@exabugs/dynamodb-client 0.4.0 → 0.5.0

package/dist/server/handler.cjs

@@ -1,5 +1,5 @@
-// @exabugs/dynamodb-client v0.4.0
-// Built: 2025-12-22T15:24:28.032Z
+// @exabugs/dynamodb-client v0.5.0
+// Built: 2025-12-23T05:07:58.552Z
 "use strict";
 var __create = Object.create;
 var __defProp = Object.defineProperty;
@@ -1241,12 +1241,12 @@ var require_dist_cjs7 = __commonJS({
     var loggerMiddleware = /* @__PURE__ */ __name(() => (next, context) => async (args) => {
       try {
         const response = await next(args);
-        const { clientName, commandName, logger: logger21, dynamoDbDocumentClientOptions = {} } = context;
+        const { clientName, commandName, logger: logger25, dynamoDbDocumentClientOptions = {} } = context;
         const { overrideInputFilterSensitiveLog, overrideOutputFilterSensitiveLog } = dynamoDbDocumentClientOptions;
         const inputFilterSensitiveLog = overrideInputFilterSensitiveLog ?? context.inputFilterSensitiveLog;
         const outputFilterSensitiveLog = overrideOutputFilterSensitiveLog ?? context.outputFilterSensitiveLog;
         const { $metadata, ...outputWithoutMetadata } = response.output;
-        logger21?.info?.({
+        logger25?.info?.({
           clientName,
           commandName,
           input: inputFilterSensitiveLog(args.input),
@@ -1255,10 +1255,10 @@ var require_dist_cjs7 = __commonJS({
         });
         return response;
       } catch (error2) {
-        const { clientName, commandName, logger: logger21, dynamoDbDocumentClientOptions = {} } = context;
+        const { clientName, commandName, logger: logger25, dynamoDbDocumentClientOptions = {} } = context;
         const { overrideInputFilterSensitiveLog } = dynamoDbDocumentClientOptions;
         const inputFilterSensitiveLog = overrideInputFilterSensitiveLog ?? context.inputFilterSensitiveLog;
-        logger21?.error?.({
+        logger25?.error?.({
           clientName,
           commandName,
           input: inputFilterSensitiveLog(args.input),
@@ -1592,11 +1592,183 @@ var init_getHttpAuthSchemeEndpointRuleSetPlugin = __esm({
   }
 });
 
-// node_modules/@smithy/middleware-serde/dist-cjs/index.js
+// node_modules/@smithy/middleware-serde/node_modules/@smithy/protocol-http/dist-cjs/index.js
 var require_dist_cjs9 = __commonJS({
+  "node_modules/@smithy/middleware-serde/node_modules/@smithy/protocol-http/dist-cjs/index.js"(exports2) {
+    "use strict";
+    var types = require_dist_cjs();
+    var getHttpHandlerExtensionConfiguration4 = /* @__PURE__ */ __name((runtimeConfig) => {
+      return {
+        setHttpHandler(handler2) {
+          runtimeConfig.httpHandler = handler2;
+        },
+        httpHandler() {
+          return runtimeConfig.httpHandler;
+        },
+        updateHttpClientConfig(key, value) {
+          runtimeConfig.httpHandler?.updateHttpClientConfig(key, value);
+        },
+        httpHandlerConfigs() {
+          return runtimeConfig.httpHandler.httpHandlerConfigs();
+        }
+      };
+    }, "getHttpHandlerExtensionConfiguration");
+    var resolveHttpHandlerRuntimeConfig4 = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => {
+      return {
+        httpHandler: httpHandlerExtensionConfiguration.httpHandler()
+      };
+    }, "resolveHttpHandlerRuntimeConfig");
+    var Field = class {
+      static {
+        __name(this, "Field");
+      }
+      name;
+      kind;
+      values;
+      constructor({ name, kind = types.FieldPosition.HEADER, values = [] }) {
+        this.name = name;
+        this.kind = kind;
+        this.values = values;
+      }
+      add(value) {
+        this.values.push(value);
+      }
+      set(values) {
+        this.values = values;
+      }
+      remove(value) {
+        this.values = this.values.filter((v4) => v4 !== value);
+      }
+      toString() {
+        return this.values.map((v4) => v4.includes(",") || v4.includes(" ") ? `"${v4}"` : v4).join(", ");
+      }
+      get() {
+        return this.values;
+      }
+    };
+    var Fields = class {
+      static {
+        __name(this, "Fields");
+      }
+      entries = {};
+      encoding;
+      constructor({ fields = [], encoding = "utf-8" }) {
+        fields.forEach(this.setField.bind(this));
+        this.encoding = encoding;
+      }
+      setField(field) {
+        this.entries[field.name.toLowerCase()] = field;
+      }
+      getField(name) {
+        return this.entries[name.toLowerCase()];
+      }
+      removeField(name) {
+        delete this.entries[name.toLowerCase()];
+      }
+      getByType(kind) {
+        return Object.values(this.entries).filter((field) => field.kind === kind);
+      }
+    };
+    var HttpRequest10 = class _HttpRequest {
+      static {
+        __name(this, "HttpRequest");
+      }
+      method;
+      protocol;
+      hostname;
+      port;
+      path;
+      query;
+      headers;
+      username;
+      password;
+      fragment;
+      body;
+      constructor(options) {
+        this.method = options.method || "GET";
+        this.hostname = options.hostname || "localhost";
+        this.port = options.port;
+        this.query = options.query || {};
+        this.headers = options.headers || {};
+        this.body = options.body;
+        this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:";
+        this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/";
+        this.username = options.username;
+        this.password = options.password;
+        this.fragment = options.fragment;
+      }
+      static clone(request2) {
+        const cloned = new _HttpRequest({
+          ...request2,
+          headers: { ...request2.headers }
+        });
+        if (cloned.query) {
+          cloned.query = cloneQuery(cloned.query);
+        }
+        return cloned;
+      }
+      static isInstance(request2) {
+        if (!request2) {
+          return false;
+        }
+        const req = request2;
+        return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object";
+      }
+      clone() {
+        return _HttpRequest.clone(this);
+      }
+    };
+    function cloneQuery(query) {
+      return Object.keys(query).reduce((carry, paramName) => {
+        const param = query[paramName];
+        return {
+          ...carry,
+          [paramName]: Array.isArray(param) ? [...param] : param
+        };
+      }, {});
+    }
+    __name(cloneQuery, "cloneQuery");
+    var HttpResponse4 = class {
+      static {
+        __name(this, "HttpResponse");
+      }
+      statusCode;
+      reason;
+      headers;
+      body;
+      constructor(options) {
+        this.statusCode = options.statusCode;
+        this.reason = options.reason;
+        this.headers = options.headers || {};
+        this.body = options.body;
+      }
+      static isInstance(response) {
+        if (!response)
+          return false;
+        const resp = response;
+        return typeof resp.statusCode === "number" && typeof resp.headers === "object";
+      }
+    };
+    function isValidHostname(hostname) {
+      const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/;
+      return hostPattern.test(hostname);
+    }
+    __name(isValidHostname, "isValidHostname");
+    exports2.Field = Field;
+    exports2.Fields = Fields;
+    exports2.HttpRequest = HttpRequest10;
+    exports2.HttpResponse = HttpResponse4;
+    exports2.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration4;
+    exports2.isValidHostname = isValidHostname;
+    exports2.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig4;
+  }
+});
+
+// node_modules/@smithy/middleware-serde/dist-cjs/index.js
+var require_dist_cjs10 = __commonJS({
   "node_modules/@smithy/middleware-serde/dist-cjs/index.js"(exports2) {
     "use strict";
-    var protocolHttp = require_dist_cjs3();
+    var protocolHttp = require_dist_cjs9();
     var deserializerMiddleware = /* @__PURE__ */ __name((options, deserializer) => (next, context) => async (args) => {
       const { response } = await next(args);
       try {
@@ -1656,72 +1828,244 @@ var require_dist_cjs9 = __commonJS({
       if (!endpoint) {
         throw new Error("No valid endpoint provider available.");
       }
-      const request2 = await serializer(args.input, { ...options, endpoint });
-      return next({
-        ...args,
-        request: request2
-      });
-    }, "serializerMiddleware");
-    var deserializerMiddlewareOption2 = {
-      name: "deserializerMiddleware",
-      step: "deserialize",
-      tags: ["DESERIALIZER"],
-      override: true
-    };
-    var serializerMiddlewareOption3 = {
-      name: "serializerMiddleware",
-      step: "serialize",
-      tags: ["SERIALIZER"],
-      override: true
+      const request2 = await serializer(args.input, { ...options, endpoint });
+      return next({
+        ...args,
+        request: request2
+      });
+    }, "serializerMiddleware");
+    var deserializerMiddlewareOption2 = {
+      name: "deserializerMiddleware",
+      step: "deserialize",
+      tags: ["DESERIALIZER"],
+      override: true
+    };
+    var serializerMiddlewareOption3 = {
+      name: "serializerMiddleware",
+      step: "serialize",
+      tags: ["SERIALIZER"],
+      override: true
+    };
+    function getSerdePlugin(config, serializer, deserializer) {
+      return {
+        applyToStack: /* @__PURE__ */ __name((commandStack) => {
+          commandStack.add(deserializerMiddleware(config, deserializer), deserializerMiddlewareOption2);
+          commandStack.add(serializerMiddleware(config, serializer), serializerMiddlewareOption3);
+        }, "applyToStack")
+      };
+    }
+    __name(getSerdePlugin, "getSerdePlugin");
+    exports2.deserializerMiddleware = deserializerMiddleware;
+    exports2.deserializerMiddlewareOption = deserializerMiddlewareOption2;
+    exports2.getSerdePlugin = getSerdePlugin;
+    exports2.serializerMiddleware = serializerMiddleware;
+    exports2.serializerMiddlewareOption = serializerMiddlewareOption3;
+  }
+});
+
+// node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemePlugin.js
+var import_middleware_serde, httpAuthSchemeMiddlewareOptions, getHttpAuthSchemePlugin;
+var init_getHttpAuthSchemePlugin = __esm({
+  "node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemePlugin.js"() {
+    import_middleware_serde = __toESM(require_dist_cjs10());
+    init_httpAuthSchemeMiddleware();
+    httpAuthSchemeMiddlewareOptions = {
+      step: "serialize",
+      tags: ["HTTP_AUTH_SCHEME"],
+      name: "httpAuthSchemeMiddleware",
+      override: true,
+      relation: "before",
+      toMiddleware: import_middleware_serde.serializerMiddlewareOption.name
+    };
+    getHttpAuthSchemePlugin = /* @__PURE__ */ __name((config, { httpAuthSchemeParametersProvider, identityProviderConfigProvider }) => ({
+      applyToStack: /* @__PURE__ */ __name((clientStack) => {
+        clientStack.addRelativeTo(httpAuthSchemeMiddleware(config, {
+          httpAuthSchemeParametersProvider,
+          identityProviderConfigProvider
+        }), httpAuthSchemeMiddlewareOptions);
+      }, "applyToStack")
+    }), "getHttpAuthSchemePlugin");
+  }
+});
+
+// node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/index.js
+var init_middleware_http_auth_scheme = __esm({
+  "node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/index.js"() {
+    init_httpAuthSchemeMiddleware();
+    init_getHttpAuthSchemeEndpointRuleSetPlugin();
+    init_getHttpAuthSchemePlugin();
+  }
+});
+
+// node_modules/@smithy/core/node_modules/@smithy/protocol-http/dist-cjs/index.js
+var require_dist_cjs11 = __commonJS({
+  "node_modules/@smithy/core/node_modules/@smithy/protocol-http/dist-cjs/index.js"(exports2) {
+    "use strict";
+    var types = require_dist_cjs();
+    var getHttpHandlerExtensionConfiguration4 = /* @__PURE__ */ __name((runtimeConfig) => {
+      return {
+        setHttpHandler(handler2) {
+          runtimeConfig.httpHandler = handler2;
+        },
+        httpHandler() {
+          return runtimeConfig.httpHandler;
+        },
+        updateHttpClientConfig(key, value) {
+          runtimeConfig.httpHandler?.updateHttpClientConfig(key, value);
+        },
+        httpHandlerConfigs() {
+          return runtimeConfig.httpHandler.httpHandlerConfigs();
+        }
+      };
+    }, "getHttpHandlerExtensionConfiguration");
+    var resolveHttpHandlerRuntimeConfig4 = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => {
+      return {
+        httpHandler: httpHandlerExtensionConfiguration.httpHandler()
+      };
+    }, "resolveHttpHandlerRuntimeConfig");
+    var Field = class {
+      static {
+        __name(this, "Field");
+      }
+      name;
+      kind;
+      values;
+      constructor({ name, kind = types.FieldPosition.HEADER, values = [] }) {
+        this.name = name;
+        this.kind = kind;
+        this.values = values;
+      }
+      add(value) {
+        this.values.push(value);
+      }
+      set(values) {
+        this.values = values;
+      }
+      remove(value) {
+        this.values = this.values.filter((v4) => v4 !== value);
+      }
+      toString() {
+        return this.values.map((v4) => v4.includes(",") || v4.includes(" ") ? `"${v4}"` : v4).join(", ");
+      }
+      get() {
+        return this.values;
+      }
+    };
+    var Fields = class {
+      static {
+        __name(this, "Fields");
+      }
+      entries = {};
+      encoding;
+      constructor({ fields = [], encoding = "utf-8" }) {
+        fields.forEach(this.setField.bind(this));
+        this.encoding = encoding;
+      }
+      setField(field) {
+        this.entries[field.name.toLowerCase()] = field;
+      }
+      getField(name) {
+        return this.entries[name.toLowerCase()];
+      }
+      removeField(name) {
+        delete this.entries[name.toLowerCase()];
+      }
+      getByType(kind) {
+        return Object.values(this.entries).filter((field) => field.kind === kind);
+      }
+    };
+    var HttpRequest10 = class _HttpRequest {
+      static {
+        __name(this, "HttpRequest");
+      }
+      method;
+      protocol;
+      hostname;
+      port;
+      path;
+      query;
+      headers;
+      username;
+      password;
+      fragment;
+      body;
+      constructor(options) {
+        this.method = options.method || "GET";
+        this.hostname = options.hostname || "localhost";
+        this.port = options.port;
+        this.query = options.query || {};
+        this.headers = options.headers || {};
+        this.body = options.body;
+        this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:";
+        this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/";
+        this.username = options.username;
+        this.password = options.password;
+        this.fragment = options.fragment;
+      }
+      static clone(request2) {
+        const cloned = new _HttpRequest({
+          ...request2,
+          headers: { ...request2.headers }
+        });
+        if (cloned.query) {
+          cloned.query = cloneQuery(cloned.query);
+        }
+        return cloned;
+      }
+      static isInstance(request2) {
+        if (!request2) {
+          return false;
+        }
+        const req = request2;
+        return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object";
+      }
+      clone() {
+        return _HttpRequest.clone(this);
+      }
+    };
+    function cloneQuery(query) {
+      return Object.keys(query).reduce((carry, paramName) => {
+        const param = query[paramName];
+        return {
+          ...carry,
+          [paramName]: Array.isArray(param) ? [...param] : param
+        };
+      }, {});
+    }
+    __name(cloneQuery, "cloneQuery");
+    var HttpResponse4 = class {
+      static {
+        __name(this, "HttpResponse");
+      }
+      statusCode;
+      reason;
+      headers;
+      body;
+      constructor(options) {
+        this.statusCode = options.statusCode;
+        this.reason = options.reason;
+        this.headers = options.headers || {};
+        this.body = options.body;
+      }
+      static isInstance(response) {
+        if (!response)
+          return false;
+        const resp = response;
+        return typeof resp.statusCode === "number" && typeof resp.headers === "object";
+      }
     };
-    function getSerdePlugin(config, serializer, deserializer) {
-      return {
-        applyToStack: /* @__PURE__ */ __name((commandStack) => {
-          commandStack.add(deserializerMiddleware(config, deserializer), deserializerMiddlewareOption2);
-          commandStack.add(serializerMiddleware(config, serializer), serializerMiddlewareOption3);
-        }, "applyToStack")
-      };
+    function isValidHostname(hostname) {
+      const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/;
+      return hostPattern.test(hostname);
     }
-    __name(getSerdePlugin, "getSerdePlugin");
-    exports2.deserializerMiddleware = deserializerMiddleware;
-    exports2.deserializerMiddlewareOption = deserializerMiddlewareOption2;
-    exports2.getSerdePlugin = getSerdePlugin;
-    exports2.serializerMiddleware = serializerMiddleware;
-    exports2.serializerMiddlewareOption = serializerMiddlewareOption3;
-  }
-});
-
-// node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemePlugin.js
-var import_middleware_serde, httpAuthSchemeMiddlewareOptions, getHttpAuthSchemePlugin;
-var init_getHttpAuthSchemePlugin = __esm({
-  "node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/getHttpAuthSchemePlugin.js"() {
-    import_middleware_serde = __toESM(require_dist_cjs9());
-    init_httpAuthSchemeMiddleware();
-    httpAuthSchemeMiddlewareOptions = {
-      step: "serialize",
-      tags: ["HTTP_AUTH_SCHEME"],
-      name: "httpAuthSchemeMiddleware",
-      override: true,
-      relation: "before",
-      toMiddleware: import_middleware_serde.serializerMiddlewareOption.name
-    };
-    getHttpAuthSchemePlugin = /* @__PURE__ */ __name((config, { httpAuthSchemeParametersProvider, identityProviderConfigProvider }) => ({
-      applyToStack: /* @__PURE__ */ __name((clientStack) => {
-        clientStack.addRelativeTo(httpAuthSchemeMiddleware(config, {
-          httpAuthSchemeParametersProvider,
-          identityProviderConfigProvider
-        }), httpAuthSchemeMiddlewareOptions);
-      }, "applyToStack")
-    }), "getHttpAuthSchemePlugin");
-  }
-});
-
-// node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/index.js
-var init_middleware_http_auth_scheme = __esm({
-  "node_modules/@smithy/core/dist-es/middleware-http-auth-scheme/index.js"() {
-    init_httpAuthSchemeMiddleware();
-    init_getHttpAuthSchemeEndpointRuleSetPlugin();
-    init_getHttpAuthSchemePlugin();
+    __name(isValidHostname, "isValidHostname");
+    exports2.Field = Field;
+    exports2.Fields = Fields;
+    exports2.HttpRequest = HttpRequest10;
+    exports2.HttpResponse = HttpResponse4;
+    exports2.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration4;
+    exports2.isValidHostname = isValidHostname;
+    exports2.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig4;
   }
 });
 
@@ -1729,7 +2073,7 @@ var init_middleware_http_auth_scheme = __esm({
 var import_protocol_http, import_util_middleware3, defaultErrorHandler, defaultSuccessHandler, httpSigningMiddleware;
 var init_httpSigningMiddleware = __esm({
   "node_modules/@smithy/core/dist-es/middleware-http-signing/httpSigningMiddleware.js"() {
-    import_protocol_http = __toESM(require_dist_cjs3());
+    import_protocol_http = __toESM(require_dist_cjs11());
     import_util_middleware3 = __toESM(require_dist_cjs2());
     defaultErrorHandler = /* @__PURE__ */ __name((signingProperties) => (error2) => {
       throw error2;
@@ -1848,7 +2192,7 @@ var init_createPaginator = __esm({
 });
 
 // node_modules/@smithy/is-array-buffer/dist-cjs/index.js
-var require_dist_cjs10 = __commonJS({
+var require_dist_cjs12 = __commonJS({
   "node_modules/@smithy/is-array-buffer/dist-cjs/index.js"(exports2) {
     "use strict";
     var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer");
@@ -1857,10 +2201,10 @@ var require_dist_cjs10 = __commonJS({
 });
 
 // node_modules/@smithy/util-buffer-from/dist-cjs/index.js
-var require_dist_cjs11 = __commonJS({
+var require_dist_cjs13 = __commonJS({
   "node_modules/@smithy/util-buffer-from/dist-cjs/index.js"(exports2) {
     "use strict";
-    var isArrayBuffer = require_dist_cjs10();
+    var isArrayBuffer = require_dist_cjs12();
     var buffer = require("buffer");
     var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => {
       if (!isArrayBuffer.isArrayBuffer(input)) {
@@ -1885,7 +2229,7 @@ var require_fromBase64 = __commonJS({
     "use strict";
     Object.defineProperty(exports2, "__esModule", { value: true });
     exports2.fromBase64 = void 0;
-    var util_buffer_from_1 = require_dist_cjs11();
+    var util_buffer_from_1 = require_dist_cjs13();
     var BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/;
     var fromBase648 = /* @__PURE__ */ __name((input) => {
       if (input.length * 3 % 4 !== 0) {
@@ -1902,10 +2246,10 @@ var require_fromBase64 = __commonJS({
 });
 
 // node_modules/@smithy/util-utf8/dist-cjs/index.js
-var require_dist_cjs12 = __commonJS({
+var require_dist_cjs14 = __commonJS({
   "node_modules/@smithy/util-utf8/dist-cjs/index.js"(exports2) {
     "use strict";
-    var utilBufferFrom = require_dist_cjs11();
+    var utilBufferFrom = require_dist_cjs13();
     var fromUtf87 = /* @__PURE__ */ __name((input) => {
       const buf = utilBufferFrom.fromString(input, "utf8");
       return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT);
@@ -1940,8 +2284,8 @@ var require_toBase64 = __commonJS({
     "use strict";
     Object.defineProperty(exports2, "__esModule", { value: true });
     exports2.toBase64 = void 0;
-    var util_buffer_from_1 = require_dist_cjs11();
-    var util_utf8_1 = require_dist_cjs12();
+    var util_buffer_from_1 = require_dist_cjs13();
+    var util_utf8_1 = require_dist_cjs14();
     var toBase648 = /* @__PURE__ */ __name((_input) => {
       let input;
       if (typeof _input === "string") {
@@ -1959,7 +2303,7 @@ var require_toBase64 = __commonJS({
 });
 
