slices 1.0.0

data/app/assets/javascripts/slices/vendor/moment.js

@@ -0,0 +1,6 @@
+// moment.js
+// version : 1.7.2
+// author : Tim Wood
+// license : MIT
+// momentjs.com
+(function(a){function E(a,b,c,d){var e=c.lang();return e[a].call?e[a](c,d):e[a][b]}function F(a,b){return function(c){return K(a.call(this,c),b)}}function G(a){return function(b){var c=a.call(this,b);return c+this.lang().ordinal(c)}}function H(a,b,c){this._d=a,this._isUTC=!!b,this._a=a._a||null,this._lang=c||!1}function I(a){var b=this._data={},c=a.years||a.y||0,d=a.months||a.M||0,e=a.weeks||a.w||0,f=a.days||a.d||0,g=a.hours||a.h||0,h=a.minutes||a.m||0,i=a.seconds||a.s||0,j=a.milliseconds||a.ms||0;this._milliseconds=j+i*1e3+h*6e4+g*36e5,this._days=f+e*7,this._months=d+c*12,b.milliseconds=j%1e3,i+=J(j/1e3),b.seconds=i%60,h+=J(i/60),b.minutes=h%60,g+=J(h/60),b.hours=g%24,f+=J(g/24),f+=e*7,b.days=f%30,d+=J(f/30),b.months=d%12,c+=J(d/12),b.years=c,this._lang=!1}function J(a){return a<0?Math.ceil(a):Math.floor(a)}function K(a,b){var c=a+"";while(c.length<b)c="0"+c;return c}function L(a,b,c){var d=b._milliseconds,e=b._days,f=b._months,g;d&&a._d.setTime(+a+d*c),e&&a.date(a.date()+e*c),f&&(g=a.date(),a.date(1).month(a.month()+f*c).date(Math.min(g,a.daysInMonth())))}function M(a){return Object.prototype.toString.call(a)==="[object Array]"}function N(a,b){var c=Math.min(a.length,b.length),d=Math.abs(a.length-b.length),e=0,f;for(f=0;f<c;f++)~~a[f]!==~~b[f]&&e++;return e+d}function O(a,b,c,d){var e,f,g=[];for(e=0;e<7;e++)g[e]=a[e]=a[e]==null?e===2?1:0:a[e];return a[7]=g[7]=b,a[8]!=null&&(g[8]=a[8]),a[3]+=c||0,a[4]+=d||0,f=new Date(0),b?(f.setUTCFullYear(a[0],a[1],a[2]),f.setUTCHours(a[3],a[4],a[5],a[6])):(f.setFullYear(a[0],a[1],a[2]),f.setHours(a[3],a[4],a[5],a[6])),f._a=g,f}function P(a,c){var d,e,g=[];!c&&h&&(c=require("./lang/"+a));for(d=0;d<i.length;d++)c[i[d]]=c[i[d]]||f.en[i[d]];for(d=0;d<12;d++)e=b([2e3,d]),g[d]=new RegExp("^"+(c.months[d]||c.months(e,""))+"|^"+(c.monthsShort[d]||c.monthsShort(e,"")).replace(".",""),"i");return c.monthsParse=c.monthsParse||g,f[a]=c,c}function Q(a){var c=typeof a=="string"&&a||a&&a._lang||null;return c?f[c]||P(c):b}function R(a){return a.match(/\[.*\]/)?a.replace(/^\[|\]$/g,""):a.replace(/\\/g,"")}function S(a){var b=a.match(k),c,d;for(c=0,d=b.length;c<d;c++)D[b[c]]?b[c]=D[b[c]]:b[c]=R(b[c]);return function(e){var f="";for(c=0;c<d;c++)f+=typeof b[c].call=="function"?b[c].call(e,a):b[c];return f}}function T(a,b){function d(b){return a.lang().longDateFormat[b]||b}var c=5;while(c--&&l.test(b))b=b.replace(l,d);return A[b]||(A[b]=S(b)),A[b](a)}function U(a){switch(a){case"DDDD":return p;case"YYYY":return q;case"S":case"SS":case"SSS":case"DDD":return o;case"MMM":case"MMMM":case"dd":case"ddd":case"dddd":case"a":case"A":return r;case"Z":case"ZZ":return s;case"T":return t;case"MM":case"DD":case"YY":case"HH":case"hh":case"mm":case"ss":case"M":case"D":case"d":case"H":case"h":case"m":case"s":return n;default:return new RegExp(a.replace("\\",""))}}function V(a,b,c,d){var e,f;switch(a){case"M":case"MM":c[1]=b==null?0:~~b-1;break;case"MMM":case"MMMM":for(e=0;e<12;e++)if(Q().monthsParse[e].test(b)){c[1]=e,f=!0;break}f||(c[8]=!1);break;case"D":case"DD":case"DDD":case"DDDD":b!=null&&(c[2]=~~b);break;case"YY":c[0]=~~b+(~~b>70?1900:2e3);break;case"YYYY":c[0]=~~Math.abs(b);break;case"a":case"A":d.isPm=(b+"").toLowerCase()==="pm";break;case"H":case"HH":case"h":case"hh":c[3]=~~b;break;case"m":case"mm":c[4]=~~b;break;case"s":case"ss":c[5]=~~b;break;case"S":case"SS":case"SSS":c[6]=~~(("0."+b)*1e3);break;case"Z":case"ZZ":d.isUTC=!0,e=(b+"").match(x),e&&e[1]&&(d.tzh=~~e[1]),e&&e[2]&&(d.tzm=~~e[2]),e&&e[0]==="+"&&(d.tzh=-d.tzh,d.tzm=-d.tzm)}b==null&&(c[8]=!1)}function W(a,b){var c=[0,0,1,0,0,0,0],d={tzh:0,tzm:0},e=b.match(k),f,g;for(f=0;f<e.length;f++)g=(U(e[f]).exec(a)||[])[0],g&&(a=a.slice(a.indexOf(g)+g.length)),D[e[f]]&&V(e[f],g,c,d);return d.isPm&&c[3]<12&&(c[3]+=12),d.isPm===!1&&c[3]===12&&(c[3]=0),O(c,d.isUTC,d.tzh,d.tzm)}function X(a,b){var c,d=a.match(m)||[],e,f=99,g,h,i;for(g=0;g<b.length;g++)h=W(a,b[g]),e=T(new H(h),b[g]).match(m)||[],i=N(d,e),i<f&&(f=i,c=h);return c}function Y(a){var b="YYYY-MM-DDT",c;if(u.exec(a)){for(c=0;c<4;c++)if(w[c][1].exec(a)){b+=w[c][0];break}return s.exec(a)?W(a,b+" Z"):W(a,b)}return new Date(a)}function Z(a,b,c,d,e){var f=e.relativeTime[a];return typeof f=="function"?f(b||1,!!c,a,d):f.replace(/%d/i,b||1)}function $(a,b,c){var e=d(Math.abs(a)/1e3),f=d(e/60),g=d(f/60),h=d(g/24),i=d(h/365),j=e<45&&["s",e]||f===1&&["m"]||f<45&&["mm",f]||g===1&&["h"]||g<22&&["hh",g]||h===1&&["d"]||h<=25&&["dd",h]||h<=45&&["M"]||h<345&&["MM",d(h/30)]||i===1&&["y"]||["yy",i];return j[2]=b,j[3]=a>0,j[4]=c,Z.apply({},j)}function _(a,c){b.fn[a]=function(a){var b=this._isUTC?"UTC":"";return a!=null?(this._d["set"+b+c](a),this):this._d["get"+b+c]()}}function ab(a){b.duration.fn[a]=function(){return this._data[a]}}function bb(a,c){b.duration.fn["as"+a]=function(){return+this/c}}var b,c="1.7.2",d=Math.round,e,f={},g="en",h=typeof module!="undefined"&&module.exports,i="months|monthsShort|weekdays|weekdaysShort|weekdaysMin|longDateFormat|calendar|relativeTime|ordinal|meridiem".split("|"),j=/^\/?Date\((\-?\d+)/i,k=/(\[[^\[]*\])|(\\)?(Mo|MM?M?M?|Do|DDDo|DD?D?D?|ddd?d?|do?|w[o|w]?|YYYY|YY|a|A|hh?|HH?|mm?|ss?|SS?S?|zz?|ZZ?|.)/g,l=/(\[[^\[]*\])|(\\)?(LT|LL?L?L?)/g,m=/([0-9a-zA-Z\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]+)/gi,n=/\d\d?/,o=/\d{1,3}/,p=/\d{3}/,q=/\d{1,4}/,r=/[0-9a-z\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]+/i,s=/Z|[\+\-]\d\d:?\d\d/i,t=/T/i,u=/^\s*\d{4}-\d\d-\d\d(T(\d\d(:\d\d(:\d\d(\.\d\d?\d?)?)?)?)?([\+\-]\d\d:?\d\d)?)?/,v="YYYY-MM-DDTHH:mm:ssZ",w=[["HH:mm:ss.S",/T\d\d:\d\d:\d\d\.\d{1,3}/],["HH:mm:ss",/T\d\d:\d\d:\d\d/],["HH:mm",/T\d\d:\d\d/],["HH",/T\d\d/]],x=/([\+\-]|\d\d)/gi,y="Month|Date|Hours|Minutes|Seconds|Milliseconds".split("|"),z={Milliseconds:1,Seconds:1e3,Minutes:6e4,Hours:36e5,Days:864e5,Months:2592e6,Years:31536e6},A={},B="DDD w M D d".split(" "),C="M D H h m s w".split(" "),D={M:function(){return this.month()+1},MMM:function(a){return E("monthsShort",this.month(),this,a)},MMMM:function(a){return E("months",this.month(),this,a)},D:function(){return this.date()},DDD:function(){var a=new Date(this.year(),this.month(),this.date()),b=new Date(this.year(),0,1);return~~((a-b)/864e5+1.5)},d:function(){return this.day()},dd:function(a){return E("weekdaysMin",this.day(),this,a)},ddd:function(a){return E("weekdaysShort",this.day(),this,a)},dddd:function(a){return E("weekdays",this.day(),this,a)},w:function(){var a=new Date(this.year(),this.month(),this.date()-this.day()+5),b=new Date(a.getFullYear(),0,4);return~~((a-b)/864e5/7+1.5)},YY:function(){return K(this.year()%100,2)},YYYY:function(){return K(this.year(),4)},a:function(){return this.lang().meridiem(this.hours(),this.minutes(),!0)},A:function(){return this.lang().meridiem(this.hours(),this.minutes(),!1)},H:function(){return this.hours()},h:function(){return this.hours()%12||12},m:function(){return this.minutes()},s:function(){return this.seconds()},S:function(){return~~(this.milliseconds()/100)},SS:function(){return K(~~(this.milliseconds()/10),2)},SSS:function(){return K(this.milliseconds(),3)},Z:function(){var a=-this.zone(),b="+";return a<0&&(a=-a,b="-"),b+K(~~(a/60),2)+":"+K(~~a%60,2)},ZZ:function(){var a=-this.zone(),b="+";return a<0&&(a=-a,b="-"),b+K(~~(10*a/6),4)}};while(B.length)e=B.pop(),D[e+"o"]=G(D[e]);while(C.length)e=C.pop(),D[e+e]=F(D[e],2);D.DDDD=F(D.DDD,3),b=function(c,d){if(c===null||c==="")return null;var e,f;return b.isMoment(c)?new H(new Date(+c._d),c._isUTC,c._lang):(d?M(d)?e=X(c,d):e=W(c,d):(f=j.exec(c),e=c===a?new Date:f?new Date(+f[1]):c instanceof Date?c:M(c)?O(c):typeof c=="string"?Y(c):new Date(c)),new H(e))},b.utc=function(a,c){return M(a)?new H(O(a,!0),!0):(typeof a=="string"&&!s.exec(a)&&(a+=" +0000",c&&(c+=" Z")),b(a,c).utc())},b.unix=function(a){return b(a*1e3)},b.duration=function(a,c){var d=b.isDuration(a),e=typeof a=="number",f=d?a._data:e?{}:a,g;return e&&(c?f[c]=a:f.milliseconds=a),g=new I(f),d&&(g._lang=a._lang),g},b.humanizeDuration=function(a,c,d){return b.duration(a,c===!0?null:c).humanize(c===!0?!0:d)},b.version=c,b.defaultFormat=v,b.lang=function(a,c){var d;if(!a)return g;(c||!f[a])&&P(a,c);if(f[a]){for(d=0;d<i.length;d++)b[i[d]]=f[a][i[d]];b.monthsParse=f[a].monthsParse,g=a}},b.langData=Q,b.isMoment=function(a){return a instanceof H},b.isDuration=function(a){return a instanceof I},b.lang("en",{months:"January_February_March_April_May_June_July_August_September_October_November_December".split("_"),monthsShort:"Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec".split("_"),weekdays:"Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"),weekdaysShort:"Sun_Mon_Tue_Wed_Thu_Fri_Sat".split("_"),weekdaysMin:"Su_Mo_Tu_We_Th_Fr_Sa".split("_"),longDateFormat:{LT:"h:mm A",L:"MM/DD/YYYY",LL:"MMMM D YYYY",LLL:"MMMM D YYYY LT",LLLL:"dddd, MMMM D YYYY LT"},meridiem:function(a,b,c){return a>11?c?"pm":"PM":c?"am":"AM"},calendar:{sameDay:"[Today at] LT",nextDay:"[Tomorrow at] LT",nextWeek:"dddd [at] LT",lastDay:"[Yesterday at] LT",lastWeek:"[last] dddd [at] LT",sameElse:"L"},relativeTime:{future:"in %s",past:"%s ago",s:"a few seconds",m:"a minute",mm:"%d minutes",h:"an hour",hh:"%d hours",d:"a day",dd:"%d days",M:"a month",MM:"%d months",y:"a year",yy:"%d years"},ordinal:function(a){var b=a%10;return~~(a%100/10)===1?"th":b===1?"st":b===2?"nd":b===3?"rd":"th"}}),b.fn=H.prototype={clone:function(){return b(this)},valueOf:function(){return+this._d},unix:function(){return Math.floor(+this._d/1e3)},toString:function(){return this._d.toString()},toDate:function(){return this._d},toArray:function(){var a=this;return[a.year(),a.month(),a.date(),a.hours(),a.minutes(),a.seconds(),a.milliseconds(),!!this._isUTC]},isValid:function(){return this._a?this._a[8]!=null?!!this._a[8]:!N(this._a,(this._a[7]?b.utc(this._a):b(this._a)).toArray()):!isNaN(this._d.getTime())},utc:function(){return this._isUTC=!0,this},local:function(){return this._isUTC=!1,this},format:function(a){return T(this,a?a:b.defaultFormat)},add:function(a,c){var d=c?b.duration(+c,a):b.duration(a);return L(this,d,1),this},subtract:function(a,c){var d=c?b.duration(+c,a):b.duration(a);return L(this,d,-1),this},diff:function(a,c,e){var f=this._isUTC?b(a).utc():b(a).local(),g=(this.zone()-f.zone())*6e4,h=this._d-f._d-g,i=this.year()-f.year(),j=this.month()-f.month(),k=this.date()-f.date(),l;return c==="months"?l=i*12+j+k/30:c==="years"?l=i+(j+k/30)/12:l=c==="seconds"?h/1e3:c==="minutes"?h/6e4:c==="hours"?h/36e5:c==="days"?h/864e5:c==="weeks"?h/6048e5:h,e?l:d(l)},from:function(a,c){return b.duration(this.diff(a)).lang(this._lang).humanize(!c)},fromNow:function(a){return this.from(b(),a)},calendar:function(){var a=this.diff(b().sod(),"days",!0),c=this.lang().calendar,d=c.sameElse,e=a<-6?d:a<-1?c.lastWeek:a<0?c.lastDay:a<1?c.sameDay:a<2?c.nextDay:a<7?c.nextWeek:d;return this.format(typeof e=="function"?e.apply(this):e)},isLeapYear:function(){var a=this.year();return a%4===0&&a%100!==0||a%400===0},isDST:function(){return this.zone()<b([this.year()]).zone()||this.zone()<b([this.year(),5]).zone()},day:function(a){var b=this._isUTC?this._d.getUTCDay():this._d.getDay();return a==null?b:this.add({d:a-b})},startOf:function(a){switch(a.replace(/s$/,"")){case"year":this.month(0);case"month":this.date(1);case"day":this.hours(0);case"hour":this.minutes(0);case"minute":this.seconds(0);case"second":this.milliseconds(0)}return this},endOf:function(a){return this.startOf(a).add(a.replace(/s?$/,"s"),1).subtract("ms",1)},sod:function(){return this.clone().startOf("day")},eod:function(){return this.clone().endOf("day")},zone:function(){return this._isUTC?0:this._d.getTimezoneOffset()},daysInMonth:function(){return b.utc([this.year(),this.month()+1,0]).date()},lang:function(b){return b===a?Q(this):(this._lang=b,this)}};for(e=0;e<y.length;e++)_(y[e].toLowerCase(),y[e]);_("year","FullYear"),b.duration.fn=I.prototype={weeks:function(){return J(this.days()/7)},valueOf:function(){return this._milliseconds+this._days*864e5+this._months*2592e6},humanize:function(a){var b=+this,c=this.lang().relativeTime,d=$(b,!a,this.lang()),e=b<=0?c.past:c.future;return a&&(typeof e=="function"?d=e(d):d=e.replace(/%s/i,d)),d},lang:b.fn.lang};for(e in z)z.hasOwnProperty(e)&&(bb(e,z[e]),ab(e.toLowerCase()));bb("Weeks",6048e5),h&&(module.exports=b),typeof ender=="undefined"&&(this.moment=b),typeof define=="function"&&define.amd&&define("moment",[],function(){return b})}).call(this);

data/app/assets/javascripts/slices/vendor/rails.js

@@ -0,0 +1,315 @@
+/**
+ * Unobtrusive scripting adapter for jQuery
+ *
+ * Requires jQuery 1.4.4 or later.
