@autobe/compiler 0.18.0 → 0.20.0
This diff represents the content of publicly available package versions that have been released to one of the supported registries. The information contained in this diff is provided for informational purposes only and reflects changes between package versions as they appear in their respective public registries.
- package/lib/AutoBeTypeScriptCompiler.js +7 -8
- package/lib/AutoBeTypeScriptCompiler.js.map +1 -1
- package/lib/interface/AutoBeInterfaceCompiler.js +2 -2
- package/lib/interface/AutoBeInterfaceCompiler.js.map +1 -1
- package/lib/prisma/validatePrismaApplication.js +259 -73
- package/lib/prisma/validatePrismaApplication.js.map +1 -1
- package/lib/prisma/writePrismaApplication.js +1 -2
- package/lib/prisma/writePrismaApplication.js.map +1 -1
- package/lib/raw/AutoBeCompilerRealizeTemplate.js +4 -3
- package/lib/raw/AutoBeCompilerRealizeTemplate.js.map +1 -1
- package/lib/raw/AutoBeCompilerTestTemplate.js +1 -1
- package/lib/raw/nestjs.json +7 -7
- package/lib/raw/test.json +2 -2
- package/lib/realize/writeRealizeControllers.js +10 -3
- package/lib/realize/writeRealizeControllers.js.map +1 -1
- package/lib/test/AutoBeTestCompiler.js +7 -8
- package/lib/test/AutoBeTestCompiler.js.map +1 -1
- package/lib/utils/FilePrinter.js +11 -11
- package/lib/utils/FilePrinter.js.map +1 -1
- package/lib/utils/shrinkCompileResult.d.ts +3 -0
- package/lib/utils/shrinkCompileResult.js +17 -0
- package/lib/utils/shrinkCompileResult.js.map +1 -0
- package/package.json +14 -9
- package/src/AutoBeTypeScriptCompiler.ts +12 -13
- package/src/interface/AutoBeInterfaceCompiler.ts +3 -3
- package/src/prisma/validatePrismaApplication.ts +265 -79
- package/src/prisma/writePrismaApplication.ts +1 -2
- package/src/raw/AutoBeCompilerRealizeTemplate.ts +4 -3
- package/src/raw/AutoBeCompilerTestTemplate.ts +1 -1
- package/src/raw/nestjs.json +7 -7
- package/src/raw/test.json +2 -2
- package/src/realize/writeRealizeControllers.ts +38 -4
- package/src/test/AutoBeTestCompiler.ts +7 -8
- package/src/utils/FilePrinter.ts +10 -9
- package/src/utils/shrinkCompileResult.ts +16 -0
- package/lib/interface/createMigrateApplication.d.ts +0 -3
- package/lib/interface/createMigrateApplication.js +0 -15
- package/lib/interface/createMigrateApplication.js.map +0 -1
- package/lib/utils/MapUtil.d.ts +0 -3
- package/lib/utils/MapUtil.js +0 -16
- package/lib/utils/MapUtil.js.map +0 -1
- package/src/interface/createMigrateApplication.ts +0 -18
- package/src/utils/MapUtil.ts +0 -10
|
@@ -1,12 +1,13 @@
|
|
|
1
1
|
export const AutoBeCompilerRealizeTemplate: Record<string, string> = {
|
|
2
2
|
".env.local": "API_PORT=37001\nJWT_SECRET_KEY=your_jwt_secret_key",
|
|
3
3
|
".gitignore": "bin/\ndist/\nlib/\nnode_modules/\n\nprisma/migrations\nprisma/schema/migrations\nprisma/bbs.db\n\n*.DS_Store\npackage-lock.json\npnpm-lock.yaml\n.npmrc",
|
|
4
|
-
"package.json": "{\n \"private\": true,\n \"name\": \"@ORGANIZATION/PROJECT\",\n \"version\": \"0.1.0\",\n \"description\": \"Starter kit of Nestia\",\n \"main\": \"lib/index.js\",\n \"scripts\": {\n \"benchmark\": \"node bin/test/benchmark\",\n \"test\": \"node bin/test\",\n \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------BUILDS------------------------\": \"\",\n \"build\": \"npm run build:prisma && npm run build:sdk && npm run build:main && npm run build:test\",\n \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n \"build:env\": \"ts-node build/env.ts\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n \"build:prisma\": \"prisma generate --schema prisma/schema\",\n \"build:swagger\": \"nestia swagger\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n \"prepare\": \"ts-patch install && npm run build:env && npm run build:prisma\",\n \"prettier\": \"prettier src --write && prettier test --write\",\n \"------------------------WEBPACK------------------------\": \"\",\n \"webpack\": \"rimraf dist && webpack\",\n \"webpack:start\": \"cd dist && node dist/server\",\n \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------DEPLOYS------------------------\": \"\",\n \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n \"start\": \"node lib/executable/server\",\n \"start:dev\": \"nest start --watch\",\n \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia-start\"\n },\n \"keywords\": [\n \"nestia\",\n \"template\",\n \"boilerplate\"\n ],\n \"author\": \"AUTHOR\",\n \"license\": \"AGPL-3.0\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia-start/issues\"\n },\n \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n \"devDependencies\": {\n \"@autobe/interface\": \"^0.10.6\",\n \"@nestia/benchmark\": \"^7.
|
|
5
|
-
"src/MyGlobal.ts": "import { PrismaClient } from \"@prisma/client\";\nimport dotenv from \"dotenv\";\nimport dotenvExpand from \"dotenv-expand\";\nimport { Singleton } from \"tstl\";\nimport typia from \"typia\";\n\n/* eslint-disable */\nexport class MyGlobal {\n public static readonly prisma: PrismaClient = new PrismaClient();\n public static testing: boolean = false;\n public static get env(): MyGlobal.IEnvironments {\n return environments.get();\n }\n}\nexport namespace MyGlobal {\n export interface IEnvironments {\n API_PORT: `${number}`;\n\n /** JWT Secret Key. */\n JWT_SECRET_KEY: string;\n }\n}\nconst environments = new Singleton(() => {\n const env = dotenv.config();\n dotenvExpand.expand(env);\n return typia.assert<MyGlobal.IEnvironments>(process.env);\n});\n",
|
|
6
|
-
"src/providers/authorize/jwtAuthorize.ts": "import { ForbiddenException, UnauthorizedException } from \"@nestjs/common\";\nimport jwt from \"jsonwebtoken\";\n\nimport { MyGlobal } from \"../../MyGlobal\";\n\nexport function jwtAuthorize(props: {\n request: {\n headers: { authorization?: string };\n };\n}) {\n if (!props.request.headers.authorization)\n throw new ForbiddenException(\"No token value exists\");\n
|
|
4
|
+
"package.json": "{\n \"private\": true,\n \"name\": \"@ORGANIZATION/PROJECT\",\n \"version\": \"0.1.0\",\n \"description\": \"Starter kit of Nestia\",\n \"main\": \"lib/index.js\",\n \"scripts\": {\n \"benchmark\": \"node bin/test/benchmark\",\n \"test\": \"node bin/test\",\n \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------BUILDS------------------------\": \"\",\n \"build\": \"npm run build:prisma && npm run build:sdk && npm run build:main && npm run build:test\",\n \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n \"build:env\": \"ts-node build/env.ts\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n \"build:prisma\": \"prisma generate --schema prisma/schema\",\n \"build:swagger\": \"nestia swagger\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n \"prepare\": \"ts-patch install && npm run build:env && npm run build:prisma\",\n \"prettier\": \"prettier src --write && prettier test --write\",\n \"------------------------WEBPACK------------------------\": \"\",\n \"webpack\": \"rimraf dist && webpack\",\n \"webpack:start\": \"cd dist && node dist/server\",\n \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------DEPLOYS------------------------\": \"\",\n \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n \"start\": \"node lib/executable/server\",\n \"start:dev\": \"nest start --watch\",\n \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia-start\"\n },\n \"keywords\": [\n \"nestia\",\n \"template\",\n \"boilerplate\"\n ],\n \"author\": \"AUTHOR\",\n \"license\": \"AGPL-3.0\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia-start/issues\"\n },\n \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n \"devDependencies\": {\n \"@autobe/interface\": \"^0.10.6\",\n \"@nestia/benchmark\": \"^7.4.0\",\n \"@nestia/e2e\": \"^7.4.0\",\n \"@nestia/sdk\": \"^7.4.0\",\n \"@nestjs/cli\": \"^11.0.7\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^11.1.6\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/bcryptjs\": \"^3.0.0\",\n \"@types/cli\": \"^0.11.21\",\n \"@types/cli-progress\": \"^3.11.5\",\n \"@types/express\": \"^4.17.21\",\n \"@types/inquirer\": \"^8.2.5\",\n \"@types/jsonwebtoken\": \"^9.0.5\",\n \"@types/node\": \"^18.11.0\",\n \"@types/uuid\": \"^8.3.4\",\n \"@typescript-eslint/eslint-plugin\": \"^8.1.0\",\n \"@typescript-eslint/parser\": \"^8.1.0\",\n \"chalk\": \"^4.1.2\",\n \"cli\": \"^1.0.1\",\n \"cli-progress\": \"^3.12.0\",\n \"copy-webpack-plugin\": \"^11.0.0\",\n \"eslint-plugin-deprecation\": \"^3.0.0\",\n \"express\": \"^4.18.2\",\n \"fastify\": \"^5.4.0\",\n \"nestia\": \"^7.4.0\",\n \"prettier\": \"^3.2.4\",\n \"prettier-plugin-prisma\": \"^5.0.0\",\n \"prisma-markdown\": \"^3.0.1\",\n \"rimraf\": \"^3.0.2\",\n \"rollup\": \"^4.18.0\",\n \"source-map-support\": \"^0.5.21\",\n \"swagger-ui-express\": \"^5.0.0\",\n \"ts-loader\": \"^9.5.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.5.5\",\n \"webpack\": \"^5.89.0\",\n \"webpack-cli\": \"^5.1.4\",\n \"write-file-webpack-plugin\": \"^4.5.1\"\n },\n \"dependencies\": {\n \"@nestia/core\": \"^7.4.0\",\n \"@nestia/fetcher\": \"^7.4.0\",\n \"@nestjs/common\": \"^11.1.3\",\n \"@nestjs/core\": \"^11.1.3\",\n \"@nestjs/platform-express\": \"^11.1.3\",\n \"@nestjs/platform-fastify\": \"^11.1.3\",\n \"@prisma/client\": \"^6.11.1\",\n \"bcryptjs\": \"^3.0.2\",\n \"commander\": \"10.0.0\",\n \"dotenv\": \"^16.3.1\",\n \"dotenv-expand\": \"^10.0.0\",\n \"inquirer\": \"8.2.5\",\n \"jsonwebtoken\": \"^9.0.2\",\n \"prisma\": \"^6.11.1\",\n \"serialize-error\": \"^4.1.0\",\n \"tgrid\": \"^1.1.0\",\n \"tstl\": \"^3.0.0\",\n \"typia\": \"^9.7.1\",\n \"uuid\": \"^9.0.0\"\n },\n \"stackblitz\": {\n \"startCommand\": \"npm run prepare && npm run build:test && npm run test -- --simultaneous 1\"\n }\n}\n",
|
|
5
|
+
"src/MyGlobal.ts": "import { PrismaClient } from \"@prisma/client\";\nimport crypto from \"crypto\";\nimport dotenv from \"dotenv\";\nimport dotenvExpand from \"dotenv-expand\";\nimport { Singleton } from \"tstl\";\nimport typia from \"typia\";\n\n/* eslint-disable */\nexport class MyGlobal {\n public static readonly prisma: PrismaClient = new PrismaClient();\n public static testing: boolean = false;\n public static get env(): MyGlobal.IEnvironments {\n return environments.get();\n }\n\n /**\n * Common password utilities for consistent authentication Uses native crypto\n * module for password hashing\n */\n public static readonly password = {\n // Fixed salt for password hashing (consistent across all operations)\n FIXED_SALT: \"autobe-fixed-salt-2024\",\n\n /**\n * Hash a plain password using crypto.pbkdf2 All authentication operations\n * (join, login) MUST use this method\n *\n * @param plainPassword - The plain text password to hash\n * @returns The hashed password as hex string\n */\n async hash(plainPassword: string): Promise<string> {\n return new Promise((resolve, reject) => {\n crypto.pbkdf2(\n plainPassword,\n this.FIXED_SALT,\n 10000,\n 64,\n \"sha512\",\n (err: Error | null, derivedKey: Buffer) => {\n if (err) reject(err);\n else resolve(derivedKey.toString(\"hex\"));\n },\n );\n });\n },\n\n /**\n * Verify a plain password against a hashed password Login operations MUST\n * use this method for password verification\n *\n * @param plainPassword - The plain text password to verify\n * @param hashedPassword - The hashed password from database\n * @returns True if passwords match, false otherwise\n */\n async verify(\n plainPassword: string,\n hashedPassword: string,\n ): Promise<boolean> {\n const hash = await this.hash(plainPassword);\n return hash === hashedPassword;\n },\n };\n}\nexport namespace MyGlobal {\n export interface IEnvironments {\n API_PORT: `${number}`;\n\n /** JWT Secret Key. */\n JWT_SECRET_KEY: string;\n }\n}\nconst environments = new Singleton(() => {\n const env = dotenv.config();\n dotenvExpand.expand(env);\n return typia.assert<MyGlobal.IEnvironments>(process.env);\n});\n",
|
|
6
|
+
"src/providers/authorize/jwtAuthorize.ts": "import { ForbiddenException, UnauthorizedException } from \"@nestjs/common\";\nimport jwt from \"jsonwebtoken\";\n\nimport { MyGlobal } from \"../../MyGlobal\";\n\nexport function jwtAuthorize(props: {\n request: {\n headers: { authorization?: string };\n };\n}) {\n if (!props.request.headers.authorization)\n throw new ForbiddenException(\"No token value exists\");\n\n // PARSE TOKEN\n try {\n if (\n props.request.headers.authorization.startsWith(BEARER_PREFIX) === true\n ) {\n const token: string = props.request.headers.authorization.substring(\n BEARER_PREFIX.length,\n );\n\n const verified = jwt.verify(token, MyGlobal.env.JWT_SECRET_KEY);\n\n return verified;\n } else {\n const token = props.request.headers.authorization;\n\n const verified = jwt.verify(token, MyGlobal.env.JWT_SECRET_KEY);\n\n return verified;\n }\n } catch {\n throw new UnauthorizedException(\"Invalid token\");\n }\n}\n\nconst BEARER_PREFIX = \"Bearer \";\n",
|
|
7
7
|
"src/setup/MySetupWizard.ts": "import cp from \"child_process\";\n\nimport { MyConfiguration } from \"../MyConfiguration\";\nimport { MyGlobal } from \"../MyGlobal\";\n\nexport namespace MySetupWizard {\n export async function schema(): Promise<void> {\n if (MyGlobal.testing === false)\n throw new Error(\n \"Error on SetupWizard.schema(): unable to reset database in non-test mode.\",\n );\n const execute = (type: string) => (argv: string) =>\n cp.execSync(`npx prisma migrate ${type} --schema=prisma/schema ${argv}`, {\n stdio: \"ignore\",\n cwd: MyConfiguration.ROOT,\n });\n execute(\"reset\")(\"--force\");\n execute(\"dev\")(\"--name init\");\n }\n\n export async function seed(): Promise<void> {}\n}\n",
|
|
8
8
|
"src/util/toISOStringSafe.ts": "import { tags } from \"typia\";\n\n/**\n * Transforms a value that is either a Date or a string into an ISO 8601\n * formatted string. If it's already a string, it assumes it's already in ISO\n * format.\n */\nexport function toISOStringSafe(\n value: Date | (string & tags.Format<\"date-time\">),\n): string & tags.Format<\"date-time\"> {\n if (value instanceof Date) {\n return value.toISOString() as string & tags.Format<\"date-time\">;\n }\n return value;\n}\n",
|
|
9
9
|
"test/servant.ts": "import { DynamicExecutor } from \"@nestia/e2e\";\nimport { Driver, WorkerServer } from \"tgrid\";\n\nimport { MyBackend } from \"../src/MyBackend\";\nimport { MyGlobal } from \"../src/MyGlobal\";\nimport { IAutoBeRealizeTestConfig } from \"./autobe/compiler/IAutoBeRealizeTestConfig\";\nimport { IAutoBeRealizeTestListener } from \"./autobe/compiler/IAutoBeRealizeTestListener\";\nimport { IAutoBeRealizeTestOperation } from \"./autobe/compiler/IAutoBeRealizeTestOperation\";\nimport { IAutoBeRealizeTestResult } from \"./autobe/compiler/IAutoBeRealizeTestResult\";\nimport { IAutoBeRealizeTestService } from \"./autobe/compiler/IAutoBeRealizeTestService\";\nimport { TestAutomation } from \"./helpers/TestAutomation\";\n\nclass AutoBeRealizeTestService implements IAutoBeRealizeTestService {\n public constructor(\n private readonly listener: Driver<IAutoBeRealizeTestListener>,\n ) {}\n\n public async execute(\n config: IAutoBeRealizeTestConfig,\n ): Promise<IAutoBeRealizeTestResult> {\n const start: Date = new Date();\n const operations: IAutoBeRealizeTestOperation[] = [];\n await TestAutomation.execute({\n open: async (): Promise<MyBackend> => {\n const backend: MyBackend = new MyBackend();\n await backend.open();\n return backend;\n },\n close: (backend: MyBackend): Promise<void> => backend.close(),\n options: {\n reset: config.reset ?? true,\n simultaneous: config.simultaneous ?? 1,\n },\n onComplete: (exec: DynamicExecutor.IExecution): void => {\n const op: IAutoBeRealizeTestOperation = {\n name: exec.name,\n location: exec.location,\n value: exec.value,\n error: exec.error,\n started_at: exec.started_at,\n completed_at: exec.completed_at,\n };\n this.listener.onOperation(op).catch(() => {});\n operations.push(op);\n },\n onReset: (): void => {\n this.listener.onReset().catch(() => {});\n },\n });\n return {\n reset: config.reset ?? true,\n simultaneous: config.simultaneous ?? 1,\n operations,\n started_at: start.toISOString(),\n completed_at: new Date().toISOString(),\n };\n }\n}\n\nconst main = async (): Promise<void> => {\n const worker: WorkerServer<\n null,\n IAutoBeRealizeTestService,\n IAutoBeRealizeTestListener\n > = new WorkerServer();\n const listener: Driver<IAutoBeRealizeTestListener> = worker.getDriver();\n const service: AutoBeRealizeTestService = new AutoBeRealizeTestService(\n listener,\n );\n\n MyGlobal.testing = true;\n await worker.open(service);\n};\nmain().catch((error) => {\n console.log(error);\n process.exit(-1);\n});\n",
|
|
10
|
+
