@autobe/compiler 0.18.0 → 0.20.0

package/src/raw/AutoBeCompilerRealizeTemplate.ts

@@ -1,12 +1,13 @@
 export const AutoBeCompilerRealizeTemplate: Record<string, string> = {
   ".env.local": "API_PORT=37001\nJWT_SECRET_KEY=your_jwt_secret_key",
   ".gitignore": "bin/\ndist/\nlib/\nnode_modules/\n\nprisma/migrations\nprisma/schema/migrations\nprisma/bbs.db\n\n*.DS_Store\npackage-lock.json\npnpm-lock.yaml\n.npmrc",
-  "package.json": "{\n  \"private\": true,\n  \"name\": \"@ORGANIZATION/PROJECT\",\n  \"version\": \"0.1.0\",\n  \"description\": \"Starter kit of Nestia\",\n  \"main\": \"lib/index.js\",\n  \"scripts\": {\n    \"benchmark\": \"node bin/test/benchmark\",\n    \"test\": \"node bin/test\",\n    \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n    \"------------------------BUILDS------------------------\": \"\",\n    \"build\": \"npm run build:prisma && npm run build:sdk && npm run build:main && npm run build:test\",\n    \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n    \"build:env\": \"ts-node build/env.ts\",\n    \"build:main\": \"rimraf lib && tsc\",\n    \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n    \"build:prisma\": \"prisma generate --schema prisma/schema\",\n    \"build:swagger\": \"nestia swagger\",\n    \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n    \"dev\": \"npm run build:test -- --watch\",\n    \"eslint\": \"eslint src && eslint test\",\n    \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n    \"prepare\": \"ts-patch install && npm run build:env && npm run build:prisma\",\n    \"prettier\": \"prettier src --write && prettier test --write\",\n    \"------------------------WEBPACK------------------------\": \"\",\n    \"webpack\": \"rimraf dist && webpack\",\n    \"webpack:start\": \"cd dist && node dist/server\",\n    \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n    \"------------------------DEPLOYS------------------------\": \"\",\n    \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n    \"start\": \"node lib/executable/server\",\n    \"start:dev\": \"nest start --watch\",\n    \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia-start\"\n  },\n  \"keywords\": [\n    \"nestia\",\n    \"template\",\n    \"boilerplate\"\n  ],\n  \"author\": \"AUTHOR\",\n  \"license\": \"AGPL-3.0\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia-start/issues\"\n  },\n  \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n  \"devDependencies\": {\n    \"@autobe/interface\": \"^0.10.6\",\n    \"@nestia/benchmark\": \"^7.3.3\",\n    \"@nestia/e2e\": \"^7.3.3\",\n    \"@nestia/sdk\": \"^7.3.3\",\n    \"@nestjs/cli\": \"^11.0.7\",\n    \"@rollup/plugin-terser\": \"^0.4.4\",\n    \"@rollup/plugin-typescript\": \"^11.1.6\",\n    \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n    \"@types/bcryptjs\": \"^3.0.0\",\n    \"@types/cli\": \"^0.11.21\",\n    \"@types/cli-progress\": \"^3.11.5\",\n    \"@types/express\": \"^4.17.21\",\n    \"@types/inquirer\": \"^8.2.5\",\n    \"@types/jsonwebtoken\": \"^9.0.5\",\n    \"@types/node\": \"^18.11.0\",\n    \"@types/uuid\": \"^8.3.4\",\n    \"@typescript-eslint/eslint-plugin\": \"^8.1.0\",\n    \"@typescript-eslint/parser\": \"^8.1.0\",\n    \"chalk\": \"^4.1.2\",\n    \"cli\": \"^1.0.1\",\n    \"cli-progress\": \"^3.12.0\",\n    \"copy-webpack-plugin\": \"^11.0.0\",\n    \"eslint-plugin-deprecation\": \"^3.0.0\",\n    \"express\": \"^4.18.2\",\n    \"fastify\": \"^5.4.0\",\n    \"nestia\": \"^7.3.3\",\n    \"prettier\": \"^3.2.4\",\n    \"prettier-plugin-prisma\": \"^5.0.0\",\n    \"prisma-markdown\": \"^3.0.1\",\n    \"rimraf\": \"^3.0.2\",\n    \"rollup\": \"^4.18.0\",\n    \"source-map-support\": \"^0.5.21\",\n    \"swagger-ui-express\": \"^5.0.0\",\n    \"ts-loader\": \"^9.5.1\",\n    \"ts-node\": \"^10.9.1\",\n    \"ts-patch\": \"^3.3.0\",\n    \"typescript\": \"~5.9.2\",\n    \"typescript-transform-paths\": \"^3.5.5\",\n    \"webpack\": \"^5.89.0\",\n    \"webpack-cli\": \"^5.1.4\",\n    \"write-file-webpack-plugin\": \"^4.5.1\"\n  },\n  \"dependencies\": {\n    \"@nestia/core\": \"^7.3.3\",\n    \"@nestia/fetcher\": \"^7.3.3\",\n    \"@nestjs/common\": \"^11.1.3\",\n    \"@nestjs/core\": \"^11.1.3\",\n    \"@nestjs/platform-express\": \"^11.1.3\",\n    \"@nestjs/platform-fastify\": \"^11.1.3\",\n    \"@prisma/client\": \"^6.11.1\",\n    \"bcryptjs\": \"^3.0.2\",\n    \"commander\": \"10.0.0\",\n    \"dotenv\": \"^16.3.1\",\n    \"dotenv-expand\": \"^10.0.0\",\n    \"inquirer\": \"8.2.5\",\n    \"jsonwebtoken\": \"^9.0.2\",\n    \"prisma\": \"^6.11.1\",\n    \"serialize-error\": \"^4.1.0\",\n    \"tgrid\": \"^1.1.0\",\n    \"tstl\": \"^3.0.0\",\n    \"typia\": \"^9.7.1\",\n    \"uuid\": \"^9.0.0\"\n  },\n  \"stackblitz\": {\n    \"startCommand\": \"npm run prepare && npm run build:test && npm run test -- --simultaneous 1\"\n  }\n}\n",
-  "src/MyGlobal.ts": "import { PrismaClient } from \"@prisma/client\";\nimport dotenv from \"dotenv\";\nimport dotenvExpand from \"dotenv-expand\";\nimport { Singleton } from \"tstl\";\nimport typia from \"typia\";\n\n/* eslint-disable */\nexport class MyGlobal {\n  public static readonly prisma: PrismaClient = new PrismaClient();\n  public static testing: boolean = false;\n  public static get env(): MyGlobal.IEnvironments {\n    return environments.get();\n  }\n}\nexport namespace MyGlobal {\n  export interface IEnvironments {\n    API_PORT: `${number}`;\n\n    /** JWT Secret Key. */\n    JWT_SECRET_KEY: string;\n  }\n}\nconst environments = new Singleton(() => {\n  const env = dotenv.config();\n  dotenvExpand.expand(env);\n  return typia.assert<MyGlobal.IEnvironments>(process.env);\n});\n",
-  "src/providers/authorize/jwtAuthorize.ts": "import { ForbiddenException, UnauthorizedException } from \"@nestjs/common\";\nimport jwt from \"jsonwebtoken\";\n\nimport { MyGlobal } from \"../../MyGlobal\";\n\nexport function jwtAuthorize(props: {\n  request: {\n    headers: { authorization?: string };\n  };\n}) {\n  if (!props.request.headers.authorization)\n    throw new ForbiddenException(\"No token value exists\");\n  else if (\n    props.request.headers.authorization.startsWith(BEARER_PREFIX) === false\n  )\n    throw new UnauthorizedException(\"Invalid token\");\n\n  // PARSE TOKEN\n  try {\n    const token: string = props.request.headers.authorization.substring(\n      BEARER_PREFIX.length,\n    );\n\n    const verified = jwt.verify(token, MyGlobal.env.JWT_SECRET_KEY);\n\n    return verified;\n  } catch {\n    throw new UnauthorizedException(\"Invalid token\");\n  }\n}\n\nconst BEARER_PREFIX = \"Bearer \";\n",
+  "package.json": "{\n  \"private\": true,\n  \"name\": \"@ORGANIZATION/PROJECT\",\n  \"version\": \"0.1.0\",\n  \"description\": \"Starter kit of Nestia\",\n  \"main\": \"lib/index.js\",\n  \"scripts\": {\n    \"benchmark\": \"node bin/test/benchmark\",\n    \"test\": \"node bin/test\",\n    \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n    \"------------------------BUILDS------------------------\": \"\",\n    \"build\": \"npm run build:prisma && npm run build:sdk && npm run build:main && npm run build:test\",\n    \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n    \"build:env\": \"ts-node build/env.ts\",\n    \"build:main\": \"rimraf lib && tsc\",\n    \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n    \"build:prisma\": \"prisma generate --schema prisma/schema\",\n    \"build:swagger\": \"nestia swagger\",\n    \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n    \"dev\": \"npm run build:test -- --watch\",\n    \"eslint\": \"eslint src && eslint test\",\n    \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n    \"prepare\": \"ts-patch install && npm run build:env && npm run build:prisma\",\n    \"prettier\": \"prettier src --write && prettier test --write\",\n    \"------------------------WEBPACK------------------------\": \"\",\n    \"webpack\": \"rimraf dist && webpack\",\n    \"webpack:start\": \"cd dist && node dist/server\",\n    \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n    \"------------------------DEPLOYS------------------------\": \"\",\n    \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n    \"start\": \"node lib/executable/server\",\n    \"start:dev\": \"nest start --watch\",\n    \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia-start\"\n  },\n  \"keywords\": [\n    \"nestia\",\n    \"template\",\n    \"boilerplate\"\n  ],\n  \"author\": \"AUTHOR\",\n  \"license\": \"AGPL-3.0\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia-start/issues\"\n  },\n  \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n  \"devDependencies\": {\n    \"@autobe/interface\": \"^0.10.6\",\n    \"@nestia/benchmark\": \"^7.4.0\",\n    \"@nestia/e2e\": \"^7.4.0\",\n    \"@nestia/sdk\": \"^7.4.0\",\n    \"@nestjs/cli\": \"^11.0.7\",\n    \"@rollup/plugin-terser\": \"^0.4.4\",\n    \"@rollup/plugin-typescript\": \"^11.1.6\",\n    \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n    \"@types/bcryptjs\": \"^3.0.0\",\n    \"@types/cli\": \"^0.11.21\",\n    \"@types/cli-progress\": \"^3.11.5\",\n    \"@types/express\": \"^4.17.21\",\n    \"@types/inquirer\": \"^8.2.5\",\n    \"@types/jsonwebtoken\": \"^9.0.5\",\n    \"@types/node\": \"^18.11.0\",\n    \"@types/uuid\": \"^8.3.4\",\n    \"@typescript-eslint/eslint-plugin\": \"^8.1.0\",\n    \"@typescript-eslint/parser\": \"^8.1.0\",\n    \"chalk\": \"^4.1.2\",\n    \"cli\": \"^1.0.1\",\n    \"cli-progress\": \"^3.12.0\",\n    \"copy-webpack-plugin\": \"^11.0.0\",\n    \"eslint-plugin-deprecation\": \"^3.0.0\",\n    \"express\": \"^4.18.2\",\n    \"fastify\": \"^5.4.0\",\n    \"nestia\": \"^7.4.0\",\n    \"prettier\": \"^3.2.4\",\n    \"prettier-plugin-prisma\": \"^5.0.0\",\n    \"prisma-markdown\": \"^3.0.1\",\n    \"rimraf\": \"^3.0.2\",\n    \"rollup\": \"^4.18.0\",\n    \"source-map-support\": \"^0.5.21\",\n    \"swagger-ui-express\": \"^5.0.0\",\n    \"ts-loader\": \"^9.5.1\",\n    \"ts-node\": \"^10.9.1\",\n    \"ts-patch\": \"^3.3.0\",\n    \"typescript\": \"~5.9.2\",\n    \"typescript-transform-paths\": \"^3.5.5\",\n    \"webpack\": \"^5.89.0\",\n    \"webpack-cli\": \"^5.1.4\",\n    \"write-file-webpack-plugin\": \"^4.5.1\"\n  },\n  \"dependencies\": {\n    \"@nestia/core\": \"^7.4.0\",\n    \"@nestia/fetcher\": \"^7.4.0\",\n    \"@nestjs/common\": \"^11.1.3\",\n    \"@nestjs/core\": \"^11.1.3\",\n    \"@nestjs/platform-express\": \"^11.1.3\",\n    \"@nestjs/platform-fastify\": \"^11.1.3\",\n    \"@prisma/client\": \"^6.11.1\",\n    \"bcryptjs\": \"^3.0.2\",\n    \"commander\": \"10.0.0\",\n    \"dotenv\": \"^16.3.1\",\n    \"dotenv-expand\": \"^10.0.0\",\n    \"inquirer\": \"8.2.5\",\n    \"jsonwebtoken\": \"^9.0.2\",\n    \"prisma\": \"^6.11.1\",\n    \"serialize-error\": \"^4.1.0\",\n    \"tgrid\": \"^1.1.0\",\n    \"tstl\": \"^3.0.0\",\n    \"typia\": \"^9.7.1\",\n    \"uuid\": \"^9.0.0\"\n  },\n  \"stackblitz\": {\n    \"startCommand\": \"npm run prepare && npm run build:test && npm run test -- --simultaneous 1\"\n  }\n}\n",
+  "src/MyGlobal.ts": "import { PrismaClient } from \"@prisma/client\";\nimport crypto from \"crypto\";\nimport dotenv from \"dotenv\";\nimport dotenvExpand from \"dotenv-expand\";\nimport { Singleton } from \"tstl\";\nimport typia from \"typia\";\n\n/* eslint-disable */\nexport class MyGlobal {\n  public static readonly prisma: PrismaClient = new PrismaClient();\n  public static testing: boolean = false;\n  public static get env(): MyGlobal.IEnvironments {\n    return environments.get();\n  }\n\n  /**\n   * Common password utilities for consistent authentication Uses native crypto\n   * module for password hashing\n   */\n  public static readonly password = {\n    // Fixed salt for password hashing (consistent across all operations)\n    FIXED_SALT: \"autobe-fixed-salt-2024\",\n\n    /**\n     * Hash a plain password using crypto.pbkdf2 All authentication operations\n     * (join, login) MUST use this method\n     *\n     * @param plainPassword - The plain text password to hash\n     * @returns The hashed password as hex string\n     */\n    async hash(plainPassword: string): Promise<string> {\n      return new Promise((resolve, reject) => {\n        crypto.pbkdf2(\n          plainPassword,\n          this.FIXED_SALT,\n          10000,\n          64,\n          \"sha512\",\n          (err: Error | null, derivedKey: Buffer) => {\n            if (err) reject(err);\n            else resolve(derivedKey.toString(\"hex\"));\n          },\n        );\n      });\n    },\n\n    /**\n     * Verify a plain password against a hashed password Login operations MUST\n     * use this method for password verification\n     *\n     * @param plainPassword - The plain text password to verify\n     * @param hashedPassword - The hashed password from database\n     * @returns True if passwords match, false otherwise\n     */\n    async verify(\n      plainPassword: string,\n      hashedPassword: string,\n    ): Promise<boolean> {\n      const hash = await this.hash(plainPassword);\n      return hash === hashedPassword;\n    },\n  };\n}\nexport namespace MyGlobal {\n  export interface IEnvironments {\n    API_PORT: `${number}`;\n\n    /** JWT Secret Key. */\n    JWT_SECRET_KEY: string;\n  }\n}\nconst environments = new Singleton(() => {\n  const env = dotenv.config();\n  dotenvExpand.expand(env);\n  return typia.assert<MyGlobal.IEnvironments>(process.env);\n});\n",
+  "src/providers/authorize/jwtAuthorize.ts": "import { ForbiddenException, UnauthorizedException } from \"@nestjs/common\";\nimport jwt from \"jsonwebtoken\";\n\nimport { MyGlobal } from \"../../MyGlobal\";\n\nexport function jwtAuthorize(props: {\n  request: {\n    headers: { authorization?: string };\n  };\n}) {\n  if (!props.request.headers.authorization)\n    throw new ForbiddenException(\"No token value exists\");\n\n  // PARSE TOKEN\n  try {\n    if (\n      props.request.headers.authorization.startsWith(BEARER_PREFIX) === true\n    ) {\n      const token: string = props.request.headers.authorization.substring(\n        BEARER_PREFIX.length,\n      );\n\n      const verified = jwt.verify(token, MyGlobal.env.JWT_SECRET_KEY);\n\n      return verified;\n    } else {\n      const token = props.request.headers.authorization;\n\n      const verified = jwt.verify(token, MyGlobal.env.JWT_SECRET_KEY);\n\n      return verified;\n    }\n  } catch {\n    throw new UnauthorizedException(\"Invalid token\");\n  }\n}\n\nconst BEARER_PREFIX = \"Bearer \";\n",
   "src/setup/MySetupWizard.ts": "import cp from \"child_process\";\n\nimport { MyConfiguration } from \"../MyConfiguration\";\nimport { MyGlobal } from \"../MyGlobal\";\n\nexport namespace MySetupWizard {\n  export async function schema(): Promise<void> {\n    if (MyGlobal.testing === false)\n      throw new Error(\n        \"Error on SetupWizard.schema(): unable to reset database in non-test mode.\",\n      );\n    const execute = (type: string) => (argv: string) =>\n      cp.execSync(`npx prisma migrate ${type} --schema=prisma/schema ${argv}`, {\n        stdio: \"ignore\",\n        cwd: MyConfiguration.ROOT,\n      });\n    execute(\"reset\")(\"--force\");\n    execute(\"dev\")(\"--name init\");\n  }\n\n  export async function seed(): Promise<void> {}\n}\n",
   "src/util/toISOStringSafe.ts": "import { tags } from \"typia\";\n\n/**\n * Transforms a value that is either a Date or a string into an ISO 8601\n * formatted string. If it's already a string, it assumes it's already in ISO\n * format.\n */\nexport function toISOStringSafe(\n  value: Date | (string & tags.Format<\"date-time\">),\n): string & tags.Format<\"date-time\"> {\n  if (value instanceof Date) {\n    return value.toISOString() as string & tags.Format<\"date-time\">;\n  }\n  return value;\n}\n",
   "test/servant.ts": "import { DynamicExecutor } from \"@nestia/e2e\";\nimport { Driver, WorkerServer } from \"tgrid\";\n\nimport { MyBackend } from \"../src/MyBackend\";\nimport { MyGlobal } from \"../src/MyGlobal\";\nimport { IAutoBeRealizeTestConfig } from \"./autobe/compiler/IAutoBeRealizeTestConfig\";\nimport { IAutoBeRealizeTestListener } from \"./autobe/compiler/IAutoBeRealizeTestListener\";\nimport { IAutoBeRealizeTestOperation } from \"./autobe/compiler/IAutoBeRealizeTestOperation\";\nimport { IAutoBeRealizeTestResult } from \"./autobe/compiler/IAutoBeRealizeTestResult\";\nimport { IAutoBeRealizeTestService } from \"./autobe/compiler/IAutoBeRealizeTestService\";\nimport { TestAutomation } from \"./helpers/TestAutomation\";\n\nclass AutoBeRealizeTestService implements IAutoBeRealizeTestService {\n  public constructor(\n    private readonly listener: Driver<IAutoBeRealizeTestListener>,\n  ) {}\n\n  public async execute(\n    config: IAutoBeRealizeTestConfig,\n  ): Promise<IAutoBeRealizeTestResult> {\n    const start: Date = new Date();\n    const operations: IAutoBeRealizeTestOperation[] = [];\n    await TestAutomation.execute({\n      open: async (): Promise<MyBackend> => {\n        const backend: MyBackend = new MyBackend();\n        await backend.open();\n        return backend;\n      },\n      close: (backend: MyBackend): Promise<void> => backend.close(),\n      options: {\n        reset: config.reset ?? true,\n        simultaneous: config.simultaneous ?? 1,\n      },\n      onComplete: (exec: DynamicExecutor.IExecution): void => {\n        const op: IAutoBeRealizeTestOperation = {\n          name: exec.name,\n          location: exec.location,\n          value: exec.value,\n          error: exec.error,\n          started_at: exec.started_at,\n          completed_at: exec.completed_at,\n        };\n        this.listener.onOperation(op).catch(() => {});\n        operations.push(op);\n      },\n      onReset: (): void => {\n        this.listener.onReset().catch(() => {});\n      },\n    });\n    return {\n      reset: config.reset ?? true,\n      simultaneous: config.simultaneous ?? 1,\n      operations,\n      started_at: start.toISOString(),\n      completed_at: new Date().toISOString(),\n    };\n  }\n}\n\nconst main = async (): Promise<void> => {\n  const worker: WorkerServer<\n    null,\n    IAutoBeRealizeTestService,\n    IAutoBeRealizeTestListener\n  > = new WorkerServer();\n  const listener: Driver<IAutoBeRealizeTestListener> = worker.getDriver();\n  const service: AutoBeRealizeTestService = new AutoBeRealizeTestService(\n    listener,\n  );\n\n  MyGlobal.testing = true;\n  await worker.open(service);\n};\nmain().catch((error) => {\n  console.log(error);\n  process.exit(-1);\n});\n",