+ * https://github.com/rails/jquery-ujs
+
+ * Uploading file using rails.js
+ * =============================
+ *
+ * By default, browsers do not allow files to be uploaded via AJAX. As a result, if there are any non-blank file fields
+ * in the remote form, this adapter aborts the AJAX submission and allows the form to submit through standard means.
+ *
+ * The `ajax:aborted:file` event allows you to bind your own handler to process the form submission however you wish.
+ *
+ * Ex:
+ *     $('form').live('ajax:aborted:file', function(event, elements){
+ *       // Implement own remote file-transfer handler here for non-blank file inputs passed in `elements`.
+ *       // Returning false in this handler tells rails.js to disallow standard form submission
+ *       return false;
+ *     });
+ *
+ * The `ajax:aborted:file` event is fired when a file-type input is detected with a non-blank value.
+ *
+ * Third-party tools can use this hook to detect when an AJAX file upload is attempted, and then use
+ * techniques like the iframe method to upload the file instead.
+ *
+ * Required fields in rails.js
+ * ===========================
+ *
+ * If any blank required inputs (required="required") are detected in the remote form, the whole form submission
+ * is canceled. Note that this is unlike file inputs, which still allow standard (non-AJAX) form submission.
+ *
+ * The `ajax:aborted:required` event allows you to bind your own handler to inform the user of blank required inputs.
+ *
+ * !! Note that Opera does not fire the form's submit event if there are blank required inputs, so this event may never
+ *    get fired in Opera. This event is what causes other browsers to exhibit the same submit-aborting behavior.
+ *
+ * Ex:
+ *     $('form').live('ajax:aborted:required', function(event, elements){
+ *       // Returning false in this handler tells rails.js to submit the form anyway.
+ *       // The blank required inputs are passed to this function in `elements`.
+ *       return ! confirm("Would you like to submit the form with missing info?");
+ *     });
+ */
+
+(function($) {
+  // Shorthand to make it a little easier to call public rails functions from within rails.js
+  var rails;
+
+  $.rails = rails = {
+    // Link elements bound by jquery-ujs
+    linkClickSelector: 'a[data-confirm], a[data-method], a[data-remote]',
+
+    // Form elements bound by jquery-ujs
+    formSubmitSelector: 'form',
+
+    // Form input elements bound by jquery-ujs
+    formInputClickSelector: 'form input[type=submit], form input[type=image], form button[type=submit], form button:not([type])',
+
+    // Form input elements disabled during form submission
+    disableSelector: 'input[data-disable-with], button[data-disable-with], textarea[data-disable-with]',
+
+    // Form input elements re-enabled after form submission
+    enableSelector: 'input[data-disable-with]:disabled, button[data-disable-with]:disabled, textarea[data-disable-with]:disabled',
+
+    // Form required input elements
+    requiredInputSelector: 'input[name][required]:not([disabled]),textarea[name][required]:not([disabled])',
+
+    // Form file input elements
+    fileInputSelector: 'input:file',
+
+    // Make sure that every Ajax request sends the CSRF token
+    CSRFProtection: function(xhr) {
+      var token = $('meta[name="csrf-token"]').attr('content');
+      if (token) xhr.setRequestHeader('X-CSRF-Token', token);
+    },
+
+    // Triggers an event on an element and returns false if the event result is false
+    fire: function(obj, name, data) {
+      var event = $.Event(name);
+      obj.trigger(event, data);
+      return event.result !== false;
+    },
+
+    // Default confirm dialog, may be overridden with custom confirm dialog in $.rails.confirm
+    confirm: function(message) {
+      return confirm(message);
+    },
+
+    // Default ajax function, may be overridden with custom function in $.rails.ajax
+    ajax: function(options) {
+      return $.ajax(options);
+    },
+
+    // Submits "remote" forms and links with ajax
+    handleRemote: function(element) {
+      var method, url, data,
+        dataType = element.data('type') || ($.ajaxSettings && $.ajaxSettings.dataType);
+
+      if (rails.fire(element, 'ajax:before')) {
+
+        if (element.is('form')) {
+          method = element.attr('method');
+          url = element.attr('action');
+          data = element.serializeArray();
+          // memoized value from clicked submit button
+          var button = element.data('ujs:submit-button');
+          if (button) {
+            data.push(button);
+            element.data('ujs:submit-button', null);
+          }
+        } else {
+          method = element.data('method');
+          url = element.attr('href');
+          data = element.data('params') || null; 
+       }
+
+        rails.ajax({
+          url: url, type: method || 'GET', data: data, dataType: dataType,
+          // stopping the "ajax:beforeSend" event will cancel the ajax request
+          beforeSend: function(xhr, settings) {
+            if (settings.dataType === undefined) {
+              xhr.setRequestHeader('accept', '*/*;q=0.5, ' + settings.accepts.script);
+            }
+            return rails.fire(element, 'ajax:beforeSend', [xhr, settings]);
+          },
+          success: function(data, status, xhr) {
+            element.trigger('ajax:success', [data, status, xhr]);
+          },
+          complete: function(xhr, status) {
+            element.trigger('ajax:complete', [xhr, status]);
+          },
+          error: function(xhr, status, error) {
+            element.trigger('ajax:error', [xhr, status, error]);
+          }
+        });
+      }
+    },
+
+    // Handles "data-method" on links such as:
+    // <a href="/users/5" data-method="delete" rel="nofollow" data-confirm="Are you sure?">Delete</a>
+    handleMethod: function(link) {
+      var href = link.attr('href'),
+        method = link.data('method'),
+        csrf_token = $('meta[name=csrf-token]').attr('content'),
+        csrf_param = $('meta[name=csrf-param]').attr('content'),
+        form = $('<form method="post" action="' + href + '"></form>'),
+        metadata_input = '<input name="_method" value="' + method + '" type="hidden" />';
+
+      if (csrf_param !== undefined && csrf_token !== undefined) {
+        metadata_input += '<input name="' + csrf_param + '" value="' + csrf_token + '" type="hidden" />';
+      }
+
+      form.hide().append(metadata_input).appendTo('body');
+      form.submit();
+    },
+
+    /* Disables form elements:
+      - Caches element value in 'ujs:enable-with' data store
+      - Replaces element text with value of 'data-disable-with' attribute
+      - Adds disabled=disabled attribute
+    */
+    disableFormElements: function(form) {
+      form.find(rails.disableSelector).each(function() {
+        var element = $(this), method = element.is('button') ? 'html' : 'val';
+        element.data('ujs:enable-with', element[method]());
+        element[method](element.data('disable-with'));
+        element.attr('disabled', 'disabled');
+      });
+    },
+
+    /* Re-enables disabled form elements:
+      - Replaces element text with cached value from 'ujs:enable-with' data store (created in `disableFormElements`)
+      - Removes disabled attribute
+    */
+    enableFormElements: function(form) {
+      form.find(rails.enableSelector).each(function() {
+        var element = $(this), method = element.is('button') ? 'html' : 'val';
+        if (element.data('ujs:enable-with')) element[method](element.data('ujs:enable-with'));
+        element.removeAttr('disabled');
+      });
+    },
+
+   /* For 'data-confirm' attribute:
+      - Fires `confirm` event
+      - Shows the confirmation dialog
+      - Fires the `confirm:complete` event
+
+      Returns `true` if no function stops the chain and user chose yes; `false` otherwise.
+      Attaching a handler to the element's `confirm` event that returns a `falsy` value cancels the confirmation dialog.
+      Attaching a handler to the element's `confirm:complete` event that returns a `falsy` value makes this function
+      return false. The `confirm:complete` event is fired whether or not the user answered true or false to the dialog.
+   */
+    allowAction: function(element) {
+      var message = element.data('confirm'),
+          answer = false, callback;
+      if (!message) { return true; }
+
+      if (rails.fire(element, 'confirm')) {
+        answer = rails.confirm(message);
+        callback = rails.fire(element, 'confirm:complete', [answer]);
+      }
+      return answer && callback;
+    },
+
+    // Helper function which checks for blank inputs in a form that match the specified CSS selector
+    blankInputs: function(form, specifiedSelector, nonBlank) {
+      var inputs = $(), input,
+        selector = specifiedSelector || 'input,textarea';
+      form.find(selector).each(function() {
+        input = $(this);
+        // Collect non-blank inputs if nonBlank option is true, otherwise, collect blank inputs
+        if (nonBlank ? input.val() : !input.val()) {
+          inputs = inputs.add(input);
+        }
+      });
+      return inputs.length ? inputs : false;
+    },
+
+    // Helper function which checks for non-blank inputs in a form that match the specified CSS selector
+    nonBlankInputs: function(form, specifiedSelector) {
+      return rails.blankInputs(form, specifiedSelector, true); // true specifies nonBlank
+    },
+
+    // Helper function, needed to provide consistent behavior in IE
+    stopEverything: function(e) {
+      $(e.target).trigger('ujs:everythingStopped');
+      e.stopImmediatePropagation();
+      return false;
+    },
+
+    // find all the submit events directly bound to the form and
+    // manually invoke them. If anyone returns false then stop the loop
+    callFormSubmitBindings: function(form) {
+      var events = form.data('events'), continuePropagation = true;
+      if (events !== undefined && events['submit'] !== undefined) {
+        $.each(events['submit'], function(i, obj){
+          if (typeof obj.handler === 'function') return continuePropagation = obj.handler(obj.data);
+        });
+      }
+      return continuePropagation;
+    }
+  };
+
+  // ajaxPrefilter is a jQuery 1.5 feature
+  if ('ajaxPrefilter' in $) {
+    $.ajaxPrefilter(function(options, originalOptions, xhr){ rails.CSRFProtection(xhr); });
+  } else {
+    $(document).ajaxSend(function(e, xhr){ rails.CSRFProtection(xhr); });
+  }
+
+  $(rails.linkClickSelector).live('click.rails', function(e) {
+    var link = $(this);
+    if (!rails.allowAction(link)) return rails.stopEverything(e);
+
+    if (link.data('remote') !== undefined) {
+      rails.handleRemote(link);
+      return false;
+    } else if (link.data('method')) {
+      rails.handleMethod(link);
+      return false;
+    }
+  });
+
+  $(rails.formSubmitSelector).live('submit.rails', function(e) {
+    var form = $(this),
+      remote = form.data('remote') !== undefined,
+      blankRequiredInputs = rails.blankInputs(form, rails.requiredInputSelector),
+      nonBlankFileInputs = rails.nonBlankInputs(form, rails.fileInputSelector);
+
+    if (!rails.allowAction(form)) return rails.stopEverything(e);
+
+    // skip other logic when required values are missing or file upload is present
+    if (blankRequiredInputs && rails.fire(form, 'ajax:aborted:required', [blankRequiredInputs])) {
+      return rails.stopEverything(e);
+    }
+
+    if (remote) {
+      if (nonBlankFileInputs) {
+        return rails.fire(form, 'ajax:aborted:file', [nonBlankFileInputs]);
+      }
+
+      // If browser does not support submit bubbling, then this live-binding will be called before direct
+      // bindings. Therefore, we should directly call any direct bindings before remotely submitting form.
