@junobuild/schema 1.0.0 → 1.0.1-next-2026-03-14
This diff represents the content of publicly available package versions that have been released to one of the supported registries. The information contained in this diff is provided for informational purposes only and reflects changes between package versions as they appear in their respective public registries.
- package/index.js +1 -1
- package/index.js.map +2 -2
- package/index.mjs +1 -1
- package/index.mjs.map +2 -2
- package/package.json +3 -3
- package/type-system/index.d.ts +4 -2
- package/utils/idl.d.ts +37 -0
- package/utils.d.ts +2 -1
- package/utils.js +1 -1
- package/utils.js.map +4 -4
- package/utils.mjs +1 -1
- package/utils.mjs.map +4 -4
- package/LICENSE +0 -21
- /package/utils/{did.d.ts → nullable.d.ts} +0 -0
package/index.js
CHANGED
|
@@ -1,4 +1,4 @@
|
|
|
1
|
-
import*as X from"zod";var H="abcdefghijklmnopqrstuvwxyz234567",m=Object.create(null);for(let e=0;e<H.length;e++)m[H[e]]=e;m[0]=m.o;m[1]=m.i;function G(e){let t=0,r=0,c="";function n(s){return t<0?r|=s>>-t:r=s<<t&248,t>3?(t-=8,1):(t<4&&(c+=H[r>>3],t+=5),0)}for(let s=0;s<e.length;)s+=n(e[s]);return c+(t<0?H[r>>3]:"")}function k(e){let t=0,r=0,c=new Uint8Array(e.length*4/3|0),n=0;function s(x){let i=m[x.toLowerCase()];if(i===void 0)throw new Error(`Invalid character: ${JSON.stringify(x)}`);i<<=3,r|=i>>>t,t+=5,t>=8&&(c[n++]=r,t-=8,t>0?r=i<<5-t&255:r=0)}for(let x of e)s(x);return c.slice(0,n)}var t0=new Uint32Array([0,1996959894,3993919788,2567524794,124634137,1886057615,3915621685,2657392035,249268274,2044508324,3772115230,2547177864,162941995,2125561021,3887607047,2428444049,498536548,1789927666,4089016648,2227061214,450548861,1843258603,4107580753,2211677639,325883990,1684777152,4251122042,2321926636,335633487,1661365465,4195302755,2366115317,997073096,1281953886,3579855332,2724688242,1006888145,1258607687,3524101629,2768942443,901097722,1119000684,3686517206,2898065728,853044451,1172266101,3705015759,2882616665,651767980,1373503546,3369554304,3218104598,565507253,1454621731,3485111705,3099436303,671266974,1594198024,3322730930,2970347812,795835527,1483230225,3244367275,3060149565,1994146192,31158534,2563907772,4023717930,1907459465,112637215,2680153253,3904427059,2013776290,251722036,2517215374,3775830040,2137656763,141376813,2439277719,3865271297,1802195444,476864866,2238001368,4066508878,1812370925,453092731,2181625025,4111451223,1706088902,314042704,2344532202,4240017532,1658658271,366619977,2362670323,4224994405,1303535960,984961486,2747007092,3569037538,1256170817,1037604311,2765210733,3554079995,1131014506,879679996,2909243462,3663771856,1141124467,855842277,2852801631,3708648649,1342533948,654459306,3188396048,3373015174,1466479909,544179635,3110523913,3462522015,1591671054,702138776,2966460450,3352799412,1504918807,783551873,3082640443,3233442989,3988292384,2596254646,62317068,1957810842,3939845945,2647816111,81470997,1943803523,3814918930,2489596804,225274430,2053790376,3826175755,2466906013,167816743,2097651377,4027552580,2265490386,503444072,1762050814,4150417245,2154129355,426522225,1852507879,4275313526,2312317920,282753626,1742555852,4189708143,2394877945,397917763,1622183637,3604390888,2714866558,953729732,1340076626,3518719985,2797360999,1068828381,1219638859,3624741850,2936675148,906185462,1090812512,3747672003,2825379669,829329135,1181335161,3412177804,3160834842,628085408,1382605366,3423369109,3138078467,570562233,1426400815,3317316542,2998733608,733239954,1555261956,3268935591,3050360625,752459403,1541320221,2607071920,3965973030,1969922972,40735498,2617837225,3943577151,1913087877,83908371,2512341634,3803740692,2075208622,213261112,2463272603,3855990285,2094854071,198958881,2262029012,4057260610,1759359992,534414190,2176718541,4139329115,1873836001,414664567,2282248934,4279200368,1711684554,285281116,2405801727,4167216745,1634467795,376229701,2685067896,3608007406,1308918612,956543938,2808555105,3495958263,1231636301,1047427035,2932959818,3654703836,1088359270,936918e3,2847714899,3736837829,1202900863,817233897,3183342108,3401237130,1404277552,615818150,3134207493,3453421203,1423857449,601450431,3009837614,3294710456,1567103746,711928724,3020668471,3272380065,1510334235,755167117]);function O(e){let t=-1;for(let r=0;r<e.length;r++){let n=(e[r]^t)&255;t=t0[n]^t>>>8}return(t^-1)>>>0}function e0(e){return e instanceof Uint8Array||ArrayBuffer.isView(e)&&e.constructor.name==="Uint8Array"}function A(e,...t){if(!e0(e))throw new Error("Uint8Array expected");if(t.length>0&&!t.includes(e.length))throw new Error("Uint8Array expected of length "+t+", got length="+e.length)}function I(e,t=!0){if(e.destroyed)throw new Error("Hash instance has been destroyed");if(t&&e.finished)throw new Error("Hash#digest() has already been called")}function N(e,t){A(e);let r=t.outputLen;if(e.length<r)throw new Error("digestInto() expects output buffer of length at least "+r)}function U(...e){for(let t=0;t<e.length;t++)e[t].fill(0)}function B(e){return new DataView(e.buffer,e.byteOffset,e.byteLength)}function d(e,t){return e<<32-t|e>>>t}var v=typeof Uint8Array.from([]).toHex=="function"&&typeof Uint8Array.fromHex=="function",r0=Array.from({length:256},(e,t)=>t.toString(16).padStart(2,"0"));function j(e){if(A(e),v)return e.toHex();let t="";for(let r=0;r<e.length;r++)t+=r0[e[r]];return t}var b={_0:48,_9:57,A:65,F:70,a:97,f:102};function V(e){if(e>=b._0&&e<=b._9)return e-b._0;if(e>=b.A&&e<=b.F)return e-(b.A-10);if(e>=b.a&&e<=b.f)return e-(b.a-10)}function M(e){if(typeof e!="string")throw new Error("hex string expected, got "+typeof e);if(v)return Uint8Array.fromHex(e);let t=e.length,r=t/2;if(t%2)throw new Error("hex string expected, got unpadded hex of length "+t);let c=new Uint8Array(r);for(let n=0,s=0;n<r;n++,s+=2){let x=V(e.charCodeAt(s)),i=V(e.charCodeAt(s+1));if(x===void 0||i===void 0){let o=e[s]+e[s+1];throw new Error('hex string expected, got non-hex character "'+o+'" at index '+s)}c[n]=x*16+i}return c}function c0(e){if(typeof e!="string")throw new Error("string expected");return new Uint8Array(new TextEncoder().encode(e))}function C(e){return typeof e=="string"&&(e=c0(e)),A(e),e}var _=class{};function W(e){let t=c=>e().update(C(c)).digest(),r=e();return t.outputLen=r.outputLen,t.blockLen=r.blockLen,t.create=()=>e(),t}function n0(e,t,r,c){if(typeof e.setBigUint64=="function")return e.setBigUint64(t,r,c);let n=BigInt(32),s=BigInt(4294967295),x=Number(r>>n&s),i=Number(r&s),o=c?4:0,f=c?0:4;e.setUint32(t+o,x,c),e.setUint32(t+f,i,c)}function J(e,t,r){return e&t^~e&r}function R(e,t,r){return e&t^e&r^t&r}var E=class extends _{constructor(t,r,c,n){super(),this.finished=!1,this.length=0,this.pos=0,this.destroyed=!1,this.blockLen=t,this.outputLen=r,this.padOffset=c,this.isLE=n,this.buffer=new Uint8Array(t),this.view=B(this.buffer)}update(t){I(this),t=C(t),A(t);let{view:r,buffer:c,blockLen:n}=this,s=t.length;for(let x=0;x<s;){let i=Math.min(n-this.pos,s-x);if(i===n){let o=B(t);for(;n<=s-x;x+=n)this.process(o,x);continue}c.set(t.subarray(x,x+i),this.pos),this.pos+=i,x+=i,this.pos===n&&(this.process(r,0),this.pos=0)}return this.length+=t.length,this.roundClean(),this}digestInto(t){I(this),N(t,this),this.finished=!0;let{buffer:r,view:c,blockLen:n,isLE:s}=this,{pos:x}=this;r[x++]=128,U(this.buffer.subarray(x)),this.padOffset>n-x&&(this.process(c,0),x=0);for(let a=x;a<n;a++)r[a]=0;n0(c,n-8,BigInt(this.length*8),s),this.process(c,0);let i=B(t),o=this.outputLen;if(o%4)throw new Error("_sha2: outputLen should be aligned to 32bit");let f=o/4,u=this.get();if(f>u.length)throw new Error("_sha2: outputLen bigger than state");for(let a=0;a<f;a++)i.setUint32(4*a,u[a],s)}digest(){let{buffer:t,outputLen:r}=this;this.digestInto(t);let c=t.slice(0,r);return this.destroy(),c}_cloneInto(t){t||(t=new this.constructor),t.set(...this.get());let{blockLen:r,buffer:c,length:n,finished:s,destroyed:x,pos:i}=this;return t.destroyed=x,t.finished=s,t.length=n,t.pos=i,n%r&&t.buffer.set(c),t}clone(){return this._cloneInto()}},h=Uint32Array.from([1779033703,3144134277,1013904242,2773480762,1359893119,2600822924,528734635,1541459225]),l=Uint32Array.from([3238371032,914150663,812702999,4144912697,4290775857,1750603025,1694076839,3204075428]);var s0=Uint32Array.from([1116352408,1899447441,3049323471,3921009573,961987163,1508970993,2453635748,2870763221,3624381080,310598401,607225278,1426881987,1925078388,2162078206,2614888103,3248222580,3835390401,4022224774,264347078,604807628,770255983,1249150122,1555081692,1996064986,2554220882,2821834349,2952996808,3210313671,3336571891,3584528711,113926993,338241895,666307205,773529912,1294757372,1396182291,1695183700,1986661051,2177026350,2456956037,2730485921,2820302411,3259730800,3345764771,3516065817,3600352804,4094571909,275423344,430227734,506948616,659060556,883997877,958139571,1322822218,1537002063,1747873779,1955562222,2024104815,2227730452,2361852424,2428436474,2756734187,3204031479,3329325298]),p=new Uint32Array(64),D=class extends E{constructor(t=32){super(64,t,8,!1),this.A=h[0]|0,this.B=h[1]|0,this.C=h[2]|0,this.D=h[3]|0,this.E=h[4]|0,this.F=h[5]|0,this.G=h[6]|0,this.H=h[7]|0}get(){let{A:t,B:r,C:c,D:n,E:s,F:x,G:i,H:o}=this;return[t,r,c,n,s,x,i,o]}set(t,r,c,n,s,x,i,o){this.A=t|0,this.B=r|0,this.C=c|0,this.D=n|0,this.E=s|0,this.F=x|0,this.G=i|0,this.H=o|0}process(t,r){for(let a=0;a<16;a++,r+=4)p[a]=t.getUint32(r,!1);for(let a=16;a<64;a++){let w=p[a-15],y=p[a-2],P=d(w,7)^d(w,18)^w>>>3,T=d(y,17)^d(y,19)^y>>>10;p[a]=T+p[a-7]+P+p[a-16]|0}let{A:c,B:n,C:s,D:x,E:i,F:o,G:f,H:u}=this;for(let a=0;a<64;a++){let w=d(i,6)^d(i,11)^d(i,25),y=u+w+J(i,o,f)+s0[a]+p[a]|0,T=(d(c,2)^d(c,13)^d(c,22))+R(c,n,s)|0;u=f,f=o,o=i,i=x+y|0,x=s,s=n,n=c,c=y+T|0}c=c+this.A|0,n=n+this.B|0,s=s+this.C|0,x=x+this.D|0,i=i+this.E|0,o=o+this.F|0,f=f+this.G|0,u=u+this.H|0,this.set(c,n,s,x,i,o,f,u)}roundClean(){U(p)}destroy(){this.set(0,0,0,0,0,0,0,0),U(this.buffer)}},F=class extends D{constructor(){super(28),this.A=l[0]|0,this.B=l[1]|0,this.C=l[2]|0,this.D=l[3]|0,this.E=l[4]|0,this.F=l[5]|0,this.G=l[6]|0,this.H=l[7]|0}};var q=W(()=>new F);var S="__principal__",x0=2,K=4,i0="aaaaa-aa",g=class e{static anonymous(){return new this(new Uint8Array([K]))}static managementCanister(){return this.fromText(i0)}static selfAuthenticating(t){let r=q(t);return new this(new Uint8Array([...r,x0]))}static from(t){if(typeof t=="string")return e.fromText(t);if(Object.getPrototypeOf(t)===Uint8Array.prototype)return new e(t);if(e.isPrincipal(t))return new e(t._arr);throw new Error(`Impossible to convert ${JSON.stringify(t)} to Principal.`)}static fromHex(t){return new this(M(t))}static fromText(t){let r=t;if(t.includes(S)){let x=JSON.parse(t);S in x&&(r=x[S])}let c=r.toLowerCase().replace(/-/g,""),n=k(c);n=n.slice(4,n.length);let s=new this(n);if(s.toText()!==r)throw new Error(`Principal "${s.toText()}" does not have a valid checksum (original value "${r}" may not be a valid Principal ID).`);return s}static fromUint8Array(t){return new this(t)}static isPrincipal(t){return t instanceof e||typeof t=="object"&&t!==null&&"_isPrincipal"in t&&t._isPrincipal===!0&&"_arr"in t&&t._arr instanceof Uint8Array}constructor(t){this._arr=t,this._isPrincipal=!0}isAnonymous(){return this._arr.byteLength===1&&this._arr[0]===K}toUint8Array(){return this._arr}toHex(){return j(this._arr).toUpperCase()}toText(){let t=new ArrayBuffer(4);new DataView(t).setUint32(0,O(this._arr));let c=new Uint8Array(t),n=new Uint8Array([...c,...this._arr]),x=G(n).match(/.{1,5}/g);if(!x)throw new Error;return x.join("-")}toString(){return this.toText()}toJSON(){return{[S]:this.toText()}}compareTo(t){for(let r=0;r<Math.min(this._arr.length,t._arr.length);r++){if(this._arr[r]<t._arr[r])return"lt";if(this._arr[r]>t._arr[r])return"gt"}return this._arr.length<t._arr.length?"lt":this._arr.length>t._arr.length?"gt":"eq"}ltEq(t){let r=this.compareTo(t);return r=="lt"||r=="eq"}gtEq(t){let r=this.compareTo(t);return r=="gt"||r=="eq"}};import*as L from"zod";import*as Y from"zod";var a0=(e=>(e.PrincipalText="PrincipalText",e.Principal="Principal",e.Uint8Array="Uint8Array",e.Url="Url",e))(a0||{}),$=X.instanceof(Uint8Array).meta({id:"Uint8Array"}),L0=L.string().refine(e=>{try{return g.fromText(e),!0}catch{return!1}},{error:"Invalid textual representation of a Principal."}).meta({id:"PrincipalText"}),z=L.custom().refine(e=>g.isPrincipal(e),{error:"Invalid Principal.",abort:!0}).transform(e=>g.from(e)).meta({id:"Principal"}),o0=({additionalProtocols:e=[],allowHttpLocally:t=!0})=>Y.url().refine(r=>{try{let c=[...new Set(["https:",...e])],{protocol:n,hostname:s}=new URL(r);return t&&["localhost","127.0.0.1"].includes(s)?["http:",...c].includes(n):c.includes(n)}catch{return!1}},{error:"Invalid URL."}),T0=o0({}).meta({id:"Url"});import*as f0 from"zod";var Z={principal:()=>z,uint8Array:()=>$},{union:D0,...d0}=f0,Q=Object.assign({},d0);Q.principal=Z.principal;Q.uint8Array=Z.uint8Array;export{Z as JunoType,z as PrincipalSchema,L0 as PrincipalTextSchema,$ as Uint8ArraySchema,T0 as UrlSchema,a0 as ZodSchemaId,o0 as createUrlSchema,Q as j};
|
|
1
|
+
import*as K from"zod";var H="abcdefghijklmnopqrstuvwxyz234567",m=Object.create(null);for(let e=0;e<H.length;e++)m[H[e]]=e;m[0]=m.o;m[1]=m.i;function G(e){let t=0,r=0,n="";function c(s){return t<0?r|=s>>-t:r=s<<t&248,t>3?(t-=8,1):(t<4&&(n+=H[r>>3],t+=5),0)}for(let s=0;s<e.length;)s+=c(e[s]);return n+(t<0?H[r>>3]:"")}function k(e){let t=0,r=0,n=new Uint8Array(e.length*4/3|0),c=0;function s(x){let i=m[x.toLowerCase()];if(i===void 0)throw new Error(`Invalid character: ${JSON.stringify(x)}`);i<<=3,r|=i>>>t,t+=5,t>=8&&(n[c++]=r,t-=8,t>0?r=i<<5-t&255:r=0)}for(let x of e)s(x);return n.slice(0,c)}var t0=new Uint32Array([0,1996959894,3993919788,2567524794,124634137,1886057615,3915621685,2657392035,249268274,2044508324,3772115230,2547177864,162941995,2125561021,3887607047,2428444049,498536548,1789927666,4089016648,2227061214,450548861,1843258603,4107580753,2211677639,325883990,1684777152,4251122042,2321926636,335633487,1661365465,4195302755,2366115317,997073096,1281953886,3579855332,2724688242,1006888145,1258607687,3524101629,2768942443,901097722,1119000684,3686517206,2898065728,853044451,1172266101,3705015759,2882616665,651767980,1373503546,3369554304,3218104598,565507253,1454621731,3485111705,3099436303,671266974,1594198024,3322730930,2970347812,795835527,1483230225,3244367275,3060149565,1994146192,31158534,2563907772,4023717930,1907459465,112637215,2680153253,3904427059,2013776290,251722036,2517215374,3775830040,2137656763,141376813,2439277719,3865271297,1802195444,476864866,2238001368,4066508878,1812370925,453092731,2181625025,4111451223,1706088902,314042704,2344532202,4240017532,1658658271,366619977,2362670323,4224994405,1303535960,984961486,2747007092,3569037538,1256170817,1037604311,2765210733,3554079995,1131014506,879679996,2909243462,3663771856,1141124467,855842277,2852801631,3708648649,1342533948,654459306,3188396048,3373015174,1466479909,544179635,3110523913,3462522015,1591671054,702138776,2966460450,3352799412,1504918807,783551873,3082640443,3233442989,3988292384,2596254646,62317068,1957810842,3939845945,2647816111,81470997,1943803523,3814918930,2489596804,225274430,2053790376,3826175755,2466906013,167816743,2097651377,4027552580,2265490386,503444072,1762050814,4150417245,2154129355,426522225,1852507879,4275313526,2312317920,282753626,1742555852,4189708143,2394877945,397917763,1622183637,3604390888,2714866558,953729732,1340076626,3518719985,2797360999,1068828381,1219638859,3624741850,2936675148,906185462,1090812512,3747672003,2825379669,829329135,1181335161,3412177804,3160834842,628085408,1382605366,3423369109,3138078467,570562233,1426400815,3317316542,2998733608,733239954,1555261956,3268935591,3050360625,752459403,1541320221,2607071920,3965973030,1969922972,40735498,2617837225,3943577151,1913087877,83908371,2512341634,3803740692,2075208622,213261112,2463272603,3855990285,2094854071,198958881,2262029012,4057260610,1759359992,534414190,2176718541,4139329115,1873836001,414664567,2282248934,4279200368,1711684554,285281116,2405801727,4167216745,1634467795,376229701,2685067896,3608007406,1308918612,956543938,2808555105,3495958263,1231636301,1047427035,2932959818,3654703836,1088359270,936918e3,2847714899,3736837829,1202900863,817233897,3183342108,3401237130,1404277552,615818150,3134207493,3453421203,1423857449,601450431,3009837614,3294710456,1567103746,711928724,3020668471,3272380065,1510334235,755167117]);function O(e){let t=-1;for(let r=0;r<e.length;r++){let c=(e[r]^t)&255;t=t0[c]^t>>>8}return(t^-1)>>>0}function e0(e){return e instanceof Uint8Array||ArrayBuffer.isView(e)&&e.constructor.name==="Uint8Array"}function A(e,...t){if(!e0(e))throw new Error("Uint8Array expected");if(t.length>0&&!t.includes(e.length))throw new Error("Uint8Array expected of length "+t+", got length="+e.length)}function I(e,t=!0){if(e.destroyed)throw new Error("Hash instance has been destroyed");if(t&&e.finished)throw new Error("Hash#digest() has already been called")}function N(e,t){A(e);let r=t.outputLen;if(e.length<r)throw new Error("digestInto() expects output buffer of length at least "+r)}function U(...e){for(let t=0;t<e.length;t++)e[t].fill(0)}function B(e){return new DataView(e.buffer,e.byteOffset,e.byteLength)}function d(e,t){return e<<32-t|e>>>t}var v=typeof Uint8Array.from([]).toHex=="function"&&typeof Uint8Array.fromHex=="function",r0=Array.from({length:256},(e,t)=>t.toString(16).padStart(2,"0"));function j(e){if(A(e),v)return e.toHex();let t="";for(let r=0;r<e.length;r++)t+=r0[e[r]];return t}var b={_0:48,_9:57,A:65,F:70,a:97,f:102};function V(e){if(e>=b._0&&e<=b._9)return e-b._0;if(e>=b.A&&e<=b.F)return e-(b.A-10);if(e>=b.a&&e<=b.f)return e-(b.a-10)}function M(e){if(typeof e!="string")throw new Error("hex string expected, got "+typeof e);if(v)return Uint8Array.fromHex(e);let t=e.length,r=t/2;if(t%2)throw new Error("hex string expected, got unpadded hex of length "+t);let n=new Uint8Array(r);for(let c=0,s=0;c<r;c++,s+=2){let x=V(e.charCodeAt(s)),i=V(e.charCodeAt(s+1));if(x===void 0||i===void 0){let o=e[s]+e[s+1];throw new Error('hex string expected, got non-hex character "'+o+'" at index '+s)}n[c]=x*16+i}return n}function n0(e){if(typeof e!="string")throw new Error("string expected");return new Uint8Array(new TextEncoder().encode(e))}function C(e){return typeof e=="string"&&(e=n0(e)),A(e),e}var _=class{};function W(e){let t=n=>e().update(C(n)).digest(),r=e();return t.outputLen=r.outputLen,t.blockLen=r.blockLen,t.create=()=>e(),t}function c0(e,t,r,n){if(typeof e.setBigUint64=="function")return e.setBigUint64(t,r,n);let c=BigInt(32),s=BigInt(4294967295),x=Number(r>>c&s),i=Number(r&s),o=n?4:0,f=n?0:4;e.setUint32(t+o,x,n),e.setUint32(t+f,i,n)}function J(e,t,r){return e&t^~e&r}function R(e,t,r){return e&t^e&r^t&r}var E=class extends _{constructor(t,r,n,c){super(),this.finished=!1,this.length=0,this.pos=0,this.destroyed=!1,this.blockLen=t,this.outputLen=r,this.padOffset=n,this.isLE=c,this.buffer=new Uint8Array(t),this.view=B(this.buffer)}update(t){I(this),t=C(t),A(t);let{view:r,buffer:n,blockLen:c}=this,s=t.length;for(let x=0;x<s;){let i=Math.min(c-this.pos,s-x);if(i===c){let o=B(t);for(;c<=s-x;x+=c)this.process(o,x);continue}n.set(t.subarray(x,x+i),this.pos),this.pos+=i,x+=i,this.pos===c&&(this.process(r,0),this.pos=0)}return this.length+=t.length,this.roundClean(),this}digestInto(t){I(this),N(t,this),this.finished=!0;let{buffer:r,view:n,blockLen:c,isLE:s}=this,{pos:x}=this;r[x++]=128,U(this.buffer.subarray(x)),this.padOffset>c-x&&(this.process(n,0),x=0);for(let a=x;a<c;a++)r[a]=0;c0(n,c-8,BigInt(this.length*8),s),this.process(n,0);let i=B(t),o=this.outputLen;if(o%4)throw new Error("_sha2: outputLen should be aligned to 32bit");let f=o/4,u=this.get();if(f>u.length)throw new Error("_sha2: outputLen bigger than state");for(let a=0;a<f;a++)i.setUint32(4*a,u[a],s)}digest(){let{buffer:t,outputLen:r}=this;this.digestInto(t);let n=t.slice(0,r);return this.destroy(),n}_cloneInto(t){t||(t=new this.constructor),t.set(...this.get());let{blockLen:r,buffer:n,length:c,finished:s,destroyed:x,pos:i}=this;return t.destroyed=x,t.finished=s,t.length=c,t.pos=i,c%r&&t.buffer.set(n),t}clone(){return this._cloneInto()}},h=Uint32Array.from([1779033703,3144134277,1013904242,2773480762,1359893119,2600822924,528734635,1541459225]),l=Uint32Array.from([3238371032,914150663,812702999,4144912697,4290775857,1750603025,1694076839,3204075428]);var s0=Uint32Array.from([1116352408,1899447441,3049323471,3921009573,961987163,1508970993,2453635748,2870763221,3624381080,310598401,607225278,1426881987,1925078388,2162078206,2614888103,3248222580,3835390401,4022224774,264347078,604807628,770255983,1249150122,1555081692,1996064986,2554220882,2821834349,2952996808,3210313671,3336571891,3584528711,113926993,338241895,666307205,773529912,1294757372,1396182291,1695183700,1986661051,2177026350,2456956037,2730485921,2820302411,3259730800,3345764771,3516065817,3600352804,4094571909,275423344,430227734,506948616,659060556,883997877,958139571,1322822218,1537002063,1747873779,1955562222,2024104815,2227730452,2361852424,2428436474,2756734187,3204031479,3329325298]),p=new Uint32Array(64),D=class extends E{constructor(t=32){super(64,t,8,!1),this.A=h[0]|0,this.B=h[1]|0,this.C=h[2]|0,this.D=h[3]|0,this.E=h[4]|0,this.F=h[5]|0,this.G=h[6]|0,this.H=h[7]|0}get(){let{A:t,B:r,C:n,D:c,E:s,F:x,G:i,H:o}=this;return[t,r,n,c,s,x,i,o]}set(t,r,n,c,s,x,i,o){this.A=t|0,this.B=r|0,this.C=n|0,this.D=c|0,this.E=s|0,this.F=x|0,this.G=i|0,this.H=o|0}process(t,r){for(let a=0;a<16;a++,r+=4)p[a]=t.getUint32(r,!1);for(let a=16;a<64;a++){let w=p[a-15],y=p[a-2],P=d(w,7)^d(w,18)^w>>>3,T=d(y,17)^d(y,19)^y>>>10;p[a]=T+p[a-7]+P+p[a-16]|0}let{A:n,B:c,C:s,D:x,E:i,F:o,G:f,H:u}=this;for(let a=0;a<64;a++){let w=d(i,6)^d(i,11)^d(i,25),y=u+w+J(i,o,f)+s0[a]+p[a]|0,T=(d(n,2)^d(n,13)^d(n,22))+R(n,c,s)|0;u=f,f=o,o=i,i=x+y|0,x=s,s=c,c=n,n=y+T|0}n=n+this.A|0,c=c+this.B|0,s=s+this.C|0,x=x+this.D|0,i=i+this.E|0,o=o+this.F|0,f=f+this.G|0,u=u+this.H|0,this.set(n,c,s,x,i,o,f,u)}roundClean(){U(p)}destroy(){this.set(0,0,0,0,0,0,0,0),U(this.buffer)}},F=class extends D{constructor(){super(28),this.A=l[0]|0,this.B=l[1]|0,this.C=l[2]|0,this.D=l[3]|0,this.E=l[4]|0,this.F=l[5]|0,this.G=l[6]|0,this.H=l[7]|0}};var q=W(()=>new F);var S="__principal__",x0=2,z=4,i0="aaaaa-aa",g=class e{static anonymous(){return new this(new Uint8Array([z]))}static managementCanister(){return this.fromText(i0)}static selfAuthenticating(t){let r=q(t);return new this(new Uint8Array([...r,x0]))}static from(t){if(typeof t=="string")return e.fromText(t);if(Object.getPrototypeOf(t)===Uint8Array.prototype)return new e(t);if(e.isPrincipal(t))return new e(t._arr);throw new Error(`Impossible to convert ${JSON.stringify(t)} to Principal.`)}static fromHex(t){return new this(M(t))}static fromText(t){let r=t;if(t.includes(S)){let x=JSON.parse(t);S in x&&(r=x[S])}let n=r.toLowerCase().replace(/-/g,""),c=k(n);c=c.slice(4,c.length);let s=new this(c);if(s.toText()!==r)throw new Error(`Principal "${s.toText()}" does not have a valid checksum (original value "${r}" may not be a valid Principal ID).`);return s}static fromUint8Array(t){return new this(t)}static isPrincipal(t){return t instanceof e||typeof t=="object"&&t!==null&&"_isPrincipal"in t&&t._isPrincipal===!0&&"_arr"in t&&t._arr instanceof Uint8Array}constructor(t){this._arr=t,this._isPrincipal=!0}isAnonymous(){return this._arr.byteLength===1&&this._arr[0]===z}toUint8Array(){return this._arr}toHex(){return j(this._arr).toUpperCase()}toText(){let t=new ArrayBuffer(4);new DataView(t).setUint32(0,O(this._arr));let n=new Uint8Array(t),c=new Uint8Array([...n,...this._arr]),x=G(c).match(/.{1,5}/g);if(!x)throw new Error;return x.join("-")}toString(){return this.toText()}toJSON(){return{[S]:this.toText()}}compareTo(t){for(let r=0;r<Math.min(this._arr.length,t._arr.length);r++){if(this._arr[r]<t._arr[r])return"lt";if(this._arr[r]>t._arr[r])return"gt"}return this._arr.length<t._arr.length?"lt":this._arr.length>t._arr.length?"gt":"eq"}ltEq(t){let r=this.compareTo(t);return r=="lt"||r=="eq"}gtEq(t){let r=this.compareTo(t);return r=="gt"||r=="eq"}};import*as L from"zod";import*as Y from"zod";var a0=(e=>(e.PrincipalText="PrincipalText",e.Principal="Principal",e.Uint8Array="Uint8Array",e.Url="Url",e))(a0||{}),X=K.instanceof(Uint8Array).meta({id:"Uint8Array"}),L0=L.string().refine(e=>{try{return g.fromText(e),!0}catch{return!1}},{error:"Invalid textual representation of a Principal."}).meta({id:"PrincipalText"}),$=L.custom().refine(e=>g.isPrincipal(e),{error:"Invalid Principal.",abort:!0}).transform(e=>g.from(e)).meta({id:"Principal"}),o0=({additionalProtocols:e=[],allowHttpLocally:t=!0})=>Y.url().refine(r=>{try{let n=[...new Set(["https:",...e])],{protocol:c,hostname:s}=new URL(r);return t&&["localhost","127.0.0.1"].includes(s)?["http:",...n].includes(c):n.includes(c)}catch{return!1}},{error:"Invalid URL."}),T0=o0({}).meta({id:"Url"});import*as f0 from"zod";var Z={principal:()=>$,uint8Array:()=>X},{union:D0,...d0}=f0,Q=Object.assign({},d0);Q.principal=Z.principal;Q.uint8Array=Z.uint8Array;export{Z as JunoType,$ as PrincipalSchema,L0 as PrincipalTextSchema,X as Uint8ArraySchema,T0 as UrlSchema,a0 as ZodSchemaId,o0 as createUrlSchema,Q as j};
|
|
2
2
|
/*! Bundled license information:
|
|
3
3
|
|
|
4
4
|
@noble/hashes/esm/utils.js:
|
package/index.js.map
CHANGED
|
@@ -1,7 +1,7 @@
|
|
|
1
1
|
{
|
|
2
2
|
"version": 3,
|
|
3
3
|
"sources": ["../../node_modules/@dfinity/zod-schemas/src/arrays.ts", "../../node_modules/@dfinity/zod-schemas/src/schema-id.ts", "../../node_modules/@dfinity/zod-schemas/src/principal.ts", "../../node_modules/@dfinity/zod-schemas/src/url.ts", "../../node_modules/@icp-sdk/core/src/principal/utils/base32.ts", "../../node_modules/@icp-sdk/core/src/principal/utils/getCrc.ts", "../../node_modules/@noble/hashes/src/utils.ts", "../../node_modules/@noble/hashes/src/_md.ts", "../../node_modules/@noble/hashes/src/sha2.ts", "../../node_modules/@icp-sdk/core/src/principal/principal.ts", "src/type-system/index.ts"],
|
|
4
|
-
"sourcesContent": ["import * as z from \"zod\";\nimport { ZodSchemaId } from \"./schema-id\";\n\n/**\n * Zod schema to validate a value is a `Uint8Array` instance.\n *\n * @example\n * ```typescript\n * const result = Uint8ArraySchema.safeParse(new Uint8Array([1, 2, 3]));\n * console.log(result.success); // true or false\n * ```\n */\nexport const Uint8ArraySchema = z\n .instanceof(Uint8Array)\n .meta({ id: ZodSchemaId.Uint8Array });\n", "/**\n * Enum of metadata `id` values assigned to Zod schemas in this library.\n */\nexport enum ZodSchemaId {\n /** Metadata id for {@link PrincipalTextSchema}. */\n PrincipalText = \"PrincipalText\",\n /** Metadata id for {@link PrincipalSchema}. */\n Principal = \"Principal\",\n /** Metadata id for {@link Uint8ArraySchema}. */\n Uint8Array = \"Uint8Array\",\n /** Metadata id for {@link UrlSchema}. */\n Url = \"Url\",\n}\n", "import { Principal } from \"@icp-sdk/core/principal\";\nimport * as z from \"zod\";\nimport { ZodSchemaId } from \"./schema-id\";\n\n/**\n * Zod schema to validate a string as a valid textual representation of a Principal.\n *\n * This schema checks if the provided string can be converted into a `Principal` instance.\n * If the conversion fails, validation will return an error message.\n *\n * @example\n * ```typescript\n * const result = PrincipalTextSchema.safeParse('aaaaa-aa');\n * console.log(result.success); // true or false\n * ```\n */\nexport const PrincipalTextSchema = z\n .string()\n .refine(\n (principal) => {\n try {\n Principal.fromText(principal);\n return true;\n } catch (_err: unknown) {\n return false;\n }\n },\n {\n error: \"Invalid textual representation of a Principal.\",\n },\n )\n .meta({ id: ZodSchemaId.PrincipalText });\n\nexport type PrincipalText = z.infer<typeof PrincipalTextSchema>;\n\n/**\n * Zod schema to validate and transform a value into a `Principal` instance.\n *\n * This schema checks if the provided value is an instance or an object representing\n * a `Principal` and transforms it into a valid `Principal` instance.\n *\n * @example\n * ```typescript\n * const result = PrincipalSchema.safeParse(Principal.fromText('aaaaa-aa'));\n * console.log(result.success); // true or false\n * ```\n */\nexport const PrincipalSchema = z\n .custom<Principal>()\n .refine((principal) => Principal.isPrincipal(principal), {\n error: \"Invalid Principal.\",\n abort: true,\n })\n .transform((value) => Principal.from(value))\n .meta({ id: ZodSchemaId.Principal });\n", "import * as z from \"zod\";\nimport { ZodSchemaId } from \"./schema-id\";\n\n/**\n * A URL protocol as template literal type.\n * Example: \"https:\" or \"ftp:\"\n */\nexport type UrlProtocol = `${string}:`;\n\n/**\n * Creates a Zod schema for validating URLs. By default, it validates that the URL protocol is HTTPS and allow usage of HTTP only locally.\n *\n * @param {Object} options - Configuration options for the schema.\n * @param {UrlProtocol[]} [options.additionalProtocols=[]] - Additional protocols to allow (e.g., \"wss:\" or \"ftp:\"). \u26A0\uFE0F Usage of insecure protocols is discouraged.\n * @param {boolean} [options.allowHttpLocally=true] - Whether to allow HTTP for localhost and 127.0.0.1. Default: true.\n * @returns {z.ZodEffects<z.ZodString, string, string>} - The Zod schema with URL validation.\n *\n * @example\n * const schema = createUrlSchema({\n * additionalProtocols: [\"wss:\"],\n * allowHttpLocally: false\n * });\n *\n * schema.parse(\"https://example.com\"); // Valid\n * schema.parse(\"wss://example.com\"); // Valid\n * schema.parse(\"http://localhost\"); // Invalid if allowHttpLocally is false\n */\nexport const createUrlSchema = ({\n additionalProtocols = [],\n allowHttpLocally = true,\n}: {\n additionalProtocols?: UrlProtocol[];\n allowHttpLocally?: boolean;\n}): z.ZodURL =>\n z.url().refine(\n (url: string | URL): boolean => {\n try {\n const protocols = [...new Set([\"https:\", ...additionalProtocols])];\n\n const { protocol, hostname } = new URL(url);\n\n // We allow http for development locally\n if (allowHttpLocally && [\"localhost\", \"127.0.0.1\"].includes(hostname)) {\n return [\"http:\", ...protocols].includes(protocol);\n }\n\n return protocols.includes(protocol);\n } catch (_err: unknown) {\n return false;\n }\n },\n {\n error: \"Invalid URL.\",\n },\n );\n\n/**\n * Default URL schema that enforces HTTPS and allows HTTP locally.\n *\n * @constant {z.ZodEffects<z.ZodString, string, string>}\n * @example\n * UrlSchema.parse(\"https://example.com\"); // Valid\n * UrlSchema.parse(\"http://127.0.0.1\"); // Valid (localhost exception)\n */\nexport const UrlSchema = createUrlSchema({}).meta({ id: ZodSchemaId.Url });\n", "const alphabet = 'abcdefghijklmnopqrstuvwxyz234567';\n\n// Build a lookup table for decoding.\nconst lookupTable: Record<string, number> = Object.create(null);\nfor (let i = 0; i < alphabet.length; i++) {\n lookupTable[alphabet[i]] = i;\n}\n\n// Add aliases for rfc4648.\nlookupTable['0'] = lookupTable.o;\nlookupTable['1'] = lookupTable.i;\n\n/**\n * @param input The Uint8Array to encode.\n * @returns A Base32 string encoding the input.\n */\nexport function base32Encode(input: Uint8Array): string {\n // How many bits will we skip from the first byte.\n let skip = 0;\n // 5 high bits, carry from one byte to the next.\n let bits = 0;\n\n // The output string in base32.\n let output = '';\n\n function encodeByte(byte: number) {\n if (skip < 0) {\n // we have a carry from the previous byte\n bits |= byte >> -skip;\n } else {\n // no carry\n bits = (byte << skip) & 248;\n }\n\n if (skip > 3) {\n // Not enough data to produce a character, get us another one\n skip -= 8;\n return 1;\n }\n\n if (skip < 4) {\n // produce a character\n output += alphabet[bits >> 3];\n skip += 5;\n }\n\n return 0;\n }\n\n for (let i = 0; i < input.length; ) {\n i += encodeByte(input[i]);\n }\n\n return output + (skip < 0 ? alphabet[bits >> 3] : '');\n}\n\n/**\n * @param input The base32 encoded string to decode.\n */\nexport function base32Decode(input: string): Uint8Array {\n // how many bits we have from the previous character.\n let skip = 0;\n // current byte we're producing.\n let byte = 0;\n\n const output = new Uint8Array(((input.length * 4) / 3) | 0);\n let o = 0;\n\n function decodeChar(char: string) {\n // Consume a character from the stream, store\n // the output in this.output. As before, better\n // to use update().\n let val = lookupTable[char.toLowerCase()];\n if (val === undefined) {\n throw new Error(`Invalid character: ${JSON.stringify(char)}`);\n }\n\n // move to the high bits\n val <<= 3;\n byte |= val >>> skip;\n skip += 5;\n\n if (skip >= 8) {\n // We have enough bytes to produce an output\n output[o++] = byte;\n skip -= 8;\n\n if (skip > 0) {\n byte = (val << (5 - skip)) & 255;\n } else {\n byte = 0;\n }\n }\n }\n\n for (const c of input) {\n decodeChar(c);\n }\n\n return output.slice(0, o);\n}\n", "// This file is translated to JavaScript from\n// https://lxp32.github.io/docs/a-simple-example-crc32-calculation/\nconst lookUpTable: Uint32Array = new Uint32Array([\n 0x00000000, 0x77073096, 0xee0e612c, 0x990951ba, 0x076dc419, 0x706af48f, 0xe963a535, 0x9e6495a3,\n 0x0edb8832, 0x79dcb8a4, 0xe0d5e91e, 0x97d2d988, 0x09b64c2b, 0x7eb17cbd, 0xe7b82d07, 0x90bf1d91,\n 0x1db71064, 0x6ab020f2, 0xf3b97148, 0x84be41de, 0x1adad47d, 0x6ddde4eb, 0xf4d4b551, 0x83d385c7,\n 0x136c9856, 0x646ba8c0, 0xfd62f97a, 0x8a65c9ec, 0x14015c4f, 0x63066cd9, 0xfa0f3d63, 0x8d080df5,\n 0x3b6e20c8, 0x4c69105e, 0xd56041e4, 0xa2677172, 0x3c03e4d1, 0x4b04d447, 0xd20d85fd, 0xa50ab56b,\n 0x35b5a8fa, 0x42b2986c, 0xdbbbc9d6, 0xacbcf940, 0x32d86ce3, 0x45df5c75, 0xdcd60dcf, 0xabd13d59,\n 0x26d930ac, 0x51de003a, 0xc8d75180, 0xbfd06116, 0x21b4f4b5, 0x56b3c423, 0xcfba9599, 0xb8bda50f,\n 0x2802b89e, 0x5f058808, 0xc60cd9b2, 0xb10be924, 0x2f6f7c87, 0x58684c11, 0xc1611dab, 0xb6662d3d,\n 0x76dc4190, 0x01db7106, 0x98d220bc, 0xefd5102a, 0x71b18589, 0x06b6b51f, 0x9fbfe4a5, 0xe8b8d433,\n 0x7807c9a2, 0x0f00f934, 0x9609a88e, 0xe10e9818, 0x7f6a0dbb, 0x086d3d2d, 0x91646c97, 0xe6635c01,\n 0x6b6b51f4, 0x1c6c6162, 0x856530d8, 0xf262004e, 0x6c0695ed, 0x1b01a57b, 0x8208f4c1, 0xf50fc457,\n 0x65b0d9c6, 0x12b7e950, 0x8bbeb8ea, 0xfcb9887c, 0x62dd1ddf, 0x15da2d49, 0x8cd37cf3, 0xfbd44c65,\n 0x4db26158, 0x3ab551ce, 0xa3bc0074, 0xd4bb30e2, 0x4adfa541, 0x3dd895d7, 0xa4d1c46d, 0xd3d6f4fb,\n 0x4369e96a, 0x346ed9fc, 0xad678846, 0xda60b8d0, 0x44042d73, 0x33031de5, 0xaa0a4c5f, 0xdd0d7cc9,\n 0x5005713c, 0x270241aa, 0xbe0b1010, 0xc90c2086, 0x5768b525, 0x206f85b3, 0xb966d409, 0xce61e49f,\n 0x5edef90e, 0x29d9c998, 0xb0d09822, 0xc7d7a8b4, 0x59b33d17, 0x2eb40d81, 0xb7bd5c3b, 0xc0ba6cad,\n 0xedb88320, 0x9abfb3b6, 0x03b6e20c, 0x74b1d29a, 0xead54739, 0x9dd277af, 0x04db2615, 0x73dc1683,\n 0xe3630b12, 0x94643b84, 0x0d6d6a3e, 0x7a6a5aa8, 0xe40ecf0b, 0x9309ff9d, 0x0a00ae27, 0x7d079eb1,\n 0xf00f9344, 0x8708a3d2, 0x1e01f268, 0x6906c2fe, 0xf762575d, 0x806567cb, 0x196c3671, 0x6e6b06e7,\n 0xfed41b76, 0x89d32be0, 0x10da7a5a, 0x67dd4acc, 0xf9b9df6f, 0x8ebeeff9, 0x17b7be43, 0x60b08ed5,\n 0xd6d6a3e8, 0xa1d1937e, 0x38d8c2c4, 0x4fdff252, 0xd1bb67f1, 0xa6bc5767, 0x3fb506dd, 0x48b2364b,\n 0xd80d2bda, 0xaf0a1b4c, 0x36034af6, 0x41047a60, 0xdf60efc3, 0xa867df55, 0x316e8eef, 0x4669be79,\n 0xcb61b38c, 0xbc66831a, 0x256fd2a0, 0x5268e236, 0xcc0c7795, 0xbb0b4703, 0x220216b9, 0x5505262f,\n 0xc5ba3bbe, 0xb2bd0b28, 0x2bb45a92, 0x5cb36a04, 0xc2d7ffa7, 0xb5d0cf31, 0x2cd99e8b, 0x5bdeae1d,\n 0x9b64c2b0, 0xec63f226, 0x756aa39c, 0x026d930a, 0x9c0906a9, 0xeb0e363f, 0x72076785, 0x05005713,\n 0x95bf4a82, 0xe2b87a14, 0x7bb12bae, 0x0cb61b38, 0x92d28e9b, 0xe5d5be0d, 0x7cdcefb7, 0x0bdbdf21,\n 0x86d3d2d4, 0xf1d4e242, 0x68ddb3f8, 0x1fda836e, 0x81be16cd, 0xf6b9265b, 0x6fb077e1, 0x18b74777,\n 0x88085ae6, 0xff0f6a70, 0x66063bca, 0x11010b5c, 0x8f659eff, 0xf862ae69, 0x616bffd3, 0x166ccf45,\n 0xa00ae278, 0xd70dd2ee, 0x4e048354, 0x3903b3c2, 0xa7672661, 0xd06016f7, 0x4969474d, 0x3e6e77db,\n 0xaed16a4a, 0xd9d65adc, 0x40df0b66, 0x37d83bf0, 0xa9bcae53, 0xdebb9ec5, 0x47b2cf7f, 0x30b5ffe9,\n 0xbdbdf21c, 0xcabac28a, 0x53b39330, 0x24b4a3a6, 0xbad03605, 0xcdd70693, 0x54de5729, 0x23d967bf,\n 0xb3667a2e, 0xc4614ab8, 0x5d681b02, 0x2a6f2b94, 0xb40bbe37, 0xc30c8ea1, 0x5a05df1b, 0x2d02ef8d,\n]);\n\n/**\n * Calculate the CRC32 of a Uint8Array.\n * @param buf The Uint8Array to calculate the CRC32 of.\n */\nexport function getCrc32(buf: Uint8Array): number {\n let crc = -1;\n\n for (let i = 0; i < buf.length; i++) {\n const byte = buf[i];\n const t = (byte ^ crc) & 0xff;\n crc = lookUpTable[t] ^ (crc >>> 8);\n }\n\n return (crc ^ -1) >>> 0;\n}\n", "/**\n * Utilities for hex, bytes, CSPRNG.\n * @module\n */\n/*! noble-hashes - MIT License (c) 2022 Paul Miller (paulmillr.com) */\n\n// We use WebCrypto aka globalThis.crypto, which exists in browsers and node.js 16+.\n// node.js versions earlier than v19 don't declare it in global scope.\n// For node.js, package.json#exports field mapping rewrites import\n// from `crypto` to `cryptoNode`, which imports native module.\n// Makes the utils un-importable in browsers without a bundler.\n// Once node.js 18 is deprecated (2025-04-30), we can just drop the import.\nimport { crypto } from '@noble/hashes/crypto';\n\n/** Checks if something is Uint8Array. Be careful: nodejs Buffer will return true. */\nexport function isBytes(a: unknown): a is Uint8Array {\n return a instanceof Uint8Array || (ArrayBuffer.isView(a) && a.constructor.name === 'Uint8Array');\n}\n\n/** Asserts something is positive integer. */\nexport function anumber(n: number): void {\n if (!Number.isSafeInteger(n) || n < 0) throw new Error('positive integer expected, got ' + n);\n}\n\n/** Asserts something is Uint8Array. */\nexport function abytes(b: Uint8Array | undefined, ...lengths: number[]): void {\n if (!isBytes(b)) throw new Error('Uint8Array expected');\n if (lengths.length > 0 && !lengths.includes(b.length))\n throw new Error('Uint8Array expected of length ' + lengths + ', got length=' + b.length);\n}\n\n/** Asserts something is hash */\nexport function ahash(h: IHash): void {\n if (typeof h !== 'function' || typeof h.create !== 'function')\n throw new Error('Hash should be wrapped by utils.createHasher');\n anumber(h.outputLen);\n anumber(h.blockLen);\n}\n\n/** Asserts a hash instance has not been destroyed / finished */\nexport function aexists(instance: any, checkFinished = true): void {\n if (instance.destroyed) throw new Error('Hash instance has been destroyed');\n if (checkFinished && instance.finished) throw new Error('Hash#digest() has already been called');\n}\n\n/** Asserts output is properly-sized byte array */\nexport function aoutput(out: any, instance: any): void {\n abytes(out);\n const min = instance.outputLen;\n if (out.length < min) {\n throw new Error('digestInto() expects output buffer of length at least ' + min);\n }\n}\n\n/** Generic type encompassing 8/16/32-byte arrays - but not 64-byte. */\n// prettier-ignore\nexport type TypedArray = Int8Array | Uint8ClampedArray | Uint8Array |\n Uint16Array | Int16Array | Uint32Array | Int32Array;\n\n/** Cast u8 / u16 / u32 to u8. */\nexport function u8(arr: TypedArray): Uint8Array {\n return new Uint8Array(arr.buffer, arr.byteOffset, arr.byteLength);\n}\n\n/** Cast u8 / u16 / u32 to u32. */\nexport function u32(arr: TypedArray): Uint32Array {\n return new Uint32Array(arr.buffer, arr.byteOffset, Math.floor(arr.byteLength / 4));\n}\n\n/** Zeroize a byte array. Warning: JS provides no guarantees. */\nexport function clean(...arrays: TypedArray[]): void {\n for (let i = 0; i < arrays.length; i++) {\n arrays[i].fill(0);\n }\n}\n\n/** Create DataView of an array for easy byte-level manipulation. */\nexport function createView(arr: TypedArray): DataView {\n return new DataView(arr.buffer, arr.byteOffset, arr.byteLength);\n}\n\n/** The rotate right (circular right shift) operation for uint32 */\nexport function rotr(word: number, shift: number): number {\n return (word << (32 - shift)) | (word >>> shift);\n}\n\n/** The rotate left (circular left shift) operation for uint32 */\nexport function rotl(word: number, shift: number): number {\n return (word << shift) | ((word >>> (32 - shift)) >>> 0);\n}\n\n/** Is current platform little-endian? Most are. Big-Endian platform: IBM */\nexport const isLE: boolean = /* @__PURE__ */ (() =>\n new Uint8Array(new Uint32Array([0x11223344]).buffer)[0] === 0x44)();\n\n/** The byte swap operation for uint32 */\nexport function byteSwap(word: number): number {\n return (\n ((word << 24) & 0xff000000) |\n ((word << 8) & 0xff0000) |\n ((word >>> 8) & 0xff00) |\n ((word >>> 24) & 0xff)\n );\n}\n/** Conditionally byte swap if on a big-endian platform */\nexport const swap8IfBE: (n: number) => number = isLE\n ? (n: number) => n\n : (n: number) => byteSwap(n);\n\n/** @deprecated */\nexport const byteSwapIfBE: typeof swap8IfBE = swap8IfBE;\n/** In place byte swap for Uint32Array */\nexport function byteSwap32(arr: Uint32Array): Uint32Array {\n for (let i = 0; i < arr.length; i++) {\n arr[i] = byteSwap(arr[i]);\n }\n return arr;\n}\n\nexport const swap32IfBE: (u: Uint32Array) => Uint32Array = isLE\n ? (u: Uint32Array) => u\n : byteSwap32;\n\n// Built-in hex conversion https://caniuse.com/mdn-javascript_builtins_uint8array_fromhex\nconst hasHexBuiltin: boolean = /* @__PURE__ */ (() =>\n // @ts-ignore\n typeof Uint8Array.from([]).toHex === 'function' && typeof Uint8Array.fromHex === 'function')();\n\n// Array where index 0xf0 (240) is mapped to string 'f0'\nconst hexes = /* @__PURE__ */ Array.from({ length: 256 }, (_, i) =>\n i.toString(16).padStart(2, '0')\n);\n\n/**\n * Convert byte array to hex string. Uses built-in function, when available.\n * @example bytesToHex(Uint8Array.from([0xca, 0xfe, 0x01, 0x23])) // 'cafe0123'\n */\nexport function bytesToHex(bytes: Uint8Array): string {\n abytes(bytes);\n // @ts-ignore\n if (hasHexBuiltin) return bytes.toHex();\n // pre-caching improves the speed 6x\n let hex = '';\n for (let i = 0; i < bytes.length; i++) {\n hex += hexes[bytes[i]];\n }\n return hex;\n}\n\n// We use optimized technique to convert hex string to byte array\nconst asciis = { _0: 48, _9: 57, A: 65, F: 70, a: 97, f: 102 } as const;\nfunction asciiToBase16(ch: number): number | undefined {\n if (ch >= asciis._0 && ch <= asciis._9) return ch - asciis._0; // '2' => 50-48\n if (ch >= asciis.A && ch <= asciis.F) return ch - (asciis.A - 10); // 'B' => 66-(65-10)\n if (ch >= asciis.a && ch <= asciis.f) return ch - (asciis.a - 10); // 'b' => 98-(97-10)\n return;\n}\n\n/**\n * Convert hex string to byte array. Uses built-in function, when available.\n * @example hexToBytes('cafe0123') // Uint8Array.from([0xca, 0xfe, 0x01, 0x23])\n */\nexport function hexToBytes(hex: string): Uint8Array {\n if (typeof hex !== 'string') throw new Error('hex string expected, got ' + typeof hex);\n // @ts-ignore\n if (hasHexBuiltin) return Uint8Array.fromHex(hex);\n const hl = hex.length;\n const al = hl / 2;\n if (hl % 2) throw new Error('hex string expected, got unpadded hex of length ' + hl);\n const array = new Uint8Array(al);\n for (let ai = 0, hi = 0; ai < al; ai++, hi += 2) {\n const n1 = asciiToBase16(hex.charCodeAt(hi));\n const n2 = asciiToBase16(hex.charCodeAt(hi + 1));\n if (n1 === undefined || n2 === undefined) {\n const char = hex[hi] + hex[hi + 1];\n throw new Error('hex string expected, got non-hex character \"' + char + '\" at index ' + hi);\n }\n array[ai] = n1 * 16 + n2; // multiply first octet, e.g. 'a3' => 10*16+3 => 160 + 3 => 163\n }\n return array;\n}\n\n/**\n * There is no setImmediate in browser and setTimeout is slow.\n * Call of async fn will return Promise, which will be fullfiled only on\n * next scheduler queue processing step and this is exactly what we need.\n */\nexport const nextTick = async (): Promise<void> => {};\n\n/** Returns control to thread each 'tick' ms to avoid blocking. */\nexport async function asyncLoop(\n iters: number,\n tick: number,\n cb: (i: number) => void\n): Promise<void> {\n let ts = Date.now();\n for (let i = 0; i < iters; i++) {\n cb(i);\n // Date.now() is not monotonic, so in case if clock goes backwards we return return control too\n const diff = Date.now() - ts;\n if (diff >= 0 && diff < tick) continue;\n await nextTick();\n ts += diff;\n }\n}\n\n// Global symbols, but ts doesn't see them: https://github.com/microsoft/TypeScript/issues/31535\ndeclare const TextEncoder: any;\ndeclare const TextDecoder: any;\n\n/**\n * Converts string to bytes using UTF8 encoding.\n * @example utf8ToBytes('abc') // Uint8Array.from([97, 98, 99])\n */\nexport function utf8ToBytes(str: string): Uint8Array {\n if (typeof str !== 'string') throw new Error('string expected');\n return new Uint8Array(new TextEncoder().encode(str)); // https://bugzil.la/1681809\n}\n\n/**\n * Converts bytes to string using UTF8 encoding.\n * @example bytesToUtf8(Uint8Array.from([97, 98, 99])) // 'abc'\n */\nexport function bytesToUtf8(bytes: Uint8Array): string {\n return new TextDecoder().decode(bytes);\n}\n\n/** Accepted input of hash functions. Strings are converted to byte arrays. */\nexport type Input = string | Uint8Array;\n/**\n * Normalizes (non-hex) string or Uint8Array to Uint8Array.\n * Warning: when Uint8Array is passed, it would NOT get copied.\n * Keep in mind for future mutable operations.\n */\nexport function toBytes(data: Input): Uint8Array {\n if (typeof data === 'string') data = utf8ToBytes(data);\n abytes(data);\n return data;\n}\n\n/** KDFs can accept string or Uint8Array for user convenience. */\nexport type KDFInput = string | Uint8Array;\n/**\n * Helper for KDFs: consumes uint8array or string.\n * When string is passed, does utf8 decoding, using TextDecoder.\n */\nexport function kdfInputToBytes(data: KDFInput): Uint8Array {\n if (typeof data === 'string') data = utf8ToBytes(data);\n abytes(data);\n return data;\n}\n\n/** Copies several Uint8Arrays into one. */\nexport function concatBytes(...arrays: Uint8Array[]): Uint8Array {\n let sum = 0;\n for (let i = 0; i < arrays.length; i++) {\n const a = arrays[i];\n abytes(a);\n sum += a.length;\n }\n const res = new Uint8Array(sum);\n for (let i = 0, pad = 0; i < arrays.length; i++) {\n const a = arrays[i];\n res.set(a, pad);\n pad += a.length;\n }\n return res;\n}\n\ntype EmptyObj = {};\nexport function checkOpts<T1 extends EmptyObj, T2 extends EmptyObj>(\n defaults: T1,\n opts?: T2\n): T1 & T2 {\n if (opts !== undefined && {}.toString.call(opts) !