rails-pixrem 0.0.1

data/spec/spec_helper.rb

@@ -0,0 +1,14 @@
+ENV['RAILS_ENV'] ||= 'test'
+
+require_relative 'dummy/config/environment'
+require 'rspec/rails'
+require 'rspec/its'
+
+require_relative '../lib/rails-pixrem'
+
+RSpec.configure do |config|
+  config.treat_symbols_as_metadata_keys_with_true_values = true
+  config.run_all_when_everything_filtered = true
+  config.filter_run :focus
+  config.order = 'random'
+end

data/vendor/pixrem.js

@@ -0,0 +1,4595 @@
+require=(function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);throw new Error("Cannot find module '"+o+"'")}var f=n[o]={exports:{}};t[o][0].call(f.exports,function(e){var n=t[o][1][e];return s(n?n:e)},f,f.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s})({"L9tR7m":[function(require,module,exports){
+'use strict';
+
+// Add pixel fallbacks for rem units to a string of CSS
+// - css `String`: the contents of a CSS file.
+// - rootvalue `String | Null`: The root element font size. Default = 16px.
+// - options `Object`
+//     - replace `Boolean`: Replace rems with pixels instead of providing
+//       fallbacks. Default = false.
+// }
+module.exports = function pixrem(css, rootvalue, options) {
+  var postcss = require('postcss');
+  var remgex = /(\d*\.?\d+)rem/ig;
+  var rootvalue = typeof rootvalue !== 'undefined' ? rootvalue : 16;
+  var options = typeof options !== 'undefined' ? options : {
+    replace: false
+  };
+  var postprocessor = postcss(function (css) {
+
+    css.eachDecl(function (decl, i) {
+      var rule = decl.parent;
+      var value = decl.value;
+
+      if (value.indexOf('rem') != -1) {
+
+        value = value.replace(remgex, function ($1) {
+          // Round decimal pixels down to match webkit and opera behavior:
+          // http://tylertate.com/blog/2012/01/05/subpixel-rounding.html
+          return Math.floor(parseFloat($1) * toPx(rootvalue)) + 'px';
+        });
+
+        if (options.replace) {
+          decl.value = value;
+        } else {
+          rule.insertBefore(i, decl.clone({ value: value }));
+        }
+      }
+    });
+  });
+
+  // Return a unitless pixel value from any root font-size value.
+  function toPx(value) {
+    var parts = /^(\d+\.?\d*)([a-zA-Z%]*)$/.exec(value);
+    var number = parts[1];
+    var unit = parts[2];
+
+    if (unit === 'px' || unit === '') {
+      return parseFloat(number);
+    }
+    else if (unit === 'em' || unit === 'rem') {
+      return parseFloat(number) * 16;
+    }
+    else if (unit === '%') {
+      return (parseFloat(number) / 100) * 16;
+    }
+
+    // TODO: Should we throw an error here?
+    return false;
+  }
+
+  return postprocessor.process(css).css;
+};
+
+},{"postcss":12}],"pixrem":[function(require,module,exports){
+module.exports=require('L9tR7m');
+},{}],3:[function(require,module,exports){
+(function() {
+  var AtRule, Container, name, _fn, _i, _len, _ref,
+    __hasProp = {}.hasOwnProperty,
+    __extends = function(child, parent) { for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } function ctor() { this.constructor = child; } ctor.prototype = parent.prototype; child.prototype = new ctor(); child.__super__ = parent.prototype; return child; };
+
+  Container = require('./container');
+
+  AtRule = (function(_super) {
+    __extends(AtRule, _super);
+
+    function AtRule() {
+      this.type = 'atrule';
+      AtRule.__super__.constructor.apply(this, arguments);
+    }
+
+    AtRule.prototype.styleType = function() {
+      return this.type + ((this.rules != null) || (this.decls != null) ? '-body' : '-bodiless');
+    };
+
+    AtRule.prototype.defaultStyle = function(type) {
+      if (type === 'atrule-body') {
+        return {
+          between: ' ',
+          after: this.defaultAfter()
+        };
+      } else {
+        return {
+          between: ''
+        };
+      }
+    };
+
+    AtRule.prototype.addMixin = function(type) {
+      var container, detector, mixin, name, value, _ref;
+      mixin = type === 'rules' ? Container.WithRules : Container.WithDecls;
+      if (!mixin) {
+        return;
+      }
+      _ref = mixin.prototype;
+      for (name in _ref) {
+        value = _ref[name];
+        if (name === 'constructor') {
+          continue;
+        }
+        container = Container.prototype[name] === value;
+        detector = name === 'append' || name === 'prepend';
+        if (container && !detector) {
+          continue;
+        }
+        this[name] = value;
+      }
+      return mixin.apply(this);
+    };
+
+    AtRule.raw('params');
+
+    AtRule.prototype.stringify = function(builder, last) {
+      var name, params, semicolon, style;
+      style = this.style();
+      name = '@' + this.name;
+      params = this._params ? this._params.toString() : '';
+      name += this.afterName != null ? this.afterName : params ? ' ' : '';
+      if ((this.rules != null) || (this.decls != null)) {
+        return this.stringifyBlock(builder, name + params + style.between + '{');
+      } else {
+        if (this.before) {
+          builder(this.before);
+        }
+        semicolon = !last || this.semicolon ? ';' : '';
+        return builder(name + params + style.between + semicolon, this);
+      }
+    };
+
+    return AtRule;
+
+  })(Container);
+
+  _ref = ['append', 'prepend'];
+  _fn = function(name) {
+    return AtRule.prototype[name] = function(child) {
+      var mixin;
+      mixin = child.type === 'decl' ? 'decls' : 'rules';
+      this.addMixin(mixin);
+      return this[name](child);
+    };
+  };
+  for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+    name = _ref[_i];
+    _fn(name);
+  }
+
+  module.exports = AtRule;
+
+}).call(this);
+
+},{"./container":5}],4:[function(require,module,exports){
+(function() {
+  var Comment, Node,
+    __hasProp = {}.hasOwnProperty,
+    __extends = function(child, parent) { for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } function ctor() { this.constructor = child; } ctor.prototype = parent.prototype; child.prototype = new ctor(); child.__super__ = parent.prototype; return child; };
+
+  Node = require('./node');
+
+  Comment = (function(_super) {
+    __extends(Comment, _super);
+
+    function Comment() {
+      this.type = 'comment';
+      Comment.__super__.constructor.apply(this, arguments);
+    }
+
+    Comment.prototype.defaultStyle = function() {
+      return {
+        left: ' ',
+        right: ' '
+      };
+    };
+
+    Comment.prototype.stringify = function(builder) {
+      var style;
+      if (this.before) {
+        builder(this.before);
+      }
+      style = this.style();
+      return builder("/*" + (style.left + this.text + style.right) + "*/", this);
+    };
+
+    return Comment;
+
+  })(Node);
+
+  module.exports = Comment;
+
+}).call(this);
+
+},{"./node":10}],5:[function(require,module,exports){
+(function() {
+  var Container, Declaration, Node,
+    __hasProp = {}.hasOwnProperty,
+    __extends = function(child, parent) { for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } function ctor() { this.constructor = child; } ctor.prototype = parent.prototype; child.prototype = new ctor(); child.__super__ = parent.prototype; return child; };
+
+  Node = require('./node');
+
+  Declaration = require('./declaration');
+
+  Container = (function(_super) {
+    __extends(Container, _super);
+
+    function Container() {
+      return Container.__super__.constructor.apply(this, arguments);
+    }
+
+    Container.prototype.stringifyContent = function(builder) {
+      var last;
+      if (!this.rules && !this.decls) {
+        return;
+      }
+      if (this.rules) {
+        last = this.rules.length - 1;
+        return this.rules.map(function(rule, i) {
+          return rule.stringify(builder, last === i);
+        });
+      } else if (this.decls) {
+        last = this.decls.length - 1;
+        return this.decls.map((function(_this) {
+          return function(decl, i) {
+            return decl.stringify(builder, last !== i || _this.semicolon);
+          };
+        })(this));
+      }
+    };
+
+    Container.prototype.defaultAfter = function() {
+      var _ref;
+      if (this.list.length === 0) {
+        return '';
+      } else if (((_ref = this.list[0].before) != null ? _ref.indexOf("\n") : void 0) === -1) {
+        return this.list[0].before;
+      } else {
+        return "\n";
+      }
+    };
+
+    Container.prototype.stringifyBlock = function(builder, start) {
+      var style;
+      style = this.style();
+      if (this.before) {
+        builder(this.before);
+      }
+      builder(start, this, 'start');
+      this.stringifyContent(builder);