+      if (!$.support.submitBubbles && rails.callFormSubmitBindings(form) === false) return rails.stopEverything(e);
+
+      rails.handleRemote(form);
+      return false;
+    } else {
+      // slight timeout so that the submit button gets properly serialized
+      setTimeout(function(){ rails.disableFormElements(form); }, 13);
+    }
+  });
+
+  $(rails.formInputClickSelector).live('click.rails', function(event) {
+    var button = $(this);
+
+    if (!rails.allowAction(button)) return rails.stopEverything(event);
+
+    // register the pressed submit button
+    var name = button.attr('name'),
+      data = name ? {name:name, value:button.val()} : null;
+
+    button.closest('form').data('ujs:submit-button', data);
+  });
+
+  $(rails.formSubmitSelector).live('ajax:beforeSend.rails', function(event) {
+    if (this == event.target) rails.disableFormElements($(this));
+  });
+
+  $(rails.formSubmitSelector).live('ajax:complete.rails', function(event) {
+    if (this == event.target) rails.enableFormElements($(this));
+  });
+
+})( jQuery );

data/app/assets/javascripts/slices/vendor/underscore-string.js

@@ -0,0 +1 @@
+!function(e,t){"use strict";var n=t.prototype.trim,r=t.prototype.trimRight,i=t.prototype.trimLeft,s=function(e){return e*1||0},o=function(e,t){if(t<1)return"";var n="";while(t>0)t&1&&(n+=e),t>>=1,e+=e;return n},u=[].slice,a=function(e){return e==null?"\\s":e.source?e.source:"["+p.escapeRegExp(e)+"]"},f={lt:"<",gt:">",quot:'"',apos:"'",amp:"&"},l={};for(var c in f)l[f[c]]=c;var h=function(){function e(e){return Object.prototype.toString.call(e).slice(8,-1).toLowerCase()}var n=o,r=function(){return r.cache.hasOwnProperty(arguments[0])||(r.cache[arguments[0]]=r.parse(arguments[0])),r.format.call(null,r.cache[arguments[0]],arguments)};return r.format=function(r,i){var s=1,o=r.length,u="",a,f=[],l,c,p,d,v,m;for(l=0;l<o;l++){u=e(r[l]);if(u==="string")f.push(r[l]);else if(u==="array"){p=r[l];if(p[2]){a=i[s];for(c=0;c<p[2].length;c++){if(!a.hasOwnProperty(p[2][c]))throw new Error(h('[_.sprintf] property "%s" does not exist',p[2][c]));a=a[p[2][c]]}}else p[1]?a=i[p[1]]:a=i[s++];if(/[^s]/.test(p[8])&&e(a)!="number")throw new Error(h("[_.sprintf] expecting number but found %s",e(a)));switch(p[8]){case"b":a=a.toString(2);break;case"c":a=t.fromCharCode(a);break;case"d":a=parseInt(a,10);break;case"e":a=p[7]?a.toExponential(p[7]):a.toExponential();break;case"f":a=p[7]?parseFloat(a).toFixed(p[7]):parseFloat(a);break;case"o":a=a.toString(8);break;case"s":a=(a=t(a))&&p[7]?a.substring(0,p[7]):a;break;case"u":a=Math.abs(a);break;case"x":a=a.toString(16);break;case"X":a=a.toString(16).toUpperCase()}a=/[def]/.test(p[8])&&p[3]&&a>=0?"+"+a:a,v=p[4]?p[4]=="0"?"0":p[4].charAt(1):" ",m=p[6]-t(a).length,d=p[6]?n(v,m):"",f.push(p[5]?a+d:d+a)}}return f.join("")},r.cache={},r.parse=function(e){var t=e,n=[],r=[],i=0;while(t){if((n=/^[^\x25]+/.exec(t))!==null)r.push(n[0]);else if((n=/^\x25{2}/.exec(t))!==null)r.push("%");else{if((n=/^\x25(?:([1-9]\d*)\$|\(([^\)]+)\))?(\+)?(0|'[^$])?(-)?(\d+)?(?:\.(\d+))?([b-fosuxX])/.exec(t))===null)throw new Error("[_.sprintf] huh?");if(n[2]){i|=1;var s=[],o=n[2],u=[];if((u=/^([a-z_][a-z_\d]*)/i.exec(o))===null)throw new Error("[_.sprintf] huh?");s.push(u[1]);while((o=o.substring(u[0].length))!=="")if((u=/^\.([a-z_][a-z_\d]*)/i.exec(o))!==null)s.push(u[1]);else{if((u=/^\[(\d+)\]/.exec(o))===null)throw new Error("[_.sprintf] huh?");s.push(u[1])}n[2]=s}else i|=2;if(i===3)throw new Error("[_.sprintf] mixing positional and named placeholders is not (yet) supported");r.push(n)}t=t.substring(n[0].length)}return r},r}(),p={VERSION:"2.3.0",isBlank:function(e){return e==null&&(e=""),/^\s*$/.test(e)},stripTags:function(e){return e==null?"":t(e).replace(/<\/?[^>]+>/g,"")},capitalize:function(e){return e=e==null?"":t(e),e.charAt(0).toUpperCase()+e.slice(1)},chop:function(e,n){return e==null?[]:(e=t(e),n=~~n,n>0?e.match(new RegExp(".{1,"+n+"}","g")):[e])},clean:function(e){return p.strip(e).replace(/\s+/g," ")},count:function(e,n){return e==null||n==null?0:t(e).split(n).length-1},chars:function(e){return e==null?[]:t(e).split("")},swapCase:function(e){return e==null?"":t(e).replace(/\S/g,function(e){return e===e.toUpperCase()?e.toLowerCase():e.toUpperCase()})},escapeHTML:function(e){return e==null?"":t(e).replace(/[&<>"']/g,function(e){return"&"+l[e]+";"})},unescapeHTML:function(e){return e==null?"":t(e).replace(/\&([^;]+);/g,function(e,n){var r;return n in f?f[n]:(r=n.match(/^#x([\da-fA-F]+)$/))?t.fromCharCode(parseInt(r[1],16)):(r=n.match(/^#(\d+)$/))?t.fromCharCode(~~r[1]):e})},escapeRegExp:function(e){return e==null?"":t(e).replace(/([.*+?^=!:${}()|[\]\/\\])/g,"\\$1")},splice:function(e,t,n,r){var i=p.chars(e);return i.splice(~~t,~~n,r),i.join("")},insert:function(e,t,n){return p.splice(e,t,0,n)},include:function(e,n){return n===""?!0:e==null?!1:t(e).indexOf(n)!==-1},join:function(){var e=u.call(arguments),t=e.shift();return t==null&&(t=""),e.join(t)},lines:function(e){return e==null?[]:t(e).split("\n")},reverse:function(e){return p.chars(e).reverse().join("")},startsWith:function(e,n){return n===""?!0:e==null||n==null?!1:(e=t(e),n=t(n),e.length>=n.length&&e.slice(0,n.length)===n)},endsWith:function(e,n){return n===""?!0:e==null||n==null?!1:(e=t(e),n=t(n),e.length>=n.length&&e.slice(e.length-n.length)===n)},succ:function(e){return e==null?"":(e=t(e),e.slice(0,-1)+t.fromCharCode(e.charCodeAt(e.length-1)+1))},titleize:function(e){return e==null?"":t(e).replace(/(?:^|\s)\S/g,function(e){return e.toUpperCase()})},camelize:function(e){return p.trim(e).replace(/[-_\s]+(.)?/g,function(e,t){return t.toUpperCase()})},underscored:function(e){return p.trim(e).replace(/([a-z\d])([A-Z]+)/g,"$1_$2").replace(/[-\s]+/g,"_").toLowerCase()},dasherize:function(e){return p.trim(e).replace(/([A-Z])/g,"-$1").replace(/[-_\s]+/g,"-").toLowerCase()},classify:function(e){return p.titleize(t(e).replace(/_/g," ")).replace(/\s/g,"")},humanize:function(e){return p.capitalize(p.underscored(e).replace(/_id$/,"").replace(/_/g," "))},trim:function(e,r){return e==null?"":!r&&n?n.call(e):(r=a(r),t(e).replace(new RegExp("^"+r+"+|"+r+"+$","g"),""))},ltrim:function(e,n){return e==null?"":!n&&i?i.call(e):(n=a(n),t(e).replace(new RegExp("^"+n+"+"),""))},rtrim:function(e,n){return e==null?"":!n&&r?r.call(e):(n=a(n),t(e).replace(new RegExp(n+"+$"),""))},truncate:function(e,n,r){return e==null?"":(e=t(e),r=r||"...",n=~~n,e.length>n?e.slice(0,n)+r:e)},prune:function(e,n,r){if(e==null)return"";e=t(e),n=~~n,r=r!=null?t(r):"...";if(e.length<=n)return e;var i=function(e){return e.toUpperCase()!==e.toLowerCase()?"A":" "},s=e.slice(0,n+1).replace(/.(?=\W*\w*$)/g,i);return s.slice(s.length-2).match(/\w\w/)?s=s.replace(/\s*\S+$/,""):s=p.rtrim(s.slice(0,s.length-1)),(s+r).length>e.length?e:e.slice(0,s.length)+r},words:function(e,t){return p.isBlank(e)?[]:p.trim(e,t).split(t||/\s+/)},pad:function(e,n,r,i){e=e==null?"":t(e),n=~~n;var s=0;r?r.length>1&&(r=r.charAt(0)):r=" ";switch(i){case"right":return s=n-e.length,e+o(r,s);case"both":return s=n-e.length,o(r,Math.ceil(s/2))+e+o(r,Math.floor(s/2));default:return s=n-e.length,o(r,s)+e}},lpad:function(e,t,n){return p.pad(e,t,n)},rpad:function(e,t,n){return p.pad(e,t,n,"right")},lrpad:function(e,t,n){return p.pad(e,t,n,"both")},sprintf:h,vsprintf:function(e,t){return t.unshift(e),h.apply(null,t)},toNumber:function(e,n){if(e==null||e=="")return 0;e=t(e);var r=s(s(e).toFixed(~~n));return r===0&&!e.match(/^0+$/)?Number.NaN:r},numberFormat:function(e,t,n,r){if(isNaN(e)||e==null)return"";e=e.toFixed(~~t),r=r||",";var i=e.split("."),s=i[0],o=i[1]?(n||".")+i[1]:"";return s.replace(/(\d)(?=(?:\d{3})+$)/g,"$1"+r)+o},strRight:function(e,n){if(e==null)return"";e=t(e),n=n!=null?t(n):n;var r=n?e.indexOf(n):-1;return~r?e.slice(r+n.length,e.length):e},strRightBack:function(e,n){if(e==null)return"";e=t(e),n=n!=null?t(n):n;var r=n?e.lastIndexOf(n):-1;return~r?e.slice(r+n.length,e.length):e},strLeft:function(e,n){if(e==null)return"";e=t(e),n=n!=null?t(n):n;var r=n?e.indexOf(n):-1;return~r?e.slice(0,r):e},strLeftBack:function(e,t){if(e==null)return"";e+="",t=t!=null?""+t:t;var n=e.lastIndexOf(t);return~n?e.slice(0,n):e},toSentence:function(e,t,n,r){t=t||", ",n=n||" and ";var i=e.slice(),s=i.pop();return e.length>2&&r&&(n=p.rtrim(t)+n),i.length?i.join(t)+n+s:s},toSentenceSerial:function(){var e=u.call(arguments);return e[3]=!0,p.toSentence.apply(p,e)},slugify:function(e){if(e==null)return"";var n="ąàáäâãåæćęèéëêìíïîłńòóöôõøùúüûñçżź",r="aaaaaaaaceeeeeiiiilnoooooouuuunczz",i=new RegExp(a(n),"g");return e=t(e).toLowerCase().replace(i,function(e){var t=n.indexOf(e);return r.charAt(t)||"-"}),p.dasherize(e.replace(/[^\w\s-]/g,""))},surround:function(e,t){return[t,e,t].join("")},quote:function(e){return p.surround(e,'"')},exports:function(){var e={};for(var t in this){if(!this.hasOwnProperty(t)||t.match(/^(?:include|contains|reverse)$/))continue;e[t]=this[t]}return e},repeat:function(e,n,r){if(e==null)return"";n=~~n;if(r==null)return o(t(e),n);for(var i=[];n>0;i[--n]=e);return i.join(r)},levenshtein:function(e,n){if(e==null&&n==null)return 0;if(e==null)return t(n).length;if(n==null)return t(e).length;e=t(e),n=t(n);var r=[],i,s;for(var o=0;o<=n.length;o++)for(var u=0;u<=e.length;u++)o&&u?e.charAt(u-1)===n.charAt(o-1)?s=i:s=Math.min(r[u],r[u-1],i)+1:s=o+u,i=r[u],r[u]=s;return r.pop()}};p.strip=p.trim,p.lstrip=p.ltrim,p.rstrip=p.rtrim,p.center=p.lrpad,p.rjust=p.lpad,p.ljust=p.rpad,p.contains=p.include,p.q=p.quote,typeof exports!="undefined"?(typeof module!="undefined"&&module.exports&&(module.exports=p),exports._s=p):typeof define=="function"&&define.amd?define("underscore.string",[],function(){return p}):(e._=e._||{},e._.string=e._.str=p)}(this,String);

data/app/assets/javascripts/slices/vendor/underscore.js

@@ -0,0 +1,5 @@
+//     Underscore.js 1.4.2
+//     http://underscorejs.org
+//     (c) 2009-2012 Jeremy Ashkenas, DocumentCloud Inc.
+//     Underscore may be freely distributed under the MIT license.