 // node_modules/@smithy/util-base64/dist-cjs/index.js
-var require_dist_cjs13 = __commonJS({
+var require_dist_cjs15 = __commonJS({
   "node_modules/@smithy/util-base64/dist-cjs/index.js"(exports2) {
     "use strict";
     var fromBase648 = require_fromBase64();
@@ -1989,7 +2333,7 @@ var require_ChecksumStream = __commonJS({
     "use strict";
     Object.defineProperty(exports2, "__esModule", { value: true });
     exports2.ChecksumStream = void 0;
-    var util_base64_1 = require_dist_cjs13();
+    var util_base64_1 = require_dist_cjs15();
     var stream_1 = require("stream");
     var ChecksumStream = class extends stream_1.Duplex {
       static {
@@ -2080,7 +2424,7 @@ var require_createChecksumStream_browser = __commonJS({
     "use strict";
     Object.defineProperty(exports2, "__esModule", { value: true });
     exports2.createChecksumStream = void 0;
-    var util_base64_1 = require_dist_cjs13();
+    var util_base64_1 = require_dist_cjs15();
     var stream_type_check_1 = require_stream_type_check();
     var ChecksumStream_browser_1 = require_ChecksumStream_browser();
     var createChecksumStream = /* @__PURE__ */ __name(({ expectedChecksum, checksum, source, checksumSourceLocation, base64Encoder }) => {
@@ -2194,7 +2538,7 @@ var require_createBufferedReadableStream = __commonJS({
     exports2.sizeOf = sizeOf;
     exports2.modeOf = modeOf;
     var ByteArrayCollector_1 = require_ByteArrayCollector();
-    function createBufferedReadableStream(upstream, size, logger21) {
+    function createBufferedReadableStream(upstream, size, logger25) {
       const reader = upstream.getReader();
       let streamBufferingLoggedWarning = false;
       let bytesSeen = 0;
@@ -2232,7 +2576,7 @@ var require_createBufferedReadableStream = __commonJS({
             const newSize = merge(buffers, mode, chunk);
             if (!streamBufferingLoggedWarning && bytesSeen > size * 2) {
               streamBufferingLoggedWarning = true;
-              logger21?.warn(`@smithy/util-stream - stream chunk size ${chunkSize} is below threshold of ${size}, automatically buffering.`);
+              logger25?.warn(`@smithy/util-stream - stream chunk size ${chunkSize} is below threshold of ${size}, automatically buffering.`);
             }
             if (newSize >= size) {
               controller.enqueue(flush(buffers, mode));
@@ -2303,9 +2647,9 @@ var require_createBufferedReadable = __commonJS({
     var ByteArrayCollector_1 = require_ByteArrayCollector();
     var createBufferedReadableStream_1 = require_createBufferedReadableStream();
     var stream_type_check_1 = require_stream_type_check();
-    function createBufferedReadable(upstream, size, logger21) {
+    function createBufferedReadable(upstream, size, logger25) {
       if ((0, stream_type_check_1.isReadableStream)(upstream)) {
-        return (0, createBufferedReadableStream_1.createBufferedReadableStream)(upstream, size, logger21);
+        return (0, createBufferedReadableStream_1.createBufferedReadableStream)(upstream, size, logger25);
       }
       const downstream = new node_stream_1.Readable({ read() {
       } });
@@ -2338,7 +2682,7 @@ var require_createBufferedReadable = __commonJS({
           const newSize = (0, createBufferedReadableStream_1.merge)(buffers, mode, chunk);
           if (!streamBufferingLoggedWarning && bytesSeen > size * 2) {
             streamBufferingLoggedWarning = true;
-            logger21?.warn(`@smithy/util-stream - stream chunk size ${chunkSize} is below threshold of ${size}, automatically buffering.`);
+            logger25?.warn(`@smithy/util-stream - stream chunk size ${chunkSize} is below threshold of ${size}, automatically buffering.`);
           }
           if (newSize >= size) {
             downstream.push((0, createBufferedReadableStream_1.flush)(buffers, mode));
@@ -2418,79 +2762,251 @@ var require_headStream_browser = __commonJS({
         if (byteLengthCounter >= bytes) {
           break;
         }
-        isDone = done;
+        isDone = done;
+      }
+      reader.releaseLock();
+      const collected = new Uint8Array(Math.min(bytes, byteLengthCounter));
+      let offset = 0;
+      for (const chunk of chunks) {
+        if (chunk.byteLength > collected.byteLength - offset) {
+          collected.set(chunk.subarray(0, collected.byteLength - offset), offset);
+          break;
+        } else {
+          collected.set(chunk, offset);
+        }
+        offset += chunk.length;
+      }
+      return collected;
+    }
+    __name(headStream, "headStream");
+  }
+});
+
+// node_modules/@smithy/util-stream/dist-cjs/headStream.js
+var require_headStream = __commonJS({
+  "node_modules/@smithy/util-stream/dist-cjs/headStream.js"(exports2) {
+    "use strict";
+    Object.defineProperty(exports2, "__esModule", { value: true });
+    exports2.headStream = void 0;
+    var stream_1 = require("stream");
+    var headStream_browser_1 = require_headStream_browser();
+    var stream_type_check_1 = require_stream_type_check();
+    var headStream = /* @__PURE__ */ __name((stream, bytes) => {
+      if ((0, stream_type_check_1.isReadableStream)(stream)) {
+        return (0, headStream_browser_1.headStream)(stream, bytes);
+      }
+      return new Promise((resolve, reject) => {
+        const collector = new Collector();
+        collector.limit = bytes;
+        stream.pipe(collector);
+        stream.on("error", (err2) => {
+          collector.end();
+          reject(err2);
+        });
+        collector.on("error", reject);
+        collector.on("finish", function() {
+          const bytes2 = new Uint8Array(Buffer.concat(this.buffers));
+          resolve(bytes2);
+        });
+      });
+    }, "headStream");
+    exports2.headStream = headStream;
+    var Collector = class extends stream_1.Writable {
+      static {
+        __name(this, "Collector");
+      }
+      buffers = [];
+      limit = Infinity;
+      bytesBuffered = 0;
+      _write(chunk, encoding, callback) {
+        this.buffers.push(chunk);
+        this.bytesBuffered += chunk.byteLength ?? 0;
+        if (this.bytesBuffered >= this.limit) {
+          const excess = this.bytesBuffered - this.limit;
+          const tailBuffer = this.buffers[this.buffers.length - 1];
+          this.buffers[this.buffers.length - 1] = tailBuffer.subarray(0, tailBuffer.byteLength - excess);
+          this.emit("finish");
+        }
+        callback();
+      }
+    };
+  }
+});
+
+// node_modules/@smithy/node-http-handler/node_modules/@smithy/protocol-http/dist-cjs/index.js
+var require_dist_cjs16 = __commonJS({
+  "node_modules/@smithy/node-http-handler/node_modules/@smithy/protocol-http/dist-cjs/index.js"(exports2) {
+    "use strict";
+    var types = require_dist_cjs();
+    var getHttpHandlerExtensionConfiguration4 = /* @__PURE__ */ __name((runtimeConfig) => {
+      return {
+        setHttpHandler(handler2) {
+          runtimeConfig.httpHandler = handler2;
+        },
+        httpHandler() {
+          return runtimeConfig.httpHandler;
+        },
+        updateHttpClientConfig(key, value) {
+          runtimeConfig.httpHandler?.updateHttpClientConfig(key, value);
+        },
+        httpHandlerConfigs() {
+          return runtimeConfig.httpHandler.httpHandlerConfigs();
+        }
+      };
+    }, "getHttpHandlerExtensionConfiguration");
+    var resolveHttpHandlerRuntimeConfig4 = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => {
+      return {
+        httpHandler: httpHandlerExtensionConfiguration.httpHandler()
+      };
+    }, "resolveHttpHandlerRuntimeConfig");
+    var Field = class {
+      static {
+        __name(this, "Field");
+      }
+      name;
+      kind;
+      values;
+      constructor({ name, kind = types.FieldPosition.HEADER, values = [] }) {
+        this.name = name;
+        this.kind = kind;
+        this.values = values;
+      }
+      add(value) {
+        this.values.push(value);
+      }
+      set(values) {
+        this.values = values;
+      }
+      remove(value) {
+        this.values = this.values.filter((v4) => v4 !== value);
+      }
+      toString() {
+        return this.values.map((v4) => v4.includes(",") || v4.includes(" ") ? `"${v4}"` : v4).join(", ");
+      }
+      get() {
+        return this.values;
+      }
+    };
+    var Fields = class {
+      static {
+        __name(this, "Fields");
+      }
+      entries = {};
+      encoding;
+      constructor({ fields = [], encoding = "utf-8" }) {
+        fields.forEach(this.setField.bind(this));
+        this.encoding = encoding;
+      }
+      setField(field) {
+        this.entries[field.name.toLowerCase()] = field;
+      }
+      getField(name) {
+        return this.entries[name.toLowerCase()];
+      }
+      removeField(name) {
+        delete this.entries[name.toLowerCase()];
+      }
+      getByType(kind) {
+        return Object.values(this.entries).filter((field) => field.kind === kind);
+      }
+    };
+    var HttpRequest10 = class _HttpRequest {
+      static {
+        __name(this, "HttpRequest");
+      }
+      method;
+      protocol;
+      hostname;
+      port;
+      path;
+      query;
+      headers;
+      username;
+      password;
+      fragment;
+      body;
+      constructor(options) {
+        this.method = options.method || "GET";
+        this.hostname = options.hostname || "localhost";
+        this.port = options.port;
+        this.query = options.query || {};
+        this.headers = options.headers || {};
+        this.body = options.body;
+        this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:";
+        this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/";
+        this.username = options.username;
+        this.password = options.password;
+        this.fragment = options.fragment;
+      }
+      static clone(request2) {
+        const cloned = new _HttpRequest({
+          ...request2,
+          headers: { ...request2.headers }
+        });
+        if (cloned.query) {
+          cloned.query = cloneQuery(cloned.query);
+        }
+        return cloned;
       }
-      reader.releaseLock();
-      const collected = new Uint8Array(Math.min(bytes, byteLengthCounter));
-      let offset = 0;
-      for (const chunk of chunks) {
-        if (chunk.byteLength > collected.byteLength - offset) {
-          collected.set(chunk.subarray(0, collected.byteLength - offset), offset);
-          break;
-        } else {
-          collected.set(chunk, offset);
+      static isInstance(request2) {
+        if (!request2) {
+          return false;
         }
-        offset += chunk.length;
+        const req = request2;
+        return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object";
       }
-      return collected;
-    }
-    __name(headStream, "headStream");
-  }
-});
-
-// node_modules/@smithy/util-stream/dist-cjs/headStream.js
-var require_headStream = __commonJS({
-  "node_modules/@smithy/util-stream/dist-cjs/headStream.js"(exports2) {
-    "use strict";
-    Object.defineProperty(exports2, "__esModule", { value: true });
-    exports2.headStream = void 0;
-    var stream_1 = require("stream");
-    var headStream_browser_1 = require_headStream_browser();
-    var stream_type_check_1 = require_stream_type_check();
-    var headStream = /* @__PURE__ */ __name((stream, bytes) => {
-      if ((0, stream_type_check_1.isReadableStream)(stream)) {
-        return (0, headStream_browser_1.headStream)(stream, bytes);
+      clone() {
+        return _HttpRequest.clone(this);
       }
-      return new Promise((resolve, reject) => {
-        const collector = new Collector();
-        collector.limit = bytes;
-        stream.pipe(collector);
-        stream.on("error", (err2) => {
-          collector.end();
-          reject(err2);
-        });
-        collector.on("error", reject);
-        collector.on("finish", function() {
-          const bytes2 = new Uint8Array(Buffer.concat(this.buffers));
-          resolve(bytes2);
-        });
-      });
-    }, "headStream");
-    exports2.headStream = headStream;
-    var Collector = class extends stream_1.Writable {
+    };
+    function cloneQuery(query) {
+      return Object.keys(query).reduce((carry, paramName) => {
+        const param = query[paramName];
+        return {
+          ...carry,
+          [paramName]: Array.isArray(param) ? [...param] : param
+        };
+      }, {});
+    }
+    __name(cloneQuery, "cloneQuery");
+    var HttpResponse4 = class {
       static {
-        __name(this, "Collector");
+        __name(this, "HttpResponse");
       }
-      buffers = [];
-      limit = Infinity;
-      bytesBuffered = 0;
-      _write(chunk, encoding, callback) {
-        this.buffers.push(chunk);
-        this.bytesBuffered += chunk.byteLength ?? 0;
-        if (this.bytesBuffered >= this.limit) {
-          const excess = this.bytesBuffered - this.limit;
-          const tailBuffer = this.buffers[this.buffers.length - 1];
-          this.buffers[this.buffers.length - 1] = tailBuffer.subarray(0, tailBuffer.byteLength - excess);
-          this.emit("finish");
-        }
-        callback();
+      statusCode;
+      reason;
+      headers;
+      body;
+      constructor(options) {
+        this.statusCode = options.statusCode;
+        this.reason = options.reason;
+        this.headers = options.headers || {};
+        this.body = options.body;
+      }
+      static isInstance(response) {
+        if (!response)
+          return false;
+        const resp = response;
+        return typeof resp.statusCode === "number" && typeof resp.headers === "object";
       }
     };
+    function isValidHostname(hostname) {
+      const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/;
+      return hostPattern.test(hostname);
+    }
+    __name(isValidHostname, "isValidHostname");
+    exports2.Field = Field;
+    exports2.Fields = Fields;
+    exports2.HttpRequest = HttpRequest10;
+    exports2.HttpResponse = HttpResponse4;
+    exports2.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration4;
+    exports2.isValidHostname = isValidHostname;
+    exports2.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig4;
   }
 });
 
 // node_modules/@smithy/util-uri-escape/dist-cjs/index.js
-var require_dist_cjs14 = __commonJS({
+var require_dist_cjs17 = __commonJS({
   "node_modules/@smithy/util-uri-escape/dist-cjs/index.js"(exports2) {
     "use strict";
     var escapeUri = /* @__PURE__ */ __name((uri) => encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode), "escapeUri");
@@ -2502,10 +3018,10 @@ var require_dist_cjs14 = __commonJS({
 });
 
 // node_modules/@smithy/querystring-builder/dist-cjs/index.js
-var require_dist_cjs15 = __commonJS({
+var require_dist_cjs18 = __commonJS({
   "node_modules/@smithy/querystring-builder/dist-cjs/index.js"(exports2) {
     "use strict";
-    var utilUriEscape = require_dist_cjs14();
+    var utilUriEscape = require_dist_cjs17();
     function buildQueryString(query) {
       const parts = [];
       for (let key of Object.keys(query).sort()) {
@@ -2531,11 +3047,11 @@ var require_dist_cjs15 = __commonJS({
 });
 
 // node_modules/@smithy/node-http-handler/dist-cjs/index.js
-var require_dist_cjs16 = __commonJS({
+var require_dist_cjs19 = __commonJS({
   "node_modules/@smithy/node-http-handler/dist-cjs/index.js"(exports2) {
     "use strict";
-    var protocolHttp = require_dist_cjs3();
-    var querystringBuilder = require_dist_cjs15();
+    var protocolHttp = require_dist_cjs16();
+    var querystringBuilder = require_dist_cjs18();
     var http = require("http");
     var https = require("https");
     var stream = require("stream");
@@ -2586,7 +3102,7 @@ var require_dist_cjs16 = __commonJS({
       }
       return timing.setTimeout(registerTimeout.bind(null, DEFER_EVENT_LISTENER_TIME$2), DEFER_EVENT_LISTENER_TIME$2);
     }, "setConnectionTimeout");
-    var setRequestTimeout = /* @__PURE__ */ __name((req, reject, timeoutInMs = 0, throwOnRequestTimeout, logger21) => {
+    var setRequestTimeout = /* @__PURE__ */ __name((req, reject, timeoutInMs = 0, throwOnRequestTimeout, logger25) => {
       if (timeoutInMs) {
         return timing.setTimeout(() => {
           let msg = `@smithy/node-http-handler - [${throwOnRequestTimeout ? "ERROR" : "WARN"}] a request has exceeded the configured ${timeoutInMs} ms requestTimeout.`;
@@ -2599,7 +3115,7 @@ var require_dist_cjs16 = __commonJS({
             reject(error2);
           } else {
             msg += ` Init client requestHandler with throwOnRequestTimeout=true to turn this into an error.`;
-            logger21?.warn?.(msg);
+            logger25?.warn?.(msg);
           }
         }, timeoutInMs);
       }
@@ -2715,7 +3231,7 @@ var require_dist_cjs16 = __commonJS({
         }
         return new _NodeHttpHandler(instanceOrOptions);
       }
-      static checkSocketUsage(agent, socketWarningTimestamp, logger21 = console) {
+      static checkSocketUsage(agent, socketWarningTimestamp, logger25 = console) {
         const { sockets, requests, maxSockets } = agent;
         if (typeof maxSockets !== "number" || maxSockets === Infinity) {
           return socketWarningTimestamp;
@@ -2729,7 +3245,7 @@ var require_dist_cjs16 = __commonJS({
             const socketsInUse = sockets[origin]?.length ?? 0;
             const requestsEnqueued = requests[origin]?.length ?? 0;
             if (socketsInUse >= maxSockets && requestsEnqueued >= 2 * maxSockets) {
-              logger21?.warn?.(`@smithy/node-http-handler:WARN - socket usage at capacity=${socketsInUse} and ${requestsEnqueued} additional requests are enqueued.
+              logger25?.warn?.(`@smithy/node-http-handler:WARN - socket usage at capacity=${socketsInUse} and ${requestsEnqueued} additional requests are enqueued.
 See https://docs.aws.amazon.com/sdk-for-javascript/v3/developer-guide/node-configuring-maxsockets.html
 or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler config.`);
               return Date.now();
@@ -3231,31 +3747,203 @@ or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler conf
           chunks.push(value);
           length += value.length;
         }
-        isDone = done;
+        isDone = done;
+      }
+      const collected = new Uint8Array(length);
+      let offset = 0;
+      for (const chunk of chunks) {
+        collected.set(chunk, offset);
+        offset += chunk.length;
+      }
+      return collected;
+    }
+    __name(collectReadableStream, "collectReadableStream");
+    exports2.DEFAULT_REQUEST_TIMEOUT = DEFAULT_REQUEST_TIMEOUT;
+    exports2.NodeHttp2Handler = NodeHttp2Handler;
+    exports2.NodeHttpHandler = NodeHttpHandler;
+    exports2.streamCollector = streamCollector4;
+  }
+});
+
+// node_modules/@smithy/fetch-http-handler/node_modules/@smithy/protocol-http/dist-cjs/index.js
+var require_dist_cjs20 = __commonJS({
+  "node_modules/@smithy/fetch-http-handler/node_modules/@smithy/protocol-http/dist-cjs/index.js"(exports2) {
+    "use strict";
+    var types = require_dist_cjs();
+    var getHttpHandlerExtensionConfiguration4 = /* @__PURE__ */ __name((runtimeConfig) => {
+      return {
+        setHttpHandler(handler2) {
+          runtimeConfig.httpHandler = handler2;
+        },
+        httpHandler() {
+          return runtimeConfig.httpHandler;
+        },
+        updateHttpClientConfig(key, value) {
+          runtimeConfig.httpHandler?.updateHttpClientConfig(key, value);
+        },
+        httpHandlerConfigs() {
+          return runtimeConfig.httpHandler.httpHandlerConfigs();
+        }
+      };
+    }, "getHttpHandlerExtensionConfiguration");
+    var resolveHttpHandlerRuntimeConfig4 = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => {
+      return {
+        httpHandler: httpHandlerExtensionConfiguration.httpHandler()
+      };
+    }, "resolveHttpHandlerRuntimeConfig");
+    var Field = class {
+      static {
+        __name(this, "Field");
+      }
+      name;
+      kind;
+      values;
+      constructor({ name, kind = types.FieldPosition.HEADER, values = [] }) {
+        this.name = name;
+        this.kind = kind;
+        this.values = values;
+      }
+      add(value) {
+        this.values.push(value);
+      }
+      set(values) {
+        this.values = values;
+      }
+      remove(value) {
+        this.values = this.values.filter((v4) => v4 !== value);
+      }
+      toString() {
+        return this.values.map((v4) => v4.includes(",") || v4.includes(" ") ? `"${v4}"` : v4).join(", ");
+      }
+      get() {
+        return this.values;
+      }
+    };
+    var Fields = class {
+      static {
+        __name(this, "Fields");
+      }
+      entries = {};
+      encoding;
+      constructor({ fields = [], encoding = "utf-8" }) {
+        fields.forEach(this.setField.bind(this));
+        this.encoding = encoding;
+      }
+      setField(field) {
+        this.entries[field.name.toLowerCase()] = field;
+      }
+      getField(name) {
+        return this.entries[name.toLowerCase()];
+      }
+      removeField(name) {
+        delete this.entries[name.toLowerCase()];
+      }
+      getByType(kind) {
+        return Object.values(this.entries).filter((field) => field.kind === kind);
+      }
+    };
+    var HttpRequest10 = class _HttpRequest {
+      static {
+        __name(this, "HttpRequest");
+      }
+      method;
+      protocol;
+      hostname;
+      port;
+      path;
+      query;
+      headers;
+      username;
+      password;
+      fragment;
+      body;
+      constructor(options) {
+        this.method = options.method || "GET";
+        this.hostname = options.hostname || "localhost";
+        this.port = options.port;
+        this.query = options.query || {};
+        this.headers = options.headers || {};
+        this.body = options.body;
+        this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:";
+        this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/";
+        this.username = options.username;
+        this.password = options.password;
+        this.fragment = options.fragment;
+      }
+      static clone(request2) {
+        const cloned = new _HttpRequest({
+          ...request2,
+          headers: { ...request2.headers }
+        });
+        if (cloned.query) {
+          cloned.query = cloneQuery(cloned.query);
+        }
+        return cloned;
+      }
+      static isInstance(request2) {
+        if (!request2) {
+          return false;
+        }
+        const req = request2;
+        return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object";
       }
-      const collected = new Uint8Array(length);
-      let offset = 0;
-      for (const chunk of chunks) {
-        collected.set(chunk, offset);
-        offset += chunk.length;
+      clone() {
+        return _HttpRequest.clone(this);
       }
-      return collected;
+    };
+    function cloneQuery(query) {
+      return Object.keys(query).reduce((carry, paramName) => {
+        const param = query[paramName];
+        return {
+          ...carry,
+          [paramName]: Array.isArray(param) ? [...param] : param
+        };
+      }, {});
     }
-    __name(collectReadableStream, "collectReadableStream");
-    exports2.DEFAULT_REQUEST_TIMEOUT = DEFAULT_REQUEST_TIMEOUT;
-    exports2.NodeHttp2Handler = NodeHttp2Handler;
-    exports2.NodeHttpHandler = NodeHttpHandler;
-    exports2.streamCollector = streamCollector4;
+    __name(cloneQuery, "cloneQuery");
+    var HttpResponse4 = class {
+      static {
+        __name(this, "HttpResponse");
+      }
+      statusCode;
+      reason;
+      headers;
+      body;
+      constructor(options) {
+        this.statusCode = options.statusCode;
+        this.reason = options.reason;
+        this.headers = options.headers || {};
+        this.body = options.body;
+      }
+      static isInstance(response) {
+        if (!response)
+          return false;
+        const resp = response;
+        return typeof resp.statusCode === "number" && typeof resp.headers === "object";
+      }
+    };
+    function isValidHostname(hostname) {
+      const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/;
+      return hostPattern.test(hostname);
+    }
+    __name(isValidHostname, "isValidHostname");
+    exports2.Field = Field;
+    exports2.Fields = Fields;
+    exports2.HttpRequest = HttpRequest10;
+    exports2.HttpResponse = HttpResponse4;
+    exports2.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration4;
+    exports2.isValidHostname = isValidHostname;
+    exports2.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig4;
   }
 });
 
 // node_modules/@smithy/fetch-http-handler/dist-cjs/index.js
-var require_dist_cjs17 = __commonJS({
+var require_dist_cjs21 = __commonJS({
   "node_modules/@smithy/fetch-http-handler/dist-cjs/index.js"(exports2) {
     "use strict";
-    var protocolHttp = require_dist_cjs3();
-    var querystringBuilder = require_dist_cjs15();
-    var utilBase64 = require_dist_cjs13();
+    var protocolHttp = require_dist_cjs20();
+    var querystringBuilder = require_dist_cjs18();
+    var utilBase64 = require_dist_cjs15();
     function createRequest(url, requestOptions) {
       return new Request(url, requestOptions);
     }
@@ -3473,7 +4161,7 @@ var require_dist_cjs17 = __commonJS({
 });
 
 // node_modules/@smithy/util-hex-encoding/dist-cjs/index.js
-var require_dist_cjs18 = __commonJS({
+var require_dist_cjs22 = __commonJS({
   "node_modules/@smithy/util-hex-encoding/dist-cjs/index.js"(exports2) {
     "use strict";
     var SHORT_TO_HEX = {};
@@ -3521,10 +4209,10 @@ var require_sdk_stream_mixin_browser = __commonJS({
     "use strict";
     Object.defineProperty(exports2, "__esModule", { value: true });
     exports2.sdkStreamMixin = void 0;
-    var fetch_http_handler_1 = require_dist_cjs17();
-    var util_base64_1 = require_dist_cjs13();
-    var util_hex_encoding_1 = require_dist_cjs18();
-    var util_utf8_1 = require_dist_cjs12();
+    var fetch_http_handler_1 = require_dist_cjs21();
+    var util_base64_1 = require_dist_cjs15();
+    var util_hex_encoding_1 = require_dist_cjs22();
+    var util_utf8_1 = require_dist_cjs14();
     var stream_type_check_1 = require_stream_type_check();
     var ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed.";
     var sdkStreamMixin2 = /* @__PURE__ */ __name((stream) => {
@@ -3588,8 +4276,8 @@ var require_sdk_stream_mixin = __commonJS({
     "use strict";
     Object.defineProperty(exports2, "__esModule", { value: true });
     exports2.sdkStreamMixin = void 0;
-    var node_http_handler_1 = require_dist_cjs16();
-    var util_buffer_from_1 = require_dist_cjs11();
+    var node_http_handler_1 = require_dist_cjs19();
+    var util_buffer_from_1 = require_dist_cjs13();
     var stream_1 = require("stream");
     var sdk_stream_mixin_browser_1 = require_sdk_stream_mixin_browser();
     var ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed.";
@@ -3681,11 +4369,11 @@ var require_splitStream = __commonJS({
 });
 
 // node_modules/@smithy/util-stream/dist-cjs/index.js
-var require_dist_cjs19 = __commonJS({
+var require_dist_cjs23 = __commonJS({
   "node_modules/@smithy/util-stream/dist-cjs/index.js"(exports2) {
     "use strict";
-    var utilBase64 = require_dist_cjs13();
-    var utilUtf8 = require_dist_cjs12();
+    var utilBase64 = require_dist_cjs15();
+    var utilUtf8 = require_dist_cjs14();
     var ChecksumStream = require_ChecksumStream();
     var createChecksumStream = require_createChecksumStream();
     var createBufferedReadable = require_createBufferedReadable();
@@ -3790,7 +4478,7 @@ var require_dist_cjs19 = __commonJS({
 var import_util_stream, collectBody;
 var init_collect_stream_body = __esm({
   "node_modules/@smithy/core/dist-es/submodules/protocols/collect-stream-body.js"() {
-    import_util_stream = __toESM(require_dist_cjs19());
+    import_util_stream = __toESM(require_dist_cjs23());
     collectBody = /* @__PURE__ */ __name(async (streamBody = new Uint8Array(), context) => {
       if (streamBody instanceof Uint8Array) {
         return import_util_stream.Uint8ArrayBlobAdapter.mutate(streamBody);
@@ -3847,7 +4535,7 @@ var init_operation = __esm({
 var import_protocol_http2, import_util_middleware4, schemaDeserializationMiddleware, findHeader;
 var init_schemaDeserializationMiddleware = __esm({
   "node_modules/@smithy/core/dist-es/submodules/schema/middleware/schemaDeserializationMiddleware.js"() {
-    import_protocol_http2 = __toESM(require_dist_cjs3());
+    import_protocol_http2 = __toESM(require_dist_cjs11());
     import_util_middleware4 = __toESM(require_dist_cjs2());
     init_operation();
     schemaDeserializationMiddleware = /* @__PURE__ */ __name((config) => (next, context) => async (args) => {
@@ -4274,7 +4962,12 @@ var init_NormalizedSchema = __esm({
       }
       isStructSchema() {
         const sc = this.getSchema();
-        return sc[0] === 3 || sc[0] === -3;
+        const id = sc[0];
+        return id === 3 || id === -3 || id === 4;
+      }
+      isUnionSchema() {
+        const sc = this.getSchema();
+        return sc[0] === 4;
       }
       isBlobSchema() {
         const sc = this.getSchema();
@@ -5590,7 +6283,7 @@ var require_randomUUID = __commonJS({
 });
 
 // node_modules/@smithy/uuid/dist-cjs/index.js
-var require_dist_cjs20 = __commonJS({
+var require_dist_cjs24 = __commonJS({
   "node_modules/@smithy/uuid/dist-cjs/index.js"(exports2) {
     "use strict";
     var randomUUID = require_randomUUID();
@@ -5613,7 +6306,7 @@ var require_dist_cjs20 = __commonJS({
 var import_uuid;
 var init_generateIdempotencyToken = __esm({
   "node_modules/@smithy/core/dist-es/submodules/serde/generateIdempotencyToken.js"() {
-    import_uuid = __toESM(require_dist_cjs20());
+    import_uuid = __toESM(require_dist_cjs24());
   }
 });
 
@@ -5959,7 +6652,7 @@ var init_SerdeContext = __esm({
 var import_util_utf8, EventStreamSerde;
 var init_EventStreamSerde = __esm({
   "node_modules/@smithy/core/dist-es/submodules/event-streams/EventStreamSerde.js"() {
-    import_util_utf8 = __toESM(require_dist_cjs12());
+    import_util_utf8 = __toESM(require_dist_cjs14());
     EventStreamSerde = class {
       static {
         __name(this, "EventStreamSerde");
@@ -6209,7 +6902,7 @@ var import_protocol_http3, HttpProtocol;
 var init_HttpProtocol = __esm({
   "node_modules/@smithy/core/dist-es/submodules/protocols/HttpProtocol.js"() {
     init_schema();
-    import_protocol_http3 = __toESM(require_dist_cjs3());
+    import_protocol_http3 = __toESM(require_dist_cjs11());
     init_SerdeContext();
     HttpProtocol = class extends SerdeContext {
       static {
@@ -6341,8 +7034,8 @@ var init_HttpBindingProtocol = __esm({
   "node_modules/@smithy/core/dist-es/submodules/protocols/HttpBindingProtocol.js"() {
     init_schema();
     init_serde();
-    import_protocol_http4 = __toESM(require_dist_cjs3());
-    import_util_stream2 = __toESM(require_dist_cjs19());
+    import_protocol_http4 = __toESM(require_dist_cjs11());
+    import_util_stream2 = __toESM(require_dist_cjs23());
     init_collect_stream_body();
     init_extended_encode_uri_component();
     init_HttpProtocol();
@@ -6595,7 +7288,7 @@ var import_protocol_http5, RpcProtocol;
 var init_RpcProtocol = __esm({
   "node_modules/@smithy/core/dist-es/submodules/protocols/RpcProtocol.js"() {
     init_schema();
-    import_protocol_http5 = __toESM(require_dist_cjs3());
+    import_protocol_http5 = __toESM(require_dist_cjs11());
     init_collect_stream_body();
     init_HttpProtocol();
     RpcProtocol = class extends HttpProtocol {
@@ -6719,7 +7412,7 @@ function requestBuilder(input, context) {
 var import_protocol_http6, RequestBuilder;
 var init_requestBuilder = __esm({
   "node_modules/@smithy/core/dist-es/submodules/protocols/requestBuilder.js"() {
-    import_protocol_http6 = __toESM(require_dist_cjs3());
+    import_protocol_http6 = __toESM(require_dist_cjs11());
     init_resolve_path();
     __name(requestBuilder, "requestBuilder");
     RequestBuilder = class {
@@ -6815,8 +7508,8 @@ var init_FromStringShapeDeserializer = __esm({
   "node_modules/@smithy/core/dist-es/submodules/protocols/serde/FromStringShapeDeserializer.js"() {
     init_schema();
     init_serde();
-    import_util_base64 = __toESM(require_dist_cjs13());
-    import_util_utf82 = __toESM(require_dist_cjs12());
+    import_util_base64 = __toESM(require_dist_cjs15());
+    import_util_utf82 = __toESM(require_dist_cjs14());
     init_SerdeContext();
     init_determineTimestampFormat();
     FromStringShapeDeserializer = class extends SerdeContext {
@@ -6890,7 +7583,7 @@ var import_util_utf83, HttpInterceptingShapeDeserializer;
 var init_HttpInterceptingShapeDeserializer = __esm({
   "node_modules/@smithy/core/dist-es/submodules/protocols/serde/HttpInterceptingShapeDeserializer.js"() {
     init_schema();
-    import_util_utf83 = __toESM(require_dist_cjs12());
+    import_util_utf83 = __toESM(require_dist_cjs14());
     init_SerdeContext();
     init_FromStringShapeDeserializer();
     HttpInterceptingShapeDeserializer = class extends SerdeContext {
@@ -6942,7 +7635,7 @@ var init_ToStringShapeSerializer = __esm({
   "node_modules/@smithy/core/dist-es/submodules/protocols/serde/ToStringShapeSerializer.js"() {
     init_schema();
     init_serde();
-    import_util_base642 = __toESM(require_dist_cjs13());
+    import_util_base642 = __toESM(require_dist_cjs15());
     init_SerdeContext();
     init_determineTimestampFormat();
     ToStringShapeSerializer = class extends SerdeContext {
@@ -7166,7 +7859,7 @@ var init_DefaultIdentityProviderConfig = __esm({
 var import_protocol_http7, import_types2, HttpApiKeyAuthSigner;
 var init_httpApiKeyAuth = __esm({
   "node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/httpApiKeyAuth.js"() {
-    import_protocol_http7 = __toESM(require_dist_cjs3());
+    import_protocol_http7 = __toESM(require_dist_cjs11());
     import_types2 = __toESM(require_dist_cjs());
     HttpApiKeyAuthSigner = class {
       static {
@@ -7203,7 +7896,7 @@ var init_httpApiKeyAuth = __esm({
 var import_protocol_http8, HttpBearerAuthSigner;
 var init_httpBearerAuth = __esm({
   "node_modules/@smithy/core/dist-es/util-identity-and-auth/httpAuthSchemes/httpBearerAuth.js"() {
-    import_protocol_http8 = __toESM(require_dist_cjs3());
+    import_protocol_http8 = __toESM(require_dist_cjs11());
     HttpBearerAuthSigner = class {
       static {
         __name(this, "HttpBearerAuthSigner");
@@ -7354,7 +8047,7 @@ var init_dist_es = __esm({
 });
 
