RubyGems - vim-jar - Versions diffs - 0.0.3 → 0.1.0 - Mend

vim-jar 0.0.3 → 0.1.0

Files changed (926) hide show

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/sinatra/Rakefile ADDED Viewed

@@ -0,0 +1,6 @@
+$:.unshift(File.dirname(__FILE__) + '/../../lib')
+require 'cucumber/rake/task'
+Cucumber::Rake::Task.new do |t|
+  t.cucumber_opts = %w{--format pretty}
+end

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/sinatra/app.rb ADDED Viewed

@@ -0,0 +1,14 @@
+begin
+  require 'sinatra'
+rescue LoadError
+  require 'rubygems'
+  require 'sinatra'
+end
+get '/add' do
+  erb :add
+end
+post '/add' do
+  "Answer: #{params[:first].to_i + params[:second].to_i}"
+end

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/sinatra/features/add.feature ADDED Viewed

@@ -0,0 +1,11 @@
+Feature: Addition
+  In order to avoid silly mistakes
+  As a math idiot
+  I want to be told the sum of two numbers
+  Scenario: Add two numbers
+    Given I visit the calculator page
+    And I fill in '50' for 'first'
+    And I fill in '70' for 'Second'
+    When I press 'Add'
+    Then I should see 'Answer: 120'

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/sinatra/features/step_definitions/add_steps.rb ADDED Viewed

@@ -0,0 +1,15 @@
+Given /^I visit the calculator page$/ do
+  visit '/add'
+end
+Given /^I fill in '(.*)' for '(.*)'$/ do |value, field|
+  fill_in(field, :with => value)
+end
+When /^I press '(.*)'$/ do |name|
+  click_button(name)
+end
+Then /^I should see '(.*)'$/ do |text|
+  body.should match(/#{text}/m)
+end

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/sinatra/features/support/env.rb ADDED Viewed

@@ -0,0 +1,13 @@
+# See http://wiki.github.com/aslakhellesoy/cucumber/sinatra
+# for more details about Sinatra with Cucumber
+app_file = File.join(File.dirname(__FILE__), *%w[.. .. app.rb])
+require app_file
+# Force the application name because polyglot breaks the auto-detection logic.
+Sinatra::Application.app_file = app_file
+begin require 'rspec/expectations'; rescue LoadError; require 'spec/expectations'; end
+require 'rack/test'
+require 'capybara/cucumber'
+Capybara.app = Sinatra::Application

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/sinatra/views/add.erb ADDED Viewed

@@ -0,0 +1,7 @@
+<form method="post" action="/add">
+  <label for="first">First</label>
+  <input id="first" name="first" type="text"/>
+  <label for="second">Second</label>
+  <input id="second" name="second" type="text"/>
+  <input type="submit" value="Add"/>
+</form>

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/sinatra/views/layout.erb ADDED Viewed

@@ -0,0 +1,8 @@
+<html>
+  <head>
+    <title>Addition</title>
+  </head>
+  <body>
+    <%= yield %>
+  </body>
+</html>

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/tcl/README.textile ADDED Viewed

@@ -0,0 +1,11 @@
+h1. Cucumber goes Tcl
+h2. Prerequisites
+Install the ruby-tcl bindings:
+  [sudo] gem install tcl
+h2. Run the example:
+  rake cucumber

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/tcl/Rakefile ADDED Viewed

@@ -0,0 +1,6 @@
+$:.unshift(File.dirname(__FILE__) + '/../../lib')
+require 'cucumber/rake/task'
+Cucumber::Rake::Task.new do |t|
+  t.cucumber_opts = %w{--format pretty}
+end

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/tcl/features/fibonnacci.feature ADDED Viewed

@@ -0,0 +1,17 @@
+Feature: Fibonacci
+  In order to calculate super fast fibonacci series
+  As a Tcl hacker
+  I want to use Tcl for that
+  Scenario Outline: Series
+    When I ask Tcl to calculate fibonacci for <n>
+    Then it should give me <result>
+    Examples:
+      | n | result |
+      | 1 | 1      |
+      | 2 | 1      |
+      | 3 | 2      |
+      | 4 | 3      |
+      | 5 | 5      |
+      | 6 | 8      |

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/tcl/features/step_definitions/fib_steps.rb ADDED Viewed

