@autobe/compiler 0.22.0 → 0.23.0

This diff represents the content of publicly available package versions that have been released to one of the supported registries. The information contained in this diff is provided for informational purposes only and reflects changes between package versions as they appear in their respective public registries.
@@ -4,7 +4,7 @@ exports.AutoBeCompilerRealizeTemplate = void 0;
4
4
  exports.AutoBeCompilerRealizeTemplate = {
5
5
  ".env.local": "API_PORT=37001\nJWT_SECRET_KEY=your_jwt_secret_key",
6
6
  ".gitignore": "bin/\ndist/\nlib/\nnode_modules/\n\nprisma/migrations\nprisma/schema/migrations\nprisma/bbs.db\n\n*.DS_Store\npackage-lock.json\npnpm-lock.yaml\n.npmrc",
7
- "package.json": "{\n \"private\": true,\n \"name\": \"@ORGANIZATION/PROJECT\",\n \"version\": \"0.1.0\",\n \"description\": \"Starter kit of Nestia\",\n \"main\": \"lib/index.js\",\n \"scripts\": {\n \"benchmark\": \"node bin/test/benchmark\",\n \"test\": \"node bin/test\",\n \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------BUILDS------------------------\": \"\",\n \"build\": \"npm run build:prisma && npm run build:sdk && npm run build:main && npm run build:test\",\n \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n \"build:env\": \"ts-node build/env.ts\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n \"build:prisma\": \"prisma generate --schema prisma/schema\",\n \"build:swagger\": \"nestia swagger\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n \"prepare\": \"ts-patch install && npm run build:env && npm run build:prisma\",\n \"prettier\": \"prettier src --write && prettier test --write\",\n \"------------------------WEBPACK------------------------\": \"\",\n \"webpack\": \"rimraf dist && webpack\",\n \"webpack:start\": \"cd dist && node dist/server\",\n \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------DEPLOYS------------------------\": \"\",\n \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n \"start\": \"node lib/executable/server\",\n \"start:dev\": \"nest start --watch\",\n \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia-start\"\n },\n \"keywords\": [\n \"nestia\",\n \"template\",\n \"boilerplate\"\n ],\n \"author\": \"AUTHOR\",\n \"license\": \"AGPL-3.0\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia-start/issues\"\n },\n \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n \"devDependencies\": {\n \"@autobe/interface\": \"^0.10.6\",\n \"@nestia/benchmark\": \"^8.0.5\",\n \"@nestia/e2e\": \"^8.0.5\",\n \"@nestia/sdk\": \"^8.0.5\",\n \"@nestjs/cli\": \"^11.0.7\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^11.1.6\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/bcryptjs\": \"^3.0.0\",\n \"@types/cli\": \"^0.11.21\",\n \"@types/cli-progress\": \"^3.11.5\",\n \"@types/express\": \"^4.17.21\",\n \"@types/inquirer\": \"^8.2.5\",\n \"@types/jsonwebtoken\": \"^9.0.5\",\n \"@types/node\": \"^18.11.0\",\n \"@types/uuid\": \"^8.3.4\",\n \"@typescript-eslint/eslint-plugin\": \"^8.1.0\",\n \"@typescript-eslint/parser\": \"^8.1.0\",\n \"chalk\": \"^4.1.2\",\n \"cli\": \"^1.0.1\",\n \"cli-progress\": \"^3.12.0\",\n \"copy-webpack-plugin\": \"^11.0.0\",\n \"eslint-plugin-deprecation\": \"^3.0.0\",\n \"express\": \"^4.18.2\",\n \"fastify\": \"^5.4.0\",\n \"nestia\": \"^8.0.5\",\n \"prettier\": \"^3.2.4\",\n \"prettier-plugin-prisma\": \"^5.0.0\",\n \"prisma-markdown\": \"^3.0.1\",\n \"rimraf\": \"^3.0.2\",\n \"rollup\": \"^4.18.0\",\n \"source-map-support\": \"^0.5.21\",\n \"swagger-ui-express\": \"^5.0.0\",\n \"ts-loader\": \"^9.5.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.5.5\",\n \"webpack\": \"^5.89.0\",\n \"webpack-cli\": \"^5.1.4\",\n \"write-file-webpack-plugin\": \"^4.5.1\"\n },\n \"dependencies\": {\n \"@nestia/core\": \"^8.0.5\",\n \"@nestia/fetcher\": \"^8.0.5\",\n \"@nestjs/common\": \"^11.1.3\",\n \"@nestjs/core\": \"^11.1.3\",\n \"@nestjs/platform-express\": \"^11.1.3\",\n \"@nestjs/platform-fastify\": \"^11.1.3\",\n \"@prisma/client\": \"^6.11.1\",\n \"bcryptjs\": \"^3.0.2\",\n \"commander\": \"10.0.0\",\n \"dotenv\": \"^16.3.1\",\n \"dotenv-expand\": \"^10.0.0\",\n \"inquirer\": \"8.2.5\",\n \"jsonwebtoken\": \"^9.0.2\",\n \"prisma\": \"^6.11.1\",\n \"serialize-error\": \"^4.1.0\",\n \"tgrid\": \"^1.1.0\",\n \"tstl\": \"^3.0.0\",\n \"typia\": \"^9.7.2\",\n \"uuid\": \"^9.0.0\"\n },\n \"stackblitz\": {\n \"startCommand\": \"npm run prepare && npm run build:test && npm run test -- --simultaneous 1\"\n }\n}\n",
7
+ "package.json": "{\n \"private\": true,\n \"name\": \"@ORGANIZATION/PROJECT\",\n \"version\": \"0.1.0\",\n \"description\": \"Starter kit of Nestia\",\n \"main\": \"lib/index.js\",\n \"scripts\": {\n \"benchmark\": \"node bin/test/benchmark\",\n \"test\": \"node bin/test\",\n \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------BUILDS------------------------\": \"\",\n \"build\": \"npm run build:prisma && npm run build:sdk && npm run build:main && npm run build:test\",\n \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n \"build:env\": \"ts-node build/env.ts\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n \"build:prisma\": \"prisma generate --schema prisma/schema\",\n \"build:swagger\": \"nestia swagger\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n \"prepare\": \"ts-patch install && npm run build:env && npm run build:prisma\",\n \"prettier\": \"prettier src --write && prettier test --write\",\n \"------------------------WEBPACK------------------------\": \"\",\n \"webpack\": \"rimraf dist && webpack\",\n \"webpack:start\": \"cd dist && node dist/server\",\n \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------DEPLOYS------------------------\": \"\",\n \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n \"start\": \"node lib/executable/server\",\n \"start:dev\": \"nest start --watch\",\n \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia-start\"\n },\n \"keywords\": [\n \"nestia\",\n \"template\",\n \"boilerplate\"\n ],\n \"author\": \"AUTHOR\",\n \"license\": \"AGPL-3.0\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia-start/issues\"\n },\n \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n \"devDependencies\": {\n \"@autobe/interface\": \"^0.10.6\",\n \"@nestia/benchmark\": \"^8.0.7\",\n \"@nestia/e2e\": \"^8.0.7\",\n \"@nestia/sdk\": \"^8.0.7\",\n \"@nestjs/cli\": \"^11.0.7\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^11.1.6\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/bcryptjs\": \"^3.0.0\",\n \"@types/cli\": \"^0.11.21\",\n \"@types/cli-progress\": \"^3.11.5\",\n \"@types/express\": \"^4.17.21\",\n \"@types/inquirer\": \"^8.2.5\",\n \"@types/jsonwebtoken\": \"^9.0.5\",\n \"@types/node\": \"^18.11.0\",\n \"@types/uuid\": \"^8.3.4\",\n \"@typescript-eslint/eslint-plugin\": \"^8.1.0\",\n \"@typescript-eslint/parser\": \"^8.1.0\",\n \"chalk\": \"^4.1.2\",\n \"cli\": \"^1.0.1\",\n \"cli-progress\": \"^3.12.0\",\n \"copy-webpack-plugin\": \"^11.0.0\",\n \"eslint-plugin-deprecation\": \"^3.0.0\",\n \"express\": \"^4.18.2\",\n \"fastify\": \"^5.4.0\",\n \"nestia\": \"^8.0.7\",\n \"prettier\": \"^3.2.4\",\n \"prettier-plugin-prisma\": \"^5.0.0\",\n \"prisma-markdown\": \"^3.0.1\",\n \"rimraf\": \"^3.0.2\",\n \"rollup\": \"^4.18.0\",\n \"source-map-support\": \"^0.5.21\",\n \"swagger-ui-express\": \"^5.0.0\",\n \"ts-loader\": \"^9.5.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.5.5\",\n \"webpack\": \"^5.89.0\",\n \"webpack-cli\": \"^5.1.4\",\n \"write-file-webpack-plugin\": \"^4.5.1\"\n },\n \"dependencies\": {\n \"@nestia/core\": \"^8.0.7\",\n \"@nestia/fetcher\": \"^8.0.7\",\n \"@nestjs/common\": \"^11.1.3\",\n \"@nestjs/core\": \"^11.1.3\",\n \"@nestjs/platform-express\": \"^11.1.3\",\n \"@nestjs/platform-fastify\": \"^11.1.3\",\n \"@prisma/client\": \"^6.11.1\",\n \"bcryptjs\": \"^3.0.2\",\n \"commander\": \"10.0.0\",\n \"dotenv\": \"^16.3.1\",\n \"dotenv-expand\": \"^10.0.0\",\n \"inquirer\": \"8.2.5\",\n \"jsonwebtoken\": \"^9.0.2\",\n \"prisma\": \"^6.11.1\",\n \"serialize-error\": \"^4.1.0\",\n \"tgrid\": \"^1.1.0\",\n \"tstl\": \"^3.0.0\",\n \"typia\": \"^9.7.2\",\n \"uuid\": \"^9.0.0\"\n },\n \"stackblitz\": {\n \"startCommand\": \"npm run prepare && npm run build:test && npm run test -- --simultaneous 1\"\n }\n}\n",
8
8
  "src/MyGlobal.ts": "import { PrismaClient } from \"@prisma/client\";\nimport crypto from \"crypto\";\nimport dotenv from \"dotenv\";\nimport dotenvExpand from \"dotenv-expand\";\nimport { Singleton } from \"tstl\";\nimport typia from \"typia\";\n\n/* eslint-disable */\nexport class MyGlobal {\n public static readonly prisma: PrismaClient = new PrismaClient();\n public static testing: boolean = false;\n public static get env(): MyGlobal.IEnvironments {\n return environments.get();\n }\n\n /**\n * Common password utilities for consistent authentication Uses native crypto\n * module for password hashing\n */\n public static readonly password = {\n // Fixed salt for password hashing (consistent across all operations)\n FIXED_SALT: \"autobe-fixed-salt-2024\",\n\n /**\n * Hash a plain password using crypto.pbkdf2 All authentication operations\n * (join, login) MUST use this method\n *\n * @param plainPassword - The plain text password to hash\n * @returns The hashed password as hex string\n */\n async hash(plainPassword: string): Promise<string> {\n return new Promise((resolve, reject) => {\n crypto.pbkdf2(\n plainPassword,\n this.FIXED_SALT,\n 10000,\n 64,\n \"sha512\",\n (err: Error | null, derivedKey: Buffer) => {\n if (err) reject(err);\n else resolve(derivedKey.toString(\"hex\"));\n },\n );\n });\n },\n\n /**\n * Verify a plain password against a hashed password Login operations MUST\n * use this method for password verification\n *\n * @param plainPassword - The plain text password to verify\n * @param hashedPassword - The hashed password from database\n * @returns True if passwords match, false otherwise\n */\n async verify(\n plainPassword: string,\n hashedPassword: string,\n ): Promise<boolean> {\n const hash = await this.hash(plainPassword);\n return hash === hashedPassword;\n },\n };\n}\nexport namespace MyGlobal {\n export interface IEnvironments {\n API_PORT: `${number}`;\n\n /** JWT Secret Key. */\n JWT_SECRET_KEY: string;\n }\n}\nconst environments = new Singleton(() => {\n const env = dotenv.config();\n dotenvExpand.expand(env);\n return typia.assert<MyGlobal.IEnvironments>(process.env);\n});\n",
9
9
  "src/providers/authorize/jwtAuthorize.ts": "import { ForbiddenException, UnauthorizedException } from \"@nestjs/common\";\nimport jwt from \"jsonwebtoken\";\n\nimport { MyGlobal } from \"../../MyGlobal\";\n\nexport function jwtAuthorize(props: {\n request: {\n headers: { authorization?: string };\n };\n}) {\n if (!props.request.headers.authorization)\n throw new ForbiddenException(\"No token value exists\");\n\n // PARSE TOKEN\n try {\n if (\n props.request.headers.authorization.startsWith(BEARER_PREFIX) === true\n ) {\n const token: string = props.request.headers.authorization.substring(\n BEARER_PREFIX.length,\n );\n\n const verified = jwt.verify(token, MyGlobal.env.JWT_SECRET_KEY);\n\n return verified;\n } else {\n const token = props.request.headers.authorization;\n\n const verified = jwt.verify(token, MyGlobal.env.JWT_SECRET_KEY);\n\n return verified;\n }\n } catch {\n throw new UnauthorizedException(\"Invalid token\");\n }\n}\n\nconst BEARER_PREFIX = \"Bearer \";\n",
10
10
  "src/setup/MySetupWizard.ts": "import cp from \"child_process\";\n\nimport { MyConfiguration } from \"../MyConfiguration\";\nimport { MyGlobal } from \"../MyGlobal\";\n\nexport namespace MySetupWizard {\n export async function schema(): Promise<void> {\n if (MyGlobal.testing === false)\n throw new Error(\n \"Error on SetupWizard.schema(): unable to reset database in non-test mode.\",\n );\n const execute = (type: string) => (argv: string) =>\n cp.execSync(`npx prisma migrate ${type} --schema=prisma/schema ${argv}`, {\n stdio: \"ignore\",\n cwd: MyConfiguration.ROOT,\n });\n execute(\"reset\")(\"--force\");\n execute(\"dev\")(\"--name init\");\n }\n\n export async function seed(): Promise<void> {}\n}\n",
@@ -2,7 +2,7 @@
2
2
  Object.defineProperty(exports, "__esModule", { value: true });
3
3
  exports.AutoBeCompilerTestTemplate = void 0;
4
4
  exports.AutoBeCompilerTestTemplate = {
5
- "package.json": "{\n \"private\": true,\n \"name\": \"@ORGANIZATION/PROJECT\",\n \"version\": \"0.1.0\",\n \"description\": \"Starter kit of Nestia\",\n \"main\": \"lib/index.js\",\n \"scripts\": {\n \"benchmark\": \"node bin/test/benchmark\",\n \"test\": \"node bin/test\",\n \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------BUILDS------------------------\": \"\",\n \"build\": \"npm run build:sdk && npm run build:main && npm run build:test\",\n \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n \"build:swagger\": \"npx nestia swagger\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n \"prepare\": \"ts-patch install && ts-node build/env.ts\",\n \"prettier\": \"prettier src --write && prettier test --write\",\n \"------------------------WEBPACK------------------------\": \"\",\n \"webpack\": \"rimraf dist && webpack\",\n \"webpack:start\": \"cd dist && node dist/server\",\n \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------DEPLOYS------------------------\": \"\",\n \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n \"start\": \"node lib/executable/server\",\n \"start:dev\": \"nest start --watch\",\n \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia-start\"\n },\n \"keywords\": [\n \"nestia\",\n \"template\",\n \"boilerplate\"\n ],\n \"author\": \"AUTHOR\",\n \"license\": \"AGPL-3.0\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia-start/issues\"\n },\n \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n \"devDependencies\": {\n \"@nestia/benchmark\": \"^8.0.5\",\n \"@nestia/e2e\": \"^8.0.5\",\n \"@nestia/sdk\": \"^8.0.5\",\n \"@nestjs/cli\": \"^11.0.7\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^11.1.6\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/cli\": \"^0.11.21\",\n \"@types/cli-progress\": \"^3.11.5\",\n \"@types/express\": \"^4.17.21\",\n \"@types/inquirer\": \"^8.2.5\",\n \"@types/node\": \"^18.11.0\",\n \"@types/uuid\": \"^8.3.4\",\n \"@typescript-eslint/eslint-plugin\": \"^8.1.0\",\n \"@typescript-eslint/parser\": \"^8.1.0\",\n \"chalk\": \"^4.1.2\",\n \"cli\": \"^1.0.1\",\n \"cli-progress\": \"^3.12.0\",\n \"copy-webpack-plugin\": \"^11.0.0\",\n \"eslint-plugin-deprecation\": \"^3.0.0\",\n \"express\": \"^4.18.2\",\n \"nestia\": \"^8.0.5\",\n \"prettier\": \"^3.2.4\",\n \"prettier-plugin-prisma\": \"^5.0.0\",\n \"prisma-markdown\": \"^3.0.1\",\n \"rimraf\": \"^3.0.2\",\n \"rollup\": \"^4.18.0\",\n \"source-map-support\": \"^0.5.21\",\n \"swagger-ui-express\": \"^5.0.0\",\n \"ts-loader\": \"^9.5.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.5.5\",\n \"webpack\": \"^5.89.0\",\n \"webpack-cli\": \"^5.1.4\",\n \"write-file-webpack-plugin\": \"^4.5.1\"\n },\n \"dependencies\": {\n \"@nestia/core\": \"^8.0.5\",\n \"@nestia/fetcher\": \"^8.0.5\",\n \"@nestjs/common\": \"^11.1.3\",\n \"@nestjs/core\": \"^11.1.3\",\n \"@nestjs/platform-express\": \"^11.1.3\",\n \"@prisma/client\": \"^6.11.1\",\n \"commander\": \"10.0.0\",\n \"dotenv\": \"^16.3.1\",\n \"dotenv-expand\": \"^10.0.0\",\n \"inquirer\": \"8.2.5\",\n \"prisma\": \"^6.11.1\",\n \"serialize-error\": \"^4.1.0\",\n \"tgrid\": \"^1.1.0\",\n \"tstl\": \"^3.0.0\",\n \"typia\": \"^9.7.2\",\n \"uuid\": \"^9.0.0\"\n },\n \"stackblitz\": {\n \"startCommand\": \"npm run prepare && npm run build:test && npm run test -- --simultaneous 1\"\n }\n}\n",
5
+ "package.json": "{\n \"private\": true,\n \"name\": \"@ORGANIZATION/PROJECT\",\n \"version\": \"0.1.0\",\n \"description\": \"Starter kit of Nestia\",\n \"main\": \"lib/index.js\",\n \"scripts\": {\n \"benchmark\": \"node bin/test/benchmark\",\n \"test\": \"node bin/test\",\n \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------BUILDS------------------------\": \"\",\n \"build\": \"npm run build:sdk && npm run build:main && npm run build:test\",\n \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n \"build:swagger\": \"npx nestia swagger\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n \"prepare\": \"ts-patch install && ts-node build/env.ts\",\n \"prettier\": \"prettier src --write && prettier test --write\",\n \"------------------------WEBPACK------------------------\": \"\",\n \"webpack\": \"rimraf dist && webpack\",\n \"webpack:start\": \"cd dist && node dist/server\",\n \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------DEPLOYS------------------------\": \"\",\n \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n \"start\": \"node lib/executable/server\",\n \"start:dev\": \"nest start --watch\",\n \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia-start\"\n },\n \"keywords\": [\n \"nestia\",\n \"template\",\n \"boilerplate\"\n ],\n \"author\": \"AUTHOR\",\n \"license\": \"AGPL-3.0\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia-start/issues\"\n },\n \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n \"devDependencies\": {\n \"@nestia/benchmark\": \"^8.0.7\",\n \"@nestia/e2e\": \"^8.0.7\",\n \"@nestia/sdk\": \"^8.0.7\",\n \"@nestjs/cli\": \"^11.0.7\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^11.1.6\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/cli\": \"^0.11.21\",\n \"@types/cli-progress\": \"^3.11.5\",\n \"@types/express\": \"^4.17.21\",\n \"@types/inquirer\": \"^8.2.5\",\n \"@types/node\": \"^18.11.0\",\n \"@types/uuid\": \"^8.3.4\",\n \"@typescript-eslint/eslint-plugin\": \"^8.1.0\",\n \"@typescript-eslint/parser\": \"^8.1.0\",\n \"chalk\": \"^4.1.2\",\n \"cli\": \"^1.0.1\",\n \"cli-progress\": \"^3.12.0\",\n \"copy-webpack-plugin\": \"^11.0.0\",\n \"eslint-plugin-deprecation\": \"^3.0.0\",\n \"express\": \"^4.18.2\",\n \"nestia\": \"^8.0.7\",\n \"prettier\": \"^3.2.4\",\n \"prettier-plugin-prisma\": \"^5.0.0\",\n \"prisma-markdown\": \"^3.0.1\",\n \"rimraf\": \"^3.0.2\",\n \"rollup\": \"^4.18.0\",\n \"source-map-support\": \"^0.5.21\",\n \"swagger-ui-express\": \"^5.0.0\",\n \"ts-loader\": \"^9.5.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.5.5\",\n \"webpack\": \"^5.89.0\",\n \"webpack-cli\": \"^5.1.4\",\n \"write-file-webpack-plugin\": \"^4.5.1\"\n },\n \"dependencies\": {\n \"@nestia/core\": \"^8.0.7\",\n \"@nestia/fetcher\": \"^8.0.7\",\n \"@nestjs/common\": \"^11.1.3\",\n \"@nestjs/core\": \"^11.1.3\",\n \"@nestjs/platform-express\": \"^11.1.3\",\n \"@prisma/client\": \"^6.11.1\",\n \"commander\": \"10.0.0\",\n \"dotenv\": \"^16.3.1\",\n \"dotenv-expand\": \"^10.0.0\",\n \"inquirer\": \"8.2.5\",\n \"prisma\": \"^6.11.1\",\n \"serialize-error\": \"^4.1.0\",\n \"tgrid\": \"^1.1.0\",\n \"tstl\": \"^3.0.0\",\n \"typia\": \"^9.7.2\",\n \"uuid\": \"^9.0.0\"\n },\n \"stackblitz\": {\n \"startCommand\": \"npm run prepare && npm run build:test && npm run test -- --simultaneous 1\"\n }\n}\n",
6
6
  "src/setup/MySetupWizard.ts": "export namespace MySetupWizard {\n export async function schema(): Promise<void> {\n console.log(\"Realize agent has not generated main program yet.\");\n }\n\n export async function seed(): Promise<void> {}\n}\n",
7
7
  "test/helpers/TestAutomation.ts": "import api from \"@ORGANIZATION/PROJECT-api\";\nimport { DynamicExecutor } from \"@nestia/e2e\";\nimport { sleep_for } from \"tstl\";\n\nimport { MyConfiguration } from \"../../src/MyConfiguration\";\nimport { MySetupWizard } from \"../../src/setup/MySetupWizard\";\n\nexport namespace TestAutomation {\n export interface IProps<T> {\n open(options: IOptions): Promise<T>;\n close(backend: T): Promise<void>;\n onComplete(exec: DynamicExecutor.IExecution): void;\n onReset(): void;\n options: IOptions;\n }\n\n export interface IOptions {\n reset: boolean;\n simultaneous: number;\n include?: string[];\n exclude?: string[];\n }\n\n export const execute = async <T>(\n props: IProps<T>,\n ): Promise<DynamicExecutor.IReport> => {\n // RESET\n if (props.options.reset === true) {\n await MySetupWizard.schema();\n await MySetupWizard.seed();\n await props.onReset();\n }\n\n // OPEN BACKEND\n const backend: T = await props.open(props.options);\n const connection: api.IConnection = {\n host: `http://127.0.0.1:${MyConfiguration.API_PORT()}`,\n };\n\n // DO TEST\n const report: DynamicExecutor.IReport = await DynamicExecutor.validate({\n prefix: \"test\",\n location: __dirname + \"/../features\",\n parameters: () => [\n {\n host: connection.host,\n } satisfies api.IConnection,\n ],\n filter: (func) =>\n (!props.options.include?.length ||\n (props.options.include ?? []).some((str) => func.includes(str))) &&\n (!props.options.exclude?.length ||\n (props.options.exclude ?? []).every((str) => !func.includes(str))),\n onComplete: props.onComplete,\n simultaneous: props.options.simultaneous,\n extension: __filename.split(\".\").pop()!,\n });\n\n // TERMINATE\n await sleep_for(2500);\n await props.close(backend);\n return report;\n };\n}\n",
8
8
  "test/helpers/TestAutomationStdio.ts": "import { DynamicExecutor } from \"@nestia/e2e\";\nimport chalk from \"chalk\";\n\nimport { ArgumentParser } from \"./ArgumentParser\";\nimport { TestAutomation } from \"./TestAutomation\";\n\nexport namespace TestAutomationStdio {\n export const getOptions = () =>\n ArgumentParser.parse<TestAutomation.IOptions>(\n async (command, prompt, action) => {\n command.option(\"--reset <true|false>\", \"reset local DB or not\");\n command.option(\n \"--simultaneous <number>\",\n \"number of simultaneous requests\",\n );\n command.option(\"--include <string...>\", \"include feature files\");\n command.option(\"--exclude <string...>\", \"exclude feature files\");\n\n return action(async (options) => {\n // reset\n if (typeof options.reset === \"string\")\n options.reset = options.reset === \"true\";\n options.reset ??= await prompt.boolean(\"reset\")(\"Reset local DB\");\n\n // simultaneous\n options.simultaneous = Number(\n options.simultaneous ??\n (await prompt.number(\"simultaneous\")(\n \"Number of simultaneous requests to make\",\n )),\n );\n if (isNaN(options.simultaneous) || options.simultaneous <= 0)\n options.simultaneous = 1;\n return options as TestAutomation.IOptions;\n });\n },\n );\n\n export const onComplete = (exec: DynamicExecutor.IExecution): void => {\n const trace = (str: string) =>\n console.log(` - ${chalk.green(exec.name)}: ${str}`);\n if (exec.error === null) {\n const elapsed: number =\n new Date(exec.completed_at).getTime() -\n new Date(exec.started_at).getTime();\n trace(`${chalk.yellow(elapsed.toLocaleString())} ms`);\n } else trace(chalk.red(exec.error.name));\n };\n\n export const onReset = (start: Date) => (): void => {\n const now: Date = new Date();\n console.log(\n ` - Reset DB: ${(now.getDate() - start.getDate()).toLocaleString()} ms`,\n );\n };\n\n export const report = (report: DynamicExecutor.IReport): void => {\n const exceptions: Error[] = report.executions\n .filter((exec) => exec.error !== null)\n .map((exec) => exec.error!);\n if (exceptions.length === 0) {\n console.log(\"Success\");\n console.log(\"Elapsed time\", report.time.toLocaleString(), `ms`);\n } else {\n for (const exp of exceptions) console.log(exp);\n console.log(\"Failed\");\n console.log(\"Elapsed time\", report.time.toLocaleString(), `ms`);\n process.exit(-1);\n }\n };\n}\n",
@@ -11602,7 +11602,7 @@
11602
11602
  "node_modules/@nestia/benchmark/lib/internal/DynamicBenchmarkReporter.d.ts": "import { DynamicBenchmarker } from \"../DynamicBenchmarker\";\nexport declare namespace DynamicBenchmarkReporter {\n const markdown: (report: DynamicBenchmarker.IReport) => string;\n}\n",
11603
11603
  "node_modules/@nestia/benchmark/lib/internal/IBenchmarkMaster.d.ts": "export interface IBenchmarkMaster {\n filter: (name: string) => boolean;\n progress: (current: number) => void;\n}\n",
11604
11604
  "node_modules/@nestia/benchmark/lib/internal/IBenchmarkServant.d.ts": "import { IBenchmarkEvent } from \"../IBenchmarkEvent\";\nexport interface IBenchmarkServant {\n execute(props: {\n count: number;\n simultaneous: number;\n }): Promise<IBenchmarkEvent[]>;\n}\n",
11605
- "node_modules/@nestia/benchmark/package.json": "{\n \"name\": \"@nestia/benchmark\",\n \"version\": \"8.0.5\",\n \"description\": \"NestJS Performance Benchmark Program\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"npm run build:main && npm run build:test\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"prepare\": \"ts-patch install\",\n \"test\": \"node bin/test\"\n },\n \"keywords\": [\n \"e2e\",\n \"nestia\",\n \"nestjs\",\n \"Performance\",\n \"benchmark\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"dependencies\": {\n \"@nestia/fetcher\": \"^8.0.5\",\n \"tgrid\": \"^1.1.0\",\n \"tstl\": \"^3.0.0\"\n },\n \"devDependencies\": {\n \"@nestia/core\": \"^8.0.5\",\n \"@nestia/e2e\": \"^8.0.5\",\n \"@nestia/sdk\": \"^8.0.5\",\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@nestjs/platform-express\": \"^11.0.13\",\n \"@types/uuid\": \"^10.0.0\",\n \"nestia\": \"workspace:^\",\n \"ts-node\": \"^10.9.2\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.7\",\n \"typia\": \"^9.6.1\",\n \"uuid\": \"^10.0.0\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
11605
+ "node_modules/@nestia/benchmark/package.json": "{\n \"name\": \"@nestia/benchmark\",\n \"version\": \"8.0.7\",\n \"description\": \"NestJS Performance Benchmark Program\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"npm run build:main && npm run build:test\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"prepare\": \"ts-patch install\",\n \"test\": \"node bin/test\"\n },\n \"keywords\": [\n \"e2e\",\n \"nestia\",\n \"nestjs\",\n \"Performance\",\n \"benchmark\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"dependencies\": {\n \"@nestia/fetcher\": \"^8.0.7\",\n \"tgrid\": \"^1.1.0\",\n \"tstl\": \"^3.0.0\"\n },\n \"devDependencies\": {\n \"@nestia/core\": \"^8.0.7\",\n \"@nestia/e2e\": \"^8.0.7\",\n \"@nestia/sdk\": \"^8.0.7\",\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@nestjs/platform-express\": \"^11.0.13\",\n \"@types/uuid\": \"^10.0.0\",\n \"nestia\": \"workspace:^\",\n \"ts-node\": \"^10.9.2\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.7\",\n \"typia\": \"^9.6.1\",\n \"uuid\": \"^10.0.0\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
11606
11606
  "node_modules/@nestia/core/lib/adaptors/WebSocketAdaptor.d.ts": "import { INestApplication } from \"@nestjs/common\";\nexport declare class WebSocketAdaptor {\n static upgrade(app: INestApplication): Promise<WebSocketAdaptor>;\n readonly close: () => Promise<void>;\n private constructor();\n private readonly handleUpgrade;\n private readonly http;\n private readonly operators;\n private readonly ws;\n}\n",
11607
11607
  "node_modules/@nestia/core/lib/decorators/DynamicModule.d.ts": "import { ModuleMetadata } from \"@nestjs/common/interfaces\";\n/**\n * Dynamic module.\n *\n * `DynamicModule` is a namespace wrapping a convenient function, which can load\n * controller classes dynamically just by specifying their directory path.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace DynamicModule {\n /**\n * Mount dynamic module.\n *\n * Constructs a module instance with directory path of controller classes.\n *\n * Every controller classes in the target directory would be dynamically\n * mounted.\n *\n * @param path Path of controllers\n * @param metadata Additional metadata except controllers\n * @returns Module instance\n */\n function mount(path: string | string[] | {\n include: string[];\n exclude?: string[];\n }, metadata?: Omit<ModuleMetadata, \"controllers\">, isTsNode?: boolean): Promise<{\n new (): {};\n }>;\n}\n",
11608
11608
  "node_modules/@nestia/core/lib/decorators/EncryptedBody.d.ts": "import { IRequestBodyValidator } from \"../options/IRequestBodyValidator\";\n/**\n * Encrypted body decorator.\n *\n * `EncryptedBody` is a decorator function getting `application/json` typed data\n * from request body which has been encrypted by AES-128/256 algorithm. Also,\n * `EncryptedBody` validates the request body data type through\n * [typia](https://github.com/samchon/typia) ad the validation speed is maximum\n * 15,000x times faster than `class-validator`.\n *\n * For reference, when the request body data is not following the promised type\n * `T`, `BadRequestException` error (status code: 400) would be thrown. Also,\n * `EncryptedRoute` decrypts request body using those options.\n *\n * - AES-128/256\n * - CBC mode\n * - PKCS #5 Padding\n * - Base64 Encoding\n *\n * @author Jeongho Nam - https://github.com/samchon\n * @returns Parameter decorator\n */\nexport declare function EncryptedBody<T>(validator?: IRequestBodyValidator<T>): ParameterDecorator;\n",
@@ -11702,7 +11702,7 @@
11702
11702
  "node_modules/minimatch/dist/esm/index.d.ts": "import { AST } from './ast.js';\ntype Platform = 'aix' | 'android' | 'darwin' | 'freebsd' | 'haiku' | 'linux' | 'openbsd' | 'sunos' | 'win32' | 'cygwin' | 'netbsd';\nexport interface MinimatchOptions {\n nobrace?: boolean;\n nocomment?: boolean;\n nonegate?: boolean;\n debug?: boolean;\n noglobstar?: boolean;\n noext?: boolean;\n nonull?: boolean;\n windowsPathsNoEscape?: boolean;\n allowWindowsEscape?: boolean;\n partial?: boolean;\n dot?: boolean;\n nocase?: boolean;\n nocaseMagicOnly?: boolean;\n magicalBraces?: boolean;\n matchBase?: boolean;\n flipNegate?: boolean;\n preserveMultipleSlashes?: boolean;\n optimizationLevel?: number;\n platform?: Platform;\n windowsNoMagicRoot?: boolean;\n}\nexport declare const minimatch: {\n (p: string, pattern: string, options?: MinimatchOptions): boolean;\n sep: Sep;\n GLOBSTAR: typeof GLOBSTAR;\n filter: (pattern: string, options?: MinimatchOptions) => (p: string) => boolean;\n defaults: (def: MinimatchOptions) => typeof minimatch;\n braceExpand: (pattern: string, options?: MinimatchOptions) => string[];\n makeRe: (pattern: string, options?: MinimatchOptions) => false | MMRegExp;\n match: (list: string[], pattern: string, options?: MinimatchOptions) => string[];\n AST: typeof AST;\n Minimatch: typeof Minimatch;\n escape: (s: string, { windowsPathsNoEscape, }?: Pick<MinimatchOptions, \"windowsPathsNoEscape\">) => string;\n unescape: (s: string, { windowsPathsNoEscape, }?: Pick<MinimatchOptions, \"windowsPathsNoEscape\">) => string;\n};\ntype Sep = '\\\\' | '/';\nexport declare const sep: Sep;\nexport declare const GLOBSTAR: unique symbol;\nexport declare const filter: (pattern: string, options?: MinimatchOptions) => (p: string) => boolean;\nexport declare const defaults: (def: MinimatchOptions) => typeof minimatch;\nexport declare const braceExpand: (pattern: string, options?: MinimatchOptions) => string[];\nexport declare const makeRe: (pattern: string, options?: MinimatchOptions) => false | MMRegExp;\nexport declare const match: (list: string[], pattern: string, options?: MinimatchOptions) => string[];\nexport type MMRegExp = RegExp & {\n _src?: string;\n _glob?: string;\n};\nexport type ParseReturnFiltered = string | MMRegExp | typeof GLOBSTAR;\nexport type ParseReturn = ParseReturnFiltered | false;\nexport declare class Minimatch {\n options: MinimatchOptions;\n set: ParseReturnFiltered[][];\n pattern: string;\n windowsPathsNoEscape: boolean;\n nonegate: boolean;\n negate: boolean;\n comment: boolean;\n empty: boolean;\n preserveMultipleSlashes: boolean;\n partial: boolean;\n globSet: string[];\n globParts: string[][];\n nocase: boolean;\n isWindows: boolean;\n platform: Platform;\n windowsNoMagicRoot: boolean;\n regexp: false | null | MMRegExp;\n constructor(pattern: string, options?: MinimatchOptions);\n hasMagic(): boolean;\n debug(..._: any[]): void;\n make(): void;\n preprocess(globParts: string[][]): string[][];\n adjascentGlobstarOptimize(globParts: string[][]): string[][];\n levelOneOptimize(globParts: string[][]): string[][];\n levelTwoFileOptimize(parts: string | string[]): string[];\n firstPhasePreProcess(globParts: string[][]): string[][];\n secondPhasePreProcess(globParts: string[][]): string[][];\n partsMatch(a: string[], b: string[], emptyGSMatch?: boolean): false | string[];\n parseNegate(): void;\n matchOne(file: string[], pattern: ParseReturn[], partial?: boolean): boolean;\n braceExpand(): string[];\n parse(pattern: string): ParseReturn;\n makeRe(): false | MMRegExp;\n slashSplit(p: string): string[];\n match(f: string, partial?: boolean): boolean;\n static defaults(def: MinimatchOptions): typeof Minimatch;\n}\nexport { AST } from './ast.js';\nexport { escape } from './escape.js';\nexport { unescape } from './unescape.js';\n//# sourceMappingURL=index.d.ts.map",
11703
11703
  "node_modules/minimatch/dist/esm/unescape.d.ts": "import { MinimatchOptions } from './index.js';\n/**\n * Un-escape a string that has been escaped with {@link escape}.\n *\n * If the {@link windowsPathsNoEscape} option is used, then square-brace\n * escapes are removed, but not backslash escapes. For example, it will turn\n * the string `'[*]'` into `*`, but it will not turn `'\\\\*'` into `'*'`,\n * becuase `\\` is a path separator in `windowsPathsNoEscape` mode.\n *\n * When `windowsPathsNoEscape` is not set, then both brace escapes and\n * backslash escapes are removed.\n *\n * Slashes (and backslashes in `windowsPathsNoEscape` mode) cannot be escaped\n * or unescaped.\n */\nexport declare const unescape: (s: string, { windowsPathsNoEscape, }?: Pick<MinimatchOptions, \"windowsPathsNoEscape\">) => string;\n//# sourceMappingURL=unescape.d.ts.map",
11704
11704
  "node_modules/minimatch/package.json": "{\n \"author\": \"Isaac Z. Schlueter <i@izs.me> (http://blog.izs.me)\",\n \"name\": \"minimatch\",\n \"description\": \"a glob matcher in javascript\",\n \"version\": \"3.1.2\",\n \"publishConfig\": {\n \"tag\": \"v3-legacy\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"git://github.com/isaacs/minimatch.git\"\n },\n \"main\": \"minimatch.js\",\n \"scripts\": {\n \"test\": \"tap\",\n \"preversion\": \"npm test\",\n \"postversion\": \"npm publish\",\n \"postpublish\": \"git push origin --all; git push origin --tags\"\n },\n \"engines\": {\n \"node\": \"*\"\n },\n \"dependencies\": {\n \"brace-expansion\": \"^1.1.7\"\n },\n \"devDependencies\": {\n \"tap\": \"^15.1.6\"\n },\n \"license\": \"ISC\",\n \"files\": [\n \"minimatch.js\"\n ]\n}\n",
11705
- "node_modules/@nestia/core/package.json": "{\n \"name\": \"@nestia/core\",\n \"version\": \"8.0.5\",\n \"description\": \"Super-fast validation decorators of NestJS\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"tsp\": {\n \"tscOptions\": {\n \"parseAllJsDoc\": true\n }\n },\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint ./**/*.ts\",\n \"eslint:fix\": \"eslint ./**/*.ts --fix\",\n \"prepare\": \"ts-patch install && typia patch\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestjs\",\n \"nestia\",\n \"typia\",\n \"validator\",\n \"decorator\",\n \"class-validator\",\n \"class-transformer\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@nestia/fetcher\": \"^8.0.5\",\n \"@nestjs/common\": \">=7.0.1\",\n \"@nestjs/core\": \">=7.0.1\",\n \"@samchon/openapi\": \"^4.5.0\",\n \"detect-ts-node\": \"^1.0.5\",\n \"get-function-location\": \"^2.0.0\",\n \"glob\": \"^11.0.3\",\n \"path-parser\": \"^6.1.0\",\n \"raw-body\": \"^2.0.0\",\n \"reflect-metadata\": \">=0.1.12\",\n \"rxjs\": \">=6.0.3\",\n \"tgrid\": \"^1.1.0\",\n \"typia\": \"^9.6.1\",\n \"ws\": \"^7.5.3\"\n },\n \"peerDependencies\": {\n \"@nestia/fetcher\": \">=8.0.5\",\n \"@nestjs/common\": \">=7.0.1\",\n \"@nestjs/core\": \">=7.0.1\",\n \"@samchon/openapi\": \">=4.5.0 <5.0.0\",\n \"reflect-metadata\": \">=0.1.12\",\n \"rxjs\": \">=6.0.3\",\n \"typia\": \"^9.6.1\"\n },\n \"devDependencies\": {\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@types/express\": \"^4.17.15\",\n \"@types/inquirer\": \"^9.0.3\",\n \"@types/multer\": \"^1.4.12\",\n \"@types/ts-expose-internals\": \"npm:ts-expose-internals@5.4.5\",\n \"@types/ws\": \"^8.5.10\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"commander\": \"^10.0.0\",\n \"comment-json\": \"^4.2.3\",\n \"eslint-plugin-deprecation\": \"^1.4.1\",\n \"fastify\": \"^4.28.1\",\n \"git-last-commit\": \"^1.0.1\",\n \"inquirer\": \"^8.2.5\",\n \"rimraf\": \"^6.0.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"tstl\": \"^3.0.0\",\n \"typescript\": \"~5.9.2\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"lib\",\n \"src\"\n ]\n}",