 // node_modules/@smithy/util-endpoints/dist-cjs/index.js
-var require_dist_cjs21 = __commonJS({
+var require_dist_cjs25 = __commonJS({
   "node_modules/@smithy/util-endpoints/dist-cjs/index.js"(exports2) {
     "use strict";
     var types = require_dist_cjs();
@@ -7762,7 +8455,7 @@ var require_dist_cjs21 = __commonJS({
       evaluateTreeRule
     };
     var resolveEndpoint4 = /* @__PURE__ */ __name((ruleSetObject, options) => {
-      const { endpointParams, logger: logger21 } = options;
+      const { endpointParams, logger: logger25 } = options;
       const { parameters, rules } = ruleSetObject;
       options.logger?.debug?.(`${debugId} Initial EndpointParams: ${toDebugString(endpointParams)}`);
       const paramsWithDefault = Object.entries(parameters).filter(([, v4]) => v4.default != null).map(([k4, v4]) => [k4, v4.default]);
@@ -7777,7 +8470,7 @@ var require_dist_cjs21 = __commonJS({
           throw new EndpointError(`Missing required parameter: '${requiredParam}'`);
         }
       }
-      const endpoint = evaluateRules(rules, { endpointParams, logger: logger21, referenceRecord: {} });
+      const endpoint = evaluateRules(rules, { endpointParams, logger: logger25, referenceRecord: {} });
       options.logger?.debug?.(`${debugId} Resolved endpoint: ${toDebugString(endpoint)}`);
       return endpoint;
     }, "resolveEndpoint");
@@ -7791,7 +8484,7 @@ var require_dist_cjs21 = __commonJS({
 });
 
 // node_modules/@smithy/querystring-parser/dist-cjs/index.js
-var require_dist_cjs22 = __commonJS({
+var require_dist_cjs26 = __commonJS({
   "node_modules/@smithy/querystring-parser/dist-cjs/index.js"(exports2) {
     "use strict";
     function parseQueryString(querystring) {
@@ -7821,10 +8514,10 @@ var require_dist_cjs22 = __commonJS({
 });
 
 // node_modules/@smithy/url-parser/dist-cjs/index.js
-var require_dist_cjs23 = __commonJS({
+var require_dist_cjs27 = __commonJS({
   "node_modules/@smithy/url-parser/dist-cjs/index.js"(exports2) {
     "use strict";
-    var querystringParser = require_dist_cjs22();
+    var querystringParser = require_dist_cjs26();
     var parseUrl4 = /* @__PURE__ */ __name((url) => {
       if (typeof url === "string") {
         return parseUrl4(new URL(url));
@@ -7847,11 +8540,11 @@ var require_dist_cjs23 = __commonJS({
 });
 
 // node_modules/@aws-sdk/util-endpoints/dist-cjs/index.js
-var require_dist_cjs24 = __commonJS({
+var require_dist_cjs28 = __commonJS({
   "node_modules/@aws-sdk/util-endpoints/dist-cjs/index.js"(exports2) {
     "use strict";
-    var utilEndpoints = require_dist_cjs21();
-    var urlParser = require_dist_cjs23();
+    var utilEndpoints = require_dist_cjs25();
+    var urlParser = require_dist_cjs27();
     var isVirtualHostableS3Bucket = /* @__PURE__ */ __name((value, allowSubDomains = false) => {
       if (allowSubDomains) {
         for (const label of value.split(".")) {
@@ -8554,7 +9247,7 @@ var init_NODE_AUTH_SCHEME_PREFERENCE_OPTIONS = __esm({
 });
 
 // node_modules/@smithy/property-provider/dist-cjs/index.js
-var require_dist_cjs25 = __commonJS({
+var require_dist_cjs29 = __commonJS({
   "node_modules/@smithy/property-provider/dist-cjs/index.js"(exports2) {
     "use strict";
     var ProviderError2 = class _ProviderError extends Error {
@@ -8564,19 +9257,19 @@ var require_dist_cjs25 = __commonJS({
       name = "ProviderError";
       tryNextLink;
       constructor(message, options = true) {
-        let logger21;
+        let logger25;
         let tryNextLink = true;
         if (typeof options === "boolean") {
-          logger21 = void 0;
+          logger25 = void 0;
           tryNextLink = options;
         } else if (options != null && typeof options === "object") {
-          logger21 = options.logger;
+          logger25 = options.logger;
           tryNextLink = options.tryNextLink ?? true;
         }
         super(message);
         this.tryNextLink = tryNextLink;
         Object.setPrototypeOf(this, _ProviderError.prototype);
-        logger21?.debug?.(`@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`);
+        logger25?.debug?.(`@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`);
       }
       static from(error2, options = true) {
         return Object.assign(new this(error2.message, options), error2);
@@ -8680,7 +9373,7 @@ var import_property_provider, resolveAwsSdkSigV4AConfig, NODE_SIGV4A_CONFIG_OPTI
 var init_resolveAwsSdkSigV4AConfig = __esm({
   "node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4AConfig.js"() {
     init_dist_es();
-    import_property_provider = __toESM(require_dist_cjs25());
+    import_property_provider = __toESM(require_dist_cjs29());
     resolveAwsSdkSigV4AConfig = /* @__PURE__ */ __name((config) => {
       config.sigv4aSigningRegionSet = normalizeProvider2(config.sigv4aSigningRegionSet);
       return config;
@@ -8708,15 +9401,15 @@ var init_resolveAwsSdkSigV4AConfig = __esm({
 });
 
 // node_modules/@smithy/signature-v4/dist-cjs/index.js
-var require_dist_cjs26 = __commonJS({
+var require_dist_cjs30 = __commonJS({
   "node_modules/@smithy/signature-v4/dist-cjs/index.js"(exports2) {
     "use strict";
-    var utilHexEncoding = require_dist_cjs18();
-    var utilUtf8 = require_dist_cjs12();
-    var isArrayBuffer = require_dist_cjs10();
+    var utilHexEncoding = require_dist_cjs22();
+    var utilUtf8 = require_dist_cjs14();
+    var isArrayBuffer = require_dist_cjs12();
     var protocolHttp = require_dist_cjs3();
     var utilMiddleware = require_dist_cjs2();
-    var utilUriEscape = require_dist_cjs14();
+    var utilUriEscape = require_dist_cjs17();
     var ALGORITHM_QUERY_PARAM = "X-Amz-Algorithm";
     var CREDENTIAL_QUERY_PARAM = "X-Amz-Credential";
     var AMZ_DATE_QUERY_PARAM = "X-Amz-Date";
@@ -9278,7 +9971,7 @@ var init_resolveAwsSdkSigV4Config = __esm({
   "node_modules/@aws-sdk/core/dist-es/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4Config.js"() {
     init_client();
     init_dist_es();
-    import_signature_v4 = __toESM(require_dist_cjs26());
+    import_signature_v4 = __toESM(require_dist_cjs30());
     resolveAwsSdkSigV4Config = /* @__PURE__ */ __name((config) => {
       let inputCredentials = config.credentials;
       let isUserSupplied = !!config.credentials;
@@ -9833,7 +10526,7 @@ var import_util_utf84, USE_TEXT_DECODER, USE_BUFFER, payload, dataView, textDeco
 var init_cbor_decode = __esm({
   "node_modules/@smithy/core/dist-es/submodules/cbor/cbor-decode.js"() {
     init_serde();
-    import_util_utf84 = __toESM(require_dist_cjs12());
+    import_util_utf84 = __toESM(require_dist_cjs14());
     init_cbor_types();
     USE_TEXT_DECODER = typeof TextDecoder !== "undefined";
     USE_BUFFER = typeof Buffer !== "undefined";
@@ -10058,7 +10751,7 @@ var import_util_utf85, USE_BUFFER2, initialSize, data, dataView2, cursor;
 var init_cbor_encode = __esm({
   "node_modules/@smithy/core/dist-es/submodules/cbor/cbor-encode.js"() {
     init_serde();
-    import_util_utf85 = __toESM(require_dist_cjs12());
+    import_util_utf85 = __toESM(require_dist_cjs14());
     init_cbor_types();
     USE_BUFFER2 = typeof Buffer !== "undefined";
     initialSize = 2048;
@@ -10146,7 +10839,7 @@ var init_CborCodec = __esm({
     init_protocols();
     init_schema();
     init_serde();
-    import_util_base643 = __toESM(require_dist_cjs13());
+    import_util_base643 = __toESM(require_dist_cjs15());
     init_cbor();
     init_parseCborBody();
     CborCodec = class extends SerdeContext {
@@ -10225,6 +10918,11 @@ var init_CborCodec = __esm({
                 newObject[key] = value;
               }
             }
+            const isUnion = ns.isUnionSchema();
+            if (isUnion && Array.isArray(sourceObject.$unknown)) {
+              const [k4, v4] = sourceObject.$unknown;
+              newObject[k4] = v4;
+            }
           } else if (ns.isDocumentSchema()) {
             for (const key of Object.keys(sourceObject)) {
               newObject[key] = this.serialize(ns.getValueSchema(), sourceObject[key]);
@@ -10304,11 +11002,22 @@ var init_CborCodec = __esm({
               }
             }
           } else if (ns.isStructSchema()) {
+            const isUnion = ns.isUnionSchema();
+            let keys;
+            if (isUnion) {
+              keys = new Set(Object.keys(value).filter((k4) => k4 !== "__type"));
+            }
             for (const [key, memberSchema] of ns.structIterator()) {
-              const v4 = this.readValue(memberSchema, value[key]);
-              if (v4 != null) {
-                newObject[key] = v4;
+              if (isUnion) {
+                keys.delete(key);
               }
+              if (value[key] != null) {
+                newObject[key] = this.readValue(memberSchema, value[key]);
+              }
+            }
+            if (isUnion && keys?.size === 1 && Object.keys(newObject).length === 0) {
+              const k4 = keys.values().next().value;
+              newObject.$unknown = [k4, value[k4]];
             }
           }
           return newObject;
@@ -10433,7 +11142,7 @@ var init_cbor2 = __esm({
 });
 
 // node_modules/@smithy/middleware-stack/dist-cjs/index.js
-var require_dist_cjs27 = __commonJS({
+var require_dist_cjs31 = __commonJS({
   "node_modules/@smithy/middleware-stack/dist-cjs/index.js"(exports2) {
     "use strict";
     var getAllAliases = /* @__PURE__ */ __name((name, aliases) => {
@@ -10704,10 +11413,10 @@ var require_dist_cjs27 = __commonJS({
 });
 
 // node_modules/@smithy/smithy-client/dist-cjs/index.js
-var require_dist_cjs28 = __commonJS({
+var require_dist_cjs32 = __commonJS({
   "node_modules/@smithy/smithy-client/dist-cjs/index.js"(exports2) {
     "use strict";
-    var middlewareStack = require_dist_cjs27();
+    var middlewareStack = require_dist_cjs31();
     var protocols = (init_protocols(), __toCommonJS(protocols_exports));
     var types = require_dist_cjs();
     var schema = (init_schema(), __toCommonJS(schema_exports));
@@ -10722,6 +11431,12 @@ var require_dist_cjs28 = __commonJS({
       handlers;
       constructor(config) {
         this.config = config;
+        const { protocol, protocolSettings } = config;
+        if (protocolSettings) {
+          if (typeof protocol === "function") {
+            config.protocol = new protocol(protocolSettings);
+          }
+        }
       }
       send(command, optionsOrCb, cb) {
         const options = typeof optionsOrCb !== "function" ? optionsOrCb : void 0;
@@ -10801,9 +11516,9 @@ var require_dist_cjs28 = __commonJS({
           this.middlewareStack.use(mw);
         }
         const stack = clientStack.concat(this.middlewareStack);
-        const { logger: logger21 } = configuration;
+        const { logger: logger25 } = configuration;
         const handlerExecutionContext = {
-          logger: logger21,
+          logger: logger25,
           clientName,
           commandName,
           inputFilterSensitiveLog,
@@ -11296,7 +12011,7 @@ var import_smithy_client, ProtocolLib;
 var init_ProtocolLib = __esm({
   "node_modules/@aws-sdk/core/dist-es/submodules/protocols/ProtocolLib.js"() {
     init_schema();
-    import_smithy_client = __toESM(require_dist_cjs28());
+    import_smithy_client = __toESM(require_dist_cjs32());
     ProtocolLib = class {
       static {
         __name(this, "ProtocolLib");
@@ -11628,8 +12343,8 @@ var init_jsonReviver = __esm({
 var import_smithy_client2, import_util_utf86, collectBodyString;
 var init_common = __esm({
   "node_modules/@aws-sdk/core/dist-es/submodules/protocols/common.js"() {
-    import_smithy_client2 = __toESM(require_dist_cjs28());
-    import_util_utf86 = __toESM(require_dist_cjs12());
+    import_smithy_client2 = __toESM(require_dist_cjs32());
+    import_util_utf86 = __toESM(require_dist_cjs14());
     collectBodyString = /* @__PURE__ */ __name((streamBody, context) => (0, import_smithy_client2.collectBody)(streamBody, context).then((body) => (context?.utf8Encoder ?? import_util_utf86.toUtf8)(body)), "collectBodyString");
   }
 });
@@ -11701,7 +12416,7 @@ var init_JsonShapeDeserializer = __esm({
     init_protocols();
     init_schema();
     init_serde();
-    import_util_base644 = __toESM(require_dist_cjs13());
+    import_util_base644 = __toESM(require_dist_cjs15());
     init_ConfigurableSerdeContext();
     init_structIterator();
     init_jsonReviver();
@@ -11892,7 +12607,7 @@ var init_JsonShapeSerializer = __esm({
     init_protocols();
     init_schema();
     init_serde();
-    import_util_base645 = __toESM(require_dist_cjs13());
+    import_util_base645 = __toESM(require_dist_cjs15());
     init_ConfigurableSerdeContext();
     init_structIterator();
     init_jsonReplacer();
@@ -12316,7 +13031,7 @@ var init_AwsRestJsonProtocol = __esm({
 var import_smithy_client3, awsExpectUnion;
 var init_awsExpectUnion = __esm({
   "node_modules/@aws-sdk/core/dist-es/submodules/protocols/json/awsExpectUnion.js"() {
-    import_smithy_client3 = __toESM(require_dist_cjs28());
+    import_smithy_client3 = __toESM(require_dist_cjs32());
     awsExpectUnion = /* @__PURE__ */ __name((value) => {
       if (value == null) {
         return void 0;
@@ -13201,7 +13916,7 @@ var require_xml_parser = __commonJS({
 });
 
 // node_modules/@aws-sdk/xml-builder/dist-cjs/index.js
-var require_dist_cjs29 = __commonJS({
+var require_dist_cjs33 = __commonJS({
   "node_modules/@aws-sdk/xml-builder/dist-cjs/index.js"(exports2) {
     "use strict";
     var xmlParser = require_xml_parser();
@@ -13329,11 +14044,11 @@ var require_dist_cjs29 = __commonJS({
 var import_xml_builder, import_smithy_client4, import_util_utf87, XmlShapeDeserializer;
 var init_XmlShapeDeserializer = __esm({
   "node_modules/@aws-sdk/core/dist-es/submodules/protocols/xml/XmlShapeDeserializer.js"() {
-    import_xml_builder = __toESM(require_dist_cjs29());
+    import_xml_builder = __toESM(require_dist_cjs33());
     init_protocols();
     init_schema();
-    import_smithy_client4 = __toESM(require_dist_cjs28());
-    import_util_utf87 = __toESM(require_dist_cjs12());
+    import_smithy_client4 = __toESM(require_dist_cjs32());
+    import_util_utf87 = __toESM(require_dist_cjs14());
     init_ConfigurableSerdeContext();
     XmlShapeDeserializer = class extends SerdeContextConfig {
       static {
@@ -13478,8 +14193,8 @@ var init_QueryShapeSerializer = __esm({
     init_protocols();
     init_schema();
     init_serde();
-    import_smithy_client5 = __toESM(require_dist_cjs28());
-    import_util_base646 = __toESM(require_dist_cjs13());
+    import_smithy_client5 = __toESM(require_dist_cjs32());
+    import_util_base646 = __toESM(require_dist_cjs15());
     init_ConfigurableSerdeContext();
     init_structIterator();
     QueryShapeSerializer = class extends SerdeContextConfig {
@@ -13803,8 +14518,8 @@ var init_AwsEc2QueryProtocol = __esm({
 var import_xml_builder2, import_smithy_client6, parseXmlBody, parseXmlErrorBody, loadRestXmlErrorCode;
 var init_parseXmlBody = __esm({
   "node_modules/@aws-sdk/core/dist-es/submodules/protocols/xml/parseXmlBody.js"() {
-    import_xml_builder2 = __toESM(require_dist_cjs29());
-    import_smithy_client6 = __toESM(require_dist_cjs28());
+    import_xml_builder2 = __toESM(require_dist_cjs33());
+    import_smithy_client6 = __toESM(require_dist_cjs32());
     init_common();
     parseXmlBody = /* @__PURE__ */ __name((streamBody, context) => collectBodyString(streamBody, context).then((encoded) => {
       if (encoded.length) {
@@ -13855,12 +14570,12 @@ var init_parseXmlBody = __esm({
 var import_xml_builder3, import_smithy_client7, import_util_base647, XmlShapeSerializer;
 var init_XmlShapeSerializer = __esm({
   "node_modules/@aws-sdk/core/dist-es/submodules/protocols/xml/XmlShapeSerializer.js"() {
-    import_xml_builder3 = __toESM(require_dist_cjs29());
+    import_xml_builder3 = __toESM(require_dist_cjs33());
     init_protocols();
     init_schema();
     init_serde();
-    import_smithy_client7 = __toESM(require_dist_cjs28());
-    import_util_base647 = __toESM(require_dist_cjs13());
+    import_smithy_client7 = __toESM(require_dist_cjs32());
+    import_util_base647 = __toESM(require_dist_cjs15());
     init_ConfigurableSerdeContext();
     init_structIterator();
     XmlShapeSerializer = class extends SerdeContextConfig {
@@ -14336,11 +15051,11 @@ var init_dist_es2 = __esm({
 });
 
 // node_modules/@aws-sdk/middleware-user-agent/dist-cjs/index.js
-var require_dist_cjs30 = __commonJS({
+var require_dist_cjs34 = __commonJS({
   "node_modules/@aws-sdk/middleware-user-agent/dist-cjs/index.js"(exports2) {
     "use strict";
     var core = (init_dist_es(), __toCommonJS(dist_es_exports));
-    var utilEndpoints = require_dist_cjs24();
+    var utilEndpoints = require_dist_cjs28();
     var protocolHttp = require_dist_cjs3();
     var core$1 = (init_dist_es2(), __toCommonJS(dist_es_exports2));
     var DEFAULT_UA_APP_ID = void 0;
@@ -14359,11 +15074,11 @@ var require_dist_cjs30 = __commonJS({
         userAgentAppId: /* @__PURE__ */ __name(async () => {
           const appId = await normalizedAppIdProvider();
           if (!isValidUserAgentAppId(appId)) {
-            const logger21 = input.logger?.constructor?.name === "NoOpLogger" || !input.logger ? console : input.logger;
+            const logger25 = input.logger?.constructor?.name === "NoOpLogger" || !input.logger ? console : input.logger;
             if (typeof appId !== "string") {
-              logger21?.warn("userAgentAppId must be a string or undefined.");
+              logger25?.warn("userAgentAppId must be a string or undefined.");
             } else if (appId.length > 50) {
-              logger21?.warn("The provided userAgentAppId exceeds the maximum length of 50 characters.");
+              logger25?.warn("The provided userAgentAppId exceeds the maximum length of 50 characters.");
             }
           }
           return appId;
@@ -14519,7 +15234,7 @@ var require_dist_cjs30 = __commonJS({
 });
 
 // node_modules/@smithy/util-config-provider/dist-cjs/index.js
-var require_dist_cjs31 = __commonJS({
+var require_dist_cjs35 = __commonJS({
   "node_modules/@smithy/util-config-provider/dist-cjs/index.js"(exports2) {
     "use strict";
     var booleanSelector = /* @__PURE__ */ __name((obj, key, type) => {
@@ -14551,12 +15266,12 @@ var require_dist_cjs31 = __commonJS({
 });
 
 // node_modules/@smithy/config-resolver/dist-cjs/index.js
-var require_dist_cjs32 = __commonJS({
+var require_dist_cjs36 = __commonJS({
   "node_modules/@smithy/config-resolver/dist-cjs/index.js"(exports2) {
     "use strict";
-    var utilConfigProvider = require_dist_cjs31();
+    var utilConfigProvider = require_dist_cjs35();
     var utilMiddleware = require_dist_cjs2();
-    var utilEndpoints = require_dist_cjs21();
+    var utilEndpoints = require_dist_cjs25();
     var ENV_USE_DUALSTACK_ENDPOINT = "AWS_USE_DUALSTACK_ENDPOINT";
     var CONFIG_USE_DUALSTACK_ENDPOINT = "use_dualstack_endpoint";
     var DEFAULT_USE_DUALSTACK_ENDPOINT = false;
@@ -14667,56 +15382,228 @@ var require_dist_cjs32 = __commonJS({
           return regionRegexmatchArray[0].slice(1, -1);
         }
       }
-    }, "getResolvedSigningRegion");
-    var getRegionInfo = /* @__PURE__ */ __name((region, { useFipsEndpoint = false, useDualstackEndpoint = false, signingService, regionHash, partitionHash }) => {
-      const partition = getResolvedPartition(region, { partitionHash });
-      const resolvedRegion = region in regionHash ? region : partitionHash[partition]?.endpoint ?? region;
-      const hostnameOptions = { useFipsEndpoint, useDualstackEndpoint };
-      const regionHostname = getHostnameFromVariants(regionHash[resolvedRegion]?.variants, hostnameOptions);
-      const partitionHostname = getHostnameFromVariants(partitionHash[partition]?.variants, hostnameOptions);
-      const hostname = getResolvedHostname(resolvedRegion, { regionHostname, partitionHostname });
-      if (hostname === void 0) {
-        throw new Error(`Endpoint resolution failed for: ${{ resolvedRegion, useFipsEndpoint, useDualstackEndpoint }}`);
-      }
-      const signingRegion = getResolvedSigningRegion(hostname, {
-        signingRegion: regionHash[resolvedRegion]?.signingRegion,
-        regionRegex: partitionHash[partition].regionRegex,
-        useFipsEndpoint
-      });
-      return {
-        partition,
-        signingService,
-        hostname,
-        ...signingRegion && { signingRegion },
-        ...regionHash[resolvedRegion]?.signingService && {
-          signingService: regionHash[resolvedRegion].signingService
+    }, "getResolvedSigningRegion");
+    var getRegionInfo = /* @__PURE__ */ __name((region, { useFipsEndpoint = false, useDualstackEndpoint = false, signingService, regionHash, partitionHash }) => {
+      const partition = getResolvedPartition(region, { partitionHash });
+      const resolvedRegion = region in regionHash ? region : partitionHash[partition]?.endpoint ?? region;
+      const hostnameOptions = { useFipsEndpoint, useDualstackEndpoint };
+      const regionHostname = getHostnameFromVariants(regionHash[resolvedRegion]?.variants, hostnameOptions);
+      const partitionHostname = getHostnameFromVariants(partitionHash[partition]?.variants, hostnameOptions);
+      const hostname = getResolvedHostname(resolvedRegion, { regionHostname, partitionHostname });
+      if (hostname === void 0) {
+        throw new Error(`Endpoint resolution failed for: ${{ resolvedRegion, useFipsEndpoint, useDualstackEndpoint }}`);
+      }
+      const signingRegion = getResolvedSigningRegion(hostname, {
+        signingRegion: regionHash[resolvedRegion]?.signingRegion,
+        regionRegex: partitionHash[partition].regionRegex,
+        useFipsEndpoint
+      });
+      return {
+        partition,
+        signingService,
+        hostname,
+        ...signingRegion && { signingRegion },
+        ...regionHash[resolvedRegion]?.signingService && {
+          signingService: regionHash[resolvedRegion].signingService
+        }
+      };
+    }, "getRegionInfo");
+    exports2.CONFIG_USE_DUALSTACK_ENDPOINT = CONFIG_USE_DUALSTACK_ENDPOINT;
+    exports2.CONFIG_USE_FIPS_ENDPOINT = CONFIG_USE_FIPS_ENDPOINT;
+    exports2.DEFAULT_USE_DUALSTACK_ENDPOINT = DEFAULT_USE_DUALSTACK_ENDPOINT;
+    exports2.DEFAULT_USE_FIPS_ENDPOINT = DEFAULT_USE_FIPS_ENDPOINT;
+    exports2.ENV_USE_DUALSTACK_ENDPOINT = ENV_USE_DUALSTACK_ENDPOINT;
+    exports2.ENV_USE_FIPS_ENDPOINT = ENV_USE_FIPS_ENDPOINT;
+    exports2.NODE_REGION_CONFIG_FILE_OPTIONS = NODE_REGION_CONFIG_FILE_OPTIONS4;
+    exports2.NODE_REGION_CONFIG_OPTIONS = NODE_REGION_CONFIG_OPTIONS4;
+    exports2.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS4;
+    exports2.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS4;
+    exports2.REGION_ENV_NAME = REGION_ENV_NAME;
+    exports2.REGION_INI_NAME = REGION_INI_NAME;
+    exports2.getRegionInfo = getRegionInfo;
+    exports2.resolveCustomEndpointsConfig = resolveCustomEndpointsConfig;
+    exports2.resolveEndpointsConfig = resolveEndpointsConfig;
+    exports2.resolveRegionConfig = resolveRegionConfig4;
+  }
+});
+
+// node_modules/@smithy/middleware-content-length/node_modules/@smithy/protocol-http/dist-cjs/index.js
+var require_dist_cjs37 = __commonJS({
+  "node_modules/@smithy/middleware-content-length/node_modules/@smithy/protocol-http/dist-cjs/index.js"(exports2) {
+    "use strict";
+    var types = require_dist_cjs();
+    var getHttpHandlerExtensionConfiguration4 = /* @__PURE__ */ __name((runtimeConfig) => {
+      return {
+        setHttpHandler(handler2) {
+          runtimeConfig.httpHandler = handler2;
+        },
+        httpHandler() {
+          return runtimeConfig.httpHandler;
+        },
+        updateHttpClientConfig(key, value) {
+          runtimeConfig.httpHandler?.updateHttpClientConfig(key, value);
+        },
+        httpHandlerConfigs() {
+          return runtimeConfig.httpHandler.httpHandlerConfigs();
+        }
+      };
+    }, "getHttpHandlerExtensionConfiguration");
+    var resolveHttpHandlerRuntimeConfig4 = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => {
+      return {
+        httpHandler: httpHandlerExtensionConfiguration.httpHandler()
+      };
+    }, "resolveHttpHandlerRuntimeConfig");
+    var Field = class {
+      static {
+        __name(this, "Field");
+      }
+      name;
+      kind;
+      values;
+      constructor({ name, kind = types.FieldPosition.HEADER, values = [] }) {
+        this.name = name;
+        this.kind = kind;
+        this.values = values;
+      }
+      add(value) {
+        this.values.push(value);
+      }
+      set(values) {
+        this.values = values;
+      }
+      remove(value) {
+        this.values = this.values.filter((v4) => v4 !== value);
+      }
+      toString() {
+        return this.values.map((v4) => v4.includes(",") || v4.includes(" ") ? `"${v4}"` : v4).join(", ");
+      }
+      get() {
+        return this.values;
+      }
+    };
+    var Fields = class {
+      static {
+        __name(this, "Fields");
+      }
+      entries = {};
+      encoding;
+      constructor({ fields = [], encoding = "utf-8" }) {
+        fields.forEach(this.setField.bind(this));
+        this.encoding = encoding;
+      }
+      setField(field) {
+        this.entries[field.name.toLowerCase()] = field;
+      }
+      getField(name) {
+        return this.entries[name.toLowerCase()];
+      }
+      removeField(name) {
+        delete this.entries[name.toLowerCase()];
+      }
+      getByType(kind) {
+        return Object.values(this.entries).filter((field) => field.kind === kind);
+      }
+    };
+    var HttpRequest10 = class _HttpRequest {
+      static {
+        __name(this, "HttpRequest");
+      }
+      method;
+      protocol;
+      hostname;
+      port;
+      path;
+      query;
+      headers;
+      username;
+      password;
+      fragment;
+      body;
+      constructor(options) {
+        this.method = options.method || "GET";
+        this.hostname = options.hostname || "localhost";
+        this.port = options.port;
+        this.query = options.query || {};
+        this.headers = options.headers || {};
+        this.body = options.body;
+        this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:";
+        this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/";
+        this.username = options.username;
+        this.password = options.password;
+        this.fragment = options.fragment;
+      }
+      static clone(request2) {
+        const cloned = new _HttpRequest({
+          ...request2,
+          headers: { ...request2.headers }
+        });
+        if (cloned.query) {
+          cloned.query = cloneQuery(cloned.query);
+        }
+        return cloned;
+      }
+      static isInstance(request2) {
+        if (!request2) {
+          return false;
         }
-      };
-    }, "getRegionInfo");
-    exports2.CONFIG_USE_DUALSTACK_ENDPOINT = CONFIG_USE_DUALSTACK_ENDPOINT;
-    exports2.CONFIG_USE_FIPS_ENDPOINT = CONFIG_USE_FIPS_ENDPOINT;
-    exports2.DEFAULT_USE_DUALSTACK_ENDPOINT = DEFAULT_USE_DUALSTACK_ENDPOINT;
-    exports2.DEFAULT_USE_FIPS_ENDPOINT = DEFAULT_USE_FIPS_ENDPOINT;
-    exports2.ENV_USE_DUALSTACK_ENDPOINT = ENV_USE_DUALSTACK_ENDPOINT;
-    exports2.ENV_USE_FIPS_ENDPOINT = ENV_USE_FIPS_ENDPOINT;
-    exports2.NODE_REGION_CONFIG_FILE_OPTIONS = NODE_REGION_CONFIG_FILE_OPTIONS4;
-    exports2.NODE_REGION_CONFIG_OPTIONS = NODE_REGION_CONFIG_OPTIONS4;
-    exports2.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS4;
-    exports2.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS4;
-    exports2.REGION_ENV_NAME = REGION_ENV_NAME;
-    exports2.REGION_INI_NAME = REGION_INI_NAME;
-    exports2.getRegionInfo = getRegionInfo;
-    exports2.resolveCustomEndpointsConfig = resolveCustomEndpointsConfig;
-    exports2.resolveEndpointsConfig = resolveEndpointsConfig;
-    exports2.resolveRegionConfig = resolveRegionConfig4;
+        const req = request2;
+        return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object";
+      }
+      clone() {
+        return _HttpRequest.clone(this);
+      }
+    };
+    function cloneQuery(query) {
+      return Object.keys(query).reduce((carry, paramName) => {
+        const param = query[paramName];
+        return {
+          ...carry,
+          [paramName]: Array.isArray(param) ? [...param] : param
+        };
+      }, {});
+    }
+    __name(cloneQuery, "cloneQuery");
+    var HttpResponse4 = class {
+      static {
+        __name(this, "HttpResponse");
+      }
+      statusCode;
+      reason;
+      headers;
+      body;
+      constructor(options) {
+        this.statusCode = options.statusCode;
+        this.reason = options.reason;
+        this.headers = options.headers || {};
+        this.body = options.body;
+      }
+      static isInstance(response) {
+        if (!response)
+          return false;
+        const resp = response;
+        return typeof resp.statusCode === "number" && typeof resp.headers === "object";
+      }
+    };
+    function isValidHostname(hostname) {
+      const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/;
+      return hostPattern.test(hostname);
+    }
+    __name(isValidHostname, "isValidHostname");
+    exports2.Field = Field;
+    exports2.Fields = Fields;
+    exports2.HttpRequest = HttpRequest10;
+    exports2.HttpResponse = HttpResponse4;
+    exports2.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration4;
+    exports2.isValidHostname = isValidHostname;
+    exports2.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig4;
   }
 });
 
