0')\n }\n\n // sha2-256\n if (multihash.code !== SHA_256_CODE) {\n throw new Error('Cannot convert non sha2-256 multihash CID to CIDv0')\n }\n\n return (\n CID.createV0(\n multihash as API.MultihashDigest<API.SHA_256>\n )\n )\n }\n default: {\n throw Error(\n `Can not convert CID version ${this.version} to version 0. This is a bug please report`\n )\n }\n }\n }\n\n toV1 (): CID<Data, Format, Alg, 1> {\n switch (this.version) {\n case 0: {\n const { code, digest } = this.multihash\n const multihash = Digest.create(code, digest)\n return (\n CID.createV1(this.code, multihash)\n )\n }\n case 1: {\n return this as CID<Data, Format, Alg, 1>\n }\n default: {\n throw Error(\n `Can not convert CID version ${this.version} to version 1. This is a bug please report`\n )\n }\n }\n }\n\n equals (other: unknown): other is CID<Data, Format, Alg, Version> {\n return CID.equals(this, other)\n }\n\n static equals <Data, Format extends number, Alg extends number, Version extends API.Version>(self: API.Link<Data, Format, Alg, Version>, other: unknown): other is CID {\n const unknown = other as { code?: unknown, version?: unknown, multihash?: unknown }\n return (\n unknown != null &&\n self.code === unknown.code &&\n self.version === unknown.version &&\n Digest.equals(self.multihash, unknown.multihash)\n )\n }\n\n toString (base?: API.MultibaseEncoder<string>): string {\n return format(this, base)\n }\n\n toJSON (): API.LinkJSON<this> {\n return { '/': format(this) }\n }\n\n link (): this {\n return this\n }\n\n readonly [Symbol.toStringTag] = 'CID';\n\n // Legacy\n\n [Symbol.for('nodejs.util.inspect.custom')] (): string {\n return `CID(${this.toString()})`\n }\n\n /**\n * Takes any input `value` and returns a `CID` instance if it was\n * a `CID` otherwise returns `null`. If `value` is instanceof `CID`\n * it will return value back. If `value` is not instance of this CID\n * class, but is compatible CID it will return new instance of this\n * `CID` class. Otherwise returns null.\n *\n * This allows two different incompatible versions of CID library to\n * co-exist and interop as long as binary interface is compatible.\n */\n static asCID <Data, Format extends number, Alg extends number, Version extends API.Version, U>(input: API.Link<Data, Format, Alg, Version> | U): CID<Data, Format, Alg, Version> | null {\n if (input == null) {\n return null\n }\n\n const value = input as any\n if (value instanceof CID) {\n // If value is instance of CID then we're all set.\n return value\n } else if ((value['/'] != null && value['/'] === value.bytes) || value.asCID === value) {\n // If value isn't instance of this CID class but `this.asCID === this` or\n // `value['/'] === value.bytes` is true it is CID instance coming from a\n // different implementation (diff version or duplicate). In that case we\n // rebase it to this `CID` implementation so caller is guaranteed to get\n // instance with expected API.\n const { version, code, multihash, bytes } = value\n return new CID(\n version,\n code,\n multihash as API.MultihashDigest<Alg>,\n bytes ?? encodeCID(version, code, multihash.bytes)\n )\n } else if (value[cidSymbol] === true) {\n // If value is a CID from older implementation that used to be tagged via\n // symbol we still rebase it to the this `CID` implementation by\n // delegating that to a constructor.\n const { version, multihash, code } = value\n const digest = Digest.decode(multihash) as API.MultihashDigest<Alg>\n return CID.create(version, code, digest)\n } else {\n // Otherwise value is not a CID (or an incompatible version of it) in\n // which case we return `null`.\n return null\n }\n }\n\n /**\n * @param version - Version of the CID\n * @param code - Code of the codec content is encoded in, see https://github.com/multiformats/multicodec/blob/master/table.csv\n * @param digest - (Multi)hash of the of the content.\n */\n static create <Data, Format extends number, Alg extends number, Version extends API.Version>(version: Version, code: Format, digest: API.MultihashDigest<Alg>): CID<Data, Format, Alg, Version> {\n if (typeof code !== 'number') {\n throw new Error('String codecs are no longer supported')\n }\n\n if (!(digest.bytes instanceof Uint8Array)) {\n throw new Error('Invalid digest')\n }\n\n switch (version) {\n case 0: {\n if (code !== DAG_PB_CODE) {\n throw new Error(\n `Version 0 CID must use dag-pb (code: ${DAG_PB_CODE}) block encoding`\n )\n } else {\n return new CID(version, code, digest, digest.bytes)\n }\n }\n case 1: {\n const bytes = encodeCID(version, code, digest.bytes)\n return new CID(version, code, digest, bytes)\n }\n default: {\n throw new Error('Invalid version')\n }\n }\n }\n\n /**\n * Simplified version of `create` for CIDv0.\n */\n static createV0 <T = unknown>(digest: API.MultihashDigest<typeof SHA_256_CODE>): CID<T, typeof DAG_PB_CODE, typeof SHA_256_CODE, 0> {\n return CID.create(0, DAG_PB_CODE, digest)\n }\n\n /**\n * Simplified version of `create` for CIDv1.\n *\n * @param code - Content encoding format code.\n * @param digest - Multihash of the content.\n */\n static createV1 <Data, Code extends number, Alg extends number>(code: Code, digest: API.MultihashDigest<Alg>): CID<Data, Code, Alg, 1> {\n return CID.create(1, code, digest)\n }\n\n /**\n * Decoded a CID from its binary representation. The byte array must contain\n * only the CID with no additional bytes.\n *\n * An error will be thrown if the bytes provided do not contain a valid\n * binary representation of a CID.\n */\n static decode <Data, Code extends number, Alg extends number, Version extends API.Version>(bytes: API.ByteView<API.Link<Data, Code, Alg, Version>>): CID<Data, Code, Alg, Version> {\n const [cid, remainder] = CID.decodeFirst(bytes)\n if (remainder.length !== 0) {\n throw new Error('Incorrect length')\n }\n return cid\n }\n\n /**\n * Decoded a CID from its binary representation at the beginning of a byte\n * array.\n *\n * Returns an array with the first element containing the CID and the second\n * element containing the remainder of the original byte array. The remainder\n * will be a zero-length byte array if the provided bytes only contained a\n * binary CID representation.\n */\n static decodeFirst <T, C extends number, A extends number, V extends API.Version>(bytes: API.ByteView<API.Link<T, C, A, V>>): [CID<T, C, A, V>, Uint8Array] {\n const specs = CID.inspectBytes(bytes)\n const prefixSize = specs.size - specs.multihashSize\n const multihashBytes = coerce(\n bytes.subarray(prefixSize, prefixSize + specs.multihashSize)\n )\n if (multihashBytes.byteLength !== specs.multihashSize) {\n throw new Error('Incorrect length')\n }\n const digestBytes = multihashBytes.subarray(\n specs.multihashSize - specs.digestSize\n )\n const digest = new Digest.Digest(\n specs.multihashCode,\n specs.digestSize,\n digestBytes,\n multihashBytes\n )\n const cid =\n specs.version === 0\n ? CID.createV0(digest as API.MultihashDigest<API.SHA_256>)\n : CID.createV1(specs.codec, digest)\n return [cid as CID<T, C, A, V>, bytes.subarray(specs.size)]\n }\n\n /**\n * Inspect the initial bytes of a CID to determine its properties.\n *\n * Involves decoding up to 4 varints. Typically this will require only 4 to 6\n * bytes but for larger multicodec code values and larger multihash digest\n * lengths these varints can be quite large. It is recommended that at least\n * 10 bytes be made available in the `initialBytes` argument for a complete\n * inspection.\n */\n static inspectBytes <T, C extends number, A extends number, V extends API.Version>(initialBytes: API.ByteView<API.Link<T, C, A, V>>): { version: V, codec: C, multihashCode: A, digestSize: number, multihashSize: number, size: number } {\n let offset = 0\n const next = (): number => {\n const [i, length] = varint.decode(initialBytes.subarray(offset))\n offset += length\n return i\n }\n\n let version = next() as V\n let codec = DAG_PB_CODE as C\n if (version as number === 18) {\n // CIDv0\n version = 0 as V\n offset = 0\n } else {\n codec = next() as C\n }\n\n if (version !== 0 && version !== 1) {\n throw new RangeError(`Invalid CID version ${version}`)\n }\n\n const prefixSize = offset\n const multihashCode = next() as A // multihash code\n const digestSize = next() // multihash length\n const size = offset + digestSize\n const multihashSize = size - prefixSize\n\n return { version, codec, multihashCode, digestSize, multihashSize, size }\n }\n\n /**\n * Takes cid in a string representation and creates an instance. If `base`\n * decoder is not provided will use a default from the configuration. It will\n * throw an error if encoding of the CID is not compatible with supplied (or\n * a default decoder).\n */\n static parse <Prefix extends string, Data, Code extends number, Alg extends number, Version extends API.Version>(source: API.ToString<API.Link<Data, Code, Alg, Version>, Prefix>, base?: API.MultibaseDecoder<Prefix>): CID<Data, Code, Alg, Version> {\n const [prefix, bytes] = parseCIDtoBytes(source, base)\n\n const cid = CID.decode(bytes)\n\n if (cid.version === 0 && source[0] !== 'Q') {\n throw Error('Version 0 CID string must not include multibase prefix')\n }\n\n // Cache string representation to avoid computing it on `this.toString()`\n baseCache(cid).set(prefix, source)\n\n return cid\n }\n}\n\nfunction parseCIDtoBytes <Prefix extends string, Data, Code extends number, Alg extends number, Version extends API.Version> (source: API.ToString<API.Link<Data, Code, Alg, Version>, Prefix>, base?: API.MultibaseDecoder<Prefix>): [Prefix, API.ByteView<API.Link<Data, Code, Alg, Version>>] {\n switch (source[0]) {\n // CIDv0 is parsed differently\n case 'Q': {\n const decoder = base ?? base58btc\n return [\n base58btc.prefix as Prefix,\n decoder.decode(`${base58btc.prefix}${source}`)\n ]\n }\n case base58btc.prefix: {\n const decoder = base ?? base58btc\n return [base58btc.prefix as Prefix, decoder.decode(source)]\n }\n case base32.prefix: {\n const decoder = base ?? base32\n return [base32.prefix as Prefix, decoder.decode(source)]\n }\n case base36.prefix: {\n const decoder = base ?? base36\n return [base36.prefix as Prefix, decoder.decode(source)]\n }\n default: {\n if (base == null) {\n throw Error(\n 'To parse non base32, base36 or base58btc encoded CID multibase decoder must be provided'\n )\n }\n return [source[0] as Prefix, base.decode(source)]\n }\n }\n}\n\nfunction toStringV0 (bytes: Uint8Array, cache: Map<string, string>, base: API.MultibaseEncoder<'z'>): string {\n const { prefix } = base\n if (prefix !== base58btc.prefix) {\n throw Error(`Cannot string encode V0 in ${base.name} encoding`)\n }\n\n const cid = cache.get(prefix)\n if (cid == null) {\n const cid = base.encode(bytes).slice(1)\n cache.set(prefix, cid)\n return cid\n } else {\n return cid\n }\n}\n\nfunction toStringV1 <Prefix extends string> (bytes: Uint8Array, cache: Map<string, string>, base: API.MultibaseEncoder<Prefix>): string {\n const { prefix } = base\n const cid = cache.get(prefix)\n if (cid == null) {\n const cid = base.encode(bytes)\n cache.set(prefix, cid)\n return cid\n } else {\n return cid\n }\n}\n\nconst DAG_PB_CODE = 0x70\nconst SHA_256_CODE = 0x12\n\nfunction encodeCID (version: API.Version, code: number, multihash: Uint8Array): Uint8Array {\n const codeOffset = varint.encodingLength(version)\n const hashOffset = codeOffset + varint.encodingLength(code)\n const bytes = new Uint8Array(hashOffset + multihash.byteLength)\n varint.encodeTo(version, bytes, 0)\n varint.encodeTo(code, bytes, codeOffset)\n bytes.set(multihash, hashOffset)\n return bytes\n}\n\nconst cidSymbol = Symbol.for('@ipld/js-cid/CID')\n", "import * as base10 from './bases/base10.js'\nimport * as base16 from './bases/base16.js'\nimport * as base2 from './bases/base2.js'\nimport * as base256emoji from './bases/base256emoji.js'\nimport * as base32 from './bases/base32.js'\nimport * as base36 from './bases/base36.js'\nimport * as base58 from './bases/base58.js'\nimport * as base64 from './bases/base64.js'\nimport * as base8 from './bases/base8.js'\nimport * as identityBase from './bases/identity.js'\nimport * as json from './codecs/json.js'\nimport * as raw from './codecs/raw.js'\nimport * as identity from './hashes/identity.js'\nimport * as sha2 from './hashes/sha2.js'\nimport { CID, hasher, digest, varint, bytes } from './index.js'\n\nexport const bases = { ...identityBase, ...base2, ...base8, ...base10, ...base16, ...base32, ...base36, ...base58, ...base64, ...base256emoji }\nexport const hashes = { ...sha2, ...identity }\nexport const codecs = { raw, json }\n\nexport { CID, hasher, digest, varint, bytes }\n", "import { bases } from 'multiformats/basics'\nimport type { MultibaseCodec } from 'multiformats'\nimport { allocUnsafe } from '#alloc'\n\nfunction createCodec (name: string, prefix: string, encode: (buf: Uint8Array) => string, decode: (str: string) => Uint8Array): MultibaseCodec<any> {\n return {\n name,\n prefix,\n encoder: {\n name,\n prefix,\n encode\n },\n decoder: {\n decode\n }\n }\n}\n\nconst string = createCodec('utf8', 'u', (buf) => {\n const decoder = new TextDecoder('utf8')\n return 'u' + decoder.decode(buf)\n}, (str) => {\n const encoder = new TextEncoder()\n return encoder.encode(str.substring(1))\n})\n\nconst ascii = createCodec('ascii', 'a', (buf) => {\n let string = 'a'\n\n for (let i = 0; i < buf.length; i++) {\n string += String.fromCharCode(buf[i])\n }\n return string\n}, (str) => {\n str = str.substring(1)\n const buf = allocUnsafe(str.length)\n\n for (let i = 0; i < str.length; i++) {\n buf[i] = str.charCodeAt(i)\n }\n\n return buf\n})\n\nexport type SupportedEncodings = 'utf8' | 'utf-8' | 'hex' | 'latin1' | 'ascii' | 'binary' | keyof typeof bases\n\nconst BASES: Record<SupportedEncodings, MultibaseCodec<any>> = {\n utf8: string,\n 'utf-8': string,\n hex: bases.base16,\n latin1: ascii,\n ascii,\n binary: ascii,\n\n ...bases\n}\n\nexport default BASES\n", "import { allocUnsafe } from 'uint8arrays/alloc'\n\n/**\n * A general purpose buffer pool\n */\nexport default function pool (size?: number): (size: number) => Uint8Array {\n const SIZE = size ?? 8192\n const MAX = SIZE >>> 1\n let slab: Uint8Array\n let offset = SIZE\n return function poolAlloc (size: number) {\n if (size < 1 || size > MAX) {\n return allocUnsafe(size)\n }\n\n if (offset + size > SIZE) {\n slab = allocUnsafe(SIZE)\n offset = 0\n }\n\n const buf = slab.subarray(offset, offset += size)\n\n if ((offset & 7) !== 0) {\n // align to 32 bit\n offset = (offset | 7) + 1\n }\n\n return buf\n }\n}\n", "import { encodeUint8Array, encodingLength } from 'uint8-varint'\nimport { allocUnsafe } from 'uint8arrays/alloc'\nimport { fromString as uint8ArrayFromString } from 'uint8arrays/from-string'\nimport { writeFloatLE, writeDoubleLE } from './float.js'\nimport { LongBits } from './longbits.js'\nimport pool from './pool.js'\nimport * as utf8 from './utf8.js'\nimport type { Writer } from '../index.js'\n\ninterface WriterOperation<T> {\n (val: T, buf: Uint8Array, pos: number): any\n}\n\n/**\n * Constructs a new writer operation instance.\n *\n * @classdesc Scheduled writer operation\n */\nclass Op<T> {\n /**\n * Function to call\n */\n public fn: WriterOperation<T>\n\n /**\n * Value byte length\n */\n public len: number\n\n /**\n * Next operation\n */\n public next?: Op<any>\n\n /**\n * Value to write\n */\n public val: T\n\n constructor (fn: WriterOperation<T>, len: number, val: T) {\n this.fn = fn\n this.len = len\n this.next = undefined\n this.val = val // type varies\n }\n}\n\n/* istanbul ignore next */\nfunction noop (): void {}\n\n/**\n * Constructs a new writer state instance\n */\nclass State {\n /**\n * Current head\n */\n public head: Op<any>\n\n /**\n * Current tail\n */\n public tail: Op<any>\n\n /**\n * Current buffer length\n */\n public len: number\n\n /**\n * Next state\n */\n public next?: State\n\n constructor (writer: Uint8ArrayWriter) {\n this.head = writer.head\n this.tail = writer.tail\n this.len = writer.len\n this.next = writer.states\n }\n}\n\nconst bufferPool = pool()\n\n/**\n * Allocates a buffer of the specified size\n */\nfunction alloc (size: number): Uint8Array {\n if (globalThis.Buffer != null) {\n return allocUnsafe(size)\n }\n\n return bufferPool(size)\n}\n\n/**\n * When a value is written, the writer calculates its byte length and puts it into a linked\n * list of operations to perform when finish() is called. This both allows us to allocate\n * buffers of the exact required size and reduces the amount of work we have to do compared\n * to first calculating over objects and then encoding over objects. In our case, the encoding\n * part is just a linked list walk calling operations with already prepared values.\n */\nclass Uint8ArrayWriter implements Writer {\n /**\n * Current length\n */\n public len: number\n\n /**\n * Operations head\n */\n public head: Op<any>\n\n /**\n * Operations tail\n */\n public tail: Op<any>\n\n /**\n * Linked forked states\n */\n public states?: any\n\n constructor () {\n this.len = 0\n this.head = new Op(noop, 0, 0)\n this.tail = this.head\n this.states = null\n }\n\n /**\n * Pushes a new operation to the queue\n */\n _push (fn: WriterOperation<any>, len: number, val: any): this {\n this.tail = this.tail.next = new Op(fn, len, val)\n this.len += len\n\n return this\n }\n\n /**\n * Writes an unsigned 32 bit value as a varint\n */\n uint32 (value: number): this {\n // here, the call to this.push has been inlined and a varint specific Op subclass is used.\n // uint32 is by far the most frequently used operation and benefits significantly from this.\n this.len += (this.tail = this.tail.next = new VarintOp(\n (value = value >>> 0) <\n 128\n ? 1\n : value < 16384\n ? 2\n : value < 2097152\n ? 3\n : value < 268435456\n ? 4\n : 5,\n value)).len\n return this\n }\n\n /**\n * Writes a signed 32 bit value as a varint`\n */\n int32 (value: number): this {\n return value < 0\n ? this._push(writeVarint64, 10, LongBits.fromNumber(value)) // 10 bytes per spec\n : this.uint32(value)\n }\n\n /**\n * Writes a 32 bit value as a varint, zig-zag encoded\n */\n sint32 (value: number): this {\n return this.uint32((value << 1 ^ value >> 31) >>> 0)\n }\n\n /**\n * Writes an unsigned 64 bit value as a varint\n */\n uint64 (value: bigint): this {\n const bits = LongBits.fromBigInt(value)\n return this._push(writeVarint64, bits.length(), bits)\n }\n\n /**\n * Writes an unsigned 64 bit value as a varint\n */\n uint64Number (value: number): this {\n return this._push(encodeUint8Array, encodingLength(value), value)\n }\n\n /**\n * Writes an unsigned 64 bit value as a varint\n */\n uint64String (value: string): this {\n return this.uint64(BigInt(value))\n }\n\n /**\n * Writes a signed 64 bit value as a varint\n */\n int64 (value: bigint): this {\n return this.uint64(value)\n }\n\n /**\n * Writes a signed 64 bit value as a varint\n */\n int64Number (value: number): this {\n return this.uint64Number(value)\n }\n\n /**\n * Writes a signed 64 bit value as a varint\n */\n int64String (value: string): this {\n return this.uint64String(value)\n }\n\n /**\n * Writes a signed 64 bit value as a varint, zig-zag encoded\n */\n sint64 (value: bigint): this {\n const bits = LongBits.fromBigInt(value).zzEncode()\n return this._push(writeVarint64, bits.length(), bits)\n }\n\n /**\n * Writes a signed 64 bit value as a varint, zig-zag encoded\n */\n sint64Number (value: number): this {\n const bits = LongBits.fromNumber(value).zzEncode()\n return this._push(writeVarint64, bits.length(), bits)\n }\n\n /**\n * Writes a signed 64 bit value as a varint, zig-zag encoded\n */\n sint64String (value: string): this {\n return this.sint64(BigInt(value))\n }\n\n /**\n * Writes a boolish value as a varint\n */\n bool (value: boolean): this {\n return this._push(writeByte, 1, value ? 1 : 0)\n }\n\n /**\n * Writes an unsigned 32 bit value as fixed 32 bits\n */\n fixed32 (value: number): this {\n return this._push(writeFixed32, 4, value >>> 0)\n }\n\n /**\n * Writes a signed 32 bit value as fixed 32 bits\n */\n sfixed32 (value: number): this {\n return this.fixed32(value)\n }\n\n /**\n * Writes an unsigned 64 bit value as fixed 64 bits\n */\n fixed64 (value: bigint): this {\n const bits = LongBits.fromBigInt(value)\n return this._push(writeFixed32, 4, bits.lo)._push(writeFixed32, 4, bits.hi)\n }\n\n /**\n * Writes an unsigned 64 bit value as fixed 64 bits\n */\n fixed64Number (value: number): this {\n const bits = LongBits.fromNumber(value)\n return this._push(writeFixed32, 4, bits.lo)._push(writeFixed32, 4, bits.hi)\n }\n\n /**\n * Writes an unsigned 64 bit value as fixed 64 bits\n */\n fixed64String (value: string): this {\n return this.fixed64(BigInt(value))\n }\n\n /**\n * Writes a signed 64 bit value as fixed 64 bits\n */\n sfixed64 (value: bigint): this {\n return this.fixed64(value)\n }\n\n /**\n * Writes a signed 64 bit value as fixed 64 bits\n */\n sfixed64Number (value: number): this {\n return this.fixed64Number(value)\n }\n\n /**\n * Writes a signed 64 bit value as fixed 64 bits\n */\n sfixed64String (value: string): this {\n return this.fixed64String(value)\n }\n\n /**\n * Writes a float (32 bit)\n */\n float (value: number): this {\n return this._push(writeFloatLE, 4, value)\n }\n\n /**\n * Writes a double (64 bit float).\n *\n * @function\n * @param {number} value - Value to write\n * @returns {Writer} `this`\n */\n double (value: number): this {\n return this._push(writeDoubleLE, 8, value)\n }\n\n /**\n * Writes a sequence of bytes\n */\n bytes (value: Uint8Array): this {\n const len = value.length >>> 0\n\n if (len === 0) {\n return this._push(writeByte, 1, 0)\n }\n\n return this.uint32(len)._push(writeBytes, len, value)\n }\n\n /**\n * Writes a string\n */\n string (value: string): this {\n const len = utf8.length(value)\n return len !== 0\n ? this.uint32(len)._push(utf8.write, len, value)\n : this._push(writeByte, 1, 0)\n }\n\n /**\n * Forks this writer's state by pushing it to a stack.\n * Calling {@link Writer#reset|reset} or {@link Writer#ldelim|ldelim} resets the writer to the previous state.\n */\n fork (): this {\n this.states = new State(this)\n this.head = this.tail = new Op(noop, 0, 0)\n this.len = 0\n return this\n }\n\n /**\n * Resets this instance to the last state\n */\n reset (): this {\n if (this.states != null) {\n this.head = this.states.head\n this.tail = this.states.tail\n this.len = this.states.len\n this.states = this.states.next\n } else {\n this.head = this.tail = new Op(noop, 0, 0)\n this.len = 0\n }\n return this\n }\n\n /**\n * Resets to the last state and appends the fork state's current write length as a varint followed by its operations.\n */\n ldelim (): this {\n const head = this.head\n const tail = this.tail\n const len = this.len\n this.reset().uint32(len)\n if (len !== 0) {\n this.tail.next = head.next // skip noop\n this.tail = tail\n this.len += len\n }\n return this\n }\n\n /**\n * Finishes the write operation\n */\n finish (): Uint8Array {\n let head = this.head.next // skip noop\n const buf = alloc(this.len)\n let pos = 0\n while (head != null) {\n head.fn(head.val, buf, pos)\n pos += head.len\n head = head.next\n }\n // this.head = this.tail = null;\n return buf\n }\n}\n\nfunction writeByte (val: number, buf: Uint8Array, pos: number): void {\n buf[pos] = val & 255\n}\n\nfunction writeVarint32 (val: number, buf: Uint8Array, pos: number): void {\n while (val > 127) {\n buf[pos++] = val & 127 | 128\n val >>>= 7\n }\n buf[pos] = val\n}\n\n/**\n * Constructs a new varint writer operation instance.\n *\n * @classdesc Scheduled varint writer operation\n */\nclass VarintOp extends Op<number> {\n public next?: Op<any>\n\n constructor (len: number, val: number) {\n super(writeVarint32, len, val)\n this.next = undefined\n }\n}\n\nfunction writeVarint64 (val: LongBits, buf: Uint8Array, pos: number): void {\n while (val.hi !== 0) {\n buf[pos++] = val.lo & 127 | 128\n val.lo = (val.lo >>> 7 | val.hi << 25) >>> 0\n val.hi >>>= 7\n }\n while (val.lo > 127) {\n buf[pos++] = val.lo & 127 | 128\n val.lo = val.lo >>> 7\n }\n buf[pos++] = val.lo\n}\n\nfunction writeFixed32 (val: number, buf: Uint8Array, pos: number): void {\n buf[pos] = val & 255\n buf[pos + 1] = val >>> 8 & 255\n buf[pos + 2] = val >>> 16 & 255\n buf[pos + 3] = val >>> 24\n}\n\nfunction writeBytes (val: Uint8Array, buf: Uint8Array, pos: number): void {\n buf.set(val, pos)\n}\n\nif (globalThis.Buffer != null) {\n Uint8ArrayWriter.prototype.bytes = function (value: Uint8Array) {\n const len = value.length >>> 0\n\n this.uint32(len)\n\n if (len > 0) {\n this._push(writeBytesBuffer, len, value)\n }\n\n return this\n }\n\n Uint8ArrayWriter.prototype.string = function (value: string) {\n const len = globalThis.Buffer.byteLength(value)\n\n this.uint32(len)\n\n if (len > 0) {\n this._push(writeStringBuffer, len, value)\n }\n\n return this\n }\n}\n\nfunction writeBytesBuffer (val: Uint8Array, buf: Uint8Array, pos: number): void {\n buf.set(val, pos) // faster than copy (requires node >= 4 where Buffers extend Uint8Array and set is properly inherited)\n // also works for plain array values\n}\n\nfunction writeStringBuffer (val: string, buf: Uint8Array, pos: number): void {\n if (val.length < 40) {\n // plain js is faster for short strings (probably due to redundant assertions)\n utf8.write(val, buf, pos)\n // @ts-expect-error buf isn't a Uint8Array?\n } else if (buf.utf8Write != null) {\n // @ts-expect-error buf isn't a Uint8Array?\n buf.utf8Write(val, pos)\n } else {\n buf.set(uint8ArrayFromString(val), pos)\n }\n}\n\n/**\n * Creates a new writer\n */\nexport function createWriter (): Writer {\n return new Uint8ArrayWriter()\n}\n", "import { createWriter } from './utils/writer.js'\nimport type { Codec } from './codec.js'\n\nexport function encodeMessage <T> (message: Partial<T>, codec: Pick<Codec<T>, 'encode'>): Uint8Array {\n const w = createWriter()\n\n codec.encode(message, w, {\n lengthDelimited: false\n })\n\n return w.finish()\n}\n", "import type { Writer, Reader } from './index.js'\n\n// https://developers.google.com/protocol-buffers/docs/encoding#structure\nexport enum CODEC_TYPES {\n VARINT = 0,\n BIT64,\n LENGTH_DELIMITED,\n START_GROUP,\n END_GROUP,\n BIT32\n}\n\nexport interface EncodeOptions {\n lengthDelimited?: boolean\n writeDefaults?: boolean\n}\n\nexport interface EncodeFunction<T> {\n (value: Partial<T>, writer: Writer, opts?: EncodeOptions): void\n}\n\n// protobuf types that contain multiple values\ntype CollectionTypes = any[] | Map<any, any>\n\n// protobuf types that are not collections or messages\ntype PrimitiveTypes = boolean | number | string | bigint | Uint8Array\n\n// recursive array/map field length limits\ntype CollectionLimits <T> = {\n [K in keyof T]: T[K] extends CollectionTypes ? number :\n T[K] extends PrimitiveTypes ? never : Limits<T[K]>\n}\n\n// recursive array member array/map field length limits\ntype ArrayElementLimits <T> = {\n [K in keyof T as `${string & K}$`]: T[K] extends Array<infer ElementType> ?\n (ElementType extends PrimitiveTypes ? never : Limits<ElementType>) :\n (T[K] extends PrimitiveTypes ? never : Limits<T[K]>)\n}\n\n// recursive map value array/map field length limits\ntype MapValueLimits <T> = {\n [K in keyof T as `${string & K}$value`]: T[K] extends Map<any, infer MapValueType> ?\n (MapValueType extends PrimitiveTypes ? never : Limits<MapValueType>) :\n (T[K] extends PrimitiveTypes ? never : Limits<T[K]>)\n}\n\n// union of collection and array elements\ntype Limits<T> = Partial<CollectionLimits<T> & ArrayElementLimits<T> & MapValueLimits<T>>\n\nexport interface DecodeOptions<T> {\n /**\n * Runtime-specified limits for lengths of repeated/map fields\n */\n limits?: Limits<T>\n}\n\nexport interface DecodeFunction<T> {\n (reader: Reader, length?: number, opts?: DecodeOptions<T>): T\n}\n\nexport interface Codec<T> {\n name: string\n type: CODEC_TYPES\n encode: EncodeFunction<T>\n decode: DecodeFunction<T>\n}\n\nexport function createCodec <T> (name: string, type: CODEC_TYPES, encode: EncodeFunction<T>, decode: DecodeFunction<T>): Codec<T> {\n return {\n name,\n type,\n encode,\n decode\n }\n}\n", "import { createCodec, CODEC_TYPES } from '../codec.js'\nimport type { DecodeFunction, EncodeFunction, Codec } from '../codec.js'\n\nexport function enumeration <T> (v: any): Codec<T> {\n function findValue (val: string | number): number {\n // Use the reverse mapping to look up the enum key for the stored value\n // https://www.typescriptlang.org/docs/handbook/enums.html#reverse-mappings\n if (v[val.toString()] == null) {\n throw new Error('Invalid enum value')\n }\n\n return v[val]\n }\n\n const encode: EncodeFunction<number | string> = function enumEncode (val, writer) {\n const enumValue = findValue(val)\n\n writer.int32(enumValue)\n }\n\n const decode: DecodeFunction<number | string> = function enumDecode (reader) {\n const val = reader.int32()\n\n return findValue(val)\n }\n\n // @ts-expect-error yeah yeah\n return createCodec('enum', CODEC_TYPES.VARINT, encode, decode)\n}\n", "import { createCodec, CODEC_TYPES } from '../codec.js'\nimport type { EncodeFunction, DecodeFunction, Codec } from '../codec.js'\n\nexport interface Factory<A, T> {\n new (obj: A): T\n}\n\nexport function message <T> (encode: EncodeFunction<T>, decode: DecodeFunction<T>): Codec<T> {\n return createCodec('message', CODEC_TYPES.LENGTH_DELIMITED, encode, decode)\n}\n", "import { enumeration, encodeMessage, decodeMessage, message } from 'protons-runtime'\nimport type { Codec } from 'protons-runtime'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nexport interface Request {\n type?: Request.Type\n connect?: ConnectRequest\n streamOpen?: StreamOpenRequest\n streamHandler?: StreamHandlerRequest\n dht?: DHTRequest\n connManager?: ConnManagerRequest\n disconnect?: DisconnectRequest\n pubsub?: PSRequest\n peerStore?: PeerstoreRequest\n}\n\nexport namespace Request {\n export enum Type {\n IDENTIFY = 'IDENTIFY',\n CONNECT = 'CONNECT',\n STREAM_OPEN = 'STREAM_OPEN',\n STREAM_HANDLER = 'STREAM_HANDLER',\n DHT = 'DHT',\n LIST_PEERS = 'LIST_PEERS',\n CONNMANAGER = 'CONNMANAGER',\n DISCONNECT = 'DISCONNECT',\n PUBSUB = 'PUBSUB',\n PEERSTORE = 'PEERSTORE'\n }\n\n enum __TypeValues {\n IDENTIFY = 0,\n CONNECT = 1,\n STREAM_OPEN = 2,\n STREAM_HANDLER = 3,\n DHT = 4,\n LIST_PEERS = 5,\n CONNMANAGER = 6,\n DISCONNECT = 7,\n PUBSUB = 8,\n PEERSTORE = 9\n }\n\n export namespace Type {\n export const codec = (): Codec<Type> => {\n return enumeration<Type>(__TypeValues)\n }\n }\n\n let _codec: Codec<Request>\n\n export const codec = (): Codec<Request> => {\n if (_codec == null) {\n _codec = message<Request>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.type != null) {\n w.uint32(8)\n Request.Type.codec().encode(obj.type, w)\n }\n\n if (obj.connect != null) {\n w.uint32(18)\n ConnectRequest.codec().encode(obj.connect, w)\n }\n\n if (obj.streamOpen != null) {\n w.uint32(26)\n StreamOpenRequest.codec().encode(obj.streamOpen, w)\n }\n\n if (obj.streamHandler != null) {\n w.uint32(34)\n StreamHandlerRequest.codec().encode(obj.streamHandler, w)\n }\n\n if (obj.dht != null) {\n w.uint32(42)\n DHTRequest.codec().encode(obj.dht, w)\n }\n\n if (obj.connManager != null) {\n w.uint32(50)\n ConnManagerRequest.codec().encode(obj.connManager, w)\n }\n\n if (obj.disconnect != null) {\n w.uint32(58)\n DisconnectRequest.codec().encode(obj.disconnect, w)\n }\n\n if (obj.pubsub != null) {\n w.uint32(66)\n PSRequest.codec().encode(obj.pubsub, w)\n }\n\n if (obj.peerStore != null) {\n w.uint32(74)\n PeerstoreRequest.codec().encode(obj.peerStore, w)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {}\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.type = Request.Type.codec().decode(reader)\n break\n case 2:\n obj.connect = ConnectRequest.codec().decode(reader, reader.uint32())\n break\n case 3:\n obj.streamOpen = StreamOpenRequest.codec().decode(reader, reader.uint32())\n break\n case 4:\n obj.streamHandler = StreamHandlerRequest.codec().decode(reader, reader.uint32())\n break\n case 5:\n obj.dht = DHTRequest.codec().decode(reader, reader.uint32())\n break\n case 6:\n obj.connManager = ConnManagerRequest.codec().decode(reader, reader.uint32())\n break\n case 7:\n obj.disconnect = DisconnectRequest.codec().decode(reader, reader.uint32())\n break\n case 8:\n obj.pubsub = PSRequest.codec().decode(reader, reader.uint32())\n break\n case 9:\n obj.peerStore = PeerstoreRequest.codec().decode(reader, reader.uint32())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<Request>): Uint8Array => {\n return encodeMessage(obj, Request.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): Request => {\n return decodeMessage(buf, Request.codec())\n }\n}\n\nexport interface Response {\n type?: Response.Type\n error?: ErrorResponse\n streamInfo?: StreamInfo\n identify?: IdentifyResponse\n dht?: DHTResponse\n peers: PeerInfo[]\n pubsub?: PSResponse\n peerStore?: PeerstoreResponse\n}\n\nexport namespace Response {\n export enum Type {\n OK = 'OK',\n ERROR = 'ERROR'\n }\n\n enum __TypeValues {\n OK = 0,\n ERROR = 1\n }\n\n export namespace Type {\n export const codec = (): Codec<Type> => {\n return enumeration<Type>(__TypeValues)\n }\n }\n\n let _codec: Codec<Response>\n\n export const codec = (): Codec<Response> => {\n if (_codec == null) {\n _codec = message<Response>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.type != null) {\n w.uint32(8)\n Response.Type.codec().encode(obj.type, w)\n }\n\n if (obj.error != null) {\n w.uint32(18)\n ErrorResponse.codec().encode(obj.error, w)\n }\n\n if (obj.streamInfo != null) {\n w.uint32(26)\n StreamInfo.codec().encode(obj.streamInfo, w)\n }\n\n if (obj.identify != null) {\n w.uint32(34)\n IdentifyResponse.codec().encode(obj.identify, w)\n }\n\n if (obj.dht != null) {\n w.uint32(42)\n DHTResponse.codec().encode(obj.dht, w)\n }\n\n if (obj.peers != null) {\n for (const value of obj.peers) {\n w.uint32(50)\n PeerInfo.codec().encode(value, w)\n }\n }\n\n if (obj.pubsub != null) {\n w.uint32(58)\n PSResponse.codec().encode(obj.pubsub, w)\n }\n\n if (obj.peerStore != null) {\n w.uint32(66)\n PeerstoreResponse.codec().encode(obj.peerStore, w)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n peers: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.type = Response.Type.codec().decode(reader)\n break\n case 2:\n obj.error = ErrorResponse.codec().decode(reader, reader.uint32())\n break\n case 3:\n obj.streamInfo = StreamInfo.codec().decode(reader, reader.uint32())\n break\n case 4:\n obj.identify = IdentifyResponse.codec().decode(reader, reader.uint32())\n break\n case 5:\n obj.dht = DHTResponse.codec().decode(reader, reader.uint32())\n break\n case 6:\n obj.peers.push(PeerInfo.codec().decode(reader, reader.uint32()))\n break\n case 7:\n obj.pubsub = PSResponse.codec().decode(reader, reader.uint32())\n break\n case 8:\n obj.peerStore = PeerstoreResponse.codec().decode(reader, reader.uint32())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<Response>): Uint8Array => {\n return encodeMessage(obj, Response.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): Response => {\n return decodeMessage(buf, Response.codec())\n }\n}\n\nexport interface IdentifyResponse {\n id: Uint8Array\n addrs: Uint8Array[]\n}\n\nexport namespace IdentifyResponse {\n let _codec: Codec<IdentifyResponse>\n\n export const codec = (): Codec<IdentifyResponse> => {\n if (_codec == null) {\n _codec = message<IdentifyResponse>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.id != null && obj.id.byteLength > 0)) {\n w.uint32(10)\n w.bytes(obj.id)\n }\n\n if (obj.addrs != null) {\n for (const value of obj.addrs) {\n w.uint32(18)\n w.bytes(value)\n }\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n id: new Uint8Array(0),\n addrs: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.id = reader.bytes()\n break\n case 2:\n obj.addrs.push(reader.bytes())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<IdentifyResponse>): Uint8Array => {\n return encodeMessage(obj, IdentifyResponse.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): IdentifyResponse => {\n return decodeMessage(buf, IdentifyResponse.codec())\n }\n}\n\nexport interface ConnectRequest {\n peer: Uint8Array\n addrs: Uint8Array[]\n timeout?: bigint\n}\n\nexport namespace ConnectRequest {\n let _codec: Codec<ConnectRequest>\n\n export const codec = (): Codec<ConnectRequest> => {\n if (_codec == null) {\n _codec = message<ConnectRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.peer != null && obj.peer.byteLength > 0)) {\n w.uint32(10)\n w.bytes(obj.peer)\n }\n\n if (obj.addrs != null) {\n for (const value of obj.addrs) {\n w.uint32(18)\n w.bytes(value)\n }\n }\n\n if (obj.timeout != null) {\n w.uint32(24)\n w.int64(obj.timeout)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n peer: new Uint8Array(0),\n addrs: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.peer = reader.bytes()\n break\n case 2:\n obj.addrs.push(reader.bytes())\n break\n case 3:\n obj.timeout = reader.int64()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<ConnectRequest>): Uint8Array => {\n return encodeMessage(obj, ConnectRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): ConnectRequest => {\n return decodeMessage(buf, ConnectRequest.codec())\n }\n}\n\nexport interface StreamOpenRequest {\n peer: Uint8Array\n proto: string[]\n timeout?: bigint\n}\n\nexport namespace StreamOpenRequest {\n let _codec: Codec<StreamOpenRequest>\n\n export const codec = (): Codec<StreamOpenRequest> => {\n if (_codec == null) {\n _codec = message<StreamOpenRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.peer != null && obj.peer.byteLength > 0)) {\n w.uint32(10)\n w.bytes(obj.peer)\n }\n\n if (obj.proto != null) {\n for (const value of obj.proto) {\n w.uint32(18)\n w.string(value)\n }\n }\n\n if (obj.timeout != null) {\n w.uint32(24)\n w.int64(obj.timeout)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n peer: new Uint8Array(0),\n proto: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.peer = reader.bytes()\n break\n case 2:\n obj.proto.push(reader.string())\n break\n case 3:\n obj.timeout = reader.int64()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<StreamOpenRequest>): Uint8Array => {\n return encodeMessage(obj, StreamOpenRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): StreamOpenRequest => {\n return decodeMessage(buf, StreamOpenRequest.codec())\n }\n}\n\nexport interface StreamHandlerRequest {\n addr: Uint8Array\n proto: string[]\n}\n\nexport namespace StreamHandlerRequest {\n let _codec: Codec<StreamHandlerRequest>\n\n export const codec = (): Codec<StreamHandlerRequest> => {\n if (_codec == null) {\n _codec = message<StreamHandlerRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.addr != null && obj.addr.byteLength > 0)) {\n w.uint32(10)\n w.bytes(obj.addr)\n }\n\n if (obj.proto != null) {\n for (const value of obj.proto) {\n w.uint32(18)\n w.string(value)\n }\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n addr: new Uint8Array(0),\n proto: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.addr = reader.bytes()\n break\n case 2:\n obj.proto.push(reader.string())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<StreamHandlerRequest>): Uint8Array => {\n return encodeMessage(obj, StreamHandlerRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): StreamHandlerRequest => {\n return decodeMessage(buf, StreamHandlerRequest.codec())\n }\n}\n\nexport interface ErrorResponse {\n msg: string\n}\n\nexport namespace ErrorResponse {\n let _codec: Codec<ErrorResponse>\n\n export const codec = (): Codec<ErrorResponse> => {\n if (_codec == null) {\n _codec = message<ErrorResponse>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.msg != null && obj.msg !== '')) {\n w.uint32(10)\n w.string(obj.msg)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n msg: ''\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.msg = reader.string()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<ErrorResponse>): Uint8Array => {\n return encodeMessage(obj, ErrorResponse.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): ErrorResponse => {\n return decodeMessage(buf, ErrorResponse.codec())\n }\n}\n\nexport interface StreamInfo {\n peer: Uint8Array\n addr: Uint8Array\n proto: string\n}\n\nexport namespace StreamInfo {\n let _codec: Codec<StreamInfo>\n\n export const codec = (): Codec<StreamInfo> => {\n if (_codec == null) {\n _codec = message<StreamInfo>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.peer != null && obj.peer.byteLength > 0)) {\n w.uint32(10)\n w.bytes(obj.peer)\n }\n\n if ((obj.addr != null && obj.addr.byteLength > 0)) {\n w.uint32(18)\n w.bytes(obj.addr)\n }\n\n if ((obj.proto != null && obj.proto !== '')) {\n w.uint32(26)\n w.string(obj.proto)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n peer: new Uint8Array(0),\n addr: new Uint8Array(0),\n proto: ''\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.peer = reader.bytes()\n break\n case 2:\n obj.addr = reader.bytes()\n break\n case 3:\n obj.proto = reader.string()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<StreamInfo>): Uint8Array => {\n return encodeMessage(obj, StreamInfo.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): StreamInfo => {\n return decodeMessage(buf, StreamInfo.codec())\n }\n}\n\nexport interface DHTRequest {\n type?: DHTRequest.Type\n peer?: Uint8Array\n cid?: Uint8Array\n key?: Uint8Array\n value?: Uint8Array\n count?: number\n timeout?: bigint\n}\n\nexport namespace DHTRequest {\n export enum Type {\n FIND_PEER = 'FIND_PEER',\n FIND_PEERS_CONNECTED_TO_PEER = 'FIND_PEERS_CONNECTED_TO_PEER',\n FIND_PROVIDERS = 'FIND_PROVIDERS',\n GET_CLOSEST_PEERS = 'GET_CLOSEST_PEERS',\n GET_PUBLIC_KEY = 'GET_PUBLIC_KEY',\n GET_VALUE = 'GET_VALUE',\n SEARCH_VALUE = 'SEARCH_VALUE',\n PUT_VALUE = 'PUT_VALUE',\n PROVIDE = 'PROVIDE'\n }\n\n enum __TypeValues {\n FIND_PEER = 0,\n FIND_PEERS_CONNECTED_TO_PEER = 1,\n FIND_PROVIDERS = 2,\n GET_CLOSEST_PEERS = 3,\n GET_PUBLIC_KEY = 4,\n GET_VALUE = 5,\n SEARCH_VALUE = 6,\n PUT_VALUE = 7,\n PROVIDE = 8\n }\n\n export namespace Type {\n export const codec = (): Codec<Type> => {\n return enumeration<Type>(__TypeValues)\n }\n }\n\n let _codec: Codec<DHTRequest>\n\n export const codec = (): Codec<DHTRequest> => {\n if (_codec == null) {\n _codec = message<DHTRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.type != null) {\n w.uint32(8)\n DHTRequest.Type.codec().encode(obj.type, w)\n }\n\n if (obj.peer != null) {\n w.uint32(18)\n w.bytes(obj.peer)\n }\n\n if (obj.cid != null) {\n w.uint32(26)\n w.bytes(obj.cid)\n }\n\n if (obj.key != null) {\n w.uint32(34)\n w.bytes(obj.key)\n }\n\n if (obj.value != null) {\n w.uint32(42)\n w.bytes(obj.value)\n }\n\n if (obj.count != null) {\n w.uint32(48)\n w.int32(obj.count)\n }\n\n if (obj.timeout != null) {\n w.uint32(56)\n w.int64(obj.timeout)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {}\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.type = DHTRequest.Type.codec().decode(reader)\n break\n case 2:\n obj.peer = reader.bytes()\n break\n case 3:\n obj.cid = reader.bytes()\n break\n case 4:\n obj.key = reader.bytes()\n break\n case 5:\n obj.value = reader.bytes()\n break\n case 6:\n obj.count = reader.int32()\n break\n case 7:\n obj.timeout = reader.int64()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<DHTRequest>): Uint8Array => {\n return encodeMessage(obj, DHTRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): DHTRequest => {\n return decodeMessage(buf, DHTRequest.codec())\n }\n}\n\nexport interface DHTResponse {\n type?: DHTResponse.Type\n peer?: PeerInfo\n value?: Uint8Array\n}\n\nexport namespace DHTResponse {\n export enum Type {\n BEGIN = 'BEGIN',\n VALUE = 'VALUE',\n END = 'END'\n }\n\n enum __TypeValues {\n BEGIN = 0,\n VALUE = 1,\n END = 2\n }\n\n export namespace Type {\n export const codec = (): Codec<Type> => {\n return enumeration<Type>(__TypeValues)\n }\n }\n\n let _codec: Codec<DHTResponse>\n\n export const codec = (): Codec<DHTResponse> => {\n if (_codec == null) {\n _codec = message<DHTResponse>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.type != null) {\n w.uint32(8)\n DHTResponse.Type.codec().encode(obj.type, w)\n }\n\n if (obj.peer != null) {\n w.uint32(18)\n PeerInfo.codec().encode(obj.peer, w)\n }\n\n if (obj.value != null) {\n w.uint32(26)\n w.bytes(obj.value)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {}\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.type = DHTResponse.Type.codec().decode(reader)\n break\n case 2:\n obj.peer = PeerInfo.codec().decode(reader, reader.uint32())\n break\n case 3:\n obj.value = reader.bytes()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<DHTResponse>): Uint8Array => {\n return encodeMessage(obj, DHTResponse.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): DHTResponse => {\n return decodeMessage(buf, DHTResponse.codec())\n }\n}\n\nexport interface PeerInfo {\n id: Uint8Array\n addrs: Uint8Array[]\n}\n\nexport namespace PeerInfo {\n let _codec: Codec<PeerInfo>\n\n export const codec = (): Codec<PeerInfo> => {\n if (_codec == null) {\n _codec = message<PeerInfo>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.id != null && obj.id.byteLength > 0)) {\n w.uint32(10)\n w.bytes(obj.id)\n }\n\n if (obj.addrs != null) {\n for (const value of obj.addrs) {\n w.uint32(18)\n w.bytes(value)\n }\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n id: new Uint8Array(0),\n addrs: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.id = reader.bytes()\n break\n case 2:\n obj.addrs.push(reader.bytes())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PeerInfo>): Uint8Array => {\n return encodeMessage(obj, PeerInfo.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): PeerInfo => {\n return decodeMessage(buf, PeerInfo.codec())\n }\n}\n\nexport interface ConnManagerRequest {\n type?: ConnManagerRequest.Type\n peer?: Uint8Array\n tag?: string\n weight?: bigint\n}\n\nexport namespace ConnManagerRequest {\n export enum Type {\n TAG_PEER = 'TAG_PEER',\n UNTAG_PEER = 'UNTAG_PEER',\n TRIM = 'TRIM'\n }\n\n enum __TypeValues {\n TAG_PEER = 0,\n UNTAG_PEER = 1,\n TRIM = 2\n }\n\n export namespace Type {\n export const codec = (): Codec<Type> => {\n return enumeration<Type>(__TypeValues)\n }\n }\n\n let _codec: Codec<ConnManagerRequest>\n\n export const codec = (): Codec<ConnManagerRequest> => {\n if (_codec == null) {\n _codec = message<ConnManagerRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.type != null) {\n w.uint32(8)\n ConnManagerRequest.Type.codec().encode(obj.type, w)\n }\n\n if (obj.peer != null) {\n w.uint32(18)\n w.bytes(obj.peer)\n }\n\n if (obj.tag != null) {\n w.uint32(26)\n w.string(obj.tag)\n }\n\n if (obj.weight != null) {\n w.uint32(32)\n w.int64(obj.weight)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {}\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.type = ConnManagerRequest.Type.codec().decode(reader)\n break\n case 2:\n obj.peer = reader.bytes()\n break\n case 3:\n obj.tag = reader.string()\n break\n case 4:\n obj.weight = reader.int64()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<ConnManagerRequest>): Uint8Array => {\n return encodeMessage(obj, ConnManagerRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): ConnManagerRequest => {\n return decodeMessage(buf, ConnManagerRequest.codec())\n }\n}\n\nexport interface DisconnectRequest {\n peer: Uint8Array\n}\n\nexport namespace DisconnectRequest {\n let _codec: Codec<DisconnectRequest>\n\n export const codec = (): Codec<DisconnectRequest> => {\n if (_codec == null) {\n _codec = message<DisconnectRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if ((obj.peer != null && obj.peer.byteLength > 0)) {\n w.uint32(10)\n w.bytes(obj.peer)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n peer: new Uint8Array(0)\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.peer = reader.bytes()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<DisconnectRequest>): Uint8Array => {\n return encodeMessage(obj, DisconnectRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): DisconnectRequest => {\n return decodeMessage(buf, DisconnectRequest.codec())\n }\n}\n\nexport interface PSRequest {\n type?: PSRequest.Type\n topic?: string\n data?: Uint8Array\n}\n\nexport namespace PSRequest {\n export enum Type {\n GET_TOPICS = 'GET_TOPICS',\n LIST_PEERS = 'LIST_PEERS',\n PUBLISH = 'PUBLISH',\n SUBSCRIBE = 'SUBSCRIBE'\n }\n\n enum __TypeValues {\n GET_TOPICS = 0,\n LIST_PEERS = 1,\n PUBLISH = 2,\n SUBSCRIBE = 3\n }\n\n export namespace Type {\n export const codec = (): Codec<Type> => {\n return enumeration<Type>(__TypeValues)\n }\n }\n\n let _codec: Codec<PSRequest>\n\n export const codec = (): Codec<PSRequest> => {\n if (_codec == null) {\n _codec = message<PSRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.type != null) {\n w.uint32(8)\n PSRequest.Type.codec().encode(obj.type, w)\n }\n\n if (obj.topic != null) {\n w.uint32(18)\n w.string(obj.topic)\n }\n\n if (obj.data != null) {\n w.uint32(26)\n w.bytes(obj.data)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {}\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.type = PSRequest.Type.codec().decode(reader)\n break\n case 2:\n obj.topic = reader.string()\n break\n case 3:\n obj.data = reader.bytes()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PSRequest>): Uint8Array => {\n return encodeMessage(obj, PSRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): PSRequest => {\n return decodeMessage(buf, PSRequest.codec())\n }\n}\n\nexport interface PSMessage {\n from?: Uint8Array\n data?: Uint8Array\n seqno?: Uint8Array\n topicIDs: string[]\n signature?: Uint8Array\n key?: Uint8Array\n}\n\nexport namespace PSMessage {\n let _codec: Codec<PSMessage>\n\n export const codec = (): Codec<PSMessage> => {\n if (_codec == null) {\n _codec = message<PSMessage>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.from != null) {\n w.uint32(10)\n w.bytes(obj.from)\n }\n\n if (obj.data != null) {\n w.uint32(18)\n w.bytes(obj.data)\n }\n\n if (obj.seqno != null) {\n w.uint32(26)\n w.bytes(obj.seqno)\n }\n\n if (obj.topicIDs != null) {\n for (const value of obj.topicIDs) {\n w.uint32(34)\n w.string(value)\n }\n }\n\n if (obj.signature != null) {\n w.uint32(42)\n w.bytes(obj.signature)\n }\n\n if (obj.key != null) {\n w.uint32(50)\n w.bytes(obj.key)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n topicIDs: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.from = reader.bytes()\n break\n case 2:\n obj.data = reader.bytes()\n break\n case 3:\n obj.seqno = reader.bytes()\n break\n case 4:\n obj.topicIDs.push(reader.string())\n break\n case 5:\n obj.signature = reader.bytes()\n break\n case 6:\n obj.key = reader.bytes()\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PSMessage>): Uint8Array => {\n return encodeMessage(obj, PSMessage.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): PSMessage => {\n return decodeMessage(buf, PSMessage.codec())\n }\n}\n\nexport interface PSResponse {\n topics: string[]\n peerIDs: Uint8Array[]\n}\n\nexport namespace PSResponse {\n let _codec: Codec<PSResponse>\n\n export const codec = (): Codec<PSResponse> => {\n if (_codec == null) {\n _codec = message<PSResponse>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.topics != null) {\n for (const value of obj.topics) {\n w.uint32(10)\n w.string(value)\n }\n }\n\n if (obj.peerIDs != null) {\n for (const value of obj.peerIDs) {\n w.uint32(18)\n w.bytes(value)\n }\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n topics: [],\n peerIDs: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.topics.push(reader.string())\n break\n case 2:\n obj.peerIDs.push(reader.bytes())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PSResponse>): Uint8Array => {\n return encodeMessage(obj, PSResponse.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): PSResponse => {\n return decodeMessage(buf, PSResponse.codec())\n }\n}\n\nexport interface PeerstoreRequest {\n type?: PeerstoreRequest.Type\n id?: Uint8Array\n protos: string[]\n}\n\nexport namespace PeerstoreRequest {\n export enum Type {\n UNSPECIFIED = 'UNSPECIFIED',\n GET_PROTOCOLS = 'GET_PROTOCOLS',\n GET_PEER_INFO = 'GET_PEER_INFO'\n }\n\n enum __TypeValues {\n UNSPECIFIED = 0,\n GET_PROTOCOLS = 1,\n GET_PEER_INFO = 2\n }\n\n export namespace Type {\n export const codec = (): Codec<Type> => {\n return enumeration<Type>(__TypeValues)\n }\n }\n\n let _codec: Codec<PeerstoreRequest>\n\n export const codec = (): Codec<PeerstoreRequest> => {\n if (_codec == null) {\n _codec = message<PeerstoreRequest>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.type != null) {\n w.uint32(8)\n PeerstoreRequest.Type.codec().encode(obj.type, w)\n }\n\n if (obj.id != null) {\n w.uint32(18)\n w.bytes(obj.id)\n }\n\n if (obj.protos != null) {\n for (const value of obj.protos) {\n w.uint32(26)\n w.string(value)\n }\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n protos: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.type = PeerstoreRequest.Type.codec().decode(reader)\n break\n case 2:\n obj.id = reader.bytes()\n break\n case 3:\n obj.protos.push(reader.string())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PeerstoreRequest>): Uint8Array => {\n return encodeMessage(obj, PeerstoreRequest.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): PeerstoreRequest => {\n return decodeMessage(buf, PeerstoreRequest.codec())\n }\n}\n\nexport interface PeerstoreResponse {\n peer?: PeerInfo\n protos: string[]\n}\n\nexport namespace PeerstoreResponse {\n let _codec: Codec<PeerstoreResponse>\n\n export const codec = (): Codec<PeerstoreResponse> => {\n if (_codec == null) {\n _codec = message<PeerstoreResponse>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.peer != null) {\n w.uint32(10)\n PeerInfo.codec().encode(obj.peer, w)\n }\n\n if (obj.protos != null) {\n for (const value of obj.protos) {\n w.uint32(18)\n w.string(value)\n }\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length) => {\n const obj: any = {\n protos: []\n }\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1:\n obj.peer = PeerInfo.codec().decode(reader, reader.uint32())\n break\n case 2:\n obj.protos.push(reader.string())\n break\n default:\n reader.skipType(tag & 7)\n break\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PeerstoreResponse>): Uint8Array => {\n return encodeMessage(obj, PeerstoreResponse.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList): PeerstoreResponse => {\n return decodeMessage(buf, PeerstoreResponse.codec())\n }\n}\n", "\nexport interface ClearableSignal extends AbortSignal {\n clear: () => void\n}\n\n/**\n * Takes an array of AbortSignals and returns a single signal.\n * If any signals are aborted, the returned signal will be aborted.\n */\nexport function anySignal (signals: Array<AbortSignal | undefined | null>): ClearableSignal {\n const controller = new globalThis.AbortController()\n\n function onAbort (): void {\n controller.abort()\n\n for (const signal of signals) {\n if (signal?.removeEventListener != null) {\n signal.removeEventListener('abort', onAbort)\n }\n }\n }\n\n for (const signal of signals) {\n if (signal?.aborted === true) {\n onAbort()\n break\n }\n\n if (signal?.addEventListener != null) {\n signal.addEventListener('abort', onAbort)\n }\n }\n\n function clear (): void {\n for (const signal of signals) {\n if (signal?.removeEventListener != null) {\n signal.removeEventListener('abort', onAbort)\n }\n }\n }\n\n const signal = controller.signal as ClearableSignal\n signal.clear = clear\n\n return signal\n}\n", "import { anySignal } from 'any-signal'\nimport type { ClearableSignal, Connection, ConnectionEncrypter, MultiaddrConnection, StreamMuxerFactory, Upgrader } from '@libp2p/interface'\n\nexport interface OnConnection {\n (conn: MultiaddrConnection): void\n}\n\nexport class PassThroughUpgrader implements Upgrader {\n private readonly onConnection?: OnConnection\n\n constructor (handler?: OnConnection) {\n this.onConnection = handler\n }\n\n async upgradeInbound (maConn: MultiaddrConnection): Promise<void> {\n this.onConnection?.(maConn)\n }\n\n async upgradeOutbound (maConn: MultiaddrConnection): Promise<Connection> {\n // @ts-expect-error should return a connection\n return maConn\n }\n\n createInboundAbortSignal (signal: AbortSignal): ClearableSignal {\n return anySignal([signal])\n }\n\n getStreamMuxers (): Map<string, StreamMuxerFactory> {\n return new Map()\n }\n\n getConnectionEncrypters (): Map<string, ConnectionEncrypter<unknown>> {\n return new Map()\n }\n}\n", "/**\n * When this error is thrown it means an operation was aborted,\n * usually in response to the `abort` event being emitted by an\n * AbortSignal.\n */\nexport class AbortError extends Error {\n static name = 'AbortError'\n\n constructor (message: string = 'The operation was aborted') {\n super(message)\n this.name = 'AbortError'\n }\n}\n\n/**\n * Thrown when a remote Peer ID does not match the expected one\n */\nexport class UnexpectedPeerError extends Error {\n static name = 'UnexpectedPeerError'\n\n constructor (message = 'Unexpected Peer') {\n super(message)\n this.name = 'UnexpectedPeerError'\n }\n}\n\n/**\n * Thrown when a crypto exchange fails\n */\nexport class InvalidCryptoExchangeError extends Error {\n static name = 'InvalidCryptoExchangeError'\n\n constructor (message = 'Invalid crypto exchange') {\n super(message)\n this.name = 'InvalidCryptoExchangeError'\n }\n}\n\n/**\n * Thrown when invalid parameters are passed to a function or method call\n */\nexport class InvalidParametersError extends Error {\n static name = 'InvalidParametersError'\n\n constructor (message = 'Invalid parameters') {\n super(message)\n this.name = 'InvalidParametersError'\n }\n}\n\n/**\n * Thrown when a public key is invalid\n */\nexport class InvalidPublicKeyError extends Error {\n static name = 'InvalidPublicKeyError'\n\n constructor (message = 'Invalid public key') {\n super(message)\n this.name = 'InvalidPublicKeyError'\n }\n}\n\n/**\n * Thrown when a private key is invalid\n */\nexport class InvalidPrivateKeyError extends Error {\n static name = 'InvalidPrivateKeyError'\n\n constructor (message = 'Invalid private key') {\n super(message)\n this.name = 'InvalidPrivateKeyError'\n }\n}\n\n/**\n * Thrown when a operation is unsupported\n */\nexport class UnsupportedOperationError extends Error {\n static name = 'UnsupportedOperationError'\n\n constructor (message = 'Unsupported operation') {\n super(message)\n this.name = 'UnsupportedOperationError'\n }\n}\n\n/**\n * Thrown when a connection is closing\n */\nexport class ConnectionClosingError extends Error {\n static name = 'ConnectionClosingError'\n\n constructor (message = 'The connection is closing') {\n super(message)\n this.name = 'ConnectionClosingError'\n }\n}\n\n/**\n * Thrown when a connection is closed\n */\nexport class ConnectionClosedError extends Error {\n static name = 'ConnectionClosedError'\n\n constructor (message = 'The connection is closed') {\n super(message)\n this.name = 'ConnectionClosedError'\n }\n}\n\n/**\n * Thrown when a connection fails\n */\nexport class ConnectionFailedError extends Error {\n static name = 'ConnectionFailedError'\n\n constructor (message = 'Connection failed') {\n super(message)\n this.name = 'ConnectionFailedError'\n }\n}\n\n/**\n * Thrown when the muxer is closed and an attempt to open a stream occurs\n */\nexport class MuxerClosedError extends Error {\n static name = 'MuxerClosedError'\n\n constructor (message = 'The muxer is closed') {\n super(message)\n this.name = 'MuxerClosedError'\n }\n}\n\n/**\n * Thrown when a protocol stream is closed during an operation\n *\n * @deprecated delete if unused\n */\nexport class StreamClosedError extends Error {\n static name = 'StreamClosedError'\n\n constructor (message = 'The stream has been closed') {\n super(message)\n this.name = 'StreamClosedError'\n }\n}\n\n/**\n * Thrown when a protocol stream is closing during an operation\n *\n * @deprecated delete if unused\n */\nexport class StreamClosingError extends Error {\n static name = 'StreamClosingError'\n\n constructor (message = 'The stream is closing') {\n super(message)\n this.name = 'StreamClosingError'\n }\n}\n\n/**\n * Thrown when a protocol stream is reset by the remote muxer\n */\nexport class StreamResetError extends Error {\n static name = 'StreamResetError'\n\n constructor (message = 'The stream has been reset') {\n super(message)\n this.name = 'StreamResetError'\n }\n}\n\n/**\n * Thrown when a protocol stream is aborted locally\n */\nexport class StreamAbortedError extends Error {\n static name = 'StreamAbortedError'\n\n constructor (message = 'The stream has been aborted') {\n super(message)\n this.name = 'StreamAbortedError'\n }\n}\n\n/**\n * Thrown when a stream is in an invalid state\n */\nexport class StreamStateError extends Error {\n static name = 'StreamStateError'\n\n constructor (message = 'The stream is in an invalid state') {\n super(message)\n this.name = 'StreamStateError'\n }\n}\n\n/**\n * Thrown when a stream buffer is full\n */\nexport class StreamBufferError extends Error {\n static name = 'StreamBufferError'\n\n constructor (message = 'The stream buffer was full') {\n super(message)\n this.name = 'StreamBufferError'\n }\n}\n\n/**\n * Thrown when a value could not be found\n */\nexport class NotFoundError extends Error {\n static name = 'NotFoundError'\n\n constructor (message = 'Not found') {\n super(message)\n this.name = 'NotFoundError'\n }\n}\n\n/**\n * Thrown when an invalid peer ID is encountered\n */\nexport class InvalidPeerIdError extends Error {\n static name = 'InvalidPeerIdError'\n\n constructor (message = 'Invalid PeerID') {\n super(message)\n this.name = 'InvalidPeerIdError'\n }\n}\n\n/**\n * Thrown when an invalid multiaddr is encountered\n */\nexport class InvalidMultiaddrError extends Error {\n static name = 'InvalidMultiaddrError'\n\n constructor (message = 'Invalid multiaddr') {\n super(message)\n this.name = 'InvalidMultiaddrError'\n }\n}\n\n/**\n * Thrown when an invalid CID is encountered\n */\nexport class InvalidCIDError extends Error {\n static name = 'InvalidCIDError'\n\n constructor (message = 'Invalid CID') {\n super(message)\n this.name = 'InvalidCIDError'\n }\n}\n\n/**\n * Thrown when an invalid multihash is encountered\n */\nexport class InvalidMultihashError extends Error {\n static name = 'InvalidMultihashError'\n\n constructor (message = 'Invalid Multihash') {\n super(message)\n this.name = 'InvalidMultihashError'\n }\n}\n\n/**\n * Thrown when a protocol is not supported\n */\nexport class UnsupportedProtocolError extends Error {\n static name = 'UnsupportedProtocolError'\n\n constructor (message = 'Unsupported protocol error') {\n super(message)\n this.name = 'UnsupportedProtocolError'\n }\n}\n\n/**\n * An invalid or malformed message was encountered during a protocol exchange\n */\nexport class InvalidMessageError extends Error {\n static name = 'InvalidMessageError'\n\n constructor (message = 'Invalid message') {\n super(message)\n this.name = 'InvalidMessageError'\n }\n}\n\n/**\n * Thrown when a remote peer sends a structurally valid message that does not\n * comply with the protocol\n */\nexport class ProtocolError extends Error {\n static name = 'ProtocolError'\n\n constructor (message = 'Protocol error') {\n super(message)\n this.name = 'ProtocolError'\n }\n}\n\n/**\n * Throw when an operation times out\n */\nexport class TimeoutError extends Error {\n static name = 'TimeoutError'\n\n constructor (message = 'Timed out') {\n super(message)\n this.name = 'TimeoutError'\n }\n}\n\n/**\n * Thrown when a startable component is interacted with but it has not been\n * started yet\n */\nexport class NotStartedError extends Error {\n static name = 'NotStartedError'\n\n constructor (message = 'Not started') {\n super(message)\n this.name = 'NotStartedError'\n }\n}\n\n/**\n * Thrown when a component is started that has already been started\n */\nexport class AlreadyStartedError extends Error {\n static name = 'AlreadyStartedError'\n\n constructor (message = 'Already started') {\n super(message)\n this.name = 'AlreadyStartedError'\n }\n}\n\n/**\n * Thrown when dialing an address failed\n */\nexport class DialError extends Error {\n static name = 'DialError'\n\n constructor (message = 'Dial error') {\n super(message)\n this.name = 'DialError'\n }\n}\n\n/**\n * Thrown when listening on an address failed\n */\nexport class ListenError extends Error {\n static name = 'ListenError'\n\n constructor (message = 'Listen error') {\n super(message)\n this.name = 'ListenError'\n }\n}\n\n/**\n * This error is thrown when a limited connection is encountered, i.e. if the\n * user tried to open a stream on a connection for a protocol that is not\n * configured to run over limited connections.\n */\nexport class LimitedConnectionError extends Error {\n static name = 'LimitedConnectionError'\n\n constructor (message = 'Limited connection') {\n super(message)\n this.name = 'LimitedConnectionError'\n }\n}\n\n/**\n * This error is thrown where there are too many inbound protocols streams open\n */\nexport class TooManyInboundProtocolStreamsError extends Error {\n static name = 'TooManyInboundProtocolStreamsError'\n\n constructor (message = 'Too many inbound protocol streams') {\n super(message)\n this.name = 'TooManyInboundProtocolStreamsError'\n }\n}\n\n/**\n * This error is thrown where there are too many outbound protocols streams open\n */\nexport class TooManyOutboundProtocolStreamsError extends Error {\n static name = 'TooManyOutboundProtocolStreamsError'\n\n constructor (message = 'Too many outbound protocol streams') {\n super(message)\n this.name = 'TooManyOutboundProtocolStreamsError'\n }\n}\n\n/**\n * Thrown when an attempt to operate on an unsupported key was made\n */\nexport class UnsupportedKeyTypeError extends Error {\n static name = 'UnsupportedKeyTypeError'\n\n constructor (message = 'Unsupported key type') {\n super(message)\n this.name = 'UnsupportedKeyTypeError'\n }\n}\n\n/**\n * Thrown when an operation has not been implemented\n */\nexport class NotImplementedError extends Error {\n static name = 'NotImplementedError'\n\n constructor (message = 'Not implemented') {\n super(message)\n this.name = 'NotImplementedError'\n }\n}\n", "import type { Uint8ArrayList } from 'uint8arraylist'\n\n/**\n * A custom implementation of MessageEvent as the Undici version does too much\n * validation in it's constructor so is very slow.\n */\nexport class StreamMessageEvent extends Event {\n public data: Uint8Array | Uint8ArrayList\n\n constructor (data: Uint8Array | Uint8ArrayList, eventInitDict?: EventInit) {\n super('message', eventInitDict)\n\n this.data = data\n }\n}\n\n/**\n * An event dispatched when the stream is closed. The `error` property can be\n * inspected to discover if the closing was graceful or not, and the `remote`\n * property shows which end of the stream initiated the closure\n */\nexport class StreamCloseEvent extends Event {\n public error?: Error\n public local?: boolean\n\n constructor (local?: boolean, error?: Error, eventInitDict?: EventInit) {\n super('close', eventInitDict)\n\n this.error = error\n this.local = local\n }\n}\n\nexport class StreamAbortEvent extends StreamCloseEvent {\n constructor (error: Error, eventInitDict?: EventInit) {\n super(true, error, eventInitDict)\n }\n}\n\nexport class StreamResetEvent extends StreamCloseEvent {\n constructor (error: Error, eventInitDict?: EventInit) {\n super(false, error, eventInitDict)\n }\n}\n", "import type { Ed25519PublicKey, KeyType, RSAPublicKey, Secp256k1PublicKey } from './keys.js'\nimport type { CID } from 'multiformats/cid'\nimport type { MultihashDigest } from 'multiformats/hashes/interface'\n\nexport type PeerIdType = KeyType | string\n\n/**\n * A PeerId generated from an RSA public key - it is a base58btc encoded sha-256\n * hash of the public key.\n *\n * RSA public keys are too large to pass around freely, instead Ed25519 or\n * secp256k1 should be preferred as they can embed their public key in the\n * PeerId itself.\n *\n * @deprecated Ed25519 or secp256k1 keys are preferred to RSA\n */\nexport interface RSAPeerId {\n readonly type: 'RSA'\n\n /**\n * RSA public keys are too large to embed in the multihash commonly used to\n * refer to peers, so this will only be defined if the public key has\n * previously been found through a routing query or during normal protocol\n * operations\n */\n readonly publicKey?: RSAPublicKey\n\n /**\n * Returns the multihash from `toMultihash()` as a base58btc encoded string\n */\n toString(): string\n\n /**\n * Returns a multihash, the digest of which is the SHA2-256 hash of the public\n * key\n */\n toMultihash(): MultihashDigest<0x12>\n\n /**\n * Returns a CID with the libp2p key code and the same multihash as\n * `toMultihash()`\n */\n toCID(): CID<Uint8Array, 0x72, 0x12, 1>\n\n /**\n * Returns true if the passed argument is equivalent to this PeerId\n */\n equals(other?: any): boolean\n}\n\nexport interface Ed25519PeerId {\n readonly type: 'Ed25519'\n\n /**\n * This will always be defined as the public key is embedded in the multihash\n * of this PeerId\n */\n readonly publicKey: Ed25519PublicKey\n\n /**\n * Returns the multihash from `toMultihash()` as a base58btc encoded string\n */\n toString(): string\n\n /**\n * Returns a multihash, the digest of which is the protobuf-encoded public key\n * encoded as an identity hash\n */\n toMultihash(): MultihashDigest<0x0>\n\n /**\n * Returns a CID with the libp2p key code and the same multihash as\n * `toMultihash()`\n */\n toCID(): CID<Uint8Array, 0x72, 0x0, 1>\n\n /**\n * Returns true if the passed argument is equivalent to this PeerId\n */\n equals(other?: any): boolean\n}\n\nexport interface Secp256k1PeerId {\n readonly type: 'secp256k1'\n\n /**\n * This will always be defined as the public key is embedded in the multihash\n * of this PeerId\n */\n readonly publicKey: Secp256k1PublicKey\n\n /**\n * Returns the multihash from `toMultihash()` as a base58btc encoded string\n */\n toString(): string\n\n /**\n * Returns a multihash, the digest of which is the protobuf-encoded public key\n * encoded as an identity hash\n */\n toMultihash(): MultihashDigest<0x0>\n\n /**\n * Returns a CID with the libp2p key code and the same multihash as\n * `toMultihash()`\n */\n toCID(): CID<Uint8Array, 0x72, 0x0, 1>\n\n /**\n * Returns true if the passed argument is equivalent to this PeerId\n */\n equals(other?: any): boolean\n}\n\nexport interface URLPeerId {\n readonly type: 'url'\n\n /**\n * This will always be undefined as URL Peers do not have public keys\n */\n readonly publicKey: undefined\n\n /**\n * Returns CID from `toCID()` encoded as a base36 string\n */\n toString(): string\n\n /**\n * Returns a multihash, the digest of which is the URL encoded as an identity\n * hash\n */\n toMultihash(): MultihashDigest<0x0>\n\n /**\n * Returns a CID with the Transport IPFS Gateway HTTP code and the same\n * multihash as `toMultihash()`\n */\n toCID(): CID<Uint8Array, 0x0920, 0x0, 1>\n\n /**\n * Returns true if the passed argument is equivalent to this PeerId\n */\n equals(other?: any): boolean\n}\n\n/**\n * This is a union of all known PeerId types - use the `.type` field to\n * disambiguate them\n */\nexport type PeerId = RSAPeerId | Ed25519PeerId | Secp256k1PeerId | URLPeerId\n\n/**\n * All PeerId implementations must use this symbol as the name of a property\n * with a boolean `true` value\n */\nexport const peerIdSymbol = Symbol.for('@libp2p/peer-id')\n\n/**\n * Returns true if the passed argument is a PeerId implementation\n */\nexport function isPeerId (other?: any): other is PeerId {\n return Boolean(other?.[peerIdSymbol])\n}\n", "import type { AbortOptions, ClearableSignal, ConnectionEncrypter, MultiaddrConnection, Connection, ConnectionLimits, StreamMuxerFactory, PeerId } from './index.js'\nimport type { Multiaddr } from '@multiformats/multiaddr'\nimport type { TypedEventTarget } from 'main-event'\nimport type { ProgressOptions, ProgressEvent } from 'progress-events'\n\nexport interface ListenerEvents {\n /**\n * This event signals to the transport manager that the listening addresses\n * have changed and may be emitted at any point and/or multiple times\n */\n listening: CustomEvent\n\n /**\n * Emitted if listening on an address failed\n */\n error: CustomEvent<Error>\n\n /**\n * Emitted when the listener has been shut down, has no open connections and\n * will no longer accept new connections\n */\n close: CustomEvent\n}\n\nexport interface Listener extends TypedEventTarget<ListenerEvents> {\n /**\n * Start a listener\n */\n listen(multiaddr: Multiaddr): Promise<void>\n\n /**\n * Get listen addresses\n */\n getAddrs(): Multiaddr[]\n\n /**\n * Close listener\n *\n * @returns {Promise<void>}\n */\n close(): Promise<void>\n\n /**\n * Allows transports to amend announce addresses - to add certificate hashes\n * or other metadata that cannot be known before runtime\n */\n updateAnnounceAddrs(addrs: Multiaddr[]): void\n}\n\nexport const transportSymbol = Symbol.for('@libp2p/transport')\n\n/**\n * A filter that acts on a list of multiaddrs\n */\nexport interface MultiaddrFilter {\n (multiaddrs: Multiaddr[]): Multiaddr[]\n}\n\nexport interface CreateListenerOptions {\n /**\n * The upgrader turns a MultiaddrConnection into a Connection and notifies\n * other libp2p components about a new incoming connection.\n */\n upgrader: Upgrader\n}\n\nexport interface DialTransportOptions<DialEvents extends ProgressEvent = ProgressEvent> extends Required<AbortOptions>, ProgressOptions<DialEvents> {\n /**\n * The upgrader turns a MultiaddrConnection into a Connection which should be\n * returned by the transport's dial method\n */\n upgrader: Upgrader\n}\n\n/**\n * A libp2p transport offers dial and listen methods to establish connections.\n */\nexport interface Transport<DialEvents extends ProgressEvent = ProgressEvent> {\n /**\n * Used to identify the transport\n */\n [Symbol.toStringTag]: string\n\n /**\n * Used by the isTransport function\n */\n [transportSymbol]: true\n\n /**\n * Dial a given multiaddr.\n */\n dial(ma: Multiaddr, options: DialTransportOptions<DialEvents>): Promise<Connection>\n\n /**\n * Create transport listeners.\n */\n createListener(options: CreateListenerOptions): Listener\n\n /**\n * Takes a list of `Multiaddr`s and returns only addresses that are valid for\n * the transport to listen on\n */\n listenFilter: MultiaddrFilter\n\n /**\n * Takes a list of `Multiaddr`s and returns only addresses that are valid for\n * the transport to dial\n */\n dialFilter: MultiaddrFilter\n}\n\n/**\n * Used to disambiguate transport implementations\n */\nexport function isTransport (other?: any): other is Transport {\n return other != null && Boolean(other[transportSymbol])\n}\n\n/**\n * Enum Transport Manager Fault Tolerance values\n */\nexport enum FaultTolerance {\n /**\n * should be used for failing in any listen circumstance\n */\n FATAL_ALL = 0,\n\n /**\n * should be used for not failing when not listening\n */\n NO_FATAL\n}\n\n/**\n * Options accepted by the upgrader during connection establishment\n */\nexport interface UpgraderOptions<ConnectionUpgradeEvents extends ProgressEvent = ProgressEvent> extends ProgressOptions<ConnectionUpgradeEvents>, Required<AbortOptions> {\n /**\n * If true no connection protection will be performed on the connection.\n */\n skipProtection?: boolean\n\n /**\n * By default a stream muxer protocol will be negotiated via multi-stream\n * select after an encryption protocol has been agreed on.\n *\n * If a transport provides it's own stream muxing facility pass a muxer\n * factory instance here to skip muxer negotiation.\n */\n muxerFactory?: StreamMuxerFactory\n\n /**\n * If the connection is to have limits applied to it, pass them here\n */\n limits?: ConnectionLimits\n\n /**\n * Multi-stream select is a initiator/responder protocol. By default a\n * connection returned from `upgrader.upgradeOutbound` will be the initiator\n * and one returned from `upgrader.upgradeInbound` will be the responder.\n *\n * Pass a value here to override the default.\n */\n initiator?: boolean\n}\n\n/**\n * Options accepted by the upgrader during connection establishment\n */\nexport interface UpgraderWithoutEncryptionOptions extends UpgraderOptions {\n /**\n * If true the invoking transport is expected to implement it's own encryption\n * and an encryption protocol will not attempted to be negotiated via\n * multi-stream select\n */\n skipEncryption: true\n\n /**\n * If `skipEncryption` is true, a remote PeerId must be supplied\n */\n remotePeer: PeerId\n}\n\nexport type InboundConnectionUpgradeEvents =\nProgressEvent<'upgrader:encrypt-inbound-connection'> |\nProgressEvent<'upgrader:multiplex-inbound-connection'>\n\nexport type OutboundConnectionUpgradeEvents =\nProgressEvent<'upgrader:encrypt-outbound-connection'> |\nProgressEvent<'upgrader:multiplex-outbound-connection'>\n\nexport interface Upgrader {\n /**\n * Upgrades an outbound connection created by the `dial` method of a transport\n */\n upgradeOutbound(maConn: MultiaddrConnection, opts: UpgraderOptions<OutboundConnectionUpgradeEvents>): Promise<Connection>\n upgradeOutbound(maConn: MultiaddrConnection, opts: UpgraderWithoutEncryptionOptions): Promise<Connection>\n\n /**\n * Upgrades an inbound connection received by a transport listener and\n * notifies other libp2p components about the new connection\n */\n upgradeInbound(maConn: MultiaddrConnection, opts: UpgraderOptions<InboundConnectionUpgradeEvents>): Promise<void>\n upgradeInbound(maConn: MultiaddrConnection, opts: UpgraderWithoutEncryptionOptions): Promise<void>\n\n /**\n * Used by transports that perform part of the upgrade process themselves and\n * do some async work. This allows configuring inbound upgrade timeouts from a\n * single location.\n *\n * Regular transports should just pass the signal from their shutdown\n * controller to `upgradeInbound`.\n */\n createInboundAbortSignal (signal: AbortSignal): ClearableSignal\n\n /**\n * Returns configured stream muxers\n */\n getStreamMuxers (): Map<string, StreamMuxerFactory>\n\n /**\n * Returns configured connection encrypters\n */\n getConnectionEncrypters (): Map<string, ConnectionEncrypter>\n}\n", "import { setMaxListeners as nodeSetMaxListeners } from 'node:events'\n\n/**\n * Create a setMaxListeners that doesn't break browser usage\n */\nexport const setMaxListeners: typeof nodeSetMaxListeners = (n, ...eventTargets) => {\n try {\n nodeSetMaxListeners(n, ...eventTargets)\n } catch {\n // swallow error, gulp\n }\n}\n", "/**\n * @packageDocumentation\n *\n * Adds types to the EventTarget class.\n *\n * Hopefully this won't be necessary\n * forever:\n *\n * - https://github.com/microsoft/TypeScript/issues/28357\n * - https://github.com/microsoft/TypeScript/issues/43477\n * - https://github.com/microsoft/TypeScript/issues/299\n * - https://www.npmjs.com/package/typed-events\n * - https://www.npmjs.com/package/typed-event-emitter\n * - https://www.npmjs.com/package/typed-event-target\n * - etc\n *\n * In addition to types, a `safeDispatchEvent` method is available which\n * prevents dispatching events that aren't in the event map, and a\n * `listenerCount` method which reports the number of listeners that are\n * currently registered for a given event.\n *\n * @example\n *\n * ```ts\n * import { TypedEventEmitter } from 'main-event'\n * import type { TypedEventTarget } from 'main-event'\n *\n * interface EventTypes {\n * 'test': CustomEvent<string>\n * }\n *\n * const target = new TypedEventEmitter<EventTypes>()\n *\n * // it's a regular EventTarget\n * console.info(target instanceof EventTarget) // true\n *\n * // register listeners normally\n * target.addEventListener('test', (evt) => {\n * // evt is CustomEvent<string>\n * })\n *\n * // @ts-expect-error 'derp' is not in the event map\n * target.addEventListener('derp', () => {})\n *\n * // use normal dispatchEvent method\n * target.dispatchEvent(new CustomEvent('test', {\n * detail: 'hello'\n * }))\n *\n * // use type safe dispatch method\n * target.safeDispatchEvent('test', {\n * detail: 'world'\n * })\n *\n * // report listener count\n * console.info(target.listenerCount('test')) // 0\n *\n * // event emitters can be used purely as interfaces too\n * function acceptTarget (target: TypedEventTarget<EventTypes>) {\n * // ...\n * }\n * ```\n */\n\nimport { setMaxListeners } from './events.js'\n\nexport interface EventCallback<EventType> { (evt: EventType): void }\nexport interface EventObject<EventType> { handleEvent: EventCallback<EventType> }\nexport type EventHandler<EventType> = EventCallback<EventType> | EventObject<EventType>\n\ninterface Listener {\n once: boolean\n callback: any\n}\n\n/**\n *\n */\nexport interface TypedEventTarget <EventMap extends Record<string, any>> extends EventTarget {\n addEventListener<K extends keyof EventMap>(type: K, listener: EventHandler<EventMap[K]> | null, options?: boolean | AddEventListenerOptions): void\n\n listenerCount (type: string): number\n\n removeEventListener<K extends keyof EventMap>(type: K, listener?: EventHandler<EventMap[K]> | null, options?: boolean | EventListenerOptions): void\n\n removeEventListener (type: string, listener?: EventHandler<Event>, options?: boolean | EventListenerOptions): void\n\n safeDispatchEvent<Detail>(type: keyof EventMap, detail?: CustomEventInit<Detail>): boolean\n}\n\n/**\n * An implementation of a typed event target\n */\nexport class TypedEventEmitter<EventMap extends Record<string, any>> extends EventTarget implements TypedEventTarget<EventMap> {\n readonly #listeners = new Map<any, Listener[]>()\n\n constructor () {\n super()\n\n // silence MaxListenersExceededWarning warning on Node.js, this is a red\n // herring almost all of the time\n setMaxListeners(Infinity, this)\n }\n\n listenerCount (type: string): number {\n const listeners = this.#listeners.get(type)\n\n if (listeners == null) {\n return 0\n }\n\n return listeners.length\n }\n\n addEventListener<K extends keyof EventMap>(type: K, listener: EventHandler<EventMap[K]> | null, options?: boolean | AddEventListenerOptions): void\n addEventListener (type: string, listener: EventHandler<Event>, options?: boolean | AddEventListenerOptions): void {\n super.addEventListener(type, listener, options)\n\n let list = this.#listeners.get(type)\n\n if (list == null) {\n list = []\n this.#listeners.set(type, list)\n }\n\n list.push({\n callback: listener,\n once: (options !== true && options !== false && options?.once) ?? false\n })\n }\n\n removeEventListener<K extends keyof EventMap>(type: K, listener?: EventHandler<EventMap[K]> | null, options?: boolean | EventListenerOptions): void\n removeEventListener (type: string, listener?: EventHandler<Event>, options?: boolean | EventListenerOptions): void {\n super.removeEventListener(type.toString(), listener ?? null, options)\n\n let list = this.#listeners.get(type)\n\n if (list == null) {\n return\n }\n\n list = list.filter(({ callback }) => callback !== listener)\n this.#listeners.set(type, list)\n }\n\n dispatchEvent (event: Event): boolean {\n const result = super.dispatchEvent(event)\n\n let list = this.#listeners.get(event.type)\n\n if (list == null) {\n return result\n }\n\n list = list.filter(({ once }) => !once)\n this.#listeners.set(event.type, list)\n\n return result\n }\n\n safeDispatchEvent<Detail>(type: keyof EventMap, detail: CustomEventInit<Detail> = {}): boolean {\n return this.dispatchEvent(new CustomEvent<Detail>(type as string, detail))\n }\n}\n\nexport { setMaxListeners }\n", "/**\n * @packageDocumentation\n *\n * Exports a `Libp2p` type for modules to use as a type argument.\n *\n * @example\n *\n * ```typescript\n * import type { Libp2p } from '@libp2p/interface'\n *\n * function doSomethingWithLibp2p (node: Libp2p) {\n * // ...\n * }\n * ```\n */\n\nimport type { Connection, NewStreamOptions } from './connection.js'\nimport type { ContentRouting } from './content-routing.js'\nimport type { Ed25519PublicKey, PublicKey, RSAPublicKey, Secp256k1PublicKey } from './keys.js'\nimport type { Metrics } from './metrics.js'\nimport type { Ed25519PeerId, PeerId, RSAPeerId, Secp256k1PeerId, URLPeerId } from './peer-id.js'\nimport type { PeerInfo } from './peer-info.js'\nimport type { PeerRouting } from './peer-routing.js'\nimport type { Address, Peer, PeerStore } from './peer-store.js'\nimport type { Startable } from './startable.js'\nimport type { StreamHandler, StreamHandlerOptions } from './stream-handler.js'\nimport type { Stream } from './stream.js'\nimport type { Topology } from './topology.js'\nimport type { Listener, OutboundConnectionUpgradeEvents } from './transport.js'\nimport type { DNS } from '@multiformats/dns'\nimport type { Multiaddr } from '@multiformats/multiaddr'\nimport type { TypedEventTarget } from 'main-event'\nimport type { ProgressOptions, ProgressEvent } from 'progress-events'\n\n/**\n * Used by the connection manager to sort addresses into order before dialling\n */\nexport interface AddressSorter {\n (a: Address, b: Address): -1 | 0 | 1\n}\n\n/**\n * Event detail emitted when peer data changes\n */\nexport interface PeerUpdate {\n peer: Peer\n previous?: Peer\n}\n\n/**\n * Peer data signed by the remote Peer's public key\n */\nexport interface SignedPeerRecord {\n addresses: Multiaddr[]\n seq: bigint\n}\n\n/**\n * A certificate that can be used to secure connections\n */\nexport interface TLSCertificate {\n /**\n * The private key that corresponds to the certificate in PEM format\n */\n key: string\n\n /**\n * The certificate chain in PEM format\n */\n cert: string\n}\n\n/**\n * Data returned from a successful identify response\n */\nexport interface IdentifyResult {\n /**\n * The remote Peer's PeerId\n */\n peerId: PeerId\n\n /**\n * The unsigned addresses they are listening on. Note - any multiaddrs present\n * in the signed peer record should be preferred to the value here.\n */\n listenAddrs: Multiaddr[]\n\n /**\n * The protocols the remote peer supports\n */\n protocols: string[]\n\n /**\n * The remote protocol version\n */\n protocolVersion?: string\n\n /**\n * The remote agent version\n */\n agentVersion?: string\n\n /**\n * The public key part of the remote PeerId - this is only useful for older\n * RSA-based PeerIds, the more modern Ed25519 and secp256k1 types have the\n * public key embedded in them\n */\n publicKey?: Uint8Array\n\n /**\n * If set this is the address that the remote peer saw the identify request\n * originate from\n */\n observedAddr?: Multiaddr\n\n /**\n * If sent by the remote peer this is the deserialized signed peer record\n */\n signedPeerRecord?: SignedPeerRecord\n\n /**\n * The connection that the identify protocol ran over\n */\n connection: Connection\n}\n\n/**\n * Logger component for libp2p\n */\nexport interface Logger {\n /**\n * Log a message\n */\n (formatter: any, ...args: any[]): void\n\n /**\n * Log an error message\n */\n error(formatter: any, ...args: any[]): void\n\n /**\n * Log a trace message\n */\n trace(formatter: any, ...args: any[]): void\n\n /**\n * `true` if this logger is enabled\n */\n enabled: boolean\n\n /**\n * Create a logger scoped below this one\n *\n * @example\n *\n * ```ts\n * import { defaultLogger } from '@libp2p/logger'\n *\n * const log = defaultLogger().forComponent('foo')\n *\n * log('hello')\n * // foo hello\n *\n * const subLog = log.newScope('bar')\n *\n * subLog('hello')\n * // foo:bar hello\n * ```\n */\n newScope(name: string): Logger\n}\n\n/**\n * Peer logger component for libp2p. This can be used to create loggers that are\n * scoped to individual system components or services.\n *\n * To see logs, run your app with `DEBUG` set as an env var or for browsers, in\n * `localStorage`:\n *\n * ```console\n * $ DEBUG=libp2p* node index.js\n * libp2p:my-service hello +0ms\n * ```\n */\nexport interface ComponentLogger {\n /**\n * Returns a logger for the specified component.\n *\n * @example\n *\n * ```TypeScript\n * import { ComponentLogger, Logger } from '@libp2p/interface'\n *\n * interface MyServiceComponents {\n * logger: ComponentLogger\n * }\n *\n * class MyService {\n * private readonly log: Logger\n *\n * constructor (components) {\n * this.log = components.logger.forComponent('libp2p:my-service')\n *\n * this.log('hello')\n * // logs:\n * // libp2p:my-service hello +0ms\n * }\n * }\n * ```\n */\n forComponent(name: string): Logger\n}\n\nexport interface MultiaddrResolveOptions extends AbortOptions, LoggerOptions {\n /**\n * An optional DNS resolver\n */\n dns?: DNS\n}\n\n/**\n * `MultiaddrResolver`s perform resolution of multiaddr components that require\n * translation by external systems (for example DNSADDR to TXT records).\n */\nexport interface MultiaddrResolver {\n /**\n * Returns true if this resolver can resolve components of this multiaddr\n */\n canResolve (address: Multiaddr): boolean\n\n /**\n * Returns one or more multiaddrs with components resolved to other values\n */\n resolve (address: Multiaddr, options: MultiaddrResolveOptions): Promise<Multiaddr[]>\n}\n\n/**\n * Once you have a libp2p instance, you can listen to several events it emits,\n * so that you can be notified of relevant network events.\n *\n * Event names are `noun:verb` so the first part is the name of the object\n * being acted on and the second is the action.\n */\nexport interface Libp2pEvents<T extends ServiceMap = ServiceMap> {\n /**\n * This event is dispatched when a new network peer is discovered.\n *\n * @example\n *\n * ```TypeScript\n * libp2p.addEventListener('peer:discovery', (event) => {\n * const peerInfo = event.detail\n * // ...\n * })\n * ```\n */\n 'peer:discovery': CustomEvent<PeerInfo>\n\n /**\n * This event will be triggered any time a new peer connects.\n *\n * @example\n *\n * ```TypeScript\n * libp2p.addEventListener('peer:connect', (event) => {\n * const peerId = event.detail\n * // ...\n * })\n * ```\n */\n 'peer:connect': CustomEvent<PeerId>\n\n /**\n * This event will be triggered any time we are disconnected from another\n * peer, regardless of the circumstances of that disconnection. If we happen\n * to have multiple connections to a peer, this event will **only** be\n * triggered when the last connection is closed.\n *\n * @example\n *\n * ```TypeScript\n * libp2p.addEventListener('peer:disconnect', (event) => {\n * const peerId = event.detail\n * // ...\n * })\n * ```\n */\n 'peer:disconnect': CustomEvent<PeerId>\n\n /**\n * When a peer tagged with `keep-alive` disconnects, we will make multiple\n * attempts to reconnect to it with a backoff factor (see the connection\n * manager settings for details). If these all fail, the `keep-alive` tag will\n * be removed and this event will be emitted.\n *\n * @example\n *\n * ```TypeScript\n * libp2p.addEventListener('peer:reconnect-failure', (event) => {\n * const peerId = event.detail\n * // ...\n * })\n * ```\n */\n 'peer:reconnect-failure': CustomEvent<PeerId>\n\n /**\n * This event is dispatched after a remote peer has successfully responded to\n * the identify protocol. Note that for this to be emitted, both peers must\n * have an identify service configured.\n *\n * @example\n *\n * ```TypeScript\n * libp2p.addEventListener('peer:identify', (event) => {\n * const identifyResult = event.detail\n * // ...\n * })\n * ```\n */\n 'peer:identify': CustomEvent<IdentifyResult>\n\n /**\n * This event is dispatched when the peer store data for a peer has been\n * updated - e.g. their multiaddrs, protocols etc have changed.\n *\n * If they were previously known to this node, the old peer data will be\n * set in the `previous` field.\n *\n * This may be in response to the identify protocol running, a manual\n * update or some other event.\n */\n 'peer:update': CustomEvent<PeerUpdate>\n\n /**\n * This event is dispatched when the current node's peer record changes -\n * for example a transport started listening on a new address or a new\n * protocol handler was registered.\n *\n * @example\n *\n * ```TypeScript\n * libp2p.addEventListener('self:peer:update', (event) => {\n * const { peer } = event.detail\n * // ...\n * })\n * ```\n */\n 'self:peer:update': CustomEvent<PeerUpdate>\n\n /**\n * This event is dispatched when a transport begins listening on a new address\n */\n 'transport:listening': CustomEvent<Listener>\n\n /**\n * This event is dispatched when a transport stops listening on an address\n */\n 'transport:close': CustomEvent<Listener>\n\n /**\n * This event is dispatched when the connection manager has more than the\n * configured allowable max connections and has closed some connections to\n * bring the node back under the limit.\n */\n 'connection:prune': CustomEvent<Connection[]>\n\n /**\n * This event notifies listeners when new incoming or outgoing connections\n * are opened.\n */\n 'connection:open': CustomEvent<Connection>\n\n /**\n * This event notifies listeners when incoming or outgoing connections are\n * closed.\n */\n 'connection:close': CustomEvent<Connection>\n\n /**\n * This event notifies listeners that a TLS certificate is available for use\n */\n 'certificate:provision': CustomEvent<TLSCertificate>\n\n /**\n * This event notifies listeners that a new TLS certificate is available for\n * use. Any previous certificate may no longer be valid.\n */\n 'certificate:renew': CustomEvent<TLSCertificate>\n\n /**\n * This event notifies listeners that the node has started\n *\n * ```TypeScript\n * libp2p.addEventListener('start', (event) => {\n * console.info(libp2p.isStarted()) // true\n * })\n * ```\n */\n start: CustomEvent<Libp2p<T>>\n\n /**\n * This event notifies listeners that the node has stopped\n *\n * ```TypeScript\n * libp2p.addEventListener('stop', (event) => {\n * console.info(libp2p.isStarted()) // false\n * })\n * ```\n */\n stop: CustomEvent<Libp2p<T>>\n}\n\n/**\n * A map of user defined services available on the libp2p node via the\n * `services` key\n *\n * @example\n *\n * ```TypeScript\n * const node = await createLibp2p({\n * // ...other options\n * services: {\n * myService: myService({\n * // ...service options\n * })\n * }\n * })\n *\n * // invoke methods on the service\n * node.services.myService.anOperation()\n * ```\n */\nexport type ServiceMap = Record<string, unknown>\n\nexport type PendingDialStatus = 'queued' | 'active' | 'error' | 'success'\n\n/**\n * An item in the dial queue\n */\nexport interface PendingDial {\n /**\n * A unique identifier for this dial\n */\n id: string\n\n /**\n * The current status of the dial\n */\n status: PendingDialStatus\n\n /**\n * If known, this is the peer id that libp2p expects to be dialling\n */\n peerId?: PeerId\n\n /**\n * The list of multiaddrs that will be dialled. The returned connection will\n * use the first address that succeeds, all other dials part of this pending\n * dial will be cancelled.\n */\n multiaddrs: Multiaddr[]\n}\n\nexport type Libp2pStatus = 'starting' | 'started' | 'stopping' | 'stopped'\n\nexport interface IsDialableOptions extends AbortOptions {\n /**\n * If the dial attempt would open a protocol, and the multiaddr being dialed\n * is a circuit relay address, passing true here would cause the test to fail\n * because that protocol would not be allowed to run over a data/time limited\n * connection.\n */\n runOnLimitedConnection?: boolean\n}\n\nexport type TransportManagerDialProgressEvents =\n ProgressEvent<'transport-manager:selected-transport', string>\n\nexport type OpenConnectionProgressEvents =\n TransportManagerDialProgressEvents |\n ProgressEvent<'dial-queue:already-connected'> |\n ProgressEvent<'dial-queue:already-in-dial-queue'> |\n ProgressEvent<'dial-queue:add-to-dial-queue'> |\n ProgressEvent<'dial-queue:start-dial'> |\n ProgressEvent<'dial-queue:calculated-addresses', Address[]> |\n OutboundConnectionUpgradeEvents\n\nexport interface DialOptions extends AbortOptions, ProgressOptions {\n /**\n * If true, open a new connection to the remote even if one already exists\n */\n force?: boolean\n}\n\nexport interface DialProtocolOptions extends NewStreamOptions {\n\n}\n\n/**\n * Libp2p nodes implement this interface.\n */\nexport interface Libp2p<T extends ServiceMap = ServiceMap> extends Startable, TypedEventTarget<Libp2pEvents<T>> {\n /**\n * The PeerId is a unique identifier for a node on the network.\n *\n * It is the hash of an RSA public key or, for Ed25519 or secp256k1 keys,\n * the key itself.\n *\n * @example\n *\n * ```TypeScript\n * console.info(libp2p.peerId)\n * // PeerId(12D3Foo...)\n * ````\n */\n peerId: PeerId\n\n /**\n * The peer store holds information we know about other peers on the network.\n * - multiaddrs, supported protocols, etc.\n *\n * @example\n *\n * ```TypeScript\n * const peer = await libp2p.peerStore.get(peerId)\n * console.info(peer)\n * // { id: PeerId(12D3Foo...), addresses: [] ... }\n * ```\n */\n peerStore: PeerStore\n\n /**\n * The peer routing subsystem allows the user to find peers on the network\n * or to find peers close to binary keys.\n *\n * @example\n *\n * ```TypeScript\n * const peerInfo = await libp2p.peerRouting.findPeer(peerId)\n * console.info(peerInfo)\n * // { id: PeerId(12D3Foo...), multiaddrs: [] ... }\n * ```\n *\n * @example\n *\n * ```TypeScript\n * for await (const peerInfo of libp2p.peerRouting.getClosestPeers(key)) {\n * console.info(peerInfo)\n * // { id: PeerId(12D3Foo...), multiaddrs: [] ... }\n * }\n * ```\n */\n peerRouting: PeerRouting\n\n /**\n * The content routing subsystem allows the user to find providers for content,\n * let the network know they are providers for content, and get/put values to\n * the DHT.\n *\n * @example\n *\n * ```TypeScript\n * for await (const peerInfo of libp2p.contentRouting.findProviders(cid)) {\n * console.info(peerInfo)\n * // { id: PeerId(12D3Foo...), multiaddrs: [] ... }\n * }\n * ```\n */\n contentRouting: ContentRouting\n\n /**\n * The metrics subsystem allows recording values to assess the health/performance\n * of the running node.\n *\n * @example\n *\n * ```TypeScript\n * const metric = libp2p.metrics.registerMetric({\n * 'my-metric'\n * })\n *\n * // later\n * metric.update(5)\n * ```\n */\n metrics?: Metrics\n\n /**\n * The logger used by this libp2p node\n */\n logger: ComponentLogger\n\n /**\n * The current status of the libp2p node\n */\n status: Libp2pStatus\n\n /**\n * Get a deduplicated list of peer advertising multiaddrs by concatenating\n * the listen addresses used by transports with any configured\n * announce addresses as well as observed addresses reported by peers.\n *\n * If Announce addrs are specified, configured listen addresses will be\n * ignored though observed addresses will still be included.\n *\n * @example\n *\n * ```TypeScript\n * const listenMa = libp2p.getMultiaddrs()\n * // [ <Multiaddr 047f00000106f9ba - /ip4/127.0.0.1/tcp/63930> ]\n * ```\n */\n getMultiaddrs(): Multiaddr[]\n\n /**\n * Returns a list of supported protocols\n *\n * @example\n *\n * ```TypeScript\n * const protocols = libp2p.getProtocols()\n * // [ '/ipfs/ping/1.0.0', '/ipfs/id/1.0.0' ]\n * ```\n */\n getProtocols(): string[]\n\n /**\n * Return a list of all connections this node has open, optionally filtering\n * by a PeerId\n *\n * @example\n *\n * ```TypeScript\n * for (const connection of libp2p.getConnections()) {\n * console.log(peerId, connection.remoteAddr.toString())\n * // Logs the PeerId string and the observed remote multiaddr of each Connection\n * }\n * ```\n */\n getConnections(peerId?: PeerId): Connection[]\n\n /**\n * Return the list of dials currently in progress or queued to start\n *\n * @example\n *\n * ```TypeScript\n * for (const pendingDial of libp2p.getDialQueue()) {\n * console.log(pendingDial)\n * }\n * ```\n */\n getDialQueue(): PendingDial[]\n\n /**\n * Return a list of all peers we currently have a connection open to\n */\n getPeers(): PeerId[]\n\n /**\n * Dials to the provided peer. If successful, the known metadata of the\n * peer will be added to the nodes `peerStore`.