+  "tsconfig.json": "{\n  \"compilerOptions\": {\n    /* Visit https://aka.ms/tsconfig to read more about this file */\n\n    /* Projects */\n    // \"incremental\": true,                              /* Save .tsbuildinfo files to allow for incremental compilation of projects. */\n    // \"composite\": true,                                /* Enable constraints that allow a TypeScript project to be used with project references. */\n    // \"tsBuildInfoFile\": \"./.tsbuildinfo\",              /* Specify the path to .tsbuildinfo incremental compilation file. */\n    // \"disableSourceOfProjectReferenceRedirect\": true,  /* Disable preferring source files instead of declaration files when referencing composite projects. */\n    // \"disableSolutionSearching\": true,                 /* Opt a project out of multi-project reference checking when editing. */\n    // \"disableReferencedProjectLoad\": true,             /* Reduce the number of projects loaded automatically by TypeScript. */\n\n    /* Language and Environment */\n    \"target\": \"ES2015\",                                  /* Set the JavaScript language version for emitted JavaScript and include compatible library declarations. */\n    // \"lib\": [],                                        /* Specify a set of bundled library declaration files that describe the target runtime environment. */\n    // \"jsx\": \"preserve\",                                /* Specify what JSX code is generated. */\n    \"experimentalDecorators\": true,                   /* Enable experimental support for TC39 stage 2 draft decorators. */\n    \"emitDecoratorMetadata\": true,                    /* Emit design-type metadata for decorated declarations in source files. */\n    // \"jsxFactory\": \"\",                                 /* Specify the JSX factory function used when targeting React JSX emit, e.g. 'React.createElement' or 'h'. */\n    // \"jsxFragmentFactory\": \"\",                         /* Specify the JSX Fragment reference used for fragments when targeting React JSX emit e.g. 'React.Fragment' or 'Fragment'. */\n    // \"jsxImportSource\": \"\",                            /* Specify module specifier used to import the JSX factory functions when using 'jsx: react-jsx*'. */\n    // \"reactNamespace\": \"\",                             /* Specify the object invoked for 'createElement'. This only applies when targeting 'react' JSX emit. */\n    // \"noLib\": true,                                    /* Disable including any library files, including the default lib.d.ts. */\n    // \"useDefineForClassFields\": true,                  /* Emit ECMAScript-standard-compliant class fields. */\n    // \"moduleDetection\": \"auto\",                        /* Control what method is used to detect module-format JS files. */\n\n    /* Modules */\n    \"module\": \"commonjs\",                                /* Specify what module code is generated. */\n    // \"rootDir\": \"./\",                                  /* Specify the root folder within your source files. */\n    // \"moduleResolution\": \"node\",                       /* Specify how TypeScript looks up a file from a given module specifier. */\n    // \"baseUrl\": \"./\",                                  /* Specify the base directory to resolve non-relative module names. */\n    \"paths\": {\n      \"@ORGANIZATION/PROJECT-api/lib/*\": [\"./src/api/*\"],\n      \"@ORGANIZATION/PROJECT-api\": [\"./src/api\"],\n    },                                      /* Specify a set of entries that re-map imports to additional lookup locations. */\n    // \"rootDirs\": [],                                   /* Allow multiple folders to be treated as one when resolving modules. */\n    // \"typeRoots\": [],                                  /* Specify multiple folders that act like './node_modules/@types'. */\n    // \"types\": [],                                      /* Specify type package names to be included without being referenced in a source file. */\n    // \"allowUmdGlobalAccess\": true,                     /* Allow accessing UMD globals from modules. */\n    // \"moduleSuffixes\": [],                             /* List of file name suffixes to search when resolving a module. */\n    // \"resolveJsonModule\": true,                        /* Enable importing .json files. */\n    // \"noResolve\": true,                                /* Disallow 'import's, 'require's or '<reference>'s from expanding the number of files TypeScript should add to a project. */\n\n    /* JavaScript Support */\n    // \"allowJs\": true,                                  /* Allow JavaScript files to be a part of your program. Use the 'checkJS' option to get errors from these files. */\n    // \"checkJs\": true,                                  /* Enable error reporting in type-checked JavaScript files. */\n    // \"maxNodeModuleJsDepth\": 1,                        /* Specify the maximum folder depth used for checking JavaScript files from 'node_modules'. Only applicable with 'allowJs'. */\n\n    /* Emit */\n    // \"declaration\": true,                              /* Generate .d.ts files from TypeScript and JavaScript files in your project. */\n    // \"declarationMap\": true,                           /* Create sourcemaps for d.ts files. */\n    // \"emitDeclarationOnly\": true,                      /* Only output d.ts files and not JavaScript files. */\n    \"sourceMap\": true,                                /* Create source map files for emitted JavaScript files. */\n    // \"outFile\": \"./\",                                  /* Specify a file that bundles all outputs into one JavaScript file. If 'declaration' is true, also designates a file that bundles all .d.ts output. */\n    \"outDir\": \"./lib\",                                   /* Specify an output folder for all emitted files. */\n    // \"removeComments\": true,                           /* Disable emitting comments. */\n    // \"noEmit\": true,                                   /* Disable emitting files from a compilation. */\n    // \"importHelpers\": true,                            /* Allow importing helper functions from tslib once per project, instead of including them per-file. */\n    // \"importsNotUsedAsValues\": \"remove\",               /* Specify emit/checking behavior for imports that are only used for types. */\n    // \"downlevelIteration\": true,                       /* Emit more compliant, but verbose and less performant JavaScript for iteration. */\n    // \"sourceRoot\": \"\",                                 /* Specify the root path for debuggers to find the reference source code. */\n    // \"mapRoot\": \"\",                                    /* Specify the location where debugger should locate map files instead of generated locations. */\n    // \"inlineSourceMap\": true,                          /* Include sourcemap files inside the emitted JavaScript. */\n    // \"inlineSources\": true,                            /* Include source code in the sourcemaps inside the emitted JavaScript. */\n    // \"emitBOM\": true,                                  /* Emit a UTF-8 Byte Order Mark (BOM) in the beginning of output files. */\n    \"newLine\": \"lf\",                                /* Set the newline character for emitting files. */\n    \"stripInternal\": true,                            /* Disable emitting declarations that have '@internal' in their JSDoc comments. */\n    // \"noEmitHelpers\": true,                            /* Disable generating custom helper functions like '__extends' in compiled output. */\n    // \"noEmitOnError\": true,                            /* Disable emitting files if any type checking errors are reported. */\n    // \"preserveConstEnums\": true,                       /* Disable erasing 'const enum' declarations in generated code. */\n    // \"declarationDir\": \"./\",                           /* Specify the output directory for generated declaration files. */\n    // \"preserveValueImports\": true,                     /* Preserve unused imported values in the JavaScript output that would otherwise be removed. */\n\n    /* Interop Constraints */\n    // \"isolatedModules\": true,                          /* Ensure that each file can be safely transpiled without relying on other imports. */\n    // \"allowSyntheticDefaultImports\": true,             /* Allow 'import x from y' when a module doesn't have a default export. */\n    \"esModuleInterop\": true,                             /* Emit additional JavaScript to ease support for importing CommonJS modules. This enables 'allowSyntheticDefaultImports' for type compatibility. */\n    // \"preserveSymlinks\": true,                         /* Disable resolving symlinks to their realpath. This correlates to the same flag in node. */\n    \"forceConsistentCasingInFileNames\": true,            /* Ensure that casing is correct in imports. */\n\n    /* Type Checking */\n    \"strict\": true,                                      /* Enable all strict type-checking options. */\n    // \"noImplicitAny\": true,                            /* Enable error reporting for expressions and declarations with an implied 'any' type. */\n    // \"strictNullChecks\": true,                         /* When type checking, take into account 'null' and 'undefined'. */\n    // \"strictFunctionTypes\": true,                      /* When assigning functions, check to ensure parameters and the return values are subtype-compatible. */\n    // \"strictBindCallApply\": true,                      /* Check that the arguments for 'bind', 'call', and 'apply' methods match the original function. */\n    // \"strictPropertyInitialization\": true,             /* Check for class properties that are declared but not set in the constructor. */\n    // \"noImplicitThis\": true,                           /* Enable error reporting when 'this' is given the type 'any'. */\n    // \"useUnknownInCatchVariables\": true,               /* Default catch clause variables as 'unknown' instead of 'any'. */\n    // \"alwaysStrict\": true,                             /* Ensure 'use strict' is always emitted. */\n    \"noUnusedLocals\": false,                           /* Enable error reporting when local variables aren't read. */\n    \"noUnusedParameters\": false,                       /* Raise an error when a function parameter isn't read. */\n    // \"exactOptionalPropertyTypes\": true,               /* Interpret optional property types as written, rather than adding 'undefined'. */\n    \"noImplicitReturns\": true,                        /* Enable error reporting for codepaths that do not explicitly return in a function. */\n    \"noFallthroughCasesInSwitch\": true,               /* Enable error reporting for fallthrough cases in switch statements. */\n    // \"noUncheckedIndexedAccess\": true,                 /* Add 'undefined' to a type when accessed using an index. */\n    // \"noImplicitOverride\": true,                       /* Ensure overriding members in derived classes are marked with an override modifier. */\n    // \"noPropertyAccessFromIndexSignature\": true,       /* Enforces using indexed accessors for keys declared using an indexed type. */\n    // \"allowUnusedLabels\": true,                        /* Disable error reporting for unused labels. */\n    // \"allowUnreachableCode\": true,                     /* Disable error reporting for unreachable code. */\n\n    /* Completeness */\n    // \"skipDefaultLibCheck\": true,                      /* Skip type checking .d.ts files that are included with TypeScript. */\n    \"skipLibCheck\": true,                                 /* Skip type checking all .d.ts files. */\n    \"plugins\": [\n      { \"transform\": \"typescript-transform-paths\" },\n      { \"transform\": \"typia/lib/transform\" },\n      { \n        \"transform\": \"@nestia/core/lib/transform\",\n        /**\n         * Validate request body.\n         * \n         *   - \"assert\": Use typia.assert() function\n         *   - \"is\": Use typia.is() function\n         *   - \"validate\": Use typia.validate() function\n         *   - \"assertEquals\": Use typia.assertEquals() function\n         *   - \"equals\": Use typia.equals() function\n         *   - \"validateEquals\": Use typia.validateEquals() function\n         */\n        \"validate\": \"validate\",\n        /**\n         * Validate JSON typed response body.\n         * \n         *   - \"assert\": Use typia.assertStringify() function\n         *   - \"is\": Use typia.isStringify() function\n         *   - \"validate\": Use typia.validateStringify() function\n         *   - \"validate.log\": typia.validateStringify(), but do not throw and just log it\n         *   - \"stringify\": Use typia.stringify() function, but dangerous\n         *   - null: Just use JSON.stringify() function, without boosting\n         */\n        \"stringify\": \"assert\",\n      },\n    ]\n  },\n  \"include\": [\n    \"src\"\n  ],\n  \"exclude\": [\n    \"node_modules\",\n    \"packages\",\n  ]\n}\n",
   "test/autobe/compiler/IAutoBeRealizeTestOperation.ts": "//---------------------------------------------------\n// Cloned from @autobe/interface\n//---------------------------------------------------\nimport { tags } from \"typia\";\n\n/**\n * Detailed result interface representing the execution outcome of an individual\n * E2E test function during comprehensive backend implementation validation.\n *\n * This interface captures comprehensive information about a single test\n * operation execution, including identification details, execution results,\n * error conditions, and precise timing data. Each operation represents the\n * validation of a specific API endpoint or business scenario through Test\n * agent-generated E2E test functions executed against the fully implemented\n * backend application.\n *\n * The operation result provides granular visibility into test execution\n * outcomes, enabling detailed analysis of implementation quality, business\n * logic compliance, and performance characteristics at the individual test\n * level. This detailed tracking supports comprehensive validation reporting and\n * precise identification of implementation issues when they occur.\n *\n * @author Samchon\n */\nexport interface IAutoBeRealizeTestOperation {\n  /**\n   * Unique identifier name of the executed E2E test function.\n   *\n   * Specifies the function name that was executed during this test operation,\n   * typically corresponding to the Test agent-generated test function\n   * identifier. This name provides direct traceability between test results and\n   * the specific business scenarios, API endpoints, or validation logic being\n   * tested.\n   *\n   * The test function name serves as the primary identifier for correlating\n   * execution results with the original test scenarios, enabling stakeholders\n   * to understand which specific functionality was validated and whether the\n   * implementation correctly fulfills the intended business requirements and\n   * API contracts.\n   */\n  name: string;\n\n  /**\n   * File system path location of the executed test function source code.\n   *\n   * Specifies the relative or absolute path to the test file that contains the\n   * executed function within the project structure. This location information\n   * enables direct navigation to the test source code for detailed analysis,\n   * debugging, result interpretation, or modification purposes.\n   *\n   * The file location provides essential context for understanding test\n   * organization, enables developers to quickly locate and examine the specific\n   * test implementation, and supports comprehensive test suite maintenance and\n   * documentation activities.\n   */\n  location: string;\n\n  /**\n   * Return value or result data produced by the test function execution.\n   *\n   * Contains the actual value returned by the test function upon completion,\n   * regardless of whether execution succeeded or failed. This could include API\n   * response objects, validation results, test data, computed values, or any\n   * other output that the test function produces as part of its business logic\n   * validation or endpoint testing.\n   *\n   * For successful test executions, this value represents the expected result\n   * that demonstrates correct implementation behavior. The return value\n   * provides insight into the test execution flow and can be analyzed to verify\n   * that API responses match expected formats, business logic produces correct\n   * outcomes, and data transformations operate as intended.\n   */\n  value: unknown;\n\n  /**\n   * Error information captured during test function execution, if any occurred.\n   *\n   * Contains detailed error information when the test function encounters\n   * exceptions, assertion failures, timeout conditions, or other error states\n   * during execution. When null, it indicates that the test completed\n   * successfully without encountering any error conditions. When present, the\n   * error provides comprehensive diagnostic information for understanding\n   * implementation issues or test failures.\n   *\n   * Error information is crucial for identifying implementation defects, API\n   * contract violations, business logic errors, integration failures, or\n   * performance issues that prevent the backend application from meeting its\n   * requirements. The error details enable developers to pinpoint specific\n   * problems and implement necessary corrections to achieve full compliance\n   * with validation scenarios.\n   */\n  error: null | unknown;\n\n  /**\n   * Precise timestamp when this specific test operation began execution.\n   *\n   * Records the exact moment when this individual test function started\n   * execution, providing the reference point for measuring test duration and\n   * understanding the temporal sequence of test operations within the overall\n   * validation process. This timestamp enables detailed performance analysis\n   * and execution timeline reconstruction.\n   *\n   * The start timestamp is essential for identifying execution patterns,\n   * analyzing test concurrency behavior, measuring individual test performance,\n   * and understanding the temporal distribution of test execution within the\n   * comprehensive validation suite.\n   */\n  started_at: string & tags.Format<\"date-time\">;\n\n  /**\n   * Precise timestamp when this specific test operation finished execution.\n   *\n   * Records the exact moment when this individual test function completed\n   * execution, regardless of whether it succeeded or failed. Combined with the\n   * start timestamp, this enables precise calculation of test execution\n   * duration and provides completion reference for the overall test timeline.\n   *\n   * The completion timestamp is valuable for performance analysis of individual\n   * test operations, identifying slow-performing test scenarios, understanding\n   * test execution efficiency, and maintaining comprehensive audit trails of\n   * the validation process. It supports optimization efforts and helps identify\n   * potential bottlenecks in either the test implementation or the backend\n   * application being validated.\n   */\n  completed_at: string & tags.Format<\"date-time\">;\n}\n",
   "test/autobe/compiler/IAutoBeRealizeTestConfig.ts": "//---------------------------------------------------\n// Cloned from @autobe/interface\n//---------------------------------------------------\n/**\n * Configuration interface defining the essential execution parameters required\n * for comprehensive E2E test suite validation against fully implemented backend\n * applications.\n *\n * This interface encapsulates the core execution settings and control\n * parameters necessary to orchestrate the final validation phase of the AutoBE\n * development pipeline. It provides streamlined configuration options that\n * control test execution behavior, database management, and performance\n * characteristics without requiring direct access to implementation files or\n * database schemas.\n *\n * The configuration assumes that the test execution environment has been\n * pre-configured with all necessary resources including generated\n * implementation files, database schemas, and package dependencies. This\n * interface focuses solely on runtime execution parameters that control how the\n * test suite operates within the prepared environment.\n *\n * This lightweight configuration approach enables flexible test execution\n * across different environments while maintaining clear separation between\n * resource provisioning and execution control, supporting both development and\n * production validation scenarios.\n *\n * @author Samchon\n */\nexport interface IAutoBeRealizeTestConfig {\n  /**\n   * Optional flag indicating whether to perform a complete database reset\n   * before test execution.\n   *\n   * When true, specifies that the test execution should begin with a\n   * comprehensive database reset, purging all existing data and reconstructing\n   * tables to their initial schema-defined state. When false, test execution\n   * proceeds with the current database state, which may contain residual data\n   * from previous operations.\n   *\n   * Database reset is crucial for ensuring test isolation, reproducibility, and\n   * deterministic results. Clean state testing eliminates interference from\n   * residual data and guarantees that each test execution cycle operates under\n   * identical baseline conditions, enabling accurate validation of backend\n   * implementation behavior.\n   *\n   * @default true\n   */\n  reset?: boolean;\n\n  /**\n   * Optional specification of the maximum number of test functions to execute\n   * concurrently during the test suite run.\n   *\n   * Defines the concurrent execution limit for E2E test functions to optimize\n   * testing performance while maintaining system stability and resource\n   * management. This value balances test execution speed with resource\n   * consumption and helps prevent system overload during comprehensive\n   * validation.\n   *\n   * Concurrent execution significantly reduces total testing time for large\n   * test suites while validating the backend application's ability to handle\n   * parallel requests correctly. The simultaneous limit ensures controlled load\n   * conditions that provide meaningful performance insights while maintaining\n   * test reliability and result accuracy.\n   *\n   * @default 1\n   */\n  simultaneous?: number;\n}\n",
