@camunda/play 5.5.2-rc.7 → 5.5.2-rc.9

package/build/index.js

@@ -74,14 +74,14 @@ function qRe() {
         Ve.unshift("Warning: " + Te), Function.prototype.apply.call(console[$], console, Ve);
       }
     }
-    var D = !1, N = !1, z = !1, T = !1, L = !1, S;
-    S = Symbol.for("react.module.reference");
+    var D = !1, N = !1, z = !1, T = !1, S = !1, L;
+    L = Symbol.for("react.module.reference");
     function _($) {
-      return !!(typeof $ == "string" || typeof $ == "function" || $ === n || $ === r || L || $ === i || $ === p || $ === u || T || $ === g || D || N || z || typeof $ == "object" && $ !== null && ($.$$typeof === h || $.$$typeof === d || $.$$typeof === s || $.$$typeof === a || $.$$typeof === l || // This needs to include all possible module reference object
+      return !!(typeof $ == "string" || typeof $ == "function" || $ === n || $ === r || S || $ === i || $ === p || $ === u || T || $ === g || D || N || z || typeof $ == "object" && $ !== null && ($.$$typeof === h || $.$$typeof === d || $.$$typeof === s || $.$$typeof === a || $.$$typeof === l || // This needs to include all possible module reference object
       // types supported by any Flight configuration anywhere since
       // we don't know which Flight build this will end up being used
       // with.
-      $.$$typeof === S || $.getModuleId !== void 0));
+      $.$$typeof === L || $.getModuleId !== void 0));
     }
     function j($, Te, et) {
       var kt = $.displayName;
@@ -4014,7 +4014,7 @@ const Qn = new tBe(), nBe = (o) => ({
       version: e?.processDefinition?.processDefinitionVersion
     }
   }))
-});
+}), y7e = "pickerKey";
 function iBe(o, e) {
   const t = {
     customProperties: {
@@ -4025,7 +4025,6 @@ function iBe(o, e) {
   }, n = new FormData();
   return n.append("files", e), n.append("metadata", JSON.stringify(t)), n;
 }
-const y7e = "pickerKey";
 class oBe {
   // eslint-disable-next-line @typescript-eslint/no-explicit-any
   handlePostRequest = void 0;
@@ -5104,9 +5103,9 @@ function I7e() {
         break;
       }
       if (C) {
-        if (!e(a, function(T, L) {
-          if (!t(C, L) && (D === T || u(D, T, l, p, d)))
-            return C.push(L);
+        if (!e(a, function(T, S) {
+          if (!t(C, S) && (D === T || u(D, T, l, p, d)))
+            return C.push(S);
         })) {
           v = !1;
           break;
@@ -5156,8 +5155,8 @@ function ZBe() {
   if (HR) return bD;
   HR = 1;
   var o = jL(), e = FBe(), t = w7e(), n = I7e(), i = YBe(), r = WBe(), s = 1, a = 2, l = "[object Boolean]", p = "[object Date]", u = "[object Error]", d = "[object Map]", h = "[object Number]", g = "[object RegExp]", m = "[object Set]", A = "[object String]", f = "[object Symbol]", w = "[object ArrayBuffer]", v = "[object DataView]", C = o ? o.prototype : void 0, D = C ? C.valueOf : void 0;
-  function N(z, T, L, S, _, j, O) {
-    switch (L) {
+  function N(z, T, S, L, _, j, O) {
+    switch (S) {
       case v:
         if (z.byteLength != T.byteLength || z.byteOffset != T.byteOffset)
           return !1;
@@ -5176,14 +5175,14 @@ function ZBe() {
       case d:
         var R = i;
       case m:
-        var V = S & s;
+        var V = L & s;
         if (R || (R = r), z.size != T.size && !V)
           return !1;
         var q = O.get(z);
         if (q)
           return q == T;
-        S |= a, O.set(z, T);
-        var se = n(R(z), R(T), S, _, j, O);
+        L |= a, O.set(z, T);
+        var se = n(R(z), R(T), L, _, j, O);
         return O.delete(z), se;
       case f:
         if (D)
@@ -5338,8 +5337,8 @@ var kD, eP;
 function rVe() {
   if (eP) return kD;
   eP = 1;
-  var o = g8(), e = z7e(), t = f8(), n = "[object Arguments]", i = "[object Array]", r = "[object Boolean]", s = "[object Date]", a = "[object Error]", l = "[object Function]", p = "[object Map]", u = "[object Number]", d = "[object Object]", h = "[object RegExp]", g = "[object Set]", m = "[object String]", A = "[object WeakMap]", f = "[object ArrayBuffer]", w = "[object DataView]", v = "[object Float32Array]", C = "[object Float64Array]", D = "[object Int8Array]", N = "[object Int16Array]", z = "[object Int32Array]", T = "[object Uint8Array]", L = "[object Uint8ClampedArray]", S = "[object Uint16Array]", _ = "[object Uint32Array]", j = {};
-  j[v] = j[C] = j[D] = j[N] = j[z] = j[T] = j[L] = j[S] = j[_] = !0, j[n] = j[i] = j[f] = j[r] = j[w] = j[s] = j[a] = j[l] = j[p] = j[u] = j[d] = j[h] = j[g] = j[m] = j[A] = !1;
+  var o = g8(), e = z7e(), t = f8(), n = "[object Arguments]", i = "[object Array]", r = "[object Boolean]", s = "[object Date]", a = "[object Error]", l = "[object Function]", p = "[object Map]", u = "[object Number]", d = "[object Object]", h = "[object RegExp]", g = "[object Set]", m = "[object String]", A = "[object WeakMap]", f = "[object ArrayBuffer]", w = "[object DataView]", v = "[object Float32Array]", C = "[object Float64Array]", D = "[object Int8Array]", N = "[object Int16Array]", z = "[object Int32Array]", T = "[object Uint8Array]", S = "[object Uint8ClampedArray]", L = "[object Uint16Array]", _ = "[object Uint32Array]", j = {};
+  j[v] = j[C] = j[D] = j[N] = j[z] = j[T] = j[S] = j[L] = j[_] = !0, j[n] = j[i] = j[f] = j[r] = j[w] = j[s] = j[a] = j[l] = j[p] = j[u] = j[d] = j[h] = j[g] = j[m] = j[A] = !1;
   function O(R) {
     return t(R) && e(R.length) && !!j[o(R)];
   }
@@ -5492,16 +5491,16 @@ function AVe() {
       w = h[f];
       var z = r[w], T = s[w];
       if (l)
-        var L = d ? l(T, z, w, s, r, u) : l(z, T, w, r, s, u);
-      if (!(L === void 0 ? z === T || p(z, T, a, l, u) : L)) {
+        var S = d ? l(T, z, w, s, r, u) : l(z, T, w, r, s, u);
+      if (!(S === void 0 ? z === T || p(z, T, a, l, u) : S)) {
         D = !1;
         break;
       }
       N || (N = w == "constructor");
     }
     if (D && !N) {
-      var S = r.constructor, _ = s.constructor;
-      S != _ && "constructor" in r && "constructor" in s && !(typeof S == "function" && S instanceof S && typeof _ == "function" && _ instanceof _) && (D = !1);
+      var L = r.constructor, _ = s.constructor;
+      L != _ && "constructor" in r && "constructor" in s && !(typeof L == "function" && L instanceof L && typeof _ == "function" && _ instanceof _) && (D = !1);
     }
     return u.delete(r), u.delete(s), D;
   }
@@ -5564,18 +5563,18 @@ function vVe() {
   yP = 1;
   var o = HBe(), e = I7e(), t = ZBe(), n = AVe(), i = wVe(), r = RL(), s = T7e(), a = S7e(), l = 1, p = "[object Arguments]", u = "[object Array]", d = "[object Object]", h = Object.prototype, g = h.hasOwnProperty;
   function m(A, f, w, v, C, D) {
-    var N = r(A), z = r(f), T = N ? u : i(A), L = z ? u : i(f);
-    T = T == p ? d : T, L = L == p ? d : L;
-    var S = T == d, _ = L == d, j = T == L;
+    var N = r(A), z = r(f), T = N ? u : i(A), S = z ? u : i(f);
+    T = T == p ? d : T, S = S == p ? d : S;
+    var L = T == d, _ = S == d, j = T == S;
     if (j && s(A)) {
       if (!s(f))
         return !1;
-      N = !0, S = !1;
+      N = !0, L = !1;
     }
-    if (j && !S)
+    if (j && !L)
       return D || (D = new o()), N || a(A) ? e(A, f, w, v, C, D) : t(A, f, T, w, v, C, D);
     if (!(w & l)) {
-      var O = S && g.call(A, "__wrapped__"), R = _ && g.call(f, "__wrapped__");
+      var O = L && g.call(A, "__wrapped__"), R = _ && g.call(f, "__wrapped__");
       if (O || R) {
         var V = O ? A.value() : A, q = R ? f.value() : f;
         return D || (D = new o()), C(V, q, w, v, D);
@@ -11276,7 +11275,7 @@ function MFe() {
         }
       }
     }
-    var N = l, z = p, T = a, L = s, S = e, _ = u, j = n, O = m, R = g, V = t, q = r, se = i, ue = d, me = !1;
+    var N = l, z = p, T = a, S = s, L = e, _ = u, j = n, O = m, R = g, V = t, q = r, se = i, ue = d, me = !1;
     function ce(ie) {
       return me || (me = !0, console.warn("The ReactIs.isAsyncMode() alias has been deprecated, and will be removed in React 17+. Update your code to use ReactIs.isConcurrentMode() instead. It has the exact same API.")), oe(ie) || D(ie) === l;
     }
@@ -11316,7 +11315,7 @@ function MFe() {
     function W(ie) {
       return D(ie) === d;
     }
-    Gn.AsyncMode = N, Gn.ConcurrentMode = z, Gn.ContextConsumer = T, Gn.ContextProvider = L, Gn.Element = S, Gn.ForwardRef = _, Gn.Fragment = j, Gn.Lazy = O, Gn.Memo = R, Gn.Portal = V, Gn.Profiler = q, Gn.StrictMode = se, Gn.Suspense = ue, Gn.isAsyncMode = ce, Gn.isConcurrentMode = oe, Gn.isContextConsumer = pe, Gn.isContextProvider = G, Gn.isElement = F, Gn.isForwardRef = be, Gn.isFragment = Se, Gn.isLazy = Re, Gn.isMemo = H, Gn.isPortal = x, Gn.isProfiler = k, Gn.isStrictMode = Y, Gn.isSuspense = W, Gn.isValidElementType = C, Gn.typeOf = D;
+    Gn.AsyncMode = N, Gn.ConcurrentMode = z, Gn.ContextConsumer = T, Gn.ContextProvider = S, Gn.Element = L, Gn.ForwardRef = _, Gn.Fragment = j, Gn.Lazy = O, Gn.Memo = R, Gn.Portal = V, Gn.Profiler = q, Gn.StrictMode = se, Gn.Suspense = ue, Gn.isAsyncMode = ce, Gn.isConcurrentMode = oe, Gn.isContextConsumer = pe, Gn.isContextProvider = G, Gn.isElement = F, Gn.isForwardRef = be, Gn.isFragment = Se, Gn.isLazy = Re, Gn.isMemo = H, Gn.isPortal = x, Gn.isProfiler = k, Gn.isStrictMode = Y, Gn.isSuspense = W, Gn.isValidElementType = C, Gn.typeOf = D;
   }()), Gn;
 }
 var uH;
@@ -11473,9 +11472,9 @@ function DFe() {
       elementType: N(),
       instanceOf: z,
       node: _(),
-      objectOf: L,
+      objectOf: S,
       oneOf: T,
-      oneOfType: S,
+      oneOfType: L,
       shape: O,
       exact: R
     };
@@ -11593,7 +11592,7 @@ function DFe() {
       }
       return f(pe);
     }
-    function L(oe) {
+    function S(oe) {
       function pe(G, F, be, Se, Re) {
         if (typeof oe != "function")
           return new A("Property `" + Re + "` of component `" + be + "` has invalid PropType notation inside objectOf.");
@@ -11610,7 +11609,7 @@ function DFe() {
       }
       return f(pe);
     }
-    function S(oe) {
+    function L(oe) {
       if (!Array.isArray(oe))
         return process.env.NODE_ENV !== "production" && r("Invalid argument supplied to oneOfType, expected an instance of array."), s;
       for (var pe = 0; pe < oe.length; pe++) {
@@ -38536,8 +38535,8 @@ var Kt;
   o.concat = A;
   function f(D, N, z) {
     let T = z;
-    for (const L of D)
-      T = N(T, L);
+    for (const S of D)
+      T = N(T, S);
     return T;
   }
   o.reduce = f;
@@ -38551,11 +38550,11 @@ var Kt;
     if (N === 0)
       return [z, D];
     const T = D[Symbol.iterator]();
-    for (let L = 0; L < N; L++) {
-      const S = T.next();
-      if (S.done)
+    for (let S = 0; S < N; S++) {
+      const L = T.next();
+      if (L.done)
         return [z, o.empty()];
-      z.push(S.value);
+      z.push(L.value);
     }
     return [z, { [Symbol.iterator]() {
       return T;
@@ -39403,7 +39402,7 @@ class V0 extends Ab {
     const g = e.minimap.maxColumn, m = e.minimap.size, A = e.minimap.side, f = e.verticalScrollbarWidth, w = e.viewLineCount, v = e.remainingWidth, C = e.isViewportWrapping, D = d ? 2 : 3;
     let N = Math.floor(r * i);
     const z = N / r;
-    let T = !1, L = !1, S = D * h, _ = h / r, j = 1;
+    let T = !1, S = !1, L = D * h, _ = h / r, j = 1;
     if (m === "fill" || m === "fit") {
       const { typicalViewportLineCount: me, extraLinesBeforeFirstLine: ce, extraLinesBeyondLastLine: oe, desiredRatio: pe, minimapLineCount: G } = V0.computeContainedMinimapLineCount({
         viewLineCount: w,
@@ -39415,17 +39414,17 @@ class V0 extends Ab {
         pixelRatio: r
       });
       if (w / G > 1)
-        T = !0, L = !0, h = 1, S = 1, _ = h / r;
+        T = !0, S = !0, h = 1, L = 1, _ = h / r;
       else {
         let be = !1, Se = h + 1;
         if (m === "fit") {
-          const Re = Math.ceil((ce + w + oe) * S);
+          const Re = Math.ceil((ce + w + oe) * L);
           C && a && v <= t.stableFitRemainingWidth ? (be = !0, Se = t.stableFitMaxMinimapScale) : be = Re > N;
         }
         if (m === "fill" || be) {
           T = !0;
           const Re = h;
-          S = Math.min(l * r, Math.max(1, Math.floor(1 / pe))), C && a && v <= t.stableFitRemainingWidth && (Se = t.stableFitMaxMinimapScale), h = Math.min(Se, Math.max(1, Math.floor(S / D))), h > Re && (j = Math.min(2, h / Re)), _ = h / r / j, N = Math.ceil(Math.max(me, ce + w + oe) * S), C ? (t.stableMinimapLayoutInput = e, t.stableFitRemainingWidth = v, t.stableFitMaxMinimapScale = h) : (t.stableMinimapLayoutInput = null, t.stableFitRemainingWidth = 0);
+          L = Math.min(l * r, Math.max(1, Math.floor(1 / pe))), C && a && v <= t.stableFitRemainingWidth && (Se = t.stableFitMaxMinimapScale), h = Math.min(Se, Math.max(1, Math.floor(L / D))), h > Re && (j = Math.min(2, h / Re)), _ = h / r / j, N = Math.ceil(Math.max(me, ce + w + oe) * L), C ? (t.stableMinimapLayoutInput = e, t.stableFitRemainingWidth = v, t.stableFitMaxMinimapScale = h) : (t.stableMinimapLayoutInput = null, t.stableFitRemainingWidth = 0);
         }
       }
     }
@@ -39439,9 +39438,9 @@ class V0 extends Ab {
       minimapLeft: ue,
       minimapWidth: R,
       minimapHeightIsEditorHeight: T,
-      minimapIsSampling: L,
+      minimapIsSampling: S,
       minimapScale: h,
-      minimapLineHeight: S,
+      minimapLineHeight: L,
       minimapCanvasInnerWidth: V,
       minimapCanvasInnerHeight: N,
       minimapCanvasOuterWidth: q,
@@ -39482,7 +39481,7 @@ class V0 extends Ab {
     ), z = e.get(
       104
       /* EditorOption.scrollbar */
-    ), T = z.verticalScrollbarSize, L = z.verticalHasArrows, S = z.arrowSize, _ = z.horizontalScrollbarSize, j = e.get(
+    ), T = z.verticalScrollbarSize, S = z.verticalHasArrows, L = z.arrowSize, _ = z.horizontalScrollbarSize, j = e.get(
       43
       /* EditorOption.folding */
     ), O = e.get(
@@ -39521,7 +39520,7 @@ class V0 extends Ab {
       isViewportWrapping: G
     }, t.memory || new eEe());
     be.renderMinimap !== 0 && be.minimapLeft === 0 && (se += be.minimapWidth, ue += be.minimapWidth, me += be.minimapWidth, ce += be.minimapWidth);
-    const Se = oe - be.minimapWidth, Re = Math.max(1, Math.floor((Se - T - 2) / a)), H = L ? S : 0;
+    const Se = oe - be.minimapWidth, Re = Math.max(1, Math.floor((Se - T - 2) / a)), H = S ? L : 0;
     return G && (F = Math.max(1, Re), g === "bounded" && (F = Math.min(F, m))), {
       width: n,
       height: i,
@@ -41851,11 +41850,11 @@ var we;
     return O((V) => R.fire(V));
   }
   o.forward = T;
-  function L(O, R, V) {
+  function S(O, R, V) {
     return R(V), O((q) => R(q));
   }
-  o.runAndSubscribe = L;
-  class S {
+  o.runAndSubscribe = S;
+  class L {
     constructor(R, V) {
       this._observable = R, this._counter = 0, this._hasChanged = !1;
       const q = {
@@ -41881,7 +41880,7 @@ var we;
     }
   }
   function _(O, R) {
-    return new S(O, R).emitter.event;
+    return new L(O, R).emitter.event;
   }
   o.fromObservable = _;
   function j(O) {
@@ -46445,9 +46444,9 @@ function kEe() {
     implementation: N,
     createNodeIterator: z,
     createDocumentFragment: T,
-    getElementsByTagName: L
+    getElementsByTagName: S
   } = i, {
-    importNode: S
+    importNode: L
   } = t;
   let _ = {};
   e.isSupported = typeof SEe == "function" && typeof v == "function" && N && N.createHTMLDocument !== void 0;
@@ -46594,7 +46593,7 @@ function kEe() {
       }
     }
     const un = Me.body || Me.documentElement;
-    return ee && Be && un.insertBefore(i.createTextNode(Be), un.childNodes[0] || null), at === ut ? L.call(Me, W ? "html" : "body")[0] : W ? Me.documentElement : un;
+    return ee && Be && un.insertBefore(i.createTextNode(Be), un.childNodes[0] || null), at === ut ? S.call(Me, W ? "html" : "body")[0] : W ? Me.documentElement : un;
   }, Qg = function(ee) {
     return z.call(
       ee.ownerDocument || ee,
@@ -46758,7 +46757,7 @@ function kEe() {
           un.appendChild(Me.firstChild);
       else
         un = Me;
-      return (pe.shadowroot || pe.shadowrootmode) && (un = S.call(t, un, !0)), un;
+      return (pe.shadowroot || pe.shadowrootmode) && (un = L.call(t, un, !0)), un;
     }
     let Wn = W ? Me.outerHTML : Me.innerHTML;
     return W && ce["!doctype"] && Me.ownerDocument && Me.ownerDocument.doctype && Me.ownerDocument.doctype.name && zs(xEe, Me.ownerDocument.doctype.name) && (Wn = "<!DOCTYPE " + Me.ownerDocument.doctype.name + `>
@@ -48137,17 +48136,17 @@ class M2t extends he {
       this._createRequest(z.charAt(j), 0, n, i), this._createRequest(z.charAt(j), 1, n, i), this._createRequest(z.charAt(j), 2, n, i);
     f2t(e, t, n);
     const T = Math.max(l.width, p.width, u.width, d.width, h.width, g.width, m.width, A.width, f.width, w.width);
-    let L = t.fontFeatureSettings === fl.OFF;
-    const S = i[0].width;
-    for (let j = 1, O = i.length; L && j < O; j++) {
-      const R = S - i[j].width;
+    let S = t.fontFeatureSettings === fl.OFF;
+    const L = i[0].width;
+    for (let j = 1, O = i.length; S && j < O; j++) {
+      const R = L - i[j].width;
       if (R < -1e-3 || R > 1e-3) {
-        L = !1;
+        S = !1;
         break;
       }
     }
     let _ = !0;
-    return L && C.width !== S && (_ = !1), C.width > v.width && (_ = !1), new yI({
+    return S && C.width !== L && (_ = !1), C.width > v.width && (_ = !1), new yI({
       pixelRatio: _5.getInstance(e).value,
       fontFamily: t.fontFamily,
       fontWeight: t.fontWeight,
@@ -48156,7 +48155,7 @@ class M2t extends he {
       fontVariationSettings: t.fontVariationSettings,
       lineHeight: t.lineHeight,
       letterSpacing: t.letterSpacing,
-      isMonospace: L,
+      isMonospace: S,
       typicalHalfwidthCharacterWidth: r.width,
       typicalFullwidthCharacterWidth: s.width,
       canUseHalfwidthRightwardsArrow: _,
@@ -52692,10 +52691,10 @@ class Hp {
     ];
   }
   WALKTRACE(e, t, n, i, r, s, a, l, p, u, d, h, g, m, A, f, w, v) {
-    let C = null, D = null, N = new fMe(), z = t, T = n, L = g[0] - f[0] - i, S = -1073741824, _ = this.m_forwardHistory.length - 1;
+    let C = null, D = null, N = new fMe(), z = t, T = n, S = g[0] - f[0] - i, L = -1073741824, _ = this.m_forwardHistory.length - 1;
     do {
-      const j = L + e;
-      j === z || j < T && p[j - 1] < p[j + 1] ? (d = p[j + 1], m = d - L - i, d < S && N.MarkNextChange(), S = d, N.AddModifiedElement(d + 1, m), L = j + 1 - e) : (d = p[j - 1] + 1, m = d - L - i, d < S && N.MarkNextChange(), S = d - 1, N.AddOriginalElement(d, m + 1), L = j - 1 - e), _ >= 0 && (p = this.m_forwardHistory[_], e = p[0], z = 1, T = p.length - 1);
+      const j = S + e;
+      j === z || j < T && p[j - 1] < p[j + 1] ? (d = p[j + 1], m = d - S - i, d < L && N.MarkNextChange(), L = d, N.AddModifiedElement(d + 1, m), S = j + 1 - e) : (d = p[j - 1] + 1, m = d - S - i, d < L && N.MarkNextChange(), L = d - 1, N.AddOriginalElement(d, m + 1), S = j - 1 - e), _ >= 0 && (p = this.m_forwardHistory[_], e = p[0], z = 1, T = p.length - 1);
     } while (--_ >= -1);
     if (C = N.getReverseChanges(), v[0]) {
       let j = g[0] + 1, O = f[0] + 1;
@@ -52707,10 +52706,10 @@ class Hp {
         new Pu(j, h - j + 1, O, A - O + 1)
       ];
     } else {