11705
+ "node_modules/@nestia/core/package.json": "{\n \"name\": \"@nestia/core\",\n \"version\": \"8.0.7\",\n \"description\": \"Super-fast validation decorators of NestJS\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"tsp\": {\n \"tscOptions\": {\n \"parseAllJsDoc\": true\n }\n },\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint ./**/*.ts\",\n \"eslint:fix\": \"eslint ./**/*.ts --fix\",\n \"prepare\": \"ts-patch install && typia patch\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestjs\",\n \"nestia\",\n \"typia\",\n \"validator\",\n \"decorator\",\n \"class-validator\",\n \"class-transformer\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@nestia/fetcher\": \"^8.0.7\",\n \"@nestjs/common\": \">=7.0.1\",\n \"@nestjs/core\": \">=7.0.1\",\n \"@samchon/openapi\": \"^4.5.0\",\n \"detect-ts-node\": \"^1.0.5\",\n \"get-function-location\": \"^2.0.0\",\n \"glob\": \"^11.0.3\",\n \"path-parser\": \"^6.1.0\",\n \"raw-body\": \"^2.0.0\",\n \"reflect-metadata\": \">=0.1.12\",\n \"rxjs\": \">=6.0.3\",\n \"tgrid\": \"^1.1.0\",\n \"typia\": \"^9.6.1\",\n \"ws\": \"^7.5.3\"\n },\n \"peerDependencies\": {\n \"@nestia/fetcher\": \">=8.0.7\",\n \"@nestjs/common\": \">=7.0.1\",\n \"@nestjs/core\": \">=7.0.1\",\n \"@samchon/openapi\": \">=4.5.0 <5.0.0\",\n \"reflect-metadata\": \">=0.1.12\",\n \"rxjs\": \">=6.0.3\",\n \"typia\": \"^9.6.1\"\n },\n \"devDependencies\": {\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@types/express\": \"^4.17.15\",\n \"@types/inquirer\": \"^9.0.3\",\n \"@types/multer\": \"^1.4.12\",\n \"@types/ts-expose-internals\": \"npm:ts-expose-internals@5.4.5\",\n \"@types/ws\": \"^8.5.10\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"commander\": \"^10.0.0\",\n \"comment-json\": \"^4.2.3\",\n \"eslint-plugin-deprecation\": \"^1.4.1\",\n \"fastify\": \"^4.28.1\",\n \"git-last-commit\": \"^1.0.1\",\n \"inquirer\": \"^8.2.5\",\n \"rimraf\": \"^6.0.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"tstl\": \"^3.0.0\",\n \"typescript\": \"~5.9.2\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"lib\",\n \"src\"\n ]\n}",
11706
11706
  "node_modules/@nestia/core/src/typings/get-function-location.d.ts": "declare module \"get-function-location\" {\n export default function (func: any): Promise<{\n source: string;\n line: number;\n column: number;\n }>;\n}\n",
11707
11707
  "node_modules/@nestia/core/node_modules/glob/dist/commonjs/glob.d.ts": "import { Minimatch } from 'minimatch';\nimport { Minipass } from 'minipass';\nimport { FSOption, Path, PathScurry } from 'path-scurry';\nimport { IgnoreLike } from './ignore.js';\nimport { Pattern } from './pattern.js';\nexport type MatchSet = Minimatch['set'];\nexport type GlobParts = Exclude<Minimatch['globParts'], undefined>;\n/**\n * A `GlobOptions` object may be provided to any of the exported methods, and\n * must be provided to the `Glob` constructor.\n *\n * All options are optional, boolean, and false by default, unless otherwise\n * noted.\n *\n * All resolved options are added to the Glob object as properties.\n *\n * If you are running many `glob` operations, you can pass a Glob object as the\n * `options` argument to a subsequent operation to share the previously loaded\n * cache.\n */\nexport interface GlobOptions {\n /**\n * Set to `true` to always receive absolute paths for\n * matched files. Set to `false` to always return relative paths.\n *\n * When this option is not set, absolute paths are returned for patterns\n * that are absolute, and otherwise paths are returned that are relative\n * to the `cwd` setting.\n *\n * This does _not_ make an extra system call to get\n * the realpath, it only does string path resolution.\n *\n * Conflicts with {@link withFileTypes}\n */\n absolute?: boolean;\n /**\n * Set to false to enable {@link windowsPathsNoEscape}\n *\n * @deprecated\n */\n allowWindowsEscape?: boolean;\n /**\n * The current working directory in which to search. Defaults to\n * `process.cwd()`.\n *\n * May be eiher a string path or a `file://` URL object or string.\n */\n cwd?: string | URL;\n /**\n * Include `.dot` files in normal matches and `globstar`\n * matches. Note that an explicit dot in a portion of the pattern\n * will always match dot files.\n */\n dot?: boolean;\n /**\n * Prepend all relative path strings with `./` (or `.\\` on Windows).\n *\n * Without this option, returned relative paths are \"bare\", so instead of\n * returning `'./foo/bar'`, they are returned as `'foo/bar'`.\n *\n * Relative patterns starting with `'../'` are not prepended with `./`, even\n * if this option is set.\n */\n dotRelative?: boolean;\n /**\n * Follow symlinked directories when expanding `**`\n * patterns. This can result in a lot of duplicate references in\n * the presence of cyclic links, and make performance quite bad.\n *\n * By default, a `**` in a pattern will follow 1 symbolic link if\n * it is not the first item in the pattern, or none if it is the\n * first item in the pattern, following the same behavior as Bash.\n */\n follow?: boolean;\n /**\n * string or string[], or an object with `ignored` and `childrenIgnored`\n * methods.\n *\n * If a string or string[] is provided, then this is treated as a glob\n * pattern or array of glob patterns to exclude from matches. To ignore all\n * children within a directory, as well as the entry itself, append `'/**'`\n * to the ignore pattern.\n *\n * **Note** `ignore` patterns are _always_ in `dot:true` mode, regardless of\n * any other settings.\n *\n * If an object is provided that has `ignored(path)` and/or\n * `childrenIgnored(path)` methods, then these methods will be called to\n * determine whether any Path is a match or if its children should be\n * traversed, respectively.\n */\n ignore?: string | string[] | IgnoreLike;\n /**\n * Treat brace expansion like `{a,b}` as a \"magic\" pattern. Has no\n * effect if {@link nobrace} is set.\n *\n * Only has effect on the {@link hasMagic} function.\n */\n magicalBraces?: boolean;\n /**\n * Add a `/` character to directory matches. Note that this requires\n * additional stat calls in some cases.\n */\n mark?: boolean;\n /**\n * Perform a basename-only match if the pattern does not contain any slash\n * characters. That is, `*.js` would be treated as equivalent to\n * `**\\/*.js`, matching all js files in all directories.\n */\n matchBase?: boolean;\n /**\n * Limit the directory traversal to a given depth below the cwd.\n * Note that this does NOT prevent traversal to sibling folders,\n * root patterns, and so on. It only limits the maximum folder depth\n * that the walk will descend, relative to the cwd.\n */\n maxDepth?: number;\n /**\n * Do not expand `{a,b}` and `{1..3}` brace sets.\n */\n nobrace?: boolean;\n /**\n * Perform a case-insensitive match. This defaults to `true` on macOS and\n * Windows systems, and `false` on all others.\n *\n * **Note** `nocase` should only be explicitly set when it is\n * known that the filesystem's case sensitivity differs from the\n * platform default. If set `true` on case-sensitive file\n * systems, or `false` on case-insensitive file systems, then the\n * walk may return more or less results than expected.\n */\n nocase?: boolean;\n /**\n * Do not match directories, only files. (Note: to match\n * _only_ directories, put a `/` at the end of the pattern.)\n */\n nodir?: boolean;\n /**\n * Do not match \"extglob\" patterns such as `+(a|b)`.\n */\n noext?: boolean;\n /**\n * Do not match `**` against multiple filenames. (Ie, treat it as a normal\n * `*` instead.)\n *\n * Conflicts with {@link matchBase}\n */\n noglobstar?: boolean;\n /**\n * Defaults to value of `process.platform` if available, or `'linux'` if\n * not. Setting `platform:'win32'` on non-Windows systems may cause strange\n * behavior.\n */\n platform?: NodeJS.Platform;\n /**\n * Set to true to call `fs.realpath` on all of the\n * results. In the case of an entry that cannot be resolved, the\n * entry is omitted. This incurs a slight performance penalty, of\n * course, because of the added system calls.\n */\n realpath?: boolean;\n /**\n *\n * A string path resolved against the `cwd` option, which\n * is used as the starting point for absolute patterns that start\n * with `/`, (but not drive letters or UNC paths on Windows).\n *\n * Note that this _doesn't_ necessarily limit the walk to the\n * `root` directory, and doesn't affect the cwd starting point for\n * non-absolute patterns. A pattern containing `..` will still be\n * able to traverse out of the root directory, if it is not an\n * actual root directory on the filesystem, and any non-absolute\n * patterns will be matched in the `cwd`. For example, the\n * pattern `/../*` with `{root:'/some/path'}` will return all\n * files in `/some`, not all files in `/some/path`. The pattern\n * `*` with `{root:'/some/path'}` will return all the entries in\n * the cwd, not the entries in `/some/path`.\n *\n * To start absolute and non-absolute patterns in the same\n * path, you can use `{root:''}`. However, be aware that on\n * Windows systems, a pattern like `x:/*` or `//host/share/*` will\n * _always_ start in the `x:/` or `//host/share` directory,\n * regardless of the `root` setting.\n */\n root?: string;\n /**\n * A [PathScurry](http://npm.im/path-scurry) object used\n * to traverse the file system. If the `nocase` option is set\n * explicitly, then any provided `scurry` object must match this\n * setting.\n */\n scurry?: PathScurry;\n /**\n * Call `lstat()` on all entries, whether required or not to determine\n * if it's a valid match. When used with {@link withFileTypes}, this means\n * that matches will include data such as modified time, permissions, and\n * so on. Note that this will incur a performance cost due to the added\n * system calls.\n */\n stat?: boolean;\n /**\n * An AbortSignal which will cancel the Glob walk when\n * triggered.\n */\n signal?: AbortSignal;\n /**\n * Use `\\\\` as a path separator _only_, and\n * _never_ as an escape character. If set, all `\\\\` characters are\n * replaced with `/` in the pattern.\n *\n * Note that this makes it **impossible** to match against paths\n * containing literal glob pattern characters, but allows matching\n * with patterns constructed using `path.join()` and\n * `path.resolve()` on Windows platforms, mimicking the (buggy!)\n * behavior of Glob v7 and before on Windows. Please use with\n * caution, and be mindful of [the caveat below about Windows\n * paths](#windows). (For legacy reasons, this is also set if\n * `allowWindowsEscape` is set to the exact value `false`.)\n */\n windowsPathsNoEscape?: boolean;\n /**\n * Return [PathScurry](http://npm.im/path-scurry)\n * `Path` objects instead of strings. These are similar to a\n * NodeJS `Dirent` object, but with additional methods and\n * properties.\n *\n * Conflicts with {@link absolute}\n */\n withFileTypes?: boolean;\n /**\n * An fs implementation to override some or all of the defaults. See\n * http://npm.im/path-scurry for details about what can be overridden.\n */\n fs?: FSOption;\n /**\n * Just passed along to Minimatch. Note that this makes all pattern\n * matching operations slower and *extremely* noisy.\n */\n debug?: boolean;\n /**\n * Return `/` delimited paths, even on Windows.\n *\n * On posix systems, this has no effect. But, on Windows, it means that\n * paths will be `/` delimited, and absolute paths will be their full\n * resolved UNC forms, eg instead of `'C:\\\\foo\\\\bar'`, it would return\n * `'//?/C:/foo/bar'`\n */\n posix?: boolean;\n /**\n * Do not match any children of any matches. For example, the pattern\n * `**\\/foo` would match `a/foo`, but not `a/foo/b/foo` in this mode.\n *\n * This is especially useful for cases like \"find all `node_modules`\n * folders, but not the ones in `node_modules`\".\n *\n * In order to support this, the `Ignore` implementation must support an\n * `add(pattern: string)` method. If using the default `Ignore` class, then\n * this is fine, but if this is set to `false`, and a custom `Ignore` is\n * provided that does not have an `add()` method, then it will throw an\n * error.\n *\n * **Caveat** It *only* ignores matches that would be a descendant of a\n * previous match, and only if that descendant is matched *after* the\n * ancestor is encountered. Since the file system walk happens in\n * indeterminate order, it's possible that a match will already be added\n * before its ancestor, if multiple or braced patterns are used.\n *\n * For example:\n *\n * ```ts\n * const results = await glob([\n * // likely to match first, since it's just a stat\n * 'a/b/c/d/e/f',\n *\n * // this pattern is more complicated! It must to various readdir()\n * // calls and test the results against a regular expression, and that\n * // is certainly going to take a little bit longer.\n * //\n * // So, later on, it encounters a match at 'a/b/c/d/e', but it's too\n * // late to ignore a/b/c/d/e/f, because it's already been emitted.\n * 'a/[bdf]/?/[a-z]/*',\n * ], { includeChildMatches: false })\n * ```\n *\n * It's best to only set this to `false` if you can be reasonably sure that\n * no components of the pattern will potentially match one another's file\n * system descendants, or if the occasional included child entry will not\n * cause problems.\n *\n * @default true\n */\n includeChildMatches?: boolean;\n}\nexport type GlobOptionsWithFileTypesTrue = GlobOptions & {\n withFileTypes: true;\n absolute?: undefined;\n mark?: undefined;\n posix?: undefined;\n};\nexport type GlobOptionsWithFileTypesFalse = GlobOptions & {\n withFileTypes?: false;\n};\nexport type GlobOptionsWithFileTypesUnset = GlobOptions & {\n withFileTypes?: undefined;\n};\nexport type Result<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? Path : Opts extends GlobOptionsWithFileTypesFalse ? string : Opts extends GlobOptionsWithFileTypesUnset ? string : string | Path;\nexport type Results<Opts> = Result<Opts>[];\nexport type FileTypes<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? true : Opts extends GlobOptionsWithFileTypesFalse ? false : Opts extends GlobOptionsWithFileTypesUnset ? false : boolean;\n/**\n * An object that can perform glob pattern traversals.\n */\nexport declare class Glob<Opts extends GlobOptions> implements GlobOptions {\n absolute?: boolean;\n cwd: string;\n root?: string;\n dot: boolean;\n dotRelative: boolean;\n follow: boolean;\n ignore?: string | string[] | IgnoreLike;\n magicalBraces: boolean;\n mark?: boolean;\n matchBase: boolean;\n maxDepth: number;\n nobrace: boolean;\n nocase: boolean;\n nodir: boolean;\n noext: boolean;\n noglobstar: boolean;\n pattern: string[];\n platform: NodeJS.Platform;\n realpath: boolean;\n scurry: PathScurry;\n stat: boolean;\n signal?: AbortSignal;\n windowsPathsNoEscape: boolean;\n withFileTypes: FileTypes<Opts>;\n includeChildMatches: boolean;\n /**\n * The options provided to the constructor.\n */\n opts: Opts;\n /**\n * An array of parsed immutable {@link Pattern} objects.\n */\n patterns: Pattern[];\n /**\n * All options are stored as properties on the `Glob` object.\n *\n * See {@link GlobOptions} for full options descriptions.\n *\n * Note that a previous `Glob` object can be passed as the\n * `GlobOptions` to another `Glob` instantiation to re-use settings\n * and caches with a new pattern.\n *\n * Traversal functions can be called multiple times to run the walk\n * again.\n */\n constructor(pattern: string | string[], opts: Opts);\n /**\n * Returns a Promise that resolves to the results array.\n */\n walk(): Promise<Results<Opts>>;\n /**\n * synchronous {@link Glob.walk}\n */\n walkSync(): Results<Opts>;\n /**\n * Stream results asynchronously.\n */\n stream(): Minipass<Result<Opts>, Result<Opts>>;\n /**\n * Stream results synchronously.\n */\n streamSync(): Minipass<Result<Opts>, Result<Opts>>;\n /**\n * Default sync iteration function. Returns a Generator that\n * iterates over the results.\n */\n iterateSync(): Generator<Result<Opts>, void, void>;\n [Symbol.iterator](): Generator<Result<Opts>, void, void>;\n /**\n * Default async iteration function. Returns an AsyncGenerator that\n * iterates over the results.\n */\n iterate(): AsyncGenerator<Result<Opts>, void, void>;\n [Symbol.asyncIterator](): AsyncGenerator<Result<Opts>, void, void>;\n}\n//# sourceMappingURL=glob.d.ts.map",
11708
11708
  "node_modules/@nestia/core/node_modules/glob/dist/commonjs/has-magic.d.ts": "import { GlobOptions } from './glob.js';\n/**\n * Return true if the patterns provided contain any magic glob characters,\n * given the options provided.\n *\n * Brace expansion is not considered \"magic\" unless the `magicalBraces` option\n * is set, as brace expansion just turns one string into an array of strings.\n * So a pattern like `'x{a,b}y'` would return `false`, because `'xay'` and\n * `'xby'` both do not contain any magic glob characters, and it's treated the\n * same as if you had called it on `['xay', 'xby']`. When `magicalBraces:true`\n * is in the options, brace expansion _is_ treated as a pattern having magic.\n */\nexport declare const hasMagic: (pattern: string | string[], options?: GlobOptions) => boolean;\n//# sourceMappingURL=has-magic.d.ts.map",
@@ -11741,7 +11741,7 @@
11741
11741
  "node_modules/@nestia/e2e/lib/index.d.ts": "import * as e2e from \"./module\";\nexport default e2e;\nexport * from \"./module\";\n",
11742
11742
  "node_modules/@nestia/e2e/lib/internal/json_equal_to.d.ts": "export declare const json_equal_to: (exception: (key: string) => boolean) => <T>(x: T) => (y: T | null | undefined) => string[];\n",
11743
11743
  "node_modules/@nestia/e2e/lib/module.d.ts": "export * from \"./ArrayUtil\";\nexport * from \"./MapUtil\";\nexport * from \"./RandomGenerator\";\nexport * from \"./DynamicExecutor\";\nexport * from \"./GaffComparator\";\nexport * from \"./TestValidator\";\n",
11744
- "node_modules/@nestia/e2e/package.json": "{\n \"name\": \"@nestia/e2e\",\n \"version\": \"8.0.5\",\n \"description\": \"E2E test utilify functions\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"npm run build:main && npm run build:test\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"prepare\": \"ts-patch install && typia patch\",\n \"test\": \"node bin/test\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"e2e\",\n \"nestia\",\n \"nestjs\",\n \"test\",\n \"tdd\",\n \"utility\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"devDependencies\": {\n \"@trivago/prettier-plugin-sort-imports\": \"^4.0.0\",\n \"@types/node\": \"^18.11.18\",\n \"@typescript-eslint/eslint-plugin\": \"^5.57.0\",\n \"@typescript-eslint/parser\": \"^5.57.0\",\n \"rimraf\": \"^6.0.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.7\",\n \"typia\": \"^9.6.1\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
11744
+ "node_modules/@nestia/e2e/package.json": "{\n \"name\": \"@nestia/e2e\",\n \"version\": \"8.0.7\",\n \"description\": \"E2E test utilify functions\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"npm run build:main && npm run build:test\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"prepare\": \"ts-patch install && typia patch\",\n \"test\": \"node bin/test\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"e2e\",\n \"nestia\",\n \"nestjs\",\n \"test\",\n \"tdd\",\n \"utility\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"devDependencies\": {\n \"@trivago/prettier-plugin-sort-imports\": \"^4.0.0\",\n \"@types/node\": \"^18.11.18\",\n \"@typescript-eslint/eslint-plugin\": \"^5.57.0\",\n \"@typescript-eslint/parser\": \"^5.57.0\",\n \"rimraf\": \"^6.0.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.7\",\n \"typia\": \"^9.6.1\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
11745
11745
  "node_modules/@nestia/editor/lib/NestiaEditorApplication.d.ts": "export declare function NestiaEditorApplication(): import(\"react/jsx-runtime\").JSX.Element;\n",
11746
11746
  "node_modules/@nestia/editor/lib/NestiaEditorIframe.d.ts": "import { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nexport declare function NestiaEditorIframe(props: NestiaEditorIframe.IProps): import(\"react/jsx-runtime\").JSX.Element;\nexport declare namespace NestiaEditorIframe {\n interface IProps {\n swagger: string | SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument;\n package?: string;\n keyword?: boolean;\n simulate?: boolean;\n e2e?: boolean;\n }\n}\n",
11747
11747
  "node_modules/@nestia/editor/lib/NestiaEditorModule.d.ts": "import type { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nexport declare namespace NestiaEditorModule {\n const setup: (props: {\n path: string;\n application: INestApplication;\n swagger: string | SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument;\n package?: string;\n simulate?: boolean;\n e2e?: boolean;\n }) => Promise<void>;\n}\ninterface INestApplication {\n use(...args: any[]): this;\n getUrl(): Promise<string>;\n getHttpAdapter(): INestHttpAdaptor;\n setGlobalPrefix(prefix: string, options?: any): this;\n}\ninterface INestHttpAdaptor {\n getType(): string;\n close(): any;\n init?(): Promise<void>;\n get: Function;\n post: Function;\n put: Function;\n patch: Function;\n delete: Function;\n head: Function;\n all: Function;\n}\nexport {};\n",
@@ -11750,7 +11750,7 @@
11750
11750
  "node_modules/@nestia/editor/lib/internal/NestiaEditorComposer.d.ts": "import { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nimport { IValidation } from \"typia\";\nexport declare namespace NestiaEditorComposer {\n interface IProps {\n document: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument;\n e2e: boolean;\n keyword: boolean;\n simulate: boolean;\n package?: string;\n }\n interface IOutput {\n files: Record<string, string>;\n openFile: string;\n startScript: string[];\n }\n const nest: (props: IProps) => Promise<IValidation<IOutput>>;\n const sdk: (props: IProps) => Promise<IValidation<IOutput>>;\n}\n",
11751
11751
  "node_modules/@nestia/editor/lib/internal/NestiaEditorFileUploader.d.ts": "import { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nexport declare function NestiaEditorFileUploader(props: NestiaEditorFileUploader.IProps): import(\"react/jsx-runtime\").JSX.Element;\nexport declare namespace NestiaEditorFileUploader {\n interface IProps {\n onChange: (swagger: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument | null, error: string | null) => void;\n }\n}\n",
11752
11752
  "node_modules/@nestia/editor/lib/main.d.ts": "export {};\n",
11753
- "node_modules/@nestia/editor/package.json": "{\n \"name\": \"@nestia/editor\",\n \"version\": \"8.0.5\",\n \"main\": \"lib/index.js\",\n \"module\": \"lib/index.mjs\",\n \"typings\": \"lib/index.d.ts\",\n \"description\": \"Swagger-UI + Cloud TypeScript Editor\",\n \"scripts\": {\n \"build\": \"npm run build:static && npm run build:lib\",\n \"build:static\": \"rimraf dist && tsc -b && vite build\",\n \"build:lib\": \"rimraf lib && tsc --project tsconfig.lib.json && rollup -c\",\n \"dev\": \"vite\",\n \"lint\": \"eslint .\",\n \"preview\": \"vite preview\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"openapi\",\n \"swagger\",\n \"generator\",\n \"cloud\",\n \"typescript\",\n \"editor\",\n \"sdk\",\n \"nestjs\",\n \"nestia\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@mui/material\": \"^5.15.6\",\n \"@nestia/migrate\": \"^8.0.5\",\n \"@samchon/openapi\": \"^4.5.0\",\n \"@stackblitz/sdk\": \"^1.11.0\",\n \"@trivago/prettier-plugin-sort-imports\": \"^5.2.2\",\n \"js-yaml\": \"^4.1.0\",\n \"prettier\": \"3.3.3\",\n \"prettier-plugin-jsdoc\": \"^1.3.2\",\n \"react-mui-fileuploader\": \"^0.5.2\",\n \"typia\": \"^9.6.1\"\n },\n \"devDependencies\": {\n \"@eslint/js\": \"^9.13.0\",\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@nestjs/platform-express\": \"^11.0.13\",\n \"@nestjs/platform-fastify\": \"^11.0.13\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^12.1.1\",\n \"@types/js-yaml\": \"^4.0.9\",\n \"@types/node\": \"^22.8.6\",\n \"@types/react\": \"^18.3.11\",\n \"@types/react-dom\": \"^18.3.1\",\n \"@vitejs/plugin-react\": \"^4.3.3\",\n \"eslint\": \"^9.13.0\",\n \"eslint-plugin-react-hooks\": \"^5.0.0\",\n \"eslint-plugin-react-refresh\": \"^0.4.13\",\n \"globals\": \"^15.11.0\",\n \"react\": \"^18.3.1\",\n \"react-dom\": \"^18.3.1\",\n \"rollup\": \"^4.24.2\",\n \"ts-node\": \"^10.9.2\",\n \"typescript\": \"~5.9.2\",\n \"typescript-eslint\": \"^8.10.0\",\n \"vite\": \"^5.4.9\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"dist\",\n \"lib\",\n \"src\"\n ]\n}",
11753
+ "node_modules/@nestia/editor/package.json": "{\n \"name\": \"@nestia/editor\",\n \"version\": \"8.0.7\",\n \"main\": \"lib/index.js\",\n \"module\": \"lib/index.mjs\",\n \"typings\": \"lib/index.d.ts\",\n \"description\": \"Swagger-UI + Cloud TypeScript Editor\",\n \"scripts\": {\n \"build\": \"npm run build:static && npm run build:lib\",\n \"build:static\": \"rimraf dist && tsc -b && vite build\",\n \"build:lib\": \"rimraf lib && tsc --project tsconfig.lib.json && rollup -c\",\n \"dev\": \"vite\",\n \"lint\": \"eslint .\",\n \"preview\": \"vite preview\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"openapi\",\n \"swagger\",\n \"generator\",\n \"cloud\",\n \"typescript\",\n \"editor\",\n \"sdk\",\n \"nestjs\",\n \"nestia\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@mui/material\": \"^5.15.6\",\n \"@nestia/migrate\": \"^8.0.7\",\n \"@samchon/openapi\": \"^4.5.0\",\n \"@stackblitz/sdk\": \"^1.11.0\",\n \"@trivago/prettier-plugin-sort-imports\": \"^5.2.2\",\n \"js-yaml\": \"^4.1.0\",\n \"prettier\": \"3.3.3\",\n \"prettier-plugin-jsdoc\": \"^1.3.2\",\n \"react-mui-fileuploader\": \"^0.5.2\",\n \"typia\": \"^9.6.1\"\n },\n \"devDependencies\": {\n \"@eslint/js\": \"^9.13.0\",\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@nestjs/platform-express\": \"^11.0.13\",\n \"@nestjs/platform-fastify\": \"^11.0.13\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^12.1.1\",\n \"@types/js-yaml\": \"^4.0.9\",\n \"@types/node\": \"^22.8.6\",\n \"@types/react\": \"^18.3.11\",\n \"@types/react-dom\": \"^18.3.1\",\n \"@vitejs/plugin-react\": \"^4.3.3\",\n \"eslint\": \"^9.13.0\",\n \"eslint-plugin-react-hooks\": \"^5.0.0\",\n \"eslint-plugin-react-refresh\": \"^0.4.13\",\n \"globals\": \"^15.11.0\",\n \"react\": \"^18.3.1\",\n \"react-dom\": \"^18.3.1\",\n \"rollup\": \"^4.24.2\",\n \"ts-node\": \"^10.9.2\",\n \"typescript\": \"~5.9.2\",\n \"typescript-eslint\": \"^8.10.0\",\n \"vite\": \"^5.4.9\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"dist\",\n \"lib\",\n \"src\"\n ]\n}",
11754
11754
  "node_modules/@nestia/editor/src/vite-env.d.ts": "/// <reference types=\"vite/client\" />\n",
11755
11755
  "node_modules/@nestia/fetcher/lib/AesPkcs5.d.ts": "/**\n * Utility class for the AES-128/256 encryption.\n *\n * - AES-128/256\n * - CBC mode\n * - PKCS#5 Padding\n * - Base64 Encoding\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace AesPkcs5 {\n /**\n * Encrypt data\n *\n * @param data Target data\n * @param key Key value of the encryption.\n * @param iv Initializer Vector for the encryption\n * @returns Encrypted data\n */\n function encrypt(data: string, key: string, iv: string): string;\n /**\n * Decrypt data.\n *\n * @param data Target data\n * @param key Key value of the decryption.\n * @param iv Initializer Vector for the decryption\n * @returns Decrypted data.\n */\n function decrypt(data: string, key: string, iv: string): string;\n}\n",
11756
11756
  "node_modules/@nestia/fetcher/lib/EncryptedFetcher.d.ts": "import { IConnection } from \"./IConnection\";\nimport { IFetchRoute } from \"./IFetchRoute\";\nimport { IPropagation } from \"./IPropagation\";\n/**\n * Utility class for `fetch` functions used in `@nestia/sdk` with encryption.\n *\n * `EncryptedFetcher` is a utility class designed for SDK functions generated by\n * [`@nestia/sdk`](https://nestia.io/docs/sdk/sdk), interacting with the remote\n * HTTP API encrypted by AES-PKCS algorithm. In other words, this is a\n * collection of dedicated `fetch()` functions for `@nestia/sdk` with\n * encryption.\n *\n * For reference, `EncryptedFetcher` class being used only when target\n * controller method is encrypting body data by `@EncryptedRoute` or\n * `@EncryptedBody` decorators. If those decorators are not used,\n * {@link PlainFetcher} class would be used instead.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace EncryptedFetcher {\n /**\n * Fetch function only for `HEAD` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Nothing because of `HEAD` method\n */\n function fetch(connection: IConnection, route: IFetchRoute<\"HEAD\">): Promise<void>;\n /**\n * Fetch function only for `GET` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Output>(connection: IConnection, route: IFetchRoute<\"GET\">): Promise<Output>;\n /**\n * Fetch function for the `POST`, `PUT`, `PATCH` and `DELETE` methods.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Input, Output>(connection: IConnection, route: IFetchRoute<\"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n function propagate<Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"GET\" | \"HEAD\">): Promise<Output>;\n function propagate<Input, Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"DELETE\" | \"GET\" | \"HEAD\" | \"PATCH\" | \"POST\" | \"PUT\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n}\n",
@@ -11766,7 +11766,7 @@
11766
11766
  "node_modules/@nestia/fetcher/lib/PlainFetcher.d.ts": "import { IConnection } from \"./IConnection\";\nimport { IFetchRoute } from \"./IFetchRoute\";\nimport { IPropagation } from \"./IPropagation\";\n/**\n * Utility class for `fetch` functions used in `@nestia/sdk`.\n *\n * `PlainFetcher` is a utility class designed for SDK functions generated by\n * [`@nestia/sdk`](https://nestia.io/docs/sdk/sdk), interacting with the remote\n * HTTP sever API. In other words, this is a collection of dedicated `fetch()`\n * functions for `@nestia/sdk`.\n *\n * For reference, `PlainFetcher` class does not encrypt or decrypt the body data\n * at all. It just delivers plain data without any post processing. If you've\n * defined a controller method through `@EncryptedRoute` or `@EncryptedBody`\n * decorator, then {@liink EncryptedFetcher} class would be used instead.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace PlainFetcher {\n /**\n * Fetch function only for `HEAD` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Nothing because of `HEAD` method\n */\n function fetch(connection: IConnection, route: IFetchRoute<\"HEAD\">): Promise<void>;\n /**\n * Fetch function only for `GET` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Output>(connection: IConnection, route: IFetchRoute<\"GET\">): Promise<Output>;\n /**\n * Fetch function for the `POST`, `PUT`, `PATCH` and `DELETE` methods.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Input, Output>(connection: IConnection, route: IFetchRoute<\"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n function propagate<Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"GET\" | \"HEAD\">): Promise<Output>;\n function propagate<Input, Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"DELETE\" | \"GET\" | \"HEAD\" | \"PATCH\" | \"POST\" | \"PUT\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n}\n",
11767
11767
  "node_modules/@nestia/fetcher/lib/index.d.ts": "export * from \"./FormDataInput\";\nexport * from \"./HttpError\";\nexport * from \"./IConnection\";\nexport * from \"./IEncryptionPassword\";\nexport * from \"./IFetchEvent\";\nexport * from \"./IFetchRoute\";\nexport * from \"./IPropagation\";\n",
11768
11768
  "node_modules/@nestia/fetcher/lib/internal/FetcherBase.d.ts": "export {};\n",
11769
- "node_modules/@nestia/fetcher/package.json": "{\n \"name\": \"@nestia/fetcher\",\n \"version\": \"8.0.5\",\n \"description\": \"Fetcher library of Nestia SDK\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint src\",\n \"eslint:fix\": \"eslint src --fix\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestia\",\n \"fetcher\",\n \"sdk\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@samchon/openapi\": \"^4.5.0\"\n },\n \"devDependencies\": {\n \"@types/node\": \"^18.11.14\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"rimraf\": \"^6.0.1\",\n \"typescript\": \"~5.9.2\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"lib\",\n \"src\"\n ]\n}",
11769
+ "node_modules/@nestia/fetcher/package.json": "{\n \"name\": \"@nestia/fetcher\",\n \"version\": \"8.0.7\",\n \"description\": \"Fetcher library of Nestia SDK\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint src\",\n \"eslint:fix\": \"eslint src --fix\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestia\",\n \"fetcher\",\n \"sdk\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@samchon/openapi\": \"^4.5.0\"\n },\n \"devDependencies\": {\n \"@types/node\": \"^18.11.14\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"rimraf\": \"^6.0.1\",\n \"typescript\": \"~5.9.2\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"lib\",\n \"src\"\n ]\n}",
11770
11770
  "node_modules/@nestia/migrate/lib/NestiaMigrateApplication.d.ts": "import { IHttpMigrateApplication, OpenApi, OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nimport { IValidation } from \"typia\";\nimport { INestiaMigrateConfig } from \"./structures/INestiaMigrateConfig\";\nimport { INestiaMigrateContext } from \"./structures/INestiaMigrateContext\";\nimport { INestiaMigrateFile } from \"./structures/INestiaMigrateFile\";\nexport declare class NestiaMigrateApplication {\n readonly document: OpenApi.IDocument;\n private readonly data_;\n constructor(document: OpenApi.IDocument);\n static assert(document: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument | OpenApi.IDocument): NestiaMigrateApplication;\n static validate(document: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument | OpenApi.IDocument): IValidation<NestiaMigrateApplication>;\n getData(): IHttpMigrateApplication;\n /** @deprecated */\n getErrors(): IHttpMigrateApplication.IError[];\n nest(config: INestiaMigrateConfig): Record<string, string>;\n sdk(config: INestiaMigrateConfig): Record<string, string>;\n}\nexport declare namespace MigrateApplication {\n interface IOutput {\n context: INestiaMigrateContext;\n files: INestiaMigrateFile[];\n errors: IHttpMigrateApplication.IError[];\n }\n}\n",
11771
11771
  "node_modules/@nestia/migrate/lib/analyzers/NestiaMigrateControllerAnalyzer.d.ts": "import { IHttpMigrateRoute } from \"@samchon/openapi\";\nimport { INestiaMigrateController } from \"../structures/INestiaMigrateController\";\nexport declare namespace NestiaMigrateControllerAnalyzer {\n const analyze: (routes: IHttpMigrateRoute[]) => INestiaMigrateController[];\n}\n",
11772
11772
  "node_modules/@nestia/migrate/lib/archivers/NestiaMigrateFileArchiver.d.ts": "export declare namespace NestiaMigrateFileArchiver {\n const archive: (props: {\n mkdir: (path: string) => Promise<void>;\n writeFile: (path: string, content: string) => Promise<void>;\n root: string;\n files: Record<string, string>;\n }) => Promise<void>;\n}\n",
@@ -11807,7 +11807,7 @@
11807
11807
  "node_modules/@nestia/migrate/lib/utils/StringUtil.d.ts": "export declare namespace StringUtil {\n const capitalize: (str: string) => string;\n const splitWithNormalization: (path: string) => string[];\n const escapeDuplicate: (keep: string[]) => (change: string) => string;\n const escapeNonVariable: (str: string) => string;\n}\n",
11808
11808