"tsconfig.json": "{\n \"compilerOptions\": {\n /* Visit https://aka.ms/tsconfig to read more about this file */\n\n /* Projects */\n // \"incremental\": true, /* Save .tsbuildinfo files to allow for incremental compilation of projects. */\n // \"composite\": true, /* Enable constraints that allow a TypeScript project to be used with project references. */\n // \"tsBuildInfoFile\": \"./.tsbuildinfo\", /* Specify the path to .tsbuildinfo incremental compilation file. */\n // \"disableSourceOfProjectReferenceRedirect\": true, /* Disable preferring source files instead of declaration files when referencing composite projects. */\n // \"disableSolutionSearching\": true, /* Opt a project out of multi-project reference checking when editing. */\n // \"disableReferencedProjectLoad\": true, /* Reduce the number of projects loaded automatically by TypeScript. */\n\n /* Language and Environment */\n \"target\": \"ES2015\", /* Set the JavaScript language version for emitted JavaScript and include compatible library declarations. */\n // \"lib\": [], /* Specify a set of bundled library declaration files that describe the target runtime environment. */\n // \"jsx\": \"preserve\", /* Specify what JSX code is generated. */\n \"experimentalDecorators\": true, /* Enable experimental support for TC39 stage 2 draft decorators. */\n \"emitDecoratorMetadata\": true, /* Emit design-type metadata for decorated declarations in source files. */\n // \"jsxFactory\": \"\", /* Specify the JSX factory function used when targeting React JSX emit, e.g. 'React.createElement' or 'h'. */\n // \"jsxFragmentFactory\": \"\", /* Specify the JSX Fragment reference used for fragments when targeting React JSX emit e.g. 'React.Fragment' or 'Fragment'. */\n // \"jsxImportSource\": \"\", /* Specify module specifier used to import the JSX factory functions when using 'jsx: react-jsx*'. */\n // \"reactNamespace\": \"\", /* Specify the object invoked for 'createElement'. This only applies when targeting 'react' JSX emit. */\n // \"noLib\": true, /* Disable including any library files, including the default lib.d.ts. */\n // \"useDefineForClassFields\": true, /* Emit ECMAScript-standard-compliant class fields. */\n // \"moduleDetection\": \"auto\", /* Control what method is used to detect module-format JS files. */\n\n /* Modules */\n \"module\": \"commonjs\", /* Specify what module code is generated. */\n // \"rootDir\": \"./\", /* Specify the root folder within your source files. */\n // \"moduleResolution\": \"node\", /* Specify how TypeScript looks up a file from a given module specifier. */\n // \"baseUrl\": \"./\", /* Specify the base directory to resolve non-relative module names. */\n \"paths\": {\n \"@ORGANIZATION/PROJECT-api/lib/*\": [\"./src/api/*\"],\n \"@ORGANIZATION/PROJECT-api\": [\"./src/api\"],\n }, /* Specify a set of entries that re-map imports to additional lookup locations. */\n // \"rootDirs\": [], /* Allow multiple folders to be treated as one when resolving modules. */\n // \"typeRoots\": [], /* Specify multiple folders that act like './node_modules/@types'. */\n // \"types\": [], /* Specify type package names to be included without being referenced in a source file. */\n // \"allowUmdGlobalAccess\": true, /* Allow accessing UMD globals from modules. */\n // \"moduleSuffixes\": [], /* List of file name suffixes to search when resolving a module. */\n // \"resolveJsonModule\": true, /* Enable importing .json files. */\n // \"noResolve\": true, /* Disallow 'import's, 'require's or '<reference>'s from expanding the number of files TypeScript should add to a project. */\n\n /* JavaScript Support */\n // \"allowJs\": true, /* Allow JavaScript files to be a part of your program. Use the 'checkJS' option to get errors from these files. */\n // \"checkJs\": true, /* Enable error reporting in type-checked JavaScript files. */\n // \"maxNodeModuleJsDepth\": 1, /* Specify the maximum folder depth used for checking JavaScript files from 'node_modules'. Only applicable with 'allowJs'. */\n\n /* Emit */\n // \"declaration\": true, /* Generate .d.ts files from TypeScript and JavaScript files in your project. */\n // \"declarationMap\": true, /* Create sourcemaps for d.ts files. */\n // \"emitDeclarationOnly\": true, /* Only output d.ts files and not JavaScript files. */\n \"sourceMap\": true, /* Create source map files for emitted JavaScript files. */\n // \"outFile\": \"./\", /* Specify a file that bundles all outputs into one JavaScript file. If 'declaration' is true, also designates a file that bundles all .d.ts output. */\n \"outDir\": \"./lib\", /* Specify an output folder for all emitted files. */\n // \"removeComments\": true, /* Disable emitting comments. */\n // \"noEmit\": true, /* Disable emitting files from a compilation. */\n // \"importHelpers\": true, /* Allow importing helper functions from tslib once per project, instead of including them per-file. */\n // \"importsNotUsedAsValues\": \"remove\", /* Specify emit/checking behavior for imports that are only used for types. */\n // \"downlevelIteration\": true, /* Emit more compliant, but verbose and less performant JavaScript for iteration. */\n // \"sourceRoot\": \"\", /* Specify the root path for debuggers to find the reference source code. */\n // \"mapRoot\": \"\", /* Specify the location where debugger should locate map files instead of generated locations. */\n // \"inlineSourceMap\": true, /* Include sourcemap files inside the emitted JavaScript. */\n // \"inlineSources\": true, /* Include source code in the sourcemaps inside the emitted JavaScript. */\n // \"emitBOM\": true, /* Emit a UTF-8 Byte Order Mark (BOM) in the beginning of output files. */\n \"newLine\": \"lf\", /* Set the newline character for emitting files. */\n \"stripInternal\": true, /* Disable emitting declarations that have '@internal' in their JSDoc comments. */\n // \"noEmitHelpers\": true, /* Disable generating custom helper functions like '__extends' in compiled output. */\n // \"noEmitOnError\": true, /* Disable emitting files if any type checking errors are reported. */\n // \"preserveConstEnums\": true, /* Disable erasing 'const enum' declarations in generated code. */\n // \"declarationDir\": \"./\", /* Specify the output directory for generated declaration files. */\n // \"preserveValueImports\": true, /* Preserve unused imported values in the JavaScript output that would otherwise be removed. */\n\n /* Interop Constraints */\n // \"isolatedModules\": true, /* Ensure that each file can be safely transpiled without relying on other imports. */\n // \"allowSyntheticDefaultImports\": true, /* Allow 'import x from y' when a module doesn't have a default export. */\n \"esModuleInterop\": true, /* Emit additional JavaScript to ease support for importing CommonJS modules. This enables 'allowSyntheticDefaultImports' for type compatibility. */\n // \"preserveSymlinks\": true, /* Disable resolving symlinks to their realpath. This correlates to the same flag in node. */\n \"forceConsistentCasingInFileNames\": true, /* Ensure that casing is correct in imports. */\n\n /* Type Checking */\n \"strict\": true, /* Enable all strict type-checking options. */\n // \"noImplicitAny\": true, /* Enable error reporting for expressions and declarations with an implied 'any' type. */\n // \"strictNullChecks\": true, /* When type checking, take into account 'null' and 'undefined'. */\n // \"strictFunctionTypes\": true, /* When assigning functions, check to ensure parameters and the return values are subtype-compatible. */\n // \"strictBindCallApply\": true, /* Check that the arguments for 'bind', 'call', and 'apply' methods match the original function. */\n // \"strictPropertyInitialization\": true, /* Check for class properties that are declared but not set in the constructor. */\n // \"noImplicitThis\": true, /* Enable error reporting when 'this' is given the type 'any'. */\n // \"useUnknownInCatchVariables\": true, /* Default catch clause variables as 'unknown' instead of 'any'. */\n // \"alwaysStrict\": true, /* Ensure 'use strict' is always emitted. */\n \"noUnusedLocals\": false, /* Enable error reporting when local variables aren't read. */\n \"noUnusedParameters\": false, /* Raise an error when a function parameter isn't read. */\n // \"exactOptionalPropertyTypes\": true, /* Interpret optional property types as written, rather than adding 'undefined'. */\n \"noImplicitReturns\": true, /* Enable error reporting for codepaths that do not explicitly return in a function. */\n \"noFallthroughCasesInSwitch\": true, /* Enable error reporting for fallthrough cases in switch statements. */\n // \"noUncheckedIndexedAccess\": true, /* Add 'undefined' to a type when accessed using an index. */\n // \"noImplicitOverride\": true, /* Ensure overriding members in derived classes are marked with an override modifier. */\n // \"noPropertyAccessFromIndexSignature\": true, /* Enforces using indexed accessors for keys declared using an indexed type. */\n // \"allowUnusedLabels\": true, /* Disable error reporting for unused labels. */\n // \"allowUnreachableCode\": true, /* Disable error reporting for unreachable code. */\n\n /* Completeness */\n // \"skipDefaultLibCheck\": true, /* Skip type checking .d.ts files that are included with TypeScript. */\n \"skipLibCheck\": true, /* Skip type checking all .d.ts files. */\n \"plugins\": [\n { \"transform\": \"typescript-transform-paths\" },\n { \"transform\": \"typia/lib/transform\" },\n { \n \"transform\": \"@nestia/core/lib/transform\",\n /**\n * Validate request body.\n * \n * - \"assert\": Use typia.assert() function\n * - \"is\": Use typia.is() function\n * - \"validate\": Use typia.validate() function\n * - \"assertEquals\": Use typia.assertEquals() function\n * - \"equals\": Use typia.equals() function\n * - \"validateEquals\": Use typia.validateEquals() function\n */\n \"validate\": \"validate\",\n /**\n * Validate JSON typed response body.\n * \n * - \"assert\": Use typia.assertStringify() function\n * - \"is\": Use typia.isStringify() function\n * - \"validate\": Use typia.validateStringify() function\n * - \"validate.log\": typia.validateStringify(), but do not throw and just log it\n * - \"stringify\": Use typia.stringify() function, but dangerous\n * - null: Just use JSON.stringify() function, without boosting\n */\n \"stringify\": \"assert\",\n },\n ]\n },\n \"include\": [\n \"src\"\n ],\n \"exclude\": [\n \"node_modules\",\n \"packages\",\n ]\n}\n",
|
|
10
11
|
"test/autobe/compiler/IAutoBeRealizeTestOperation.ts": "//---------------------------------------------------\n// Cloned from @autobe/interface\n//---------------------------------------------------\nimport { tags } from \"typia\";\n\n/**\n * Detailed result interface representing the execution outcome of an individual\n * E2E test function during comprehensive backend implementation validation.\n *\n * This interface captures comprehensive information about a single test\n * operation execution, including identification details, execution results,\n * error conditions, and precise timing data. Each operation represents the\n * validation of a specific API endpoint or business scenario through Test\n * agent-generated E2E test functions executed against the fully implemented\n * backend application.\n *\n * The operation result provides granular visibility into test execution\n * outcomes, enabling detailed analysis of implementation quality, business\n * logic compliance, and performance characteristics at the individual test\n * level. This detailed tracking supports comprehensive validation reporting and\n * precise identification of implementation issues when they occur.\n *\n * @author Samchon\n */\nexport interface IAutoBeRealizeTestOperation {\n /**\n * Unique identifier name of the executed E2E test function.\n *\n * Specifies the function name that was executed during this test operation,\n * typically corresponding to the Test agent-generated test function\n * identifier. This name provides direct traceability between test results and\n * the specific business scenarios, API endpoints, or validation logic being\n * tested.\n *\n * The test function name serves as the primary identifier for correlating\n * execution results with the original test scenarios, enabling stakeholders\n * to understand which specific functionality was validated and whether the\n * implementation correctly fulfills the intended business requirements and\n * API contracts.\n */\n name: string;\n\n /**\n * File system path location of the executed test function source code.\n *\n * Specifies the relative or absolute path to the test file that contains the\n * executed function within the project structure. This location information\n * enables direct navigation to the test source code for detailed analysis,\n * debugging, result interpretation, or modification purposes.\n *\n * The file location provides essential context for understanding test\n * organization, enables developers to quickly locate and examine the specific\n * test implementation, and supports comprehensive test suite maintenance and\n * documentation activities.\n */\n location: string;\n\n /**\n * Return value or result data produced by the test function execution.\n *\n * Contains the actual value returned by the test function upon completion,\n * regardless of whether execution succeeded or failed. This could include API\n * response objects, validation results, test data, computed values, or any\n * other output that the test function produces as part of its business logic\n * validation or endpoint testing.\n *\n * For successful test executions, this value represents the expected result\n * that demonstrates correct implementation behavior. The return value\n * provides insight into the test execution flow and can be analyzed to verify\n * that API responses match expected formats, business logic produces correct\n * outcomes, and data transformations operate as intended.\n */\n value: unknown;\n\n /**\n * Error information captured during test function execution, if any occurred.\n *\n * Contains detailed error information when the test function encounters\n * exceptions, assertion failures, timeout conditions, or other error states\n * during execution. When null, it indicates that the test completed\n * successfully without encountering any error conditions. When present, the\n * error provides comprehensive diagnostic information for understanding\n * implementation issues or test failures.\n *\n * Error information is crucial for identifying implementation defects, API\n * contract violations, business logic errors, integration failures, or\n * performance issues that prevent the backend application from meeting its\n * requirements. The error details enable developers to pinpoint specific\n * problems and implement necessary corrections to achieve full compliance\n * with validation scenarios.\n */\n error: null | unknown;\n\n /**\n * Precise timestamp when this specific test operation began execution.\n *\n * Records the exact moment when this individual test function started\n * execution, providing the reference point for measuring test duration and\n * understanding the temporal sequence of test operations within the overall\n * validation process. This timestamp enables detailed performance analysis\n * and execution timeline reconstruction.\n *\n * The start timestamp is essential for identifying execution patterns,\n * analyzing test concurrency behavior, measuring individual test performance,\n * and understanding the temporal distribution of test execution within the\n * comprehensive validation suite.\n */\n started_at: string & tags.Format<\"date-time\">;\n\n /**\n * Precise timestamp when this specific test operation finished execution.\n *\n * Records the exact moment when this individual test function completed\n * execution, regardless of whether it succeeded or failed. Combined with the\n * start timestamp, this enables precise calculation of test execution\n * duration and provides completion reference for the overall test timeline.\n *\n * The completion timestamp is valuable for performance analysis of individual\n * test operations, identifying slow-performing test scenarios, understanding\n * test execution efficiency, and maintaining comprehensive audit trails of\n * the validation process. It supports optimization efforts and helps identify\n * potential bottlenecks in either the test implementation or the backend\n * application being validated.\n */\n completed_at: string & tags.Format<\"date-time\">;\n}\n",
|
|
11
12
|
"test/autobe/compiler/IAutoBeRealizeTestConfig.ts": "//---------------------------------------------------\n// Cloned from @autobe/interface\n//---------------------------------------------------\n/**\n * Configuration interface defining the essential execution parameters required\n * for comprehensive E2E test suite validation against fully implemented backend\n * applications.\n *\n * This interface encapsulates the core execution settings and control\n * parameters necessary to orchestrate the final validation phase of the AutoBE\n * development pipeline. It provides streamlined configuration options that\n * control test execution behavior, database management, and performance\n * characteristics without requiring direct access to implementation files or\n * database schemas.\n *\n * The configuration assumes that the test execution environment has been\n * pre-configured with all necessary resources including generated\n * implementation files, database schemas, and package dependencies. This\n * interface focuses solely on runtime execution parameters that control how the\n * test suite operates within the prepared environment.\n *\n * This lightweight configuration approach enables flexible test execution\n * across different environments while maintaining clear separation between\n * resource provisioning and execution control, supporting both development and\n * production validation scenarios.\n *\n * @author Samchon\n */\nexport interface IAutoBeRealizeTestConfig {\n /**\n * Optional flag indicating whether to perform a complete database reset\n * before test execution.\n *\n * When true, specifies that the test execution should begin with a\n * comprehensive database reset, purging all existing data and reconstructing\n * tables to their initial schema-defined state. When false, test execution\n * proceeds with the current database state, which may contain residual data\n * from previous operations.\n *\n * Database reset is crucial for ensuring test isolation, reproducibility, and\n * deterministic results. Clean state testing eliminates interference from\n * residual data and guarantees that each test execution cycle operates under\n * identical baseline conditions, enabling accurate validation of backend\n * implementation behavior.\n *\n * @default true\n */\n reset?: boolean;\n\n /**\n * Optional specification of the maximum number of test functions to execute\n * concurrently during the test suite run.\n *\n * Defines the concurrent execution limit for E2E test functions to optimize\n * testing performance while maintaining system stability and resource\n * management. This value balances test execution speed with resource\n * consumption and helps prevent system overload during comprehensive\n * validation.\n *\n * Concurrent execution significantly reduces total testing time for large\n * test suites while validating the backend application's ability to handle\n * parallel requests correctly. The simultaneous limit ensures controlled load\n * conditions that provide meaningful performance insights while maintaining\n * test reliability and result accuracy.\n *\n * @default 1\n */\n simultaneous?: number;\n}\n",