 // node_modules/@smithy/middleware-content-length/dist-cjs/index.js
-var require_dist_cjs33 = __commonJS({
+var require_dist_cjs38 = __commonJS({
   "node_modules/@smithy/middleware-content-length/dist-cjs/index.js"(exports2) {
     "use strict";
-    var protocolHttp = require_dist_cjs3();
+    var protocolHttp = require_dist_cjs37();
     var CONTENT_LENGTH_HEADER = "content-length";
     function contentLengthMiddleware(bodyLengthChecker) {
       return (next) => async (args) => {
@@ -14852,7 +15739,7 @@ var require_readFile = __commonJS({
 });
 
 // node_modules/@smithy/shared-ini-file-loader/dist-cjs/index.js
-var require_dist_cjs34 = __commonJS({
+var require_dist_cjs39 = __commonJS({
   "node_modules/@smithy/shared-ini-file-loader/dist-cjs/index.js"(exports2) {
     "use strict";
     var getHomeDir = require_getHomeDir();
@@ -15030,11 +15917,11 @@ var require_dist_cjs34 = __commonJS({
 });
 
 // node_modules/@smithy/node-config-provider/dist-cjs/index.js
-var require_dist_cjs35 = __commonJS({
+var require_dist_cjs40 = __commonJS({
   "node_modules/@smithy/node-config-provider/dist-cjs/index.js"(exports2) {
     "use strict";
-    var propertyProvider = require_dist_cjs25();
-    var sharedIniFileLoader = require_dist_cjs34();
+    var propertyProvider = require_dist_cjs29();
+    var sharedIniFileLoader = require_dist_cjs39();
     function getSelectorName(functionString) {
       try {
         const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? []));
@@ -15078,8 +15965,8 @@ var require_dist_cjs35 = __commonJS({
     var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction");
     var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : propertyProvider.fromStatic(defaultValue), "fromStatic");
     var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => {
-      const { signingName, logger: logger21 } = configuration;
-      const envOptions = { signingName, logger: logger21 };
+      const { signingName, logger: logger25 } = configuration;
+      const envOptions = { signingName, logger: logger25 };
       return propertyProvider.memoize(propertyProvider.chain(fromEnv(environmentVariableSelector, envOptions), fromSharedConfigFiles(configFileSelector, configuration), fromStatic(defaultValue)));
     }, "loadConfig");
     exports2.loadConfig = loadConfig;
@@ -15092,7 +15979,7 @@ var require_getEndpointUrlConfig = __commonJS({
     "use strict";
     Object.defineProperty(exports2, "__esModule", { value: true });
     exports2.getEndpointUrlConfig = void 0;
-    var shared_ini_file_loader_1 = require_dist_cjs34();
+    var shared_ini_file_loader_1 = require_dist_cjs39();
     var ENV_ENDPOINT_URL = "AWS_ENDPOINT_URL";
     var CONFIG_ENDPOINT_URL = "endpoint_url";
     var getEndpointUrlConfig = /* @__PURE__ */ __name((serviceId) => ({
@@ -15133,7 +16020,7 @@ var require_getEndpointFromConfig = __commonJS({
     "use strict";
     Object.defineProperty(exports2, "__esModule", { value: true });
     exports2.getEndpointFromConfig = void 0;
-    var node_config_provider_1 = require_dist_cjs35();
+    var node_config_provider_1 = require_dist_cjs40();
     var getEndpointUrlConfig_1 = require_getEndpointUrlConfig();
     var getEndpointFromConfig = /* @__PURE__ */ __name(async (serviceId) => (0, node_config_provider_1.loadConfig)((0, getEndpointUrlConfig_1.getEndpointUrlConfig)(serviceId ?? ""))(), "getEndpointFromConfig");
     exports2.getEndpointFromConfig = getEndpointFromConfig;
@@ -15141,14 +16028,14 @@ var require_getEndpointFromConfig = __commonJS({
 });
 
 // node_modules/@smithy/middleware-endpoint/dist-cjs/index.js
-var require_dist_cjs36 = __commonJS({
+var require_dist_cjs41 = __commonJS({
   "node_modules/@smithy/middleware-endpoint/dist-cjs/index.js"(exports2) {
     "use strict";
     var getEndpointFromConfig = require_getEndpointFromConfig();
-    var urlParser = require_dist_cjs23();
+    var urlParser = require_dist_cjs27();
     var core = (init_dist_es(), __toCommonJS(dist_es_exports));
     var utilMiddleware = require_dist_cjs2();
-    var middlewareSerde = require_dist_cjs9();
+    var middlewareSerde = require_dist_cjs10();
     var resolveParamsForS3 = /* @__PURE__ */ __name(async (endpointParams) => {
       const bucket = endpointParams?.Bucket || "";
       if (typeof endpointParams.Bucket === "string") {
@@ -15180,9 +16067,16 @@ var require_dist_cjs36 = __commonJS({
       }
       return isValidArn;
     }, "isArnBucketName");
-    var createConfigValueProvider = /* @__PURE__ */ __name((configKey, canonicalEndpointParamKey, config) => {
+    var createConfigValueProvider = /* @__PURE__ */ __name((configKey, canonicalEndpointParamKey, config, isClientContextParam = false) => {
       const configProvider = /* @__PURE__ */ __name(async () => {
-        const configValue = config[configKey] ?? config[canonicalEndpointParamKey];
+        let configValue;
+        if (isClientContextParam) {
+          const clientContextParams = config.clientContextParams;
+          const nestedValue = clientContextParams?.[configKey];
+          configValue = nestedValue ?? config[configKey] ?? config[canonicalEndpointParamKey];
+        } else {
+          configValue = config[configKey] ?? config[canonicalEndpointParamKey];
+        }
         if (typeof configValue === "function") {
           return configValue();
         }
@@ -15264,7 +16158,7 @@ var require_dist_cjs36 = __commonJS({
             break;
           case "clientContextParams":
           case "builtInParams":
-            endpointParams[name] = await createConfigValueProvider(instruction.name, name, clientConfig)();
+            endpointParams[name] = await createConfigValueProvider(instruction.name, name, clientConfig, instruction.type !== "builtInParams")();
             break;
           case "operationContextParams":
             endpointParams[name] = instruction.get(commandInput);
@@ -15372,7 +16266,7 @@ var require_dist_cjs36 = __commonJS({
 });
 
 // node_modules/@smithy/service-error-classification/dist-cjs/index.js
-var require_dist_cjs37 = __commonJS({
+var require_dist_cjs42 = __commonJS({
   "node_modules/@smithy/service-error-classification/dist-cjs/index.js"(exports2) {
     "use strict";
     var CLOCK_SKEW_ERROR_CODES = [
@@ -15443,10 +16337,10 @@ var require_dist_cjs37 = __commonJS({
 });
 
 // node_modules/@smithy/util-retry/dist-cjs/index.js
-var require_dist_cjs38 = __commonJS({
+var require_dist_cjs43 = __commonJS({
   "node_modules/@smithy/util-retry/dist-cjs/index.js"(exports2) {
     "use strict";
-    var serviceErrorClassification = require_dist_cjs37();
+    var serviceErrorClassification = require_dist_cjs42();
     exports2.RETRY_MODES = void 0;
     (function(RETRY_MODES) {
       RETRY_MODES["STANDARD"] = "standard";
@@ -15635,89 +16529,261 @@ var require_dist_cjs38 = __commonJS({
       recordSuccess(token) {
         this.capacity = Math.max(INITIAL_RETRY_TOKENS, this.capacity + (token.getRetryCost() ?? NO_RETRY_INCREMENT));
       }
-      getCapacity() {
-        return this.capacity;
+      getCapacity() {
+        return this.capacity;
+      }
+      async getMaxAttempts() {
+        try {
+          return await this.maxAttemptsProvider();
+        } catch (error2) {
+          console.warn(`Max attempts provider could not resolve. Using default of ${DEFAULT_MAX_ATTEMPTS}`);
+          return DEFAULT_MAX_ATTEMPTS;
+        }
+      }
+      shouldRetry(tokenToRenew, errorInfo, maxAttempts) {
+        const attempts = tokenToRenew.getRetryCount() + 1;
+        return attempts < maxAttempts && this.capacity >= this.getCapacityCost(errorInfo.errorType) && this.isRetryableError(errorInfo.errorType);
+      }
+      getCapacityCost(errorType) {
+        return errorType === "TRANSIENT" ? TIMEOUT_RETRY_COST : RETRY_COST;
+      }
+      isRetryableError(errorType) {
+        return errorType === "THROTTLING" || errorType === "TRANSIENT";
+      }
+    };
+    var AdaptiveRetryStrategy = class {
+      static {
+        __name(this, "AdaptiveRetryStrategy");
+      }
+      maxAttemptsProvider;
+      rateLimiter;
+      standardRetryStrategy;
+      mode = exports2.RETRY_MODES.ADAPTIVE;
+      constructor(maxAttemptsProvider, options) {
+        this.maxAttemptsProvider = maxAttemptsProvider;
+        const { rateLimiter } = options ?? {};
+        this.rateLimiter = rateLimiter ?? new DefaultRateLimiter();
+        this.standardRetryStrategy = new StandardRetryStrategy(maxAttemptsProvider);
+      }
+      async acquireInitialRetryToken(retryTokenScope) {
+        await this.rateLimiter.getSendToken();
+        return this.standardRetryStrategy.acquireInitialRetryToken(retryTokenScope);
+      }
+      async refreshRetryTokenForRetry(tokenToRenew, errorInfo) {
+        this.rateLimiter.updateClientSendingRate(errorInfo);
+        return this.standardRetryStrategy.refreshRetryTokenForRetry(tokenToRenew, errorInfo);
+      }
+      recordSuccess(token) {
+        this.rateLimiter.updateClientSendingRate({});
+        this.standardRetryStrategy.recordSuccess(token);
+      }
+    };
+    var ConfiguredRetryStrategy = class extends StandardRetryStrategy {
+      static {
+        __name(this, "ConfiguredRetryStrategy");
+      }
+      computeNextBackoffDelay;
+      constructor(maxAttempts, computeNextBackoffDelay = DEFAULT_RETRY_DELAY_BASE) {
+        super(typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts);
+        if (typeof computeNextBackoffDelay === "number") {
+          this.computeNextBackoffDelay = () => computeNextBackoffDelay;
+        } else {
+          this.computeNextBackoffDelay = computeNextBackoffDelay;
+        }
+      }
+      async refreshRetryTokenForRetry(tokenToRenew, errorInfo) {
+        const token = await super.refreshRetryTokenForRetry(tokenToRenew, errorInfo);
+        token.getRetryDelay = () => this.computeNextBackoffDelay(token.getRetryCount());
+        return token;
+      }
+    };
+    exports2.AdaptiveRetryStrategy = AdaptiveRetryStrategy;
+    exports2.ConfiguredRetryStrategy = ConfiguredRetryStrategy;
+    exports2.DEFAULT_MAX_ATTEMPTS = DEFAULT_MAX_ATTEMPTS;
+    exports2.DEFAULT_RETRY_DELAY_BASE = DEFAULT_RETRY_DELAY_BASE;
+    exports2.DEFAULT_RETRY_MODE = DEFAULT_RETRY_MODE4;
+    exports2.DefaultRateLimiter = DefaultRateLimiter;
+    exports2.INITIAL_RETRY_TOKENS = INITIAL_RETRY_TOKENS;
+    exports2.INVOCATION_ID_HEADER = INVOCATION_ID_HEADER;
+    exports2.MAXIMUM_RETRY_DELAY = MAXIMUM_RETRY_DELAY;
+    exports2.NO_RETRY_INCREMENT = NO_RETRY_INCREMENT;
+    exports2.REQUEST_HEADER = REQUEST_HEADER;
+    exports2.RETRY_COST = RETRY_COST;
+    exports2.StandardRetryStrategy = StandardRetryStrategy;
+    exports2.THROTTLING_RETRY_DELAY_BASE = THROTTLING_RETRY_DELAY_BASE;
+    exports2.TIMEOUT_RETRY_COST = TIMEOUT_RETRY_COST;
+  }
+});
+
+// node_modules/@smithy/middleware-retry/node_modules/@smithy/protocol-http/dist-cjs/index.js
+var require_dist_cjs44 = __commonJS({
+  "node_modules/@smithy/middleware-retry/node_modules/@smithy/protocol-http/dist-cjs/index.js"(exports2) {
+    "use strict";
+    var types = require_dist_cjs();
+    var getHttpHandlerExtensionConfiguration4 = /* @__PURE__ */ __name((runtimeConfig) => {
+      return {
+        setHttpHandler(handler2) {
+          runtimeConfig.httpHandler = handler2;
+        },
+        httpHandler() {
+          return runtimeConfig.httpHandler;
+        },
+        updateHttpClientConfig(key, value) {
+          runtimeConfig.httpHandler?.updateHttpClientConfig(key, value);
+        },
+        httpHandlerConfigs() {
+          return runtimeConfig.httpHandler.httpHandlerConfigs();
+        }
+      };
+    }, "getHttpHandlerExtensionConfiguration");
+    var resolveHttpHandlerRuntimeConfig4 = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => {
+      return {
+        httpHandler: httpHandlerExtensionConfiguration.httpHandler()
+      };
+    }, "resolveHttpHandlerRuntimeConfig");
+    var Field = class {
+      static {
+        __name(this, "Field");
+      }
+      name;
+      kind;
+      values;
+      constructor({ name, kind = types.FieldPosition.HEADER, values = [] }) {
+        this.name = name;
+        this.kind = kind;
+        this.values = values;
+      }
+      add(value) {
+        this.values.push(value);
+      }
+      set(values) {
+        this.values = values;
+      }
+      remove(value) {
+        this.values = this.values.filter((v4) => v4 !== value);
+      }
+      toString() {
+        return this.values.map((v4) => v4.includes(",") || v4.includes(" ") ? `"${v4}"` : v4).join(", ");
+      }
+      get() {
+        return this.values;
+      }
+    };
+    var Fields = class {
+      static {
+        __name(this, "Fields");
+      }
+      entries = {};
+      encoding;
+      constructor({ fields = [], encoding = "utf-8" }) {
+        fields.forEach(this.setField.bind(this));
+        this.encoding = encoding;
       }
-      async getMaxAttempts() {
-        try {
-          return await this.maxAttemptsProvider();
-        } catch (error2) {
-          console.warn(`Max attempts provider could not resolve. Using default of ${DEFAULT_MAX_ATTEMPTS}`);
-          return DEFAULT_MAX_ATTEMPTS;
-        }
+      setField(field) {
+        this.entries[field.name.toLowerCase()] = field;
       }
-      shouldRetry(tokenToRenew, errorInfo, maxAttempts) {
-        const attempts = tokenToRenew.getRetryCount() + 1;
-        return attempts < maxAttempts && this.capacity >= this.getCapacityCost(errorInfo.errorType) && this.isRetryableError(errorInfo.errorType);
+      getField(name) {
+        return this.entries[name.toLowerCase()];
       }
-      getCapacityCost(errorType) {
-        return errorType === "TRANSIENT" ? TIMEOUT_RETRY_COST : RETRY_COST;
+      removeField(name) {
+        delete this.entries[name.toLowerCase()];
       }
-      isRetryableError(errorType) {
-        return errorType === "THROTTLING" || errorType === "TRANSIENT";
+      getByType(kind) {
+        return Object.values(this.entries).filter((field) => field.kind === kind);
       }
     };
-    var AdaptiveRetryStrategy = class {
+    var HttpRequest10 = class _HttpRequest {
       static {
-        __name(this, "AdaptiveRetryStrategy");
+        __name(this, "HttpRequest");
       }
-      maxAttemptsProvider;
-      rateLimiter;
-      standardRetryStrategy;
-      mode = exports2.RETRY_MODES.ADAPTIVE;
-      constructor(maxAttemptsProvider, options) {
-        this.maxAttemptsProvider = maxAttemptsProvider;
-        const { rateLimiter } = options ?? {};
-        this.rateLimiter = rateLimiter ?? new DefaultRateLimiter();
-        this.standardRetryStrategy = new StandardRetryStrategy(maxAttemptsProvider);
+      method;
+      protocol;
+      hostname;
+      port;
+      path;
+      query;
+      headers;
+      username;
+      password;
+      fragment;
+      body;
+      constructor(options) {
+        this.method = options.method || "GET";
+        this.hostname = options.hostname || "localhost";
+        this.port = options.port;
+        this.query = options.query || {};
+        this.headers = options.headers || {};
+        this.body = options.body;
+        this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:";
+        this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/";
+        this.username = options.username;
+        this.password = options.password;
+        this.fragment = options.fragment;
       }
-      async acquireInitialRetryToken(retryTokenScope) {
-        await this.rateLimiter.getSendToken();
-        return this.standardRetryStrategy.acquireInitialRetryToken(retryTokenScope);
+      static clone(request2) {
+        const cloned = new _HttpRequest({
+          ...request2,
+          headers: { ...request2.headers }
+        });
+        if (cloned.query) {
+          cloned.query = cloneQuery(cloned.query);
+        }
+        return cloned;
       }
-      async refreshRetryTokenForRetry(tokenToRenew, errorInfo) {
-        this.rateLimiter.updateClientSendingRate(errorInfo);
-        return this.standardRetryStrategy.refreshRetryTokenForRetry(tokenToRenew, errorInfo);
+      static isInstance(request2) {
+        if (!request2) {
+          return false;
+        }
+        const req = request2;
+        return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object";
       }
-      recordSuccess(token) {
-        this.rateLimiter.updateClientSendingRate({});
-        this.standardRetryStrategy.recordSuccess(token);
+      clone() {
+        return _HttpRequest.clone(this);
       }
     };
-    var ConfiguredRetryStrategy = class extends StandardRetryStrategy {
+    function cloneQuery(query) {
+      return Object.keys(query).reduce((carry, paramName) => {
+        const param = query[paramName];
+        return {
+          ...carry,
+          [paramName]: Array.isArray(param) ? [...param] : param
+        };
+      }, {});
+    }
+    __name(cloneQuery, "cloneQuery");
+    var HttpResponse4 = class {
       static {
-        __name(this, "ConfiguredRetryStrategy");
+        __name(this, "HttpResponse");
       }
-      computeNextBackoffDelay;
-      constructor(maxAttempts, computeNextBackoffDelay = DEFAULT_RETRY_DELAY_BASE) {
-        super(typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts);
-        if (typeof computeNextBackoffDelay === "number") {
-          this.computeNextBackoffDelay = () => computeNextBackoffDelay;
-        } else {
-          this.computeNextBackoffDelay = computeNextBackoffDelay;
-        }
+      statusCode;
+      reason;
+      headers;
+      body;
+      constructor(options) {
+        this.statusCode = options.statusCode;
+        this.reason = options.reason;
+        this.headers = options.headers || {};
+        this.body = options.body;
       }
-      async refreshRetryTokenForRetry(tokenToRenew, errorInfo) {
-        const token = await super.refreshRetryTokenForRetry(tokenToRenew, errorInfo);
-        token.getRetryDelay = () => this.computeNextBackoffDelay(token.getRetryCount());
-        return token;
+      static isInstance(response) {
+        if (!response)
+          return false;
+        const resp = response;
+        return typeof resp.statusCode === "number" && typeof resp.headers === "object";
       }
     };
-    exports2.AdaptiveRetryStrategy = AdaptiveRetryStrategy;
-    exports2.ConfiguredRetryStrategy = ConfiguredRetryStrategy;
-    exports2.DEFAULT_MAX_ATTEMPTS = DEFAULT_MAX_ATTEMPTS;
-    exports2.DEFAULT_RETRY_DELAY_BASE = DEFAULT_RETRY_DELAY_BASE;
-    exports2.DEFAULT_RETRY_MODE = DEFAULT_RETRY_MODE4;
-    exports2.DefaultRateLimiter = DefaultRateLimiter;
-    exports2.INITIAL_RETRY_TOKENS = INITIAL_RETRY_TOKENS;
-    exports2.INVOCATION_ID_HEADER = INVOCATION_ID_HEADER;
-    exports2.MAXIMUM_RETRY_DELAY = MAXIMUM_RETRY_DELAY;
-    exports2.NO_RETRY_INCREMENT = NO_RETRY_INCREMENT;
-    exports2.REQUEST_HEADER = REQUEST_HEADER;
-    exports2.RETRY_COST = RETRY_COST;
-    exports2.StandardRetryStrategy = StandardRetryStrategy;
-    exports2.THROTTLING_RETRY_DELAY_BASE = THROTTLING_RETRY_DELAY_BASE;
-    exports2.TIMEOUT_RETRY_COST = TIMEOUT_RETRY_COST;
+    function isValidHostname(hostname) {
+      const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/;
+      return hostPattern.test(hostname);
+    }
+    __name(isValidHostname, "isValidHostname");
+    exports2.Field = Field;
+    exports2.Fields = Fields;
+    exports2.HttpRequest = HttpRequest10;
+    exports2.HttpResponse = HttpResponse4;
+    exports2.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration4;
+    exports2.isValidHostname = isValidHostname;
+    exports2.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig4;
   }
 });
 
@@ -15734,15 +16800,15 @@ var require_isStreamingPayload = __commonJS({
 });
 
 // node_modules/@smithy/middleware-retry/dist-cjs/index.js
-var require_dist_cjs39 = __commonJS({
+var require_dist_cjs45 = __commonJS({
   "node_modules/@smithy/middleware-retry/dist-cjs/index.js"(exports2) {
     "use strict";
-    var utilRetry = require_dist_cjs38();
-    var protocolHttp = require_dist_cjs3();
-    var serviceErrorClassification = require_dist_cjs37();
-    var uuid = require_dist_cjs20();
+    var utilRetry = require_dist_cjs43();
+    var protocolHttp = require_dist_cjs44();
+    var serviceErrorClassification = require_dist_cjs42();
+    var uuid = require_dist_cjs24();
     var utilMiddleware = require_dist_cjs2();
-    var smithyClient = require_dist_cjs28();
+    var smithyClient = require_dist_cjs32();
     var isStreamingPayload = require_isStreamingPayload();
     var getDefaultRetryQuota = /* @__PURE__ */ __name((initialRetryTokens, options) => {
       const MAX_CAPACITY = initialRetryTokens;
@@ -16250,11 +17316,11 @@ var require_package = __commonJS({
 });
 
 // node_modules/@aws-sdk/credential-provider-env/dist-cjs/index.js
-var require_dist_cjs40 = __commonJS({
+var require_dist_cjs46 = __commonJS({
   "node_modules/@aws-sdk/credential-provider-env/dist-cjs/index.js"(exports2) {
     "use strict";
     var client = (init_client(), __toCommonJS(client_exports));
-    var propertyProvider = require_dist_cjs25();
+    var propertyProvider = require_dist_cjs29();
     var ENV_KEY = "AWS_ACCESS_KEY_ID";
     var ENV_SECRET = "AWS_SECRET_ACCESS_KEY";
     var ENV_SESSION = "AWS_SESSION_TOKEN";
@@ -16294,15 +17360,15 @@ var require_dist_cjs40 = __commonJS({
 });
 