+      if (style.after) {
+        builder(style.after);
+      }
+      return builder('}', this, 'end');
+    };
+
+    Container.prototype.push = function(child) {
+      child.parent = this;
+      this.list.push(child);
+      return this;
+    };
+
+    Container.prototype.each = function(callback) {
+      var id, index, list, result;
+      this.lastEach || (this.lastEach = 0);
+      this.indexes || (this.indexes = {});
+      this.lastEach += 1;
+      id = this.lastEach;
+      this.indexes[id] = 0;
+      list = this.list;
+      if (!list) {
+        return;
+      }
+      while (this.indexes[id] < list.length) {
+        index = this.indexes[id];
+        result = callback(list[index], index);
+        if (result === false) {
+          break;
+        }
+        this.indexes[id] += 1;
+      }
+      delete this.indexes[id];
+      if (result === false) {
+        return false;
+      }
+    };
+
+    Container.prototype.eachInside = function(callback) {
+      return this.each((function(_this) {
+        return function(child, i) {
+          var result;
+          result = callback(child, i);
+          if (result !== false && child.eachInside) {
+            result = child.eachInside(callback);
+          }
+          if (result === false) {
+            return result;
+          }
+        };
+      })(this));
+    };
+
+    Container.prototype.eachDecl = function(callback) {};
+
+    Container.prototype.eachComment = function(callback) {
+      return this.eachInside((function(_this) {
+        return function(child, i) {
+          var result;
+          result = child.type === 'comment' ? callback(child, i) : void 0;
+          if (result === false) {
+            return result;
+          }
+        };
+      })(this));
+    };
+
+    Container.prototype.append = function(child) {
+      child = this.normalize(child, this.list[this.list.length - 1]);
+      this.list.push(child);
+      return this;
+    };
+
+    Container.prototype.prepend = function(child) {
+      var id, index, _ref;
+      child = this.normalize(child, this.list[0], 'prepend');
+      this.list.unshift(child);
+      _ref = this.indexes;
+      for (id in _ref) {
+        index = _ref[id];
+        this.indexes[id] = index + 1;
+      }
+      return this;
+    };
+
+    Container.prototype.insertBefore = function(exist, add) {
+      var id, index, _ref;
+      exist = this.index(exist);
+      add = this.normalize(add, this.list[exist], exist === 0 ? 'prepend' : void 0);
+      this.list.splice(exist, 0, add);
+      _ref = this.indexes;
+      for (id in _ref) {
+        index = _ref[id];
+        if (index >= exist) {
+          this.indexes[id] = index + 1;
+        }
+      }
+      return this;
+    };
+
+    Container.prototype.insertAfter = function(exist, add) {
+      var id, index, _ref;
+      exist = this.index(exist);
+      add = this.normalize(add, this.list[exist]);
+      this.list.splice(exist + 1, 0, add);
+      _ref = this.indexes;
+      for (id in _ref) {
+        index = _ref[id];
+        if (index > exist) {
+          this.indexes[id] = index + 1;
+        }
+      }
+      return this;
+    };
+
+    Container.prototype.remove = function(child) {
+      var id, index, _ref;
+      child = this.index(child);
+      this.list.splice(child, 1);
+      _ref = this.indexes;
+      for (id in _ref) {
+        index = _ref[id];
+        if (index >= child) {
+          this.indexes[id] = index - 1;
+        }
+      }
+      return this;
+    };
+
+    Container.prototype.every = function(condition) {
+      return this.list.every(condition);
+    };
+
+    Container.prototype.some = function(condition) {
+      return this.list.some(condition);
+    };
+
+    Container.prototype.index = function(child) {
+      if (typeof child === 'number') {
+        return child;
+      } else {
+        return this.list.indexOf(child);
+      }
+    };
+
+    Container.prop('first', {
+      get: function() {
+        return this.list[0];
+      }
+    });
+
+    Container.prop('last', {
+      get: function() {
+        return this.list[this.list.length - 1];
+      }
+    });
+
+    Container.prop('list', {
+      get: function() {
+        return this.rules || this.decls;
+      }
+    });
+
+    Container.prototype.normalize = function(child, sample) {
+      child.parent = this;
+      if ((child.before == null) && sample) {
+        child.before = sample.before;
+      }
+      return child;
+    };
+
+    return Container;
+
+  })(Node);
+
+  Container.WithRules = (function(_super) {
+    __extends(WithRules, _super);
+
+    function WithRules() {
+      this.rules = [];
+      WithRules.__super__.constructor.apply(this, arguments);
+    }
+
+    WithRules.prototype.eachDecl = function(callback) {
+      return this.each(function(child) {
+        var result;
+        if (!child.eachDecl) {
+          return;
+        }
+        result = child.eachDecl(callback);
+        if (result === false) {
+          return result;
+        }
+      });
+    };
+
+    WithRules.prototype.eachRule = function(callback) {
+      return this.each((function(_this) {
+        return function(child, i) {
+          var result;
+          result = child.type === 'rule' ? callback(child, i) : child.eachRule ? child.eachRule(callback) : void 0;
+          if (result === false) {
+            return result;
+          }
+        };
+      })(this));
+    };
+
+    WithRules.prototype.eachAtRule = function(callback) {
+      return this.eachInside((function(_this) {
+        return function(child, i) {
+          var result;
+          result = child.type === 'atrule' ? callback(child, i) : void 0;
+          if (result === false) {
+            return result;
+          }
+        };
+      })(this));
+    };
+
+    return WithRules;
+
+  })(Container);
+
+  Container.WithDecls = (function(_super) {
+    __extends(WithDecls, _super);
+
+    function WithDecls() {
+      this.decls = [];
+      WithDecls.__super__.constructor.apply(this, arguments);
+    }
+
+    WithDecls.prototype.normalize = function(child, sample) {
+      if (!child.type) {
+        child = new Declaration(child);
+      }
+      return WithDecls.__super__.normalize.call(this, child, sample);
+    };
+
+    WithDecls.prototype.eachDecl = function(callback) {
+      return this.each((function(_this) {
+        return function(node, i) {
+          var result;
+          if (node.type !== 'decl') {
+            return;
+          }
+          result = callback(node, i);
+          if (result === false) {
+            return result;
+          }
+        };
+      })(this));
+    };
+
+    return WithDecls;
+
+  })(Container);
+
+  module.exports = Container;
+
+}).call(this);
+
+},{"./declaration":6,"./node":10}],6:[function(require,module,exports){
+(function() {
+  var Declaration, Node, vendor,
+    __hasProp = {}.hasOwnProperty,
+    __extends = function(child, parent) { for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } function ctor() { this.constructor = child; } ctor.prototype = parent.prototype; child.prototype = new ctor(); child.__super__ = parent.prototype; return child; };
+
+  Node = require('./node');
+
+  vendor = require('./vendor');
+
+  Declaration = (function(_super) {
+    __extends(Declaration, _super);
+
+    function Declaration() {
+      this.type = 'decl';
+      Declaration.__super__.constructor.apply(this, arguments);
+    }
+
+    Declaration.prototype.defaultStyle = function() {
+      return {
+        before: "\n    ",
+        between: ': '
+      };
+    };
+
+    Declaration.raw('value');
+
+    Declaration.prop('important', {
+      get: function() {
+        return !!this._important;
+      },
+      set: function(value) {
+        if (typeof value === 'string' && value !== '') {
+          return this._important = value;
+        } else if (value) {
+          return this._important = ' !important';
+        } else {
+          return this._important = false;
+        }
+      }
+    });
+
+    Declaration.prototype.stringify = function(builder, semicolon) {
+      var string, style;
+      style = this.style();
+      if (style.before) {
+        builder(style.before);
+      }
+      string = this.prop + style.between + this._value.toString();
+      string += this._important || '';
+      if (semicolon) {
+        string += ';';
+      }
+      return builder(string, this);
+    };
+
+    Declaration.prototype.clone = function(obj) {
+      var cloned;
+      cloned = Declaration.__super__.clone.apply(this, arguments);
+      delete cloned.before;
+      return cloned;
+    };
+