|
|
12
13
|
"test/autobe/compiler/IAutoBeRealizeTestResult.ts": "//---------------------------------------------------\n// Cloned from @autobe/interface\n//---------------------------------------------------\nimport { tags } from \"typia\";\n\nimport { IAutoBeRealizeTestOperation } from \"./IAutoBeRealizeTestOperation\";\n\n/**\n * Comprehensive result interface containing complete information about E2E test\n * suite execution for backend implementation validation.\n *\n * This interface represents the final consolidated results of executing the\n * entire Test agent-generated E2E test suite against the fully implemented\n * backend application. It encapsulates all aspects of the test execution\n * process including configuration parameters, individual operation results, and\n * timing information that collectively determine the validation outcome of the\n * generated backend implementation.\n *\n * The result structure provides stakeholders with comprehensive visibility into\n * the validation process, enabling detailed analysis of backend implementation\n * quality, compliance with requirements, and production readiness assessment\n * based on exhaustive functional testing.\n *\n * @author Samchon\n */\nexport interface IAutoBeRealizeTestResult {\n /**\n * Whether the test execution included a clean database reset before testing.\n *\n * Indicates if the test suite execution began with a complete database reset\n * to ensure clean testing conditions. When true, all existing data was purged\n * and database tables were reconstructed to their initial state before test\n * execution commenced, guaranteeing test isolation and reproducibility.\n *\n * Database reset is essential for ensuring that test results are\n * deterministic and accurately reflect the application's behavior under\n * controlled conditions, free from interference by residual data from\n * previous executions or development activities. This flag helps stakeholders\n * understand the testing conditions and trust the reliability of results.\n */\n reset: boolean;\n\n /**\n * Number of test functions that were executed simultaneously during the test\n * suite run.\n *\n * Specifies the concurrent execution limit that was applied during E2E test\n * function execution to optimize testing performance while maintaining system\n * stability. This value represents the balance between test execution speed\n * and resource consumption that was used to validate the backend\n * implementation's ability to handle concurrent requests.\n *\n * The simultaneous execution count provides insight into the load conditions\n * under which the backend application was validated, helping stakeholders\n * understand the concurrency testing coverage and the application's\n * performance characteristics under parallel request scenarios.\n */\n simultaneous: number;\n\n /**\n * Complete collection of individual test operation results with detailed\n * execution information.\n *\n * Contains the comprehensive array of {@link IAutoBeRealizeTestOperation}\n * results representing every E2E test function that was executed during the\n * validation process. Each operation result includes detailed information\n * about test execution outcomes, return values, error conditions, timing\n * data, and validation status for specific API endpoints or business\n * scenarios.\n *\n * This complete result set enables stakeholders to perform detailed analysis\n * of which functionality passed validation, which tests failed, what specific\n * issues were encountered, and how the backend implementation performs under\n * various test scenarios. The operation results serve as the authoritative\n * record of implementation quality and compliance with established\n * requirements.\n */\n operations: IAutoBeRealizeTestOperation[];\n\n /**\n * Timestamp when the comprehensive test suite execution was initiated.\n *\n * Records the exact moment when the E2E test suite execution began, marking\n * the start of the final validation phase in the AutoBE development pipeline.\n * This timestamp provides the reference point for understanding the complete\n * test execution timeline and measuring the duration of comprehensive backend\n * validation.\n *\n * The start timestamp is essential for performance analysis of the entire\n * validation process, enabling stakeholders to understand test execution\n * efficiency and identify potential optimization opportunities in the testing\n * infrastructure or backend implementation.\n */\n started_at: string & tags.Format<\"date-time\">;\n\n /**\n * Timestamp when the entire test suite execution was finalized.\n *\n * Records the exact moment when all planned E2E test operations finished\n * execution, marking the completion of the comprehensive validation process.\n * This timestamp represents the definitive end point of the AutoBE\n * development pipeline validation phase and provides the completion reference\n * for calculating total validation duration.\n *\n * The completion timestamp serves as the official validation completion\n * marker for stakeholders tracking project delivery milestones and provides\n * essential audit trail information for the complete development and\n * validation cycle. Combined with the start timestamp, it enables precise\n * measurement of the total time required for comprehensive backend\n * validation.\n */\n completed_at: string & tags.Format<\"date-time\">;\n}\n",
|
|
@@ -1,5 +1,5 @@
|
|
|
1
1
|
export const AutoBeCompilerTestTemplate: Record<string, string> = {
|
|
2
|
-
"package.json": "{\n \"private\": true,\n \"name\": \"@ORGANIZATION/PROJECT\",\n \"version\": \"0.1.0\",\n \"description\": \"Starter kit of Nestia\",\n \"main\": \"lib/index.js\",\n \"scripts\": {\n \"benchmark\": \"node bin/test/benchmark\",\n \"test\": \"node bin/test\",\n \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------BUILDS------------------------\": \"\",\n \"build\": \"npm run build:sdk && npm run build:main && npm run build:test\",\n \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n \"build:swagger\": \"npx nestia swagger\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n \"prepare\": \"ts-patch install && ts-node build/env.ts\",\n \"prettier\": \"prettier src --write && prettier test --write\",\n \"------------------------WEBPACK------------------------\": \"\",\n \"webpack\": \"rimraf dist && webpack\",\n \"webpack:start\": \"cd dist && node dist/server\",\n \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------DEPLOYS------------------------\": \"\",\n \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n \"start\": \"node lib/executable/server\",\n \"start:dev\": \"nest start --watch\",\n \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia-start\"\n },\n \"keywords\": [\n \"nestia\",\n \"template\",\n \"boilerplate\"\n ],\n \"author\": \"AUTHOR\",\n \"license\": \"AGPL-3.0\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia-start/issues\"\n },\n \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n \"devDependencies\": {\n \"@nestia/benchmark\": \"^7.
|
|
2
|
+
"package.json": "{\n \"private\": true,\n \"name\": \"@ORGANIZATION/PROJECT\",\n \"version\": \"0.1.0\",\n \"description\": \"Starter kit of Nestia\",\n \"main\": \"lib/index.js\",\n \"scripts\": {\n \"benchmark\": \"node bin/test/benchmark\",\n \"test\": \"node bin/test\",\n \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------BUILDS------------------------\": \"\",\n \"build\": \"npm run build:sdk && npm run build:main && npm run build:test\",\n \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n \"build:swagger\": \"npx nestia swagger\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n \"prepare\": \"ts-patch install && ts-node build/env.ts\",\n \"prettier\": \"prettier src --write && prettier test --write\",\n \"------------------------WEBPACK------------------------\": \"\",\n \"webpack\": \"rimraf dist && webpack\",\n \"webpack:start\": \"cd dist && node dist/server\",\n \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n \"------------------------DEPLOYS------------------------\": \"\",\n \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n \"start\": \"node lib/executable/server\",\n \"start:dev\": \"nest start --watch\",\n \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia-start\"\n },\n \"keywords\": [\n \"nestia\",\n \"template\",\n \"boilerplate\"\n ],\n \"author\": \"AUTHOR\",\n \"license\": \"AGPL-3.0\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia-start/issues\"\n },\n \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n \"devDependencies\": {\n \"@nestia/benchmark\": \"^7.4.0\",\n \"@nestia/e2e\": \"^7.4.0\",\n \"@nestia/sdk\": \"^7.4.0\",\n \"@nestjs/cli\": \"^11.0.7\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^11.1.6\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/cli\": \"^0.11.21\",\n \"@types/cli-progress\": \"^3.11.5\",\n \"@types/express\": \"^4.17.21\",\n \"@types/inquirer\": \"^8.2.5\",\n \"@types/node\": \"^18.11.0\",\n \"@types/uuid\": \"^8.3.4\",\n \"@typescript-eslint/eslint-plugin\": \"^8.1.0\",\n \"@typescript-eslint/parser\": \"^8.1.0\",\n \"chalk\": \"^4.1.2\",\n \"cli\": \"^1.0.1\",\n \"cli-progress\": \"^3.12.0\",\n \"copy-webpack-plugin\": \"^11.0.0\",\n \"eslint-plugin-deprecation\": \"^3.0.0\",\n \"express\": \"^4.18.2\",\n \"nestia\": \"^7.4.0\",\n \"prettier\": \"^3.2.4\",\n \"prettier-plugin-prisma\": \"^5.0.0\",\n \"prisma-markdown\": \"^3.0.1\",\n \"rimraf\": \"^3.0.2\",\n \"rollup\": \"^4.18.0\",\n \"source-map-support\": \"^0.5.21\",\n \"swagger-ui-express\": \"^5.0.0\",\n \"ts-loader\": \"^9.5.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.5.5\",\n \"webpack\": \"^5.89.0\",\n \"webpack-cli\": \"^5.1.4\",\n \"write-file-webpack-plugin\": \"^4.5.1\"\n },\n \"dependencies\": {\n \"@nestia/core\": \"^7.4.0\",\n \"@nestia/fetcher\": \"^7.4.0\",\n \"@nestjs/common\": \"^11.1.3\",\n \"@nestjs/core\": \"^11.1.3\",\n \"@nestjs/platform-express\": \"^11.1.3\",\n \"@prisma/client\": \"^6.11.1\",\n \"commander\": \"10.0.0\",\n \"dotenv\": \"^16.3.1\",\n \"dotenv-expand\": \"^10.0.0\",\n \"inquirer\": \"8.2.5\",\n \"prisma\": \"^6.11.1\",\n \"serialize-error\": \"^4.1.0\",\n \"tgrid\": \"^1.1.0\",\n \"tstl\": \"^3.0.0\",\n \"typia\": \"^9.7.1\",\n \"uuid\": \"^9.0.0\"\n },\n \"stackblitz\": {\n \"startCommand\": \"npm run prepare && npm run build:test && npm run test -- --simultaneous 1\"\n }\n}\n",
|
|
3
3
|
"src/setup/MySetupWizard.ts": "export namespace MySetupWizard {\n export async function schema(): Promise<void> {\n console.log(\"Realize agent has not generated main program yet.\");\n }\n\n export async function seed(): Promise<void> {}\n}\n",
|
|
4
4
|
"test/helpers/TestAutomation.ts": "import api from \"@ORGANIZATION/PROJECT-api\";\nimport { DynamicExecutor } from \"@nestia/e2e\";\nimport { sleep_for } from \"tstl\";\n\nimport { MyConfiguration } from \"../../src/MyConfiguration\";\nimport { MySetupWizard } from \"../../src/setup/MySetupWizard\";\n\nexport namespace TestAutomation {\n export interface IProps<T> {\n open(options: IOptions): Promise<T>;\n close(backend: T): Promise<void>;\n onComplete(exec: DynamicExecutor.IExecution): void;\n onReset(): void;\n options: IOptions;\n }\n\n export interface IOptions {\n reset: boolean;\n simultaneous: number;\n include?: string[];\n exclude?: string[];\n }\n\n export const execute = async <T>(\n props: IProps<T>,\n ): Promise<DynamicExecutor.IReport> => {\n // RESET\n if (props.options.reset === true) {\n await MySetupWizard.schema();\n await MySetupWizard.seed();\n await props.onReset();\n }\n\n // OPEN BACKEND\n const backend: T = await props.open(props.options);\n const connection: api.IConnection = {\n host: `http://127.0.0.1:${MyConfiguration.API_PORT()}`,\n };\n\n // DO TEST\n const report: DynamicExecutor.IReport = await DynamicExecutor.validate({\n prefix: \"test\",\n location: __dirname + \"/../features\",\n parameters: () => [\n {\n host: connection.host,\n } satisfies api.IConnection,\n ],\n filter: (func) =>\n (!props.options.include?.length ||\n (props.options.include ?? []).some((str) => func.includes(str))) &&\n (!props.options.exclude?.length ||\n (props.options.exclude ?? []).every((str) => !func.includes(str))),\n onComplete: props.onComplete,\n simultaneous: props.options.simultaneous,\n extension: __filename.split(\".\").pop()!,\n });\n\n // TERMINATE\n await sleep_for(2500);\n await props.close(backend);\n return report;\n };\n}\n",
|
|
5
5
|
"test/helpers/TestAutomationStdio.ts": "import { DynamicExecutor } from \"@nestia/e2e\";\nimport chalk from \"chalk\";\n\nimport { ArgumentParser } from \"./ArgumentParser\";\nimport { TestAutomation } from \"./TestAutomation\";\n\nexport namespace TestAutomationStdio {\n export const getOptions = () =>\n ArgumentParser.parse<TestAutomation.IOptions>(\n async (command, prompt, action) => {\n command.option(\"--reset <true|false>\", \"reset local DB or not\");\n command.option(\n \"--simultaneous <number>\",\n \"number of simultaneous requests\",\n );\n command.option(\"--include <string...>\", \"include feature files\");\n command.option(\"--exclude <string...>\", \"exclude feature files\");\n\n return action(async (options) => {\n // reset\n if (typeof options.reset === \"string\")\n options.reset = options.reset === \"true\";\n options.reset ??= await prompt.boolean(\"reset\")(\"Reset local DB\");\n\n // simultaneous\n options.simultaneous = Number(\n options.simultaneous ??\n (await prompt.number(\"simultaneous\")(\n \"Number of simultaneous requests to make\",\n )),\n );\n if (isNaN(options.simultaneous) || options.simultaneous <= 0)\n options.simultaneous = 1;\n return options as TestAutomation.IOptions;\n });\n },\n );\n\n export const onComplete = (exec: DynamicExecutor.IExecution): void => {\n const trace = (str: string) =>\n console.log(` - ${chalk.green(exec.name)}: ${str}`);\n if (exec.error === null) {\n const elapsed: number =\n new Date(exec.completed_at).getTime() -\n new Date(exec.started_at).getTime();\n trace(`${chalk.yellow(elapsed.toLocaleString())} ms`);\n } else trace(chalk.red(exec.error.name));\n };\n\n export const onReset = (start: Date) => (): void => {\n const now: Date = new Date();\n console.log(\n ` - Reset DB: ${(now.getDate() - start.getDate()).toLocaleString()} ms`,\n );\n };\n\n export const report = (report: DynamicExecutor.IReport): void => {\n const exceptions: Error[] = report.executions\n .filter((exec) => exec.error !== null)\n .map((exec) => exec.error!);\n if (exceptions.length === 0) {\n console.log(\"Success\");\n console.log(\"Elapsed time\", report.time.toLocaleString(), `ms`);\n } else {\n for (const exp of exceptions) console.log(exp);\n console.log(\"Failed\");\n console.log(\"Elapsed time\", report.time.toLocaleString(), `ms`);\n process.exit(-1);\n }\n };\n}\n",
|
package/src/raw/nestjs.json
CHANGED
|
@@ -11602,7 +11602,7 @@
|
|
|
11602
11602
|
"node_modules/@nestia/benchmark/lib/internal/DynamicBenchmarkReporter.d.ts": "import { DynamicBenchmarker } from \"../DynamicBenchmarker\";\nexport declare namespace DynamicBenchmarkReporter {\n const markdown: (report: DynamicBenchmarker.IReport) => string;\n}\n",
|
|
11603
11603
|
"node_modules/@nestia/benchmark/lib/internal/IBenchmarkMaster.d.ts": "export interface IBenchmarkMaster {\n filter: (name: string) => boolean;\n progress: (current: number) => void;\n}\n",
|
|
11604
11604
|
"node_modules/@nestia/benchmark/lib/internal/IBenchmarkServant.d.ts": "import { IBenchmarkEvent } from \"../IBenchmarkEvent\";\nexport interface IBenchmarkServant {\n execute(props: {\n count: number;\n simultaneous: number;\n }): Promise<IBenchmarkEvent[]>;\n}\n",
|
|
11605
|
-
"node_modules/@nestia/benchmark/package.json": "{\n \"name\": \"@nestia/benchmark\",\n \"version\": \"7.