  "node_modules/@nestia/migrate/lib/utils/openapi-down-convert/RefVisitor.d.ts": "/**\n * Recursively walk a JSON object and invoke a callback function on each `{\n * \"$ref\" : \"path\" }` object found\n */\n/**\n * Represents a JSON Reference object, such as `{\"$ref\":\n * \"#/components/schemas/problemResponse\" }`\n */\nexport interface RefObject {\n $ref: string;\n}\n/** JsonNode represents a node within the OpenAPI object */\nexport type JsonNode = object | [] | string | boolean | null | number;\n/** A JSON Schema object in an API def */\nexport type SchemaObject = object;\n/** Function signature for the visitRefObjects callback */\nexport type RefVisitor = (node: RefObject) => JsonNode;\n/** Function signature for the visitSchemaObjects callback */\nexport type SchemaVisitor = (node: SchemaObject) => SchemaObject;\n/** /** Function signature for the walkObject callback */\nexport type ObjectVisitor = (node: object) => JsonNode;\n/** Test if a JSON node is a `{ $ref: \"uri\" }` object */\nexport declare function isRef(node: any): boolean;\n/**\n * Walk a JSON object and apply `schemaCallback` when a JSON schema is found.\n * JSON Schema objects are items in components/schemas or in an item named\n * `schema`\n *\n * @param node A node in the OpenAPI document\n * @param schemaCallback The function to call on JSON schema objects\n * @returns The modified (annotated) node\n */\nexport declare function visitSchemaObjects(node: any, schemaCallback: SchemaVisitor): any;\n/**\n * Walk a JSON object and apply `refCallback` when a JSON `{$ref: url }` is\n * found\n *\n * @param node A node in the OpenAPI document\n * @param refCallback The function to call on JSON `$ref` objects\n * @returns The modified (annotated) node\n */\nexport declare function visitRefObjects(node: any, refCallback: RefVisitor): any;\n/**\n * Walk a JSON object or array and apply objectCallback when a JSON object is\n * found\n *\n * @param node A node in the OpenAPI document\n * @param objectCallback The function to call on JSON objects\n * @param nav Tracks where we are in the original document\n * @returns The modified (annotated) node\n */\nexport declare function walkObject(node: object, objectCallback: ObjectVisitor): JsonNode;\n",
11809
11809
  "node_modules/@nestia/migrate/lib/utils/openapi-down-convert/converter.d.ts": "/** Options for the converter instantiation */\nexport interface ConverterOptions {\n /** If `true`, log conversion transformations to stderr */\n verbose?: boolean;\n /**\n * If `true`, remove `id` values in schema examples, to bypass [Spectral issue\n * 2081](https://github.com/stoplightio/spectral/issues/2081)\n */\n deleteExampleWithId?: boolean;\n /** If `true`, replace a `$ref` object that has siblings into an `allOf` */\n allOfTransform?: boolean;\n /** The authorizationUrl for openIdConnect -> oauth2 transformation */\n authorizationUrl?: string;\n /** The tokenUrl for openIdConnect -> oauth2 transformation */\n tokenUrl?: string;\n /**\n * Name of YAML/JSON file with scope descriptions. This is a simple map in the\n * format `{ scope1: \"description of scope1\", ... }`\n */\n scopeDescriptionFile?: string;\n /**\n * Earlier versions of the tool converted $comment to x-comment in JSON\n * Schemas. The tool now deletes $comment values by default. Use this option\n * to preserve the conversion and not delete comments.\n */\n convertSchemaComments?: boolean;\n}\nexport declare class Converter {\n private openapi30;\n private verbose;\n private deleteExampleWithId;\n private allOfTransform;\n private authorizationUrl;\n /** The tokenUrl for openIdConnect -> oauth2 transformation */\n private tokenUrl;\n private scopeDescriptions;\n private convertSchemaComments;\n private returnCode;\n /**\n * Construct a new Converter\n *\n * @throws Error if the scopeDescriptionFile (if specified) cannot be read or\n * parsed as YAML/JSON\n */\n constructor(openapiDocument: object, options?: ConverterOptions);\n /**\n * Load the scopes.yaml file and save in this.scopeDescriptions\n *\n * @throws Error if the file cannot be read or parsed as YAML/JSON\n */\n private loadScopeDescriptions;\n /**\n * Log a message to console.warn stream if verbose is true\n *\n * @param message Parameters for console.warn\n */\n private log;\n /**\n * Log a message to console.warn stream. Prefix the message string with\n * `Warning: ` if it does not already have that text.\n *\n * @param message Parameters for console.warn\n */\n private warn;\n /**\n * Log an error message to `console.error` stream. Prefix the message string\n * with `Error: ` if it does not already start with `'Error'`. Increments the\n * `returnCode`, causing the CLI to throw an Error when done.\n *\n * @param message Parameters for `console.error`\n */\n private error;\n /**\n * Convert the OpenAPI document to 3.0\n *\n * @returns The converted document. The input is not modified.\n */\n convert(): object;\n /**\n * OpenAPI 3.1 uses JSON Schema 2020-12 which allows schema `examples`;\n * OpenAPI 3.0 uses JSON Scheme Draft 7 which only allows `example`. Replace\n * all `examples` with `example`, using `examples[0]`\n */\n convertJsonSchemaExamples(): void;\n private walkNestedSchemaObjects;\n /**\n * OpenAPI 3.1 uses JSON Schema 2020-12 which allows `const` OpenAPI 3.0 uses\n * JSON Scheme Draft 7 which only allows `enum`. Replace all `const: value`\n * with `enum: [ value ]`\n */\n convertConstToEnum(): void;\n /**\n * Convert 2-element type arrays containing 'null' to string type and\n * `nullable: true`\n */\n convertNullableTypeArray(): void;\n removeWebhooksObject(): void;\n removeUnsupportedSchemaKeywords(): void;\n renameSchema$comment(): void;\n private deleteSchema$comment;\n /**\n * Convert\n *\n * contentMediaType: \"application/octet-stream\";\n *\n * To\n *\n * format: binary;\n *\n * In `type: string` schemas. Warn if schema has a `format` already and it is\n * not `binary`.\n */\n convertJsonSchemaContentMediaType(): void;\n /**\n * Convert\n *\n * contentEncoding: base64;\n *\n * To\n *\n * format: byte;\n *\n * In `type: string` schemas. It is an error if the schema has a `format`\n * already and it is not `byte`.\n */\n convertJsonSchemaContentEncoding(): void;\n private json;\n /**\n * OpenAPI 3.1 defines a new `openIdConnect` security scheme. Down-convert the\n * scheme to `oauth2` / authorization code flow. Collect all the scopes used\n * in any security requirements within operations and add them to the scheme.\n * Also define the URLs to the `authorizationUrl` and `tokenUrl` of `oauth2`.\n */\n convertSecuritySchemes(): void;\n /**\n * Find remaining OpenAPI 3.0 [Reference\n * Objects](https://github.com/OAI/OpenAPI-Specification/blob/main/versions/3.1.0.md#referenceObject)\n * and down convert them to [JSON\n * Reference](https://tools.ietf.org/html/draft-pbryan-zyp-json-ref-03)\n * objects with _only_ a `$ref` property.\n */\n simplifyNonSchemaRef(): void;\n removeLicenseIdentifier(): void;\n convertSchemaRef(): void;\n static deepClone(obj: object): object;\n}\n",
11810
- "node_modules/@nestia/migrate/package.json": "{\n \"name\": \"@nestia/migrate\",\n \"version\": \"8.0.5\",\n \"description\": \"Migration program from swagger to NestJS\",\n \"typings\": \"lib/index.d.ts\",\n \"main\": \"lib/index.js\",\n \"module\": \"lib/index.mjs\",\n \"bin\": {\n \"@nestia/migrate\": \"lib/executable/migrate.js\"\n },\n \"scripts\": {\n \"build\": \"rimraf lib && tsc && rollup -c\",\n \"bundle\": \"node src/executable/bundle.js\",\n \"dev\": \"rimraf lib && tsc --watch\",\n \"package:next\": \"npm publish --access public --tag next\",\n \"prepare\": \"ts-patch install && typia patch && npm run bundle\",\n \"test\": \"node lib/test\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"migration\",\n \"swagger\",\n \"openapi generator\",\n \"NestJS\",\n \"nestia\",\n \"SDK\",\n \"RPC\",\n \"Mockup Simulator\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"devDependencies\": {\n \"@nestia/benchmark\": \"^8.0.5\",\n \"@nestia/core\": \"^8.0.5\",\n \"@nestia/e2e\": \"^8.0.5\",\n \"@nestia/fetcher\": \"^8.0.5\",\n \"@nestia/sdk\": \"^8.0.5\",\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@nestjs/platform-express\": \"^11.0.13\",\n \"@nestjs/platform-fastify\": \"^11.0.13\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^12.1.1\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/cli-progress\": \"^3.11.5\",\n \"@types/express\": \"^4.17.21\",\n \"@types/inquirer\": \"^9.0.7\",\n \"@types/multer\": \"^1.4.12\",\n \"@types/node\": \"^20.3.3\",\n \"@types/swagger-ui-express\": \"^4.1.6\",\n \"chalk\": \"4.1.2\",\n \"cli-progress\": \"^3.12.0\",\n \"dotenv\": \"^16.3.1\",\n \"dotenv-expand\": \"^10.0.0\",\n \"express\": \"^4.19.2\",\n \"multer\": \"^2.0.2\",\n \"rimraf\": \"^6.0.1\",\n \"rollup\": \"^4.24.3\",\n \"serialize-error\": \"^4.1.0\",\n \"source-map-support\": \"^0.5.21\",\n \"swagger-ui-express\": \"^5.0.0\",\n \"tgrid\": \"^1.1.0\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript-transform-paths\": \"^3.5.2\"\n },\n \"dependencies\": {\n \"@samchon/openapi\": \"^4.5.0\",\n \"commander\": \"10.0.0\",\n \"inquirer\": \"8.2.5\",\n \"prettier\": \"^3.3.3\",\n \"prettier-plugin-jsdoc\": \"^1.3.2\",\n \"tstl\": \"^3.0.0\",\n \"typescript\": \"~5.9.2\",\n \"typia\": \"^9.6.1\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"!lib/test\",\n \"!src/test\",\n \"package.json\",\n \"README.md\",\n \"LICENSE\"\n ]\n}",
11810
+ "node_modules/@nestia/migrate/package.json": "{\n \"name\": \"@nestia/migrate\",\n \"version\": \"8.0.7\",\n \"description\": \"Migration program from swagger to NestJS\",\n \"typings\": \"lib/index.d.ts\",\n \"main\": \"lib/index.js\",\n \"module\": \"lib/index.mjs\",\n \"bin\": {\n \"@nestia/migrate\": \"lib/executable/migrate.js\"\n },\n \"scripts\": {\n \"build\": \"rimraf lib && tsc && rollup -c\",\n \"bundle\": \"node src/executable/bundle.js\",\n \"dev\": \"rimraf lib && tsc --watch\",\n \"package:next\": \"npm publish --access public --tag next\",\n \"prepare\": \"ts-patch install && typia patch && npm run bundle\",\n \"test\": \"node lib/test\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"migration\",\n \"swagger\",\n \"openapi generator\",\n \"NestJS\",\n \"nestia\",\n \"SDK\",\n \"RPC\",\n \"Mockup Simulator\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"devDependencies\": {\n \"@nestia/benchmark\": \"^8.0.7\",\n \"@nestia/core\": \"^8.0.7\",\n \"@nestia/e2e\": \"^8.0.7\",\n \"@nestia/fetcher\": \"^8.0.7\",\n \"@nestia/sdk\": \"^8.0.7\",\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@nestjs/platform-express\": \"^11.0.13\",\n \"@nestjs/platform-fastify\": \"^11.0.13\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^12.1.1\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/cli-progress\": \"^3.11.5\",\n \"@types/express\": \"^4.17.21\",\n \"@types/inquirer\": \"^9.0.7\",\n \"@types/multer\": \"^1.4.12\",\n \"@types/node\": \"^20.3.3\",\n \"@types/swagger-ui-express\": \"^4.1.6\",\n \"chalk\": \"4.1.2\",\n \"cli-progress\": \"^3.12.0\",\n \"dotenv\": \"^16.3.1\",\n \"dotenv-expand\": \"^10.0.0\",\n \"express\": \"^4.19.2\",\n \"multer\": \"^2.0.2\",\n \"rimraf\": \"^6.0.1\",\n \"rollup\": \"^4.24.3\",\n \"serialize-error\": \"^4.1.0\",\n \"source-map-support\": \"^0.5.21\",\n \"swagger-ui-express\": \"^5.0.0\",\n \"tgrid\": \"^1.1.0\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript-transform-paths\": \"^3.5.2\"\n },\n \"dependencies\": {\n \"@samchon/openapi\": \"^4.5.0\",\n \"commander\": \"10.0.0\",\n \"inquirer\": \"8.2.5\",\n \"prettier\": \"^3.3.3\",\n \"prettier-plugin-jsdoc\": \"^1.3.2\",\n \"tstl\": \"^3.0.0\",\n \"typescript\": \"~5.9.2\",\n \"typia\": \"^9.6.1\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"!lib/test\",\n \"!src/test\",\n \"package.json\",\n \"README.md\",\n \"LICENSE\"\n ]\n}",
11811
11811
  "node_modules/@nestia/sdk/lib/INestiaConfig.d.ts": "import type { INestApplication } from \"@nestjs/common\";\nimport type { OpenApi } from \"@samchon/openapi\";\n/**\n * Definition for the `nestia.config.ts` file.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport interface INestiaConfig {\n /**\n * Accessor of controller classes.\n *\n * You can specify target controller classes within two ways.\n *\n * - Asynchronous function returning `INestApplication` instance\n * - Specify the path or directory of controller class files\n */\n input: (() => Promise<INestApplication>) | INestiaConfig.IInput | string[] | string;\n /**\n * Building `swagger.json` is also possible.\n *\n * If not specified, you can't build the `swagger.json`.\n */\n swagger?: INestiaConfig.ISwaggerConfig;\n /**\n * Response directory that SDK would be placed in.\n *\n * If not configured, you can't build the SDK library.\n */\n output?: string;\n /**\n * Target directory that SDK distribution files would be placed in.\n *\n * If you configure this property and runs `npx nestia sdk` command,\n * distribution environments for the SDK library would be generated.\n *\n * After the SDK library generation, move to the `distribute` directory, and\n * runs `npm publish` command, then you can share SDK library with other\n * client (frontend) developers.\n *\n * Recommend to use `\"packages/api\"` value.\n */\n distribute?: string;\n /** @default false */\n keyword?: boolean;\n /**\n * Allow simulation mode.\n *\n * If you configure this property to be `true`, the SDK library would be\n * contain simulation mode. In the simulation mode, the SDK library would not\n * communicate with the real backend server, but just returns random mock-up\n * data with requestion data validation.\n *\n * For reference, random mock-up data would be generated by\n * `typia.random<T>()` function.\n *\n * @default false\n */\n simulate?: boolean;\n /**\n * Target directory that e2e test functions would be placed in.\n *\n * If you configure this property and runs `npx nestia e2e` command,\n * `@nestia/sdk` will analyze your NestJS backend server code, and generates\n * e2e test functions for every API endpoints.\n *\n * If not configured, you can't run `npx nestia e2e` command.\n */\n e2e?: string;\n /**\n * Whether to use propagation mode or not.\n *\n * If being configured, interaction functions of the SDK library would perform\n * the propagation mode. The propagation mode means that never throwing\n * exception even when status code is not 200 (or 201), but just returning the\n * {@link IPropagation} typed instance, which can specify its body type through\n * discriminated union determined by status code.\n *\n * @default false\n */\n propagate?: boolean;\n /**\n * Whether to clone DTO structures or not.\n *\n * If being configured, all of DTOs used in the backend server would be cloned\n * into the `structures` directory, and the SDK library would be refer to the\n * cloned DTOs instead of the original.\n *\n * @default false\n */\n clone?: boolean;\n /**\n * Whether to wrap DTO by primitive type.\n *\n * If you don't configure this property as `false`, all of DTOs in the SDK\n * library would be automatically wrapped by {@link Primitive} type.\n *\n * For refenrece, if a DTO type be capsuled by the {@link Primitive} type, all\n * of methods in the DTO type would be automatically erased. Also, if the DTO\n * has a `toJSON()` method, the DTO type would be automatically converted to\n * return type of the `toJSON()` method.\n *\n * @default true\n */\n primitive?: boolean;\n /**\n * Whether to assert parameter types or not.\n *\n * If you configure this property to be `true`, all of the function parameters\n * of SDK library would be checked through [`typia.assert<T>()`\n * function](https://typia.io/docs/validators/assert/).\n *\n * This option would make your SDK library compilation time a little bit\n * slower, but would enahcne the type safety even in the runtime level.\n *\n * @default false\n */\n assert?: boolean;\n /**\n * Whether to optimize JSON string conversion 10x faster or not.\n *\n * If you configure this property to be `true`, the SDK library would utilize\n * the [`typia.assertStringify<T>()\n * function`](https://github.com/samchon/typia#enhanced-json) to boost up JSON\n * serialization speed and ensure type safety.\n *\n * This option would make your SDK library compilation time a little bit\n * slower, but would enhance JSON serialization speed 10x faster. Also, it can\n * ensure type safety even in the runtime level.\n *\n * @default false\n */\n json?: boolean;\n}\nexport declare namespace INestiaConfig {\n /**\n * List of files or directories to include or exclude to specifying the NestJS\n * controllers.\n */\n interface IInput {\n /** List of files or directories containing the NestJS controller classes. */\n include: string[];\n /** List of files or directories to be excluded. */\n exclude?: string[];\n }\n /** Building `swagger.json` is also possible. */\n interface ISwaggerConfig {\n /**\n * Response path of the `swagger.json`.\n *\n * If you've configured only directory, the file name would be the\n * `swagger.json`. Otherwise you've configured the full path with file name\n * and extension, the `swagger.json` file would be renamed to it.\n */\n output: string;\n /**\n * OpenAPI version.\n *\n * If you configure this property to be `2.0` or `3.0`, the newly generated\n * `swagger.json` file would follow the specified OpenAPI version. The newly\n * generated `swagger.json` file would be downgraded from the OpenAPI v3.1\n * specification by {@link OpenApi.downgrade} method.\n *\n * @default 3.1\n */\n openapi?: \"2.0\" | \"3.0\" | \"3.1\";\n /**\n * Whether to beautify JSON content or not.\n *\n * If you configure this property to be `true`, the `swagger.json` file\n * would be beautified with indentation (2 spaces) and line breaks. If you\n * configure numeric value instead, the indentation would be specified by\n * the number.\n *\n * @default false\n */\n beautify?: boolean | number;\n /**\n * Whether to include additional information or not.\n *\n * If configured to be `true`, those properties would be added into each API\n * endpoinnt.\n *\n * - `x-nestia-method`\n * - `x-nestia-namespace` ` `x-nestia-jsDocTags`\n *\n * @default false\n */\n additional?: boolean;\n /**\n * API information.\n *\n * If omitted, `package.json` content would be used instead.\n */\n info?: Partial<OpenApi.IDocument.IInfo>;\n /** List of server addresses. */\n servers?: OpenApi.IServer[];\n /**\n * Security schemes.\n *\n * When generating `swagger.json` file through `nestia`, if your controllers\n * or theirs methods have a security key which is not enrolled in here\n * property, it would be an error.\n */\n security?: Record<string, OpenApi.ISecurityScheme>;\n /**\n * List of tag names with description.\n *\n * It is possible to omit this property or skip some tag name even if the\n * tag name is used in the API routes. In that case, the tag name would be\n * used without description.\n *\n * Of course, if you've written a comment like `@tag {name} {description}`,\n * you can entirely replace this property specification.\n */\n tags?: OpenApi.IDocument.ITag[];\n /**\n * Decompose query DTO.\n *\n * If you configure this property to be `true`, the query DTO would be\n * decomposed into individual query parameters per each property. Otherwise\n * you set it to be `false`, the query DTO would be one object type which\n * contains all of query parameters.\n *\n * @default true\n */\n decompose?: boolean;\n /**\n * Operation ID generator.\n *\n * @param props Properties of the API endpoint.\n * @returns Operation ID.\n */\n operationId?(props: {\n class: string;\n function: string;\n method: \"HEAD\" | \"GET\" | \"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\";\n path: string;\n }): string;\n }\n}\n",
11812
11812
  "node_modules/@nestia/sdk/lib/NestiaSdkApplication.d.ts": "import { INestiaConfig } from \"./INestiaConfig\";\nexport declare class NestiaSdkApplication {\n private readonly config;\n constructor(config: INestiaConfig);\n all(): Promise<void>;\n e2e(): Promise<void>;\n sdk(): Promise<void>;\n swagger(): Promise<void>;\n private generate;\n}\n",
11813
11813
  "node_modules/@nestia/sdk/lib/NestiaSwaggerComposer.d.ts": "import { INestApplication } from \"@nestjs/common\";\nimport { OpenApi, OpenApiV3, SwaggerV2 } from \"@samchon/openapi\";\nimport { INestiaConfig } from \"./INestiaConfig\";\nexport declare namespace NestiaSwaggerComposer {\n const document: (app: INestApplication, config: Omit<INestiaConfig.ISwaggerConfig, \"output\">) => Promise<OpenApi.IDocument | OpenApiV3.IDocument | SwaggerV2.IDocument>;\n}\n",
@@ -11906,7 +11906,7 @@
11906
11906
  "node_modules/@nestia/sdk/lib/validators/HttpQueryValidator.d.ts": "import { MetadataFactory } from \"typia/lib/factories/MetadataFactory\";\nimport { Metadata } from \"typia/lib/schemas/metadata/Metadata\";\nexport declare namespace HttpQueryValidator {\n const validate: (meta: Metadata, explore: MetadataFactory.IExplore) => string[];\n}\n",
11907
11907
  "node_modules/path-to-regexp/dist/index.d.ts": "/**\n * Encode a string into another string.\n */\nexport type Encode = (value: string) => string;\n/**\n * Decode a string into another string.\n */\nexport type Decode = (value: string) => string;\nexport interface ParseOptions {\n /**\n * A function for encoding input strings.\n */\n encodePath?: Encode;\n}\nexport interface PathToRegexpOptions {\n /**\n * Matches the path completely without trailing characters. (default: `true`)\n */\n end?: boolean;\n /**\n * Allows optional trailing delimiter to match. (default: `true`)\n */\n trailing?: boolean;\n /**\n * Match will be case sensitive. (default: `false`)\n */\n sensitive?: boolean;\n /**\n * The default delimiter for segments. (default: `'/'`)\n */\n delimiter?: string;\n}\nexport interface MatchOptions extends PathToRegexpOptions {\n /**\n * Function for decoding strings for params, or `false` to disable entirely. (default: `decodeURIComponent`)\n */\n decode?: Decode | false;\n}\nexport interface CompileOptions {\n /**\n * Function for encoding input strings for output into the path, or `false` to disable entirely. (default: `encodeURIComponent`)\n */\n encode?: Encode | false;\n /**\n * The default delimiter for segments. (default: `'/'`)\n */\n delimiter?: string;\n}\n/**\n * Plain text.\n */\nexport interface Text {\n type: \"text\";\n value: string;\n}\n/**\n * A parameter designed to match arbitrary text within a segment.\n */\nexport interface Parameter {\n type: \"param\";\n name: string;\n}\n/**\n * A wildcard parameter designed to match multiple segments.\n */\nexport interface Wildcard {\n type: \"wildcard\";\n name: string;\n}\n/**\n * A set of possible tokens to expand when matching.\n */\nexport interface Group {\n type: \"group\";\n tokens: Token[];\n}\n/**\n * A token that corresponds with a regexp capture.\n */\nexport type Key = Parameter | Wildcard;\n/**\n * A sequence of `path-to-regexp` keys that match capturing groups.\n */\nexport type Keys = Array<Key>;\n/**\n * A sequence of path match characters.\n */\nexport type Token = Text | Parameter | Wildcard | Group;\n/**\n * Tokenized path instance.\n */\nexport declare class TokenData {\n readonly tokens: Token[];\n constructor(tokens: Token[]);\n}\n/**\n * Parse a string for the raw tokens.\n */\nexport declare function parse(str: string, options?: ParseOptions): TokenData;\n/**\n * Compile a string to a template function for the path.\n */\nexport declare function compile<P extends ParamData = ParamData>(path: Path, options?: CompileOptions & ParseOptions): (data?: P) => string;\nexport type ParamData = Partial<Record<string, string | string[]>>;\nexport type PathFunction<P extends ParamData> = (data?: P) => string;\n/**\n * A match result contains data about the path match.\n */\nexport interface MatchResult<P extends ParamData> {\n path: string;\n params: P;\n}\n/**\n * A match is either `false` (no match) or a match result.\n */\nexport type Match<P extends ParamData> = false | MatchResult<P>;\n/**\n * The match function takes a string and returns whether it matched the path.\n */\nexport type MatchFunction<P extends ParamData> = (path: string) => Match<P>;\n/**\n * Supported path types.\n */\nexport type Path = string | TokenData;\n/**\n * Transform a path into a match function.\n */\nexport declare function match<P extends ParamData>(path: Path | Path[], options?: MatchOptions & ParseOptions): MatchFunction<P>;\nexport declare function pathToRegexp(path: Path | Path[], options?: PathToRegexpOptions & ParseOptions): {\n regexp: RegExp;\n keys: Keys;\n};\n/**\n * Stringify token data into a path string.\n */\nexport declare function stringify(data: TokenData): string;\n",
11908
11908
  "node_modules/path-to-regexp/package.json": "{\n \"name\": \"path-to-regexp\",\n \"version\": \"8.2.0\",\n \"description\": \"Express style path to RegExp utility\",\n \"keywords\": [\n \"express\",\n \"regexp\",\n \"route\",\n \"routing\"\n ],\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/pillarjs/path-to-regexp.git\"\n },\n \"license\": \"MIT\",\n \"exports\": \"./dist/index.js\",\n \"main\": \"dist/index.js\",\n \"typings\": \"dist/index.d.ts\",\n \"files\": [\n \"dist/\"\n ],\n \"scripts\": {\n \"bench\": \"vitest bench\",\n \"build\": \"ts-scripts build\",\n \"format\": \"ts-scripts format\",\n \"lint\": \"ts-scripts lint\",\n \"prepare\": \"ts-scripts install && npm run build\",\n \"size\": \"size-limit\",\n \"specs\": \"ts-scripts specs\",\n \"test\": \"ts-scripts test && npm run size\"\n },\n \"devDependencies\": {\n \"@borderless/ts-scripts\": \"^0.15.0\",\n \"@size-limit/preset-small-lib\": \"^11.1.2\",\n \"@types/node\": \"^22.7.2\",\n \"@types/semver\": \"^7.3.1\",\n \"@vitest/coverage-v8\": \"^2.1.1\",\n \"recheck\": \"^4.4.5\",\n \"size-limit\": \"^11.1.2\",\n \"typescript\": \"^5.5.3\"\n },\n \"engines\": {\n \"node\": \">=16\"\n },\n \"publishConfig\": {\n \"access\": \"public\"\n },\n \"size-limit\": [\n {\n \"path\": \"dist/index.js\",\n \"limit\": \"2.2 kB\"\n }\n ],\n \"ts-scripts\": {\n \"dist\": [\n \"dist\"\n ],\n \"project\": [\n \"tsconfig.build.json\"\n ]\n }\n}\n",
11909
- "node_modules/@nestia/sdk/package.json": "{\n \"name\": \"@nestia/sdk\",\n \"version\": \"8.0.5\",\n \"description\": \"Nestia SDK and Swagger generator\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"bin\": {\n \"@nestia/sdk\": \"lib/executable/sdk.js\"\n },\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint ./**/*.ts\",\n \"prepare\": \"ts-patch install && typia patch\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestia\",\n \"sdk\",\n \"swagger\",\n \"generator\",\n \"nestjs\",\n \"typia\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@nestia/core\": \"^8.0.5\",\n \"@nestia/fetcher\": \"^8.0.5\",\n \"@samchon/openapi\": \"^4.5.0\",\n \"cli\": \"^1.0.1\",\n \"get-function-location\": \"^2.0.0\",\n \"glob\": \"^11.0.3\",\n \"path-to-regexp\": \"^6.2.1\",\n \"prettier\": \"^3.2.5\",\n \"ts-node\": \">=10.6.0\",\n \"tsconfck\": \"^2.1.2\",\n \"tsconfig-paths\": \"^4.1.1\",\n \"tstl\": \"^3.0.0\",\n \"typia\": \"^9.6.1\"\n },\n \"peerDependencies\": {\n \"@nestia/core\": \">=8.0.5\"\n },\n \"devDependencies\": {\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/cli\": \"^0.11.21\",\n \"@types/express\": \"^4.17.15\",\n \"@types/node\": \"^18.11.15\",\n \"@types/ts-expose-internals\": \"npm:ts-expose-internals@5.4.5\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"eslint\": \"^8.29.0\",\n \"eslint-plugin-deprecation\": \"^1.4.1\",\n \"rimraf\": \"^6.0.1\",\n \"tgrid\": \"^1.1.0\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.4\"\n },\n \"files\": [\n \"assets\",\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
11909
+ "node_modules/@nestia/sdk/package.json": "{\n \"name\": \"@nestia/sdk\",\n \"version\": \"8.0.7\",\n \"description\": \"Nestia SDK and Swagger generator\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"bin\": {\n \"@nestia/sdk\": \"lib/executable/sdk.js\"\n },\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint ./**/*.ts\",\n \"prepare\": \"ts-patch install && typia patch\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestia\",\n \"sdk\",\n \"swagger\",\n \"generator\",\n \"nestjs\",\n \"typia\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@nestia/core\": \"^8.0.7\",\n \"@nestia/fetcher\": \"^8.0.7\",\n \"@samchon/openapi\": \"^4.5.0\",\n \"cli\": \"^1.0.1\",\n \"get-function-location\": \"^2.0.0\",\n \"glob\": \"^11.0.3\",\n \"path-to-regexp\": \"^6.2.1\",\n \"prettier\": \"^3.2.5\",\n \"ts-node\": \">=10.6.0\",\n \"tsconfck\": \"^2.1.2\",\n \"tsconfig-paths\": \"^4.1.1\",\n \"tstl\": \"^3.0.0\",\n \"typia\": \"^9.6.1\"\n },\n \"peerDependencies\": {\n \"@nestia/core\": \">=8.0.7\"\n },\n \"devDependencies\": {\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/cli\": \"^0.11.21\",\n \"@types/express\": \"^4.17.15\",\n \"@types/node\": \"^18.11.15\",\n \"@types/ts-expose-internals\": \"npm:ts-expose-internals@5.4.5\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"eslint\": \"^8.29.0\",\n \"eslint-plugin-deprecation\": \"^1.4.1\",\n \"rimraf\": \"^6.0.1\",\n \"tgrid\": \"^1.1.0\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.4\"\n },\n \"files\": [\n \"assets\",\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
11910
11910
  "node_modules/@nestia/sdk/src/typings/get-function-location.d.ts": "declare module \"get-function-location\" {\n export default function (func: any): Promise<{\n source: string;\n line: number;\n column: number;\n }>;\n}\n",
11911
11911
  "node_modules/@nestia/sdk/node_modules/glob/dist/commonjs/glob.d.ts": "import { Minimatch } from 'minimatch';\nimport { Minipass } from 'minipass';\nimport { FSOption, Path, PathScurry } from 'path-scurry';\nimport { IgnoreLike } from './ignore.js';\nimport { Pattern } from './pattern.js';\nexport type MatchSet = Minimatch['set'];\nexport type GlobParts = Exclude<Minimatch['globParts'], undefined>;\n/**\n * A `GlobOptions` object may be provided to any of the exported methods, and\n * must be provided to the `Glob` constructor.\n *\n * All options are optional, boolean, and false by default, unless otherwise\n * noted.\n *\n * All resolved options are added to the Glob object as properties.\n *\n * If you are running many `glob` operations, you can pass a Glob object as the\n * `options` argument to a subsequent operation to share the previously loaded\n * cache.\n */\nexport interface GlobOptions {\n /**\n * Set to `true` to always receive absolute paths for\n * matched files. Set to `false` to always return relative paths.\n *\n * When this option is not set, absolute paths are returned for patterns\n * that are absolute, and otherwise paths are returned that are relative\n * to the `cwd` setting.\n *\n * This does _not_ make an extra system call to get\n * the realpath, it only does string path resolution.\n *\n * Conflicts with {@link withFileTypes}\n */\n absolute?: boolean;\n /**\n * Set to false to enable {@link windowsPathsNoEscape}\n *\n * @deprecated\n */\n allowWindowsEscape?: boolean;\n /**\n * The current working directory in which to search. Defaults to\n * `process.cwd()`.\n *\n * May be eiher a string path or a `file://` URL object or string.\n */\n cwd?: string | URL;\n /**\n * Include `.dot` files in normal matches and `globstar`\n * matches. Note that an explicit dot in a portion of the pattern\n * will always match dot files.\n */\n dot?: boolean;\n /**\n * Prepend all relative path strings with `./` (or `.\\` on Windows).\n *\n * Without this option, returned relative paths are \"bare\", so instead of\n * returning `'./foo/bar'`, they are returned as `'foo/bar'`.\n *\n * Relative patterns starting with `'../'` are not prepended with `./`, even\n * if this option is set.\n */\n dotRelative?: boolean;\n /**\n * Follow symlinked directories when expanding `**`\n * patterns. This can result in a lot of duplicate references in\n * the presence of cyclic links, and make performance quite bad.\n *\n * By default, a `**` in a pattern will follow 1 symbolic link if\n * it is not the first item in the pattern, or none if it is the\n * first item in the pattern, following the same behavior as Bash.\n */\n follow?: boolean;\n /**\n * string or string[], or an object with `ignored` and `childrenIgnored`\n * methods.\n *\n * If a string or string[] is provided, then this is treated as a glob\n * pattern or array of glob patterns to exclude from matches. To ignore all\n * children within a directory, as well as the entry itself, append `'/**'`\n * to the ignore pattern.\n *\n * **Note** `ignore` patterns are _always_ in `dot:true` mode, regardless of\n * any other settings.\n *\n * If an object is provided that has `ignored(path)` and/or\n * `childrenIgnored(path)` methods, then these methods will be called to\n * determine whether any Path is a match or if its children should be\n * traversed, respectively.\n */\n ignore?: string | string[] | IgnoreLike;\n /**\n * Treat brace expansion like `{a,b}` as a \"magic\" pattern. Has no\n * effect if {@link nobrace} is set.\n *\n * Only has effect on the {@link hasMagic} function.\n */\n magicalBraces?: boolean;\n /**\n * Add a `/` character to directory matches. Note that this requires\n * additional stat calls in some cases.\n */\n mark?: boolean;\n /**\n * Perform a basename-only match if the pattern does not contain any slash\n * characters. That is, `*.js` would be treated as equivalent to\n * `**\\/*.js`, matching all js files in all directories.\n */\n matchBase?: boolean;\n /**\n * Limit the directory traversal to a given depth below the cwd.\n * Note that this does NOT prevent traversal to sibling folders,\n * root patterns, and so on. It only limits the maximum folder depth\n * that the walk will descend, relative to the cwd.\n */\n maxDepth?: number;\n /**\n * Do not expand `{a,b}` and `{1..3}` brace sets.\n */\n nobrace?: boolean;\n /**\n * Perform a case-insensitive match. This defaults to `true` on macOS and\n * Windows systems, and `false` on all others.\n *\n * **Note** `nocase` should only be explicitly set when it is\n * known that the filesystem's case sensitivity differs from the\n * platform default. If set `true` on case-sensitive file\n * systems, or `false` on case-insensitive file systems, then the\n * walk may return more or less results than expected.\n */\n nocase?: boolean;\n /**\n * Do not match directories, only files. (Note: to match\n * _only_ directories, put a `/` at the end of the pattern.)\n */\n nodir?: boolean;\n /**\n * Do not match \"extglob\" patterns such as `+(a|b)`.\n */\n noext?: boolean;\n /**\n * Do not match `**` against multiple filenames. (Ie, treat it as a normal\n * `*` instead.)\n *\n * Conflicts with {@link matchBase}\n */\n noglobstar?: boolean;\n /**\n * Defaults to value of `process.platform` if available, or `'linux'` if\n * not. Setting `platform:'win32'` on non-Windows systems may cause strange\n * behavior.\n */\n platform?: NodeJS.Platform;\n /**\n * Set to true to call `fs.realpath` on all of the\n * results. In the case of an entry that cannot be resolved, the\n * entry is omitted. This incurs a slight performance penalty, of\n * course, because of the added system calls.\n */\n realpath?: boolean;\n /**\n *\n * A string path resolved against the `cwd` option, which\n * is used as the starting point for absolute patterns that start\n * with `/`, (but not drive letters or UNC paths on Windows).\n *\n * Note that this _doesn't_ necessarily limit the walk to the\n * `root` directory, and doesn't affect the cwd starting point for\n * non-absolute patterns. A pattern containing `..` will still be\n * able to traverse out of the root directory, if it is not an\n * actual root directory on the filesystem, and any non-absolute\n * patterns will be matched in the `cwd`. For example, the\n * pattern `/../*` with `{root:'/some/path'}` will return all\n * files in `/some`, not all files in `/some/path`. The pattern\n * `*` with `{root:'/some/path'}` will return all the entries in\n * the cwd, not the entries in `/some/path`.\n *\n * To start absolute and non-absolute patterns in the same\n * path, you can use `{root:''}`. However, be aware that on\n * Windows systems, a pattern like `x:/*` or `//host/share/*` will\n * _always_ start in the `x:/` or `//host/share` directory,\n * regardless of the `root` setting.\n */\n root?: string;\n /**\n * A [PathScurry](http://npm.im/path-scurry) object used\n * to traverse the file system. If the `nocase` option is set\n * explicitly, then any provided `scurry` object must match this\n * setting.