+(function(){var e=this,t=e._,n={},r=Array.prototype,i=Object.prototype,s=Function.prototype,o=r.push,u=r.slice,a=r.concat,f=r.unshift,l=i.toString,c=i.hasOwnProperty,h=r.forEach,p=r.map,d=r.reduce,v=r.reduceRight,m=r.filter,g=r.every,y=r.some,b=r.indexOf,w=r.lastIndexOf,E=Array.isArray,S=Object.keys,x=s.bind,T=function(e){if(e instanceof T)return e;if(!(this instanceof T))return new T(e);this._wrapped=e};typeof exports!="undefined"?(typeof module!="undefined"&&module.exports&&(exports=module.exports=T),exports._=T):e._=T,T.VERSION="1.4.2";var N=T.each=T.forEach=function(e,t,r){if(e==null)return;if(h&&e.forEach===h)e.forEach(t,r);else if(e.length===+e.length){for(var i=0,s=e.length;i<s;i++)if(t.call(r,e[i],i,e)===n)return}else for(var o in e)if(T.has(e,o)&&t.call(r,e[o],o,e)===n)return};T.map=T.collect=function(e,t,n){var r=[];return e==null?r:p&&e.map===p?e.map(t,n):(N(e,function(e,i,s){r[r.length]=t.call(n,e,i,s)}),r)},T.reduce=T.foldl=T.inject=function(e,t,n,r){var i=arguments.length>2;e==null&&(e=[]);if(d&&e.reduce===d)return r&&(t=T.bind(t,r)),i?e.reduce(t,n):e.reduce(t);N(e,function(e,s,o){i?n=t.call(r,n,e,s,o):(n=e,i=!0)});if(!i)throw new TypeError("Reduce of empty array with no initial value");return n},T.reduceRight=T.foldr=function(e,t,n,r){var i=arguments.length>2;e==null&&(e=[]);if(v&&e.reduceRight===v)return r&&(t=T.bind(t,r)),arguments.length>2?e.reduceRight(t,n):e.reduceRight(t);var s=e.length;if(s!==+s){var o=T.keys(e);s=o.length}N(e,function(u,a,f){a=o?o[--s]:--s,i?n=t.call(r,n,e[a],a,f):(n=e[a],i=!0)});if(!i)throw new TypeError("Reduce of empty array with no initial value");return n},T.find=T.detect=function(e,t,n){var r;return C(e,function(e,i,s){if(t.call(n,e,i,s))return r=e,!0}),r},T.filter=T.select=function(e,t,n){var r=[];return e==null?r:m&&e.filter===m?e.filter(t,n):(N(e,function(e,i,s){t.call(n,e,i,s)&&(r[r.length]=e)}),r)},T.reject=function(e,t,n){var r=[];return e==null?r:(N(e,function(e,i,s){t.call(n,e,i,s)||(r[r.length]=e)}),r)},T.every=T.all=function(e,t,r){t||(t=T.identity);var i=!0;return e==null?i:g&&e.every===g?e.every(t,r):(N(e,function(e,s,o){if(!(i=i&&t.call(r,e,s,o)))return n}),!!i)};var C=T.some=T.any=function(e,t,r){t||(t=T.identity);var i=!1;return e==null?i:y&&e.some===y?e.some(t,r):(N(e,function(e,s,o){if(i||(i=t.call(r,e,s,o)))return n}),!!i)};T.contains=T.include=function(e,t){var n=!1;return e==null?n:b&&e.indexOf===b?e.indexOf(t)!=-1:(n=C(e,function(e){return e===t}),n)},T.invoke=function(e,t){var n=u.call(arguments,2);return T.map(e,function(e){return(T.isFunction(t)?t:e[t]).apply(e,n)})},T.pluck=function(e,t){return T.map(e,function(e){return e[t]})},T.where=function(e,t){return T.isEmpty(t)?[]:T.filter(e,function(e){for(var n in t)if(t[n]!==e[n])return!1;return!0})},T.max=function(e,t,n){if(!t&&T.isArray(e)&&e[0]===+e[0]&&e.length<65535)return Math.max.apply(Math,e);if(!t&&T.isEmpty(e))return-Infinity;var r={computed:-Infinity};return N(e,function(e,i,s){var o=t?t.call(n,e,i,s):e;o>=r.computed&&(r={value:e,computed:o})}),r.value},T.min=function(e,t,n){if(!t&&T.isArray(e)&&e[0]===+e[0]&&e.length<65535)return Math.min.apply(Math,e);if(!t&&T.isEmpty(e))return Infinity;var r={computed:Infinity};return N(e,function(e,i,s){var o=t?t.call(n,e,i,s):e;o<r.computed&&(r={value:e,computed:o})}),r.value},T.shuffle=function(e){var t,n=0,r=[];return N(e,function(e){t=T.random(n++),r[n-1]=r[t],r[t]=e}),r};var k=function(e){return T.isFunction(e)?e:function(t){return t[e]}};T.sortBy=function(e,t,n){var r=k(t);return T.pluck(T.map(e,function(e,t,i){return{value:e,index:t,criteria:r.call(n,e,t,i)}}).sort(function(e,t){var n=e.criteria,r=t.criteria;if(n!==r){if(n>r||n===void 0)return 1;if(n<r||r===void 0)return-1}return e.index<t.index?-1:1}),"value")};var L=function(e,t,n,r){var i={},s=k(t);return N(e,function(t,o){var u=s.call(n,t,o,e);r(i,u,t)}),i};T.groupBy=function(e,t,n){return L(e,t,n,function(e,t,n){(T.has(e,t)?e[t]:e[t]=[]).push(n)})},T.countBy=function(e,t,n){return L(e,t,n,function(e,t,n){T.has(e,t)||(e[t]=0),e[t]++})},T.sortedIndex=function(e,t,n,r){n=n==null?T.identity:k(n);var i=n.call(r,t),s=0,o=e.length;while(s<o){var u=s+o>>>1;n.call(r,e[u])<i?s=u+1:o=u}return s},T.toArray=function(e){return e?e.length===+e.length?u.call(e):T.values(e):[]},T.size=function(e){return e.length===+e.length?e.length:T.keys(e).length},T.first=T.head=T.take=function(e,t,n){return t!=null&&!n?u.call(e,0,t):e[0]},T.initial=function(e,t,n){return u.call(e,0,e.length-(t==null||n?1:t))},T.last=function(e,t,n){return t!=null&&!n?u.call(e,Math.max(e.length-t,0)):e[e.length-1]},T.rest=T.tail=T.drop=function(e,t,n){return u.call(e,t==null||n?1:t)},T.compact=function(e){return T.filter(e,function(e){return!!e})};var A=function(e,t,n){return N(e,function(e){T.isArray(e)?t?o.apply(n,e):A(e,t,n):n.push(e)}),n};T.flatten=function(e,t){return A(e,t,[])},T.without=function(e){return T.difference(e,u.call(arguments,1))},T.uniq=T.unique=function(e,t,n,r){var i=n?T.map(e,n,r):e,s=[],o=[];return N(i,function(n,r){if(t?!r||o[o.length-1]!==n:!T.contains(o,n))o.push(n),s.push(e[r])}),s},T.union=function(){return T.uniq(a.apply(r,arguments))},T.intersection=function(e){var t=u.call(arguments,1);return T.filter(T.uniq(e),function(e){return T.every(t,function(t){return T.indexOf(t,e)>=0})})},T.difference=function(e){var t=a.apply(r,u.call(arguments,1));return T.filter(e,function(e){return!T.contains(t,e)})},T.zip=function(){var e=u.call(arguments),t=T.max(T.pluck(e,"length")),n=new Array(t);for(var r=0;r<t;r++)n[r]=T.pluck(e,""+r);return n},T.object=function(e,t){var n={};for(var r=0,i=e.length;r<i;r++)t?n[e[r]]=t[r]:n[e[r][0]]=e[r][1];return n},T.indexOf=function(e,t,n){if(e==null)return-1;var r=0,i=e.length;if(n){if(typeof n!="number")return r=T.sortedIndex(e,t),e[r]===t?r:-1;r=n<0?Math.max(0,i+n):n}if(b&&e.indexOf===b)return e.indexOf(t,n);for(;r<i;r++)if(e[r]===t)return r;return-1},T.lastIndexOf=function(e,t,n){if(e==null)return-1;var r=n!=null;if(w&&e.lastIndexOf===w)return r?e.lastIndexOf(t,n):e.lastIndexOf(t);var i=r?n:e.length;while(i--)if(e[i]===t)return i;return-1},T.range=function(e,t,n){arguments.length<=1&&(t=e||0,e=0),n=arguments[2]||1;var r=Math.max(Math.ceil((t-e)/n),0),i=0,s=new Array(r);while(i<r)s[i++]=e,e+=n;return s};var O=function(){};T.bind=function(t,n){var r,i;if(t.bind===x&&x)return x.apply(t,u.call(arguments,1));if(!T.isFunction(t))throw new TypeError;return i=u.call(arguments,2),r=function(){if(this instanceof r){O.prototype=t.prototype;var e=new O,s=t.apply(e,i.concat(u.call(arguments)));return Object(s)===s?s:e}return t.apply(n,i.concat(u.call(arguments)))}},T.bindAll=function(e){var t=u.call(arguments,1);return t.length==0&&(t=T.functions(e)),N(t,function(t){e[t]=T.bind(e[t],e)}),e},T.memoize=function(e,t){var n={};return t||(t=T.identity),function(){var r=t.apply(this,arguments);return T.has(n,r)?n[r]:n[r]=e.apply(this,arguments)}},T.delay=function(e,t){var n=u.call(arguments,2);return setTimeout(function(){return e.apply(null,n)},t)},T.defer=function(e){return T.delay.apply(T,[e,1].concat(u.call(arguments,1)))},T.throttle=function(e,t){var n,r,i,s,o,u,a=T.debounce(function(){o=s=!1},t);return function(){n=this,r=arguments;var f=function(){i=null,o&&(u=e.apply(n,r)),a()};return i||(i=setTimeout(f,t)),s?o=!0:(s=!0,u=e.apply(n,r)),a(),u}},T.debounce=function(e,t,n){var r,i;return function(){var s=this,o=arguments,u=function(){r=null,n||(i=e.apply(s,o))},a=n&&!r;return clearTimeout(r),r=setTimeout(u,t),a&&(i=e.apply(s,o)),i}},T.once=function(e){var t=!1,n;return function(){return t?n:(t=!0,n=e.apply(this,arguments),e=null,n)}},T.wrap=function(e,t){return function(){var n=[e];return o.apply(n,arguments),t.apply(this,n)}},T.compose=function(){var e=arguments;return function(){var t=arguments;for(var n=e.length-1;n>=0;n--)t=[e[n].apply(this,t)];return t[0]}},T.after=function(e,t){return e<=0?t():function(){if(--e<1)return t.apply(this,arguments)}},T.keys=S||function(e){if(e!==Object(e))throw new TypeError("Invalid object");var t=[];for(var n in e)T.has(e,n)&&(t[t.length]=n);return t},T.values=function(e){var t=[];for(var n in e)T.has(e,n)&&t.push(e[n]);return t},T.pairs=function(e){var t=[];for(var n in e)T.has(e,n)&&t.push([n,e[n]]);return t},T.invert=function(e){var t={};for(var n in e)T.has(e,n)&&(t[e[n]]=n);return t},T.functions=T.methods=function(e){var t=[];for(var n in e)T.isFunction(e[n])&&t.push(n);return t.sort()},T.extend=function(e){return N(u.call(arguments,1),function(t){for(var n in t)e[n]=t[n]}),e},T.pick=function(e){var t={},n=a.apply(r,u.call(arguments,1));return N(n,function(n){n in e&&(t[n]=e[n])}),t},T.omit=function(e){var t={},n=a.apply(r,u.call(arguments,1));for(var i in e)T.contains(n,i)||(t[i]=e[i]);return t},T.defaults=function(e){return N(u.call(arguments,1),function(t){for(var n in t)e[n]==null&&(e[n]=t[n])}),e},T.clone=function(e){return T.isObject(e)?T.isArray(e)?e.slice():T.extend({},e):e},T.tap=function(e,t){return t(e),e};var M=function(e,t,n,r){if(e===t)return e!==0||1/e==1/t;if(e==null||t==null)return e===t;e instanceof T&&(e=e._wrapped),t instanceof T&&(t=t._wrapped);var i=l.call(e);if(i!=l.call(t))return!1;switch(i){case"[object String]":return e==String(t);case"[object Number]":return e!=+e?t!=+t:e==0?1/e==1/t:e==+t;case"[object Date]":case"[object Boolean]":return+e==+t;case"[object RegExp]":return e.source==t.source&&e.global==t.global&&e.multiline==t.multiline&&e.ignoreCase==t.ignoreCase}if(typeof e!="object"||typeof t!="object")return!1;var s=n.length;while(s--)if(n[s]==e)return r[s]==t;n.push(e),r.push(t);var o=0,u=!0;if(i=="[object Array]"){o=e.length,u=o==t.length;if(u)while(o--)if(!(u=M(e[o],t[o],n,r)))break}else{var a=e.constructor,f=t.constructor;if(a!==f&&!(T.isFunction(a)&&a instanceof a&&T.isFunction(f)&&f instanceof f))return!1;for(var c in e)if(T.has(e,c)){o++;if(!(u=T.has(t,c)&&M(e[c],t[c],n,r)))break}if(u){for(c in t)if(T.has(t,c)&&!(o--))break;u=!o}}return n.pop(),r.pop(),u};T.isEqual=function(e,t){return M(e,t,[],[])},T.isEmpty=function(e){if(e==null)return!0;if(T.isArray(e)||T.isString(e))return e.length===0;for(var t in e)if(T.has(e,t))return!1;return!0},T.isElement=function(e){return!!e&&e.nodeType===1},T.isArray=E||function(e){return l.call(e)=="[object Array]"},T.isObject=function(e){return e===Object(e)},N(["Arguments","Function","String","Number","Date","RegExp"],function(e){T["is"+e]=function(t){return l.call(t)=="[object "+e+"]"}}),T.isArguments(arguments)||(T.isArguments=function(e){return!!e&&!!T.has(e,"callee")}),typeof /./!="function"&&(T.isFunction=function(e){return typeof e=="function"}),T.isFinite=function(e){return T.isNumber(e)&&isFinite(e)},T.isNaN=function(e){return T.isNumber(e)&&e!=+e},T.isBoolean=function(e){return e===!0||e===!1||l.call(e)=="[object Boolean]"},T.isNull=function(e){return e===null},T.isUndefined=function(e){return e===void 0},T.has=function(e,t){return c.call(e,t)},T.noConflict=function(){return e._=t,this},T.identity=function(e){return e},T.times=function(e,t,n){for(var r=0;r<e;r++)t.call(n,r)},T.random=function(e,t){return t==null&&(t=e,e=0),e+(0|Math.random()*(t-e+1))};var _={escape:{"&":"&amp;","<":"&lt;",">":"&gt;",'"':"&quot;","'":"&#x27;","/":"&#x2F;"}};_.unescape=T.invert(_.escape);var D={escape:new RegExp("["+T.keys(_.escape).join("")+"]","g"),unescape:new RegExp("("+T.keys(_.unescape).join("|")+")","g")};T.each(["escape","unescape"],function(e){T[e]=function(t){return t==null?"":(""+t).replace(D[e],function(t){return _[e][t]})}}),T.result=function(e,t){if(e==null)return null;var n=e[t];return T.isFunction(n)?n.call(e):n},T.mixin=function(e){N(T.functions(e),function(t){var n=T[t]=e[t];T.prototype[t]=function(){var e=[this._wrapped];return o.apply(e,arguments),F.call(this,n.apply(T,e))}})};var P=0;T.uniqueId=function(e){var t=P++;return e?e+t:t},T.templateSettings={evaluate:/<%([\s\S]+?)%>/g,interpolate:/<%=([\s\S]+?)%>/g,escape:/<%-([\s\S]+?)%>/g};var H=/(.)^/,B={"'":"'","\\":"\\","\r":"r","\n":"n","	":"t","\u2028":"u2028","\u2029":"u2029"},j=/\\|'|\r|\n|\t|\u2028|\u2029/g;T.template=function(e,t,n){n=T.defaults({},n,T.templateSettings);var r=new RegExp([(n.escape||H).source,(n.interpolate||H).source,(n.evaluate||H).source].join("|")+"|$","g"),i=0,s="__p+='";e.replace(r,function(t,n,r,o,u){s+=e.slice(i,u).replace(j,function(e){return"\\"+B[e]}),s+=n?"'+\n((__t=("+n+"))==null?'':_.escape(__t))+\n'":r?"'+\n((__t=("+r+"))==null?'':__t)+\n'":o?"';\n"+o+"\n__p+='":"",i=u+t.length}),s+="';\n",n.variable||(s="with(obj||{}){\n"+s+"}\n"),s="var __t,__p='',__j=Array.prototype.join,print=function(){__p+=__j.call(arguments,'');};\n"+s+"return __p;\n";try{var o=new Function(n.variable||"obj","_",s)}catch(u){throw u.source=s,u}if(t)return o(t,T);var a=function(e){return o.call(this,e,T)};return a.source="function("+(n.variable||"obj")+"){\n"+s+"}",a},T.chain=function(e){return T(e).chain()};var F=function(e){return this._chain?T(e).chain():e};T.mixin(T),N(["pop","push","reverse","shift","sort","splice","unshift"],function(e){var t=r[e];T.prototype[e]=function(){var n=this._wrapped;return t.apply(n,arguments),(e=="shift"||e=="splice")&&n.length===0&&delete n[0],F.call(this,n)}}),N(["concat","join","slice"],function(e){var t=r[e];T.prototype[e]=function(){return F.call(this,t.apply(this._wrapped,arguments))}}),T.extend(T.prototype,{chain:function(){return this._chain=!0,this},value:function(){return this._wrapped}})}).call(this);