+    return Declaration;
+
+  })(Node);
+
+  module.exports = Declaration;
+
+}).call(this);
+
+},{"./node":10,"./vendor":18}],7:[function(require,module,exports){
+(function() {
+  var lazy;
+
+  lazy = function(klass, name, callback) {
+    var cache;
+    cache = name + 'Cache';
+    return klass.prototype[name] = function() {
+      if (this[cache] != null) {
+        return this[cache];
+      } else {
+        return this[cache] = callback.apply(this, arguments);
+      }
+    };
+  };
+
+  module.exports = lazy;
+
+}).call(this);
+
+},{}],8:[function(require,module,exports){
+(function() {
+  var list;
+
+  list = {
+    split: function(string, separators, last) {
+      var array, current, escape, func, letter, quote, separator, split, _i, _j, _len, _len1;
+      array = [];
+      current = '';
+      split = false;
+      func = 0;
+      quote = false;
+      escape = false;
+      for (_i = 0, _len = string.length; _i < _len; _i++) {
+        letter = string[_i];
+        if (quote) {
+          if (escape) {
+            escape = false;
+          } else if (letter === '\\') {
+            escape = true;
+          } else if (letter === quote) {
+            quote = false;
+          }
+        } else if (letter === '"' || letter === "'") {
+          quote = letter;
+        } else if (letter === '(') {
+          func += 1;
+        } else if (letter === ')') {
+          if (func > 0) {
+            func -= 1;
+          }
+        } else if (func === 0) {
+          for (_j = 0, _len1 = separators.length; _j < _len1; _j++) {
+            separator = separators[_j];
+            if (letter === separator) {
+              split = true;
+            }
+          }
+        }
+        if (split) {
+          if (current !== '') {
+            array.push(current.trim());
+          }
+          current = '';
+          split = false;
+        } else {
+          current += letter;
+        }
+      }
+      if (last || current !== '') {
+        array.push(current.trim());
+      }
+      return array;
+    },
+    space: function(string) {
+      return this.split(string, [' ', "\n", "\t"]);
+    },
+    comma: function(string) {
+      return this.split(string, [','], true);
+    }
+  };
+
+  module.exports = list;
+
+}).call(this);
+
+},{}],9:[function(require,module,exports){
+(function() {
+  var MapGenerator, Result, base64js, fs, lazy, mozilla, path;
+
+  base64js = require('base64-js');
+
+  mozilla = require('source-map');
+
+  Result = require('./result');
+
+  lazy = require('./lazy');
+
+  path = require('path');
+
+  fs = require('fs');
+
+  MapGenerator = (function() {
+    function MapGenerator(root, opts) {
+      this.root = root;
+      this.opts = opts;
+    }
+
+    MapGenerator.prototype.startWith = function(string, start) {
+      return string.slice(0, +(start.length - 1) + 1 || 9e9) === start;
+    };
+
+    MapGenerator.prototype.isMap = function() {
+      if (typeof this.opts.map === 'boolean') {
+        return this.opts.map;
+      }
+      return !!this.opts.inlineMap || !!this.prevMap();
+    };
+
+    lazy(MapGenerator, 'isInline', function() {
+      if (this.opts.inlineMap != null) {
+        return this.opts.inlineMap;
+      }
+      return this.isPrevInline();
+    });
+
+    lazy(MapGenerator, 'isPrevInline', function() {
+      var text;
+      if (!this.prevAnnotation()) {
+        return false;
+      }
+      text = this.prevAnnotation().text;
+      return this.startWith(text, '# sourceMappingURL=data:');
+    });
+
+    lazy(MapGenerator, 'prevMap', function() {
+      var file, map;
+      if (this.opts.map && typeof this.opts.map !== 'boolean') {
+        return this.opts.map;
+      }
+      if (this.isPrevInline()) {
+        return this.encodeInline(this.prevAnnotation().text);
+      } else if (this.opts.from) {
+        map = this.opts.from + '.map';
+        if (this.prevAnnotation()) {
+          file = this.prevAnnotation().text.replace('# sourceMappingURL=', '');
+          map = path.join(path.dirname(this.opts.from), file);
+        }
+        if (typeof fs.existsSync === "function" ? fs.existsSync(map) : void 0) {
+          return fs.readFileSync(map).toString();
+        } else {
+          return false;
+        }
+      }
+    });
+
+    lazy(MapGenerator, 'prevAnnotation', function() {
+      var last;
+      last = this.root.last;
+      if (!last) {
+        return null;
+      }
+      if (last.type === 'comment' && this.startWith(last.text, '# sourceMappingURL=')) {
+        return last;
+      } else {
+        return null;
+      }
+    });
+
+    MapGenerator.prototype.encodeInline = function(text) {
+      var base64, byte, bytes, uri;
+      uri = '# sourceMappingURL=data:application/json,';
+      base64 = '# sourceMappingURL=data:application/json;base64,';
+      if (this.startWith(text, uri)) {
+        return decodeURIComponent(text.slice(uri.length));
+      } else if (this.startWith(text, base64)) {
+        text = text.slice(base64.length);
+        bytes = base64js.toByteArray(text);
+        return ((function() {
+          var _i, _len, _results;
+          _results = [];
+          for (_i = 0, _len = bytes.length; _i < _len; _i++) {
+            byte = bytes[_i];
+            _results.push(String.fromCharCode(byte));
+          }
+          return _results;
+        })()).join('');
+      } else {
+        throw new Error('Unknown source map encoding');
+      }
+    };
+
+    MapGenerator.prototype.clearAnnotation = function() {
+      var _ref;
+      return (_ref = this.prevAnnotation()) != null ? _ref.removeSelf() : void 0;
+    };
+
+    MapGenerator.prototype.applyPrevMap = function() {
+      var from, prev;
+      if (this.prevMap()) {
+        prev = this.prevMap();
+        prev = typeof prev === 'string' ? JSON.parse(prev) : prev instanceof mozilla.SourceMapConsumer ? mozilla.SourceMapGenerator.fromSourceMap(prev).toJSON() : typeof prev === 'object' && prev.toJSON ? prev.toJSON() : prev;
+        prev = new mozilla.SourceMapConsumer(prev);
+        from = this.relative(this.opts.from);
+        return this.map.applySourceMap(prev, from, path.dirname(from));
+      }
+    };
+
+    MapGenerator.prototype.addAnnotation = function() {
+      var bytes, char, content;
+      if (this.opts.mapAnnotation === false) {
+        return;
+      }
+      if (this.prevMap() && !this.prevAnnotation()) {
+        return;
+      }
+      content = this.isInline() ? (bytes = (function() {
+        var _i, _len, _ref, _results;
+        _ref = this.map.toString();
+        _results = [];
+        for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+          char = _ref[_i];
+          _results.push(char.charCodeAt(0));
+        }
+        return _results;
+      }).call(this), "data:application/json;base64," + base64js.fromByteArray(bytes)) : this.outputFile() + '.map';
+      return this.css += "\n/*# sourceMappingURL=" + content + " */";
+    };
+
+    MapGenerator.prototype.outputFile = function() {
+      if (this.opts.to) {
+        return path.basename(this.opts.to);
+      } else {
+        return 'to.css';
+      }
+    };
+
+    MapGenerator.prototype.generateMap = function() {
+      this.stringify();
+      this.applyPrevMap();
+      this.addAnnotation();
+      if (this.isInline()) {
+        return new Result(this.css);
+      } else {
+        return new Result(this.css, this.map.toString());
+      }
+    };
+
+    MapGenerator.prototype.relative = function(file) {
+      var from;
+      from = this.opts.to ? path.dirname(this.opts.to) : '.';
+      file = path.relative(from, file);
+      if (path.sep === '\\') {
+        file = file.replace('\\', '/');
+      }
+      return file;
+    };
+
+    MapGenerator.prototype.sourcePath = function(node) {
+      return this.relative(node.source.file || 'from.css');
+    };
+
+    MapGenerator.prototype.stringify = function() {
+      var builder, column, line;
+      this.css = '';
+      this.map = new mozilla.SourceMapGenerator({
+        file: this.outputFile()
+      });
+      line = 1;
+      column = 1;
+      builder = (function(_this) {
+        return function(str, node, type) {
+          var last, lines, _ref, _ref1;
+          _this.css += str;
+          if ((node != null ? (_ref = node.source) != null ? _ref.start : void 0 : void 0) && type !== 'end') {
+            _this.map.addMapping({
+              source: _this.sourcePath(node),
+              original: {
+                line: node.source.start.line,
+                column: node.source.start.column - 1
+              },
+              generated: {
+                line: line,