   "test/autobe/compiler/IAutoBeRealizeTestResult.ts": "//---------------------------------------------------\n// Cloned from @autobe/interface\n//---------------------------------------------------\nimport { tags } from \"typia\";\n\nimport { IAutoBeRealizeTestOperation } from \"./IAutoBeRealizeTestOperation\";\n\n/**\n * Comprehensive result interface containing complete information about E2E test\n * suite execution for backend implementation validation.\n *\n * This interface represents the final consolidated results of executing the\n * entire Test agent-generated E2E test suite against the fully implemented\n * backend application. It encapsulates all aspects of the test execution\n * process including configuration parameters, individual operation results, and\n * timing information that collectively determine the validation outcome of the\n * generated backend implementation.\n *\n * The result structure provides stakeholders with comprehensive visibility into\n * the validation process, enabling detailed analysis of backend implementation\n * quality, compliance with requirements, and production readiness assessment\n * based on exhaustive functional testing.\n *\n * @author Samchon\n */\nexport interface IAutoBeRealizeTestResult {\n  /**\n   * Whether the test execution included a clean database reset before testing.\n   *\n   * Indicates if the test suite execution began with a complete database reset\n   * to ensure clean testing conditions. When true, all existing data was purged\n   * and database tables were reconstructed to their initial state before test\n   * execution commenced, guaranteeing test isolation and reproducibility.\n   *\n   * Database reset is essential for ensuring that test results are\n   * deterministic and accurately reflect the application's behavior under\n   * controlled conditions, free from interference by residual data from\n   * previous executions or development activities. This flag helps stakeholders\n   * understand the testing conditions and trust the reliability of results.\n   */\n  reset: boolean;\n\n  /**\n   * Number of test functions that were executed simultaneously during the test\n   * suite run.\n   *\n   * Specifies the concurrent execution limit that was applied during E2E test\n   * function execution to optimize testing performance while maintaining system\n   * stability. This value represents the balance between test execution speed\n   * and resource consumption that was used to validate the backend\n   * implementation's ability to handle concurrent requests.\n   *\n   * The simultaneous execution count provides insight into the load conditions\n   * under which the backend application was validated, helping stakeholders\n   * understand the concurrency testing coverage and the application's\n   * performance characteristics under parallel request scenarios.\n   */\n  simultaneous: number;\n\n  /**\n   * Complete collection of individual test operation results with detailed\n   * execution information.\n   *\n   * Contains the comprehensive array of {@link IAutoBeRealizeTestOperation}\n   * results representing every E2E test function that was executed during the\n   * validation process. Each operation result includes detailed information\n   * about test execution outcomes, return values, error conditions, timing\n   * data, and validation status for specific API endpoints or business\n   * scenarios.\n   *\n   * This complete result set enables stakeholders to perform detailed analysis\n   * of which functionality passed validation, which tests failed, what specific\n   * issues were encountered, and how the backend implementation performs under\n   * various test scenarios. The operation results serve as the authoritative\n   * record of implementation quality and compliance with established\n   * requirements.\n   */\n  operations: IAutoBeRealizeTestOperation[];\n\n  /**\n   * Timestamp when the comprehensive test suite execution was initiated.\n   *\n   * Records the exact moment when the E2E test suite execution began, marking\n   * the start of the final validation phase in the AutoBE development pipeline.\n   * This timestamp provides the reference point for understanding the complete\n   * test execution timeline and measuring the duration of comprehensive backend\n   * validation.\n   *\n   * The start timestamp is essential for performance analysis of the entire\n   * validation process, enabling stakeholders to understand test execution\n   * efficiency and identify potential optimization opportunities in the testing\n   * infrastructure or backend implementation.\n   */\n  started_at: string & tags.Format<\"date-time\">;\n\n  /**\n   * Timestamp when the entire test suite execution was finalized.\n   *\n   * Records the exact moment when all planned E2E test operations finished\n   * execution, marking the completion of the comprehensive validation process.\n   * This timestamp represents the definitive end point of the AutoBE\n   * development pipeline validation phase and provides the completion reference\n   * for calculating total validation duration.\n   *\n   * The completion timestamp serves as the official validation completion\n   * marker for stakeholders tracking project delivery milestones and provides\n   * essential audit trail information for the complete development and\n   * validation cycle. Combined with the start timestamp, it enables precise\n   * measurement of the total time required for comprehensive backend\n   * validation.\n   */\n  completed_at: string & tags.Format<\"date-time\">;\n}\n",

package/src/raw/AutoBeCompilerTestTemplate.ts

@@ -1,5 +1,5 @@
 export const AutoBeCompilerTestTemplate: Record<string, string> = {
-  "package.json": "{\n  \"private\": true,\n  \"name\": \"@ORGANIZATION/PROJECT\",\n  \"version\": \"0.1.0\",\n  \"description\": \"Starter kit of Nestia\",\n  \"main\": \"lib/index.js\",\n  \"scripts\": {\n    \"benchmark\": \"node bin/test/benchmark\",\n    \"test\": \"node bin/test\",\n    \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n    \"------------------------BUILDS------------------------\": \"\",\n    \"build\": \"npm run build:sdk && npm run build:main && npm run build:test\",\n    \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n    \"build:main\": \"rimraf lib && tsc\",\n    \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n    \"build:swagger\": \"npx nestia swagger\",\n    \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n    \"dev\": \"npm run build:test -- --watch\",\n    \"eslint\": \"eslint src && eslint test\",\n    \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n    \"prepare\": \"ts-patch install && ts-node build/env.ts\",\n    \"prettier\": \"prettier src --write && prettier test --write\",\n    \"------------------------WEBPACK------------------------\": \"\",\n    \"webpack\": \"rimraf dist && webpack\",\n    \"webpack:start\": \"cd dist && node dist/server\",\n    \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n    \"------------------------DEPLOYS------------------------\": \"\",\n    \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n    \"start\": \"node lib/executable/server\",\n    \"start:dev\": \"nest start --watch\",\n    \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia-start\"\n  },\n  \"keywords\": [\n    \"nestia\",\n    \"template\",\n    \"boilerplate\"\n  ],\n  \"author\": \"AUTHOR\",\n  \"license\": \"AGPL-3.0\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia-start/issues\"\n  },\n  \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n  \"devDependencies\": {\n    \"@nestia/benchmark\": \"^7.3.3\",\n    \"@nestia/e2e\": \"^7.3.3\",\n    \"@nestia/sdk\": \"^7.3.3\",\n    \"@nestjs/cli\": \"^11.0.7\",\n    \"@rollup/plugin-terser\": \"^0.4.4\",\n    \"@rollup/plugin-typescript\": \"^11.1.6\",\n    \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n    \"@types/cli\": \"^0.11.21\",\n    \"@types/cli-progress\": \"^3.11.5\",\n    \"@types/express\": \"^4.17.21\",\n    \"@types/inquirer\": \"^8.2.5\",\n    \"@types/node\": \"^18.11.0\",\n    \"@types/uuid\": \"^8.3.4\",\n    \"@typescript-eslint/eslint-plugin\": \"^8.1.0\",\n    \"@typescript-eslint/parser\": \"^8.1.0\",\n    \"chalk\": \"^4.1.2\",\n    \"cli\": \"^1.0.1\",\n    \"cli-progress\": \"^3.12.0\",\n    \"copy-webpack-plugin\": \"^11.0.0\",\n    \"eslint-plugin-deprecation\": \"^3.0.0\",\n    \"express\": \"^4.18.2\",\n    \"nestia\": \"^7.3.3\",\n    \"prettier\": \"^3.2.4\",\n    \"prettier-plugin-prisma\": \"^5.0.0\",\n    \"prisma-markdown\": \"^3.0.1\",\n    \"rimraf\": \"^3.0.2\",\n    \"rollup\": \"^4.18.0\",\n    \"source-map-support\": \"^0.5.21\",\n    \"swagger-ui-express\": \"^5.0.0\",\n    \"ts-loader\": \"^9.5.1\",\n    \"ts-node\": \"^10.9.1\",\n    \"ts-patch\": \"^3.3.0\",\n    \"typescript\": \"~5.9.2\",\n    \"typescript-transform-paths\": \"^3.5.5\",\n    \"webpack\": \"^5.89.0\",\n    \"webpack-cli\": \"^5.1.4\",\n    \"write-file-webpack-plugin\": \"^4.5.1\"\n  },\n  \"dependencies\": {\n    \"@nestia/core\": \"^7.3.3\",\n    \"@nestia/fetcher\": \"^7.3.3\",\n    \"@nestjs/common\": \"^11.1.3\",\n    \"@nestjs/core\": \"^11.1.3\",\n    \"@nestjs/platform-express\": \"^11.1.3\",\n    \"@prisma/client\": \"^6.11.1\",\n    \"commander\": \"10.0.0\",\n    \"dotenv\": \"^16.3.1\",\n    \"dotenv-expand\": \"^10.0.0\",\n    \"inquirer\": \"8.2.5\",\n    \"prisma\": \"^6.11.1\",\n    \"serialize-error\": \"^4.1.0\",\n    \"tgrid\": \"^1.1.0\",\n    \"tstl\": \"^3.0.0\",\n    \"typia\": \"^9.7.1\",\n    \"uuid\": \"^9.0.0\"\n  },\n  \"stackblitz\": {\n    \"startCommand\": \"npm run prepare && npm run build:test && npm run test -- --simultaneous 1\"\n  }\n}\n",
+  "package.json": "{\n  \"private\": true,\n  \"name\": \"@ORGANIZATION/PROJECT\",\n  \"version\": \"0.1.0\",\n  \"description\": \"Starter kit of Nestia\",\n  \"main\": \"lib/index.js\",\n  \"scripts\": {\n    \"benchmark\": \"node bin/test/benchmark\",\n    \"test\": \"node bin/test\",\n    \"test:webpack\": \"npm run webpack && node bin/test/webpack.js\",\n    \"------------------------BUILDS------------------------\": \"\",\n    \"build\": \"npm run build:sdk && npm run build:main && npm run build:test\",\n    \"build:api\": \"rimraf packages/api/lib && nestia all && rimraf packages/api/lib && tsc -p packages/api/tsconfig.json && rollup -c packages/api/rollup.config.js\",\n    \"build:main\": \"rimraf lib && tsc\",\n    \"build:sdk\": \"rimraf src/api/functional && nestia sdk\",\n    \"build:swagger\": \"npx nestia swagger\",\n    \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n    \"dev\": \"npm run build:test -- --watch\",\n    \"eslint\": \"eslint src && eslint test\",\n    \"eslint:fix\": \"eslint --fix src && eslint --fix test\",\n    \"prepare\": \"ts-patch install && ts-node build/env.ts\",\n    \"prettier\": \"prettier src --write && prettier test --write\",\n    \"------------------------WEBPACK------------------------\": \"\",\n    \"webpack\": \"rimraf dist && webpack\",\n    \"webpack:start\": \"cd dist && node dist/server\",\n    \"webpack:test\": \"npm run webpack && node bin/test/webpack.js\",\n    \"------------------------DEPLOYS------------------------\": \"\",\n    \"package:api\": \"npm run build:api && cd packages/api && npm publish\",\n    \"start\": \"node lib/executable/server\",\n    \"start:dev\": \"nest start --watch\",\n    \"start:swagger\": \"ts-node src/executable/swagger.ts\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia-start\"\n  },\n  \"keywords\": [\n    \"nestia\",\n    \"template\",\n    \"boilerplate\"\n  ],\n  \"author\": \"AUTHOR\",\n  \"license\": \"AGPL-3.0\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia-start/issues\"\n  },\n  \"homepage\": \"https://github.com/samchon/nestia-start#readme\",\n  \"devDependencies\": {\n    \"@nestia/benchmark\": \"^7.4.0\",\n    \"@nestia/e2e\": \"^7.4.0\",\n    \"@nestia/sdk\": \"^7.4.0\",\n    \"@nestjs/cli\": \"^11.0.7\",\n    \"@rollup/plugin-terser\": \"^0.4.4\",\n    \"@rollup/plugin-typescript\": \"^11.1.6\",\n    \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n    \"@types/cli\": \"^0.11.21\",\n    \"@types/cli-progress\": \"^3.11.5\",\n    \"@types/express\": \"^4.17.21\",\n    \"@types/inquirer\": \"^8.2.5\",\n    \"@types/node\": \"^18.11.0\",\n    \"@types/uuid\": \"^8.3.4\",\n    \"@typescript-eslint/eslint-plugin\": \"^8.1.0\",\n    \"@typescript-eslint/parser\": \"^8.1.0\",\n    \"chalk\": \"^4.1.2\",\n    \"cli\": \"^1.0.1\",\n    \"cli-progress\": \"^3.12.0\",\n    \"copy-webpack-plugin\": \"^11.0.0\",\n    \"eslint-plugin-deprecation\": \"^3.0.0\",\n    \"express\": \"^4.18.2\",\n    \"nestia\": \"^7.4.0\",\n    \"prettier\": \"^3.2.4\",\n    \"prettier-plugin-prisma\": \"^5.0.0\",\n    \"prisma-markdown\": \"^3.0.1\",\n    \"rimraf\": \"^3.0.2\",\n    \"rollup\": \"^4.18.0\",\n    \"source-map-support\": \"^0.5.21\",\n    \"swagger-ui-express\": \"^5.0.0\",\n    \"ts-loader\": \"^9.5.1\",\n    \"ts-node\": \"^10.9.1\",\n    \"ts-patch\": \"^3.3.0\",\n    \"typescript\": \"~5.9.2\",\n    \"typescript-transform-paths\": \"^3.5.5\",\n    \"webpack\": \"^5.89.0\",\n    \"webpack-cli\": \"^5.1.4\",\n    \"write-file-webpack-plugin\": \"^4.5.1\"\n  },\n  \"dependencies\": {\n    \"@nestia/core\": \"^7.4.0\",\n    \"@nestia/fetcher\": \"^7.4.0\",\n    \"@nestjs/common\": \"^11.1.3\",\n    \"@nestjs/core\": \"^11.1.3\",\n    \"@nestjs/platform-express\": \"^11.1.3\",\n    \"@prisma/client\": \"^6.11.1\",\n    \"commander\": \"10.0.0\",\n    \"dotenv\": \"^16.3.1\",\n    \"dotenv-expand\": \"^10.0.0\",\n    \"inquirer\": \"8.2.5\",\n    \"prisma\": \"^6.11.1\",\n    \"serialize-error\": \"^4.1.0\",\n    \"tgrid\": \"^1.1.0\",\n    \"tstl\": \"^3.0.0\",\n    \"typia\": \"^9.7.1\",\n    \"uuid\": \"^9.0.0\"\n  },\n  \"stackblitz\": {\n    \"startCommand\": \"npm run prepare && npm run build:test && npm run test -- --simultaneous 1\"\n  }\n}\n",
   "src/setup/MySetupWizard.ts": "export namespace MySetupWizard {\n  export async function schema(): Promise<void> {\n    console.log(\"Realize agent has not generated main program yet.\");\n  }\n\n  export async function seed(): Promise<void> {}\n}\n",
   "test/helpers/TestAutomation.ts": "import api from \"@ORGANIZATION/PROJECT-api\";\nimport { DynamicExecutor } from \"@nestia/e2e\";\nimport { sleep_for } from \"tstl\";\n\nimport { MyConfiguration } from \"../../src/MyConfiguration\";\nimport { MySetupWizard } from \"../../src/setup/MySetupWizard\";\n\nexport namespace TestAutomation {\n  export interface IProps<T> {\n    open(options: IOptions): Promise<T>;\n    close(backend: T): Promise<void>;\n    onComplete(exec: DynamicExecutor.IExecution): void;\n    onReset(): void;\n    options: IOptions;\n  }\n\n  export interface IOptions {\n    reset: boolean;\n    simultaneous: number;\n    include?: string[];\n    exclude?: string[];\n  }\n\n  export const execute = async <T>(\n    props: IProps<T>,\n  ): Promise<DynamicExecutor.IReport> => {\n    // RESET\n    if (props.options.reset === true) {\n      await MySetupWizard.schema();\n      await MySetupWizard.seed();\n      await props.onReset();\n    }\n\n    // OPEN BACKEND\n    const backend: T = await props.open(props.options);\n    const connection: api.IConnection = {\n      host: `http://127.0.0.1:${MyConfiguration.API_PORT()}`,\n    };\n\n    // DO TEST\n    const report: DynamicExecutor.IReport = await DynamicExecutor.validate({\n      prefix: \"test\",\n      location: __dirname + \"/../features\",\n      parameters: () => [\n        {\n          host: connection.host,\n        } satisfies api.IConnection,\n      ],\n      filter: (func) =>\n        (!props.options.include?.length ||\n          (props.options.include ?? []).some((str) => func.includes(str))) &&\n        (!props.options.exclude?.length ||\n          (props.options.exclude ?? []).every((str) => !func.includes(str))),\n      onComplete: props.onComplete,\n      simultaneous: props.options.simultaneous,\n      extension: __filename.split(\".\").pop()!,\n    });\n\n    // TERMINATE\n    await sleep_for(2500);\n    await props.close(backend);\n    return report;\n  };\n}\n",
   "test/helpers/TestAutomationStdio.ts": "import { DynamicExecutor } from \"@nestia/e2e\";\nimport chalk from \"chalk\";\n\nimport { ArgumentParser } from \"./ArgumentParser\";\nimport { TestAutomation } from \"./TestAutomation\";\n\nexport namespace TestAutomationStdio {\n  export const getOptions = () =>\n    ArgumentParser.parse<TestAutomation.IOptions>(\n      async (command, prompt, action) => {\n        command.option(\"--reset <true|false>\", \"reset local DB or not\");\n        command.option(\n          \"--simultaneous <number>\",\n          \"number of simultaneous requests\",\n        );\n        command.option(\"--include <string...>\", \"include feature files\");\n        command.option(\"--exclude <string...>\", \"exclude feature files\");\n\n        return action(async (options) => {\n          // reset\n          if (typeof options.reset === \"string\")\n            options.reset = options.reset === \"true\";\n          options.reset ??= await prompt.boolean(\"reset\")(\"Reset local DB\");\n\n          // simultaneous\n          options.simultaneous = Number(\n            options.simultaneous ??\n              (await prompt.number(\"simultaneous\")(\n                \"Number of simultaneous requests to make\",\n              )),\n          );\n          if (isNaN(options.simultaneous) || options.simultaneous <= 0)\n            options.simultaneous = 1;\n          return options as TestAutomation.IOptions;\n        });\n      },\n    );\n\n  export const onComplete = (exec: DynamicExecutor.IExecution): void => {\n    const trace = (str: string) =>\n      console.log(`  - ${chalk.green(exec.name)}: ${str}`);\n    if (exec.error === null) {\n      const elapsed: number =\n        new Date(exec.completed_at).getTime() -\n        new Date(exec.started_at).getTime();\n      trace(`${chalk.yellow(elapsed.toLocaleString())} ms`);\n    } else trace(chalk.red(exec.error.name));\n  };\n\n  export const onReset = (start: Date) => (): void => {\n    const now: Date = new Date();\n    console.log(\n      `  - Reset DB: ${(now.getDate() - start.getDate()).toLocaleString()} ms`,\n    );\n  };\n\n  export const report = (report: DynamicExecutor.IReport): void => {\n    const exceptions: Error[] = report.executions\n      .filter((exec) => exec.error !== null)\n      .map((exec) => exec.error!);\n    if (exceptions.length === 0) {\n      console.log(\"Success\");\n      console.log(\"Elapsed time\", report.time.toLocaleString(), `ms`);\n    } else {\n      for (const exp of exceptions) console.log(exp);\n      console.log(\"Failed\");\n      console.log(\"Elapsed time\", report.time.toLocaleString(), `ms`);\n      process.exit(-1);\n    }\n  };\n}\n",

package/src/raw/nestjs.json

@@ -11602,7 +11602,7 @@
   "node_modules/@nestia/benchmark/lib/internal/DynamicBenchmarkReporter.d.ts": "import { DynamicBenchmarker } from \"../DynamicBenchmarker\";\nexport declare namespace DynamicBenchmarkReporter {\n    const markdown: (report: DynamicBenchmarker.IReport) => string;\n}\n",
   "node_modules/@nestia/benchmark/lib/internal/IBenchmarkMaster.d.ts": "export interface IBenchmarkMaster {\n    filter: (name: string) => boolean;\n    progress: (current: number) => void;\n}\n",
   "node_modules/@nestia/benchmark/lib/internal/IBenchmarkServant.d.ts": "import { IBenchmarkEvent } from \"../IBenchmarkEvent\";\nexport interface IBenchmarkServant {\n    execute(props: {\n        count: number;\n        simultaneous: number;\n    }): Promise<IBenchmarkEvent[]>;\n}\n",
-  "node_modules/@nestia/benchmark/package.json": "{\n  \"name\": \"@nestia/benchmark\",\n  \"version\": \"7.3.3\",\n  \"description\": \"NestJS Performance Benchmark Program\",\n  \"main\": \"lib/index.js\",\n  \"typings\": \"lib/index.d.ts\",\n  \"scripts\": {\n    \"build\": \"npm run build:main && npm run build:test\",\n    \"build:main\": \"rimraf lib && tsc\",\n    \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n    \"dev\": \"npm run build:test -- --watch\",\n    \"prepare\": \"ts-patch install\",\n    \"test\": \"node bin/test\"\n  },\n  \"keywords\": [\n    \"e2e\",\n    \"nestia\",\n    \"nestjs\",\n    \"Performance\",\n    \"benchmark\"\n  ],\n  \"author\": \"Jeongho Nam\",\n  \"license\": \"MIT\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia/issues\"\n  },\n  \"homepage\": \"https://nestia.io\",\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia\"\n  },\n  \"dependencies\": {\n    \"@nestia/fetcher\": \"^7.3.3\",\n    \"tgrid\": \"^1.1.0\",\n    \"tstl\": \"^3.0.0\"\n  },\n  \"devDependencies\": {\n    \"@nestia/core\": \"^7.3.3\",\n    \"@nestia/e2e\": \"^7.3.3\",\n    \"@nestia/sdk\": \"^7.3.3\",\n    \"@nestjs/common\": \"^11.0.13\",\n    \"@nestjs/core\": \"^11.0.13\",\n    \"@nestjs/platform-express\": \"^11.0.13\",\n    \"@types/uuid\": \"^10.0.0\",\n    \"nestia\": \"workspace:^\",\n    \"ts-node\": \"^10.9.2\",\n    \"ts-patch\": \"^3.3.0\",\n    \"typescript\": \"~5.9.2\",\n    \"typescript-transform-paths\": \"^3.4.7\",\n    \"typia\": \"^9.6.1\",\n    \"uuid\": \"^10.0.0\"\n  },\n  \"files\": [\n    \"lib\",\n    \"src\",\n    \"README.md\",\n    \"LICENSE\",\n    \"package.json\"\n  ]\n}",