|
|
11605
|
+
"node_modules/@nestia/benchmark/package.json": "{\n \"name\": \"@nestia/benchmark\",\n \"version\": \"7.4.0\",\n \"description\": \"NestJS Performance Benchmark Program\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"npm run build:main && npm run build:test\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"prepare\": \"ts-patch install\",\n \"test\": \"node bin/test\"\n },\n \"keywords\": [\n \"e2e\",\n \"nestia\",\n \"nestjs\",\n \"Performance\",\n \"benchmark\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"dependencies\": {\n \"@nestia/fetcher\": \"^7.4.0\",\n \"tgrid\": \"^1.1.0\",\n \"tstl\": \"^3.0.0\"\n },\n \"devDependencies\": {\n \"@nestia/core\": \"^7.4.0\",\n \"@nestia/e2e\": \"^7.4.0\",\n \"@nestia/sdk\": \"^7.4.0\",\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@nestjs/platform-express\": \"^11.0.13\",\n \"@types/uuid\": \"^10.0.0\",\n \"nestia\": \"workspace:^\",\n \"ts-node\": \"^10.9.2\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.7\",\n \"typia\": \"^9.6.1\",\n \"uuid\": \"^10.0.0\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
|
|
11606
11606
|
"node_modules/@nestia/core/lib/adaptors/WebSocketAdaptor.d.ts": "import { INestApplication } from \"@nestjs/common\";\nexport declare class WebSocketAdaptor {\n static upgrade(app: INestApplication): Promise<WebSocketAdaptor>;\n readonly close: () => Promise<void>;\n private constructor();\n private readonly handleUpgrade;\n private readonly http;\n private readonly operators;\n private readonly ws;\n}\n",
|
|
11607
11607
|
"node_modules/@nestia/core/lib/decorators/DynamicModule.d.ts": "import { ModuleMetadata } from \"@nestjs/common/interfaces\";\n/**\n * Dynamic module.\n *\n * `DynamicModule` is a namespace wrapping a convenient function, which can load\n * controller classes dynamically just by specifying their directory path.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace DynamicModule {\n /**\n * Mount dynamic module.\n *\n * Constructs a module instance with directory path of controller classes.\n *\n * Every controller classes in the target directory would be dynamically\n * mounted.\n *\n * @param path Path of controllers\n * @param metadata Additional metadata except controllers\n * @returns Module instance\n */\n function mount(path: string | string[] | {\n include: string[];\n exclude?: string[];\n }, metadata?: Omit<ModuleMetadata, \"controllers\">, isTsNode?: boolean): Promise<{\n new (): {};\n }>;\n}\n",
|
|
11608
11608
|
"node_modules/@nestia/core/lib/decorators/EncryptedBody.d.ts": "import { IRequestBodyValidator } from \"../options/IRequestBodyValidator\";\n/**\n * Encrypted body decorator.\n *\n * `EncryptedBody` is a decorator function getting `application/json` typed data\n * from request body which has been encrypted by AES-128/256 algorithm. Also,\n * `EncryptedBody` validates the request body data type through\n * [typia](https://github.com/samchon/typia) ad the validation speed is maximum\n * 15,000x times faster than `class-validator`.\n *\n * For reference, when the request body data is not following the promised type\n * `T`, `BadRequestException` error (status code: 400) would be thrown. Also,\n * `EncryptedRoute` decrypts request body using those options.\n *\n * - AES-128/256\n * - CBC mode\n * - PKCS #5 Padding\n * - Base64 Encoding\n *\n * @author Jeongho Nam - https://github.com/samchon\n * @returns Parameter decorator\n */\nexport declare function EncryptedBody<T>(validator?: IRequestBodyValidator<T>): ParameterDecorator;\n",
|
|
@@ -11702,7 +11702,7 @@
|
|
|
11702
11702
|
"node_modules/minimatch/dist/esm/index.d.ts": "import { AST } from './ast.js';\ntype Platform = 'aix' | 'android' | 'darwin' | 'freebsd' | 'haiku' | 'linux' | 'openbsd' | 'sunos' | 'win32' | 'cygwin' | 'netbsd';\nexport interface MinimatchOptions {\n nobrace?: boolean;\n nocomment?: boolean;\n nonegate?: boolean;\n debug?: boolean;\n noglobstar?: boolean;\n noext?: boolean;\n nonull?: boolean;\n windowsPathsNoEscape?: boolean;\n allowWindowsEscape?: boolean;\n partial?: boolean;\n dot?: boolean;\n nocase?: boolean;\n nocaseMagicOnly?: boolean;\n magicalBraces?: boolean;\n matchBase?: boolean;\n flipNegate?: boolean;\n preserveMultipleSlashes?: boolean;\n optimizationLevel?: number;\n platform?: Platform;\n windowsNoMagicRoot?: boolean;\n}\nexport declare const minimatch: {\n (p: string, pattern: string, options?: MinimatchOptions): boolean;\n sep: Sep;\n GLOBSTAR: typeof GLOBSTAR;\n filter: (pattern: string, options?: MinimatchOptions) => (p: string) => boolean;\n defaults: (def: MinimatchOptions) => typeof minimatch;\n braceExpand: (pattern: string, options?: MinimatchOptions) => string[];\n makeRe: (pattern: string, options?: MinimatchOptions) => false | MMRegExp;\n match: (list: string[], pattern: string, options?: MinimatchOptions) => string[];\n AST: typeof AST;\n Minimatch: typeof Minimatch;\n escape: (s: string, { windowsPathsNoEscape, }?: Pick<MinimatchOptions, \"windowsPathsNoEscape\">) => string;\n unescape: (s: string, { windowsPathsNoEscape, }?: Pick<MinimatchOptions, \"windowsPathsNoEscape\">) => string;\n};\ntype Sep = '\\\\' | '/';\nexport declare const sep: Sep;\nexport declare const GLOBSTAR: unique symbol;\nexport declare const filter: (pattern: string, options?: MinimatchOptions) => (p: string) => boolean;\nexport declare const defaults: (def: MinimatchOptions) => typeof minimatch;\nexport declare const braceExpand: (pattern: string, options?: MinimatchOptions) => string[];\nexport declare const makeRe: (pattern: string, options?: MinimatchOptions) => false | MMRegExp;\nexport declare const match: (list: string[], pattern: string, options?: MinimatchOptions) => string[];\nexport type MMRegExp = RegExp & {\n _src?: string;\n _glob?: string;\n};\nexport type ParseReturnFiltered = string | MMRegExp | typeof GLOBSTAR;\nexport type ParseReturn = ParseReturnFiltered | false;\nexport declare class Minimatch {\n options: MinimatchOptions;\n set: ParseReturnFiltered[][];\n pattern: string;\n windowsPathsNoEscape: boolean;\n nonegate: boolean;\n negate: boolean;\n comment: boolean;\n empty: boolean;\n preserveMultipleSlashes: boolean;\n partial: boolean;\n globSet: string[];\n globParts: string[][];\n nocase: boolean;\n isWindows: boolean;\n platform: Platform;\n windowsNoMagicRoot: boolean;\n regexp: false | null | MMRegExp;\n constructor(pattern: string, options?: MinimatchOptions);\n hasMagic(): boolean;\n debug(..._: any[]): void;\n make(): void;\n preprocess(globParts: string[][]): string[][];\n adjascentGlobstarOptimize(globParts: string[][]): string[][];\n levelOneOptimize(globParts: string[][]): string[][];\n levelTwoFileOptimize(parts: string | string[]): string[];\n firstPhasePreProcess(globParts: string[][]): string[][];\n secondPhasePreProcess(globParts: string[][]): string[][];\n partsMatch(a: string[], b: string[], emptyGSMatch?: boolean): false | string[];\n parseNegate(): void;\n matchOne(file: string[], pattern: ParseReturn[], partial?: boolean): boolean;\n braceExpand(): string[];\n parse(pattern: string): ParseReturn;\n makeRe(): false | MMRegExp;\n slashSplit(p: string): string[];\n match(f: string, partial?: boolean): boolean;\n static defaults(def: MinimatchOptions): typeof Minimatch;\n}\nexport { AST } from './ast.js';\nexport { escape } from './escape.js';\nexport { unescape } from './unescape.js';\n//# sourceMappingURL=index.d.ts.map",
|
|
11703
11703
|
"node_modules/minimatch/dist/esm/unescape.d.ts": "import { MinimatchOptions } from './index.js';\n/**\n * Un-escape a string that has been escaped with {@link escape}.\n *\n * If the {@link windowsPathsNoEscape} option is used, then square-brace\n * escapes are removed, but not backslash escapes. For example, it will turn\n * the string `'[*]'` into `*`, but it will not turn `'\\\\*'` into `'*'`,\n * becuase `\\` is a path separator in `windowsPathsNoEscape` mode.\n *\n * When `windowsPathsNoEscape` is not set, then both brace escapes and\n * backslash escapes are removed.\n *\n * Slashes (and backslashes in `windowsPathsNoEscape` mode) cannot be escaped\n * or unescaped.\n */\nexport declare const unescape: (s: string, { windowsPathsNoEscape, }?: Pick<MinimatchOptions, \"windowsPathsNoEscape\">) => string;\n//# sourceMappingURL=unescape.d.ts.map",
|
|
11704
11704
|
"node_modules/minimatch/package.json": "{\n \"author\": \"Isaac Z. Schlueter <i@izs.me> (http://blog.izs.me)\",\n \"name\": \"minimatch\",\n \"description\": \"a glob matcher in javascript\",\n \"version\": \"3.1.2\",\n \"publishConfig\": {\n \"tag\": \"v3-legacy\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"git://github.com/isaacs/minimatch.git\"\n },\n \"main\": \"minimatch.js\",\n \"scripts\": {\n \"test\": \"tap\",\n \"preversion\": \"npm test\",\n \"postversion\": \"npm publish\",\n \"postpublish\": \"git push origin --all; git push origin --tags\"\n },\n \"engines\": {\n \"node\": \"*\"\n },\n \"dependencies\": {\n \"brace-expansion\": \"^1.1.7\"\n },\n \"devDependencies\": {\n \"tap\": \"^15.1.6\"\n },\n \"license\": \"ISC\",\n \"files\": [\n \"minimatch.js\"\n ]\n}\n",
|
|
11705
|
-
"node_modules/@nestia/core/package.json": "{\n \"name\": \"@nestia/core\",\n \"version\": \"7.
|
|
11705
|
+
"node_modules/@nestia/core/package.json": "{\n \"name\": \"@nestia/core\",\n \"version\": \"7.4.0\",\n \"description\": \"Super-fast validation decorators of NestJS\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"tsp\": {\n \"tscOptions\": {\n \"parseAllJsDoc\": true\n }\n },\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint ./**/*.ts\",\n \"eslint:fix\": \"eslint ./**/*.ts --fix\",\n \"prepare\": \"ts-patch install && typia patch\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestjs\",\n \"nestia\",\n \"typia\",\n \"validator\",\n \"decorator\",\n \"class-validator\",\n \"class-transformer\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@nestia/fetcher\": \"^7.4.0\",\n \"@nestjs/common\": \">=7.0.1\",\n \"@nestjs/core\": \">=7.0.1\",\n \"@samchon/openapi\": \"^4.5.0\",\n \"detect-ts-node\": \"^1.0.5\",\n \"get-function-location\": \"^2.0.0\",\n \"glob\": \"^11.0.3\",\n \"path-parser\": \"^6.1.0\",\n \"raw-body\": \"^2.0.0\",\n \"reflect-metadata\": \">=0.1.12\",\n \"rxjs\": \">=6.0.3\",\n \"tgrid\": \"^1.1.0\",\n \"typia\": \"^9.6.1\",\n \"ws\": \"^7.5.3\"\n },\n \"peerDependencies\": {\n \"@nestia/fetcher\": \">=7.4.0\",\n \"@nestjs/common\": \">=7.0.1\",\n \"@nestjs/core\": \">=7.0.1\",\n \"@samchon/openapi\": \">=4.5.0 <5.0.0\",\n \"reflect-metadata\": \">=0.1.12\",\n \"rxjs\": \">=6.0.3\",\n \"typia\": \"^9.6.1\"\n },\n \"devDependencies\": {\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@types/express\": \"^4.17.15\",\n \"@types/inquirer\": \"^9.0.3\",\n \"@types/multer\": \"^1.4.12\",\n \"@types/ts-expose-internals\": \"npm:ts-expose-internals@5.4.5\",\n \"@types/ws\": \"^8.5.10\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"commander\": \"^10.0.0\",\n \"comment-json\": \"^4.2.3\",\n \"eslint-plugin-deprecation\": \"^1.4.1\",\n \"fastify\": \"^4.28.1\",\n \"git-last-commit\": \"^1.0.1\",\n \"inquirer\": \"^8.2.5\",\n \"rimraf\": \"^6.0.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"tstl\": \"^3.0.0\",\n \"typescript\": \"~5.9.2\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"lib\",\n \"src\"\n ]\n}",
|
|
11706
11706
|
"node_modules/@nestia/core/src/typings/get-function-location.d.ts": "declare module \"get-function-location\" {\n export default function (func: any): Promise<{\n source: string;\n line: number;\n column: number;\n }>;\n}\n",
|
|
11707
11707
|
"node_modules/@nestia/core/node_modules/glob/dist/commonjs/glob.d.ts": "import { Minimatch } from 'minimatch';\nimport { Minipass } from 'minipass';\nimport { FSOption, Path, PathScurry } from 'path-scurry';\nimport { IgnoreLike } from './ignore.js';\nimport { Pattern } from './pattern.js';\nexport type MatchSet = Minimatch['set'];\nexport type GlobParts = Exclude<Minimatch['globParts'], undefined>;\n/**\n * A `GlobOptions` object may be provided to any of the exported methods, and\n * must be provided to the `Glob` constructor.\n *\n * All options are optional, boolean, and false by default, unless otherwise\n * noted.\n *\n * All resolved options are added to the Glob object as properties.\n *\n * If you are running many `glob` operations, you can pass a Glob object as the\n * `options` argument to a subsequent operation to share the previously loaded\n * cache.\n */\nexport interface GlobOptions {\n /**\n * Set to `true` to always receive absolute paths for\n * matched files. Set to `false` to always return relative paths.\n *\n * When this option is not set, absolute paths are returned for patterns\n * that are absolute, and otherwise paths are returned that are relative\n * to the `cwd` setting.\n *\n * This does _not_ make an extra system call to get\n * the realpath, it only does string path resolution.\n *\n * Conflicts with {@link withFileTypes}\n */\n absolute?: boolean;\n /**\n * Set to false to enable {@link windowsPathsNoEscape}\n *\n * @deprecated\n */\n allowWindowsEscape?: boolean;\n /**\n * The current working directory in which to search. Defaults to\n * `process.cwd()`.\n *\n * May be eiher a string path or a `file://` URL object or string.\n */\n cwd?: string | URL;\n /**\n * Include `.dot` files in normal matches and `globstar`\n * matches. Note that an explicit dot in a portion of the pattern\n * will always match dot files.\n */\n dot?: boolean;\n /**\n * Prepend all relative path strings with `./` (or `.\\` on Windows).\n *\n * Without this option, returned relative paths are \"bare\", so instead of\n * returning `'./foo/bar'`, they are returned as `'foo/bar'`.\n *\n * Relative patterns starting with `'../'` are not prepended with `./`, even\n * if this option is set.\n */\n dotRelative?: boolean;\n /**\n * Follow symlinked directories when expanding `**`\n * patterns. This can result in a lot of duplicate references in\n * the presence of cyclic links, and make performance quite bad.\n *\n * By default, a `**` in a pattern will follow 1 symbolic link if\n * it is not the first item in the pattern, or none if it is the\n * first item in the pattern, following the same behavior as Bash.\n */\n follow?: boolean;\n /**\n * string or string[], or an object with `ignored` and `childrenIgnored`\n * methods.\n *\n * If a string or string[] is provided, then this is treated as a glob\n * pattern or array of glob patterns to exclude from matches. To ignore all\n * children within a directory, as well as the entry itself, append `'/**'`\n * to the ignore pattern.\n *\n * **Note** `ignore` patterns are _always_ in `dot:true` mode, regardless of\n * any other settings.\n *\n * If an object is provided that has `ignored(path)` and/or\n * `childrenIgnored(path)` methods, then these methods will be called to\n * determine whether any Path is a match or if its children should be\n * traversed, respectively.\n */\n ignore?: string | string[] | IgnoreLike;\n /**\n * Treat brace expansion like `{a,b}` as a \"magic\" pattern. Has no\n * effect if {@link nobrace} is set.\n *\n * Only has effect on the {@link hasMagic} function.\n */\n magicalBraces?: boolean;\n /**\n * Add a `/` character to directory matches. Note that this requires\n * additional stat calls in some cases.\n */\n mark?: boolean;\n /**\n * Perform a basename-only match if the pattern does not contain any slash\n * characters. That is, `*.js` would be treated as equivalent to\n * `**\\/*.js`, matching all js files in all directories.