== '[object Object]')\n throw new Error('options should be object or undefined');\n const merged = Object.assign(defaults, opts);\n return merged as T1 & T2;\n}\n\n/** Hash interface. */\nexport type IHash = {\n (data: Uint8Array): Uint8Array;\n blockLen: number;\n outputLen: number;\n create: any;\n};\n\n/** For runtime check if class implements interface */\nexport abstract class Hash<T extends Hash<T>> {\n abstract blockLen: number; // Bytes per block\n abstract outputLen: number; // Bytes in output\n abstract update(buf: Input): this;\n // Writes digest into buf\n abstract digestInto(buf: Uint8Array): void;\n abstract digest(): Uint8Array;\n /**\n * Resets internal state. Makes Hash instance unusable.\n * Reset is impossible for keyed hashes if key is consumed into state. If digest is not consumed\n * by user, they will need to manually call `destroy()` when zeroing is necessary.\n */\n abstract destroy(): void;\n /**\n * Clones hash instance. Unsafe: doesn't check whether `to` is valid. Can be used as `clone()`\n * when no options are passed.\n * Reasons to use `_cloneInto` instead of clone: 1) performance 2) reuse instance => all internal\n * buffers are overwritten => causes buffer overwrite which is used for digest in some cases.\n * There are no guarantees for clean-up because it's impossible in JS.\n */\n abstract _cloneInto(to?: T): T;\n // Safe version that clones internal state\n abstract clone(): T;\n}\n\n/**\n * XOF: streaming API to read digest in chunks.\n * Same as 'squeeze' in keccak/k12 and 'seek' in blake3, but more generic name.\n * When hash used in XOF mode it is up to user to call '.destroy' afterwards, since we cannot\n * destroy state, next call can require more bytes.\n */\nexport type HashXOF<T extends Hash<T>> = Hash<T> & {\n xof(bytes: number): Uint8Array; // Read 'bytes' bytes from digest stream\n xofInto(buf: Uint8Array): Uint8Array; // read buf.length bytes from digest stream into buf\n};\n\n/** Hash function */\nexport type CHash = ReturnType<typeof createHasher>;\n/** Hash function with output */\nexport type CHashO = ReturnType<typeof createOptHasher>;\n/** XOF with output */\nexport type CHashXO = ReturnType<typeof createXOFer>;\n\n/** Wraps hash function, creating an interface on top of it */\nexport function createHasher<T extends Hash<T>>(\n hashCons: () => Hash<T>\n): {\n (msg: Input): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(): Hash<T>;\n} {\n const hashC = (msg: Input): Uint8Array => hashCons().update(toBytes(msg)).digest();\n const tmp = hashCons();\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = () => hashCons();\n return hashC;\n}\n\nexport function createOptHasher<H extends Hash<H>, T extends Object>(\n hashCons: (opts?: T) => Hash<H>\n): {\n (msg: Input, opts?: T): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(opts?: T): Hash<H>;\n} {\n const hashC = (msg: Input, opts?: T): Uint8Array => hashCons(opts).update(toBytes(msg)).digest();\n const tmp = hashCons({} as T);\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = (opts?: T) => hashCons(opts);\n return hashC;\n}\n\nexport function createXOFer<H extends HashXOF<H>, T extends Object>(\n hashCons: (opts?: T) => HashXOF<H>\n): {\n (msg: Input, opts?: T): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(opts?: T): HashXOF<H>;\n} {\n const hashC = (msg: Input, opts?: T): Uint8Array => hashCons(opts).update(toBytes(msg)).digest();\n const tmp = hashCons({} as T);\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = (opts?: T) => hashCons(opts);\n return hashC;\n}\nexport const wrapConstructor: typeof createHasher = createHasher;\nexport const wrapConstructorWithOpts: typeof createOptHasher = createOptHasher;\nexport const wrapXOFConstructorWithOpts: typeof createXOFer = createXOFer;\n\n/** Cryptographically secure PRNG. Uses internal OS-level `crypto.getRandomValues`. */\nexport function randomBytes(bytesLength = 32): Uint8Array {\n if (crypto && typeof crypto.getRandomValues === 'function') {\n return crypto.getRandomValues(new Uint8Array(bytesLength));\n }\n // Legacy Node.js compatibility\n if (crypto && typeof crypto.randomBytes === 'function') {\n return Uint8Array.from(crypto.randomBytes(bytesLength));\n }\n throw new Error('crypto.getRandomValues must be defined');\n}\n", "/**\n * Internal Merkle-Damgard hash utils.\n * @module\n */\nimport { type Input, Hash, abytes, aexists, aoutput, clean, createView, toBytes } from './utils.ts';\n\n/** Polyfill for Safari 14. https://caniuse.com/mdn-javascript_builtins_dataview_setbiguint64 */\nexport function setBigUint64(\n view: DataView,\n byteOffset: number,\n value: bigint,\n isLE: boolean\n): void {\n if (typeof view.setBigUint64 === 'function') return view.setBigUint64(byteOffset, value, isLE);\n const _32n = BigInt(32);\n const _u32_max = BigInt(0xffffffff);\n const wh = Number((value >> _32n) & _u32_max);\n const wl = Number(value & _u32_max);\n const h = isLE ? 4 : 0;\n const l = isLE ? 0 : 4;\n view.setUint32(byteOffset + h, wh, isLE);\n view.setUint32(byteOffset + l, wl, isLE);\n}\n\n/** Choice: a ? b : c */\nexport function Chi(a: number, b: number, c: number): number {\n return (a & b) ^ (~a & c);\n}\n\n/** Majority function, true if any two inputs is true. */\nexport function Maj(a: number, b: number, c: number): number {\n return (a & b) ^ (a & c) ^ (b & c);\n}\n\n/**\n * Merkle-Damgard hash construction base class.\n * Could be used to create MD5, RIPEMD, SHA1, SHA2.\n */\nexport abstract class HashMD<T extends HashMD<T>> extends Hash<T> {\n protected abstract process(buf: DataView, offset: number): void;\n protected abstract get(): number[];\n protected abstract set(...args: number[]): void;\n abstract destroy(): void;\n protected abstract roundClean(): void;\n\n readonly blockLen: number;\n readonly outputLen: number;\n readonly padOffset: number;\n readonly isLE: boolean;\n\n // For partial updates less than block size\n protected buffer: Uint8Array;\n protected view: DataView;\n protected finished = false;\n protected length = 0;\n protected pos = 0;\n protected destroyed = false;\n\n constructor(blockLen: number, outputLen: number, padOffset: number, isLE: boolean) {\n super();\n this.blockLen = blockLen;\n this.outputLen = outputLen;\n this.padOffset = padOffset;\n this.isLE = isLE;\n this.buffer = new Uint8Array(blockLen);\n this.view = createView(this.buffer);\n }\n update(data: Input): this {\n aexists(this);\n data = toBytes(data);\n abytes(data);\n const { view, buffer, blockLen } = this;\n const len = data.length;\n for (let pos = 0; pos < len; ) {\n const take = Math.min(blockLen - this.pos, len - pos);\n // Fast path: we have at least one block in input, cast it to view and process\n if (take === blockLen) {\n const dataView = createView(data);\n for (; blockLen <= len - pos; pos += blockLen) this.process(dataView, pos);\n continue;\n }\n buffer.set(data.subarray(pos, pos + take), this.pos);\n this.pos += take;\n pos += take;\n if (this.pos === blockLen) {\n this.process(view, 0);\n this.pos = 0;\n }\n }\n this.length += data.length;\n this.roundClean();\n return this;\n }\n digestInto(out: Uint8Array): void {\n aexists(this);\n aoutput(out, this);\n this.finished = true;\n // Padding\n // We can avoid allocation of buffer for padding completely if it\n // was previously not allocated here. But it won't change performance.\n const { buffer, view, blockLen, isLE } = this;\n let { pos } = this;\n // append the bit '1' to the message\n buffer[pos++] = 0b10000000;\n clean(this.buffer.subarray(pos));\n // we have less than padOffset left in buffer, so we cannot put length in\n // current block, need process it and pad again\n if (this.padOffset > blockLen - pos) {\n this.process(view, 0);\n pos = 0;\n }\n // Pad until full block byte with zeros\n for (let i = pos; i < blockLen; i++) buffer[i] = 0;\n // Note: sha512 requires length to be 128bit integer, but length in JS will overflow before that\n // You need to write around 2 exabytes (u64_max / 8 / (1024**6)) for this to happen.\n // So we just write lowest 64 bits of that value.\n setBigUint64(view, blockLen - 8, BigInt(this.length * 8), isLE);\n this.process(view, 0);\n const oview = createView(out);\n const len = this.outputLen;\n // NOTE: we do division by 4 later, which should be fused in single op with modulo by JIT\n if (len % 4) throw new Error('_sha2: outputLen should be aligned to 32bit');\n const outLen = len / 4;\n const state = this.get();\n if (outLen > state.length) throw new Error('_sha2: outputLen bigger than state');\n for (let i = 0; i < outLen; i++) oview.setUint32(4 * i, state[i], isLE);\n }\n digest(): Uint8Array {\n const { buffer, outputLen } = this;\n this.digestInto(buffer);\n const res = buffer.slice(0, outputLen);\n this.destroy();\n return res;\n }\n _cloneInto(to?: T): T {\n to ||= new (this.constructor as any)() as T;\n to.set(...this.get());\n const { blockLen, buffer, length, finished, destroyed, pos } = this;\n to.destroyed = destroyed;\n to.finished = finished;\n to.length = length;\n to.pos = pos;\n if (length % blockLen) to.buffer.set(buffer);\n return to;\n }\n clone(): T {\n return this._cloneInto();\n }\n}\n\n/**\n * Initial SHA-2 state: fractional parts of square roots of first 16 primes 2..53.\n * Check out `test/misc/sha2-gen-iv.js` for recomputation guide.\n */\n\n/** Initial SHA256 state. Bits 0..32 of frac part of sqrt of primes 2..19 */\nexport const SHA256_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0x6a09e667, 0xbb67ae85, 0x3c6ef372, 0xa54ff53a, 0x510e527f, 0x9b05688c, 0x1f83d9ab, 0x5be0cd19,\n]);\n\n/** Initial SHA224 state. Bits 32..64 of frac part of sqrt of primes 23..53 */\nexport const SHA224_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0xc1059ed8, 0x367cd507, 0x3070dd17, 0xf70e5939, 0xffc00b31, 0x68581511, 0x64f98fa7, 0xbefa4fa4,\n]);\n\n/** Initial SHA384 state. Bits 0..64 of frac part of sqrt of primes 23..53 */\nexport const SHA384_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0xcbbb9d5d, 0xc1059ed8, 0x629a292a, 0x367cd507, 0x9159015a, 0x3070dd17, 0x152fecd8, 0xf70e5939,\n 0x67332667, 0xffc00b31, 0x8eb44a87, 0x68581511, 0xdb0c2e0d, 0x64f98fa7, 0x47b5481d, 0xbefa4fa4,\n]);\n\n/** Initial SHA512 state. Bits 0..64 of frac part of sqrt of primes 2..19 */\nexport const SHA512_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0x6a09e667, 0xf3bcc908, 0xbb67ae85, 0x84caa73b, 0x3c6ef372, 0xfe94f82b, 0xa54ff53a, 0x5f1d36f1,\n 0x510e527f, 0xade682d1, 0x9b05688c, 0x2b3e6c1f, 0x1f83d9ab, 0xfb41bd6b, 0x5be0cd19, 0x137e2179,\n]);\n", "/**\n * SHA2 hash function. A.k.a. sha256, sha384, sha512, sha512_224, sha512_256.\n * SHA256 is the fastest hash implementable in JS, even faster than Blake3.\n * Check out [RFC 4634](https://datatracker.ietf.org/doc/html/rfc4634) and\n * [FIPS 180-4](https://nvlpubs.nist.gov/nistpubs/FIPS/NIST.FIPS.180-4.pdf).\n * @module\n */\nimport { Chi, HashMD, Maj, SHA224_IV, SHA256_IV, SHA384_IV, SHA512_IV } from './_md.ts';\nimport * as u64 from './_u64.ts';\nimport { type CHash, clean, createHasher, rotr } from './utils.ts';\n\n/**\n * Round constants:\n * First 32 bits of fractional parts of the cube roots of the first 64 primes 2..311)\n */\n// prettier-ignore\nconst SHA256_K = /* @__PURE__ */ Uint32Array.from([\n 0x428a2f98, 0x71374491, 0xb5c0fbcf, 0xe9b5dba5, 0x3956c25b, 0x59f111f1, 0x923f82a4, 0xab1c5ed5,\n 0xd807aa98, 0x12835b01, 0x243185be, 0x550c7dc3, 0x72be5d74, 0x80deb1fe, 0x9bdc06a7, 0xc19bf174,\n 0xe49b69c1, 0xefbe4786, 0x0fc19dc6, 0x240ca1cc, 0x2de92c6f, 0x4a7484aa, 0x5cb0a9dc, 0x76f988da,\n 0x983e5152, 0xa831c66d, 0xb00327c8, 0xbf597fc7, 0xc6e00bf3, 0xd5a79147, 0x06ca6351, 0x14292967,\n 0x27b70a85, 0x2e1b2138, 0x4d2c6dfc, 0x53380d13, 0x650a7354, 0x766a0abb, 0x81c2c92e, 0x92722c85,\n 0xa2bfe8a1, 0xa81a664b, 0xc24b8b70, 0xc76c51a3, 0xd192e819, 0xd6990624, 0xf40e3585, 0x106aa070,\n 0x19a4c116, 0x1e376c08, 0x2748774c, 0x34b0bcb5, 0x391c0cb3, 0x4ed8aa4a, 0x5b9cca4f, 0x682e6ff3,\n 0x748f82ee, 0x78a5636f, 0x84c87814, 0x8cc70208, 0x90befffa, 0xa4506ceb, 0xbef9a3f7, 0xc67178f2\n]);\n\n/** Reusable temporary buffer. \"W\" comes straight from spec. */\nconst SHA256_W = /* @__PURE__ */ new Uint32Array(64);\nexport class SHA256 extends HashMD<SHA256> {\n // We cannot use array here since array allows indexing by variable\n // which means optimizer/compiler cannot use registers.\n protected A: number = SHA256_IV[0] | 0;\n protected B: number = SHA256_IV[1] | 0;\n protected C: number = SHA256_IV[2] | 0;\n protected D: number = SHA256_IV[3] | 0;\n protected E: number = SHA256_IV[4] | 0;\n protected F: number = SHA256_IV[5] | 0;\n protected G: number = SHA256_IV[6] | 0;\n protected H: number = SHA256_IV[7] | 0;\n\n constructor(outputLen: number = 32) {\n super(64, outputLen, 8, false);\n }\n protected get(): [number, number, number, number, number, number, number, number] {\n const { A, B, C, D, E, F, G, H } = this;\n return [A, B, C, D, E, F, G, H];\n }\n // prettier-ignore\n protected set(\n A: number, B: number, C: number, D: number, E: number, F: number, G: number, H: number\n ): void {\n this.A = A | 0;\n this.B = B | 0;\n this.C = C | 0;\n this.D = D | 0;\n this.E = E | 0;\n this.F = F | 0;\n this.G = G | 0;\n this.H = H | 0;\n }\n protected process(view: DataView, offset: number): void {\n // Extend the first 16 words into the remaining 48 words w[16..63] of the message schedule array\n for (let i = 0; i < 16; i++, offset += 4) SHA256_W[i] = view.getUint32(offset, false);\n for (let i = 16; i < 64; i++) {\n const W15 = SHA256_W[i - 15];\n const W2 = SHA256_W[i - 2];\n const s0 = rotr(W15, 7) ^ rotr(W15, 18) ^ (W15 >>> 3);\n const s1 = rotr(W2, 17) ^ rotr(W2, 19) ^ (W2 >>> 10);\n SHA256_W[i] = (s1 + SHA256_W[i - 7] + s0 + SHA256_W[i - 16]) | 0;\n }\n // Compression function main loop, 64 rounds\n let { A, B, C, D, E, F, G, H } = this;\n for (let i = 0; i < 64; i++) {\n const sigma1 = rotr(E, 6) ^ rotr(E, 11) ^ rotr(E, 25);\n const T1 = (H + sigma1 + Chi(E, F, G) + SHA256_K[i] + SHA256_W[i]) | 0;\n const sigma0 = rotr(A, 2) ^ rotr(A, 13) ^ rotr(A, 22);\n const T2 = (sigma0 + Maj(A, B, C)) | 0;\n H = G;\n G = F;\n F = E;\n E = (D + T1) | 0;\n D = C;\n C = B;\n B = A;\n A = (T1 + T2) | 0;\n }\n // Add the compressed chunk to the current hash value\n A = (A + this.A) | 0;\n B = (B + this.B) | 0;\n C = (C + this.C) | 0;\n D = (D + this.D) | 0;\n E = (E + this.E) | 0;\n F = (F + this.F) | 0;\n G = (G + this.G) | 0;\n H = (H + this.H) | 0;\n this.set(A, B, C, D, E, F, G, H);\n }\n protected roundClean(): void {\n clean(SHA256_W);\n }\n destroy(): void {\n this.set(0, 0, 0, 0, 0, 0, 0, 0);\n clean(this.buffer);\n }\n}\n\nexport class SHA224 extends SHA256 {\n protected A: number = SHA224_IV[0] | 0;\n protected B: number = SHA224_IV[1] | 0;\n protected C: number = SHA224_IV[2] | 0;\n protected D: number = SHA224_IV[3] | 0;\n protected E: number = SHA224_IV[4] | 0;\n protected F: number = SHA224_IV[5] | 0;\n protected G: number = SHA224_IV[6] | 0;\n protected H: number = SHA224_IV[7] | 0;\n constructor() {\n super(28);\n }\n}\n\n// SHA2-512 is slower than sha256 in js because u64 operations are slow.\n\n// Round contants\n// First 32 bits of the fractional parts of the cube roots of the first 80 primes 2..409\n// prettier-ignore\nconst K512 = /* @__PURE__ */ (() => u64.split([\n '0x428a2f98d728ae22', '0x7137449123ef65cd', '0xb5c0fbcfec4d3b2f', '0xe9b5dba58189dbbc',\n '0x3956c25bf348b538', '0x59f111f1b605d019', '0x923f82a4af194f9b', '0xab1c5ed5da6d8118',\n '0xd807aa98a3030242', '0x12835b0145706fbe', '0x243185be4ee4b28c', '0x550c7dc3d5ffb4e2',\n '0x72be5d74f27b896f', '0x80deb1fe3b1696b1', '0x9bdc06a725c71235', '0xc19bf174cf692694',\n '0xe49b69c19ef14ad2', '0xefbe4786384f25e3', '0x0fc19dc68b8cd5b5', '0x240ca1cc77ac9c65',\n '0x2de92c6f592b0275', '0x4a7484aa6ea6e483', '0x5cb0a9dcbd41fbd4', '0x76f988da831153b5',\n '0x983e5152ee66dfab', '0xa831c66d2db43210', '0xb00327c898fb213f', '0xbf597fc7beef0ee4',\n '0xc6e00bf33da88fc2', '0xd5a79147930aa725', '0x06ca6351e003826f', '0x142929670a0e6e70',\n '0x27b70a8546d22ffc', '0x2e1b21385c26c926', '0x4d2c6dfc5ac42aed', '0x53380d139d95b3df',\n '0x650a73548baf63de', '0x766a0abb3c77b2a8', '0x81c2c92e47edaee6', '0x92722c851482353b',\n '0xa2bfe8a14cf10364', '0xa81a664bbc423001', '0xc24b8b70d0f89791', '0xc76c51a30654be30',\n '0xd192e819d6ef5218', '0xd69906245565a910', '0xf40e35855771202a', '0x106aa07032bbd1b8',\n '0x19a4c116b8d2d0c8', '0x1e376c085141ab53', '0x2748774cdf8eeb99', '0x34b0bcb5e19b48a8',\n '0x391c0cb3c5c95a63', '0x4ed8aa4ae3418acb', '0x5b9cca4f7763e373', '0x682e6ff3d6b2b8a3',\n '0x748f82ee5defb2fc', '0x78a5636f43172f60', '0x84c87814a1f0ab72', '0x8cc702081a6439ec',\n '0x90befffa23631e28', '0xa4506cebde82bde9', '0xbef9a3f7b2c67915', '0xc67178f2e372532b',\n '0xca273eceea26619c', '0xd186b8c721c0c207', '0xeada7dd6cde0eb1e', '0xf57d4f7fee6ed178',\n '0x06f067aa72176fba', '0x0a637dc5a2c898a6', '0x113f9804bef90dae', '0x1b710b35131c471b',\n '0x28db77f523047d84', '0x32caab7b40c72493', '0x3c9ebe0a15c9bebc', '0x431d67c49c100d4c',\n '0x4cc5d4becb3e42b6', '0x597f299cfc657e2a', '0x5fcb6fab3ad6faec', '0x6c44198c4a475817'\n].map(n => BigInt(n))))();\nconst SHA512_Kh = /* @__PURE__ */ (() => K512[0])();\nconst SHA512_Kl = /* @__PURE__ */ (() => K512[1])();\n\n// Reusable temporary buffers\nconst SHA512_W_H = /* @__PURE__ */ new Uint32Array(80);\nconst SHA512_W_L = /* @__PURE__ */ new Uint32Array(80);\n\nexport class SHA512 extends HashMD<SHA512> {\n // We cannot use array here since array allows indexing by variable\n // which means optimizer/compiler cannot use registers.\n // h -- high 32 bits, l -- low 32 bits\n protected Ah: number = SHA512_IV[0] | 0;\n protected Al: number = SHA512_IV[1] | 0;\n protected Bh: number = SHA512_IV[2] | 0;\n protected Bl: number = SHA512_IV[3] | 0;\n protected Ch: number = SHA512_IV[4] | 0;\n protected Cl: number = SHA512_IV[5] | 0;\n protected Dh: number = SHA512_IV[6] | 0;\n protected Dl: number = SHA512_IV[7] | 0;\n protected Eh: number = SHA512_IV[8] | 0;\n protected El: number = SHA512_IV[9] | 0;\n protected Fh: number = SHA512_IV[10] | 0;\n protected Fl: number = SHA512_IV[11] | 0;\n protected Gh: number = SHA512_IV[12] | 0;\n protected Gl: number = SHA512_IV[13] | 0;\n protected Hh: number = SHA512_IV[14] | 0;\n protected Hl: number = SHA512_IV[15] | 0;\n\n constructor(outputLen: number = 64) {\n super(128, outputLen, 16, false);\n }\n // prettier-ignore\n protected get(): [\n number, number, number, number, number, number, number, number,\n number, number, number, number, number, number, number, number\n ] {\n const { Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl } = this;\n return [Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl];\n }\n // prettier-ignore\n protected set(\n Ah: number, Al: number, Bh: number, Bl: number, Ch: number, Cl: number, Dh: number, Dl: number,\n Eh: number, El: number, Fh: number, Fl: number, Gh: number, Gl: number, Hh: number, Hl: number\n ): void {\n this.Ah = Ah | 0;\n this.Al = Al | 0;\n this.Bh = Bh | 0;\n this.Bl = Bl | 0;\n this.Ch = Ch | 0;\n this.Cl = Cl | 0;\n this.Dh = Dh | 0;\n this.Dl = Dl | 0;\n this.Eh = Eh | 0;\n this.El = El | 0;\n this.Fh = Fh | 0;\n this.Fl = Fl | 0;\n this.Gh = Gh | 0;\n this.Gl = Gl | 0;\n this.Hh = Hh | 0;\n this.Hl = Hl | 0;\n }\n protected process(view: DataView, offset: number): void {\n // Extend the first 16 words into the remaining 64 words w[16..79] of the message schedule array\n for (let i = 0; i < 16; i++, offset += 4) {\n SHA512_W_H[i] = view.getUint32(offset);\n SHA512_W_L[i] = view.getUint32((offset += 4));\n }\n for (let i = 16; i < 80; i++) {\n // s0 := (w[i-15] rightrotate 1) xor (w[i-15] rightrotate 8) xor (w[i-15] rightshift 7)\n const W15h = SHA512_W_H[i - 15] | 0;\n const W15l = SHA512_W_L[i - 15] | 0;\n const s0h = u64.rotrSH(W15h, W15l, 1) ^ u64.rotrSH(W15h, W15l, 8) ^ u64.shrSH(W15h, W15l, 7);\n const s0l = u64.rotrSL(W15h, W15l, 1) ^ u64.rotrSL(W15h, W15l, 8) ^ u64.shrSL(W15h, W15l, 7);\n // s1 := (w[i-2] rightrotate 19) xor (w[i-2] rightrotate 61) xor (w[i-2] rightshift 6)\n const W2h = SHA512_W_H[i - 2] | 0;\n const W2l = SHA512_W_L[i - 2] | 0;\n const s1h = u64.rotrSH(W2h, W2l, 19) ^ u64.rotrBH(W2h, W2l, 61) ^ u64.shrSH(W2h, W2l, 6);\n const s1l = u64.rotrSL(W2h, W2l, 19) ^ u64.rotrBL(W2h, W2l, 61) ^ u64.shrSL(W2h, W2l, 6);\n // SHA256_W[i] = s0 + s1 + SHA256_W[i - 7] + SHA256_W[i - 16];\n const SUMl = u64.add4L(s0l, s1l, SHA512_W_L[i - 7], SHA512_W_L[i - 16]);\n const SUMh = u64.add4H(SUMl, s0h, s1h, SHA512_W_H[i - 7], SHA512_W_H[i - 16]);\n SHA512_W_H[i] = SUMh | 0;\n SHA512_W_L[i] = SUMl | 0;\n }\n let { Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl } = this;\n // Compression function main loop, 80 rounds\n for (let i = 0; i < 80; i++) {\n // S1 := (e rightrotate 14) xor (e rightrotate 18) xor (e rightrotate 41)\n const sigma1h = u64.rotrSH(Eh, El, 14) ^ u64.rotrSH(Eh, El, 18) ^ u64.rotrBH(Eh, El, 41);\n const sigma1l = u64.rotrSL(Eh, El, 14) ^ u64.rotrSL(Eh, El, 18) ^ u64.rotrBL(Eh, El, 41);\n //const T1 = (H + sigma1 + Chi(E, F, G) + SHA256_K[i] + SHA256_W[i]) | 0;\n const CHIh = (Eh & Fh) ^ (~Eh & Gh);\n const CHIl = (El & Fl) ^ (~El & Gl);\n // T1 = H + sigma1 + Chi(E, F, G) + SHA512_K[i] + SHA512_W[i]\n // prettier-ignore\n const T1ll = u64.add5L(Hl, sigma1l, CHIl, SHA512_Kl[i], SHA512_W_L[i]);\n const T1h = u64.add5H(T1ll, Hh, sigma1h, CHIh, SHA512_Kh[i], SHA512_W_H[i]);\n const T1l = T1ll | 0;\n // S0 := (a rightrotate 28) xor (a rightrotate 34) xor (a rightrotate 39)\n const sigma0h = u64.rotrSH(Ah, Al, 28) ^ u64.rotrBH(Ah, Al, 34) ^ u64.rotrBH(Ah, Al, 39);\n const sigma0l = u64.rotrSL(Ah, Al, 28) ^ u64.rotrBL(Ah, Al, 34) ^ u64.rotrBL(Ah, Al, 39);\n const MAJh = (Ah & Bh) ^ (Ah & Ch) ^ (Bh & Ch);\n const MAJl = (Al & Bl) ^ (Al & Cl) ^ (Bl & Cl);\n Hh = Gh | 0;\n Hl = Gl | 0;\n Gh = Fh | 0;\n Gl = Fl | 0;\n Fh = Eh | 0;\n Fl = El | 0;\n ({ h: Eh, l: El } = u64.add(Dh | 0, Dl | 0, T1h | 0, T1l | 0));\n Dh = Ch | 0;\n Dl = Cl | 0;\n Ch = Bh | 0;\n Cl = Bl | 0;\n Bh = Ah | 0;\n Bl = Al | 0;\n const All = u64.add3L(T1l, sigma0l, MAJl);\n Ah = u64.add3H(All, T1h, sigma0h, MAJh);\n Al = All | 0;\n }\n // Add the compressed chunk to the current hash value\n ({ h: Ah, l: Al } = u64.add(this.Ah | 0, this.Al | 0, Ah | 0, Al | 0));\n ({ h: Bh, l: Bl } = u64.add(this.Bh | 0, this.Bl | 0, Bh | 0, Bl | 0));\n ({ h: Ch, l: Cl } = u64.add(this.Ch | 0, this.Cl | 0, Ch | 0, Cl | 0));\n ({ h: Dh, l: Dl } = u64.add(this.Dh | 0, this.Dl | 0, Dh | 0, Dl | 0));\n ({ h: Eh, l: El } = u64.add(this.Eh | 0, this.El | 0, Eh | 0, El | 0));\n ({ h: Fh, l: Fl } = u64.add(this.Fh | 0, this.Fl | 0, Fh | 0, Fl | 0));\n ({ h: Gh, l: Gl } = u64.add(this.Gh | 0, this.Gl | 0, Gh | 0, Gl | 0));\n ({ h: Hh, l: Hl } = u64.add(this.Hh | 0, this.Hl | 0, Hh | 0, Hl | 0));\n this.set(Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl);\n }\n protected roundClean(): void {\n clean(SHA512_W_H, SHA512_W_L);\n }\n destroy(): void {\n clean(this.buffer);\n this.set(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0);\n }\n}\n\nexport class SHA384 extends SHA512 {\n protected Ah: number = SHA384_IV[0] | 0;\n protected Al: number = SHA384_IV[1] | 0;\n protected Bh: number = SHA384_IV[2] | 0;\n protected Bl: number = SHA384_IV[3] | 0;\n protected Ch: number = SHA384_IV[4] | 0;\n protected Cl: number = SHA384_IV[5] | 0;\n protected Dh: number = SHA384_IV[6] | 0;\n protected Dl: number = SHA384_IV[7] | 0;\n protected Eh: number = SHA384_IV[8] | 0;\n protected El: number = SHA384_IV[9] | 0;\n protected Fh: number = SHA384_IV[10] | 0;\n protected Fl: number = SHA384_IV[11] | 0;\n protected Gh: number = SHA384_IV[12] | 0;\n protected Gl: number = SHA384_IV[13] | 0;\n protected Hh: number = SHA384_IV[14] | 0;\n protected Hl: number = SHA384_IV[15] | 0;\n\n constructor() {\n super(48);\n }\n}\n\n/**\n * Truncated SHA512/256 and SHA512/224.\n * SHA512_IV is XORed with 0xa5a5a5a5a5a5a5a5, then used as \"intermediary\" IV of SHA512/t.\n * Then t hashes string to produce result IV.\n * See `test/misc/sha2-gen-iv.js`.\n */\n\n/** SHA512/224 IV */\nconst T224_IV = /* @__PURE__ */ Uint32Array.from([\n 0x8c3d37c8, 0x19544da2, 0x73e19966, 0x89dcd4d6, 0x1dfab7ae, 0x32ff9c82, 0x679dd514, 0x582f9fcf,\n 0x0f6d2b69, 0x7bd44da8, 0x77e36f73, 0x04c48942, 0x3f9d85a8, 0x6a1d36c8, 0x1112e6ad, 0x91d692a1,\n]);\n\n/** SHA512/256 IV */\nconst T256_IV = /* @__PURE__ */ Uint32Array.from([\n 0x22312194, 0xfc2bf72c, 0x9f555fa3, 0xc84c64c2, 0x2393b86b, 0x6f53b151, 0x96387719, 0x5940eabd,\n 0x96283ee2, 0xa88effe3, 0xbe5e1e25, 0x53863992, 0x2b0199fc, 0x2c85b8aa, 0x0eb72ddc, 0x81c52ca2,\n]);\n\nexport class SHA512_224 extends SHA512 {\n protected Ah: number = T224_IV[0] | 0;\n protected Al: number = T224_IV[1] | 0;\n protected Bh: number = T224_IV[2] | 0;\n protected Bl: number = T224_IV[3] | 0;\n protected Ch: number = T224_IV[4] | 0;\n protected Cl: number = T224_IV[5] | 0;\n protected Dh: number = T224_IV[6] | 0;\n protected Dl: number = T224_IV[7] | 0;\n protected Eh: number = T224_IV[8] | 0;\n protected El: number = T224_IV[9] | 0;\n protected Fh: number = T224_IV[10] | 0;\n protected Fl: number = T224_IV[11] | 0;\n protected Gh: number = T224_IV[12] | 0;\n protected Gl: number = T224_IV[13] | 0;\n protected Hh: number = T224_IV[14] | 0;\n protected Hl: number = T224_IV[15] | 0;\n\n constructor() {\n super(28);\n }\n}\n\nexport class SHA512_256 extends SHA512 {\n protected Ah: number = T256_IV[0] | 0;\n protected Al: number = T256_IV[1] | 0;\n protected Bh: number = T256_IV[2] | 0;\n protected Bl: number = T256_IV[3] | 0;\n protected Ch: number = T256_IV[4] | 0;\n protected Cl: number = T256_IV[5] | 0;\n protected Dh: number = T256_IV[6] | 0;\n protected Dl: number = T256_IV[7] | 0;\n protected Eh: number = T256_IV[8] | 0;\n protected El: number = T256_IV[9] | 0;\n protected Fh: number = T256_IV[10] | 0;\n protected Fl: number = T256_IV[11] | 0;\n protected Gh: number = T256_IV[12] | 0;\n protected Gl: number = T256_IV[13] | 0;\n protected Hh: number = T256_IV[14] | 0;\n protected Hl: number = T256_IV[15] | 0;\n\n constructor() {\n super(32);\n }\n}\n\n/**\n * SHA2-256 hash function from RFC 4634.\n *\n * It is the fastest JS hash, even faster than Blake3.\n * To break sha256 using birthday attack, attackers need to try 2^128 hashes.\n * BTC network is doing 2^70 hashes/sec (2^95 hashes/year) as per 2025.\n */\nexport const sha256: CHash = /* @__PURE__ */ createHasher(() => new SHA256());\n/** SHA2-224 hash function from RFC 4634 */\nexport const sha224: CHash = /* @__PURE__ */ createHasher(() => new SHA224());\n\n/** SHA2-512 hash function from RFC 4634. */\nexport const sha512: CHash = /* @__PURE__ */ createHasher(() => new SHA512());\n/** SHA2-384 hash function from RFC 4634. */\nexport const sha384: CHash = /* @__PURE__ */ createHasher(() => new SHA384());\n\n/**\n * SHA2-512/256 \"truncated\" hash function, with improved resistance to length extension attacks.\n * See the paper on [truncated SHA512](https://eprint.iacr.org/2010/548.pdf).\n */\nexport const sha512_256: CHash = /* @__PURE__ */ createHasher(() => new SHA512_256());\n/**\n * SHA2-512/224 \"truncated\" hash function, with improved resistance to length extension attacks.\n * See the paper on [truncated SHA512](https://eprint.iacr.org/2010/548.pdf).\n */\nexport const sha512_224: CHash = /* @__PURE__ */ createHasher(() => new SHA512_224());\n", "import { base32Decode, base32Encode } from './utils/base32.ts';\nimport { getCrc32 } from './utils/getCrc.ts';\nimport { sha224 } from '@noble/hashes/sha2';\nimport { bytesToHex, hexToBytes } from '@noble/hashes/utils';\n\nexport const JSON_KEY_PRINCIPAL = '__principal__';\nconst SELF_AUTHENTICATING_SUFFIX = 2;\nconst ANONYMOUS_SUFFIX = 4;\n\nconst MANAGEMENT_CANISTER_PRINCIPAL_TEXT_STR = 'aaaaa-aa';\n\nexport type JsonnablePrincipal = {\n [JSON_KEY_PRINCIPAL]: string;\n};\n\nexport class Principal {\n public static anonymous(): Principal {\n return new this(new Uint8Array([ANONYMOUS_SUFFIX]));\n }\n\n /**\n * Utility method, returning the principal representing the management canister, decoded from the hex string `'aaaaa-aa'`\n * @returns {Principal} principal of the management canister\n */\n public static managementCanister(): Principal {\n return this.fromText(MANAGEMENT_CANISTER_PRINCIPAL_TEXT_STR);\n }\n\n public static selfAuthenticating(publicKey: Uint8Array): Principal {\n const sha = sha224(publicKey);\n return new this(new Uint8Array([...sha, SELF_AUTHENTICATING_SUFFIX]));\n }\n\n public static from(other: unknown): Principal {\n if (typeof other === 'string') {\n return Principal.fromText(other);\n } else if (Object.getPrototypeOf(other) === Uint8Array.prototype) {\n return new Principal(other as Uint8Array);\n } else if (Principal.isPrincipal(other)) {\n return new Principal(other._arr);\n }\n\n throw new Error(`Impossible to convert ${JSON.stringify(other)} to Principal.`);\n }\n\n public static fromHex(hex: string): Principal {\n return new this(hexToBytes(hex));\n }\n\n public static fromText(text: string): Principal {\n let maybePrincipal = text;\n // If formatted as JSON string, parse it first\n if (text.includes(JSON_KEY_PRINCIPAL)) {\n const obj = JSON.parse(text);\n if (JSON_KEY_PRINCIPAL in obj) {\n maybePrincipal = obj[JSON_KEY_PRINCIPAL];\n }\n }\n\n const canisterIdNoDash = maybePrincipal.toLowerCase().replace(/-/g, '');\n\n let arr = base32Decode(canisterIdNoDash);\n arr = arr.slice(4, arr.length);\n\n const principal = new this(arr);\n if (principal.toText() !== maybePrincipal) {\n throw new Error(\n `Principal \"${principal.toText()}\" does not have a valid checksum (original value \"${maybePrincipal}\" may not be a valid Principal ID).`,\n );\n }\n\n return principal;\n }\n\n public static fromUint8Array(arr: Uint8Array): Principal {\n return new this(arr);\n }\n\n public static isPrincipal(other: unknown): other is Principal {\n return (\n other instanceof Principal ||\n (typeof other === 'object' &&\n other !== null &&\n '_isPrincipal' in other &&\n (other as { _isPrincipal: boolean })['_isPrincipal'] === true &&\n '_arr' in other &&\n (other as { _arr: Uint8Array })['_arr'] instanceof Uint8Array)\n );\n }\n\n public readonly _isPrincipal = true;\n\n protected constructor(private _arr: Uint8Array) {}\n\n public isAnonymous(): boolean {\n return this._arr.byteLength === 1 && this._arr[0] === ANONYMOUS_SUFFIX;\n }\n\n public toUint8Array(): Uint8Array {\n return this._arr;\n }\n\n public toHex(): string {\n return bytesToHex(this._arr).toUpperCase();\n }\n\n public toText(): string {\n const checksumArrayBuf = new ArrayBuffer(4);\n const view = new DataView(checksumArrayBuf);\n view.setUint32(0, getCrc32(this._arr));\n const checksum = new Uint8Array(checksumArrayBuf);\n\n const array = new Uint8Array([...checksum, ...this._arr]);\n\n const result = base32Encode(array);\n const matches = result.match(/.{1,5}/g);\n if (!matches) {\n // This should only happen if there's no character, which is unreachable.\n throw new Error();\n }\n return matches.join('-');\n }\n\n public toString(): string {\n return this.toText();\n }\n\n /**\n * Serializes to JSON\n * @returns {JsonnablePrincipal} a JSON object with a single key, {@link JSON_KEY_PRINCIPAL}, whose value is the principal as a string\n */\n public toJSON(): JsonnablePrincipal {\n return { [JSON_KEY_PRINCIPAL]: this.toText() };\n }\n\n /**\n * Utility method taking a Principal to compare against. Used for determining canister ranges in certificate verification\n * @param {Principal} other - a {@link Principal} to compare\n * @returns {'lt' | 'eq' | 'gt'} `'lt' | 'eq' | 'gt'` a string, representing less than, equal to, or greater than\n */\n public compareTo(other: Principal): 'lt' | 'eq' | 'gt' {\n for (let i = 0; i < Math.min(this._arr.length, other._arr.length); i++) {\n if (this._arr[i] < other._arr[i]) return 'lt';\n else if (this._arr[i] > other._arr[i]) return 'gt';\n }\n // Here, at least one principal is a prefix of the other principal (they could be the same)\n if (this._arr.length < other._arr.length) return 'lt';\n if (this._arr.length > other._arr.length) return 'gt';\n return 'eq';\n }\n\n /**\n * Utility method checking whether a provided Principal is less than or equal to the current one using the {@link Principal.compareTo} method\n * @param other a {@link Principal} to compare\n * @returns {boolean} boolean\n */\n public ltEq(other: Principal): boolean {\n const cmp = this.compareTo(other);\n return cmp == 'lt' || cmp == 'eq';\n }\n\n /**\n * Utility method checking whether a provided Principal is greater than or equal to the current one using the {@link Principal.compareTo} method\n * @param other a {@link Principal} to compare\n * @returns {boolean} boolean\n */\n public gtEq(other: Principal): boolean {\n const cmp = this.compareTo(other);\n return cmp == 'gt' || cmp == 'eq';\n }\n}\n", "import {PrincipalSchema, Uint8ArraySchema} from '@dfinity/zod-schemas';\nimport * as z from 'zod';\n\nexport const JunoType = {\n /** Validates a Principal. */\n principal: () => PrincipalSchema,\n /** Validates a Uint8Array (blob, vec<u8>). */\n uint8Array: () => Uint8ArraySchema\n};\n\n// z.union is omitted because object unions can't be reliably serialized to Candid/Rust without a discriminator field.\nconst {union: _, ...rest} = z;\n\n/**\n * Juno's type system - an extended Zod instance for Serverless Functions.\n *\n * The schema builder exposes all Zod schemas and functions aside from\n * `union()` which can't be reliably serialized currently without a discriminator field.\n * That's why you should prefer using `discriminatedUnion()` instead.\n *\n * It extends Zod with various schemas useful for writing your custom functions\n * such as `j.principal()` and `j.uint8Array()`.\n *\n * @example\n * import { j } from '@junobuild/schema';\n *\n * const MySchema = j.strictObject({\n * id: j.principal(),\n * name: j.string(),\n * });\n */\nconst j = Object.assign({}, rest) as unknown as Omit<typeof z, 'union'> & typeof JunoType;\n\nj.principal = JunoType.principal;\nj.uint8Array = JunoType.uint8Array;\n\nexport {j};\n"],
|
|
5
|
-
"mappings": "AAAA,UAAYA,MAAO,MIAnB,IAAMC,EAAW,mCAGXC,EAAsC,OAAO,OAAO,IAAI,EAC9D,QAASC,EAAI,EAAGA,EAAIF,EAAS,OAAQE,IACnCD,EAAYD,EAASE,CAAC,CAAC,EAAIA,EAI7BD,EAAY,CAAG,EAAIA,EAAY,EAC/BA,EAAY,CAAG,EAAIA,EAAY,EAMzB,SAAUE,EAAaC,EAAiB,CAE5C,IAAIC,EAAO,EAEPC,EAAO,EAGPC,EAAS,GAEb,SAASC,EAAWC,EAAY,CAS9B,OARIJ,EAAO,EAETC,GAAQG,GAAQ,CAACJ,EAGjBC,EAAQG,GAAQJ,EAAQ,IAGtBA,EAAO,GAETA,GAAQ,EACD,IAGLA,EAAO,IAETE,GAAUP,EAASM,GAAQ,CAAC,EAC5BD,GAAQ,GAGH,EACT,CAEA,QAASH,EAAI,EAAGA,EAAIE,EAAM,QACxBF,GAAKM,EAAWJ,EAAMF,CAAC,CAAC,EAG1B,OAAOK,GAAUF,EAAO,EAAIL,EAASM,GAAQ,CAAC,EAAI,GACpD,CAKM,SAAUI,EAAaN,EAAa,CAExC,IAAIC,EAAO,EAEPI,EAAO,EAELF,EAAS,IAAI,WAAaH,EAAM,OAAS,EAAK,EAAK,CAAC,EACtDO,EAAI,EAER,SAASC,EAAWC,EAAY,CAI9B,IAAIC,EAAMb,EAAYY,EAAK,YAAW,CAAE,EACxC,GAAIC,IAAQ,OACV,MAAM,IAAI,MAAM,sBAAsB,KAAK,UAAUD,CAAI,CAAC,EAAE,EAI9DC,IAAQ,EACRL,GAAQK,IAAQT,EAChBA,GAAQ,EAEJA,GAAQ,IAEVE,EAAOI,GAAG,EAAIF,EACdJ,GAAQ,EAEJA,EAAO,EACTI,EAAQK,GAAQ,EAAIT,EAAS,IAE7BI,EAAO,EAGb,CAEA,QAAWM,KAAKX,EACdQ,EAAWG,CAAC,EAGd,OAAOR,EAAO,MAAM,EAAGI,CAAC,CAC1B,CClGA,IAAMK,GAA2B,IAAI,YAAY,CAC/C,EAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,WAAY,SAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,WAAY,SAAY,WAAY,WAAY,WAAY,SAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,WAAY,SAAY,WAAY,WAAY,WAAY,SACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,SAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACrF,EAMK,SAAUC,EAASC,EAAe,CACtC,IAAIC,EAAM,GAEV,QAASC,EAAI,EAAGA,EAAIF,EAAI,OAAQE,IAAK,CAEnC,IAAMC,GADOH,EAAIE,CAAC,EACAD,GAAO,IACzBA,EAAMH,GAAYK,CAAC,EAAKF,IAAQ,CAClC,CAEA,OAAQA,EAAM,MAAQ,CACxB,CCpCM,SAAUG,GAAQC,EAAU,CAChC,OAAOA,aAAa,YAAe,YAAY,OAAOA,CAAC,GAAKA,EAAE,YAAY,OAAS,YACrF,CAQM,SAAUC,EAAOC,KAA8BC,EAAiB,CACpE,GAAI,CAACC,GAAQF,CAAC,EAAG,MAAM,IAAI,MAAM,qBAAqB,EACtD,GAAIC,EAAQ,OAAS,GAAK,CAACA,EAAQ,SAASD,EAAE,MAAM,EAClD,MAAM,IAAI,MAAM,iCAAmCC,EAAU,gBAAkBD,EAAE,MAAM,CAC3F,CAWM,SAAUG,EAAQC,EAAeC,EAAgB,GAAI,CACzD,GAAID,EAAS,UAAW,MAAM,IAAI,MAAM,kCAAkC,EAC1E,GAAIC,GAAiBD,EAAS,SAAU,MAAM,IAAI,MAAM,uCAAuC,CACjG,CAGM,SAAUE,EAAQC,EAAUH,EAAa,CAC7CI,EAAOD,CAAG,EACV,IAAME,EAAML,EAAS,UACrB,GAAIG,EAAI,OAASE,EACf,MAAM,IAAI,MAAM,yDAA2DA,CAAG,CAElF,CAkBM,SAAUC,KAASC,EAAoB,CAC3C,QAASC,EAAI,EAAGA,EAAID,EAAO,OAAQC,IACjCD,EAAOC,CAAC,EAAE,KAAK,CAAC,CAEpB,CAGM,SAAUC,EAAWC,EAAe,CACxC,OAAO,IAAI,SAASA,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,CAChE,CAGM,SAAUC,EAAKC,EAAcC,EAAa,CAC9C,OAAQD,GAAS,GAAKC,EAAWD,IAASC,CAC5C,CAwCA,IAAMC,EAEJ,OAAO,WAAW,KAAK,CAAA,CAAE,EAAE,OAAU,YAAc,OAAO,WAAW,SAAY,WAG7EC,GAAwB,MAAM,KAAK,CAAE,OAAQ,GAAG,EAAI,CAACC,EAAGC,IAC5DA,EAAE,SAAS,EAAE,EAAE,SAAS,EAAG,GAAG,CAAC,EAO3B,SAAUC,EAAWC,EAAiB,CAG1C,GAFAC,EAAOD,CAAK,EAERL,EAAe,OAAOK,EAAM,MAAK,EAErC,IAAIE,EAAM,GACV,QAASJ,EAAI,EAAGA,EAAIE,EAAM,OAAQF,IAChCI,GAAON,GAAMI,EAAMF,CAAC,CAAC,EAEvB,OAAOI,CACT,CAGA,IAAMC,EAAS,CAAE,GAAI,GAAI,GAAI,GAAI,EAAG,GAAI,EAAG,GAAI,EAAG,GAAI,EAAG,GAAG,EAC5D,SAASC,EAAcC,EAAU,CAC/B,GAAIA,GAAMF,EAAO,IAAME,GAAMF,EAAO,GAAI,OAAOE,EAAKF,EAAO,GAC3D,GAAIE,GAAMF,EAAO,GAAKE,GAAMF,EAAO,EAAG,OAAOE,GAAMF,EAAO,EAAI,IAC9D,GAAIE,GAAMF,EAAO,GAAKE,GAAMF,EAAO,EAAG,OAAOE,GAAMF,EAAO,EAAI,GAEhE,CAMM,SAAUG,EAAWJ,EAAW,CACpC,GAAI,OAAOA,GAAQ,SAAU,MAAM,IAAI,MAAM,4BAA8B,OAAOA,CAAG,EAErF,GAAIP,EAAe,OAAO,WAAW,QAAQO,CAAG,EAChD,IAAMK,EAAKL,EAAI,OACTM,EAAKD,EAAK,EAChB,GAAIA,EAAK,EAAG,MAAM,IAAI,MAAM,mDAAqDA,CAAE,EACnF,IAAME,EAAQ,IAAI,WAAWD,CAAE,EAC/B,QAASE,EAAK,EAAGC,EAAK,EAAGD,EAAKF,EAAIE,IAAMC,GAAM,EAAG,CAC/C,IAAMC,EAAKR,EAAcF,EAAI,WAAWS,CAAE,CAAC,EACrCE,EAAKT,EAAcF,EAAI,WAAWS,EAAK,CAAC,CAAC,EAC/C,GAAIC,IAAO,QAAaC,IAAO,OAAW,CACxC,IAAMC,EAAOZ,EAAIS,CAAE,EAAIT,EAAIS,EAAK,CAAC,EACjC,MAAM,IAAI,MAAM,+CAAiDG,EAAO,cAAgBH,CAAE,CAC5F,CACAF,EAAMC,CAAE,EAAIE,EAAK,GAAKC,CACxB,CACA,OAAOJ,CACT,CAkCM,SAAUM,GAAYC,EAAW,CACrC,GAAI,OAAOA,GAAQ,SAAU,MAAM,IAAI,MAAM,iBAAiB,EAC9D,OAAO,IAAI,WAAW,IAAI,YAAW,EAAG,OAAOA,CAAG,CAAC,CACrD,CAiBM,SAAUC,EAAQC,EAAW,CACjC,OAAI,OAAOA,GAAS,WAAUA,EAAOC,GAAYD,CAAI,GACrDE,EAAOF,CAAI,EACJA,CACT,CAmDM,IAAgBG,EAAhB,KAAoB,GA4CpB,SAAUC,EACdC,EAAuB,CAOvB,IAAMC,EAASC,GAA2BF,EAAQ,EAAG,OAAOG,EAAQD,CAAG,CAAC,EAAE,OAAM,EAC1EE,EAAMJ,EAAQ,EACpB,OAAAC,EAAM,UAAYG,EAAI,UACtBH,EAAM,SAAWG,EAAI,SACrBH,EAAM,OAAS,IAAMD,EAAQ,EACtBC,CACT,CCpVM,SAAUI,GACdC,EACAC,EACAC,EACAC,EAAa,CAEb,GAAI,OAAOH,EAAK,cAAiB,WAAY,OAAOA,EAAK,aAAaC,EAAYC,EAAOC,CAAI,EAC7F,IAAMC,EAAO,OAAO,EAAE,EAChBC,EAAW,OAAO,UAAU,EAC5BC,EAAK,OAAQJ,GAASE,EAAQC,CAAQ,EACtCE,EAAK,OAAOL,EAAQG,CAAQ,EAC5BG,EAAIL,EAAO,EAAI,EACfM,EAAIN,EAAO,EAAI,EACrBH,EAAK,UAAUC,EAAaO,EAAGF,EAAIH,CAAI,EACvCH,EAAK,UAAUC,EAAaQ,EAAGF,EAAIJ,CAAI,CACzC,CAGM,SAAUO,EAAIC,EAAWC,EAAWC,EAAS,CACjD,OAAQF,EAAIC,EAAM,CAACD,EAAIE,CACzB,CAGM,SAAUC,EAAIH,EAAWC,EAAWC,EAAS,CACjD,OAAQF,EAAIC,EAAMD,EAAIE,EAAMD,EAAIC,CAClC,CAMM,IAAgBE,EAAhB,cAAoDC,CAAO,CAoB/D,YAAYC,EAAkBC,EAAmBC,EAAmBhB,EAAa,CAC/E,MAAK,EANG,KAAA,SAAW,GACX,KAAA,OAAS,EACT,KAAA,IAAM,EACN,KAAA,UAAY,GAIpB,KAAK,SAAWc,EAChB,KAAK,UAAYC,EACjB,KAAK,UAAYC,EACjB,KAAK,KAAOhB,EACZ,KAAK,OAAS,IAAI,WAAWc,CAAQ,EACrC,KAAK,KAAOG,EAAW,KAAK,MAAM,CACpC,CACA,OAAOC,EAAW,CAChBC,EAAQ,IAAI,EACZD,EAAOE,EAAQF,CAAI,EACnBG,EAAOH,CAAI,EACX,GAAM,CAAE,KAAArB,EAAM,OAAAyB,EAAQ,SAAAR,CAAQ,EAAK,KAC7BS,EAAML,EAAK,OACjB,QAASM,EAAM,EAAGA,EAAMD,GAAO,CAC7B,IAAME,EAAO,KAAK,IAAIX,EAAW,KAAK,IAAKS,EAAMC,CAAG,EAEpD,GAAIC,IAASX,EAAU,CACrB,IAAMY,EAAWT,EAAWC,CAAI,EAChC,KAAOJ,GAAYS,EAAMC,EAAKA,GAAOV,EAAU,KAAK,QAAQY,EAAUF,CAAG,EACzE,QACF,CACAF,EAAO,IAAIJ,EAAK,SAASM,EAAKA,EAAMC,CAAI,EAAG,KAAK,GAAG,EACnD,KAAK,KAAOA,EACZD,GAAOC,EACH,KAAK,MAAQX,IACf,KAAK,QAAQjB,EAAM,CAAC,EACpB,KAAK,IAAM,EAEf,CACA,YAAK,QAAUqB,EAAK,OACpB,KAAK,WAAU,EACR,IACT,CACA,WAAWS,EAAe,CACxBR,EAAQ,IAAI,EACZS,EAAQD,EAAK,IAAI,EACjB,KAAK,SAAW,GAIhB,GAAM,CAAE,OAAAL,EAAQ,KAAAzB,EAAM,SAAAiB,EAAU,KAAAd,CAAI,EAAK,KACrC,CAAE,IAAAwB,CAAG,EAAK,KAEdF,EAAOE,GAAK,EAAI,IAChBK,EAAM,KAAK,OAAO,SAASL,CAAG,CAAC,EAG3B,KAAK,UAAYV,EAAWU,IAC9B,KAAK,QAAQ3B,EAAM,CAAC,EACpB2B,EAAM,GAGR,QAASM,EAAIN,EAAKM,EAAIhB,EAAUgB,IAAKR,EAAOQ,CAAC,EAAI,EAIjDlC,GAAaC,EAAMiB,EAAW,EAAG,OAAO,KAAK,OAAS,CAAC,EAAGd,CAAI,EAC9D,KAAK,QAAQH,EAAM,CAAC,EACpB,IAAMkC,EAAQd,EAAWU,CAAG,EACtBJ,EAAM,KAAK,UAEjB,GAAIA,EAAM,EAAG,MAAM,IAAI,MAAM,6CAA6C,EAC1E,IAAMS,EAAST,EAAM,EACfU,EAAQ,KAAK,IAAG,EACtB,GAAID,EAASC,EAAM,OAAQ,MAAM,IAAI,MAAM,oCAAoC,EAC/E,QAASH,EAAI,EAAGA,EAAIE,EAAQF,IAAKC,EAAM,UAAU,EAAID,EAAGG,EAAMH,CAAC,EAAG9B,CAAI,CACxE,CACA,QAAM,CACJ,GAAM,CAAE,OAAAsB,EAAQ,UAAAP,CAAS,EAAK,KAC9B,KAAK,WAAWO,CAAM,EACtB,IAAMY,EAAMZ,EAAO,MAAM,EAAGP,CAAS,EACrC,YAAK,QAAO,EACLmB,CACT,CACA,WAAWC,EAAM,CACfA,IAAAA,EAAO,IAAK,KAAK,aACjBA,EAAG,IAAI,GAAG,KAAK,IAAG,CAAE,EACpB,GAAM,CAAE,SAAArB,EAAU,OAAAQ,EAAQ,OAAAc,EAAQ,SAAAC,EAAU,UAAAC,EAAW,IAAAd,CAAG,EAAK,KAC/D,OAAAW,EAAG,UAAYG,EACfH,EAAG,SAAWE,EACdF,EAAG,OAASC,EACZD,EAAG,IAAMX,EACLY,EAAStB,GAAUqB,EAAG,OAAO,IAAIb,CAAM,EACpCa,CACT,CACA,OAAK,CACH,OAAO,KAAK,WAAU,CACxB,GASWI,EAAyC,YAAY,KAAK,CACrE,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UAAY,WACrF,EAGYC,EAAyC,YAAY,KAAK,CACrE,WAAY,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WACrF,ECnJD,IAAMC,GAA2B,YAAY,KAAK,CAChD,WAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,WAAY,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,UAAY,UAAY,UAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UAAY,UACpF,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UACpF,UAAY,UAAY,UAAY,UAAY,UAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACrF,EAGKC,EAA2B,IAAI,YAAY,EAAE,EACtCC,EAAP,cAAsBC,CAAc,CAYxC,YAAYC,EAAoB,GAAE,CAChC,MAAM,GAAIA,EAAW,EAAG,EAAK,EAVrB,KAAA,EAAYC,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,CAIrC,CACU,KAAG,CACX,GAAM,CAAE,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,CAAC,EAAK,KACnC,MAAO,CAACP,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,CAAC,CAChC,CAEU,IACRP,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAS,CAEtF,KAAK,EAAIP,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,CACf,CACU,QAAQC,EAAgBC,EAAc,CAE9C,QAASC,EAAI,EAAGA,EAAI,GAAIA,IAAKD,GAAU,EAAGd,EAASe,CAAC,EAAIF,EAAK,UAAUC,EAAQ,EAAK,EACpF,QAASC,EAAI,GAAIA,EAAI,GAAIA,IAAK,CAC5B,IAAMC,EAAMhB,EAASe,EAAI,EAAE,EACrBE,EAAKjB,EAASe,EAAI,CAAC,EACnBG,EAAKC,EAAKH,EAAK,CAAC,EAAIG,EAAKH,EAAK,EAAE,EAAKA,IAAQ,EAC7CI,EAAKD,EAAKF,EAAI,EAAE,EAAIE,EAAKF,EAAI,EAAE,EAAKA,IAAO,GACjDjB,EAASe,CAAC,EAAKK,EAAKpB,EAASe,EAAI,CAAC,EAAIG,EAAKlB,EAASe,EAAI,EAAE,EAAK,CACjE,CAEA,GAAI,CAAE,EAAAV,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,CAAC,EAAK,KACjC,QAASG,EAAI,EAAGA,EAAI,GAAIA,IAAK,CAC3B,IAAMM,EAASF,EAAKV,EAAG,CAAC,EAAIU,EAAKV,EAAG,EAAE,EAAIU,EAAKV,EAAG,EAAE,EAC9Ca,EAAMV,EAAIS,EAASE,EAAId,EAAGC,EAAGC,CAAC,EAAIZ,GAASgB,CAAC,EAAIf,EAASe,CAAC,EAAK,EAE/DS,GADSL,EAAKd,EAAG,CAAC,EAAIc,EAAKd,EAAG,EAAE,EAAIc,EAAKd,EAAG,EAAE,GAC/BoB,EAAIpB,EAAGC,EAAGC,CAAC,EAAK,EACrCK,EAAID,EACJA,EAAID,EACJA,EAAID,EACJA,EAAKD,EAAIc,EAAM,EACfd,EAAID,EACJA,EAAID,EACJA,EAAID,EACJA,EAAKiB,EAAKE,EAAM,CAClB,CAEAnB,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnB,KAAK,IAAIP,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,CAAC,CACjC,CACU,YAAU,CAClBc,EAAM1B,CAAQ,CAChB,CACA,SAAO,CACL,KAAK,IAAI,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,CAAC,EAC/B0B,EAAM,KAAK,MAAM,CACnB,GAGWC,EAAP,cAAsB1B,CAAM,CAShC,aAAA,CACE,MAAM,EAAE,EATA,KAAA,EAAY2B,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,CAGrC,GA2QK,IAAMC,EAAgCC,EAAa,IAAM,IAAIC,CAAQ,EC5XrE,IAAMC,EAAqB,gBAC5BC,GAA6B,EAC7BC,EAAmB,EAEnBC,GAAyC,WAMlCC,EAAP,MAAOC,CAAS,CACb,OAAO,WAAS,CACrB,OAAO,IAAI,KAAK,IAAI,WAAW,CAACH,CAAgB,CAAC,CAAC,CACpD,CAMO,OAAO,oBAAkB,CAC9B,OAAO,KAAK,SAASC,EAAsC,CAC7D,CAEO,OAAO,mBAAmBG,EAAqB,CACpD,IAAMC,EAAMC,EAAOF,CAAS,EAC5B,OAAO,IAAI,KAAK,IAAI,WAAW,CAAC,GAAGC,EAAKN,EAA0B,CAAC,CAAC,CACtE,CAEO,OAAO,KAAKQ,EAAc,CAC/B,GAAI,OAAOA,GAAU,SACnB,OAAOJ,EAAU,SAASI,CAAK,EAC1B,GAAI,OAAO,eAAeA,CAAK,IAAM,WAAW,UACrD,OAAO,IAAIJ,EAAUI,CAAmB,EACnC,GAAIJ,EAAU,YAAYI,CAAK,EACpC,OAAO,IAAIJ,EAAUI,EAAM,IAAI,EAGjC,MAAM,IAAI,MAAM,yBAAyB,KAAK,UAAUA,CAAK,CAAC,gBAAgB,CAChF,CAEO,OAAO,QAAQC,EAAW,CAC/B,OAAO,IAAI,KAAKC,EAAWD,CAAG,CAAC,CACjC,CAEO,OAAO,SAASE,EAAY,CACjC,IAAIC,EAAiBD,EAErB,GAAIA,EAAK,SAASZ,CAAkB,EAAG,CACrC,IAAMc,EAAM,KAAK,MAAMF,CAAI,EACvBZ,KAAsBc,IACxBD,EAAiBC,EAAId,CAAkB,EAE3C,CAEA,IAAMe,EAAmBF,EAAe,YAAW,EAAG,QAAQ,KAAM,EAAE,EAElEG,EAAMC,EAAaF,CAAgB,EACvCC,EAAMA,EAAI,MAAM,EAAGA,EAAI,MAAM,EAE7B,IAAME,EAAY,IAAI,KAAKF,CAAG,EAC9B,GAAIE,EAAU,OAAM,IAAOL,EACzB,MAAM,IAAI,MACR,cAAcK,EAAU,OAAM,CAAE,qDAAqDL,CAAc,qCAAqC,EAI5I,OAAOK,CACT,CAEO,OAAO,eAAeF,EAAe,CAC1C,OAAO,IAAI,KAAKA,CAAG,CACrB,CAEO,OAAO,YAAYP,EAAc,CACtC,OACEA,aAAiBJ,GAChB,OAAOI,GAAU,UAChBA,IAAU,MACV,iBAAkBA,GACjBA,EAAoC,eAAoB,IACzD,SAAUA,GACTA,EAA+B,gBAAmB,UAEzD,CAIA,YAA8BU,EAAgB,CAAhB,KAAA,KAAAA,EAFd,KAAA,aAAe,EAEkB,CAE1C,aAAW,CAChB,OAAO,KAAK,KAAK,aAAe,GAAK,KAAK,KAAK,CAAC,IAAMjB,CACxD,CAEO,cAAY,CACjB,OAAO,KAAK,IACd,CAEO,OAAK,CACV,OAAOkB,EAAW,KAAK,IAAI,EAAE,YAAW,CAC1C,CAEO,QAAM,CACX,IAAMC,EAAmB,IAAI,YAAY,CAAC,EAC7B,IAAI,SAASA,CAAgB,EACrC,UAAU,EAAGC,EAAS,KAAK,IAAI,CAAC,EACrC,IAAMC,EAAW,IAAI,WAAWF,CAAgB,EAE1CG,EAAQ,IAAI,WAAW,CAAC,GAAGD,EAAU,GAAG,KAAK,IAAI,CAAC,EAGlDE,EADSC,EAAaF,CAAK,EACV,MAAM,SAAS,EACtC,GAAI,CAACC,EAEH,MAAM,IAAI,MAEZ,OAAOA,EAAQ,KAAK,GAAG,CACzB,CAEO,UAAQ,CACb,OAAO,KAAK,OAAM,CACpB,CAMO,QAAM,CACX,MAAO,CAAE,CAACzB,CAAkB,EAAG,KAAK,OAAM,CAAE,CAC9C,CAOO,UAAUS,EAAgB,CAC/B,QAASkB,EAAI,EAAGA,EAAI,KAAK,IAAI,KAAK,KAAK,OAAQlB,EAAM,KAAK,MAAM,EAAGkB,IAAK,CACtE,GAAI,KAAK,KAAKA,CAAC,EAAIlB,EAAM,KAAKkB,CAAC,EAAG,MAAO,KACpC,GAAI,KAAK,KAAKA,CAAC,EAAIlB,EAAM,KAAKkB,CAAC,EAAG,MAAO,IAChD,CAEA,OAAI,KAAK,KAAK,OAASlB,EAAM,KAAK,OAAe,KAC7C,KAAK,KAAK,OAASA,EAAM,KAAK,OAAe,KAC1C,IACT,CAOO,KAAKA,EAAgB,CAC1B,IAAMmB,EAAM,KAAK,UAAUnB,CAAK,EAChC,OAAOmB,GAAO,MAAQA,GAAO,IAC/B,CAOO,KAAKnB,EAAgB,CAC1B,IAAMmB,EAAM,KAAK,UAAUnB,CAAK,EAChC,OAAOmB,GAAO,MAAQA,GAAO,IAC/B,GPxKF,UAAYC,MAAO,MCDnB,UAAYA,MAAO,MFGZ,IAAKC,IAAAA,IAEVA,EAAA,cAAgB,gBAEhBA,EAAA,UAAY,YAEZA,EAAA,WAAa,aAEbA,EAAA,IAAM,MARIA,IAAAA,IAAA,CAAA,CAAA,EDSCC,EACV,aAAW,UAAU,EACrB,KAAK,CAAE,GAAA,YAA2B,CAAC,EEEzBC,GACV,SAAO,EACP,OACEC,GAAc,CACb,GAAI,CACF,OAAAC,EAAU,SAASD,CAAS,EACrB,EACT,MAAwB,CACtB,MAAO,EACT,CACF,EACA,CACE,MAAO,gDACT,CACF,EACC,KAAK,CAAE,GAAA,eAA8B,CAAC,EAgB5BE,EACV,SAAkB,EAClB,OAAQF,GAAcC,EAAU,YAAYD,CAAS,EAAG,CACvD,MAAO,qBACP,MAAO,EACT,CAAC,EACA,UAAWG,GAAUF,EAAU,KAAKE,CAAK,CAAC,EAC1C,KAAK,CAAE,GAAA,WAA0B,CAAC,EC3BxBC,GAAkB,CAAC,CAC9B,oBAAAC,EAAsB,CAAC,EACvB,iBAAAC,EAAmB,EACrB,IAII,MAAI,EAAE,OACLC,GAA+B,CAC9B,GAAI,CACF,IAAMC,EAAY,CAAC,GAAG,IAAI,IAAI,CAAC,SAAU,GAAGH,CAAmB,CAAC,CAAC,EAE3D,CAAE,SAAAI,EAAU,SAAAC,CAAS,EAAI,IAAI,IAAIH,CAAG,EAG1C,OAAID,GAAoB,CAAC,YAAa,WAAW,EAAE,SAASI,CAAQ,EAC3D,CAAC,QAAS,GAAGF,CAAS,EAAE,SAASC,CAAQ,EAG3CD,EAAU,SAASC,CAAQ,CACpC,MAAwB,CACtB,MAAO,EACT,CACF,EACA,CACE,MAAO,cACT,CACF,EAUWE,GAAYP,GAAgB,CAAC,CAAC,EAAE,KAAK,CAAE,GAAA,KAAoB,CAAC,EO/DzE,UAAYQ,OAAO,MAEZ,IAAMC,EAAW,CAEtB,UAAW,IAAMC,EAEjB,WAAY,IAAMC,CACpB,EAGM,CAAC,MAAOC,GAAG,GAAGC,EAAI,EAAIL,GAoBtBM,EAAI,OAAO,OAAO,CAAC,EAAGD,EAAI,EAEhCC,EAAE,UAAYL,EAAS,UACvBK,EAAE,WAAaL,EAAS",
