@circle-fin/w3s-pw-react-native-sdk 1.1.7 → 2.0.1

package/android/src/main/java/com/circlefin/programmablewalletrnsdk/RecordsHelper.kt

@@ -0,0 +1,602 @@
+/**
+ * Copyright 2025 Circle Internet Group, Inc. All rights reserved.
+ *
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.circlefin.programmablewalletrnsdk
+
+import android.content.Context
+import android.graphics.Color
+import android.graphics.Typeface
+import android.text.TextUtils
+import android.util.Log
+import circle.programmablewallet.sdk.api.ApiError
+import circle.programmablewallet.sdk.api.ExecuteWarning
+import circle.programmablewallet.sdk.presentation.SecurityQuestion
+import circle.programmablewallet.sdk.presentation.SettingsManagement
+import circle.programmablewallet.sdk.presentation.TextConfig
+import circle.programmablewallet.sdk.presentation.IconTextConfig
+import com.circlefin.programmablewalletrnsdk.pwcustom.RnLayoutProvider
+import circle.programmablewallet.sdk.presentation.Resource
+import com.circlefin.programmablewalletrnsdk.pwcustom.RnImageSetter
+import circle.programmablewallet.sdk.result.ExecuteResult
+import circle.programmablewallet.sdk.result.LoginResult
+import com.circlefin.programmablewalletrnsdk.models.ConfigurationRecord
+import com.circlefin.programmablewalletrnsdk.models.SettingsManagementRecord
+
+object RecordsHelper {
+
+    private const val INPUT_TYPE_TEXT = "text"
+    private const val INPUT_TYPE_DATE_PICKER = "datePicker"
+
+    private val typefaceMap = mutableMapOf<String, Typeface>()
+    fun convertJsSecurityQuestionsToNative(jsSecurityQuestions: Array<Any>): Array<SecurityQuestion?> {
+        return jsSecurityQuestions.mapIndexed { _, jsQuestion ->
+            try {
+                val (title, inputTypeValue) = extractSecurityQuestionData(jsQuestion)
+
+                val inputType = when (inputTypeValue) {
+                    INPUT_TYPE_TEXT -> SecurityQuestion.InputType.text
+                    INPUT_TYPE_DATE_PICKER -> SecurityQuestion.InputType.datePicker
+                    else -> {
+                        SecurityQuestion.InputType.text
+                    }
+                }
+
+                val securityQuestion = SecurityQuestion(title, inputType)
+                securityQuestion
+            } catch (e: Exception) {
+                SecurityQuestion("", SecurityQuestion.InputType.text)
+            }
+        }.toTypedArray()
+    }
+
+    private fun extractSecurityQuestionData(jsQuestion: Any): Pair<String, String?> {
+        return when (jsQuestion) {
+            is Map<*, *> -> {
+                val title = (jsQuestion["title"] as? String) ?: ""
+                val inputType = jsQuestion["inputType"] as? String
+                Pair(title, inputType)
+            }
+
+            is Array<*> -> {
+                if (jsQuestion.size >= 2) {
+                    val title = (jsQuestion[0] as? String) ?: ""
+                    val inputType = jsQuestion[1] as? String
+                    Pair(title, inputType)
+                } else {
+                    Pair("", null)
+                }
+            }
+
+            else -> {
+                val title = tryExtractField(jsQuestion, "title") ?: ""
+                val inputType = tryExtractField(jsQuestion, "inputType")
+                Pair(title, inputType)
+            }
+        }
+    }
+
+    private fun tryExtractField(obj: Any, fieldName: String): String? {
+        return try {
+            /** Try direct field access */
+            val field = obj.javaClass.getDeclaredField(fieldName)
+            field.isAccessible = true
+            field.get(obj) as? String
+        } catch (e: Exception) {
+            try {
+                /** Try getter method */
+                val capitalizedName = fieldName.first().uppercaseChar() + fieldName.substring(1)
+                val getter = obj.javaClass.getMethod("get$capitalizedName")
+                getter.invoke(obj) as? String
+            } catch (e2: Exception) {
+                try {
+                    /** Try public field */
+                    val field = obj.javaClass.getField(fieldName)
+                    field.get(obj) as? String
+                } catch (e3: Exception) {
+                    null
+                }
+            }
+        }
+    }
+
+    private fun toNativeSettingsManagement(record: SettingsManagementRecord): SettingsManagement {
+        return SettingsManagement(record.enableBiometricsPin)
+    }
+
+    fun prepareConfigurationData(record: ConfigurationRecord): Triple<String?, String?, SettingsManagement?> {