+                column: column - 1
+              }
+            });
+          }
+          lines = str.match(/\n/g);
+          if (lines) {
+            line += lines.length;
+            last = str.lastIndexOf("\n");
+            column = str.length - last;
+          } else {
+            column = column + str.length;
+          }
+          if ((node != null ? (_ref1 = node.source) != null ? _ref1.end : void 0 : void 0) && type !== 'start') {
+            return _this.map.addMapping({
+              source: _this.sourcePath(node),
+              original: {
+                line: node.source.end.line,
+                column: node.source.end.column
+              },
+              generated: {
+                line: line,
+                column: column
+              }
+            });
+          }
+        };
+      })(this);
+      return this.root.stringify(builder);
+    };
+
+    MapGenerator.prototype.getResult = function() {
+      this.clearAnnotation();
+      if (this.isMap()) {
+        return this.generateMap();
+      } else {
+        return new Result(this.root.toString());
+      }
+    };
+
+    return MapGenerator;
+
+  })();
+
+  module.exports = MapGenerator;
+
+}).call(this);
+
+},{"./lazy":7,"./result":14,"base64-js":19,"fs":30,"path":32,"source-map":20}],10:[function(require,module,exports){
+(function() {
+  var Node, Raw, clone, keys,
+    __hasProp = {}.hasOwnProperty;
+
+  Raw = require('./raw');
+
+  clone = function(obj, parent) {
+    var cloned, name, value;
+    if (typeof obj !== 'object') {
+      return obj;
+    }
+    cloned = new obj.constructor();
+    for (name in obj) {
+      if (!__hasProp.call(obj, name)) continue;
+      value = obj[name];
+      if (name === 'parent' && typeof value === 'object') {
+        if (parent) {
+          cloned[name] = parent;
+        }
+      } else if (value instanceof Array) {
+        cloned[name] = value.map(function(i) {
+          return clone(i, cloned);
+        });
+      } else {
+        cloned[name] = clone(value, cloned);
+      }
+    }
+    return cloned;
+  };
+
+  keys = function(obj, keys) {
+    var all, key;
+    all = {};
+    for (key in keys) {
+      if (obj[key] != null) {
+        all[key] = obj[key];
+      } else {
+        return false;
+      }
+    }
+    return all;
+  };
+
+  Node = (function() {
+    function Node(defaults) {
+      var name, value;
+      if (defaults == null) {
+        defaults = {};
+      }
+      for (name in defaults) {
+        value = defaults[name];
+        this[name] = value;
+      }
+    }
+
+    Node.prop = function(name, params) {
+      return Object.defineProperty(this.prototype, name, params);
+    };
+
+    Node.raw = function(name) {
+      var hidden;
+      hidden = '_' + name;
+      return this.prop(name, {
+        get: function() {
+          var prop;
+          prop = this[hidden];
+          if (prop instanceof Raw) {
+            return prop.value;
+          } else {
+            return prop;
+          }
+        },
+        set: function(value) {
+          if (value instanceof Raw) {
+            return this[hidden] = value;
+          } else {
+            return this[hidden] = value;
+          }
+        }
+      });
+    };
+
+    Node.prototype.removeSelf = function() {
+      if (!this.parent) {
+        return;
+      }
+      this.parent.remove(this);
+      return this;
+    };
+
+    Node.prototype.toString = function() {
+      var builder, result;
+      result = '';
+      builder = function(str) {
+        return result += str;
+      };
+      this.stringify(builder);
+      return result;
+    };
+
+    Node.prototype.clone = function(overrides) {
+      var cloned, name, value;
+      if (overrides == null) {
+        overrides = {};
+      }
+      cloned = clone(this);
+      for (name in overrides) {
+        value = overrides[name];
+        cloned[name] = value;
+      }
+      return cloned;
+    };
+
+    Node.prototype.toJSON = function() {
+      var fixed, name, value;
+      fixed = {};
+      for (name in this) {
+        if (!__hasProp.call(this, name)) continue;
+        value = this[name];
+        if (name === 'parent') {
+          continue;
+        }
+        fixed[name] = value instanceof Array ? value.map(function(i) {
+          if (typeof i === 'object' && i.toJSON) {
+            return i.toJSON();
+          } else {
+            return i;
+          }
+        }) : typeof value === 'object' && value.toJSON ? value.toJSON() : value;
+      }
+      return fixed;
+    };
+
+    Node.prototype.defaultStyle = function() {
+      return {};
+    };
+
+    Node.prototype.styleType = function() {
+      return this.type;
+    };
+
+    Node.prototype.style = function() {
+      var all, defaults, key, merge, root, style, type;
+      type = this.styleType();
+      defaults = this.defaultStyle(type);
+      all = keys(this, defaults);
+      if (all) {
+        return all;
+      }
+      style = defaults;
+      if (this.parent) {
+        root = this;
+        while (root.parent) {
+          root = root.parent;
+        }
+        root.styleCache || (root.styleCache = {});
+        if (root.styleCache[type]) {
+          style = root.styleCache[type];
+        } else {
+          root.eachInside(function(another) {
+            if (another.styleType() !== type) {
+              return;
+            }
+            if (this === another) {
+              return;
+            }
+            all = keys(another, style);
+            if (all) {
+              style = all;
+              return false;
+            }
+          });
+          root.styleCache[type] = style;
+        }
+      }
+      merge = {};
+      for (key in style) {
+        merge[key] = this[key] != null ? this[key] : style[key];
+      }
+      return merge;
+    };
+
+    return Node;
+
+  })();
+
+  module.exports = Node;
+
+}).call(this);
+
+},{"./raw":13}],11:[function(require,module,exports){
+(function() {
+  var AtRule, Comment, Declaration, Parser, Raw, Root, Rule, SyntexError;
+
+  SyntexError = require('./syntax-error');
+
+  Declaration = require('./declaration');
+
+  Comment = require('./comment');
+
+  AtRule = require('./at-rule');
+
+  Root = require('./root');
+
+  Rule = require('./rule');
+
+  Raw = require('./raw');
+
+  Parser = (function() {
+    function Parser(source, opts) {
+      this.opts = opts;
+      this.source = source.toString();
+      this.root = new Root();
+      this.current = this.root;
+      this.parents = [this.current];
+      this.type = 'rules';
+      this.types = [this.type];
+      this.pos = -1;
+      this.line = 1;
+      this.lines = [];
+      this.column = 0;
+      this.buffer = '';
+    }
+
+    Parser.prototype.loop = function() {
+      while (this.pos < this.source.length - 1) {
+        this.move();
+        this.nextLetter();
+      }
+      return this.endFile();
+    };
+
+    Parser.prototype.nextLetter = function() {
+      this.inString() || this.inComment() || this.isComment() || this.isString() || this.isWrong() || this.inAtrule() || this.isAtrule() || this.isBlockEnd() || this.inSelector() || this.isSelector() || this.inProperty() || this.isProperty() || this.inValue();
+      return this.unknown();
+    };
+
+    Parser.prototype.inString = function() {
+      if (this.quote) {
+        if (this.escape) {
+          this.escape = false;
+        } else if (this.letter === '\\') {
+          this.escape = true;
+        } else if (this.letter === this.quote) {
+          this.quote = void 0;
+        }
+        this.trimmed += this.letter;
+        return true;
+      }
+    };
+
+    Parser.prototype.isString = function() {
+      if (this.letter === '"' || this.letter === "'") {
+        this.quote = this.letter;
+        this.quotePos = {
+          line: this.line,
+          column: this.column
+        };
+        this.trimmed += this.letter;
+        return true;
+      }
+    };
+
+    Parser.prototype.inComment = function() {
+      var left, right, text, _ref, _ref1;
+      if (this.inside('comment')) {
+        if (this.next('*/')) {
+          _ref = this.startSpaces(this.prevBuffer()), text = _ref[0], left = _ref[1];
+          _ref1 = this.endSpaces(text), text = _ref1[0], right = _ref1[1];
+          this.current.text = text;
+          this.current.left = left;
+          this.current.right = right;
+          this.move();
+          this.pop();
+        }
+        return true;
+      } else if (this.inside('value-comment')) {
+        if (this.next('*/')) {
+          this.popType();
+          this.move();
+        }