|
|
4
|
+
"sourcesContent": ["import * as z from \"zod\";\nimport { ZodSchemaId } from \"./schema-id\";\n\n/**\n * Zod schema to validate a value is a `Uint8Array` instance.\n *\n * @example\n * ```typescript\n * const result = Uint8ArraySchema.safeParse(new Uint8Array([1, 2, 3]));\n * console.log(result.success); // true or false\n * ```\n */\nexport const Uint8ArraySchema = z\n .instanceof(Uint8Array)\n .meta({ id: ZodSchemaId.Uint8Array });\n", "/**\n * Enum of metadata `id` values assigned to Zod schemas in this library.\n */\nexport enum ZodSchemaId {\n /** Metadata id for {@link PrincipalTextSchema}. */\n PrincipalText = \"PrincipalText\",\n /** Metadata id for {@link PrincipalSchema}. */\n Principal = \"Principal\",\n /** Metadata id for {@link Uint8ArraySchema}. */\n Uint8Array = \"Uint8Array\",\n /** Metadata id for {@link UrlSchema}. */\n Url = \"Url\",\n}\n", "import { Principal } from \"@icp-sdk/core/principal\";\nimport * as z from \"zod\";\nimport { ZodSchemaId } from \"./schema-id\";\n\n/**\n * Zod schema to validate a string as a valid textual representation of a Principal.\n *\n * This schema checks if the provided string can be converted into a `Principal` instance.\n * If the conversion fails, validation will return an error message.\n *\n * @example\n * ```typescript\n * const result = PrincipalTextSchema.safeParse('aaaaa-aa');\n * console.log(result.success); // true or false\n * ```\n */\nexport const PrincipalTextSchema = z\n .string()\n .refine(\n (principal) => {\n try {\n Principal.fromText(principal);\n return true;\n } catch (_err: unknown) {\n return false;\n }\n },\n {\n error: \"Invalid textual representation of a Principal.\",\n },\n )\n .meta({ id: ZodSchemaId.PrincipalText });\n\nexport type PrincipalText = z.infer<typeof PrincipalTextSchema>;\n\n/**\n * Zod schema to validate and transform a value into a `Principal` instance.\n *\n * This schema checks if the provided value is an instance or an object representing\n * a `Principal` and transforms it into a valid `Principal` instance.\n *\n * @example\n * ```typescript\n * const result = PrincipalSchema.safeParse(Principal.fromText('aaaaa-aa'));\n * console.log(result.success); // true or false\n * ```\n */\nexport const PrincipalSchema = z\n .custom<Principal>()\n .refine((principal) => Principal.isPrincipal(principal), {\n error: \"Invalid Principal.\",\n abort: true,\n })\n .transform((value) => Principal.from(value))\n .meta({ id: ZodSchemaId.Principal });\n", "import * as z from \"zod\";\nimport { ZodSchemaId } from \"./schema-id\";\n\n/**\n * A URL protocol as template literal type.\n * Example: \"https:\" or \"ftp:\"\n */\nexport type UrlProtocol = `${string}:`;\n\n/**\n * Creates a Zod schema for validating URLs. By default, it validates that the URL protocol is HTTPS and allow usage of HTTP only locally.\n *\n * @param {Object} options - Configuration options for the schema.\n * @param {UrlProtocol[]} [options.additionalProtocols=[]] - Additional protocols to allow (e.g., \"wss:\" or \"ftp:\"). \u26A0\uFE0F Usage of insecure protocols is discouraged.\n * @param {boolean} [options.allowHttpLocally=true] - Whether to allow HTTP for localhost and 127.0.0.1. Default: true.\n * @returns {z.ZodEffects<z.ZodString, string, string>} - The Zod schema with URL validation.\n *\n * @example\n * const schema = createUrlSchema({\n * additionalProtocols: [\"wss:\"],\n * allowHttpLocally: false\n * });\n *\n * schema.parse(\"https://example.com\"); // Valid\n * schema.parse(\"wss://example.com\"); // Valid\n * schema.parse(\"http://localhost\"); // Invalid if allowHttpLocally is false\n */\nexport const createUrlSchema = ({\n additionalProtocols = [],\n allowHttpLocally = true,\n}: {\n additionalProtocols?: UrlProtocol[];\n allowHttpLocally?: boolean;\n}): z.ZodURL =>\n z.url().refine(\n (url: string | URL): boolean => {\n try {\n const protocols = [...new Set([\"https:\", ...additionalProtocols])];\n\n const { protocol, hostname } = new URL(url);\n\n // We allow http for development locally\n if (allowHttpLocally && [\"localhost\", \"127.0.0.1\"].includes(hostname)) {\n return [\"http:\", ...protocols].includes(protocol);\n }\n\n return protocols.includes(protocol);\n } catch (_err: unknown) {\n return false;\n }\n },\n {\n error: \"Invalid URL.\",\n },\n );\n\n/**\n * Default URL schema that enforces HTTPS and allows HTTP locally.\n *\n * @constant {z.ZodEffects<z.ZodString, string, string>}\n * @example\n * UrlSchema.parse(\"https://example.com\"); // Valid\n * UrlSchema.parse(\"http://127.0.0.1\"); // Valid (localhost exception)\n */\nexport const UrlSchema = createUrlSchema({}).meta({ id: ZodSchemaId.Url });\n", "const alphabet = 'abcdefghijklmnopqrstuvwxyz234567';\n\n// Build a lookup table for decoding.\nconst lookupTable: Record<string, number> = Object.create(null);\nfor (let i = 0; i < alphabet.length; i++) {\n lookupTable[alphabet[i]] = i;\n}\n\n// Add aliases for rfc4648.\nlookupTable['0'] = lookupTable.o;\nlookupTable['1'] = lookupTable.i;\n\n/**\n * @param input The Uint8Array to encode.\n * @returns A Base32 string encoding the input.\n */\nexport function base32Encode(input: Uint8Array): string {\n // How many bits will we skip from the first byte.\n let skip = 0;\n // 5 high bits, carry from one byte to the next.\n let bits = 0;\n\n // The output string in base32.\n let output = '';\n\n function encodeByte(byte: number) {\n if (skip < 0) {\n // we have a carry from the previous byte\n bits |= byte >> -skip;\n } else {\n // no carry\n bits = (byte << skip) & 248;\n }\n\n if (skip > 3) {\n // Not enough data to produce a character, get us another one\n skip -= 8;\n return 1;\n }\n\n if (skip < 4) {\n // produce a character\n output += alphabet[bits >> 3];\n skip += 5;\n }\n\n return 0;\n }\n\n for (let i = 0; i < input.length; ) {\n i += encodeByte(input[i]);\n }\n\n return output + (skip < 0 ? alphabet[bits >> 3] : '');\n}\n\n/**\n * @param input The base32 encoded string to decode.\n */\nexport function base32Decode(input: string): Uint8Array {\n // how many bits we have from the previous character.\n let skip = 0;\n // current byte we're producing.\n let byte = 0;\n\n const output = new Uint8Array(((input.length * 4) / 3) | 0);\n let o = 0;\n\n function decodeChar(char: string) {\n // Consume a character from the stream, store\n // the output in this.output. As before, better\n // to use update().\n let val = lookupTable[char.toLowerCase()];\n if (val === undefined) {\n throw new Error(`Invalid character: ${JSON.stringify(char)}`);\n }\n\n // move to the high bits\n val <<= 3;\n byte |= val >>> skip;\n skip += 5;\n\n if (skip >= 8) {\n // We have enough bytes to produce an output\n output[o++] = byte;\n skip -= 8;\n\n if (skip > 0) {\n byte = (val << (5 - skip)) & 255;\n } else {\n byte = 0;\n }\n }\n }\n\n for (const c of input) {\n decodeChar(c);\n }\n\n return output.slice(0, o);\n}\n", "// This file is translated to JavaScript from\n// https://lxp32.github.io/docs/a-simple-example-crc32-calculation/\nconst lookUpTable: Uint32Array = new Uint32Array([\n 0x00000000, 0x77073096, 0xee0e612c, 0x990951ba, 0x076dc419, 0x706af48f, 0xe963a535, 0x9e6495a3,\n 0x0edb8832, 0x79dcb8a4, 0xe0d5e91e, 0x97d2d988, 0x09b64c2b, 0x7eb17cbd, 0xe7b82d07, 0x90bf1d91,\n 0x1db71064, 0x6ab020f2, 0xf3b97148, 0x84be41de, 0x1adad47d, 0x6ddde4eb, 0xf4d4b551, 0x83d385c7,\n 0x136c9856, 0x646ba8c0, 0xfd62f97a, 0x8a65c9ec, 0x14015c4f, 0x63066cd9, 0xfa0f3d63, 0x8d080df5,\n 0x3b6e20c8, 0x4c69105e, 0xd56041e4, 0xa2677172, 0x3c03e4d1, 0x4b04d447, 0xd20d85fd, 0xa50ab56b,\n 0x35b5a8fa, 0x42b2986c, 0xdbbbc9d6, 0xacbcf940, 0x32d86ce3, 0x45df5c75, 0xdcd60dcf, 0xabd13d59,\n 0x26d930ac, 0x51de003a, 0xc8d75180, 0xbfd06116, 0x21b4f4b5, 0x56b3c423, 0xcfba9599, 0xb8bda50f,\n 0x2802b89e, 0x5f058808, 0xc60cd9b2, 0xb10be924, 0x2f6f7c87, 0x58684c11, 0xc1611dab, 0xb6662d3d,\n 0x76dc4190, 0x01db7106, 0x98d220bc, 0xefd5102a, 0x71b18589, 0x06b6b51f, 0x9fbfe4a5, 0xe8b8d433,\n 0x7807c9a2, 0x0f00f934, 0x9609a88e, 0xe10e9818, 0x7f6a0dbb, 0x086d3d2d, 0x91646c97, 0xe6635c01,\n 0x6b6b51f4, 0x1c6c6162, 0x856530d8, 0xf262004e, 0x6c0695ed, 0x1b01a57b, 0x8208f4c1, 0xf50fc457,\n 0x65b0d9c6, 0x12b7e950, 0x8bbeb8ea, 0xfcb9887c, 0x62dd1ddf, 0x15da2d49, 0x8cd37cf3, 0xfbd44c65,\n 0x4db26158, 0x3ab551ce, 0xa3bc0074, 0xd4bb30e2, 0x4adfa541, 0x3dd895d7, 0xa4d1c46d, 0xd3d6f4fb,\n 0x4369e96a, 0x346ed9fc, 0xad678846, 0xda60b8d0, 0x44042d73, 0x33031de5, 0xaa0a4c5f, 0xdd0d7cc9,\n 0x5005713c, 0x270241aa, 0xbe0b1010, 0xc90c2086, 0x5768b525, 0x206f85b3, 0xb966d409, 0xce61e49f,\n 0x5edef90e, 0x29d9c998, 0xb0d09822, 0xc7d7a8b4, 0x59b33d17, 0x2eb40d81, 0xb7bd5c3b, 0xc0ba6cad,\n 0xedb88320, 0x9abfb3b6, 0x03b6e20c, 0x74b1d29a, 0xead54739, 0x9dd277af, 0x04db2615, 0x73dc1683,\n 0xe3630b12, 0x94643b84, 0x0d6d6a3e, 0x7a6a5aa8, 0xe40ecf0b, 0x9309ff9d, 0x0a00ae27, 0x7d079eb1,\n 0xf00f9344, 0x8708a3d2, 0x1e01f268, 0x6906c2fe, 0xf762575d, 0x806567cb, 0x196c3671, 0x6e6b06e7,\n 0xfed41b76, 0x89d32be0, 0x10da7a5a, 0x67dd4acc, 0xf9b9df6f, 0x8ebeeff9, 0x17b7be43, 0x60b08ed5,\n 0xd6d6a3e8, 0xa1d1937e, 0x38d8c2c4, 0x4fdff252, 0xd1bb67f1, 0xa6bc5767, 0x3fb506dd, 0x48b2364b,\n 0xd80d2bda, 0xaf0a1b4c, 0x36034af6, 0x41047a60, 0xdf60efc3, 0xa867df55, 0x316e8eef, 0x4669be79,\n 0xcb61b38c, 0xbc66831a, 0x256fd2a0, 0x5268e236, 0xcc0c7795, 0xbb0b4703, 0x220216b9, 0x5505262f,\n 0xc5ba3bbe, 0xb2bd0b28, 0x2bb45a92, 0x5cb36a04, 0xc2d7ffa7, 0xb5d0cf31, 0x2cd99e8b, 0x5bdeae1d,\n 0x9b64c2b0, 0xec63f226, 0x756aa39c, 0x026d930a, 0x9c0906a9, 0xeb0e363f, 0x72076785, 0x05005713,\n 0x95bf4a82, 0xe2b87a14, 0x7bb12bae, 0x0cb61b38, 0x92d28e9b, 0xe5d5be0d, 0x7cdcefb7, 0x0bdbdf21,\n 0x86d3d2d4, 0xf1d4e242, 0x68ddb3f8, 0x1fda836e, 0x81be16cd, 0xf6b9265b, 0x6fb077e1, 0x18b74777,\n 0x88085ae6, 0xff0f6a70, 0x66063bca, 0x11010b5c, 0x8f659eff, 0xf862ae69, 0x616bffd3, 0x166ccf45,\n 0xa00ae278, 0xd70dd2ee, 0x4e048354, 0x3903b3c2, 0xa7672661, 0xd06016f7, 0x4969474d, 0x3e6e77db,\n 0xaed16a4a, 0xd9d65adc, 0x40df0b66, 0x37d83bf0, 0xa9bcae53, 0xdebb9ec5, 0x47b2cf7f, 0x30b5ffe9,\n 0xbdbdf21c, 0xcabac28a, 0x53b39330, 0x24b4a3a6, 0xbad03605, 0xcdd70693, 0x54de5729, 0x23d967bf,\n 0xb3667a2e, 0xc4614ab8, 0x5d681b02, 0x2a6f2b94, 0xb40bbe37, 0xc30c8ea1, 0x5a05df1b, 0x2d02ef8d,\n]);\n\n/**\n * Calculate the CRC32 of a Uint8Array.\n * @param buf The Uint8Array to calculate the CRC32 of.\n */\nexport function getCrc32(buf: Uint8Array): number {\n let crc = -1;\n\n for (let i = 0; i < buf.length; i++) {\n const byte = buf[i];\n const t = (byte ^ crc) & 0xff;\n crc = lookUpTable[t] ^ (crc >>> 8);\n }\n\n return (crc ^ -1) >>> 0;\n}\n", "/**\n * Utilities for hex, bytes, CSPRNG.\n * @module\n */\n/*! noble-hashes - MIT License (c) 2022 Paul Miller (paulmillr.com) */\n\n// We use WebCrypto aka globalThis.crypto, which exists in browsers and node.js 16+.\n// node.js versions earlier than v19 don't declare it in global scope.\n// For node.js, package.json#exports field mapping rewrites import\n// from `crypto` to `cryptoNode`, which imports native module.\n// Makes the utils un-importable in browsers without a bundler.\n// Once node.js 18 is deprecated (2025-04-30), we can just drop the import.\nimport { crypto } from '@noble/hashes/crypto';\n\n/** Checks if something is Uint8Array. Be careful: nodejs Buffer will return true. */\nexport function isBytes(a: unknown): a is Uint8Array {\n return a instanceof Uint8Array || (ArrayBuffer.isView(a) && a.constructor.name === 'Uint8Array');\n}\n\n/** Asserts something is positive integer. */\nexport function anumber(n: number): void {\n if (!Number.isSafeInteger(n) || n < 0) throw new Error('positive integer expected, got ' + n);\n}\n\n/** Asserts something is Uint8Array. */\nexport function abytes(b: Uint8Array | undefined, ...lengths: number[]): void {\n if (!isBytes(b)) throw new Error('Uint8Array expected');\n if (lengths.length > 0 && !lengths.includes(b.length))\n throw new Error('Uint8Array expected of length ' + lengths + ', got length=' + b.length);\n}\n\n/** Asserts something is hash */\nexport function ahash(h: IHash): void {\n if (typeof h !== 'function' || typeof h.create !== 'function')\n throw new Error('Hash should be wrapped by utils.createHasher');\n anumber(h.outputLen);\n anumber(h.blockLen);\n}\n\n/** Asserts a hash instance has not been destroyed / finished */\nexport function aexists(instance: any, checkFinished = true): void {\n if (instance.destroyed) throw new Error('Hash instance has been destroyed');\n if (checkFinished && instance.finished) throw new Error('Hash#digest() has already been called');\n}\n\n/** Asserts output is properly-sized byte array */\nexport function aoutput(out: any, instance: any): void {\n abytes(out);\n const min = instance.outputLen;\n if (out.length < min) {\n throw new Error('digestInto() expects output buffer of length at least ' + min);\n }\n}\n\n/** Generic type encompassing 8/16/32-byte arrays - but not 64-byte. */\n// prettier-ignore\nexport type TypedArray = Int8Array | Uint8ClampedArray | Uint8Array |\n Uint16Array | Int16Array | Uint32Array | Int32Array;\n\n/** Cast u8 / u16 / u32 to u8. */\nexport function u8(arr: TypedArray): Uint8Array {\n return new Uint8Array(arr.buffer, arr.byteOffset, arr.byteLength);\n}\n\n/** Cast u8 / u16 / u32 to u32. */\nexport function u32(arr: TypedArray): Uint32Array {\n return new Uint32Array(arr.buffer, arr.byteOffset, Math.floor(arr.byteLength / 4));\n}\n\n/** Zeroize a byte array. Warning: JS provides no guarantees. */\nexport function clean(...arrays: TypedArray[]): void {\n for (let i = 0; i < arrays.length; i++) {\n arrays[i].fill(0);\n }\n}\n\n/** Create DataView of an array for easy byte-level manipulation. */\nexport function createView(arr: TypedArray): DataView {\n return new DataView(arr.buffer, arr.byteOffset, arr.byteLength);\n}\n\n/** The rotate right (circular right shift) operation for uint32 */\nexport function rotr(word: number, shift: number): number {\n return (word << (32 - shift)) | (word >>> shift);\n}\n\n/** The rotate left (circular left shift) operation for uint32 */\nexport function rotl(word: number, shift: number): number {\n return (word << shift) | ((word >>> (32 - shift)) >>> 0);\n}\n\n/** Is current platform little-endian? Most are. Big-Endian platform: IBM */\nexport const isLE: boolean = /* @__PURE__ */ (() =>\n new Uint8Array(new Uint32Array([0x11223344]).buffer)[0] === 0x44)();\n\n/** The byte swap operation for uint32 */\nexport function byteSwap(word: number): number {\n return (\n ((word << 24) & 0xff000000) |\n ((word << 8) & 0xff0000) |\n ((word >>> 8) & 0xff00) |\n ((word >>> 24) & 0xff)\n );\n}\n/** Conditionally byte swap if on a big-endian platform */\nexport const swap8IfBE: (n: number) => number = isLE\n ? (n: number) => n\n : (n: number) => byteSwap(n);\n\n/** @deprecated */\nexport const byteSwapIfBE: typeof swap8IfBE = swap8IfBE;\n/** In place byte swap for Uint32Array */\nexport function byteSwap32(arr: Uint32Array): Uint32Array {\n for (let i = 0; i < arr.length; i++) {\n arr[i] = byteSwap(arr[i]);\n }\n return arr;\n}\n\nexport const swap32IfBE: (u: Uint32Array) => Uint32Array = isLE\n ? (u: Uint32Array) => u\n : byteSwap32;\n\n// Built-in hex conversion https://caniuse.com/mdn-javascript_builtins_uint8array_fromhex\nconst hasHexBuiltin: boolean = /* @__PURE__ */ (() =>\n // @ts-ignore\n typeof Uint8Array.from([]).toHex === 'function' && typeof Uint8Array.fromHex === 'function')();\n\n// Array where index 0xf0 (240) is mapped to string 'f0'\nconst hexes = /* @__PURE__ */ Array.from({ length: 256 }, (_, i) =>\n i.toString(16).padStart(2, '0')\n);\n\n/**\n * Convert byte array to hex string. Uses built-in function, when available.\n * @example bytesToHex(Uint8Array.from([0xca, 0xfe, 0x01, 0x23])) // 'cafe0123'\n */\nexport function bytesToHex(bytes: Uint8Array): string {\n abytes(bytes);\n // @ts-ignore\n if (hasHexBuiltin) return bytes.toHex();\n // pre-caching improves the speed 6x\n let hex = '';\n for (let i = 0; i < bytes.length; i++) {\n hex += hexes[bytes[i]];\n }\n return hex;\n}\n\n// We use optimized technique to convert hex string to byte array\nconst asciis = { _0: 48, _9: 57, A: 65, F: 70, a: 97, f: 102 } as const;\nfunction asciiToBase16(ch: number): number | undefined {\n if (ch >= asciis._0 && ch <= asciis._9) return ch - asciis._0; // '2' => 50-48\n if (ch >= asciis.A && ch <= asciis.F) return ch - (asciis.A - 10); // 'B' => 66-(65-10)\n if (ch >= asciis.a && ch <= asciis.f) return ch - (asciis.a - 10); // 'b' => 98-(97-10)\n return;\n}\n\n/**\n * Convert hex string to byte array. Uses built-in function, when available.\n * @example hexToBytes('cafe0123') // Uint8Array.from([0xca, 0xfe, 0x01, 0x23])\n */\nexport function hexToBytes(hex: string): Uint8Array {\n if (typeof hex !== 'string') throw new Error('hex string expected, got ' + typeof hex);\n // @ts-ignore\n if (hasHexBuiltin) return Uint8Array.fromHex(hex);\n const hl = hex.length;\n const al = hl / 2;\n if (hl % 2) throw new Error('hex string expected, got unpadded hex of length ' + hl);\n const array = new Uint8Array(al);\n for (let ai = 0, hi = 0; ai < al; ai++, hi += 2) {\n const n1 = asciiToBase16(hex.charCodeAt(hi));\n const n2 = asciiToBase16(hex.charCodeAt(hi + 1));\n if (n1 === undefined || n2 === undefined) {\n const char = hex[hi] + hex[hi + 1];\n throw new Error('hex string expected, got non-hex character \"' + char + '\" at index ' + hi);\n }\n array[ai] = n1 * 16 + n2; // multiply first octet, e.g. 'a3' => 10*16+3 => 160 + 3 => 163\n }\n return array;\n}\n\n/**\n * There is no setImmediate in browser and setTimeout is slow.\n * Call of async fn will return Promise, which will be fullfiled only on\n * next scheduler queue processing step and this is exactly what we need.\n */\nexport const nextTick = async (): Promise<void> => {};\n\n/** Returns control to thread each 'tick' ms to avoid blocking. */\nexport async function asyncLoop(\n iters: number,\n tick: number,\n cb: (i: number) => void\n): Promise<void> {\n let ts = Date.now();\n for (let i = 0; i < iters; i++) {\n cb(i);\n // Date.now() is not monotonic, so in case if clock goes backwards we return return control too\n const diff = Date.now() - ts;\n if (diff >= 0 && diff < tick) continue;\n await nextTick();\n ts += diff;\n }\n}\n\n// Global symbols, but ts doesn't see them: https://github.com/microsoft/TypeScript/issues/31535\ndeclare const TextEncoder: any;\ndeclare const TextDecoder: any;\n\n/**\n * Converts string to bytes using UTF8 encoding.\n * @example utf8ToBytes('abc') // Uint8Array.from([97, 98, 99])\n */\nexport function utf8ToBytes(str: string): Uint8Array {\n if (typeof str !== 'string') throw new Error('string expected');\n return new Uint8Array(new TextEncoder().encode(str)); // https://bugzil.la/1681809\n}\n\n/**\n * Converts bytes to string using UTF8 encoding.\n * @example bytesToUtf8(Uint8Array.from([97, 98, 99])) // 'abc'\n */\nexport function bytesToUtf8(bytes: Uint8Array): string {\n return new TextDecoder().decode(bytes);\n}\n\n/** Accepted input of hash functions. Strings are converted to byte arrays. */\nexport type Input = string | Uint8Array;\n/**\n * Normalizes (non-hex) string or Uint8Array to Uint8Array.\n * Warning: when Uint8Array is passed, it would NOT get copied.\n * Keep in mind for future mutable operations.\n */\nexport function toBytes(data: Input): Uint8Array {\n if (typeof data === 'string') data = utf8ToBytes(data);\n abytes(data);\n return data;\n}\n\n/** KDFs can accept string or Uint8Array for user convenience. */\nexport type KDFInput = string | Uint8Array;\n/**\n * Helper for KDFs: consumes uint8array or string.\n * When string is passed, does utf8 decoding, using TextDecoder.\n */\nexport function kdfInputToBytes(data: KDFInput): Uint8Array {\n if (typeof data === 'string') data = utf8ToBytes(data);\n abytes(data);\n return data;\n}\n\n/** Copies several Uint8Arrays into one. */\nexport function concatBytes(...arrays: Uint8Array[]): Uint8Array {\n let sum = 0;\n for (let i = 0; i < arrays.length; i++) {\n const a = arrays[i];\n abytes(a);\n sum += a.length;\n }\n const res = new Uint8Array(sum);\n for (let i = 0, pad = 0; i < arrays.length; i++) {\n const a = arrays[i];\n res.set(a, pad);\n pad += a.length;\n }\n return res;\n}\n\ntype EmptyObj = {};\nexport function checkOpts<T1 extends EmptyObj, T2 extends EmptyObj>(\n defaults: T1,\n opts?: T2\n): T1 & T2 {\n if (opts !== undefined && {}.toString.call(opts) !== '[object Object]')\n throw new Error('options should be object or undefined');\n const merged = Object.assign(defaults, opts);\n return merged as T1 & T2;\n}\n\n/** Hash interface. */\nexport type IHash = {\n (data: Uint8Array): Uint8Array;\n blockLen: number;\n outputLen: number;\n create: any;\n};\n\n/** For runtime check if class implements interface */\nexport abstract class Hash<T extends Hash<T>> {\n abstract blockLen: number; // Bytes per block\n abstract outputLen: number; // Bytes in output\n abstract update(buf: Input): this;\n // Writes digest into buf\n abstract digestInto(buf: Uint8Array): void;\n abstract digest(): Uint8Array;\n /**\n * Resets internal state. Makes Hash instance unusable.\n * Reset is impossible for keyed hashes if key is consumed into state. If digest is not consumed\n * by user, they will need to manually call `destroy()` when zeroing is necessary.\n */\n abstract destroy(): void;\n /**\n * Clones hash instance. Unsafe: doesn't check whether `to` is valid. Can be used as `clone()`\n * when no options are passed.\n * Reasons to use `_cloneInto` instead of clone: 1) performance 2) reuse instance => all internal\n * buffers are overwritten => causes buffer overwrite which is used for digest in some cases.\n * There are no guarantees for clean-up because it's impossible in JS.\n */\n abstract _cloneInto(to?: T): T;\n // Safe version that clones internal state\n abstract clone(): T;\n}\n\n/**\n * XOF: streaming API to read digest in chunks.\n * Same as 'squeeze' in keccak/k12 and 'seek' in blake3, but more generic name.\n * When hash used in XOF mode it is up to user to call '.destroy' afterwards, since we cannot\n * destroy state, next call can require more bytes.\n */\nexport type HashXOF<T extends Hash<T>> = Hash<T> & {\n xof(bytes: number): Uint8Array; // Read 'bytes' bytes from digest stream\n xofInto(buf: Uint8Array): Uint8Array; // read buf.length bytes from digest stream into buf\n};\n\n/** Hash function */\nexport type CHash = ReturnType<typeof createHasher>;\n/** Hash function with output */\nexport type CHashO = ReturnType<typeof createOptHasher>;\n/** XOF with output */\nexport type CHashXO = ReturnType<typeof createXOFer>;\n\n/** Wraps hash function, creating an interface on top of it */\nexport function createHasher<T extends Hash<T>>(\n hashCons: () => Hash<T>\n): {\n (msg: Input): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(): Hash<T>;\n} {\n const hashC = (msg: Input): Uint8Array => hashCons().update(toBytes(msg)).digest();\n const tmp = hashCons();\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = () => hashCons();\n return hashC;\n}\n\nexport function createOptHasher<H extends Hash<H>, T extends Object>(\n hashCons: (opts?: T) => Hash<H>\n): {\n (msg: Input, opts?: T): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(opts?: T): Hash<H>;\n} {\n const hashC = (msg: Input, opts?: T): Uint8Array => hashCons(opts).update(toBytes(msg)).digest();\n const tmp = hashCons({} as T);\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = (opts?: T) => hashCons(opts);\n return hashC;\n}\n\nexport function createXOFer<H extends HashXOF<H>, T extends Object>(\n hashCons: (opts?: T) => HashXOF<H>\n): {\n (msg: Input, opts?: T): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(opts?: T): HashXOF<H>;\n} {\n const hashC = (msg: Input, opts?: T): Uint8Array => hashCons(opts).update(toBytes(msg)).digest();\n const tmp = hashCons({} as T);\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = (opts?: T) => hashCons(opts);\n return hashC;\n}\nexport const wrapConstructor: typeof createHasher = createHasher;\nexport const wrapConstructorWithOpts: typeof createOptHasher = createOptHasher;\nexport const wrapXOFConstructorWithOpts: typeof createXOFer = createXOFer;\n\n/** Cryptographically secure PRNG. Uses internal OS-level `crypto.getRandomValues`. */\nexport function randomBytes(bytesLength = 32): Uint8Array {\n if (crypto && typeof crypto.getRandomValues === 'function') {\n return crypto.getRandomValues(new Uint8Array(bytesLength));\n }\n // Legacy Node.js compatibility\n if (crypto && typeof crypto.randomBytes === 'function') {\n return Uint8Array.from(crypto.randomBytes(bytesLength));\n }\n throw new Error('crypto.getRandomValues must be defined');\n}\n", "/**\n * Internal Merkle-Damgard hash utils.\n * @module\n */\nimport { type Input, Hash, abytes, aexists, aoutput, clean, createView, toBytes } from './utils.ts';\n\n/** Polyfill for Safari 14. https://caniuse.com/mdn-javascript_builtins_dataview_setbiguint64 */\nexport function setBigUint64(\n view: DataView,\n byteOffset: number,\n value: bigint,\n isLE: boolean\n): void {\n if (typeof view.setBigUint64 === 'function') return view.setBigUint64(byteOffset, value, isLE);\n const _32n = BigInt(32);\n const _u32_max = BigInt(0xffffffff);\n const wh = Number((value >> _32n) & _u32_max);\n const wl = Number(value & _u32_max);\n const h = isLE ? 4 : 0;\n const l = isLE ? 0 : 4;\n view.setUint32(byteOffset + h, wh, isLE);\n view.setUint32(byteOffset + l, wl, isLE);\n}\n\n/** Choice: a ? b : c */\nexport function Chi(a: number, b: number, c: number): number {\n return (a & b) ^ (~a & c);\n}\n\n/** Majority function, true if any two inputs is true. */\nexport function Maj(a: number, b: number, c: number): number {\n return (a & b) ^ (a & c) ^ (b & c);\n}\n\n/**\n * Merkle-Damgard hash construction base class.\n * Could be used to create MD5, RIPEMD, SHA1, SHA2.\n */\nexport abstract class HashMD<T extends HashMD<T>> extends Hash<T> {\n protected abstract process(buf: DataView, offset: number): void;\n protected abstract get(): number[];\n protected abstract set(...args: number[]): void;\n abstract destroy(): void;\n protected abstract roundClean(): void;\n\n readonly blockLen: number;\n readonly outputLen: number;\n readonly padOffset: number;\n readonly isLE: boolean;\n\n // For partial updates less than block size\n protected buffer: Uint8Array;\n protected view: DataView;\n protected finished = false;\n protected length = 0;\n protected pos = 0;\n protected destroyed = false;\n\n constructor(blockLen: number, outputLen: number, padOffset: number, isLE: boolean) {\n super();\n this.blockLen = blockLen;\n this.outputLen = outputLen;\n this.padOffset = padOffset;\n this.isLE = isLE;\n this.buffer = new Uint8Array(blockLen);\n this.view = createView(this.buffer);\n }\n update(data: Input): this {\n aexists(this);\n data = toBytes(data);\n abytes(data);\n const { view, buffer, blockLen } = this;\n const len = data.length;\n for (let pos = 0; pos < len; ) {\n const take = Math.min(blockLen - this.pos, len - pos);\n // Fast path: we have at least one block in input, cast it to view and process\n if (take === blockLen) {\n const dataView = createView(data);\n for (; blockLen <= len - pos; pos += blockLen) this.process(dataView, pos);\n continue;\n }\n buffer.set(data.subarray(pos, pos + take), this.pos);\n this.pos += take;\n pos += take;\n if (this.pos === blockLen) {\n this.process(view, 0);\n this.pos = 0;\n }\n }\n this.length += data.length;\n this.roundClean();\n return this;\n }\n digestInto(out: Uint8Array): void {\n aexists(this);\n aoutput(out, this);\n this.finished = true;\n // Padding\n // We can avoid allocation of buffer for padding completely if it\n // was previously not allocated here. But it won't change performance.\n const { buffer, view, blockLen, isLE } = this;\n let { pos } = this;\n // append the bit '1' to the message\n buffer[pos++] = 0b10000000;\n clean(this.buffer.subarray(pos));\n // we have less than padOffset left in buffer, so we cannot put length in\n // current block, need process it and pad again\n if (this.padOffset > blockLen - pos) {\n this.process(view, 0);\n pos = 0;\n }\n // Pad until full block byte with zeros\n for (let i = pos; i < blockLen; i++) buffer[i] = 0;\n // Note: sha512 requires length to be 128bit integer, but length in JS will overflow before that\n // You need to write around 2 exabytes (u64_max / 8 / (1024**6)) for this to happen.\n // So we just write lowest 64 bits of that value.\n setBigUint64(view, blockLen - 8, BigInt(this.length * 8), isLE);\n this.process(view, 0);\n const oview = createView(out);\n const len = this.outputLen;\n // NOTE: we do division by 4 later, which should be fused in single op with modulo by JIT\n if (len % 4) throw new Error('_sha2: outputLen should be aligned to 32bit');\n const outLen = len / 4;\n const state = this.get();\n if (outLen > state.length) throw new Error('_sha2: outputLen bigger than state');\n for (let i = 0; i < outLen; i++) oview.setUint32(4 * i, state[i], isLE);\n }\n digest(): Uint8Array {\n const { buffer, outputLen } = this;\n this.digestInto(buffer);\n const res = buffer.slice(0, outputLen);\n this.destroy();\n return res;\n }\n _cloneInto(to?: T): T {\n to ||= new (this.constructor as any)() as T;\n to.set(...this.get());\n const { blockLen, buffer, length, finished, destroyed, pos } = this;\n to.destroyed = destroyed;\n to.finished = finished;\n to.length = length;\n to.pos = pos;\n if (length % blockLen) to.buffer.set(buffer);\n return to;\n }\n clone(): T {\n return this._cloneInto();\n }\n}\n\n/**\n * Initial SHA-2 state: fractional parts of square roots of first 16 primes 2..53.\n * Check out `test/misc/sha2-gen-iv.js` for recomputation guide.\n */\n\n/** Initial SHA256 state. Bits 0..32 of frac part of sqrt of primes 2..19 */\nexport const SHA256_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0x6a09e667, 0xbb67ae85, 0x3c6ef372, 0xa54ff53a, 0x510e527f, 0x9b05688c, 0x1f83d9ab, 0x5be0cd19,\n]);\n\n/** Initial SHA224 state. Bits 32..64 of frac part of sqrt of primes 23..53 */\nexport const SHA224_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0xc1059ed8, 0x367cd507, 0x3070dd17, 0xf70e5939, 0xffc00b31, 0x68581511, 0x64f98fa7, 0xbefa4fa4,\n]);\n\n/** Initial SHA384 state. Bits 0..64 of frac part of sqrt of primes 23..53 */\nexport const SHA384_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0xcbbb9d5d, 0xc1059ed8, 0x629a292a, 0x367cd507, 0x9159015a, 0x3070dd17, 0x152fecd8, 0xf70e5939,\n 0x67332667, 0xffc00b31, 0x8eb44a87, 0x68581511, 0xdb0c2e0d, 0x64f98fa7, 0x47b5481d, 0xbefa4fa4,\n]);\n\n/** Initial SHA512 state. Bits 0..64 of frac part of sqrt of primes 2..19 */\nexport const SHA512_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0x6a09e667, 0xf3bcc908, 0xbb67ae85, 0x84caa73b, 0x3c6ef372, 0xfe94f82b, 0xa54ff53a, 0x5f1d36f1,\n 0x510e527f, 0xade682d1, 0x9b05688c, 0x2b3e6c1f, 0x1f83d9ab, 0xfb41bd6b, 0x5be0cd19, 0x137e2179,\n]);\n", "/**\n * SHA2 hash function. A.k.a. sha256, sha384, sha512, sha512_224, sha512_256.\n * SHA256 is the fastest hash implementable in JS, even faster than Blake3.\n * Check out [RFC 4634](https://datatracker.ietf.org/doc/html/rfc4634) and\n * [FIPS 180-4](https://nvlpubs.nist.gov/nistpubs/FIPS/NIST.FIPS.180-4.pdf).\n * @module\n */\nimport { Chi, HashMD, Maj, SHA224_IV, SHA256_IV, SHA384_IV, SHA512_IV } from './_md.ts';\nimport * as u64 from './_u64.ts';\nimport { type CHash, clean, createHasher, rotr } from './utils.ts';\n\n/**\n * Round constants:\n * First 32 bits of fractional parts of the cube roots of the first 64 primes 2..311)\n */\n// prettier-ignore\nconst SHA256_K = /* @__PURE__ */ Uint32Array.from([\n 0x428a2f98, 0x71374491, 0xb5c0fbcf, 0xe9b5dba5, 0x3956c25b, 0x59f111f1, 0x923f82a4, 0xab1c5ed5,\n 0xd807aa98, 0x12835b01, 0x243185be, 0x550c7dc3, 0x72be5d74, 0x80deb1fe, 0x9bdc06a7, 0xc19bf174,\n 0xe49b69c1, 0xefbe4786, 0x0fc19dc6, 0x240ca1cc, 0x2de92c6f, 0x4a7484aa, 0x5cb0a9dc, 0x76f988da,\n 0x983e5152, 0xa831c66d, 0xb00327c8, 0xbf597fc7, 0xc6e00bf3, 0xd5a79147, 0x06ca6351, 0x14292967,\n 0x27b70a85, 0x2e1b2138, 0x4d2c6dfc, 0x53380d13, 0x650a7354, 0x766a0abb, 0x81c2c92e, 0x92722c85,\n 0xa2bfe8a1, 0xa81a664b, 0xc24b8b70, 0xc76c51a3, 0xd192e819, 0xd6990624, 0xf40e3585, 0x106aa070,\n 0x19a4c116, 0x1e376c08, 0x2748774c, 0x34b0bcb5, 0x391c0cb3, 0x4ed8aa4a, 0x5b9cca4f, 0x682e6ff3,\n 0x748f82ee, 0x78a5636f, 0x84c87814, 0x8cc70208, 0x90befffa, 0xa4506ceb, 0xbef9a3f7, 0xc67178f2\n]);\n\n/** Reusable temporary buffer. \"W\" comes straight from spec. */\nconst SHA256_W = /* @__PURE__ */ new Uint32Array(64);\nexport class SHA256 extends HashMD<SHA256> {\n // We cannot use array here since array allows indexing by variable\n // which means optimizer/compiler cannot use registers.\n protected A: number = SHA256_IV[0] | 0;\n protected B: number = SHA256_IV[1] | 0;\n protected C: number = SHA256_IV[2] | 0;\n protected D: number = SHA256_IV[3] | 0;\n protected E: number = SHA256_IV[4] | 0;\n protected F: number = SHA256_IV[5] | 0;\n protected G: number = SHA256_IV[6] | 0;\n protected H: number = SHA256_IV[7] | 0;\n\n constructor(outputLen: number = 32) {\n super(64, outputLen, 8, false);\n }\n protected get(): [number, number, number, number, number, number, number, number] {\n const { A, B, C, D, E, F, G, H } = this;\n return [A, B, C, D, E, F, G, H];\n }\n // prettier-ignore\n protected set(\n A: number, B: number, C: number, D: number, E: number, F: number, G: number, H: number\n ): void {\n this.A = A | 0;\n this.B = B | 0;\n this.C = C | 0;\n this.D = D | 0;\n this.E = E | 0;\n this.F = F | 0;\n this.G = G | 0;\n this.H = H | 0;\n }\n protected process(view: DataView, offset: number): void {\n // Extend the first 16 words into the remaining 48 words w[16..63] of the message schedule array\n for (let i = 0; i < 16; i++, offset += 4) SHA256_W[i] = view.getUint32(offset, false);\n for (let i = 16; i < 64; i++) {\n const W15 = SHA256_W[i - 15];\n const W2 = SHA256_W[i - 2];\n const s0 = rotr(W15, 7) ^ rotr(W15, 18) ^ (W15 >>> 3);\n const s1 = rotr(W2, 17) ^ rotr(W2, 19) ^ (W2 >>> 10);\n SHA256_W[i] = (s1 + SHA256_W[i - 7] + s0 + SHA256_W[i - 16]) | 0;\n }\n // Compression function main loop, 64 rounds\n let { A, B, C, D, E, F, G, H } = this;\n for (let i = 0; i < 64; i++) {\n const sigma1 = rotr(E, 6) ^ rotr(E, 11) ^ rotr(E, 25);\n const T1 = (H + sigma1 + Chi(E, F, G) + SHA256_K[i] + SHA256_W[i]) | 0;\n const sigma0 = rotr(A, 2) ^ rotr(A, 13) ^ rotr(A, 22);\n const T2 = (sigma0 + Maj(A, B, C)) | 0;\n H = G;\n G = F;\n F = E;\n E = (D + T1) | 0;\n D = C;\n C = B;\n B = A;\n A = (T1 + T2) | 0;\n }\n // Add the compressed chunk to the current hash value\n A = (A + this.A) | 0;\n B = (B + this.B) | 0;\n C = (C + this.C) | 0;\n D = (D + this.D) | 0;\n E = (E + this.E) | 0;\n F = (F + this.F) | 0;\n G = (G + this.G) | 0;\n H = (H + this.H) | 0;\n this.set(A, B, C, D, E, F, G, H);\n }\n protected roundClean(): void {\n clean(SHA256_W);\n }\n destroy(): void {\n this.set(0, 0, 0, 0, 0, 0, 0, 0);\n clean(this.buffer);\n }\n}\n\nexport class SHA224 extends SHA256 {\n protected A: number = SHA224_IV[0] | 0;\n protected B: number = SHA224_IV[1] | 0;\n protected C: number = SHA224_IV[2] | 0;\n protected D: number = SHA224_IV[3] | 0;\n protected E: number = SHA224_IV[4] | 0;\n protected F: number = SHA224_IV[5] | 0;\n protected G: number = SHA224_IV[6] | 0;\n protected H: number = SHA224_IV[7] | 0;\n constructor() {\n super(28);\n }\n}\n\n// SHA2-512 is slower than sha256 in js because u64 operations are slow.\n\n// Round contants\n// First 32 bits of the fractional parts of the cube roots of the first 80 primes 2..409\n// prettier-ignore\nconst K512 = /* @__PURE__ */ (() => u64.split([\n '0x428a2f98d728ae22', '0x7137449123ef65cd', '0xb5c0fbcfec4d3b2f', '0xe9b5dba58189dbbc',\n '0x3956c25bf348b538', '0x59f111f1b605d019', '0x923f82a4af194f9b', '0xab1c5ed5da6d8118',\n '0xd807aa98a3030242', '0x12835b0145706fbe', '0x243185be4ee4b28c', '0x550c7dc3d5ffb4e2',\n '0x72be5d74f27b896f', '0x80deb1fe3b1696b1', '0x9bdc06a725c71235', '0xc19bf174cf692694',\n '0xe49b69c19ef14ad2', '0xefbe4786384f25e3', '0x0fc19dc68b8cd5b5', '0x240ca1cc77ac9c65',\n '0x2de92c6f592b0275', '0x4a7484aa6ea6e483', '0x5cb0a9dcbd41fbd4', '0x76f988da831153b5',\n '0x983e5152ee66dfab', '0xa831c66d2db43210', '0xb00327c898fb213f', '0xbf597fc7beef0ee4',\n '0xc6e00bf33da88fc2', '0xd5a79147930aa725', '0x06ca6351e003826f', '0x142929670a0e6e70',\n '0x27b70a8546d22ffc', '0x2e1b21385c26c926', '0x4d2c6dfc5ac42aed', '0x53380d139d95b3df',\n '0x650a73548baf63de', '0x766a0abb3c77b2a8', '0x81c2c92e47edaee6', '0x92722c851482353b',\n '0xa2bfe8a14cf10364', '0xa81a664bbc423001', '0xc24b8b70d0f89791', '0xc76c51a30654be30',\n '0xd192e819d6ef5218', '0xd69906245565a910', '0xf40e35855771202a', '0x106aa07032bbd1b8',\n '0x19a4c116b8d2d0c8', '0x1e376c085141ab53', '0x2748774cdf8eeb99', '0x34b0bcb5e19b48a8',\n '0x391c0cb3c5c95a63', '0x4ed8aa4ae3418acb', '0x5b9cca4f7763e373', '0x682e6ff3d6b2b8a3',\n '0x748f82ee5defb2fc', '0x78a5636f43172f60', '0x84c87814a1f0ab72', '0x8cc702081a6439ec',\n '0x90befffa23631e28', '0xa4506cebde82bde9', '0xbef9a3f7b2c67915', '0xc67178f2e372532b',\n '0xca273eceea26619c', '0xd186b8c721c0c207', '0xeada7dd6cde0eb1e', '0xf57d4f7fee6ed178',\n '0x06f067aa72176fba', '0x0a637dc5a2c898a6', '0x113f9804bef90dae', '0x1b710b35131c471b',\n '0x28db77f523047d84', '0x32caab7b40c72493', '0x3c9ebe0a15c9bebc', '0x431d67c49c100d4c',\n '0x4cc5d4becb3e42b6', '0x597f299cfc657e2a', '0x5fcb6fab3ad6faec', '0x6c44198c4a475817'\n].map(n => BigInt(n))))();\nconst SHA512_Kh = /* @__PURE__ */ (() => K512[0])();\nconst SHA512_Kl = /* @__PURE__ */ (() => K512[1])();\n\n// Reusable temporary buffers\nconst SHA512_W_H = /* @__PURE__ */ new Uint32Array(80);\nconst SHA512_W_L = /* @__PURE__ */ new Uint32Array(80);\n\nexport class SHA512 extends HashMD<SHA512> {\n // We cannot use array here since array allows indexing by variable\n // which means optimizer/compiler cannot use registers.\n // h -- high 32 bits, l -- low 32 bits\n protected Ah: number = SHA512_IV[0] | 0;\n protected Al: number = SHA512_IV[1] | 0;\n protected Bh: number = SHA512_IV[2] | 0;\n protected Bl: number = SHA512_IV[3] | 0;\n protected Ch: number = SHA512_IV[4] | 0;\n protected Cl: number = SHA512_IV[5] | 0;\n protected Dh: number = SHA512_IV[6] | 0;\n protected Dl: number = SHA512_IV[7] | 0;\n protected Eh: number = SHA512_IV[8] | 0;\n protected El: number = SHA512_IV[9] | 0;\n protected Fh: number = SHA512_IV[10] | 0;\n protected Fl: number = SHA512_IV[11] | 0;\n protected Gh: number = SHA512_IV[12] | 0;\n protected Gl: number = SHA512_IV[13] | 0;\n protected Hh: number = SHA512_IV[14] | 0;\n protected Hl: number = SHA512_IV[15] | 0;\n\n constructor(outputLen: number = 64) {\n super(128, outputLen, 16, false);\n }\n // prettier-ignore\n protected get(): [\n number, number, number, number, number, number, number, number,\n number, number, number, number, number, number, number, number\n ] {\n const { Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl } = this;\n return [Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl];\n }\n // prettier-ignore\n protected set(\n Ah: number, Al: number, Bh: number, Bl: number, Ch: number, Cl: number, Dh: number, Dl: number,\n Eh: number, El: number, Fh: number, Fl: number, Gh: number, Gl: number, Hh: number, Hl: number\n ): void {\n this.Ah = Ah | 0;\n this.Al = Al | 0;\n this.Bh = Bh | 0;\n this.Bl = Bl | 0;\n this.Ch = Ch | 0;\n this.Cl = Cl | 0;\n this.Dh = Dh | 0;\n this.Dl = Dl | 0;\n this.Eh = Eh | 0;\n this.El = El | 0;\n this.Fh = Fh | 0;\n this.Fl = Fl | 0;\n this.Gh = Gh | 0;\n this.Gl = Gl | 0;\n this.Hh = Hh | 0;\n this.Hl = Hl | 0;\n }\n protected process(view: DataView, offset: number): void {\n // Extend the first 16 words into the remaining 64 words w[16..79] of the message schedule array\n for (let i = 0; i < 16; i++, offset += 4) {\n SHA512_W_H[i] = view.getUint32(offset);\n SHA512_W_L[i] = view.getUint32((offset += 4));\n }\n for (let i = 16; i < 80; i++) {\n // s0 := (w[i-15] rightrotate 1) xor (w[i-15] rightrotate 8) xor (w[i-15] rightshift 7)\n const W15h = SHA512_W_H[i - 15] | 0;\n const W15l = SHA512_W_L[i - 15] | 0;\n const s0h = u64.rotrSH(W15h, W15l, 1) ^ u64.rotrSH(W15h, W15l, 8) ^ u64.shrSH(W15h, W15l, 7);\n const s0l = u64.rotrSL(W15h, W15l, 1) ^ u64.rotrSL(W15h, W15l, 8) ^ u64.shrSL(W15h, W15l, 7);\n // s1 := (w[i-2] rightrotate 19) xor (w[i-2] rightrotate 61) xor (w[i-2] rightshift 6)\n const W2h = SHA512_W_H[i - 2] | 0;\n const W2l = SHA512_W_L[i - 2] | 0;\n const s1h = u64.rotrSH(W2h, W2l, 19) ^ u64.rotrBH(W2h, W2l, 61) ^ u64.shrSH(W2h, W2l, 6);\n const s1l = u64.rotrSL(W2h, W2l, 19) ^ u64.rotrBL(W2h, W2l, 61) ^ u64.shrSL(W2h, W2l, 6);\n // SHA256_W[i] = s0 + s1 + SHA256_W[i - 7] + SHA256_W[i - 16];\n const SUMl = u64.add4L(s0l, s1l, SHA512_W_L[i - 7], SHA512_W_L[i - 16]);\n const SUMh = u64.add4H(SUMl, s0h, s1h, SHA512_W_H[i - 7], SHA512_W_H[i - 16]);\n SHA512_W_H[i] = SUMh | 0;\n SHA512_W_L[i] = SUMl | 0;\n }\n let { Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl } = this;\n // Compression function main loop, 80 rounds\n for (let i = 0; i < 80; i++) {\n // S1 := (e rightrotate 14) xor (e rightrotate 18) xor (e rightrotate 41)\n const sigma1h = u64.rotrSH(Eh, El, 14) ^ u64.rotrSH(Eh, El, 18) ^ u64.rotrBH(Eh, El, 41);\n const sigma1l = u64.rotrSL(Eh, El, 14) ^ u64.rotrSL(Eh, El, 18) ^ u64.rotrBL(Eh, El, 41);\n //const T1 = (H + sigma1 + Chi(E, F, G) + SHA256_K[i] + SHA256_W[i]) | 0;\n const CHIh = (Eh & Fh) ^ (~Eh & Gh);\n const CHIl = (El & Fl) ^ (~El & Gl);\n // T1 = H + sigma1 + Chi(E, F, G) + SHA512_K[i] + SHA512_W[i]\n // prettier-ignore\n const T1ll = u64.add5L(Hl, sigma1l, CHIl, SHA512_Kl[i], SHA512_W_L[i]);\n const T1h = u64.add5H(T1ll, Hh, sigma1h, CHIh, SHA512_Kh[i], SHA512_W_H[i]);\n const T1l = T1ll | 0;\n // S0 := (a rightrotate 28) xor (a rightrotate 34) xor (a rightrotate 39)\n const sigma0h = u64.rotrSH(Ah, Al, 28) ^ u64.rotrBH(Ah, Al, 34) ^ u64.rotrBH(Ah, Al, 39);\n const sigma0l = u64.rotrSL(Ah, Al, 28) ^ u64.rotrBL(Ah, Al, 34) ^ u64.rotrBL(Ah, Al, 39);\n const MAJh = (Ah & Bh) ^ (Ah & Ch) ^ (Bh & Ch);\n const MAJl = (Al & Bl) ^ (Al & Cl) ^ (Bl & Cl);\n Hh = Gh | 0;\n Hl = Gl | 0;\n Gh = Fh | 0;\n Gl = Fl | 0;\n Fh = Eh | 0;\n Fl = El | 0;\n ({ h: Eh, l: El } = u64.add(Dh | 0, Dl | 0, T1h | 0, T1l | 0));\n Dh = Ch | 0;\n Dl = Cl | 0;\n Ch = Bh | 0;\n Cl = Bl | 0;\n Bh = Ah | 0;\n Bl = Al | 0;\n const All = u64.add3L(T1l, sigma0l, MAJl);\n Ah = u64.add3H(All, T1h, sigma0h, MAJh);\n Al = All | 0;\n }\n // Add the compressed chunk to the current hash value\n ({ h: Ah, l: Al } = u64.add(this.Ah | 0, this.Al | 0, Ah | 0, Al | 0));\n ({ h: Bh, l: Bl } = u64.add(this.Bh | 0, this.Bl | 0, Bh | 0, Bl | 0));\n ({ h: Ch, l: Cl } = u64.add(this.Ch | 0, this.Cl | 0, Ch | 0, Cl | 0));\n ({ h: Dh, l: Dl } = u64.add(this.Dh | 0, this.Dl | 0, Dh | 0, Dl | 0));\n ({ h: Eh, l: El } = u64.add(this.Eh | 0, this.El | 0, Eh | 0, El | 0));\n ({ h: Fh, l: Fl } = u64.add(this.Fh | 0, this.Fl | 0, Fh | 0, Fl | 0));\n ({ h: Gh, l: Gl } = u64.add(this.Gh | 0, this.Gl | 0, Gh | 0, Gl | 0));\n ({ h: Hh, l: Hl } = u64.add(this.Hh | 0, this.Hl | 0, Hh | 0, Hl | 0));\n this.set(Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl);\n }\n protected roundClean(): void {\n clean(SHA512_W_H, SHA512_W_L);\n }\n destroy(): void {\n clean(this.buffer);\n this.set(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0);\n }\n}\n\nexport class SHA384 extends SHA512 {\n protected Ah: number = SHA384_IV[0] | 0;\n protected Al: number = SHA384_IV[1] | 0;\n protected Bh: number = SHA384_IV[2] | 0;\n protected Bl: number = SHA384_IV[3] | 0;\n protected Ch: number = SHA384_IV[4] | 0;\n protected Cl: number = SHA384_IV[5] | 0;\n protected Dh: number = SHA384_IV[6] | 0;\n protected Dl: number = SHA384_IV[7] | 0;\n protected Eh: number = SHA384_IV[8] | 0;\n protected El: number = SHA384_IV[9] | 0;\n protected Fh: number = SHA384_IV[10] | 0;\n protected Fl: number = SHA384_IV[11] | 0;\n protected Gh: number = SHA384_IV[12] | 0;\n protected Gl: number = SHA384_IV[13] | 0;\n protected Hh: number = SHA384_IV[14] | 0;\n protected Hl: number = SHA384_IV[15] | 0;\n\n constructor() {\n super(48);\n }\n}\n\n/**\n * Truncated SHA512/256 and SHA512/224.\n * SHA512_IV is XORed with 0xa5a5a5a5a5a5a5a5, then used as \"intermediary\" IV of SHA512/t.\n * Then t hashes string to produce result IV.\n * See `test/misc/sha2-gen-iv.js`.\n */\n\n/** SHA512/224 IV */\nconst T224_IV = /* @__PURE__ */ Uint32Array.from([\n 0x8c3d37c8, 0x19544da2, 0x73e19966, 0x89dcd4d6, 0x1dfab7ae, 0x32ff9c82, 0x679dd514, 0x582f9fcf,\n 0x0f6d2b69, 0x7bd44da8, 0x77e36f73, 0x04c48942, 0x3f9d85a8, 0x6a1d36c8, 0x1112e6ad, 0x91d692a1,\n]);\n\n/** SHA512/256 IV */\nconst T256_IV = /* @__PURE__ */ Uint32Array.from([\n 0x22312194, 0xfc2bf72c, 0x9f555fa3, 0xc84c64c2, 0x2393b86b, 0x6f53b151, 0x96387719, 0x5940eabd,\n 0x96283ee2, 0xa88effe3, 0xbe5e1e25, 0x53863992, 0x2b0199fc, 0x2c85b8aa, 0x0eb72ddc, 0x81c52ca2,\n]);\n\nexport class SHA512_224 extends SHA512 {\n protected Ah: number = T224_IV[0] | 0;\n protected Al: number = T224_IV[1] | 0;\n protected Bh: number = T224_IV[2] | 0;\n protected Bl: number = T224_IV[3] | 0;\n protected Ch: number = T224_IV[4] | 0;\n protected Cl: number = T224_IV[5] | 0;\n protected Dh: number = T224_IV[6] | 0;\n protected Dl: number = T224_IV[7] | 0;\n protected Eh: number = T224_IV[8] | 0;\n protected El: number = T224_IV[9] | 0;\n protected Fh: number = T224_IV[10] | 0;\n protected Fl: number = T224_IV[11] | 0;\n protected Gh: number = T224_IV[12] | 0;\n protected Gl: number = T224_IV[13] | 0;\n protected Hh: number = T224_IV[14] | 0;\n protected Hl: number = T224_IV[15] | 0;\n\n constructor() {\n super(28);\n }\n}\n\nexport class SHA512_256 extends SHA512 {\n protected Ah: number = T256_IV[0] | 0;\n protected Al: number = T256_IV[1] | 0;\n protected Bh: number = T256_IV[2] | 0;\n protected Bl: number = T256_IV[3] | 0;\n protected Ch: number = T256_IV[4] | 0;\n protected Cl: number = T256_IV[5] | 0;\n protected Dh: number = T256_IV[6] | 0;\n protected Dl: number = T256_IV[7] | 0;\n protected Eh: number = T256_IV[8] | 0;\n protected El: number = T256_IV[9] | 0;\n protected Fh: number = T256_IV[10] | 0;\n protected Fl: number = T256_IV[11] | 0;\n protected Gh: number = T256_IV[12] | 0;\n protected Gl: number = T256_IV[13] | 0;\n protected Hh: number = T256_IV[14] | 0;\n protected Hl: number = T256_IV[15] | 0;\n\n constructor() {\n super(32);\n }\n}\n\n/**\n * SHA2-256 hash function from RFC 4634.