-      N = new fMe(), z = s, T = a, L = g[0] - f[0] - l, S = 1073741824, _ = w ? this.m_reverseHistory.length - 1 : this.m_reverseHistory.length - 2;
+      N = new fMe(), z = s, T = a, S = g[0] - f[0] - l, L = 1073741824, _ = w ? this.m_reverseHistory.length - 1 : this.m_reverseHistory.length - 2;
       do {
-        const j = L + r;
-        j === z || j < T && u[j - 1] >= u[j + 1] ? (d = u[j + 1] - 1, m = d - L - l, d > S && N.MarkNextChange(), S = d + 1, N.AddOriginalElement(d + 1, m + 1), L = j + 1 - r) : (d = u[j - 1], m = d - L - l, d > S && N.MarkNextChange(), S = d, N.AddModifiedElement(d + 1, m + 1), L = j - 1 - r), _ >= 0 && (u = this.m_reverseHistory[_], r = u[0], z = 1, T = u.length - 1);
+        const j = S + r;
+        j === z || j < T && u[j - 1] >= u[j + 1] ? (d = u[j + 1] - 1, m = d - S - l, d > L && N.MarkNextChange(), L = d + 1, N.AddOriginalElement(d + 1, m + 1), S = j + 1 - r) : (d = u[j - 1], m = d - S - l, d > L && N.MarkNextChange(), L = d, N.AddModifiedElement(d + 1, m + 1), S = j - 1 - r), _ >= 0 && (u = this.m_reverseHistory[_], r = u[0], z = 1, T = u.length - 1);
       } while (--_ >= -1);
       D = N.getChanges();
     }
@@ -52737,32 +52736,32 @@ class Hp {
     e--, n--, r[0] = 0, s[0] = 0, this.m_forwardHistory = [], this.m_reverseHistory = [];
     const m = t - e + (i - n), A = m + 1, f = new Int32Array(A), w = new Int32Array(A), v = i - n, C = t - e, D = e - n, N = t - i, T = (C - v) % 2 === 0;
     f[v] = e, w[C] = t, a[0] = !1;
-    for (let L = 1; L <= m / 2 + 1; L++) {
-      let S = 0, _ = 0;
-      u = this.ClipDiagonalBound(v - L, L, v, A), d = this.ClipDiagonalBound(v + L, L, v, A);
+    for (let S = 1; S <= m / 2 + 1; S++) {
+      let L = 0, _ = 0;
+      u = this.ClipDiagonalBound(v - S, S, v, A), d = this.ClipDiagonalBound(v + S, S, v, A);
       for (let O = u; O <= d; O += 2) {
         O === u || O < d && f[O - 1] < f[O + 1] ? l = f[O + 1] : l = f[O - 1] + 1, p = l - (O - v) - D;
         const R = l;
         for (; l < t && p < i && this.ElementsAreEqual(l + 1, p + 1); )
           l++, p++;
-        if (f[O] = l, l + p > S + _ && (S = l, _ = p), !T && Math.abs(O - C) <= L - 1 && l >= w[O])
-          return r[0] = l, s[0] = p, R <= w[O] && L <= 1448 ? this.WALKTRACE(v, u, d, D, C, h, g, N, f, w, l, t, r, p, i, s, T, a) : null;
+        if (f[O] = l, l + p > L + _ && (L = l, _ = p), !T && Math.abs(O - C) <= S - 1 && l >= w[O])
+          return r[0] = l, s[0] = p, R <= w[O] && S <= 1448 ? this.WALKTRACE(v, u, d, D, C, h, g, N, f, w, l, t, r, p, i, s, T, a) : null;
       }
-      const j = (S - e + (_ - n) - L) / 2;
-      if (this.ContinueProcessingPredicate !== null && !this.ContinueProcessingPredicate(S, j))
-        return a[0] = !0, r[0] = S, s[0] = _, j > 0 && L <= 1448 ? this.WALKTRACE(v, u, d, D, C, h, g, N, f, w, l, t, r, p, i, s, T, a) : (e++, n++, [
+      const j = (L - e + (_ - n) - S) / 2;
+      if (this.ContinueProcessingPredicate !== null && !this.ContinueProcessingPredicate(L, j))
+        return a[0] = !0, r[0] = L, s[0] = _, j > 0 && S <= 1448 ? this.WALKTRACE(v, u, d, D, C, h, g, N, f, w, l, t, r, p, i, s, T, a) : (e++, n++, [
           new Pu(e, t - e + 1, n, i - n + 1)
         ]);
-      h = this.ClipDiagonalBound(C - L, L, C, A), g = this.ClipDiagonalBound(C + L, L, C, A);
+      h = this.ClipDiagonalBound(C - S, S, C, A), g = this.ClipDiagonalBound(C + S, S, C, A);
       for (let O = h; O <= g; O += 2) {
         O === h || O < g && w[O - 1] >= w[O + 1] ? l = w[O + 1] - 1 : l = w[O - 1], p = l - (O - C) - N;
         const R = l;
         for (; l > e && p > n && this.ElementsAreEqual(l, p); )
           l--, p--;
-        if (w[O] = l, T && Math.abs(O - v) <= L && l <= f[O])
-          return r[0] = l, s[0] = p, R >= f[O] && L <= 1448 ? this.WALKTRACE(v, u, d, D, C, h, g, N, f, w, l, t, r, p, i, s, T, a) : null;
+        if (w[O] = l, T && Math.abs(O - v) <= S && l <= f[O])
+          return r[0] = l, s[0] = p, R >= f[O] && S <= 1448 ? this.WALKTRACE(v, u, d, D, C, h, g, N, f, w, l, t, r, p, i, s, T, a) : null;
       }
-      if (L <= 1447) {
+      if (S <= 1447) {
         let O = new Int32Array(d - u + 2);
         O[0] = v - u + 1, Kg.Copy2(f, u, O, 1, d - u + 1), this.m_forwardHistory.push(O), O = new Int32Array(g - h + 2), O[0] = C - h + 1, Kg.Copy2(w, h, O, 1, g - h + 1), this.m_reverseHistory.push(O);
       }
@@ -54258,19 +54257,19 @@ class lAt {
         if (h = p.next(v), h) {
           let D = h.index, N = h.index + h[0].length;
           if (D > 0) {
-            const S = v.charCodeAt(D - 1);
-            Pi(S) && D--;
+            const L = v.charCodeAt(D - 1);
+            Pi(L) && D--;
           }
           if (N + 1 < C) {
-            const S = v.charCodeAt(N - 1);
-            Pi(S) && N++;
+            const L = v.charCodeAt(N - 1);
+            Pi(L) && N++;
           }
           const z = v.substring(D, N);
           let T = Xf(D + 1, ox, v, 0);
           T && T.endColumn <= D + 1 && (T = null);
-          const L = s.shouldHighlightNonBasicASCII(z, T ? T.word : null);
-          if (L !== 0) {
-            if (L === 3 ? g++ : L === 2 ? m++ : L === 1 ? A++ : Ox(), u.length >= 1e3) {
+          const S = s.shouldHighlightNonBasicASCII(z, T ? T.word : null);
+          if (S !== 0) {
+            if (S === 3 ? g++ : S === 2 ? m++ : S === 1 ? A++ : Ox(), u.length >= 1e3) {
               d = !0;
               break e;
             }
@@ -55927,11 +55926,11 @@ function BAt(o, e, t) {
         const w = o.getText(A).trim();
         if (w.length > 20 || w.split(/\r\n|\r|\n/).length > 1)
           return !1;
-        const v = o.countLinesIn(g.seq1Range), C = g.seq1Range.length, D = e.countLinesIn(g.seq2Range), N = g.seq2Range.length, z = o.countLinesIn(m.seq1Range), T = m.seq1Range.length, L = e.countLinesIn(m.seq2Range), S = m.seq2Range.length, _ = 2 * 40 + 50;
+        const v = o.countLinesIn(g.seq1Range), C = g.seq1Range.length, D = e.countLinesIn(g.seq2Range), N = g.seq2Range.length, z = o.countLinesIn(m.seq1Range), T = m.seq1Range.length, S = e.countLinesIn(m.seq2Range), L = m.seq2Range.length, _ = 2 * 40 + 50;
         function j(O) {
           return Math.min(O, _);
         }
-        return Math.pow(Math.pow(j(v * 40 + C), 1.5) + Math.pow(j(D * 40 + N), 1.5), 1.5) + Math.pow(Math.pow(j(z * 40 + T), 1.5) + Math.pow(j(L * 40 + S), 1.5), 1.5) > (_ ** 1.5) ** 1.5 * 1.3;
+        return Math.pow(Math.pow(j(v * 40 + C), 1.5) + Math.pow(j(D * 40 + N), 1.5), 1.5) + Math.pow(Math.pow(j(z * 40 + T), 1.5) + Math.pow(j(S * 40 + L), 1.5), 1.5) > (_ ** 1.5) ** 1.5 * 1.3;
       };
       const p = n[l], u = a[a.length - 1];
       d(u, p) ? (r = !0, a[a.length - 1] = a[a.length - 1].join(p)) : a.push(p);
@@ -56004,12 +56003,12 @@ class EIe {
     const A = [], f = (N) => {
       if (r)
         for (let z = 0; z < N; z++) {
-          const T = w + z, L = v + z;
-          if (e[T] !== t[L]) {
-            const S = this.refineDiff(e, t, new Ti(new mt(T, T + 1), new mt(L, L + 1)), i, r);
-            for (const _ of S.mappings)
+          const T = w + z, S = v + z;
+          if (e[T] !== t[S]) {
+            const L = this.refineDiff(e, t, new Ti(new mt(T, T + 1), new mt(S, S + 1)), i, r);
+            for (const _ of L.mappings)
               A.push(_);
-            S.hitTimeout && (m = !0);
+            L.hitTimeout && (m = !0);
           }
         }
     };
@@ -56020,27 +56019,27 @@ class EIe {
       f(z), w = N.seq1Range.endExclusive, v = N.seq2Range.endExclusive;
       const T = this.refineDiff(e, t, N, i, r);
       T.hitTimeout && (m = !0);
-      for (const L of T.mappings)
-        A.push(L);
+      for (const S of T.mappings)
+        A.push(S);
     }
     f(e.length - w);
     const C = _Me(A, e, t);
     let D = [];
     return n.computeMoves && (D = this.computeMoves(C, e, t, l, p, i, r)), Y1(() => {
-      function N(T, L) {
-        if (T.lineNumber < 1 || T.lineNumber > L.length)
+      function N(T, S) {
+        if (T.lineNumber < 1 || T.lineNumber > S.length)
           return !1;
-        const S = L[T.lineNumber - 1];
-        return !(T.column < 1 || T.column > S.length + 1);
+        const L = S[T.lineNumber - 1];
+        return !(T.column < 1 || T.column > L.length + 1);
       }
-      function z(T, L) {
-        return !(T.startLineNumber < 1 || T.startLineNumber > L.length + 1 || T.endLineNumberExclusive < 1 || T.endLineNumberExclusive > L.length + 1);
+      function z(T, S) {
+        return !(T.startLineNumber < 1 || T.startLineNumber > S.length + 1 || T.endLineNumberExclusive < 1 || T.endLineNumberExclusive > S.length + 1);
       }
       for (const T of C) {
         if (!T.innerChanges)
           return !1;
-        for (const L of T.innerChanges)
-          if (!(N(L.modifiedRange.getStartPosition(), t) && N(L.modifiedRange.getEndPosition(), t) && N(L.originalRange.getStartPosition(), e) && N(L.originalRange.getEndPosition(), e)))
+        for (const S of T.innerChanges)
+          if (!(N(S.modifiedRange.getStartPosition(), t) && N(S.modifiedRange.getEndPosition(), t) && N(S.originalRange.getStartPosition(), e) && N(S.originalRange.getEndPosition(), e)))
             return !1;
         if (!z(T.modified, t) || !z(T.original, e))
           return !1;
@@ -57772,10 +57771,10 @@ function dft(o, e, t, n) {
   const C = n.length;
   let D = !1, N = qr(e), z;
   N === -1 ? (D = !0, N = t, z = t) : z = yg(e);
-  let T = !1, L = 0, S = p && p[L], _ = a % s;
+  let T = !1, S = 0, L = p && p[S], _ = a % s;
   for (let O = r; O < t; O++) {
     const R = e.charCodeAt(O);
-    S && O >= S.endOffset && (L++, S = p && p[L]);
+    L && O >= L.endOffset && (S++, L = p && p[S]);
     let V;
     if (O < N || O > z)
       V = !0;
@@ -57793,7 +57792,7 @@ function dft(o, e, t, n) {
         V = !0;
     else
       V = !1;
-    if (V && p && (V = !!S && S.startOffset <= O && S.endOffset > O), V && d && (V = D || O > z), V && w && O >= N && O <= z && (V = !1), T) {
+    if (V && p && (V = !!L && L.startOffset <= O && L.endOffset > O), V && d && (V = D || O > z), V && w && O >= N && O <= z && (V = !1), T) {
       if (!V || !l && _ >= s) {
         if (h) {
           const q = m > 0 ? g[m - 1].endIndex : r;
@@ -57855,10 +57854,10 @@ function hft(o, e, t, n) {
 }
 function gft(o, e) {
   const t = o.fontIsMonospace, n = o.canUseHalfwidthRightwardsArrow, i = o.containsForeignElements, r = o.lineContent, s = o.len, a = o.isOverflowing, l = o.overflowingCharCount, p = o.parts, u = o.fauxIndentLength, d = o.tabSize, h = o.startVisibleColumn, g = o.containsRTL, m = o.spaceWidth, A = o.renderSpaceCharCode, f = o.renderWhitespace, w = o.renderControlCharacters, v = new Nc(s + 1, p.length);
-  let C = !1, D = 0, N = h, z = 0, T = 0, L = 0;
+  let C = !1, D = 0, N = h, z = 0, T = 0, S = 0;
   g ? e.appendString('<span dir="ltr">') : e.appendString("<span>");
-  for (let S = 0, _ = p.length; S < _; S++) {
-    const j = p[S], O = j.endIndex, R = j.type, V = j.containsRTL, q = f !== 0 && j.isWhitespace(), se = q && !t && (R === "mtkw" || !i), ue = D === O && j.isPseudoAfter();
+  for (let L = 0, _ = p.length; L < _; L++) {
+    const j = p[L], O = j.endIndex, R = j.type, V = j.containsRTL, q = f !== 0 && j.isWhitespace(), se = q && !t && (R === "mtkw" || !i), ue = D === O && j.isPseudoAfter();
     if (z = 0, e.appendString("<span "), V && e.appendString('style="unicode-bidi:isolate" '), e.appendString('class="'), e.appendString(se ? "mtkz" : R), e.appendASCIICharCode(
       34
       /* CharCode.DoubleQuote */
@@ -57875,7 +57874,7 @@ function gft(o, e) {
         62
         /* CharCode.GreaterThan */
       ); D < O; D++) {
-        v.setColumnInfo(D + 1, S - L, z, T), L = 0;
+        v.setColumnInfo(D + 1, L - S, z, T), S = 0;
         const ce = r.charCodeAt(D);
         let oe, pe;
         if (ce === 9) {
@@ -57891,7 +57890,7 @@ function gft(o, e) {
         62
         /* CharCode.GreaterThan */
       ); D < O; D++) {
-        v.setColumnInfo(D + 1, S - L, z, T), L = 0;
+        v.setColumnInfo(D + 1, L - S, z, T), S = 0;
         const me = r.charCodeAt(D);
         let ce = 1, oe = 1;
         switch (me) {
@@ -57926,7 +57925,7 @@ function gft(o, e) {
         }
         z += ce, T += oe, D >= u && (N += oe);
       }
-    ue ? L++ : L = 0, D >= s && !C && j.isPseudoAfter() && (C = !0, v.setColumnInfo(D + 1, S, z, T)), e.appendString("</span>");
+    ue ? S++ : S = 0, D >= s && !C && j.isPseudoAfter() && (C = !0, v.setColumnInfo(D + 1, L, z, T)), e.appendString("</span>");
   }
   return C || v.setColumnInfo(s + 1, p.length - 1, z, T), a && (e.appendString('<span class="mtkoverflow">'), e.appendString(b("showMore", "Show more ({0})", Aft(l))), e.appendString("</span>")), e.appendString("</span>"), new xI(v, g, i);
 }
@@ -58347,17 +58346,17 @@ let uy = kI = class extends he {
       let v = null, C = null, D = null, N = null, z = null;
       if (h) {
         v = h.matches;
-        const S = h.groups.shift();
-        C = S.matched, D = S.action, N = h.rule, h.groups.length === 0 && (h = null);
+        const L = h.groups.shift();
+        C = L.matched, D = L.action, N = h.rule, h.groups.length === 0 && (h = null);
       } else {
         if (!g && d >= l)
           break;
         g = !1;
-        let S = this._lexer.tokenizer[w];
-        if (!S && (S = x3(this._lexer, w), !S))
+        let L = this._lexer.tokenizer[w];
+        if (!L && (L = x3(this._lexer, w), !L))
           throw Sn(this._lexer, "tokenizer state is not defined: " + w);
         const _ = a.substr(d);
-        for (const j of S)
+        for (const j of L)
           if ((d === 0 || !j.matchOnlyAtLineStart) && (v = _.match(j.resolveRegex(w)), v)) {
             C = v[0], D = j.action;
             break;
@@ -58384,11 +58383,11 @@ let uy = kI = class extends he {
             z = Ju(this._lexer, D.nextEmbedded, C, v, w);
           }
         if (D.goBack && (d = Math.max(0, d - D.goBack)), D.switchTo && typeof D.switchTo == "string") {
-          let S = Ju(this._lexer, D.switchTo, C, v, w);
-          if (S[0] === "@" && (S = S.substr(1)), x3(this._lexer, S))
-            u = u.switchTo(S);
+          let L = Ju(this._lexer, D.switchTo, C, v, w);
+          if (L[0] === "@" && (L = L.substr(1)), x3(this._lexer, L))
+            u = u.switchTo(L);
           else
-            throw Sn(this._lexer, "trying to switch to a state '" + S + "' that is undefined in rule: " + this._safeRuleName(N));
+            throw Sn(this._lexer, "trying to switch to a state '" + L + "' that is undefined in rule: " + this._safeRuleName(N));
         } else {
           if (D.transform && typeof D.transform == "function")
             throw Sn(this._lexer, "action.transform not supported");
@@ -58404,19 +58403,19 @@ let uy = kI = class extends he {
             } else if (D.next === "@popall")
               u = u.popall();
             else {
-              let S = Ju(this._lexer, D.next, C, v, w);
-              if (S[0] === "@" && (S = S.substr(1)), x3(this._lexer, S))
-                u = u.push(S);
+              let L = Ju(this._lexer, D.next, C, v, w);
+              if (L[0] === "@" && (L = L.substr(1)), x3(this._lexer, L))
+                u = u.push(L);
               else
-                throw Sn(this._lexer, "trying to set a next state '" + S + "' that is undefined in rule: " + this._safeRuleName(N));
+                throw Sn(this._lexer, "trying to set a next state '" + L + "' that is undefined in rule: " + this._safeRuleName(N));
             }
         }
         D.log && typeof D.log == "string" && wft(this._lexer, this._lexer.languageId + ": " + Ju(this._lexer, D.log, C, v, w));
       }
       if (T === null)
         throw Sn(this._lexer, "lexer rule has no well-defined action in rule: " + this._safeRuleName(N));
-      const L = (S) => {
-        const _ = this._languageService.getLanguageIdByLanguageName(S) || this._languageService.getLanguageIdByMimeType(S) || S, j = this._getNestedEmbeddedLanguageData(_);
+      const S = (L) => {
+        const _ = this._languageService.getLanguageIdByLanguageName(L) || this._languageService.getLanguageIdByMimeType(L) || L, j = this._getNestedEmbeddedLanguageData(_);
         if (d < l) {
           const O = e.substr(d);
           return this._nestedTokenize(O, t, Xu.create(u, j), i + d, r);
@@ -58428,10 +58427,10 @@ let uy = kI = class extends he {
           throw Sn(this._lexer, "groups cannot be nested: " + this._safeRuleName(N));
         if (v.length !== T.length + 1)
           throw Sn(this._lexer, "matched number of groups does not match the number of actions in rule: " + this._safeRuleName(N));
-        let S = 0;
+        let L = 0;
         for (let _ = 1; _ < v.length; _++)
-          S += v[_].length;
-        if (S !== C.length)
+          L += v[_].length;
+        if (L !== C.length)
           throw Sn(this._lexer, "with groups, all characters should be matched in consecutive groups in rule: " + this._safeRuleName(N));
         h = {
           rule: N,
@@ -58447,26 +58446,26 @@ let uy = kI = class extends he {
         continue;
       } else {
         if (T === "@rematch" && (d -= C.length, C = "", v = null, T = "", z !== null))
-          return L(z);
+          return S(z);
         if (C.length === 0) {
           if (l === 0 || A !== u.depth || w !== u.state || (h ? h.groups.length : 0) !== f)
             continue;
           throw Sn(this._lexer, "no progress in tokenizer in rule: " + this._safeRuleName(N));
         }
-        let S = null;
+        let L = null;
         if (RIe(T) && T.indexOf("@brackets") === 0) {
           const _ = T.substr(9), j = Ift(this._lexer, C);
           if (!j)
             throw Sn(this._lexer, "@brackets token returned but no bracket defined as: " + C);
-          S = WMe(j.token + _);
+          L = WMe(j.token + _);
         } else {
           const _ = T === "" ? "" : T + this._lexer.tokenPostfix;
-          S = WMe(_);
+          L = WMe(_);
         }
-        m < s && r.emit(m + i, S);
+        m < s && r.emit(m + i, L);
       }
       if (z !== null)
-        return L(z);
+        return S(z);
     }
     return Xu.create(u, p);
   }
@@ -59065,9 +59064,9 @@ var pd;
   function w() {
     s.keydown === 2 && s.input === 2 && s.render === 2 && (performance.mark("inputlatency/end"), performance.measure("keydown", "keydown/start", "keydown/end"), performance.measure("input", "input/start", "input/end"), performance.measure("render", "render/start", "render/end"), performance.measure("inputlatency", "inputlatency/start", "inputlatency/end"), v("keydown", e), v("input", t), v("render", n), v("inputlatency", i), r++, C());
   }
-  function v(T, L) {
-    const S = performance.getEntriesByName(T)[0].duration;
-    L.total += S, L.min = Math.min(L.min, S), L.max = Math.max(L.max, S);
+  function v(T, S) {
+    const L = performance.getEntriesByName(T)[0].duration;
+    S.total += L, S.min = Math.min(S.min, L), S.max = Math.max(S.max, L);
   }
   function C() {