+        val endpoint = record.endpoint?.run {
+            if (this.endsWith("/")) this else "$this/"
+        }
+        val appId = record.appId
+        val settings = record.settingsManagement?.let { settingsRecord ->
+            toNativeSettingsManagement(settingsRecord)
+        }
+
+        return Triple(endpoint, appId, settings)
+    }
+
+    fun convertToDismissOnCallbackMap(mapData: Map<String, Any>): Map<Int, Boolean> {
+        val result = mapData.mapNotNull { (key, value) ->
+            try {
+                val intKey = key.toInt()
+                val boolValue = when (value) {
+                    is Boolean -> value
+                    is String -> value.toBoolean()
+                    is Number -> value.toInt() != 0
+                    else -> false
+                }
+                intKey to boolValue
+            } catch (e: NumberFormatException) {
+                null
+            }
+        }.toMap()
+        return result
+    }
+
+    fun filterValidErrorCodeKeys(mapData: Map<String, Any>): Map<String, Any> {
+        return mapData.filter { (key, _) ->
+            // Check if key is a valid integer string or ErrorCode name
+            try {
+                key.toInt()
+                true
+            } catch (e: NumberFormatException) {
+                errorCodeStringToIntMap.containsKey(key)
+            }
+        }
+    }
+
+    fun convertToErrorStringMap(mapData: Map<String, Any>): Map<Int, String> {
+        val result = mapData.map { (key, value) ->
+            // Convert key to Int (keys are pre-validated by filterValidErrorCodeKeys)
+            val intKey: Int = try {
+                key.toInt()
+            } catch (e: NumberFormatException) {
+                // If not an integer string, map from error code string
+                errorCodeStringToIntMap[key] ?: throw IllegalArgumentException("Invalid ErrorCode key: $key")
+            }
+
+            val stringValue = when (value) {
+                is String -> value
+                else -> value.toString()
+            }
+            intKey to stringValue
+        }.toMap()
+        return result
+    }
+
+    private val errorCodeStringToIntMap = mapOf(
+        "unknown" to -1,
+        "success" to 0,
+        "apiParameterMissing" to 1,
+        "apiParameterInvalid" to 2,
+        "forbidden" to 3,
+        "unauthorized" to 4,
+        "retry" to 9,
+        "customerSuspended" to 10,
+        "pending" to 11,
+        "invalidSession" to 12,
+        "invalidPartnerId" to 13,
+        "invalidMessage" to 14,
+        "invalidPhone" to 15,
+        "walletIdNotFound" to 156001,
+        "tokenIdNotFound" to 156002,
+        "transactionIdNotFound" to 156003,
+        "walletSetIdNotFound" to 156004,
+        "notEnoughFounds" to 155201,
+        "notEnoughBalance" to 155202,
+        "exceedWithdrawLimit" to 155203,
+        "minimumFundsRequired" to 155204,
+        "invalidTransactionFee" to 155205,
+        "rejectedOnAmlScreening" to 155206,
+        "tagRequired" to 155207,
+        "gasLimitTooLow" to 155208,
+        "transactionDataNotEncodedProperly" to 155209,
+        "fullNodeReturnedError" to 155210,
+        "walletSetupRequired" to 155211,
+        "lowerThenMinimumAccountBalance" to 155212,
+        "rejectedByBlockchain" to 155213,
+        "droppedAsPartOfReorg" to 155214,
+        "operationNotSupport" to 155215,
+        "amountBelowMinimum" to 155216,
+        "wrongNftTokenIdNumber" to 155217,
+        "invalidDestinationAddress" to 155218,
+        "tokenWalletChainMismatch" to 155219,
+        "wrongAmountsNumber" to 155220,
+        "userAlreadyExisted" to 155101,
+        "userNotFound" to 155102,
+        "userTokenNotFound" to 155103,
+        "userTokenExpired" to 155104,
+        "invalidUserToken" to 155105,
+        "userWasInitialized" to 155106,
+        "userHasSetPin" to 155107,
+        "userHasSetSecurityQuestion" to 155108,
+        "userWasDisabled" to 155109,
+        "userDoesNotSetPinYet" to 155110,
+        "userDoesNotSetSecurityQuestionYet" to 155111,
+        "incorrectUserPin" to 155112,
+        "incorrectDeviceId" to 155113,
+        "incorrectAppId" to 155114,
+        "incorrectSecurityAnswers" to 155115,
+        "invalidChallengeId" to 155116,
+        "invalidApproveContent" to 155117,
+        "invalidEncryptionKey" to 155118,
+        "userPinLocked" to 155119,
+        "securityAnswersLocked" to 155120,
+        "walletIsFrozen" to 155501,
+        "maxWalletLimitReached" to 155502,