\n *\n * It is the fastest JS hash, even faster than Blake3.\n * To break sha256 using birthday attack, attackers need to try 2^128 hashes.\n * BTC network is doing 2^70 hashes/sec (2^95 hashes/year) as per 2025.\n */\nexport const sha256: CHash = /* @__PURE__ */ createHasher(() => new SHA256());\n/** SHA2-224 hash function from RFC 4634 */\nexport const sha224: CHash = /* @__PURE__ */ createHasher(() => new SHA224());\n\n/** SHA2-512 hash function from RFC 4634. */\nexport const sha512: CHash = /* @__PURE__ */ createHasher(() => new SHA512());\n/** SHA2-384 hash function from RFC 4634. */\nexport const sha384: CHash = /* @__PURE__ */ createHasher(() => new SHA384());\n\n/**\n * SHA2-512/256 \"truncated\" hash function, with improved resistance to length extension attacks.\n * See the paper on [truncated SHA512](https://eprint.iacr.org/2010/548.pdf).\n */\nexport const sha512_256: CHash = /* @__PURE__ */ createHasher(() => new SHA512_256());\n/**\n * SHA2-512/224 \"truncated\" hash function, with improved resistance to length extension attacks.\n * See the paper on [truncated SHA512](https://eprint.iacr.org/2010/548.pdf).\n */\nexport const sha512_224: CHash = /* @__PURE__ */ createHasher(() => new SHA512_224());\n", "import { base32Decode, base32Encode } from './utils/base32.ts';\nimport { getCrc32 } from './utils/getCrc.ts';\nimport { sha224 } from '@noble/hashes/sha2';\nimport { bytesToHex, hexToBytes } from '@noble/hashes/utils';\n\nexport const JSON_KEY_PRINCIPAL = '__principal__';\nconst SELF_AUTHENTICATING_SUFFIX = 2;\nconst ANONYMOUS_SUFFIX = 4;\n\nconst MANAGEMENT_CANISTER_PRINCIPAL_TEXT_STR = 'aaaaa-aa';\n\nexport type JsonnablePrincipal = {\n [JSON_KEY_PRINCIPAL]: string;\n};\n\nexport class Principal {\n public static anonymous(): Principal {\n return new this(new Uint8Array([ANONYMOUS_SUFFIX]));\n }\n\n /**\n * Utility method, returning the principal representing the management canister, decoded from the hex string `'aaaaa-aa'`\n * @returns {Principal} principal of the management canister\n */\n public static managementCanister(): Principal {\n return this.fromText(MANAGEMENT_CANISTER_PRINCIPAL_TEXT_STR);\n }\n\n public static selfAuthenticating(publicKey: Uint8Array): Principal {\n const sha = sha224(publicKey);\n return new this(new Uint8Array([...sha, SELF_AUTHENTICATING_SUFFIX]));\n }\n\n public static from(other: unknown): Principal {\n if (typeof other === 'string') {\n return Principal.fromText(other);\n } else if (Object.getPrototypeOf(other) === Uint8Array.prototype) {\n return new Principal(other as Uint8Array);\n } else if (Principal.isPrincipal(other)) {\n return new Principal(other._arr);\n }\n\n throw new Error(`Impossible to convert ${JSON.stringify(other)} to Principal.`);\n }\n\n public static fromHex(hex: string): Principal {\n return new this(hexToBytes(hex));\n }\n\n public static fromText(text: string): Principal {\n let maybePrincipal = text;\n // If formatted as JSON string, parse it first\n if (text.includes(JSON_KEY_PRINCIPAL)) {\n const obj = JSON.parse(text);\n if (JSON_KEY_PRINCIPAL in obj) {\n maybePrincipal = obj[JSON_KEY_PRINCIPAL];\n }\n }\n\n const canisterIdNoDash = maybePrincipal.toLowerCase().replace(/-/g, '');\n\n let arr = base32Decode(canisterIdNoDash);\n arr = arr.slice(4, arr.length);\n\n const principal = new this(arr);\n if (principal.toText() !== maybePrincipal) {\n throw new Error(\n `Principal \"${principal.toText()}\" does not have a valid checksum (original value \"${maybePrincipal}\" may not be a valid Principal ID).`,\n );\n }\n\n return principal;\n }\n\n public static fromUint8Array(arr: Uint8Array): Principal {\n return new this(arr);\n }\n\n public static isPrincipal(other: unknown): other is Principal {\n return (\n other instanceof Principal ||\n (typeof other === 'object' &&\n other !== null &&\n '_isPrincipal' in other &&\n (other as { _isPrincipal: boolean })['_isPrincipal'] === true &&\n '_arr' in other &&\n (other as { _arr: Uint8Array })['_arr'] instanceof Uint8Array)\n );\n }\n\n public readonly _isPrincipal = true;\n\n protected constructor(private _arr: Uint8Array) {}\n\n public isAnonymous(): boolean {\n return this._arr.byteLength === 1 && this._arr[0] === ANONYMOUS_SUFFIX;\n }\n\n public toUint8Array(): Uint8Array {\n return this._arr;\n }\n\n public toHex(): string {\n return bytesToHex(this._arr).toUpperCase();\n }\n\n public toText(): string {\n const checksumArrayBuf = new ArrayBuffer(4);\n const view = new DataView(checksumArrayBuf);\n view.setUint32(0, getCrc32(this._arr));\n const checksum = new Uint8Array(checksumArrayBuf);\n\n const array = new Uint8Array([...checksum, ...this._arr]);\n\n const result = base32Encode(array);\n const matches = result.match(/.{1,5}/g);\n if (!matches) {\n // This should only happen if there's no character, which is unreachable.\n throw new Error();\n }\n return matches.join('-');\n }\n\n public toString(): string {\n return this.toText();\n }\n\n /**\n * Serializes to JSON\n * @returns {JsonnablePrincipal} a JSON object with a single key, {@link JSON_KEY_PRINCIPAL}, whose value is the principal as a string\n */\n public toJSON(): JsonnablePrincipal {\n return { [JSON_KEY_PRINCIPAL]: this.toText() };\n }\n\n /**\n * Utility method taking a Principal to compare against. Used for determining canister ranges in certificate verification\n * @param {Principal} other - a {@link Principal} to compare\n * @returns {'lt' | 'eq' | 'gt'} `'lt' | 'eq' | 'gt'` a string, representing less than, equal to, or greater than\n */\n public compareTo(other: Principal): 'lt' | 'eq' | 'gt' {\n for (let i = 0; i < Math.min(this._arr.length, other._arr.length); i++) {\n if (this._arr[i] < other._arr[i]) return 'lt';\n else if (this._arr[i] > other._arr[i]) return 'gt';\n }\n // Here, at least one principal is a prefix of the other principal (they could be the same)\n if (this._arr.length < other._arr.length) return 'lt';\n if (this._arr.length > other._arr.length) return 'gt';\n return 'eq';\n }\n\n /**\n * Utility method checking whether a provided Principal is less than or equal to the current one using the {@link Principal.compareTo} method\n * @param other a {@link Principal} to compare\n * @returns {boolean} boolean\n */\n public ltEq(other: Principal): boolean {\n const cmp = this.compareTo(other);\n return cmp == 'lt' || cmp == 'eq';\n }\n\n /**\n * Utility method checking whether a provided Principal is greater than or equal to the current one using the {@link Principal.compareTo} method\n * @param other a {@link Principal} to compare\n * @returns {boolean} boolean\n */\n public gtEq(other: Principal): boolean {\n const cmp = this.compareTo(other);\n return cmp == 'gt' || cmp == 'eq';\n }\n}\n", "import {PrincipalSchema, Uint8ArraySchema} from '@dfinity/zod-schemas';\nimport * as z from 'zod';\n\nexport const JunoType = {\n /** Validates a Principal. */\n principal: () => PrincipalSchema,\n /** Validates a Uint8Array (blob, vec<u8>). */\n uint8Array: () => Uint8ArraySchema\n};\n\n// z.union is omitted because object unions can't be reliably serialized to Candid/Rust without a discriminator field.\nconst {union: _, ...rest} = z;\n\n/**\n * Juno's type system - an extended Zod instance for Serverless Functions.\n *\n * The schema builder exposes all Zod schemas and functions aside from\n * `union()` which can't be reliably serialized currently without a discriminator field.\n * That's why you should prefer using `discriminatedUnion()` instead.\n *\n * It extends Zod with various schemas useful for writing your custom functions\n * such as `j.principal()` and `j.uint8Array()`.\n *\n * @example\n * import { j } from '@junobuild/schema';\n *\n * const MySchema = j.strictObject({\n * id: j.principal(),\n * name: j.string(),\n * });\n */\nexport const j = Object.assign({}, rest) as unknown as Omit<typeof z, 'union'> & typeof JunoType;\n\nj.principal = JunoType.principal;\nj.uint8Array = JunoType.uint8Array;\n\n// eslint-disable-next-line @typescript-eslint/no-namespace\nexport namespace j {\n export type infer<T extends z.ZodType> = z.infer<T>;\n}\n"],
|
|
5
|
+
"mappings": "AAAA,UAAYA,MAAO,MIAnB,IAAMC,EAAW,mCAGXC,EAAsC,OAAO,OAAO,IAAI,EAC9D,QAASC,EAAI,EAAGA,EAAIF,EAAS,OAAQE,IACnCD,EAAYD,EAASE,CAAC,CAAC,EAAIA,EAI7BD,EAAY,CAAG,EAAIA,EAAY,EAC/BA,EAAY,CAAG,EAAIA,EAAY,EAMzB,SAAUE,EAAaC,EAAiB,CAE5C,IAAIC,EAAO,EAEPC,EAAO,EAGPC,EAAS,GAEb,SAASC,EAAWC,EAAY,CAS9B,OARIJ,EAAO,EAETC,GAAQG,GAAQ,CAACJ,EAGjBC,EAAQG,GAAQJ,EAAQ,IAGtBA,EAAO,GAETA,GAAQ,EACD,IAGLA,EAAO,IAETE,GAAUP,EAASM,GAAQ,CAAC,EAC5BD,GAAQ,GAGH,EACT,CAEA,QAASH,EAAI,EAAGA,EAAIE,EAAM,QACxBF,GAAKM,EAAWJ,EAAMF,CAAC,CAAC,EAG1B,OAAOK,GAAUF,EAAO,EAAIL,EAASM,GAAQ,CAAC,EAAI,GACpD,CAKM,SAAUI,EAAaN,EAAa,CAExC,IAAIC,EAAO,EAEPI,EAAO,EAELF,EAAS,IAAI,WAAaH,EAAM,OAAS,EAAK,EAAK,CAAC,EACtDO,EAAI,EAER,SAASC,EAAWC,EAAY,CAI9B,IAAIC,EAAMb,EAAYY,EAAK,YAAW,CAAE,EACxC,GAAIC,IAAQ,OACV,MAAM,IAAI,MAAM,sBAAsB,KAAK,UAAUD,CAAI,CAAC,EAAE,EAI9DC,IAAQ,EACRL,GAAQK,IAAQT,EAChBA,GAAQ,EAEJA,GAAQ,IAEVE,EAAOI,GAAG,EAAIF,EACdJ,GAAQ,EAEJA,EAAO,EACTI,EAAQK,GAAQ,EAAIT,EAAS,IAE7BI,EAAO,EAGb,CAEA,QAAWM,KAAKX,EACdQ,EAAWG,CAAC,EAGd,OAAOR,EAAO,MAAM,EAAGI,CAAC,CAC1B,CClGA,IAAMK,GAA2B,IAAI,YAAY,CAC/C,EAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,WAAY,SAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,WAAY,SAAY,WAAY,WAAY,WAAY,SAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,WAAY,SAAY,WAAY,WAAY,WAAY,SACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,SAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACrF,EAMK,SAAUC,EAASC,EAAe,CACtC,IAAIC,EAAM,GAEV,QAASC,EAAI,EAAGA,EAAIF,EAAI,OAAQE,IAAK,CAEnC,IAAMC,GADOH,EAAIE,CAAC,EACAD,GAAO,IACzBA,EAAMH,GAAYK,CAAC,EAAKF,IAAQ,CAClC,CAEA,OAAQA,EAAM,MAAQ,CACxB,CCpCM,SAAUG,GAAQC,EAAU,CAChC,OAAOA,aAAa,YAAe,YAAY,OAAOA,CAAC,GAAKA,EAAE,YAAY,OAAS,YACrF,CAQM,SAAUC,EAAOC,KAA8BC,EAAiB,CACpE,GAAI,CAACC,GAAQF,CAAC,EAAG,MAAM,IAAI,MAAM,qBAAqB,EACtD,GAAIC,EAAQ,OAAS,GAAK,CAACA,EAAQ,SAASD,EAAE,MAAM,EAClD,MAAM,IAAI,MAAM,iCAAmCC,EAAU,gBAAkBD,EAAE,MAAM,CAC3F,CAWM,SAAUG,EAAQC,EAAeC,EAAgB,GAAI,CACzD,GAAID,EAAS,UAAW,MAAM,IAAI,MAAM,kCAAkC,EAC1E,GAAIC,GAAiBD,EAAS,SAAU,MAAM,IAAI,MAAM,uCAAuC,CACjG,CAGM,SAAUE,EAAQC,EAAUH,EAAa,CAC7CI,EAAOD,CAAG,EACV,IAAME,EAAML,EAAS,UACrB,GAAIG,EAAI,OAASE,EACf,MAAM,IAAI,MAAM,yDAA2DA,CAAG,CAElF,CAkBM,SAAUC,KAASC,EAAoB,CAC3C,QAASC,EAAI,EAAGA,EAAID,EAAO,OAAQC,IACjCD,EAAOC,CAAC,EAAE,KAAK,CAAC,CAEpB,CAGM,SAAUC,EAAWC,EAAe,CACxC,OAAO,IAAI,SAASA,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,CAChE,CAGM,SAAUC,EAAKC,EAAcC,EAAa,CAC9C,OAAQD,GAAS,GAAKC,EAAWD,IAASC,CAC5C,CAwCA,IAAMC,EAEJ,OAAO,WAAW,KAAK,CAAA,CAAE,EAAE,OAAU,YAAc,OAAO,WAAW,SAAY,WAG7EC,GAAwB,MAAM,KAAK,CAAE,OAAQ,GAAG,EAAI,CAACC,EAAGC,IAC5DA,EAAE,SAAS,EAAE,EAAE,SAAS,EAAG,GAAG,CAAC,EAO3B,SAAUC,EAAWC,EAAiB,CAG1C,GAFAC,EAAOD,CAAK,EAERL,EAAe,OAAOK,EAAM,MAAK,EAErC,IAAIE,EAAM,GACV,QAASJ,EAAI,EAAGA,EAAIE,EAAM,OAAQF,IAChCI,GAAON,GAAMI,EAAMF,CAAC,CAAC,EAEvB,OAAOI,CACT,CAGA,IAAMC,EAAS,CAAE,GAAI,GAAI,GAAI,GAAI,EAAG,GAAI,EAAG,GAAI,EAAG,GAAI,EAAG,GAAG,EAC5D,SAASC,EAAcC,EAAU,CAC/B,GAAIA,GAAMF,EAAO,IAAME,GAAMF,EAAO,GAAI,OAAOE,EAAKF,EAAO,GAC3D,GAAIE,GAAMF,EAAO,GAAKE,GAAMF,EAAO,EAAG,OAAOE,GAAMF,EAAO,EAAI,IAC9D,GAAIE,GAAMF,EAAO,GAAKE,GAAMF,EAAO,EAAG,OAAOE,GAAMF,EAAO,EAAI,GAEhE,CAMM,SAAUG,EAAWJ,EAAW,CACpC,GAAI,OAAOA,GAAQ,SAAU,MAAM,IAAI,MAAM,4BAA8B,OAAOA,CAAG,EAErF,GAAIP,EAAe,OAAO,WAAW,QAAQO,CAAG,EAChD,IAAMK,EAAKL,EAAI,OACTM,EAAKD,EAAK,EAChB,GAAIA,EAAK,EAAG,MAAM,IAAI,MAAM,mDAAqDA,CAAE,EACnF,IAAME,EAAQ,IAAI,WAAWD,CAAE,EAC/B,QAASE,EAAK,EAAGC,EAAK,EAAGD,EAAKF,EAAIE,IAAMC,GAAM,EAAG,CAC/C,IAAMC,EAAKR,EAAcF,EAAI,WAAWS,CAAE,CAAC,EACrCE,EAAKT,EAAcF,EAAI,WAAWS,EAAK,CAAC,CAAC,EAC/C,GAAIC,IAAO,QAAaC,IAAO,OAAW,CACxC,IAAMC,EAAOZ,EAAIS,CAAE,EAAIT,EAAIS,EAAK,CAAC,EACjC,MAAM,IAAI,MAAM,+CAAiDG,EAAO,cAAgBH,CAAE,CAC5F,CACAF,EAAMC,CAAE,EAAIE,EAAK,GAAKC,CACxB,CACA,OAAOJ,CACT,CAkCM,SAAUM,GAAYC,EAAW,CACrC,GAAI,OAAOA,GAAQ,SAAU,MAAM,IAAI,MAAM,iBAAiB,EAC9D,OAAO,IAAI,WAAW,IAAI,YAAW,EAAG,OAAOA,CAAG,CAAC,CACrD,CAiBM,SAAUC,EAAQC,EAAW,CACjC,OAAI,OAAOA,GAAS,WAAUA,EAAOC,GAAYD,CAAI,GACrDE,EAAOF,CAAI,EACJA,CACT,CAmDM,IAAgBG,EAAhB,KAAoB,GA4CpB,SAAUC,EACdC,EAAuB,CAOvB,IAAMC,EAASC,GAA2BF,EAAQ,EAAG,OAAOG,EAAQD,CAAG,CAAC,EAAE,OAAM,EAC1EE,EAAMJ,EAAQ,EACpB,OAAAC,EAAM,UAAYG,EAAI,UACtBH,EAAM,SAAWG,EAAI,SACrBH,EAAM,OAAS,IAAMD,EAAQ,EACtBC,CACT,CCpVM,SAAUI,GACdC,EACAC,EACAC,EACAC,EAAa,CAEb,GAAI,OAAOH,EAAK,cAAiB,WAAY,OAAOA,EAAK,aAAaC,EAAYC,EAAOC,CAAI,EAC7F,IAAMC,EAAO,OAAO,EAAE,EAChBC,EAAW,OAAO,UAAU,EAC5BC,EAAK,OAAQJ,GAASE,EAAQC,CAAQ,EACtCE,EAAK,OAAOL,EAAQG,CAAQ,EAC5BG,EAAIL,EAAO,EAAI,EACfM,EAAIN,EAAO,EAAI,EACrBH,EAAK,UAAUC,EAAaO,EAAGF,EAAIH,CAAI,EACvCH,EAAK,UAAUC,EAAaQ,EAAGF,EAAIJ,CAAI,CACzC,CAGM,SAAUO,EAAIC,EAAWC,EAAWC,EAAS,CACjD,OAAQF,EAAIC,EAAM,CAACD,EAAIE,CACzB,CAGM,SAAUC,EAAIH,EAAWC,EAAWC,EAAS,CACjD,OAAQF,EAAIC,EAAMD,EAAIE,EAAMD,EAAIC,CAClC,CAMM,IAAgBE,EAAhB,cAAoDC,CAAO,CAoB/D,YAAYC,EAAkBC,EAAmBC,EAAmBhB,EAAa,CAC/E,MAAK,EANG,KAAA,SAAW,GACX,KAAA,OAAS,EACT,KAAA,IAAM,EACN,KAAA,UAAY,GAIpB,KAAK,SAAWc,EAChB,KAAK,UAAYC,EACjB,KAAK,UAAYC,EACjB,KAAK,KAAOhB,EACZ,KAAK,OAAS,IAAI,WAAWc,CAAQ,EACrC,KAAK,KAAOG,EAAW,KAAK,MAAM,CACpC,CACA,OAAOC,EAAW,CAChBC,EAAQ,IAAI,EACZD,EAAOE,EAAQF,CAAI,EACnBG,EAAOH,CAAI,EACX,GAAM,CAAE,KAAArB,EAAM,OAAAyB,EAAQ,SAAAR,CAAQ,EAAK,KAC7BS,EAAML,EAAK,OACjB,QAASM,EAAM,EAAGA,EAAMD,GAAO,CAC7B,IAAME,EAAO,KAAK,IAAIX,EAAW,KAAK,IAAKS,EAAMC,CAAG,EAEpD,GAAIC,IAASX,EAAU,CACrB,IAAMY,EAAWT,EAAWC,CAAI,EAChC,KAAOJ,GAAYS,EAAMC,EAAKA,GAAOV,EAAU,KAAK,QAAQY,EAAUF,CAAG,EACzE,QACF,CACAF,EAAO,IAAIJ,EAAK,SAASM,EAAKA,EAAMC,CAAI,EAAG,KAAK,GAAG,EACnD,KAAK,KAAOA,EACZD,GAAOC,EACH,KAAK,MAAQX,IACf,KAAK,QAAQjB,EAAM,CAAC,EACpB,KAAK,IAAM,EAEf,CACA,YAAK,QAAUqB,EAAK,OACpB,KAAK,WAAU,EACR,IACT,CACA,WAAWS,EAAe,CACxBR,EAAQ,IAAI,EACZS,EAAQD,EAAK,IAAI,EACjB,KAAK,SAAW,GAIhB,GAAM,CAAE,OAAAL,EAAQ,KAAAzB,EAAM,SAAAiB,EAAU,KAAAd,CAAI,EAAK,KACrC,CAAE,IAAAwB,CAAG,EAAK,KAEdF,EAAOE,GAAK,EAAI,IAChBK,EAAM,KAAK,OAAO,SAASL,CAAG,CAAC,EAG3B,KAAK,UAAYV,EAAWU,IAC9B,KAAK,QAAQ3B,EAAM,CAAC,EACpB2B,EAAM,GAGR,QAASM,EAAIN,EAAKM,EAAIhB,EAAUgB,IAAKR,EAAOQ,CAAC,EAAI,EAIjDlC,GAAaC,EAAMiB,EAAW,EAAG,OAAO,KAAK,OAAS,CAAC,EAAGd,CAAI,EAC9D,KAAK,QAAQH,EAAM,CAAC,EACpB,IAAMkC,EAAQd,EAAWU,CAAG,EACtBJ,EAAM,KAAK,UAEjB,GAAIA,EAAM,EAAG,MAAM,IAAI,MAAM,6CAA6C,EAC1E,IAAMS,EAAST,EAAM,EACfU,EAAQ,KAAK,IAAG,EACtB,GAAID,EAASC,EAAM,OAAQ,MAAM,IAAI,MAAM,oCAAoC,EAC/E,QAASH,EAAI,EAAGA,EAAIE,EAAQF,IAAKC,EAAM,UAAU,EAAID,EAAGG,EAAMH,CAAC,EAAG9B,CAAI,CACxE,CACA,QAAM,CACJ,GAAM,CAAE,OAAAsB,EAAQ,UAAAP,CAAS,EAAK,KAC9B,KAAK,WAAWO,CAAM,EACtB,IAAMY,EAAMZ,EAAO,MAAM,EAAGP,CAAS,EACrC,YAAK,QAAO,EACLmB,CACT,CACA,WAAWC,EAAM,CACfA,IAAAA,EAAO,IAAK,KAAK,aACjBA,EAAG,IAAI,GAAG,KAAK,IAAG,CAAE,EACpB,GAAM,CAAE,SAAArB,EAAU,OAAAQ,EAAQ,OAAAc,EAAQ,SAAAC,EAAU,UAAAC,EAAW,IAAAd,CAAG,EAAK,KAC/D,OAAAW,EAAG,UAAYG,EACfH,EAAG,SAAWE,EACdF,EAAG,OAASC,EACZD,EAAG,IAAMX,EACLY,EAAStB,GAAUqB,EAAG,OAAO,IAAIb,CAAM,EACpCa,CACT,CACA,OAAK,CACH,OAAO,KAAK,WAAU,CACxB,GASWI,EAAyC,YAAY,KAAK,CACrE,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UAAY,WACrF,EAGYC,EAAyC,YAAY,KAAK,CACrE,WAAY,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WACrF,ECnJD,IAAMC,GAA2B,YAAY,KAAK,CAChD,WAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,WAAY,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,UAAY,UAAY,UAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UAAY,UACpF,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UACpF,UAAY,UAAY,UAAY,UAAY,UAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACrF,EAGKC,EAA2B,IAAI,YAAY,EAAE,EACtCC,EAAP,cAAsBC,CAAc,CAYxC,YAAYC,EAAoB,GAAE,CAChC,MAAM,GAAIA,EAAW,EAAG,EAAK,EAVrB,KAAA,EAAYC,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,CAIrC,CACU,KAAG,CACX,GAAM,CAAE,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,CAAC,EAAK,KACnC,MAAO,CAACP,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,CAAC,CAChC,CAEU,IACRP,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAS,CAEtF,KAAK,EAAIP,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,CACf,CACU,QAAQC,EAAgBC,EAAc,CAE9C,QAASC,EAAI,EAAGA,EAAI,GAAIA,IAAKD,GAAU,EAAGd,EAASe,CAAC,EAAIF,EAAK,UAAUC,EAAQ,EAAK,EACpF,QAASC,EAAI,GAAIA,EAAI,GAAIA,IAAK,CAC5B,IAAMC,EAAMhB,EAASe,EAAI,EAAE,EACrBE,EAAKjB,EAASe,EAAI,CAAC,EACnBG,EAAKC,EAAKH,EAAK,CAAC,EAAIG,EAAKH,EAAK,EAAE,EAAKA,IAAQ,EAC7CI,EAAKD,EAAKF,EAAI,EAAE,EAAIE,EAAKF,EAAI,EAAE,EAAKA,IAAO,GACjDjB,EAASe,CAAC,EAAKK,EAAKpB,EAASe,EAAI,CAAC,EAAIG,EAAKlB,EAASe,EAAI,EAAE,EAAK,CACjE,CAEA,GAAI,CAAE,EAAAV,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,CAAC,EAAK,KACjC,QAASG,EAAI,EAAGA,EAAI,GAAIA,IAAK,CAC3B,IAAMM,EAASF,EAAKV,EAAG,CAAC,EAAIU,EAAKV,EAAG,EAAE,EAAIU,EAAKV,EAAG,EAAE,EAC9Ca,EAAMV,EAAIS,EAASE,EAAId,EAAGC,EAAGC,CAAC,EAAIZ,GAASgB,CAAC,EAAIf,EAASe,CAAC,EAAK,EAE/DS,GADSL,EAAKd,EAAG,CAAC,EAAIc,EAAKd,EAAG,EAAE,EAAIc,EAAKd,EAAG,EAAE,GAC/BoB,EAAIpB,EAAGC,EAAGC,CAAC,EAAK,EACrCK,EAAID,EACJA,EAAID,EACJA,EAAID,EACJA,EAAKD,EAAIc,EAAM,EACfd,EAAID,EACJA,EAAID,EACJA,EAAID,EACJA,EAAKiB,EAAKE,EAAM,CAClB,CAEAnB,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnB,KAAK,IAAIP,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,CAAC,CACjC,CACU,YAAU,CAClBc,EAAM1B,CAAQ,CAChB,CACA,SAAO,CACL,KAAK,IAAI,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,CAAC,EAC/B0B,EAAM,KAAK,MAAM,CACnB,GAGWC,EAAP,cAAsB1B,CAAM,CAShC,aAAA,CACE,MAAM,EAAE,EATA,KAAA,EAAY2B,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,CAGrC,GA2QK,IAAMC,EAAgCC,EAAa,IAAM,IAAIC,CAAQ,EC5XrE,IAAMC,EAAqB,gBAC5BC,GAA6B,EAC7BC,EAAmB,EAEnBC,GAAyC,WAMlCC,EAAP,MAAOC,CAAS,CACb,OAAO,WAAS,CACrB,OAAO,IAAI,KAAK,IAAI,WAAW,CAACH,CAAgB,CAAC,CAAC,CACpD,CAMO,OAAO,oBAAkB,CAC9B,OAAO,KAAK,SAASC,EAAsC,CAC7D,CAEO,OAAO,mBAAmBG,EAAqB,CACpD,IAAMC,EAAMC,EAAOF,CAAS,EAC5B,OAAO,IAAI,KAAK,IAAI,WAAW,CAAC,GAAGC,EAAKN,EAA0B,CAAC,CAAC,CACtE,CAEO,OAAO,KAAKQ,EAAc,CAC/B,GAAI,OAAOA,GAAU,SACnB,OAAOJ,EAAU,SAASI,CAAK,EAC1B,GAAI,OAAO,eAAeA,CAAK,IAAM,WAAW,UACrD,OAAO,IAAIJ,EAAUI,CAAmB,EACnC,GAAIJ,EAAU,YAAYI,CAAK,EACpC,OAAO,IAAIJ,EAAUI,EAAM,IAAI,EAGjC,MAAM,IAAI,MAAM,yBAAyB,KAAK,UAAUA,CAAK,CAAC,gBAAgB,CAChF,CAEO,OAAO,QAAQC,EAAW,CAC/B,OAAO,IAAI,KAAKC,EAAWD,CAAG,CAAC,CACjC,CAEO,OAAO,SAASE,EAAY,CACjC,IAAIC,EAAiBD,EAErB,GAAIA,EAAK,SAASZ,CAAkB,EAAG,CACrC,IAAMc,EAAM,KAAK,MAAMF,CAAI,EACvBZ,KAAsBc,IACxBD,EAAiBC,EAAId,CAAkB,EAE3C,CAEA,IAAMe,EAAmBF,EAAe,YAAW,EAAG,QAAQ,KAAM,EAAE,EAElEG,EAAMC,EAAaF,CAAgB,EACvCC,EAAMA,EAAI,MAAM,EAAGA,EAAI,MAAM,EAE7B,IAAME,EAAY,IAAI,KAAKF,CAAG,EAC9B,GAAIE,EAAU,OAAM,IAAOL,EACzB,MAAM,IAAI,MACR,cAAcK,EAAU,OAAM,CAAE,qDAAqDL,CAAc,qCAAqC,EAI5I,OAAOK,CACT,CAEO,OAAO,eAAeF,EAAe,CAC1C,OAAO,IAAI,KAAKA,CAAG,CACrB,CAEO,OAAO,YAAYP,EAAc,CACtC,OACEA,aAAiBJ,GAChB,OAAOI,GAAU,UAChBA,IAAU,MACV,iBAAkBA,GACjBA,EAAoC,eAAoB,IACzD,SAAUA,GACTA,EAA+B,gBAAmB,UAEzD,CAIA,YAA8BU,EAAgB,CAAhB,KAAA,KAAAA,EAFd,KAAA,aAAe,EAEkB,CAE1C,aAAW,CAChB,OAAO,KAAK,KAAK,aAAe,GAAK,KAAK,KAAK,CAAC,IAAMjB,CACxD,CAEO,cAAY,CACjB,OAAO,KAAK,IACd,CAEO,OAAK,CACV,OAAOkB,EAAW,KAAK,IAAI,EAAE,YAAW,CAC1C,CAEO,QAAM,CACX,IAAMC,EAAmB,IAAI,YAAY,CAAC,EAC7B,IAAI,SAASA,CAAgB,EACrC,UAAU,EAAGC,EAAS,KAAK,IAAI,CAAC,EACrC,IAAMC,EAAW,IAAI,WAAWF,CAAgB,EAE1CG,EAAQ,IAAI,WAAW,CAAC,GAAGD,EAAU,GAAG,KAAK,IAAI,CAAC,EAGlDE,EADSC,EAAaF,CAAK,EACV,MAAM,SAAS,EACtC,GAAI,CAACC,EAEH,MAAM,IAAI,MAEZ,OAAOA,EAAQ,KAAK,GAAG,CACzB,CAEO,UAAQ,CACb,OAAO,KAAK,OAAM,CACpB,CAMO,QAAM,CACX,MAAO,CAAE,CAACzB,CAAkB,EAAG,KAAK,OAAM,CAAE,CAC9C,CAOO,UAAUS,EAAgB,CAC/B,QAASkB,EAAI,EAAGA,EAAI,KAAK,IAAI,KAAK,KAAK,OAAQlB,EAAM,KAAK,MAAM,EAAGkB,IAAK,CACtE,GAAI,KAAK,KAAKA,CAAC,EAAIlB,EAAM,KAAKkB,CAAC,EAAG,MAAO,KACpC,GAAI,KAAK,KAAKA,CAAC,EAAIlB,EAAM,KAAKkB,CAAC,EAAG,MAAO,IAChD,CAEA,OAAI,KAAK,KAAK,OAASlB,EAAM,KAAK,OAAe,KAC7C,KAAK,KAAK,OAASA,EAAM,KAAK,OAAe,KAC1C,IACT,CAOO,KAAKA,EAAgB,CAC1B,IAAMmB,EAAM,KAAK,UAAUnB,CAAK,EAChC,OAAOmB,GAAO,MAAQA,GAAO,IAC/B,CAOO,KAAKnB,EAAgB,CAC1B,IAAMmB,EAAM,KAAK,UAAUnB,CAAK,EAChC,OAAOmB,GAAO,MAAQA,GAAO,IAC/B,GPxKF,UAAYC,MAAO,MCDnB,UAAYA,MAAO,MFGZ,IAAKC,IAAAA,IAEVA,EAAA,cAAgB,gBAEhBA,EAAA,UAAY,YAEZA,EAAA,WAAa,aAEbA,EAAA,IAAM,MARIA,IAAAA,IAAA,CAAA,CAAA,EDSCC,EACV,aAAW,UAAU,EACrB,KAAK,CAAE,GAAA,YAA2B,CAAC,EEEzBC,GACV,SAAO,EACP,OACEC,GAAc,CACb,GAAI,CACF,OAAAC,EAAU,SAASD,CAAS,EACrB,EACT,MAAwB,CACtB,MAAO,EACT,CACF,EACA,CACE,MAAO,gDACT,CACF,EACC,KAAK,CAAE,GAAA,eAA8B,CAAC,EAgB5BE,EACV,SAAkB,EAClB,OAAQF,GAAcC,EAAU,YAAYD,CAAS,EAAG,CACvD,MAAO,qBACP,MAAO,EACT,CAAC,EACA,UAAWG,GAAUF,EAAU,KAAKE,CAAK,CAAC,EAC1C,KAAK,CAAE,GAAA,WAA0B,CAAC,EC3BxBC,GAAkB,CAAC,CAC9B,oBAAAC,EAAsB,CAAC,EACvB,iBAAAC,EAAmB,EACrB,IAII,MAAI,EAAE,OACLC,GAA+B,CAC9B,GAAI,CACF,IAAMC,EAAY,CAAC,GAAG,IAAI,IAAI,CAAC,SAAU,GAAGH,CAAmB,CAAC,CAAC,EAE3D,CAAE,SAAAI,EAAU,SAAAC,CAAS,EAAI,IAAI,IAAIH,CAAG,EAG1C,OAAID,GAAoB,CAAC,YAAa,WAAW,EAAE,SAASI,CAAQ,EAC3D,CAAC,QAAS,GAAGF,CAAS,EAAE,SAASC,CAAQ,EAG3CD,EAAU,SAASC,CAAQ,CACpC,MAAwB,CACtB,MAAO,EACT,CACF,EACA,CACE,MAAO,cACT,CACF,EAUWE,GAAYP,GAAgB,CAAC,CAAC,EAAE,KAAK,CAAE,GAAA,KAAoB,CAAC,EO/DzE,UAAYQ,OAAO,MAEZ,IAAMC,EAAW,CAEtB,UAAW,IAAMC,EAEjB,WAAY,IAAMC,CACpB,EAGM,CAAC,MAAOC,GAAG,GAAGC,EAAI,EAAIL,GAoBfM,EAAI,OAAO,OAAO,CAAC,EAAGD,EAAI,EAEvCC,EAAE,UAAYL,EAAS,UACvBK,EAAE,WAAaL,EAAS",
|
|
6
6
|
"names": ["z", "alphabet", "lookupTable", "i", "base32Encode", "input", "skip", "bits", "output", "encodeByte", "byte", "base32Decode", "o", "decodeChar", "char", "val", "c", "lookUpTable", "getCrc32", "buf", "crc", "i", "t", "isBytes", "a", "abytes", "b", "lengths", "isBytes", "aexists", "instance", "checkFinished", "aoutput", "out", "abytes", "min", "clean", "arrays", "i", "createView", "arr", "rotr", "word", "shift", "hasHexBuiltin", "hexes", "_", "i", "bytesToHex", "bytes", "abytes", "hex", "asciis", "asciiToBase16", "ch", "hexToBytes", "hl", "al", "array", "ai", "hi", "n1", "n2", "char", "utf8ToBytes", "str", "toBytes", "data", "utf8ToBytes", "abytes", "Hash", "createHasher", "hashCons", "hashC", "msg", "toBytes", "tmp", "setBigUint64", "view", "byteOffset", "value", "isLE", "_32n", "_u32_max", "wh", "wl", "h", "l", "Chi", "a", "b", "c", "Maj", "HashMD", "Hash", "blockLen", "outputLen", "padOffset", "createView", "data", "aexists", "toBytes", "abytes", "buffer", "len", "pos", "take", "dataView", "out", "aoutput", "clean", "i", "oview", "outLen", "state", "res", "to", "length", "finished", "destroyed", "SHA256_IV", "SHA224_IV", "SHA256_K", "SHA256_W", "SHA256", "HashMD", "outputLen", "SHA256_IV", "A", "B", "C", "D", "E", "F", "G", "H", "view", "offset", "i", "W15", "W2", "s0", "rotr", "s1", "sigma1", "T1", "Chi", "T2", "Maj", "clean", "SHA224", "SHA224_IV", "sha224", "createHasher", "SHA224", "JSON_KEY_PRINCIPAL", "SELF_AUTHENTICATING_SUFFIX", "ANONYMOUS_SUFFIX", "MANAGEMENT_CANISTER_PRINCIPAL_TEXT_STR", "Principal", "_Principal", "publicKey", "sha", "sha224", "other", "hex", "hexToBytes", "text", "maybePrincipal", "obj", "canisterIdNoDash", "arr", "base32Decode", "principal", "_arr", "bytesToHex", "checksumArrayBuf", "getCrc32", "checksum", "array", "matches", "base32Encode", "i", "cmp", "z", "ZodSchemaId", "Uint8ArraySchema", "PrincipalTextSchema", "principal", "Principal", "PrincipalSchema", "value", "createUrlSchema", "additionalProtocols", "allowHttpLocally", "url", "protocols", "protocol", "hostname", "UrlSchema", "z", "JunoType", "y", "P", "_", "rest", "j"]
|
|
7
7
|
}
|
package/index.mjs
CHANGED
|
@@ -1,6 +1,6 @@
|
|
|
1
1
|
import { createRequire as topLevelCreateRequire } from 'module';
|
|
2
2
|
const require = topLevelCreateRequire(import.meta.url);
|
|
3
|
-
import*as X from"zod";var H="abcdefghijklmnopqrstuvwxyz234567",m=Object.create(null);for(let e=0;e<H.length;e++)m[H[e]]=e;m[0]=m.o;m[1]=m.i;function G(e){let t=0,r=0,c="";function n(s){return t<0?r|=s>>-t:r=s<<t&248,t>3?(t-=8,1):(t<4&&(c+=H[r>>3],t+=5),0)}for(let s=0;s<e.length;)s+=n(e[s]);return c+(t<0?H[r>>3]:"")}function k(e){let t=0,r=0,c=new Uint8Array(e.length*4/3|0),n=0;function s(x){let i=m[x.toLowerCase()];if(i===void 0)throw new Error(`Invalid character: ${JSON.stringify(x)}`);i<<=3,r|=i>>>t,t+=5,t>=8&&(c[n++]=r,t-=8,t>0?r=i<<5-t&255:r=0)}for(let x of e)s(x);return c.slice(0,n)}var t0=new Uint32Array([0,1996959894,3993919788,2567524794,124634137,1886057615,3915621685,2657392035,249268274,2044508324,3772115230,2547177864,162941995,2125561021,3887607047,2428444049,498536548,1789927666,4089016648,2227061214,450548861,1843258603,4107580753,2211677639,325883990,1684777152,4251122042,2321926636,335633487,1661365465,4195302755,2366115317,997073096,1281953886,3579855332,2724688242,1006888145,1258607687,3524101629,2768942443,901097722,1119000684,3686517206,2898065728,853044451,1172266101,3705015759,2882616665,651767980,1373503546,3369554304,3218104598,565507253,1454621731,3485111705,3099436303,671266974,1594198024,3322730930,2970347812,795835527,1483230225,3244367275,3060149565,1994146192,31158534,2563907772,4023717930,1907459465,112637215,2680153253,3904427059,2013776290,251722036,2517215374,3775830040,2137656763,141376813,2439277719,3865271297,1802195444,476864866,2238001368,4066508878,1812370925,453092731,2181625025,4111451223,1706088902,314042704,2344532202,4240017532,1658658271,366619977,2362670323,4224994405,1303535960,984961486,2747007092,3569037538,1256170817,1037604311,2765210733,3554079995,1131014506,879679996,2909243462,3663771856,1141124467,855842277,2852801631,3708648649,1342533948,654459306,3188396048,3373015174,1466479909,544179635,3110523913,3462522015,1591671054,702138776,2966460450,3352799412,1504918807,783551873,3082640443,3233442989,3988292384,2596254646,62317068,1957810842,3939845945,2647816111,81470997,1943803523,3814918930,2489596804,225274430,2053790376,3826175755,2466906013,167816743,2097651377,4027552580,2265490386,503444072,1762050814,4150417245,2154129355,426522225,1852507879,4275313526,2312317920,282753626,1742555852,4189708143,2394877945,397917763,1622183637,3604390888,2714866558,953729732,1340076626,3518719985,2797360999,1068828381,1219638859,3624741850,2936675148,906185462,1090812512,3747672003,2825379669,829329135,1181335161,3412177804,3160834842,628085408,1382605366,3423369109,3138078467,570562233,1426400815,3317316542,2998733608,733239954,1555261956,3268935591,3050360625,752459403,1541320221,2607071920,3965973030,1969922972,40735498,2617837225,3943577151,1913087877,83908371,2512341634,3803740692,2075208622,213261112,2463272603,3855990285,2094854071,198958881,2262029012,4057260610,1759359992,534414190,2176718541,4139329115,1873836001,414664567,2282248934,4279200368,1711684554,285281116,2405801727,4167216745,1634467795,376229701,2685067896,3608007406,1308918612,956543938,2808555105,3495958263,1231636301,1047427035,2932959818,3654703836,1088359270,936918e3,2847714899,3736837829,1202900863,817233897,3183342108,3401237130,1404277552,615818150,3134207493,3453421203,1423857449,601450431,3009837614,3294710456,1567103746,711928724,3020668471,3272380065,1510334235,755167117]);function O(e){let t=-1;for(let r=0;r<e.length;r++){let n=(e[r]^t)&255;t=t0[n]^t>>>8}return(t^-1)>>>0}function e0(e){return e instanceof Uint8Array||ArrayBuffer.isView(e)&&e.constructor.name==="Uint8Array"}function A(e,...t){if(!e0(e))throw new Error("Uint8Array expected");if(t.length>0&&!t.includes(e.length))throw new Error("Uint8Array expected of length "+t+", got length="+e.length)}function I(e,t=!0){if(e.destroyed)throw new Error("Hash instance has been destroyed");if(t&&e.finished)throw new Error("Hash#digest() has already been called")}function N(e,t){A(e);let r=t.outputLen;if(e.length<r)throw new Error("digestInto() expects output buffer of length at least "+r)}function U(...e){for(let t=0;t<e.length;t++)e[t].fill(0)}function B(e){return new DataView(e.buffer,e.byteOffset,e.byteLength)}function d(e,t){return e<<32-t|e>>>t}var v=typeof Uint8Array.from([]).toHex=="function"&&typeof Uint8Array.fromHex=="function",r0=Array.from({length:256},(e,t)=>t.toString(16).padStart(2,"0"));function j(e){if(A(e),v)return e.toHex();let t="";for(let r=0;r<e.length;r++)t+=r0[e[r]];return t}var b={_0:48,_9:57,A:65,F:70,a:97,f:102};function V(e){if(e>=b._0&&e<=b._9)return e-b._0;if(e>=b.A&&e<=b.F)return e-(b.A-10);if(e>=b.a&&e<=b.f)return e-(b.a-10)}function M(e){if(typeof e!="string")throw new Error("hex string expected, got "+typeof e);if(v)return Uint8Array.fromHex(e);let t=e.length,r=t/2;if(t%2)throw new Error("hex string expected, got unpadded hex of length "+t);let c=new Uint8Array(r);for(let n=0,s=0;n<r;n++,s+=2){let x=V(e.charCodeAt(s)),i=V(e.charCodeAt(s+1));if(x===void 0||i===void 0){let o=e[s]+e[s+1];throw new Error('hex string expected, got non-hex character "'+o+'" at index '+s)}c[n]=x*16+i}return c}function c0(e){if(typeof e!="string")throw new Error("string expected");return new Uint8Array(new TextEncoder().encode(e))}function C(e){return typeof e=="string"&&(e=c0(e)),A(e),e}var _=class{};function W(e){let t=c=>e().update(C(c)).digest(),r=e();return t.outputLen=r.outputLen,t.blockLen=r.blockLen,t.create=()=>e(),t}function n0(e,t,r,c){if(typeof e.setBigUint64=="function")return e.setBigUint64(t,r,c);let n=BigInt(32),s=BigInt(4294967295),x=Number(r>>n&s),i=Number(r&s),o=c?4:0,f=c?0:4;e.setUint32(t+o,x,c),e.setUint32(t+f,i,c)}function J(e,t,r){return e&t^~e&r}function R(e,t,r){return e&t^e&r^t&r}var E=class extends _{constructor(t,r,c,n){super(),this.finished=!1,this.length=0,this.pos=0,this.destroyed=!1,this.blockLen=t,this.outputLen=r,this.padOffset=c,this.isLE=n,this.buffer=new Uint8Array(t),this.view=B(this.buffer)}update(t){I(this),t=C(t),A(t);let{view:r,buffer:c,blockLen:n}=this,s=t.length;for(let x=0;x<s;){let i=Math.min(n-this.pos,s-x);if(i===n){let o=B(t);for(;n<=s-x;x+=n)this.process(o,x);continue}c.set(t.subarray(x,x+i),this.pos),this.pos+=i,x+=i,this.pos===n&&(this.process(r,0),this.pos=0)}return this.length+=t.length,this.roundClean(),this}digestInto(t){I(this),N(t,this),this.finished=!0;let{buffer:r,view:c,blockLen:n,isLE:s}=this,{pos:x}=this;r[x++]=128,U(this.buffer.subarray(x)),this.padOffset>n-x&&(this.process(c,0),x=0);for(let a=x;a<n;a++)r[a]=0;n0(c,n-8,BigInt(this.length*8),s),this.process(c,0);let i=B(t),o=this.outputLen;if(o%4)throw new Error("_sha2: outputLen should be aligned to 32bit");let f=o/4,u=this.get();if(f>u.length)throw new Error("_sha2: outputLen bigger than state");for(let a=0;a<f;a++)i.setUint32(4*a,u[a],s)}digest(){let{buffer:t,outputLen:r}=this;this.digestInto(t);let c=t.slice(0,r);return this.destroy(),c}_cloneInto(t){t||(t=new this.constructor),t.set(...this.get());let{blockLen:r,buffer:c,length:n,finished:s,destroyed:x,pos:i}=this;return t.destroyed=x,t.finished=s,t.length=n,t.pos=i,n%r&&t.buffer.set(c),t}clone(){return this._cloneInto()}},h=Uint32Array.from([1779033703,3144134277,1013904242,2773480762,1359893119,2600822924,528734635,1541459225]),l=Uint32Array.from([3238371032,914150663,812702999,4144912697,4290775857,1750603025,1694076839,3204075428]);var s0=Uint32Array.from([1116352408,1899447441,3049323471,3921009573,961987163,1508970993,2453635748,2870763221,3624381080,310598401,607225278,1426881987,1925078388,2162078206,2614888103,3248222580,3835390401,4022224774,264347078,604807628,770255983,1249150122,1555081692,1996064986,2554220882,2821834349,2952996808,3210313671,3336571891,3584528711,113926993,338241895,666307205,773529912,1294757372,1396182291,1695183700,1986661051,2177026350,2456956037,2730485921,2820302411,3259730800,3345764771,3516065817,3600352804,4094571909,275423344,430227734,506948616,659060556,883997877,958139571,1322822218,1537002063,1747873779,1955562222,2024104815,2227730452,2361852424,2428436474,2756734187,3204031479,3329325298]),p=new Uint32Array(64),D=class extends E{constructor(t=32){super(64,t,8,!1),this.A=h[0]|0,this.B=h[1]|0,this.C=h[2]|0,this.D=h[3]|0,this.E=h[4]|0,this.F=h[5]|0,this.G=h[6]|0,this.H=h[7]|0}get(){let{A:t,B:r,C:c,D:n,E:s,F:x,G:i,H:o}=this;return[t,r,c,n,s,x,i,o]}set(t,r,c,n,s,x,i,o){this.A=t|0,this.B=r|0,this.C=c|0,this.D=n|0,this.E=s|0,this.F=x|0,this.G=i|0,this.H=o|0}process(t,r){for(let a=0;a<16;a++,r+=4)p[a]=t.getUint32(r,!1);for(let a=16;a<64;a++){let w=p[a-15],y=p[a-2],P=d(w,7)^d(w,18)^w>>>3,T=d(y,17)^d(y,19)^y>>>10;p[a]=T+p[a-7]+P+p[a-16]|0}let{A:c,B:n,C:s,D:x,E:i,F:o,G:f,H:u}=this;for(let a=0;a<64;a++){let w=d(i,6)^d(i,11)^d(i,25),y=u+w+J(i,o,f)+s0[a]+p[a]|0,T=(d(c,2)^d(c,13)^d(c,22))+R(c,n,s)|0;u=f,f=o,o=i,i=x+y|0,x=s,s=n,n=c,c=y+T|0}c=c+this.A|0,n=n+this.B|0,s=s+this.C|0,x=x+this.D|0,i=i+this.E|0,o=o+this.F|0,f=f+this.G|0,u=u+this.H|0,this.set(c,n,s,x,i,o,f,u)}roundClean(){U(p)}destroy(){this.set(0,0,0,0,0,0,0,0),U(this.buffer)}},F=class extends D{constructor(){super(28),this.A=l[0]|0,this.B=l[1]|0,this.C=l[2]|0,this.D=l[3]|0,this.E=l[4]|0,this.F=l[5]|0,this.G=l[6]|0,this.H=l[7]|0}};var q=W(()=>new F);var S="__principal__",x0=2,K=4,i0="aaaaa-aa",g=class e{static anonymous(){return new this(new Uint8Array([K]))}static managementCanister(){return this.fromText(i0)}static selfAuthenticating(t){let r=q(t);return new this(new Uint8Array([...r,x0]))}static from(t){if(typeof t=="string")return e.fromText(t);if(Object.getPrototypeOf(t)===Uint8Array.prototype)return new e(t);if(e.isPrincipal(t))return new e(t._arr);throw new Error(`Impossible to convert ${JSON.stringify(t)} to Principal.`)}static fromHex(t){return new this(M(t))}static fromText(t){let r=t;if(t.includes(S)){let x=JSON.parse(t);S in x&&(r=x[S])}let c=r.toLowerCase().replace(/-/g,""),n=k(c);n=n.slice(4,n.length);let s=new this(n);if(s.toText()!==r)throw new Error(`Principal "${s.toText()}" does not have a valid checksum (original value "${r}" may not be a valid Principal ID).`);return s}static fromUint8Array(t){return new this(t)}static isPrincipal(t){return t instanceof e||typeof t=="object"&&t!==null&&"_isPrincipal"in t&&t._isPrincipal===!0&&"_arr"in t&&t._arr instanceof Uint8Array}constructor(t){this._arr=t,this._isPrincipal=!0}isAnonymous(){return this._arr.byteLength===1&&this._arr[0]===K}toUint8Array(){return this._arr}toHex(){return j(this._arr).toUpperCase()}toText(){let t=new ArrayBuffer(4);new DataView(t).setUint32(0,O(this._arr));let c=new Uint8Array(t),n=new Uint8Array([...c,...this._arr]),x=G(n).match(/.{1,5}/g);if(!x)throw new Error;return x.join("-")}toString(){return this.toText()}toJSON(){return{[S]:this.toText()}}compareTo(t){for(let r=0;r<Math.min(this._arr.length,t._arr.length);r++){if(this._arr[r]<t._arr[r])return"lt";if(this._arr[r]>t._arr[r])return"gt"}return this._arr.length<t._arr.length?"lt":this._arr.length>t._arr.length?"gt":"eq"}ltEq(t){let r=this.compareTo(t);return r=="lt"||r=="eq"}gtEq(t){let r=this.compareTo(t);return r=="gt"||r=="eq"}};import*as L from"zod";import*as Y from"zod";var a0=(e=>(e.PrincipalText="PrincipalText",e.Principal="Principal",e.Uint8Array="Uint8Array",e.Url="Url",e))(a0||{}),$=X.instanceof(Uint8Array).meta({id:"Uint8Array"}),L0=L.string().refine(e=>{try{return g.fromText(e),!0}catch{return!1}},{error:"Invalid textual representation of a Principal."}).meta({id:"PrincipalText"}),z=L.custom().refine(e=>g.isPrincipal(e),{error:"Invalid Principal.",abort:!0}).transform(e=>g.from(e)).meta({id:"Principal"}),o0=({additionalProtocols:e=[],allowHttpLocally:t=!0})=>Y.url().refine(r=>{try{let c=[...new Set(["https:",...e])],{protocol:n,hostname:s}=new URL(r);return t&&["localhost","127.0.0.1"].includes(s)?["http:",...c].includes(n):c.includes(n)}catch{return!1}},{error:"Invalid URL."}),T0=o0({}).meta({id:"Url"});import*as f0 from"zod";var Z={principal:()=>z,uint8Array:()=>$},{union:D0,...d0}=f0,Q=Object.assign({},d0);Q.principal=Z.principal;Q.uint8Array=Z.uint8Array;export{Z as JunoType,z as PrincipalSchema,L0 as PrincipalTextSchema,$ as Uint8ArraySchema,T0 as UrlSchema,a0 as ZodSchemaId,o0 as createUrlSchema,Q as j};
|
|
3
|
+
import*as K from"zod";var H="abcdefghijklmnopqrstuvwxyz234567",m=Object.create(null);for(let e=0;e<H.length;e++)m[H[e]]=e;m[0]=m.o;m[1]=m.i;function G(e){let t=0,r=0,n="";function c(s){return t<0?r|=s>>-t:r=s<<t&248,t>3?(t-=8,1):(t<4&&(n+=H[r>>3],t+=5),0)}for(let s=0;s<e.length;)s+=c(e[s]);return n+(t<0?H[r>>3]:"")}function k(e){let t=0,r=0,n=new Uint8Array(e.length*4/3|0),c=0;function s(x){let i=m[x.toLowerCase()];if(i===void 0)throw new Error(`Invalid character: ${JSON.stringify(x)}`);i<<=3,r|=i>>>t,t+=5,t>=8&&(n[c++]=r,t-=8,t>0?r=i<<5-t&255:r=0)}for(let x of e)s(x);return n.slice(0,c)}var t0=new Uint32Array([0,1996959894,3993919788,2567524794,124634137,1886057615,3915621685,2657392035,249268274,2044508324,3772115230,2547177864,162941995,2125561021,3887607047,2428444049,498536548,1789927666,4089016648,2227061214,450548861,1843258603,4107580753,2211677639,325883990,1684777152,4251122042,2321926636,335633487,1661365465,4195302755,2366115317,997073096,1281953886,3579855332,2724688242,1006888145,1258607687,3524101629,2768942443,901097722,1119000684,3686517206,2898065728,853044451,1172266101,3705015759,2882616665,651767980,1373503546,3369554304,3218104598,565507253,1454621731,3485111705,3099436303,671266974,1594198024,3322730930,2970347812,795835527,1483230225,3244367275,3060149565,1994146192,31158534,2563907772,4023717930,1907459465,112637215,2680153253,3904427059,2013776290,251722036,2517215374,3775830040,2137656763,141376813,2439277719,3865271297,1802195444,476864866,2238001368,4066508878,1812370925,453092731,2181625025,4111451223,1706088902,314042704,2344532202,4240017532,1658658271,366619977,2362670323,4224994405,1303535960,984961486,2747007092,3569037538,1256170817,1037604311,2765210733,3554079995,1131014506,879679996,2909243462,3663771856,1141124467,855842277,2852801631,3708648649,1342533948,654459306,3188396048,3373015174,1466479909,544179635,3110523913,3462522015,1591671054,702138776,2966460450,3352799412,1504918807,783551873,3082640443,3233442989,3988292384,2596254646,62317068,1957810842,3939845945,2647816111,81470997,1943803523,3814918930,2489596804,225274430,2053790376,3826175755,2466906013,167816743,2097651377,4027552580,2265490386,503444072,1762050814,4150417245,2154129355,426522225,1852507879,4275313526,2312317920,282753626,1742555852,4189708143,2394877945,397917763,1622183637,3604390888,2714866558,953729732,1340076626,3518719985,2797360999,1068828381,1219638859,3624741850,2936675148,906185462,1090812512,3747672003,2825379669,829329135,1181335161,3412177804,3160834842,628085408,1382605366,3423369109,3138078467,570562233,1426400815,3317316542,2998733608,733239954,1555261956,3268935591,3050360625,752459403,1541320221,2607071920,3965973030,1969922972,40735498,2617837225,3943577151,1913087877,83908371,2512341634,3803740692,2075208622,213261112,2463272603,3855990285,2094854071,198958881,2262029012,4057260610,1759359992,534414190,2176718541,4139329115,1873836001,414664567,2282248934,4279200368,1711684554,285281116,2405801727,4167216745,1634467795,376229701,2685067896,3608007406,1308918612,956543938,2808555105,3495958263,1231636301,1047427035,2932959818,3654703836,1088359270,936918e3,2847714899,3736837829,1202900863,817233897,3183342108,3401237130,1404277552,615818150,3134207493,3453421203,1423857449,601450431,3009837614,3294710456,1567103746,711928724,3020668471,3272380065,1510334235,755167117]);function O(e){let t=-1;for(let r=0;r<e.length;r++){let c=(e[r]^t)&255;t=t0[c]^t>>>8}return(t^-1)>>>0}function e0(e){return e instanceof Uint8Array||ArrayBuffer.isView(e)&&e.constructor.name==="Uint8Array"}function A(e,...t){if(!e0(e))throw new Error("Uint8Array expected");if(t.length>0&&!t.includes(e.length))throw new Error("Uint8Array expected of length "+t+", got length="+e.length)}function I(e,t=!0){if(e.destroyed)throw new Error("Hash instance has been destroyed");if(t&&e.finished)throw new Error("Hash#digest() has already been called")}function N(e,t){A(e);let r=t.outputLen;if(e.length<r)throw new Error("digestInto() expects output buffer of length at least "+r)}function U(...e){for(let t=0;t<e.length;t++)e[t].fill(0)}function B(e){return new DataView(e.buffer,e.byteOffset,e.byteLength)}function d(e,t){return e<<32-t|e>>>t}var v=typeof Uint8Array.from([]).toHex=="function"&&typeof Uint8Array.fromHex=="function",r0=Array.from({length:256},(e,t)=>t.toString(16).padStart(2,"0"));function j(e){if(A(e),v)return e.toHex();let t="";for(let r=0;r<e.length;r++)t+=r0[e[r]];return t}var b={_0:48,_9:57,A:65,F:70,a:97,f:102};function V(e){if(e>=b._0&&e<=b._9)return e-b._0;if(e>=b.A&&e<=b.F)return e-(b.A-10);if(e>=b.a&&e<=b.f)return e-(b.a-10)}function M(e){if(typeof e!="string")throw new Error("hex string expected, got "+typeof e);if(v)return Uint8Array.fromHex(e);let t=e.length,r=t/2;if(t%2)throw new Error("hex string expected, got unpadded hex of length "+t);let n=new Uint8Array(r);for(let c=0,s=0;c<r;c++,s+=2){let x=V(e.charCodeAt(s)),i=V(e.charCodeAt(s+1));if(x===void 0||i===void 0){let o=e[s]+e[s+1];throw new Error('hex string expected, got non-hex character "'+o+'" at index '+s)}n[c]=x*16+i}return n}function n0(e){if(typeof e!="string")throw new Error("string expected");return new Uint8Array(new TextEncoder().encode(e))}function C(e){return typeof e=="string"&&(e=n0(e)),A(e),e}var _=class{};function W(e){let t=n=>e().update(C(n)).digest(),r=e();return t.outputLen=r.outputLen,t.blockLen=r.blockLen,t.create=()=>e(),t}function c0(e,t,r,n){if(typeof e.setBigUint64=="function")return e.setBigUint64(t,r,n);let c=BigInt(32),s=BigInt(4294967295),x=Number(r>>c&s),i=Number(r&s),o=n?4:0,f=n?0:4;e.setUint32(t+o,x,n),e.setUint32(t+f,i,n)}function J(e,t,r){return e&t^~e&r}function R(e,t,r){return e&t^e&r^t&r}var E=class extends _{constructor(t,r,n,c){super(),this.finished=!1,this.length=0,this.pos=0,this.destroyed=!1,this.blockLen=t,this.outputLen=r,this.padOffset=n,this.isLE=c,this.buffer=new Uint8Array(t),this.view=B(this.buffer)}update(t){I(this),t=C(t),A(t);let{view:r,buffer:n,blockLen:c}=this,s=t.length;for(let x=0;x<s;){let i=Math.min(c-this.pos,s-x);if(i===c){let o=B(t);for(;c<=s-x;x+=c)this.process(o,x);continue}n.set(t.subarray(x,x+i),this.pos),this.pos+=i,x+=i,this.pos===c&&(this.process(r,0),this.pos=0)}return this.length+=t.length,this.roundClean(),this}digestInto(t){I(this),N(t,this),this.finished=!0;let{buffer:r,view:n,blockLen:c,isLE:s}=this,{pos:x}=this;r[x++]=128,U(this.buffer.subarray(x)),this.padOffset>c-x&&(this.process(n,0),x=0);for(let a=x;a<c;a++)r[a]=0;c0(n,c-8,BigInt(this.length*8),s),this.process(n,0);let i=B(t),o=this.outputLen;if(o%4)throw new Error("_sha2: outputLen should be aligned to 32bit");let f=o/4,u=this.get();if(f>u.length)throw new Error("_sha2: outputLen bigger than state");for(let a=0;a<f;a++)i.setUint32(4*a,u[a],s)}digest(){let{buffer:t,outputLen:r}=this;this.digestInto(t);let n=t.slice(0,r);return this.destroy(),n}_cloneInto(t){t||(t=new this.constructor),t.set(...this.get());let{blockLen:r,buffer:n,length:c,finished:s,destroyed:x,pos:i}=this;return t.destroyed=x,t.finished=s,t.length=c,t.pos=i,c%r&&t.buffer.set(n),t}clone(){return this._cloneInto()}},h=Uint32Array.from([1779033703,3144134277,1013904242,2773480762,1359893119,2600822924,528734635,1541459225]),l=Uint32Array.from([3238371032,914150663,812702999,4144912697,4290775857,1750603025,1694076839,3204075428]);var s0=Uint32Array.from([1116352408,1899447441,3049323471,3921009573,961987163,1508970993,2453635748,2870763221,3624381080,310598401,607225278,1426881987,1925078388,2162078206,2614888103,3248222580,3835390401,4022224774,264347078,604807628,770255983,1249150122,1555081692,1996064986,2554220882,2821834349,2952996808,3210313671,3336571891,3584528711,113926993,338241895,666307205,773529912,1294757372,1396182291,1695183700,1986661051,2177026350,2456956037,2730485921,2820302411,3259730800,3345764771,3516065817,3600352804,4094571909,275423344,430227734,506948616,659060556,883997877,958139571,1322822218,1537002063,1747873779,1955562222,2024104815,2227730452,2361852424,2428436474,2756734187,3204031479,3329325298]),p=new Uint32Array(64),D=class extends E{constructor(t=32){super(64,t,8,!1),this.A=h[0]|0,this.B=h[1]|0,this.C=h[2]|0,this.D=h[3]|0,this.E=h[4]|0,this.F=h[5]|0,this.G=h[6]|0,this.H=h[7]|0}get(){let{A:t,B:r,C:n,D:c,E:s,F:x,G:i,H:o}=this;return[t,r,n,c,s,x,i,o]}set(t,r,n,c,s,x,i,o){this.A=t|0,this.B=r|0,this.C=n|0,this.D=c|0,this.E=s|0,this.F=x|0,this.G=i|0,this.H=o|0}process(t,r){for(let a=0;a<16;a++,r+=4)p[a]=t.getUint32(r,!1);for(let a=16;a<64;a++){let w=p[a-15],y=p[a-2],P=d(w,7)^d(w,18)^w>>>3,T=d(y,17)^d(y,19)^y>>>10;p[a]=T+p[a-7]+P+p[a-16]|0}let{A:n,B:c,C:s,D:x,E:i,F:o,G:f,H:u}=this;for(let a=0;a<64;a++){let w=d(i,6)^d(i,11)^d(i,25),y=u+w+J(i,o,f)+s0[a]+p[a]|0,T=(d(n,2)^d(n,13)^d(n,22))+R(n,c,s)|0;u=f,f=o,o=i,i=x+y|0,x=s,s=c,c=n,n=y+T|0}n=n+this.A|0,c=c+this.B|0,s=s+this.C|0,x=x+this.D|0,i=i+this.E|0,o=o+this.F|0,f=f+this.G|0,u=u+this.H|0,this.set(n,c,s,x,i,o,f,u)}roundClean(){U(p)}destroy(){this.set(0,0,0,0,0,0,0,0),U(this.buffer)}},F=class extends D{constructor(){super(28),this.A=l[0]|0,this.B=l[1]|0,this.C=l[2]|0,this.D=l[3]|0,this.E=l[4]|0,this.F=l[5]|0,this.G=l[6]|0,this.H=l[7]|0}};var q=W(()=>new F);var S="__principal__",x0=2,z=4,i0="aaaaa-aa",g=class e{static anonymous(){return new this(new Uint8Array([z]))}static managementCanister(){return this.fromText(i0)}static selfAuthenticating(t){let r=q(t);return new this(new Uint8Array([...r,x0]))}static from(t){if(typeof t=="string")return e.fromText(t);if(Object.getPrototypeOf(t)===Uint8Array.prototype)return new e(t);if(e.isPrincipal(t))return new e(t._arr);throw new Error(`Impossible to convert ${JSON.stringify(t)} to Principal.`)}static fromHex(t){return new this(M(t))}static fromText(t){let r=t;if(t.includes(S)){let x=JSON.parse(t);S in x&&(r=x[S])}let n=r.toLowerCase().replace(/-/g,""),c=k(n);c=c.slice(4,c.length);let s=new this(c);if(s.toText()!==r)throw new Error(`Principal "${s.toText()}" does not have a valid checksum (original value "${r}" may not be a valid Principal ID).`);return s}static fromUint8Array(t){return new this(t)}static isPrincipal(t){return t instanceof e||typeof t=="object"&&t!==null&&"_isPrincipal"in t&&t._isPrincipal===!0&&"_arr"in t&&t._arr instanceof Uint8Array}constructor(t){this._arr=t,this._isPrincipal=!0}isAnonymous(){return this._arr.byteLength===1&&this._arr[0]===z}toUint8Array(){return this._arr}toHex(){return j(this._arr).toUpperCase()}toText(){let t=new ArrayBuffer(4);new DataView(t).setUint32(0,O(this._arr));let n=new Uint8Array(t),c=new Uint8Array([...n,...this._arr]),x=G(c).match(/.{1,5}/g);if(!x)throw new Error;return x.join("-")}toString(){return this.toText()}toJSON(){return{[S]:this.toText()}}compareTo(t){for(let r=0;r<Math.min(this._arr.length,t._arr.length);r++){if(this._arr[r]<t._arr[r])return"lt";if(this._arr[r]>t._arr[r])return"gt"}return this._arr.length<t._arr.length?"lt":this._arr.length>t._arr.length?"gt":"eq"}ltEq(t){let r=this.compareTo(t);return r=="lt"||r=="eq"}gtEq(t){let r=this.compareTo(t);return r=="gt"||r=="eq"}};import*as L from"zod";import*as Y from"zod";var a0=(e=>(e.PrincipalText="PrincipalText",e.Principal="Principal",e.Uint8Array="Uint8Array",e.Url="Url",e))(a0||{}),X=K.instanceof(Uint8Array).meta({id:"Uint8Array"}),L0=L.string().refine(e=>{try{return g.fromText(e),!0}catch{return!1}},{error:"Invalid textual representation of a Principal."}).meta({id:"PrincipalText"}),$=L.custom().refine(e=>g.isPrincipal(e),{error:"Invalid Principal.",abort:!0}).transform(e=>g.from(e)).meta({id:"Principal"}),o0=({additionalProtocols:e=[],allowHttpLocally:t=!0})=>Y.url().refine(r=>{try{let n=[...new Set(["https:",...e])],{protocol:c,hostname:s}=new URL(r);return t&&["localhost","127.0.0.1"].includes(s)?["http:",...n].includes(c):n.includes(c)}catch{return!1}},{error:"Invalid URL."}),T0=o0({}).meta({id:"Url"});import*as f0 from"zod";var Z={principal:()=>$,uint8Array:()=>X},{union:D0,...d0}=f0,Q=Object.assign({},d0);Q.principal=Z.principal;Q.uint8Array=Z.uint8Array;export{Z as JunoType,$ as PrincipalSchema,L0 as PrincipalTextSchema,X as Uint8ArraySchema,T0 as UrlSchema,a0 as ZodSchemaId,o0 as createUrlSchema,Q as j};