\n *\n * If a PeerId is passed as the first argument, the peer will need to have known multiaddrs for it in the PeerStore.\n *\n * @example\n *\n * ```TypeScript\n * const conn = await libp2p.dial(remotePeerId)\n *\n * // create a new stream within the connection\n * const stream = await conn.newStream(['/echo/1.1.0', '/echo/1.0.0'])\n *\n * // protocol negotiated: 'echo/1.0.0' means that the other party only supports the older version\n *\n * // ...\n * await conn.close()\n * ```\n */\n dial(peer: PeerId | Multiaddr | Multiaddr[], options?: DialOptions): Promise<Connection>\n\n /**\n * Dials to the provided peer and tries to handshake with the given protocols in order.\n * If successful, the known metadata of the peer will be added to the nodes `peerStore`,\n * and the `MuxedStream` will be returned together with the successful negotiated protocol.\n *\n * @example\n *\n * ```TypeScript\n * import { pipe } from 'it-pipe'\n *\n * const { stream, protocol } = await libp2p.dialProtocol(remotePeerId, protocols)\n *\n * // Use this new stream like any other duplex stream\n * pipe([1, 2, 3], stream, consume)\n * ```\n */\n dialProtocol(peer: PeerId | Multiaddr | Multiaddr[], protocols: string | string[], options?: DialProtocolOptions): Promise<Stream>\n\n /**\n * Attempts to gracefully close an open connection to the given peer. If the\n * connection is not closed in the grace period, it will be forcefully closed.\n *\n * An AbortSignal can optionally be passed to control when the connection is\n * forcefully closed.\n *\n * @example\n *\n * ```TypeScript\n * await libp2p.hangUp(remotePeerId)\n * ```\n */\n hangUp(peer: PeerId | Multiaddr, options?: AbortOptions): Promise<void>\n\n /**\n * Sets up [multistream-select routing](https://github.com/multiformats/multistream-select) of protocols to their application handlers. Whenever a stream is opened on one of the provided protocols, the handler will be called. `handle` must be called in order to register a handler and support for a given protocol. This also informs other peers of the protocols you support.\n *\n * `libp2p.handle(protocols, handler, options)`\n *\n * In the event of a new handler for the same protocol being added and error\n * will be thrown. Pass `force: true` to override this.\n *\n * @example\n *\n * ```TypeScript\n * const handler = ({ connection, stream, protocol }) => {\n * // use stream or connection according to the needs\n * }\n *\n * libp2p.handle('/echo/1.0.0', handler, {\n * maxInboundStreams: 5,\n * maxOutboundStreams: 5\n * })\n * ```\n */\n handle(protocol: string | string[], handler: StreamHandler, options?: StreamHandlerOptions): Promise<void>\n\n /**\n * Removes the handler for each protocol. The protocol\n * will no longer be supported on streams.\n *\n * @example\n *\n * ```TypeScript\n * libp2p.unhandle(['/echo/1.0.0'])\n * ```\n */\n unhandle(protocols: string[] | string, options?: AbortOptions): Promise<void>\n\n /**\n * Register a topology to be informed when peers are encountered that\n * support the specified protocol\n *\n * @example\n *\n * ```TypeScript\n * const id = await libp2p.register('/echo/1.0.0', {\n * onConnect: (peer, connection) => {\n * // handle connect\n * },\n * onDisconnect: (peer, connection) => {\n * // handle disconnect\n * }\n * })\n * ```\n */\n register(protocol: string, topology: Topology, options?: AbortOptions): Promise<string>\n\n /**\n * Unregister topology to no longer be informed when peers connect or\n * disconnect.\n *\n * @example\n *\n * ```TypeScript\n * const id = await libp2p.register(...)\n *\n * libp2p.unregister(id)\n * ```\n */\n unregister(id: string): void\n\n /**\n * Returns the public key for the passed PeerId. If the PeerId is of the 'RSA'\n * type this may mean searching the routing if the peer's key is not present\n * in the peer store.\n */\n getPublicKey(peer: Ed25519PeerId, options?: AbortOptions): Promise<Ed25519PublicKey>\n getPublicKey(peer: Secp256k1PeerId, options?: AbortOptions): Promise<Secp256k1PublicKey>\n getPublicKey(peer: RSAPeerId, options?: AbortOptions): Promise<RSAPublicKey>\n getPublicKey(peer: URLPeerId, options?: AbortOptions): Promise<never>\n getPublicKey(peer: PeerId, options?: AbortOptions): Promise<PublicKey>\n\n /**\n * Given the current node configuration, returns a promise of `true` or\n * `false` if the node would attempt to dial the passed multiaddr.\n *\n * This means a relevant transport is configured, and the connection gater\n * would not block the dial attempt.\n *\n * This may involve resolving DNS addresses so you should pass an AbortSignal.\n */\n isDialable(multiaddr: Multiaddr | Multiaddr[], options?: IsDialableOptions): Promise<boolean>\n\n /**\n * A set of user defined services\n */\n services: T\n}\n\n/**\n * Metadata about the current node\n */\nexport interface NodeInfo {\n /**\n * The implementation name\n */\n name: string\n\n /**\n * The implementation version\n */\n version: string\n\n /**\n * A string that contains information about the implementation and runtime\n */\n userAgent: string\n}\n\n/**\n * An object that contains an AbortSignal as\n * the optional `signal` property.\n *\n * @example\n *\n * ```TypeScript\n * const controller = new AbortController()\n *\n * aLongRunningOperation({\n * signal: controller.signal\n * })\n *\n * // later\n *\n * controller.abort()\n */\nexport interface AbortOptions {\n signal?: AbortSignal\n}\n\n/**\n * An object that contains a Logger as the `log` property.\n */\nexport interface LoggerOptions {\n log: Logger\n}\n\n/**\n * An object that includes a trace object that is passed onwards.\n *\n * This is used by metrics method tracing to link function calls together.\n */\nexport interface TraceOptions {\n trace?: any\n}\n\n/**\n * A signal that needs to be cleared when no longer in use\n */\nexport interface ClearableSignal extends AbortSignal {\n clear(): void\n}\n\n/**\n * When a routing operation involves reading values, these options allow\n * controlling where the values are read from. By default libp2p will check\n * local caches but may not use the network if a valid local value is found,\n * these options allow tuning that behavior.\n */\nexport interface RoutingOptions extends AbortOptions, ProgressOptions, TraceOptions {\n /**\n * Pass `false` to not use the network\n *\n * @default true\n */\n useNetwork?: boolean\n\n /**\n * Pass `false` to not use cached values\n *\n * @default true\n */\n useCache?: boolean\n}\n\n/**\n * This symbol is used by libp2p services to define the capabilities they can\n * provide to other libp2p services.\n *\n * The service should define a property with this symbol as the key and the\n * value should be a string array of provided capabilities.\n */\nexport const serviceCapabilities = Symbol.for('@libp2p/service-capabilities')\n\n/**\n * This symbol is used by libp2p services to define the capabilities they\n * require from other libp2p services.\n *\n * The service should define a property with this symbol as the key and the\n * value should be a string array of required capabilities.\n */\nexport const serviceDependencies = Symbol.for('@libp2p/service-dependencies')\n\nexport * from './connection.js'\nexport * from './connection-encrypter.js'\nexport * from './connection-gater.js'\nexport * from './connection-protector.js'\nexport * from './content-routing.js'\nexport * from './errors.js'\nexport * from './events.js'\nexport * from './keys.js'\nexport * from './message-stream.js'\nexport * from './metrics.js'\nexport * from './multiaddr-connection.js'\nexport * from './peer-discovery.js'\nexport * from './peer-id.js'\nexport * from './peer-info.js'\nexport * from './peer-routing.js'\nexport * from './peer-store.js'\nexport * from './pubsub.js'\nexport * from './record.js'\nexport * from './startable.js'\nexport * from './stream-handler.js'\nexport * from './stream-muxer.js'\nexport * from './stream.js'\nexport * from './topology.js'\nexport * from './transport.js'\n\nexport * from 'main-event'\n", "/**\n * @packageDocumentation\n *\n * This module is a fork of the [debug](https://www.npmjs.com/package/debug) module. It has been converted to TypeScript and the output is ESM.\n *\n * It is API compatible with no extra features or bug fixes, it should only be used if you want a 100% ESM application.\n *\n * ESM should be arriving in `debug@5.x.x` so this module can be retired after that.\n *\n * Please see [debug](https://www.npmjs.com/package/debug) for API details.\n */\n\n/**\n * Module dependencies.\n */\n\nimport tty from 'node:tty'\nimport util from 'node:util'\nimport humanize from 'ms'\nimport supportsColor from 'supports-color'\nimport setup from './common.js'\n\n/**\n * This is the Node.js implementation of `debug()`.\n */\n\n/**\n * Colors.\n */\n\nlet colors = [6, 2, 3, 4, 5, 1]\n\nif (supportsColor.stderr !== false && (supportsColor.stderr ?? supportsColor).level >= 2) {\n colors = [\n 20,\n 21,\n 26,\n 27,\n 32,\n 33,\n 38,\n 39,\n 40,\n 41,\n 42,\n 43,\n 44,\n 45,\n 56,\n 57,\n 62,\n 63,\n 68,\n 69,\n 74,\n 75,\n 76,\n 77,\n 78,\n 79,\n 80,\n 81,\n 92,\n 93,\n 98,\n 99,\n 112,\n 113,\n 128,\n 129,\n 134,\n 135,\n 148,\n 149,\n 160,\n 161,\n 162,\n 163,\n 164,\n 165,\n 166,\n 167,\n 168,\n 169,\n 170,\n 171,\n 172,\n 173,\n 178,\n 179,\n 184,\n 185,\n 196,\n 197,\n 198,\n 199,\n 200,\n 201,\n 202,\n 203,\n 204,\n 205,\n 206,\n 207,\n 208,\n 209,\n 214,\n 215,\n 220,\n 221\n ]\n}\n\n/**\n * Build up the default `inspectOpts` object from the environment variables.\n *\n * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js\n */\n\nconst inspectOpts = Object.keys(process.env).filter(key => {\n return /^debug_/i.test(key)\n}).reduce<Record<string, any>>((obj, key) => {\n // Camel-case\n const prop = key\n .substring(6)\n .toLowerCase()\n .replace(/_([a-z])/g, (_, k) => {\n return k.toUpperCase()\n })\n\n // Coerce string value into JS value\n let val: any = process.env[key]\n if (/^(yes|on|true|enabled)$/i.test(val)) {\n val = true\n } else if (/^(no|off|false|disabled)$/i.test(val)) {\n val = false\n } else if (val === 'null') {\n val = null\n } else {\n val = Number(val)\n }\n\n obj[prop] = val\n return obj\n}, {})\n\n/**\n * Is stdout a TTY? Colored output is enabled when `true`.\n */\n\nfunction useColors (): boolean {\n return 'colors' in inspectOpts\n ? Boolean(inspectOpts.colors)\n : tty.isatty(process.stderr.fd)\n}\n\n/**\n * Adds ANSI color escape codes if enabled.\n */\nfunction formatArgs (this: any, args: any[]): void {\n const {\n namespace: name, useColors\n } = this\n\n if (useColors === true) {\n const c = this.color\n const colorCode = '\\u001B[3' + (c < 8 ? c : '8;5;' + c)\n const prefix = ` ${colorCode};1m${name} \\u001B[0m`\n\n args[0] = prefix + args[0].split('\\n').join('\\n' + prefix)\n args.push(colorCode + 'm+' + humanize(this.diff) + '\\u001B[0m')\n } else {\n args[0] = getDate() + name + ' ' + args[0]\n }\n}\n\nfunction getDate (): string {\n if (inspectOpts.hideDate != null) {\n return ''\n }\n return new Date().toISOString() + ' '\n}\n\n/**\n * Invokes `util.format()` with the specified arguments and writes to stderr.\n */\nfunction log (...args: any[]): boolean {\n return process.stderr.write(util.format(...args) + '\\n')\n}\n\n/**\n * Save `namespaces`.\n *\n * @param {string} namespaces\n */\nfunction save (namespaces: string): void {\n if (namespaces != null) {\n process.env.DEBUG = namespaces\n } else {\n // If you set a process.env field to null or undefined, it gets cast to the\n // string 'null' or 'undefined'. Just delete instead.\n delete process.env.DEBUG\n }\n}\n\n/**\n * Load `namespaces`.\n *\n * @returns {string} returns the previously persisted debug modes\n */\nfunction load (): string | undefined {\n return process.env.DEBUG\n}\n\n/**\n * Init logic for `debug` instances.\n *\n * Create a new `inspectOpts` object in case `useColors` is set\n * differently for a particular `debug` instance.\n */\n\nfunction init (debug: any): void {\n debug.inspectOpts = {}\n\n const keys = Object.keys(inspectOpts)\n for (let i = 0; i < keys.length; i++) {\n debug.inspectOpts[keys[i]] = inspectOpts[keys[i]]\n }\n}\n\nfunction setupFormatters (formatters: any): void {\n /**\n * Map %o to `util.inspect()`, all on a single line.\n */\n formatters.o = function (v: any): string {\n this.inspectOpts.colors = this.useColors\n return util.inspect(v, this.inspectOpts)\n .split('\\n')\n .map(str => str.trim())\n .join(' ')\n }\n\n /**\n * Map %O to `util.inspect()`, allowing multiple lines if needed.\n */\n formatters.O = function (v: any): string {\n this.inspectOpts.colors = this.useColors\n return util.inspect(v, this.inspectOpts)\n }\n}\n\nexport default setup({ init, log, formatArgs, save, load, useColors, setupFormatters, colors, inspectOpts })\n", "const s = 1000;\nconst m = s * 60;\nconst h = m * 60;\nconst d = h * 24;\nconst w = d * 7;\nconst y = d * 365.25;\nconst mo = y / 12;\n\ntype Years = 'years' | 'year' | 'yrs' | 'yr' | 'y';\ntype Months = 'months' | 'month' | 'mo';\ntype Weeks = 'weeks' | 'week' | 'w';\ntype Days = 'days' | 'day' | 'd';\ntype Hours = 'hours' | 'hour' | 'hrs' | 'hr' | 'h';\ntype Minutes = 'minutes' | 'minute' | 'mins' | 'min' | 'm';\ntype Seconds = 'seconds' | 'second' | 'secs' | 'sec' | 's';\ntype Milliseconds = 'milliseconds' | 'millisecond' | 'msecs' | 'msec' | 'ms';\ntype Unit =\n | Years\n | Months\n | Weeks\n | Days\n | Hours\n | Minutes\n | Seconds\n | Milliseconds;\n\ntype UnitAnyCase = Capitalize<Unit> | Uppercase<Unit> | Unit;\n\nexport type StringValue =\n | `${number}`\n | `${number}${UnitAnyCase}`\n | `${number} ${UnitAnyCase}`;\n\ninterface Options {\n /**\n * Set to `true` to use verbose formatting. Defaults to `false`.\n */\n long?: boolean;\n}\n\n/**\n * Parse or format the given value.\n *\n * @param value - The string or number to convert\n * @param options - Options for the conversion\n * @throws Error if `value` is not a non-empty string or a number\n */\nexport function ms(value: StringValue, options?: Options): number;\nexport function ms(value: number, options?: Options): string;\nexport function ms(\n value: StringValue | number,\n options?: Options,\n): number | string {\n if (typeof value === 'string') {\n return parse(value);\n } else if (typeof value === 'number') {\n return format(value, options);\n }\n throw new Error(\n `Value provided to ms() must be a string or number. value=${JSON.stringify(value)}`,\n );\n}\n\nexport default ms;\n\n/**\n * Parse the given string and return milliseconds.\n *\n * @param str - A string to parse to milliseconds\n * @returns The parsed value in milliseconds, or `NaN` if the string can't be\n * parsed\n */\nexport function parse(str: string): number {\n if (typeof str !== 'string' || str.length === 0 || str.length > 100) {\n throw new Error(\n `Value provided to ms.parse() must be a string with length between 1 and 99. value=${JSON.stringify(str)}`,\n );\n }\n const match =\n /^(?<value>-?\\d*\\.?\\d+) *(?<unit>milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|months?|mo|years?|yrs?|y)?$/i.exec(\n str,\n );\n\n if (!match?.groups) {\n return NaN;\n }\n\n // Named capture groups need to be manually typed today.\n // https://github.com/microsoft/TypeScript/issues/32098\n const { value, unit = 'ms' } = match.groups as {\n value: string;\n unit: string | undefined;\n };\n\n const n = parseFloat(value);\n\n const matchUnit = unit.toLowerCase() as Lowercase<Unit>;\n\n /* istanbul ignore next - istanbul doesn't understand, but thankfully the TypeScript the exhaustiveness check in the default case keeps us type safe here */\n switch (matchUnit) {\n case 'years':\n case 'year':\n case 'yrs':\n case 'yr':\n case 'y':\n return n * y;\n case 'months':\n case 'month':\n case 'mo':\n return n * mo;\n case 'weeks':\n case 'week':\n case 'w':\n return n * w;\n case 'days':\n case 'day':\n case 'd':\n return n * d;\n case 'hours':\n case 'hour':\n case 'hrs':\n case 'hr':\n case 'h':\n return n * h;\n case 'minutes':\n case 'minute':\n case 'mins':\n case 'min':\n case 'm':\n return n * m;\n case 'seconds':\n case 'second':\n case 'secs':\n case 'sec':\n case 's':\n return n * s;\n case 'milliseconds':\n case 'millisecond':\n case 'msecs':\n case 'msec':\n case 'ms':\n return n;\n default:\n matchUnit satisfies never;\n throw new Error(\n `Unknown unit \"${matchUnit}\" provided to ms.parse(). value=${JSON.stringify(str)}`,\n );\n }\n}\n\n/**\n * Parse the given StringValue and return milliseconds.\n *\n * @param value - A typesafe StringValue to parse to milliseconds\n * @returns The parsed value in milliseconds, or `NaN` if the string can't be\n * parsed\n */\nexport function parseStrict(value: StringValue): number {\n return parse(value);\n}\n\n/**\n * Short format for `ms`.\n */\nfunction fmtShort(ms: number): StringValue {\n const msAbs = Math.abs(ms);\n if (msAbs >= y) {\n return `${Math.round(ms / y)}y`;\n }\n if (msAbs >= mo) {\n return `${Math.round(ms / mo)}mo`;\n }\n if (msAbs >= w) {\n return `${Math.round(ms / w)}w`;\n }\n if (msAbs >= d) {\n return `${Math.round(ms / d)}d`;\n }\n if (msAbs >= h) {\n return `${Math.round(ms / h)}h`;\n }\n if (msAbs >= m) {\n return `${Math.round(ms / m)}m`;\n }\n if (msAbs >= s) {\n return `${Math.round(ms / s)}s`;\n }\n return `${ms}ms`;\n}\n\n/**\n * Long format for `ms`.\n */\nfunction fmtLong(ms: number): StringValue {\n const msAbs = Math.abs(ms);\n if (msAbs >= y) {\n return plural(ms, msAbs, y, 'year');\n }\n if (msAbs >= mo) {\n return plural(ms, msAbs, mo, 'month');\n }\n if (msAbs >= w) {\n return plural(ms, msAbs, w, 'week');\n }\n if (msAbs >= d) {\n return plural(ms, msAbs, d, 'day');\n }\n if (msAbs >= h) {\n return plural(ms, msAbs, h, 'hour');\n }\n if (msAbs >= m) {\n return plural(ms, msAbs, m, 'minute');\n }\n if (msAbs >= s) {\n return plural(ms, msAbs, s, 'second');\n }\n return `${ms} ms`;\n}\n\n/**\n * Format the given integer as a string.\n *\n * @param ms - milliseconds\n * @param options - Options for the conversion\n * @returns The formatted string\n */\nexport function format(ms: number, options?: Options): string {\n if (typeof ms !== 'number' || !Number.isFinite(ms)) {\n throw new Error('Value provided to ms.format() must be of type number.');\n }\n\n return options?.long ? fmtLong(ms) : fmtShort(ms);\n}\n\n/**\n * Pluralization helper.\n */\nfunction plural(\n ms: number,\n msAbs: number,\n n: number,\n name: string,\n): StringValue {\n const isPlural = msAbs >= n * 1.5;\n return `${Math.round(ms / n)} ${name}${isPlural ? 's' : ''}` as StringValue;\n}\n", "import process from 'node:process';\nimport os from 'node:os';\nimport tty from 'node:tty';\n\n// From: https://github.com/sindresorhus/has-flag/blob/main/index.js\n/// function hasFlag(flag, argv = globalThis.Deno?.args ?? process.argv) {\nfunction hasFlag(flag, argv = globalThis.Deno ? globalThis.Deno.args : process.argv) {\n\tconst prefix = flag.startsWith('-') ? '' : (flag.length === 1 ? '-' : '--');\n\tconst position = argv.indexOf(prefix + flag);\n\tconst terminatorPosition = argv.indexOf('--');\n\treturn position !== -1 && (terminatorPosition === -1 || position < terminatorPosition);\n}\n\nconst {env} = process;\n\nlet flagForceColor;\nif (\n\thasFlag('no-color')\n\t|| hasFlag('no-colors')\n\t|| hasFlag('color=false')\n\t|| hasFlag('color=never')\n) {\n\tflagForceColor = 0;\n} else if (\n\thasFlag('color')\n\t|| hasFlag('colors')\n\t|| hasFlag('color=true')\n\t|| hasFlag('color=always')\n) {\n\tflagForceColor = 1;\n}\n\nfunction envForceColor() {\n\tif (!('FORCE_COLOR' in env)) {\n\t\treturn;\n\t}\n\n\tif (env.FORCE_COLOR === 'true') {\n\t\treturn 1;\n\t}\n\n\tif (env.FORCE_COLOR === 'false') {\n\t\treturn 0;\n\t}\n\n\tif (env.FORCE_COLOR.length === 0) {\n\t\treturn 1;\n\t}\n\n\tconst level = Math.min(Number.parseInt(env.FORCE_COLOR, 10), 3);\n\n\tif (![0, 1, 2, 3].includes(level)) {\n\t\treturn;\n\t}\n\n\treturn level;\n}\n\nfunction translateLevel(level) {\n\tif (level === 0) {\n\t\treturn false;\n\t}\n\n\treturn {\n\t\tlevel,\n\t\thasBasic: true,\n\t\thas256: level >= 2,\n\t\thas16m: level >= 3,\n\t};\n}\n\nfunction _supportsColor(haveStream, {streamIsTTY, sniffFlags = true} = {}) {\n\tconst noFlagForceColor = envForceColor();\n\tif (noFlagForceColor !== undefined) {\n\t\tflagForceColor = noFlagForceColor;\n\t}\n\n\tconst forceColor = sniffFlags ? flagForceColor : noFlagForceColor;\n\n\tif (forceColor === 0) {\n\t\treturn 0;\n\t}\n\n\tif (sniffFlags) {\n\t\tif (hasFlag('color=16m')\n\t\t\t|| hasFlag('color=full')\n\t\t\t|| hasFlag('color=truecolor')) {\n\t\t\treturn 3;\n\t\t}\n\n\t\tif (hasFlag('color=256')) {\n\t\t\treturn 2;\n\t\t}\n\t}\n\n\t// Check for Azure DevOps pipelines.\n\t// Has to be above the `!streamIsTTY` check.\n\tif ('TF_BUILD' in env && 'AGENT_NAME' in env) {\n\t\treturn 1;\n\t}\n\n\tif (haveStream && !streamIsTTY && forceColor === undefined) {\n\t\treturn 0;\n\t}\n\n\tconst min = forceColor || 0;\n\n\tif (env.TERM === 'dumb') {\n\t\treturn min;\n\t}\n\n\tif (process.platform === 'win32') {\n\t\t// Windows 10 build 10586 is the first Windows release that supports 256 colors.\n\t\t// Windows 10 build 14931 is the first release that supports 16m/TrueColor.\n\t\tconst osRelease = os.release().split('.');\n\t\tif (\n\t\t\tNumber(osRelease[0]) >= 10\n\t\t\t&& Number(osRelease[2]) >= 10_586\n\t\t) {\n\t\t\treturn Number(osRelease[2]) >= 14_931 ? 3 : 2;\n\t\t}\n\n\t\treturn 1;\n\t}\n\n\tif ('CI' in env) {\n\t\tif (['GITHUB_ACTIONS', 'GITEA_ACTIONS', 'CIRCLECI'].some(key => key in env)) {\n\t\t\treturn 3;\n\t\t}\n\n\t\tif (['TRAVIS', 'APPVEYOR', 'GITLAB_CI', 'BUILDKITE', 'DRONE'].some(sign => sign in env) || env.CI_NAME === 'codeship') {\n\t\t\treturn 1;\n\t\t}\n\n\t\treturn min;\n\t}\n\n\tif ('TEAMCITY_VERSION' in env) {\n\t\treturn /^(9\\.(0*[1-9]\\d*)\\.|\\d{2,}\\.)/.test(env.TEAMCITY_VERSION) ? 1 : 0;\n\t}\n\n\tif (env.COLORTERM === 'truecolor') {\n\t\treturn 3;\n\t}\n\n\tif (env.TERM === 'xterm-kitty') {\n\t\treturn 3;\n\t}\n\n\tif (env.TERM === 'xterm-ghostty') {\n\t\treturn 3;\n\t}\n\n\tif (env.TERM === 'wezterm') {\n\t\treturn 3;\n\t}\n\n\tif ('TERM_PROGRAM' in env) {\n\t\tconst version = Number.parseInt((env.TERM_PROGRAM_VERSION || '').split('.')[0], 10);\n\n\t\tswitch (env.TERM_PROGRAM) {\n\t\t\tcase 'iTerm.app': {\n\t\t\t\treturn version >= 3 ? 3 : 2;\n\t\t\t}\n\n\t\t\tcase 'Apple_Terminal': {\n\t\t\t\treturn 2;\n\t\t\t}\n\t\t\t// No default\n\t\t}\n\t}\n\n\tif (/-256(color)?$/i.test(env.TERM)) {\n\t\treturn 2;\n\t}\n\n\tif (/^screen|^xterm|^vt100|^vt220|^rxvt|color|ansi|cygwin|linux/i.test(env.TERM)) {\n\t\treturn 1;\n\t}\n\n\tif ('COLORTERM' in env) {\n\t\treturn 1;\n\t}\n\n\treturn min;\n}\n\nexport function createSupportsColor(stream, options = {}) {\n\tconst level = _supportsColor(stream, {\n\t\tstreamIsTTY: stream && stream.isTTY,\n\t\t...options,\n\t});\n\n\treturn translateLevel(level);\n}\n\nconst supportsColor = {\n\tstdout: createSupportsColor({isTTY: tty.isatty(1)}),\n\tstderr: createSupportsColor({isTTY: tty.isatty(2)}),\n};\n\nexport default supportsColor;\n", "/* eslint-disable no-console */\n\n/**\n * This is the common logic for both the Node.js and web browser\n * implementations of `debug()`.\n */\nimport humanize from 'ms'\nimport type { Debug, Debugger } from './index.js'\n\nexport default function setup (env: any): Debug {\n createDebug.debug = createDebug\n createDebug.default = createDebug\n createDebug.coerce = coerce\n createDebug.disable = disable\n createDebug.enable = enable\n createDebug.enabled = enabled\n createDebug.humanize = humanize\n createDebug.destroy = destroy\n\n Object.keys(env).forEach(key => {\n // @ts-expect-error cannot use string to index type\n createDebug[key] = env[key]\n })\n\n /**\n * The currently active debug mode names, and names to skip.\n */\n\n createDebug.names = [] as any[]\n createDebug.skips = [] as any[]\n\n /**\n * Map of special \"%n\" handling functions, for the debug \"format\" argument.\n *\n * Valid key names are a single, lower or upper-case letter, i.e. \"n\" and \"N\".\n */\n createDebug.formatters = {} satisfies Record<string, any>\n\n /**\n * Selects a color for a debug namespace\n *\n * @param {string} namespace - The namespace string for the debug instance to be colored\n * @returns {number | string} An ANSI color code for the given namespace\n */\n function selectColor (namespace: string): number | string {\n let hash = 0\n\n for (let i = 0; i < namespace.length; i++) {\n hash = ((hash << 5) - hash) + namespace.charCodeAt(i)\n hash |= 0 // Convert to 32bit integer\n }\n\n // @ts-expect-error colors is not in the types\n return createDebug.colors[Math.abs(hash) % createDebug.colors.length]\n }\n createDebug.selectColor = selectColor\n\n /**\n * Create a debugger with the given `namespace`.\n *\n * @param {string} namespace\n * @returns {Function}\n */\n function createDebug (namespace: string): Debugger {\n let prevTime: any\n let enableOverride: any = null\n let namespacesCache: any\n let enabledCache: any\n\n function debug (...args: any[]): void {\n // Disabled?\n // @ts-expect-error enabled is not in the types\n if (!debug.enabled) {\n return\n }\n\n const self: any = debug\n\n // Set `diff` timestamp\n const curr = Number(new Date())\n const ms = curr - (prevTime || curr)\n self.diff = ms\n self.prev = prevTime\n self.curr = curr\n prevTime = curr\n\n args[0] = createDebug.coerce(args[0])\n\n if (typeof args[0] !== 'string') {\n // Anything else let's inspect with %O\n args.unshift('%O')\n }\n\n // Apply any `formatters` transformations\n let index = 0\n args[0] = args[0].replace(/%([a-zA-Z%])/g, (match: any, format: any): any => {\n // If we encounter an escaped % then don't increase the array index\n if (match === '%%') {\n return '%'\n }\n index++\n // @ts-expect-error formatters is not in the types\n const formatter = createDebug.formatters[format]\n if (typeof formatter === 'function') {\n const val = args[index]\n match = formatter.call(self, val)\n\n // Now we need to remove `args[index]` since it's inlined in the `format`\n args.splice(index, 1)\n index--\n }\n return match\n })\n\n // Apply env-specific formatting (colors, etc.)\n // @ts-expect-error formatArgs is not in the types\n createDebug.formatArgs.call(self, args)\n\n // @ts-expect-error log is not in the types\n const logFn = self.log || createDebug.log\n logFn.apply(self, args)\n }\n\n debug.namespace = namespace\n // @ts-expect-error useColors is not in the types\n debug.useColors = createDebug.useColors()\n debug.color = createDebug.selectColor(namespace)\n debug.extend = extend\n debug.destroy = createDebug.destroy // XXX Temporary. Will be removed in the next major release.\n\n Object.defineProperty(debug, 'enabled', {\n enumerable: true,\n configurable: false,\n get: () => {\n if (enableOverride !== null) {\n return enableOverride\n }\n // @ts-expect-error namespaces is not in the types\n if (namespacesCache !== createDebug.namespaces) {\n // @ts-expect-error namespaces is not in the types\n namespacesCache = createDebug.namespaces\n enabledCache = createDebug.enabled(namespace)\n }\n\n return enabledCache\n },\n set: v => {\n enableOverride = v\n }\n })\n\n // Env-specific initialization logic for debug instances\n // @ts-expect-error init is not in the types\n if (typeof createDebug.init === 'function') {\n // @ts-expect-error init is not in the types\n createDebug.init(debug)\n }\n\n // @ts-expect-error some properties are added dynamically\n return debug\n }\n\n function extend (this: any, namespace: string, delimiter: string): any {\n const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace)\n newDebug.log = this.log\n return newDebug\n }\n\n /**\n * Enables a debug mode by namespaces. This can include modes\n * separated by a colon and wildcards.\n *\n * @param {string} namespaces\n */\n function enable (namespaces: string): void {\n // @ts-expect-error save is not in the types\n createDebug.save(namespaces)\n // @ts-expect-error namespaces is not in the types\n createDebug.namespaces = namespaces\n\n createDebug.names = []\n createDebug.skips = []\n\n let i\n const split = (typeof namespaces === 'string' ? namespaces : '').split(/[\\s,]+/)\n const len = split.length\n\n for (i = 0; i < len; i++) {\n if (!split[i]) {\n // ignore empty strings\n continue\n }\n\n namespaces = split[i].replace(/\\*/g, '.*?')\n\n if (namespaces[0] === '-') {\n createDebug.skips.push(new RegExp('^' + namespaces.substr(1) + '$'))\n } else {\n createDebug.names.push(new RegExp('^' + namespaces + '$'))\n }\n }\n }\n\n /**\n * Disable debug output.\n *\n * @returns {string} namespaces\n */\n function disable (): string {\n const namespaces = [\n ...createDebug.names.map(toNamespace),\n ...createDebug.skips.map(toNamespace).map(namespace => '-' + namespace)\n ].join(',')\n createDebug.enable('')\n return namespaces\n }\n\n /**\n * Returns true if the given mode name is enabled, false otherwise.\n *\n * @param {string} name\n * @returns {boolean}\n */\n function enabled (name: string): boolean {\n if (name[name.length - 1] === '*') {\n return true\n }\n\n let i\n let len\n\n for (i = 0, len = createDebug.skips.length; i < len; i++) {\n if (createDebug.skips[i].test(name)) {\n return false\n }\n }\n\n for (i = 0, len = createDebug.names.length; i < len; i++) {\n if (createDebug.names[i].test(name)) {\n return true\n }\n }\n\n return false\n }\n\n /**\n * Convert regexp to namespace\n */\n function toNamespace (regexp: RegExp): string {\n return regexp.toString()\n .substring(2, regexp.toString().length - 2)\n .replace(/\\.\\*\\?$/, '*')\n }\n\n /**\n * Coerce `val`.\n */\n function coerce (val: any): any {\n if (val instanceof Error) {\n return val.stack ?? val.message\n }\n return val\n }\n\n /**\n * XXX DO NOT USE. This is a temporary stub function.\n * XXX It WILL be removed in the next major release.\n */\n function destroy (): void {\n console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.')\n }\n\n // @ts-expect-error setupFormatters is not in the types\n createDebug.setupFormatters(createDebug.formatters)\n\n // @ts-expect-error load is not in the types\n createDebug.enable(createDebug.load())\n\n // @ts-expect-error some properties are added dynamically\n return createDebug\n}\n", "/**\n * @packageDocumentation\n *\n * This module is a fork of the [debug](https://www.npmjs.com/package/debug) module. It has been converted to TypeScript and the output is ESM.\n *\n * It is API compatible with no extra features or bug fixes, it should only be used if you want a 100% ESM application.\n *\n * ESM should be arriving in `debug@5.x.x` so this module can be retired after that.\n *\n * Please see [debug](https://www.npmjs.com/package/debug) for API details.\n */\n\n/**\n * Module dependencies.\n */\nimport weald from './node.js'\nimport type ms from 'ms'\n\nexport interface Debug {\n (namespace: string): Debugger\n coerce(val: any): any\n disable(...args: string[]): string\n enable(namespaces: string | boolean): void\n enabled(namespaces: string): boolean\n formatArgs(this: Debugger, args: any[]): void\n log(...args: any[]): any\n selectColor(namespace: string): string | number\n humanize: typeof ms\n\n names: RegExp[]\n skips: RegExp[]\n\n formatters: Formatters\n\n inspectOpts?: {\n hideDate?: boolean | number | null\n colors?: boolean | number | null\n depth?: boolean | number | null\n showHidden?: boolean | number | null\n }\n}\n\nexport type Formatters = Record<string, (v: any) => string>\n\nexport interface Debugger {\n (formatter: any, ...args: any[]): void\n\n color: string\n diff: number\n enabled: boolean\n log(...args: any[]): any\n namespace: string\n destroy(): boolean\n extend(namespace: string, delimiter?: string): Debugger\n}\n\nexport default weald\n", "/**\n * @packageDocumentation\n *\n * A logger for libp2p based on [weald](https://www.npmjs.com/package/weald), a TypeScript port of the venerable [debug](https://www.npmjs.com/package/debug) module.\n *\n * @example\n *\n * ```TypeScript\n * import { logger } from '@libp2p/logger'\n *\n * const log = logger('libp2p:my:component:name')\n *\n * try {\n * // an operation\n * log('something happened: %s', 'it was ok')\n * } catch (err) {\n * log.error('something bad happened: %o', err)\n * }\n *\n * log('with this peer: %p', {})\n * log('and this base58btc: %b', Uint8Array.from([0, 1, 2, 3]))\n * log('and this base32: %t', Uint8Array.from([4, 5, 6, 7]))\n * ```\n *\n * ```console\n * $ DEBUG=libp2p:* node index.js\n * something happened: it was ok\n * something bad happened: <stack trace>\n * with this peer: 12D3Foo\n * with this base58btc: Qmfoo\n * with this base32: bafyfoo\n * ```\n */\n\nimport { base32 } from 'multiformats/bases/base32'\nimport { base58btc } from 'multiformats/bases/base58'\nimport { base64 } from 'multiformats/bases/base64'\nimport debug from 'weald'\nimport { truncatePeerId } from './utils.js'\nimport type { PeerId, Logger, ComponentLogger } from '@libp2p/interface'\nimport type { Multiaddr } from '@multiformats/multiaddr'\nimport type { Key } from 'interface-datastore'\nimport type { CID } from 'multiformats/cid'\n\n// Add a formatter for converting to a base58 string\ndebug.formatters.b = (v?: Uint8Array): string => {\n return v == null ? 'undefined' : base58btc.baseEncode(v)\n}\n\n// Add a formatter for converting to a base32 string\ndebug.formatters.t = (v?: Uint8Array): string => {\n return v == null ? 'undefined' : base32.baseEncode(v)\n}\n\n// Add a formatter for converting to a base64 string\ndebug.formatters.m = (v?: Uint8Array): string => {\n return v == null ? 'undefined' : base64.baseEncode(v)\n}\n\n// Add a formatter for stringifying peer ids\ndebug.formatters.p = (v?: PeerId): string => {\n return v == null ? 'undefined' : v.toString()\n}\n\n// Add a formatter for stringifying CIDs\ndebug.formatters.c = (v?: CID): string => {\n return v == null ? 'undefined' : v.toString()\n}\n\n// Add a formatter for stringifying Datastore keys\ndebug.formatters.k = (v: Key): string => {\n return v == null ? 'undefined' : v.toString()\n}\n\n// Add a formatter for stringifying Multiaddrs\ndebug.formatters.a = (v?: Multiaddr): string => {\n return v == null ? 'undefined' : v.toString()\n}\n\n// Add a formatter for stringifying Errors\ndebug.formatters.e = (v?: Error): string => {\n return v == null ? 'undefined' : notEmpty(v.stack) ?? notEmpty(v.message) ?? v.toString()\n}\n\nexport type { Logger, ComponentLogger }\n\nfunction createDisabledLogger (namespace: string): debug.Debugger {\n const logger = (): void => {}\n logger.enabled = false\n logger.color = ''\n logger.diff = 0\n logger.log = (): void => {}\n logger.namespace = namespace\n logger.destroy = () => true\n logger.extend = () => logger\n\n return logger\n}\n\nexport interface PeerLoggerOptions {\n prefixLength: number\n suffixLength: number\n}\n\n/**\n * Create a component logger that will prefix any log messages with a truncated\n * peer id.\n *\n * @example\n *\n * ```TypeScript\n * import { peerLogger } from '@libp2p/logger'\n * import { peerIdFromString } from '@libp2p/peer-id'\n *\n * const peerId = peerIdFromString('12D3FooBar')\n * const logger = peerLogger(peerId)\n *\n * const log = logger.forComponent('my-component')\n * log.info('hello world')\n * // logs \"12\u2026oBar:my-component hello world\"\n * ```\n */\nexport function peerLogger (peerId: PeerId, options: Partial<PeerLoggerOptions> = {}): ComponentLogger {\n return prefixLogger(truncatePeerId(peerId, options))\n}\n\n/**\n * Create a component logger that will prefix any log messages with the passed\n * string.\n *\n * @example\n *\n * ```TypeScript\n * import { prefixLogger } from '@libp2p/logger'\n *\n * const logger = prefixLogger('my-node')\n *\n * const log = logger.forComponent('my-component')\n * log.info('hello world')\n * // logs \"my-node:my-component hello world\"\n * ```\n */\nexport function prefixLogger (prefix: string): ComponentLogger {\n return {\n forComponent (name: string) {\n return logger(`${prefix}:${name}`)\n }\n }\n}\n\n/**\n * Create a component logger\n *\n * @example\n *\n * ```TypeScript\n * import { defaultLogger } from '@libp2p/logger'\n * import { peerIdFromString } from '@libp2p/peer-id'\n *\n * const logger = defaultLogger()\n *\n * const log = logger.forComponent('my-component')\n * log.info('hello world')\n * // logs \"my-component hello world\"\n * ```\n */\nexport function defaultLogger (): ComponentLogger {\n return {\n forComponent (name: string) {\n return logger(name)\n }\n }\n}\n\n/**\n * Creates a logger for the passed component name.\n *\n * @example\n *\n * ```TypeScript\n * import { logger } from '@libp2p/logger'\n *\n * const log = logger('my-component')\n * log.info('hello world')\n * // logs \"my-component hello world\"\n * ```\n */\nexport function logger (name: string): Logger {\n // trace logging is a no-op by default\n let trace: debug.Debugger = createDisabledLogger(`${name}:trace`)\n\n // look at all the debug names and see if trace logging has explicitly been enabled\n if (debug.enabled(`${name}:trace`) && debug.names.map((r: any) => r.toString()).find((n: string) => n.includes(':trace')) != null) {\n trace = debug(`${name}:trace`)\n }\n\n return Object.assign(debug(name), {\n error: debug(`${name}:error`),\n trace,\n newScope: (scope: string) => logger(`${name}:${scope}`)\n })\n}\n\nexport function disable (): void {\n debug.disable()\n}\n\nexport function enable (namespaces: string): void {\n debug.enable(namespaces)\n}\n\nexport function enabled (namespaces: string): boolean {\n return debug.enabled(namespaces)\n}\n\nfunction notEmpty (str?: string): string | undefined {\n if (str == null) {\n return\n }\n\n str = str.trim()\n\n if (str.length === 0) {\n return\n }\n\n return str\n}\n", "/**\n * Returns true if the two passed Uint8Arrays have the same content\n */\nexport function equals (a: Uint8Array, b: Uint8Array): boolean {\n if (a === b) {\n return true\n }\n\n if (a.byteLength !== b.byteLength) {\n return false\n }\n\n for (let i = 0; i < a.byteLength; i++) {\n if (a[i] !== b[i]) {\n return false\n }\n }\n\n return true\n}\n", "import { Buffer } from 'node:buffer'\nimport { asUint8Array } from '#util/as-uint8array'\n\n/**\n * Returns a new Uint8Array created by concatenating the passed Uint8Arrays\n */\nexport function concat (arrays: Uint8Array[], length?: number): Uint8Array {\n return asUint8Array(Buffer.concat(arrays, length))\n}\n", "/**\n * @packageDocumentation\n *\n * A class that lets you do operations over a list of Uint8Arrays without\n * copying them.\n *\n * ```js\n * import { Uint8ArrayList } from 'uint8arraylist'\n *\n * const list = new Uint8ArrayList()\n * list.append(Uint8Array.from([0, 1, 2]))\n * list.append(Uint8Array.from([3, 4, 5]))\n *\n * list.subarray()\n * // -> Uint8Array([0, 1, 2, 3, 4, 5])\n *\n * list.consume(3)\n * list.subarray()\n * // -> Uint8Array([3, 4, 5])\n *\n * // you can also iterate over the list\n * for (const buf of list) {\n * // ..do something with `buf`\n * }\n *\n * list.subarray(0, 1)\n * // -> Uint8Array([0])\n * ```\n *\n * ## Converting Uint8ArrayLists to Uint8Arrays\n *\n * There are two ways to turn a `Uint8ArrayList` into a `Uint8Array` - `.slice` and `.subarray` and one way to turn a `Uint8ArrayList` into a `Uint8ArrayList` with different contents - `.sublist`.\n *\n * ### slice\n *\n * Slice follows the same semantics as [Uint8Array.slice](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/TypedArray/slice) in that it creates a new `Uint8Array` and copies bytes into it using an optional offset & length.\n *\n * ```js\n * const list = new Uint8ArrayList()\n * list.append(Uint8Array.from([0, 1, 2]))\n * list.append(Uint8Array.from([3, 4, 5]))\n *\n * list.slice(0, 1)\n * // -> Uint8Array([0])\n * ```\n *\n * ### subarray\n *\n * Subarray attempts to follow the same semantics as [Uint8Array.subarray](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/TypedArray/subarray) with one important different - this is a no-copy operation, unless the requested bytes span two internal buffers in which case it is a copy operation.\n *\n * ```js\n * const list = new Uint8ArrayList()\n * list.append(Uint8Array.from([0, 1, 2]))\n * list.append(Uint8Array.from([3, 4, 5]))\n *\n * list.subarray(0, 1)\n * // -> Uint8Array([0]) - no-copy\n *\n * list.subarray(2, 5)\n * // -> Uint8Array([2, 3, 4]) - copy\n * ```\n *\n * ### sublist\n *\n * Sublist creates and returns a new `Uint8ArrayList` that shares the underlying buffers with the original so is always a no-copy operation.\n *\n * ```js\n * const list = new Uint8ArrayList()\n * list.append(Uint8Array.from([0, 1, 2]))\n * list.append(Uint8Array.from([3, 4, 5]))\n *\n * list.sublist(0, 1)\n * // -> Uint8ArrayList([0]) - no-copy\n *\n * list.sublist(2, 5)\n * // -> Uint8ArrayList([2], [3, 4]) - no-copy\n * ```\n *\n * ## Inspiration\n *\n * Borrows liberally from [bl](https://www.npmjs.com/package/bl) but only uses native JS types.\n */\nimport { allocUnsafe, alloc } from 'uint8arrays/alloc'\nimport { concat } from 'uint8arrays/concat'\nimport { equals } from 'uint8arrays/equals'\n\nconst symbol = Symbol.for('@achingbrain/uint8arraylist')\n\nexport type Appendable = Uint8ArrayList | Uint8Array\n\nfunction findBufAndOffset (bufs: Uint8Array[], index: number): { buf: Uint8Array, index: number } {\n if (index == null || index < 0) {\n throw new RangeError('index is out of bounds')\n }\n\n let offset = 0\n\n for (const buf of bufs) {\n const bufEnd = offset + buf.byteLength\n\n if (index < bufEnd) {\n return {\n buf,\n index: index - offset\n }\n }\n\n offset = bufEnd\n }\n\n throw new RangeError('index is out of bounds')\n}\n\n/**\n * Check if object is a CID instance\n *\n * @example\n *\n * ```js\n * import { isUint8ArrayList, Uint8ArrayList } from 'uint8arraylist'\n *\n * isUint8ArrayList(true) // false\n * isUint8ArrayList([]) // false\n * isUint8ArrayList(new Uint8ArrayList()) // true\n * ```\n */\nexport function isUint8ArrayList (value: any): value is Uint8ArrayList {\n return Boolean(value?.[symbol])\n}\n\nexport class Uint8ArrayList implements Iterable<Uint8Array> {\n private bufs: Uint8Array[]\n public length: number\n public readonly [symbol] = true\n\n constructor (...data: Appendable[]) {\n this.bufs = []\n this.length = 0\n\n if (data.length > 0) {\n this.appendAll(data)\n }\n }\n\n * [Symbol.iterator] (): Iterator<Uint8Array> {\n yield * this.bufs\n }\n\n get byteLength (): number {\n return this.length\n }\n\n /**\n * Add one or more `bufs` to the end of this Uint8ArrayList\n */\n append (...bufs: Appendable[]): void {\n this.appendAll(bufs)\n }\n\n /**\n * Add all `bufs` to the end of this Uint8ArrayList\n */\n appendAll (bufs: Appendable[]): void {\n let length = 0\n\n for (const buf of bufs) {\n if (buf instanceof Uint8Array) {\n length += buf.byteLength\n this.bufs.push(buf)\n } else if (isUint8ArrayList(buf)) {\n length += buf.byteLength\n this.bufs.push(...buf.bufs)\n } else {\n throw new Error('Could not append value, must be an Uint8Array or a Uint8ArrayList')\n }\n }\n\n this.length += length\n }\n\n /**\n * Add one or more `bufs` to the start of this Uint8ArrayList\n */\n prepend (...bufs: Appendable[]): void {\n this.prependAll(bufs)\n }\n\n /**\n * Add all `bufs` to the start of this Uint8ArrayList\n */\n prependAll (bufs: Appendable[]): void {\n let length = 0\n\n for (const buf of bufs.reverse()) {\n if (buf instanceof Uint8Array) {\n length += buf.byteLength\n this.bufs.unshift(buf)\n } else if (isUint8ArrayList(buf)) {\n length += buf.byteLength\n this.bufs.unshift(...buf.bufs)\n } else {\n throw new Error('Could not prepend value, must be an Uint8Array or a Uint8ArrayList')\n }\n }\n\n this.length += length\n }\n\n /**\n * Read the value at `index`\n */\n get (index: number): number {\n const res = findBufAndOffset(this.bufs, index)\n\n return res.buf[res.index]\n }\n\n /**\n * Set the value at `index` to `value`\n */\n set (index: number, value: number): void {\n const res = findBufAndOffset(this.bufs, index)\n\n res.buf[res.index] = value\n }\n\n /**\n * Copy bytes from `buf` to the index specified by `offset`\n */\n write (buf: Appendable, offset: number = 0): void {\n if (buf instanceof Uint8Array) {\n for (let i = 0; i < buf.length; i++) {\n this.set(offset + i, buf[i])\n }\n } else if (isUint8ArrayList(buf)) {\n for (let i = 0; i < buf.length; i++) {\n this.set(offset + i, buf.get(i))\n }\n } else {\n throw new Error('Could not write value, must be an Uint8Array or a Uint8ArrayList')\n }\n }\n\n /**\n * Remove bytes from the front of the pool\n */\n consume (bytes: number): void {\n // first, normalize the argument, in accordance with how Buffer does it\n bytes = Math.trunc(bytes)\n\n // do nothing if not a positive number\n if (Number.isNaN(bytes) || bytes <= 0) {\n return\n }\n\n // if consuming all bytes, skip iterating\n if (bytes === this.byteLength) {\n this.bufs = []\n this.length = 0\n return\n }\n\n while (this.bufs.length > 0) {\n if (bytes >= this.bufs[0].byteLength) {\n bytes -= this.bufs[0].byteLength\n this.length -= this.bufs[0].byteLength\n this.bufs.shift()\n } else {\n this.bufs[0] = this.bufs[0].subarray(bytes)\n this.length -= bytes\n break\n }\n }\n }\n\n /**\n * Extracts a section of an array and returns a new array.\n *\n * This is a copy operation as it is with Uint8Arrays and Arrays\n * - note this is different to the behaviour of Node Buffers.\n */\n slice (beginInclusive?: number, endExclusive?: number): Uint8Array {\n const { bufs, length } = this._subList(beginInclusive, endExclusive)\n\n return concat(bufs, length)\n }\n\n /**\n * Returns a alloc from the given start and end element index.\n *\n * In the best case where the data extracted comes from a single Uint8Array\n * internally this is a no-copy operation otherwise it is a copy operation.\n */\n subarray (beginInclusive?: number, endExclusive?: number): Uint8Array {\n const { bufs, length } = this._subList(beginInclusive, endExclusive)\n\n if (bufs.length === 1) {\n return bufs[0]\n }\n\n return concat(bufs, length)\n }\n\n /**\n * Returns a allocList from the given start and end element index.\n *\n * This is a no-copy operation.\n */\n sublist (beginInclusive?: number, endExclusive?: number): Uint8ArrayList {\n const { bufs, length } = this._subList(beginInclusive, endExclusive)\n\n const list = new Uint8ArrayList()\n list.length = length\n // don't loop, just set the bufs\n list.bufs = [...bufs]\n\n return list\n }\n\n private _subList (beginInclusive?: number, endExclusive?: number): { bufs: Uint8Array[], length: number } {\n beginInclusive = beginInclusive ?? 0\n endExclusive = endExclusive ?? this.length\n\n if (beginInclusive < 0) {\n beginInclusive = this.length + beginInclusive\n }\n\n if (endExclusive < 0) {\n endExclusive = this.length + endExclusive\n }\n\n if (beginInclusive < 0 || endExclusive > this.length) {\n throw new RangeError('index is out of bounds')\n }\n\n if (beginInclusive === endExclusive) {\n return { bufs: [], length: 0 }\n }\n\n if (beginInclusive === 0 && endExclusive === this.length) {\n return { bufs: this.bufs, length: this.length }\n }\n\n const bufs: Uint8Array[] = []\n let offset = 0\n\n for (let i = 0; i < this.bufs.length; i++) {\n const buf = this.bufs[i]\n const bufStart = offset\n const bufEnd = bufStart + buf.byteLength\n\n // for next loop\n offset = bufEnd\n\n if (beginInclusive >= bufEnd) {\n // start after this buf\n continue\n }\n\n const sliceStartInBuf = beginInclusive >= bufStart && beginInclusive < bufEnd\n const sliceEndsInBuf = endExclusive > bufStart && endExclusive <= bufEnd\n\n if (sliceStartInBuf && sliceEndsInBuf) {\n // slice is wholly contained within this buffer\n if (beginInclusive === bufStart && endExclusive === bufEnd) {\n // requested whole buffer\n bufs.push(buf)\n break\n }\n\n // requested part of buffer\n const start = beginInclusive - bufStart\n bufs.push(buf.subarray(start, start + (endExclusive - beginInclusive)))\n break\n }\n\n if (sliceStartInBuf) {\n // slice starts in this buffer\n if (beginInclusive === 0) {\n // requested whole buffer\n bufs.push(buf)\n continue\n }\n\n // requested part of buffer\n bufs.push(buf.subarray(beginInclusive - bufStart))\n continue\n }\n\n if (sliceEndsInBuf) {\n if (endExclusive === bufEnd) {\n // requested whole buffer\n bufs.push(buf)\n break\n }\n\n // requested part of buffer\n bufs.push(buf.subarray(0, endExclusive - bufStart))\n break\n }\n\n // slice started before this buffer and ends after it\n bufs.push(buf)\n }\n\n return { bufs, length: endExclusive - beginInclusive }\n }\n\n indexOf (search: Uint8ArrayList | Uint8Array, offset: number = 0): number {\n if (!isUint8ArrayList(search) && !(search instanceof Uint8Array)) {\n throw new TypeError('The \"value\" argument must be a Uint8ArrayList or Uint8Array')\n }\n\n const needle = search instanceof Uint8Array ? search : search.subarray()\n\n offset = Number(offset ?? 0)\n\n if (isNaN(offset)) {\n offset = 0\n }\n\n if (offset < 0) {\n offset = this.length + offset\n }\n\n if (offset < 0) {\n offset = 0\n }\n\n if (search.length === 0) {\n return offset > this.length ? this.length : offset\n }\n\n // https://en.wikipedia.org/wiki/Boyer%E2%80%93Moore_string-search_algorithm\n const M: number = needle.byteLength\n\n if (M === 0) {\n throw new TypeError('search must be at least 1 byte long')\n }\n\n // radix\n const radix: number = 256\n const rightmostPositions: Int32Array = new Int32Array(radix)\n\n // position of the rightmost occurrence of the byte c in the pattern\n for (let c: number = 0; c < radix; c++) {\n // -1 for bytes not in pattern\n rightmostPositions[c] = -1\n }\n\n for (let j = 0; j < M; j++) {\n // rightmost position for bytes in pattern\n rightmostPositions[needle[j]] = j\n }\n\n // Return offset of first match, -1 if no match\n const right = rightmostPositions\n const lastIndex = this.byteLength - needle.byteLength\n const lastPatIndex = needle.byteLength - 1\n let skip: number\n\n for (let i = offset; i <= lastIndex; i += skip) {\n skip = 0\n\n for (let j = lastPatIndex; j >= 0; j--) {\n const char: number = this.get(i + j)\n\n if (needle[j] !== char) {\n skip = Math.max(1, j - right[char])\n break\n }\n }\n\n if (skip === 0) {\n return i\n }\n }\n\n return -1\n }\n\n getInt8 (byteOffset: number): number {\n const buf = this.subarray(byteOffset, byteOffset + 1)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getInt8(0)\n }\n\n setInt8 (byteOffset: number, value: number): void {\n const buf = allocUnsafe(1)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setInt8(0, value)\n\n this.write(buf, byteOffset)\n }\n\n getInt16 (byteOffset: number, littleEndian?: boolean): number {\n const buf = this.subarray(byteOffset, byteOffset + 2)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getInt16(0, littleEndian)\n }\n\n setInt16 (byteOffset: number, value: number, littleEndian?: boolean): void {\n const buf = alloc(2)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setInt16(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n getInt32 (byteOffset: number, littleEndian?: boolean): number {\n const buf = this.subarray(byteOffset, byteOffset + 4)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getInt32(0, littleEndian)\n }\n\n setInt32 (byteOffset: number, value: number, littleEndian?: boolean): void {\n const buf = alloc(4)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setInt32(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n getBigInt64 (byteOffset: number, littleEndian?: boolean): bigint {\n const buf = this.subarray(byteOffset, byteOffset + 8)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getBigInt64(0, littleEndian)\n }\n\n setBigInt64 (byteOffset: number, value: bigint, littleEndian?: boolean): void {\n const buf = alloc(8)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setBigInt64(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n getUint8 (byteOffset: number): number {\n const buf = this.subarray(byteOffset, byteOffset + 1)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getUint8(0)\n }\n\n setUint8 (byteOffset: number, value: number): void {\n const buf = allocUnsafe(1)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setUint8(0, value)\n\n this.write(buf, byteOffset)\n }\n\n getUint16 (byteOffset: number, littleEndian?: boolean): number {\n const buf = this.subarray(byteOffset, byteOffset + 2)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getUint16(0, littleEndian)\n }\n\n setUint16 (byteOffset: number, value: number, littleEndian?: boolean): void {\n const buf = alloc(2)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setUint16(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n getUint32 (byteOffset: number, littleEndian?: boolean): number {\n const buf = this.subarray(byteOffset, byteOffset + 4)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getUint32(0, littleEndian)\n }\n\n setUint32 (byteOffset: number, value: number, littleEndian?: boolean): void {\n const buf = alloc(4)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setUint32(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n getBigUint64 (byteOffset: number, littleEndian?: boolean): bigint {\n const buf = this.subarray(byteOffset, byteOffset + 8)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getBigUint64(0, littleEndian)\n }\n\n setBigUint64 (byteOffset: number, value: bigint, littleEndian?: boolean): void {\n const buf = alloc(8)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setBigUint64(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n getFloat32 (byteOffset: number, littleEndian?: boolean): number {\n const buf = this.subarray(byteOffset, byteOffset + 4)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getFloat32(0, littleEndian)\n }\n\n setFloat32 (byteOffset: number, value: number, littleEndian?: boolean): void {\n const buf = alloc(4)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setFloat32(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n getFloat64 (byteOffset: number, littleEndian?: boolean): number {\n const buf = this.subarray(byteOffset, byteOffset + 8)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n\n return view.getFloat64(0, littleEndian)\n }\n\n setFloat64 (byteOffset: number, value: number, littleEndian?: boolean): void {\n const buf = alloc(8)\n const view = new DataView(buf.buffer, buf.byteOffset, buf.byteLength)\n view.setFloat64(0, value, littleEndian)\n\n this.write(buf, byteOffset)\n }\n\n equals (other: any): other is Uint8ArrayList {\n if (other == null) {\n return false\n }\n\n if (!(other instanceof Uint8ArrayList)) {\n return false\n }\n\n if (other.bufs.length !== this.bufs.length) {\n return false\n }\n\n for (let i = 0; i < this.bufs.length; i++) {\n if (!equals(this.bufs[i], other.bufs[i])) {\n return false\n }\n }\n\n return true\n }\n\n /**\n * Create a Uint8ArrayList from a pre-existing list of Uint8Arrays. Use this\n * method if you know the total size of all the Uint8Arrays ahead of time.\n */\n static fromUint8Arrays (bufs: Uint8Array[], length?: number): Uint8ArrayList {\n const list = new Uint8ArrayList()\n list.bufs = bufs\n\n if (length == null) {\n length = bufs.reduce((acc, curr) => acc + curr.byteLength, 0)\n }\n\n list.length = length\n\n return list\n }\n}\n\n/*\nfunction indexOf (needle: Uint8Array, haystack: Uint8Array, offset = 0) {\n for (let i = offset; i < haystack.byteLength; i++) {\n for (let j = 0; j < needle.length; j++) {\n if (haystack[i + j] !== needle[j]) {\n break\n }\n\n if (j === needle.byteLength -1) {\n return i\n }\n }\n\n if (haystack.byteLength - i < needle.byteLength) {\n break\n }\n }\n\n return -1\n}\n*/\n", "import { Buffer } from 'node:buffer'\nimport bases, { type SupportedEncodings } from './util/bases.js'\n\nexport type { SupportedEncodings }\n\n/**\n * Turns a `Uint8Array` into a string.\n *\n * Supports `utf8`, `utf-8` and any encoding supported by the multibase module.\n *\n * Also `ascii` which is similar to node's 'binary' encoding.\n */\nexport function toString (array: Uint8Array, encoding: SupportedEncodings = 'utf8'): string {\n const base = bases[encoding]\n\n if (base == null) {\n throw new Error(`Unsupported encoding \"${encoding}\"`)\n }\n\n if (encoding === 'utf8' || encoding === 'utf-8') {\n return Buffer.from(array.buffer, array.byteOffset, array.byteLength).toString('utf8')\n }\n\n // strip multibase prefix\n return base.encoder.encode(array).substring(1)\n}\n", "import { Uint8ArrayList } from 'uint8arraylist'\n\ninterface Context {\n offset: number\n}\n\nconst TAG_MASK = parseInt('11111', 2)\nconst LONG_LENGTH_MASK = parseInt('10000000', 2)\nconst LONG_LENGTH_BYTES_MASK = parseInt('01111111', 2)\n\ninterface Decoder {\n (buf: Uint8Array, context: Context): any\n}\n\nconst decoders: Record<number, Decoder> = {\n 0x0: readSequence,\n 0x1: readSequence,\n 0x2: readInteger,\n 0x3: readBitString,\n 0x4: readOctetString,\n 0x5: readNull,\n 0x6: readObjectIdentifier,\n 0x10: readSequence,\n 0x16: readSequence,\n 0x30: readSequence\n}\n\nexport function decodeDer (buf: Uint8Array, context: Context = { offset: 0 }): any {\n const tag = buf[context.offset] & TAG_MASK\n context.offset++\n\n if (decoders[tag] != null) {\n return decoders[tag](buf, context)\n }\n\n throw new Error('No decoder for tag ' + tag)\n}\n\nfunction readLength (buf: Uint8Array, context: Context): number {\n let length = 0\n\n if ((buf[context.offset] & LONG_LENGTH_MASK) === LONG_LENGTH_MASK) {\n // long length\n const count = buf[context.offset] & LONG_LENGTH_BYTES_MASK\n let str = '0x'\n context.offset++\n\n for (let i = 0; i < count; i++, context.offset++) {\n str += buf[context.offset].toString(16).padStart(2, '0')\n }\n\n length = parseInt(str, 16)\n } else {\n length = buf[context.offset]\n context.offset++\n }\n\n return length\n}\n\nfunction readSequence (buf: Uint8Array, context: Context): any[] {\n readLength(buf, context)\n const entries: any[] = []\n\n while (true) {\n if (context.offset >= buf.byteLength) {\n break\n }\n\n const result = decodeDer(buf, context)\n\n if (result === null) {\n break\n }\n\n entries.push(result)\n }\n\n return entries\n}\n\nfunction readInteger (buf: Uint8Array, context: Context): Uint8Array {\n const length = readLength(buf, context)\n const start = context.offset\n const end = context.offset + length\n\n const vals: number[] = []\n\n for (let i = start; i < end; i++) {\n if (i === start && buf[i] === 0) {\n continue\n }\n\n vals.push(buf[i])\n }\n\n context.offset += length\n\n return Uint8Array.from(vals)\n}\n\nfunction readObjectIdentifier (buf: Uint8Array, context: Context): string {\n const count = readLength(buf, context)\n const finalOffset = context.offset + count\n\n const byte = buf[context.offset]\n context.offset++\n\n let val1 = 0\n let val2 = 0\n\n if (byte < 40) {\n val1 = 0\n val2 = byte\n } else if (byte < 80) {\n val1 = 1\n val2 = byte - 40\n } else {\n val1 = 2\n val2 = byte - 80\n }\n\n let oid = `${val1}.${val2}`\n let num: number[] = []\n\n while (context.offset < finalOffset) {\n const byte = buf[context.offset]\n context.offset++\n\n // remove msb\n num.push(byte & 0b01111111)\n\n if (byte < 128) {\n num.reverse()\n\n // reached the end of the encoding\n let val = 0\n\n for (let i = 0; i < num.length; i++) {\n val += num[i] << (i * 7)\n }\n\n oid += `.${val}`\n num = []\n }\n }\n\n return oid\n}\n\nfunction readNull (buf: Uint8Array, context: Context): null {\n context.offset++\n\n return null\n}\n\nfunction readBitString (buf: Uint8Array, context: Context): any {\n const length = readLength(buf, context)\n const unusedBits = buf[context.offset]\n context.offset++\n const bytes = buf.subarray(context.offset, context.offset + length - 1)\n context.offset += length\n\n if (unusedBits !== 0) {\n // need to shift all bytes along by this many bits\n throw new Error('Unused bits in bit string is unimplemented')\n }\n\n return bytes\n}\n\nfunction readOctetString (buf: Uint8Array, context: Context): any {\n const length = readLength(buf, context)\n const bytes = buf.subarray(context.offset, context.offset + length)\n context.offset += length\n\n return bytes\n}\n\nfunction encodeNumber (value: number): Uint8ArrayList {\n let number = value.toString(16)\n\n if (number.length % 2 === 1) {\n number = '0' + number\n }\n\n const array = new Uint8ArrayList()\n\n for (let i = 0; i < number.length; i += 2) {\n array.append(Uint8Array.from([parseInt(`${number[i]}${number[i + 1]}`, 16)]))\n }\n\n return array\n}\n\nfunction encodeLength (bytes: { byteLength: number }): Uint8Array | Uint8ArrayList {\n if (bytes.byteLength < 128) {\n return Uint8Array.from([bytes.byteLength])\n }\n\n // long length\n const length = encodeNumber(bytes.byteLength)\n\n return new Uint8ArrayList(\n Uint8Array.from([\n length.byteLength | LONG_LENGTH_MASK\n ]),\n length\n )\n}\n\nexport function encodeInteger (value: Uint8Array | Uint8ArrayList): Uint8ArrayList {\n const contents = new Uint8ArrayList()\n\n const mask = 0b10000000\n const positive = (value.subarray()[0] & mask) === mask\n\n if (positive) {\n contents.append(Uint8Array.from([0]))\n }\n\n contents.append(value)\n\n return new Uint8ArrayList(\n Uint8Array.from([0x02]),\n encodeLength(contents),\n contents\n )\n}\n\nexport function encodeBitString (value: Uint8Array | Uint8ArrayList): Uint8ArrayList {\n // unused bits is always 0 with full-byte-only values\n const unusedBits = Uint8Array.from([0])\n\n const contents = new Uint8ArrayList(\n unusedBits,\n value\n )\n\n return new Uint8ArrayList(\n Uint8Array.from([0x03]),\n encodeLength(contents),\n contents\n )\n}\n\nexport function encodeOctetString (value: Uint8Array | Uint8ArrayList): Uint8ArrayList {\n return new Uint8ArrayList(\n Uint8Array.from([0x04]),\n encodeLength(value),\n value\n )\n}\n\nexport function encodeSequence (values: Array<Uint8Array | Uint8ArrayList>, tag = 0x30): Uint8ArrayList {\n const output = new Uint8ArrayList()\n\n for (const buf of values) {\n output.append(\n buf\n )\n }\n\n return new Uint8ArrayList(\n Uint8Array.from([tag]),\n encodeLength(output),\n output\n )\n}\n", "import type { JWKKeyPair } from '../interface.js'\nimport type { AbortOptions } from '@libp2p/interface'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nexport type Curve = 'P-256' | 'P-384' | 'P-521'\n\nexport const ECDSA_P_256_OID = '1.2.840.10045.3.1.7'\nexport const ECDSA_P_384_OID = '1.3.132.0.34'\nexport const ECDSA_P_521_OID = '1.3.132.0.35'\n\nexport async function generateECDSAKey (curve: Curve = 'P-256'): Promise<JWKKeyPair> {\n const keyPair = await crypto.subtle.generateKey({\n name: 'ECDSA',\n namedCurve: curve\n }, true, ['sign', 'verify'])\n\n return {\n publicKey: await crypto.subtle.exportKey('jwk', keyPair.publicKey),\n privateKey: await crypto.subtle.exportKey('jwk', keyPair.privateKey)\n }\n}\n\nexport async function hashAndSign (key: JsonWebKey, msg: Uint8Array | Uint8ArrayList, options?: AbortOptions): Promise<Uint8Array> {\n const privateKey = await crypto.subtle.importKey('jwk', key, {\n name: 'ECDSA',\n namedCurve: key.crv ?? 'P-256'\n }, false, ['sign'])\n options?.signal?.throwIfAborted()\n\n const signature = await crypto.subtle.sign({\n name: 'ECDSA',\n hash: {\n name: 'SHA-256'\n }\n }, privateKey, msg.subarray())\n options?.signal?.throwIfAborted()\n\n return new Uint8Array(signature, 0, signature.byteLength)\n}\n\nexport async function hashAndVerify (key: JsonWebKey, sig: Uint8Array, msg: Uint8Array | Uint8ArrayList, options?: AbortOptions): Promise<boolean> {\n const publicKey = await crypto.subtle.importKey('jwk', key, {\n name: 'ECDSA',\n namedCurve: key.crv ?? 'P-256'\n }, false, ['verify'])\n options?.signal?.throwIfAborted()\n\n const result = await crypto.subtle.verify({\n name: 'ECDSA',\n hash: {\n name: 'SHA-256'\n }\n }, publicKey, sig, msg.subarray())\n options?.signal?.throwIfAborted()\n\n return result\n}\n", "import { InvalidParametersError } from '@libp2p/interface'\nimport { Uint8ArrayList } from 'uint8arraylist'\nimport { fromString as uint8ArrayFromString } from 'uint8arrays/from-string'\nimport { toString as uint8ArrayToString } from 'uint8arrays/to-string'\nimport { decodeDer, encodeBitString, encodeInteger, encodeOctetString, encodeSequence } from '../rsa/der.js'\nimport { ECDSAPrivateKey as ECDSAPrivateKeyClass, ECDSAPublicKey as ECDSAPublicKeyClass } from './ecdsa.js'\nimport { generateECDSAKey } from './index.js'\nimport type { Curve } from '../ecdh/index.js'\nimport type { ECDSAPublicKey, ECDSAPrivateKey } from '@libp2p/interface'\n\n// 1.2.840.10045.3.1.7 prime256v1 (ANSI X9.62 named elliptic curve)\nconst OID_256 = Uint8Array.from([0x06, 0x08, 0x2A, 0x86, 0x48, 0xCE, 0x3D, 0x03, 0x01, 0x07])\n// 1.3.132.0.34 secp384r1 (SECG (Certicom) named elliptic curve)\nconst OID_384 = Uint8Array.from([0x06, 0x05, 0x2B, 0x81, 0x04, 0x00, 0x22])\n// 1.3.132.0.35 secp521r1 (SECG (Certicom) named elliptic curve)\nconst OID_521 = Uint8Array.from([0x06, 0x05, 0x2B, 0x81, 0x04, 0x00, 0x23])\n\nconst P_256_KEY_JWK = {\n ext: true,\n kty: 'EC',\n crv: 'P-256'\n}\n\nconst P_384_KEY_JWK = {\n ext: true,\n kty: 'EC',\n crv: 'P-384'\n}\n\nconst P_521_KEY_JWK = {\n ext: true,\n kty: 'EC',\n crv: 'P-521'\n}\n\nconst P_256_KEY_LENGTH = 32\nconst P_384_KEY_LENGTH = 48\nconst P_521_KEY_LENGTH = 66\n\nexport function unmarshalECDSAPrivateKey (bytes: Uint8Array): ECDSAPrivateKey {\n const message = decodeDer(bytes)\n\n return pkiMessageToECDSAPrivateKey(message)\n}\n\nexport function pkiMessageToECDSAPrivateKey (message: any): ECDSAPrivateKey {\n const privateKey = message[1]\n const d = uint8ArrayToString(privateKey, 'base64url')\n const coordinates: Uint8Array = message[2][1][0]\n const offset = 1\n let x: string\n let y: string\n\n if (privateKey.byteLength === P_256_KEY_LENGTH) {\n x = uint8ArrayToString(coordinates.subarray(offset, offset + P_256_KEY_LENGTH), 'base64url')\n y = uint8ArrayToString(coordinates.subarray(offset + P_256_KEY_LENGTH), 'base64url')\n\n return new ECDSAPrivateKeyClass({\n ...P_256_KEY_JWK,\n key_ops: ['sign'],\n d,\n x,\n y\n })\n }\n\n if (privateKey.byteLength === P_384_KEY_LENGTH) {\n x = uint8ArrayToString(coordinates.subarray(offset, offset + P_384_KEY_LENGTH), 'base64url')\n y = uint8ArrayToString(coordinates.subarray(offset + P_384_KEY_LENGTH), 'base64url')\n\n return new ECDSAPrivateKeyClass({\n ...P_384_KEY_JWK,\n key_ops: ['sign'],\n d,\n x,\n y\n })\n }\n\n if (privateKey.byteLength === P_521_KEY_LENGTH) {\n x = uint8ArrayToString(coordinates.subarray(offset, offset + P_521_KEY_LENGTH), 'base64url')\n y = uint8ArrayToString(coordinates.subarray(offset + P_521_KEY_LENGTH), 'base64url')\n\n return new ECDSAPrivateKeyClass({\n ...P_521_KEY_JWK,\n key_ops: ['sign'],\n d,\n x,\n y\n })\n }\n\n throw new InvalidParametersError(`Private key length was wrong length, got ${privateKey.byteLength}, expected 32, 48 or 66`)\n}\n\nexport function unmarshalECDSAPublicKey (bytes: Uint8Array): ECDSAPublicKey {\n const message = decodeDer(bytes)\n\n return pkiMessageToECDSAPublicKey(message)\n}\n\nexport function pkiMessageToECDSAPublicKey (message: any): ECDSAPublicKey {\n const coordinates = message[1][1][0]\n const offset = 1\n let x: string\n let y: string\n\n if (coordinates.byteLength === ((P_256_KEY_LENGTH * 2) + 1)) {\n x = uint8ArrayToString(coordinates.subarray(offset, offset + P_256_KEY_LENGTH), 'base64url')\n y = uint8ArrayToString(coordinates.subarray(offset + P_256_KEY_LENGTH), 'base64url')\n\n return new ECDSAPublicKeyClass({\n ...P_256_KEY_JWK,\n key_ops: ['verify'],\n x,\n y\n })\n }\n\n if (coordinates.byteLength === ((P_384_KEY_LENGTH * 2) + 1)) {\n x = uint8ArrayToString(coordinates.subarray(offset, offset + P_384_KEY_LENGTH), 'base64url')\n y = uint8ArrayToString(coordinates.subarray(offset + P_384_KEY_LENGTH), 'base64url')\n\n return new ECDSAPublicKeyClass({\n ...P_384_KEY_JWK,\n key_ops: ['verify'],\n x,\n y\n })\n }\n\n if (coordinates.byteLength === ((P_521_KEY_LENGTH * 2) + 1)) {\n x = uint8ArrayToString(coordinates.subarray(offset, offset + P_521_KEY_LENGTH), 'base64url')\n y = uint8ArrayToString(coordinates.subarray(offset + P_521_KEY_LENGTH), 'base64url')\n\n return new ECDSAPublicKeyClass({\n ...P_521_KEY_JWK,\n key_ops: ['verify'],\n x,\n y\n })\n }\n\n throw new InvalidParametersError(`coordinates were wrong length, got ${coordinates.byteLength}, expected 65, 97 or 133`)\n}\n\nexport function privateKeyToPKIMessage (privateKey: JsonWebKey): Uint8Array {\n return encodeSequence([\n encodeInteger(Uint8Array.from([1])), // header\n encodeOctetString(uint8ArrayFromString(privateKey.d ?? '', 'base64url')), // body\n encodeSequence([ // PKIProtection\n getOID(privateKey.crv)\n ], 0xA0),\n encodeSequence([ // extraCerts\n encodeBitString(\n new Uint8ArrayList(\n Uint8Array.from([0x04]),\n uint8ArrayFromString(privateKey.x ?? '', 'base64url'),\n uint8ArrayFromString(privateKey.y ?? '', 'base64url')\n )\n )\n ], 0xA1)\n ]).subarray()\n}\n\nexport function publicKeyToPKIMessage (publicKey: JsonWebKey): Uint8Array {\n return encodeSequence([\n encodeInteger(Uint8Array.from([1])), // header\n encodeSequence([ // PKIProtection\n getOID(publicKey.crv)\n ], 0xA0),\n encodeSequence([ // extraCerts\n encodeBitString(\n new Uint8ArrayList(\n Uint8Array.from([0x04]),\n uint8ArrayFromString(publicKey.x ?? '', 'base64url'),\n uint8ArrayFromString(publicKey.y ?? '', 'base64url')\n )\n )\n ], 0xA1)\n ]).subarray()\n}\n\nfunction getOID (curve?: string): Uint8Array {\n if (curve === 'P-256') {\n return OID_256\n }\n\n if (curve === 'P-384') {\n return OID_384\n }\n\n if (curve === 'P-521') {\n return OID_521\n }\n\n throw new InvalidParametersError(`Invalid curve ${curve}`)\n}\n\nexport async function generateECDSAKeyPair (curve: Curve = 'P-256'): Promise<ECDSAPrivateKey> {\n const key = await generateECDSAKey(curve)\n\n return new ECDSAPrivateKeyClass(key.privateKey)\n}\n\nexport function ensureECDSAKey (key: Uint8Array, length: number): Uint8Array {\n key = Uint8Array.from(key ?? [])\n if (key.length !== length) {\n throw new InvalidParametersError(`Key must be a Uint8Array of length ${length}, got ${key.length}`)\n }\n return key\n}\n", "import { base58btc } from 'multiformats/bases/base58'\nimport { CID } from 'multiformats/cid'\nimport { identity } from 'multiformats/hashes/identity'\nimport { equals as uint8ArrayEquals } from 'uint8arrays/equals'\nimport { publicKeyToProtobuf } from '../index.js'\nimport { privateKeyToPKIMessage, publicKeyToPKIMessage } from './utils.js'\nimport { hashAndVerify, hashAndSign } from './index.js'\nimport type { ECDSAPublicKey as ECDSAPublicKeyInterface, ECDSAPrivateKey as ECDSAPrivateKeyInterface, AbortOptions } from '@libp2p/interface'\nimport type { Digest } from 'multiformats/hashes/digest'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nexport class ECDSAPublicKey implements ECDSAPublicKeyInterface {\n public readonly type = 'ECDSA'\n public readonly jwk: JsonWebKey\n private _raw?: Uint8Array\n\n constructor (jwk: JsonWebKey) {\n this.jwk = jwk\n }\n\n get raw (): Uint8Array {\n if (this._raw == null) {\n this._raw = publicKeyToPKIMessage(this.jwk)\n }\n\n return this._raw\n }\n\n toMultihash (): Digest<0x0, number> {\n return identity.digest(publicKeyToProtobuf(this))\n }\n\n toCID (): CID<unknown, 114, 0x0, 1> {\n return CID.createV1(114, this.toMultihash())\n }\n\n toString (): string {\n return base58btc.encode(this.toMultihash().bytes).substring(1)\n }\n\n equals (key?: any): boolean {\n if (key == null || !(key.raw instanceof Uint8Array)) {\n return false\n }\n\n return uint8ArrayEquals(this.raw, key.raw)\n }\n\n async verify (data: Uint8Array | Uint8ArrayList, sig: Uint8Array, options?: AbortOptions): Promise<boolean> {\n return hashAndVerify(this.jwk, sig, data, options)\n }\n}\n\nexport class ECDSAPrivateKey implements ECDSAPrivateKeyInterface {\n public readonly type = 'ECDSA'\n public readonly jwk: JsonWebKey\n public readonly publicKey: ECDSAPublicKey\n private _raw?: Uint8Array\n\n constructor (jwk: JsonWebKey) {\n this.jwk = jwk\n this.publicKey = new ECDSAPublicKey({\n crv: jwk.crv,\n ext: jwk.ext,\n key_ops: ['verify'],\n kty: 'EC',\n x: jwk.x,\n y: jwk.y\n })\n }\n\n get raw (): Uint8Array {\n if (this._raw == null) {\n this._raw = privateKeyToPKIMessage(this.jwk)\n }\n\n return this._raw\n }\n\n equals (key?: any): boolean {\n if (key == null || !(key.raw instanceof Uint8Array)) {\n return false\n }\n\n return uint8ArrayEquals(this.raw, key.raw)\n }\n\n async sign (message: Uint8Array | Uint8ArrayList, options?: AbortOptions): Promise<Uint8Array> {\n return hashAndSign(this.jwk, message, options)\n }\n}\n", "import crypto from 'crypto'\nimport { concat as uint8arrayConcat } from 'uint8arrays/concat'\nimport { fromString as uint8arrayFromString } from 'uint8arrays/from-string'\nimport { toString as uint8arrayToString } from 'uint8arrays/to-string'\nimport type { Uint8ArrayKeyPair } from '../interface.js'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nconst keypair = crypto.generateKeyPairSync\n\nconst PUBLIC_KEY_BYTE_LENGTH = 32\nconst PRIVATE_KEY_BYTE_LENGTH = 64 // private key is actually 32 bytes but for historical reasons we concat private and public keys\nconst KEYS_BYTE_LENGTH = 32\nconst SIGNATURE_BYTE_LENGTH = 64\n\nexport { PUBLIC_KEY_BYTE_LENGTH as publicKeyLength }\nexport { PRIVATE_KEY_BYTE_LENGTH as privateKeyLength }\n\nfunction derivePublicKey (privateKey: Uint8Array): Uint8Array {\n const keyObject = crypto.createPrivateKey({\n format: 'jwk',\n key: {\n crv: 'Ed25519',\n x: '',\n d: uint8arrayToString(privateKey, 'base64url'),\n kty: 'OKP'\n }\n })\n const jwk = keyObject.export({\n format: 'jwk'\n })\n\n if (jwk.x == null || jwk.x === '') {\n throw new Error('Could not export JWK public key')\n }\n\n return uint8arrayFromString(jwk.x, 'base64url')\n}\n\nexport function generateKey (): Uint8ArrayKeyPair {\n const key = keypair('ed25519', {\n publicKeyEncoding: { type: 'spki', format: 'jwk' },\n privateKeyEncoding: { type: 'pkcs8', format: 'jwk' }\n })\n\n // @ts-expect-error node types are missing jwk as a format\n const privateKeyRaw = uint8arrayFromString(key.privateKey.d, 'base64url')\n // @ts-expect-error node types are missing jwk as a format\n const publicKeyRaw = uint8arrayFromString(key.publicKey.x, 'base64url')\n\n return {\n privateKey: uint8arrayConcat([privateKeyRaw, publicKeyRaw], privateKeyRaw.byteLength + publicKeyRaw.byteLength),\n publicKey: publicKeyRaw\n }\n}\n\n/**\n * Generate keypair from a 32 byte uint8array\n */\nexport function generateKeyFromSeed (seed: Uint8Array): Uint8ArrayKeyPair {\n if (seed.length !== KEYS_BYTE_LENGTH) {\n throw new TypeError('\"seed\" must be 32 bytes in length.')\n } else if (!(seed instanceof Uint8Array)) {\n throw new TypeError('\"seed\" must be a node.js Buffer, or Uint8Array.')\n }\n\n // based on node forges algorithm, the seed is used directly as private key\n const publicKeyRaw = derivePublicKey(seed)\n\n return {\n privateKey: uint8arrayConcat([seed, publicKeyRaw], seed.byteLength + publicKeyRaw.byteLength),\n publicKey: publicKeyRaw\n }\n}\n\nexport function hashAndSign (key: Uint8Array, msg: Uint8Array | Uint8ArrayList): Uint8Array {\n if (!(key instanceof Uint8Array)) {\n throw new TypeError('\"key\" must be a node.js Buffer, or Uint8Array.')\n }\n\n let privateKey: Uint8Array\n let publicKey: Uint8Array\n\n if (key.byteLength === PRIVATE_KEY_BYTE_LENGTH) {\n privateKey = key.subarray(0, 32)\n publicKey = key.subarray(32)\n } else if (key.byteLength === KEYS_BYTE_LENGTH) {\n privateKey = key.subarray(0, 32)\n publicKey = derivePublicKey(privateKey)\n } else {\n throw new TypeError('\"key\" must be 64 or 32 bytes in length.')\n }\n\n const obj = crypto.createPrivateKey({\n format: 'jwk',\n key: {\n crv: 'Ed25519',\n d: uint8arrayToString(privateKey, 'base64url'),\n x: uint8arrayToString(publicKey, 'base64url'),\n kty: 'OKP'\n }\n })\n\n return crypto.sign(null, msg instanceof Uint8Array ? msg : msg.subarray(), obj)\n}\n\nexport function hashAndVerify (key: Uint8Array, sig: Uint8Array, msg: Uint8Array | Uint8ArrayList): boolean {\n if (key.byteLength !== PUBLIC_KEY_BYTE_LENGTH) {\n throw new TypeError('\"key\" must be 32 bytes in length.')\n } else if (!(key instanceof Uint8Array)) {\n throw new TypeError('\"key\" must be a node.js Buffer, or Uint8Array.')\n }\n\n if (sig.byteLength !== SIGNATURE_BYTE_LENGTH) {\n throw new TypeError('\"sig\" must be 64 bytes in length.')\n } else if (!(sig instanceof Uint8Array)) {\n throw new TypeError('\"sig\" must be a node.js Buffer, or Uint8Array.')\n }\n\n const obj = crypto.createPublicKey({\n format: 'jwk',\n key: {\n crv: 'Ed25519',\n x: uint8arrayToString(key, 'base64url'),\n kty: 'OKP'\n }\n })\n\n return crypto.verify(null, msg instanceof Uint8Array ? msg : msg.subarray(), obj, sig)\n}\n", "import { concat as uint8ArrayConcat } from 'uint8arrays/concat'\nimport { fromString as uint8ArrayFromString } from 'uint8arrays/from-string'\n\nexport function base64urlToBuffer (str: string, len?: number): Uint8Array {\n let buf = uint8ArrayFromString(str, 'base64urlpad')\n\n if (len != null) {\n if (buf.length > len) {\n throw new Error('byte array longer than desired length')\n }\n\n buf = uint8ArrayConcat([new Uint8Array(len - buf.length), buf])\n }\n\n return buf\n}\n\nexport function isPromise <T = unknown> (thing: any): thing is Promise<T> {\n if (thing == null) {\n return false\n }\n\n return typeof thing.then === 'function' &&\n typeof thing.catch === 'function' &&\n typeof thing.finally === 'function'\n}\n", "import { base58btc } from 'multiformats/bases/base58'\nimport { CID } from 'multiformats/cid'\nimport { identity } from 'multiformats/hashes/identity'\nimport { equals as uint8ArrayEquals } from 'uint8arrays/equals'\nimport { isPromise } from '../../util.ts'\nimport { publicKeyToProtobuf } from '../index.js'\nimport { ensureEd25519Key } from './utils.js'\nimport * as crypto from './index.js'\nimport type { Ed25519PublicKey as Ed25519PublicKeyInterface, Ed25519PrivateKey as Ed25519PrivateKeyInterface, AbortOptions } from '@libp2p/interface'\nimport type { Digest } from 'multiformats/hashes/digest'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nexport class Ed25519PublicKey implements Ed25519PublicKeyInterface {\n public readonly type = 'Ed25519'\n public readonly raw: Uint8Array\n\n constructor (key: Uint8Array) {\n this.raw = ensureEd25519Key(key, crypto.publicKeyLength)\n }\n\n toMultihash (): Digest<0x0, number> {\n return identity.digest(publicKeyToProtobuf(this))\n }\n\n toCID (): CID<unknown, 114, 0x0, 1> {\n return CID.createV1(114, this.toMultihash())\n }\n\n toString (): string {\n return base58btc.encode(this.toMultihash().bytes).substring(1)\n }\n\n equals (key?: any): boolean {\n if (key == null || !(key.raw instanceof Uint8Array)) {\n return false\n }\n\n return uint8ArrayEquals(this.raw, key.raw)\n }\n\n verify (data: Uint8Array | Uint8ArrayList, sig: Uint8Array, options?: AbortOptions): boolean | Promise<boolean> {\n options?.signal?.throwIfAborted()\n const result = crypto.hashAndVerify(this.raw, sig, data)\n\n if (isPromise<boolean>(result)) {\n return result.then(res => {\n options?.signal?.throwIfAborted()\n return res\n })\n }\n\n return result\n }\n}\n\nexport class Ed25519PrivateKey implements Ed25519PrivateKeyInterface {\n public readonly type = 'Ed25519'\n public readonly raw: Uint8Array\n public readonly publicKey: Ed25519PublicKey\n\n // key - 64 byte Uint8Array containing private key\n // publicKey - 32 byte Uint8Array containing public key\n constructor (key: Uint8Array, publicKey: Uint8Array) {\n this.raw = ensureEd25519Key(key, crypto.privateKeyLength)\n this.publicKey = new Ed25519PublicKey(publicKey)\n }\n\n equals (key?: any): boolean {\n if (key == null || !(key.raw instanceof Uint8Array)) {\n return false\n }\n\n return uint8ArrayEquals(this.raw, key.raw)\n }\n\n sign (message: Uint8Array | Uint8ArrayList, options?: AbortOptions): Uint8Array | Promise<Uint8Array> {\n options?.signal?.throwIfAborted()\n const sig = crypto.hashAndSign(this.raw, message)\n\n if (isPromise<Uint8Array>(sig)) {\n return sig.then(res => {\n options?.signal?.throwIfAborted()\n return res\n })\n }\n\n options?.signal?.throwIfAborted()\n return sig\n }\n}\n", "import { InvalidParametersError } from '@libp2p/interface'\nimport { Ed25519PublicKey as Ed25519PublicKeyClass, Ed25519PrivateKey as Ed25519PrivateKeyClass } from './ed25519.js'\nimport * as crypto from './index.js'\nimport type { Ed25519PublicKey, Ed25519PrivateKey } from '@libp2p/interface'\n\nexport function unmarshalEd25519PrivateKey (bytes: Uint8Array): Ed25519PrivateKey {\n // Try the old, redundant public key version\n if (bytes.length > crypto.privateKeyLength) {\n bytes = ensureEd25519Key(bytes, crypto.privateKeyLength + crypto.publicKeyLength)\n const privateKeyBytes = bytes.subarray(0, crypto.privateKeyLength)\n const publicKeyBytes = bytes.subarray(crypto.privateKeyLength, bytes.length)\n return new Ed25519PrivateKeyClass(privateKeyBytes, publicKeyBytes)\n }\n\n bytes = ensureEd25519Key(bytes, crypto.privateKeyLength)\n const privateKeyBytes = bytes.subarray(0, crypto.privateKeyLength)\n const publicKeyBytes = bytes.subarray(crypto.publicKeyLength)\n return new Ed25519PrivateKeyClass(privateKeyBytes, publicKeyBytes)\n}\n\nexport function unmarshalEd25519PublicKey (bytes: Uint8Array): Ed25519PublicKey {\n bytes = ensureEd25519Key(bytes, crypto.publicKeyLength)\n return new Ed25519PublicKeyClass(bytes)\n}\n\nexport async function generateEd25519KeyPair (): Promise<Ed25519PrivateKey> {\n const { privateKey, publicKey } = crypto.generateKey()\n return new Ed25519PrivateKeyClass(privateKey, publicKey)\n}\n\nexport async function generateEd25519KeyPairFromSeed (seed: Uint8Array): Promise<Ed25519PrivateKey> {\n const { privateKey, publicKey } = crypto.generateKeyFromSeed(seed)\n return new Ed25519PrivateKeyClass(privateKey, publicKey)\n}\n\nexport function ensureEd25519Key (key: Uint8Array, length: number): Uint8Array {\n key = Uint8Array.from(key ?? [])\n if (key.length !== length) {\n throw new InvalidParametersError(`Key must be a Uint8Array of length ${length}, got ${key.length}`)\n }\n return key\n}\n", "import { decodeMessage, encodeMessage, enumeration, message } from 'protons-runtime'\nimport type { Codec, DecodeOptions } from 'protons-runtime'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nexport enum KeyType {\n RSA = 'RSA',\n Ed25519 = 'Ed25519',\n secp256k1 = 'secp256k1',\n ECDSA = 'ECDSA'\n}\n\nenum __KeyTypeValues {\n RSA = 0,\n Ed25519 = 1,\n secp256k1 = 2,\n ECDSA = 3\n}\n\nexport namespace KeyType {\n export const codec = (): Codec<KeyType> => {\n return enumeration<KeyType>(__KeyTypeValues)\n }\n}\nexport interface PublicKey {\n Type?: KeyType\n Data?: Uint8Array\n}\n\nexport namespace PublicKey {\n let _codec: Codec<PublicKey>\n\n export const codec = (): Codec<PublicKey> => {\n if (_codec == null) {\n _codec = message<PublicKey>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.Type != null) {\n w.uint32(8)\n KeyType.codec().encode(obj.Type, w)\n }\n\n if (obj.Data != null) {\n w.uint32(18)\n w.bytes(obj.Data)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length, opts = {}) => {\n const obj: any = {}\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1: {\n obj.Type = KeyType.codec().decode(reader)\n break\n }\n case 2: {\n obj.Data = reader.bytes()\n break\n }\n default: {\n reader.skipType(tag & 7)\n break\n }\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PublicKey>): Uint8Array => {\n return encodeMessage(obj, PublicKey.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList, opts?: DecodeOptions<PublicKey>): PublicKey => {\n return decodeMessage(buf, PublicKey.codec(), opts)\n }\n}\n\nexport interface PrivateKey {\n Type?: KeyType\n Data?: Uint8Array\n}\n\nexport namespace PrivateKey {\n let _codec: Codec<PrivateKey>\n\n export const codec = (): Codec<PrivateKey> => {\n if (_codec == null) {\n _codec = message<PrivateKey>((obj, w, opts = {}) => {\n if (opts.lengthDelimited !== false) {\n w.fork()\n }\n\n if (obj.Type != null) {\n w.uint32(8)\n KeyType.codec().encode(obj.Type, w)\n }\n\n if (obj.Data != null) {\n w.uint32(18)\n w.bytes(obj.Data)\n }\n\n if (opts.lengthDelimited !== false) {\n w.ldelim()\n }\n }, (reader, length, opts = {}) => {\n const obj: any = {}\n\n const end = length == null ? reader.len : reader.pos + length\n\n while (reader.pos < end) {\n const tag = reader.uint32()\n\n switch (tag >>> 3) {\n case 1: {\n obj.Type = KeyType.codec().decode(reader)\n break\n }\n case 2: {\n obj.Data = reader.bytes()\n break\n }\n default: {\n reader.skipType(tag & 7)\n break\n }\n }\n }\n\n return obj\n })\n }\n\n return _codec\n }\n\n export const encode = (obj: Partial<PrivateKey>): Uint8Array => {\n return encodeMessage(obj, PrivateKey.codec())\n }\n\n export const decode = (buf: Uint8Array | Uint8ArrayList, opts?: DecodeOptions<PrivateKey>): PrivateKey => {\n return decodeMessage(buf, PrivateKey.codec(), opts)\n }\n}\n", "/**\n * Internal webcrypto alias.\n * We prefer WebCrypto aka globalThis.crypto, which exists in node.js 16+.\n * Falls back to Node.js built-in crypto for Node.js <=v14.\n * See utils.ts for details.\n * @module\n */\n// @ts-ignore\nimport * as nc from 'node:crypto';\nexport const crypto: any =\n nc && typeof nc === 'object' && 'webcrypto' in nc\n ? (nc.webcrypto as any)\n : nc && typeof nc === 'object' && 'randomBytes' in nc\n ? nc\n : undefined;\n", "/**\n * Utilities for hex, bytes, CSPRNG.\n * @module\n */\n/*! noble-hashes - MIT License (c) 2022 Paul Miller (paulmillr.com) */\n\n// We use WebCrypto aka globalThis.crypto, which exists in browsers and node.js 16+.\n// node.js versions earlier than v19 don't declare it in global scope.\n// For node.js, package.json#exports field mapping rewrites import\n// from `crypto` to `cryptoNode`, which imports native module.\n// Makes the utils un-importable in browsers without a bundler.\n// Once node.js 18 is deprecated (2025-04-30), we can just drop the import.\nimport { crypto } from '@noble/hashes/crypto';\n\n/** Checks if something is Uint8Array. Be careful: nodejs Buffer will return true. */\nexport function isBytes(a: unknown): a is Uint8Array {\n return a instanceof Uint8Array || (ArrayBuffer.isView(a) && a.constructor.name === 'Uint8Array');\n}\n\n/** Asserts something is positive integer. */\nexport function anumber(n: number): void {\n if (!Number.isSafeInteger(n) || n < 0) throw new Error('positive integer expected, got ' + n);\n}\n\n/** Asserts something is Uint8Array. */\nexport function abytes(b: Uint8Array | undefined, ...lengths: number[]): void {\n if (!isBytes(b)) throw new Error('Uint8Array expected');\n if (lengths.length > 0 && !lengths.includes(b.length))\n throw new Error('Uint8Array expected of length ' + lengths + ', got length=' + b.length);\n}\n\n/** Asserts something is hash */\nexport function ahash(h: IHash): void {\n if (typeof h !== 'function' || typeof h.create !== 'function')\n throw new Error('Hash should be wrapped by utils.createHasher');\n anumber(h.outputLen);\n anumber(h.blockLen);\n}\n\n/** Asserts a hash instance has not been destroyed / finished */\nexport function aexists(instance: any, checkFinished = true): void {\n if (instance.destroyed) throw new Error('Hash instance has been destroyed');\n if (checkFinished && instance.finished) throw new Error('Hash#digest() has already been called');\n}\n\n/** Asserts output is properly-sized byte array */\nexport function aoutput(out: any, instance: any): void {\n abytes(out);\n const min = instance.outputLen;\n if (out.length < min) {\n throw new Error('digestInto() expects output buffer of length at least ' + min);\n }\n}\n\n/** Generic type encompassing 8/16/32-byte arrays - but not 64-byte. */\n// prettier-ignore\nexport type TypedArray = Int8Array | Uint8ClampedArray | Uint8Array |\n Uint16Array | Int16Array | Uint32Array | Int32Array;\n\n/** Cast u8 / u16 / u32 to u8. */\nexport function u8(arr: TypedArray): Uint8Array {\n return new Uint8Array(arr.buffer, arr.byteOffset, arr.byteLength);\n}\n\n/** Cast u8 / u16 / u32 to u32. */\nexport function u32(arr: TypedArray): Uint32Array {\n return new Uint32Array(arr.buffer, arr.byteOffset, Math.floor(arr.byteLength / 4));\n}\n\n/** Zeroize a byte array. Warning: JS provides no guarantees. */\nexport function clean(...arrays: TypedArray[]): void {\n for (let i = 0; i < arrays.length; i++) {\n arrays[i].fill(0);\n }\n}\n\n/** Create DataView of an array for easy byte-level manipulation. */\nexport function createView(arr: TypedArray): DataView {\n return new DataView(arr.buffer, arr.byteOffset, arr.byteLength);\n}\n\n/** The rotate right (circular right shift) operation for uint32 */\nexport function rotr(word: number, shift: number): number {\n return (word << (32 - shift)) | (word >>> shift);\n}\n\n/** The rotate left (circular left shift) operation for uint32 */\nexport function rotl(word: number, shift: number): number {\n return (word << shift) | ((word >>> (32 - shift)) >>> 0);\n}\n\n/** Is current platform little-endian? Most are. Big-Endian platform: IBM */\nexport const isLE: boolean = /* @__PURE__ */ (() =>\n new Uint8Array(new Uint32Array([0x11223344]).buffer)[0] === 0x44)();\n\n/** The byte swap operation for uint32 */\nexport function byteSwap(word: number): number {\n return (\n ((word << 24) & 0xff000000) |\n ((word << 8) & 0xff0000) |\n ((word >>> 8) & 0xff00) |\n ((word >>> 24) & 0xff)\n );\n}\n/** Conditionally byte swap if on a big-endian platform */\nexport const swap8IfBE: (n: number) => number = isLE\n ? (n: number) => n\n : (n: number) => byteSwap(n);\n\n/** @deprecated */\nexport const byteSwapIfBE: typeof swap8IfBE = swap8IfBE;\n/** In place byte swap for Uint32Array */\nexport function byteSwap32(arr: Uint32Array): Uint32Array {\n for (let i = 0; i < arr.length; i++) {\n arr[i] = byteSwap(arr[i]);\n }\n return arr;\n}\n\nexport const swap32IfBE: (u: Uint32Array) => Uint32Array = isLE\n ? (u: Uint32Array) => u\n : byteSwap32;\n\n// Built-in hex conversion https://caniuse.com/mdn-javascript_builtins_uint8array_fromhex\nconst hasHexBuiltin: boolean = /* @__PURE__ */ (() =>\n // @ts-ignore\n typeof Uint8Array.from([]).toHex === 'function' && typeof Uint8Array.fromHex === 'function')();\n\n// Array where index 0xf0 (240) is mapped to string 'f0'\nconst hexes = /* @__PURE__ */ Array.from({ length: 256 }, (_, i) =>\n i.toString(16).padStart(2, '0')\n);\n\n/**\n * Convert byte array to hex string. Uses built-in function, when available.\n * @example bytesToHex(Uint8Array.from([0xca, 0xfe, 0x01, 0x23])) // 'cafe0123'\n */\nexport function bytesToHex(bytes: Uint8Array): string {\n abytes(bytes);\n // @ts-ignore\n if (hasHexBuiltin) return bytes.toHex();\n // pre-caching improves the speed 6x\n let hex = '';\n for (let i = 0; i < bytes.length; i++) {\n hex += hexes[bytes[i]];\n }\n return hex;\n}\n\n// We use optimized technique to convert hex string to byte array\nconst asciis = { _0: 48, _9: 57, A: 65, F: 70, a: 97, f: 102 } as const;\nfunction asciiToBase16(ch: number): number | undefined {\n if (ch >= asciis._0 && ch <= asciis._9) return ch - asciis._0; // '2' => 50-48\n if (ch >= asciis.A && ch <= asciis.F) return ch - (asciis.A - 10); // 'B' => 66-(65-10)\n if (ch >= asciis.a && ch <= asciis.f) return ch - (asciis.a - 10); // 'b' => 98-(97-10)\n return;\n}\n\n/**\n * Convert hex string to byte array. Uses built-in function, when available.\n * @example hexToBytes('cafe0123') // Uint8Array.from([0xca, 0xfe, 0x01, 0x23])\n */\nexport function hexToBytes(hex: string): Uint8Array {\n if (typeof hex !== 'string') throw new Error('hex string expected, got ' + typeof hex);\n // @ts-ignore\n if (hasHexBuiltin) return Uint8Array.fromHex(hex);\n const hl = hex.length;\n const al = hl / 2;\n if (hl % 2) throw new Error('hex string expected, got unpadded hex of length ' + hl);\n const array = new Uint8Array(al);\n for (let ai = 0, hi = 0; ai < al; ai++, hi += 2) {\n const n1 = asciiToBase16(hex.charCodeAt(hi));\n const n2 = asciiToBase16(hex.charCodeAt(hi + 1));\n if (n1 === undefined || n2 === undefined) {\n const char = hex[hi] + hex[hi + 1];\n throw new Error('hex string expected, got non-hex character \"' + char + '\" at index ' + hi);\n }\n array[ai] = n1 * 16 + n2; // multiply first octet, e.g. 'a3' => 10*16+3 => 160 + 3 => 163\n }\n return array;\n}\n\n/**\n * There is no setImmediate in browser and setTimeout is slow.\n * Call of async fn will return Promise, which will be fullfiled only on\n * next scheduler queue processing step and this is exactly what we need.\n */\nexport const nextTick = async (): Promise<void> => {};\n\n/** Returns control to thread each 'tick' ms to avoid blocking. */\nexport async function asyncLoop(\n iters: number,\n tick: number,\n cb: (i: number) => void\n): Promise<void> {\n let ts = Date.now();\n for (let i = 0; i < iters; i++) {\n cb(i);\n // Date.now() is not monotonic, so in case if clock goes backwards we return return control too\n const diff = Date.now() - ts;\n if (diff >= 0 && diff < tick) continue;\n await nextTick();\n ts += diff;\n }\n}\n\n// Global symbols, but ts doesn't see them: https://github.com/microsoft/TypeScript/issues/31535\ndeclare const TextEncoder: any;\ndeclare const TextDecoder: any;\n\n/**\n * Converts string to bytes using UTF8 encoding.\n * @example utf8ToBytes('abc') // Uint8Array.from([97, 98, 99])\n */\nexport function utf8ToBytes(str: string): Uint8Array {\n if (typeof str !== 'string') throw new Error('string expected');\n return new Uint8Array(new TextEncoder().encode(str)); // https://bugzil.la/1681809\n}\n\n/**\n * Converts bytes to string using UTF8 encoding.\n * @example bytesToUtf8(Uint8Array.from([97, 98, 99])) // 'abc'\n */\nexport function bytesToUtf8(bytes: Uint8Array): string {\n return new TextDecoder().decode(bytes);\n}\n\n/** Accepted input of hash functions. Strings are converted to byte arrays. */\nexport type Input = string | Uint8Array;\n/**\n * Normalizes (non-hex) string or Uint8Array to Uint8Array.\n * Warning: when Uint8Array is passed, it would NOT get copied.\n * Keep in mind for future mutable operations.\n */\nexport function toBytes(data: Input): Uint8Array {\n if (typeof data === 'string') data = utf8ToBytes(data);\n abytes(data);\n return data;\n}\n\n/** KDFs can accept string or Uint8Array for user convenience. */\nexport type KDFInput = string | Uint8Array;\n/**\n * Helper for KDFs: consumes uint8array or string.\n * When string is passed, does utf8 decoding, using TextDecoder.\n */\nexport function kdfInputToBytes(data: KDFInput): Uint8Array {\n if (typeof data === 'string') data = utf8ToBytes(data);\n abytes(data);\n return data;\n}\n\n/** Copies several Uint8Arrays into one. */\nexport function concatBytes(...arrays: Uint8Array[]): Uint8Array {\n let sum = 0;\n for (let i = 0; i < arrays.length; i++) {\n const a = arrays[i];\n abytes(a);\n sum += a.length;\n }\n const res = new Uint8Array(sum);\n for (let i = 0, pad = 0; i < arrays.length; i++) {\n const a = arrays[i];\n res.set(a, pad);\n pad += a.length;\n }\n return res;\n}\n\ntype EmptyObj = {};\nexport function checkOpts<T1 extends EmptyObj, T2 extends EmptyObj>(\n defaults: T1,\n opts?: T2\n): T1 & T2 {\n if (opts !== undefined && {}.toString.call(opts) !== '[object Object]')\n throw new Error('options should be object or undefined');\n const merged = Object.assign(defaults, opts);\n return merged as T1 & T2;\n}\n\n/** Hash interface. */\nexport type IHash = {\n (data: Uint8Array): Uint8Array;\n blockLen: number;\n outputLen: number;\n create: any;\n};\n\n/** For runtime check if class implements interface */\nexport abstract class Hash<T extends Hash<T>> {\n abstract blockLen: number; // Bytes per block\n abstract outputLen: number; // Bytes in output\n abstract update(buf: Input): this;\n // Writes digest into buf\n abstract digestInto(buf: Uint8Array): void;\n abstract digest(): Uint8Array;\n /**\n * Resets internal state. Makes Hash instance unusable.\n * Reset is impossible for keyed hashes if key is consumed into state. If digest is not consumed\n * by user, they will need to manually call `destroy()` when zeroing is necessary.\n */\n abstract destroy(): void;\n /**\n * Clones hash instance. Unsafe: doesn't check whether `to` is valid. Can be used as `clone()`\n * when no options are passed.\n * Reasons to use `_cloneInto` instead of clone: 1) performance 2) reuse instance => all internal\n * buffers are overwritten => causes buffer overwrite which is used for digest in some cases.\n * There are no guarantees for clean-up because it's impossible in JS.\n */\n abstract _cloneInto(to?: T): T;\n // Safe version that clones internal state\n abstract clone(): T;\n}\n\n/**\n * XOF: streaming API to read digest in chunks.\n * Same as 'squeeze' in keccak/k12 and 'seek' in blake3, but more generic name.\n * When hash used in XOF mode it is up to user to call '.destroy' afterwards, since we cannot\n * destroy state, next call can require more bytes.\n */\nexport type HashXOF<T extends Hash<T>> = Hash<T> & {\n xof(bytes: number): Uint8Array; // Read 'bytes' bytes from digest stream\n xofInto(buf: Uint8Array): Uint8Array; // read buf.length bytes from digest stream into buf\n};\n\n/** Hash function */\nexport type CHash = ReturnType<typeof createHasher>;\n/** Hash function with output */\nexport type CHashO = ReturnType<typeof createOptHasher>;\n/** XOF with output */\nexport type CHashXO = ReturnType<typeof createXOFer>;\n\n/** Wraps hash function, creating an interface on top of it */\nexport function createHasher<T extends Hash<T>>(\n hashCons: () => Hash<T>\n): {\n (msg: Input): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(): Hash<T>;\n} {\n const hashC = (msg: Input): Uint8Array => hashCons().update(toBytes(msg)).digest();\n const tmp = hashCons();\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = () => hashCons();\n return hashC;\n}\n\nexport function createOptHasher<H extends Hash<H>, T extends Object>(\n hashCons: (opts?: T) => Hash<H>\n): {\n (msg: Input, opts?: T): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(opts?: T): Hash<H>;\n} {\n const hashC = (msg: Input, opts?: T): Uint8Array => hashCons(opts).update(toBytes(msg)).digest();\n const tmp = hashCons({} as T);\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = (opts?: T) => hashCons(opts);\n return hashC;\n}\n\nexport function createXOFer<H extends HashXOF<H>, T extends Object>(\n hashCons: (opts?: T) => HashXOF<H>\n): {\n (msg: Input, opts?: T): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(opts?: T): HashXOF<H>;\n} {\n const hashC = (msg: Input, opts?: T): Uint8Array => hashCons(opts).update(toBytes(msg)).digest();\n const tmp = hashCons({} as T);\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = (opts?: T) => hashCons(opts);\n return hashC;\n}\nexport const wrapConstructor: typeof createHasher = createHasher;\nexport const wrapConstructorWithOpts: typeof createOptHasher = createOptHasher;\nexport const wrapXOFConstructorWithOpts: typeof createXOFer = createXOFer;\n\n/** Cryptographically secure PRNG. Uses internal OS-level `crypto.getRandomValues`. */\nexport function randomBytes(bytesLength = 32): Uint8Array {\n if (crypto && typeof crypto.getRandomValues === 'function') {\n return crypto.getRandomValues(new Uint8Array(bytesLength));\n }\n // Legacy Node.js compatibility\n if (crypto && typeof crypto.randomBytes === 'function') {\n return Uint8Array.from(crypto.randomBytes(bytesLength));\n }\n throw new Error('crypto.getRandomValues must be defined');\n}\n", "/**\n * Internal Merkle-Damgard hash utils.