@@ -0,0 +1,7 @@
+When /^I ask Tcl to calculate fibonacci for (\d+)$/ do |n|
+  @fib_result = @fib.eval("fib #{n}").to_i
+end
+Then /^it should give me (\d+)$/ do |expected|
+  @fib_result.should == expected.to_i
+end

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/tcl/features/support/env.rb ADDED Viewed

@@ -0,0 +1,6 @@
+require 'rubygems'
+require 'tcl'
+Before do
+  @fib = Tcl::Interp.load_from_file(File.dirname(__FILE__) + '/../../src/fib.tcl')
+end

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/tcl/src/fib.tcl ADDED Viewed

@@ -0,0 +1,3 @@
+proc fib {n} {
+    return [expr {$n<2 ? $n : [fib [expr $n-1]] + [fib [expr $n-2]]}]
+}

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/test_unit/Rakefile ADDED Viewed

@@ -0,0 +1,6 @@
+$:.unshift(File.dirname(__FILE__) + '/../../lib')
+require 'cucumber/rake/task'
+Cucumber::Rake::Task.new do |t|
+  t.cucumber_opts = %w{--format pretty}
+end

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/test_unit/features/step_definitions/test_unit_steps.rb ADDED Viewed

@@ -0,0 +1,23 @@
+require 'test/unit/assertions'
+World(Test::Unit::Assertions)
+Given /^(\w+) = (\w+)$/ do |var, value|
+  instance_variable_set("@#{var}", value)
+end
+begin
+  require 'rubygems'
+  require 'matchy'
+  Then /^I can assert that (\w+) == (\w+)$/ do |var_a, var_b|
+    a = instance_variable_get("@#{var_a}")
+    b = instance_variable_get("@#{var_b}")
+    a.should == b
+  end
+rescue LoadError
+  STDERR.puts "***** You should install matchy *****"
+  Then /^I can assert that (\w+) == (\w+)$/ do |var_a, var_b|
+    a = instance_variable_get("@#{var_a}")
+    b = instance_variable_get("@#{var_b}")
+    assert_equal(a, b)
+  end
+end

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/test_unit/features/test_unit.feature ADDED Viewed

@@ -0,0 +1,9 @@
+Feature: Test::Unit
+  In order to please people who like Test::Unit
+  As a Cucumber user
+  I want to be able to use assert* in my step definitions
+  Scenario: assert_equal
+    Given x = 5
+    And y = 5
+    Then I can assert that x == y

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/v8/Rakefile ADDED Viewed

@@ -0,0 +1,6 @@
+$:.unshift(File.dirname(__FILE__) + '/../../lib')
+require 'cucumber/rake/task'
+Cucumber::Rake::Task.new
+task :default => 'cucumber'

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/v8/features/fibonacci.feature ADDED Viewed

@@ -0,0 +1,43 @@
+Feature: Fibonacci
+  In order to calculate super fast fibonacci series
+  As a Javascriptist
+  I want to use Javascript for that
+  Scenario Outline: Series
+    When I ask Javascript to calculate fibonacci up to <n>
+    Then it should give me <series>
+    Examples:
+      | n   | series                                 |
+      | 1   | []                                     |
+      | 2   | [1, 1]                                 |
+      | 3   | [1, 1, 2]                              |
+      | 4   | [1, 1, 2, 3]                           |
+      | 6   | [1, 1, 2, 3, 5]                        |
+      | 9   | [1, 1, 2, 3, 5, 8]                     |
+      | 100 | [1, 1, 2, 3, 5, 8, 13, 21, 34, 55, 89] |
+  Scenario: Single series tested via a PyString
+    When I ask Javascript to calculate fibonacci up to 2 with formatting
+    Then it should give me:
+    """
+    '[1, 1]'
+    """
+  Scenario: Single series tested via a Step Table
+    When I ask Javascript to calculate fibonacci up to 2
+    Then it should contain:
+    | cell 1 | cell 2 |
+    |   1    |   1    |
+  @do-fibonnacci-in-before-hook @reviewed
+  Scenario: Single series with Before hook with a tag label
+    Then it should give me [1, 1, 2]
+  Scenario: Single series by calling a step from within a step
+    Then it should give me [1, 1] via calling another step definition
+  Scenario: Single series by calling multiple steps from within a step
+    Then it should calculate fibonacci up to 2 giving me [1, 1]

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/v8/features/step_definitions/fib_steps.js ADDED Viewed