|
|
4
4
|
/*! Bundled license information:
|
|
5
5
|
|
|
6
6
|
@noble/hashes/esm/utils.js:
|
package/index.mjs.map
CHANGED
|
@@ -1,7 +1,7 @@
|
|
|
1
1
|
{
|
|
2
2
|
"version": 3,
|
|
3
3
|
"sources": ["../../node_modules/@dfinity/zod-schemas/src/arrays.ts", "../../node_modules/@dfinity/zod-schemas/src/schema-id.ts", "../../node_modules/@dfinity/zod-schemas/src/principal.ts", "../../node_modules/@dfinity/zod-schemas/src/url.ts", "../../node_modules/@icp-sdk/core/src/principal/utils/base32.ts", "../../node_modules/@icp-sdk/core/src/principal/utils/getCrc.ts", "../../node_modules/@noble/hashes/src/utils.ts", "../../node_modules/@noble/hashes/src/_md.ts", "../../node_modules/@noble/hashes/src/sha2.ts", "../../node_modules/@icp-sdk/core/src/principal/principal.ts", "src/type-system/index.ts"],
|
|
4
|
-
"sourcesContent": ["import * as z from \"zod\";\nimport { ZodSchemaId } from \"./schema-id\";\n\n/**\n * Zod schema to validate a value is a `Uint8Array` instance.\n *\n * @example\n * ```typescript\n * const result = Uint8ArraySchema.safeParse(new Uint8Array([1, 2, 3]));\n * console.log(result.success); // true or false\n * ```\n */\nexport const Uint8ArraySchema = z\n .instanceof(Uint8Array)\n .meta({ id: ZodSchemaId.Uint8Array });\n", "/**\n * Enum of metadata `id` values assigned to Zod schemas in this library.\n */\nexport enum ZodSchemaId {\n /** Metadata id for {@link PrincipalTextSchema}. */\n PrincipalText = \"PrincipalText\",\n /** Metadata id for {@link PrincipalSchema}. */\n Principal = \"Principal\",\n /** Metadata id for {@link Uint8ArraySchema}. */\n Uint8Array = \"Uint8Array\",\n /** Metadata id for {@link UrlSchema}. */\n Url = \"Url\",\n}\n", "import { Principal } from \"@icp-sdk/core/principal\";\nimport * as z from \"zod\";\nimport { ZodSchemaId } from \"./schema-id\";\n\n/**\n * Zod schema to validate a string as a valid textual representation of a Principal.\n *\n * This schema checks if the provided string can be converted into a `Principal` instance.\n * If the conversion fails, validation will return an error message.\n *\n * @example\n * ```typescript\n * const result = PrincipalTextSchema.safeParse('aaaaa-aa');\n * console.log(result.success); // true or false\n * ```\n */\nexport const PrincipalTextSchema = z\n .string()\n .refine(\n (principal) => {\n try {\n Principal.fromText(principal);\n return true;\n } catch (_err: unknown) {\n return false;\n }\n },\n {\n error: \"Invalid textual representation of a Principal.\",\n },\n )\n .meta({ id: ZodSchemaId.PrincipalText });\n\nexport type PrincipalText = z.infer<typeof PrincipalTextSchema>;\n\n/**\n * Zod schema to validate and transform a value into a `Principal` instance.\n *\n * This schema checks if the provided value is an instance or an object representing\n * a `Principal` and transforms it into a valid `Principal` instance.\n *\n * @example\n * ```typescript\n * const result = PrincipalSchema.safeParse(Principal.fromText('aaaaa-aa'));\n * console.log(result.success); // true or false\n * ```\n */\nexport const PrincipalSchema = z\n .custom<Principal>()\n .refine((principal) => Principal.isPrincipal(principal), {\n error: \"Invalid Principal.\",\n abort: true,\n })\n .transform((value) => Principal.from(value))\n .meta({ id: ZodSchemaId.Principal });\n", "import * as z from \"zod\";\nimport { ZodSchemaId } from \"./schema-id\";\n\n/**\n * A URL protocol as template literal type.\n * Example: \"https:\" or \"ftp:\"\n */\nexport type UrlProtocol = `${string}:`;\n\n/**\n * Creates a Zod schema for validating URLs. By default, it validates that the URL protocol is HTTPS and allow usage of HTTP only locally.\n *\n * @param {Object} options - Configuration options for the schema.\n * @param {UrlProtocol[]} [options.additionalProtocols=[]] - Additional protocols to allow (e.g., \"wss:\" or \"ftp:\"). \u26A0\uFE0F Usage of insecure protocols is discouraged.\n * @param {boolean} [options.allowHttpLocally=true] - Whether to allow HTTP for localhost and 127.0.0.1. Default: true.\n * @returns {z.ZodEffects<z.ZodString, string, string>} - The Zod schema with URL validation.\n *\n * @example\n * const schema = createUrlSchema({\n * additionalProtocols: [\"wss:\"],\n * allowHttpLocally: false\n * });\n *\n * schema.parse(\"https://example.com\"); // Valid\n * schema.parse(\"wss://example.com\"); // Valid\n * schema.parse(\"http://localhost\"); // Invalid if allowHttpLocally is false\n */\nexport const createUrlSchema = ({\n additionalProtocols = [],\n allowHttpLocally = true,\n}: {\n additionalProtocols?: UrlProtocol[];\n allowHttpLocally?: boolean;\n}): z.ZodURL =>\n z.url().refine(\n (url: string | URL): boolean => {\n try {\n const protocols = [...new Set([\"https:\", ...additionalProtocols])];\n\n const { protocol, hostname } = new URL(url);\n\n // We allow http for development locally\n if (allowHttpLocally && [\"localhost\", \"127.0.0.1\"].includes(hostname)) {\n return [\"http:\", ...protocols].includes(protocol);\n }\n\n return protocols.includes(protocol);\n } catch (_err: unknown) {\n return false;\n }\n },\n {\n error: \"Invalid URL.\",\n },\n );\n\n/**\n * Default URL schema that enforces HTTPS and allows HTTP locally.\n *\n * @constant {z.ZodEffects<z.ZodString, string, string>}\n * @example\n * UrlSchema.parse(\"https://example.com\"); // Valid\n * UrlSchema.parse(\"http://127.0.0.1\"); // Valid (localhost exception)\n */\nexport const UrlSchema = createUrlSchema({}).meta({ id: ZodSchemaId.Url });\n", "const alphabet = 'abcdefghijklmnopqrstuvwxyz234567';\n\n// Build a lookup table for decoding.\nconst lookupTable: Record<string, number> = Object.create(null);\nfor (let i = 0; i < alphabet.length; i++) {\n lookupTable[alphabet[i]] = i;\n}\n\n// Add aliases for rfc4648.\nlookupTable['0'] = lookupTable.o;\nlookupTable['1'] = lookupTable.i;\n\n/**\n * @param input The Uint8Array to encode.\n * @returns A Base32 string encoding the input.\n */\nexport function base32Encode(input: Uint8Array): string {\n // How many bits will we skip from the first byte.\n let skip = 0;\n // 5 high bits, carry from one byte to the next.\n let bits = 0;\n\n // The output string in base32.\n let output = '';\n\n function encodeByte(byte: number) {\n if (skip < 0) {\n // we have a carry from the previous byte\n bits |= byte >> -skip;\n } else {\n // no carry\n bits = (byte << skip) & 248;\n }\n\n if (skip > 3) {\n // Not enough data to produce a character, get us another one\n skip -= 8;\n return 1;\n }\n\n if (skip < 4) {\n // produce a character\n output += alphabet[bits >> 3];\n skip += 5;\n }\n\n return 0;\n }\n\n for (let i = 0; i < input.length; ) {\n i += encodeByte(input[i]);\n }\n\n return output + (skip < 0 ? alphabet[bits >> 3] : '');\n}\n\n/**\n * @param input The base32 encoded string to decode.\n */\nexport function base32Decode(input: string): Uint8Array {\n // how many bits we have from the previous character.\n let skip = 0;\n // current byte we're producing.\n let byte = 0;\n\n const output = new Uint8Array(((input.length * 4) / 3) | 0);\n let o = 0;\n\n function decodeChar(char: string) {\n // Consume a character from the stream, store\n // the output in this.output. As before, better\n // to use update().\n let val = lookupTable[char.toLowerCase()];\n if (val === undefined) {\n throw new Error(`Invalid character: ${JSON.stringify(char)}`);\n }\n\n // move to the high bits\n val <<= 3;\n byte |= val >>> skip;\n skip += 5;\n\n if (skip >= 8) {\n // We have enough bytes to produce an output\n output[o++] = byte;\n skip -= 8;\n\n if (skip > 0) {\n byte = (val << (5 - skip)) & 255;\n } else {\n byte = 0;\n }\n }\n }\n\n for (const c of input) {\n decodeChar(c);\n }\n\n return output.slice(0, o);\n}\n", "// This file is translated to JavaScript from\n// https://lxp32.github.io/docs/a-simple-example-crc32-calculation/\nconst lookUpTable: Uint32Array = new Uint32Array([\n 0x00000000, 0x77073096, 0xee0e612c, 0x990951ba, 0x076dc419, 0x706af48f, 0xe963a535, 0x9e6495a3,\n 0x0edb8832, 0x79dcb8a4, 0xe0d5e91e, 0x97d2d988, 0x09b64c2b, 0x7eb17cbd, 0xe7b82d07, 0x90bf1d91,\n 0x1db71064, 0x6ab020f2, 0xf3b97148, 0x84be41de, 0x1adad47d, 0x6ddde4eb, 0xf4d4b551, 0x83d385c7,\n 0x136c9856, 0x646ba8c0, 0xfd62f97a, 0x8a65c9ec, 0x14015c4f, 0x63066cd9, 0xfa0f3d63, 0x8d080df5,\n 0x3b6e20c8, 0x4c69105e, 0xd56041e4, 0xa2677172, 0x3c03e4d1, 0x4b04d447, 0xd20d85fd, 0xa50ab56b,\n 0x35b5a8fa, 0x42b2986c, 0xdbbbc9d6, 0xacbcf940, 0x32d86ce3, 0x45df5c75, 0xdcd60dcf, 0xabd13d59,\n 0x26d930ac, 0x51de003a, 0xc8d75180, 0xbfd06116, 0x21b4f4b5, 0x56b3c423, 0xcfba9599, 0xb8bda50f,\n 0x2802b89e, 0x5f058808, 0xc60cd9b2, 0xb10be924, 0x2f6f7c87, 0x58684c11, 0xc1611dab, 0xb6662d3d,\n 0x76dc4190, 0x01db7106, 0x98d220bc, 0xefd5102a, 0x71b18589, 0x06b6b51f, 0x9fbfe4a5, 0xe8b8d433,\n 0x7807c9a2, 0x0f00f934, 0x9609a88e, 0xe10e9818, 0x7f6a0dbb, 0x086d3d2d, 0x91646c97, 0xe6635c01,\n 0x6b6b51f4, 0x1c6c6162, 0x856530d8, 0xf262004e, 0x6c0695ed, 0x1b01a57b, 0x8208f4c1, 0xf50fc457,\n 0x65b0d9c6, 0x12b7e950, 0x8bbeb8ea, 0xfcb9887c, 0x62dd1ddf, 0x15da2d49, 0x8cd37cf3, 0xfbd44c65,\n 0x4db26158, 0x3ab551ce, 0xa3bc0074, 0xd4bb30e2, 0x4adfa541, 0x3dd895d7, 0xa4d1c46d, 0xd3d6f4fb,\n 0x4369e96a, 0x346ed9fc, 0xad678846, 0xda60b8d0, 0x44042d73, 0x33031de5, 0xaa0a4c5f, 0xdd0d7cc9,\n 0x5005713c, 0x270241aa, 0xbe0b1010, 0xc90c2086, 0x5768b525, 0x206f85b3, 0xb966d409, 0xce61e49f,\n 0x5edef90e, 0x29d9c998, 0xb0d09822, 0xc7d7a8b4, 0x59b33d17, 0x2eb40d81, 0xb7bd5c3b, 0xc0ba6cad,\n 0xedb88320, 0x9abfb3b6, 0x03b6e20c, 0x74b1d29a, 0xead54739, 0x9dd277af, 0x04db2615, 0x73dc1683,\n 0xe3630b12, 0x94643b84, 0x0d6d6a3e, 0x7a6a5aa8, 0xe40ecf0b, 0x9309ff9d, 0x0a00ae27, 0x7d079eb1,\n 0xf00f9344, 0x8708a3d2, 0x1e01f268, 0x6906c2fe, 0xf762575d, 0x806567cb, 0x196c3671, 0x6e6b06e7,\n 0xfed41b76, 0x89d32be0, 0x10da7a5a, 0x67dd4acc, 0xf9b9df6f, 0x8ebeeff9, 0x17b7be43, 0x60b08ed5,\n 0xd6d6a3e8, 0xa1d1937e, 0x38d8c2c4, 0x4fdff252, 0xd1bb67f1, 0xa6bc5767, 0x3fb506dd, 0x48b2364b,\n 0xd80d2bda, 0xaf0a1b4c, 0x36034af6, 0x41047a60, 0xdf60efc3, 0xa867df55, 0x316e8eef, 0x4669be79,\n 0xcb61b38c, 0xbc66831a, 0x256fd2a0, 0x5268e236, 0xcc0c7795, 0xbb0b4703, 0x220216b9, 0x5505262f,\n 0xc5ba3bbe, 0xb2bd0b28, 0x2bb45a92, 0x5cb36a04, 0xc2d7ffa7, 0xb5d0cf31, 0x2cd99e8b, 0x5bdeae1d,\n 0x9b64c2b0, 0xec63f226, 0x756aa39c, 0x026d930a, 0x9c0906a9, 0xeb0e363f, 0x72076785, 0x05005713,\n 0x95bf4a82, 0xe2b87a14, 0x7bb12bae, 0x0cb61b38, 0x92d28e9b, 0xe5d5be0d, 0x7cdcefb7, 0x0bdbdf21,\n 0x86d3d2d4, 0xf1d4e242, 0x68ddb3f8, 0x1fda836e, 0x81be16cd, 0xf6b9265b, 0x6fb077e1, 0x18b74777,\n 0x88085ae6, 0xff0f6a70, 0x66063bca, 0x11010b5c, 0x8f659eff, 0xf862ae69, 0x616bffd3, 0x166ccf45,\n 0xa00ae278, 0xd70dd2ee, 0x4e048354, 0x3903b3c2, 0xa7672661, 0xd06016f7, 0x4969474d, 0x3e6e77db,\n 0xaed16a4a, 0xd9d65adc, 0x40df0b66, 0x37d83bf0, 0xa9bcae53, 0xdebb9ec5, 0x47b2cf7f, 0x30b5ffe9,\n 0xbdbdf21c, 0xcabac28a, 0x53b39330, 0x24b4a3a6, 0xbad03605, 0xcdd70693, 0x54de5729, 0x23d967bf,\n 0xb3667a2e, 0xc4614ab8, 0x5d681b02, 0x2a6f2b94, 0xb40bbe37, 0xc30c8ea1, 0x5a05df1b, 0x2d02ef8d,\n]);\n\n/**\n * Calculate the CRC32 of a Uint8Array.\n * @param buf The Uint8Array to calculate the CRC32 of.\n */\nexport function getCrc32(buf: Uint8Array): number {\n let crc = -1;\n\n for (let i = 0; i < buf.length; i++) {\n const byte = buf[i];\n const t = (byte ^ crc) & 0xff;\n crc = lookUpTable[t] ^ (crc >>> 8);\n }\n\n return (crc ^ -1) >>> 0;\n}\n", "/**\n * Utilities for hex, bytes, CSPRNG.\n * @module\n */\n/*! noble-hashes - MIT License (c) 2022 Paul Miller (paulmillr.com) */\n\n// We use WebCrypto aka globalThis.crypto, which exists in browsers and node.js 16+.\n// node.js versions earlier than v19 don't declare it in global scope.\n// For node.js, package.json#exports field mapping rewrites import\n// from `crypto` to `cryptoNode`, which imports native module.\n// Makes the utils un-importable in browsers without a bundler.\n// Once node.js 18 is deprecated (2025-04-30), we can just drop the import.\nimport { crypto } from '@noble/hashes/crypto';\n\n/** Checks if something is Uint8Array. Be careful: nodejs Buffer will return true. */\nexport function isBytes(a: unknown): a is Uint8Array {\n return a instanceof Uint8Array || (ArrayBuffer.isView(a) && a.constructor.name === 'Uint8Array');\n}\n\n/** Asserts something is positive integer. */\nexport function anumber(n: number): void {\n if (!Number.isSafeInteger(n) || n < 0) throw new Error('positive integer expected, got ' + n);\n}\n\n/** Asserts something is Uint8Array. */\nexport function abytes(b: Uint8Array | undefined, ...lengths: number[]): void {\n if (!isBytes(b)) throw new Error('Uint8Array expected');\n if (lengths.length > 0 && !lengths.includes(b.length))\n throw new Error('Uint8Array expected of length ' + lengths + ', got length=' + b.length);\n}\n\n/** Asserts something is hash */\nexport function ahash(h: IHash): void {\n if (typeof h !== 'function' || typeof h.create !== 'function')\n throw new Error('Hash should be wrapped by utils.createHasher');\n anumber(h.outputLen);\n anumber(h.blockLen);\n}\n\n/** Asserts a hash instance has not been destroyed / finished */\nexport function aexists(instance: any, checkFinished = true): void {\n if (instance.destroyed) throw new Error('Hash instance has been destroyed');\n if (checkFinished && instance.finished) throw new Error('Hash#digest() has already been called');\n}\n\n/** Asserts output is properly-sized byte array */\nexport function aoutput(out: any, instance: any): void {\n abytes(out);\n const min = instance.outputLen;\n if (out.length < min) {\n throw new Error('digestInto() expects output buffer of length at least ' + min);\n }\n}\n\n/** Generic type encompassing 8/16/32-byte arrays - but not 64-byte. */\n// prettier-ignore\nexport type TypedArray = Int8Array | Uint8ClampedArray | Uint8Array |\n Uint16Array | Int16Array | Uint32Array | Int32Array;\n\n/** Cast u8 / u16 / u32 to u8. */\nexport function u8(arr: TypedArray): Uint8Array {\n return new Uint8Array(arr.buffer, arr.byteOffset, arr.byteLength);\n}\n\n/** Cast u8 / u16 / u32 to u32. */\nexport function u32(arr: TypedArray): Uint32Array {\n return new Uint32Array(arr.buffer, arr.byteOffset, Math.floor(arr.byteLength / 4));\n}\n\n/** Zeroize a byte array. Warning: JS provides no guarantees. */\nexport function clean(...arrays: TypedArray[]): void {\n for (let i = 0; i < arrays.length; i++) {\n arrays[i].fill(0);\n }\n}\n\n/** Create DataView of an array for easy byte-level manipulation. */\nexport function createView(arr: TypedArray): DataView {\n return new DataView(arr.buffer, arr.byteOffset, arr.byteLength);\n}\n\n/** The rotate right (circular right shift) operation for uint32 */\nexport function rotr(word: number, shift: number): number {\n return (word << (32 - shift)) | (word >>> shift);\n}\n\n/** The rotate left (circular left shift) operation for uint32 */\nexport function rotl(word: number, shift: number): number {\n return (word << shift) | ((word >>> (32 - shift)) >>> 0);\n}\n\n/** Is current platform little-endian? Most are. Big-Endian platform: IBM */\nexport const isLE: boolean = /* @__PURE__ */ (() =>\n new Uint8Array(new Uint32Array([0x11223344]).buffer)[0] === 0x44)();\n\n/** The byte swap operation for uint32 */\nexport function byteSwap(word: number): number {\n return (\n ((word << 24) & 0xff000000) |\n ((word << 8) & 0xff0000) |\n ((word >>> 8) & 0xff00) |\n ((word >>> 24) & 0xff)\n );\n}\n/** Conditionally byte swap if on a big-endian platform */\nexport const swap8IfBE: (n: number) => number = isLE\n ? (n: number) => n\n : (n: number) => byteSwap(n);\n\n/** @deprecated */\nexport const byteSwapIfBE: typeof swap8IfBE = swap8IfBE;\n/** In place byte swap for Uint32Array */\nexport function byteSwap32(arr: Uint32Array): Uint32Array {\n for (let i = 0; i < arr.length; i++) {\n arr[i] = byteSwap(arr[i]);\n }\n return arr;\n}\n\nexport const swap32IfBE: (u: Uint32Array) => Uint32Array = isLE\n ? (u: Uint32Array) => u\n : byteSwap32;\n\n// Built-in hex conversion https://caniuse.com/mdn-javascript_builtins_uint8array_fromhex\nconst hasHexBuiltin: boolean = /* @__PURE__ */ (() =>\n // @ts-ignore\n typeof Uint8Array.from([]).toHex === 'function' && typeof Uint8Array.fromHex === 'function')();\n\n// Array where index 0xf0 (240) is mapped to string 'f0'\nconst hexes = /* @__PURE__ */ Array.from({ length: 256 }, (_, i) =>\n i.toString(16).padStart(2, '0')\n);\n\n/**\n * Convert byte array to hex string. Uses built-in function, when available.\n * @example bytesToHex(Uint8Array.from([0xca, 0xfe, 0x01, 0x23])) // 'cafe0123'\n */\nexport function bytesToHex(bytes: Uint8Array): string {\n abytes(bytes);\n // @ts-ignore\n if (hasHexBuiltin) return bytes.toHex();\n // pre-caching improves the speed 6x\n let hex = '';\n for (let i = 0; i < bytes.length; i++) {\n hex += hexes[bytes[i]];\n }\n return hex;\n}\n\n// We use optimized technique to convert hex string to byte array\nconst asciis = { _0: 48, _9: 57, A: 65, F: 70, a: 97, f: 102 } as const;\nfunction asciiToBase16(ch: number): number | undefined {\n if (ch >= asciis._0 && ch <= asciis._9) return ch - asciis._0; // '2' => 50-48\n if (ch >= asciis.A && ch <= asciis.F) return ch - (asciis.A - 10); // 'B' => 66-(65-10)\n if (ch >= asciis.a && ch <= asciis.f) return ch - (asciis.a - 10); // 'b' => 98-(97-10)\n return;\n}\n\n/**\n * Convert hex string to byte array. Uses built-in function, when available.\n * @example hexToBytes('cafe0123') // Uint8Array.from([0xca, 0xfe, 0x01, 0x23])\n */\nexport function hexToBytes(hex: string): Uint8Array {\n if (typeof hex !== 'string') throw new Error('hex string expected, got ' + typeof hex);\n // @ts-ignore\n if (hasHexBuiltin) return Uint8Array.fromHex(hex);\n const hl = hex.length;\n const al = hl / 2;\n if (hl % 2) throw new Error('hex string expected, got unpadded hex of length ' + hl);\n const array = new Uint8Array(al);\n for (let ai = 0, hi = 0; ai < al; ai++, hi += 2) {\n const n1 = asciiToBase16(hex.charCodeAt(hi));\n const n2 = asciiToBase16(hex.charCodeAt(hi + 1));\n if (n1 === undefined || n2 === undefined) {\n const char = hex[hi] + hex[hi + 1];\n throw new Error('hex string expected, got non-hex character \"' + char + '\" at index ' + hi);\n }\n array[ai] = n1 * 16 + n2; // multiply first octet, e.g. 'a3' => 10*16+3 => 160 + 3 => 163\n }\n return array;\n}\n\n/**\n * There is no setImmediate in browser and setTimeout is slow.\n * Call of async fn will return Promise, which will be fullfiled only on\n * next scheduler queue processing step and this is exactly what we need.\n */\nexport const nextTick = async (): Promise<void> => {};\n\n/** Returns control to thread each 'tick' ms to avoid blocking. */\nexport async function asyncLoop(\n iters: number,\n tick: number,\n cb: (i: number) => void\n): Promise<void> {\n let ts = Date.now();\n for (let i = 0; i < iters; i++) {\n cb(i);\n // Date.now() is not monotonic, so in case if clock goes backwards we return return control too\n const diff = Date.now() - ts;\n if (diff >= 0 && diff < tick) continue;\n await nextTick();\n ts += diff;\n }\n}\n\n// Global symbols, but ts doesn't see them: https://github.com/microsoft/TypeScript/issues/31535\ndeclare const TextEncoder: any;\ndeclare const TextDecoder: any;\n\n/**\n * Converts string to bytes using UTF8 encoding.\n * @example utf8ToBytes('abc') // Uint8Array.from([97, 98, 99])\n */\nexport function utf8ToBytes(str: string): Uint8Array {\n if (typeof str !== 'string') throw new Error('string expected');\n return new Uint8Array(new TextEncoder().encode(str)); // https://bugzil.la/1681809\n}\n\n/**\n * Converts bytes to string using UTF8 encoding.\n * @example bytesToUtf8(Uint8Array.from([97, 98, 99])) // 'abc'\n */\nexport function bytesToUtf8(bytes: Uint8Array): string {\n return new TextDecoder().decode(bytes);\n}\n\n/** Accepted input of hash functions. Strings are converted to byte arrays. */\nexport type Input = string | Uint8Array;\n/**\n * Normalizes (non-hex) string or Uint8Array to Uint8Array.\n * Warning: when Uint8Array is passed, it would NOT get copied.\n * Keep in mind for future mutable operations.\n */\nexport function toBytes(data: Input): Uint8Array {\n if (typeof data === 'string') data = utf8ToBytes(data);\n abytes(data);\n return data;\n}\n\n/** KDFs can accept string or Uint8Array for user convenience. */\nexport type KDFInput = string | Uint8Array;\n/**\n * Helper for KDFs: consumes uint8array or string.\n * When string is passed, does utf8 decoding, using TextDecoder.\n */\nexport function kdfInputToBytes(data: KDFInput): Uint8Array {\n if (typeof data === 'string') data = utf8ToBytes(data);\n abytes(data);\n return data;\n}\n\n/** Copies several Uint8Arrays into one. */\nexport function concatBytes(...arrays: Uint8Array[]): Uint8Array {\n let sum = 0;\n for (let i = 0; i < arrays.length; i++) {\n const a = arrays[i];\n abytes(a);\n sum += a.length;\n }\n const res = new Uint8Array(sum);\n for (let i = 0, pad = 0; i < arrays.length; i++) {\n const a = arrays[i];\n res.set(a, pad);\n pad += a.length;\n }\n return res;\n}\n\ntype EmptyObj = {};\nexport function checkOpts<T1 extends EmptyObj, T2 extends EmptyObj>(\n defaults: T1,\n opts?: T2\n): T1 & T2 {\n if (opts !== undefined && {}.toString.call(opts) !== '[object Object]')\n throw new Error('options should be object or undefined');\n const merged = Object.assign(defaults, opts);\n return merged as T1 & T2;\n}\n\n/** Hash interface. */\nexport type IHash = {\n (data: Uint8Array): Uint8Array;\n blockLen: number;\n outputLen: number;\n create: any;\n};\n\n/** For runtime check if class implements interface */\nexport abstract class Hash<T extends Hash<T>> {\n abstract blockLen: number; // Bytes per block\n abstract outputLen: number; // Bytes in output\n abstract update(buf: Input): this;\n // Writes digest into buf\n abstract digestInto(buf: Uint8Array): void;\n abstract digest(): Uint8Array;\n /**\n * Resets internal state. Makes Hash instance unusable.\n * Reset is impossible for keyed hashes if key is consumed into state. If digest is not consumed\n * by user, they will need to manually call `destroy()` when zeroing is necessary.\n */\n abstract destroy(): void;\n /**\n * Clones hash instance. Unsafe: doesn't check whether `to` is valid. Can be used as `clone()`\n * when no options are passed.\n * Reasons to use `_cloneInto` instead of clone: 1) performance 2) reuse instance => all internal\n * buffers are overwritten => causes buffer overwrite which is used for digest in some cases.\n * There are no guarantees for clean-up because it's impossible in JS.\n */\n abstract _cloneInto(to?: T): T;\n // Safe version that clones internal state\n abstract clone(): T;\n}\n\n/**\n * XOF: streaming API to read digest in chunks.\n * Same as 'squeeze' in keccak/k12 and 'seek' in blake3, but more generic name.\n * When hash used in XOF mode it is up to user to call '.destroy' afterwards, since we cannot\n * destroy state, next call can require more bytes.\n */\nexport type HashXOF<T extends Hash<T>> = Hash<T> & {\n xof(bytes: number): Uint8Array; // Read 'bytes' bytes from digest stream\n xofInto(buf: Uint8Array): Uint8Array; // read buf.length bytes from digest stream into buf\n};\n\n/** Hash function */\nexport type CHash = ReturnType<typeof createHasher>;\n/** Hash function with output */\nexport type CHashO = ReturnType<typeof createOptHasher>;\n/** XOF with output */\nexport type CHashXO = ReturnType<typeof createXOFer>;\n\n/** Wraps hash function, creating an interface on top of it */\nexport function createHasher<T extends Hash<T>>(\n hashCons: () => Hash<T>\n): {\n (msg: Input): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(): Hash<T>;\n} {\n const hashC = (msg: Input): Uint8Array => hashCons().update(toBytes(msg)).digest();\n const tmp = hashCons();\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = () => hashCons();\n return hashC;\n}\n\nexport function createOptHasher<H extends Hash<H>, T extends Object>(\n hashCons: (opts?: T) => Hash<H>\n): {\n (msg: Input, opts?: T): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(opts?: T): Hash<H>;\n} {\n const hashC = (msg: Input, opts?: T): Uint8Array => hashCons(opts).update(toBytes(msg)).digest();\n const tmp = hashCons({} as T);\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = (opts?: T) => hashCons(opts);\n return hashC;\n}\n\nexport function createXOFer<H extends HashXOF<H>, T extends Object>(\n hashCons: (opts?: T) => HashXOF<H>\n): {\n (msg: Input, opts?: T): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(opts?: T): HashXOF<H>;\n} {\n const hashC = (msg: Input, opts?: T): Uint8Array => hashCons(opts).update(toBytes(msg)).digest();\n const tmp = hashCons({} as T);\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = (opts?: T) => hashCons(opts);\n return hashC;\n}\nexport const wrapConstructor: typeof createHasher = createHasher;\nexport const wrapConstructorWithOpts: typeof createOptHasher = createOptHasher;\nexport const wrapXOFConstructorWithOpts: typeof createXOFer = createXOFer;\n\n/** Cryptographically secure PRNG. Uses internal OS-level `crypto.getRandomValues`. */\nexport function randomBytes(bytesLength = 32): Uint8Array {\n if (crypto && typeof crypto.getRandomValues === 'function') {\n return crypto.getRandomValues(new Uint8Array(bytesLength));\n }\n // Legacy Node.js compatibility\n if (crypto && typeof crypto.randomBytes === 'function') {\n return Uint8Array.from(crypto.randomBytes(bytesLength));\n }\n throw new Error('crypto.getRandomValues must be defined');\n}\n", "/**\n * Internal Merkle-Damgard hash utils.\n * @module\n */\nimport { type Input, Hash, abytes, aexists, aoutput, clean, createView, toBytes } from './utils.ts';\n\n/** Polyfill for Safari 14. https://caniuse.com/mdn-javascript_builtins_dataview_setbiguint64 */\nexport function setBigUint64(\n view: DataView,\n byteOffset: number,\n value: bigint,\n isLE: boolean\n): void {\n if (typeof view.setBigUint64 === 'function') return view.setBigUint64(byteOffset, value, isLE);\n const _32n = BigInt(32);\n const _u32_max = BigInt(0xffffffff);\n const wh = Number((value >> _32n) & _u32_max);\n const wl = Number(value & _u32_max);\n const h = isLE ? 4 : 0;\n const l = isLE ? 0 : 4;\n view.setUint32(byteOffset + h, wh, isLE);\n view.setUint32(byteOffset + l, wl, isLE);\n}\n\n/** Choice: a ? b : c */\nexport function Chi(a: number, b: number, c: number): number {\n return (a & b) ^ (~a & c);\n}\n\n/** Majority function, true if any two inputs is true. */\nexport function Maj(a: number, b: number, c: number): number {\n return (a & b) ^ (a & c) ^ (b & c);\n}\n\n/**\n * Merkle-Damgard hash construction base class.\n * Could be used to create MD5, RIPEMD, SHA1, SHA2.\n */\nexport abstract class HashMD<T extends HashMD<T>> extends Hash<T> {\n protected abstract process(buf: DataView, offset: number): void;\n protected abstract get(): number[];\n protected abstract set(...args: number[]): void;\n abstract destroy(): void;\n protected abstract roundClean(): void;\n\n readonly blockLen: number;\n readonly outputLen: number;\n readonly padOffset: number;\n readonly isLE: boolean;\n\n // For partial updates less than block size\n protected buffer: Uint8Array;\n protected view: DataView;\n protected finished = false;\n protected length = 0;\n protected pos = 0;\n protected destroyed = false;\n\n constructor(blockLen: number, outputLen: number, padOffset: number, isLE: boolean) {\n super();\n this.blockLen = blockLen;\n this.outputLen = outputLen;\n this.padOffset = padOffset;\n this.isLE = isLE;\n this.buffer = new Uint8Array(blockLen);\n this.view = createView(this.buffer);\n }\n update(data: Input): this {\n aexists(this);\n data = toBytes(data);\n abytes(data);\n const { view, buffer, blockLen } = this;\n const len = data.length;\n for (let pos = 0; pos < len; ) {\n const take = Math.min(blockLen - this.pos, len - pos);\n // Fast path: we have at least one block in input, cast it to view and process\n if (take === blockLen) {\n const dataView = createView(data);\n for (; blockLen <= len - pos; pos += blockLen) this.process(dataView, pos);\n continue;\n }\n buffer.set(data.subarray(pos, pos + take), this.pos);\n this.pos += take;\n pos += take;\n if (this.pos === blockLen) {\n this.process(view, 0);\n this.pos = 0;\n }\n }\n this.length += data.length;\n this.roundClean();\n return this;\n }\n digestInto(out: Uint8Array): void {\n aexists(this);\n aoutput(out, this);\n this.finished = true;\n // Padding\n // We can avoid allocation of buffer for padding completely if it\n // was previously not allocated here. But it won't change performance.\n const { buffer, view, blockLen, isLE } = this;\n let { pos } = this;\n // append the bit '1' to the message\n buffer[pos++] = 0b10000000;\n clean(this.buffer.subarray(pos));\n // we have less than padOffset left in buffer, so we cannot put length in\n // current block, need process it and pad again\n if (this.padOffset > blockLen - pos) {\n this.process(view, 0);\n pos = 0;\n }\n // Pad until full block byte with zeros\n for (let i = pos; i < blockLen; i++) buffer[i] = 0;\n // Note: sha512 requires length to be 128bit integer, but length in JS will overflow before that\n // You need to write around 2 exabytes (u64_max / 8 / (1024**6)) for this to happen.\n // So we just write lowest 64 bits of that value.\n setBigUint64(view, blockLen - 8, BigInt(this.length * 8), isLE);\n this.process(view, 0);\n const oview = createView(out);\n const len = this.outputLen;\n // NOTE: we do division by 4 later, which should be fused in single op with modulo by JIT\n if (len % 4) throw new Error('_sha2: outputLen should be aligned to 32bit');\n const outLen = len / 4;\n const state = this.get();\n if (outLen > state.length) throw new Error('_sha2: outputLen bigger than state');\n for (let i = 0; i < outLen; i++) oview.setUint32(4 * i, state[i], isLE);\n }\n digest(): Uint8Array {\n const { buffer, outputLen } = this;\n this.digestInto(buffer);\n const res = buffer.slice(0, outputLen);\n this.destroy();\n return res;\n }\n _cloneInto(to?: T): T {\n to ||= new (this.constructor as any)() as T;\n to.set(...this.get());\n const { blockLen, buffer, length, finished, destroyed, pos } = this;\n to.destroyed = destroyed;\n to.finished = finished;\n to.length = length;\n to.pos = pos;\n if (length % blockLen) to.buffer.set(buffer);\n return to;\n }\n clone(): T {\n return this._cloneInto();\n }\n}\n\n/**\n * Initial SHA-2 state: fractional parts of square roots of first 16 primes 2..53.\n * Check out `test/misc/sha2-gen-iv.js` for recomputation guide.\n */\n\n/** Initial SHA256 state. Bits 0..32 of frac part of sqrt of primes 2..19 */\nexport const SHA256_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0x6a09e667, 0xbb67ae85, 0x3c6ef372, 0xa54ff53a, 0x510e527f, 0x9b05688c, 0x1f83d9ab, 0x5be0cd19,\n]);\n\n/** Initial SHA224 state. Bits 32..64 of frac part of sqrt of primes 23..53 */\nexport const SHA224_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0xc1059ed8, 0x367cd507, 0x3070dd17, 0xf70e5939, 0xffc00b31, 0x68581511, 0x64f98fa7, 0xbefa4fa4,\n]);\n\n/** Initial SHA384 state. Bits 0..64 of frac part of sqrt of primes 23..53 */\nexport const SHA384_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0xcbbb9d5d, 0xc1059ed8, 0x629a292a, 0x367cd507, 0x9159015a, 0x3070dd17, 0x152fecd8, 0xf70e5939,\n 0x67332667, 0xffc00b31, 0x8eb44a87, 0x68581511, 0xdb0c2e0d, 0x64f98fa7, 0x47b5481d, 0xbefa4fa4,\n]);\n\n/** Initial SHA512 state. Bits 0..64 of frac part of sqrt of primes 2..19 */\nexport const SHA512_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0x6a09e667, 0xf3bcc908, 0xbb67ae85, 0x84caa73b, 0x3c6ef372, 0xfe94f82b, 0xa54ff53a, 0x5f1d36f1,\n 0x510e527f, 0xade682d1, 0x9b05688c, 0x2b3e6c1f, 0x1f83d9ab, 0xfb41bd6b, 0x5be0cd19, 0x137e2179,\n]);\n", "/**\n * SHA2 hash function. A.k.a. sha256, sha384, sha512, sha512_224, sha512_256.\n * SHA256 is the fastest hash implementable in JS, even faster than Blake3.\n * Check out [RFC 4634](https://datatracker.ietf.org/doc/html/rfc4634) and\n * [FIPS 180-4](https://nvlpubs.nist.gov/nistpubs/FIPS/NIST.FIPS.180-4.pdf).\n * @module\n */\nimport { Chi, HashMD, Maj, SHA224_IV, SHA256_IV, SHA384_IV, SHA512_IV } from './_md.ts';\nimport * as u64 from './_u64.ts';\nimport { type CHash, clean, createHasher, rotr } from './utils.ts';\n\n/**\n * Round constants:\n * First 32 bits of fractional parts of the cube roots of the first 64 primes 2..311)\n */\n// prettier-ignore\nconst SHA256_K = /* @__PURE__ */ Uint32Array.from([\n 0x428a2f98, 0x71374491, 0xb5c0fbcf, 0xe9b5dba5, 0x3956c25b, 0x59f111f1, 0x923f82a4, 0xab1c5ed5,\n 0xd807aa98, 0x12835b01, 0x243185be, 0x550c7dc3, 0x72be5d74, 0x80deb1fe, 0x9bdc06a7, 0xc19bf174,\n 0xe49b69c1, 0xefbe4786, 0x0fc19dc6, 0x240ca1cc, 0x2de92c6f, 0x4a7484aa, 0x5cb0a9dc, 0x76f988da,\n 0x983e5152, 0xa831c66d, 0xb00327c8, 0xbf597fc7, 0xc6e00bf3, 0xd5a79147, 0x06ca6351, 0x14292967,\n 0x27b70a85, 0x2e1b2138, 0x4d2c6dfc, 0x53380d13, 0x650a7354, 0x766a0abb, 0x81c2c92e, 0x92722c85,\n 0xa2bfe8a1, 0xa81a664b, 0xc24b8b70, 0xc76c51a3, 0xd192e819, 0xd6990624, 0xf40e3585, 0x106aa070,\n 0x19a4c116, 0x1e376c08, 0x2748774c, 0x34b0bcb5, 0x391c0cb3, 0x4ed8aa4a, 0x5b9cca4f, 0x682e6ff3,\n 0x748f82ee, 0x78a5636f, 0x84c87814, 0x8cc70208, 0x90befffa, 0xa4506ceb, 0xbef9a3f7, 0xc67178f2\n]);\n\n/** Reusable temporary buffer. \"W\" comes straight from spec. */\nconst SHA256_W = /* @__PURE__ */ new Uint32Array(64);\nexport class SHA256 extends HashMD<SHA256> {\n // We cannot use array here since array allows indexing by variable\n // which means optimizer/compiler cannot use registers.\n protected A: number = SHA256_IV[0] | 0;\n protected B: number = SHA256_IV[1] | 0;\n protected C: number = SHA256_IV[2] | 0;\n protected D: number = SHA256_IV[3] | 0;\n protected E: number = SHA256_IV[4] | 0;\n protected F: number = SHA256_IV[5] | 0;\n protected G: number = SHA256_IV[6] | 0;\n protected H: number = SHA256_IV[7] | 0;\n\n constructor(outputLen: number = 32) {\n super(64, outputLen, 8, false);\n }\n protected get(): [number, number, number, number, number, number, number, number] {\n const { A, B, C, D, E, F, G, H } = this;\n return [A, B, C, D, E, F, G, H];\n }\n // prettier-ignore\n protected set(\n A: number, B: number, C: number, D: number, E: number, F: number, G: number, H: number\n ): void {\n this.A = A | 0;\n this.B = B | 0;\n this.C = C | 0;\n this.D = D | 0;\n this.E = E | 0;\n this.F = F | 0;\n this.G = G | 0;\n this.H = H | 0;\n }\n protected process(view: DataView, offset: number): void {\n // Extend the first 16 words into the remaining 48 words w[16..63] of the message schedule array\n for (let i = 0; i < 16; i++, offset += 4) SHA256_W[i] = view.getUint32(offset, false);\n for (let i = 16; i < 64; i++) {\n const W15 = SHA256_W[i - 15];\n const W2 = SHA256_W[i - 2];\n const s0 = rotr(W15, 7) ^ rotr(W15, 18) ^ (W15 >>> 3);\n const s1 = rotr(W2, 17) ^ rotr(W2, 19) ^ (W2 >>> 10);\n SHA256_W[i] = (s1 + SHA256_W[i - 7] + s0 + SHA256_W[i - 16]) | 0;\n }\n // Compression function main loop, 64 rounds\n let { A, B, C, D, E, F, G, H } = this;\n for (let i = 0; i < 64; i++) {\n const sigma1 = rotr(E, 6) ^ rotr(E, 11) ^ rotr(E, 25);\n const T1 = (H + sigma1 + Chi(E, F, G) + SHA256_K[i] + SHA256_W[i]) | 0;\n const sigma0 = rotr(A, 2) ^ rotr(A, 13) ^ rotr(A, 22);\n const T2 = (sigma0 + Maj(A, B, C)) | 0;\n H = G;\n G = F;\n F = E;\n E = (D + T1) | 0;\n D = C;\n C = B;\n B = A;\n A = (T1 + T2) | 0;\n }\n // Add the compressed chunk to the current hash value\n A = (A + this.A) | 0;\n B = (B + this.B) | 0;\n C = (C + this.C) | 0;\n D = (D + this.D) | 0;\n E = (E + this.E) | 0;\n F = (F + this.F) | 0;\n G = (G + this.G) | 0;\n H = (H + this.H) | 0;\n this.set(A, B, C, D, E, F, G, H);\n }\n protected roundClean(): void {\n clean(SHA256_W);\n }\n destroy(): void {\n this.set(0, 0, 0, 0, 0, 0, 0, 0);\n clean(this.buffer);\n }\n}\n\nexport class SHA224 extends SHA256 {\n protected A: number = SHA224_IV[0] | 0;\n protected B: number = SHA224_IV[1] | 0;\n protected C: number = SHA224_IV[2] | 0;\n protected D: number = SHA224_IV[3] | 0;\n protected E: number = SHA224_IV[4] | 0;\n protected F: number = SHA224_IV[5] | 0;\n protected G: number = SHA224_IV[6] | 0;\n protected H: number = SHA224_IV[7] | 0;\n constructor() {\n super(28);\n }\n}\n\n// SHA2-512 is slower than sha256 in js because u64 operations are slow.\n\n// Round contants\n// First 32 bits of the fractional parts of the cube roots of the first 80 primes 2..409\n// prettier-ignore\nconst K512 = /* @__PURE__ */ (() => u64.split([\n '0x428a2f98d728ae22', '0x7137449123ef65cd', '0xb5c0fbcfec4d3b2f', '0xe9b5dba58189dbbc',\n '0x3956c25bf348b538', '0x59f111f1b605d019', '0x923f82a4af194f9b', '0xab1c5ed5da6d8118',\n '0xd807aa98a3030242', '0x12835b0145706fbe', '0x243185be4ee4b28c', '0x550c7dc3d5ffb4e2',\n '0x72be5d74f27b896f', '0x80deb1fe3b1696b1', '0x9bdc06a725c71235', '0xc19bf174cf692694',\n '0xe49b69c19ef14ad2', '0xefbe4786384f25e3', '0x0fc19dc68b8cd5b5', '0x240ca1cc77ac9c65',\n '0x2de92c6f592b0275', '0x4a7484aa6ea6e483', '0x5cb0a9dcbd41fbd4', '0x76f988da831153b5',\n '0x983e5152ee66dfab', '0xa831c66d2db43210', '0xb00327c898fb213f', '0xbf597fc7beef0ee4',\n '0xc6e00bf33da88fc2', '0xd5a79147930aa725', '0x06ca6351e003826f', '0x142929670a0e6e70',\n '0x27b70a8546d22ffc', '0x2e1b21385c26c926', '0x4d2c6dfc5ac42aed', '0x53380d139d95b3df',\n '0x650a73548baf63de', '0x766a0abb3c77b2a8', '0x81c2c92e47edaee6', '0x92722c851482353b',\n '0xa2bfe8a14cf10364', '0xa81a664bbc423001', '0xc24b8b70d0f89791', '0xc76c51a30654be30',\n '0xd192e819d6ef5218', '0xd69906245565a910', '0xf40e35855771202a', '0x106aa07032bbd1b8',\n '0x19a4c116b8d2d0c8', '0x1e376c085141ab53', '0x2748774cdf8eeb99', '0x34b0bcb5e19b48a8',\n '0x391c0cb3c5c95a63', '0x4ed8aa4ae3418acb', '0x5b9cca4f7763e373', '0x682e6ff3d6b2b8a3',\n '0x748f82ee5defb2fc', '0x78a5636f43172f60', '0x84c87814a1f0ab72', '0x8cc702081a6439ec',\n '0x90befffa23631e28', '0xa4506cebde82bde9', '0xbef9a3f7b2c67915', '0xc67178f2e372532b',\n '0xca273eceea26619c', '0xd186b8c721c0c207', '0xeada7dd6cde0eb1e', '0xf57d4f7fee6ed178',\n '0x06f067aa72176fba', '0x0a637dc5a2c898a6', '0x113f9804bef90dae', '0x1b710b35131c471b',\n '0x28db77f523047d84', '0x32caab7b40c72493', '0x3c9ebe0a15c9bebc', '0x431d67c49c100d4c',\n '0x4cc5d4becb3e42b6', '0x597f299cfc657e2a', '0x5fcb6fab3ad6faec', '0x6c44198c4a475817'\n].map(n => BigInt(n))))();\nconst SHA512_Kh = /* @__PURE__ */ (() => K512[0])();\nconst SHA512_Kl = /* @__PURE__ */ (() => K512[1])();\n\n// Reusable temporary buffers\nconst SHA512_W_H = /* @__PURE__ */ new Uint32Array(80);\nconst SHA512_W_L = /* @__PURE__ */ new Uint32Array(80);\n\nexport class SHA512 extends HashMD<SHA512> {\n // We cannot use array here since array allows indexing by variable\n // which means optimizer/compiler cannot use registers.\n // h -- high 32 bits, l -- low 32 bits\n protected Ah: number = SHA512_IV[0] | 0;\n protected Al: number = SHA512_IV[1] | 0;\n protected Bh: number = SHA512_IV[2] | 0;\n protected Bl: number = SHA512_IV[3] | 0;\n protected Ch: number = SHA512_IV[4] | 0;\n protected Cl: number = SHA512_IV[5] | 0;\n protected Dh: number = SHA512_IV[6] | 0;\n protected Dl: number = SHA512_IV[7] | 0;\n protected Eh: number = SHA512_IV[8] | 0;\n protected El: number = SHA512_IV[9] | 0;\n protected Fh: number = SHA512_IV[10] | 0;\n protected Fl: number = SHA512_IV[11] | 0;\n protected Gh: number = SHA512_IV[12] | 0;\n protected Gl: number = SHA512_IV[13] | 0;\n protected Hh: number = SHA512_IV[14] | 0;\n protected Hl: number = SHA512_IV[15] | 0;\n\n constructor(outputLen: number = 64) {\n super(128, outputLen, 16, false);\n }\n // prettier-ignore\n protected get(): [\n number, number, number, number, number, number, number, number,\n number, number, number, number, number, number, number, number\n ] {\n const { Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl } = this;\n return [Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl];\n }\n // prettier-ignore\n protected set(\n Ah: number, Al: number, Bh: number, Bl: number, Ch: number, Cl: number, Dh: number, Dl: number,\n Eh: number, El: number, Fh: number, Fl: number, Gh: number, Gl: number, Hh: number, Hl: number\n ): void {\n this.Ah = Ah | 0;\n this.Al = Al | 0;\n this.Bh = Bh | 0;\n this.Bl = Bl | 0;\n this.Ch = Ch | 0;\n this.Cl = Cl | 0;\n this.Dh = Dh | 0;\n this.Dl = Dl | 0;\n this.Eh = Eh | 0;\n this.El = El | 0;\n this.Fh = Fh | 0;\n this.Fl = Fl | 0;\n this.Gh = Gh | 0;\n this.Gl = Gl | 0;\n this.Hh = Hh | 0;\n this.Hl = Hl | 0;\n }\n protected process(view: DataView, offset: number): void {\n // Extend the first 16 words into the remaining 64 words w[16..79] of the message schedule array\n for (let i = 0; i < 16; i++, offset += 4) {\n SHA512_W_H[i] = view.getUint32(offset);\n SHA512_W_L[i] = view.getUint32((offset += 4));\n }\n for (let i = 16; i < 80; i++) {\n // s0 := (w[i-15] rightrotate 1) xor (w[i-15] rightrotate 8) xor (w[i-15] rightshift 7)\n const W15h = SHA512_W_H[i - 15] | 0;\n const W15l = SHA512_W_L[i - 15] | 0;\n const s0h = u64.rotrSH(W15h, W15l, 1) ^ u64.rotrSH(W15h, W15l, 8) ^ u64.shrSH(W15h, W15l, 7);\n const s0l = u64.rotrSL(W15h, W15l, 1) ^ u64.rotrSL(W15h, W15l, 8) ^ u64.shrSL(W15h, W15l, 7);\n // s1 := (w[i-2] rightrotate 19) xor (w[i-2] rightrotate 61) xor (w[i-2] rightshift 6)\n const W2h = SHA512_W_H[i - 2] | 0;\n const W2l = SHA512_W_L[i - 2] | 0;\n const s1h = u64.rotrSH(W2h, W2l, 19) ^ u64.rotrBH(W2h, W2l, 61) ^ u64.shrSH(W2h, W2l, 6);\n const s1l = u64.rotrSL(W2h, W2l, 19) ^ u64.rotrBL(W2h, W2l, 61) ^ u64.shrSL(W2h, W2l, 6);\n // SHA256_W[i] = s0 + s1 + SHA256_W[i - 7] + SHA256_W[i - 16];\n const SUMl = u64.add4L(s0l, s1l, SHA512_W_L[i - 7], SHA512_W_L[i - 16]);\n const SUMh = u64.add4H(SUMl, s0h, s1h, SHA512_W_H[i - 7], SHA512_W_H[i - 16]);\n SHA512_W_H[i] = SUMh | 0;\n SHA512_W_L[i] = SUMl | 0;\n }\n let { Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl } = this;\n // Compression function main loop, 80 rounds\n for (let i = 0; i < 80; i++) {\n // S1 := (e rightrotate 14) xor (e rightrotate 18) xor (e rightrotate 41)\n const sigma1h = u64.rotrSH(Eh, El, 14) ^ u64.rotrSH(Eh, El, 18) ^ u64.rotrBH(Eh, El, 41);\n const sigma1l = u64.rotrSL(Eh, El, 14) ^ u64.rotrSL(Eh, El, 18) ^ u64.rotrBL(Eh, El, 41);\n //const T1 = (H + sigma1 + Chi(E, F, G) + SHA256_K[i] + SHA256_W[i]) | 0;\n const CHIh = (Eh & Fh) ^ (~Eh & Gh);\n const CHIl = (El & Fl) ^ (~El & Gl);\n // T1 = H + sigma1 + Chi(E, F, G) + SHA512_K[i] + SHA512_W[i]\n // prettier-ignore\n const T1ll = u64.add5L(Hl, sigma1l, CHIl, SHA512_Kl[i], SHA512_W_L[i]);\n const T1h = u64.add5H(T1ll, Hh, sigma1h, CHIh, SHA512_Kh[i], SHA512_W_H[i]);\n const T1l = T1ll | 0;\n // S0 := (a rightrotate 28) xor (a rightrotate 34) xor (a rightrotate 39)\n const sigma0h = u64.rotrSH(Ah, Al, 28) ^ u64.rotrBH(Ah, Al, 34) ^ u64.rotrBH(Ah, Al, 39);\n const sigma0l = u64.rotrSL(Ah, Al, 28) ^ u64.rotrBL(Ah, Al, 34) ^ u64.rotrBL(Ah, Al, 39);\n const MAJh = (Ah & Bh) ^ (Ah & Ch) ^ (Bh & Ch);\n const MAJl = (Al & Bl) ^ (Al & Cl) ^ (Bl & Cl);\n Hh = Gh | 0;\n Hl = Gl | 0;\n Gh = Fh | 0;\n Gl = Fl | 0;\n Fh = Eh | 0;\n Fl = El | 0;\n ({ h: Eh, l: El } = u64.add(Dh | 0, Dl | 0, T1h | 0, T1l | 0));\n Dh = Ch | 0;\n Dl = Cl | 0;\n Ch = Bh | 0;\n Cl = Bl | 0;\n Bh = Ah | 0;\n Bl = Al | 0;\n const All = u64.add3L(T1l, sigma0l, MAJl);\n Ah = u64.add3H(All, T1h, sigma0h, MAJh);\n Al = All | 0;\n }\n // Add the compressed chunk to the current hash value\n ({ h: Ah, l: Al } = u64.add(this.Ah | 0, this.Al | 0, Ah | 0, Al | 0));\n ({ h: Bh, l: Bl } = u64.add(this.Bh | 0, this.Bl | 0, Bh | 0, Bl | 0));\n ({ h: Ch, l: Cl } = u64.add(this.Ch | 0, this.Cl | 0, Ch | 0, Cl | 0));\n ({ h: Dh, l: Dl } = u64.add(this.Dh | 0, this.Dl | 0, Dh | 0, Dl | 0));\n ({ h: Eh, l: El } = u64.add(this.Eh | 0, this.El | 0, Eh | 0, El | 0));\n ({ h: Fh, l: Fl } = u64.add(this.Fh | 0, this.Fl | 0, Fh | 0, Fl | 0));\n ({ h: Gh, l: Gl } = u64.add(this.Gh | 0, this.Gl | 0, Gh | 0, Gl | 0));\n ({ h: Hh, l: Hl } = u64.add(this.Hh | 0, this.Hl | 0, Hh | 0, Hl | 0));\n this.set(Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl);\n }\n protected roundClean(): void {\n clean(SHA512_W_H, SHA512_W_L);\n }\n destroy(): void {\n clean(this.buffer);\n this.set(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0);\n }\n}\n\nexport class SHA384 extends SHA512 {\n protected Ah: number = SHA384_IV[0] | 0;\n protected Al: number = SHA384_IV[1] | 0;\n protected Bh: number = SHA384_IV[2] | 0;\n protected Bl: number = SHA384_IV[3] | 0;\n protected Ch: number = SHA384_IV[4] | 0;\n protected Cl: number = SHA384_IV[5] | 0;\n protected Dh: number = SHA384_IV[6] | 0;\n protected Dl: number = SHA384_IV[7] | 0;\n protected Eh: number = SHA384_IV[8] | 0;\n protected El: number = SHA384_IV[9] | 0;\n protected Fh: number = SHA384_IV[10] | 0;\n protected Fl: number = SHA384_IV[11] | 0;\n protected Gh: number = SHA384_IV[12] | 0;\n protected Gl: number = SHA384_IV[13] | 0;\n protected Hh: number = SHA384_IV[14] | 0;\n protected Hl: number = SHA384_IV[15] | 0;\n\n constructor() {\n super(48);\n }\n}\n\n/**\n * Truncated SHA512/256 and SHA512/224.