\n */\n matchBase?: boolean;\n /**\n * Limit the directory traversal to a given depth below the cwd.\n * Note that this does NOT prevent traversal to sibling folders,\n * root patterns, and so on. It only limits the maximum folder depth\n * that the walk will descend, relative to the cwd.\n */\n maxDepth?: number;\n /**\n * Do not expand `{a,b}` and `{1..3}` brace sets.\n */\n nobrace?: boolean;\n /**\n * Perform a case-insensitive match. This defaults to `true` on macOS and\n * Windows systems, and `false` on all others.\n *\n * **Note** `nocase` should only be explicitly set when it is\n * known that the filesystem's case sensitivity differs from the\n * platform default. If set `true` on case-sensitive file\n * systems, or `false` on case-insensitive file systems, then the\n * walk may return more or less results than expected.\n */\n nocase?: boolean;\n /**\n * Do not match directories, only files. (Note: to match\n * _only_ directories, put a `/` at the end of the pattern.)\n */\n nodir?: boolean;\n /**\n * Do not match \"extglob\" patterns such as `+(a|b)`.\n */\n noext?: boolean;\n /**\n * Do not match `**` against multiple filenames. (Ie, treat it as a normal\n * `*` instead.)\n *\n * Conflicts with {@link matchBase}\n */\n noglobstar?: boolean;\n /**\n * Defaults to value of `process.platform` if available, or `'linux'` if\n * not. Setting `platform:'win32'` on non-Windows systems may cause strange\n * behavior.\n */\n platform?: NodeJS.Platform;\n /**\n * Set to true to call `fs.realpath` on all of the\n * results. In the case of an entry that cannot be resolved, the\n * entry is omitted. This incurs a slight performance penalty, of\n * course, because of the added system calls.\n */\n realpath?: boolean;\n /**\n *\n * A string path resolved against the `cwd` option, which\n * is used as the starting point for absolute patterns that start\n * with `/`, (but not drive letters or UNC paths on Windows).\n *\n * Note that this _doesn't_ necessarily limit the walk to the\n * `root` directory, and doesn't affect the cwd starting point for\n * non-absolute patterns. A pattern containing `..` will still be\n * able to traverse out of the root directory, if it is not an\n * actual root directory on the filesystem, and any non-absolute\n * patterns will be matched in the `cwd`. For example, the\n * pattern `/../*` with `{root:'/some/path'}` will return all\n * files in `/some`, not all files in `/some/path`. The pattern\n * `*` with `{root:'/some/path'}` will return all the entries in\n * the cwd, not the entries in `/some/path`.\n *\n * To start absolute and non-absolute patterns in the same\n * path, you can use `{root:''}`. However, be aware that on\n * Windows systems, a pattern like `x:/*` or `//host/share/*` will\n * _always_ start in the `x:/` or `//host/share` directory,\n * regardless of the `root` setting.\n */\n root?: string;\n /**\n * A [PathScurry](http://npm.im/path-scurry) object used\n * to traverse the file system. If the `nocase` option is set\n * explicitly, then any provided `scurry` object must match this\n * setting.\n */\n scurry?: PathScurry;\n /**\n * Call `lstat()` on all entries, whether required or not to determine\n * if it's a valid match. When used with {@link withFileTypes}, this means\n * that matches will include data such as modified time, permissions, and\n * so on. Note that this will incur a performance cost due to the added\n * system calls.\n */\n stat?: boolean;\n /**\n * An AbortSignal which will cancel the Glob walk when\n * triggered.\n */\n signal?: AbortSignal;\n /**\n * Use `\\\\` as a path separator _only_, and\n * _never_ as an escape character. If set, all `\\\\` characters are\n * replaced with `/` in the pattern.\n *\n * Note that this makes it **impossible** to match against paths\n * containing literal glob pattern characters, but allows matching\n * with patterns constructed using `path.join()` and\n * `path.resolve()` on Windows platforms, mimicking the (buggy!)\n * behavior of Glob v7 and before on Windows. Please use with\n * caution, and be mindful of [the caveat below about Windows\n * paths](#windows). (For legacy reasons, this is also set if\n * `allowWindowsEscape` is set to the exact value `false`.)\n */\n windowsPathsNoEscape?: boolean;\n /**\n * Return [PathScurry](http://npm.im/path-scurry)\n * `Path` objects instead of strings. These are similar to a\n * NodeJS `Dirent` object, but with additional methods and\n * properties.\n *\n * Conflicts with {@link absolute}\n */\n withFileTypes?: boolean;\n /**\n * An fs implementation to override some or all of the defaults. See\n * http://npm.im/path-scurry for details about what can be overridden.\n */\n fs?: FSOption;\n /**\n * Just passed along to Minimatch. Note that this makes all pattern\n * matching operations slower and *extremely* noisy.\n */\n debug?: boolean;\n /**\n * Return `/` delimited paths, even on Windows.\n *\n * On posix systems, this has no effect. But, on Windows, it means that\n * paths will be `/` delimited, and absolute paths will be their full\n * resolved UNC forms, eg instead of `'C:\\\\foo\\\\bar'`, it would return\n * `'//?/C:/foo/bar'`\n */\n posix?: boolean;\n /**\n * Do not match any children of any matches. For example, the pattern\n * `**\\/foo` would match `a/foo`, but not `a/foo/b/foo` in this mode.\n *\n * This is especially useful for cases like \"find all `node_modules`\n * folders, but not the ones in `node_modules`\".\n *\n * In order to support this, the `Ignore` implementation must support an\n * `add(pattern: string)` method. If using the default `Ignore` class, then\n * this is fine, but if this is set to `false`, and a custom `Ignore` is\n * provided that does not have an `add()` method, then it will throw an\n * error.\n *\n * **Caveat** It *only* ignores matches that would be a descendant of a\n * previous match, and only if that descendant is matched *after* the\n * ancestor is encountered. Since the file system walk happens in\n * indeterminate order, it's possible that a match will already be added\n * before its ancestor, if multiple or braced patterns are used.\n *\n * For example:\n *\n * ```ts\n * const results = await glob([\n * // likely to match first, since it's just a stat\n * 'a/b/c/d/e/f',\n *\n * // this pattern is more complicated! It must to various readdir()\n * // calls and test the results against a regular expression, and that\n * // is certainly going to take a little bit longer.\n * //\n * // So, later on, it encounters a match at 'a/b/c/d/e', but it's too\n * // late to ignore a/b/c/d/e/f, because it's already been emitted.\n * 'a/[bdf]/?/[a-z]/*',\n * ], { includeChildMatches: false })\n * ```\n *\n * It's best to only set this to `false` if you can be reasonably sure that\n * no components of the pattern will potentially match one another's file\n * system descendants, or if the occasional included child entry will not\n * cause problems.\n *\n * @default true\n */\n includeChildMatches?: boolean;\n}\nexport type GlobOptionsWithFileTypesTrue = GlobOptions & {\n withFileTypes: true;\n absolute?: undefined;\n mark?: undefined;\n posix?: undefined;\n};\nexport type GlobOptionsWithFileTypesFalse = GlobOptions & {\n withFileTypes?: false;\n};\nexport type GlobOptionsWithFileTypesUnset = GlobOptions & {\n withFileTypes?: undefined;\n};\nexport type Result<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? Path : Opts extends GlobOptionsWithFileTypesFalse ? string : Opts extends GlobOptionsWithFileTypesUnset ? string : string | Path;\nexport type Results<Opts> = Result<Opts>[];\nexport type FileTypes<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? true : Opts extends GlobOptionsWithFileTypesFalse ? false : Opts extends GlobOptionsWithFileTypesUnset ? false : boolean;\n/**\n * An object that can perform glob pattern traversals.\n */\nexport declare class Glob<Opts extends GlobOptions> implements GlobOptions {\n absolute?: boolean;\n cwd: string;\n root?: string;\n dot: boolean;\n dotRelative: boolean;\n follow: boolean;\n ignore?: string | string[] | IgnoreLike;\n magicalBraces: boolean;\n mark?: boolean;\n matchBase: boolean;\n maxDepth: number;\n nobrace: boolean;\n nocase: boolean;\n nodir: boolean;\n noext: boolean;\n noglobstar: boolean;\n pattern: string[];\n platform: NodeJS.Platform;\n realpath: boolean;\n scurry: PathScurry;\n stat: boolean;\n signal?: AbortSignal;\n windowsPathsNoEscape: boolean;\n withFileTypes: FileTypes<Opts>;\n includeChildMatches: boolean;\n /**\n * The options provided to the constructor.\n */\n opts: Opts;\n /**\n * An array of parsed immutable {@link Pattern} objects.\n */\n patterns: Pattern[];\n /**\n * All options are stored as properties on the `Glob` object.\n *\n * See {@link GlobOptions} for full options descriptions.\n *\n * Note that a previous `Glob` object can be passed as the\n * `GlobOptions` to another `Glob` instantiation to re-use settings\n * and caches with a new pattern.\n *\n * Traversal functions can be called multiple times to run the walk\n * again.\n */\n constructor(pattern: string | string[], opts: Opts);\n /**\n * Returns a Promise that resolves to the results array.\n */\n walk(): Promise<Results<Opts>>;\n /**\n * synchronous {@link Glob.walk}\n */\n walkSync(): Results<Opts>;\n /**\n * Stream results asynchronously.\n */\n stream(): Minipass<Result<Opts>, Result<Opts>>;\n /**\n * Stream results synchronously.\n */\n streamSync(): Minipass<Result<Opts>, Result<Opts>>;\n /**\n * Default sync iteration function. Returns a Generator that\n * iterates over the results.\n */\n iterateSync(): Generator<Result<Opts>, void, void>;\n [Symbol.iterator](): Generator<Result<Opts>, void, void>;\n /**\n * Default async iteration function. Returns an AsyncGenerator that\n * iterates over the results.\n */\n iterate(): AsyncGenerator<Result<Opts>, void, void>;\n [Symbol.asyncIterator](): AsyncGenerator<Result<Opts>, void, void>;\n}\n//# sourceMappingURL=glob.d.ts.map",
|
|
11708
11708
|
"node_modules/@nestia/core/node_modules/glob/dist/commonjs/has-magic.d.ts": "import { GlobOptions } from './glob.js';\n/**\n * Return true if the patterns provided contain any magic glob characters,\n * given the options provided.\n *\n * Brace expansion is not considered \"magic\" unless the `magicalBraces` option\n * is set, as brace expansion just turns one string into an array of strings.\n * So a pattern like `'x{a,b}y'` would return `false`, because `'xay'` and\n * `'xby'` both do not contain any magic glob characters, and it's treated the\n * same as if you had called it on `['xay', 'xby']`. When `magicalBraces:true`\n * is in the options, brace expansion _is_ treated as a pattern having magic.\n */\nexport declare const hasMagic: (pattern: string | string[], options?: GlobOptions) => boolean;\n//# sourceMappingURL=has-magic.d.ts.map",
|
|
@@ -11740,7 +11740,7 @@
|
|
|
11740
11740
|
"node_modules/@nestia/e2e/lib/index.d.ts": "import * as e2e from \"./module\";\nexport default e2e;\nexport * from \"./module\";\n",
|
|
11741
11741
|
"node_modules/@nestia/e2e/lib/internal/json_equal_to.d.ts": "export declare const json_equal_to: (exception: (key: string) => boolean) => <T>(x: T) => (y: T | null | undefined) => string[];\n",
|
|
11742
11742
|
"node_modules/@nestia/e2e/lib/module.d.ts": "export * from \"./ArrayUtil\";\nexport * from \"./DynamicExecutor\";\nexport * from \"./GaffComparator\";\nexport * from \"./RandomGenerator\";\nexport * from \"./TestValidator\";\n",
|
|
11743
|
-
"node_modules/@nestia/e2e/package.json": "{\n \"name\": \"@nestia/e2e\",\n \"version\": \"7.
|
|
11743
|
+
"node_modules/@nestia/e2e/package.json": "{\n \"name\": \"@nestia/e2e\",\n \"version\": \"7.4.0\",\n \"description\": \"E2E test utilify functions\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"npm run build:main && npm run build:test\",\n \"build:main\": \"rimraf lib && tsc\",\n \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n \"dev\": \"npm run build:test -- --watch\",\n \"eslint\": \"eslint src && eslint test\",\n \"prepare\": \"ts-patch install && typia patch\",\n \"test\": \"node bin/test\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"e2e\",\n \"nestia\",\n \"nestjs\",\n \"test\",\n \"tdd\",\n \"utility\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"devDependencies\": {\n \"@trivago/prettier-plugin-sort-imports\": \"^4.0.0\",\n \"@types/node\": \"^18.11.18\",\n \"@typescript-eslint/eslint-plugin\": \"^5.57.0\",\n \"@typescript-eslint/parser\": \"^5.57.0\",\n \"rimraf\": \"^6.0.1\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.7\",\n \"typia\": \"^9.6.1\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
|
|
11744
11744
|
"node_modules/@nestia/editor/lib/NestiaEditorApplication.d.ts": "export declare function NestiaEditorApplication(): import(\"react/jsx-runtime\").JSX.Element;\n",
|
|
11745
11745
|
"node_modules/@nestia/editor/lib/NestiaEditorIframe.d.ts": "import { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nexport declare function NestiaEditorIframe(props: NestiaEditorIframe.IProps): import(\"react/jsx-runtime\").JSX.Element;\nexport declare namespace NestiaEditorIframe {\n interface IProps {\n swagger: string | SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument;\n package?: string;\n keyword?: boolean;\n simulate?: boolean;\n e2e?: boolean;\n }\n}\n",
|
|
11746
11746
|
"node_modules/@nestia/editor/lib/NestiaEditorModule.d.ts": "import type { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nexport declare namespace NestiaEditorModule {\n const setup: (props: {\n path: string;\n application: INestApplication;\n swagger: string | SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument;\n package?: string;\n simulate?: boolean;\n e2e?: boolean;\n }) => Promise<void>;\n}\ninterface INestApplication {\n use(...args: any[]): this;\n getUrl(): Promise<string>;\n getHttpAdapter(): INestHttpAdaptor;\n setGlobalPrefix(prefix: string, options?: any): this;\n}\ninterface INestHttpAdaptor {\n getType(): string;\n close(): any;\n init?(): Promise<void>;\n get: Function;\n post: Function;\n put: Function;\n patch: Function;\n delete: Function;\n head: Function;\n all: Function;\n}\nexport {};\n",
|
|
@@ -11749,7 +11749,7 @@
|
|
|
11749
11749
|
"node_modules/@nestia/editor/lib/internal/NestiaEditorComposer.d.ts": "import { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nimport { IValidation } from \"typia\";\nexport declare namespace NestiaEditorComposer {\n interface IProps {\n document: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument;\n e2e: boolean;\n keyword: boolean;\n simulate: boolean;\n package?: string;\n }\n interface IOutput {\n files: Record<string, string>;\n openFile: string;\n startScript: string[];\n }\n const nest: (props: IProps) => Promise<IValidation<IOutput>>;\n const sdk: (props: IProps) => Promise<IValidation<IOutput>>;\n}\n",
|
|
11750
11750
|
"node_modules/@nestia/editor/lib/internal/NestiaEditorFileUploader.d.ts": "import { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nexport declare function NestiaEditorFileUploader(props: NestiaEditorFileUploader.IProps): import(\"react/jsx-runtime\").JSX.Element;\nexport declare namespace NestiaEditorFileUploader {\n interface IProps {\n onChange: (swagger: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument | null, error: string | null) => void;\n }\n}\n",
|
|
11751
11751
|
"node_modules/@nestia/editor/lib/main.d.ts": "export {};\n",
|
|
11752
|
-
"node_modules/@nestia/editor/package.json": "{\n \"name\": \"@nestia/editor\",\n \"version\": \"7.