\n * @module\n */\nimport { type Input, Hash, abytes, aexists, aoutput, clean, createView, toBytes } from './utils.ts';\n\n/** Polyfill for Safari 14. https://caniuse.com/mdn-javascript_builtins_dataview_setbiguint64 */\nexport function setBigUint64(\n view: DataView,\n byteOffset: number,\n value: bigint,\n isLE: boolean\n): void {\n if (typeof view.setBigUint64 === 'function') return view.setBigUint64(byteOffset, value, isLE);\n const _32n = BigInt(32);\n const _u32_max = BigInt(0xffffffff);\n const wh = Number((value >> _32n) & _u32_max);\n const wl = Number(value & _u32_max);\n const h = isLE ? 4 : 0;\n const l = isLE ? 0 : 4;\n view.setUint32(byteOffset + h, wh, isLE);\n view.setUint32(byteOffset + l, wl, isLE);\n}\n\n/** Choice: a ? b : c */\nexport function Chi(a: number, b: number, c: number): number {\n return (a & b) ^ (~a & c);\n}\n\n/** Majority function, true if any two inputs is true. */\nexport function Maj(a: number, b: number, c: number): number {\n return (a & b) ^ (a & c) ^ (b & c);\n}\n\n/**\n * Merkle-Damgard hash construction base class.\n * Could be used to create MD5, RIPEMD, SHA1, SHA2.\n */\nexport abstract class HashMD<T extends HashMD<T>> extends Hash<T> {\n protected abstract process(buf: DataView, offset: number): void;\n protected abstract get(): number[];\n protected abstract set(...args: number[]): void;\n abstract destroy(): void;\n protected abstract roundClean(): void;\n\n readonly blockLen: number;\n readonly outputLen: number;\n readonly padOffset: number;\n readonly isLE: boolean;\n\n // For partial updates less than block size\n protected buffer: Uint8Array;\n protected view: DataView;\n protected finished = false;\n protected length = 0;\n protected pos = 0;\n protected destroyed = false;\n\n constructor(blockLen: number, outputLen: number, padOffset: number, isLE: boolean) {\n super();\n this.blockLen = blockLen;\n this.outputLen = outputLen;\n this.padOffset = padOffset;\n this.isLE = isLE;\n this.buffer = new Uint8Array(blockLen);\n this.view = createView(this.buffer);\n }\n update(data: Input): this {\n aexists(this);\n data = toBytes(data);\n abytes(data);\n const { view, buffer, blockLen } = this;\n const len = data.length;\n for (let pos = 0; pos < len; ) {\n const take = Math.min(blockLen - this.pos, len - pos);\n // Fast path: we have at least one block in input, cast it to view and process\n if (take === blockLen) {\n const dataView = createView(data);\n for (; blockLen <= len - pos; pos += blockLen) this.process(dataView, pos);\n continue;\n }\n buffer.set(data.subarray(pos, pos + take), this.pos);\n this.pos += take;\n pos += take;\n if (this.pos === blockLen) {\n this.process(view, 0);\n this.pos = 0;\n }\n }\n this.length += data.length;\n this.roundClean();\n return this;\n }\n digestInto(out: Uint8Array): void {\n aexists(this);\n aoutput(out, this);\n this.finished = true;\n // Padding\n // We can avoid allocation of buffer for padding completely if it\n // was previously not allocated here. But it won't change performance.\n const { buffer, view, blockLen, isLE } = this;\n let { pos } = this;\n // append the bit '1' to the message\n buffer[pos++] = 0b10000000;\n clean(this.buffer.subarray(pos));\n // we have less than padOffset left in buffer, so we cannot put length in\n // current block, need process it and pad again\n if (this.padOffset > blockLen - pos) {\n this.process(view, 0);\n pos = 0;\n }\n // Pad until full block byte with zeros\n for (let i = pos; i < blockLen; i++) buffer[i] = 0;\n // Note: sha512 requires length to be 128bit integer, but length in JS will overflow before that\n // You need to write around 2 exabytes (u64_max / 8 / (1024**6)) for this to happen.\n // So we just write lowest 64 bits of that value.\n setBigUint64(view, blockLen - 8, BigInt(this.length * 8), isLE);\n this.process(view, 0);\n const oview = createView(out);\n const len = this.outputLen;\n // NOTE: we do division by 4 later, which should be fused in single op with modulo by JIT\n if (len % 4) throw new Error('_sha2: outputLen should be aligned to 32bit');\n const outLen = len / 4;\n const state = this.get();\n if (outLen > state.length) throw new Error('_sha2: outputLen bigger than state');\n for (let i = 0; i < outLen; i++) oview.setUint32(4 * i, state[i], isLE);\n }\n digest(): Uint8Array {\n const { buffer, outputLen } = this;\n this.digestInto(buffer);\n const res = buffer.slice(0, outputLen);\n this.destroy();\n return res;\n }\n _cloneInto(to?: T): T {\n to ||= new (this.constructor as any)() as T;\n to.set(...this.get());\n const { blockLen, buffer, length, finished, destroyed, pos } = this;\n to.destroyed = destroyed;\n to.finished = finished;\n to.length = length;\n to.pos = pos;\n if (length % blockLen) to.buffer.set(buffer);\n return to;\n }\n clone(): T {\n return this._cloneInto();\n }\n}\n\n/**\n * Initial SHA-2 state: fractional parts of square roots of first 16 primes 2..53.\n * Check out `test/misc/sha2-gen-iv.js` for recomputation guide.\n */\n\n/** Initial SHA256 state. Bits 0..32 of frac part of sqrt of primes 2..19 */\nexport const SHA256_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0x6a09e667, 0xbb67ae85, 0x3c6ef372, 0xa54ff53a, 0x510e527f, 0x9b05688c, 0x1f83d9ab, 0x5be0cd19,\n]);\n\n/** Initial SHA224 state. Bits 32..64 of frac part of sqrt of primes 23..53 */\nexport const SHA224_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0xc1059ed8, 0x367cd507, 0x3070dd17, 0xf70e5939, 0xffc00b31, 0x68581511, 0x64f98fa7, 0xbefa4fa4,\n]);\n\n/** Initial SHA384 state. Bits 0..64 of frac part of sqrt of primes 23..53 */\nexport const SHA384_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0xcbbb9d5d, 0xc1059ed8, 0x629a292a, 0x367cd507, 0x9159015a, 0x3070dd17, 0x152fecd8, 0xf70e5939,\n 0x67332667, 0xffc00b31, 0x8eb44a87, 0x68581511, 0xdb0c2e0d, 0x64f98fa7, 0x47b5481d, 0xbefa4fa4,\n]);\n\n/** Initial SHA512 state. Bits 0..64 of frac part of sqrt of primes 2..19 */\nexport const SHA512_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0x6a09e667, 0xf3bcc908, 0xbb67ae85, 0x84caa73b, 0x3c6ef372, 0xfe94f82b, 0xa54ff53a, 0x5f1d36f1,\n 0x510e527f, 0xade682d1, 0x9b05688c, 0x2b3e6c1f, 0x1f83d9ab, 0xfb41bd6b, 0x5be0cd19, 0x137e2179,\n]);\n", "/**\n * SHA2 hash function. A.k.a. sha256, sha384, sha512, sha512_224, sha512_256.\n * SHA256 is the fastest hash implementable in JS, even faster than Blake3.\n * Check out [RFC 4634](https://datatracker.ietf.org/doc/html/rfc4634) and\n * [FIPS 180-4](https://nvlpubs.nist.gov/nistpubs/FIPS/NIST.FIPS.180-4.pdf).\n * @module\n */\nimport { Chi, HashMD, Maj, SHA224_IV, SHA256_IV, SHA384_IV, SHA512_IV } from './_md.ts';\nimport * as u64 from './_u64.ts';\nimport { type CHash, clean, createHasher, rotr } from './utils.ts';\n\n/**\n * Round constants:\n * First 32 bits of fractional parts of the cube roots of the first 64 primes 2..311)\n */\n// prettier-ignore\nconst SHA256_K = /* @__PURE__ */ Uint32Array.from([\n 0x428a2f98, 0x71374491, 0xb5c0fbcf, 0xe9b5dba5, 0x3956c25b, 0x59f111f1, 0x923f82a4, 0xab1c5ed5,\n 0xd807aa98, 0x12835b01, 0x243185be, 0x550c7dc3, 0x72be5d74, 0x80deb1fe, 0x9bdc06a7, 0xc19bf174,\n 0xe49b69c1, 0xefbe4786, 0x0fc19dc6, 0x240ca1cc, 0x2de92c6f, 0x4a7484aa, 0x5cb0a9dc, 0x76f988da,\n 0x983e5152, 0xa831c66d, 0xb00327c8, 0xbf597fc7, 0xc6e00bf3, 0xd5a79147, 0x06ca6351, 0x14292967,\n 0x27b70a85, 0x2e1b2138, 0x4d2c6dfc, 0x53380d13, 0x650a7354, 0x766a0abb, 0x81c2c92e, 0x92722c85,\n 0xa2bfe8a1, 0xa81a664b, 0xc24b8b70, 0xc76c51a3, 0xd192e819, 0xd6990624, 0xf40e3585, 0x106aa070,\n 0x19a4c116, 0x1e376c08, 0x2748774c, 0x34b0bcb5, 0x391c0cb3, 0x4ed8aa4a, 0x5b9cca4f, 0x682e6ff3,\n 0x748f82ee, 0x78a5636f, 0x84c87814, 0x8cc70208, 0x90befffa, 0xa4506ceb, 0xbef9a3f7, 0xc67178f2\n]);\n\n/** Reusable temporary buffer. \"W\" comes straight from spec. */\nconst SHA256_W = /* @__PURE__ */ new Uint32Array(64);\nexport class SHA256 extends HashMD<SHA256> {\n // We cannot use array here since array allows indexing by variable\n // which means optimizer/compiler cannot use registers.\n protected A: number = SHA256_IV[0] | 0;\n protected B: number = SHA256_IV[1] | 0;\n protected C: number = SHA256_IV[2] | 0;\n protected D: number = SHA256_IV[3] | 0;\n protected E: number = SHA256_IV[4] | 0;\n protected F: number = SHA256_IV[5] | 0;\n protected G: number = SHA256_IV[6] | 0;\n protected H: number = SHA256_IV[7] | 0;\n\n constructor(outputLen: number = 32) {\n super(64, outputLen, 8, false);\n }\n protected get(): [number, number, number, number, number, number, number, number] {\n const { A, B, C, D, E, F, G, H } = this;\n return [A, B, C, D, E, F, G, H];\n }\n // prettier-ignore\n protected set(\n A: number, B: number, C: number, D: number, E: number, F: number, G: number, H: number\n ): void {\n this.A = A | 0;\n this.B = B | 0;\n this.C = C | 0;\n this.D = D | 0;\n this.E = E | 0;\n this.F = F | 0;\n this.G = G | 0;\n this.H = H | 0;\n }\n protected process(view: DataView, offset: number): void {\n // Extend the first 16 words into the remaining 48 words w[16..63] of the message schedule array\n for (let i = 0; i < 16; i++, offset += 4) SHA256_W[i] = view.getUint32(offset, false);\n for (let i = 16; i < 64; i++) {\n const W15 = SHA256_W[i - 15];\n const W2 = SHA256_W[i - 2];\n const s0 = rotr(W15, 7) ^ rotr(W15, 18) ^ (W15 >>> 3);\n const s1 = rotr(W2, 17) ^ rotr(W2, 19) ^ (W2 >>> 10);\n SHA256_W[i] = (s1 + SHA256_W[i - 7] + s0 + SHA256_W[i - 16]) | 0;\n }\n // Compression function main loop, 64 rounds\n let { A, B, C, D, E, F, G, H } = this;\n for (let i = 0; i < 64; i++) {\n const sigma1 = rotr(E, 6) ^ rotr(E, 11) ^ rotr(E, 25);\n const T1 = (H + sigma1 + Chi(E, F, G) + SHA256_K[i] + SHA256_W[i]) | 0;\n const sigma0 = rotr(A, 2) ^ rotr(A, 13) ^ rotr(A, 22);\n const T2 = (sigma0 + Maj(A, B, C)) | 0;\n H = G;\n G = F;\n F = E;\n E = (D + T1) | 0;\n D = C;\n C = B;\n B = A;\n A = (T1 + T2) | 0;\n }\n // Add the compressed chunk to the current hash value\n A = (A + this.A) | 0;\n B = (B + this.B) | 0;\n C = (C + this.C) | 0;\n D = (D + this.D) | 0;\n E = (E + this.E) | 0;\n F = (F + this.F) | 0;\n G = (G + this.G) | 0;\n H = (H + this.H) | 0;\n this.set(A, B, C, D, E, F, G, H);\n }\n protected roundClean(): void {\n clean(SHA256_W);\n }\n destroy(): void {\n this.set(0, 0, 0, 0, 0, 0, 0, 0);\n clean(this.buffer);\n }\n}\n\nexport class SHA224 extends SHA256 {\n protected A: number = SHA224_IV[0] | 0;\n protected B: number = SHA224_IV[1] | 0;\n protected C: number = SHA224_IV[2] | 0;\n protected D: number = SHA224_IV[3] | 0;\n protected E: number = SHA224_IV[4] | 0;\n protected F: number = SHA224_IV[5] | 0;\n protected G: number = SHA224_IV[6] | 0;\n protected H: number = SHA224_IV[7] | 0;\n constructor() {\n super(28);\n }\n}\n\n// SHA2-512 is slower than sha256 in js because u64 operations are slow.\n\n// Round contants\n// First 32 bits of the fractional parts of the cube roots of the first 80 primes 2..409\n// prettier-ignore\nconst K512 = /* @__PURE__ */ (() => u64.split([\n '0x428a2f98d728ae22', '0x7137449123ef65cd', '0xb5c0fbcfec4d3b2f', '0xe9b5dba58189dbbc',\n '0x3956c25bf348b538', '0x59f111f1b605d019', '0x923f82a4af194f9b', '0xab1c5ed5da6d8118',\n '0xd807aa98a3030242', '0x12835b0145706fbe', '0x243185be4ee4b28c', '0x550c7dc3d5ffb4e2',\n '0x72be5d74f27b896f', '0x80deb1fe3b1696b1', '0x9bdc06a725c71235', '0xc19bf174cf692694',\n '0xe49b69c19ef14ad2', '0xefbe4786384f25e3', '0x0fc19dc68b8cd5b5', '0x240ca1cc77ac9c65',\n '0x2de92c6f592b0275', '0x4a7484aa6ea6e483', '0x5cb0a9dcbd41fbd4', '0x76f988da831153b5',\n '0x983e5152ee66dfab', '0xa831c66d2db43210', '0xb00327c898fb213f', '0xbf597fc7beef0ee4',\n '0xc6e00bf33da88fc2', '0xd5a79147930aa725', '0x06ca6351e003826f', '0x142929670a0e6e70',\n '0x27b70a8546d22ffc', '0x2e1b21385c26c926', '0x4d2c6dfc5ac42aed', '0x53380d139d95b3df',\n '0x650a73548baf63de', '0x766a0abb3c77b2a8', '0x81c2c92e47edaee6', '0x92722c851482353b',\n '0xa2bfe8a14cf10364', '0xa81a664bbc423001', '0xc24b8b70d0f89791', '0xc76c51a30654be30',\n '0xd192e819d6ef5218', '0xd69906245565a910', '0xf40e35855771202a', '0x106aa07032bbd1b8',\n '0x19a4c116b8d2d0c8', '0x1e376c085141ab53', '0x2748774cdf8eeb99', '0x34b0bcb5e19b48a8',\n '0x391c0cb3c5c95a63', '0x4ed8aa4ae3418acb', '0x5b9cca4f7763e373', '0x682e6ff3d6b2b8a3',\n '0x748f82ee5defb2fc', '0x78a5636f43172f60', '0x84c87814a1f0ab72', '0x8cc702081a6439ec',\n '0x90befffa23631e28', '0xa4506cebde82bde9', '0xbef9a3f7b2c67915', '0xc67178f2e372532b',\n '0xca273eceea26619c', '0xd186b8c721c0c207', '0xeada7dd6cde0eb1e', '0xf57d4f7fee6ed178',\n '0x06f067aa72176fba', '0x0a637dc5a2c898a6', '0x113f9804bef90dae', '0x1b710b35131c471b',\n '0x28db77f523047d84', '0x32caab7b40c72493', '0x3c9ebe0a15c9bebc', '0x431d67c49c100d4c',\n '0x4cc5d4becb3e42b6', '0x597f299cfc657e2a', '0x5fcb6fab3ad6faec', '0x6c44198c4a475817'\n].map(n => BigInt(n))))();\nconst SHA512_Kh = /* @__PURE__ */ (() => K512[0])();\nconst SHA512_Kl = /* @__PURE__ */ (() => K512[1])();\n\n// Reusable temporary buffers\nconst SHA512_W_H = /* @__PURE__ */ new Uint32Array(80);\nconst SHA512_W_L = /* @__PURE__ */ new Uint32Array(80);\n\nexport class SHA512 extends HashMD<SHA512> {\n // We cannot use array here since array allows indexing by variable\n // which means optimizer/compiler cannot use registers.\n // h -- high 32 bits, l -- low 32 bits\n protected Ah: number = SHA512_IV[0] | 0;\n protected Al: number = SHA512_IV[1] | 0;\n protected Bh: number = SHA512_IV[2] | 0;\n protected Bl: number = SHA512_IV[3] | 0;\n protected Ch: number = SHA512_IV[4] | 0;\n protected Cl: number = SHA512_IV[5] | 0;\n protected Dh: number = SHA512_IV[6] | 0;\n protected Dl: number = SHA512_IV[7] | 0;\n protected Eh: number = SHA512_IV[8] | 0;\n protected El: number = SHA512_IV[9] | 0;\n protected Fh: number = SHA512_IV[10] | 0;\n protected Fl: number = SHA512_IV[11] | 0;\n protected Gh: number = SHA512_IV[12] | 0;\n protected Gl: number = SHA512_IV[13] | 0;\n protected Hh: number = SHA512_IV[14] | 0;\n protected Hl: number = SHA512_IV[15] | 0;\n\n constructor(outputLen: number = 64) {\n super(128, outputLen, 16, false);\n }\n // prettier-ignore\n protected get(): [\n number, number, number, number, number, number, number, number,\n number, number, number, number, number, number, number, number\n ] {\n const { Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl } = this;\n return [Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl];\n }\n // prettier-ignore\n protected set(\n Ah: number, Al: number, Bh: number, Bl: number, Ch: number, Cl: number, Dh: number, Dl: number,\n Eh: number, El: number, Fh: number, Fl: number, Gh: number, Gl: number, Hh: number, Hl: number\n ): void {\n this.Ah = Ah | 0;\n this.Al = Al | 0;\n this.Bh = Bh | 0;\n this.Bl = Bl | 0;\n this.Ch = Ch | 0;\n this.Cl = Cl | 0;\n this.Dh = Dh | 0;\n this.Dl = Dl | 0;\n this.Eh = Eh | 0;\n this.El = El | 0;\n this.Fh = Fh | 0;\n this.Fl = Fl | 0;\n this.Gh = Gh | 0;\n this.Gl = Gl | 0;\n this.Hh = Hh | 0;\n this.Hl = Hl | 0;\n }\n protected process(view: DataView, offset: number): void {\n // Extend the first 16 words into the remaining 64 words w[16..79] of the message schedule array\n for (let i = 0; i < 16; i++, offset += 4) {\n SHA512_W_H[i] = view.getUint32(offset);\n SHA512_W_L[i] = view.getUint32((offset += 4));\n }\n for (let i = 16; i < 80; i++) {\n // s0 := (w[i-15] rightrotate 1) xor (w[i-15] rightrotate 8) xor (w[i-15] rightshift 7)\n const W15h = SHA512_W_H[i - 15] | 0;\n const W15l = SHA512_W_L[i - 15] | 0;\n const s0h = u64.rotrSH(W15h, W15l, 1) ^ u64.rotrSH(W15h, W15l, 8) ^ u64.shrSH(W15h, W15l, 7);\n const s0l = u64.rotrSL(W15h, W15l, 1) ^ u64.rotrSL(W15h, W15l, 8) ^ u64.shrSL(W15h, W15l, 7);\n // s1 := (w[i-2] rightrotate 19) xor (w[i-2] rightrotate 61) xor (w[i-2] rightshift 6)\n const W2h = SHA512_W_H[i - 2] | 0;\n const W2l = SHA512_W_L[i - 2] | 0;\n const s1h = u64.rotrSH(W2h, W2l, 19) ^ u64.rotrBH(W2h, W2l, 61) ^ u64.shrSH(W2h, W2l, 6);\n const s1l = u64.rotrSL(W2h, W2l, 19) ^ u64.rotrBL(W2h, W2l, 61) ^ u64.shrSL(W2h, W2l, 6);\n // SHA256_W[i] = s0 + s1 + SHA256_W[i - 7] + SHA256_W[i - 16];\n const SUMl = u64.add4L(s0l, s1l, SHA512_W_L[i - 7], SHA512_W_L[i - 16]);\n const SUMh = u64.add4H(SUMl, s0h, s1h, SHA512_W_H[i - 7], SHA512_W_H[i - 16]);\n SHA512_W_H[i] = SUMh | 0;\n SHA512_W_L[i] = SUMl | 0;\n }\n let { Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl } = this;\n // Compression function main loop, 80 rounds\n for (let i = 0; i < 80; i++) {\n // S1 := (e rightrotate 14) xor (e rightrotate 18) xor (e rightrotate 41)\n const sigma1h = u64.rotrSH(Eh, El, 14) ^ u64.rotrSH(Eh, El, 18) ^ u64.rotrBH(Eh, El, 41);\n const sigma1l = u64.rotrSL(Eh, El, 14) ^ u64.rotrSL(Eh, El, 18) ^ u64.rotrBL(Eh, El, 41);\n //const T1 = (H + sigma1 + Chi(E, F, G) + SHA256_K[i] + SHA256_W[i]) | 0;\n const CHIh = (Eh & Fh) ^ (~Eh & Gh);\n const CHIl = (El & Fl) ^ (~El & Gl);\n // T1 = H + sigma1 + Chi(E, F, G) + SHA512_K[i] + SHA512_W[i]\n // prettier-ignore\n const T1ll = u64.add5L(Hl, sigma1l, CHIl, SHA512_Kl[i], SHA512_W_L[i]);\n const T1h = u64.add5H(T1ll, Hh, sigma1h, CHIh, SHA512_Kh[i], SHA512_W_H[i]);\n const T1l = T1ll | 0;\n // S0 := (a rightrotate 28) xor (a rightrotate 34) xor (a rightrotate 39)\n const sigma0h = u64.rotrSH(Ah, Al, 28) ^ u64.rotrBH(Ah, Al, 34) ^ u64.rotrBH(Ah, Al, 39);\n const sigma0l = u64.rotrSL(Ah, Al, 28) ^ u64.rotrBL(Ah, Al, 34) ^ u64.rotrBL(Ah, Al, 39);\n const MAJh = (Ah & Bh) ^ (Ah & Ch) ^ (Bh & Ch);\n const MAJl = (Al & Bl) ^ (Al & Cl) ^ (Bl & Cl);\n Hh = Gh | 0;\n Hl = Gl | 0;\n Gh = Fh | 0;\n Gl = Fl | 0;\n Fh = Eh | 0;\n Fl = El | 0;\n ({ h: Eh, l: El } = u64.add(Dh | 0, Dl | 0, T1h | 0, T1l | 0));\n Dh = Ch | 0;\n Dl = Cl | 0;\n Ch = Bh | 0;\n Cl = Bl | 0;\n Bh = Ah | 0;\n Bl = Al | 0;\n const All = u64.add3L(T1l, sigma0l, MAJl);\n Ah = u64.add3H(All, T1h, sigma0h, MAJh);\n Al = All | 0;\n }\n // Add the compressed chunk to the current hash value\n ({ h: Ah, l: Al } = u64.add(this.Ah | 0, this.Al | 0, Ah | 0, Al | 0));\n ({ h: Bh, l: Bl } = u64.add(this.Bh | 0, this.Bl | 0, Bh | 0, Bl | 0));\n ({ h: Ch, l: Cl } = u64.add(this.Ch | 0, this.Cl | 0, Ch | 0, Cl | 0));\n ({ h: Dh, l: Dl } = u64.add(this.Dh | 0, this.Dl | 0, Dh | 0, Dl | 0));\n ({ h: Eh, l: El } = u64.add(this.Eh | 0, this.El | 0, Eh | 0, El | 0));\n ({ h: Fh, l: Fl } = u64.add(this.Fh | 0, this.Fl | 0, Fh | 0, Fl | 0));\n ({ h: Gh, l: Gl } = u64.add(this.Gh | 0, this.Gl | 0, Gh | 0, Gl | 0));\n ({ h: Hh, l: Hl } = u64.add(this.Hh | 0, this.Hl | 0, Hh | 0, Hl | 0));\n this.set(Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl);\n }\n protected roundClean(): void {\n clean(SHA512_W_H, SHA512_W_L);\n }\n destroy(): void {\n clean(this.buffer);\n this.set(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0);\n }\n}\n\nexport class SHA384 extends SHA512 {\n protected Ah: number = SHA384_IV[0] | 0;\n protected Al: number = SHA384_IV[1] | 0;\n protected Bh: number = SHA384_IV[2] | 0;\n protected Bl: number = SHA384_IV[3] | 0;\n protected Ch: number = SHA384_IV[4] | 0;\n protected Cl: number = SHA384_IV[5] | 0;\n protected Dh: number = SHA384_IV[6] | 0;\n protected Dl: number = SHA384_IV[7] | 0;\n protected Eh: number = SHA384_IV[8] | 0;\n protected El: number = SHA384_IV[9] | 0;\n protected Fh: number = SHA384_IV[10] | 0;\n protected Fl: number = SHA384_IV[11] | 0;\n protected Gh: number = SHA384_IV[12] | 0;\n protected Gl: number = SHA384_IV[13] | 0;\n protected Hh: number = SHA384_IV[14] | 0;\n protected Hl: number = SHA384_IV[15] | 0;\n\n constructor() {\n super(48);\n }\n}\n\n/**\n * Truncated SHA512/256 and SHA512/224.\n * SHA512_IV is XORed with 0xa5a5a5a5a5a5a5a5, then used as \"intermediary\" IV of SHA512/t.\n * Then t hashes string to produce result IV.\n * See `test/misc/sha2-gen-iv.js`.\n */\n\n/** SHA512/224 IV */\nconst T224_IV = /* @__PURE__ */ Uint32Array.from([\n 0x8c3d37c8, 0x19544da2, 0x73e19966, 0x89dcd4d6, 0x1dfab7ae, 0x32ff9c82, 0x679dd514, 0x582f9fcf,\n 0x0f6d2b69, 0x7bd44da8, 0x77e36f73, 0x04c48942, 0x3f9d85a8, 0x6a1d36c8, 0x1112e6ad, 0x91d692a1,\n]);\n\n/** SHA512/256 IV */\nconst T256_IV = /* @__PURE__ */ Uint32Array.from([\n 0x22312194, 0xfc2bf72c, 0x9f555fa3, 0xc84c64c2, 0x2393b86b, 0x6f53b151, 0x96387719, 0x5940eabd,\n 0x96283ee2, 0xa88effe3, 0xbe5e1e25, 0x53863992, 0x2b0199fc, 0x2c85b8aa, 0x0eb72ddc, 0x81c52ca2,\n]);\n\nexport class SHA512_224 extends SHA512 {\n protected Ah: number = T224_IV[0] | 0;\n protected Al: number = T224_IV[1] | 0;\n protected Bh: number = T224_IV[2] | 0;\n protected Bl: number = T224_IV[3] | 0;\n protected Ch: number = T224_IV[4] | 0;\n protected Cl: number = T224_IV[5] | 0;\n protected Dh: number = T224_IV[6] | 0;\n protected Dl: number = T224_IV[7] | 0;\n protected Eh: number = T224_IV[8] | 0;\n protected El: number = T224_IV[9] | 0;\n protected Fh: number = T224_IV[10] | 0;\n protected Fl: number = T224_IV[11] | 0;\n protected Gh: number = T224_IV[12] | 0;\n protected Gl: number = T224_IV[13] | 0;\n protected Hh: number = T224_IV[14] | 0;\n protected Hl: number = T224_IV[15] | 0;\n\n constructor() {\n super(28);\n }\n}\n\nexport class SHA512_256 extends SHA512 {\n protected Ah: number = T256_IV[0] | 0;\n protected Al: number = T256_IV[1] | 0;\n protected Bh: number = T256_IV[2] | 0;\n protected Bl: number = T256_IV[3] | 0;\n protected Ch: number = T256_IV[4] | 0;\n protected Cl: number = T256_IV[5] | 0;\n protected Dh: number = T256_IV[6] | 0;\n protected Dl: number = T256_IV[7] | 0;\n protected Eh: number = T256_IV[8] | 0;\n protected El: number = T256_IV[9] | 0;\n protected Fh: number = T256_IV[10] | 0;\n protected Fl: number = T256_IV[11] | 0;\n protected Gh: number = T256_IV[12] | 0;\n protected Gl: number = T256_IV[13] | 0;\n protected Hh: number = T256_IV[14] | 0;\n protected Hl: number = T256_IV[15] | 0;\n\n constructor() {\n super(32);\n }\n}\n\n/**\n * SHA2-256 hash function from RFC 4634.\n *\n * It is the fastest JS hash, even faster than Blake3.\n * To break sha256 using birthday attack, attackers need to try 2^128 hashes.\n * BTC network is doing 2^70 hashes/sec (2^95 hashes/year) as per 2025.\n */\nexport const sha256: CHash = /* @__PURE__ */ createHasher(() => new SHA256());\n/** SHA2-224 hash function from RFC 4634 */\nexport const sha224: CHash = /* @__PURE__ */ createHasher(() => new SHA224());\n\n/** SHA2-512 hash function from RFC 4634. */\nexport const sha512: CHash = /* @__PURE__ */ createHasher(() => new SHA512());\n/** SHA2-384 hash function from RFC 4634. */\nexport const sha384: CHash = /* @__PURE__ */ createHasher(() => new SHA384());\n\n/**\n * SHA2-512/256 \"truncated\" hash function, with improved resistance to length extension attacks.\n * See the paper on [truncated SHA512](https://eprint.iacr.org/2010/548.pdf).\n */\nexport const sha512_256: CHash = /* @__PURE__ */ createHasher(() => new SHA512_256());\n/**\n * SHA2-512/224 \"truncated\" hash function, with improved resistance to length extension attacks.\n * See the paper on [truncated SHA512](https://eprint.iacr.org/2010/548.pdf).\n */\nexport const sha512_224: CHash = /* @__PURE__ */ createHasher(() => new SHA512_224());\n", "import crypto from 'node:crypto'\nimport { secp256k1 as secp } from '@noble/curves/secp256k1'\nimport { SigningError, VerificationError } from '../../errors.js'\nimport type { AbortOptions } from '@libp2p/interface'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nconst PUBLIC_KEY_BYTE_LENGTH = 33\nconst PRIVATE_KEY_BYTE_LENGTH = 32\n\nexport { PUBLIC_KEY_BYTE_LENGTH as publicKeyLength }\nexport { PRIVATE_KEY_BYTE_LENGTH as privateKeyLength }\n\n/**\n * Hash and sign message with private key\n */\nexport function hashAndSign (key: Uint8Array, msg: Uint8Array | Uint8ArrayList, options?: AbortOptions): Uint8Array {\n options?.signal?.throwIfAborted()\n\n const hash = crypto.createHash('sha256')\n\n if (msg instanceof Uint8Array) {\n hash.update(msg)\n } else {\n for (const buf of msg) {\n hash.update(buf)\n }\n }\n\n const digest = hash.digest()\n\n try {\n const signature = secp.sign(digest, key)\n return signature.toDERRawBytes()\n } catch (err) {\n throw new SigningError(String(err))\n }\n}\n\n/**\n * Hash message and verify signature with public key\n */\nexport function hashAndVerify (key: Uint8Array, sig: Uint8Array, msg: Uint8Array | Uint8ArrayList, options?: AbortOptions): boolean {\n options?.signal?.throwIfAborted()\n const hash = crypto.createHash('sha256')\n\n if (msg instanceof Uint8Array) {\n hash.update(msg)\n } else {\n for (const buf of msg) {\n hash.update(buf)\n }\n }\n\n const digest = hash.digest()\n\n try {\n return secp.verify(sig, digest, key)\n } catch (err) {\n throw new VerificationError(String(err))\n }\n}\n", "/**\n * HMAC: RFC2104 message authentication code.\n * @module\n */\nimport { abytes, aexists, ahash, clean, Hash, toBytes, type CHash, type Input } from './utils.ts';\n\nexport class HMAC<T extends Hash<T>> extends Hash<HMAC<T>> {\n oHash: T;\n iHash: T;\n blockLen: number;\n outputLen: number;\n private finished = false;\n private destroyed = false;\n\n constructor(hash: CHash, _key: Input) {\n super();\n ahash(hash);\n const key = toBytes(_key);\n this.iHash = hash.create() as T;\n if (typeof this.iHash.update !== 'function')\n throw new Error('Expected instance of class which extends utils.Hash');\n this.blockLen = this.iHash.blockLen;\n this.outputLen = this.iHash.outputLen;\n const blockLen = this.blockLen;\n const pad = new Uint8Array(blockLen);\n // blockLen can be bigger than outputLen\n pad.set(key.length > blockLen ? hash.create().update(key).digest() : key);\n for (let i = 0; i < pad.length; i++) pad[i] ^= 0x36;\n this.iHash.update(pad);\n // By doing update (processing of first block) of outer hash here we can re-use it between multiple calls via clone\n this.oHash = hash.create() as T;\n // Undo internal XOR && apply outer XOR\n for (let i = 0; i < pad.length; i++) pad[i] ^= 0x36 ^ 0x5c;\n this.oHash.update(pad);\n clean(pad);\n }\n update(buf: Input): this {\n aexists(this);\n this.iHash.update(buf);\n return this;\n }\n digestInto(out: Uint8Array): void {\n aexists(this);\n abytes(out, this.outputLen);\n this.finished = true;\n this.iHash.digestInto(out);\n this.oHash.update(out);\n this.oHash.digestInto(out);\n this.destroy();\n }\n digest(): Uint8Array {\n const out = new Uint8Array(this.oHash.outputLen);\n this.digestInto(out);\n return out;\n }\n _cloneInto(to?: HMAC<T>): HMAC<T> {\n // Create new instance without calling constructor since key already in state and we don't know it.\n to ||= Object.create(Object.getPrototypeOf(this), {});\n const { oHash, iHash, finished, destroyed, blockLen, outputLen } = this;\n to = to as this;\n to.finished = finished;\n to.destroyed = destroyed;\n to.blockLen = blockLen;\n to.outputLen = outputLen;\n to.oHash = oHash._cloneInto(to.oHash);\n to.iHash = iHash._cloneInto(to.iHash);\n return to;\n }\n clone(): HMAC<T> {\n return this._cloneInto();\n }\n destroy(): void {\n this.destroyed = true;\n this.oHash.destroy();\n this.iHash.destroy();\n }\n}\n\n/**\n * HMAC: RFC2104 message authentication code.\n * @param hash - function that would be used e.g. sha256\n * @param key - message key\n * @param message - message data\n * @example\n * import { hmac } from '@noble/hashes/hmac';\n * import { sha256 } from '@noble/hashes/sha2';\n * const mac1 = hmac(sha256, 'key', 'message');\n */\nexport const hmac: {\n (hash: CHash, key: Input, message: Input): Uint8Array;\n create(hash: CHash, key: Input): HMAC<any>;\n} = (hash: CHash, key: Input, message: Input): Uint8Array =>\n new HMAC<any>(hash, key).update(message).digest();\nhmac.create = (hash: CHash, key: Input) => new HMAC<any>(hash, key);\n", "/**\n * Hex, bytes and number utilities.\n * @module\n */\n/*! noble-curves - MIT License (c) 2022 Paul Miller (paulmillr.com) */\nimport {\n abytes as abytes_,\n bytesToHex as bytesToHex_,\n concatBytes as concatBytes_,\n hexToBytes as hexToBytes_,\n isBytes as isBytes_,\n} from '@noble/hashes/utils.js';\nexport {\n abytes,\n anumber,\n bytesToHex,\n bytesToUtf8,\n concatBytes,\n hexToBytes,\n isBytes,\n randomBytes,\n utf8ToBytes,\n} from '@noble/hashes/utils.js';\nconst _0n = /* @__PURE__ */ BigInt(0);\nconst _1n = /* @__PURE__ */ BigInt(1);\nexport type Hex = Uint8Array | string; // hex strings are accepted for simplicity\nexport type PrivKey = Hex | bigint; // bigints are accepted to ease learning curve\nexport type CHash = {\n (message: Uint8Array | string): Uint8Array;\n blockLen: number;\n outputLen: number;\n create(opts?: { dkLen?: number }): any; // For shake\n};\nexport type FHash = (message: Uint8Array | string) => Uint8Array;\n\nexport function abool(title: string, value: boolean): void {\n if (typeof value !== 'boolean') throw new Error(title + ' boolean expected, got ' + value);\n}\n\n// tmp name until v2\nexport function _abool2(value: boolean, title: string = ''): boolean {\n if (typeof value !== 'boolean') {\n const prefix = title && `\"${title}\"`;\n throw new Error(prefix + 'expected boolean, got type=' + typeof value);\n }\n return value;\n}\n\n// tmp name until v2\n/** Asserts something is Uint8Array. */\nexport function _abytes2(value: Uint8Array, length?: number, title: string = ''): Uint8Array {\n const bytes = isBytes_(value);\n const len = value?.length;\n const needsLen = length !== undefined;\n if (!bytes || (needsLen && len !== length)) {\n const prefix = title && `\"${title}\" `;\n const ofLen = needsLen ? ` of length ${length}` : '';\n const got = bytes ? `length=${len}` : `type=${typeof value}`;\n throw new Error(prefix + 'expected Uint8Array' + ofLen + ', got ' + got);\n }\n return value;\n}\n\n// Used in weierstrass, der\nexport function numberToHexUnpadded(num: number | bigint): string {\n const hex = num.toString(16);\n return hex.length & 1 ? '0' + hex : hex;\n}\n\nexport function hexToNumber(hex: string): bigint {\n if (typeof hex !== 'string') throw new Error('hex string expected, got ' + typeof hex);\n return hex === '' ? _0n : BigInt('0x' + hex); // Big Endian\n}\n\n// BE: Big Endian, LE: Little Endian\nexport function bytesToNumberBE(bytes: Uint8Array): bigint {\n return hexToNumber(bytesToHex_(bytes));\n}\nexport function bytesToNumberLE(bytes: Uint8Array): bigint {\n abytes_(bytes);\n return hexToNumber(bytesToHex_(Uint8Array.from(bytes).reverse()));\n}\n\nexport function numberToBytesBE(n: number | bigint, len: number): Uint8Array {\n return hexToBytes_(n.toString(16).padStart(len * 2, '0'));\n}\nexport function numberToBytesLE(n: number | bigint, len: number): Uint8Array {\n return numberToBytesBE(n, len).reverse();\n}\n// Unpadded, rarely used\nexport function numberToVarBytesBE(n: number | bigint): Uint8Array {\n return hexToBytes_(numberToHexUnpadded(n));\n}\n\n/**\n * Takes hex string or Uint8Array, converts to Uint8Array.\n * Validates output length.\n * Will throw error for other types.\n * @param title descriptive title for an error e.g. 'secret key'\n * @param hex hex string or Uint8Array\n * @param expectedLength optional, will compare to result array's length\n * @returns\n */\nexport function ensureBytes(title: string, hex: Hex, expectedLength?: number): Uint8Array {\n let res: Uint8Array;\n if (typeof hex === 'string') {\n try {\n res = hexToBytes_(hex);\n } catch (e) {\n throw new Error(title + ' must be hex string or Uint8Array, cause: ' + e);\n }\n } else if (isBytes_(hex)) {\n // Uint8Array.from() instead of hash.slice() because node.js Buffer\n // is instance of Uint8Array, and its slice() creates **mutable** copy\n res = Uint8Array.from(hex);\n } else {\n throw new Error(title + ' must be hex string or Uint8Array');\n }\n const len = res.length;\n if (typeof expectedLength === 'number' && len !== expectedLength)\n throw new Error(title + ' of length ' + expectedLength + ' expected, got ' + len);\n return res;\n}\n\n// Compares 2 u8a-s in kinda constant time\nexport function equalBytes(a: Uint8Array, b: Uint8Array): boolean {\n if (a.length !== b.length) return false;\n let diff = 0;\n for (let i = 0; i < a.length; i++) diff |= a[i] ^ b[i];\n return diff === 0;\n}\n/**\n * Copies Uint8Array. We can't use u8a.slice(), because u8a can be Buffer,\n * and Buffer#slice creates mutable copy. Never use Buffers!\n */\nexport function copyBytes(bytes: Uint8Array): Uint8Array {\n return Uint8Array.from(bytes);\n}\n\n/**\n * Decodes 7-bit ASCII string to Uint8Array, throws on non-ascii symbols\n * Should be safe to use for things expected to be ASCII.\n * Returns exact same result as utf8ToBytes for ASCII or throws.\n */\nexport function asciiToBytes(ascii: string): Uint8Array {\n return Uint8Array.from(ascii, (c, i) => {\n const charCode = c.charCodeAt(0);\n if (c.length !== 1 || charCode > 127) {\n throw new Error(\n `string contains non-ASCII character \"${ascii[i]}\" with code ${charCode} at position ${i}`\n );\n }\n return charCode;\n });\n}\n\n/**\n * @example utf8ToBytes('abc') // new Uint8Array([97, 98, 99])\n */\n// export const utf8ToBytes: typeof utf8ToBytes_ = utf8ToBytes_;\n/**\n * Converts bytes to string using UTF8 encoding.\n * @example bytesToUtf8(Uint8Array.from([97, 98, 99])) // 'abc'\n */\n// export const bytesToUtf8: typeof bytesToUtf8_ = bytesToUtf8_;\n\n// Is positive bigint\nconst isPosBig = (n: bigint) => typeof n === 'bigint' && _0n <= n;\n\nexport function inRange(n: bigint, min: bigint, max: bigint): boolean {\n return isPosBig(n) && isPosBig(min) && isPosBig(max) && min <= n && n < max;\n}\n\n/**\n * Asserts min <= n < max. NOTE: It's < max and not <= max.\n * @example\n * aInRange('x', x, 1n, 256n); // would assume x is in (1n..255n)\n */\nexport function aInRange(title: string, n: bigint, min: bigint, max: bigint): void {\n // Why min <= n < max and not a (min < n < max) OR b (min <= n <= max)?\n // consider P=256n, min=0n, max=P\n // - a for min=0 would require -1: `inRange('x', x, -1n, P)`\n // - b would commonly require subtraction: `inRange('x', x, 0n, P - 1n)`\n // - our way is the cleanest: `inRange('x', x, 0n, P)\n if (!inRange(n, min, max))\n throw new Error('expected valid ' + title + ': ' + min + ' <= n < ' + max + ', got ' + n);\n}\n\n// Bit operations\n\n/**\n * Calculates amount of bits in a bigint.\n * Same as `n.toString(2).length`\n * TODO: merge with nLength in modular\n */\nexport function bitLen(n: bigint): number {\n let len;\n for (len = 0; n > _0n; n >>= _1n, len += 1);\n return len;\n}\n\n/**\n * Gets single bit at position.\n * NOTE: first bit position is 0 (same as arrays)\n * Same as `!!+Array.from(n.toString(2)).reverse()[pos]`\n */\nexport function bitGet(n: bigint, pos: number): bigint {\n return (n >> BigInt(pos)) & _1n;\n}\n\n/**\n * Sets single bit at position.\n */\nexport function bitSet(n: bigint, pos: number, value: boolean): bigint {\n return n | ((value ? _1n : _0n) << BigInt(pos));\n}\n\n/**\n * Calculate mask for N bits. Not using ** operator with bigints because of old engines.\n * Same as BigInt(`0b${Array(i).fill('1').join('')}`)\n */\nexport const bitMask = (n: number): bigint => (_1n << BigInt(n)) - _1n;\n\n// DRBG\n\ntype Pred<T> = (v: Uint8Array) => T | undefined;\n/**\n * Minimal HMAC-DRBG from NIST 800-90 for RFC6979 sigs.\n * @returns function that will call DRBG until 2nd arg returns something meaningful\n * @example\n * const drbg = createHmacDRBG<Key>(32, 32, hmac);\n * drbg(seed, bytesToKey); // bytesToKey must return Key or undefined\n */\nexport function createHmacDrbg<T>(\n hashLen: number,\n qByteLen: number,\n hmacFn: (key: Uint8Array, ...messages: Uint8Array[]) => Uint8Array\n): (seed: Uint8Array, predicate: Pred<T>) => T {\n if (typeof hashLen !== 'number' || hashLen < 2) throw new Error('hashLen must be a number');\n if (typeof qByteLen !== 'number' || qByteLen < 2) throw new Error('qByteLen must be a number');\n if (typeof hmacFn !== 'function') throw new Error('hmacFn must be a function');\n // Step B, Step C: set hashLen to 8*ceil(hlen/8)\n const u8n = (len: number) => new Uint8Array(len); // creates Uint8Array\n const u8of = (byte: number) => Uint8Array.of(byte); // another shortcut\n let v = u8n(hashLen); // Minimal non-full-spec HMAC-DRBG from NIST 800-90 for RFC6979 sigs.\n let k = u8n(hashLen); // Steps B and C of RFC6979 3.2: set hashLen, in our case always same\n let i = 0; // Iterations counter, will throw when over 1000\n const reset = () => {\n v.fill(1);\n k.fill(0);\n i = 0;\n };\n const h = (...b: Uint8Array[]) => hmacFn(k, v, ...b); // hmac(k)(v, ...values)\n const reseed = (seed = u8n(0)) => {\n // HMAC-DRBG reseed() function. Steps D-G\n k = h(u8of(0x00), seed); // k = hmac(k || v || 0x00 || seed)\n v = h(); // v = hmac(k || v)\n if (seed.length === 0) return;\n k = h(u8of(0x01), seed); // k = hmac(k || v || 0x01 || seed)\n v = h(); // v = hmac(k || v)\n };\n const gen = () => {\n // HMAC-DRBG generate() function\n if (i++ >= 1000) throw new Error('drbg: tried 1000 values');\n let len = 0;\n const out: Uint8Array[] = [];\n while (len < qByteLen) {\n v = h();\n const sl = v.slice();\n out.push(sl);\n len += v.length;\n }\n return concatBytes_(...out);\n };\n const genUntil = (seed: Uint8Array, pred: Pred<T>): T => {\n reset();\n reseed(seed); // Steps D-G\n let res: T | undefined = undefined; // Step H: grind until k is in [1..n-1]\n while (!(res = pred(gen()))) reseed();\n reset();\n return res;\n };\n return genUntil;\n}\n\n// Validating curves and fields\n\nconst validatorFns = {\n bigint: (val: any): boolean => typeof val === 'bigint',\n function: (val: any): boolean => typeof val === 'function',\n boolean: (val: any): boolean => typeof val === 'boolean',\n string: (val: any): boolean => typeof val === 'string',\n stringOrUint8Array: (val: any): boolean => typeof val === 'string' || isBytes_(val),\n isSafeInteger: (val: any): boolean => Number.isSafeInteger(val),\n array: (val: any): boolean => Array.isArray(val),\n field: (val: any, object: any): any => (object as any).Fp.isValid(val),\n hash: (val: any): boolean => typeof val === 'function' && Number.isSafeInteger(val.outputLen),\n} as const;\ntype Validator = keyof typeof validatorFns;\ntype ValMap<T extends Record<string, any>> = { [K in keyof T]?: Validator };\n// type Record<K extends string | number | symbol, T> = { [P in K]: T; }\n\nexport function validateObject<T extends Record<string, any>>(\n object: T,\n validators: ValMap<T>,\n optValidators: ValMap<T> = {}\n): T {\n const checkField = (fieldName: keyof T, type: Validator, isOptional: boolean) => {\n const checkVal = validatorFns[type];\n if (typeof checkVal !== 'function') throw new Error('invalid validator function');\n\n const val = object[fieldName as keyof typeof object];\n if (isOptional && val === undefined) return;\n if (!checkVal(val, object)) {\n throw new Error(\n 'param ' + String(fieldName) + ' is invalid. Expected ' + type + ', got ' + val\n );\n }\n };\n for (const [fieldName, type] of Object.entries(validators)) checkField(fieldName, type!, false);\n for (const [fieldName, type] of Object.entries(optValidators)) checkField(fieldName, type!, true);\n return object;\n}\n// validate type tests\n// const o: { a: number; b: number; c: number } = { a: 1, b: 5, c: 6 };\n// const z0 = validateObject(o, { a: 'isSafeInteger' }, { c: 'bigint' }); // Ok!\n// // Should fail type-check\n// const z1 = validateObject(o, { a: 'tmp' }, { c: 'zz' });\n// const z2 = validateObject(o, { a: 'isSafeInteger' }, { c: 'zz' });\n// const z3 = validateObject(o, { test: 'boolean', z: 'bug' });\n// const z4 = validateObject(o, { a: 'boolean', z: 'bug' });\n\nexport function isHash(val: CHash): boolean {\n return typeof val === 'function' && Number.isSafeInteger(val.outputLen);\n}\nexport function _validateObject(\n object: Record<string, any>,\n fields: Record<string, string>,\n optFields: Record<string, string> = {}\n): void {\n if (!object || typeof object !== 'object') throw new Error('expected valid options object');\n type Item = keyof typeof object;\n function checkField(fieldName: Item, expectedType: string, isOpt: boolean) {\n const val = object[fieldName];\n if (isOpt && val === undefined) return;\n const current = typeof val;\n if (current !== expectedType || val === null)\n throw new Error(`param \"${fieldName}\" is invalid: expected ${expectedType}, got ${current}`);\n }\n Object.entries(fields).forEach(([k, v]) => checkField(k, v, false));\n Object.entries(optFields).forEach(([k, v]) => checkField(k, v, true));\n}\n\n/**\n * throws not implemented error\n */\nexport const notImplemented = (): never => {\n throw new Error('not implemented');\n};\n\n/**\n * Memoizes (caches) computation result.\n * Uses WeakMap: the value is going auto-cleaned by GC after last reference is removed.\n */\nexport function memoized<T extends object, R, O extends any[]>(\n fn: (arg: T, ...args: O) => R\n): (arg: T, ...args: O) => R {\n const map = new WeakMap<T, R>();\n return (arg: T, ...args: O): R => {\n const val = map.get(arg);\n if (val !== undefined) return val;\n const computed = fn(arg, ...args);\n map.set(arg, computed);\n return computed;\n };\n}\n", "/**\n * Utils for modular division and fields.\n * Field over 11 is a finite (Galois) field is integer number operations `mod 11`.\n * There is no division: it is replaced by modular multiplicative inverse.\n * @module\n */\n/*! noble-curves - MIT License (c) 2022 Paul Miller (paulmillr.com) */\nimport {\n _validateObject,\n anumber,\n bitMask,\n bytesToNumberBE,\n bytesToNumberLE,\n ensureBytes,\n numberToBytesBE,\n numberToBytesLE,\n} from '../utils.ts';\n\n// prettier-ignore\nconst _0n = BigInt(0), _1n = BigInt(1), _2n = /* @__PURE__ */ BigInt(2), _3n = /* @__PURE__ */ BigInt(3);\n// prettier-ignore\nconst _4n = /* @__PURE__ */ BigInt(4), _5n = /* @__PURE__ */ BigInt(5), _7n = /* @__PURE__ */ BigInt(7);\n// prettier-ignore\nconst _8n = /* @__PURE__ */ BigInt(8), _9n = /* @__PURE__ */ BigInt(9), _16n = /* @__PURE__ */ BigInt(16);\n\n// Calculates a modulo b\nexport function mod(a: bigint, b: bigint): bigint {\n const result = a % b;\n return result >= _0n ? result : b + result;\n}\n/**\n * Efficiently raise num to power and do modular division.\n * Unsafe in some contexts: uses ladder, so can expose bigint bits.\n * @example\n * pow(2n, 6n, 11n) // 64n % 11n == 9n\n */\nexport function pow(num: bigint, power: bigint, modulo: bigint): bigint {\n return FpPow(Field(modulo), num, power);\n}\n\n/** Does `x^(2^power)` mod p. `pow2(30, 4)` == `30^(2^4)` */\nexport function pow2(x: bigint, power: bigint, modulo: bigint): bigint {\n let res = x;\n while (power-- > _0n) {\n res *= res;\n res %= modulo;\n }\n return res;\n}\n\n/**\n * Inverses number over modulo.\n * Implemented using [Euclidean GCD](https://brilliant.org/wiki/extended-euclidean-algorithm/).\n */\nexport function invert(number: bigint, modulo: bigint): bigint {\n if (number === _0n) throw new Error('invert: expected non-zero number');\n if (modulo <= _0n) throw new Error('invert: expected positive modulus, got ' + modulo);\n // Fermat's little theorem \"CT-like\" version inv(n) = n^(m-2) mod m is 30x slower.\n let a = mod(number, modulo);\n let b = modulo;\n // prettier-ignore\n let x = _0n, y = _1n, u = _1n, v = _0n;\n while (a !== _0n) {\n // JIT applies optimization if those two lines follow each other\n const q = b / a;\n const r = b % a;\n const m = x - u * q;\n const n = y - v * q;\n // prettier-ignore\n b = a, a = r, x = u, y = v, u = m, v = n;\n }\n const gcd = b;\n if (gcd !== _1n) throw new Error('invert: does not exist');\n return mod(x, modulo);\n}\n\nfunction assertIsSquare<T>(Fp: IField<T>, root: T, n: T): void {\n if (!Fp.eql(Fp.sqr(root), n)) throw new Error('Cannot find square root');\n}\n\n// Not all roots are possible! Example which will throw:\n// const NUM =\n// n = 72057594037927816n;\n// Fp = Field(BigInt('0x1a0111ea397fe69a4b1ba7b6434bacd764774b84f38512bf6730d2a0f6b0f6241eabfffeb153ffffb9feffffffffaaab'));\nfunction sqrt3mod4<T>(Fp: IField<T>, n: T) {\n const p1div4 = (Fp.ORDER + _1n) / _4n;\n const root = Fp.pow(n, p1div4);\n assertIsSquare(Fp, root, n);\n return root;\n}\n\nfunction sqrt5mod8<T>(Fp: IField<T>, n: T) {\n const p5div8 = (Fp.ORDER - _5n) / _8n;\n const n2 = Fp.mul(n, _2n);\n const v = Fp.pow(n2, p5div8);\n const nv = Fp.mul(n, v);\n const i = Fp.mul(Fp.mul(nv, _2n), v);\n const root = Fp.mul(nv, Fp.sub(i, Fp.ONE));\n assertIsSquare(Fp, root, n);\n return root;\n}\n\n// Based on RFC9380, Kong algorithm\n// prettier-ignore\nfunction sqrt9mod16(P: bigint): <T>(Fp: IField<T>, n: T) => T {\n const Fp_ = Field(P);\n const tn = tonelliShanks(P);\n const c1 = tn(Fp_, Fp_.neg(Fp_.ONE));// 1. c1 = sqrt(-1) in F, i.e., (c1^2) == -1 in F\n const c2 = tn(Fp_, c1); // 2. c2 = sqrt(c1) in F, i.e., (c2^2) == c1 in F\n const c3 = tn(Fp_, Fp_.neg(c1)); // 3. c3 = sqrt(-c1) in F, i.e., (c3^2) == -c1 in F\n const c4 = (P + _7n) / _16n; // 4. c4 = (q + 7) / 16 # Integer arithmetic\n return <T>(Fp: IField<T>, n: T) => {\n let tv1 = Fp.pow(n, c4); // 1. tv1 = x^c4\n let tv2 = Fp.mul(tv1, c1); // 2. tv2 = c1 * tv1\n const tv3 = Fp.mul(tv1, c2); // 3. tv3 = c2 * tv1\n const tv4 = Fp.mul(tv1, c3); // 4. tv4 = c3 * tv1\n const e1 = Fp.eql(Fp.sqr(tv2), n); // 5. e1 = (tv2^2) == x\n const e2 = Fp.eql(Fp.sqr(tv3), n); // 6. e2 = (tv3^2) == x\n tv1 = Fp.cmov(tv1, tv2, e1); // 7. tv1 = CMOV(tv1, tv2, e1) # Select tv2 if (tv2^2) == x\n tv2 = Fp.cmov(tv4, tv3, e2); // 8. tv2 = CMOV(tv4, tv3, e2) # Select tv3 if (tv3^2) == x\n const e3 = Fp.eql(Fp.sqr(tv2), n); // 9. e3 = (tv2^2) == x\n const root = Fp.cmov(tv1, tv2, e3);// 10. z = CMOV(tv1, tv2, e3) # Select sqrt from tv1 & tv2\n assertIsSquare(Fp, root, n);\n return root;\n };\n}\n\n/**\n * Tonelli-Shanks square root search algorithm.\n * 1. https://eprint.iacr.org/2012/685.pdf (page 12)\n * 2. Square Roots from 1; 24, 51, 10 to Dan Shanks\n * @param P field order\n * @returns function that takes field Fp (created from P) and number n\n */\nexport function tonelliShanks(P: bigint): <T>(Fp: IField<T>, n: T) => T {\n // Initialization (precomputation).\n // Caching initialization could boost perf by 7%.\n if (P < _3n) throw new Error('sqrt is not defined for small field');\n // Factor P - 1 = Q * 2^S, where Q is odd\n let Q = P - _1n;\n let S = 0;\n while (Q % _2n === _0n) {\n Q /= _2n;\n S++;\n }\n\n // Find the first quadratic non-residue Z >= 2\n let Z = _2n;\n const _Fp = Field(P);\n while (FpLegendre(_Fp, Z) === 1) {\n // Basic primality test for P. After x iterations, chance of\n // not finding quadratic non-residue is 2^x, so 2^1000.\n if (Z++ > 1000) throw new Error('Cannot find square root: probably non-prime P');\n }\n // Fast-path; usually done before Z, but we do \"primality test\".\n if (S === 1) return sqrt3mod4;\n\n // Slow-path\n // TODO: test on Fp2 and others\n let cc = _Fp.pow(Z, Q); // c = z^Q\n const Q1div2 = (Q + _1n) / _2n;\n return function tonelliSlow<T>(Fp: IField<T>, n: T): T {\n if (Fp.is0(n)) return n;\n // Check if n is a quadratic residue using Legendre symbol\n if (FpLegendre(Fp, n) !== 1) throw new Error('Cannot find square root');\n\n // Initialize variables for the main loop\n let M = S;\n let c = Fp.mul(Fp.ONE, cc); // c = z^Q, move cc from field _Fp into field Fp\n let t = Fp.pow(n, Q); // t = n^Q, first guess at the fudge factor\n let R = Fp.pow(n, Q1div2); // R = n^((Q+1)/2), first guess at the square root\n\n // Main loop\n // while t != 1\n while (!Fp.eql(t, Fp.ONE)) {\n if (Fp.is0(t)) return Fp.ZERO; // if t=0 return R=0\n let i = 1;\n\n // Find the smallest i >= 1 such that t^(2^i) \u2261 1 (mod P)\n let t_tmp = Fp.sqr(t); // t^(2^1)\n while (!Fp.eql(t_tmp, Fp.ONE)) {\n i++;\n t_tmp = Fp.sqr(t_tmp); // t^(2^2)...\n if (i === M) throw new Error('Cannot find square root');\n }\n\n // Calculate the exponent for b: 2^(M - i - 1)\n const exponent = _1n << BigInt(M - i - 1); // bigint is important\n const b = Fp.pow(c, exponent); // b = 2^(M - i - 1)\n\n // Update variables\n M = i;\n c = Fp.sqr(b); // c = b^2\n t = Fp.mul(t, c); // t = (t * b^2)\n R = Fp.mul(R, b); // R = R*b\n }\n return R;\n };\n}\n\n/**\n * Square root for a finite field. Will try optimized versions first:\n *\n * 1. P \u2261 3 (mod 4)\n * 2. P \u2261 5 (mod 8)\n * 3. P \u2261 9 (mod 16)\n * 4. Tonelli-Shanks algorithm\n *\n * Different algorithms can give different roots, it is up to user to decide which one they want.\n * For example there is FpSqrtOdd/FpSqrtEven to choice root based on oddness (used for hash-to-curve).\n */\nexport function FpSqrt(P: bigint): <T>(Fp: IField<T>, n: T) => T {\n // P \u2261 3 (mod 4) => \u221An = n^((P+1)/4)\n if (P % _4n === _3n) return sqrt3mod4;\n // P \u2261 5 (mod 8) => Atkin algorithm, page 10 of https://eprint.iacr.org/2012/685.pdf\n if (P % _8n === _5n) return sqrt5mod8;\n // P \u2261 9 (mod 16) => Kong algorithm, page 11 of https://eprint.iacr.org/2012/685.pdf (algorithm 4)\n if (P % _16n === _9n) return sqrt9mod16(P);\n // Tonelli-Shanks algorithm\n return tonelliShanks(P);\n}\n\n// Little-endian check for first LE bit (last BE bit);\nexport const isNegativeLE = (num: bigint, modulo: bigint): boolean =>\n (mod(num, modulo) & _1n) === _1n;\n\n/** Field is not always over prime: for example, Fp2 has ORDER(q)=p^m. */\nexport interface IField<T> {\n ORDER: bigint;\n isLE: boolean;\n BYTES: number;\n BITS: number;\n MASK: bigint;\n ZERO: T;\n ONE: T;\n // 1-arg\n create: (num: T) => T;\n isValid: (num: T) => boolean;\n is0: (num: T) => boolean;\n isValidNot0: (num: T) => boolean;\n neg(num: T): T;\n inv(num: T): T;\n sqrt(num: T): T;\n sqr(num: T): T;\n // 2-args\n eql(lhs: T, rhs: T): boolean;\n add(lhs: T, rhs: T): T;\n sub(lhs: T, rhs: T): T;\n mul(lhs: T, rhs: T | bigint): T;\n pow(lhs: T, power: bigint): T;\n div(lhs: T, rhs: T | bigint): T;\n // N for NonNormalized (for now)\n addN(lhs: T, rhs: T): T;\n subN(lhs: T, rhs: T): T;\n mulN(lhs: T, rhs: T | bigint): T;\n sqrN(num: T): T;\n\n // Optional\n // Should be same as sgn0 function in\n // [RFC9380](https://www.rfc-editor.org/rfc/rfc9380#section-4.1).\n // NOTE: sgn0 is 'negative in LE', which is same as odd. And negative in LE is kinda strange definition anyway.\n isOdd?(num: T): boolean; // Odd instead of even since we have it for Fp2\n allowedLengths?: number[];\n // legendre?(num: T): T;\n invertBatch: (lst: T[]) => T[];\n toBytes(num: T): Uint8Array;\n fromBytes(bytes: Uint8Array, skipValidation?: boolean): T;\n // If c is False, CMOV returns a, otherwise it returns b.\n cmov(a: T, b: T, c: boolean): T;\n}\n// prettier-ignore\nconst FIELD_FIELDS = [\n 'create', 'isValid', 'is0', 'neg', 'inv', 'sqrt', 'sqr',\n 'eql', 'add', 'sub', 'mul', 'pow', 'div',\n 'addN', 'subN', 'mulN', 'sqrN'\n] as const;\nexport function validateField<T>(field: IField<T>): IField<T> {\n const initial = {\n ORDER: 'bigint',\n MASK: 'bigint',\n BYTES: 'number',\n BITS: 'number',\n } as Record<string, string>;\n const opts = FIELD_FIELDS.reduce((map, val: string) => {\n map[val] = 'function';\n return map;\n }, initial);\n _validateObject(field, opts);\n // const max = 16384;\n // if (field.BYTES < 1 || field.BYTES > max) throw new Error('invalid field');\n // if (field.BITS < 1 || field.BITS > 8 * max) throw new Error('invalid field');\n return field;\n}\n\n// Generic field functions\n\n/**\n * Same as `pow` but for Fp: non-constant-time.\n * Unsafe in some contexts: uses ladder, so can expose bigint bits.\n */\nexport function FpPow<T>(Fp: IField<T>, num: T, power: bigint): T {\n if (power < _0n) throw new Error('invalid exponent, negatives unsupported');\n if (power === _0n) return Fp.ONE;\n if (power === _1n) return num;\n let p = Fp.ONE;\n let d = num;\n while (power > _0n) {\n if (power & _1n) p = Fp.mul(p, d);\n d = Fp.sqr(d);\n power >>= _1n;\n }\n return p;\n}\n\n/**\n * Efficiently invert an array of Field elements.\n * Exception-free. Will return `undefined` for 0 elements.\n * @param passZero map 0 to 0 (instead of undefined)\n */\nexport function FpInvertBatch<T>(Fp: IField<T>, nums: T[], passZero = false): T[] {\n const inverted = new Array(nums.length).fill(passZero ? Fp.ZERO : undefined);\n // Walk from first to last, multiply them by each other MOD p\n const multipliedAcc = nums.reduce((acc, num, i) => {\n if (Fp.is0(num)) return acc;\n inverted[i] = acc;\n return Fp.mul(acc, num);\n }, Fp.ONE);\n // Invert last element\n const invertedAcc = Fp.inv(multipliedAcc);\n // Walk from last to first, multiply them by inverted each other MOD p\n nums.reduceRight((acc, num, i) => {\n if (Fp.is0(num)) return acc;\n inverted[i] = Fp.mul(acc, inverted[i]);\n return Fp.mul(acc, num);\n }, invertedAcc);\n return inverted;\n}\n\n// TODO: remove\nexport function FpDiv<T>(Fp: IField<T>, lhs: T, rhs: T | bigint): T {\n return Fp.mul(lhs, typeof rhs === 'bigint' ? invert(rhs, Fp.ORDER) : Fp.inv(rhs));\n}\n\n/**\n * Legendre symbol.\n * Legendre constant is used to calculate Legendre symbol (a | p)\n * which denotes the value of a^((p-1)/2) (mod p).\n *\n * * (a | p) \u2261 1 if a is a square (mod p), quadratic residue\n * * (a | p) \u2261 -1 if a is not a square (mod p), quadratic non residue\n * * (a | p) \u2261 0 if a \u2261 0 (mod p)\n */\nexport function FpLegendre<T>(Fp: IField<T>, n: T): -1 | 0 | 1 {\n // We can use 3rd argument as optional cache of this value\n // but seems unneeded for now. The operation is very fast.\n const p1mod2 = (Fp.ORDER - _1n) / _2n;\n const powered = Fp.pow(n, p1mod2);\n const yes = Fp.eql(powered, Fp.ONE);\n const zero = Fp.eql(powered, Fp.ZERO);\n const no = Fp.eql(powered, Fp.neg(Fp.ONE));\n if (!yes && !zero && !no) throw new Error('invalid Legendre symbol result');\n return yes ? 1 : zero ? 0 : -1;\n}\n\n// This function returns True whenever the value x is a square in the field F.\nexport function FpIsSquare<T>(Fp: IField<T>, n: T): boolean {\n const l = FpLegendre(Fp, n);\n return l === 1;\n}\n\nexport type NLength = { nByteLength: number; nBitLength: number };\n// CURVE.n lengths\nexport function nLength(n: bigint, nBitLength?: number): NLength {\n // Bit size, byte size of CURVE.n\n if (nBitLength !== undefined) anumber(nBitLength);\n const _nBitLength = nBitLength !== undefined ? nBitLength : n.toString(2).length;\n const nByteLength = Math.ceil(_nBitLength / 8);\n return { nBitLength: _nBitLength, nByteLength };\n}\n\ntype FpField = IField<bigint> & Required<Pick<IField<bigint>, 'isOdd'>>;\ntype SqrtFn = (n: bigint) => bigint;\ntype FieldOpts = Partial<{\n sqrt: SqrtFn;\n isLE: boolean;\n BITS: number;\n modFromBytes: boolean; // bls12-381 requires mod(n) instead of rejecting keys >= n\n allowedLengths?: readonly number[]; // for P521 (adds padding for smaller sizes)\n}>;\n/**\n * Creates a finite field. Major performance optimizations:\n * * 1. Denormalized operations like mulN instead of mul.\n * * 2. Identical object shape: never add or remove keys.\n * * 3. `Object.freeze`.\n * Fragile: always run a benchmark on a change.\n * Security note: operations don't check 'isValid' for all elements for performance reasons,\n * it is caller responsibility to check this.\n * This is low-level code, please make sure you know what you're doing.\n *\n * Note about field properties:\n * * CHARACTERISTIC p = prime number, number of elements in main subgroup.\n * * ORDER q = similar to cofactor in curves, may be composite `q = p^m`.\n *\n * @param ORDER field order, probably prime, or could be composite\n * @param bitLen how many bits the field consumes\n * @param isLE (default: false) if encoding / decoding should be in little-endian\n * @param redef optional faster redefinitions of sqrt and other methods\n */\nexport function Field(\n ORDER: bigint,\n bitLenOrOpts?: number | FieldOpts, // TODO: use opts only in v2?\n isLE = false,\n opts: { sqrt?: SqrtFn } = {}\n): Readonly<FpField> {\n if (ORDER <= _0n) throw new Error('invalid field: expected ORDER > 0, got ' + ORDER);\n let _nbitLength: number | undefined = undefined;\n let _sqrt: SqrtFn | undefined = undefined;\n let modFromBytes: boolean = false;\n let allowedLengths: undefined | readonly number[] = undefined;\n if (typeof bitLenOrOpts === 'object' && bitLenOrOpts != null) {\n if (opts.sqrt || isLE) throw new Error('cannot specify opts in two arguments');\n const _opts = bitLenOrOpts;\n if (_opts.BITS) _nbitLength = _opts.BITS;\n if (_opts.sqrt) _sqrt = _opts.sqrt;\n if (typeof _opts.isLE === 'boolean') isLE = _opts.isLE;\n if (typeof _opts.modFromBytes === 'boolean') modFromBytes = _opts.modFromBytes;\n allowedLengths = _opts.allowedLengths;\n } else {\n if (typeof bitLenOrOpts === 'number') _nbitLength = bitLenOrOpts;\n if (opts.sqrt) _sqrt = opts.sqrt;\n }\n const { nBitLength: BITS, nByteLength: BYTES } = nLength(ORDER, _nbitLength);\n if (BYTES > 2048) throw new Error('invalid field: expected ORDER of <= 2048 bytes');\n let sqrtP: ReturnType<typeof FpSqrt>; // cached sqrtP\n const f: Readonly<FpField> = Object.freeze({\n ORDER,\n isLE,\n BITS,\n BYTES,\n MASK: bitMask(BITS),\n ZERO: _0n,\n ONE: _1n,\n allowedLengths: allowedLengths,\n create: (num) => mod(num, ORDER),\n isValid: (num) => {\n if (typeof num !== 'bigint')\n throw new Error('invalid field element: expected bigint, got ' + typeof num);\n return _0n <= num && num < ORDER; // 0 is valid element, but it's not invertible\n },\n is0: (num) => num === _0n,\n // is valid and invertible\n isValidNot0: (num: bigint) => !f.is0(num) && f.isValid(num),\n isOdd: (num) => (num & _1n) === _1n,\n neg: (num) => mod(-num, ORDER),\n eql: (lhs, rhs) => lhs === rhs,\n\n sqr: (num) => mod(num * num, ORDER),\n add: (lhs, rhs) => mod(lhs + rhs, ORDER),\n sub: (lhs, rhs) => mod(lhs - rhs, ORDER),\n mul: (lhs, rhs) => mod(lhs * rhs, ORDER),\n pow: (num, power) => FpPow(f, num, power),\n div: (lhs, rhs) => mod(lhs * invert(rhs, ORDER), ORDER),\n\n // Same as above, but doesn't normalize\n sqrN: (num) => num * num,\n addN: (lhs, rhs) => lhs + rhs,\n subN: (lhs, rhs) => lhs - rhs,\n mulN: (lhs, rhs) => lhs * rhs,\n\n inv: (num) => invert(num, ORDER),\n sqrt:\n _sqrt ||\n ((n) => {\n if (!sqrtP) sqrtP = FpSqrt(ORDER);\n return sqrtP(f, n);\n }),\n toBytes: (num) => (isLE ? numberToBytesLE(num, BYTES) : numberToBytesBE(num, BYTES)),\n fromBytes: (bytes, skipValidation = true) => {\n if (allowedLengths) {\n if (!allowedLengths.includes(bytes.length) || bytes.length > BYTES) {\n throw new Error(\n 'Field.fromBytes: expected ' + allowedLengths + ' bytes, got ' + bytes.length\n );\n }\n const padded = new Uint8Array(BYTES);\n // isLE add 0 to right, !isLE to the left.\n padded.set(bytes, isLE ? 0 : padded.length - bytes.length);\n bytes = padded;\n }\n if (bytes.length !== BYTES)\n throw new Error('Field.fromBytes: expected ' + BYTES + ' bytes, got ' + bytes.length);\n let scalar = isLE ? bytesToNumberLE(bytes) : bytesToNumberBE(bytes);\n if (modFromBytes) scalar = mod(scalar, ORDER);\n if (!skipValidation)\n if (!f.isValid(scalar)) throw new Error('invalid field element: outside of range 0..ORDER');\n // NOTE: we don't validate scalar here, please use isValid. This done such way because some\n // protocol may allow non-reduced scalar that reduced later or changed some other way.\n return scalar;\n },\n // TODO: we don't need it here, move out to separate fn\n invertBatch: (lst) => FpInvertBatch(f, lst),\n // We can't move this out because Fp6, Fp12 implement it\n // and it's unclear what to return in there.\n cmov: (a, b, c) => (c ? b : a),\n } as FpField);\n return Object.freeze(f);\n}\n\n// Generic random scalar, we can do same for other fields if via Fp2.mul(Fp2.ONE, Fp2.random)?\n// This allows unsafe methods like ignore bias or zero. These unsafe, but often used in different protocols (if deterministic RNG).\n// which mean we cannot force this via opts.\n// Not sure what to do with randomBytes, we can accept it inside opts if wanted.\n// Probably need to export getMinHashLength somewhere?\n// random(bytes?: Uint8Array, unsafeAllowZero = false, unsafeAllowBias = false) {\n// const LEN = !unsafeAllowBias ? getMinHashLength(ORDER) : BYTES;\n// if (bytes === undefined) bytes = randomBytes(LEN); // _opts.randomBytes?\n// const num = isLE ? bytesToNumberLE(bytes) : bytesToNumberBE(bytes);\n// // `mod(x, 11)` can sometimes produce 0. `mod(x, 10) + 1` is the same, but no 0\n// const reduced = unsafeAllowZero ? mod(num, ORDER) : mod(num, ORDER - _1n) + _1n;\n// return reduced;\n// },\n\nexport function FpSqrtOdd<T>(Fp: IField<T>, elm: T): T {\n if (!Fp.isOdd) throw new Error(\"Field doesn't have isOdd\");\n const root = Fp.sqrt(elm);\n return Fp.isOdd(root) ? root : Fp.neg(root);\n}\n\nexport function FpSqrtEven<T>(Fp: IField<T>, elm: T): T {\n if (!Fp.isOdd) throw new Error(\"Field doesn't have isOdd\");\n const root = Fp.sqrt(elm);\n return Fp.isOdd(root) ? Fp.neg(root) : root;\n}\n\n/**\n * \"Constant-time\" private key generation utility.\n * Same as mapKeyToField, but accepts less bytes (40 instead of 48 for 32-byte field).\n * Which makes it slightly more biased, less secure.\n * @deprecated use `mapKeyToField` instead\n */\nexport function hashToPrivateScalar(\n hash: string | Uint8Array,\n groupOrder: bigint,\n isLE = false\n): bigint {\n hash = ensureBytes('privateHash', hash);\n const hashLen = hash.length;\n const minLen = nLength(groupOrder).nByteLength + 8;\n if (minLen < 24 || hashLen < minLen || hashLen > 1024)\n throw new Error(\n 'hashToPrivateScalar: expected ' + minLen + '-1024 bytes of input, got ' + hashLen\n );\n const num = isLE ? bytesToNumberLE(hash) : bytesToNumberBE(hash);\n return mod(num, groupOrder - _1n) + _1n;\n}\n\n/**\n * Returns total number of bytes consumed by the field element.\n * For example, 32 bytes for usual 256-bit weierstrass curve.\n * @param fieldOrder number of field elements, usually CURVE.n\n * @returns byte length of field\n */\nexport function getFieldBytesLength(fieldOrder: bigint): number {\n if (typeof fieldOrder !== 'bigint') throw new Error('field order must be bigint');\n const bitLength = fieldOrder.toString(2).length;\n return Math.ceil(bitLength / 8);\n}\n\n/**\n * Returns minimal amount of bytes that can be safely reduced\n * by field order.\n * Should be 2^-128 for 128-bit curve such as P256.\n * @param fieldOrder number of field elements, usually CURVE.n\n * @returns byte length of target hash\n */\nexport function getMinHashLength(fieldOrder: bigint): number {\n const length = getFieldBytesLength(fieldOrder);\n return length + Math.ceil(length / 2);\n}\n\n/**\n * \"Constant-time\" private key generation utility.\n * Can take (n + n/2) or more bytes of uniform input e.g. from CSPRNG or KDF\n * and convert them into private scalar, with the modulo bias being negligible.\n * Needs at least 48 bytes of input for 32-byte private key.\n * https://research.kudelskisecurity.com/2020/07/28/the-definitive-guide-to-modulo-bias-and-how-to-avoid-it/\n * FIPS 186-5, A.2 https://csrc.nist.gov/publications/detail/fips/186/5/final\n * RFC 9380, https://www.rfc-editor.org/rfc/rfc9380#section-5\n * @param hash hash output from SHA3 or a similar function\n * @param groupOrder size of subgroup - (e.g. secp256k1.CURVE.n)\n * @param isLE interpret hash bytes as LE num\n * @returns valid private scalar\n */\nexport function mapHashToField(key: Uint8Array, fieldOrder: bigint, isLE = false): Uint8Array {\n const len = key.length;\n const fieldLen = getFieldBytesLength(fieldOrder);\n const minLen = getMinHashLength(fieldOrder);\n // No small numbers: need to understand bias story. No huge numbers: easier to detect JS timings.\n if (len < 16 || len < minLen || len > 1024)\n throw new Error('expected ' + minLen + '-1024 bytes of input, got ' + len);\n const num = isLE ? bytesToNumberLE(key) : bytesToNumberBE(key);\n // `mod(x, 11)` can sometimes produce 0. `mod(x, 10) + 1` is the same, but no 0\n const reduced = mod(num, fieldOrder - _1n) + _1n;\n return isLE ? numberToBytesLE(reduced, fieldLen) : numberToBytesBE(reduced, fieldLen);\n}\n", "/**\n * Methods for elliptic curve multiplication by scalars.\n * Contains wNAF, pippenger.\n * @module\n */\n/*! noble-curves - MIT License (c) 2022 Paul Miller (paulmillr.com) */\nimport { bitLen, bitMask, validateObject } from '../utils.ts';\nimport { Field, FpInvertBatch, nLength, validateField, type IField } from './modular.ts';\n\nconst _0n = BigInt(0);\nconst _1n = BigInt(1);\n\nexport type AffinePoint<T> = {\n x: T;\n y: T;\n} & { Z?: never };\n\n// This was initialy do this way to re-use montgomery ladder in field (add->mul,double->sqr), but\n// that didn't happen and there is probably not much reason to have separate Group like this?\nexport interface Group<T extends Group<T>> {\n double(): T;\n negate(): T;\n add(other: T): T;\n subtract(other: T): T;\n equals(other: T): boolean;\n multiply(scalar: bigint): T;\n toAffine?(invertedZ?: any): AffinePoint<any>;\n}\n\n// We can't \"abstract out\" coordinates (X, Y, Z; and T in Edwards): argument names of constructor\n// are not accessible. See Typescript gh-56093, gh-41594.\n//\n// We have to use recursive types, so it will return actual point, not constained `CurvePoint`.\n// If, at any point, P is `any`, it will erase all types and replace it\n// with `any`, because of recursion, `any implements CurvePoint`,\n// but we lose all constrains on methods.\n\n/** Base interface for all elliptic curve Points. */\nexport interface CurvePoint<F, P extends CurvePoint<F, P>> extends Group<P> {\n /** Affine x coordinate. Different from projective / extended X coordinate. */\n x: F;\n /** Affine y coordinate. Different from projective / extended Y coordinate. */\n y: F;\n Z?: F;\n double(): P;\n negate(): P;\n add(other: P): P;\n subtract(other: P): P;\n equals(other: P): boolean;\n multiply(scalar: bigint): P;\n assertValidity(): void;\n clearCofactor(): P;\n is0(): boolean;\n isTorsionFree(): boolean;\n isSmallOrder(): boolean;\n multiplyUnsafe(scalar: bigint): P;\n /**\n * Massively speeds up `p.multiply(n)` by using precompute tables (caching). See {@link wNAF}.\n * @param isLazy calculate cache now. Default (true) ensures it's deferred to first `multiply()`\n */\n precompute(windowSize?: number, isLazy?: boolean): P;\n /** Converts point to 2D xy affine coordinates */\n toAffine(invertedZ?: F): AffinePoint<F>;\n toBytes(): Uint8Array;\n toHex(): string;\n}\n\n/** Base interface for all elliptic curve Point constructors. */\nexport interface CurvePointCons<P extends CurvePoint<any, P>> {\n [Symbol.hasInstance]: (item: unknown) => boolean;\n BASE: P;\n ZERO: P;\n /** Field for basic curve math */\n Fp: IField<P_F<P>>;\n /** Scalar field, for scalars in multiply and others */\n Fn: IField<bigint>;\n /** Creates point from x, y. Does NOT validate if the point is valid. Use `.assertValidity()`. */\n fromAffine(p: AffinePoint<P_F<P>>): P;\n fromBytes(bytes: Uint8Array): P;\n fromHex(hex: Uint8Array | string): P;\n}\n\n// Type inference helpers: PC - PointConstructor, P - Point, Fp - Field element\n// Short names, because we use them a lot in result types:\n// * we can't do 'P = GetCurvePoint<PC>': this is default value and doesn't constrain anything\n// * we can't do 'type X = GetCurvePoint<PC>': it won't be accesible for arguments/return types\n// * `CurvePointCons<P extends CurvePoint<any, P>>` constraints from interface definition\n// won't propagate, if `PC extends CurvePointCons<any>`: the P would be 'any', which is incorrect\n// * PC could be super specific with super specific P, which implements CurvePoint<any, P>.\n// this means we need to do stuff like\n// `function test<P extends CurvePoint<any, P>, PC extends CurvePointCons<P>>(`\n// if we want type safety around P, otherwise PC_P<PC> will be any\n\n/** Returns Fp type from Point (P_F<P> == P.F) */\nexport type P_F<P extends CurvePoint<any, P>> = P extends CurvePoint<infer F, P> ? F : never;\n/** Returns Fp type from PointCons (PC_F<PC> == PC.P.F) */\nexport type PC_F<PC extends CurvePointCons<CurvePoint<any, any>>> = PC['Fp']['ZERO'];\n/** Returns Point type from PointCons (PC_P<PC> == PC.P) */\nexport type PC_P<PC extends CurvePointCons<CurvePoint<any, any>>> = PC['ZERO'];\n\n// Ugly hack to get proper type inference, because in typescript fails to infer resursively.\n// The hack allows to do up to 10 chained operations without applying type erasure.\n//\n// Types which won't work:\n// * `CurvePointCons<CurvePoint<any, any>>`, will return `any` after 1 operation\n// * `CurvePointCons<any>: WeierstrassPointCons<bigint> extends CurvePointCons<any> = false`\n// * `P extends CurvePoint, PC extends CurvePointCons<P>`\n// * It can't infer P from PC alone\n// * Too many relations between F, P & PC\n// * It will infer P/F if `arg: CurvePointCons<F, P>`, but will fail if PC is generic\n// * It will work correctly if there is an additional argument of type P\n// * But generally, we don't want to parametrize `CurvePointCons` over `F`: it will complicate\n// types, making them un-inferable\n// prettier-ignore\nexport type PC_ANY = CurvePointCons<\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any,\n CurvePoint<any, any>\n >>>>>>>>>\n>;\n\nexport interface CurveLengths {\n secretKey?: number;\n publicKey?: number;\n publicKeyUncompressed?: number;\n publicKeyHasPrefix?: boolean;\n signature?: number;\n seed?: number;\n}\nexport type GroupConstructor<T> = {\n BASE: T;\n ZERO: T;\n};\n/** @deprecated */\nexport type ExtendedGroupConstructor<T> = GroupConstructor<T> & {\n Fp: IField<any>;\n Fn: IField<bigint>;\n fromAffine(ap: AffinePoint<any>): T;\n};\nexport type Mapper<T> = (i: T[]) => T[];\n\nexport function negateCt<T extends { negate: () => T }>(condition: boolean, item: T): T {\n const neg = item.negate();\n return condition ? neg : item;\n}\n\n/**\n * Takes a bunch of Projective Points but executes only one\n * inversion on all of them. Inversion is very slow operation,\n * so this improves performance massively.\n * Optimization: converts a list of projective points to a list of identical points with Z=1.\n */\nexport function normalizeZ<P extends CurvePoint<any, P>, PC extends CurvePointCons<P>>(\n c: PC,\n points: P[]\n): P[] {\n const invertedZs = FpInvertBatch(\n c.Fp,\n points.map((p) => p.Z!)\n );\n return points.map((p, i) => c.fromAffine(p.toAffine(invertedZs[i])));\n}\n\nfunction validateW(W: number, bits: number) {\n if (!Number.isSafeInteger(W) || W <= 0 || W > bits)\n throw new Error('invalid window size, expected [1..' + bits + '], got W=' + W);\n}\n\n/** Internal wNAF opts for specific W and scalarBits */\nexport type WOpts = {\n windows: number;\n windowSize: number;\n mask: bigint;\n maxNumber: number;\n shiftBy: bigint;\n};\n\nfunction calcWOpts(W: number, scalarBits: number): WOpts {\n validateW(W, scalarBits);\n const windows = Math.ceil(scalarBits / W) + 1; // W=8 33. Not 32, because we skip zero\n const windowSize = 2 ** (W - 1); // W=8 128. Not 256, because we skip zero\n const maxNumber = 2 ** W; // W=8 256\n const mask = bitMask(W); // W=8 255 == mask 0b11111111\n const shiftBy = BigInt(W); // W=8 8\n return { windows, windowSize, mask, maxNumber, shiftBy };\n}\n\nfunction calcOffsets(n: bigint, window: number, wOpts: WOpts) {\n const { windowSize, mask, maxNumber, shiftBy } = wOpts;\n let wbits = Number(n & mask); // extract W bits.\n let nextN = n >> shiftBy; // shift number by W bits.\n\n // What actually happens here:\n // const highestBit = Number(mask ^ (mask >> 1n));\n // let wbits2 = wbits - 1; // skip zero\n // if (wbits2 & highestBit) { wbits2 ^= Number(mask); // (~);\n\n // split if bits > max: +224 => 256-32\n if (wbits > windowSize) {\n // we skip zero, which means instead of `>= size-1`, we do `> size`\n wbits -= maxNumber; // -32, can be maxNumber - wbits, but then we need to set isNeg here.\n nextN += _1n; // +256 (carry)\n }\n const offsetStart = window * windowSize;\n const offset = offsetStart + Math.abs(wbits) - 1; // -1 because we skip zero\n const isZero = wbits === 0; // is current window slice a 0?\n const isNeg = wbits < 0; // is current window slice negative?\n const isNegF = window % 2 !== 0; // fake random statement for noise\n const offsetF = offsetStart; // fake offset for noise\n return { nextN, offset, isZero, isNeg, isNegF, offsetF };\n}\n\nfunction validateMSMPoints(points: any[], c: any) {\n if (!Array.isArray(points)) throw new Error('array expected');\n points.forEach((p, i) => {\n if (!(p instanceof c)) throw new Error('invalid point at index ' + i);\n });\n}\nfunction validateMSMScalars(scalars: any[], field: any) {\n if (!Array.isArray(scalars)) throw new Error('array of scalars expected');\n scalars.forEach((s, i) => {\n if (!field.isValid(s)) throw new Error('invalid scalar at index ' + i);\n });\n}\n\n// Since points in different groups cannot be equal (different object constructor),\n// we can have single place to store precomputes.\n// Allows to make points frozen / immutable.\nconst pointPrecomputes = new WeakMap<any, any[]>();\nconst pointWindowSizes = new WeakMap<any, number>();\n\nfunction getW(P: any): number {\n // To disable precomputes:\n // return 1;\n return pointWindowSizes.get(P) || 1;\n}\n\nfunction assert0(n: bigint): void {\n if (n !== _0n) throw new Error('invalid wNAF');\n}\n\n/**\n * Elliptic curve multiplication of Point by scalar. Fragile.\n * Table generation takes **30MB of ram and 10ms on high-end CPU**,\n * but may take much longer on slow devices. Actual generation will happen on\n * first call of `multiply()`. By default, `BASE` point is precomputed.\n *\n * Scalars should always be less than curve order: this should be checked inside of a curve itself.\n * Creates precomputation tables for fast multiplication:\n * - private scalar is split by fixed size windows of W bits\n * - every window point is collected from window's table & added to accumulator\n * - since windows are different, same point inside tables won't be accessed more than once per calc\n * - each multiplication is 'Math.ceil(CURVE_ORDER / \uD835\uDC4A) + 1' point additions (fixed for any scalar)\n * - +1 window is neccessary for wNAF\n * - wNAF reduces table size: 2x less memory + 2x faster generation, but 10% slower multiplication\n *\n * @todo Research returning 2d JS array of windows, instead of a single window.\n * This would allow windows to be in different memory locations\n */\nexport class wNAF<PC extends PC_ANY> {\n private readonly BASE: PC_P<PC>;\n private readonly ZERO: PC_P<PC>;\n private readonly Fn: PC['Fn'];\n readonly bits: number;\n\n // Parametrized with a given Point class (not individual point)\n constructor(Point: PC, bits: number) {\n this.BASE = Point.BASE;\n this.ZERO = Point.ZERO;\n this.Fn = Point.Fn;\n this.bits = bits;\n }\n\n // non-const time multiplication ladder\n _unsafeLadder(elm: PC_P<PC>, n: bigint, p: PC_P<PC> = this.ZERO): PC_P<PC> {\n let d: PC_P<PC> = elm;\n while (n > _0n) {\n if (n & _1n) p = p.add(d);\n d = d.double();\n n >>= _1n;\n }\n return p;\n }\n\n /**\n * Creates a wNAF precomputation window. Used for caching.\n * Default window size is set by `utils.precompute()` and is equal to 8.\n * Number of precomputed points depends on the curve size:\n * 2^(\uD835\uDC4A\u22121) * (Math.ceil(\uD835\uDC5B / \uD835\uDC4A) + 1), where:\n * - \uD835\uDC4A is the window size\n * - \uD835\uDC5B is the bitlength of the curve order.\n * For a 256-bit curve and window size 8, the number of precomputed points is 128 * 33 = 4224.\n * @param point Point instance\n * @param W window size\n * @returns precomputed point tables flattened to a single array\n */\n private precomputeWindow(point: PC_P<PC>, W: number): PC_P<PC>[] {\n const { windows, windowSize } = calcWOpts(W, this.bits);\n const points: PC_P<PC>[] = [];\n let p: PC_P<PC> = point;\n let base = p;\n for (let window = 0; window < windows; window++) {\n base = p;\n points.push(base);\n // i=1, bc we skip 0\n for (let i = 1; i < windowSize; i++) {\n base = base.add(p);\n points.push(base);\n }\n p = base.double();\n }\n return points;\n }\n\n /**\n * Implements ec multiplication using precomputed tables and w-ary non-adjacent form.\n * More compact implementation:\n * https://github.com/paulmillr/noble-secp256k1/blob/47cb1669b6e506ad66b35fe7d76132ae97465da2/index.ts#L502-L541\n * @returns real and fake (for const-time) points\n */\n private wNAF(W: number, precomputes: PC_P<PC>[], n: bigint): { p: PC_P<PC>; f: PC_P<PC> } {\n // Scalar should be smaller than field order\n if (!this.Fn.isValid(n)) throw new Error('invalid scalar');\n // Accumulators\n let p = this.ZERO;\n let f = this.BASE;\n // This code was first written with assumption that 'f' and 'p' will never be infinity point:\n // since each addition is multiplied by 2 ** W, it cannot cancel each other. However,\n // there is negate now: it is possible that negated element from low value\n // would be the same as high element, which will create carry into next window.\n // It's not obvious how this can fail, but still worth investigating later.\n const wo = calcWOpts(W, this.bits);\n for (let window = 0; window < wo.windows; window++) {\n // (n === _0n) is handled and not early-exited. isEven and offsetF are used for noise\n const { nextN, offset, isZero, isNeg, isNegF, offsetF } = calcOffsets(n, window, wo);\n n = nextN;\n if (isZero) {\n // bits are 0: add garbage to fake point\n // Important part for const-time getPublicKey: add random \"noise\" point to f.\n f = f.add(negateCt(isNegF, precomputes[offsetF]));\n } else {\n // bits are 1: add to result point\n p = p.add(negateCt(isNeg, precomputes[offset]));\n }\n }\n assert0(n);\n // Return both real and fake points: JIT won't eliminate f.\n // At this point there is a way to F be infinity-point even if p is not,\n // which makes it less const-time: around 1 bigint multiply.\n return { p, f };\n }\n\n /**\n * Implements ec unsafe (non const-time) multiplication using precomputed tables and w-ary non-adjacent form.\n * @param acc accumulator point to add result of multiplication\n * @returns point\n */\n private wNAFUnsafe(\n W: number,\n precomputes: PC_P<PC>[],\n n: bigint,\n acc: PC_P<PC> = this.ZERO\n ): PC_P<PC> {\n const wo = calcWOpts(W, this.bits);\n for (let window = 0; window < wo.windows; window++) {\n if (n === _0n) break; // Early-exit, skip 0 value\n const { nextN, offset, isZero, isNeg } = calcOffsets(n, window, wo);\n n = nextN;\n if (isZero) {\n // Window bits are 0: skip processing.\n // Move to next window.\n continue;\n } else {\n const item = precomputes[offset];\n acc = acc.add(isNeg ? item.negate() : item); // Re-using acc allows to save adds in MSM\n }\n }\n assert0(n);\n return acc;\n }\n\n private getPrecomputes(W: number, point: PC_P<PC>, transform?: Mapper<PC_P<PC>>): PC_P<PC>[] {\n // Calculate precomputes on a first run, reuse them after\n let comp = pointPrecomputes.get(point);\n if (!comp) {\n comp = this.precomputeWindow(point, W) as PC_P<PC>[];\n if (W !== 1) {\n // Doing transform outside of if brings 15% perf hit\n if (typeof transform === 'function') comp = transform(comp);\n pointPrecomputes.set(point, comp);\n }\n }\n return comp;\n }\n\n cached(\n point: PC_P<PC>,\n scalar: bigint,\n transform?: Mapper<PC_P<PC>>\n ): { p: PC_P<PC>; f: PC_P<PC> } {\n const W = getW(point);\n return this.wNAF(W, this.getPrecomputes(W, point, transform), scalar);\n }\n\n unsafe(point: PC_P<PC>, scalar: bigint, transform?: Mapper<PC_P<PC>>, prev?: PC_P<PC>): PC_P<PC> {\n const W = getW(point);\n if (W === 1) return this._unsafeLadder(point, scalar, prev); // For W=1 ladder is ~x2 faster\n return this.wNAFUnsafe(W, this.getPrecomputes(W, point, transform), scalar, prev);\n }\n\n // We calculate precomputes for elliptic curve point multiplication\n // using windowed method. This specifies window size and\n // stores precomputed values. Usually only base point would be precomputed.\n createCache(P: PC_P<PC>, W: number): void {\n validateW(W, this.bits);\n pointWindowSizes.set(P, W);\n pointPrecomputes.delete(P);\n }\n\n hasCache(elm: PC_P<PC>): boolean {\n return getW(elm) !== 1;\n }\n}\n\n/**\n * Endomorphism-specific multiplication for Koblitz curves.\n * Cost: 128 dbl, 0-256 adds.\n */\nexport function mulEndoUnsafe<P extends CurvePoint<any, P>, PC extends CurvePointCons<P>>(\n Point: PC,\n point: P,\n k1: bigint,\n k2: bigint\n): { p1: P; p2: P } {\n let acc = point;\n let p1 = Point.ZERO;\n let p2 = Point.ZERO;\n while (k1 > _0n || k2 > _0n) {\n if (k1 & _1n) p1 = p1.add(acc);\n if (k2 & _1n) p2 = p2.add(acc);\n acc = acc.double();\n k1 >>= _1n;\n k2 >>= _1n;\n }\n return { p1, p2 };\n}\n\n/**\n * Pippenger algorithm for multi-scalar multiplication (MSM, Pa + Qb + Rc + ...).\n * 30x faster vs naive addition on L=4096, 10x faster than precomputes.\n * For N=254bit, L=1, it does: 1024 ADD + 254 DBL. For L=5: 1536 ADD + 254 DBL.\n * Algorithmically constant-time (for same L), even when 1 point + scalar, or when scalar = 0.\n * @param c Curve Point constructor\n * @param fieldN field over CURVE.N - important that it's not over CURVE.P\n * @param points array of L curve points\n * @param scalars array of L scalars (aka secret keys / bigints)\n */\nexport function pippenger<P extends CurvePoint<any, P>, PC extends CurvePointCons<P>>(\n c: PC,\n fieldN: IField<bigint>,\n points: P[],\n scalars: bigint[]\n): P {\n // If we split scalars by some window (let's say 8 bits), every chunk will only\n // take 256 buckets even if there are 4096 scalars, also re-uses double.\n // TODO:\n // - https://eprint.iacr.org/2024/750.pdf\n // - https://tches.iacr.org/index.php/TCHES/article/view/10287\n // 0 is accepted in scalars\n validateMSMPoints(points, c);\n validateMSMScalars(scalars, fieldN);\n const plength = points.length;\n const slength = scalars.length;\n if (plength !== slength) throw new Error('arrays of points and scalars must have equal length');\n // if (plength === 0) throw new Error('array must be of length >= 2');\n const zero = c.ZERO;\n const wbits = bitLen(BigInt(plength));\n let windowSize = 1; // bits\n if (wbits > 12) windowSize = wbits - 3;\n else if (wbits > 4) windowSize = wbits - 2;\n else if (wbits > 0) windowSize = 2;\n const MASK = bitMask(windowSize);\n const buckets = new Array(Number(MASK) + 1).fill(zero); // +1 for zero array\n const lastBits = Math.floor((fieldN.BITS - 1) / windowSize) * windowSize;\n let sum = zero;\n for (let i = lastBits; i >= 0; i -= windowSize) {\n buckets.fill(zero);\n for (let j = 0; j < slength; j++) {\n const scalar = scalars[j];\n const wbits = Number((scalar >> BigInt(i)) & MASK);\n buckets[wbits] = buckets[wbits].add(points[j]);\n }\n let resI = zero; // not using this will do small speed-up, but will lose ct\n // Skip first bucket, because it is zero\n for (let j = buckets.length - 1, sumI = zero; j > 0; j--) {\n sumI = sumI.add(buckets[j]);\n resI = resI.add(sumI);\n }\n sum = sum.add(resI);\n if (i !== 0) for (let j = 0; j < windowSize; j++) sum = sum.double();\n }\n return sum as P;\n}\n/**\n * Precomputed multi-scalar multiplication (MSM, Pa + Qb + Rc + ...).\n * @param c Curve Point constructor\n * @param fieldN field over CURVE.N - important that it's not over CURVE.P\n * @param points array of L curve points\n * @returns function which multiplies points with scaars\n */\nexport function precomputeMSMUnsafe<P extends CurvePoint<any, P>, PC extends CurvePointCons<P>>(\n c: PC,\n fieldN: IField<bigint>,\n points: P[],\n windowSize: number\n): (scalars: bigint[]) => P {\n /**\n * Performance Analysis of Window-based Precomputation\n *\n * Base Case (256-bit scalar, 8-bit window):\n * - Standard precomputation requires:\n * - 31 additions per scalar \u00D7 256 scalars = 7,936 ops\n * - Plus 255 summary additions = 8,191 total ops\n * Note: Summary additions can be optimized via accumulator\n *\n * Chunked Precomputation Analysis:\n * - Using 32 chunks requires:\n * - 255 additions per chunk\n * - 256 doublings\n * - Total: (255 \u00D7 32) + 256 = 8,416 ops\n *\n * Memory Usage Comparison:\n * Window Size | Standard Points | Chunked Points\n * ------------|-----------------|---------------\n * 4-bit | 520 | 15\n * 8-bit | 4,224 | 255\n * 10-bit | 13,824 | 1,023\n * 16-bit | 557,056 | 65,535\n *\n * Key Advantages:\n * 1. Enables larger window sizes due to reduced memory overhead\n * 2. More efficient for smaller scalar counts:\n * - 16 chunks: (16 \u00D7 255) + 256 = 4,336 ops\n * - ~2x faster than standard 8,191 ops\n *\n * Limitations:\n * - Not suitable for plain precomputes (requires 256 constant doublings)\n * - Performance degrades with larger scalar counts:\n * - Optimal for ~256 scalars\n * - Less efficient for 4096+ scalars (Pippenger preferred)\n */\n validateW(windowSize, fieldN.BITS);\n validateMSMPoints(points, c);\n const zero = c.ZERO;\n const tableSize = 2 ** windowSize - 1; // table size (without zero)\n const chunks = Math.ceil(fieldN.BITS / windowSize); // chunks of item\n const MASK = bitMask(windowSize);\n const tables = points.map((p: P) => {\n const res = [];\n for (let i = 0, acc = p; i < tableSize; i++) {\n res.push(acc);\n acc = acc.add(p);\n }\n return res;\n });\n return (scalars: bigint[]): P => {\n validateMSMScalars(scalars, fieldN);\n if (scalars.length > points.length)\n throw new Error('array of scalars must be smaller than array of points');\n let res = zero;\n for (let i = 0; i < chunks; i++) {\n // No need to double if accumulator is still zero.\n if (res !== zero) for (let j = 0; j < windowSize; j++) res = res.double();\n const shiftBy = BigInt(chunks * windowSize - (i + 1) * windowSize);\n for (let j = 0; j < scalars.length; j++) {\n const n = scalars[j];\n const curr = Number((n >> shiftBy) & MASK);\n if (!curr) continue; // skip zero scalars chunks\n res = res.add(tables[j][curr - 1]);\n }\n }\n return res;\n };\n}\n\n// TODO: remove\n/**\n * Generic BasicCurve interface: works even for polynomial fields (BLS): P, n, h would be ok.\n * Though generator can be different (Fp2 / Fp6 for BLS).\n */\nexport type BasicCurve<T> = {\n Fp: IField<T>; // Field over which we'll do calculations (Fp)\n n: bigint; // Curve order, total count of valid points in the field\n nBitLength?: number; // bit length of curve order\n nByteLength?: number; // byte length of curve order\n h: bigint; // cofactor. we can assign default=1, but users will just ignore it w/o validation\n hEff?: bigint; // Number to multiply to clear cofactor\n Gx: T; // base point X coordinate\n Gy: T; // base point Y coordinate\n allowInfinityPoint?: boolean; // bls12-381 requires it. ZERO point is valid, but invalid pubkey\n};\n\n// TODO: remove\n/** @deprecated */\nexport function validateBasic<FP, T>(\n curve: BasicCurve<FP> & T\n): Readonly<\n {\n readonly nBitLength: number;\n readonly nByteLength: number;\n } & BasicCurve<FP> &\n T & {\n p: bigint;\n }\n> {\n validateField(curve.Fp);\n validateObject(\n curve,\n {\n n: 'bigint',\n h: 'bigint',\n Gx: 'field',\n Gy: 'field',\n },\n {\n nBitLength: 'isSafeInteger',\n nByteLength: 'isSafeInteger',\n }\n );\n // Set defaults\n return Object.freeze({\n ...nLength(curve.n, curve.nBitLength),\n ...curve,\n ...{ p: curve.Fp.ORDER },\n } as const);\n}\n\nexport type ValidCurveParams<T> = {\n p: bigint;\n n: bigint;\n h: bigint;\n a: T;\n b?: T;\n d?: T;\n Gx: T;\n Gy: T;\n};\n\nfunction createField<T>(order: bigint, field?: IField<T>, isLE?: boolean): IField<T> {\n if (field) {\n if (field.ORDER !== order) throw new Error('Field.ORDER must match order: Fp == p, Fn == n');\n validateField(field);\n return field;\n } else {\n return Field(order, { isLE }) as unknown as IField<T>;\n }\n}\nexport type FpFn<T> = { Fp: IField<T>; Fn: IField<bigint> };\n\n/** Validates CURVE opts and creates fields */\nexport function _createCurveFields<T>(\n type: 'weierstrass' | 'edwards',\n CURVE: ValidCurveParams<T>,\n curveOpts: Partial<FpFn<T>> = {},\n FpFnLE?: boolean\n): FpFn<T> & { CURVE: ValidCurveParams<T> } {\n if (FpFnLE === undefined) FpFnLE = type === 'edwards';\n if (!CURVE || typeof CURVE !== 'object') throw new Error(`expected valid ${type} CURVE object`);\n for (const p of ['p', 'n', 'h'] as const) {\n const val = CURVE[p];\n if (!(typeof val === 'bigint' && val > _0n))\n throw new Error(`CURVE.${p} must be positive bigint`);\n }\n const Fp = createField(CURVE.p, curveOpts.Fp, FpFnLE);\n const Fn = createField(CURVE.n, curveOpts.Fn, FpFnLE);\n const _b: 'b' | 'd' = type === 'weierstrass' ? 'b' : 'd';\n const params = ['Gx', 'Gy', 'a', _b] as const;\n for (const p of params) {\n // @ts-ignore\n if (!Fp.isValid(CURVE[p]))\n throw new Error(`CURVE.${p} must be valid field element of CURVE.Fp`);\n }\n CURVE = Object.freeze(Object.assign({}, CURVE));\n return { CURVE, Fp, Fn };\n}\n", "/**\n * Short Weierstrass curve methods. The formula is: y\u00B2 = x\u00B3 + ax + b.\n *\n * ### Design rationale for types\n *\n * * Interaction between classes from different curves should fail:\n * `k256.Point.BASE.add(p256.Point.BASE)`\n * * For this purpose we want to use `instanceof` operator, which is fast and works during runtime\n * * Different calls of `curve()` would return different classes -\n * `curve(params) !== curve(params)`: if somebody decided to monkey-patch their curve,\n * it won't affect others\n *\n * TypeScript can't infer types for classes created inside a function. Classes is one instance\n * of nominative types in TypeScript and interfaces only check for shape, so it's hard to create\n * unique type for every function call.\n *\n * We can use generic types via some param, like curve opts, but that would:\n * 1. Enable interaction between `curve(params)` and `curve(params)` (curves of same params)\n * which is hard to debug.\n * 2. Params can be generic and we can't enforce them to be constant value:\n * if somebody creates curve from non-constant params,\n * it would be allowed to interact with other curves with non-constant params\n *\n * @todo https://www.typescriptlang.org/docs/handbook/release-notes/typescript-2-7.html#unique-symbol\n * @module\n */\n/*! noble-curves - MIT License (c) 2022 Paul Miller (paulmillr.com) */\nimport { hmac as nobleHmac } from '@noble/hashes/hmac.js';\nimport { ahash } from '@noble/hashes/utils';\nimport {\n _validateObject,\n _abool2 as abool,\n _abytes2 as abytes,\n aInRange,\n bitLen,\n bitMask,\n bytesToHex,\n bytesToNumberBE,\n concatBytes,\n createHmacDrbg,\n ensureBytes,\n hexToBytes,\n inRange,\n isBytes,\n memoized,\n numberToHexUnpadded,\n randomBytes as randomBytesWeb,\n type CHash,\n type Hex,\n type PrivKey,\n} from '../utils.ts';\nimport {\n _createCurveFields,\n mulEndoUnsafe,\n negateCt,\n normalizeZ,\n pippenger,\n wNAF,\n type AffinePoint,\n type BasicCurve,\n type CurveLengths,\n type CurvePoint,\n type CurvePointCons,\n} from './curve.ts';\nimport {\n Field,\n FpInvertBatch,\n getMinHashLength,\n mapHashToField,\n nLength,\n validateField,\n type IField,\n type NLength,\n} from './modular.ts';\n\nexport type { AffinePoint };\nexport type HmacFnSync = (key: Uint8Array, ...messages: Uint8Array[]) => Uint8Array;\n\ntype EndoBasis = [[bigint, bigint], [bigint, bigint]];\n/**\n * When Weierstrass curve has `a=0`, it becomes Koblitz curve.\n * Koblitz curves allow using **efficiently-computable GLV endomorphism \u03C8**.\n * Endomorphism uses 2x less RAM, speeds up precomputation by 2x and ECDH / key recovery by 20%.\n * For precomputed wNAF it trades off 1/2 init time & 1/3 ram for 20% perf hit.\n *\n * Endomorphism consists of beta, lambda and splitScalar:\n *\n * 1. GLV endomorphism \u03C8 transforms a point: `P = (x, y) \u21A6 \u03C8(P) = (\u03B2\u00B7x mod p, y)`\n * 2. GLV scalar decomposition transforms a scalar: `k \u2261 k\u2081 + k\u2082\u00B7\u03BB (mod n)`\n * 3. Then these are combined: `k\u00B7P = k\u2081\u00B7P + k\u2082\u00B7\u03C8(P)`\n * 4. Two 128-bit point-by-scalar multiplications + one point addition is faster than\n * one 256-bit multiplication.\n *\n * where\n * * beta: \u03B2 \u2208 F\u209A with \u03B2\u00B3 = 1, \u03B2 \u2260 1\n * * lambda: \u03BB \u2208 F\u2099 with \u03BB\u00B3 = 1, \u03BB \u2260 1\n * * splitScalar decomposes k \u21A6 k\u2081, k\u2082, by using reduced basis vectors.\n * Gauss lattice reduction calculates them from initial basis vectors `(n, 0), (-\u03BB, 0)`\n *\n * Check out `test/misc/endomorphism.js` and\n * [gist](https://gist.github.com/paulmillr/eb670806793e84df628a7c434a873066).\n */\nexport type EndomorphismOpts = {\n beta: bigint;\n basises?: EndoBasis;\n splitScalar?: (k: bigint) => { k1neg: boolean; k1: bigint; k2neg: boolean; k2: bigint };\n};\n\n// We construct basis in such way that den is always positive and equals n, but num sign depends on basis (not on secret value)\nconst divNearest = (num: bigint, den: bigint) => (num + (num >= 0 ? den : -den) / _2n) / den;\n\nexport type ScalarEndoParts = { k1neg: boolean; k1: bigint; k2neg: boolean; k2: bigint };\n\n/**\n * Splits scalar for GLV endomorphism.\n */\nexport function _splitEndoScalar(k: bigint, basis: EndoBasis, n: bigint): ScalarEndoParts {\n // Split scalar into two such that part is ~half bits: `abs(part) < sqrt(N)`\n // Since part can be negative, we need to do this on point.\n // TODO: verifyScalar function which consumes lambda\n const [[a1, b1], [a2, b2]] = basis;\n const c1 = divNearest(b2 * k, n);\n const c2 = divNearest(-b1 * k, n);\n // |k1|/|k2| is < sqrt(N), but can be negative.\n // If we do `k1 mod N`, we'll get big scalar (`> sqrt(N)`): so, we do cheaper negation instead.\n let k1 = k - c1 * a1 - c2 * a2;\n let k2 = -c1 * b1 - c2 * b2;\n const k1neg = k1 < _0n;\n const k2neg = k2 < _0n;\n if (k1neg) k1 = -k1;\n if (k2neg) k2 = -k2;\n // Double check that resulting scalar less than half bits of N: otherwise wNAF will fail.\n // This should only happen on wrong basises. Also, math inside is too complex and I don't trust it.\n const MAX_NUM = bitMask(Math.ceil(bitLen(n) / 2)) + _1n; // Half bits of N\n if (k1 < _0n || k1 >= MAX_NUM || k2 < _0n || k2 >= MAX_NUM) {\n throw new Error('splitScalar (endomorphism): failed, k=' + k);\n }\n return { k1neg, k1, k2neg, k2 };\n}\n\nexport type ECDSASigFormat = 'compact' | 'recovered' | 'der';\nexport type ECDSARecoverOpts = {\n prehash?: boolean;\n};\nexport type ECDSAVerifyOpts = {\n prehash?: boolean;\n lowS?: boolean;\n format?: ECDSASigFormat;\n};\nexport type ECDSASignOpts = {\n prehash?: boolean;\n lowS?: boolean;\n format?: ECDSASigFormat;\n extraEntropy?: Uint8Array | boolean;\n};\n\nfunction validateSigFormat(format: string): ECDSASigFormat {\n if (!['compact', 'recovered', 'der'].includes(format))\n throw new Error('Signature format must be \"compact\", \"recovered\", or \"der\"');\n return format as ECDSASigFormat;\n}\n\nfunction validateSigOpts<T extends ECDSASignOpts, D extends Required<ECDSASignOpts>>(\n opts: T,\n def: D\n): Required<ECDSASignOpts> {\n const optsn: ECDSASignOpts = {};\n for (let optName of Object.keys(def)) {\n // @ts-ignore\n optsn[optName] = opts[optName] === undefined ? def[optName] : opts[optName];\n }\n abool(optsn.lowS!, 'lowS');\n abool(optsn.prehash!, 'prehash');\n if (optsn.format !== undefined) validateSigFormat(optsn.format);\n return optsn as Required<ECDSASignOpts>;\n}\n\n/** Instance methods for 3D XYZ projective points. */\nexport interface WeierstrassPoint<T> extends CurvePoint<T, WeierstrassPoint<T>> {\n /** projective X coordinate. Different from affine x. */\n readonly X: T;\n /** projective Y coordinate. Different from affine y. */\n readonly Y: T;\n /** projective z coordinate */\n readonly Z: T;\n /** affine x coordinate. Different from projective X. */\n get x(): T;\n /** affine y coordinate. Different from projective Y. */\n get y(): T;\n /** Encodes point using IEEE P1363 (DER) encoding. First byte is 2/3/4. Default = isCompressed. */\n toBytes(isCompressed?: boolean): Uint8Array;\n toHex(isCompressed?: boolean): string;\n\n /** @deprecated use `.X` */\n readonly px: T;\n /** @deprecated use `.Y` */\n readonly py: T;\n /** @deprecated use `.Z` */\n readonly pz: T;\n /** @deprecated use `toBytes` */\n toRawBytes(isCompressed?: boolean): Uint8Array;\n /** @deprecated use `multiplyUnsafe` */\n multiplyAndAddUnsafe(\n Q: WeierstrassPoint<T>,\n a: bigint,\n b: bigint\n ): WeierstrassPoint<T> | undefined;\n /** @deprecated use `p.y % 2n === 0n` */\n hasEvenY(): boolean;\n /** @deprecated use `p.precompute(windowSize)` */\n _setWindowSize(windowSize: number): void;\n}\n\n/** Static methods for 3D XYZ projective points. */\nexport interface WeierstrassPointCons<T> extends CurvePointCons<WeierstrassPoint<T>> {\n /** Does NOT validate if the point is valid. Use `.assertValidity()`. */\n new (X: T, Y: T, Z: T): WeierstrassPoint<T>;\n CURVE(): WeierstrassOpts<T>;\n /** @deprecated use `Point.BASE.multiply(Point.Fn.fromBytes(privateKey))` */\n fromPrivateKey(privateKey: PrivKey): WeierstrassPoint<T>;\n /** @deprecated use `import { normalizeZ } from '@noble/curves/abstract/curve.js';` */\n normalizeZ(points: WeierstrassPoint<T>[]): WeierstrassPoint<T>[];\n /** @deprecated use `import { pippenger } from '@noble/curves/abstract/curve.js';` */\n msm(points: WeierstrassPoint<T>[], scalars: bigint[]): WeierstrassPoint<T>;\n}\n\n/**\n * Weierstrass curve options.\n *\n * * p: prime characteristic (order) of finite field, in which arithmetics is done\n * * n: order of prime subgroup a.k.a total amount of valid curve points\n * * h: cofactor, usually 1. h*n is group order; n is subgroup order\n * * a: formula param, must be in field of p\n * * b: formula param, must be in field of p\n * * Gx: x coordinate of generator point a.k.a. base point\n * * Gy: y coordinate of generator point\n */\nexport type WeierstrassOpts<T> = Readonly<{\n p: bigint;\n n: bigint;\n h: bigint;\n a: T;\n b: T;\n Gx: T;\n Gy: T;\n}>;\n\n// When a cofactor != 1, there can be an effective methods to:\n// 1. Determine whether a point is torsion-free\n// 2. Clear torsion component\n// wrapPrivateKey: bls12-381 requires mod(n) instead of rejecting keys >= n\nexport type WeierstrassExtraOpts<T> = Partial<{\n Fp: IField<T>;\n Fn: IField<bigint>;\n allowInfinityPoint: boolean;\n endo: EndomorphismOpts;\n isTorsionFree: (c: WeierstrassPointCons<T>, point: WeierstrassPoint<T>) => boolean;\n clearCofactor: (c: WeierstrassPointCons<T>, point: WeierstrassPoint<T>) => WeierstrassPoint<T>;\n fromBytes: (bytes: Uint8Array) => AffinePoint<T>;\n toBytes: (\n c: WeierstrassPointCons<T>,\n point: WeierstrassPoint<T>,\n isCompressed: boolean\n ) => Uint8Array;\n}>;\n\n/**\n * Options for ECDSA signatures over a Weierstrass curve.\n *\n * * lowS: (default: true) whether produced / verified signatures occupy low half of ecdsaOpts.p. Prevents malleability.\n * * hmac: (default: noble-hashes hmac) function, would be used to init hmac-drbg for k generation.\n * * randomBytes: (default: webcrypto os-level CSPRNG) custom method for fetching secure randomness.\n * * bits2int, bits2int_modN: used in sigs, sometimes overridden by curves\n */\nexport type ECDSAOpts = Partial<{\n lowS: boolean;\n hmac: HmacFnSync;\n randomBytes: (bytesLength?: number) => Uint8Array;\n bits2int: (bytes: Uint8Array) => bigint;\n bits2int_modN: (bytes: Uint8Array) => bigint;\n}>;\n\n/**\n * Elliptic Curve Diffie-Hellman interface.\n * Provides keygen, secret-to-public conversion, calculating shared secrets.