+        return true;
+      }
+    };
+
+    Parser.prototype.isComment = function() {
+      if (this.next('/*')) {
+        if (this.inside('rules') || this.inside('decls')) {
+          this.init(new Comment());
+          this.addType('comment');
+          this.move();
+          return this.buffer = '';
+        } else {
+          this.commentPos = {
+            line: this.line,
+            column: this.column
+          };
+          this.addType('value-comment');
+          this.move();
+          return true;
+        }
+      }
+    };
+
+    Parser.prototype.isWrong = function() {
+      if (this.letter === '{' && (this.inside('decls') || this.inside('value'))) {
+        this.error("Unexpected {");
+      }
+      if (this.inside('prop') && (this.letter === '}' || this.letter === ';')) {
+        return this.error('Missing property value');
+      }
+    };
+
+    Parser.prototype.isAtrule = function() {
+      if (this.letter === '@' && this.inside('rules')) {
+        this.init(new AtRule());
+        this.current.name = '';
+        this.addType('atrule-name');
+        return true;
+      }
+    };
+
+    Parser.prototype.inAtrule = function(close) {
+      var left, raw, right, _ref, _ref1;
+      if (this.inside('atrule-name')) {
+        if (this.space()) {
+          this.checkAtruleName();
+          this.buffer = this.buffer.slice(this.current.name.length);
+          this.trimmed = '';
+          this.setType('atrule-param');
+        } else if (this.letter === ';' || this.letter === '{' || close) {
+          this.current.between = '';
+          this.checkAtruleName();
+          this.endAtruleParams();
+        } else {
+          this.current.name += this.letter;
+        }
+        return true;
+      } else if (this.inside('atrule-param')) {
+        if (this.letter === ';' || this.letter === '{' || close) {
+          _ref = this.startSpaces(this.prevBuffer()), raw = _ref[0], left = _ref[1];
+          _ref1 = this.endSpaces(raw), raw = _ref1[0], right = _ref1[1];
+          this.current.params = this.raw(this.trimmed.trim(), raw);
+          if (this.current.params) {
+            this.current.afterName = left;
+            this.current.between = right;
+          } else {
+            this.current.afterName = '';
+            this.current.between = left + right;
+          }
+          this.endAtruleParams();
+        } else {
+          this.trimmed += this.letter;
+        }
+        return true;
+      }
+    };
+
+    Parser.prototype.inSelector = function() {
+      var raw, spaces, _ref;
+      if (this.inside('selector')) {
+        if (this.letter === '{') {
+          _ref = this.endSpaces(this.prevBuffer()), raw = _ref[0], spaces = _ref[1];
+          this.current.selector = this.raw(this.trimmed.trim(), raw);
+          this.current.between = spaces;
+          this.semicolon = false;
+          this.buffer = '';
+          this.setType('decls');
+        } else {
+          this.trimmed += this.letter;
+        }
+        return true;
+      }
+    };
+
+    Parser.prototype.isSelector = function() {
+      if (!this.space() && this.inside('rules')) {
+        this.init(new Rule());
+        if (this.letter === '{') {
+          this.addType('decls');
+          this.current.selector = '';
+          this.current.between = '';
+          this.semicolon = false;
+          this.buffer = '';
+        } else {
+          this.addType('selector');
+          this.buffer = this.letter;
+          this.trimmed = this.letter;
+        }
+        return true;
+      }
+    };
+
+    Parser.prototype.isBlockEnd = function() {
+      if (this.letter === '}') {
+        if (this.parents.length === 1) {
+          this.error('Unexpected }');
+        } else {
+          if (this.inside('value')) {
+            this.fixEnd(function() {
+              return this.inValue('close');
+            });
+          } else {
+            if (this.semicolon) {
+              this.current.semicolon = true;
+            }
+            this.current.after = this.prevBuffer();
+          }
+          this.pop();
+        }
+        return true;
+      }
+    };
+
+    Parser.prototype.inProperty = function() {
+      if (this.inside('prop')) {
+        if (this.letter === ':') {
+          if (this.buffer[0] === '*' || this.buffer[0] === '_') {
+            this.current.before += this.buffer[0];
+            this.trimmed = this.trimmed.slice(1);
+            this.buffer = this.buffer.slice(1);
+          }
+          this.current.prop = this.trimmed.trim();
+          this.current.between = this.prevBuffer().slice(this.current.prop.length);
+          this.buffer = '';
+          this.setType('value');
+          this.trimmed = '';
+        } else if (this.letter === '{') {
+          this.error('Unexpected { in decls');
+        } else {
+          this.trimmed += this.letter;
+        }
+        return true;
+      }
+    };
+
+    Parser.prototype.isProperty = function() {
+      if (this.inside('decls') && !this.space() && this.letter !== ';') {
+        this.init(new Declaration());
+        this.addType('prop');
+        this.buffer = this.letter;
+        this.trimmed = this.letter;
+        this.semicolon = false;
+        return true;
+      }
+    };
+
+    Parser.prototype.inValue = function(close) {
+      var end, match, raw, spaces, trim, _ref;
+      if (this.inside('value')) {
+        if (this.letter === '(') {
+          this.inBrackets = true;
+        } else if (this.inBrackets && this.letter === ')') {
+          this.inBrackets = false;
+        }
+        if ((this.letter === ';' && !this.inBrackets) || close) {
+          if (this.letter === ';') {
+            this.semicolon = true;
+          }
+          _ref = this.startSpaces(this.prevBuffer()), raw = _ref[0], spaces = _ref[1];
+          trim = this.trimmed.trim();
+          if (match = raw.match(/\s+!important\s*$/)) {
+            this.current._important = match[0];
+            end = -match[0].length - 1;
+            raw = raw.slice(0, +end + 1 || 9e9);
+            trim = trim.replace(/\s+!important$/, '');
+          }
+          this.current.value = this.raw(trim, raw);
+          this.current.between += ':' + spaces;
+          this.pop();
+        } else {
+          this.trimmed += this.letter;
+        }
+        return true;
+      }
+    };
+
+    Parser.prototype.unknown = function() {
+      if (!this.space) {
+        return this.error("Unexpected symbol " + this.letter);
+      }
+    };
+
+    Parser.prototype.endFile = function() {
+      if (this.inside('atrule-param') || this.inside('atrule-name')) {
+        this.fixEnd(function() {
+          return this.inAtrule('close');
+        });
+      }
+      if (this.inside('comment')) {
+        return this.error('Unclosed comment', this.current.source.start);
+      } else if (this.parents.length > 1) {
+        return this.error('Unclosed block', this.current.source.start);
+      } else if (this.inside('value-comment')) {
+        return this.error('Unclosed comment', this.commentPos);
+      } else if (this.quote) {
+        return this.error('Unclosed quote', this.quotePos);
+      } else {
+        return this.root.after = this.buffer;
+      }
+    };
+
+    Parser.prototype.error = function(message, position) {
+      if (position == null) {
+        position = {
+          line: this.line,
+          column: this.column
+        };
+      }
+      throw new SyntexError(message, this.source, position, this.opts.from);
+    };
+
+    Parser.prototype.move = function() {
+      this.pos += 1;
+      this.column += 1;
+      this.letter = this.source[this.pos];
+      this.buffer += this.letter;
+      if (this.letter === "\n") {
+        this.lines[this.line] = this.column - 1;
+        this.line += 1;
+        return this.column = 0;
+      }
+    };
+
+    Parser.prototype.prevBuffer = function() {
+      return this.buffer.slice(0, -1);
+    };
+
+    Parser.prototype.inside = function(type) {
+      return this.type === type;
+    };
+
+    Parser.prototype.next = function(string) {
+      return this.source.slice(this.pos, +(this.pos + string.length - 1) + 1 || 9e9) === string;
+    };
+
+    Parser.prototype.space = function() {
+      return this.letter.match(/\s/);
+    };
+
+    Parser.prototype.init = function(node) {
+      this.current.push(node);
+      this.parents.push(node);
+      this.current = node;
+      this.current.source = {
+        start: {
+          line: this.line,
+          column: this.column
+        }
+      };
+      if (this.opts.from) {
+        this.current.source.file = this.opts.from;