 // node_modules/@smithy/credential-provider-imds/dist-cjs/index.js
-var require_dist_cjs41 = __commonJS({
+var require_dist_cjs47 = __commonJS({
   "node_modules/@smithy/credential-provider-imds/dist-cjs/index.js"(exports2) {
     "use strict";
-    var propertyProvider = require_dist_cjs25();
+    var propertyProvider = require_dist_cjs29();
     var url = require("url");
     var buffer = require("buffer");
     var http = require("http");
-    var nodeConfigProvider = require_dist_cjs35();
-    var urlParser = require_dist_cjs23();
+    var nodeConfigProvider = require_dist_cjs40();
+    var urlParser = require_dist_cjs27();
     function httpRequest(options) {
       return new Promise((resolve, reject) => {
         const req = http.request({
@@ -16393,7 +17459,7 @@ var require_dist_cjs41 = __commonJS({
       "http:": true,
       "https:": true
     };
-    var getCmdsUri = /* @__PURE__ */ __name(async ({ logger: logger21 }) => {
+    var getCmdsUri = /* @__PURE__ */ __name(async ({ logger: logger25 }) => {
       if (process.env[ENV_CMDS_RELATIVE_URI]) {
         return {
           hostname: CMDS_IP,
@@ -16405,13 +17471,13 @@ var require_dist_cjs41 = __commonJS({
         if (!parsed.hostname || !(parsed.hostname in GREENGRASS_HOSTS)) {
           throw new propertyProvider.CredentialsProviderError(`${parsed.hostname} is not a valid container metadata service hostname`, {
             tryNextLink: false,
-            logger: logger21
+            logger: logger25
           });
         }
         if (!parsed.protocol || !(parsed.protocol in GREENGRASS_PROTOCOLS)) {
           throw new propertyProvider.CredentialsProviderError(`${parsed.protocol} is not a valid container metadata service protocol`, {
             tryNextLink: false,
-            logger: logger21
+            logger: logger25
           });
         }
         return {
@@ -16421,7 +17487,7 @@ var require_dist_cjs41 = __commonJS({
       }
       throw new propertyProvider.CredentialsProviderError(`The container metadata credential provider cannot be used unless the ${ENV_CMDS_RELATIVE_URI} or ${ENV_CMDS_FULL_URI} environment variable is set`, {
         tryNextLink: false,
-        logger: logger21
+        logger: logger25
       });
     }, "getCmdsUri");
     var InstanceMetadataV1FallbackError = class _InstanceMetadataV1FallbackError extends propertyProvider.CredentialsProviderError {
@@ -16476,10 +17542,10 @@ var require_dist_cjs41 = __commonJS({
     var STATIC_STABILITY_REFRESH_INTERVAL_SECONDS = 5 * 60;
     var STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS = 5 * 60;
     var STATIC_STABILITY_DOC_URL = "https://docs.aws.amazon.com/sdkref/latest/guide/feature-static-credentials.html";
-    var getExtendedInstanceMetadataCredentials = /* @__PURE__ */ __name((credentials, logger21) => {
+    var getExtendedInstanceMetadataCredentials = /* @__PURE__ */ __name((credentials, logger25) => {
       const refreshInterval = STATIC_STABILITY_REFRESH_INTERVAL_SECONDS + Math.floor(Math.random() * STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS);
       const newExpiration = new Date(Date.now() + refreshInterval * 1e3);
-      logger21.warn(`Attempting credential expiration extension due to a credential service availability issue. A refresh of these credentials will be attempted after ${new Date(newExpiration)}.
+      logger25.warn(`Attempting credential expiration extension due to a credential service availability issue. A refresh of these credentials will be attempted after ${new Date(newExpiration)}.
 For more information, please visit: ` + STATIC_STABILITY_DOC_URL);
       const originalExpiration = credentials.originalExpiration ?? credentials.expiration;
       return {
@@ -16489,19 +17555,19 @@ For more information, please visit: ` + STATIC_STABILITY_DOC_URL);
       };
     }, "getExtendedInstanceMetadataCredentials");
     var staticStabilityProvider = /* @__PURE__ */ __name((provider, options = {}) => {
-      const logger21 = options?.logger || console;
+      const logger25 = options?.logger || console;
       let pastCredentials;
       return async () => {
         let credentials;
         try {
           credentials = await provider();
           if (credentials.expiration && credentials.expiration.getTime() < Date.now()) {
-            credentials = getExtendedInstanceMetadataCredentials(credentials, logger21);
+            credentials = getExtendedInstanceMetadataCredentials(credentials, logger25);
           }
         } catch (e4) {
           if (pastCredentials) {
-            logger21.warn("Credential renew failed: ", e4);
-            credentials = getExtendedInstanceMetadataCredentials(pastCredentials, logger21);
+            logger25.warn("Credential renew failed: ", e4);
+            credentials = getExtendedInstanceMetadataCredentials(pastCredentials, logger25);
           } else {
             throw e4;
           }
@@ -16518,7 +17584,7 @@ For more information, please visit: ` + STATIC_STABILITY_DOC_URL);
     var fromInstanceMetadata = /* @__PURE__ */ __name((init = {}) => staticStabilityProvider(getInstanceMetadataProvider(init), { logger: init.logger }), "fromInstanceMetadata");
     var getInstanceMetadataProvider = /* @__PURE__ */ __name((init = {}) => {
       let disableFetchToken = false;
-      const { logger: logger21, profile } = init;
+      const { logger: logger25, profile } = init;
       const { timeout, maxRetries } = providerConfigFromInit(init);
       const getCredentials = /* @__PURE__ */ __name(async (maxRetries2, options) => {
         const isImdsV1Fallback = disableFetchToken || options.headers?.[X_AWS_EC2_METADATA_TOKEN] == null;
@@ -16582,7 +17648,7 @@ For more information, please visit: ` + STATIC_STABILITY_DOC_URL);
       return async () => {
         const endpoint = await getInstanceMetadataEndpoint();
         if (disableFetchToken) {
-          logger21?.debug("AWS SDK Instance Metadata", "using v1 fallback (no token fetch)");
+          logger25?.debug("AWS SDK Instance Metadata", "using v1 fallback (no token fetch)");
           return getCredentials(maxRetries, { ...endpoint, timeout });
         } else {
           let token;
@@ -16596,7 +17662,7 @@ For more information, please visit: ` + STATIC_STABILITY_DOC_URL);
             } else if (error2.message === "TimeoutError" || [403, 404, 405].includes(error2.statusCode)) {
               disableFetchToken = true;
             }
-            logger21?.debug("AWS SDK Instance Metadata", "using v1 fallback (initial)");
+            logger25?.debug("AWS SDK Instance Metadata", "using v1 fallback (initial)");
             return getCredentials(maxRetries, { ...endpoint, timeout });
           }
           return getCredentials(maxRetries, {
@@ -16649,11 +17715,11 @@ var require_checkUrl = __commonJS({
     "use strict";
     Object.defineProperty(exports2, "__esModule", { value: true });
     exports2.checkUrl = void 0;
-    var property_provider_1 = require_dist_cjs25();
+    var property_provider_1 = require_dist_cjs29();
     var ECS_CONTAINER_HOST = "169.254.170.2";
     var EKS_CONTAINER_HOST_IPv4 = "169.254.170.23";
     var EKS_CONTAINER_HOST_IPv6 = "[fd00:ec2::23]";
-    var checkUrl = /* @__PURE__ */ __name((url, logger21) => {
+    var checkUrl = /* @__PURE__ */ __name((url, logger25) => {
       if (url.protocol === "https:") {
         return;
       }
@@ -16680,7 +17746,7 @@ var require_checkUrl = __commonJS({
       throw new property_provider_1.CredentialsProviderError(`URL not accepted. It must either be HTTPS or match one of the following:
   - loopback CIDR 127.0.0.0/8 or [::1/128]
   - ECS container host 169.254.170.2
-  - EKS container host 169.254.170.23 or [fd00:ec2::23]`, { logger: logger21 });
+  - EKS container host 169.254.170.23 or [fd00:ec2::23]`, { logger: logger25 });
     }, "checkUrl");
     exports2.checkUrl = checkUrl;
   }
@@ -16693,10 +17759,10 @@ var require_requestHelpers = __commonJS({
     Object.defineProperty(exports2, "__esModule", { value: true });
     exports2.createGetRequest = createGetRequest;
     exports2.getCredentials = getCredentials;
-    var property_provider_1 = require_dist_cjs25();
+    var property_provider_1 = require_dist_cjs29();
     var protocol_http_1 = require_dist_cjs3();
-    var smithy_client_1 = require_dist_cjs28();
-    var util_stream_1 = require_dist_cjs19();
+    var smithy_client_1 = require_dist_cjs32();
+    var util_stream_1 = require_dist_cjs23();
     function createGetRequest(url) {
       return new protocol_http_1.HttpRequest({
         protocol: url.protocol,
@@ -16711,13 +17777,13 @@ var require_requestHelpers = __commonJS({
       });
     }
     __name(createGetRequest, "createGetRequest");
-    async function getCredentials(response, logger21) {
+    async function getCredentials(response, logger25) {
       const stream = (0, util_stream_1.sdkStreamMixin)(response.body);
       const str = await stream.transformToString();
       if (response.statusCode === 200) {
         const parsed = JSON.parse(str);
         if (typeof parsed.AccessKeyId !== "string" || typeof parsed.SecretAccessKey !== "string" || typeof parsed.Token !== "string" || typeof parsed.Expiration !== "string") {
-          throw new property_provider_1.CredentialsProviderError("HTTP credential provider response not of the required format, an object matching: { AccessKeyId: string, SecretAccessKey: string, Token: string, Expiration: string(rfc3339) }", { logger: logger21 });
+          throw new property_provider_1.CredentialsProviderError("HTTP credential provider response not of the required format, an object matching: { AccessKeyId: string, SecretAccessKey: string, Token: string, Expiration: string(rfc3339) }", { logger: logger25 });
         }
         return {
           accessKeyId: parsed.AccessKeyId,
@@ -16732,12 +17798,12 @@ var require_requestHelpers = __commonJS({
           parsedBody = JSON.parse(str);
         } catch (e4) {
         }
-        throw Object.assign(new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger: logger21 }), {
+        throw Object.assign(new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger: logger25 }), {
           Code: parsedBody.Code,
           Message: parsedBody.Message
         });
       }
-      throw new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger: logger21 });
+      throw new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger: logger25 });
     }
     __name(getCredentials, "getCredentials");
   }
@@ -16773,8 +17839,8 @@ var require_fromHttp = __commonJS({
     exports2.fromHttp = void 0;
     var tslib_1 = (init_tslib_es6(), __toCommonJS(tslib_es6_exports));
     var client_1 = (init_client(), __toCommonJS(client_exports));
-    var node_http_handler_1 = require_dist_cjs16();
-    var property_provider_1 = require_dist_cjs25();
+    var node_http_handler_1 = require_dist_cjs19();
+    var property_provider_1 = require_dist_cjs29();
     var promises_1 = tslib_1.__importDefault(require("fs/promises"));
     var checkUrl_1 = require_checkUrl();
     var requestHelpers_1 = require_requestHelpers();
@@ -16834,7 +17900,7 @@ Set AWS_CONTAINER_CREDENTIALS_FULL_URI or AWS_CONTAINER_CREDENTIALS_RELATIVE_URI
 });
 
 // node_modules/@aws-sdk/credential-provider-http/dist-cjs/index.js
-var require_dist_cjs42 = __commonJS({
+var require_dist_cjs48 = __commonJS({
   "node_modules/@aws-sdk/credential-provider-http/dist-cjs/index.js"(exports2) {
     "use strict";
     Object.defineProperty(exports2, "__esModule", { value: true });
@@ -17059,12 +18125,12 @@ var init_package = __esm({
 });
 
 // node_modules/@aws-sdk/util-user-agent-node/dist-cjs/index.js
-var require_dist_cjs43 = __commonJS({
+var require_dist_cjs49 = __commonJS({
   "node_modules/@aws-sdk/util-user-agent-node/dist-cjs/index.js"(exports2) {
     "use strict";
     var os = require("os");
     var process2 = require("process");
-    var middlewareUserAgent = require_dist_cjs30();
+    var middlewareUserAgent = require_dist_cjs34();
     var crtAvailability = {
       isCrtAvailable: false
     };
@@ -17117,11 +18183,11 @@ var require_dist_cjs43 = __commonJS({
 });
 
 // node_modules/@smithy/hash-node/dist-cjs/index.js
-var require_dist_cjs44 = __commonJS({
+var require_dist_cjs50 = __commonJS({
   "node_modules/@smithy/hash-node/dist-cjs/index.js"(exports2) {
     "use strict";
-    var utilBufferFrom = require_dist_cjs11();
-    var utilUtf8 = require_dist_cjs12();
+    var utilBufferFrom = require_dist_cjs13();
+    var utilUtf8 = require_dist_cjs14();
     var buffer = require("buffer");
     var crypto3 = require("crypto");
     var Hash4 = class {
@@ -17164,7 +18230,7 @@ var require_dist_cjs44 = __commonJS({
 });
 
 // node_modules/@smithy/util-body-length-node/dist-cjs/index.js
-var require_dist_cjs45 = __commonJS({
+var require_dist_cjs51 = __commonJS({
   "node_modules/@smithy/util-body-length-node/dist-cjs/index.js"(exports2) {
     "use strict";
     var node_fs = require("node:fs");
@@ -17194,12 +18260,12 @@ var require_dist_cjs45 = __commonJS({
 });
 
 // node_modules/@smithy/util-defaults-mode-node/dist-cjs/index.js
-var require_dist_cjs46 = __commonJS({
+var require_dist_cjs52 = __commonJS({
   "node_modules/@smithy/util-defaults-mode-node/dist-cjs/index.js"(exports2) {
     "use strict";
-    var configResolver = require_dist_cjs32();
-    var nodeConfigProvider = require_dist_cjs35();
-    var propertyProvider = require_dist_cjs25();
+    var configResolver = require_dist_cjs36();
+    var nodeConfigProvider = require_dist_cjs40();
+    var propertyProvider = require_dist_cjs29();
     var AWS_EXECUTION_ENV = "AWS_EXECUTION_ENV";
     var AWS_REGION_ENV = "AWS_REGION";
     var AWS_DEFAULT_REGION_ENV = "AWS_DEFAULT_REGION";
@@ -17255,7 +18321,7 @@ var require_dist_cjs46 = __commonJS({
       }
       if (!process.env[ENV_IMDS_DISABLED]) {
         try {
-          const { getInstanceMetadataEndpoint, httpRequest } = await Promise.resolve().then(() => __toESM(require_dist_cjs41()));
+          const { getInstanceMetadataEndpoint, httpRequest } = await Promise.resolve().then(() => __toESM(require_dist_cjs47()));
           const endpoint = await getInstanceMetadataEndpoint();
           return (await httpRequest({ ...endpoint, path: IMDS_REGION_PATH })).toString();
         } catch (e4) {
@@ -17303,8 +18369,8 @@ var init_ruleset = __esm({
 var import_util_endpoints, import_util_endpoints2, cache, defaultEndpointResolver;
 var init_endpointResolver = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/sso-oidc/endpoint/endpointResolver.js"() {
-    import_util_endpoints = __toESM(require_dist_cjs24());
-    import_util_endpoints2 = __toESM(require_dist_cjs21());
+    import_util_endpoints = __toESM(require_dist_cjs28());
+    import_util_endpoints2 = __toESM(require_dist_cjs25());
     init_ruleset();
     cache = new import_util_endpoints2.EndpointCache({
       size: 50,
@@ -17327,10 +18393,10 @@ var init_runtimeConfig_shared = __esm({
     init_dist_es2();
     init_protocols2();
     init_dist_es();
-    import_smithy_client8 = __toESM(require_dist_cjs28());
-    import_url_parser = __toESM(require_dist_cjs23());
-    import_util_base648 = __toESM(require_dist_cjs13());
-    import_util_utf88 = __toESM(require_dist_cjs12());
+    import_smithy_client8 = __toESM(require_dist_cjs32());
+    import_url_parser = __toESM(require_dist_cjs27());
+    import_util_base648 = __toESM(require_dist_cjs15());
+    import_util_utf88 = __toESM(require_dist_cjs14());
     init_httpAuthSchemeProvider();
     init_endpointResolver();
     getRuntimeConfig = /* @__PURE__ */ __name((config) => {
@@ -17371,16 +18437,16 @@ var init_runtimeConfig = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/sso-oidc/runtimeConfig.js"() {
     init_package();
     init_dist_es2();
-    import_util_user_agent_node = __toESM(require_dist_cjs43());
-    import_config_resolver = __toESM(require_dist_cjs32());
-    import_hash_node = __toESM(require_dist_cjs44());
-    import_middleware_retry = __toESM(require_dist_cjs39());
-    import_node_config_provider = __toESM(require_dist_cjs35());
-    import_node_http_handler = __toESM(require_dist_cjs16());
-    import_smithy_client9 = __toESM(require_dist_cjs28());
-    import_util_body_length_node = __toESM(require_dist_cjs45());
-    import_util_defaults_mode_node = __toESM(require_dist_cjs46());
-    import_util_retry = __toESM(require_dist_cjs38());
+    import_util_user_agent_node = __toESM(require_dist_cjs49());
+    import_config_resolver = __toESM(require_dist_cjs36());
+    import_hash_node = __toESM(require_dist_cjs50());
+    import_middleware_retry = __toESM(require_dist_cjs45());
+    import_node_config_provider = __toESM(require_dist_cjs40());
+    import_node_http_handler = __toESM(require_dist_cjs19());
+    import_smithy_client9 = __toESM(require_dist_cjs32());
+    import_util_body_length_node = __toESM(require_dist_cjs51());
+    import_util_defaults_mode_node = __toESM(require_dist_cjs52());
+    import_util_retry = __toESM(require_dist_cjs43());
     init_runtimeConfig_shared();
     getRuntimeConfig2 = /* @__PURE__ */ __name((config) => {
       (0, import_smithy_client9.emitWarningIfUnsupportedVersion)(process.version);
@@ -17424,8 +18490,8 @@ var require_stsRegionDefaultResolver = __commonJS({
     Object.defineProperty(exports2, "__esModule", { value: true });
     exports2.warning = void 0;
     exports2.stsRegionDefaultResolver = stsRegionDefaultResolver2;
-    var config_resolver_1 = require_dist_cjs32();
-    var node_config_provider_1 = require_dist_cjs35();
+    var config_resolver_1 = require_dist_cjs36();
+    var node_config_provider_1 = require_dist_cjs40();
     function stsRegionDefaultResolver2(loaderConfig = {}) {
       return (0, node_config_provider_1.loadConfig)({
         ...config_resolver_1.NODE_REGION_CONFIG_OPTIONS,
@@ -17445,10 +18511,10 @@ var require_stsRegionDefaultResolver = __commonJS({
 });
 
 // node_modules/@aws-sdk/region-config-resolver/dist-cjs/index.js
-var require_dist_cjs47 = __commonJS({
+var require_dist_cjs53 = __commonJS({
   "node_modules/@aws-sdk/region-config-resolver/dist-cjs/index.js"(exports2) {
     "use strict";
-    var configResolver = require_dist_cjs32();
+    var configResolver = require_dist_cjs36();
     var stsRegionDefaultResolver2 = require_stsRegionDefaultResolver();
     var getAwsRegionExtensionConfiguration4 = /* @__PURE__ */ __name((runtimeConfig) => {
       return {
@@ -17556,9 +18622,9 @@ var init_httpAuthExtensionConfiguration = __esm({
 var import_region_config_resolver, import_protocol_http12, import_smithy_client10, resolveRuntimeExtensions;
 var init_runtimeExtensions = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/sso-oidc/runtimeExtensions.js"() {
-    import_region_config_resolver = __toESM(require_dist_cjs47());
+    import_region_config_resolver = __toESM(require_dist_cjs53());
     import_protocol_http12 = __toESM(require_dist_cjs3());
-    import_smithy_client10 = __toESM(require_dist_cjs28());
+    import_smithy_client10 = __toESM(require_dist_cjs32());
     init_httpAuthExtensionConfiguration();
     resolveRuntimeExtensions = /* @__PURE__ */ __name((runtimeConfig, extensions) => {
       const extensionConfiguration = Object.assign((0, import_region_config_resolver.getAwsRegionExtensionConfiguration)(runtimeConfig), (0, import_smithy_client10.getDefaultExtensionConfiguration)(runtimeConfig), (0, import_protocol_http12.getHttpHandlerExtensionConfiguration)(runtimeConfig), getHttpAuthExtensionConfiguration(runtimeConfig));
@@ -17575,14 +18641,14 @@ var init_SSOOIDCClient = __esm({
     import_middleware_host_header = __toESM(require_dist_cjs6());
     import_middleware_logger = __toESM(require_dist_cjs7());
     import_middleware_recursion_detection = __toESM(require_dist_cjs8());
-    import_middleware_user_agent = __toESM(require_dist_cjs30());
-    import_config_resolver2 = __toESM(require_dist_cjs32());
+    import_middleware_user_agent = __toESM(require_dist_cjs34());
+    import_config_resolver2 = __toESM(require_dist_cjs36());
     init_dist_es();
     init_schema();
-    import_middleware_content_length = __toESM(require_dist_cjs33());
-    import_middleware_endpoint = __toESM(require_dist_cjs36());
-    import_middleware_retry2 = __toESM(require_dist_cjs39());
-    import_smithy_client11 = __toESM(require_dist_cjs28());
+    import_middleware_content_length = __toESM(require_dist_cjs38());
+    import_middleware_endpoint = __toESM(require_dist_cjs41());
+    import_middleware_retry2 = __toESM(require_dist_cjs45());
+    import_smithy_client11 = __toESM(require_dist_cjs32());
     init_httpAuthSchemeProvider();
     init_EndpointParameters();
     init_runtimeConfig();
@@ -17631,7 +18697,7 @@ var init_SSOOIDCClient = __esm({
 var import_smithy_client12, SSOOIDCServiceException;
 var init_SSOOIDCServiceException = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/sso-oidc/models/SSOOIDCServiceException.js"() {
-    import_smithy_client12 = __toESM(require_dist_cjs28());
+    import_smithy_client12 = __toESM(require_dist_cjs32());
     SSOOIDCServiceException = class _SSOOIDCServiceException extends import_smithy_client12.ServiceException {
       static {
         __name(this, "SSOOIDCServiceException");
@@ -18002,8 +19068,8 @@ var init_schemas_0 = __esm({
 var import_middleware_endpoint2, import_smithy_client13, CreateTokenCommand;
 var init_CreateTokenCommand = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/sso-oidc/commands/CreateTokenCommand.js"() {
-    import_middleware_endpoint2 = __toESM(require_dist_cjs36());
-    import_smithy_client13 = __toESM(require_dist_cjs28());
+    import_middleware_endpoint2 = __toESM(require_dist_cjs41());
+    import_smithy_client13 = __toESM(require_dist_cjs32());
     init_EndpointParameters();
     init_schemas_0();
     CreateTokenCommand = class extends import_smithy_client13.Command.classBuilder().ep(commonParams).m(function(Command, cs, config, o4) {
@@ -18020,7 +19086,7 @@ var init_CreateTokenCommand = __esm({
 var import_smithy_client14, commands, SSOOIDC;
 var init_SSOOIDC = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/sso-oidc/SSOOIDC.js"() {
-    import_smithy_client14 = __toESM(require_dist_cjs28());
+    import_smithy_client14 = __toESM(require_dist_cjs32());
     init_CreateTokenCommand();
     init_SSOOIDCClient();
     commands = {
@@ -18093,22 +19159,22 @@ var init_sso_oidc = __esm({
 });
 
 // node_modules/@aws-sdk/token-providers/dist-cjs/index.js
-var require_dist_cjs48 = __commonJS({
+var require_dist_cjs54 = __commonJS({
   "node_modules/@aws-sdk/token-providers/dist-cjs/index.js"(exports2) {
     "use strict";
     var client = (init_client(), __toCommonJS(client_exports));
     var httpAuthSchemes = (init_httpAuthSchemes2(), __toCommonJS(httpAuthSchemes_exports));
-    var propertyProvider = require_dist_cjs25();
-    var sharedIniFileLoader = require_dist_cjs34();
+    var propertyProvider = require_dist_cjs29();
+    var sharedIniFileLoader = require_dist_cjs39();
     var fs = require("fs");
-    var fromEnvSigningName = /* @__PURE__ */ __name(({ logger: logger21, signingName } = {}) => async () => {
-      logger21?.debug?.("@aws-sdk/token-providers - fromEnvSigningName");
+    var fromEnvSigningName = /* @__PURE__ */ __name(({ logger: logger25, signingName } = {}) => async () => {
+      logger25?.debug?.("@aws-sdk/token-providers - fromEnvSigningName");
       if (!signingName) {
-        throw new propertyProvider.TokenProviderError("Please pass 'signingName' to compute environment variable key", { logger: logger21 });
+        throw new propertyProvider.TokenProviderError("Please pass 'signingName' to compute environment variable key", { logger: logger25 });
       }
       const bearerTokenKey = httpAuthSchemes.getBearerTokenEnvKey(signingName);
       if (!(bearerTokenKey in process.env)) {
-        throw new propertyProvider.TokenProviderError(`Token not present in '${bearerTokenKey}' environment variable`, { logger: logger21 });
+        throw new propertyProvider.TokenProviderError(`Token not present in '${bearerTokenKey}' environment variable`, { logger: logger25 });
       }
       const token = { token: process.env[bearerTokenKey] };
       client.setTokenFeature(token, "BEARER_SERVICE_ENV_VARS", "3");
@@ -18229,8 +19295,8 @@ var require_dist_cjs48 = __commonJS({
         return existingToken;
       }
     }, "fromSso");
-    var fromStatic = /* @__PURE__ */ __name(({ token, logger: logger21 }) => async () => {
-      logger21?.debug("@aws-sdk/token-providers - fromStatic");
+    var fromStatic = /* @__PURE__ */ __name(({ token, logger: logger25 }) => async () => {
+      logger25?.debug("@aws-sdk/token-providers - fromStatic");
       if (!token || !token.token) {
         throw new propertyProvider.TokenProviderError(`Please pass a valid token to fromStatic`, false);
       }
@@ -18467,8 +19533,8 @@ var require_endpointResolver = __commonJS({
     "use strict";
     Object.defineProperty(exports2, "__esModule", { value: true });
     exports2.defaultEndpointResolver = void 0;
-    var util_endpoints_1 = require_dist_cjs24();
-    var util_endpoints_2 = require_dist_cjs21();
+    var util_endpoints_1 = require_dist_cjs28();
+    var util_endpoints_2 = require_dist_cjs25();
     var ruleset_1 = require_ruleset();
     var cache4 = new util_endpoints_2.EndpointCache({
       size: 50,
@@ -18494,10 +19560,10 @@ var require_runtimeConfig_shared = __commonJS({
     var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2));
     var protocols_1 = (init_protocols2(), __toCommonJS(protocols_exports2));
     var core_2 = (init_dist_es(), __toCommonJS(dist_es_exports));
-    var smithy_client_1 = require_dist_cjs28();
-    var url_parser_1 = require_dist_cjs23();
-    var util_base64_1 = require_dist_cjs13();
-    var util_utf8_1 = require_dist_cjs12();
+    var smithy_client_1 = require_dist_cjs32();
+    var url_parser_1 = require_dist_cjs27();
+    var util_base64_1 = require_dist_cjs15();
+    var util_utf8_1 = require_dist_cjs14();
     var httpAuthSchemeProvider_1 = require_httpAuthSchemeProvider2();
     var endpointResolver_1 = require_endpointResolver();
     var getRuntimeConfig7 = /* @__PURE__ */ __name((config) => {
@@ -18542,16 +19608,16 @@ var require_runtimeConfig = __commonJS({
     var tslib_1 = (init_tslib_es6(), __toCommonJS(tslib_es6_exports));
     var package_json_1 = tslib_1.__importDefault(require_package2());
     var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2));
-    var util_user_agent_node_1 = require_dist_cjs43();
-    var config_resolver_1 = require_dist_cjs32();
-    var hash_node_1 = require_dist_cjs44();
-    var middleware_retry_1 = require_dist_cjs39();
-    var node_config_provider_1 = require_dist_cjs35();
-    var node_http_handler_1 = require_dist_cjs16();
-    var smithy_client_1 = require_dist_cjs28();
-    var util_body_length_node_1 = require_dist_cjs45();
-    var util_defaults_mode_node_1 = require_dist_cjs46();
-    var util_retry_1 = require_dist_cjs38();
+    var util_user_agent_node_1 = require_dist_cjs49();
+    var config_resolver_1 = require_dist_cjs36();
+    var hash_node_1 = require_dist_cjs50();
+    var middleware_retry_1 = require_dist_cjs45();
+    var node_config_provider_1 = require_dist_cjs40();
+    var node_http_handler_1 = require_dist_cjs19();
+    var smithy_client_1 = require_dist_cjs32();
+    var util_body_length_node_1 = require_dist_cjs51();
+    var util_defaults_mode_node_1 = require_dist_cjs52();
+    var util_retry_1 = require_dist_cjs43();
     var runtimeConfig_shared_1 = require_runtimeConfig_shared();
     var getRuntimeConfig7 = /* @__PURE__ */ __name((config) => {
       (0, smithy_client_1.emitWarningIfUnsupportedVersion)(process.version);
@@ -18590,23 +19656,23 @@ var require_runtimeConfig = __commonJS({
 });
 