|
|
11752
|
+
"node_modules/@nestia/editor/package.json": "{\n \"name\": \"@nestia/editor\",\n \"version\": \"7.4.0\",\n \"main\": \"lib/index.js\",\n \"module\": \"lib/index.mjs\",\n \"typings\": \"lib/index.d.ts\",\n \"description\": \"Swagger-UI + Cloud TypeScript Editor\",\n \"scripts\": {\n \"build\": \"npm run build:static && npm run build:lib\",\n \"build:static\": \"rimraf dist && tsc -b && vite build\",\n \"build:lib\": \"rimraf lib && tsc --project tsconfig.lib.json && rollup -c\",\n \"dev\": \"vite\",\n \"lint\": \"eslint .\",\n \"preview\": \"vite preview\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"openapi\",\n \"swagger\",\n \"generator\",\n \"cloud\",\n \"typescript\",\n \"editor\",\n \"sdk\",\n \"nestjs\",\n \"nestia\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@mui/material\": \"^5.15.6\",\n \"@nestia/migrate\": \"^7.4.0\",\n \"@samchon/openapi\": \"^4.5.0\",\n \"@stackblitz/sdk\": \"^1.11.0\",\n \"@trivago/prettier-plugin-sort-imports\": \"^5.2.2\",\n \"js-yaml\": \"^4.1.0\",\n \"prettier\": \"3.3.3\",\n \"prettier-plugin-jsdoc\": \"^1.3.2\",\n \"react-mui-fileuploader\": \"^0.5.2\",\n \"typia\": \"^9.6.1\"\n },\n \"devDependencies\": {\n \"@eslint/js\": \"^9.13.0\",\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@nestjs/platform-express\": \"^11.0.13\",\n \"@nestjs/platform-fastify\": \"^11.0.13\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^12.1.1\",\n \"@types/js-yaml\": \"^4.0.9\",\n \"@types/node\": \"^22.8.6\",\n \"@types/react\": \"^18.3.11\",\n \"@types/react-dom\": \"^18.3.1\",\n \"@vitejs/plugin-react\": \"^4.3.3\",\n \"eslint\": \"^9.13.0\",\n \"eslint-plugin-react-hooks\": \"^5.0.0\",\n \"eslint-plugin-react-refresh\": \"^0.4.13\",\n \"globals\": \"^15.11.0\",\n \"react\": \"^18.3.1\",\n \"react-dom\": \"^18.3.1\",\n \"rollup\": \"^4.24.2\",\n \"ts-node\": \"^10.9.2\",\n \"typescript\": \"~5.9.2\",\n \"typescript-eslint\": \"^8.10.0\",\n \"vite\": \"^5.4.9\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"dist\",\n \"lib\",\n \"src\"\n ]\n}",
|
|
11753
11753
|
"node_modules/@nestia/editor/src/vite-env.d.ts": "/// <reference types=\"vite/client\" />\n",
|
|
11754
11754
|
"node_modules/@nestia/fetcher/lib/AesPkcs5.d.ts": "/**\n * Utility class for the AES-128/256 encryption.\n *\n * - AES-128/256\n * - CBC mode\n * - PKCS#5 Padding\n * - Base64 Encoding\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace AesPkcs5 {\n /**\n * Encrypt data\n *\n * @param data Target data\n * @param key Key value of the encryption.\n * @param iv Initializer Vector for the encryption\n * @returns Encrypted data\n */\n function encrypt(data: string, key: string, iv: string): string;\n /**\n * Decrypt data.\n *\n * @param data Target data\n * @param key Key value of the decryption.\n * @param iv Initializer Vector for the decryption\n * @returns Decrypted data.\n */\n function decrypt(data: string, key: string, iv: string): string;\n}\n",
|
|
11755
11755
|
"node_modules/@nestia/fetcher/lib/EncryptedFetcher.d.ts": "import { IConnection } from \"./IConnection\";\nimport { IFetchRoute } from \"./IFetchRoute\";\nimport { IPropagation } from \"./IPropagation\";\n/**\n * Utility class for `fetch` functions used in `@nestia/sdk` with encryption.\n *\n * `EncryptedFetcher` is a utility class designed for SDK functions generated by\n * [`@nestia/sdk`](https://nestia.io/docs/sdk/sdk), interacting with the remote\n * HTTP API encrypted by AES-PKCS algorithm. In other words, this is a\n * collection of dedicated `fetch()` functions for `@nestia/sdk` with\n * encryption.\n *\n * For reference, `EncryptedFetcher` class being used only when target\n * controller method is encrypting body data by `@EncryptedRoute` or\n * `@EncryptedBody` decorators. If those decorators are not used,\n * {@link PlainFetcher} class would be used instead.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace EncryptedFetcher {\n /**\n * Fetch function only for `HEAD` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Nothing because of `HEAD` method\n */\n function fetch(connection: IConnection, route: IFetchRoute<\"HEAD\">): Promise<void>;\n /**\n * Fetch function only for `GET` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Output>(connection: IConnection, route: IFetchRoute<\"GET\">): Promise<Output>;\n /**\n * Fetch function for the `POST`, `PUT`, `PATCH` and `DELETE` methods.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Input, Output>(connection: IConnection, route: IFetchRoute<\"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n function propagate<Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"GET\" | \"HEAD\">): Promise<Output>;\n function propagate<Input, Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"DELETE\" | \"GET\" | \"HEAD\" | \"PATCH\" | \"POST\" | \"PUT\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n}\n",
|
|
@@ -11765,7 +11765,7 @@
|
|
|
11765
11765
|
"node_modules/@nestia/fetcher/lib/PlainFetcher.d.ts": "import { IConnection } from \"./IConnection\";\nimport { IFetchRoute } from \"./IFetchRoute\";\nimport { IPropagation } from \"./IPropagation\";\n/**\n * Utility class for `fetch` functions used in `@nestia/sdk`.\n *\n * `PlainFetcher` is a utility class designed for SDK functions generated by\n * [`@nestia/sdk`](https://nestia.io/docs/sdk/sdk), interacting with the remote\n * HTTP sever API. In other words, this is a collection of dedicated `fetch()`\n * functions for `@nestia/sdk`.\n *\n * For reference, `PlainFetcher` class does not encrypt or decrypt the body data\n * at all. It just delivers plain data without any post processing. If you've\n * defined a controller method through `@EncryptedRoute` or `@EncryptedBody`\n * decorator, then {@liink EncryptedFetcher} class would be used instead.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace PlainFetcher {\n /**\n * Fetch function only for `HEAD` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Nothing because of `HEAD` method\n */\n function fetch(connection: IConnection, route: IFetchRoute<\"HEAD\">): Promise<void>;\n /**\n * Fetch function only for `GET` method.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Output>(connection: IConnection, route: IFetchRoute<\"GET\">): Promise<Output>;\n /**\n * Fetch function for the `POST`, `PUT`, `PATCH` and `DELETE` methods.\n *\n * @param connection Connection information for the remote HTTP server\n * @param route Route information about the target API\n * @returns Response body data from the remote API\n */\n function fetch<Input, Output>(connection: IConnection, route: IFetchRoute<\"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n function propagate<Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"GET\" | \"HEAD\">): Promise<Output>;\n function propagate<Input, Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"DELETE\" | \"GET\" | \"HEAD\" | \"PATCH\" | \"POST\" | \"PUT\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n}\n",
|
|
11766
11766
|
"node_modules/@nestia/fetcher/lib/index.d.ts": "export * from \"./FormDataInput\";\nexport * from \"./HttpError\";\nexport * from \"./IConnection\";\nexport * from \"./IEncryptionPassword\";\nexport * from \"./IFetchEvent\";\nexport * from \"./IFetchRoute\";\nexport * from \"./IPropagation\";\n",
|
|
11767
11767
|
"node_modules/@nestia/fetcher/lib/internal/FetcherBase.d.ts": "export {};\n",
|
|
11768
|
-
"node_modules/@nestia/fetcher/package.json": "{\n \"name\": \"@nestia/fetcher\",\n \"version\": \"7.
|
|
11768
|
+
"node_modules/@nestia/fetcher/package.json": "{\n \"name\": \"@nestia/fetcher\",\n \"version\": \"7.4.0\",\n \"description\": \"Fetcher library of Nestia SDK\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint src\",\n \"eslint:fix\": \"eslint src --fix\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestia\",\n \"fetcher\",\n \"sdk\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@samchon/openapi\": \"^4.5.0\"\n },\n \"devDependencies\": {\n \"@types/node\": \"^18.11.14\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"rimraf\": \"^6.0.1\",\n \"typescript\": \"~5.9.2\"\n },\n \"files\": [\n \"README.md\",\n \"LICENSE\",\n \"package.json\",\n \"lib\",\n \"src\"\n ]\n}",
|
|
11769
11769
|
"node_modules/@nestia/migrate/lib/NestiaMigrateApplication.d.ts": "import { IHttpMigrateApplication, OpenApi, OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nimport { IValidation } from \"typia\";\nimport { INestiaMigrateConfig } from \"./structures/INestiaMigrateConfig\";\nimport { INestiaMigrateContext } from \"./structures/INestiaMigrateContext\";\nimport { INestiaMigrateFile } from \"./structures/INestiaMigrateFile\";\nexport declare class NestiaMigrateApplication {\n readonly document: OpenApi.IDocument;\n private readonly data_;\n constructor(document: OpenApi.IDocument);\n static assert(document: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument | OpenApi.IDocument): NestiaMigrateApplication;\n static validate(document: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument | OpenApi.IDocument): IValidation<NestiaMigrateApplication>;\n getData(): IHttpMigrateApplication;\n /** @deprecated */\n getErrors(): IHttpMigrateApplication.IError[];\n nest(config: INestiaMigrateConfig): Record<string, string>;\n sdk(config: INestiaMigrateConfig): Record<string, string>;\n}\nexport declare namespace MigrateApplication {\n interface IOutput {\n context: INestiaMigrateContext;\n files: INestiaMigrateFile[];\n errors: IHttpMigrateApplication.IError[];\n }\n}\n",
|
|
11770
11770
|
"node_modules/@nestia/migrate/lib/analyzers/NestiaMigrateControllerAnalyzer.d.ts": "import { IHttpMigrateRoute } from \"@samchon/openapi\";\nimport { INestiaMigrateController } from \"../structures/INestiaMigrateController\";\nexport declare namespace NestiaMigrateControllerAnalyzer {\n const analyze: (routes: IHttpMigrateRoute[]) => INestiaMigrateController[];\n}\n",
|
|
11771
11771
|
"node_modules/@nestia/migrate/lib/archivers/NestiaMigrateFileArchiver.d.ts": "export declare namespace NestiaMigrateFileArchiver {\n const archive: (props: {\n mkdir: (path: string) => Promise<void>;\n writeFile: (path: string, content: string) => Promise<void>;\n root: string;\n files: Record<string, string>;\n }) => Promise<void>;\n}\n",
|
|
@@ -11806,7 +11806,7 @@
|
|
|
11806
11806
|
"node_modules/@nestia/migrate/lib/utils/StringUtil.d.ts": "export declare namespace StringUtil {\n const capitalize: (str: string) => string;\n const splitWithNormalization: (path: string) => string[];\n const escapeDuplicate: (keep: string[]) => (change: string) => string;\n const escapeNonVariable: (str: string) => string;\n}\n",
|
|
11807
11807
|
"node_modules/@nestia/migrate/lib/utils/openapi-down-convert/RefVisitor.d.ts": "/**\n * Recursively walk a JSON object and invoke a callback function on each `{\n * \"$ref\" : \"path\" }` object found\n */\n/**\n * Represents a JSON Reference object, such as `{\"$ref\":\n * \"#/components/schemas/problemResponse\" }`\n */\nexport interface RefObject {\n $ref: string;\n}\n/** JsonNode represents a node within the OpenAPI object */\nexport type JsonNode = object | [] | string | boolean | null | number;\n/** A JSON Schema object in an API def */\nexport type SchemaObject = object;\n/** Function signature for the visitRefObjects callback */\nexport type RefVisitor = (node: RefObject) => JsonNode;\n/** Function signature for the visitSchemaObjects callback */\nexport type SchemaVisitor = (node: SchemaObject) => SchemaObject;\n/** /** Function signature for the walkObject callback */\nexport type ObjectVisitor = (node: object) => JsonNode;\n/** Test if a JSON node is a `{ $ref: \"uri\" }` object */\nexport declare function isRef(node: any): boolean;\n/**\n * Walk a JSON object and apply `schemaCallback` when a JSON schema is found.\n * JSON Schema objects are items in components/schemas or in an item named\n * `schema`\n *\n * @param node A node in the OpenAPI document\n * @param schemaCallback The function to call on JSON schema objects\n * @returns The modified (annotated) node\n */\nexport declare function visitSchemaObjects(node: any, schemaCallback: SchemaVisitor): any;\n/**\n * Walk a JSON object and apply `refCallback` when a JSON `{$ref: url }` is\n * found\n *\n * @param node A node in the OpenAPI document\n * @param refCallback The function to call on JSON `$ref` objects\n * @returns The modified (annotated) node\n */\nexport declare function visitRefObjects(node: any, refCallback: RefVisitor): any;\n/**\n * Walk a JSON object or array and apply objectCallback when a JSON object is\n * found\n *\n * @param node A node in the OpenAPI document\n * @param objectCallback The function to call on JSON objects\n * @param nav Tracks where we are in the original document\n * @returns The modified (annotated) node\n */\nexport declare function walkObject(node: object, objectCallback: ObjectVisitor): JsonNode;\n",
|
|
11808
11808
|
"node_modules/@nestia/migrate/lib/utils/openapi-down-convert/converter.d.ts": "/** Options for the converter instantiation */\nexport interface ConverterOptions {\n /** If `true`, log conversion transformations to stderr */\n verbose?: boolean;\n /**\n * If `true`, remove `id` values in schema examples, to bypass [Spectral issue\n * 2081](https://github.com/stoplightio/spectral/issues/2081)\n */\n deleteExampleWithId?: boolean;\n /** If `true`, replace a `$ref` object that has siblings into an `allOf` */\n allOfTransform?: boolean;\n /** The authorizationUrl for openIdConnect -> oauth2 transformation */\n authorizationUrl?: string;\n /** The tokenUrl for openIdConnect -> oauth2 transformation */\n tokenUrl?: string;\n /**\n * Name of YAML/JSON file with scope descriptions. This is a simple map in the\n * format `{ scope1: \"description of scope1\", ... }`\n */\n scopeDescriptionFile?: string;\n /**\n * Earlier versions of the tool converted $comment to x-comment in JSON\n * Schemas. The tool now deletes $comment values by default. Use this option\n * to preserve the conversion and not delete comments.\n */\n convertSchemaComments?: boolean;\n}\nexport declare class Converter {\n private openapi30;\n private verbose;\n private deleteExampleWithId;\n private allOfTransform;\n private authorizationUrl;\n /** The tokenUrl for openIdConnect -> oauth2 transformation */\n private tokenUrl;\n private scopeDescriptions;\n private convertSchemaComments;\n private returnCode;\n /**\n * Construct a new Converter\n *\n * @throws Error if the scopeDescriptionFile (if specified) cannot be read or\n * parsed as YAML/JSON\n */\n constructor(openapiDocument: object, options?: ConverterOptions);\n /**\n * Load the scopes.yaml file and save in this.scopeDescriptions\n *\n * @throws Error if the file cannot be read or parsed as YAML/JSON\n */\n private loadScopeDescriptions;\n /**\n * Log a message to console.warn stream if verbose is true\n *\n * @param message Parameters for console.warn\n */\n private log;\n /**\n * Log a message to console.warn stream. Prefix the message string with\n * `Warning: ` if it does not already have that text.\n *\n * @param message Parameters for console.warn\n */\n private warn;\n /**\n * Log an error message to `console.error` stream. Prefix the message string\n * with `Error: ` if it does not already start with `'Error'`. Increments the\n * `returnCode`, causing the CLI to throw an Error when done.\n *\n * @param message Parameters for `console.error`\n */\n private error;\n /**\n * Convert the OpenAPI document to 3.0\n *\n * @returns The converted document. The input is not modified.\n */\n convert(): object;\n /**\n * OpenAPI 3.1 uses JSON Schema 2020-12 which allows schema `examples`;\n * OpenAPI 3.0 uses JSON Scheme Draft 7 which only allows `example`. Replace\n * all `examples` with `example`, using `examples[0]`\n */\n convertJsonSchemaExamples(): void;\n private walkNestedSchemaObjects;\n /**\n * OpenAPI 3.1 uses JSON Schema 2020-12 which allows `const` OpenAPI 3.0 uses\n * JSON Scheme Draft 7 which only allows `enum`. Replace all `const: value`\n * with `enum: [ value ]`\n */\n convertConstToEnum(): void;\n /**\n * Convert 2-element type arrays containing 'null' to string type and\n * `nullable: true`\n */\n convertNullableTypeArray(): void;\n removeWebhooksObject(): void;\n removeUnsupportedSchemaKeywords(): void;\n renameSchema$comment(): void;\n private deleteSchema$comment;\n /**\n * Convert\n *\n * contentMediaType: \"application/octet-stream\";\n *\n * To\n *\n * format: binary;\n *\n * In `type: string` schemas. Warn if schema has a `format` already and it is\n * not `binary`.\n */\n convertJsonSchemaContentMediaType(): void;\n /**\n * Convert\n *\n * contentEncoding: base64;\n *\n * To\n *\n * format: byte;\n *\n * In `type: string` schemas. It is an error if the schema has a `format`\n * already and it is not `byte`.\n */\n convertJsonSchemaContentEncoding(): void;\n private json;\n /**\n * OpenAPI 3.1 defines a new `openIdConnect` security scheme. Down-convert the\n * scheme to `oauth2` / authorization code flow. Collect all the scopes used\n * in any security requirements within operations and add them to the scheme.\n * Also define the URLs to the `authorizationUrl` and `tokenUrl` of `oauth2`.\n */\n convertSecuritySchemes(): void;\n /**\n * Find remaining OpenAPI 3.0 [Reference\n * Objects](https://github.com/OAI/OpenAPI-Specification/blob/main/versions/3.1.0.md#referenceObject)\n * and down convert them to [JSON\n * Reference](https://tools.ietf.org/html/draft-pbryan-zyp-json-ref-03)\n * objects with _only_ a `$ref` property.\n */\n simplifyNonSchemaRef(): void;\n removeLicenseIdentifier(): void;\n convertSchemaRef(): void;\n static deepClone(obj: object): object;\n}\n",
|
|
11809
|
-
"node_modules/@nestia/migrate/package.json": "{\n \"name\": \"@nestia/migrate\",\n \"version\": \"7.