\n */\nexport interface ECDH {\n keygen: (seed?: Uint8Array) => { secretKey: Uint8Array; publicKey: Uint8Array };\n getPublicKey: (secretKey: PrivKey, isCompressed?: boolean) => Uint8Array;\n getSharedSecret: (secretKeyA: PrivKey, publicKeyB: Hex, isCompressed?: boolean) => Uint8Array;\n Point: WeierstrassPointCons<bigint>;\n utils: {\n isValidSecretKey: (secretKey: PrivKey) => boolean;\n isValidPublicKey: (publicKey: Uint8Array, isCompressed?: boolean) => boolean;\n randomSecretKey: (seed?: Uint8Array) => Uint8Array;\n /** @deprecated use `randomSecretKey` */\n randomPrivateKey: (seed?: Uint8Array) => Uint8Array;\n /** @deprecated use `isValidSecretKey` */\n isValidPrivateKey: (secretKey: PrivKey) => boolean;\n /** @deprecated use `Point.Fn.fromBytes()` */\n normPrivateKeyToScalar: (key: PrivKey) => bigint;\n /** @deprecated use `point.precompute()` */\n precompute: (windowSize?: number, point?: WeierstrassPoint<bigint>) => WeierstrassPoint<bigint>;\n };\n lengths: CurveLengths;\n}\n\n/**\n * ECDSA interface.\n * Only supported for prime fields, not Fp2 (extension fields).\n */\nexport interface ECDSA extends ECDH {\n sign: (message: Hex, secretKey: PrivKey, opts?: ECDSASignOpts) => ECDSASigRecovered;\n verify: (\n signature: Uint8Array,\n message: Uint8Array,\n publicKey: Uint8Array,\n opts?: ECDSAVerifyOpts\n ) => boolean;\n recoverPublicKey(signature: Uint8Array, message: Uint8Array, opts?: ECDSARecoverOpts): Uint8Array;\n Signature: ECDSASignatureCons;\n}\nexport class DERErr extends Error {\n constructor(m = '') {\n super(m);\n }\n}\nexport type IDER = {\n // asn.1 DER encoding utils\n Err: typeof DERErr;\n // Basic building block is TLV (Tag-Length-Value)\n _tlv: {\n encode: (tag: number, data: string) => string;\n // v - value, l - left bytes (unparsed)\n decode(tag: number, data: Uint8Array): { v: Uint8Array; l: Uint8Array };\n };\n // https://crypto.stackexchange.com/a/57734 Leftmost bit of first byte is 'negative' flag,\n // since we always use positive integers here. It must always be empty:\n // - add zero byte if exists\n // - if next byte doesn't have a flag, leading zero is not allowed (minimal encoding)\n _int: {\n encode(num: bigint): string;\n decode(data: Uint8Array): bigint;\n };\n toSig(hex: string | Uint8Array): { r: bigint; s: bigint };\n hexFromSig(sig: { r: bigint; s: bigint }): string;\n};\n/**\n * ASN.1 DER encoding utilities. ASN is very complex & fragile. Format:\n *\n * [0x30 (SEQUENCE), bytelength, 0x02 (INTEGER), intLength, R, 0x02 (INTEGER), intLength, S]\n *\n * Docs: https://letsencrypt.org/docs/a-warm-welcome-to-asn1-and-der/, https://luca.ntop.org/Teaching/Appunti/asn1.html\n */\nexport const DER: IDER = {\n // asn.1 DER encoding utils\n Err: DERErr,\n // Basic building block is TLV (Tag-Length-Value)\n _tlv: {\n encode: (tag: number, data: string): string => {\n const { Err: E } = DER;\n if (tag < 0 || tag > 256) throw new E('tlv.encode: wrong tag');\n if (data.length & 1) throw new E('tlv.encode: unpadded data');\n const dataLen = data.length / 2;\n const len = numberToHexUnpadded(dataLen);\n if ((len.length / 2) & 0b1000_0000) throw new E('tlv.encode: long form length too big');\n // length of length with long form flag\n const lenLen = dataLen > 127 ? numberToHexUnpadded((len.length / 2) | 0b1000_0000) : '';\n const t = numberToHexUnpadded(tag);\n return t + lenLen + len + data;\n },\n // v - value, l - left bytes (unparsed)\n decode(tag: number, data: Uint8Array): { v: Uint8Array; l: Uint8Array } {\n const { Err: E } = DER;\n let pos = 0;\n if (tag < 0 || tag > 256) throw new E('tlv.encode: wrong tag');\n if (data.length < 2 || data[pos++] !== tag) throw new E('tlv.decode: wrong tlv');\n const first = data[pos++];\n const isLong = !!(first & 0b1000_0000); // First bit of first length byte is flag for short/long form\n let length = 0;\n if (!isLong) length = first;\n else {\n // Long form: [longFlag(1bit), lengthLength(7bit), length (BE)]\n const lenLen = first & 0b0111_1111;\n if (!lenLen) throw new E('tlv.decode(long): indefinite length not supported');\n if (lenLen > 4) throw new E('tlv.decode(long): byte length is too big'); // this will overflow u32 in js\n const lengthBytes = data.subarray(pos, pos + lenLen);\n if (lengthBytes.length !== lenLen) throw new E('tlv.decode: length bytes not complete');\n if (lengthBytes[0] === 0) throw new E('tlv.decode(long): zero leftmost byte');\n for (const b of lengthBytes) length = (length << 8) | b;\n pos += lenLen;\n if (length < 128) throw new E('tlv.decode(long): not minimal encoding');\n }\n const v = data.subarray(pos, pos + length);\n if (v.length !== length) throw new E('tlv.decode: wrong value length');\n return { v, l: data.subarray(pos + length) };\n },\n },\n // https://crypto.stackexchange.com/a/57734 Leftmost bit of first byte is 'negative' flag,\n // since we always use positive integers here. It must always be empty:\n // - add zero byte if exists\n // - if next byte doesn't have a flag, leading zero is not allowed (minimal encoding)\n _int: {\n encode(num: bigint): string {\n const { Err: E } = DER;\n if (num < _0n) throw new E('integer: negative integers are not allowed');\n let hex = numberToHexUnpadded(num);\n // Pad with zero byte if negative flag is present\n if (Number.parseInt(hex[0], 16) & 0b1000) hex = '00' + hex;\n if (hex.length & 1) throw new E('unexpected DER parsing assertion: unpadded hex');\n return hex;\n },\n decode(data: Uint8Array): bigint {\n const { Err: E } = DER;\n if (data[0] & 0b1000_0000) throw new E('invalid signature integer: negative');\n if (data[0] === 0x00 && !(data[1] & 0b1000_0000))\n throw new E('invalid signature integer: unnecessary leading zero');\n return bytesToNumberBE(data);\n },\n },\n toSig(hex: string | Uint8Array): { r: bigint; s: bigint } {\n // parse DER signature\n const { Err: E, _int: int, _tlv: tlv } = DER;\n const data = ensureBytes('signature', hex);\n const { v: seqBytes, l: seqLeftBytes } = tlv.decode(0x30, data);\n if (seqLeftBytes.length) throw new E('invalid signature: left bytes after parsing');\n const { v: rBytes, l: rLeftBytes } = tlv.decode(0x02, seqBytes);\n const { v: sBytes, l: sLeftBytes } = tlv.decode(0x02, rLeftBytes);\n if (sLeftBytes.length) throw new E('invalid signature: left bytes after parsing');\n return { r: int.decode(rBytes), s: int.decode(sBytes) };\n },\n hexFromSig(sig: { r: bigint; s: bigint }): string {\n const { _tlv: tlv, _int: int } = DER;\n const rs = tlv.encode(0x02, int.encode(sig.r));\n const ss = tlv.encode(0x02, int.encode(sig.s));\n const seq = rs + ss;\n return tlv.encode(0x30, seq);\n },\n};\n\n// Be friendly to bad ECMAScript parsers by not using bigint literals\n// prettier-ignore\nconst _0n = BigInt(0), _1n = BigInt(1), _2n = BigInt(2), _3n = BigInt(3), _4n = BigInt(4);\n\nexport function _normFnElement(Fn: IField<bigint>, key: PrivKey): bigint {\n const { BYTES: expected } = Fn;\n let num: bigint;\n if (typeof key === 'bigint') {\n num = key;\n } else {\n let bytes = ensureBytes('private key', key);\n try {\n num = Fn.fromBytes(bytes);\n } catch (error) {\n throw new Error(`invalid private key: expected ui8a of size ${expected}, got ${typeof key}`);\n }\n }\n if (!Fn.isValidNot0(num)) throw new Error('invalid private key: out of range [1..N-1]');\n return num;\n}\n\n/**\n * Creates weierstrass Point constructor, based on specified curve options.\n *\n * @example\n```js\nconst opts = {\n p: BigInt('0xffffffff00000001000000000000000000000000ffffffffffffffffffffffff'),\n n: BigInt('0xffffffff00000000ffffffffffffffffbce6faada7179e84f3b9cac2fc632551'),\n h: BigInt(1),\n a: BigInt('0xffffffff00000001000000000000000000000000fffffffffffffffffffffffc'),\n b: BigInt('0x5ac635d8aa3a93e7b3ebbd55769886bc651d06b0cc53b0f63bce3c3e27d2604b'),\n Gx: BigInt('0x6b17d1f2e12c4247f8bce6e563a440f277037d812deb33a0f4a13945d898c296'),\n Gy: BigInt('0x4fe342e2fe1a7f9b8ee7eb4a7c0f9e162bce33576b315ececbb6406837bf51f5'),\n};\nconst p256_Point = weierstrass(opts);\n```\n */\nexport function weierstrassN<T>(\n params: WeierstrassOpts<T>,\n extraOpts: WeierstrassExtraOpts<T> = {}\n): WeierstrassPointCons<T> {\n const validated = _createCurveFields('weierstrass', params, extraOpts);\n const { Fp, Fn } = validated;\n let CURVE = validated.CURVE as WeierstrassOpts<T>;\n const { h: cofactor, n: CURVE_ORDER } = CURVE;\n _validateObject(\n extraOpts,\n {},\n {\n allowInfinityPoint: 'boolean',\n clearCofactor: 'function',\n isTorsionFree: 'function',\n fromBytes: 'function',\n toBytes: 'function',\n endo: 'object',\n wrapPrivateKey: 'boolean',\n }\n );\n\n const { endo } = extraOpts;\n if (endo) {\n // validateObject(endo, { beta: 'bigint', splitScalar: 'function' });\n if (!Fp.is0(CURVE.a) || typeof endo.beta !== 'bigint' || !Array.isArray(endo.basises)) {\n throw new Error('invalid endo: expected \"beta\": bigint and \"basises\": array');\n }\n }\n\n const lengths = getWLengths(Fp, Fn);\n\n function assertCompressionIsSupported() {\n if (!Fp.isOdd) throw new Error('compression is not supported: Field does not have .isOdd()');\n }\n\n // Implements IEEE P1363 point encoding\n function pointToBytes(\n _c: WeierstrassPointCons<T>,\n point: WeierstrassPoint<T>,\n isCompressed: boolean\n ): Uint8Array {\n const { x, y } = point.toAffine();\n const bx = Fp.toBytes(x);\n abool(isCompressed, 'isCompressed');\n if (isCompressed) {\n assertCompressionIsSupported();\n const hasEvenY = !Fp.isOdd!(y);\n return concatBytes(pprefix(hasEvenY), bx);\n } else {\n return concatBytes(Uint8Array.of(0x04), bx, Fp.toBytes(y));\n }\n }\n function pointFromBytes(bytes: Uint8Array) {\n abytes(bytes, undefined, 'Point');\n const { publicKey: comp, publicKeyUncompressed: uncomp } = lengths; // e.g. for 32-byte: 33, 65\n const length = bytes.length;\n const head = bytes[0];\n const tail = bytes.subarray(1);\n // No actual validation is done here: use .assertValidity()\n if (length === comp && (head === 0x02 || head === 0x03)) {\n const x = Fp.fromBytes(tail);\n if (!Fp.isValid(x)) throw new Error('bad point: is not on curve, wrong x');\n const y2 = weierstrassEquation(x); // y\u00B2 = x\u00B3 + ax + b\n let y: T;\n try {\n y = Fp.sqrt(y2); // y = y\u00B2 ^ (p+1)/4\n } catch (sqrtError) {\n const err = sqrtError instanceof Error ? ': ' + sqrtError.message : '';\n throw new Error('bad point: is not on curve, sqrt error' + err);\n }\n assertCompressionIsSupported();\n const isYOdd = Fp.isOdd!(y); // (y & _1n) === _1n;\n const isHeadOdd = (head & 1) === 1; // ECDSA-specific\n if (isHeadOdd !== isYOdd) y = Fp.neg(y);\n return { x, y };\n } else if (length === uncomp && head === 0x04) {\n // TODO: more checks\n const L = Fp.BYTES;\n const x = Fp.fromBytes(tail.subarray(0, L));\n const y = Fp.fromBytes(tail.subarray(L, L * 2));\n if (!isValidXY(x, y)) throw new Error('bad point: is not on curve');\n return { x, y };\n } else {\n throw new Error(\n `bad point: got length ${length}, expected compressed=${comp} or uncompressed=${uncomp}`\n );\n }\n }\n\n const encodePoint = extraOpts.toBytes || pointToBytes;\n const decodePoint = extraOpts.fromBytes || pointFromBytes;\n function weierstrassEquation(x: T): T {\n const x2 = Fp.sqr(x); // x * x\n const x3 = Fp.mul(x2, x); // x\u00B2 * x\n return Fp.add(Fp.add(x3, Fp.mul(x, CURVE.a)), CURVE.b); // x\u00B3 + a * x + b\n }\n\n // TODO: move top-level\n /** Checks whether equation holds for given x, y: y\u00B2 == x\u00B3 + ax + b */\n function isValidXY(x: T, y: T): boolean {\n const left = Fp.sqr(y); // y\u00B2\n const right = weierstrassEquation(x); // x\u00B3 + ax + b\n return Fp.eql(left, right);\n }\n\n // Validate whether the passed curve params are valid.\n // Test 1: equation y\u00B2 = x\u00B3 + ax + b should work for generator point.\n if (!isValidXY(CURVE.Gx, CURVE.Gy)) throw new Error('bad curve params: generator point');\n\n // Test 2: discriminant \u0394 part should be non-zero: 4a\u00B3 + 27b\u00B2 != 0.\n // Guarantees curve is genus-1, smooth (non-singular).\n const _4a3 = Fp.mul(Fp.pow(CURVE.a, _3n), _4n);\n const _27b2 = Fp.mul(Fp.sqr(CURVE.b), BigInt(27));\n if (Fp.is0(Fp.add(_4a3, _27b2))) throw new Error('bad curve params: a or b');\n\n /** Asserts coordinate is valid: 0 <= n < Fp.ORDER. */\n function acoord(title: string, n: T, banZero = false) {\n if (!Fp.isValid(n) || (banZero && Fp.is0(n))) throw new Error(`bad point coordinate ${title}`);\n return n;\n }\n\n function aprjpoint(other: unknown) {\n if (!(other instanceof Point)) throw new Error('ProjectivePoint expected');\n }\n\n function splitEndoScalarN(k: bigint) {\n if (!endo || !endo.basises) throw new Error('no endo');\n return _splitEndoScalar(k, endo.basises, Fn.ORDER);\n }\n\n // Memoized toAffine / validity check. They are heavy. Points are immutable.\n\n // Converts Projective point to affine (x, y) coordinates.\n // Can accept precomputed Z^-1 - for example, from invertBatch.\n // (X, Y, Z) \u220B (x=X/Z, y=Y/Z)\n const toAffineMemo = memoized((p: Point, iz?: T): AffinePoint<T> => {\n const { X, Y, Z } = p;\n // Fast-path for normalized points\n if (Fp.eql(Z, Fp.ONE)) return { x: X, y: Y };\n const is0 = p.is0();\n // If invZ was 0, we return zero point. However we still want to execute\n // all operations, so we replace invZ with a random number, 1.\n if (iz == null) iz = is0 ? Fp.ONE : Fp.inv(Z);\n const x = Fp.mul(X, iz);\n const y = Fp.mul(Y, iz);\n const zz = Fp.mul(Z, iz);\n if (is0) return { x: Fp.ZERO, y: Fp.ZERO };\n if (!Fp.eql(zz, Fp.ONE)) throw new Error('invZ was invalid');\n return { x, y };\n });\n // NOTE: on exception this will crash 'cached' and no value will be set.\n // Otherwise true will be return\n const assertValidMemo = memoized((p: Point) => {\n if (p.is0()) {\n // (0, 1, 0) aka ZERO is invalid in most contexts.\n // In BLS, ZERO can be serialized, so we allow it.\n // (0, 0, 0) is invalid representation of ZERO.\n if (extraOpts.allowInfinityPoint && !Fp.is0(p.Y)) return;\n throw new Error('bad point: ZERO');\n }\n // Some 3rd-party test vectors require different wording between here & `fromCompressedHex`\n const { x, y } = p.toAffine();\n if (!Fp.isValid(x) || !Fp.isValid(y)) throw new Error('bad point: x or y not field elements');\n if (!isValidXY(x, y)) throw new Error('bad point: equation left != right');\n if (!p.isTorsionFree()) throw new Error('bad point: not in prime-order subgroup');\n return true;\n });\n\n function finishEndo(\n endoBeta: EndomorphismOpts['beta'],\n k1p: Point,\n k2p: Point,\n k1neg: boolean,\n k2neg: boolean\n ) {\n k2p = new Point(Fp.mul(k2p.X, endoBeta), k2p.Y, k2p.Z);\n k1p = negateCt(k1neg, k1p);\n k2p = negateCt(k2neg, k2p);\n return k1p.add(k2p);\n }\n\n /**\n * Projective Point works in 3d / projective (homogeneous) coordinates:(X, Y, Z) \u220B (x=X/Z, y=Y/Z).\n * Default Point works in 2d / affine coordinates: (x, y).\n * We're doing calculations in projective, because its operations don't require costly inversion.\n */\n class Point implements WeierstrassPoint<T> {\n // base / generator point\n static readonly BASE = new Point(CURVE.Gx, CURVE.Gy, Fp.ONE);\n // zero / infinity / identity point\n static readonly ZERO = new Point(Fp.ZERO, Fp.ONE, Fp.ZERO); // 0, 1, 0\n // math field\n static readonly Fp = Fp;\n // scalar field\n static readonly Fn = Fn;\n\n readonly X: T;\n readonly Y: T;\n readonly Z: T;\n\n /** Does NOT validate if the point is valid. Use `.assertValidity()`. */\n constructor(X: T, Y: T, Z: T) {\n this.X = acoord('x', X);\n this.Y = acoord('y', Y, true);\n this.Z = acoord('z', Z);\n Object.freeze(this);\n }\n\n static CURVE(): WeierstrassOpts<T> {\n return CURVE;\n }\n\n /** Does NOT validate if the point is valid. Use `.assertValidity()`. */\n static fromAffine(p: AffinePoint<T>): Point {\n const { x, y } = p || {};\n if (!p || !Fp.isValid(x) || !Fp.isValid(y)) throw new Error('invalid affine point');\n if (p instanceof Point) throw new Error('projective point not allowed');\n // (0, 0) would've produced (0, 0, 1) - instead, we need (0, 1, 0)\n if (Fp.is0(x) && Fp.is0(y)) return Point.ZERO;\n return new Point(x, y, Fp.ONE);\n }\n\n static fromBytes(bytes: Uint8Array): Point {\n const P = Point.fromAffine(decodePoint(abytes(bytes, undefined, 'point')));\n P.assertValidity();\n return P;\n }\n static fromHex(hex: Hex): Point {\n return Point.fromBytes(ensureBytes('pointHex', hex));\n }\n\n get x(): T {\n return this.toAffine().x;\n }\n get y(): T {\n return this.toAffine().y;\n }\n\n /**\n *\n * @param windowSize\n * @param isLazy true will defer table computation until the first multiplication\n * @returns\n */\n precompute(windowSize: number = 8, isLazy = true): Point {\n wnaf.createCache(this, windowSize);\n if (!isLazy) this.multiply(_3n); // random number\n return this;\n }\n\n // TODO: return `this`\n /** A point on curve is valid if it conforms to equation. */\n assertValidity(): void {\n assertValidMemo(this);\n }\n\n hasEvenY(): boolean {\n const { y } = this.toAffine();\n if (!Fp.isOdd) throw new Error(\"Field doesn't support isOdd\");\n return !Fp.isOdd(y);\n }\n\n /** Compare one point to another. */\n equals(other: Point): boolean {\n aprjpoint(other);\n const { X: X1, Y: Y1, Z: Z1 } = this;\n const { X: X2, Y: Y2, Z: Z2 } = other;\n const U1 = Fp.eql(Fp.mul(X1, Z2), Fp.mul(X2, Z1));\n const U2 = Fp.eql(Fp.mul(Y1, Z2), Fp.mul(Y2, Z1));\n return U1 && U2;\n }\n\n /** Flips point to one corresponding to (x, -y) in Affine coordinates. */\n negate(): Point {\n return new Point(this.X, Fp.neg(this.Y), this.Z);\n }\n\n // Renes-Costello-Batina exception-free doubling formula.\n // There is 30% faster Jacobian formula, but it is not complete.\n // https://eprint.iacr.org/2015/1060, algorithm 3\n // Cost: 8M + 3S + 3*a + 2*b3 + 15add.\n double() {\n const { a, b } = CURVE;\n const b3 = Fp.mul(b, _3n);\n const { X: X1, Y: Y1, Z: Z1 } = this;\n let X3 = Fp.ZERO, Y3 = Fp.ZERO, Z3 = Fp.ZERO; // prettier-ignore\n let t0 = Fp.mul(X1, X1); // step 1\n let t1 = Fp.mul(Y1, Y1);\n let t2 = Fp.mul(Z1, Z1);\n let t3 = Fp.mul(X1, Y1);\n t3 = Fp.add(t3, t3); // step 5\n Z3 = Fp.mul(X1, Z1);\n Z3 = Fp.add(Z3, Z3);\n X3 = Fp.mul(a, Z3);\n Y3 = Fp.mul(b3, t2);\n Y3 = Fp.add(X3, Y3); // step 10\n X3 = Fp.sub(t1, Y3);\n Y3 = Fp.add(t1, Y3);\n Y3 = Fp.mul(X3, Y3);\n X3 = Fp.mul(t3, X3);\n Z3 = Fp.mul(b3, Z3); // step 15\n t2 = Fp.mul(a, t2);\n t3 = Fp.sub(t0, t2);\n t3 = Fp.mul(a, t3);\n t3 = Fp.add(t3, Z3);\n Z3 = Fp.add(t0, t0); // step 20\n t0 = Fp.add(Z3, t0);\n t0 = Fp.add(t0, t2);\n t0 = Fp.mul(t0, t3);\n Y3 = Fp.add(Y3, t0);\n t2 = Fp.mul(Y1, Z1); // step 25\n t2 = Fp.add(t2, t2);\n t0 = Fp.mul(t2, t3);\n X3 = Fp.sub(X3, t0);\n Z3 = Fp.mul(t2, t1);\n Z3 = Fp.add(Z3, Z3); // step 30\n Z3 = Fp.add(Z3, Z3);\n return new Point(X3, Y3, Z3);\n }\n\n // Renes-Costello-Batina exception-free addition formula.\n // There is 30% faster Jacobian formula, but it is not complete.\n // https://eprint.iacr.org/2015/1060, algorithm 1\n // Cost: 12M + 0S + 3*a + 3*b3 + 23add.\n add(other: Point): Point {\n aprjpoint(other);\n const { X: X1, Y: Y1, Z: Z1 } = this;\n const { X: X2, Y: Y2, Z: Z2 } = other;\n let X3 = Fp.ZERO, Y3 = Fp.ZERO, Z3 = Fp.ZERO; // prettier-ignore\n const a = CURVE.a;\n const b3 = Fp.mul(CURVE.b, _3n);\n let t0 = Fp.mul(X1, X2); // step 1\n let t1 = Fp.mul(Y1, Y2);\n let t2 = Fp.mul(Z1, Z2);\n let t3 = Fp.add(X1, Y1);\n let t4 = Fp.add(X2, Y2); // step 5\n t3 = Fp.mul(t3, t4);\n t4 = Fp.add(t0, t1);\n t3 = Fp.sub(t3, t4);\n t4 = Fp.add(X1, Z1);\n let t5 = Fp.add(X2, Z2); // step 10\n t4 = Fp.mul(t4, t5);\n t5 = Fp.add(t0, t2);\n t4 = Fp.sub(t4, t5);\n t5 = Fp.add(Y1, Z1);\n X3 = Fp.add(Y2, Z2); // step 15\n t5 = Fp.mul(t5, X3);\n X3 = Fp.add(t1, t2);\n t5 = Fp.sub(t5, X3);\n Z3 = Fp.mul(a, t4);\n X3 = Fp.mul(b3, t2); // step 20\n Z3 = Fp.add(X3, Z3);\n X3 = Fp.sub(t1, Z3);\n Z3 = Fp.add(t1, Z3);\n Y3 = Fp.mul(X3, Z3);\n t1 = Fp.add(t0, t0); // step 25\n t1 = Fp.add(t1, t0);\n t2 = Fp.mul(a, t2);\n t4 = Fp.mul(b3, t4);\n t1 = Fp.add(t1, t2);\n t2 = Fp.sub(t0, t2); // step 30\n t2 = Fp.mul(a, t2);\n t4 = Fp.add(t4, t2);\n t0 = Fp.mul(t1, t4);\n Y3 = Fp.add(Y3, t0);\n t0 = Fp.mul(t5, t4); // step 35\n X3 = Fp.mul(t3, X3);\n X3 = Fp.sub(X3, t0);\n t0 = Fp.mul(t3, t1);\n Z3 = Fp.mul(t5, Z3);\n Z3 = Fp.add(Z3, t0); // step 40\n return new Point(X3, Y3, Z3);\n }\n\n subtract(other: Point) {\n return this.add(other.negate());\n }\n\n is0(): boolean {\n return this.equals(Point.ZERO);\n }\n\n /**\n * Constant time multiplication.\n * Uses wNAF method. Windowed method may be 10% faster,\n * but takes 2x longer to generate and consumes 2x memory.\n * Uses precomputes when available.\n * Uses endomorphism for Koblitz curves.\n * @param scalar by which the point would be multiplied\n * @returns New point\n */\n multiply(scalar: bigint): Point {\n const { endo } = extraOpts;\n if (!Fn.isValidNot0(scalar)) throw new Error('invalid scalar: out of range'); // 0 is invalid\n let point: Point, fake: Point; // Fake point is used to const-time mult\n const mul = (n: bigint) => wnaf.cached(this, n, (p) => normalizeZ(Point, p));\n /** See docs for {@link EndomorphismOpts} */\n if (endo) {\n const { k1neg, k1, k2neg, k2 } = splitEndoScalarN(scalar);\n const { p: k1p, f: k1f } = mul(k1);\n const { p: k2p, f: k2f } = mul(k2);\n fake = k1f.add(k2f);\n point = finishEndo(endo.beta, k1p, k2p, k1neg, k2neg);\n } else {\n const { p, f } = mul(scalar);\n point = p;\n fake = f;\n }\n // Normalize `z` for both points, but return only real one\n return normalizeZ(Point, [point, fake])[0];\n }\n\n /**\n * Non-constant-time multiplication. Uses double-and-add algorithm.\n * It's faster, but should only be used when you don't care about\n * an exposed secret key e.g. sig verification, which works over *public* keys.\n */\n multiplyUnsafe(sc: bigint): Point {\n const { endo } = extraOpts;\n const p = this as Point;\n if (!Fn.isValid(sc)) throw new Error('invalid scalar: out of range'); // 0 is valid\n if (sc === _0n || p.is0()) return Point.ZERO;\n if (sc === _1n) return p; // fast-path\n if (wnaf.hasCache(this)) return this.multiply(sc);\n if (endo) {\n const { k1neg, k1, k2neg, k2 } = splitEndoScalarN(sc);\n const { p1, p2 } = mulEndoUnsafe(Point, p, k1, k2); // 30% faster vs wnaf.unsafe\n return finishEndo(endo.beta, p1, p2, k1neg, k2neg);\n } else {\n return wnaf.unsafe(p, sc);\n }\n }\n\n multiplyAndAddUnsafe(Q: Point, a: bigint, b: bigint): Point | undefined {\n const sum = this.multiplyUnsafe(a).add(Q.multiplyUnsafe(b));\n return sum.is0() ? undefined : sum;\n }\n\n /**\n * Converts Projective point to affine (x, y) coordinates.\n * @param invertedZ Z^-1 (inverted zero) - optional, precomputation is useful for invertBatch\n */\n toAffine(invertedZ?: T): AffinePoint<T> {\n return toAffineMemo(this, invertedZ);\n }\n\n /**\n * Checks whether Point is free of torsion elements (is in prime subgroup).\n * Always torsion-free for cofactor=1 curves.\n */\n isTorsionFree(): boolean {\n const { isTorsionFree } = extraOpts;\n if (cofactor === _1n) return true;\n if (isTorsionFree) return isTorsionFree(Point, this);\n return wnaf.unsafe(this, CURVE_ORDER).is0();\n }\n\n clearCofactor(): Point {\n const { clearCofactor } = extraOpts;\n if (cofactor === _1n) return this; // Fast-path\n if (clearCofactor) return clearCofactor(Point, this) as Point;\n return this.multiplyUnsafe(cofactor);\n }\n\n isSmallOrder(): boolean {\n // can we use this.clearCofactor()?\n return this.multiplyUnsafe(cofactor).is0();\n }\n\n toBytes(isCompressed = true): Uint8Array {\n abool(isCompressed, 'isCompressed');\n this.assertValidity();\n return encodePoint(Point, this, isCompressed);\n }\n\n toHex(isCompressed = true): string {\n return bytesToHex(this.toBytes(isCompressed));\n }\n\n toString() {\n return `<Point ${this.is0() ? 'ZERO' : this.toHex()}>`;\n }\n\n // TODO: remove\n get px(): T {\n return this.X;\n }\n get py(): T {\n return this.X;\n }\n get pz(): T {\n return this.Z;\n }\n toRawBytes(isCompressed = true): Uint8Array {\n return this.toBytes(isCompressed);\n }\n _setWindowSize(windowSize: number) {\n this.precompute(windowSize);\n }\n static normalizeZ(points: Point[]): Point[] {\n return normalizeZ(Point, points);\n }\n static msm(points: Point[], scalars: bigint[]): Point {\n return pippenger(Point, Fn, points, scalars);\n }\n static fromPrivateKey(privateKey: PrivKey) {\n return Point.BASE.multiply(_normFnElement(Fn, privateKey));\n }\n }\n const bits = Fn.BITS;\n const wnaf = new wNAF(Point, extraOpts.endo ? Math.ceil(bits / 2) : bits);\n Point.BASE.precompute(8); // Enable precomputes. Slows down first publicKey computation by 20ms.\n return Point;\n}\n\n/** Methods of ECDSA signature instance. */\nexport interface ECDSASignature {\n readonly r: bigint;\n readonly s: bigint;\n readonly recovery?: number;\n addRecoveryBit(recovery: number): ECDSASigRecovered;\n hasHighS(): boolean;\n toBytes(format?: string): Uint8Array;\n toHex(format?: string): string;\n\n /** @deprecated */\n assertValidity(): void;\n /** @deprecated */\n normalizeS(): ECDSASignature;\n /** @deprecated use standalone method `curve.recoverPublicKey(sig.toBytes('recovered'), msg)` */\n recoverPublicKey(msgHash: Hex): WeierstrassPoint<bigint>;\n /** @deprecated use `.toBytes('compact')` */\n toCompactRawBytes(): Uint8Array;\n /** @deprecated use `.toBytes('compact')` */\n toCompactHex(): string;\n /** @deprecated use `.toBytes('der')` */\n toDERRawBytes(): Uint8Array;\n /** @deprecated use `.toBytes('der')` */\n toDERHex(): string;\n}\nexport type ECDSASigRecovered = ECDSASignature & {\n readonly recovery: number;\n};\n/** Methods of ECDSA signature constructor. */\nexport type ECDSASignatureCons = {\n new (r: bigint, s: bigint, recovery?: number): ECDSASignature;\n fromBytes(bytes: Uint8Array, format?: ECDSASigFormat): ECDSASignature;\n fromHex(hex: string, format?: ECDSASigFormat): ECDSASignature;\n\n /** @deprecated use `.fromBytes(bytes, 'compact')` */\n fromCompact(hex: Hex): ECDSASignature;\n /** @deprecated use `.fromBytes(bytes, 'der')` */\n fromDER(hex: Hex): ECDSASignature;\n};\n\n// Points start with byte 0x02 when y is even; otherwise 0x03\nfunction pprefix(hasEvenY: boolean): Uint8Array {\n return Uint8Array.of(hasEvenY ? 0x02 : 0x03);\n}\n\n/**\n * Implementation of the Shallue and van de Woestijne method for any weierstrass curve.\n * TODO: check if there is a way to merge this with uvRatio in Edwards; move to modular.\n * b = True and y = sqrt(u / v) if (u / v) is square in F, and\n * b = False and y = sqrt(Z * (u / v)) otherwise.\n * @param Fp\n * @param Z\n * @returns\n */\nexport function SWUFpSqrtRatio<T>(\n Fp: IField<T>,\n Z: T\n): (u: T, v: T) => { isValid: boolean; value: T } {\n // Generic implementation\n const q = Fp.ORDER;\n let l = _0n;\n for (let o = q - _1n; o % _2n === _0n; o /= _2n) l += _1n;\n const c1 = l; // 1. c1, the largest integer such that 2^c1 divides q - 1.\n // We need 2n ** c1 and 2n ** (c1-1). We can't use **; but we can use <<.\n // 2n ** c1 == 2n << (c1-1)\n const _2n_pow_c1_1 = _2n << (c1 - _1n - _1n);\n const _2n_pow_c1 = _2n_pow_c1_1 * _2n;\n const c2 = (q - _1n) / _2n_pow_c1; // 2. c2 = (q - 1) / (2^c1) # Integer arithmetic\n const c3 = (c2 - _1n) / _2n; // 3. c3 = (c2 - 1) / 2 # Integer arithmetic\n const c4 = _2n_pow_c1 - _1n; // 4. c4 = 2^c1 - 1 # Integer arithmetic\n const c5 = _2n_pow_c1_1; // 5. c5 = 2^(c1 - 1) # Integer arithmetic\n const c6 = Fp.pow(Z, c2); // 6. c6 = Z^c2\n const c7 = Fp.pow(Z, (c2 + _1n) / _2n); // 7. c7 = Z^((c2 + 1) / 2)\n let sqrtRatio = (u: T, v: T): { isValid: boolean; value: T } => {\n let tv1 = c6; // 1. tv1 = c6\n let tv2 = Fp.pow(v, c4); // 2. tv2 = v^c4\n let tv3 = Fp.sqr(tv2); // 3. tv3 = tv2^2\n tv3 = Fp.mul(tv3, v); // 4. tv3 = tv3 * v\n let tv5 = Fp.mul(u, tv3); // 5. tv5 = u * tv3\n tv5 = Fp.pow(tv5, c3); // 6. tv5 = tv5^c3\n tv5 = Fp.mul(tv5, tv2); // 7. tv5 = tv5 * tv2\n tv2 = Fp.mul(tv5, v); // 8. tv2 = tv5 * v\n tv3 = Fp.mul(tv5, u); // 9. tv3 = tv5 * u\n let tv4 = Fp.mul(tv3, tv2); // 10. tv4 = tv3 * tv2\n tv5 = Fp.pow(tv4, c5); // 11. tv5 = tv4^c5\n let isQR = Fp.eql(tv5, Fp.ONE); // 12. isQR = tv5 == 1\n tv2 = Fp.mul(tv3, c7); // 13. tv2 = tv3 * c7\n tv5 = Fp.mul(tv4, tv1); // 14. tv5 = tv4 * tv1\n tv3 = Fp.cmov(tv2, tv3, isQR); // 15. tv3 = CMOV(tv2, tv3, isQR)\n tv4 = Fp.cmov(tv5, tv4, isQR); // 16. tv4 = CMOV(tv5, tv4, isQR)\n // 17. for i in (c1, c1 - 1, ..., 2):\n for (let i = c1; i > _1n; i--) {\n let tv5 = i - _2n; // 18. tv5 = i - 2\n tv5 = _2n << (tv5 - _1n); // 19. tv5 = 2^tv5\n let tvv5 = Fp.pow(tv4, tv5); // 20. tv5 = tv4^tv5\n const e1 = Fp.eql(tvv5, Fp.ONE); // 21. e1 = tv5 == 1\n tv2 = Fp.mul(tv3, tv1); // 22. tv2 = tv3 * tv1\n tv1 = Fp.mul(tv1, tv1); // 23. tv1 = tv1 * tv1\n tvv5 = Fp.mul(tv4, tv1); // 24. tv5 = tv4 * tv1\n tv3 = Fp.cmov(tv2, tv3, e1); // 25. tv3 = CMOV(tv2, tv3, e1)\n tv4 = Fp.cmov(tvv5, tv4, e1); // 26. tv4 = CMOV(tv5, tv4, e1)\n }\n return { isValid: isQR, value: tv3 };\n };\n if (Fp.ORDER % _4n === _3n) {\n // sqrt_ratio_3mod4(u, v)\n const c1 = (Fp.ORDER - _3n) / _4n; // 1. c1 = (q - 3) / 4 # Integer arithmetic\n const c2 = Fp.sqrt(Fp.neg(Z)); // 2. c2 = sqrt(-Z)\n sqrtRatio = (u: T, v: T) => {\n let tv1 = Fp.sqr(v); // 1. tv1 = v^2\n const tv2 = Fp.mul(u, v); // 2. tv2 = u * v\n tv1 = Fp.mul(tv1, tv2); // 3. tv1 = tv1 * tv2\n let y1 = Fp.pow(tv1, c1); // 4. y1 = tv1^c1\n y1 = Fp.mul(y1, tv2); // 5. y1 = y1 * tv2\n const y2 = Fp.mul(y1, c2); // 6. y2 = y1 * c2\n const tv3 = Fp.mul(Fp.sqr(y1), v); // 7. tv3 = y1^2; 8. tv3 = tv3 * v\n const isQR = Fp.eql(tv3, u); // 9. isQR = tv3 == u\n let y = Fp.cmov(y2, y1, isQR); // 10. y = CMOV(y2, y1, isQR)\n return { isValid: isQR, value: y }; // 11. return (isQR, y) isQR ? y : y*c2\n };\n }\n // No curves uses that\n // if (Fp.ORDER % _8n === _5n) // sqrt_ratio_5mod8\n return sqrtRatio;\n}\n/**\n * Simplified Shallue-van de Woestijne-Ulas Method\n * https://www.rfc-editor.org/rfc/rfc9380#section-6.6.2\n */\nexport function mapToCurveSimpleSWU<T>(\n Fp: IField<T>,\n opts: {\n A: T;\n B: T;\n Z: T;\n }\n): (u: T) => { x: T; y: T } {\n validateField(Fp);\n const { A, B, Z } = opts;\n if (!Fp.isValid(A) || !Fp.isValid(B) || !Fp.isValid(Z))\n throw new Error('mapToCurveSimpleSWU: invalid opts');\n const sqrtRatio = SWUFpSqrtRatio(Fp, Z);\n if (!Fp.isOdd) throw new Error('Field does not have .isOdd()');\n // Input: u, an element of F.\n // Output: (x, y), a point on E.\n return (u: T): { x: T; y: T } => {\n // prettier-ignore\n let tv1, tv2, tv3, tv4, tv5, tv6, x, y;\n tv1 = Fp.sqr(u); // 1. tv1 = u^2\n tv1 = Fp.mul(tv1, Z); // 2. tv1 = Z * tv1\n tv2 = Fp.sqr(tv1); // 3. tv2 = tv1^2\n tv2 = Fp.add(tv2, tv1); // 4. tv2 = tv2 + tv1\n tv3 = Fp.add(tv2, Fp.ONE); // 5. tv3 = tv2 + 1\n tv3 = Fp.mul(tv3, B); // 6. tv3 = B * tv3\n tv4 = Fp.cmov(Z, Fp.neg(tv2), !Fp.eql(tv2, Fp.ZERO)); // 7. tv4 = CMOV(Z, -tv2, tv2 != 0)\n tv4 = Fp.mul(tv4, A); // 8. tv4 = A * tv4\n tv2 = Fp.sqr(tv3); // 9. tv2 = tv3^2\n tv6 = Fp.sqr(tv4); // 10. tv6 = tv4^2\n tv5 = Fp.mul(tv6, A); // 11. tv5 = A * tv6\n tv2 = Fp.add(tv2, tv5); // 12. tv2 = tv2 + tv5\n tv2 = Fp.mul(tv2, tv3); // 13. tv2 = tv2 * tv3\n tv6 = Fp.mul(tv6, tv4); // 14. tv6 = tv6 * tv4\n tv5 = Fp.mul(tv6, B); // 15. tv5 = B * tv6\n tv2 = Fp.add(tv2, tv5); // 16. tv2 = tv2 + tv5\n x = Fp.mul(tv1, tv3); // 17. x = tv1 * tv3\n const { isValid, value } = sqrtRatio(tv2, tv6); // 18. (is_gx1_square, y1) = sqrt_ratio(tv2, tv6)\n y = Fp.mul(tv1, u); // 19. y = tv1 * u -> Z * u^3 * y1\n y = Fp.mul(y, value); // 20. y = y * y1\n x = Fp.cmov(x, tv3, isValid); // 21. x = CMOV(x, tv3, is_gx1_square)\n y = Fp.cmov(y, value, isValid); // 22. y = CMOV(y, y1, is_gx1_square)\n const e1 = Fp.isOdd!(u) === Fp.isOdd!(y); // 23. e1 = sgn0(u) == sgn0(y)\n y = Fp.cmov(Fp.neg(y), y, e1); // 24. y = CMOV(-y, y, e1)\n const tv4_inv = FpInvertBatch(Fp, [tv4], true)[0];\n x = Fp.mul(x, tv4_inv); // 25. x = x / tv4\n return { x, y };\n };\n}\n\nfunction getWLengths<T>(Fp: IField<T>, Fn: IField<bigint>) {\n return {\n secretKey: Fn.BYTES,\n publicKey: 1 + Fp.BYTES,\n publicKeyUncompressed: 1 + 2 * Fp.BYTES,\n publicKeyHasPrefix: true,\n signature: 2 * Fn.BYTES,\n };\n}\n\n/**\n * Sometimes users only need getPublicKey, getSharedSecret, and secret key handling.\n * This helper ensures no signature functionality is present. Less code, smaller bundle size.\n */\nexport function ecdh(\n Point: WeierstrassPointCons<bigint>,\n ecdhOpts: { randomBytes?: (bytesLength?: number) => Uint8Array } = {}\n): ECDH {\n const { Fn } = Point;\n const randomBytes_ = ecdhOpts.randomBytes || randomBytesWeb;\n const lengths = Object.assign(getWLengths(Point.Fp, Fn), { seed: getMinHashLength(Fn.ORDER) });\n\n function isValidSecretKey(secretKey: PrivKey) {\n try {\n return !!_normFnElement(Fn, secretKey);\n } catch (error) {\n return false;\n }\n }\n\n function isValidPublicKey(publicKey: Uint8Array, isCompressed?: boolean): boolean {\n const { publicKey: comp, publicKeyUncompressed } = lengths;\n try {\n const l = publicKey.length;\n if (isCompressed === true && l !== comp) return false;\n if (isCompressed === false && l !== publicKeyUncompressed) return false;\n return !!Point.fromBytes(publicKey);\n } catch (error) {\n return false;\n }\n }\n\n /**\n * Produces cryptographically secure secret key from random of size\n * (groupLen + ceil(groupLen / 2)) with modulo bias being negligible.\n */\n function randomSecretKey(seed = randomBytes_(lengths.seed)): Uint8Array {\n return mapHashToField(abytes(seed, lengths.seed, 'seed'), Fn.ORDER);\n }\n\n /**\n * Computes public key for a secret key. Checks for validity of the secret key.\n * @param isCompressed whether to return compact (default), or full key\n * @returns Public key, full when isCompressed=false; short when isCompressed=true\n */\n function getPublicKey(secretKey: PrivKey, isCompressed = true): Uint8Array {\n return Point.BASE.multiply(_normFnElement(Fn, secretKey)).toBytes(isCompressed);\n }\n\n function keygen(seed?: Uint8Array) {\n const secretKey = randomSecretKey(seed);\n return { secretKey, publicKey: getPublicKey(secretKey) };\n }\n\n /**\n * Quick and dirty check for item being public key. Does not validate hex, or being on-curve.\n */\n function isProbPub(item: PrivKey | PubKey): boolean | undefined {\n if (typeof item === 'bigint') return false;\n if (item instanceof Point) return true;\n const { secretKey, publicKey, publicKeyUncompressed } = lengths;\n if (Fn.allowedLengths || secretKey === publicKey) return undefined;\n const l = ensureBytes('key', item).length;\n return l === publicKey || l === publicKeyUncompressed;\n }\n\n /**\n * ECDH (Elliptic Curve Diffie Hellman).\n * Computes shared public key from secret key A and public key B.\n * Checks: 1) secret key validity 2) shared key is on-curve.\n * Does NOT hash the result.\n * @param isCompressed whether to return compact (default), or full key\n * @returns shared public key\n */\n function getSharedSecret(secretKeyA: PrivKey, publicKeyB: Hex, isCompressed = true): Uint8Array {\n if (isProbPub(secretKeyA) === true) throw new Error('first arg must be private key');\n if (isProbPub(publicKeyB) === false) throw new Error('second arg must be public key');\n const s = _normFnElement(Fn, secretKeyA);\n const b = Point.fromHex(publicKeyB); // checks for being on-curve\n return b.multiply(s).toBytes(isCompressed);\n }\n\n const utils = {\n isValidSecretKey,\n isValidPublicKey,\n randomSecretKey,\n\n // TODO: remove\n isValidPrivateKey: isValidSecretKey,\n randomPrivateKey: randomSecretKey,\n normPrivateKeyToScalar: (key: PrivKey) => _normFnElement(Fn, key),\n precompute(windowSize = 8, point = Point.BASE): WeierstrassPoint<bigint> {\n return point.precompute(windowSize, false);\n },\n };\n\n return Object.freeze({ getPublicKey, getSharedSecret, keygen, Point, utils, lengths });\n}\n\n/**\n * Creates ECDSA signing interface for given elliptic curve `Point` and `hash` function.\n * We need `hash` for 2 features:\n * 1. Message prehash-ing. NOT used if `sign` / `verify` are called with `prehash: false`\n * 2. k generation in `sign`, using HMAC-drbg(hash)\n *\n * ECDSAOpts are only rarely needed.\n *\n * @example\n * ```js\n * const p256_Point = weierstrass(...);\n * const p256_sha256 = ecdsa(p256_Point, sha256);\n * const p256_sha224 = ecdsa(p256_Point, sha224);\n * const p256_sha224_r = ecdsa(p256_Point, sha224, { randomBytes: (length) => { ... } });\n * ```\n */\nexport function ecdsa(\n Point: WeierstrassPointCons<bigint>,\n hash: CHash,\n ecdsaOpts: ECDSAOpts = {}\n): ECDSA {\n ahash(hash);\n _validateObject(\n ecdsaOpts,\n {},\n {\n hmac: 'function',\n lowS: 'boolean',\n randomBytes: 'function',\n bits2int: 'function',\n bits2int_modN: 'function',\n }\n );\n\n const randomBytes = ecdsaOpts.randomBytes || randomBytesWeb;\n const hmac: HmacFnSync =\n ecdsaOpts.hmac ||\n (((key, ...msgs) => nobleHmac(hash, key, concatBytes(...msgs))) satisfies HmacFnSync);\n\n const { Fp, Fn } = Point;\n const { ORDER: CURVE_ORDER, BITS: fnBits } = Fn;\n const { keygen, getPublicKey, getSharedSecret, utils, lengths } = ecdh(Point, ecdsaOpts);\n const defaultSigOpts: Required<ECDSASignOpts> = {\n prehash: false,\n lowS: typeof ecdsaOpts.lowS === 'boolean' ? ecdsaOpts.lowS : false,\n format: undefined as any, //'compact' as ECDSASigFormat,\n extraEntropy: false,\n };\n const defaultSigOpts_format = 'compact';\n\n function isBiggerThanHalfOrder(number: bigint) {\n const HALF = CURVE_ORDER >> _1n;\n return number > HALF;\n }\n function validateRS(title: string, num: bigint): bigint {\n if (!Fn.isValidNot0(num))\n throw new Error(`invalid signature ${title}: out of range 1..Point.Fn.ORDER`);\n return num;\n }\n function validateSigLength(bytes: Uint8Array, format: ECDSASigFormat) {\n validateSigFormat(format);\n const size = lengths.signature!;\n const sizer = format === 'compact' ? size : format === 'recovered' ? size + 1 : undefined;\n return abytes(bytes, sizer, `${format} signature`);\n }\n\n /**\n * ECDSA signature with its (r, s) properties. Supports compact, recovered & DER representations.\n */\n class Signature implements ECDSASignature {\n readonly r: bigint;\n readonly s: bigint;\n readonly recovery?: number;\n constructor(r: bigint, s: bigint, recovery?: number) {\n this.r = validateRS('r', r); // r in [1..N-1];\n this.s = validateRS('s', s); // s in [1..N-1];\n if (recovery != null) this.recovery = recovery;\n Object.freeze(this);\n }\n\n static fromBytes(bytes: Uint8Array, format: ECDSASigFormat = defaultSigOpts_format): Signature {\n validateSigLength(bytes, format);\n let recid: number | undefined;\n if (format === 'der') {\n const { r, s } = DER.toSig(abytes(bytes));\n return new Signature(r, s);\n }\n if (format === 'recovered') {\n recid = bytes[0];\n format = 'compact';\n bytes = bytes.subarray(1);\n }\n const L = Fn.BYTES;\n const r = bytes.subarray(0, L);\n const s = bytes.subarray(L, L * 2);\n return new Signature(Fn.fromBytes(r), Fn.fromBytes(s), recid);\n }\n\n static fromHex(hex: string, format?: ECDSASigFormat) {\n return this.fromBytes(hexToBytes(hex), format);\n }\n\n addRecoveryBit(recovery: number): RecoveredSignature {\n return new Signature(this.r, this.s, recovery) as RecoveredSignature;\n }\n\n recoverPublicKey(messageHash: Hex): WeierstrassPoint<bigint> {\n const FIELD_ORDER = Fp.ORDER;\n const { r, s, recovery: rec } = this;\n if (rec == null || ![0, 1, 2, 3].includes(rec)) throw new Error('recovery id invalid');\n\n // ECDSA recovery is hard for cofactor > 1 curves.\n // In sign, `r = q.x mod n`, and here we recover q.x from r.\n // While recovering q.x >= n, we need to add r+n for cofactor=1 curves.\n // However, for cofactor>1, r+n may not get q.x:\n // r+n*i would need to be done instead where i is unknown.\n // To easily get i, we either need to:\n // a. increase amount of valid recid values (4, 5...); OR\n // b. prohibit non-prime-order signatures (recid > 1).\n const hasCofactor = CURVE_ORDER * _2n < FIELD_ORDER;\n if (hasCofactor && rec > 1) throw new Error('recovery id is ambiguous for h>1 curve');\n\n const radj = rec === 2 || rec === 3 ? r + CURVE_ORDER : r;\n if (!Fp.isValid(radj)) throw new Error('recovery id 2 or 3 invalid');\n const x = Fp.toBytes(radj);\n const R = Point.fromBytes(concatBytes(pprefix((rec & 1) === 0), x));\n const ir = Fn.inv(radj); // r^-1\n const h = bits2int_modN(ensureBytes('msgHash', messageHash)); // Truncate hash\n const u1 = Fn.create(-h * ir); // -hr^-1\n const u2 = Fn.create(s * ir); // sr^-1\n // (sr^-1)R-(hr^-1)G = -(hr^-1)G + (sr^-1). unsafe is fine: there is no private data.\n const Q = Point.BASE.multiplyUnsafe(u1).add(R.multiplyUnsafe(u2));\n if (Q.is0()) throw new Error('point at infinify');\n Q.assertValidity();\n return Q;\n }\n\n // Signatures should be low-s, to prevent malleability.\n hasHighS(): boolean {\n return isBiggerThanHalfOrder(this.s);\n }\n\n toBytes(format: ECDSASigFormat = defaultSigOpts_format) {\n validateSigFormat(format);\n if (format === 'der') return hexToBytes(DER.hexFromSig(this));\n const r = Fn.toBytes(this.r);\n const s = Fn.toBytes(this.s);\n if (format === 'recovered') {\n if (this.recovery == null) throw new Error('recovery bit must be present');\n return concatBytes(Uint8Array.of(this.recovery), r, s);\n }\n return concatBytes(r, s);\n }\n\n toHex(format?: ECDSASigFormat) {\n return bytesToHex(this.toBytes(format));\n }\n\n // TODO: remove\n assertValidity(): void {}\n static fromCompact(hex: Hex) {\n return Signature.fromBytes(ensureBytes('sig', hex), 'compact');\n }\n static fromDER(hex: Hex) {\n return Signature.fromBytes(ensureBytes('sig', hex), 'der');\n }\n normalizeS() {\n return this.hasHighS() ? new Signature(this.r, Fn.neg(this.s), this.recovery) : this;\n }\n toDERRawBytes() {\n return this.toBytes('der');\n }\n toDERHex() {\n return bytesToHex(this.toBytes('der'));\n }\n toCompactRawBytes() {\n return this.toBytes('compact');\n }\n toCompactHex() {\n return bytesToHex(this.toBytes('compact'));\n }\n }\n type RecoveredSignature = Signature & { recovery: number };\n\n // RFC6979: ensure ECDSA msg is X bytes and < N. RFC suggests optional truncating via bits2octets.\n // FIPS 186-4 4.6 suggests the leftmost min(nBitLen, outLen) bits, which matches bits2int.\n // bits2int can produce res>N, we can do mod(res, N) since the bitLen is the same.\n // int2octets can't be used; pads small msgs with 0: unacceptatble for trunc as per RFC vectors\n const bits2int =\n ecdsaOpts.bits2int ||\n function bits2int_def(bytes: Uint8Array): bigint {\n // Our custom check \"just in case\", for protection against DoS\n if (bytes.length > 8192) throw new Error('input is too large');\n // For curves with nBitLength % 8 !== 0: bits2octets(bits2octets(m)) !== bits2octets(m)\n // for some cases, since bytes.length * 8 is not actual bitLength.\n const num = bytesToNumberBE(bytes); // check for == u8 done here\n const delta = bytes.length * 8 - fnBits; // truncate to nBitLength leftmost bits\n return delta > 0 ? num >> BigInt(delta) : num;\n };\n const bits2int_modN =\n ecdsaOpts.bits2int_modN ||\n function bits2int_modN_def(bytes: Uint8Array): bigint {\n return Fn.create(bits2int(bytes)); // can't use bytesToNumberBE here\n };\n // Pads output with zero as per spec\n const ORDER_MASK = bitMask(fnBits);\n /** Converts to bytes. Checks if num in `[0..ORDER_MASK-1]` e.g.: `[0..2^256-1]`. */\n function int2octets(num: bigint): Uint8Array {\n // IMPORTANT: the check ensures working for case `Fn.BYTES != Fn.BITS * 8`\n aInRange('num < 2^' + fnBits, num, _0n, ORDER_MASK);\n return Fn.toBytes(num);\n }\n\n function validateMsgAndHash(message: Uint8Array, prehash: boolean) {\n abytes(message, undefined, 'message');\n return prehash ? abytes(hash(message), undefined, 'prehashed message') : message;\n }\n\n /**\n * Steps A, D of RFC6979 3.2.\n * Creates RFC6979 seed; converts msg/privKey to numbers.\n * Used only in sign, not in verify.\n *\n * Warning: we cannot assume here that message has same amount of bytes as curve order,\n * this will be invalid at least for P521. Also it can be bigger for P224 + SHA256.\n */\n function prepSig(message: Uint8Array, privateKey: PrivKey, opts: ECDSASignOpts) {\n if (['recovered', 'canonical'].some((k) => k in opts))\n throw new Error('sign() legacy options not supported');\n const { lowS, prehash, extraEntropy } = validateSigOpts(opts, defaultSigOpts);\n message = validateMsgAndHash(message, prehash); // RFC6979 3.2 A: h1 = H(m)\n // We can't later call bits2octets, since nested bits2int is broken for curves\n // with fnBits % 8 !== 0. Because of that, we unwrap it here as int2octets call.\n // const bits2octets = (bits) => int2octets(bits2int_modN(bits))\n const h1int = bits2int_modN(message);\n const d = _normFnElement(Fn, privateKey); // validate secret key, convert to bigint\n const seedArgs = [int2octets(d), int2octets(h1int)];\n // extraEntropy. RFC6979 3.6: additional k' (optional).\n if (extraEntropy != null && extraEntropy !== false) {\n // K = HMAC_K(V || 0x00 || int2octets(x) || bits2octets(h1) || k')\n // gen random bytes OR pass as-is\n const e = extraEntropy === true ? randomBytes(lengths.secretKey) : extraEntropy;\n seedArgs.push(ensureBytes('extraEntropy', e)); // check for being bytes\n }\n const seed = concatBytes(...seedArgs); // Step D of RFC6979 3.2\n const m = h1int; // NOTE: no need to call bits2int second time here, it is inside truncateHash!\n // Converts signature params into point w r/s, checks result for validity.\n // To transform k => Signature:\n // q = k\u22C5G\n // r = q.x mod n\n // s = k^-1(m + rd) mod n\n // Can use scalar blinding b^-1(bm + bdr) where b \u2208 [1,q\u22121] according to\n // https://tches.iacr.org/index.php/TCHES/article/view/7337/6509. We've decided against it:\n // a) dependency on CSPRNG b) 15% slowdown c) doesn't really help since bigints are not CT\n function k2sig(kBytes: Uint8Array): RecoveredSignature | undefined {\n // RFC 6979 Section 3.2, step 3: k = bits2int(T)\n // Important: all mod() calls here must be done over N\n const k = bits2int(kBytes); // mod n, not mod p\n if (!Fn.isValidNot0(k)) return; // Valid scalars (including k) must be in 1..N-1\n const ik = Fn.inv(k); // k^-1 mod n\n const q = Point.BASE.multiply(k).toAffine(); // q = k\u22C5G\n const r = Fn.create(q.x); // r = q.x mod n\n if (r === _0n) return;\n const s = Fn.create(ik * Fn.create(m + r * d)); // Not using blinding here, see comment above\n if (s === _0n) return;\n let recovery = (q.x === r ? 0 : 2) | Number(q.y & _1n); // recovery bit (2 or 3, when q.x > n)\n let normS = s;\n if (lowS && isBiggerThanHalfOrder(s)) {\n normS = Fn.neg(s); // if lowS was passed, ensure s is always\n recovery ^= 1; // // in the bottom half of N\n }\n return new Signature(r, normS, recovery) as RecoveredSignature; // use normS, not s\n }\n return { seed, k2sig };\n }\n\n /**\n * Signs message hash with a secret key.\n *\n * ```\n * sign(m, d) where\n * k = rfc6979_hmac_drbg(m, d)\n * (x, y) = G \u00D7 k\n * r = x mod n\n * s = (m + dr) / k mod n\n * ```\n */\n function sign(message: Hex, secretKey: PrivKey, opts: ECDSASignOpts = {}): RecoveredSignature {\n message = ensureBytes('message', message);\n const { seed, k2sig } = prepSig(message, secretKey, opts); // Steps A, D of RFC6979 3.2.\n const drbg = createHmacDrbg<RecoveredSignature>(hash.outputLen, Fn.BYTES, hmac);\n const sig = drbg(seed, k2sig); // Steps B, C, D, E, F, G\n return sig;\n }\n\n function tryParsingSig(sg: Hex | SignatureLike) {\n // Try to deduce format\n let sig: Signature | undefined = undefined;\n const isHex = typeof sg === 'string' || isBytes(sg);\n const isObj =\n !isHex &&\n sg !== null &&\n typeof sg === 'object' &&\n typeof sg.r === 'bigint' &&\n typeof sg.s === 'bigint';\n if (!isHex && !isObj)\n throw new Error('invalid signature, expected Uint8Array, hex string or Signature instance');\n if (isObj) {\n sig = new Signature(sg.r, sg.s);\n } else if (isHex) {\n try {\n sig = Signature.fromBytes(ensureBytes('sig', sg), 'der');\n } catch (derError) {\n if (!(derError instanceof DER.Err)) throw derError;\n }\n if (!sig) {\n try {\n sig = Signature.fromBytes(ensureBytes('sig', sg), 'compact');\n } catch (error) {\n return false;\n }\n }\n }\n if (!sig) return false;\n return sig;\n }\n\n /**\n * Verifies a signature against message and public key.\n * Rejects lowS signatures by default: see {@link ECDSAVerifyOpts}.\n * Implements section 4.1.4 from https://www.secg.org/sec1-v2.pdf:\n *\n * ```\n * verify(r, s, h, P) where\n * u1 = hs^-1 mod n\n * u2 = rs^-1 mod n\n * R = u1\u22C5G + u2\u22C5P\n * mod(R.x, n) == r\n * ```\n */\n function verify(\n signature: Hex | SignatureLike,\n message: Hex,\n publicKey: Hex,\n opts: ECDSAVerifyOpts = {}\n ): boolean {\n const { lowS, prehash, format } = validateSigOpts(opts, defaultSigOpts);\n publicKey = ensureBytes('publicKey', publicKey);\n message = validateMsgAndHash(ensureBytes('message', message), prehash);\n if ('strict' in opts) throw new Error('options.strict was renamed to lowS');\n const sig =\n format === undefined\n ? tryParsingSig(signature)\n : Signature.fromBytes(ensureBytes('sig', signature as Hex), format);\n if (sig === false) return false;\n try {\n const P = Point.fromBytes(publicKey);\n if (lowS && sig.hasHighS()) return false;\n const { r, s } = sig;\n const h = bits2int_modN(message); // mod n, not mod p\n const is = Fn.inv(s); // s^-1 mod n\n const u1 = Fn.create(h * is); // u1 = hs^-1 mod n\n const u2 = Fn.create(r * is); // u2 = rs^-1 mod n\n const R = Point.BASE.multiplyUnsafe(u1).add(P.multiplyUnsafe(u2)); // u1\u22C5G + u2\u22C5P\n if (R.is0()) return false;\n const v = Fn.create(R.x); // v = r.x mod n\n return v === r;\n } catch (e) {\n return false;\n }\n }\n\n function recoverPublicKey(\n signature: Uint8Array,\n message: Uint8Array,\n opts: ECDSARecoverOpts = {}\n ): Uint8Array {\n const { prehash } = validateSigOpts(opts, defaultSigOpts);\n message = validateMsgAndHash(message, prehash);\n return Signature.fromBytes(signature, 'recovered').recoverPublicKey(message).toBytes();\n }\n\n return Object.freeze({\n keygen,\n getPublicKey,\n getSharedSecret,\n utils,\n lengths,\n Point,\n sign,\n verify,\n recoverPublicKey,\n Signature,\n hash,\n });\n}\n\n// TODO: remove everything below\n/** @deprecated use ECDSASignature */\nexport type SignatureType = ECDSASignature;\n/** @deprecated use ECDSASigRecovered */\nexport type RecoveredSignatureType = ECDSASigRecovered;\n/** @deprecated switch to Uint8Array signatures in format 'compact' */\nexport type SignatureLike = { r: bigint; s: bigint };\nexport type ECDSAExtraEntropy = Hex | boolean;\n/** @deprecated use `ECDSAExtraEntropy` */\nexport type Entropy = Hex | boolean;\nexport type BasicWCurve<T> = BasicCurve<T> & {\n // Params: a, b\n a: T;\n b: T;\n\n // Optional params\n allowedPrivateKeyLengths?: readonly number[]; // for P521\n wrapPrivateKey?: boolean; // bls12-381 requires mod(n) instead of rejecting keys >= n\n endo?: EndomorphismOpts;\n // When a cofactor != 1, there can be an effective methods to:\n // 1. Determine whether a point is torsion-free\n isTorsionFree?: (c: WeierstrassPointCons<T>, point: WeierstrassPoint<T>) => boolean;\n // 2. Clear torsion component\n clearCofactor?: (c: WeierstrassPointCons<T>, point: WeierstrassPoint<T>) => WeierstrassPoint<T>;\n};\n/** @deprecated use ECDSASignOpts */\nexport type SignOpts = ECDSASignOpts;\n/** @deprecated use ECDSASignOpts */\nexport type VerOpts = ECDSAVerifyOpts;\n\n/** @deprecated use WeierstrassPoint */\nexport type ProjPointType<T> = WeierstrassPoint<T>;\n/** @deprecated use WeierstrassPointCons */\nexport type ProjConstructor<T> = WeierstrassPointCons<T>;\n/** @deprecated use ECDSASignatureCons */\nexport type SignatureConstructor = ECDSASignatureCons;\n\n// TODO: remove\nexport type CurvePointsType<T> = BasicWCurve<T> & {\n fromBytes?: (bytes: Uint8Array) => AffinePoint<T>;\n toBytes?: (\n c: WeierstrassPointCons<T>,\n point: WeierstrassPoint<T>,\n isCompressed: boolean\n ) => Uint8Array;\n};\n\n// LegacyWeierstrassOpts\nexport type CurvePointsTypeWithLength<T> = Readonly<CurvePointsType<T> & Partial<NLength>>;\n\n// LegacyWeierstrass\nexport type CurvePointsRes<T> = {\n Point: WeierstrassPointCons<T>;\n\n /** @deprecated use `Point.CURVE()` */\n CURVE: CurvePointsType<T>;\n /** @deprecated use `Point` */\n ProjectivePoint: WeierstrassPointCons<T>;\n /** @deprecated use `Point.Fn.fromBytes(privateKey)` */\n normPrivateKeyToScalar: (key: PrivKey) => bigint;\n /** @deprecated */\n weierstrassEquation: (x: T) => T;\n /** @deprecated use `Point.Fn.isValidNot0(num)` */\n isWithinCurveOrder: (num: bigint) => boolean;\n};\n\n// Aliases to legacy types\n// export type CurveType = LegacyECDSAOpts;\n// export type CurveFn = LegacyECDSA;\n// export type CurvePointsRes<T> = LegacyWeierstrass<T>;\n// export type CurvePointsType<T> = LegacyWeierstrassOpts<T>;\n// export type CurvePointsTypeWithLength<T> = LegacyWeierstrassOpts<T>;\n// export type BasicWCurve<T> = LegacyWeierstrassOpts<T>;\n\n/** @deprecated use `Uint8Array` */\nexport type PubKey = Hex | WeierstrassPoint<bigint>;\nexport type CurveType = BasicWCurve<bigint> & {\n hash: CHash; // CHash not FHash because we need outputLen for DRBG\n hmac?: HmacFnSync;\n randomBytes?: (bytesLength?: number) => Uint8Array;\n lowS?: boolean;\n bits2int?: (bytes: Uint8Array) => bigint;\n bits2int_modN?: (bytes: Uint8Array) => bigint;\n};\nexport type CurveFn = {\n /** @deprecated use `Point.CURVE()` */\n CURVE: CurvePointsType<bigint>;\n keygen: ECDSA['keygen'];\n getPublicKey: ECDSA['getPublicKey'];\n getSharedSecret: ECDSA['getSharedSecret'];\n sign: ECDSA['sign'];\n verify: ECDSA['verify'];\n Point: WeierstrassPointCons<bigint>;\n /** @deprecated use `Point` */\n ProjectivePoint: WeierstrassPointCons<bigint>;\n Signature: ECDSASignatureCons;\n utils: ECDSA['utils'];\n lengths: ECDSA['lengths'];\n};\n/** @deprecated use `weierstrass` in newer releases */\nexport function weierstrassPoints<T>(c: CurvePointsTypeWithLength<T>): CurvePointsRes<T> {\n const { CURVE, curveOpts } = _weierstrass_legacy_opts_to_new(c);\n const Point = weierstrassN(CURVE, curveOpts);\n return _weierstrass_new_output_to_legacy(c, Point);\n}\nexport type WsPointComposed<T> = {\n CURVE: WeierstrassOpts<T>;\n curveOpts: WeierstrassExtraOpts<T>;\n};\nexport type WsComposed = {\n /** @deprecated use `Point.CURVE()` */\n CURVE: WeierstrassOpts<bigint>;\n hash: CHash;\n curveOpts: WeierstrassExtraOpts<bigint>;\n ecdsaOpts: ECDSAOpts;\n};\nfunction _weierstrass_legacy_opts_to_new<T>(c: CurvePointsType<T>): WsPointComposed<T> {\n const CURVE: WeierstrassOpts<T> = {\n a: c.a,\n b: c.b,\n p: c.Fp.ORDER,\n n: c.n,\n h: c.h,\n Gx: c.Gx,\n Gy: c.Gy,\n };\n const Fp = c.Fp;\n let allowedLengths = c.allowedPrivateKeyLengths\n ? Array.from(new Set(c.allowedPrivateKeyLengths.map((l) => Math.ceil(l / 2))))\n : undefined;\n const Fn = Field(CURVE.n, {\n BITS: c.nBitLength,\n allowedLengths: allowedLengths,\n modFromBytes: c.wrapPrivateKey,\n });\n const curveOpts: WeierstrassExtraOpts<T> = {\n Fp,\n Fn,\n allowInfinityPoint: c.allowInfinityPoint,\n endo: c.endo,\n isTorsionFree: c.isTorsionFree,\n clearCofactor: c.clearCofactor,\n fromBytes: c.fromBytes,\n toBytes: c.toBytes,\n };\n return { CURVE, curveOpts };\n}\nfunction _ecdsa_legacy_opts_to_new(c: CurveType): WsComposed {\n const { CURVE, curveOpts } = _weierstrass_legacy_opts_to_new(c);\n const ecdsaOpts: ECDSAOpts = {\n hmac: c.hmac,\n randomBytes: c.randomBytes,\n lowS: c.lowS,\n bits2int: c.bits2int,\n bits2int_modN: c.bits2int_modN,\n };\n return { CURVE, curveOpts, hash: c.hash, ecdsaOpts };\n}\nexport function _legacyHelperEquat<T>(Fp: IField<T>, a: T, b: T): (x: T) => T {\n /**\n * y\u00B2 = x\u00B3 + ax + b: Short weierstrass curve formula. Takes x, returns y\u00B2.\n * @returns y\u00B2\n */\n function weierstrassEquation(x: T): T {\n const x2 = Fp.sqr(x); // x * x\n const x3 = Fp.mul(x2, x); // x\u00B2 * x\n return Fp.add(Fp.add(x3, Fp.mul(x, a)), b); // x\u00B3 + a * x + b\n }\n return weierstrassEquation;\n}\nfunction _weierstrass_new_output_to_legacy<T>(\n c: CurvePointsType<T>,\n Point: WeierstrassPointCons<T>\n): CurvePointsRes<T> {\n const { Fp, Fn } = Point;\n function isWithinCurveOrder(num: bigint): boolean {\n return inRange(num, _1n, Fn.ORDER);\n }\n const weierstrassEquation = _legacyHelperEquat(Fp, c.a, c.b);\n return Object.assign(\n {},\n {\n CURVE: c,\n Point: Point,\n ProjectivePoint: Point,\n normPrivateKeyToScalar: (key: PrivKey) => _normFnElement(Fn, key),\n weierstrassEquation,\n isWithinCurveOrder,\n }\n );\n}\nfunction _ecdsa_new_output_to_legacy(c: CurveType, _ecdsa: ECDSA): CurveFn {\n const Point = _ecdsa.Point;\n return Object.assign({}, _ecdsa, {\n ProjectivePoint: Point,\n CURVE: Object.assign({}, c, nLength(Point.Fn.ORDER, Point.Fn.BITS)),\n });\n}\n\n// _ecdsa_legacy\nexport function weierstrass(c: CurveType): CurveFn {\n const { CURVE, curveOpts, hash, ecdsaOpts } = _ecdsa_legacy_opts_to_new(c);\n const Point = weierstrassN(CURVE, curveOpts);\n const signs = ecdsa(Point, hash, ecdsaOpts);\n return _ecdsa_new_output_to_legacy(c, signs);\n}\n", "/**\n * Utilities for short weierstrass curves, combined with noble-hashes.\n * @module\n */\n/*! noble-curves - MIT License (c) 2022 Paul Miller (paulmillr.com) */\nimport { type CurveFn, type CurveType, weierstrass } from './abstract/weierstrass.ts';\nimport type { CHash } from './utils.ts';\n\n/** connects noble-curves to noble-hashes */\nexport function getHash(hash: CHash): { hash: CHash } {\n return { hash };\n}\n/** Same API as @noble/hashes, with ability to create curve with custom hash */\nexport type CurveDef = Readonly<Omit<CurveType, 'hash'>>;\nexport type CurveFnWithCreate = CurveFn & { create: (hash: CHash) => CurveFn };\n\n/** @deprecated use new `weierstrass()` and `ecdsa()` methods */\nexport function createCurve(curveDef: CurveDef, defHash: CHash): CurveFnWithCreate {\n const create = (hash: CHash): CurveFn => weierstrass({ ...curveDef, hash: hash });\n return { ...create(defHash), create };\n}\n", "/**\n * SECG secp256k1. See [pdf](https://www.secg.org/sec2-v2.pdf).\n *\n * Belongs to Koblitz curves: it has efficiently-computable GLV endomorphism \u03C8,\n * check out {@link EndomorphismOpts}. Seems to be rigid (not backdoored).\n * @module\n */\n/*! noble-curves - MIT License (c) 2022 Paul Miller (paulmillr.com) */\nimport { sha256 } from '@noble/hashes/sha2.js';\nimport { randomBytes } from '@noble/hashes/utils.js';\nimport { createCurve, type CurveFnWithCreate } from './_shortw_utils.ts';\nimport type { CurveLengths } from './abstract/curve.ts';\nimport {\n createHasher,\n type H2CHasher,\n type H2CMethod,\n isogenyMap,\n} from './abstract/hash-to-curve.ts';\nimport { Field, mapHashToField, mod, pow2 } from './abstract/modular.ts';\nimport {\n _normFnElement,\n type EndomorphismOpts,\n mapToCurveSimpleSWU,\n type WeierstrassPoint as PointType,\n type WeierstrassOpts,\n type WeierstrassPointCons,\n} from './abstract/weierstrass.ts';\nimport type { Hex, PrivKey } from './utils.ts';\nimport {\n bytesToNumberBE,\n concatBytes,\n ensureBytes,\n inRange,\n numberToBytesBE,\n utf8ToBytes,\n} from './utils.ts';\n\n// Seems like generator was produced from some seed:\n// `Point.BASE.multiply(Point.Fn.inv(2n, N)).toAffine().x`\n// // gives short x 0x3b78ce563f89a0ed9414f5aa28ad0d96d6795f9c63n\nconst secp256k1_CURVE: WeierstrassOpts<bigint> = {\n p: BigInt('0xfffffffffffffffffffffffffffffffffffffffffffffffffffffffefffffc2f'),\n n: BigInt('0xfffffffffffffffffffffffffffffffebaaedce6af48a03bbfd25e8cd0364141'),\n h: BigInt(1),\n a: BigInt(0),\n b: BigInt(7),\n Gx: BigInt('0x79be667ef9dcbbac55a06295ce870b07029bfcdb2dce28d959f2815b16f81798'),\n Gy: BigInt('0x483ada7726a3c4655da4fbfc0e1108a8fd17b448a68554199c47d08ffb10d4b8'),\n};\n\nconst secp256k1_ENDO: EndomorphismOpts = {\n beta: BigInt('0x7ae96a2b657c07106e64479eac3434e99cf0497512f58995c1396c28719501ee'),\n basises: [\n [BigInt('0x3086d221a7d46bcde86c90e49284eb15'), -BigInt('0xe4437ed6010e88286f547fa90abfe4c3')],\n [BigInt('0x114ca50f7a8e2f3f657c1108d9d44cfd8'), BigInt('0x3086d221a7d46bcde86c90e49284eb15')],\n ],\n};\n\nconst _0n = /* @__PURE__ */ BigInt(0);\nconst _1n = /* @__PURE__ */ BigInt(1);\nconst _2n = /* @__PURE__ */ BigInt(2);\n\n/**\n * \u221An = n^((p+1)/4) for fields p = 3 mod 4. We unwrap the loop and multiply bit-by-bit.\n * (P+1n/4n).toString(2) would produce bits [223x 1, 0, 22x 1, 4x 0, 11, 00]\n */\nfunction sqrtMod(y: bigint): bigint {\n const P = secp256k1_CURVE.p;\n // prettier-ignore\n const _3n = BigInt(3), _6n = BigInt(6), _11n = BigInt(11), _22n = BigInt(22);\n // prettier-ignore\n const _23n = BigInt(23), _44n = BigInt(44), _88n = BigInt(88);\n const b2 = (y * y * y) % P; // x^3, 11\n const b3 = (b2 * b2 * y) % P; // x^7\n const b6 = (pow2(b3, _3n, P) * b3) % P;\n const b9 = (pow2(b6, _3n, P) * b3) % P;\n const b11 = (pow2(b9, _2n, P) * b2) % P;\n const b22 = (pow2(b11, _11n, P) * b11) % P;\n const b44 = (pow2(b22, _22n, P) * b22) % P;\n const b88 = (pow2(b44, _44n, P) * b44) % P;\n const b176 = (pow2(b88, _88n, P) * b88) % P;\n const b220 = (pow2(b176, _44n, P) * b44) % P;\n const b223 = (pow2(b220, _3n, P) * b3) % P;\n const t1 = (pow2(b223, _23n, P) * b22) % P;\n const t2 = (pow2(t1, _6n, P) * b2) % P;\n const root = pow2(t2, _2n, P);\n if (!Fpk1.eql(Fpk1.sqr(root), y)) throw new Error('Cannot find square root');\n return root;\n}\n\nconst Fpk1 = Field(secp256k1_CURVE.p, { sqrt: sqrtMod });\n\n/**\n * secp256k1 curve, ECDSA and ECDH methods.\n *\n * Field: `2n**256n - 2n**32n - 2n**9n - 2n**8n - 2n**7n - 2n**6n - 2n**4n - 1n`\n *\n * @example\n * ```js\n * import { secp256k1 } from '@noble/curves/secp256k1';\n * const { secretKey, publicKey } = secp256k1.keygen();\n * const msg = new TextEncoder().encode('hello');\n * const sig = secp256k1.sign(msg, secretKey);\n * const isValid = secp256k1.verify(sig, msg, publicKey) === true;\n * ```\n */\nexport const secp256k1: CurveFnWithCreate = createCurve(\n { ...secp256k1_CURVE, Fp: Fpk1, lowS: true, endo: secp256k1_ENDO },\n sha256\n);\n\n// Schnorr signatures are superior to ECDSA from above. Below is Schnorr-specific BIP0340 code.\n// https://github.com/bitcoin/bips/blob/master/bip-0340.mediawiki\n/** An object mapping tags to their tagged hash prefix of [SHA256(tag) | SHA256(tag)] */\nconst TAGGED_HASH_PREFIXES: { [tag: string]: Uint8Array } = {};\nfunction taggedHash(tag: string, ...messages: Uint8Array[]): Uint8Array {\n let tagP = TAGGED_HASH_PREFIXES[tag];\n if (tagP === undefined) {\n const tagH = sha256(utf8ToBytes(tag));\n tagP = concatBytes(tagH, tagH);\n TAGGED_HASH_PREFIXES[tag] = tagP;\n }\n return sha256(concatBytes(tagP, ...messages));\n}\n\n// ECDSA compact points are 33-byte. Schnorr is 32: we strip first byte 0x02 or 0x03\nconst pointToBytes = (point: PointType<bigint>) => point.toBytes(true).slice(1);\nconst Pointk1 = /* @__PURE__ */ (() => secp256k1.Point)();\nconst hasEven = (y: bigint) => y % _2n === _0n;\n\n// Calculate point, scalar and bytes\nfunction schnorrGetExtPubKey(priv: PrivKey) {\n const { Fn, BASE } = Pointk1;\n const d_ = _normFnElement(Fn, priv);\n const p = BASE.multiply(d_); // P = d'\u22C5G; 0 < d' < n check is done inside\n const scalar = hasEven(p.y) ? d_ : Fn.neg(d_);\n return { scalar, bytes: pointToBytes(p) };\n}\n/**\n * lift_x from BIP340. Convert 32-byte x coordinate to elliptic curve point.\n * @returns valid point checked for being on-curve\n */\nfunction lift_x(x: bigint): PointType<bigint> {\n const Fp = Fpk1;\n if (!Fp.isValidNot0(x)) throw new Error('invalid x: Fail if x \u2265 p');\n const xx = Fp.create(x * x);\n const c = Fp.create(xx * x + BigInt(7)); // Let c = x\u00B3 + 7 mod p.\n let y = Fp.sqrt(c); // Let y = c^(p+1)/4 mod p. Same as sqrt().\n // Return the unique point P such that x(P) = x and\n // y(P) = y if y mod 2 = 0 or y(P) = p-y otherwise.\n if (!hasEven(y)) y = Fp.neg(y);\n const p = Pointk1.fromAffine({ x, y });\n p.assertValidity();\n return p;\n}\nconst num = bytesToNumberBE;\n/**\n * Create tagged hash, convert it to bigint, reduce modulo-n.\n */\nfunction challenge(...args: Uint8Array[]): bigint {\n return Pointk1.Fn.create(num(taggedHash('BIP0340/challenge', ...args)));\n}\n\n/**\n * Schnorr public key is just `x` coordinate of Point as per BIP340.\n */\nfunction schnorrGetPublicKey(secretKey: Hex): Uint8Array {\n return schnorrGetExtPubKey(secretKey).bytes; // d'=int(sk). Fail if d'=0 or d'\u2265n. Ret bytes(d'\u22C5G)\n}\n\n/**\n * Creates Schnorr signature as per BIP340. Verifies itself before returning anything.\n * auxRand is optional and is not the sole source of k generation: bad CSPRNG won't be dangerous.\n */\nfunction schnorrSign(message: Hex, secretKey: PrivKey, auxRand: Hex = randomBytes(32)): Uint8Array {\n const { Fn } = Pointk1;\n const m = ensureBytes('message', message);\n const { bytes: px, scalar: d } = schnorrGetExtPubKey(secretKey); // checks for isWithinCurveOrder\n const a = ensureBytes('auxRand', auxRand, 32); // Auxiliary random data a: a 32-byte array\n const t = Fn.toBytes(d ^ num(taggedHash('BIP0340/aux', a))); // Let t be the byte-wise xor of bytes(d) and hash/aux(a)\n const rand = taggedHash('BIP0340/nonce', t, px, m); // Let rand = hash/nonce(t || bytes(P) || m)\n // Let k' = int(rand) mod n. Fail if k' = 0. Let R = k'\u22C5G\n const { bytes: rx, scalar: k } = schnorrGetExtPubKey(rand);\n const e = challenge(rx, px, m); // Let e = int(hash/challenge(bytes(R) || bytes(P) || m)) mod n.\n const sig = new Uint8Array(64); // Let sig = bytes(R) || bytes((k + ed) mod n).\n sig.set(rx, 0);\n sig.set(Fn.toBytes(Fn.create(k + e * d)), 32);\n // If Verify(bytes(P), m, sig) (see below) returns failure, abort\n if (!schnorrVerify(sig, m, px)) throw new Error('sign: Invalid signature produced');\n return sig;\n}\n\n/**\n * Verifies Schnorr signature.\n * Will swallow errors & return false except for initial type validation of arguments.\n */\nfunction schnorrVerify(signature: Hex, message: Hex, publicKey: Hex): boolean {\n const { Fn, BASE } = Pointk1;\n const sig = ensureBytes('signature', signature, 64);\n const m = ensureBytes('message', message);\n const pub = ensureBytes('publicKey', publicKey, 32);\n try {\n const P = lift_x(num(pub)); // P = lift_x(int(pk)); fail if that fails\n const r = num(sig.subarray(0, 32)); // Let r = int(sig[0:32]); fail if r \u2265 p.\n if (!inRange(r, _1n, secp256k1_CURVE.p)) return false;\n const s = num(sig.subarray(32, 64)); // Let s = int(sig[32:64]); fail if s \u2265 n.\n if (!inRange(s, _1n, secp256k1_CURVE.n)) return false;\n // int(challenge(bytes(r)||bytes(P)||m))%n\n const e = challenge(Fn.toBytes(r), pointToBytes(P), m);\n // R = s\u22C5G - e\u22C5P, where -eP == (n-e)P\n const R = BASE.multiplyUnsafe(s).add(P.multiplyUnsafe(Fn.neg(e)));\n const { x, y } = R.toAffine();\n // Fail if is_infinite(R) / not has_even_y(R) / x(R) \u2260 r.\n if (R.is0() || !hasEven(y) || x !== r) return false;\n return true;\n } catch (error) {\n return false;\n }\n}\n\nexport type SecpSchnorr = {\n keygen: (seed?: Uint8Array) => { secretKey: Uint8Array; publicKey: Uint8Array };\n getPublicKey: typeof schnorrGetPublicKey;\n sign: typeof schnorrSign;\n verify: typeof schnorrVerify;\n Point: WeierstrassPointCons<bigint>;\n utils: {\n randomSecretKey: (seed?: Uint8Array) => Uint8Array;\n pointToBytes: (point: PointType<bigint>) => Uint8Array;\n lift_x: typeof lift_x;\n taggedHash: typeof taggedHash;\n\n /** @deprecated use `randomSecretKey` */\n randomPrivateKey: (seed?: Uint8Array) => Uint8Array;\n /** @deprecated use `utils` */\n numberToBytesBE: typeof numberToBytesBE;\n /** @deprecated use `utils` */\n bytesToNumberBE: typeof bytesToNumberBE;\n /** @deprecated use `modular` */\n mod: typeof mod;\n };\n lengths: CurveLengths;\n};\n/**\n * Schnorr signatures over secp256k1.\n * https://github.com/bitcoin/bips/blob/master/bip-0340.mediawiki\n * @example\n * ```js\n * import { schnorr } from '@noble/curves/secp256k1';\n * const { secretKey, publicKey } = schnorr.keygen();\n * // const publicKey = schnorr.getPublicKey(secretKey);\n * const msg = new TextEncoder().encode('hello');\n * const sig = schnorr.sign(msg, secretKey);\n * const isValid = schnorr.verify(sig, msg, publicKey);\n * ```\n */\nexport const schnorr: SecpSchnorr = /* @__PURE__ */ (() => {\n const size = 32;\n const seedLength = 48;\n const randomSecretKey = (seed = randomBytes(seedLength)): Uint8Array => {\n return mapHashToField(seed, secp256k1_CURVE.n);\n };\n // TODO: remove\n secp256k1.utils.randomSecretKey;\n function keygen(seed?: Uint8Array) {\n const secretKey = randomSecretKey(seed);\n return { secretKey, publicKey: schnorrGetPublicKey(secretKey) };\n }\n return {\n keygen,\n getPublicKey: schnorrGetPublicKey,\n sign: schnorrSign,\n verify: schnorrVerify,\n Point: Pointk1,\n utils: {\n randomSecretKey: randomSecretKey,\n randomPrivateKey: randomSecretKey,\n taggedHash,\n\n // TODO: remove\n lift_x,\n pointToBytes,\n numberToBytesBE,\n bytesToNumberBE,\n mod,\n },\n lengths: {\n secretKey: size,\n publicKey: size,\n publicKeyHasPrefix: false,\n signature: size * 2,\n seed: seedLength,\n },\n };\n})();\n\nconst isoMap = /* @__PURE__ */ (() =>\n isogenyMap(\n Fpk1,\n [\n // xNum\n [\n '0x8e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38daaaaa8c7',\n '0x7d3d4c80bc321d5b9f315cea7fd44c5d595d2fc0bf63b92dfff1044f17c6581',\n '0x534c328d23f234e6e2a413deca25caece4506144037c40314ecbd0b53d9dd262',\n '0x8e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38e38daaaaa88c',\n ],\n // xDen\n [\n '0xd35771193d94918a9ca34ccbb7b640dd86cd409542f8487d9fe6b745781eb49b',\n '0xedadc6f64383dc1df7c4b2d51b54225406d36b641f5e41bbc52a56612a8c6d14',\n '0x0000000000000000000000000000000000000000000000000000000000000001', // LAST 1\n ],\n // yNum\n [\n '0x4bda12f684bda12f684bda12f684bda12f684bda12f684bda12f684b8e38e23c',\n '0xc75e0c32d5cb7c0fa9d0a54b12a0a6d5647ab046d686da6fdffc90fc201d71a3',\n '0x29a6194691f91a73715209ef6512e576722830a201be2018a765e85a9ecee931',\n '0x2f684bda12f684bda12f684bda12f684bda12f684bda12f684bda12f38e38d84',\n ],\n // yDen\n [\n '0xfffffffffffffffffffffffffffffffffffffffffffffffffffffffefffff93b',\n '0x7a06534bb8bdb49fd5e9e6632722c2989467c1bfc8e8d978dfb425d2685c2573',\n '0x6484aa716545ca2cf3a70c3fa8fe337e0a3d21162f0d6299a7bf8192bfd2a76f',\n '0x0000000000000000000000000000000000000000000000000000000000000001', // LAST 1\n ],\n ].map((i) => i.map((j) => BigInt(j))) as [bigint[], bigint[], bigint[], bigint[]]\n ))();\nconst mapSWU = /* @__PURE__ */ (() =>\n mapToCurveSimpleSWU(Fpk1, {\n A: BigInt('0x3f8731abdd661adca08a5558f0f5d272e953d363cb6f0e5d405447c01a444533'),\n B: BigInt('1771'),\n Z: Fpk1.create(BigInt('-11')),\n }))();\n\n/** Hashing / encoding to secp256k1 points / field. RFC 9380 methods. */\nexport const secp256k1_hasher: H2CHasher<bigint> = /* @__PURE__ */ (() =>\n createHasher(\n secp256k1.Point,\n (scalars: bigint[]) => {\n const { x, y } = mapSWU(Fpk1.create(scalars[0]));\n return isoMap(x, y);\n },\n {\n DST: 'secp256k1_XMD:SHA-256_SSWU_RO_',\n encodeDST: 'secp256k1_XMD:SHA-256_SSWU_NU_',\n p: Fpk1.ORDER,\n m: 1,\n k: 128,\n expand: 'xmd',\n hash: sha256,\n }\n ))();\n\n/** @deprecated use `import { secp256k1_hasher } from '@noble/curves/secp256k1.js';` */\nexport const hashToCurve: H2CMethod<bigint> = /* @__PURE__ */ (() =>\n secp256k1_hasher.hashToCurve)();\n\n/** @deprecated use `import { secp256k1_hasher } from '@noble/curves/secp256k1.js';` */\nexport const encodeToCurve: H2CMethod<bigint> = /* @__PURE__ */ (() =>\n secp256k1_hasher.encodeToCurve)();\n", "/**\n * Signing a message failed\n */\nexport class SigningError extends Error {\n constructor (message = 'An error occurred while signing a message') {\n super(message)\n this.name = 'SigningError'\n }\n}\n\n/**\n * Verifying a message signature failed\n */\nexport class VerificationError extends Error {\n constructor (message = 'An error occurred while verifying a message') {\n super(message)\n this.name = 'VerificationError'\n }\n}\n\n/**\n * WebCrypto was not available in the current context\n */\nexport class WebCryptoMissingError extends Error {\n constructor (message = 'Missing Web Crypto API') {\n super(message)\n this.name = 'WebCryptoMissingError'\n }\n}\n", "import { base58btc } from 'multiformats/bases/base58'\nimport { CID } from 'multiformats/cid'\nimport { identity } from 'multiformats/hashes/identity'\nimport { equals as uint8ArrayEquals } from 'uint8arrays/equals'\nimport { publicKeyToProtobuf } from '../index.js'\nimport { validateSecp256k1PublicKey, compressSecp256k1PublicKey, computeSecp256k1PublicKey, validateSecp256k1PrivateKey } from './utils.js'\nimport { hashAndVerify, hashAndSign } from './index.js'\nimport type { Secp256k1PublicKey as Secp256k1PublicKeyInterface, Secp256k1PrivateKey as Secp256k1PrivateKeyInterface, AbortOptions } from '@libp2p/interface'\nimport type { Digest } from 'multiformats/hashes/digest'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nexport class Secp256k1PublicKey implements Secp256k1PublicKeyInterface {\n public readonly type = 'secp256k1'\n public readonly raw: Uint8Array\n public readonly _key: Uint8Array\n\n constructor (key: Uint8Array) {\n this._key = validateSecp256k1PublicKey(key)\n this.raw = compressSecp256k1PublicKey(this._key)\n }\n\n toMultihash (): Digest<0x0, number> {\n return identity.digest(publicKeyToProtobuf(this))\n }\n\n toCID (): CID<unknown, 114, 0x0, 1> {\n return CID.createV1(114, this.toMultihash())\n }\n\n toString (): string {\n return base58btc.encode(this.toMultihash().bytes).substring(1)\n }\n\n equals (key: any): boolean {\n if (key == null || !(key.raw instanceof Uint8Array)) {\n return false\n }\n\n return uint8ArrayEquals(this.raw, key.raw)\n }\n\n verify (data: Uint8Array | Uint8ArrayList, sig: Uint8Array, options?: AbortOptions): boolean {\n return hashAndVerify(this._key, sig, data, options)\n }\n}\n\nexport class Secp256k1PrivateKey implements Secp256k1PrivateKeyInterface {\n public readonly type = 'secp256k1'\n public readonly raw: Uint8Array\n public readonly publicKey: Secp256k1PublicKey\n\n constructor (key: Uint8Array, publicKey?: Uint8Array) {\n this.raw = validateSecp256k1PrivateKey(key)\n this.publicKey = new Secp256k1PublicKey(publicKey ?? computeSecp256k1PublicKey(key))\n }\n\n equals (key?: any): boolean {\n if (key == null || !(key.raw instanceof Uint8Array)) {\n return false\n }\n\n return uint8ArrayEquals(this.raw, key.raw)\n }\n\n sign (message: Uint8Array | Uint8ArrayList, options?: AbortOptions): Uint8Array | Promise<Uint8Array> {\n return hashAndSign(this.raw, message, options)\n }\n}\n", "import { InvalidPrivateKeyError, InvalidPublicKeyError } from '@libp2p/interface'\nimport { secp256k1 as secp } from '@noble/curves/secp256k1'\nimport { Secp256k1PublicKey as Secp256k1PublicKeyClass, Secp256k1PrivateKey as Secp256k1PrivateKeyClass } from './secp256k1.js'\nimport type { Secp256k1PublicKey, Secp256k1PrivateKey } from '@libp2p/interface'\n\nconst PRIVATE_KEY_BYTE_LENGTH = 32\n\nexport { PRIVATE_KEY_BYTE_LENGTH as privateKeyLength }\n\nexport function unmarshalSecp256k1PrivateKey (bytes: Uint8Array): Secp256k1PrivateKey {\n return new Secp256k1PrivateKeyClass(bytes)\n}\n\nexport function unmarshalSecp256k1PublicKey (bytes: Uint8Array): Secp256k1PublicKey {\n return new Secp256k1PublicKeyClass(bytes)\n}\n\nexport async function generateSecp256k1KeyPair (): Promise<Secp256k1PrivateKey> {\n const privateKeyBytes = generateSecp256k1PrivateKey()\n return new Secp256k1PrivateKeyClass(privateKeyBytes)\n}\n\nexport function compressSecp256k1PublicKey (key: Uint8Array): Uint8Array {\n const point = secp.ProjectivePoint.fromHex(key).toRawBytes(true)\n return point\n}\n\nexport function decompressSecp256k1PublicKey (key: Uint8Array): Uint8Array {\n const point = secp.ProjectivePoint.fromHex(key).toRawBytes(false)\n return point\n}\n\nexport function validateSecp256k1PrivateKey (key: Uint8Array): Uint8Array {\n try {\n secp.getPublicKey(key, true)\n\n return key\n } catch (err) {\n throw new InvalidPrivateKeyError(String(err))\n }\n}\n\nexport function validateSecp256k1PublicKey (key: Uint8Array): Uint8Array {\n try {\n secp.ProjectivePoint.fromHex(key)\n\n return key\n } catch (err) {\n throw new InvalidPublicKeyError(String(err))\n }\n}\n\nexport function computeSecp256k1PublicKey (privateKey: Uint8Array): Uint8Array {\n try {\n return secp.getPublicKey(privateKey, true)\n } catch (err) {\n throw new InvalidPrivateKeyError(String(err))\n }\n}\n\nexport function generateSecp256k1PrivateKey (): Uint8Array {\n return secp.utils.randomPrivateKey()\n}\n", "/**\n * @packageDocumentation\n *\n * ## Supported Key Types\n *\n * Currently the `'RSA'`, `'ed25519'`, and `secp256k1` types are supported, although ed25519 and secp256k1 keys support only signing and verification of messages.\n *\n * For encryption / decryption support, RSA keys should be used.\n */\n\nimport { InvalidParametersError, UnsupportedKeyTypeError } from '@libp2p/interface'\nimport { ECDSAPrivateKey as ECDSAPrivateKeyClass } from './ecdsa/ecdsa.js'\nimport { ECDSA_P_256_OID, ECDSA_P_384_OID, ECDSA_P_521_OID } from './ecdsa/index.js'\nimport { generateECDSAKeyPair, pkiMessageToECDSAPrivateKey, pkiMessageToECDSAPublicKey, unmarshalECDSAPrivateKey, unmarshalECDSAPublicKey } from './ecdsa/utils.js'\nimport { privateKeyLength as ed25519PrivateKeyLength, publicKeyLength as ed25519PublicKeyLength } from './ed25519/index.js'\nimport { generateEd25519KeyPair, generateEd25519KeyPairFromSeed, unmarshalEd25519PrivateKey, unmarshalEd25519PublicKey } from './ed25519/utils.js'\nimport * as pb from './keys.js'\nimport { decodeDer } from './rsa/der.js'\nimport { RSAES_PKCS1_V1_5_OID } from './rsa/index.js'\nimport { pkcs1ToRSAPrivateKey, pkixToRSAPublicKey, generateRSAKeyPair, pkcs1MessageToRSAPrivateKey, pkixMessageToRSAPublicKey, jwkToRSAPrivateKey } from './rsa/utils.js'\nimport { privateKeyLength as secp256k1PrivateKeyLength, publicKeyLength as secp256k1PublicKeyLength } from './secp256k1/index.js'\nimport { generateSecp256k1KeyPair, unmarshalSecp256k1PrivateKey, unmarshalSecp256k1PublicKey } from './secp256k1/utils.js'\nimport type { Curve } from './ecdsa/index.js'\nimport type { PrivateKey, PublicKey, KeyType, RSAPrivateKey, Secp256k1PrivateKey, Ed25519PrivateKey, Secp256k1PublicKey, Ed25519PublicKey, ECDSAPrivateKey, ECDSAPublicKey } from '@libp2p/interface'\nimport type { MultihashDigest } from 'multiformats'\nimport type { Digest } from 'multiformats/hashes/digest'\n\nexport { generateEphemeralKeyPair } from './ecdh/index.js'\nexport type { Curve } from './ecdh/index.js'\nexport type { ECDHKey, EnhancedKey, EnhancedKeyPair, ECDHKeyPair } from './interface.js'\nexport { keyStretcher } from './key-stretcher.js'\n\n/**\n * Generates a keypair of the given type and bitsize\n */\nexport async function generateKeyPair (type: 'Ed25519'): Promise<Ed25519PrivateKey>\nexport async function generateKeyPair (type: 'secp256k1'): Promise<Secp256k1PrivateKey>\nexport async function generateKeyPair (type: 'ECDSA', curve?: Curve): Promise<ECDSAPrivateKey>\nexport async function generateKeyPair (type: 'RSA', bits?: number): Promise<RSAPrivateKey>\nexport async function generateKeyPair (type: KeyType, bits?: number): Promise<PrivateKey>\nexport async function generateKeyPair (type: KeyType, bits?: number | string): Promise<unknown> {\n if (type === 'Ed25519') {\n return generateEd25519KeyPair()\n }\n\n if (type === 'secp256k1') {\n return generateSecp256k1KeyPair()\n }\n\n if (type === 'RSA') {\n return generateRSAKeyPair(toBits(bits))\n }\n\n if (type === 'ECDSA') {\n return generateECDSAKeyPair(toCurve(bits))\n }\n\n throw new UnsupportedKeyTypeError()\n}\n\n/**\n * Generates a keypair of the given type from the passed seed. Currently only\n * supports Ed25519 keys.\n *\n * Seed is a 32 byte uint8array\n */\nexport async function generateKeyPairFromSeed (type: 'Ed25519', seed: Uint8Array): Promise<Ed25519PrivateKey>\nexport async function generateKeyPairFromSeed <T extends KeyType> (type: T, seed: Uint8Array, bits?: number): Promise<never>\nexport async function generateKeyPairFromSeed (type: string, seed: Uint8Array): Promise<unknown> {\n if (type !== 'Ed25519') {\n throw new UnsupportedKeyTypeError('Seed key derivation only supported for Ed25519 keys')\n }\n\n return generateEd25519KeyPairFromSeed(seed)\n}\n\n/**\n * Converts a protobuf serialized public key into its representative object.\n *\n * For RSA public keys optionally pass the multihash digest of the public key if\n * it is known. If the digest is omitted it will be calculated which can be\n * expensive.\n *\n * For other key types the digest option is ignored.\n */\nexport function publicKeyFromProtobuf (buf: Uint8Array, digest?: Digest<18, number>): PublicKey {\n const { Type, Data } = pb.PublicKey.decode(buf)\n const data = Data ?? new Uint8Array()\n\n switch (Type) {\n case pb.KeyType.RSA:\n return pkixToRSAPublicKey(data, digest)\n case pb.KeyType.Ed25519:\n return unmarshalEd25519PublicKey(data)\n case pb.KeyType.secp256k1:\n return unmarshalSecp256k1PublicKey(data)\n case pb.KeyType.ECDSA:\n return unmarshalECDSAPublicKey(data)\n default:\n throw new UnsupportedKeyTypeError()\n }\n}\n\n/**\n * Creates a public key from the raw key bytes\n */\nexport function publicKeyFromRaw (buf: Uint8Array): PublicKey {\n if (buf.byteLength === ed25519PublicKeyLength) {\n return unmarshalEd25519PublicKey(buf)\n } else if (buf.byteLength === secp256k1PublicKeyLength) {\n return unmarshalSecp256k1PublicKey(buf)\n }\n\n const message = decodeDer(buf)\n const ecdsaOid = message[1]?.[0]\n\n if (ecdsaOid === ECDSA_P_256_OID || ecdsaOid === ECDSA_P_384_OID || ecdsaOid === ECDSA_P_521_OID) {\n return pkiMessageToECDSAPublicKey(message)\n }\n\n if (message[0]?.[0] === RSAES_PKCS1_V1_5_OID) {\n return pkixMessageToRSAPublicKey(message, buf)\n }\n\n throw new InvalidParametersError('Could not extract public key from raw bytes')\n}\n\n/**\n * Creates a public key from an identity multihash which contains a protobuf\n * encoded Ed25519 or secp256k1 public key.\n *\n * RSA keys are not supported as in practice we they are not stored in identity\n * multihash since the hash would be very large.\n */\nexport function publicKeyFromMultihash (digest: MultihashDigest<0x0>): Ed25519PublicKey | Secp256k1PublicKey | ECDSAPublicKey {\n const { Type, Data } = pb.PublicKey.decode(digest.digest)\n const data = Data ?? new Uint8Array()\n\n switch (Type) {\n case pb.KeyType.Ed25519:\n return unmarshalEd25519PublicKey(data)\n case pb.KeyType.secp256k1:\n return unmarshalSecp256k1PublicKey(data)\n case pb.KeyType.ECDSA:\n return unmarshalECDSAPublicKey(data)\n default:\n throw new UnsupportedKeyTypeError()\n }\n}\n\n/**\n * Converts a public key object into a protobuf serialized public key\n */\nexport function publicKeyToProtobuf (key: PublicKey): Uint8Array {\n return pb.PublicKey.encode({\n Type: pb.KeyType[key.type],\n Data: key.raw\n })\n}\n\n/**\n * Converts a protobuf serialized private key into its representative object\n */\nexport function privateKeyFromProtobuf (buf: Uint8Array): Ed25519PrivateKey | Secp256k1PrivateKey | RSAPrivateKey | ECDSAPrivateKey {\n const decoded = pb.PrivateKey.decode(buf)\n const data = decoded.Data ?? new Uint8Array()\n\n switch (decoded.Type) {\n case pb.KeyType.RSA:\n return pkcs1ToRSAPrivateKey(data)\n case pb.KeyType.Ed25519:\n return unmarshalEd25519PrivateKey(data)\n case pb.KeyType.secp256k1:\n return unmarshalSecp256k1PrivateKey(data)\n case pb.KeyType.ECDSA:\n return unmarshalECDSAPrivateKey(data)\n default:\n throw new UnsupportedKeyTypeError()\n }\n}\n\n/**\n * Creates a private key from the raw key bytes. For Ed25519 keys this requires\n * the public key to be appended to the private key otherwise we can't\n * differentiate between Ed25519 and secp256k1 keys as they are the same length.\n */\nexport function privateKeyFromRaw (buf: Uint8Array): PrivateKey {\n if (buf.byteLength === ed25519PrivateKeyLength) {\n return unmarshalEd25519PrivateKey(buf)\n } else if (buf.byteLength === secp256k1PrivateKeyLength) {\n return unmarshalSecp256k1PrivateKey(buf)\n }\n\n const message = decodeDer(buf)\n const ecdsaOid = message[2]?.[0]\n\n if (ecdsaOid === ECDSA_P_256_OID || ecdsaOid === ECDSA_P_384_OID || ecdsaOid === ECDSA_P_521_OID) {\n return pkiMessageToECDSAPrivateKey(message)\n }\n\n if (message.length > 8) {\n return pkcs1MessageToRSAPrivateKey(message)\n }\n\n throw new InvalidParametersError('Could not extract private key from raw bytes')\n}\n\n/**\n * Converts a private key object into a protobuf serialized private key\n */\nexport function privateKeyToProtobuf (key: PrivateKey): Uint8Array {\n return pb.PrivateKey.encode({\n Type: pb.KeyType[key.type],\n Data: key.raw\n })\n}\n\nfunction toBits (bits: any): number {\n if (bits == null) {\n return 2048\n }\n\n return parseInt(bits, 10)\n}\n\nfunction toCurve (curve: any): Curve {\n if (curve === 'P-256' || curve == null) {\n return 'P-256'\n }\n\n if (curve === 'P-384') {\n return 'P-384'\n }\n\n if (curve === 'P-521') {\n return 'P-521'\n }\n\n throw new InvalidParametersError('Unsupported curve, should be P-256, P-384 or P-521')\n}\n\n/**\n * Convert a libp2p RSA or ECDSA private key to a WebCrypto CryptoKeyPair\n */\nexport async function privateKeyToCryptoKeyPair (privateKey: PrivateKey): Promise<CryptoKeyPair> {\n if (privateKey.type === 'RSA') {\n return {\n privateKey: await crypto.subtle.importKey('jwk', privateKey.jwk, {\n name: 'RSASSA-PKCS1-v1_5',\n hash: { name: 'SHA-256' }\n }, true, ['sign']),\n publicKey: await crypto.subtle.importKey('jwk', privateKey.publicKey.jwk, {\n name: 'RSASSA-PKCS1-v1_5',\n hash: { name: 'SHA-256' }\n }, true, ['verify'])\n }\n }\n\n if (privateKey.type === 'ECDSA') {\n return {\n privateKey: await crypto.subtle.importKey('jwk', privateKey.jwk, {\n name: 'ECDSA',\n namedCurve: privateKey.jwk.crv ?? 'P-256'\n }, true, ['sign']),\n publicKey: await crypto.subtle.importKey('jwk', privateKey.publicKey.jwk, {\n name: 'ECDSA',\n namedCurve: privateKey.publicKey.jwk.crv ?? 'P-256'\n }, true, ['verify'])\n }\n }\n\n throw new InvalidParametersError('Only RSA and ECDSA keys are supported')\n}\n\n/**\n * Convert a RSA or ECDSA WebCrypto CryptoKeyPair to a libp2p private key\n */\nexport async function privateKeyFromCryptoKeyPair (keyPair: CryptoKeyPair): Promise<PrivateKey> {\n if (keyPair.privateKey.algorithm.name === 'RSASSA-PKCS1-v1_5') {\n const jwk = await crypto.subtle.exportKey('jwk', keyPair.privateKey)\n\n return jwkToRSAPrivateKey(jwk)\n }\n\n if (keyPair.privateKey.algorithm.name === 'ECDSA') {\n const jwk = await crypto.subtle.exportKey('jwk', keyPair.privateKey)\n\n return new ECDSAPrivateKeyClass(jwk)\n }\n\n throw new InvalidParametersError('Only RSA and ECDSA keys are supported')\n}\n", "/**\n * @packageDocumentation\n *\n * An implementation of a peer id\n *\n * @example\n *\n * ```TypeScript\n * import { peerIdFromString } from '@libp2p/peer-id'\n * const peer = peerIdFromString('k51qzi5uqu5dkwkqm42v9j9kqcam2jiuvloi16g72i4i4amoo2m8u3ol3mqu6s')\n *\n * console.log(peer.toCID()) // CID(bafzaa...)\n * console.log(peer.toString()) // \"12D3K...\"\n * ```\n */\n\nimport { peerIdSymbol } from '@libp2p/interface'\nimport { base58btc } from 'multiformats/bases/base58'\nimport { CID } from 'multiformats/cid'\nimport { identity } from 'multiformats/hashes/identity'\nimport { equals as uint8ArrayEquals } from 'uint8arrays/equals'\nimport { fromString as uint8ArrayFromString } from 'uint8arrays/from-string'\nimport { toString as uint8ArrayToString } from 'uint8arrays/to-string'\nimport type { Ed25519PeerId as Ed25519PeerIdInterface, PeerIdType, RSAPeerId as RSAPeerIdInterface, URLPeerId as URLPeerIdInterface, Secp256k1PeerId as Secp256k1PeerIdInterface, PeerId, PublicKey, Ed25519PublicKey, Secp256k1PublicKey, RSAPublicKey } from '@libp2p/interface'\nimport type { MultihashDigest } from 'multiformats/hashes/interface'\n\nconst inspect = Symbol.for('nodejs.util.inspect.custom')\n\n// these values are from https://github.com/multiformats/multicodec/blob/master/table.csv\nconst LIBP2P_KEY_CODE = 0x72\n\ninterface PeerIdInit <DigestCode extends number> {\n type: PeerIdType\n multihash: MultihashDigest<DigestCode>\n}\n\ninterface RSAPeerIdInit {\n multihash: MultihashDigest<0x12>\n publicKey?: RSAPublicKey\n}\n\ninterface Ed25519PeerIdInit {\n multihash: MultihashDigest<0x0>\n publicKey: Ed25519PublicKey\n}\n\ninterface Secp256k1PeerIdInit {\n multihash: MultihashDigest<0x0>\n publicKey: Secp256k1PublicKey\n}\n\nclass PeerIdImpl <DigestCode extends number> {\n public type: PeerIdType\n private readonly multihash: MultihashDigest<DigestCode>\n public readonly publicKey?: PublicKey\n private string?: string\n\n constructor (init: PeerIdInit<DigestCode>) {\n this.type = init.type\n this.multihash = init.multihash\n\n // mark string cache as non-enumerable\n Object.defineProperty(this, 'string', {\n enumerable: false,\n writable: true\n })\n }\n\n get [Symbol.toStringTag] (): string {\n return `PeerId(${this.toString()})`\n }\n\n readonly [peerIdSymbol] = true\n\n toString (): string {\n if (this.string == null) {\n this.string = base58btc.encode(this.multihash.bytes).slice(1)\n }\n\n return this.string\n }\n\n toMultihash (): MultihashDigest<DigestCode> {\n return this.multihash\n }\n\n // return self-describing String representation\n // in default format from RFC 0001: https://github.com/libp2p/specs/pull/209\n toCID (): CID<Uint8Array, 0x72, DigestCode, 1> {\n return CID.createV1(LIBP2P_KEY_CODE, this.multihash)\n }\n\n toJSON (): string {\n return this.toString()\n }\n\n /**\n * Checks the equality of `this` peer against a given PeerId\n */\n equals (id?: PeerId | Uint8Array | string): boolean {\n if (id == null) {\n return false\n }\n\n if (id instanceof Uint8Array) {\n return uint8ArrayEquals(this.multihash.bytes, id)\n } else if (typeof id === 'string') {\n return this.toString() === id\n } else if (id?.toMultihash()?.bytes != null) {\n return uint8ArrayEquals(this.multihash.bytes, id.toMultihash().bytes)\n } else {\n throw new Error('not valid Id')\n }\n }\n\n /**\n * Returns PeerId as a human-readable string\n * https://nodejs.org/api/util.html#utilinspectcustom\n *\n * @example\n * ```TypeScript\n * import { peerIdFromString } from '@libp2p/peer-id'\n *\n * console.info(peerIdFromString('QmFoo'))\n * // 'PeerId(QmFoo)'\n * ```\n */\n [inspect] (): string {\n return `PeerId(${this.toString()})`\n }\n}\n\nexport class RSAPeerId extends PeerIdImpl<0x12> implements RSAPeerIdInterface {\n public readonly type = 'RSA'\n public readonly publicKey?: RSAPublicKey\n\n constructor (init: RSAPeerIdInit) {\n super({ ...init, type: 'RSA' })\n\n this.publicKey = init.publicKey\n }\n}\n\nexport class Ed25519PeerId extends PeerIdImpl<0x0> implements Ed25519PeerIdInterface {\n public readonly type = 'Ed25519'\n public readonly publicKey: Ed25519PublicKey\n\n constructor (init: Ed25519PeerIdInit) {\n super({ ...init, type: 'Ed25519' })\n\n this.publicKey = init.publicKey\n }\n}\n\nexport class Secp256k1PeerId extends PeerIdImpl<0x0> implements Secp256k1PeerIdInterface {\n public readonly type = 'secp256k1'\n public readonly publicKey: Secp256k1PublicKey\n\n constructor (init: Secp256k1PeerIdInit) {\n super({ ...init, type: 'secp256k1' })\n\n this.publicKey = init.publicKey\n }\n}\n\n// these values are from https://github.com/multiformats/multicodec/blob/master/table.csv\nconst TRANSPORT_IPFS_GATEWAY_HTTP_CODE = 0x0920\n\nexport class URLPeerId implements URLPeerIdInterface {\n readonly type = 'url'\n readonly multihash: MultihashDigest<0x0>\n readonly publicKey: undefined\n readonly url: string\n\n constructor (url: URL) {\n this.url = url.toString()\n this.multihash = identity.digest(uint8ArrayFromString(this.url))\n }\n\n [inspect] (): string {\n return `PeerId(${this.url})`\n }\n\n readonly [peerIdSymbol] = true\n\n toString (): string {\n return this.toCID().toString()\n }\n\n toMultihash (): MultihashDigest<0x0> {\n return this.multihash\n }\n\n toCID (): CID<Uint8Array, 0x0920, 0x0, 1> {\n return CID.createV1(TRANSPORT_IPFS_GATEWAY_HTTP_CODE, this.toMultihash())\n }\n\n toJSON (): string {\n return this.toString()\n }\n\n equals (other?: PeerId | Uint8Array | string): boolean {\n if (other == null) {\n return false\n }\n\n if (other instanceof Uint8Array) {\n other = uint8ArrayToString(other)\n }\n\n return other.toString() === this.toString()\n }\n}\n", "/**\n * @packageDocumentation\n *\n * An implementation of a peer id\n *\n * @example\n *\n * ```TypeScript\n * import { peerIdFromString } from '@libp2p/peer-id'\n * const peer = peerIdFromString('12D3KooWKnDdG3iXw9eTFijk3EWSunZcFi54Zka4wmtqtt6rPxc8')\n *\n * console.log(peer.toCID()) // CID(bafzaa...)\n * console.log(peer.toString()) // \"12D3K...\"\n * ```\n */\n\nimport { publicKeyFromMultihash } from '@libp2p/crypto/keys'\nimport { InvalidCIDError, InvalidMultihashError, InvalidParametersError, UnsupportedKeyTypeError } from '@libp2p/interface'\nimport { base58btc } from 'multiformats/bases/base58'\nimport { CID } from 'multiformats/cid'\nimport * as Digest from 'multiformats/hashes/digest'\nimport { identity } from 'multiformats/hashes/identity'\nimport { sha256 } from 'multiformats/hashes/sha2'\nimport { toString as uint8ArrayToString } from 'uint8arrays/to-string'\nimport { RSAPeerId as RSAPeerIdClass, Ed25519PeerId as Ed25519PeerIdClass, Secp256k1PeerId as Secp256k1PeerIdClass, URLPeerId as URLPeerIdClass } from './peer-id.js'\nimport type { Ed25519PeerId, RSAPeerId, URLPeerId, Secp256k1PeerId, PeerId, PublicKey, Ed25519PublicKey, Secp256k1PublicKey, RSAPublicKey, Ed25519PrivateKey, Secp256k1PrivateKey, RSAPrivateKey, PrivateKey } from '@libp2p/interface'\nimport type { MultibaseDecoder } from 'multiformats/cid'\nimport type { MultihashDigest } from 'multiformats/hashes/interface'\n\n// these values are from https://github.com/multiformats/multicodec/blob/master/table.csv\nconst LIBP2P_KEY_CODE = 0x72\nconst TRANSPORT_IPFS_GATEWAY_HTTP_CODE = 0x0920\n\nexport function peerIdFromString (str: string, decoder?: MultibaseDecoder<any>): Ed25519PeerId | Secp256k1PeerId | RSAPeerId | URLPeerId {\n let multihash: MultihashDigest\n\n if (str.charAt(0) === '1' || str.charAt(0) === 'Q') {\n // identity hash ed25519/secp256k1 key or sha2-256 hash of\n // rsa public key - base58btc encoded either way\n multihash = Digest.decode(base58btc.decode(`z${str}`))\n } else if (str.startsWith('k51qzi5uqu5') || str.startsWith('kzwfwjn5ji4') || str.startsWith('k2k4r8') || str.startsWith('bafz')) {\n // base36 encoded CIDv1 with libp2p-key and identity hash (for ed25519/secp256k1/rsa) or base32 encoded CIDv1 with libp2p-key and identity hash (for ed25519/secp256k1/rsa)\n return peerIdFromCID(CID.parse(str))\n } else {\n if (decoder == null) {\n throw new InvalidParametersError('Please pass a multibase decoder for strings that do not start with \"1\" or \"Q\"')\n }\n\n multihash = Digest.decode(decoder.decode(str))\n }\n\n return peerIdFromMultihash(multihash)\n}\n\nexport function peerIdFromPublicKey (publicKey: Ed25519PublicKey): Ed25519PeerId\nexport function peerIdFromPublicKey (publicKey: Secp256k1PublicKey): Secp256k1PeerId\nexport function peerIdFromPublicKey (publicKey: RSAPublicKey): RSAPeerId\nexport function peerIdFromPublicKey (publicKey: PublicKey): PeerId\nexport function peerIdFromPublicKey (publicKey: PublicKey): PeerId {\n if (publicKey.type === 'Ed25519') {\n return new Ed25519PeerIdClass({\n multihash: publicKey.toCID().multihash,\n publicKey\n })\n } else if (publicKey.type === 'secp256k1') {\n return new Secp256k1PeerIdClass({\n multihash: publicKey.toCID().multihash,\n publicKey\n })\n } else if (publicKey.type === 'RSA') {\n return new RSAPeerIdClass({\n multihash: publicKey.toCID().multihash,\n publicKey\n })\n }\n\n throw new UnsupportedKeyTypeError()\n}\n\nexport function peerIdFromPrivateKey (privateKey: Ed25519PrivateKey): Ed25519PeerId\nexport function peerIdFromPrivateKey (privateKey: Secp256k1PrivateKey): Secp256k1PeerId\nexport function peerIdFromPrivateKey (privateKey: RSAPrivateKey): RSAPeerId\nexport function peerIdFromPrivateKey (privateKey: PrivateKey): PeerId\nexport function peerIdFromPrivateKey (privateKey: PrivateKey): PeerId {\n return peerIdFromPublicKey(privateKey.publicKey)\n}\n\nexport function peerIdFromMultihash (multihash: MultihashDigest): PeerId {\n if (isSha256Multihash(multihash)) {\n return new RSAPeerIdClass({ multihash })\n } else if (isIdentityMultihash(multihash)) {\n try {\n const publicKey = publicKeyFromMultihash(multihash)\n\n if (publicKey.type === 'Ed25519') {\n return new Ed25519PeerIdClass({ multihash, publicKey })\n } else if (publicKey.type === 'secp256k1') {\n return new Secp256k1PeerIdClass({ multihash, publicKey })\n }\n } catch (err) {\n // was not Ed or secp key, try URL\n const url = uint8ArrayToString(multihash.digest)\n\n return new URLPeerIdClass(new URL(url))\n }\n }\n\n throw new InvalidMultihashError('Supplied PeerID Multihash is invalid')\n}\n\nexport function peerIdFromCID (cid: CID): Ed25519PeerId | Secp256k1PeerId | RSAPeerId | URLPeerId {\n if (cid?.multihash == null || cid.version == null || (cid.version === 1 && (cid.code !== LIBP2P_KEY_CODE) && cid.code !== TRANSPORT_IPFS_GATEWAY_HTTP_CODE)) {\n throw new InvalidCIDError('Supplied PeerID CID is invalid')\n }\n\n if (cid.code === TRANSPORT_IPFS_GATEWAY_HTTP_CODE) {\n const url = uint8ArrayToString(cid.multihash.digest)\n\n return new URLPeerIdClass(new URL(url))\n }\n\n return peerIdFromMultihash(cid.multihash)\n}\n\nfunction isIdentityMultihash (multihash: MultihashDigest): multihash is MultihashDigest<0x0> {\n return multihash.code === identity.code\n}\n\nfunction isSha256Multihash (multihash: MultihashDigest): multihash is MultihashDigest<0x12> {\n return multihash.code === sha256.code\n}\n", "/**\n * @packageDocumentation\n *\n * A [libp2p transport](https://docs.libp2p.io/concepts/transports/overview/) based on the TCP networking stack.\n *\n * @example\n *\n * ```TypeScript\n * import { createLibp2p } from 'libp2p'\n * import { tcp } from '@libp2p/tcp'\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const node = await createLibp2p({\n * transports: [\n * tcp()\n * ]\n * })\n *\n * const ma = multiaddr('/ip4/123.123.123.123/tcp/1234')\n *\n * // dial a TCP connection, timing out after 10 seconds\n * const connection = await node.dial(ma, {\n * signal: AbortSignal.timeout(10_000)\n * })\n *\n * // use connection...