+        "walletSetIdMutuallyExclusive" to 155503,
+        "metadataUnmatched" to 155504,
+        "userCanceled" to 155701,
+        "launchUiFailed" to 155702,
+        "pinCodeNotMatched" to 155703,
+        "insecurePinCode" to 155704,
+        "hintsMatchAnswers" to 155705,
+        "networkError" to 155706,
+        "biometricsSettingNotEnabled" to 155708,
+        "deviceNotSupportBiometrics" to 155709,
+        "biometricsKeyPermanentlyInvalidated" to 155710,
+        "biometricsUserSkip" to 155711,
+        "biometricsUserDisableForPin" to 155712,
+        "biometricsUserLockout" to 155713,
+        "biometricsUserLockoutPermanent" to 155714,
+        "biometricsUserNotAllowPermission" to 155715,
+        "biometricsInternalError" to 155716,
+        "userSecretMissing" to 155717,
+        "invalidUserTokenFormat" to 155718,
+        "userTokenMismatch" to 155719,
+        "socialLoginFailed" to 155720,
+        "loginInfoMissing" to 155721
+    )
+
+    fun convertToImageMap(context: Context, mapData: Map<String, Any>): Map<String, String> {
+        val result = mapData.mapNotNull { (key, value) ->
+            try {
+                val imageUrl = when (value) {
+                    is String -> value
+                    else -> value.toString()
+                }
+
+                // Map TypeScript ImageKey enum values to their actual enum names
+                // Some ImageKey values use different names than expected
+                val mappedKey = when (key) {
+                    "back" -> "back"  // This maps to ToolbarIcon.back
+                    "close" -> "close"  // This maps to ToolbarIcon.close
+                    else -> key  // Most keys should match Resource.Icon enum names directly
+                }
+
+                mappedKey to imageUrl
+            } catch (e: Exception) {
+                Log.e("RecordsHelper", "Failed to process image map entry for key: '$key', value: '$value'", e)
+                null
+            }
+        }.toMap()
+        return result
+    }
+
+    private fun convertExecuteResultToMap(result: ExecuteResult): Map<String, Any?> {
+        return mapOf(
+            "resultType" to result.resultType?.name,
+            "status" to result.status?.name,
+            "data" to result.data?.let { data ->
+                mapOf(
+                    "signature" to data.signature,
+                    "signedTransaction" to data.signedTransaction,
+                    "txHash" to data.txHash
+                )
+            }
+        )
+    }
+
+    fun convertApiErrorToMap(error: ApiError): Map<String, Any?> {
+        // Check if there's a custom error message set via setErrorStringMap
+        val customMessage = RnLayoutProvider.getErrorString(error.code)
+        val messageToUse = customMessage ?: error.message
+
+        return mapOf(
+            "code" to error.code.value,
+            "message" to messageToUse
+        )
+    }
+
+    fun convertExecuteWarningToMap(warning: ExecuteWarning): Map<String, Any?> {
+        return mapOf(
+            "warningType" to warning.warningType,
+            "warningString" to warning.warningString
+        )
+    }
+
+    fun convertResultToMap(result: Any?): Map<String, Any?> {
+        return when (result) {
+            null -> emptyMap()
+            is ExecuteResult -> convertExecuteResultToMap(result)
+            is LoginResult -> convertLoginResultToMap(result)
+            is Map<*, *> -> {
+                @Suppress("UNCHECKED_CAST")
+                result as Map<String, Any?>
+            }
+
+            else -> {
+                try {
+                    mapOf("data" to result.toString())
+                } catch (e: Exception) {
+                    mapOf("data" to result.toString())
+                }
+            }
+        }
+    }
+
+    private fun convertLoginResultToMap(loginResult: LoginResult): Map<String, Any?> {
+        val resultMap = mutableMapOf<String, Any?>()
+
+        loginResult.userToken?.let { resultMap["userToken"] = it }
+        loginResult.encryptionKey?.let { resultMap["encryptionKey"] = it }
+        loginResult.refreshToken?.let { resultMap["refreshToken"] = it }
+
+        loginResult.oauthInfo?.let { oauthInfo ->
+            val oauthMap = mutableMapOf<String, Any?>()
+            oauthInfo.provider?.let { oauthMap["provider"] = it }
+            oauthInfo.scope?.let { oauthMap["scope"] = it }
+            oauthInfo.socialUserUUID?.let { oauthMap["socialUserUUID"] = it }
+
+            oauthInfo.socialUserInfo?.let { userInfo ->