@@ -0,0 +1,49 @@
+Before(function(){
+  fibResult = 0;
+});
+Before(['@do-fibonnacci-in-before-hook', '@reviewed'], function(){
+  fibResult = fibonacciSeries(3);
+});
+After(function(){
+  //throw 'Sabotage scenario';
+});
+Transform(/^(\d+)$/, function(n){
+  return parseInt(n);
+});
+When(/^I ask Javascript to calculate fibonacci up to (\d+)$/, function(n){
+  assertEqual(fibResult, 0);
+  fibResult = fibonacciSeries(n);
+});
+When(/^I ask Javascript to calculate fibonacci up to (\d+) with formatting$/, function(n){
+  assertEqual(0, fibResult)
+  fibResult = fibonacciSeriesFormatted(n);
+});
+Then(/^it should give me (\[.*\])$/, function(expectedResult){
+  assertEqual(expectedResult, fibResult)
+});
+Then(/^it should give me:$/, function(string){
+  assertEqual(string, fibResult);
+});
+Then(/^it should contain:$/, function(table){
+  var hashes = table.hashes;
+  assertMatches(hashes[0]['cell 1'], fibResult);
+  assertMatches(hashes[0]['cell 2'], fibResult);
+});
+Then(/^it should give me (\[.*\]) via calling another step definition$/, function(expectedResult){
+  Given("I ask Javascript to calculate fibonacci up to 2");
+  assertEqual(expectedResult, fibResult);
+});
+Then(/^it should calculate fibonacci up to (\d+) giving me (\[.*\])/, function(n, expectedResult){
+  steps("Given I ask Javascript to calculate fibonacci up to "+ n + "\n" +
+        "Then it should give me "+ expectedResult);
+});

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/v8/features/support/env.js ADDED Viewed

@@ -0,0 +1,14 @@
+//The path is relative to the folder which contains the features folder
+World(['lib/fibonacci.js']);
+function assertEqual(expected, actual){
+  if(expected != actual){
+    throw 'Expected <' + expected + "> but got <" + actual + ">";
+  }
+}
+function assertMatches(expected, actual){
+  if(actual.indexOf(expected) == -1){
+    throw 'Expected <' + expected + "> to contain <" + actual + "> but it did not";
+  }
+}

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/v8/lib/fibonacci.js ADDED Viewed

@@ -0,0 +1,19 @@
+function fibonacci(n){
+  return n<2?n:fibonacci(n-1)+fibonacci(n-2);
+}
+var fibonacciSeries = function(fibonacciLimit) {
+  var result = Array();
+  var currentfibonacciValue = fibonacci(1);
+  var i = 2;
+  while(currentfibonacciValue < fibonacciLimit) {
+    result.push(currentfibonacciValue);
+    currentfibonacciValue  = fibonacci(i);
+    i++;
+  }
+  return "[" + result.join(", ") + "]";
+}
+var fibonacciSeriesFormatted = function(fibonacciLimit){
+  return "\n'" + fibonacciSeries(fibonacciLimit) + "'\n"
+}

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/watir/.gitignore ADDED Viewed

	@@ -0,0 +1,2 @@
1	+ *.html
2	+ *.png

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/watir/README.textile ADDED Viewed

@@ -0,0 +1,16 @@
+Here you'll find examples for Watir, FireWatir, SafariWatir and Celerity.
+All of these browser libraries have the same API, so the example code will
+work with all of them.
+Just run with:
+  rake cucumber
+This will use Watir/IE if you're on Windows, and SafariWatir/Safari if you're on OS X.
+You can force the use of FireWatir/Firefox on any platform like this:
+  rake features FIREWATIR=true
+And finally, you can use Celerity by running in JRuby:
+  jruby -S rake cucumber

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/watir/Rakefile ADDED Viewed

@@ -0,0 +1,12 @@
+$:.unshift(File.dirname(__FILE__) + '/../../lib')
+require 'cucumber/rake/task'
+Cucumber::Rake::Task.new do |t|
+  t.cucumber_opts = %w{--format pretty}
+end
+Cucumber::Rake::Task.new(:cucumber_screenshot) do |t|
+  t.cucumber_opts = %w{--format html --out report.html}
+end
+task :default => :cucumber

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/watir/cucumber.yml ADDED Viewed

	@@ -0,0 +1 @@
1	+ default: --format html --out report.html --format pretty

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/watir/features/search.feature ADDED Viewed