+  "node_modules/@nestia/benchmark/package.json": "{\n  \"name\": \"@nestia/benchmark\",\n  \"version\": \"7.4.0\",\n  \"description\": \"NestJS Performance Benchmark Program\",\n  \"main\": \"lib/index.js\",\n  \"typings\": \"lib/index.d.ts\",\n  \"scripts\": {\n    \"build\": \"npm run build:main && npm run build:test\",\n    \"build:main\": \"rimraf lib && tsc\",\n    \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n    \"dev\": \"npm run build:test -- --watch\",\n    \"prepare\": \"ts-patch install\",\n    \"test\": \"node bin/test\"\n  },\n  \"keywords\": [\n    \"e2e\",\n    \"nestia\",\n    \"nestjs\",\n    \"Performance\",\n    \"benchmark\"\n  ],\n  \"author\": \"Jeongho Nam\",\n  \"license\": \"MIT\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia/issues\"\n  },\n  \"homepage\": \"https://nestia.io\",\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia\"\n  },\n  \"dependencies\": {\n    \"@nestia/fetcher\": \"^7.4.0\",\n    \"tgrid\": \"^1.1.0\",\n    \"tstl\": \"^3.0.0\"\n  },\n  \"devDependencies\": {\n    \"@nestia/core\": \"^7.4.0\",\n    \"@nestia/e2e\": \"^7.4.0\",\n    \"@nestia/sdk\": \"^7.4.0\",\n    \"@nestjs/common\": \"^11.0.13\",\n    \"@nestjs/core\": \"^11.0.13\",\n    \"@nestjs/platform-express\": \"^11.0.13\",\n    \"@types/uuid\": \"^10.0.0\",\n    \"nestia\": \"workspace:^\",\n    \"ts-node\": \"^10.9.2\",\n    \"ts-patch\": \"^3.3.0\",\n    \"typescript\": \"~5.9.2\",\n    \"typescript-transform-paths\": \"^3.4.7\",\n    \"typia\": \"^9.6.1\",\n    \"uuid\": \"^10.0.0\"\n  },\n  \"files\": [\n    \"lib\",\n    \"src\",\n    \"README.md\",\n    \"LICENSE\",\n    \"package.json\"\n  ]\n}",
   "node_modules/@nestia/core/lib/adaptors/WebSocketAdaptor.d.ts": "import { INestApplication } from \"@nestjs/common\";\nexport declare class WebSocketAdaptor {\n    static upgrade(app: INestApplication): Promise<WebSocketAdaptor>;\n    readonly close: () => Promise<void>;\n    private constructor();\n    private readonly handleUpgrade;\n    private readonly http;\n    private readonly operators;\n    private readonly ws;\n}\n",
   "node_modules/@nestia/core/lib/decorators/DynamicModule.d.ts": "import { ModuleMetadata } from \"@nestjs/common/interfaces\";\n/**\n * Dynamic module.\n *\n * `DynamicModule` is a namespace wrapping a convenient function, which can load\n * controller classes dynamically just by specifying their directory path.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace DynamicModule {\n    /**\n     * Mount dynamic module.\n     *\n     * Constructs a module instance with directory path of controller classes.\n     *\n     * Every controller classes in the target directory would be dynamically\n     * mounted.\n     *\n     * @param path Path of controllers\n     * @param metadata Additional metadata except controllers\n     * @returns Module instance\n     */\n    function mount(path: string | string[] | {\n        include: string[];\n        exclude?: string[];\n    }, metadata?: Omit<ModuleMetadata, \"controllers\">, isTsNode?: boolean): Promise<{\n        new (): {};\n    }>;\n}\n",
   "node_modules/@nestia/core/lib/decorators/EncryptedBody.d.ts": "import { IRequestBodyValidator } from \"../options/IRequestBodyValidator\";\n/**\n * Encrypted body decorator.\n *\n * `EncryptedBody` is a decorator function getting `application/json` typed data\n * from request body which has been encrypted by AES-128/256 algorithm. Also,\n * `EncryptedBody` validates the request body data type through\n * [typia](https://github.com/samchon/typia) ad the validation speed is maximum\n * 15,000x times faster than `class-validator`.\n *\n * For reference, when the request body data is not following the promised type\n * `T`, `BadRequestException` error (status code: 400) would be thrown. Also,\n * `EncryptedRoute` decrypts request body using those options.\n *\n * - AES-128/256\n * - CBC mode\n * - PKCS #5 Padding\n * - Base64 Encoding\n *\n * @author Jeongho Nam - https://github.com/samchon\n * @returns Parameter decorator\n */\nexport declare function EncryptedBody<T>(validator?: IRequestBodyValidator<T>): ParameterDecorator;\n",
@@ -11702,7 +11702,7 @@
   "node_modules/minimatch/dist/esm/index.d.ts": "import { AST } from './ast.js';\ntype Platform = 'aix' | 'android' | 'darwin' | 'freebsd' | 'haiku' | 'linux' | 'openbsd' | 'sunos' | 'win32' | 'cygwin' | 'netbsd';\nexport interface MinimatchOptions {\n    nobrace?: boolean;\n    nocomment?: boolean;\n    nonegate?: boolean;\n    debug?: boolean;\n    noglobstar?: boolean;\n    noext?: boolean;\n    nonull?: boolean;\n    windowsPathsNoEscape?: boolean;\n    allowWindowsEscape?: boolean;\n    partial?: boolean;\n    dot?: boolean;\n    nocase?: boolean;\n    nocaseMagicOnly?: boolean;\n    magicalBraces?: boolean;\n    matchBase?: boolean;\n    flipNegate?: boolean;\n    preserveMultipleSlashes?: boolean;\n    optimizationLevel?: number;\n    platform?: Platform;\n    windowsNoMagicRoot?: boolean;\n}\nexport declare const minimatch: {\n    (p: string, pattern: string, options?: MinimatchOptions): boolean;\n    sep: Sep;\n    GLOBSTAR: typeof GLOBSTAR;\n    filter: (pattern: string, options?: MinimatchOptions) => (p: string) => boolean;\n    defaults: (def: MinimatchOptions) => typeof minimatch;\n    braceExpand: (pattern: string, options?: MinimatchOptions) => string[];\n    makeRe: (pattern: string, options?: MinimatchOptions) => false | MMRegExp;\n    match: (list: string[], pattern: string, options?: MinimatchOptions) => string[];\n    AST: typeof AST;\n    Minimatch: typeof Minimatch;\n    escape: (s: string, { windowsPathsNoEscape, }?: Pick<MinimatchOptions, \"windowsPathsNoEscape\">) => string;\n    unescape: (s: string, { windowsPathsNoEscape, }?: Pick<MinimatchOptions, \"windowsPathsNoEscape\">) => string;\n};\ntype Sep = '\\\\' | '/';\nexport declare const sep: Sep;\nexport declare const GLOBSTAR: unique symbol;\nexport declare const filter: (pattern: string, options?: MinimatchOptions) => (p: string) => boolean;\nexport declare const defaults: (def: MinimatchOptions) => typeof minimatch;\nexport declare const braceExpand: (pattern: string, options?: MinimatchOptions) => string[];\nexport declare const makeRe: (pattern: string, options?: MinimatchOptions) => false | MMRegExp;\nexport declare const match: (list: string[], pattern: string, options?: MinimatchOptions) => string[];\nexport type MMRegExp = RegExp & {\n    _src?: string;\n    _glob?: string;\n};\nexport type ParseReturnFiltered = string | MMRegExp | typeof GLOBSTAR;\nexport type ParseReturn = ParseReturnFiltered | false;\nexport declare class Minimatch {\n    options: MinimatchOptions;\n    set: ParseReturnFiltered[][];\n    pattern: string;\n    windowsPathsNoEscape: boolean;\n    nonegate: boolean;\n    negate: boolean;\n    comment: boolean;\n    empty: boolean;\n    preserveMultipleSlashes: boolean;\n    partial: boolean;\n    globSet: string[];\n    globParts: string[][];\n    nocase: boolean;\n    isWindows: boolean;\n    platform: Platform;\n    windowsNoMagicRoot: boolean;\n    regexp: false | null | MMRegExp;\n    constructor(pattern: string, options?: MinimatchOptions);\n    hasMagic(): boolean;\n    debug(..._: any[]): void;\n    make(): void;\n    preprocess(globParts: string[][]): string[][];\n    adjascentGlobstarOptimize(globParts: string[][]): string[][];\n    levelOneOptimize(globParts: string[][]): string[][];\n    levelTwoFileOptimize(parts: string | string[]): string[];\n    firstPhasePreProcess(globParts: string[][]): string[][];\n    secondPhasePreProcess(globParts: string[][]): string[][];\n    partsMatch(a: string[], b: string[], emptyGSMatch?: boolean): false | string[];\n    parseNegate(): void;\n    matchOne(file: string[], pattern: ParseReturn[], partial?: boolean): boolean;\n    braceExpand(): string[];\n    parse(pattern: string): ParseReturn;\n    makeRe(): false | MMRegExp;\n    slashSplit(p: string): string[];\n    match(f: string, partial?: boolean): boolean;\n    static defaults(def: MinimatchOptions): typeof Minimatch;\n}\nexport { AST } from './ast.js';\nexport { escape } from './escape.js';\nexport { unescape } from './unescape.js';\n//# sourceMappingURL=index.d.ts.map",
   "node_modules/minimatch/dist/esm/unescape.d.ts": "import { MinimatchOptions } from './index.js';\n/**\n * Un-escape a string that has been escaped with {@link escape}.\n *\n * If the {@link windowsPathsNoEscape} option is used, then square-brace\n * escapes are removed, but not backslash escapes.  For example, it will turn\n * the string `'[*]'` into `*`, but it will not turn `'\\\\*'` into `'*'`,\n * becuase `\\` is a path separator in `windowsPathsNoEscape` mode.\n *\n * When `windowsPathsNoEscape` is not set, then both brace escapes and\n * backslash escapes are removed.\n *\n * Slashes (and backslashes in `windowsPathsNoEscape` mode) cannot be escaped\n * or unescaped.\n */\nexport declare const unescape: (s: string, { windowsPathsNoEscape, }?: Pick<MinimatchOptions, \"windowsPathsNoEscape\">) => string;\n//# sourceMappingURL=unescape.d.ts.map",
   "node_modules/minimatch/package.json": "{\n  \"author\": \"Isaac Z. Schlueter <i@izs.me> (http://blog.izs.me)\",\n  \"name\": \"minimatch\",\n  \"description\": \"a glob matcher in javascript\",\n  \"version\": \"3.1.2\",\n  \"publishConfig\": {\n    \"tag\": \"v3-legacy\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"git://github.com/isaacs/minimatch.git\"\n  },\n  \"main\": \"minimatch.js\",\n  \"scripts\": {\n    \"test\": \"tap\",\n    \"preversion\": \"npm test\",\n    \"postversion\": \"npm publish\",\n    \"postpublish\": \"git push origin --all; git push origin --tags\"\n  },\n  \"engines\": {\n    \"node\": \"*\"\n  },\n  \"dependencies\": {\n    \"brace-expansion\": \"^1.1.7\"\n  },\n  \"devDependencies\": {\n    \"tap\": \"^15.1.6\"\n  },\n  \"license\": \"ISC\",\n  \"files\": [\n    \"minimatch.js\"\n  ]\n}\n",
-  "node_modules/@nestia/core/package.json": "{\n  \"name\": \"@nestia/core\",\n  \"version\": \"7.3.3\",\n  \"description\": \"Super-fast validation decorators of NestJS\",\n  \"main\": \"lib/index.js\",\n  \"typings\": \"lib/index.d.ts\",\n  \"tsp\": {\n    \"tscOptions\": {\n      \"parseAllJsDoc\": true\n    }\n  },\n  \"scripts\": {\n    \"build\": \"rimraf lib && tsc\",\n    \"dev\": \"tsc -p tsconfig.test.json --watch\",\n    \"eslint\": \"eslint ./**/*.ts\",\n    \"eslint:fix\": \"eslint ./**/*.ts --fix\",\n    \"prepare\": \"ts-patch install && typia patch\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia\"\n  },\n  \"keywords\": [\n    \"nestjs\",\n    \"nestia\",\n    \"typia\",\n    \"validator\",\n    \"decorator\",\n    \"class-validator\",\n    \"class-transformer\"\n  ],\n  \"author\": \"Jeongho Nam\",\n  \"license\": \"MIT\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia/issues\"\n  },\n  \"homepage\": \"https://nestia.io\",\n  \"dependencies\": {\n    \"@nestia/fetcher\": \"^7.3.3\",\n    \"@nestjs/common\": \">=7.0.1\",\n    \"@nestjs/core\": \">=7.0.1\",\n    \"@samchon/openapi\": \"^4.5.0\",\n    \"detect-ts-node\": \"^1.0.5\",\n    \"get-function-location\": \"^2.0.0\",\n    \"glob\": \"^11.0.3\",\n    \"path-parser\": \"^6.1.0\",\n    \"raw-body\": \"^2.0.0\",\n    \"reflect-metadata\": \">=0.1.12\",\n    \"rxjs\": \">=6.0.3\",\n    \"tgrid\": \"^1.1.0\",\n    \"typia\": \"^9.6.1\",\n    \"ws\": \"^7.5.3\"\n  },\n  \"peerDependencies\": {\n    \"@nestia/fetcher\": \">=7.3.3\",\n    \"@nestjs/common\": \">=7.0.1\",\n    \"@nestjs/core\": \">=7.0.1\",\n    \"@samchon/openapi\": \">=4.5.0 <5.0.0\",\n    \"reflect-metadata\": \">=0.1.12\",\n    \"rxjs\": \">=6.0.3\",\n    \"typia\": \"^9.6.1\"\n  },\n  \"devDependencies\": {\n    \"@nestjs/common\": \"^11.0.13\",\n    \"@nestjs/core\": \"^11.0.13\",\n    \"@types/express\": \"^4.17.15\",\n    \"@types/inquirer\": \"^9.0.3\",\n    \"@types/multer\": \"^1.4.12\",\n    \"@types/ts-expose-internals\": \"npm:ts-expose-internals@5.4.5\",\n    \"@types/ws\": \"^8.5.10\",\n    \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n    \"@typescript-eslint/parser\": \"^5.46.1\",\n    \"commander\": \"^10.0.0\",\n    \"comment-json\": \"^4.2.3\",\n    \"eslint-plugin-deprecation\": \"^1.4.1\",\n    \"fastify\": \"^4.28.1\",\n    \"git-last-commit\": \"^1.0.1\",\n    \"inquirer\": \"^8.2.5\",\n    \"rimraf\": \"^6.0.1\",\n    \"ts-node\": \"^10.9.1\",\n    \"ts-patch\": \"^3.3.0\",\n    \"tstl\": \"^3.0.0\",\n    \"typescript\": \"~5.9.2\"\n  },\n  \"files\": [\n    \"README.md\",\n    \"LICENSE\",\n    \"package.json\",\n    \"lib\",\n    \"src\"\n  ]\n}",
+  "node_modules/@nestia/core/package.json": "{\n  \"name\": \"@nestia/core\",\n  \"version\": \"7.4.0\",\n  \"description\": \"Super-fast validation decorators of NestJS\",\n  \"main\": \"lib/index.js\",\n  \"typings\": \"lib/index.d.ts\",\n  \"tsp\": {\n    \"tscOptions\": {\n      \"parseAllJsDoc\": true\n    }\n  },\n  \"scripts\": {\n    \"build\": \"rimraf lib && tsc\",\n    \"dev\": \"tsc -p tsconfig.test.json --watch\",\n    \"eslint\": \"eslint ./**/*.ts\",\n    \"eslint:fix\": \"eslint ./**/*.ts --fix\",\n    \"prepare\": \"ts-patch install && typia patch\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia\"\n  },\n  \"keywords\": [\n    \"nestjs\",\n    \"nestia\",\n    \"typia\",\n    \"validator\",\n    \"decorator\",\n    \"class-validator\",\n    \"class-transformer\"\n  ],\n  \"author\": \"Jeongho Nam\",\n  \"license\": \"MIT\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia/issues\"\n  },\n  \"homepage\": \"https://nestia.io\",\n  \"dependencies\": {\n    \"@nestia/fetcher\": \"^7.4.0\",\n    \"@nestjs/common\": \">=7.0.1\",\n    \"@nestjs/core\": \">=7.0.1\",\n    \"@samchon/openapi\": \"^4.5.0\",\n    \"detect-ts-node\": \"^1.0.5\",\n    \"get-function-location\": \"^2.0.0\",\n    \"glob\": \"^11.0.3\",\n    \"path-parser\": \"^6.1.0\",\n    \"raw-body\": \"^2.0.0\",\n    \"reflect-metadata\": \">=0.1.12\",\n    \"rxjs\": \">=6.0.3\",\n    \"tgrid\": \"^1.1.0\",\n    \"typia\": \"^9.6.1\",\n    \"ws\": \"^7.5.3\"\n  },\n  \"peerDependencies\": {\n    \"@nestia/fetcher\": \">=7.4.0\",\n    \"@nestjs/common\": \">=7.0.1\",\n    \"@nestjs/core\": \">=7.0.1\",\n    \"@samchon/openapi\": \">=4.5.0 <5.0.0\",\n    \"reflect-metadata\": \">=0.1.12\",\n    \"rxjs\": \">=6.0.3\",\n    \"typia\": \"^9.6.1\"\n  },\n  \"devDependencies\": {\n    \"@nestjs/common\": \"^11.0.13\",\n    \"@nestjs/core\": \"^11.0.13\",\n    \"@types/express\": \"^4.17.15\",\n    \"@types/inquirer\": \"^9.0.3\",\n    \"@types/multer\": \"^1.4.12\",\n    \"@types/ts-expose-internals\": \"npm:ts-expose-internals@5.4.5\",\n    \"@types/ws\": \"^8.5.10\",\n    \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n    \"@typescript-eslint/parser\": \"^5.46.1\",\n    \"commander\": \"^10.0.0\",\n    \"comment-json\": \"^4.2.3\",\n    \"eslint-plugin-deprecation\": \"^1.4.1\",\n    \"fastify\": \"^4.28.1\",\n    \"git-last-commit\": \"^1.0.1\",\n    \"inquirer\": \"^8.2.5\",\n    \"rimraf\": \"^6.0.1\",\n    \"ts-node\": \"^10.9.1\",\n    \"ts-patch\": \"^3.3.0\",\n    \"tstl\": \"^3.0.0\",\n    \"typescript\": \"~5.9.2\"\n  },\n  \"files\": [\n    \"README.md\",\n    \"LICENSE\",\n    \"package.json\",\n    \"lib\",\n    \"src\"\n  ]\n}",
   "node_modules/@nestia/core/src/typings/get-function-location.d.ts": "declare module \"get-function-location\" {\n  export default function (func: any): Promise<{\n    source: string;\n    line: number;\n    column: number;\n  }>;\n}\n",
   "node_modules/@nestia/core/node_modules/glob/dist/commonjs/glob.d.ts": "import { Minimatch } from 'minimatch';\nimport { Minipass } from 'minipass';\nimport { FSOption, Path, PathScurry } from 'path-scurry';\nimport { IgnoreLike } from './ignore.js';\nimport { Pattern } from './pattern.js';\nexport type MatchSet = Minimatch['set'];\nexport type GlobParts = Exclude<Minimatch['globParts'], undefined>;\n/**\n * A `GlobOptions` object may be provided to any of the exported methods, and\n * must be provided to the `Glob` constructor.\n *\n * All options are optional, boolean, and false by default, unless otherwise\n * noted.\n *\n * All resolved options are added to the Glob object as properties.\n *\n * If you are running many `glob` operations, you can pass a Glob object as the\n * `options` argument to a subsequent operation to share the previously loaded\n * cache.\n */\nexport interface GlobOptions {\n    /**\n     * Set to `true` to always receive absolute paths for\n     * matched files. Set to `false` to always return relative paths.\n     *\n     * When this option is not set, absolute paths are returned for patterns\n     * that are absolute, and otherwise paths are returned that are relative\n     * to the `cwd` setting.\n     *\n     * This does _not_ make an extra system call to get\n     * the realpath, it only does string path resolution.\n     *\n     * Conflicts with {@link withFileTypes}\n     */\n    absolute?: boolean;\n    /**\n     * Set to false to enable {@link windowsPathsNoEscape}\n     *\n     * @deprecated\n     */\n    allowWindowsEscape?: boolean;\n    /**\n     * The current working directory in which to search. Defaults to\n     * `process.cwd()`.\n     *\n     * May be eiher a string path or a `file://` URL object or string.\n     */\n    cwd?: string | URL;\n    /**\n     * Include `.dot` files in normal matches and `globstar`\n     * matches. Note that an explicit dot in a portion of the pattern\n     * will always match dot files.\n     */\n    dot?: boolean;\n    /**\n     * Prepend all relative path strings with `./` (or `.\\` on Windows).\n     *\n     * Without this option, returned relative paths are \"bare\", so instead of\n     * returning `'./foo/bar'`, they are returned as `'foo/bar'`.\n     *\n     * Relative patterns starting with `'../'` are not prepended with `./`, even\n     * if this option is set.\n     */\n    dotRelative?: boolean;\n    /**\n     * Follow symlinked directories when expanding `**`\n     * patterns. This can result in a lot of duplicate references in\n     * the presence of cyclic links, and make performance quite bad.\n     *\n     * By default, a `**` in a pattern will follow 1 symbolic link if\n     * it is not the first item in the pattern, or none if it is the\n     * first item in the pattern, following the same behavior as Bash.\n     */\n    follow?: boolean;\n    /**\n     * string or string[], or an object with `ignored` and `childrenIgnored`\n     * methods.\n     *\n     * If a string or string[] is provided, then this is treated as a glob\n     * pattern or array of glob patterns to exclude from matches. To ignore all\n     * children within a directory, as well as the entry itself, append `'/**'`\n     * to the ignore pattern.\n     *\n     * **Note** `ignore` patterns are _always_ in `dot:true` mode, regardless of\n     * any other settings.\n     *\n     * If an object is provided that has `ignored(path)` and/or\n     * `childrenIgnored(path)` methods, then these methods will be called to\n     * determine whether any Path is a match or if its children should be\n     * traversed, respectively.\n     */\n    ignore?: string | string[] | IgnoreLike;\n    /**\n     * Treat brace expansion like `{a,b}` as a \"magic\" pattern. Has no\n     * effect if {@link nobrace} is set.\n     *\n     * Only has effect on the {@link hasMagic} function.\n     */\n    magicalBraces?: boolean;\n    /**\n     * Add a `/` character to directory matches. Note that this requires\n     * additional stat calls in some cases.\n     */\n    mark?: boolean;\n    /**\n     * Perform a basename-only match if the pattern does not contain any slash\n     * characters. That is, `*.js` would be treated as equivalent to\n     * `**\\/*.js`, matching all js files in all directories.\n     */\n    matchBase?: boolean;\n    /**\n     * Limit the directory traversal to a given depth below the cwd.\n     * Note that this does NOT prevent traversal to sibling folders,\n     * root patterns, and so on. It only limits the maximum folder depth\n     * that the walk will descend, relative to the cwd.\n     */\n    maxDepth?: number;\n    /**\n     * Do not expand `{a,b}` and `{1..3}` brace sets.\n     */\n    nobrace?: boolean;\n    /**\n     * Perform a case-insensitive match. This defaults to `true` on macOS and\n     * Windows systems, and `false` on all others.\n     *\n     * **Note** `nocase` should only be explicitly set when it is\n     * known that the filesystem's case sensitivity differs from the\n     * platform default. If set `true` on case-sensitive file\n     * systems, or `false` on case-insensitive file systems, then the\n     * walk may return more or less results than expected.