|
|
11809
|
+
"node_modules/@nestia/migrate/package.json": "{\n \"name\": \"@nestia/migrate\",\n \"version\": \"7.4.0\",\n \"description\": \"Migration program from swagger to NestJS\",\n \"typings\": \"lib/index.d.ts\",\n \"main\": \"lib/index.js\",\n \"module\": \"lib/index.mjs\",\n \"bin\": {\n \"@nestia/migrate\": \"lib/executable/migrate.js\"\n },\n \"scripts\": {\n \"build\": \"rimraf lib && tsc && rollup -c\",\n \"bundle\": \"node src/executable/bundle.js\",\n \"dev\": \"rimraf lib && tsc --watch\",\n \"package:next\": \"npm publish --access public --tag next\",\n \"prepare\": \"ts-patch install && typia patch && npm run bundle\",\n \"test\": \"node lib/test\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"migration\",\n \"swagger\",\n \"openapi generator\",\n \"NestJS\",\n \"nestia\",\n \"SDK\",\n \"RPC\",\n \"Mockup Simulator\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"devDependencies\": {\n \"@nestia/benchmark\": \"^7.4.0\",\n \"@nestia/core\": \"^7.4.0\",\n \"@nestia/e2e\": \"^7.4.0\",\n \"@nestia/fetcher\": \"^7.4.0\",\n \"@nestia/sdk\": \"^7.4.0\",\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@nestjs/platform-express\": \"^11.0.13\",\n \"@nestjs/platform-fastify\": \"^11.0.13\",\n \"@rollup/plugin-terser\": \"^0.4.4\",\n \"@rollup/plugin-typescript\": \"^12.1.1\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/cli-progress\": \"^3.11.5\",\n \"@types/express\": \"^4.17.21\",\n \"@types/inquirer\": \"^9.0.7\",\n \"@types/multer\": \"^1.4.12\",\n \"@types/node\": \"^20.3.3\",\n \"@types/swagger-ui-express\": \"^4.1.6\",\n \"chalk\": \"4.1.2\",\n \"cli-progress\": \"^3.12.0\",\n \"dotenv\": \"^16.3.1\",\n \"dotenv-expand\": \"^10.0.0\",\n \"express\": \"^4.19.2\",\n \"multer\": \"^2.0.2\",\n \"rimraf\": \"^6.0.1\",\n \"rollup\": \"^4.24.3\",\n \"serialize-error\": \"^4.1.0\",\n \"source-map-support\": \"^0.5.21\",\n \"swagger-ui-express\": \"^5.0.0\",\n \"tgrid\": \"^1.1.0\",\n \"ts-node\": \"^10.9.1\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript-transform-paths\": \"^3.5.2\"\n },\n \"dependencies\": {\n \"@samchon/openapi\": \"^4.5.0\",\n \"commander\": \"10.0.0\",\n \"inquirer\": \"8.2.5\",\n \"prettier\": \"^3.3.3\",\n \"prettier-plugin-jsdoc\": \"^1.3.2\",\n \"tstl\": \"^3.0.0\",\n \"typescript\": \"~5.9.2\",\n \"typia\": \"^9.6.1\"\n },\n \"files\": [\n \"lib\",\n \"src\",\n \"!lib/test\",\n \"!src/test\",\n \"package.json\",\n \"README.md\",\n \"LICENSE\"\n ]\n}",
|
|
11810
11810
|
"node_modules/@nestia/sdk/lib/INestiaConfig.d.ts": "import type { INestApplication } from \"@nestjs/common\";\nimport type { OpenApi } from \"@samchon/openapi\";\n/**\n * Definition for the `nestia.config.ts` file.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport interface INestiaConfig {\n /**\n * Accessor of controller classes.\n *\n * You can specify target controller classes within two ways.\n *\n * - Asynchronous function returning `INestApplication` instance\n * - Specify the path or directory of controller class files\n */\n input: (() => Promise<INestApplication>) | INestiaConfig.IInput | string[] | string;\n /**\n * Building `swagger.json` is also possible.\n *\n * If not specified, you can't build the `swagger.json`.\n */\n swagger?: INestiaConfig.ISwaggerConfig;\n /**\n * Response directory that SDK would be placed in.\n *\n * If not configured, you can't build the SDK library.\n */\n output?: string;\n /**\n * Target directory that SDK distribution files would be placed in.\n *\n * If you configure this property and runs `npx nestia sdk` command,\n * distribution environments for the SDK library would be generated.\n *\n * After the SDK library generation, move to the `distribute` directory, and\n * runs `npm publish` command, then you can share SDK library with other\n * client (frontend) developers.\n *\n * Recommend to use `\"packages/api\"` value.\n */\n distribute?: string;\n /** @default false */\n keyword?: boolean;\n /**\n * Allow simulation mode.\n *\n * If you configure this property to be `true`, the SDK library would be\n * contain simulation mode. In the simulation mode, the SDK library would not\n * communicate with the real backend server, but just returns random mock-up\n * data with requestion data validation.\n *\n * For reference, random mock-up data would be generated by\n * `typia.random<T>()` function.\n *\n * @default false\n */\n simulate?: boolean;\n /**\n * Target directory that e2e test functions would be placed in.\n *\n * If you configure this property and runs `npx nestia e2e` command,\n * `@nestia/sdk` will analyze your NestJS backend server code, and generates\n * e2e test functions for every API endpoints.\n *\n * If not configured, you can't run `npx nestia e2e` command.\n */\n e2e?: string;\n /**\n * Whether to use propagation mode or not.\n *\n * If being configured, interaction functions of the SDK library would perform\n * the propagation mode. The propagation mode means that never throwing\n * exception even when status code is not 200 (or 201), but just returning the\n * {@link IPropagation} typed instance, which can specify its body type through\n * discriminated union determined by status code.\n *\n * @default false\n */\n propagate?: boolean;\n /**\n * Whether to clone DTO structures or not.\n *\n * If being configured, all of DTOs used in the backend server would be cloned\n * into the `structures` directory, and the SDK library would be refer to the\n * cloned DTOs instead of the original.\n *\n * @default false\n */\n clone?: boolean;\n /**\n * Whether to wrap DTO by primitive type.\n *\n * If you don't configure this property as `false`, all of DTOs in the SDK\n * library would be automatically wrapped by {@link Primitive} type.\n *\n * For refenrece, if a DTO type be capsuled by the {@link Primitive} type, all\n * of methods in the DTO type would be automatically erased. Also, if the DTO\n * has a `toJSON()` method, the DTO type would be automatically converted to\n * return type of the `toJSON()` method.\n *\n * @default true\n */\n primitive?: boolean;\n /**\n * Whether to assert parameter types or not.\n *\n * If you configure this property to be `true`, all of the function parameters\n * of SDK library would be checked through [`typia.assert<T>()`\n * function](https://typia.io/docs/validators/assert/).\n *\n * This option would make your SDK library compilation time a little bit\n * slower, but would enahcne the type safety even in the runtime level.\n *\n * @default false\n */\n assert?: boolean;\n /**\n * Whether to optimize JSON string conversion 10x faster or not.\n *\n * If you configure this property to be `true`, the SDK library would utilize\n * the [`typia.assertStringify<T>()\n * function`](https://github.com/samchon/typia#enhanced-json) to boost up JSON\n * serialization speed and ensure type safety.\n *\n * This option would make your SDK library compilation time a little bit\n * slower, but would enhance JSON serialization speed 10x faster. Also, it can\n * ensure type safety even in the runtime level.\n *\n * @default false\n */\n json?: boolean;\n}\nexport declare namespace INestiaConfig {\n /**\n * List of files or directories to include or exclude to specifying the NestJS\n * controllers.\n */\n interface IInput {\n /** List of files or directories containing the NestJS controller classes. */\n include: string[];\n /** List of files or directories to be excluded. */\n exclude?: string[];\n }\n /** Building `swagger.json` is also possible. */\n interface ISwaggerConfig {\n /**\n * Response path of the `swagger.json`.\n *\n * If you've configured only directory, the file name would be the\n * `swagger.json`. Otherwise you've configured the full path with file name\n * and extension, the `swagger.json` file would be renamed to it.\n */\n output: string;\n /**\n * OpenAPI version.\n *\n * If you configure this property to be `2.0` or `3.0`, the newly generated\n * `swagger.json` file would follow the specified OpenAPI version. The newly\n * generated `swagger.json` file would be downgraded from the OpenAPI v3.1\n * specification by {@link OpenApi.downgrade} method.\n *\n * @default 3.1\n */\n openapi?: \"2.0\" | \"3.0\" | \"3.1\";\n /**\n * Whether to beautify JSON content or not.\n *\n * If you configure this property to be `true`, the `swagger.json` file\n * would be beautified with indentation (2 spaces) and line breaks. If you\n * configure numeric value instead, the indentation would be specified by\n * the number.\n *\n * @default false\n */\n beautify?: boolean | number;\n /**\n * Whether to include additional information or not.\n *\n * If configured to be `true`, those properties would be added into each API\n * endpoinnt.\n *\n * - `x-nestia-method`\n * - `x-nestia-namespace` ` `x-nestia-jsDocTags`\n *\n * @default false\n */\n additional?: boolean;\n /**\n * API information.\n *\n * If omitted, `package.json` content would be used instead.\n */\n info?: Partial<OpenApi.IDocument.IInfo>;\n /** List of server addresses. */\n servers?: OpenApi.IServer[];\n /**\n * Security schemes.\n *\n * When generating `swagger.json` file through `nestia`, if your controllers\n * or theirs methods have a security key which is not enrolled in here\n * property, it would be an error.\n */\n security?: Record<string, OpenApi.ISecurityScheme>;\n /**\n * List of tag names with description.\n *\n * It is possible to omit this property or skip some tag name even if the\n * tag name is used in the API routes. In that case, the tag name would be\n * used without description.\n *\n * Of course, if you've written a comment like `@tag {name} {description}`,\n * you can entirely replace this property specification.\n */\n tags?: OpenApi.IDocument.ITag[];\n /**\n * Decompose query DTO.\n *\n * If you configure this property to be `true`, the query DTO would be\n * decomposed into individual query parameters per each property. Otherwise\n * you set it to be `false`, the query DTO would be one object type which\n * contains all of query parameters.\n *\n * @default true\n */\n decompose?: boolean;\n /**\n * Operation ID generator.\n *\n * @param props Properties of the API endpoint.\n * @returns Operation ID.\n */\n operationId?(props: {\n class: string;\n function: string;\n method: \"HEAD\" | \"GET\" | \"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\";\n path: string;\n }): string;\n }\n}\n",
|
|
11811
11811
|
"node_modules/@nestia/sdk/lib/NestiaSdkApplication.d.ts": "import { INestiaConfig } from \"./INestiaConfig\";\nexport declare class NestiaSdkApplication {\n private readonly config;\n constructor(config: INestiaConfig);\n all(): Promise<void>;\n e2e(): Promise<void>;\n sdk(): Promise<void>;\n swagger(): Promise<void>;\n private generate;\n}\n",
|
|
11812
11812
|
"node_modules/@nestia/sdk/lib/NestiaSwaggerComposer.d.ts": "import { INestApplication } from \"@nestjs/common\";\nimport { OpenApi, OpenApiV3, SwaggerV2 } from \"@samchon/openapi\";\nimport { INestiaConfig } from \"./INestiaConfig\";\nexport declare namespace NestiaSwaggerComposer {\n const document: (app: INestApplication, config: Omit<INestiaConfig.ISwaggerConfig, \"output\">) => Promise<OpenApi.IDocument | OpenApiV3.IDocument | SwaggerV2.IDocument>;\n}\n",
|
|
@@ -11905,7 +11905,7 @@
|
|
|
11905
11905
|
"node_modules/@nestia/sdk/lib/validators/HttpQueryValidator.d.ts": "import { MetadataFactory } from \"typia/lib/factories/MetadataFactory\";\nimport { Metadata } from \"typia/lib/schemas/metadata/Metadata\";\nexport declare namespace HttpQueryValidator {\n const validate: (meta: Metadata, explore: MetadataFactory.IExplore) => string[];\n}\n",
|
|
11906
11906
|
"node_modules/path-to-regexp/dist/index.d.ts": "/**\n * Encode a string into another string.\n */\nexport type Encode = (value: string) => string;\n/**\n * Decode a string into another string.\n */\nexport type Decode = (value: string) => string;\nexport interface ParseOptions {\n /**\n * A function for encoding input strings.\n */\n encodePath?: Encode;\n}\nexport interface PathToRegexpOptions {\n /**\n * Matches the path completely without trailing characters. (default: `true`)\n */\n end?: boolean;\n /**\n * Allows optional trailing delimiter to match. (default: `true`)\n */\n trailing?: boolean;\n /**\n * Match will be case sensitive. (default: `false`)\n */\n sensitive?: boolean;\n /**\n * The default delimiter for segments. (default: `'/'`)\n */\n delimiter?: string;\n}\nexport interface MatchOptions extends PathToRegexpOptions {\n /**\n * Function for decoding strings for params, or `false` to disable entirely. (default: `decodeURIComponent`)\n */\n decode?: Decode | false;\n}\nexport interface CompileOptions {\n /**\n * Function for encoding input strings for output into the path, or `false` to disable entirely. (default: `encodeURIComponent`)\n */\n encode?: Encode | false;\n /**\n * The default delimiter for segments. (default: `'/'`)\n */\n delimiter?: string;\n}\n/**\n * Plain text.\n */\nexport interface Text {\n type: \"text\";\n value: string;\n}\n/**\n * A parameter designed to match arbitrary text within a segment.\n */\nexport interface Parameter {\n type: \"param\";\n name: string;\n}\n/**\n * A wildcard parameter designed to match multiple segments.\n */\nexport interface Wildcard {\n type: \"wildcard\";\n name: string;\n}\n/**\n * A set of possible tokens to expand when matching.\n */\nexport interface Group {\n type: \"group\";\n tokens: Token[];\n}\n/**\n * A token that corresponds with a regexp capture.\n */\nexport type Key = Parameter | Wildcard;\n/**\n * A sequence of `path-to-regexp` keys that match capturing groups.\n */\nexport type Keys = Array<Key>;\n/**\n * A sequence of path match characters.\n */\nexport type Token = Text | Parameter | Wildcard | Group;\n/**\n * Tokenized path instance.\n */\nexport declare class TokenData {\n readonly tokens: Token[];\n constructor(tokens: Token[]);\n}\n/**\n * Parse a string for the raw tokens.\n */\nexport declare function parse(str: string, options?: ParseOptions): TokenData;\n/**\n * Compile a string to a template function for the path.\n */\nexport declare function compile<P extends ParamData = ParamData>(path: Path, options?: CompileOptions & ParseOptions): (data?: P) => string;\nexport type ParamData = Partial<Record<string, string | string[]>>;\nexport type PathFunction<P extends ParamData> = (data?: P) => string;\n/**\n * A match result contains data about the path match.\n */\nexport interface MatchResult<P extends ParamData> {\n path: string;\n params: P;\n}\n/**\n * A match is either `false` (no match) or a match result.\n */\nexport type Match<P extends ParamData> = false | MatchResult<P>;\n/**\n * The match function takes a string and returns whether it matched the path.\n */\nexport type MatchFunction<P extends ParamData> = (path: string) => Match<P>;\n/**\n * Supported path types.\n */\nexport type Path = string | TokenData;\n/**\n * Transform a path into a match function.\n */\nexport declare function match<P extends ParamData>(path: Path | Path[], options?: MatchOptions & ParseOptions): MatchFunction<P>;\nexport declare function pathToRegexp(path: Path | Path[], options?: PathToRegexpOptions & ParseOptions): {\n regexp: RegExp;\n keys: Keys;\n};\n/**\n * Stringify token data into a path string.\n */\nexport declare function stringify(data: TokenData): string;\n",
|
|
11907
11907
|
"node_modules/path-to-regexp/package.json": "{\n \"name\": \"path-to-regexp\",\n \"version\": \"8.2.0\",\n \"description\": \"Express style path to RegExp utility\",\n \"keywords\": [\n \"express\",\n \"regexp\",\n \"route\",\n \"routing\"\n ],\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/pillarjs/path-to-regexp.git\"\n },\n \"license\": \"MIT\",\n \"exports\": \"./dist/index.js\",\n \"main\": \"dist/index.js\",\n \"typings\": \"dist/index.d.ts\",\n \"files\": [\n \"dist/\"\n ],\n \"scripts\": {\n \"bench\": \"vitest bench\",\n \"build\": \"ts-scripts build\",\n \"format\": \"ts-scripts format\",\n \"lint\": \"ts-scripts lint\",\n \"prepare\": \"ts-scripts install && npm run build\",\n \"size\": \"size-limit\",\n \"specs\": \"ts-scripts specs\",\n \"test\": \"ts-scripts test && npm run size\"\n },\n \"devDependencies\": {\n \"@borderless/ts-scripts\": \"^0.15.0\",\n \"@size-limit/preset-small-lib\": \"^11.1.2\",\n \"@types/node\": \"^22.7.2\",\n \"@types/semver\": \"^7.3.1\",\n \"@vitest/coverage-v8\": \"^2.1.1\",\n \"recheck\": \"^4.4.5\",\n \"size-limit\": \"^11.1.2\",\n \"typescript\": \"^5.5.3\"\n },\n \"engines\": {\n \"node\": \">=16\"\n },\n \"publishConfig\": {\n \"access\": \"public\"\n },\n \"size-limit\": [\n {\n \"path\": \"dist/index.js\",\n \"limit\": \"2.2 kB\"\n }\n ],\n \"ts-scripts\": {\n \"dist\": [\n \"dist\"\n ],\n \"project\": [\n \"tsconfig.build.json\"\n ]\n }\n}\n",
|
|
11908
|
-
"node_modules/@nestia/sdk/package.json": "{\n \"name\": \"@nestia/sdk\",\n \"version\": \"7.