     performance.clearMarks("keydown/start"), performance.clearMarks("keydown/end"), performance.clearMarks("input/start"), performance.clearMarks("input/end"), performance.clearMarks("render/start"), performance.clearMarks("render/end"), performance.clearMarks("inputlatency/start"), performance.clearMarks("inputlatency/end"), performance.clearMeasures("keydown"), performance.clearMeasures("input"), performance.clearMeasures("render"), performance.clearMeasures("inputlatency"), s.keydown = 0, s.input = 0, s.render = 0;
@@ -63256,12 +63255,12 @@ let GI = class extends Gr {
     })), this._register(this._textAreaInput.onCompositionStart((h) => {
       const g = this.textArea.domNode, m = this._modelSelections[0], { distanceToModelLineStart: A, widthOfHiddenTextBefore: f } = (() => {
         const v = g.value.substring(0, Math.min(g.selectionStart, g.selectionEnd)), C = v.lastIndexOf(`
-`), D = v.substring(C + 1), N = D.lastIndexOf("	"), z = D.length - N - 1, T = m.getStartPosition(), L = Math.min(T.column - 1, z), S = T.column - 1 - L, _ = D.substring(0, D.length - L), { tabSize: j } = this._context.viewModel.model.getOptions(), O = i4t(this.textArea.domNode.ownerDocument, _, this._fontInfo, j);
-        return { distanceToModelLineStart: S, widthOfHiddenTextBefore: O };
+`), D = v.substring(C + 1), N = D.lastIndexOf("	"), z = D.length - N - 1, T = m.getStartPosition(), S = Math.min(T.column - 1, z), L = T.column - 1 - S, _ = D.substring(0, D.length - S), { tabSize: j } = this._context.viewModel.model.getOptions(), O = i4t(this.textArea.domNode.ownerDocument, _, this._fontInfo, j);
+        return { distanceToModelLineStart: L, widthOfHiddenTextBefore: O };
       })(), { distanceToModelLineEnd: w } = (() => {
         const v = g.value.substring(Math.max(g.selectionStart, g.selectionEnd)), C = v.indexOf(`
-`), D = C === -1 ? v : v.substring(0, C), N = D.indexOf("	"), z = N === -1 ? D.length : D.length - N - 1, T = m.getEndPosition(), L = Math.min(this._context.viewModel.model.getLineMaxColumn(T.lineNumber) - T.column, z);
-        return { distanceToModelLineEnd: this._context.viewModel.model.getLineMaxColumn(T.lineNumber) - T.column - L };
+`), D = C === -1 ? v : v.substring(0, C), N = D.indexOf("	"), z = N === -1 ? D.length : D.length - N - 1, T = m.getEndPosition(), S = Math.min(this._context.viewModel.model.getLineMaxColumn(T.lineNumber) - T.column, z);
+        return { distanceToModelLineEnd: this._context.viewModel.model.getLineMaxColumn(T.lineNumber) - T.column - S };
       })();
       this._context.viewModel.revealRange(
         "keyboard",
@@ -65426,7 +65425,7 @@ function f4t(o, e, t, n, i, r) {
     if (p.shouldIndentNextLine(w) && p.shouldIncrease(A)) {
       const C = s6(s, e, t.startLineNumber, !1, r)?.indentation;
       if (C !== void 0) {
-        const D = e.getLineContent(t.startLineNumber), N = Jo(D), T = i.shiftIndent(C) === N, L = /^\s*$/.test(m), S = o.autoClosingPairs.autoClosingPairsOpenByEnd.get(n), j = S && S.length > 0 && L;
+        const D = e.getLineContent(t.startLineNumber), N = Jo(D), T = i.shiftIndent(C) === N, S = /^\s*$/.test(m), L = o.autoClosingPairs.autoClosingPairsOpenByEnd.get(n), j = L && L.length > 0 && S;
         if (T && j)
           return C;
       }
@@ -65567,15 +65566,15 @@ class KI {
     for (const m of s) {
       const { lineNumber: A, beforeColumn: f, afterColumn: w } = m, v = t.getLineContent(A), C = v.substring(0, f - 1), D = v.substring(w - 1);
       if (D.startsWith(h) || (g = !1), D.length > 0) {
-        const L = D.charAt(0);
-        if (!this._isBeforeClosingBrace(e, D) && !p(L))
+        const S = D.charAt(0);
+        if (!this._isBeforeClosingBrace(e, D) && !p(S))
           return null;
       }
       if (a.open.length === 1 && (i === "'" || i === '"') && l !== "always") {
-        const L = x2(e.wordSeparators, []);
+        const S = x2(e.wordSeparators, []);
         if (C.length > 0) {
-          const S = C.charCodeAt(C.length - 1);
-          if (L.get(S) === 0)
+          const L = C.charCodeAt(C.length - 1);
+          if (S.get(L) === 0)
             return null;
         }
       }
@@ -65587,8 +65586,8 @@ class KI {
         return null;
       const T = a.findNeutralCharacter();
       if (T) {
-        const L = t.tokenization.getTokenTypeIfInsertingCharacter(A, f, T);
-        if (!a.isOK(L))
+        const S = t.tokenization.getTokenTypeIfInsertingCharacter(A, f, T);
+        if (!a.isOK(S))
           return null;
       }
     }
@@ -66398,8 +66397,8 @@ var Oi;
     _getColumnSelectResult(w, v, C, D) {
       if (typeof D.position > "u" || typeof D.viewPosition > "u" || typeof D.mouseColumn > "u")
         return null;
-      const N = w.model.validatePosition(D.position), z = w.coordinatesConverter.validateViewPosition(new ne(D.viewPosition.lineNumber, D.viewPosition.column), N), T = D.doColumnSelect ? C.fromViewLineNumber : z.lineNumber, L = D.doColumnSelect ? C.fromViewVisualColumn : D.mouseColumn - 1;
-      return Wh.columnSelect(w.cursorConfig, w, T, L, z.lineNumber, D.mouseColumn - 1);
+      const N = w.model.validatePosition(D.position), z = w.coordinatesConverter.validateViewPosition(new ne(D.viewPosition.lineNumber, D.viewPosition.column), N), T = D.doColumnSelect ? C.fromViewLineNumber : z.lineNumber, S = D.doColumnSelect ? C.fromViewVisualColumn : D.mouseColumn - 1;
+      return Wh.columnSelect(w.cursorConfig, w, T, S, z.lineNumber, D.mouseColumn - 1);
     }
   }()), o.CursorColumnSelectLeft = Ke(new class extends t {
     constructor() {
@@ -66780,9 +66779,9 @@ var Oi;
       const D = w.getCursorStates();
       if (D.length > 1) {
         const N = C.modelState ? C.modelState.position : null, z = C.viewState ? C.viewState.position : null;
-        for (let T = 0, L = D.length; T < L; T++) {
-          const S = D[T];
-          if (!(N && !S.modelState.selection.containsPosition(N)) && !(z && !S.viewState.selection.containsPosition(z))) {
+        for (let T = 0, S = D.length; T < S; T++) {
+          const L = D[T];
+          if (!(N && !L.modelState.selection.containsPosition(N)) && !(z && !L.viewState.selection.containsPosition(z))) {
             D.splice(T, 1), w.model.pushStackElement(), w.setCursorStates(v.source, 3, D);
             return;
           }
@@ -66961,8 +66960,8 @@ var Oi;
     _exec(v, C) {
       const D = [];
       for (let N = 0, z = C.length; N < z; N++) {
-        const T = C[N], L = T.modelState.position.lineNumber, S = v.model.getLineMaxColumn(L);
-        D[N] = Tt.fromModelState(T.modelState.move(this._inSelectionMode, L, S, 0));
+        const T = C[N], S = T.modelState.position.lineNumber, L = v.model.getLineMaxColumn(S);
+        D[N] = Tt.fromModelState(T.modelState.move(this._inSelectionMode, S, L, 0));
       }
       return D;
     }
@@ -67118,10 +67117,10 @@ var Oi;
     }
     _computeDesiredScrollTop(v, C) {
       if (C.unit === 1) {
-        const z = v.viewLayout.getFutureViewport(), T = v.getCompletelyVisibleViewRangeAtScrollTop(z.top), L = v.coordinatesConverter.convertViewRangeToModelRange(T);
-        let S;
-        C.direction === 1 ? S = Math.max(1, L.startLineNumber - C.value) : S = Math.min(v.model.getLineCount(), L.startLineNumber + C.value);
-        const _ = v.coordinatesConverter.convertModelPositionToViewPosition(new ne(S, 1));
+        const z = v.viewLayout.getFutureViewport(), T = v.getCompletelyVisibleViewRangeAtScrollTop(z.top), S = v.coordinatesConverter.convertViewRangeToModelRange(T);
+        let L;
+        C.direction === 1 ? L = Math.max(1, S.startLineNumber - C.value) : L = Math.min(v.model.getLineCount(), S.startLineNumber + C.value);
+        const _ = v.coordinatesConverter.convertModelPositionToViewPosition(new ne(L, 1));
         return v.viewLayout.getVerticalOffsetForLineNumber(_.lineNumber);
       }
       if (C.unit === 5) {
@@ -67470,25 +67469,25 @@ var Oi;
       const z = w.model.getLineCount();
       N > z && (N = z);
       const T = new Q(N, 1, N, w.model.getLineMaxColumn(N));
-      let L = 0;
+      let S = 0;
       if (C.at)
         switch (C.at) {
           case I0.RawAtArgument.Top:
-            L = 3;
+            S = 3;
             break;
           case I0.RawAtArgument.Center:
-            L = 1;
+            S = 1;
             break;
           case I0.RawAtArgument.Bottom:
-            L = 4;
+            S = 4;
             break;
         }
-      const S = w.coordinatesConverter.convertModelRangeToViewRange(T);
+      const L = w.coordinatesConverter.convertModelRangeToViewRange(T);
       w.revealRange(
         v.source,
         !1,
-        S,
         L,
+        S,
         0
         /* ScrollType.Smooth */
       );
@@ -69480,20 +69479,20 @@ class J4t extends OTe {
     const d = (T) => {
       if (a !== -1 && (a === -2 || a > T - 1)) {
         a = -1, l = -1;
-        for (let L = T - 2; L >= 0; L--) {
-          const S = this._computeIndentLevel(L);
-          if (S >= 0) {
-            a = L, l = S;
+        for (let S = T - 2; S >= 0; S--) {
+          const L = this._computeIndentLevel(S);
+          if (L >= 0) {
+            a = S, l = L;
             break;
           }
         }
       }
       if (p === -2) {
         p = -1, u = -1;
-        for (let L = T; L < i; L++) {
-          const S = this._computeIndentLevel(L);
-          if (S >= 0) {
-            p = L, u = S;
+        for (let S = T; S < i; S++) {
+          const L = this._computeIndentLevel(S);
+          if (L >= 0) {
+            p = S, u = L;
             break;
           }
         }
@@ -69503,20 +69502,20 @@ class J4t extends OTe {
     const f = (T) => {
       if (h === -2) {
         h = -1, g = -1;
-        for (let L = T - 2; L >= 0; L--) {
-          const S = this._computeIndentLevel(L);
-          if (S >= 0) {
-            h = L, g = S;
+        for (let S = T - 2; S >= 0; S--) {
+          const L = this._computeIndentLevel(S);
+          if (L >= 0) {
+            h = S, g = L;
             break;
           }
         }
       }
       if (m !== -1 && (m === -2 || m < T - 1)) {
         m = -1, A = -1;
-        for (let L = T; L < i; L++) {
-          const S = this._computeIndentLevel(L);
-          if (S >= 0) {
-            m = L, A = S;
+        for (let S = T; S < i; S++) {
+          const L = this._computeIndentLevel(S);
+          if (L >= 0) {
+            m = S, A = L;
             break;
           }
         }
@@ -69524,35 +69523,35 @@ class J4t extends OTe {
     };
     let w = 0, v = !0, C = 0, D = !0, N = 0, z = 0;
     for (let T = 0; v || D; T++) {
-      const L = e - T, S = e + T;
-      T > 1 && (L < 1 || L < t) && (v = !1), T > 1 && (S > i || S > n) && (D = !1), T > 5e4 && (v = !1, D = !1);
+      const S = e - T, L = e + T;
+      T > 1 && (S < 1 || S < t) && (v = !1), T > 1 && (L > i || L > n) && (D = !1), T > 5e4 && (v = !1, D = !1);
       let _ = -1;
-      if (v && L >= 1) {
-        const O = this._computeIndentLevel(L - 1);
-        O >= 0 ? (p = L - 1, u = O, _ = Math.ceil(O / this.textModel.getOptions().indentSize)) : (d(L), _ = this._getIndentLevelForWhitespaceLine(s, l, u));
+      if (v && S >= 1) {
+        const O = this._computeIndentLevel(S - 1);
+        O >= 0 ? (p = S - 1, u = O, _ = Math.ceil(O / this.textModel.getOptions().indentSize)) : (d(S), _ = this._getIndentLevelForWhitespaceLine(s, l, u));
       }
       let j = -1;
-      if (D && S <= i) {
-        const O = this._computeIndentLevel(S - 1);
-        O >= 0 ? (h = S - 1, g = O, j = Math.ceil(O / this.textModel.getOptions().indentSize)) : (f(S), j = this._getIndentLevelForWhitespaceLine(s, g, A));
+      if (D && L <= i) {
+        const O = this._computeIndentLevel(L - 1);
+        O >= 0 ? (h = L - 1, g = O, j = Math.ceil(O / this.textModel.getOptions().indentSize)) : (f(L), j = this._getIndentLevelForWhitespaceLine(s, g, A));
       }
       if (T === 0) {
         z = _;
         continue;
       }
       if (T === 1) {
-        if (S <= i && j >= 0 && z + 1 === j) {
-          v = !1, w = S, C = S, N = j;
+        if (L <= i && j >= 0 && z + 1 === j) {
+          v = !1, w = L, C = L, N = j;
           continue;
         }
-        if (L >= 1 && _ >= 0 && _ - 1 === z) {
-          D = !1, w = L, C = L, N = _;
+        if (S >= 1 && _ >= 0 && _ - 1 === z) {
+          D = !1, w = S, C = S, N = _;
           continue;
         }
         if (w = e, C = e, N = z, N === 0)
           return { startLineNumber: w, endLineNumber: C, indent: N };
       }
-      v && (_ >= N ? w = L : v = !1), D && (j >= N ? C = S : D = !1);
+      v && (_ >= N ? w = S : v = !1), D && (j >= N ? C = L : D = !1);
     }
     return { startLineNumber: w, endLineNumber: C, indent: N };
   }
@@ -69581,8 +69580,8 @@ class J4t extends OTe {
       const w = this.getVisibleColumnFromPosition(A), v = this.getVisibleColumnFromPosition(d.openingBracketRange.getStartPosition()), C = Math.min(v, w, d.minVisibleColumnIndentation + 1);
       let D = !1;
       qr(this.textModel.getLineContent(d.closingBracketRange.startLineNumber)) < d.closingBracketRange.startColumn - 1 && (D = !0);
-      const T = Math.max(m.lineNumber, e), L = Math.min(A.lineNumber, t), S = D ? 1 : 0;
-      for (let _ = T; _ < L + S; _++)
+      const T = Math.max(m.lineNumber, e), S = Math.min(A.lineNumber, t), L = D ? 1 : 0;
+      for (let _ = T; _ < S + L; _++)
         r[_ - e].push(new u1(C, -1, g, null, _ === m.lineNumber ? m.column : -1, _ === A.lineNumber ? A.column : -1));
       f && (m.lineNumber >= e && v > C && r[m.lineNumber - e].push(new u1(C, -1, g, new sf(!1, m.column), -1, -1)), A.lineNumber <= t && w > C && r[A.lineNumber - e].push(new u1(C, -1, g, new sf(!D, A.column), -1, -1)));
     }
@@ -70487,13 +70486,13 @@ class my {
       console.warn("bad render request outside image data");
       return;
     }
-    const A = u ? this.charDataLight : this.charDataNormal, f = rMt(i, p), w = e.width * 4, v = a.r, C = a.g, D = a.b, N = r.r - v, z = r.g - C, T = r.b - D, L = Math.max(s, l), S = e.data;
+    const A = u ? this.charDataLight : this.charDataNormal, f = rMt(i, p), w = e.width * 4, v = a.r, C = a.g, D = a.b, N = r.r - v, z = r.g - C, T = r.b - D, S = Math.max(s, l), L = e.data;
     let _ = f * h * g, j = n * w + t * 4;
     for (let O = 0; O < m; O++) {
       let R = j;
       for (let V = 0; V < h; V++) {
         const q = A[_++] / 255 * (s / 255);
-        S[R++] = v + N * q, S[R++] = C + z * q, S[R++] = D + T * q, S[R++] = L;
+        L[R++] = v + N * q, L[R++] = C + z * q, L[R++] = D + T * q, L[R++] = S;
       }
       j += w;
     }
@@ -70504,13 +70503,13 @@ class my {
       console.warn("bad render request outside image data");
       return;
     }
-    const h = e.width * 4, g = 0.5 * (r / 255), m = s.r, A = s.g, f = s.b, w = i.r - m, v = i.g - A, C = i.b - f, D = m + w * g, N = A + v * g, z = f + C * g, T = Math.max(r, a), L = e.data;
-    let S = n * h + t * 4;
+    const h = e.width * 4, g = 0.5 * (r / 255), m = s.r, A = s.g, f = s.b, w = i.r - m, v = i.g - A, C = i.b - f, D = m + w * g, N = A + v * g, z = f + C * g, T = Math.max(r, a), S = e.data;
+    let L = n * h + t * 4;
     for (let _ = 0; _ < d; _++) {
-      let j = S;
+      let j = L;
       for (let O = 0; O < p; O++)
-        L[j++] = D, L[j++] = N, L[j++] = z, L[j++] = T;
-      S += h;
+        S[j++] = D, S[j++] = N, S[j++] = z, S[j++] = T;
+      L += h;
     }
   }
 }
@@ -70587,8 +70586,8 @@ class af {
         for (let C = d; C < h; C++) {
           const D = t + Math.floor(C) * 3840, N = 1 - (C - Math.floor(C));
           for (let z = m; z < A; z++) {
-            const T = 1 - (z - Math.floor(z)), L = D + Math.floor(z) * 4, S = T * N;
-            w += S, f += e[L] * e[L + 3] / 255 * S;
+            const T = 1 - (z - Math.floor(z)), S = D + Math.floor(z) * 4, L = T * N;
+            w += L, f += e[S] * e[S + 3] / 255 * L;
           }
         }
         const v = f / w;
@@ -70693,8 +70692,8 @@ class lf {
     if (e.minimapHeightIsEditorHeight) {
       let z = l * e.lineHeight + e.paddingTop + e.paddingBottom;
       e.scrollBeyondLastLine && (z += Math.max(0, r - e.lineHeight - e.paddingBottom));
-      const T = Math.max(1, Math.floor(r * r / z)), L = Math.max(0, e.minimapHeight - T), S = L / (u - r), _ = p * S, j = L > 0, O = Math.floor(e.canvasInnerHeight / e.minimapLineHeight), R = Math.floor(e.paddingTop / e.lineHeight);
-      return new lf(p, u, j, S, _, T, R, 1, Math.min(a, O));
+      const T = Math.max(1, Math.floor(r * r / z)), S = Math.max(0, e.minimapHeight - T), L = S / (u - r), _ = p * L, j = S > 0, O = Math.floor(e.canvasInnerHeight / e.minimapLineHeight), R = Math.floor(e.paddingTop / e.lineHeight);
+      return new lf(p, u, j, L, _, T, R, 1, Math.min(a, O));
     }
     let f;
     if (s && n !== a) {
@@ -70724,11 +70723,11 @@ class lf {
     } else {
       let z;
       t > 1 ? z = t + w : z = Math.max(1, p / A);
-      let T, L = Math.max(1, Math.floor(z - N * h / g));
-      L < w ? (T = w - L + 1, L = 1) : (T = 0, L = Math.max(1, L - w)), d && d.scrollHeight === u && (d.scrollTop > p && (L = Math.min(L, d.startLineNumber), T = Math.max(T, d.topPaddingLineCount)), d.scrollTop < p && (L = Math.max(L, d.startLineNumber), T = Math.min(T, d.topPaddingLineCount)));
-      const S = Math.min(a, L - T + m - 1), _ = (p - i) / A;
+      let T, S = Math.max(1, Math.floor(z - N * h / g));
+      S < w ? (T = w - S + 1, S = 1) : (T = 0, S = Math.max(1, S - w)), d && d.scrollHeight === u && (d.scrollTop > p && (S = Math.min(S, d.startLineNumber), T = Math.max(T, d.topPaddingLineCount)), d.scrollTop < p && (S = Math.max(S, d.startLineNumber), T = Math.min(T, d.topPaddingLineCount)));
+      const L = Math.min(a, S - T + m - 1), _ = (p - i) / A;
       let j;
-      return p >= e.paddingTop ? j = (t - L + T + _) * g / h : j = p / e.paddingTop * (T + _) * g / h, new lf(p, u, !0, D, j, f, T, L, S);
+      return p >= e.paddingTop ? j = (t - S + T + _) * g / h : j = p / e.paddingTop * (T + _) * g / h, new lf(p, u, !0, D, j, f, T, S, L);
     }
   }
 }
@@ -71377,25 +71376,25 @@ class T0 extends he {
     const r = this._getBuffer();
     if (!r)
       return null;
-    const [s, a, l] = T0._renderUntouchedLines(r, e.topPaddingLineCount, t, n, i, this._lastRenderData), p = this._model.getMinimapLinesRenderingData(t, n, l), u = this._model.getOptions().tabSize, d = this._model.options.defaultBackgroundColor, h = this._model.options.backgroundColor, g = this._model.options.foregroundAlpha, m = this._model.tokensColorTracker, A = m.backgroundIsLight(), f = this._model.options.renderMinimap, w = this._model.options.charRenderer(), v = this._model.options.fontScale, C = this._model.options.minimapCharWidth, N = (f === 1 ? 2 : 3) * v, z = i > N ? Math.floor((i - N) / 2) : 0, T = h.a / 255, L = new Us(Math.round((h.r - d.r) * T + d.r), Math.round((h.g - d.g) * T + d.g), Math.round((h.b - d.b) * T + d.b), 255);
-    let S = e.topPaddingLineCount * i;
+    const [s, a, l] = T0._renderUntouchedLines(r, e.topPaddingLineCount, t, n, i, this._lastRenderData), p = this._model.getMinimapLinesRenderingData(t, n, l), u = this._model.getOptions().tabSize, d = this._model.options.defaultBackgroundColor, h = this._model.options.backgroundColor, g = this._model.options.foregroundAlpha, m = this._model.tokensColorTracker, A = m.backgroundIsLight(), f = this._model.options.renderMinimap, w = this._model.options.charRenderer(), v = this._model.options.fontScale, C = this._model.options.minimapCharWidth, N = (f === 1 ? 2 : 3) * v, z = i > N ? Math.floor((i - N) / 2) : 0, T = h.a / 255, S = new Us(Math.round((h.r - d.r) * T + d.r), Math.round((h.g - d.g) * T + d.g), Math.round((h.b - d.b) * T + d.b), 255);