@@ -0,0 +1,12 @@
+Feature: Search
+  In order to learn more
+  As an information seeker
+  I want to find more information
+  Scenario: Find what I'm looking for
+    Given I am on the Google search page
+    When I search for "cucumber github"
+    Then I should see
+      """
+      GitHub
+      """

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/watir/features/step_definitions/search_steps.rb ADDED Viewed

@@ -0,0 +1,26 @@
+# Full Watir API: http://wtr.rubyforge.org/rdoc/
+# Full RSpec API: http://rspec.rubyforge.org/
+Given 'I am on the Google search page' do
+  @browser.goto 'http://www.google.com/'
+end
+When /I search for "(.*)"/ do |query|
+  @browser.text_field(:name, 'q').set(query)
+  @browser.button(:name, 'btnG').click
+end
+Then /I should see/ do |text|
+  @browser.text.should =~ /#{text}/m
+end
+# To avoid step definitions that are tightly coupled to your user interface,
+# consider creating classes for your pages - such as this:
+# http://github.com/aslakhellesoy/cucumber/tree/v0.1.15/examples/watir/features/step_definitons/search_steps.rb
+#
+# You may keep the page classes along your steps, or even better, put them in separate files, e.g.
+# support/pages/google_search.rb
+#
+# This technique is called "Page Objects", and you can read more about it here:
+# http://github.com/marekj/watirloo/tree/master
+# We're not using this technique here, since we want to illustrate the basics only.

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/watir/features/support/env.rb ADDED Viewed

@@ -0,0 +1,32 @@
+begin require 'rspec/expectations'; rescue LoadError; require 'spec/expectations'; end
+if ENV['FIREWATIR']
+  require 'firewatir'
+  Browser = FireWatir::Firefox
+else
+  case RUBY_PLATFORM
+  when /darwin/
+    require 'safariwatir'
+    Browser = Watir::Safari
+  when /win32|mingw/
+    require 'watir'
+    Browser = Watir::IE
+  when /java/
+    require 'celerity'
+    Browser = Celerity::Browser
+  else
+    raise "This platform is not supported (#{PLATFORM})"
+  end
+end
+# "before all"
+browser = Browser.new
+Before do
+  @browser = browser
+end
+# "after all"
+at_exit do
+  browser.close
+end

data/bundler/ruby/1.8/gems/cucumber-0.9.4/examples/watir/features/support/screenshots.rb ADDED Viewed

@@ -0,0 +1,47 @@
+# This is an example of how you can set up screenshots for your
+# browser testing. Just run cucumber with --format html --out report.html
+#
+# The code below will work on OS X or Windows (with IE Watir only).
+# Adding support for other platforms should be easy - as long as there is a
+# ruby library or command line tool to take pictures.
+#
+module Screenshots
+  if Cucumber::OS_X
+    def embed_screenshot(id)
+      `screencapture -t png #{id}.png`
+      embed("#{id}.png", "image/png")
+    end
+  elsif Cucumber::WINDOWS
+    # http://wtr.rubyforge.org/rdoc/classes/Watir/ScreenCapture.html
+    require 'watir/screen_capture'
+    include Watir::ScreenCapture
+    def embed_screenshot(id)
+      screen_capture("#{id}.jpg", true)
+      embed("#{id}.jpg", "image/jpeg")
+    end
+  else
+    # Other platforms...
+    def embed_screenshot(id)
+      STDERR.puts "Sorry - no screenshots on your platform yet."
+    end
+  end
+end
+World(Screenshots)
+After do
+  embed_screenshot("screenshot-#{Time.new.to_i}")
+end
+# Other variants:
+#
+# Only take screenshot on failures
+#
+#   After do |scenario|
+#     embed_screenshot("screenshot-#{Time.new.to_i}") if scenario.failed?
+#   end
+#
+# Only take screenshot for scenarios or features tagged @screenshot
+#
+#   After(@screenshot) do
+#     embed_screenshot("screenshot-#{Time.new.to_i}")
+#   end