\n */\n scurry?: PathScurry;\n /**\n * Call `lstat()` on all entries, whether required or not to determine\n * if it's a valid match. When used with {@link withFileTypes}, this means\n * that matches will include data such as modified time, permissions, and\n * so on. Note that this will incur a performance cost due to the added\n * system calls.\n */\n stat?: boolean;\n /**\n * An AbortSignal which will cancel the Glob walk when\n * triggered.\n */\n signal?: AbortSignal;\n /**\n * Use `\\\\` as a path separator _only_, and\n * _never_ as an escape character. If set, all `\\\\` characters are\n * replaced with `/` in the pattern.\n *\n * Note that this makes it **impossible** to match against paths\n * containing literal glob pattern characters, but allows matching\n * with patterns constructed using `path.join()` and\n * `path.resolve()` on Windows platforms, mimicking the (buggy!)\n * behavior of Glob v7 and before on Windows. Please use with\n * caution, and be mindful of [the caveat below about Windows\n * paths](#windows). (For legacy reasons, this is also set if\n * `allowWindowsEscape` is set to the exact value `false`.)\n */\n windowsPathsNoEscape?: boolean;\n /**\n * Return [PathScurry](http://npm.im/path-scurry)\n * `Path` objects instead of strings. These are similar to a\n * NodeJS `Dirent` object, but with additional methods and\n * properties.\n *\n * Conflicts with {@link absolute}\n */\n withFileTypes?: boolean;\n /**\n * An fs implementation to override some or all of the defaults. See\n * http://npm.im/path-scurry for details about what can be overridden.\n */\n fs?: FSOption;\n /**\n * Just passed along to Minimatch. Note that this makes all pattern\n * matching operations slower and *extremely* noisy.\n */\n debug?: boolean;\n /**\n * Return `/` delimited paths, even on Windows.\n *\n * On posix systems, this has no effect. But, on Windows, it means that\n * paths will be `/` delimited, and absolute paths will be their full\n * resolved UNC forms, eg instead of `'C:\\\\foo\\\\bar'`, it would return\n * `'//?/C:/foo/bar'`\n */\n posix?: boolean;\n /**\n * Do not match any children of any matches. For example, the pattern\n * `**\\/foo` would match `a/foo`, but not `a/foo/b/foo` in this mode.\n *\n * This is especially useful for cases like \"find all `node_modules`\n * folders, but not the ones in `node_modules`\".\n *\n * In order to support this, the `Ignore` implementation must support an\n * `add(pattern: string)` method. If using the default `Ignore` class, then\n * this is fine, but if this is set to `false`, and a custom `Ignore` is\n * provided that does not have an `add()` method, then it will throw an\n * error.\n *\n * **Caveat** It *only* ignores matches that would be a descendant of a\n * previous match, and only if that descendant is matched *after* the\n * ancestor is encountered. Since the file system walk happens in\n * indeterminate order, it's possible that a match will already be added\n * before its ancestor, if multiple or braced patterns are used.\n *\n * For example:\n *\n * ```ts\n * const results = await glob([\n * // likely to match first, since it's just a stat\n * 'a/b/c/d/e/f',\n *\n * // this pattern is more complicated! It must to various readdir()\n * // calls and test the results against a regular expression, and that\n * // is certainly going to take a little bit longer.\n * //\n * // So, later on, it encounters a match at 'a/b/c/d/e', but it's too\n * // late to ignore a/b/c/d/e/f, because it's already been emitted.\n * 'a/[bdf]/?/[a-z]/*',\n * ], { includeChildMatches: false })\n * ```\n *\n * It's best to only set this to `false` if you can be reasonably sure that\n * no components of the pattern will potentially match one another's file\n * system descendants, or if the occasional included child entry will not\n * cause problems.\n *\n * @default true\n */\n includeChildMatches?: boolean;\n}\nexport type GlobOptionsWithFileTypesTrue = GlobOptions & {\n withFileTypes: true;\n absolute?: undefined;\n mark?: undefined;\n posix?: undefined;\n};\nexport type GlobOptionsWithFileTypesFalse = GlobOptions & {\n withFileTypes?: false;\n};\nexport type GlobOptionsWithFileTypesUnset = GlobOptions & {\n withFileTypes?: undefined;\n};\nexport type Result<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? Path : Opts extends GlobOptionsWithFileTypesFalse ? string : Opts extends GlobOptionsWithFileTypesUnset ? string : string | Path;\nexport type Results<Opts> = Result<Opts>[];\nexport type FileTypes<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? true : Opts extends GlobOptionsWithFileTypesFalse ? false : Opts extends GlobOptionsWithFileTypesUnset ? false : boolean;\n/**\n * An object that can perform glob pattern traversals.\n */\nexport declare class Glob<Opts extends GlobOptions> implements GlobOptions {\n absolute?: boolean;\n cwd: string;\n root?: string;\n dot: boolean;\n dotRelative: boolean;\n follow: boolean;\n ignore?: string | string[] | IgnoreLike;\n magicalBraces: boolean;\n mark?: boolean;\n matchBase: boolean;\n maxDepth: number;\n nobrace: boolean;\n nocase: boolean;\n nodir: boolean;\n noext: boolean;\n noglobstar: boolean;\n pattern: string[];\n platform: NodeJS.Platform;\n realpath: boolean;\n scurry: PathScurry;\n stat: boolean;\n signal?: AbortSignal;\n windowsPathsNoEscape: boolean;\n withFileTypes: FileTypes<Opts>;\n includeChildMatches: boolean;\n /**\n * The options provided to the constructor.\n */\n opts: Opts;\n /**\n * An array of parsed immutable {@link Pattern} objects.\n */\n patterns: Pattern[];\n /**\n * All options are stored as properties on the `Glob` object.\n *\n * See {@link GlobOptions} for full options descriptions.\n *\n * Note that a previous `Glob` object can be passed as the\n * `GlobOptions` to another `Glob` instantiation to re-use settings\n * and caches with a new pattern.\n *\n * Traversal functions can be called multiple times to run the walk\n * again.\n */\n constructor(pattern: string | string[], opts: Opts);\n /**\n * Returns a Promise that resolves to the results array.\n */\n walk(): Promise<Results<Opts>>;\n /**\n * synchronous {@link Glob.walk}\n */\n walkSync(): Results<Opts>;\n /**\n * Stream results asynchronously.\n */\n stream(): Minipass<Result<Opts>, Result<Opts>>;\n /**\n * Stream results synchronously.\n */\n streamSync(): Minipass<Result<Opts>, Result<Opts>>;\n /**\n * Default sync iteration function. Returns a Generator that\n * iterates over the results.\n */\n iterateSync(): Generator<Result<Opts>, void, void>;\n [Symbol.iterator](): Generator<Result<Opts>, void, void>;\n /**\n * Default async iteration function. Returns an AsyncGenerator that\n * iterates over the results.\n */\n iterate(): AsyncGenerator<Result<Opts>, void, void>;\n [Symbol.asyncIterator](): AsyncGenerator<Result<Opts>, void, void>;\n}\n//# sourceMappingURL=glob.d.ts.map",
11912
11912
  "node_modules/@nestia/sdk/node_modules/glob/dist/commonjs/has-magic.d.ts": "import { GlobOptions } from './glob.js';\n/**\n * Return true if the patterns provided contain any magic glob characters,\n * given the options provided.\n *\n * Brace expansion is not considered \"magic\" unless the `magicalBraces` option\n * is set, as brace expansion just turns one string into an array of strings.\n * So a pattern like `'x{a,b}y'` would return `false`, because `'xay'` and\n * `'xby'` both do not contain any magic glob characters, and it's treated the\n * same as if you had called it on `['xay', 'xby']`. When `magicalBraces:true`\n * is in the options, brace expansion _is_ treated as a pattern having magic.\n */\nexport declare const hasMagic: (pattern: string | string[], options?: GlobOptions) => boolean;\n//# sourceMappingURL=has-magic.d.ts.map",
package/lib/raw/test.json CHANGED
@@ -8,7 +8,7 @@
8
8
  "node_modules/@nestia/e2e/lib/index.d.ts": "import * as e2e from \"./module\";\nexport default e2e;\nexport * from \"./module\";\n",
9
9
  "node_modules/@nestia/e2e/lib/internal/json_equal_to.d.ts": "export declare const json_equal_to: (exception: (key: string) => boolean) => <T>(x: T) => (y: T | null | undefined) => string[];\n",
10
10
  "node_modules/@nestia/e2e/lib/module.d.ts": "export * from \"./ArrayUtil\";\nexport * from \"./MapUtil\";\nexport * from \"./RandomGenerator\";\nexport * from \"./DynamicExecutor\";\nexport * from \"./GaffComparator\";\nexport * from \"./TestValidator\";\n",
11
- "node_modules/@nestia/e2e/package.json": "{\n \"name\": \"@nestia/e2e\",\n \"version\": \"8.0.5\",\n \"description\": \"E2E test utilify functions\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"npm run build:main && npm run build:test\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"prepare\": \"ts-patch install && typia patch\",\n \"test\": \"node bin/test\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"e2e\",\n \"nestia\",\n \"nestjs\",\n \"test\",\n \"tdd\",\n \"utility\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"devDependencies\": {\n \"@trivago/prettier-plugin-sort-imports\": \"^4.0.0\",\n \"@types/node\": \"^18.11.18\",\n \"@typescript-eslint/eslint-plugin\": \"^5.57.0\",\n \"@typescript-eslint/parser\": \"^5.57.0\",\n \"rimraf\": \"^6.0.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.7\",\n \"typia\": \"^9.6.1\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
11
+ "node_modules/@nestia/e2e/package.json": "{\n \"name\": \"@nestia/e2e\",\n \"version\": \"8.0.7\",\n \"description\": \"E2E test utilify functions\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"npm run build:main && npm run build:test\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"prepare\": \"ts-patch install && typia patch\",\n \"test\": \"node bin/test\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"e2e\",\n \"nestia\",\n \"nestjs\",\n \"test\",\n \"tdd\",\n \"utility\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"devDependencies\": {\n \"@trivago/prettier-plugin-sort-imports\": \"^4.0.0\",\n \"@types/node\": \"^18.11.18\",\n \"@typescript-eslint/eslint-plugin\": \"^5.57.0\",\n \"@typescript-eslint/parser\": \"^5.57.0\",\n \"rimraf\": \"^6.0.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.7\",\n \"typia\": \"^9.6.1\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
12
12
  "node_modules/@nestia/fetcher/lib/AesPkcs5.d.ts": "/**\n * Utility class for the AES-128/256 encryption.\n *\n * - AES-128/256\n * - CBC mode\n * - PKCS#5 Padding\n * - Base64 Encoding\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace AesPkcs5 {\n /**\n * Encrypt data\n *\n * @param data Target data\n * @param key Key value of the encryption.\n * @param iv Initializer Vector for the encryption\n * @returns Encrypted data\n */\n function encrypt(data: string, key: string, iv: string): string;\n /**\n * Decrypt data.\n *\n * @param data Target data\n * @param key Key value of the decryption.\n * @param iv Initializer Vector for the decryption\n * @returns Decrypted data.\n */\n function decrypt(data: string, key: string, iv: string): string;\n}\n",
13
13
  "node_modules/@nestia/fetcher/lib/EncryptedFetcher.d.ts": "import { IConnection } from \"./IConnection\";\nimport { IFetchRoute } from \"./IFetchRoute\";\nimport { IPropagation } from \"./IPropagation\";\n/**\n * Utility class for `fetch` functions used in `@nestia/sdk` with encryption.\n *\n * `EncryptedFetcher` is a utility class designed for SDK functions generated by\n * [`@nestia/sdk`](https://nestia.io/docs/sdk/sdk), interacting with the remote\n * HTTP API encrypted by AES-PKCS algorithm. In other words, this is a\n * collection of dedicated `fetch()` functions for `@nestia/sdk` with\n * encryption.\n *\n * For reference, `EncryptedFetcher` class being used only when target\n * controller method is encrypting body data by `@EncryptedRoute` or\n * `@EncryptedBody` decorators. If those decorators are not used,\n * {@link PlainFetcher} class would be used instead.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace EncryptedFetcher {\n /**\n * Fetch function only for `HEAD` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Nothing because of `HEAD` method\n */\n function fetch(connection: IConnection, route: IFetchRoute<\"HEAD\">): Promise<void>;\n /**\n * Fetch function only for `GET` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Output>(connection: IConnection, route: IFetchRoute<\"GET\">): Promise<Output>;\n /**\n * Fetch function for the `POST`, `PUT`, `PATCH` and `DELETE` methods.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Input, Output>(connection: IConnection, route: IFetchRoute<\"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n function propagate<Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"GET\" | \"HEAD\">): Promise<Output>;\n function propagate<Input, Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"DELETE\" | \"GET\" | \"HEAD\" | \"PATCH\" | \"POST\" | \"PUT\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n}\n",
14
14
  "node_modules/@nestia/fetcher/lib/FormDataInput.d.ts": "/**\n * FormData input type.\n *\n * `FormDataInput<T>` is a type for the input of the `FormData` request, casting\n * `File` property value type as an union of `File` and\n * {@link FormDataInput.IFileProps}, especially for the React Native\n * environment.\n *\n * You know what? In the React Native environment, `File` class is not\n * supported. Therefore, when composing a `FormData` request, you have to put\n * the URI address of the local filesystem with file name and content type that\n * is represented by the {@link FormDataInput.IFileProps} type.\n *\n * This `FormDataInput<T>` type is designed for that purpose. If the property\n * value type is a `File` class, it converts it to an union type of `File` and\n * {@link FormDataInput.IFileProps} type. Also, if the property value type is an\n * array of `File` class, it converts it to an array of union type of `File` and\n * {@link FormDataInput.IFileProps} type too.\n *\n * Before | After ----------|------------------------ `boolean` | `boolean`\n * `bigint` | `bigint` `number` | `number` `string` | `string` `File` | `File \\|\n * IFileProps`\n *\n * @author Jeongho Nam - https://github.com/samchon\n * @template T Target object type.\n */\nexport type FormDataInput<T extends object> = T extends Array<any> ? never : T extends Function ? never : {\n [P in keyof T]: T[P] extends Array<infer U> ? FormDataInput.Value<U>[] : FormDataInput.Value<T[P]>;\n};\nexport declare namespace FormDataInput {\n /**\n * Value type of the `FormDataInput`.\n *\n * `Value<T>` is a type for the property value defined in the `FormDataInput`.\n *\n * If the original value type is a `File` class, `Value<T>` converts it to an\n * union type of `File` and {@link IFileProps} type which is a structured data\n * for the URI file location in the React Native environment.\n */\n type Value<T> = T extends File ? T | IFileProps : T;\n /**\n * Properties of a file.\n *\n * In the React Native, this `IFileProps` structured data can replace the\n * `File` class instance in the `FormData` request.\n *\n * Just put the {@link uri URI address} of the local file system with the\n * file's {@link name} and {@link type}. It would be casted to the `File` class\n * instance automatically in the `FormData` request.\n *\n * Note that, this `IFileProps` type works only in the React Native\n * environment. If you are developing a Web or NodeJS application, you have to\n * utilize the `File` class instance directly.\n */\n interface IFileProps {\n /**\n * URI address of the file.\n *\n * In the React Native, the URI address in the local file system can replace\n * the `File` class instance. If\n *\n * @format uri\n */\n uri: string;\n /** Name of the file. */\n name: string;\n /** Content type of the file. */\n type: string;\n }\n}\n",
@@ -23,7 +23,7 @@
23
23
  "node_modules/@nestia/fetcher/lib/PlainFetcher.d.ts": "import { IConnection } from \"./IConnection\";\nimport { IFetchRoute } from \"./IFetchRoute\";\nimport { IPropagation } from \"./IPropagation\";\n/**\n * Utility class for `fetch` functions used in `@nestia/sdk`.\n *\n * `PlainFetcher` is a utility class designed for SDK functions generated by\n * [`@nestia/sdk`](https://nestia.io/docs/sdk/sdk), interacting with the remote\n * HTTP sever API. In other words, this is a collection of dedicated `fetch()`\n * functions for `@nestia/sdk`.\n *\n * For reference, `PlainFetcher` class does not encrypt or decrypt the body data\n * at all. It just delivers plain data without any post processing. If you've\n * defined a controller method through `@EncryptedRoute` or `@EncryptedBody`\n * decorator, then {@liink EncryptedFetcher} class would be used instead.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace PlainFetcher {\n /**\n * Fetch function only for `HEAD` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Nothing because of `HEAD` method\n */\n function fetch(connection: IConnection, route: IFetchRoute<\"HEAD\">): Promise<void>;\n /**\n * Fetch function only for `GET` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Output>(connection: IConnection, route: IFetchRoute<\"GET\">): Promise<Output>;\n /**\n * Fetch function for the `POST`, `PUT`, `PATCH` and `DELETE` methods.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Input, Output>(connection: IConnection, route: IFetchRoute<\"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n function propagate<Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"GET\" | \"HEAD\">): Promise<Output>;\n function propagate<Input, Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"DELETE\" | \"GET\" | \"HEAD\" | \"PATCH\" | \"POST\" | \"PUT\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n}\n",
24
24
  "node_modules/@nestia/fetcher/lib/index.d.ts": "export * from \"./FormDataInput\";\nexport * from \"./HttpError\";\nexport * from \"./IConnection\";\nexport * from \"./IEncryptionPassword\";\nexport * from \"./IFetchEvent\";\nexport * from \"./IFetchRoute\";\nexport * from \"./IPropagation\";\n",
25
25
  "node_modules/@nestia/fetcher/lib/internal/FetcherBase.d.ts": "export {};\n",
26
- "node_modules/@nestia/fetcher/package.json": "{\n \"name\": \"@nestia/fetcher\",\n \"version\": \"8.0.5\",\n \"description\": \"Fetcher library of Nestia SDK\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint src\",\n \"eslint:fix\": \"eslint src --fix\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestia\",\n \"fetcher\",\n \"sdk\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@samchon/openapi\": \"^4.5.0\"\n },\n \"devDependencies\": {\n \"@types/node\": \"^18.11.14\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"rimraf\": \"^6.0.1\",\n \"typescript\": \"~5.9.2\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"lib\",\n \"src\"\n ]\n}",
26
+ "node_modules/@nestia/fetcher/package.json": "{\n \"name\": \"@nestia/fetcher\",\n \"version\": \"8.0.7\",\n \"description\": \"Fetcher library of Nestia SDK\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint src\",\n \"eslint:fix\": \"eslint src --fix\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestia\",\n \"fetcher\",\n \"sdk\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@samchon/openapi\": \"^4.5.0\"\n },\n \"devDependencies\": {\n \"@types/node\": \"^18.11.14\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"rimraf\": \"^6.0.1\",\n \"typescript\": \"~5.9.2\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"lib\",\n \"src\"\n ]\n}",
27
27
  "node_modules/@samchon/openapi/lib/HttpLlm.d.ts": "import { OpenApi } from \"./OpenApi\";\nimport { OpenApiV3 } from \"./OpenApiV3\";\nimport { OpenApiV3_1 } from \"./OpenApiV3_1\";\nimport { SwaggerV2 } from \"./SwaggerV2\";\nimport { IHttpConnection } from \"./structures/IHttpConnection\";\nimport { IHttpLlmApplication } from \"./structures/IHttpLlmApplication\";\nimport { IHttpLlmFunction } from \"./structures/IHttpLlmFunction\";\nimport { IHttpResponse } from \"./structures/IHttpResponse\";\nimport { ILlmFunction } from \"./structures/ILlmFunction\";\nimport { ILlmSchema } from \"./structures/ILlmSchema\";\n/**\n * LLM function calling application composer from OpenAPI document.\n *\n * `HttpLlm` is a module for composing LLM (Large Language Model) function\n * calling application from the {@link OpenApi.IDocument OpenAPI document}, and\n * also for LLM function call execution and parameter merging.\n *\n * At first, you can construct the LLM function calling application by the\n * {@link HttpLlm.application HttpLlm.application()} function. And then the LLM\n * has selected a {@link IHttpLlmFunction function} to call and composes its\n * arguments, you can execute the function by\n * {@link HttpLlm.execute HttpLlm.execute()} or\n * {@link HttpLlm.propagate HttpLlm.propagate()}.\n *\n * By the way, if you have configured the\n * {@link IHttpLlmApplication.IOptions.separate} option to separate the\n * parameters into human and LLM sides, you can merge these human and LLM sides'\n * parameters into one through\n * {@link HttpLlm.mergeParameters HttpLlm.mergeParameters()} before the actual\n * LLM function call execution.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace HttpLlm {\n /**\n * Properties for the LLM function calling application composer.\n *\n * @template Model Target LLM model\n */\n interface IApplicationProps<Model extends ILlmSchema.Model> {\n /** Target LLM model. */\n model: Model;\n /** OpenAPI document to convert. */\n document: OpenApi.IDocument | SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument;\n /** Options for the LLM function calling schema conversion. */\n options?: Partial<IHttpLlmApplication.IOptions<Model>>;\n }\n /**\n * Convert OpenAPI document to LLM function calling application.\n *\n * Converts {@link OpenApi.IDocument OpenAPI document} or\n * {@link IHttpMigrateApplication migrated application} to the\n * {@link IHttpLlmApplication LLM function calling application}. Every\n * {@link OpenApi.IOperation API operations} in the OpenAPI document are\n * converted to the {@link IHttpLlmFunction LLM function} type, and they would\n * be used for the LLM function calling.\n *\n * If you have configured the {@link IHttpLlmApplication.IOptions.separate}\n * option, every parameters in the {@link IHttpLlmFunction} would be separated\n * into both human and LLM sides. In that case, you can merge these human and\n * LLM sides' parameters into one through {@link HttpLlm.mergeParameters}\n * before the actual LLM function call execution.\n *\n * Additionally, if you have configured the\n * {@link IHttpLlmApplication.IOptions.keyword} as `true`, the number of\n * {@link IHttpLlmFunction.parameters} are always 1 and the first parameter\n * type is always {@link ILlmSchemaV3.IObject}. I recommend this option because\n * LLM can understand the keyword arguments more easily.\n *\n * @param props Properties for composition\n * @returns LLM function calling application\n */\n const application: <Model extends ILlmSchema.Model>(props: IApplicationProps<Model>) => IHttpLlmApplication<Model>;\n /** Properties for the LLM function call. */\n interface IFetchProps<Model extends ILlmSchema.Model> {\n /** Application of the LLM function calling. */\n application: IHttpLlmApplication<Model>;\n /** LLM function schema to call. */\n function: IHttpLlmFunction<ILlmSchema.Model>;\n /** Connection info to the HTTP server. */\n connection: IHttpConnection;\n /** Input arguments for the function call. */\n input: object;\n }\n /**\n * Execute the LLM function call.\n *\n * `HttmLlm.execute()` is a function executing the target\n * {@link OpenApi.IOperation API endpoint} with with the connection information\n * and arguments composed by Large Language Model like OpenAI (+human\n * sometimes).\n *\n * By the way, if you've configured the\n * {@link IHttpLlmApplication.IOptions.separate}, so that the parameters are\n * separated to human and LLM sides, you have to merge these humand and LLM\n * sides' parameters into one through {@link HttpLlm.mergeParameters}\n * function.\n *\n * About the {@link IHttpLlmApplication.IOptions.keyword} option, don't worry\n * anything. This `HttmLlm.execute()` function will automatically recognize\n * the keyword arguments and convert them to the proper sequence.\n *\n * For reference, if the target API endpoinnt responds none 200/201 status,\n * this would be considered as an error and the {@link HttpError} would be\n * thrown. Otherwise you don't want such rule, you can use the\n * {@link HttpLlm.propagate} function instead.\n *\n * @param props Properties for the LLM function call\n * @returns Return value (response body) from the API endpoint\n * @throws HttpError when the API endpoint responds none 200/201 status\n */\n const execute: <Model extends ILlmSchema.Model>(props: IFetchProps<Model>) => Promise<unknown>;\n /**\n * Propagate the LLM function call.\n *\n * `HttmLlm.propagate()` is a function propagating the target\n * {@link OpenApi.IOperation API endpoint} with with the connection information\n * and arguments composed by Large Language Model like OpenAI (+human\n * sometimes).\n *\n * By the way, if you've configured the\n * {@link IHttpLlmApplication.IOptions.separate}, so that the parameters are\n * separated to human and LLM sides, you have to merge these humand and LLM\n * sides' parameters into one through {@link HttpLlm.mergeParameters}\n * function.\n *\n * About the {@link IHttpLlmApplication.IOptions.keyword} option, don't worry\n * anything. This `HttmLlm.propagate()` function will automatically recognize\n * the keyword arguments and convert them to the proper sequence.\n *\n * For reference, the propagation means always returning the response from the\n * API endpoint, even if the status is not 200/201. This is useful when you\n * want to handle the response by yourself.\n *\n * @param props Properties for the LLM function call\n * @returns Response from the API endpoint\n * @throws Error only when the connection is failed\n */\n const propagate: <Model extends ILlmSchema.Model>(props: IFetchProps<Model>) => Promise<IHttpResponse>;\n /** Properties for the parameters' merging. */\n interface IMergeProps<Model extends ILlmSchema.Model> {\n /** Metadata of the target function. */\n function: ILlmFunction<Model>;\n /** Arguments composed by the LLM. */\n llm: object | null;\n /** Arguments composed by the human. */\n human: object | null;\n }\n /**\n * Merge the parameters.\n *\n * If you've configured the {@link IHttpLlmApplication.IOptions.separate}\n * option, so that the parameters are separated to human and LLM sides, you\n * can merge these humand and LLM sides' parameters into one through this\n * `HttpLlm.mergeParameters()` function before the actual LLM function call\n * wexecution.\n *\n * On contrary, if you've not configured the\n * {@link IHttpLlmApplication.IOptions.separate} option, this function would\n * throw an error.\n *\n * @param props Properties for the parameters' merging\n * @returns Merged parameter values\n */\n const mergeParameters: <Model extends ILlmSchema.Model>(props: IMergeProps<Model>) => object;\n /**\n * Merge two values.\n *\n * If both values are objects, then combines them in the properties level.\n *\n * Otherwise, returns the latter value if it's not null, otherwise the former\n * value.\n *\n * - `return (y ?? x)`\n *\n * @param x Value X to merge\n * @param y Value Y to merge\n * @returns Merged value\n */\n const mergeValue: (x: unknown, y: unknown) => unknown;\n}\n",
28
28
  "node_modules/@samchon/openapi/lib/HttpMigration.d.ts": "import { OpenApi } from \"./OpenApi\";\nimport { OpenApiV3 } from \"./OpenApiV3\";\nimport { OpenApiV3_1 } from \"./OpenApiV3_1\";\nimport { SwaggerV2 } from \"./SwaggerV2\";\nimport { IHttpConnection } from \"./structures/IHttpConnection\";\nimport { IHttpMigrateApplication } from \"./structures/IHttpMigrateApplication\";\nimport { IHttpMigrateRoute } from \"./structures/IHttpMigrateRoute\";\nimport { IHttpResponse } from \"./structures/IHttpResponse\";\n/**\n * HTTP migration application composer from OpenAPI document.\n *\n * `HttpMigration` is a module for composing HTTP migration application from the\n * {@link OpenApi.IDocument OpenAPI document}. It is designed for helping the\n * OpenAPI generator libraries, which converts\n * {@link OpenApi.IOperation OpenAPI operations} to an RPC (Remote Procedure\n * Call) function.\n *\n * The key feature of the `HttpModule` is the {@link HttpMigration.application}\n * function. It converts the {@link OpenApi.IOperation OpenAPI operations} to the\n * {@link IHttpMigrateRoute HTTP migration route}, and it normalizes the OpenAPI\n * operations to the RPC function calling suitable route structure.\n *\n * The other functions, {@link HttpMigration.execute} and\n * {@link HttpMigration.propagate}, are for executing the HTTP request to the\n * HTTP server. The {@link HttpMigration.execute} function returns the response\n * body from the API endpoint when the status code is `200` or `201`. Otherwise,\n * it throws an {@link HttpError} when the status code is not `200` or `201`. The\n * {@link HttpMigration.propagate} function returns the response information from\n * the API endpoint, including the status code, headers, and response body.\n *\n * The {@link HttpLlm} module is a good example utilizing this `HttpMigration`\n * module for composing RPC function calling application. The {@link HttpLlm}\n * module composes LLM (Large Language Model) function calling application from\n * the OpenAPI document bypassing through the {@link IHttpLlmApplication} type.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace HttpMigration {\n /**\n * Convert HTTP migration application from OpenAPI document.\n *\n * `HttpMigration.application()` is a function converting the\n * {@link OpenApi.IDocument OpenAPI document} and its\n * {@link OpenApi.IOperation operations} to the\n * {@link IHttpMigrateApplication HTTP migration application}.\n *\n * The HTTP migration application is designed for helping the OpenAPI\n * generator libraries, which converts OpenAPI operations to an RPC (Remote\n * Procedure Call) function. To support the OpenAPI generator libraries,\n * {@link IHttpMigrateRoute} takes below normalization rules:\n *\n * - Path parameters are separated to atomic level.\n * - Query parameters are binded into one object.\n * - Header parameters are binded into one object.\n * - Allow only below HTTP methods\n *\n * - `head`\n * - `get`\n * - `post`\n * - `put`\n * - `patch`\n * - `delete`\n * - Allow only below content media types\n *\n * - `application/json`\n * - `application/x-www-form-urlencoded`\n * - `multipart/form-data`\n * - `text/plain`\n *\n * If there're some {@link OpenApi.IOperation API operations} which canont\n * adjust the above rules or there're some logically insensible, these\n * operation would be failed to migrate and registered into the\n * {@link IHttpMigrateApplication.errors}.\n *\n * @param document OpenAPI document to migrate.\n * @returns Migrated application.\n */\n const application: (document: OpenApi.IDocument | SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument) => IHttpMigrateApplication;\n /** Properties for the request to the HTTP server. */\n interface IFetchProps {\n /** Connection info to the HTTP server. */\n connection: IHttpConnection;\n /** Route information for the migration. */\n route: IHttpMigrateRoute;\n /**\n * Path parameters.\n *\n * Path parameters with sequenced array or key-value paired object.\n */\n parameters: Array<string | number | boolean | bigint | null> | Record<string, string | number | boolean | bigint | null>;\n /** Query parameters as a key-value paired object. */\n query?: object | undefined;\n /** Request body data. */\n body?: object | undefined;\n }\n /**\n * Execute the HTTP request.\n *\n * `HttpMigration.execute()` is a function executing the HTTP request to the\n * HTTP server.\n *\n * It returns the response body from the API endpoint when the status code is\n * `200` or `201`. Otherwise, it throws an {@link HttpError} when the status\n * code is not `200` or `201`.\n *\n * If you want to get more information than the response body, or get the\n * detailed response information even when the status code is `200` or `201`,\n * use the {@link HttpMigration.propagate} function instead.\n *\n * @param props Properties for the request.\n * @returns Return value (response body) from the API endpoint.\n * @throws HttpError when the API endpoint responds none 200/201 status.\n */\n const execute: (props: IFetchProps) => Promise<unknown>;\n /**\n * Propagate the HTTP request.\n *\n * `HttpMigration.propagate()` is a function propagating the request to the\n * HTTP server.\n *\n * It returns the response information from the API endpoint, including the\n * status code, headers, and response body.\n *\n * Even if the status code is not `200` or `201`, this function would return\n * the response information. By the way, if the connection to the HTTP server\n * is failed, this function would throw an {@link Error}.\n *\n * @param props Properties for the request.\n * @returns Response from the API endpoint.\n * @throws Error when the connection is failed.\n */\n const propagate: (props: IFetchProps) => Promise<IHttpResponse>;\n}\n",
29
29
  "node_modules/@samchon/openapi/lib/McpLlm.d.ts": "import { ILlmSchema } from \"./structures/ILlmSchema\";\nimport { IMcpLlmApplication } from \"./structures/IMcpLlmApplication\";\nimport { IMcpTool } from \"./structures/IMcpTool\";\n/**\n * Application of LLM function calling from MCP document.\n *\n * `McpLlm` is a module for composing LLM (Large Language Model) function\n * calling application from MCP (Model Context Protocol) document.\n *\n * The reasons why `@samchon/openapi` recommends to use the function calling\n * feature instead of directly using the\n * [`mcp_servers`](https://openai.github.io/openai-agents-python/mcp/#using-mcp-servers)\n * property of LLM API are:\n *\n * - Model Specification: {@link ILlmSchema}\n * - Validation Feedback: {@link IMcpLlmFunction.validate}\n * - Selector agent for reducing context: [Agentica > Orchestration\n * Strategy](https://wrtnlabs.io/agentica/docs/concepts/function-calling/#orchestration-strategy)\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace McpLlm {\n /**\n * Properties for the LLM function calling application composer.\n *\n * @template Model Target LLM model\n */\n interface IApplicationProps<Model extends ILlmSchema.Model> {\n /** Target LLM model. */\n model: Model;\n /**\n * List of tools.\n *\n * A list of tools defined in the MCP (Model Context Protocol) document.\n *\n * It is better to validate the tools using the\n * [`typia.assert<T>()`](https://typia.io/docs/validate/assert) function for\n * type safety.\n */\n tools: Array<IMcpTool>;\n /** Options for the LLM function calling schema conversion. */\n options?: Partial<IMcpLlmApplication.IOptions<Model>>;\n }\n /**\n * Convert MCP document to LLM function calling application.\n *\n * Converts MCP (Model Context Protocol) to LLM (Large Language Model)\n * function calling application.\n *\n * The reasons why `@samchon/openapi` recommends using the function calling\n * feature instead of directly using the\n * [`mcp_servers`](https://openai.github.io/openai-agents-python/mcp/#using-mcp-servers)\n * property of LLM API are:\n *\n * - **Model Specification**: {@link ILlmSchema}\n * - **Validation Feedback**: {@link IMcpLlmFunction.validate}\n * - **Selector agent for reducing context**: [Agentica > Orchestration\n * Strategy](https://wrtnlabs.io/agentica/docs/concepts/function-calling/#orchestration-strategy)\n *\n * @param props Properties for composition\n * @returns LLM function calling application\n */\n const application: <Model extends ILlmSchema.Model>(props: IApplicationProps<Model>) => IMcpLlmApplication<Model>;\n}\n",
package/package.json CHANGED
@@ -1,6 +1,6 @@
1
1
  {
2
2
  "name": "@autobe/compiler",
3
- "version": "0.22.0",
3
+ "version": "0.23.0",
4
4
  "description": "AI backend server code generator",
5
5
  "main": "lib/index.js",
6
6
  "author": "Wrtn Technologies",
@@ -13,8 +13,8 @@
13
13
  "url": "https://github.com/wrtnlabs/autobe/issues"
14
14
  },
15
15
  "dependencies": {
16
- "@nestia/core": "^8.0.5",
17
- "@nestia/migrate": "^8.0.5",