+                val userInfoMap = mutableMapOf<String, Any?>()
+                userInfo.name?.let { userInfoMap["name"] = it }
+                userInfo.email?.let { userInfoMap["email"] = it }
+                userInfo.phone?.let { userInfoMap["phone"] = it }
+                if (userInfoMap.isNotEmpty()) {
+                    oauthMap["socialUserInfo"] = userInfoMap
+                }
+            }
+
+            if (oauthMap.isNotEmpty()) {
+                resultMap["oauthInfo"] = oauthMap
+            }
+        }
+
+        return resultMap
+    }
+
+    fun convertToTextConfigsMap(context: Context, mapData: Map<String, Any>): Map<String, Array<TextConfig?>> {
+        val resultMap = mutableMapOf<String, Array<TextConfig?>>()
+
+        for ((key, value) in mapData) {
+            when (value) {
+                is List<*> -> {
+                    val textConfigs = mutableListOf<TextConfig?>()
+                    for (item in value) {
+                        val textConfig = convertToTextConfig(context, item)
+                        textConfigs.add(textConfig)
+                    }
+                    resultMap[key] = textConfigs.toTypedArray()
+                }
+                is Array<*> -> {
+                    val textConfigs = mutableListOf<TextConfig?>()
+                    for (item in value) {
+                        val textConfig = convertToTextConfig(context, item)
+                        textConfigs.add(textConfig)
+                    }
+                    resultMap[key] = textConfigs.toTypedArray()
+                }
+                else -> {
+                    // If it's not a collection, treat it as a single TextConfig
+                    val textConfig = convertToTextConfig(context, value)
+                    resultMap[key] = arrayOf(textConfig)
+                }
+            }
+        }
+
+        return resultMap
+    }
+
+    fun convertToTextConfigMap(context: Context, mapData: Map<String, Any>): Map<String, TextConfig> {
+        val resultMap = mutableMapOf<String, TextConfig>()
+
+        for ((key, value) in mapData) {
+            val textConfig = convertToTextConfig(context, value)
+            textConfig?.let {
+                resultMap[key] = it
+            }
+        }
+
+        return resultMap
+    }
+
+    fun convertToIconTextConfigsMap(context: Context, mapData: Map<String, Any>): Map<Resource.IconTextsKey, Array<IconTextConfig?>> {
+        val resultMap = mutableMapOf<Resource.IconTextsKey, Array<IconTextConfig?>>()
+
+        for ((key, value) in mapData) {
+            try {
+                val enumKey = Resource.IconTextsKey.valueOf(key)
+
+                when (value) {
+                    is List<*> -> {
+                        val iconTextConfigs = mutableListOf<IconTextConfig?>()
+                        for (item in value) {
+                            val iconTextConfig = createIconTextConfig(context, item)
+                            iconTextConfigs.add(iconTextConfig)
+                        }
+                        resultMap[enumKey] = iconTextConfigs.toTypedArray()
+                    }
+                    is Array<*> -> {
+                        val iconTextConfigs = mutableListOf<IconTextConfig?>()
+                        for (item in value) {
+                            val iconTextConfig = createIconTextConfig(context, item)
+                            iconTextConfigs.add(iconTextConfig)
+                        }
+                        resultMap[enumKey] = iconTextConfigs.toTypedArray()
+                    }
+                    else -> {
+                        val iconTextConfig = createIconTextConfig(context, value)
+                        resultMap[enumKey] = arrayOf(iconTextConfig)
+                    }
+                }
+            } catch (e: Exception) {
+                continue
+            }
+        }
+
+        return resultMap
+    }
+
+    /**
+     * Creates an IconTextConfig using the map data.
+     *
+     * @param context The Android context.
+     * @param data The input data, expected to be a map with the following structure:
+     * - "image": A string representing the image URL (optional).
+     * - "textConfig": An object that can be converted to a TextConfig instance (optional).
+     * If the input is not a map or does not contain these keys, the function will attempt
+     * to create a TextConfig from the data directly.
+     * @return An IconTextConfig instance if the input data is valid, or null otherwise.