\n * ```\n */\n\nimport net from 'net'\nimport { AbortError, TimeoutError, serviceCapabilities, transportSymbol } from '@libp2p/interface'\nimport { TCP as TCPMatcher } from '@multiformats/multiaddr-matcher'\nimport { CustomProgressEvent } from 'progress-events'\nimport { TCPListener } from './listener.js'\nimport { toMultiaddrConnection } from './socket-to-conn.js'\nimport { multiaddrToNetConfig } from './utils.js'\nimport type { TCPComponents, TCPCreateListenerOptions, TCPDialEvents, TCPDialOptions, TCPMetrics, TCPOptions } from './index.js'\nimport type { Logger, Connection, Transport, Listener, MultiaddrConnection } from '@libp2p/interface'\nimport type { Multiaddr } from '@multiformats/multiaddr'\nimport type { Socket, IpcSocketConnectOpts, TcpSocketConnectOpts } from 'net'\n\nexport class TCP implements Transport<TCPDialEvents> {\n private readonly opts: TCPOptions\n private readonly metrics?: TCPMetrics\n private readonly components: TCPComponents\n private readonly log: Logger\n\n constructor (components: TCPComponents, options: TCPOptions = {}) {\n this.log = components.logger.forComponent('libp2p:tcp')\n this.opts = options\n this.components = components\n\n if (components.metrics != null) {\n this.metrics = {\n events: components.metrics.registerCounterGroup('libp2p_tcp_dialer_events_total', {\n label: 'event',\n help: 'Total count of TCP dialer events by type'\n }),\n errors: components.metrics.registerCounterGroup('libp2p_tcp_dialer_errors_total', {\n label: 'event',\n help: 'Total count of TCP dialer events by type'\n })\n }\n }\n }\n\n readonly [transportSymbol] = true\n\n readonly [Symbol.toStringTag] = '@libp2p/tcp'\n\n readonly [serviceCapabilities]: string[] = [\n '@libp2p/transport'\n ]\n\n async dial (ma: Multiaddr, options: TCPDialOptions): Promise<Connection> {\n options.keepAlive = options.keepAlive ?? true\n options.noDelay = options.noDelay ?? true\n options.allowHalfOpen = options.allowHalfOpen ?? false\n\n // options.signal destroys the socket before 'connect' event\n const socket = await this._connect(ma, options)\n\n let maConn: MultiaddrConnection\n\n try {\n maConn = toMultiaddrConnection({\n socket,\n inactivityTimeout: this.opts.outboundSocketInactivityTimeout,\n metrics: this.metrics?.events,\n direction: 'outbound',\n remoteAddr: ma,\n log: this.log.newScope('connection')\n })\n } catch (err: any) {\n this.metrics?.errors.increment({ outbound_to_connection: true })\n socket.destroy(err)\n throw err\n }\n\n try {\n this.log('new outbound connection %s', maConn.remoteAddr)\n return await options.upgrader.upgradeOutbound(maConn, options)\n } catch (err: any) {\n this.metrics?.errors.increment({ outbound_upgrade: true })\n this.log.error('error upgrading outbound connection', err)\n maConn.abort(err)\n throw err\n }\n }\n\n async _connect (ma: Multiaddr, options: TCPDialOptions): Promise<Socket> {\n options.signal.throwIfAborted()\n options.onProgress?.(new CustomProgressEvent('tcp:open-connection'))\n\n let rawSocket: Socket\n\n return new Promise<Socket>((resolve, reject) => {\n const start = Date.now()\n const cOpts = multiaddrToNetConfig(ma, {\n ...(this.opts.dialOpts ?? {}),\n ...options\n }) as (IpcSocketConnectOpts & TcpSocketConnectOpts)\n\n this.log('dialing %a with opts %o', ma, cOpts)\n rawSocket = net.connect(cOpts)\n\n const onError = (err: Error): void => {\n this.log.error('dial to %a errored - %e', ma, err)\n const cOptsStr = cOpts.path ?? `${cOpts.host ?? ''}:${cOpts.port}`\n err.message = `connection error ${cOptsStr}: ${err.message}`\n this.metrics?.events.increment({ error: true })\n done(err)\n }\n\n const onTimeout = (): void => {\n this.log('connection timeout %a', ma)\n this.metrics?.events.increment({ timeout: true })\n\n const err = new TimeoutError(`Connection timeout after ${Date.now() - start}ms`)\n // Note: this will result in onError() being called\n rawSocket.emit('error', err)\n }\n\n const onConnect = (): void => {\n this.log('connection opened %a', ma)\n this.metrics?.events.increment({ connect: true })\n done()\n }\n\n const onAbort = (): void => {\n this.log('connection aborted %a', ma)\n this.metrics?.events.increment({ abort: true })\n done(new AbortError())\n }\n\n const done = (err?: Error): void => {\n rawSocket.removeListener('error', onError)\n rawSocket.removeListener('timeout', onTimeout)\n rawSocket.removeListener('connect', onConnect)\n\n if (options.signal != null) {\n options.signal.removeEventListener('abort', onAbort)\n }\n\n if (err != null) {\n reject(err); return\n }\n\n resolve(rawSocket)\n }\n\n rawSocket.on('error', onError)\n rawSocket.on('timeout', onTimeout)\n rawSocket.on('connect', onConnect)\n\n options.signal.addEventListener('abort', onAbort)\n })\n .catch(err => {\n rawSocket?.destroy()\n throw err\n })\n }\n\n /**\n * Creates a TCP listener. The provided `handler` function will be called\n * anytime a new incoming Connection has been successfully upgraded via\n * `upgrader.upgradeInbound`.\n */\n createListener (options: TCPCreateListenerOptions): Listener {\n return new TCPListener({\n ...(this.opts.listenOpts ?? {}),\n ...options,\n maxConnections: this.opts.maxConnections,\n backlog: this.opts.backlog,\n closeServerOnMaxConnections: this.opts.closeServerOnMaxConnections,\n inactivityTimeout: this.opts.inboundSocketInactivityTimeout,\n metrics: this.components.metrics,\n logger: this.components.logger\n })\n }\n\n /**\n * Takes a list of `Multiaddr`s and returns only valid TCP addresses\n */\n listenFilter (multiaddrs: Multiaddr[]): Multiaddr[] {\n return multiaddrs.filter(ma => TCPMatcher.exactMatch(ma) || ma.toString().startsWith('/unix/'))\n }\n\n /**\n * Filter check for all Multiaddrs that this transport can dial\n */\n dialFilter (multiaddrs: Multiaddr[]): Multiaddr[] {\n return this.listenFilter(multiaddrs)\n }\n}\n", "/**\n * Thrown when an invalid multiaddr is encountered\n */\nexport class InvalidMultiaddrError extends Error {\n static name = 'InvalidMultiaddrError'\n name = 'InvalidMultiaddrError'\n}\n\nexport class ValidationError extends Error {\n static name = 'ValidationError'\n name = 'ValidationError'\n}\n\nexport class InvalidParametersError extends Error {\n static name = 'InvalidParametersError'\n name = 'InvalidParametersError'\n}\n\nexport class UnknownProtocolError extends Error {\n static name = 'UnknownProtocolError'\n name = 'UnknownProtocolError'\n}\n", "import { isIPv4, isIPv6, isIP as ipVersion } from \"node:net\";\n\nexport { isIPv4, isIPv6, ipVersion };\n\n/** Check if `input` is IPv4 or IPv6. */\nexport function isIP(input: string): boolean {\n return Boolean(ipVersion(input));\n}\n", "import { isIPv4 } from '@chainsafe/is-ip'\nimport { base32 } from 'multiformats/bases/base32'\nimport { bases } from 'multiformats/basics'\nimport { concat as uint8ArrayConcat } from 'uint8arrays/concat'\nimport { fromString as uint8ArrayFromString } from 'uint8arrays/from-string'\nimport { toString as uint8ArrayToString } from 'uint8arrays/to-string'\nimport { InvalidMultiaddrError } from './errors.ts'\nimport type { MultibaseCodec } from 'multiformats'\nimport type { SupportedEncodings } from 'uint8arrays/to-string'\n\nexport function bytesToString (base: SupportedEncodings): (buf: Uint8Array) => string {\n return (buf) => {\n return uint8ArrayToString(buf, base)\n }\n}\n\nexport function stringToBytes (base: SupportedEncodings): (value: string) => Uint8Array {\n return (buf) => {\n return uint8ArrayFromString(buf, base)\n }\n}\n\nexport function bytes2port (buf: Uint8Array): string {\n const view = new DataView(buf.buffer)\n return view.getUint16(buf.byteOffset).toString()\n}\n\nexport function port2bytes (port: string | number): Uint8Array {\n const buf = new ArrayBuffer(2)\n const view = new DataView(buf)\n view.setUint16(0, typeof port === 'string' ? parseInt(port) : port)\n\n return new Uint8Array(buf)\n}\n\nexport function onion2bytes (str: string): Uint8Array {\n const addr = str.split(':')\n\n if (addr.length !== 2) {\n throw new Error(`failed to parse onion addr: [\"'${addr.join('\", \"')}'\"]' does not contain a port number`)\n }\n\n if (addr[0].length !== 16) {\n throw new Error(`failed to parse onion addr: ${addr[0]} not a Tor onion address.`)\n }\n\n // onion addresses do not include the multibase prefix, add it before decoding\n const buf = uint8ArrayFromString(addr[0], 'base32')\n\n // onion port number\n const port = parseInt(addr[1], 10)\n\n if (port < 1 || port > 65536) {\n throw new Error('Port number is not in range(1, 65536)')\n }\n\n const portBuf = port2bytes(port)\n\n return uint8ArrayConcat([buf, portBuf], buf.length + portBuf.length)\n}\n\nexport function onion32bytes (str: string): Uint8Array {\n const addr = str.split(':')\n\n if (addr.length !== 2) {\n throw new Error(`failed to parse onion addr: [\"'${addr.join('\", \"')}'\"]' does not contain a port number`)\n }\n\n if (addr[0].length !== 56) {\n throw new Error(`failed to parse onion addr: ${addr[0]} not a Tor onion3 address.`)\n }\n\n // onion addresses do not include the multibase prefix, add it before decoding\n const buf = base32.decode(`b${addr[0]}`)\n\n // onion port number\n const port = parseInt(addr[1], 10)\n\n if (port < 1 || port > 65536) {\n throw new Error('Port number is not in range(1, 65536)')\n }\n\n const portBuf = port2bytes(port)\n\n return uint8ArrayConcat([buf, portBuf], buf.length + portBuf.length)\n}\n\nexport function bytes2onion (buf: Uint8Array): string {\n const addrBytes = buf.subarray(0, buf.length - 2)\n const portBytes = buf.subarray(buf.length - 2)\n const addr = uint8ArrayToString(addrBytes, 'base32')\n const port = bytes2port(portBytes)\n return `${addr}:${port}`\n}\n\n// Copied from https://github.com/indutny/node-ip/blob/master/lib/ip.js#L7\n// but with buf/offset args removed because we don't use them\nexport const ip4ToBytes = function (ip: string): Uint8Array {\n ip = ip.toString().trim()\n\n const bytes = new Uint8Array(4)\n\n ip.split(/\\./g).forEach((byte, index) => {\n const value = parseInt(byte, 10)\n\n if (isNaN(value) || value < 0 || value > 0xff) {\n throw new InvalidMultiaddrError('Invalid byte value in IP address')\n }\n\n bytes[index] = value\n })\n\n return bytes\n}\n\n// Copied from https://github.com/indutny/node-ip/blob/master/lib/ip.js#L7\n// but with buf/offset args removed because we don't use them\nexport const ip6ToBytes = function (ip: string): Uint8Array {\n let offset = 0\n ip = ip.toString().trim()\n\n const sections = ip.split(':', 8)\n\n let i\n for (i = 0; i < sections.length; i++) {\n const isv4 = isIPv4(sections[i])\n let v4Buffer: Uint8Array | undefined\n\n if (isv4) {\n v4Buffer = ip4ToBytes(sections[i])\n sections[i] = uint8ArrayToString(v4Buffer.subarray(0, 2), 'base16')\n }\n\n if (v4Buffer != null && ++i < 8) {\n sections.splice(i, 0, uint8ArrayToString(v4Buffer.subarray(2, 4), 'base16'))\n }\n }\n\n if (sections[0] === '') {\n while (sections.length < 8) { sections.unshift('0') }\n } else if (sections[sections.length - 1] === '') {\n while (sections.length < 8) { sections.push('0') }\n } else if (sections.length < 8) {\n for (i = 0; i < sections.length && sections[i] !== ''; i++) { }\n const argv: [number, number, ...string[]] = [i, 1]\n for (i = 9 - sections.length; i > 0; i--) {\n argv.push('0')\n }\n sections.splice.apply(sections, argv)\n }\n\n const bytes = new Uint8Array(offset + 16)\n\n for (i = 0; i < sections.length; i++) {\n if (sections[i] === '') {\n sections[i] = '0'\n }\n\n const word = parseInt(sections[i], 16)\n\n if (isNaN(word) || word < 0 || word > 0xffff) {\n throw new InvalidMultiaddrError('Invalid byte value in IP address')\n }\n\n bytes[offset++] = (word >> 8) & 0xff\n bytes[offset++] = word & 0xff\n }\n\n return bytes\n}\n\n// Copied from https://github.com/indutny/node-ip/blob/master/lib/ip.js#L63\nexport const ip4ToString = function (buf: Uint8Array): string {\n if (buf.byteLength !== 4) {\n throw new InvalidMultiaddrError('IPv4 address was incorrect length')\n }\n\n const result = []\n\n for (let i = 0; i < buf.byteLength; i++) {\n result.push(buf[i])\n }\n\n return result.join('.')\n}\n\nexport const ip6ToString = function (buf: Uint8Array): string {\n if (buf.byteLength !== 16) {\n throw new InvalidMultiaddrError('IPv6 address was incorrect length')\n }\n\n const result: string[] = []\n\n for (let i = 0; i < buf.byteLength; i += 2) {\n const byte1 = buf[i]\n const byte2 = buf[i + 1]\n\n const tuple = `${byte1.toString(16).padStart(2, '0')}${byte2.toString(16).padStart(2, '0')}`\n\n result.push(tuple)\n }\n\n const ip = result.join(':')\n\n try {\n const url = new URL(`http://[${ip}]`)\n\n return url.hostname.substring(1, url.hostname.length - 1)\n } catch {\n throw new InvalidMultiaddrError(`Invalid IPv6 address \"${ip}\"`)\n }\n}\n\nexport function ip6StringToValue (str: string): string {\n try {\n const url = new URL(`http://[${str}]`)\n\n return url.hostname.substring(1, url.hostname.length - 1)\n } catch {\n throw new InvalidMultiaddrError(`Invalid IPv6 address \"${str}\"`)\n }\n}\n\nconst decoders = Object.values(bases).map((c) => c.decoder)\nconst anybaseDecoder = (function () {\n let acc = decoders[0].or(decoders[1])\n decoders.slice(2).forEach((d) => (acc = acc.or(d)))\n return acc\n})()\n\nexport function mb2bytes (mbstr: string): Uint8Array {\n return anybaseDecoder.decode(mbstr)\n}\n\nexport function bytes2mb (base: MultibaseCodec<any>): (buf: Uint8Array) => string {\n return (buf) => {\n return base.encoder.encode(buf)\n }\n}\n", "import { ValidationError } from './errors.ts'\n\nexport function integer (value: string): void {\n const int = parseInt(value)\n\n if (int.toString() !== value) {\n throw new ValidationError('Value must be an integer')\n }\n}\n\nexport function positive (value: any): void {\n if (value < 0) {\n throw new ValidationError('Value must be a positive integer, or zero')\n }\n}\n\nexport function maxValue (max: number): (value: any) => void {\n return (value) => {\n if (value > max) {\n throw new ValidationError(`Value must be smaller than or equal to ${max}`)\n }\n }\n}\n\nexport function validate (...funcs: Array<(value: string) => void>): (value: string) => void {\n return (value) => {\n for (const fn of funcs) {\n fn(value)\n }\n }\n}\n\nexport const validatePort = validate(\n integer,\n positive,\n maxValue(65_535)\n)\n", "import { isIPv4, isIPv6 } from '@chainsafe/is-ip'\nimport { CID } from 'multiformats'\nimport { base64url } from 'multiformats/bases/base64'\nimport { CODE_CERTHASH, CODE_DCCP, CODE_DNS, CODE_DNS4, CODE_DNS6, CODE_DNSADDR, CODE_GARLIC32, CODE_GARLIC64, CODE_HTTP, CODE_HTTP_PATH, CODE_HTTPS, CODE_IP4, CODE_IP6, CODE_IP6ZONE, CODE_IPCIDR, CODE_MEMORY, CODE_NOISE, CODE_ONION, CODE_ONION3, CODE_P2P, CODE_P2P_CIRCUIT, CODE_P2P_STARDUST, CODE_P2P_WEBRTC_DIRECT, CODE_P2P_WEBRTC_STAR, CODE_P2P_WEBSOCKET_STAR, CODE_QUIC, CODE_QUIC_V1, CODE_SCTP, CODE_SNI, CODE_TCP, CODE_TLS, CODE_UDP, CODE_UDT, CODE_UNIX, CODE_UTP, CODE_WEBRTC, CODE_WEBRTC_DIRECT, CODE_WEBTRANSPORT, CODE_WS, CODE_WSS } from './constants.ts'\nimport { UnknownProtocolError, ValidationError } from './errors.ts'\nimport { bytes2mb, bytes2onion, bytes2port, bytesToString, ip4ToBytes, ip4ToString, ip6StringToValue, ip6ToBytes, ip6ToString, mb2bytes, onion2bytes, onion32bytes, port2bytes, stringToBytes } from './utils.ts'\nimport { validatePort } from './validation.ts'\nimport type { Registry as RegistryInterface } from './index.ts'\n\nexport const V = -1\n\nexport interface ProtocolCodec {\n /**\n * A numeric code that will be used in the binary representation of the tuple.\n */\n code: number\n\n /**\n * A string name that will be used in the string representation of the addr.\n */\n name: string\n\n /**\n * Size defines the expected length of the address part of the tuple - valid\n * values are `-1` (or the `V` constant) for variable length (this will be\n * varint encoded in the binary representation), `0` for no address part or a\n * number that represents a fixed-length address.\n */\n size?: number\n\n /**\n * If specified this protocol codec will also be used to decode tuples with\n * these names from string multiaddrs.\n */\n aliases?: string[]\n\n /**\n * Where the multiaddr has been encoded as a string, decode the value if\n * necessary, unescaping any escaped values\n */\n stringToValue?(value: string): string\n\n /**\n * To encode the multiaddr as a string, escape any necessary values\n */\n valueToString?(value: string): string\n\n /**\n * To encode the multiaddr as bytes, convert the value to bytes\n */\n valueToBytes?(value: string): Uint8Array\n\n /**\n * To decode bytes to a multiaddr, convert the value bytes to a string\n */\n bytesToValue?(bytes: Uint8Array): string\n\n /**\n * Perform any necessary validation on the string value\n */\n validate?(value: string): void\n}\n\nclass Registry implements RegistryInterface {\n private protocolsByCode = new Map<number, ProtocolCodec>()\n private protocolsByName = new Map<string, ProtocolCodec>()\n\n getProtocol (key: string | number): ProtocolCodec {\n let codec: ProtocolCodec | undefined\n\n if (typeof key === 'string') {\n codec = this.protocolsByName.get(key)\n } else {\n codec = this.protocolsByCode.get(key)\n }\n\n if (codec == null) {\n throw new UnknownProtocolError(`Protocol ${key} was unknown`)\n }\n\n return codec\n }\n\n addProtocol (codec: ProtocolCodec): void {\n this.protocolsByCode.set(codec.code, codec)\n this.protocolsByName.set(codec.name, codec)\n\n codec.aliases?.forEach(alias => {\n this.protocolsByName.set(alias, codec)\n })\n }\n\n removeProtocol (code: number): void {\n const codec = this.protocolsByCode.get(code)\n\n if (codec == null) {\n return\n }\n\n this.protocolsByCode.delete(codec.code)\n this.protocolsByName.delete(codec.name)\n\n codec.aliases?.forEach(alias => {\n this.protocolsByName.delete(alias)\n })\n }\n}\n\nexport const registry = new Registry()\n\nconst codecs: ProtocolCodec[] = [{\n code: CODE_IP4,\n name: 'ip4',\n size: 32,\n valueToBytes: ip4ToBytes,\n bytesToValue: ip4ToString,\n validate: (value) => {\n if (!isIPv4(value)) {\n throw new ValidationError(`Invalid IPv4 address \"${value}\"`)\n }\n }\n}, {\n code: CODE_TCP,\n name: 'tcp',\n size: 16,\n valueToBytes: port2bytes,\n bytesToValue: bytes2port,\n validate: validatePort\n}, {\n code: CODE_UDP,\n name: 'udp',\n size: 16,\n valueToBytes: port2bytes,\n bytesToValue: bytes2port,\n validate: validatePort\n}, {\n code: CODE_DCCP,\n name: 'dccp',\n size: 16,\n valueToBytes: port2bytes,\n bytesToValue: bytes2port,\n validate: validatePort\n}, {\n code: CODE_IP6,\n name: 'ip6',\n size: 128,\n valueToBytes: ip6ToBytes,\n bytesToValue: ip6ToString,\n stringToValue: ip6StringToValue,\n validate: (value) => {\n if (!isIPv6(value)) {\n throw new ValidationError(`Invalid IPv6 address \"${value}\"`)\n }\n }\n}, {\n code: CODE_IP6ZONE,\n name: 'ip6zone',\n size: V\n}, {\n code: CODE_IPCIDR,\n name: 'ipcidr',\n size: 8,\n bytesToValue: bytesToString('base10'),\n valueToBytes: stringToBytes('base10')\n}, {\n code: CODE_DNS,\n name: 'dns',\n size: V\n}, {\n code: CODE_DNS4,\n name: 'dns4',\n size: V\n}, {\n code: CODE_DNS6,\n name: 'dns6',\n size: V\n}, {\n code: CODE_DNSADDR,\n name: 'dnsaddr',\n size: V\n}, {\n code: CODE_SCTP,\n name: 'sctp',\n size: 16,\n valueToBytes: port2bytes,\n bytesToValue: bytes2port,\n validate: validatePort\n}, {\n code: CODE_UDT,\n name: 'udt'\n}, {\n code: CODE_UTP,\n name: 'utp'\n}, {\n code: CODE_UNIX,\n name: 'unix',\n size: V,\n stringToValue: (str) => decodeURIComponent(str),\n valueToString: (val) => encodeURIComponent(val)\n}, {\n code: CODE_P2P,\n name: 'p2p',\n aliases: ['ipfs'],\n size: V,\n bytesToValue: bytesToString('base58btc'),\n valueToBytes: (val) => {\n if (val.startsWith('Q') || val.startsWith('1')) {\n return stringToBytes('base58btc')(val)\n }\n\n return CID.parse(val).multihash.bytes\n }\n}, {\n code: CODE_ONION,\n name: 'onion',\n size: 96,\n bytesToValue: bytes2onion,\n valueToBytes: onion2bytes\n}, {\n code: CODE_ONION3,\n name: 'onion3',\n size: 296,\n bytesToValue: bytes2onion,\n valueToBytes: onion32bytes\n}, {\n code: CODE_GARLIC64,\n name: 'garlic64',\n size: V\n}, {\n code: CODE_GARLIC32,\n name: 'garlic32',\n size: V\n}, {\n code: CODE_TLS,\n name: 'tls'\n}, {\n code: CODE_SNI,\n name: 'sni',\n size: V\n}, {\n code: CODE_NOISE,\n name: 'noise'\n}, {\n code: CODE_QUIC,\n name: 'quic'\n}, {\n code: CODE_QUIC_V1,\n name: 'quic-v1'\n}, {\n code: CODE_WEBTRANSPORT,\n name: 'webtransport'\n}, {\n code: CODE_CERTHASH,\n name: 'certhash',\n size: V,\n bytesToValue: bytes2mb(base64url),\n valueToBytes: mb2bytes\n}, {\n code: CODE_HTTP,\n name: 'http'\n}, {\n code: CODE_HTTP_PATH,\n name: 'http-path',\n size: V,\n stringToValue: (str) => `/${decodeURIComponent(str)}`,\n valueToString: (val) => encodeURIComponent(val.substring(1))\n}, {\n code: CODE_HTTPS,\n name: 'https'\n}, {\n code: CODE_WS,\n name: 'ws'\n}, {\n code: CODE_WSS,\n name: 'wss'\n}, {\n code: CODE_P2P_WEBSOCKET_STAR,\n name: 'p2p-websocket-star'\n}, {\n code: CODE_P2P_STARDUST,\n name: 'p2p-stardust'\n}, {\n code: CODE_P2P_WEBRTC_STAR,\n name: 'p2p-webrtc-star'\n}, {\n code: CODE_P2P_WEBRTC_DIRECT,\n name: 'p2p-webrtc-direct'\n}, {\n code: CODE_WEBRTC_DIRECT,\n name: 'webrtc-direct'\n}, {\n code: CODE_WEBRTC,\n name: 'webrtc'\n}, {\n code: CODE_P2P_CIRCUIT,\n name: 'p2p-circuit'\n}, {\n code: CODE_MEMORY,\n name: 'memory',\n size: V\n}]\n\ncodecs.forEach(codec => {\n registry.addProtocol(codec)\n})\n", "import * as varint from 'uint8-varint'\nimport { concat as uint8ArrayConcat } from 'uint8arrays/concat'\nimport { fromString as uint8ArrayFromString } from 'uint8arrays/from-string'\nimport { toString as uint8ArrayToString } from 'uint8arrays/to-string'\nimport { InvalidMultiaddrError } from './errors.ts'\nimport { registry, V } from './registry.ts'\nimport type { Component } from './index.js'\nimport type { ProtocolCodec } from './registry.ts'\n\nexport function bytesToComponents (bytes: Uint8Array): Component[] {\n const components: Component[] = []\n\n let i = 0\n while (i < bytes.length) {\n const code = varint.decode(bytes, i)\n const codec = registry.getProtocol(code)\n const codeLength = varint.encodingLength(code)\n const size = sizeForAddr(codec, bytes, i + codeLength)\n let sizeLength = 0\n\n if (size > 0 && codec.size === V) {\n sizeLength = varint.encodingLength(size)\n }\n\n const componentLength = codeLength + sizeLength + size\n\n const component: Component = {\n code,\n name: codec.name,\n bytes: bytes.subarray(i, i + componentLength)\n }\n\n if (size > 0) {\n const valueOffset = i + codeLength + sizeLength\n const valueBytes = bytes.subarray(valueOffset, valueOffset + size)\n\n component.value = codec.bytesToValue?.(valueBytes) ?? uint8ArrayToString(valueBytes)\n }\n\n components.push(component)\n\n i += componentLength\n }\n\n return components\n}\n\nexport function componentsToBytes (components: Component[]): Uint8Array {\n let length = 0\n const bytes: Uint8Array[] = []\n\n for (const component of components) {\n if (component.bytes == null) {\n const codec = registry.getProtocol(component.code)\n const codecLength = varint.encodingLength(component.code)\n let valueBytes: Uint8Array | undefined\n let valueLength = 0\n let valueLengthLength = 0\n\n if (component.value != null) {\n valueBytes = codec.valueToBytes?.(component.value) ?? uint8ArrayFromString(component.value)\n valueLength = valueBytes.byteLength\n\n if (codec.size === V) {\n valueLengthLength = varint.encodingLength(valueLength)\n }\n }\n\n const bytes = new Uint8Array(codecLength + valueLengthLength + valueLength)\n\n // encode the protocol code\n let offset = 0\n varint.encodeUint8Array(component.code, bytes, offset)\n offset += codecLength\n\n // if there is a value\n if (valueBytes != null) {\n // if the value has variable length, encode the length\n if (codec.size === V) {\n varint.encodeUint8Array(valueLength, bytes, offset)\n offset += valueLengthLength\n }\n\n // finally encode the value\n bytes.set(valueBytes, offset)\n }\n\n component.bytes = bytes\n }\n\n bytes.push(component.bytes)\n length += component.bytes.byteLength\n }\n\n return uint8ArrayConcat(bytes, length)\n}\n\nexport function stringToComponents (string: string): Component[] {\n if (string.charAt(0) !== '/') {\n throw new InvalidMultiaddrError('String multiaddr must start with \"/\"')\n }\n\n const components: Component[] = []\n let collecting: 'protocol' | 'value' = 'protocol'\n let value = ''\n let protocol = ''\n\n for (let i = 1; i < string.length; i++) {\n const char = string.charAt(i)\n\n if (char !== '/') {\n if (collecting === 'protocol') {\n protocol += string.charAt(i)\n } else {\n value += string.charAt(i)\n }\n }\n\n const ended = i === string.length - 1\n\n if (char === '/' || ended) {\n const codec = registry.getProtocol(protocol)\n\n if (collecting === 'protocol') {\n if (codec.size == null || codec.size === 0) {\n // a protocol without an address, eg. `/tls`\n components.push({\n code: codec.code,\n name: codec.name\n })\n\n value = ''\n protocol = ''\n collecting = 'protocol'\n\n continue\n } else if (ended) {\n throw new InvalidMultiaddrError(`Component ${protocol} was missing value`)\n }\n\n // continue collecting value\n collecting = 'value'\n } else if (collecting === 'value') {\n const component: Component = {\n code: codec.code,\n name: codec.name\n }\n\n if (codec.size != null && codec.size !== 0) {\n if (value === '') {\n throw new InvalidMultiaddrError(`Component ${protocol} was missing value`)\n }\n\n component.value = codec.stringToValue?.(value) ?? value\n }\n\n components.push(component)\n\n value = ''\n protocol = ''\n collecting = 'protocol'\n }\n }\n }\n\n if (protocol !== '' && value !== '') {\n throw new InvalidMultiaddrError('Incomplete multiaddr')\n }\n\n return components\n}\n\nexport function componentsToString (components: Component[]): string {\n return `/${components.flatMap(component => {\n if (component.value == null) {\n return component.name\n }\n\n const codec = registry.getProtocol(component.code)\n\n if (codec == null) {\n throw new InvalidMultiaddrError(`Unknown protocol code ${component.code}`)\n }\n\n return [\n component.name,\n codec.valueToString?.(component.value) ?? component.value\n ]\n }).join('/')}`\n}\n\n/**\n * For the passed address, return the serialized size\n */\nfunction sizeForAddr (codec: ProtocolCodec, bytes: Uint8Array, offset: number): number {\n if (codec.size == null || codec.size === 0) {\n return 0\n }\n\n if (codec.size > 0) {\n return codec.size / 8\n }\n\n return varint.decode(bytes, offset)\n}\n", "import { equals as uint8ArrayEquals } from 'uint8arrays/equals'\nimport { bytesToComponents, componentsToBytes, componentsToString, stringToComponents } from './components.js'\nimport { InvalidMultiaddrError, InvalidParametersError } from './errors.ts'\nimport { registry } from './registry.ts'\nimport { isMultiaddr } from './index.js'\nimport type { MultiaddrInput, Multiaddr as MultiaddrInterface, Component } from './index.js'\n\nconst inspect = Symbol.for('nodejs.util.inspect.custom')\nexport const symbol = Symbol.for('@multiformats/multiaddr')\n\nfunction toComponents (addr: MultiaddrInput): Component[] {\n if (addr == null) {\n addr = '/'\n }\n\n if (isMultiaddr(addr)) {\n return addr.getComponents()\n }\n\n if (addr instanceof Uint8Array) {\n return bytesToComponents(addr)\n }\n\n if (typeof addr === 'string') {\n addr = addr\n .replace(/\\/(\\/)+/, '/')\n .replace(/(\\/)+$/, '')\n\n if (addr === '') {\n addr = '/'\n }\n\n return stringToComponents(addr)\n }\n\n if (Array.isArray(addr)) {\n return addr\n }\n\n throw new InvalidMultiaddrError('Must be a string, Uint8Array, Component[], or another Multiaddr')\n}\n\ninterface MultiaddrOptions {\n validate?: boolean\n}\n\n/**\n * Creates a {@link Multiaddr} from a {@link MultiaddrInput}\n */\nexport class Multiaddr implements MultiaddrInterface {\n [symbol]: boolean = true\n readonly #components: Component[]\n\n // cache string representation\n #string: string | undefined\n // cache byte representation\n #bytes: Uint8Array | undefined\n\n constructor (addr: MultiaddrInput | Component[] = '/', options: MultiaddrOptions = {}) {\n this.#components = toComponents(addr)\n\n if (options.validate !== false) {\n validate(this)\n }\n }\n\n get bytes (): Uint8Array {\n if (this.#bytes == null) {\n this.#bytes = componentsToBytes(this.#components)\n }\n\n return this.#bytes\n }\n\n toString (): string {\n if (this.#string == null) {\n this.#string = componentsToString(this.#components)\n }\n\n return this.#string\n }\n\n toJSON (): string {\n return this.toString()\n }\n\n getComponents (): Component[] {\n return [\n ...this.#components.map(c => ({ ...c }))\n ]\n }\n\n encapsulate (addr: MultiaddrInput): MultiaddrInterface {\n const ma = new Multiaddr(addr)\n\n return new Multiaddr([\n ...this.#components,\n ...ma.getComponents()\n ], {\n validate: false\n })\n }\n\n decapsulate (addr: Multiaddr | string): MultiaddrInterface {\n const addrString = addr.toString()\n const s = this.toString()\n const i = s.lastIndexOf(addrString)\n\n if (i < 0) {\n throw new InvalidParametersError(`Address ${this.toString()} does not contain subaddress: ${addrString}`)\n }\n\n return new Multiaddr(s.slice(0, i), {\n validate: false\n })\n }\n\n decapsulateCode (code: number): Multiaddr {\n let index\n\n for (let i = this.#components.length - 1; i > -1; i--) {\n if (this.#components[i].code === code) {\n index = i\n break\n }\n }\n\n return new Multiaddr(this.#components.slice(0, index), {\n validate: false\n })\n }\n\n equals (addr: { bytes: Uint8Array }): boolean {\n return uint8ArrayEquals(this.bytes, addr.bytes)\n }\n\n /**\n * Returns Multiaddr as a human-readable string\n * https://nodejs.org/api/util.html#utilinspectcustom\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * console.info(multiaddr('/ip4/127.0.0.1/tcp/4001'))\n * // 'Multiaddr(/ip4/127.0.0.1/tcp/4001)'\n * ```\n */\n [inspect] (): string {\n return `Multiaddr(${this.toString()})`\n }\n}\n\n/**\n * Ensures all multiaddr tuples are correct. Throws if any invalid protocols or\n * values are encountered.\n */\nexport function validate (addr: Multiaddr): void {\n addr.getComponents()\n .forEach(component => {\n const codec = registry.getProtocol(component.code)\n\n if (component.value == null) {\n return\n }\n\n codec.validate?.(component.value)\n })\n}\n", "/**\n * @packageDocumentation\n *\n * A standard way to represent addresses that\n *\n * - support any standard network protocol\n * - have a binary packed format\n * - have a nice string representation\n * - encapsulate well\n *\n * @example\n *\n * ```TypeScript\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const addr = multiaddr('/ip4/127.0.0.1/udp/1234')\n * // Multiaddr(/ip4/127.0.0.1/udp/1234)\n *\n * addr.bytes\n * // <Uint8Array 04 7f 00 00 01 11 04 d2>\n *\n * addr.toString()\n * // '/ip4/127.0.0.1/udp/1234'\n *\n * addr.getComponents()\n * // [\n * // { code: 4, name: 'ip4', value: '127.0.0.1' },\n * // { code: 273, name: 'udp', value: '1234' }\n * // ]\n *\n * addr.encapsulate('/sctp/5678')\n * // Multiaddr(/ip4/127.0.0.1/udp/1234/sctp/5678)\n * ```\n *\n * @example Adding custom protocols\n *\n * To add application-specific or experimental protocols, add a protocol codec\n * to the protocol registry:\n *\n * ```ts\n * import { registry, V, multiaddr } from '@multiformats/multiaddr'\n * import type { ProtocolCodec } from '@multiformats/multiaddr'\n *\n * const maWithCustomTuple = '/custom-protocol/hello'\n *\n * // throws UnknownProtocolError\n * multiaddr(maWithCustomTuple)\n *\n * const protocol: ProtocolCodec = {\n * code: 2059,\n * name: 'custom-protocol',\n * size: V\n * // V means variable length, can also be 0, a positive integer (e.g. a fixed\n * // length or omitted\n * }\n *\n * registry.addProtocol(protocol)\n *\n * // does not throw UnknownProtocolError\n * multiaddr(maWithCustomTuple)\n *\n * // protocols can also be removed\n * registry.removeProtocol(protocol.code)\n * ```\n */\n\nimport { Multiaddr as MultiaddrClass, symbol } from './multiaddr.js'\nimport { registry, V } from './registry.ts'\nimport type { ProtocolCodec } from './registry.ts'\n\n/**\n * The protocol registry stores protocol codecs that allow transformation of\n * multiaddr tuples from bytes to string and back again, and also validation of\n * the address values.\n */\nexport interface Registry {\n /**\n * Retrieve a protocol definition by it's code or name\n */\n getProtocol (key: string | number): ProtocolCodec\n\n /**\n * Add a new protocol definition\n */\n addProtocol (codec: ProtocolCodec): void\n\n /**\n * Remove a protocol definition by it's code\n */\n removeProtocol (code: number): void\n}\n\n/**\n * These types can be parsed into a {@link Multiaddr} object\n */\nexport type MultiaddrInput = string | Multiaddr | Uint8Array | null | Component[]\n\n/**\n * A Component is a section of a multiaddr with a name/code, possibly with a\n * value.\n *\n * Component names/codes are defined in the protocol table.\n *\n * @see https://github.com/multiformats/multiaddr/blob/master/protocols.csv\n */\nexport interface Component {\n /**\n * The code of the component as defined in the protocol table\n */\n code: number\n\n /**\n * The name of the component as defined in the protocol table\n */\n name: string\n\n /**\n * The component value, if one is present\n */\n value?: string\n\n /**\n * The bytes that make up the component. This will be set if the multiaddr\n * was parsed from a `Uint8Array`, or if `.bytes` has been accessed on it.\n */\n bytes?: Uint8Array\n}\n\nexport interface Multiaddr {\n bytes: Uint8Array\n\n /**\n * Returns Multiaddr as a String\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * multiaddr('/ip4/127.0.0.1/tcp/4001').toString()\n * // '/ip4/127.0.0.1/tcp/4001'\n * ```\n */\n toString(): string\n\n /**\n * Returns Multiaddr as a JSON encoded object\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * JSON.stringify(multiaddr('/ip4/127.0.0.1/tcp/4001'))\n * // '/ip4/127.0.0.1/tcp/4001'\n * ```\n */\n toJSON(): string\n\n /**\n * Returns the components that make up this Multiaddr\n *\n * @example\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * multiaddr('/ip4/127.0.0.1/tcp/4001').getComponents()\n * // [{ name: 'ip4', code: 4, value: '127.0.0.1' }, { name: 'tcp', code: 6, value: '4001' }]\n * ```\n */\n getComponents(): Component[]\n\n /**\n * Encapsulates a Multiaddr in another Multiaddr\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const mh1 = multiaddr('/ip4/8.8.8.8/tcp/1080')\n * // Multiaddr(/ip4/8.8.8.8/tcp/1080)\n *\n * const mh2 = multiaddr('/ip4/127.0.0.1/tcp/4001')\n * // Multiaddr(/ip4/127.0.0.1/tcp/4001)\n *\n * const mh3 = mh1.encapsulate(mh2)\n * // Multiaddr(/ip4/8.8.8.8/tcp/1080/ip4/127.0.0.1/tcp/4001)\n *\n * mh3.toString()\n * // '/ip4/8.8.8.8/tcp/1080/ip4/127.0.0.1/tcp/4001'\n * ```\n *\n * @param {MultiaddrInput} addr - Multiaddr to add into this Multiaddr\n */\n encapsulate(addr: MultiaddrInput): Multiaddr\n\n /**\n * Decapsulates a Multiaddr from another Multiaddr\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const mh1 = multiaddr('/ip4/8.8.8.8/tcp/1080')\n * // Multiaddr(/ip4/8.8.8.8/tcp/1080)\n *\n * const mh2 = multiaddr('/ip4/127.0.0.1/tcp/4001')\n * // Multiaddr(/ip4/127.0.0.1/tcp/4001)\n *\n * const mh3 = mh1.encapsulate(mh2)\n * // Multiaddr(/ip4/8.8.8.8/tcp/1080/ip4/127.0.0.1/tcp/4001)\n *\n * mh3.decapsulate(mh2).toString()\n * // '/ip4/8.8.8.8/tcp/1080'\n * ```\n *\n * @param {Multiaddr | string} addr - Multiaddr to remove from this Multiaddr\n */\n decapsulate(addr: Multiaddr | string): Multiaddr\n\n /**\n * A more reliable version of `decapsulate` if you are targeting a specific\n * code, such as 421 (the `p2p` protocol code). The last index of the code\n * will be removed from the `Multiaddr`, and a new instance will be returned.\n * If the code is not present, the original `Multiaddr` is returned.\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const addr = multiaddr('/ip4/0.0.0.0/tcp/8080/p2p/QmcgpsyWgH8Y8ajJz1Cu72KnS5uo2Aa2LpzU7kinSupNKC')\n * // Multiaddr(/ip4/0.0.0.0/tcp/8080/p2p/QmcgpsyWgH8Y8ajJz1Cu72KnS5uo2Aa2LpzU7kinSupNKC)\n *\n * addr.decapsulateCode(421).toString()\n * // '/ip4/0.0.0.0/tcp/8080'\n *\n * multiaddr('/ip4/127.0.0.1/tcp/8080').decapsulateCode(421).toString()\n * // '/ip4/127.0.0.1/tcp/8080'\n * ```\n */\n decapsulateCode(code: number): Multiaddr\n\n /**\n * Checks if two Multiaddrs are the same\n *\n * @example\n * ```js\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const mh1 = multiaddr('/ip4/8.8.8.8/tcp/1080')\n * // Multiaddr(/ip4/8.8.8.8/tcp/1080)\n *\n * const mh2 = multiaddr('/ip4/127.0.0.1/tcp/4001')\n * // Multiaddr(/ip4/127.0.0.1/tcp/4001)\n *\n * mh1.equals(mh1)\n * // true\n *\n * mh1.equals(mh2)\n * // false\n * ```\n */\n equals(addr: { bytes: Uint8Array }): boolean\n}\n\n/**\n * Check if object is a {@link Multiaddr} instance\n *\n * @example\n *\n * ```js\n * import { isMultiaddr, multiaddr } from '@multiformats/multiaddr'\n *\n * isMultiaddr(5)\n * // false\n * isMultiaddr(multiaddr('/ip4/127.0.0.1'))\n * // true\n * ```\n */\nexport function isMultiaddr (value: any): value is Multiaddr {\n return Boolean(value?.[symbol])\n}\n\n/**\n * A function that takes a {@link MultiaddrInput} and returns a {@link Multiaddr}\n *\n * @example\n * ```js\n * import { multiaddr } from '@libp2p/multiaddr'\n *\n * multiaddr('/ip4/127.0.0.1/tcp/4001')\n * // Multiaddr(/ip4/127.0.0.1/tcp/4001)\n * ```\n *\n * @param {MultiaddrInput} [addr] - If String or Uint8Array, needs to adhere to the address format of a [multiaddr](https://github.com/multiformats/multiaddr#string-format)\n */\nexport function multiaddr (addr?: MultiaddrInput): Multiaddr {\n return new MultiaddrClass(addr)\n}\n\n/**\n * Export all table.csv codes. These are all named exports so can be tree-shaken\n * out by bundlers.\n */\nexport * from './constants.ts'\nexport { registry, V }\nexport type { ProtocolCodec }\n", "import type { Matcher, MultiaddrMatcher } from './index.js'\nimport type { Multiaddr, Component } from '@multiformats/multiaddr'\n\n/**\n * Matches a multiaddr component with the specified code but no value\n */\nexport const code = (code: number): Matcher => {\n return {\n match: (vals) => {\n const component = vals[0]\n\n if (component == null) {\n return false\n }\n\n if (component.code !== code) {\n return false\n }\n\n if (component.value != null) {\n return false\n }\n\n return vals.slice(1)\n }\n }\n}\n\n/**\n * Matches a multiaddr component with the specified code and value. If the value\n * is omitted any non-undefined value is matched.\n */\nexport const value = (code: number, value?: string): Matcher => {\n return {\n match: (vals) => {\n const component = vals[0]\n\n if (component?.code !== code) {\n return false\n }\n\n if (component.value == null) {\n return false\n }\n\n if (value != null && component.value !== value) {\n return false\n }\n\n return vals.slice(1)\n }\n }\n}\n\n/**\n * Matches a multiaddr component with the specified code and value. If the value\n * is omitted any non-undefined value is matched.\n */\nexport const not = (matcher: Matcher): Matcher => {\n return {\n match: (vals) => {\n const result = matcher.match(vals)\n\n if (result === false) {\n return vals\n }\n\n return false\n }\n }\n}\n\n/**\n * An optional matcher\n */\nexport const optional = (matcher: Matcher): Matcher => {\n return {\n match: (vals) => {\n const result = matcher.match(vals)\n\n if (result === false) {\n return vals\n }\n\n return result\n }\n }\n}\n\n/**\n * Matches any one of the passed matches\n */\nexport const or = (...matchers: Matcher[]): Matcher => {\n return {\n match: (vals) => {\n let matches: Component[] | undefined\n\n for (const matcher of matchers) {\n const result = matcher.match(vals)\n\n // no match\n if (result === false) {\n continue\n }\n\n // choose greediest matcher\n if (matches == null || result.length < matches.length) {\n matches = result\n }\n }\n\n if (matches == null) {\n return false\n }\n\n return matches\n }\n }\n}\n\n/**\n * Matches all of the passed matchers\n */\nexport const and = (...matchers: Matcher[]): Matcher => {\n return {\n match: (vals) => {\n for (const matcher of matchers) {\n // pass what's left of the array\n const result = matcher.match(vals)\n\n // no match\n if (result === false) {\n return false\n }\n\n vals = result\n }\n\n return vals\n }\n }\n}\n\n/**\n * Create a multiaddr matcher from the passed component matchers\n */\nexport function fmt (...matchers: Matcher[]): MultiaddrMatcher {\n function match (ma?: Multiaddr): Component[] | false {\n if (ma == null) {\n return false\n }\n\n let parts = ma.getComponents()\n\n for (const matcher of matchers) {\n const result = matcher.match(parts)\n\n if (result === false) {\n return false\n }\n\n parts = result\n }\n\n return parts\n }\n\n function matches (ma?: Multiaddr): boolean {\n const result = match(ma)\n\n return result !== false\n }\n\n function exactMatch (ma?: Multiaddr): boolean {\n const result = match(ma)\n\n if (result === false) {\n return false\n }\n\n return result.length === 0\n }\n\n return {\n matchers,\n matches,\n exactMatch\n }\n}\n", "/**\n * @packageDocumentation\n *\n * This module exports various matchers that can be used to infer the type of a\n * passed multiaddr.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { DNS } from '@multiformats/multiaddr-matcher'\n *\n * const ma = multiaddr('/dnsaddr/example.org')\n *\n * DNS.matches(ma) // true - this is a multiaddr with a DNS address at the start\n * ```\n *\n * @example\n *\n * The default matching behaviour ignores any subsequent tuples in the multiaddr.\n * If you want stricter matching you can use `.exactMatch`:\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { DNS, Circuit } from '@multiformats/multiaddr-matcher'\n *\n * const ma = multiaddr('/dnsaddr/example.org/p2p/QmFoo/p2p-circuit/p2p/QmBar')\n *\n * DNS.exactMatch(ma) // false - this address has extra tuples after the DNS component\n * Circuit.matches(ma) // true\n * Circuit.exactMatch(ma) // true - the extra tuples are circuit relay related\n * ```\n */\n\nimport { CODE_P2P, CODE_DNS4, CODE_DNS6, CODE_DNSADDR, CODE_DNS, CODE_IP4, CODE_IP6, CODE_TCP, CODE_UDP, CODE_QUIC, CODE_QUIC_V1, CODE_WS, CODE_WSS, CODE_TLS, CODE_SNI, CODE_WEBRTC_DIRECT, CODE_CERTHASH, CODE_WEBTRANSPORT, CODE_P2P_CIRCUIT, CODE_WEBRTC, CODE_HTTP, CODE_UNIX, CODE_HTTPS, CODE_MEMORY, CODE_IP6ZONE, CODE_IPCIDR } from '@multiformats/multiaddr'\nimport { and, or, optional, fmt, code, value, not } from './utils.js'\nimport type { Multiaddr, Component } from '@multiformats/multiaddr'\n\n/**\n * A matcher accepts multiaddr components and either fails to match and returns\n * false or returns a sublist of unmatched components\n */\nexport interface Matcher {\n match(parts: Component[]): Component[] | false\n}\n\n/**\n * A MultiaddrMatcher allows interpreting a multiaddr as a certain type of\n * multiaddr\n */\nexport interface MultiaddrMatcher {\n /**\n * The matchers that make up this MultiaddrMatcher - useful if you want to\n * make your own custom matchers\n */\n matchers: Matcher[]\n\n /**\n * Returns true if the passed multiaddr can be treated as this type of\n * multiaddr\n */\n matches(ma?: Multiaddr): boolean\n\n /**\n * Returns true if the passed multiaddr terminates as this type of\n * multiaddr\n */\n exactMatch(ma?: Multiaddr): boolean\n}\n\n/**\n * Matches PeerId addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { PEER_ID } from '@multiformats/multiaddr-matcher'\n *\n * PEER_ID.matches(multiaddr('/p2p/Qmfoo')) // true\n * PEER_ID.matches(multiaddr('/ipfs/Qmfoo')) // true\n * ```\n */\nconst _PEER_ID = value(CODE_P2P)\n\nexport const PEER_ID = fmt(_PEER_ID)\n\n/**\n * DNS matchers\n */\nconst _DNS4 = value(CODE_DNS4)\nconst _DNS6 = value(CODE_DNS6)\nconst _DNSADDR = value(CODE_DNSADDR)\nconst _DNS = value(CODE_DNS)\n\n/**\n * Matches dns4 addresses.\n *\n * Use {@link DNS DNS} instead to match any type of DNS address.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { DNS4 } from '@multiformats/multiaddr-matcher'\n *\n * DNS4.matches(multiaddr('/dns4/example.org')) // true\n * ```\n */\nexport const DNS4 = fmt(_DNS4, optional(value(CODE_P2P)))\n\n/**\n * Matches dns6 addresses.\n *\n * Use {@link DNS DNS} instead to match any type of DNS address.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { DNS6 } from '@multiformats/multiaddr-matcher'\n *\n * DNS6.matches(multiaddr('/dns6/example.org')) // true\n * ```\n */\nexport const DNS6 = fmt(_DNS6, optional(value(CODE_P2P)))\n\n/**\n * Matches dnsaddr addresses.\n *\n * Use {@link DNS DNS} instead to match any type of DNS address.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { DNSADDR } from '@multiformats/multiaddr-matcher'\n *\n * DNSADDR.matches(multiaddr('/dnsaddr/example.org')) // true\n * DNSADDR.matches(multiaddr('/dnsaddr/example.org/p2p/Qmfoo')) // true\n * ```\n */\nexport const DNSADDR = fmt(_DNSADDR, optional(value(CODE_P2P)))\n\n/**\n * Matches any dns address.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { DNS } from '@multiformats/multiaddr-matcher'\n *\n * DNS.matches(multiaddr('/dnsaddr/example.org')) // true\n * DNS.matches(multiaddr('/dns4/example.org')) // true\n * DNS.matches(multiaddr('/dns6/example.org')) // true\n * DNS.matches(multiaddr('/dns6/example.org/p2p/Qmfoo')) // true\n * ```\n */\nexport const DNS = fmt(or(_DNS, _DNSADDR, _DNS4, _DNS6), optional(value(CODE_P2P)))\n\nconst _IP4 = and(\n value(CODE_IP4),\n optional(value(CODE_IPCIDR))\n)\nconst _IP6 = and(\n optional(value(CODE_IP6ZONE)),\n value(CODE_IP6),\n optional(value(CODE_IPCIDR))\n)\nconst _IP = or(_IP4, _IP6)\n\nconst _IP_OR_DOMAIN = or(_IP, _DNS, _DNS4, _DNS6, _DNSADDR)\n\n/**\n * A matcher for addresses that start with IP or DNS tuples.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { IP_OR_DOMAIN } from '@multiformats/multiaddr-matcher'\n *\n * IP_OR_DOMAIN.matches(multiaddr('/ip4/123.123.123.123')) // true\n * IP_OR_DOMAIN.matches(multiaddr('/ip4/123.123.123.123/p2p/QmFoo')) // true\n * IP_OR_DOMAIN.matches(multiaddr('/dns/example.com/p2p/QmFoo')) // true\n * IP_OR_DOMAIN.matches(multiaddr('/p2p/QmFoo')) // false\n * ```\n */\nexport const IP_OR_DOMAIN = fmt(or(_IP, and(or(_DNS, _DNSADDR, _DNS4, _DNS6), optional(value(CODE_P2P)))))\n\n/**\n * Matches ip4 addresses.\n *\n * Use {@link IP IP} instead to match any ip4/ip6 address.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { IP4 } from '@multiformats/multiaddr-matcher'\n *\n * const ma = multiaddr('/ip4/123.123.123.123')\n *\n * IP4.matches(ma) // true\n * ```\n */\nexport const IP4 = fmt(_IP4)\n\n/**\n * Matches ip6 addresses.\n *\n * Use {@link IP IP} instead to match any ip4/ip6 address.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { IP6 } from '@multiformats/multiaddr-matcher'\n *\n * const ma = multiaddr('/ip6/fe80::1cc1:a3b8:322f:cf22')\n *\n * IP6.matches(ma) // true\n * ```\n */\nexport const IP6 = fmt(_IP6)\n\n/**\n * Matches ip4 or ip6 addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { IP } from '@multiformats/multiaddr-matcher'\n *\n * IP.matches(multiaddr('/ip4/123.123.123.123')) // true\n * IP.matches(multiaddr('/ip6/fe80::1cc1:a3b8:322f:cf22')) // true\n * ```\n */\nexport const IP = fmt(_IP)\n\nconst _TCP = and(_IP_OR_DOMAIN, value(CODE_TCP))\nconst _UDP = and(_IP_OR_DOMAIN, value(CODE_UDP))\n\n/**\n * Matches TCP addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { TCP } from '@multiformats/multiaddr-matcher'\n *\n * TCP.matches(multiaddr('/ip4/123.123.123.123/tcp/1234')) // true\n * ```\n */\nexport const TCP = fmt(and(_TCP, optional(value(CODE_P2P))))\n\n/**\n * Matches UDP addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { UDP } from '@multiformats/multiaddr-matcher'\n *\n * UDP.matches(multiaddr('/ip4/123.123.123.123/udp/1234')) // true\n * ```\n */\nexport const UDP = fmt(_UDP)\n\nconst _QUIC = and(_UDP, code(CODE_QUIC), optional(value(CODE_P2P)))\nconst _QUIC_V1 = and(_UDP, code(CODE_QUIC_V1), optional(value(CODE_P2P)))\n\nconst QUIC_V0_OR_V1 = or(_QUIC, _QUIC_V1)\n\n/**\n * Matches QUIC addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { QUIC } from '@multiformats/multiaddr-matcher'\n *\n * QUIC.matches(multiaddr('/ip4/123.123.123.123/udp/1234/quic')) // true\n * ```\n */\nexport const QUIC = fmt(_QUIC)\n\n/**\n * Matches QUICv1 addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { QUIC_V1 } from '@multiformats/multiaddr-matcher'\n *\n * QUIC_V1.matches(multiaddr('/ip4/123.123.123.123/udp/1234/quic-v1')) // true\n * ```\n */\nexport const QUIC_V1 = fmt(_QUIC_V1)\n\nconst _WEB = or(\n _IP_OR_DOMAIN,\n _TCP,\n _UDP,\n _QUIC,\n _QUIC_V1\n)\n\nconst _WebSockets = or(\n and(_WEB, code(CODE_WS), optional(value(CODE_P2P)))\n)\n\n/**\n * Matches WebSocket addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { WebSockets } from '@multiformats/multiaddr-matcher'\n *\n * WebSockets.matches(multiaddr('/ip4/123.123.123.123/tcp/1234/ws')) // true\n * ```\n */\nexport const WebSockets = fmt(_WebSockets)\n\nconst _WebSocketsSecure = or(\n and(_WEB, code(CODE_WSS), optional(value(CODE_P2P))),\n and(_WEB, code(CODE_TLS), optional(value(CODE_SNI)), code(CODE_WS), optional(value(CODE_P2P)))\n)\n\n/**\n * Matches secure WebSocket addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { WebSocketsSecure } from '@multiformats/multiaddr-matcher'\n *\n * WebSocketsSecure.matches(multiaddr('/ip4/123.123.123.123/tcp/1234/wss')) // true\n * ```\n */\nexport const WebSocketsSecure = fmt(_WebSocketsSecure)\n\nconst _WebRTCDirect = and(_UDP, code(CODE_WEBRTC_DIRECT), optional(value(CODE_CERTHASH)), optional(value(CODE_CERTHASH)), optional(value(CODE_P2P)))\n\n/**\n * Matches WebRTC-direct addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { WebRTCDirect } from '@multiformats/multiaddr-matcher'\n *\n * WebRTCDirect.matches(multiaddr('/ip4/123.123.123.123/tcp/1234/p2p/QmFoo/webrtc-direct/certhash/u....')) // true\n * ```\n */\nexport const WebRTCDirect = fmt(_WebRTCDirect)\n\nconst _WebTransport = and(_QUIC_V1, code(CODE_WEBTRANSPORT), optional(value(CODE_CERTHASH)), optional(value(CODE_CERTHASH)), optional(value(CODE_P2P)))\n\n/**\n * Matches WebTransport addresses.\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { WebRTCDirect } from '@multiformats/multiaddr-matcher'\n *\n * WebRTCDirect.matches(multiaddr('/ip4/123.123.123.123/udp/1234/quic-v1/webtransport/certhash/u..../certhash/u..../p2p/QmFoo')) // true\n * ```\n */\nexport const WebTransport = fmt(_WebTransport)\n\nconst _P2P = or(\n _WebSockets,\n _WebSocketsSecure,\n and(_TCP, optional(value(CODE_P2P))),\n and(QUIC_V0_OR_V1, optional(value(CODE_P2P))),\n and(_IP_OR_DOMAIN, optional(value(CODE_P2P))),\n _WebRTCDirect,\n _WebTransport,\n value(CODE_P2P)\n)\n\n/**\n * Matches peer addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { P2P } from '@multiformats/multiaddr-matcher'\n *\n * P2P.matches(multiaddr('/ip4/123.123.123.123/tcp/1234/p2p/QmFoo')) // true\n * ```\n */\nexport const P2P = fmt(_P2P)\n\nconst _Circuit = and(optional(_P2P), code(CODE_P2P_CIRCUIT), not(code(CODE_WEBRTC)), optional(value(CODE_P2P)))\n\n/**\n * Matches circuit relay addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { Circuit } from '@multiformats/multiaddr-matcher'\n *\n * Circuit.matches(multiaddr('/ip4/123.123.123.123/tcp/1234/p2p/QmRelay/p2p-circuit/p2p/QmTarget')) // true\n * ```\n */\nexport const Circuit = fmt(_Circuit)\n\nconst _WebRTC = or(\n and(_P2P, code(CODE_P2P_CIRCUIT), code(CODE_WEBRTC), optional(value(CODE_P2P))),\n and(_P2P, code(CODE_WEBRTC), optional(value(CODE_P2P))),\n and(code(CODE_WEBRTC), optional(value(CODE_P2P)))\n)\n\n/**\n * Matches WebRTC addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { WebRTC } from '@multiformats/multiaddr-matcher'\n *\n * WebRTC.matches(multiaddr('/ip4/123.123.123.123/tcp/1234/p2p/QmRelay/p2p-circuit/webrtc/p2p/QmTarget')) // true\n * ```\n */\nexport const WebRTC = fmt(_WebRTC)\n\nconst _HTTP = or(\n and(_IP_OR_DOMAIN, value(CODE_TCP), code(CODE_HTTP), optional(value(CODE_P2P))),\n and(_IP_OR_DOMAIN, code(CODE_HTTP), optional(value(CODE_P2P)))\n)\n\n/**\n * Matches HTTP addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { HTTP } from '@multiformats/multiaddr-matcher'\n *\n * HTTP.matches(multiaddr('/dns/example.org/http')) // true\n * ```\n */\nexport const HTTP = fmt(_HTTP)\n\nconst _HTTPS = and(_IP_OR_DOMAIN, or(\n and(value(CODE_TCP, '443'), code(CODE_HTTP)),\n and(value(CODE_TCP), code(CODE_HTTPS)),\n and(value(CODE_TCP), code(CODE_TLS), code(CODE_HTTP)),\n and(code(CODE_TLS), code(CODE_HTTP)),\n code(CODE_TLS),\n code(CODE_HTTPS)\n),\noptional(value(CODE_P2P))\n)\n\n/**\n * Matches HTTPS addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { HTTP } from '@multiformats/multiaddr-matcher'\n *\n * HTTP.matches(multiaddr('/dns/example.org/tls/http')) // true\n * ```\n */\nexport const HTTPS = fmt(_HTTPS)\n\nconst _Memory = or(\n and(value(CODE_MEMORY), optional(value(CODE_P2P)))\n)\n\n/**\n * Matches Memory addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { Memory } from '@multiformats/multiaddr-matcher'\n *\n * Memory.matches(multiaddr('/memory/0xDEADBEEF')) // true\n * ```\n */\nexport const Memory = fmt(_Memory)\n\nconst _Unix = or(\n and(value(CODE_UNIX), optional(value(CODE_P2P)))\n)\n\n/**\n * Matches Unix addresses\n *\n * @example\n *\n * ```ts\n * import { multiaddr } from '@multiformats/multiaddr'\n * import { Unix } from '@multiformats/multiaddr-matcher'\n *\n * Unix.matches(multiaddr('/unix/%2Fpath%2Fto%2Funix.socket')) // true\n * ```\n */\nexport const Unix = fmt(_Unix)\n", "/**\n * Progress events are emitted during long running operations\n */\nexport interface ProgressEvent<T extends string = any, D = unknown> {\n /**\n * The event type\n */\n type: T\n\n /**\n * Context-specific event information\n */\n detail: D\n}\n\n/**\n * An implementation of the ProgressEvent interface, this is essentially\n * a typed `CustomEvent` with a `type` property that lets us disambiguate\n * events passed to `progress` callbacks.\n */\nexport class CustomProgressEvent<D = unknown, T extends string = any> extends Event implements ProgressEvent<T, D> {\n public type: T\n public detail: D\n\n constructor (type: T, detail?: D) {\n super(type)\n\n this.type = type\n // @ts-expect-error detail may be undefined\n this.detail = detail\n }\n}\n\n/**\n * Define an `onProgress` callback that can be invoked with `ProgressEvent`s\n *\n * @example\n *\n * ```typescript\n * type MyOperationProgressEvents =\n * ProgressEvent<'operation:start'> |\n * ProgressEvent<'operation:success', Result> |\n * ProgressEvent<'operation:error', Error>\n *\n * export interface MyOperationOptions extends ProgressOptions<MyOperationProgressEvents> {\n * // define options here\n * }\n * ```\n */\nexport interface ProgressOptions<Event extends ProgressEvent = any> {\n onProgress?: (evt: Event) => void\n}\n", "import net from 'node:net'\nimport { AlreadyStartedError, InvalidParametersError, NotStartedError } from '@libp2p/interface'\nimport { getThinWaistAddresses } from '@libp2p/utils'\nimport { multiaddr } from '@multiformats/multiaddr'\nimport { TypedEventEmitter, setMaxListeners } from 'main-event'\nimport { pEvent } from 'p-event'\nimport { toMultiaddrConnection } from './socket-to-conn.js'\nimport { multiaddrToNetConfig } from './utils.js'\nimport type { CloseServerOnMaxConnectionsOpts, TCPCreateListenerOptions } from './index.js'\nimport type { NetConfig } from './utils.js'\nimport type { ComponentLogger, Logger, MultiaddrConnection, CounterGroup, MetricGroup, Metrics, Listener, ListenerEvents, Upgrader, AbortOptions } from '@libp2p/interface'\nimport type { Multiaddr } from '@multiformats/multiaddr'\n\ninterface Context extends TCPCreateListenerOptions {\n upgrader: Upgrader\n inactivityTimeout?: number\n maxConnections?: number\n backlog?: number\n metrics?: Metrics\n closeServerOnMaxConnections?: CloseServerOnMaxConnectionsOpts\n logger: ComponentLogger\n}\n\ninterface TCPListenerMetrics {\n status?: MetricGroup\n errors?: CounterGroup\n events?: CounterGroup\n}\n\nenum TCPListenerStatusCode {\n /**\n * When server object is initialized but we don't know the listening address\n * yet or the server object is stopped manually, can be resumed only by\n * calling listen()\n */\n INACTIVE = 0,\n ACTIVE = 1,\n /* During the connection limits */\n PAUSED = 2\n}\n\ntype Status = { code: TCPListenerStatusCode.INACTIVE } | {\n code: Exclude<TCPListenerStatusCode, TCPListenerStatusCode.INACTIVE>\n listeningAddr: Multiaddr\n netConfig: NetConfig\n}\n\nexport class TCPListener extends TypedEventEmitter<ListenerEvents> implements Listener {\n private readonly server: net.Server\n /** Keep track of open sockets to destroy in case of timeout */\n private readonly sockets = new Set<net.Socket>()\n private status: Status = { code: TCPListenerStatusCode.INACTIVE }\n private metrics: TCPListenerMetrics\n private addr: string\n private readonly log: Logger\n private readonly shutdownController: AbortController\n\n constructor (private readonly context: Context) {\n super()\n\n context.keepAlive = context.keepAlive ?? true\n context.noDelay = context.noDelay ?? true\n context.allowHalfOpen = context.allowHalfOpen ?? false\n\n this.shutdownController = new AbortController()\n setMaxListeners(Infinity, this.shutdownController.signal)\n\n this.log = context.logger.forComponent('libp2p:tcp:listener')\n this.addr = 'unknown'\n this.server = net.createServer(context, this.onSocket.bind(this))\n\n // https://nodejs.org/api/net.html#servermaxconnections\n // If set reject connections when the server's connection count gets high\n // Useful to prevent too resource exhaustion via many open connections on\n // high bursts of activity\n if (context.maxConnections !== undefined) {\n this.server.maxConnections = context.maxConnections\n }\n\n if (context.closeServerOnMaxConnections != null) {\n // Sanity check options\n if (context.closeServerOnMaxConnections.closeAbove < context.closeServerOnMaxConnections.listenBelow) {\n throw new InvalidParametersError('closeAbove must be >= listenBelow')\n }\n }\n\n context.metrics?.registerMetricGroup('libp2p_tcp_inbound_connections_total', {\n label: 'address',\n help: 'Current active connections in TCP listener',\n calculate: () => {\n return {\n [this.addr]: this.sockets.size\n }\n }\n })\n\n this.metrics = {\n status: context.metrics?.registerMetricGroup('libp2p_tcp_listener_status_info', {\n label: 'address',\n help: 'Current status of the TCP listener socket'\n }),\n errors: context.metrics?.registerMetricGroup('libp2p_tcp_listener_errors_total', {\n label: 'address',\n help: 'Total count of TCP listener errors by type'\n }),\n events: context.metrics?.registerMetricGroup('libp2p_tcp_listener_events_total', {\n label: 'address',\n help: 'Total count of TCP listener events by type'\n })\n }\n\n this.server\n .on('listening', () => {\n // we are listening, register metrics for our port\n const address = this.server.address()\n\n if (address == null) {\n this.addr = 'unknown'\n } else if (typeof address === 'string') {\n // unix socket\n this.addr = address\n } else {\n this.addr = `${address.address}:${address.port}`\n }\n\n this.metrics.status?.update({\n [this.addr]: TCPListenerStatusCode.ACTIVE\n })\n\n this.safeDispatchEvent('listening')\n })\n .on('error', err => {\n this.metrics.errors?.increment({ [`${this.addr} listen_error`]: true })\n this.safeDispatchEvent('error', { detail: err })\n })\n .on('close', () => {\n this.metrics.status?.update({\n [this.addr]: this.status.code\n })\n\n // If this event is emitted, the transport manager will remove the\n // listener from it's cache in the meanwhile if the connections are\n // dropped then listener will start listening again and the transport\n // manager will not be able to close the server\n if (this.status.code !== TCPListenerStatusCode.PAUSED) {\n this.safeDispatchEvent('close')\n }\n })\n .on('drop', () => {\n this.metrics.events?.increment({ [`${this.addr} drop`]: true })\n })\n }\n\n private onSocket (socket: net.Socket): void {\n this.metrics.events?.increment({ [`${this.addr} connection`]: true })\n\n if (this.status.code !== TCPListenerStatusCode.ACTIVE) {\n socket.destroy()\n throw new NotStartedError('Server is not listening yet')\n }\n\n let maConn: MultiaddrConnection\n try {\n maConn = toMultiaddrConnection({\n socket,\n inactivityTimeout: this.context.inactivityTimeout,\n metrics: this.metrics?.events,\n metricPrefix: `${this.addr} `,\n direction: 'inbound',\n localAddr: this.status.listeningAddr,\n log: this.context.logger.forComponent('libp2p:tcp:connection')\n })\n } catch (err: any) {\n this.log.error('inbound connection failed', err)\n this.metrics.errors?.increment({ [`${this.addr} inbound_to_connection`]: true })\n socket.destroy()\n return\n }\n\n this.log('new inbound connection %s', maConn.remoteAddr)\n this.sockets.add(socket)\n\n this.context.upgrader.upgradeInbound(maConn, {\n signal: this.shutdownController.signal\n })\n .then(() => {\n this.log('inbound connection upgraded %s', maConn.remoteAddr)\n\n socket.once('close', () => {\n this.sockets.delete(socket)\n\n if (\n this.context.closeServerOnMaxConnections != null &&\n this.sockets.size < this.context.closeServerOnMaxConnections.listenBelow\n ) {\n // The most likely case of error is if the port taken by this\n // application is bound by another process during the time the\n // server if closed. In that case there's not much we can do.\n // resume() will be called again every time a connection is\n // dropped, which acts as an eventual retry mechanism.\n // onListenError allows the consumer act on this.\n this.resume().catch(e => {\n this.log.error('error attempting to listen server once connection count under limit', e)\n this.context.closeServerOnMaxConnections?.onListenError?.(e as Error)\n })\n }\n })\n\n if (\n this.context.closeServerOnMaxConnections != null &&\n this.sockets.size >= this.context.closeServerOnMaxConnections.closeAbove\n ) {\n this.log('pausing incoming connections as limit is exceeded - %d/%d', this.sockets.size, this.context.closeServerOnMaxConnections.closeAbove)\n this.pause()\n }\n })\n .catch(async err => {\n this.log.error('inbound connection upgrade failed', err)\n this.metrics.errors?.increment({ [`${this.addr} inbound_upgrade`]: true })\n this.sockets.delete(socket)\n maConn.abort(err)\n })\n }\n\n getAddrs (): Multiaddr[] {\n if (this.status.code === TCPListenerStatusCode.INACTIVE) {\n return []\n }\n\n const address = this.server.address()\n\n if (address == null) {\n return []\n }\n\n if (typeof address === 'string') {\n return [\n multiaddr(`/unix/${encodeURIComponent(address)}`)\n ]\n }\n\n return getThinWaistAddresses(this.status.listeningAddr, address.port)\n }\n\n updateAnnounceAddrs (): void {\n\n }\n\n async listen (ma: Multiaddr): Promise<void> {\n if (this.status.code === TCPListenerStatusCode.ACTIVE || this.status.code === TCPListenerStatusCode.PAUSED) {\n throw new AlreadyStartedError('server is already listening')\n }\n\n try {\n this.status = {\n code: TCPListenerStatusCode.ACTIVE,\n listeningAddr: ma,\n netConfig: multiaddrToNetConfig(ma, this.context)\n }\n\n await this.resume()\n } catch (err) {\n this.status = { code: TCPListenerStatusCode.INACTIVE }\n throw err\n }\n }\n\n async close (options?: AbortOptions): Promise<void> {\n const events: Array<Promise<void>> = []\n\n if (this.server.listening) {\n events.push(pEvent(this.server, 'close', options))\n }\n\n // shut down the server socket, permanently\n this.pause(true)\n\n // stop any in-progress connection upgrades\n this.shutdownController.abort()\n\n // synchronously close any open connections - should be done after closing\n // the server socket in case new sockets are opened during the shutdown\n this.sockets.forEach(socket => {\n if (socket.readable) {\n events.push(pEvent(socket, 'close', options))\n socket.destroy()\n }\n })\n\n await Promise.all(events)\n }\n\n /**\n * Can resume a stopped or start an inert server\n */\n private async resume (): Promise<void> {\n if (this.server.listening || this.status.code === TCPListenerStatusCode.INACTIVE) {\n return\n }\n\n const netConfig = this.status.netConfig\n\n await new Promise<void>((resolve, reject) => {\n // NOTE: 'listening' event is only fired on success. Any error such as\n // port already bound, is emitted via 'error'\n this.server.once('error', reject)\n this.server.listen(netConfig, resolve)\n })\n\n this.status = { ...this.status, code: TCPListenerStatusCode.ACTIVE }\n this.log('listening on %s', this.server.address())\n }\n\n private pause (permanent: boolean = false): void {\n if (!this.server.listening && this.status.code === TCPListenerStatusCode.PAUSED && permanent) {\n this.status = { code: TCPListenerStatusCode.INACTIVE }\n return\n }\n\n if (!this.server.listening || this.status.code !== TCPListenerStatusCode.ACTIVE) {\n return\n }\n\n this.log('%s server on %s', permanent ? 'closing' : 'pausing', this.server.address())\n\n // NodeJS implementation tracks listening status with `this._handle` property.\n // - Server.close() sets this._handle to null immediately. If this._handle is null, NotStartedError is thrown\n // - Server.listening returns `this._handle !== null` https://github.com/nodejs/node/blob/386d761943bb1b217fba27d6b80b658c23009e60/lib/net.js#L1675\n // - Server.listen() if `this._handle !== null` throws AlreadyStartedError\n //\n // NOTE: Both listen and close are technically not async actions, so it's not necessary to track\n // states 'pending-close' or 'pending-listen'\n\n // From docs https://nodejs.org/api/net.html#serverclosecallback\n // Stops the server from accepting new connections and keeps existing connections.\n // 'close' event is emitted only emitted when all connections are ended.\n // The optional callback will be called once the 'close' event occurs.\n\n // We need to set this status before closing server, so other procedures are aware\n // during the time the server is closing\n this.status = permanent ? { code: TCPListenerStatusCode.INACTIVE } : { ...this.status, code: TCPListenerStatusCode.PAUSED }\n\n // stop accepting incoming connections - existing connections are maintained\n // - any callback passed here would be invoked after existing connections\n // close, we want to maintain them so no callback is passed otherwise his\n // method will never return\n this.server.close()\n }\n}\n", "import { InvalidParametersError } from '@libp2p/interface'\nimport type { Multiaddr } from '@multiformats/multiaddr'\n\nexport interface IP4NetConfig {\n type: 'ip4'\n host: string\n protocol?: 'tcp' | 'udp'\n port?: number\n cidr?: number\n sni?: string\n}\n\nexport interface IP6NetConfig {\n type: 'ip6'\n host: string\n protocol?: 'tcp' | 'udp'\n port?: number\n zone?: string\n cidr?: string\n sni?: string\n}\n\nexport interface DNSNetConfig {\n type: 'dns'\n host: string\n protocol?: 'tcp' | 'udp'\n port: number\n cidr?: number\n}\n\nexport interface DNS4NetConfig {\n type: 'dns4'\n host: string\n protocol?: 'tcp' | 'udp'\n port: number\n cidr?: number\n}\n\nexport interface DNS6NetConfig {\n type: 'dns6'\n host: string\n protocol?: 'tcp' | 'udp'\n port: number\n cidr?: number\n}\n\nexport interface DNSAddrNetConfig {\n type: 'dnsaddr'\n host: string\n protocol?: 'tcp' | 'udp'\n port: number\n cidr?: number\n}\n\nexport type NetConfig = IP4NetConfig | IP6NetConfig | DNSNetConfig | DNS4NetConfig | DNS6NetConfig | DNSAddrNetConfig\n\n/**\n * Returns host/port/etc information for multiaddrs, if it is available.\n *\n * It will throw if the passed multiaddr does not start with a network address,\n * e.g. a IPv4, IPv6, DNS, DNS4, DNS6 or DNSADDR address\n */\nexport function getNetConfig (ma: Multiaddr): NetConfig {\n const components = ma.getComponents()\n const config: any = {}\n let index = 0\n\n if (components[index]?.name === 'ip6zone') {\n config.zone = `${components[index].value}`\n index++\n }\n\n if (components[index].name === 'ip4' || components[index].name === 'ip6') {\n config.type = components[index].name\n config.host = components[index].value\n index++\n } else if (components[index].name === 'dns' || components[index].name === 'dns4' || components[index].name === 'dns6') {\n config.type = components[index].name\n config.host = components[index].value\n index++\n } else if (components[index].name === 'dnsaddr') {\n config.type = components[index].name\n config.host = `_dnsaddr.${components[index].value}`\n index++\n }\n\n if (components[index]?.name === 'tcp' || components[index]?.name === 'udp') {\n config.protocol = components[index].name === 'tcp' ? 'tcp' : 'udp'\n config.port = parseInt(`${components[index].value}`)\n index++\n }\n\n if (components[index]?.name === 'ipcidr') {\n if (config.type === 'ip4') {\n config.cidr = parseInt(`${components[index].value}`)\n } else if (config.type === 'ip6') {\n config.cidr = `${components[index].value}`\n }\n index++\n }\n\n if (config.type == null || config.host == null) {\n throw new InvalidParametersError(`Multiaddr ${ma} was not an IPv4, IPv6, DNS, DNS4, DNS6 or DNSADDR address`)\n }\n\n if (components[index]?.name === 'tls' && components[index + 1]?.name === 'sni') {\n config.sni = components[index + 1].value\n index += 2\n }\n\n return config\n}\n", "export default function pDefer() {\n\tconst deferred = {};\n\n\tdeferred.promise = new Promise((resolve, reject) => {\n\t\tdeferred.resolve = resolve;\n\t\tdeferred.reject = reject;\n\t});\n\n\treturn deferred;\n}\n", "// ported from https://www.npmjs.com/package/fast-fifo\n\nexport interface Next<T> {\n done?: boolean\n error?: Error\n value?: T\n}\n\nclass FixedFIFO<T> {\n public buffer: Array<Next<T> | undefined>\n private readonly mask: number\n private top: number\n private btm: number\n public next: FixedFIFO<T> | null\n\n constructor (hwm: number) {\n if (!(hwm > 0) || ((hwm - 1) & hwm) !== 0) {\n throw new Error('Max size for a FixedFIFO should be a power of two')\n }\n\n this.buffer = new Array(hwm)\n this.mask = hwm - 1\n this.top = 0\n this.btm = 0\n this.next = null\n }\n\n push (data: Next<T>): boolean {\n if (this.buffer[this.top] !== undefined) {\n return false\n }\n\n this.buffer[this.top] = data\n this.top = (this.top + 1) & this.mask\n\n return true\n }\n\n shift (): Next<T> | undefined {\n const last = this.buffer[this.btm]\n\n if (last === undefined) {\n return undefined\n }\n\n this.buffer[this.btm] = undefined\n this.btm = (this.btm + 1) & this.mask\n return last\n }\n\n isEmpty (): boolean {\n return this.buffer[this.btm] === undefined\n }\n}\n\nexport interface FIFOOptions {\n /**\n * When the queue reaches this size, it will be split into head/tail parts\n */\n splitLimit?: number\n}\n\nexport class FIFO<T> {\n public size: number\n private readonly hwm: number\n private head: FixedFIFO<T>\n private tail: FixedFIFO<T>\n\n constructor (options: FIFOOptions = {}) {\n this.hwm = options.splitLimit ?? 16\n this.head = new FixedFIFO<T>(this.hwm)\n this.tail = this.head\n this.size = 0\n }\n\n calculateSize (obj: any): number {\n if (obj?.byteLength != null) {\n return obj.byteLength\n }\n\n return 1\n }\n\n push (val: Next<T>): void {\n if (val?.value != null) {\n this.size += this.calculateSize(val.value)\n }\n\n if (!this.head.push(val)) {\n const prev = this.head\n this.head = prev.next = new FixedFIFO<T>(2 * this.head.buffer.length)\n this.head.push(val)\n }\n }\n\n shift (): Next<T> | undefined {\n let val = this.tail.shift()\n\n if (val === undefined && (this.tail.next != null)) {\n const next = this.tail.next\n this.tail.next = null\n this.tail = next\n val = this.tail.shift()\n }\n\n if (val?.value != null) {\n this.size -= this.calculateSize(val.value)\n }\n\n return val\n }\n\n isEmpty (): boolean {\n return this.head.isEmpty()\n }\n}\n", "/**\n * @packageDocumentation\n *\n * An iterable that you can push values into.\n *\n * @example\n *\n * ```js\n * import { pushable } from 'it-pushable'\n *\n * const source = pushable()\n *\n * setTimeout(() => source.push('hello'), 100)\n * setTimeout(() => source.push('world'), 200)\n * setTimeout(() => source.end(), 300)\n *\n * const start = Date.now()\n *\n * for await (const value of source) {\n * console.log(`got \"${value}\" after ${Date.now() - start}ms`)\n * }\n * console.log(`done after ${Date.now() - start}ms`)\n *\n * // Output:\n * // got \"hello\" after 105ms\n * // got \"world\" after 207ms\n * // done after 309ms\n * ```\n *\n * @example\n *\n * ```js\n * import { pushableV } from 'it-pushable'\n * import all from 'it-all'\n *\n * const source = pushableV()\n *\n * source.push(1)\n * source.push(2)\n * source.push(3)\n * source.end()\n *\n * console.info(await all(source))\n *\n * // Output:\n * // [ [1, 2, 3] ]\n * ```\n */\n\nimport deferred from 'p-defer'\nimport { FIFO, type Next } from './fifo.js'\n\nexport class AbortError extends Error {\n type: string\n code: string\n\n constructor (message?: string, code?: string) {\n super(message ?? 'The operation was aborted')\n this.type = 'aborted'\n this.code = code ?? 'ABORT_ERR'\n }\n}\n\nexport interface AbortOptions {\n signal?: AbortSignal\n}\n\ninterface BasePushable<T> {\n /**\n * End the iterable after all values in the buffer (if any) have been yielded. If an\n * error is passed the buffer is cleared immediately and the next iteration will\n * throw the passed error\n */\n end(err?: Error): this\n\n /**\n * Push a value into the iterable. Values are yielded from the iterable in the order\n * they are pushed. Values not yet consumed from the iterable are buffered.\n */\n push(value: T): this\n\n /**\n * Returns a promise that resolves when the underlying queue becomes empty (e.g.\n * this.readableLength === 0).\n *\n * If an AbortSignal is passed as an option and that signal aborts, it only\n * causes the returned promise to reject - it does not end the pushable.\n */\n onEmpty(options?: AbortOptions): Promise<void>\n\n /**\n * This property contains the number of bytes (or objects) in the queue ready to be read.\n *\n * If `objectMode` is true, this is the number of objects in the queue, if false it's the\n * total number of bytes in the queue.\n */\n readableLength: number\n}\n\n/**\n * An iterable that you can push values into.\n */\nexport interface Pushable<T, R = void, N = unknown> extends AsyncGenerator<T, R, N>, BasePushable<T> {}\n\n/**\n * Similar to `pushable`, except it yields multiple buffered chunks at a time. All values yielded from the iterable will be arrays.\n */\nexport interface PushableV<T, R = void, N = unknown> extends AsyncGenerator<T[], R, N>, BasePushable<T> {}\n\nexport interface Options {\n /**\n * A boolean value that means non-`Uint8Array`s will be passed to `.push`, default: `false`\n */\n objectMode?: boolean\n\n /**\n * A function called after *all* values have been yielded from the iterator (including\n * buffered values). In the case when the iterator is ended with an error it will be\n * passed the error as a parameter.\n */\n onEnd?(err?: Error): void\n}\n\nexport interface DoneResult { done: true }\nexport interface ValueResult<T> { done: false, value: T }\nexport type NextResult<T> = ValueResult<T> | DoneResult\n\ninterface getNext<T, V = T> { (buffer: FIFO<T>): NextResult<V> }\n\nexport interface ObjectPushableOptions extends Options {\n objectMode: true\n}\n\nexport interface BytePushableOptions extends Options {\n objectMode?: false\n}\n\n/**\n * Create a new async iterable. The values yielded from calls to `.next()`\n * or when used in a `for await of`loop are \"pushed\" into the iterable.\n * Returns an async iterable object with additional methods.\n */\nexport function pushable<T extends { byteLength: number } = Uint8Array> (options?: BytePushableOptions): Pushable<T>\nexport function pushable<T> (options: ObjectPushableOptions): Pushable<T>\nexport function pushable<T> (options: Options = {}): Pushable<T> {\n const getNext = (buffer: FIFO<T>): NextResult<T> => {\n const next: Next<T> | undefined = buffer.shift()\n\n if (next == null) {\n return { done: true }\n }\n\n if (next.error != null) {\n throw next.error\n }\n\n return {\n done: next.done === true,\n // @ts-expect-error if done is false, value will be present\n value: next.value\n }\n }\n\n return _pushable<T, T, Pushable<T>>(getNext, options)\n}\n\nexport function pushableV<T extends { byteLength: number } = Uint8Array> (options?: BytePushableOptions): PushableV<T>\nexport function pushableV<T> (options: ObjectPushableOptions): PushableV<T>\nexport function pushableV<T> (options: Options = {}): PushableV<T> {\n const getNext = (buffer: FIFO<T>): NextResult<T[]> => {\n let next: Next<T> | undefined\n const values: T[] = []\n\n while (!buffer.isEmpty()) {\n next = buffer.shift()\n\n if (next == null) {\n break\n }\n\n if (next.error != null) {\n throw next.error\n }\n\n if (next.done === false) {\n // @ts-expect-error if done is false value should be pushed\n values.push(next.value)\n }\n }\n\n if (next == null) {\n return { done: true }\n }\n\n return {\n done: next.done === true,\n value: values\n }\n }\n\n return _pushable<T, T[], PushableV<T>>(getNext, options)\n}\n\nfunction _pushable<PushType, ValueType, ReturnType> (getNext: getNext<PushType, ValueType>, options?: Options): ReturnType {\n options = options ?? {}\n let onEnd = options.onEnd\n let buffer = new FIFO<PushType>()\n let pushable: any\n let onNext: ((next: Next<PushType>) => ReturnType) | null\n let ended: boolean\n let drain = deferred()\n\n const waitNext = async (): Promise<NextResult<ValueType>> => {\n try {\n if (!buffer.isEmpty()) {\n return getNext(buffer)\n }\n\n if (ended) {\n return { done: true }\n }\n\n return await new Promise<NextResult<ValueType>>((resolve, reject) => {\n onNext = (next: Next<PushType>) => {\n onNext = null\n buffer.push(next)\n\n try {\n resolve(getNext(buffer))\n } catch (err) {\n reject(err)\n }\n\n return pushable\n }\n })\n } finally {\n if (buffer.isEmpty()) {\n // settle promise in the microtask queue to give consumers a chance to\n // await after calling .push\n queueMicrotask(() => {\n drain.resolve()\n drain = deferred()\n })\n }\n }\n }\n\n const bufferNext = (next: Next<PushType>): ReturnType => {\n if (onNext != null) {\n return onNext(next)\n }\n\n buffer.push(next)\n return pushable\n }\n\n const bufferError = (err: Error): ReturnType => {\n buffer = new FIFO()\n\n if (onNext != null) {\n return onNext({ error: err })\n }\n\n buffer.push({ error: err })\n return pushable\n }\n\n const push = (value: PushType): ReturnType => {\n if (ended) {\n return pushable\n }\n\n // @ts-expect-error `byteLength` is not declared on PushType\n if (options?.objectMode !== true && value?.byteLength == null) {\n throw new Error('objectMode was not true but tried to push non-Uint8Array value')\n }\n\n return bufferNext({ done: false, value })\n }\n const end = (err?: Error): ReturnType => {\n if (ended) return pushable\n ended = true\n\n return (err != null) ? bufferError(err) : bufferNext({ done: true })\n }\n const _return = (): DoneResult => {\n buffer = new FIFO()\n end()\n\n return { done: true }\n }\n const _throw = (err: Error): DoneResult => {\n end(err)\n\n return { done: true }\n }\n\n pushable = {\n [Symbol.asyncIterator] () { return this },\n next: waitNext,\n return: _return,\n throw: _throw,\n push,\n end,\n get readableLength (): number {\n return buffer.size\n },\n onEmpty: async (options?: AbortOptions) => {\n const signal = options?.signal\n signal?.throwIfAborted()\n\n if (buffer.isEmpty()) {\n return\n }\n\n let cancel: Promise<void> | undefined\n let listener: (() => void) | undefined\n\n if (signal != null) {\n cancel = new Promise((resolve, reject) => {\n listener = () => {\n reject(new AbortError())\n }\n\n signal.addEventListener('abort', listener)\n })\n }\n\n try {\n await Promise.race([\n drain.promise,\n cancel\n ])\n } finally {\n if (listener != null && signal != null) {\n signal?.removeEventListener('abort', listener)\n }\n }\n }\n }\n\n if (onEnd == null) {\n return pushable\n }\n\n const _pushable = pushable\n\n pushable = {\n [Symbol.asyncIterator] () { return this },\n next () {\n return _pushable.next()\n },\n throw (err: Error) {\n _pushable.throw(err)\n\n if (onEnd != null) {\n onEnd(err)\n onEnd = undefined\n }\n\n return { done: true }\n },\n return () {\n _pushable.return()\n\n if (onEnd != null) {\n onEnd()\n onEnd = undefined\n }\n\n return { done: true }\n },\n push,\n end (err: Error) {\n _pushable.end(err)\n\n if (onEnd != null) {\n onEnd(err)\n onEnd = undefined\n }\n\n return pushable\n },\n get readableLength () {\n return _pushable.readableLength\n },\n onEmpty: (opts?: AbortOptions) => {\n return _pushable.onEmpty(opts)\n }\n }\n\n return pushable\n}\n", "export class TimeoutError extends Error {\n\tconstructor(message) {\n\t\tsuper(message);\n\t\tthis.name = 'TimeoutError';\n\t}\n}\n\n/**\nAn error to be thrown when the request is aborted by AbortController.\nDOMException is thrown instead of this Error when DOMException is available.\n*/\nexport class AbortError extends Error {\n\tconstructor(message) {\n\t\tsuper();\n\t\tthis.name = 'AbortError';\n\t\tthis.message = message;\n\t}\n}\n\n/**\nTODO: Remove AbortError and just throw DOMException when targeting Node 18.\n*/\nconst getDOMException = errorMessage => globalThis.DOMException === undefined\n\t? new AbortError(errorMessage)\n\t: new DOMException(errorMessage);\n\n/**\nTODO: Remove below function and just 'reject(signal.reason)' when targeting Node 18.\n*/\nconst getAbortedReason = signal => {\n\tconst reason = signal.reason === undefined\n\t\t? getDOMException('This operation was aborted.')\n\t\t: signal.reason;\n\n\treturn reason instanceof Error ? reason : getDOMException(reason);\n};\n\nexport default function pTimeout(promise, options) {\n\tconst {\n\t\tmilliseconds,\n\t\tfallback,\n\t\tmessage,\n\t\tcustomTimers = {setTimeout, clearTimeout},\n\t} = options;\n\n\tlet timer;\n\tlet abortHandler;\n\n\tconst wrappedPromise = new Promise((resolve, reject) => {\n\t\tif (typeof milliseconds !== 'number' || Math.sign(milliseconds) !== 1) {\n\t\t\tthrow new TypeError(`Expected \\`milliseconds\\` to be a positive number, got \\`${milliseconds}\\``);\n\t\t}\n\n\t\tif (options.signal) {\n\t\t\tconst {signal} = options;\n\t\t\tif (signal.aborted) {\n\t\t\t\treject(getAbortedReason(signal));\n\t\t\t}\n\n\t\t\tabortHandler = () => {\n\t\t\t\treject(getAbortedReason(signal));\n\t\t\t};\n\n\t\t\tsignal.addEventListener('abort', abortHandler, {once: true});\n\t\t}\n\n\t\tif (milliseconds === Number.POSITIVE_INFINITY) {\n\t\t\tpromise.then(resolve, reject);\n\t\t\treturn;\n\t\t}\n\n\t\t// We create the error outside of `setTimeout` to preserve the stack trace.\n\t\tconst timeoutError = new TimeoutError();\n\n\t\ttimer = customTimers.setTimeout.call(undefined, () => {\n\t\t\tif (fallback) {\n\t\t\t\ttry {\n\t\t\t\t\tresolve(fallback());\n\t\t\t\t} catch (error) {\n\t\t\t\t\treject(error);\n\t\t\t\t}\n\n\t\t\t\treturn;\n\t\t\t}\n\n\t\t\tif (typeof promise.cancel === 'function') {\n\t\t\t\tpromise.cancel();\n\t\t\t}\n\n\t\t\tif (message === false) {\n\t\t\t\tresolve();\n\t\t\t} else if (message instanceof Error) {\n\t\t\t\treject(message);\n\t\t\t} else {\n\t\t\t\ttimeoutError.message = message ?? `Promise timed out after ${milliseconds} milliseconds`;\n\t\t\t\treject(timeoutError);\n\t\t\t}\n\t\t}, milliseconds);\n\n\t\t(async () => {\n\t\t\ttry {\n\t\t\t\tresolve(await promise);\n\t\t\t} catch (error) {\n\t\t\t\treject(error);\n\t\t\t}\n\t\t})();\n\t});\n\n\tconst cancelablePromise = wrappedPromise.finally(() => {\n\t\tcancelablePromise.clear();\n\t\tif (abortHandler && options.signal) {\n\t\t\toptions.signal.removeEventListener('abort', abortHandler);\n\t\t}\n\t});\n\n\tcancelablePromise.clear = () => {\n\t\tcustomTimers.clearTimeout.call(undefined, timer);\n\t\ttimer = undefined;\n\t};\n\n\treturn cancelablePromise;\n}\n", "import pTimeout from 'p-timeout';\n\nconst normalizeEmitter = emitter => {\n\tconst addListener = emitter.addEventListener || emitter.on || emitter.addListener;\n\tconst removeListener = emitter.removeEventListener || emitter.off || emitter.removeListener;\n\n\tif (!addListener || !removeListener) {\n\t\tthrow new TypeError('Emitter is not compatible');\n\t}\n\n\treturn {\n\t\taddListener: addListener.bind(emitter),\n\t\tremoveListener: removeListener.bind(emitter),\n\t};\n};\n\nexport function pEventMultiple(emitter, event, options) {\n\tlet cancel;\n\tconst returnValue = new Promise((resolve, reject) => {\n\t\toptions = {\n\t\t\trejectionEvents: ['error'],\n\t\t\tmultiArgs: false,\n\t\t\tresolveImmediately: false,\n\t\t\t...options,\n\t\t};\n\n\t\tif (!(options.count >= 0 && (options.count === Number.POSITIVE_INFINITY || Number.isInteger(options.count)))) {\n\t\t\tthrow new TypeError('The `count` option should be at least 0 or more');\n\t\t}\n\n\t\toptions.signal?.throwIfAborted();\n\n\t\t// Allow multiple events\n\t\tconst events = [event].flat();\n\n\t\tconst items = [];\n\t\tconst {addListener, removeListener} = normalizeEmitter(emitter);\n\n\t\tconst onItem = (...arguments_) => {\n\t\t\tconst value = options.multiArgs ? arguments_ : arguments_[0];\n\n\t\t\t// eslint-disable-next-line unicorn/no-array-callback-reference\n\t\t\tif (options.filter && !options.filter(value)) {\n\t\t\t\treturn;\n\t\t\t}\n\n\t\t\titems.push(value);\n\n\t\t\tif (options.count === items.length) {\n\t\t\t\tcancel();\n\t\t\t\tresolve(items);\n\t\t\t}\n\t\t};\n\n\t\tconst rejectHandler = error => {\n\t\t\tcancel();\n\t\t\treject(error);\n\t\t};\n\n\t\tcancel = () => {\n\t\t\tfor (const event of events) {\n\t\t\t\tremoveListener(event, onItem);\n\t\t\t}\n\n\t\t\tfor (const rejectionEvent of options.rejectionEvents) {\n\t\t\t\tremoveListener(rejectionEvent, rejectHandler);\n\t\t\t}\n\t\t};\n\n\t\tfor (const event of events) {\n\t\t\taddListener(event, onItem);\n\t\t}\n\n\t\tfor (const rejectionEvent of options.rejectionEvents) {\n\t\t\taddListener(rejectionEvent, rejectHandler);\n\t\t}\n\n\t\tif (options.signal) {\n\t\t\toptions.signal.addEventListener('abort', () => {\n\t\t\t\trejectHandler(options.signal.reason);\n\t\t\t}, {once: true});\n\t\t}\n\n\t\tif (options.resolveImmediately) {\n\t\t\tresolve(items);\n\t\t}\n\t});\n\n\treturnValue.cancel = cancel;\n\n\tif (typeof options.timeout === 'number') {\n\t\tconst timeout = pTimeout(returnValue, {milliseconds: options.timeout});\n\t\ttimeout.cancel = cancel;\n\t\treturn timeout;\n\t}\n\n\treturn returnValue;\n}\n\nexport function pEvent(emitter, event, options) {\n\tif (typeof options === 'function') {\n\t\toptions = {filter: options};\n\t}\n\n\toptions = {\n\t\t...options,\n\t\tcount: 1,\n\t\tresolveImmediately: false,\n\t};\n\n\tconst arrayPromise = pEventMultiple(emitter, event, options);\n\tconst promise = arrayPromise.then(array => array[0]);\n\tpromise.cancel = arrayPromise.cancel;\n\n\treturn promise;\n}\n\nexport function pEventIterator(emitter, event, options) {\n\tif (typeof options === 'function') {\n\t\toptions = {filter: options};\n\t}\n\n\t// Allow multiple events\n\tconst events = [event].flat();\n\n\toptions = {\n\t\trejectionEvents: ['error'],\n\t\tresolutionEvents: [],\n\t\tlimit: Number.POSITIVE_INFINITY,\n\t\tmultiArgs: false,\n\t\t...options,\n\t};\n\n\tconst {limit} = options;\n\tconst isValidLimit = limit >= 0 && (limit === Number.POSITIVE_INFINITY || Number.isInteger(limit));\n\tif (!isValidLimit) {\n\t\tthrow new TypeError('The `limit` option should be a non-negative integer or Infinity');\n\t}\n\n\toptions.signal?.throwIfAborted();\n\n\tif (limit === 0) {\n\t\t// Return an empty async iterator to avoid any further cost\n\t\treturn {\n\t\t\t[Symbol.asyncIterator]() {\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\tasync next() {\n\t\t\t\treturn {\n\t\t\t\t\tdone: true,\n\t\t\t\t\tvalue: undefined,\n\t\t\t\t};\n\t\t\t},\n\t\t};\n\t}\n\n\tconst {addListener, removeListener} = normalizeEmitter(emitter);\n\n\tlet isDone = false;\n\tlet error;\n\tlet hasPendingError = false;\n\tconst nextQueue = [];\n\tconst valueQueue = [];\n\tlet eventCount = 0;\n\tlet isLimitReached = false;\n\n\tconst valueHandler = (...arguments_) => {\n\t\teventCount++;\n\t\tisLimitReached = eventCount === limit;\n\n\t\tconst value = options.multiArgs ? arguments_ : arguments_[0];\n\n\t\tif (nextQueue.length > 0) {\n\t\t\tconst {resolve} = nextQueue.shift();\n\n\t\t\tresolve({done: false, value});\n\n\t\t\tif (isLimitReached) {\n\t\t\t\tcancel();\n\t\t\t}\n\n\t\t\treturn;\n\t\t}\n\n\t\tvalueQueue.push(value);\n\n\t\tif (isLimitReached) {\n\t\t\tcancel();\n\t\t}\n\t};\n\n\tconst cancel = () => {\n\t\tisDone = true;\n\n\t\tfor (const event of events) {\n\t\t\tremoveListener(event, valueHandler);\n\t\t}\n\n\t\tfor (const rejectionEvent of options.rejectionEvents) {\n\t\t\tremoveListener(rejectionEvent, rejectHandler);\n\t\t}\n\n\t\tfor (const resolutionEvent of options.resolutionEvents) {\n\t\t\tremoveListener(resolutionEvent, resolveHandler);\n\t\t}\n\n\t\twhile (nextQueue.length > 0) {\n\t\t\tconst {resolve} = nextQueue.shift();\n\t\t\tresolve({done: true, value: undefined});\n\t\t}\n\t};\n\n\tconst rejectHandler = (...arguments_) => {\n\t\terror = options.multiArgs ? arguments_ : arguments_[0];\n\n\t\tif (nextQueue.length > 0) {\n\t\t\tconst {reject} = nextQueue.shift();\n\t\t\treject(error);\n\t\t} else {\n\t\t\thasPendingError = true;\n\t\t}\n\n\t\tcancel();\n\t};\n\n\tconst resolveHandler = (...arguments_) => {\n\t\tconst value = options.multiArgs ? arguments_ : arguments_[0];\n\n\t\t// eslint-disable-next-line unicorn/no-array-callback-reference\n\t\tif (options.filter && !options.filter(value)) {\n\t\t\tcancel();\n\t\t\treturn;\n\t\t}\n\n\t\tif (nextQueue.length > 0) {\n\t\t\tconst {resolve} = nextQueue.shift();\n\t\t\tresolve({done: true, value});\n\t\t} else {\n\t\t\tvalueQueue.push(value);\n\t\t}\n\n\t\tcancel();\n\t};\n\n\tfor (const event of events) {\n\t\taddListener(event, valueHandler);\n\t}\n\n\tfor (const rejectionEvent of options.rejectionEvents) {\n\t\taddListener(rejectionEvent, rejectHandler);\n\t}\n\n\tfor (const resolutionEvent of options.resolutionEvents) {\n\t\taddListener(resolutionEvent, resolveHandler);\n\t}\n\n\tif (options.signal) {\n\t\toptions.signal.addEventListener('abort', () => {\n\t\t\trejectHandler(options.signal.reason);\n\t\t}, {once: true});\n\t}\n\n\treturn {\n\t\t[Symbol.asyncIterator]() {\n\t\t\treturn this;\n\t\t},\n\t\tasync next() {\n\t\t\tif (valueQueue.length > 0) {\n\t\t\t\tconst value = valueQueue.shift();\n\t\t\t\treturn {\n\t\t\t\t\tdone: isDone && valueQueue.length === 0 && !isLimitReached,\n\t\t\t\t\tvalue,\n\t\t\t\t};\n\t\t\t}\n\n\t\t\tif (hasPendingError) {\n\t\t\t\thasPendingError = false;\n\t\t\t\tthrow error;\n\t\t\t}\n\n\t\t\tif (isDone) {\n\t\t\t\treturn {\n\t\t\t\t\tdone: true,\n\t\t\t\t\tvalue: undefined,\n\t\t\t\t};\n\t\t\t}\n\n\t\t\treturn new Promise((resolve, reject) => {\n\t\t\t\tnextQueue.push({resolve, reject});\n\t\t\t});\n\t\t},\n\t\tasync return(value) {\n\t\t\tcancel();\n\t\t\treturn {\n\t\t\t\tdone: isDone,\n\t\t\t\tvalue,\n\t\t\t};\n\t\t},\n\t};\n}\n\nexport {TimeoutError} from 'p-timeout';\n", "import type { RateLimiterResult } from './rate-limiter.js'\n\n/**\n * A rate limit was hit\n */\nexport class RateLimitError extends Error {\n remainingPoints: number\n msBeforeNext: number\n consumedPoints: number\n isFirstInDuration: boolean\n\n constructor (message = 'Rate limit exceeded', props: RateLimiterResult) {\n super(message)\n this.name = 'RateLimitError'\n this.remainingPoints = props.remainingPoints\n this.msBeforeNext = props.msBeforeNext\n this.consumedPoints = props.consumedPoints\n this.isFirstInDuration = props.isFirstInDuration\n }\n}\n\nexport class QueueFullError extends Error {\n static name = 'QueueFullError'\n\n constructor (message: string = 'The queue was full') {\n super(message)\n this.name = 'QueueFullError'\n }\n}\n\nexport class UnexpectedEOFError extends Error {\n static name = 'UnexpectedEOFError'\n name = 'UnexpectedEOFError'\n}\n\nexport class MaxEarlyStreamsError extends Error {\n static name = 'MaxEarlyStreamsError'\n name = 'MaxEarlyStreamsError'\n}\n", "/**\n * @packageDocumentation\n *\n * Pass a promise and an abort signal and await the result.\n *\n * @example Basic usage\n *\n * ```ts\n * import { raceSignal } from 'race-signal'\n *\n * const controller = new AbortController()\n *\n * const promise = new Promise((resolve, reject) => {\n * setTimeout(() => {\n * resolve('a value')\n * }, 1000)\n * })\n *\n * setTimeout(() => {\n * controller.abort()\n * }, 500)\n *\n * // throws an AbortError\n * const resolve = await raceSignal(promise, controller.signal)\n * ```\n *\n * @example Overriding errors\n *\n * By default the thrown error is the `.reason` property of the signal but it's\n * possible to override this behaviour with the `translateError` option:\n *\n * ```ts\n * import { raceSignal } from 'race-signal'\n *\n * const controller = new AbortController()\n *\n * const promise = new Promise((resolve, reject) => {\n * setTimeout(() => {\n * resolve('a value')\n * }, 1000)\n * })\n *\n * setTimeout(() => {\n * controller.abort()\n * }, 500)\n *\n * // throws `Error('Oh no!')`\n * const resolve = await raceSignal(promise, controller.signal, {\n * translateError: (signal) => {\n * // use `signal`, or don't\n * return new Error('Oh no!')\n * }\n * })\n * ```\n */\n\nexport interface RaceSignalOptions {\n /**\n * By default the rejection reason will be taken from the `.reason` field of\n * the aborted signal.\n *\n * Passing a function here allows overriding the default error.\n */\n translateError?(signal: AbortSignal): Error\n}\n\nfunction defaultTranslate (signal: AbortSignal): Error {\n return signal.reason\n}\n\n/**\n * Race a promise against an abort signal\n */\nexport async function raceSignal <T> (promise: Promise<T>, signal?: AbortSignal, opts?: RaceSignalOptions): Promise<T> {\n if (signal == null) {\n return promise\n }\n\n const translateError = opts?.translateError ?? defaultTranslate\n\n if (signal.aborted) {\n // the passed promise may yet resolve or reject but the use has signalled\n // they are no longer interested so smother the error\n promise.catch(() => {})\n return Promise.reject(translateError(signal))\n }\n\n let listener\n\n try {\n return await Promise.race([\n promise,\n new Promise<T>((resolve, reject) => {\n listener = () => {\n reject(translateError(signal))\n }\n signal.addEventListener('abort', listener)\n })\n ])\n } finally {\n if (listener != null) {\n signal.removeEventListener('abort', listener)\n }\n }\n}\n", "import { StreamResetError, TypedEventEmitter, StreamMessageEvent, StreamBufferError, StreamResetEvent, StreamAbortEvent, StreamCloseEvent, StreamStateError } from '@libp2p/interface'\nimport { pushable } from 'it-pushable'\nimport { Uint8ArrayList } from 'uint8arraylist'\nimport type { MessageStreamEvents, MessageStreamStatus, MessageStream, AbortOptions, MessageStreamTimeline, MessageStreamDirection, EventHandler, StreamOptions, MessageStreamReadStatus, MessageStreamWriteStatus } from '@libp2p/interface'\nimport type { Logger } from '@libp2p/logger'\n\nconst DEFAULT_MAX_READ_BUFFER_LENGTH = Math.pow(2, 20) * 4 // 4MB\n\nexport interface MessageStreamInit extends StreamOptions {\n /**\n * A Logger implementation used to log stream-specific information\n */\n log: Logger\n\n /**\n * The stream direction\n */\n direction?: MessageStreamDirection\n\n /**\n * By default all available bytes are passed to the `sendData` method of\n * extending classes, if smaller chunks are required, pass a value here.\n */\n maxMessageSize?: number\n}\n\nexport interface SendResult {\n /**\n * The number of bytes from the passed buffer that were sent\n */\n sentBytes: number\n\n /**\n * If the underlying resource can accept more data immediately. If `true`,\n * `sent` must equal the `.byteLength` of the buffer passed to `sendData`.\n */\n canSendMore: boolean\n}\n\nexport abstract class AbstractMessageStream<Timeline extends MessageStreamTimeline = MessageStreamTimeline> extends TypedEventEmitter<MessageStreamEvents> implements MessageStream {\n public status: MessageStreamStatus\n public readonly timeline: Timeline\n public inactivityTimeout: number\n public maxReadBufferLength: number\n public maxWriteBufferLength?: number\n public readonly log: Logger\n public direction: MessageStreamDirection\n public maxMessageSize?: number\n\n public readStatus: MessageStreamReadStatus\n public writeStatus: MessageStreamWriteStatus\n public remoteReadStatus: MessageStreamReadStatus\n public remoteWriteStatus: MessageStreamWriteStatus\n\n public writableNeedsDrain: boolean\n\n /**\n * Any data stored here is emitted before any new incoming data.\n *\n * This is used when the stream is paused or if data is pushed onto the stream\n */\n protected readonly readBuffer: Uint8ArrayList\n protected readonly writeBuffer: Uint8ArrayList\n protected sendingData: boolean\n\n constructor (init: MessageStreamInit) {\n super()\n\n this.status = 'open'\n this.log = init.log\n this.direction = init.direction ?? 'outbound'\n this.inactivityTimeout = init.inactivityTimeout ?? 120_000\n this.maxReadBufferLength = init.maxReadBufferLength ?? DEFAULT_MAX_READ_BUFFER_LENGTH\n this.maxWriteBufferLength = init.maxWriteBufferLength\n this.maxMessageSize = init.maxMessageSize\n this.readBuffer = new Uint8ArrayList()\n this.writeBuffer = new Uint8ArrayList()\n\n this.readStatus = 'readable'\n this.remoteReadStatus = 'readable'\n this.writeStatus = 'writable'\n this.remoteWriteStatus = 'writable'\n this.sendingData = false\n this.writableNeedsDrain = false\n\n // @ts-expect-error type could have required fields other than 'open'\n this.timeline = {\n open: Date.now()\n }\n\n this.processSendQueue = this.processSendQueue.bind(this)\n\n const continueSendingOnDrain = (): void => {\n this.log.trace('drain event received, continue sending data')\n this.writableNeedsDrain = false\n this.processSendQueue()\n }\n this.addEventListener('drain', continueSendingOnDrain)\n }\n\n async * [Symbol.asyncIterator] (): AsyncGenerator<Uint8Array | Uint8ArrayList> {\n if (this.readStatus !== 'readable' && this.readStatus !== 'paused') {\n return\n }\n\n const output = pushable<Uint8Array | Uint8ArrayList>()\n\n const streamAsyncIterableOnMessageListener = (evt: StreamMessageEvent): void => {\n output.push(evt.data)\n }\n this.addEventListener('message', streamAsyncIterableOnMessageListener)\n\n const streamAsyncIterableOnCloseListener = (evt: StreamCloseEvent): void => {\n output.end(evt.error)\n }\n this.addEventListener('close', streamAsyncIterableOnCloseListener)\n\n const streamAsyncIterableOnRemoteCloseWriteListener = (): void => {\n output.end()\n }\n this.addEventListener('remoteCloseWrite', streamAsyncIterableOnRemoteCloseWriteListener)\n\n try {\n yield * output\n } finally {\n this.removeEventListener('message', streamAsyncIterableOnMessageListener)\n this.removeEventListener('close', streamAsyncIterableOnCloseListener)\n this.removeEventListener('remoteCloseWrite', streamAsyncIterableOnRemoteCloseWriteListener)\n }\n }\n\n isReadable (): boolean {\n return this.status === 'open'\n }\n\n send (data: Uint8Array | Uint8ArrayList): boolean {\n if (this.writeStatus === 'closed' || this.writeStatus === 'closing') {\n throw new StreamStateError(`Cannot write to a stream that is ${this.writeStatus}`)\n }\n\n this.log.trace('append %d bytes to write buffer', data.byteLength)\n this.writeBuffer.append(data)\n\n return this.processSendQueue()\n }\n\n /**\n * Close immediately for reading and writing and send a reset message (local\n * error)\n */\n abort (err: Error): void {\n if (this.status === 'aborted' || this.status === 'reset' || this.status === 'closed') {\n return\n }\n\n this.log.error('abort with error - %e', err)\n\n this.status = 'aborted'\n\n // throw away unread data\n if (this.readBuffer.byteLength > 0) {\n this.readBuffer.consume(this.readBuffer.byteLength)\n }\n\n // throw away unsent data\n if (this.writeBuffer.byteLength > 0) {\n this.writeBuffer.consume(this.writeBuffer.byteLength)\n this.safeDispatchEvent('idle')\n }\n\n this.writeStatus = 'closed'\n this.remoteWriteStatus = 'closed'\n\n this.readStatus = 'closed'\n this.remoteReadStatus = 'closed'\n this.timeline.close = Date.now()\n\n try {\n this.sendReset(err)\n } catch (err: any) {\n this.log('failed to send reset to remote - %e', err)\n }\n\n this.dispatchEvent(new StreamAbortEvent(err))\n }\n\n pause (): void {\n if (this.readStatus === 'closed' || this.readStatus === 'closing') {\n throw new StreamStateError('Cannot pause a stream that is closing/closed')\n }\n\n if (this.readStatus === 'paused') {\n return\n }\n\n this.readStatus = 'paused'\n this.sendPause()\n }\n\n resume (): void {\n if (this.readStatus === 'closed' || this.readStatus === 'closing') {\n throw new StreamStateError('Cannot resume a stream that is closing/closed')\n }\n\n if (this.readStatus === 'readable') {\n return\n }\n\n this.readStatus = 'readable'\n // emit any data that accumulated while we were paused\n this.dispatchReadBuffer()\n this.sendResume()\n }\n\n push (data: Uint8Array | Uint8ArrayList): void {\n if (this.readStatus === 'closed' || this.readStatus === 'closing') {\n throw new StreamStateError(`Cannot push data onto a stream that is ${this.readStatus}`)\n }\n\n if (data.byteLength === 0) {\n return\n }\n\n this.readBuffer.append(data)\n\n if (this.readStatus === 'paused' || this.listenerCount('message') === 0) {\n // abort if the read buffer is too large\n this.checkReadBufferLength()\n\n return\n }\n\n // TODO: use a microtask instead?