\n * SHA512_IV is XORed with 0xa5a5a5a5a5a5a5a5, then used as \"intermediary\" IV of SHA512/t.\n * Then t hashes string to produce result IV.\n * See `test/misc/sha2-gen-iv.js`.\n */\n\n/** SHA512/224 IV */\nconst T224_IV = /* @__PURE__ */ Uint32Array.from([\n 0x8c3d37c8, 0x19544da2, 0x73e19966, 0x89dcd4d6, 0x1dfab7ae, 0x32ff9c82, 0x679dd514, 0x582f9fcf,\n 0x0f6d2b69, 0x7bd44da8, 0x77e36f73, 0x04c48942, 0x3f9d85a8, 0x6a1d36c8, 0x1112e6ad, 0x91d692a1,\n]);\n\n/** SHA512/256 IV */\nconst T256_IV = /* @__PURE__ */ Uint32Array.from([\n 0x22312194, 0xfc2bf72c, 0x9f555fa3, 0xc84c64c2, 0x2393b86b, 0x6f53b151, 0x96387719, 0x5940eabd,\n 0x96283ee2, 0xa88effe3, 0xbe5e1e25, 0x53863992, 0x2b0199fc, 0x2c85b8aa, 0x0eb72ddc, 0x81c52ca2,\n]);\n\nexport class SHA512_224 extends SHA512 {\n protected Ah: number = T224_IV[0] | 0;\n protected Al: number = T224_IV[1] | 0;\n protected Bh: number = T224_IV[2] | 0;\n protected Bl: number = T224_IV[3] | 0;\n protected Ch: number = T224_IV[4] | 0;\n protected Cl: number = T224_IV[5] | 0;\n protected Dh: number = T224_IV[6] | 0;\n protected Dl: number = T224_IV[7] | 0;\n protected Eh: number = T224_IV[8] | 0;\n protected El: number = T224_IV[9] | 0;\n protected Fh: number = T224_IV[10] | 0;\n protected Fl: number = T224_IV[11] | 0;\n protected Gh: number = T224_IV[12] | 0;\n protected Gl: number = T224_IV[13] | 0;\n protected Hh: number = T224_IV[14] | 0;\n protected Hl: number = T224_IV[15] | 0;\n\n constructor() {\n super(28);\n }\n}\n\nexport class SHA512_256 extends SHA512 {\n protected Ah: number = T256_IV[0] | 0;\n protected Al: number = T256_IV[1] | 0;\n protected Bh: number = T256_IV[2] | 0;\n protected Bl: number = T256_IV[3] | 0;\n protected Ch: number = T256_IV[4] | 0;\n protected Cl: number = T256_IV[5] | 0;\n protected Dh: number = T256_IV[6] | 0;\n protected Dl: number = T256_IV[7] | 0;\n protected Eh: number = T256_IV[8] | 0;\n protected El: number = T256_IV[9] | 0;\n protected Fh: number = T256_IV[10] | 0;\n protected Fl: number = T256_IV[11] | 0;\n protected Gh: number = T256_IV[12] | 0;\n protected Gl: number = T256_IV[13] | 0;\n protected Hh: number = T256_IV[14] | 0;\n protected Hl: number = T256_IV[15] | 0;\n\n constructor() {\n super(32);\n }\n}\n\n/**\n * SHA2-256 hash function from RFC 4634.\n *\n * It is the fastest JS hash, even faster than Blake3.\n * To break sha256 using birthday attack, attackers need to try 2^128 hashes.\n * BTC network is doing 2^70 hashes/sec (2^95 hashes/year) as per 2025.\n */\nexport const sha256: CHash = /* @__PURE__ */ createHasher(() => new SHA256());\n/** SHA2-224 hash function from RFC 4634 */\nexport const sha224: CHash = /* @__PURE__ */ createHasher(() => new SHA224());\n\n/** SHA2-512 hash function from RFC 4634. */\nexport const sha512: CHash = /* @__PURE__ */ createHasher(() => new SHA512());\n/** SHA2-384 hash function from RFC 4634. */\nexport const sha384: CHash = /* @__PURE__ */ createHasher(() => new SHA384());\n\n/**\n * SHA2-512/256 \"truncated\" hash function, with improved resistance to length extension attacks.\n * See the paper on [truncated SHA512](https://eprint.iacr.org/2010/548.pdf).\n */\nexport const sha512_256: CHash = /* @__PURE__ */ createHasher(() => new SHA512_256());\n/**\n * SHA2-512/224 \"truncated\" hash function, with improved resistance to length extension attacks.\n * See the paper on [truncated SHA512](https://eprint.iacr.org/2010/548.pdf).\n */\nexport const sha512_224: CHash = /* @__PURE__ */ createHasher(() => new SHA512_224());\n", "import { base32Decode, base32Encode } from './utils/base32.ts';\nimport { getCrc32 } from './utils/getCrc.ts';\nimport { sha224 } from '@noble/hashes/sha2';\nimport { bytesToHex, hexToBytes } from '@noble/hashes/utils';\n\nexport const JSON_KEY_PRINCIPAL = '__principal__';\nconst SELF_AUTHENTICATING_SUFFIX = 2;\nconst ANONYMOUS_SUFFIX = 4;\n\nconst MANAGEMENT_CANISTER_PRINCIPAL_TEXT_STR = 'aaaaa-aa';\n\nexport type JsonnablePrincipal = {\n [JSON_KEY_PRINCIPAL]: string;\n};\n\nexport class Principal {\n public static anonymous(): Principal {\n return new this(new Uint8Array([ANONYMOUS_SUFFIX]));\n }\n\n /**\n * Utility method, returning the principal representing the management canister, decoded from the hex string `'aaaaa-aa'`\n * @returns {Principal} principal of the management canister\n */\n public static managementCanister(): Principal {\n return this.fromText(MANAGEMENT_CANISTER_PRINCIPAL_TEXT_STR);\n }\n\n public static selfAuthenticating(publicKey: Uint8Array): Principal {\n const sha = sha224(publicKey);\n return new this(new Uint8Array([...sha, SELF_AUTHENTICATING_SUFFIX]));\n }\n\n public static from(other: unknown): Principal {\n if (typeof other === 'string') {\n return Principal.fromText(other);\n } else if (Object.getPrototypeOf(other) === Uint8Array.prototype) {\n return new Principal(other as Uint8Array);\n } else if (Principal.isPrincipal(other)) {\n return new Principal(other._arr);\n }\n\n throw new Error(`Impossible to convert ${JSON.stringify(other)} to Principal.`);\n }\n\n public static fromHex(hex: string): Principal {\n return new this(hexToBytes(hex));\n }\n\n public static fromText(text: string): Principal {\n let maybePrincipal = text;\n // If formatted as JSON string, parse it first\n if (text.includes(JSON_KEY_PRINCIPAL)) {\n const obj = JSON.parse(text);\n if (JSON_KEY_PRINCIPAL in obj) {\n maybePrincipal = obj[JSON_KEY_PRINCIPAL];\n }\n }\n\n const canisterIdNoDash = maybePrincipal.toLowerCase().replace(/-/g, '');\n\n let arr = base32Decode(canisterIdNoDash);\n arr = arr.slice(4, arr.length);\n\n const principal = new this(arr);\n if (principal.toText() !== maybePrincipal) {\n throw new Error(\n `Principal \"${principal.toText()}\" does not have a valid checksum (original value \"${maybePrincipal}\" may not be a valid Principal ID).`,\n );\n }\n\n return principal;\n }\n\n public static fromUint8Array(arr: Uint8Array): Principal {\n return new this(arr);\n }\n\n public static isPrincipal(other: unknown): other is Principal {\n return (\n other instanceof Principal ||\n (typeof other === 'object' &&\n other !== null &&\n '_isPrincipal' in other &&\n (other as { _isPrincipal: boolean })['_isPrincipal'] === true &&\n '_arr' in other &&\n (other as { _arr: Uint8Array })['_arr'] instanceof Uint8Array)\n );\n }\n\n public readonly _isPrincipal = true;\n\n protected constructor(private _arr: Uint8Array) {}\n\n public isAnonymous(): boolean {\n return this._arr.byteLength === 1 && this._arr[0] === ANONYMOUS_SUFFIX;\n }\n\n public toUint8Array(): Uint8Array {\n return this._arr;\n }\n\n public toHex(): string {\n return bytesToHex(this._arr).toUpperCase();\n }\n\n public toText(): string {\n const checksumArrayBuf = new ArrayBuffer(4);\n const view = new DataView(checksumArrayBuf);\n view.setUint32(0, getCrc32(this._arr));\n const checksum = new Uint8Array(checksumArrayBuf);\n\n const array = new Uint8Array([...checksum, ...this._arr]);\n\n const result = base32Encode(array);\n const matches = result.match(/.{1,5}/g);\n if (!matches) {\n // This should only happen if there's no character, which is unreachable.\n throw new Error();\n }\n return matches.join('-');\n }\n\n public toString(): string {\n return this.toText();\n }\n\n /**\n * Serializes to JSON\n * @returns {JsonnablePrincipal} a JSON object with a single key, {@link JSON_KEY_PRINCIPAL}, whose value is the principal as a string\n */\n public toJSON(): JsonnablePrincipal {\n return { [JSON_KEY_PRINCIPAL]: this.toText() };\n }\n\n /**\n * Utility method taking a Principal to compare against. Used for determining canister ranges in certificate verification\n * @param {Principal} other - a {@link Principal} to compare\n * @returns {'lt' | 'eq' | 'gt'} `'lt' | 'eq' | 'gt'` a string, representing less than, equal to, or greater than\n */\n public compareTo(other: Principal): 'lt' | 'eq' | 'gt' {\n for (let i = 0; i < Math.min(this._arr.length, other._arr.length); i++) {\n if (this._arr[i] < other._arr[i]) return 'lt';\n else if (this._arr[i] > other._arr[i]) return 'gt';\n }\n // Here, at least one principal is a prefix of the other principal (they could be the same)\n if (this._arr.length < other._arr.length) return 'lt';\n if (this._arr.length > other._arr.length) return 'gt';\n return 'eq';\n }\n\n /**\n * Utility method checking whether a provided Principal is less than or equal to the current one using the {@link Principal.compareTo} method\n * @param other a {@link Principal} to compare\n * @returns {boolean} boolean\n */\n public ltEq(other: Principal): boolean {\n const cmp = this.compareTo(other);\n return cmp == 'lt' || cmp == 'eq';\n }\n\n /**\n * Utility method checking whether a provided Principal is greater than or equal to the current one using the {@link Principal.compareTo} method\n * @param other a {@link Principal} to compare\n * @returns {boolean} boolean\n */\n public gtEq(other: Principal): boolean {\n const cmp = this.compareTo(other);\n return cmp == 'gt' || cmp == 'eq';\n }\n}\n", "import {PrincipalSchema, Uint8ArraySchema} from '@dfinity/zod-schemas';\nimport * as z from 'zod';\n\nexport const JunoType = {\n /** Validates a Principal. */\n principal: () => PrincipalSchema,\n /** Validates a Uint8Array (blob, vec<u8>). */\n uint8Array: () => Uint8ArraySchema\n};\n\n// z.union is omitted because object unions can't be reliably serialized to Candid/Rust without a discriminator field.\nconst {union: _, ...rest} = z;\n\n/**\n * Juno's type system - an extended Zod instance for Serverless Functions.\n *\n * The schema builder exposes all Zod schemas and functions aside from\n * `union()` which can't be reliably serialized currently without a discriminator field.\n * That's why you should prefer using `discriminatedUnion()` instead.\n *\n * It extends Zod with various schemas useful for writing your custom functions\n * such as `j.principal()` and `j.uint8Array()`.\n *\n * @example\n * import { j } from '@junobuild/schema';\n *\n * const MySchema = j.strictObject({\n * id: j.principal(),\n * name: j.string(),\n * });\n */\nconst j = Object.assign({}, rest) as unknown as Omit<typeof z, 'union'> & typeof JunoType;\n\nj.principal = JunoType.principal;\nj.uint8Array = JunoType.uint8Array;\n\nexport {j};\n"],
|
|
5
|
-
"mappings": ";;AAAA,UAAYA,MAAO,MIAnB,IAAMC,EAAW,mCAGXC,EAAsC,OAAO,OAAO,IAAI,EAC9D,QAASC,EAAI,EAAGA,EAAIF,EAAS,OAAQE,IACnCD,EAAYD,EAASE,CAAC,CAAC,EAAIA,EAI7BD,EAAY,CAAG,EAAIA,EAAY,EAC/BA,EAAY,CAAG,EAAIA,EAAY,EAMzB,SAAUE,EAAaC,EAAiB,CAE5C,IAAIC,EAAO,EAEPC,EAAO,EAGPC,EAAS,GAEb,SAASC,EAAWC,EAAY,CAS9B,OARIJ,EAAO,EAETC,GAAQG,GAAQ,CAACJ,EAGjBC,EAAQG,GAAQJ,EAAQ,IAGtBA,EAAO,GAETA,GAAQ,EACD,IAGLA,EAAO,IAETE,GAAUP,EAASM,GAAQ,CAAC,EAC5BD,GAAQ,GAGH,EACT,CAEA,QAASH,EAAI,EAAGA,EAAIE,EAAM,QACxBF,GAAKM,EAAWJ,EAAMF,CAAC,CAAC,EAG1B,OAAOK,GAAUF,EAAO,EAAIL,EAASM,GAAQ,CAAC,EAAI,GACpD,CAKM,SAAUI,EAAaN,EAAa,CAExC,IAAIC,EAAO,EAEPI,EAAO,EAELF,EAAS,IAAI,WAAaH,EAAM,OAAS,EAAK,EAAK,CAAC,EACtDO,EAAI,EAER,SAASC,EAAWC,EAAY,CAI9B,IAAIC,EAAMb,EAAYY,EAAK,YAAW,CAAE,EACxC,GAAIC,IAAQ,OACV,MAAM,IAAI,MAAM,sBAAsB,KAAK,UAAUD,CAAI,CAAC,EAAE,EAI9DC,IAAQ,EACRL,GAAQK,IAAQT,EAChBA,GAAQ,EAEJA,GAAQ,IAEVE,EAAOI,GAAG,EAAIF,EACdJ,GAAQ,EAEJA,EAAO,EACTI,EAAQK,GAAQ,EAAIT,EAAS,IAE7BI,EAAO,EAGb,CAEA,QAAWM,KAAKX,EACdQ,EAAWG,CAAC,EAGd,OAAOR,EAAO,MAAM,EAAGI,CAAC,CAC1B,CClGA,IAAMK,GAA2B,IAAI,YAAY,CAC/C,EAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,WAAY,SAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,WAAY,SAAY,WAAY,WAAY,WAAY,SAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,WAAY,SAAY,WAAY,WAAY,WAAY,SACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,SAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACrF,EAMK,SAAUC,EAASC,EAAe,CACtC,IAAIC,EAAM,GAEV,QAASC,EAAI,EAAGA,EAAIF,EAAI,OAAQE,IAAK,CAEnC,IAAMC,GADOH,EAAIE,CAAC,EACAD,GAAO,IACzBA,EAAMH,GAAYK,CAAC,EAAKF,IAAQ,CAClC,CAEA,OAAQA,EAAM,MAAQ,CACxB,CCpCM,SAAUG,GAAQC,EAAU,CAChC,OAAOA,aAAa,YAAe,YAAY,OAAOA,CAAC,GAAKA,EAAE,YAAY,OAAS,YACrF,CAQM,SAAUC,EAAOC,KAA8BC,EAAiB,CACpE,GAAI,CAACC,GAAQF,CAAC,EAAG,MAAM,IAAI,MAAM,qBAAqB,EACtD,GAAIC,EAAQ,OAAS,GAAK,CAACA,EAAQ,SAASD,EAAE,MAAM,EAClD,MAAM,IAAI,MAAM,iCAAmCC,EAAU,gBAAkBD,EAAE,MAAM,CAC3F,CAWM,SAAUG,EAAQC,EAAeC,EAAgB,GAAI,CACzD,GAAID,EAAS,UAAW,MAAM,IAAI,MAAM,kCAAkC,EAC1E,GAAIC,GAAiBD,EAAS,SAAU,MAAM,IAAI,MAAM,uCAAuC,CACjG,CAGM,SAAUE,EAAQC,EAAUH,EAAa,CAC7CI,EAAOD,CAAG,EACV,IAAME,EAAML,EAAS,UACrB,GAAIG,EAAI,OAASE,EACf,MAAM,IAAI,MAAM,yDAA2DA,CAAG,CAElF,CAkBM,SAAUC,KAASC,EAAoB,CAC3C,QAASC,EAAI,EAAGA,EAAID,EAAO,OAAQC,IACjCD,EAAOC,CAAC,EAAE,KAAK,CAAC,CAEpB,CAGM,SAAUC,EAAWC,EAAe,CACxC,OAAO,IAAI,SAASA,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,CAChE,CAGM,SAAUC,EAAKC,EAAcC,EAAa,CAC9C,OAAQD,GAAS,GAAKC,EAAWD,IAASC,CAC5C,CAwCA,IAAMC,EAEJ,OAAO,WAAW,KAAK,CAAA,CAAE,EAAE,OAAU,YAAc,OAAO,WAAW,SAAY,WAG7EC,GAAwB,MAAM,KAAK,CAAE,OAAQ,GAAG,EAAI,CAACC,EAAGC,IAC5DA,EAAE,SAAS,EAAE,EAAE,SAAS,EAAG,GAAG,CAAC,EAO3B,SAAUC,EAAWC,EAAiB,CAG1C,GAFAC,EAAOD,CAAK,EAERL,EAAe,OAAOK,EAAM,MAAK,EAErC,IAAIE,EAAM,GACV,QAASJ,EAAI,EAAGA,EAAIE,EAAM,OAAQF,IAChCI,GAAON,GAAMI,EAAMF,CAAC,CAAC,EAEvB,OAAOI,CACT,CAGA,IAAMC,EAAS,CAAE,GAAI,GAAI,GAAI,GAAI,EAAG,GAAI,EAAG,GAAI,EAAG,GAAI,EAAG,GAAG,EAC5D,SAASC,EAAcC,EAAU,CAC/B,GAAIA,GAAMF,EAAO,IAAME,GAAMF,EAAO,GAAI,OAAOE,EAAKF,EAAO,GAC3D,GAAIE,GAAMF,EAAO,GAAKE,GAAMF,EAAO,EAAG,OAAOE,GAAMF,EAAO,EAAI,IAC9D,GAAIE,GAAMF,EAAO,GAAKE,GAAMF,EAAO,EAAG,OAAOE,GAAMF,EAAO,EAAI,GAEhE,CAMM,SAAUG,EAAWJ,EAAW,CACpC,GAAI,OAAOA,GAAQ,SAAU,MAAM,IAAI,MAAM,4BAA8B,OAAOA,CAAG,EAErF,GAAIP,EAAe,OAAO,WAAW,QAAQO,CAAG,EAChD,IAAMK,EAAKL,EAAI,OACTM,EAAKD,EAAK,EAChB,GAAIA,EAAK,EAAG,MAAM,IAAI,MAAM,mDAAqDA,CAAE,EACnF,IAAME,EAAQ,IAAI,WAAWD,CAAE,EAC/B,QAASE,EAAK,EAAGC,EAAK,EAAGD,EAAKF,EAAIE,IAAMC,GAAM,EAAG,CAC/C,IAAMC,EAAKR,EAAcF,EAAI,WAAWS,CAAE,CAAC,EACrCE,EAAKT,EAAcF,EAAI,WAAWS,EAAK,CAAC,CAAC,EAC/C,GAAIC,IAAO,QAAaC,IAAO,OAAW,CACxC,IAAMC,EAAOZ,EAAIS,CAAE,EAAIT,EAAIS,EAAK,CAAC,EACjC,MAAM,IAAI,MAAM,+CAAiDG,EAAO,cAAgBH,CAAE,CAC5F,CACAF,EAAMC,CAAE,EAAIE,EAAK,GAAKC,CACxB,CACA,OAAOJ,CACT,CAkCM,SAAUM,GAAYC,EAAW,CACrC,GAAI,OAAOA,GAAQ,SAAU,MAAM,IAAI,MAAM,iBAAiB,EAC9D,OAAO,IAAI,WAAW,IAAI,YAAW,EAAG,OAAOA,CAAG,CAAC,CACrD,CAiBM,SAAUC,EAAQC,EAAW,CACjC,OAAI,OAAOA,GAAS,WAAUA,EAAOC,GAAYD,CAAI,GACrDE,EAAOF,CAAI,EACJA,CACT,CAmDM,IAAgBG,EAAhB,KAAoB,GA4CpB,SAAUC,EACdC,EAAuB,CAOvB,IAAMC,EAASC,GAA2BF,EAAQ,EAAG,OAAOG,EAAQD,CAAG,CAAC,EAAE,OAAM,EAC1EE,EAAMJ,EAAQ,EACpB,OAAAC,EAAM,UAAYG,EAAI,UACtBH,EAAM,SAAWG,EAAI,SACrBH,EAAM,OAAS,IAAMD,EAAQ,EACtBC,CACT,CCpVM,SAAUI,GACdC,EACAC,EACAC,EACAC,EAAa,CAEb,GAAI,OAAOH,EAAK,cAAiB,WAAY,OAAOA,EAAK,aAAaC,EAAYC,EAAOC,CAAI,EAC7F,IAAMC,EAAO,OAAO,EAAE,EAChBC,EAAW,OAAO,UAAU,EAC5BC,EAAK,OAAQJ,GAASE,EAAQC,CAAQ,EACtCE,EAAK,OAAOL,EAAQG,CAAQ,EAC5BG,EAAIL,EAAO,EAAI,EACfM,EAAIN,EAAO,EAAI,EACrBH,EAAK,UAAUC,EAAaO,EAAGF,EAAIH,CAAI,EACvCH,EAAK,UAAUC,EAAaQ,EAAGF,EAAIJ,CAAI,CACzC,CAGM,SAAUO,EAAIC,EAAWC,EAAWC,EAAS,CACjD,OAAQF,EAAIC,EAAM,CAACD,EAAIE,CACzB,CAGM,SAAUC,EAAIH,EAAWC,EAAWC,EAAS,CACjD,OAAQF,EAAIC,EAAMD,EAAIE,EAAMD,EAAIC,CAClC,CAMM,IAAgBE,EAAhB,cAAoDC,CAAO,CAoB/D,YAAYC,EAAkBC,EAAmBC,EAAmBhB,EAAa,CAC/E,MAAK,EANG,KAAA,SAAW,GACX,KAAA,OAAS,EACT,KAAA,IAAM,EACN,KAAA,UAAY,GAIpB,KAAK,SAAWc,EAChB,KAAK,UAAYC,EACjB,KAAK,UAAYC,EACjB,KAAK,KAAOhB,EACZ,KAAK,OAAS,IAAI,WAAWc,CAAQ,EACrC,KAAK,KAAOG,EAAW,KAAK,MAAM,CACpC,CACA,OAAOC,EAAW,CAChBC,EAAQ,IAAI,EACZD,EAAOE,EAAQF,CAAI,EACnBG,EAAOH,CAAI,EACX,GAAM,CAAE,KAAArB,EAAM,OAAAyB,EAAQ,SAAAR,CAAQ,EAAK,KAC7BS,EAAML,EAAK,OACjB,QAASM,EAAM,EAAGA,EAAMD,GAAO,CAC7B,IAAME,EAAO,KAAK,IAAIX,EAAW,KAAK,IAAKS,EAAMC,CAAG,EAEpD,GAAIC,IAASX,EAAU,CACrB,IAAMY,EAAWT,EAAWC,CAAI,EAChC,KAAOJ,GAAYS,EAAMC,EAAKA,GAAOV,EAAU,KAAK,QAAQY,EAAUF,CAAG,EACzE,QACF,CACAF,EAAO,IAAIJ,EAAK,SAASM,EAAKA,EAAMC,CAAI,EAAG,KAAK,GAAG,EACnD,KAAK,KAAOA,EACZD,GAAOC,EACH,KAAK,MAAQX,IACf,KAAK,QAAQjB,EAAM,CAAC,EACpB,KAAK,IAAM,EAEf,CACA,YAAK,QAAUqB,EAAK,OACpB,KAAK,WAAU,EACR,IACT,CACA,WAAWS,EAAe,CACxBR,EAAQ,IAAI,EACZS,EAAQD,EAAK,IAAI,EACjB,KAAK,SAAW,GAIhB,GAAM,CAAE,OAAAL,EAAQ,KAAAzB,EAAM,SAAAiB,EAAU,KAAAd,CAAI,EAAK,KACrC,CAAE,IAAAwB,CAAG,EAAK,KAEdF,EAAOE,GAAK,EAAI,IAChBK,EAAM,KAAK,OAAO,SAASL,CAAG,CAAC,EAG3B,KAAK,UAAYV,EAAWU,IAC9B,KAAK,QAAQ3B,EAAM,CAAC,EACpB2B,EAAM,GAGR,QAASM,EAAIN,EAAKM,EAAIhB,EAAUgB,IAAKR,EAAOQ,CAAC,EAAI,EAIjDlC,GAAaC,EAAMiB,EAAW,EAAG,OAAO,KAAK,OAAS,CAAC,EAAGd,CAAI,EAC9D,KAAK,QAAQH,EAAM,CAAC,EACpB,IAAMkC,EAAQd,EAAWU,CAAG,EACtBJ,EAAM,KAAK,UAEjB,GAAIA,EAAM,EAAG,MAAM,IAAI,MAAM,6CAA6C,EAC1E,IAAMS,EAAST,EAAM,EACfU,EAAQ,KAAK,IAAG,EACtB,GAAID,EAASC,EAAM,OAAQ,MAAM,IAAI,MAAM,oCAAoC,EAC/E,QAASH,EAAI,EAAGA,EAAIE,EAAQF,IAAKC,EAAM,UAAU,EAAID,EAAGG,EAAMH,CAAC,EAAG9B,CAAI,CACxE,CACA,QAAM,CACJ,GAAM,CAAE,OAAAsB,EAAQ,UAAAP,CAAS,EAAK,KAC9B,KAAK,WAAWO,CAAM,EACtB,IAAMY,EAAMZ,EAAO,MAAM,EAAGP,CAAS,EACrC,YAAK,QAAO,EACLmB,CACT,CACA,WAAWC,EAAM,CACfA,IAAAA,EAAO,IAAK,KAAK,aACjBA,EAAG,IAAI,GAAG,KAAK,IAAG,CAAE,EACpB,GAAM,CAAE,SAAArB,EAAU,OAAAQ,EAAQ,OAAAc,EAAQ,SAAAC,EAAU,UAAAC,EAAW,IAAAd,CAAG,EAAK,KAC/D,OAAAW,EAAG,UAAYG,EACfH,EAAG,SAAWE,EACdF,EAAG,OAASC,EACZD,EAAG,IAAMX,EACLY,EAAStB,GAAUqB,EAAG,OAAO,IAAIb,CAAM,EACpCa,CACT,CACA,OAAK,CACH,OAAO,KAAK,WAAU,CACxB,GASWI,EAAyC,YAAY,KAAK,CACrE,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UAAY,WACrF,EAGYC,EAAyC,YAAY,KAAK,CACrE,WAAY,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WACrF,ECnJD,IAAMC,GAA2B,YAAY,KAAK,CAChD,WAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,WAAY,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,UAAY,UAAY,UAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UAAY,UACpF,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UACpF,UAAY,UAAY,UAAY,UAAY,UAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACrF,EAGKC,EAA2B,IAAI,YAAY,EAAE,EACtCC,EAAP,cAAsBC,CAAc,CAYxC,YAAYC,EAAoB,GAAE,CAChC,MAAM,GAAIA,EAAW,EAAG,EAAK,EAVrB,KAAA,EAAYC,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,CAIrC,CACU,KAAG,CACX,GAAM,CAAE,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,CAAC,EAAK,KACnC,MAAO,CAACP,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,CAAC,CAChC,CAEU,IACRP,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAS,CAEtF,KAAK,EAAIP,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,CACf,CACU,QAAQC,EAAgBC,EAAc,CAE9C,QAASC,EAAI,EAAGA,EAAI,GAAIA,IAAKD,GAAU,EAAGd,EAASe,CAAC,EAAIF,EAAK,UAAUC,EAAQ,EAAK,EACpF,QAASC,EAAI,GAAIA,EAAI,GAAIA,IAAK,CAC5B,IAAMC,EAAMhB,EAASe,EAAI,EAAE,EACrBE,EAAKjB,EAASe,EAAI,CAAC,EACnBG,EAAKC,EAAKH,EAAK,CAAC,EAAIG,EAAKH,EAAK,EAAE,EAAKA,IAAQ,EAC7CI,EAAKD,EAAKF,EAAI,EAAE,EAAIE,EAAKF,EAAI,EAAE,EAAKA,IAAO,GACjDjB,EAASe,CAAC,EAAKK,EAAKpB,EAASe,EAAI,CAAC,EAAIG,EAAKlB,EAASe,EAAI,EAAE,EAAK,CACjE,CAEA,GAAI,CAAE,EAAAV,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,CAAC,EAAK,KACjC,QAASG,EAAI,EAAGA,EAAI,GAAIA,IAAK,CAC3B,IAAMM,EAASF,EAAKV,EAAG,CAAC,EAAIU,EAAKV,EAAG,EAAE,EAAIU,EAAKV,EAAG,EAAE,EAC9Ca,EAAMV,EAAIS,EAASE,EAAId,EAAGC,EAAGC,CAAC,EAAIZ,GAASgB,CAAC,EAAIf,EAASe,CAAC,EAAK,EAE/DS,GADSL,EAAKd,EAAG,CAAC,EAAIc,EAAKd,EAAG,EAAE,EAAIc,EAAKd,EAAG,EAAE,GAC/BoB,EAAIpB,EAAGC,EAAGC,CAAC,EAAK,EACrCK,EAAID,EACJA,EAAID,EACJA,EAAID,EACJA,EAAKD,EAAIc,EAAM,EACfd,EAAID,EACJA,EAAID,EACJA,EAAID,EACJA,EAAKiB,EAAKE,EAAM,CAClB,CAEAnB,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnB,KAAK,IAAIP,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,CAAC,CACjC,CACU,YAAU,CAClBc,EAAM1B,CAAQ,CAChB,CACA,SAAO,CACL,KAAK,IAAI,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,CAAC,EAC/B0B,EAAM,KAAK,MAAM,CACnB,GAGWC,EAAP,cAAsB1B,CAAM,CAShC,aAAA,CACE,MAAM,EAAE,EATA,KAAA,EAAY2B,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,CAGrC,GA2QK,IAAMC,EAAgCC,EAAa,IAAM,IAAIC,CAAQ,EC5XrE,IAAMC,EAAqB,gBAC5BC,GAA6B,EAC7BC,EAAmB,EAEnBC,GAAyC,WAMlCC,EAAP,MAAOC,CAAS,CACb,OAAO,WAAS,CACrB,OAAO,IAAI,KAAK,IAAI,WAAW,CAACH,CAAgB,CAAC,CAAC,CACpD,CAMO,OAAO,oBAAkB,CAC9B,OAAO,KAAK,SAASC,EAAsC,CAC7D,CAEO,OAAO,mBAAmBG,EAAqB,CACpD,IAAMC,EAAMC,EAAOF,CAAS,EAC5B,OAAO,IAAI,KAAK,IAAI,WAAW,CAAC,GAAGC,EAAKN,EAA0B,CAAC,CAAC,CACtE,CAEO,OAAO,KAAKQ,EAAc,CAC/B,GAAI,OAAOA,GAAU,SACnB,OAAOJ,EAAU,SAASI,CAAK,EAC1B,GAAI,OAAO,eAAeA,CAAK,IAAM,WAAW,UACrD,OAAO,IAAIJ,EAAUI,CAAmB,EACnC,GAAIJ,EAAU,YAAYI,CAAK,EACpC,OAAO,IAAIJ,EAAUI,EAAM,IAAI,EAGjC,MAAM,IAAI,MAAM,yBAAyB,KAAK,UAAUA,CAAK,CAAC,gBAAgB,CAChF,CAEO,OAAO,QAAQC,EAAW,CAC/B,OAAO,IAAI,KAAKC,EAAWD,CAAG,CAAC,CACjC,CAEO,OAAO,SAASE,EAAY,CACjC,IAAIC,EAAiBD,EAErB,GAAIA,EAAK,SAASZ,CAAkB,EAAG,CACrC,IAAMc,EAAM,KAAK,MAAMF,CAAI,EACvBZ,KAAsBc,IACxBD,EAAiBC,EAAId,CAAkB,EAE3C,CAEA,IAAMe,EAAmBF,EAAe,YAAW,EAAG,QAAQ,KAAM,EAAE,EAElEG,EAAMC,EAAaF,CAAgB,EACvCC,EAAMA,EAAI,MAAM,EAAGA,EAAI,MAAM,EAE7B,IAAME,EAAY,IAAI,KAAKF,CAAG,EAC9B,GAAIE,EAAU,OAAM,IAAOL,EACzB,MAAM,IAAI,MACR,cAAcK,EAAU,OAAM,CAAE,qDAAqDL,CAAc,qCAAqC,EAI5I,OAAOK,CACT,CAEO,OAAO,eAAeF,EAAe,CAC1C,OAAO,IAAI,KAAKA,CAAG,CACrB,CAEO,OAAO,YAAYP,EAAc,CACtC,OACEA,aAAiBJ,GAChB,OAAOI,GAAU,UAChBA,IAAU,MACV,iBAAkBA,GACjBA,EAAoC,eAAoB,IACzD,SAAUA,GACTA,EAA+B,gBAAmB,UAEzD,CAIA,YAA8BU,EAAgB,CAAhB,KAAA,KAAAA,EAFd,KAAA,aAAe,EAEkB,CAE1C,aAAW,CAChB,OAAO,KAAK,KAAK,aAAe,GAAK,KAAK,KAAK,CAAC,IAAMjB,CACxD,CAEO,cAAY,CACjB,OAAO,KAAK,IACd,CAEO,OAAK,CACV,OAAOkB,EAAW,KAAK,IAAI,EAAE,YAAW,CAC1C,CAEO,QAAM,CACX,IAAMC,EAAmB,IAAI,YAAY,CAAC,EAC7B,IAAI,SAASA,CAAgB,EACrC,UAAU,EAAGC,EAAS,KAAK,IAAI,CAAC,EACrC,IAAMC,EAAW,IAAI,WAAWF,CAAgB,EAE1CG,EAAQ,IAAI,WAAW,CAAC,GAAGD,EAAU,GAAG,KAAK,IAAI,CAAC,EAGlDE,EADSC,EAAaF,CAAK,EACV,MAAM,SAAS,EACtC,GAAI,CAACC,EAEH,MAAM,IAAI,MAEZ,OAAOA,EAAQ,KAAK,GAAG,CACzB,CAEO,UAAQ,CACb,OAAO,KAAK,OAAM,CACpB,CAMO,QAAM,CACX,MAAO,CAAE,CAACzB,CAAkB,EAAG,KAAK,OAAM,CAAE,CAC9C,CAOO,UAAUS,EAAgB,CAC/B,QAASkB,EAAI,EAAGA,EAAI,KAAK,IAAI,KAAK,KAAK,OAAQlB,EAAM,KAAK,MAAM,EAAGkB,IAAK,CACtE,GAAI,KAAK,KAAKA,CAAC,EAAIlB,EAAM,KAAKkB,CAAC,EAAG,MAAO,KACpC,GAAI,KAAK,KAAKA,CAAC,EAAIlB,EAAM,KAAKkB,CAAC,EAAG,MAAO,IAChD,CAEA,OAAI,KAAK,KAAK,OAASlB,EAAM,KAAK,OAAe,KAC7C,KAAK,KAAK,OAASA,EAAM,KAAK,OAAe,KAC1C,IACT,CAOO,KAAKA,EAAgB,CAC1B,IAAMmB,EAAM,KAAK,UAAUnB,CAAK,EAChC,OAAOmB,GAAO,MAAQA,GAAO,IAC/B,CAOO,KAAKnB,EAAgB,CAC1B,IAAMmB,EAAM,KAAK,UAAUnB,CAAK,EAChC,OAAOmB,GAAO,MAAQA,GAAO,IAC/B,GPxKF,UAAYC,MAAO,MCDnB,UAAYA,MAAO,MFGZ,IAAKC,IAAAA,IAEVA,EAAA,cAAgB,gBAEhBA,EAAA,UAAY,YAEZA,EAAA,WAAa,aAEbA,EAAA,IAAM,MARIA,IAAAA,IAAA,CAAA,CAAA,EDSCC,EACV,aAAW,UAAU,EACrB,KAAK,CAAE,GAAA,YAA2B,CAAC,EEEzBC,GACV,SAAO,EACP,OACEC,GAAc,CACb,GAAI,CACF,OAAAC,EAAU,SAASD,CAAS,EACrB,EACT,MAAwB,CACtB,MAAO,EACT,CACF,EACA,CACE,MAAO,gDACT,CACF,EACC,KAAK,CAAE,GAAA,eAA8B,CAAC,EAgB5BE,EACV,SAAkB,EAClB,OAAQF,GAAcC,EAAU,YAAYD,CAAS,EAAG,CACvD,MAAO,qBACP,MAAO,EACT,CAAC,EACA,UAAWG,GAAUF,EAAU,KAAKE,CAAK,CAAC,EAC1C,KAAK,CAAE,GAAA,WAA0B,CAAC,EC3BxBC,GAAkB,CAAC,CAC9B,oBAAAC,EAAsB,CAAC,EACvB,iBAAAC,EAAmB,EACrB,IAII,MAAI,EAAE,OACLC,GAA+B,CAC9B,GAAI,CACF,IAAMC,EAAY,CAAC,GAAG,IAAI,IAAI,CAAC,SAAU,GAAGH,CAAmB,CAAC,CAAC,EAE3D,CAAE,SAAAI,EAAU,SAAAC,CAAS,EAAI,IAAI,IAAIH,CAAG,EAG1C,OAAID,GAAoB,CAAC,YAAa,WAAW,EAAE,SAASI,CAAQ,EAC3D,CAAC,QAAS,GAAGF,CAAS,EAAE,SAASC,CAAQ,EAG3CD,EAAU,SAASC,CAAQ,CACpC,MAAwB,CACtB,MAAO,EACT,CACF,EACA,CACE,MAAO,cACT,CACF,EAUWE,GAAYP,GAAgB,CAAC,CAAC,EAAE,KAAK,CAAE,GAAA,KAAoB,CAAC,EO/DzE,UAAYQ,OAAO,MAEZ,IAAMC,EAAW,CAEtB,UAAW,IAAMC,EAEjB,WAAY,IAAMC,CACpB,EAGM,CAAC,MAAOC,GAAG,GAAGC,EAAI,EAAIL,GAoBtBM,EAAI,OAAO,OAAO,CAAC,EAAGD,EAAI,EAEhCC,EAAE,UAAYL,EAAS,UACvBK,EAAE,WAAaL,EAAS",
|
|
4
|
+
"sourcesContent": ["import * as z from \"zod\";\nimport { ZodSchemaId } from \"./schema-id\";\n\n/**\n * Zod schema to validate a value is a `Uint8Array` instance.\n *\n * @example\n * ```typescript\n * const result = Uint8ArraySchema.safeParse(new Uint8Array([1, 2, 3]));\n * console.log(result.success); // true or false\n * ```\n */\nexport const Uint8ArraySchema = z\n .instanceof(Uint8Array)\n .meta({ id: ZodSchemaId.Uint8Array });\n", "/**\n * Enum of metadata `id` values assigned to Zod schemas in this library.\n */\nexport enum ZodSchemaId {\n /** Metadata id for {@link PrincipalTextSchema}. */\n PrincipalText = \"PrincipalText\",\n /** Metadata id for {@link PrincipalSchema}. */\n Principal = \"Principal\",\n /** Metadata id for {@link Uint8ArraySchema}. */\n Uint8Array = \"Uint8Array\",\n /** Metadata id for {@link UrlSchema}. */\n Url = \"Url\",\n}\n", "import { Principal } from \"@icp-sdk/core/principal\";\nimport * as z from \"zod\";\nimport { ZodSchemaId } from \"./schema-id\";\n\n/**\n * Zod schema to validate a string as a valid textual representation of a Principal.\n *\n * This schema checks if the provided string can be converted into a `Principal` instance.\n * If the conversion fails, validation will return an error message.\n *\n * @example\n * ```typescript\n * const result = PrincipalTextSchema.safeParse('aaaaa-aa');\n * console.log(result.success); // true or false\n * ```\n */\nexport const PrincipalTextSchema = z\n .string()\n .refine(\n (principal) => {\n try {\n Principal.fromText(principal);\n return true;\n } catch (_err: unknown) {\n return false;\n }\n },\n {\n error: \"Invalid textual representation of a Principal.\",\n },\n )\n .meta({ id: ZodSchemaId.PrincipalText });\n\nexport type PrincipalText = z.infer<typeof PrincipalTextSchema>;\n\n/**\n * Zod schema to validate and transform a value into a `Principal` instance.\n *\n * This schema checks if the provided value is an instance or an object representing\n * a `Principal` and transforms it into a valid `Principal` instance.\n *\n * @example\n * ```typescript\n * const result = PrincipalSchema.safeParse(Principal.fromText('aaaaa-aa'));\n * console.log(result.success); // true or false\n * ```\n */\nexport const PrincipalSchema = z\n .custom<Principal>()\n .refine((principal) => Principal.isPrincipal(principal), {\n error: \"Invalid Principal.\",\n abort: true,\n })\n .transform((value) => Principal.from(value))\n .meta({ id: ZodSchemaId.Principal });\n", "import * as z from \"zod\";\nimport { ZodSchemaId } from \"./schema-id\";\n\n/**\n * A URL protocol as template literal type.\n * Example: \"https:\" or \"ftp:\"\n */\nexport type UrlProtocol = `${string}:`;\n\n/**\n * Creates a Zod schema for validating URLs. By default, it validates that the URL protocol is HTTPS and allow usage of HTTP only locally.\n *\n * @param {Object} options - Configuration options for the schema.\n * @param {UrlProtocol[]} [options.additionalProtocols=[]] - Additional protocols to allow (e.g., \"wss:\" or \"ftp:\"). \u26A0\uFE0F Usage of insecure protocols is discouraged.\n * @param {boolean} [options.allowHttpLocally=true] - Whether to allow HTTP for localhost and 127.0.0.1. Default: true.\n * @returns {z.ZodEffects<z.ZodString, string, string>} - The Zod schema with URL validation.\n *\n * @example\n * const schema = createUrlSchema({\n * additionalProtocols: [\"wss:\"],\n * allowHttpLocally: false\n * });\n *\n * schema.parse(\"https://example.com\"); // Valid\n * schema.parse(\"wss://example.com\"); // Valid\n * schema.parse(\"http://localhost\"); // Invalid if allowHttpLocally is false\n */\nexport const createUrlSchema = ({\n additionalProtocols = [],\n allowHttpLocally = true,\n}: {\n additionalProtocols?: UrlProtocol[];\n allowHttpLocally?: boolean;\n}): z.ZodURL =>\n z.url().refine(\n (url: string | URL): boolean => {\n try {\n const protocols = [...new Set([\"https:\", ...additionalProtocols])];\n\n const { protocol, hostname } = new URL(url);\n\n // We allow http for development locally\n if (allowHttpLocally && [\"localhost\", \"127.0.0.1\"].includes(hostname)) {\n return [\"http:\", ...protocols].includes(protocol);\n }\n\n return protocols.includes(protocol);\n } catch (_err: unknown) {\n return false;\n }\n },\n {\n error: \"Invalid URL.\",\n },\n );\n\n/**\n * Default URL schema that enforces HTTPS and allows HTTP locally.\n *\n * @constant {z.ZodEffects<z.ZodString, string, string>}\n * @example\n * UrlSchema.parse(\"https://example.com\"); // Valid\n * UrlSchema.parse(\"http://127.0.0.1\"); // Valid (localhost exception)\n */\nexport const UrlSchema = createUrlSchema({}).meta({ id: ZodSchemaId.Url });\n", "const alphabet = 'abcdefghijklmnopqrstuvwxyz234567';\n\n// Build a lookup table for decoding.\nconst lookupTable: Record<string, number> = Object.create(null);\nfor (let i = 0; i < alphabet.length; i++) {\n lookupTable[alphabet[i]] = i;\n}\n\n// Add aliases for rfc4648.\nlookupTable['0'] = lookupTable.o;\nlookupTable['1'] = lookupTable.i;\n\n/**\n * @param input The Uint8Array to encode.\n * @returns A Base32 string encoding the input.\n */\nexport function base32Encode(input: Uint8Array): string {\n // How many bits will we skip from the first byte.\n let skip = 0;\n // 5 high bits, carry from one byte to the next.\n let bits = 0;\n\n // The output string in base32.\n let output = '';\n\n function encodeByte(byte: number) {\n if (skip < 0) {\n // we have a carry from the previous byte\n bits |= byte >> -skip;\n } else {\n // no carry\n bits = (byte << skip) & 248;\n }\n\n if (skip > 3) {\n // Not enough data to produce a character, get us another one\n skip -= 8;\n return 1;\n }\n\n if (skip < 4) {\n // produce a character\n output += alphabet[bits >> 3];\n skip += 5;\n }\n\n return 0;\n }\n\n for (let i = 0; i < input.length; ) {\n i += encodeByte(input[i]);\n }\n\n return output + (skip < 0 ? alphabet[bits >> 3] : '');\n}\n\n/**\n * @param input The base32 encoded string to decode.\n */\nexport function base32Decode(input: string): Uint8Array {\n // how many bits we have from the previous character.\n let skip = 0;\n // current byte we're producing.\n let byte = 0;\n\n const output = new Uint8Array(((input.length * 4) / 3) | 0);\n let o = 0;\n\n function decodeChar(char: string) {\n // Consume a character from the stream, store\n // the output in this.output. As before, better\n // to use update().\n let val = lookupTable[char.toLowerCase()];\n if (val === undefined) {\n throw new Error(`Invalid character: ${JSON.stringify(char)}`);\n }\n\n // move to the high bits\n val <<= 3;\n byte |= val >>> skip;\n skip += 5;\n\n if (skip >= 8) {\n // We have enough bytes to produce an output\n output[o++] = byte;\n skip -= 8;\n\n if (skip > 0) {\n byte = (val << (5 - skip)) & 255;\n } else {\n byte = 0;\n }\n }\n }\n\n for (const c of input) {\n decodeChar(c);\n }\n\n return output.slice(0, o);\n}\n", "// This file is translated to JavaScript from\n// https://lxp32.github.io/docs/a-simple-example-crc32-calculation/\nconst lookUpTable: Uint32Array = new Uint32Array([\n 0x00000000, 0x77073096, 0xee0e612c, 0x990951ba, 0x076dc419, 0x706af48f, 0xe963a535, 0x9e6495a3,\n 0x0edb8832, 0x79dcb8a4, 0xe0d5e91e, 0x97d2d988, 0x09b64c2b, 0x7eb17cbd, 0xe7b82d07, 0x90bf1d91,\n 0x1db71064, 0x6ab020f2, 0xf3b97148, 0x84be41de, 0x1adad47d, 0x6ddde4eb, 0xf4d4b551, 0x83d385c7,\n 0x136c9856, 0x646ba8c0, 0xfd62f97a, 0x8a65c9ec, 0x14015c4f, 0x63066cd9, 0xfa0f3d63, 0x8d080df5,\n 0x3b6e20c8, 0x4c69105e, 0xd56041e4, 0xa2677172, 0x3c03e4d1, 0x4b04d447, 0xd20d85fd, 0xa50ab56b,\n 0x35b5a8fa, 0x42b2986c, 0xdbbbc9d6, 0xacbcf940, 0x32d86ce3, 0x45df5c75, 0xdcd60dcf, 0xabd13d59,\n 0x26d930ac, 0x51de003a, 0xc8d75180, 0xbfd06116, 0x21b4f4b5, 0x56b3c423, 0xcfba9599, 0xb8bda50f,\n 0x2802b89e, 0x5f058808, 0xc60cd9b2, 0xb10be924, 0x2f6f7c87, 0x58684c11, 0xc1611dab, 0xb6662d3d,\n 0x76dc4190, 0x01db7106, 0x98d220bc, 0xefd5102a, 0x71b18589, 0x06b6b51f, 0x9fbfe4a5, 0xe8b8d433,\n 0x7807c9a2, 0x0f00f934, 0x9609a88e, 0xe10e9818, 0x7f6a0dbb, 0x086d3d2d, 0x91646c97, 0xe6635c01,\n 0x6b6b51f4, 0x1c6c6162, 0x856530d8, 0xf262004e, 0x6c0695ed, 0x1b01a57b, 0x8208f4c1, 0xf50fc457,\n 0x65b0d9c6, 0x12b7e950, 0x8bbeb8ea, 0xfcb9887c, 0x62dd1ddf, 0x15da2d49, 0x8cd37cf3, 0xfbd44c65,\n 0x4db26158, 0x3ab551ce, 0xa3bc0074, 0xd4bb30e2, 0x4adfa541, 0x3dd895d7, 0xa4d1c46d, 0xd3d6f4fb,\n 0x4369e96a, 0x346ed9fc, 0xad678846, 0xda60b8d0, 0x44042d73, 0x33031de5, 0xaa0a4c5f, 0xdd0d7cc9,\n 0x5005713c, 0x270241aa, 0xbe0b1010, 0xc90c2086, 0x5768b525, 0x206f85b3, 0xb966d409, 0xce61e49f,\n 0x5edef90e, 0x29d9c998, 0xb0d09822, 0xc7d7a8b4, 0x59b33d17, 0x2eb40d81, 0xb7bd5c3b, 0xc0ba6cad,\n 0xedb88320, 0x9abfb3b6, 0x03b6e20c, 0x74b1d29a, 0xead54739, 0x9dd277af, 0x04db2615, 0x73dc1683,\n 0xe3630b12, 0x94643b84, 0x0d6d6a3e, 0x7a6a5aa8, 0xe40ecf0b, 0x9309ff9d, 0x0a00ae27, 0x7d079eb1,\n 0xf00f9344, 0x8708a3d2, 0x1e01f268, 0x6906c2fe, 0xf762575d, 0x806567cb, 0x196c3671, 0x6e6b06e7,\n 0xfed41b76, 0x89d32be0, 0x10da7a5a, 0x67dd4acc, 0xf9b9df6f, 0x8ebeeff9, 0x17b7be43, 0x60b08ed5,\n 0xd6d6a3e8, 0xa1d1937e, 0x38d8c2c4, 0x4fdff252, 0xd1bb67f1, 0xa6bc5767, 0x3fb506dd, 0x48b2364b,\n 0xd80d2bda, 0xaf0a1b4c, 0x36034af6, 0x41047a60, 0xdf60efc3, 0xa867df55, 0x316e8eef, 0x4669be79,\n 0xcb61b38c, 0xbc66831a, 0x256fd2a0, 0x5268e236, 0xcc0c7795, 0xbb0b4703, 0x220216b9, 0x5505262f,\n 0xc5ba3bbe, 0xb2bd0b28, 0x2bb45a92, 0x5cb36a04, 0xc2d7ffa7, 0xb5d0cf31, 0x2cd99e8b, 0x5bdeae1d,\n 0x9b64c2b0, 0xec63f226, 0x756aa39c, 0x026d930a, 0x9c0906a9, 0xeb0e363f, 0x72076785, 0x05005713,\n 0x95bf4a82, 0xe2b87a14, 0x7bb12bae, 0x0cb61b38, 0x92d28e9b, 0xe5d5be0d, 0x7cdcefb7, 0x0bdbdf21,\n 0x86d3d2d4, 0xf1d4e242, 0x68ddb3f8, 0x1fda836e, 0x81be16cd, 0xf6b9265b, 0x6fb077e1, 0x18b74777,\n 0x88085ae6, 0xff0f6a70, 0x66063bca, 0x11010b5c, 0x8f659eff, 0xf862ae69, 0x616bffd3, 0x166ccf45,\n 0xa00ae278, 0xd70dd2ee, 0x4e048354, 0x3903b3c2, 0xa7672661, 0xd06016f7, 0x4969474d, 0x3e6e77db,\n 0xaed16a4a, 0xd9d65adc, 0x40df0b66, 0x37d83bf0, 0xa9bcae53, 0xdebb9ec5, 0x47b2cf7f, 0x30b5ffe9,\n 0xbdbdf21c, 0xcabac28a, 0x53b39330, 0x24b4a3a6, 0xbad03605, 0xcdd70693, 0x54de5729, 0x23d967bf,\n 0xb3667a2e, 0xc4614ab8, 0x5d681b02, 0x2a6f2b94, 0xb40bbe37, 0xc30c8ea1, 0x5a05df1b, 0x2d02ef8d,\n]);\n\n/**\n * Calculate the CRC32 of a Uint8Array.\n * @param buf The Uint8Array to calculate the CRC32 of.\n */\nexport function getCrc32(buf: Uint8Array): number {\n let crc = -1;\n\n for (let i = 0; i < buf.length; i++) {\n const byte = buf[i];\n const t = (byte ^ crc) & 0xff;\n crc = lookUpTable[t] ^ (crc >>> 8);\n }\n\n return (crc ^ -1) >>> 0;\n}\n", "/**\n * Utilities for hex, bytes, CSPRNG.\n * @module\n */\n/*! noble-hashes - MIT License (c) 2022 Paul Miller (paulmillr.com) */\n\n// We use WebCrypto aka globalThis.crypto, which exists in browsers and node.js 16+.\n// node.js versions earlier than v19 don't declare it in global scope.\n// For node.js, package.json#exports field mapping rewrites import\n// from `crypto` to `cryptoNode`, which imports native module.\n// Makes the utils un-importable in browsers without a bundler.\n// Once node.js 18 is deprecated (2025-04-30), we can just drop the import.\nimport { crypto } from '@noble/hashes/crypto';\n\n/** Checks if something is Uint8Array. Be careful: nodejs Buffer will return true. */\nexport function isBytes(a: unknown): a is Uint8Array {\n return a instanceof Uint8Array || (ArrayBuffer.isView(a) && a.constructor.name === 'Uint8Array');\n}\n\n/** Asserts something is positive integer. */\nexport function anumber(n: number): void {\n if (!Number.isSafeInteger(n) || n < 0) throw new Error('positive integer expected, got ' + n);\n}\n\n/** Asserts something is Uint8Array. */\nexport function abytes(b: Uint8Array | undefined, ...lengths: number[]): void {\n if (!isBytes(b)) throw new Error('Uint8Array expected');\n if (lengths.length > 0 && !lengths.includes(b.length))\n throw new Error('Uint8Array expected of length ' + lengths + ', got length=' + b.length);\n}\n\n/** Asserts something is hash */\nexport function ahash(h: IHash): void {\n if (typeof h !== 'function' || typeof h.create !== 'function')\n throw new Error('Hash should be wrapped by utils.createHasher');\n anumber(h.outputLen);\n anumber(h.blockLen);\n}\n\n/** Asserts a hash instance has not been destroyed / finished */\nexport function aexists(instance: any, checkFinished = true): void {\n if (instance.destroyed) throw new Error('Hash instance has been destroyed');\n if (checkFinished && instance.finished) throw new Error('Hash#digest() has already been called');\n}\n\n/** Asserts output is properly-sized byte array */\nexport function aoutput(out: any, instance: any): void {\n abytes(out);\n const min = instance.outputLen;\n if (out.length < min) {\n throw new Error('digestInto() expects output buffer of length at least ' + min);\n }\n}\n\n/** Generic type encompassing 8/16/32-byte arrays - but not 64-byte. */\n// prettier-ignore\nexport type TypedArray = Int8Array | Uint8ClampedArray | Uint8Array |\n Uint16Array | Int16Array | Uint32Array | Int32Array;\n\n/** Cast u8 / u16 / u32 to u8. */\nexport function u8(arr: TypedArray): Uint8Array {\n return new Uint8Array(arr.buffer, arr.byteOffset, arr.byteLength);\n}\n\n/** Cast u8 / u16 / u32 to u32. */\nexport function u32(arr: TypedArray): Uint32Array {\n return new Uint32Array(arr.buffer, arr.byteOffset, Math.floor(arr.byteLength / 4));\n}\n\n/** Zeroize a byte array. Warning: JS provides no guarantees. */\nexport function clean(...arrays: TypedArray[]): void {\n for (let i = 0; i < arrays.length; i++) {\n arrays[i].fill(0);\n }\n}\n\n/** Create DataView of an array for easy byte-level manipulation. */\nexport function createView(arr: TypedArray): DataView {\n return new DataView(arr.buffer, arr.byteOffset, arr.byteLength);\n}\n\n/** The rotate right (circular right shift) operation for uint32 */\nexport function rotr(word: number, shift: number): number {\n return (word << (32 - shift)) | (word >>> shift);\n}\n\n/** The rotate left (circular left shift) operation for uint32 */\nexport function rotl(word: number, shift: number): number {\n return (word << shift) | ((word >>> (32 - shift)) >>> 0);\n}\n\n/** Is current platform little-endian? Most are. Big-Endian platform: IBM */\nexport const isLE: boolean = /* @__PURE__ */ (() =>\n new Uint8Array(new Uint32Array([0x11223344]).buffer)[0] === 0x44)();\n\n/** The byte swap operation for uint32 */\nexport function byteSwap(word: number): number {\n return (\n ((word << 24) & 0xff000000) |\n ((word << 8) & 0xff0000) |\n ((word >>> 8) & 0xff00) |\n ((word >>> 24) & 0xff)\n );\n}\n/** Conditionally byte swap if on a big-endian platform */\nexport const swap8IfBE: (n: number) => number = isLE\n ? (n: number) => n\n : (n: number) => byteSwap(n);\n\n/** @deprecated */\nexport const byteSwapIfBE: typeof swap8IfBE = swap8IfBE;\n/** In place byte swap for Uint32Array */\nexport function byteSwap32(arr: Uint32Array): Uint32Array {\n for (let i = 0; i < arr.length; i++) {\n arr[i] = byteSwap(arr[i]);\n }\n return arr;\n}\n\nexport const swap32IfBE: (u: Uint32Array) => Uint32Array = isLE\n ? (u: Uint32Array) => u\n : byteSwap32;\n\n// Built-in hex conversion https://caniuse.com/mdn-javascript_builtins_uint8array_fromhex\nconst hasHexBuiltin: boolean = /* @__PURE__ */ (() =>\n // @ts-ignore\n typeof Uint8Array.from([]).toHex === 'function' && typeof Uint8Array.fromHex === 'function')();\n\n// Array where index 0xf0 (240) is mapped to string 'f0'\nconst hexes = /* @__PURE__ */ Array.from({ length: 256 }, (_, i) =>\n i.toString(16).padStart(2, '0')\n);\n\n/**\n * Convert byte array to hex string. Uses built-in function, when available.\n * @example bytesToHex(Uint8Array.from([0xca, 0xfe, 0x01, 0x23])) // 'cafe0123'\n */\nexport function bytesToHex(bytes: Uint8Array): string {\n abytes(bytes);\n // @ts-ignore\n if (hasHexBuiltin) return bytes.toHex();\n // pre-caching improves the speed 6x\n let hex = '';\n for (let i = 0; i < bytes.length; i++) {\n hex += hexes[bytes[i]];\n }\n return hex;\n}\n\n// We use optimized technique to convert hex string to byte array\nconst asciis = { _0: 48, _9: 57, A: 65, F: 70, a: 97, f: 102 } as const;\nfunction asciiToBase16(ch: number): number | undefined {\n if (ch >= asciis._0 && ch <= asciis._9) return ch - asciis._0; // '2' => 50-48\n if (ch >= asciis.A && ch <= asciis.F) return ch - (asciis.A - 10); // 'B' => 66-(65-10)\n if (ch >= asciis.a && ch <= asciis.f) return ch - (asciis.a - 10); // 'b' => 98-(97-10)\n return;\n}\n\n/**\n * Convert hex string to byte array. Uses built-in function, when available.\n * @example hexToBytes('cafe0123') // Uint8Array.from([0xca, 0xfe, 0x01, 0x23])\n */\nexport function hexToBytes(hex: string): Uint8Array {\n if (typeof hex !== 'string') throw new Error('hex string expected, got ' + typeof hex);\n // @ts-ignore\n if (hasHexBuiltin) return Uint8Array.fromHex(hex);\n const hl = hex.length;\n const al = hl / 2;\n if (hl % 2) throw new Error('hex string expected, got unpadded hex of length ' + hl);\n const array = new Uint8Array(al);\n for (let ai = 0, hi = 0; ai < al; ai++, hi += 2) {\n const n1 = asciiToBase16(hex.charCodeAt(hi));\n const n2 = asciiToBase16(hex.charCodeAt(hi + 1));\n if (n1 === undefined || n2 === undefined) {\n const char = hex[hi] + hex[hi + 1];\n throw new Error('hex string expected, got non-hex character \"' + char + '\" at index ' + hi);\n }\n array[ai] = n1 * 16 + n2; // multiply first octet, e.g. 'a3' => 10*16+3 => 160 + 3 => 163\n }\n return array;\n}\n\n/**\n * There is no setImmediate in browser and setTimeout is slow.\n * Call of async fn will return Promise, which will be fullfiled only on\n * next scheduler queue processing step and this is exactly what we need.\n */\nexport const nextTick = async (): Promise<void> => {};\n\n/** Returns control to thread each 'tick' ms to avoid blocking. */\nexport async function asyncLoop(\n iters: number,\n tick: number,\n cb: (i: number) => void\n): Promise<void> {\n let ts = Date.now();\n for (let i = 0; i < iters; i++) {\n cb(i);\n // Date.now() is not monotonic, so in case if clock goes backwards we return return control too\n const diff = Date.now() - ts;\n if (diff >= 0 && diff < tick) continue;\n await nextTick();\n ts += diff;\n }\n}\n\n// Global symbols, but ts doesn't see them: https://github.com/microsoft/TypeScript/issues/31535\ndeclare const TextEncoder: any;\ndeclare const TextDecoder: any;\n\n/**\n * Converts string to bytes using UTF8 encoding.\n * @example utf8ToBytes('abc') // Uint8Array.from([97, 98, 99])\n */\nexport function utf8ToBytes(str: string): Uint8Array {\n if (typeof str !== 'string') throw new Error('string expected');\n return new Uint8Array(new TextEncoder().encode(str)); // https://bugzil.la/1681809\n}\n\n/**\n * Converts bytes to string using UTF8 encoding.\n * @example bytesToUtf8(Uint8Array.from([97, 98, 99])) // 'abc'\n */\nexport function bytesToUtf8(bytes: Uint8Array): string {\n return new TextDecoder().decode(bytes);\n}\n\n/** Accepted input of hash functions. Strings are converted to byte arrays. */\nexport type Input = string | Uint8Array;\n/**\n * Normalizes (non-hex) string or Uint8Array to Uint8Array.\n * Warning: when Uint8Array is passed, it would NOT get copied.\n * Keep in mind for future mutable operations.\n */\nexport function toBytes(data: Input): Uint8Array {\n if (typeof data === 'string') data = utf8ToBytes(data);\n abytes(data);\n return data;\n}\n\n/** KDFs can accept string or Uint8Array for user convenience. */\nexport type KDFInput = string | Uint8Array;\n/**\n * Helper for KDFs: consumes uint8array or string.\n * When string is passed, does utf8 decoding, using TextDecoder.\n */\nexport function kdfInputToBytes(data: KDFInput): Uint8Array {\n if (typeof data === 'string') data = utf8ToBytes(data);\n abytes(data);\n return data;\n}\n\n/** Copies several Uint8Arrays into one. */\nexport function concatBytes(...arrays: Uint8Array[]): Uint8Array {\n let sum = 0;\n for (let i = 0; i < arrays.length; i++) {\n const a = arrays[i];\n abytes(a);\n sum += a.length;\n }\n const res = new Uint8Array(sum);\n for (let i = 0, pad = 0; i < arrays.length; i++) {\n const a = arrays[i];\n res.set(a, pad);\n pad += a.length;\n }\n return res;\n}\n\ntype EmptyObj = {};\nexport function checkOpts<T1 extends EmptyObj, T2 extends EmptyObj>(\n defaults: T1,\n opts?: T2\n): T1 & T2 {\n if (opts !== undefined && {}.toString.call(opts) !== '[object Object]')\n throw new Error('options should be object or undefined');\n const merged = Object.assign(defaults, opts);\n return merged as T1 & T2;\n}\n\n/** Hash interface. */\nexport type IHash = {\n (data: Uint8Array): Uint8Array;\n blockLen: number;\n outputLen: number;\n create: any;\n};\n\n/** For runtime check if class implements interface */\nexport abstract class Hash<T extends Hash<T>> {\n abstract blockLen: number; // Bytes per block\n abstract outputLen: number; // Bytes in output\n abstract update(buf: Input): this;\n // Writes digest into buf\n abstract digestInto(buf: Uint8Array): void;\n abstract digest(): Uint8Array;\n /**\n * Resets internal state. Makes Hash instance unusable.\n * Reset is impossible for keyed hashes if key is consumed into state. If digest is not consumed\n * by user, they will need to manually call `destroy()` when zeroing is necessary.\n */\n abstract destroy(): void;\n /**\n * Clones hash instance. Unsafe: doesn't check whether `to` is valid. Can be used as `clone()`\n * when no options are passed.\n * Reasons to use `_cloneInto` instead of clone: 1) performance 2) reuse instance => all internal\n * buffers are overwritten => causes buffer overwrite which is used for digest in some cases.\n * There are no guarantees for clean-up because it's impossible in JS.\n */\n abstract _cloneInto(to?: T): T;\n // Safe version that clones internal state\n abstract clone(): T;\n}\n\n/**\n * XOF: streaming API to read digest in chunks.\n * Same as 'squeeze' in keccak/k12 and 'seek' in blake3, but more generic name.\n * When hash used in XOF mode it is up to user to call '.destroy' afterwards, since we cannot\n * destroy state, next call can require more bytes.