16
+ "@nestia/core": "^8.0.7",
17
+ "@nestia/migrate": "^8.0.7",
18
18
  "@samchon/openapi": "^4.7.1",
19
19
  "@trivago/prettier-plugin-sort-imports": "^5.2.2",
20
20
  "@typescript-eslint/eslint-plugin": "8.40.0",
@@ -22,7 +22,7 @@
22
22
  "embed-eslint": "^2.0.1",
23
23
  "embed-prisma": "^1.1.1",
24
24
  "embed-typescript": "^2.0.1",
25
- "eslint": "^9.34.0",
25
+ "eslint": "9.34.0",
26
26
  "import2": "^1.0.3",
27
27
  "prettier": "^3.5.3",
28
28
  "prettier-plugin-jsdoc": "^1.3.2",
@@ -30,9 +30,9 @@
30
30
  "tgrid": "^1.2.0",
31
31
  "tstl": "^3.0.0",
32
32
  "typia": "^9.7.2",
33
- "@autobe/filesystem": "^0.22.0",
34
- "@autobe/interface": "^0.22.0",
35
- "@autobe/utils": "^0.22.0"
33
+ "@autobe/interface": "^0.23.0",
34
+ "@autobe/filesystem": "^0.23.0",
35
+ "@autobe/utils": "^0.23.0"
36
36
  },
37
37
  "devDependencies": {
38
38
  "@types/node": "^22.15.3",
@@ -1,7 +1,7 @@
1
1
  export const AutoBeCompilerRealizeTemplate: Record<string, string> = {
2
2
  ".env.local": "API_PORT=37001\nJWT_SECRET_KEY=your_jwt_secret_key",
3
3
  ".gitignore": "bin/\ndist/\nlib/\nnode_modules/\n\nprisma/migrations\nprisma/schema/migrations\nprisma/bbs.db\n\n*.DS_Store\npackage-lock.json\npnpm-lock.yaml\n.npmrc",
4
- "package.json": "{\n \"private\": true,\n \"name\": \"@ORGANIZATION/PROJECT\",\n \"version\": \"0.1.0\",\n \"description\": \"Starter kit of Nestia\",\n \"main\": \"lib/index.js\",\n \"scripts\": {\n \"benchmark\": \"node bin/test/benchmark\",\n \"test\": \"node bin/test\",\n \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------BUILDS------------------------\": \"\",\n \"build\": \"npm run build:prisma && npm run build:sdk && npm run build:main && npm run build:test\",\n \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n \"build:env\": \"ts-node build/env.ts\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n \"build:prisma\": \"prisma generate --schema prisma/schema\",\n \"build:swagger\": \"nestia swagger\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n \"prepare\": \"ts-patch install && npm run build:env && npm run build:prisma\",\n \"prettier\": \"prettier src --write && prettier test --write\",\n \"------------------------WEBPACK------------------------\": \"\",\n \"webpack\": \"rimraf dist && webpack\",\n \"webpack:start\": \"cd dist && node dist/server\",\n \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------DEPLOYS------------------------\": \"\",\n \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n \"start\": \"node lib/executable/server\",\n \"start:dev\": \"nest start --watch\",\n \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia-start\"\n },\n \"keywords\": [\n \"nestia\",\n \"template\",\n \"boilerplate\"\n ],\n \"author\": \"AUTHOR\",\n \"license\": \"AGPL-3.0\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia-start/issues\"\n },\n \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n \"devDependencies\": {\n \"@autobe/interface\": \"^0.10.6\",\n \"@nestia/benchmark\": \"^8.0.5\",\n \"@nestia/e2e\": \"^8.0.5\",\n \"@nestia/sdk\": \"^8.0.5\",\n \"@nestjs/cli\": \"^11.0.7\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^11.1.6\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/bcryptjs\": \"^3.0.0\",\n \"@types/cli\": \"^0.11.21\",\n \"@types/cli-progress\": \"^3.11.5\",\n \"@types/express\": \"^4.17.21\",\n \"@types/inquirer\": \"^8.2.5\",\n \"@types/jsonwebtoken\": \"^9.0.5\",\n \"@types/node\": \"^18.11.0\",\n \"@types/uuid\": \"^8.3.4\",\n \"@typescript-eslint/eslint-plugin\": \"^8.1.0\",\n \"@typescript-eslint/parser\": \"^8.1.0\",\n \"chalk\": \"^4.1.2\",\n \"cli\": \"^1.0.1\",\n \"cli-progress\": \"^3.12.0\",\n \"copy-webpack-plugin\": \"^11.0.0\",\n \"eslint-plugin-deprecation\": \"^3.0.0\",\n \"express\": \"^4.18.2\",\n \"fastify\": \"^5.4.0\",\n \"nestia\": \"^8.0.5\",\n \"prettier\": \"^3.2.4\",\n \"prettier-plugin-prisma\": \"^5.0.0\",\n \"prisma-markdown\": \"^3.0.1\",\n \"rimraf\": \"^3.0.2\",\n \"rollup\": \"^4.18.0\",\n \"source-map-support\": \"^0.5.21\",\n \"swagger-ui-express\": \"^5.0.0\",\n \"ts-loader\": \"^9.5.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.5.5\",\n \"webpack\": \"^5.89.0\",\n \"webpack-cli\": \"^5.1.4\",\n \"write-file-webpack-plugin\": \"^4.5.1\"\n },\n \"dependencies\": {\n \"@nestia/core\": \"^8.0.5\",\n \"@nestia/fetcher\": \"^8.0.5\",\n \"@nestjs/common\": \"^11.1.3\",\n \"@nestjs/core\": \"^11.1.3\",\n \"@nestjs/platform-express\": \"^11.1.3\",\n \"@nestjs/platform-fastify\": \"^11.1.3\",\n \"@prisma/client\": \"^6.11.1\",\n \"bcryptjs\": \"^3.0.2\",\n \"commander\": \"10.0.0\",\n \"dotenv\": \"^16.3.1\",\n \"dotenv-expand\": \"^10.0.0\",\n \"inquirer\": \"8.2.5\",\n \"jsonwebtoken\": \"^9.0.2\",\n \"prisma\": \"^6.11.1\",\n \"serialize-error\": \"^4.1.0\",\n \"tgrid\": \"^1.1.0\",\n \"tstl\": \"^3.0.0\",\n \"typia\": \"^9.7.2\",\n \"uuid\": \"^9.0.0\"\n },\n \"stackblitz\": {\n \"startCommand\": \"npm run prepare && npm run build:test && npm run test -- --simultaneous 1\"\n }\n}\n",
4
+ "package.json": "{\n \"private\": true,\n \"name\": \"@ORGANIZATION/PROJECT\",\n \"version\": \"0.1.0\",\n \"description\": \"Starter kit of Nestia\",\n \"main\": \"lib/index.js\",\n \"scripts\": {\n \"benchmark\": \"node bin/test/benchmark\",\n \"test\": \"node bin/test\",\n \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------BUILDS------------------------\": \"\",\n \"build\": \"npm run build:prisma && npm run build:sdk && npm run build:main && npm run build:test\",\n \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n \"build:env\": \"ts-node build/env.ts\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n \"build:prisma\": \"prisma generate --schema prisma/schema\",\n \"build:swagger\": \"nestia swagger\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n \"prepare\": \"ts-patch install && npm run build:env && npm run build:prisma\",\n \"prettier\": \"prettier src --write && prettier test --write\",\n \"------------------------WEBPACK------------------------\": \"\",\n \"webpack\": \"rimraf dist && webpack\",\n \"webpack:start\": \"cd dist && node dist/server\",\n \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------DEPLOYS------------------------\": \"\",\n \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n \"start\": \"node lib/executable/server\",\n \"start:dev\": \"nest start --watch\",\n \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia-start\"\n },\n \"keywords\": [\n \"nestia\",\n \"template\",\n \"boilerplate\"\n ],\n \"author\": \"AUTHOR\",\n \"license\": \"AGPL-3.0\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia-start/issues\"\n },\n \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n \"devDependencies\": {\n \"@autobe/interface\": \"^0.10.6\",\n \"@nestia/benchmark\": \"^8.0.7\",\n \"@nestia/e2e\": \"^8.0.7\",\n \"@nestia/sdk\": \"^8.0.7\",\n \"@nestjs/cli\": \"^11.0.7\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^11.1.6\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/bcryptjs\": \"^3.0.0\",\n \"@types/cli\": \"^0.11.21\",\n \"@types/cli-progress\": \"^3.11.5\",\n \"@types/express\": \"^4.17.21\",\n \"@types/inquirer\": \"^8.2.5\",\n \"@types/jsonwebtoken\": \"^9.0.5\",\n \"@types/node\": \"^18.11.0\",\n \"@types/uuid\": \"^8.3.4\",\n \"@typescript-eslint/eslint-plugin\": \"^8.1.0\",\n \"@typescript-eslint/parser\": \"^8.1.0\",\n \"chalk\": \"^4.1.2\",\n \"cli\": \"^1.0.1\",\n \"cli-progress\": \"^3.12.0\",\n \"copy-webpack-plugin\": \"^11.0.0\",\n \"eslint-plugin-deprecation\": \"^3.0.0\",\n \"express\": \"^4.18.2\",\n \"fastify\": \"^5.4.0\",\n \"nestia\": \"^8.0.7\",\n \"prettier\": \"^3.2.4\",\n \"prettier-plugin-prisma\": \"^5.0.0\",\n \"prisma-markdown\": \"^3.0.1\",\n \"rimraf\": \"^3.0.2\",\n \"rollup\": \"^4.18.0\",\n \"source-map-support\": \"^0.5.21\",\n \"swagger-ui-express\": \"^5.0.0\",\n \"ts-loader\": \"^9.5.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.5.5\",\n \"webpack\": \"^5.89.0\",\n \"webpack-cli\": \"^5.1.4\",\n \"write-file-webpack-plugin\": \"^4.5.1\"\n },\n \"dependencies\": {\n \"@nestia/core\": \"^8.0.7\",\n \"@nestia/fetcher\": \"^8.0.7\",\n \"@nestjs/common\": \"^11.1.3\",\n \"@nestjs/core\": \"^11.1.3\",\n \"@nestjs/platform-express\": \"^11.1.3\",\n \"@nestjs/platform-fastify\": \"^11.1.3\",\n \"@prisma/client\": \"^6.11.1\",\n \"bcryptjs\": \"^3.0.2\",\n \"commander\": \"10.0.0\",\n \"dotenv\": \"^16.3.1\",\n \"dotenv-expand\": \"^10.0.0\",\n \"inquirer\": \"8.2.5\",\n \"jsonwebtoken\": \"^9.0.2\",\n \"prisma\": \"^6.11.1\",\n \"serialize-error\": \"^4.1.0\",\n \"tgrid\": \"^1.1.0\",\n \"tstl\": \"^3.0.0\",\n \"typia\": \"^9.7.2\",\n \"uuid\": \"^9.0.0\"\n },\n \"stackblitz\": {\n \"startCommand\": \"npm run prepare && npm run build:test && npm run test -- --simultaneous 1\"\n }\n}\n",
5
5
  "src/MyGlobal.ts": "import { PrismaClient } from \"@prisma/client\";\nimport crypto from \"crypto\";\nimport dotenv from \"dotenv\";\nimport dotenvExpand from \"dotenv-expand\";\nimport { Singleton } from \"tstl\";\nimport typia from \"typia\";\n\n/* eslint-disable */\nexport class MyGlobal {\n public static readonly prisma: PrismaClient = new PrismaClient();\n public static testing: boolean = false;\n public static get env(): MyGlobal.IEnvironments {\n return environments.get();\n }\n\n /**\n * Common password utilities for consistent authentication Uses native crypto\n * module for password hashing\n */\n public static readonly password = {\n // Fixed salt for password hashing (consistent across all operations)\n FIXED_SALT: \"autobe-fixed-salt-2024\",\n\n /**\n * Hash a plain password using crypto.pbkdf2 All authentication operations\n * (join, login) MUST use this method\n *\n * @param plainPassword - The plain text password to hash\n * @returns The hashed password as hex string\n */\n async hash(plainPassword: string): Promise<string> {\n return new Promise((resolve, reject) => {\n crypto.pbkdf2(\n plainPassword,\n this.FIXED_SALT,\n 10000,\n 64,\n \"sha512\",\n (err: Error | null, derivedKey: Buffer) => {\n if (err) reject(err);\n else resolve(derivedKey.toString(\"hex\"));\n },\n );\n });\n },\n\n /**\n * Verify a plain password against a hashed password Login operations MUST\n * use this method for password verification\n *\n * @param plainPassword - The plain text password to verify\n * @param hashedPassword - The hashed password from database\n * @returns True if passwords match, false otherwise\n */\n async verify(\n plainPassword: string,\n hashedPassword: string,\n ): Promise<boolean> {\n const hash = await this.hash(plainPassword);\n return hash === hashedPassword;\n },\n };\n}\nexport namespace MyGlobal {\n export interface IEnvironments {\n API_PORT: `${number}`;\n\n /** JWT Secret Key. */\n JWT_SECRET_KEY: string;\n }\n}\nconst environments = new Singleton(() => {\n const env = dotenv.config();\n dotenvExpand.expand(env);\n return typia.assert<MyGlobal.IEnvironments>(process.env);\n});\n",
6
6
  "src/providers/authorize/jwtAuthorize.ts": "import { ForbiddenException, UnauthorizedException } from \"@nestjs/common\";\nimport jwt from \"jsonwebtoken\";\n\nimport { MyGlobal } from \"../../MyGlobal\";\n\nexport function jwtAuthorize(props: {\n request: {\n headers: { authorization?: string };\n };\n}) {\n if (!props.request.headers.authorization)\n throw new ForbiddenException(\"No token value exists\");\n\n // PARSE TOKEN\n try {\n if (\n props.request.headers.authorization.startsWith(BEARER_PREFIX) === true\n ) {\n const token: string = props.request.headers.authorization.substring(\n BEARER_PREFIX.length,\n );\n\n const verified = jwt.verify(token, MyGlobal.env.JWT_SECRET_KEY);\n\n return verified;\n } else {\n const token = props.request.headers.authorization;\n\n const verified = jwt.verify(token, MyGlobal.env.JWT_SECRET_KEY);\n\n return verified;\n }\n } catch {\n throw new UnauthorizedException(\"Invalid token\");\n }\n}\n\nconst BEARER_PREFIX = \"Bearer \";\n",
7
7
  "src/setup/MySetupWizard.ts": "import cp from \"child_process\";\n\nimport { MyConfiguration } from \"../MyConfiguration\";\nimport { MyGlobal } from \"../MyGlobal\";\n\nexport namespace MySetupWizard {\n export async function schema(): Promise<void> {\n if (MyGlobal.testing === false)\n throw new Error(\n \"Error on SetupWizard.schema(): unable to reset database in non-test mode.\",\n );\n const execute = (type: string) => (argv: string) =>\n cp.execSync(`npx prisma migrate ${type} --schema=prisma/schema ${argv}`, {\n stdio: \"ignore\",\n cwd: MyConfiguration.ROOT,\n });\n execute(\"reset\")(\"--force\");\n execute(\"dev\")(\"--name init\");\n }\n\n export async function seed(): Promise<void> {}\n}\n",
@@ -1,5 +1,5 @@
1
1
  export const AutoBeCompilerTestTemplate: Record<string, string> = {
2
- "package.json": "{\n \"private\": true,\n \"name\": \"@ORGANIZATION/PROJECT\",\n \"version\": \"0.1.0\",\n \"description\": \"Starter kit of Nestia\",\n \"main\": \"lib/index.js\",\n \"scripts\": {\n \"benchmark\": \"node bin/test/benchmark\",\n \"test\": \"node bin/test\",\n \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------BUILDS------------------------\": \"\",\n \"build\": \"npm run build:sdk && npm run build:main && npm run build:test\",\n \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n \"build:swagger\": \"npx nestia swagger\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n \"prepare\": \"ts-patch install && ts-node build/env.ts\",\n \"prettier\": \"prettier src --write && prettier test --write\",\n \"------------------------WEBPACK------------------------\": \"\",\n \"webpack\": \"rimraf dist && webpack\",\n \"webpack:start\": \"cd dist && node dist/server\",\n \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------DEPLOYS------------------------\": \"\",\n \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n \"start\": \"node lib/executable/server\",\n \"start:dev\": \"nest start --watch\",\n \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia-start\"\n },\n \"keywords\": [\n \"nestia\",\n \"template\",\n \"boilerplate\"\n ],\n \"author\": \"AUTHOR\",\n \"license\": \"AGPL-3.0\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia-start/issues\"\n },\n \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n \"devDependencies\": {\n \"@nestia/benchmark\": \"^8.0.5\",\n \"@nestia/e2e\": \"^8.0.5\",\n \"@nestia/sdk\": \"^8.0.5\",\n \"@nestjs/cli\": \"^11.0.7\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^11.1.6\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/cli\": \"^0.11.21\",\n \"@types/cli-progress\": \"^3.11.5\",\n \"@types/express\": \"^4.17.21\",\n \"@types/inquirer\": \"^8.2.5\",\n \"@types/node\": \"^18.11.0\",\n \"@types/uuid\": \"^8.3.4\",\n \"@typescript-eslint/eslint-plugin\": \"^8.1.0\",\n \"@typescript-eslint/parser\": \"^8.1.0\",\n \"chalk\": \"^4.1.2\",\n \"cli\": \"^1.0.1\",\n \"cli-progress\": \"^3.12.0\",\n \"copy-webpack-plugin\": \"^11.0.0\",\n \"eslint-plugin-deprecation\": \"^3.0.0\",\n \"express\": \"^4.18.2\",\n \"nestia\": \"^8.0.5\",\n \"prettier\": \"^3.2.4\",\n \"prettier-plugin-prisma\": \"^5.0.0\",\n \"prisma-markdown\": \"^3.0.1\",\n \"rimraf\": \"^3.0.2\",\n \"rollup\": \"^4.18.0\",\n \"source-map-support\": \"^0.5.21\",\n \"swagger-ui-express\": \"^5.0.0\",\n \"ts-loader\": \"^9.5.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.5.5\",\n \"webpack\": \"^5.89.0\",\n \"webpack-cli\": \"^5.1.4\",\n \"write-file-webpack-plugin\": \"^4.5.1\"\n },\n \"dependencies\": {\n \"@nestia/core\": \"^8.0.5\",\n \"@nestia/fetcher\": \"^8.0.5\",\n \"@nestjs/common\": \"^11.1.3\",\n \"@nestjs/core\": \"^11.1.3\",\n \"@nestjs/platform-express\": \"^11.1.3\",\n \"@prisma/client\": \"^6.11.1\",\n \"commander\": \"10.0.0\",\n \"dotenv\": \"^16.3.1\",\n \"dotenv-expand\": \"^10.0.0\",\n \"inquirer\": \"8.2.5\",\n \"prisma\": \"^6.11.1\",\n \"serialize-error\": \"^4.1.0\",\n \"tgrid\": \"^1.1.0\",\n \"tstl\": \"^3.0.0\",\n \"typia\": \"^9.7.2\",\n \"uuid\": \"^9.0.0\"\n },\n \"stackblitz\": {\n \"startCommand\": \"npm run prepare && npm run build:test && npm run test -- --simultaneous 1\"\n }\n}\n",
2
+ "package.json": "{\n \"private\": true,\n \"name\": \"@ORGANIZATION/PROJECT\",\n \"version\": \"0.1.0\",\n \"description\": \"Starter kit of Nestia\",\n \"main\": \"lib/index.js\",\n \"scripts\": {\n \"benchmark\": \"node bin/test/benchmark\",\n \"test\": \"node bin/test\",\n \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------BUILDS------------------------\": \"\",\n \"build\": \"npm run build:sdk && npm run build:main && npm run build:test\",\n \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n \"build:swagger\": \"npx nestia swagger\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n \"prepare\": \"ts-patch install && ts-node build/env.ts\",\n \"prettier\": \"prettier src --write && prettier test --write\",\n \"------------------------WEBPACK------------------------\": \"\",\n \"webpack\": \"rimraf dist && webpack\",\n \"webpack:start\": \"cd dist && node dist/server\",\n \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------DEPLOYS------------------------\": \"\",\n \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n \"start\": \"node lib/executable/server\",\n \"start:dev\": \"nest start --watch\",\n \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia-start\"\n },\n \"keywords\": [\n \"nestia\",\n \"template\",\n \"boilerplate\"\n ],\n \"author\": \"AUTHOR\",\n \"license\": \"AGPL-3.0\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia-start/issues\"\n },\n \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n \"devDependencies\": {\n \"@nestia/benchmark\": \"^8.0.7\",\n \"@nestia/e2e\": \"^8.0.7\",\n \"@nestia/sdk\": \"^8.0.7\",\n \"@nestjs/cli\": \"^11.0.7\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^11.1.6\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/cli\": \"^0.11.21\",\n \"@types/cli-progress\": \"^3.11.5\",\n \"@types/express\": \"^4.17.21\",\n \"@types/inquirer\": \"^8.2.5\",\n \"@types/node\": \"^18.11.0\",\n \"@types/uuid\": \"^8.3.4\",\n \"@typescript-eslint/eslint-plugin\": \"^8.1.0\",\n \"@typescript-eslint/parser\": \"^8.1.0\",\n \"chalk\": \"^4.1.2\",\n \"cli\": \"^1.0.1\",\n \"cli-progress\": \"^3.12.0\",\n \"copy-webpack-plugin\": \"^11.0.0\",\n \"eslint-plugin-deprecation\": \"^3.0.0\",\n \"express\": \"^4.18.2\",\n \"nestia\": \"^8.0.7\",\n \"prettier\": \"^3.2.4\",\n \"prettier-plugin-prisma\": \"^5.0.0\",\n \"prisma-markdown\": \"^3.0.1\",\n \"rimraf\": \"^3.0.2\",\n \"rollup\": \"^4.18.0\",\n \"source-map-support\": \"^0.5.21\",\n \"swagger-ui-express\": \"^5.0.0\",\n \"ts-loader\": \"^9.5.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.5.5\",\n \"webpack\": \"^5.89.0\",\n \"webpack-cli\": \"^5.1.4\",\n \"write-file-webpack-plugin\": \"^4.5.1\"\n },\n \"dependencies\": {\n \"@nestia/core\": \"^8.0.7\",\n \"@nestia/fetcher\": \"^8.0.7\",\n \"@nestjs/common\": \"^11.1.3\",\n \"@nestjs/core\": \"^11.1.3\",\n \"@nestjs/platform-express\": \"^11.1.3\",\n \"@prisma/client\": \"^6.11.1\",\n \"commander\": \"10.0.0\",\n \"dotenv\": \"^16.3.1\",\n \"dotenv-expand\": \"^10.0.0\",\n \"inquirer\": \"8.2.5\",\n \"prisma\": \"^6.11.1\",\n \"serialize-error\": \"^4.1.0\",\n \"tgrid\": \"^1.1.0\",\n \"tstl\": \"^3.0.0\",\n \"typia\": \"^9.7.2\",\n \"uuid\": \"^9.0.0\"\n },\n \"stackblitz\": {\n \"startCommand\": \"npm run prepare && npm run build:test && npm run test -- --simultaneous 1\"\n }\n}\n",
3
3
  "src/setup/MySetupWizard.ts": "export namespace MySetupWizard {\n export async function schema(): Promise<void> {\n console.log(\"Realize agent has not generated main program yet.\");\n }\n\n export async function seed(): Promise<void> {}\n}\n",
4
4
  "test/helpers/TestAutomation.ts": "import api from \"@ORGANIZATION/PROJECT-api\";\nimport { DynamicExecutor } from \"@nestia/e2e\";\nimport { sleep_for } from \"tstl\";\n\nimport { MyConfiguration } from \"../../src/MyConfiguration\";\nimport { MySetupWizard } from \"../../src/setup/MySetupWizard\";\n\nexport namespace TestAutomation {\n export interface IProps<T> {\n open(options: IOptions): Promise<T>;\n close(backend: T): Promise<void>;\n onComplete(exec: DynamicExecutor.IExecution): void;\n onReset(): void;\n options: IOptions;\n }\n\n export interface IOptions {\n reset: boolean;\n simultaneous: number;\n include?: string[];\n exclude?: string[];\n }\n\n export const execute = async <T>(\n props: IProps<T>,\n ): Promise<DynamicExecutor.IReport> => {\n // RESET\n if (props.options.reset === true) {\n await MySetupWizard.schema();\n await MySetupWizard.seed();\n await props.onReset();\n }\n\n // OPEN BACKEND\n const backend: T = await props.open(props.options);\n const connection: api.IConnection = {\n host: `http://127.0.0.1:${MyConfiguration.API_PORT()}`,\n };\n\n // DO TEST\n const report: DynamicExecutor.IReport = await DynamicExecutor.validate({\n prefix: \"test\",\n location: __dirname + \"/../features\",\n parameters: () => [\n {\n host: connection.host,\n } satisfies api.IConnection,\n ],\n filter: (func) =>\n (!props.options.include?.length ||\n (props.options.include ?? []).some((str) => func.includes(str))) &&\n (!props.options.exclude?.length ||\n (props.options.exclude ?? []).every((str) => !func.includes(str))),\n onComplete: props.onComplete,\n simultaneous: props.options.simultaneous,\n extension: __filename.split(\".\").pop()!,\n });\n\n // TERMINATE\n await sleep_for(2500);\n await props.close(backend);\n return report;\n };\n}\n",
5
5
  "test/helpers/TestAutomationStdio.ts": "import { DynamicExecutor } from \"@nestia/e2e\";\nimport chalk from \"chalk\";\n\nimport { ArgumentParser } from \"./ArgumentParser\";\nimport { TestAutomation } from \"./TestAutomation\";\n\nexport namespace TestAutomationStdio {\n export const getOptions = () =>\n ArgumentParser.parse<TestAutomation.IOptions>(\n async (command, prompt, action) => {\n command.option(\"--reset <true|false>\", \"reset local DB or not\");\n command.option(\n \"--simultaneous <number>\",\n \"number of simultaneous requests\",\n );\n command.option(\"--include <string...>\", \"include feature files\");\n command.option(\"--exclude <string...>\", \"exclude feature files\");\n\n return action(async (options) => {\n // reset\n if (typeof options.reset === \"string\")\n options.reset = options.reset === \"true\";\n options.reset ??= await prompt.boolean(\"reset\")(\"Reset local DB\");\n\n // simultaneous\n options.simultaneous = Number(\n options.simultaneous ??\n (await prompt.number(\"simultaneous\")(\n \"Number of simultaneous requests to make\",\n )),\n );\n if (isNaN(options.simultaneous) || options.simultaneous <= 0)\n options.simultaneous = 1;\n return options as TestAutomation.IOptions;\n });\n },\n );\n\n export const onComplete = (exec: DynamicExecutor.IExecution): void => {\n const trace = (str: string) =>\n console.log(` - ${chalk.green(exec.name)}: ${str}`);\n if (exec.error === null) {\n const elapsed: number =\n new Date(exec.completed_at).getTime() -\n new Date(exec.started_at).getTime();\n trace(`${chalk.yellow(elapsed.toLocaleString())} ms`);\n } else trace(chalk.red(exec.error.name));\n };\n\n export const onReset = (start: Date) => (): void => {\n const now: Date = new Date();\n console.log(\n ` - Reset DB: ${(now.getDate() - start.getDate()).toLocaleString()} ms`,\n );\n };\n\n export const report = (report: DynamicExecutor.IReport): void => {\n const exceptions: Error[] = report.executions\n .filter((exec) => exec.error !== null)\n .map((exec) => exec.error!);\n if (exceptions.length === 0) {\n console.log(\"Success\");\n console.log(\"Elapsed time\", report.time.toLocaleString(), `ms`);\n } else {\n for (const exp of exceptions) console.log(exp);\n console.log(\"Failed\");\n console.log(\"Elapsed time\", report.time.toLocaleString(), `ms`);\n process.exit(-1);\n }\n };\n}\n",
@@ -11602,7 +11602,7 @@
11602
11602
  "node_modules/@nestia/benchmark/lib/internal/DynamicBenchmarkReporter.d.ts": "import { DynamicBenchmarker } from \"../DynamicBenchmarker\";\nexport declare namespace DynamicBenchmarkReporter {\n const markdown: (report: DynamicBenchmarker.IReport) => string;\n}\n",
11603
11603
  "node_modules/@nestia/benchmark/lib/internal/IBenchmarkMaster.d.ts": "export interface IBenchmarkMaster {\n filter: (name: string) => boolean;\n progress: (current: number) => void;\n}\n",
11604
11604
  "node_modules/@nestia/benchmark/lib/internal/IBenchmarkServant.d.ts": "import { IBenchmarkEvent } from \"../IBenchmarkEvent\";\nexport interface IBenchmarkServant {\n execute(props: {\n count: number;\n simultaneous: number;\n }): Promise<IBenchmarkEvent[]>;\n}\n",
11605
- "node_modules/@nestia/benchmark/package.json": "{\n \"name\": \"@nestia/benchmark\",\n \"version\": \"8.0.5\",\n \"description\": \"NestJS Performance Benchmark Program\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"npm run build:main && npm run build:test\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"prepare\": \"ts-patch install\",\n \"test\": \"node bin/test\"\n },\n \"keywords\": [\n \"e2e\",\n \"nestia\",\n \"nestjs\",\n \"Performance\",\n \"benchmark\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"dependencies\": {\n \"@nestia/fetcher\": \"^8.0.5\",\n \"tgrid\": \"^1.1.0\",\n \"tstl\": \"^3.0.0\"\n },\n \"devDependencies\": {\n \"@nestia/core\": \"^8.0.5\",\n \"@nestia/e2e\": \"^8.0.5\",\n \"@nestia/sdk\": \"^8.0.5\",\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@nestjs/platform-express\": \"^11.0.13\",\n \"@types/uuid\": \"^10.0.0\",\n \"nestia\": \"workspace:^\",\n \"ts-node\": \"^10.9.2\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.7\",\n \"typia\": \"^9.6.1\",\n \"uuid\": \"^10.0.0\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
11605
+ "node_modules/@nestia/benchmark/package.json": "{\n \"name\": \"@nestia/benchmark\",\n \"version\": \"8.0.7\",\n \"description\": \"NestJS Performance Benchmark Program\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"npm run build:main && npm run build:test\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"prepare\": \"ts-patch install\",\n \"test\": \"node bin/test\"\n },\n \"keywords\": [\n \"e2e\",\n \"nestia\",\n \"nestjs\",\n \"Performance\",\n \"benchmark\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"dependencies\": {\n \"@nestia/fetcher\": \"^8.0.7\",\n \"tgrid\": \"^1.1.0\",\n \"tstl\": \"^3.0.0\"\n },\n \"devDependencies\": {\n \"@nestia/core\": \"^8.0.7\",\n \"@nestia/e2e\": \"^8.0.7\",\n \"@nestia/sdk\": \"^8.0.7\",\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@nestjs/platform-express\": \"^11.0.13\",\n \"@types/uuid\": \"^10.0.0\",\n \"nestia\": \"workspace:^\",\n \"ts-node\": \"^10.9.2\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.7\",\n \"typia\": \"^9.6.1\",\n \"uuid\": \"^10.0.0\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
11606
11606
  "node_modules/@nestia/core/lib/adaptors/WebSocketAdaptor.d.ts": "import { INestApplication } from \"@nestjs/common\";\nexport declare class WebSocketAdaptor {\n static upgrade(app: INestApplication): Promise<WebSocketAdaptor>;\n readonly close: () => Promise<void>;\n private constructor();\n private readonly handleUpgrade;\n private readonly http;\n private readonly operators;\n private readonly ws;\n}\n",
11607
11607
  "node_modules/@nestia/core/lib/decorators/DynamicModule.d.ts": "import { ModuleMetadata } from \"@nestjs/common/interfaces\";\n/**\n * Dynamic module.\n *\n * `DynamicModule` is a namespace wrapping a convenient function, which can load\n * controller classes dynamically just by specifying their directory path.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace DynamicModule {\n /**\n * Mount dynamic module.\n *\n * Constructs a module instance with directory path of controller classes.\n *\n * Every controller classes in the target directory would be dynamically\n * mounted.\n *\n * @param path Path of controllers\n * @param metadata Additional metadata except controllers\n * @returns Module instance\n */\n function mount(path: string | string[] | {\n include: string[];\n exclude?: string[];\n }, metadata?: Omit<ModuleMetadata, \"controllers\">, isTsNode?: boolean): Promise<{\n new (): {};\n }>;\n}\n",
11608
11608
  "node_modules/@nestia/core/lib/decorators/EncryptedBody.d.ts": "import { IRequestBodyValidator } from \"../options/IRequestBodyValidator\";\n/**\n * Encrypted body decorator.\n *\n * `EncryptedBody` is a decorator function getting `application/json` typed data\n * from request body which has been encrypted by AES-128/256 algorithm. Also,\n * `EncryptedBody` validates the request body data type through\n * [typia](https://github.com/samchon/typia) ad the validation speed is maximum\n * 15,000x times faster than `class-validator`.\n *\n * For reference, when the request body data is not following the promised type\n * `T`, `BadRequestException` error (status code: 400) would be thrown. Also,\n * `EncryptedRoute` decrypts request body using those options.\n *\n * - AES-128/256\n * - CBC mode\n * - PKCS #5 Padding\n * - Base64 Encoding\n *\n * @author Jeongho Nam - https://github.com/samchon\n * @returns Parameter decorator\n */\nexport declare function EncryptedBody<T>(validator?: IRequestBodyValidator<T>): ParameterDecorator;\n",
@@ -11702,7 +11702,7 @@
11702
11702
  "node_modules/minimatch/dist/esm/index.d.ts": "import { AST } from './ast.js';\ntype Platform = 'aix' | 'android' | 'darwin' | 'freebsd' | 'haiku' | 'linux' | 'openbsd' | 'sunos' | 'win32' | 'cygwin' | 'netbsd';\nexport interface MinimatchOptions {\n nobrace?: boolean;\n nocomment?: boolean;\n nonegate?: boolean;\n debug?: boolean;\n noglobstar?: boolean;\n noext?: boolean;\n nonull?: boolean;\n windowsPathsNoEscape?: boolean;\n allowWindowsEscape?: boolean;\n partial?: boolean;\n dot?: boolean;\n nocase?: boolean;\n nocaseMagicOnly?: boolean;\n magicalBraces?: boolean;\n matchBase?: boolean;\n flipNegate?: boolean;\n preserveMultipleSlashes?: boolean;\n optimizationLevel?: number;\n platform?: Platform;\n windowsNoMagicRoot?: boolean;\n}\nexport declare const minimatch: {\n (p: string, pattern: string, options?: MinimatchOptions): boolean;\n sep: Sep;\n GLOBSTAR: typeof GLOBSTAR;\n filter: (pattern: string, options?: MinimatchOptions) => (p: string) => boolean;\n defaults: (def: MinimatchOptions) => typeof minimatch;\n braceExpand: (pattern: string, options?: MinimatchOptions) => string[];\n makeRe: (pattern: string, options?: MinimatchOptions) => false | MMRegExp;\n match: (list: string[], pattern: string, options?: MinimatchOptions) => string[];\n AST: typeof AST;\n Minimatch: typeof Minimatch;\n escape: (s: string, { windowsPathsNoEscape, }?: Pick<MinimatchOptions, \"windowsPathsNoEscape\">) => string;\n unescape: (s: string, { windowsPathsNoEscape, }?: Pick<MinimatchOptions, \"windowsPathsNoEscape\">) => string;\n};\ntype Sep = '\\\\' | '/';\nexport declare const sep: Sep;\nexport declare const GLOBSTAR: unique symbol;\nexport declare const filter: (pattern: string, options?: MinimatchOptions) => (p: string) => boolean;\nexport declare const defaults: (def: MinimatchOptions) => typeof minimatch;\nexport declare const braceExpand: (pattern: string, options?: MinimatchOptions) => string[];\nexport declare const makeRe: (pattern: string, options?: MinimatchOptions) => false | MMRegExp;\nexport declare const match: (list: string[], pattern: string, options?: MinimatchOptions) => string[];\nexport type MMRegExp = RegExp & {\n _src?: string;\n _glob?: string;\n};\nexport type ParseReturnFiltered = string | MMRegExp | typeof GLOBSTAR;\nexport type ParseReturn = ParseReturnFiltered | false;\nexport declare class Minimatch {\n options: MinimatchOptions;\n set: ParseReturnFiltered[][];\n pattern: string;\n windowsPathsNoEscape: boolean;\n nonegate: boolean;\n negate: boolean;\n comment: boolean;\n empty: boolean;\n preserveMultipleSlashes: boolean;\n partial: boolean;\n globSet: string[];\n globParts: string[][];\n nocase: boolean;\n isWindows: boolean;\n platform: Platform;\n windowsNoMagicRoot: boolean;\n regexp: false | null | MMRegExp;\n constructor(pattern: string, options?: MinimatchOptions);\n hasMagic(): boolean;\n debug(..._: any[]): void;\n make(): void;\n preprocess(globParts: string[][]): string[][];\n adjascentGlobstarOptimize(globParts: string[][]): string[][];\n levelOneOptimize(globParts: string[][]): string[][];\n levelTwoFileOptimize(parts: string | string[]): string[];\n firstPhasePreProcess(globParts: string[][]): string[][];\n secondPhasePreProcess(globParts: string[][]): string[][];\n partsMatch(a: string[], b: string[], emptyGSMatch?: boolean): false | string[];\n parseNegate(): void;\n matchOne(file: string[], pattern: ParseReturn[], partial?: boolean): boolean;\n braceExpand(): string[];\n parse(pattern: string): ParseReturn;\n makeRe(): false | MMRegExp;\n slashSplit(p: string): string[];\n match(f: string, partial?: boolean): boolean;\n static defaults(def: MinimatchOptions): typeof Minimatch;\n}\nexport { AST } from './ast.js';\nexport { escape } from './escape.js';\nexport { unescape } from './unescape.js';\n//# sourceMappingURL=index.d.ts.map",
11703
11703
  "node_modules/minimatch/dist/esm/unescape.d.ts": "import { MinimatchOptions } from './index.js';\n/**\n * Un-escape a string that has been escaped with {@link escape}.\n *\n * If the {@link windowsPathsNoEscape} option is used, then square-brace\n * escapes are removed, but not backslash escapes. For example, it will turn\n * the string `'[*]'` into `*`, but it will not turn `'\\\\*'` into `'*'`,\n * becuase `\\` is a path separator in `windowsPathsNoEscape` mode.\n *\n * When `windowsPathsNoEscape` is not set, then both brace escapes and\n * backslash escapes are removed.\n *\n * Slashes (and backslashes in `windowsPathsNoEscape` mode) cannot be escaped\n * or unescaped.\n */\nexport declare const unescape: (s: string, { windowsPathsNoEscape, }?: Pick<MinimatchOptions, \"windowsPathsNoEscape\">) => string;\n//# sourceMappingURL=unescape.d.ts.map",
11704
11704
  "node_modules/minimatch/package.json": "{\n \"author\": \"Isaac Z. Schlueter <i@izs.me> (http://blog.izs.me)\",\n \"name\": \"minimatch\",\n \"description\": \"a glob matcher in javascript\",\n \"version\": \"3.1.2\",\n \"publishConfig\": {\n \"tag\": \"v3-legacy\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"git://github.com/isaacs/minimatch.git\"\n },\n \"main\": \"minimatch.js\",\n \"scripts\": {\n \"test\": \"tap\",\n \"preversion\": \"npm test\",\n \"postversion\": \"npm publish\",\n \"postpublish\": \"git push origin --all; git push origin --tags\"\n },\n \"engines\": {\n \"node\": \"*\"\n },\n \"dependencies\": {\n \"brace-expansion\": \"^1.1.7\"\n },\n \"devDependencies\": {\n \"tap\": \"^15.1.6\"\n },\n \"license\": \"ISC\",\n \"files\": [\n \"minimatch.js\"\n ]\n}\n",
11705
- "node_modules/@nestia/core/package.json": "{\n \"name\": \"@nestia/core\",\n \"version\": \"8.0.5\",\n \"description\": \"Super-fast validation decorators of NestJS\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"tsp\": {\n \"tscOptions\": {\n \"parseAllJsDoc\": true\n }\n },\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint ./**/*.ts\",\n \"eslint:fix\": \"eslint ./**/*.ts --fix\",\n \"prepare\": \"ts-patch install && typia patch\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestjs\",\n \"nestia\",\n \"typia\",\n \"validator\",\n \"decorator\",\n \"class-validator\",\n \"class-transformer\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@nestia/fetcher\": \"^8.0.5\",\n \"@nestjs/common\": \">=7.0.1\",\n \"@nestjs/core\": \">=7.0.1\",\n \"@samchon/openapi\": \"^4.5.0\",\n \"detect-ts-node\": \"^1.0.5\",\n \"get-function-location\": \"^2.0.0\",\n \"glob\": \"^11.0.3\",\n \"path-parser\": \"^6.1.0\",\n \"raw-body\": \"^2.0.0\",\n \"reflect-metadata\": \">=0.1.12\",\n \"rxjs\": \">=6.0.3\",\n \"tgrid\": \"^1.1.0\",\n \"typia\": \"^9.6.1\",\n \"ws\": \"^7.5.3\"\n },\n \"peerDependencies\": {\n \"@nestia/fetcher\": \">=8.0.5\",\n \"@nestjs/common\": \">=7.0.1\",\n \"@nestjs/core\": \">=7.0.1\",\n \"@samchon/openapi\": \">=4.5.0 <5.0.0\",\n \"reflect-metadata\": \">=0.1.12\",\n \"rxjs\": \">=6.0.3\",\n \"typia\": \"^9.6.1\"\n },\n \"devDependencies\": {\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@types/express\": \"^4.17.15\",\n \"@types/inquirer\": \"^9.0.3\",\n \"@types/multer\": \"^1.4.12\",\n \"@types/ts-expose-internals\": \"npm:ts-expose-internals@5.4.5\",\n \"@types/ws\": \"^8.5.10\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"commander\": \"^10.0.0\",\n \"comment-json\": \"^4.2.3\",\n \"eslint-plugin-deprecation\": \"^1.4.1\",\n \"fastify\": \"^4.28.1\",\n \"git-last-commit\": \"^1.0.1\",\n \"inquirer\": \"^8.2.5\",\n \"rimraf\": \"^6.0.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"tstl\": \"^3.0.0\",\n \"typescript\": \"~5.9.2\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"lib\",\n \"src\"\n ]\n}",