+    let L = e.topPaddingLineCount * i;
     const _ = [];
     for (let q = 0, se = n - t + 1; q < se; q++)
-      l[q] && T0._renderLine(r, L, h.a, A, f, C, m, g, w, S, z, u, p[q], v, i), _[q] = new uv(S), S += i;
+      l[q] && T0._renderLine(r, S, h.a, A, f, C, m, g, w, L, z, u, p[q], v, i), _[q] = new uv(L), L += i;
     const j = s === -1 ? 0 : s, R = (a === -1 ? r.height : a) - j;
     return this._canvas.domNode.getContext("2d").putImageData(r, 0, 0, 0, j, r.width, R), new T5e(e, r, _);
   }
   static _renderUntouchedLines(e, t, n, i, r, s) {
     const a = [];
     if (!s) {
-      for (let S = 0, _ = i - n + 1; S < _; S++)
-        a[S] = !0;
+      for (let L = 0, _ = i - n + 1; L < _; L++)
+        a[L] = !0;
       return [-1, -1, a];
     }
     const l = s._get(), p = l.imageData.data, u = l.rendLineNumberStart, d = l.lines, h = d.length, g = e.width, m = e.data, A = (i - n + 1) * r * g * 4;
     let f = -1, w = -1, v = -1, C = -1, D = -1, N = -1, z = t * r;
-    for (let S = n; S <= i; S++) {
-      const _ = S - n, j = S - u, O = j >= 0 && j < h ? d[j].dy : -1;
+    for (let L = n; L <= i; L++) {
+      const _ = L - n, j = L - u, O = j >= 0 && j < h ? d[j].dy : -1;
       if (O === -1) {
         a[_] = !0, z += r;
         continue;
@@ -71404,15 +71403,15 @@ class T0 extends he {
       C === R && N === q ? (C = V, N = se) : (v !== -1 && (m.set(p.subarray(v, C), D), f === -1 && v === 0 && v === D && (f = C), w === -1 && C === A && v === D && (w = v)), v = R, C = V, D = q, N = se), a[_] = !1, z += r;
     }
     v !== -1 && (m.set(p.subarray(v, C), D), f === -1 && v === 0 && v === D && (f = C), w === -1 && C === A && v === D && (w = v));
-    const T = f === -1 ? -1 : f / (g * 4), L = w === -1 ? -1 : w / (g * 4);
-    return [T, L, a];
+    const T = f === -1 ? -1 : f / (g * 4), S = w === -1 ? -1 : w / (g * 4);
+    return [T, S, a];
   }
   static _renderLine(e, t, n, i, r, s, a, l, p, u, d, h, g, m, A) {
     const f = g.content, w = g.tokens, v = e.width - s, C = A === 1;
     let D = Ac, N = 0, z = 0;
-    for (let T = 0, L = w.getCount(); T < L; T++) {
-      const S = w.getEndOffset(T), _ = w.getForeground(T), j = a.getColor(_);
-      for (; N < S; N++) {
+    for (let T = 0, S = w.getCount(); T < S; T++) {
+      const L = w.getEndOffset(T), _ = w.getForeground(T), j = a.getColor(_);
+      for (; N < L; N++) {
         if (D > v)
           return;
         const O = f.charCodeAt(N);
@@ -71789,13 +71788,13 @@ class dMt extends Gr {
       d.fillStyle = A;
       let w = 0, v = 0, C = 0;
       for (let D = 0, N = f.length / 3; D < N; D++) {
-        const z = f[3 * D], T = f[3 * D + 1], L = f[3 * D + 2];
-        let S = s.getVerticalOffsetForLineNumber(T) * l | 0, _ = (s.getVerticalOffsetForLineNumber(L) + r) * l | 0;
-        if (_ - S < p) {
-          let O = (S + _) / 2 | 0;
-          O < u ? O = u : O + u > i && (O = i - u), S = O - u, _ = O + u;
+        const z = f[3 * D], T = f[3 * D + 1], S = f[3 * D + 2];
+        let L = s.getVerticalOffsetForLineNumber(T) * l | 0, _ = (s.getVerticalOffsetForLineNumber(S) + r) * l | 0;
+        if (_ - L < p) {
+          let O = (L + _) / 2 | 0;
+          O < u ? O = u : O + u > i && (O = i - u), L = O - u, _ = O + u;
         }
-        S > C + 1 || z !== w ? (D !== 0 && d.fillRect(h[w], v, g[w], C - v), w = z, v = S, C = _) : _ > C && (C = _);
+        L > C + 1 || z !== w ? (D !== 0 && d.fillRect(h[w], v, g[w], C - v), w = z, v = L, C = _) : _ > C && (C = _);
       }
       d.fillRect(h[w], v, g[w], C - v);
     }
@@ -71812,10 +71811,10 @@ class dMt extends Gr {
         const T = this._cursorPositions[N].color;
         if (!T)
           continue;
-        const L = this._cursorPositions[N].position;
-        let S = s.getVerticalOffsetForLineNumber(L.lineNumber) * l | 0;
-        S < A ? S = A : S + A > i && (S = i - A);
-        const _ = S - A, j = _ + m;
+        const S = this._cursorPositions[N].position;
+        let L = s.getVerticalOffsetForLineNumber(S.lineNumber) * l | 0;
+        L < A ? L = A : L + A > i && (L = i - A);
+        const _ = L - A, j = _ + m;
         _ > C + 1 || T !== D ? (N !== 0 && D && d.fillRect(f, v, w, C - v), v = _, C = j) : j > C && (C = j), D = T, d.fillStyle = T;
       }
       D && d.fillRect(f, v, w, C - v);
@@ -72890,14 +72889,14 @@ class DMt extends zg {
     if (this._options.renderWhitespace === "selection" && !n || this._options.renderWhitespace === "trailing" && i.continuesWithWrappedLine)
       return "";
     const r = this._context.theme.getColor(dk), s = this._options.renderWithSVG, a = i.content, l = this._options.stopRenderingLineAfter === -1 ? a.length : Math.min(this._options.stopRenderingLineAfter, a.length), p = i.continuesWithWrappedLine, u = i.minColumn - 1, d = this._options.renderWhitespace === "boundary", h = this._options.renderWhitespace === "trailing", g = this._options.lineHeight, m = this._options.middotWidth, A = this._options.wsmiddotWidth, f = this._options.spaceWidth, w = Math.abs(A - f), v = Math.abs(m - f), C = w < v ? 11825 : 183, D = this._options.canUseHalfwidthRightwardsArrow;
-    let N = "", z = !1, T = qr(a), L;
-    T === -1 ? (z = !0, T = l, L = l) : L = yg(a);
-    let S = 0, _ = n && n[S], j = 0;
+    let N = "", z = !1, T = qr(a), S;
+    T === -1 ? (z = !0, T = l, S = l) : S = yg(a);
+    let L = 0, _ = n && n[L], j = 0;
     for (let O = u; O < l; O++) {
       const R = a.charCodeAt(O);
-      if (_ && O >= _.endOffset && (S++, _ = n && n[S]), R !== 9 && R !== 32 || h && !z && O <= L)
+      if (_ && O >= _.endOffset && (L++, _ = n && n[L]), R !== 9 && R !== 32 || h && !z && O <= S)
         continue;
-      if (d && O >= T && O <= L && R === 32) {
+      if (d && O >= T && O <= S && R === 32) {
         const q = O - 1 >= 0 ? a.charCodeAt(O - 1) : 0, se = O + 1 < l ? a.charCodeAt(O + 1) : 0;
         if (q !== 32 && se !== 32)
           continue;
@@ -73594,25 +73593,25 @@ class vk {
   }
 }
 function OMt(o, e, t, n, i, r, s, a) {
-  function l(S) {
-    const _ = a[S];
+  function l(L) {
+    const _ = a[L];
     if (_) {
-      const j = Ul.applyInjectedText(e[S], _), O = _.map((V) => V.options), R = _.map((V) => V.column - 1);
+      const j = Ul.applyInjectedText(e[L], _), O = _.map((V) => V.options), R = _.map((V) => V.column - 1);
       return new cf(R, O, [j.length], [], 0);
     } else
       return null;
   }
   if (i === -1) {
-    const S = [];
+    const L = [];
     for (let _ = 0, j = e.length; _ < j; _++)
-      S[_] = l(_);
-    return S;
+      L[_] = l(_);
+    return L;
   }
   const p = Math.round(i * t.typicalHalfwidthCharacterWidth), d = Math.round(n * (r === 3 ? 2 : r === 2 ? 1 : 0)), h = Math.ceil(t.spaceWidth * d), g = document.createElement("div");
   Eo(g, t);
   const m = new q8(1e4), A = [], f = [], w = [], v = [], C = [];
-  for (let S = 0; S < e.length; S++) {
-    const _ = Ul.applyInjectedText(e[S], a[S]);
+  for (let L = 0; L < e.length; L++) {
+    const _ = Ul.applyInjectedText(e[L], a[L]);
     let j = 0, O = 0, R = p;
     if (r !== 0)
       if (j = qr(_), j === -1)
@@ -73626,28 +73625,28 @@ function OMt(o, e, t, n, i, r, s, a) {
         se + t.typicalFullwidthCharacterWidth > p ? (j = 0, O = 0) : R = p - se;
       }
     const V = _.substr(j), q = jMt(V, O, n, R, m, h);
-    A[S] = j, f[S] = O, w[S] = V, v[S] = q[0], C[S] = q[1];
+    A[L] = j, f[L] = O, w[L] = V, v[L] = q[0], C[L] = q[1];
   }
   const D = m.build(), N = kMt?.createHTML(D) ?? D;
   g.innerHTML = N, g.style.position = "absolute", g.style.top = "10000", s === "keepAll" ? (g.style.wordBreak = "keep-all", g.style.overflowWrap = "anywhere") : (g.style.wordBreak = "inherit", g.style.overflowWrap = "break-word"), o.document.body.appendChild(g);
-  const z = document.createRange(), T = Array.prototype.slice.call(g.children, 0), L = [];
-  for (let S = 0; S < e.length; S++) {
-    const _ = T[S], j = _Mt(z, _, w[S], v[S]);
+  const z = document.createRange(), T = Array.prototype.slice.call(g.children, 0), S = [];
+  for (let L = 0; L < e.length; L++) {
+    const _ = T[L], j = _Mt(z, _, w[L], v[L]);
     if (j === null) {
-      L[S] = l(S);
+      S[L] = l(L);
       continue;
     }
-    const O = A[S], R = f[S] + d, V = C[S], q = [];
+    const O = A[L], R = f[L] + d, V = C[L], q = [];
     for (let ce = 0, oe = j.length; ce < oe; ce++)
       q[ce] = V[j[ce]];
     if (O !== 0)
       for (let ce = 0, oe = j.length; ce < oe; ce++)
         j[ce] += O;
     let se, ue;
-    const me = a[S];
-    me ? (se = me.map((ce) => ce.options), ue = me.map((ce) => ce.column - 1)) : (se = null, ue = null), L[S] = new cf(ue, se, j, q, R);
+    const me = a[L];
+    me ? (se = me.map((ce) => ce.options), ue = me.map((ce) => ce.column - 1)) : (se = null, ue = null), S[L] = new cf(ue, se, j, q, R);
   }
-  return g.remove(), L;
+  return g.remove(), S;
 }
 function jMt(o, e, t, n, i, r) {
   if (r !== 0) {
@@ -76207,11 +76206,11 @@ function Y5e(o, e, t) {
   for (let m = 1; m <= n; m++) {
     const A = o.getLineLength(m), f = o.getLineContent(m), w = A <= 65536;
     let v = !1, C = 0, D = 0, N = 0;
-    for (let T = 0, L = A; T < L; T++) {
-      const S = w ? f.charCodeAt(T) : o.getLineCharCode(m, T);
-      if (S === 9)
+    for (let T = 0, S = A; T < S; T++) {
+      const L = w ? f.charCodeAt(T) : o.getLineCharCode(m, T);
+      if (L === 9)
         N++;
-      else if (S === 32)
+      else if (L === 32)
         D++;
       else {
         v = !0, C = T;
@@ -79675,22 +79674,22 @@ let lT = class extends he {
       for (let p = 0, u = s.length; p < u; p++) {
         const d = s[p], [h] = B2(d.text);
         this._onDidChangeDecorations.fire();
-        const g = d.range.startLineNumber, m = d.range.endLineNumber, A = m - g, f = h, w = Math.min(A, f), v = f - A, C = r - l - v + g, D = C, N = C + f, z = this._decorationsTree.getInjectedTextInInterval(this, this.getOffsetAt(new ne(D, 1)), this.getOffsetAt(new ne(N, this.getLineMaxColumn(N))), 0), T = Ul.fromDecorations(z), L = new pu(T);
-        for (let S = w; S >= 0; S--) {
-          const _ = g + S, j = C + S;
-          L.takeFromEndWhile((R) => R.lineNumber > j);
-          const O = L.takeFromEndWhile((R) => R.lineNumber === j);
+        const g = d.range.startLineNumber, m = d.range.endLineNumber, A = m - g, f = h, w = Math.min(A, f), v = f - A, C = r - l - v + g, D = C, N = C + f, z = this._decorationsTree.getInjectedTextInInterval(this, this.getOffsetAt(new ne(D, 1)), this.getOffsetAt(new ne(N, this.getLineMaxColumn(N))), 0), T = Ul.fromDecorations(z), S = new pu(T);
+        for (let L = w; L >= 0; L--) {
+          const _ = g + L, j = C + L;
+          S.takeFromEndWhile((R) => R.lineNumber > j);
+          const O = S.takeFromEndWhile((R) => R.lineNumber === j);
           a.push(new _5e(_, this.getLineContent(j), O));
         }
         if (w < A) {
-          const S = g + w;
-          a.push(new SMt(S + 1, m));
+          const L = g + w;
+          a.push(new SMt(L + 1, m));
         }
         if (w < f) {
-          const S = new pu(T), _ = g + w, j = f - w, O = r - l - j + _ + 1, R = [], V = [];
+          const L = new pu(T), _ = g + w, j = f - w, O = r - l - j + _ + 1, R = [], V = [];
           for (let q = 0; q < j; q++) {
             const se = O + q;
-            V[q] = this.getLineContent(se), S.takeWhile((ue) => ue.lineNumber < se), R[q] = S.takeWhile((ue) => ue.lineNumber === se);
+            V[q] = this.getLineContent(se), L.takeWhile((ue) => ue.lineNumber < se), R[q] = L.takeWhile((ue) => ue.lineNumber === se);
           }
           a.push(new LMt(_ + 1, g + f, V, R));
         }
@@ -80267,14 +80266,14 @@ function d6t(o, e, t, n, i, r, s, a) {
   for (; N < D; ) {
     let z = N < 0 ? 0 : u[N], T = N < 0 ? 0 : d[N];
     w > z && (z = w, T = v);
-    let L = 0, S = 0, _ = 0, j = 0;
+    let S = 0, L = 0, _ = 0, j = 0;
     if (T <= C) {
       let R = T, V = z === 0 ? 0 : t.charCodeAt(z - 1), q = z === 0 ? 0 : o.get(V), se = !0;
       for (let ue = z; ue < l; ue++) {
         const me = ue, ce = t.charCodeAt(ue);
         let oe, pe;
-        if (Pi(ce) ? (ue++, oe = 0, pe = 2) : (oe = o.get(ce), pe = gf(ce, R, n, r)), me > w && uT(V, q, ce, oe, p) && (L = me, S = R), R += pe, R > C) {
-          me > w ? (_ = me, j = R - pe) : (_ = ue + 1, j = R), R - S > g && (L = 0), se = !1;
+        if (Pi(ce) ? (ue++, oe = 0, pe = 2) : (oe = o.get(ce), pe = gf(ce, R, n, r)), me > w && uT(V, q, ce, oe, p) && (S = me, L = R), R += pe, R > C) {
+          me > w ? (_ = me, j = R - pe) : (_ = ue + 1, j = R), R - L > g && (S = 0), se = !1;
           break;
         }
         V = ce, q = oe;
@@ -80284,7 +80283,7 @@ function d6t(o, e, t, n, i, r, s, a) {
         break;
       }
     }
-    if (L === 0) {
+    if (S === 0) {
       let R = T, V = t.charCodeAt(z), q = o.get(V), se = !1;
       for (let ue = z - 1; ue >= w; ue--) {
         const me = ue + 1, ce = t.charCodeAt(ue);
@@ -80297,18 +80296,18 @@ function d6t(o, e, t, n, i, r, s, a) {
           if (_ === 0 && (_ = me, j = R), R <= C - g)
             break;
           if (uT(ce, oe, V, q, p)) {
-            L = me, S = R;
+            S = me, L = R;
             break;
           }
         }
         R -= pe, V = ce, q = oe;
       }
-      if (L !== 0) {
-        const ue = g - (j - S);
+      if (S !== 0) {
+        const ue = g - (j - L);
         if (ue <= n) {
           const me = t.charCodeAt(_);
           let ce;
-          Pi(me) ? ce = 2 : ce = gf(me, j, n, r), ue - ce < 0 && (L = 0);
+          Pi(me) ? ce = 2 : ce = gf(me, j, n, r), ue - ce < 0 && (S = 0);
         }
       }
       if (se) {
@@ -80316,11 +80315,11 @@ function d6t(o, e, t, n, i, r, s, a) {
         continue;
       }
     }
-    if (L === 0 && (L = _, S = j), L <= w) {
+    if (S === 0 && (S = _, L = j), S <= w) {
       const R = t.charCodeAt(w);
-      Pi(R) ? (L = w + 2, S = v + 2) : (L = w + 1, S = v + gf(R, v, n, r));
+      Pi(R) ? (S = w + 2, L = v + 2) : (S = w + 1, L = v + gf(R, v, n, r));
     }
-    for (w = L, m[f] = L, v = S, A[f] = S, f++, C = S + g; N < 0 || N < D && d[N] < S; )
+    for (w = S, m[f] = S, v = L, A[f] = L, f++, C = L + g; N < 0 || N < D && d[N] < L; )
       N++;
     let O = Math.abs(d[N] - C);
     for (; N + 1 < D; ) {
@@ -80335,18 +80334,18 @@ function d6t(o, e, t, n, i, r, s, a) {
 function h6t(o, e, t, n, i, r, s, a) {
   const l = Ul.applyInjectedText(e, t);
   let p, u;
-  if (t && t.length > 0 ? (p = t.map((S) => S.options), u = t.map((S) => S.column - 1)) : (p = null, u = null), i === -1)
+  if (t && t.length > 0 ? (p = t.map((L) => L.options), u = t.map((L) => L.column - 1)) : (p = null, u = null), i === -1)
     return p ? new cf(u, p, [l.length], [], 0) : null;
   const d = l.length;
   if (d <= 1)
     return p ? new cf(u, p, [l.length], [], 0) : null;
   const h = a === "keepAll", g = tze(l, n, i, r, s), m = i - g, A = [], f = [];
-  let w = 0, v = 0, C = 0, D = i, N = l.charCodeAt(0), z = o.get(N), T = gf(N, 0, n, r), L = 1;
-  Pi(N) && (T += 1, N = l.charCodeAt(1), z = o.get(N), L++);
-  for (let S = L; S < d; S++) {
-    const _ = S, j = l.charCodeAt(S);
+  let w = 0, v = 0, C = 0, D = i, N = l.charCodeAt(0), z = o.get(N), T = gf(N, 0, n, r), S = 1;
+  Pi(N) && (T += 1, N = l.charCodeAt(1), z = o.get(N), S++);
+  for (let L = S; L < d; L++) {
+    const _ = L, j = l.charCodeAt(L);
     let O, R;
-    Pi(j) ? (S++, O = 0, R = 2) : (O = o.get(j), R = gf(j, T, n, r)), uT(N, z, j, O, h) && (v = _, C = T), T += R, T > D && ((v === 0 || T - C > m) && (v = _, C = T - R), A[w] = v, f[w] = C, w++, D = C + m, v = 0), N = j, z = O;
+    Pi(j) ? (L++, O = 0, R = 2) : (O = o.get(j), R = gf(j, T, n, r)), uT(N, z, j, O, h) && (v = _, C = T), T += R, T > D && ((v === 0 || T - C > m) && (v = _, C = T - R), A[w] = v, f[w] = C, w++, D = C + m, v = 0), N = j, z = O;
   }
   return w === 0 && (!t || t.length === 0) ? null : (A[w] = d, f[w] = T, new cf(u, p, A, f, g));
 }
@@ -82554,8 +82553,8 @@ class J6t {
           if (w < N) {
             const z = u[m];
             if (z.inlineClassName) {
-              const T = A > 0 ? l.wrappedTextIndentLength : 0, L = T + Math.max(D - w, 0), S = T + Math.min(N - w, v - w);
-              L !== S && f.push(new yft(L, S, z.inlineClassName, z.inlineClassNameAffectsLetterSpacing));
+              const T = A > 0 ? l.wrappedTextIndentLength : 0, S = T + Math.max(D - w, 0), L = T + Math.min(N - w, v - w);
+              S !== L && f.push(new yft(S, L, z.inlineClassName, z.inlineClassNameAffectsLetterSpacing));
             }
           }
           if (N <= v)
@@ -87376,11 +87375,11 @@ function Ize(o, e, t, n, i, r, s = D8t.default) {
       h <= C && (N = N8t(o, e, d, t, n, i, h, l, r, fp[p - 1][u - 1] === 0, g));
       let T = 0;
       N !== Number.MAX_SAFE_INTEGER && (z = !0, T = N + Ch[p - 1][u - 1]);
-      const L = h > v, S = L ? Ch[p][u - 1] + (fp[p][u - 1] > 0 ? -5 : 0) : 0, _ = h > v + 1 && fp[p][u - 1] > 0, j = _ ? Ch[p][u - 2] + (fp[p][u - 2] > 0 ? -5 : 0) : 0;
-      if (_ && (!L || j >= S) && (!z || j >= T))
+      const S = h > v, L = S ? Ch[p][u - 1] + (fp[p][u - 1] > 0 ? -5 : 0) : 0, _ = h > v + 1 && fp[p][u - 1] > 0, j = _ ? Ch[p][u - 2] + (fp[p][u - 2] > 0 ? -5 : 0) : 0;
+      if (_ && (!S || j >= L) && (!z || j >= T))
         Ch[p][u] = j, G3[p][u] = 3, fp[p][u] = 0;
-      else if (L && (!z || S >= T))
-        Ch[p][u] = S, G3[p][u] = 2, fp[p][u] = 0;
+      else if (S && (!z || L >= T))
+        Ch[p][u] = L, G3[p][u] = 2, fp[p][u] = 0;
       else if (z)
         Ch[p][u] = T, G3[p][u] = 1, fp[p][u] = fp[p - 1][u - 1] + 1;
       else
@@ -87671,11 +87670,11 @@ In order to be iterable, non-array objects must have a [Symbol.iterator]() metho
       }
       return re;
     }
-    var T = {}, L = /^[^:]+:\/*[^/]*$/, S = /^([^:]+:)[\s\S]*$/, _ = /^([^:]+:\/*[^/]*)[\s\S]*$/;
+    var T = {}, S = /^[^:]+:\/*[^/]*$/, L = /^([^:]+:)[\s\S]*$/, _ = /^([^:]+:\/*[^/]*)[\s\S]*$/;
     function j(fe, ae) {
-      T[" " + fe] || (L.test(fe) ? T[" " + fe] = fe + "/" : T[" " + fe] = q(fe, "/", !0)), fe = T[" " + fe];
+      T[" " + fe] || (S.test(fe) ? T[" " + fe] = fe + "/" : T[" " + fe] = q(fe, "/", !0)), fe = T[" " + fe];
       var re = fe.indexOf(":") === -1;
-      return ae.substring(0, 2) === "//" ? re ? ae : fe.replace(S, "$1") + ae : ae.charAt(0) === "/" ? re ? ae : fe.replace(_, "$1") + ae : fe + ae;
+      return ae.substring(0, 2) === "//" ? re ? ae : fe.replace(L, "$1") + ae : ae.charAt(0) === "/" ? re ? ae : fe.replace(_, "$1") + ae : fe + ae;
     }
     var O = {
       exec: function() {
@@ -92711,8 +92710,8 @@ class $a {
       if (z.dragStartDisposable.dispose(), z.checkedDisposable.dispose(), z.row) {
         let T = a.get(z.templateId);
         T || (T = [], a.set(z.templateId, T));