\n     */\n    nocase?: boolean;\n    /**\n     * Do not match directories, only files. (Note: to match\n     * _only_ directories, put a `/` at the end of the pattern.)\n     */\n    nodir?: boolean;\n    /**\n     * Do not match \"extglob\" patterns such as `+(a|b)`.\n     */\n    noext?: boolean;\n    /**\n     * Do not match `**` against multiple filenames. (Ie, treat it as a normal\n     * `*` instead.)\n     *\n     * Conflicts with {@link matchBase}\n     */\n    noglobstar?: boolean;\n    /**\n     * Defaults to value of `process.platform` if available, or `'linux'` if\n     * not. Setting `platform:'win32'` on non-Windows systems may cause strange\n     * behavior.\n     */\n    platform?: NodeJS.Platform;\n    /**\n     * Set to true to call `fs.realpath` on all of the\n     * results. In the case of an entry that cannot be resolved, the\n     * entry is omitted. This incurs a slight performance penalty, of\n     * course, because of the added system calls.\n     */\n    realpath?: boolean;\n    /**\n     *\n     * A string path resolved against the `cwd` option, which\n     * is used as the starting point for absolute patterns that start\n     * with `/`, (but not drive letters or UNC paths on Windows).\n     *\n     * Note that this _doesn't_ necessarily limit the walk to the\n     * `root` directory, and doesn't affect the cwd starting point for\n     * non-absolute patterns. A pattern containing `..` will still be\n     * able to traverse out of the root directory, if it is not an\n     * actual root directory on the filesystem, and any non-absolute\n     * patterns will be matched in the `cwd`. For example, the\n     * pattern `/../*` with `{root:'/some/path'}` will return all\n     * files in `/some`, not all files in `/some/path`. The pattern\n     * `*` with `{root:'/some/path'}` will return all the entries in\n     * the cwd, not the entries in `/some/path`.\n     *\n     * To start absolute and non-absolute patterns in the same\n     * path, you can use `{root:''}`. However, be aware that on\n     * Windows systems, a pattern like `x:/*` or `//host/share/*` will\n     * _always_ start in the `x:/` or `//host/share` directory,\n     * regardless of the `root` setting.\n     */\n    root?: string;\n    /**\n     * A [PathScurry](http://npm.im/path-scurry) object used\n     * to traverse the file system. If the `nocase` option is set\n     * explicitly, then any provided `scurry` object must match this\n     * setting.\n     */\n    scurry?: PathScurry;\n    /**\n     * Call `lstat()` on all entries, whether required or not to determine\n     * if it's a valid match. When used with {@link withFileTypes}, this means\n     * that matches will include data such as modified time, permissions, and\n     * so on.  Note that this will incur a performance cost due to the added\n     * system calls.\n     */\n    stat?: boolean;\n    /**\n     * An AbortSignal which will cancel the Glob walk when\n     * triggered.\n     */\n    signal?: AbortSignal;\n    /**\n     * Use `\\\\` as a path separator _only_, and\n     *  _never_ as an escape character. If set, all `\\\\` characters are\n     *  replaced with `/` in the pattern.\n     *\n     *  Note that this makes it **impossible** to match against paths\n     *  containing literal glob pattern characters, but allows matching\n     *  with patterns constructed using `path.join()` and\n     *  `path.resolve()` on Windows platforms, mimicking the (buggy!)\n     *  behavior of Glob v7 and before on Windows. Please use with\n     *  caution, and be mindful of [the caveat below about Windows\n     *  paths](#windows). (For legacy reasons, this is also set if\n     *  `allowWindowsEscape` is set to the exact value `false`.)\n     */\n    windowsPathsNoEscape?: boolean;\n    /**\n     * Return [PathScurry](http://npm.im/path-scurry)\n     * `Path` objects instead of strings. These are similar to a\n     * NodeJS `Dirent` object, but with additional methods and\n     * properties.\n     *\n     * Conflicts with {@link absolute}\n     */\n    withFileTypes?: boolean;\n    /**\n     * An fs implementation to override some or all of the defaults.  See\n     * http://npm.im/path-scurry for details about what can be overridden.\n     */\n    fs?: FSOption;\n    /**\n     * Just passed along to Minimatch.  Note that this makes all pattern\n     * matching operations slower and *extremely* noisy.\n     */\n    debug?: boolean;\n    /**\n     * Return `/` delimited paths, even on Windows.\n     *\n     * On posix systems, this has no effect.  But, on Windows, it means that\n     * paths will be `/` delimited, and absolute paths will be their full\n     * resolved UNC forms, eg instead of `'C:\\\\foo\\\\bar'`, it would return\n     * `'//?/C:/foo/bar'`\n     */\n    posix?: boolean;\n    /**\n     * Do not match any children of any matches. For example, the pattern\n     * `**\\/foo` would match `a/foo`, but not `a/foo/b/foo` in this mode.\n     *\n     * This is especially useful for cases like \"find all `node_modules`\n     * folders, but not the ones in `node_modules`\".\n     *\n     * In order to support this, the `Ignore` implementation must support an\n     * `add(pattern: string)` method. If using the default `Ignore` class, then\n     * this is fine, but if this is set to `false`, and a custom `Ignore` is\n     * provided that does not have an `add()` method, then it will throw an\n     * error.\n     *\n     * **Caveat** It *only* ignores matches that would be a descendant of a\n     * previous match, and only if that descendant is matched *after* the\n     * ancestor is encountered. Since the file system walk happens in\n     * indeterminate order, it's possible that a match will already be added\n     * before its ancestor, if multiple or braced patterns are used.\n     *\n     * For example:\n     *\n     * ```ts\n     * const results = await glob([\n     *   // likely to match first, since it's just a stat\n     *   'a/b/c/d/e/f',\n     *\n     *   // this pattern is more complicated! It must to various readdir()\n     *   // calls and test the results against a regular expression, and that\n     *   // is certainly going to take a little bit longer.\n     *   //\n     *   // So, later on, it encounters a match at 'a/b/c/d/e', but it's too\n     *   // late to ignore a/b/c/d/e/f, because it's already been emitted.\n     *   'a/[bdf]/?/[a-z]/*',\n     * ], { includeChildMatches: false })\n     * ```\n     *\n     * It's best to only set this to `false` if you can be reasonably sure that\n     * no components of the pattern will potentially match one another's file\n     * system descendants, or if the occasional included child entry will not\n     * cause problems.\n     *\n     * @default true\n     */\n    includeChildMatches?: boolean;\n}\nexport type GlobOptionsWithFileTypesTrue = GlobOptions & {\n    withFileTypes: true;\n    absolute?: undefined;\n    mark?: undefined;\n    posix?: undefined;\n};\nexport type GlobOptionsWithFileTypesFalse = GlobOptions & {\n    withFileTypes?: false;\n};\nexport type GlobOptionsWithFileTypesUnset = GlobOptions & {\n    withFileTypes?: undefined;\n};\nexport type Result<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? Path : Opts extends GlobOptionsWithFileTypesFalse ? string : Opts extends GlobOptionsWithFileTypesUnset ? string : string | Path;\nexport type Results<Opts> = Result<Opts>[];\nexport type FileTypes<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? true : Opts extends GlobOptionsWithFileTypesFalse ? false : Opts extends GlobOptionsWithFileTypesUnset ? false : boolean;\n/**\n * An object that can perform glob pattern traversals.\n */\nexport declare class Glob<Opts extends GlobOptions> implements GlobOptions {\n    absolute?: boolean;\n    cwd: string;\n    root?: string;\n    dot: boolean;\n    dotRelative: boolean;\n    follow: boolean;\n    ignore?: string | string[] | IgnoreLike;\n    magicalBraces: boolean;\n    mark?: boolean;\n    matchBase: boolean;\n    maxDepth: number;\n    nobrace: boolean;\n    nocase: boolean;\n    nodir: boolean;\n    noext: boolean;\n    noglobstar: boolean;\n    pattern: string[];\n    platform: NodeJS.Platform;\n    realpath: boolean;\n    scurry: PathScurry;\n    stat: boolean;\n    signal?: AbortSignal;\n    windowsPathsNoEscape: boolean;\n    withFileTypes: FileTypes<Opts>;\n    includeChildMatches: boolean;\n    /**\n     * The options provided to the constructor.\n     */\n    opts: Opts;\n    /**\n     * An array of parsed immutable {@link Pattern} objects.\n     */\n    patterns: Pattern[];\n    /**\n     * All options are stored as properties on the `Glob` object.\n     *\n     * See {@link GlobOptions} for full options descriptions.\n     *\n     * Note that a previous `Glob` object can be passed as the\n     * `GlobOptions` to another `Glob` instantiation to re-use settings\n     * and caches with a new pattern.\n     *\n     * Traversal functions can be called multiple times to run the walk\n     * again.\n     */\n    constructor(pattern: string | string[], opts: Opts);\n    /**\n     * Returns a Promise that resolves to the results array.\n     */\n    walk(): Promise<Results<Opts>>;\n    /**\n     * synchronous {@link Glob.walk}\n     */\n    walkSync(): Results<Opts>;\n    /**\n     * Stream results asynchronously.\n     */\n    stream(): Minipass<Result<Opts>, Result<Opts>>;\n    /**\n     * Stream results synchronously.\n     */\n    streamSync(): Minipass<Result<Opts>, Result<Opts>>;\n    /**\n     * Default sync iteration function. Returns a Generator that\n     * iterates over the results.\n     */\n    iterateSync(): Generator<Result<Opts>, void, void>;\n    [Symbol.iterator](): Generator<Result<Opts>, void, void>;\n    /**\n     * Default async iteration function. Returns an AsyncGenerator that\n     * iterates over the results.\n     */\n    iterate(): AsyncGenerator<Result<Opts>, void, void>;\n    [Symbol.asyncIterator](): AsyncGenerator<Result<Opts>, void, void>;\n}\n//# sourceMappingURL=glob.d.ts.map",
   "node_modules/@nestia/core/node_modules/glob/dist/commonjs/has-magic.d.ts": "import { GlobOptions } from './glob.js';\n/**\n * Return true if the patterns provided contain any magic glob characters,\n * given the options provided.\n *\n * Brace expansion is not considered \"magic\" unless the `magicalBraces` option\n * is set, as brace expansion just turns one string into an array of strings.\n * So a pattern like `'x{a,b}y'` would return `false`, because `'xay'` and\n * `'xby'` both do not contain any magic glob characters, and it's treated the\n * same as if you had called it on `['xay', 'xby']`. When `magicalBraces:true`\n * is in the options, brace expansion _is_ treated as a pattern having magic.\n */\nexport declare const hasMagic: (pattern: string | string[], options?: GlobOptions) => boolean;\n//# sourceMappingURL=has-magic.d.ts.map",
@@ -11740,7 +11740,7 @@
   "node_modules/@nestia/e2e/lib/index.d.ts": "import * as e2e from \"./module\";\nexport default e2e;\nexport * from \"./module\";\n",
   "node_modules/@nestia/e2e/lib/internal/json_equal_to.d.ts": "export declare const json_equal_to: (exception: (key: string) => boolean) => <T>(x: T) => (y: T | null | undefined) => string[];\n",
   "node_modules/@nestia/e2e/lib/module.d.ts": "export * from \"./ArrayUtil\";\nexport * from \"./DynamicExecutor\";\nexport * from \"./GaffComparator\";\nexport * from \"./RandomGenerator\";\nexport * from \"./TestValidator\";\n",
-  "node_modules/@nestia/e2e/package.json": "{\n  \"name\": \"@nestia/e2e\",\n  \"version\": \"7.3.3\",\n  \"description\": \"E2E test utilify functions\",\n  \"main\": \"lib/index.js\",\n  \"typings\": \"lib/index.d.ts\",\n  \"scripts\": {\n    \"build\": \"npm run build:main && npm run build:test\",\n    \"build:main\": \"rimraf lib && tsc\",\n    \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n    \"dev\": \"npm run build:test -- --watch\",\n    \"eslint\": \"eslint src && eslint test\",\n    \"prepare\": \"ts-patch install && typia patch\",\n    \"test\": \"node bin/test\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia\"\n  },\n  \"keywords\": [\n    \"e2e\",\n    \"nestia\",\n    \"nestjs\",\n    \"test\",\n    \"tdd\",\n    \"utility\"\n  ],\n  \"author\": \"Jeongho Nam\",\n  \"license\": \"MIT\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia/issues\"\n  },\n  \"homepage\": \"https://nestia.io\",\n  \"devDependencies\": {\n    \"@trivago/prettier-plugin-sort-imports\": \"^4.0.0\",\n    \"@types/node\": \"^18.11.18\",\n    \"@typescript-eslint/eslint-plugin\": \"^5.57.0\",\n    \"@typescript-eslint/parser\": \"^5.57.0\",\n    \"rimraf\": \"^6.0.1\",\n    \"ts-node\": \"^10.9.1\",\n    \"ts-patch\": \"^3.3.0\",\n    \"typescript\": \"~5.9.2\",\n    \"typescript-transform-paths\": \"^3.4.7\",\n    \"typia\": \"^9.6.1\"\n  },\n  \"files\": [\n    \"lib\",\n    \"src\",\n    \"README.md\",\n    \"LICENSE\",\n    \"package.json\"\n  ]\n}",
+  "node_modules/@nestia/e2e/package.json": "{\n  \"name\": \"@nestia/e2e\",\n  \"version\": \"7.4.0\",\n  \"description\": \"E2E test utilify functions\",\n  \"main\": \"lib/index.js\",\n  \"typings\": \"lib/index.d.ts\",\n  \"scripts\": {\n    \"build\": \"npm run build:main && npm run build:test\",\n    \"build:main\": \"rimraf lib && tsc\",\n    \"build:test\": \"rimraf bin && tsc -p test/tsconfig.json\",\n    \"dev\": \"npm run build:test -- --watch\",\n    \"eslint\": \"eslint src && eslint test\",\n    \"prepare\": \"ts-patch install && typia patch\",\n    \"test\": \"node bin/test\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia\"\n  },\n  \"keywords\": [\n    \"e2e\",\n    \"nestia\",\n    \"nestjs\",\n    \"test\",\n    \"tdd\",\n    \"utility\"\n  ],\n  \"author\": \"Jeongho Nam\",\n  \"license\": \"MIT\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia/issues\"\n  },\n  \"homepage\": \"https://nestia.io\",\n  \"devDependencies\": {\n    \"@trivago/prettier-plugin-sort-imports\": \"^4.0.0\",\n    \"@types/node\": \"^18.11.18\",\n    \"@typescript-eslint/eslint-plugin\": \"^5.57.0\",\n    \"@typescript-eslint/parser\": \"^5.57.0\",\n    \"rimraf\": \"^6.0.1\",\n    \"ts-node\": \"^10.9.1\",\n    \"ts-patch\": \"^3.3.0\",\n    \"typescript\": \"~5.9.2\",\n    \"typescript-transform-paths\": \"^3.4.7\",\n    \"typia\": \"^9.6.1\"\n  },\n  \"files\": [\n    \"lib\",\n    \"src\",\n    \"README.md\",\n    \"LICENSE\",\n    \"package.json\"\n  ]\n}",
   "node_modules/@nestia/editor/lib/NestiaEditorApplication.d.ts": "export declare function NestiaEditorApplication(): import(\"react/jsx-runtime\").JSX.Element;\n",
   "node_modules/@nestia/editor/lib/NestiaEditorIframe.d.ts": "import { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nexport declare function NestiaEditorIframe(props: NestiaEditorIframe.IProps): import(\"react/jsx-runtime\").JSX.Element;\nexport declare namespace NestiaEditorIframe {\n    interface IProps {\n        swagger: string | SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument;\n        package?: string;\n        keyword?: boolean;\n        simulate?: boolean;\n        e2e?: boolean;\n    }\n}\n",
   "node_modules/@nestia/editor/lib/NestiaEditorModule.d.ts": "import type { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nexport declare namespace NestiaEditorModule {\n    const setup: (props: {\n        path: string;\n        application: INestApplication;\n        swagger: string | SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument;\n        package?: string;\n        simulate?: boolean;\n        e2e?: boolean;\n    }) => Promise<void>;\n}\ninterface INestApplication {\n    use(...args: any[]): this;\n    getUrl(): Promise<string>;\n    getHttpAdapter(): INestHttpAdaptor;\n    setGlobalPrefix(prefix: string, options?: any): this;\n}\ninterface INestHttpAdaptor {\n    getType(): string;\n    close(): any;\n    init?(): Promise<void>;\n    get: Function;\n    post: Function;\n    put: Function;\n    patch: Function;\n    delete: Function;\n    head: Function;\n    all: Function;\n}\nexport {};\n",
@@ -11749,7 +11749,7 @@
   "node_modules/@nestia/editor/lib/internal/NestiaEditorComposer.d.ts": "import { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nimport { IValidation } from \"typia\";\nexport declare namespace NestiaEditorComposer {\n    interface IProps {\n        document: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument;\n        e2e: boolean;\n        keyword: boolean;\n        simulate: boolean;\n        package?: string;\n    }\n    interface IOutput {\n        files: Record<string, string>;\n        openFile: string;\n        startScript: string[];\n    }\n    const nest: (props: IProps) => Promise<IValidation<IOutput>>;\n    const sdk: (props: IProps) => Promise<IValidation<IOutput>>;\n}\n",
   "node_modules/@nestia/editor/lib/internal/NestiaEditorFileUploader.d.ts": "import { OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nexport declare function NestiaEditorFileUploader(props: NestiaEditorFileUploader.IProps): import(\"react/jsx-runtime\").JSX.Element;\nexport declare namespace NestiaEditorFileUploader {\n    interface IProps {\n        onChange: (swagger: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument | null, error: string | null) => void;\n    }\n}\n",
   "node_modules/@nestia/editor/lib/main.d.ts": "export {};\n",
-  "node_modules/@nestia/editor/package.json": "{\n  \"name\": \"@nestia/editor\",\n  \"version\": \"7.3.3\",\n  \"main\": \"lib/index.js\",\n  \"module\": \"lib/index.mjs\",\n  \"typings\": \"lib/index.d.ts\",\n  \"description\": \"Swagger-UI + Cloud TypeScript Editor\",\n  \"scripts\": {\n    \"build\": \"npm run build:static && npm run build:lib\",\n    \"build:static\": \"rimraf dist && tsc -b && vite build\",\n    \"build:lib\": \"rimraf lib && tsc --project tsconfig.lib.json && rollup -c\",\n    \"dev\": \"vite\",\n    \"lint\": \"eslint .\",\n    \"preview\": \"vite preview\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia\"\n  },\n  \"keywords\": [\n    \"openapi\",\n    \"swagger\",\n    \"generator\",\n    \"cloud\",\n    \"typescript\",\n    \"editor\",\n    \"sdk\",\n    \"nestjs\",\n    \"nestia\"\n  ],\n  \"author\": \"Jeongho Nam\",\n  \"license\": \"MIT\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia/issues\"\n  },\n  \"homepage\": \"https://nestia.io\",\n  \"dependencies\": {\n    \"@mui/material\": \"^5.15.6\",\n    \"@nestia/migrate\": \"^7.3.3\",\n    \"@samchon/openapi\": \"^4.5.0\",\n    \"@stackblitz/sdk\": \"^1.11.0\",\n    \"@trivago/prettier-plugin-sort-imports\": \"^5.2.2\",\n    \"js-yaml\": \"^4.1.0\",\n    \"prettier\": \"3.3.3\",\n    \"prettier-plugin-jsdoc\": \"^1.3.2\",\n    \"react-mui-fileuploader\": \"^0.5.2\",\n    \"typia\": \"^9.6.1\"\n  },\n  \"devDependencies\": {\n    \"@eslint/js\": \"^9.13.0\",\n    \"@nestjs/common\": \"^11.0.13\",\n    \"@nestjs/core\": \"^11.0.13\",\n    \"@nestjs/platform-express\": \"^11.0.13\",\n    \"@nestjs/platform-fastify\": \"^11.0.13\",\n    \"@rollup/plugin-terser\": \"^0.4.4\",\n    \"@rollup/plugin-typescript\": \"^12.1.1\",\n    \"@types/js-yaml\": \"^4.0.9\",\n    \"@types/node\": \"^22.8.6\",\n    \"@types/react\": \"^18.3.11\",\n    \"@types/react-dom\": \"^18.3.1\",\n    \"@vitejs/plugin-react\": \"^4.3.3\",\n    \"eslint\": \"^9.13.0\",\n    \"eslint-plugin-react-hooks\": \"^5.0.0\",\n    \"eslint-plugin-react-refresh\": \"^0.4.13\",\n    \"globals\": \"^15.11.0\",\n    \"react\": \"^18.3.1\",\n    \"react-dom\": \"^18.3.1\",\n    \"rollup\": \"^4.24.2\",\n    \"ts-node\": \"^10.9.2\",\n    \"typescript\": \"~5.9.2\",\n    \"typescript-eslint\": \"^8.10.0\",\n    \"vite\": \"^5.4.9\"\n  },\n  \"files\": [\n    \"README.md\",\n    \"LICENSE\",\n    \"package.json\",\n    \"dist\",\n    \"lib\",\n    \"src\"\n  ]\n}",