\n setTimeout(() => {\n this.dispatchReadBuffer()\n }, 0)\n }\n\n /**\n * When an extending class reads data from it's implementation-specific source,\n * call this method to allow the stream consumer to read the data.\n */\n onData (data: Uint8Array | Uint8ArrayList): void {\n if (data.byteLength === 0) {\n // this.log('ignoring empty data')\n return\n }\n\n // discard the data if our readable end is closed\n if (this.readStatus === 'closing' || this.readStatus === 'closed') {\n this.log('ignoring data - read status %s', this.readStatus)\n return\n }\n\n this.readBuffer.append(data)\n this.dispatchReadBuffer()\n }\n\n addEventListener<K extends keyof MessageStreamEvents>(type: K, listener: EventHandler<MessageStreamEvents[K]> | null, options?: boolean | AddEventListenerOptions): void\n addEventListener (type: string, listener: EventHandler<Event>, options?: boolean | AddEventListenerOptions): void\n addEventListener (...args: any[]): void {\n // @ts-expect-error cannot ensure args has enough members\n super.addEventListener.apply(this, args)\n\n // if a 'message' listener is being added and we have queued data, dispatch\n // the data\n if (args[0] === 'message' && this.readBuffer.byteLength > 0) {\n // event listeners can be added in constructors and often use object\n // properties - if this the case we can access a class member before it\n // has been initialized so dispatch the message in the microtask queue\n queueMicrotask(() => {\n this.dispatchReadBuffer()\n })\n }\n }\n\n /**\n * Receive a reset message - close immediately for reading and writing (remote\n * error)\n */\n onRemoteReset (): void {\n this.log('remote reset')\n\n this.status = 'reset'\n this.writeStatus = 'closed'\n this.remoteWriteStatus = 'closed'\n this.remoteReadStatus = 'closed'\n this.timeline.close = Date.now()\n\n if (this.readBuffer.byteLength === 0) {\n this.readStatus = 'closed'\n }\n\n const err = new StreamResetError()\n this.dispatchEvent(new StreamResetEvent(err))\n }\n\n /**\n * The underlying resource or transport this stream uses has closed - it is\n * not possible to send any more messages though any data still in the read\n * buffer may still be read\n */\n onTransportClosed (err?: Error): void {\n this.log('transport closed')\n\n if (this.readStatus === 'readable' && this.readBuffer.byteLength === 0) {\n this.readStatus = 'closed'\n }\n\n if (this.remoteReadStatus !== 'closed') {\n this.remoteReadStatus = 'closed'\n }\n\n if (this.remoteWriteStatus !== 'closed') {\n this.remoteWriteStatus = 'closed'\n }\n\n if (this.writeStatus !== 'closed') {\n this.writeStatus = 'closed'\n }\n\n if (err != null) {\n this.abort(err)\n } else {\n if (this.status === 'open' || this.status === 'closing') {\n this.timeline.close = Date.now()\n this.status = 'closed'\n this.writeStatus = 'closed'\n this.remoteWriteStatus = 'closed'\n this.remoteReadStatus = 'closed'\n this.dispatchEvent(new StreamCloseEvent())\n }\n }\n }\n\n /**\n * Called by extending classes when the remote closes its writable end\n */\n onRemoteCloseWrite (): void {\n if (this.remoteWriteStatus === 'closed') {\n return\n }\n\n this.log.trace('on remote close write')\n\n this.remoteWriteStatus = 'closed'\n\n this.safeDispatchEvent('remoteCloseWrite')\n\n if (this.writeStatus === 'closed') {\n this.onTransportClosed()\n }\n }\n\n /**\n * Called by extending classes when the remote closes its readable end\n */\n onRemoteCloseRead (): void {\n this.log.trace('on remote close read')\n\n this.remoteReadStatus = 'closed'\n\n // throw away any unsent bytes if the remote closes it's readable end\n if (this.writeBuffer.byteLength > 0) {\n this.writeBuffer.consume(this.writeBuffer.byteLength)\n this.safeDispatchEvent('idle')\n }\n }\n\n protected processSendQueue (): boolean {\n // bail if the underlying transport is full\n if (this.writableNeedsDrain) {\n this.log.trace('not processing send queue as drain is required')\n this.checkWriteBufferLength()\n\n return false\n }\n\n // bail if there is no data to send\n if (this.writeBuffer.byteLength === 0) {\n this.log.trace('not processing send queue as no bytes to send')\n return true\n }\n\n // bail if we are already sending data\n if (this.sendingData) {\n this.log.trace('not processing send queue as already sending data')\n return true\n }\n\n this.sendingData = true\n\n this.log.trace('processing send queue with %d queued bytes', this.writeBuffer.byteLength)\n\n try {\n let canSendMore = true\n const totalBytes = this.writeBuffer.byteLength\n let sentBytes = 0\n\n // send as much data as possible while we have data to send and the\n // underlying muxer can still accept data\n while (this.writeBuffer.byteLength > 0) {\n const end = Math.min(this.maxMessageSize ?? this.writeBuffer.byteLength, this.writeBuffer.byteLength)\n\n // this can happen if a subclass changes the max message size dynamically\n if (end === 0) {\n canSendMore = false\n break\n }\n\n // chunk to send to the remote end\n const toSend = this.writeBuffer.sublist(0, end)\n\n // copy toSend in case the extending class modifies the list\n const willSend = new Uint8ArrayList(toSend)\n\n this.writeBuffer.consume(toSend.byteLength)\n\n // sending data can cause buffers to fill up, events to be emitted and\n // this method to be invoked again\n const sendResult = this.sendData(toSend)\n canSendMore = sendResult.canSendMore\n sentBytes += sendResult.sentBytes\n\n if (sendResult.sentBytes !== willSend.byteLength) {\n willSend.consume(sendResult.sentBytes)\n this.writeBuffer.prepend(willSend)\n }\n\n if (!canSendMore) {\n break\n }\n }\n\n if (!canSendMore) {\n this.log.trace('sent %d/%d bytes, pausing sending because underlying stream is full, %d bytes left in the write buffer', sentBytes, totalBytes, this.writeBuffer.byteLength)\n this.writableNeedsDrain = true\n this.checkWriteBufferLength()\n }\n\n // we processed all bytes in the queue, resolve the write queue idle promise\n if (this.writeBuffer.byteLength === 0) {\n this.safeDispatchEvent('idle')\n }\n\n return canSendMore\n } finally {\n this.sendingData = false\n }\n }\n\n protected dispatchReadBuffer (): void {\n try {\n if (this.listenerCount('message') === 0) {\n this.log.trace('not dispatching pause buffer as there are no listeners for the message event')\n return\n }\n\n if (this.readBuffer.byteLength === 0) {\n this.log.trace('not dispatching pause buffer as there is no data to dispatch')\n return\n }\n\n if (this.readStatus === 'paused') {\n this.log.trace('not dispatching pause buffer we are paused')\n return\n }\n\n // discard the pause buffer if our readable end is closed\n if (this.readStatus === 'closing' || this.readStatus === 'closed') {\n this.log('dropping %d bytes because the readable end is %s', this.readBuffer.byteLength, this.readStatus)\n this.readBuffer.consume(this.readBuffer.byteLength)\n return\n }\n\n const buf = this.readBuffer.sublist()\n this.readBuffer.consume(buf.byteLength)\n\n this.dispatchEvent(new StreamMessageEvent(buf))\n } finally {\n if (this.remoteWriteStatus === 'closed') {\n this.readStatus = 'closed'\n }\n\n // abort if we failed to consume the read buffer and it is too large\n this.checkReadBufferLength()\n }\n }\n\n private checkReadBufferLength (): void {\n if (this.readBuffer.byteLength > this.maxReadBufferLength) {\n this.abort(new StreamBufferError(`Read buffer length of ${this.readBuffer.byteLength} exceeded limit of ${this.maxReadBufferLength}, read status is ${this.readStatus}`))\n }\n }\n\n private checkWriteBufferLength (): void {\n if (this.maxWriteBufferLength == null) {\n return\n }\n\n if (this.writeBuffer.byteLength > this.maxWriteBufferLength) {\n this.abort(new StreamBufferError(`Write buffer length of ${this.writeBuffer.byteLength} exceeded limit of ${this.maxWriteBufferLength}, write status is ${this.writeStatus}`))\n }\n }\n\n public onMuxerNeedsDrain (): void {\n this.writableNeedsDrain = true\n }\n\n public onMuxerDrain (): void {\n this.safeDispatchEvent('drain')\n }\n\n /**\n * Send a data message to the remote end of the stream. Implementations of\n * this method should return the number of bytes from the passed buffer that\n * were sent successfully and if the underlying resource can accept more data.\n *\n * The implementation should always attempt to send the maximum amount of data\n * possible.\n *\n * Returning a result that means the data was only partially sent but that the\n * underlying resource can accept more data is invalid.\n */\n abstract sendData (data: Uint8ArrayList): SendResult\n\n /**\n * Send a reset message to the remote end of the stream\n */\n abstract sendReset (err: Error): void\n\n /**\n * If supported, instruct the remote end of the stream to temporarily stop\n * sending data messages\n */\n abstract sendPause (): void\n\n /**\n * If supported, inform the remote end of the stream they may resume sending\n * data messages\n */\n abstract sendResume (): void\n\n /**\n * Stop accepting new data to send and return a promise that resolves when any\n * unsent data has been written into the underlying resource.\n */\n abstract close (options?: AbortOptions): Promise<void>\n}\n", "import { pEvent } from 'p-event'\nimport { AbstractMessageStream } from './abstract-message-stream.ts'\nimport type { MessageStreamInit } from './abstract-message-stream.ts'\nimport type { CounterGroup, Logger, MultiaddrConnection, MessageStreamDirection, AbortOptions } from '@libp2p/interface'\nimport type { Multiaddr } from '@multiformats/multiaddr'\n\nexport interface AbstractMultiaddrConnectionInit extends Omit<MessageStreamInit, 'log'> {\n remoteAddr: Multiaddr\n direction: MessageStreamDirection\n log: Logger\n inactivityTimeout?: number\n localAddr?: Multiaddr\n metricPrefix?: string\n metrics?: CounterGroup\n}\n\nexport abstract class AbstractMultiaddrConnection extends AbstractMessageStream implements MultiaddrConnection {\n public remoteAddr: Multiaddr\n\n private metricPrefix: string\n private metrics?: CounterGroup\n\n constructor (init: AbstractMultiaddrConnectionInit) {\n super(init)\n\n this.metricPrefix = init.metricPrefix ?? ''\n this.metrics = init.metrics\n this.remoteAddr = init.remoteAddr\n\n this.addEventListener('close', (evt) => {\n this.metrics?.increment({ [`${this.metricPrefix}end`]: true })\n\n if (evt.error != null) {\n if (evt.local) {\n this.metrics?.increment({ [`${this.metricPrefix}abort`]: true })\n } else {\n this.metrics?.increment({ [`${this.metricPrefix}reset`]: true })\n }\n } else {\n if (evt.local) {\n this.metrics?.increment({ [`${this.metricPrefix}_local_close`]: true })\n } else {\n this.metrics?.increment({ [`${this.metricPrefix}_remote_close`]: true })\n }\n }\n })\n }\n\n async close (options?: AbortOptions): Promise<void> {\n if (this.status !== 'open') {\n return\n }\n\n this.status = 'closing'\n this.writeStatus = 'closing'\n this.remoteWriteStatus = 'closing'\n this.remoteReadStatus = 'closing'\n\n // if we are currently sending data, wait for all the data to be written\n // into the underlying transport\n if (this.sendingData || this.writeBuffer.byteLength > 0) {\n this.log('waiting for write queue to become idle before closing writable end of stream, %d unsent bytes', this.writeBuffer.byteLength)\n await pEvent(this, 'idle', {\n ...options,\n rejectionEvents: [\n 'close'\n ]\n })\n }\n\n // now that the underlying transport has all the data, if the buffer is full\n // wait for it to be emptied\n if (this.writableNeedsDrain) {\n this.log('waiting for write queue to drain before closing writable end of stream, %d unsent bytes', this.writeBuffer.byteLength)\n await pEvent(this, 'drain', {\n ...options,\n rejectionEvents: [\n 'close'\n ]\n })\n }\n\n await this.sendClose(options)\n\n this.onTransportClosed()\n }\n\n /**\n * Wait for any unsent data to be written to the underlying resource, then\n * close the resource and resolve the returned promise\n */\n abstract sendClose (options?: AbortOptions): Promise<void>\n}\n", "import os from 'node:os'\nimport { isLinkLocalIp } from './link-local-ip.js'\nimport { getNetConfig } from './multiaddr/get-net-config.ts'\nimport { netConfigToMultiaddr } from './multiaddr/utils.ts'\nimport type { Multiaddr } from '@multiformats/multiaddr'\n\nconst FAMILIES = { 4: 'IPv4', 6: 'IPv6' }\n\nfunction isWildcard (ip: string): boolean {\n return ['0.0.0.0', '::'].includes(ip)\n}\n\nfunction getNetworkAddrs (family: 4 | 6): string[] {\n const addresses: string[] = []\n const networks = os.networkInterfaces()\n\n for (const [, netAddrs] of Object.entries(networks)) {\n if (netAddrs != null) {\n for (const netAddr of netAddrs) {\n if (isLinkLocalIp(netAddr.address)) {\n continue\n }\n\n if (netAddr.family === FAMILIES[family]) {\n addresses.push(netAddr.address)\n }\n }\n }\n }\n\n return addresses\n}\n\n/**\n * Get all thin waist addresses on the current host that match the family of the\n * passed multiaddr and optionally override the port.\n *\n * Wildcard IP4/6 addresses will be expanded into all available interfaces.\n */\nexport function getThinWaistAddresses (ma?: Multiaddr, port?: number | string): Multiaddr[] {\n if (ma == null) {\n return []\n }\n\n const config = getNetConfig(ma)\n\n if ((config.type === 'ip4' || config.type === 'ip6') && isWildcard(config.host)) {\n return getNetworkAddrs(config.type === 'ip4' ? 4 : 6)\n .map(host => netConfigToMultiaddr(config, port, host))\n }\n\n return [\n netConfigToMultiaddr(config, port)\n ]\n}\n", "export function isLinkLocalIp (ip: string): boolean {\n if (ip.startsWith('169.254.')) {\n return true\n }\n\n if (ip.toLowerCase().startsWith('fe80')) {\n return true\n }\n\n return false\n}\n", "import { CODE_IP4, CODE_IP6, CODE_IP6ZONE, multiaddr } from '@multiformats/multiaddr'\nimport type { NetConfig } from './get-net-config.ts'\nimport type { Multiaddr } from '@multiformats/multiaddr'\n\nexport function getIpFromMultiaddr (ma: Multiaddr): string | undefined {\n const components = ma.getComponents()\n let index = 0\n\n if (components[0]?.code === CODE_IP6ZONE) {\n index++\n }\n\n if (components[index]?.code !== CODE_IP4 && components[index]?.code !== CODE_IP6) {\n return\n }\n\n return components[index]?.value\n}\n\nexport function netConfigToMultiaddr (config: NetConfig, port?: number | string, host?: string): Multiaddr {\n const parts: Array<string | number> = [\n config.type,\n host ?? config.host\n ]\n\n if (config.protocol != null) {\n const p = port ?? config.port\n\n if (p != null) {\n parts.push(\n config.protocol,\n p\n )\n }\n }\n\n if (config.type === 'ip6' && config.zone != null) {\n parts.unshift('ip6zone', config.zone)\n }\n\n if (config.cidr != null) {\n parts.push('ipcidr', config.cidr)\n }\n\n return multiaddr(`/${parts.join('/')}`)\n}\n", "import { isIPv4, isIPv6 } from '@chainsafe/is-ip'\nimport { InvalidParametersError } from '@libp2p/interface'\nimport { multiaddr } from '@multiformats/multiaddr'\nimport type { Multiaddr } from '@multiformats/multiaddr'\n\n/**\n * Transform an IP, Port pair into a multiaddr\n */\nexport function ipPortToMultiaddr (ip: string, port: number | string): Multiaddr {\n if (typeof ip !== 'string') {\n throw new InvalidParametersError(`invalid ip provided: ${ip}`)\n }\n\n if (typeof port === 'string') {\n port = parseInt(port)\n }\n\n if (isNaN(port)) {\n throw new InvalidParametersError(`invalid port provided: ${port}`)\n }\n\n if (isIPv4(ip)) {\n return multiaddr(`/ip4/${ip}/tcp/${port}`)\n }\n\n if (isIPv6(ip)) {\n return multiaddr(`/ip6/${ip}/tcp/${port}`)\n }\n\n throw new InvalidParametersError(`invalid ip:port for creating a multiaddr: ${ip}:${port}`)\n}\n", "import { StreamMessageEvent, StreamCloseEvent, InvalidParametersError } from '@libp2p/interface'\nimport { pipe as itPipe } from 'it-pipe'\nimport { pushable } from 'it-pushable'\nimport { pEvent } from 'p-event'\nimport { raceSignal } from 'race-signal'\nimport * as varint from 'uint8-varint'\nimport { Uint8ArrayList } from 'uint8arraylist'\nimport { UnexpectedEOFError } from './errors.js'\nimport type { MessageStream, MultiaddrConnection, Stream, AbortOptions } from '@libp2p/interface'\nimport type { Duplex, Source, Transform, Sink } from 'it-stream-types'\n\nconst DEFAULT_MAX_BUFFER_SIZE = 4_194_304\n\nexport class UnwrappedError extends Error {\n static name = 'UnwrappedError'\n name = 'UnwrappedError'\n}\n\n/**\n * The reported length of the next data message was not a positive integer\n */\nexport class InvalidMessageLengthError extends Error {\n name = 'InvalidMessageLengthError'\n code = 'ERR_INVALID_MSG_LENGTH'\n}\n\n/**\n * The reported length of the next data message was larger than the configured\n * max allowable value\n */\nexport class InvalidDataLengthError extends Error {\n name = 'InvalidDataLengthError'\n code = 'ERR_MSG_DATA_TOO_LONG'\n}\n\n/**\n * The varint used to specify the length of the next data message contained more\n * bytes than the configured max allowable value\n */\nexport class InvalidDataLengthLengthError extends Error {\n name = 'InvalidDataLengthLengthError'\n code = 'ERR_MSG_LENGTH_TOO_LONG'\n}\n\nexport interface ByteStreamOpts {\n /**\n * Incoming bytes are buffered until read, this setting limits how many bytes\n * will be buffered.\n *\n * @default 4_194_304\n */\n maxBufferSize?: number\n\n /**\n * If true, prevent message events propagating after they have been received,\n *\n * This is useful for when there are be other observers of messages and the\n * caller does not wish to them to receive anything\n */\n stopPropagation?: boolean\n}\n\nexport interface ReadBytesOptions extends AbortOptions {\n /**\n * If specified, read this number of bytes from the stream\n */\n bytes: number\n}\n\nexport interface ByteStream<S extends MessageStream> {\n /**\n * Read bytes from the stream.\n *\n * If a required number of bytes is passed as an option, this will wait for\n * the underlying stream to supply that number of bytes, throwing an\n * `UnexpectedEOFError` if the stream closes before this happens.\n *\n * If no required number of bytes is passed, this will return `null` if the\n * underlying stream closes before supplying any bytes.\n */\n read(options: ReadBytesOptions): Promise<Uint8ArrayList>\n read(options?: AbortOptions): Promise<Uint8ArrayList | null>\n\n /**\n * Write the passed bytes to the stream\n */\n write(data: Uint8Array | Uint8ArrayList, options?: AbortOptions): Promise<void>\n\n /**\n * After calling this method the stream can no longer be used. Any unread data\n * will be emitted as a message event during the microtask queue of the\n * current event loop tick.\n */\n unwrap(): S\n}\n\nfunction isStream (obj?: any): obj is Stream {\n return typeof obj?.closeRead === 'function'\n}\n\nfunction isMultiaddrConnection (obj?: any): obj is MultiaddrConnection {\n return typeof obj?.close === 'function'\n}\n\nfunction isEOF (obj?: any): boolean {\n if (isStream(obj)) {\n return obj.readStatus === 'closing' || obj.readStatus === 'closed'\n }\n\n if (isMultiaddrConnection(obj)) {\n return obj.status !== 'open'\n }\n\n return false\n}\n\ntype ByteStreamReadable = Pick<Stream & MultiaddrConnection, 'addEventListener' | 'removeEventListener' | 'send' | 'push' | 'log'>\n\nfunction isValid (obj?: any): obj is ByteStreamReadable {\n return obj?.addEventListener != null && obj?.removeEventListener != null && obj?.send != null && obj?.push != null && obj?.log != null\n}\n\nexport function byteStream <T extends MessageStream> (stream: T, opts?: ByteStreamOpts): ByteStream<T> {\n const maxBufferSize = opts?.maxBufferSize ?? DEFAULT_MAX_BUFFER_SIZE\n const readBuffer = new Uint8ArrayList()\n\n let hasBytes = Promise.withResolvers<void>()\n let unwrapped = false\n\n if (!isValid(stream)) {\n throw new InvalidParametersError('Argument should be a Stream or a Multiaddr')\n }\n\n const byteStreamOnMessageListener = (evt: StreamMessageEvent): void => {\n if (opts?.stopPropagation === true) {\n // evt.stopImmediatePropagation()\n }\n\n readBuffer.append(evt.data)\n\n if (readBuffer.byteLength > maxBufferSize) {\n const readBufferSize = readBuffer.byteLength\n readBuffer.consume(readBuffer.byteLength)\n hasBytes.reject(new Error(`Read buffer overflow - ${readBufferSize} > ${maxBufferSize}`))\n }\n\n hasBytes.resolve()\n }\n stream.addEventListener('message', byteStreamOnMessageListener)\n\n const byteStreamOnCloseListener = (evt: StreamCloseEvent): void => {\n if (evt.error != null) {\n hasBytes.reject(evt.error)\n } else {\n hasBytes.resolve()\n }\n }\n stream.addEventListener('close', byteStreamOnCloseListener)\n\n const byteStreamOnRemoteCloseWrite = (): void => {\n hasBytes.resolve()\n }\n stream.addEventListener('remoteCloseWrite', byteStreamOnRemoteCloseWrite)\n\n const byteStream: ByteStream<T> = {\n readBuffer,\n\n // @ts-expect-error options type prevents type inference\n async read (options?: ReadBytesOptions) {\n if (unwrapped === true) {\n throw new UnwrappedError('Stream was unwrapped')\n }\n\n if (isEOF(stream)) {\n if (options?.bytes == null) {\n return null\n }\n\n if (readBuffer.byteLength < options.bytes) {\n throw new UnexpectedEOFError(`Unexpected EOF - stream closed after reading ${readBuffer.byteLength}/${options.bytes} bytes`)\n }\n }\n\n const bytesToRead = options?.bytes ?? 1\n\n while (true) {\n if (readBuffer.byteLength >= bytesToRead) {\n // if we are about to exit the loop this promise will not be awaited\n // so resolve it to prevent and unhandled promise rejections that may\n // occur\n hasBytes.resolve()\n\n break\n }\n\n await raceSignal(hasBytes.promise, options?.signal)\n\n if (isEOF(stream)) {\n if (readBuffer.byteLength === 0 && options?.bytes == null) {\n return null\n }\n\n break\n }\n\n hasBytes = Promise.withResolvers<void>()\n }\n\n const toRead = options?.bytes ?? readBuffer.byteLength\n\n if (readBuffer.byteLength < toRead) {\n if (isEOF(stream)) {\n throw new UnexpectedEOFError(`Unexpected EOF - stream closed while reading ${readBuffer.byteLength}/${toRead} bytes`)\n }\n\n return byteStream.read(options)\n }\n\n const output = readBuffer.sublist(0, toRead)\n readBuffer.consume(toRead)\n\n return output\n },\n async write (data: Uint8Array | Uint8ArrayList, options?: AbortOptions) {\n if (unwrapped === true) {\n throw new UnwrappedError('Stream was unwrapped')\n }\n\n if (!stream.send(data)) {\n await pEvent(stream, 'drain', {\n signal: options?.signal,\n rejectionEvents: ['close']\n })\n }\n },\n unwrap () {\n // already unwrapped, just return the original stream\n if (unwrapped) {\n return stream\n }\n\n // only unwrap once\n unwrapped = true\n stream.removeEventListener('message', byteStreamOnMessageListener)\n stream.removeEventListener('close', byteStreamOnCloseListener)\n stream.removeEventListener('remoteCloseWrite', byteStreamOnRemoteCloseWrite)\n\n // emit any unread data\n if (readBuffer.byteLength > 0) {\n stream.log('stream unwrapped with %d unread bytes', readBuffer.byteLength)\n stream.push(readBuffer)\n }\n\n return stream\n }\n }\n\n return byteStream\n}\n\nexport interface LengthPrefixedStream<S extends MessageStream = MessageStream> {\n /**\n * Read the next length-prefixed number of bytes from the stream\n */\n read(options?: AbortOptions): Promise<Uint8ArrayList>\n\n /**\n * Write the passed bytes to the stream prefixed by their length\n */\n write(data: Uint8Array | Uint8ArrayList, options?: AbortOptions): Promise<void>\n\n /**\n * Write passed list of bytes, prefix by their individual lengths to the stream as a single write\n */\n writeV(input: Array<Uint8Array | Uint8ArrayList>, options?: AbortOptions): Promise<void>\n\n /**\n * Returns the underlying stream\n */\n unwrap(): S\n}\n\nexport interface LengthPrefixedStreamOpts extends ByteStreamOpts {\n lengthEncoder (value: number): Uint8ArrayList | Uint8Array\n lengthDecoder (data: Uint8ArrayList): number\n maxLengthLength: number\n maxDataLength: number\n}\n\nexport function lpStream <T extends MessageStream> (stream: T, opts: Partial<LengthPrefixedStreamOpts> = {}): LengthPrefixedStream<T> {\n const bytes = byteStream(stream, opts)\n\n if (opts.maxDataLength != null && opts.maxLengthLength == null) {\n // if max data length is set but max length length is not, calculate the\n // max length length needed to encode max data length\n opts.maxLengthLength = varint.encodingLength(opts.maxDataLength)\n }\n\n const decodeLength = opts?.lengthDecoder ?? varint.decode\n const encodeLength = opts?.lengthEncoder ?? varint.encode\n\n const lpStream: LengthPrefixedStream<any> = {\n async read (options?: AbortOptions) {\n let dataLength: number = -1\n const lengthBuffer = new Uint8ArrayList()\n\n while (true) {\n // read one byte at a time until we can decode a varint\n const buf = await bytes.read({\n ...options,\n bytes: 1\n })\n\n // the underlying resource closed gracefully\n if (buf == null) {\n break\n }\n\n // append byte and try to decode\n lengthBuffer.append(buf)\n\n try {\n dataLength = decodeLength(lengthBuffer)\n } catch (err) {\n if (err instanceof RangeError) {\n continue\n }\n\n throw err\n }\n\n if (dataLength < 0) {\n throw new InvalidMessageLengthError('Invalid message length')\n }\n\n if (opts?.maxLengthLength != null && lengthBuffer.byteLength > opts.maxLengthLength) {\n throw new InvalidDataLengthLengthError(`Message length length too long - ${lengthBuffer.byteLength} > ${opts.maxLengthLength}`)\n }\n\n if (dataLength > -1) {\n break\n }\n }\n\n if (opts?.maxDataLength != null && dataLength > opts.maxDataLength) {\n throw new InvalidDataLengthError(`Message length too long - ${dataLength} > ${opts.maxDataLength}`)\n }\n\n const buf = await bytes.read({\n ...options,\n bytes: dataLength\n })\n\n if (buf == null) {\n throw new UnexpectedEOFError(`Unexpected EOF - tried to read ${dataLength} bytes but the stream closed`)\n }\n\n if (buf.byteLength !== dataLength) {\n throw new UnexpectedEOFError(`Unexpected EOF - read ${buf.byteLength}/${dataLength} bytes before the stream closed`)\n }\n\n return buf\n },\n async write (data, options?: AbortOptions) {\n // encode, write\n await bytes.write(new Uint8ArrayList(encodeLength(data.byteLength), data), options)\n },\n async writeV (data, options?: AbortOptions) {\n const list = new Uint8ArrayList(\n ...data.flatMap(buf => ([encodeLength(buf.byteLength), buf]))\n )\n\n // encode, write\n await bytes.write(list, options)\n },\n unwrap () {\n return bytes.unwrap()\n }\n }\n\n return lpStream\n}\n\n/**\n * A protobuf decoder - takes a byte array and returns an object\n */\nexport interface ProtobufDecoder<T> {\n (data: Uint8Array | Uint8ArrayList): T\n}\n\n/**\n * A protobuf encoder - takes an object and returns a byte array\n */\nexport interface ProtobufEncoder<T> {\n (data: T): Uint8Array\n}\n\n/**\n * Convenience methods for working with protobuf streams\n */\nexport interface ProtobufStream<S extends MessageStream = MessageStream> {\n /**\n * Read the next length-prefixed byte array from the stream and decode it as the passed protobuf format\n */\n read<T>(proto: { decode: ProtobufDecoder<T> }, options?: AbortOptions): Promise<T>\n\n /**\n * Encode the passed object as a protobuf message and write it's length-prefixed bytes to the stream\n */\n write<T>(data: T, proto: { encode: ProtobufEncoder<T> }, options?: AbortOptions): Promise<void>\n\n /**\n * Encode the passed objects as protobuf messages and write their length-prefixed bytes to the stream as a single write\n */\n writeV<T>(input: T[], proto: { encode: ProtobufEncoder<T> }, options?: AbortOptions): Promise<void>\n\n /**\n * Returns an object with read/write methods for operating on one specific type of protobuf message\n */\n pb<T>(proto: { encode: ProtobufEncoder<T>, decode: ProtobufDecoder<T> }): ProtobufMessageStream<T, S>\n\n /**\n * Returns the underlying stream\n */\n unwrap(): S\n}\n\n/**\n * A message reader/writer that only uses one type of message\n */\nexport interface ProtobufMessageStream <T, S extends MessageStream = MessageStream> {\n /**\n * Read a message from the stream\n */\n read(options?: AbortOptions): Promise<T>\n\n /**\n * Write a message to the stream\n */\n write(d: T, options?: AbortOptions): Promise<void>\n\n /**\n * Write several messages to the stream\n */\n writeV(d: T[], options?: AbortOptions): Promise<void>\n\n /**\n * Unwrap the underlying protobuf stream\n */\n unwrap(): ProtobufStream<S>\n}\n\nexport interface ProtobufStreamOpts extends LengthPrefixedStreamOpts {\n\n}\n\nexport function pbStream <T extends MessageStream = Stream> (stream: T, opts?: Partial<ProtobufStreamOpts>): ProtobufStream<T> {\n const lp = lpStream(stream, opts)\n\n const pbStream: ProtobufStream<T> = {\n read: async (proto, options?: AbortOptions) => {\n // readLP, decode\n const value = await lp.read(options)\n\n return proto.decode(value)\n },\n write: async (message, proto, options?: AbortOptions) => {\n // encode, writeLP\n await lp.write(proto.encode(message), options)\n },\n writeV: async (messages, proto, options?: AbortOptions) => {\n // encode, writeLP\n await lp.writeV(messages.map(message => proto.encode(message)), options)\n },\n pb: (proto) => {\n return {\n read: async (options) => pbStream.read(proto, options),\n write: async (d, options) => pbStream.write(d, proto, options),\n writeV: async (d, options) => pbStream.writeV(d, proto, options),\n unwrap: () => pbStream\n }\n },\n unwrap: () => {\n return lp.unwrap()\n }\n }\n\n return pbStream\n}\n\nexport async function echo (stream: MessageStream, options?: AbortOptions): Promise<void> {\n const log = stream.log.newScope('echo')\n const start = Date.now()\n\n let bytes = 0\n\n try {\n for await (const buf of stream) {\n bytes += buf.byteLength\n\n if (!stream.send(buf)) {\n stream.pause()\n\n await pEvent(stream, 'drain', {\n rejectionEvents: [\n 'close'\n ],\n ...options\n })\n\n stream.resume()\n }\n }\n\n log('echoed %d bytes in %dms', bytes, Date.now() - start)\n\n await stream.close(options)\n } catch (err: any) {\n stream.abort(err)\n }\n}\n\nexport type PipeInput = Iterable<Uint8Array | Uint8ArrayList> | AsyncIterable<Uint8Array | Uint8ArrayList> | Stream\n\nfunction isMessageStream (obj?: any): obj is Stream {\n return obj?.addEventListener != null\n}\n\nexport function messageStreamToDuplex (stream: Stream): Duplex<AsyncGenerator<Uint8ArrayList | Uint8Array>, Iterable<Uint8ArrayList | Uint8Array> | AsyncIterable<Uint8ArrayList | Uint8Array>, Promise<void>> {\n const source = pushable<Uint8ArrayList | Uint8Array>()\n let onError: PromiseWithResolvers<IteratorResult<Uint8ArrayList | Uint8Array>> | undefined\n\n const onMessage = (evt: StreamMessageEvent): void => {\n source.push(evt.data)\n }\n\n const onRemoteCloseWrite = (): void => {\n source.end()\n\n stream.removeEventListener('message', onMessage)\n stream.removeEventListener('close', onClose)\n stream.removeEventListener('remoteCloseWrite', onRemoteCloseWrite)\n }\n\n const onClose = (evt: StreamCloseEvent): void => {\n source.end(evt.error)\n\n if (evt.error != null) {\n onError?.reject(evt.error)\n }\n\n stream.removeEventListener('message', onMessage)\n stream.removeEventListener('close', onClose)\n stream.removeEventListener('remoteCloseWrite', onRemoteCloseWrite)\n }\n\n stream.addEventListener('message', onMessage)\n stream.addEventListener('close', onClose, {\n once: true\n })\n stream.addEventListener('remoteCloseWrite', onRemoteCloseWrite, {\n once: true\n })\n\n return {\n source,\n async sink (source: Source<Uint8Array | Uint8ArrayList>) {\n async function * toGenerator (): AsyncGenerator<Uint8Array | Uint8ArrayList> {\n yield * source\n }\n\n const gen = toGenerator()\n\n while (true) {\n onError = Promise.withResolvers<IteratorResult<Uint8ArrayList | Uint8Array>>()\n\n const { done, value } = await Promise.race([\n gen.next(),\n onError.promise\n ])\n\n if (stream.writeStatus === 'closing' || stream.writeStatus === 'closed') {\n break\n }\n\n if (value != null) {\n if (!stream.send(value)) {\n await Promise.race([\n pEvent(stream, 'drain', {\n rejectionEvents: [\n 'close'\n ]\n })\n ])\n }\n }\n\n if (done === true) {\n break\n }\n }\n\n await stream.close()\n }\n }\n}\n\ninterface SourceFn<A = any> { (): A }\n\ntype PipeSource<A = any> =\n Iterable<A> |\n AsyncIterable<A> |\n SourceFn<A> |\n Duplex<A, any, any> |\n MessageStream\n\ntype PipeTransform<A = any, B = any> =\n Transform<A, B> |\n Duplex<B, A> |\n MessageStream\n\ntype PipeSink<A = any, B = any> =\n Sink<A, B> |\n Duplex<any, A, B> |\n MessageStream\n\ntype PipeOutput<A> =\n A extends Sink<any> ? ReturnType<A> :\n A extends Duplex<any, any, any> ? ReturnType<A['sink']> :\n A extends MessageStream ? Promise<void> :\n never\n\n// single item pipe output includes pipe source types\ntype SingleItemPipeOutput<A> =\n A extends Iterable<any> ? A :\n A extends AsyncIterable<any> ? A :\n A extends SourceFn ? ReturnType<A> :\n A extends Duplex<any, any, any> ? A['source'] :\n PipeOutput<A>\n\ntype PipeFnInput<A> =\n A extends Iterable<any> ? A :\n A extends AsyncIterable<any> ? A :\n A extends SourceFn ? ReturnType<A> :\n A extends Transform<any, any> ? ReturnType<A> :\n A extends Duplex<any, any, any> ? A['source'] :\n never\n\nexport function pipe<\n A extends PipeSource\n> (\n source: A\n): SingleItemPipeOutput<A>\n// two items, source to sink\nexport function pipe<\n A extends PipeSource,\n B extends PipeSink<PipeFnInput<A>>\n> (\n source: A,\n sink: B\n): PipeOutput<B>\n\n// three items, source to sink with transform(s) in between\nexport function pipe<\n A extends PipeSource,\n B extends PipeTransform<PipeFnInput<A>>,\n C extends PipeSink<PipeFnInput<B>>\n> (\n source: A,\n transform1: B,\n sink: C\n): PipeOutput<C>\n\n// many items, source to sink with transform(s) in between\nexport function pipe<\n A extends PipeSource,\n B extends PipeTransform<PipeFnInput<A>>,\n C extends PipeTransform<PipeFnInput<B>>,\n D extends PipeSink<PipeFnInput<C>>\n> (\n source: A,\n transform1: B,\n transform2: C,\n sink: D\n): PipeOutput<D>\n\n// lots of items, source to sink with transform(s) in between\nexport function pipe<\n A extends PipeSource,\n B extends PipeTransform<PipeFnInput<A>>,\n C extends PipeTransform<PipeFnInput<B>>,\n D extends PipeTransform<PipeFnInput<C>>,\n E extends PipeSink<PipeFnInput<D>>\n> (\n source: A,\n transform1: B,\n transform2: C,\n transform3: D,\n sink: E\n): PipeOutput<E>\n\n// lots of items, source to sink with transform(s) in between\nexport function pipe<\n A extends PipeSource,\n B extends PipeTransform<PipeFnInput<A>>,\n C extends PipeTransform<PipeFnInput<B>>,\n D extends PipeTransform<PipeFnInput<C>>,\n E extends PipeTransform<PipeFnInput<D>>,\n F extends PipeSink<PipeFnInput<E>>\n> (\n source: A,\n transform1: B,\n transform2: C,\n transform3: D,\n transform4: E,\n sink: F\n): PipeOutput<F>\n\n// lots of items, source to sink with transform(s) in between\nexport function pipe<\n A extends PipeSource,\n B extends PipeTransform<PipeFnInput<A>>,\n C extends PipeTransform<PipeFnInput<B>>,\n D extends PipeTransform<PipeFnInput<C>>,\n E extends PipeTransform<PipeFnInput<D>>,\n F extends PipeTransform<PipeFnInput<E>>,\n G extends PipeSink<PipeFnInput<F>>\n> (\n source: A,\n transform1: B,\n transform2: C,\n transform3: D,\n transform4: E,\n transform5: F,\n sink: G\n): PipeOutput<G>\n\n// lots of items, source to sink with transform(s) in between\nexport function pipe<\n A extends PipeSource,\n B extends PipeTransform<PipeFnInput<A>>,\n C extends PipeTransform<PipeFnInput<B>>,\n D extends PipeTransform<PipeFnInput<C>>,\n E extends PipeTransform<PipeFnInput<D>>,\n F extends PipeTransform<PipeFnInput<E>>,\n G extends PipeTransform<PipeFnInput<F>>,\n H extends PipeSink<PipeFnInput<G>>\n> (\n source: A,\n transform1: B,\n transform2: C,\n transform3: D,\n transform4: E,\n transform5: F,\n transform6: G,\n sink: H\n): PipeOutput<H>\n\n// lots of items, source to sink with transform(s) in between\nexport function pipe<\n A extends PipeSource,\n B extends PipeTransform<PipeFnInput<A>>,\n C extends PipeTransform<PipeFnInput<B>>,\n D extends PipeTransform<PipeFnInput<C>>,\n E extends PipeTransform<PipeFnInput<D>>,\n F extends PipeTransform<PipeFnInput<E>>,\n G extends PipeTransform<PipeFnInput<F>>,\n H extends PipeTransform<PipeFnInput<G>>,\n I extends PipeSink<PipeFnInput<H>>\n> (\n source: A,\n transform1: B,\n transform2: C,\n transform3: D,\n transform4: E,\n transform5: F,\n transform6: G,\n transform7: H,\n sink: I\n): PipeOutput<I>\n\n// lots of items, source to sink with transform(s) in between\nexport function pipe<\n A extends PipeSource,\n B extends PipeTransform<PipeFnInput<A>>,\n C extends PipeTransform<PipeFnInput<B>>,\n D extends PipeTransform<PipeFnInput<C>>,\n E extends PipeTransform<PipeFnInput<D>>,\n F extends PipeTransform<PipeFnInput<E>>,\n G extends PipeTransform<PipeFnInput<F>>,\n H extends PipeTransform<PipeFnInput<G>>,\n I extends PipeTransform<PipeFnInput<H>>,\n J extends PipeSink<PipeFnInput<I>>\n> (\n source: A,\n transform1: B,\n transform2: C,\n transform3: D,\n transform4: E,\n transform5: F,\n transform6: G,\n transform7: H,\n transform8: I,\n sink: J\n): PipeOutput<J>\n\n// lots of items, source to sink with transform(s) in between\nexport function pipe<\n A extends PipeSource,\n B extends PipeTransform<PipeFnInput<A>>,\n C extends PipeTransform<PipeFnInput<B>>,\n D extends PipeTransform<PipeFnInput<C>>,\n E extends PipeTransform<PipeFnInput<D>>,\n F extends PipeTransform<PipeFnInput<E>>,\n G extends PipeTransform<PipeFnInput<F>>,\n H extends PipeTransform<PipeFnInput<G>>,\n I extends PipeTransform<PipeFnInput<H>>,\n J extends PipeTransform<PipeFnInput<I>>,\n K extends PipeSink<PipeFnInput<J>>\n> (\n source: A,\n transform1: B,\n transform2: C,\n transform3: D,\n transform4: E,\n transform5: F,\n transform6: G,\n transform7: H,\n transform8: I,\n transform9: J,\n sink: K\n): PipeOutput<K>\n\n// lots of items, source to sink with transform(s) in between\nexport function pipe<\n A extends PipeSource,\n B extends PipeTransform<PipeFnInput<A>>,\n C extends PipeTransform<PipeFnInput<B>>,\n D extends PipeTransform<PipeFnInput<C>>,\n E extends PipeTransform<PipeFnInput<D>>,\n F extends PipeTransform<PipeFnInput<E>>,\n G extends PipeTransform<PipeFnInput<F>>,\n H extends PipeTransform<PipeFnInput<G>>,\n I extends PipeTransform<PipeFnInput<H>>,\n J extends PipeTransform<PipeFnInput<I>>,\n K extends PipeTransform<PipeFnInput<J>>,\n L extends PipeSink<PipeFnInput<K>>\n> (\n source: A,\n transform1: B,\n transform2: C,\n transform3: D,\n transform4: E,\n transform5: F,\n transform6: G,\n transform7: H,\n transform8: I,\n transform9: J,\n transform10: K,\n sink: L\n): PipeOutput<L>\nexport function pipe (...input: any[]): any {\n const sources = input.map(source => {\n if (isMessageStream(source)) {\n return messageStreamToDuplex(source)\n }\n\n return source\n })\n\n // @ts-expect-error it-pipe types say args cannot be spread like this\n return itPipe(...sources)\n}\n", "import { InvalidParametersError, TimeoutError } from '@libp2p/interface'\nimport { AbstractMultiaddrConnection, ipPortToMultiaddr } from '@libp2p/utils'\nimport { Unix } from '@multiformats/multiaddr-matcher'\nimport { pEvent } from 'p-event'\nimport type { AbortOptions, MultiaddrConnection } from '@libp2p/interface'\nimport type { AbstractMultiaddrConnectionInit, SendResult } from '@libp2p/utils'\nimport type { Multiaddr } from '@multiformats/multiaddr'\nimport type { Socket } from 'net'\nimport type { Uint8ArrayList } from 'uint8arraylist'\n\nexport interface TCPSocketMultiaddrConnectionInit extends Omit<AbstractMultiaddrConnectionInit, 'name' | 'stream' | 'remoteAddr'> {\n socket: Socket\n remoteAddr?: Multiaddr\n}\n\nclass TCPSocketMultiaddrConnection extends AbstractMultiaddrConnection {\n private socket: Socket\n\n constructor (init: TCPSocketMultiaddrConnectionInit) {\n let remoteAddr = init.remoteAddr\n\n // check if we are connected on a unix path\n if (init.localAddr != null && Unix.matches(init.localAddr)) {\n remoteAddr = init.localAddr\n } else if (remoteAddr == null) {\n if (init.socket.remoteAddress == null || init.socket.remotePort == null) {\n // this can be undefined if the socket is destroyed (for example, if the client disconnected)\n // https://nodejs.org/dist/latest-v16.x/docs/api/net.html#socketremoteaddress\n throw new InvalidParametersError('Could not determine remote address or port')\n }\n\n remoteAddr = ipPortToMultiaddr(init.socket.remoteAddress, init.socket.remotePort)\n }\n\n super({\n ...init,\n remoteAddr\n })\n\n this.socket = init.socket\n\n // handle incoming data\n this.socket.on('data', buf => {\n this.onData(buf)\n })\n\n // handle socket errors\n this.socket.on('error', err => {\n this.log('tcp error', remoteAddr, err)\n\n this.abort(err)\n })\n\n // by default there is no timeout\n // https://nodejs.org/dist/latest-v16.x/docs/api/net.html#socketsettimeouttimeout-callback\n this.socket.setTimeout(init.inactivityTimeout ?? (2 * 60 * 1_000))\n\n this.socket.once('timeout', () => {\n this.log('tcp timeout', remoteAddr)\n // if the socket times out due to inactivity we must manually close the connection\n // https://nodejs.org/dist/latest-v16.x/docs/api/net.html#event-timeout\n this.abort(new TimeoutError())\n })\n\n this.socket.once('end', () => {\n this.log('tcp end', remoteAddr)\n\n // the remote sent a FIN packet which means no more data will be sent\n // https://nodejs.org/dist/latest-v16.x/docs/api/net.html#event-end\n // half open TCP sockets are disabled by default so Node.js should send a\n // FIN in response to this event and then emit a 'close' event, during\n // which we tear down the MultiaddrConnection so there is nothing to do\n // until that occurs\n this.onTransportClosed()\n })\n\n this.socket.once('close', hadError => {\n this.log('tcp close', remoteAddr)\n\n if (hadError) {\n this.abort(new Error('TCP transmission error'))\n return\n }\n\n this.onTransportClosed()\n })\n\n // the socket can accept more data\n this.socket.on('drain', () => {\n this.log('tcp drain')\n\n this.safeDispatchEvent('drain')\n })\n }\n\n sendData (data: Uint8ArrayList): SendResult {\n let sentBytes = 0\n let canSendMore = true\n\n for (const buf of data) {\n sentBytes += buf.byteLength\n canSendMore = this.socket.write(buf)\n\n if (!canSendMore) {\n break\n }\n }\n\n return {\n sentBytes,\n canSendMore\n }\n }\n\n async sendClose (options?: AbortOptions): Promise<void> {\n if (this.socket.destroyed) {\n return\n }\n\n this.socket.destroySoon()\n\n await pEvent(this.socket, 'close', options)\n }\n\n sendReset (): void {\n this.socket.resetAndDestroy()\n }\n\n sendPause (): void {\n this.socket.pause()\n }\n\n sendResume (): void {\n this.socket.resume()\n }\n}\n\n/**\n * Convert a socket into a MultiaddrConnection\n * https://github.com/libp2p/interface-transport#multiaddrconnection\n */\nexport const toMultiaddrConnection = (init: TCPSocketMultiaddrConnectionInit): MultiaddrConnection => {\n return new TCPSocketMultiaddrConnection(init)\n}\n", "import os from 'os'\nimport path from 'path'\nimport { InvalidParametersError } from '@libp2p/interface'\nimport { getNetConfig } from '@libp2p/utils'\nimport { CODE_UNIX } from '@multiformats/multiaddr'\nimport { Unix } from '@multiformats/multiaddr-matcher'\nimport type { Multiaddr } from '@multiformats/multiaddr'\nimport type { ListenOptions, IpcSocketConnectOpts, TcpSocketConnectOpts } from 'net'\n\nexport type NetConfig = ListenOptions | (IpcSocketConnectOpts & TcpSocketConnectOpts)\n\nexport function multiaddrToNetConfig (addr: Multiaddr, options: NetConfig = {}): NetConfig {\n if (Unix.exactMatch(addr)) {\n const listenPath = addr.getComponents().find(c => c.code === CODE_UNIX)?.value\n\n if (listenPath == null) {\n throw new InvalidParametersError(`Multiaddr ${addr} was not a Unix address`)\n }\n\n // unix socket listening\n if (os.platform() === 'win32') {\n // Use named pipes on Windows systems.\n return { path: path.join('\\\\\\\\.\\\\pipe\\\\', listenPath) }\n } else {\n return { path: listenPath }\n }\n }\n\n const config = getNetConfig(addr)\n const host = config.host\n const port = config.port\n\n // tcp listening\n return {\n host,\n port,\n ipv6Only: config.type === 'ip6',\n ...options\n }\n}\n", "/**\n * @packageDocumentation\n *\n * A [libp2p transport](https://docs.libp2p.io/concepts/transports/overview/) based on the TCP networking stack.\n *\n * @example\n *\n * ```TypeScript\n * import { createLibp2p } from 'libp2p'\n * import { tcp } from '@libp2p/tcp'\n * import { multiaddr } from '@multiformats/multiaddr'\n *\n * const node = await createLibp2p({\n * transports: [\n * tcp()\n * ]\n * })\n *\n * const ma = multiaddr('/ip4/123.123.123.123/tcp/1234')\n *\n * // dial a TCP connection, timing out after 10 seconds\n * const connection = await node.dial(ma, {\n * signal: AbortSignal.timeout(10_000)\n * })\n *\n * // use connection...\n * ```\n */\n\nimport { TCP } from './tcp.js'\nimport type { ComponentLogger, CounterGroup, Metrics, CreateListenerOptions, DialTransportOptions, Transport, OutboundConnectionUpgradeEvents } from '@libp2p/interface'\nimport type { ProgressEvent } from 'progress-events'\n\nexport interface CloseServerOnMaxConnectionsOpts {\n /**\n * Server listens once connection count is less than `listenBelow`\n */\n listenBelow: number\n\n /**\n * Close server once connection count is greater than or equal to `closeAbove`\n */\n closeAbove: number\n\n /**\n * Invoked when there was an error listening on a socket\n */\n onListenError?(err: Error): void\n}\n\nexport interface TCPOptions {\n /**\n * An optional number in ms that is used as an inactivity timeout after which the socket will be closed\n */\n inboundSocketInactivityTimeout?: number\n\n /**\n * An optional number in ms that is used as an inactivity timeout after which the socket will be closed\n */\n outboundSocketInactivityTimeout?: number\n\n /**\n * Set this property to reject connections when the server's connection count gets high.\n * https://nodejs.org/api/net.html#servermaxconnections\n */\n maxConnections?: number\n\n /**\n * Parameter to specify the maximum length of the queue of pending connections\n * https://nodejs.org/dist/latest-v18.x/docs/api/net.html#serverlisten\n */\n backlog?: number\n\n /**\n * Close server (stop listening for new connections) if connections exceed a limit.\n * Open server (start listening for new connections) if connections fall below a limit.\n */\n closeServerOnMaxConnections?: CloseServerOnMaxConnectionsOpts\n\n /**\n * Options passed to `net.connect` for every opened TCP socket\n */\n dialOpts?: TCPSocketOptions\n\n /**\n * Options passed to every `net.createServer` for every TCP server\n */\n listenOpts?: TCPSocketOptions\n}\n\n/**\n * Expose a subset of net.connect options\n */\nexport interface TCPSocketOptions {\n /**\n * @see https://nodejs.org/api/net.html#socketconnectoptions-connectlistener\n */\n noDelay?: boolean\n\n /**\n * @see https://nodejs.org/api/net.html#socketconnectoptions-connectlistener\n */\n keepAlive?: boolean\n\n /**\n * @see https://nodejs.org/api/net.html#socketconnectoptions-connectlistener\n */\n keepAliveInitialDelay?: number\n\n /**\n * @see https://nodejs.org/api/net.html#new-netsocketoptions\n */\n allowHalfOpen?: boolean\n}\n\nexport type TCPDialEvents =\n OutboundConnectionUpgradeEvents |\n ProgressEvent<'tcp:open-connection'>\n\nexport interface TCPDialOptions extends DialTransportOptions<TCPDialEvents>, TCPSocketOptions {\n\n}\n\nexport interface TCPCreateListenerOptions extends CreateListenerOptions, TCPSocketOptions {\n\n}\n\nexport interface TCPComponents {\n metrics?: Metrics\n logger: ComponentLogger\n}\n\nexport interface TCPMetrics {\n events: CounterGroup<'error' | 'timeout' | 'connect' | 'abort'>\n errors: CounterGroup<'outbound_to_connection' | 'outbound_upgrade'>\n}\n\nexport function tcp (init: TCPOptions = {}): (components: TCPComponents) => Transport {\n return (components: TCPComponents) => {\n return new TCP(components, init)\n }\n}\n", "import {\n Request,\n Response,\n DHTRequest,\n DHTResponse\n} from '@libp2p/daemon-protocol'\nimport { InvalidMessageError, InvalidParametersError, ProtocolError, isPeerId } from '@libp2p/interface'\nimport { logger } from '@libp2p/logger'\nimport { peerIdFromMultihash } from '@libp2p/peer-id'\nimport { multiaddr } from '@multiformats/multiaddr'\nimport { CID } from 'multiformats/cid'\nimport * as Digest from 'multiformats/hashes/digest'\nimport { OperationFailedError } from './index.js'\nimport type { DaemonClient } from './index.js'\nimport type { PeerId, PeerInfo } from '@libp2p/interface'\n\nconst log = logger('libp2p:daemon-client:dht')\n\nexport class DHT {\n private readonly client: DaemonClient\n\n constructor (client: DaemonClient) {\n this.client = client\n }\n\n /**\n * Write a value to a key in the DHT\n */\n async put (key: Uint8Array, value: Uint8Array): Promise<void> {\n if (!(key instanceof Uint8Array)) {\n throw new InvalidParametersError('invalid key received')\n }\n\n if (!(value instanceof Uint8Array)) {\n throw new InvalidParametersError('value received is not a Uint8Array')\n }\n\n const sh = await this.client.send({\n type: Request.Type.DHT,\n dht: {\n type: DHTRequest.Type.PUT_VALUE,\n key,\n value\n }\n })\n\n const response = await sh.read(Response)\n\n log('read', response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new ProtocolError(response.error?.msg ?? 'DHT put failed')\n }\n }\n\n /**\n * Query the DHT for a value stored at a key in the DHT\n */\n async get (key: Uint8Array): Promise<Uint8Array> {\n if (!(key instanceof Uint8Array)) {\n throw new InvalidParametersError('invalid key received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.DHT,\n dht: {\n type: DHTRequest.Type.GET_VALUE,\n key\n }\n })\n\n const response = await sh.read(Response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'DHT get failed')\n }\n\n if (response.dht?.value == null) {\n throw new OperationFailedError('Invalid DHT get response')\n }\n\n return response.dht.value\n }\n\n /**\n * Query the DHT for a given peer's known addresses.\n */\n async findPeer (peerId: PeerId): Promise<PeerInfo> {\n if (!isPeerId(peerId)) {\n throw new InvalidParametersError('invalid peer id received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.DHT,\n dht: {\n type: DHTRequest.Type.FIND_PEER,\n peer: peerId.toMultihash().bytes\n }\n })\n\n const response = await sh.read(Response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'DHT find peer failed')\n }\n\n if (response.dht?.peer?.addrs == null) {\n throw new OperationFailedError('Invalid response')\n }\n\n return {\n id: peerIdFromMultihash(Digest.decode(response.dht.peer.id)),\n multiaddrs: response.dht.peer.addrs.map((a) => multiaddr(a))\n }\n }\n\n /**\n * Announce to the network that the peer have data addressed by the provided CID\n */\n async provide (cid: CID): Promise<void> {\n if (cid == null || CID.asCID(cid) == null) {\n throw new InvalidParametersError('invalid cid received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.DHT,\n dht: {\n type: DHTRequest.Type.PROVIDE,\n cid: cid.bytes\n }\n })\n\n const response = await sh.read(Response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'DHT provide failed')\n }\n }\n\n /**\n * Query the DHT for peers that have a piece of content, identified by a CID\n */\n async * findProviders (cid: CID, count: number = 1): AsyncIterable<PeerInfo> {\n if (cid == null || CID.asCID(cid) == null) {\n throw new InvalidParametersError('invalid cid received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.DHT,\n dht: {\n type: DHTRequest.Type.FIND_PROVIDERS,\n cid: cid.bytes,\n count\n }\n })\n\n // stream begin message\n const response = await sh.read(Response)\n\n if (response.type !== Response.Type.OK) {\n await sh.unwrap().close()\n throw new OperationFailedError(response.error?.msg ?? 'DHT find providers failed')\n }\n\n while (true) {\n const dhtResponse = await sh.read(DHTResponse)\n\n // Stream end\n if (dhtResponse.type === DHTResponse.Type.END) {\n await sh.unwrap().close()\n return\n }\n\n // Stream values\n if (dhtResponse.type === DHTResponse.Type.VALUE && dhtResponse.peer?.addrs != null) {\n yield {\n id: peerIdFromMultihash(Digest.decode(dhtResponse.peer.id)),\n multiaddrs: dhtResponse.peer.addrs.map((a) => multiaddr(a))\n }\n } else {\n // Unexpected message received\n await sh.unwrap().close()\n throw new ProtocolError('unexpected message received')\n }\n }\n }\n\n /**\n * Query the DHT routing table for peers that are closest to a provided key.\n */\n async * getClosestPeers (key: Uint8Array): AsyncIterable<PeerInfo> {\n if (!(key instanceof Uint8Array)) {\n throw new InvalidParametersError('invalid key received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.DHT,\n dht: {\n type: DHTRequest.Type.GET_CLOSEST_PEERS,\n key\n }\n })\n\n // stream begin message\n const response = await sh.read(Response)\n\n if (response.type !== Response.Type.OK) {\n await sh.unwrap().close()\n throw new OperationFailedError(response.error?.msg ?? 'DHT find providers failed')\n }\n\n while (true) {\n const dhtResponse = await sh.read(DHTResponse)\n\n // Stream end\n if (dhtResponse.type === DHTResponse.Type.END) {\n await sh.unwrap().close()\n return\n }\n\n // Stream values\n if (dhtResponse.type === DHTResponse.Type.VALUE && dhtResponse.value != null) {\n const peerId = peerIdFromMultihash(Digest.decode(dhtResponse.value))\n\n yield {\n id: peerId,\n multiaddrs: []\n }\n } else {\n // Unexpected message received\n await sh.unwrap().close()\n throw new InvalidMessageError('unexpected message received')\n }\n }\n }\n\n /**\n * Query the DHT routing table for a given peer's public key.\n */\n async getPublicKey (peerId: PeerId): Promise<Uint8Array | undefined> {\n if (!isPeerId(peerId)) {\n throw new InvalidParametersError('invalid peer id received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.DHT,\n dht: {\n type: DHTRequest.Type.GET_PUBLIC_KEY,\n peer: peerId.toMultihash().bytes\n }\n })\n\n const response = await sh.read(Response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'DHT get public key failed')\n }\n\n if (response.dht == null) {\n throw new InvalidMessageError('Invalid response')\n }\n\n return response.dht.value\n }\n}\n", "import {\n Request,\n Response,\n PSRequest,\n PSMessage\n} from '@libp2p/daemon-protocol'\nimport { InvalidParametersError } from '@libp2p/interface'\nimport { peerIdFromMultihash } from '@libp2p/peer-id'\nimport * as Digest from 'multiformats/hashes/digest'\nimport { OperationFailedError } from './index.js'\nimport type { DaemonClient, Subscription } from './index.js'\nimport type { PeerId } from '@libp2p/interface'\n\nexport class Pubsub {\n private readonly client: DaemonClient\n\n constructor (client: DaemonClient) {\n this.client = client\n }\n\n /**\n * Get a list of topics the node is subscribed to.\n *\n * @returns {Array<string>} topics\n */\n async getTopics (): Promise<string[]> {\n const sh = await this.client.send({\n type: Request.Type.PUBSUB,\n pubsub: {\n type: PSRequest.Type.GET_TOPICS\n }\n })\n\n const response = await sh.read(Response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'Pubsub get topics failed')\n }\n\n if (response.pubsub?.topics == null) {\n throw new OperationFailedError('Invalid response')\n }\n\n return response.pubsub.topics\n }\n\n /**\n * Publish data under a topic\n */\n async publish (topic: string, data: Uint8Array): Promise<void> {\n if (typeof topic !== 'string') {\n throw new InvalidParametersError('invalid topic received')\n }\n\n if (!(data instanceof Uint8Array)) {\n throw new InvalidParametersError('data received is not a Uint8Array')\n }\n\n const sh = await this.client.send({\n type: Request.Type.PUBSUB,\n pubsub: {\n type: PSRequest.Type.PUBLISH,\n topic,\n data\n }\n })\n\n const response = await sh.read(Response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'Pubsub publish failed')\n }\n }\n\n /**\n * Request to subscribe a certain topic\n */\n async subscribe (topic: string): Promise<Subscription> {\n if (typeof topic !== 'string') {\n throw new InvalidParametersError('invalid topic received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.PUBSUB,\n pubsub: {\n type: PSRequest.Type.SUBSCRIBE,\n topic\n }\n })\n\n const response = await sh.read(Response)\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'Pubsub publish failed')\n }\n\n let subscribed = true\n\n const subscription: Subscription = {\n async * messages () {\n while (subscribed) { // eslint-disable-line no-unmodified-loop-condition\n yield await sh.read(PSMessage)\n }\n },\n async cancel () {\n subscribed = false\n await sh.unwrap().close()\n }\n }\n\n return subscription\n }\n\n async getSubscribers (topic: string): Promise<PeerId[]> {\n if (typeof topic !== 'string') {\n throw new InvalidParametersError('invalid topic received')\n }\n\n const sh = await this.client.send({\n type: Request.Type.PUBSUB,\n pubsub: {\n type: PSRequest.Type.LIST_PEERS,\n topic\n }\n })\n\n const response = await sh.read(Response)\n\n await sh.unwrap().close()\n\n if (response.type !== Response.Type.OK) {\n throw new OperationFailedError(response.error?.msg ?? 'Pubsub get subscribers failed')\n }\n\n if (response.pubsub?.topics == null) {\n throw new OperationFailedError('Invalid response')\n }\n\n return response.pubsub.peerIDs.map(buf => peerIdFromMultihash(Digest.decode(buf)))\n }\n}\n"],
5
+ "mappings": ";s2BAAA,IAAAA,GAAA,GAAAC,GAAAD,GAAA,0BAAAE,EAAA,iBAAAC,KCAA,IAAAC,GAAuB,kBCIjB,SAAUC,GAAcC,EAAe,CAC3C,OAAO,IAAI,WAAWA,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,CAClE,CDCM,SAAUC,GAAOC,EAAe,EAAC,CACrC,OAAOC,GAAa,UAAO,MAAMD,CAAI,CAAC,CACxC,CAOM,SAAUE,GAAaF,EAAe,EAAC,CAC3C,OAAOC,GAAa,UAAO,YAAYD,CAAI,CAAC,CAC9C,CEdA,IAAMG,GAAK,KAAK,IAAI,EAAG,CAAC,EAClBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EAGnBC,EAAM,IAENC,GAAO,IAEP,SAAUC,GAAgBC,EAAa,CAC3C,GAAIA,EAAQV,GACV,MAAO,GAGT,GAAIU,EAAQT,GACV,MAAO,GAGT,GAAIS,EAAQR,GACV,MAAO,GAGT,GAAIQ,EAAQP,GACV,MAAO,GAGT,GAAIO,EAAQN,GACV,MAAO,GAGT,GAAIM,EAAQL,GACV,MAAO,GAGT,GAAIK,EAAQJ,GACV,MAAO,GAGT,GAAI,OAAO,kBAAoB,MAAQI,EAAQ,OAAO,iBACpD,MAAM,IAAI,WAAW,yBAAyB,EAGhD,MAAO,EACT,CAEM,SAAUC,GAAkBD,EAAeE,EAAiBC,EAAiB,EAAC,CAClF,OAAQJ,GAAeC,CAAK,EAAG,CAC7B,IAAK,GACHE,EAAIC,GAAQ,EAAKH,EAAQ,IAAQH,EACjCG,GAAS,IAEX,IAAK,GACHE,EAAIC,GAAQ,EAAKH,EAAQ,IAAQH,EACjCG,GAAS,IAEX,IAAK,GACHE,EAAIC,GAAQ,EAAKH,EAAQ,IAAQH,EACjCG,GAAS,IAEX,IAAK,GACHE,EAAIC,GAAQ,EAAKH,EAAQ,IAAQH,EACjCG,GAAS,IAEX,IAAK,GACHE,EAAIC,GAAQ,EAAKH,EAAQ,IAAQH,EACjCG,KAAW,EAEb,IAAK,GACHE,EAAIC,GAAQ,EAAKH,EAAQ,IAAQH,EACjCG,KAAW,EAEb,IAAK,GACHE,EAAIC,GAAQ,EAAKH,EAAQ,IAAQH,EACjCG,KAAW,EAEb,IAAK,GAAG,CACNE,EAAIC,GAAQ,EAAKH,EAAQ,IACzBA,KAAW,EACX,KACF,CACA,QAAS,MAAM,IAAI,MAAM,aAAa,CACxC,CACA,OAAOE,CACT,CAEM,SAAUE,GAAsBJ,EAAeE,EAAqBC,EAAiB,EAAC,CAC1F,OAAQJ,GAAeC,CAAK,EAAG,CAC7B,IAAK,GACHE,EAAI,IAAIC,IAAWH,EAAQ,IAAQH,CAAG,EACtCG,GAAS,IAEX,IAAK,GACHE,EAAI,IAAIC,IAAWH,EAAQ,IAAQH,CAAG,EACtCG,GAAS,IAEX,IAAK,GACHE,EAAI,IAAIC,IAAWH,EAAQ,IAAQH,CAAG,EACtCG,GAAS,IAEX,IAAK,GACHE,EAAI,IAAIC,IAAWH,EAAQ,IAAQH,CAAG,EACtCG,GAAS,IAEX,IAAK,GACHE,EAAI,IAAIC,IAAWH,EAAQ,IAAQH,CAAG,EACtCG,KAAW,EAEb,IAAK,GACHE,EAAI,IAAIC,IAAWH,EAAQ,IAAQH,CAAG,EACtCG,KAAW,EAEb,IAAK,GACHE,EAAI,IAAIC,IAAWH,EAAQ,IAAQH,CAAG,EACtCG,KAAW,EAEb,IAAK,GAAG,CACNE,EAAI,IAAIC,IAAWH,EAAQ,GAAK,EAChCA,KAAW,EACX,KACF,CACA,QAAS,MAAM,IAAI,MAAM,aAAa,CACxC,CACA,OAAOE,CACT,CAEM,SAAUG,GAAkBH,EAAiBC,EAAc,CAC/D,IAAIG,EAAIJ,EAAIC,CAAM,EACdI,EAAM,EA6CV,GA3CAA,GAAOD,EAAIR,GACPQ,EAAIT,IAIRS,EAAIJ,EAAIC,EAAS,CAAC,EAClBI,IAAQD,EAAIR,KAAS,EACjBQ,EAAIT,KAIRS,EAAIJ,EAAIC,EAAS,CAAC,EAClBI,IAAQD,EAAIR,KAAS,GACjBQ,EAAIT,KAIRS,EAAIJ,EAAIC,EAAS,CAAC,EAClBI,IAAQD,EAAIR,KAAS,GACjBQ,EAAIT,KAIRS,EAAIJ,EAAIC,EAAS,CAAC,EAClBI,IAAQD,EAAIR,IAAQL,GAChBa,EAAIT,KAIRS,EAAIJ,EAAIC,EAAS,CAAC,EAClBI,IAAQD,EAAIR,IAAQJ,GAChBY,EAAIT,KAIRS,EAAIJ,EAAIC,EAAS,CAAC,EAClBI,IAAQD,EAAIR,IAAQH,GAChBW,EAAIT,KAIRS,EAAIJ,EAAIC,EAAS,CAAC,EAClBI,IAAQD,EAAIR,IAAQF,GAChBU,EAAIT,GACN,OAAOU,EAGT,MAAM,IAAI,WAAW,yBAAyB,CAChD,CAEM,SAAUC,GAAsBN,EAAqBC,EAAc,CACvE,IAAIG,EAAIJ,EAAI,IAAIC,CAAM,EAClBI,EAAM,EA6CV,GA3CAA,GAAOD,EAAIR,GACPQ,EAAIT,IAIRS,EAAIJ,EAAI,IAAIC,EAAS,CAAC,EACtBI,IAAQD,EAAIR,KAAS,EACjBQ,EAAIT,KAIRS,EAAIJ,EAAI,IAAIC,EAAS,CAAC,EACtBI,IAAQD,EAAIR,KAAS,GACjBQ,EAAIT,KAIRS,EAAIJ,EAAI,IAAIC,EAAS,CAAC,EACtBI,IAAQD,EAAIR,KAAS,GACjBQ,EAAIT,KAIRS,EAAIJ,EAAI,IAAIC,EAAS,CAAC,EACtBI,IAAQD,EAAIR,IAAQL,GAChBa,EAAIT,KAIRS,EAAIJ,EAAI,IAAIC,EAAS,CAAC,EACtBI,IAAQD,EAAIR,IAAQJ,GAChBY,EAAIT,KAIRS,EAAIJ,EAAI,IAAIC,EAAS,CAAC,EACtBI,IAAQD,EAAIR,IAAQH,GAChBW,EAAIT,KAIRS,EAAIJ,EAAI,IAAIC,EAAS,CAAC,EACtBI,IAAQD,EAAIR,IAAQF,GAChBU,EAAIT,GACN,OAAOU,EAGT,MAAM,IAAI,WAAW,yBAAyB,CAChD,CAKM,SAAUE,GAA6DT,EAAeE,EAASC,EAAiB,EAAC,CAIrH,OAHID,GAAO,OACTA,EAAMQ,GAAYX,GAAeC,CAAK,CAAC,GAErCE,aAAe,WACVD,GAAiBD,EAAOE,EAAKC,CAAM,EAEnCC,GAAqBJ,EAAOE,EAAKC,CAAM,CAElD,CAEM,SAAUQ,GAAQT,EAAkCC,EAAiB,EAAC,CAC1E,OAAID,aAAe,WACVG,GAAiBH,EAAKC,CAAM,EAE5BK,GAAqBN,EAAKC,CAAM,CAE3C,CCrQA,IAAMS,GAAM,IAAI,aAAa,CAAC,EAAE,CAAC,EAC3BC,GAAM,IAAI,WAAWD,GAAI,MAAM,EAK/B,SAAUE,GAAcC,EAAaC,EAAiBC,EAAW,CACrEL,GAAI,CAAC,EAAIG,EACTC,EAAIC,CAAG,EAAIJ,GAAI,CAAC,EAChBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,CACtB,CAgBM,SAAUK,GAAaC,EAAiBC,EAAW,CACvD,OAAAC,GAAI,CAAC,EAAIF,EAAIC,CAAG,EAChBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACbE,GAAI,CAAC,CACd,CAaA,IAAMC,GAAM,IAAI,aAAa,CAAC,EAAE,CAAC,EAC3BC,GAAM,IAAI,WAAWD,GAAI,MAAM,EAK/B,SAAUE,GAAeC,EAAaC,EAAiBC,EAAW,CACtEL,GAAI,CAAC,EAAIG,EACTC,EAAIC,CAAG,EAAIJ,GAAI,CAAC,EAChBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,EACpBG,EAAIC,EAAM,CAAC,EAAIJ,GAAI,CAAC,CACtB,CAoBM,SAAUK,GAAcC,EAAiBC,EAAW,CACxD,OAAAC,GAAI,CAAC,EAAIF,EAAIC,CAAG,EAChBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACpBC,GAAI,CAAC,EAAIF,EAAIC,EAAM,CAAC,EACbE,GAAI,CAAC,CACd,CC5FA,IAAMC,GAA0B,OAAO,OAAO,gBAAgB,EACxDC,GAA0B,OAAO,OAAO,gBAAgB,EAWjDC,GAAP,MAAOC,CAAQ,CACZ,GACA,GAEP,YAAaC,EAAYC,EAAU,CAOjC,KAAK,GAAKD,EAAK,EAKf,KAAK,GAAKC,EAAK,CACjB,CAKA,SAAUC,EAAoB,GAAK,CACjC,GAAI,CAACA,GAAa,KAAK,KAAO,GAAM,EAAG,CACrC,IAAMF,EAAK,CAAC,KAAK,GAAK,IAAM,EACxBC,EAAK,CAAC,KAAK,KAAO,EACtB,OAAID,IAAO,IACTC,EAAKA,EAAK,IAAM,GAEX,EAAED,EAAKC,EAAK,WACrB,CACA,OAAO,KAAK,GAAK,KAAK,GAAK,UAC7B,CAKA,SAAUC,EAAoB,GAAK,CACjC,GAAIA,EACF,OAAO,OAAO,KAAK,KAAO,CAAC,GAAK,OAAO,KAAK,KAAO,CAAC,GAAK,KAG3D,GAAK,KAAK,KAAO,GAAW,CAC1B,IAAMF,EAAK,CAAC,KAAK,GAAK,IAAM,EACxBC,EAAK,CAAC,KAAK,KAAO,EACtB,OAAID,IAAO,IACTC,EAAKA,EAAK,IAAM,GAEX,EAAE,OAAOD,CAAE,GAAK,OAAOC,CAAE,GAAK,KACvC,CAEA,OAAO,OAAO,KAAK,KAAO,CAAC,GAAK,OAAO,KAAK,KAAO,CAAC,GAAK,IAC3D,CAKA,SAAUC,EAAoB,GAAK,CACjC,OAAO,KAAK,SAASA,CAAQ,EAAE,SAAQ,CACzC,CAKA,UAAQ,CACN,IAAMC,EAAO,KAAK,IAAM,GACxB,YAAK,KAAO,KAAK,IAAM,EAAI,KAAK,KAAO,IAAMA,KAAU,EACvD,KAAK,IAAM,KAAK,IAAM,EAAIA,KAAU,EAC7B,IACT,CAKA,UAAQ,CACN,IAAMA,EAAO,EAAE,KAAK,GAAK,GACzB,YAAK,KAAO,KAAK,KAAO,EAAI,KAAK,IAAM,IAAMA,KAAU,EACvD,KAAK,IAAM,KAAK,KAAO,EAAIA,KAAU,EAC9B,IACT,CAKA,QAAM,CACJ,IAAMC,EAAQ,KAAK,GACbC,GAAS,KAAK,KAAO,GAAK,KAAK,IAAM,KAAO,EAC5CC,EAAQ,KAAK,KAAO,GAC1B,OAAOA,IAAU,EACbD,IAAU,EACRD,EAAQ,MACNA,EAAQ,IAAM,EAAI,EAClBA,EAAQ,QAAU,EAAI,EACxBC,EAAQ,MACNA,EAAQ,IAAM,EAAI,EAClBA,EAAQ,QAAU,EAAI,EAC1BC,EAAQ,IAAM,EAAI,EACxB,CAKA,OAAO,WAAYC,EAAa,CAC9B,GAAIA,IAAU,GACZ,OAAOC,GAGT,GAAID,EAAQX,IAA2BW,EAAQV,GAC7C,OAAO,KAAK,WAAW,OAAOU,CAAK,CAAC,EAGtC,IAAME,EAAWF,EAAQ,GAErBE,IACFF,EAAQ,CAACA,GAGX,IAAIN,EAAKM,GAAS,IACdP,EAAKO,GAASN,GAAM,KAExB,OAAIQ,IACFR,EAAK,CAACA,EAAK,GACXD,EAAK,CAACA,EAAK,GAEP,EAAEA,EAAKU,KACTV,EAAK,GACD,EAAEC,EAAKS,KAAUT,EAAK,MAIvB,IAAIF,EAAS,OAAOC,CAAE,EAAG,OAAOC,CAAE,CAAC,CAC5C,CAKA,OAAO,WAAYM,EAAa,CAC9B,GAAIA,IAAU,EAAK,OAAOC,GAC1B,IAAMG,EAAOJ,EAAQ,EACjBI,IAAQJ,EAAQ,CAACA,GACrB,IAAIP,EAAKO,IAAU,EACfN,GAAMM,EAAQP,GAAM,aAAe,EACvC,OAAIW,IACFV,EAAK,CAACA,IAAO,EACbD,EAAK,CAACA,IAAO,EACT,EAAEA,EAAK,aACTA,EAAK,EACD,EAAEC,EAAK,aAAcA,EAAK,KAG3B,IAAIF,EAASC,EAAIC,CAAE,CAC5B,CAKA,OAAO,KAAMM,EAA+D,CAC1E,OAAI,OAAOA,GAAU,SACZR,EAAS,WAAWQ,CAAK,EAE9B,OAAOA,GAAU,SACZR,EAAS,WAAWQ,CAAK,EAE9B,OAAOA,GAAU,SACZR,EAAS,WAAW,OAAOQ,CAAK,CAAC,EAEnCA,EAAM,KAAO,MAAQA,EAAM,MAAQ,KAAO,IAAIR,EAASQ,EAAM,MAAQ,EAAGA,EAAM,OAAS,CAAC,EAAIC,EACrG,GAGIA,GAAO,IAAIV,GAAS,EAAG,CAAC,EAC9BU,GAAK,SAAW,UAAA,CAAc,OAAO,EAAG,EACxCA,GAAK,SAAWA,GAAK,SAAW,UAAA,CAAc,OAAO,IAAK,EAC1DA,GAAK,OAAS,UAAA,CAAc,MAAO,EAAE,EAErC,IAAME,GAAS,YCzLT,SAAUE,GAAQC,EAAc,CACpC,IAAIC,EAAM,EACNC,EAAI,EACR,QAASC,EAAI,EAAGA,EAAIH,EAAO,OAAQ,EAAEG,EACnCD,EAAIF,EAAO,WAAWG,CAAC,EAEnBD,EAAI,IACND,GAAO,EACEC,EAAI,KACbD,GAAO,GACGC,EAAI,SAAY,QAAWF,EAAO,WAAWG,EAAI,CAAC,EAAI,SAAY,OAC5E,EAAEA,EACFF,GAAO,GAEPA,GAAO,EAIX,OAAOA,CACT,CAKM,SAAUG,GAAMC,EAAoBC,EAAeC,EAAW,CAGlE,GAFYA,EAAMD,EAER,EACR,MAAO,GAGT,IAAIE,EACEC,EAAkB,CAAA,EACpB,EAAI,EACJC,EAEJ,KAAOJ,EAAQC,GACbG,EAAIL,EAAOC,GAAO,EAEdI,EAAI,IACND,EAAM,GAAG,EAAIC,EACJA,EAAI,KAAOA,EAAI,IACxBD,EAAM,GAAG,GAAKC,EAAI,KAAO,EAAIL,EAAOC,GAAO,EAAI,GACtCI,EAAI,KAAOA,EAAI,KACxBA,IAAMA,EAAI,IAAM,IAAML,EAAOC,GAAO,EAAI,KAAO,IAAMD,EAAOC,GAAO,EAAI,KAAO,EAAID,EAAOC,GAAO,EAAI,IAAM,MAC1GG,EAAM,GAAG,EAAI,OAAUC,GAAK,IAC5BD,EAAM,GAAG,EAAI,OAAUC,EAAI,OAE3BD,EAAM,GAAG,GAAKC,EAAI,KAAO,IAAML,EAAOC,GAAO,EAAI,KAAO,EAAID,EAAOC,GAAO,EAAI,GAG5E,EAAI,QACLE,IAAUA,EAAQ,CAAA,IAAK,KAAK,OAAO,aAAa,MAAM,OAAQC,CAAK,CAAC,EACrE,EAAI,GAIR,OAAID,GAAS,MACP,EAAI,GACNA,EAAM,KAAK,OAAO,aAAa,MAAM,OAAQC,EAAM,MAAM,EAAG,CAAC,CAAC,CAAC,EAG1DD,EAAM,KAAK,EAAE,GAGf,OAAO,aAAa,MAAM,OAAQC,EAAM,MAAM,EAAG,CAAC,CAAC,CAC5D,CAKM,SAAUE,GAAOX,EAAgBK,EAAoBO,EAAc,CACvE,IAAMN,EAAQM,EACVC,EACAC,EAEJ,QAAS,EAAI,EAAG,EAAId,EAAO,OAAQ,EAAE,EACnCa,EAAKb,EAAO,WAAW,CAAC,EAEpBa,EAAK,IACPR,EAAOO,GAAQ,EAAIC,EACVA,EAAK,MACdR,EAAOO,GAAQ,EAAIC,GAAM,EAAI,IAC7BR,EAAOO,GAAQ,EAAIC,EAAK,GAAK,MACnBA,EAAK,SAAY,SAAYC,EAAKd,EAAO,WAAW,EAAI,CAAC,GAAK,SAAY,OACpFa,EAAK,QAAYA,EAAK,OAAW,KAAOC,EAAK,MAC7C,EAAE,EACFT,EAAOO,GAAQ,EAAIC,GAAM,GAAK,IAC9BR,EAAOO,GAAQ,EAAIC,GAAM,GAAK,GAAK,IACnCR,EAAOO,GAAQ,EAAIC,GAAM,EAAI,GAAK,IAClCR,EAAOO,GAAQ,EAAIC,EAAK,GAAK,MAE7BR,EAAOO,GAAQ,EAAIC,GAAM,GAAK,IAC9BR,EAAOO,GAAQ,EAAIC,GAAM,EAAI,GAAK,IAClCR,EAAOO,GAAQ,EAAIC,EAAK,GAAK,KAIjC,OAAOD,EAASN,CAClB,CC9FA,SAASS,GAAiBC,EAAgBC,EAAoB,CAC5D,OAAO,WAAW,uBAAuBD,EAAO,GAAG,MAAMC,GAAe,CAAC,MAAMD,EAAO,GAAG,EAAE,CAC7F,CAEA,SAASE,GAAgBC,EAAiBC,EAAW,CACnD,OAAQD,EAAIC,EAAM,CAAC,EACbD,EAAIC,EAAM,CAAC,GAAK,EAChBD,EAAIC,EAAM,CAAC,GAAK,GAChBD,EAAIC,EAAM,CAAC,GAAK,MAAQ,CAChC,CAKM,IAAOC,GAAP,KAAuB,CACpB,IACA,IACA,IAEA,OAAS,WAAW,UAAU,SAErC,YAAaC,EAAkB,CAI7B,KAAK,IAAMA,EAKX,KAAK,IAAM,EAKX,KAAK,IAAMA,EAAO,MACpB,CAKA,QAAM,CACJ,IAAIC,EAAQ,WAM6C,GAJzDA,GAAS,KAAK,IAAI,KAAK,GAAG,EAAI,OAAS,EAAO,KAAK,IAAI,KAAK,KAAK,EAAI,MACrEA,GAASA,GAAS,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQ,KAAO,EAAO,KAAK,IAAI,KAAK,KAAK,EAAI,OACpFA,GAASA,GAAS,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQ,MAAQ,EAAO,KAAK,IAAI,KAAK,KAAK,EAAI,OACrFA,GAASA,GAAS,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQ,MAAQ,EAAO,KAAK,IAAI,KAAK,KAAK,EAAI,OACrFA,GAASA,GAAS,KAAK,IAAI,KAAK,GAAG,EAAI,KAAO,MAAQ,EAAO,KAAK,IAAI,KAAK,KAAK,EAAI,KAAO,OAAOA,EAElG,IAAK,KAAK,KAAO,GAAK,KAAK,IACzB,WAAK,IAAM,KAAK,IACVR,GAAgB,KAAM,EAAE,EAGhC,OAAOQ,CACT,CAKA,OAAK,CACH,OAAO,KAAK,OAAM,EAAK,CACzB,CAKA,QAAM,CACJ,IAAMA,EAAQ,KAAK,OAAM,EACzB,OAAOA,IAAU,EAAI,EAAEA,EAAQ,GAAK,CACtC,CAKA,MAAI,CACF,OAAO,KAAK,OAAM,IAAO,CAC3B,CAKA,SAAO,CACL,GAAI,KAAK,IAAM,EAAI,KAAK,IAAO,MAAMR,GAAgB,KAAM,CAAC,EAI5D,OAFYG,GAAe,KAAK,IAAK,KAAK,KAAO,CAAC,CAGpD,CAKA,UAAQ,CACN,GAAI,KAAK,IAAM,EAAI,KAAK,IACtB,MAAMH,GAAgB,KAAM,CAAC,EAK/B,OAFYG,GAAe,KAAK,IAAK,KAAK,KAAO,CAAC,EAAI,CAGxD,CAKA,OAAK,CACH,GAAI,KAAK,IAAM,EAAI,KAAK,IACtB,MAAMH,GAAgB,KAAM,CAAC,EAG/B,IAAMQ,EAAQC,GAAY,KAAK,IAAK,KAAK,GAAG,EAC5C,YAAK,KAAO,EACLD,CACT,CAKA,QAAM,CAEJ,GAAI,KAAK,IAAM,EAAI,KAAK,IAAO,MAAMR,GAAgB,KAAM,CAAC,EAE5D,IAAMQ,EAAQE,GAAa,KAAK,IAAK,KAAK,GAAG,EAC7C,YAAK,KAAO,EACLF,CACT,CAKA,OAAK,CACH,IAAMG,EAAS,KAAK,OAAM,EACpBC,EAAQ,KAAK,IACbP,EAAM,KAAK,IAAMM,EAGvB,GAAIN,EAAM,KAAK,IACb,MAAML,GAAgB,KAAMW,CAAM,EAGpC,YAAK,KAAOA,EAELC,IAAUP,EACb,IAAI,WAAW,CAAC,EAChB,KAAK,IAAI,SAASO,EAAOP,CAAG,CAClC,CAKA,QAAM,CACJ,IAAMQ,EAAQ,KAAK,MAAK,EACxB,OAAYC,GAAKD,EAAO,EAAGA,EAAM,MAAM,CACzC,CAKA,KAAMF,EAAe,CACnB,GAAI,OAAOA,GAAW,SAAU,CAE9B,GAAI,KAAK,IAAMA,EAAS,KAAK,IAAO,MAAMX,GAAgB,KAAMW,CAAM,EACtE,KAAK,KAAOA,CACd,KACE,GAEE,IAAI,KAAK,KAAO,KAAK,IACnB,MAAMX,GAAgB,IAAI,SAEpB,KAAK,IAAI,KAAK,KAAK,EAAI,OAAS,GAE5C,OAAO,IACT,CAKA,SAAUe,EAAgB,CACxB,OAAQA,EAAU,CAChB,IAAK,GACH,KAAK,KAAI,EACT,MACF,IAAK,GACH,KAAK,KAAK,CAAC,EACX,MACF,IAAK,GACH,KAAK,KAAK,KAAK,OAAM,CAAE,EACvB,MACF,IAAK,GACH,MAAQA,EAAW,KAAK,OAAM,EAAK,KAAO,GACxC,KAAK,SAASA,CAAQ,EAExB,MACF,IAAK,GACH,KAAK,KAAK,CAAC,EACX,MAGF,QACE,MAAM,MAAM,qBAAqBA,CAAQ,cAAc,KAAK,GAAG,EAAE,CACrE,CACA,OAAO,IACT,CAEQ,gBAAc,CAEpB,IAAMC,EAAO,IAAIC,GAAS,EAAG,CAAC,EAC1BC,EAAI,EACR,GAAI,KAAK,IAAM,KAAK,IAAM,EAAG,CAC3B,KAAOA,EAAI,EAAG,EAAEA,EAGd,GADAF,EAAK,IAAMA,EAAK,IAAM,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQE,EAAI,KAAO,EAC1D,KAAK,IAAI,KAAK,KAAK,EAAI,IAAO,OAAOF,EAK3C,GAFAA,EAAK,IAAMA,EAAK,IAAM,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQ,MAAQ,EAC3DA,EAAK,IAAMA,EAAK,IAAM,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQ,KAAO,EACtD,KAAK,IAAI,KAAK,KAAK,EAAI,IAAO,OAAOA,EACzCE,EAAI,CACN,KAAO,CACL,KAAOA,EAAI,EAAG,EAAEA,EAAG,CAEjB,GAAI,KAAK,KAAO,KAAK,IAAO,MAAMlB,GAAgB,IAAI,EAGtD,GADAgB,EAAK,IAAMA,EAAK,IAAM,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQE,EAAI,KAAO,EAC1D,KAAK,IAAI,KAAK,KAAK,EAAI,IAAO,OAAOF,CAC3C,CAEA,OAAAA,EAAK,IAAMA,EAAK,IAAM,KAAK,IAAI,KAAK,KAAK,EAAI,MAAQE,EAAI,KAAO,EACzDF,CACT,CACA,GAAI,KAAK,IAAM,KAAK,IAAM,GACxB,KAAOE,EAAI,EAAG,EAAEA,EAGd,GADAF,EAAK,IAAMA,EAAK,IAAM,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQE,EAAI,EAAI,KAAO,EAC9D,KAAK,IAAI,KAAK,KAAK,EAAI,IAAO,OAAOF,MAG3C,MAAOE,EAAI,EAAG,EAAEA,EAAG,CACjB,GAAI,KAAK,KAAO,KAAK,IACnB,MAAMlB,GAAgB,IAAI,EAK5B,GADAgB,EAAK,IAAMA,EAAK,IAAM,KAAK,IAAI,KAAK,GAAG,EAAI,MAAQE,EAAI,EAAI,KAAO,EAC9D,KAAK,IAAI,KAAK,KAAK,EAAI,IAAO,OAAOF,CAC3C,CAGF,MAAM,MAAM,yBAAyB,CACvC,CAEQ,aAAW,CACjB,GAAI,KAAK,IAAM,EAAI,KAAK,IACtB,MAAMhB,GAAgB,KAAM,CAAC,EAG/B,IAAMmB,EAAKhB,GAAe,KAAK,IAAK,KAAK,KAAO,CAAC,EAC3CiB,EAAKjB,GAAe,KAAK,IAAK,KAAK,KAAO,CAAC,EAEjD,OAAO,IAAIc,GAASE,EAAIC,CAAE,CAC5B,CAKA,OAAK,CACH,OAAO,KAAK,eAAc,EAAG,SAAQ,CACvC,CAMA,aAAW,CACT,OAAO,KAAK,eAAc,EAAG,SAAQ,CACvC,CAKA,aAAW,CACT,OAAO,KAAK,eAAc,EAAG,SAAQ,CACvC,CAKA,QAAM,CACJ,OAAO,KAAK,eAAc,EAAG,SAAS,EAAI,CAC5C,CAMA,cAAY,CACV,IAAMZ,EAAQa,GAAiB,KAAK,IAAK,KAAK,GAAG,EACjD,YAAK,KAAOC,GAAed,CAAK,EACzBA,CACT,CAKA,cAAY,CACV,OAAO,KAAK,eAAc,EAAG,SAAS,EAAI,CAC5C,CAKA,QAAM,CACJ,OAAO,KAAK,eAAc,EAAG,SAAQ,EAAG,SAAQ,CAClD,CAMA,cAAY,CACV,OAAO,KAAK,eAAc,EAAG,SAAQ,EAAG,SAAQ,CAClD,CAMA,cAAY,CACV,OAAO,KAAK,eAAc,EAAG,SAAQ,EAAG,SAAQ,CAClD,CAKA,SAAO,CACL,OAAO,KAAK,YAAW,EAAG,SAAQ,CACpC,CAKA,eAAa,CACX,OAAO,KAAK,YAAW,EAAG,SAAQ,CACpC,CAKA,eAAa,CACX,OAAO,KAAK,YAAW,EAAG,SAAQ,CACpC,CAKA,UAAQ,CACN,OAAO,KAAK,YAAW,EAAG,SAAQ,CACpC,CAMA,gBAAc,CACZ,OAAO,KAAK,YAAW,EAAG,SAAQ,CACpC,CAKA,gBAAc,CACZ,OAAO,KAAK,YAAW,EAAG,SAAQ,CACpC,GAGI,SAAUe,GAAcnB,EAAgC,CAC5D,OAAO,IAAIE,GAAiBF,aAAe,WAAaA,EAAMA,EAAI,SAAQ,CAAE,CAC9E,CChYM,SAAUoB,EAAmBC,EAAkCC,EAAiCC,EAAuB,CAC3H,IAAMC,EAASC,GAAaJ,CAAG,EAE/B,OAAOC,EAAM,OAAOE,EAAQ,OAAWD,CAAI,CAC7C,CCRA,IAAAG,GAAuB,kBCAvB,IAAAC,GAAA,GAAAC,GAAAD,GAAA,YAAAE,KCAO,IAAMC,GAAQ,IAAI,WAAW,CAAC,EAW/B,SAAUC,GAAQC,EAAgBC,EAAc,CACpD,GAAID,IAAOC,EAAM,MAAO,GACxB,GAAID,EAAG,aAAeC,EAAG,WACvB,MAAO,GAGT,QAASC,EAAK,EAAGA,EAAKF,EAAG,WAAYE,IACnC,GAAIF,EAAGE,CAAE,IAAMD,EAAGC,CAAE,EAClB,MAAO,GAIX,MAAO,EACT,CAEM,SAAUC,GAAQC,EAA6C,CACnE,GAAIA,aAAa,YAAcA,EAAE,YAAY,OAAS,aAAgB,OAAOA,EAC7E,GAAIA,aAAa,YAAe,OAAO,IAAI,WAAWA,CAAC,EACvD,GAAI,YAAY,OAAOA,CAAC,EACtB,OAAO,IAAI,WAAWA,EAAE,OAAQA,EAAE,WAAYA,EAAE,UAAU,EAE5D,MAAM,IAAI,MAAM,mCAAmC,CACrD,CAMM,SAAUC,GAAYC,EAAW,CACrC,OAAO,IAAI,YAAW,EAAG,OAAOA,CAAG,CACrC,CAEM,SAAUC,GAAUC,EAAa,CACrC,OAAO,IAAI,YAAW,EAAG,OAAOA,CAAC,CACnC,CCnCA,SAASC,GAAMC,EAAUC,EAAI,CAC3B,GAAID,EAAS,QAAU,IAAO,MAAM,IAAI,UAAU,mBAAmB,EAErE,QADIE,EAAW,IAAI,WAAW,GAAG,EACxBC,EAAI,EAAGA,EAAID,EAAS,OAAQC,IACnCD,EAASC,CAAC,EAAI,IAEhB,QAASC,EAAI,EAAGA,EAAIJ,EAAS,OAAQI,IAAK,CACxC,IAAIC,EAAIL,EAAS,OAAOI,CAAC,EACrBE,EAAKD,EAAE,WAAW,CAAC,EACvB,GAAIH,EAASI,CAAE,IAAM,IAAO,MAAM,IAAI,UAAUD,EAAI,eAAe,EACnEH,EAASI,CAAE,EAAIF,CACjB,CACA,IAAIG,EAAOP,EAAS,OAChBQ,EAASR,EAAS,OAAO,CAAC,EAC1BS,EAAS,KAAK,IAAIF,CAAI,EAAI,KAAK,IAAI,GAAG,EACtCG,EAAU,KAAK,IAAI,GAAG,EAAI,KAAK,IAAIH,CAAI,EAI3C,SAASI,EAAQC,EAAM,CAOrB,GALIA,aAAkB,aAAuB,YAAY,OAAOA,CAAM,EACpEA,EAAS,IAAI,WAAWA,EAAO,OAAQA,EAAO,WAAYA,EAAO,UAAU,EAClE,MAAM,QAAQA,CAAM,IAC7BA,EAAS,WAAW,KAAKA,CAAM,IAE7B,EAAEA,aAAkB,YAAe,MAAM,IAAI,UAAU,qBAAqB,EAChF,GAAIA,EAAO,SAAW,EAAK,MAAO,GAMlC,QAJIC,EAAS,EACTC,EAAS,EACTC,EAAS,EACTC,EAAOJ,EAAO,OACXG,IAAWC,GAAQJ,EAAOG,CAAM,IAAM,GAC3CA,IACAF,IAMF,QAHII,GAASD,EAAOD,GAAUL,EAAU,IAAO,EAC3CQ,EAAM,IAAI,WAAWD,CAAI,EAEtBF,IAAWC,GAAM,CAItB,QAHIG,EAAQP,EAAOG,CAAM,EAErBX,GAAI,EACCgB,GAAMH,EAAO,GAAIE,IAAU,GAAKf,GAAIU,IAAYM,KAAQ,GAAKA,KAAOhB,KAC3Ee,GAAU,IAAMD,EAAIE,EAAG,IAAO,EAC9BF,EAAIE,EAAG,EAAKD,EAAQZ,IAAU,EAC9BY,EAASA,EAAQZ,IAAU,EAE7B,GAAIY,IAAU,EAAK,MAAM,IAAI,MAAM,gBAAgB,EACnDL,EAASV,GACTW,GACF,CAGA,QADIM,GAAMJ,EAAOH,EACVO,KAAQJ,GAAQC,EAAIG,EAAG,IAAM,GAClCA,KAIF,QADIC,EAAMd,EAAO,OAAOK,CAAM,EACvBQ,GAAMJ,EAAM,EAAEI,GAAOC,GAAOtB,EAAS,OAAOkB,EAAIG,EAAG,CAAC,EAC3D,OAAOC,CACT,CAIA,SAASC,EAAcX,EAAM,CAC3B,GAAI,OAAOA,GAAW,SAAY,MAAM,IAAI,UAAU,iBAAiB,EACvE,GAAIA,EAAO,SAAW,EAAK,OAAO,IAAI,WACtC,IAAIY,EAAM,EAEV,GAAIZ,EAAOY,CAAG,IAAM,IAIpB,SAFIX,EAAS,EACTC,EAAS,EACNF,EAAOY,CAAG,IAAMhB,GACrBK,IACAW,IAMF,QAHIP,GAAUL,EAAO,OAASY,GAAOf,EAAU,IAAO,EAClDgB,EAAO,IAAI,WAAWR,CAAI,EAEvBL,EAAOY,CAAG,GAAG,CAElB,IAAIL,EAAQjB,EAASU,EAAO,WAAWY,CAAG,CAAC,EAE3C,GAAIL,IAAU,IAAO,OAErB,QADIf,EAAI,EACCsB,GAAMT,EAAO,GAAIE,IAAU,GAAKf,EAAIU,IAAYY,KAAQ,GAAKA,KAAOtB,IAC3Ee,GAAUZ,EAAOkB,EAAKC,EAAG,IAAO,EAChCD,EAAKC,EAAG,EAAKP,EAAQ,MAAS,EAC9BA,EAASA,EAAQ,MAAS,EAE5B,GAAIA,IAAU,EAAK,MAAM,IAAI,MAAM,gBAAgB,EACnDL,EAASV,EACToB,GACF,CAEA,GAAIZ,EAAOY,CAAG,IAAM,IAGpB,SADIG,GAAMV,EAAOH,EACVa,KAAQV,GAAQQ,EAAKE,EAAG,IAAM,GACnCA,KAIF,QAFIC,GAAM,IAAI,WAAWf,GAAUI,EAAOU,GAAI,EAC1CxB,EAAIU,EACDc,KAAQV,GACbW,GAAIzB,GAAG,EAAIsB,EAAKE,IAAK,EAEvB,OAAOC,IACT,CAIA,SAASC,EAAQC,EAAM,CACrB,IAAIC,EAASR,EAAaO,CAAM,EAChC,GAAIC,EAAU,OAAOA,EACrB,MAAM,IAAI,MAAM,OAAO9B,CAAI,YAAY,CACzC,CACA,MAAO,CACL,OAAQU,EACR,aAAcY,EACd,OAAQM,EAEZ,CACA,IAAIG,GAAMjC,GAENkC,GAAkCD,GAEtCE,GAAeD,GCjIf,IAAME,GAAN,KAAa,CACF,KACA,OACA,WAET,YAAaC,EAAYC,EAAgBC,EAAoB,CAC3D,KAAK,KAAOF,EACZ,KAAK,OAASC,EACd,KAAK,WAAaC,CACpB,CAEA,OAAQC,EAAiB,CACvB,GAAIA,aAAiB,WACnB,MAAO,GAAG,KAAK,MAAM,GAAG,KAAK,WAAWA,CAAK,CAAC,GAE9C,MAAM,MAAM,mCAAmC,CAEnD,GAQIC,GAAN,KAAa,CACF,KACA,OACA,WACQ,gBAEjB,YAAaJ,EAAYC,EAAgBI,EAAoB,CAC3D,KAAK,KAAOL,EACZ,KAAK,OAASC,EACd,IAAMK,EAAkBL,EAAO,YAAY,CAAC,EAE5C,GAAIK,IAAoB,OACtB,MAAM,IAAI,MAAM,0BAA0B,EAE5C,KAAK,gBAAkBA,EACvB,KAAK,WAAaD,CACpB,CAEA,OAAQE,EAAY,CAClB,GAAI,OAAOA,GAAS,SAAU,CAC5B,GAAIA,EAAK,YAAY,CAAC,IAAM,KAAK,gBAC/B,MAAM,MAAM,qCAAqC,KAAK,UAAUA,CAAI,CAAC,KAAK,KAAK,IAAI,+CAA+C,KAAK,MAAM,EAAE,EAEjJ,OAAO,KAAK,WAAWA,EAAK,MAAM,KAAK,OAAO,MAAM,CAAC,CACvD,KACE,OAAM,MAAM,mCAAmC,CAEnD,CAEA,GAAgCC,EAAmE,CACjG,OAAOC,GAAG,KAAMD,CAAO,CACzB,GAKIE,GAAN,KAAqB,CACV,SAET,YAAaC,EAA0B,CACrC,KAAK,SAAWA,CAClB,CAEA,GAAiCH,EAAmE,CAClG,OAAOC,GAAG,KAAMD,CAAO,CACzB,CAEA,OAAQI,EAAa,CACnB,IAAMX,EAASW,EAAM,CAAC,EAChBJ,EAAU,KAAK,SAASP,CAAM,EACpC,GAAIO,GAAW,KACb,OAAOA,EAAQ,OAAOI,CAAK,EAE3B,MAAM,WAAW,qCAAqC,KAAK,UAAUA,CAAK,CAAC,+BAA+B,OAAO,KAAK,KAAK,QAAQ,CAAC,gBAAgB,CAExJ,GAGI,SAAUH,GAAyCI,EAA+CC,EAA8C,CACpJ,OAAO,IAAIJ,GAAgB,CACzB,GAAIG,EAAK,UAAY,CAAE,CAAEA,EAA2B,MAAM,EAAGA,CAAI,EACjE,GAAIC,EAAM,UAAY,CAAE,CAAEA,EAA4B,MAAM,EAAGA,CAAK,EAClD,CACtB,CAEM,IAAOC,GAAP,KAAY,CACP,KACA,OACA,WACA,WACA,QACA,QAET,YAAaf,EAAYC,EAAgBC,EAAsBG,EAAoB,CACjF,KAAK,KAAOL,EACZ,KAAK,OAASC,EACd,KAAK,WAAaC,EAClB,KAAK,WAAaG,EAClB,KAAK,QAAU,IAAIN,GAAQC,EAAMC,EAAQC,CAAU,EACnD,KAAK,QAAU,IAAIE,GAAQJ,EAAMC,EAAQI,CAAU,CACrD,CAEA,OAAQO,EAAiB,CACvB,OAAO,KAAK,QAAQ,OAAOA,CAAK,CAClC,CAEA,OAAQA,EAAa,CACnB,OAAO,KAAK,QAAQ,OAAOA,CAAK,CAClC,GAGI,SAAUI,GAAmD,CAAE,KAAAhB,EAAM,OAAAC,EAAQ,OAAAgB,EAAQ,OAAAC,CAAM,EAAsE,CACrK,OAAO,IAAIH,GAAMf,EAAMC,EAAQgB,EAAQC,CAAM,CAC/C,CAEM,SAAUC,GAAoD,CAAE,KAAAnB,EAAM,OAAAC,EAAQ,SAAAmB,CAAQ,EAAoD,CAC9I,GAAM,CAAE,OAAAH,EAAQ,OAAAC,CAAM,EAAKG,GAAMD,EAAUpB,CAAI,EAC/C,OAAOgB,GAAK,CACV,OAAAf,EACA,KAAAD,EACA,OAAAiB,EACA,OAASV,GAA6Be,GAAOJ,EAAOX,CAAI,CAAC,EAC1D,CACH,CAEA,SAASW,GAAQK,EAAgBC,EAAqCC,EAAqBzB,EAAY,CAErG,IAAI0B,EAAMH,EAAO,OACjB,KAAOA,EAAOG,EAAM,CAAC,IAAM,KACzB,EAAEA,EAIJ,IAAMC,EAAM,IAAI,WAAYD,EAAMD,EAAc,EAAK,CAAC,EAGlDG,EAAO,EACPC,EAAS,EACTC,EAAU,EACd,QAASC,EAAI,EAAGA,EAAIL,EAAK,EAAEK,EAAG,CAE5B,IAAMC,EAAQR,EAAYD,EAAOQ,CAAC,CAAC,EACnC,GAAIC,IAAU,OACZ,MAAM,IAAI,YAAY,OAAOhC,CAAI,YAAY,EAI/C6B,EAAUA,GAAUJ,EAAeO,EACnCJ,GAAQH,EAGJG,GAAQ,IACVA,GAAQ,EACRD,EAAIG,GAAS,EAAI,IAAQD,GAAUD,EAEvC,CAGA,GAAIA,GAAQH,IAAgB,IAAQI,GAAW,EAAID,KAAY,EAC7D,MAAM,IAAI,YAAY,wBAAwB,EAGhD,OAAOD,CACT,CAEA,SAASV,GAAQgB,EAAkBb,EAAkBK,EAAmB,CACtE,IAAMS,EAAMd,EAASA,EAAS,OAAS,CAAC,IAAM,IACxCe,GAAQ,GAAKV,GAAe,EAC9BE,EAAM,GAENC,EAAO,EACPC,EAAS,EACb,QAASE,EAAI,EAAGA,EAAIE,EAAK,OAAQ,EAAEF,EAMjC,IAJAF,EAAUA,GAAU,EAAKI,EAAKF,CAAC,EAC/BH,GAAQ,EAGDA,EAAOH,GACZG,GAAQH,EACRE,GAAOP,EAASe,EAAQN,GAAUD,CAAK,EAU3C,GALIA,IAAS,IACXD,GAAOP,EAASe,EAAQN,GAAWJ,EAAcG,CAAM,GAIrDM,EACF,MAASP,EAAI,OAASF,EAAe,KAAO,GAC1CE,GAAO,IAIX,OAAOA,CACT,CAEA,SAASS,GAAmBhB,EAAgB,CAE1C,IAAMI,EAAsC,CAAA,EAC5C,QAASO,EAAI,EAAGA,EAAIX,EAAS,OAAQ,EAAEW,EACrCP,EAAYJ,EAASW,CAAC,CAAC,EAAIA,EAE7B,OAAOP,CACT,CAKM,SAAUa,EAAsD,CAAE,KAAArC,EAAM,OAAAC,EAAQ,YAAAwB,EAAa,SAAAL,CAAQ,EAAyE,CAClL,IAAMI,EAAcY,GAAkBhB,CAAQ,EAC9C,OAAOJ,GAAK,CACV,OAAAf,EACA,KAAAD,EACA,OAAQY,EAAiB,CACvB,OAAOK,GAAOL,EAAOQ,EAAUK,CAAW,CAC5C,EACA,OAAQb,EAAa,CACnB,OAAOM,GAAON,EAAOY,EAAaC,EAAazB,CAAI,CACrD,EACD,CACH,CH9OO,IAAMsC,GAASC,GAAM,CAC1B,OAAQ,IACR,KAAM,SACN,SAAU,aACX,EIND,IAAAC,GAAA,GAAAC,GAAAD,GAAA,YAAAE,GAAA,gBAAAC,KAEO,IAAMC,GAASC,EAAQ,CAC5B,OAAQ,IACR,KAAM,SACN,SAAU,mBACV,YAAa,EACd,EAEYC,GAAcD,EAAQ,CACjC,OAAQ,IACR,KAAM,cACN,SAAU,mBACV,YAAa,EACd,ECdD,IAAAE,GAAA,GAAAC,GAAAD,GAAA,WAAAE,KAEO,IAAMC,GAAQC,EAAQ,CAC3B,OAAQ,IACR,KAAM,QACN,SAAU,KACV,YAAa,EACd,ECPD,IAAAC,GAAA,GAAAC,GAAAD,GAAA,kBAAAE,KAEA,IAAMC,GAAW,MAAM,KAAK,orEAAwe,EAC9fC,GAAkCD,GAAS,OAAiB,CAACE,EAAGC,EAAGC,KAAQF,EAAEE,CAAC,EAAID,EAAUD,GAAM,CAAA,CAAG,EACrGG,GAAkCL,GAAS,OAAiB,CAACE,EAAGC,EAAGC,IAAK,CAC5E,IAAME,EAAYH,EAAE,YAAY,CAAC,EACjC,GAAIG,GAAa,KACf,MAAM,IAAI,MAAM,sBAAsBH,CAAC,EAAE,EAE3C,OAAAD,EAAEI,CAAS,EAAIF,EACRF,CACT,EAAI,CAAA,CAAG,EAEP,SAASK,GAAQC,EAAgB,CAC/B,OAAOA,EAAK,OAAO,CAACN,EAAGC,KACrBD,GAAKD,GAAqBE,CAAC,EACpBD,GACN,EAAE,CACP,CAEA,SAASO,GAAQC,EAAW,CAC1B,IAAMC,EAAO,CAAA,EACb,QAAWC,KAAQF,EAAK,CACtB,IAAMJ,EAAYM,EAAK,YAAY,CAAC,EACpC,GAAIN,GAAa,KACf,MAAM,IAAI,MAAM,sBAAsBM,CAAI,EAAE,EAE9C,IAAMC,EAAMR,GAAqBC,CAAS,EAC1C,GAAIO,GAAO,KACT,MAAM,IAAI,MAAM,+BAA+BD,CAAI,EAAE,EAEvDD,EAAK,KAAKE,CAAG,CACf,CACA,OAAO,IAAI,WAAWF,CAAI,CAC5B,CAEO,IAAMG,GAAeC,GAAK,CAC/B,OAAQ,YACR,KAAM,eACN,OAAAR,GACA,OAAAE,GACD,ECzCD,IAAAO,GAAA,GAAAC,GAAAD,GAAA,YAAAE,GAAA,cAAAC,GAAA,iBAAAC,GAAA,sBAAAC,GAAA,mBAAAC,GAAA,cAAAC,GAAA,mBAAAC,GAAA,gBAAAC,GAAA,YAAAC,KAEO,IAAMC,GAASC,EAAQ,CAC5B,OAAQ,IACR,KAAM,SACN,SAAU,mCACV,YAAa,EACd,EAEYC,GAAcD,EAAQ,CACjC,OAAQ,IACR,KAAM,cACN,SAAU,mCACV,YAAa,EACd,EAEYE,GAAYF,EAAQ,CAC/B,OAAQ,IACR,KAAM,YACN,SAAU,oCACV,YAAa,EACd,EAEYG,GAAiBH,EAAQ,CACpC,OAAQ,IACR,KAAM,iBACN,SAAU,oCACV,YAAa,EACd,EAEYI,GAAYJ,EAAQ,CAC/B,OAAQ,IACR,KAAM,YACN,SAAU,mCACV,YAAa,EACd,EAEYK,GAAiBL,EAAQ,CACpC,OAAQ,IACR,KAAM,iBACN,SAAU,mCACV,YAAa,EACd,EAEYM,GAAeN,EAAQ,CAClC,OAAQ,IACR,KAAM,eACN,SAAU,oCACV,YAAa,EACd,EAEYO,GAAoBP,EAAQ,CACvC,OAAQ,IACR,KAAM,oBACN,SAAU,oCACV,YAAa,EACd,EAEYQ,GAAUR,EAAQ,CAC7B,OAAQ,IACR,KAAM,UACN,SAAU,mCACV,YAAa,EACd,EC/DD,IAAAS,GAAA,GAAAC,GAAAD,GAAA,YAAAE,GAAA,gBAAAC,KAEO,IAAMC,GAASC,GAAM,CAC1B,OAAQ,IACR,KAAM,SACN,SAAU,uCACX,EAEYC,GAAcD,GAAM,CAC/B,OAAQ,IACR,KAAM,cACN,SAAU,uCACX,ECZD,IAAAE,GAAA,GAAAC,GAAAD,GAAA,eAAAE,GAAA,iBAAAC,KAEO,IAAMC,GAAYC,GAAM,CAC7B,KAAM,YACN,OAAQ,IACR,SAAU,6DACX,EAEYC,GAAeD,GAAM,CAChC,KAAM,eACN,OAAQ,IACR,SAAU,6DACX,ECZD,IAAAE,GAAA,GAAAC,GAAAD,GAAA,YAAAE,GAAA,cAAAC,GAAA,cAAAC,GAAA,iBAAAC,KAEO,IAAMC,GAASC,EAAQ,CAC5B,OAAQ,IACR,KAAM,SACN,SAAU,mEACV,YAAa,EACd,EAEYC,GAAYD,EAAQ,CAC/B,OAAQ,IACR,KAAM,YACN,SAAU,oEACV,YAAa,EACd,EAEYE,GAAYF,EAAQ,CAC/B,OAAQ,IACR,KAAM,YACN,SAAU,mEACV,YAAa,EACd,EAEYG,GAAeH,EAAQ,CAClC,OAAQ,IACR,KAAM,eACN,SAAU,oEACV,YAAa,EACd,EC5BD,IAAAI,GAAA,GAAAC,GAAAD,GAAA,WAAAE,KAEO,IAAMC,GAAQC,EAAQ,CAC3B,OAAQ,IACR,KAAM,QACN,SAAU,WACV,YAAa,EACd,ECPD,IAAAC,GAAA,GAAAC,GAAAD,GAAA,cAAAE,KAGO,IAAMC,GAAWC,GAAK,CAC3B,OAAQ,KACR,KAAM,WACN,OAASC,GAAQC,GAASD,CAAG,EAC7B,OAASE,GAAQC,GAAWD,CAAG,EAChC,ECND,IAAME,GAAc,IAAI,YAClBC,GAAc,IAAI,YCHxB,IAAAC,GAAA,GAAAC,GAAAD,GAAA,cAAAE,KCCA,IAAIC,GAAWC,GAEXC,GAAM,IACNC,GAAO,IACPC,GAAS,CAACD,GACVE,GAAM,KAAK,IAAI,EAAG,EAAE,EAOxB,SAASJ,GAAOK,EAAKC,EAAKC,EAAM,CAC9BD,EAAMA,GAAO,CAAA,EACbC,EAASA,GAAU,EAGnB,QAFIC,EAAYD,EAEVF,GAAOD,IACXE,EAAIC,GAAQ,EAAKF,EAAM,IAAQJ,GAC/BI,GAAO,IAET,KAAMA,EAAMF,IACVG,EAAIC,GAAQ,EAAKF,EAAM,IAAQJ,GAC/BI,KAAS,EAEX,OAAAC,EAAIC,CAAM,EAAIF,EAAM,EAGpBL,GAAO,MAAQO,EAASC,EAAY,EAE7BF,CACT,CAEA,IAAIG,GAASC,GAETC,GAAQ,IACRC,GAAS,IAMb,SAASF,GAAKG,EAAKN,EAAM,CACvB,IAAIO,EAAS,EACTP,EAASA,GAAU,EACnBQ,EAAS,EACTC,EAAUT,EACVU,EACAC,EAAIL,EAAI,OAEZ,EAAG,CACD,GAAIG,GAAWE,EAEb,MAAAR,GAAK,MAAQ,EACP,IAAI,WAAW,yBAAyB,EAEhDO,EAAIJ,EAAIG,GAAS,EACjBF,GAAOC,EAAQ,IACVE,EAAIL,KAAWG,GACfE,EAAIL,IAAU,KAAK,IAAI,EAAGG,CAAK,EACpCA,GAAS,CACX,OAASE,GAAKN,IAGd,OAAAD,GAAK,MAAQM,EAAUT,EAEhBO,CACT,CAEA,IAAIK,GAAK,KAAK,IAAI,EAAI,CAAC,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EACnBC,GAAK,KAAK,IAAI,EAAG,EAAE,EAEnBC,GAAS,SAAgCC,EAAK,CAChD,OACEA,EAAQV,GAAK,EACbU,EAAQT,GAAK,EACbS,EAAQR,GAAK,EACbQ,EAAQP,GAAK,EACbO,EAAQN,GAAK,EACbM,EAAQL,GAAK,EACbK,EAAQJ,GAAK,EACbI,EAAQH,GAAK,EACbG,EAAQF,GAAK,EACA,EAEjB,EAEIG,GAAS,CACT,OAAQ/B,GACR,OAAQU,GACR,eAAgBmB,IAGhBG,GAAeD,GAEnBE,GAAeD,GCrGT,SAAUE,GAAQC,EAAkBC,EAAS,EAAC,CAElD,MAAO,CADMC,GAAO,OAAOF,EAAMC,CAAM,EACzBC,GAAO,OAAO,KAAK,CACnC,CAEM,SAAUC,GAAUC,EAAaC,EAAoBJ,EAAS,EAAC,CACnE,OAAAC,GAAO,OAAOE,EAAKC,EAAQJ,CAAM,EAC1BI,CACT,CAEM,SAAUC,GAAgBF,EAAW,CACzC,OAAOF,GAAO,eAAeE,CAAG,CAClC,CCPM,SAAUG,GAA8BC,EAAYC,EAAkB,CAC1E,IAAMC,EAAOD,EAAO,WACdE,EAAoBC,GAAeJ,CAAI,EACvCK,EAAeF,EAAoBC,GAAeF,CAAI,EAEtDI,EAAQ,IAAI,WAAWD,EAAeH,CAAI,EAChD,OAAOK,GAASP,EAAMM,EAAO,CAAC,EACvBC,GAASL,EAAMI,EAAOH,CAAU,EACvCG,EAAM,IAAIL,EAAQI,CAAY,EAEvB,IAAIG,GAAOR,EAAME,EAAMD,EAAQK,CAAK,CAC7C,CAKM,SAAUG,GAAQC,EAAqB,CAC3C,IAAMJ,EAAQK,GAAOD,CAAS,EACxB,CAACV,EAAMG,CAAU,EAAWM,GAAOH,CAAK,EACxC,CAACJ,EAAMG,CAAY,EAAWI,GAAOH,EAAM,SAASH,CAAU,CAAC,EAC/DF,EAASK,EAAM,SAASH,EAAaE,CAAY,EAEvD,GAAIJ,EAAO,aAAeC,EACxB,MAAM,IAAI,MAAM,kBAAkB,EAGpC,OAAO,IAAIM,GAAOR,EAAME,EAAMD,EAAQK,CAAK,CAC7C,CAEM,SAAUM,GAAQC,EAAoBC,EAAU,CACpD,GAAID,IAAMC,EACR,MAAO,GACF,CACL,IAAMC,EAAOD,EAEb,OACED,EAAE,OAASE,EAAK,MAChBF,EAAE,OAASE,EAAK,MAChBA,EAAK,iBAAiB,YACtBH,GAAWC,EAAE,MAAOE,EAAK,KAAK,CAElC,CACF,CAMM,IAAOP,GAAP,KAAa,CACR,KACA,KACA,OACA,MAKT,YAAaR,EAAYE,EAAYD,EAAoBK,EAAiB,CACxE,KAAK,KAAON,EACZ,KAAK,KAAOE,EACZ,KAAK,OAASD,EACd,KAAK,MAAQK,CACf,GHjEF,IAAMU,GAAY,EACZC,GAAO,WAEPC,GAA4CC,GAElD,SAASC,GAAQC,EAAmBC,EAAuB,CACzD,GAAIA,GAAS,UAAY,MAAQA,EAAQ,WAAaD,EAAM,WAAY,CACtE,GAAIC,EAAQ,SAAW,GAAKA,EAAQ,SAAWD,EAAM,WACnD,MAAM,IAAI,MAAM,0DAA0DA,EAAM,UAAU,EAAE,EAG9FA,EAAQA,EAAM,SAAS,EAAGC,EAAQ,QAAQ,CAC5C,CAEA,OAAcC,GAAOP,GAAME,GAAOG,CAAK,CAAC,CAC1C,CAEO,IAAMG,GAAW,CAAE,KAAAR,GAAM,KAAAC,GAAM,OAAAC,GAAQ,OAAAE,EAAM,EIrBpD,IAAAK,GAAA,GAAAC,GAAAD,GAAA,YAAAE,GAAA,WAAAC,KAAA,IAAAC,GAAmB,mBCKnB,IAAMC,GAA4B,GAqB5B,SAAUC,GAAiD,CAAE,KAAAC,EAAM,KAAAC,EAAM,OAAAC,EAAQ,gBAAAC,EAAiB,gBAAAC,CAAe,EAA0B,CAC/I,OAAO,IAAIC,GAAOL,EAAMC,EAAMC,EAAQC,EAAiBC,CAAe,CACxE,CAoBM,IAAOC,GAAP,KAAa,CACR,KACA,KACA,OACA,gBACA,gBAET,YAAaL,EAAYC,EAAYC,EAAkDC,EAA0BC,EAAwB,CACvI,KAAK,KAAOJ,EACZ,KAAK,KAAOC,EACZ,KAAK,OAASC,EACd,KAAK,gBAAkBC,GAAmBL,GAC1C,KAAK,gBAAkBM,CACzB,CAEA,OAAQE,EAAmBC,EAAuB,CAChD,GAAIA,GAAS,UAAY,KAAM,CAC7B,GAAIA,EAAQ,SAAW,KAAK,gBAC1B,MAAM,IAAI,MAAM,6DAA6D,KAAK,eAAe,EAAE,EAGrG,GAAI,KAAK,iBAAmB,MAAQA,EAAQ,SAAW,KAAK,gBAC1D,MAAM,IAAI,MAAM,0DAA0D,KAAK,eAAe,EAAE,CAEpG,CAEA,GAAID,aAAiB,WAAY,CAC/B,IAAME,EAAS,KAAK,OAAOF,CAAK,EAEhC,OAAIE,aAAkB,WACbC,GAAaD,EAAQ,KAAK,KAAMD,GAAS,QAAQ,EAGnDC,EAAO,KAAKE,GAAUD,GAAaC,EAAQ,KAAK,KAAMH,GAAS,QAAQ,CAAC,CACjF,KACE,OAAM,MAAM,mCAAmC,CAGnD,GAOF,SAASE,GAAoCC,EAAoBT,EAAYU,EAAiB,CAC5F,GAAIA,GAAY,MAAQA,IAAaD,EAAO,WAAY,CACtD,GAAIC,EAAWD,EAAO,WACpB,MAAM,IAAI,MAAM,0DAA0DA,EAAO,UAAU,EAAE,EAG/FA,EAASA,EAAO,SAAS,EAAGC,CAAQ,CACtC,CAEA,OAAcC,GAAOX,EAAMS,CAAM,CACnC,CDnGO,IAAMG,GAASC,GAAK,CACzB,KAAM,WACN,KAAM,GACN,OAASC,GAAUC,GAAO,GAAAC,QAAO,WAAW,QAAQ,EAAE,OAAOF,CAAK,EAAE,OAAM,CAAE,EAC7E,EAEYG,GAASJ,GAAK,CACzB,KAAM,WACN,KAAM,GACN,OAAQC,GAASC,GAAO,GAAAC,QAAO,WAAW,QAAQ,EAAE,OAAOF,CAAK,EAAE,OAAM,CAAE,EAC3E,EEHK,SAAUI,GAA0FC,EAASC,EAAmC,CACpJ,GAAM,CAAE,MAAAC,EAAO,QAAAC,CAAO,EAAKH,EAC3B,OAAQG,EAAS,CACf,IAAK,GACH,OAAOC,GACLF,EACAG,GAAUL,CAAI,EACdC,GAAqCK,GAAU,OAAO,EAE1D,QACE,OAAOC,GACLL,EACAG,GAAUL,CAAI,EACbC,GAAQO,GAAO,OAAwC,CAE9D,CACF,CAYA,IAAMC,GAAQ,IAAI,QAElB,SAASC,GAAWC,EAAoB,CACtC,IAAMD,EAAYD,GAAM,IAAIE,CAAG,EAC/B,GAAID,GAAa,KAAM,CACrB,IAAMA,EAAY,IAAI,IACtB,OAAAD,GAAM,IAAIE,EAAKD,CAAS,EACjBA,CACT,CACA,OAAOA,CACT,CAEM,IAAOE,GAAP,MAAOC,CAAG,CACL,KACA,QACA,UACA,MACA,IAOT,YAAaC,EAAkBC,EAAcC,EAAqCC,EAAiB,CACjG,KAAK,KAAOF,EACZ,KAAK,QAAUD,EACf,KAAK,UAAYE,EACjB,KAAK,MAAQC,EAIb,KAAK,GAAG,EAAIA,CACd,CAQA,IAAI,OAAK,CACP,OAAO,IACT,CAGA,IAAI,YAAU,CACZ,OAAO,KAAK,MAAM,UACpB,CAGA,IAAI,YAAU,CACZ,OAAO,KAAK,MAAM,UACpB,CAEA,MAAI,CACF,OAAQ,KAAK,QAAS,CACpB,IAAK,GACH,OAAO,KAET,IAAK,GAAG,CACN,GAAM,CAAE,KAAAF,EAAM,UAAAC,CAAS,EAAK,KAE5B,GAAID,IAASG,GACX,MAAM,IAAI,MAAM,0CAA0C,EAI5D,GAAIF,EAAU,OAASG,GACrB,MAAM,IAAI,MAAM,oDAAoD,EAGtE,OACEN,EAAI,SACFG,CAA6C,CAGnD,CACA,QACE,MAAM,MACJ,+BAA+B,KAAK,OAAO,4CAA4C,CAG7F,CACF,CAEA,MAAI,CACF,OAAQ,KAAK,QAAS,CACpB,IAAK,GAAG,CACN,GAAM,CAAE,KAAAD,EAAM,OAAAK,CAAM,EAAK,KAAK,UACxBJ,EAAmBK,GAAON,EAAMK,CAAM,EAC5C,OACEP,EAAI,SAAS,KAAK,KAAMG,CAAS,CAErC,CACA,IAAK,GACH,OAAO,KAET,QACE,MAAM,MACJ,+BAA+B,KAAK,OAAO,4CAA4C,CAG7F,CACF,CAEA,OAAQM,EAAc,CACpB,OAAOT,EAAI,OAAO,KAAMS,CAAK,CAC/B,CAEA,OAAO,OAAsFC,EAA4CD,EAAc,CACrJ,IAAME,EAAUF,EAChB,OACEE,GAAW,MACXD,EAAK,OAASC,EAAQ,MACtBD,EAAK,UAAYC,EAAQ,SAClBC,GAAOF,EAAK,UAAWC,EAAQ,SAAS,CAEnD,CAEA,SAAUE,EAAmC,CAC3C,OAAOC,GAAO,KAAMD,CAAI,CAC1B,CAEA,QAAM,CACJ,MAAO,CAAE,IAAKC,GAAO,IAAI,CAAC,CAC5B,CAEA,MAAI,CACF,OAAO,IACT,CAES,CAAC,OAAO,WAAW,EAAI,MAIhC,CAAC,OAAO,IAAI,4BAA4B,CAAC,GAAC,CACxC,MAAO,OAAO,KAAK,SAAQ,CAAE,GAC/B,CAYA,OAAO,MAAwFC,EAA+C,CAC5I,GAAIA,GAAS,KACX,OAAO,KAGT,IAAMC,EAAQD,EACd,GAAIC,aAAiBhB,EAEnB,OAAOgB,EACF,GAAKA,EAAM,GAAG,GAAK,MAAQA,EAAM,GAAG,IAAMA,EAAM,OAAUA,EAAM,QAAUA,EAAO,CAMtF,GAAM,CAAE,QAAAf,EAAS,KAAAC,EAAM,UAAAC,EAAW,MAAAC,CAAK,EAAKY,EAC5C,OAAO,IAAIhB,EACTC,EACAC,EACAC,EACAC,GAASa,GAAUhB,EAASC,EAAMC,EAAU,KAAK,CAAC,CAEtD,SAAWa,EAAME,EAAS,IAAM,GAAM,CAIpC,GAAM,CAAE,QAAAjB,EAAS,UAAAE,EAAW,KAAAD,CAAI,EAAKc,EAC/BT,EAAgBY,GAAOhB,CAAS,EACtC,OAAOH,EAAI,OAAOC,EAASC,EAAMK,CAAM,CACzC,KAGE,QAAO,IAEX,CAOA,OAAO,OAAsFN,EAAkBC,EAAcK,EAAgC,CAC3J,GAAI,OAAOL,GAAS,SAClB,MAAM,IAAI,MAAM,uCAAuC,EAGzD,GAAI,EAAEK,EAAO,iBAAiB,YAC5B,MAAM,IAAI,MAAM,gBAAgB,EAGlC,OAAQN,EAAS,CACf,IAAK,GAAG,CACN,GAAIC,IAASG,GACX,MAAM,IAAI,MACR,wCAAwCA,EAAW,kBAAkB,EAGvE,OAAO,IAAIL,EAAIC,EAASC,EAAMK,EAAQA,EAAO,KAAK,CAEtD,CACA,IAAK,GAAG,CACN,IAAMH,EAAQa,GAAUhB,EAASC,EAAMK,EAAO,KAAK,EACnD,OAAO,IAAIP,EAAIC,EAASC,EAAMK,EAAQH,CAAK,CAC7C,CACA,QACE,MAAM,IAAI,MAAM,iBAAiB,CAErC,CACF,CAKA,OAAO,SAAuBG,EAAgD,CAC5E,OAAOP,EAAI,OAAO,EAAGK,GAAaE,CAAM,CAC1C,CAQA,OAAO,SAAyDL,EAAYK,EAAgC,CAC1G,OAAOP,EAAI,OAAO,EAAGE,EAAMK,CAAM,CACnC,CASA,OAAO,OAAoFH,EAAuD,CAChJ,GAAM,CAACN,EAAKsB,CAAS,EAAIpB,EAAI,YAAYI,CAAK,EAC9C,GAAIgB,EAAU,SAAW,EACvB,MAAM,IAAI,MAAM,kBAAkB,EAEpC,OAAOtB,CACT,CAWA,OAAO,YAA2EM,EAAyC,CACzH,IAAMiB,EAAQrB,EAAI,aAAaI,CAAK,EAC9BkB,EAAaD,EAAM,KAAOA,EAAM,cAChCE,EAAiBC,GACrBpB,EAAM,SAASkB,EAAYA,EAAaD,EAAM,aAAa,CAAC,EAE9D,GAAIE,EAAe,aAAeF,EAAM,cACtC,MAAM,IAAI,MAAM,kBAAkB,EAEpC,IAAMI,EAAcF,EAAe,SACjCF,EAAM,cAAgBA,EAAM,UAAU,EAElCd,EAAS,IAAWmB,GACxBL,EAAM,cACNA,EAAM,WACNI,EACAF,CAAc,EAMhB,MAAO,CAHLF,EAAM,UAAY,EACdrB,EAAI,SAASO,CAA0C,EACvDP,EAAI,SAASqB,EAAM,MAAOd,CAAM,EACNH,EAAM,SAASiB,EAAM,IAAI,CAAC,CAC5D,CAWA,OAAO,aAA4EM,EAAgD,CACjI,IAAIC,EAAS,EACPC,EAAO,IAAa,CACxB,GAAM,CAACC,EAAGC,CAAM,EAAWZ,GAAOQ,EAAa,SAASC,CAAM,CAAC,EAC/D,OAAAA,GAAUG,EACHD,CACT,EAEI7B,EAAU4B,EAAI,EACdG,EAAQ3B,GASZ,GARIJ,IAAsB,IAExBA,EAAU,EACV2B,EAAS,GAETI,EAAQH,EAAI,EAGV5B,IAAY,GAAKA,IAAY,EAC/B,MAAM,IAAI,WAAW,uBAAuBA,CAAO,EAAE,EAGvD,IAAMqB,EAAaM,EACbK,EAAgBJ,EAAI,EACpBK,EAAaL,EAAI,EACjBM,EAAOP,EAASM,EAChBE,EAAgBD,EAAOb,EAE7B,MAAO,CAAE,QAAArB,EAAS,MAAA+B,EAAO,cAAAC,EAAe,WAAAC,EAAY,cAAAE,EAAe,KAAAD,CAAI,CACzE,CAQA,OAAO,MAA0GE,EAAkExB,EAAmC,CACpN,GAAM,CAACyB,EAAQlC,CAAK,EAAImC,GAAgBF,EAAQxB,CAAI,EAE9Cf,EAAME,EAAI,OAAOI,CAAK,EAE5B,GAAIN,EAAI,UAAY,GAAKuC,EAAO,CAAC,IAAM,IACrC,MAAM,MAAM,wDAAwD,EAItE,OAAAxC,GAAUC,CAAG,EAAE,IAAIwC,EAAQD,CAAM,EAE1BvC,CACT,GAGF,SAASyC,GAAqHF,EAAkExB,EAAmC,CACjO,OAAQwB,EAAO,CAAC,EAAG,CAEjB,IAAK,IAAK,CACR,IAAMG,EAAU3B,GAAQ4B,GACxB,MAAO,CACLA,GAAU,OACVD,EAAQ,OAAO,GAAGC,GAAU,MAAM,GAAGJ,CAAM,EAAE,EAEjD,CACA,KAAKI,GAAU,OAAQ,CACrB,IAAMD,EAAU3B,GAAQ4B,GACxB,MAAO,CAACA,GAAU,OAAkBD,EAAQ,OAAOH,CAAM,CAAC,CAC5D,CACA,KAAKK,GAAO,OAAQ,CAClB,IAAMF,EAAU3B,GAAQ6B,GACxB,MAAO,CAACA,GAAO,OAAkBF,EAAQ,OAAOH,CAAM,CAAC,CACzD,CACA,KAAKM,GAAO,OAAQ,CAClB,IAAMH,EAAU3B,GAAQ8B,GACxB,MAAO,CAACA,GAAO,OAAkBH,EAAQ,OAAOH,CAAM,CAAC,CACzD,CACA,QAAS,CACP,GAAIxB,GAAQ,KACV,MAAM,MACJ,yFAAyF,EAG7F,MAAO,CAACwB,EAAO,CAAC,EAAaxB,EAAK,OAAOwB,CAAM,CAAC,CAClD,CACF,CACF,CAEA,SAASO,GAAYxC,EAAmBR,EAA4BiB,EAA+B,CACjG,GAAM,CAAE,OAAAyB,CAAM,EAAKzB,EACnB,GAAIyB,IAAWG,GAAU,OACvB,MAAM,MAAM,8BAA8B5B,EAAK,IAAI,WAAW,EAGhE,IAAMf,EAAMF,EAAM,IAAI0C,CAAM,EAC5B,GAAIxC,GAAO,KAAM,CACf,IAAMA,EAAMe,EAAK,OAAOT,CAAK,EAAE,MAAM,CAAC,EACtC,OAAAR,EAAM,IAAI0C,EAAQxC,CAAG,EACdA,CACT,KACE,QAAOA,CAEX,CAEA,SAAS+C,GAAoCzC,EAAmBR,EAA4BiB,EAAkC,CAC5H,GAAM,CAAE,OAAAyB,CAAM,EAAKzB,EACbf,EAAMF,EAAM,IAAI0C,CAAM,EAC5B,GAAIxC,GAAO,KAAM,CACf,IAAMA,EAAMe,EAAK,OAAOT,CAAK,EAC7B,OAAAR,EAAM,IAAI0C,EAAQxC,CAAG,EACdA,CACT,KACE,QAAOA,CAEX,CAEA,IAAMO,GAAc,IACdC,GAAe,GAErB,SAASW,GAAWhB,EAAsBC,EAAcC,EAAqB,CAC3E,IAAM2C,EAAoBC,GAAe9C,CAAO,EAC1C+C,EAAaF,EAAoBC,GAAe7C,CAAI,EACpDE,EAAQ,IAAI,WAAW4C,EAAa7C,EAAU,UAAU,EAC9D,OAAO8C,GAAShD,EAASG,EAAO,CAAC,EAC1B6C,GAAS/C,EAAME,EAAO0C,CAAU,EACvC1C,EAAM,IAAID,EAAW6C,CAAU,EACxB5C,CACT,CAEA,IAAMc,GAAY,OAAO,IAAI,kBAAkB,EC7bxC,IAAMgC,GAAQ,CAAE,GAAGC,GAAc,GAAGC,GAAO,GAAGC,GAAO,GAAGC,GAAQ,GAAGC,GAAQ,GAAGC,GAAQ,GAAGC,GAAQ,GAAGC,GAAQ,GAAGC,GAAQ,GAAGC,EAAY,EAChIC,GAAS,CAAE,GAAGC,GAAM,GAAGX,EAAQ,ECb5C,SAASY,GAAaC,EAAcC,EAAgBC,EAAqCC,EAAmC,CAC1H,MAAO,CACL,KAAAH,EACA,OAAAC,EACA,QAAS,CACP,KAAAD,EACA,OAAAC,EACA,OAAAC,GAEF,QAAS,CACP,OAAAC,GAGN,CAEA,IAAMC,GAASL,GAAY,OAAQ,IAAMM,GAEhC,IADS,IAAI,YAAY,MAAM,EACjB,OAAOA,CAAG,EAC7BC,GACc,IAAI,YAAW,EAChB,OAAOA,EAAI,UAAU,CAAC,CAAC,CACvC,EAEKC,GAAQR,GAAY,QAAS,IAAMM,GAAO,CAC9C,IAAID,EAAS,IAEb,QAASI,EAAI,EAAGA,EAAIH,EAAI,OAAQG,IAC9BJ,GAAU,OAAO,aAAaC,EAAIG,CAAC,CAAC,EAEtC,OAAOJ,CACT,EAAIE,GAAO,CACTA,EAAMA,EAAI,UAAU,CAAC,EACrB,IAAMD,EAAMI,GAAYH,EAAI,MAAM,EAElC,QAASE,EAAI,EAAGA,EAAIF,EAAI,OAAQE,IAC9BH,EAAIG,CAAC,EAAIF,EAAI,WAAWE,CAAC,EAG3B,OAAOH,CACT,CAAC,EAIKK,GAAyD,CAC7D,KAAMN,GACN,QAASA,GACT,IAAKO,GAAM,OACX,OAAQJ,GACR,MAAAA,GACA,OAAQA,GAER,GAAGI,IAGLC,GAAeF,GvB7CT,SAAUG,GAAYC,EAAgBC,EAA+B,OAAM,CAC/E,IAAMC,EAAOC,GAAMF,CAAQ,EAE3B,GAAIC,GAAQ,KACV,MAAM,IAAI,MAAM,yBAAyBD,CAAQ,GAAG,EAGtD,OAAIA,IAAa,QAAUA,IAAa,QAC/BG,GAAa,UAAO,KAAKJ,EAAQ,OAAO,CAAC,EAI3CE,EAAK,QAAQ,OAAO,GAAGA,EAAK,MAAM,GAAGF,CAAM,EAAE,CACtD,CwBrBc,SAAPK,GAAuBC,EAAa,CACzC,IAAMC,EAAOD,GAAQ,KACfE,EAAMD,IAAS,EACjBE,EACAC,EAASH,EACb,OAAO,SAAoBD,EAAY,CACrC,GAAIA,EAAO,GAAKA,EAAOE,EACrB,OAAOG,GAAYL,CAAI,EAGrBI,EAASJ,EAAOC,IAClBE,EAAOE,GAAYJ,CAAI,EACvBG,EAAS,GAGX,IAAME,EAAMH,EAAK,SAASC,EAAQA,GAAUJ,CAAI,EAEhD,OAAKI,EAAS,KAAO,IAEnBA,GAAUA,EAAS,GAAK,GAGnBE,CACT,CACF,CCXA,IAAMC,GAAN,KAAQ,CAIC,GAKA,IAKA,KAKA,IAEP,YAAaC,EAAwBC,EAAaC,EAAM,CACtD,KAAK,GAAKF,EACV,KAAK,IAAMC,EACX,KAAK,KAAO,OACZ,KAAK,IAAMC,CACb,GAIF,SAASC,IAAI,CAAW,CAKxB,IAAMC,GAAN,KAAW,CAIF,KAKA,KAKA,IAKA,KAEP,YAAaC,EAAwB,CACnC,KAAK,KAAOA,EAAO,KACnB,KAAK,KAAOA,EAAO,KACnB,KAAK,IAAMA,EAAO,IAClB,KAAK,KAAOA,EAAO,MACrB,GAGIC,GAAaC,GAAI,EAKvB,SAASC,GAAOC,EAAY,CAC1B,OAAI,WAAW,QAAU,KAChBC,GAAYD,CAAI,EAGlBH,GAAWG,CAAI,CACxB,CASA,IAAME,GAAN,KAAsB,CAIb,IAKA,KAKA,KAKA,OAEP,aAAA,CACE,KAAK,IAAM,EACX,KAAK,KAAO,IAAIZ,GAAGI,GAAM,EAAG,CAAC,EAC7B,KAAK,KAAO,KAAK,KACjB,KAAK,OAAS,IAChB,CAKA,MAAOH,EAA0BC,EAAaC,EAAQ,CACpD,YAAK,KAAO,KAAK,KAAK,KAAO,IAAIH,GAAGC,EAAIC,EAAKC,CAAG,EAChD,KAAK,KAAOD,EAEL,IACT,CAKA,OAAQW,EAAa,CAGnB,YAAK,MAAQ,KAAK,KAAO,KAAK,KAAK,KAAO,IAAIC,IAC3CD,EAAQA,IAAU,GACT,IACN,EACAA,EAAQ,MACN,EACAA,EAAQ,QACN,EACAA,EAAQ,UACN,EACA,EACVA,CAAK,GAAG,IACH,IACT,CAKA,MAAOA,EAAa,CAClB,OAAOA,EAAQ,EACX,KAAK,MAAME,GAAe,GAAIC,GAAS,WAAWH,CAAK,CAAC,EACxD,KAAK,OAAOA,CAAK,CACvB,CAKA,OAAQA,EAAa,CACnB,OAAO,KAAK,QAAQA,GAAS,EAAIA,GAAS,MAAQ,CAAC,CACrD,CAKA,OAAQA,EAAa,CACnB,IAAMI,EAAOD,GAAS,WAAWH,CAAK,EACtC,OAAO,KAAK,MAAME,GAAeE,EAAK,OAAM,EAAIA,CAAI,CACtD,CAKA,aAAcJ,EAAa,CACzB,OAAO,KAAK,MAAMK,GAAkBC,GAAeN,CAAK,EAAGA,CAAK,CAClE,CAKA,aAAcA,EAAa,CACzB,OAAO,KAAK,OAAO,OAAOA,CAAK,CAAC,CAClC,CAKA,MAAOA,EAAa,CAClB,OAAO,KAAK,OAAOA,CAAK,CAC1B,CAKA,YAAaA,EAAa,CACxB,OAAO,KAAK,aAAaA,CAAK,CAChC,CAKA,YAAaA,EAAa,CACxB,OAAO,KAAK,aAAaA,CAAK,CAChC,CAKA,OAAQA,EAAa,CACnB,IAAMI,EAAOD,GAAS,WAAWH,CAAK,EAAE,SAAQ,EAChD,OAAO,KAAK,MAAME,GAAeE,EAAK,OAAM,EAAIA,CAAI,CACtD,CAKA,aAAcJ,EAAa,CACzB,IAAMI,EAAOD,GAAS,WAAWH,CAAK,EAAE,SAAQ,EAChD,OAAO,KAAK,MAAME,GAAeE,EAAK,OAAM,EAAIA,CAAI,CACtD,CAKA,aAAcJ,EAAa,CACzB,OAAO,KAAK,OAAO,OAAOA,CAAK,CAAC,CAClC,CAKA,KAAMA,EAAc,CAClB,OAAO,KAAK,MAAMO,GAAW,EAAGP,EAAQ,EAAI,CAAC,CAC/C,CAKA,QAASA,EAAa,CACpB,OAAO,KAAK,MAAMQ,GAAc,EAAGR,IAAU,CAAC,CAChD,CAKA,SAAUA,EAAa,CACrB,OAAO,KAAK,QAAQA,CAAK,CAC3B,CAKA,QAASA,EAAa,CACpB,IAAMI,EAAOD,GAAS,WAAWH,CAAK,EACtC,OAAO,KAAK,MAAMQ,GAAc,EAAGJ,EAAK,EAAE,EAAE,MAAMI,GAAc,EAAGJ,EAAK,EAAE,CAC5E,CAKA,cAAeJ,EAAa,CAC1B,IAAMI,EAAOD,GAAS,WAAWH,CAAK,EACtC,OAAO,KAAK,MAAMQ,GAAc,EAAGJ,EAAK,EAAE,EAAE,MAAMI,GAAc,EAAGJ,EAAK,EAAE,CAC5E,CAKA,cAAeJ,EAAa,CAC1B,OAAO,KAAK,QAAQ,OAAOA,CAAK,CAAC,CACnC,CAKA,SAAUA,EAAa,CACrB,OAAO,KAAK,QAAQA,CAAK,CAC3B,CAKA,eAAgBA,EAAa,CAC3B,OAAO,KAAK,cAAcA,CAAK,CACjC,CAKA,eAAgBA,EAAa,CAC3B,OAAO,KAAK,cAAcA,CAAK,CACjC,CAKA,MAAOA,EAAa,CAClB,OAAO,KAAK,MAAMS,GAAc,EAAGT,CAAK,CAC1C,CASA,OAAQA,EAAa,CACnB,OAAO,KAAK,MAAMU,GAAe,EAAGV,CAAK,CAC3C,CAKA,MAAOA,EAAiB,CACtB,IAAMX,EAAMW,EAAM,SAAW,EAE7B,OAAIX,IAAQ,EACH,KAAK,MAAMkB,GAAW,EAAG,CAAC,EAG5B,KAAK,OAAOlB,CAAG,EAAE,MAAMsB,GAAYtB,EAAKW,CAAK,CACtD,CAKA,OAAQA,EAAa,CACnB,IAAMX,EAAWuB,GAAOZ,CAAK,EAC7B,OAAOX,IAAQ,EACX,KAAK,OAAOA,CAAG,EAAE,MAAWwB,GAAOxB,EAAKW,CAAK,EAC7C,KAAK,MAAMO,GAAW,EAAG,CAAC,CAChC,CAMA,MAAI,CACF,YAAK,OAAS,IAAIf,GAAM,IAAI,EAC5B,KAAK,KAAO,KAAK,KAAO,IAAIL,GAAGI,GAAM,EAAG,CAAC,EACzC,KAAK,IAAM,EACJ,IACT,CAKA,OAAK,CACH,OAAI,KAAK,QAAU,MACjB,KAAK,KAAO,KAAK,OAAO,KACxB,KAAK,KAAO,KAAK,OAAO,KACxB,KAAK,IAAM,KAAK,OAAO,IACvB,KAAK,OAAS,KAAK,OAAO,OAE1B,KAAK,KAAO,KAAK,KAAO,IAAIJ,GAAGI,GAAM,EAAG,CAAC,EACzC,KAAK,IAAM,GAEN,IACT,CAKA,QAAM,CACJ,IAAMuB,EAAO,KAAK,KACZC,EAAO,KAAK,KACZ1B,EAAM,KAAK,IACjB,YAAK,MAAK,EAAG,OAAOA,CAAG,EACnBA,IAAQ,IACV,KAAK,KAAK,KAAOyB,EAAK,KACtB,KAAK,KAAOC,EACZ,KAAK,KAAO1B,GAEP,IACT,CAKA,QAAM,CACJ,IAAIyB,EAAO,KAAK,KAAK,KACfE,EAAMpB,GAAM,KAAK,GAAG,EACtBqB,EAAM,EACV,KAAOH,GAAQ,MACbA,EAAK,GAAGA,EAAK,IAAKE,EAAKC,CAAG,EAC1BA,GAAOH,EAAK,IACZA,EAAOA,EAAK,KAGd,OAAOE,CACT,GAGF,SAAST,GAAWjB,EAAa0B,EAAiBC,EAAW,CAC3DD,EAAIC,CAAG,EAAI3B,EAAM,GACnB,CAEA,SAAS4B,GAAe5B,EAAa0B,EAAiBC,EAAW,CAC/D,KAAO3B,EAAM,KACX0B,EAAIC,GAAK,EAAI3B,EAAM,IAAM,IACzBA,KAAS,EAEX0B,EAAIC,CAAG,EAAI3B,CACb,CAOA,IAAMW,GAAN,cAAuBd,EAAU,CACxB,KAEP,YAAaE,EAAaC,EAAW,CACnC,MAAM4B,GAAe7B,EAAKC,CAAG,EAC7B,KAAK,KAAO,MACd,GAGF,SAASY,GAAeZ,EAAe0B,EAAiBC,EAAW,CACjE,KAAO3B,EAAI,KAAO,GAChB0B,EAAIC,GAAK,EAAI3B,EAAI,GAAK,IAAM,IAC5BA,EAAI,IAAMA,EAAI,KAAO,EAAIA,EAAI,IAAM,MAAQ,EAC3CA,EAAI,MAAQ,EAEd,KAAOA,EAAI,GAAK,KACd0B,EAAIC,GAAK,EAAI3B,EAAI,GAAK,IAAM,IAC5BA,EAAI,GAAKA,EAAI,KAAO,EAEtB0B,EAAIC,GAAK,EAAI3B,EAAI,EACnB,CAEA,SAASkB,GAAclB,EAAa0B,EAAiBC,EAAW,CAC9DD,EAAIC,CAAG,EAAI3B,EAAM,IACjB0B,EAAIC,EAAM,CAAC,EAAI3B,IAAQ,EAAI,IAC3B0B,EAAIC,EAAM,CAAC,EAAI3B,IAAQ,GAAK,IAC5B0B,EAAIC,EAAM,CAAC,EAAI3B,IAAQ,EACzB,CAEA,SAASqB,GAAYrB,EAAiB0B,EAAiBC,EAAW,CAChED,EAAI,IAAI1B,EAAK2B,CAAG,CAClB,CAEI,WAAW,QAAU,OACvBlB,GAAiB,UAAU,MAAQ,SAAUC,EAAiB,CAC5D,IAAMX,EAAMW,EAAM,SAAW,EAE7B,YAAK,OAAOX,CAAG,EAEXA,EAAM,GACR,KAAK,MAAM8B,GAAkB9B,EAAKW,CAAK,EAGlC,IACT,EAEAD,GAAiB,UAAU,OAAS,SAAUC,EAAa,CACzD,IAAMX,EAAM,WAAW,OAAO,WAAWW,CAAK,EAE9C,YAAK,OAAOX,CAAG,EAEXA,EAAM,GACR,KAAK,MAAM+B,GAAmB/B,EAAKW,CAAK,EAGnC,IACT,GAGF,SAASmB,GAAkB7B,EAAiB0B,EAAiBC,EAAW,CACtED,EAAI,IAAI1B,EAAK2B,CAAG,CAElB,CAEA,SAASG,GAAmB9B,EAAa0B,EAAiBC,EAAW,CAC/D3B,EAAI,OAAS,GAEVuB,GAAMvB,EAAK0B,EAAKC,CAAG,EAEfD,EAAI,WAAa,KAE1BA,EAAI,UAAU1B,EAAK2B,CAAG,EAEtBD,EAAI,IAAIK,GAAqB/B,CAAG,EAAG2B,CAAG,CAE1C,CAKM,SAAUK,IAAY,CAC1B,OAAO,IAAIvB,EACb,CCzfM,SAAUwB,EAAmBC,EAAqBC,EAA+B,CACrF,IAAMC,EAAIC,GAAY,EAEtB,OAAAF,EAAM,OAAOD,EAASE,EAAG,CACvB,gBAAiB,GAClB,EAEMA,EAAE,OAAM,CACjB,CCRA,IAAYE,IAAZ,SAAYA,EAAW,CACrBA,EAAAA,EAAA,OAAA,CAAA,EAAA,SACAA,EAAAA,EAAA,MAAA,CAAA,EAAA,QACAA,EAAAA,EAAA,iBAAA,CAAA,EAAA,mBACAA,EAAAA,EAAA,YAAA,CAAA,EAAA,cACAA,EAAAA,EAAA,UAAA,CAAA,EAAA,YACAA,EAAAA,EAAA,MAAA,CAAA,EAAA,OACF,GAPYA,KAAAA,GAAW,CAAA,EAAA,EAiEjB,SAAUC,GAAiBC,EAAcC,EAAmBC,EAA2BC,EAAyB,CACpH,MAAO,CACL,KAAAH,EACA,KAAAC,EACA,OAAAC,EACA,OAAAC,EAEJ,CCxEM,SAAUC,GAAiBC,EAAM,CACrC,SAASC,EAAWC,EAAoB,CAGtC,GAAIF,EAAEE,EAAI,SAAQ,CAAE,GAAK,KACvB,MAAM,IAAI,MAAM,oBAAoB,EAGtC,OAAOF,EAAEE,CAAG,CACd,CAEA,IAAMC,EAA0C,SAAqBD,EAAKE,EAAM,CAC9E,IAAMC,EAAYJ,EAAUC,CAAG,EAE/BE,EAAO,MAAMC,CAAS,CACxB,EAEMC,EAA0C,SAAqBC,EAAM,CACzE,IAAML,EAAMK,EAAO,MAAK,EAExB,OAAON,EAAUC,CAAG,CACtB,EAGA,OAAOM,GAAY,OAAQC,GAAY,OAAQN,EAAQG,CAAM,CAC/D,CCrBM,SAAUI,EAAaC,EAA2BC,EAAyB,CAC/E,OAAOC,GAAY,UAAWC,GAAY,iBAAkBH,EAAQC,CAAM,CAC5E,CCOM,IAAWG,GAAjB,SAAiBA,EAAO,CACtB,IAAYC,GAAZ,SAAYA,EAAI,CACdA,EAAA,SAAA,WACAA,EAAA,QAAA,UACAA,EAAA,YAAA,cACAA,EAAA,eAAA,iBACAA,EAAA,IAAA,MACAA,EAAA,WAAA,aACAA,EAAA,YAAA,cACAA,EAAA,WAAA,aACAA,EAAA,OAAA,SACAA,EAAA,UAAA,WACF,GAXYA,EAAAD,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAahB,IAAKE,GAAL,SAAKA,EAAY,CACfA,EAAAA,EAAA,SAAA,CAAA,EAAA,WACAA,EAAAA,EAAA,QAAA,CAAA,EAAA,UACAA,EAAAA,EAAA,YAAA,CAAA,EAAA,cACAA,EAAAA,EAAA,eAAA,CAAA,EAAA,iBACAA,EAAAA,EAAA,IAAA,CAAA,EAAA,MACAA,EAAAA,EAAA,WAAA,CAAA,EAAA,aACAA,EAAAA,EAAA,YAAA,CAAA,EAAA,cACAA,EAAAA,EAAA,WAAA,CAAA,EAAA,aACAA,EAAAA,EAAA,OAAA,CAAA,EAAA,SACAA,EAAAA,EAAA,UAAA,CAAA,EAAA,WACF,GAXKA,IAAAA,EAAY,CAAA,EAAA,GAajB,SAAiBD,EAAI,CACNA,EAAA,MAAQ,IACZE,GAAkBD,CAAY,CAEzC,GAJiBD,EAAAD,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMrB,IAAII,EAESJ,EAAA,MAAQ,KACfI,GAAU,OACZA,EAASC,EAAiB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAC1CA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVP,EAAQ,KAAK,MAAK,EAAG,OAAOM,EAAI,KAAMC,CAAC,GAGrCD,EAAI,SAAW,OACjBC,EAAE,OAAO,EAAE,EACXE,GAAe,MAAK,EAAG,OAAOH,EAAI,QAASC,CAAC,GAG1CD,EAAI,YAAc,OACpBC,EAAE,OAAO,EAAE,EACXG,GAAkB,MAAK,EAAG,OAAOJ,EAAI,WAAYC,CAAC,GAGhDD,EAAI,eAAiB,OACvBC,EAAE,OAAO,EAAE,EACXI,GAAqB,MAAK,EAAG,OAAOL,EAAI,cAAeC,CAAC,GAGtDD,EAAI,KAAO,OACbC,EAAE,OAAO,EAAE,EACXK,GAAW,MAAK,EAAG,OAAON,EAAI,IAAKC,CAAC,GAGlCD,EAAI,aAAe,OACrBC,EAAE,OAAO,EAAE,EACXM,GAAmB,MAAK,EAAG,OAAOP,EAAI,YAAaC,CAAC,GAGlDD,EAAI,YAAc,OACpBC,EAAE,OAAO,EAAE,EACXO,GAAkB,MAAK,EAAG,OAAOR,EAAI,WAAYC,CAAC,GAGhDD,EAAI,QAAU,OAChBC,EAAE,OAAO,EAAE,EACXQ,GAAU,MAAK,EAAG,OAAOT,EAAI,OAAQC,CAAC,GAGpCD,EAAI,WAAa,OACnBC,EAAE,OAAO,EAAE,EACXS,GAAiB,MAAK,EAAG,OAAOV,EAAI,UAAWC,CAAC,GAG9CC,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CAAA,EAEXa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAON,EAAQ,KAAK,MAAK,EAAG,OAAOiB,CAAM,EAC7C,MACF,IAAK,GACHX,EAAI,QAAUG,GAAe,MAAK,EAAG,OAAOQ,EAAQA,EAAO,OAAM,CAAE,EACnE,MACF,IAAK,GACHX,EAAI,WAAaI,GAAkB,MAAK,EAAG,OAAOO,EAAQA,EAAO,OAAM,CAAE,EACzE,MACF,IAAK,GACHX,EAAI,cAAgBK,GAAqB,MAAK,EAAG,OAAOM,EAAQA,EAAO,OAAM,CAAE,EAC/E,MACF,IAAK,GACHX,EAAI,IAAMM,GAAW,MAAK,EAAG,OAAOK,EAAQA,EAAO,OAAM,CAAE,EAC3D,MACF,IAAK,GACHX,EAAI,YAAcO,GAAmB,MAAK,EAAG,OAAOI,EAAQA,EAAO,OAAM,CAAE,EAC3E,MACF,IAAK,GACHX,EAAI,WAAaQ,GAAkB,MAAK,EAAG,OAAOG,EAAQA,EAAO,OAAM,CAAE,EACzE,MACF,IAAK,GACHX,EAAI,OAASS,GAAU,MAAK,EAAG,OAAOE,EAAQA,EAAO,OAAM,CAAE,EAC7D,MACF,IAAK,GACHX,EAAI,UAAYU,GAAiB,MAAK,EAAG,OAAOC,EAAQA,EAAO,OAAM,CAAE,EACvE,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIJ,EAAA,OAAUM,GACde,EAAcf,EAAKN,EAAQ,MAAK,CAAE,EAG9BA,EAAA,OAAUsB,GACdC,EAAcD,EAAKtB,EAAQ,MAAK,CAAE,CAE7C,GAlJiBA,IAAAA,EAAO,CAAA,EAAA,EA+JlB,IAAWwB,GAAjB,SAAiBA,EAAQ,CACvB,IAAYvB,GAAZ,SAAYA,EAAI,CACdA,EAAA,GAAA,KACAA,EAAA,MAAA,OACF,GAHYA,EAAAuB,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAKhB,IAAKtB,GAAL,SAAKA,EAAY,CACfA,EAAAA,EAAA,GAAA,CAAA,EAAA,KACAA,EAAAA,EAAA,MAAA,CAAA,EAAA,OACF,GAHKA,IAAAA,EAAY,CAAA,EAAA,GAKjB,SAAiBD,EAAI,CACNA,EAAA,MAAQ,IACZE,GAAkBD,CAAY,CAEzC,GAJiBD,EAAAuB,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMrB,IAAIpB,EAESoB,EAAA,MAAQ,KACfpB,GAAU,OACZA,EAASC,EAAkB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CA8B/C,GA7BIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACViB,EAAS,KAAK,MAAK,EAAG,OAAOlB,EAAI,KAAMC,CAAC,GAGtCD,EAAI,OAAS,OACfC,EAAE,OAAO,EAAE,EACXkB,GAAc,MAAK,EAAG,OAAOnB,EAAI,MAAOC,CAAC,GAGvCD,EAAI,YAAc,OACpBC,EAAE,OAAO,EAAE,EACXmB,GAAW,MAAK,EAAG,OAAOpB,EAAI,WAAYC,CAAC,GAGzCD,EAAI,UAAY,OAClBC,EAAE,OAAO,EAAE,EACXoB,GAAiB,MAAK,EAAG,OAAOrB,EAAI,SAAUC,CAAC,GAG7CD,EAAI,KAAO,OACbC,EAAE,OAAO,EAAE,EACXqB,GAAY,MAAK,EAAG,OAAOtB,EAAI,IAAKC,CAAC,GAGnCD,EAAI,OAAS,KACf,QAAWuB,KAASvB,EAAI,MACtBC,EAAE,OAAO,EAAE,EACXuB,GAAS,MAAK,EAAG,OAAOD,EAAOtB,CAAC,EAIhCD,EAAI,QAAU,OAChBC,EAAE,OAAO,EAAE,EACXwB,GAAW,MAAK,EAAG,OAAOzB,EAAI,OAAQC,CAAC,GAGrCD,EAAI,WAAa,OACnBC,EAAE,OAAO,EAAE,EACXyB,GAAkB,MAAK,EAAG,OAAO1B,EAAI,UAAWC,CAAC,GAG/CC,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,MAAO,CAAA,GAGHa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOkB,EAAS,KAAK,MAAK,EAAG,OAAOP,CAAM,EAC9C,MACF,IAAK,GACHX,EAAI,MAAQmB,GAAc,MAAK,EAAG,OAAOR,EAAQA,EAAO,OAAM,CAAE,EAChE,MACF,IAAK,GACHX,EAAI,WAAaoB,GAAW,MAAK,EAAG,OAAOT,EAAQA,EAAO,OAAM,CAAE,EAClE,MACF,IAAK,GACHX,EAAI,SAAWqB,GAAiB,MAAK,EAAG,OAAOV,EAAQA,EAAO,OAAM,CAAE,EACtE,MACF,IAAK,GACHX,EAAI,IAAMsB,GAAY,MAAK,EAAG,OAAOX,EAAQA,EAAO,OAAM,CAAE,EAC5D,MACF,IAAK,GACHX,EAAI,MAAM,KAAKwB,GAAS,MAAK,EAAG,OAAOb,EAAQA,EAAO,OAAM,CAAE,CAAC,EAC/D,MACF,IAAK,GACHX,EAAI,OAASyB,GAAW,MAAK,EAAG,OAAOd,EAAQA,EAAO,OAAM,CAAE,EAC9D,MACF,IAAK,GACHX,EAAI,UAAY0B,GAAkB,MAAK,EAAG,OAAOf,EAAQA,EAAO,OAAM,CAAE,EACxE,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIoB,EAAA,OAAUlB,GACde,EAAcf,EAAKkB,EAAS,MAAK,CAAE,EAG/BA,EAAA,OAAUF,GACdC,EAAcD,EAAKE,EAAS,MAAK,CAAE,CAE9C,GA9HiBA,IAAAA,EAAQ,CAAA,EAAA,EAqInB,IAAWG,IAAjB,SAAiBA,EAAgB,CAC/B,IAAIvB,EAESuB,EAAA,MAAQ,KACfvB,GAAU,OACZA,EAASC,EAA0B,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAUvD,GATIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,IAAM,MAAQA,EAAI,GAAG,WAAa,IACzCC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,EAAE,GAGZA,EAAI,OAAS,KACf,QAAWuB,KAASvB,EAAI,MACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMsB,CAAK,EAIbrB,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,GAAI,IAAI,WAAW,CAAC,EACpB,MAAO,CAAA,GAGHa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,GAAKW,EAAO,MAAK,EACrB,MACF,IAAK,GACHX,EAAI,MAAM,KAAKW,EAAO,MAAK,CAAE,EAC7B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIuB,EAAA,OAAUrB,GACde,EAAcf,EAAKqB,EAAiB,MAAK,CAAE,EAGvCA,EAAA,OAAUL,GACdC,EAAcD,EAAKK,EAAiB,MAAK,CAAE,CAEtD,GA/DiBA,KAAAA,GAAgB,CAAA,EAAA,EAuE3B,IAAWlB,IAAjB,SAAiBA,EAAc,CAC7B,IAAIL,EAESK,EAAA,MAAQ,KACfL,GAAU,OACZA,EAASC,EAAwB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAUrD,GATIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,MAAQ,MAAQA,EAAI,KAAK,WAAa,IAC7CC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdA,EAAI,OAAS,KACf,QAAWuB,KAASvB,EAAI,MACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMsB,CAAK,EAIbvB,EAAI,SAAW,OACjBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,OAAO,GAGjBE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,KAAM,IAAI,WAAW,CAAC,EACtB,MAAO,CAAA,GAGHa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,MAAM,KAAKW,EAAO,MAAK,CAAE,EAC7B,MACF,IAAK,GACHX,EAAI,QAAUW,EAAO,MAAK,EAC1B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIK,EAAA,OAAUH,GACde,EAAcf,EAAKG,EAAe,MAAK,CAAE,EAGrCA,EAAA,OAAUa,GACdC,EAAcD,EAAKb,EAAe,MAAK,CAAE,CAEpD,GAvEiBA,KAAAA,GAAc,CAAA,EAAA,EA+EzB,IAAWC,IAAjB,SAAiBA,EAAiB,CAChC,IAAIN,EAESM,EAAA,MAAQ,KACfN,GAAU,OACZA,EAASC,EAA2B,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAUxD,GATIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,MAAQ,MAAQA,EAAI,KAAK,WAAa,IAC7CC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdA,EAAI,OAAS,KACf,QAAWuB,KAASvB,EAAI,MACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOsB,CAAK,EAIdvB,EAAI,SAAW,OACjBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,OAAO,GAGjBE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,KAAM,IAAI,WAAW,CAAC,EACtB,MAAO,CAAA,GAGHa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,MAAM,KAAKW,EAAO,OAAM,CAAE,EAC9B,MACF,IAAK,GACHX,EAAI,QAAUW,EAAO,MAAK,EAC1B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIM,EAAA,OAAUJ,GACde,EAAcf,EAAKI,EAAkB,MAAK,CAAE,EAGxCA,EAAA,OAAUY,GACdC,EAAcD,EAAKZ,EAAkB,MAAK,CAAE,CAEvD,GAvEiBA,KAAAA,GAAiB,CAAA,EAAA,EA8E5B,IAAWC,IAAjB,SAAiBA,EAAoB,CACnC,IAAIP,EAESO,EAAA,MAAQ,KACfP,GAAU,OACZA,EAASC,EAA8B,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAU3D,GATIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,MAAQ,MAAQA,EAAI,KAAK,WAAa,IAC7CC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdA,EAAI,OAAS,KACf,QAAWuB,KAASvB,EAAI,MACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOsB,CAAK,EAIdrB,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,KAAM,IAAI,WAAW,CAAC,EACtB,MAAO,CAAA,GAGHa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,MAAM,KAAKW,EAAO,OAAM,CAAE,EAC9B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIO,EAAA,OAAUL,GACde,EAAcf,EAAKK,EAAqB,MAAK,CAAE,EAG3CA,EAAA,OAAUW,GACdC,EAAcD,EAAKX,EAAqB,MAAK,CAAE,CAE1D,GA/DiBA,KAAAA,GAAoB,CAAA,EAAA,EAqE/B,IAAWc,IAAjB,SAAiBA,EAAa,CAC5B,IAAIrB,EAESqB,EAAA,MAAQ,KACfrB,GAAU,OACZA,EAASC,EAAuB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAChDA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,KAAO,MAAQA,EAAI,MAAQ,KAClCC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOD,EAAI,GAAG,GAGdE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,IAAK,IAGDa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,IAAMW,EAAO,OAAM,EACvB,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIqB,EAAA,OAAUnB,GACde,EAAcf,EAAKmB,EAAc,MAAK,CAAE,EAGpCA,EAAA,OAAUH,GACdC,EAAcD,EAAKG,EAAc,MAAK,CAAE,CAEnD,GApDiBA,KAAAA,GAAa,CAAA,EAAA,EA4DxB,IAAWC,IAAjB,SAAiBA,EAAU,CACzB,IAAItB,EAESsB,EAAA,MAAQ,KACftB,GAAU,OACZA,EAASC,EAAoB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAC7CA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,MAAQ,MAAQA,EAAI,KAAK,WAAa,IAC7CC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGbA,EAAI,MAAQ,MAAQA,EAAI,KAAK,WAAa,IAC7CC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGbA,EAAI,OAAS,MAAQA,EAAI,QAAU,KACtCC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOD,EAAI,KAAK,GAGhBE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,KAAM,IAAI,WAAW,CAAC,EACtB,KAAM,IAAI,WAAW,CAAC,EACtB,MAAO,IAGHa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,MAAQW,EAAO,OAAM,EACzB,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIsB,EAAA,OAAUpB,GACde,EAAcf,EAAKoB,EAAW,MAAK,CAAE,EAGjCA,EAAA,OAAUJ,GACdC,EAAcD,EAAKI,EAAW,MAAK,CAAE,CAEhD,GAtEiBA,KAAAA,GAAU,CAAA,EAAA,EAkFrB,IAAWd,IAAjB,SAAiBA,EAAU,CACzB,IAAYX,GAAZ,SAAYA,EAAI,CACdA,EAAA,UAAA,YACAA,EAAA,6BAAA,+BACAA,EAAA,eAAA,iBACAA,EAAA,kBAAA,oBACAA,EAAA,eAAA,iBACAA,EAAA,UAAA,YACAA,EAAA,aAAA,eACAA,EAAA,UAAA,YACAA,EAAA,QAAA,SACF,GAVYA,EAAAW,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAYhB,IAAKV,GAAL,SAAKA,EAAY,CACfA,EAAAA,EAAA,UAAA,CAAA,EAAA,YACAA,EAAAA,EAAA,6BAAA,CAAA,EAAA,+BACAA,EAAAA,EAAA,eAAA,CAAA,EAAA,iBACAA,EAAAA,EAAA,kBAAA,CAAA,EAAA,oBACAA,EAAAA,EAAA,eAAA,CAAA,EAAA,iBACAA,EAAAA,EAAA,UAAA,CAAA,EAAA,YACAA,EAAAA,EAAA,aAAA,CAAA,EAAA,eACAA,EAAAA,EAAA,UAAA,CAAA,EAAA,YACAA,EAAAA,EAAA,QAAA,CAAA,EAAA,SACF,GAVKA,IAAAA,EAAY,CAAA,EAAA,GAYjB,SAAiBD,EAAI,CACNA,EAAA,MAAQ,IACZE,GAAkBD,CAAY,CAEzC,GAJiBD,EAAAW,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMrB,IAAIR,EAESQ,EAAA,MAAQ,KACfR,GAAU,OACZA,EAASC,EAAoB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAC7CA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVK,EAAW,KAAK,MAAK,EAAG,OAAON,EAAI,KAAMC,CAAC,GAGxCD,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdA,EAAI,KAAO,OACbC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,GAAG,GAGbA,EAAI,KAAO,OACbC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,GAAG,GAGbA,EAAI,OAAS,OACfC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,KAAK,GAGfA,EAAI,OAAS,OACfC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,KAAK,GAGfA,EAAI,SAAW,OACjBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,OAAO,GAGjBE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CAAA,EAEXa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOM,EAAW,KAAK,MAAK,EAAG,OAAOK,CAAM,EAChD,MACF,IAAK,GACHX,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,IAAMW,EAAO,MAAK,EACtB,MACF,IAAK,GACHX,EAAI,IAAMW,EAAO,MAAK,EACtB,MACF,IAAK,GACHX,EAAI,MAAQW,EAAO,MAAK,EACxB,MACF,IAAK,GACHX,EAAI,MAAQW,EAAO,MAAK,EACxB,MACF,IAAK,GACHX,EAAI,QAAUW,EAAO,MAAK,EAC1B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIQ,EAAA,OAAUN,GACde,EAAcf,EAAKM,EAAW,MAAK,CAAE,EAGjCA,EAAA,OAAUU,GACdC,EAAcD,EAAKV,EAAW,MAAK,CAAE,CAEhD,GAhIiBA,KAAAA,GAAU,CAAA,EAAA,EAwIrB,IAAWgB,IAAjB,SAAiBA,EAAW,CAC1B,IAAY3B,GAAZ,SAAYA,EAAI,CACdA,EAAA,MAAA,QACAA,EAAA,MAAA,QACAA,EAAA,IAAA,KACF,GAJYA,EAAA2B,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMhB,IAAK1B,GAAL,SAAKA,EAAY,CACfA,EAAAA,EAAA,MAAA,CAAA,EAAA,QACAA,EAAAA,EAAA,MAAA,CAAA,EAAA,QACAA,EAAAA,EAAA,IAAA,CAAA,EAAA,KACF,GAJKA,IAAAA,EAAY,CAAA,EAAA,GAMjB,SAAiBD,EAAI,CACNA,EAAA,MAAQ,IACZE,GAAkBD,CAAY,CAEzC,GAJiBD,EAAA2B,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMrB,IAAIxB,EAESwB,EAAA,MAAQ,KACfxB,GAAU,OACZA,EAASC,EAAqB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAC9CA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVqB,EAAY,KAAK,MAAK,EAAG,OAAOtB,EAAI,KAAMC,CAAC,GAGzCD,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXuB,GAAS,MAAK,EAAG,OAAOxB,EAAI,KAAMC,CAAC,GAGjCD,EAAI,OAAS,OACfC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,KAAK,GAGfE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CAAA,EAEXa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOsB,EAAY,KAAK,MAAK,EAAG,OAAOX,CAAM,EACjD,MACF,IAAK,GACHX,EAAI,KAAOwB,GAAS,MAAK,EAAG,OAAOb,EAAQA,EAAO,OAAM,CAAE,EAC1D,MACF,IAAK,GACHX,EAAI,MAAQW,EAAO,MAAK,EACxB,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIwB,EAAA,OAAUtB,GACde,EAAcf,EAAKsB,EAAY,MAAK,CAAE,EAGlCA,EAAA,OAAUN,GACdC,EAAcD,EAAKM,EAAY,MAAK,CAAE,CAEjD,GApFiBA,KAAAA,GAAW,CAAA,EAAA,EA2FtB,IAAWE,IAAjB,SAAiBA,EAAQ,CACvB,IAAI1B,EAES0B,EAAA,MAAQ,KACf1B,GAAU,OACZA,EAASC,EAAkB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAU/C,GATIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,IAAM,MAAQA,EAAI,GAAG,WAAa,IACzCC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,EAAE,GAGZA,EAAI,OAAS,KACf,QAAWuB,KAASvB,EAAI,MACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMsB,CAAK,EAIbrB,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,GAAI,IAAI,WAAW,CAAC,EACpB,MAAO,CAAA,GAGHa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,GAAKW,EAAO,MAAK,EACrB,MACF,IAAK,GACHX,EAAI,MAAM,KAAKW,EAAO,MAAK,CAAE,EAC7B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGI0B,EAAA,OAAUxB,GACde,EAAcf,EAAKwB,EAAS,MAAK,CAAE,EAG/BA,EAAA,OAAUR,GACdC,EAAcD,EAAKQ,EAAS,MAAK,CAAE,CAE9C,GA/DiBA,KAAAA,GAAQ,CAAA,EAAA,EAwEnB,IAAWjB,IAAjB,SAAiBA,EAAkB,CACjC,IAAYZ,GAAZ,SAAYA,EAAI,CACdA,EAAA,SAAA,WACAA,EAAA,WAAA,aACAA,EAAA,KAAA,MACF,GAJYA,EAAAY,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMhB,IAAKX,GAAL,SAAKA,EAAY,CACfA,EAAAA,EAAA,SAAA,CAAA,EAAA,WACAA,EAAAA,EAAA,WAAA,CAAA,EAAA,aACAA,EAAAA,EAAA,KAAA,CAAA,EAAA,MACF,GAJKA,IAAAA,EAAY,CAAA,EAAA,GAMjB,SAAiBD,EAAI,CACNA,EAAA,MAAQ,IACZE,GAAkBD,CAAY,CAEzC,GAJiBD,EAAAY,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMrB,IAAIT,EAESS,EAAA,MAAQ,KACfT,GAAU,OACZA,EAASC,EAA4B,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CACrDA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVM,EAAmB,KAAK,MAAK,EAAG,OAAOP,EAAI,KAAMC,CAAC,GAGhDD,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdA,EAAI,KAAO,OACbC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOD,EAAI,GAAG,GAGdA,EAAI,QAAU,OAChBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,MAAM,GAGhBE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CAAA,EAEXa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOO,EAAmB,KAAK,MAAK,EAAG,OAAOI,CAAM,EACxD,MACF,IAAK,GACHX,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,IAAMW,EAAO,OAAM,EACvB,MACF,IAAK,GACHX,EAAI,OAASW,EAAO,MAAK,EACzB,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIS,EAAA,OAAUP,GACde,EAAcf,EAAKO,EAAmB,MAAK,CAAE,EAGzCA,EAAA,OAAUS,GACdC,EAAcD,EAAKT,EAAmB,MAAK,CAAE,CAExD,GA5FiBA,KAAAA,GAAkB,CAAA,EAAA,EAkG7B,IAAWC,IAAjB,SAAiBA,EAAiB,CAChC,IAAIV,EAESU,EAAA,MAAQ,KACfV,GAAU,OACZA,EAASC,EAA2B,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CACpDA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGHD,EAAI,MAAQ,MAAQA,EAAI,KAAK,WAAa,IAC7CC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,KAAM,IAAI,WAAW,CAAC,GAGlBa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIU,EAAA,OAAUR,GACde,EAAcf,EAAKQ,EAAkB,MAAK,CAAE,EAGxCA,EAAA,OAAUQ,GACdC,EAAcD,EAAKR,EAAkB,MAAK,CAAE,CAEvD,GApDiBA,KAAAA,GAAiB,CAAA,EAAA,EA4D5B,IAAWC,IAAjB,SAAiBA,EAAS,CACxB,IAAYd,GAAZ,SAAYA,EAAI,CACdA,EAAA,WAAA,aACAA,EAAA,WAAA,aACAA,EAAA,QAAA,UACAA,EAAA,UAAA,WACF,GALYA,EAAAc,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAOhB,IAAKb,GAAL,SAAKA,EAAY,CACfA,EAAAA,EAAA,WAAA,CAAA,EAAA,aACAA,EAAAA,EAAA,WAAA,CAAA,EAAA,aACAA,EAAAA,EAAA,QAAA,CAAA,EAAA,UACAA,EAAAA,EAAA,UAAA,CAAA,EAAA,WACF,GALKA,IAAAA,EAAY,CAAA,EAAA,GAOjB,SAAiBD,EAAI,CACNA,EAAA,MAAQ,IACZE,GAAkBD,CAAY,CAEzC,GAJiBD,EAAAc,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMrB,IAAIX,EAESW,EAAA,MAAQ,KACfX,GAAU,OACZA,EAASC,EAAmB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAC5CA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVQ,EAAU,KAAK,MAAK,EAAG,OAAOT,EAAI,KAAMC,CAAC,GAGvCD,EAAI,OAAS,OACfC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOD,EAAI,KAAK,GAGhBA,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CAAA,EAEXa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOS,EAAU,KAAK,MAAK,EAAG,OAAOE,CAAM,EAC/C,MACF,IAAK,GACHX,EAAI,MAAQW,EAAO,OAAM,EACzB,MACF,IAAK,GACHX,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIW,EAAA,OAAUT,GACde,EAAcf,EAAKS,EAAU,MAAK,CAAE,EAGhCA,EAAA,OAAUO,GACdC,EAAcD,EAAKP,EAAU,MAAK,CAAE,CAE/C,GAtFiBA,KAAAA,GAAS,CAAA,EAAA,EAiGpB,IAAWkB,IAAjB,SAAiBA,EAAS,CACxB,IAAI7B,EAES6B,EAAA,MAAQ,KACf7B,GAAU,OACZA,EAASC,EAAmB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAoBhD,GAnBIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdA,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdA,EAAI,OAAS,OACfC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,KAAK,GAGfA,EAAI,UAAY,KAClB,QAAWuB,KAASvB,EAAI,SACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOsB,CAAK,EAIdvB,EAAI,WAAa,OACnBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,SAAS,GAGnBA,EAAI,KAAO,OACbC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,GAAG,GAGbE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,SAAU,CAAA,GAGNa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,KAAOW,EAAO,MAAK,EACvB,MACF,IAAK,GACHX,EAAI,MAAQW,EAAO,MAAK,EACxB,MACF,IAAK,GACHX,EAAI,SAAS,KAAKW,EAAO,OAAM,CAAE,EACjC,MACF,IAAK,GACHX,EAAI,UAAYW,EAAO,MAAK,EAC5B,MACF,IAAK,GACHX,EAAI,IAAMW,EAAO,MAAK,EACtB,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGI6B,EAAA,OAAU3B,GACde,EAAcf,EAAK2B,EAAU,MAAK,CAAE,EAGhCA,EAAA,OAAUX,GACdC,EAAcD,EAAKW,EAAU,MAAK,CAAE,CAE/C,GA9FiBA,KAAAA,GAAS,CAAA,EAAA,EAqGpB,IAAWF,IAAjB,SAAiBA,EAAU,CACzB,IAAI3B,EAES2B,EAAA,MAAQ,KACf3B,GAAU,OACZA,EAASC,EAAoB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAKjD,GAJIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,QAAU,KAChB,QAAWuB,KAASvB,EAAI,OACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOsB,CAAK,EAIlB,GAAIvB,EAAI,SAAW,KACjB,QAAWuB,KAASvB,EAAI,QACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMsB,CAAK,EAIbrB,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,OAAQ,CAAA,EACR,QAAS,CAAA,GAGLa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,OAAO,KAAKW,EAAO,OAAM,CAAE,EAC/B,MACF,IAAK,GACHX,EAAI,QAAQ,KAAKW,EAAO,MAAK,CAAE,EAC/B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGI2B,EAAA,OAAUzB,GACde,EAAcf,EAAKyB,EAAW,MAAK,CAAE,EAGjCA,EAAA,OAAUT,GACdC,EAAcD,EAAKS,EAAW,MAAK,CAAE,CAEhD,GAjEiBA,KAAAA,GAAU,CAAA,EAAA,EAyErB,IAAWf,IAAjB,SAAiBA,EAAgB,CAC/B,IAAYf,GAAZ,SAAYA,EAAI,CACdA,EAAA,YAAA,cACAA,EAAA,cAAA,gBACAA,EAAA,cAAA,eACF,GAJYA,EAAAe,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMhB,IAAKd,GAAL,SAAKA,EAAY,CACfA,EAAAA,EAAA,YAAA,CAAA,EAAA,cACAA,EAAAA,EAAA,cAAA,CAAA,EAAA,gBACAA,EAAAA,EAAA,cAAA,CAAA,EAAA,eACF,GAJKA,IAAAA,EAAY,CAAA,EAAA,GAMjB,SAAiBD,EAAI,CACNA,EAAA,MAAQ,IACZE,GAAkBD,CAAY,CAEzC,GAJiBD,EAAAe,EAAA,OAAAA,EAAA,KAAI,CAAA,EAAA,EAMrB,IAAIZ,EAESY,EAAA,MAAQ,KACfZ,GAAU,OACZA,EAASC,EAA0B,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAevD,GAdIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVS,EAAiB,KAAK,MAAK,EAAG,OAAOV,EAAI,KAAMC,CAAC,GAG9CD,EAAI,IAAM,OACZC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,EAAE,GAGZA,EAAI,QAAU,KAChB,QAAWuB,KAASvB,EAAI,OACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOsB,CAAK,EAIdrB,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,OAAQ,CAAA,GAGJa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOU,EAAiB,KAAK,MAAK,EAAG,OAAOC,CAAM,EACtD,MACF,IAAK,GACHX,EAAI,GAAKW,EAAO,MAAK,EACrB,MACF,IAAK,GACHX,EAAI,OAAO,KAAKW,EAAO,OAAM,CAAE,EAC/B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGIY,EAAA,OAAUV,GACde,EAAcf,EAAKU,EAAiB,MAAK,CAAE,EAGvCA,EAAA,OAAUM,GACdC,EAAcD,EAAKN,EAAiB,MAAK,CAAE,CAEtD,GAxFiBA,KAAAA,GAAgB,CAAA,EAAA,EA+F3B,IAAWgB,IAAjB,SAAiBA,EAAiB,CAChC,IAAI5B,EAES4B,EAAA,MAAQ,KACf5B,GAAU,OACZA,EAASC,EAA2B,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAUxD,GATIA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXuB,GAAS,MAAK,EAAG,OAAOxB,EAAI,KAAMC,CAAC,GAGjCD,EAAI,QAAU,KAChB,QAAWuB,KAASvB,EAAI,OACtBC,EAAE,OAAO,EAAE,EACXA,EAAE,OAAOsB,CAAK,EAIdrB,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACU,EAAQC,IAAU,CACpB,IAAMZ,EAAW,CACf,OAAQ,CAAA,GAGJa,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GACHd,EAAI,KAAOwB,GAAS,MAAK,EAAG,OAAOb,EAAQA,EAAO,OAAM,CAAE,EAC1D,MACF,IAAK,GACHX,EAAI,OAAO,KAAKW,EAAO,OAAM,CAAE,EAC/B,MACF,QACEA,EAAO,SAASG,EAAM,CAAC,EACvB,KACJ,CACF,CAEA,OAAOd,CACT,CAAC,GAGIF,GAGI4B,EAAA,OAAU1B,GACde,EAAcf,EAAK0B,EAAkB,MAAK,CAAE,EAGxCA,EAAA,OAAUV,GACdC,EAAcD,EAAKU,EAAkB,MAAK,CAAE,CAEvD,GA9DiBA,KAAAA,GAAiB,CAAA,EAAA,ECzhD5B,SAAUE,GAAWC,EAA8C,CACvE,IAAMC,EAAa,IAAI,WAAW,gBAElC,SAASC,GAAO,CACdD,EAAW,MAAK,EAEhB,QAAWE,KAAUH,EACfG,GAAQ,qBAAuB,MACjCA,EAAO,oBAAoB,QAASD,CAAO,CAGjD,CAEA,QAAWC,KAAUH,EAAS,CAC5B,GAAIG,GAAQ,UAAY,GAAM,CAC5BD,EAAO,EACP,MAGEC,GAAQ,kBAAoB,MAC9BA,EAAO,iBAAiB,QAASD,CAAO,EAI5C,SAASE,GAAK,CACZ,QAAWD,KAAUH,EACfG,GAAQ,qBAAuB,MACjCA,EAAO,oBAAoB,QAASD,CAAO,CAGjD,CAEA,IAAMC,EAASF,EAAW,OAC1B,OAAAE,EAAO,MAAQC,EAERD,CACT,CCtCM,IAAOE,GAAP,KAA0B,CACb,aAEjB,YAAaC,EAAsB,CACjC,KAAK,aAAeA,CACtB,CAEA,MAAM,eAAgBC,EAA2B,CAC/C,KAAK,eAAeA,CAAM,CAC5B,CAEA,MAAM,gBAAiBA,EAA2B,CAEhD,OAAOA,CACT,CAEA,yBAA0BC,EAAmB,CAC3C,OAAOC,GAAU,CAACD,CAAM,CAAC,CAC3B,CAEA,iBAAe,CACb,OAAO,IAAI,GACb,CAEA,yBAAuB,CACrB,OAAO,IAAI,GACb,GC5BI,IAAOE,GAAP,cAA0B,KAAK,CACnC,OAAO,KAAO,aAEd,YAAaC,EAAkB,4BAA2B,CACxD,MAAMA,CAAO,EACb,KAAK,KAAO,YACd,GA8BI,IAAOC,EAAP,cAAsC,KAAK,CAC/C,OAAO,KAAO,yBAEd,YAAaC,EAAU,qBAAoB,CACzC,MAAMA,CAAO,EACb,KAAK,KAAO,wBACd,GAMWC,GAAP,cAAqC,KAAK,CAC9C,OAAO,KAAO,wBAEd,YAAaD,EAAU,qBAAoB,CACzC,MAAMA,CAAO,EACb,KAAK,KAAO,uBACd,GA0GI,IAAOE,GAAP,cAAgC,KAAK,CACzC,OAAO,KAAO,mBAEd,YAAaC,EAAU,4BAA2B,CAChD,MAAMA,CAAO,EACb,KAAK,KAAO,kBACd,GAkBI,IAAOC,GAAP,cAAgC,KAAK,CACzC,OAAO,KAAO,mBAEd,YAAaC,EAAU,oCAAmC,CACxD,MAAMA,CAAO,EACb,KAAK,KAAO,kBACd,GAMWC,GAAP,cAAiC,KAAK,CAC1C,OAAO,KAAO,oBAEd,YAAaD,EAAU,6BAA4B,CACjD,MAAMA,CAAO,EACb,KAAK,KAAO,mBACd,GAsDI,IAAOE,GAAP,cAAqC,KAAK,CAC9C,OAAO,KAAO,wBAEd,YAAaC,EAAU,oBAAmB,CACxC,MAAMA,CAAO,EACb,KAAK,KAAO,uBACd,GAkBI,IAAOC,GAAP,cAAmC,KAAK,CAC5C,OAAO,KAAO,sBAEd,YAAaC,EAAU,kBAAiB,CACtC,MAAMA,CAAO,EACb,KAAK,KAAO,qBACd,GAOWC,GAAP,cAA6B,KAAK,CACtC,OAAO,KAAO,gBAEd,YAAaD,EAAU,iBAAgB,CACrC,MAAMA,CAAO,EACb,KAAK,KAAO,eACd,GAMWE,GAAP,cAA4B,KAAK,CACrC,OAAO,KAAO,eAEd,YAAaF,EAAU,YAAW,CAChC,MAAMA,CAAO,EACb,KAAK,KAAO,cACd,GAOWG,GAAP,cAA+B,KAAK,CACxC,OAAO,KAAO,kBAEd,YAAaH,EAAU,cAAa,CAClC,MAAMA,CAAO,EACb,KAAK,KAAO,iBACd,GAMWI,GAAP,cAAmC,KAAK,CAC5C,OAAO,KAAO,sBAEd,YAAaJ,EAAU,kBAAiB,CACtC,MAAMA,CAAO,EACb,KAAK,KAAO,qBACd,GAoEI,IAAOK,GAAP,cAAuC,KAAK,CAChD,OAAO,KAAO,0BAEd,YAAaC,EAAU,uBAAsB,CAC3C,MAAMA,CAAO,EACb,KAAK,KAAO,yBACd,GCzZI,IAAOC,GAAP,cAAkC,KAAK,CACpC,KAEP,YAAaC,EAAmCC,EAAyB,CACvE,MAAM,UAAWA,CAAa,EAE9B,KAAK,KAAOD,CACd,GAQWE,GAAP,cAAgC,KAAK,CAClC,MACA,MAEP,YAAaC,EAAiBC,EAAeH,EAAyB,CACpE,MAAM,QAASA,CAAa,EAE5B,KAAK,MAAQG,EACb,KAAK,MAAQD,CACf,GAGWE,GAAP,cAAgCH,EAAgB,CACpD,YAAaE,EAAcH,EAAyB,CAClD,MAAM,GAAMG,EAAOH,CAAa,CAClC,GAGWK,GAAP,cAAgCJ,EAAgB,CACpD,YAAaE,EAAcH,EAAyB,CAClD,MAAM,GAAOG,EAAOH,CAAa,CACnC,GCiHK,IAAMM,GAAe,OAAO,IAAI,iBAAiB,EAKlD,SAAUC,GAAUC,EAAW,CACnC,MAAO,EAAQA,IAAQF,EAAY,CACrC,CCjHO,IAAMG,GAAkB,OAAO,IAAI,mBAAmB,EAwE7D,IAAYC,IAAZ,SAAYA,EAAc,CAIxBA,EAAAA,EAAA,UAAA,CAAA,EAAA,YAKAA,EAAAA,EAAA,SAAA,CAAA,EAAA,UACF,GAVYA,KAAAA,GAAc,CAAA,EAAA,ECzH1B,IAAAC,GAAuD,kBAK1CC,GAA8C,CAACC,KAAMC,IAAgB,CAChF,GAAI,IACF,GAAAC,iBAAoBF,EAAG,GAAGC,CAAY,CACxC,MAAQ,CAER,CACF,ECkFM,IAAOE,GAAP,cAAuE,WAAW,CAC7EC,GAAa,IAAI,IAE1B,aAAA,CACE,MAAK,EAILC,GAAgB,IAAU,IAAI,CAChC,CAEA,cAAeC,EAAY,CACzB,IAAMC,EAAY,KAAKH,GAAW,IAAIE,CAAI,EAE1C,OAAIC,GAAa,KACR,EAGFA,EAAU,MACnB,CAGA,iBAAkBD,EAAcE,EAA+BC,EAA2C,CACxG,MAAM,iBAAiBH,EAAME,EAAUC,CAAO,EAE9C,IAAIC,EAAO,KAAKN,GAAW,IAAIE,CAAI,EAE/BI,GAAQ,OACVA,EAAO,CAAA,EACP,KAAKN,GAAW,IAAIE,EAAMI,CAAI,GAGhCA,EAAK,KAAK,CACR,SAAUF,EACV,MAAOC,IAAY,IAAQA,IAAY,IAASA,GAAS,OAAS,GACnE,CACH,CAGA,oBAAqBH,EAAcE,EAAgCC,EAAwC,CACzG,MAAM,oBAAoBH,EAAK,SAAQ,EAAIE,GAAY,KAAMC,CAAO,EAEpE,IAAIC,EAAO,KAAKN,GAAW,IAAIE,CAAI,EAE/BI,GAAQ,OAIZA,EAAOA,EAAK,OAAO,CAAC,CAAE,SAAAC,CAAQ,IAAOA,IAAaH,CAAQ,EAC1D,KAAKJ,GAAW,IAAIE,EAAMI,CAAI,EAChC,CAEA,cAAeE,EAAY,CACzB,IAAMC,EAAS,MAAM,cAAcD,CAAK,EAEpCF,EAAO,KAAKN,GAAW,IAAIQ,EAAM,IAAI,EAEzC,OAAIF,GAAQ,OAIZA,EAAOA,EAAK,OAAO,CAAC,CAAE,KAAAI,CAAI,IAAO,CAACA,CAAI,EACtC,KAAKV,GAAW,IAAIQ,EAAM,KAAMF,CAAI,GAE7BG,CACT,CAEA,kBAA0BP,EAAsBS,EAAkC,CAAA,EAAE,CAClF,OAAO,KAAK,cAAc,IAAI,YAAoBT,EAAgBS,CAAM,CAAC,CAC3E,GCsuBK,IAAMC,GAAsB,OAAO,IAAI,8BAA8B,EAS/DC,GAAsB,OAAO,IAAI,8BAA8B,ECj4B5E,IAAAC,GAAgB,qBAChBC,GAAiB,sBCgCjB,SAAgBC,GACdC,EACAC,EACiB,CACjB,GAAI,OAAOC,GAAU,SACnB,OAAOC,GAAMD,CAAA,EAAM,GACV,OAAOA,GAAU,SAC1B,OAAOE,GAAOF,EAAOG,CAAA,EAEvB,MAAU,MACR,4DAA4D,KAAK,UAAUH,CAAA,CAAM,EAAE,CAEtF,CAED,IAAAI,GAAeP,GASf,SAAgBI,GAAMI,EAAqB,CACzC,GAAI,OAAOR,GAAQ,UAAYA,EAAI,SAAW,GAAKA,EAAI,OAAS,IAC9D,MAAU,MACR,qFAAqF,KAAK,UAAUA,CAAA,CAAI,EAAE,EAG9G,IAAMO,EACJ,wJAAwJ,KACtJP,CAAA,EAGJ,GAAI,CAACO,GAAO,OACV,MAAO,KAKT,GAAM,CAAE,MAAAH,EAAO,KAAAK,EAAO,IAAA,EAASF,EAAM,OAK/BG,EAAI,WAAWN,CAAA,EAEfO,EAAYF,EAAK,YAAA,EAGvB,OAAQE,EAAR,CACE,IAAK,QACL,IAAK,OACL,IAAK,MACL,IAAK,KACL,IAAK,IACH,OAAOD,EAAI,SACb,IAAK,SACL,IAAK,QACL,IAAK,KACH,OAAOA,EAAI,QACb,IAAK,QACL,IAAK,OACL,IAAK,IACH,OAAOA,EAAI,OACb,IAAK,OACL,IAAK,MACL,IAAK,IACH,OAAOA,EAAI,MACb,IAAK,QACL,IAAK,OACL,IAAK,MACL,IAAK,KACL,IAAK,IACH,OAAOA,EAAI,KACb,IAAK,UACL,IAAK,SACL,IAAK,OACL,IAAK,MACL,IAAK,IACH,OAAOA,EAAI,IACb,IAAK,UACL,IAAK,SACL,IAAK,OACL,IAAK,MACL,IAAK,IACH,OAAOA,EAAI,IACb,IAAK,eACL,IAAK,cACL,IAAK,QACL,IAAK,OACL,IAAK,KACH,OAAOA,EACT,QAEE,MAAU,MACR,iBAAiBC,CAAA,mCAA4C,KAAK,UAAUX,CAAA,CAAI,EAAE,CAEvF,CACF,CAgBD,SAASY,GAASC,EAAyB,CACzC,IAAMC,EAAQ,KAAK,IAAIC,CAAAA,EAsBvB,OArBID,GAAS,SACJ,GAAG,KAAK,MAAMC,EAAK,QAAA,CAAE,IAE1BD,GAAS,QACJ,GAAG,KAAK,MAAMC,EAAK,OAAA,CAAG,KAE3BD,GAAS,OACJ,GAAG,KAAK,MAAMC,EAAK,MAAA,CAAE,IAE1BD,GAAS,MACJ,GAAG,KAAK,MAAMC,EAAK,KAAA,CAAE,IAE1BD,GAAS,KACJ,GAAG,KAAK,MAAMC,EAAK,IAAA,CAAE,IAE1BD,GAAS,IACJ,GAAG,KAAK,MAAMC,EAAK,GAAA,CAAE,IAE1BD,GAAS,IACJ,GAAG,KAAK,MAAMC,EAAK,GAAA,CAAE,IAEvB,GAAGA,CAAAA,IACX,CAKD,SAASC,GAAQH,EAAyB,CACxC,IAAMC,EAAQ,KAAK,IAAIC,CAAAA,EAsBvB,OArBID,GAAS,SACJG,GAAOF,EAAID,EAAO,SAAG,MAAA,EAE1BA,GAAS,QACJG,GAAOF,EAAID,EAAO,QAAI,OAAA,EAE3BA,GAAS,OACJG,GAAOF,EAAID,EAAO,OAAG,MAAA,EAE1BA,GAAS,MACJG,GAAOF,EAAID,EAAO,MAAG,KAAA,EAE1BA,GAAS,KACJG,GAAOF,EAAID,EAAO,KAAG,MAAA,EAE1BA,GAAS,IACJG,GAAOF,EAAID,EAAO,IAAG,QAAA,EAE1BA,GAAS,IACJG,GAAOF,EAAID,EAAO,IAAG,QAAA,EAEvB,GAAGC,CAAAA,KACX,CASD,SAAgBG,GAAOL,EAAYM,EAA2B,CAC5D,GAAI,OAAOJ,GAAO,UAAY,CAAC,OAAO,SAASA,CAAAA,EAC7C,MAAU,MAAM,uDAAA,EAGlB,OAAOK,GAAS,KAAOJ,GAAQD,CAAAA,EAAMH,GAASG,CAAAA,CAC/C,CAKD,SAASE,GACPJ,EACAQ,EACAC,EACAC,EACa,CACb,IAAMC,EAAWJ,GAASK,EAAI,IAC9B,MAAO,GAAG,KAAK,MAAMV,EAAKU,CAAA,CAAE,IAAIC,CAAA,GAAOF,EAAW,IAAM,EAAA,EACzD,CCrPD,IAAAG,GAAoB,yBACpBC,GAAe,oBACfC,GAAgB,qBAIhB,SAASC,GAAQC,EAAMC,EAAO,WAAW,KAAO,WAAW,KAAK,KAAO,GAAAC,QAAQ,KAAM,CACpF,IAAMC,EAASH,EAAK,WAAW,GAAG,EAAI,GAAMA,EAAK,SAAW,EAAI,IAAM,KAChEI,EAAWH,EAAK,QAAQE,EAASH,CAAI,EACrCK,EAAqBJ,EAAK,QAAQ,IAAI,EAC5C,OAAOG,IAAa,KAAOC,IAAuB,IAAMD,EAAWC,EACpE,CAEA,GAAM,CAAC,IAAAC,CAAG,EAAI,GAAAJ,QAEVK,GAEHR,GAAQ,UAAU,GACfA,GAAQ,WAAW,GACnBA,GAAQ,aAAa,GACrBA,GAAQ,aAAa,EAExBQ,GAAiB,GAEjBR,GAAQ,OAAO,GACZA,GAAQ,QAAQ,GAChBA,GAAQ,YAAY,GACpBA,GAAQ,cAAc,KAEzBQ,GAAiB,GAGlB,SAASC,IAAgB,CACxB,GAAI,EAAE,gBAAiBF,GACtB,OAGD,GAAIA,EAAI,cAAgB,OACvB,MAAO,GAGR,GAAIA,EAAI,cAAgB,QACvB,MAAO,GAGR,GAAIA,EAAI,YAAY,SAAW,EAC9B,MAAO,GAGR,IAAMG,EAAQ,KAAK,IAAI,OAAO,SAASH,EAAI,YAAa,EAAE,EAAG,CAAC,EAE9D,GAAK,CAAC,EAAG,EAAG,EAAG,CAAC,EAAE,SAASG,CAAK,EAIhC,OAAOA,CACR,CAEA,SAASC,GAAeD,EAAO,CAC9B,OAAIA,IAAU,EACN,GAGD,CACN,MAAAA,EACA,SAAU,GACV,OAAQA,GAAS,EACjB,OAAQA,GAAS,CAClB,CACD,CAEA,SAASE,GAAeC,EAAY,CAAC,YAAAC,EAAa,WAAAC,EAAa,EAAI,EAAI,CAAC,EAAG,CAC1E,IAAMC,EAAmBP,GAAc,EACnCO,IAAqB,SACxBR,GAAiBQ,GAGlB,IAAMC,EAAaF,EAAaP,GAAiBQ,EAEjD,GAAIC,IAAe,EAClB,MAAO,GAGR,GAAIF,EAAY,CACf,GAAIf,GAAQ,WAAW,GACnBA,GAAQ,YAAY,GACpBA,GAAQ,iBAAiB,EAC5B,MAAO,GAGR,GAAIA,GAAQ,WAAW,EACtB,MAAO,EAET,CAIA,GAAI,aAAcO,GAAO,eAAgBA,EACxC,MAAO,GAGR,GAAIM,GAAc,CAACC,GAAeG,IAAe,OAChD,MAAO,GAGR,IAAMC,EAAMD,GAAc,EAE1B,GAAIV,EAAI,OAAS,OAChB,OAAOW,EAGR,GAAI,GAAAf,QAAQ,WAAa,QAAS,CAGjC,IAAMgB,EAAY,GAAAC,QAAG,QAAQ,EAAE,MAAM,GAAG,EACxC,OACC,OAAOD,EAAU,CAAC,CAAC,GAAK,IACrB,OAAOA,EAAU,CAAC,CAAC,GAAK,MAEpB,OAAOA,EAAU,CAAC,CAAC,GAAK,MAAS,EAAI,EAGtC,CACR,CAEA,GAAI,OAAQZ,EACX,MAAI,CAAC,iBAAkB,gBAAiB,UAAU,EAAE,KAAKc,GAAOA,KAAOd,CAAG,EAClE,EAGJ,CAAC,SAAU,WAAY,YAAa,YAAa,OAAO,EAAE,KAAKe,GAAQA,KAAQf,CAAG,GAAKA,EAAI,UAAY,WACnG,EAGDW,EAGR,GAAI,qBAAsBX,EACzB,MAAO,gCAAgC,KAAKA,EAAI,gBAAgB,EAAI,EAAI,EAezE,GAZIA,EAAI,YAAc,aAIlBA,EAAI,OAAS,eAIbA,EAAI,OAAS,iBAIbA,EAAI,OAAS,UAChB,MAAO,GAGR,GAAI,iBAAkBA,EAAK,CAC1B,IAAMgB,EAAU,OAAO,UAAUhB,EAAI,sBAAwB,IAAI,MAAM,GAAG,EAAE,CAAC,EAAG,EAAE,EAElF,OAAQA,EAAI,aAAc,CACzB,IAAK,YACJ,OAAOgB,GAAW,EAAI,EAAI,EAG3B,IAAK,iBACJ,MAAO,EAGT,CACD,CAEA,MAAI,iBAAiB,KAAKhB,EAAI,IAAI,EAC1B,EAGJ,8DAA8D,KAAKA,EAAI,IAAI,GAI3E,cAAeA,EACX,EAGDW,CACR,CAEO,SAASM,GAAoBC,EAAQC,EAAU,CAAC,EAAG,CACzD,IAAMhB,EAAQE,GAAea,EAAQ,CACpC,YAAaA,GAAUA,EAAO,MAC9B,GAAGC,CACJ,CAAC,EAED,OAAOf,GAAeD,CAAK,CAC5B,CAEA,IAAMiB,GAAgB,CACrB,OAAQH,GAAoB,CAAC,MAAO,GAAAI,QAAI,OAAO,CAAC,CAAC,CAAC,EAClD,OAAQJ,GAAoB,CAAC,MAAO,GAAAI,QAAI,OAAO,CAAC,CAAC,CAAC,CACnD,EAEOC,GAAQF,GChMD,SAAPG,GAAwBC,EAAQ,CACrCC,EAAY,MAAQA,EACpBA,EAAY,QAAUA,EACtBA,EAAY,OAASC,EACrBD,EAAY,QAAUE,EACtBF,EAAY,OAASG,EACrBH,EAAY,QAAUI,EACtBJ,EAAY,SAAWK,GACvBL,EAAY,QAAUM,EAEtB,OAAO,KAAKP,CAAG,EAAE,QAAQQ,GAAM,CAE7BP,EAAYO,CAAG,EAAIR,EAAIQ,CAAG,CAC5B,CAAC,EAMDP,EAAY,MAAQ,CAAA,EACpBA,EAAY,MAAQ,CAAA,EAOpBA,EAAY,WAAa,CAAA,EAQzB,SAASQ,EAAaC,EAAiB,CACrC,IAAIC,EAAO,EAEX,QAASC,EAAI,EAAGA,EAAIF,EAAU,OAAQE,IACpCD,GAASA,GAAQ,GAAKA,EAAQD,EAAU,WAAWE,CAAC,EACpDD,GAAQ,EAIV,OAAOV,EAAY,OAAO,KAAK,IAAIU,CAAI,EAAIV,EAAY,OAAO,MAAM,CACtE,CACAA,EAAY,YAAcQ,EAQ1B,SAASR,EAAaS,EAAiB,CACrC,IAAIG,EACAC,EAAsB,KACtBC,EACAC,EAEJ,SAASC,KAAUC,EAAW,CAG5B,GAAI,CAACD,EAAM,QACT,OAGF,IAAME,EAAYF,EAGZG,EAAO,OAAO,IAAI,IAAM,EACxBC,EAAKD,GAAQP,GAAYO,GAC/BD,EAAK,KAAOE,EACZF,EAAK,KAAON,EACZM,EAAK,KAAOC,EACZP,EAAWO,EAEXF,EAAK,CAAC,EAAIjB,EAAY,OAAOiB,EAAK,CAAC,CAAC,EAEhC,OAAOA,EAAK,CAAC,GAAM,UAErBA,EAAK,QAAQ,IAAI,EAInB,IAAII,EAAQ,EACZJ,EAAK,CAAC,EAAIA,EAAK,CAAC,EAAE,QAAQ,gBAAiB,CAACK,GAAYC,KAAoB,CAE1E,GAAID,KAAU,KACZ,MAAO,IAETD,IAEA,IAAMG,GAAYxB,EAAY,WAAWuB,EAAM,EAC/C,GAAI,OAAOC,IAAc,WAAY,CACnC,IAAMC,EAAMR,EAAKI,CAAK,EACtBC,GAAQE,GAAU,KAAKN,EAAMO,CAAG,EAGhCR,EAAK,OAAOI,EAAO,CAAC,EACpBA,GACF,CACA,OAAOC,EACT,CAAC,EAIDtB,EAAY,WAAW,KAAKkB,EAAMD,CAAI,GAGxBC,EAAK,KAAOlB,EAAY,KAChC,MAAMkB,EAAMD,CAAI,CACxB,CAEA,OAAAD,EAAM,UAAYP,EAElBO,EAAM,UAAYhB,EAAY,UAAS,EACvCgB,EAAM,MAAQhB,EAAY,YAAYS,CAAS,EAC/CO,EAAM,OAASU,EACfV,EAAM,QAAUhB,EAAY,QAE5B,OAAO,eAAegB,EAAO,UAAW,CACtC,WAAY,GACZ,aAAc,GACd,IAAK,IACCH,IAAmB,KACdA,GAGLC,IAAoBd,EAAY,aAElCc,EAAkBd,EAAY,WAC9Be,EAAef,EAAY,QAAQS,CAAS,GAGvCM,GAET,IAAKY,GAAI,CACPd,EAAiBc,CACnB,EACD,EAIG,OAAO3B,EAAY,MAAS,YAE9BA,EAAY,KAAKgB,CAAK,EAIjBA,CACT,CAEA,SAASU,EAAmBjB,EAAmBmB,EAAiB,CAC9D,IAAMC,EAAW7B,EAAY,KAAK,WAAa,OAAO4B,EAAc,IAAc,IAAMA,GAAanB,CAAS,EAC9G,OAAAoB,EAAS,IAAM,KAAK,IACbA,CACT,CAQA,SAAS1B,EAAQ2B,EAAkB,CAEjC9B,EAAY,KAAK8B,CAAU,EAE3B9B,EAAY,WAAa8B,EAEzB9B,EAAY,MAAQ,CAAA,EACpBA,EAAY,MAAQ,CAAA,EAEpB,IAAIW,EACEoB,GAAS,OAAOD,GAAe,SAAWA,EAAa,IAAI,MAAM,QAAQ,EACzEE,EAAMD,EAAM,OAElB,IAAKpB,EAAI,EAAGA,EAAIqB,EAAKrB,IACdoB,EAAMpB,CAAC,IAKZmB,EAAaC,EAAMpB,CAAC,EAAE,QAAQ,MAAO,KAAK,EAEtCmB,EAAW,CAAC,IAAM,IACpB9B,EAAY,MAAM,KAAK,IAAI,OAAO,IAAM8B,EAAW,OAAO,CAAC,EAAI,GAAG,CAAC,EAEnE9B,EAAY,MAAM,KAAK,IAAI,OAAO,IAAM8B,EAAa,GAAG,CAAC,EAG/D,CAOA,SAAS5B,GAAO,CACd,IAAM4B,EAAa,CACjB,GAAG9B,EAAY,MAAM,IAAIiC,CAAW,EACpC,GAAGjC,EAAY,MAAM,IAAIiC,CAAW,EAAE,IAAIxB,GAAa,IAAMA,CAAS,GACtE,KAAK,GAAG,EACV,OAAAT,EAAY,OAAO,EAAE,EACd8B,CACT,CAQA,SAAS1B,EAAS8B,EAAY,CAC5B,GAAIA,EAAKA,EAAK,OAAS,CAAC,IAAM,IAC5B,MAAO,GAGT,IAAIvB,EACAqB,EAEJ,IAAKrB,EAAI,EAAGqB,EAAMhC,EAAY,MAAM,OAAQW,EAAIqB,EAAKrB,IACnD,GAAIX,EAAY,MAAMW,CAAC,EAAE,KAAKuB,CAAI,EAChC,MAAO,GAIX,IAAKvB,EAAI,EAAGqB,EAAMhC,EAAY,MAAM,OAAQW,EAAIqB,EAAKrB,IACnD,GAAIX,EAAY,MAAMW,CAAC,EAAE,KAAKuB,CAAI,EAChC,MAAO,GAIX,MAAO,EACT,CAKA,SAASD,EAAaE,EAAc,CAClC,OAAOA,EAAO,SAAQ,EACnB,UAAU,EAAGA,EAAO,SAAQ,EAAG,OAAS,CAAC,EACzC,QAAQ,UAAW,GAAG,CAC3B,CAKA,SAASlC,EAAQwB,EAAQ,CACvB,OAAIA,aAAe,MACVA,EAAI,OAASA,EAAI,QAEnBA,CACT,CAMA,SAASnB,GAAO,CACd,QAAQ,KAAK,uIAAuI,CACtJ,CAGA,OAAAN,EAAY,gBAAgBA,EAAY,UAAU,EAGlDA,EAAY,OAAOA,EAAY,KAAI,CAAE,EAG9BA,CACT,CH3PA,IAAIoC,GAAS,CAAC,EAAG,EAAG,EAAG,EAAG,EAAG,CAAC,EAE1BC,GAAc,SAAW,KAAUA,GAAc,QAAUA,IAAe,OAAS,IACrFD,GAAS,CACP,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,MAUJ,IAAME,GAAc,OAAO,KAAK,QAAQ,GAAG,EAAE,OAAOC,GAC3C,WAAW,KAAKA,CAAG,CAC3B,EAAE,OAA4B,CAACC,EAAKD,IAAO,CAE1C,IAAME,EAAOF,EACV,UAAU,CAAC,EACX,YAAW,EACX,QAAQ,YAAa,CAACG,EAAGC,IACjBA,EAAE,YAAW,CACrB,EAGCC,EAAW,QAAQ,IAAIL,CAAG,EAC9B,MAAI,2BAA2B,KAAKK,CAAG,EACrCA,EAAM,GACG,6BAA6B,KAAKA,CAAG,EAC9CA,EAAM,GACGA,IAAQ,OACjBA,EAAM,KAENA,EAAM,OAAOA,CAAG,EAGlBJ,EAAIC,CAAI,EAAIG,EACLJ,CACT,EAAG,CAAA,CAAE,EAML,SAASK,IAAS,CAChB,MAAO,WAAYP,GACf,EAAQA,GAAY,OACpB,GAAAQ,QAAI,OAAO,QAAQ,OAAO,EAAE,CAClC,CAKA,SAASC,GAAuBC,EAAW,CACzC,GAAM,CACJ,UAAWC,EAAM,UAAAJ,CAAS,EACxB,KAEJ,GAAIA,IAAc,GAAM,CACtB,IAAMK,EAAI,KAAK,MACTC,EAAY,UAAcD,EAAI,EAAIA,EAAI,OAASA,GAC/CE,EAAS,KAAKD,CAAS,MAAMF,CAAI,WAEvCD,EAAK,CAAC,EAAII,EAASJ,EAAK,CAAC,EAAE,MAAM;CAAI,EAAE,KAAK;EAAOI,CAAM,EACzDJ,EAAK,KAAKG,EAAY,KAAOD,GAAS,KAAK,IAAI,EAAI,SAAW,CAChE,MACEF,EAAK,CAAC,EAAIK,GAAO,EAAKJ,EAAO,IAAMD,EAAK,CAAC,CAE7C,CAEA,SAASK,IAAO,CACd,OAAIf,GAAY,UAAY,KACnB,GAEF,IAAI,KAAI,EAAG,YAAW,EAAK,GACpC,CAKA,SAASgB,MAAQN,EAAW,CAC1B,OAAO,QAAQ,OAAO,MAAM,GAAAO,QAAK,OAAO,GAAGP,CAAI,EAAI;CAAI,CACzD,CAOA,SAASQ,GAAMC,EAAkB,CAC3BA,GAAc,KAChB,QAAQ,IAAI,MAAQA,EAIpB,OAAO,QAAQ,IAAI,KAEvB,CAOA,SAASC,IAAI,CACX,OAAO,QAAQ,IAAI,KACrB,CASA,SAASC,GAAMC,EAAU,CACvBA,EAAM,YAAc,CAAA,EAEpB,IAAMC,EAAO,OAAO,KAAKvB,EAAW,EACpC,QAASwB,EAAI,EAAGA,EAAID,EAAK,OAAQC,IAC/BF,EAAM,YAAYC,EAAKC,CAAC,CAAC,EAAIxB,GAAYuB,EAAKC,CAAC,CAAC,CAEpD,CAEA,SAASC,GAAiBC,EAAe,CAIvCA,EAAW,EAAI,SAAUC,EAAM,CAC7B,YAAK,YAAY,OAAS,KAAK,UACxB,GAAAV,QAAK,QAAQU,EAAG,KAAK,WAAW,EACpC,MAAM;CAAI,EACV,IAAIC,GAAOA,EAAI,KAAI,CAAE,EACrB,KAAK,GAAG,CACb,EAKAF,EAAW,EAAI,SAAUC,EAAM,CAC7B,YAAK,YAAY,OAAS,KAAK,UACxB,GAAAV,QAAK,QAAQU,EAAG,KAAK,WAAW,CACzC,CACF,CAEA,IAAAE,GAAeC,GAAM,CAAE,KAAAT,GAAM,IAAAL,GAAK,WAAAP,GAAY,KAAAS,GAAM,KAAAE,GAAM,UAAAb,GAAW,gBAAAkB,GAAiB,OAAA3B,GAAQ,YAAAE,EAAW,CAAE,EInM3G,IAAA+B,GAAeC,GCXfC,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcC,GAAU,WAAWD,CAAC,EAIzDD,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcE,GAAO,WAAWF,CAAC,EAItDD,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcG,GAAO,WAAWH,CAAC,EAItDD,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcA,EAAE,SAAQ,EAI7CD,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcA,EAAE,SAAQ,EAI7CD,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcA,EAAE,SAAQ,EAI7CD,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcA,EAAE,SAAQ,EAI7CD,GAAM,WAAW,EAAKC,GACbA,GAAK,KAAO,YAAcI,GAASJ,EAAE,KAAK,GAAKI,GAASJ,EAAE,OAAO,GAAKA,EAAE,SAAQ,EAKzF,SAASK,GAAsBC,EAAiB,CAC9C,IAAMC,EAAS,IAAW,CAAE,EAC5B,OAAAA,EAAO,QAAU,GACjBA,EAAO,MAAQ,GACfA,EAAO,KAAO,EACdA,EAAO,IAAM,IAAW,CAAE,EAC1BA,EAAO,UAAYD,EACnBC,EAAO,QAAU,IAAM,GACvBA,EAAO,OAAS,IAAMA,EAEfA,CACT,CAqEM,SAAUC,IAAa,CAC3B,MAAO,CACL,aAAcC,EAAY,CACxB,OAAOC,GAAOD,CAAI,CACpB,EAEJ,CAeM,SAAUC,GAAQD,EAAY,CAElC,IAAIE,EAAwBC,GAAqB,GAAGH,CAAI,QAAQ,EAGhE,OAAII,GAAM,QAAQ,GAAGJ,CAAI,QAAQ,GAAKI,GAAM,MAAM,IAAKC,GAAWA,EAAE,SAAQ,CAAE,EAAE,KAAMC,GAAcA,EAAE,SAAS,QAAQ,CAAC,GAAK,OAC3HJ,EAAQE,GAAM,GAAGJ,CAAI,QAAQ,GAGxB,OAAO,OAAOI,GAAMJ,CAAI,EAAG,CAChC,MAAOI,GAAM,GAAGJ,CAAI,QAAQ,EAC5B,MAAAE,EACA,SAAWK,GAAkBN,GAAO,GAAGD,CAAI,IAAIO,CAAK,EAAE,EACvD,CACH,CAcA,SAASC,GAAUC,EAAY,CAC7B,GAAIA,GAAO,OAIXA,EAAMA,EAAI,KAAI,EAEVA,EAAI,SAAW,GAInB,OAAOA,CACT,CChOM,SAAUC,GAAQC,EAAeC,EAAa,CAClD,GAAID,IAAMC,EACR,MAAO,GAGT,GAAID,EAAE,aAAeC,EAAE,WACrB,MAAO,GAGT,QAASC,EAAI,EAAGA,EAAIF,EAAE,WAAYE,IAChC,GAAIF,EAAEE,CAAC,IAAMD,EAAEC,CAAC,EACd,MAAO,GAIX,MAAO,EACT,CCnBA,IAAAC,GAAuB,kBAMjB,SAAUC,GAAQC,EAAsBC,EAAe,CAC3D,OAAOC,GAAa,UAAO,OAAOF,EAAQC,CAAM,CAAC,CACnD,CC8EA,IAAME,GAAS,OAAO,IAAI,6BAA6B,EAIvD,SAASC,GAAkBC,EAAoBC,EAAa,CAC1D,GAAIA,GAAS,MAAQA,EAAQ,EAC3B,MAAM,IAAI,WAAW,wBAAwB,EAG/C,IAAIC,EAAS,EAEb,QAAWC,KAAOH,EAAM,CACtB,IAAMI,EAASF,EAASC,EAAI,WAE5B,GAAIF,EAAQG,EACV,MAAO,CACL,IAAAD,EACA,MAAOF,EAAQC,GAInBA,EAASE,CACX,CAEA,MAAM,IAAI,WAAW,wBAAwB,CAC/C,CAeM,SAAUC,GAAkBC,EAAU,CAC1C,MAAO,EAAQA,IAAQR,EAAM,CAC/B,CAEM,IAAOS,GAAP,MAAOC,CAAc,CACjB,KACD,OACS,CAACV,EAAM,EAAI,GAE3B,eAAgBW,EAAkB,CAChC,KAAK,KAAO,CAAA,EACZ,KAAK,OAAS,EAEVA,EAAK,OAAS,GAChB,KAAK,UAAUA,CAAI,CAEvB,CAEA,EAAG,OAAO,QAAQ,GAAC,CACjB,MAAQ,KAAK,IACf,CAEA,IAAI,YAAU,CACZ,OAAO,KAAK,MACd,CAKA,UAAWT,EAAkB,CAC3B,KAAK,UAAUA,CAAI,CACrB,CAKA,UAAWA,EAAkB,CAC3B,IAAIU,EAAS,EAEb,QAAWP,KAAOH,EAChB,GAAIG,aAAe,WACjBO,GAAUP,EAAI,WACd,KAAK,KAAK,KAAKA,CAAG,UACTE,GAAiBF,CAAG,EAC7BO,GAAUP,EAAI,WACd,KAAK,KAAK,KAAK,GAAGA,EAAI,IAAI,MAE1B,OAAM,IAAI,MAAM,mEAAmE,EAIvF,KAAK,QAAUO,CACjB,CAKA,WAAYV,EAAkB,CAC5B,KAAK,WAAWA,CAAI,CACtB,CAKA,WAAYA,EAAkB,CAC5B,IAAIU,EAAS,EAEb,QAAWP,KAAOH,EAAK,QAAO,EAC5B,GAAIG,aAAe,WACjBO,GAAUP,EAAI,WACd,KAAK,KAAK,QAAQA,CAAG,UACZE,GAAiBF,CAAG,EAC7BO,GAAUP,EAAI,WACd,KAAK,KAAK,QAAQ,GAAGA,EAAI,IAAI,MAE7B,OAAM,IAAI,MAAM,oEAAoE,EAIxF,KAAK,QAAUO,CACjB,CAKA,IAAKT,EAAa,CAChB,IAAMU,EAAMZ,GAAiB,KAAK,KAAME,CAAK,EAE7C,OAAOU,EAAI,IAAIA,EAAI,KAAK,CAC1B,CAKA,IAAKV,EAAeK,EAAa,CAC/B,IAAMK,EAAMZ,GAAiB,KAAK,KAAME,CAAK,EAE7CU,EAAI,IAAIA,EAAI,KAAK,EAAIL,CACvB,CAKA,MAAOH,EAAiBD,EAAiB,EAAC,CACxC,GAAIC,aAAe,WACjB,QAASS,EAAI,EAAGA,EAAIT,EAAI,OAAQS,IAC9B,KAAK,IAAIV,EAASU,EAAGT,EAAIS,CAAC,CAAC,UAEpBP,GAAiBF,CAAG,EAC7B,QAASS,EAAI,EAAGA,EAAIT,EAAI,OAAQS,IAC9B,KAAK,IAAIV,EAASU,EAAGT,EAAI,IAAIS,CAAC,CAAC,MAGjC,OAAM,IAAI,MAAM,kEAAkE,CAEtF,CAKA,QAASC,EAAa,CAKpB,GAHAA,EAAQ,KAAK,MAAMA,CAAK,EAGpB,SAAO,MAAMA,CAAK,GAAKA,GAAS,GAKpC,IAAIA,IAAU,KAAK,WAAY,CAC7B,KAAK,KAAO,CAAA,EACZ,KAAK,OAAS,EACd,MACF,CAEA,KAAO,KAAK,KAAK,OAAS,GACxB,GAAIA,GAAS,KAAK,KAAK,CAAC,EAAE,WACxBA,GAAS,KAAK,KAAK,CAAC,EAAE,WACtB,KAAK,QAAU,KAAK,KAAK,CAAC,EAAE,WAC5B,KAAK,KAAK,MAAK,MACV,CACL,KAAK,KAAK,CAAC,EAAI,KAAK,KAAK,CAAC,EAAE,SAASA,CAAK,EAC1C,KAAK,QAAUA,EACf,KACF,EAEJ,CAQA,MAAOC,EAAyBC,EAAqB,CACnD,GAAM,CAAE,KAAAf,EAAM,OAAAU,CAAM,EAAK,KAAK,SAASI,EAAgBC,CAAY,EAEnE,OAAOC,GAAOhB,EAAMU,CAAM,CAC5B,CAQA,SAAUI,EAAyBC,EAAqB,CACtD,GAAM,CAAE,KAAAf,EAAM,OAAAU,CAAM,EAAK,KAAK,SAASI,EAAgBC,CAAY,EAEnE,OAAIf,EAAK,SAAW,EACXA,EAAK,CAAC,EAGRgB,GAAOhB,EAAMU,CAAM,CAC5B,CAOA,QAASI,EAAyBC,EAAqB,CACrD,GAAM,CAAE,KAAAf,EAAM,OAAAU,CAAM,EAAK,KAAK,SAASI,EAAgBC,CAAY,EAE7DE,EAAO,IAAIT,EACjB,OAAAS,EAAK,OAASP,EAEdO,EAAK,KAAO,CAAC,GAAGjB,CAAI,EAEbiB,CACT,CAEQ,SAAUH,EAAyBC,EAAqB,CAY9D,GAXAD,EAAiBA,GAAkB,EACnCC,EAAeA,GAAgB,KAAK,OAEhCD,EAAiB,IACnBA,EAAiB,KAAK,OAASA,GAG7BC,EAAe,IACjBA,EAAe,KAAK,OAASA,GAG3BD,EAAiB,GAAKC,EAAe,KAAK,OAC5C,MAAM,IAAI,WAAW,wBAAwB,EAG/C,GAAID,IAAmBC,EACrB,MAAO,CAAE,KAAM,CAAA,EAAI,OAAQ,CAAC,EAG9B,GAAID,IAAmB,GAAKC,IAAiB,KAAK,OAChD,MAAO,CAAE,KAAM,KAAK,KAAM,OAAQ,KAAK,MAAM,EAG/C,IAAMf,EAAqB,CAAA,EACvBE,EAAS,EAEb,QAASU,EAAI,EAAGA,EAAI,KAAK,KAAK,OAAQA,IAAK,CACzC,IAAMT,EAAM,KAAK,KAAKS,CAAC,EACjBM,EAAWhB,EACXE,EAASc,EAAWf,EAAI,WAK9B,GAFAD,EAASE,EAELU,GAAkBV,EAEpB,SAGF,IAAMe,EAAkBL,GAAkBI,GAAYJ,EAAiBV,EACjEgB,EAAiBL,EAAeG,GAAYH,GAAgBX,EAElE,GAAIe,GAAmBC,EAAgB,CAErC,GAAIN,IAAmBI,GAAYH,IAAiBX,EAAQ,CAE1DJ,EAAK,KAAKG,CAAG,EACb,KACF,CAGA,IAAMkB,EAAQP,EAAiBI,EAC/BlB,EAAK,KAAKG,EAAI,SAASkB,EAAOA,GAASN,EAAeD,EAAe,CAAC,EACtE,KACF,CAEA,GAAIK,EAAiB,CAEnB,GAAIL,IAAmB,EAAG,CAExBd,EAAK,KAAKG,CAAG,EACb,QACF,CAGAH,EAAK,KAAKG,EAAI,SAASW,EAAiBI,CAAQ,CAAC,EACjD,QACF,CAEA,GAAIE,EAAgB,CAClB,GAAIL,IAAiBX,EAAQ,CAE3BJ,EAAK,KAAKG,CAAG,EACb,KACF,CAGAH,EAAK,KAAKG,EAAI,SAAS,EAAGY,EAAeG,CAAQ,CAAC,EAClD,KACF,CAGAlB,EAAK,KAAKG,CAAG,CACf,CAEA,MAAO,CAAE,KAAAH,EAAM,OAAQe,EAAeD,CAAc,CACtD,CAEA,QAASQ,EAAqCpB,EAAiB,EAAC,CAC9D,GAAI,CAACG,GAAiBiB,CAAM,GAAK,EAAEA,aAAkB,YACnD,MAAM,IAAI,UAAU,6DAA6D,EAGnF,IAAMC,EAASD,aAAkB,WAAaA,EAASA,EAAO,SAAQ,EAgBtE,GAdApB,EAAS,OAAOA,GAAU,CAAC,EAEvB,MAAMA,CAAM,IACdA,EAAS,GAGPA,EAAS,IACXA,EAAS,KAAK,OAASA,GAGrBA,EAAS,IACXA,EAAS,GAGPoB,EAAO,SAAW,EACpB,OAAOpB,EAAS,KAAK,OAAS,KAAK,OAASA,EAI9C,IAAMsB,EAAYD,EAAO,WAEzB,GAAIC,IAAM,EACR,MAAM,IAAI,UAAU,qCAAqC,EAI3D,IAAMC,EAAgB,IAChBC,EAAiC,IAAI,WAAWD,CAAK,EAG3D,QAASE,EAAY,EAAGA,EAAIF,EAAOE,IAEjCD,EAAmBC,CAAC,EAAI,GAG1B,QAASC,EAAI,EAAGA,EAAIJ,EAAGI,IAErBF,EAAmBH,EAAOK,CAAC,CAAC,EAAIA,EAIlC,IAAMC,EAAQH,EACRI,EAAY,KAAK,WAAaP,EAAO,WACrCQ,EAAeR,EAAO,WAAa,EACrCS,EAEJ,QAASpB,EAAIV,EAAQU,GAAKkB,EAAWlB,GAAKoB,EAAM,CAC9CA,EAAO,EAEP,QAASJ,EAAIG,EAAcH,GAAK,EAAGA,IAAK,CACtC,IAAMK,EAAe,KAAK,IAAIrB,EAAIgB,CAAC,EAEnC,GAAIL,EAAOK,CAAC,IAAMK,EAAM,CACtBD,EAAO,KAAK,IAAI,EAAGJ,EAAIC,EAAMI,CAAI,CAAC,EAClC,KACF,CACF,CAEA,GAAID,IAAS,EACX,OAAOpB,CAEX,CAEA,MAAO,EACT,CAEA,QAASsB,EAAkB,CACzB,IAAM/B,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,QAAQ,CAAC,CACvB,CAEA,QAAS+B,EAAoB5B,EAAa,CACxC,IAAMH,EAAMgC,GAAY,CAAC,EACZ,IAAI,SAAShC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,QAAQ,EAAGG,CAAK,EAErB,KAAK,MAAMH,EAAK+B,CAAU,CAC5B,CAEA,SAAUA,EAAoBE,EAAsB,CAClD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,SAAS,EAAGiC,CAAY,CACtC,CAEA,SAAUF,EAAoB5B,EAAe8B,EAAsB,CACjE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,SAAS,EAAGG,EAAO8B,CAAY,EAEpC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,SAAUA,EAAoBE,EAAsB,CAClD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,SAAS,EAAGiC,CAAY,CACtC,CAEA,SAAUF,EAAoB5B,EAAe8B,EAAsB,CACjE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,SAAS,EAAGG,EAAO8B,CAAY,EAEpC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,YAAaA,EAAoBE,EAAsB,CACrD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,YAAY,EAAGiC,CAAY,CACzC,CAEA,YAAaF,EAAoB5B,EAAe8B,EAAsB,CACpE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,YAAY,EAAGG,EAAO8B,CAAY,EAEvC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,SAAUA,EAAkB,CAC1B,IAAM/B,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,SAAS,CAAC,CACxB,CAEA,SAAU+B,EAAoB5B,EAAa,CACzC,IAAMH,EAAMgC,GAAY,CAAC,EACZ,IAAI,SAAShC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,SAAS,EAAGG,CAAK,EAEtB,KAAK,MAAMH,EAAK+B,CAAU,CAC5B,CAEA,UAAWA,EAAoBE,EAAsB,CACnD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,UAAU,EAAGiC,CAAY,CACvC,CAEA,UAAWF,EAAoB5B,EAAe8B,EAAsB,CAClE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,UAAU,EAAGG,EAAO8B,CAAY,EAErC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,UAAWA,EAAoBE,EAAsB,CACnD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,UAAU,EAAGiC,CAAY,CACvC,CAEA,UAAWF,EAAoB5B,EAAe8B,EAAsB,CAClE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,UAAU,EAAGG,EAAO8B,CAAY,EAErC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,aAAcA,EAAoBE,EAAsB,CACtD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,aAAa,EAAGiC,CAAY,CAC1C,CAEA,aAAcF,EAAoB5B,EAAe8B,EAAsB,CACrE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,aAAa,EAAGG,EAAO8B,CAAY,EAExC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,WAAYA,EAAoBE,EAAsB,CACpD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,WAAW,EAAGiC,CAAY,CACxC,CAEA,WAAYF,EAAoB5B,EAAe8B,EAAsB,CACnE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,WAAW,EAAGG,EAAO8B,CAAY,EAEtC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,WAAYA,EAAoBE,EAAsB,CACpD,IAAMjC,EAAM,KAAK,SAAS+B,EAAYA,EAAa,CAAC,EAGpD,OAFa,IAAI,SAAS/B,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAExD,WAAW,EAAGiC,CAAY,CACxC,CAEA,WAAYF,EAAoB5B,EAAe8B,EAAsB,CACnE,IAAMjC,EAAMkC,GAAM,CAAC,EACN,IAAI,SAASlC,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,EAC/D,WAAW,EAAGG,EAAO8B,CAAY,EAEtC,KAAK,MAAMjC,EAAK+B,CAAU,CAC5B,CAEA,OAAQI,EAAU,CAShB,GARIA,GAAS,MAIT,EAAEA,aAAiB9B,IAInB8B,EAAM,KAAK,SAAW,KAAK,KAAK,OAClC,MAAO,GAGT,QAAS1B,EAAI,EAAGA,EAAI,KAAK,KAAK,OAAQA,IACpC,GAAI,CAAC2B,GAAO,KAAK,KAAK3B,CAAC,EAAG0B,EAAM,KAAK1B,CAAC,CAAC,EACrC,MAAO,GAIX,MAAO,EACT,CAMA,OAAO,gBAAiBZ,EAAoBU,EAAe,CACzD,IAAMO,EAAO,IAAIT,EACjB,OAAAS,EAAK,KAAOjB,EAERU,GAAU,OACZA,EAASV,EAAK,OAAO,CAACwC,EAAKC,IAASD,EAAMC,EAAK,WAAY,CAAC,GAG9DxB,EAAK,OAASP,EAEPO,CACT,GC5pBF,IAAAyB,GAAuB,kBAYjB,SAAUC,GAAUC,EAAmBC,EAA+B,OAAM,CAChF,IAAMC,EAAOC,GAAMF,CAAQ,EAE3B,GAAIC,GAAQ,KACV,MAAM,IAAI,MAAM,yBAAyBD,CAAQ,GAAG,EAGtD,OAAIA,IAAa,QAAUA,IAAa,QAC/B,UAAO,KAAKD,EAAM,OAAQA,EAAM,WAAYA,EAAM,UAAU,EAAE,SAAS,MAAM,EAI/EE,EAAK,QAAQ,OAAOF,CAAK,EAAE,UAAU,CAAC,CAC/C,CCnBA,IAAMI,GAAW,SAAS,QAAS,CAAC,EAC9BC,GAAmB,SAAS,WAAY,CAAC,EACzCC,GAAyB,SAAS,WAAY,CAAC,EAM/CC,GAAoC,CACxC,EAAKC,GACL,EAAKA,GACL,EAAKC,GACL,EAAKC,GACL,EAAKC,GACL,EAAKC,GACL,EAAKC,GACL,GAAML,GACN,GAAMA,GACN,GAAMA,IAGF,SAAUM,GAAWC,EAAiBC,EAAmB,CAAE,OAAQ,CAAC,EAAE,CAC1E,IAAMC,EAAMF,EAAIC,EAAQ,MAAM,EAAIZ,GAGlC,GAFAY,EAAQ,SAEJT,GAASU,CAAG,GAAK,KACnB,OAAOV,GAASU,CAAG,EAAEF,EAAKC,CAAO,EAGnC,MAAM,IAAI,MAAM,sBAAwBC,CAAG,CAC7C,CAEA,SAASC,GAAYH,EAAiBC,EAAgB,CACpD,IAAIG,EAAS,EAEb,IAAKJ,EAAIC,EAAQ,MAAM,EAAIX,MAAsBA,GAAkB,CAEjE,IAAMe,EAAQL,EAAIC,EAAQ,MAAM,EAAIV,GAChCe,EAAM,KACVL,EAAQ,SAER,QAASM,EAAI,EAAGA,EAAIF,EAAOE,IAAKN,EAAQ,SACtCK,GAAON,EAAIC,EAAQ,MAAM,EAAE,SAAS,EAAE,EAAE,SAAS,EAAG,GAAG,EAGzDG,EAAS,SAASE,EAAK,EAAE,CAC3B,MACEF,EAASJ,EAAIC,EAAQ,MAAM,EAC3BA,EAAQ,SAGV,OAAOG,CACT,CAEA,SAASX,GAAcO,EAAiBC,EAAgB,CACtDE,GAAWH,EAAKC,CAAO,EACvB,IAAMO,EAAiB,CAAA,EAEvB,KACM,EAAAP,EAAQ,QAAUD,EAAI,aADf,CAKX,IAAMS,EAASV,GAAUC,EAAKC,CAAO,EAErC,GAAIQ,IAAW,KACb,MAGFD,EAAQ,KAAKC,CAAM,CACrB,CAEA,OAAOD,CACT,CAEA,SAASd,GAAaM,EAAiBC,EAAgB,CACrD,IAAMG,EAASD,GAAWH,EAAKC,CAAO,EAChCS,EAAQT,EAAQ,OAChBU,EAAMV,EAAQ,OAASG,EAEvBQ,EAAiB,CAAA,EAEvB,QAAS,EAAIF,EAAO,EAAIC,EAAK,IACvB,IAAMD,GAASV,EAAI,CAAC,IAAM,GAI9BY,EAAK,KAAKZ,EAAI,CAAC,CAAC,EAGlB,OAAAC,EAAQ,QAAUG,EAEX,WAAW,KAAKQ,CAAI,CAC7B,CAEA,SAASd,GAAsBE,EAAiBC,EAAgB,CAC9D,IAAMI,EAAQF,GAAWH,EAAKC,CAAO,EAC/BY,EAAcZ,EAAQ,OAASI,EAE/BS,EAAOd,EAAIC,EAAQ,MAAM,EAC/BA,EAAQ,SAER,IAAIc,EAAO,EACPC,EAAO,EAEPF,EAAO,IACTC,EAAO,EACPC,EAAOF,GACEA,EAAO,IAChBC,EAAO,EACPC,EAAOF,EAAO,KAEdC,EAAO,EACPC,EAAOF,EAAO,IAGhB,IAAIG,EAAM,GAAGF,CAAI,IAAIC,CAAI,GACrBE,EAAgB,CAAA,EAEpB,KAAOjB,EAAQ,OAASY,GAAa,CACnC,IAAMC,EAAOd,EAAIC,EAAQ,MAAM,EAM/B,GALAA,EAAQ,SAGRiB,EAAI,KAAKJ,EAAO,GAAU,EAEtBA,EAAO,IAAK,CACdI,EAAI,QAAO,EAGX,IAAIC,EAAM,EAEV,QAASZ,EAAI,EAAGA,EAAIW,EAAI,OAAQX,IAC9BY,GAAOD,EAAIX,CAAC,GAAMA,EAAI,EAGxBU,GAAO,IAAIE,CAAG,GACdD,EAAM,CAAA,CACR,CACF,CAEA,OAAOD,CACT,CAEA,SAASpB,GAAUG,EAAiBC,EAAgB,CAClD,OAAAA,EAAQ,SAED,IACT,CAEA,SAASN,GAAeK,EAAiBC,EAAgB,CACvD,IAAMG,EAASD,GAAWH,EAAKC,CAAO,EAChCmB,EAAapB,EAAIC,EAAQ,MAAM,EACrCA,EAAQ,SACR,IAAMoB,EAAQrB,EAAI,SAASC,EAAQ,OAAQA,EAAQ,OAASG,EAAS,CAAC,EAGtE,GAFAH,EAAQ,QAAUG,EAEdgB,IAAe,EAEjB,MAAM,IAAI,MAAM,4CAA4C,EAG9D,OAAOC,CACT,CAEA,SAASzB,GAAiBI,EAAiBC,EAAgB,CACzD,IAAMG,EAASD,GAAWH,EAAKC,CAAO,EAChCoB,EAAQrB,EAAI,SAASC,EAAQ,OAAQA,EAAQ,OAASG,CAAM,EAClE,OAAAH,EAAQ,QAAUG,EAEXiB,CACT,CAEA,SAASC,GAAcC,EAAa,CAClC,IAAIC,EAASD,EAAM,SAAS,EAAE,EAE1BC,EAAO,OAAS,IAAM,IACxBA,EAAS,IAAMA,GAGjB,IAAMC,EAAQ,IAAIC,GAElB,QAASnB,EAAI,EAAGA,EAAIiB,EAAO,OAAQjB,GAAK,EACtCkB,EAAM,OAAO,WAAW,KAAK,CAAC,SAAS,GAAGD,EAAOjB,CAAC,CAAC,GAAGiB,EAAOjB,EAAI,CAAC,CAAC,GAAI,EAAE,CAAC,CAAC,CAAC,EAG9E,OAAOkB,CACT,CAEA,SAASE,GAAcN,EAA6B,CAClD,GAAIA,EAAM,WAAa,IACrB,OAAO,WAAW,KAAK,CAACA,EAAM,UAAU,CAAC,EAI3C,IAAMjB,EAASkB,GAAaD,EAAM,UAAU,EAE5C,OAAO,IAAIK,GACT,WAAW,KAAK,CACdtB,EAAO,WAAad,GACrB,EACDc,CAAM,CAEV,CAEM,SAAUwB,GAAeL,EAAkC,CAC/D,IAAMM,EAAW,IAAIH,GAEfI,EAAO,IAGb,OAFkBP,EAAM,SAAQ,EAAG,CAAC,EAAIO,KAAUA,GAGhDD,EAAS,OAAO,WAAW,KAAK,CAAC,CAAC,CAAC,CAAC,EAGtCA,EAAS,OAAON,CAAK,EAEd,IAAIG,GACT,WAAW,KAAK,CAAC,CAAI,CAAC,EACtBC,GAAaE,CAAQ,EACrBA,CAAQ,CAEZ,CAEM,SAAUE,GAAiBR,EAAkC,CAEjE,IAAMH,EAAa,WAAW,KAAK,CAAC,CAAC,CAAC,EAEhCS,EAAW,IAAIH,GACnBN,EACAG,CAAK,EAGP,OAAO,IAAIG,GACT,WAAW,KAAK,CAAC,CAAI,CAAC,EACtBC,GAAaE,CAAQ,EACrBA,CAAQ,CAEZ,CAUM,SAAUG,GAAgBC,EAA4CC,EAAM,GAAI,CACpF,IAAMC,EAAS,IAAIC,GAEnB,QAAWC,KAAOJ,EAChBE,EAAO,OACLE,CAAG,EAIP,OAAO,IAAID,GACT,WAAW,KAAK,CAACF,CAAG,CAAC,EACrBI,GAAaH,CAAM,EACnBA,CAAM,CAEV,CCpOA,eAAsBI,GAAeC,EAAiBC,EAAiBC,EAAkCC,EAAsB,CAC7H,IAAMC,EAAY,MAAM,OAAO,OAAO,UAAU,MAAOJ,EAAK,CAC1D,KAAM,QACN,WAAYA,EAAI,KAAO,SACtB,GAAO,CAAC,QAAQ,CAAC,EACpBG,GAAS,QAAQ,eAAc,EAE/B,IAAME,EAAS,MAAM,OAAO,OAAO,OAAO,CACxC,KAAM,QACN,KAAM,CACJ,KAAM,YAEPD,EAAWH,EAAKC,EAAI,SAAQ,CAAE,EACjC,OAAAC,GAAS,QAAQ,eAAc,EAExBE,CACT,CC7CA,IAAMC,GAAU,WAAW,KAAK,CAAC,EAAM,EAAM,GAAM,IAAM,GAAM,IAAM,GAAM,EAAM,EAAM,CAAI,CAAC,EAEtFC,GAAU,WAAW,KAAK,CAAC,EAAM,EAAM,GAAM,IAAM,EAAM,EAAM,EAAI,CAAC,EAEpEC,GAAU,WAAW,KAAK,CAAC,EAAM,EAAM,GAAM,IAAM,EAAM,EAAM,EAAI,CAAC,EAEpEC,GAAgB,CACpB,IAAK,GACL,IAAK,KACL,IAAK,SAGDC,GAAgB,CACpB,IAAK,GACL,IAAK,KACL,IAAK,SAGDC,GAAgB,CACpB,IAAK,GACL,IAAK,KACL,IAAK,SAGDC,GAAmB,GACnBC,GAAmB,GACnBC,GAAmB,GA0DnB,SAAUC,GAAyBC,EAAiB,CACxD,IAAMC,EAAUC,GAAUF,CAAK,EAE/B,OAAOG,GAA2BF,CAAO,CAC3C,CAEM,SAAUE,GAA4BF,EAAY,CACtD,IAAMG,EAAcH,EAAQ,CAAC,EAAE,CAAC,EAAE,CAAC,EAC7BI,EAAS,EACXC,EACAC,EAEJ,GAAIH,EAAY,aAAiBI,GAAmB,EAAK,EACvD,OAAAF,EAAIG,GAAmBL,EAAY,SAASC,EAAQA,EAASG,EAAgB,EAAG,WAAW,EAC3FD,EAAIE,GAAmBL,EAAY,SAASC,EAASG,EAAgB,EAAG,WAAW,EAE5E,IAAIE,GAAoB,CAC7B,GAAGC,GACH,QAAS,CAAC,QAAQ,EAClB,EAAAL,EACA,EAAAC,EACD,EAGH,GAAIH,EAAY,aAAiBQ,GAAmB,EAAK,EACvD,OAAAN,EAAIG,GAAmBL,EAAY,SAASC,EAAQA,EAASO,EAAgB,EAAG,WAAW,EAC3FL,EAAIE,GAAmBL,EAAY,SAASC,EAASO,EAAgB,EAAG,WAAW,EAE5E,IAAIF,GAAoB,CAC7B,GAAGG,GACH,QAAS,CAAC,QAAQ,EAClB,EAAAP,EACA,EAAAC,EACD,EAGH,GAAIH,EAAY,aAAiBU,GAAmB,EAAK,EACvD,OAAAR,EAAIG,GAAmBL,EAAY,SAASC,EAAQA,EAASS,EAAgB,EAAG,WAAW,EAC3FP,EAAIE,GAAmBL,EAAY,SAASC,EAASS,EAAgB,EAAG,WAAW,EAE5E,IAAIJ,GAAoB,CAC7B,GAAGK,GACH,QAAS,CAAC,QAAQ,EAClB,EAAAT,EACA,EAAAC,EACD,EAGH,MAAM,IAAIS,EAAuB,sCAAsCZ,EAAY,UAAU,0BAA0B,CACzH,CAqBM,SAAUa,GAAuBC,EAAqB,CAC1D,OAAOC,GAAe,CACpBC,GAAc,WAAW,KAAK,CAAC,CAAC,CAAC,CAAC,EAClCD,GAAe,CACbE,GAAOH,EAAU,GAAG,GACnB,GAAI,EACPC,GAAe,CACbG,GACE,IAAIC,GACF,WAAW,KAAK,CAAC,CAAI,CAAC,EACtBC,GAAqBN,EAAU,GAAK,GAAI,WAAW,EACnDM,GAAqBN,EAAU,GAAK,GAAI,WAAW,CAAC,CACrD,GAEF,GAAI,EACR,EAAE,SAAQ,CACb,CAEA,SAASG,GAAQI,EAAc,CAC7B,GAAIA,IAAU,QACZ,OAAOC,GAGT,GAAID,IAAU,QACZ,OAAOE,GAGT,GAAIF,IAAU,QACZ,OAAOG,GAGT,MAAM,IAAIC,EAAuB,iBAAiBJ,CAAK,EAAE,CAC3D,CC1LM,IAAOK,GAAP,KAAqB,CACT,KAAO,QACP,IACR,KAER,YAAaC,EAAe,CAC1B,KAAK,IAAMA,CACb,CAEA,IAAI,KAAG,CACL,OAAI,KAAK,MAAQ,OACf,KAAK,KAAOC,GAAsB,KAAK,GAAG,GAGrC,KAAK,IACd,CAEA,aAAW,CACT,OAAOC,GAAS,OAAOC,GAAoB,IAAI,CAAC,CAClD,CAEA,OAAK,CACH,OAAOC,GAAI,SAAS,IAAK,KAAK,YAAW,CAAE,CAC7C,CAEA,UAAQ,CACN,OAAOC,GAAU,OAAO,KAAK,YAAW,EAAG,KAAK,EAAE,UAAU,CAAC,CAC/D,CAEA,OAAQC,EAAS,CACf,OAAIA,GAAO,MAAQ,EAAEA,EAAI,eAAe,YAC/B,GAGFC,GAAiB,KAAK,IAAKD,EAAI,GAAG,CAC3C,CAEA,MAAM,OAAQE,EAAmCC,EAAiBC,EAAsB,CACtF,OAAOC,GAAc,KAAK,IAAKF,EAAKD,EAAME,CAAO,CACnD,GClDF,IAAAE,GAAmB,mBAOnB,IAAMC,GAAU,GAAAC,QAAO,oBAEjBC,GAAyB,GAG/B,IAAMC,GAAwB,GA6FxB,SAAUC,GAAeC,EAAiBC,EAAiBC,EAAgC,CAC/F,GAAIF,EAAI,aAAeG,GACrB,MAAM,IAAI,UAAU,mCAAmC,EAClD,GAAI,EAAEH,aAAe,YAC1B,MAAM,IAAI,UAAU,gDAAgD,EAGtE,GAAIC,EAAI,aAAeG,GACrB,MAAM,IAAI,UAAU,mCAAmC,EAClD,GAAI,EAAEH,aAAe,YAC1B,MAAM,IAAI,UAAU,gDAAgD,EAGtE,IAAMI,EAAM,GAAAC,QAAO,gBAAgB,CACjC,OAAQ,MACR,IAAK,CACH,IAAK,UACL,EAAGC,GAAmBP,EAAK,WAAW,EACtC,IAAK,OAER,EAED,OAAO,GAAAM,QAAO,OAAO,KAAMJ,aAAe,WAAaA,EAAMA,EAAI,SAAQ,EAAIG,EAAKJ,CAAG,CACvF,CC/GM,SAAUO,GAAyBC,EAAU,CACjD,OAAIA,GAAS,KACJ,GAGF,OAAOA,EAAM,MAAS,YAC3B,OAAOA,EAAM,OAAU,YACvB,OAAOA,EAAM,SAAY,UAC7B,CCbM,IAAOC,GAAP,KAAuB,CACX,KAAO,UACP,IAEhB,YAAaC,EAAe,CAC1B,KAAK,IAAMC,GAAiBD,EAAYE,EAAe,CACzD,CAEA,aAAW,CACT,OAAOC,GAAS,OAAOC,GAAoB,IAAI,CAAC,CAClD,CAEA,OAAK,CACH,OAAOC,GAAI,SAAS,IAAK,KAAK,YAAW,CAAE,CAC7C,CAEA,UAAQ,CACN,OAAOC,GAAU,OAAO,KAAK,YAAW,EAAG,KAAK,EAAE,UAAU,CAAC,CAC/D,CAEA,OAAQN,EAAS,CACf,OAAIA,GAAO,MAAQ,EAAEA,EAAI,eAAe,YAC/B,GAGFO,GAAiB,KAAK,IAAKP,EAAI,GAAG,CAC3C,CAEA,OAAQQ,EAAmCC,EAAiBC,EAAsB,CAChFA,GAAS,QAAQ,eAAc,EAC/B,IAAMC,EAAgBC,GAAc,KAAK,IAAKH,EAAKD,CAAI,EAEvD,OAAIK,GAAmBF,CAAM,EACpBA,EAAO,KAAKG,IACjBJ,GAAS,QAAQ,eAAc,EACxBI,EACR,EAGIH,CACT,GChCI,SAAUI,GAA2BC,EAAiB,CAC1D,OAAAA,EAAQC,GAAiBD,EAAcE,EAAe,EAC/C,IAAIC,GAAsBH,CAAK,CACxC,CAYM,SAAUI,GAAkBC,EAAiBC,EAAc,CAE/D,GADAD,EAAM,WAAW,KAAKA,GAAO,CAAA,CAAE,EAC3BA,EAAI,SAAWC,EACjB,MAAM,IAAIC,EAAuB,sCAAsCD,CAAM,SAASD,EAAI,MAAM,EAAE,EAEpG,OAAOA,CACT,CCrCA,IAAYG,IAAZ,SAAYA,EAAO,CACjBA,EAAA,IAAA,MACAA,EAAA,QAAA,UACAA,EAAA,UAAA,YACAA,EAAA,MAAA,OACF,GALYA,KAAAA,GAAO,CAAA,EAAA,EAOnB,IAAKC,IAAL,SAAKA,EAAe,CAClBA,EAAAA,EAAA,IAAA,CAAA,EAAA,MACAA,EAAAA,EAAA,QAAA,CAAA,EAAA,UACAA,EAAAA,EAAA,UAAA,CAAA,EAAA,YACAA,EAAAA,EAAA,MAAA,CAAA,EAAA,OACF,GALKA,KAAAA,GAAe,CAAA,EAAA,GAOpB,SAAiBD,EAAO,CACTA,EAAA,MAAQ,IACZE,GAAqBD,EAAe,CAE/C,GAJiBD,KAAAA,GAAO,CAAA,EAAA,EAUlB,IAAWG,IAAjB,SAAiBA,EAAS,CACxB,IAAIC,EAESD,EAAA,MAAQ,KACfC,GAAU,OACZA,EAASC,EAAmB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAC5CA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVP,GAAQ,MAAK,EAAG,OAAOM,EAAI,KAAMC,CAAC,GAGhCD,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACE,EAAQC,EAAQF,EAAO,CAAA,IAAM,CAC/B,IAAMF,EAAW,CAAA,EAEXK,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GAAG,CACNN,EAAI,KAAON,GAAQ,MAAK,EAAG,OAAOS,CAAM,EACxC,KACF,CACA,IAAK,GAAG,CACNH,EAAI,KAAOG,EAAO,MAAK,EACvB,KACF,CACA,QAAS,CACPA,EAAO,SAASG,EAAM,CAAC,EACvB,KACF,CACF,CACF,CAEA,OAAON,CACT,CAAC,GAGIF,GAGID,EAAA,OAAUG,GACdO,EAAcP,EAAKH,EAAU,MAAK,CAAE,EAGhCA,EAAA,OAAS,CAACW,EAAkCN,IAChDO,EAAcD,EAAKX,EAAU,MAAK,EAAIK,CAAI,CAErD,GA7DiBL,KAAAA,GAAS,CAAA,EAAA,EAoEpB,IAAWa,IAAjB,SAAiBA,EAAU,CACzB,IAAIZ,EAESY,EAAA,MAAQ,KACfZ,GAAU,OACZA,EAASC,EAAoB,CAACC,EAAKC,EAAGC,EAAO,CAAA,IAAM,CAC7CA,EAAK,kBAAoB,IAC3BD,EAAE,KAAI,EAGJD,EAAI,MAAQ,OACdC,EAAE,OAAO,CAAC,EACVP,GAAQ,MAAK,EAAG,OAAOM,EAAI,KAAMC,CAAC,GAGhCD,EAAI,MAAQ,OACdC,EAAE,OAAO,EAAE,EACXA,EAAE,MAAMD,EAAI,IAAI,GAGdE,EAAK,kBAAoB,IAC3BD,EAAE,OAAM,CAEZ,EAAG,CAACE,EAAQC,EAAQF,EAAO,CAAA,IAAM,CAC/B,IAAMF,EAAW,CAAA,EAEXK,EAAMD,GAAU,KAAOD,EAAO,IAAMA,EAAO,IAAMC,EAEvD,KAAOD,EAAO,IAAME,GAAK,CACvB,IAAMC,EAAMH,EAAO,OAAM,EAEzB,OAAQG,IAAQ,EAAG,CACjB,IAAK,GAAG,CACNN,EAAI,KAAON,GAAQ,MAAK,EAAG,OAAOS,CAAM,EACxC,KACF,CACA,IAAK,GAAG,CACNH,EAAI,KAAOG,EAAO,MAAK,EACvB,KACF,CACA,QAAS,CACPA,EAAO,SAASG,EAAM,CAAC,EACvB,KACF,CACF,CACF,CAEA,OAAON,CACT,CAAC,GAGIF,GAGIY,EAAA,OAAUV,GACdO,EAAcP,EAAKU,EAAW,MAAK,CAAE,EAGjCA,EAAA,OAAS,CAACF,EAAkCN,IAChDO,EAAcD,EAAKE,EAAW,MAAK,EAAIR,CAAI,CAEtD,GA7DiBQ,KAAAA,GAAU,CAAA,EAAA,ECxF3B,IAAAC,GAAoB,wBACPC,GACXD,IAAM,OAAOA,IAAO,UAAY,cAAeA,GACvC,aACJA,IAAM,OAAOA,IAAO,UAAY,gBAAiBA,GAC/CA,GACA,OCCF,SAAUE,GAAQC,EAAU,CAChC,OAAOA,aAAa,YAAe,YAAY,OAAOA,CAAC,GAAKA,EAAE,YAAY,OAAS,YACrF,CAGM,SAAUC,GAAQC,EAAS,CAC/B,GAAI,CAAC,OAAO,cAAcA,CAAC,GAAKA,EAAI,EAAG,MAAM,IAAI,MAAM,kCAAoCA,CAAC,CAC9F,CAGM,SAAUC,GAAOC,KAA8BC,EAAiB,CACpE,GAAI,CAACN,GAAQK,CAAC,EAAG,MAAM,IAAI,MAAM,qBAAqB,EACtD,GAAIC,EAAQ,OAAS,GAAK,CAACA,EAAQ,SAASD,EAAE,MAAM,EAClD,MAAM,IAAI,MAAM,iCAAmCC,EAAU,gBAAkBD,EAAE,MAAM,CAC3F,CAGM,SAAUE,GAAMC,EAAQ,CAC5B,GAAI,OAAOA,GAAM,YAAc,OAAOA,EAAE,QAAW,WACjD,MAAM,IAAI,MAAM,8CAA8C,EAChEN,GAAQM,EAAE,SAAS,EACnBN,GAAQM,EAAE,QAAQ,CACpB,CAGM,SAAUC,GAAQC,EAAeC,EAAgB,GAAI,CACzD,GAAID,EAAS,UAAW,MAAM,IAAI,MAAM,kCAAkC,EAC1E,GAAIC,GAAiBD,EAAS,SAAU,MAAM,IAAI,MAAM,uCAAuC,CACjG,CAGM,SAAUE,GAAQC,EAAUH,EAAa,CAC7CN,GAAOS,CAAG,EACV,IAAMC,EAAMJ,EAAS,UACrB,GAAIG,EAAI,OAASC,EACf,MAAM,IAAI,MAAM,yDAA2DA,CAAG,CAElF,CAkBM,SAAUC,MAASC,EAAoB,CAC3C,QAASC,EAAI,EAAGA,EAAID,EAAO,OAAQC,IACjCD,EAAOC,CAAC,EAAE,KAAK,CAAC,CAEpB,CAGM,SAAUC,GAAWC,EAAe,CACxC,OAAO,IAAI,SAASA,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,CAChE,CAGM,SAAUC,GAAKC,EAAcC,EAAa,CAC9C,OAAQD,GAAS,GAAKC,EAAWD,IAASC,CAC5C,CAwCA,IAAMC,GAEJ,OAAO,WAAW,KAAK,CAAA,CAAE,EAAE,OAAU,YAAc,OAAO,WAAW,SAAY,WAG7EC,GAAwB,MAAM,KAAK,CAAE,OAAQ,GAAG,EAAI,CAACC,EAAGC,IAC5DA,EAAE,SAAS,EAAE,EAAE,SAAS,EAAG,GAAG,CAAC,EAO3B,SAAUC,GAAWC,EAAiB,CAG1C,GAFAC,GAAOD,CAAK,EAERL,GAAe,OAAOK,EAAM,MAAK,EAErC,IAAIE,EAAM,GACV,QAASJ,EAAI,EAAGA,EAAIE,EAAM,OAAQF,IAChCI,GAAON,GAAMI,EAAMF,CAAC,CAAC,EAEvB,OAAOI,CACT,CAGA,IAAMC,GAAS,CAAE,GAAI,GAAI,GAAI,GAAI,EAAG,GAAI,EAAG,GAAI,EAAG,GAAI,EAAG,GAAG,EAC5D,SAASC,GAAcC,EAAU,CAC/B,GAAIA,GAAMF,GAAO,IAAME,GAAMF,GAAO,GAAI,OAAOE,EAAKF,GAAO,GAC3D,GAAIE,GAAMF,GAAO,GAAKE,GAAMF,GAAO,EAAG,OAAOE,GAAMF,GAAO,EAAI,IAC9D,GAAIE,GAAMF,GAAO,GAAKE,GAAMF,GAAO,EAAG,OAAOE,GAAMF,GAAO,EAAI,GAEhE,CAMM,SAAUG,GAAWJ,EAAW,CACpC,GAAI,OAAOA,GAAQ,SAAU,MAAM,IAAI,MAAM,4BAA8B,OAAOA,CAAG,EAErF,GAAIP,GAAe,OAAO,WAAW,QAAQO,CAAG,EAChD,IAAMK,EAAKL,EAAI,OACTM,EAAKD,EAAK,EAChB,GAAIA,EAAK,EAAG,MAAM,IAAI,MAAM,mDAAqDA,CAAE,EACnF,IAAME,EAAQ,IAAI,WAAWD,CAAE,EAC/B,QAASE,EAAK,EAAGC,EAAK,EAAGD,EAAKF,EAAIE,IAAMC,GAAM,EAAG,CAC/C,IAAMC,EAAKR,GAAcF,EAAI,WAAWS,CAAE,CAAC,EACrCE,EAAKT,GAAcF,EAAI,WAAWS,EAAK,CAAC,CAAC,EAC/C,GAAIC,IAAO,QAAaC,IAAO,OAAW,CACxC,IAAMC,EAAOZ,EAAIS,CAAE,EAAIT,EAAIS,EAAK,CAAC,EACjC,MAAM,IAAI,MAAM,+CAAiDG,EAAO,cAAgBH,CAAE,CAC5F,CACAF,EAAMC,CAAE,EAAIE,EAAK,GAAKC,CACxB,CACA,OAAOJ,CACT,CAkCM,SAAUM,GAAYC,EAAW,CACrC,GAAI,OAAOA,GAAQ,SAAU,MAAM,IAAI,MAAM,iBAAiB,EAC9D,OAAO,IAAI,WAAW,IAAI,YAAW,EAAG,OAAOA,CAAG,CAAC,CACrD,CAiBM,SAAUC,GAAQC,EAAW,CACjC,OAAI,OAAOA,GAAS,WAAUA,EAAOC,GAAYD,CAAI,GACrDE,GAAOF,CAAI,EACJA,CACT,CAeM,SAAUG,MAAeC,EAAoB,CACjD,IAAIC,EAAM,EACV,QAASC,EAAI,EAAGA,EAAIF,EAAO,OAAQE,IAAK,CACtC,IAAMC,EAAIH,EAAOE,CAAC,EAClBE,GAAOD,CAAC,EACRF,GAAOE,EAAE,MACX,CACA,IAAME,EAAM,IAAI,WAAWJ,CAAG,EAC9B,QAASC,EAAI,EAAGI,EAAM,EAAGJ,EAAIF,EAAO,OAAQE,IAAK,CAC/C,IAAMC,EAAIH,EAAOE,CAAC,EAClBG,EAAI,IAAIF,EAAGG,CAAG,EACdA,GAAOH,EAAE,MACX,CACA,OAAOE,CACT,CAsBM,IAAgBE,GAAhB,KAAoB,GA4CpB,SAAUC,GACdC,EAAuB,CAOvB,IAAMC,EAASC,GAA2BF,EAAQ,EAAG,OAAOG,GAAQD,CAAG,CAAC,EAAE,OAAM,EAC1EE,EAAMJ,EAAQ,EACpB,OAAAC,EAAM,UAAYG,EAAI,UACtBH,EAAM,SAAWG,EAAI,SACrBH,EAAM,OAAS,IAAMD,EAAQ,EACtBC,CACT,CAsCM,SAAUI,GAAYC,EAAc,GAAE,CAC1C,GAAIC,IAAU,OAAOA,GAAO,iBAAoB,WAC9C,OAAOA,GAAO,gBAAgB,IAAI,WAAWD,CAAW,CAAC,EAG3D,GAAIC,IAAU,OAAOA,GAAO,aAAgB,WAC1C,OAAO,WAAW,KAAKA,GAAO,YAAYD,CAAW,CAAC,EAExD,MAAM,IAAI,MAAM,wCAAwC,CAC1D,CCnYM,SAAUE,GACdC,EACAC,EACAC,EACAC,EAAa,CAEb,GAAI,OAAOH,EAAK,cAAiB,WAAY,OAAOA,EAAK,aAAaC,EAAYC,EAAOC,CAAI,EAC7F,IAAMC,EAAO,OAAO,EAAE,EAChBC,EAAW,OAAO,UAAU,EAC5BC,EAAK,OAAQJ,GAASE,EAAQC,CAAQ,EACtCE,EAAK,OAAOL,EAAQG,CAAQ,EAC5BG,EAAIL,EAAO,EAAI,EACfM,EAAIN,EAAO,EAAI,EACrBH,EAAK,UAAUC,EAAaO,EAAGF,EAAIH,CAAI,EACvCH,EAAK,UAAUC,EAAaQ,EAAGF,EAAIJ,CAAI,CACzC,CAGM,SAAUO,GAAIC,EAAWC,EAAWC,EAAS,CACjD,OAAQF,EAAIC,EAAM,CAACD,EAAIE,CACzB,CAGM,SAAUC,GAAIH,EAAWC,EAAWC,EAAS,CACjD,OAAQF,EAAIC,EAAMD,EAAIE,EAAMD,EAAIC,CAClC,CAMM,IAAgBE,GAAhB,cAAoDC,EAAO,CAoB/D,YAAYC,EAAkBC,EAAmBC,EAAmBhB,EAAa,CAC/E,MAAK,EANG,KAAA,SAAW,GACX,KAAA,OAAS,EACT,KAAA,IAAM,EACN,KAAA,UAAY,GAIpB,KAAK,SAAWc,EAChB,KAAK,UAAYC,EACjB,KAAK,UAAYC,EACjB,KAAK,KAAOhB,EACZ,KAAK,OAAS,IAAI,WAAWc,CAAQ,EACrC,KAAK,KAAOG,GAAW,KAAK,MAAM,CACpC,CACA,OAAOC,EAAW,CAChBC,GAAQ,IAAI,EACZD,EAAOE,GAAQF,CAAI,EACnBG,GAAOH,CAAI,EACX,GAAM,CAAE,KAAArB,EAAM,OAAAyB,EAAQ,SAAAR,CAAQ,EAAK,KAC7BS,EAAML,EAAK,OACjB,QAASM,EAAM,EAAGA,EAAMD,GAAO,CAC7B,IAAME,EAAO,KAAK,IAAIX,EAAW,KAAK,IAAKS,EAAMC,CAAG,EAEpD,GAAIC,IAASX,EAAU,CACrB,IAAMY,EAAWT,GAAWC,CAAI,EAChC,KAAOJ,GAAYS,EAAMC,EAAKA,GAAOV,EAAU,KAAK,QAAQY,EAAUF,CAAG,EACzE,QACF,CACAF,EAAO,IAAIJ,EAAK,SAASM,EAAKA,EAAMC,CAAI,EAAG,KAAK,GAAG,EACnD,KAAK,KAAOA,EACZD,GAAOC,EACH,KAAK,MAAQX,IACf,KAAK,QAAQjB,EAAM,CAAC,EACpB,KAAK,IAAM,EAEf,CACA,YAAK,QAAUqB,EAAK,OACpB,KAAK,WAAU,EACR,IACT,CACA,WAAWS,EAAe,CACxBR,GAAQ,IAAI,EACZS,GAAQD,EAAK,IAAI,EACjB,KAAK,SAAW,GAIhB,GAAM,CAAE,OAAAL,EAAQ,KAAAzB,EAAM,SAAAiB,EAAU,KAAAd,CAAI,EAAK,KACrC,CAAE,IAAAwB,CAAG,EAAK,KAEdF,EAAOE,GAAK,EAAI,IAChBK,GAAM,KAAK,OAAO,SAASL,CAAG,CAAC,EAG3B,KAAK,UAAYV,EAAWU,IAC9B,KAAK,QAAQ3B,EAAM,CAAC,EACpB2B,EAAM,GAGR,QAASM,EAAIN,EAAKM,EAAIhB,EAAUgB,IAAKR,EAAOQ,CAAC,EAAI,EAIjDlC,GAAaC,EAAMiB,EAAW,EAAG,OAAO,KAAK,OAAS,CAAC,EAAGd,CAAI,EAC9D,KAAK,QAAQH,EAAM,CAAC,EACpB,IAAMkC,EAAQd,GAAWU,CAAG,EACtBJ,EAAM,KAAK,UAEjB,GAAIA,EAAM,EAAG,MAAM,IAAI,MAAM,6CAA6C,EAC1E,IAAMS,EAAST,EAAM,EACfU,EAAQ,KAAK,IAAG,EACtB,GAAID,EAASC,EAAM,OAAQ,MAAM,IAAI,MAAM,oCAAoC,EAC/E,QAASH,EAAI,EAAGA,EAAIE,EAAQF,IAAKC,EAAM,UAAU,EAAID,EAAGG,EAAMH,CAAC,EAAG9B,CAAI,CACxE,CACA,QAAM,CACJ,GAAM,CAAE,OAAAsB,EAAQ,UAAAP,CAAS,EAAK,KAC9B,KAAK,WAAWO,CAAM,EACtB,IAAMY,EAAMZ,EAAO,MAAM,EAAGP,CAAS,EACrC,YAAK,QAAO,EACLmB,CACT,CACA,WAAWC,EAAM,CACfA,IAAAA,EAAO,IAAK,KAAK,aACjBA,EAAG,IAAI,GAAG,KAAK,IAAG,CAAE,EACpB,GAAM,CAAE,SAAArB,EAAU,OAAAQ,EAAQ,OAAAc,EAAQ,SAAAC,EAAU,UAAAC,EAAW,IAAAd,CAAG,EAAK,KAC/D,OAAAW,EAAG,UAAYG,EACfH,EAAG,SAAWE,EACdF,EAAG,OAASC,EACZD,EAAG,IAAMX,EACLY,EAAStB,GAAUqB,EAAG,OAAO,IAAIb,CAAM,EACpCa,CACT,CACA,OAAK,CACH,OAAO,KAAK,WAAU,CACxB,GASWI,GAAyC,YAAY,KAAK,CACrE,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UAAY,WACrF,EC9ID,IAAMC,GAA2B,YAAY,KAAK,CAChD,WAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,WAAY,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,UAAY,UAAY,UAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UAAY,UACpF,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UACpF,UAAY,UAAY,UAAY,UAAY,UAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACrF,EAGKC,GAA2B,IAAI,YAAY,EAAE,EACtCC,GAAP,cAAsBC,EAAc,CAYxC,YAAYC,EAAoB,GAAE,CAChC,MAAM,GAAIA,EAAW,EAAG,EAAK,EAVrB,KAAA,EAAYC,GAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,GAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,GAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,GAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,GAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,GAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,GAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,GAAU,CAAC,EAAI,CAIrC,CACU,KAAG,CACX,GAAM,CAAE,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,CAAC,EAAK,KACnC,MAAO,CAACP,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,CAAC,CAChC,CAEU,IACRP,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAS,CAEtF,KAAK,EAAIP,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,CACf,CACU,QAAQC,EAAgBC,EAAc,CAE9C,QAASC,EAAI,EAAGA,EAAI,GAAIA,IAAKD,GAAU,EAAGd,GAASe,CAAC,EAAIF,EAAK,UAAUC,EAAQ,EAAK,EACpF,QAASC,EAAI,GAAIA,EAAI,GAAIA,IAAK,CAC5B,IAAMC,EAAMhB,GAASe,EAAI,EAAE,EACrBE,EAAKjB,GAASe,EAAI,CAAC,EACnBG,EAAKC,GAAKH,EAAK,CAAC,EAAIG,GAAKH,EAAK,EAAE,EAAKA,IAAQ,EAC7CI,EAAKD,GAAKF,EAAI,EAAE,EAAIE,GAAKF,EAAI,EAAE,EAAKA,IAAO,GACjDjB,GAASe,CAAC,EAAKK,EAAKpB,GAASe,EAAI,CAAC,EAAIG,EAAKlB,GAASe,EAAI,EAAE,EAAK,CACjE,CAEA,GAAI,CAAE,EAAAV,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,CAAC,EAAK,KACjC,QAASG,EAAI,EAAGA,EAAI,GAAIA,IAAK,CAC3B,IAAMM,EAASF,GAAKV,EAAG,CAAC,EAAIU,GAAKV,EAAG,EAAE,EAAIU,GAAKV,EAAG,EAAE,EAC9Ca,EAAMV,EAAIS,EAASE,GAAId,EAAGC,EAAGC,CAAC,EAAIZ,GAASgB,CAAC,EAAIf,GAASe,CAAC,EAAK,EAE/DS,GADSL,GAAKd,EAAG,CAAC,EAAIc,GAAKd,EAAG,EAAE,EAAIc,GAAKd,EAAG,EAAE,GAC/BoB,GAAIpB,EAAGC,EAAGC,CAAC,EAAK,EACrCK,EAAID,EACJA,EAAID,EACJA,EAAID,EACJA,EAAKD,EAAIc,EAAM,EACfd,EAAID,EACJA,EAAID,EACJA,EAAID,EACJA,EAAKiB,EAAKE,EAAM,CAClB,CAEAnB,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnB,KAAK,IAAIP,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,CAAC,CACjC,CACU,YAAU,CAClBc,GAAM1B,EAAQ,CAChB,CACA,SAAO,CACL,KAAK,IAAI,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,CAAC,EAC/B0B,GAAM,KAAK,MAAM,CACnB,GAuRK,IAAMC,GAAgCC,GAAa,IAAM,IAAIC,EAAQ,EC/X5E,IAAAC,GAAmB,wBCMb,IAAOC,GAAP,cAAuCC,EAAa,CAQxD,YAAYC,EAAaC,EAAW,CAClC,MAAK,EAJC,KAAA,SAAW,GACX,KAAA,UAAY,GAIlBC,GAAMF,CAAI,EACV,IAAMG,EAAMC,GAAQH,CAAI,EAExB,GADA,KAAK,MAAQD,EAAK,OAAM,EACpB,OAAO,KAAK,MAAM,QAAW,WAC/B,MAAM,IAAI,MAAM,qDAAqD,EACvE,KAAK,SAAW,KAAK,MAAM,SAC3B,KAAK,UAAY,KAAK,MAAM,UAC5B,IAAMK,EAAW,KAAK,SAChBC,EAAM,IAAI,WAAWD,CAAQ,EAEnCC,EAAI,IAAIH,EAAI,OAASE,EAAWL,EAAK,OAAM,EAAG,OAAOG,CAAG,EAAE,OAAM,EAAKA,CAAG,EACxE,QAAS,EAAI,EAAG,EAAIG,EAAI,OAAQ,IAAKA,EAAI,CAAC,GAAK,GAC/C,KAAK,MAAM,OAAOA,CAAG,EAErB,KAAK,MAAQN,EAAK,OAAM,EAExB,QAAS,EAAI,EAAG,EAAIM,EAAI,OAAQ,IAAKA,EAAI,CAAC,GAAK,IAC/C,KAAK,MAAM,OAAOA,CAAG,EACrBC,GAAMD,CAAG,CACX,CACA,OAAOE,EAAU,CACf,OAAAC,GAAQ,IAAI,EACZ,KAAK,MAAM,OAAOD,CAAG,EACd,IACT,CACA,WAAWE,EAAe,CACxBD,GAAQ,IAAI,EACZE,GAAOD,EAAK,KAAK,SAAS,EAC1B,KAAK,SAAW,GAChB,KAAK,MAAM,WAAWA,CAAG,EACzB,KAAK,MAAM,OAAOA,CAAG,EACrB,KAAK,MAAM,WAAWA,CAAG,EACzB,KAAK,QAAO,CACd,CACA,QAAM,CACJ,IAAMA,EAAM,IAAI,WAAW,KAAK,MAAM,SAAS,EAC/C,YAAK,WAAWA,CAAG,EACZA,CACT,CACA,WAAWE,EAAY,CAErBA,IAAAA,EAAO,OAAO,OAAO,OAAO,eAAe,IAAI,EAAG,CAAA,CAAE,GACpD,GAAM,CAAE,MAAAC,EAAO,MAAAC,EAAO,SAAAC,EAAU,UAAAC,EAAW,SAAAX,EAAU,UAAAY,CAAS,EAAK,KACnE,OAAAL,EAAKA,EACLA,EAAG,SAAWG,EACdH,EAAG,UAAYI,EACfJ,EAAG,SAAWP,EACdO,EAAG,UAAYK,EACfL,EAAG,MAAQC,EAAM,WAAWD,EAAG,KAAK,EACpCA,EAAG,MAAQE,EAAM,WAAWF,EAAG,KAAK,EAC7BA,CACT,CACA,OAAK,CACH,OAAO,KAAK,WAAU,CACxB,CACA,SAAO,CACL,KAAK,UAAY,GACjB,KAAK,MAAM,QAAO,EAClB,KAAK,MAAM,QAAO,CACpB,GAaWM,GAGT,CAAClB,EAAaG,EAAYgB,IAC5B,IAAIrB,GAAUE,EAAMG,CAAG,EAAE,OAAOgB,CAAO,EAAE,OAAM,EACjDD,GAAK,OAAS,CAAClB,EAAaG,IAAe,IAAIL,GAAUE,EAAMG,CAAG,ECtElE,IAAMiB,GAAsB,OAAO,CAAC,EAC9BC,GAAsB,OAAO,CAAC,EAgB9B,SAAUC,GAAQC,EAAgBC,EAAgB,GAAE,CACxD,GAAI,OAAOD,GAAU,UAAW,CAC9B,IAAME,EAASD,GAAS,IAAIA,CAAK,IACjC,MAAM,IAAI,MAAMC,EAAS,8BAAgC,OAAOF,CAAK,CACvE,CACA,OAAOA,CACT,CAIM,SAAUG,GAASH,EAAmBI,EAAiBH,EAAgB,GAAE,CAC7E,IAAMI,EAAQC,GAASN,CAAK,EACtBO,EAAMP,GAAO,OACbQ,EAAWJ,IAAW,OAC5B,GAAI,CAACC,GAAUG,GAAYD,IAAQH,EAAS,CAC1C,IAAMF,EAASD,GAAS,IAAIA,CAAK,KAC3BQ,EAAQD,EAAW,cAAcJ,CAAM,GAAK,GAC5CM,EAAML,EAAQ,UAAUE,CAAG,GAAK,QAAQ,OAAOP,CAAK,GAC1D,MAAM,IAAI,MAAME,EAAS,sBAAwBO,EAAQ,SAAWC,CAAG,CACzE,CACA,OAAOV,CACT,CAGM,SAAUW,GAAoBC,EAAoB,CACtD,IAAMC,EAAMD,EAAI,SAAS,EAAE,EAC3B,OAAOC,EAAI,OAAS,EAAI,IAAMA,EAAMA,CACtC,CAEM,SAAUC,GAAYD,EAAW,CACrC,GAAI,OAAOA,GAAQ,SAAU,MAAM,IAAI,MAAM,4BAA8B,OAAOA,CAAG,EACrF,OAAOA,IAAQ,GAAKE,GAAM,OAAO,KAAOF,CAAG,CAC7C,CAGM,SAAUG,GAAgBX,EAAiB,CAC/C,OAAOS,GAAYG,GAAYZ,CAAK,CAAC,CACvC,CACM,SAAUa,GAAgBb,EAAiB,CAC/C,OAAAc,GAAQd,CAAK,EACNS,GAAYG,GAAY,WAAW,KAAKZ,CAAK,EAAE,QAAO,CAAE,CAAC,CAClE,CAEM,SAAUe,GAAgBC,EAAoBd,EAAW,CAC7D,OAAOe,GAAYD,EAAE,SAAS,EAAE,EAAE,SAASd,EAAM,EAAG,GAAG,CAAC,CAC1D,CACM,SAAUgB,GAAgBF,EAAoBd,EAAW,CAC7D,OAAOa,GAAgBC,EAAGd,CAAG,EAAE,QAAO,CACxC,CAeM,SAAUiB,GAAYC,EAAeC,EAAUC,EAAuB,CAC1E,IAAIC,EACJ,GAAI,OAAOF,GAAQ,SACjB,GAAI,CACFE,EAAMC,GAAYH,CAAG,CACvB,OAASI,EAAG,CACV,MAAM,IAAI,MAAML,EAAQ,6CAA+CK,CAAC,CAC1E,SACSC,GAASL,CAAG,EAGrBE,EAAM,WAAW,KAAKF,CAAG,MAEzB,OAAM,IAAI,MAAMD,EAAQ,mCAAmC,EAE7D,IAAMO,EAAMJ,EAAI,OAChB,GAAI,OAAOD,GAAmB,UAAYK,IAAQL,EAChD,MAAM,IAAI,MAAMF,EAAQ,cAAgBE,EAAiB,kBAAoBK,CAAG,EAClF,OAAOJ,CACT,CA6CA,IAAMK,GAAYC,GAAc,OAAOA,GAAM,UAAYC,IAAOD,EAE1D,SAAUE,GAAQF,EAAWG,EAAaC,EAAW,CACzD,OAAOL,GAASC,CAAC,GAAKD,GAASI,CAAG,GAAKJ,GAASK,CAAG,GAAKD,GAAOH,GAAKA,EAAII,CAC1E,CAOM,SAAUC,GAASC,EAAeN,EAAWG,EAAaC,EAAW,CAMzE,GAAI,CAACF,GAAQF,EAAGG,EAAKC,CAAG,EACtB,MAAM,IAAI,MAAM,kBAAoBE,EAAQ,KAAOH,EAAM,WAAaC,EAAM,SAAWJ,CAAC,CAC5F,CASM,SAAUO,GAAOP,EAAS,CAC9B,IAAIQ,EACJ,IAAKA,EAAM,EAAGR,EAAIC,GAAKD,IAAMS,GAAKD,GAAO,EAAE,CAC3C,OAAOA,CACT,CAsBO,IAAME,GAAWC,IAAuBC,IAAO,OAAOD,CAAC,GAAKC,GAY7D,SAAUC,GACdC,EACAC,EACAC,EAAkE,CAElE,GAAI,OAAOF,GAAY,UAAYA,EAAU,EAAG,MAAM,IAAI,MAAM,0BAA0B,EAC1F,GAAI,OAAOC,GAAa,UAAYA,EAAW,EAAG,MAAM,IAAI,MAAM,2BAA2B,EAC7F,GAAI,OAAOC,GAAW,WAAY,MAAM,IAAI,MAAM,2BAA2B,EAE7E,IAAMC,EAAOC,GAAgB,IAAI,WAAWA,CAAG,EACzCC,EAAQC,GAAiB,WAAW,GAAGA,CAAI,EAC7CC,EAAIJ,EAAIH,CAAO,EACfQ,EAAIL,EAAIH,CAAO,EACfS,EAAI,EACFC,EAAQ,IAAK,CACjBH,EAAE,KAAK,CAAC,EACRC,EAAE,KAAK,CAAC,EACRC,EAAI,CACN,EACM,EAAI,IAAIE,IAAoBT,EAAOM,EAAGD,EAAG,GAAGI,CAAC,EAC7CC,EAAS,CAACC,EAAOV,EAAI,CAAC,IAAK,CAE/BK,EAAI,EAAEH,EAAK,CAAI,EAAGQ,CAAI,EACtBN,EAAI,EAAC,EACDM,EAAK,SAAW,IACpBL,EAAI,EAAEH,EAAK,CAAI,EAAGQ,CAAI,EACtBN,EAAI,EAAC,EACP,EACMO,EAAM,IAAK,CAEf,GAAIL,KAAO,IAAM,MAAM,IAAI,MAAM,yBAAyB,EAC1D,IAAIL,EAAM,EACJW,EAAoB,CAAA,EAC1B,KAAOX,EAAMH,GAAU,CACrBM,EAAI,EAAC,EACL,IAAMS,EAAKT,EAAE,MAAK,EAClBQ,EAAI,KAAKC,CAAE,EACXZ,GAAOG,EAAE,MACX,CACA,OAAOU,GAAa,GAAGF,CAAG,CAC5B,EASA,MARiB,CAACF,EAAkBK,IAAoB,CACtDR,EAAK,EACLE,EAAOC,CAAI,EACX,IAAIM,EACJ,KAAO,EAAEA,EAAMD,EAAKJ,EAAG,CAAE,IAAIF,EAAM,EACnC,OAAAF,EAAK,EACES,CACT,CAEF,CAoDM,SAAUC,GACdC,EACAC,EACAC,EAAoC,CAAA,EAAE,CAEtC,GAAI,CAACF,GAAU,OAAOA,GAAW,SAAU,MAAM,IAAI,MAAM,+BAA+B,EAE1F,SAASG,EAAWC,EAAiBC,EAAsBC,EAAc,CACvE,IAAMC,EAAMP,EAAOI,CAAS,EAC5B,GAAIE,GAASC,IAAQ,OAAW,OAChC,IAAMC,EAAU,OAAOD,EACvB,GAAIC,IAAYH,GAAgBE,IAAQ,KACtC,MAAM,IAAI,MAAM,UAAUH,CAAS,0BAA0BC,CAAY,SAASG,CAAO,EAAE,CAC/F,CACA,OAAO,QAAQP,CAAM,EAAE,QAAQ,CAAC,CAACQ,EAAGC,CAAC,IAAMP,EAAWM,EAAGC,EAAG,EAAK,CAAC,EAClE,OAAO,QAAQR,CAAS,EAAE,QAAQ,CAAC,CAACO,EAAGC,CAAC,IAAMP,EAAWM,EAAGC,EAAG,EAAI,CAAC,CACtE,CAaM,SAAUC,GACdC,EAA6B,CAE7B,IAAMC,EAAM,IAAI,QAChB,MAAO,CAACC,KAAWC,IAAc,CAC/B,IAAMC,EAAMH,EAAI,IAAIC,CAAG,EACvB,GAAIE,IAAQ,OAAW,OAAOA,EAC9B,IAAMC,EAAWL,EAAGE,EAAK,GAAGC,CAAI,EAChC,OAAAF,EAAI,IAAIC,EAAKG,CAAQ,EACdA,CACT,CACF,CCpWA,IAAMC,GAAM,OAAO,CAAC,EAAGC,GAAM,OAAO,CAAC,EAAGC,GAAsB,OAAO,CAAC,EAAGC,GAAsB,OAAO,CAAC,EAEjGC,GAAsB,OAAO,CAAC,EAAGC,GAAsB,OAAO,CAAC,EAAGC,GAAsB,OAAO,CAAC,EAEhGC,GAAsB,OAAO,CAAC,EAAGC,GAAsB,OAAO,CAAC,EAAGC,GAAuB,OAAO,EAAE,EAGlG,SAAUC,GAAIC,EAAWC,EAAS,CACtC,IAAMC,EAASF,EAAIC,EACnB,OAAOC,GAAUb,GAAMa,EAASD,EAAIC,CACtC,CAYM,SAAUC,GAAKC,EAAWC,EAAeC,EAAc,CAC3D,IAAIC,EAAMH,EACV,KAAOC,KAAUG,IACfD,GAAOA,EACPA,GAAOD,EAET,OAAOC,CACT,CAMM,SAAUE,GAAOC,EAAgBJ,EAAc,CACnD,GAAII,IAAWF,GAAK,MAAM,IAAI,MAAM,kCAAkC,EACtE,GAAIF,GAAUE,GAAK,MAAM,IAAI,MAAM,0CAA4CF,CAAM,EAErF,IAAIK,EAAIC,GAAIF,EAAQJ,CAAM,EACtBO,EAAIP,EAEJF,EAAII,GAAKM,EAAIC,GAAKC,EAAID,GAAKE,EAAIT,GACnC,KAAOG,IAAMH,IAAK,CAEhB,IAAMU,EAAIL,EAAIF,EACRQ,EAAIN,EAAIF,EACRS,EAAIhB,EAAIY,EAAIE,EACZG,EAAIP,EAAIG,EAAIC,EAElBL,EAAIF,EAAGA,EAAIQ,EAAGf,EAAIY,EAAGF,EAAIG,EAAGD,EAAII,EAAGH,EAAII,CACzC,CAEA,GADYR,IACAE,GAAK,MAAM,IAAI,MAAM,wBAAwB,EACzD,OAAOH,GAAIR,EAAGE,CAAM,CACtB,CAEA,SAASgB,GAAkBC,EAAeC,EAASH,EAAI,CACrD,GAAI,CAACE,EAAG,IAAIA,EAAG,IAAIC,CAAI,EAAGH,CAAC,EAAG,MAAM,IAAI,MAAM,yBAAyB,CACzE,CAMA,SAASI,GAAaF,EAAeF,EAAI,CACvC,IAAMK,GAAUH,EAAG,MAAQR,IAAOY,GAC5BH,EAAOD,EAAG,IAAIF,EAAGK,CAAM,EAC7B,OAAAJ,GAAeC,EAAIC,EAAMH,CAAC,EACnBG,CACT,CAEA,SAASI,GAAaL,EAAeF,EAAI,CACvC,IAAMQ,GAAUN,EAAG,MAAQO,IAAOC,GAC5BC,EAAKT,EAAG,IAAIF,EAAGY,EAAG,EAClBhB,EAAIM,EAAG,IAAIS,EAAIH,CAAM,EACrBK,EAAKX,EAAG,IAAIF,EAAGJ,CAAC,EAChB,EAAIM,EAAG,IAAIA,EAAG,IAAIW,EAAID,EAAG,EAAGhB,CAAC,EAC7BO,EAAOD,EAAG,IAAIW,EAAIX,EAAG,IAAI,EAAGA,EAAG,GAAG,CAAC,EACzC,OAAAD,GAAeC,EAAIC,EAAMH,CAAC,EACnBG,CACT,CAIA,SAASW,GAAWC,EAAS,CAC3B,IAAMC,EAAMC,GAAMF,CAAC,EACbG,EAAKC,GAAcJ,CAAC,EACpBK,EAAKF,EAAGF,EAAKA,EAAI,IAAIA,EAAI,GAAG,CAAC,EAC7BK,EAAKH,EAAGF,EAAKI,CAAE,EACfE,EAAKJ,EAAGF,EAAKA,EAAI,IAAII,CAAE,CAAC,EACxBG,GAAMR,EAAIS,IAAOC,GACvB,MAAO,CAAIvB,EAAeF,IAAQ,CAChC,IAAI0B,EAAMxB,EAAG,IAAIF,EAAGuB,CAAE,EAClBI,EAAMzB,EAAG,IAAIwB,EAAKN,CAAE,EAClBQ,EAAM1B,EAAG,IAAIwB,EAAKL,CAAE,EACpBQ,EAAM3B,EAAG,IAAIwB,EAAKJ,CAAE,EACpBQ,EAAK5B,EAAG,IAAIA,EAAG,IAAIyB,CAAG,EAAG3B,CAAC,EAC1B+B,EAAK7B,EAAG,IAAIA,EAAG,IAAI0B,CAAG,EAAG5B,CAAC,EAChC0B,EAAMxB,EAAG,KAAKwB,EAAKC,EAAKG,CAAE,EAC1BH,EAAMzB,EAAG,KAAK2B,EAAKD,EAAKG,CAAE,EAC1B,IAAMC,EAAK9B,EAAG,IAAIA,EAAG,IAAIyB,CAAG,EAAG3B,CAAC,EAC1BG,EAAOD,EAAG,KAAKwB,EAAKC,EAAKK,CAAE,EACjC,OAAA/B,GAAeC,EAAIC,EAAMH,CAAC,EACnBG,CACT,CACF,CASM,SAAUgB,GAAcJ,EAAS,CAGrC,GAAIA,EAAIkB,GAAK,MAAM,IAAI,MAAM,qCAAqC,EAElE,IAAIC,EAAInB,EAAIrB,GACRyC,EAAI,EACR,KAAOD,EAAItB,KAAQzB,IACjB+C,GAAKtB,GACLuB,IAIF,IAAIC,EAAIxB,GACFyB,EAAMpB,GAAMF,CAAC,EACnB,KAAOuB,GAAWD,EAAKD,CAAC,IAAM,GAG5B,GAAIA,IAAM,IAAM,MAAM,IAAI,MAAM,+CAA+C,EAGjF,GAAID,IAAM,EAAG,OAAO/B,GAIpB,IAAImC,EAAKF,EAAI,IAAID,EAAGF,CAAC,EACfM,GAAUN,EAAIxC,IAAOkB,GAC3B,OAAO,SAAwBV,EAAeF,EAAI,CAChD,GAAIE,EAAG,IAAIF,CAAC,EAAG,OAAOA,EAEtB,GAAIsC,GAAWpC,EAAIF,CAAC,IAAM,EAAG,MAAM,IAAI,MAAM,yBAAyB,EAGtE,IAAIyC,EAAIN,EACJO,EAAIxC,EAAG,IAAIA,EAAG,IAAKqC,CAAE,EACrBI,EAAIzC,EAAG,IAAIF,EAAGkC,CAAC,EACfU,EAAI1C,EAAG,IAAIF,EAAGwC,CAAM,EAIxB,KAAO,CAACtC,EAAG,IAAIyC,EAAGzC,EAAG,GAAG,GAAG,CACzB,GAAIA,EAAG,IAAIyC,CAAC,EAAG,OAAOzC,EAAG,KACzB,IAAI2C,EAAI,EAGJC,EAAQ5C,EAAG,IAAIyC,CAAC,EACpB,KAAO,CAACzC,EAAG,IAAI4C,EAAO5C,EAAG,GAAG,GAG1B,GAFA2C,IACAC,EAAQ5C,EAAG,IAAI4C,CAAK,EAChBD,IAAMJ,EAAG,MAAM,IAAI,MAAM,yBAAyB,EAIxD,IAAMM,EAAWrD,IAAO,OAAO+C,EAAII,EAAI,CAAC,EAClCrD,EAAIU,EAAG,IAAIwC,EAAGK,CAAQ,EAG5BN,EAAII,EACJH,EAAIxC,EAAG,IAAIV,CAAC,EACZmD,EAAIzC,EAAG,IAAIyC,EAAGD,CAAC,EACfE,EAAI1C,EAAG,IAAI0C,EAAGpD,CAAC,CACjB,CACA,OAAOoD,CACT,CACF,CAaM,SAAUI,GAAOjC,EAAS,CAE9B,OAAIA,EAAIT,KAAQ2B,GAAY7B,GAExBW,EAAIL,KAAQD,GAAYF,GAExBQ,EAAIU,KAASwB,GAAYnC,GAAWC,CAAC,EAElCI,GAAcJ,CAAC,CACxB,CAmDA,IAAMmC,GAAe,CACnB,SAAU,UAAW,MAAO,MAAO,MAAO,OAAQ,MAClD,MAAO,MAAO,MAAO,MAAO,MAAO,MACnC,OAAQ,OAAQ,OAAQ,QAEpB,SAAUC,GAAiBC,EAAgB,CAC/C,IAAMC,EAAU,CACd,MAAO,SACP,KAAM,SACN,MAAO,SACP,KAAM,UAEFC,EAAOJ,GAAa,OAAO,CAACK,EAAKC,KACrCD,EAAIC,CAAG,EAAI,WACJD,GACNF,CAAO,EACV,OAAAI,GAAgBL,EAAOE,CAAI,EAIpBF,CACT,CAQM,SAAUM,GAASC,EAAeC,EAAQC,EAAa,CAC3D,GAAIA,EAAQC,GAAK,MAAM,IAAI,MAAM,yCAAyC,EAC1E,GAAID,IAAUC,GAAK,OAAOH,EAAG,IAC7B,GAAIE,IAAUE,GAAK,OAAOH,EAC1B,IAAII,EAAIL,EAAG,IACPM,EAAIL,EACR,KAAOC,EAAQC,IACTD,EAAQE,KAAKC,EAAIL,EAAG,IAAIK,EAAGC,CAAC,GAChCA,EAAIN,EAAG,IAAIM,CAAC,EACZJ,IAAUE,GAEZ,OAAOC,CACT,CAOM,SAAUE,GAAiBP,EAAeQ,EAAWC,EAAW,GAAK,CACzE,IAAMC,EAAW,IAAI,MAAMF,EAAK,MAAM,EAAE,KAAKC,EAAWT,EAAG,KAAO,MAAS,EAErEW,EAAgBH,EAAK,OAAO,CAACI,EAAKX,EAAKY,IACvCb,EAAG,IAAIC,CAAG,EAAUW,GACxBF,EAASG,CAAC,EAAID,EACPZ,EAAG,IAAIY,EAAKX,CAAG,GACrBD,EAAG,GAAG,EAEHc,EAAcd,EAAG,IAAIW,CAAa,EAExC,OAAAH,EAAK,YAAY,CAACI,EAAKX,EAAKY,IACtBb,EAAG,IAAIC,CAAG,EAAUW,GACxBF,EAASG,CAAC,EAAIb,EAAG,IAAIY,EAAKF,EAASG,CAAC,CAAC,EAC9Bb,EAAG,IAAIY,EAAKX,CAAG,GACrBa,CAAW,EACPJ,CACT,CAgBM,SAAUK,GAAcC,EAAeC,EAAI,CAG/C,IAAMC,GAAUF,EAAG,MAAQG,IAAOC,GAC5BC,EAAUL,EAAG,IAAIC,EAAGC,CAAM,EAC1BI,EAAMN,EAAG,IAAIK,EAASL,EAAG,GAAG,EAC5BO,EAAOP,EAAG,IAAIK,EAASL,EAAG,IAAI,EAC9BQ,EAAKR,EAAG,IAAIK,EAASL,EAAG,IAAIA,EAAG,GAAG,CAAC,EACzC,GAAI,CAACM,GAAO,CAACC,GAAQ,CAACC,EAAI,MAAM,IAAI,MAAM,gCAAgC,EAC1E,OAAOF,EAAM,EAAIC,EAAO,EAAI,EAC9B,CAUM,SAAUE,GAAQC,EAAWC,EAAmB,CAEhDA,IAAe,QAAWC,GAAQD,CAAU,EAChD,IAAME,EAAcF,IAAe,OAAYA,EAAaD,EAAE,SAAS,CAAC,EAAE,OACpEI,EAAc,KAAK,KAAKD,EAAc,CAAC,EAC7C,MAAO,CAAE,WAAYA,EAAa,YAAAC,CAAW,CAC/C,CA8BM,SAAUC,GACdC,EACAC,EACAC,EAAO,GACPC,EAA0B,CAAA,EAAE,CAE5B,GAAIH,GAASI,GAAK,MAAM,IAAI,MAAM,0CAA4CJ,CAAK,EACnF,IAAIK,EACAC,EACAC,EAAwB,GACxBC,EACJ,GAAI,OAAOP,GAAiB,UAAYA,GAAgB,KAAM,CAC5D,GAAIE,EAAK,MAAQD,EAAM,MAAM,IAAI,MAAM,sCAAsC,EAC7E,IAAMO,EAAQR,EACVQ,EAAM,OAAMJ,EAAcI,EAAM,MAChCA,EAAM,OAAMH,EAAQG,EAAM,MAC1B,OAAOA,EAAM,MAAS,YAAWP,EAAOO,EAAM,MAC9C,OAAOA,EAAM,cAAiB,YAAWF,EAAeE,EAAM,cAClED,EAAiBC,EAAM,cACzB,MACM,OAAOR,GAAiB,WAAUI,EAAcJ,GAChDE,EAAK,OAAMG,EAAQH,EAAK,MAE9B,GAAM,CAAE,WAAYO,EAAM,YAAaC,CAAK,EAAKlB,GAAQO,EAAOK,CAAW,EAC3E,GAAIM,EAAQ,KAAM,MAAM,IAAI,MAAM,gDAAgD,EAClF,IAAIC,EACE,EAAuB,OAAO,OAAO,CACzC,MAAAZ,EACA,KAAAE,EACA,KAAAQ,EACA,MAAAC,EACA,KAAME,GAAQH,CAAI,EAClB,KAAMN,GACN,IAAKU,GACL,eAAgBN,EAChB,OAASO,GAAQC,GAAID,EAAKf,CAAK,EAC/B,QAAUe,GAAO,CACf,GAAI,OAAOA,GAAQ,SACjB,MAAM,IAAI,MAAM,+CAAiD,OAAOA,CAAG,EAC7E,OAAOX,IAAOW,GAAOA,EAAMf,CAC7B,EACA,IAAMe,GAAQA,IAAQX,GAEtB,YAAcW,GAAgB,CAAC,EAAE,IAAIA,CAAG,GAAK,EAAE,QAAQA,CAAG,EAC1D,MAAQA,IAASA,EAAMD,MAASA,GAChC,IAAMC,GAAQC,GAAI,CAACD,EAAKf,CAAK,EAC7B,IAAK,CAACiB,EAAKC,IAAQD,IAAQC,EAE3B,IAAMH,GAAQC,GAAID,EAAMA,EAAKf,CAAK,EAClC,IAAK,CAACiB,EAAKC,IAAQF,GAAIC,EAAMC,EAAKlB,CAAK,EACvC,IAAK,CAACiB,EAAKC,IAAQF,GAAIC,EAAMC,EAAKlB,CAAK,EACvC,IAAK,CAACiB,EAAKC,IAAQF,GAAIC,EAAMC,EAAKlB,CAAK,EACvC,IAAK,CAACe,EAAKI,IAAUC,GAAM,EAAGL,EAAKI,CAAK,EACxC,IAAK,CAACF,EAAKC,IAAQF,GAAIC,EAAMI,GAAOH,EAAKlB,CAAK,EAAGA,CAAK,EAGtD,KAAOe,GAAQA,EAAMA,EACrB,KAAM,CAACE,EAAKC,IAAQD,EAAMC,EAC1B,KAAM,CAACD,EAAKC,IAAQD,EAAMC,EAC1B,KAAM,CAACD,EAAKC,IAAQD,EAAMC,EAE1B,IAAMH,GAAQM,GAAON,EAAKf,CAAK,EAC/B,KACEM,IACEZ,IACKkB,IAAOA,EAAQU,GAAOtB,CAAK,GACzBY,EAAM,EAAGlB,CAAC,IAErB,QAAUqB,GAASb,EAAOqB,GAAgBR,EAAKJ,CAAK,EAAIa,GAAgBT,EAAKJ,CAAK,EAClF,UAAW,CAACc,EAAOC,EAAiB,KAAQ,CAC1C,GAAIlB,EAAgB,CAClB,GAAI,CAACA,EAAe,SAASiB,EAAM,MAAM,GAAKA,EAAM,OAASd,EAC3D,MAAM,IAAI,MACR,6BAA+BH,EAAiB,eAAiBiB,EAAM,MAAM,EAGjF,IAAME,EAAS,IAAI,WAAWhB,CAAK,EAEnCgB,EAAO,IAAIF,EAAOvB,EAAO,EAAIyB,EAAO,OAASF,EAAM,MAAM,EACzDA,EAAQE,CACV,CACA,GAAIF,EAAM,SAAWd,EACnB,MAAM,IAAI,MAAM,6BAA+BA,EAAQ,eAAiBc,EAAM,MAAM,EACtF,IAAIG,EAAS1B,EAAO2B,GAAgBJ,CAAK,EAAIK,GAAgBL,CAAK,EAElE,GADIlB,IAAcqB,EAASZ,GAAIY,EAAQ5B,CAAK,GACxC,CAAC0B,GACC,CAAC,EAAE,QAAQE,CAAM,EAAG,MAAM,IAAI,MAAM,kDAAkD,EAG5F,OAAOA,CACT,EAEA,YAAcG,GAAQC,GAAc,EAAGD,CAAG,EAG1C,KAAM,CAACE,EAAGC,EAAGC,IAAOA,EAAID,EAAID,EAClB,EACZ,OAAO,OAAO,OAAO,CAAC,CACxB,CAwDM,SAAUG,GAAoBC,EAAkB,CACpD,GAAI,OAAOA,GAAe,SAAU,MAAM,IAAI,MAAM,4BAA4B,EAChF,IAAMC,EAAYD,EAAW,SAAS,CAAC,EAAE,OACzC,OAAO,KAAK,KAAKC,EAAY,CAAC,CAChC,CASM,SAAUC,GAAiBF,EAAkB,CACjD,IAAMG,EAASJ,GAAoBC,CAAU,EAC7C,OAAOG,EAAS,KAAK,KAAKA,EAAS,CAAC,CACtC,CAeM,SAAUC,GAAeC,EAAiBL,EAAoBM,EAAO,GAAK,CAC9E,IAAMC,EAAMF,EAAI,OACVG,EAAWT,GAAoBC,CAAU,EACzCS,EAASP,GAAiBF,CAAU,EAE1C,GAAIO,EAAM,IAAMA,EAAME,GAAUF,EAAM,KACpC,MAAM,IAAI,MAAM,YAAcE,EAAS,6BAA+BF,CAAG,EAC3E,IAAMG,EAAMJ,EAAOK,GAAgBN,CAAG,EAAIO,GAAgBP,CAAG,EAEvDQ,EAAUC,GAAIJ,EAAKV,EAAae,EAAG,EAAIA,GAC7C,OAAOT,EAAOU,GAAgBH,EAASL,CAAQ,EAAIS,GAAgBJ,EAASL,CAAQ,CACtF,CCnlBA,IAAMU,GAAM,OAAO,CAAC,EACdC,GAAM,OAAO,CAAC,EA0Id,SAAUC,GAAwCC,EAAoBC,EAAO,CACjF,IAAMC,EAAMD,EAAK,OAAM,EACvB,OAAOD,EAAYE,EAAMD,CAC3B,CAQM,SAAUE,GACdC,EACAC,EAAW,CAEX,IAAMC,EAAaC,GACjBH,EAAE,GACFC,EAAO,IAAKG,GAAMA,EAAE,CAAE,CAAC,EAEzB,OAAOH,EAAO,IAAI,CAACG,EAAGC,IAAML,EAAE,WAAWI,EAAE,SAASF,EAAWG,CAAC,CAAC,CAAC,CAAC,CACrE,CAEA,SAASC,GAAUC,EAAWC,EAAY,CACxC,GAAI,CAAC,OAAO,cAAcD,CAAC,GAAKA,GAAK,GAAKA,EAAIC,EAC5C,MAAM,IAAI,MAAM,qCAAuCA,EAAO,YAAcD,CAAC,CACjF,CAWA,SAASE,GAAUF,EAAWG,EAAkB,CAC9CJ,GAAUC,EAAGG,CAAU,EACvB,IAAMC,EAAU,KAAK,KAAKD,EAAaH,CAAC,EAAI,EACtCK,EAAa,IAAML,EAAI,GACvBM,EAAY,GAAKN,EACjBO,EAAOC,GAAQR,CAAC,EAChBS,EAAU,OAAOT,CAAC,EACxB,MAAO,CAAE,QAAAI,EAAS,WAAAC,EAAY,KAAAE,EAAM,UAAAD,EAAW,QAAAG,CAAO,CACxD,CAEA,SAASC,GAAYC,EAAWC,EAAgBC,EAAY,CAC1D,GAAM,CAAE,WAAAR,EAAY,KAAAE,EAAM,UAAAD,EAAW,QAAAG,CAAO,EAAKI,EAC7CC,EAAQ,OAAOH,EAAIJ,CAAI,EACvBQ,EAAQJ,GAAKF,EAQbK,EAAQT,IAEVS,GAASR,EACTS,GAAS5B,IAEX,IAAM6B,EAAcJ,EAASP,EACvBY,EAASD,EAAc,KAAK,IAAIF,CAAK,EAAI,EACzCI,EAASJ,IAAU,EACnBK,EAAQL,EAAQ,EAChBM,EAASR,EAAS,IAAM,EAE9B,MAAO,CAAE,MAAAG,EAAO,OAAAE,EAAQ,OAAAC,EAAQ,MAAAC,EAAO,OAAAC,EAAQ,QAD/BJ,CACsC,CACxD,CAEA,SAASK,GAAkB3B,EAAeD,EAAM,CAC9C,GAAI,CAAC,MAAM,QAAQC,CAAM,EAAG,MAAM,IAAI,MAAM,gBAAgB,EAC5DA,EAAO,QAAQ,CAACG,EAAGC,IAAK,CACtB,GAAI,EAAED,aAAaJ,GAAI,MAAM,IAAI,MAAM,0BAA4BK,CAAC,CACtE,CAAC,CACH,CACA,SAASwB,GAAmBC,EAAgBC,EAAU,CACpD,GAAI,CAAC,MAAM,QAAQD,CAAO,EAAG,MAAM,IAAI,MAAM,2BAA2B,EACxEA,EAAQ,QAAQ,CAACE,EAAG3B,IAAK,CACvB,GAAI,CAAC0B,EAAM,QAAQC,CAAC,EAAG,MAAM,IAAI,MAAM,2BAA6B3B,CAAC,CACvE,CAAC,CACH,CAKA,IAAM4B,GAAmB,IAAI,QACvBC,GAAmB,IAAI,QAE7B,SAASC,GAAKC,EAAM,CAGlB,OAAOF,GAAiB,IAAIE,CAAC,GAAK,CACpC,CAEA,SAASC,GAAQnB,EAAS,CACxB,GAAIA,IAAMzB,GAAK,MAAM,IAAI,MAAM,cAAc,CAC/C,CAoBM,IAAO6C,GAAP,KAAW,CAOf,YAAYC,EAAW/B,EAAY,CACjC,KAAK,KAAO+B,EAAM,KAClB,KAAK,KAAOA,EAAM,KAClB,KAAK,GAAKA,EAAM,GAChB,KAAK,KAAO/B,CACd,CAGA,cAAcgC,EAAetB,EAAWd,EAAc,KAAK,KAAI,CAC7D,IAAIqC,EAAcD,EAClB,KAAOtB,EAAIzB,IACLyB,EAAIxB,KAAKU,EAAIA,EAAE,IAAIqC,CAAC,GACxBA,EAAIA,EAAE,OAAM,EACZvB,IAAMxB,GAER,OAAOU,CACT,CAcQ,iBAAiBsC,EAAiBnC,EAAS,CACjD,GAAM,CAAE,QAAAI,EAAS,WAAAC,CAAU,EAAKH,GAAUF,EAAG,KAAK,IAAI,EAChDN,EAAqB,CAAA,EACvBG,EAAcsC,EACdC,EAAOvC,EACX,QAASe,EAAS,EAAGA,EAASR,EAASQ,IAAU,CAC/CwB,EAAOvC,EACPH,EAAO,KAAK0C,CAAI,EAEhB,QAAStC,EAAI,EAAGA,EAAIO,EAAYP,IAC9BsC,EAAOA,EAAK,IAAIvC,CAAC,EACjBH,EAAO,KAAK0C,CAAI,EAElBvC,EAAIuC,EAAK,OAAM,CACjB,CACA,OAAO1C,CACT,CAQQ,KAAKM,EAAWqC,EAAyB,EAAS,CAExD,GAAI,CAAC,KAAK,GAAG,QAAQ,CAAC,EAAG,MAAM,IAAI,MAAM,gBAAgB,EAEzD,IAAIxC,EAAI,KAAK,KACTyC,EAAI,KAAK,KAMPC,EAAKrC,GAAUF,EAAG,KAAK,IAAI,EACjC,QAASY,EAAS,EAAGA,EAAS2B,EAAG,QAAS3B,IAAU,CAElD,GAAM,CAAE,MAAAG,EAAO,OAAAE,EAAQ,OAAAC,EAAQ,MAAAC,EAAO,OAAAC,EAAQ,QAAAoB,CAAO,EAAK9B,GAAY,EAAGE,EAAQ2B,CAAE,EACnF,EAAIxB,EACAG,EAGFoB,EAAIA,EAAE,IAAIlD,GAASgC,EAAQiB,EAAYG,CAAO,CAAC,CAAC,EAGhD3C,EAAIA,EAAE,IAAIT,GAAS+B,EAAOkB,EAAYpB,CAAM,CAAC,CAAC,CAElD,CACA,OAAAa,GAAQ,CAAC,EAIF,CAAE,EAAAjC,EAAG,EAAAyC,CAAC,CACf,CAOQ,WACNtC,EACAqC,EACA,EACAI,EAAgB,KAAK,KAAI,CAEzB,IAAMF,EAAKrC,GAAUF,EAAG,KAAK,IAAI,EACjC,QAASY,EAAS,EAAGA,EAAS2B,EAAG,SAC3B,IAAMrD,GAD8B0B,IAAU,CAElD,GAAM,CAAE,MAAAG,EAAO,OAAAE,EAAQ,OAAAC,EAAQ,MAAAC,CAAK,EAAKT,GAAY,EAAGE,EAAQ2B,CAAE,EAElE,GADA,EAAIxB,EACA,CAAAG,EAIG,CACL,IAAM5B,EAAO+C,EAAYpB,CAAM,EAC/BwB,EAAMA,EAAI,IAAItB,EAAQ7B,EAAK,OAAM,EAAKA,CAAI,CAC5C,CACF,CACA,OAAAwC,GAAQ,CAAC,EACFW,CACT,CAEQ,eAAezC,EAAWmC,EAAiBO,EAA4B,CAE7E,IAAIC,EAAOjB,GAAiB,IAAIS,CAAK,EACrC,OAAKQ,IACHA,EAAO,KAAK,iBAAiBR,EAAOnC,CAAC,EACjCA,IAAM,IAEJ,OAAO0C,GAAc,aAAYC,EAAOD,EAAUC,CAAI,GAC1DjB,GAAiB,IAAIS,EAAOQ,CAAI,IAG7BA,CACT,CAEA,OACER,EACAS,EACAF,EAA4B,CAE5B,IAAM1C,EAAI4B,GAAKO,CAAK,EACpB,OAAO,KAAK,KAAKnC,EAAG,KAAK,eAAeA,EAAGmC,EAAOO,CAAS,EAAGE,CAAM,CACtE,CAEA,OAAOT,EAAiBS,EAAgBF,EAA8BG,EAAe,CACnF,IAAM7C,EAAI4B,GAAKO,CAAK,EACpB,OAAInC,IAAM,EAAU,KAAK,cAAcmC,EAAOS,EAAQC,CAAI,EACnD,KAAK,WAAW7C,EAAG,KAAK,eAAeA,EAAGmC,EAAOO,CAAS,EAAGE,EAAQC,CAAI,CAClF,CAKA,YAAYhB,EAAa7B,EAAS,CAChCD,GAAUC,EAAG,KAAK,IAAI,EACtB2B,GAAiB,IAAIE,EAAG7B,CAAC,EACzB0B,GAAiB,OAAOG,CAAC,CAC3B,CAEA,SAASI,EAAa,CACpB,OAAOL,GAAKK,CAAG,IAAM,CACvB,GAOI,SAAUa,GACdd,EACAG,EACAY,EACAC,EAAU,CAEV,IAAIP,EAAMN,EACNc,EAAKjB,EAAM,KACXkB,EAAKlB,EAAM,KACf,KAAOe,EAAK7D,IAAO8D,EAAK9D,IAClB6D,EAAK5D,KAAK8D,EAAKA,EAAG,IAAIR,CAAG,GACzBO,EAAK7D,KAAK+D,EAAKA,EAAG,IAAIT,CAAG,GAC7BA,EAAMA,EAAI,OAAM,EAChBM,IAAO5D,GACP6D,IAAO7D,GAET,MAAO,CAAE,GAAA8D,EAAI,GAAAC,CAAE,CACjB,CAYM,SAAUC,GACd1D,EACA2D,EACA1D,EACA6B,EAAiB,CAQjBF,GAAkB3B,EAAQD,CAAC,EAC3B6B,GAAmBC,EAAS6B,CAAM,EAClC,IAAMC,EAAU3D,EAAO,OACjB4D,EAAU/B,EAAQ,OACxB,GAAI8B,IAAYC,EAAS,MAAM,IAAI,MAAM,qDAAqD,EAE9F,IAAMC,EAAO9D,EAAE,KACTqB,EAAQ0C,GAAO,OAAOH,CAAO,CAAC,EAChChD,EAAa,EACbS,EAAQ,GAAIT,EAAaS,EAAQ,EAC5BA,EAAQ,EAAGT,EAAaS,EAAQ,EAChCA,EAAQ,IAAGT,EAAa,GACjC,IAAMoD,EAAOjD,GAAQH,CAAU,EACzBqD,EAAU,IAAI,MAAM,OAAOD,CAAI,EAAI,CAAC,EAAE,KAAKF,CAAI,EAC/CI,EAAW,KAAK,OAAOP,EAAO,KAAO,GAAK/C,CAAU,EAAIA,EAC1DuD,EAAML,EACV,QAASzD,EAAI6D,EAAU7D,GAAK,EAAGA,GAAKO,EAAY,CAC9CqD,EAAQ,KAAKH,CAAI,EACjB,QAASM,EAAI,EAAGA,EAAIP,EAASO,IAAK,CAChC,IAAMjB,EAASrB,EAAQsC,CAAC,EAClB/C,EAAQ,OAAQ8B,GAAU,OAAO9C,CAAC,EAAK2D,CAAI,EACjDC,EAAQ5C,CAAK,EAAI4C,EAAQ5C,CAAK,EAAE,IAAIpB,EAAOmE,CAAC,CAAC,CAC/C,CACA,IAAIC,EAAOP,EAEX,QAASM,EAAIH,EAAQ,OAAS,EAAGK,EAAOR,EAAMM,EAAI,EAAGA,IACnDE,EAAOA,EAAK,IAAIL,EAAQG,CAAC,CAAC,EAC1BC,EAAOA,EAAK,IAAIC,CAAI,EAGtB,GADAH,EAAMA,EAAI,IAAIE,CAAI,EACdhE,IAAM,EAAG,QAAS+D,EAAI,EAAGA,EAAIxD,EAAYwD,IAAKD,EAAMA,EAAI,OAAM,CACpE,CACA,OAAOA,CACT,CAkJA,SAASI,GAAeC,EAAeC,EAAmBC,EAAc,CACtE,GAAID,EAAO,CACT,GAAIA,EAAM,QAAUD,EAAO,MAAM,IAAI,MAAM,gDAAgD,EAC3F,OAAAG,GAAcF,CAAK,EACZA,CACT,KACE,QAAOG,GAAMJ,EAAO,CAAE,KAAAE,CAAI,CAAE,CAEhC,CAIM,SAAUG,GACdC,EACAC,EACAC,EAA8B,CAAA,EAC9BC,EAAgB,CAGhB,GADIA,IAAW,SAAWA,EAASH,IAAS,WACxC,CAACC,GAAS,OAAOA,GAAU,SAAU,MAAM,IAAI,MAAM,kBAAkBD,CAAI,eAAe,EAC9F,QAAWI,IAAK,CAAC,IAAK,IAAK,GAAG,EAAY,CACxC,IAAMC,EAAMJ,EAAMG,CAAC,EACnB,GAAI,EAAE,OAAOC,GAAQ,UAAYA,EAAMC,IACrC,MAAM,IAAI,MAAM,SAASF,CAAC,0BAA0B,CACxD,CACA,IAAMG,EAAKd,GAAYQ,EAAM,EAAGC,EAAU,GAAIC,CAAM,EAC9CK,EAAKf,GAAYQ,EAAM,EAAGC,EAAU,GAAIC,CAAM,EAE9CM,EAAS,CAAC,KAAM,KAAM,IADNT,IAAS,cAAgB,IAAM,GAClB,EACnC,QAAWI,KAAKK,EAEd,GAAI,CAACF,EAAG,QAAQN,EAAMG,CAAC,CAAC,EACtB,MAAM,IAAI,MAAM,SAASA,CAAC,0CAA0C,EAExE,OAAAH,EAAQ,OAAO,OAAO,OAAO,OAAO,CAAA,EAAIA,CAAK,CAAC,EACvC,CAAE,MAAAA,EAAO,GAAAM,EAAI,GAAAC,CAAE,CACxB,CCtkBA,IAAME,GAAa,CAACC,EAAaC,KAAiBD,GAAOA,GAAO,EAAIC,EAAM,CAACA,GAAOC,IAAOD,EAOnF,SAAUE,GAAiBC,EAAWC,EAAkBC,EAAS,CAIrE,GAAM,CAAC,CAACC,EAAIC,CAAE,EAAG,CAACC,EAAIC,CAAE,CAAC,EAAIL,EACvBM,EAAKZ,GAAWW,EAAKN,EAAGE,CAAC,EACzBM,EAAKb,GAAW,CAACS,EAAKJ,EAAGE,CAAC,EAG5BO,EAAKT,EAAIO,EAAKJ,EAAKK,EAAKH,EACxBK,EAAK,CAACH,EAAKH,EAAKI,EAAKF,EACnBK,EAAQF,EAAKG,GACbC,EAAQH,EAAKE,GACfD,IAAOF,EAAK,CAACA,GACbI,IAAOH,EAAK,CAACA,GAGjB,IAAMI,EAAUC,GAAQ,KAAK,KAAKC,GAAOd,CAAC,EAAI,CAAC,CAAC,EAAIe,GACpD,GAAIR,EAAKG,IAAOH,GAAMK,GAAWJ,EAAKE,IAAOF,GAAMI,EACjD,MAAM,IAAI,MAAM,yCAA2Cd,CAAC,EAE9D,MAAO,CAAE,MAAAW,EAAO,GAAAF,EAAI,MAAAI,EAAO,GAAAH,CAAE,CAC/B,CAkBA,SAASQ,GAAkBC,EAAc,CACvC,GAAI,CAAC,CAAC,UAAW,YAAa,KAAK,EAAE,SAASA,CAAM,EAClD,MAAM,IAAI,MAAM,2DAA2D,EAC7E,OAAOA,CACT,CAEA,SAASC,GACPC,EACAC,EAAM,CAEN,IAAMC,EAAuB,CAAA,EAC7B,QAASC,KAAW,OAAO,KAAKF,CAAG,EAEjCC,EAAMC,CAAO,EAAIH,EAAKG,CAAO,IAAM,OAAYF,EAAIE,CAAO,EAAIH,EAAKG,CAAO,EAE5E,OAAAC,GAAMF,EAAM,KAAO,MAAM,EACzBE,GAAMF,EAAM,QAAU,SAAS,EAC3BA,EAAM,SAAW,QAAWL,GAAkBK,EAAM,MAAM,EACvDA,CACT,CAmJM,IAAOG,GAAP,cAAsB,KAAK,CAC/B,YAAYC,EAAI,GAAE,CAChB,MAAMA,CAAC,CACT,GA6BWC,GAAY,CAEvB,IAAKF,GAEL,KAAM,CACJ,OAAQ,CAACG,EAAaC,IAAwB,CAC5C,GAAM,CAAE,IAAKC,CAAC,EAAKH,GACnB,GAAIC,EAAM,GAAKA,EAAM,IAAK,MAAM,IAAIE,EAAE,uBAAuB,EAC7D,GAAID,EAAK,OAAS,EAAG,MAAM,IAAIC,EAAE,2BAA2B,EAC5D,IAAMC,EAAUF,EAAK,OAAS,EACxBG,EAAMC,GAAoBF,CAAO,EACvC,GAAKC,EAAI,OAAS,EAAK,IAAa,MAAM,IAAIF,EAAE,sCAAsC,EAEtF,IAAMI,EAASH,EAAU,IAAME,GAAqBD,EAAI,OAAS,EAAK,GAAW,EAAI,GAErF,OADUC,GAAoBL,CAAG,EACtBM,EAASF,EAAMH,CAC5B,EAEA,OAAOD,EAAaC,EAAgB,CAClC,GAAM,CAAE,IAAKC,CAAC,EAAKH,GACfQ,EAAM,EACV,GAAIP,EAAM,GAAKA,EAAM,IAAK,MAAM,IAAIE,EAAE,uBAAuB,EAC7D,GAAID,EAAK,OAAS,GAAKA,EAAKM,GAAK,IAAMP,EAAK,MAAM,IAAIE,EAAE,uBAAuB,EAC/E,IAAMM,EAAQP,EAAKM,GAAK,EAClBE,EAAS,CAAC,EAAED,EAAQ,KACtBE,EAAS,EACb,GAAI,CAACD,EAAQC,EAASF,MACjB,CAEH,IAAMF,EAASE,EAAQ,IACvB,GAAI,CAACF,EAAQ,MAAM,IAAIJ,EAAE,mDAAmD,EAC5E,GAAII,EAAS,EAAG,MAAM,IAAIJ,EAAE,0CAA0C,EACtE,IAAMS,EAAcV,EAAK,SAASM,EAAKA,EAAMD,CAAM,EACnD,GAAIK,EAAY,SAAWL,EAAQ,MAAM,IAAIJ,EAAE,uCAAuC,EACtF,GAAIS,EAAY,CAAC,IAAM,EAAG,MAAM,IAAIT,EAAE,sCAAsC,EAC5E,QAAWU,KAAKD,EAAaD,EAAUA,GAAU,EAAKE,EAEtD,GADAL,GAAOD,EACHI,EAAS,IAAK,MAAM,IAAIR,EAAE,wCAAwC,CACxE,CACA,IAAMW,EAAIZ,EAAK,SAASM,EAAKA,EAAMG,CAAM,EACzC,GAAIG,EAAE,SAAWH,EAAQ,MAAM,IAAIR,EAAE,gCAAgC,EACrE,MAAO,CAAE,EAAAW,EAAG,EAAGZ,EAAK,SAASM,EAAMG,CAAM,CAAC,CAC5C,GAMF,KAAM,CACJ,OAAO3C,EAAW,CAChB,GAAM,CAAE,IAAKmC,CAAC,EAAKH,GACnB,GAAIhC,EAAMgB,GAAK,MAAM,IAAImB,EAAE,4CAA4C,EACvE,IAAIY,EAAMT,GAAoBtC,CAAG,EAGjC,GADI,OAAO,SAAS+C,EAAI,CAAC,EAAG,EAAE,EAAI,IAAQA,EAAM,KAAOA,GACnDA,EAAI,OAAS,EAAG,MAAM,IAAIZ,EAAE,gDAAgD,EAChF,OAAOY,CACT,EACA,OAAOb,EAAgB,CACrB,GAAM,CAAE,IAAKC,CAAC,EAAKH,GACnB,GAAIE,EAAK,CAAC,EAAI,IAAa,MAAM,IAAIC,EAAE,qCAAqC,EAC5E,GAAID,EAAK,CAAC,IAAM,GAAQ,EAAEA,EAAK,CAAC,EAAI,KAClC,MAAM,IAAIC,EAAE,qDAAqD,EACnE,OAAOa,GAAgBd,CAAI,CAC7B,GAEF,MAAMa,EAAwB,CAE5B,GAAM,CAAE,IAAKZ,EAAG,KAAMc,EAAK,KAAMC,CAAG,EAAKlB,GACnCE,EAAOiB,GAAY,YAAaJ,CAAG,EACnC,CAAE,EAAGK,EAAU,EAAGC,CAAY,EAAKH,EAAI,OAAO,GAAMhB,CAAI,EAC9D,GAAImB,EAAa,OAAQ,MAAM,IAAIlB,EAAE,6CAA6C,EAClF,GAAM,CAAE,EAAGmB,EAAQ,EAAGC,CAAU,EAAKL,EAAI,OAAO,EAAME,CAAQ,EACxD,CAAE,EAAGI,EAAQC,CAAa,EAAKP,EAAI,OAAO,EAAMK,CAAU,EAChE,GAAIE,EAAW,OAAQ,MAAM,IAAItB,EAAE,6CAA6C,EAChF,MAAO,CAAE,EAAGc,EAAI,OAAOK,CAAM,EAAG,EAAGL,EAAI,OAAOO,CAAM,CAAC,CACvD,EACA,WAAWE,EAA6B,CACtC,GAAM,CAAE,KAAMR,EAAK,KAAMD,CAAG,EAAKjB,GAC3B2B,EAAKT,EAAI,OAAO,EAAMD,EAAI,OAAOS,EAAI,CAAC,CAAC,EACvCE,EAAKV,EAAI,OAAO,EAAMD,EAAI,OAAOS,EAAI,CAAC,CAAC,EACvCG,EAAMF,EAAKC,EACjB,OAAOV,EAAI,OAAO,GAAMW,CAAG,CAC7B,GAKI7C,GAAM,OAAO,CAAC,EAAGK,GAAM,OAAO,CAAC,EAAGnB,GAAM,OAAO,CAAC,EAAG4D,GAAM,OAAO,CAAC,EAAGC,GAAM,OAAO,CAAC,EAElF,SAAUC,GAAeC,EAAoBC,EAAY,CAC7D,GAAM,CAAE,MAAOC,CAAQ,EAAKF,EACxBjE,EACJ,GAAI,OAAOkE,GAAQ,SACjBlE,EAAMkE,MACD,CACL,IAAIE,EAAQjB,GAAY,cAAee,CAAG,EAC1C,GAAI,CACFlE,EAAMiE,EAAG,UAAUG,CAAK,CAC1B,MAAgB,CACd,MAAM,IAAI,MAAM,8CAA8CD,CAAQ,SAAS,OAAOD,CAAG,EAAE,CAC7F,CACF,CACA,GAAI,CAACD,EAAG,YAAYjE,CAAG,EAAG,MAAM,IAAI,MAAM,4CAA4C,EACtF,OAAOA,CACT,CAmBM,SAAUqE,GACdC,EACAC,EAAqC,CAAA,EAAE,CAEvC,IAAMC,EAAYC,GAAmB,cAAeH,EAAQC,CAAS,EAC/D,CAAE,GAAAG,EAAI,GAAAT,CAAE,EAAKO,EACfG,EAAQH,EAAU,MAChB,CAAE,EAAGI,EAAU,EAAGC,CAAW,EAAKF,EACxCG,GACEP,EACA,CAAA,EACA,CACE,mBAAoB,UACpB,cAAe,WACf,cAAe,WACf,UAAW,WACX,QAAS,WACT,KAAM,SACN,eAAgB,UACjB,EAGH,GAAM,CAAE,KAAAQ,CAAI,EAAKR,EACjB,GAAIQ,IAEE,CAACL,EAAG,IAAIC,EAAM,CAAC,GAAK,OAAOI,EAAK,MAAS,UAAY,CAAC,MAAM,QAAQA,EAAK,OAAO,GAClF,MAAM,IAAI,MAAM,4DAA4D,EAIhF,IAAMC,EAAUC,GAAYP,EAAIT,CAAE,EAElC,SAASiB,GAA4B,CACnC,GAAI,CAACR,EAAG,MAAO,MAAM,IAAI,MAAM,4DAA4D,CAC7F,CAGA,SAASS,EACPC,EACAC,EACAC,EAAqB,CAErB,GAAM,CAAE,EAAAC,EAAG,EAAAC,CAAC,EAAKH,EAAM,SAAQ,EACzBI,EAAKf,EAAG,QAAQa,CAAC,EAEvB,GADA1D,GAAMyD,EAAc,cAAc,EAC9BA,EAAc,CAChBJ,EAA4B,EAC5B,IAAMQ,EAAW,CAAChB,EAAG,MAAOc,CAAC,EAC7B,OAAOG,GAAYC,GAAQF,CAAQ,EAAGD,CAAE,CAC1C,KACE,QAAOE,GAAY,WAAW,GAAG,CAAI,EAAGF,EAAIf,EAAG,QAAQc,CAAC,CAAC,CAE7D,CACA,SAASK,EAAezB,EAAiB,CACvC0B,GAAO1B,EAAO,OAAW,OAAO,EAChC,GAAM,CAAE,UAAW2B,EAAM,sBAAuBC,CAAM,EAAKhB,EACrDrC,EAASyB,EAAM,OACf6B,EAAO7B,EAAM,CAAC,EACd8B,EAAO9B,EAAM,SAAS,CAAC,EAE7B,GAAIzB,IAAWoD,IAASE,IAAS,GAAQA,IAAS,GAAO,CACvD,IAAMV,EAAIb,EAAG,UAAUwB,CAAI,EAC3B,GAAI,CAACxB,EAAG,QAAQa,CAAC,EAAG,MAAM,IAAI,MAAM,qCAAqC,EACzE,IAAMY,EAAKC,EAAoBb,CAAC,EAC5BC,EACJ,GAAI,CACFA,EAAId,EAAG,KAAKyB,CAAE,CAChB,OAASE,GAAW,CAClB,IAAMC,EAAMD,cAAqB,MAAQ,KAAOA,GAAU,QAAU,GACpE,MAAM,IAAI,MAAM,yCAA2CC,CAAG,CAChE,CACApB,EAA4B,EAC5B,IAAMqB,EAAS7B,EAAG,MAAOc,CAAC,EAE1B,OADmBS,EAAO,KAAO,IACfM,IAAQf,EAAId,EAAG,IAAIc,CAAC,GAC/B,CAAE,EAAAD,EAAG,EAAAC,CAAC,CACf,SAAW7C,IAAWqD,GAAUC,IAAS,EAAM,CAE7C,IAAMO,EAAI9B,EAAG,MACPa,EAAIb,EAAG,UAAUwB,EAAK,SAAS,EAAGM,CAAC,CAAC,EACpChB,EAAId,EAAG,UAAUwB,EAAK,SAASM,EAAGA,EAAI,CAAC,CAAC,EAC9C,GAAI,CAACC,EAAUlB,EAAGC,CAAC,EAAG,MAAM,IAAI,MAAM,4BAA4B,EAClE,MAAO,CAAE,EAAAD,EAAG,EAAAC,CAAC,CACf,KACE,OAAM,IAAI,MACR,yBAAyB7C,CAAM,yBAAyBoD,CAAI,oBAAoBC,CAAM,EAAE,CAG9F,CAEA,IAAMU,EAAcnC,EAAU,SAAWY,EACnCwB,EAAcpC,EAAU,WAAasB,EAC3C,SAASO,EAAoBb,EAAI,CAC/B,IAAMqB,EAAKlC,EAAG,IAAIa,CAAC,EACbsB,EAAKnC,EAAG,IAAIkC,EAAIrB,CAAC,EACvB,OAAOb,EAAG,IAAIA,EAAG,IAAImC,EAAInC,EAAG,IAAIa,EAAGZ,EAAM,CAAC,CAAC,EAAGA,EAAM,CAAC,CACvD,CAIA,SAAS8B,EAAUlB,EAAM,EAAI,CAC3B,IAAMuB,EAAOpC,EAAG,IAAI,CAAC,EACfqC,EAAQX,EAAoBb,CAAC,EACnC,OAAOb,EAAG,IAAIoC,EAAMC,CAAK,CAC3B,CAIA,GAAI,CAACN,EAAU9B,EAAM,GAAIA,EAAM,EAAE,EAAG,MAAM,IAAI,MAAM,mCAAmC,EAIvF,IAAMqC,EAAOtC,EAAG,IAAIA,EAAG,IAAIC,EAAM,EAAGb,EAAG,EAAGC,EAAG,EACvCkD,EAAQvC,EAAG,IAAIA,EAAG,IAAIC,EAAM,CAAC,EAAG,OAAO,EAAE,CAAC,EAChD,GAAID,EAAG,IAAIA,EAAG,IAAIsC,EAAMC,CAAK,CAAC,EAAG,MAAM,IAAI,MAAM,0BAA0B,EAG3E,SAASC,EAAOC,EAAe7G,EAAM8G,EAAU,GAAK,CAClD,GAAI,CAAC1C,EAAG,QAAQpE,CAAC,GAAM8G,GAAW1C,EAAG,IAAIpE,CAAC,EAAI,MAAM,IAAI,MAAM,wBAAwB6G,CAAK,EAAE,EAC7F,OAAO7G,CACT,CAEA,SAAS+G,EAAUC,EAAc,CAC/B,GAAI,EAAEA,aAAiBC,GAAQ,MAAM,IAAI,MAAM,0BAA0B,CAC3E,CAEA,SAASC,EAAiBpH,EAAS,CACjC,GAAI,CAAC2E,GAAQ,CAACA,EAAK,QAAS,MAAM,IAAI,MAAM,SAAS,EACrD,OAAO5E,GAAiBC,EAAG2E,EAAK,QAASd,EAAG,KAAK,CACnD,CAOA,IAAMwD,GAAeC,GAAS,CAACC,EAAUC,IAA0B,CACjE,GAAM,CAAE,EAAAC,EAAG,EAAAC,EAAG,EAAAC,CAAC,EAAKJ,EAEpB,GAAIjD,EAAG,IAAIqD,EAAGrD,EAAG,GAAG,EAAG,MAAO,CAAE,EAAGmD,EAAG,EAAGC,CAAC,EAC1C,IAAME,EAAML,EAAE,IAAG,EAGbC,GAAM,OAAMA,EAAKI,EAAMtD,EAAG,IAAMA,EAAG,IAAIqD,CAAC,GAC5C,IAAMxC,EAAIb,EAAG,IAAImD,EAAGD,CAAE,EAChBpC,EAAId,EAAG,IAAIoD,EAAGF,CAAE,EAChBK,EAAKvD,EAAG,IAAIqD,EAAGH,CAAE,EACvB,GAAII,EAAK,MAAO,CAAE,EAAGtD,EAAG,KAAM,EAAGA,EAAG,IAAI,EACxC,GAAI,CAACA,EAAG,IAAIuD,EAAIvD,EAAG,GAAG,EAAG,MAAM,IAAI,MAAM,kBAAkB,EAC3D,MAAO,CAAE,EAAAa,EAAG,EAAAC,CAAC,CACf,CAAC,EAGK0C,GAAkBR,GAAUC,GAAY,CAC5C,GAAIA,EAAE,IAAG,EAAI,CAIX,GAAIpD,EAAU,oBAAsB,CAACG,EAAG,IAAIiD,EAAE,CAAC,EAAG,OAClD,MAAM,IAAI,MAAM,iBAAiB,CACnC,CAEA,GAAM,CAAE,EAAApC,EAAG,EAAAC,CAAC,EAAKmC,EAAE,SAAQ,EAC3B,GAAI,CAACjD,EAAG,QAAQa,CAAC,GAAK,CAACb,EAAG,QAAQc,CAAC,EAAG,MAAM,IAAI,MAAM,sCAAsC,EAC5F,GAAI,CAACiB,EAAUlB,EAAGC,CAAC,EAAG,MAAM,IAAI,MAAM,mCAAmC,EACzE,GAAI,CAACmC,EAAE,cAAa,EAAI,MAAM,IAAI,MAAM,wCAAwC,EAChF,MAAO,EACT,CAAC,EAED,SAASQ,GACPC,EACAC,EACAC,EACAvH,EACAE,EAAc,CAEd,OAAAqH,EAAM,IAAIf,EAAM7C,EAAG,IAAI4D,EAAI,EAAGF,CAAQ,EAAGE,EAAI,EAAGA,EAAI,CAAC,EACrDD,EAAME,GAASxH,EAAOsH,CAAG,EACzBC,EAAMC,GAAStH,EAAOqH,CAAG,EAClBD,EAAI,IAAIC,CAAG,CACpB,CAOA,MAAMf,CAAK,CAeT,YAAYM,EAAMC,EAAMC,EAAI,CAC1B,KAAK,EAAIb,EAAO,IAAKW,CAAC,EACtB,KAAK,EAAIX,EAAO,IAAKY,EAAG,EAAI,EAC5B,KAAK,EAAIZ,EAAO,IAAKa,CAAC,EACtB,OAAO,OAAO,IAAI,CACpB,CAEA,OAAO,OAAK,CACV,OAAOpD,CACT,CAGA,OAAO,WAAWgD,EAAiB,CACjC,GAAM,CAAE,EAAApC,EAAG,EAAAC,CAAC,EAAKmC,GAAK,CAAA,EACtB,GAAI,CAACA,GAAK,CAACjD,EAAG,QAAQa,CAAC,GAAK,CAACb,EAAG,QAAQc,CAAC,EAAG,MAAM,IAAI,MAAM,sBAAsB,EAClF,GAAImC,aAAaJ,EAAO,MAAM,IAAI,MAAM,8BAA8B,EAEtE,OAAI7C,EAAG,IAAIa,CAAC,GAAKb,EAAG,IAAIc,CAAC,EAAU+B,EAAM,KAClC,IAAIA,EAAMhC,EAAGC,EAAGd,EAAG,GAAG,CAC/B,CAEA,OAAO,UAAUN,EAAiB,CAChC,IAAMoE,EAAIjB,EAAM,WAAWZ,EAAYb,GAAO1B,EAAO,OAAW,OAAO,CAAC,CAAC,EACzE,OAAAoE,EAAE,eAAc,EACTA,CACT,CACA,OAAO,QAAQzF,EAAQ,CACrB,OAAOwE,EAAM,UAAUpE,GAAY,WAAYJ,CAAG,CAAC,CACrD,CAEA,IAAI,GAAC,CACH,OAAO,KAAK,SAAQ,EAAG,CACzB,CACA,IAAI,GAAC,CACH,OAAO,KAAK,SAAQ,EAAG,CACzB,CAQA,WAAW0F,EAAqB,EAAGC,EAAS,GAAI,CAC9C,OAAAC,GAAK,YAAY,KAAMF,CAAU,EAC5BC,GAAQ,KAAK,SAAS5E,EAAG,EACvB,IACT,CAIA,gBAAc,CACZoE,GAAgB,IAAI,CACtB,CAEA,UAAQ,CACN,GAAM,CAAE,CAAC,EAAK,KAAK,SAAQ,EAC3B,GAAI,CAACxD,EAAG,MAAO,MAAM,IAAI,MAAM,6BAA6B,EAC5D,MAAO,CAACA,EAAG,MAAM,CAAC,CACpB,CAGA,OAAO4C,EAAY,CACjBD,EAAUC,CAAK,EACf,GAAM,CAAE,EAAGsB,EAAI,EAAGC,EAAI,EAAGC,CAAE,EAAK,KAC1B,CAAE,EAAGC,EAAI,EAAGC,EAAI,EAAGC,CAAE,EAAK3B,EAC1B4B,EAAKxE,EAAG,IAAIA,EAAG,IAAIkE,EAAIK,CAAE,EAAGvE,EAAG,IAAIqE,EAAID,CAAE,CAAC,EAC1CK,EAAKzE,EAAG,IAAIA,EAAG,IAAImE,EAAII,CAAE,EAAGvE,EAAG,IAAIsE,EAAIF,CAAE,CAAC,EAChD,OAAOI,GAAMC,CACf,CAGA,QAAM,CACJ,OAAO,IAAI5B,EAAM,KAAK,EAAG7C,EAAG,IAAI,KAAK,CAAC,EAAG,KAAK,CAAC,CACjD,CAMA,QAAM,CACJ,GAAM,CAAE,EAAA0E,EAAG,EAAAvG,CAAC,EAAK8B,EACX0E,EAAK3E,EAAG,IAAI7B,EAAGiB,EAAG,EAClB,CAAE,EAAG8E,EAAI,EAAGC,EAAI,EAAGC,CAAE,EAAK,KAC5BQ,EAAK5E,EAAG,KAAM6E,EAAK7E,EAAG,KAAM8E,EAAK9E,EAAG,KACpC+E,EAAK/E,EAAG,IAAIkE,EAAIA,CAAE,EAClBc,GAAKhF,EAAG,IAAImE,EAAIA,CAAE,EAClBc,EAAKjF,EAAG,IAAIoE,EAAIA,CAAE,EAClBc,EAAKlF,EAAG,IAAIkE,EAAIC,CAAE,EACtB,OAAAe,EAAKlF,EAAG,IAAIkF,EAAIA,CAAE,EAClBJ,EAAK9E,EAAG,IAAIkE,EAAIE,CAAE,EAClBU,EAAK9E,EAAG,IAAI8E,EAAIA,CAAE,EAClBF,EAAK5E,EAAG,IAAI0E,EAAGI,CAAE,EACjBD,EAAK7E,EAAG,IAAI2E,EAAIM,CAAE,EAClBJ,EAAK7E,EAAG,IAAI4E,EAAIC,CAAE,EAClBD,EAAK5E,EAAG,IAAIgF,GAAIH,CAAE,EAClBA,EAAK7E,EAAG,IAAIgF,GAAIH,CAAE,EAClBA,EAAK7E,EAAG,IAAI4E,EAAIC,CAAE,EAClBD,EAAK5E,EAAG,IAAIkF,EAAIN,CAAE,EAClBE,EAAK9E,EAAG,IAAI2E,EAAIG,CAAE,EAClBG,EAAKjF,EAAG,IAAI0E,EAAGO,CAAE,EACjBC,EAAKlF,EAAG,IAAI+E,EAAIE,CAAE,EAClBC,EAAKlF,EAAG,IAAI0E,EAAGQ,CAAE,EACjBA,EAAKlF,EAAG,IAAIkF,EAAIJ,CAAE,EAClBA,EAAK9E,EAAG,IAAI+E,EAAIA,CAAE,EAClBA,EAAK/E,EAAG,IAAI8E,EAAIC,CAAE,EAClBA,EAAK/E,EAAG,IAAI+E,EAAIE,CAAE,EAClBF,EAAK/E,EAAG,IAAI+E,EAAIG,CAAE,EAClBL,EAAK7E,EAAG,IAAI6E,EAAIE,CAAE,EAClBE,EAAKjF,EAAG,IAAImE,EAAIC,CAAE,EAClBa,EAAKjF,EAAG,IAAIiF,EAAIA,CAAE,EAClBF,EAAK/E,EAAG,IAAIiF,EAAIC,CAAE,EAClBN,EAAK5E,EAAG,IAAI4E,EAAIG,CAAE,EAClBD,EAAK9E,EAAG,IAAIiF,EAAID,EAAE,EAClBF,EAAK9E,EAAG,IAAI8E,EAAIA,CAAE,EAClBA,EAAK9E,EAAG,IAAI8E,EAAIA,CAAE,EACX,IAAIjC,EAAM+B,EAAIC,EAAIC,CAAE,CAC7B,CAMA,IAAIlC,EAAY,CACdD,EAAUC,CAAK,EACf,GAAM,CAAE,EAAGsB,EAAI,EAAGC,EAAI,EAAGC,CAAE,EAAK,KAC1B,CAAE,EAAGC,EAAI,EAAGC,EAAI,EAAGC,CAAE,EAAK3B,EAC5BgC,EAAK5E,EAAG,KAAM6E,EAAK7E,EAAG,KAAM8E,EAAK9E,EAAG,KAClC0E,GAAIzE,EAAM,EACV0E,EAAK3E,EAAG,IAAIC,EAAM,EAAGb,EAAG,EAC1B2F,EAAK/E,EAAG,IAAIkE,EAAIG,CAAE,EAClBW,EAAKhF,EAAG,IAAImE,EAAIG,CAAE,EAClBW,GAAKjF,EAAG,IAAIoE,EAAIG,CAAE,EAClBW,GAAKlF,EAAG,IAAIkE,EAAIC,CAAE,EAClBgB,EAAKnF,EAAG,IAAIqE,EAAIC,CAAE,EACtBY,GAAKlF,EAAG,IAAIkF,GAAIC,CAAE,EAClBA,EAAKnF,EAAG,IAAI+E,EAAIC,CAAE,EAClBE,GAAKlF,EAAG,IAAIkF,GAAIC,CAAE,EAClBA,EAAKnF,EAAG,IAAIkE,EAAIE,CAAE,EAClB,IAAIgB,GAAKpF,EAAG,IAAIqE,EAAIE,CAAE,EACtB,OAAAY,EAAKnF,EAAG,IAAImF,EAAIC,EAAE,EAClBA,GAAKpF,EAAG,IAAI+E,EAAIE,EAAE,EAClBE,EAAKnF,EAAG,IAAImF,EAAIC,EAAE,EAClBA,GAAKpF,EAAG,IAAImE,EAAIC,CAAE,EAClBQ,EAAK5E,EAAG,IAAIsE,EAAIC,CAAE,EAClBa,GAAKpF,EAAG,IAAIoF,GAAIR,CAAE,EAClBA,EAAK5E,EAAG,IAAIgF,EAAIC,EAAE,EAClBG,GAAKpF,EAAG,IAAIoF,GAAIR,CAAE,EAClBE,EAAK9E,EAAG,IAAI0E,GAAGS,CAAE,EACjBP,EAAK5E,EAAG,IAAI2E,EAAIM,EAAE,EAClBH,EAAK9E,EAAG,IAAI4E,EAAIE,CAAE,EAClBF,EAAK5E,EAAG,IAAIgF,EAAIF,CAAE,EAClBA,EAAK9E,EAAG,IAAIgF,EAAIF,CAAE,EAClBD,EAAK7E,EAAG,IAAI4E,EAAIE,CAAE,EAClBE,EAAKhF,EAAG,IAAI+E,EAAIA,CAAE,EAClBC,EAAKhF,EAAG,IAAIgF,EAAID,CAAE,EAClBE,GAAKjF,EAAG,IAAI0E,GAAGO,EAAE,EACjBE,EAAKnF,EAAG,IAAI2E,EAAIQ,CAAE,EAClBH,EAAKhF,EAAG,IAAIgF,EAAIC,EAAE,EAClBA,GAAKjF,EAAG,IAAI+E,EAAIE,EAAE,EAClBA,GAAKjF,EAAG,IAAI0E,GAAGO,EAAE,EACjBE,EAAKnF,EAAG,IAAImF,EAAIF,EAAE,EAClBF,EAAK/E,EAAG,IAAIgF,EAAIG,CAAE,EAClBN,EAAK7E,EAAG,IAAI6E,EAAIE,CAAE,EAClBA,EAAK/E,EAAG,IAAIoF,GAAID,CAAE,EAClBP,EAAK5E,EAAG,IAAIkF,GAAIN,CAAE,EAClBA,EAAK5E,EAAG,IAAI4E,EAAIG,CAAE,EAClBA,EAAK/E,EAAG,IAAIkF,GAAIF,CAAE,EAClBF,EAAK9E,EAAG,IAAIoF,GAAIN,CAAE,EAClBA,EAAK9E,EAAG,IAAI8E,EAAIC,CAAE,EACX,IAAIlC,EAAM+B,EAAIC,EAAIC,CAAE,CAC7B,CAEA,SAASlC,EAAY,CACnB,OAAO,KAAK,IAAIA,EAAM,OAAM,CAAE,CAChC,CAEA,KAAG,CACD,OAAO,KAAK,OAAOC,EAAM,IAAI,CAC/B,CAWA,SAASwC,EAAc,CACrB,GAAM,CAAE,KAAAhF,CAAI,EAAKR,EACjB,GAAI,CAACN,EAAG,YAAY8F,CAAM,EAAG,MAAM,IAAI,MAAM,8BAA8B,EAC3E,IAAI1E,EAAc2E,EACZC,EAAO3J,GAAcqI,GAAK,OAAO,KAAMrI,EAAIqH,GAAMuC,GAAW3C,EAAOI,CAAC,CAAC,EAE3E,GAAI5C,EAAM,CACR,GAAM,CAAE,MAAAhE,EAAO,GAAAF,EAAI,MAAAI,EAAO,GAAAH,CAAE,EAAK0G,EAAiBuC,CAAM,EAClD,CAAE,EAAG1B,EAAK,EAAG8B,EAAG,EAAKF,EAAIpJ,CAAE,EAC3B,CAAE,EAAGyH,EAAK,EAAG8B,CAAG,EAAKH,EAAInJ,CAAE,EACjCkJ,EAAOG,GAAI,IAAIC,CAAG,EAClB/E,EAAQ8C,GAAWpD,EAAK,KAAMsD,EAAKC,EAAKvH,EAAOE,CAAK,CACtD,KAAO,CACL,GAAM,CAAE,EAAA0G,EAAG,EAAA0C,CAAC,EAAKJ,EAAIF,CAAM,EAC3B1E,EAAQsC,EACRqC,EAAOK,CACT,CAEA,OAAOH,GAAW3C,EAAO,CAAClC,EAAO2E,CAAI,CAAC,EAAE,CAAC,CAC3C,CAOA,eAAeM,EAAU,CACvB,GAAM,CAAE,KAAAvF,CAAI,EAAKR,EACX,EAAI,KACV,GAAI,CAACN,EAAG,QAAQqG,CAAE,EAAG,MAAM,IAAI,MAAM,8BAA8B,EACnE,GAAIA,IAAOtJ,IAAO,EAAE,IAAG,EAAI,OAAOuG,EAAM,KACxC,GAAI+C,IAAOjJ,GAAK,OAAO,EACvB,GAAIsH,GAAK,SAAS,IAAI,EAAG,OAAO,KAAK,SAAS2B,CAAE,EAChD,GAAIvF,EAAM,CACR,GAAM,CAAE,MAAAhE,EAAO,GAAAF,EAAI,MAAAI,EAAO,GAAAH,CAAE,EAAK0G,EAAiB8C,CAAE,EAC9C,CAAE,GAAAC,EAAI,GAAAC,CAAE,EAAKC,GAAclD,EAAO,EAAG1G,EAAIC,CAAE,EACjD,OAAOqH,GAAWpD,EAAK,KAAMwF,EAAIC,EAAIzJ,EAAOE,CAAK,CACnD,KACE,QAAO0H,GAAK,OAAO,EAAG2B,CAAE,CAE5B,CAEA,qBAAqBI,EAAUtB,EAAWvG,EAAS,CACjD,IAAM8H,EAAM,KAAK,eAAevB,CAAC,EAAE,IAAIsB,EAAE,eAAe7H,CAAC,CAAC,EAC1D,OAAO8H,EAAI,IAAG,EAAK,OAAYA,CACjC,CAMA,SAASC,EAAa,CACpB,OAAOnD,GAAa,KAAMmD,CAAS,CACrC,CAMA,eAAa,CACX,GAAM,CAAE,cAAAC,CAAa,EAAKtG,EAC1B,OAAIK,IAAavD,GAAY,GACzBwJ,EAAsBA,EAActD,EAAO,IAAI,EAC5CoB,GAAK,OAAO,KAAM9D,CAAW,EAAE,IAAG,CAC3C,CAEA,eAAa,CACX,GAAM,CAAE,cAAAiG,CAAa,EAAKvG,EAC1B,OAAIK,IAAavD,GAAY,KACzByJ,EAAsBA,EAAcvD,EAAO,IAAI,EAC5C,KAAK,eAAe3C,CAAQ,CACrC,CAEA,cAAY,CAEV,OAAO,KAAK,eAAeA,CAAQ,EAAE,IAAG,CAC1C,CAEA,QAAQU,EAAe,GAAI,CACzB,OAAAzD,GAAMyD,EAAc,cAAc,EAClC,KAAK,eAAc,EACZoB,EAAYa,EAAO,KAAMjC,CAAY,CAC9C,CAEA,MAAMA,EAAe,GAAI,CACvB,OAAOyF,GAAW,KAAK,QAAQzF,CAAY,CAAC,CAC9C,CAEA,UAAQ,CACN,MAAO,UAAU,KAAK,IAAG,EAAK,OAAS,KAAK,MAAK,CAAE,GACrD,CAGA,IAAI,IAAE,CACJ,OAAO,KAAK,CACd,CACA,IAAI,IAAE,CACJ,OAAO,KAAK,CACd,CACA,IAAI,IAAE,CACJ,OAAO,KAAK,CACd,CACA,WAAWA,EAAe,GAAI,CAC5B,OAAO,KAAK,QAAQA,CAAY,CAClC,CACA,eAAemD,EAAkB,CAC/B,KAAK,WAAWA,CAAU,CAC5B,CACA,OAAO,WAAWuC,EAAe,CAC/B,OAAOd,GAAW3C,EAAOyD,CAAM,CACjC,CACA,OAAO,IAAIA,EAAiBC,EAAiB,CAC3C,OAAOC,GAAU3D,EAAOtD,EAAI+G,EAAQC,CAAO,CAC7C,CACA,OAAO,eAAeE,EAAmB,CACvC,OAAO5D,EAAM,KAAK,SAASvD,GAAeC,EAAIkH,CAAU,CAAC,CAC3D,EA/TgB5D,EAAA,KAAO,IAAIA,EAAM5C,EAAM,GAAIA,EAAM,GAAID,EAAG,GAAG,EAE3C6C,EAAA,KAAO,IAAIA,EAAM7C,EAAG,KAAMA,EAAG,IAAKA,EAAG,IAAI,EAEzC6C,EAAA,GAAK7C,EAEL6C,EAAA,GAAKtD,EA2TvB,IAAMmH,GAAOnH,EAAG,KACV0E,GAAO,IAAI0C,GAAK9D,EAAOhD,EAAU,KAAO,KAAK,KAAK6G,GAAO,CAAC,EAAIA,EAAI,EACxE,OAAA7D,EAAM,KAAK,WAAW,CAAC,EAChBA,CACT,CA2CA,SAAS3B,GAAQF,EAAiB,CAChC,OAAO,WAAW,GAAGA,EAAW,EAAO,CAAI,CAC7C,CAuIA,SAAS4F,GAAeC,EAAeC,EAAkB,CACvD,MAAO,CACL,UAAWA,EAAG,MACd,UAAW,EAAID,EAAG,MAClB,sBAAuB,EAAI,EAAIA,EAAG,MAClC,mBAAoB,GACpB,UAAW,EAAIC,EAAG,MAEtB,CAMM,SAAUC,GACdC,EACAC,EAAmE,CAAA,EAAE,CAErE,GAAM,CAAE,GAAAH,CAAE,EAAKE,EACTE,EAAeD,EAAS,aAAeE,GACvCC,EAAU,OAAO,OAAOR,GAAYI,EAAM,GAAIF,CAAE,EAAG,CAAE,KAAMO,GAAiBP,EAAG,KAAK,CAAC,CAAE,EAE7F,SAASQ,EAAiBC,EAAkB,CAC1C,GAAI,CACF,MAAO,CAAC,CAACC,GAAeV,EAAIS,CAAS,CACvC,MAAgB,CACd,MAAO,EACT,CACF,CAEA,SAASE,EAAiBC,EAAuBC,EAAsB,CACrE,GAAM,CAAE,UAAWC,EAAM,sBAAAC,CAAqB,EAAKT,EACnD,GAAI,CACF,IAAMU,EAAIJ,EAAU,OAEpB,OADIC,IAAiB,IAAQG,IAAMF,GAC/BD,IAAiB,IAASG,IAAMD,EAA8B,GAC3D,CAAC,CAACb,EAAM,UAAUU,CAAS,CACpC,MAAgB,CACd,MAAO,EACT,CACF,CAMA,SAASK,EAAgBC,EAAOd,EAAaE,EAAQ,IAAI,EAAC,CACxD,OAAOa,GAAeC,GAAOF,EAAMZ,EAAQ,KAAM,MAAM,EAAGN,EAAG,KAAK,CACpE,CAOA,SAASqB,EAAaZ,EAAoBI,EAAe,GAAI,CAC3D,OAAOX,EAAM,KAAK,SAASQ,GAAeV,EAAIS,CAAS,CAAC,EAAE,QAAQI,CAAY,CAChF,CAEA,SAASS,EAAOJ,EAAiB,CAC/B,IAAMT,EAAYQ,EAAgBC,CAAI,EACtC,MAAO,CAAE,UAAAT,EAAW,UAAWY,EAAaZ,CAAS,CAAC,CACxD,CAKA,SAASc,EAAUC,EAAsB,CACvC,GAAI,OAAOA,GAAS,SAAU,MAAO,GACrC,GAAIA,aAAgBtB,EAAO,MAAO,GAClC,GAAM,CAAE,UAAAO,EAAW,UAAAG,EAAW,sBAAAG,CAAqB,EAAKT,EACxD,GAAIN,EAAG,gBAAkBS,IAAcG,EAAW,OAClD,IAAMI,EAAIS,GAAY,MAAOD,CAAI,EAAE,OACnC,OAAOR,IAAMJ,GAAaI,IAAMD,CAClC,CAUA,SAASW,EAAgBC,EAAqBC,EAAiBf,EAAe,GAAI,CAChF,GAAIU,EAAUI,CAAU,IAAM,GAAM,MAAM,IAAI,MAAM,+BAA+B,EACnF,GAAIJ,EAAUK,CAAU,IAAM,GAAO,MAAM,IAAI,MAAM,+BAA+B,EACpF,IAAMC,EAAInB,GAAeV,EAAI2B,CAAU,EAEvC,OADUzB,EAAM,QAAQ0B,CAAU,EACzB,SAASC,CAAC,EAAE,QAAQhB,CAAY,CAC3C,CAgBA,OAAO,OAAO,OAAO,CAAE,aAAAQ,EAAc,gBAAAK,EAAiB,OAAAJ,EAAQ,MAAApB,EAAO,MAdvD,CACZ,iBAAAM,EACA,iBAAAG,EACA,gBAAAM,EAGA,kBAAmBT,EACnB,iBAAkBS,EAClB,uBAAyBa,GAAiBpB,GAAeV,EAAI8B,CAAG,EAChE,WAAWC,EAAa,EAAGC,EAAQ9B,EAAM,KAAI,CAC3C,OAAO8B,EAAM,WAAWD,EAAY,EAAK,CAC3C,GAG0E,QAAAzB,CAAO,CAAE,CACvF,CAkBM,SAAU2B,GACd/B,EACAgC,EACAC,EAAuB,CAAA,EAAE,CAEzBC,GAAMF,CAAI,EACVG,GACEF,EACA,CAAA,EACA,CACE,KAAM,WACN,KAAM,UACN,YAAa,WACb,SAAU,WACV,cAAe,WAChB,EAGH,IAAM9B,EAAc8B,EAAU,aAAe9B,GACvCiC,EACJH,EAAU,OACR,CAACL,KAAQS,IAASD,GAAUJ,EAAMJ,EAAKU,GAAY,GAAGD,CAAI,CAAC,GAEzD,CAAE,GAAAxC,EAAI,GAAAC,CAAE,EAAKE,EACb,CAAE,MAAOuC,EAAa,KAAMC,CAAM,EAAK1C,EACvC,CAAE,OAAAsB,EAAQ,aAAAD,EAAc,gBAAAK,EAAiB,MAAAiB,EAAO,QAAArC,CAAO,EAAKL,GAAKC,EAAOiC,CAAS,EACjFS,EAA0C,CAC9C,QAAS,GACT,KAAM,OAAOT,EAAU,MAAS,UAAYA,EAAU,KAAO,GAC7D,OAAQ,OACR,aAAc,IAEVU,EAAwB,UAE9B,SAASC,EAAsBC,EAAc,CAC3C,IAAMC,EAAOP,GAAeQ,GAC5B,OAAOF,EAASC,CAClB,CACA,SAASE,EAAWC,EAAeC,EAAW,CAC5C,GAAI,CAACpD,EAAG,YAAYoD,CAAG,EACrB,MAAM,IAAI,MAAM,qBAAqBD,CAAK,kCAAkC,EAC9E,OAAOC,CACT,CACA,SAASC,EAAkBC,EAAmBC,EAAsB,CAClEC,GAAkBD,CAAM,EACxB,IAAME,EAAOnD,EAAQ,UACfoD,EAAQH,IAAW,UAAYE,EAAOF,IAAW,YAAcE,EAAO,EAAI,OAChF,OAAOrC,GAAOkC,EAAOI,EAAO,GAAGH,CAAM,YAAY,CACnD,CAKA,MAAMI,CAAS,CAIb,YAAYC,EAAW/B,EAAWgC,EAAiB,CACjD,KAAK,EAAIX,EAAW,IAAKU,CAAC,EAC1B,KAAK,EAAIV,EAAW,IAAKrB,CAAC,EACtBgC,GAAY,OAAM,KAAK,SAAWA,GACtC,OAAO,OAAO,IAAI,CACpB,CAEA,OAAO,UAAUP,EAAmBC,EAAyBV,EAAqB,CAChFQ,EAAkBC,EAAOC,CAAM,EAC/B,IAAIO,EACJ,GAAIP,IAAW,MAAO,CACpB,GAAM,CAAE,EAAAK,EAAG,EAAA/B,CAAC,EAAKkC,GAAI,MAAM3C,GAAOkC,CAAK,CAAC,EACxC,OAAO,IAAIK,EAAUC,EAAG/B,CAAC,CAC3B,CACI0B,IAAW,cACbO,EAAQR,EAAM,CAAC,EACfC,EAAS,UACTD,EAAQA,EAAM,SAAS,CAAC,GAE1B,IAAMU,EAAIhE,EAAG,MACP4D,EAAIN,EAAM,SAAS,EAAGU,CAAC,EACvBnC,EAAIyB,EAAM,SAASU,EAAGA,EAAI,CAAC,EACjC,OAAO,IAAIL,EAAU3D,EAAG,UAAU4D,CAAC,EAAG5D,EAAG,UAAU6B,CAAC,EAAGiC,CAAK,CAC9D,CAEA,OAAO,QAAQG,EAAaV,EAAuB,CACjD,OAAO,KAAK,UAAUW,GAAWD,CAAG,EAAGV,CAAM,CAC/C,CAEA,eAAeM,EAAgB,CAC7B,OAAO,IAAIF,EAAU