-        const L = this.renderers.get(z.templateId);
-        L && L.disposeElement && L.disposeElement(z.element, N, z.row.templateData, z.size), T.unshift(z.row);
+        const S = this.renderers.get(z.templateId);
+        S && S.disposeElement && S.disposeElement(z.element, N, z.row.templateData, z.size), T.unshift(z.row);
       }
       z.row = null, z.stale = !0;
     }
@@ -92743,8 +92742,8 @@ class $a {
     const v = u.map((N) => OT(N, g)), D = [{ start: e, end: e + n.length }, ...v].map((N) => wo.intersect(m, N)).reverse();
     for (const N of D)
       for (let z = N.end - 1; z >= N.start; z--) {
-        const T = this.items[z], S = a.get(T.templateId)?.pop();
-        this.insertItemInDOM(z, S);
+        const T = this.items[z], L = a.get(T.templateId)?.pop();
+        this.insertItemInDOM(z, L);
       }
     for (const N of a.values())
       for (const z of N)
@@ -99853,21 +99852,21 @@ class hCt extends he {
         }
       let h, g;
       if (!l) {
-        const m = Ar(i, -1), A = Ar(i + 1, this.viewItems.length), f = m.reduce((L, S) => L + (this.viewItems[S].minimumSize - p[S]), 0), w = m.reduce((L, S) => L + (this.viewItems[S].viewMaximumSize - p[S]), 0), v = A.length === 0 ? Number.POSITIVE_INFINITY : A.reduce((L, S) => L + (p[S] - this.viewItems[S].minimumSize), 0), C = A.length === 0 ? Number.NEGATIVE_INFINITY : A.reduce((L, S) => L + (p[S] - this.viewItems[S].viewMaximumSize), 0), D = Math.max(f, C), N = Math.min(v, w), z = this.findFirstSnapIndex(m), T = this.findFirstSnapIndex(A);
+        const m = Ar(i, -1), A = Ar(i + 1, this.viewItems.length), f = m.reduce((S, L) => S + (this.viewItems[L].minimumSize - p[L]), 0), w = m.reduce((S, L) => S + (this.viewItems[L].viewMaximumSize - p[L]), 0), v = A.length === 0 ? Number.POSITIVE_INFINITY : A.reduce((S, L) => S + (p[L] - this.viewItems[L].minimumSize), 0), C = A.length === 0 ? Number.NEGATIVE_INFINITY : A.reduce((S, L) => S + (p[L] - this.viewItems[L].viewMaximumSize), 0), D = Math.max(f, C), N = Math.min(v, w), z = this.findFirstSnapIndex(m), T = this.findFirstSnapIndex(A);
         if (typeof z == "number") {
-          const L = this.viewItems[z], S = Math.floor(L.viewMinimumSize / 2);
+          const S = this.viewItems[z], L = Math.floor(S.viewMinimumSize / 2);
           h = {
             index: z,
-            limitDelta: L.visible ? D - S : D + S,
-            size: L.size
+            limitDelta: S.visible ? D - L : D + L,
+            size: S.size
           };
         }
         if (typeof T == "number") {
-          const L = this.viewItems[T], S = Math.floor(L.viewMinimumSize / 2);
+          const S = this.viewItems[T], L = Math.floor(S.viewMinimumSize / 2);
           g = {
             index: T,
-            limitDelta: L.visible ? N + S : N - S,
-            size: L.size
+            limitDelta: S.visible ? N + L : N - L,
+            size: S.size
           };
         }
       }
@@ -99957,17 +99956,17 @@ class hCt extends he {
       typeof t == "number" ? p = t : (t.type === "auto" && (this.areViewsDistributed() ? t = { type: "distribute" } : t = { type: "split", index: t.index }), t.type === "split" ? p = this.getViewSize(t.index) / 2 : t.type === "invisible" ? p = { cachedVisibleSize: t.cachedVisibleSize } : p = e.minimumSize);
       const u = this.orientation === 0 ? new uCt(r, e, p, l) : new dCt(r, e, p, l);
       if (this.viewItems.splice(n, 0, u), this.viewItems.length > 1) {
-        const h = { orthogonalStartSash: this.orthogonalStartSash, orthogonalEndSash: this.orthogonalEndSash }, g = this.orientation === 0 ? new ns(this.sashContainer, { getHorizontalSashTop: (L) => this.getSashPosition(L), getHorizontalSashWidth: this.getSashOrthogonalSize }, {
+        const h = { orthogonalStartSash: this.orthogonalStartSash, orthogonalEndSash: this.orthogonalEndSash }, g = this.orientation === 0 ? new ns(this.sashContainer, { getHorizontalSashTop: (S) => this.getSashPosition(S), getHorizontalSashWidth: this.getSashOrthogonalSize }, {
           ...h,
           orientation: 1
           /* Orientation.HORIZONTAL */
-        }) : new ns(this.sashContainer, { getVerticalSashLeft: (L) => this.getSashPosition(L), getVerticalSashHeight: this.getSashOrthogonalSize }, {
+        }) : new ns(this.sashContainer, { getVerticalSashLeft: (S) => this.getSashPosition(S), getVerticalSashHeight: this.getSashOrthogonalSize }, {
           ...h,
           orientation: 0
           /* Orientation.VERTICAL */
-        }), m = this.orientation === 0 ? (L) => ({ sash: g, start: L.startY, current: L.currentY, alt: L.altKey }) : (L) => ({ sash: g, start: L.startX, current: L.currentX, alt: L.altKey }), f = we.map(g.onDidStart, m)(this.onSashStart, this), v = we.map(g.onDidChange, m)(this.onSashChange, this), D = we.map(g.onDidEnd, () => this.sashItems.findIndex((L) => L.sash === g))(this.onSashEnd, this), N = g.onDidReset(() => {
-          const L = this.sashItems.findIndex((R) => R.sash === g), S = Ar(L, -1), _ = Ar(L + 1, this.viewItems.length), j = this.findFirstSnapIndex(S), O = this.findFirstSnapIndex(_);
-          typeof j == "number" && !this.viewItems[j].visible || typeof O == "number" && !this.viewItems[O].visible || this._onDidSashReset.fire(L);
+        }), m = this.orientation === 0 ? (S) => ({ sash: g, start: S.startY, current: S.currentY, alt: S.altKey }) : (S) => ({ sash: g, start: S.startX, current: S.currentX, alt: S.altKey }), f = we.map(g.onDidStart, m)(this.onSashStart, this), v = we.map(g.onDidChange, m)(this.onSashChange, this), D = we.map(g.onDidEnd, () => this.sashItems.findIndex((S) => S.sash === g))(this.onSashEnd, this), N = g.onDidReset(() => {
+          const S = this.sashItems.findIndex((R) => R.sash === g), L = Ar(S, -1), _ = Ar(S + 1, this.viewItems.length), j = this.findFirstSnapIndex(L), O = this.findFirstSnapIndex(_);
+          typeof j == "number" && !this.viewItems[j].visible || typeof O == "number" && !this.viewItems[O].visible || this._onDidSashReset.fire(S);
         }), z = Rc(f, v, D, N, g), T = { sash: g, disposable: z };
         this.sashItems.splice(n - 1, 0, T);
       }
@@ -99992,26 +99991,26 @@ class hCt extends he {
     if (i)
       for (const T of i)
         M3(u, T), M3(d, T);
-    const h = u.map((T) => this.viewItems[T]), g = u.map((T) => n[T]), m = d.map((T) => this.viewItems[T]), A = d.map((T) => n[T]), f = u.reduce((T, L) => T + (this.viewItems[L].minimumSize - n[L]), 0), w = u.reduce((T, L) => T + (this.viewItems[L].maximumSize - n[L]), 0), v = d.length === 0 ? Number.POSITIVE_INFINITY : d.reduce((T, L) => T + (n[L] - this.viewItems[L].minimumSize), 0), C = d.length === 0 ? Number.NEGATIVE_INFINITY : d.reduce((T, L) => T + (n[L] - this.viewItems[L].maximumSize), 0), D = Math.max(f, C, s), N = Math.min(v, w, a);
+    const h = u.map((T) => this.viewItems[T]), g = u.map((T) => n[T]), m = d.map((T) => this.viewItems[T]), A = d.map((T) => n[T]), f = u.reduce((T, S) => T + (this.viewItems[S].minimumSize - n[S]), 0), w = u.reduce((T, S) => T + (this.viewItems[S].maximumSize - n[S]), 0), v = d.length === 0 ? Number.POSITIVE_INFINITY : d.reduce((T, S) => T + (n[S] - this.viewItems[S].minimumSize), 0), C = d.length === 0 ? Number.NEGATIVE_INFINITY : d.reduce((T, S) => T + (n[S] - this.viewItems[S].maximumSize), 0), D = Math.max(f, C, s), N = Math.min(v, w, a);
     let z = !1;
     if (l) {
-      const T = this.viewItems[l.index], L = t >= l.limitDelta;
-      z = L !== T.visible, T.setVisible(L, l.size);
+      const T = this.viewItems[l.index], S = t >= l.limitDelta;
+      z = S !== T.visible, T.setVisible(S, l.size);
     }
     if (!z && p) {
-      const T = this.viewItems[p.index], L = t < p.limitDelta;
-      z = L !== T.visible, T.setVisible(L, p.size);
+      const T = this.viewItems[p.index], S = t < p.limitDelta;
+      z = S !== T.visible, T.setVisible(S, p.size);
     }
     if (z)
       return this.resize(e, t, n, i, r, s, a);
     t = fr(t, D, N);
-    for (let T = 0, L = t; T < h.length; T++) {
-      const S = h[T], _ = fr(g[T] + L, S.minimumSize, S.maximumSize), j = _ - g[T];
-      L -= j, S.size = _;
+    for (let T = 0, S = t; T < h.length; T++) {
+      const L = h[T], _ = fr(g[T] + S, L.minimumSize, L.maximumSize), j = _ - g[T];
+      S -= j, L.size = _;
     }
-    for (let T = 0, L = t; T < m.length; T++) {
-      const S = m[T], _ = fr(A[T] - L, S.minimumSize, S.maximumSize), j = _ - A[T];
-      L += j, S.size = _;
+    for (let T = 0, S = t; T < m.length; T++) {
+      const L = m[T], _ = fr(A[T] - S, L.minimumSize, L.maximumSize), j = _ - A[T];
+      S += j, L.size = _;
     }
     return t;
   }
@@ -104809,10 +104808,10 @@ let cz = class extends he {
     z.label = b("custom", "Custom"), this._register(z.onDidClick((V) => {
       this.onDidCustomEmitter.fire();
     }));
-    const T = Oe(d, jr(`#${this.idPrefix}message.quick-input-message`)), L = this._register(new sO(t, this.styles.progressBar));
-    L.getContainer().classList.add("quick-input-progress");
-    const S = Oe(t, jr(".quick-input-html-widget"));
-    S.tabIndex = -1;
+    const T = Oe(d, jr(`#${this.idPrefix}message.quick-input-message`)), S = this._register(new sO(t, this.styles.progressBar));
+    S.getContainer().classList.add("quick-input-progress");
+    const L = Oe(t, jr(".quick-input-html-widget"));
+    L.tabIndex = -1;
     const _ = Oe(t, jr(".quick-input-description")), j = this.idPrefix + "list", O = this._register(this.instantiationService.createInstance(Ly, t, this.options.hoverDelegate, this.options.linkOpenerDelegate, j));
     g.setAttribute("aria-controls", j), this._register(O.onDidChangeFocus(() => {
       g.setAttribute("aria-activedescendant", O.getActiveDescendant() ?? "");
@@ -104843,7 +104842,7 @@ let cz = class extends he {
     })), this._register(le(t, De.FOCUS, (V) => {
       g.setFocus();
     })), this._register(qi(t, De.KEY_DOWN, (V) => {
-      if (!Vi(V.target, S))
+      if (!Vi(V.target, L))
         switch (V.keyCode) {
           case 3:
             zt.stop(V, !0), this.enabled && this.onDidAcceptEmitter.fire();
@@ -104879,7 +104878,7 @@ let cz = class extends he {
       title: s,
       description1: _,
       description2: u,
-      widget: S,
+      widget: L,
       rightActionBar: a,
       inlineActionBar: v,
       checkAll: p,
@@ -104896,7 +104895,7 @@ let cz = class extends he {
       customButtonContainer: N,
       customButton: z,
       list: O,
-      progressBar: L,
+      progressBar: S,
       onDidAccept: this.onDidAcceptEmitter.event,
       onDidCustom: this.onDidCustomEmitter.event,
       onDidTriggerButton: this.onDidTriggerButtonEmitter.event,
@@ -108985,33 +108984,33 @@ let zz = class extends he {
     N.style.width = g + "px", N.style.minWidth = g + "px", N.style.paddingRight = "10px", N.className = "diff-review-line-number" + A, e.modifiedLineNumber !== void 0 ? N.appendChild(document.createTextNode(String(e.modifiedLineNumber))) : N.innerText = " ", C.appendChild(N);
     const z = document.createElement("span");
     if (z.className = f, w) {
-      const S = document.createElement("span");
-      S.className = St.asClassName(w), S.innerText = "  ", z.appendChild(S);
+      const L = document.createElement("span");
+      L.className = St.asClassName(w), L.innerText = "  ", z.appendChild(L);
     } else
       z.innerText = "  ";
     C.appendChild(z);
     let T;
     if (e.modifiedLineNumber !== void 0) {
-      let S = this._getLineHtml(l, a, p.tabSize, e.modifiedLineNumber, this._languageService.languageIdCodec);
-      g1._ttPolicy && (S = g1._ttPolicy.createHTML(S)), C.insertAdjacentHTML("beforeend", S), T = l.getLineContent(e.modifiedLineNumber);
+      let L = this._getLineHtml(l, a, p.tabSize, e.modifiedLineNumber, this._languageService.languageIdCodec);
+      g1._ttPolicy && (L = g1._ttPolicy.createHTML(L)), C.insertAdjacentHTML("beforeend", L), T = l.getLineContent(e.modifiedLineNumber);
     } else {
-      let S = this._getLineHtml(r, i, s.tabSize, e.originalLineNumber, this._languageService.languageIdCodec);
-      g1._ttPolicy && (S = g1._ttPolicy.createHTML(S)), C.insertAdjacentHTML("beforeend", S), T = r.getLineContent(e.originalLineNumber);
+      let L = this._getLineHtml(r, i, s.tabSize, e.originalLineNumber, this._languageService.languageIdCodec);
+      g1._ttPolicy && (L = g1._ttPolicy.createHTML(L)), C.insertAdjacentHTML("beforeend", L), T = r.getLineContent(e.originalLineNumber);
     }
     T.length === 0 && (T = b("blankLine", "blank"));
-    let L = "";
+    let S = "";
     switch (e.type) {
       case Xo.Unchanged:
-        e.originalLineNumber === e.modifiedLineNumber ? L = b({ key: "unchangedLine", comment: ["The placeholders are contents of the line and should not be translated."] }, "{0} unchanged line {1}", T, e.originalLineNumber) : L = b("equalLine", "{0} original line {1} modified line {2}", T, e.originalLineNumber, e.modifiedLineNumber);
+        e.originalLineNumber === e.modifiedLineNumber ? S = b({ key: "unchangedLine", comment: ["The placeholders are contents of the line and should not be translated."] }, "{0} unchanged line {1}", T, e.originalLineNumber) : S = b("equalLine", "{0} original line {1} modified line {2}", T, e.originalLineNumber, e.modifiedLineNumber);
         break;
       case Xo.Added:
-        L = b("insertLine", "+ {0} modified line {1}", T, e.modifiedLineNumber);
+        S = b("insertLine", "+ {0} modified line {1}", T, e.modifiedLineNumber);
         break;
       case Xo.Deleted:
-        L = b("deleteLine", "- {0} original line {1}", T, e.originalLineNumber);
+        S = b("deleteLine", "- {0} original line {1}", T, e.originalLineNumber);
         break;
     }
-    return v.setAttribute("aria-label", L), v;
+    return v.setAttribute("aria-label", S), v;
   }
   _getLineHtml(e, t, n, i, r) {
     const s = e.getLineContent(i), a = t.get(
@@ -109781,19 +109780,19 @@ let jz = class extends he {
     const w = this._register(new Pe());
     this.viewZones = Nm(this, (C, D) => {
       w.clear();
-      const N = m.read(C) || [], z = [], T = [], L = this._modifiedTopPadding.read(C);
-      L > 0 && T.push({
+      const N = m.read(C) || [], z = [], T = [], S = this._modifiedTopPadding.read(C);
+      S > 0 && T.push({
         afterLineNumber: 0,
         domNode: document.createElement("div"),
-        heightInPx: L,
+        heightInPx: S,
         showInHiddenAreas: !0,
         suppressMouseDown: !0
       });
-      const S = this._originalTopPadding.read(C);
-      S > 0 && z.push({
+      const L = this._originalTopPadding.read(C);
+      L > 0 && z.push({
         afterLineNumber: 0,
         domNode: document.createElement("div"),
-        heightInPx: S,
+        heightInPx: L,
         showInHiddenAreas: !0,
         suppressMouseDown: !0
       });
@@ -110003,15 +110002,15 @@ function o8e(o, e, t, n, i, r) {
         f = !1;
       else if (!z && (D === v || N === w))
         return;
-      const T = new st(v, D), L = new st(w, N);
-      if (T.isEmpty && L.isEmpty)
+      const T = new st(v, D), S = new st(w, N);
+      if (T.isEmpty && S.isEmpty)
         return;
-      const S = s.takeWhile((j) => j.lineNumber < D)?.reduce((j, O) => j + O.heightInPx, 0) ?? 0, _ = a.takeWhile((j) => j.lineNumber < N)?.reduce((j, O) => j + O.heightInPx, 0) ?? 0;
+      const L = s.takeWhile((j) => j.lineNumber < D)?.reduce((j, O) => j + O.heightInPx, 0) ?? 0, _ = a.takeWhile((j) => j.lineNumber < N)?.reduce((j, O) => j + O.heightInPx, 0) ?? 0;
       u.push({
         originalRange: T,
-        modifiedRange: L,
-        originalHeightInPx: T.length * l + S,
-        modifiedHeightInPx: L.length * p + _,
+        modifiedRange: S,
+        originalHeightInPx: T.length * l + L,
+        modifiedHeightInPx: S.length * p + _,
         diff: m.lineRangeMapping
       }), v = D, w = N;
     };
@@ -110075,21 +110074,21 @@ class x1 extends he {
       }
       this._modifiedViewZonesChangedSignal.read(u), this._originalViewZonesChangedSignal.read(u);
       const f = g.map((T) => {
-        function L(ue, me) {
+        function S(ue, me) {
           const ce = me.getTopForLineNumber(ue.startLineNumber, !0), oe = me.getTopForLineNumber(ue.endLineNumberExclusive, !0);
           return (ce + oe) / 2;
         }
-        const S = L(T.lineRangeMapping.original, this._editors.original), _ = this._originalScrollTop.read(u), j = L(T.lineRangeMapping.modified, this._editors.modified), O = this._modifiedScrollTop.read(u), R = S - _, V = j - O, q = Math.min(S, j), se = Math.max(S, j);
-        return { range: new mt(q, se), from: R, to: V, fromWithoutScroll: S, toWithoutScroll: j, move: T };
+        const L = S(T.lineRangeMapping.original, this._editors.original), _ = this._originalScrollTop.read(u), j = S(T.lineRangeMapping.modified, this._editors.modified), O = this._modifiedScrollTop.read(u), R = L - _, V = j - O, q = Math.min(L, j), se = Math.max(L, j);
+        return { range: new mt(q, se), from: R, to: V, fromWithoutScroll: L, toWithoutScroll: j, move: T };
       });
       f.sort(kht(Ba((T) => T.fromWithoutScroll > T.toWithoutScroll, Oht), Ba((T) => T.fromWithoutScroll > T.toWithoutScroll ? T.fromWithoutScroll : -T.toWithoutScroll, Dd)));
       const w = PO.compute(f.map((T) => T.range)), v = 10, C = m.verticalScrollbarWidth, D = (w.getTrackCount() - 1) * 10 + v * 2, N = C + D + (A.contentLeft - x1.movedCodeBlockPadding);
       let z = 0;
       for (const T of f) {
-        const L = w.getTrack(z), S = C + v + L * 10, _ = 15, j = 15, O = N, R = A.glyphMarginWidth + A.lineNumbersWidth, V = 18, q = document.createElementNS("http://www.w3.org/2000/svg", "rect");
+        const S = w.getTrack(z), L = C + v + S * 10, _ = 15, j = 15, O = N, R = A.glyphMarginWidth + A.lineNumbersWidth, V = 18, q = document.createElementNS("http://www.w3.org/2000/svg", "rect");
         q.classList.add("arrow-rectangle"), q.setAttribute("x", `${O - R}`), q.setAttribute("y", `${T.to - V / 2}`), q.setAttribute("width", `${R}`), q.setAttribute("height", `${V}`), this._element.appendChild(q);
         const se = document.createElementNS("http://www.w3.org/2000/svg", "g"), ue = document.createElementNS("http://www.w3.org/2000/svg", "path");
-        ue.setAttribute("d", `M 0 ${T.from} L ${S} ${T.from} L ${S} ${T.to} L ${O - j} ${T.to}`), ue.setAttribute("fill", "none"), se.appendChild(ue);
+        ue.setAttribute("d", `M 0 ${T.from} L ${L} ${T.from} L ${L} ${T.to} L ${O - j} ${T.to}`), ue.setAttribute("fill", "none"), se.appendChild(ue);
         const me = document.createElementNS("http://www.w3.org/2000/svg", "polygon");
         me.classList.add("arrow"), d.add(en((ce) => {
           ue.classList.toggle("currentMove", T.move === h.activeMovedText.read(ce)), me.classList.toggle("currentMove", T.move === h.activeMovedText.read(ce));
@@ -111099,8 +111098,8 @@ class u8e extends SO {
           /* EditorOption.lineHeight */
         )), z = Math.max(0, Math.min(m - N, this._unchangedRegion.getMaxVisibleLineCountBottom())), T = this._unchangedRegionRange.endLineNumberExclusive > u.getModel().getLineCount() ? u.getContentHeight() : u.getTopForLineNumber(this._unchangedRegionRange.endLineNumberExclusive);