+     */
+     private fun createIconTextConfig(context: Context, data: Any?): IconTextConfig? {
+         if (data == null) return null
+
+         return when (data) {
+             is Map<*, *> -> {
+                 @Suppress("UNCHECKED_CAST")
+                 val dataMap = data as Map<String, Any?>
+
+                 val imageUrl = dataMap["image"] as? String
+
+                 val textConfigData = dataMap["textConfig"]
+                 val textConfig = if (textConfigData != null) {
+                     convertToTextConfig(context, textConfigData)
+                 } else {
+                     null
+                 }
+
+                 try {
+                     val setter = if (imageUrl != null) {
+                         RnImageSetter(imageUrl)
+                     } else {
+                         null
+                     }
+
+                     IconTextConfig(setter, textConfig)
+                 } catch (e: Exception) {
+                     null
+                 }
+             }
+             else -> {
+                 try {
+                     val textConfig = convertToTextConfig(context, data)
+                     IconTextConfig(null, textConfig)
+                 } catch (e: Exception) {
+                     null
+                 }
+             }
+         }
+     }
+
+    private fun convertToTextConfig(context: Context, data: Any?): TextConfig? {
+        if (data == null) return null
+
+        return when (data) {
+            is Map<*, *> -> {
+                @Suppress("UNCHECKED_CAST")
+                val dataMap = data as Map<String, Any?>
+
+                val text = dataMap["text"] as? String
+                val gradientColors = convertToGradientColors(dataMap["gradientColors"])
+                val font = dataMap["font"] as? String
+                val textColor = dataMap["textColor"] as? String
+
+                val textConfig = TextConfig(text, gradientColors, getTypeface(context, font))
+                textConfig.textColor = getColor(textColor)
+                textConfig
+            }
+            is String -> {
+                TextConfig(data, null, null)
+            }
+            else -> {
+                try {
+                    val stringValue = data.toString()
+                    if (stringValue.isNotEmpty() && stringValue != "null") {
+                        TextConfig(stringValue, null, null)
+                    } else {
+                        null
+                    }
+                } catch (e: Exception) {
+                    null
+                }
+            }
+        }
+    }
+
+    private fun convertToGradientColors(colorsData: Any?): IntArray? {
+        if (colorsData == null) return null
+
+        return when (colorsData) {
+            is List<*> -> {
+                colorsData.mapNotNull { colorStr ->
+                    try {
+                        getColor(colorStr as? String)
+                    } catch (e: Exception) {
+                        null
+                    }
+                }.toIntArray()
+            }
+            is Array<*> -> {
+                colorsData.mapNotNull { colorStr ->
+                    try {
+                        getColor(colorStr as? String)
+                    } catch (e: Exception) {
+                        null
+                    }
+                }.toIntArray()
+            }
+            else -> null
+        }
+    }
+
+    private fun getColor(colorStr: String?): Int {
+        return try {
+            if (TextUtils.isEmpty(colorStr)) {
+                0
+            } else Color.parseColor(colorStr)
+        } catch (e: Exception) {
+            0
+        }
+    }
+
+    private fun getTypeface(context: Context, fontFamilyName: String?): Typeface? {
+        if (TextUtils.isEmpty(fontFamilyName)) {
+            return null
+        }
+
+        if (typefaceMap[fontFamilyName] != null) {
+            return typefaceMap[fontFamilyName]
+        }
+
+        val fileExtensions = arrayOf(".ttf", ".otf")
+        val fontsAssetPath = "fonts/"
+
+        for (fileExtension in fileExtensions) {
+            try {
+                val fileName = fontsAssetPath + fontFamilyName!! + fileExtension
+                val typeface = Typeface.createFromAsset(context.assets, fileName)
+                typefaceMap[fontFamilyName] = typeface
+                return typeface
+            } catch (e: Exception) {
+                // If the typeface asset does not exist, try another extension.
+                continue
+            }
+        }
+        return null
+    }
+}

package/android/src/main/java/com/circlefin/programmablewalletrnsdk/models/Records.kt

@@ -0,0 +1,43 @@
+/**
+ * Copyright 2025 Circle Internet Group, Inc. All rights reserved.
+ *
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.circlefin.programmablewalletrnsdk.models
+
+import expo.modules.kotlin.records.Field
+import expo.modules.kotlin.records.Record
+
+/**
+ * Record for settings management configuration
+ */
+class SettingsManagementRecord : Record {
+    @Field
+    val enableBiometricsPin: Boolean = false
+}
+
+/**
+ * Record for wallet SDK configuration
+ */
+class ConfigurationRecord : Record {
+    @Field
+    val endpoint: String? = null
+
+    @Field
+    val appId: String? = null
+
+    @Field
+    val settingsManagement: SettingsManagementRecord? = null
+}