data/app/assets/stylesheets/admin.css

@@ -0,0 +1 @@
+/* This file is overrideable by the host app, allowing stylesheet customisation. */

data/app/assets/stylesheets/slices/admin.css.erb

@@ -0,0 +1,2237 @@
+html {
+  overflow-x: hidden;
+  overflow-y: scroll;
+}
+body {
+  font: 0.75em/1.2 Helvetica, Arial, sans-serif;
+  background-color: #fff;
+  min-width: 860px;
+  height: auto;
+  min-height: 100%;
+  position: relative;
+}
+#main {
+  margin: 0 auto;
+  padding: 20px 0;
+}
+body.devise {
+  background-color: #bbb;
+}
+body.site-maps {
+  background-color: #bbb;
+}
+body.devise header {
+  display: none
+}
+body.pages {
+  background-color: #bbb;
+}
+body.assets {
+  background-color: #666;
+}
+body.site-maps #main,
+body.pages #main {
+  width: 811px;
+}
+body.site-maps #main {
+  padding-top: 17px;
+}
+body.pages #main section {
+  background-color: #fff;
+  padding: 20px 15px;
+  -moz-box-shadow: 0px 3px 8px rgba(0,0,0,0.2); /* FF3.5+ */
+  -webkit-box-shadow: 0px 3px 8px rgba(0,0,0,0.2); /* Saf3.0+, Chrome */
+  box-shadow: 0px 3px 8px rgba(0,0,0,0.2); /* Opera 10.5, IE9 */
+  border-radius: 2px;
+}
+p, h1, h2, h3, h4, h5, label {
+  -webkit-user-select: auto;
+}
+#show-meta {
+  margin-bottom: 1.5em;
+  display: block;
+  overflow: hidden;
+}
+#show-meta a {
+  background-color: #E2E2E2;
+  border: 1px solid #D7D7D7;
+  border-top: 0 none;
+  color: #333;
+  cursor: hand;
+  cursor: pointer;
+  display: block;
+  float: left;
+  font-size: 11px;
+  font-weight: bold;
+  padding: 4px 10px;
+  text-decoration: none;
+}
+#show-meta.open {
+  margin-top: -1px;
+}
+
+/*IE Warning*/
+.notice {
+  padding: 0.8em;
+  text-align: center;
+  background: yellow;
+  color: black;
+  font-weight: bold;
+  font-size: 15px;
+  margin-top: 0px;
+  margin-bottom: 20px;
+}
+.notice a {
+  text-decoration: underline;
+  color: black;
+}
+
+/*End IE Warning*/
+#server-communication {
+  position: fixed;
+  top: 0;
+  margin: 0 auto;
+  right: 0;
+  background: #D82E32;
+  color: #fff;
+  padding: 3px 10px;
+  font-weight: bold;
+  z-index: 9999;
+  display: none;
+}
+#container {
+  min-width: 720px;
+  padding-top: 80px;
+}
+input,
+textarea,
+select,
+button,
+.add,
+.button,
+.standard,
+.switcher li a {
+  font-family: Helvetica, Arial, sans-serif;
+  font-size: 12px;
+  margin: 0;
+}
+input[type="text"],
+input[type="search"],
+input[type="password"],
+textarea,
+button {
+  -webkit-appearance: none
+}
+
+/* Master button styles*/
+input[type="submit"],
+button[type="submit"],
+input[type="reset"],
+.add,
+.button,
+.standard,
+button {
+  padding: 6px 10px;
+  border-radius: 2px;
+  border: solid 1px rgb(153, 153, 153);
+  background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(rgb(255, 255, 255)), to(rgb(221, 221, 221)));
+  color: #333;
+  text-decoration: none;
+  cursor: pointer;
+  display: inline-block;
+  text-align: center;
+  text-shadow: 0px 1px 1px rgba(255,255,255,1);
+  line-height: 1;
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -ms-user-select: none;
+  -o-user-select: none;
+  user-select: none;
+}
+
+button[type="submit"]:active,
+input[type="submit"]:active,
+input[type="reset"]:active,
+.add:active,
+.button:active,
+.standard:active,
+button:active {
+  box-shadow:
+  inset 0px 0px 16px rgba(0,0,0,0.2),
+  inset 0px 1px 4px rgba(0,0,0,0.6);
+  border-color: #888;
+  border-top-color: #666;
+  color: rgba(0,0,0,0.65);
+}
+
+/*
+Submit Button
+*/
+
+button[type="submit"],
+input[type="submit"] {
+  background-color: hsl(107, 40%, 46%);
+  background: -webkit-linear-gradient(
+    hsl(106, 42%, 57%) 17%,
+    hsl(107, 40%, 46%) 80%
+  );
+  border: 1px solid hsl(107, 64%, 32%);
+  color: white;
+  text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.4);
+  font-weight: bold;
+}
+
+button[type="submit"]:active,
+input[type="submit"]:active {
+  border: 1px solid hsl(107, 64%, 26%);
+  box-shadow:
+    inset 0px 0px 16px rgba(0,0,0,0.2),
+    inset 0px 1px 4px rgba(0,0,0,0.2);
+  color: white;
+}
+
+button[type="submit"]:disabled,
+input[type="submit"]:disabled {
+  background: hsl(106, 22%, 57%);
+  background: -webkit-linear-gradient(
+    hsl(106, 22%, 57%) 17%,
+    hsl(107, 20%, 46%) 80%
+  );
+  border: 1px solid hsl(107, 30%, 32%);
+  cursor: default;
+  opacity: 0.5;
+}
+
+/*
+Search
+*/
+
+input[type="search"] {
+  box-sizing: border-box;
+  padding-left: 18px;
+  background: #fff url(<%= asset_path('slices/icon_search.png') %>) no-repeat 6px 4px;
+  border: 1px solid #d7d7d7;
+  vertical-align: baseline;
+}
+input[type="search"]:focus {
+  outline: none;
+  border-color: #aaa;
+  box-shadow: 0px 0px 5px rgba(0, 0, 0, 0.1);
+}
+button.delete {
+  background: #8a1c1c;
+  background: -webkit-linear-gradient(top, #8a1c1c 0%, #611111 100%);
+  border-color: rgb(97, 17, 17);
+  color: #fff;
+  text-shadow: 0px -1px 0px rgba(0, 0, 0, 0.75);
+}
+
+.small-button {
+  padding: 2px 6px;
+}
+
+.slices-holder .ui-sortable-helper {
+  -webkit-box-shadow: 0px 3px 12px rgba(0, 0, 0, 0.15);
+  -moz-box-shadow: 0px 3px 12px rgba(0, 0, 0, 0.15);
+  -ms-box-shadow: 0px 3px 12px rgba(0, 0, 0, 0.15);
+  box-shadow: 0px 3px 12px rgba(0, 0, 0, 0.15);
+  -webkit-background-clip: padding-box;
+  -moz-background-clip: padding-box;
+  -ms-background-clip: padding-box;
+  background-clip: padding-box;
+}
+
+.button:hover {
+  text-decoration: none;
+}
+
+/* End button styles*/
+#sitemap li .button {
+  padding: 5px 10px 4px;
+  margin-top: 4px;
+}
+#sitemap .item-actions {
+  visibility: hidden;
+}
+#sitemap .item-actions.primary {}
+#sitemap .item-actions.secondary {
+  position: absolute;
+  right: 7px;
+  opacity: 0.5;
+}
+#sitemap .item-actions.secondary:hover {
+  opacity: 1;
+}
+#sitemap li > div:hover .item-actions {
+  visibility: visible;
+}
+#sitemap.unlocked li > div:hover .item-actions {
+  visibility: hidden;
+}
+#sitemap .item-actions .view-page {
+  margin-left: 20px;
+  color: #888;
+}
+#sitemap .item-actions .view-page:hover {
+  color: #222;
+  text-decoration: none;
+}
+
+.toolbar {
+  background: #DADADA;
+  height: 40px;
+  background: -webkit-gradient(linear, 0% 100%, 0% 0%, from(#D2D2D2), to(#F0F0F0));
+  -webkit-box-shadow: rgba(0, 0, 0, 0.3) 0px 1px 3px;
+  -moz-box-shadow: rgba(0, 0, 0, 0.3) 0px 1px 3px;
+  -ms-box-shadow: rgba(0, 0, 0, 0.3) 0px 1px 3px;
+  box-shadow: rgba(0, 0, 0, 0.3) 0px 1px 3px;
+}
+.toolbar input[type="search"] {
+  float: left;
+  height: 24px;
+  margin-left: 15px;
+  margin-top: 8px;
+  width: 204px;
+}
+.search-form input[type="text"] {
+  border: none;
+  width: 160px;
+  padding: 1px 1px 1px 1px;
+}
+.search-form input[type="submit"] {
+  border: none;
+  background: url(<%= asset_path('slices/icon_search.png') %>) no-repeat 0 0;
+  height: 16px;
+  text-indent: -9999em;
+  padding: 0;
+  margin: 0;
+  width: 16px;
+}
+.toolbar .breadcrumb {
+  float: left;
+  padding-top: 0.5em;
+}
+.toolbar a {
+  cursor: pointer;
+}
+#container-actions {
+  top: 40px;
+  position: absolute;
+  right: 0;
+  left: 0;
+  z-index: 5;
+}
+a {
+  color: #0075D8;
+  text-decoration: none;
+}
+a:hover {
+  text-decoration: underline
+}
+header {
+  background: #282828;
+  left: 0;
+  top: 0;
+  position: absolute;
+  right: 0;
+  z-index: 5;
+  overflow: hidden;
+  *display: inline-block;
+  padding: 0;
+  text-align: right;
+  color: #666666;
+  line-height: 11px;
+  background: -webkit-gradient(linear, 0% 100%, 0% 0%, from(black), to(#282828));
+  border-bottom: 1px solid #1F201F;
+  height: 40px;
+}
+.toolbar nav {
+  float: left;
+  padding-left: 19px;
+}
+header ul {
+  float: right;
+  overflow: visible;
+  height: 40px;
+  margin-left: 4px;
+  margin-right: 19px;
+}
+header ul li {
+  float: left;
+  height: 39px;
+  line-height: 39px;
+  font-size: 11px;
+  color: #6b6b6b;
+  font-family: "Lucida Grande", Tahoma, Arial, Helvetica, sans-serif;
+  text-shadow: 0 1px 0 rgba(0, 0, 0, 1);
+}
+header ul li a {
+  color: #aaaaaa;
+  display: inline-block;
+  padding: 0px 5px;
+  background-repeat: no-repeat;
+  background-position: 8px 50%;
+}
+header nav {
+  -webkit-font-smoothing: antialiased;
+}
+header nav ul li:first-child a {
+  background-image: url(<%= asset_path('slices/icon_sitemap.png') %>)
+}
+header nav ul li:nth-child(2) a {
+  background-image: url(<%= asset_path('slices/icon_assets.png') %>)
+}
+header nav ul li:nth-child(3) a {
+  background-image: url(<%= asset_path('slices/icon_snippets.png') %>)
+}
+header nav ul li#admin-nav-administrators a {
+  background-image: url(<%= asset_path('slices/icon_admins.png') %>)
+}
+header ul li:first-child {
+  /*Correct margin for text only username*/
+  margin-right: 9px;
+}
+header nav ul li:first-child {
+  /*Correct nav*/
+  margin-right: 0px;
+}
+header ul li:first-child {
+  /*margin-left: -1em;_NO__DOTCOMMA__AFTER__*/
+}
+header nav ul {
+  overflow: hidden;
+  float: left;
+  font-size: 1.083em;
+  font-weight: bold;
+  margin-left: 15px;
+}
+header nav ul li {
+  margin: 0px;
+  padding: 0px;
+  margin-left: 0px;
+  font-family: Arial, Helvetica, sans-serif;
+}
+header nav li a {
+  display: inline-block;
+  color: #fff!important;
+  padding: 0px 10px;
+  padding-left: 30px;
+  padding-right: 15px;
+  font-size: 13px;
+}
+header nav .active {
+  color: #fff;
+  background-color: #000;
+}
+header nav li:hover a {
+  background-color: #222222;
+  text-decoration: none!important;
+}
+header nav .active a {
+  color: #4C4C4C
+}
+header ul li,
+.toolbar ul li {
+  display: inline
+}
+.actions {
+  float: right;
+}
+.toolbar .actions {
+  position: absolute;
+  right: 24px;
+  top: 0;
+}
+.toolbar .actions li {
+  margin-left: 7px
+}
+.toolbar .actions a,
+.toolbar .actions input {
+  position: relative;
+  top: 8px;
+  padding-top: 5px;
+  padding-bottom: 5px;
+  vertical-align: baseline;
+}
+.toolbar .actions .button {
+  position: relative;
+  top: 8px;
+  text-decoration: none;
+}
+
+/* Sitemap page */
+.toolbar p,
+.toolbar nav ul li.back a {
+  color: #696969;
+  font-weight: normal;
+  font-size: 11px;
+  font-family: "Lucida Grande", Arial, Helvetica, sans-serif;
+  line-height: 38px;
+  letter-spacing: 0px;
+}
+.toolbar a {
+  text-decoration: underline
+}
+#structure-locked,
+#structure-unlocked p {
+  padding-left: 24px;
+  float: left;
+}
+#structure-locked a,
+#structure-unlocked a {
+  color: #696969;
+  font-weight: normal;
+  text-decoration: underline;
+}
+#structure-unlocked {
+  display: none
+}
+#structure-unlocked p {
+  background-position: 0 -18px
+}
+#sitemap ol,
+#virtual-pages ol {
+  margin: 0 0 0 30px
+}
+#sitemap li,
+#virtual-pages li {
+  list-style: none;
+  text-align: left;
+  margin-top: 3px !important;
+  position: relative;
+}
+#sitemap.unlocked li {
+  cursor: move
+}
+#sitemap li a.delete,
+#virtual-pages li a.delete {
+  position: absolute;
+  top: 0;
+  right: 5px;
+  color: #860202;
+}
+#sitemap ol,
+#virtual-pages ol {
+  margin-top: 3px !important
+}
+#sitemap ol li:last-child,
+#virtual-pages ol li:last-child {
+  padding-bottom: 0
+}
+#sitemap .placeholder,
+#virtual-pages .placeholder {
+  background-color: #d2d2d2
+}
+#sitemap li h2,
+#virtual-pages li h2 {
+  float: left;
+  padding-left: 6px;
+  margin-left: 5px;
+  line-height: 31px;
+  background-repeat: no-repeat;
+  background-position: 0px 50%;
+}
+#sitemap li h2 a,
+#virtual-pages li h2 a {
+  color: #4f4f4f;
+  margin-right: 25px;
+}
+#sitemap li.set-link h2,