         this._unchangedRegion.visibleLineCountBottom.set(z, void 0);
-        const L = this._unchangedRegionRange.endLineNumberExclusive > u.getModel().getLineCount() ? u.getContentHeight() : u.getTopForLineNumber(this._unchangedRegionRange.endLineNumberExclusive);
-        u.setScrollTop(u.getScrollTop() + (L - T));
+        const S = this._unchangedRegionRange.endLineNumberExclusive > u.getModel().getLineCount() ? u.getContentHeight() : u.getTopForLineNumber(this._unchangedRegionRange.endLineNumberExclusive);
+        u.setScrollTop(u.getScrollTop() + (S - T));
       }), w = le(A, "mouseup", (v) => {
         if (this._unchangedRegion.isDragged.set(void 0, void 0), !g) {
           const C = u.getTopForLineNumber(this._unchangedRegionRange.endLineNumberExclusive);
@@ -111183,23 +111182,23 @@ let jy = class extends he {
       g.add(en((N) => {
         w.read(N), v.read(N), C.read(N), D.read(N);
         const z = p.read(N), T = m?.diff.read(N)?.mappings;
-        function L(j, O, R) {
+        function S(j, O, R) {
           const V = R._getViewModel();
           return V ? j.filter((q) => q.length > 0).map((q) => {
             const se = V.coordinatesConverter.convertModelPositionToViewPosition(new ne(q.startLineNumber, 1)), ue = V.coordinatesConverter.convertModelPositionToViewPosition(new ne(q.endLineNumberExclusive, 1)), me = ue.lineNumber - se.lineNumber;
             return new _Te(se.lineNumber, ue.lineNumber, me, O.toString());
           }) : [];
         }
-        const S = L((T || []).map((j) => j.lineRangeMapping.original), z.removeColor, this._editors.original), _ = L((T || []).map((j) => j.lineRangeMapping.modified), z.insertColor, this._editors.modified);
-        A?.setZones(S), f?.setZones(_);
+        const L = S((T || []).map((j) => j.lineRangeMapping.original), z.removeColor, this._editors.original), _ = S((T || []).map((j) => j.lineRangeMapping.modified), z.insertColor, this._editors.modified);
+        A?.setZones(L), f?.setZones(_);
       })), g.add(en((N) => {
-        const z = this._rootHeight.read(N), T = this._rootWidth.read(N), L = this._modifiedEditorLayoutInfo.read(N);
-        if (L) {
-          const S = pl.ENTIRE_DIFF_OVERVIEW_WIDTH - 2 * pl.ONE_OVERVIEW_WIDTH;
+        const z = this._rootHeight.read(N), T = this._rootWidth.read(N), S = this._modifiedEditorLayoutInfo.read(N);
+        if (S) {
+          const L = pl.ENTIRE_DIFF_OVERVIEW_WIDTH - 2 * pl.ONE_OVERVIEW_WIDTH;
           A.setLayout({
             top: 0,
             height: z,
-            right: S + pl.ONE_OVERVIEW_WIDTH,
+            right: L + pl.ONE_OVERVIEW_WIDTH,
             width: pl.ONE_OVERVIEW_WIDTH
           }), f.setLayout({
             top: 0,
@@ -111210,7 +111209,7 @@ let jy = class extends he {
           const _ = this._editors.modifiedScrollTop.read(N), j = this._editors.modifiedScrollHeight.read(N), O = this._editors.modified.getOption(
             104
             /* EditorOption.scrollbar */
-          ), R = new H2(O.verticalHasArrows ? O.arrowSize : 0, O.verticalScrollbarSize, 0, L.height, j, _);
+          ), R = new H2(O.verticalHasArrows ? O.arrowSize : 0, O.verticalScrollbarSize, 0, S.height, j, _);
           u.setTop(R.getSliderPosition()), u.setHeight(R.getSliderSize());
         } else
           u.setTop(0), u.setHeight(0);
@@ -111622,17 +111621,17 @@ let cw = class extends HO {
     ]), this._diffModelSrc = this._register(Qze(this, void 0)), this._diffModel = ct(this, (D) => this._diffModelSrc.read(D)?.object), this.onDidChangeModel = we.fromObservableLight(this._diffModel), this._contextKeyService = this._register(this._parentContextKeyService.createScoped(this._domElement)), this._instantiationService = this._register(this._parentInstantiationService.createChild(new kb([tn, this._contextKeyService]))), this._boundarySashes = qt(this, void 0), this._accessibleDiffViewerShouldBeVisible = qt(this, !1), this._accessibleDiffViewerVisible = ct(this, (D) => this._options.onlyShowAccessibleDiffViewer.read(D) ? !0 : this._accessibleDiffViewerShouldBeVisible.read(D)), this._movedBlocksLinesPart = qt(this, void 0), this._layoutInfo = ct(this, (D) => {
       const N = this._rootSizeObserver.width.read(D), z = this._rootSizeObserver.height.read(D);
       this._rootSizeObserver.automaticLayout ? this.elements.root.style.height = "100%" : this.elements.root.style.height = z + "px";
-      const T = this._sash.read(D), L = this._gutter.read(D), S = L?.width.read(D) ?? 0, _ = this._overviewRulerPart.read(D)?.width ?? 0;
+      const T = this._sash.read(D), S = this._gutter.read(D), L = S?.width.read(D) ?? 0, _ = this._overviewRulerPart.read(D)?.width ?? 0;
       let j, O, R, V, q;
       if (!!T) {
         const ue = T.sashLeft.read(D), me = this._movedBlocksLinesPart.read(D)?.width.read(D) ?? 0;
-        j = 0, O = ue - S - me, q = ue - S, R = ue, V = N - R - _;
+        j = 0, O = ue - L - me, q = ue - L, R = ue, V = N - R - _;
       } else {
         q = 0;
         const ue = this._options.inlineViewHideOriginalLineNumbers.read(D);
-        j = S, ue ? O = 0 : O = Math.max(5, this._editors.originalObs.layoutInfoDecorationsLeft.read(D)), R = S + O, V = N - R - _;
+        j = L, ue ? O = 0 : O = Math.max(5, this._editors.originalObs.layoutInfoDecorationsLeft.read(D)), R = L + O, V = N - R - _;
       }
-      return this.elements.original.style.left = j + "px", this.elements.original.style.width = O + "px", this._editors.original.layout({ width: O, height: z }, !0), L?.layout(q), this.elements.modified.style.left = R + "px", this.elements.modified.style.width = V + "px", this._editors.modified.layout({ width: V, height: z }, !0), {
+      return this.elements.original.style.left = j + "px", this.elements.original.style.width = O + "px", this._editors.original.layout({ width: O, height: z }, !0), S?.layout(q), this.elements.modified.style.left = R + "px", this.elements.modified.style.width = V + "px", this._editors.modified.layout({ width: V, height: z }, !0), {
         modifiedEditor: this._editors.modified.getLayoutInfo(),
         originalEditor: this._editors.original.getLayoutInfo()
       };
@@ -111696,7 +111695,7 @@ let cw = class extends HO {
       const z = this._diffModel.read(D);
       if (z)
         for (const T of [z.model.original, z.model.modified])
-          N.add(T.onWillDispose((L) => {
+          N.add(T.onWillDispose((S) => {
             gn(new rn("TextModel got disposed before DiffEditorWidget model got reset")), this.setModel(null);
           }));
     })), this._register(en((D) => {
@@ -116637,9 +116636,9 @@ const kzt = ge.div`
       isDirty: D,
       setEditedValue: N,
       resetPrefill: z
-    } = mLe(s, Fe.processId), { authType: T } = Fe, L = ws(null);
+    } = mLe(s, Fe.processId), { authType: T } = Fe, S = ws(null);
     return Qt(() => {
-      v && L.current?.hideMarkers();
+      v && S.current?.hideMarkers();
     }, [v]), /* @__PURE__ */ E.jsx(
       mg,
       {
@@ -116657,7 +116656,7 @@ const kzt = ge.div`
         onClose: n,
         onSubmit: async () => {
           n();
-          const S = await a.publishMessage?.({
+          const L = await a.publishMessage?.({
             messageName: p,
             correlationKey: d,
             variables: w,
@@ -116665,7 +116664,7 @@ const kzt = ge.div`
             messageId: A,
             isStartEvent: r
           });
-          if (S?.status === Rl) {
+          if (L?.status === Rl) {
             a.displayNotification?.error(
               {
                 title: ep,
@@ -116675,7 +116674,7 @@ const kzt = ge.div`
             );
             return;
           }
-          S?.success ? (S?.success && l !== void 0 && ms(ao(l.key), {
+          L?.success ? (L?.success && l !== void 0 && ms(ao(l.key), {
             action: "publishMessage",
             elementId: i,
             messageName: p,
@@ -116722,11 +116721,11 @@ const kzt = ge.div`
                 value: w,
                 isVisible: o,
                 placeholder: kL,
-                onChange: (S) => {
-                  N(S ?? "");
+                onChange: (L) => {
+                  N(L ?? "");
                 },
-                onMount: (S) => {
-                  L.current = S;
+                onMount: (L) => {
+                  S.current = L;
                 },
                 hasJSONObjectValidation: !0
               }
@@ -116740,8 +116739,8 @@ const kzt = ge.div`
                 labelText: "Message name",
                 placeholder: "new order",
                 value: p,
-                onChange: (S) => {
-                  u(S.target.value);
+                onChange: (L) => {
+                  u(L.target.value);
                 }
               }
             ),
@@ -116752,8 +116751,8 @@ const kzt = ge.div`
                 labelText: "Message correlation key",
                 placeholder: "order-key-123",
                 value: d,
-                onChange: (S) => {
-                  h(S.target.value);
+                onChange: (L) => {
+                  h(L.target.value);
                 }
               }
             )
@@ -116765,8 +116764,8 @@ const kzt = ge.div`
               labelText: "Message ID",
               placeholder: "tracking-id-123",
               value: A,
-              onChange: (S) => {
-                f(S.target.value);
+              onChange: (L) => {
+                f(L.target.value);
               }
             }
           ),
@@ -116777,8 +116776,8 @@ const kzt = ge.div`
               labelText: "Message time-to-live (TTL)",
               placeholder: "PT5M",
               value: g,
-              onChange: (S) => {
-                m(S.target.value);
+              onChange: (L) => {
+                m(L.target.value);
               },
               helperText: "Time duration defined as ISO 8601 durations format"
             }
@@ -117086,11 +117085,11 @@ function Pzt({
   formPrefillSettings: t = { sanitizePrefillData: !1 }
 }) {
   const [n, i] = it(!1), [r, s] = it("none"), [a, l] = it(""), [p, u] = it(!1), [d, h] = it(!1), g = ws(null), m = ws(), A = Ri(
-    (T, L) => {
-      const { cachedVariables: S, variablesFromExampleData: _ } = k8e({
+    (T, S) => {
+      const { cachedVariables: L, variablesFromExampleData: _ } = k8e({
         element: o,
         processId: Fe.processId
-      }), j = L === "bpmn" && od(T, _), O = L === "cache" && od(T, S);
+      }), j = S === "bpmn" && od(T, _), O = S === "cache" && od(T, L);
       return j || O;
     },
     [o]
@@ -117104,8 +117103,8 @@ function Pzt({
     );
   }, [a, r, A]);
   const f = Ri(
-    ({ data: T, errors: L }) => {
-      u(Object.keys(L).length === 0), l(JSON.stringify(T));
+    ({ data: T, errors: S }) => {
+      u(Object.keys(S).length === 0), l(JSON.stringify(T));
     },
     []
   ), w = Ri(async () => {
@@ -117120,26 +117119,26 @@ function Pzt({
       }
       T = _.reduce((O, { name: R, value: V }) => (O[R] = JSON.parse(V), O), {});
     }
-    const { cachedVariables: L, variablesFromExampleData: S } = k8e(
+    const { cachedVariables: S, variablesFromExampleData: L } = k8e(
       {
         element: o,
         processId: Fe.processId
       }
     );
     return {
-      variablesFromExampleData: S,
-      cachedVariables: L,
+      variablesFromExampleData: L,
+      cachedVariables: S,
       processVariables: T
     };
   }, [o, t]), v = Ri(async () => {
     let T = {};
-    const L = await e();
-    if (L === void 0) {
+    const S = await e();
+    if (S === void 0) {
       i(!0);
       return;
     }
     try {
-      T = JSON.parse(L ?? "{}");
+      T = JSON.parse(S ?? "{}");
     } catch {
       i(!0);
       return;
@@ -117148,19 +117147,19 @@ function Pzt({
   }, [e]), C = Ri(
     async ({
       ignoreCachedVariables: T = !1,
-      parsedForm: L
+      parsedForm: S
     } = {
       ignoreCachedVariables: !1,
       parsedForm: void 0
     }) => {
-      const S = await w();
-      if (!S)
+      const L = await w();
+      if (!L)
         return;
-      const { variablesFromExampleData: _, cachedVariables: j, processVariables: O } = S, R = {
+      const { variablesFromExampleData: _, cachedVariables: j, processVariables: O } = L, R = {
         ..._,
         ...T ? {} : j,
         ...O
-      }, V = t.sanitizePrefillData ? Rzt(VRe(L), R) : R;
+      }, V = t.sanitizePrefillData ? Rzt(VRe(S), R) : R;
       let q = "none";
       return od(V, _) ? q = "bpmn" : !T && od(V, j) && (q = "cache"), s(q), l(JSON.stringify(V)), V;
     },
@@ -117169,15 +117168,15 @@ function Pzt({
     async ({
       ignoreCachedVariables: T = !1
     } = { ignoreCachedVariables: !1 }) => {
-      const L = await v();
-      if (L === void 0)
+      const S = await v();
+      if (S === void 0)
         return;
-      const S = await C({
-        parsedForm: L,
+      const L = await C({
+        parsedForm: S,
         ignoreCachedVariables: T
       }), { warnings: _ } = await m.current?.importSchema(
-        L,
-        S
+        S,
+        L
       ) ?? { warnings: [] };
       u(_.length === 0);
     },
@@ -117248,58 +117247,65 @@ const MLe = ({
   dataTestId: a,
   formPrefillSettings: l
 }) => {
-  const {
-    renderForm: p,
-    resetForm: u,
-    isDirty: d,
-    isFormContentValid: h,
-    originalPrefillSource: g,
-    setOriginalPrefillSource: m,
-    formVariables: A,
-    hasFormLoadError: f,
-    setHasFormLoadError: w,
-    formContainerRef: v,
-    taskForm: C
+  const [p, u] = it(!1), {
+    renderForm: d,
+    resetForm: h,
+    isDirty: g,
+    isFormContentValid: m,
+    originalPrefillSource: A,
+    setOriginalPrefillSource: f,
+    formVariables: w,
+    hasFormLoadError: v,
+    setHasFormLoadError: C,
+    formContainerRef: D,
+    taskForm: N
   } = Pzt({
     element: e,
     formPrefillSettings: l,
     getFormBody: i
   });
   Qt(() => {
-    if (!o && C.current) {
-      C.current.detach(), C.current = void 0;
+    if (!o && N.current) {
+      N.current.detach(), N.current = void 0;
       return;
     }
-    !o || !v.current || C.current || p();
-  }, [p, o, v, C]);
-  async function D(z) {
-    if (z.size === 0)
+    !o || !D.current || N.current || d();
+  }, [d, o, D, N]);
+  async function z(S) {
+    if (S.size === 0)
       return /* @__PURE__ */ new Map();
-    const { response: T, success: L } = await gt.uploadDocuments({
-      files: z
+    const { response: L, success: _ } = await gt.uploadDocuments({
+      files: S
     });
-    if (!L)
+    if (!_)
       return console.error("Failed to upload documents"), /* @__PURE__ */ new Map();
-    const S = /* @__PURE__ */ new Map();
-    return T.forEach((_) => {
-      const j = _.metadata.customProperties?.[y7e];
-      if (typeof j != "string" || j.length === 0)
+    const j = /* @__PURE__ */ new Map();
+    return L.forEach((O) => {
+      const R = O.metadata.customProperties?.[y7e];
+      if (typeof R != "string" || R.length === 0)
         return;
-      const O = S.get(j);
-      Array.isArray(O) ? S.set(j, [...O, _]) : S.set(j, [_]);
-    }), S;
-  }
-  async function N() {
-    const { data: z, errors: T, files: L } = C.current?.submit() ?? {
-      data: {},
-      errors: {},
-      files: /* @__PURE__ */ new Map()
-    }, S = L.size === 0 ? z : Bzt({
-      data: z,
-      fileMetadata: await D(L),
-      pathsToInject: Hzt(z)
-    });
-    Object.keys(T).length === 0 && n(S);
+      const V = j.get(R);
+      Array.isArray(V) ? j.set(R, [...V, O]) : j.set(R, [O]);
+    }), j;
+  }
+  async function T() {
+    u(!0);
+    try {
+      const { data: S, errors: L, files: _ } = N.current?.submit() ?? {
+        data: {},
+        errors: {},
+        files: /* @__PURE__ */ new Map()
+      }, j = _.size === 0 ? S : Bzt({
+        data: S,
+        fileMetadata: await z(_),
+        pathsToInject: Hzt(S)
+      });
+      Object.keys(L).length === 0 && n(j);
+    } catch (S) {
+      console.error(S);
+    } finally {
+      u(!1);
+    }
   }
   return /* @__PURE__ */ E.jsx(
     mg,
@@ -117309,26 +117315,27 @@ const MLe = ({
       isVisible: o,
       dataTestId: a,
       primaryButtonLabel: r,
+      isPrimaryButtonDisabled: !m || p,
       secondaryButton: {
         label: "Close",
         onClick: t
       },
       onClose: t,
-      onSubmit: N,
+      onSubmit: T,
       ghostButton: {
         label: "Reset",
-        onClick: u
+        onClick: h
       },
       modalBody: /* @__PURE__ */ E.jsxs(E.Fragment, { children: [
         /* @__PURE__ */ E.jsxs(ii, { gap: 5, children: [
           /* @__PURE__ */ E.jsx(
             _v,
             {
-              isValid: h,
-              editedValue: A,
+              isValid: m,
+              editedValue: w,
               element: e,
               onSuccess: () => {
-                m("bpmn");
+                f("bpmn");
               },
               tooltipTextForInvalid: "Please enter valid data to save"
             }
@@ -117336,12 +117343,12 @@ const MLe = ({
           /* @__PURE__ */ E.jsx(
             Rv,
             {
-              originalSource: g,
-              isDescriptionVisible: !d
+              originalSource: A,
+              isDescriptionVisible: !g
             }
           )
         ] }),
-        f && /* @__PURE__ */ E.jsxs(_zt, { children: [
+        v && /* @__PURE__ */ E.jsxs(_zt, { children: [
           "We were unable to load the form",
           /* @__PURE__ */ E.jsx(
             so,
@@ -117350,13 +117357,13 @@ const MLe = ({
               size: "sm",
               renderIcon: oNe,
               onClick: () => {
-                w(!1), p();
+                C(!1), d();
               },
               children: "Retry"
             }
           )
         ] }),
-        /* @__PURE__ */ E.jsx("div", { ref: v })
+        /* @__PURE__ */ E.jsx("div", { ref: D })
       ] })
     }
   );
@@ -120672,7 +120679,7 @@ function _g(o, e, t, n, i, r, s) {
       return z(H)(x, k, Y);
     };
   }
-  var L = {
+  var S = {
     "bpmn:MessageEventDefinition": function(H, x, k = {}, Y) {
       var W = n.getScaledPath("EVENT_MESSAGE", {
         xScaleFactor: 0.9,
@@ -120890,9 +120897,9 @@ function _g(o, e, t, n, i, r, s) {
       return Y;
     }
   };
-  function S(H, x, k = {}, Y) {
+  function L(H, x, k = {}, Y) {
     var W = wn(H), ie = hxt(W), je = Y || H;
-    return W.get("eventDefinitions") && W.get("eventDefinitions").length > 1 ? W.get("parallelMultiple") ? L["bpmn:ParallelMultipleEventDefinition"](x, je, k, ie) : L["bpmn:MultipleEventDefinition"](x, je, k, ie) : uc(W, "bpmn:MessageEventDefinition") ? L["bpmn:MessageEventDefinition"](x, je, k, ie) : uc(W, "bpmn:TimerEventDefinition") ? L["bpmn:TimerEventDefinition"](x, je, k, ie) : uc(W, "bpmn:ConditionalEventDefinition") ? L["bpmn:ConditionalEventDefinition"](x, je, k, ie) : uc(W, "bpmn:SignalEventDefinition") ? L["bpmn:SignalEventDefinition"](x, je, k, ie) : uc(W, "bpmn:EscalationEventDefinition") ? L["bpmn:EscalationEventDefinition"](x, je, k, ie) : uc(W, "bpmn:LinkEventDefinition") ? L["bpmn:LinkEventDefinition"](x, je, k, ie) : uc(W, "bpmn:ErrorEventDefinition") ? L["bpmn:ErrorEventDefinition"](x, je, k, ie) : uc(W, "bpmn:CancelEventDefinition") ? L["bpmn:CancelEventDefinition"](x, je, k, ie) : uc(W, "bpmn:CompensateEventDefinition") ? L["bpmn:CompensateEventDefinition"](x, je, k, ie) : uc(W, "bpmn:TerminateEventDefinition") ? L["bpmn:TerminateEventDefinition"](x, je, k, ie) : null;