+  "node_modules/@nestia/editor/package.json": "{\n  \"name\": \"@nestia/editor\",\n  \"version\": \"7.4.0\",\n  \"main\": \"lib/index.js\",\n  \"module\": \"lib/index.mjs\",\n  \"typings\": \"lib/index.d.ts\",\n  \"description\": \"Swagger-UI + Cloud TypeScript Editor\",\n  \"scripts\": {\n    \"build\": \"npm run build:static && npm run build:lib\",\n    \"build:static\": \"rimraf dist && tsc -b && vite build\",\n    \"build:lib\": \"rimraf lib && tsc --project tsconfig.lib.json && rollup -c\",\n    \"dev\": \"vite\",\n    \"lint\": \"eslint .\",\n    \"preview\": \"vite preview\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia\"\n  },\n  \"keywords\": [\n    \"openapi\",\n    \"swagger\",\n    \"generator\",\n    \"cloud\",\n    \"typescript\",\n    \"editor\",\n    \"sdk\",\n    \"nestjs\",\n    \"nestia\"\n  ],\n  \"author\": \"Jeongho Nam\",\n  \"license\": \"MIT\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia/issues\"\n  },\n  \"homepage\": \"https://nestia.io\",\n  \"dependencies\": {\n    \"@mui/material\": \"^5.15.6\",\n    \"@nestia/migrate\": \"^7.4.0\",\n    \"@samchon/openapi\": \"^4.5.0\",\n    \"@stackblitz/sdk\": \"^1.11.0\",\n    \"@trivago/prettier-plugin-sort-imports\": \"^5.2.2\",\n    \"js-yaml\": \"^4.1.0\",\n    \"prettier\": \"3.3.3\",\n    \"prettier-plugin-jsdoc\": \"^1.3.2\",\n    \"react-mui-fileuploader\": \"^0.5.2\",\n    \"typia\": \"^9.6.1\"\n  },\n  \"devDependencies\": {\n    \"@eslint/js\": \"^9.13.0\",\n    \"@nestjs/common\": \"^11.0.13\",\n    \"@nestjs/core\": \"^11.0.13\",\n    \"@nestjs/platform-express\": \"^11.0.13\",\n    \"@nestjs/platform-fastify\": \"^11.0.13\",\n    \"@rollup/plugin-terser\": \"^0.4.4\",\n    \"@rollup/plugin-typescript\": \"^12.1.1\",\n    \"@types/js-yaml\": \"^4.0.9\",\n    \"@types/node\": \"^22.8.6\",\n    \"@types/react\": \"^18.3.11\",\n    \"@types/react-dom\": \"^18.3.1\",\n    \"@vitejs/plugin-react\": \"^4.3.3\",\n    \"eslint\": \"^9.13.0\",\n    \"eslint-plugin-react-hooks\": \"^5.0.0\",\n    \"eslint-plugin-react-refresh\": \"^0.4.13\",\n    \"globals\": \"^15.11.0\",\n    \"react\": \"^18.3.1\",\n    \"react-dom\": \"^18.3.1\",\n    \"rollup\": \"^4.24.2\",\n    \"ts-node\": \"^10.9.2\",\n    \"typescript\": \"~5.9.2\",\n    \"typescript-eslint\": \"^8.10.0\",\n    \"vite\": \"^5.4.9\"\n  },\n  \"files\": [\n    \"README.md\",\n    \"LICENSE\",\n    \"package.json\",\n    \"dist\",\n    \"lib\",\n    \"src\"\n  ]\n}",
   "node_modules/@nestia/editor/src/vite-env.d.ts": "/// <reference types=\"vite/client\" />\n",
   "node_modules/@nestia/fetcher/lib/AesPkcs5.d.ts": "/**\n * Utility class for the AES-128/256 encryption.\n *\n * - AES-128/256\n * - CBC mode\n * - PKCS#5 Padding\n * - Base64 Encoding\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace AesPkcs5 {\n    /**\n     * Encrypt data\n     *\n     * @param data Target data\n     * @param key Key value of the encryption.\n     * @param iv Initializer Vector for the encryption\n     * @returns Encrypted data\n     */\n    function encrypt(data: string, key: string, iv: string): string;\n    /**\n     * Decrypt data.\n     *\n     * @param data Target data\n     * @param key Key value of the decryption.\n     * @param iv Initializer Vector for the decryption\n     * @returns Decrypted data.\n     */\n    function decrypt(data: string, key: string, iv: string): string;\n}\n",
   "node_modules/@nestia/fetcher/lib/EncryptedFetcher.d.ts": "import { IConnection } from \"./IConnection\";\nimport { IFetchRoute } from \"./IFetchRoute\";\nimport { IPropagation } from \"./IPropagation\";\n/**\n * Utility class for `fetch` functions used in `@nestia/sdk` with encryption.\n *\n * `EncryptedFetcher` is a utility class designed for SDK functions generated by\n * [`@nestia/sdk`](https://nestia.io/docs/sdk/sdk), interacting with the remote\n * HTTP API encrypted by AES-PKCS algorithm. In other words, this is a\n * collection of dedicated `fetch()` functions for `@nestia/sdk` with\n * encryption.\n *\n * For reference, `EncryptedFetcher` class being used only when target\n * controller method is encrypting body data by `@EncryptedRoute` or\n * `@EncryptedBody` decorators. If those decorators are not used,\n * {@link PlainFetcher} class would be used instead.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace EncryptedFetcher {\n    /**\n     * Fetch function only for `HEAD` method.\n     *\n     * @param connection Connection information for the remote HTTP server\n     * @param route Route information about the target API\n     * @returns Nothing because of `HEAD` method\n     */\n    function fetch(connection: IConnection, route: IFetchRoute<\"HEAD\">): Promise<void>;\n    /**\n     * Fetch function only for `GET` method.\n     *\n     * @param connection Connection information for the remote HTTP server\n     * @param route Route information about the target API\n     * @returns Response body data from the remote API\n     */\n    function fetch<Output>(connection: IConnection, route: IFetchRoute<\"GET\">): Promise<Output>;\n    /**\n     * Fetch function for the `POST`, `PUT`, `PATCH` and `DELETE` methods.\n     *\n     * @param connection Connection information for the remote HTTP server\n     * @param route Route information about the target API\n     * @returns Response body data from the remote API\n     */\n    function fetch<Input, Output>(connection: IConnection, route: IFetchRoute<\"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n    function propagate<Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"GET\" | \"HEAD\">): Promise<Output>;\n    function propagate<Input, Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"DELETE\" | \"GET\" | \"HEAD\" | \"PATCH\" | \"POST\" | \"PUT\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n}\n",
@@ -11765,7 +11765,7 @@
   "node_modules/@nestia/fetcher/lib/PlainFetcher.d.ts": "import { IConnection } from \"./IConnection\";\nimport { IFetchRoute } from \"./IFetchRoute\";\nimport { IPropagation } from \"./IPropagation\";\n/**\n * Utility class for `fetch` functions used in `@nestia/sdk`.\n *\n * `PlainFetcher` is a utility class designed for SDK functions generated by\n * [`@nestia/sdk`](https://nestia.io/docs/sdk/sdk), interacting with the remote\n * HTTP sever API. In other words, this is a collection of dedicated `fetch()`\n * functions for `@nestia/sdk`.\n *\n * For reference, `PlainFetcher` class does not encrypt or decrypt the body data\n * at all. It just delivers plain data without any post processing. If you've\n * defined a controller method through `@EncryptedRoute` or `@EncryptedBody`\n * decorator, then {@liink EncryptedFetcher} class would be used instead.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport declare namespace PlainFetcher {\n    /**\n     * Fetch function only for `HEAD` method.\n     *\n     * @param connection Connection information for the remote HTTP server\n     * @param route Route information about the target API\n     * @returns Nothing because of `HEAD` method\n     */\n    function fetch(connection: IConnection, route: IFetchRoute<\"HEAD\">): Promise<void>;\n    /**\n     * Fetch function only for `GET` method.\n     *\n     * @param connection Connection information for the remote HTTP server\n     * @param route Route information about the target API\n     * @returns Response body data from the remote API\n     */\n    function fetch<Output>(connection: IConnection, route: IFetchRoute<\"GET\">): Promise<Output>;\n    /**\n     * Fetch function for the `POST`, `PUT`, `PATCH` and `DELETE` methods.\n     *\n     * @param connection Connection information for the remote HTTP server\n     * @param route Route information about the target API\n     * @returns Response body data from the remote API\n     */\n    function fetch<Input, Output>(connection: IConnection, route: IFetchRoute<\"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n    function propagate<Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"GET\" | \"HEAD\">): Promise<Output>;\n    function propagate<Input, Output extends IPropagation<any, any>>(connection: IConnection, route: IFetchRoute<\"DELETE\" | \"GET\" | \"HEAD\" | \"PATCH\" | \"POST\" | \"PUT\">, input?: Input, stringify?: (input: Input) => string): Promise<Output>;\n}\n",
   "node_modules/@nestia/fetcher/lib/index.d.ts": "export * from \"./FormDataInput\";\nexport * from \"./HttpError\";\nexport * from \"./IConnection\";\nexport * from \"./IEncryptionPassword\";\nexport * from \"./IFetchEvent\";\nexport * from \"./IFetchRoute\";\nexport * from \"./IPropagation\";\n",
   "node_modules/@nestia/fetcher/lib/internal/FetcherBase.d.ts": "export {};\n",
-  "node_modules/@nestia/fetcher/package.json": "{\n  \"name\": \"@nestia/fetcher\",\n  \"version\": \"7.3.3\",\n  \"description\": \"Fetcher library of Nestia SDK\",\n  \"main\": \"lib/index.js\",\n  \"typings\": \"lib/index.d.ts\",\n  \"scripts\": {\n    \"build\": \"rimraf lib && tsc\",\n    \"dev\": \"tsc -p tsconfig.test.json --watch\",\n    \"eslint\": \"eslint src\",\n    \"eslint:fix\": \"eslint src --fix\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia\"\n  },\n  \"keywords\": [\n    \"nestia\",\n    \"fetcher\",\n    \"sdk\"\n  ],\n  \"author\": \"Jeongho Nam\",\n  \"license\": \"MIT\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia/issues\"\n  },\n  \"homepage\": \"https://nestia.io\",\n  \"dependencies\": {\n    \"@samchon/openapi\": \"^4.5.0\"\n  },\n  \"devDependencies\": {\n    \"@types/node\": \"^18.11.14\",\n    \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n    \"@typescript-eslint/parser\": \"^5.46.1\",\n    \"rimraf\": \"^6.0.1\",\n    \"typescript\": \"~5.9.2\"\n  },\n  \"files\": [\n    \"README.md\",\n    \"LICENSE\",\n    \"package.json\",\n    \"lib\",\n    \"src\"\n  ]\n}",
+  "node_modules/@nestia/fetcher/package.json": "{\n  \"name\": \"@nestia/fetcher\",\n  \"version\": \"7.4.0\",\n  \"description\": \"Fetcher library of Nestia SDK\",\n  \"main\": \"lib/index.js\",\n  \"typings\": \"lib/index.d.ts\",\n  \"scripts\": {\n    \"build\": \"rimraf lib && tsc\",\n    \"dev\": \"tsc -p tsconfig.test.json --watch\",\n    \"eslint\": \"eslint src\",\n    \"eslint:fix\": \"eslint src --fix\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia\"\n  },\n  \"keywords\": [\n    \"nestia\",\n    \"fetcher\",\n    \"sdk\"\n  ],\n  \"author\": \"Jeongho Nam\",\n  \"license\": \"MIT\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia/issues\"\n  },\n  \"homepage\": \"https://nestia.io\",\n  \"dependencies\": {\n    \"@samchon/openapi\": \"^4.5.0\"\n  },\n  \"devDependencies\": {\n    \"@types/node\": \"^18.11.14\",\n    \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n    \"@typescript-eslint/parser\": \"^5.46.1\",\n    \"rimraf\": \"^6.0.1\",\n    \"typescript\": \"~5.9.2\"\n  },\n  \"files\": [\n    \"README.md\",\n    \"LICENSE\",\n    \"package.json\",\n    \"lib\",\n    \"src\"\n  ]\n}",
   "node_modules/@nestia/migrate/lib/NestiaMigrateApplication.d.ts": "import { IHttpMigrateApplication, OpenApi, OpenApiV3, OpenApiV3_1, SwaggerV2 } from \"@samchon/openapi\";\nimport { IValidation } from \"typia\";\nimport { INestiaMigrateConfig } from \"./structures/INestiaMigrateConfig\";\nimport { INestiaMigrateContext } from \"./structures/INestiaMigrateContext\";\nimport { INestiaMigrateFile } from \"./structures/INestiaMigrateFile\";\nexport declare class NestiaMigrateApplication {\n    readonly document: OpenApi.IDocument;\n    private readonly data_;\n    constructor(document: OpenApi.IDocument);\n    static assert(document: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument | OpenApi.IDocument): NestiaMigrateApplication;\n    static validate(document: SwaggerV2.IDocument | OpenApiV3.IDocument | OpenApiV3_1.IDocument | OpenApi.IDocument): IValidation<NestiaMigrateApplication>;\n    getData(): IHttpMigrateApplication;\n    /** @deprecated */\n    getErrors(): IHttpMigrateApplication.IError[];\n    nest(config: INestiaMigrateConfig): Record<string, string>;\n    sdk(config: INestiaMigrateConfig): Record<string, string>;\n}\nexport declare namespace MigrateApplication {\n    interface IOutput {\n        context: INestiaMigrateContext;\n        files: INestiaMigrateFile[];\n        errors: IHttpMigrateApplication.IError[];\n    }\n}\n",
   "node_modules/@nestia/migrate/lib/analyzers/NestiaMigrateControllerAnalyzer.d.ts": "import { IHttpMigrateRoute } from \"@samchon/openapi\";\nimport { INestiaMigrateController } from \"../structures/INestiaMigrateController\";\nexport declare namespace NestiaMigrateControllerAnalyzer {\n    const analyze: (routes: IHttpMigrateRoute[]) => INestiaMigrateController[];\n}\n",
   "node_modules/@nestia/migrate/lib/archivers/NestiaMigrateFileArchiver.d.ts": "export declare namespace NestiaMigrateFileArchiver {\n    const archive: (props: {\n        mkdir: (path: string) => Promise<void>;\n        writeFile: (path: string, content: string) => Promise<void>;\n        root: string;\n        files: Record<string, string>;\n    }) => Promise<void>;\n}\n",
@@ -11806,7 +11806,7 @@
   "node_modules/@nestia/migrate/lib/utils/StringUtil.d.ts": "export declare namespace StringUtil {\n    const capitalize: (str: string) => string;\n    const splitWithNormalization: (path: string) => string[];\n    const escapeDuplicate: (keep: string[]) => (change: string) => string;\n    const escapeNonVariable: (str: string) => string;\n}\n",
   "node_modules/@nestia/migrate/lib/utils/openapi-down-convert/RefVisitor.d.ts": "/**\n * Recursively walk a JSON object and invoke a callback function on each `{\n * \"$ref\" : \"path\" }` object found\n */\n/**\n * Represents a JSON Reference object, such as `{\"$ref\":\n * \"#/components/schemas/problemResponse\" }`\n */\nexport interface RefObject {\n    $ref: string;\n}\n/** JsonNode represents a node within the OpenAPI object */\nexport type JsonNode = object | [] | string | boolean | null | number;\n/** A JSON Schema object in an API def */\nexport type SchemaObject = object;\n/** Function signature for the visitRefObjects callback */\nexport type RefVisitor = (node: RefObject) => JsonNode;\n/** Function signature for the visitSchemaObjects callback */\nexport type SchemaVisitor = (node: SchemaObject) => SchemaObject;\n/** /** Function signature for the walkObject callback */\nexport type ObjectVisitor = (node: object) => JsonNode;\n/** Test if a JSON node is a `{ $ref: \"uri\" }` object */\nexport declare function isRef(node: any): boolean;\n/**\n * Walk a JSON object and apply `schemaCallback` when a JSON schema is found.\n * JSON Schema objects are items in components/schemas or in an item named\n * `schema`\n *\n * @param node A node in the OpenAPI document\n * @param schemaCallback The function to call on JSON schema objects\n * @returns The modified (annotated) node\n */\nexport declare function visitSchemaObjects(node: any, schemaCallback: SchemaVisitor): any;\n/**\n * Walk a JSON object and apply `refCallback` when a JSON `{$ref: url }` is\n * found\n *\n * @param node A node in the OpenAPI document\n * @param refCallback The function to call on JSON `$ref` objects\n * @returns The modified (annotated) node\n */\nexport declare function visitRefObjects(node: any, refCallback: RefVisitor): any;\n/**\n * Walk a JSON object or array and apply objectCallback when a JSON object is\n * found\n *\n * @param node A node in the OpenAPI document\n * @param objectCallback The function to call on JSON objects\n * @param nav Tracks where we are in the original document\n * @returns The modified (annotated) node\n */\nexport declare function walkObject(node: object, objectCallback: ObjectVisitor): JsonNode;\n",
   "node_modules/@nestia/migrate/lib/utils/openapi-down-convert/converter.d.ts": "/** Options for the converter instantiation */\nexport interface ConverterOptions {\n    /** If `true`, log conversion transformations to stderr */\n    verbose?: boolean;\n    /**\n     * If `true`, remove `id` values in schema examples, to bypass [Spectral issue\n     * 2081](https://github.com/stoplightio/spectral/issues/2081)\n     */\n    deleteExampleWithId?: boolean;\n    /** If `true`, replace a `$ref` object that has siblings into an `allOf` */\n    allOfTransform?: boolean;\n    /** The authorizationUrl for openIdConnect -> oauth2 transformation */\n    authorizationUrl?: string;\n    /** The tokenUrl for openIdConnect -> oauth2 transformation */\n    tokenUrl?: string;\n    /**\n     * Name of YAML/JSON file with scope descriptions. This is a simple map in the\n     * format `{ scope1: \"description of scope1\", ... }`\n     */\n    scopeDescriptionFile?: string;\n    /**\n     * Earlier versions of the tool converted $comment to x-comment in JSON\n     * Schemas. The tool now deletes $comment values by default. Use this option\n     * to preserve the conversion and not delete comments.\n     */\n    convertSchemaComments?: boolean;\n}\nexport declare class Converter {\n    private openapi30;\n    private verbose;\n    private deleteExampleWithId;\n    private allOfTransform;\n    private authorizationUrl;\n    /** The tokenUrl for openIdConnect -> oauth2 transformation */\n    private tokenUrl;\n    private scopeDescriptions;\n    private convertSchemaComments;\n    private returnCode;\n    /**\n     * Construct a new Converter\n     *\n     * @throws Error if the scopeDescriptionFile (if specified) cannot be read or\n     *   parsed as YAML/JSON\n     */\n    constructor(openapiDocument: object, options?: ConverterOptions);\n    /**\n     * Load the scopes.yaml file and save in this.scopeDescriptions\n     *\n     * @throws Error if the file cannot be read or parsed as YAML/JSON\n     */\n    private loadScopeDescriptions;\n    /**\n     * Log a message to console.warn stream if verbose is true\n     *\n     * @param message Parameters for console.warn\n     */\n    private log;\n    /**\n     * Log a message to console.warn stream. Prefix the message string with\n     * `Warning: ` if it does not already have that text.\n     *\n     * @param message Parameters for console.warn\n     */\n    private warn;\n    /**\n     * Log an error message to `console.error` stream. Prefix the message string\n     * with `Error: ` if it does not already start with `'Error'`. Increments the\n     * `returnCode`, causing the CLI to throw an Error when done.\n     *\n     * @param message Parameters for `console.error`\n     */\n    private error;\n    /**\n     * Convert the OpenAPI document to 3.0\n     *\n     * @returns The converted document. The input is not modified.\n     */\n    convert(): object;\n    /**\n     * OpenAPI 3.1 uses JSON Schema 2020-12 which allows schema `examples`;\n     * OpenAPI 3.0 uses JSON Scheme Draft 7 which only allows `example`. Replace\n     * all `examples` with `example`, using `examples[0]`\n     */\n    convertJsonSchemaExamples(): void;\n    private walkNestedSchemaObjects;\n    /**\n     * OpenAPI 3.1 uses JSON Schema 2020-12 which allows `const` OpenAPI 3.0 uses\n     * JSON Scheme Draft 7 which only allows `enum`. Replace all `const: value`\n     * with `enum: [ value ]`\n     */\n    convertConstToEnum(): void;\n    /**\n     * Convert 2-element type arrays containing 'null' to string type and\n     * `nullable: true`\n     */\n    convertNullableTypeArray(): void;\n    removeWebhooksObject(): void;\n    removeUnsupportedSchemaKeywords(): void;\n    renameSchema$comment(): void;\n    private deleteSchema$comment;\n    /**\n     * Convert\n     *\n     *     contentMediaType: \"application/octet-stream\";\n     *\n     * To\n     *\n     *     format: binary;\n     *\n     * In `type: string` schemas. Warn if schema has a `format` already and it is\n     * not `binary`.\n     */\n    convertJsonSchemaContentMediaType(): void;\n    /**\n     * Convert\n     *\n     *     contentEncoding: base64;\n     *\n     * To\n     *\n     *     format: byte;\n     *\n     * In `type: string` schemas. It is an error if the schema has a `format`\n     * already and it is not `byte`.\n     */\n    convertJsonSchemaContentEncoding(): void;\n    private json;\n    /**\n     * OpenAPI 3.1 defines a new `openIdConnect` security scheme. Down-convert the\n     * scheme to `oauth2` / authorization code flow. Collect all the scopes used\n     * in any security requirements within operations and add them to the scheme.\n     * Also define the URLs to the `authorizationUrl` and `tokenUrl` of `oauth2`.\n     */\n    convertSecuritySchemes(): void;\n    /**\n     * Find remaining OpenAPI 3.0 [Reference\n     * Objects](https://github.com/OAI/OpenAPI-Specification/blob/main/versions/3.1.0.md#referenceObject)\n     * and down convert them to [JSON\n     * Reference](https://tools.ietf.org/html/draft-pbryan-zyp-json-ref-03)\n     * objects with _only_ a `$ref` property.\n     */\n    simplifyNonSchemaRef(): void;\n    removeLicenseIdentifier(): void;\n    convertSchemaRef(): void;\n    static deepClone(obj: object): object;\n}\n",