11705
+ "node_modules/@nestia/core/package.json": "{\n \"name\": \"@nestia/core\",\n \"version\": \"8.0.7\",\n \"description\": \"Super-fast validation decorators of NestJS\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"tsp\": {\n \"tscOptions\": {\n \"parseAllJsDoc\": true\n }\n },\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint ./**/*.ts\",\n \"eslint:fix\": \"eslint ./**/*.ts --fix\",\n \"prepare\": \"ts-patch install && typia patch\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestjs\",\n \"nestia\",\n \"typia\",\n \"validator\",\n \"decorator\",\n \"class-validator\",\n \"class-transformer\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@nestia/fetcher\": \"^8.0.7\",\n \"@nestjs/common\": \">=7.0.1\",\n \"@nestjs/core\": \">=7.0.1\",\n \"@samchon/openapi\": \"^4.5.0\",\n \"detect-ts-node\": \"^1.0.5\",\n \"get-function-location\": \"^2.0.0\",\n \"glob\": \"^11.0.3\",\n \"path-parser\": \"^6.1.0\",\n \"raw-body\": \"^2.0.0\",\n \"reflect-metadata\": \">=0.1.12\",\n \"rxjs\": \">=6.0.3\",\n \"tgrid\": \"^1.1.0\",\n \"typia\": \"^9.6.1\",\n \"ws\": \"^7.5.3\"\n },\n \"peerDependencies\": {\n \"@nestia/fetcher\": \">=8.0.7\",\n \"@nestjs/common\": \">=7.0.1\",\n \"@nestjs/core\": \">=7.0.1\",\n \"@samchon/openapi\": \">=4.5.0 <5.0.0\",\n \"reflect-metadata\": \">=0.1.12\",\n \"rxjs\": \">=6.0.3\",\n \"typia\": \"^9.6.1\"\n },\n \"devDependencies\": {\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@types/express\": \"^4.17.15\",\n \"@types/inquirer\": \"^9.0.3\",\n \"@types/multer\": \"^1.4.12\",\n \"@types/ts-expose-internals\": \"npm:ts-expose-internals@5.4.5\",\n \"@types/ws\": \"^8.5.10\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"commander\": \"^10.0.0\",\n \"comment-json\": \"^4.2.3\",\n \"eslint-plugin-deprecation\": \"^1.4.1\",\n \"fastify\": \"^4.28.1\",\n \"git-last-commit\": \"^1.0.1\",\n \"inquirer\": \"^8.2.5\",\n \"rimraf\": \"^6.0.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"tstl\": \"^3.0.0\",\n \"typescript\": \"~5.9.2\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"lib\",\n \"src\"\n ]\n}",
11706
11706
  "node_modules/@nestia/core/src/typings/get-function-location.d.ts": "declare module \"get-function-location\" {\n export default function (func: any): Promise<{\n source: string;\n line: number;\n column: number;\n }>;\n}\n",
11707
11707
  "node_modules/@nestia/core/node_modules/glob/dist/commonjs/glob.d.ts": "import { Minimatch } from 'minimatch';\nimport { Minipass } from 'minipass';\nimport { FSOption, Path, PathScurry } from 'path-scurry';\nimport { IgnoreLike } from './ignore.js';\nimport { Pattern } from './pattern.js';\nexport type MatchSet = Minimatch['set'];\nexport type GlobParts = Exclude<Minimatch['globParts'], undefined>;\n/**\n * A `GlobOptions` object may be provided to any of the exported methods, and\n * must be provided to the `Glob` constructor.\n *\n * All options are optional, boolean, and false by default, unless otherwise\n * noted.\n *\n * All resolved options are added to the Glob object as properties.\n *\n * If you are running many `glob` operations, you can pass a Glob object as the\n * `options` argument to a subsequent operation to share the previously loaded\n * cache.\n */\nexport interface GlobOptions {\n /**\n * Set to `true` to always receive absolute paths for\n * matched files. Set to `false` to always return relative paths.\n *\n * When this option is not set, absolute paths are returned for patterns\n * that are absolute, and otherwise paths are returned that are relative\n * to the `cwd` setting.\n *\n * This does _not_ make an extra system call to get\n * the realpath, it only does string path resolution.\n *\n * Conflicts with {@link withFileTypes}\n */\n absolute?: boolean;\n /**\n * Set to false to enable {@link windowsPathsNoEscape}\n *\n * @deprecated\n */\n allowWindowsEscape?: boolean;\n /**\n * The current working directory in which to search. Defaults to\n * `process.cwd()`.\n *\n * May be eiher a string path or a `file://` URL object or string.\n */\n cwd?: string | URL;\n /**\n * Include `.dot` files in normal matches and `globstar`\n * matches. Note that an explicit dot in a portion of the pattern\n * will always match dot files.\n */\n dot?: boolean;\n /**\n * Prepend all relative path strings with `./` (or `.\\` on Windows).\n *\n * Without this option, returned relative paths are \"bare\", so instead of\n * returning `'./foo/bar'`, they are returned as `'foo/bar'`.\n *\n * Relative patterns starting with `'../'` are not prepended with `./`, even\n * if this option is set.\n */\n dotRelative?: boolean;\n /**\n * Follow symlinked directories when expanding `**`\n * patterns. This can result in a lot of duplicate references in\n * the presence of cyclic links, and make performance quite bad.\n *\n * By default, a `**` in a pattern will follow 1 symbolic link if\n * it is not the first item in the pattern, or none if it is the\n * first item in the pattern, following the same behavior as Bash.\n */\n follow?: boolean;\n /**\n * string or string[], or an object with `ignored` and `childrenIgnored`\n * methods.\n *\n * If a string or string[] is provided, then this is treated as a glob\n * pattern or array of glob patterns to exclude from matches. To ignore all\n * children within a directory, as well as the entry itself, append `'/**'`\n * to the ignore pattern.\n *\n * **Note** `ignore` patterns are _always_ in `dot:true` mode, regardless of\n * any other settings.\n *\n * If an object is provided that has `ignored(path)` and/or\n * `childrenIgnored(path)` methods, then these methods will be called to\n * determine whether any Path is a match or if its children should be\n * traversed, respectively.\n */\n ignore?: string | string[] | IgnoreLike;\n /**\n * Treat brace expansion like `{a,b}` as a \"magic\" pattern. Has no\n * effect if {@link nobrace} is set.\n *\n * Only has effect on the {@link hasMagic} function.\n */\n magicalBraces?: boolean;\n /**\n * Add a `/` character to directory matches. Note that this requires\n * additional stat calls in some cases.\n */\n mark?: boolean;\n /**\n * Perform a basename-only match if the pattern does not contain any slash\n * characters. That is, `*.js` would be treated as equivalent to\n * `**\\/*.js`, matching all js files in all directories.\n */\n matchBase?: boolean;\n /**\n * Limit the directory traversal to a given depth below the cwd.\n * Note that this does NOT prevent traversal to sibling folders,\n * root patterns, and so on. It only limits the maximum folder depth\n * that the walk will descend, relative to the cwd.\n */\n maxDepth?: number;\n /**\n * Do not expand `{a,b}` and `{1..3}` brace sets.\n */\n nobrace?: boolean;\n /**\n * Perform a case-insensitive match. This defaults to `true` on macOS and\n * Windows systems, and `false` on all others.\n *\n * **Note** `nocase` should only be explicitly set when it is\n * known that the filesystem's case sensitivity differs from the\n * platform default. If set `true` on case-sensitive file\n * systems, or `false` on case-insensitive file systems, then the\n * walk may return more or less results than expected.\n */\n nocase?: boolean;\n /**\n * Do not match directories, only files. (Note: to match\n * _only_ directories, put a `/` at the end of the pattern.)\n */\n nodir?: boolean;\n /**\n * Do not match \"extglob\" patterns such as `+(a|b)`.\n */\n noext?: boolean;\n /**\n * Do not match `**` against multiple filenames. (Ie, treat it as a normal\n * `*` instead.)\n *\n * Conflicts with {@link matchBase}\n */\n noglobstar?: boolean;\n /**\n * Defaults to value of `process.platform` if available, or `'linux'` if\n * not. Setting `platform:'win32'` on non-Windows systems may cause strange\n * behavior.\n */\n platform?: NodeJS.Platform;\n /**\n * Set to true to call `fs.realpath` on all of the\n * results. In the case of an entry that cannot be resolved, the\n * entry is omitted. This incurs a slight performance penalty, of\n * course, because of the added system calls.\n */\n realpath?: boolean;\n /**\n *\n * A string path resolved against the `cwd` option, which\n * is used as the starting point for absolute patterns that start\n * with `/`, (but not drive letters or UNC paths on Windows).\n *\n * Note that this _doesn't_ necessarily limit the walk to the\n * `root` directory, and doesn't affect the cwd starting point for\n * non-absolute patterns. A pattern containing `..` will still be\n * able to traverse out of the root directory, if it is not an\n * actual root directory on the filesystem, and any non-absolute\n * patterns will be matched in the `cwd`. For example, the\n * pattern `/../*` with `{root:'/some/path'}` will return all\n * files in `/some`, not all files in `/some/path`. The pattern\n * `*` with `{root:'/some/path'}` will return all the entries in\n * the cwd, not the entries in `/some/path`.\n *\n * To start absolute and non-absolute patterns in the same\n * path, you can use `{root:''}`. However, be aware that on\n * Windows systems, a pattern like `x:/*` or `//host/share/*` will\n * _always_ start in the `x:/` or `//host/share` directory,\n * regardless of the `root` setting.\n */\n root?: string;\n /**\n * A [PathScurry](http://npm.im/path-scurry) object used\n * to traverse the file system. If the `nocase` option is set\n * explicitly, then any provided `scurry` object must match this\n * setting.\n */\n scurry?: PathScurry;\n /**\n * Call `lstat()` on all entries, whether required or not to determine\n * if it's a valid match. When used with {@link withFileTypes}, this means\n * that matches will include data such as modified time, permissions, and\n * so on. Note that this will incur a performance cost due to the added\n * system calls.\n */\n stat?: boolean;\n /**\n * An AbortSignal which will cancel the Glob walk when\n * triggered.\n */\n signal?: AbortSignal;\n /**\n * Use `\\\\` as a path separator _only_, and\n * _never_ as an escape character. If set, all `\\\\` characters are\n * replaced with `/` in the pattern.\n *\n * Note that this makes it **impossible** to match against paths\n * containing literal glob pattern characters, but allows matching\n * with patterns constructed using `path.join()` and\n * `path.resolve()` on Windows platforms, mimicking the (buggy!)\n * behavior of Glob v7 and before on Windows. Please use with\n * caution, and be mindful of [the caveat below about Windows\n * paths](#windows). (For legacy reasons, this is also set if\n * `allowWindowsEscape` is set to the exact value `false`.)\n */\n windowsPathsNoEscape?: boolean;\n /**\n * Return [PathScurry](http://npm.im/path-scurry)\n * `Path` objects instead of strings. These are similar to a\n * NodeJS `Dirent` object, but with additional methods and\n * properties.\n *\n * Conflicts with {@link absolute}\n */\n withFileTypes?: boolean;\n /**\n * An fs implementation to override some or all of the defaults. See\n * http://npm.im/path-scurry for details about what can be overridden.\n */\n fs?: FSOption;\n /**\n * Just passed along to Minimatch. Note that this makes all pattern\n * matching operations slower and *extremely* noisy.\n */\n debug?: boolean;\n /**\n * Return `/` delimited paths, even on Windows.\n *\n * On posix systems, this has no effect. But, on Windows, it means that\n * paths will be `/` delimited, and absolute paths will be their full\n * resolved UNC forms, eg instead of `'C:\\\\foo\\\\bar'`, it would return\n * `'//?/C:/foo/bar'`\n */\n posix?: boolean;\n /**\n * Do not match any children of any matches. For example, the pattern\n * `**\\/foo` would match `a/foo`, but not `a/foo/b/foo` in this mode.\n *\n * This is especially useful for cases like \"find all `node_modules`\n * folders, but not the ones in `node_modules`\".\n *\n * In order to support this, the `Ignore` implementation must support an\n * `add(pattern: string)` method. If using the default `Ignore` class, then\n * this is fine, but if this is set to `false`, and a custom `Ignore` is\n * provided that does not have an `add()` method, then it will throw an\n * error.\n *\n * **Caveat** It *only* ignores matches that would be a descendant of a\n * previous match, and only if that descendant is matched *after* the\n * ancestor is encountered. Since the file system walk happens in\n * indeterminate order, it's possible that a match will already be added\n * before its ancestor, if multiple or braced patterns are used.\n *\n * For example:\n *\n * ```ts\n * const results = await glob([\n * // likely to match first, since it's just a stat\n * 'a/b/c/d/e/f',\n *\n * // this pattern is more complicated! It must to various readdir()\n * // calls and test the results against a regular expression, and that\n * // is certainly going to take a little bit longer.\n * //\n * // So, later on, it encounters a match at 'a/b/c/d/e', but it's too\n * // late to ignore a/b/c/d/e/f, because it's already been emitted.\n * 'a/[bdf]/?/[a-z]/*',\n * ], { includeChildMatches: false })\n * ```\n *\n * It's best to only set this to `false` if you can be reasonably sure that\n * no components of the pattern will potentially match one another's file\n * system descendants, or if the occasional included child entry will not\n * cause problems.\n *\n * @default true\n */\n includeChildMatches?: boolean;\n}\nexport type GlobOptionsWithFileTypesTrue = GlobOptions & {\n withFileTypes: true;\n absolute?: undefined;\n mark?: undefined;\n posix?: undefined;\n};\nexport type GlobOptionsWithFileTypesFalse = GlobOptions & {\n withFileTypes?: false;\n};\nexport type GlobOptionsWithFileTypesUnset = GlobOptions & {\n withFileTypes?: undefined;\n};\nexport type Result<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? Path : Opts extends GlobOptionsWithFileTypesFalse ? string : Opts extends GlobOptionsWithFileTypesUnset ? string : string | Path;\nexport type Results<Opts> = Result<Opts>[];\nexport type FileTypes<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? true : Opts extends GlobOptionsWithFileTypesFalse ? false : Opts extends GlobOptionsWithFileTypesUnset ? false : boolean;\n/**\n * An object that can perform glob pattern traversals.\n */\nexport declare class Glob<Opts extends GlobOptions> implements GlobOptions {\n absolute?: boolean;\n cwd: string;\n root?: string;\n dot: boolean;\n dotRelative: boolean;\n follow: boolean;\n ignore?: string | string[] | IgnoreLike;\n magicalBraces: boolean;\n mark?: boolean;\n matchBase: boolean;\n maxDepth: number;\n nobrace: boolean;\n nocase: boolean;\n nodir: boolean;\n noext: boolean;\n noglobstar: boolean;\n pattern: string[];\n platform: NodeJS.Platform;\n realpath: boolean;\n scurry: PathScurry;\n stat: boolean;\n signal?: AbortSignal;\n windowsPathsNoEscape: boolean;\n withFileTypes: FileTypes<Opts>;\n includeChildMatches: boolean;\n /**\n * The options provided to the constructor.\n */\n opts: Opts;\n /**\n * An array of parsed immutable {@link Pattern} objects.\n */\n patterns: Pattern[];\n /**\n * All options are stored as properties on the `Glob` object.\n *\n * See {@link GlobOptions} for full options descriptions.\n *\n * Note that a previous `Glob` object can be passed as the\n * `GlobOptions` to another `Glob` instantiation to re-use settings\n * and caches with a new pattern.\n *\n * Traversal functions can be called multiple times to run the walk\n * again.\n */\n constructor(pattern: string | string[], opts: Opts);\n /**\n * Returns a Promise that resolves to the results array.\n */\n walk(): Promise<Results<Opts>>;\n /**\n * synchronous {@link Glob.walk}\n */\n walkSync(): Results<Opts>;\n /**\n * Stream results asynchronously.\n */\n stream(): Minipass<Result<Opts>, Result<Opts>>;\n /**\n * Stream results synchronously.\n */\n streamSync(): Minipass<Result<Opts>, Result<Opts>>;\n /**\n * Default sync iteration function. Returns a Generator that\n * iterates over the results.\n */\n iterateSync(): Generator<Result<Opts>, void, void>;\n [Symbol.iterator](): Generator<Result<Opts>, void, void>;\n /**\n * Default async iteration function. Returns an AsyncGenerator that\n * iterates over the results.\n */\n iterate(): AsyncGenerator<Result<Opts>, void, void>;\n [Symbol.asyncIterator](): AsyncGenerator<Result<Opts>, void, void>;\n}\n//# sourceMappingURL=glob.d.ts.map",
11708
11708
  "node_modules/@nestia/core/node_modules/glob/dist/commonjs/has-magic.d.ts": "import { GlobOptions } from './glob.js';\n/**\n * Return true if the patterns provided contain any magic glob characters,\n * given the options provided.\n *\n * Brace expansion is not considered \"magic\" unless the `magicalBraces` option\n * is set, as brace expansion just turns one string into an array of strings.\n * So a pattern like `'x{a,b}y'` would return `false`, because `'xay'` and\n * `'xby'` both do not contain any magic glob characters, and it's treated the\n * same as if you had called it on `['xay', 'xby']`. When `magicalBraces:true`\n * is in the options, brace expansion _is_ treated as a pattern having magic.\n */\nexport declare const hasMagic: (pattern: string | string[], options?: GlobOptions) => boolean;\n//# sourceMappingURL=has-magic.d.ts.map",
@@ -11741,7 +11741,7 @@
11741
11741
  "node_modules/@nestia/e2e/lib/index.d.ts": "import * as e2e from \"./module\";\nexport default e2e;\nexport * from \"./module\";\n",
11742
11742
  "node_modules/@nestia/e2e/lib/internal/json_equal_to.d.ts": "export declare const json_equal_to: (exception: (key: string) => boolean) => <T>(x: T) => (y: T | null | undefined) => string[];\n",
11743
11743
  "node_modules/@nestia/e2e/lib/module.d.ts": "export * from \"./ArrayUtil\";\nexport * from \"./MapUtil\";\nexport * from \"./RandomGenerator\";\nexport * from \"./DynamicExecutor\";\nexport * from \"./GaffComparator\";\nexport * from \"./TestValidator\";\n",
11744
- "node_modules/@nestia/e2e/package.json": "{\n \"name\": \"@nestia/e2e\",\n \"version\": \"8.0.5\",\n \"description\": \"E2E test utilify functions\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"npm run build:main && npm run build:test\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"prepare\": \"ts-patch install && typia patch\",\n \"test\": \"node bin/test\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"e2e\",\n \"nestia\",\n \"nestjs\",\n \"test\",\n \"tdd\",\n \"utility\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"devDependencies\": {\n \"@trivago/prettier-plugin-sort-imports\": \"^4.0.0\",\n \"@types/node\": \"^18.11.18\",\n \"@typescript-eslint/eslint-plugin\": \"^5.57.0\",\n \"@typescript-eslint/parser\": \"^5.57.0\",\n \"rimraf\": \"^6.0.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.7\",\n \"typia\": \"^9.6.1\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
11744
+ "node_modules/@nestia/e2e/package.json": "{\n \"name\": \"@nestia/e2e\",\n \"version\": \"8.0.7\",\n \"description\": \"E2E test utilify functions\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"npm run build:main && npm run build:test\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"prepare\": \"ts-patch install && typia patch\",\n \"test\": \"node bin/test\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"e2e\",\n \"nestia\",\n \"nestjs\",\n \"test\",\n \"tdd\",\n \"utility\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"devDependencies\": {\n \"@trivago/prettier-plugin-sort-imports\": \"^4.0.0\",\n \"@types/node\": \"^18.11.18\",\n \"@typescript-eslint/eslint-plugin\": \"^5.57.0\",\n \"@typescript-eslint/parser\": \"^5.57.0\",\n \"rimraf\": \"^6.0.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.7\",\n \"typia\": \"^9.6.1\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
11745
11745
  "node_modules/@nestia/editor/lib/NestiaEditorApplication.d.ts": "export declare function NestiaEditorApplication(): import(\"react/jsx-runtime\").JSX.Element;\n",
11746
11746
  "node_modules/@nestia/editor/lib/NestiaEditorIframe.d.ts": "import { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nexport declare function NestiaEditorIframe(props: NestiaEditorIframe.IProps): import(\"react/jsx-runtime\").JSX.Element;\nexport declare namespace NestiaEditorIframe {\n interface IProps {\n swagger: string | SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument;\n package?: string;\n keyword?: boolean;\n simulate?: boolean;\n e2e?: boolean;\n }\n}\n",
11747
11747
  "node_modules/@nestia/editor/lib/NestiaEditorModule.d.ts": "import type { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nexport declare namespace NestiaEditorModule {\n const setup: (props: {\n path: string;\n application: INestApplication;\n swagger: string | SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument;\n package?: string;\n simulate?: boolean;\n e2e?: boolean;\n }) => Promise<void>;\n}\ninterface INestApplication {\n use(...args: any[]): this;\n getUrl(): Promise<string>;\n getHttpAdapter(): INestHttpAdaptor;\n setGlobalPrefix(prefix: string, options?: any): this;\n}\ninterface INestHttpAdaptor {\n getType(): string;\n close(): any;\n init?(): Promise<void>;\n get: Function;\n post: Function;\n put: Function;\n patch: Function;\n delete: Function;\n head: Function;\n all: Function;\n}\nexport {};\n",
@@ -11750,7 +11750,7 @@
11750
11750
  "node_modules/@nestia/editor/lib/internal/NestiaEditorComposer.d.ts": "import { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nimport { IValidation } from \"typia\";\nexport declare namespace NestiaEditorComposer {\n interface IProps {\n document: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument;\n e2e: boolean;\n keyword: boolean;\n simulate: boolean;\n package?: string;\n }\n interface IOutput {\n files: Record<string, string>;\n openFile: string;\n startScript: string[];\n }\n const nest: (props: IProps) => Promise<IValidation<IOutput>>;\n const sdk: (props: IProps) => Promise<IValidation<IOutput>>;\n}\n",
11751
11751
  "node_modules/@nestia/editor/lib/internal/NestiaEditorFileUploader.d.ts": "import { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nexport declare function NestiaEditorFileUploader(props: NestiaEditorFileUploader.IProps): import(\"react/jsx-runtime\").JSX.Element;\nexport declare namespace NestiaEditorFileUploader {\n interface IProps {\n onChange: (swagger: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument | null, error: string | null) => void;\n }\n}\n",
11752
11752
  "node_modules/@nestia/editor/lib/main.d.ts": "export {};\n",
11753
- "node_modules/@nestia/editor/package.json": "{\n \"name\": \"@nestia/editor\",\n \"version\": \"8.0.5\",\n \"main\": \"lib/index.js\",\n \"module\": \"lib/index.mjs\",\n \"typings\": \"lib/index.d.ts\",\n \"description\": \"Swagger-UI + Cloud TypeScript Editor\",\n \"scripts\": {\n \"build\": \"npm run build:static && npm run build:lib\",\n \"build:static\": \"rimraf dist && tsc -b && vite build\",\n \"build:lib\": \"rimraf lib && tsc --project tsconfig.lib.json && rollup -c\",\n \"dev\": \"vite\",\n \"lint\": \"eslint .\",\n \"preview\": \"vite preview\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"openapi\",\n \"swagger\",\n \"generator\",\n \"cloud\",\n \"typescript\",\n \"editor\",\n \"sdk\",\n \"nestjs\",\n \"nestia\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@mui/material\": \"^5.15.6\",\n \"@nestia/migrate\": \"^8.0.5\",\n \"@samchon/openapi\": \"^4.5.0\",\n \"@stackblitz/sdk\": \"^1.11.0\",\n \"@trivago/prettier-plugin-sort-imports\": \"^5.2.2\",\n \"js-yaml\": \"^4.1.0\",\n \"prettier\": \"3.3.3\",\n \"prettier-plugin-jsdoc\": \"^1.3.2\",\n \"react-mui-fileuploader\": \"^0.5.2\",\n \"typia\": \"^9.6.1\"\n },\n \"devDependencies\": {\n \"@eslint/js\": \"^9.13.0\",\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@nestjs/platform-express\": \"^11.0.13\",\n \"@nestjs/platform-fastify\": \"^11.0.13\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^12.1.1\",\n \"@types/js-yaml\": \"^4.0.9\",\n \"@types/node\": \"^22.8.6\",\n \"@types/react\": \"^18.3.11\",\n \"@types/react-dom\": \"^18.3.1\",\n \"@vitejs/plugin-react\": \"^4.3.3\",\n \"eslint\": \"^9.13.0\",\n \"eslint-plugin-react-hooks\": \"^5.0.0\",\n \"eslint-plugin-react-refresh\": \"^0.4.13\",\n \"globals\": \"^15.11.0\",\n \"react\": \"^18.3.1\",\n \"react-dom\": \"^18.3.1\",\n \"rollup\": \"^4.24.2\",\n \"ts-node\": \"^10.9.2\",\n \"typescript\": \"~5.9.2\",\n \"typescript-eslint\": \"^8.10.0\",\n \"vite\": \"^5.4.9\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"dist\",\n \"lib\",\n \"src\"\n ]\n}",
11753
+ "node_modules/@nestia/editor/package.json": "{\n \"name\": \"@nestia/editor\",\n \"version\": \"8.0.7\",\n \"main\": \"lib/index.js\",\n \"module\": \"lib/index.mjs\",\n \"typings\": \"lib/index.d.ts\",\n \"description\": \"Swagger-UI + Cloud TypeScript Editor\",\n \"scripts\": {\n \"build\": \"npm run build:static && npm run build:lib\",\n \"build:static\": \"rimraf dist && tsc -b && vite build\",\n \"build:lib\": \"rimraf lib && tsc --project tsconfig.lib.json && rollup -c\",\n \"dev\": \"vite\",\n \"lint\": \"eslint .\",\n \"preview\": \"vite preview\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"openapi\",\n \"swagger\",\n \"generator\",\n \"cloud\",\n \"typescript\",\n \"editor\",\n \"sdk\",\n \"nestjs\",\n \"nestia\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@mui/material\": \"^5.15.6\",\n \"@nestia/migrate\": \"^8.0.7\",\n \"@samchon/openapi\": \"^4.5.0\",\n \"@stackblitz/sdk\": \"^1.11.0\",\n \"@trivago/prettier-plugin-sort-imports\": \"^5.2.2\",\n \"js-yaml\": \"^4.1.0\",\n \"prettier\": \"3.3.3\",\n \"prettier-plugin-jsdoc\": \"^1.3.2\",\n \"react-mui-fileuploader\": \"^0.5.2\",\n \"typia\": \"^9.6.1\"\n },\n \"devDependencies\": {\n \"@eslint/js\": \"^9.13.0\",\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@nestjs/platform-express\": \"^11.0.13\",\n \"@nestjs/platform-fastify\": \"^11.0.13\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^12.1.1\",\n \"@types/js-yaml\": \"^4.0.9\",\n \"@types/node\": \"^22.8.6\",\n \"@types/react\": \"^18.3.11\",\n \"@types/react-dom\": \"^18.3.1\",\n \"@vitejs/plugin-react\": \"^4.3.3\",\n \"eslint\": \"^9.13.0\",\n \"eslint-plugin-react-hooks\": \"^5.0.0\",\n \"eslint-plugin-react-refresh\": \"^0.4.13\",\n \"globals\": \"^15.11.0\",\n \"react\": \"^18.3.1\",\n \"react-dom\": \"^18.3.1\",\n \"rollup\": \"^4.24.2\",\n \"ts-node\": \"^10.9.2\",\n \"typescript\": \"~5.9.2\",\n \"typescript-eslint\": \"^8.10.0\",\n \"vite\": \"^5.4.9\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"dist\",\n \"lib\",\n \"src\"\n ]\n}",
11754
11754
  "node_modules/@nestia/editor/src/vite-env.d.ts": "/// <reference types=\"vite/client\" />\n",
11755
11755
  "node_modules/@nestia/fetcher/lib/AesPkcs5.d.ts": "/**\n * Utility class for the AES-128/256 encryption.\n *\n * - AES-128/256\n * - CBC mode\n * - PKCS#5 Padding\n * - Base64 Encoding\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace AesPkcs5 {\n /**\n * Encrypt data\n *\n * @param data Target data\n * @param key Key value of the encryption.\n * @param iv Initializer Vector for the encryption\n * @returns Encrypted data\n */\n function encrypt(data: string, key: string, iv: string): string;\n /**\n * Decrypt data.\n *\n * @param data Target data\n * @param key Key value of the decryption.\n * @param iv Initializer Vector for the decryption\n * @returns Decrypted data.\n */\n function decrypt(data: string, key: string, iv: string): string;\n}\n",
11756
11756
  "node_modules/@nestia/fetcher/lib/EncryptedFetcher.d.ts": "import { IConnection } from \"./IConnection\";\nimport { IFetchRoute } from \"./IFetchRoute\";\nimport { IPropagation } from \"./IPropagation\";\n/**\n * Utility class for `fetch` functions used in `@nestia/sdk` with encryption.\n *\n * `EncryptedFetcher` is a utility class designed for SDK functions generated by\n * [`@nestia/sdk`](https://nestia.io/docs/sdk/sdk), interacting with the remote\n * HTTP API encrypted by AES-PKCS algorithm. In other words, this is a\n * collection of dedicated `fetch()` functions for `@nestia/sdk` with\n * encryption.\n *\n * For reference, `EncryptedFetcher` class being used only when target\n * controller method is encrypting body data by `@EncryptedRoute` or\n * `@EncryptedBody` decorators. If those decorators are not used,\n * {@link PlainFetcher} class would be used instead.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace EncryptedFetcher {\n /**\n * Fetch function only for `HEAD` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Nothing because of `HEAD` method\n */\n function fetch(connection: IConnection, route: IFetchRoute<\"HEAD\">): Promise<void>;\n /**\n * Fetch function only for `GET` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Output>(connection: IConnection, route: IFetchRoute<\"GET\">): Promise<Output>;\n /**\n * Fetch function for the `POST`, `PUT`, `PATCH` and `DELETE` methods.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Input, Output>(connection: IConnection, route: IFetchRoute<\"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n function propagate<Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"GET\" | \"HEAD\">): Promise<Output>;\n function propagate<Input, Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"DELETE\" | \"GET\" | \"HEAD\" | \"PATCH\" | \"POST\" | \"PUT\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n}\n",
@@ -11766,7 +11766,7 @@
11766
11766
  "node_modules/@nestia/fetcher/lib/PlainFetcher.d.ts": "import { IConnection } from \"./IConnection\";\nimport { IFetchRoute } from \"./IFetchRoute\";\nimport { IPropagation } from \"./IPropagation\";\n/**\n * Utility class for `fetch` functions used in `@nestia/sdk`.\n *\n * `PlainFetcher` is a utility class designed for SDK functions generated by\n * [`@nestia/sdk`](https://nestia.io/docs/sdk/sdk), interacting with the remote\n * HTTP sever API. In other words, this is a collection of dedicated `fetch()`\n * functions for `@nestia/sdk`.\n *\n * For reference, `PlainFetcher` class does not encrypt or decrypt the body data\n * at all. It just delivers plain data without any post processing. If you've\n * defined a controller method through `@EncryptedRoute` or `@EncryptedBody`\n * decorator, then {@liink EncryptedFetcher} class would be used instead.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace PlainFetcher {\n /**\n * Fetch function only for `HEAD` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Nothing because of `HEAD` method\n */\n function fetch(connection: IConnection, route: IFetchRoute<\"HEAD\">): Promise<void>;\n /**\n * Fetch function only for `GET` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Output>(connection: IConnection, route: IFetchRoute<\"GET\">): Promise<Output>;\n /**\n * Fetch function for the `POST`, `PUT`, `PATCH` and `DELETE` methods.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Input, Output>(connection: IConnection, route: IFetchRoute<\"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n function propagate<Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"GET\" | \"HEAD\">): Promise<Output>;\n function propagate<Input, Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"DELETE\" | \"GET\" | \"HEAD\" | \"PATCH\" | \"POST\" | \"PUT\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n}\n",
11767
11767
  "node_modules/@nestia/fetcher/lib/index.d.ts": "export * from \"./FormDataInput\";\nexport * from \"./HttpError\";\nexport * from \"./IConnection\";\nexport * from \"./IEncryptionPassword\";\nexport * from \"./IFetchEvent\";\nexport * from \"./IFetchRoute\";\nexport * from \"./IPropagation\";\n",
11768
11768
  "node_modules/@nestia/fetcher/lib/internal/FetcherBase.d.ts": "export {};\n",
11769
- "node_modules/@nestia/fetcher/package.json": "{\n \"name\": \"@nestia/fetcher\",\n \"version\": \"8.0.5\",\n \"description\": \"Fetcher library of Nestia SDK\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint src\",\n \"eslint:fix\": \"eslint src --fix\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestia\",\n \"fetcher\",\n \"sdk\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@samchon/openapi\": \"^4.5.0\"\n },\n \"devDependencies\": {\n \"@types/node\": \"^18.11.14\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"rimraf\": \"^6.0.1\",\n \"typescript\": \"~5.9.2\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"lib\",\n \"src\"\n ]\n}",
11769
+ "node_modules/@nestia/fetcher/package.json": "{\n \"name\": \"@nestia/fetcher\",\n \"version\": \"8.0.7\",\n \"description\": \"Fetcher library of Nestia SDK\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint src\",\n \"eslint:fix\": \"eslint src --fix\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestia\",\n \"fetcher\",\n \"sdk\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@samchon/openapi\": \"^4.5.0\"\n },\n \"devDependencies\": {\n \"@types/node\": \"^18.11.14\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"rimraf\": \"^6.0.1\",\n \"typescript\": \"~5.9.2\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"lib\",\n \"src\"\n ]\n}",
11770
11770
  "node_modules/@nestia/migrate/lib/NestiaMigrateApplication.d.ts": "import { IHttpMigrateApplication, OpenApi, OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nimport { IValidation } from \"typia\";\nimport { INestiaMigrateConfig } from \"./structures/INestiaMigrateConfig\";\nimport { INestiaMigrateContext } from \"./structures/INestiaMigrateContext\";\nimport { INestiaMigrateFile } from \"./structures/INestiaMigrateFile\";\nexport declare class NestiaMigrateApplication {\n readonly document: OpenApi.IDocument;\n private readonly data_;\n constructor(document: OpenApi.IDocument);\n static assert(document: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument | OpenApi.IDocument): NestiaMigrateApplication;\n static validate(document: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument | OpenApi.IDocument): IValidation<NestiaMigrateApplication>;\n getData(): IHttpMigrateApplication;\n /** @deprecated */\n getErrors(): IHttpMigrateApplication.IError[];\n nest(config: INestiaMigrateConfig): Record<string, string>;\n sdk(config: INestiaMigrateConfig): Record<string, string>;\n}\nexport declare namespace MigrateApplication {\n interface IOutput {\n context: INestiaMigrateContext;\n files: INestiaMigrateFile[];\n errors: IHttpMigrateApplication.IError[];\n }\n}\n",
11771
11771
  "node_modules/@nestia/migrate/lib/analyzers/NestiaMigrateControllerAnalyzer.d.ts": "import { IHttpMigrateRoute } from \"@samchon/openapi\";\nimport { INestiaMigrateController } from \"../structures/INestiaMigrateController\";\nexport declare namespace NestiaMigrateControllerAnalyzer {\n const analyze: (routes: IHttpMigrateRoute[]) => INestiaMigrateController[];\n}\n",
11772
11772
  "node_modules/@nestia/migrate/lib/archivers/NestiaMigrateFileArchiver.d.ts": "export declare namespace NestiaMigrateFileArchiver {\n const archive: (props: {\n mkdir: (path: string) => Promise<void>;\n writeFile: (path: string, content: string) => Promise<void>;\n root: string;\n files: Record<string, string>;\n }) => Promise<void>;\n}\n",
@@ -11807,7 +11807,7 @@
11807
11807
  "node_modules/@nestia/migrate/lib/utils/StringUtil.d.ts": "export declare namespace StringUtil {\n const capitalize: (str: string) => string;\n const splitWithNormalization: (path: string) => string[];\n const escapeDuplicate: (keep: string[]) => (change: string) => string;\n const escapeNonVariable: (str: string) => string;\n}\n",
11808
11808