+    return W.get("eventDefinitions") && W.get("eventDefinitions").length > 1 ? W.get("parallelMultiple") ? S["bpmn:ParallelMultipleEventDefinition"](x, je, k, ie) : S["bpmn:MultipleEventDefinition"](x, je, k, ie) : uc(W, "bpmn:MessageEventDefinition") ? S["bpmn:MessageEventDefinition"](x, je, k, ie) : uc(W, "bpmn:TimerEventDefinition") ? S["bpmn:TimerEventDefinition"](x, je, k, ie) : uc(W, "bpmn:ConditionalEventDefinition") ? S["bpmn:ConditionalEventDefinition"](x, je, k, ie) : uc(W, "bpmn:SignalEventDefinition") ? S["bpmn:SignalEventDefinition"](x, je, k, ie) : uc(W, "bpmn:EscalationEventDefinition") ? S["bpmn:EscalationEventDefinition"](x, je, k, ie) : uc(W, "bpmn:LinkEventDefinition") ? S["bpmn:LinkEventDefinition"](x, je, k, ie) : uc(W, "bpmn:ErrorEventDefinition") ? S["bpmn:ErrorEventDefinition"](x, je, k, ie) : uc(W, "bpmn:CancelEventDefinition") ? S["bpmn:CancelEventDefinition"](x, je, k, ie) : uc(W, "bpmn:CompensateEventDefinition") ? S["bpmn:CompensateEventDefinition"](x, je, k, ie) : uc(W, "bpmn:TerminateEventDefinition") ? S["bpmn:TerminateEventDefinition"](x, je, k, ie) : null;
   }
   var _ = {
     ParticipantMultiplicityMarker: function(H, x, k = {}) {
@@ -121227,7 +121234,7 @@ function _g(o, e, t, n, i, r, s) {
       strokeWidth: Dt,
       strokeDasharray: pt,
       transform: Yo
-    }), S(H, x, ie, Y);
+    }), L(H, x, ie, Y);
   }
   function Se(H, x, k = {}) {
     var Y = ue(H, x, k);
@@ -121268,7 +121275,7 @@ function _g(o, e, t, n, i, r, s) {
       return A(H, x.width, x.height, M4, {
         ...k,
         fill: "none"
-      }), Y && S(x, H, k), je;
+      }), Y && L(x, H, k), je;
     },
     "bpmn:BusinessRuleTask": function(H, x, k = {}) {
       k = dn(k, [
@@ -121409,7 +121416,7 @@ function _g(o, e, t, n, i, r, s) {
         ...k,
         strokeWidth: 4
       });
-      return Y && S(x, H, k), W;
+      return Y && L(x, H, k), W;
     },
     "bpmn:EventBasedGateway": function(H, x, k = {}) {
       k = dn(k, [
@@ -121532,7 +121539,7 @@ function _g(o, e, t, n, i, r, s) {
         fill: "none",
         stroke: We(x, l, k.stroke),
         strokeWidth: 1.5
-      }), Y && S(x, H, k), W;
+      }), Y && L(x, H, k), W;
     },
     "bpmn:IntermediateCatchEvent": T("bpmn:IntermediateEvent"),
     "bpmn:IntermediateThrowEvent": T("bpmn:IntermediateEvent"),
@@ -121804,7 +121811,7 @@ function _g(o, e, t, n, i, r, s) {
         strokeDasharray: "6"
       });
       var ie = oe(H, x, k);
-      return Y && S(x, H, k), ie;
+      return Y && L(x, H, k), ie;
     },
     "bpmn:SubProcess": function(H, x, k = {}) {
       return Sh(x) ? k = dn(k, [
@@ -123223,23 +123230,23 @@ function v4(o) {
 var G8e = 500;
 function dxe(o, e, t) {
   var n = this;
-  function i(L, S, _) {
-    if (!a(L, S)) {
+  function i(S, L, _) {
+    if (!a(S, L)) {
       var j, O, R;
-      _ ? O = e.getGraphics(_) : (j = S.delegateTarget || S.target, j && (O = j, _ = e.get(O))), !(!O || !_) && (R = o.fire(L, {
+      _ ? O = e.getGraphics(_) : (j = L.delegateTarget || L.target, j && (O = j, _ = e.get(O))), !(!O || !_) && (R = o.fire(S, {
         element: _,
         gfx: O,
-        originalEvent: S
-      }), R === !1 && (S.stopPropagation(), S.preventDefault()));
+        originalEvent: L
+      }), R === !1 && (L.stopPropagation(), L.preventDefault()));
     }
   }
   var r = {};
-  function s(L) {
-    return r[L];
+  function s(S) {
+    return r[S];
   }
-  function a(L, S) {
-    var _ = p[L] || Vv;
-    return !_(S);
+  function a(S, L) {
+    var _ = p[S] || Vv;
+    return !_(L);
   }
   var l = {
     click: "element.click",
@@ -123257,52 +123264,52 @@ function dxe(o, e, t) {
     "element.click": v4,
     "element.dblclick": v4
   };
-  function u(L, S, _) {
-    var j = l[L];
+  function u(S, L, _) {
+    var j = l[S];
     if (!j)
-      throw new Error("unmapped DOM event name <" + L + ">");
-    return i(j, S, _);
+      throw new Error("unmapped DOM event name <" + S + ">");
+    return i(j, L, _);
   }
   var d = "svg, .djs-element";
-  function h(L, S, _, j) {
+  function h(S, L, _, j) {
     var O = r[_] = function(R) {
       i(_, R);
     };
-    j && (p[_] = j), O.$delegate = oS.bind(L, d, S, O);
+    j && (p[_] = j), O.$delegate = oS.bind(S, d, L, O);
   }
-  function g(L, S, _) {
+  function g(S, L, _) {
     var j = s(_);
-    j && oS.unbind(L, S, j.$delegate);
+    j && oS.unbind(S, L, j.$delegate);
   }
-  function m(L) {
-    ln(l, function(S, _) {
-      h(L, _, S);
+  function m(S) {
+    ln(l, function(L, _) {
+      h(S, _, L);
     });
   }
-  function A(L) {
-    ln(l, function(S, _) {
-      g(L, _, S);
+  function A(S) {
+    ln(l, function(L, _) {
+      g(S, _, L);
     });
   }
-  o.on("canvas.destroy", function(L) {
-    A(L.svg);
-  }), o.on("canvas.init", function(L) {
-    m(L.svg);
-  }), o.on(["shape.added", "connection.added"], function(L) {
-    var S = L.element, _ = L.gfx;
-    o.fire("interactionEvents.createHit", { element: S, gfx: _ });
+  o.on("canvas.destroy", function(S) {
+    A(S.svg);
+  }), o.on("canvas.init", function(S) {
+    m(S.svg);
+  }), o.on(["shape.added", "connection.added"], function(S) {
+    var L = S.element, _ = S.gfx;
+    o.fire("interactionEvents.createHit", { element: L, gfx: _ });
   }), o.on([
     "shape.changed",
     "connection.changed"
-  ], G8e, function(L) {
-    var S = L.element, _ = L.gfx;
-    o.fire("interactionEvents.updateHit", { element: S, gfx: _ });
-  }), o.on("interactionEvents.createHit", G8e, function(L) {
-    var S = L.element, _ = L.gfx;
-    n.createDefaultHit(S, _);
-  }), o.on("interactionEvents.updateHit", function(L) {
-    var S = L.element, _ = L.gfx;
-    n.updateDefaultHit(S, _);
+  ], G8e, function(S) {
+    var L = S.element, _ = S.gfx;
+    o.fire("interactionEvents.updateHit", { element: L, gfx: _ });
+  }), o.on("interactionEvents.createHit", G8e, function(S) {
+    var L = S.element, _ = S.gfx;
+    n.createDefaultHit(L, _);
+  }), o.on("interactionEvents.updateHit", function(S) {
+    var L = S.element, _ = S.gfx;
+    n.updateDefaultHit(L, _);
   });
   var f = N("djs-hit djs-hit-stroke"), w = N("djs-hit djs-hit-click-stroke"), v = N("djs-hit djs-hit-all"), C = N("djs-hit djs-hit-no-move"), D = {
     all: v,
@@ -123310,46 +123317,46 @@ function dxe(o, e, t) {
     stroke: f,
     "no-move": C
   };
-  function N(L, S) {
-    return S = vt({
+  function N(S, L) {
+    return L = vt({
       stroke: "white",
       strokeWidth: 15
-    }, S || {}), t.cls(L, ["no-fill", "no-border"], S);
+    }, L || {}), t.cls(S, ["no-fill", "no-border"], L);
   }
-  function z(L, S) {
-    var _ = D[S];
+  function z(S, L) {
+    var _ = D[L];
     if (!_)
-      throw new Error("invalid hit type <" + S + ">");
-    return fi(L, _), L;
-  }
-  function T(L, S) {
-    ta(L, S);
-  }
-  this.removeHits = function(L) {
-    var S = WLe(".djs-hit", L);
-    ln(S, qb);
-  }, this.createDefaultHit = function(L, S) {
-    var _ = L.waypoints, j = L.isFrame, O;
-    return _ ? this.createWaypointsHit(S, _) : (O = j ? "stroke" : "all", this.createBoxHit(S, O, {
-      width: L.width,
-      height: L.height
+      throw new Error("invalid hit type <" + L + ">");
+    return fi(S, _), S;
+  }
+  function T(S, L) {
+    ta(S, L);
+  }
+  this.removeHits = function(S) {
+    var L = WLe(".djs-hit", S);
+    ln(L, qb);
+  }, this.createDefaultHit = function(S, L) {
+    var _ = S.waypoints, j = S.isFrame, O;
+    return _ ? this.createWaypointsHit(L, _) : (O = j ? "stroke" : "all", this.createBoxHit(L, O, {
+      width: S.width,
+      height: S.height
     }));
-  }, this.createWaypointsHit = function(L, S) {
-    var _ = ej(S);
-    return z(_, "stroke"), T(L, _), _;
-  }, this.createBoxHit = function(L, S, _) {
+  }, this.createWaypointsHit = function(S, L) {
+    var _ = ej(L);
+    return z(_, "stroke"), T(S, _), _;
+  }, this.createBoxHit = function(S, L, _) {
     _ = vt({
       x: 0,
       y: 0
     }, _);
     var j = Nr("rect");
-    return z(j, S), fi(j, _), T(L, j), j;
-  }, this.updateDefaultHit = function(L, S) {
-    var _ = Uo(".djs-hit", S);
+    return z(j, L), fi(j, _), T(S, j), j;
+  }, this.updateDefaultHit = function(S, L) {
+    var _ = Uo(".djs-hit", L);
     if (_)
-      return L.waypoints ? VLe(_, L.waypoints) : fi(_, {
-        width: L.width,
-        height: L.height
+      return S.waypoints ? VLe(_, S.waypoints) : fi(_, {
+        width: S.width,
+        height: S.height
       }), _;
   }, this.fire = i, this.triggerMouseEvent = u, this.mouseHandler = s, this.registerEvent = h, this.unregisterEvent = g;
 }
@@ -123567,10 +123574,10 @@ function Axe(o, e) {
   }
   function g(C, D) {
     if (D && D.length) {
-      const N = /* @__PURE__ */ Object.create(null), z = /* @__PURE__ */ Object.create(null), T = [], L = [], S = [];
+      const N = /* @__PURE__ */ Object.create(null), z = /* @__PURE__ */ Object.create(null), T = [], S = [], L = [];
       let _, j, O, R;
       for (let V in i)
-        _ = i[V], D.indexOf(V) !== -1 && (_[2] === "private" ? (j = T.indexOf(_[3]), j === -1 ? (O = _[3].createChild([], D), R = h(O), T.push(_[3]), L.push(O), S.push(R), N[V] = [R, V, "private", O]) : N[V] = [S[j], V, "private", L[j]]) : N[V] = [_[2], _[1]], z[V] = !0), (_[2] === "factory" || _[2] === "type") && _[1].$scope && D.forEach((q) => {
+        _ = i[V], D.indexOf(V) !== -1 && (_[2] === "private" ? (j = T.indexOf(_[3]), j === -1 ? (O = _[3].createChild([], D), R = h(O), T.push(_[3]), S.push(O), L.push(R), N[V] = [R, V, "private", O]) : N[V] = [L[j], V, "private", S[j]]) : N[V] = [_[2], _[1]], z[V] = !0), (_[2] === "factory" || _[2] === "type") && _[1].$scope && D.forEach((q) => {
           _[1].$scope.indexOf(q) !== -1 && (N[V] = [_[2], _[1]], z[q] = !0);
         });
       D.forEach((V) => {
@@ -123598,18 +123605,18 @@ function Axe(o, e) {
   function f(C) {
     const D = C.__exports__;
     if (D) {
-      const N = C.__modules__, z = Object.keys(C).reduce((j, O) => (O !== "__exports__" && O !== "__modules__" && O !== "__init__" && O !== "__depends__" && (j[O] = C[O]), j), /* @__PURE__ */ Object.create(null)), T = (N || []).concat(z), L = g(T), S = VM(function(j) {
-        return L.get(j);
+      const N = C.__modules__, z = Object.keys(C).reduce((j, O) => (O !== "__exports__" && O !== "__modules__" && O !== "__init__" && O !== "__depends__" && (j[O] = C[O]), j), /* @__PURE__ */ Object.create(null)), T = (N || []).concat(z), S = g(T), L = VM(function(j) {
+        return S.get(j);
       });
       D.forEach(function(j) {
-        i[j] = [S, j, "private", L];
+        i[j] = [L, j, "private", S];
       });
       const _ = (C.__init__ || []).slice();
       return _.unshift(function() {
-        L.init();
+        S.init();
       }), C = Object.assign({}, C, {
         __init__: _
-      }), A(C, L);
+      }), A(C, S);
     }
     return Object.keys(C).forEach(function(N) {
       if (N === "__init__" || N === "__depends__")
@@ -123622,8 +123629,8 @@ function Axe(o, e) {
         i[N] = z;
         return;
       }
-      const T = z[0], L = z[1];
-      i[N] = [m[T], lOt(T, L), T];
+      const T = z[0], S = z[1];
+      i[N] = [m[T], lOt(T, S), T];
     }), A(C, s);
   }
   function w(C, D) {
@@ -124684,7 +124691,7 @@ function OOt(o) {
       F = t.shift(), F();
   };
   function f(G, F) {
-    ue(G, F), S(G.ioSpecification, F), L(G.artifacts, F), r(G);
+    ue(G, F), L(G.ioSpecification, F), S(G.artifacts, F), r(G);
   }
   function w(G, F) {
     var be = ZN(G, function(Se) {
@@ -124710,22 +124717,22 @@ function OOt(o) {
   function T(G, F) {
     p(G, F);
   }
-  function L(G, F) {
+  function S(G, F) {
     ln(G, function(be) {
       _r(be, "bpmn:Association") ? t.push(function() {
         T(be, F);
       }) : T(be, F);
     });
   }
-  function S(G, F) {
+  function L(G, F) {
     G && (ln(G.dataInputs, i(N, F)), ln(G.dataOutputs, i(z, F)));
   }
   var _ = this.handleSubProcess = function(F, be) {
-    ue(F, be), L(F.artifacts, be);
+    ue(F, be), S(F.artifacts, be);
   };
   function j(G, F) {
     var be = p(G, F);
-    _r(G, "bpmn:SubProcess") && _(G, be || F), _r(G, "bpmn:Activity") && S(G.ioSpecification, F), t.push(function() {
+    _r(G, "bpmn:SubProcess") && _(G, be || F), _r(G, "bpmn:Activity") && L(G.ioSpecification, F), t.push(function() {
       ln(G.dataInputAssociations, i(D, F)), ln(G.dataOutputAssociations, i(D, F));
     });
   }
@@ -124772,7 +124779,7 @@ function OOt(o) {
   function oe(G, F) {
     ln(G.participants, i(ce, F)), t.push(function() {
       C(G.messageFlows, F);
-    }), L(G.artifacts, F);
+    }), S(G.artifacts, F);
   }
   function pe(G) {
     ln(G.flowNodeRef, function(F) {
@@ -126432,13 +126439,13 @@ function hve(o) {
   return this.l[o.type + !0](ft.event ? ft.event(o) : o);
 }
 function dj(o, e, t, n, i, r, s, a, l, p) {
-  var u, d, h, g, m, A, f, w, v, C, D, N, z, T, L, S = e.type;
+  var u, d, h, g, m, A, f, w, v, C, D, N, z, T, S, L = e.type;
   if (e.constructor !== void 0) return null;
   128 & t.__u && (l = !!(32 & t.__u), r = [a = e.__e = t.__e]), (u = ft.__b) && u(e);
-  e: if (typeof S == "function") try {
-    if (w = e.props, v = (u = S.contextType) && n[u.__c], C = u ? v ? v.props.value : u.__ : n, t.__c ? f = (d = e.__c = t.__c).__ = d.__E : ("prototype" in S && S.prototype.render ? e.__c = d = new S(w, C) : (e.__c = d = new ru(w, C), d.constructor = S, d.render = C_t), v && v.sub(d), d.props = w, d.state || (d.state = {}), d.context = C, d.__n = n, h = d.__d = !0, d.__h = [], d._sb = []), d.__s == null && (d.__s = d.state), S.getDerivedStateFromProps != null && (d.__s == d.state && (d.__s = yd({}, d.__s)), yd(d.__s, S.getDerivedStateFromProps(w, d.__s))), g = d.props, m = d.state, d.__v = e, h) S.getDerivedStateFromProps == null && d.componentWillMount != null && d.componentWillMount(), d.componentDidMount != null && d.__h.push(d.componentDidMount);
+  e: if (typeof L == "function") try {
+    if (w = e.props, v = (u = L.contextType) && n[u.__c], C = u ? v ? v.props.value : u.__ : n, t.__c ? f = (d = e.__c = t.__c).__ = d.__E : ("prototype" in L && L.prototype.render ? e.__c = d = new L(w, C) : (e.__c = d = new ru(w, C), d.constructor = L, d.render = C_t), v && v.sub(d), d.props = w, d.state || (d.state = {}), d.context = C, d.__n = n, h = d.__d = !0, d.__h = [], d._sb = []), d.__s == null && (d.__s = d.state), L.getDerivedStateFromProps != null && (d.__s == d.state && (d.__s = yd({}, d.__s)), yd(d.__s, L.getDerivedStateFromProps(w, d.__s))), g = d.props, m = d.state, d.__v = e, h) L.getDerivedStateFromProps == null && d.componentWillMount != null && d.componentWillMount(), d.componentDidMount != null && d.__h.push(d.componentDidMount);
     else {
-      if (S.getDerivedStateFromProps == null && w !== g && d.componentWillReceiveProps != null && d.componentWillReceiveProps(w, C), !d.__e && (d.shouldComponentUpdate != null && d.shouldComponentUpdate(w, d.__s, C) === !1 || e.__v === t.__v)) {
+      if (L.getDerivedStateFromProps == null && w !== g && d.componentWillReceiveProps != null && d.componentWillReceiveProps(w, C), !d.__e && (d.shouldComponentUpdate != null && d.shouldComponentUpdate(w, d.__s, C) === !1 || e.__v === t.__v)) {
         for (e.__v !== t.__v && (d.props = w, d.state = d.__s, d.__d = !1), e.__e = t.__e, e.__k = t.__k, e.__k.forEach(function(_) {
           _ && (_.__ = e);
         }), D = 0; D < d._sb.length; D++) d.__h.push(d._sb[D]);
@@ -126449,13 +126456,13 @@ function dj(o, e, t, n, i, r, s, a, l, p) {
         d.componentDidUpdate(g, m, A);
       });
     }
-    if (d.context = C, d.props = w, d.__P = o, d.__e = !1, N = ft.__r, z = 0, "prototype" in S && S.prototype.render) {
+    if (d.context = C, d.props = w, d.__P = o, d.__e = !1, N = ft.__r, z = 0, "prototype" in L && L.prototype.render) {
       for (d.state = d.__s, d.__d = !1, N && N(e), u = d.render(d.props, d.state, d.context), T = 0; T < d._sb.length; T++) d.__h.push(d._sb[T]);
       d._sb = [];
     } else do
       d.__d = !1, N && N(e), u = d.render(d.props, d.state, d.context), d.state = d.__s;
     while (d.__d && ++z < 25);
-    d.state = d.__s, d.getChildContext != null && (n = yd(yd({}, n), d.getChildContext())), h || d.getSnapshotBeforeUpdate == null || (A = d.getSnapshotBeforeUpdate(g, m)), $xe(o, qv(L = u != null && u.type === og && u.key == null ? u.props.children : u) ? L : [L], e, t, n, i, r, s, a, l, p), d.base = e.__e, e.__u &= -161, d.__h.length && s.push(d), f && (d.__E = d.__ = null);
+    d.state = d.__s, d.getChildContext != null && (n = yd(yd({}, n), d.getChildContext())), h || d.getSnapshotBeforeUpdate == null || (A = d.getSnapshotBeforeUpdate(g, m)), $xe(o, qv(S = u != null && u.type === og && u.key == null ? u.props.children : u) ? S : [S], e, t, n, i, r, s, a, l, p), d.base = e.__e, e.__u &= -161, d.__h.length && s.push(d), f && (d.__E = d.__ = null);
   } catch (_) {
     e.__v = null, l || r != null ? (e.__e = a, e.__u |= l ? 160 : 32, r[r.indexOf(a)] = null) : (e.__e = t.__e, e.__k = t.__k), ft.__e(_, e, t);
   }
@@ -128007,12 +128014,12 @@ function mj(o) {
 function J_t(o) {
   var e;
   let { buffer: t, nodeSet: n, maxBufferLength: i = dke, reused: r = [], minRepeatType: s = n.types.length } = o, a = Array.isArray(t) ? new gj(t, t.length) : t, l = n.types, p = 0, u = 0;
-  function d(N, z, T, L, S, _) {
+  function d(N, z, T, S, L, _) {
     let { id: j, start: O, end: R, size: V } = a, q = u;
     for (; V < 0; )
       if (a.next(), V == -1) {
         let oe = r[j];
-        T.push(oe), L.push(O - N);
+        T.push(oe), S.push(O - N);
         return;
       } else if (V == -3) {
         p = j;
@@ -128023,7 +128030,7 @@ function J_t(o) {
       } else
         throw new RangeError(`Unrecognized record size: ${V}`);
     let se = l[j], ue, me, ce = O - N;
-    if (R - O <= i && (me = f(a.pos - z, S))) {
+    if (R - O <= i && (me = f(a.pos - z, L))) {
       let oe = new Uint16Array(me.size - me.skip), pe = a.pos - me.size, G = oe.length;
       for (; a.pos > pe; )
         G = w(me.start, oe, G);
@@ -128040,10 +128047,10 @@ function J_t(o) {
       } else
         ue = A(se, pe, G, R - O, q - R);
     }
-    T.push(ue), L.push(ce);
+    T.push(ue), S.push(ce);
   }
-  function h(N, z, T, L) {
-    let S = [], _ = 0, j = -1;
+  function h(N, z, T, S) {
+    let L = [], _ = 0, j = -1;
     for (; a.pos > z; ) {
       let { id: O, start: R, end: V, size: q } = a;
       if (q > 4)
@@ -128051,50 +128058,50 @@ function J_t(o) {
       else {
         if (j > -1 && R < j)
           break;
-        j < 0 && (j = V - i), S.push(O, R, V), _++, a.next();
+        j < 0 && (j = V - i), L.push(O, R, V), _++, a.next();
       }
     }
     if (_) {
-      let O = new Uint16Array(_ * 4), R = S[S.length - 2];
-      for (let V = S.length - 3, q = 0; V >= 0; V -= 3)
-        O[q++] = S[V], O[q++] = S[V + 1] - R, O[q++] = S[V + 2] - R, O[q++] = q;