|
|
11908
|
+
"node_modules/@nestia/sdk/package.json": "{\n \"name\": \"@nestia/sdk\",\n \"version\": \"7.4.0\",\n \"description\": \"Nestia SDK and Swagger generator\",\n \"main\": \"lib/index.js\",\n \"typings\": \"lib/index.d.ts\",\n \"bin\": {\n \"@nestia/sdk\": \"lib/executable/sdk.js\"\n },\n \"scripts\": {\n \"build\": \"rimraf lib && tsc\",\n \"dev\": \"tsc -p tsconfig.test.json --watch\",\n \"eslint\": \"eslint ./**/*.ts\",\n \"prepare\": \"ts-patch install && typia patch\"\n },\n \"repository\": {\n \"type\": \"git\",\n \"url\": \"https://github.com/samchon/nestia\"\n },\n \"keywords\": [\n \"nestia\",\n \"sdk\",\n \"swagger\",\n \"generator\",\n \"nestjs\",\n \"typia\"\n ],\n \"author\": \"Jeongho Nam\",\n \"license\": \"MIT\",\n \"bugs\": {\n \"url\": \"https://github.com/samchon/nestia/issues\"\n },\n \"homepage\": \"https://nestia.io\",\n \"dependencies\": {\n \"@nestia/core\": \"^7.4.0\",\n \"@nestia/fetcher\": \"^7.4.0\",\n \"@samchon/openapi\": \"^4.5.0\",\n \"cli\": \"^1.0.1\",\n \"get-function-location\": \"^2.0.0\",\n \"glob\": \"^11.0.3\",\n \"path-to-regexp\": \"^6.2.1\",\n \"prettier\": \"^3.2.5\",\n \"ts-node\": \">=10.6.0\",\n \"tsconfck\": \"^2.1.2\",\n \"tsconfig-paths\": \"^4.1.1\",\n \"tstl\": \"^3.0.0\",\n \"typia\": \"^9.6.1\"\n },\n \"peerDependencies\": {\n \"@nestia/core\": \">=7.4.0\"\n },\n \"devDependencies\": {\n \"@nestjs/common\": \"^11.0.13\",\n \"@nestjs/core\": \"^11.0.13\",\n \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n \"@types/cli\": \"^0.11.21\",\n \"@types/express\": \"^4.17.15\",\n \"@types/node\": \"^18.11.15\",\n \"@types/ts-expose-internals\": \"npm:ts-expose-internals@5.4.5\",\n \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n \"@typescript-eslint/parser\": \"^5.46.1\",\n \"eslint\": \"^8.29.0\",\n \"eslint-plugin-deprecation\": \"^1.4.1\",\n \"rimraf\": \"^6.0.1\",\n \"tgrid\": \"^1.1.0\",\n \"ts-patch\": \"^3.3.0\",\n \"typescript\": \"~5.9.2\",\n \"typescript-transform-paths\": \"^3.4.4\"\n },\n \"files\": [\n \"assets\",\n \"lib\",\n \"src\",\n \"README.md\",\n \"LICENSE\",\n \"package.json\"\n ]\n}",
|
|
11909
11909
|
"node_modules/@nestia/sdk/src/typings/get-function-location.d.ts": "declare module \"get-function-location\" {\n export default function (func: any): Promise<{\n source: string;\n line: number;\n column: number;\n }>;\n}\n",
|
|
11910
11910
|
"node_modules/@nestia/sdk/node_modules/glob/dist/commonjs/glob.d.ts": "import { Minimatch } from 'minimatch';\nimport { Minipass } from 'minipass';\nimport { FSOption, Path, PathScurry } from 'path-scurry';\nimport { IgnoreLike } from './ignore.js';\nimport { Pattern } from './pattern.js';\nexport type MatchSet = Minimatch['set'];\nexport type GlobParts = Exclude<Minimatch['globParts'], undefined>;\n/**\n * A `GlobOptions` object may be provided to any of the exported methods, and\n * must be provided to the `Glob` constructor.\n *\n * All options are optional, boolean, and false by default, unless otherwise\n * noted.\n *\n * All resolved options are added to the Glob object as properties.\n *\n * If you are running many `glob` operations, you can pass a Glob object as the\n * `options` argument to a subsequent operation to share the previously loaded\n * cache.\n */\nexport interface GlobOptions {\n /**\n * Set to `true` to always receive absolute paths for\n * matched files. Set to `false` to always return relative paths.\n *\n * When this option is not set, absolute paths are returned for patterns\n * that are absolute, and otherwise paths are returned that are relative\n * to the `cwd` setting.\n *\n * This does _not_ make an extra system call to get\n * the realpath, it only does string path resolution.\n *\n * Conflicts with {@link withFileTypes}\n */\n absolute?: boolean;\n /**\n * Set to false to enable {@link windowsPathsNoEscape}\n *\n * @deprecated\n */\n allowWindowsEscape?: boolean;\n /**\n * The current working directory in which to search. Defaults to\n * `process.cwd()`.\n *\n * May be eiher a string path or a `file://` URL object or string.\n */\n cwd?: string | URL;\n /**\n * Include `.dot` files in normal matches and `globstar`\n * matches. Note that an explicit dot in a portion of the pattern\n * will always match dot files.\n */\n dot?: boolean;\n /**\n * Prepend all relative path strings with `./` (or `.\\` on Windows).\n *\n * Without this option, returned relative paths are \"bare\", so instead of\n * returning `'./foo/bar'`, they are returned as `'foo/bar'`.\n *\n * Relative patterns starting with `'../'` are not prepended with `./`, even\n * if this option is set.\n */\n dotRelative?: boolean;\n /**\n * Follow symlinked directories when expanding `**`\n * patterns. This can result in a lot of duplicate references in\n * the presence of cyclic links, and make performance quite bad.\n *\n * By default, a `**` in a pattern will follow 1 symbolic link if\n * it is not the first item in the pattern, or none if it is the\n * first item in the pattern, following the same behavior as Bash.\n */\n follow?: boolean;\n /**\n * string or string[], or an object with `ignored` and `childrenIgnored`\n * methods.\n *\n * If a string or string[] is provided, then this is treated as a glob\n * pattern or array of glob patterns to exclude from matches. To ignore all\n * children within a directory, as well as the entry itself, append `'/**'`\n * to the ignore pattern.\n *\n * **Note** `ignore` patterns are _always_ in `dot:true` mode, regardless of\n * any other settings.\n *\n * If an object is provided that has `ignored(path)` and/or\n * `childrenIgnored(path)` methods, then these methods will be called to\n * determine whether any Path is a match or if its children should be\n * traversed, respectively.\n */\n ignore?: string | string[] | IgnoreLike;\n /**\n * Treat brace expansion like `{a,b}` as a \"magic\" pattern. Has no\n * effect if {@link nobrace} is set.\n *\n * Only has effect on the {@link hasMagic} function.\n */\n magicalBraces?: boolean;\n /**\n * Add a `/` character to directory matches. Note that this requires\n * additional stat calls in some cases.\n */\n mark?: boolean;\n /**\n * Perform a basename-only match if the pattern does not contain any slash\n * characters. That is, `*.js` would be treated as equivalent to\n * `**\\/*.js`, matching all js files in all directories.\n */\n matchBase?: boolean;\n /**\n * Limit the directory traversal to a given depth below the cwd.\n * Note that this does NOT prevent traversal to sibling folders,\n * root patterns, and so on. It only limits the maximum folder depth\n * that the walk will descend, relative to the cwd.\n */\n maxDepth?: number;\n /**\n * Do not expand `{a,b}` and `{1..3}` brace sets.\n */\n nobrace?: boolean;\n /**\n * Perform a case-insensitive match. This defaults to `true` on macOS and\n * Windows systems, and `false` on all others.\n *\n * **Note** `nocase` should only be explicitly set when it is\n * known that the filesystem's case sensitivity differs from the\n * platform default. If set `true` on case-sensitive file\n * systems, or `false` on case-insensitive file systems, then the\n * walk may return more or less results than expected.\n */\n nocase?: boolean;\n /**\n * Do not match directories, only files. (Note: to match\n * _only_ directories, put a `/` at the end of the pattern.)\n */\n nodir?: boolean;\n /**\n * Do not match \"extglob\" patterns such as `+(a|b)`.\n */\n noext?: boolean;\n /**\n * Do not match `**` against multiple filenames. (Ie, treat it as a normal\n * `*` instead.)\n *\n * Conflicts with {@link matchBase}\n */\n noglobstar?: boolean;\n /**\n * Defaults to value of `process.platform` if available, or `'linux'` if\n * not. Setting `platform:'win32'` on non-Windows systems may cause strange\n * behavior.\n */\n platform?: NodeJS.Platform;\n /**\n * Set to true to call `fs.realpath` on all of the\n * results. In the case of an entry that cannot be resolved, the\n * entry is omitted. This incurs a slight performance penalty, of\n * course, because of the added system calls.\n */\n realpath?: boolean;\n /**\n *\n * A string path resolved against the `cwd` option, which\n * is used as the starting point for absolute patterns that start\n * with `/`, (but not drive letters or UNC paths on Windows).\n *\n * Note that this _doesn't_ necessarily limit the walk to the\n * `root` directory, and doesn't affect the cwd starting point for\n * non-absolute patterns. A pattern containing `..` will still be\n * able to traverse out of the root directory, if it is not an\n * actual root directory on the filesystem, and any non-absolute\n * patterns will be matched in the `cwd`. For example, the\n * pattern `/../*` with `{root:'/some/path'}` will return all\n * files in `/some`, not all files in `/some/path`. The pattern\n * `*` with `{root:'/some/path'}` will return all the entries in\n * the cwd, not the entries in `/some/path`.\n *\n * To start absolute and non-absolute patterns in the same\n * path, you can use `{root:''}`. However, be aware that on\n * Windows systems, a pattern like `x:/*` or `//host/share/*` will\n * _always_ start in the `x:/` or `//host/share` directory,\n * regardless of the `root` setting.\n */\n root?: string;\n /**\n * A [PathScurry](http://npm.im/path-scurry) object used\n * to traverse the file system. If the `nocase` option is set\n * explicitly, then any provided `scurry` object must match this\n * setting.\n */\n scurry?: PathScurry;\n /**\n * Call `lstat()` on all entries, whether required or not to determine\n * if it's a valid match. When used with {@link withFileTypes}, this means\n * that matches will include data such as modified time, permissions, and\n * so on. Note that this will incur a performance cost due to the added\n * system calls.\n */\n stat?: boolean;\n /**\n * An AbortSignal which will cancel the Glob walk when\n * triggered.\n */\n signal?: AbortSignal;\n /**\n * Use `\\\\` as a path separator _only_, and\n * _never_ as an escape character. If set, all `\\\\` characters are\n * replaced with `/` in the pattern.\n *\n * Note that this makes it **impossible** to match against paths\n * containing literal glob pattern characters, but allows matching\n * with patterns constructed using `path.join()` and\n * `path.resolve()` on Windows platforms, mimicking the (buggy!)\n * behavior of Glob v7 and before on Windows. Please use with\n * caution, and be mindful of [the caveat below about Windows\n * paths](#windows). (For legacy reasons, this is also set if\n * `allowWindowsEscape` is set to the exact value `false`.)\n */\n windowsPathsNoEscape?: boolean;\n /**\n * Return [PathScurry](http://npm.im/path-scurry)\n * `Path` objects instead of strings. These are similar to a\n * NodeJS `Dirent` object, but with additional methods and\n * properties.\n *\n * Conflicts with {@link absolute}\n */\n withFileTypes?: boolean;\n /**\n * An fs implementation to override some or all of the defaults. See\n * http://npm.im/path-scurry for details about what can be overridden.\n */\n fs?: FSOption;\n /**\n * Just passed along to Minimatch. Note that this makes all pattern\n * matching operations slower and *extremely* noisy.\n */\n debug?: boolean;\n /**\n * Return `/` delimited paths, even on Windows.\n *\n * On posix systems, this has no effect. But, on Windows, it means that\n * paths will be `/` delimited, and absolute paths will be their full\n * resolved UNC forms, eg instead of `'C:\\\\foo\\\\bar'`, it would return\n * `'//?/C:/foo/bar'`\n */\n posix?: boolean;\n /**\n * Do not match any children of any matches. For example, the pattern\n * `**\\/foo` would match `a/foo`, but not `a/foo/b/foo` in this mode.\n *\n * This is especially useful for cases like \"find all `node_modules`\n * folders, but not the ones in `node_modules`\".\n *\n * In order to support this, the `Ignore` implementation must support an\n * `add(pattern: string)` method. If using the default `Ignore` class, then\n * this is fine, but if this is set to `false`, and a custom `Ignore` is\n * provided that does not have an `add()` method, then it will throw an\n * error.\n *\n * **Caveat** It *only* ignores matches that would be a descendant of a\n * previous match, and only if that descendant is matched *after* the\n * ancestor is encountered. Since the file system walk happens in\n * indeterminate order, it's possible that a match will already be added\n * before its ancestor, if multiple or braced patterns are used.\n *\n * For example:\n *\n * ```ts\n * const results = await glob([\n * // likely to match first, since it's just a stat\n * 'a/b/c/d/e/f',\n *\n * // this pattern is more complicated! It must to various readdir()\n * // calls and test the results against a regular expression, and that\n * // is certainly going to take a little bit longer.\n * //\n * // So, later on, it encounters a match at 'a/b/c/d/e', but it's too\n * // late to ignore a/b/c/d/e/f, because it's already been emitted.\n * 'a/[bdf]/?/[a-z]/*',\n * ], { includeChildMatches: false })\n * ```\n *\n * It's best to only set this to `false` if you can be reasonably sure that\n * no components of the pattern will potentially match one another's file\n * system descendants, or if the occasional included child entry will not\n * cause problems.\n *\n * @default true\n */\n includeChildMatches?: boolean;\n}\nexport type GlobOptionsWithFileTypesTrue = GlobOptions & {\n withFileTypes: true;\n absolute?: undefined;\n mark?: undefined;\n posix?: undefined;\n};\nexport type GlobOptionsWithFileTypesFalse = GlobOptions & {\n withFileTypes?: false;\n};\nexport type GlobOptionsWithFileTypesUnset = GlobOptions & {\n withFileTypes?: undefined;\n};\nexport type Result<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? Path : Opts extends GlobOptionsWithFileTypesFalse ? string : Opts extends GlobOptionsWithFileTypesUnset ? string : string | Path;\nexport type Results<Opts> = Result<Opts>[];\nexport type FileTypes<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? true : Opts extends GlobOptionsWithFileTypesFalse ? false : Opts extends GlobOptionsWithFileTypesUnset ? false : boolean;\n/**\n * An object that can perform glob pattern traversals.\n */\nexport declare class Glob<Opts extends GlobOptions> implements GlobOptions {\n absolute?: boolean;\n cwd: string;\n root?: string;\n dot: boolean;\n dotRelative: boolean;\n follow: boolean;\n ignore?: string | string[] | IgnoreLike;\n magicalBraces: boolean;\n mark?: boolean;\n matchBase: boolean;\n maxDepth: number;\n nobrace: boolean;\n nocase: boolean;\n nodir: boolean;\n noext: boolean;\n noglobstar: boolean;\n pattern: string[];\n platform: NodeJS.Platform;\n realpath: boolean;\n scurry: PathScurry;\n stat: boolean;\n signal?: AbortSignal;\n windowsPathsNoEscape: boolean;\n withFileTypes: FileTypes<Opts>;\n includeChildMatches: boolean;\n /**\n * The options provided to the constructor.\n */\n opts: Opts;\n /**\n * An array of parsed immutable {@link Pattern} objects.\n */\n patterns: Pattern[];\n /**\n * All options are stored as properties on the `Glob` object.\n *\n * See {@link GlobOptions} for full options descriptions.\n *\n * Note that a previous `Glob` object can be passed as the\n * `GlobOptions` to another `Glob` instantiation to re-use settings\n * and caches with a new pattern.\n *\n * Traversal functions can be called multiple times to run the walk\n * again.\n */\n constructor(pattern: string | string[], opts: Opts);\n /**\n * Returns a Promise that resolves to the results array.\n */\n walk(): Promise<Results<Opts>>;\n /**\n * synchronous {@link Glob.walk}\n */\n walkSync(): Results<Opts>;\n /**\n * Stream results asynchronously.\n */\n stream(): Minipass<Result<Opts>, Result<Opts>>;\n /**\n * Stream results synchronously.\n */\n streamSync(): Minipass<Result<Opts>, Result<Opts>>;\n /**\n * Default sync iteration function. Returns a Generator that\n * iterates over the results.\n */\n iterateSync(): Generator<Result<Opts>, void, void>;\n [Symbol.iterator](): Generator<Result<Opts>, void, void>;\n /**\n * Default async iteration function. Returns an AsyncGenerator that\n * iterates over the results.\n */\n iterate(): AsyncGenerator<Result<Opts>, void, void>;\n [Symbol.asyncIterator](): AsyncGenerator<Result<Opts>, void, void>;\n}\n//# sourceMappingURL=glob.d.ts.map",
|
|
11911
11911
|
"node_modules/@nestia/sdk/node_modules/glob/dist/commonjs/has-magic.d.ts": "import { GlobOptions } from './glob.js';\n/**\n * Return true if the patterns provided contain any magic glob characters,\n * given the options provided.\n *\n * Brace expansion is not considered \"magic\" unless the `magicalBraces` option\n * is set, as brace expansion just turns one string into an array of strings.\n * So a pattern like `'x{a,b}y'` would return `false`, because `'xay'` and\n * `'xby'` both do not contain any magic glob characters, and it's treated the\n * same as if you had called it on `['xay', 'xby']`. When `magicalBraces:true`\n * is in the options, brace expansion _is_ treated as a pattern having magic.\n */\nexport declare const hasMagic: (pattern: string | string[], options?: GlobOptions) => boolean;\n//# sourceMappingURL=has-magic.d.ts.map",
|