 // node_modules/@aws-sdk/client-sso/dist-cjs/index.js
-var require_dist_cjs49 = __commonJS({
+var require_dist_cjs55 = __commonJS({
   "node_modules/@aws-sdk/client-sso/dist-cjs/index.js"(exports2) {
     "use strict";
     var middlewareHostHeader = require_dist_cjs6();
     var middlewareLogger = require_dist_cjs7();
     var middlewareRecursionDetection = require_dist_cjs8();
-    var middlewareUserAgent = require_dist_cjs30();
-    var configResolver = require_dist_cjs32();
+    var middlewareUserAgent = require_dist_cjs34();
+    var configResolver = require_dist_cjs36();
     var core = (init_dist_es(), __toCommonJS(dist_es_exports));
     var schema = (init_schema(), __toCommonJS(schema_exports));
-    var middlewareContentLength = require_dist_cjs33();
-    var middlewareEndpoint = require_dist_cjs36();
-    var middlewareRetry = require_dist_cjs39();
-    var smithyClient = require_dist_cjs28();
+    var middlewareContentLength = require_dist_cjs38();
+    var middlewareEndpoint = require_dist_cjs41();
+    var middlewareRetry = require_dist_cjs45();
+    var smithyClient = require_dist_cjs32();
     var httpAuthSchemeProvider = require_httpAuthSchemeProvider2();
     var runtimeConfig = require_runtimeConfig();
-    var regionConfigResolver = require_dist_cjs47();
+    var regionConfigResolver = require_dist_cjs53();
     var protocolHttp = require_dist_cjs3();
     var resolveClientEndpointParameters4 = /* @__PURE__ */ __name((options) => {
       return Object.assign(options, {
@@ -18993,7 +20059,7 @@ var require_dist_cjs49 = __commonJS({
 var require_loadSso_CVy8iqsZ = __commonJS({
   "node_modules/@aws-sdk/credential-provider-sso/dist-cjs/loadSso-CVy8iqsZ.js"(exports2) {
     "use strict";
-    var clientSso = require_dist_cjs49();
+    var clientSso = require_dist_cjs55();
     Object.defineProperty(exports2, "GetRoleCredentialsCommand", {
       enumerable: true,
       get: /* @__PURE__ */ __name(function() {
@@ -19010,16 +20076,16 @@ var require_loadSso_CVy8iqsZ = __commonJS({
 });
 
 // node_modules/@aws-sdk/credential-provider-sso/dist-cjs/index.js
-var require_dist_cjs50 = __commonJS({
+var require_dist_cjs56 = __commonJS({
   "node_modules/@aws-sdk/credential-provider-sso/dist-cjs/index.js"(exports2) {
     "use strict";
-    var propertyProvider = require_dist_cjs25();
-    var sharedIniFileLoader = require_dist_cjs34();
+    var propertyProvider = require_dist_cjs29();
+    var sharedIniFileLoader = require_dist_cjs39();
     var client = (init_client(), __toCommonJS(client_exports));
-    var tokenProviders = require_dist_cjs48();
+    var tokenProviders = require_dist_cjs54();
     var isSsoProfile = /* @__PURE__ */ __name((arg) => arg && (typeof arg.sso_start_url === "string" || typeof arg.sso_account_id === "string" || typeof arg.sso_session === "string" || typeof arg.sso_region === "string" || typeof arg.sso_role_name === "string"), "isSsoProfile");
     var SHOULD_FAIL_CREDENTIAL_CHAIN = false;
-    var resolveSSOCredentials = /* @__PURE__ */ __name(async ({ ssoStartUrl, ssoSession, ssoAccountId, ssoRegion, ssoRoleName, ssoClient, clientConfig, parentClientConfig, profile, filepath, configFilepath, ignoreCache, logger: logger21 }) => {
+    var resolveSSOCredentials = /* @__PURE__ */ __name(async ({ ssoStartUrl, ssoSession, ssoAccountId, ssoRegion, ssoRoleName, ssoClient, clientConfig, parentClientConfig, profile, filepath, configFilepath, ignoreCache, logger: logger25 }) => {
       let token;
       const refreshMessage = `To refresh this SSO session run aws sso login with the corresponding profile.`;
       if (ssoSession) {
@@ -19037,7 +20103,7 @@ var require_dist_cjs50 = __commonJS({
         } catch (e4) {
           throw new propertyProvider.CredentialsProviderError(e4.message, {
             tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN,
-            logger: logger21
+            logger: logger25
           });
         }
       } else {
@@ -19046,14 +20112,14 @@ var require_dist_cjs50 = __commonJS({
         } catch (e4) {
           throw new propertyProvider.CredentialsProviderError(`The SSO session associated with this profile is invalid. ${refreshMessage}`, {
             tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN,
-            logger: logger21
+            logger: logger25
           });
         }
       }
       if (new Date(token.expiresAt).getTime() - Date.now() <= 0) {
         throw new propertyProvider.CredentialsProviderError(`The SSO session associated with this profile has expired. ${refreshMessage}`, {
           tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN,
-          logger: logger21
+          logger: logger25
         });
       }
       const { accessToken } = token;
@@ -19075,14 +20141,14 @@ var require_dist_cjs50 = __commonJS({
       } catch (e4) {
         throw new propertyProvider.CredentialsProviderError(e4, {
           tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN,
-          logger: logger21
+          logger: logger25
         });
       }
       const { roleCredentials: { accessKeyId, secretAccessKey, sessionToken, expiration, credentialScope, accountId } = {} } = ssoResp;
       if (!accessKeyId || !secretAccessKey || !sessionToken || !expiration) {
         throw new propertyProvider.CredentialsProviderError("SSO returns an invalid temporary credential.", {
           tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN,
-          logger: logger21
+          logger: logger25
         });
       }
       const credentials = {
@@ -19100,11 +20166,11 @@ var require_dist_cjs50 = __commonJS({
       }
       return credentials;
     }, "resolveSSOCredentials");
-    var validateSsoProfile = /* @__PURE__ */ __name((profile, logger21) => {
+    var validateSsoProfile = /* @__PURE__ */ __name((profile, logger25) => {
       const { sso_start_url, sso_account_id, sso_region, sso_role_name } = profile;
       if (!sso_start_url || !sso_account_id || !sso_region || !sso_role_name) {
         throw new propertyProvider.CredentialsProviderError(`Profile is configured with invalid SSO credentials. Required parameters "sso_account_id", "sso_region", "sso_role_name", "sso_start_url". Got ${Object.keys(profile).join(", ")}
-Reference: https://docs.aws.amazon.com/cli/latest/userguide/cli-configure-sso.html`, { tryNextLink: false, logger: logger21 });
+Reference: https://docs.aws.amazon.com/cli/latest/userguide/cli-configure-sso.html`, { tryNextLink: false, logger: logger25 });
       }
       return profile;
     }, "validateSsoProfile");
@@ -19302,8 +20368,8 @@ var init_ruleset2 = __esm({
 var import_util_endpoints3, import_util_endpoints4, cache2, defaultEndpointResolver2;
 var init_endpointResolver2 = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/signin/endpoint/endpointResolver.js"() {
-    import_util_endpoints3 = __toESM(require_dist_cjs24());
-    import_util_endpoints4 = __toESM(require_dist_cjs21());
+    import_util_endpoints3 = __toESM(require_dist_cjs28());
+    import_util_endpoints4 = __toESM(require_dist_cjs25());
     init_ruleset2();
     cache2 = new import_util_endpoints4.EndpointCache({
       size: 50,
@@ -19326,10 +20392,10 @@ var init_runtimeConfig_shared2 = __esm({
     init_dist_es2();
     init_protocols2();
     init_dist_es();
-    import_smithy_client15 = __toESM(require_dist_cjs28());
-    import_url_parser2 = __toESM(require_dist_cjs23());
-    import_util_base649 = __toESM(require_dist_cjs13());
-    import_util_utf89 = __toESM(require_dist_cjs12());
+    import_smithy_client15 = __toESM(require_dist_cjs32());
+    import_url_parser2 = __toESM(require_dist_cjs27());
+    import_util_base649 = __toESM(require_dist_cjs15());
+    import_util_utf89 = __toESM(require_dist_cjs14());
     init_httpAuthSchemeProvider2();
     init_endpointResolver2();
     getRuntimeConfig3 = /* @__PURE__ */ __name((config) => {
@@ -19370,16 +20436,16 @@ var init_runtimeConfig2 = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/signin/runtimeConfig.js"() {
     init_package();
     init_dist_es2();
-    import_util_user_agent_node2 = __toESM(require_dist_cjs43());
-    import_config_resolver3 = __toESM(require_dist_cjs32());
-    import_hash_node2 = __toESM(require_dist_cjs44());
-    import_middleware_retry3 = __toESM(require_dist_cjs39());
-    import_node_config_provider2 = __toESM(require_dist_cjs35());
-    import_node_http_handler2 = __toESM(require_dist_cjs16());
-    import_smithy_client16 = __toESM(require_dist_cjs28());
-    import_util_body_length_node2 = __toESM(require_dist_cjs45());
-    import_util_defaults_mode_node2 = __toESM(require_dist_cjs46());
-    import_util_retry2 = __toESM(require_dist_cjs38());
+    import_util_user_agent_node2 = __toESM(require_dist_cjs49());
+    import_config_resolver3 = __toESM(require_dist_cjs36());
+    import_hash_node2 = __toESM(require_dist_cjs50());
+    import_middleware_retry3 = __toESM(require_dist_cjs45());
+    import_node_config_provider2 = __toESM(require_dist_cjs40());
+    import_node_http_handler2 = __toESM(require_dist_cjs19());
+    import_smithy_client16 = __toESM(require_dist_cjs32());
+    import_util_body_length_node2 = __toESM(require_dist_cjs51());
+    import_util_defaults_mode_node2 = __toESM(require_dist_cjs52());
+    import_util_retry2 = __toESM(require_dist_cjs43());
     init_runtimeConfig_shared2();
     getRuntimeConfig4 = /* @__PURE__ */ __name((config) => {
       (0, import_smithy_client16.emitWarningIfUnsupportedVersion)(process.version);
@@ -19464,9 +20530,9 @@ var init_httpAuthExtensionConfiguration2 = __esm({
 var import_region_config_resolver2, import_protocol_http13, import_smithy_client17, resolveRuntimeExtensions2;
 var init_runtimeExtensions2 = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/signin/runtimeExtensions.js"() {
-    import_region_config_resolver2 = __toESM(require_dist_cjs47());
+    import_region_config_resolver2 = __toESM(require_dist_cjs53());
     import_protocol_http13 = __toESM(require_dist_cjs3());
-    import_smithy_client17 = __toESM(require_dist_cjs28());
+    import_smithy_client17 = __toESM(require_dist_cjs32());
     init_httpAuthExtensionConfiguration2();
     resolveRuntimeExtensions2 = /* @__PURE__ */ __name((runtimeConfig, extensions) => {
       const extensionConfiguration = Object.assign((0, import_region_config_resolver2.getAwsRegionExtensionConfiguration)(runtimeConfig), (0, import_smithy_client17.getDefaultExtensionConfiguration)(runtimeConfig), (0, import_protocol_http13.getHttpHandlerExtensionConfiguration)(runtimeConfig), getHttpAuthExtensionConfiguration2(runtimeConfig));
@@ -19483,14 +20549,14 @@ var init_SigninClient = __esm({
     import_middleware_host_header2 = __toESM(require_dist_cjs6());
     import_middleware_logger2 = __toESM(require_dist_cjs7());
     import_middleware_recursion_detection2 = __toESM(require_dist_cjs8());
-    import_middleware_user_agent2 = __toESM(require_dist_cjs30());
-    import_config_resolver4 = __toESM(require_dist_cjs32());
+    import_middleware_user_agent2 = __toESM(require_dist_cjs34());
+    import_config_resolver4 = __toESM(require_dist_cjs36());
     init_dist_es();
     init_schema();
-    import_middleware_content_length2 = __toESM(require_dist_cjs33());
-    import_middleware_endpoint3 = __toESM(require_dist_cjs36());
-    import_middleware_retry4 = __toESM(require_dist_cjs39());
-    import_smithy_client18 = __toESM(require_dist_cjs28());
+    import_middleware_content_length2 = __toESM(require_dist_cjs38());
+    import_middleware_endpoint3 = __toESM(require_dist_cjs41());
+    import_middleware_retry4 = __toESM(require_dist_cjs45());
+    import_smithy_client18 = __toESM(require_dist_cjs32());
     init_httpAuthSchemeProvider2();
     init_EndpointParameters2();
     init_runtimeConfig2();
@@ -19539,7 +20605,7 @@ var init_SigninClient = __esm({
 var import_smithy_client19, SigninServiceException;
 var init_SigninServiceException = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/signin/models/SigninServiceException.js"() {
-    import_smithy_client19 = __toESM(require_dist_cjs28());
+    import_smithy_client19 = __toESM(require_dist_cjs32());
     SigninServiceException = class _SigninServiceException extends import_smithy_client19.ServiceException {
       static {
         __name(this, "SigninServiceException");
@@ -19753,8 +20819,8 @@ var init_schemas_02 = __esm({
 var import_middleware_endpoint4, import_smithy_client20, CreateOAuth2TokenCommand;
 var init_CreateOAuth2TokenCommand = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/signin/commands/CreateOAuth2TokenCommand.js"() {
-    import_middleware_endpoint4 = __toESM(require_dist_cjs36());
-    import_smithy_client20 = __toESM(require_dist_cjs28());
+    import_middleware_endpoint4 = __toESM(require_dist_cjs41());
+    import_smithy_client20 = __toESM(require_dist_cjs32());
     init_EndpointParameters2();
     init_schemas_02();
     CreateOAuth2TokenCommand = class extends import_smithy_client20.Command.classBuilder().ep(commonParams2).m(function(Command, cs, config, o4) {
@@ -19771,7 +20837,7 @@ var init_CreateOAuth2TokenCommand = __esm({
 var import_smithy_client21, commands2, Signin;
 var init_Signin = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/signin/Signin.js"() {
-    import_smithy_client21 = __toESM(require_dist_cjs28());
+    import_smithy_client21 = __toESM(require_dist_cjs32());
     init_CreateOAuth2TokenCommand();
     init_SigninClient();
     commands2 = {
@@ -19835,12 +20901,12 @@ var init_signin = __esm({
 });
 
 // node_modules/@aws-sdk/credential-provider-login/dist-cjs/index.js
-var require_dist_cjs51 = __commonJS({
+var require_dist_cjs57 = __commonJS({
   "node_modules/@aws-sdk/credential-provider-login/dist-cjs/index.js"(exports2) {
     "use strict";
     var client = (init_client(), __toCommonJS(client_exports));
-    var propertyProvider = require_dist_cjs25();
-    var sharedIniFileLoader = require_dist_cjs34();
+    var propertyProvider = require_dist_cjs29();
+    var sharedIniFileLoader = require_dist_cjs39();
     var protocolHttp = require_dist_cjs3();
     var node_crypto = require("node:crypto");
     var node_fs = require("node:fs");
@@ -19887,7 +20953,7 @@ var require_dist_cjs51 = __commonJS({
       }
       async refresh(token) {
         const { SigninClient: SigninClient2, CreateOAuth2TokenCommand: CreateOAuth2TokenCommand2 } = await Promise.resolve().then(() => (init_signin(), signin_exports));
-        const { logger: logger21, userAgentAppId } = this.callerClientConfig ?? {};
+        const { logger: logger25, userAgentAppId } = this.callerClientConfig ?? {};
         const isH22 = /* @__PURE__ */ __name((requestHandler2) => {
           return requestHandler2?.metadata?.handlerProtocol === "h2";
         }, "isH2");
@@ -19900,7 +20966,7 @@ var require_dist_cjs51 = __commonJS({
           },
           region,
           requestHandler,
-          logger: logger21,
+          logger: logger25,
           userAgentAppId,
           ...this.init?.clientConfig
         });
@@ -20250,8 +21316,8 @@ var init_ruleset3 = __esm({
 var import_util_endpoints5, import_util_endpoints6, cache3, defaultEndpointResolver3;
 var init_endpointResolver3 = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/sts/endpoint/endpointResolver.js"() {
-    import_util_endpoints5 = __toESM(require_dist_cjs24());
-    import_util_endpoints6 = __toESM(require_dist_cjs21());
+    import_util_endpoints5 = __toESM(require_dist_cjs28());
+    import_util_endpoints6 = __toESM(require_dist_cjs25());
     init_ruleset3();
     cache3 = new import_util_endpoints6.EndpointCache({
       size: 50,
@@ -20274,10 +21340,10 @@ var init_runtimeConfig_shared3 = __esm({
     init_dist_es2();
     init_protocols2();
     init_dist_es();
-    import_smithy_client22 = __toESM(require_dist_cjs28());
-    import_url_parser3 = __toESM(require_dist_cjs23());
-    import_util_base6410 = __toESM(require_dist_cjs13());
-    import_util_utf810 = __toESM(require_dist_cjs12());
+    import_smithy_client22 = __toESM(require_dist_cjs32());
+    import_url_parser3 = __toESM(require_dist_cjs27());
+    import_util_base6410 = __toESM(require_dist_cjs15());
+    import_util_utf810 = __toESM(require_dist_cjs14());
     init_httpAuthSchemeProvider3();
     init_endpointResolver3();
     getRuntimeConfig5 = /* @__PURE__ */ __name((config) => {
@@ -20322,17 +21388,17 @@ var init_runtimeConfig3 = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/sts/runtimeConfig.js"() {
     init_package();
     init_dist_es2();
-    import_util_user_agent_node3 = __toESM(require_dist_cjs43());
-    import_config_resolver5 = __toESM(require_dist_cjs32());
+    import_util_user_agent_node3 = __toESM(require_dist_cjs49());
+    import_config_resolver5 = __toESM(require_dist_cjs36());
     init_dist_es();
-    import_hash_node3 = __toESM(require_dist_cjs44());
-    import_middleware_retry5 = __toESM(require_dist_cjs39());
-    import_node_config_provider3 = __toESM(require_dist_cjs35());
-    import_node_http_handler3 = __toESM(require_dist_cjs16());
-    import_smithy_client23 = __toESM(require_dist_cjs28());
-    import_util_body_length_node3 = __toESM(require_dist_cjs45());
-    import_util_defaults_mode_node3 = __toESM(require_dist_cjs46());
-    import_util_retry3 = __toESM(require_dist_cjs38());
+    import_hash_node3 = __toESM(require_dist_cjs50());
+    import_middleware_retry5 = __toESM(require_dist_cjs45());
+    import_node_config_provider3 = __toESM(require_dist_cjs40());
+    import_node_http_handler3 = __toESM(require_dist_cjs19());
+    import_smithy_client23 = __toESM(require_dist_cjs32());
+    import_util_body_length_node3 = __toESM(require_dist_cjs51());
+    import_util_defaults_mode_node3 = __toESM(require_dist_cjs52());
+    import_util_retry3 = __toESM(require_dist_cjs43());
     init_runtimeConfig_shared3();
     getRuntimeConfig6 = /* @__PURE__ */ __name((config) => {
       (0, import_smithy_client23.emitWarningIfUnsupportedVersion)(process.version);
@@ -20429,9 +21495,9 @@ var init_httpAuthExtensionConfiguration3 = __esm({
 var import_region_config_resolver3, import_protocol_http14, import_smithy_client24, resolveRuntimeExtensions3;
 var init_runtimeExtensions3 = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/sts/runtimeExtensions.js"() {
-    import_region_config_resolver3 = __toESM(require_dist_cjs47());
+    import_region_config_resolver3 = __toESM(require_dist_cjs53());
     import_protocol_http14 = __toESM(require_dist_cjs3());
-    import_smithy_client24 = __toESM(require_dist_cjs28());
+    import_smithy_client24 = __toESM(require_dist_cjs32());
     init_httpAuthExtensionConfiguration3();
     resolveRuntimeExtensions3 = /* @__PURE__ */ __name((runtimeConfig, extensions) => {
       const extensionConfiguration = Object.assign((0, import_region_config_resolver3.getAwsRegionExtensionConfiguration)(runtimeConfig), (0, import_smithy_client24.getDefaultExtensionConfiguration)(runtimeConfig), (0, import_protocol_http14.getHttpHandlerExtensionConfiguration)(runtimeConfig), getHttpAuthExtensionConfiguration3(runtimeConfig));
@@ -20448,14 +21514,14 @@ var init_STSClient = __esm({
     import_middleware_host_header3 = __toESM(require_dist_cjs6());
     import_middleware_logger3 = __toESM(require_dist_cjs7());
     import_middleware_recursion_detection3 = __toESM(require_dist_cjs8());
-    import_middleware_user_agent3 = __toESM(require_dist_cjs30());
-    import_config_resolver6 = __toESM(require_dist_cjs32());
+    import_middleware_user_agent3 = __toESM(require_dist_cjs34());
+    import_config_resolver6 = __toESM(require_dist_cjs36());
     init_dist_es();
     init_schema();
-    import_middleware_content_length3 = __toESM(require_dist_cjs33());
-    import_middleware_endpoint5 = __toESM(require_dist_cjs36());
-    import_middleware_retry6 = __toESM(require_dist_cjs39());
-    import_smithy_client25 = __toESM(require_dist_cjs28());
+    import_middleware_content_length3 = __toESM(require_dist_cjs38());
+    import_middleware_endpoint5 = __toESM(require_dist_cjs41());
+    import_middleware_retry6 = __toESM(require_dist_cjs45());
+    import_smithy_client25 = __toESM(require_dist_cjs32());
     init_httpAuthSchemeProvider3();
     init_EndpointParameters3();
     init_runtimeConfig3();
@@ -20504,7 +21570,7 @@ var init_STSClient = __esm({
 var import_smithy_client26, STSServiceException;
 var init_STSServiceException = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/sts/models/STSServiceException.js"() {
-    import_smithy_client26 = __toESM(require_dist_cjs28());
+    import_smithy_client26 = __toESM(require_dist_cjs32());
     STSServiceException = class _STSServiceException extends import_smithy_client26.ServiceException {
       static {
         __name(this, "STSServiceException");
@@ -20827,8 +21893,8 @@ var init_schemas_03 = __esm({
 var import_middleware_endpoint6, import_smithy_client27, AssumeRoleCommand;
 var init_AssumeRoleCommand = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/sts/commands/AssumeRoleCommand.js"() {
-    import_middleware_endpoint6 = __toESM(require_dist_cjs36());
-    import_smithy_client27 = __toESM(require_dist_cjs28());
+    import_middleware_endpoint6 = __toESM(require_dist_cjs41());
+    import_smithy_client27 = __toESM(require_dist_cjs32());
     init_EndpointParameters3();
     init_schemas_03();
     AssumeRoleCommand = class extends import_smithy_client27.Command.classBuilder().ep(commonParams3).m(function(Command, cs, config, o4) {
@@ -20845,8 +21911,8 @@ var init_AssumeRoleCommand = __esm({
 var import_middleware_endpoint7, import_smithy_client28, AssumeRoleWithWebIdentityCommand;
 var init_AssumeRoleWithWebIdentityCommand = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/sts/commands/AssumeRoleWithWebIdentityCommand.js"() {
-    import_middleware_endpoint7 = __toESM(require_dist_cjs36());
-    import_smithy_client28 = __toESM(require_dist_cjs28());
+    import_middleware_endpoint7 = __toESM(require_dist_cjs41());
+    import_smithy_client28 = __toESM(require_dist_cjs32());
     init_EndpointParameters3();
     init_schemas_03();
     AssumeRoleWithWebIdentityCommand = class extends import_smithy_client28.Command.classBuilder().ep(commonParams3).m(function(Command, cs, config, o4) {
@@ -20863,7 +21929,7 @@ var init_AssumeRoleWithWebIdentityCommand = __esm({
 var import_smithy_client29, commands3, STS;
 var init_STS = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/sts/STS.js"() {
-    import_smithy_client29 = __toESM(require_dist_cjs28());
+    import_smithy_client29 = __toESM(require_dist_cjs32());
     init_AssumeRoleCommand();
     init_AssumeRoleWithWebIdentityCommand();
     init_STSClient();
@@ -20893,7 +21959,7 @@ var import_region_config_resolver4, getAccountIdFromAssumedRoleUser, resolveRegi
 var init_defaultStsRoleAssumers = __esm({
   "node_modules/@aws-sdk/nested-clients/dist-es/submodules/sts/defaultStsRoleAssumers.js"() {
     init_client();
-    import_region_config_resolver4 = __toESM(require_dist_cjs47());
+    import_region_config_resolver4 = __toESM(require_dist_cjs53());
     init_AssumeRoleCommand();
     init_AssumeRoleWithWebIdentityCommand();
     getAccountIdFromAssumedRoleUser = /* @__PURE__ */ __name((assumedRoleUser) => {
@@ -20918,9 +21984,9 @@ var init_defaultStsRoleAssumers = __esm({
       return async (sourceCreds, params) => {
         closureSourceCreds = sourceCreds;
         if (!stsClient) {
-          const { logger: logger21 = stsOptions?.parentClientConfig?.logger, profile = stsOptions?.parentClientConfig?.profile, region, requestHandler = stsOptions?.parentClientConfig?.requestHandler, credentialProviderLogger, userAgentAppId = stsOptions?.parentClientConfig?.userAgentAppId } = stsOptions;
+          const { logger: logger25 = stsOptions?.parentClientConfig?.logger, profile = stsOptions?.parentClientConfig?.profile, region, requestHandler = stsOptions?.parentClientConfig?.requestHandler, credentialProviderLogger, userAgentAppId = stsOptions?.parentClientConfig?.userAgentAppId } = stsOptions;
           const resolvedRegion = await resolveRegion(region, stsOptions?.parentClientConfig?.region, credentialProviderLogger, {
-            logger: logger21,
+            logger: logger25,
             profile
           });
           const isCompatibleRequestHandler = !isH2(requestHandler);
@@ -20931,7 +21997,7 @@ var init_defaultStsRoleAssumers = __esm({
             credentialDefaultProvider: /* @__PURE__ */ __name(() => async () => closureSourceCreds, "credentialDefaultProvider"),
             region: resolvedRegion,
             requestHandler: isCompatibleRequestHandler ? requestHandler : void 0,
-            logger: logger21
+            logger: logger25
           });
         }
         const { Credentials: Credentials2, AssumedRoleUser: AssumedRoleUser2 } = await stsClient.send(new AssumeRoleCommand(params));
@@ -20955,9 +22021,9 @@ var init_defaultStsRoleAssumers = __esm({
       let stsClient;
       return async (params) => {
         if (!stsClient) {
-          const { logger: logger21 = stsOptions?.parentClientConfig?.logger, profile = stsOptions?.parentClientConfig?.profile, region, requestHandler = stsOptions?.parentClientConfig?.requestHandler, credentialProviderLogger, userAgentAppId = stsOptions?.parentClientConfig?.userAgentAppId } = stsOptions;
+          const { logger: logger25 = stsOptions?.parentClientConfig?.logger, profile = stsOptions?.parentClientConfig?.profile, region, requestHandler = stsOptions?.parentClientConfig?.requestHandler, credentialProviderLogger, userAgentAppId = stsOptions?.parentClientConfig?.userAgentAppId } = stsOptions;
           const resolvedRegion = await resolveRegion(region, stsOptions?.parentClientConfig?.region, credentialProviderLogger, {
-            logger: logger21,
+            logger: logger25,
             profile
           });
           const isCompatibleRequestHandler = !isH2(requestHandler);
@@ -20967,7 +22033,7 @@ var init_defaultStsRoleAssumers = __esm({
             profile,
             region: resolvedRegion,
             requestHandler: isCompatibleRequestHandler ? requestHandler : void 0,
-            logger: logger21
+            logger: logger25
           });
         }
         const { Credentials: Credentials2, AssumedRoleUser: AssumedRoleUser2 } = await stsClient.send(new AssumeRoleWithWebIdentityCommand(params));
@@ -21060,11 +22126,11 @@ var init_sts = __esm({
 });
 