-  "node_modules/@nestia/migrate/package.json": "{\n  \"name\": \"@nestia/migrate\",\n  \"version\": \"7.3.3\",\n  \"description\": \"Migration program from swagger to NestJS\",\n  \"typings\": \"lib/index.d.ts\",\n  \"main\": \"lib/index.js\",\n  \"module\": \"lib/index.mjs\",\n  \"bin\": {\n    \"@nestia/migrate\": \"lib/executable/migrate.js\"\n  },\n  \"scripts\": {\n    \"build\": \"rimraf lib && tsc && rollup -c\",\n    \"bundle\": \"node src/executable/bundle.js\",\n    \"dev\": \"rimraf lib && tsc --watch\",\n    \"package:next\": \"npm publish --access public --tag next\",\n    \"prepare\": \"ts-patch install && typia patch && npm run bundle\",\n    \"test\": \"node lib/test\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia\"\n  },\n  \"keywords\": [\n    \"migration\",\n    \"swagger\",\n    \"openapi generator\",\n    \"NestJS\",\n    \"nestia\",\n    \"SDK\",\n    \"RPC\",\n    \"Mockup Simulator\"\n  ],\n  \"author\": \"Jeongho Nam\",\n  \"license\": \"MIT\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia/issues\"\n  },\n  \"homepage\": \"https://nestia.io\",\n  \"devDependencies\": {\n    \"@nestia/benchmark\": \"^7.3.3\",\n    \"@nestia/core\": \"^7.3.3\",\n    \"@nestia/e2e\": \"^7.3.3\",\n    \"@nestia/fetcher\": \"^7.3.3\",\n    \"@nestia/sdk\": \"^7.3.3\",\n    \"@nestjs/common\": \"^11.0.13\",\n    \"@nestjs/core\": \"^11.0.13\",\n    \"@nestjs/platform-express\": \"^11.0.13\",\n    \"@nestjs/platform-fastify\": \"^11.0.13\",\n    \"@rollup/plugin-terser\": \"^0.4.4\",\n    \"@rollup/plugin-typescript\": \"^12.1.1\",\n    \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n    \"@types/cli-progress\": \"^3.11.5\",\n    \"@types/express\": \"^4.17.21\",\n    \"@types/inquirer\": \"^9.0.7\",\n    \"@types/multer\": \"^1.4.12\",\n    \"@types/node\": \"^20.3.3\",\n    \"@types/swagger-ui-express\": \"^4.1.6\",\n    \"chalk\": \"4.1.2\",\n    \"cli-progress\": \"^3.12.0\",\n    \"dotenv\": \"^16.3.1\",\n    \"dotenv-expand\": \"^10.0.0\",\n    \"express\": \"^4.19.2\",\n    \"multer\": \"^2.0.2\",\n    \"rimraf\": \"^6.0.1\",\n    \"rollup\": \"^4.24.3\",\n    \"serialize-error\": \"^4.1.0\",\n    \"source-map-support\": \"^0.5.21\",\n    \"swagger-ui-express\": \"^5.0.0\",\n    \"tgrid\": \"^1.1.0\",\n    \"ts-node\": \"^10.9.1\",\n    \"ts-patch\": \"^3.3.0\",\n    \"typescript-transform-paths\": \"^3.5.2\"\n  },\n  \"dependencies\": {\n    \"@samchon/openapi\": \"^4.5.0\",\n    \"commander\": \"10.0.0\",\n    \"inquirer\": \"8.2.5\",\n    \"prettier\": \"^3.3.3\",\n    \"prettier-plugin-jsdoc\": \"^1.3.2\",\n    \"tstl\": \"^3.0.0\",\n    \"typescript\": \"~5.9.2\",\n    \"typia\": \"^9.6.1\"\n  },\n  \"files\": [\n    \"lib\",\n    \"src\",\n    \"!lib/test\",\n    \"!src/test\",\n    \"package.json\",\n    \"README.md\",\n    \"LICENSE\"\n  ]\n}",
+  "node_modules/@nestia/migrate/package.json": "{\n  \"name\": \"@nestia/migrate\",\n  \"version\": \"7.4.0\",\n  \"description\": \"Migration program from swagger to NestJS\",\n  \"typings\": \"lib/index.d.ts\",\n  \"main\": \"lib/index.js\",\n  \"module\": \"lib/index.mjs\",\n  \"bin\": {\n    \"@nestia/migrate\": \"lib/executable/migrate.js\"\n  },\n  \"scripts\": {\n    \"build\": \"rimraf lib && tsc && rollup -c\",\n    \"bundle\": \"node src/executable/bundle.js\",\n    \"dev\": \"rimraf lib && tsc --watch\",\n    \"package:next\": \"npm publish --access public --tag next\",\n    \"prepare\": \"ts-patch install && typia patch && npm run bundle\",\n    \"test\": \"node lib/test\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia\"\n  },\n  \"keywords\": [\n    \"migration\",\n    \"swagger\",\n    \"openapi generator\",\n    \"NestJS\",\n    \"nestia\",\n    \"SDK\",\n    \"RPC\",\n    \"Mockup Simulator\"\n  ],\n  \"author\": \"Jeongho Nam\",\n  \"license\": \"MIT\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia/issues\"\n  },\n  \"homepage\": \"https://nestia.io\",\n  \"devDependencies\": {\n    \"@nestia/benchmark\": \"^7.4.0\",\n    \"@nestia/core\": \"^7.4.0\",\n    \"@nestia/e2e\": \"^7.4.0\",\n    \"@nestia/fetcher\": \"^7.4.0\",\n    \"@nestia/sdk\": \"^7.4.0\",\n    \"@nestjs/common\": \"^11.0.13\",\n    \"@nestjs/core\": \"^11.0.13\",\n    \"@nestjs/platform-express\": \"^11.0.13\",\n    \"@nestjs/platform-fastify\": \"^11.0.13\",\n    \"@rollup/plugin-terser\": \"^0.4.4\",\n    \"@rollup/plugin-typescript\": \"^12.1.1\",\n    \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n    \"@types/cli-progress\": \"^3.11.5\",\n    \"@types/express\": \"^4.17.21\",\n    \"@types/inquirer\": \"^9.0.7\",\n    \"@types/multer\": \"^1.4.12\",\n    \"@types/node\": \"^20.3.3\",\n    \"@types/swagger-ui-express\": \"^4.1.6\",\n    \"chalk\": \"4.1.2\",\n    \"cli-progress\": \"^3.12.0\",\n    \"dotenv\": \"^16.3.1\",\n    \"dotenv-expand\": \"^10.0.0\",\n    \"express\": \"^4.19.2\",\n    \"multer\": \"^2.0.2\",\n    \"rimraf\": \"^6.0.1\",\n    \"rollup\": \"^4.24.3\",\n    \"serialize-error\": \"^4.1.0\",\n    \"source-map-support\": \"^0.5.21\",\n    \"swagger-ui-express\": \"^5.0.0\",\n    \"tgrid\": \"^1.1.0\",\n    \"ts-node\": \"^10.9.1\",\n    \"ts-patch\": \"^3.3.0\",\n    \"typescript-transform-paths\": \"^3.5.2\"\n  },\n  \"dependencies\": {\n    \"@samchon/openapi\": \"^4.5.0\",\n    \"commander\": \"10.0.0\",\n    \"inquirer\": \"8.2.5\",\n    \"prettier\": \"^3.3.3\",\n    \"prettier-plugin-jsdoc\": \"^1.3.2\",\n    \"tstl\": \"^3.0.0\",\n    \"typescript\": \"~5.9.2\",\n    \"typia\": \"^9.6.1\"\n  },\n  \"files\": [\n    \"lib\",\n    \"src\",\n    \"!lib/test\",\n    \"!src/test\",\n    \"package.json\",\n    \"README.md\",\n    \"LICENSE\"\n  ]\n}",
   "node_modules/@nestia/sdk/lib/INestiaConfig.d.ts": "import type { INestApplication } from \"@nestjs/common\";\nimport type { OpenApi } from \"@samchon/openapi\";\n/**\n * Definition for the `nestia.config.ts` file.\n *\n * @author Jeongho Nam - https://github.com/samchon\n */\nexport interface INestiaConfig {\n    /**\n     * Accessor of controller classes.\n     *\n     * You can specify target controller classes within two ways.\n     *\n     * - Asynchronous function returning `INestApplication` instance\n     * - Specify the path or directory of controller class files\n     */\n    input: (() => Promise<INestApplication>) | INestiaConfig.IInput | string[] | string;\n    /**\n     * Building `swagger.json` is also possible.\n     *\n     * If not specified, you can't build the `swagger.json`.\n     */\n    swagger?: INestiaConfig.ISwaggerConfig;\n    /**\n     * Response directory that SDK would be placed in.\n     *\n     * If not configured, you can't build the SDK library.\n     */\n    output?: string;\n    /**\n     * Target directory that SDK distribution files would be placed in.\n     *\n     * If you configure this property and runs `npx nestia sdk` command,\n     * distribution environments for the SDK library would be generated.\n     *\n     * After the SDK library generation, move to the `distribute` directory, and\n     * runs `npm publish` command, then you can share SDK library with other\n     * client (frontend) developers.\n     *\n     * Recommend to use `\"packages/api\"` value.\n     */\n    distribute?: string;\n    /** @default false */\n    keyword?: boolean;\n    /**\n     * Allow simulation mode.\n     *\n     * If you configure this property to be `true`, the SDK library would be\n     * contain simulation mode. In the simulation mode, the SDK library would not\n     * communicate with the real backend server, but just returns random mock-up\n     * data with requestion data validation.\n     *\n     * For reference, random mock-up data would be generated by\n     * `typia.random<T>()` function.\n     *\n     * @default false\n     */\n    simulate?: boolean;\n    /**\n     * Target directory that e2e test functions would be placed in.\n     *\n     * If you configure this property and runs `npx nestia e2e` command,\n     * `@nestia/sdk` will analyze your NestJS backend server code, and generates\n     * e2e test functions for every API endpoints.\n     *\n     * If not configured, you can't run `npx nestia e2e` command.\n     */\n    e2e?: string;\n    /**\n     * Whether to use propagation mode or not.\n     *\n     * If being configured, interaction functions of the SDK library would perform\n     * the propagation mode. The propagation mode means that never throwing\n     * exception even when status code is not 200 (or 201), but just returning the\n     * {@link IPropagation} typed instance, which can specify its body type through\n     * discriminated union determined by status code.\n     *\n     * @default false\n     */\n    propagate?: boolean;\n    /**\n     * Whether to clone DTO structures or not.\n     *\n     * If being configured, all of DTOs used in the backend server would be cloned\n     * into the `structures` directory, and the SDK library would be refer to the\n     * cloned DTOs instead of the original.\n     *\n     * @default false\n     */\n    clone?: boolean;\n    /**\n     * Whether to wrap DTO by primitive type.\n     *\n     * If you don't configure this property as `false`, all of DTOs in the SDK\n     * library would be automatically wrapped by {@link Primitive} type.\n     *\n     * For refenrece, if a DTO type be capsuled by the {@link Primitive} type, all\n     * of methods in the DTO type would be automatically erased. Also, if the DTO\n     * has a `toJSON()` method, the DTO type would be automatically converted to\n     * return type of the `toJSON()` method.\n     *\n     * @default true\n     */\n    primitive?: boolean;\n    /**\n     * Whether to assert parameter types or not.\n     *\n     * If you configure this property to be `true`, all of the function parameters\n     * of SDK library would be checked through [`typia.assert<T>()`\n     * function](https://typia.io/docs/validators/assert/).\n     *\n     * This option would make your SDK library compilation time a little bit\n     * slower, but would enahcne the type safety even in the runtime level.\n     *\n     * @default false\n     */\n    assert?: boolean;\n    /**\n     * Whether to optimize JSON string conversion 10x faster or not.\n     *\n     * If you configure this property to be `true`, the SDK library would utilize\n     * the [`typia.assertStringify<T>()\n     * function`](https://github.com/samchon/typia#enhanced-json) to boost up JSON\n     * serialization speed and ensure type safety.\n     *\n     * This option would make your SDK library compilation time a little bit\n     * slower, but would enhance JSON serialization speed 10x faster. Also, it can\n     * ensure type safety even in the runtime level.\n     *\n     * @default false\n     */\n    json?: boolean;\n}\nexport declare namespace INestiaConfig {\n    /**\n     * List of files or directories to include or exclude to specifying the NestJS\n     * controllers.\n     */\n    interface IInput {\n        /** List of files or directories containing the NestJS controller classes. */\n        include: string[];\n        /** List of files or directories to be excluded. */\n        exclude?: string[];\n    }\n    /** Building `swagger.json` is also possible. */\n    interface ISwaggerConfig {\n        /**\n         * Response path of the `swagger.json`.\n         *\n         * If you've configured only directory, the file name would be the\n         * `swagger.json`. Otherwise you've configured the full path with file name\n         * and extension, the `swagger.json` file would be renamed to it.\n         */\n        output: string;\n        /**\n         * OpenAPI version.\n         *\n         * If you configure this property to be `2.0` or `3.0`, the newly generated\n         * `swagger.json` file would follow the specified OpenAPI version. The newly\n         * generated `swagger.json` file would be downgraded from the OpenAPI v3.1\n         * specification by {@link OpenApi.downgrade} method.\n         *\n         * @default 3.1\n         */\n        openapi?: \"2.0\" | \"3.0\" | \"3.1\";\n        /**\n         * Whether to beautify JSON content or not.\n         *\n         * If you configure this property to be `true`, the `swagger.json` file\n         * would be beautified with indentation (2 spaces) and line breaks. If you\n         * configure numeric value instead, the indentation would be specified by\n         * the number.\n         *\n         * @default false\n         */\n        beautify?: boolean | number;\n        /**\n         * Whether to include additional information or not.\n         *\n         * If configured to be `true`, those properties would be added into each API\n         * endpoinnt.\n         *\n         * - `x-nestia-method`\n         * - `x-nestia-namespace` ` `x-nestia-jsDocTags`\n         *\n         * @default false\n         */\n        additional?: boolean;\n        /**\n         * API information.\n         *\n         * If omitted, `package.json` content would be used instead.\n         */\n        info?: Partial<OpenApi.IDocument.IInfo>;\n        /** List of server addresses. */\n        servers?: OpenApi.IServer[];\n        /**\n         * Security schemes.\n         *\n         * When generating `swagger.json` file through `nestia`, if your controllers\n         * or theirs methods have a security key which is not enrolled in here\n         * property, it would be an error.\n         */\n        security?: Record<string, OpenApi.ISecurityScheme>;\n        /**\n         * List of tag names with description.\n         *\n         * It is possible to omit this property or skip some tag name even if the\n         * tag name is used in the API routes. In that case, the tag name would be\n         * used without description.\n         *\n         * Of course, if you've written a comment like `@tag {name} {description}`,\n         * you can entirely replace this property specification.\n         */\n        tags?: OpenApi.IDocument.ITag[];\n        /**\n         * Decompose query DTO.\n         *\n         * If you configure this property to be `true`, the query DTO would be\n         * decomposed into individual query parameters per each property. Otherwise\n         * you set it to be `false`, the query DTO would be one object type which\n         * contains all of query parameters.\n         *\n         * @default true\n         */\n        decompose?: boolean;\n        /**\n         * Operation ID generator.\n         *\n         * @param props Properties of the API endpoint.\n         * @returns Operation ID.\n         */\n        operationId?(props: {\n            class: string;\n            function: string;\n            method: \"HEAD\" | \"GET\" | \"POST\" | \"PUT\" | \"PATCH\" | \"DELETE\";\n            path: string;\n        }): string;\n    }\n}\n",
   "node_modules/@nestia/sdk/lib/NestiaSdkApplication.d.ts": "import { INestiaConfig } from \"./INestiaConfig\";\nexport declare class NestiaSdkApplication {\n    private readonly config;\n    constructor(config: INestiaConfig);\n    all(): Promise<void>;\n    e2e(): Promise<void>;\n    sdk(): Promise<void>;\n    swagger(): Promise<void>;\n    private generate;\n}\n",
   "node_modules/@nestia/sdk/lib/NestiaSwaggerComposer.d.ts": "import { INestApplication } from \"@nestjs/common\";\nimport { OpenApi, OpenApiV3, SwaggerV2 } from \"@samchon/openapi\";\nimport { INestiaConfig } from \"./INestiaConfig\";\nexport declare namespace NestiaSwaggerComposer {\n    const document: (app: INestApplication, config: Omit<INestiaConfig.ISwaggerConfig, \"output\">) => Promise<OpenApi.IDocument | OpenApiV3.IDocument | SwaggerV2.IDocument>;\n}\n",
@@ -11905,7 +11905,7 @@
   "node_modules/@nestia/sdk/lib/validators/HttpQueryValidator.d.ts": "import { MetadataFactory } from \"typia/lib/factories/MetadataFactory\";\nimport { Metadata } from \"typia/lib/schemas/metadata/Metadata\";\nexport declare namespace HttpQueryValidator {\n    const validate: (meta: Metadata, explore: MetadataFactory.IExplore) => string[];\n}\n",
   "node_modules/path-to-regexp/dist/index.d.ts": "/**\n * Encode a string into another string.\n */\nexport type Encode = (value: string) => string;\n/**\n * Decode a string into another string.\n */\nexport type Decode = (value: string) => string;\nexport interface ParseOptions {\n    /**\n     * A function for encoding input strings.\n     */\n    encodePath?: Encode;\n}\nexport interface PathToRegexpOptions {\n    /**\n     * Matches the path completely without trailing characters. (default: `true`)\n     */\n    end?: boolean;\n    /**\n     * Allows optional trailing delimiter to match. (default: `true`)\n     */\n    trailing?: boolean;\n    /**\n     * Match will be case sensitive. (default: `false`)\n     */\n    sensitive?: boolean;\n    /**\n     * The default delimiter for segments. (default: `'/'`)\n     */\n    delimiter?: string;\n}\nexport interface MatchOptions extends PathToRegexpOptions {\n    /**\n     * Function for decoding strings for params, or `false` to disable entirely. (default: `decodeURIComponent`)\n     */\n    decode?: Decode | false;\n}\nexport interface CompileOptions {\n    /**\n     * Function for encoding input strings for output into the path, or `false` to disable entirely. (default: `encodeURIComponent`)\n     */\n    encode?: Encode | false;\n    /**\n     * The default delimiter for segments. (default: `'/'`)\n     */\n    delimiter?: string;\n}\n/**\n * Plain text.\n */\nexport interface Text {\n    type: \"text\";\n    value: string;\n}\n/**\n * A parameter designed to match arbitrary text within a segment.\n */\nexport interface Parameter {\n    type: \"param\";\n    name: string;\n}\n/**\n * A wildcard parameter designed to match multiple segments.\n */\nexport interface Wildcard {\n    type: \"wildcard\";\n    name: string;\n}\n/**\n * A set of possible tokens to expand when matching.\n */\nexport interface Group {\n    type: \"group\";\n    tokens: Token[];\n}\n/**\n * A token that corresponds with a regexp capture.\n */\nexport type Key = Parameter | Wildcard;\n/**\n * A sequence of `path-to-regexp` keys that match capturing groups.\n */\nexport type Keys = Array<Key>;\n/**\n * A sequence of path match characters.\n */\nexport type Token = Text | Parameter | Wildcard | Group;\n/**\n * Tokenized path instance.\n */\nexport declare class TokenData {\n    readonly tokens: Token[];\n    constructor(tokens: Token[]);\n}\n/**\n * Parse a string for the raw tokens.\n */\nexport declare function parse(str: string, options?: ParseOptions): TokenData;\n/**\n * Compile a string to a template function for the path.\n */\nexport declare function compile<P extends ParamData = ParamData>(path: Path, options?: CompileOptions & ParseOptions): (data?: P) => string;\nexport type ParamData = Partial<Record<string, string | string[]>>;\nexport type PathFunction<P extends ParamData> = (data?: P) => string;\n/**\n * A match result contains data about the path match.\n */\nexport interface MatchResult<P extends ParamData> {\n    path: string;\n    params: P;\n}\n/**\n * A match is either `false` (no match) or a match result.\n */\nexport type Match<P extends ParamData> = false | MatchResult<P>;\n/**\n * The match function takes a string and returns whether it matched the path.\n */\nexport type MatchFunction<P extends ParamData> = (path: string) => Match<P>;\n/**\n * Supported path types.\n */\nexport type Path = string | TokenData;\n/**\n * Transform a path into a match function.\n */\nexport declare function match<P extends ParamData>(path: Path | Path[], options?: MatchOptions & ParseOptions): MatchFunction<P>;\nexport declare function pathToRegexp(path: Path | Path[], options?: PathToRegexpOptions & ParseOptions): {\n    regexp: RegExp;\n    keys: Keys;\n};\n/**\n * Stringify token data into a path string.\n */\nexport declare function stringify(data: TokenData): string;\n",
   "node_modules/path-to-regexp/package.json": "{\n  \"name\": \"path-to-regexp\",\n  \"version\": \"8.2.0\",\n  \"description\": \"Express style path to RegExp utility\",\n  \"keywords\": [\n    \"express\",\n    \"regexp\",\n    \"route\",\n    \"routing\"\n  ],\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/pillarjs/path-to-regexp.git\"\n  },\n  \"license\": \"MIT\",\n  \"exports\": \"./dist/index.js\",\n  \"main\": \"dist/index.js\",\n  \"typings\": \"dist/index.d.ts\",\n  \"files\": [\n    \"dist/\"\n  ],\n  \"scripts\": {\n    \"bench\": \"vitest bench\",\n    \"build\": \"ts-scripts build\",\n    \"format\": \"ts-scripts format\",\n    \"lint\": \"ts-scripts lint\",\n    \"prepare\": \"ts-scripts install && npm run build\",\n    \"size\": \"size-limit\",\n    \"specs\": \"ts-scripts specs\",\n    \"test\": \"ts-scripts test && npm run size\"\n  },\n  \"devDependencies\": {\n    \"@borderless/ts-scripts\": \"^0.15.0\",\n    \"@size-limit/preset-small-lib\": \"^11.1.2\",\n    \"@types/node\": \"^22.7.2\",\n    \"@types/semver\": \"^7.3.1\",\n    \"@vitest/coverage-v8\": \"^2.1.1\",\n    \"recheck\": \"^4.4.5\",\n    \"size-limit\": \"^11.1.2\",\n    \"typescript\": \"^5.5.3\"\n  },\n  \"engines\": {\n    \"node\": \">=16\"\n  },\n  \"publishConfig\": {\n    \"access\": \"public\"\n  },\n  \"size-limit\": [\n    {\n      \"path\": \"dist/index.js\",\n      \"limit\": \"2.2 kB\"\n    }\n  ],\n  \"ts-scripts\": {\n    \"dist\": [\n      \"dist\"\n    ],\n    \"project\": [\n      \"tsconfig.build.json\"\n    ]\n  }\n}\n",