-      T.push(new Jd(O, S[2] - R, n)), L.push(R - N);
+      let O = new Uint16Array(_ * 4), R = L[L.length - 2];
+      for (let V = L.length - 3, q = 0; V >= 0; V -= 3)
+        O[q++] = L[V], O[q++] = L[V + 1] - R, O[q++] = L[V + 2] - R, O[q++] = q;
+      T.push(new Jd(O, L[2] - R, n)), S.push(R - N);
     }
   }
   function g(N) {
-    return (z, T, L) => {
-      let S = 0, _ = z.length - 1, j, O;
+    return (z, T, S) => {
+      let L = 0, _ = z.length - 1, j, O;
       if (_ >= 0 && (j = z[_]) instanceof ei) {
-        if (!_ && j.type == N && j.length == L)
+        if (!_ && j.type == N && j.length == S)
           return j;
-        (O = j.prop(Gt.lookAhead)) && (S = T[_] + j.length + O);
+        (O = j.prop(Gt.lookAhead)) && (L = T[_] + j.length + O);
       }
-      return A(N, z, T, L, S);
+      return A(N, z, T, S, L);
     };
   }
-  function m(N, z, T, L, S, _, j, O) {
+  function m(N, z, T, S, L, _, j, O) {
     let R = [], V = [];
-    for (; N.length > L; )
-      R.push(N.pop()), V.push(z.pop() + T - S);
-    N.push(A(n.types[j], R, V, _ - S, O - _)), z.push(S - T);
+    for (; N.length > S; )
+      R.push(N.pop()), V.push(z.pop() + T - L);
+    N.push(A(n.types[j], R, V, _ - L, O - _)), z.push(L - T);
   }
-  function A(N, z, T, L, S = 0, _) {
+  function A(N, z, T, S, L = 0, _) {
     if (p) {
       let j = [Gt.contextHash, p];
       _ = _ ? [j].concat(_) : [j];
     }
-    if (S > 25) {
-      let j = [Gt.lookAhead, S];
+    if (L > 25) {
+      let j = [Gt.lookAhead, L];
       _ = _ ? [j].concat(_) : [j];
     }
-    return new ei(N, z, T, L, _);
+    return new ei(N, z, T, S, _);
   }
   function f(N, z) {
-    let T = a.fork(), L = 0, S = 0, _ = 0, j = T.end - i, O = { size: 0, start: 0, skip: 0 };
+    let T = a.fork(), S = 0, L = 0, _ = 0, j = T.end - i, O = { size: 0, start: 0, skip: 0 };
     e: for (let R = T.pos - N; T.pos > R; ) {
       let V = T.size;
       if (T.id == z && V >= 0) {
-        O.size = L, O.start = S, O.skip = _, _ += 4, L += 4, T.next();
+        O.size = S, O.start = L, O.skip = _, _ += 4, S += 4, T.next();
         continue;
       }
       let q = T.pos - V;
@@ -128110,21 +128117,21 @@ function J_t(o) {
         else T.id >= s && (se += 4);
         T.next();
       }
-      S = ue, L += V, _ += se;
+      L = ue, S += V, _ += se;
     }
-    return (z < 0 || L == N) && (O.size = L, O.start = S, O.skip = _), O.size > 4 ? O : void 0;
+    return (z < 0 || S == N) && (O.size = S, O.start = L, O.skip = _), O.size > 4 ? O : void 0;
   }
   function w(N, z, T) {
-    let { id: L, start: S, end: _, size: j } = a;
-    if (a.next(), j >= 0 && L < s) {
+    let { id: S, start: L, end: _, size: j } = a;
+    if (a.next(), j >= 0 && S < s) {
       let O = T;
       if (j > 4) {
         let R = a.pos - (j - 4);
         for (; a.pos > R; )
           T = w(N, z, T);
       }
-      z[--T] = O, z[--T] = _ - N, z[--T] = S - N, z[--T] = L;
-    } else j == -3 ? p = L : j == -4 && (u = L);
+      z[--T] = O, z[--T] = _ - N, z[--T] = L - N, z[--T] = S;
+    } else j == -3 ? p = S : j == -4 && (u = S);
     return T;
   }
   let v = [], C = [];
@@ -139304,11 +139311,11 @@ const t5 = /* @__PURE__ */ bt.define({
       } else u.style.height && (u.style.height = "");
       let z = D ? d.top - f - m - w.y : d.bottom + m + w.y, T = C + A;
       if (p.overlap !== !0)
-        for (let L of s)
-          L.left < T && L.right > C && L.top < z + f && L.bottom > z && (z = D ? L.top - f - 2 - m : L.bottom + m + 2);
+        for (let S of s)
+          S.left < T && S.right > C && S.top < z + f && S.bottom > z && (z = D ? S.top - f - 2 - m : S.bottom + m + 2);
       if (this.position == "absolute" ? (u.style.top = (z - o.parent.top) / r + "px", u.style.left = (C - o.parent.left) / i + "px") : (u.style.top = z / r + "px", u.style.left = C / i + "px"), g) {
-        let L = d.left + (v ? w.x : -w.x) - (C + 14 - 7);
-        g.style.left = L / i + "px";
+        let S = d.left + (v ? w.x : -w.x) - (C + 14 - 7);
+        g.style.left = S / i + "px";
       }
       p.overlap !== !0 && s.push({ left: C, top: z, right: T, bottom: z + f }), u.classList.toggle("cm-tooltip-above", D), u.classList.toggle("cm-tooltip-below", !D), p.positioned && p.positioned(o.space);
     }
@@ -144819,10 +144826,10 @@ function o9({
   const g = ot.updateListener.of((N) => {
     N.docChanged && i(N.state.doc.toString());
   }), m = ot.updateListener.of((N) => {
-    const z = N.transactions.flatMap((L) => L.effects).filter((L) => L.is(o3));
+    const z = N.transactions.flatMap((S) => S.effects).filter((S) => S.is(o3));
     if (!z.length)
       return;
-    const T = z.flatMap((L) => L.value);
+    const T = z.flatMap((S) => S.value);
     s(T);
   }), A = ot.contentAttributes.of(a), f = ot.domEventHandlers(
     {
@@ -147736,9 +147743,9 @@ var ODe = {
       });
     });
     O && g(d());
-  }, L = typeof window < "u" && "MutationObserver" in window ? new MutationObserver(T) : void 0, S = function() {
-    L && (L.disconnect(), s.active && !s.paused && s.containers.map(function(j) {
-      L.observe(j, {
+  }, S = typeof window < "u" && "MutationObserver" in window ? new MutationObserver(T) : void 0, L = function() {
+    S && (S.disconnect(), s.active && !s.paused && s.containers.map(function(j) {
+      S.observe(j, {
         subtree: !0,
         childList: !0
       });
@@ -147757,7 +147764,7 @@ var ODe = {
       var O = l(j, "onActivate"), R = l(j, "onPostActivate"), V = l(j, "checkCanFocusTrap");
       V || h(), s.active = !0, s.paused = !1, s.nodeFocusedBeforeActivation = n.activeElement, O?.();
       var q = function() {
-        V && h(), N(), S(), R?.();
+        V && h(), N(), L(), R?.();
       };
       return V ? (V(s.containers.concat()).then(q, q), this) : (q(), this);
     },
@@ -147769,7 +147776,7 @@ var ODe = {
         onPostDeactivate: r.onPostDeactivate,
         checkCanReturnFocus: r.checkCanReturnFocus
       }, j);
-      clearTimeout(s.delayInitialFocusTimer), s.delayInitialFocusTimer = void 0, z(), s.active = !1, s.paused = !1, S(), ODe.deactivateTrap(i, a);
+      clearTimeout(s.delayInitialFocusTimer), s.delayInitialFocusTimer = void 0, z(), s.active = !1, s.paused = !1, L(), ODe.deactivateTrap(i, a);
       var R = l(O, "onDeactivate"), V = l(O, "onPostDeactivate"), q = l(O, "checkCanReturnFocus"), se = l(O, "returnFocus", "returnFocusOnDeactivate");
       R?.();
       var ue = function() {
@@ -147783,19 +147790,19 @@ var ODe = {
       if (s.paused || !s.active)
         return this;
       var O = l(j, "onPause"), R = l(j, "onPostPause");
-      return s.paused = !0, O?.(), z(), S(), R?.(), this;
+      return s.paused = !0, O?.(), z(), L(), R?.(), this;
     },
     unpause: function(j) {
       if (!s.paused || !s.active)
         return this;
       var O = l(j, "onUnpause"), R = l(j, "onPostUnpause");
-      return s.paused = !1, O?.(), h(), N(), S(), R?.(), this;
+      return s.paused = !1, O?.(), h(), N(), L(), R?.(), this;
     },
     updateContainerElements: function(j) {
       var O = [].concat(j).filter(Boolean);
       return s.containers = O.map(function(R) {
         return typeof R == "string" ? n.querySelector(R) : R;
-      }), s.active && h(), S(), this;
+      }), s.active && h(), L(), this;
     }
   }, a.updateContainerElements(e), a;
 }, v_e = function(e) {
@@ -147940,7 +147947,7 @@ function mFt(o) {
     }, D = (N) => {
       const {
         relatedTarget: z
-      } = N, T = (L) => !!L.closest(".bio-properties-panel-tooltip");
+      } = N, T = (S) => !!S.closest(".bio-properties-panel-tooltip");
       s && !fFt(d.current) && z && !T(z) && m();
     };
     return document.addEventListener("wheel", C), document.addEventListener("focusout", D), document.addEventListener("mousemove", C), () => {
@@ -148111,8 +148118,8 @@ fh((o, e) => {
     const N = (z) => {
       if (z.key !== "Backspace" || !D)
         return;
-      const T = D.getSelection(), L = T.ranges[T.mainIndex];
-      L.from === 0 && L.to === 0 && s();
+      const T = D.getSelection(), S = T.ranges[T.mainIndex];
+      S.from === 0 && S.to === 0 && s();
     };
     return D = new r3({
       container: g.current,
@@ -151323,22 +151330,22 @@ function aL(o, e, t) {
 }
 const V_e = Pt(({ element: o }) => {
   const { displayNotification: e } = pr(Fo), [t, n] = it(!1), [i, r] = it(!1), [s, a] = it(""), [l, p] = it(!1), { instanceKey: u, processInstance: d } = Ie.state, h = HL(o), g = _s.state.statistics.some(
-    ({ activityId: S, active: _ }) => S === o.id && _ > 0
+    ({ activityId: L, active: _ }) => L === o.id && _ > 0
   ), m = g && M7e.includes(o.businessObject.$type) && h !== void 0, A = f5.state.userTasks?.find(
-    (S) => S.taskDefinitionId === o.id && S.taskState === "CREATED"
+    (L) => L.taskDefinitionId === o.id && L.taskState === "CREATED"
   ), f = m || A !== void 0;
   Qt(() => {
     p(!1);
   }, [f]);
   const w = Et.getAvailableErrorEvents(o), v = Ri(async () => {
     r(!1), p(!0);
-    const S = await B0.throwError({
+    const L = await B0.throwError({
       taskDefinitionType: h,
       processInstanceKey: u,
       errorCode: s,
       elementId: o.id
     });
-    if (S && u !== void 0) {
+    if (L && u !== void 0) {
       ms(ao(u), {
         action: "throwJob",
         elementId: o.id,
@@ -151368,7 +151375,7 @@ const V_e = Pt(({ element: o }) => {
         }
       );
     }
-    S || (e?.error(
+    L || (e?.error(
       {
         title: Qo.title,
         subtitle: "Please try again or make sure you have the right permissions to throw an error"
@@ -151383,8 +151390,8 @@ const V_e = Pt(({ element: o }) => {
     s,
     u
   ]), C = Ri(
-    async (S) => {
-      S ? e?.error(
+    async (L) => {
+      L ? e?.error(
         {
           title: ep,
           subtitle: `Please contact your ${Fe.authType === "sm" ? "admin" : "organization owner or admin"} to give you the necessary permissions to update the user task.`
@@ -151409,7 +151416,7 @@ const V_e = Pt(({ element: o }) => {
     element: o,
     useCache: !0,
     processId: Fe.processId
-  }), L = [
+  }), S = [
     {
       label: eg({
         prefix: "Complete job",
@@ -151419,28 +151426,28 @@ const V_e = Pt(({ element: o }) => {
       renderIcon: () => /* @__PURE__ */ E.jsx(WL, { color: "white" }),
       onClick: async () => {
         p(!0);
-        let S = !1, _ = !1;
+        let L = !1, _ = !1;
         if (o.type === "bpmn:UserTask") {
           const { success: j, status: O } = await gt.completeUserTask({
             taskId: A?.id,
             variables: N,
             isZeebeUserTask: A?.implementation === "ZEEBE_USER_TASK"
           });
-          S = j, _ = O === Rl;
+          L = j, _ = O === Rl;
         } else
-          S = await B0.completeJob({
+          L = await B0.completeJob({
             taskDefinitionType: h,
             processInstanceKey: d?.key,
             variables: N,
             elementId: o.id
           });
-        if (S && d !== void 0 && (ms(ao(d.key), {
+        if (L && d !== void 0 && (ms(ao(d.key), {
           action: "completeJob",
           type: o.type === "bpmn:UserTask" ? "userTask" : "serviceTask",
           elementId: o.id,
           variables: N || void 0,
           taskDefinitionType: h
-        }), Qn.trackUserCompletesElement(o, N)), !S)
+        }), Qn.trackUserCompletesElement(o, N)), !L)
           C(_), p(!1);
         else {
           const j = eg({ prefillSource: z }) || void 0;
@@ -151456,7 +151463,7 @@ const V_e = Pt(({ element: o }) => {
       }
     }
   ];
-  return m && w.length > 0 && L.push(
+  return m && w.length > 0 && S.push(
     {
       //@ts-expect-error Object literal may only specify known properties, and 'type' does not exist in type '{ label: string; renderIcon: () => Element; onClick: () => Promise<void>; } | { label: string; onClick: () => void; renderIcon?: undefined; }'.ts(2353)
       type: "divider",
@@ -151479,7 +151486,7 @@ const V_e = Pt(({ element: o }) => {
           xu,
           {
             disabled: l || D,
-            actions: L
+            actions: S
           }
         )
       }
@@ -151492,13 +151499,13 @@ const V_e = Pt(({ element: o }) => {
         primaryButtonLabel: "Complete job",
         onClose: () => n(!1),
         element: o,
-        onSubmit: async (S) => {
+        onSubmit: async (L) => {
           n(!1), p(!0);
           let _ = !1, j = !1;
           if (o.type === "bpmn:UserTask") {
             const { success: O, status: R } = await gt.completeUserTask({
               taskId: A?.id,
-              variables: S ?? "{}",
+              variables: L ?? "{}",
               isZeebeUserTask: A?.implementation === "ZEEBE_USER_TASK"
             });
             _ = O, j = R === Rl;
@@ -151506,22 +151513,22 @@ const V_e = Pt(({ element: o }) => {
             _ = await B0.completeJob({
               taskDefinitionType: h,
               processInstanceKey: d?.key,
-              variables: S,
+              variables: L,
               elementId: o.id
             });
           _ && d !== void 0 && (ms(ao(d.key), {
             action: "completeJob",
             type: o.type === "bpmn:UserTask" ? "userTask" : "serviceTask",
             elementId: o.id,
-            variables: S ?? void 0,
+            variables: L ?? void 0,
             taskDefinitionType: h
           }), Qn.trackUserCompletesElement(
             o,
-            S
+            L
           ), hb({
             processId: Fe.processId,
             elementId: o.id,
-            variables: S ?? ""
+            variables: L ?? ""
           })), _ ? aL(o, e) : (C(j), p(!1));
         }
       }
@@ -151547,17 +151554,17 @@ const V_e = Pt(({ element: o }) => {
             id: "error",
             "aria-label": "Select an Error",
             items: w.map(
-              ({ errorCode: S, errorName: _, errorElementId: j }) => ({
-                id: S,
+              ({ errorCode: L, errorName: _, errorElementId: j }) => ({
+                id: L,
                 label: _ ?? j
               })
             ),
-            onChange: ({ selectedItem: S }) => {
-              if (S === null) {
+            onChange: ({ selectedItem: L }) => {
+              if (L === null) {
                 a("");
                 return;
               }
-              a(S?.id);
+              a(L?.id);
             }
           }
         )
@@ -152579,7 +152586,7 @@ const FWt = (o) => ({
     }, g = u_(i), m = p_(g), A = await s.getDimensions(p), f = g === "y", w = f ? "top" : "left", v = f ? "bottom" : "right", C = f ? "clientHeight" : "clientWidth", D = r.reference[m] + r.reference[g] - h[g] - r.floating[m], N = h[g] - r.reference[g], z = await (s.getOffsetParent == null ? void 0 : s.getOffsetParent(p));
     let T = z ? z[C] : 0;
     (!T || !await (s.isElement == null ? void 0 : s.isElement(z))) && (T = a.floating[C] || r.floating[m]);
-    const L = D / 2 - N / 2, S = T / 2 - A[m] / 2 - 1, _ = rm(d[w], S), j = rm(d[v], S), O = _, R = T - A[m] - j, V = T / 2 - A[m] / 2 + L, q = kWt(O, V, R), se = !l.arrow && c3(i) != null && V !== q && r.reference[m] / 2 - (V < O ? _ : j) - A[m] / 2 < 0, ue = se ? V < O ? V - O : V - R : 0;
+    const S = D / 2 - N / 2, L = T / 2 - A[m] / 2 - 1, _ = rm(d[w], L), j = rm(d[v], L), O = _, R = T - A[m] - j, V = T / 2 - A[m] / 2 + S, q = kWt(O, V, R), se = !l.arrow && c3(i) != null && V !== q && r.reference[m] / 2 - (V < O ? _ : j) - A[m] / 2 < 0, ue = se ? V < O ? V - O : V - R : 0;
     return {
       [g]: h[g] + ue,
       data: {
@@ -152618,16 +152625,16 @@ const FWt = (o) => ({
         return {};
       const w = sm(i), v = y1(a), C = sm(a) === a, D = await (l.isRTL == null ? void 0 : l.isRTL(p.floating)), N = h || (C || !A ? [Yw(a)] : RWt(a)), z = m !== "none";
       !h && z && N.push(...VWt(a, A, m, D));
-      const T = [a, ...N], L = await qWt(e, f), S = [];
+      const T = [a, ...N], S = await qWt(e, f), L = [];
       let _ = ((n = r.flip) == null ? void 0 : n.overflows) || [];
-      if (u && S.push(L[w]), d) {
+      if (u && L.push(S[w]), d) {
         const V = _Wt(i, s, D);
-        S.push(L[V[0]], L[V[1]]);
+        L.push(S[V[0]], S[V[1]]);
       }
       if (_ = [..._, {
         placement: i,
-        overflows: S
-      }], !S.every((V) => V <= 0)) {
+        overflows: L
+      }], !L.every((V) => V <= 0)) {
         var j, O;
         const V = (((j = r.flip) == null ? void 0 : j.index) || 0) + 1, q = T[V];
         if (q && (!(d === "alignment" ? v !== y1(q) : !1) || // We leave the current main axis only if every placement on that axis
@@ -153296,7 +153303,7 @@ function IZt(o) {
     me !== z.current && (z.current = me, A(me));
   }, []), C = nt.useCallback((me) => {
     me !== T.current && (T.current = me, w(me));
-  }, []), D = r || m, N = s || f, z = nt.useRef(null), T = nt.useRef(null), L = nt.useRef(u), S = l != null, _ = xN(l), j = xN(i), O = xN(p), R = nt.useCallback(() => {
+  }, []), D = r || m, N = s || f, z = nt.useRef(null), T = nt.useRef(null), S = nt.useRef(u), L = l != null, _ = xN(l), j = xN(i), O = xN(p), R = nt.useCallback(() => {
     if (!z.current || !T.current)
       return;
     const me = {
@@ -153313,13 +153320,13 @@ function IZt(o) {
         // setting it to `true` when `open === false` (must be specified).
         isPositioned: O.current !== !1
       };
-      V.current && !Zw(L.current, oe) && (L.current = oe, MRe.flushSync(() => {
+      V.current && !Zw(S.current, oe) && (S.current = oe, MRe.flushSync(() => {
         d(oe);
       }));
     });
   }, [h, e, t, j, O]);
   i5(() => {
-    p === !1 && L.current.isPositioned && (L.current.isPositioned = !1, d((me) => ({
+    p === !1 && S.current.isPositioned && (S.current.isPositioned = !1, d((me) => ({
       ...me,
       isPositioned: !1
     })));
@@ -153333,7 +153340,7 @@ function IZt(o) {
         return _.current(D, N, R);
       R();
     }
-  }, [D, N, R, _, S]);
+  }, [D, N, R, _, L]);
   const q = nt.useMemo(() => ({
     reference: z,
     floating: T,
@@ -154133,8 +154140,8 @@ const xJt = ({
   isUserOrgOwnerOrAdmin: N,
   organizationManagementPageUrl: z,
   currentDiagramRevision: T,
-  updateFileById: L,
-  originAppInstanceId: S,
+  updateFileById: S,
+  originAppInstanceId: L,
   canUserSaveExampleData: _,
   diagramId: j,
   FeedbackButton: O
@@ -154200,8 +154207,8 @@ const xJt = ({
       consoleDashboardPageUrl: D,
       clusterId: ue,
       currentDiagramRevision: T,
-      updateFileById: L,
-      originAppInstanceId: S,
+      updateFileById: S,
+      originAppInstanceId: L,
       canUserSaveExampleData: _,
       diagramId: j,
       authType: q,
@@ -154221,8 +154228,8 @@ const xJt = ({
     t,
     D,
     T,
-    L,
     S,
+    L,
     _,
     j,
     q,
@@ -154232,15 +154239,15 @@ const xJt = ({
       fetchTestsByProcessId: w,
       displayNotification: p,
       createFile: v,
-      updateFileById: L,
-      originAppInstanceId: S
+      updateFileById: S,
+      originAppInstanceId: L
     });
   }, [
     w,
     p,
-    S,
+    L,
     v,
-    L
+    S
   ]);
   const be = Vqe(q, ue);
   Qt(() => {