 // node_modules/@aws-sdk/credential-provider-process/dist-cjs/index.js
-var require_dist_cjs52 = __commonJS({
+var require_dist_cjs58 = __commonJS({
   "node_modules/@aws-sdk/credential-provider-process/dist-cjs/index.js"(exports2) {
     "use strict";
-    var sharedIniFileLoader = require_dist_cjs34();
-    var propertyProvider = require_dist_cjs25();
+    var sharedIniFileLoader = require_dist_cjs39();
+    var propertyProvider = require_dist_cjs29();
     var child_process = require("child_process");
     var util = require("util");
     var client = (init_client(), __toCommonJS(client_exports));
@@ -21097,7 +22163,7 @@ var require_dist_cjs52 = __commonJS({
       client.setCredentialFeature(credentials, "CREDENTIALS_PROCESS", "w");
       return credentials;
     }, "getValidatedProcessCredentials");
-    var resolveProcessCredentials = /* @__PURE__ */ __name(async (profileName, profiles, logger21) => {
+    var resolveProcessCredentials = /* @__PURE__ */ __name(async (profileName, profiles, logger25) => {
       const profile = profiles[profileName];
       if (profiles[profileName]) {
         const credentialProcess = profile["credential_process"];
@@ -21113,14 +22179,14 @@ var require_dist_cjs52 = __commonJS({
             }
             return getValidatedProcessCredentials(profileName, data2, profiles);
           } catch (error2) {
-            throw new propertyProvider.CredentialsProviderError(error2.message, { logger: logger21 });
+            throw new propertyProvider.CredentialsProviderError(error2.message, { logger: logger25 });
           }
         } else {
-          throw new propertyProvider.CredentialsProviderError(`Profile ${profileName} did not contain credential_process.`, { logger: logger21 });
+          throw new propertyProvider.CredentialsProviderError(`Profile ${profileName} did not contain credential_process.`, { logger: logger25 });
         }
       } else {
         throw new propertyProvider.CredentialsProviderError(`Profile ${profileName} could not be found in shared credentials file.`, {
-          logger: logger21
+          logger: logger25
         });
       }
     }, "resolveProcessCredentials");
@@ -21214,8 +22280,8 @@ var require_fromTokenFile = __commonJS({
     Object.defineProperty(exports2, "__esModule", { value: true });
     exports2.fromTokenFile = void 0;
     var client_1 = (init_client(), __toCommonJS(client_exports));
-    var property_provider_1 = require_dist_cjs25();
-    var shared_ini_file_loader_1 = require_dist_cjs34();
+    var property_provider_1 = require_dist_cjs29();
+    var shared_ini_file_loader_1 = require_dist_cjs39();
     var fs_1 = require("fs");
     var fromWebToken_1 = require_fromWebToken();
     var ENV_TOKEN_FILE = "AWS_WEB_IDENTITY_TOKEN_FILE";
@@ -21247,7 +22313,7 @@ var require_fromTokenFile = __commonJS({
 });
 
 // node_modules/@aws-sdk/credential-provider-web-identity/dist-cjs/index.js
-var require_dist_cjs53 = __commonJS({
+var require_dist_cjs59 = __commonJS({
   "node_modules/@aws-sdk/credential-provider-web-identity/dist-cjs/index.js"(exports2) {
     "use strict";
     var fromTokenFile = require_fromTokenFile();
@@ -21272,53 +22338,53 @@ var require_dist_cjs53 = __commonJS({
 });
 
 // node_modules/@aws-sdk/credential-provider-ini/dist-cjs/index.js
-var require_dist_cjs54 = __commonJS({
+var require_dist_cjs60 = __commonJS({
   "node_modules/@aws-sdk/credential-provider-ini/dist-cjs/index.js"(exports2) {
     "use strict";
-    var sharedIniFileLoader = require_dist_cjs34();
-    var propertyProvider = require_dist_cjs25();
+    var sharedIniFileLoader = require_dist_cjs39();
+    var propertyProvider = require_dist_cjs29();
     var client = (init_client(), __toCommonJS(client_exports));
-    var credentialProviderLogin = require_dist_cjs51();
-    var resolveCredentialSource = /* @__PURE__ */ __name((credentialSource, profileName, logger21) => {
+    var credentialProviderLogin = require_dist_cjs57();
+    var resolveCredentialSource = /* @__PURE__ */ __name((credentialSource, profileName, logger25) => {
       const sourceProvidersMap = {
         EcsContainer: /* @__PURE__ */ __name(async (options) => {
-          const { fromHttp } = await Promise.resolve().then(() => __toESM(require_dist_cjs42()));
-          const { fromContainerMetadata } = await Promise.resolve().then(() => __toESM(require_dist_cjs41()));
-          logger21?.debug("@aws-sdk/credential-provider-ini - credential_source is EcsContainer");
+          const { fromHttp } = await Promise.resolve().then(() => __toESM(require_dist_cjs48()));
+          const { fromContainerMetadata } = await Promise.resolve().then(() => __toESM(require_dist_cjs47()));
+          logger25?.debug("@aws-sdk/credential-provider-ini - credential_source is EcsContainer");
           return async () => propertyProvider.chain(fromHttp(options ?? {}), fromContainerMetadata(options))().then(setNamedProvider);
         }, "EcsContainer"),
         Ec2InstanceMetadata: /* @__PURE__ */ __name(async (options) => {
-          logger21?.debug("@aws-sdk/credential-provider-ini - credential_source is Ec2InstanceMetadata");
-          const { fromInstanceMetadata } = await Promise.resolve().then(() => __toESM(require_dist_cjs41()));
+          logger25?.debug("@aws-sdk/credential-provider-ini - credential_source is Ec2InstanceMetadata");
+          const { fromInstanceMetadata } = await Promise.resolve().then(() => __toESM(require_dist_cjs47()));
           return async () => fromInstanceMetadata(options)().then(setNamedProvider);
         }, "Ec2InstanceMetadata"),
         Environment: /* @__PURE__ */ __name(async (options) => {
-          logger21?.debug("@aws-sdk/credential-provider-ini - credential_source is Environment");
-          const { fromEnv } = await Promise.resolve().then(() => __toESM(require_dist_cjs40()));
+          logger25?.debug("@aws-sdk/credential-provider-ini - credential_source is Environment");
+          const { fromEnv } = await Promise.resolve().then(() => __toESM(require_dist_cjs46()));
           return async () => fromEnv(options)().then(setNamedProvider);
         }, "Environment")
       };
       if (credentialSource in sourceProvidersMap) {
         return sourceProvidersMap[credentialSource];
       } else {
-        throw new propertyProvider.CredentialsProviderError(`Unsupported credential source in profile ${profileName}. Got ${credentialSource}, expected EcsContainer or Ec2InstanceMetadata or Environment.`, { logger: logger21 });
+        throw new propertyProvider.CredentialsProviderError(`Unsupported credential source in profile ${profileName}. Got ${credentialSource}, expected EcsContainer or Ec2InstanceMetadata or Environment.`, { logger: logger25 });
       }
     }, "resolveCredentialSource");
     var setNamedProvider = /* @__PURE__ */ __name((creds) => client.setCredentialFeature(creds, "CREDENTIALS_PROFILE_NAMED_PROVIDER", "p"), "setNamedProvider");
-    var isAssumeRoleProfile = /* @__PURE__ */ __name((arg, { profile = "default", logger: logger21 } = {}) => {
-      return Boolean(arg) && typeof arg === "object" && typeof arg.role_arn === "string" && ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1 && ["undefined", "string"].indexOf(typeof arg.external_id) > -1 && ["undefined", "string"].indexOf(typeof arg.mfa_serial) > -1 && (isAssumeRoleWithSourceProfile(arg, { profile, logger: logger21 }) || isCredentialSourceProfile(arg, { profile, logger: logger21 }));
+    var isAssumeRoleProfile = /* @__PURE__ */ __name((arg, { profile = "default", logger: logger25 } = {}) => {
+      return Boolean(arg) && typeof arg === "object" && typeof arg.role_arn === "string" && ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1 && ["undefined", "string"].indexOf(typeof arg.external_id) > -1 && ["undefined", "string"].indexOf(typeof arg.mfa_serial) > -1 && (isAssumeRoleWithSourceProfile(arg, { profile, logger: logger25 }) || isCredentialSourceProfile(arg, { profile, logger: logger25 }));
     }, "isAssumeRoleProfile");
-    var isAssumeRoleWithSourceProfile = /* @__PURE__ */ __name((arg, { profile, logger: logger21 }) => {
+    var isAssumeRoleWithSourceProfile = /* @__PURE__ */ __name((arg, { profile, logger: logger25 }) => {
       const withSourceProfile = typeof arg.source_profile === "string" && typeof arg.credential_source === "undefined";
       if (withSourceProfile) {
-        logger21?.debug?.(`    ${profile} isAssumeRoleWithSourceProfile source_profile=${arg.source_profile}`);
+        logger25?.debug?.(`    ${profile} isAssumeRoleWithSourceProfile source_profile=${arg.source_profile}`);
       }
       return withSourceProfile;
     }, "isAssumeRoleWithSourceProfile");
-    var isCredentialSourceProfile = /* @__PURE__ */ __name((arg, { profile, logger: logger21 }) => {
+    var isCredentialSourceProfile = /* @__PURE__ */ __name((arg, { profile, logger: logger25 }) => {
       const withProviderProfile = typeof arg.credential_source === "string" && typeof arg.source_profile === "undefined";
       if (withProviderProfile) {
-        logger21?.debug?.(`    ${profile} isCredentialSourceProfile credential_source=${arg.credential_source}`);
+        logger25?.debug?.(`    ${profile} isCredentialSourceProfile credential_source=${arg.credential_source}`);
       }
       return withProviderProfile;
     }, "isCredentialSourceProfile");
@@ -21380,12 +22446,12 @@ var require_dist_cjs54 = __commonJS({
       return client.setCredentialFeature(credentials, "CREDENTIALS_PROFILE_LOGIN", "AC");
     }, "resolveLoginCredentials");
     var isProcessProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.credential_process === "string", "isProcessProfile");
-    var resolveProcessCredentials = /* @__PURE__ */ __name(async (options, profile) => Promise.resolve().then(() => __toESM(require_dist_cjs52())).then(({ fromProcess }) => fromProcess({
+    var resolveProcessCredentials = /* @__PURE__ */ __name(async (options, profile) => Promise.resolve().then(() => __toESM(require_dist_cjs58())).then(({ fromProcess }) => fromProcess({
       ...options,
       profile
     })().then((creds) => client.setCredentialFeature(creds, "CREDENTIALS_PROFILE_PROCESS", "v"))), "resolveProcessCredentials");
     var resolveSsoCredentials = /* @__PURE__ */ __name(async (profile, profileData, options = {}) => {
-      const { fromSSO } = await Promise.resolve().then(() => __toESM(require_dist_cjs50()));
+      const { fromSSO } = await Promise.resolve().then(() => __toESM(require_dist_cjs56()));
       return fromSSO({
         profile,
         logger: options.logger,
@@ -21413,7 +22479,7 @@ var require_dist_cjs54 = __commonJS({
       return client.setCredentialFeature(credentials, "CREDENTIALS_PROFILE", "n");
     }, "resolveStaticCredentials");
     var isWebIdentityProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.web_identity_token_file === "string" && typeof arg.role_arn === "string" && ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1, "isWebIdentityProfile");
-    var resolveWebIdentityCredentials = /* @__PURE__ */ __name(async (profile, options) => Promise.resolve().then(() => __toESM(require_dist_cjs53())).then(({ fromTokenFile }) => fromTokenFile({
+    var resolveWebIdentityCredentials = /* @__PURE__ */ __name(async (profile, options) => Promise.resolve().then(() => __toESM(require_dist_cjs59())).then(({ fromTokenFile }) => fromTokenFile({
       webIdentityTokenFile: profile.web_identity_token_file,
       roleArn: profile.role_arn,
       roleSessionName: profile.role_session_name,
@@ -21465,18 +22531,18 @@ var require_dist_cjs54 = __commonJS({
 });
 
 // node_modules/@aws-sdk/credential-provider-node/dist-cjs/index.js
-var require_dist_cjs55 = __commonJS({
+var require_dist_cjs61 = __commonJS({
   "node_modules/@aws-sdk/credential-provider-node/dist-cjs/index.js"(exports2) {
     "use strict";
-    var credentialProviderEnv = require_dist_cjs40();
-    var propertyProvider = require_dist_cjs25();
-    var sharedIniFileLoader = require_dist_cjs34();
+    var credentialProviderEnv = require_dist_cjs46();
+    var propertyProvider = require_dist_cjs29();
+    var sharedIniFileLoader = require_dist_cjs39();
     var ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED";
     var remoteProvider = /* @__PURE__ */ __name(async (init) => {
-      const { ENV_CMDS_FULL_URI, ENV_CMDS_RELATIVE_URI, fromContainerMetadata, fromInstanceMetadata } = await Promise.resolve().then(() => __toESM(require_dist_cjs41()));
+      const { ENV_CMDS_FULL_URI, ENV_CMDS_RELATIVE_URI, fromContainerMetadata, fromInstanceMetadata } = await Promise.resolve().then(() => __toESM(require_dist_cjs47()));
       if (process.env[ENV_CMDS_RELATIVE_URI] || process.env[ENV_CMDS_FULL_URI]) {
         init.logger?.debug("@aws-sdk/credential-provider-node - remoteProvider::fromHttp/fromContainerMetadata");
-        const { fromHttp } = await Promise.resolve().then(() => __toESM(require_dist_cjs42()));
+        const { fromHttp } = await Promise.resolve().then(() => __toESM(require_dist_cjs48()));
         return propertyProvider.chain(fromHttp(init), fromContainerMetadata(init));
       }
       if (process.env[ENV_IMDS_DISABLED] && process.env[ENV_IMDS_DISABLED] !== "false") {
@@ -21574,22 +22640,22 @@ var require_dist_cjs55 = __commonJS({
         if (!ssoStartUrl && !ssoAccountId && !ssoRegion && !ssoRoleName && !ssoSession) {
           throw new propertyProvider.CredentialsProviderError("Skipping SSO provider in default chain (inputs do not include SSO fields).", { logger: init.logger });
         }
-        const { fromSSO } = await Promise.resolve().then(() => __toESM(require_dist_cjs50()));
+        const { fromSSO } = await Promise.resolve().then(() => __toESM(require_dist_cjs56()));
         return fromSSO(init)(awsIdentityProperties);
       },
       async (awsIdentityProperties) => {
         init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromIni");
-        const { fromIni } = await Promise.resolve().then(() => __toESM(require_dist_cjs54()));
+        const { fromIni } = await Promise.resolve().then(() => __toESM(require_dist_cjs60()));
         return fromIni(init)(awsIdentityProperties);
       },
       async (awsIdentityProperties) => {
         init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromProcess");
-        const { fromProcess } = await Promise.resolve().then(() => __toESM(require_dist_cjs52()));
+        const { fromProcess } = await Promise.resolve().then(() => __toESM(require_dist_cjs58()));
         return fromProcess(init)(awsIdentityProperties);
       },
       async (awsIdentityProperties) => {
         init.logger?.debug("@aws-sdk/credential-provider-node - defaultProvider::fromTokenFile");
-        const { fromTokenFile } = await Promise.resolve().then(() => __toESM(require_dist_cjs53()));
+        const { fromTokenFile } = await Promise.resolve().then(() => __toESM(require_dist_cjs59()));
         return fromTokenFile(init)(awsIdentityProperties);
       },
       async () => {
@@ -21612,13 +22678,13 @@ var require_dist_cjs55 = __commonJS({
 });
 
 // node_modules/@aws-sdk/dynamodb-codec/dist-cjs/index.js
-var require_dist_cjs56 = __commonJS({
+var require_dist_cjs62 = __commonJS({
   "node_modules/@aws-sdk/dynamodb-codec/dist-cjs/index.js"(exports2) {
     "use strict";
     var protocols = (init_protocols2(), __toCommonJS(protocols_exports2));
     var schema = (init_schema(), __toCommonJS(schema_exports));
-    var smithyClient = require_dist_cjs28();
-    var utilBase64 = require_dist_cjs13();
+    var smithyClient = require_dist_cjs32();
+    var utilBase64 = require_dist_cjs15();
     var DynamoDBJsonCodec = class extends protocols.JsonCodec {
       static {
         __name(this, "DynamoDBJsonCodec");
@@ -21779,8 +22845,8 @@ var require_endpointResolver2 = __commonJS({
     "use strict";
     Object.defineProperty(exports2, "__esModule", { value: true });
     exports2.defaultEndpointResolver = void 0;
-    var util_endpoints_1 = require_dist_cjs24();
-    var util_endpoints_2 = require_dist_cjs21();
+    var util_endpoints_1 = require_dist_cjs28();
+    var util_endpoints_2 = require_dist_cjs25();
     var ruleset_1 = require_ruleset2();
     var cache4 = new util_endpoints_2.EndpointCache({
       size: 50,
@@ -21814,11 +22880,11 @@ var require_runtimeConfig_shared2 = __commonJS({
     exports2.getRuntimeConfig = void 0;
     var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2));
     var protocols_1 = (init_protocols2(), __toCommonJS(protocols_exports2));
-    var dynamodb_codec_1 = require_dist_cjs56();
-    var smithy_client_1 = require_dist_cjs28();
-    var url_parser_1 = require_dist_cjs23();
-    var util_base64_1 = require_dist_cjs13();
-    var util_utf8_1 = require_dist_cjs12();
+    var dynamodb_codec_1 = require_dist_cjs62();
+    var smithy_client_1 = require_dist_cjs32();
+    var url_parser_1 = require_dist_cjs27();
+    var util_base64_1 = require_dist_cjs15();
+    var util_utf8_1 = require_dist_cjs14();
     var httpAuthSchemeProvider_1 = require_httpAuthSchemeProvider();
     var endpointResolver_1 = require_endpointResolver2();
     var getRuntimeConfig7 = /* @__PURE__ */ __name((config) => {
@@ -21864,18 +22930,18 @@ var require_runtimeConfig2 = __commonJS({
     var package_json_1 = tslib_1.__importDefault(require_package());
     var core_1 = (init_dist_es2(), __toCommonJS(dist_es_exports2));
     var account_id_endpoint_1 = (init_account_id_endpoint(), __toCommonJS(account_id_endpoint_exports));
-    var credential_provider_node_1 = require_dist_cjs55();
+    var credential_provider_node_1 = require_dist_cjs61();
     var middleware_endpoint_discovery_1 = require_dist_cjs5();
-    var util_user_agent_node_1 = require_dist_cjs43();
-    var config_resolver_1 = require_dist_cjs32();
-    var hash_node_1 = require_dist_cjs44();
-    var middleware_retry_1 = require_dist_cjs39();
-    var node_config_provider_1 = require_dist_cjs35();
-    var node_http_handler_1 = require_dist_cjs16();
-    var smithy_client_1 = require_dist_cjs28();
-    var util_body_length_node_1 = require_dist_cjs45();
-    var util_defaults_mode_node_1 = require_dist_cjs46();
-    var util_retry_1 = require_dist_cjs38();
+    var util_user_agent_node_1 = require_dist_cjs49();
+    var config_resolver_1 = require_dist_cjs36();
+    var hash_node_1 = require_dist_cjs50();
+    var middleware_retry_1 = require_dist_cjs45();
+    var node_config_provider_1 = require_dist_cjs40();
+    var node_http_handler_1 = require_dist_cjs19();
+    var smithy_client_1 = require_dist_cjs32();
+    var util_body_length_node_1 = require_dist_cjs51();
+    var util_defaults_mode_node_1 = require_dist_cjs52();
+    var util_retry_1 = require_dist_cjs43();
     var runtimeConfig_shared_1 = require_runtimeConfig_shared2();
     var getRuntimeConfig7 = /* @__PURE__ */ __name((config) => {
       (0, smithy_client_1.emitWarningIfUnsupportedVersion)(process.version);
@@ -21917,7 +22983,7 @@ var require_runtimeConfig2 = __commonJS({
 });
 
 // node_modules/@smithy/util-waiter/dist-cjs/index.js
-var require_dist_cjs57 = __commonJS({
+var require_dist_cjs63 = __commonJS({
   "node_modules/@smithy/util-waiter/dist-cjs/index.js"(exports2) {
     "use strict";
     var getCircularReplacer = /* @__PURE__ */ __name(() => {
@@ -22088,7 +23154,7 @@ var require_dist_cjs57 = __commonJS({
 });
 
 // node_modules/@aws-sdk/client-dynamodb/dist-cjs/index.js
-var require_dist_cjs58 = __commonJS({
+var require_dist_cjs64 = __commonJS({
   "node_modules/@aws-sdk/client-dynamodb/dist-cjs/index.js"(exports2) {
     "use strict";
     var accountIdEndpoint = (init_account_id_endpoint(), __toCommonJS(account_id_endpoint_exports));
@@ -22096,19 +23162,19 @@ var require_dist_cjs58 = __commonJS({
     var middlewareHostHeader = require_dist_cjs6();
     var middlewareLogger = require_dist_cjs7();
     var middlewareRecursionDetection = require_dist_cjs8();
-    var middlewareUserAgent = require_dist_cjs30();
-    var configResolver = require_dist_cjs32();
+    var middlewareUserAgent = require_dist_cjs34();
+    var configResolver = require_dist_cjs36();
     var core = (init_dist_es(), __toCommonJS(dist_es_exports));
     var schema = (init_schema(), __toCommonJS(schema_exports));
-    var middlewareContentLength = require_dist_cjs33();
-    var middlewareEndpoint = require_dist_cjs36();
-    var middlewareRetry = require_dist_cjs39();
-    var smithyClient = require_dist_cjs28();
+    var middlewareContentLength = require_dist_cjs38();
+    var middlewareEndpoint = require_dist_cjs41();
+    var middlewareRetry = require_dist_cjs45();
+    var smithyClient = require_dist_cjs32();
     var httpAuthSchemeProvider = require_httpAuthSchemeProvider();
     var runtimeConfig = require_runtimeConfig2();
-    var regionConfigResolver = require_dist_cjs47();
+    var regionConfigResolver = require_dist_cjs53();
     var protocolHttp = require_dist_cjs3();
-    var utilWaiter = require_dist_cjs57();
+    var utilWaiter = require_dist_cjs63();
     var resolveClientEndpointParameters4 = /* @__PURE__ */ __name((options) => {
       return Object.assign(options, {
         useDualstackEndpoint: options.useDualstackEndpoint ?? false,
@@ -26413,7 +27479,7 @@ var require_dist_cjs58 = __commonJS({
 });
 
 // node_modules/@aws-sdk/util-dynamodb/dist-cjs/index.js
-var require_dist_cjs59 = __commonJS({
+var require_dist_cjs65 = __commonJS({
   "node_modules/@aws-sdk/util-dynamodb/dist-cjs/index.js"(exports2) {
     "use strict";
     var NumberValue = class _NumberValue {
@@ -26687,13 +27753,13 @@ var require_dist_cjs59 = __commonJS({
 });
 
 // node_modules/@aws-sdk/lib-dynamodb/dist-cjs/index.js
-var require_dist_cjs60 = __commonJS({
+var require_dist_cjs66 = __commonJS({
   "node_modules/@aws-sdk/lib-dynamodb/dist-cjs/index.js"(exports2) {
     "use strict";
-    var clientDynamodb = require_dist_cjs58();
-    var smithyClient = require_dist_cjs28();
+    var clientDynamodb = require_dist_cjs64();
+    var smithyClient = require_dist_cjs32();
     var core = (init_dist_es2(), __toCommonJS(dist_es_exports2));
-    var utilDynamodb = require_dist_cjs59();
+    var utilDynamodb = require_dist_cjs65();
     var core$1 = (init_dist_es(), __toCommonJS(dist_es_exports));
     var SELF = null;
     var ALL_VALUES = {};
@@ -27777,8 +28843,8 @@ function ulid2() {
 __name(ulid2, "ulid");
 
 // src/shared/utils/dynamodb.ts
-var import_client_dynamodb = __toESM(require_dist_cjs58(), 1);
-var import_lib_dynamodb = __toESM(require_dist_cjs60(), 1);
+var import_client_dynamodb = __toESM(require_dist_cjs64(), 1);
+var import_lib_dynamodb = __toESM(require_dist_cjs66(), 1);
 function createDynamoDBClient(config = {}) {
   const { region = process.env.AWS_REGION || "us-east-1", endpoint } = config;
   const client = new import_client_dynamodb.DynamoDBClient({
@@ -27798,6 +28864,18 @@ function createDynamoDBClient(config = {}) {
 }
 __name(createDynamoDBClient, "createDynamoDBClient");
 
+// src/shared/constants/http.ts
+var HTTP_STATUS = {
+  OK: 200,
+  BAD_REQUEST: 400,
+  UNAUTHORIZED: 401,
+  FORBIDDEN: 403,
+  NOT_FOUND: 404,
+  METHOD_NOT_ALLOWED: 405,
+  INTERNAL_SERVER_ERROR: 500,
+  NOT_IMPLEMENTED: 501
+};
+
 // src/shared/constants/dynamodb.ts
 var DYNAMODB_TRANSACT_WRITE_MAX_ITEMS = 100;
 var DYNAMODB_QUERY_MAX_SIZE_BYTES = 1024 * 1024;
@@ -27813,7 +28891,7 @@ var LAMBDA_MAX_RESPONSE_SIZE = 6 * 1024 * 1024;
 var LAMBDA_MAX_ENV_VARS_SIZE = 4 * 1024;
 
 // src/server/operations/deleteMany.ts
-var import_lib_dynamodb2 = __toESM(require_dist_cjs60(), 1);
+var import_lib_dynamodb2 = __toESM(require_dist_cjs66(), 1);
 
 // src/server/shadow/typeInference.ts
 function inferFieldType(value) {
@@ -27842,6 +28920,14 @@ function inferFieldType(value) {
 }
 __name(inferFieldType, "inferFieldType");
 
+// src/shared/constants/formatting.ts
+var NUMBER_FORMAT = {
+  /** シャドウSKで使用する数値の桁数（20桁ゼロ埋め） */
+  SHADOW_SK_DIGITS: 20,
+  /** ゼロ埋め文字 */
+  ZERO_PAD_CHAR: "0"
+};
+
 // src/shadows/generator.ts
 function escapeString(value) {
   return value.replace(/#/g, "##").replace(/ /g, "#");
@@ -28502,7 +29588,7 @@ async function handleDeleteMany(resource, params, requestId) {
 __name(handleDeleteMany, "handleDeleteMany");
 
 // src/server/operations/deleteOne.ts
-var import_lib_dynamodb3 = __toESM(require_dist_cjs60(), 1);
+var import_lib_dynamodb3 = __toESM(require_dist_cjs66(), 1);
 var logger6 = createLogger({ service: "records-lambda" });
 async function handleDeleteOne(resource, params, requestId) {
   const { id } = params;
@@ -28710,7 +29796,25 @@ function matchesAllFilters(record, parsedFilters) {
 __name(matchesAllFilters, "matchesAllFilters");
 
 // src/server/operations/find/idQuery.ts
-var import_lib_dynamodb4 = __toESM(require_dist_cjs60(), 1);
+var import_lib_dynamodb4 = __toESM(require_dist_cjs66(), 1);
+
+// src/shared/constants/validation.ts
+var VALIDATION_ERROR_MESSAGES = {
+  REQUEST_BODY_REQUIRED: "Request body is required",
+  INVALID_JSON: "Invalid JSON in request body",
+  MISSING_OPERATION: "Missing required field: operation",
+  MISSING_COLLECTION: "Missing required field: collection",
+  MISSING_PARAMS: "Missing required field: params",
+  MISSING_TOKEN_FIELDS: "Missing required fields in token payload"
+};
+var VALIDATION_ERROR_PATTERNS = [
+  "Missing required field",
+  "Invalid JSON",
+  "Request body is required",
+  "requires filter.id",
+  "requires document",
+  "requires documents"
+];
 
 // src/server/utils/pagination.ts
 function encodeNextToken(pk, sk) {
@@ -28730,7 +29834,7 @@ function decodeNextToken(token) {
     const json = Buffer.from(base64, "base64").toString("utf-8");
     const payload2 = JSON.parse(json);
     if (!payload2.PK || !payload2.SK) {
-      throw new Error("Missing required fields in token payload");
+      throw new Error(VALIDATION_ERROR_MESSAGES.MISSING_TOKEN_FIELDS);
     }
     return payload2;
   } catch (error2) {
@@ -28869,7 +29973,7 @@ async function executeAllRecordsQuery(resource, sort, perPage, nextToken, parsed
 __name(executeAllRecordsQuery, "executeAllRecordsQuery");
 
 // src/server/operations/find/shadowQuery.ts
-var import_lib_dynamodb5 = __toESM(require_dist_cjs60(), 1);
+var import_lib_dynamodb5 = __toESM(require_dist_cjs66(), 1);
 var logger9 = createLogger({
   service: "shadow-query",
   level: process.env.LOG_LEVEL || "info"
@@ -29048,7 +30152,7 @@ function buildKeyCondition(resource, sortField, optimizableFilter) {
 __name(buildKeyCondition, "buildKeyCondition");
 function encodeValueForShadowSK(value, type) {
   if (type === "number") {
-    return String(value).padStart(20, "0");
+    return String(value).padStart(NUMBER_FORMAT.SHADOW_SK_DIGITS, NUMBER_FORMAT.ZERO_PAD_CHAR);
   } else if (type === "date") {
     return new Date(String(value)).toISOString();
   } else if (type === "boolean") {
@@ -29126,7 +30230,7 @@ async function handleFind(resource, params, requestId) {
 __name(handleFind, "handleFind");
 