  "node_modules/@nestia/migrate/lib/utils/openapi-down-convert/RefVisitor.d.ts": "/**\n * Recursively walk a JSON object and invoke a callback function on each `{\n * \"$ref\" : \"path\" }` object found\n */\n/**\n * Represents a JSON Reference object, such as `{\"$ref\":\n * \"#/components/schemas/problemResponse\" }`\n */\nexport interface RefObject {\n $ref: string;\n}\n/** JsonNode represents a node within the OpenAPI object */\nexport type JsonNode = object | [] | string | boolean | null | number;\n/** A JSON Schema object in an API def */\nexport type SchemaObject = object;\n/** Function signature for the visitRefObjects callback */\nexport type RefVisitor = (node: RefObject) => JsonNode;\n/** Function signature for the visitSchemaObjects callback */\nexport type SchemaVisitor = (node: SchemaObject) => SchemaObject;\n/** /** Function signature for the walkObject callback */\nexport type ObjectVisitor = (node: object) => JsonNode;\n/** Test if a JSON node is a `{ $ref: \"uri\" }` object */\nexport declare function isRef(node: any): boolean;\n/**\n * Walk a JSON object and apply `schemaCallback` when a JSON schema is found.\n * JSON Schema objects are items in components/schemas or in an item named\n * `schema`\n *\n * @param node A node in the OpenAPI document\n * @param schemaCallback The function to call on JSON schema objects\n * @returns The modified (annotated) node\n */\nexport declare function visitSchemaObjects(node: any, schemaCallback: SchemaVisitor): any;\n/**\n * Walk a JSON object and apply `refCallback` when a JSON `{$ref: url }` is\n * found\n *\n * @param node A node in the OpenAPI document\n * @param refCallback The function to call on JSON `$ref` objects\n * @returns The modified (annotated) node\n */\nexport declare function visitRefObjects(node: any, refCallback: RefVisitor): any;\n/**\n * Walk a JSON object or array and apply objectCallback when a JSON object is\n * found\n *\n * @param node A node in the OpenAPI document\n * @param objectCallback The function to call on JSON objects\n * @param nav Tracks where we are in the original document\n * @returns The modified (annotated) node\n */\nexport declare function walkObject(node: object, objectCallback: ObjectVisitor): JsonNode;\n",
11809
11809
  "node_modules/@nestia/migrate/lib/utils/openapi-down-convert/converter.d.ts": "/** Options for the converter instantiation */\nexport interface ConverterOptions {\n /** If `true`, log conversion transformations to stderr */\n verbose?: boolean;\n /**\n * If `true`, remove `id` values in schema examples, to bypass [Spectral issue\n * 2081](https://github.com/stoplightio/spectral/issues/2081)\n */\n deleteExampleWithId?: boolean;\n /** If `true`, replace a `$ref` object that has siblings into an `allOf` */\n allOfTransform?: boolean;\n /** The authorizationUrl for openIdConnect -> oauth2 transformation */\n authorizationUrl?: string;\n /** The tokenUrl for openIdConnect -> oauth2 transformation */\n tokenUrl?: string;\n /**\n * Name of YAML/JSON file with scope descriptions. This is a simple map in the\n * format `{ scope1: \"description of scope1\", ... }`\n */\n scopeDescriptionFile?: string;\n /**\n * Earlier versions of the tool converted $comment to x-comment in JSON\n * Schemas. The tool now deletes $comment values by default. Use this option\n * to preserve the conversion and not delete comments.\n */\n convertSchemaComments?: boolean;\n}\nexport declare class Converter {\n private openapi30;\n private verbose;\n private deleteExampleWithId;\n private allOfTransform;\n private authorizationUrl;\n /** The tokenUrl for openIdConnect -> oauth2 transformation */\n private tokenUrl;\n private scopeDescriptions;\n private convertSchemaComments;\n private returnCode;\n /**\n * Construct a new Converter\n *\n * @throws Error if the scopeDescriptionFile (if specified) cannot be read or\n * parsed as YAML/JSON\n */\n constructor(openapiDocument: object, options?: ConverterOptions);\n /**\n * Load the scopes.yaml file and save in this.scopeDescriptions\n *\n * @throws Error if the file cannot be read or parsed as YAML/JSON\n */\n private loadScopeDescriptions;\n /**\n * Log a message to console.warn stream if verbose is true\n *\n * @param message Parameters for console.warn\n */\n private log;\n /**\n * Log a message to console.warn stream. Prefix the message string with\n * `Warning: ` if it does not already have that text.\n *\n * @param message Parameters for console.warn\n */\n private warn;\n /**\n * Log an error message to `console.error` stream. Prefix the message string\n * with `Error: ` if it does not already start with `'Error'`. Increments the\n * `returnCode`, causing the CLI to throw an Error when done.\n *\n * @param message Parameters for `console.error`\n */\n private error;\n /**\n * Convert the OpenAPI document to 3.0\n *\n * @returns The converted document. The input is not modified.\n */\n convert(): object;\n /**\n * OpenAPI 3.1 uses JSON Schema 2020-12 which allows schema `examples`;\n * OpenAPI 3.0 uses JSON Scheme Draft 7 which only allows `example`. Replace\n * all `examples` with `example`, using `examples[0]`\n */\n convertJsonSchemaExamples(): void;\n private walkNestedSchemaObjects;\n /**\n * OpenAPI 3.1 uses JSON Schema 2020-12 which allows `const` OpenAPI 3.0 uses\n * JSON Scheme Draft 7 which only allows `enum`. Replace all `const: value`\n * with `enum: [ value ]`\n */\n convertConstToEnum(): void;\n /**\n * Convert 2-element type arrays containing 'null' to string type and\n * `nullable: true`\n */\n convertNullableTypeArray(): void;\n removeWebhooksObject(): void;\n removeUnsupportedSchemaKeywords(): void;\n renameSchema$comment(): void;\n private deleteSchema$comment;\n /**\n * Convert\n *\n * contentMediaType: \"application/octet-stream\";\n *\n * To\n *\n * format: binary;\n *\n * In `type: string` schemas. Warn if schema has a `format` already and it is\n * not `binary`.\n */\n convertJsonSchemaContentMediaType(): void;\n /**\n * Convert\n *\n * contentEncoding: base64;\n *\n * To\n *\n * format: byte;\n *\n * In `type: string` schemas. It is an error if the schema has a `format`\n * already and it is not `byte`.\n */\n convertJsonSchemaContentEncoding(): void;\n private json;\n /**\n * OpenAPI 3.1 defines a new `openIdConnect` security scheme. Down-convert the\n * scheme to `oauth2` / authorization code flow. Collect all the scopes used\n * in any security requirements within operations and add them to the scheme.\n * Also define the URLs to the `authorizationUrl` and `tokenUrl` of `oauth2`.\n */\n convertSecuritySchemes(): void;\n /**\n * Find remaining OpenAPI 3.0 [Reference\n * Objects](https://github.com/OAI/OpenAPI-Specification/blob/main/versions/3.1.0.md#referenceObject)\n * and down convert them to [JSON\n * Reference](https://tools.ietf.org/html/draft-pbryan-zyp-json-ref-03)\n * objects with _only_ a `$ref` property.\n */\n simplifyNonSchemaRef(): void;\n removeLicenseIdentifier(): void;\n convertSchemaRef(): void;\n static deepClone(obj: object): object;\n}\n",
11810
- "node_modules/@nestia/migrate/package.json": "{\n \"name\": \"@nestia/migrate\",\n \"version\": \"8.0.5\",\n \"description\": \"Migration program from swagger to NestJS\",\n \"typings\": \"lib/index.d.ts\",\n \"main\": \"lib/index.js\",\n \"module\": \"lib/index.mjs\",\n \"bin\": {\n \"@nestia/migrate\": \"lib/executable/migrate.js\"\n },\n \"scripts\": {\n \"build\": \"rimraf lib && tsc && rollup -c\",\n \"bundle\": \"node src/executable/bundle.js\",\n \"dev\": \"rimraf lib && tsc --watch\",\n \"package:next\": \"npm publish --access public --tag next\",\n \"prepare\": \"ts-patch install && typia patch && npm run bundle\",\n \"test\": \"node lib/test\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"migration\",\n \"swagger\",\n \"openapi generator\",\n \"NestJS\",\n \"nestia\",\n \"SDK\",\n \"RPC\",\n \"Mockup Simulator\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"devDependencies\": {\n \"@nestia/benchmark\": \"^8.0.5\",\n \"@nestia/core\": \"^8.0.5\",\n \"@nestia/e2e\": \"^8.0.5\",\n \"@nestia/fetcher\": \"^8.0.5\",\n \"@nestia/sdk\": \"^8.0.5\",\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@nestjs/platform-express\": \"^11.0.13\",\n \"@nestjs/platform-fastify\": \"^11.0.13\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^12.1.1\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/cli-progress\": \"^3.11.5\",\n \"@types/express\": \"^4.17.21\",\n \"@types/inquirer\": \"^9.0.7\",\n \"@types/multer\": \"^1.4.12\",\n \"@types/node\": \"^20.3.3\",\n \"@types/swagger-ui-express\": \"^4.1.6\",\n \"chalk\": \"4.1.2\",\n \"cli-progress\": \"^3.12.0\",\n \"dotenv\": \"^16.3.1\",\n \"dotenv-expand\": \"^10.0.0\",\n \"express\": \"^4.19.2\",\n \"multer\": \"^2.0.2\",\n \"rimraf\": \"^6.0.1\",\n \"rollup\": \"^4.24.3\",\n \"serialize-error\": \"^4.1.0\",\n \"source-map-support\": \"^0.5.21\",\n \"swagger-ui-express\": \"^5.0.0\",\n \"tgrid\": \"^1.1.0\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript-transform-paths\": \"^3.5.2\"\n },\n \"dependencies\": {\n \"@samchon/openapi\": \"^4.5.0\",\n \"commander\": \"10.0.0\",\n \"inquirer\": \"8.2.5\",\n \"prettier\": \"^3.3.3\",\n \"prettier-plugin-jsdoc\": \"^1.3.2\",\n \"tstl\": \"^3.0.0\",\n \"typescript\": \"~5.9.2\",\n \"typia\": \"^9.6.1\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"!lib/test\",\n \"!src/test\",\n \"package.json\",\n \"README.md\",\n \"LICENSE\"\n ]\n}",
11810
+ "node_modules/@nestia/migrate/package.json": "{\n \"name\": \"@nestia/migrate\",\n \"version\": \"8.0.7\",\n \"description\": \"Migration program from swagger to NestJS\",\n \"typings\": \"lib/index.d.ts\",\n \"main\": \"lib/index.js\",\n \"module\": \"lib/index.mjs\",\n \"bin\": {\n \"@nestia/migrate\": \"lib/executable/migrate.js\"\n },\n \"scripts\": {\n \"build\": \"rimraf lib && tsc && rollup -c\",\n \"bundle\": \"node src/executable/bundle.js\",\n \"dev\": \"rimraf lib && tsc --watch\",\n \"package:next\": \"npm publish --access public --tag next\",\n \"prepare\": \"ts-patch install && typia patch && npm run bundle\",\n \"test\": \"node lib/test\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"migration\",\n \"swagger\",\n \"openapi generator\",\n \"NestJS\",\n \"nestia\",\n \"SDK\",\n \"RPC\",\n \"Mockup Simulator\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"devDependencies\": {\n \"@nestia/benchmark\": \"^8.0.7\",\n \"@nestia/core\": \"^8.0.7\",\n \"@nestia/e2e\": \"^8.0.7\",\n \"@nestia/fetcher\": \"^8.0.7\",\n \"@nestia/sdk\": \"^8.0.7\",\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@nestjs/platform-express\": \"^11.0.13\",\n \"@nestjs/platform-fastify\": \"^11.0.13\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^12.1.1\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/cli-progress\": \"^3.11.5\",\n \"@types/express\": \"^4.17.21\",\n \"@types/inquirer\": \"^9.0.7\",\n \"@types/multer\": \"^1.4.12\",\n \"@types/node\": \"^20.3.3\",\n \"@types/swagger-ui-express\": \"^4.1.6\",\n \"chalk\": \"4.1.2\",\n \"cli-progress\": \"^3.12.0\",\n \"dotenv\": \"^16.3.1\",\n \"dotenv-expand\": \"^10.0.0\",\n \"express\": \"^4.19.2\",\n \"multer\": \"^2.0.2\",\n \"rimraf\": \"^6.0.1\",\n \"rollup\": \"^4.24.3\",\n \"serialize-error\": \"^4.1.0\",\n \"source-map-support\": \"^0.5.21\",\n \"swagger-ui-express\": \"^5.0.0\",\n \"tgrid\": \"^1.1.0\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript-transform-paths\": \"^3.5.2\"\n },\n \"dependencies\": {\n \"@samchon/openapi\": \"^4.5.0\",\n \"commander\": \"10.0.0\",\n \"inquirer\": \"8.2.5\",\n \"prettier\": \"^3.3.3\",\n \"prettier-plugin-jsdoc\": \"^1.3.2\",\n \"tstl\": \"^3.0.0\",\n \"typescript\": \"~5.9.2\",\n \"typia\": \"^9.6.1\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"!lib/test\",\n \"!src/test\",\n \"package.json\",\n \"README.md\",\n \"LICENSE\"\n ]\n}",
11811
11811
  "node_modules/@nestia/sdk/lib/INestiaConfig.d.ts": "import type { INestApplication } from \"@nestjs/common\";\nimport type { OpenApi } from \"@samchon/openapi\";\n/**\n * Definition for the `nestia.config.ts` file.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport interface INestiaConfig {\n /**\n * Accessor of controller classes.\n *\n * You can specify target controller classes within two ways.\n *\n * - Asynchronous function returning `INestApplication` instance\n * - Specify the path or directory of controller class files\n */\n input: (() => Promise<INestApplication>) | INestiaConfig.IInput | string[] | string;\n /**\n * Building `swagger.json` is also possible.\n *\n * If not specified, you can't build the `swagger.json`.\n */\n swagger?: INestiaConfig.ISwaggerConfig;\n /**\n * Response directory that SDK would be placed in.\n *\n * If not configured, you can't build the SDK library.\n */\n output?: string;\n /**\n * Target directory that SDK distribution files would be placed in.\n *\n * If you configure this property and runs `npx nestia sdk` command,\n * distribution environments for the SDK library would be generated.\n *\n * After the SDK library generation, move to the `distribute` directory, and\n * runs `npm publish` command, then you can share SDK library with other\n * client (frontend) developers.\n *\n * Recommend to use `\"packages/api\"` value.\n */\n distribute?: string;\n /** @default false */\n keyword?: boolean;\n /**\n * Allow simulation mode.\n *\n * If you configure this property to be `true`, the SDK library would be\n * contain simulation mode. In the simulation mode, the SDK library would not\n * communicate with the real backend server, but just returns random mock-up\n * data with requestion data validation.\n *\n * For reference, random mock-up data would be generated by\n * `typia.random<T>()` function.\n *\n * @default false\n */\n simulate?: boolean;\n /**\n * Target directory that e2e test functions would be placed in.\n *\n * If you configure this property and runs `npx nestia e2e` command,\n * `@nestia/sdk` will analyze your NestJS backend server code, and generates\n * e2e test functions for every API endpoints.\n *\n * If not configured, you can't run `npx nestia e2e` command.\n */\n e2e?: string;\n /**\n * Whether to use propagation mode or not.\n *\n * If being configured, interaction functions of the SDK library would perform\n * the propagation mode. The propagation mode means that never throwing\n * exception even when status code is not 200 (or 201), but just returning the\n * {@link IPropagation} typed instance, which can specify its body type through\n * discriminated union determined by status code.\n *\n * @default false\n */\n propagate?: boolean;\n /**\n * Whether to clone DTO structures or not.\n *\n * If being configured, all of DTOs used in the backend server would be cloned\n * into the `structures` directory, and the SDK library would be refer to the\n * cloned DTOs instead of the original.\n *\n * @default false\n */\n clone?: boolean;\n /**\n * Whether to wrap DTO by primitive type.\n *\n * If you don't configure this property as `false`, all of DTOs in the SDK\n * library would be automatically wrapped by {@link Primitive} type.\n *\n * For refenrece, if a DTO type be capsuled by the {@link Primitive} type, all\n * of methods in the DTO type would be automatically erased. Also, if the DTO\n * has a `toJSON()` method, the DTO type would be automatically converted to\n * return type of the `toJSON()` method.\n *\n * @default true\n */\n primitive?: boolean;\n /**\n * Whether to assert parameter types or not.\n *\n * If you configure this property to be `true`, all of the function parameters\n * of SDK library would be checked through [`typia.assert<T>()`\n * function](https://typia.io/docs/validators/assert/).\n *\n * This option would make your SDK library compilation time a little bit\n * slower, but would enahcne the type safety even in the runtime level.\n *\n * @default false\n */\n assert?: boolean;\n /**\n * Whether to optimize JSON string conversion 10x faster or not.\n *\n * If you configure this property to be `true`, the SDK library would utilize\n * the [`typia.assertStringify<T>()\n * function`](https://github.com/samchon/typia#enhanced-json) to boost up JSON\n * serialization speed and ensure type safety.\n *\n * This option would make your SDK library compilation time a little bit\n * slower, but would enhance JSON serialization speed 10x faster. Also, it can\n * ensure type safety even in the runtime level.\n *\n * @default false\n */\n json?: boolean;\n}\nexport declare namespace INestiaConfig {\n /**\n * List of files or directories to include or exclude to specifying the NestJS\n * controllers.\n */\n interface IInput {\n /** List of files or directories containing the NestJS controller classes. */\n include: string[];\n /** List of files or directories to be excluded. */\n exclude?: string[];\n }\n /** Building `swagger.json` is also possible. */\n interface ISwaggerConfig {\n /**\n * Response path of the `swagger.json`.\n *\n * If you've configured only directory, the file name would be the\n * `swagger.json`. Otherwise you've configured the full path with file name\n * and extension, the `swagger.json` file would be renamed to it.\n */\n output: string;\n /**\n * OpenAPI version.\n *\n * If you configure this property to be `2.0` or `3.0`, the newly generated\n * `swagger.json` file would follow the specified OpenAPI version. The newly\n * generated `swagger.json` file would be downgraded from the OpenAPI v3.1\n * specification by {@link OpenApi.downgrade} method.\n *\n * @default 3.1\n */\n openapi?: \"2.0\" | \"3.0\" | \"3.1\";\n /**\n * Whether to beautify JSON content or not.\n *\n * If you configure this property to be `true`, the `swagger.json` file\n * would be beautified with indentation (2 spaces) and line breaks. If you\n * configure numeric value instead, the indentation would be specified by\n * the number.\n *\n * @default false\n */\n beautify?: boolean | number;\n /**\n * Whether to include additional information or not.\n *\n * If configured to be `true`, those properties would be added into each API\n * endpoinnt.\n *\n * - `x-nestia-method`\n * - `x-nestia-namespace` ` `x-nestia-jsDocTags`\n *\n * @default false\n */\n additional?: boolean;\n /**\n * API information.\n *\n * If omitted, `package.json` content would be used instead.\n */\n info?: Partial<OpenApi.IDocument.IInfo>;\n /** List of server addresses. */\n servers?: OpenApi.IServer[];\n /**\n * Security schemes.\n *\n * When generating `swagger.json` file through `nestia`, if your controllers\n * or theirs methods have a security key which is not enrolled in here\n * property, it would be an error.\n */\n security?: Record<string, OpenApi.ISecurityScheme>;\n /**\n * List of tag names with description.\n *\n * It is possible to omit this property or skip some tag name even if the\n * tag name is used in the API routes. In that case, the tag name would be\n * used without description.\n *\n * Of course, if you've written a comment like `@tag {name} {description}`,\n * you can entirely replace this property specification.\n */\n tags?: OpenApi.IDocument.ITag[];\n /**\n * Decompose query DTO.\n *\n * If you configure this property to be `true`, the query DTO would be\n * decomposed into individual query parameters per each property. Otherwise\n * you set it to be `false`, the query DTO would be one object type which\n * contains all of query parameters.\n *\n * @default true\n */\n decompose?: boolean;\n /**\n * Operation ID generator.\n *\n * @param props Properties of the API endpoint.\n * @returns Operation ID.\n */\n operationId?(props: {\n class: string;\n function: string;\n method: \"HEAD\" | \"GET\" | \"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\";\n path: string;\n }): string;\n }\n}\n",
11812
11812
  "node_modules/@nestia/sdk/lib/NestiaSdkApplication.d.ts": "import { INestiaConfig } from \"./INestiaConfig\";\nexport declare class NestiaSdkApplication {\n private readonly config;\n constructor(config: INestiaConfig);\n all(): Promise<void>;\n e2e(): Promise<void>;\n sdk(): Promise<void>;\n swagger(): Promise<void>;\n private generate;\n}\n",
11813
11813
  "node_modules/@nestia/sdk/lib/NestiaSwaggerComposer.d.ts": "import { INestApplication } from \"@nestjs/common\";\nimport { OpenApi, OpenApiV3, SwaggerV2 } from \"@samchon/openapi\";\nimport { INestiaConfig } from \"./INestiaConfig\";\nexport declare namespace NestiaSwaggerComposer {\n const document: (app: INestApplication, config: Omit<INestiaConfig.ISwaggerConfig, \"output\">) => Promise<OpenApi.IDocument | OpenApiV3.IDocument | SwaggerV2.IDocument>;\n}\n",
@@ -11906,7 +11906,7 @@
11906
11906
  "node_modules/@nestia/sdk/lib/validators/HttpQueryValidator.d.ts": "import { MetadataFactory } from \"typia/lib/factories/MetadataFactory\";\nimport { Metadata } from \"typia/lib/schemas/metadata/Metadata\";\nexport declare namespace HttpQueryValidator {\n const validate: (meta: Metadata, explore: MetadataFactory.IExplore) => string[];\n}\n",
11907
11907
  "node_modules/path-to-regexp/dist/index.d.ts": "/**\n * Encode a string into another string.\n */\nexport type Encode = (value: string) => string;\n/**\n * Decode a string into another string.\n */\nexport type Decode = (value: string) => string;\nexport interface ParseOptions {\n /**\n * A function for encoding input strings.\n */\n encodePath?: Encode;\n}\nexport interface PathToRegexpOptions {\n /**\n * Matches the path completely without trailing characters. (default: `true`)\n */\n end?: boolean;\n /**\n * Allows optional trailing delimiter to match. (default: `true`)\n */\n trailing?: boolean;\n /**\n * Match will be case sensitive. (default: `false`)\n */\n sensitive?: boolean;\n /**\n * The default delimiter for segments. (default: `'/'`)\n */\n delimiter?: string;\n}\nexport interface MatchOptions extends PathToRegexpOptions {\n /**\n * Function for decoding strings for params, or `false` to disable entirely. (default: `decodeURIComponent`)\n */\n decode?: Decode | false;\n}\nexport interface CompileOptions {\n /**\n * Function for encoding input strings for output into the path, or `false` to disable entirely. (default: `encodeURIComponent`)\n */\n encode?: Encode | false;\n /**\n * The default delimiter for segments. (default: `'/'`)\n */\n delimiter?: string;\n}\n/**\n * Plain text.\n */\nexport interface Text {\n type: \"text\";\n value: string;\n}\n/**\n * A parameter designed to match arbitrary text within a segment.\n */\nexport interface Parameter {\n type: \"param\";\n name: string;\n}\n/**\n * A wildcard parameter designed to match multiple segments.\n */\nexport interface Wildcard {\n type: \"wildcard\";\n name: string;\n}\n/**\n * A set of possible tokens to expand when matching.\n */\nexport interface Group {\n type: \"group\";\n tokens: Token[];\n}\n/**\n * A token that corresponds with a regexp capture.\n */\nexport type Key = Parameter | Wildcard;\n/**\n * A sequence of `path-to-regexp` keys that match capturing groups.\n */\nexport type Keys = Array<Key>;\n/**\n * A sequence of path match characters.\n */\nexport type Token = Text | Parameter | Wildcard | Group;\n/**\n * Tokenized path instance.\n */\nexport declare class TokenData {\n readonly tokens: Token[];\n constructor(tokens: Token[]);\n}\n/**\n * Parse a string for the raw tokens.\n */\nexport declare function parse(str: string, options?: ParseOptions): TokenData;\n/**\n * Compile a string to a template function for the path.\n */\nexport declare function compile<P extends ParamData = ParamData>(path: Path, options?: CompileOptions & ParseOptions): (data?: P) => string;\nexport type ParamData = Partial<Record<string, string | string[]>>;\nexport type PathFunction<P extends ParamData> = (data?: P) => string;\n/**\n * A match result contains data about the path match.\n */\nexport interface MatchResult<P extends ParamData> {\n path: string;\n params: P;\n}\n/**\n * A match is either `false` (no match) or a match result.\n */\nexport type Match<P extends ParamData> = false | MatchResult<P>;\n/**\n * The match function takes a string and returns whether it matched the path.\n */\nexport type MatchFunction<P extends ParamData> = (path: string) => Match<P>;\n/**\n * Supported path types.\n */\nexport type Path = string | TokenData;\n/**\n * Transform a path into a match function.\n */\nexport declare function match<P extends ParamData>(path: Path | Path[], options?: MatchOptions & ParseOptions): MatchFunction<P>;\nexport declare function pathToRegexp(path: Path | Path[], options?: PathToRegexpOptions & ParseOptions): {\n regexp: RegExp;\n keys: Keys;\n};\n/**\n * Stringify token data into a path string.\n */\nexport declare function stringify(data: TokenData): string;\n",
11908
11908
  "node_modules/path-to-regexp/package.json": "{\n \"name\": \"path-to-regexp\",\n \"version\": \"8.2.0\",\n \"description\": \"Express style path to RegExp utility\",\n \"keywords\": [\n \"express\",\n \"regexp\",\n \"route\",\n \"routing\"\n ],\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/pillarjs/path-to-regexp.git\"\n },\n \"license\": \"MIT\",\n \"exports\": \"./dist/index.js\",\n \"main\": \"dist/index.js\",\n \"typings\": \"dist/index.d.ts\",\n \"files\": [\n \"dist/\"\n ],\n \"scripts\": {\n \"bench\": \"vitest bench\",\n \"build\": \"ts-scripts build\",\n \"format\": \"ts-scripts format\",\n \"lint\": \"ts-scripts lint\",\n \"prepare\": \"ts-scripts install && npm run build\",\n \"size\": \"size-limit\",\n \"specs\": \"ts-scripts specs\",\n \"test\": \"ts-scripts test && npm run size\"\n },\n \"devDependencies\": {\n \"@borderless/ts-scripts\": \"^0.15.0\",\n \"@size-limit/preset-small-lib\": \"^11.1.2\",\n \"@types/node\": \"^22.7.2\",\n \"@types/semver\": \"^7.3.1\",\n \"@vitest/coverage-v8\": \"^2.1.1\",\n \"recheck\": \"^4.4.5\",\n \"size-limit\": \"^11.1.2\",\n \"typescript\": \"^5.5.3\"\n },\n \"engines\": {\n \"node\": \">=16\"\n },\n \"publishConfig\": {\n \"access\": \"public\"\n },\n \"size-limit\": [\n {\n \"path\": \"dist/index.js\",\n \"limit\": \"2.2 kB\"\n }\n ],\n \"ts-scripts\": {\n \"dist\": [\n \"dist\"\n ],\n \"project\": [\n \"tsconfig.build.json\"\n ]\n }\n}\n",
11909
- "node_modules/@nestia/sdk/package.json": "{\n \"name\": \"@nestia/sdk\",\n \"version\": \"8.0.5\",\n \"description\": \"Nestia SDK and Swagger generator\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"bin\": {\n \"@nestia/sdk\": \"lib/executable/sdk.js\"\n },\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint ./**/*.ts\",\n \"prepare\": \"ts-patch install && typia patch\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestia\",\n \"sdk\",\n \"swagger\",\n \"generator\",\n \"nestjs\",\n \"typia\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@nestia/core\": \"^8.0.5\",\n \"@nestia/fetcher\": \"^8.0.5\",\n \"@samchon/openapi\": \"^4.5.0\",\n \"cli\": \"^1.0.1\",\n \"get-function-location\": \"^2.0.0\",\n \"glob\": \"^11.0.3\",\n \"path-to-regexp\": \"^6.2.1\",\n \"prettier\": \"^3.2.5\",\n \"ts-node\": \">=10.6.0\",\n \"tsconfck\": \"^2.1.2\",\n \"tsconfig-paths\": \"^4.1.1\",\n \"tstl\": \"^3.0.0\",\n \"typia\": \"^9.6.1\"\n },\n \"peerDependencies\": {\n \"@nestia/core\": \">=8.0.5\"\n },\n \"devDependencies\": {\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/cli\": \"^0.11.21\",\n \"@types/express\": \"^4.17.15\",\n \"@types/node\": \"^18.11.15\",\n \"@types/ts-expose-internals\": \"npm:ts-expose-internals@5.4.5\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"eslint\": \"^8.29.0\",\n \"eslint-plugin-deprecation\": \"^1.4.1\",\n \"rimraf\": \"^6.0.1\",\n \"tgrid\": \"^1.1.0\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.4\"\n },\n \"files\": [\n \"assets\",\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
11909
+ "node_modules/@nestia/sdk/package.json": "{\n \"name\": \"@nestia/sdk\",\n \"version\": \"8.0.7\",\n \"description\": \"Nestia SDK and Swagger generator\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"bin\": {\n \"@nestia/sdk\": \"lib/executable/sdk.js\"\n },\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint ./**/*.ts\",\n \"prepare\": \"ts-patch install && typia patch\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestia\",\n \"sdk\",\n \"swagger\",\n \"generator\",\n \"nestjs\",\n \"typia\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@nestia/core\": \"^8.0.7\",\n \"@nestia/fetcher\": \"^8.0.7\",\n \"@samchon/openapi\": \"^4.5.0\",\n \"cli\": \"^1.0.1\",\n \"get-function-location\": \"^2.0.0\",\n \"glob\": \"^11.0.3\",\n \"path-to-regexp\": \"^6.2.1\",\n \"prettier\": \"^3.2.5\",\n \"ts-node\": \">=10.6.0\",\n \"tsconfck\": \"^2.1.2\",\n \"tsconfig-paths\": \"^4.1.1\",\n \"tstl\": \"^3.0.0\",\n \"typia\": \"^9.6.1\"\n },\n \"peerDependencies\": {\n \"@nestia/core\": \">=8.0.7\"\n },\n \"devDependencies\": {\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/cli\": \"^0.11.21\",\n \"@types/express\": \"^4.17.15\",\n \"@types/node\": \"^18.11.15\",\n \"@types/ts-expose-internals\": \"npm:ts-expose-internals@5.4.5\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"eslint\": \"^8.29.0\",\n \"eslint-plugin-deprecation\": \"^1.4.1\",\n \"rimraf\": \"^6.0.1\",\n \"tgrid\": \"^1.1.0\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.4\"\n },\n \"files\": [\n \"assets\",\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
11910
11910
  "node_modules/@nestia/sdk/src/typings/get-function-location.d.ts": "declare module \"get-function-location\" {\n export default function (func: any): Promise<{\n source: string;\n line: number;\n column: number;\n }>;\n}\n",
11911
11911
  "node_modules/@nestia/sdk/node_modules/glob/dist/commonjs/glob.d.ts": "import { Minimatch } from 'minimatch';\nimport { Minipass } from 'minipass';\nimport { FSOption, Path, PathScurry } from 'path-scurry';\nimport { IgnoreLike } from './ignore.js';\nimport { Pattern } from './pattern.js';\nexport type MatchSet = Minimatch['set'];\nexport type GlobParts = Exclude<Minimatch['globParts'], undefined>;\n/**\n * A `GlobOptions` object may be provided to any of the exported methods, and\n * must be provided to the `Glob` constructor.\n *\n * All options are optional, boolean, and false by default, unless otherwise\n * noted.\n *\n * All resolved options are added to the Glob object as properties.\n *\n * If you are running many `glob` operations, you can pass a Glob object as the\n * `options` argument to a subsequent operation to share the previously loaded\n * cache.\n */\nexport interface GlobOptions {\n /**\n * Set to `true` to always receive absolute paths for\n * matched files. Set to `false` to always return relative paths.\n *\n * When this option is not set, absolute paths are returned for patterns\n * that are absolute, and otherwise paths are returned that are relative\n * to the `cwd` setting.\n *\n * This does _not_ make an extra system call to get\n * the realpath, it only does string path resolution.\n *\n * Conflicts with {@link withFileTypes}\n */\n absolute?: boolean;\n /**\n * Set to false to enable {@link windowsPathsNoEscape}\n *\n * @deprecated\n */\n allowWindowsEscape?: boolean;\n /**\n * The current working directory in which to search. Defaults to\n * `process.cwd()`.\n *\n * May be eiher a string path or a `file://` URL object or string.\n */\n cwd?: string | URL;\n /**\n * Include `.dot` files in normal matches and `globstar`\n * matches. Note that an explicit dot in a portion of the pattern\n * will always match dot files.\n */\n dot?: boolean;\n /**\n * Prepend all relative path strings with `./` (or `.\\` on Windows).\n *\n * Without this option, returned relative paths are \"bare\", so instead of\n * returning `'./foo/bar'`, they are returned as `'foo/bar'`.\n *\n * Relative patterns starting with `'../'` are not prepended with `./`, even\n * if this option is set.\n */\n dotRelative?: boolean;\n /**\n * Follow symlinked directories when expanding `**`\n * patterns. This can result in a lot of duplicate references in\n * the presence of cyclic links, and make performance quite bad.\n *\n * By default, a `**` in a pattern will follow 1 symbolic link if\n * it is not the first item in the pattern, or none if it is the\n * first item in the pattern, following the same behavior as Bash.\n */\n follow?: boolean;\n /**\n * string or string[], or an object with `ignored` and `childrenIgnored`\n * methods.\n *\n * If a string or string[] is provided, then this is treated as a glob\n * pattern or array of glob patterns to exclude from matches. To ignore all\n * children within a directory, as well as the entry itself, append `'/**'`\n * to the ignore pattern.\n *\n * **Note** `ignore` patterns are _always_ in `dot:true` mode, regardless of\n * any other settings.\n *\n * If an object is provided that has `ignored(path)` and/or\n * `childrenIgnored(path)` methods, then these methods will be called to\n * determine whether any Path is a match or if its children should be\n * traversed, respectively.\n */\n ignore?: string | string[] | IgnoreLike;\n /**\n * Treat brace expansion like `{a,b}` as a \"magic\" pattern. Has no\n * effect if {@link nobrace} is set.\n *\n * Only has effect on the {@link hasMagic} function.\n */\n magicalBraces?: boolean;\n /**\n * Add a `/` character to directory matches. Note that this requires\n * additional stat calls in some cases.\n */\n mark?: boolean;\n /**\n * Perform a basename-only match if the pattern does not contain any slash\n * characters. That is, `*.js` would be treated as equivalent to\n * `**\\/*.js`, matching all js files in all directories.\n */\n matchBase?: boolean;\n /**\n * Limit the directory traversal to a given depth below the cwd.\n * Note that this does NOT prevent traversal to sibling folders,\n * root patterns, and so on. It only limits the maximum folder depth\n * that the walk will descend, relative to the cwd.\n */\n maxDepth?: number;\n /**\n * Do not expand `{a,b}` and `{1..3}` brace sets.\n */\n nobrace?: boolean;\n /**\n * Perform a case-insensitive match. This defaults to `true` on macOS and\n * Windows systems, and `false` on all others.\n *\n * **Note** `nocase` should only be explicitly set when it is\n * known that the filesystem's case sensitivity differs from the\n * platform default. If set `true` on case-sensitive file\n * systems, or `false` on case-insensitive file systems, then the\n * walk may return more or less results than expected.\n */\n nocase?: boolean;\n /**\n * Do not match directories, only files. (Note: to match\n * _only_ directories, put a `/` at the end of the pattern.)\n */\n nodir?: boolean;\n /**\n * Do not match \"extglob\" patterns such as `+(a|b)`.\n */\n noext?: boolean;\n /**\n * Do not match `**` against multiple filenames. (Ie, treat it as a normal\n * `*` instead.)\n *\n * Conflicts with {@link matchBase}\n */\n noglobstar?: boolean;\n /**\n * Defaults to value of `process.platform` if available, or `'linux'` if\n * not. Setting `platform:'win32'` on non-Windows systems may cause strange\n * behavior.\n */\n platform?: NodeJS.Platform;\n /**\n * Set to true to call `fs.realpath` on all of the\n * results. In the case of an entry that cannot be resolved, the\n * entry is omitted. This incurs a slight performance penalty, of\n * course, because of the added system calls.\n */\n realpath?: boolean;\n /**\n *\n * A string path resolved against the `cwd` option, which\n * is used as the starting point for absolute patterns that start\n * with `/`, (but not drive letters or UNC paths on Windows).\n *\n * Note that this _doesn't_ necessarily limit the walk to the\n * `root` directory, and doesn't affect the cwd starting point for\n * non-absolute patterns. A pattern containing `..` will still be\n * able to traverse out of the root directory, if it is not an\n * actual root directory on the filesystem, and any non-absolute\n * patterns will be matched in the `cwd`. For example, the\n * pattern `/../*` with `{root:'/some/path'}` will return all\n * files in `/some`, not all files in `/some/path`. The pattern\n * `*` with `{root:'/some/path'}` will return all the entries in\n * the cwd, not the entries in `/some/path`.\n *\n * To start absolute and non-absolute patterns in the same\n * path, you can use `{root:''}`. However, be aware that on\n * Windows systems, a pattern like `x:/*` or `//host/share/*` will\n * _always_ start in the `x:/` or `//host/share` directory,\n * regardless of the `root` setting.