+#virtual-pages li.set-link h2 {
+  background-image: url(<%= asset_path('slices/icon_set-link.png') %>);
+  padding-left: 20px;
+}
+#sitemap li a.sort,
+#virtual-pages li a.sort {
+  margin: 0 0 0 1em;
+  display: none;
+}
+#sitemap.unlocked li a.sort,
+#virtual-pages.unlocked li a.sort {
+  margin-left: -20px;
+  text-align: left;
+  display: block;
+}
+#sitemap li.set>ul>li>div a.sort,
+#sitemap li.set>ul>li>div:hover a.sort {
+  display: none
+}
+#sitemap li>div,
+#virtual-pages li>div {
+  background: #fff;
+  overflow: hidden;
+  -moz-border-radius: 2px; /* FF1+ */
+  -webkit-border-radius: 2px; /* Saf3-4 */
+  border-radius: 2px; /* Opera 10.5, IE9, Saf5, Chrome */
+  -moz-box-shadow: 0px 1px 2px rgba(0,0,0,0.1); /* FF3.5+ */
+  -webkit-box-shadow: 0px 1px 2px rgba(0,0,0,0.1); /* Saf3.0+, Chrome */
+  box-shadow: 0px 1px 2px rgba(0,0,0,0.1); /* Opera 10.5, IE9 */
+  padding-left: 22px;
+  background-repeat: no-repeat;
+}
+#sitemap li.page > div {
+  background-image: url(<%= asset_path('slices/sitemap_icon_page.png') %>);
+}
+#virtual-pages li.page > div {
+  background-image: url(<%= asset_path('slices/sitemap_icon_virtual_page.png') %>);
+}
+#sitemap li.home > div {
+  background-image: url(<%= asset_path('slices/sitemap_icon_home.png') %>);
+}
+#sitemap li.set-page > div {
+  background-image: url(<%= asset_path('slices/sitemap_icon_set_page.png') %>);
+}
+#sitemap li>div:hover,
+#virtual-pages li>div:hover {
+  background-color: #f1f1f1
+}
+#sitemap .nested-error,
+#virtual-pages .nested-error {
+  background-color: #f1888c;
+  color: #8a1f11;
+}
+#sitemap
+#virtual-pages {
+  margin-left: 15px;
+  margin-right: 15px;
+}
+#sitemap {
+  background: url(<%= asset_path('slices/sitemap_overlay.png') %>);
+  padding-bottom: 60px;
+}
+#sitemap-divider {
+  display: block;
+  height: 64px;
+  margin: 0;
+  margin-top: -60px;
+  color: transparent;
+  border: none;
+
+  background: -moz-linear-gradient(top, rgba(187,187,187,0) 0%, rgba(187,187,187,1) 100%);
+  background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,rgba(187,187,187,0)), color-stop(100%,rgba(187,187,187,1)));
+  background: -webkit-linear-gradient(top, rgba(187,187,187,0) 0%,rgba(187,187,187,1) 100%);
+  background: -o-linear-gradient(top, rgba(187,187,187,0) 0%,rgba(187,187,187,1) 100%);
+  background: -ms-linear-gradient(top, rgba(187,187,187,0) 0%,rgba(187,187,187,1) 100%);
+  background: linear-gradient(top, rgba(187,187,187,0) 0%,rgba(187,187,187,1) 100%);
+  filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#00ece5eb', endColorstr='#bbbbbb',GradientType=0 );
+}
+
+/* Edit slices pages */
+#page-meta {
+  display: none;
+  background-color: #E2E2E2;
+  overflow: auto;
+  border: 1px solid #CFCFCF;
+  border-top: 0 none;
+  padding-bottom: 5px;
+}
+#page-meta > li {
+  padding: 5px 10px 10px;
+  border-bottom: 1px solid #999;
+  border-bottom: 1px dotted #c8c8c8;
+}
+#page-meta > li:last-child {
+  border-bottom: 0 none;
+}
+#page-meta .label {
+  margin-bottom: 4px
+}
+#page-meta .field-items {
+  line-height: 2;
+}
+#page-meta .field-items label {
+  display: inline;
+  font-weight: normal;
+}
+#page-meta input[type="checkbox"] {
+  margin: 0 5px 0 2px;
+}
+input[type='text']:focus,
+textarea:focus {
+  outline: none
+}
+span.editinplace {
+  display: block;
+  cursor: pointer;
+  min-height: 1em;
+}
+span.editinplace:hover {
+  background: #DCDCDC;
+  cursor: text;
+}
+input[type="checkbox"],
+input[type="radio"] {
+  width: auto;
+  margin: 0 5px 0 0;
+  border: 0;
+}
+fieldset label {
+  width: auto !important;
+  margin-left: 0 !important;
+  float: none !important;
+  display: inline !important;
+  color: #999 !important;
+}
+aside fieldset label {
+  /*float: left !important;_NO__DOTCOMMA__AFTER__*/
+}
+form ul fieldset li {
+  display: inline
+}
+form aside ul fieldset li {
+  display: block
+}
+form ul li {
+  display: block;
+  padding: 0;
+  margin: 0;
+  overflow: visible;
+  *display: inline-block;
+}
+form #main ul {
+  padding: 0
+}
+form #main #meta-top ol,
+form #main #meta-top ul {
+  margin-left: 0
+}
+form #main ul ul.multi-tag-list,
+form #main ul ul.single-tag-list {
+  margin: 0.5em 0 0 0;
+}
+.multi-tag-list li,
+.single-tag-list li {
+  display: inline-block;
+  color: #007de6;
+  cursor: pointer;
+}
+.multi-tag-list li.on,
+.single-tag-list li.on {
+  color: #999
+}
+.multi-tag-list li:after,
+.single-tag-list li:after {
+  content: ',';
+  color: #007de6 !important;
+}
+.multi-tag-list li:last-child:after,
+.single-tag-list li:last-child:after {
+  content: '';
+}
+form #main ul ul {
+  margin-left: 0
+}
+#container-slices {
+  background: #FAFAFA;
+  border: 1px solid #cfcfcf;
+  text-align: center;
+  -webkit-border-bottom-left-radius: 2px;
+  -webkit-border-bottom-right-radius: 2px;
+}
+form #main #container-tab-controls {
+  margin: 0em;
+  text-align: left;
+  background: #E2E2E2;
+  padding: 5px;
+}
+.switcher {
+  float: left;
+  position: relative;
+  top: 8px;
+  margin-left: 10px;
+}
+.switcher li {
+  float: left
+}
+#container-tab-controls li,
+.switcher li {
+  display: inline;
+  list-style: none;
+}
+#container-tab-controls li a,
+.switcher li a {
+  font-weight: bold;
+  color: #696969;
+  display: inline-block;
+  padding: 5px 12px;
+  text-decoration: none!important;
+  margin: 0;
+  font-size: 11px;
+  text-shadow: 0px 1px 0px rgba(255,255,255,0.7);
+  border-right: 1px solid #989898;
+  border-bottom: 1px solid #989898;
+  border-top: 1px solid #989898;
+  background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(rgb(255, 255, 255)), to(rgb(221, 221, 221)));
+}
+#container-tab-controls li a:hover,
+.switcher li a:hover {
+  text-decoration: none
+}
+#container-tab-controls li a.active,
+.switcher li.active a {
+  text-decoration: none!important;
+  color: #696969;
+  background: #CECECE;
+  -webkit-box-shadow: inset 1px 1px 2px 0px rgba(0,0,0,0.3);
+  -moz-box-shadow: inset 1px 1px 2px 0px rgba(0,0,0,0.3);
+  box-shadow: inset 1px 1px 2px 0px rgba(0,0,0,0.3);
+}
+#container-tab-controls li a.field-with-errors {
+  color: #B30D0D
+}
+#container-tab-controls li:first-child {
+  margin-left: 0
+}
+#container-tab-controls li:first-child a,
+.switcher li:first-child a {
+  border-left: 1px solid #989898;
+  border-right: 1px solid #989898;
+  border-bottom: 1px solid #989898;
+  border-top: 1px solid #989898;
+  -webkit-border-top-left-radius: 2px;
+  -webkit-border-bottom-left-radius: 2px;
+  -moz-border-radius-topleft: 2px;
+  -moz-border-radius-bottomleft: 2px;
+  border-top-left-radius: 2px;
+  border-bottom-left-radius: 2px;
+}
+#container-tab-controls li:last-child a,
+.switcher li:last-child a {
+  border-right: 1px solid #989898;
+  border-bottom: 1px solid #989898;
+  border-top: 1px solid #989898;
+  -webkit-border-top-right-radius: 2px;
+  -webkit-border-bottom-right-radius: 2px;
+  -moz-border-radius-topright: 2px;
+  -moz-border-radius-bottomright: 2px;
+  border-top-right-radius: 2px;
+  border-bottom-right-radius: 2px;
+}
+form #main .slices-holder {
+  text-align: left;
+  margin: 0;
+  border-top: 1px solid #cfcfcf;
+}
+.slices-holder > li {
+  border: 1px solid #cfcfcf;
+  background: #F7F7F7;
+  margin-bottom: 0px;
+  position: relative;
+  padding-bottom: 0px;
+  margin: -1px;
+}
+.control-bar {
+  background: #E8E8E8;
+  border-bottom: 1px solid #cfcfcf;
+  padding: 5px 12px;
+  overflow: hidden;
+  font-size: 12px;
+  font-weight: bold;
+  cursor: pointer;
+  background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#F0F0F0), to(#DDDDDD));
+  color: #333;
+  text-decoration: none;
+  text-shadow: 0px 1px 1px rgba(255,255,255,1);
+  position: relative;
+}
+.control-bar:active {
+  background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#DDDDDD), to(#F0F0F0));
+}
+.add-slice-fields {
+  padding: 5px 0;
+  background-color: #E2E2E2;
+  border-top: 1px solid #cfcfcf;
+  margin-top: -1px;
+  -webkit-border-bottom-left-radius: 2px;
+  -webkit-border-bottom-right-radius: 2px;
+}
+.slice-content{
+  padding: 15px;
+  background-color: #fff;
+}
+.slice-content ul > li {
+  margin-bottom: 15px;
+}
+.slice-content ul > li:last-child {
+  margin-bottom: 0;
+}
+.slice-content label,
+.slice-content legend {
+  margin-bottom: 0.5em;
+  margin-right: 1%;
+  color: #5A5A5A;
+  font-weight: bold;
+}
+.slice-content input[type='text'],
+.slice-content textarea,
+.modal form textarea,
+.modal form input[type='text'] {
+  padding: 0.5em;
+  color: #333;
+}
+.slice-content textarea {
+  display: block;
+  max-width: 100%;
+  padding-right: 1em;
+}
+.slice-content select {
+  margin: 0;
+}
+.slice .delete {
+  display: block;
+  position: absolute;
+  width: 24px;
+  height: 24px;
+  text-indent: -999px;
+  overflow: hidden;
+  background: url(<%= asset_path('slices/trash.png') %>) no-repeat center;
+  top: 0; right: 0;
+}
+.slice .delete:active {
+  opacity: 0.5;
+}
+.slice .container-select-wrapper {
+  display: block;
+  position: absolute;
+  right: 27px;
+  top: 0px;
+  line-height: 23px;
+}
+.slice .container-select {
+  margin: 0;
+}
+section label,
+section h1 {
+  color: #5A5A5A;
+  font-weight: bold;
+  margin-bottom: 0.5em;
+  display: block;
+}
+input[type="text"],
+input[type="password"],
+textarea {
+  border: 1px solid #d7d7d7;
+  padding: 0.5em;
+  width: 100%;
+  -webkit-box-sizing: border-box;
+  -moz-box-sizing: border-box;
+  -ms-box-sizing: border-box;
+  box-sizing: border-box;
+}
+textarea {
+  display: block;
+  margin: 0;
+}
+section select {
+  margin-bottom: 2em
+}
+section textarea#meta-extended {
+  min-height: 200px
+}
+select#meta-layout {
+  width: 160px;
+  margin-bottom: 0px!important;
+}
+form ul li.field-with-errors,
+form ul li.field-with-errors label,
+form ul li.field-with-errors legend {
+  color: #b30d0d !important
+}
+form ul li.field-with-errors input,
+form ul li.field-with-errors textarea,
+form ul li.field-with-errors select {
+  border: 1px solid #b30d0d
+}
+#add-slice-option {
+  width: 300px;
+  margin: 0;
+}
+
+/* entries list */
+.elements-table {
+  margin-top: -20px;
+  width: 100%;
+}
+.elements-table tr {
+  width: 100%;
+  list-style: none;
+  overflow: hidden;
+  *display: inline-block;
+  height: 25px;
+  border-bottom: 1px solid #e6e6e6;
+  background: white;
+}
+
+.elements-table .ui-sortable tr {
+  cursor: move;
+}
+.elements-table tr.ui-sortable-helper {
+  border: 1px solid #e6e6e6;
+  box-shadow: 0 0 10px 0 rgba(0,0,0,0.1);
+}
+.elements-table tr.ui-sortable-helper td:not(:first-child) {
+  display: none;
+}
+
+.elements-table tr td {
+  padding-top: 5px;
+  padding-bottom: 5px;
+  padding-left: 15px;
+  vertical-align: middle;
+}
+.elements-table tr td.action {
+  padding-top: 3px;
+  padding-bottom: 3px;
+}
+.elements-table tr td.right {
+  text-align: right;
+  padding-right: 15px;
+}
+.elements-table tr th.image {
+  width: 10%;
+}
+.elements-table td img {
+  padding-top: 5px;
+  padding-bottom: 5px;
+}
+.elements-table td span {
+  display: block
+}
+.elements-table tr th {
+  text-align: left;
+  color: #666;
+  font-size: 11px;
+  font-weight: normal;
+  background-color: #EFEFEF;
+  padding: 5px 0;
+  font-family: "Lucida Grande", Tahoma, Arial, Helvetica, sans-serif;
+  padding-left: 15px;
+}
+.elements-table tr td {
+  width: auto
+}
+.elements-table .header {
+  font-weight: bold;
+  color: #999;
+}
+.asset .name {
+  display: block;
+  margin-bottom: 0.5em;
+}
+
+/* JQModal Stuff */
+.jqmWindow {
+  display: none;
+  position: fixed;
+  top: 52px;
+  left: 50%;
+  height: auto;
+  overflow: auto;
+  margin-left: -300px;
+  width: 600px;
+  background-color: #EEE;
+  color: #333;
+  overflow-x: hidden;
+  -webkit-box-shadow: 0px 2px 6px rgba(0,0,0,0.2);
+  -moz-box-shadow: 0px 2px 6px rgba(0,0,0,0.2);
+  box-shadow: 0px 2px 6px rgba(0,0,0,0.2);
+}
+.jqmOverlay {
+  background-color: #000
+}
+.modal {
+  -webkit-border-radius: 2px;
+  -moz-border-radius: 2px;
+  -ms-border-radius: 2px;
+  border-radius: 2px;
+}
+.modal header {
+  display: none
+}
+.modal form {
+  position: relative;
+}
+.modal .fields {
+  padding: 10px;
+  border-bottom: 1px solid #ccc;
+}
+.modal .fields li {
+  margin-bottom: 10px;
+}
+.modal label {
+  display: block;
+  font-weight: bold;
+  color: #5a5a5a;
+  margin-bottom: 5px;
+}
+.modal label.legend {
+  display: block;
+  margin-bottom: 0.75em;
+  text-shadow: 0px 1px 0px #fff;
+}
+.modal .legend em {