 // src/server/operations/findMany.ts
-var import_lib_dynamodb6 = __toESM(require_dist_cjs60(), 1);
+var import_lib_dynamodb6 = __toESM(require_dist_cjs66(), 1);
 var logger11 = createLogger({ service: "records-lambda" });
 async function handleFindMany(resource, params, requestId) {
   const { ids } = params;
@@ -29170,7 +30274,7 @@ async function handleFindMany(resource, params, requestId) {
 __name(handleFindMany, "handleFindMany");
 
 // src/server/operations/findManyReference.ts
-var import_lib_dynamodb7 = __toESM(require_dist_cjs60(), 1);
+var import_lib_dynamodb7 = __toESM(require_dist_cjs66(), 1);
 var logger12 = createLogger({ service: "records-lambda" });
 async function handleFindManyReference(resource, params, requestId) {
   const { target, id, filter, sort: sortParam, pagination } = params;
@@ -29284,7 +30388,7 @@ async function handleFindManyReference(resource, params, requestId) {
 __name(handleFindManyReference, "handleFindManyReference");
 
 // src/server/operations/findOne.ts
-var import_lib_dynamodb8 = __toESM(require_dist_cjs60(), 1);
+var import_lib_dynamodb8 = __toESM(require_dist_cjs66(), 1);
 var logger13 = createLogger({ service: "records-lambda" });
 async function handleFindOne(resource, params, requestId) {
   const { id } = params;
@@ -29323,7 +30427,7 @@ async function handleFindOne(resource, params, requestId) {
 __name(handleFindOne, "handleFindOne");
 
 // src/server/operations/insertMany.ts
-var import_lib_dynamodb9 = __toESM(require_dist_cjs60(), 1);
+var import_lib_dynamodb9 = __toESM(require_dist_cjs66(), 1);
 
 // src/server/utils/timestamps.ts
 function getTimestampFields() {
@@ -29605,12 +30709,12 @@ function getPreparationErrorCode(error2) {
       return error2.name;
     }
   }
-  return "VALIDATION_ERROR";
+  return "VALIDATION_ERROR" /* VALIDATION_ERROR */;
 }
 __name(getPreparationErrorCode, "getPreparationErrorCode");
 
 // src/server/operations/insertOne.ts
-var import_lib_dynamodb10 = __toESM(require_dist_cjs60(), 1);
+var import_lib_dynamodb10 = __toESM(require_dist_cjs66(), 1);
 var logger16 = createLogger({ service: "records-lambda" });
 async function handleInsertOne(resource, params, requestId) {
   logger16.debug("Executing insertOne", {
@@ -29663,7 +30767,7 @@ async function handleInsertOne(resource, params, requestId) {
 __name(handleInsertOne, "handleInsertOne");
 
 // src/server/operations/updateMany.ts
-var import_lib_dynamodb11 = __toESM(require_dist_cjs60(), 1);
+var import_lib_dynamodb11 = __toESM(require_dist_cjs66(), 1);
 var logger17 = createLogger({ service: "records-lambda" });
 function applyJsonMergePatch(target, patch) {
   const result = { ...target };
@@ -29934,12 +31038,12 @@ function getPreparationErrorCode2(error2) {
       return error2.name;
     }
   }
-  return "VALIDATION_ERROR";
+  return "VALIDATION_ERROR" /* VALIDATION_ERROR */;
 }
 __name(getPreparationErrorCode2, "getPreparationErrorCode");
 
 // src/server/operations/updateOne.ts
-var import_lib_dynamodb12 = __toESM(require_dist_cjs60(), 1);
+var import_lib_dynamodb12 = __toESM(require_dist_cjs66(), 1);
 var logger18 = createLogger({ service: "records-lambda" });
 function applyJsonMergePatch2(target, patch) {
   const result = { ...target };
@@ -30021,35 +31125,187 @@ async function handleUpdateOne(resource, params, requestId) {
       }
     });
   }
-  for (const shadowRecord of newShadowRecords) {
-    if (shadowDiff.toAdd.includes(shadowRecord.SK)) {
-      transactItems.push({
-        Put: {
-          TableName: tableName,
-          Item: shadowRecord
-        }
-      });
-    }
+  for (const shadowRecord of newShadowRecords) {
+    if (shadowDiff.toAdd.includes(shadowRecord.SK)) {
+      transactItems.push({
+        Put: {
+          TableName: tableName,
+          Item: shadowRecord
+        }
+      });
+    }
+  }
+  await executeDynamoDBOperation(
+    () => dbClient2.send(
+      new import_lib_dynamodb12.TransactWriteCommand({
+        TransactItems: transactItems
+      })
+    ),
+    "TransactWriteItems"
+  );
+  logger18.info("updateOne succeeded", {
+    requestId,
+    resource,
+    id,
+    shadowDiffEmpty: isDiffEmpty(shadowDiff),
+    shadowsDeleted: shadowDiff.toDelete.length,
+    shadowsAdded: shadowDiff.toAdd.length
+  });
+  return removeShadowKeys(updatedData);
+}
+__name(handleUpdateOne, "handleUpdateOne");
+
+// src/server/operations/parameterConverter.ts
+function convertFindParams(mongoParams) {
+  const { filter = {}, options = {} } = mongoParams;
+  const { sort, limit, nextToken } = options;
+  const internalParams = {
+    filter,
+    ...sort && Object.keys(sort).length > 0 && {
+      sort: {
+        field: Object.keys(sort)[0],
+        order: Object.values(sort)[0] === "desc" ? "DESC" : "ASC"
+      }
+    },
+    ...(limit || nextToken) && {
+      pagination: {
+        ...limit && { perPage: limit },
+        ...nextToken && { nextToken }
+      }
+    }
+  };
+  return internalParams;
+}
+__name(convertFindParams, "convertFindParams");
+function convertFindOneParams(mongoParams) {
+  const id = typeof mongoParams.filter?.id === "string" ? mongoParams.filter.id : void 0;
+  if (!id) {
+    throw new Error("findOne requires filter.id");
+  }
+  return { id };
+}
+__name(convertFindOneParams, "convertFindOneParams");
+function convertFindManyParams(mongoParams) {
+  const idFilter = mongoParams.filter?.id;
+  const ids = typeof idFilter === "object" && idFilter !== null && "in" in idFilter ? idFilter.in || [] : [];
+  return { ids };
+}
+__name(convertFindManyParams, "convertFindManyParams");
+function convertInsertOneParams(mongoParams) {
+  if (!mongoParams.document) {
+    throw new Error("insertOne requires document");
+  }
+  return {
+    data: mongoParams.document
+  };
+}
+__name(convertInsertOneParams, "convertInsertOneParams");
+function convertUpdateOneParams(mongoParams) {
+  const id = typeof mongoParams.filter?.id === "string" ? mongoParams.filter.id : void 0;
+  if (!id) {
+    throw new Error("updateOne requires filter.id");
+  }
+  const updateData = mongoParams.update && typeof mongoParams.update === "object" ? "set" in mongoParams.update ? mongoParams.update.set || {} : mongoParams.update : {};
+  return {
+    id,
+    data: updateData
+  };
+}
+__name(convertUpdateOneParams, "convertUpdateOneParams");
+function convertUpdateManyParams(mongoParams) {
+  const idFilter = mongoParams.filter?.id;
+  const ids = typeof idFilter === "object" && idFilter !== null && "in" in idFilter ? idFilter.in || [] : [];
+  const updateData = mongoParams.update && typeof mongoParams.update === "object" ? "set" in mongoParams.update ? mongoParams.update.set || {} : mongoParams.update : {};
+  return {
+    ids,
+    data: updateData
+  };
+}
+__name(convertUpdateManyParams, "convertUpdateManyParams");
+function convertDeleteOneParams(mongoParams) {
+  const id = typeof mongoParams.filter?.id === "string" ? mongoParams.filter.id : void 0;
+  if (!id) {
+    throw new Error("deleteOne requires filter.id");
+  }
+  return { id };
+}
+__name(convertDeleteOneParams, "convertDeleteOneParams");
+function convertDeleteManyParams(mongoParams) {
+  const idFilter = mongoParams.filter?.id;
+  const ids = typeof idFilter === "object" && idFilter !== null && "in" in idFilter ? idFilter.in || [] : [];
+  return { ids };
+}
+__name(convertDeleteManyParams, "convertDeleteManyParams");
+function convertInsertManyParams(mongoParams) {
+  if (!mongoParams.documents) {
+    throw new Error("insertMany requires documents");
   }
-  await executeDynamoDBOperation(
-    () => dbClient2.send(
-      new import_lib_dynamodb12.TransactWriteCommand({
-        TransactItems: transactItems
-      })
-    ),
-    "TransactWriteItems"
-  );
-  logger18.info("updateOne succeeded", {
+  return {
+    data: mongoParams.documents
+  };
+}
+__name(convertInsertManyParams, "convertInsertManyParams");
+
+// src/server/operations/operationDispatcher.ts
+var logger19 = createLogger({
+  service: "operation-dispatcher",
+  level: process.env.LOG_LEVEL || "info"
+});
+async function executeOperation(request2, requestId) {
+  const { op: op2, resource } = request2;
+  logger19.debug("Executing operation", {
     requestId,
-    resource,
-    id,
-    shadowDiffEmpty: isDiffEmpty(shadowDiff),
-    shadowsDeleted: shadowDiff.toDelete.length,
-    shadowsAdded: shadowDiff.toAdd.length
+    operation: op2,
+    resource
   });
-  return removeShadowKeys(updatedData);
+  switch (op2) {
+    case "find": {
+      const internalParams = convertFindParams(request2.params);
+      return await handleFind(resource, internalParams, requestId);
+    }
+    case "findOne": {
+      const internalParams = convertFindOneParams(request2.params);
+      return await handleFindOne(resource, internalParams, requestId);
+    }
+    case "findMany": {
+      const internalParams = convertFindManyParams(request2.params);
+      return await handleFindMany(resource, internalParams, requestId);
+    }
+    case "findManyReference":
+      return await handleFindManyReference(
+        resource,
+        request2.params,
+        requestId
+      );
+    case "insertOne": {
+      const internalParams = convertInsertOneParams(request2.params);
+      return await handleInsertOne(resource, internalParams, requestId);
+    }
+    case "updateOne": {
+      const internalParams = convertUpdateOneParams(request2.params);
+      return await handleUpdateOne(resource, internalParams, requestId);
+    }
+    case "updateMany": {
+      const internalParams = convertUpdateManyParams(request2.params);
+      return await handleUpdateMany(resource, internalParams, requestId);
+    }
+    case "deleteOne": {
+      const internalParams = convertDeleteOneParams(request2.params);
+      return await handleDeleteOne(resource, internalParams, requestId);
+    }
+    case "deleteMany": {
+      const internalParams = convertDeleteManyParams(request2.params);
+      return await handleDeleteMany(resource, internalParams, requestId);
+    }
+    case "insertMany": {
+      const internalParams = convertInsertManyParams(request2.params);
+      return await handleInsertMany(resource, internalParams, requestId);
+    }
+    default:
+      throw new Error(`Unknown operation: ${op2}`);
+  }
 }
-__name(handleUpdateOne, "handleUpdateOne");
+__name(executeOperation, "executeOperation");
 
 // node_modules/aws-jwt-verify/dist/esm/error.js
 var JwtBaseError = class extends Error {
@@ -31216,11 +32472,11 @@ var CognitoJwtVerifier = class _CognitoJwtVerifier extends JwtVerifierBase {
 CognitoJwtVerifier.USER_POOL_ID_REGEX = /^(?<region>[a-z]{2}-(gov-)?[a-z]+-\d)_[a-zA-Z0-9]+$/;
 
 // src/server/utils/auth.ts
-var logger19 = createLogger({ service: "records-lambda" });
+var logger20 = createLogger({ service: "records-lambda" });
 var verifierInstance = null;
 function getVerifier(userPoolId, clientId) {
   if (!verifierInstance) {
-    logger19.debug("Creating JWT verifier instance", { userPoolId, clientId });
+    logger20.debug("Creating JWT verifier instance", { userPoolId, clientId });
     verifierInstance = CognitoJwtVerifier.create({
       userPoolId,
       tokenUse: "id",
@@ -31233,18 +32489,18 @@ function getVerifier(userPoolId, clientId) {
 }
 __name(getVerifier, "getVerifier");
 async function verifyJwt(token, userPoolId, clientId) {
-  logger19.debug("Verifying JWT token with signature validation");
+  logger20.debug("Verifying JWT token with signature validation");
   try {
     const verifier = getVerifier(userPoolId, clientId);
     const payload2 = await verifier.verify(token);
-    logger19.debug("JWT token verified successfully", {
+    logger20.debug("JWT token verified successfully", {
       sub: payload2.sub,
       email: payload2.email,
       tokenUse: payload2.token_use
     });
     return payload2;
   } catch (error2) {
-    logger19.error("JWT verification failed", {
+    logger20.error("JWT verification failed", {
       error: error2 instanceof Error ? error2.message : String(error2)
     });
     let message = "JWT verification failed";
@@ -31284,238 +32540,68 @@ async function verifyAuthHeader(authHeader, userPoolId, clientId) {
 }
 __name(verifyAuthHeader, "verifyAuthHeader");
 
-// src/server/handler.ts
-var logger20 = createLogger({
-  service: "records-lambda",
+// src/server/utils/authHandler.ts
+var logger21 = createLogger({
+  service: "auth-handler",
   level: process.env.LOG_LEVEL || "info"
 });
-logger20.info("Records Lambda started with automatic shadow field detection");
-var CORS_HEADERS = {};
-async function handler(event) {
-  const requestId = event.requestContext.requestId;
-  logger20.info("Received request", {
+async function handleAuthentication(event, requestId) {
+  const authHeader = event.headers.authorization || event.headers.Authorization;
+  const hasAmzDate = event.headers["x-amz-date"] || event.headers["X-Amz-Date"];
+  const hasAmzContentSha = event.headers["x-amz-content-sha256"] || event.headers["X-Amz-Content-Sha256"];
+  const hasAwsSigV4Auth = authHeader?.startsWith("AWS4-HMAC-SHA256");
+  logger21.debug("Authentication check", {
     requestId,
-    method: event.requestContext.http.method,
-    path: event.requestContext.http.path
+    hasAuthHeader: !!authHeader,
+    hasAmzDate: !!hasAmzDate,
+    hasAmzContentSha: !!hasAmzContentSha,
+    hasAwsSigV4Auth: !!hasAwsSigV4Auth,
+    authHeaderPrefix: authHeader?.substring(0, 20)
   });
-  try {
-    if (event.requestContext.http.method === "OPTIONS") {
-      return createCorsResponse(200);
-    }
-    if (event.requestContext.http.method !== "POST") {
-      return createErrorResponse(
-        "METHOD_NOT_ALLOWED",
-        "Only POST method is allowed",
-        405,
-        requestId
-      );
-    }
-    const authHeader = event.headers.authorization || event.headers.Authorization;
-    const hasAmzDate = event.headers["x-amz-date"] || event.headers["X-Amz-Date"];
-    const hasAmzContentSha = event.headers["x-amz-content-sha256"] || event.headers["X-Amz-Content-Sha256"];
-    const hasAwsSigV4Auth = authHeader?.startsWith("AWS4-HMAC-SHA256");
-    logger20.debug("Authentication check", {
-      requestId,
-      hasAuthHeader: !!authHeader,
-      hasAmzDate: !!hasAmzDate,
-      hasAmzContentSha: !!hasAmzContentSha,
-      hasAwsSigV4Auth: !!hasAwsSigV4Auth,
-      authHeaderPrefix: authHeader?.substring(0, 20)
-    });
-    const isIAMAuth = hasAwsSigV4Auth || !!(hasAmzDate && hasAmzContentSha);
-    if (isIAMAuth) {
-      logger20.info("IAM authenticated request", {
-        requestId,
-        sourceIp: event.requestContext.http.sourceIp
-      });
-    } else {
-      const userPoolId = process.env.COGNITO_USER_POOL_ID;
-      const clientId = process.env.COGNITO_CLIENT_ID;
-      if (!userPoolId) {
-        throw new Error("COGNITO_USER_POOL_ID environment variable is required");
-      }
-      const jwtPayload = await verifyAuthHeader(authHeader, userPoolId, clientId);
-      logger20.debug("Cognito JWT verified", {
-        requestId,
-        sub: jwtPayload.sub,
-        email: jwtPayload.email
-      });
-    }
-    const request2 = parseRequestBody(event.body);
-    logger20.info("Parsed request", {
-      requestId,
-      operation: request2.op,
-      resource: request2.resource
-    });
-    const result = await executeOperation(request2, requestId);
-    return createSuccessResponse(result, requestId);
-  } catch (error2) {
-    return handleError(error2, requestId);
+  const isIAMAuth = hasAwsSigV4Auth || !!(hasAmzDate && hasAmzContentSha);
+  if (isIAMAuth) {
+    await handleIAMAuthentication(event, requestId);
+  } else {
+    await handleCognitoAuthentication(authHeader, requestId);
   }
 }
-__name(handler, "handler");
-function parseRequestBody(body) {
-  if (!body) {
-    throw new Error("Request body is required");
-  }
-  try {
-    const parsed = JSON.parse(body);
-    if (!parsed.operation) {
-      throw new Error("Missing required field: operation");
-    }
-    if (!parsed.collection) {
-      throw new Error("Missing required field: collection");
-    }
-    if (parsed.params === void 0) {
-      throw new Error("Missing required field: params");
-    }
-    const op2 = parsed.operation;
-    return {
-      op: op2,
-      resource: parsed.collection,
-      params: parsed.params
-    };
-  } catch (error2) {
-    if (error2 instanceof SyntaxError) {
-      throw new Error("Invalid JSON in request body");
-    }
-    throw error2;
-  }
+__name(handleAuthentication, "handleAuthentication");
+async function handleIAMAuthentication(event, requestId) {
+  logger21.info("IAM authenticated request", {
+    requestId,
+    sourceIp: event.requestContext.http.sourceIp
+  });
 }
-__name(parseRequestBody, "parseRequestBody");
-async function executeOperation(request2, requestId) {
-  const { op: op2, resource } = request2;
-  logger20.debug("Executing operation", {
+__name(handleIAMAuthentication, "handleIAMAuthentication");
+async function handleCognitoAuthentication(authHeader, requestId) {
+  const userPoolId = process.env.COGNITO_USER_POOL_ID;
+  const clientId = process.env.COGNITO_CLIENT_ID;
+  if (!userPoolId) {
+    throw new Error("COGNITO_USER_POOL_ID environment variable is required");
+  }
+  const jwtPayload = await verifyAuthHeader(authHeader, userPoolId, clientId);
+  logger21.debug("Cognito JWT verified", {
     requestId,
-    operation: op2,
-    resource
+    sub: jwtPayload.sub,
+    email: jwtPayload.email
   });
-  switch (op2) {
-    case "find": {
-      const mongoParams = request2.params;
-      const { filter = {}, options = {} } = mongoParams;
-      const { sort, limit, nextToken } = options;
-      logger20.debug("Processing find operation", {
-        requestId,
-        hasSort: !!sort,
-        sortType: typeof sort,
-        sortKeys: sort ? Object.keys(sort) : [],
-        sortValues: sort ? Object.values(sort) : [],
-        sort,
-        hasNextToken: !!nextToken
-      });
-      const internalParams = {
-        filter,
-        ...sort && Object.keys(sort).length > 0 && {
-          sort: {
-            field: Object.keys(sort)[0],
-            order: Object.values(sort)[0] === "desc" ? "DESC" : "ASC"
-          }
-        },
-        ...(limit || nextToken) && {
-          pagination: {
-            ...limit && { perPage: limit },
-            ...nextToken && { nextToken }
-          }
-        }
-      };
-      return await handleFind(resource, internalParams, requestId);
-    }
-    case "findOne": {
-      const mongoParams = request2.params;
-      const id = typeof mongoParams.filter?.id === "string" ? mongoParams.filter.id : void 0;
-      if (!id) {
-        throw new Error("findOne requires filter.id");
-      }
-      const internalParams = { id };
-      return await handleFindOne(resource, internalParams, requestId);
-    }
-    case "findMany": {
-      const mongoParams = request2.params;
-      const idFilter = mongoParams.filter?.id;
-      const ids = typeof idFilter === "object" && idFilter !== null && "in" in idFilter ? idFilter.in || [] : [];
-      const internalParams = { ids };
-      return await handleFindMany(resource, internalParams, requestId);
-    }
-    case "findManyReference":
-      return await handleFindManyReference(
-        resource,
-        request2.params,
-        requestId
-      );
-    case "insertOne": {
-      const mongoParams = request2.params;
-      if (!mongoParams.document) {
-        throw new Error("insertOne requires document");
-      }
-      const internalParams = {
-        data: mongoParams.document
-      };
-      return await handleInsertOne(resource, internalParams, requestId);
-    }
-    case "updateOne": {
-      const mongoParams = request2.params;
-      const id = typeof mongoParams.filter?.id === "string" ? mongoParams.filter.id : void 0;
-      if (!id) {
-        throw new Error("updateOne requires filter.id");
-      }
-      const updateData = mongoParams.update && typeof mongoParams.update === "object" ? "set" in mongoParams.update ? mongoParams.update.set || {} : mongoParams.update : {};
-      const internalParams = {
-        id,
-        data: updateData
-      };
-      return await handleUpdateOne(resource, internalParams, requestId);
-    }
-    case "updateMany": {
-      const mongoParams = request2.params;
-      const idFilter = mongoParams.filter?.id;
-      const ids = typeof idFilter === "object" && idFilter !== null && "in" in idFilter ? idFilter.in || [] : [];
-      const updateData = mongoParams.update && typeof mongoParams.update === "object" ? "set" in mongoParams.update ? mongoParams.update.set || {} : mongoParams.update : {};
-      const internalParams = {
-        ids,
-        data: updateData
-      };
-      return await handleUpdateMany(resource, internalParams, requestId);
-    }
-    case "deleteOne": {
-      const mongoParams = request2.params;
-      const id = typeof mongoParams.filter?.id === "string" ? mongoParams.filter.id : void 0;
-      if (!id) {
-        throw new Error("deleteOne requires filter.id");
-      }
-      const internalParams = { id };
-      return await handleDeleteOne(resource, internalParams, requestId);
-    }
-    case "deleteMany": {
-      const mongoParams = request2.params;
-      const idFilter = mongoParams.filter?.id;
-      const ids = typeof idFilter === "object" && idFilter !== null && "in" in idFilter ? idFilter.in || [] : [];
-      const internalParams = { ids };
-      return await handleDeleteMany(resource, internalParams, requestId);
-    }
-    case "insertMany": {
-      const mongoParams = request2.params;
-      if (!mongoParams.documents) {
-        throw new Error("insertMany requires documents");
-      }
-      const internalParams = {
-        data: mongoParams.documents
-      };
-      return await handleInsertMany(resource, internalParams, requestId);
-    }
-    default:
-      throw new Error(`Unknown operation: ${op2}`);
-  }
 }
-__name(executeOperation, "executeOperation");
+__name(handleCognitoAuthentication, "handleCognitoAuthentication");
+
+// src/server/utils/responseBuilder.ts
+var logger22 = createLogger({
+  service: "response-builder",
+  level: process.env.LOG_LEVEL || "info"
+});
+var CORS_HEADERS = {};
 function createSuccessResponse(data2, requestId) {
   const response = {
     success: true,
     data: data2
   };
-  logger20.info("Request succeeded", { requestId });
+  logger22.info("Request succeeded", { requestId });
   return {
-    statusCode: 200,
+    statusCode: HTTP_STATUS.OK,
     headers: {
       "Content-Type": "application/json",
       ...CORS_HEADERS
@@ -31534,7 +32620,7 @@ function createErrorResponse(code, message, statusCode, requestId, details) {
       details
     }
   };
-  logger20.error("Request failed", {
+  logger22.error("Request failed", {
     requestId,
     code,
     message,
@@ -31558,6 +32644,12 @@ function createCorsResponse(statusCode) {
   };
 }
 __name(createCorsResponse, "createCorsResponse");
+
+// src/server/utils/errorHandler.ts
+var logger23 = createLogger({
+  service: "error-handler",
+  level: process.env.LOG_LEVEL || "info"
+});
 function handleError(error2, requestId) {
   if (isAppError(error2)) {
     return createErrorResponse(
@@ -31569,27 +32661,97 @@ function handleError(error2, requestId) {
     );
   }
   if (error2 instanceof Error) {
-    logger20.error("Error stack trace", {
+    logger23.error("Error stack trace", {
       requestId,
       stack: error2.stack,
       message: error2.message
     });
-    if (error2.message.includes("Missing required field") || error2.message.includes("Invalid JSON") || error2.message.includes("Request body is required")) {
-      return createErrorResponse("VALIDATION_ERROR", error2.message, 400, requestId);
+    if (isValidationError(error2.message)) {
+      return createErrorResponse("VALIDATION_ERROR" /* VALIDATION_ERROR */, error2.message, HTTP_STATUS.BAD_REQUEST, requestId);
     }
     if (error2.message.includes("not yet implemented")) {
-      return createErrorResponse("NOT_IMPLEMENTED", error2.message, 501, requestId);
+      return createErrorResponse("NOT_IMPLEMENTED" /* NOT_IMPLEMENTED */, error2.message, HTTP_STATUS.NOT_IMPLEMENTED, requestId);
     }
     if (error2.message.includes("Unknown operation")) {
-      return createErrorResponse("INVALID_OPERATION", error2.message, 400, requestId);
+      return createErrorResponse("INVALID_OPERATION" /* INVALID_OPERATION */, error2.message, HTTP_STATUS.BAD_REQUEST, requestId);
     }
-    return createErrorResponse("INTERNAL_ERROR", error2.message, 500, requestId);
+    return createErrorResponse("INTERNAL_ERROR" /* INTERNAL_ERROR */, error2.message, HTTP_STATUS.INTERNAL_SERVER_ERROR, requestId);
   }
-  return createErrorResponse("UNKNOWN_ERROR", "An unexpected error occurred", 500, requestId, {
+  return createErrorResponse("UNKNOWN_ERROR" /* UNKNOWN_ERROR */, "An unexpected error occurred", HTTP_STATUS.INTERNAL_SERVER_ERROR, requestId, {
     error: String(error2)
   });
 }
 __name(handleError, "handleError");
+function isValidationError(message) {
+  return VALIDATION_ERROR_PATTERNS.some((pattern) => message.includes(pattern));
+}
+__name(isValidationError, "isValidationError");
+
+// src/server/utils/requestParser.ts
+function parseRequestBody(body) {
+  if (!body) {
+    throw new Error(VALIDATION_ERROR_MESSAGES.REQUEST_BODY_REQUIRED);
+  }
+  try {
+    const parsed = JSON.parse(body);
+    if (!parsed.operation) {
+      throw new Error(VALIDATION_ERROR_MESSAGES.MISSING_OPERATION);
+    }
+    if (!parsed.collection) {
+      throw new Error(VALIDATION_ERROR_MESSAGES.MISSING_COLLECTION);
+    }
+    if (parsed.params === void 0) {
+      throw new Error(VALIDATION_ERROR_MESSAGES.MISSING_PARAMS);
+    }
+    const op2 = parsed.operation;
+    return {
+      op: op2,
+      resource: parsed.collection,
+      params: parsed.params
+    };
+  } catch (error2) {
+    if (error2 instanceof SyntaxError) {
+      throw new Error(VALIDATION_ERROR_MESSAGES.INVALID_JSON);
+    }
+    throw error2;
+  }
+}
+__name(parseRequestBody, "parseRequestBody");
+
+// src/server/handler.ts
+var logger24 = createLogger({
+  service: "records-lambda",
+  level: process.env.LOG_LEVEL || "info"
+});
+logger24.info("Records Lambda started with automatic shadow field detection");
+async function handler(event) {
+  const requestId = event.requestContext.requestId;
+  logger24.info("Received request", {
+    requestId,
+    method: event.requestContext.http.method,
+    path: event.requestContext.http.path
+  });
+  try {
+    if (event.requestContext.http.method === "OPTIONS") {
+      return createCorsResponse(HTTP_STATUS.OK);
+    }
+    if (event.requestContext.http.method !== "POST") {
+      throw new Error("Only POST method is allowed");
+    }
+    await handleAuthentication(event, requestId);
+    const request2 = parseRequestBody(event.body);
+    logger24.info("Parsed request", {
+      requestId,
+      operation: request2.op,
+      resource: request2.resource
+    });
+    const result = await executeOperation(request2, requestId);
+    return createSuccessResponse(result, requestId);
+  } catch (error2) {
+    return handleError(error2, requestId);
+  }
+}
+__name(handler, "handler");
 // Annotate the CommonJS export names for ESM import in node:
 0 && (module.exports = {
   handler