-  "node_modules/@nestia/sdk/package.json": "{\n  \"name\": \"@nestia/sdk\",\n  \"version\": \"7.3.3\",\n  \"description\": \"Nestia SDK and Swagger generator\",\n  \"main\": \"lib/index.js\",\n  \"typings\": \"lib/index.d.ts\",\n  \"bin\": {\n    \"@nestia/sdk\": \"lib/executable/sdk.js\"\n  },\n  \"scripts\": {\n    \"build\": \"rimraf lib && tsc\",\n    \"dev\": \"tsc -p tsconfig.test.json --watch\",\n    \"eslint\": \"eslint ./**/*.ts\",\n    \"prepare\": \"ts-patch install && typia patch\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia\"\n  },\n  \"keywords\": [\n    \"nestia\",\n    \"sdk\",\n    \"swagger\",\n    \"generator\",\n    \"nestjs\",\n    \"typia\"\n  ],\n  \"author\": \"Jeongho Nam\",\n  \"license\": \"MIT\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia/issues\"\n  },\n  \"homepage\": \"https://nestia.io\",\n  \"dependencies\": {\n    \"@nestia/core\": \"^7.3.3\",\n    \"@nestia/fetcher\": \"^7.3.3\",\n    \"@samchon/openapi\": \"^4.5.0\",\n    \"cli\": \"^1.0.1\",\n    \"get-function-location\": \"^2.0.0\",\n    \"glob\": \"^11.0.3\",\n    \"path-to-regexp\": \"^6.2.1\",\n    \"prettier\": \"^3.2.5\",\n    \"ts-node\": \">=10.6.0\",\n    \"tsconfck\": \"^2.1.2\",\n    \"tsconfig-paths\": \"^4.1.1\",\n    \"tstl\": \"^3.0.0\",\n    \"typia\": \"^9.6.1\"\n  },\n  \"peerDependencies\": {\n    \"@nestia/core\": \">=7.3.3\"\n  },\n  \"devDependencies\": {\n    \"@nestjs/common\": \"^11.0.13\",\n    \"@nestjs/core\": \"^11.0.13\",\n    \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n    \"@types/cli\": \"^0.11.21\",\n    \"@types/express\": \"^4.17.15\",\n    \"@types/node\": \"^18.11.15\",\n    \"@types/ts-expose-internals\": \"npm:ts-expose-internals@5.4.5\",\n    \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n    \"@typescript-eslint/parser\": \"^5.46.1\",\n    \"eslint\": \"^8.29.0\",\n    \"eslint-plugin-deprecation\": \"^1.4.1\",\n    \"rimraf\": \"^6.0.1\",\n    \"tgrid\": \"^1.1.0\",\n    \"ts-patch\": \"^3.3.0\",\n    \"typescript\": \"~5.9.2\",\n    \"typescript-transform-paths\": \"^3.4.4\"\n  },\n  \"files\": [\n    \"assets\",\n    \"lib\",\n    \"src\",\n    \"README.md\",\n    \"LICENSE\",\n    \"package.json\"\n  ]\n}",
+  "node_modules/@nestia/sdk/package.json": "{\n  \"name\": \"@nestia/sdk\",\n  \"version\": \"7.4.0\",\n  \"description\": \"Nestia SDK and Swagger generator\",\n  \"main\": \"lib/index.js\",\n  \"typings\": \"lib/index.d.ts\",\n  \"bin\": {\n    \"@nestia/sdk\": \"lib/executable/sdk.js\"\n  },\n  \"scripts\": {\n    \"build\": \"rimraf lib && tsc\",\n    \"dev\": \"tsc -p tsconfig.test.json --watch\",\n    \"eslint\": \"eslint ./**/*.ts\",\n    \"prepare\": \"ts-patch install && typia patch\"\n  },\n  \"repository\": {\n    \"type\": \"git\",\n    \"url\": \"https://github.com/samchon/nestia\"\n  },\n  \"keywords\": [\n    \"nestia\",\n    \"sdk\",\n    \"swagger\",\n    \"generator\",\n    \"nestjs\",\n    \"typia\"\n  ],\n  \"author\": \"Jeongho Nam\",\n  \"license\": \"MIT\",\n  \"bugs\": {\n    \"url\": \"https://github.com/samchon/nestia/issues\"\n  },\n  \"homepage\": \"https://nestia.io\",\n  \"dependencies\": {\n    \"@nestia/core\": \"^7.4.0\",\n    \"@nestia/fetcher\": \"^7.4.0\",\n    \"@samchon/openapi\": \"^4.5.0\",\n    \"cli\": \"^1.0.1\",\n    \"get-function-location\": \"^2.0.0\",\n    \"glob\": \"^11.0.3\",\n    \"path-to-regexp\": \"^6.2.1\",\n    \"prettier\": \"^3.2.5\",\n    \"ts-node\": \">=10.6.0\",\n    \"tsconfck\": \"^2.1.2\",\n    \"tsconfig-paths\": \"^4.1.1\",\n    \"tstl\": \"^3.0.0\",\n    \"typia\": \"^9.6.1\"\n  },\n  \"peerDependencies\": {\n    \"@nestia/core\": \">=7.4.0\"\n  },\n  \"devDependencies\": {\n    \"@nestjs/common\": \"^11.0.13\",\n    \"@nestjs/core\": \"^11.0.13\",\n    \"@trivago/prettier-plugin-sort-imports\": \"^4.3.0\",\n    \"@types/cli\": \"^0.11.21\",\n    \"@types/express\": \"^4.17.15\",\n    \"@types/node\": \"^18.11.15\",\n    \"@types/ts-expose-internals\": \"npm:ts-expose-internals@5.4.5\",\n    \"@typescript-eslint/eslint-plugin\": \"^5.46.1\",\n    \"@typescript-eslint/parser\": \"^5.46.1\",\n    \"eslint\": \"^8.29.0\",\n    \"eslint-plugin-deprecation\": \"^1.4.1\",\n    \"rimraf\": \"^6.0.1\",\n    \"tgrid\": \"^1.1.0\",\n    \"ts-patch\": \"^3.3.0\",\n    \"typescript\": \"~5.9.2\",\n    \"typescript-transform-paths\": \"^3.4.4\"\n  },\n  \"files\": [\n    \"assets\",\n    \"lib\",\n    \"src\",\n    \"README.md\",\n    \"LICENSE\",\n    \"package.json\"\n  ]\n}",
   "node_modules/@nestia/sdk/src/typings/get-function-location.d.ts": "declare module \"get-function-location\" {\n  export default function (func: any): Promise<{\n    source: string;\n    line: number;\n    column: number;\n  }>;\n}\n",
   "node_modules/@nestia/sdk/node_modules/glob/dist/commonjs/glob.d.ts": "import { Minimatch } from 'minimatch';\nimport { Minipass } from 'minipass';\nimport { FSOption, Path, PathScurry } from 'path-scurry';\nimport { IgnoreLike } from './ignore.js';\nimport { Pattern } from './pattern.js';\nexport type MatchSet = Minimatch['set'];\nexport type GlobParts = Exclude<Minimatch['globParts'], undefined>;\n/**\n * A `GlobOptions` object may be provided to any of the exported methods, and\n * must be provided to the `Glob` constructor.\n *\n * All options are optional, boolean, and false by default, unless otherwise\n * noted.\n *\n * All resolved options are added to the Glob object as properties.\n *\n * If you are running many `glob` operations, you can pass a Glob object as the\n * `options` argument to a subsequent operation to share the previously loaded\n * cache.\n */\nexport interface GlobOptions {\n    /**\n     * Set to `true` to always receive absolute paths for\n     * matched files. Set to `false` to always return relative paths.\n     *\n     * When this option is not set, absolute paths are returned for patterns\n     * that are absolute, and otherwise paths are returned that are relative\n     * to the `cwd` setting.\n     *\n     * This does _not_ make an extra system call to get\n     * the realpath, it only does string path resolution.\n     *\n     * Conflicts with {@link withFileTypes}\n     */\n    absolute?: boolean;\n    /**\n     * Set to false to enable {@link windowsPathsNoEscape}\n     *\n     * @deprecated\n     */\n    allowWindowsEscape?: boolean;\n    /**\n     * The current working directory in which to search. Defaults to\n     * `process.cwd()`.\n     *\n     * May be eiher a string path or a `file://` URL object or string.\n     */\n    cwd?: string | URL;\n    /**\n     * Include `.dot` files in normal matches and `globstar`\n     * matches. Note that an explicit dot in a portion of the pattern\n     * will always match dot files.\n     */\n    dot?: boolean;\n    /**\n     * Prepend all relative path strings with `./` (or `.\\` on Windows).\n     *\n     * Without this option, returned relative paths are \"bare\", so instead of\n     * returning `'./foo/bar'`, they are returned as `'foo/bar'`.\n     *\n     * Relative patterns starting with `'../'` are not prepended with `./`, even\n     * if this option is set.\n     */\n    dotRelative?: boolean;\n    /**\n     * Follow symlinked directories when expanding `**`\n     * patterns. This can result in a lot of duplicate references in\n     * the presence of cyclic links, and make performance quite bad.\n     *\n     * By default, a `**` in a pattern will follow 1 symbolic link if\n     * it is not the first item in the pattern, or none if it is the\n     * first item in the pattern, following the same behavior as Bash.\n     */\n    follow?: boolean;\n    /**\n     * string or string[], or an object with `ignored` and `childrenIgnored`\n     * methods.\n     *\n     * If a string or string[] is provided, then this is treated as a glob\n     * pattern or array of glob patterns to exclude from matches. To ignore all\n     * children within a directory, as well as the entry itself, append `'/**'`\n     * to the ignore pattern.\n     *\n     * **Note** `ignore` patterns are _always_ in `dot:true` mode, regardless of\n     * any other settings.\n     *\n     * If an object is provided that has `ignored(path)` and/or\n     * `childrenIgnored(path)` methods, then these methods will be called to\n     * determine whether any Path is a match or if its children should be\n     * traversed, respectively.\n     */\n    ignore?: string | string[] | IgnoreLike;\n    /**\n     * Treat brace expansion like `{a,b}` as a \"magic\" pattern. Has no\n     * effect if {@link nobrace} is set.\n     *\n     * Only has effect on the {@link hasMagic} function.\n     */\n    magicalBraces?: boolean;\n    /**\n     * Add a `/` character to directory matches. Note that this requires\n     * additional stat calls in some cases.\n     */\n    mark?: boolean;\n    /**\n     * Perform a basename-only match if the pattern does not contain any slash\n     * characters. That is, `*.js` would be treated as equivalent to\n     * `**\\/*.js`, matching all js files in all directories.\n     */\n    matchBase?: boolean;\n    /**\n     * Limit the directory traversal to a given depth below the cwd.\n     * Note that this does NOT prevent traversal to sibling folders,\n     * root patterns, and so on. It only limits the maximum folder depth\n     * that the walk will descend, relative to the cwd.\n     */\n    maxDepth?: number;\n    /**\n     * Do not expand `{a,b}` and `{1..3}` brace sets.\n     */\n    nobrace?: boolean;\n    /**\n     * Perform a case-insensitive match. This defaults to `true` on macOS and\n     * Windows systems, and `false` on all others.\n     *\n     * **Note** `nocase` should only be explicitly set when it is\n     * known that the filesystem's case sensitivity differs from the\n     * platform default. If set `true` on case-sensitive file\n     * systems, or `false` on case-insensitive file systems, then the\n     * walk may return more or less results than expected.\n     */\n    nocase?: boolean;\n    /**\n     * Do not match directories, only files. (Note: to match\n     * _only_ directories, put a `/` at the end of the pattern.)\n     */\n    nodir?: boolean;\n    /**\n     * Do not match \"extglob\" patterns such as `+(a|b)`.\n     */\n    noext?: boolean;\n    /**\n     * Do not match `**` against multiple filenames. (Ie, treat it as a normal\n     * `*` instead.)\n     *\n     * Conflicts with {@link matchBase}\n     */\n    noglobstar?: boolean;\n    /**\n     * Defaults to value of `process.platform` if available, or `'linux'` if\n     * not. Setting `platform:'win32'` on non-Windows systems may cause strange\n     * behavior.\n     */\n    platform?: NodeJS.Platform;\n    /**\n     * Set to true to call `fs.realpath` on all of the\n     * results. In the case of an entry that cannot be resolved, the\n     * entry is omitted. This incurs a slight performance penalty, of\n     * course, because of the added system calls.\n     */\n    realpath?: boolean;\n    /**\n     *\n     * A string path resolved against the `cwd` option, which\n     * is used as the starting point for absolute patterns that start\n     * with `/`, (but not drive letters or UNC paths on Windows).\n     *\n     * Note that this _doesn't_ necessarily limit the walk to the\n     * `root` directory, and doesn't affect the cwd starting point for\n     * non-absolute patterns. A pattern containing `..` will still be\n     * able to traverse out of the root directory, if it is not an\n     * actual root directory on the filesystem, and any non-absolute\n     * patterns will be matched in the `cwd`. For example, the\n     * pattern `/../*` with `{root:'/some/path'}` will return all\n     * files in `/some`, not all files in `/some/path`. The pattern\n     * `*` with `{root:'/some/path'}` will return all the entries in\n     * the cwd, not the entries in `/some/path`.\n     *\n     * To start absolute and non-absolute patterns in the same\n     * path, you can use `{root:''}`. However, be aware that on\n     * Windows systems, a pattern like `x:/*` or `//host/share/*` will\n     * _always_ start in the `x:/` or `//host/share` directory,\n     * regardless of the `root` setting.\n     */\n    root?: string;\n    /**\n     * A [PathScurry](http://npm.im/path-scurry) object used\n     * to traverse the file system. If the `nocase` option is set\n     * explicitly, then any provided `scurry` object must match this\n     * setting.\n     */\n    scurry?: PathScurry;\n    /**\n     * Call `lstat()` on all entries, whether required or not to determine\n     * if it's a valid match. When used with {@link withFileTypes}, this means\n     * that matches will include data such as modified time, permissions, and\n     * so on.  Note that this will incur a performance cost due to the added\n     * system calls.\n     */\n    stat?: boolean;\n    /**\n     * An AbortSignal which will cancel the Glob walk when\n     * triggered.\n     */\n    signal?: AbortSignal;\n    /**\n     * Use `\\\\` as a path separator _only_, and\n     *  _never_ as an escape character. If set, all `\\\\` characters are\n     *  replaced with `/` in the pattern.\n     *\n     *  Note that this makes it **impossible** to match against paths\n     *  containing literal glob pattern characters, but allows matching\n     *  with patterns constructed using `path.join()` and\n     *  `path.resolve()` on Windows platforms, mimicking the (buggy!)\n     *  behavior of Glob v7 and before on Windows. Please use with\n     *  caution, and be mindful of [the caveat below about Windows\n     *  paths](#windows). (For legacy reasons, this is also set if\n     *  `allowWindowsEscape` is set to the exact value `false`.)\n     */\n    windowsPathsNoEscape?: boolean;\n    /**\n     * Return [PathScurry](http://npm.im/path-scurry)\n     * `Path` objects instead of strings. These are similar to a\n     * NodeJS `Dirent` object, but with additional methods and\n     * properties.\n     *\n     * Conflicts with {@link absolute}\n     */\n    withFileTypes?: boolean;\n    /**\n     * An fs implementation to override some or all of the defaults.  See\n     * http://npm.im/path-scurry for details about what can be overridden.\n     */\n    fs?: FSOption;\n    /**\n     * Just passed along to Minimatch.  Note that this makes all pattern\n     * matching operations slower and *extremely* noisy.\n     */\n    debug?: boolean;\n    /**\n     * Return `/` delimited paths, even on Windows.\n     *\n     * On posix systems, this has no effect.  But, on Windows, it means that\n     * paths will be `/` delimited, and absolute paths will be their full\n     * resolved UNC forms, eg instead of `'C:\\\\foo\\\\bar'`, it would return\n     * `'//?/C:/foo/bar'`\n     */\n    posix?: boolean;\n    /**\n     * Do not match any children of any matches. For example, the pattern\n     * `**\\/foo` would match `a/foo`, but not `a/foo/b/foo` in this mode.\n     *\n     * This is especially useful for cases like \"find all `node_modules`\n     * folders, but not the ones in `node_modules`\".\n     *\n     * In order to support this, the `Ignore` implementation must support an\n     * `add(pattern: string)` method. If using the default `Ignore` class, then\n     * this is fine, but if this is set to `false`, and a custom `Ignore` is\n     * provided that does not have an `add()` method, then it will throw an\n     * error.\n     *\n     * **Caveat** It *only* ignores matches that would be a descendant of a\n     * previous match, and only if that descendant is matched *after* the\n     * ancestor is encountered. Since the file system walk happens in\n     * indeterminate order, it's possible that a match will already be added\n     * before its ancestor, if multiple or braced patterns are used.\n     *\n     * For example:\n     *\n     * ```ts\n     * const results = await glob([\n     *   // likely to match first, since it's just a stat\n     *   'a/b/c/d/e/f',\n     *\n     *   // this pattern is more complicated! It must to various readdir()\n     *   // calls and test the results against a regular expression, and that\n     *   // is certainly going to take a little bit longer.\n     *   //\n     *   // So, later on, it encounters a match at 'a/b/c/d/e', but it's too\n     *   // late to ignore a/b/c/d/e/f, because it's already been emitted.\n     *   'a/[bdf]/?/[a-z]/*',\n     * ], { includeChildMatches: false })\n     * ```\n     *\n     * It's best to only set this to `false` if you can be reasonably sure that\n     * no components of the pattern will potentially match one another's file\n     * system descendants, or if the occasional included child entry will not\n     * cause problems.\n     *\n     * @default true\n     */\n    includeChildMatches?: boolean;\n}\nexport type GlobOptionsWithFileTypesTrue = GlobOptions & {\n    withFileTypes: true;\n    absolute?: undefined;\n    mark?: undefined;\n    posix?: undefined;\n};\nexport type GlobOptionsWithFileTypesFalse = GlobOptions & {\n    withFileTypes?: false;\n};\nexport type GlobOptionsWithFileTypesUnset = GlobOptions & {\n    withFileTypes?: undefined;\n};\nexport type Result<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? Path : Opts extends GlobOptionsWithFileTypesFalse ? string : Opts extends GlobOptionsWithFileTypesUnset ? string : string | Path;\nexport type Results<Opts> = Result<Opts>[];\nexport type FileTypes<Opts> = Opts extends GlobOptionsWithFileTypesTrue ? true : Opts extends GlobOptionsWithFileTypesFalse ? false : Opts extends GlobOptionsWithFileTypesUnset ? false : boolean;\n/**\n * An object that can perform glob pattern traversals.\n */\nexport declare class Glob<Opts extends GlobOptions> implements GlobOptions {\n    absolute?: boolean;\n    cwd: string;\n    root?: string;\n    dot: boolean;\n    dotRelative: boolean;\n    follow: boolean;\n    ignore?: string | string[] | IgnoreLike;\n    magicalBraces: boolean;\n    mark?: boolean;\n    matchBase: boolean;\n    maxDepth: number;\n    nobrace: boolean;\n    nocase: boolean;\n    nodir: boolean;\n    noext: boolean;\n    noglobstar: boolean;\n    pattern: string[];\n    platform: NodeJS.Platform;\n    realpath: boolean;\n    scurry: PathScurry;\n    stat: boolean;\n    signal?: AbortSignal;\n    windowsPathsNoEscape: boolean;\n    withFileTypes: FileTypes<Opts>;\n    includeChildMatches: boolean;\n    /**\n     * The options provided to the constructor.\n     */\n    opts: Opts;\n    /**\n     * An array of parsed immutable {@link Pattern} objects.\n     */\n    patterns: Pattern[];\n    /**\n     * All options are stored as properties on the `Glob` object.\n     *\n     * See {@link GlobOptions} for full options descriptions.\n     *\n     * Note that a previous `Glob` object can be passed as the\n     * `GlobOptions` to another `Glob` instantiation to re-use settings\n     * and caches with a new pattern.\n     *\n     * Traversal functions can be called multiple times to run the walk\n     * again.\n     */\n    constructor(pattern: string | string[], opts: Opts);\n    /**\n     * Returns a Promise that resolves to the results array.\n     */\n    walk(): Promise<Results<Opts>>;\n    /**\n     * synchronous {@link Glob.walk}\n     */\n    walkSync(): Results<Opts>;\n    /**\n     * Stream results asynchronously.\n     */\n    stream(): Minipass<Result<Opts>, Result<Opts>>;\n    /**\n     * Stream results synchronously.\n     */\n    streamSync(): Minipass<Result<Opts>, Result<Opts>>;\n    /**\n     * Default sync iteration function. Returns a Generator that\n     * iterates over the results.\n     */\n    iterateSync(): Generator<Result<Opts>, void, void>;\n    [Symbol.iterator](): Generator<Result<Opts>, void, void>;\n    /**\n     * Default async iteration function. Returns an AsyncGenerator that\n     * iterates over the results.\n     */\n    iterate(): AsyncGenerator<Result<Opts>, void, void>;\n    [Symbol.asyncIterator](): AsyncGenerator<Result<Opts>, void, void>;\n}\n//# sourceMappingURL=glob.d.ts.map",
   "node_modules/@nestia/sdk/node_modules/glob/dist/commonjs/has-magic.d.ts": "import { GlobOptions } from './glob.js';\n/**\n * Return true if the patterns provided contain any magic glob characters,\n * given the options provided.\n *\n * Brace expansion is not considered \"magic\" unless the `magicalBraces` option\n * is set, as brace expansion just turns one string into an array of strings.\n * So a pattern like `'x{a,b}y'` would return `false`, because `'xay'` and\n * `'xby'` both do not contain any magic glob characters, and it's treated the\n * same as if you had called it on `['xay', 'xby']`. When `magicalBraces:true`\n * is in the options, brace expansion _is_ treated as a pattern having magic.\n */\nexport declare const hasMagic: (pattern: string | string[], options?: GlobOptions) => boolean;\n//# sourceMappingURL=has-magic.d.ts.map",