\n */\nexport type HashXOF<T extends Hash<T>> = Hash<T> & {\n xof(bytes: number): Uint8Array; // Read 'bytes' bytes from digest stream\n xofInto(buf: Uint8Array): Uint8Array; // read buf.length bytes from digest stream into buf\n};\n\n/** Hash function */\nexport type CHash = ReturnType<typeof createHasher>;\n/** Hash function with output */\nexport type CHashO = ReturnType<typeof createOptHasher>;\n/** XOF with output */\nexport type CHashXO = ReturnType<typeof createXOFer>;\n\n/** Wraps hash function, creating an interface on top of it */\nexport function createHasher<T extends Hash<T>>(\n hashCons: () => Hash<T>\n): {\n (msg: Input): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(): Hash<T>;\n} {\n const hashC = (msg: Input): Uint8Array => hashCons().update(toBytes(msg)).digest();\n const tmp = hashCons();\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = () => hashCons();\n return hashC;\n}\n\nexport function createOptHasher<H extends Hash<H>, T extends Object>(\n hashCons: (opts?: T) => Hash<H>\n): {\n (msg: Input, opts?: T): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(opts?: T): Hash<H>;\n} {\n const hashC = (msg: Input, opts?: T): Uint8Array => hashCons(opts).update(toBytes(msg)).digest();\n const tmp = hashCons({} as T);\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = (opts?: T) => hashCons(opts);\n return hashC;\n}\n\nexport function createXOFer<H extends HashXOF<H>, T extends Object>(\n hashCons: (opts?: T) => HashXOF<H>\n): {\n (msg: Input, opts?: T): Uint8Array;\n outputLen: number;\n blockLen: number;\n create(opts?: T): HashXOF<H>;\n} {\n const hashC = (msg: Input, opts?: T): Uint8Array => hashCons(opts).update(toBytes(msg)).digest();\n const tmp = hashCons({} as T);\n hashC.outputLen = tmp.outputLen;\n hashC.blockLen = tmp.blockLen;\n hashC.create = (opts?: T) => hashCons(opts);\n return hashC;\n}\nexport const wrapConstructor: typeof createHasher = createHasher;\nexport const wrapConstructorWithOpts: typeof createOptHasher = createOptHasher;\nexport const wrapXOFConstructorWithOpts: typeof createXOFer = createXOFer;\n\n/** Cryptographically secure PRNG. Uses internal OS-level `crypto.getRandomValues`. */\nexport function randomBytes(bytesLength = 32): Uint8Array {\n if (crypto && typeof crypto.getRandomValues === 'function') {\n return crypto.getRandomValues(new Uint8Array(bytesLength));\n }\n // Legacy Node.js compatibility\n if (crypto && typeof crypto.randomBytes === 'function') {\n return Uint8Array.from(crypto.randomBytes(bytesLength));\n }\n throw new Error('crypto.getRandomValues must be defined');\n}\n", "/**\n * Internal Merkle-Damgard hash utils.\n * @module\n */\nimport { type Input, Hash, abytes, aexists, aoutput, clean, createView, toBytes } from './utils.ts';\n\n/** Polyfill for Safari 14. https://caniuse.com/mdn-javascript_builtins_dataview_setbiguint64 */\nexport function setBigUint64(\n view: DataView,\n byteOffset: number,\n value: bigint,\n isLE: boolean\n): void {\n if (typeof view.setBigUint64 === 'function') return view.setBigUint64(byteOffset, value, isLE);\n const _32n = BigInt(32);\n const _u32_max = BigInt(0xffffffff);\n const wh = Number((value >> _32n) & _u32_max);\n const wl = Number(value & _u32_max);\n const h = isLE ? 4 : 0;\n const l = isLE ? 0 : 4;\n view.setUint32(byteOffset + h, wh, isLE);\n view.setUint32(byteOffset + l, wl, isLE);\n}\n\n/** Choice: a ? b : c */\nexport function Chi(a: number, b: number, c: number): number {\n return (a & b) ^ (~a & c);\n}\n\n/** Majority function, true if any two inputs is true. */\nexport function Maj(a: number, b: number, c: number): number {\n return (a & b) ^ (a & c) ^ (b & c);\n}\n\n/**\n * Merkle-Damgard hash construction base class.\n * Could be used to create MD5, RIPEMD, SHA1, SHA2.\n */\nexport abstract class HashMD<T extends HashMD<T>> extends Hash<T> {\n protected abstract process(buf: DataView, offset: number): void;\n protected abstract get(): number[];\n protected abstract set(...args: number[]): void;\n abstract destroy(): void;\n protected abstract roundClean(): void;\n\n readonly blockLen: number;\n readonly outputLen: number;\n readonly padOffset: number;\n readonly isLE: boolean;\n\n // For partial updates less than block size\n protected buffer: Uint8Array;\n protected view: DataView;\n protected finished = false;\n protected length = 0;\n protected pos = 0;\n protected destroyed = false;\n\n constructor(blockLen: number, outputLen: number, padOffset: number, isLE: boolean) {\n super();\n this.blockLen = blockLen;\n this.outputLen = outputLen;\n this.padOffset = padOffset;\n this.isLE = isLE;\n this.buffer = new Uint8Array(blockLen);\n this.view = createView(this.buffer);\n }\n update(data: Input): this {\n aexists(this);\n data = toBytes(data);\n abytes(data);\n const { view, buffer, blockLen } = this;\n const len = data.length;\n for (let pos = 0; pos < len; ) {\n const take = Math.min(blockLen - this.pos, len - pos);\n // Fast path: we have at least one block in input, cast it to view and process\n if (take === blockLen) {\n const dataView = createView(data);\n for (; blockLen <= len - pos; pos += blockLen) this.process(dataView, pos);\n continue;\n }\n buffer.set(data.subarray(pos, pos + take), this.pos);\n this.pos += take;\n pos += take;\n if (this.pos === blockLen) {\n this.process(view, 0);\n this.pos = 0;\n }\n }\n this.length += data.length;\n this.roundClean();\n return this;\n }\n digestInto(out: Uint8Array): void {\n aexists(this);\n aoutput(out, this);\n this.finished = true;\n // Padding\n // We can avoid allocation of buffer for padding completely if it\n // was previously not allocated here. But it won't change performance.\n const { buffer, view, blockLen, isLE } = this;\n let { pos } = this;\n // append the bit '1' to the message\n buffer[pos++] = 0b10000000;\n clean(this.buffer.subarray(pos));\n // we have less than padOffset left in buffer, so we cannot put length in\n // current block, need process it and pad again\n if (this.padOffset > blockLen - pos) {\n this.process(view, 0);\n pos = 0;\n }\n // Pad until full block byte with zeros\n for (let i = pos; i < blockLen; i++) buffer[i] = 0;\n // Note: sha512 requires length to be 128bit integer, but length in JS will overflow before that\n // You need to write around 2 exabytes (u64_max / 8 / (1024**6)) for this to happen.\n // So we just write lowest 64 bits of that value.\n setBigUint64(view, blockLen - 8, BigInt(this.length * 8), isLE);\n this.process(view, 0);\n const oview = createView(out);\n const len = this.outputLen;\n // NOTE: we do division by 4 later, which should be fused in single op with modulo by JIT\n if (len % 4) throw new Error('_sha2: outputLen should be aligned to 32bit');\n const outLen = len / 4;\n const state = this.get();\n if (outLen > state.length) throw new Error('_sha2: outputLen bigger than state');\n for (let i = 0; i < outLen; i++) oview.setUint32(4 * i, state[i], isLE);\n }\n digest(): Uint8Array {\n const { buffer, outputLen } = this;\n this.digestInto(buffer);\n const res = buffer.slice(0, outputLen);\n this.destroy();\n return res;\n }\n _cloneInto(to?: T): T {\n to ||= new (this.constructor as any)() as T;\n to.set(...this.get());\n const { blockLen, buffer, length, finished, destroyed, pos } = this;\n to.destroyed = destroyed;\n to.finished = finished;\n to.length = length;\n to.pos = pos;\n if (length % blockLen) to.buffer.set(buffer);\n return to;\n }\n clone(): T {\n return this._cloneInto();\n }\n}\n\n/**\n * Initial SHA-2 state: fractional parts of square roots of first 16 primes 2..53.\n * Check out `test/misc/sha2-gen-iv.js` for recomputation guide.\n */\n\n/** Initial SHA256 state. Bits 0..32 of frac part of sqrt of primes 2..19 */\nexport const SHA256_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0x6a09e667, 0xbb67ae85, 0x3c6ef372, 0xa54ff53a, 0x510e527f, 0x9b05688c, 0x1f83d9ab, 0x5be0cd19,\n]);\n\n/** Initial SHA224 state. Bits 32..64 of frac part of sqrt of primes 23..53 */\nexport const SHA224_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0xc1059ed8, 0x367cd507, 0x3070dd17, 0xf70e5939, 0xffc00b31, 0x68581511, 0x64f98fa7, 0xbefa4fa4,\n]);\n\n/** Initial SHA384 state. Bits 0..64 of frac part of sqrt of primes 23..53 */\nexport const SHA384_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0xcbbb9d5d, 0xc1059ed8, 0x629a292a, 0x367cd507, 0x9159015a, 0x3070dd17, 0x152fecd8, 0xf70e5939,\n 0x67332667, 0xffc00b31, 0x8eb44a87, 0x68581511, 0xdb0c2e0d, 0x64f98fa7, 0x47b5481d, 0xbefa4fa4,\n]);\n\n/** Initial SHA512 state. Bits 0..64 of frac part of sqrt of primes 2..19 */\nexport const SHA512_IV: Uint32Array = /* @__PURE__ */ Uint32Array.from([\n 0x6a09e667, 0xf3bcc908, 0xbb67ae85, 0x84caa73b, 0x3c6ef372, 0xfe94f82b, 0xa54ff53a, 0x5f1d36f1,\n 0x510e527f, 0xade682d1, 0x9b05688c, 0x2b3e6c1f, 0x1f83d9ab, 0xfb41bd6b, 0x5be0cd19, 0x137e2179,\n]);\n", "/**\n * SHA2 hash function. A.k.a. sha256, sha384, sha512, sha512_224, sha512_256.\n * SHA256 is the fastest hash implementable in JS, even faster than Blake3.\n * Check out [RFC 4634](https://datatracker.ietf.org/doc/html/rfc4634) and\n * [FIPS 180-4](https://nvlpubs.nist.gov/nistpubs/FIPS/NIST.FIPS.180-4.pdf).\n * @module\n */\nimport { Chi, HashMD, Maj, SHA224_IV, SHA256_IV, SHA384_IV, SHA512_IV } from './_md.ts';\nimport * as u64 from './_u64.ts';\nimport { type CHash, clean, createHasher, rotr } from './utils.ts';\n\n/**\n * Round constants:\n * First 32 bits of fractional parts of the cube roots of the first 64 primes 2..311)\n */\n// prettier-ignore\nconst SHA256_K = /* @__PURE__ */ Uint32Array.from([\n 0x428a2f98, 0x71374491, 0xb5c0fbcf, 0xe9b5dba5, 0x3956c25b, 0x59f111f1, 0x923f82a4, 0xab1c5ed5,\n 0xd807aa98, 0x12835b01, 0x243185be, 0x550c7dc3, 0x72be5d74, 0x80deb1fe, 0x9bdc06a7, 0xc19bf174,\n 0xe49b69c1, 0xefbe4786, 0x0fc19dc6, 0x240ca1cc, 0x2de92c6f, 0x4a7484aa, 0x5cb0a9dc, 0x76f988da,\n 0x983e5152, 0xa831c66d, 0xb00327c8, 0xbf597fc7, 0xc6e00bf3, 0xd5a79147, 0x06ca6351, 0x14292967,\n 0x27b70a85, 0x2e1b2138, 0x4d2c6dfc, 0x53380d13, 0x650a7354, 0x766a0abb, 0x81c2c92e, 0x92722c85,\n 0xa2bfe8a1, 0xa81a664b, 0xc24b8b70, 0xc76c51a3, 0xd192e819, 0xd6990624, 0xf40e3585, 0x106aa070,\n 0x19a4c116, 0x1e376c08, 0x2748774c, 0x34b0bcb5, 0x391c0cb3, 0x4ed8aa4a, 0x5b9cca4f, 0x682e6ff3,\n 0x748f82ee, 0x78a5636f, 0x84c87814, 0x8cc70208, 0x90befffa, 0xa4506ceb, 0xbef9a3f7, 0xc67178f2\n]);\n\n/** Reusable temporary buffer. \"W\" comes straight from spec. */\nconst SHA256_W = /* @__PURE__ */ new Uint32Array(64);\nexport class SHA256 extends HashMD<SHA256> {\n // We cannot use array here since array allows indexing by variable\n // which means optimizer/compiler cannot use registers.\n protected A: number = SHA256_IV[0] | 0;\n protected B: number = SHA256_IV[1] | 0;\n protected C: number = SHA256_IV[2] | 0;\n protected D: number = SHA256_IV[3] | 0;\n protected E: number = SHA256_IV[4] | 0;\n protected F: number = SHA256_IV[5] | 0;\n protected G: number = SHA256_IV[6] | 0;\n protected H: number = SHA256_IV[7] | 0;\n\n constructor(outputLen: number = 32) {\n super(64, outputLen, 8, false);\n }\n protected get(): [number, number, number, number, number, number, number, number] {\n const { A, B, C, D, E, F, G, H } = this;\n return [A, B, C, D, E, F, G, H];\n }\n // prettier-ignore\n protected set(\n A: number, B: number, C: number, D: number, E: number, F: number, G: number, H: number\n ): void {\n this.A = A | 0;\n this.B = B | 0;\n this.C = C | 0;\n this.D = D | 0;\n this.E = E | 0;\n this.F = F | 0;\n this.G = G | 0;\n this.H = H | 0;\n }\n protected process(view: DataView, offset: number): void {\n // Extend the first 16 words into the remaining 48 words w[16..63] of the message schedule array\n for (let i = 0; i < 16; i++, offset += 4) SHA256_W[i] = view.getUint32(offset, false);\n for (let i = 16; i < 64; i++) {\n const W15 = SHA256_W[i - 15];\n const W2 = SHA256_W[i - 2];\n const s0 = rotr(W15, 7) ^ rotr(W15, 18) ^ (W15 >>> 3);\n const s1 = rotr(W2, 17) ^ rotr(W2, 19) ^ (W2 >>> 10);\n SHA256_W[i] = (s1 + SHA256_W[i - 7] + s0 + SHA256_W[i - 16]) | 0;\n }\n // Compression function main loop, 64 rounds\n let { A, B, C, D, E, F, G, H } = this;\n for (let i = 0; i < 64; i++) {\n const sigma1 = rotr(E, 6) ^ rotr(E, 11) ^ rotr(E, 25);\n const T1 = (H + sigma1 + Chi(E, F, G) + SHA256_K[i] + SHA256_W[i]) | 0;\n const sigma0 = rotr(A, 2) ^ rotr(A, 13) ^ rotr(A, 22);\n const T2 = (sigma0 + Maj(A, B, C)) | 0;\n H = G;\n G = F;\n F = E;\n E = (D + T1) | 0;\n D = C;\n C = B;\n B = A;\n A = (T1 + T2) | 0;\n }\n // Add the compressed chunk to the current hash value\n A = (A + this.A) | 0;\n B = (B + this.B) | 0;\n C = (C + this.C) | 0;\n D = (D + this.D) | 0;\n E = (E + this.E) | 0;\n F = (F + this.F) | 0;\n G = (G + this.G) | 0;\n H = (H + this.H) | 0;\n this.set(A, B, C, D, E, F, G, H);\n }\n protected roundClean(): void {\n clean(SHA256_W);\n }\n destroy(): void {\n this.set(0, 0, 0, 0, 0, 0, 0, 0);\n clean(this.buffer);\n }\n}\n\nexport class SHA224 extends SHA256 {\n protected A: number = SHA224_IV[0] | 0;\n protected B: number = SHA224_IV[1] | 0;\n protected C: number = SHA224_IV[2] | 0;\n protected D: number = SHA224_IV[3] | 0;\n protected E: number = SHA224_IV[4] | 0;\n protected F: number = SHA224_IV[5] | 0;\n protected G: number = SHA224_IV[6] | 0;\n protected H: number = SHA224_IV[7] | 0;\n constructor() {\n super(28);\n }\n}\n\n// SHA2-512 is slower than sha256 in js because u64 operations are slow.\n\n// Round contants\n// First 32 bits of the fractional parts of the cube roots of the first 80 primes 2..409\n// prettier-ignore\nconst K512 = /* @__PURE__ */ (() => u64.split([\n '0x428a2f98d728ae22', '0x7137449123ef65cd', '0xb5c0fbcfec4d3b2f', '0xe9b5dba58189dbbc',\n '0x3956c25bf348b538', '0x59f111f1b605d019', '0x923f82a4af194f9b', '0xab1c5ed5da6d8118',\n '0xd807aa98a3030242', '0x12835b0145706fbe', '0x243185be4ee4b28c', '0x550c7dc3d5ffb4e2',\n '0x72be5d74f27b896f', '0x80deb1fe3b1696b1', '0x9bdc06a725c71235', '0xc19bf174cf692694',\n '0xe49b69c19ef14ad2', '0xefbe4786384f25e3', '0x0fc19dc68b8cd5b5', '0x240ca1cc77ac9c65',\n '0x2de92c6f592b0275', '0x4a7484aa6ea6e483', '0x5cb0a9dcbd41fbd4', '0x76f988da831153b5',\n '0x983e5152ee66dfab', '0xa831c66d2db43210', '0xb00327c898fb213f', '0xbf597fc7beef0ee4',\n '0xc6e00bf33da88fc2', '0xd5a79147930aa725', '0x06ca6351e003826f', '0x142929670a0e6e70',\n '0x27b70a8546d22ffc', '0x2e1b21385c26c926', '0x4d2c6dfc5ac42aed', '0x53380d139d95b3df',\n '0x650a73548baf63de', '0x766a0abb3c77b2a8', '0x81c2c92e47edaee6', '0x92722c851482353b',\n '0xa2bfe8a14cf10364', '0xa81a664bbc423001', '0xc24b8b70d0f89791', '0xc76c51a30654be30',\n '0xd192e819d6ef5218', '0xd69906245565a910', '0xf40e35855771202a', '0x106aa07032bbd1b8',\n '0x19a4c116b8d2d0c8', '0x1e376c085141ab53', '0x2748774cdf8eeb99', '0x34b0bcb5e19b48a8',\n '0x391c0cb3c5c95a63', '0x4ed8aa4ae3418acb', '0x5b9cca4f7763e373', '0x682e6ff3d6b2b8a3',\n '0x748f82ee5defb2fc', '0x78a5636f43172f60', '0x84c87814a1f0ab72', '0x8cc702081a6439ec',\n '0x90befffa23631e28', '0xa4506cebde82bde9', '0xbef9a3f7b2c67915', '0xc67178f2e372532b',\n '0xca273eceea26619c', '0xd186b8c721c0c207', '0xeada7dd6cde0eb1e', '0xf57d4f7fee6ed178',\n '0x06f067aa72176fba', '0x0a637dc5a2c898a6', '0x113f9804bef90dae', '0x1b710b35131c471b',\n '0x28db77f523047d84', '0x32caab7b40c72493', '0x3c9ebe0a15c9bebc', '0x431d67c49c100d4c',\n '0x4cc5d4becb3e42b6', '0x597f299cfc657e2a', '0x5fcb6fab3ad6faec', '0x6c44198c4a475817'\n].map(n => BigInt(n))))();\nconst SHA512_Kh = /* @__PURE__ */ (() => K512[0])();\nconst SHA512_Kl = /* @__PURE__ */ (() => K512[1])();\n\n// Reusable temporary buffers\nconst SHA512_W_H = /* @__PURE__ */ new Uint32Array(80);\nconst SHA512_W_L = /* @__PURE__ */ new Uint32Array(80);\n\nexport class SHA512 extends HashMD<SHA512> {\n // We cannot use array here since array allows indexing by variable\n // which means optimizer/compiler cannot use registers.\n // h -- high 32 bits, l -- low 32 bits\n protected Ah: number = SHA512_IV[0] | 0;\n protected Al: number = SHA512_IV[1] | 0;\n protected Bh: number = SHA512_IV[2] | 0;\n protected Bl: number = SHA512_IV[3] | 0;\n protected Ch: number = SHA512_IV[4] | 0;\n protected Cl: number = SHA512_IV[5] | 0;\n protected Dh: number = SHA512_IV[6] | 0;\n protected Dl: number = SHA512_IV[7] | 0;\n protected Eh: number = SHA512_IV[8] | 0;\n protected El: number = SHA512_IV[9] | 0;\n protected Fh: number = SHA512_IV[10] | 0;\n protected Fl: number = SHA512_IV[11] | 0;\n protected Gh: number = SHA512_IV[12] | 0;\n protected Gl: number = SHA512_IV[13] | 0;\n protected Hh: number = SHA512_IV[14] | 0;\n protected Hl: number = SHA512_IV[15] | 0;\n\n constructor(outputLen: number = 64) {\n super(128, outputLen, 16, false);\n }\n // prettier-ignore\n protected get(): [\n number, number, number, number, number, number, number, number,\n number, number, number, number, number, number, number, number\n ] {\n const { Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl } = this;\n return [Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl];\n }\n // prettier-ignore\n protected set(\n Ah: number, Al: number, Bh: number, Bl: number, Ch: number, Cl: number, Dh: number, Dl: number,\n Eh: number, El: number, Fh: number, Fl: number, Gh: number, Gl: number, Hh: number, Hl: number\n ): void {\n this.Ah = Ah | 0;\n this.Al = Al | 0;\n this.Bh = Bh | 0;\n this.Bl = Bl | 0;\n this.Ch = Ch | 0;\n this.Cl = Cl | 0;\n this.Dh = Dh | 0;\n this.Dl = Dl | 0;\n this.Eh = Eh | 0;\n this.El = El | 0;\n this.Fh = Fh | 0;\n this.Fl = Fl | 0;\n this.Gh = Gh | 0;\n this.Gl = Gl | 0;\n this.Hh = Hh | 0;\n this.Hl = Hl | 0;\n }\n protected process(view: DataView, offset: number): void {\n // Extend the first 16 words into the remaining 64 words w[16..79] of the message schedule array\n for (let i = 0; i < 16; i++, offset += 4) {\n SHA512_W_H[i] = view.getUint32(offset);\n SHA512_W_L[i] = view.getUint32((offset += 4));\n }\n for (let i = 16; i < 80; i++) {\n // s0 := (w[i-15] rightrotate 1) xor (w[i-15] rightrotate 8) xor (w[i-15] rightshift 7)\n const W15h = SHA512_W_H[i - 15] | 0;\n const W15l = SHA512_W_L[i - 15] | 0;\n const s0h = u64.rotrSH(W15h, W15l, 1) ^ u64.rotrSH(W15h, W15l, 8) ^ u64.shrSH(W15h, W15l, 7);\n const s0l = u64.rotrSL(W15h, W15l, 1) ^ u64.rotrSL(W15h, W15l, 8) ^ u64.shrSL(W15h, W15l, 7);\n // s1 := (w[i-2] rightrotate 19) xor (w[i-2] rightrotate 61) xor (w[i-2] rightshift 6)\n const W2h = SHA512_W_H[i - 2] | 0;\n const W2l = SHA512_W_L[i - 2] | 0;\n const s1h = u64.rotrSH(W2h, W2l, 19) ^ u64.rotrBH(W2h, W2l, 61) ^ u64.shrSH(W2h, W2l, 6);\n const s1l = u64.rotrSL(W2h, W2l, 19) ^ u64.rotrBL(W2h, W2l, 61) ^ u64.shrSL(W2h, W2l, 6);\n // SHA256_W[i] = s0 + s1 + SHA256_W[i - 7] + SHA256_W[i - 16];\n const SUMl = u64.add4L(s0l, s1l, SHA512_W_L[i - 7], SHA512_W_L[i - 16]);\n const SUMh = u64.add4H(SUMl, s0h, s1h, SHA512_W_H[i - 7], SHA512_W_H[i - 16]);\n SHA512_W_H[i] = SUMh | 0;\n SHA512_W_L[i] = SUMl | 0;\n }\n let { Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl } = this;\n // Compression function main loop, 80 rounds\n for (let i = 0; i < 80; i++) {\n // S1 := (e rightrotate 14) xor (e rightrotate 18) xor (e rightrotate 41)\n const sigma1h = u64.rotrSH(Eh, El, 14) ^ u64.rotrSH(Eh, El, 18) ^ u64.rotrBH(Eh, El, 41);\n const sigma1l = u64.rotrSL(Eh, El, 14) ^ u64.rotrSL(Eh, El, 18) ^ u64.rotrBL(Eh, El, 41);\n //const T1 = (H + sigma1 + Chi(E, F, G) + SHA256_K[i] + SHA256_W[i]) | 0;\n const CHIh = (Eh & Fh) ^ (~Eh & Gh);\n const CHIl = (El & Fl) ^ (~El & Gl);\n // T1 = H + sigma1 + Chi(E, F, G) + SHA512_K[i] + SHA512_W[i]\n // prettier-ignore\n const T1ll = u64.add5L(Hl, sigma1l, CHIl, SHA512_Kl[i], SHA512_W_L[i]);\n const T1h = u64.add5H(T1ll, Hh, sigma1h, CHIh, SHA512_Kh[i], SHA512_W_H[i]);\n const T1l = T1ll | 0;\n // S0 := (a rightrotate 28) xor (a rightrotate 34) xor (a rightrotate 39)\n const sigma0h = u64.rotrSH(Ah, Al, 28) ^ u64.rotrBH(Ah, Al, 34) ^ u64.rotrBH(Ah, Al, 39);\n const sigma0l = u64.rotrSL(Ah, Al, 28) ^ u64.rotrBL(Ah, Al, 34) ^ u64.rotrBL(Ah, Al, 39);\n const MAJh = (Ah & Bh) ^ (Ah & Ch) ^ (Bh & Ch);\n const MAJl = (Al & Bl) ^ (Al & Cl) ^ (Bl & Cl);\n Hh = Gh | 0;\n Hl = Gl | 0;\n Gh = Fh | 0;\n Gl = Fl | 0;\n Fh = Eh | 0;\n Fl = El | 0;\n ({ h: Eh, l: El } = u64.add(Dh | 0, Dl | 0, T1h | 0, T1l | 0));\n Dh = Ch | 0;\n Dl = Cl | 0;\n Ch = Bh | 0;\n Cl = Bl | 0;\n Bh = Ah | 0;\n Bl = Al | 0;\n const All = u64.add3L(T1l, sigma0l, MAJl);\n Ah = u64.add3H(All, T1h, sigma0h, MAJh);\n Al = All | 0;\n }\n // Add the compressed chunk to the current hash value\n ({ h: Ah, l: Al } = u64.add(this.Ah | 0, this.Al | 0, Ah | 0, Al | 0));\n ({ h: Bh, l: Bl } = u64.add(this.Bh | 0, this.Bl | 0, Bh | 0, Bl | 0));\n ({ h: Ch, l: Cl } = u64.add(this.Ch | 0, this.Cl | 0, Ch | 0, Cl | 0));\n ({ h: Dh, l: Dl } = u64.add(this.Dh | 0, this.Dl | 0, Dh | 0, Dl | 0));\n ({ h: Eh, l: El } = u64.add(this.Eh | 0, this.El | 0, Eh | 0, El | 0));\n ({ h: Fh, l: Fl } = u64.add(this.Fh | 0, this.Fl | 0, Fh | 0, Fl | 0));\n ({ h: Gh, l: Gl } = u64.add(this.Gh | 0, this.Gl | 0, Gh | 0, Gl | 0));\n ({ h: Hh, l: Hl } = u64.add(this.Hh | 0, this.Hl | 0, Hh | 0, Hl | 0));\n this.set(Ah, Al, Bh, Bl, Ch, Cl, Dh, Dl, Eh, El, Fh, Fl, Gh, Gl, Hh, Hl);\n }\n protected roundClean(): void {\n clean(SHA512_W_H, SHA512_W_L);\n }\n destroy(): void {\n clean(this.buffer);\n this.set(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0);\n }\n}\n\nexport class SHA384 extends SHA512 {\n protected Ah: number = SHA384_IV[0] | 0;\n protected Al: number = SHA384_IV[1] | 0;\n protected Bh: number = SHA384_IV[2] | 0;\n protected Bl: number = SHA384_IV[3] | 0;\n protected Ch: number = SHA384_IV[4] | 0;\n protected Cl: number = SHA384_IV[5] | 0;\n protected Dh: number = SHA384_IV[6] | 0;\n protected Dl: number = SHA384_IV[7] | 0;\n protected Eh: number = SHA384_IV[8] | 0;\n protected El: number = SHA384_IV[9] | 0;\n protected Fh: number = SHA384_IV[10] | 0;\n protected Fl: number = SHA384_IV[11] | 0;\n protected Gh: number = SHA384_IV[12] | 0;\n protected Gl: number = SHA384_IV[13] | 0;\n protected Hh: number = SHA384_IV[14] | 0;\n protected Hl: number = SHA384_IV[15] | 0;\n\n constructor() {\n super(48);\n }\n}\n\n/**\n * Truncated SHA512/256 and SHA512/224.\n * SHA512_IV is XORed with 0xa5a5a5a5a5a5a5a5, then used as \"intermediary\" IV of SHA512/t.\n * Then t hashes string to produce result IV.\n * See `test/misc/sha2-gen-iv.js`.\n */\n\n/** SHA512/224 IV */\nconst T224_IV = /* @__PURE__ */ Uint32Array.from([\n 0x8c3d37c8, 0x19544da2, 0x73e19966, 0x89dcd4d6, 0x1dfab7ae, 0x32ff9c82, 0x679dd514, 0x582f9fcf,\n 0x0f6d2b69, 0x7bd44da8, 0x77e36f73, 0x04c48942, 0x3f9d85a8, 0x6a1d36c8, 0x1112e6ad, 0x91d692a1,\n]);\n\n/** SHA512/256 IV */\nconst T256_IV = /* @__PURE__ */ Uint32Array.from([\n 0x22312194, 0xfc2bf72c, 0x9f555fa3, 0xc84c64c2, 0x2393b86b, 0x6f53b151, 0x96387719, 0x5940eabd,\n 0x96283ee2, 0xa88effe3, 0xbe5e1e25, 0x53863992, 0x2b0199fc, 0x2c85b8aa, 0x0eb72ddc, 0x81c52ca2,\n]);\n\nexport class SHA512_224 extends SHA512 {\n protected Ah: number = T224_IV[0] | 0;\n protected Al: number = T224_IV[1] | 0;\n protected Bh: number = T224_IV[2] | 0;\n protected Bl: number = T224_IV[3] | 0;\n protected Ch: number = T224_IV[4] | 0;\n protected Cl: number = T224_IV[5] | 0;\n protected Dh: number = T224_IV[6] | 0;\n protected Dl: number = T224_IV[7] | 0;\n protected Eh: number = T224_IV[8] | 0;\n protected El: number = T224_IV[9] | 0;\n protected Fh: number = T224_IV[10] | 0;\n protected Fl: number = T224_IV[11] | 0;\n protected Gh: number = T224_IV[12] | 0;\n protected Gl: number = T224_IV[13] | 0;\n protected Hh: number = T224_IV[14] | 0;\n protected Hl: number = T224_IV[15] | 0;\n\n constructor() {\n super(28);\n }\n}\n\nexport class SHA512_256 extends SHA512 {\n protected Ah: number = T256_IV[0] | 0;\n protected Al: number = T256_IV[1] | 0;\n protected Bh: number = T256_IV[2] | 0;\n protected Bl: number = T256_IV[3] | 0;\n protected Ch: number = T256_IV[4] | 0;\n protected Cl: number = T256_IV[5] | 0;\n protected Dh: number = T256_IV[6] | 0;\n protected Dl: number = T256_IV[7] | 0;\n protected Eh: number = T256_IV[8] | 0;\n protected El: number = T256_IV[9] | 0;\n protected Fh: number = T256_IV[10] | 0;\n protected Fl: number = T256_IV[11] | 0;\n protected Gh: number = T256_IV[12] | 0;\n protected Gl: number = T256_IV[13] | 0;\n protected Hh: number = T256_IV[14] | 0;\n protected Hl: number = T256_IV[15] | 0;\n\n constructor() {\n super(32);\n }\n}\n\n/**\n * SHA2-256 hash function from RFC 4634.\n *\n * It is the fastest JS hash, even faster than Blake3.\n * To break sha256 using birthday attack, attackers need to try 2^128 hashes.\n * BTC network is doing 2^70 hashes/sec (2^95 hashes/year) as per 2025.\n */\nexport const sha256: CHash = /* @__PURE__ */ createHasher(() => new SHA256());\n/** SHA2-224 hash function from RFC 4634 */\nexport const sha224: CHash = /* @__PURE__ */ createHasher(() => new SHA224());\n\n/** SHA2-512 hash function from RFC 4634. */\nexport const sha512: CHash = /* @__PURE__ */ createHasher(() => new SHA512());\n/** SHA2-384 hash function from RFC 4634. */\nexport const sha384: CHash = /* @__PURE__ */ createHasher(() => new SHA384());\n\n/**\n * SHA2-512/256 \"truncated\" hash function, with improved resistance to length extension attacks.\n * See the paper on [truncated SHA512](https://eprint.iacr.org/2010/548.pdf).\n */\nexport const sha512_256: CHash = /* @__PURE__ */ createHasher(() => new SHA512_256());\n/**\n * SHA2-512/224 \"truncated\" hash function, with improved resistance to length extension attacks.\n * See the paper on [truncated SHA512](https://eprint.iacr.org/2010/548.pdf).\n */\nexport const sha512_224: CHash = /* @__PURE__ */ createHasher(() => new SHA512_224());\n", "import { base32Decode, base32Encode } from './utils/base32.ts';\nimport { getCrc32 } from './utils/getCrc.ts';\nimport { sha224 } from '@noble/hashes/sha2';\nimport { bytesToHex, hexToBytes } from '@noble/hashes/utils';\n\nexport const JSON_KEY_PRINCIPAL = '__principal__';\nconst SELF_AUTHENTICATING_SUFFIX = 2;\nconst ANONYMOUS_SUFFIX = 4;\n\nconst MANAGEMENT_CANISTER_PRINCIPAL_TEXT_STR = 'aaaaa-aa';\n\nexport type JsonnablePrincipal = {\n [JSON_KEY_PRINCIPAL]: string;\n};\n\nexport class Principal {\n public static anonymous(): Principal {\n return new this(new Uint8Array([ANONYMOUS_SUFFIX]));\n }\n\n /**\n * Utility method, returning the principal representing the management canister, decoded from the hex string `'aaaaa-aa'`\n * @returns {Principal} principal of the management canister\n */\n public static managementCanister(): Principal {\n return this.fromText(MANAGEMENT_CANISTER_PRINCIPAL_TEXT_STR);\n }\n\n public static selfAuthenticating(publicKey: Uint8Array): Principal {\n const sha = sha224(publicKey);\n return new this(new Uint8Array([...sha, SELF_AUTHENTICATING_SUFFIX]));\n }\n\n public static from(other: unknown): Principal {\n if (typeof other === 'string') {\n return Principal.fromText(other);\n } else if (Object.getPrototypeOf(other) === Uint8Array.prototype) {\n return new Principal(other as Uint8Array);\n } else if (Principal.isPrincipal(other)) {\n return new Principal(other._arr);\n }\n\n throw new Error(`Impossible to convert ${JSON.stringify(other)} to Principal.`);\n }\n\n public static fromHex(hex: string): Principal {\n return new this(hexToBytes(hex));\n }\n\n public static fromText(text: string): Principal {\n let maybePrincipal = text;\n // If formatted as JSON string, parse it first\n if (text.includes(JSON_KEY_PRINCIPAL)) {\n const obj = JSON.parse(text);\n if (JSON_KEY_PRINCIPAL in obj) {\n maybePrincipal = obj[JSON_KEY_PRINCIPAL];\n }\n }\n\n const canisterIdNoDash = maybePrincipal.toLowerCase().replace(/-/g, '');\n\n let arr = base32Decode(canisterIdNoDash);\n arr = arr.slice(4, arr.length);\n\n const principal = new this(arr);\n if (principal.toText() !== maybePrincipal) {\n throw new Error(\n `Principal \"${principal.toText()}\" does not have a valid checksum (original value \"${maybePrincipal}\" may not be a valid Principal ID).`,\n );\n }\n\n return principal;\n }\n\n public static fromUint8Array(arr: Uint8Array): Principal {\n return new this(arr);\n }\n\n public static isPrincipal(other: unknown): other is Principal {\n return (\n other instanceof Principal ||\n (typeof other === 'object' &&\n other !== null &&\n '_isPrincipal' in other &&\n (other as { _isPrincipal: boolean })['_isPrincipal'] === true &&\n '_arr' in other &&\n (other as { _arr: Uint8Array })['_arr'] instanceof Uint8Array)\n );\n }\n\n public readonly _isPrincipal = true;\n\n protected constructor(private _arr: Uint8Array) {}\n\n public isAnonymous(): boolean {\n return this._arr.byteLength === 1 && this._arr[0] === ANONYMOUS_SUFFIX;\n }\n\n public toUint8Array(): Uint8Array {\n return this._arr;\n }\n\n public toHex(): string {\n return bytesToHex(this._arr).toUpperCase();\n }\n\n public toText(): string {\n const checksumArrayBuf = new ArrayBuffer(4);\n const view = new DataView(checksumArrayBuf);\n view.setUint32(0, getCrc32(this._arr));\n const checksum = new Uint8Array(checksumArrayBuf);\n\n const array = new Uint8Array([...checksum, ...this._arr]);\n\n const result = base32Encode(array);\n const matches = result.match(/.{1,5}/g);\n if (!matches) {\n // This should only happen if there's no character, which is unreachable.\n throw new Error();\n }\n return matches.join('-');\n }\n\n public toString(): string {\n return this.toText();\n }\n\n /**\n * Serializes to JSON\n * @returns {JsonnablePrincipal} a JSON object with a single key, {@link JSON_KEY_PRINCIPAL}, whose value is the principal as a string\n */\n public toJSON(): JsonnablePrincipal {\n return { [JSON_KEY_PRINCIPAL]: this.toText() };\n }\n\n /**\n * Utility method taking a Principal to compare against. Used for determining canister ranges in certificate verification\n * @param {Principal} other - a {@link Principal} to compare\n * @returns {'lt' | 'eq' | 'gt'} `'lt' | 'eq' | 'gt'` a string, representing less than, equal to, or greater than\n */\n public compareTo(other: Principal): 'lt' | 'eq' | 'gt' {\n for (let i = 0; i < Math.min(this._arr.length, other._arr.length); i++) {\n if (this._arr[i] < other._arr[i]) return 'lt';\n else if (this._arr[i] > other._arr[i]) return 'gt';\n }\n // Here, at least one principal is a prefix of the other principal (they could be the same)\n if (this._arr.length < other._arr.length) return 'lt';\n if (this._arr.length > other._arr.length) return 'gt';\n return 'eq';\n }\n\n /**\n * Utility method checking whether a provided Principal is less than or equal to the current one using the {@link Principal.compareTo} method\n * @param other a {@link Principal} to compare\n * @returns {boolean} boolean\n */\n public ltEq(other: Principal): boolean {\n const cmp = this.compareTo(other);\n return cmp == 'lt' || cmp == 'eq';\n }\n\n /**\n * Utility method checking whether a provided Principal is greater than or equal to the current one using the {@link Principal.compareTo} method\n * @param other a {@link Principal} to compare\n * @returns {boolean} boolean\n */\n public gtEq(other: Principal): boolean {\n const cmp = this.compareTo(other);\n return cmp == 'gt' || cmp == 'eq';\n }\n}\n", "import {PrincipalSchema, Uint8ArraySchema} from '@dfinity/zod-schemas';\nimport * as z from 'zod';\n\nexport const JunoType = {\n /** Validates a Principal. */\n principal: () => PrincipalSchema,\n /** Validates a Uint8Array (blob, vec<u8>). */\n uint8Array: () => Uint8ArraySchema\n};\n\n// z.union is omitted because object unions can't be reliably serialized to Candid/Rust without a discriminator field.\nconst {union: _, ...rest} = z;\n\n/**\n * Juno's type system - an extended Zod instance for Serverless Functions.\n *\n * The schema builder exposes all Zod schemas and functions aside from\n * `union()` which can't be reliably serialized currently without a discriminator field.\n * That's why you should prefer using `discriminatedUnion()` instead.\n *\n * It extends Zod with various schemas useful for writing your custom functions\n * such as `j.principal()` and `j.uint8Array()`.\n *\n * @example\n * import { j } from '@junobuild/schema';\n *\n * const MySchema = j.strictObject({\n * id: j.principal(),\n * name: j.string(),\n * });\n */\nexport const j = Object.assign({}, rest) as unknown as Omit<typeof z, 'union'> & typeof JunoType;\n\nj.principal = JunoType.principal;\nj.uint8Array = JunoType.uint8Array;\n\n// eslint-disable-next-line @typescript-eslint/no-namespace\nexport namespace j {\n export type infer<T extends z.ZodType> = z.infer<T>;\n}\n"],
|
|
5
|
+
"mappings": ";;AAAA,UAAYA,MAAO,MIAnB,IAAMC,EAAW,mCAGXC,EAAsC,OAAO,OAAO,IAAI,EAC9D,QAASC,EAAI,EAAGA,EAAIF,EAAS,OAAQE,IACnCD,EAAYD,EAASE,CAAC,CAAC,EAAIA,EAI7BD,EAAY,CAAG,EAAIA,EAAY,EAC/BA,EAAY,CAAG,EAAIA,EAAY,EAMzB,SAAUE,EAAaC,EAAiB,CAE5C,IAAIC,EAAO,EAEPC,EAAO,EAGPC,EAAS,GAEb,SAASC,EAAWC,EAAY,CAS9B,OARIJ,EAAO,EAETC,GAAQG,GAAQ,CAACJ,EAGjBC,EAAQG,GAAQJ,EAAQ,IAGtBA,EAAO,GAETA,GAAQ,EACD,IAGLA,EAAO,IAETE,GAAUP,EAASM,GAAQ,CAAC,EAC5BD,GAAQ,GAGH,EACT,CAEA,QAASH,EAAI,EAAGA,EAAIE,EAAM,QACxBF,GAAKM,EAAWJ,EAAMF,CAAC,CAAC,EAG1B,OAAOK,GAAUF,EAAO,EAAIL,EAASM,GAAQ,CAAC,EAAI,GACpD,CAKM,SAAUI,EAAaN,EAAa,CAExC,IAAIC,EAAO,EAEPI,EAAO,EAELF,EAAS,IAAI,WAAaH,EAAM,OAAS,EAAK,EAAK,CAAC,EACtDO,EAAI,EAER,SAASC,EAAWC,EAAY,CAI9B,IAAIC,EAAMb,EAAYY,EAAK,YAAW,CAAE,EACxC,GAAIC,IAAQ,OACV,MAAM,IAAI,MAAM,sBAAsB,KAAK,UAAUD,CAAI,CAAC,EAAE,EAI9DC,IAAQ,EACRL,GAAQK,IAAQT,EAChBA,GAAQ,EAEJA,GAAQ,IAEVE,EAAOI,GAAG,EAAIF,EACdJ,GAAQ,EAEJA,EAAO,EACTI,EAAQK,GAAQ,EAAIT,EAAS,IAE7BI,EAAO,EAGb,CAEA,QAAWM,KAAKX,EACdQ,EAAWG,CAAC,EAGd,OAAOR,EAAO,MAAM,EAAGI,CAAC,CAC1B,CClGA,IAAMK,GAA2B,IAAI,YAAY,CAC/C,EAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,WAAY,SAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WACpF,WAAY,WAAY,SAAY,WAAY,WAAY,WAAY,SAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,WAAY,SAAY,WAAY,WAAY,WAAY,SACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,SAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WAAY,UACrF,EAMK,SAAUC,EAASC,EAAe,CACtC,IAAIC,EAAM,GAEV,QAASC,EAAI,EAAGA,EAAIF,EAAI,OAAQE,IAAK,CAEnC,IAAMC,GADOH,EAAIE,CAAC,EACAD,GAAO,IACzBA,EAAMH,GAAYK,CAAC,EAAKF,IAAQ,CAClC,CAEA,OAAQA,EAAM,MAAQ,CACxB,CCpCM,SAAUG,GAAQC,EAAU,CAChC,OAAOA,aAAa,YAAe,YAAY,OAAOA,CAAC,GAAKA,EAAE,YAAY,OAAS,YACrF,CAQM,SAAUC,EAAOC,KAA8BC,EAAiB,CACpE,GAAI,CAACC,GAAQF,CAAC,EAAG,MAAM,IAAI,MAAM,qBAAqB,EACtD,GAAIC,EAAQ,OAAS,GAAK,CAACA,EAAQ,SAASD,EAAE,MAAM,EAClD,MAAM,IAAI,MAAM,iCAAmCC,EAAU,gBAAkBD,EAAE,MAAM,CAC3F,CAWM,SAAUG,EAAQC,EAAeC,EAAgB,GAAI,CACzD,GAAID,EAAS,UAAW,MAAM,IAAI,MAAM,kCAAkC,EAC1E,GAAIC,GAAiBD,EAAS,SAAU,MAAM,IAAI,MAAM,uCAAuC,CACjG,CAGM,SAAUE,EAAQC,EAAUH,EAAa,CAC7CI,EAAOD,CAAG,EACV,IAAME,EAAML,EAAS,UACrB,GAAIG,EAAI,OAASE,EACf,MAAM,IAAI,MAAM,yDAA2DA,CAAG,CAElF,CAkBM,SAAUC,KAASC,EAAoB,CAC3C,QAASC,EAAI,EAAGA,EAAID,EAAO,OAAQC,IACjCD,EAAOC,CAAC,EAAE,KAAK,CAAC,CAEpB,CAGM,SAAUC,EAAWC,EAAe,CACxC,OAAO,IAAI,SAASA,EAAI,OAAQA,EAAI,WAAYA,EAAI,UAAU,CAChE,CAGM,SAAUC,EAAKC,EAAcC,EAAa,CAC9C,OAAQD,GAAS,GAAKC,EAAWD,IAASC,CAC5C,CAwCA,IAAMC,EAEJ,OAAO,WAAW,KAAK,CAAA,CAAE,EAAE,OAAU,YAAc,OAAO,WAAW,SAAY,WAG7EC,GAAwB,MAAM,KAAK,CAAE,OAAQ,GAAG,EAAI,CAACC,EAAGC,IAC5DA,EAAE,SAAS,EAAE,EAAE,SAAS,EAAG,GAAG,CAAC,EAO3B,SAAUC,EAAWC,EAAiB,CAG1C,GAFAC,EAAOD,CAAK,EAERL,EAAe,OAAOK,EAAM,MAAK,EAErC,IAAIE,EAAM,GACV,QAASJ,EAAI,EAAGA,EAAIE,EAAM,OAAQF,IAChCI,GAAON,GAAMI,EAAMF,CAAC,CAAC,EAEvB,OAAOI,CACT,CAGA,IAAMC,EAAS,CAAE,GAAI,GAAI,GAAI,GAAI,EAAG,GAAI,EAAG,GAAI,EAAG,GAAI,EAAG,GAAG,EAC5D,SAASC,EAAcC,EAAU,CAC/B,GAAIA,GAAMF,EAAO,IAAME,GAAMF,EAAO,GAAI,OAAOE,EAAKF,EAAO,GAC3D,GAAIE,GAAMF,EAAO,GAAKE,GAAMF,EAAO,EAAG,OAAOE,GAAMF,EAAO,EAAI,IAC9D,GAAIE,GAAMF,EAAO,GAAKE,GAAMF,EAAO,EAAG,OAAOE,GAAMF,EAAO,EAAI,GAEhE,CAMM,SAAUG,EAAWJ,EAAW,CACpC,GAAI,OAAOA,GAAQ,SAAU,MAAM,IAAI,MAAM,4BAA8B,OAAOA,CAAG,EAErF,GAAIP,EAAe,OAAO,WAAW,QAAQO,CAAG,EAChD,IAAMK,EAAKL,EAAI,OACTM,EAAKD,EAAK,EAChB,GAAIA,EAAK,EAAG,MAAM,IAAI,MAAM,mDAAqDA,CAAE,EACnF,IAAME,EAAQ,IAAI,WAAWD,CAAE,EAC/B,QAASE,EAAK,EAAGC,EAAK,EAAGD,EAAKF,EAAIE,IAAMC,GAAM,EAAG,CAC/C,IAAMC,EAAKR,EAAcF,EAAI,WAAWS,CAAE,CAAC,EACrCE,EAAKT,EAAcF,EAAI,WAAWS,EAAK,CAAC,CAAC,EAC/C,GAAIC,IAAO,QAAaC,IAAO,OAAW,CACxC,IAAMC,EAAOZ,EAAIS,CAAE,EAAIT,EAAIS,EAAK,CAAC,EACjC,MAAM,IAAI,MAAM,+CAAiDG,EAAO,cAAgBH,CAAE,CAC5F,CACAF,EAAMC,CAAE,EAAIE,EAAK,GAAKC,CACxB,CACA,OAAOJ,CACT,CAkCM,SAAUM,GAAYC,EAAW,CACrC,GAAI,OAAOA,GAAQ,SAAU,MAAM,IAAI,MAAM,iBAAiB,EAC9D,OAAO,IAAI,WAAW,IAAI,YAAW,EAAG,OAAOA,CAAG,CAAC,CACrD,CAiBM,SAAUC,EAAQC,EAAW,CACjC,OAAI,OAAOA,GAAS,WAAUA,EAAOC,GAAYD,CAAI,GACrDE,EAAOF,CAAI,EACJA,CACT,CAmDM,IAAgBG,EAAhB,KAAoB,GA4CpB,SAAUC,EACdC,EAAuB,CAOvB,IAAMC,EAASC,GAA2BF,EAAQ,EAAG,OAAOG,EAAQD,CAAG,CAAC,EAAE,OAAM,EAC1EE,EAAMJ,EAAQ,EACpB,OAAAC,EAAM,UAAYG,EAAI,UACtBH,EAAM,SAAWG,EAAI,SACrBH,EAAM,OAAS,IAAMD,EAAQ,EACtBC,CACT,CCpVM,SAAUI,GACdC,EACAC,EACAC,EACAC,EAAa,CAEb,GAAI,OAAOH,EAAK,cAAiB,WAAY,OAAOA,EAAK,aAAaC,EAAYC,EAAOC,CAAI,EAC7F,IAAMC,EAAO,OAAO,EAAE,EAChBC,EAAW,OAAO,UAAU,EAC5BC,EAAK,OAAQJ,GAASE,EAAQC,CAAQ,EACtCE,EAAK,OAAOL,EAAQG,CAAQ,EAC5BG,EAAIL,EAAO,EAAI,EACfM,EAAIN,EAAO,EAAI,EACrBH,EAAK,UAAUC,EAAaO,EAAGF,EAAIH,CAAI,EACvCH,EAAK,UAAUC,EAAaQ,EAAGF,EAAIJ,CAAI,CACzC,CAGM,SAAUO,EAAIC,EAAWC,EAAWC,EAAS,CACjD,OAAQF,EAAIC,EAAM,CAACD,EAAIE,CACzB,CAGM,SAAUC,EAAIH,EAAWC,EAAWC,EAAS,CACjD,OAAQF,EAAIC,EAAMD,EAAIE,EAAMD,EAAIC,CAClC,CAMM,IAAgBE,EAAhB,cAAoDC,CAAO,CAoB/D,YAAYC,EAAkBC,EAAmBC,EAAmBhB,EAAa,CAC/E,MAAK,EANG,KAAA,SAAW,GACX,KAAA,OAAS,EACT,KAAA,IAAM,EACN,KAAA,UAAY,GAIpB,KAAK,SAAWc,EAChB,KAAK,UAAYC,EACjB,KAAK,UAAYC,EACjB,KAAK,KAAOhB,EACZ,KAAK,OAAS,IAAI,WAAWc,CAAQ,EACrC,KAAK,KAAOG,EAAW,KAAK,MAAM,CACpC,CACA,OAAOC,EAAW,CAChBC,EAAQ,IAAI,EACZD,EAAOE,EAAQF,CAAI,EACnBG,EAAOH,CAAI,EACX,GAAM,CAAE,KAAArB,EAAM,OAAAyB,EAAQ,SAAAR,CAAQ,EAAK,KAC7BS,EAAML,EAAK,OACjB,QAASM,EAAM,EAAGA,EAAMD,GAAO,CAC7B,IAAME,EAAO,KAAK,IAAIX,EAAW,KAAK,IAAKS,EAAMC,CAAG,EAEpD,GAAIC,IAASX,EAAU,CACrB,IAAMY,EAAWT,EAAWC,CAAI,EAChC,KAAOJ,GAAYS,EAAMC,EAAKA,GAAOV,EAAU,KAAK,QAAQY,EAAUF,CAAG,EACzE,QACF,CACAF,EAAO,IAAIJ,EAAK,SAASM,EAAKA,EAAMC,CAAI,EAAG,KAAK,GAAG,EACnD,KAAK,KAAOA,EACZD,GAAOC,EACH,KAAK,MAAQX,IACf,KAAK,QAAQjB,EAAM,CAAC,EACpB,KAAK,IAAM,EAEf,CACA,YAAK,QAAUqB,EAAK,OACpB,KAAK,WAAU,EACR,IACT,CACA,WAAWS,EAAe,CACxBR,EAAQ,IAAI,EACZS,EAAQD,EAAK,IAAI,EACjB,KAAK,SAAW,GAIhB,GAAM,CAAE,OAAAL,EAAQ,KAAAzB,EAAM,SAAAiB,EAAU,KAAAd,CAAI,EAAK,KACrC,CAAE,IAAAwB,CAAG,EAAK,KAEdF,EAAOE,GAAK,EAAI,IAChBK,EAAM,KAAK,OAAO,SAASL,CAAG,CAAC,EAG3B,KAAK,UAAYV,EAAWU,IAC9B,KAAK,QAAQ3B,EAAM,CAAC,EACpB2B,EAAM,GAGR,QAASM,EAAIN,EAAKM,EAAIhB,EAAUgB,IAAKR,EAAOQ,CAAC,EAAI,EAIjDlC,GAAaC,EAAMiB,EAAW,EAAG,OAAO,KAAK,OAAS,CAAC,EAAGd,CAAI,EAC9D,KAAK,QAAQH,EAAM,CAAC,EACpB,IAAMkC,EAAQd,EAAWU,CAAG,EACtBJ,EAAM,KAAK,UAEjB,GAAIA,EAAM,EAAG,MAAM,IAAI,MAAM,6CAA6C,EAC1E,IAAMS,EAAST,EAAM,EACfU,EAAQ,KAAK,IAAG,EACtB,GAAID,EAASC,EAAM,OAAQ,MAAM,IAAI,MAAM,oCAAoC,EAC/E,QAASH,EAAI,EAAGA,EAAIE,EAAQF,IAAKC,EAAM,UAAU,EAAID,EAAGG,EAAMH,CAAC,EAAG9B,CAAI,CACxE,CACA,QAAM,CACJ,GAAM,CAAE,OAAAsB,EAAQ,UAAAP,CAAS,EAAK,KAC9B,KAAK,WAAWO,CAAM,EACtB,IAAMY,EAAMZ,EAAO,MAAM,EAAGP,CAAS,EACrC,YAAK,QAAO,EACLmB,CACT,CACA,WAAWC,EAAM,CACfA,IAAAA,EAAO,IAAK,KAAK,aACjBA,EAAG,IAAI,GAAG,KAAK,IAAG,CAAE,EACpB,GAAM,CAAE,SAAArB,EAAU,OAAAQ,EAAQ,OAAAc,EAAQ,SAAAC,EAAU,UAAAC,EAAW,IAAAd,CAAG,EAAK,KAC/D,OAAAW,EAAG,UAAYG,EACfH,EAAG,SAAWE,EACdF,EAAG,OAASC,EACZD,EAAG,IAAMX,EACLY,EAAStB,GAAUqB,EAAG,OAAO,IAAIb,CAAM,EACpCa,CACT,CACA,OAAK,CACH,OAAO,KAAK,WAAU,CACxB,GASWI,EAAyC,YAAY,KAAK,CACrE,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UAAY,WACrF,EAGYC,EAAyC,YAAY,KAAK,CACrE,WAAY,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WACrF,ECnJD,IAAMC,GAA2B,YAAY,KAAK,CAChD,WAAY,WAAY,WAAY,WAAY,UAAY,WAAY,WAAY,WACpF,WAAY,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,UAAY,UAAY,UAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UAAY,UACpF,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,UACpF,UAAY,UAAY,UAAY,UAAY,UAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACrF,EAGKC,EAA2B,IAAI,YAAY,EAAE,EACtCC,EAAP,cAAsBC,CAAc,CAYxC,YAAYC,EAAoB,GAAE,CAChC,MAAM,GAAIA,EAAW,EAAG,EAAK,EAVrB,KAAA,EAAYC,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,CAIrC,CACU,KAAG,CACX,GAAM,CAAE,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,CAAC,EAAK,KACnC,MAAO,CAACP,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,CAAC,CAChC,CAEU,IACRP,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAWC,EAAS,CAEtF,KAAK,EAAIP,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,EACb,KAAK,EAAIC,EAAI,CACf,CACU,QAAQC,EAAgBC,EAAc,CAE9C,QAASC,EAAI,EAAGA,EAAI,GAAIA,IAAKD,GAAU,EAAGd,EAASe,CAAC,EAAIF,EAAK,UAAUC,EAAQ,EAAK,EACpF,QAASC,EAAI,GAAIA,EAAI,GAAIA,IAAK,CAC5B,IAAMC,EAAMhB,EAASe,EAAI,EAAE,EACrBE,EAAKjB,EAASe,EAAI,CAAC,EACnBG,EAAKC,EAAKH,EAAK,CAAC,EAAIG,EAAKH,EAAK,EAAE,EAAKA,IAAQ,EAC7CI,EAAKD,EAAKF,EAAI,EAAE,EAAIE,EAAKF,EAAI,EAAE,EAAKA,IAAO,GACjDjB,EAASe,CAAC,EAAKK,EAAKpB,EAASe,EAAI,CAAC,EAAIG,EAAKlB,EAASe,EAAI,EAAE,EAAK,CACjE,CAEA,GAAI,CAAE,EAAAV,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,EAAG,EAAAC,CAAC,EAAK,KACjC,QAASG,EAAI,EAAGA,EAAI,GAAIA,IAAK,CAC3B,IAAMM,EAASF,EAAKV,EAAG,CAAC,EAAIU,EAAKV,EAAG,EAAE,EAAIU,EAAKV,EAAG,EAAE,EAC9Ca,EAAMV,EAAIS,EAASE,EAAId,EAAGC,EAAGC,CAAC,EAAIZ,GAASgB,CAAC,EAAIf,EAASe,CAAC,EAAK,EAE/DS,GADSL,EAAKd,EAAG,CAAC,EAAIc,EAAKd,EAAG,EAAE,EAAIc,EAAKd,EAAG,EAAE,GAC/BoB,EAAIpB,EAAGC,EAAGC,CAAC,EAAK,EACrCK,EAAID,EACJA,EAAID,EACJA,EAAID,EACJA,EAAKD,EAAIc,EAAM,EACfd,EAAID,EACJA,EAAID,EACJA,EAAID,EACJA,EAAKiB,EAAKE,EAAM,CAClB,CAEAnB,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnBC,EAAKA,EAAI,KAAK,EAAK,EACnB,KAAK,IAAIP,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,EAAGC,CAAC,CACjC,CACU,YAAU,CAClBc,EAAM1B,CAAQ,CAChB,CACA,SAAO,CACL,KAAK,IAAI,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,CAAC,EAC/B0B,EAAM,KAAK,MAAM,CACnB,GAGWC,EAAP,cAAsB1B,CAAM,CAShC,aAAA,CACE,MAAM,EAAE,EATA,KAAA,EAAY2B,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,EAC3B,KAAA,EAAYA,EAAU,CAAC,EAAI,CAGrC,GA2QK,IAAMC,EAAgCC,EAAa,IAAM,IAAIC,CAAQ,EC5XrE,IAAMC,EAAqB,gBAC5BC,GAA6B,EAC7BC,EAAmB,EAEnBC,GAAyC,WAMlCC,EAAP,MAAOC,CAAS,CACb,OAAO,WAAS,CACrB,OAAO,IAAI,KAAK,IAAI,WAAW,CAACH,CAAgB,CAAC,CAAC,CACpD,CAMO,OAAO,oBAAkB,CAC9B,OAAO,KAAK,SAASC,EAAsC,CAC7D,CAEO,OAAO,mBAAmBG,EAAqB,CACpD,IAAMC,EAAMC,EAAOF,CAAS,EAC5B,OAAO,IAAI,KAAK,IAAI,WAAW,CAAC,GAAGC,EAAKN,EAA0B,CAAC,CAAC,CACtE,CAEO,OAAO,KAAKQ,EAAc,CAC/B,GAAI,OAAOA,GAAU,SACnB,OAAOJ,EAAU,SAASI,CAAK,EAC1B,GAAI,OAAO,eAAeA,CAAK,IAAM,WAAW,UACrD,OAAO,IAAIJ,EAAUI,CAAmB,EACnC,GAAIJ,EAAU,YAAYI,CAAK,EACpC,OAAO,IAAIJ,EAAUI,EAAM,IAAI,EAGjC,MAAM,IAAI,MAAM,yBAAyB,KAAK,UAAUA,CAAK,CAAC,gBAAgB,CAChF,CAEO,OAAO,QAAQC,EAAW,CAC/B,OAAO,IAAI,KAAKC,EAAWD,CAAG,CAAC,CACjC,CAEO,OAAO,SAASE,EAAY,CACjC,IAAIC,EAAiBD,EAErB,GAAIA,EAAK,SAASZ,CAAkB,EAAG,CACrC,IAAMc,EAAM,KAAK,MAAMF,CAAI,EACvBZ,KAAsBc,IACxBD,EAAiBC,EAAId,CAAkB,EAE3C,CAEA,IAAMe,EAAmBF,EAAe,YAAW,EAAG,QAAQ,KAAM,EAAE,EAElEG,EAAMC,EAAaF,CAAgB,EACvCC,EAAMA,EAAI,MAAM,EAAGA,EAAI,MAAM,EAE7B,IAAME,EAAY,IAAI,KAAKF,CAAG,EAC9B,GAAIE,EAAU,OAAM,IAAOL,EACzB,MAAM,IAAI,MACR,cAAcK,EAAU,OAAM,CAAE,qDAAqDL,CAAc,qCAAqC,EAI5I,OAAOK,CACT,CAEO,OAAO,eAAeF,EAAe,CAC1C,OAAO,IAAI,KAAKA,CAAG,CACrB,CAEO,OAAO,YAAYP,EAAc,CACtC,OACEA,aAAiBJ,GAChB,OAAOI,GAAU,UAChBA,IAAU,MACV,iBAAkBA,GACjBA,EAAoC,eAAoB,IACzD,SAAUA,GACTA,EAA+B,gBAAmB,UAEzD,CAIA,YAA8BU,EAAgB,CAAhB,KAAA,KAAAA,EAFd,KAAA,aAAe,EAEkB,CAE1C,aAAW,CAChB,OAAO,KAAK,KAAK,aAAe,GAAK,KAAK,KAAK,CAAC,IAAMjB,CACxD,CAEO,cAAY,CACjB,OAAO,KAAK,IACd,CAEO,OAAK,CACV,OAAOkB,EAAW,KAAK,IAAI,EAAE,YAAW,CAC1C,CAEO,QAAM,CACX,IAAMC,EAAmB,IAAI,YAAY,CAAC,EAC7B,IAAI,SAASA,CAAgB,EACrC,UAAU,EAAGC,EAAS,KAAK,IAAI,CAAC,EACrC,IAAMC,EAAW,IAAI,WAAWF,CAAgB,EAE1CG,EAAQ,IAAI,WAAW,CAAC,GAAGD,EAAU,GAAG,KAAK,IAAI,CAAC,EAGlDE,EADSC,EAAaF,CAAK,EACV,MAAM,SAAS,EACtC,GAAI,CAACC,EAEH,MAAM,IAAI,MAEZ,OAAOA,EAAQ,KAAK,GAAG,CACzB,CAEO,UAAQ,CACb,OAAO,KAAK,OAAM,CACpB,CAMO,QAAM,CACX,MAAO,CAAE,CAACzB,CAAkB,EAAG,KAAK,OAAM,CAAE,CAC9C,CAOO,UAAUS,EAAgB,CAC/B,QAASkB,EAAI,EAAGA,EAAI,KAAK,IAAI,KAAK,KAAK,OAAQlB,EAAM,KAAK,MAAM,EAAGkB,IAAK,CACtE,GAAI,KAAK,KAAKA,CAAC,EAAIlB,EAAM,KAAKkB,CAAC,EAAG,MAAO,KACpC,GAAI,KAAK,KAAKA,CAAC,EAAIlB,EAAM,KAAKkB,CAAC,EAAG,MAAO,IAChD,CAEA,OAAI,KAAK,KAAK,OAASlB,EAAM,KAAK,OAAe,KAC7C,KAAK,KAAK,OAASA,EAAM,KAAK,OAAe,KAC1C,IACT,CAOO,KAAKA,EAAgB,CAC1B,IAAMmB,EAAM,KAAK,UAAUnB,CAAK,EAChC,OAAOmB,GAAO,MAAQA,GAAO,IAC/B,CAOO,KAAKnB,EAAgB,CAC1B,IAAMmB,EAAM,KAAK,UAAUnB,CAAK,EAChC,OAAOmB,GAAO,MAAQA,GAAO,IAC/B,GPxKF,UAAYC,MAAO,MCDnB,UAAYA,MAAO,MFGZ,IAAKC,IAAAA,IAEVA,EAAA,cAAgB,gBAEhBA,EAAA,UAAY,YAEZA,EAAA,WAAa,aAEbA,EAAA,IAAM,MARIA,IAAAA,IAAA,CAAA,CAAA,EDSCC,EACV,aAAW,UAAU,EACrB,KAAK,CAAE,GAAA,YAA2B,CAAC,EEEzBC,GACV,SAAO,EACP,OACEC,GAAc,CACb,GAAI,CACF,OAAAC,EAAU,SAASD,CAAS,EACrB,EACT,MAAwB,CACtB,MAAO,EACT,CACF,EACA,CACE,MAAO,gDACT,CACF,EACC,KAAK,CAAE,GAAA,eAA8B,CAAC,EAgB5BE,EACV,SAAkB,EAClB,OAAQF,GAAcC,EAAU,YAAYD,CAAS,EAAG,CACvD,MAAO,qBACP,MAAO,EACT,CAAC,EACA,UAAWG,GAAUF,EAAU,KAAKE,CAAK,CAAC,EAC1C,KAAK,CAAE,GAAA,WAA0B,CAAC,EC3BxBC,GAAkB,CAAC,CAC9B,oBAAAC,EAAsB,CAAC,EACvB,iBAAAC,EAAmB,EACrB,IAII,MAAI,EAAE,OACLC,GAA+B,CAC9B,GAAI,CACF,IAAMC,EAAY,CAAC,GAAG,IAAI,IAAI,CAAC,SAAU,GAAGH,CAAmB,CAAC,CAAC,EAE3D,CAAE,SAAAI,EAAU,SAAAC,CAAS,EAAI,IAAI,IAAIH,CAAG,EAG1C,OAAID,GAAoB,CAAC,YAAa,WAAW,EAAE,SAASI,CAAQ,EAC3D,CAAC,QAAS,GAAGF,CAAS,EAAE,SAASC,CAAQ,EAG3CD,EAAU,SAASC,CAAQ,CACpC,MAAwB,CACtB,MAAO,EACT,CACF,EACA,CACE,MAAO,cACT,CACF,EAUWE,GAAYP,GAAgB,CAAC,CAAC,EAAE,KAAK,CAAE,GAAA,KAAoB,CAAC,EO/DzE,UAAYQ,OAAO,MAEZ,IAAMC,EAAW,CAEtB,UAAW,IAAMC,EAEjB,WAAY,IAAMC,CACpB,EAGM,CAAC,MAAOC,GAAG,GAAGC,EAAI,EAAIL,GAoBfM,EAAI,OAAO,OAAO,CAAC,EAAGD,EAAI,EAEvCC,EAAE,UAAYL,EAAS,UACvBK,EAAE,WAAaL,EAAS",
|
|
6
6
|
"names": ["z", "alphabet", "lookupTable", "i", "base32Encode", "input", "skip", "bits", "output", "encodeByte", "byte", "base32Decode", "o", "decodeChar", "char", "val", "c", "lookUpTable", "getCrc32", "buf", "crc", "i", "t", "isBytes", "a", "abytes", "b", "lengths", "isBytes", "aexists", "instance", "checkFinished", "aoutput", "out", "abytes", "min", "clean", "arrays", "i", "createView", "arr", "rotr", "word", "shift", "hasHexBuiltin", "hexes", "_", "i", "bytesToHex", "bytes", "abytes", "hex", "asciis", "asciiToBase16", "ch", "hexToBytes", "hl", "al", "array", "ai", "hi", "n1", "n2", "char", "utf8ToBytes", "str", "toBytes", "data", "utf8ToBytes", "abytes", "Hash", "createHasher", "hashCons", "hashC", "msg", "toBytes", "tmp", "setBigUint64", "view", "byteOffset", "value", "isLE", "_32n", "_u32_max", "wh", "wl", "h", "l", "Chi", "a", "b", "c", "Maj", "HashMD", "Hash", "blockLen", "outputLen", "padOffset", "createView", "data", "aexists", "toBytes", "abytes", "buffer", "len", "pos", "take", "dataView", "out", "aoutput", "clean", "i", "oview", "outLen", "state", "res", "to", "length", "finished", "destroyed", "SHA256_IV", "SHA224_IV", "SHA256_K", "SHA256_W", "SHA256", "HashMD", "outputLen", "SHA256_IV", "A", "B", "C", "D", "E", "F", "G", "H", "view", "offset", "i", "W15", "W2", "s0", "rotr", "s1", "sigma1", "T1", "Chi", "T2", "Maj", "clean", "SHA224", "SHA224_IV", "sha224", "createHasher", "SHA224", "JSON_KEY_PRINCIPAL", "SELF_AUTHENTICATING_SUFFIX", "ANONYMOUS_SUFFIX", "MANAGEMENT_CANISTER_PRINCIPAL_TEXT_STR", "Principal", "_Principal", "publicKey", "sha", "sha224", "other", "hex", "hexToBytes", "text", "maybePrincipal", "obj", "canisterIdNoDash", "arr", "base32Decode", "principal", "_arr", "bytesToHex", "checksumArrayBuf", "getCrc32", "checksum", "array", "matches", "base32Encode", "i", "cmp", "z", "ZodSchemaId", "Uint8ArraySchema", "PrincipalTextSchema", "principal", "Principal", "PrincipalSchema", "value", "createUrlSchema", "additionalProtocols", "allowHttpLocally", "url", "protocols", "protocol", "hostname", "UrlSchema", "z", "JunoType", "y", "P", "_", "rest", "j"]
|
|
7
7
|
}
|
package/package.json
CHANGED
|
@@ -1,6 +1,6 @@
|
|
|
1
1
|
{
|
|
2
2
|
"name": "@junobuild/schema",
|
|
3
|
-
"version": "1.0.