+      }
+      this.current.before = this.buffer.slice(0, -1);
+      return this.buffer = '';
+    };
+
+    Parser.prototype.raw = function(value, raw) {
+      if (value !== raw) {
+        return new Raw(value, raw);
+      } else {
+        return value;
+      }
+    };
+
+    Parser.prototype.fixEnd = function(callback) {
+      var after, all, el, last, lines, start;
+      if (this.letter === '}') {
+        start = this.buffer.search(/\s*\}$/);
+        after = this.buffer.slice(start, -1);
+      } else {
+        start = this.buffer.search(/\s*$/);
+        after = this.buffer.slice(start);
+      }
+      this.buffer = this.buffer.slice(0, +start + 1 || 9e9);
+      el = this.current;
+      callback.apply(this);
+      lines = after.match(/\n/g);
+      if (lines) {
+        el.source.end.line -= lines.length;
+        all = this.lines[el.source.end.line];
+        last = after.indexOf("\n");
+        if (last === -1) {
+          last = after.length;
+        }
+        el.source.end.column = all - last;
+      } else {
+        el.source.end.column -= after.length;
+      }
+      this.current.after = after;
+      return this.buffer = after;
+    };
+
+    Parser.prototype.pop = function() {
+      this.current.source.end = {
+        line: this.line,
+        column: this.column
+      };
+      this.popType();
+      this.parents.pop();
+      this.current = this.parents[this.parents.length - 1];
+      return this.buffer = '';
+    };
+
+    Parser.prototype.addType = function(type) {
+      this.types.push(type);
+      return this.type = type;
+    };
+
+    Parser.prototype.setType = function(type) {
+      this.types[this.types.length - 1] = type;
+      return this.type = type;
+    };
+
+    Parser.prototype.popType = function() {
+      this.types.pop();
+      return this.type = this.types[this.types.length - 1];
+    };
+
+    Parser.prototype.atruleType = function() {
+      var name;
+      name = this.current.name.toLowerCase();
+      if (name === 'page' || name === 'font-face' || name.slice(-8) === 'viewport') {
+        return 'decls';
+      } else {
+        return 'rules';
+      }
+    };
+
+    Parser.prototype.endAtruleParams = function() {
+      var type;
+      if (this.letter === '{') {
+        type = this.atruleType();
+        this.current.addMixin(type);
+        this.setType(type);
+        return this.buffer = '';
+      } else {
+        if (this.letter === ';') {
+          this.current.semicolon = true;
+        }
+        return this.pop();
+      }
+    };
+
+    Parser.prototype.checkAtruleName = function() {
+      if (this.current.name === '') {
+        return this.error('At-rule without name');
+      }
+    };
+
+    Parser.prototype.startSpaces = function(string) {
+      var match, pos;
+      match = string.match(/^\s*/);
+      if (match) {
+        pos = match[0].length;
+        return [string.slice(pos), match[0]];
+      } else {
+        return [string, ''];
+      }
+    };
+
+    Parser.prototype.endSpaces = function(string) {
+      var match, pos;
+      match = string.match(/\s*$/);
+      if (match) {
+        pos = match[0].length + 1;
+        return [string.slice(0, +(-pos) + 1 || 9e9), match[0]];
+      } else {
+        return [string, ''];
+      }
+    };
+
+    return Parser;
+
+  })();
+
+  module.exports = function(source, opts) {
+    var parser;
+    if (opts == null) {
+      opts = {};
+    }
+    parser = new Parser(source, opts);
+    parser.loop();
+    return parser.root;
+  };
+
+}).call(this);
+
+},{"./at-rule":3,"./comment":4,"./declaration":6,"./raw":13,"./root":15,"./rule":16,"./syntax-error":17}],12:[function(require,module,exports){
+(function() {
+  var AtRule, Comment, Declaration, PostCSS, Root, Rule, postcss,
+    __slice = [].slice;
+
+  Declaration = require('./declaration');
+
+  Comment = require('./comment');
+
+  AtRule = require('./at-rule');
+
+  Rule = require('./rule');
+
+  Root = require('./root');
+
+  PostCSS = (function() {
+    function PostCSS(processors) {
+      this.processors = processors != null ? processors : [];
+    }
+
+    PostCSS.prototype.use = function(processor) {
+      this.processors.push(processor);
+      return this;
+    };
+
+    PostCSS.prototype.process = function(css, opts) {
+      var parsed, processor, returned, _i, _len, _ref;
+      if (opts == null) {
+        opts = {};
+      }
+      parsed = postcss.parse(css, opts);
+      _ref = this.processors;
+      for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+        processor = _ref[_i];
+        returned = processor(parsed);
+        if (returned instanceof Root) {
+          parsed = returned;
+        }
+      }
+      return parsed.toResult(opts);
+    };
+
+    return PostCSS;
+
+  })();
+
+  postcss = function() {
+    var processors;
+    processors = 1 <= arguments.length ? __slice.call(arguments, 0) : [];
+    return new PostCSS(processors);
+  };
+
+  postcss.parse = require('./parse');
+
+  postcss.comment = function(defaults) {
+    return new Comment(defaults);
+  };
+
+  postcss.atRule = function(defaults) {
+    return new AtRule(defaults);
+  };
+
+  postcss.decl = function(defaults) {
+    return new Declaration(defaults);
+  };
+
+  postcss.rule = function(defaults) {
+    return new Rule(defaults);
+  };
+
+  postcss.root = function(defaults) {
+    return new Root(defaults);
+  };
+
+  module.exports = postcss;
+
+}).call(this);
+
+},{"./at-rule":3,"./comment":4,"./declaration":6,"./parse":11,"./root":15,"./rule":16}],13:[function(require,module,exports){
+(function() {
+  var Raw;
+
+  Raw = (function() {
+    Raw.load = function(value, raw) {
+      if ((raw != null) && value !== raw) {
+        return new Raw(value, raw);
+      } else {
+        return value;
+      }
+    };
+
+    function Raw(value, raw) {
+      this.value = value;
+      this.raw = raw;
+    }
+
+    Raw.prototype.toString = function() {
+      if (this.changed) {
+        return this.value || '';
+      } else {
+        return this.raw || this.value || '';
+      }
+    };
+
+    return Raw;
+
+  })();
+
+  module.exports = Raw;
+
+}).call(this);
+
+},{}],14:[function(require,module,exports){
+(function() {
+  var Result;
+
+  Result = (function() {
+    function Result(css, map) {
+      this.css = css;
+      if (map) {
+        this.map = map;
+      }
+    }
+
+    Result.prototype.toString = function() {
+      return this.css;
+    };
+
+    return Result;
+
+  })();
+
+  module.exports = Result;
+
+}).call(this);
+
+},{}],15:[function(require,module,exports){
+(function() {
+  var AtRule, Comment, Container, Declaration, MapGenerator, Root, Rule,
+    __hasProp = {}.hasOwnProperty,
+    __extends = function(child, parent) { for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } function ctor() { this.constructor = child; } ctor.prototype = parent.prototype; child.prototype = new ctor(); child.__super__ = parent.prototype; return child; };
+
+  MapGenerator = require('./map-generator');
+
+  Declaration = require('./declaration');
+
+  Container = require('./container');
+
+  Comment = require('./comment');
+
+  AtRule = require('./at-rule');
+
+  Rule = require('./rule');
+
+  Root = (function(_super) {
+    __extends(Root, _super);
+
+    function Root() {
+      this.type = 'root';
+      this.rules = [];
+      Root.__super__.constructor.apply(this, arguments);
+    }
+
+    Root.prototype.normalize = function(child, sample, type) {
+      child = Root.__super__.normalize.apply(this, arguments);
+      if (type === 'prepend') {
+        sample.before = this.rules.length > 1 ? this.rules[1].before : this.after;
+      }
+      return child;
+    };
+
+    Root.prototype.stringify = function(builder) {
+      this.stringifyContent(builder);
+      if (this.after) {
+        return builder(this.after);
+      }
+    };
+
+    Root.prototype.toResult = function(opts) {
+      var map;
+      if (opts == null) {
+        opts = {};
+      }
+      map = new MapGenerator(this, opts);
+      return map.getResult();
+    };
+
+    return Root;
+
+  })(Container.WithRules);
+
+  module.exports = Root;
+
+}).call(this);
+
+},{"./at-rule":3,"./comment":4,"./container":5,"./declaration":6,"./map-generator":9,"./rule":16}],16:[function(require,module,exports){
+(function() {
+  var Container, Declaration, Rule, list,
+    __hasProp = {}.hasOwnProperty,
+    __extends = function(child, parent) { for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } function ctor() { this.constructor = child; } ctor.prototype = parent.prototype; child.prototype = new ctor(); child.__super__ = parent.prototype; return child; };