,KAAK,EAAG,KAAK,EAAGE,CAAQ,CAC/C,CAEA,iBAAiBM,EAAgB,CAC/B,IAAMC,EAAcrE,EAAG,MACjB,CAAE,EAAA6D,EAAG,EAAA/B,EAAG,SAAUwC,CAAG,EAAK,KAChC,GAAIA,GAAO,MAAQ,CAAC,CAAC,EAAG,EAAG,EAAG,CAAC,EAAE,SAASA,CAAG,EAAG,MAAM,IAAI,MAAM,qBAAqB,EAWrF,GADoB5B,EAAc6B,GAAMF,GACrBC,EAAM,EAAG,MAAM,IAAI,MAAM,wCAAwC,EAEpF,IAAME,EAAOF,IAAQ,GAAKA,IAAQ,EAAIT,EAAInB,EAAcmB,EACxD,GAAI,CAAC7D,EAAG,QAAQwE,CAAI,EAAG,MAAM,IAAI,MAAM,4BAA4B,EACnE,IAAMC,EAAIzE,EAAG,QAAQwE,CAAI,EACnBE,GAAIvE,EAAM,UAAUsC,GAAYkC,IAASL,EAAM,KAAO,CAAC,EAAGG,CAAC,CAAC,EAC5DG,EAAK3E,EAAG,IAAIuE,CAAI,EAChBK,EAAIC,EAAcpD,GAAY,UAAW0C,CAAW,CAAC,EACrDW,EAAK9E,EAAG,OAAO,CAAC4E,EAAID,CAAE,EACtBI,GAAK/E,EAAG,OAAO6B,EAAI8C,CAAE,EAErBK,GAAI9E,EAAM,KAAK,eAAe4E,CAAE,EAAE,IAAIL,GAAE,eAAeM,EAAE,CAAC,EAChE,GAAIC,GAAE,IAAG,EAAI,MAAM,IAAI,MAAM,mBAAmB,EAChD,OAAAA,GAAE,eAAc,EACTA,EACT,CAGA,UAAQ,CACN,OAAOlC,EAAsB,KAAK,CAAC,CACrC,CAEA,QAAQS,EAAyBV,EAAqB,CAEpD,GADAW,GAAkBD,CAAM,EACpBA,IAAW,MAAO,OAAOW,GAAWH,GAAI,WAAW,IAAI,CAAC,EAC5D,IAAMH,EAAI5D,EAAG,QAAQ,KAAK,CAAC,EACrB6B,EAAI7B,EAAG,QAAQ,KAAK,CAAC,EAC3B,GAAIuD,IAAW,YAAa,CAC1B,GAAI,KAAK,UAAY,KAAM,MAAM,IAAI,MAAM,8BAA8B,EACzE,OAAOf,GAAY,WAAW,GAAG,KAAK,QAAQ,EAAGoB,EAAG/B,CAAC,CACvD,CACA,OAAOW,GAAYoB,EAAG/B,CAAC,CACzB,CAEA,MAAM0B,EAAuB,CAC3B,OAAO0B,GAAW,KAAK,QAAQ1B,CAAM,CAAC,CACxC,CAGA,gBAAc,CAAU,CACxB,OAAO,YAAYU,EAAQ,CACzB,OAAON,EAAU,UAAUlC,GAAY,MAAOwC,CAAG,EAAG,SAAS,CAC/D,CACA,OAAO,QAAQA,EAAQ,CACrB,OAAON,EAAU,UAAUlC,GAAY,MAAOwC,CAAG,EAAG,KAAK,CAC3D,CACA,YAAU,CACR,OAAO,KAAK,SAAQ,EAAK,IAAIN,EAAU,KAAK,EAAG3D,EAAG,IAAI,KAAK,CAAC,EAAG,KAAK,QAAQ,EAAI,IAClF,CACA,eAAa,CACX,OAAO,KAAK,QAAQ,KAAK,CAC3B,CACA,UAAQ,CACN,OAAOiF,GAAW,KAAK,QAAQ,KAAK,CAAC,CACvC,CACA,mBAAiB,CACf,OAAO,KAAK,QAAQ,SAAS,CAC/B,CACA,cAAY,CACV,OAAOA,GAAW,KAAK,QAAQ,SAAS,CAAC,CAC3C,EAQF,IAAMC,EACJ/C,EAAU,UACV,SAAsBmB,EAAiB,CAErC,GAAIA,EAAM,OAAS,KAAM,MAAM,IAAI,MAAM,oBAAoB,EAG7D,IAAMF,EAAM+B,GAAgB7B,CAAK,EAC3B8B,EAAQ9B,EAAM,OAAS,EAAIZ,EACjC,OAAO0C,EAAQ,EAAIhC,GAAO,OAAOgC,CAAK,EAAIhC,CAC5C,EACIyB,EACJ1C,EAAU,eACV,SAA2BmB,EAAiB,CAC1C,OAAOtD,EAAG,OAAOkF,EAAS5B,CAAK,CAAC,CAClC,EAEI+B,GAAaC,GAAQ5C,CAAM,EAEjC,SAAS6C,GAAWnC,EAAW,CAE7B,OAAAoC,GAAS,WAAa9C,EAAQU,EAAKqC,GAAKJ,EAAU,EAC3CrF,EAAG,QAAQoD,CAAG,CACvB,CAEA,SAASsC,GAAmBC,EAAqBC,EAAgB,CAC/D,OAAAxE,GAAOuE,EAAS,OAAW,SAAS,EAC7BC,EAAUxE,GAAOc,EAAKyD,CAAO,EAAG,OAAW,mBAAmB,EAAIA,CAC3E,CAUA,SAASE,EAAQF,EAAqBG,EAAqBC,EAAmB,CAC5E,GAAI,CAAC,YAAa,WAAW,EAAE,KAAMC,GAAMA,KAAKD,CAAI,EAClD,MAAM,IAAI,MAAM,qCAAqC,EACvD,GAAM,CAAE,KAAAE,EAAM,QAAAL,EAAS,aAAAM,CAAY,EAAKC,GAAgBJ,EAAMnD,CAAc,EAC5E+C,EAAUD,GAAmBC,EAASC,CAAO,EAI7C,IAAMQ,EAAQvB,EAAcc,CAAO,EAC7BU,EAAI3F,GAAeV,EAAI8F,CAAU,EACjCQ,EAAW,CAACf,GAAWc,CAAC,EAAGd,GAAWa,CAAK,CAAC,EAElD,GAAIF,GAAgB,MAAQA,IAAiB,GAAO,CAGlD,IAAMK,EAAIL,IAAiB,GAAO7F,EAAYC,EAAQ,SAAS,EAAI4F,EACnEI,EAAS,KAAK7E,GAAY,eAAgB8E,CAAC,CAAC,CAC9C,CACA,IAAMrF,GAAOsB,GAAY,GAAG8D,CAAQ,EAC9BE,EAAIJ,EASV,SAASK,EAAMC,EAAkB,CAG/B,IAAMV,GAAId,EAASwB,CAAM,EACzB,GAAI,CAAC1G,EAAG,YAAYgG,EAAC,EAAG,OACxB,IAAMW,GAAK3G,EAAG,IAAIgG,EAAC,EACbY,EAAI1G,EAAM,KAAK,SAAS8F,EAAC,EAAE,SAAQ,EACnCpC,GAAI5D,EAAG,OAAO4G,EAAE,CAAC,EACvB,GAAIhD,KAAM6B,GAAK,OACf,IAAM5D,GAAI7B,EAAG,OAAO2G,GAAK3G,EAAG,OAAOwG,EAAI5C,GAAIyC,CAAC,CAAC,EAC7C,GAAIxE,KAAM4D,GAAK,OACf,IAAI5B,IAAY+C,EAAE,IAAMhD,GAAI,EAAI,GAAK,OAAOgD,EAAE,EAAI3D,EAAG,EACjD4D,GAAQhF,GACZ,OAAIoE,GAAQnD,EAAsBjB,EAAC,IACjCgF,GAAQ7G,EAAG,IAAI6B,EAAC,EAChBgC,IAAY,GAEP,IAAIF,EAAUC,GAAGiD,GAAOhD,EAAQ,CACzC,CACA,MAAO,CAAE,KAAA3C,GAAM,MAAAuF,CAAK,CACtB,CAaA,SAASK,GAAKnB,EAAclF,EAAoBsF,EAAsB,CAAA,EAAE,CACtEJ,EAAUlE,GAAY,UAAWkE,CAAO,EACxC,GAAM,CAAE,KAAAzE,EAAM,MAAAuF,CAAK,EAAKZ,EAAQF,EAASlF,EAAWsF,CAAI,EAGxD,OAFagB,GAAmC7E,EAAK,UAAWlC,EAAG,MAAOsC,CAAI,EAC7DpB,EAAMuF,CAAK,CAE9B,CAEA,SAASO,GAAcC,EAAuB,CAE5C,IAAIC,EACEC,EAAQ,OAAOF,GAAO,UAAYG,GAAQH,CAAE,EAC5CI,EACJ,CAACF,GACDF,IAAO,MACP,OAAOA,GAAO,UACd,OAAOA,EAAG,GAAM,UAChB,OAAOA,EAAG,GAAM,SAClB,GAAI,CAACE,GAAS,CAACE,EACb,MAAM,IAAI,MAAM,0EAA0E,EAC5F,GAAIA,EACFH,EAAM,IAAIvD,EAAUsD,EAAG,EAAGA,EAAG,CAAC,UACrBE,EAAO,CAChB,GAAI,CACFD,EAAMvD,EAAU,UAAUlC,GAAY,MAAOwF,CAAE,EAAG,KAAK,CACzD,OAASK,EAAU,CACjB,GAAI,EAAEA,aAAoBvD,GAAI,KAAM,MAAMuD,CAC5C,CACA,GAAI,CAACJ,EACH,GAAI,CACFA,EAAMvD,EAAU,UAAUlC,GAAY,MAAOwF,CAAE,EAAG,SAAS,CAC7D,MAAgB,CACd,MAAO,EACT,CAEJ,CACA,OAAKC,GAAY,EAEnB,CAeA,SAASK,EACPC,EACA7B,EACA/E,EACAmF,EAAwB,CAAA,EAAE,CAE1B,GAAM,CAAE,KAAAE,EAAM,QAAAL,EAAS,OAAArC,CAAM,EAAK4C,GAAgBJ,EAAMnD,CAAc,EAGtE,GAFAhC,EAAYa,GAAY,YAAab,CAAS,EAC9C+E,EAAUD,GAAmBjE,GAAY,UAAWkE,CAAO,EAAGC,CAAO,EACjE,WAAYG,EAAM,MAAM,IAAI,MAAM,oCAAoC,EAC1E,IAAMmB,EACJ3D,IAAW,OACPyD,GAAcQ,CAAS,EACvB7D,EAAU,UAAUlC,GAAY,MAAO+F,CAAgB,EAAGjE,CAAM,EACtE,GAAI2D,IAAQ,GAAO,MAAO,GAC1B,GAAI,CACF,IAAMO,EAAIvH,EAAM,UAAUU,CAAS,EACnC,GAAIqF,GAAQiB,EAAI,SAAQ,EAAI,MAAO,GACnC,GAAM,CAAE,EAAAtD,GAAG,EAAA/B,CAAC,EAAKqF,EACXtC,EAAIC,EAAcc,CAAO,EACzB+B,EAAK1H,EAAG,IAAI6B,CAAC,EACbiD,GAAK9E,EAAG,OAAO4E,EAAI8C,CAAE,EACrB3C,GAAK/E,EAAG,OAAO4D,GAAI8D,CAAE,EACrBjD,EAAIvE,EAAM,KAAK,eAAe4E,EAAE,EAAE,IAAI2C,EAAE,eAAe1C,EAAE,CAAC,EAChE,OAAIN,EAAE,IAAG,EAAW,GACVzE,EAAG,OAAOyE,EAAE,CAAC,IACVb,EACf,MAAY,CACV,MAAO,EACT,CACF,CAEA,SAAS+D,EACPH,EACA7B,EACAI,EAAyB,CAAA,EAAE,CAE3B,GAAM,CAAE,QAAAH,CAAO,EAAKO,GAAgBJ,EAAMnD,CAAc,EACxD,OAAA+C,EAAUD,GAAmBC,EAASC,CAAO,EACtCjC,EAAU,UAAU6D,EAAW,WAAW,EAAE,iBAAiB7B,CAAO,EAAE,QAAO,CACtF,CAEA,OAAO,OAAO,OAAO,CACnB,OAAArE,EACA,aAAAD,EACA,gBAAAK,EACA,MAAAiB,EACA,QAAArC,EACA,MAAAJ,EACA,KAAA4G,GACA,OAAAS,EACA,iBAAAI,EACA,UAAAhE,EACA,KAAAzB,EACD,CACH,CAsHA,SAAS0F,GAAmCC,EAAqB,CAC/D,IAAMC,EAA4B,CAChC,EAAGD,EAAE,EACL,EAAGA,EAAE,EACL,EAAGA,EAAE,GAAG,MACR,EAAGA,EAAE,EACL,EAAGA,EAAE,EACL,GAAIA,EAAE,GACN,GAAIA,EAAE,IAEFE,EAAKF,EAAE,GACTG,EAAiBH,EAAE,yBACnB,MAAM,KAAK,IAAI,IAAIA,EAAE,yBAAyB,IAAKI,GAAM,KAAK,KAAKA,EAAI,CAAC,CAAC,CAAC,CAAC,EAC3E,OACEC,EAAKC,GAAML,EAAM,EAAG,CACxB,KAAMD,EAAE,WACR,eAAgBG,EAChB,aAAcH,EAAE,eACjB,EACKO,EAAqC,CACzC,GAAAL,EACA,GAAAG,EACA,mBAAoBL,EAAE,mBACtB,KAAMA,EAAE,KACR,cAAeA,EAAE,cACjB,cAAeA,EAAE,cACjB,UAAWA,EAAE,UACb,QAASA,EAAE,SAEb,MAAO,CAAE,MAAAC,EAAO,UAAAM,CAAS,CAC3B,CACA,SAASC,GAA0BR,EAAY,CAC7C,GAAM,CAAE,MAAAC,EAAO,UAAAM,CAAS,EAAKR,GAAgCC,CAAC,EACxDS,EAAuB,CAC3B,KAAMT,EAAE,KACR,YAAaA,EAAE,YACf,KAAMA,EAAE,KACR,SAAUA,EAAE,SACZ,cAAeA,EAAE,eAEnB,MAAO,CAAE,MAAAC,EAAO,UAAAM,EAAW,KAAMP,EAAE,KAAM,UAAAS,CAAS,CACpD,CAkCA,SAASC,GAA4BC,EAAcC,EAAa,CAC9D,IAAMC,EAAQD,EAAO,MACrB,OAAO,OAAO,OAAO,CAAA,EAAIA,EAAQ,CAC/B,gBAAiBC,EACjB,MAAO,OAAO,OAAO,CAAA,EAAIF,EAAGG,GAAQD,EAAM,GAAG,MAAOA,EAAM,GAAG,IAAI,CAAC,EACnE,CACH,CAGM,SAAUE,GAAYJ,EAAY,CACtC,GAAM,CAAE,MAAAK,EAAO,UAAAC,EAAW,KAAAC,EAAM,UAAAC,CAAS,EAAKC,GAA0BT,CAAC,EACnEE,EAAQQ,GAAaL,EAAOC,CAAS,EACrCK,EAAQC,GAAMV,EAAOK,EAAMC,CAAS,EAC1C,OAAOT,GAA4BC,EAAGW,CAAK,CAC7C,CC10DM,SAAUE,GAAYC,EAAoBC,EAAc,CAC5D,IAAMC,EAAUC,GAAyBC,GAAY,CAAE,GAAGJ,EAAU,KAAMG,CAAI,CAAE,EAChF,MAAO,CAAE,GAAGD,EAAOD,CAAO,EAAG,OAAAC,CAAM,CACrC,CCoBA,IAAMG,GAA2C,CAC/C,EAAG,OAAO,oEAAoE,EAC9E,EAAG,OAAO,oEAAoE,EAC9E,EAAG,OAAO,CAAC,EACX,EAAG,OAAO,CAAC,EACX,EAAG,OAAO,CAAC,EACX,GAAI,OAAO,oEAAoE,EAC/E,GAAI,OAAO,oEAAoE,GAG3EC,GAAmC,CACvC,KAAM,OAAO,oEAAoE,EACjF,QAAS,CACP,CAAC,OAAO,oCAAoC,EAAG,CAAC,OAAO,oCAAoC,CAAC,EAC5F,CAAC,OAAO,qCAAqC,EAAG,OAAO,oCAAoC,CAAC,IAMhG,IAAMC,GAAsB,OAAO,CAAC,EAMpC,SAASC,GAAQC,EAAS,CACxB,IAAMC,EAAIC,GAAgB,EAEpBC,EAAM,OAAO,CAAC,EAAGC,EAAM,OAAO,CAAC,EAAGC,EAAO,OAAO,EAAE,EAAGC,EAAO,OAAO,EAAE,EAErEC,EAAO,OAAO,EAAE,EAAGC,EAAO,OAAO,EAAE,EAAGC,EAAO,OAAO,EAAE,EACtDC,EAAMV,EAAIA,EAAIA,EAAKC,EACnBU,EAAMD,EAAKA,EAAKV,EAAKC,EACrBW,EAAMC,GAAKF,EAAIR,EAAKF,CAAC,EAAIU,EAAMV,EAC/Ba,EAAMD,GAAKD,EAAIT,EAAKF,CAAC,EAAIU,EAAMV,EAC/Bc,EAAOF,GAAKC,EAAIhB,GAAKG,CAAC,EAAIS,EAAMT,EAChCe,EAAOH,GAAKE,EAAKV,EAAMJ,CAAC,EAAIc,EAAOd,EACnCgB,EAAOJ,GAAKG,EAAKV,EAAML,CAAC,EAAIe,EAAOf,EACnCiB,EAAOL,GAAKI,EAAKT,EAAMP,CAAC,EAAIgB,EAAOhB,EACnCkB,EAAQN,GAAKK,EAAKT,EAAMR,CAAC,EAAIiB,EAAOjB,EACpCmB,EAAQP,GAAKM,EAAMX,EAAMP,CAAC,EAAIgB,EAAOhB,EACrCoB,EAAQR,GAAKO,EAAMjB,EAAKF,CAAC,EAAIU,EAAMV,EACnCqB,EAAMT,GAAKQ,EAAMd,EAAMN,CAAC,EAAIe,EAAOf,EACnCsB,EAAMV,GAAKS,EAAIlB,EAAKH,CAAC,EAAIS,EAAMT,EAC/BuB,GAAOX,GAAKU,EAAIzB,GAAKG,CAAC,EAC5B,GAAI,CAACwB,GAAK,IAAIA,GAAK,IAAID,EAAI,EAAGxB,CAAC,EAAG,MAAM,IAAI,MAAM,yBAAyB,EAC3E,OAAOwB,EACT,CAEA,IAAMC,GAAOC,GAAMxB,GAAgB,EAAG,CAAE,KAAMH,EAAO,CAAE,EAgB1C4B,GAA+BC,GAC1C,CAAE,GAAG1B,GAAiB,GAAIuB,GAAM,KAAM,GAAM,KAAMI,EAAc,EAChEC,EAAM,EC/FF,IAAOC,GAAP,cAAiC,KAAK,CAC1C,YAAaC,EAAU,8CAA6C,CAClE,MAAMA,CAAO,EACb,KAAK,KAAO,mBACd,GRwBI,SAAUC,GAAeC,EAAiBC,EAAiBC,EAAkCC,EAAsB,CACvHA,GAAS,QAAQ,eAAc,EAC/B,IAAMC,EAAO,GAAAC,QAAO,WAAW,QAAQ,EAEvC,GAAIH,aAAe,WACjBE,EAAK,OAAOF,CAAG,MAEf,SAAWI,KAAOJ,EAChBE,EAAK,OAAOE,CAAG,EAInB,IAAMC,EAASH,EAAK,OAAM,EAE1B,GAAI,CACF,OAAOI,GAAK,OAAOP,EAAKM,EAAQP,CAAG,CACrC,OAASS,EAAK,CACZ,MAAM,IAAIC,GAAkB,OAAOD,CAAG,CAAC,CACzC,CACF,CSjDM,IAAOE,GAAP,KAAyB,CACb,KAAO,YACP,IACA,KAEhB,YAAaC,EAAe,CAC1B,KAAK,KAAOC,GAA2BD,CAAG,EAC1C,KAAK,IAAME,GAA2B,KAAK,IAAI,CACjD,CAEA,aAAW,CACT,OAAOC,GAAS,OAAOC,GAAoB,IAAI,CAAC,CAClD,CAEA,OAAK,CACH,OAAOC,GAAI,SAAS,IAAK,KAAK,YAAW,CAAE,CAC7C,CAEA,UAAQ,CACN,OAAOC,GAAU,OAAO,KAAK,YAAW,EAAG,KAAK,EAAE,UAAU,CAAC,CAC/D,CAEA,OAAQN,EAAQ,CACd,OAAIA,GAAO,MAAQ,EAAEA,EAAI,eAAe,YAC/B,GAGFO,GAAiB,KAAK,IAAKP,EAAI,GAAG,CAC3C,CAEA,OAAQQ,EAAmCC,EAAiBC,EAAsB,CAChF,OAAOC,GAAc,KAAK,KAAMF,EAAKD,EAAME,CAAO,CACpD,GC9BI,SAAUE,GAA6BC,EAAiB,CAC5D,OAAO,IAAIC,GAAwBD,CAAK,CAC1C,CAOM,SAAUE,GAA4BC,EAAe,CAEzD,OADcC,GAAK,gBAAgB,QAAQD,CAAG,EAAE,WAAW,EAAI,CAEjE,CAiBM,SAAUE,GAA4BC,EAAe,CACzD,GAAI,CACF,OAAAC,GAAK,gBAAgB,QAAQD,CAAG,EAEzBA,CACT,OAASE,EAAK,CACZ,MAAM,IAAIC,GAAsB,OAAOD,CAAG,CAAC,CAC7C,CACF,CCoFM,SAAUE,GAAwBC,EAA4B,CAClE,GAAM,CAAE,KAAAC,EAAM,KAAAC,CAAI,EAAQC,GAAU,OAAOH,EAAO,MAAM,EAClDI,EAAOF,GAAQ,IAAI,WAEzB,OAAQD,EAAM,CACZ,KAAQI,GAAQ,QACd,OAAOC,GAA0BF,CAAI,EACvC,KAAQC,GAAQ,UACd,OAAOE,GAA4BH,CAAI,EACzC,KAAQC,GAAQ,MACd,OAAOG,GAAwBJ,CAAI,EACrC,QACE,MAAM,IAAIK,EACd,CACF,CAKM,SAAUC,GAAqBC,EAAc,CACjD,OAAUR,GAAU,OAAO,CACzB,KAASE,GAAQM,EAAI,IAAI,EACzB,KAAMA,EAAI,IACX,CACH,CCpIA,IAAMC,GAAU,OAAO,IAAI,4BAA4B,EAGjDC,GAAkB,IAsBlBC,GAAN,KAAgB,CACP,KACU,UACD,UACR,OAER,YAAaC,EAA4B,CACvC,KAAK,KAAOA,EAAK,KACjB,KAAK,UAAYA,EAAK,UAGtB,OAAO,eAAe,KAAM,SAAU,CACpC,WAAY,GACZ,SAAU,GACX,CACH,CAEA,IAAK,OAAO,WAAW,GAAC,CACtB,MAAO,UAAU,KAAK,SAAQ,CAAE,GAClC,CAES,CAACC,EAAY,EAAI,GAE1B,UAAQ,CACN,OAAI,KAAK,QAAU,OACjB,KAAK,OAASC,GAAU,OAAO,KAAK,UAAU,KAAK,EAAE,MAAM,CAAC,GAGvD,KAAK,MACd,CAEA,aAAW,CACT,OAAO,KAAK,SACd,CAIA,OAAK,CACH,OAAOC,GAAI,SAASL,GAAiB,KAAK,SAAS,CACrD,CAEA,QAAM,CACJ,OAAO,KAAK,SAAQ,CACtB,CAKA,OAAQM,EAAiC,CACvC,GAAIA,GAAM,KACR,MAAO,GAGT,GAAIA,aAAc,WAChB,OAAOC,GAAiB,KAAK,UAAU,MAAOD,CAAE,EAC3C,GAAI,OAAOA,GAAO,SACvB,OAAO,KAAK,SAAQ,IAAOA,EACtB,GAAIA,GAAI,YAAW,GAAI,OAAS,KACrC,OAAOC,GAAiB,KAAK,UAAU,MAAOD,EAAG,YAAW,EAAG,KAAK,EAEpE,MAAM,IAAI,MAAM,cAAc,CAElC,CAcA,CAACP,EAAO,GAAC,CACP,MAAO,UAAU,KAAK,SAAQ,CAAE,GAClC,GAGWS,GAAP,cAAyBP,EAAgB,CAC7B,KAAO,MACP,UAEhB,YAAaC,EAAmB,CAC9B,MAAM,CAAE,GAAGA,EAAM,KAAM,KAAK,CAAE,EAE9B,KAAK,UAAYA,EAAK,SACxB,GAGWO,GAAP,cAA6BR,EAAe,CAChC,KAAO,UACP,UAEhB,YAAaC,EAAuB,CAClC,MAAM,CAAE,GAAGA,EAAM,KAAM,SAAS,CAAE,EAElC,KAAK,UAAYA,EAAK,SACxB,GAGWQ,GAAP,cAA+BT,EAAe,CAClC,KAAO,YACP,UAEhB,YAAaC,EAAyB,CACpC,MAAM,CAAE,GAAGA,EAAM,KAAM,WAAW,CAAE,EAEpC,KAAK,UAAYA,EAAK,SACxB,GAIIS,GAAmC,KAE5BC,GAAP,KAAgB,CACX,KAAO,MACP,UACA,UACA,IAET,YAAaC,EAAQ,CACnB,KAAK,IAAMA,EAAI,SAAQ,EACvB,KAAK,UAAYC,GAAS,OAAOC,GAAqB,KAAK,GAAG,CAAC,CACjE,CAEA,CAAChB,EAAO,GAAC,CACP,MAAO,UAAU,KAAK,GAAG,GAC3B,CAES,CAACI,EAAY,EAAI,GAE1B,UAAQ,CACN,OAAO,KAAK,MAAK,EAAG,SAAQ,CAC9B,CAEA,aAAW,CACT,OAAO,KAAK,SACd,CAEA,OAAK,CACH,OAAOE,GAAI,SAASM,GAAkC,KAAK,YAAW,CAAE,CAC1E,CAEA,QAAM,CACJ,OAAO,KAAK,SAAQ,CACtB,CAEA,OAAQK,EAAoC,CAC1C,OAAIA,GAAS,KACJ,IAGLA,aAAiB,aACnBA,EAAQC,GAAmBD,CAAK,GAG3BA,EAAM,SAAQ,IAAO,KAAK,SAAQ,EAC3C,GC5HI,SAAUE,GAAqBC,EAA0B,CAC7D,GAAIC,GAAkBD,CAAS,EAC7B,OAAO,IAAIE,GAAe,CAAE,UAAAF,CAAS,CAAE,EAClC,GAAIG,GAAoBH,CAAS,EACtC,GAAI,CACF,IAAMI,EAAYC,GAAuBL,CAAS,EAElD,GAAII,EAAU,OAAS,UACrB,OAAO,IAAIE,GAAmB,CAAE,UAAAN,EAAW,UAAAI,CAAS,CAAE,EACjD,GAAIA,EAAU,OAAS,YAC5B,OAAO,IAAIG,GAAqB,CAAE,UAAAP,EAAW,UAAAI,CAAS,CAAE,CAE5D,MAAc,CAEZ,IAAMI,EAAMC,GAAmBT,EAAU,MAAM,EAE/C,OAAO,IAAIU,GAAe,IAAI,IAAIF,CAAG,CAAC,CACxC,CAGF,MAAM,IAAIG,GAAsB,sCAAsC,CACxE,CAgBA,SAASC,GAAqBC,EAA0B,CACtD,OAAOA,EAAU,OAASC,GAAS,IACrC,CAEA,SAASC,GAAmBF,EAA0B,CACpD,OAAOA,EAAU,OAASG,GAAO,IACnC,CCrGA,IAAAC,GAAgB,gBC1BV,IAAOC,GAAP,cAAqC,KAAK,CAC9C,OAAO,KAAO,wBACd,KAAO,yBAGIC,GAAP,cAA+B,KAAK,CACxC,OAAO,KAAO,kBACd,KAAO,mBAGIC,GAAP,cAAsC,KAAK,CAC/C,OAAO,KAAO,yBACd,KAAO,0BAGIC,GAAP,cAAoC,KAAK,CAC7C,OAAO,KAAO,uBACd,KAAO,wBCpBT,IAAAC,GAAkD,eCU5C,SAAUC,GAAeC,EAAwB,CACrD,OAAQC,GACCC,GAAmBD,EAAKD,CAAI,CAEvC,CAEM,SAAUG,GAAeH,EAAwB,CACrD,OAAQC,GACCG,GAAqBH,EAAKD,CAAI,CAEzC,CAEM,SAAUK,GAAYJ,EAAe,CAEzC,OADa,IAAI,SAASA,EAAI,MAAM,EACxB,UAAUA,EAAI,UAAU,EAAE,SAAQ,CAChD,CAEM,SAAUK,GAAYC,EAAqB,CAC/C,IAAMN,EAAM,IAAI,YAAY,CAAC,EAE7B,OADa,IAAI,SAASA,CAAG,EACxB,UAAU,EAAG,OAAOM,GAAS,SAAW,SAASA,CAAI,EAAIA,CAAI,EAE3D,IAAI,WAAWN,CAAG,CAC3B,CAEM,SAAUO,GAAaC,EAAW,CACtC,IAAMC,EAAOD,EAAI,MAAM,GAAG,EAE1B,GAAIC,EAAK,SAAW,EAClB,MAAM,IAAI,MAAM,kCAAkCA,EAAK,KAAK,MAAM,CAAC,qCAAqC,EAG1G,GAAIA,EAAK,CAAC,EAAE,SAAW,GACrB,MAAM,IAAI,MAAM,+BAA+BA,EAAK,CAAC,CAAC,2BAA2B,EAInF,IAAMT,EAAMG,GAAqBM,EAAK,CAAC,EAAG,QAAQ,EAG5CH,EAAO,SAASG,EAAK,CAAC,EAAG,EAAE,EAEjC,GAAIH,EAAO,GAAKA,EAAO,MACrB,MAAM,IAAI,MAAM,uCAAuC,EAGzD,IAAMI,EAAUL,GAAWC,CAAI,EAE/B,OAAOK,GAAiB,CAACX,EAAKU,CAAO,EAAGV,EAAI,OAASU,EAAQ,MAAM,CACrE,CAEM,SAAUE,GAAcJ,EAAW,CACvC,IAAMC,EAAOD,EAAI,MAAM,GAAG,EAE1B,GAAIC,EAAK,SAAW,EAClB,MAAM,IAAI,MAAM,kCAAkCA,EAAK,KAAK,MAAM,CAAC,qCAAqC,EAG1G,GAAIA,EAAK,CAAC,EAAE,SAAW,GACrB,MAAM,IAAI,MAAM,+BAA+BA,EAAK,CAAC,CAAC,4BAA4B,EAIpF,IAAMT,EAAMa,GAAO,OAAO,IAAIJ,EAAK,CAAC,CAAC,EAAE,EAGjCH,EAAO,SAASG,EAAK,CAAC,EAAG,EAAE,EAEjC,GAAIH,EAAO,GAAKA,EAAO,MACrB,MAAM,IAAI,MAAM,uCAAuC,EAGzD,IAAMI,EAAUL,GAAWC,CAAI,EAE/B,OAAOK,GAAiB,CAACX,EAAKU,CAAO,EAAGV,EAAI,OAASU,EAAQ,MAAM,CACrE,CAEM,SAAUI,GAAad,EAAe,CAC1C,IAAMe,EAAYf,EAAI,SAAS,EAAGA,EAAI,OAAS,CAAC,EAC1CgB,EAAYhB,EAAI,SAASA,EAAI,OAAS,CAAC,EACvCS,EAAOR,GAAmBc,EAAW,QAAQ,EAC7CT,EAAOF,GAAWY,CAAS,EACjC,MAAO,GAAGP,CAAI,IAAIH,CAAI,EACxB,CAIO,IAAMW,GAAa,SAAUC,EAAU,CAC5CA,EAAKA,EAAG,SAAQ,EAAG,KAAI,EAEvB,IAAMC,EAAQ,IAAI,WAAW,CAAC,EAE9B,OAAAD,EAAG,MAAM,KAAK,EAAE,QAAQ,CAACE,EAAMC,IAAS,CACtC,IAAMC,EAAQ,SAASF,EAAM,EAAE,EAE/B,GAAI,MAAME,CAAK,GAAKA,EAAQ,GAAKA,EAAQ,IACvC,MAAM,IAAIC,GAAsB,kCAAkC,EAGpEJ,EAAME,CAAK,EAAIC,CACjB,CAAC,EAEMH,CACT,EAIaK,GAAa,SAAUN,EAAU,CAC5C,IAAIO,EAAS,EACbP,EAAKA,EAAG,SAAQ,EAAG,KAAI,EAEvB,IAAMQ,EAAWR,EAAG,MAAM,IAAK,CAAC,EAE5BS,EACJ,IAAKA,EAAI,EAAGA,EAAID,EAAS,OAAQC,IAAK,CACpC,IAAMC,KAAO,WAAOF,EAASC,CAAC,CAAC,EAC3BE,EAEAD,IACFC,EAAWZ,GAAWS,EAASC,CAAC,CAAC,EACjCD,EAASC,CAAC,EAAI1B,GAAmB4B,EAAS,SAAS,EAAG,CAAC,EAAG,QAAQ,GAGhEA,GAAY,MAAQ,EAAEF,EAAI,GAC5BD,EAAS,OAAOC,EAAG,EAAG1B,GAAmB4B,EAAS,SAAS,EAAG,CAAC,EAAG,QAAQ,CAAC,CAE/E,CAEA,GAAIH,EAAS,CAAC,IAAM,GAClB,KAAOA,EAAS,OAAS,GAAKA,EAAS,QAAQ,GAAG,UACzCA,EAASA,EAAS,OAAS,CAAC,IAAM,GAC3C,KAAOA,EAAS,OAAS,GAAKA,EAAS,KAAK,GAAG,UACtCA,EAAS,OAAS,EAAG,CAC9B,IAAKC,EAAI,EAAGA,EAAID,EAAS,QAAUA,EAASC,CAAC,IAAM,GAAIA,IAAK,CAC5D,IAAMG,EAAsC,CAACH,EAAG,CAAC,EACjD,IAAKA,EAAI,EAAID,EAAS,OAAQC,EAAI,EAAGA,IACnCG,EAAK,KAAK,GAAG,EAEfJ,EAAS,OAAO,MAAMA,EAAUI,CAAI,CACtC,CAEA,IAAMX,EAAQ,IAAI,WAAWM,EAAS,EAAE,EAExC,IAAKE,EAAI,EAAGA,EAAID,EAAS,OAAQC,IAAK,CAChCD,EAASC,CAAC,IAAM,KAClBD,EAASC,CAAC,EAAI,KAGhB,IAAMI,EAAO,SAASL,EAASC,CAAC,EAAG,EAAE,EAErC,GAAI,MAAMI,CAAI,GAAKA,EAAO,GAAKA,EAAO,MACpC,MAAM,IAAIR,GAAsB,kCAAkC,EAGpEJ,EAAMM,GAAQ,EAAKM,GAAQ,EAAK,IAChCZ,EAAMM,GAAQ,EAAIM,EAAO,GAC3B,CAEA,OAAOZ,CACT,EAGaa,GAAc,SAAUhC,EAAe,CAClD,GAAIA,EAAI,aAAe,EACrB,MAAM,IAAIuB,GAAsB,mCAAmC,EAGrE,IAAMU,EAAS,CAAA,EAEf,QAASN,EAAI,EAAGA,EAAI3B,EAAI,WAAY2B,IAClCM,EAAO,KAAKjC,EAAI2B,CAAC,CAAC,EAGpB,OAAOM,EAAO,KAAK,GAAG,CACxB,EAEaC,GAAc,SAAUlC,EAAe,CAClD,GAAIA,EAAI,aAAe,GACrB,MAAM,IAAIuB,GAAsB,mCAAmC,EAGrE,IAAMU,EAAmB,CAAA,EAEzB,QAASN,EAAI,EAAGA,EAAI3B,EAAI,WAAY2B,GAAK,EAAG,CAC1C,IAAMQ,EAAQnC,EAAI2B,CAAC,EACbS,EAAQpC,EAAI2B,EAAI,CAAC,EAEjBU,EAAQ,GAAGF,EAAM,SAAS,EAAE,EAAE,SAAS,EAAG,GAAG,CAAC,GAAGC,EAAM,SAAS,EAAE,EAAE,SAAS,EAAG,GAAG,CAAC,GAE1FH,EAAO,KAAKI,CAAK,CACnB,CAEA,IAAMnB,EAAKe,EAAO,KAAK,GAAG,EAE1B,GAAI,CACF,IAAMK,EAAM,IAAI,IAAI,WAAWpB,CAAE,GAAG,EAEpC,OAAOoB,EAAI,SAAS,UAAU,EAAGA,EAAI,SAAS,OAAS,CAAC,CAC1D,MAAQ,CACN,MAAM,IAAIf,GAAsB,yBAAyBL,CAAE,GAAG,CAChE,CACF,EAEM,SAAUqB,GAAkB/B,EAAW,CAC3C,GAAI,CACF,IAAM8B,EAAM,IAAI,IAAI,WAAW9B,CAAG,GAAG,EAErC,OAAO8B,EAAI,SAAS,UAAU,EAAGA,EAAI,SAAS,OAAS,CAAC,CAC1D,MAAQ,CACN,MAAM,IAAIf,GAAsB,yBAAyBf,CAAG,GAAG,CACjE,CACF,CAEA,IAAMgC,GAAW,OAAO,OAAOC,EAAK,EAAE,IAAKC,GAAMA,EAAE,OAAO,EACpDC,IAAkB,UAAA,CACtB,IAAIC,EAAMJ,GAAS,CAAC,EAAE,GAAGA,GAAS,CAAC,CAAC,EACpC,OAAAA,GAAS,MAAM,CAAC,EAAE,QAASK,GAAOD,EAAMA,EAAI,GAAGC,CAAC,CAAE,EAC3CD,CACT,GAAE,EAEI,SAAUE,GAAUC,EAAa,CACrC,OAAOJ,GAAe,OAAOI,CAAK,CACpC,CAEM,SAAUC,GAAUjD,EAAyB,CACjD,OAAQC,GACCD,EAAK,QAAQ,OAAOC,CAAG,CAElC,CC5OM,SAAUiD,GAASC,EAAa,CAGpC,GAFY,SAASA,CAAK,EAElB,SAAQ,IAAOA,EACrB,MAAM,IAAIC,GAAgB,0BAA0B,CAExD,CAEM,SAAUC,GAAUF,EAAU,CAClC,GAAIA,EAAQ,EACV,MAAM,IAAIC,GAAgB,2CAA2C,CAEzE,CAEM,SAAUE,GAAUC,EAAW,CACnC,OAAQJ,GAAS,CACf,GAAIA,EAAQI,EACV,MAAM,IAAIH,GAAgB,0CAA0CG,CAAG,EAAE,CAE7E,CACF,CAEM,SAAUC,MAAaC,EAAqC,CAChE,OAAQN,GAAS,CACf,QAAWO,KAAMD,EACfC,EAAGP,CAAK,CAEZ,CACF,CAEO,IAAMQ,GAAeH,GAC1BN,GACAG,GACAC,GAAS,KAAM,CAAC,EC1BX,IAAMM,GAAI,GAsDXC,GAAN,KAAc,CACJ,gBAAkB,IAAI,IACtB,gBAAkB,IAAI,IAE9B,YAAaC,EAAoB,CAC/B,IAAIC,EAQJ,GANI,OAAOD,GAAQ,SACjBC,EAAQ,KAAK,gBAAgB,IAAID,CAAG,EAEpCC,EAAQ,KAAK,gBAAgB,IAAID,CAAG,EAGlCC,GAAS,KACX,MAAM,IAAIC,GAAqB,YAAYF,CAAG,cAAc,EAG9D,OAAOC,CACT,CAEA,YAAaA,EAAoB,CAC/B,KAAK,gBAAgB,IAAIA,EAAM,KAAMA,CAAK,EAC1C,KAAK,gBAAgB,IAAIA,EAAM,KAAMA,CAAK,EAE1CA,EAAM,SAAS,QAAQE,GAAQ,CAC7B,KAAK,gBAAgB,IAAIA,EAAOF,CAAK,CACvC,CAAC,CACH,CAEA,eAAgBG,EAAY,CAC1B,IAAMH,EAAQ,KAAK,gBAAgB,IAAIG,CAAI,EAEvCH,GAAS,OAIb,KAAK,gBAAgB,OAAOA,EAAM,IAAI,EACtC,KAAK,gBAAgB,OAAOA,EAAM,IAAI,EAEtCA,EAAM,SAAS,QAAQE,GAAQ,CAC7B,KAAK,gBAAgB,OAAOA,CAAK,CACnC,CAAC,EACH,GAGWE,GAAW,IAAIN,GAEtBO,GAA0B,CAAC,CAC/B,KAAM,EACN,KAAM,MACN,KAAM,GACN,aAAcC,GACd,aAAcC,GACd,SAAWC,GAAS,CAClB,GAAI,IAAC,WAAOA,CAAK,EACf,MAAM,IAAIC,GAAgB,yBAAyBD,CAAK,GAAG,CAE/D,GACC,CACD,KAAM,EACN,KAAM,MACN,KAAM,GACN,aAAcE,GACd,aAAcC,GACd,SAAUC,IACT,CACD,KAAM,IACN,KAAM,MACN,KAAM,GACN,aAAcF,GACd,aAAcC,GACd,SAAUC,IACT,CACD,KAAM,GACN,KAAM,OACN,KAAM,GACN,aAAcF,GACd,aAAcC,GACd,SAAUC,IACT,CACD,KAAM,GACN,KAAM,MACN,KAAM,IACN,aAAcC,GACd,aAAcC,GACd,cAAeC,GACf,SAAWP,GAAS,CAClB,GAAI,IAAC,WAAOA,CAAK,EACf,MAAM,IAAIC,GAAgB,yBAAyBD,CAAK,GAAG,CAE/D,GACC,CACD,KAAM,GACN,KAAM,UACN,KAAMX,IACL,CACD,KAAM,GACN,KAAM,SACN,KAAM,EACN,aAAcmB,GAAc,QAAQ,EACpC,aAAcC,GAAc,QAAQ,GACnC,CACD,KAAM,GACN,KAAM,MACN,KAAMpB,IACL,CACD,KAAM,GACN,KAAM,OACN,KAAMA,IACL,CACD,KAAM,GACN,KAAM,OACN,KAAMA,IACL,CACD,KAAM,GACN,KAAM,UACN,KAAMA,IACL,CACD,KAAM,IACN,KAAM,OACN,KAAM,GACN,aAAca,GACd,aAAcC,GACd,SAAUC,IACT,CACD,KAAM,IACN,KAAM,OACL,CACD,KAAM,IACN,KAAM,OACL,CACD,KAAM,IACN,KAAM,OACN,KAAMf,GACN,cAAgBqB,GAAQ,mBAAmBA,CAAG,EAC9C,cAAgBC,GAAQ,mBAAmBA,CAAG,GAC7C,CACD,KAAM,IACN,KAAM,MACN,QAAS,CAAC,MAAM,EAChB,KAAMtB,GACN,aAAcmB,GAAc,WAAW,EACvC,aAAeG,GACTA,EAAI,WAAW,GAAG,GAAKA,EAAI,WAAW,GAAG,EACpCF,GAAc,WAAW,EAAEE,CAAG,EAGhCC,GAAI,MAAMD,CAAG,EAAE,UAAU,OAEjC,CACD,KAAM,IACN,KAAM,QACN,KAAM,GACN,aAAcE,GACd,aAAcC,IACb,CACD,KAAM,IACN,KAAM,SACN,KAAM,IACN,aAAcD,GACd,aAAcE,IACb,CACD,KAAM,IACN,KAAM,WACN,KAAM1B,IACL,CACD,KAAM,IACN,KAAM,WACN,KAAMA,IACL,CACD,KAAM,IACN,KAAM,OACL,CACD,KAAM,IACN,KAAM,MACN,KAAMA,IACL,CACD,KAAM,IACN,KAAM,SACL,CACD,KAAM,IACN,KAAM,QACL,CACD,KAAM,IACN,KAAM,WACL,CACD,KAAM,IACN,KAAM,gBACL,CACD,KAAM,IACN,KAAM,WACN,KAAMA,GACN,aAAc2B,GAASC,EAAS,EAChC,aAAcC,IACb,CACD,KAAM,IACN,KAAM,QACL,CACD,KAAM,IACN,KAAM,YACN,KAAM7B,GACN,cAAgBqB,GAAQ,IAAI,mBAAmBA,CAAG,CAAC,GACnD,cAAgBC,GAAQ,mBAAmBA,EAAI,UAAU,CAAC,CAAC,GAC1D,CACD,KAAM,IACN,KAAM,SACL,CACD,KAAM,IACN,KAAM,MACL,CACD,KAAM,IACN,KAAM,OACL,CACD,KAAM,IACN,KAAM,sBACL,CACD,KAAM,IACN,KAAM,gBACL,CACD,KAAM,IACN,KAAM,mBACL,CACD,KAAM,IACN,KAAM,qBACL,CACD,KAAM,IACN,KAAM,iBACL,CACD,KAAM,IACN,KAAM,UACL,CACD,KAAM,IACN,KAAM,eACL,CACD,KAAM,IACN,KAAM,SACN,KAAMtB,GACP,EAEDQ,GAAO,QAAQL,GAAQ,CACrBI,GAAS,YAAYJ,CAAK,CAC5B,CAAC,ECvSK,SAAU2B,GAAmBC,EAAiB,CAClD,IAAMC,EAA0B,CAAA,EAE5BC,EAAI,EACR,KAAOA,EAAIF,EAAM,QAAQ,CACvB,IAAMG,EAAcC,GAAOJ,EAAOE,CAAC,EAC7BG,EAAQC,GAAS,YAAYH,CAAI,EACjCI,EAAoBC,GAAeL,CAAI,EACvCM,EAAOC,GAAYL,EAAOL,EAAOE,EAAIK,CAAU,EACjDI,EAAa,EAEbF,EAAO,GAAKJ,EAAM,OAASO,KAC7BD,EAAoBH,GAAeC,CAAI,GAGzC,IAAMI,EAAkBN,EAAaI,EAAaF,EAE5CK,EAAuB,CAC3B,KAAAX,EACA,KAAME,EAAM,KACZ,MAAOL,EAAM,SAASE,EAAGA,EAAIW,CAAe,GAG9C,GAAIJ,EAAO,EAAG,CACZ,IAAMM,EAAcb,EAAIK,EAAaI,EAC/BK,EAAahB,EAAM,SAASe,EAAaA,EAAcN,CAAI,EAEjEK,EAAU,MAAQT,EAAM,eAAeW,CAAU,GAAKC,GAAmBD,CAAU,CACrF,CAEAf,EAAW,KAAKa,CAAS,EAEzBZ,GAAKW,CACP,CAEA,OAAOZ,CACT,CAEM,SAAUiB,GAAmBjB,EAAuB,CACxD,IAAIkB,EAAS,EACPnB,EAAsB,CAAA,EAE5B,QAAWc,KAAab,EAAY,CAClC,GAAIa,EAAU,OAAS,KAAM,CAC3B,IAAMT,EAAQC,GAAS,YAAYQ,EAAU,IAAI,EAC3CM,EAAqBZ,GAAeM,EAAU,IAAI,EACpDE,EACAK,EAAc,EACdC,EAAoB,EAEpBR,EAAU,OAAS,OACrBE,EAAaX,EAAM,eAAeS,EAAU,KAAK,GAAKS,GAAqBT,EAAU,KAAK,EAC1FO,EAAcL,EAAW,WAErBX,EAAM,OAASO,KACjBU,EAA2Bd,GAAea,CAAW,IAIzD,IAAMrB,EAAQ,IAAI,WAAWoB,EAAcE,EAAoBD,CAAW,EAGtEG,EAAS,EACNC,GAAiBX,EAAU,KAAMd,EAAOwB,CAAM,EACrDA,GAAUJ,EAGNJ,GAAc,OAEZX,EAAM,OAASO,KACVa,GAAiBJ,EAAarB,EAAOwB,CAAM,EAClDA,GAAUF,GAIZtB,EAAM,IAAIgB,EAAYQ,CAAM,GAG9BV,EAAU,MAAQd,CACpB,CAEAA,EAAM,KAAKc,EAAU,KAAK,EAC1BK,GAAUL,EAAU,MAAM,UAC5B,CAEA,OAAOY,GAAiB1B,EAAOmB,CAAM,CACvC,CAEM,SAAUQ,GAAoBC,EAAc,CAChD,GAAIA,EAAO,OAAO,CAAC,IAAM,IACvB,MAAM,IAAIC,GAAsB,sCAAsC,EAGxE,IAAM5B,EAA0B,CAAA,EAC5B6B,EAAmC,WACnCC,EAAQ,GACRC,EAAW,GAEf,QAAS9B,EAAI,EAAGA,EAAI0B,EAAO,OAAQ1B,IAAK,CACtC,IAAM+B,EAAOL,EAAO,OAAO1B,CAAC,EAExB+B,IAAS,MACPH,IAAe,WACjBE,GAAYJ,EAAO,OAAO1B,CAAC,EAE3B6B,GAASH,EAAO,OAAO1B,CAAC,GAI5B,IAAMgC,EAAQhC,IAAM0B,EAAO,OAAS,EAEpC,GAAIK,IAAS,KAAOC,EAAO,CACzB,IAAM7B,EAAQC,GAAS,YAAY0B,CAAQ,EAE3C,GAAIF,IAAe,WAAY,CAC7B,GAAIzB,EAAM,MAAQ,MAAQA,EAAM,OAAS,EAAG,CAE1CJ,EAAW,KAAK,CACd,KAAMI,EAAM,KACZ,KAAMA,EAAM,KACb,EAED0B,EAAQ,GACRC,EAAW,GACXF,EAAa,WAEb,QACF,SAAWI,EACT,MAAM,IAAIL,GAAsB,aAAaG,CAAQ,oBAAoB,EAI3EF,EAAa,OACf,SAAWA,IAAe,QAAS,CACjC,IAAMhB,EAAuB,CAC3B,KAAMT,EAAM,KACZ,KAAMA,EAAM,MAGd,GAAIA,EAAM,MAAQ,MAAQA,EAAM,OAAS,EAAG,CAC1C,GAAI0B,IAAU,GACZ,MAAM,IAAIF,GAAsB,aAAaG,CAAQ,oBAAoB,EAG3ElB,EAAU,MAAQT,EAAM,gBAAgB0B,CAAK,GAAKA,CACpD,CAEA9B,EAAW,KAAKa,CAAS,EAEzBiB,EAAQ,GACRC,EAAW,GACXF,EAAa,UACf,CACF,CACF,CAEA,GAAIE,IAAa,IAAMD,IAAU,GAC/B,MAAM,IAAIF,GAAsB,sBAAsB,EAGxD,OAAO5B,CACT,CAEM,SAAUkC,GAAoBlC,EAAuB,CACzD,MAAO,IAAIA,EAAW,QAAQa,GAAY,CACtC,GAAIA,EAAU,OAAS,KACrB,OAAOA,EAAU,KAGnB,IAAMT,EAAQC,GAAS,YAAYQ,EAAU,IAAI,EAEjD,GAAIT,GAAS,KACX,MAAM,IAAIwB,GAAsB,yBAAyBf,EAAU,IAAI,EAAE,EAG3E,MAAO,CACLA,EAAU,KACVT,EAAM,gBAAgBS,EAAU,KAAK,GAAKA,EAAU,MAExD,CAAC,EAAE,KAAK,GAAG,CAAC,EAChB,CAKA,SAASJ,GAAaL,EAAsBL,EAAmBwB,EAAc,CAC3E,OAAInB,EAAM,MAAQ,MAAQA,EAAM,OAAS,EAChC,EAGLA,EAAM,KAAO,EACRA,EAAM,KAAO,EAGRD,GAAOJ,EAAOwB,CAAM,CACpC,CCrMA,IAAMY,GAAU,OAAO,IAAI,4BAA4B,EAC1CC,GAAS,OAAO,IAAI,yBAAyB,EAE1D,SAASC,GAAcC,EAAoB,CAKzC,GAJIA,GAAQ,OACVA,EAAO,KAGLC,GAAYD,CAAI,EAClB,OAAOA,EAAK,cAAa,EAG3B,GAAIA,aAAgB,WAClB,OAAOE,GAAkBF,CAAI,EAG/B,GAAI,OAAOA,GAAS,SAClB,OAAAA,EAAOA,EACJ,QAAQ,UAAW,GAAG,EACtB,QAAQ,SAAU,EAAE,EAEnBA,IAAS,KACXA,EAAO,KAGFG,GAAmBH,CAAI,EAGhC,GAAI,MAAM,QAAQA,CAAI,EACpB,OAAOA,EAGT,MAAM,IAAII,GAAsB,iEAAiE,CACnG,CASM,IAAOC,GAAP,MAAOC,CAAS,CACpB,CAACR,EAAM,EAAa,GACXS,GAGTC,GAEAC,GAEA,YAAaT,EAAqC,IAAKU,EAA4B,CAAA,EAAE,CACnF,KAAKH,GAAcR,GAAaC,CAAI,EAEhCU,EAAQ,WAAa,IACvBC,GAAS,IAAI,CAEjB,CAEA,IAAI,OAAK,CACP,OAAI,KAAKF,IAAU,OACjB,KAAKA,GAASG,GAAkB,KAAKL,EAAW,GAG3C,KAAKE,EACd,CAEA,UAAQ,CACN,OAAI,KAAKD,IAAW,OAClB,KAAKA,GAAUK,GAAmB,KAAKN,EAAW,GAG7C,KAAKC,EACd,CAEA,QAAM,CACJ,OAAO,KAAK,SAAQ,CACtB,CAEA,eAAa,CACX,MAAO,CACL,GAAG,KAAKD,GAAY,IAAIO,IAAM,CAAE,GAAGA,CAAC,EAAG,EAE3C,CAEA,YAAad,EAAoB,CAC/B,IAAMe,EAAK,IAAIT,EAAUN,CAAI,EAE7B,OAAO,IAAIM,EAAU,CACnB,GAAG,KAAKC,GACR,GAAGQ,EAAG,cAAa,GAClB,CACD,SAAU,GACX,CACH,CAEA,YAAaf,EAAwB,CACnC,IAAMgB,EAAahB,EAAK,SAAQ,EAC1BiB,EAAI,KAAK,SAAQ,EACjBC,EAAID,EAAE,YAAYD,CAAU,EAElC,GAAIE,EAAI,EACN,MAAM,IAAIC,GAAuB,WAAW,KAAK,SAAQ,CAAE,iCAAiCH,CAAU,EAAE,EAG1G,OAAO,IAAIV,EAAUW,EAAE,MAAM,EAAGC,CAAC,EAAG,CAClC,SAAU,GACX,CACH,CAEA,gBAAiBE,EAAY,CAC3B,IAAIC,EAEJ,QAASH,EAAI,KAAKX,GAAY,OAAS,EAAGW,EAAI,GAAIA,IAChD,GAAI,KAAKX,GAAYW,CAAC,EAAE,OAASE,EAAM,CACrCC,EAAQH,EACR,KACF,CAGF,OAAO,IAAIZ,EAAU,KAAKC,GAAY,MAAM,EAAGc,CAAK,EAAG,CACrD,SAAU,GACX,CACH,CAEA,OAAQrB,EAA2B,CACjC,OAAOsB,GAAiB,KAAK,MAAOtB,EAAK,KAAK,CAChD,CAcA,CAACH,EAAO,GAAC,CACP,MAAO,aAAa,KAAK,SAAQ,CAAE,GACrC,GAOI,SAAUc,GAAUX,EAAe,CACvCA,EAAK,cAAa,EACf,QAAQuB,GAAY,CACnB,IAAMC,EAAQC,GAAS,YAAYF,EAAU,IAAI,EAE7CA,EAAU,OAAS,MAIvBC,EAAM,WAAWD,EAAU,KAAK,CAClC,CAAC,CACL,CC6GM,SAAUG,GAAaC,EAAU,CACrC,MAAO,EAAQA,IAAQC,EAAM,CAC/B,CAeM,SAAUC,GAAWC,EAAqB,CAC9C,OAAO,IAAIC,GAAeD,CAAI,CAChC,CClSO,IAAME,EAAQA,IACZ,CACL,MAAQC,GAAQ,CACd,IAAMC,EAAYD,EAAK,CAAC,EAUxB,OARIC,GAAa,MAIbA,EAAU,OAASF,GAInBE,EAAU,OAAS,KACd,GAGFD,EAAK,MAAM,CAAC,CACrB,IAQSE,EAAQ,CAACH,EAAcG,KAC3B,CACL,MAAQF,GAAQ,CACd,IAAMC,EAAYD,EAAK,CAAC,EAUxB,OARIC,GAAW,OAASF,GAIpBE,EAAU,OAAS,MAInBC,GAAS,MAAQD,EAAU,QAAUC,EAChC,GAGFF,EAAK,MAAM,CAAC,CACrB,IAQSG,GAAOC,IACX,CACL,MAAQJ,GACSI,EAAQ,MAAMJ,CAAI,IAElB,GACNA,EAGF,KAQAK,EAAYD,IAChB,CACL,MAAQJ,GAAQ,CACd,IAAMM,EAASF,EAAQ,MAAMJ,CAAI,EAEjC,OAAIM,IAAW,GACNN,EAGFM,CACT,IAOSC,GAAK,IAAIC,KACb,CACL,MAAQR,GAAQ,CACd,IAAIS,EAEJ,QAAWL,KAAWI,EAAU,CAC9B,IAAMF,EAASF,EAAQ,MAAMJ,CAAI,EAG7BM,IAAW,KAKXG,GAAW,MAAQH,EAAO,OAASG,EAAQ,UAC7CA,EAAUH,EAEd,CAEA,OAAIG,GACK,EAIX,IAOSC,EAAM,IAAIF,KACd,CACL,MAAQR,GAAQ,CACd,QAAWI,KAAWI,EAAU,CAE9B,IAAMF,EAASF,EAAQ,MAAMJ,CAAI,EAGjC,GAAIM,IAAW,GACb,MAAO,GAGTN,EAAOM,CACT,CAEA,OAAON,CACT,IAOE,SAAUW,KAAQH,EAAmB,CACzC,SAASI,EAAOC,EAAc,CAC5B,GAAIA,GAAM,KACR,MAAO,GAGT,IAAIC,EAAQD,EAAG,cAAa,EAE5B,QAAWT,KAAWI,EAAU,CAC9B,IAAMF,EAASF,EAAQ,MAAMU,CAAK,EAElC,GAAIR,IAAW,GACb,MAAO,GAGTQ,EAAQR,CACV,CAEA,OAAOQ,CACT,CAEA,SAASL,EAASI,EAAc,CAG9B,OAFeD,EAAMC,CAAE,IAEL,EACpB,CAEA,SAASE,EAAYF,EAAc,CACjC,IAAMP,EAASM,EAAMC,CAAE,EAEvB,OAAIP,IAAW,GACN,GAGFA,EAAO,SAAW,CAC3B,CAEA,MAAO,CACL,SAAAE,EACA,QAAAC,EACA,WAAAM,EAEJ,CCzGA,IAAMC,GAAWC,EAAM,GAAQ,EAElBC,GAAUC,EAAIH,EAAQ,EAK7BI,GAAQH,EAAM,EAAS,EACvBI,GAAQJ,EAAM,EAAS,EACvBK,GAAWL,EAAM,EAAY,EAC7BM,GAAON,EAAM,EAAQ,EAgBdO,GAAOL,EAAIC,GAAOK,EAASR,EAAM,GAAQ,CAAC,CAAC,EAgB3CS,GAAOP,EAAIE,GAAOI,EAASR,EAAM,GAAQ,CAAC,CAAC,EAiB3CU,GAAUR,EAAIG,GAAUG,EAASR,EAAM,GAAQ,CAAC,CAAC,EAiBjDW,GAAMT,EAAIU,GAAGN,GAAMD,GAAUF,GAAOC,EAAK,EAAGI,EAASR,EAAM,GAAQ,CAAC,CAAC,EAE5Ea,GAAOC,EACXd,EAAM,CAAQ,EACdQ,EAASR,EAAM,EAAW,CAAC,CAAC,EAExBe,GAAOD,EACXN,EAASR,EAAM,EAAY,CAAC,EAC5BA,EAAM,EAAQ,EACdQ,EAASR,EAAM,EAAW,CAAC,CAAC,EAExBgB,GAAMJ,GAAGC,GAAME,EAAI,EAEnBE,GAAgBL,GAAGI,GAAKV,GAAMH,GAAOC,GAAOC,EAAQ,EAiB7Ca,GAAehB,EAAIU,GAAGI,GAAKF,EAAIF,GAAGN,GAAMD,GAAUF,GAAOC,EAAK,EAAGI,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,CAAC,EAkB5FmB,GAAMjB,EAAIW,EAAI,EAkBdO,GAAMlB,EAAIa,EAAI,EAedM,GAAKnB,EAAIc,EAAG,EAEnBM,GAAOR,EAAIG,GAAejB,EAAM,CAAQ,CAAC,EACzCuB,GAAOT,EAAIG,GAAejB,EAAM,GAAQ,CAAC,EAclCwB,GAAMtB,EAAIY,EAAIQ,GAAMd,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,EAc9CyB,GAAMvB,EAAIqB,EAAI,EAErBG,GAAQZ,EAAIS,GAAMI,EAAK,GAAS,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,EAC5D4B,GAAWd,EAAIS,GAAMI,EAAK,GAAY,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,EAElE6B,GAAgBjB,GAAGc,GAAOE,EAAQ,EAc3BE,GAAO5B,EAAIwB,EAAK,EAchBK,GAAU7B,EAAI0B,EAAQ,EAE7BI,GAAOpB,GACXK,GACAK,GACAC,GACAG,GACAE,EAAQ,EAGJK,GAAcrB,GAClBE,EAAIkB,GAAML,EAAK,GAAO,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,EAexCkC,GAAahC,EAAI+B,EAAW,EAEnCE,GAAoBvB,GACxBE,EAAIkB,GAAML,EAAK,GAAQ,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,EACnDc,EAAIkB,GAAML,EAAK,GAAQ,EAAGnB,EAASR,EAAM,GAAQ,CAAC,EAAG2B,EAAK,GAAO,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,EAenFoC,GAAmBlC,EAAIiC,EAAiB,EAE/CE,GAAgBvB,EAAIS,GAAMI,EAAK,GAAkB,EAAGnB,EAASR,EAAM,GAAa,CAAC,EAAGQ,EAASR,EAAM,GAAa,CAAC,EAAGQ,EAASR,EAAM,GAAQ,CAAC,CAAC,EActIsC,GAAepC,EAAImC,EAAa,EAEvCE,GAAgBzB,EAAIc,GAAUD,EAAK,GAAiB,EAAGnB,EAASR,EAAM,GAAa,CAAC,EAAGQ,EAASR,EAAM,GAAa,CAAC,EAAGQ,EAASR,EAAM,GAAQ,CAAC,CAAC,EAczIwC,GAAetC,EAAIqC,EAAa,EAEvCE,GAAO7B,GACXqB,GACAE,GACArB,EAAIQ,GAAMd,EAASR,EAAM,GAAQ,CAAC,CAAC,EACnCc,EAAIe,GAAerB,EAASR,EAAM,GAAQ,CAAC,CAAC,EAC5Cc,EAAIG,GAAeT,EAASR,EAAM,GAAQ,CAAC,CAAC,EAC5CqC,GACAE,GACAvC,EAAM,GAAQ,CAAC,EAeJ0C,GAAMxC,EAAIuC,EAAI,EAErBE,GAAW7B,EAAIN,EAASiC,EAAI,EAAGd,EAAK,GAAgB,EAAGiB,GAAIjB,EAAK,GAAW,CAAC,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,EAcjG6C,GAAU3C,EAAIyC,EAAQ,EAE7BG,GAAUlC,GACdE,EAAI2B,GAAMd,EAAK,GAAgB,EAAGA,EAAK,GAAW,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,EAC9Ec,EAAI2B,GAAMd,EAAK,GAAW,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,EACtDc,EAAIa,EAAK,GAAW,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,EAetC+C,GAAS7C,EAAI4C,EAAO,EAE3BE,GAAQpC,GACZE,EAAIG,GAAejB,EAAM,CAAQ,EAAG2B,EAAK,GAAS,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,EAC9Ec,EAAIG,GAAeU,EAAK,GAAS,EAAGnB,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,EAenDiD,GAAO/C,EAAI8C,EAAK,EAEvBE,GAASpC,EAAIG,GAAeL,GAChCE,EAAId,EAAM,EAAU,KAAK,EAAG2B,EAAK,GAAS,CAAC,EAC3Cb,EAAId,EAAM,CAAQ,EAAG2B,EAAK,GAAU,CAAC,EACrCb,EAAId,EAAM,CAAQ,EAAG2B,EAAK,GAAQ,EAAGA,EAAK,GAAS,CAAC,EACpDb,EAAIa,EAAK,GAAQ,EAAGA,EAAK,GAAS,CAAC,EACnCA,EAAK,GAAQ,EACbA,EAAK,GAAU,CAAC,EAElBnB,EAASR,EAAM,GAAQ,CAAC,CAAC,EAeZmD,GAAQjD,EAAIgD,EAAM,EAEzBE,GAAUxC,GACdE,EAAId,EAAM,GAAW,EAAGQ,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,EAevCqD,GAASnD,EAAIkD,EAAO,EAE3BE,GAAQ1C,GACZE,EAAId,EAAM,GAAS,EAAGQ,EAASR,EAAM,GAAQ,CAAC,CAAC,CAAC,EAerCuD,GAAOrD,EAAIoD,EAAK,ECtfvB,IAAOE,GAAP,cAAwE,KAAK,CAC1E,KACA,OAEP,YAAaC,EAASC,EAAU,CAC9B,MAAMD,CAAI,EAEV,KAAK,KAAOA,EAEZ,KAAK,OAASC,CAChB,GC9BF,IAAAC,GAAgB,qBC8DV,SAAUC,GAAcC,EAAa,CACzC,IAAMC,EAAaD,EAAG,cAAa,EAC7BE,EAAc,CAAA,EAChBC,EAAQ,EAoCZ,GAlCIF,EAAWE,CAAK,GAAG,OAAS,YAC9BD,EAAO,KAAO,GAAGD,EAAWE,CAAK,EAAE,KAAK,GACxCA,KAGEF,EAAWE,CAAK,EAAE,OAAS,OAASF,EAAWE,CAAK,EAAE,OAAS,OAIxDF,EAAWE,CAAK,EAAE,OAAS,OAASF,EAAWE,CAAK,EAAE,OAAS,QAAUF,EAAWE,CAAK,EAAE,OAAS,QAH7GD,EAAO,KAAOD,EAAWE,CAAK,EAAE,KAChCD,EAAO,KAAOD,EAAWE,CAAK,EAAE,MAChCA,KAKSF,EAAWE,CAAK,EAAE,OAAS,YACpCD,EAAO,KAAOD,EAAWE,CAAK,EAAE,KAChCD,EAAO,KAAO,YAAYD,EAAWE,CAAK,EAAE,KAAK,GACjDA,MAGEF,EAAWE,CAAK,GAAG,OAAS,OAASF,EAAWE,CAAK,GAAG,OAAS,SACnED,EAAO,SAAWD,EAAWE,CAAK,EAAE,OAAS,MAAQ,MAAQ,MAC7DD,EAAO,KAAO,SAAS,GAAGD,EAAWE,CAAK,EAAE,KAAK,EAAE,EACnDA,KAGEF,EAAWE,CAAK,GAAG,OAAS,WAC1BD,EAAO,OAAS,MAClBA,EAAO,KAAO,SAAS,GAAGD,EAAWE,CAAK,EAAE,KAAK,EAAE,EAC1CD,EAAO,OAAS,QACzBA,EAAO,KAAO,GAAGD,EAAWE,CAAK,EAAE,KAAK,IAE1CA,KAGED,EAAO,MAAQ,MAAQA,EAAO,MAAQ,KACxC,MAAM,IAAIE,EAAuB,aAAaJ,CAAE,4DAA4D,EAG9G,OAAIC,EAAWE,CAAK,GAAG,OAAS,OAASF,EAAWE,EAAQ,CAAC,GAAG,OAAS,QACvED,EAAO,IAAMD,EAAWE,EAAQ,CAAC,EAAE,MACnCA,GAAS,GAGJD,CACT,CC/Ge,SAARG,IAA0B,CAChC,IAAMC,EAAW,CAAC,EAElB,OAAAA,EAAS,QAAU,IAAI,QAAQ,CAACC,EAASC,IAAW,CACnDF,EAAS,QAAUC,EACnBD,EAAS,OAASE,CACnB,CAAC,EAEMF,CACR,CCDA,IAAMG,GAAN,KAAe,CACN,OACU,KACT,IACA,IACD,KAEP,YAAaC,EAAW,CACtB,GAAI,EAAEA,EAAM,KAAQA,EAAM,EAAKA,KAAS,EACtC,MAAM,IAAI,MAAM,mDAAmD,EAGrE,KAAK,OAAS,IAAI,MAAMA,CAAG,EAC3B,KAAK,KAAOA,EAAM,EAClB,KAAK,IAAM,EACX,KAAK,IAAM,EACX,KAAK,KAAO,IACd,CAEA,KAAMC,EAAa,CACjB,OAAI,KAAK,OAAO,KAAK,GAAG,IAAM,OACrB,IAGT,KAAK,OAAO,KAAK,GAAG,EAAIA,EACxB,KAAK,IAAO,KAAK,IAAM,EAAK,KAAK,KAE1B,GACT,CAEA,OAAK,CACH,IAAMC,EAAO,KAAK,OAAO,KAAK,GAAG,EAEjC,GAAIA,IAAS,OAIb,YAAK,OAAO,KAAK,GAAG,EAAI,OACxB,KAAK,IAAO,KAAK,IAAM,EAAK,KAAK,KAC1BA,CACT,CAEA,SAAO,CACL,OAAO,KAAK,OAAO,KAAK,GAAG,IAAM,MACnC,GAUWC,GAAP,KAAW,CACR,KACU,IACT,KACA,KAER,YAAaC,EAAuB,CAAA,EAAE,CACpC,KAAK,IAAMA,EAAQ,YAAc,GACjC,KAAK,KAAO,IAAIL,GAAa,KAAK,GAAG,EACrC,KAAK,KAAO,KAAK,KACjB,KAAK,KAAO,CACd,CAEA,cAAeM,EAAQ,CACrB,OAAIA,GAAK,YAAc,KACdA,EAAI,WAGN,CACT,CAEA,KAAMC,EAAY,CAKhB,GAJIA,GAAK,OAAS,OAChB,KAAK,MAAQ,KAAK,cAAcA,EAAI,KAAK,GAGvC,CAAC,KAAK,KAAK,KAAKA,CAAG,EAAG,CACxB,IAAMC,EAAO,KAAK,KAClB,KAAK,KAAOA,EAAK,KAAO,IAAIR,GAAa,EAAI,KAAK,KAAK,OAAO,MAAM,EACpE,KAAK,KAAK,KAAKO,CAAG,EAEtB,CAEA,OAAK,CACH,IAAIA,EAAM,KAAK,KAAK,MAAK,EAEzB,GAAIA,IAAQ,QAAc,KAAK,KAAK,MAAQ,KAAO,CACjD,IAAME,EAAO,KAAK,KAAK,KACvB,KAAK,KAAK,KAAO,KACjB,KAAK,KAAOA,EACZF,EAAM,KAAK,KAAK,MAAK,EAGvB,OAAIA,GAAK,OAAS,OAChB,KAAK,MAAQ,KAAK,cAAcA,EAAI,KAAK,GAGpCA,CACT,CAEA,SAAO,CACL,OAAO,KAAK,KAAK,QAAO,CAC1B,GC9DI,IAAOG,GAAP,cAA0B,KAAK,CACnC,KACA,KAEA,YAAaC,EAAkBC,EAAa,CAC1C,MAAMD,GAAW,2BAA2B,EAC5C,KAAK,KAAO,UACZ,KAAK,KAAOC,GAAQ,WACtB,GAoFI,SAAUC,GAAaC,EAAmB,CAAA,EAAE,CAmBhD,OAAOC,GAlBUC,GAAkC,CACjD,IAAMC,EAA4BD,EAAO,MAAK,EAE9C,GAAIC,GAAQ,KACV,MAAO,CAAE,KAAM,EAAI,EAGrB,GAAIA,EAAK,OAAS,KAChB,MAAMA,EAAK,MAGb,MAAO,CACL,KAAMA,EAAK,OAAS,GAEpB,MAAOA,EAAK,MAEhB,EAE6CH,CAAO,CACtD,CAuCA,SAASI,GAA4CC,EAAuCC,EAAiB,CAC3GA,EAAUA,GAAW,CAAA,EACrB,IAAIC,EAAQD,EAAQ,MAChBE,EAAS,IAAIC,GACbC,EACAC,EACAC,EACAC,EAAQC,GAAQ,EAEdC,EAAW,SAA2C,CAC1D,GAAI,CACF,OAAKP,EAAO,QAAO,EAIfI,EACK,CAAE,KAAM,EAAI,EAGd,MAAM,IAAI,QAA+B,CAACI,EAASC,IAAU,CAClEN,EAAUO,GAAwB,CAChCP,EAAS,KACTH,EAAO,KAAKU,CAAI,EAEhB,GAAI,CACFF,EAAQX,EAAQG,CAAM,CAAC,QAChBW,EAAK,CACZF,EAAOE,CAAG,EAGZ,OAAOT,CACT,CACF,CAAC,EApBQL,EAAQG,CAAM,UAsBnBA,EAAO,QAAO,GAGhB,eAAe,IAAK,CAClBK,EAAM,QAAO,EACbA,EAAQC,GAAQ,CAClB,CAAC,EAGP,EAEMM,EAAcF,GACdP,GAAU,KACLA,EAAOO,CAAI,GAGpBV,EAAO,KAAKU,CAAI,EACTR,GAGHW,EAAeF,IACnBX,EAAS,IAAIC,GAETE,GAAU,KACLA,EAAO,CAAE,MAAOQ,CAAG,CAAE,GAG9BX,EAAO,KAAK,CAAE,MAAOW,CAAG,CAAE,EACnBT,IAGHY,EAAQC,GAA+B,CAC3C,GAAIX,EACF,OAAOF,EAIT,GAAIJ,GAAS,aAAe,IAAQiB,GAAO,YAAc,KACvD,MAAM,IAAI,MAAM,gEAAgE,EAGlF,OAAOH,EAAW,CAAE,KAAM,GAAO,MAAAG,CAAK,CAAE,CAC1C,EACMC,EAAOL,GACPP,EAAcF,GAClBE,EAAQ,GAEAO,GAAO,KAAQE,EAAYF,CAAG,EAAIC,EAAW,CAAE,KAAM,EAAI,CAAE,GAE/DK,EAAU,KACdjB,EAAS,IAAIC,GACbe,EAAG,EAEI,CAAE,KAAM,EAAI,GAEfE,EAAUP,IACdK,EAAIL,CAAG,EAEA,CAAE,KAAM,EAAI,GA+CrB,GA5CAT,EAAW,CACT,CAAC,OAAO,aAAa,GAAC,CAAM,OAAO,IAAK,EACxC,KAAMK,EACN,OAAQU,EACR,MAAOC,EACP,KAAAJ,EACA,IAAAE,EACA,IAAI,gBAAc,CAChB,OAAOhB,EAAO,IAChB,EACA,QAAS,MAAOF,GAA0B,CACxC,IAAMqB,EAASrB,GAAS,OAGxB,GAFAqB,GAAQ,eAAc,EAElBnB,EAAO,QAAO,EAChB,OAGF,IAAIoB,EACAC,EAEAF,GAAU,OACZC,EAAS,IAAI,QAAQ,CAACZ,EAASC,IAAU,CACvCY,EAAW,IAAK,CACdZ,EAAO,IAAIa,EAAY,CACzB,EAEAH,EAAO,iBAAiB,QAASE,CAAQ,CAC3C,CAAC,GAGH,GAAI,CACF,MAAM,QAAQ,KAAK,CACjBhB,EAAM,QACNe,EACD,UAEGC,GAAY,MAAQF,GAAU,MAChCA,GAAQ,oBAAoB,QAASE,CAAQ,EAGnD,GAGEtB,GAAS,KACX,OAAOG,EAGT,IAAMN,EAAYM,EAElB,OAAAA,EAAW,CACT,CAAC,OAAO,aAAa,GAAC,CAAM,OAAO,IAAK,EACxC,MAAI,CACF,OAAON,EAAU,KAAI,CACvB,EACA,MAAOe,EAAU,CACf,OAAAf,EAAU,MAAMe,CAAG,EAEfZ,GAAS,OACXA,EAAMY,CAAG,EACTZ,EAAQ,QAGH,CAAE,KAAM,EAAI,CACrB,EACA,QAAM,CACJ,OAAAH,EAAU,OAAM,EAEZG,GAAS,OACXA,EAAK,EACLA,EAAQ,QAGH,CAAE,KAAM,EAAI,CACrB,EACA,KAAAe,EACA,IAAKH,EAAU,CACb,OAAAf,EAAU,IAAIe,CAAG,EAEbZ,GAAS,OACXA,EAAMY,CAAG,EACTZ,EAAQ,QAGHG,CACT,EACA,IAAI,gBAAc,CAChB,OAAON,EAAU,cACnB,EACA,QAAU2B,GACD3B,EAAU,QAAQ2B,CAAI,GAI1BrB,CACT,CCzYO,IAAMsB,GAAN,cAA2B,KAAM,CACvC,YAAYC,EAAS,CACpB,MAAMA,CAAO,EACb,KAAK,KAAO,cACb,CACD,EAMaC,GAAN,cAAyB,KAAM,CACrC,YAAYD,EAAS,CACpB,MAAM,EACN,KAAK,KAAO,aACZ,KAAK,QAAUA,CAChB,CACD,EAKME,GAAkBC,GAAgB,WAAW,eAAiB,OACjE,IAAIF,GAAWE,CAAY,EAC3B,IAAI,aAAaA,CAAY,EAK1BC,GAAmBC,GAAU,CAClC,IAAMC,EAASD,EAAO,SAAW,OAC9BH,GAAgB,6BAA6B,EAC7CG,EAAO,OAEV,OAAOC,aAAkB,MAAQA,EAASJ,GAAgBI,CAAM,CACjE,EAEe,SAARC,GAA0BC,EAASC,EAAS,CAClD,GAAM,CACL,aAAAC,EACA,SAAAC,EACA,QAAAX,EACA,aAAAY,EAAe,CAAC,WAAY,YAAY,CACzC,EAAIH,EAEAI,EACAC,EA8DEC,EA5DiB,IAAI,QAAQ,CAACC,EAASC,IAAW,CACvD,GAAI,OAAOP,GAAiB,UAAY,KAAK,KAAKA,CAAY,IAAM,EACnE,MAAM,IAAI,UAAU,4DAA4DA,CAAY,IAAI,EAGjG,GAAID,EAAQ,OAAQ,CACnB,GAAM,CAAC,OAAAJ,CAAM,EAAII,EACbJ,EAAO,SACVY,EAAOb,GAAiBC,CAAM,CAAC,EAGhCS,EAAe,IAAM,CACpBG,EAAOb,GAAiBC,CAAM,CAAC,CAChC,EAEAA,EAAO,iBAAiB,QAASS,EAAc,CAAC,KAAM,EAAI,CAAC,CAC5D,CAEA,GAAIJ,IAAiB,OAAO,kBAAmB,CAC9CF,EAAQ,KAAKQ,EAASC,CAAM,EAC5B,MACD,CAGA,IAAMC,EAAe,IAAInB,GAEzBc,EAAQD,EAAa,WAAW,KAAK,OAAW,IAAM,CACrD,GAAID,EAAU,CACb,GAAI,CACHK,EAAQL,EAAS,CAAC,CACnB,OAASQ,EAAO,CACfF,EAAOE,CAAK,CACb,CAEA,MACD,CAEI,OAAOX,EAAQ,QAAW,YAC7BA,EAAQ,OAAO,EAGZR,IAAY,GACfgB,EAAQ,EACEhB,aAAmB,MAC7BiB,EAAOjB,CAAO,GAEdkB,EAAa,QAAUlB,GAAW,2BAA2BU,CAAY,gBACzEO,EAAOC,CAAY,EAErB,EAAGR,CAAY,GAEd,SAAY,CACZ,GAAI,CACHM,EAAQ,MAAMR,CAAO,CACtB,OAASW,EAAO,CACfF,EAAOE,CAAK,CACb,CACD,GAAG,CACJ,CAAC,EAEwC,QAAQ,IAAM,CACtDJ,EAAkB,MAAM,EACpBD,GAAgBL,EAAQ,QAC3BA,EAAQ,OAAO,oBAAoB,QAASK,CAAY,CAE1D,CAAC,EAED,OAAAC,EAAkB,MAAQ,IAAM,CAC/BH,EAAa,aAAa,KAAK,OAAWC,CAAK,EAC/CA,EAAQ,MACT,EAEOE,CACR,CCvHA,IAAMK,GAAmBC,GAAW,CACnC,IAAMC,EAAcD,EAAQ,kBAAoBA,EAAQ,IAAMA,EAAQ,YAChEE,EAAiBF,EAAQ,qBAAuBA,EAAQ,KAAOA,EAAQ,eAE7E,GAAI,CAACC,GAAe,CAACC,EACpB,MAAM,IAAI,UAAU,2BAA2B,EAGhD,MAAO,CACN,YAAaD,EAAY,KAAKD,CAAO,EACrC,eAAgBE,EAAe,KAAKF,CAAO,CAC5C,CACD,EAEO,SAASG,GAAeH,EAASI,EAAOC,EAAS,CACvD,IAAIC,EACEC,EAAc,IAAI,QAAQ,CAACC,EAASC,IAAW,CAQpD,GAPAJ,EAAU,CACT,gBAAiB,CAAC,OAAO,EACzB,UAAW,GACX,mBAAoB,GACpB,GAAGA,CACJ,EAEI,EAAEA,EAAQ,OAAS,IAAMA,EAAQ,QAAU,OAAO,mBAAqB,OAAO,UAAUA,EAAQ,KAAK,IACxG,MAAM,IAAI,UAAU,iDAAiD,EAGtEA,EAAQ,QAAQ,eAAe,EAG/B,IAAMK,EAAS,CAACN,CAAK,EAAE,KAAK,EAEtBO,EAAQ,CAAC,EACT,CAAC,YAAAV,EAAa,eAAAC,CAAc,EAAIH,GAAiBC,CAAO,EAExDY,EAAS,IAAIC,IAAe,CACjC,IAAMC,EAAQT,EAAQ,UAAYQ,EAAaA,EAAW,CAAC,EAGvDR,EAAQ,QAAU,CAACA,EAAQ,OAAOS,CAAK,IAI3CH,EAAM,KAAKG,CAAK,EAEZT,EAAQ,QAAUM,EAAM,SAC3BL,EAAO,EACPE,EAAQG,CAAK,GAEf,EAEMI,EAAgBC,GAAS,CAC9BV,EAAO,EACPG,EAAOO,CAAK,CACb,EAEAV,EAAS,IAAM,CACd,QAAWF,KAASM,EACnBR,EAAeE,EAAOQ,CAAM,EAG7B,QAAWK,KAAkBZ,EAAQ,gBACpCH,EAAee,EAAgBF,CAAa,CAE9C,EAEA,QAAWX,KAASM,EACnBT,EAAYG,EAAOQ,CAAM,EAG1B,QAAWK,KAAkBZ,EAAQ,gBACpCJ,EAAYgB,EAAgBF,CAAa,EAGtCV,EAAQ,QACXA,EAAQ,OAAO,iBAAiB,QAAS,IAAM,CAC9CU,EAAcV,EAAQ,OAAO,MAAM,CACpC,EAAG,CAAC,KAAM,EAAI,CAAC,EAGZA,EAAQ,oBACXG,EAAQG,CAAK,CAEf,CAAC,EAID,GAFAJ,EAAY,OAASD,EAEjB,OAAOD,EAAQ,SAAY,SAAU,CACxC,IAAMa,EAAUC,GAASZ,EAAa,CAAC,aAAcF,EAAQ,OAAO,CAAC,EACrE,OAAAa,EAAQ,OAASZ,EACVY,CACR,CAEA,OAAOX,CACR,CAEO,SAASa,GAAOpB,EAASI,EAAOC,EAAS,CAC3C,OAAOA,GAAY,aACtBA,EAAU,CAAC,OAAQA,CAAO,GAG3BA,EAAU,CACT,GAAGA,EACH,MAAO,EACP,mBAAoB,EACrB,EAEA,IAAMgB,EAAelB,GAAeH,EAASI,EAAOC,CAAO,EACrDiB,EAAUD,EAAa,KAAKE,GAASA,EAAM,CAAC,CAAC,EACnD,OAAAD,EAAQ,OAASD,EAAa,OAEvBC,CACR,CCrFM,IAAOE,GAAP,cAAkC,KAAK,CAC3C,OAAO,KAAO,qBACd,KAAO,sBCkCT,SAASC,GAAkBC,EAAmB,CAC5C,OAAOA,EAAO,MAChB,CAKA,eAAsBC,GAAgBC,EAAqBF,EAAsBG,EAAwB,CACvG,GAAIH,GAAU,KACZ,OAAOE,EAGT,IAAME,EAAiBD,GAAM,gBAAkBJ,GAE/C,GAAIC,EAAO,QAGT,OAAAE,EAAQ,MAAM,IAAK,CAAE,CAAC,EACf,QAAQ,OAAOE,EAAeJ,CAAM,CAAC,EAG9C,IAAIK,EAEJ,GAAI,CACF,OAAO,MAAM,QAAQ,KAAK,CACxBH,EACA,IAAI,QAAW,CAACI,EAASC,IAAU,CACjCF,EAAW,IAAK,CACdE,EAAOH,EAAeJ,CAAM,CAAC,CAC/B,EACAA,EAAO,iBAAiB,QAASK,CAAQ,CAC3C,CAAC,EACF,CACH,SACMA,GAAY,MACdL,EAAO,oBAAoB,QAASK,CAAQ,CAEhD,CACF,CClGA,IAAMG,GAAiC,KAAK,IAAI,EAAG,EAAE,EAAI,EAiCnCC,GAAhB,cAA8GC,EAAsC,CACjJ,OACS,SACT,kBACA,oBACA,qBACS,IACT,UACA,eAEA,WACA,YACA,iBACA,kBAEA,mBAOY,WACA,YACT,YAEV,YAAaC,EAAuB,CAClC,MAAK,EAEL,KAAK,OAAS,OACd,KAAK,IAAMA,EAAK,IAChB,KAAK,UAAYA,EAAK,WAAa,WACnC,KAAK,kBAAoBA,EAAK,mBAAqB,KACnD,KAAK,oBAAsBA,EAAK,qBAAuBH,GACvD,KAAK,qBAAuBG,EAAK,qBACjC,KAAK,eAAiBA,EAAK,eAC3B,KAAK,WAAa,IAAIC,GACtB,KAAK,YAAc,IAAIA,GAEvB,KAAK,WAAa,WAClB,KAAK,iBAAmB,WACxB,KAAK,YAAc,WACnB,KAAK,kBAAoB,WACzB,KAAK,YAAc,GACnB,KAAK,mBAAqB,GAG1B,KAAK,SAAW,CACd,KAAM,KAAK,IAAG,GAGhB,KAAK,iBAAmB,KAAK,iBAAiB,KAAK,IAAI,EAEvD,IAAMC,EAAyB,IAAW,CACxC,KAAK,IAAI,MAAM,6CAA6C,EAC5D,KAAK,mBAAqB,GAC1B,KAAK,iBAAgB,CACvB,EACA,KAAK,iBAAiB,QAASA,CAAsB,CACvD,CAEA,OAAS,OAAO,aAAa,GAAC,CAC5B,GAAI,KAAK,aAAe,YAAc,KAAK,aAAe,SACxD,OAGF,IAAMC,EAASC,GAAQ,EAEjBC,EAAwCC,GAAiC,CAC7EH,EAAO,KAAKG,EAAI,IAAI,CACtB,EACA,KAAK,iBAAiB,UAAWD,CAAoC,EAErE,IAAME,EAAsCD,GAA+B,CACzEH,EAAO,IAAIG,EAAI,KAAK,CACtB,EACA,KAAK,iBAAiB,QAASC,CAAkC,EAEjE,IAAMC,EAAgD,IAAW,CAC/DL,EAAO,IAAG,CACZ,EACA,KAAK,iBAAiB,mBAAoBK,CAA6C,EAEvF,GAAI,CACF,MAAQL,CACV,SACE,KAAK,oBAAoB,UAAWE,CAAoC,EACxE,KAAK,oBAAoB,QAASE,CAAkC,EACpE,KAAK,oBAAoB,mBAAoBC,CAA6C,CAC5F,CACF,CAEA,YAAU,CACR,OAAO,KAAK,SAAW,MACzB,CAEA,KAAMC,EAAiC,CACrC,GAAI,KAAK,cAAgB,UAAY,KAAK,cAAgB,UACxD,MAAM,IAAIC,GAAiB,oCAAoC,KAAK,WAAW,EAAE,EAGnF,YAAK,IAAI,MAAM,kCAAmCD,EAAK,UAAU,EACjE,KAAK,YAAY,OAAOA,CAAI,EAErB,KAAK,iBAAgB,CAC9B,CAMA,MAAOE,EAAU,CACf,GAAI,OAAK,SAAW,WAAa,KAAK,SAAW,SAAW,KAAK,SAAW,UAI5E,MAAK,IAAI,MAAM,wBAAyBA,CAAG,EAE3C,KAAK,OAAS,UAGV,KAAK,WAAW,WAAa,GAC/B,KAAK,WAAW,QAAQ,KAAK,WAAW,UAAU,EAIhD,KAAK,YAAY,WAAa,IAChC,KAAK,YAAY,QAAQ,KAAK,YAAY,UAAU,EACpD,KAAK,kBAAkB,MAAM,GAG/B,KAAK,YAAc,SACnB,KAAK,kBAAoB,SAEzB,KAAK,WAAa,SAClB,KAAK,iBAAmB,SACxB,KAAK,SAAS,MAAQ,KAAK,IAAG,EAE9B,GAAI,CACF,KAAK,UAAUA,CAAG,CACpB,OAASA,EAAU,CACjB,KAAK,IAAI,sCAAuCA,CAAG,CACrD,CAEA,KAAK,cAAc,IAAIC,GAAiBD,CAAG,CAAC,EAC9C,CAEA,OAAK,CACH,GAAI,KAAK,aAAe,UAAY,KAAK,aAAe,UACtD,MAAM,IAAID,GAAiB,8CAA8C,EAGvE,KAAK,aAAe,WAIxB,KAAK,WAAa,SAClB,KAAK,UAAS,EAChB,CAEA,QAAM,CACJ,GAAI,KAAK,aAAe,UAAY,KAAK,aAAe,UACtD,MAAM,IAAIA,GAAiB,+CAA+C,EAGxE,KAAK,aAAe,aAIxB,KAAK,WAAa,WAElB,KAAK,mBAAkB,EACvB,KAAK,WAAU,EACjB,CAEA,KAAMD,EAAiC,CACrC,GAAI,KAAK,aAAe,UAAY,KAAK,aAAe,UACtD,MAAM,IAAIC,GAAiB,0CAA0C,KAAK,UAAU,EAAE,EAGxF,GAAID,EAAK,aAAe,EAMxB,IAFA,KAAK,WAAW,OAAOA,CAAI,EAEvB,KAAK,aAAe,UAAY,KAAK,cAAc,SAAS,IAAM,EAAG,CAEvE,KAAK,sBAAqB,EAE1B,MACF,CAGA,WAAW,IAAK,CACd,KAAK,mBAAkB,CACzB,EAAG,CAAC,EACN,CAMA,OAAQA,EAAiC,CACvC,GAAIA,EAAK,aAAe,EAMxB,IAAI,KAAK,aAAe,WAAa,KAAK,aAAe,SAAU,CACjE,KAAK,IAAI,iCAAkC,KAAK,UAAU,EAC1D,MACF,CAEA,KAAK,WAAW,OAAOA,CAAI,EAC3B,KAAK,mBAAkB,EACzB,CAIA,oBAAqBI,EAAW,CAE9B,MAAM,iBAAiB,MAAM,KAAMA,CAAI,EAInCA,EAAK,CAAC,IAAM,WAAa,KAAK,WAAW,WAAa,GAIxD,eAAe,IAAK,CAClB,KAAK,mBAAkB,CACzB,CAAC,CAEL,CAMA,eAAa,CACX,KAAK,IAAI,cAAc,EAEvB,KAAK,OAAS,QACd,KAAK,YAAc,SACnB,KAAK,kBAAoB,SACzB,KAAK,iBAAmB,SACxB,KAAK,SAAS,MAAQ,KAAK,IAAG,EAE1B,KAAK,WAAW,aAAe,IACjC,KAAK,WAAa,UAGpB,IAAMF,EAAM,IAAIG,GAChB,KAAK,cAAc,IAAIC,GAAiBJ,CAAG,CAAC,CAC9C,CAOA,kBAAmBA,EAAW,CAC5B,KAAK,IAAI,kBAAkB,EAEvB,KAAK,aAAe,YAAc,KAAK,WAAW,aAAe,IACnE,KAAK,WAAa,UAGhB,KAAK,mBAAqB,WAC5B,KAAK,iBAAmB,UAGtB,KAAK,oBAAsB,WAC7B,KAAK,kBAAoB,UAGvB,KAAK,cAAgB,WACvB,KAAK,YAAc,UAGjBA,GAAO,KACT,KAAK,MAAMA,CAAG,GAEV,KAAK,SAAW,QAAU,KAAK,SAAW,aAC5C,KAAK,SAAS,MAAQ,KAAK,IAAG,EAC9B,KAAK,OAAS,SACd,KAAK,YAAc,SACnB,KAAK,kBAAoB,SACzB,KAAK,iBAAmB,SACxB,KAAK,cAAc,IAAIK,EAAkB,EAG/C,CAKA,oBAAkB,CACZ,KAAK,oBAAsB,WAI/B,KAAK,IAAI,MAAM,uBAAuB,EAEtC,KAAK,kBAAoB,SAEzB,KAAK,kBAAkB,kBAAkB,EAErC,KAAK,cAAgB,UACvB,KAAK,kBAAiB,EAE1B,CAKA,mBAAiB,CACf,KAAK,IAAI,MAAM,sBAAsB,EAErC,KAAK,iBAAmB,SAGpB,KAAK,YAAY,WAAa,IAChC,KAAK,YAAY,QAAQ,KAAK,YAAY,UAAU,EACpD,KAAK,kBAAkB,MAAM,EAEjC,CAEU,kBAAgB,CAExB,GAAI,KAAK,mBACP,YAAK,IAAI,MAAM,gDAAgD,EAC/D,KAAK,uBAAsB,EAEpB,GAIT,GAAI,KAAK,YAAY,aAAe,EAClC,YAAK,IAAI,MAAM,+CAA+C,EACvD,GAIT,GAAI,KAAK,YACP,YAAK,IAAI,MAAM,mDAAmD,EAC3D,GAGT,KAAK,YAAc,GAEnB,KAAK,IAAI,MAAM,6CAA8C,KAAK,YAAY,UAAU,EAExF,GAAI,CACF,IAAIC,EAAc,GACZC,EAAa,KAAK,YAAY,WAChCC,EAAY,EAIhB,KAAO,KAAK,YAAY,WAAa,GAAG,CACtC,IAAMC,EAAM,KAAK,IAAI,KAAK,gBAAkB,KAAK,YAAY,WAAY,KAAK,YAAY,UAAU,EAGpG,GAAIA,IAAQ,EAAG,CACbH,EAAc,GACd,KACF,CAGA,IAAMI,EAAS,KAAK,YAAY,QAAQ,EAAGD,CAAG,EAGxCE,EAAW,IAAIrB,GAAeoB,CAAM,EAE1C,KAAK,YAAY,QAAQA,EAAO,UAAU,EAI1C,IAAME,EAAa,KAAK,SAASF,CAAM,EASvC,GARAJ,EAAcM,EAAW,YACzBJ,GAAaI,EAAW,UAEpBA,EAAW,YAAcD,EAAS,aACpCA,EAAS,QAAQC,EAAW,SAAS,EACrC,KAAK,YAAY,QAAQD,CAAQ,GAG/B,CAACL,EACH,KAEJ,CAEA,OAAKA,IACH,KAAK,IAAI,MAAM,yGAA0GE,EAAWD,EAAY,KAAK,YAAY,UAAU,EAC3K,KAAK,mBAAqB,GAC1B,KAAK,uBAAsB,GAIzB,KAAK,YAAY,aAAe,GAClC,KAAK,kBAAkB,MAAM,EAGxBD,CACT,SACE,KAAK,YAAc,EACrB,CACF,CAEU,oBAAkB,CAC1B,GAAI,CACF,GAAI,KAAK,cAAc,SAAS,IAAM,EAAG,CACvC,KAAK,IAAI,MAAM,8EAA8E,EAC7F,MACF,CAEA,GAAI,KAAK,WAAW,aAAe,EAAG,CACpC,KAAK,IAAI,MAAM,8DAA8D,EAC7E,MACF,CAEA,GAAI,KAAK,aAAe,SAAU,CAChC,KAAK,IAAI,MAAM,4CAA4C,EAC3D,MACF,CAGA,GAAI,KAAK,aAAe,WAAa,KAAK,aAAe,SAAU,CACjE,KAAK,IAAI,mDAAoD,KAAK,WAAW,WAAY,KAAK,UAAU,EACxG,KAAK,WAAW,QAAQ,KAAK,WAAW,UAAU,EAClD,MACF,CAEA,IAAMO,EAAM,KAAK,WAAW,QAAO,EACnC,KAAK,WAAW,QAAQA,EAAI,UAAU,EAEtC,KAAK,cAAc,IAAIC,GAAmBD,CAAG,CAAC,CAChD,SACM,KAAK,oBAAsB,WAC7B,KAAK,WAAa,UAIpB,KAAK,sBAAqB,CAC5B,CACF,CAEQ,uBAAqB,CACvB,KAAK,WAAW,WAAa,KAAK,qBACpC,KAAK,MAAM,IAAIE,GAAkB,yBAAyB,KAAK,WAAW,UAAU,sBAAsB,KAAK,mBAAmB,oBAAoB,KAAK,UAAU,EAAE,CAAC,CAE5K,CAEQ,wBAAsB,CACxB,KAAK,sBAAwB,MAI7B,KAAK,YAAY,WAAa,KAAK,sBACrC,KAAK,MAAM,IAAIA,GAAkB,0BAA0B,KAAK,YAAY,UAAU,sBAAsB,KAAK,oBAAoB,qBAAqB,KAAK,WAAW,EAAE,CAAC,CAEjL,CAEO,mBAAiB,CACtB,KAAK,mBAAqB,EAC5B,CAEO,cAAY,CACjB,KAAK,kBAAkB,OAAO,CAChC,GC/eI,IAAgBC,GAAhB,cAAoDC,EAAqB,CACtE,WAEC,aACA,QAER,YAAaC,EAAqC,CAChD,MAAMA,CAAI,EAEV,KAAK,aAAeA,EAAK,cAAgB,GACzC,KAAK,QAAUA,EAAK,QACpB,KAAK,WAAaA,EAAK,WAEvB,KAAK,iBAAiB,QAAUC,GAAO,CACrC,KAAK,SAAS,UAAU,CAAE,CAAC,GAAG,KAAK,YAAY,KAAK,EAAG,EAAI,CAAE,EAEzDA,EAAI,OAAS,KACXA,EAAI,MACN,KAAK,SAAS,UAAU,CAAE,CAAC,GAAG,KAAK,YAAY,OAAO,EAAG,EAAI,CAAE,EAE/D,KAAK,SAAS,UAAU,CAAE,CAAC,GAAG,KAAK,YAAY,OAAO,EAAG,EAAI,CAAE,EAG7DA,EAAI,MACN,KAAK,SAAS,UAAU,CAAE,CAAC,GAAG,KAAK,YAAY,cAAc,EAAG,EAAI,CAAE,EAEtE,KAAK,SAAS,UAAU,CAAE,CAAC,GAAG,KAAK,YAAY,eAAe,EAAG,EAAI,CAAE,CAG7E,CAAC,CACH,CAEA,MAAM,MAAOC,EAAsB,CAC7B,KAAK,SAAW,SAIpB,KAAK,OAAS,UACd,KAAK,YAAc,UACnB,KAAK,kBAAoB,UACzB,KAAK,iBAAmB,WAIpB,KAAK,aAAe,KAAK,YAAY,WAAa,KACpD,KAAK,IAAI,gGAAiG,KAAK,YAAY,UAAU,EACrI,MAAMC,GAAO,KAAM,OAAQ,CACzB,GAAGD,EACH,gBAAiB,CACf,SAEH,GAKC,KAAK,qBACP,KAAK,IAAI,0FAA2F,KAAK,YAAY,UAAU,EAC/H,MAAMC,GAAO,KAAM,QAAS,CAC1B,GAAGD,EACH,gBAAiB,CACf,SAEH,GAGH,MAAM,KAAK,UAAUA,CAAO,EAE5B,KAAK,kBAAiB,EACxB,GCrFF,IAAAE,GAAe,oBCAT,SAAUC,GAAeC,EAAU,CAKvC,MAJI,GAAAA,EAAG,WAAW,UAAU,GAIxBA,EAAG,YAAW,EAAG,WAAW,MAAM,EAKxC,CCSM,SAAUC,GAAsBC,EAAmBC,EAAwBC,EAAa,CAC5F,IAAMC,EAAgC,CACpCH,EAAO,KACPE,GAAQF,EAAO,MAGjB,GAAIA,EAAO,UAAY,KAAM,CAC3B,IAAMI,EAAIH,GAAQD,EAAO,KAErBI,GAAK,MACPD,EAAM,KACJH,EAAO,SACPI,CAAC,CAGP,CAEA,OAAIJ,EAAO,OAAS,OAASA,EAAO,MAAQ,MAC1CG,EAAM,QAAQ,UAAWH,EAAO,IAAI,EAGlCA,EAAO,MAAQ,MACjBG,EAAM,KAAK,SAAUH,EAAO,IAAI,EAG3BK,GAAU,IAAIF,EAAM,KAAK,GAAG,CAAC,EAAE,CACxC,CFvCA,IAAMG,GAAW,CAAE,EAAG,OAAQ,EAAG,MAAM,EAEvC,SAASC,GAAYC,EAAU,CAC7B,MAAO,CAAC,UAAW,IAAI,EAAE,SAASA,CAAE,CACtC,CAEA,SAASC,GAAiBC,EAAa,CACrC,IAAMC,EAAsB,CAAA,EACtBC,EAAW,GAAAC,QAAG,kBAAiB,EAErC,OAAW,CAAC,CAAEC,CAAQ,IAAK,OAAO,QAAQF,CAAQ,EAChD,GAAIE,GAAY,KACd,QAAWC,KAAWD,EAChBE,GAAcD,EAAQ,OAAO,GAI7BA,EAAQ,SAAWT,GAASI,CAAM,GACpCC,EAAU,KAAKI,EAAQ,OAAO,EAMtC,OAAOJ,CACT,CAQM,SAAUM,GAAuBC,EAAgBC,EAAsB,CAC3E,GAAID,GAAM,KACR,MAAO,CAAA,EAGT,IAAME,EAASC,GAAaH,CAAE,EAE9B,OAAKE,EAAO,OAAS,OAASA,EAAO,OAAS,QAAUb,GAAWa,EAAO,IAAI,EACrEX,GAAgBW,EAAO,OAAS,MAAQ,EAAI,CAAC,EACjD,IAAIE,GAAQC,GAAqBH,EAAQD,EAAMG,CAAI,CAAC,EAGlD,CACLC,GAAqBH,EAAQD,CAAI,EAErC,CG9CM,SAAUK,GAAmBC,EAAYC,EAAqB,CAClE,GAAI,OAAOD,GAAO,SAChB,MAAM,IAAIE,EAAuB,wBAAwBF,CAAE,EAAE,EAO/D,GAJI,OAAOC,GAAS,WAClBA,EAAO,SAASA,CAAI,GAGlB,MAAMA,CAAI,EACZ,MAAM,IAAIC,EAAuB,0BAA0BD,CAAI,EAAE,EAGnE,MAAI,WAAOD,CAAE,EACX,OAAOG,GAAU,QAAQH,CAAE,QAAQC,CAAI,EAAE,EAG3C,MAAI,WAAOD,CAAE,EACX,OAAOG,GAAU,QAAQH,CAAE,QAAQC,CAAI,EAAE,EAG3C,MAAM,IAAIC,EAAuB,6CAA6CF,CAAE,IAAIC,CAAI,EAAE,CAC5F,CCnBA,IAAMG,GAA0B,QAEnBC,GAAP,cAA8B,KAAK,CACvC,OAAO,KAAO,iBACd,KAAO,kBAMIC,GAAP,cAAyC,KAAK,CAClD,KAAO,4BACP,KAAO,0BAOIC,GAAP,cAAsC,KAAK,CAC/C,KAAO,yBACP,KAAO,yBAOIC,GAAP,cAA4C,KAAK,CACrD,KAAO,+BACP,KAAO,2BAuDT,SAASC,GAAUC,EAAS,CAC1B,OAAO,OAAOA,GAAK,WAAc,UACnC,CAEA,SAASC,GAAuBD,EAAS,CACvC,OAAO,OAAOA,GAAK,OAAU,UAC/B,CAEA,SAASE,GAAOF,EAAS,CACvB,OAAID,GAASC,CAAG,EACPA,EAAI,aAAe,WAAaA,EAAI,aAAe,SAGxDC,GAAsBD,CAAG,EACpBA,EAAI,SAAW,OAGjB,EACT,CAIA,SAASG,GAASH,EAAS,CACzB,OAAOA,GAAK,kBAAoB,MAAQA,GAAK,qBAAuB,MAAQA,GAAK,MAAQ,MAAQA,GAAK,MAAQ,MAAQA,GAAK,KAAO,IACpI,CAEM,SAAUI,GAAsCC,EAAWC,EAAqB,CACpF,IAAMC,EAAgBD,GAAM,eAAiBZ,GACvCc,EAAa,IAAIC,GAEnBC,EAAW,QAAQ,cAAa,EAChCC,EAAY,GAEhB,GAAI,CAACR,GAAQE,CAAM,EACjB,MAAM,IAAIO,EAAuB,4CAA4C,EAG/E,IAAMC,EAA+BC,GAAiC,CAOpE,GANIR,GAAM,gBAIVE,EAAW,OAAOM,EAAI,IAAI,EAEtBN,EAAW,WAAaD,EAAe,CACzC,IAAMQ,EAAiBP,EAAW,WAClCA,EAAW,QAAQA,EAAW,UAAU,EACxCE,EAAS,OAAO,IAAI,MAAM,0BAA0BK,CAAc,MAAMR,CAAa,EAAE,CAAC,CAC1F,CAEAG,EAAS,QAAO,CAClB,EACAL,EAAO,iBAAiB,UAAWQ,CAA2B,EAE9D,IAAMG,EAA6BF,GAA+B,CAC5DA,EAAI,OAAS,KACfJ,EAAS,OAAOI,EAAI,KAAK,EAEzBJ,EAAS,QAAO,CAEpB,EACAL,EAAO,iBAAiB,QAASW,CAAyB,EAE1D,IAAMC,EAA+B,IAAW,CAC9CP,EAAS,QAAO,CAClB,EACAL,EAAO,iBAAiB,mBAAoBY,CAA4B,EAExE,IAAMb,EAA4B,CAChC,WAAAI,EAGA,MAAM,KAAMU,EAA0B,CACpC,GAAIP,IAAc,GAChB,MAAM,IAAIhB,GAAe,sBAAsB,EAGjD,GAAIO,GAAMG,CAAM,EAAG,CACjB,GAAIa,GAAS,OAAS,KACpB,OAAO,KAGT,GAAIV,EAAW,WAAaU,EAAQ,MAClC,MAAM,IAAIC,GAAmB,gDAAgDX,EAAW,UAAU,IAAIU,EAAQ,KAAK,QAAQ,CAE/H,CAEA,IAAME,EAAcF,GAAS,OAAS,EAEtC,OAAa,CACX,GAAIV,EAAW,YAAcY,EAAa,CAIxCV,EAAS,QAAO,EAEhB,KACF,CAIA,GAFA,MAAMW,GAAWX,EAAS,QAASQ,GAAS,MAAM,EAE9ChB,GAAMG,CAAM,EAAG,CACjB,GAAIG,EAAW,aAAe,GAAKU,GAAS,OAAS,KACnD,OAAO,KAGT,KACF,CAEAR,EAAW,QAAQ,cAAa,CAClC,CAEA,IAAMY,EAASJ,GAAS,OAASV,EAAW,WAE5C,GAAIA,EAAW,WAAac,EAAQ,CAClC,GAAIpB,GAAMG,CAAM,EACd,MAAM,IAAIc,GAAmB,gDAAgDX,EAAW,UAAU,IAAIc,CAAM,QAAQ,EAGtH,OAAOlB,EAAW,KAAKc,CAAO,CAChC,CAEA,IAAMK,EAASf,EAAW,QAAQ,EAAGc,CAAM,EAC3C,OAAAd,EAAW,QAAQc,CAAM,EAElBC,CACT,EACA,MAAM,MAAOC,EAAmCN,EAAsB,CACpE,GAAIP,IAAc,GAChB,MAAM,IAAIhB,GAAe,sBAAsB,EAG5CU,EAAO,KAAKmB,CAAI,GACnB,MAAMC,GAAOpB,EAAQ,QAAS,CAC5B,OAAQa,GAAS,OACjB,gBAAiB,CAAC,OAAO,EAC1B,CAEL,EACA,QAAM,CAEJ,OAAIP,IAKJA,EAAY,GACZN,EAAO,oBAAoB,UAAWQ,CAA2B,EACjER,EAAO,oBAAoB,QAASW,CAAyB,EAC7DX,EAAO,oBAAoB,mBAAoBY,CAA4B,EAGvET,EAAW,WAAa,IAC1BH,EAAO,IAAI,wCAAyCG,EAAW,UAAU,EACzEH,EAAO,KAAKG,CAAU,IAGjBH,CACT,GAGF,OAAOD,CACT,CA+BM,SAAUsB,GAAoCrB,EAAWC,EAA0C,CAAA,EAAE,CACzG,IAAMqB,EAAQvB,GAAWC,EAAQC,CAAI,EAEjCA,EAAK,eAAiB,MAAQA,EAAK,iBAAmB,OAGxDA,EAAK,gBAAyBsB,GAAetB,EAAK,aAAa,GAGjE,IAAMuB,EAAevB,GAAM,eAAwBwB,GAC7CC,EAAezB,GAAM,eAAwB0B,GAiFnD,MA/E4C,CAC1C,MAAM,KAAMd,EAAsB,CAChC,IAAIe,EAAqB,GACnBC,EAAe,IAAIzB,GAEzB,OAAa,CAEX,IAAM0B,EAAM,MAAMR,EAAM,KAAK,CAC3B,GAAGT,EACH,MAAO,EACR,EAGD,GAAIiB,GAAO,KACT,MAIFD,EAAa,OAAOC,CAAG,EAEvB,GAAI,CACFF,EAAaJ,EAAaK,CAAY,CACxC,OAASE,EAAK,CACZ,GAAIA,aAAe,WACjB,SAGF,MAAMA,CACR,CAEA,GAAIH,EAAa,EACf,MAAM,IAAIrC,GAA0B,wBAAwB,EAG9D,GAAIU,GAAM,iBAAmB,MAAQ4B,EAAa,WAAa5B,EAAK,gBAClE,MAAM,IAAIR,GAA6B,oCAAoCoC,EAAa,UAAU,MAAM5B,EAAK,eAAe,EAAE,EAGhI,GAAI2B,EAAa,GACf,KAEJ,CAEA,GAAI3B,GAAM,eAAiB,MAAQ2B,EAAa3B,EAAK,cACnD,MAAM,IAAIT,GAAuB,6BAA6BoC,CAAU,MAAM3B,EAAK,aAAa,EAAE,EAGpG,IAAM6B,EAAM,MAAMR,EAAM,KAAK,CAC3B,GAAGT,EACH,MAAOe,EACR,EAED,GAAIE,GAAO,KACT,MAAM,IAAIhB,GAAmB,kCAAkCc,CAAU,8BAA8B,EAGzG,GAAIE,EAAI,aAAeF,EACrB,MAAM,IAAId,GAAmB,yBAAyBgB,EAAI,UAAU,IAAIF,CAAU,iCAAiC,EAGrH,OAAOE,CACT,EACA,MAAM,MAAOX,EAAMN,EAAsB,CAEvC,MAAMS,EAAM,MAAM,IAAIlB,GAAesB,EAAaP,EAAK,UAAU,EAAGA,CAAI,EAAGN,CAAO,CACpF,EACA,MAAM,OAAQM,EAAMN,EAAsB,CACxC,IAAMmB,EAAO,IAAI5B,GACf,GAAGe,EAAK,QAAQW,GAAQ,CAACJ,EAAaI,EAAI,UAAU,EAAGA,CAAG,CAAE,CAAC,EAI/D,MAAMR,EAAM,MAAMU,EAAMnB,CAAO,CACjC,EACA,QAAM,CACJ,OAAOS,EAAM,OAAM,CACrB,EAIJ,CA2EM,SAAUW,GAA6CjC,EAAWC,EAAkC,CACxG,IAAMiC,EAAKb,GAASrB,EAAQC,CAAI,EAE1BgC,EAA8B,CAClC,KAAM,MAAOE,EAAOtB,IAA0B,CAE5C,IAAMuB,EAAQ,MAAMF,EAAG,KAAKrB,CAAO,EAEnC,OAAOsB,EAAM,OAAOC,CAAK,CAC3B,EACA,MAAO,MAAOC,EAASF,EAAOtB,IAA0B,CAEtD,MAAMqB,EAAG,MAAMC,EAAM,OAAOE,CAAO,EAAGxB,CAAO,CAC/C,EACA,OAAQ,MAAOyB,EAAUH,EAAOtB,IAA0B,CAExD,MAAMqB,EAAG,OAAOI,EAAS,IAAID,GAAWF,EAAM,OAAOE,CAAO,CAAC,EAAGxB,CAAO,CACzE,EACA,GAAKsB,IACI,CACL,KAAM,MAAOtB,GAAYoB,EAAS,KAAKE,EAAOtB,CAAO,EACrD,MAAO,MAAO0B,EAAG1B,IAAYoB,EAAS,MAAMM,EAAGJ,EAAOtB,CAAO,EAC7D,OAAQ,MAAO0B,EAAG1B,IAAYoB,EAAS,OAAOM,EAAGJ,EAAOtB,CAAO,EAC/D,OAAQ,IAAMoB,IAGlB,OAAQ,IACCC,EAAG,OAAM,GAIpB,OAAOD,CACT,CCzdA,IAAMO,GAAN,cAA2CC,EAA2B,CAC5D,OAER,YAAaC,EAAsC,CACjD,IAAIC,EAAaD,EAAK,WAGtB,GAAIA,EAAK,WAAa,MAAQE,GAAK,QAAQF,EAAK,SAAS,EACvDC,EAAaD,EAAK,kBACTC,GAAc,KAAM,CAC7B,GAAID,EAAK,OAAO,eAAiB,MAAQA,EAAK,OAAO,YAAc,KAGjE,MAAM,IAAIG,EAAuB,4CAA4C,EAG/EF,EAAaG,GAAkBJ,EAAK,OAAO,cAAeA,EAAK,OAAO,UAAU,CAClF,CAEA,MAAM,CACJ,GAAGA,EACH,WAAAC,EACD,EAED,KAAK,OAASD,EAAK,OAGnB,KAAK,OAAO,GAAG,OAAQK,GAAM,CAC3B,KAAK,OAAOA,CAAG,CACjB,CAAC,EAGD,KAAK,OAAO,GAAG,QAASC,GAAM,CAC5B,KAAK,IAAI,YAAaL,EAAYK,CAAG,EAErC,KAAK,MAAMA,CAAG,CAChB,CAAC,EAID,KAAK,OAAO,WAAWN,EAAK,mBAAsB,IAAS,GAAM,EAEjE,KAAK,OAAO,KAAK,UAAW,IAAK,CAC/B,KAAK,IAAI,cAAeC,CAAU,EAGlC,KAAK,MAAM,IAAIM,EAAc,CAC/B,CAAC,EAED,KAAK,OAAO,KAAK,MAAO,IAAK,CAC3B,KAAK,IAAI,UAAWN,CAAU,EAQ9B,KAAK,kBAAiB,CACxB,CAAC,EAED,KAAK,OAAO,KAAK,QAASO,GAAW,CAGnC,GAFA,KAAK,IAAI,YAAaP,CAAU,EAE5BO,EAAU,CACZ,KAAK,MAAM,IAAI,MAAM,wBAAwB,CAAC,EAC9C,MACF,CAEA,KAAK,kBAAiB,CACxB,CAAC,EAGD,KAAK,OAAO,GAAG,QAAS,IAAK,CAC3B,KAAK,IAAI,WAAW,EAEpB,KAAK,kBAAkB,OAAO,CAChC,CAAC,CACH,CAEA,SAAUC,EAAoB,CAC5B,IAAIC,EAAY,EACZC,EAAc,GAElB,QAAWN,KAAOI,EAIhB,GAHAC,GAAaL,EAAI,WACjBM,EAAc,KAAK,OAAO,MAAMN,CAAG,EAE/B,CAACM,EACH,MAIJ,MAAO,CACL,UAAAD,EACA,YAAAC,EAEJ,CAEA,MAAM,UAAWC,EAAsB,CACjC,KAAK,OAAO,YAIhB,KAAK,OAAO,YAAW,EAEvB,MAAMC,GAAO,KAAK,OAAQ,QAASD,CAAO,EAC5C,CAEA,WAAS,CACP,KAAK,OAAO,gBAAe,CAC7B,CAEA,WAAS,CACP,KAAK,OAAO,MAAK,CACnB,CAEA,YAAU,CACR,KAAK,OAAO,OAAM,CACpB,GAOWE,GAAyBd,GAC7B,IAAIF,GAA6BE,CAAI,EC9I9C,IAAAe,GAAe,eACfC,GAAiB,iBAUX,SAAUC,GAAsBC,EAAiBC,EAAqB,CAAA,EAAE,CAC5E,GAAIC,GAAK,WAAWF,CAAI,EAAG,CACzB,IAAMG,EAAaH,EAAK,cAAa,EAAG,KAAKI,GAAKA,EAAE,OAAS,GAAS,GAAG,MAEzE,GAAID,GAAc,KAChB,MAAM,IAAIE,EAAuB,aAAaL,CAAI,yBAAyB,EAI7E,OAAI,GAAAM,QAAG,SAAQ,IAAO,QAEb,CAAE,KAAM,GAAAC,QAAK,KAAK,gBAAiBJ,CAAU,CAAC,EAE9C,CAAE,KAAMA,CAAU,CAE7B,CAEA,IAAMK,EAASC,GAAaT,CAAI,EAC1BU,EAAOF,EAAO,KACdG,EAAOH,EAAO,KAGpB,MAAO,CACL,KAAAE,EACA,KAAAC,EACA,SAAUH,EAAO,OAAS,MAC1B,GAAGP,EAEP,CjBVA,IAAKW,IAAL,SAAKA,EAAqB,CAMxBA,EAAAA,EAAA,SAAA,CAAA,EAAA,WACAA,EAAAA,EAAA,OAAA,CAAA,EAAA,SAEAA,EAAAA,EAAA,OAAA,CAAA,EAAA,QACF,GAVKA,KAAAA,GAAqB,CAAA,EAAA,EAkBpB,IAAOC,GAAP,cAA2BC,EAAiC,CAUlC,QATb,OAEA,QAAU,IAAI,IACvB,OAAiB,CAAE,KAAMF,GAAsB,QAAQ,EACvD,QACA,KACS,IACA,mBAEjB,YAA8BG,EAAgB,CAsB5C,GArBA,MAAK,EADuB,KAAA,QAAAA,EAG5BA,EAAQ,UAAYA,EAAQ,WAAa,GACzCA,EAAQ,QAAUA,EAAQ,SAAW,GACrCA,EAAQ,cAAgBA,EAAQ,eAAiB,GAEjD,KAAK,mBAAqB,IAAI,gBAC9BC,GAAgB,IAAU,KAAK,mBAAmB,MAAM,EAExD,KAAK,IAAMD,EAAQ,OAAO,aAAa,qBAAqB,EAC5D,KAAK,KAAO,UACZ,KAAK,OAAS,GAAAE,QAAI,aAAaF,EAAS,KAAK,SAAS,KAAK,IAAI,CAAC,EAM5DA,EAAQ,iBAAmB,SAC7B,KAAK,OAAO,eAAiBA,EAAQ,gBAGnCA,EAAQ,6BAA+B,MAErCA,EAAQ,4BAA4B,WAAaA,EAAQ,4BAA4B,YACvF,MAAM,IAAIG,EAAuB,mCAAmC,EAIxEH,EAAQ,SAAS,oBAAoB,uCAAwC,CAC3E,MAAO,UACP,KAAM,6CACN,UAAW,KACF,CACL,CAAC,KAAK,IAAI,EAAG,KAAK,QAAQ,OAG/B,EAED,KAAK,QAAU,CACb,OAAQA,EAAQ,SAAS,oBAAoB,kCAAmC,CAC9E,MAAO,UACP,KAAM,4CACP,EACD,OAAQA,EAAQ,SAAS,oBAAoB,mCAAoC,CAC/E,MAAO,UACP,KAAM,6CACP,EACD,OAAQA,EAAQ,SAAS,oBAAoB,mCAAoC,CAC/E,MAAO,UACP,KAAM,6CACP,GAGH,KAAK,OACF,GAAG,YAAa,IAAK,CAEpB,IAAMI,EAAU,KAAK,OAAO,QAAO,EAE/BA,GAAW,KACb,KAAK,KAAO,UACH,OAAOA,GAAY,SAE5B,KAAK,KAAOA,EAEZ,KAAK,KAAO,GAAGA,EAAQ,OAAO,IAAIA,EAAQ,IAAI,GAGhD,KAAK,QAAQ,QAAQ,OAAO,CAC1B,CAAC,KAAK,IAAI,EAAGP,GAAsB,OACpC,EAED,KAAK,kBAAkB,WAAW,CACpC,CAAC,EACA,GAAG,QAASQ,GAAM,CACjB,KAAK,QAAQ,QAAQ,UAAU,CAAE,CAAC,GAAG,KAAK,IAAI,eAAe,EAAG,EAAI,CAAE,EACtE,KAAK,kBAAkB,QAAS,CAAE,OAAQA,CAAG,CAAE,CACjD,CAAC,EACA,GAAG,QAAS,IAAK,CAChB,KAAK,QAAQ,QAAQ,OAAO,CAC1B,CAAC,KAAK,IAAI,EAAG,KAAK,OAAO,KAC1B,EAMG,KAAK,OAAO,OAASR,GAAsB,QAC7C,KAAK,kBAAkB,OAAO,CAElC,CAAC,EACA,GAAG,OAAQ,IAAK,CACf,KAAK,QAAQ,QAAQ,UAAU,CAAE,CAAC,GAAG,KAAK,IAAI,OAAO,EAAG,EAAI,CAAE,CAChE,CAAC,CACL,CAEQ,SAAUS,EAAkB,CAGlC,GAFA,KAAK,QAAQ,QAAQ,UAAU,CAAE,CAAC,GAAG,KAAK,IAAI,aAAa,EAAG,EAAI,CAAE,EAEhE,KAAK,OAAO,OAAST,GAAsB,OAC7C,MAAAS,EAAO,QAAO,EACR,IAAIC,GAAgB,6BAA6B,EAGzD,IAAIC,EACJ,GAAI,CACFA,EAASC,GAAsB,CAC7B,OAAAH,EACA,kBAAmB,KAAK,QAAQ,kBAChC,QAAS,KAAK,SAAS,OACvB,aAAc,GAAG,KAAK,IAAI,IAC1B,UAAW,UACX,UAAW,KAAK,OAAO,cACvB,IAAK,KAAK,QAAQ,OAAO,aAAa,uBAAuB,EAC9D,CACH,OAASD,EAAU,CACjB,KAAK,IAAI,MAAM,4BAA6BA,CAAG,EAC/C,KAAK,QAAQ,QAAQ,UAAU,CAAE,CAAC,GAAG,KAAK,IAAI,wBAAwB,EAAG,EAAI,CAAE,EAC/EC,EAAO,QAAO,EACd,MACF,CAEA,KAAK,IAAI,4BAA6BE,EAAO,UAAU,EACvD,KAAK,QAAQ,IAAIF,CAAM,EAEvB,KAAK,QAAQ,SAAS,eAAeE,EAAQ,CAC3C,OAAQ,KAAK,mBAAmB,OACjC,EACE,KAAK,IAAK,CACT,KAAK,IAAI,iCAAkCA,EAAO,UAAU,EAE5DF,EAAO,KAAK,QAAS,IAAK,CACxB,KAAK,QAAQ,OAAOA,CAAM,EAGxB,KAAK,QAAQ,6BAA+B,MAC5C,KAAK,QAAQ,KAAO,KAAK,QAAQ,4BAA4B,aAQ7D,KAAK,OAAM,EAAG,MAAMI,GAAI,CACtB,KAAK,IAAI,MAAM,sEAAuEA,CAAC,EACvF,KAAK,QAAQ,6BAA6B,gBAAgBA,CAAU,CACtE,CAAC,CAEL,CAAC,EAGC,KAAK,QAAQ,6BAA+B,MAC5C,KAAK,QAAQ,MAAQ,KAAK,QAAQ,4BAA4B,aAE9D,KAAK,IAAI,4DAA6D,KAAK,QAAQ,KAAM,KAAK,QAAQ,4BAA4B,UAAU,EAC5I,KAAK,MAAK,EAEd,CAAC,EACA,MAAM,MAAML,GAAM,CACjB,KAAK,IAAI,MAAM,oCAAqCA,CAAG,EACvD,KAAK,QAAQ,QAAQ,UAAU,CAAE,CAAC,GAAG,KAAK,IAAI,kBAAkB,EAAG,EAAI,CAAE,EACzE,KAAK,QAAQ,OAAOC,CAAM,EAC1BE,EAAO,MAAMH,CAAG,CAClB,CAAC,CACL,CAEA,UAAQ,CACN,GAAI,KAAK,OAAO,OAASR,GAAsB,SAC7C,MAAO,CAAA,EAGT,IAAMO,EAAU,KAAK,OAAO,QAAO,EAEnC,OAAIA,GAAW,KACN,CAAA,EAGL,OAAOA,GAAY,SACd,CACLO,GAAU,SAAS,mBAAmBP,CAAO,CAAC,EAAE,GAI7CQ,GAAsB,KAAK,OAAO,cAAeR,EAAQ,IAAI,CACtE,CAEA,qBAAmB,CAEnB,CAEA,MAAM,OAAQS,EAAa,CACzB,GAAI,KAAK,OAAO,OAAShB,GAAsB,QAAU,KAAK,OAAO,OAASA,GAAsB,OAClG,MAAM,IAAIiB,GAAoB,6BAA6B,EAG7D,GAAI,CACF,KAAK,OAAS,CACZ,KAAMjB,GAAsB,OAC5B,cAAegB,EACf,UAAWE,GAAqBF,EAAI,KAAK,OAAO,GAGlD,MAAM,KAAK,OAAM,CACnB,OAASR,EAAK,CACZ,WAAK,OAAS,CAAE,KAAMR,GAAsB,QAAQ,EAC9CQ,CACR,CACF,CAEA,MAAM,MAAOW,EAAsB,CACjC,IAAMC,EAA+B,CAAA,EAEjC,KAAK,OAAO,WACdA,EAAO,KAAKC,GAAO,KAAK,OAAQ,QAASF,CAAO,CAAC,EAInD,KAAK,MAAM,EAAI,EAGf,KAAK,mBAAmB,MAAK,EAI7B,KAAK,QAAQ,QAAQV,GAAS,CACxBA,EAAO,WACTW,EAAO,KAAKC,GAAOZ,EAAQ,QAASU,CAAO,CAAC,EAC5CV,EAAO,QAAO,EAElB,CAAC,EAED,MAAM,QAAQ,IAAIW,CAAM,CAC1B,CAKQ,MAAM,QAAM,CAClB,GAAI,KAAK,OAAO,WAAa,KAAK,OAAO,OAASpB,GAAsB,SACtE,OAGF,IAAMsB,EAAY,KAAK,OAAO,UAE9B,MAAM,IAAI,QAAc,CAACC,EAASC,IAAU,CAG1C,KAAK,OAAO,KAAK,QAASA,CAAM,EAChC,KAAK,OAAO,OAAOF,EAAWC,CAAO,CACvC,CAAC,EAED,KAAK,OAAS,CAAE,GAAG,KAAK,OAAQ,KAAMvB,GAAsB,MAAM,EAClE,KAAK,IAAI,kBAAmB,KAAK,OAAO,QAAO,CAAE,CACnD,CAEQ,MAAOyB,EAAqB,GAAK,CACvC,GAAI,CAAC,KAAK,OAAO,WAAa,KAAK,OAAO,OAASzB,GAAsB,QAAUyB,EAAW,CAC5F,KAAK,OAAS,CAAE,KAAMzB,GAAsB,QAAQ,EACpD,MACF,CAEI,CAAC,KAAK,OAAO,WAAa,KAAK,OAAO,OAASA,GAAsB,SAIzE,KAAK,IAAI,kBAAmByB,EAAY,UAAY,UAAW,KAAK,OAAO,QAAO,CAAE,EAiBpF,KAAK,OAASA,EAAY,CAAE,KAAMzB,GAAsB,QAAQ,EAAK,CAAE,GAAG,KAAK,OAAQ,KAAMA,GAAsB,MAAM,EAMzH,KAAK,OAAO,MAAK,EACnB,GZlTI,IAAO0B,GAAP,KAAU,CACG,KACA,QACA,WACA,IAEjB,YAAaC,EAA2BC,EAAsB,CAAA,EAAE,CAC9D,KAAK,IAAMD,EAAW,OAAO,aAAa,YAAY,EACtD,KAAK,KAAOC,EACZ,KAAK,WAAaD,EAEdA,EAAW,SAAW,OACxB,KAAK,QAAU,CACb,OAAQA,EAAW,QAAQ,qBAAqB,iCAAkC,CAChF,MAAO,QACP,KAAM,2CACP,EACD,OAAQA,EAAW,QAAQ,qBAAqB,iCAAkC,CAChF,MAAO,QACP,KAAM,2CACP,GAGP,CAES,CAACE,EAAe,EAAI,GAEpB,CAAC,OAAO,WAAW,EAAI,cAEvB,CAACC,EAAmB,EAAc,CACzC,qBAGF,MAAM,KAAMC,EAAeH,EAAuB,CAChDA,EAAQ,UAAYA,EAAQ,WAAa,GACzCA,EAAQ,QAAUA,EAAQ,SAAW,GACrCA,EAAQ,cAAgBA,EAAQ,eAAiB,GAGjD,IAAMI,EAAS,MAAM,KAAK,SAASD,EAAIH,CAAO,EAE1CK,EAEJ,GAAI,CACFA,EAASC,GAAsB,CAC7B,OAAAF,EACA,kBAAmB,KAAK,KAAK,gCAC7B,QAAS,KAAK,SAAS,OACvB,UAAW,WACX,WAAYD,EACZ,IAAK,KAAK,IAAI,SAAS,YAAY,EACpC,CACH,OAASI,EAAU,CACjB,WAAK,SAAS,OAAO,UAAU,CAAE,uBAAwB,EAAI,CAAE,EAC/DH,EAAO,QAAQG,CAAG,EACZA,CACR,CAEA,GAAI,CACF,YAAK,IAAI,6BAA8BF,EAAO,UAAU,EACjD,MAAML,EAAQ,SAAS,gBAAgBK,EAAQL,CAAO,CAC/D,OAASO,EAAU,CACjB,WAAK,SAAS,OAAO,UAAU,CAAE,iBAAkB,EAAI,CAAE,EACzD,KAAK,IAAI,MAAM,sCAAuCA,CAAG,EACzDF,EAAO,MAAME,CAAG,EACVA,CACR,CACF,CAEA,MAAM,SAAUJ,EAAeH,EAAuB,CACpDA,EAAQ,OAAO,eAAc,EAC7BA,EAAQ,aAAa,IAAIQ,GAAoB,qBAAqB,CAAC,EAEnE,IAAIC,EAEJ,OAAO,IAAI,QAAgB,CAACC,EAASC,IAAU,CAC7C,IAAMC,EAAQ,KAAK,IAAG,EAChBC,EAAQC,GAAqBX,EAAI,CACrC,GAAI,KAAK,KAAK,UAAY,CAAA,EAC1B,GAAGH,EACJ,EAED,KAAK,IAAI,0BAA2BG,EAAIU,CAAK,EAC7CJ,EAAY,GAAAM,QAAI,QAAQF,CAAK,EAE7B,IAAMG,EAAWT,GAAoB,CACnC,KAAK,IAAI,MAAM,0BAA2BJ,EAAII,CAAG,EACjD,IAAMU,EAAWJ,EAAM,MAAQ,GAAGA,EAAM,MAAQ,EAAE,IAAIA,EAAM,IAAI,GAChEN,EAAI,QAAU,oBAAoBU,CAAQ,KAAKV,EAAI,OAAO,GAC1D,KAAK,SAAS,OAAO,UAAU,CAAE,MAAO,EAAI,CAAE,EAC9CW,EAAKX,CAAG,CACV,EAEMY,EAAY,IAAW,CAC3B,KAAK,IAAI,wBAAyBhB,CAAE,EACpC,KAAK,SAAS,OAAO,UAAU,CAAE,QAAS,EAAI,CAAE,EAEhD,IAAMI,EAAM,IAAIa,GAAa,4BAA4B,KAAK,IAAG,EAAKR,CAAK,IAAI,EAE/EH,EAAU,KAAK,QAASF,CAAG,CAC7B,EAEMc,EAAY,IAAW,CAC3B,KAAK,IAAI,uBAAwBlB,CAAE,EACnC,KAAK,SAAS,OAAO,UAAU,CAAE,QAAS,EAAI,CAAE,EAChDe,EAAI,CACN,EAEMI,EAAU,IAAW,CACzB,KAAK,IAAI,wBAAyBnB,CAAE,EACpC,KAAK,SAAS,OAAO,UAAU,CAAE,MAAO,EAAI,CAAE,EAC9Ce,EAAK,IAAIK,EAAY,CACvB,EAEML,EAAQX,GAAqB,CASjC,GARAE,EAAU,eAAe,QAASO,CAAO,EACzCP,EAAU,eAAe,UAAWU,CAAS,EAC7CV,EAAU,eAAe,UAAWY,CAAS,EAEzCrB,EAAQ,QAAU,MACpBA,EAAQ,OAAO,oBAAoB,QAASsB,CAAO,EAGjDf,GAAO,KAAM,CACfI,EAAOJ,CAAG,EAAG,MACf,CAEAG,EAAQD,CAAS,CACnB,EAEAA,EAAU,GAAG,QAASO,CAAO,EAC7BP,EAAU,GAAG,UAAWU,CAAS,EACjCV,EAAU,GAAG,UAAWY,CAAS,EAEjCrB,EAAQ,OAAO,iBAAiB,QAASsB,CAAO,CAClD,CAAC,EACE,MAAMf,GAAM,CACX,MAAAE,GAAW,QAAO,EACZF,CACR,CAAC,CACL,CAOA,eAAgBP,EAAiC,CAC/C,OAAO,IAAIwB,GAAY,CACrB,GAAI,KAAK,KAAK,YAAc,CAAA,EAC5B,GAAGxB,EACH,eAAgB,KAAK,KAAK,eAC1B,QAAS,KAAK,KAAK,QACnB,4BAA6B,KAAK,KAAK,4BACvC,kBAAmB,KAAK,KAAK,+BAC7B,QAAS,KAAK,WAAW,QACzB,OAAQ,KAAK,WAAW,OACzB,CACH,CAKA,aAAcyB,EAAuB,CACnC,OAAOA,EAAW,OAAOtB,GAAML,GAAW,WAAWK,CAAE,GAAKA,EAAG,SAAQ,EAAG,WAAW,QAAQ,CAAC,CAChG,CAKA,WAAYsB,EAAuB,CACjC,OAAO,KAAK,aAAaA,CAAU,CACrC,G8B5EI,SAAUC,GAAKC,EAAmB,CAAA,EAAE,CACxC,OAAQC,GACC,IAAIC,GAAID,EAAYD,CAAI,CAEnC,CC7HA,IAAMG,GAAMC,GAAO,0BAA0B,EAEhCC,GAAP,KAAU,CACG,OAEjB,YAAaC,EAAoB,CAC/B,KAAK,OAASA,CAChB,CAKA,MAAM,IAAKC,EAAiBC,EAAiB,CAC3C,GAAI,EAAED,aAAe,YACnB,MAAM,IAAIE,EAAuB,sBAAsB,EAGzD,GAAI,EAAED,aAAiB,YACrB,MAAM,IAAIC,EAAuB,oCAAoC,EAGvE,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,EAAQ,KAAK,IACnB,IAAK,CACH,KAAMC,GAAW,KAAK,UACtB,IAAAL,EACA,MAAAC,GAEH,EAEKK,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAMvC,GAJAX,GAAI,OAAQU,CAAQ,EAEpB,MAAMH,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIC,GAAcF,EAAS,OAAO,KAAO,gBAAgB,CAEnE,CAKA,MAAM,IAAKN,EAAe,CACxB,GAAI,EAAEA,aAAe,YACnB,MAAM,IAAIE,EAAuB,sBAAsB,EAGzD,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,EAAQ,KAAK,IACnB,IAAK,CACH,KAAMC,GAAW,KAAK,UACtB,IAAAL,GAEH,EAEKM,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAIvC,GAFA,MAAMJ,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIE,EAAqBH,EAAS,OAAO,KAAO,gBAAgB,EAGxE,GAAIA,EAAS,KAAK,OAAS,KACzB,MAAM,IAAIG,EAAqB,0BAA0B,EAG3D,OAAOH,EAAS,IAAI,KACtB,CAKA,MAAM,SAAUI,EAAc,CAC5B,GAAI,CAACC,GAASD,CAAM,EAClB,MAAM,IAAIR,EAAuB,0BAA0B,EAG7D,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,EAAQ,KAAK,IACnB,IAAK,CACH,KAAMC,GAAW,KAAK,UACtB,KAAMK,EAAO,YAAW,EAAG,OAE9B,EAEKJ,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAIvC,GAFA,MAAMJ,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIE,EAAqBH,EAAS,OAAO,KAAO,sBAAsB,EAG9E,GAAIA,EAAS,KAAK,MAAM,OAAS,KAC/B,MAAM,IAAIG,EAAqB,kBAAkB,EAGnD,MAAO,CACL,GAAIG,GAA2BC,GAAOP,EAAS,IAAI,KAAK,EAAE,CAAC,EAC3D,WAAYA,EAAS,IAAI,KAAK,MAAM,IAAKQ,GAAMC,GAAUD,CAAC,CAAC,EAE/D,CAKA,MAAM,QAASE,EAAQ,CACrB,GAAIA,GAAO,MAAQC,GAAI,MAAMD,CAAG,GAAK,KACnC,MAAM,IAAId,EAAuB,sBAAsB,EAGzD,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,EAAQ,KAAK,IACnB,IAAK,CACH,KAAMC,GAAW,KAAK,QACtB,IAAKW,EAAI,OAEZ,EAEKV,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAIvC,GAFA,MAAMJ,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIE,EAAqBH,EAAS,OAAO,KAAO,oBAAoB,CAE9E,CAKA,MAAQ,cAAeU,EAAUE,EAAgB,EAAC,CAChD,GAAIF,GAAO,MAAQC,GAAI,MAAMD,CAAG,GAAK,KACnC,MAAM,IAAId,EAAuB,sBAAsB,EAGzD,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,EAAQ,KAAK,IACnB,IAAK,CACH,KAAMC,GAAW,KAAK,eACtB,IAAKW,EAAI,MACT,MAAAE,GAEH,EAGKZ,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAEvC,GAAID,EAAS,OAASC,EAAS,KAAK,GAClC,YAAMJ,EAAG,OAAM,EAAG,MAAK,EACjB,IAAIM,EAAqBH,EAAS,OAAO,KAAO,2BAA2B,EAGnF,OAAa,CACX,IAAMa,EAAc,MAAMhB,EAAG,KAAKiB,EAAW,EAG7C,GAAID,EAAY,OAASC,GAAY,KAAK,IAAK,CAC7C,MAAMjB,EAAG,OAAM,EAAG,MAAK,EACvB,MACF,CAGA,GAAIgB,EAAY,OAASC,GAAY,KAAK,OAASD,EAAY,MAAM,OAAS,KAC5E,KAAM,CACJ,GAAIP,GAA2BC,GAAOM,EAAY,KAAK,EAAE,CAAC,EAC1D,WAAYA,EAAY,KAAK,MAAM,IAAKL,GAAMC,GAAUD,CAAC,CAAC,OAI5D,aAAMX,EAAG,OAAM,EAAG,MAAK,EACjB,IAAIK,GAAc,6BAA6B,CAEzD,CACF,CAKA,MAAQ,gBAAiBR,EAAe,CACtC,GAAI,EAAEA,aAAe,YACnB,MAAM,IAAIE,EAAuB,sBAAsB,EAGzD,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,EAAQ,KAAK,IACnB,IAAK,CACH,KAAMC,GAAW,KAAK,kBACtB,IAAAL,GAEH,EAGKM,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAEvC,GAAID,EAAS,OAASC,EAAS,KAAK,GAClC,YAAMJ,EAAG,OAAM,EAAG,MAAK,EACjB,IAAIM,EAAqBH,EAAS,OAAO,KAAO,2BAA2B,EAGnF,OAAa,CACX,IAAMa,EAAc,MAAMhB,EAAG,KAAKiB,EAAW,EAG7C,GAAID,EAAY,OAASC,GAAY,KAAK,IAAK,CAC7C,MAAMjB,EAAG,OAAM,EAAG,MAAK,EACvB,MACF,CAGA,GAAIgB,EAAY,OAASC,GAAY,KAAK,OAASD,EAAY,OAAS,KAGtE,KAAM,CACJ,GAHaP,GAA2BC,GAAOM,EAAY,KAAK,CAAC,EAIjE,WAAY,CAAA,OAId,aAAMhB,EAAG,OAAM,EAAG,MAAK,EACjB,IAAIkB,GAAoB,6BAA6B,CAE/D,CACF,CAKA,MAAM,aAAcX,EAAc,CAChC,GAAI,CAACC,GAASD,CAAM,EAClB,MAAM,IAAIR,EAAuB,0BAA0B,EAG7D,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,EAAQ,KAAK,IACnB,IAAK,CACH,KAAMC,GAAW,KAAK,eACtB,KAAMK,EAAO,YAAW,EAAG,OAE9B,EAEKJ,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAIvC,GAFA,MAAMJ,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIE,EAAqBH,EAAS,OAAO,KAAO,2BAA2B,EAGnF,GAAIA,EAAS,KAAO,KAClB,MAAM,IAAIe,GAAoB,kBAAkB,EAGlD,OAAOf,EAAS,IAAI,KACtB,GCpQI,IAAOgB,GAAP,KAAa,CACA,OAEjB,YAAaC,EAAoB,CAC/B,KAAK,OAASA,CAChB,CAOA,MAAM,WAAS,CACb,IAAMC,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,EAAQ,KAAK,OACnB,OAAQ,CACN,KAAMC,GAAU,KAAK,YAExB,EAEKC,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAIvC,GAFA,MAAMJ,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIC,EAAqBF,EAAS,OAAO,KAAO,0BAA0B,EAGlF,GAAIA,EAAS,QAAQ,QAAU,KAC7B,MAAM,IAAIE,EAAqB,kBAAkB,EAGnD,OAAOF,EAAS,OAAO,MACzB,CAKA,MAAM,QAASG,EAAeC,EAAgB,CAC5C,GAAI,OAAOD,GAAU,SACnB,MAAM,IAAIE,EAAuB,wBAAwB,EAG3D,GAAI,EAAED,aAAgB,YACpB,MAAM,IAAIC,EAAuB,mCAAmC,EAGtE,IAAMR,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,EAAQ,KAAK,OACnB,OAAQ,CACN,KAAMC,GAAU,KAAK,QACrB,MAAAI,EACA,KAAAC,GAEH,EAEKJ,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAIvC,GAFA,MAAMJ,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIC,EAAqBF,EAAS,OAAO,KAAO,uBAAuB,CAEjF,CAKA,MAAM,UAAWG,EAAa,CAC5B,GAAI,OAAOA,GAAU,SACnB,MAAM,IAAIE,EAAuB,wBAAwB,EAG3D,IAAMR,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,EAAQ,KAAK,OACnB,OAAQ,CACN,KAAMC,GAAU,KAAK,UACrB,MAAAI,GAEH,EAEKH,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAEvC,GAAID,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIC,EAAqBF,EAAS,OAAO,KAAO,uBAAuB,EAG/E,IAAIM,EAAa,GAcjB,MAZmC,CACjC,MAAQ,UAAQ,CACd,KAAOA,GACL,MAAM,MAAMT,EAAG,KAAKU,EAAS,CAEjC,EACA,MAAM,QAAM,CACVD,EAAa,GACb,MAAMT,EAAG,OAAM,EAAG,MAAK,CACzB,EAIJ,CAEA,MAAM,eAAgBM,EAAa,CACjC,GAAI,OAAOA,GAAU,SACnB,MAAM,IAAIE,EAAuB,wBAAwB,EAG3D,IAAMR,EAAK,MAAM,KAAK,OAAO,KAAK,CAChC,KAAMC,EAAQ,KAAK,OACnB,OAAQ,CACN,KAAMC,GAAU,KAAK,WACrB,MAAAI,GAEH,EAEKH,EAAW,MAAMH,EAAG,KAAKI,CAAQ,EAIvC,GAFA,MAAMJ,EAAG,OAAM,EAAG,MAAK,EAEnBG,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIC,EAAqBF,EAAS,OAAO,KAAO,+BAA+B,EAGvF,GAAIA,EAAS,QAAQ,QAAU,KAC7B,MAAM,IAAIE,EAAqB,kBAAkB,EAGnD,OAAOF,EAAS,OAAO,QAAQ,IAAIQ,GAAOC,GAA2BC,GAAOF,CAAG,CAAC,CAAC,CACnF,GtH9HF,IAAMG,GAAMC,GAAO,sBAAsB,EAE5BC,EAAP,cAAoC,KAAK,CAC7C,YAAaC,EAAU,mBAAkB,CACvC,MAAMA,CAAO,EACb,KAAK,KAAO,sBACd,GAGIC,GAAN,KAAY,CACO,UACV,IACA,OACU,IAEjB,YAAaC,EAAe,CAC1B,KAAK,UAAYA,EACjB,KAAK,IAAMC,GAAG,EAAG,CACf,OAAQC,GAAa,EACtB,EACD,KAAK,IAAM,IAAIC,GAAI,IAAI,EACvB,KAAK,OAAS,IAAIC,GAAO,IAAI,CAC/B,CASA,MAAM,cAAeC,EAAoB,CAGvC,OAAO,KAAK,IAAI,KAAK,KAAK,UAAW,CACnC,SAAU,IAAIC,GACd,OAAQD,GAAU,YAAY,QAAQ,GAAM,EAC7C,CACH,CAMA,MAAM,KAAME,EAAgB,CAC1B,IAAMC,EAAS,MAAM,KAAK,cAAa,EAEjCC,EAAUF,EAAQ,QAAQ,MAAQA,EAAQ,KAAK,MAAQA,EAAQ,WAAW,MAAQ,GACxFZ,GAAI,OAAQY,EAAQ,KAAME,CAAO,EAEjC,IAAMC,EAAKC,GAASH,CAAM,EAC1B,aAAME,EAAG,MAAMH,EAASK,CAAO,EAExBF,CACT,CAKA,MAAM,QAASG,EAAgBC,EAAkB,CAC/C,GAAI,CAACC,GAASF,CAAM,EAClB,MAAM,IAAIG,EAAuB,0BAA0B,EAG7D,GAAI,CAAC,MAAM,QAAQF,CAAK,EACtB,MAAM,IAAIE,EAAuB,oCAAoC,EAGvEF,EAAM,QAASd,GAAQ,CACrB,GAAI,CAACiB,GAAYjB,CAAI,EACnB,MAAM,IAAIgB,EAAuB,6CAA6C,CAElF,CAAC,EAED,IAAME,EAAK,MAAM,KAAK,KAAK,CACzB,KAAMN,EAAQ,KAAK,QACnB,QAAS,CACP,KAAMC,EAAO,YAAW,EAAG,MAC3B,MAAOC,EAAM,IAAKK,GAAMA,EAAE,KAAK,GAElC,EAEKC,EAAW,MAAMF,EAAG,KAAKG,CAAQ,EAIvC,GAFA1B,GAAI,iBAAkBiB,EAAQ,KAAK,QAASQ,EAAS,IAAI,EAErDA,EAAS,OAASC,EAAS,KAAK,GAAI,CACtC,IAAMC,EAAcF,EAAS,OAAS,CAAE,IAAK,aAAa,EAC1D,MAAM,IAAIvB,EAAqByB,EAAY,KAAO,aAAa,CACjE,CAEA,MAAMJ,EAAG,OAAM,EAAG,MAAK,CACzB,CAWA,MAAM,UAAQ,CACZ,IAAMA,EAAK,MAAM,KAAK,KAAK,CACzB,KAAMN,EAAQ,KAAK,SACpB,EAEKQ,EAAW,MAAMF,EAAG,KAAKG,CAAQ,EAIvC,GAFA1B,GAAI,iBAAkBiB,EAAQ,KAAK,SAAUQ,EAAS,IAAI,EAEtDA,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIxB,EAAqBuB,EAAS,OAAO,KAAO,iBAAiB,EAGzE,GAAIA,EAAS,UAAU,OAAS,KAC9B,MAAM,IAAIvB,EAAqB,kBAAkB,EAGnD,IAAMgB,EAASU,GAA2BC,GAAOJ,EAAS,UAAU,EAAE,CAAC,EACjEN,EAAQM,EAAS,SAAS,MAAM,IAAKD,GAAMM,GAAUN,CAAC,CAAC,EAE7D,aAAMD,EAAG,OAAM,EAAG,MAAK,EAEf,CAAE,OAAAL,EAAQ,MAAAC,CAAK,CACzB,CAKA,MAAM,WAAS,CACb,IAAMI,EAAK,MAAM,KAAK,KAAK,CACzB,KAAMN,EAAQ,KAAK,WACpB,EAEKQ,EAAW,MAAMF,EAAG,KAAKG,CAAQ,EAIvC,GAFA1B,GAAI,iBAAkBiB,EAAQ,KAAK,WAAYQ,EAAS,IAAI,EAExDA,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIxB,EAAqBuB,EAAS,OAAO,KAAO,mBAAmB,EAG3E,aAAMF,EAAG,OAAM,EAAG,MAAK,EAEhBE,EAAS,MAAM,IAAKM,GAASH,GAA2BC,GAAOE,EAAK,EAAE,CAAC,CAAC,CACjF,CAKA,MAAM,WAAYb,EAAgBc,EAAgB,CAChD,GAAI,CAACZ,GAASF,CAAM,EAClB,MAAM,IAAIG,EAAuB,0BAA0B,EAG7D,GAAI,OAAOW,GAAa,SACtB,MAAM,IAAIX,EAAuB,2BAA2B,EAG9D,IAAME,EAAK,MAAM,KAAK,KAAK,CACzB,KAAMN,EAAQ,KAAK,YACnB,WAAY,CACV,KAAMC,EAAO,YAAW,EAAG,MAC3B,MAAO,CAACc,CAAQ,GAEnB,EAEKP,EAAW,MAAMF,EAAG,KAAKG,CAAQ,EAIvC,GAFA1B,GAAI,iBAAkBiB,EAAQ,KAAK,YAAaQ,EAAS,IAAI,EAEzDA,EAAS,OAASC,EAAS,KAAK,GAAI,CACtC,IAAMO,EAAM,IAAI/B,EAAqBuB,EAAS,OAAO,KAAO,oBAAoB,EAChF,MAAAF,EAAG,OAAM,EAAG,MAAMU,CAAG,EACfA,CACR,CAEA,OAAOV,EAAG,OAAM,CAClB,CAKA,MAAM,sBAAuBS,EAAkBE,EAA8B,CAC3E,GAAI,OAAOF,GAAa,SACtB,MAAM,IAAIX,EAAuB,2BAA2B,EAI9D,IAAMc,EAAW,KAAK,IAAI,eAAe,CACvC,SAAU,IAAIxB,GAAqBE,GAAU,CAC3C,KAAK,aAAamB,EAAUG,EAAUD,EAASrB,CAAM,CACvD,CAAC,EACF,EACD,MAAMsB,EAAS,OAAOL,GAAU,sBAAsB,CAAC,EACvD,IAAMM,EAAUD,EAAS,SAAQ,EAAG,CAAC,EAErC,GAAIC,GAAW,KACb,MAAM,IAAIlC,EAAqB,0BAA0B,EAG3D,IAAMqB,EAAK,MAAM,KAAK,KAAK,CACzB,KAAMN,EAAQ,KAAK,eACnB,cAAe,CACb,KAAMmB,EAAQ,MACd,MAAO,CAACJ,CAAQ,GAEnB,EAEKP,EAAW,MAAMF,EAAG,KAAKG,CAAQ,EAMvC,GAJA1B,GAAI,iBAAkBiB,EAAQ,KAAK,eAAgBQ,EAAS,IAAI,EAEhE,MAAMF,EAAG,OAAM,EAAG,MAAK,EAEnBE,EAAS,OAASC,EAAS,KAAK,GAClC,MAAM,IAAIxB,EAAqBuB,EAAS,OAAO,KAAO,gCAAgC,CAE1F,CAEQ,aAAcO,EAAkBG,EAAoBD,EAAgCG,EAA+B,CACzH,QAAQ,QAAO,EACZ,KAAK,SAAW,CACf,IAAMtB,EAAKC,GAASqB,CAAU,EAAE,GAAGC,EAAU,EAG7C,IAFgB,MAAMvB,EAAG,KAAI,GAEjB,QAAUiB,EACpB,MAAM,IAAI9B,EAAqB,oBAAoB,EAIrD,MAAMgC,EAAQnB,EAAG,OAAM,EAAG,OAAM,CAAE,CACpC,CAAC,EACA,MAAMkB,GAAM,CACXI,EAAW,MAAMJ,CAAG,CACtB,CAAC,EACA,QAAQ,IAAK,CACZI,EAAW,MAAK,EACb,MAAMJ,GAAM,CACXjC,GAAI,MAAMiC,CAAG,CACf,CAAC,EACHE,EAAS,MAAK,EACX,MAAMF,GAAM,CACXjC,GAAI,MAAMiC,CAAG,CACf,CAAC,CACL,CAAC,CACL,GA6CI,SAAUM,GAAcT,EAAoB,CAChD,OAAO,IAAI1B,GAAO0B,CAAS,CAC7B",
6
+ "names": ["index_exports", "__export", "OperationFailedError", "createClient", "import_node_buffer", "asUint8Array", "buf", "alloc", "size", "asUint8Array", "allocUnsafe", "N1", "N2", "N3", "N4", "N5", "N6", "N7", "MSB", "REST", "encodingLength", "value", "encodeUint8Array", "buf", "offset", "encodeUint8ArrayList", "decodeUint8Array", "b", "res", "decodeUint8ArrayList", "encode", "allocUnsafe", "decode", "f32", "f8b", "writeFloatLE", "val", "buf", "pos", "readFloatLE", "buf", "pos", "f8b", "f32", "f64", "d8b", "writeDoubleLE", "val", "buf", "pos", "readDoubleLE", "buf", "pos", "d8b", "f64", "MAX_SAFE_NUMBER_INTEGER", "MIN_SAFE_NUMBER_INTEGER", "LongBits", "_LongBits", "lo", "hi", "unsigned", "mask", "part0", "part1", "part2", "value", "zero", "negative", "TWO_32", "sign", "length", "string", "len", "c", "i", "read", "buffer", "start", "end", "parts", "chunk", "t", "write", "offset", "c1", "c2", "indexOutOfRange", "reader", "writeLength", "readFixed32End", "buf", "end", "Uint8ArrayReader", "buffer", "value", "readFloatLE", "readDoubleLE", "length", "start", "bytes", "read", "wireType", "bits", "LongBits", "i", "lo", "hi", "decodeUint8Array", "encodingLength", "createReader", "decodeMessage", "buf", "codec", "opts", "reader", "createReader", "import_node_buffer", "base10_exports", "__export", "base10", "empty", "equals", "aa", "bb", "ii", "coerce", "o", "fromString", "str", "toString", "b", "base", "ALPHABET", "name", "BASE_MAP", "j", "i", "x", "xc", "BASE", "LEADER", "FACTOR", "iFACTOR", "encode", "source", "zeroes", "length", "pbegin", "pend", "size", "b58", "carry", "it1", "it2", "str", "decodeUnsafe", "psz", "b256", "it3", "it4", "vch", "decode", "string", "buffer", "src", "_brrp__multiformats_scope_baseX", "base_x_default", "Encoder", "name", "prefix", "baseEncode", "bytes", "Decoder", "baseDecode", "prefixCodePoint", "text", "decoder", "or", "ComposedDecoder", "decoders", "input", "left", "right", "Codec", "from", "encode", "decode", "baseX", "alphabet", "base_x_default", "coerce", "string", "alphabetIdx", "bitsPerChar", "end", "out", "bits", "buffer", "written", "i", "value", "data", "pad", "mask", "createAlphabetIdx", "rfc4648", "base10", "baseX", "base16_exports", "__export", "base16", "base16upper", "base16", "rfc4648", "base16upper", "base2_exports", "__export", "base2", "base2", "rfc4648", "base256emoji_exports", "__export", "base256emoji", "alphabet", "alphabetBytesToChars", "p", "c", "i", "alphabetCharsToBytes", "codePoint", "encode", "data", "decode", "str", "byts", "char", "byt", "base256emoji", "from", "base32_exports", "__export", "base32", "base32hex", "base32hexpad", "base32hexpadupper", "base32hexupper", "base32pad", "base32padupper", "base32upper", "base32z", "base32", "rfc4648", "base32upper", "base32pad", "base32padupper", "base32hex", "base32hexupper", "base32hexpad", "base32hexpadupper", "base32z", "base36_exports", "__export", "base36", "base36upper", "base36", "baseX", "base36upper", "base58_exports", "__export", "base58btc", "base58flickr", "base58btc", "baseX", "base58flickr", "base64_exports", "__export", "base64", "base64pad", "base64url", "base64urlpad", "base64", "rfc4648", "base64pad", "base64url", "base64urlpad", "base8_exports", "__export", "base8", "base8", "rfc4648", "identity_exports", "__export", "identity", "identity", "from", "buf", "toString", "str", "fromString", "textEncoder", "textDecoder", "identity_exports", "__export", "identity", "encode_1", "encode", "MSB", "REST", "MSBALL", "INT", "num", "out", "offset", "oldOffset", "decode", "read", "MSB$1", "REST$1", "buf", "res", "shift", "counter", "b", "l", "N1", "N2", "N3", "N4", "N5", "N6", "N7", "N8", "N9", "length", "value", "varint", "_brrp_varint", "varint_default", "decode", "data", "offset", "varint_default", "encodeTo", "int", "target", "encodingLength", "create", "code", "digest", "size", "sizeOffset", "encodingLength", "digestOffset", "bytes", "encodeTo", "Digest", "decode", "multihash", "coerce", "equals", "a", "b", "data", "code", "name", "encode", "coerce", "digest", "input", "options", "create", "identity", "sha2_exports", "__export", "sha256", "sha512", "import_crypto", "DEFAULT_MIN_DIGEST_LENGTH", "from", "name", "code", "encode", "minDigestLength", "maxDigestLength", "Hasher", "input", "options", "result", "createDigest", "digest", "truncate", "create", "sha256", "from", "input", "coerce", "crypto", "sha512", "format", "link", "base", "bytes", "version", "toStringV0", "baseCache", "base58btc", "toStringV1", "base32", "cache", "baseCache", "cid", "CID", "_CID", "version", "code", "multihash", "bytes", "DAG_PB_CODE", "SHA_256_CODE", "digest", "create", "other", "self", "unknown", "equals", "base", "format", "input", "value", "encodeCID", "cidSymbol", "decode", "remainder", "specs", "prefixSize", "multihashBytes", "coerce", "digestBytes", "Digest", "initialBytes", "offset", "next", "i", "length", "codec", "multihashCode", "digestSize", "size", "multihashSize", "source", "prefix", "parseCIDtoBytes", "decoder", "base58btc", "base32", "base36", "toStringV0", "toStringV1", "codeOffset", "encodingLength", "hashOffset", "encodeTo", "bases", "identity_exports", "base2_exports", "base8_exports", "base10_exports", "base16_exports", "base32_exports", "base36_exports", "base58_exports", "base64_exports", "base256emoji_exports", "hashes", "sha2_exports", "createCodec", "name", "prefix", "encode", "decode", "string", "buf", "str", "ascii", "i", "allocUnsafe", "BASES", "bases", "bases_default", "fromString", "string", "encoding", "base", "bases_default", "asUint8Array", "pool", "size", "SIZE", "MAX", "slab", "offset", "allocUnsafe", "buf", "Op", "fn", "len", "val", "noop", "State", "writer", "bufferPool", "pool", "alloc", "size", "allocUnsafe", "Uint8ArrayWriter", "value", "VarintOp", "writeVarint64", "LongBits", "bits", "encodeUint8Array", "encodingLength", "writeByte", "writeFixed32", "writeFloatLE", "writeDoubleLE", "writeBytes", "length", "write", "head", "tail", "buf", "pos", "writeVarint32", "writeBytesBuffer", "writeStringBuffer", "fromString", "createWriter", "encodeMessage", "message", "codec", "w", "createWriter", "CODEC_TYPES", "createCodec", "name", "type", "encode", "decode", "enumeration", "v", "findValue", "val", "encode", "writer", "enumValue", "decode", "reader", "createCodec", "CODEC_TYPES", "message", "encode", "decode", "createCodec", "CODEC_TYPES", "Request", "Type", "__TypeValues", "enumeration", "_codec", "message", "obj", "w", "opts", "ConnectRequest", "StreamOpenRequest", "StreamHandlerRequest", "DHTRequest", "ConnManagerRequest", "DisconnectRequest", "PSRequest", "PeerstoreRequest", "reader", "length", "end", "tag", "encodeMessage", "buf", "decodeMessage", "Response", "ErrorResponse", "StreamInfo", "IdentifyResponse", "DHTResponse", "value", "PeerInfo", "PSResponse", "PeerstoreResponse", "PSMessage", "anySignal", "signals", "controller", "onAbort", "signal", "clear", "PassThroughUpgrader", "handler", "maConn", "signal", "anySignal", "AbortError", "message", "InvalidParametersError", "message", "InvalidPublicKeyError", "StreamResetError", "message", "StreamStateError", "message", "StreamBufferError", "InvalidMultihashError", "message", "InvalidMessageError", "message", "ProtocolError", "TimeoutError", "NotStartedError", "AlreadyStartedError", "UnsupportedKeyTypeError", "message", "StreamMessageEvent", "data", "eventInitDict", "StreamCloseEvent", "local", "error", "StreamAbortEvent", "StreamResetEvent", "peerIdSymbol", "isPeerId", "other", "transportSymbol", "FaultTolerance", "import_node_events", "setMaxListeners", "n", "eventTargets", "nodeSetMaxListeners", "TypedEventEmitter", "#listeners", "setMaxListeners", "type", "listeners", "listener", "options", "list", "callback", "event", "result", "once", "detail", "serviceCapabilities", "serviceDependencies", "import_node_tty", "import_node_util", "s", "value: StringValue | number", "options?: Options", "e", "l", "p", "t", "c", "str: string", "u", "d", "f", "d", "ms: number", "c", "ms", "f", "m", "p", "options?: Options", "t", "msAbs: number", "n: number", "name: string", "i", "n", "r", "import_node_process", "import_node_os", "import_node_tty", "hasFlag", "flag", "argv", "process", "prefix", "position", "terminatorPosition", "env", "flagForceColor", "envForceColor", "level", "translateLevel", "_supportsColor", "haveStream", "streamIsTTY", "sniffFlags", "noFlagForceColor", "forceColor", "min", "osRelease", "os", "key", "sign", "version", "createSupportsColor", "stream", "options", "supportsColor", "tty", "supports_color_default", "setup", "env", "createDebug", "coerce", "disable", "enable", "enabled", "c", "destroy", "key", "selectColor", "namespace", "hash", "i", "prevTime", "enableOverride", "namespacesCache", "enabledCache", "debug", "args", "self", "curr", "ms", "index", "match", "format", "formatter", "val", "extend", "v", "delimiter", "newDebug", "namespaces", "split", "len", "toNamespace", "name", "regexp", "colors", "supports_color_default", "inspectOpts", "key", "obj", "prop", "_", "k", "val", "useColors", "tty", "formatArgs", "args", "name", "c", "colorCode", "prefix", "getDate", "log", "util", "save", "namespaces", "load", "init", "debug", "keys", "i", "setupFormatters", "formatters", "v", "str", "node_default", "setup", "src_default", "node_default", "src_default", "v", "base58btc", "base32", "base64", "notEmpty", "createDisabledLogger", "namespace", "logger", "defaultLogger", "name", "logger", "trace", "createDisabledLogger", "src_default", "r", "n", "scope", "notEmpty", "str", "equals", "a", "b", "i", "import_node_buffer", "concat", "arrays", "length", "asUint8Array", "symbol", "findBufAndOffset", "bufs", "index", "offset", "buf", "bufEnd", "isUint8ArrayList", "value", "Uint8ArrayList", "_Uint8ArrayList", "data", "length", "res", "i", "bytes", "beginInclusive", "endExclusive", "concat", "list", "bufStart", "sliceStartInBuf", "sliceEndsInBuf", "start", "search", "needle", "M", "radix", "rightmostPositions", "c", "j", "right", "lastIndex", "lastPatIndex", "skip", "char", "byteOffset", "allocUnsafe", "littleEndian", "alloc", "other", "equals", "acc", "curr", "import_node_buffer", "toString", "array", "encoding", "base", "bases_default", "TAG_MASK", "LONG_LENGTH_MASK", "LONG_LENGTH_BYTES_MASK", "decoders", "readSequence", "readInteger", "readBitString", "readOctetString", "readNull", "readObjectIdentifier", "decodeDer", "buf", "context", "tag", "readLength", "length", "count", "str", "i", "entries", "result", "start", "end", "vals", "finalOffset", "byte", "val1", "val2", "oid", "num", "val", "unusedBits", "bytes", "encodeNumber", "value", "number", "array", "Uint8ArrayList", "encodeLength", "encodeInteger", "contents", "mask", "encodeBitString", "encodeSequence", "values", "tag", "output", "Uint8ArrayList", "buf", "encodeLength", "hashAndVerify", "key", "sig", "msg", "options", "publicKey", "result", "OID_256", "OID_384", "OID_521", "P_256_KEY_JWK", "P_384_KEY_JWK", "P_521_KEY_JWK", "P_256_KEY_LENGTH", "P_384_KEY_LENGTH", "P_521_KEY_LENGTH", "unmarshalECDSAPublicKey", "bytes", "message", "decodeDer", "pkiMessageToECDSAPublicKey", "coordinates", "offset", "x", "y", "P_256_KEY_LENGTH", "toString", "ECDSAPublicKey", "P_256_KEY_JWK", "P_384_KEY_LENGTH", "P_384_KEY_JWK", "P_521_KEY_LENGTH", "P_521_KEY_JWK", "InvalidParametersError", "publicKeyToPKIMessage", "publicKey", "encodeSequence", "encodeInteger", "getOID", "encodeBitString", "Uint8ArrayList", "fromString", "curve", "OID_256", "OID_384", "OID_521", "InvalidParametersError", "ECDSAPublicKey", "jwk", "publicKeyToPKIMessage", "identity", "publicKeyToProtobuf", "CID", "base58btc", "key", "equals", "data", "sig", "options", "hashAndVerify", "import_crypto", "keypair", "crypto", "PUBLIC_KEY_BYTE_LENGTH", "SIGNATURE_BYTE_LENGTH", "hashAndVerify", "key", "sig", "msg", "PUBLIC_KEY_BYTE_LENGTH", "SIGNATURE_BYTE_LENGTH", "obj", "crypto", "toString", "isPromise", "thing", "Ed25519PublicKey", "key", "ensureEd25519Key", "PUBLIC_KEY_BYTE_LENGTH", "identity", "publicKeyToProtobuf", "CID", "base58btc", "equals", "data", "sig", "options", "result", "hashAndVerify", "isPromise", "res", "unmarshalEd25519PublicKey", "bytes", "ensureEd25519Key", "PUBLIC_KEY_BYTE_LENGTH", "Ed25519PublicKey", "ensureEd25519Key", "key", "length", "InvalidParametersError", "KeyType", "__KeyTypeValues", "enumeration", "PublicKey", "_codec", "message", "obj", "w", "opts", "reader", "length", "end", "tag", "encodeMessage", "buf", "decodeMessage", "PrivateKey", "nc", "crypto", "isBytes", "a", "anumber", "n", "abytes", "b", "lengths", "ahash", "h", "aexists", "instance", "checkFinished", "aoutput", "out", "min", "clean", "arrays", "i", "createView", "arr", "rotr", "word", "shift", "hasHexBuiltin", "hexes", "_", "i", "bytesToHex", "bytes", "abytes", "hex", "asciis", "asciiToBase16", "ch", "hexToBytes", "hl", "al", "array", "ai", "hi", "n1", "n2", "char", "utf8ToBytes", "str", "toBytes", "data", "utf8ToBytes", "abytes", "concatBytes", "arrays", "sum", "i", "a", "abytes", "res", "pad", "Hash", "createHasher", "hashCons", "hashC", "msg", "toBytes", "tmp", "randomBytes", "bytesLength", "crypto", "setBigUint64", "view", "byteOffset", "value", "isLE", "_32n", "_u32_max", "wh", "wl", "h", "l", "Chi", "a", "b", "c", "Maj", "HashMD", "Hash", "blockLen", "outputLen", "padOffset", "createView", "data", "aexists", "toBytes", "abytes", "buffer", "len", "pos", "take", "dataView", "out", "aoutput", "clean", "i", "oview", "outLen", "state", "res", "to", "length", "finished", "destroyed", "SHA256_IV", "SHA256_K", "SHA256_W", "SHA256", "HashMD", "outputLen", "SHA256_IV", "A", "B", "C", "D", "E", "F", "G", "H", "view", "offset", "i", "W15", "W2", "s0", "rotr", "s1", "sigma1", "T1", "Chi", "T2", "Maj", "clean", "sha256", "createHasher", "SHA256", "import_node_crypto", "HMAC", "Hash", "hash", "_key", "ahash", "key", "toBytes", "blockLen", "pad", "clean", "buf", "aexists", "out", "abytes", "to", "oHash", "iHash", "finished", "destroyed", "outputLen", "hmac", "message", "_0n", "_1n", "_abool2", "value", "title", "prefix", "_abytes2", "length", "bytes", "isBytes", "len", "needsLen", "ofLen", "got", "numberToHexUnpadded", "num", "hex", "hexToNumber", "_0n", "bytesToNumberBE", "bytesToHex", "bytesToNumberLE", "abytes", "numberToBytesBE", "n", "hexToBytes", "numberToBytesLE", "ensureBytes", "title", "hex", "expectedLength", "res", "hexToBytes", "e", "isBytes", "len", "isPosBig", "n", "_0n", "inRange", "min", "max", "aInRange", "title", "bitLen", "len", "_1n", "bitMask", "n", "_1n", "createHmacDrbg", "hashLen", "qByteLen", "hmacFn", "u8n", "len", "u8of", "byte", "v", "k", "i", "reset", "b", "reseed", "seed", "gen", "out", "sl", "concatBytes", "pred", "res", "_validateObject", "object", "fields", "optFields", "checkField", "fieldName", "expectedType", "isOpt", "val", "current", "k", "v", "memoized", "fn", "map", "arg", "args", "val", "computed", "_0n", "_1n", "_2n", "_3n", "_4n", "_5n", "_7n", "_8n", "_9n", "_16n", "mod", "a", "b", "result", "pow2", "x", "power", "modulo", "res", "_0n", "invert", "number", "a", "mod", "b", "y", "_1n", "u", "v", "q", "r", "m", "n", "assertIsSquare", "Fp", "root", "sqrt3mod4", "p1div4", "_4n", "sqrt5mod8", "p5div8", "_5n", "_8n", "n2", "_2n", "nv", "sqrt9mod16", "P", "Fp_", "Field", "tn", "tonelliShanks", "c1", "c2", "c3", "c4", "_7n", "_16n", "tv1", "tv2", "tv3", "tv4", "e1", "e2", "e3", "_3n", "Q", "S", "Z", "_Fp", "FpLegendre", "cc", "Q1div2", "M", "c", "t", "R", "i", "t_tmp", "exponent", "FpSqrt", "_9n", "FIELD_FIELDS", "validateField", "field", "initial", "opts", "map", "val", "_validateObject", "FpPow", "Fp", "num", "power", "_0n", "_1n", "p", "d", "FpInvertBatch", "nums", "passZero", "inverted", "multipliedAcc", "acc", "i", "invertedAcc", "FpLegendre", "Fp", "n", "p1mod2", "_1n", "_2n", "powered", "yes", "zero", "no", "nLength", "n", "nBitLength", "anumber", "_nBitLength", "nByteLength", "Field", "ORDER", "bitLenOrOpts", "isLE", "opts", "_0n", "_nbitLength", "_sqrt", "modFromBytes", "allowedLengths", "_opts", "BITS", "BYTES", "sqrtP", "bitMask", "_1n", "num", "mod", "lhs", "rhs", "power", "FpPow", "invert", "FpSqrt", "numberToBytesLE", "numberToBytesBE", "bytes", "skipValidation", "padded", "scalar", "bytesToNumberLE", "bytesToNumberBE", "lst", "FpInvertBatch", "a", "b", "c", "getFieldBytesLength", "fieldOrder", "bitLength", "getMinHashLength", "length", "mapHashToField", "key", "isLE", "len", "fieldLen", "minLen", "num", "bytesToNumberLE", "bytesToNumberBE", "reduced", "mod", "_1n", "numberToBytesLE", "numberToBytesBE", "_0n", "_1n", "negateCt", "condition", "item", "neg", "normalizeZ", "c", "points", "invertedZs", "FpInvertBatch", "p", "i", "validateW", "W", "bits", "calcWOpts", "scalarBits", "windows", "windowSize", "maxNumber", "mask", "bitMask", "shiftBy", "calcOffsets", "n", "window", "wOpts", "wbits", "nextN", "offsetStart", "offset", "isZero", "isNeg", "isNegF", "validateMSMPoints", "validateMSMScalars", "scalars", "field", "s", "pointPrecomputes", "pointWindowSizes", "getW", "P", "assert0", "wNAF", "Point", "elm", "d", "point", "base", "precomputes", "f", "wo", "offsetF", "acc", "transform", "comp", "scalar", "prev", "mulEndoUnsafe", "k1", "k2", "p1", "p2", "pippenger", "fieldN", "plength", "slength", "zero", "bitLen", "MASK", "buckets", "lastBits", "sum", "j", "resI", "sumI", "createField", "order", "field", "isLE", "validateField", "Field", "_createCurveFields", "type", "CURVE", "curveOpts", "FpFnLE", "p", "val", "_0n", "Fp", "Fn", "params", "divNearest", "num", "den", "_2n", "_splitEndoScalar", "k", "basis", "n", "a1", "b1", "a2", "b2", "c1", "c2", "k1", "k2", "k1neg", "_0n", "k2neg", "MAX_NUM", "bitMask", "bitLen", "_1n", "validateSigFormat", "format", "validateSigOpts", "opts", "def", "optsn", "optName", "_abool2", "DERErr", "m", "DER", "tag", "data", "E", "dataLen", "len", "numberToHexUnpadded", "lenLen", "pos", "first", "isLong", "length", "lengthBytes", "b", "v", "hex", "bytesToNumberBE", "int", "tlv", "ensureBytes", "seqBytes", "seqLeftBytes", "rBytes", "rLeftBytes", "sBytes", "sLeftBytes", "sig", "rs", "ss", "seq", "_3n", "_4n", "_normFnElement", "Fn", "key", "expected", "bytes", "weierstrassN", "params", "extraOpts", "validated", "_createCurveFields", "Fp", "CURVE", "cofactor", "CURVE_ORDER", "_validateObject", "endo", "lengths", "getWLengths", "assertCompressionIsSupported", "pointToBytes", "_c", "point", "isCompressed", "x", "y", "bx", "hasEvenY", "concatBytes", "pprefix", "pointFromBytes", "_abytes2", "comp", "uncomp", "head", "tail", "y2", "weierstrassEquation", "sqrtError", "err", "isYOdd", "L", "isValidXY", "encodePoint", "decodePoint", "x2", "x3", "left", "right", "_4a3", "_27b2", "acoord", "title", "banZero", "aprjpoint", "other", "Point", "splitEndoScalarN", "toAffineMemo", "memoized", "p", "iz", "X", "Y", "Z", "is0", "zz", "assertValidMemo", "finishEndo", "endoBeta", "k1p", "k2p", "negateCt", "P", "windowSize", "isLazy", "wnaf", "X1", "Y1", "Z1", "X2", "Y2", "Z2", "U1", "U2", "a", "b3", "X3", "Y3", "Z3", "t0", "t1", "t2", "t3", "t4", "t5", "scalar", "fake", "mul", "normalizeZ", "k1f", "k2f", "f", "sc", "p1", "p2", "mulEndoUnsafe", "Q", "sum", "invertedZ", "isTorsionFree", "clearCofactor", "bytesToHex", "points", "scalars", "pippenger", "privateKey", "bits", "wNAF", "getWLengths", "Fp", "Fn", "ecdh", "Point", "ecdhOpts", "randomBytes_", "randomBytes", "lengths", "getMinHashLength", "isValidSecretKey", "secretKey", "_normFnElement", "isValidPublicKey", "publicKey", "isCompressed", "comp", "publicKeyUncompressed", "l", "randomSecretKey", "seed", "mapHashToField", "_abytes2", "getPublicKey", "keygen", "isProbPub", "item", "ensureBytes", "getSharedSecret", "secretKeyA", "publicKeyB", "s", "key", "windowSize", "point", "ecdsa", "hash", "ecdsaOpts", "ahash", "_validateObject", "hmac", "msgs", "concatBytes", "CURVE_ORDER", "fnBits", "utils", "defaultSigOpts", "defaultSigOpts_format", "isBiggerThanHalfOrder", "number", "HALF", "_1n", "validateRS", "title", "num", "validateSigLength", "bytes", "format", "validateSigFormat", "size", "sizer", "Signature", "r", "recovery", "recid", "DER", "L", "hex", "hexToBytes", "messageHash", "FIELD_ORDER", "rec", "_2n", "radj", "x", "R", "pprefix", "ir", "h", "bits2int_modN", "u1", "u2", "Q", "bytesToHex", "bits2int", "bytesToNumberBE", "delta", "ORDER_MASK", "bitMask", "int2octets", "aInRange", "_0n", "validateMsgAndHash", "message", "prehash", "prepSig", "privateKey", "opts", "k", "lowS", "extraEntropy", "validateSigOpts", "h1int", "d", "seedArgs", "e", "m", "k2sig", "kBytes", "ik", "q", "normS", "sign", "createHmacDrbg", "tryParsingSig", "sg", "sig", "isHex", "isBytes", "isObj", "derError", "verify", "signature", "P", "is", "recoverPublicKey", "_weierstrass_legacy_opts_to_new", "c", "CURVE", "Fp", "allowedLengths", "l", "Fn", "Field", "curveOpts", "_ecdsa_legacy_opts_to_new", "ecdsaOpts", "_ecdsa_new_output_to_legacy", "c", "_ecdsa", "Point", "nLength", "weierstrass", "CURVE", "curveOpts", "hash", "ecdsaOpts", "_ecdsa_legacy_opts_to_new", "weierstrassN", "signs", "ecdsa", "createCurve", "curveDef", "defHash", "create", "hash", "weierstrass", "secp256k1_CURVE", "secp256k1_ENDO", "_2n", "sqrtMod", "y", "P", "secp256k1_CURVE", "_3n", "_6n", "_11n", "_22n", "_23n", "_44n", "_88n", "b2", "b3", "b6", "pow2", "b9", "b11", "b22", "b44", "b88", "b176", "b220", "b223", "t1", "t2", "root", "Fpk1", "Field", "secp256k1", "createCurve", "secp256k1_ENDO", "sha256", "VerificationError", "message", "hashAndVerify", "key", "sig", "msg", "options", "hash", "crypto", "buf", "digest", "secp256k1", "err", "VerificationError", "Secp256k1PublicKey", "key", "validateSecp256k1PublicKey", "compressSecp256k1PublicKey", "identity", "publicKeyToProtobuf", "CID", "base58btc", "equals", "data", "sig", "options", "hashAndVerify", "unmarshalSecp256k1PublicKey", "bytes", "Secp256k1PublicKey", "compressSecp256k1PublicKey", "key", "secp256k1", "validateSecp256k1PublicKey", "key", "secp256k1", "err", "InvalidPublicKeyError", "publicKeyFromMultihash", "digest", "Type", "Data", "PublicKey", "data", "KeyType", "unmarshalEd25519PublicKey", "unmarshalSecp256k1PublicKey", "unmarshalECDSAPublicKey", "UnsupportedKeyTypeError", "publicKeyToProtobuf", "key", "inspect", "LIBP2P_KEY_CODE", "PeerIdImpl", "init", "peerIdSymbol", "base58btc", "CID", "id", "equals", "RSAPeerId", "Ed25519PeerId", "Secp256k1PeerId", "TRANSPORT_IPFS_GATEWAY_HTTP_CODE", "URLPeerId", "url", "identity", "fromString", "other", "toString", "peerIdFromMultihash", "multihash", "isSha256Multihash", "RSAPeerId", "isIdentityMultihash", "publicKey", "publicKeyFromMultihash", "Ed25519PeerId", "Secp256k1PeerId", "url", "toString", "URLPeerId", "InvalidMultihashError", "isIdentityMultihash", "multihash", "identity", "isSha256Multihash", "sha256", "import_net", "InvalidMultiaddrError", "ValidationError", "InvalidParametersError", "UnknownProtocolError", "import_node_net", "bytesToString", "base", "buf", "toString", "stringToBytes", "fromString", "bytes2port", "port2bytes", "port", "onion2bytes", "str", "addr", "portBuf", "concat", "onion32bytes", "base32", "bytes2onion", "addrBytes", "portBytes", "ip4ToBytes", "ip", "bytes", "byte", "index", "value", "InvalidMultiaddrError", "ip6ToBytes", "offset", "sections", "i", "isv4", "v4Buffer", "argv", "word", "ip4ToString", "result", "ip6ToString", "byte1", "byte2", "tuple", "url", "ip6StringToValue", "decoders", "bases", "c", "anybaseDecoder", "acc", "d", "mb2bytes", "mbstr", "bytes2mb", "integer", "value", "ValidationError", "positive", "maxValue", "max", "validate", "funcs", "fn", "validatePort", "V", "Registry", "key", "codec", "UnknownProtocolError", "alias", "code", "registry", "codecs", "ip4ToBytes", "ip4ToString", "value", "ValidationError", "port2bytes", "bytes2port", "validatePort", "ip6ToBytes", "ip6ToString", "ip6StringToValue", "bytesToString", "stringToBytes", "str", "val", "CID", "bytes2onion", "onion2bytes", "onion32bytes", "bytes2mb", "base64url", "mb2bytes", "bytesToComponents", "bytes", "components", "i", "code", "decode", "codec", "registry", "codeLength", "encodingLength", "size", "sizeForAddr", "sizeLength", "V", "componentLength", "component", "valueOffset", "valueBytes", "toString", "componentsToBytes", "length", "codecLength", "valueLength", "valueLengthLength", "fromString", "offset", "encodeUint8Array", "concat", "stringToComponents", "string", "InvalidMultiaddrError", "collecting", "value", "protocol", "char", "ended", "componentsToString", "inspect", "symbol", "toComponents", "addr", "isMultiaddr", "bytesToComponents", "stringToComponents", "InvalidMultiaddrError", "Multiaddr", "_Multiaddr", "#components", "#string", "#bytes", "options", "validate", "componentsToBytes", "componentsToString", "c", "ma", "addrString", "s", "i", "InvalidParametersError", "code", "index", "equals", "component", "codec", "registry", "isMultiaddr", "value", "symbol", "multiaddr", "addr", "Multiaddr", "code", "vals", "component", "value", "not", "matcher", "optional", "result", "or", "matchers", "matches", "and", "fmt", "match", "ma", "parts", "exactMatch", "_PEER_ID", "value", "PEER_ID", "fmt", "_DNS4", "_DNS6", "_DNSADDR", "_DNS", "DNS4", "optional", "DNS6", "DNSADDR", "DNS", "or", "_IP4", "and", "_IP6", "_IP", "_IP_OR_DOMAIN", "IP_OR_DOMAIN", "IP4", "IP6", "IP", "_TCP", "_UDP", "TCP", "UDP", "_QUIC", "code", "_QUIC_V1", "QUIC_V0_OR_V1", "QUIC", "QUIC_V1", "_WEB", "_WebSockets", "WebSockets", "_WebSocketsSecure", "WebSocketsSecure", "_WebRTCDirect", "WebRTCDirect", "_WebTransport", "WebTransport", "_P2P", "P2P", "_Circuit", "not", "Circuit", "_WebRTC", "WebRTC", "_HTTP", "HTTP", "_HTTPS", "HTTPS", "_Memory", "Memory", "_Unix", "Unix", "CustomProgressEvent", "type", "detail", "import_node_net", "getNetConfig", "ma", "components", "config", "index", "InvalidParametersError", "pDefer", "deferred", "resolve", "reject", "FixedFIFO", "hwm", "data", "last", "FIFO", "options", "obj", "val", "prev", "next", "AbortError", "message", "code", "pushable", "options", "_pushable", "buffer", "next", "_pushable", "getNext", "options", "onEnd", "buffer", "FIFO", "pushable", "onNext", "ended", "drain", "pDefer", "waitNext", "resolve", "reject", "next", "err", "bufferNext", "bufferError", "push", "value", "end", "_return", "_throw", "signal", "cancel", "listener", "AbortError", "opts", "TimeoutError", "message", "AbortError", "getDOMException", "errorMessage", "getAbortedReason", "signal", "reason", "pTimeout", "promise", "options", "milliseconds", "fallback", "customTimers", "timer", "abortHandler", "cancelablePromise", "resolve", "reject", "timeoutError", "error", "normalizeEmitter", "emitter", "addListener", "removeListener", "pEventMultiple", "event", "options", "cancel", "returnValue", "resolve", "reject", "events", "items", "onItem", "arguments_", "value", "rejectHandler", "error", "rejectionEvent", "timeout", "pTimeout", "pEvent", "arrayPromise", "promise", "array", "UnexpectedEOFError", "defaultTranslate", "signal", "raceSignal", "promise", "opts", "translateError", "listener", "resolve", "reject", "DEFAULT_MAX_READ_BUFFER_LENGTH", "AbstractMessageStream", "TypedEventEmitter", "init", "Uint8ArrayList", "continueSendingOnDrain", "output", "pushable", "streamAsyncIterableOnMessageListener", "evt", "streamAsyncIterableOnCloseListener", "streamAsyncIterableOnRemoteCloseWriteListener", "data", "StreamStateError", "err", "StreamAbortEvent", "args", "StreamResetError", "StreamResetEvent", "StreamCloseEvent", "canSendMore", "totalBytes", "sentBytes", "end", "toSend", "willSend", "sendResult", "buf", "StreamMessageEvent", "StreamBufferError", "AbstractMultiaddrConnection", "AbstractMessageStream", "init", "evt", "options", "pEvent", "import_node_os", "isLinkLocalIp", "ip", "netConfigToMultiaddr", "config", "port", "host", "parts", "p", "multiaddr", "FAMILIES", "isWildcard", "ip", "getNetworkAddrs", "family", "addresses", "networks", "os", "netAddrs", "netAddr", "isLinkLocalIp", "getThinWaistAddresses", "ma", "port", "config", "getNetConfig", "host", "netConfigToMultiaddr", "ipPortToMultiaddr", "ip", "port", "InvalidParametersError", "multiaddr", "DEFAULT_MAX_BUFFER_SIZE", "UnwrappedError", "InvalidMessageLengthError", "InvalidDataLengthError", "InvalidDataLengthLengthError", "isStream", "obj", "isMultiaddrConnection", "isEOF", "isValid", "byteStream", "stream", "opts", "maxBufferSize", "readBuffer", "Uint8ArrayList", "hasBytes", "unwrapped", "InvalidParametersError", "byteStreamOnMessageListener", "evt", "readBufferSize", "byteStreamOnCloseListener", "byteStreamOnRemoteCloseWrite", "options", "UnexpectedEOFError", "bytesToRead", "raceSignal", "toRead", "output", "data", "pEvent", "lpStream", "bytes", "encodingLength", "decodeLength", "decode", "encodeLength", "encode", "dataLength", "lengthBuffer", "buf", "err", "list", "pbStream", "lp", "proto", "value", "message", "messages", "d", "TCPSocketMultiaddrConnection", "AbstractMultiaddrConnection", "init", "remoteAddr", "Unix", "InvalidParametersError", "ipPortToMultiaddr", "buf", "err", "TimeoutError", "hadError", "data", "sentBytes", "canSendMore", "options", "pEvent", "toMultiaddrConnection", "import_os", "import_path", "multiaddrToNetConfig", "addr", "options", "Unix", "listenPath", "c", "InvalidParametersError", "os", "path", "config", "getNetConfig", "host", "port", "TCPListenerStatusCode", "TCPListener", "TypedEventEmitter", "context", "setMaxListeners", "net", "InvalidParametersError", "address", "err", "socket", "NotStartedError", "maConn", "toMultiaddrConnection", "e", "multiaddr", "getThinWaistAddresses", "ma", "AlreadyStartedError", "multiaddrToNetConfig", "options", "events", "pEvent", "netConfig", "resolve", "reject", "permanent", "TCP", "components", "options", "transportSymbol", "serviceCapabilities", "ma", "socket", "maConn", "toMultiaddrConnection", "err", "CustomProgressEvent", "rawSocket", "resolve", "reject", "start", "cOpts", "multiaddrToNetConfig", "net", "onError", "cOptsStr", "done", "onTimeout", "TimeoutError", "onConnect", "onAbort", "AbortError", "TCPListener", "multiaddrs", "tcp", "init", "components", "TCP", "log", "logger", "DHT", "client", "key", "value", "InvalidParametersError", "sh", "Request", "DHTRequest", "response", "Response", "ProtocolError", "OperationFailedError", "peerId", "isPeerId", "peerIdFromMultihash", "decode", "a", "multiaddr", "cid", "CID", "count", "dhtResponse", "DHTResponse", "InvalidMessageError", "Pubsub", "client", "sh", "Request", "PSRequest", "response", "Response", "OperationFailedError", "topic", "data", "InvalidParametersError", "subscribed", "PSMessage", "buf", "peerIdFromMultihash", "decode", "log", "logger", "OperationFailedError", "message", "Client", "addr", "tcp", "defaultLogger", "DHT", "Pubsub", "signal", "PassThroughUpgrader", "request", "maConn", "subtype", "pb", "pbStream", "Request", "peerId", "addrs", "isPeerId", "InvalidParametersError", "isMultiaddr", "sh", "a", "response", "Response", "errResponse", "peerIdFromMultihash", "decode", "multiaddr", "peer", "protocol", "err", "handler", "listener", "address", "connection", "StreamInfo", "createClient"]
7
7
  }