\n */\n root?: string;\n /**\n * A [PathScurry](http://npm.im/path-scurry) object used\n * to traverse the file system. If the `nocase` option is set\n * explicitly, then any provided `scurry` object must match this\n * setting.\n */\n scurry?: PathScurry;\n /**\n * Call `lstat()` on all entries, whether required or not to determine\n * if it's a valid match. When used with {@link withFileTypes}, this means\n * that matches will include data such as modified time, permissions, and\n * so on. Note that this will incur a performance cost due to the added\n * system calls.\n */\n stat?: boolean;\n /**\n * An AbortSignal which will cancel the Glob walk when\n * triggered.\n */\n signal?: AbortSignal;\n /**\n * Use `\\\\` as a path separator _only_, and\n * _never_ as an escape character. If set, all `\\\\` characters are\n * replaced with `/` in the pattern.\n *\n * Note that this makes it **impossible** to match against paths\n * containing literal glob pattern characters, but allows matching\n * with patterns constructed using `path.join()` and\n * `path.resolve()` on Windows platforms, mimicking the (buggy!)\n * behavior of Glob v7 and before on Windows. Please use with\n * caution, and be mindful of [the caveat below about Windows\n * paths](#windows). (For legacy reasons, this is also set if\n * `allowWindowsEscape` is set to the exact value `false`.)\n */\n windowsPathsNoEscape?: boolean;\n /**\n * Return [PathScurry](http://npm.im/path-scurry)\n * `Path` objects instead of strings. These are similar to a\n * NodeJS `Dirent` object, but with additional methods and\n * properties.\n *\n * Conflicts with {@link absolute}\n */\n withFileTypes?: boolean;\n /**\n * An fs implementation to override some or all of the defaults. See\n * http://npm.im/path-scurry for details about what can be overridden.\n */\n fs?: FSOption;\n /**\n * Just passed along to Minimatch. Note that this makes all pattern\n * matching operations slower and *extremely* noisy.\n */\n debug?: boolean;\n /**\n * Return `/` delimited paths, even on Windows.\n *\n * On posix systems, this has no effect. But, on Windows, it means that\n * paths will be `/` delimited, and absolute paths will be their full\n * resolved UNC forms, eg instead of `'C:\\\\foo\\\\bar'`, it would return\n * `'//?/C:/foo/bar'`\n */\n posix?: boolean;\n /**\n * Do not match any children of any matches. For example, the pattern\n * `**\\/foo` would match `a/foo`, but not `a/foo/b/foo` in this mode.\n *\n * This is especially useful for cases like \"find all `node_modules`\n * folders, but not the ones in `node_modules`\".\n *\n * In order to support this, the `Ignore` implementation must support an\n * `add(pattern: string)` method. If using the default `Ignore` class, then\n * this is fine, but if this is set to `false`, and a custom `Ignore` is\n * provided that does not have an `add()` method, then it will throw an\n * error.\n *\n * **Caveat** It *only* ignores matches that would be a descendant of a\n * previous match, and only if that descendant is matched *after* the\n * ancestor is encountered. Since the file system walk happens in\n * indeterminate order, it's possible that a match will already be added\n * before its ancestor, if multiple or braced patterns are used.\n *\n * For example:\n *\n * ```ts\n * const results = await glob([\n * // likely to match first, since it's just a stat\n * 'a/b/c/d/e/f',\n *\n * // this pattern is more complicated! It must to various readdir()\n * // calls and test the results against a regular expression, and that\n * // is certainly going to take a little bit longer.\n * //\n * // So, later on, it encounters a match at 'a/b/c/d/e', but it's too\n * // late to ignore a/b/c/d/e/f, because it's already been emitted.\n * 'a/[bdf]/?/[a-z]/*',\n * ], { includeChildMatches: false })\n * ```\n *\n * It's best to only set this to `false` if you can be reasonably sure that\n * no components of the pattern will potentially match one another's file\n * system descendants, or if the occasional included child entry will not\n * cause problems.\n *\n * @default true\n */\n includeChildMatches?: boolean;\n}\nexport type GlobOptionsWithFileTypesTrue = GlobOptions & {\n withFileTypes: true;\n absolute?: undefined;\n mark?: undefined;\n posix?: undefined;\n};\nexport type GlobOptionsWithFileTypesFalse = GlobOptions & {\n withFileTypes?: false;\n};\nexport type GlobOptionsWithFileTypesUnset = GlobOptions & {\n withFileTypes?: undefined;\n};\nexport type Result<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? Path : Opts extends GlobOptionsWithFileTypesFalse ? string : Opts extends GlobOptionsWithFileTypesUnset ? string : string | Path;\nexport type Results<Opts> = Result<Opts>[];\nexport type FileTypes<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? true : Opts extends GlobOptionsWithFileTypesFalse ? false : Opts extends GlobOptionsWithFileTypesUnset ? false : boolean;\n/**\n * An object that can perform glob pattern traversals.\n */\nexport declare class Glob<Opts extends GlobOptions> implements GlobOptions {\n absolute?: boolean;\n cwd: string;\n root?: string;\n dot: boolean;\n dotRelative: boolean;\n follow: boolean;\n ignore?: string | string[] | IgnoreLike;\n magicalBraces: boolean;\n mark?: boolean;\n matchBase: boolean;\n maxDepth: number;\n nobrace: boolean;\n nocase: boolean;\n nodir: boolean;\n noext: boolean;\n noglobstar: boolean;\n pattern: string[];\n platform: NodeJS.Platform;\n realpath: boolean;\n scurry: PathScurry;\n stat: boolean;\n signal?: AbortSignal;\n windowsPathsNoEscape: boolean;\n withFileTypes: FileTypes<Opts>;\n includeChildMatches: boolean;\n /**\n * The options provided to the constructor.\n */\n opts: Opts;\n /**\n * An array of parsed immutable {@link Pattern} objects.\n */\n patterns: Pattern[];\n /**\n * All options are stored as properties on the `Glob` object.\n *\n * See {@link GlobOptions} for full options descriptions.\n *\n * Note that a previous `Glob` object can be passed as the\n * `GlobOptions` to another `Glob` instantiation to re-use settings\n * and caches with a new pattern.\n *\n * Traversal functions can be called multiple times to run the walk\n * again.\n */\n constructor(pattern: string | string[], opts: Opts);\n /**\n * Returns a Promise that resolves to the results array.\n */\n walk(): Promise<Results<Opts>>;\n /**\n * synchronous {@link Glob.walk}\n */\n walkSync(): Results<Opts>;\n /**\n * Stream results asynchronously.\n */\n stream(): Minipass<Result<Opts>, Result<Opts>>;\n /**\n * Stream results synchronously.\n */\n streamSync(): Minipass<Result<Opts>, Result<Opts>>;\n /**\n * Default sync iteration function. Returns a Generator that\n * iterates over the results.\n */\n iterateSync(): Generator<Result<Opts>, void, void>;\n [Symbol.iterator](): Generator<Result<Opts>, void, void>;\n /**\n * Default async iteration function. Returns an AsyncGenerator that\n * iterates over the results.\n */\n iterate(): AsyncGenerator<Result<Opts>, void, void>;\n [Symbol.asyncIterator](): AsyncGenerator<Result<Opts>, void, void>;\n}\n//# sourceMappingURL=glob.d.ts.map",
11912
11912
  "node_modules/@nestia/sdk/node_modules/glob/dist/commonjs/has-magic.d.ts": "import { GlobOptions } from './glob.js';\n/**\n * Return true if the patterns provided contain any magic glob characters,\n * given the options provided.\n *\n * Brace expansion is not considered \"magic\" unless the `magicalBraces` option\n * is set, as brace expansion just turns one string into an array of strings.\n * So a pattern like `'x{a,b}y'` would return `false`, because `'xay'` and\n * `'xby'` both do not contain any magic glob characters, and it's treated the\n * same as if you had called it on `['xay', 'xby']`. When `magicalBraces:true`\n * is in the options, brace expansion _is_ treated as a pattern having magic.\n */\nexport declare const hasMagic: (pattern: string | string[], options?: GlobOptions) => boolean;\n//# sourceMappingURL=has-magic.d.ts.map",
package/src/raw/test.json CHANGED
@@ -8,7 +8,7 @@
8
8
  "node_modules/@nestia/e2e/lib/index.d.ts": "import * as e2e from \"./module\";\nexport default e2e;\nexport * from \"./module\";\n",
9
9
  "node_modules/@nestia/e2e/lib/internal/json_equal_to.d.ts": "export declare const json_equal_to: (exception: (key: string) => boolean) => <T>(x: T) => (y: T | null | undefined) => string[];\n",
10
10
  "node_modules/@nestia/e2e/lib/module.d.ts": "export * from \"./ArrayUtil\";\nexport * from \"./MapUtil\";\nexport * from \"./RandomGenerator\";\nexport * from \"./DynamicExecutor\";\nexport * from \"./GaffComparator\";\nexport * from \"./TestValidator\";\n",
11
- "node_modules/@nestia/e2e/package.json": "{\n \"name\": \"@nestia/e2e\",\n \"version\": \"8.0.5\",\n \"description\": \"E2E test utilify functions\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"npm run build:main && npm run build:test\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"prepare\": \"ts-patch install && typia patch\",\n \"test\": \"node bin/test\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"e2e\",\n \"nestia\",\n \"nestjs\",\n \"test\",\n \"tdd\",\n \"utility\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"devDependencies\": {\n \"@trivago/prettier-plugin-sort-imports\": \"^4.0.0\",\n \"@types/node\": \"^18.11.18\",\n \"@typescript-eslint/eslint-plugin\": \"^5.57.0\",\n \"@typescript-eslint/parser\": \"^5.57.0\",\n \"rimraf\": \"^6.0.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.7\",\n \"typia\": \"^9.6.1\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
11
+ "node_modules/@nestia/e2e/package.json": "{\n \"name\": \"@nestia/e2e\",\n \"version\": \"8.0.7\",\n \"description\": \"E2E test utilify functions\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"npm run build:main && npm run build:test\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"prepare\": \"ts-patch install && typia patch\",\n \"test\": \"node bin/test\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"e2e\",\n \"nestia\",\n \"nestjs\",\n \"test\",\n \"tdd\",\n \"utility\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"devDependencies\": {\n \"@trivago/prettier-plugin-sort-imports\": \"^4.0.0\",\n \"@types/node\": \"^18.11.18\",\n \"@typescript-eslint/eslint-plugin\": \"^5.57.0\",\n \"@typescript-eslint/parser\": \"^5.57.0\",\n \"rimraf\": \"^6.0.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.7\",\n \"typia\": \"^9.6.1\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
12
12
  "node_modules/@nestia/fetcher/lib/AesPkcs5.d.ts": "/**\n * Utility class for the AES-128/256 encryption.\n *\n * - AES-128/256\n * - CBC mode\n * - PKCS#5 Padding\n * - Base64 Encoding\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace AesPkcs5 {\n /**\n * Encrypt data\n *\n * @param data Target data\n * @param key Key value of the encryption.\n * @param iv Initializer Vector for the encryption\n * @returns Encrypted data\n */\n function encrypt(data: string, key: string, iv: string): string;\n /**\n * Decrypt data.\n *\n * @param data Target data\n * @param key Key value of the decryption.\n * @param iv Initializer Vector for the decryption\n * @returns Decrypted data.\n */\n function decrypt(data: string, key: string, iv: string): string;\n}\n",
13
13
  "node_modules/@nestia/fetcher/lib/EncryptedFetcher.d.ts": "import { IConnection } from \"./IConnection\";\nimport { IFetchRoute } from \"./IFetchRoute\";\nimport { IPropagation } from \"./IPropagation\";\n/**\n * Utility class for `fetch` functions used in `@nestia/sdk` with encryption.\n *\n * `EncryptedFetcher` is a utility class designed for SDK functions generated by\n * [`@nestia/sdk`](https://nestia.io/docs/sdk/sdk), interacting with the remote\n * HTTP API encrypted by AES-PKCS algorithm. In other words, this is a\n * collection of dedicated `fetch()` functions for `@nestia/sdk` with\n * encryption.\n *\n * For reference, `EncryptedFetcher` class being used only when target\n * controller method is encrypting body data by `@EncryptedRoute` or\n * `@EncryptedBody` decorators. If those decorators are not used,\n * {@link PlainFetcher} class would be used instead.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace EncryptedFetcher {\n /**\n * Fetch function only for `HEAD` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Nothing because of `HEAD` method\n */\n function fetch(connection: IConnection, route: IFetchRoute<\"HEAD\">): Promise<void>;\n /**\n * Fetch function only for `GET` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Output>(connection: IConnection, route: IFetchRoute<\"GET\">): Promise<Output>;\n /**\n * Fetch function for the `POST`, `PUT`, `PATCH` and `DELETE` methods.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Input, Output>(connection: IConnection, route: IFetchRoute<\"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n function propagate<Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"GET\" | \"HEAD\">): Promise<Output>;\n function propagate<Input, Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"DELETE\" | \"GET\" | \"HEAD\" | \"PATCH\" | \"POST\" | \"PUT\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n}\n",
14
14
  "node_modules/@nestia/fetcher/lib/FormDataInput.d.ts": "/**\n * FormData input type.\n *\n * `FormDataInput<T>` is a type for the input of the `FormData` request, casting\n * `File` property value type as an union of `File` and\n * {@link FormDataInput.IFileProps}, especially for the React Native\n * environment.\n *\n * You know what? In the React Native environment, `File` class is not\n * supported. Therefore, when composing a `FormData` request, you have to put\n * the URI address of the local filesystem with file name and content type that\n * is represented by the {@link FormDataInput.IFileProps} type.\n *\n * This `FormDataInput<T>` type is designed for that purpose. If the property\n * value type is a `File` class, it converts it to an union type of `File` and\n * {@link FormDataInput.IFileProps} type. Also, if the property value type is an\n * array of `File` class, it converts it to an array of union type of `File` and\n * {@link FormDataInput.IFileProps} type too.\n *\n * Before | After ----------|------------------------ `boolean` | `boolean`\n * `bigint` | `bigint` `number` | `number` `string` | `string` `File` | `File \\|\n * IFileProps`\n *\n * @author Jeongho Nam - https://github.com/samchon\n * @template T Target object type.\n */\nexport type FormDataInput<T extends object> = T extends Array<any> ? never : T extends Function ? never : {\n [P in keyof T]: T[P] extends Array<infer U> ? FormDataInput.Value<U>[] : FormDataInput.Value<T[P]>;\n};\nexport declare namespace FormDataInput {\n /**\n * Value type of the `FormDataInput`.\n *\n * `Value<T>` is a type for the property value defined in the `FormDataInput`.\n *\n * If the original value type is a `File` class, `Value<T>` converts it to an\n * union type of `File` and {@link IFileProps} type which is a structured data\n * for the URI file location in the React Native environment.\n */\n type Value<T> = T extends File ? T | IFileProps : T;\n /**\n * Properties of a file.\n *\n * In the React Native, this `IFileProps` structured data can replace the\n * `File` class instance in the `FormData` request.\n *\n * Just put the {@link uri URI address} of the local file system with the\n * file's {@link name} and {@link type}. It would be casted to the `File` class\n * instance automatically in the `FormData` request.\n *\n * Note that, this `IFileProps` type works only in the React Native\n * environment. If you are developing a Web or NodeJS application, you have to\n * utilize the `File` class instance directly.\n */\n interface IFileProps {\n /**\n * URI address of the file.\n *\n * In the React Native, the URI address in the local file system can replace\n * the `File` class instance. If\n *\n * @format uri\n */\n uri: string;\n /** Name of the file. */\n name: string;\n /** Content type of the file. */\n type: string;\n }\n}\n",
@@ -23,7 +23,7 @@
23
23
  "node_modules/@nestia/fetcher/lib/PlainFetcher.d.ts": "import { IConnection } from \"./IConnection\";\nimport { IFetchRoute } from \"./IFetchRoute\";\nimport { IPropagation } from \"./IPropagation\";\n/**\n * Utility class for `fetch` functions used in `@nestia/sdk`.\n *\n * `PlainFetcher` is a utility class designed for SDK functions generated by\n * [`@nestia/sdk`](https://nestia.io/docs/sdk/sdk), interacting with the remote\n * HTTP sever API. In other words, this is a collection of dedicated `fetch()`\n * functions for `@nestia/sdk`.\n *\n * For reference, `PlainFetcher` class does not encrypt or decrypt the body data\n * at all. It just delivers plain data without any post processing. If you've\n * defined a controller method through `@EncryptedRoute` or `@EncryptedBody`\n * decorator, then {@liink EncryptedFetcher} class would be used instead.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace PlainFetcher {\n /**\n * Fetch function only for `HEAD` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Nothing because of `HEAD` method\n */\n function fetch(connection: IConnection, route: IFetchRoute<\"HEAD\">): Promise<void>;\n /**\n * Fetch function only for `GET` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Output>(connection: IConnection, route: IFetchRoute<\"GET\">): Promise<Output>;\n /**\n * Fetch function for the `POST`, `PUT`, `PATCH` and `DELETE` methods.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Input, Output>(connection: IConnection, route: IFetchRoute<\"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n function propagate<Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"GET\" | \"HEAD\">): Promise<Output>;\n function propagate<Input, Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"DELETE\" | \"GET\" | \"HEAD\" | \"PATCH\" | \"POST\" | \"PUT\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n}\n",
24
24
  "node_modules/@nestia/fetcher/lib/index.d.ts": "export * from \"./FormDataInput\";\nexport * from \"./HttpError\";\nexport * from \"./IConnection\";\nexport * from \"./IEncryptionPassword\";\nexport * from \"./IFetchEvent\";\nexport * from \"./IFetchRoute\";\nexport * from \"./IPropagation\";\n",
25
25
  "node_modules/@nestia/fetcher/lib/internal/FetcherBase.d.ts": "export {};\n",
26
- "node_modules/@nestia/fetcher/package.json": "{\n \"name\": \"@nestia/fetcher\",\n \"version\": \"8.0.5\",\n \"description\": \"Fetcher library of Nestia SDK\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint src\",\n \"eslint:fix\": \"eslint src --fix\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestia\",\n \"fetcher\",\n \"sdk\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@samchon/openapi\": \"^4.5.0\"\n },\n \"devDependencies\": {\n \"@types/node\": \"^18.11.14\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"rimraf\": \"^6.0.1\",\n \"typescript\": \"~5.9.2\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"lib\",\n \"src\"\n ]\n}",
26
+ "node_modules/@nestia/fetcher/package.json": "{\n \"name\": \"@nestia/fetcher\",\n \"version\": \"8.0.7\",\n \"description\": \"Fetcher library of Nestia SDK\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint src\",\n \"eslint:fix\": \"eslint src --fix\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestia\",\n \"fetcher\",\n \"sdk\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@samchon/openapi\": \"^4.5.0\"\n },\n \"devDependencies\": {\n \"@types/node\": \"^18.11.14\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"rimraf\": \"^6.0.1\",\n \"typescript\": \"~5.9.2\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"lib\",\n \"src\"\n ]\n}",
27
27
  "node_modules/@samchon/openapi/lib/HttpLlm.d.ts": "import { OpenApi } from \"./OpenApi\";\nimport { OpenApiV3 } from \"./OpenApiV3\";\nimport { OpenApiV3_1 } from \"./OpenApiV3_1\";\nimport { SwaggerV2 } from \"./SwaggerV2\";\nimport { IHttpConnection } from \"./structures/IHttpConnection\";\nimport { IHttpLlmApplication } from \"./structures/IHttpLlmApplication\";\nimport { IHttpLlmFunction } from \"./structures/IHttpLlmFunction\";\nimport { IHttpResponse } from \"./structures/IHttpResponse\";\nimport { ILlmFunction } from \"./structures/ILlmFunction\";\nimport { ILlmSchema } from \"./structures/ILlmSchema\";\n/**\n * LLM function calling application composer from OpenAPI document.\n *\n * `HttpLlm` is a module for composing LLM (Large Language Model) function\n * calling application from the {@link OpenApi.IDocument OpenAPI document}, and\n * also for LLM function call execution and parameter merging.\n *\n * At first, you can construct the LLM function calling application by the\n * {@link HttpLlm.application HttpLlm.application()} function. And then the LLM\n * has selected a {@link IHttpLlmFunction function} to call and composes its\n * arguments, you can execute the function by\n * {@link HttpLlm.execute HttpLlm.execute()} or\n * {@link HttpLlm.propagate HttpLlm.propagate()}.\n *\n * By the way, if you have configured the\n * {@link IHttpLlmApplication.IOptions.separate} option to separate the\n * parameters into human and LLM sides, you can merge these human and LLM sides'\n * parameters into one through\n * {@link HttpLlm.mergeParameters HttpLlm.mergeParameters()} before the actual\n * LLM function call execution.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace HttpLlm {\n /**\n * Properties for the LLM function calling application composer.\n *\n * @template Model Target LLM model\n */\n interface IApplicationProps<Model extends ILlmSchema.Model> {\n /** Target LLM model. */\n model: Model;\n /** OpenAPI document to convert. */\n document: OpenApi.IDocument | SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument;\n /** Options for the LLM function calling schema conversion. */\n options?: Partial<IHttpLlmApplication.IOptions<Model>>;\n }\n /**\n * Convert OpenAPI document to LLM function calling application.\n *\n * Converts {@link OpenApi.IDocument OpenAPI document} or\n * {@link IHttpMigrateApplication migrated application} to the\n * {@link IHttpLlmApplication LLM function calling application}. Every\n * {@link OpenApi.IOperation API operations} in the OpenAPI document are\n * converted to the {@link IHttpLlmFunction LLM function} type, and they would\n * be used for the LLM function calling.\n *\n * If you have configured the {@link IHttpLlmApplication.IOptions.separate}\n * option, every parameters in the {@link IHttpLlmFunction} would be separated\n * into both human and LLM sides. In that case, you can merge these human and\n * LLM sides' parameters into one through {@link HttpLlm.mergeParameters}\n * before the actual LLM function call execution.\n *\n * Additionally, if you have configured the\n * {@link IHttpLlmApplication.IOptions.keyword} as `true`, the number of\n * {@link IHttpLlmFunction.parameters} are always 1 and the first parameter\n * type is always {@link ILlmSchemaV3.IObject}. I recommend this option because\n * LLM can understand the keyword arguments more easily.\n *\n * @param props Properties for composition\n * @returns LLM function calling application\n */\n const application: <Model extends ILlmSchema.Model>(props: IApplicationProps<Model>) => IHttpLlmApplication<Model>;\n /** Properties for the LLM function call. */\n interface IFetchProps<Model extends ILlmSchema.Model> {\n /** Application of the LLM function calling. */\n application: IHttpLlmApplication<Model>;\n /** LLM function schema to call. */\n function: IHttpLlmFunction<ILlmSchema.Model>;\n /** Connection info to the HTTP server. */\n connection: IHttpConnection;\n /** Input arguments for the function call. */\n input: object;\n }\n /**\n * Execute the LLM function call.\n *\n * `HttmLlm.execute()` is a function executing the target\n * {@link OpenApi.IOperation API endpoint} with with the connection information\n * and arguments composed by Large Language Model like OpenAI (+human\n * sometimes).\n *\n * By the way, if you've configured the\n * {@link IHttpLlmApplication.IOptions.separate}, so that the parameters are\n * separated to human and LLM sides, you have to merge these humand and LLM\n * sides' parameters into one through {@link HttpLlm.mergeParameters}\n * function.\n *\n * About the {@link IHttpLlmApplication.IOptions.keyword} option, don't worry\n * anything. This `HttmLlm.execute()` function will automatically recognize\n * the keyword arguments and convert them to the proper sequence.\n *\n * For reference, if the target API endpoinnt responds none 200/201 status,\n * this would be considered as an error and the {@link HttpError} would be\n * thrown. Otherwise you don't want such rule, you can use the\n * {@link HttpLlm.propagate} function instead.\n *\n * @param props Properties for the LLM function call\n * @returns Return value (response body) from the API endpoint\n * @throws HttpError when the API endpoint responds none 200/201 status\n */\n const execute: <Model extends ILlmSchema.Model>(props: IFetchProps<Model>) => Promise<unknown>;\n /**\n * Propagate the LLM function call.\n *\n * `HttmLlm.propagate()` is a function propagating the target\n * {@link OpenApi.IOperation API endpoint} with with the connection information\n * and arguments composed by Large Language Model like OpenAI (+human\n * sometimes).\n *\n * By the way, if you've configured the\n * {@link IHttpLlmApplication.IOptions.separate}, so that the parameters are\n * separated to human and LLM sides, you have to merge these humand and LLM\n * sides' parameters into one through {@link HttpLlm.mergeParameters}\n * function.\n *\n * About the {@link IHttpLlmApplication.IOptions.keyword} option, don't worry\n * anything. This `HttmLlm.propagate()` function will automatically recognize\n * the keyword arguments and convert them to the proper sequence.\n *\n * For reference, the propagation means always returning the response from the\n * API endpoint, even if the status is not 200/201. This is useful when you\n * want to handle the response by yourself.\n *\n * @param props Properties for the LLM function call\n * @returns Response from the API endpoint\n * @throws Error only when the connection is failed\n */\n const propagate: <Model extends ILlmSchema.Model>(props: IFetchProps<Model>) => Promise<IHttpResponse>;\n /** Properties for the parameters' merging. */\n interface IMergeProps<Model extends ILlmSchema.Model> {\n /** Metadata of the target function. */\n function: ILlmFunction<Model>;\n /** Arguments composed by the LLM. */\n llm: object | null;\n /** Arguments composed by the human. */\n human: object | null;\n }\n /**\n * Merge the parameters.\n *\n * If you've configured the {@link IHttpLlmApplication.IOptions.separate}\n * option, so that the parameters are separated to human and LLM sides, you\n * can merge these humand and LLM sides' parameters into one through this\n * `HttpLlm.mergeParameters()` function before the actual LLM function call\n * wexecution.\n *\n * On contrary, if you've not configured the\n * {@link IHttpLlmApplication.IOptions.separate} option, this function would\n * throw an error.\n *\n * @param props Properties for the parameters' merging\n * @returns Merged parameter values\n */\n const mergeParameters: <Model extends ILlmSchema.Model>(props: IMergeProps<Model>) => object;\n /**\n * Merge two values.\n *\n * If both values are objects, then combines them in the properties level.\n *\n * Otherwise, returns the latter value if it's not null, otherwise the former\n * value.\n *\n * - `return (y ?? x)`\n *\n * @param x Value X to merge\n * @param y Value Y to merge\n * @returns Merged value\n */\n const mergeValue: (x: unknown, y: unknown) => unknown;\n}\n",
28
28
  "node_modules/@samchon/openapi/lib/HttpMigration.d.ts": "import { OpenApi } from \"./OpenApi\";\nimport { OpenApiV3 } from \"./OpenApiV3\";\nimport { OpenApiV3_1 } from \"./OpenApiV3_1\";\nimport { SwaggerV2 } from \"./SwaggerV2\";\nimport { IHttpConnection } from \"./structures/IHttpConnection\";\nimport { IHttpMigrateApplication } from \"./structures/IHttpMigrateApplication\";\nimport { IHttpMigrateRoute } from \"./structures/IHttpMigrateRoute\";\nimport { IHttpResponse } from \"./structures/IHttpResponse\";\n/**\n * HTTP migration application composer from OpenAPI document.\n *\n * `HttpMigration` is a module for composing HTTP migration application from the\n * {@link OpenApi.IDocument OpenAPI document}. It is designed for helping the\n * OpenAPI generator libraries, which converts\n * {@link OpenApi.IOperation OpenAPI operations} to an RPC (Remote Procedure\n * Call) function.\n *\n * The key feature of the `HttpModule` is the {@link HttpMigration.application}\n * function. It converts the {@link OpenApi.IOperation OpenAPI operations} to the\n * {@link IHttpMigrateRoute HTTP migration route}, and it normalizes the OpenAPI\n * operations to the RPC function calling suitable route structure.\n *\n * The other functions, {@link HttpMigration.execute} and\n * {@link HttpMigration.propagate}, are for executing the HTTP request to the\n * HTTP server. The {@link HttpMigration.execute} function returns the response\n * body from the API endpoint when the status code is `200` or `201`. Otherwise,\n * it throws an {@link HttpError} when the status code is not `200` or `201`. The\n * {@link HttpMigration.propagate} function returns the response information from\n * the API endpoint, including the status code, headers, and response body.\n *\n * The {@link HttpLlm} module is a good example utilizing this `HttpMigration`\n * module for composing RPC function calling application. The {@link HttpLlm}\n * module composes LLM (Large Language Model) function calling application from\n * the OpenAPI document bypassing through the {@link IHttpLlmApplication} type.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace HttpMigration {\n /**\n * Convert HTTP migration application from OpenAPI document.\n *\n * `HttpMigration.application()` is a function converting the\n * {@link OpenApi.IDocument OpenAPI document} and its\n * {@link OpenApi.IOperation operations} to the\n * {@link IHttpMigrateApplication HTTP migration application}.\n *\n * The HTTP migration application is designed for helping the OpenAPI\n * generator libraries, which converts OpenAPI operations to an RPC (Remote\n * Procedure Call) function. To support the OpenAPI generator libraries,\n * {@link IHttpMigrateRoute} takes below normalization rules:\n *\n * - Path parameters are separated to atomic level.\n * - Query parameters are binded into one object.\n * - Header parameters are binded into one object.\n * - Allow only below HTTP methods\n *\n * - `head`\n * - `get`\n * - `post`\n * - `put`\n * - `patch`\n * - `delete`\n * - Allow only below content media types\n *\n * - `application/json`\n * - `application/x-www-form-urlencoded`\n * - `multipart/form-data`\n * - `text/plain`\n *\n * If there're some {@link OpenApi.IOperation API operations} which canont\n * adjust the above rules or there're some logically insensible, these\n * operation would be failed to migrate and registered into the\n * {@link IHttpMigrateApplication.errors}.\n *\n * @param document OpenAPI document to migrate.\n * @returns Migrated application.\n */\n const application: (document: OpenApi.IDocument | SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument) => IHttpMigrateApplication;\n /** Properties for the request to the HTTP server. */\n interface IFetchProps {\n /** Connection info to the HTTP server. */\n connection: IHttpConnection;\n /** Route information for the migration. */\n route: IHttpMigrateRoute;\n /**\n * Path parameters.\n *\n * Path parameters with sequenced array or key-value paired object.\n */\n parameters: Array<string | number | boolean | bigint | null> | Record<string, string | number | boolean | bigint | null>;\n /** Query parameters as a key-value paired object. */\n query?: object | undefined;\n /** Request body data. */\n body?: object | undefined;\n }\n /**\n * Execute the HTTP request.\n *\n * `HttpMigration.execute()` is a function executing the HTTP request to the\n * HTTP server.\n *\n * It returns the response body from the API endpoint when the status code is\n * `200` or `201`. Otherwise, it throws an {@link HttpError} when the status\n * code is not `200` or `201`.\n *\n * If you want to get more information than the response body, or get the\n * detailed response information even when the status code is `200` or `201`,\n * use the {@link HttpMigration.propagate} function instead.\n *\n * @param props Properties for the request.\n * @returns Return value (response body) from the API endpoint.\n * @throws HttpError when the API endpoint responds none 200/201 status.\n */\n const execute: (props: IFetchProps) => Promise<unknown>;\n /**\n * Propagate the HTTP request.\n *\n * `HttpMigration.propagate()` is a function propagating the request to the\n * HTTP server.\n *\n * It returns the response information from the API endpoint, including the\n * status code, headers, and response body.\n *\n * Even if the status code is not `200` or `201`, this function would return\n * the response information. By the way, if the connection to the HTTP server\n * is failed, this function would throw an {@link Error}.\n *\n * @param props Properties for the request.\n * @returns Response from the API endpoint.\n * @throws Error when the connection is failed.\n */\n const propagate: (props: IFetchProps) => Promise<IHttpResponse>;\n}\n",
29
29
  "node_modules/@samchon/openapi/lib/McpLlm.d.ts": "import { ILlmSchema } from \"./structures/ILlmSchema\";\nimport { IMcpLlmApplication } from \"./structures/IMcpLlmApplication\";\nimport { IMcpTool } from \"./structures/IMcpTool\";\n/**\n * Application of LLM function calling from MCP document.\n *\n * `McpLlm` is a module for composing LLM (Large Language Model) function\n * calling application from MCP (Model Context Protocol) document.\n *\n * The reasons why `@samchon/openapi` recommends to use the function calling\n * feature instead of directly using the\n * [`mcp_servers`](https://openai.github.io/openai-agents-python/mcp/#using-mcp-servers)\n * property of LLM API are:\n *\n * - Model Specification: {@link ILlmSchema}\n * - Validation Feedback: {@link IMcpLlmFunction.validate}\n * - Selector agent for reducing context: [Agentica > Orchestration\n * Strategy](https://wrtnlabs.io/agentica/docs/concepts/function-calling/#orchestration-strategy)\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace McpLlm {\n /**\n * Properties for the LLM function calling application composer.\n *\n * @template Model Target LLM model\n */\n interface IApplicationProps<Model extends ILlmSchema.Model> {\n /** Target LLM model. */\n model: Model;\n /**\n * List of tools.\n *\n * A list of tools defined in the MCP (Model Context Protocol) document.\n *\n * It is better to validate the tools using the\n * [`typia.assert<T>()`](https://typia.io/docs/validate/assert) function for\n * type safety.\n */\n tools: Array<IMcpTool>;\n /** Options for the LLM function calling schema conversion. */\n options?: Partial<IMcpLlmApplication.IOptions<Model>>;\n }\n /**\n * Convert MCP document to LLM function calling application.\n *\n * Converts MCP (Model Context Protocol) to LLM (Large Language Model)\n * function calling application.\n *\n * The reasons why `@samchon/openapi` recommends using the function calling\n * feature instead of directly using the\n * [`mcp_servers`](https://openai.github.io/openai-agents-python/mcp/#using-mcp-servers)\n * property of LLM API are:\n *\n * - **Model Specification**: {@link ILlmSchema}\n * - **Validation Feedback**: {@link IMcpLlmFunction.validate}\n * - **Selector agent for reducing context**: [Agentica > Orchestration\n * Strategy](https://wrtnlabs.io/agentica/docs/concepts/function-calling/#orchestration-strategy)\n *\n * @param props Properties for composition\n * @returns LLM function calling application\n */\n const application: <Model extends ILlmSchema.Model>(props: IApplicationProps<Model>) => IMcpLlmApplication<Model>;\n}\n",