|
|
3
|
+
"version": "1.0.1-next-2026-03-14",
|
|
4
4
|
"description": "The type system and utilities for validation on Juno",
|
|
5
5
|
"author": "David Dal Busco (https://daviddalbusco.com)",
|
|
6
6
|
"license": "MIT",
|
|
@@ -52,7 +52,7 @@
|
|
|
52
52
|
],
|
|
53
53
|
"homepage": "https://juno.build",
|
|
54
54
|
"peerDependencies": {
|
|
55
|
-
"zod": "
|
|
55
|
+
"zod": "*"
|
|
56
56
|
},
|
|
57
57
|
"dependencies": {
|
|
58
58
|
"@dfinity/zod-schemas": "^3.1"
|
|
@@ -60,4 +60,4 @@
|
|
|
60
60
|
"devDependencies": {
|
|
61
61
|
"@icp-sdk/core": "^5"
|
|
62
62
|
}
|
|
63
|
-
}
|
|
63
|
+
}
|
package/type-system/index.d.ts
CHANGED
|
@@ -23,5 +23,7 @@ export declare const JunoType: {
|
|
|
23
23
|
* name: j.string(),
|
|
24
24
|
* });
|
|
25
25
|
*/
|
|
26
|
-
declare const j: Omit<typeof z, "union"> & typeof JunoType;
|
|
27
|
-
export
|
|
26
|
+
export declare const j: Omit<typeof z, "union"> & typeof JunoType;
|
|
27
|
+
export declare namespace j {
|
|
28
|
+
type infer<T extends z.ZodType> = z.infer<T>;
|
|
29
|
+
}
|
package/utils/idl.d.ts
ADDED
|
@@ -0,0 +1,37 @@
|
|
|
1
|
+
import * as z from 'zod';
|
|
2
|
+
export interface IdlParams {
|
|
3
|
+
schema: z.core.$ZodType;
|
|
4
|
+
value: unknown;
|
|
5
|
+
}
|
|
6
|
+
/**
|
|
7
|
+
* Recursively converts a JavaScript value to its Candid IDL representation,
|
|
8
|
+
* guided by a Zod schema.
|
|
9
|
+
*
|
|
10
|
+
* Discriminated unions are converted from `{ type: "active", owner: ... }` to
|
|
11
|
+
* `{ active: { owner: ... } }` to match the Candid variant shape.
|
|
12
|
+
* Optional and nullable fields are converted from `undefined` or `null` to `[]`,
|
|
13
|
+
* and present values are wrapped in `[value]`. Objects and arrays are processed
|
|
14
|
+
* recursively. Non-nullable primitives and unknown types are passed through as-is.
|
|
15
|
+
*
|
|
16
|
+
* @param {IdlParams} params - The schema and value to convert.
|
|
17
|
+
* @param {z.core.$ZodType} params.schema - The Zod schema describing the value's structure.
|
|
18
|
+
* @param {unknown} params.value - The JavaScript value to convert.
|
|
19
|
+
* @returns {unknown} The value in Candid IDL format.
|
|
20
|
+
*/
|
|
21
|
+
export declare const schemaToIdl: ({ schema, value }: IdlParams) => unknown;
|
|
22
|
+
/**
|
|
23
|
+
* Recursively converts a Candid IDL value back to its JavaScript representation,
|
|
24
|
+
* guided by a Zod schema.
|
|
25
|
+
*
|
|
26
|
+
* Discriminated unions are converted from `{ active: { owner: ... } }` back to
|
|
27
|
+
* `{ type: "active", owner: ... }` to match the Zod discriminated union shape.
|
|
28
|
+
* Optional and nullable fields are converted from `[]` to `undefined` and from
|
|
29
|
+
* `[value]` to `value`. Objects and arrays are processed recursively.
|
|
30
|
+
* Non-nullable primitives and unknown types are passed through as-is.
|
|
31
|
+
*
|
|
32
|
+
* @param {IdlParams} params - The schema and value to convert.
|
|
33
|
+
* @param {z.core.$ZodType} params.schema - The Zod schema describing the value's structure.
|
|
34
|
+
* @param {unknown} params.value - The Candid IDL value to convert.
|
|
35
|
+
* @returns {unknown} The value in JavaScript representation.
|
|
36
|
+
*/
|
|
37
|
+
export declare const schemaFromIdl: ({ schema, value }: IdlParams) => unknown;
|
package/utils.d.ts
CHANGED
|
@@ -1 +1,2 @@
|
|
|
1
|
-
export * from './utils/
|
|
1
|
+
export * from './utils/idl';
|
|
2
|
+
export * from './utils/nullable';
|
package/utils.js
CHANGED
|
@@ -1,2 +1,2 @@
|
|
|
1
|
-
import*as
|
|
1
|
+
import*as r from"zod";var u=({schema:n,value:o})=>{if(n instanceof r.ZodDiscriminatedUnion){let{discriminator:e}=n._zod.def,t=o,i=t[e];if(typeof i!="string")throw new Error(`Expected discriminator field "${e}" to be a string`);let{[e]:a,...s}=t,c=n._zod.def.options.find(f=>f instanceof r.ZodObject&&f._zod.def.shape[e]instanceof r.ZodLiteral&&f._zod.def.shape[e]._zod.def.values.includes(i));return{[i]:c!==void 0?u({schema:c,value:s}):s}}return n instanceof r.ZodOptional||n instanceof r.ZodNullable?o==null?[]:[u({schema:n._zod.def.innerType,value:o})]:n instanceof r.ZodObject?Object.fromEntries(Object.entries(n._zod.def.shape).map(([e,t])=>[e,u({schema:t,value:o[e]})])):n instanceof r.ZodArray?o.map(e=>u({schema:n._zod.def.element,value:e})):o},z=({schema:n,value:o})=>{if(n instanceof r.ZodDiscriminatedUnion){let{discriminator:e}=n._zod.def,t=o,i=Object.keys(t);if(i.length!==1)throw new Error(`Expected exactly one key in variant object, got: ${i.join(", ")}`);let[a]=i,s=t[a];if(typeof s!="object"||s===null)throw new Error(`Expected variant value for "${a}" to be an object`);let c=n._zod.def.options.find(l=>l instanceof r.ZodObject&&l._zod.def.shape[e]instanceof r.ZodLiteral&&l._zod.def.shape[e]._zod.def.values.includes(a));return c!==void 0?z({schema:c,value:{[e]:a,...s}}):{[e]:a,...s}}if(n instanceof r.ZodOptional||n instanceof r.ZodNullable){let e=o;return e.length===0?void 0:z({schema:n._zod.def.innerType,value:e[0]})}return n instanceof r.ZodObject?Object.fromEntries(Object.entries(n._zod.def.shape).map(([e,t])=>[e,z({schema:t,value:o[e]})])):n instanceof r.ZodArray?o.map(e=>z({schema:n._zod.def.element,value:e})):o};import*as d from"zod";var p=({schema:n,value:o})=>n instanceof d.ZodOptional||n instanceof d.ZodNullable?o==null?[]:[p({schema:n._zod.def.innerType,value:o})]:n instanceof d.ZodObject?Object.fromEntries(Object.entries(n._zod.def.shape).map(([e,t])=>[e,p({schema:t,value:o[e]})])):n instanceof d.ZodArray?o.map(e=>p({schema:n._zod.def.element,value:e})):o,b=({schema:n,value:o})=>{if(n instanceof d.ZodOptional||n instanceof d.ZodNullable){let e=o;return e.length===0?void 0:b({schema:n._zod.def.innerType,value:e[0]})}return n instanceof d.ZodObject?Object.fromEntries(Object.entries(n._zod.def.shape).map(([e,t])=>[e,b({schema:t,value:o[e]})])):n instanceof d.ZodArray?o.map(e=>b({schema:n._zod.def.element,value:e})):o};export{b as recursiveFromNullable,p as recursiveToNullable,z as schemaFromIdl,u as schemaToIdl};
|
|
2
2
|
//# sourceMappingURL=utils.js.map
|
package/utils.js.map
CHANGED
|
@@ -1,7 +1,7 @@
|
|
|
1
1
|
{
|
|
2
2
|
"version": 3,
|
|
3
|
-
"sources": ["src/utils/
|
|
4
|
-
"sourcesContent": ["import * as z from 'zod';\n\nexport interface NullableParams {\n schema: z.core.$ZodType;\n value: unknown;\n}\n\n/**\n * Recursively converts a JavaScript value to its Candid nullable representation,\n * guided by a Zod schema.\n *\n * Optional and nullable fields are converted from `undefined` or `null` to `[]`,\n * and present values are wrapped in `[value]`. Objects and arrays are processed\n * recursively. Non-nullable primitives and unknown types are passed through as-is.\n *\n * @param {NullableParams} params - The schema and value to convert.\n * @param {z.core.$ZodType} params.schema - The Zod schema describing the value's structure.\n * @param {unknown} params.value - The JavaScript value to convert.\n * @returns {unknown} The value in Candid nullable format.\n *\n */\nexport const recursiveToNullable = ({schema, value}: NullableParams): unknown => {\n if (schema instanceof z.ZodOptional || schema instanceof z.ZodNullable) {\n return value === undefined || value === null\n ? []\n : [recursiveToNullable({schema: schema._zod.def.innerType, value})];\n }\n\n if (schema instanceof z.ZodObject) {\n return Object.fromEntries(\n Object.entries(schema._zod.def.shape).map(([k, t]) => [\n k,\n recursiveToNullable({\n schema: t as z.core.$ZodType,\n value: (value as Record<string, unknown>)[k]\n })\n ])\n );\n }\n\n if (schema instanceof z.ZodArray) {\n return (value as unknown[]).map((value) =>\n recursiveToNullable({schema: schema._zod.def.element, value})\n );\n }\n\n return value;\n};\n\n/**\n * Recursively converts a Candid nullable value back to its JavaScript representation,\n * guided by a Zod schema.\n *\n * Optional and nullable fields are converted from `[]` to `undefined` and from\n * `[value]` to `value`. Objects and arrays are processed recursively. Non-nullable\n * primitives and unknown types are passed through as-is.\n *\n * @param {NullableParams} params - The schema and value to convert.\n * @param {z.core.$ZodType} params.schema - The Zod schema describing the value's structure.\n * @param {unknown} params.value - The Candid nullable value to convert.\n * @returns {unknown} The value in JavaScript representation.\n *\n */\nexport const recursiveFromNullable = ({schema, value}: NullableParams): unknown => {\n if (schema instanceof z.ZodOptional || schema instanceof z.ZodNullable) {\n const arr = value as [] | [unknown];\n return arr.length === 0\n ? undefined\n : recursiveFromNullable({\n schema: schema._zod.def.innerType,\n value: arr[0]\n });\n }\n\n if (schema instanceof z.ZodObject) {\n return Object.fromEntries(\n Object.entries(schema._zod.def.shape).map(([k, t]) => [\n k,\n recursiveFromNullable({\n schema: t as z.core.$ZodType,\n value: (value as Record<string, unknown>)[k]\n })\n ])\n );\n }\n\n if (schema instanceof z.ZodArray) {\n return (value as unknown[]).map((value) =>\n recursiveFromNullable({\n schema: schema._zod.def.element,\n value\n })\n );\n }\n\n return value;\n};\n"],
|
|
5
|
-
"mappings": "AAAA,UAAYA,MAAO,MAqBZ,IAAMC,EAAsB,CAAC,CAAC,OAAAC,EAAQ,MAAAC,CAAK,IAC5CD,aAAoB,eAAeA,aAAoB,cAC3BC,GAAU,KACpC,CAAC,EACD,CAACF,EAAoB,CAAC,OAAQC,EAAO,KAAK,IAAI,UAAW,MAAAC,CAAK,CAAC,CAAC,EAGlED,aAAoB,YACf,OAAO,YACZ,OAAO,QAAQA,EAAO,KAAK,IAAI,KAAK,EAAE,IAAI,CAAC,CAACE,EAAG,CAAC,IAAM,CACpDA,EACAH,EAAoB,CAClB,OAAQ,EACR,MAAQE,EAAkCC,CAAC,CAC7C,CAAC,CACH,CAAC,CACH,EAGEF,aAAoB,WACdC,EAAoB,IAAKA,GAC/BF,EAAoB,CAAC,OAAQC,EAAO,KAAK,IAAI,QAAS,MAAAC,CAAK,CAAC,CAC9D,EAGKA,EAiBIE,EAAwB,CAAC,CAAC,OAAAH,EAAQ,MAAAC,CAAK,IAA+B,CACjF,GAAID,aAAoB,eAAeA,aAAoB,cAAa,CACtE,IAAMI,EAAMH,EACZ,OAAOG,EAAI,SAAW,EAClB,OACAD,EAAsB,CACpB,OAAQH,EAAO,KAAK,IAAI,UACxB,MAAOI,EAAI,CAAC,CACd,CAAC,CACP,CAEA,OAAIJ,aAAoB,YACf,OAAO,YACZ,OAAO,QAAQA,EAAO,KAAK,IAAI,KAAK,EAAE,IAAI,CAAC,CAACE,EAAG,CAAC,IAAM,CACpDA,EACAC,EAAsB,CACpB,OAAQ,EACR,MAAQF,EAAkCC,CAAC,CAC7C,CAAC,CACH,CAAC,CACH,EAGEF,aAAoB,WACdC,EAAoB,IAAKA,GAC/BE,EAAsB,CACpB,OAAQH,EAAO,KAAK,IAAI,QACxB,MAAAC,CACF,CAAC,CACH,EAGKA,CACT",
|
|
6
|
-
"names": ["z", "recursiveToNullable", "schema", "value", "k", "recursiveFromNullable", "arr"]
|
|
3
|
+
"sources": ["src/utils/idl.ts", "src/utils/nullable.ts"],
|
|
4
|
+
"sourcesContent": ["import * as z from 'zod';\n\nexport interface IdlParams {\n schema: z.core.$ZodType;\n value: unknown;\n}\n\n/**\n * Recursively converts a JavaScript value to its Candid IDL representation,\n * guided by a Zod schema.\n *\n * Discriminated unions are converted from `{ type: \"active\", owner: ... }` to\n * `{ active: { owner: ... } }` to match the Candid variant shape.\n * Optional and nullable fields are converted from `undefined` or `null` to `[]`,\n * and present values are wrapped in `[value]`. Objects and arrays are processed\n * recursively. Non-nullable primitives and unknown types are passed through as-is.\n *\n * @param {IdlParams} params - The schema and value to convert.\n * @param {z.core.$ZodType} params.schema - The Zod schema describing the value's structure.\n * @param {unknown} params.value - The JavaScript value to convert.\n * @returns {unknown} The value in Candid IDL format.\n */\nexport const schemaToIdl = ({schema, value}: IdlParams): unknown => {\n if (schema instanceof z.ZodDiscriminatedUnion) {\n const {discriminator} = schema._zod.def;\n const obj = value as Record<string, unknown>;\n const tag = obj[discriminator];\n\n if (typeof tag !== 'string') {\n throw new Error(`Expected discriminator field \"${discriminator}\" to be a string`);\n }\n\n const {[discriminator]: _, ...rest} = obj;\n\n const variantSchema = schema._zod.def.options.find(\n (o: z.core.$ZodType) =>\n o instanceof z.ZodObject &&\n o._zod.def.shape[discriminator] instanceof z.ZodLiteral &&\n o._zod.def.shape[discriminator]._zod.def.values.includes(tag)\n );\n\n return {\n [tag]: variantSchema !== undefined ? schemaToIdl({schema: variantSchema, value: rest}) : rest\n };\n }\n\n if (schema instanceof z.ZodOptional || schema instanceof z.ZodNullable) {\n return value === undefined || value === null\n ? []\n : [schemaToIdl({schema: schema._zod.def.innerType, value})];\n }\n\n if (schema instanceof z.ZodObject) {\n return Object.fromEntries(\n Object.entries(schema._zod.def.shape).map(([k, t]) => [\n k,\n schemaToIdl({schema: t as z.core.$ZodType, value: (value as Record<string, unknown>)[k]})\n ])\n );\n }\n\n if (schema instanceof z.ZodArray) {\n return (value as unknown[]).map((v) =>\n schemaToIdl({schema: schema._zod.def.element, value: v})\n );\n }\n\n return value;\n};\n\n/**\n * Recursively converts a Candid IDL value back to its JavaScript representation,\n * guided by a Zod schema.\n *\n * Discriminated unions are converted from `{ active: { owner: ... } }` back to\n * `{ type: \"active\", owner: ... }` to match the Zod discriminated union shape.\n * Optional and nullable fields are converted from `[]` to `undefined` and from\n * `[value]` to `value`. Objects and arrays are processed recursively.\n * Non-nullable primitives and unknown types are passed through as-is.\n *\n * @param {IdlParams} params - The schema and value to convert.\n * @param {z.core.$ZodType} params.schema - The Zod schema describing the value's structure.\n * @param {unknown} params.value - The Candid IDL value to convert.\n * @returns {unknown} The value in JavaScript representation.\n */\nexport const schemaFromIdl = ({schema, value}: IdlParams): unknown => {\n if (schema instanceof z.ZodDiscriminatedUnion) {\n const {discriminator} = schema._zod.def;\n const obj = value as Record<string, unknown>;\n const keys = Object.keys(obj);\n\n if (keys.length !== 1) {\n throw new Error(`Expected exactly one key in variant object, got: ${keys.join(', ')}`);\n }\n\n const [tag] = keys;\n const inner = obj[tag];\n\n if (typeof inner !== 'object' || inner === null) {\n throw new Error(`Expected variant value for \"${tag}\" to be an object`);\n }\n\n const variantSchema = schema._zod.def.options.find(\n (o: z.core.$ZodType) =>\n o instanceof z.ZodObject &&\n o._zod.def.shape[discriminator] instanceof z.ZodLiteral &&\n o._zod.def.shape[discriminator]._zod.def.values.includes(tag)\n );\n\n const reconstructed =\n variantSchema !== undefined\n ? (schemaFromIdl({\n schema: variantSchema,\n value: {[discriminator]: tag, ...(inner as Record<string, unknown>)}\n }) as Record<string, unknown>)\n : {[discriminator]: tag, ...(inner as Record<string, unknown>)};\n\n return reconstructed;\n }\n\n if (schema instanceof z.ZodOptional || schema instanceof z.ZodNullable) {\n const arr = value as [] | [unknown];\n return arr.length === 0\n ? undefined\n : schemaFromIdl({schema: schema._zod.def.innerType, value: arr[0]});\n }\n\n if (schema instanceof z.ZodObject) {\n return Object.fromEntries(\n Object.entries(schema._zod.def.shape).map(([k, t]) => [\n k,\n schemaFromIdl({schema: t as z.core.$ZodType, value: (value as Record<string, unknown>)[k]})\n ])\n );\n }\n\n if (schema instanceof z.ZodArray) {\n return (value as unknown[]).map((v) =>\n schemaFromIdl({schema: schema._zod.def.element, value: v})\n );\n }\n\n return value;\n};\n", "import * as z from 'zod';\n\nexport interface NullableParams {\n schema: z.core.$ZodType;\n value: unknown;\n}\n\n/**\n * Recursively converts a JavaScript value to its Candid nullable representation,\n * guided by a Zod schema.\n *\n * Optional and nullable fields are converted from `undefined` or `null` to `[]`,\n * and present values are wrapped in `[value]`. Objects and arrays are processed\n * recursively. Non-nullable primitives and unknown types are passed through as-is.\n *\n * @param {NullableParams} params - The schema and value to convert.\n * @param {z.core.$ZodType} params.schema - The Zod schema describing the value's structure.\n * @param {unknown} params.value - The JavaScript value to convert.\n * @returns {unknown} The value in Candid nullable format.\n *\n */\nexport const recursiveToNullable = ({schema, value}: NullableParams): unknown => {\n if (schema instanceof z.ZodOptional || schema instanceof z.ZodNullable) {\n return value === undefined || value === null\n ? []\n : [recursiveToNullable({schema: schema._zod.def.innerType, value})];\n }\n\n if (schema instanceof z.ZodObject) {\n return Object.fromEntries(\n Object.entries(schema._zod.def.shape).map(([k, t]) => [\n k,\n recursiveToNullable({\n schema: t as z.core.$ZodType,\n value: (value as Record<string, unknown>)[k]\n })\n ])\n );\n }\n\n if (schema instanceof z.ZodArray) {\n return (value as unknown[]).map((value) =>\n recursiveToNullable({schema: schema._zod.def.element, value})\n );\n }\n\n return value;\n};\n\n/**\n * Recursively converts a Candid nullable value back to its JavaScript representation,\n * guided by a Zod schema.\n *\n * Optional and nullable fields are converted from `[]` to `undefined` and from\n * `[value]` to `value`. Objects and arrays are processed recursively. Non-nullable\n * primitives and unknown types are passed through as-is.\n *\n * @param {NullableParams} params - The schema and value to convert.\n * @param {z.core.$ZodType} params.schema - The Zod schema describing the value's structure.\n * @param {unknown} params.value - The Candid nullable value to convert.\n * @returns {unknown} The value in JavaScript representation.\n *\n */\nexport const recursiveFromNullable = ({schema, value}: NullableParams): unknown => {\n if (schema instanceof z.ZodOptional || schema instanceof z.ZodNullable) {\n const arr = value as [] | [unknown];\n return arr.length === 0\n ? undefined\n : recursiveFromNullable({\n schema: schema._zod.def.innerType,\n value: arr[0]\n });\n }\n\n if (schema instanceof z.ZodObject) {\n return Object.fromEntries(\n Object.entries(schema._zod.def.shape).map(([k, t]) => [\n k,\n recursiveFromNullable({\n schema: t as z.core.$ZodType,\n value: (value as Record<string, unknown>)[k]\n })\n ])\n );\n }\n\n if (schema instanceof z.ZodArray) {\n return (value as unknown[]).map((value) =>\n recursiveFromNullable({\n schema: schema._zod.def.element,\n value\n })\n );\n }\n\n return value;\n};\n"],
|
|
5
|
+
"mappings": "AAAA,UAAYA,MAAO,MAsBZ,IAAMC,EAAc,CAAC,CAAC,OAAAC,EAAQ,MAAAC,CAAK,IAA0B,CAClE,GAAID,aAAoB,wBAAuB,CAC7C,GAAM,CAAC,cAAAE,CAAa,EAAIF,EAAO,KAAK,IAC9BG,EAAMF,EACNG,EAAMD,EAAID,CAAa,EAE7B,GAAI,OAAOE,GAAQ,SACjB,MAAM,IAAI,MAAM,iCAAiCF,CAAa,kBAAkB,EAGlF,GAAM,CAAC,CAACA,CAAa,EAAGG,EAAG,GAAGC,CAAI,EAAIH,EAEhCI,EAAgBP,EAAO,KAAK,IAAI,QAAQ,KAC3CQ,GACCA,aAAe,aACfA,EAAE,KAAK,IAAI,MAAMN,CAAa,YAAe,cAC7CM,EAAE,KAAK,IAAI,MAAMN,CAAa,EAAE,KAAK,IAAI,OAAO,SAASE,CAAG,CAChE,EAEA,MAAO,CACL,CAACA,CAAG,EAAGG,IAAkB,OAAYR,EAAY,CAAC,OAAQQ,EAAe,MAAOD,CAAI,CAAC,EAAIA,CAC3F,CACF,CAEA,OAAIN,aAAoB,eAAeA,aAAoB,cAC3BC,GAAU,KACpC,CAAC,EACD,CAACF,EAAY,CAAC,OAAQC,EAAO,KAAK,IAAI,UAAW,MAAAC,CAAK,CAAC,CAAC,EAG1DD,aAAoB,YACf,OAAO,YACZ,OAAO,QAAQA,EAAO,KAAK,IAAI,KAAK,EAAE,IAAI,CAAC,CAACS,EAAG,CAAC,IAAM,CACpDA,EACAV,EAAY,CAAC,OAAQ,EAAsB,MAAQE,EAAkCQ,CAAC,CAAC,CAAC,CAC1F,CAAC,CACH,EAGET,aAAoB,WACdC,EAAoB,IAAKS,GAC/BX,EAAY,CAAC,OAAQC,EAAO,KAAK,IAAI,QAAS,MAAOU,CAAC,CAAC,CACzD,EAGKT,CACT,EAiBaU,EAAgB,CAAC,CAAC,OAAAX,EAAQ,MAAAC,CAAK,IAA0B,CACpE,GAAID,aAAoB,wBAAuB,CAC7C,GAAM,CAAC,cAAAE,CAAa,EAAIF,EAAO,KAAK,IAC9BG,EAAMF,EACNW,EAAO,OAAO,KAAKT,CAAG,EAE5B,GAAIS,EAAK,SAAW,EAClB,MAAM,IAAI,MAAM,oDAAoDA,EAAK,KAAK,IAAI,CAAC,EAAE,EAGvF,GAAM,CAACR,CAAG,EAAIQ,EACRC,EAAQV,EAAIC,CAAG,EAErB,GAAI,OAAOS,GAAU,UAAYA,IAAU,KACzC,MAAM,IAAI,MAAM,+BAA+BT,CAAG,mBAAmB,EAGvE,IAAMG,EAAgBP,EAAO,KAAK,IAAI,QAAQ,KAC3CQ,GACCA,aAAe,aACfA,EAAE,KAAK,IAAI,MAAMN,CAAa,YAAe,cAC7CM,EAAE,KAAK,IAAI,MAAMN,CAAa,EAAE,KAAK,IAAI,OAAO,SAASE,CAAG,CAChE,EAUA,OAPEG,IAAkB,OACbI,EAAc,CACb,OAAQJ,EACR,MAAO,CAAC,CAACL,CAAa,EAAGE,EAAK,GAAIS,CAAiC,CACrE,CAAC,EACD,CAAC,CAACX,CAAa,EAAGE,EAAK,GAAIS,CAAiC,CAGpE,CAEA,GAAIb,aAAoB,eAAeA,aAAoB,cAAa,CACtE,IAAMc,EAAMb,EACZ,OAAOa,EAAI,SAAW,EAClB,OACAH,EAAc,CAAC,OAAQX,EAAO,KAAK,IAAI,UAAW,MAAOc,EAAI,CAAC,CAAC,CAAC,CACtE,CAEA,OAAId,aAAoB,YACf,OAAO,YACZ,OAAO,QAAQA,EAAO,KAAK,IAAI,KAAK,EAAE,IAAI,CAAC,CAACS,EAAG,CAAC,IAAM,CACpDA,EACAE,EAAc,CAAC,OAAQ,EAAsB,MAAQV,EAAkCQ,CAAC,CAAC,CAAC,CAC5F,CAAC,CACH,EAGET,aAAoB,WACdC,EAAoB,IAAKS,GAC/BC,EAAc,CAAC,OAAQX,EAAO,KAAK,IAAI,QAAS,MAAOU,CAAC,CAAC,CAC3D,EAGKT,CACT,EC/IA,UAAYc,MAAO,MAqBZ,IAAMC,EAAsB,CAAC,CAAC,OAAAC,EAAQ,MAAAC,CAAK,IAC5CD,aAAoB,eAAeA,aAAoB,cAC3BC,GAAU,KACpC,CAAC,EACD,CAACF,EAAoB,CAAC,OAAQC,EAAO,KAAK,IAAI,UAAW,MAAAC,CAAK,CAAC,CAAC,EAGlED,aAAoB,YACf,OAAO,YACZ,OAAO,QAAQA,EAAO,KAAK,IAAI,KAAK,EAAE,IAAI,CAAC,CAACE,EAAG,CAAC,IAAM,CACpDA,EACAH,EAAoB,CAClB,OAAQ,EACR,MAAQE,EAAkCC,CAAC,CAC7C,CAAC,CACH,CAAC,CACH,EAGEF,aAAoB,WACdC,EAAoB,IAAKA,GAC/BF,EAAoB,CAAC,OAAQC,EAAO,KAAK,IAAI,QAAS,MAAAC,CAAK,CAAC,CAC9D,EAGKA,EAiBIE,EAAwB,CAAC,CAAC,OAAAH,EAAQ,MAAAC,CAAK,IAA+B,CACjF,GAAID,aAAoB,eAAeA,aAAoB,cAAa,CACtE,IAAMI,EAAMH,EACZ,OAAOG,EAAI,SAAW,EAClB,OACAD,EAAsB,CACpB,OAAQH,EAAO,KAAK,IAAI,UACxB,MAAOI,EAAI,CAAC,CACd,CAAC,CACP,CAEA,OAAIJ,aAAoB,YACf,OAAO,YACZ,OAAO,QAAQA,EAAO,KAAK,IAAI,KAAK,EAAE,IAAI,CAAC,CAACE,EAAG,CAAC,IAAM,CACpDA,EACAC,EAAsB,CACpB,OAAQ,EACR,MAAQF,EAAkCC,CAAC,CAC7C,CAAC,CACH,CAAC,CACH,EAGEF,aAAoB,WACdC,EAAoB,IAAKA,GAC/BE,EAAsB,CACpB,OAAQH,EAAO,KAAK,IAAI,QACxB,MAAAC,CACF,CAAC,CACH,EAGKA,CACT",
|
|
6
|
+
"names": ["z", "schemaToIdl", "schema", "value", "discriminator", "obj", "tag", "_", "rest", "variantSchema", "o", "k", "v", "schemaFromIdl", "keys", "inner", "arr", "z", "recursiveToNullable", "schema", "value", "k", "recursiveFromNullable", "arr"]
|
|
7
7
|
}
|
package/utils.mjs
CHANGED
|
@@ -1,4 +1,4 @@
|
|
|
1
1
|
import { createRequire as topLevelCreateRequire } from 'module';
|
|
2
2
|
const require = topLevelCreateRequire(import.meta.url);
|
|
3
|
-
import*as
|
|
3
|
+
import*as r from"zod";var u=({schema:n,value:o})=>{if(n instanceof r.ZodDiscriminatedUnion){let{discriminator:e}=n._zod.def,t=o,i=t[e];if(typeof i!="string")throw new Error(`Expected discriminator field "${e}" to be a string`);let{[e]:a,...s}=t,c=n._zod.def.options.find(f=>f instanceof r.ZodObject&&f._zod.def.shape[e]instanceof r.ZodLiteral&&f._zod.def.shape[e]._zod.def.values.includes(i));return{[i]:c!==void 0?u({schema:c,value:s}):s}}return n instanceof r.ZodOptional||n instanceof r.ZodNullable?o==null?[]:[u({schema:n._zod.def.innerType,value:o})]:n instanceof r.ZodObject?Object.fromEntries(Object.entries(n._zod.def.shape).map(([e,t])=>[e,u({schema:t,value:o[e]})])):n instanceof r.ZodArray?o.map(e=>u({schema:n._zod.def.element,value:e})):o},z=({schema:n,value:o})=>{if(n instanceof r.ZodDiscriminatedUnion){let{discriminator:e}=n._zod.def,t=o,i=Object.keys(t);if(i.length!==1)throw new Error(`Expected exactly one key in variant object, got: ${i.join(", ")}`);let[a]=i,s=t[a];if(typeof s!="object"||s===null)throw new Error(`Expected variant value for "${a}" to be an object`);let c=n._zod.def.options.find(l=>l instanceof r.ZodObject&&l._zod.def.shape[e]instanceof r.ZodLiteral&&l._zod.def.shape[e]._zod.def.values.includes(a));return c!==void 0?z({schema:c,value:{[e]:a,...s}}):{[e]:a,...s}}if(n instanceof r.ZodOptional||n instanceof r.ZodNullable){let e=o;return e.length===0?void 0:z({schema:n._zod.def.innerType,value:e[0]})}return n instanceof r.ZodObject?Object.fromEntries(Object.entries(n._zod.def.shape).map(([e,t])=>[e,z({schema:t,value:o[e]})])):n instanceof r.ZodArray?o.map(e=>z({schema:n._zod.def.element,value:e})):o};import*as d from"zod";var p=({schema:n,value:o})=>n instanceof d.ZodOptional||n instanceof d.ZodNullable?o==null?[]:[p({schema:n._zod.def.innerType,value:o})]:n instanceof d.ZodObject?Object.fromEntries(Object.entries(n._zod.def.shape).map(([e,t])=>[e,p({schema:t,value:o[e]})])):n instanceof d.ZodArray?o.map(e=>p({schema:n._zod.def.element,value:e})):o,b=({schema:n,value:o})=>{if(n instanceof d.ZodOptional||n instanceof d.ZodNullable){let e=o;return e.length===0?void 0:b({schema:n._zod.def.innerType,value:e[0]})}return n instanceof d.ZodObject?Object.fromEntries(Object.entries(n._zod.def.shape).map(([e,t])=>[e,b({schema:t,value:o[e]})])):n instanceof d.ZodArray?o.map(e=>b({schema:n._zod.def.element,value:e})):o};export{b as recursiveFromNullable,p as recursiveToNullable,z as schemaFromIdl,u as schemaToIdl};
|
|
4
4
|
//# sourceMappingURL=utils.mjs.map
|
package/utils.mjs.map
CHANGED
|
@@ -1,7 +1,7 @@
|
|
|
1
1
|
{
|
|
2
2
|
"version": 3,
|
|
3
|
-
"sources": ["src/utils/
|
|
4
|
-
"sourcesContent": ["import * as z from 'zod';\n\nexport interface NullableParams {\n schema: z.core.$ZodType;\n value: unknown;\n}\n\n/**\n * Recursively converts a JavaScript value to its Candid nullable representation,\n * guided by a Zod schema.\n *\n * Optional and nullable fields are converted from `undefined` or `null` to `[]`,\n * and present values are wrapped in `[value]`. Objects and arrays are processed\n * recursively. Non-nullable primitives and unknown types are passed through as-is.\n *\n * @param {NullableParams} params - The schema and value to convert.\n * @param {z.core.$ZodType} params.schema - The Zod schema describing the value's structure.\n * @param {unknown} params.value - The JavaScript value to convert.\n * @returns {unknown} The value in Candid nullable format.\n *\n */\nexport const recursiveToNullable = ({schema, value}: NullableParams): unknown => {\n if (schema instanceof z.ZodOptional || schema instanceof z.ZodNullable) {\n return value === undefined || value === null\n ? []\n : [recursiveToNullable({schema: schema._zod.def.innerType, value})];\n }\n\n if (schema instanceof z.ZodObject) {\n return Object.fromEntries(\n Object.entries(schema._zod.def.shape).map(([k, t]) => [\n k,\n recursiveToNullable({\n schema: t as z.core.$ZodType,\n value: (value as Record<string, unknown>)[k]\n })\n ])\n );\n }\n\n if (schema instanceof z.ZodArray) {\n return (value as unknown[]).map((value) =>\n recursiveToNullable({schema: schema._zod.def.element, value})\n );\n }\n\n return value;\n};\n\n/**\n * Recursively converts a Candid nullable value back to its JavaScript representation,\n * guided by a Zod schema.\n *\n * Optional and nullable fields are converted from `[]` to `undefined` and from\n * `[value]` to `value`. Objects and arrays are processed recursively. Non-nullable\n * primitives and unknown types are passed through as-is.\n *\n * @param {NullableParams} params - The schema and value to convert.\n * @param {z.core.$ZodType} params.schema - The Zod schema describing the value's structure.\n * @param {unknown} params.value - The Candid nullable value to convert.\n * @returns {unknown} The value in JavaScript representation.\n *\n */\nexport const recursiveFromNullable = ({schema, value}: NullableParams): unknown => {\n if (schema instanceof z.ZodOptional || schema instanceof z.ZodNullable) {\n const arr = value as [] | [unknown];\n return arr.length === 0\n ? undefined\n : recursiveFromNullable({\n schema: schema._zod.def.innerType,\n value: arr[0]\n });\n }\n\n if (schema instanceof z.ZodObject) {\n return Object.fromEntries(\n Object.entries(schema._zod.def.shape).map(([k, t]) => [\n k,\n recursiveFromNullable({\n schema: t as z.core.$ZodType,\n value: (value as Record<string, unknown>)[k]\n })\n ])\n );\n }\n\n if (schema instanceof z.ZodArray) {\n return (value as unknown[]).map((value) =>\n recursiveFromNullable({\n schema: schema._zod.def.element,\n value\n })\n );\n }\n\n return value;\n};\n"],
|
|
5
|
-
"mappings": ";;AAAA,UAAYA,MAAO,MAqBZ,IAAMC,EAAsB,CAAC,CAAC,OAAAC,EAAQ,MAAAC,CAAK,IAC5CD,aAAoB,eAAeA,aAAoB,cAC3BC,GAAU,KACpC,CAAC,EACD,CAACF,EAAoB,CAAC,OAAQC,EAAO,KAAK,IAAI,UAAW,MAAAC,CAAK,CAAC,CAAC,EAGlED,aAAoB,YACf,OAAO,YACZ,OAAO,QAAQA,EAAO,KAAK,IAAI,KAAK,EAAE,IAAI,CAAC,CAACE,EAAG,CAAC,IAAM,CACpDA,EACAH,EAAoB,CAClB,OAAQ,EACR,MAAQE,EAAkCC,CAAC,CAC7C,CAAC,CACH,CAAC,CACH,EAGEF,aAAoB,WACdC,EAAoB,IAAKA,GAC/BF,EAAoB,CAAC,OAAQC,EAAO,KAAK,IAAI,QAAS,MAAAC,CAAK,CAAC,CAC9D,EAGKA,EAiBIE,EAAwB,CAAC,CAAC,OAAAH,EAAQ,MAAAC,CAAK,IAA+B,CACjF,GAAID,aAAoB,eAAeA,aAAoB,cAAa,CACtE,IAAMI,EAAMH,EACZ,OAAOG,EAAI,SAAW,EAClB,OACAD,EAAsB,CACpB,OAAQH,EAAO,KAAK,IAAI,UACxB,MAAOI,EAAI,CAAC,CACd,CAAC,CACP,CAEA,OAAIJ,aAAoB,YACf,OAAO,YACZ,OAAO,QAAQA,EAAO,KAAK,IAAI,KAAK,EAAE,IAAI,CAAC,CAACE,EAAG,CAAC,IAAM,CACpDA,EACAC,EAAsB,CACpB,OAAQ,EACR,MAAQF,EAAkCC,CAAC,CAC7C,CAAC,CACH,CAAC,CACH,EAGEF,aAAoB,WACdC,EAAoB,IAAKA,GAC/BE,EAAsB,CACpB,OAAQH,EAAO,KAAK,IAAI,QACxB,MAAAC,CACF,CAAC,CACH,EAGKA,CACT",
|
|
6
|
-
"names": ["z", "recursiveToNullable", "schema", "value", "k", "recursiveFromNullable", "arr"]
|
|
3
|
+
"sources": ["src/utils/idl.ts", "src/utils/nullable.ts"],
|
|
4
|
+
"sourcesContent": ["import * as z from 'zod';\n\nexport interface IdlParams {\n schema: z.core.$ZodType;\n value: unknown;\n}\n\n/**\n * Recursively converts a JavaScript value to its Candid IDL representation,\n * guided by a Zod schema.\n *\n * Discriminated unions are converted from `{ type: \"active\", owner: ... }` to\n * `{ active: { owner: ... } }` to match the Candid variant shape.\n * Optional and nullable fields are converted from `undefined` or `null` to `[]`,\n * and present values are wrapped in `[value]`. Objects and arrays are processed\n * recursively. Non-nullable primitives and unknown types are passed through as-is.\n *\n * @param {IdlParams} params - The schema and value to convert.\n * @param {z.core.$ZodType} params.schema - The Zod schema describing the value's structure.\n * @param {unknown} params.value - The JavaScript value to convert.\n * @returns {unknown} The value in Candid IDL format.\n */\nexport const schemaToIdl = ({schema, value}: IdlParams): unknown => {\n if (schema instanceof z.ZodDiscriminatedUnion) {\n const {discriminator} = schema._zod.def;\n const obj = value as Record<string, unknown>;\n const tag = obj[discriminator];\n\n if (typeof tag !== 'string') {\n throw new Error(`Expected discriminator field \"${discriminator}\" to be a string`);\n }\n\n const {[discriminator]: _, ...rest} = obj;\n\n const variantSchema = schema._zod.def.options.find(\n (o: z.core.$ZodType) =>\n o instanceof z.ZodObject &&\n o._zod.def.shape[discriminator] instanceof z.ZodLiteral &&\n o._zod.def.shape[discriminator]._zod.def.values.includes(tag)\n );\n\n return {\n [tag]: variantSchema !== undefined ? schemaToIdl({schema: variantSchema, value: rest}) : rest\n };\n }\n\n if (schema instanceof z.ZodOptional || schema instanceof z.ZodNullable) {\n return value === undefined || value === null\n ? []\n : [schemaToIdl({schema: schema._zod.def.innerType, value})];\n }\n\n if (schema instanceof z.ZodObject) {\n return Object.fromEntries(\n Object.entries(schema._zod.def.shape).map(([k, t]) => [\n k,\n schemaToIdl({schema: t as z.core.$ZodType, value: (value as Record<string, unknown>)[k]})\n ])\n );\n }\n\n if (schema instanceof z.ZodArray) {\n return (value as unknown[]).map((v) =>\n schemaToIdl({schema: schema._zod.def.element, value: v})\n );\n }\n\n return value;\n};\n\n/**\n * Recursively converts a Candid IDL value back to its JavaScript representation,\n * guided by a Zod schema.\n *\n * Discriminated unions are converted from `{ active: { owner: ... } }` back to\n * `{ type: \"active\", owner: ... }` to match the Zod discriminated union shape.\n * Optional and nullable fields are converted from `[]` to `undefined` and from\n * `[value]` to `value`. Objects and arrays are processed recursively.\n * Non-nullable primitives and unknown types are passed through as-is.\n *\n * @param {IdlParams} params - The schema and value to convert.\n * @param {z.core.$ZodType} params.schema - The Zod schema describing the value's structure.\n * @param {unknown} params.value - The Candid IDL value to convert.\n * @returns {unknown} The value in JavaScript representation.\n */\nexport const schemaFromIdl = ({schema, value}: IdlParams): unknown => {\n if (schema instanceof z.ZodDiscriminatedUnion) {\n const {discriminator} = schema._zod.def;\n const obj = value as Record<string, unknown>;\n const keys = Object.keys(obj);\n\n if (keys.length !== 1) {\n throw new Error(`Expected exactly one key in variant object, got: ${keys.join(', ')}`);\n }\n\n const [tag] = keys;\n const inner = obj[tag];\n\n if (typeof inner !== 'object' || inner === null) {\n throw new Error(`Expected variant value for \"${tag}\" to be an object`);\n }\n\n const variantSchema = schema._zod.def.options.find(\n (o: z.core.$ZodType) =>\n o instanceof z.ZodObject &&\n o._zod.def.shape[discriminator] instanceof z.ZodLiteral &&\n o._zod.def.shape[discriminator]._zod.def.values.includes(tag)\n );\n\n const reconstructed =\n variantSchema !== undefined\n ? (schemaFromIdl({\n schema: variantSchema,\n value: {[discriminator]: tag, ...(inner as Record<string, unknown>)}\n }) as Record<string, unknown>)\n : {[discriminator]: tag, ...(inner as Record<string, unknown>)};\n\n return reconstructed;\n }\n\n if (schema instanceof z.ZodOptional || schema instanceof z.ZodNullable) {\n const arr = value as [] | [unknown];\n return arr.length === 0\n ? undefined\n : schemaFromIdl({schema: schema._zod.def.innerType, value: arr[0]});\n }\n\n if (schema instanceof z.ZodObject) {\n return Object.fromEntries(\n Object.entries(schema._zod.def.shape).map(([k, t]) => [\n k,\n schemaFromIdl({schema: t as z.core.$ZodType, value: (value as Record<string, unknown>)[k]})\n ])\n );\n }\n\n if (schema instanceof z.ZodArray) {\n return (value as unknown[]).map((v) =>\n schemaFromIdl({schema: schema._zod.def.element, value: v})\n );\n }\n\n return value;\n};\n", "import * as z from 'zod';\n\nexport interface NullableParams {\n schema: z.core.$ZodType;\n value: unknown;\n}\n\n/**\n * Recursively converts a JavaScript value to its Candid nullable representation,\n * guided by a Zod schema.\n *\n * Optional and nullable fields are converted from `undefined` or `null` to `[]`,\n * and present values are wrapped in `[value]`. Objects and arrays are processed\n * recursively. Non-nullable primitives and unknown types are passed through as-is.\n *\n * @param {NullableParams} params - The schema and value to convert.\n * @param {z.core.$ZodType} params.schema - The Zod schema describing the value's structure.\n * @param {unknown} params.value - The JavaScript value to convert.\n * @returns {unknown} The value in Candid nullable format.\n *\n */\nexport const recursiveToNullable = ({schema, value}: NullableParams): unknown => {\n if (schema instanceof z.ZodOptional || schema instanceof z.ZodNullable) {\n return value === undefined || value === null\n ? []\n : [recursiveToNullable({schema: schema._zod.def.innerType, value})];\n }\n\n if (schema instanceof z.ZodObject) {\n return Object.fromEntries(\n Object.entries(schema._zod.def.shape).map(([k, t]) => [\n k,\n recursiveToNullable({\n schema: t as z.core.$ZodType,\n value: (value as Record<string, unknown>)[k]\n })\n ])\n );\n }\n\n if (schema instanceof z.ZodArray) {\n return (value as unknown[]).map((value) =>\n recursiveToNullable({schema: schema._zod.def.element, value})\n );\n }\n\n return value;\n};\n\n/**\n * Recursively converts a Candid nullable value back to its JavaScript representation,\n * guided by a Zod schema.\n *\n * Optional and nullable fields are converted from `[]` to `undefined` and from\n * `[value]` to `value`. Objects and arrays are processed recursively. Non-nullable\n * primitives and unknown types are passed through as-is.\n *\n * @param {NullableParams} params - The schema and value to convert.\n * @param {z.core.$ZodType} params.schema - The Zod schema describing the value's structure.\n * @param {unknown} params.value - The Candid nullable value to convert.\n * @returns {unknown} The value in JavaScript representation.\n *\n */\nexport const recursiveFromNullable = ({schema, value}: NullableParams): unknown => {\n if (schema instanceof z.ZodOptional || schema instanceof z.ZodNullable) {\n const arr = value as [] | [unknown];\n return arr.length === 0\n ? undefined\n : recursiveFromNullable({\n schema: schema._zod.def.innerType,\n value: arr[0]\n });\n }\n\n if (schema instanceof z.ZodObject) {\n return Object.fromEntries(\n Object.entries(schema._zod.def.shape).map(([k, t]) => [\n k,\n recursiveFromNullable({\n schema: t as z.core.$ZodType,\n value: (value as Record<string, unknown>)[k]\n })\n ])\n );\n }\n\n if (schema instanceof z.ZodArray) {\n return (value as unknown[]).map((value) =>\n recursiveFromNullable({\n schema: schema._zod.def.element,\n value\n })\n );\n }\n\n return value;\n};\n"],
|
|
5
|
+
"mappings": ";;AAAA,UAAYA,MAAO,MAsBZ,IAAMC,EAAc,CAAC,CAAC,OAAAC,EAAQ,MAAAC,CAAK,IAA0B,CAClE,GAAID,aAAoB,wBAAuB,CAC7C,GAAM,CAAC,cAAAE,CAAa,EAAIF,EAAO,KAAK,IAC9BG,EAAMF,EACNG,EAAMD,EAAID,CAAa,EAE7B,GAAI,OAAOE,GAAQ,SACjB,MAAM,IAAI,MAAM,iCAAiCF,CAAa,kBAAkB,EAGlF,GAAM,CAAC,CAACA,CAAa,EAAGG,EAAG,GAAGC,CAAI,EAAIH,EAEhCI,EAAgBP,EAAO,KAAK,IAAI,QAAQ,KAC3CQ,GACCA,aAAe,aACfA,EAAE,KAAK,IAAI,MAAMN,CAAa,YAAe,cAC7CM,EAAE,KAAK,IAAI,MAAMN,CAAa,EAAE,KAAK,IAAI,OAAO,SAASE,CAAG,CAChE,EAEA,MAAO,CACL,CAACA,CAAG,EAAGG,IAAkB,OAAYR,EAAY,CAAC,OAAQQ,EAAe,MAAOD,CAAI,CAAC,EAAIA,CAC3F,CACF,CAEA,OAAIN,aAAoB,eAAeA,aAAoB,cAC3BC,GAAU,KACpC,CAAC,EACD,CAACF,EAAY,CAAC,OAAQC,EAAO,KAAK,IAAI,UAAW,MAAAC,CAAK,CAAC,CAAC,EAG1DD,aAAoB,YACf,OAAO,YACZ,OAAO,QAAQA,EAAO,KAAK,IAAI,KAAK,EAAE,IAAI,CAAC,CAACS,EAAG,CAAC,IAAM,CACpDA,EACAV,EAAY,CAAC,OAAQ,EAAsB,MAAQE,EAAkCQ,CAAC,CAAC,CAAC,CAC1F,CAAC,CACH,EAGET,aAAoB,WACdC,EAAoB,IAAKS,GAC/BX,EAAY,CAAC,OAAQC,EAAO,KAAK,IAAI,QAAS,MAAOU,CAAC,CAAC,CACzD,EAGKT,CACT,EAiBaU,EAAgB,CAAC,CAAC,OAAAX,EAAQ,MAAAC,CAAK,IAA0B,CACpE,GAAID,aAAoB,wBAAuB,CAC7C,GAAM,CAAC,cAAAE,CAAa,EAAIF,EAAO,KAAK,IAC9BG,EAAMF,EACNW,EAAO,OAAO,KAAKT,CAAG,EAE5B,GAAIS,EAAK,SAAW,EAClB,MAAM,IAAI,MAAM,oDAAoDA,EAAK,KAAK,IAAI,CAAC,EAAE,EAGvF,GAAM,CAACR,CAAG,EAAIQ,EACRC,EAAQV,EAAIC,CAAG,EAErB,GAAI,OAAOS,GAAU,UAAYA,IAAU,KACzC,MAAM,IAAI,MAAM,+BAA+BT,CAAG,mBAAmB,EAGvE,IAAMG,EAAgBP,EAAO,KAAK,IAAI,QAAQ,KAC3CQ,GACCA,aAAe,aACfA,EAAE,KAAK,IAAI,MAAMN,CAAa,YAAe,cAC7CM,EAAE,KAAK,IAAI,MAAMN,CAAa,EAAE,KAAK,IAAI,OAAO,SAASE,CAAG,CAChE,EAUA,OAPEG,IAAkB,OACbI,EAAc,CACb,OAAQJ,EACR,MAAO,CAAC,CAACL,CAAa,EAAGE,EAAK,GAAIS,CAAiC,CACrE,CAAC,EACD,CAAC,CAACX,CAAa,EAAGE,EAAK,GAAIS,CAAiC,CAGpE,CAEA,GAAIb,aAAoB,eAAeA,aAAoB,cAAa,CACtE,IAAMc,EAAMb,EACZ,OAAOa,EAAI,SAAW,EAClB,OACAH,EAAc,CAAC,OAAQX,EAAO,KAAK,IAAI,UAAW,MAAOc,EAAI,CAAC,CAAC,CAAC,CACtE,CAEA,OAAId,aAAoB,YACf,OAAO,YACZ,OAAO,QAAQA,EAAO,KAAK,IAAI,KAAK,EAAE,IAAI,CAAC,CAACS,EAAG,CAAC,IAAM,CACpDA,EACAE,EAAc,CAAC,OAAQ,EAAsB,MAAQV,EAAkCQ,CAAC,CAAC,CAAC,CAC5F,CAAC,CACH,EAGET,aAAoB,WACdC,EAAoB,IAAKS,GAC/BC,EAAc,CAAC,OAAQX,EAAO,KAAK,IAAI,QAAS,MAAOU,CAAC,CAAC,CAC3D,EAGKT,CACT,EC/IA,UAAYc,MAAO,MAqBZ,IAAMC,EAAsB,CAAC,CAAC,OAAAC,EAAQ,MAAAC,CAAK,IAC5CD,aAAoB,eAAeA,aAAoB,cAC3BC,GAAU,KACpC,CAAC,EACD,CAACF,EAAoB,CAAC,OAAQC,EAAO,KAAK,IAAI,UAAW,MAAAC,CAAK,CAAC,CAAC,EAGlED,aAAoB,YACf,OAAO,YACZ,OAAO,QAAQA,EAAO,KAAK,IAAI,KAAK,EAAE,IAAI,CAAC,CAACE,EAAG,CAAC,IAAM,CACpDA,EACAH,EAAoB,CAClB,OAAQ,EACR,MAAQE,EAAkCC,CAAC,CAC7C,CAAC,CACH,CAAC,CACH,EAGEF,aAAoB,WACdC,EAAoB,IAAKA,GAC/BF,EAAoB,CAAC,OAAQC,EAAO,KAAK,IAAI,QAAS,MAAAC,CAAK,CAAC,CAC9D,EAGKA,EAiBIE,EAAwB,CAAC,CAAC,OAAAH,EAAQ,MAAAC,CAAK,IAA+B,CACjF,GAAID,aAAoB,eAAeA,aAAoB,cAAa,CACtE,IAAMI,EAAMH,EACZ,OAAOG,EAAI,SAAW,EAClB,OACAD,EAAsB,CACpB,OAAQH,EAAO,KAAK,IAAI,UACxB,MAAOI,EAAI,CAAC,CACd,CAAC,CACP,CAEA,OAAIJ,aAAoB,YACf,OAAO,YACZ,OAAO,QAAQA,EAAO,KAAK,IAAI,KAAK,EAAE,IAAI,CAAC,CAACE,EAAG,CAAC,IAAM,CACpDA,EACAC,EAAsB,CACpB,OAAQ,EACR,MAAQF,EAAkCC,CAAC,CAC7C,CAAC,CACH,CAAC,CACH,EAGEF,aAAoB,WACdC,EAAoB,IAAKA,GAC/BE,EAAsB,CACpB,OAAQH,EAAO,KAAK,IAAI,QACxB,MAAAC,CACF,CAAC,CACH,EAGKA,CACT",
|
|
6
|
+
"names": ["z", "schemaToIdl", "schema", "value", "discriminator", "obj", "tag", "_", "rest", "variantSchema", "o", "k", "v", "schemaFromIdl", "keys", "inner", "arr", "z", "recursiveToNullable", "schema", "value", "k", "recursiveFromNullable", "arr"]
|
|
7
7
|
}
|
package/LICENSE
DELETED
|
@@ -1,21 +0,0 @@
|
|
|
1
|
-
MIT License
|
|
2
|
-
|
|
3
|
-
Copyright (c) 2026 David Dal Busco
|
|
4
|
-
|
|
5
|
-
Permission is hereby granted, free of charge, to any person obtaining a copy
|
|
6
|
-
of this software and associated documentation files (the "Software"), to deal
|
|
7
|
-
in the Software without restriction, including without limitation the rights
|
|
8
|
-
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
|
9
|
-
copies of the Software, and to permit persons to whom the Software is
|
|
10
|
-
furnished to do so, subject to the following conditions:
|
|
11
|
-
|
|
12
|
-
The above copyright notice and this permission notice shall be included in all
|
|
13
|
-
copies or substantial portions of the Software.
|
|
14
|
-
|
|
15
|
-
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
|
16
|
-
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
|
17
|
-
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
|
18
|
-
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
|
19
|
-
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
|
20
|
-
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
|
|
21
|
-
SOFTWARE.
|
|
File without changes
|