+  font-style: normal;
+  color: #333;
+}
+
+.modal .bottom-toolbar {
+  z-index: 5;
+  border-top: 1px solid #fafafa;
+  background: #DADADA;
+  text-align: right;
+  -webkit-box-shadow: rgba(0, 0, 0, 0.0976562) 0px 1px 2px;
+  background: -webkit-gradient(linear, 0% 100%, 0% 0%, from(#D2D2D2), to(#F0F0F0));
+  padding: 10px;
+  -webkit-border-bottom-left-radius: 2px;
+  -moz-border-bottom-left-radius: 2px;
+  border-bottom-left-radius: 2px;
+  -webkit-border-bottom-right-radius: 2px;
+  -moz-border-bottom-right-radius: 2px;
+  border-bottom-right-radius: 2px;
+}
+
+/* Hacky CSS to skin hacky add page modal*/
+.modal #container {
+  padding: 0px;
+  margin: 0px;
+  width: 600px;
+  min-width: 600px!important;
+}
+/* End hacky css */
+
+/* Related to asset management within slices - probably needs moving somewhere more sensible/ making consistent with everything else */
+form #main ul.manage-assets {
+  margin-bottom: 2em
+}
+form #main ul.manage-assets li {
+  overflow: visible;
+  margin-bottom: 1em;
+}
+ul.manage-assets img {
+  float: left;
+  width: 90px;
+  margin-right: 20px;
+}
+ul.manage-assets .sort {
+  margin-right: 10px
+}
+ul.manage-assets input.caption {
+  float: left;
+  width: 420px;
+  margin-right: 10px;
+}
+form #main ul.manage-assets.single a.sort {
+  display: none
+}
+.elements-list {
+  list-style-type: none
+}
+.elements-list .asset {
+  display: block;
+  border-bottom: 1px solid #e6e6e6;
+  background-color: #fff;
+  padding-left: 15px;
+  padding-right: 15px;
+  padding-top: 5px;
+  padding-bottom: 5px;
+  min-height: 73px;
+}
+.elements-list .asset ul li {
+  height: auto
+}
+.elements-list .asset .meta {
+  position: relative;
+  top: -25px;
+}
+.elements-list .asset .actions {
+  position: relative;
+  top: 20px;
+}
+.elements-list .asset .thumb {
+  width: 80px;
+  overflow: hidden;
+  padding-right: 15px;
+}
+.elements-list .asset .thumb,
+.elements-list .asset .meta,
+.elements-list .asset .actions {
+  display: inline-block
+}
+
+/* functional element styling */
+a.sort {
+  display: inline-block;
+  float: right !important;
+  background: url(<%= asset_path('slices/icon_drag.png') %>) 0 0 no-repeat;
+  text-indent: -9999em;
+  width: 20px;
+  text-align: left;
+  margin: 0px 0 -5px;
+}
+body.site-maps a.sort {
+  margin-top: 8px!important;
+  margin-right: 19px;
+  background-image: none!important;
+}
+a.collapse {
+  display: inline-block;
+  float: left !important;
+  background: url(<%= asset_path('slices/icon_collapse.png') %>) 0 2px no-repeat;
+  text-indent: -9999em;
+  width: 10px;
+  height: 10px;
+  margin-top: 2px;
+}
+.closed a.collapse {
+  background-position: 0 -40px
+}
+.closed {
+  border-bottom: 0px!important
+}
+a.remove-asset {
+}
+
+/* pagination */
+#pagination {
+  float: left;
+  margin-top: 7px;
+  margin-left: 15px;
+}
+#pagination li {
+  list-style: none;
+  display: inline;
+}
+#pagination li:last-child {
+
+}
+#pagination li a {
+  display: inline-block;
+  padding: 5px;
+}
+#pagination li a.active {
+  font-weight: bold;
+  color: #000;
+  text-decoration: none;
+}
+.view-on-site {
+  font-size: 1.083em;
+  text-align: center;
+  padding: 1em 0;
+  font-weight: bold;
+}
+.icon {
+  display: inline-block;
+  width: 12px;
+}
+.devise .login {
+  background-color: #ccc;
+  width: 340px;
+  margin: 0 auto;
+  padding: 13px 0px;
+  -webkit-border-radius: 3px;
+  -moz-border-radius: 3px;
+  border-radius: 3px;
+  border: 1px solid #D2D2D2;
+  background-color: #DCDCDC;
+  background: -webkit-gradient(linear, 0% 0%, 0% 100%, from(#eee), to(#c4c4c4));
+  -moz-box-shadow: 0px 2px 6px rgba(0,0,0,0.2); /* FF3.5+ */
+  -webkit-box-shadow: 0px 2px 6px rgba(0,0,0,0.2); /* Saf3.0+, Chrome */
+  box-shadow: 0px 2px 6px rgba(0,0,0,0.2); /* Opera 10.5, IE9 */
+}
+.devise .login form p {
+  padding: 0px 15px;
+  padding-top: 4px;
+}
+.devise .login form p label {
+  color: #5a5a5a;
+  font-weight: bold;
+}
+.devise .login form p input[type='email'],
+.login form p input[type='password'] {
+  border: 1px solid #D2D2D2;
+  margin-bottom: 1em;
+  padding: 0.5em;
+  font-family: "Lucida Grande", Tahoma, Arial, Helvetica, sans-serif;
+  font-size: 11px;
+  margin-top: 6px;
+  width: 100%;
+  box-sizing: border-box;
+}
+.devise .login form p label[for='admin_remember_me'] {
+  color: #696969;
+  font-weight: normal;
+  font-size: 11px;
+  font-family: "Lucida Grande", Arial, Helvetica, sans-serif;
+}
+.devise .login form p input[type='submit'] {
+  width: 312px;
+  margin-bottom: 10px;
+  font-size: 13px;
+}
+.devise .login form p a {
+  float: right;
+  font-size: 11px;
+  text-decoration: underline;
+  color: #696969;
+  font-weight: normal;
+  font-size: 11px;
+  font-family: "Lucida Grande", Arial, Helvetica, sans-serif;
+}
+
+/*SPECIFIC TO It's Nice That*/
+.multi-tag-list li.first_not_shown_in_category_list,
+.single-tag-list li.first_not_shown_in_category_list {
+  display: block;
+  float: left;
+  clear: both;
+}
+
+/* Livefield */
+.livefield-results,
+.livefield-result {
+  color: #565656;
+  font: 13px/1 Helvetica, Arial, sans-serif;
+}
+.livefield-input {
+
+}
+.livefield-results {
+  display: block;
+  position: relative;
+  list-style: none outside;
+  margin: 0;
+  padding: 2px 0;
+  border: 1px solid #e6e6e6;
+  border-top: 0 none;
+  line-height: 1;
+  background: #fff;
+}
+.livefield-drop-up {
+  border-bottom: 0 none;
+  border-top: 1px solid #d4d4d4;
+}
+.livefield-result {
+  display: block;
+  position: relative;
+  list-style: none outside;
+  margin: 0;
+  padding: 4px 6px 5px;
+  font-weight: bold;
+  cursor: pointer;
+  cursor: hand;
+}
+.livefield-result.livefield-highlighted {
+  background-color: #dee5ea
+}
+.livefield-result .name {
+  display: block;
+  font-weight: bold;
+  color: #565656;
+}
+.livefield-result .path {
+  display: block;
+  font-weight: normal;
+  margin-top: 0.25em;
+  color: #a2a2a2;
+}
+
+/* Attachments */
+
+.attachment-composer {}
+#page-extra-main .attachment-composer {
+  border: 1px solid #d7d7d7;
+  padding: 15px;
+  padding-right: 18px;
+}
+#page-meta .attachment-composer {
+  padding-right: 5px;
+}
+.attachment-composer .attachment-list {}
+.attachment-composer.not-empty .attachment-list,
+.attachment-composer.assets-over .attachment-list {
+  margin-bottom: 15px;
+}
+.attachment-composer li {
+  display: block;
+  position: relative;
+  padding: 0px;
+  margin: 0 12px 16px 0;
+  background: #fff;
+  height: 180px;
+}
+.attachment-composer li:last-child {
+  margin-bottom: 0;
+}
+#page-meta .attachment-composer li {
+  background-color: #e2e2e2;
+}
+.attachment-composer .cursor {
+  height: 2px;
+  background: rgb(255, 190, 0);
+  box-shadow: 0px 0px 8px rgb(255, 190, 0);
+}
+.attachment-composer .attachment-drop-target {
+  padding: 28px 0 28px;
+  text-align: center;
+  color: #565656;
+}
+.attachment-composer .attachment-actions {
+  display: block;
+  text-align: center;
+}
+.attachment-composer .attachment-actions button {
+  width: 170px;
+  margin-right: 8px;
+}
+.attachment-composer .attachment-thumb {
+  display: block;
+  position: absolute;
+  left: 0px;
+  width: 180px;
+  height: 180px;
+  overflow: hidden;
+  cursor: move;
+}
+.attachment-thumb img {
+  background: url(<%= asset_path('slices/asset-background.png') %>) 0 0;
+}
+.attachment-thumb button {
+  position: absolute;
+  bottom: 0px;
+  display: none;
+}
+.attachment-composer .attachment-fields {
+  display: block;
+  position: absolute;
+  left: 195px;
+  right: 0;
+  margin: 0;
+  height: 180px;
+}
+.attachment-composer .attachment-fields > * {
+  margin-bottom: 15px;
+}
+.attachment-composer .attachment-fields > *:last-child {
+  margin-bottom: 0;
+}
+.attachment-composer .attachment-fields textarea {
+  display: block;
+  padding: 5px;
+  resize: none;
+}
+.attachment-composer .attachment-fields textarea.full-height {
+  height: 180px;
+}
+
+.upload-info {
+  position: absolute;
+  top: 0;
+  left: 0;
+  width: 180px;
+  height: 180px;
+}
+.upload-info .canvas {
+  display: block;
+  position: absolute;
+  top: 0;
+  left: 0;
+}
+.upload-info .text {
+  position: absolute;
+  top: 115px;
+  left: 0; right: 0;
+  padding: 0 20px;
+  text-align: center;
+  color: #838383;
+}
+.upload-info .upload-name {
+  display: block;
+  margin-bottom: 0.333em;
+  font-weight: bold;
+}
+.upload-info .upload-progress {
+  display: block;
+}
+
+.attachment-composer li .remove {
+  position: absolute;
+  background: url(<%= asset_path('slices/trash.png') %>) no-repeat 50% 50%;
+  text-indent: -1000px;
+  overflow: hidden;
+  border: 0 none;
+  outline: 0 none;
+  width: 20px;
+  height: 20px;
+  top: -6px;
+  right: -25px;
+  cursor: hand; cursor: pointer;
+}
+.attachment-composer .status-uploading .remove,
+.attachment-composer .status-processing .remove {
+  display: none;
+}
+.attachment-composer li .remove:active {
+  opacity: 0.5;
+}
+.attachment-composer .ui-sortable-helper {
+  -webkit-box-shadow: 0px 3px 12px rgba(0, 0, 0, 0.15);
+  -moz-box-shadow: 0px 3px 12px rgba(0, 0, 0, 0.15);
+  -ms-box-shadow: 0px 3px 12px rgba(0, 0, 0, 0.15);
+  box-shadow: 0px 3px 12px rgba(0, 0, 0, 0.15);
+  overflow: hidden;
+}
+
+.attachment-composer .ui-sortable-helper .attachment-thumb:hover button,
+.attachment-composer .ui-sortable-helper .remove {
+  display: none;
+}
+
+/* Asset Library */
+.asset-library {
+  position: absolute;
+  top: 40px;
+  bottom: 0;
+  left: 0;
+  right: 0;
+}
+.asset-library .library-container {
+  position: relative;
+}
+.asset-library .toolbar {
+  display: block;
+  position: relative;
+  z-index: 10;
+}
+.asset-library .library {
+  display: block;
+  position: relative;
+  padding: 10px;
+  margin: 0;
+  list-style: none outside;
+  overflow: hidden;
+  -webkit-transform: translate3d(0, 0, 0);
+  -moz-transform: translate3d(0, 0, 0);
+  -ms-transform: translate3d(0, 0, 0);
+  transform: translate3d(0, 0, 0);
+}
+.asset-library .library-container {
+  overflow: auto;
+  position: absolute;
+  top: 40px;
+  left: 0;
+  right: 0;
+  bottom: 0;
+}
+
+.asset-library-item {
+  display: block;
+  position: relative;
+  width: 180px;
+  height: 180px;
+  word-wrap: break-word;
+}
+.library .asset-library-item {
+  margin: 5px;
+  float: left;
+  -webkit-box-shadow: 0px 2px 8px rgba(0, 0, 0, 0.5);
+  -moz-box-shadow: 0px 2px 8px rgba(0, 0, 0, 0.5);
+  -ms-box-shadow: 0px 2px 8px rgba(0, 0, 0, 0.5);
+  box-shadow: 0px 2px 8px rgba(0, 0, 0, 0.5);
+}
+  .asset-library-item.selected {
+    outline: 3px solid rgb(255, 190, 0);
+  }
+  .asset-library-item .name {
+    display: block;
+    position: absolute;
+    left: 0;
+    right: 0;
+    bottom: 0;
+    padding: 1em;
+    text-align: center;
+    font-weight: bold;
+    color: #666;
+  }
+  .asset-library-item img {
+    display: block;
+    position: absolute;
+    margin: 0;
+    background: url(<%= asset_path('slices/asset-background.png') %>) 0 0 repeat;
+  }
+  .asset-library-item .meta {
+    display: block;
+    position: absolute;
+    top: 0;
+    left: 0;
+    right: 0;
+    bottom: 0;
+    background: rgba(0, 0, 0, 0.75);
+    color: #fff;
+    margin: 0;
+    padding: 10px;
+    visibility: hidden;
+  }
+    .asset-library-item .meta dd {
+      margin: 0 0 0.5em 0;
+    }
+    .asset-library-item .meta a {
+      color: #fff;
+      font-weight: bold;
+      text-decoration: underline;
+    }
+    .asset-library-item:hover .meta,
+    .asset-library-item.editing .meta {
+      visibility: visible;
+    }
+
+    .asset-library-item.destroying {
+      opacity: 0.25;
+      outline: none;
+    }
+    .asset-library-item.destroying .meta {
+      visibility: hidden;
+    }
+
+  .toolbar > * {
+    position: relative;
+  }
+  .toolbar .count {
+    color: rgba(0, 0, 0, 0.5);
+    display: block;
+    float: left;
+    font-weight: bold;
+    padding: 13px 1em;
+    text-shadow: 0px 1px 0px #fff;
+  }
+  .toolbar .hint {
+    color: rgba(0, 0, 0, 0.5);
+    display: block;
+    position: absolute;
+    font-weight: bold;
+    padding: 13px 0;
+    text-shadow: 0px 1px 0px #fff;
+    width: 240px;
+    text-align: center;
+    left: 50%;
+    margin-left: -120px;
+  }
+  .toolbar .resize-handle {
+    position: absolute;
+    top: 0;
+    right: 0;
+    bottom: 0;
+    left: 0;
+    cursor: ns-resize;
+    z-index: 0;
+  }
+
+.loading-indicator {
+  display: block;
+  margin: 5px;
+  float: left;
+  position: relative;