+
+  Container = require('./container');
+
+  Declaration = require('./declaration');
+
+  list = require('./list');
+
+  Rule = (function(_super) {
+    __extends(Rule, _super);
+
+    function Rule() {
+      this.type = 'rule';
+      Rule.__super__.constructor.apply(this, arguments);
+    }
+
+    Rule.prototype.styleType = function() {
+      return this.type + (this.decls.length ? '-body' : '-empty');
+    };
+
+    Rule.prototype.defaultStyle = function(type) {
+      if (type === 'rule-body') {
+        return {
+          between: ' ',
+          after: this.defaultAfter()
+        };
+      } else {
+        return {
+          between: ' ',
+          after: ''
+        };
+      }
+    };
+
+    Rule.raw('selector');
+
+    Rule.prop('selectors', {
+      get: function() {
+        return list.comma(this.selector);
+      },
+      set: function(values) {
+        return this.selector = values.join(', ');
+      }
+    });
+
+    Rule.prototype.stringify = function(builder) {
+      return this.stringifyBlock(builder, this._selector + this.style().between + '{');
+    };
+
+    return Rule;
+
+  })(Container.WithDecls);
+
+  module.exports = Rule;
+
+}).call(this);
+
+},{"./container":5,"./declaration":6,"./list":8}],17:[function(require,module,exports){
+(function() {
+  var SyntaxError,
+    __hasProp = {}.hasOwnProperty,
+    __extends = function(child, parent) { for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } function ctor() { this.constructor = child; } ctor.prototype = parent.prototype; child.prototype = new ctor(); child.__super__ = parent.prototype; return child; };
+
+  SyntaxError = (function(_super) {
+    __extends(SyntaxError, _super);
+
+    function SyntaxError(text, source, pos, file) {
+      this.source = source;
+      this.file = file;
+      this.line = pos.line;
+      this.column = pos.column;
+      this.message = "Can't parse CSS: " + text;
+      this.message += " at line " + pos.line + ":" + pos.column;
+      if (this.file) {
+        this.message += " in " + this.file;
+      }
+    }
+
+    return SyntaxError;
+
+  })(Error);
+
+  module.exports = SyntaxError;
+
+}).call(this);
+
+},{}],18:[function(require,module,exports){
+(function() {
+  var vendor;
+
+  vendor = {
+    prefix: function(prop) {
+      var separator;
+      if (prop[0] === '-') {
+        separator = prop.indexOf('-', 1) + 1;
+        return prop.slice(0, separator);
+      } else {
+        return '';
+      }
+    },
+    unprefixed: function(prop) {
+      var separator;
+      if (prop[0] === '-') {
+        separator = prop.indexOf('-', 1) + 1;
+        return prop.slice(separator);
+      } else {
+        return prop;
+      }
+    }
+  };
+
+  module.exports = vendor;
+
+}).call(this);
+
+},{}],19:[function(require,module,exports){
+var lookup = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/';
+
+;(function (exports) {
+	'use strict';
+
+  var Arr = (typeof Uint8Array !== 'undefined')
+    ? Uint8Array
+    : Array
+
+	var ZERO   = '0'.charCodeAt(0)
+	var PLUS   = '+'.charCodeAt(0)
+	var SLASH  = '/'.charCodeAt(0)
+	var NUMBER = '0'.charCodeAt(0)
+	var LOWER  = 'a'.charCodeAt(0)
+	var UPPER  = 'A'.charCodeAt(0)
+
+	function decode (elt) {
+		var code = elt.charCodeAt(0)
+		if (code === PLUS)
+			return 62 // '+'
+		if (code === SLASH)
+			return 63 // '/'
+		if (code < NUMBER)
+			return -1 //no match
+		if (code < NUMBER + 10)
+			return code - NUMBER + 26 + 26
+		if (code < UPPER + 26)
+			return code - UPPER
+		if (code < LOWER + 26)
+			return code - LOWER + 26
+	}
+
+	function b64ToByteArray (b64) {
+		var i, j, l, tmp, placeHolders, arr
+
+		if (b64.length % 4 > 0) {
+			throw new Error('Invalid string. Length must be a multiple of 4')
+		}
+
+		// the number of equal signs (place holders)
+		// if there are two placeholders, than the two characters before it
+		// represent one byte
+		// if there is only one, then the three characters before it represent 2 bytes
+		// this is just a cheap hack to not do indexOf twice
+		var len = b64.length
+		placeHolders = '=' === b64.charAt(len - 2) ? 2 : '=' === b64.charAt(len - 1) ? 1 : 0
+
+		// base64 is 4/3 + up to two characters of the original data
+		arr = new Arr(b64.length * 3 / 4 - placeHolders)
+
+		// if there are placeholders, only get up to the last complete 4 chars
+		l = placeHolders > 0 ? b64.length - 4 : b64.length
+
+		var L = 0
+
+		function push (v) {
+			arr[L++] = v
+		}
+
+		for (i = 0, j = 0; i < l; i += 4, j += 3) {
+			tmp = (decode(b64.charAt(i)) << 18) | (decode(b64.charAt(i + 1)) << 12) | (decode(b64.charAt(i + 2)) << 6) | decode(b64.charAt(i + 3))
+			push((tmp & 0xFF0000) >> 16)
+			push((tmp & 0xFF00) >> 8)
+			push(tmp & 0xFF)
+		}
+
+		if (placeHolders === 2) {
+			tmp = (decode(b64.charAt(i)) << 2) | (decode(b64.charAt(i + 1)) >> 4)
+			push(tmp & 0xFF)
+		} else if (placeHolders === 1) {
+			tmp = (decode(b64.charAt(i)) << 10) | (decode(b64.charAt(i + 1)) << 4) | (decode(b64.charAt(i + 2)) >> 2)
+			push((tmp >> 8) & 0xFF)
+			push(tmp & 0xFF)
+		}
+
+		return arr
+	}
+
+	function uint8ToBase64 (uint8) {
+		var i,
+			extraBytes = uint8.length % 3, // if we have 1 byte left, pad 2 bytes
+			output = "",
+			temp, length
+
+		function encode (num) {
+			return lookup.charAt(num)
+		}
+
+		function tripletToBase64 (num) {
+			return encode(num >> 18 & 0x3F) + encode(num >> 12 & 0x3F) + encode(num >> 6 & 0x3F) + encode(num & 0x3F)
+		}
+
+		// go through the array every three bytes, we'll deal with trailing stuff later
+		for (i = 0, length = uint8.length - extraBytes; i < length; i += 3) {
+			temp = (uint8[i] << 16) + (uint8[i + 1] << 8) + (uint8[i + 2])
+			output += tripletToBase64(temp)
+		}
+
+		// pad the end with zeros, but make sure to not forget the extra bytes
+		switch (extraBytes) {
+			case 1:
+				temp = uint8[uint8.length - 1]
+				output += encode(temp >> 2)
+				output += encode((temp << 4) & 0x3F)
+				output += '=='
+				break
+			case 2:
+				temp = (uint8[uint8.length - 2] << 8) + (uint8[uint8.length - 1])
+				output += encode(temp >> 10)
+				output += encode((temp >> 4) & 0x3F)
+				output += encode((temp << 2) & 0x3F)
+				output += '='
+				break
+		}
+
+		return output
+	}
+
+	module.exports.toByteArray = b64ToByteArray
+	module.exports.fromByteArray = uint8ToBase64
+}())
+
+},{}],20:[function(require,module,exports){
+/*
+ * Copyright 2009-2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE.txt or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+exports.SourceMapGenerator = require('./source-map/source-map-generator').SourceMapGenerator;
+exports.SourceMapConsumer = require('./source-map/source-map-consumer').SourceMapConsumer;
+exports.SourceNode = require('./source-map/source-node').SourceNode;
+
+},{"./source-map/source-map-consumer":25,"./source-map/source-map-generator":26,"./source-map/source-node":27}],21:[function(require,module,exports){
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+if (typeof define !== 'function') {
+    var define = require('amdefine')(module, require);
+}
+define(function (require, exports, module) {
+
+  var util = require('./util');
+
+  /**
+   * A data structure which is a combination of an array and a set. Adding a new
+   * member is O(1), testing for membership is O(1), and finding the index of an
+   * element is O(1). Removing elements from the set is not supported. Only
+   * strings are supported for membership.
+   */
+  function ArraySet() {
+    this._array = [];
+    this._set = {};
+  }
+
+  /**
+   * Static method for creating ArraySet instances from an existing array.
+   */
+  ArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) {
+    var set = new ArraySet();
+    for (var i = 0, len = aArray.length; i < len; i++) {
+      set.add(aArray[i], aAllowDuplicates);
+    }
+    return set;
+  };
+
+  /**
+   * Add the given string to this set.
+   *
+   * @param String aStr
+   */
+  ArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) {
+    var isDuplicate = this.has(aStr);
+    var idx = this._array.length;
+    if (!isDuplicate || aAllowDuplicates) {
+      this._array.push(aStr);
+    }
+    if (!isDuplicate) {
+      this._set[util.toSetString(aStr)] = idx;
+    }
+  };
+
+  /**
+   * Is the given string a member of this set?
+   *
+   * @param String aStr
+   */
+  ArraySet.prototype.has = function ArraySet_has(aStr) {
+    return Object.prototype.hasOwnProperty.call(this._set,
+                                                util.toSetString(aStr));
+  };
+
+  /**
+   * What is the index of the given string in the array?