data/bundler/ruby/1.8/gems/cucumber-0.9.4/features/announce.feature ADDED Viewed

@@ -0,0 +1,164 @@
+Feature: Delayed announcement
+  Background:
+    Given a standard Cucumber project directory structure
+    And a file named "features/step_definitions/steps.rb" with:
+      """
+      Given /^I use announce with text "(.*)"$/ do |ann| x=1
+        announce(ann)
+      end
+      Given /^I use multiple announces$/ do x=1
+        announce("Multiple")
+        announce(["Announce","Me"])
+      end
+      Given /^I use announcement (.+) in line (.+) (?:with result (.+))$/ do |ann, line, result| x=1
+        announce("Last announcement") if line == "3"
+        announce("Line: #{line}: #{ann}")
+        fail if result =~ /fail/i
+      end
+      Given /^I use announce and step fails$/ do x=1
+        announce("Announce with fail")
+        fail
+      end
+      Given /^this step works$/ do x=1
+      end
+      Given /^I announce the world$/ do x=1
+        announce_world
+      end
+      """
+    And a file named "features/f.feature" with:
+      """
+      Feature: F
+        Scenario: S
+          Given I use announce with text "Ann"
+          And this step works
+        Scenario: S2
+          Given I use multiple announces
+          And this step works
+        Scenario Outline: S3
+          Given I use announcement <ann> in line <line>
+          Examples:
+            | line | ann |
+            | 1 | anno1 |
+            | 2 | anno2 |
+            | 3 | anno3 |
+        Scenario: S4
+          Given I use announce and step fails
+          And this step works
+        Scenario Outline: s5
+          Given I use announcement <ann> in line <line> with result <result>
+          Examples:
+            | line | ann | result |
+            | 1 | anno1 | fail |
+            | 2 | anno2 | pass |
+      """
+    And a file named "features/announce_world.feature" with:
+      """
+      Feature: announce_world
+        Scenario: announce_world
+          Given I announce the world
+      """
+    Scenario: Delayed announcements feature
+      When I run cucumber --format pretty features/f.feature
+      Then STDERR should be empty
+      And the output should contain
+      """
+      Feature: F
+        Scenario: S                            # features/f.feature:3
+          Given I use announce with text "Ann" # features/step_definitions/steps.rb:1
+            Ann
+          And this step works                  # features/step_definitions/steps.rb:21
+        Scenario: S2                     # features/f.feature:7
+          Given I use multiple announces # features/step_definitions/steps.rb:5
+            Multiple
+            Announce
+            Me
+          And this step works            # features/step_definitions/steps.rb:21
+        Scenario Outline: S3                            # features/f.feature:11
+          Given I use announcement <ann> in line <line> # features/f.feature:12
+          Examples:
+            | line | ann   |
+            | 1    | anno1 |
+            | 2    | anno2 |
+            | 3    | anno3 |
+        Scenario: S4                          # features/f.feature:20
+          Given I use announce and step fails # features/step_definitions/steps.rb:16
+            Announce with fail
+             (RuntimeError)
+            ./features/step_definitions/steps.rb:18:in `/^I use announce and step fails$/'
+            features/f.feature:21:in `Given I use announce and step fails'
+          And this step works                 # features/step_definitions/steps.rb:21
+        Scenario Outline: s5                                                 # features/f.feature:24
+          Given I use announcement <ann> in line <line> with result <result> # features/step_definitions/steps.rb:10
+          Examples:
+            | line | ann   | result |
+            | 1    | anno1 | fail   |  Line: 1: anno1
+             (RuntimeError)
+            ./features/step_definitions/steps.rb:13:in `/^I use announcement (.+) in line (.+) (?:with result (.+))$/'
+            features/f.feature:25:in `Given I use announcement <ann> in line <line> with result <result>'
+            | 2    | anno2 | pass   |  Line: 2: anno2
+      """
+    Scenario: Non-delayed announcements feature (progress formatter)
+      When I run cucumber --format progress features/f.feature
+      Then the output should contain
+        """
+        Ann
+        ..
+        Multiple
+        Announce
+        Me
+        ..-UUUUUU
+        Announce with fail
+        F--
+        Line: 1: anno1
+        FFF
+        Line: 2: anno2
+        ...
+        """
+    @rspec2
+    Scenario: announce world
+      When I run cucumber --format progress features/announce_world.feature
+      Then the output should contain
+      """
+      WORLD:
+        Object
+        RSpec::Matchers
+        Cucumber::RbSupport::RbWorld
+      """
+    @rspec1
+    Scenario: announce world
+      When I run cucumber --format progress features/announce_world.feature
+      Then the output should contain
+      """
+      WORLD:
+        Object
+        Spec::Matchers
+        Cucumber::RbSupport::RbWorld
+      """