+  width: 180px;
+  height: 180px;
+  background: url(<%= asset_path('slices/asset-spinner.gif') %>) 50% 50% no-repeat;
+  box-shadow: none;
+}
+  .loading-indicator .label {
+    bottom: 20px;
+    color: rgba(0, 0, 0, 0.45);
+    display: block;
+    font-size: 1.25em;
+    font-weight: bold;
+    left: 0;
+    position: absolute;
+    right: 0;
+    text-align: center;
+    text-shadow: 0px 1px 0px rgba(255, 255, 255, 0.15);
+  }
+
+
+#asset-drawer {
+  background: #666;
+  display: block;
+  height: 0px;
+  position: fixed;
+  top: auto; right: 0; left: 0; bottom: 0;
+  z-index: 10;
+  -webkit-box-shadow: rgba(0, 0, 0, 0.3) 0px 0px 5px;
+  -moz-box-shadow: rgba(0, 0, 0, 0.3) 0px 0px 5px;
+  -ms-box-shadow: rgba(0, 0, 0, 0.3) 0px 0px 5px;
+  box-shadow: rgba(0, 0, 0, 0.3) 0px 0px 5px;
+}
+  #asset-drawer .toolbar {
+    display: block;
+    position: relative;
+    z-index: 10;
+  }
+  #asset-drawer .library-container {
+    overflow: auto;
+    position: absolute;
+    top: 40px;
+    left: 0;
+    right: 0;
+    bottom: 0;
+  }
+
+.asset-drag-helper {
+  position: absolute;
+  margin-left: -18px;
+  margin-top: -18px;
+  z-index: 5000;
+  white-space: nowrap;
+}
+  .asset-drag-helper img {
+    display: block;
+    float: left;
+    margin: 1px;
+    width: 36px;
+    height: 36px;
+    box-shadow: 1px 1px 5px rgba(0, 0, 0, 0.5);
+  }
+
+.receiver {
+  box-shadow: inset 0px 0px 8px rgb(255, 190, 0);
+}
+
+#page-extra-main > li {
+  margin-bottom: 1.5em;
+}
+
+.asset-editor {}
+  .asset-editor .overview {
+    position: relative;
+    height: 180px;
+    margin-bottom: 20px;
+  }
+  .asset-editor .overview .thumb {
+    position: absolute;
+    top: 0;
+    left: 0;
+    box-shadow:
+      0px 1px 5px rgba(0, 0, 0, 0.3);
+  }
+  .asset-editor .overview .thumb img {
+    display: block;
+    margin: 0;
+  }
+  .asset-editor .overview .meta {
+    position: absolute;
+    top: 0;
+    left: 190px;
+    right: 0;
+  }
+    .asset-editor .overview .meta dd {
+      margin: 0 0 0.5em 0;
+    }
+    .asset-editor .overview .meta .options {
+      margin-top: 1em;
+    }
+
+  .asset-editor .tabs {}
+    .asset-editor .tab {
+      margin-bottom: 10px;
+    }
+
+  .asset-editor .pages ul {
+    list-style: none outside;
+    margin: 0;
+  }
+    .asset-editor .pages li {
+      display: inline;
+    }
+    .asset-editor .pages li:after {
+      content: ', ';
+    }
+    .asset-editor .pages li:last-child:after {
+      content: '';
+    }
+
+
+/* Explanations */
+.explanation {
+  color: #333;
+  color: rgba(0, 0, 0, 0.666);
+  text-shadow: 0px 1px 0px #fff;
+  background: #e2e2e2;
+  border: 1px solid #cfcfcf;
+  padding: 15px;
+  margin: 0 0 15px 0;
+  font-weight: bold;
+  border-top-left-radius: 2px;
+  border-top-right-radius: 2px;
+  text-align: center;
+}
+
+/* Pinning */
+.pinned { position: absolute }
+.pinned.top { top: 0 }
+.pinned.right { right: 0 }
+.pinned.bottom { bottom: 0 }
+.pinned.left { left: 0 }
+
+.bottom-toolbar { position: relative }
+.bottom-toolbar .pinned.top { top: 10px }
+.bottom-toolbar .pinned.right { right: 10px }
+.bottom-toolbar .pinned.bottom { bottom: 10px }
+.bottom-toolbar .pinned.left { left: 10px }
+
+/* Button Group */
+.button-group {
+  overflow: hidden;
+}
+.button-group button {
+  display: block;
+  float: left;
+  margin-left: 0;
+  margin-right: 8px;
+}
+.button-group.aligned-right button {
+  float: right;
+  margin-left: 8px;
+  margin-right: 0;
+}
+
+
+#sitemap-search {
+  position: absolute;
+  right: 24px;
+}
+.sitemap-unlocked #sitemap-search {
+  display: none;
+}
+
+.slice-preview {
+  display: none;
+  font-family: courier;
+  font-weight: normal;
+  margin-left: 20px;
+  color: #777;
+  position: absolute;
+  height: 1.2em;
+  overflow: hidden;
+  margin-right: 210px;
+  word-break: break-all;
+}
+
+.closed .slice-preview {
+  display: inline-block;
+}
+
+.admins-editor {
+  padding: 0 50px;
+  width: 781px;
+  margin: 0 auto;
+}
+  .admins-editor li {
+    margin-bottom: 1em;
+  }
+
+label abbr[title] {
+  text-decoration: none;
+  border: none;
+}
+
+/*
+Token Field
+*/
+
+.token-field {
+  position: relative;
+}
+.token-field input {}
+.token-field .tokens {
+  padding: 1px 7px 1px 2px;
+  position: absolute;
+  top: 0; left: 0;
+  overflow: hidden;
+}
+.token-field .token {
+  background: hsl(133, 53%, 79%);
+  border-radius: 1px;
+  border: 1px solid rgba(0, 0, 0, 0.25);
+  color: rgba(0, 0, 0, 0.618);
+  display: block;
+  float: left;
+  font-weight: bold;
+  margin: 2px 1px;
+  padding: 0.25em 1.75em 0.25em 0.5em;
+  position: relative;
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -ms-user-select: none;
+  user-select: none;
+  cursor: default;
+}
+.token-field .token.focus {
+  background: hsl(133, 30%, 60%);
+}
+.token-field .token .del {
+  background-clip: border;
+  background: rgba(0, 0, 0, 0.25);
+  border-radius: 7px;
+  box-sizing: border-box;
+  color: hsl(133, 53%, 79%);
+  cursor: pointer;
+  font-size: 10px;
+  font-weight: normal;
+  line-height: 1;
+  padding: 0px 0 0 3px;
+  position: absolute;
+  top: 4px; right: 4px;
+  width: 12px; height: 12px;
+  box-shadow:
+    inset 0px 1px rgba(0, 0, 0, 0.15),
+    0px 1px rgba(255, 255, 255, 0.5);
+  text-shadow:
+    0px 1px 1px rgba(0, 0, 0, 0.3);
+}
+.token-field .token .del:hover {
+  background: rgba(0, 0, 0, 0.5);
+}
+.token-field .token .del:active {
+  background: rgba(0, 0, 0, 0.75);
+}
+.token-field .options {
+  display: block;
+  padding: 0.5em 0 0 0;
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -ms-user-select: none;
+  user-select: none;
+}
+.token-field .option {
+  color: hsl(133, 53%, 40%);
+  cursor: pointer;
+}
+.token-field .option:hover {
+  text-decoration: none;
+}
+.token-field .option.used {
+  color: hsl(133, 53%, 79%);
+}
+#page-meta .token-field .option.used {
+  color: hsl(0, 0%, 75%);
+}
+.token-field .option:after {
+  content: ', ';
+}
+.token-field .option:last-child:after {
+  content: '';
+}
+
+
+/*
+Date Field
+*/
+
+.date-field {
+  border: 1px solid #d7d7d7;
+  padding: 0.7em;
+  padding-left: 30px;
+  position: relative;
+  width: 100%; height: 32px;
+  box-sizing: border-box;
+  z-index: 4;
+}
+#page-meta .date-field {
+  border: none;
+}
+.date-field .calendar-button {
+  background-image: url(<%= asset_path('slices/calendar.svg') %>);
+  background-size: 100%;
+  border: none;
+  margin: 0 1px;
+  overflow: hidden;
+  padding: 0;
+  position: absolute;
+  text-indent: -1000px;
+  top: 2px; left: 2px;
+  width: 20px; height: 24px;
+}
+.date-field .calendar-button:active {
+  opacity: 0.5;
+  box-shadow: none;
+}
+.date-field .display {
+  color: #444;
+  display: block;
+  font-weight: bold;
+}
+.date-field select {
+  margin: -2px 0 0 0;
+  line-height: 1;
+  vertical-align: baseline;
+}
+.date-field select.hour {
+  margin-left: 3px;
+}
+.date-field select.minute {
+  margin-left: 1px;
+}
+.date-field .clear {
+  background: #ccc;
+  border-radius: 18px;
+  border: none;
+  box-sizing: border-box;
+  color: white;
+  cursor: pointer;
+  font-size: 14px;
+  font-weight: normal;
+  line-height: 1;
+  padding: 0 0 2px 0;
+  position: absolute;
+  text-shadow: none;
+  top: 7px; right: 7px;
+  width: 16px; height: 16px;
+}
+.date-field .clear:hover {
+  background: #bbb;
+}
+.date-field .clear:active {
+  box-shadow: none;
+  background: #999;
+}
+
+/* Calendar View */
+.calendar-modal {
+  position: absolute;
+  top: 0; right: 0; bottom: 0; left: 0;
+  z-index: 5000;
+}
+
+.calendar-modal .background {
+  position: absolute;
+  top: 0; right: 0; bottom: 0; left: 0;
+  background: rgba(0, 0, 0, 0.15);
+}
+
+.calendar {
+  background: white;
+  border-radius: 2px;
+  box-shadow: 0px 1px 8px rgba(0, 0, 0, 0.5);
+  line-height: 1;
+  padding: 7px;
+  position: absolute;
+  margin: 10px 0 0 0;
+
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -o-user-select: none;
+  user-select: none;
+
+  -webkit-transform-origin: 50% -7px;
+}
+.calendar:after {
+  bottom: 100%; left: 50%;
+  border: 10px solid transparent;
+  border-bottom-color: white;
+  content: ' ';
+  width: 0; height: 0;
+  position: absolute;
+  pointer-events: none;
+  border-width: 7px;
+  margin-left: -7px;
+}
+
+.calendar table {
+  border-collapse: collapse;
+}
+.calendar th,
+.calendar td {
+  text-align: center;
+  vertical-align: middle;
+  width: 2em; height: 2em;
+}
+.calendar th {
+  color: hsl(207, 97%, 80%);
+  pointer-events: none;
+}
+.calendar [data-action$="-month"] {
+  cursor: pointer;
+  font-weight: bold;
+  color: hsl(207, 97%, 80%);
+}
+
+.calendar [data-action$="-month"]:hover {
+  color: hsl(207, 97%, 50%);
+}
+.calendar [data-action$="-month"]:active {
+  color: hsl(207, 97%, 20%);
+}
+
+.calendar time {
+  box-sizing: border-box;
+  cursor: pointer;
+  display: block;
+  padding: 6px 0;
+  vertical-align: middle;
+  width: 2em; height: 2em;
+}
+.calendar time:hover {
+  background: hsl(0, 0%, 90%);
+  color: hsl(0, 0%, 30%);
+}
+
+.calendar .prev-month,
+.calendar .next-month {
+  color: hsl(0, 0%, 80%);
+}
+.calendar .today {
+  border: 1px solid hsl(0, 0%, 80%);
+}
+.calendar .highlight,
+.calendar .highlight:hover {
+  background: hsl(207, 97%, 80%);
+  color: white;
+  font-weight: bold;
+  text-shadow: 0px -1px rgba(0, 0, 0, 0.5);
+}
+.calendar .highlight.today {
+  border-color: hsl(207, 50%, 50%)
+}
+
+.calendar-modal[data-state="preparing"] .background {
+  -webkit-transition: none;
+  opacity: 0;
+}
+.calendar-modal[data-state="preparing"] .calendar {
+  -webkit-transition: none;
+  -webkit-transform: scale(0);
+}
+
+.calendar-modal[data-state="showing"] .background {
+  -webkit-transition: opacity 0.25s;
+  opacity: 1;
+}
+.calendar-modal[data-state="showing"] .calendar {
+  -webkit-transition: -webkit-transform 0.25s;
+  -webkit-transform: scale(1);
+}
+
+.calendar-modal[data-state="hiding"] .background {
+  -webkit-transition: opacity 0.25s;
+  opacity: 0;
+}
+.calendar-modal[data-state="hiding"] .calendar {
+  -webkit-transition: -webkit-transform 0.25s;
+  -webkit-transform: scale(0);
+}
+
+/* In-page Navigation */
+.navigation {
+  margin: 0 0 16px 0;
+  position: relative;
+}
+
+/* Breadcrumbs */
+#breadcrumbs {
+  display: block;
+  position: relative;
+  color: hsl(0, 0%, 50%);
+}
+#breadcrumbs:after {
+  display: block;
+  content: ' ';
+  clear: both;
+}
+#breadcrumbs li:before {
+  content: '/';
+  margin: 0 0.333em;
+}
+#breadcrumbs li:first-child:before {
+  display: none;
+}
+#breadcrumbs li {
+  display: block;
+  float: left;
+}
+#breadcrumbs a {
+  color: inherit;
+}
+#breadcrumbs a:hover {
+  color: hsl(0, 0%, 25%);
+  text-decoration: none;
+}
+#breadcrumbs li.current a {
+  color: hsl(0, 0%, 25%);
+}
+#breadcrumbs li.current a:hover {
+  color: hsl(0, 0%, 25%);
+}
+#breadcrumbs select {
+  background: none;
+  border: none;
+  color: inherit;
+  cursor: pointer;
+  display: inline;
+  font-size: 1em;
+  outline: none;
+  vertical-align: baseline;
+  -webkit-appearance: none;
+}
+#breadcrumbs select:hover {
+  color: hsl(0, 0%, 25%);
+}
+
+/* Composer */
+.composer {}
+
+.composer-item {
+  background: white;
+  display: block;
+  margin: 0 9px 15px -13px;
+  padding: 0px;
+  position: relative;
+}
+.composer-item:last-child {
+  margin-bottom: 0;
+}
+.composer.not-empty .composer-actions {
+  padding-top: 15px;
+}
+.composer-item input {
+  margin-bottom: 4px;
+}
+.composer-item input:last-child {
+  margin-bottom: 0;
+}
+.composer-item .item-fields {
+  padding: 0 0 0 32px;
+}
+.composer-item [data-role="drag-handle"] {
+  position: absolute;
+  top: 0px; left: 0px;
+  width: 30px; height: 30px;
+  background: url(<%= asset_path('slices/drag-handle.svg') %>) no-repeat 50% 6px;
+  opacity: 0.2;
+  cursor: move;
+}
+.composer-item [data-role="drag-handle"]:hover {
+  opacity: 0.5;
+}
+.composer-item [data-action="remove"] {
+  background: url(<%= asset_path('slices/trash.png') %>) no-repeat 50% 50%;
+  border: 0 none;
+  cursor: pointer;
+  outline: 0 none;
+  overflow: hidden;
+  position: absolute;
+  text-indent: -1000px;
+  top: -3px; right: -22px;
+  width: 20px; height: 20px;
+
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -ms-user-select: none;
+  -o-user-select: none;
+  user-select: none;
+}
+.composer-item [data-action="remove"]:active {
+  box-shadow: none;
+  opacity: 0.5;
+}
+.composer .ui-sortable-helper [data-action="remove"] {
+  display: none;
+}