+   *
+   * @param String aStr
+   */
+  ArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) {
+    if (this.has(aStr)) {
+      return this._set[util.toSetString(aStr)];
+    }
+    throw new Error('"' + aStr + '" is not in the set.');
+  };
+
+  /**
+   * What is the element at the given index?
+   *
+   * @param Number aIdx
+   */
+  ArraySet.prototype.at = function ArraySet_at(aIdx) {
+    if (aIdx >= 0 && aIdx < this._array.length) {
+      return this._array[aIdx];
+    }
+    throw new Error('No element indexed by ' + aIdx);
+  };
+
+  /**
+   * Returns the array representation of this set (which has the proper indices
+   * indicated by indexOf). Note that this is a copy of the internal array used
+   * for storing the members so that no one can mess with internal state.
+   */
+  ArraySet.prototype.toArray = function ArraySet_toArray() {
+    return this._array.slice();
+  };
+
+  exports.ArraySet = ArraySet;
+
+});
+
+},{"./util":28,"amdefine":29}],22:[function(require,module,exports){
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ *
+ * Based on the Base 64 VLQ implementation in Closure Compiler:
+ * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java
+ *
+ * Copyright 2011 The Closure Compiler Authors. All rights reserved.
+ * Redistribution and use in source and binary forms, with or without
+ * modification, are permitted provided that the following conditions are
+ * met:
+ *
+ *  * Redistributions of source code must retain the above copyright
+ *    notice, this list of conditions and the following disclaimer.
+ *  * Redistributions in binary form must reproduce the above
+ *    copyright notice, this list of conditions and the following
+ *    disclaimer in the documentation and/or other materials provided
+ *    with the distribution.
+ *  * Neither the name of Google Inc. nor the names of its
+ *    contributors may be used to endorse or promote products derived
+ *    from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+ * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+ * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+ * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
+ * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+ * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
+ * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+ * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+ * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+ * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+ * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+ */
+if (typeof define !== 'function') {
+    var define = require('amdefine')(module, require);
+}
+define(function (require, exports, module) {
+
+  var base64 = require('./base64');
+
+  // A single base 64 digit can contain 6 bits of data. For the base 64 variable
+  // length quantities we use in the source map spec, the first bit is the sign,
+  // the next four bits are the actual value, and the 6th bit is the
+  // continuation bit. The continuation bit tells us whether there are more
+  // digits in this value following this digit.
+  //
+  //   Continuation
+  //   |    Sign
+  //   |    |
+  //   V    V
+  //   101011
+
+  var VLQ_BASE_SHIFT = 5;
+
+  // binary: 100000
+  var VLQ_BASE = 1 << VLQ_BASE_SHIFT;
+
+  // binary: 011111
+  var VLQ_BASE_MASK = VLQ_BASE - 1;
+
+  // binary: 100000
+  var VLQ_CONTINUATION_BIT = VLQ_BASE;
+
+  /**
+   * Converts from a two-complement value to a value where the sign bit is
+   * is placed in the least significant bit.  For example, as decimals:
+   *   1 becomes 2 (10 binary), -1 becomes 3 (11 binary)
+   *   2 becomes 4 (100 binary), -2 becomes 5 (101 binary)
+   */
+  function toVLQSigned(aValue) {
+    return aValue < 0
+      ? ((-aValue) << 1) + 1
+      : (aValue << 1) + 0;
+  }
+
+  /**
+   * Converts to a two-complement value from a value where the sign bit is
+   * is placed in the least significant bit.  For example, as decimals:
+   *   2 (10 binary) becomes 1, 3 (11 binary) becomes -1
+   *   4 (100 binary) becomes 2, 5 (101 binary) becomes -2
+   */
+  function fromVLQSigned(aValue) {
+    var isNegative = (aValue & 1) === 1;
+    var shifted = aValue >> 1;
+    return isNegative
+      ? -shifted
+      : shifted;
+  }
+
+  /**
+   * Returns the base 64 VLQ encoded value.
+   */
+  exports.encode = function base64VLQ_encode(aValue) {
+    var encoded = "";
+    var digit;
+
+    var vlq = toVLQSigned(aValue);
+
+    do {
+      digit = vlq & VLQ_BASE_MASK;
+      vlq >>>= VLQ_BASE_SHIFT;
+      if (vlq > 0) {
+        // There are still more digits in this value, so we must make sure the
+        // continuation bit is marked.
+        digit |= VLQ_CONTINUATION_BIT;
+      }
+      encoded += base64.encode(digit);
+    } while (vlq > 0);
+
+    return encoded;
+  };
+
+  /**
+   * Decodes the next base 64 VLQ value from the given string and returns the
+   * value and the rest of the string.
+   */
+  exports.decode = function base64VLQ_decode(aStr) {
+    var i = 0;
+    var strLen = aStr.length;
+    var result = 0;
+    var shift = 0;
+    var continuation, digit;
+
+    do {
+      if (i >= strLen) {
+        throw new Error("Expected more digits in base 64 VLQ value.");
+      }
+      digit = base64.decode(aStr.charAt(i++));
+      continuation = !!(digit & VLQ_CONTINUATION_BIT);
+      digit &= VLQ_BASE_MASK;
+      result = result + (digit << shift);
+      shift += VLQ_BASE_SHIFT;
+    } while (continuation);
+
+    return {
+      value: fromVLQSigned(result),
+      rest: aStr.slice(i)
+    };
+  };
+
+});
+
+},{"./base64":23,"amdefine":29}],23:[function(require,module,exports){
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+if (typeof define !== 'function') {
+    var define = require('amdefine')(module, require);
+}
+define(function (require, exports, module) {
+
+  var charToIntMap = {};
+  var intToCharMap = {};
+
+  'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'
+    .split('')
+    .forEach(function (ch, index) {
+      charToIntMap[ch] = index;
+      intToCharMap[index] = ch;
+    });
+
+  /**
+   * Encode an integer in the range of 0 to 63 to a single base 64 digit.
+   */
+  exports.encode = function base64_encode(aNumber) {
+    if (aNumber in intToCharMap) {
+      return intToCharMap[aNumber];
+    }
+    throw new TypeError("Must be between 0 and 63: " + aNumber);
+  };
+
+  /**
+   * Decode a single base 64 digit to an integer.
+   */
+  exports.decode = function base64_decode(aChar) {
+    if (aChar in charToIntMap) {
+      return charToIntMap[aChar];
+    }
+    throw new TypeError("Not a valid base 64 digit: " + aChar);
+  };
+
+});
+
+},{"amdefine":29}],24:[function(require,module,exports){
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+if (typeof define !== 'function') {
+    var define = require('amdefine')(module, require);
+}
+define(function (require, exports, module) {
+
+  /**
+   * Recursive implementation of binary search.
+   *
+   * @param aLow Indices here and lower do not contain the needle.
+   * @param aHigh Indices here and higher do not contain the needle.
+   * @param aNeedle The element being searched for.
+   * @param aHaystack The non-empty array being searched.
+   * @param aCompare Function which takes two elements and returns -1, 0, or 1.
+   */
+  function recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare) {
+    // This function terminates when one of the following is true:
+    //
+    //   1. We find the exact element we are looking for.
+    //
+    //   2. We did not find the exact element, but we can return the next
+    //      closest element that is less than that element.
+    //
+    //   3. We did not find the exact element, and there is no next-closest
+    //      element which is less than the one we are searching for, so we
+    //      return null.
+    var mid = Math.floor((aHigh - aLow) / 2) + aLow;
+    var cmp = aCompare(aNeedle, aHaystack[mid], true);
+    if (cmp === 0) {
+      // Found the element we are looking for.
+      return aHaystack[mid];
+    }
+    else if (cmp > 0) {
+      // aHaystack[mid] is greater than our needle.
+      if (aHigh - mid > 1) {
+        // The element is in the upper half.
+        return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare);
+      }
+      // We did not find an exact match, return the next closest one
+      // (termination case 2).
+      return aHaystack[mid];
+    }
+    else {
+      // aHaystack[mid] is less than our needle.
+      if (mid - aLow > 1) {
+        // The element is in the lower half.
+        return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare);
+      }
+      // The exact needle element was not found in this haystack. Determine if
+      // we are in termination case (2) or (3) and return the appropriate thing.
+      return aLow < 0
+        ? null
+        : aHaystack[aLow];
+    }
+  }
+
+  /**
+   * This is an implementation of binary search which will always try and return
+   * the next lowest value checked if there is no exact hit. This is because
+   * mappings between original and generated line/col pairs are single points,
+   * and there is an implicit region between each of them, so a miss just means
+   * that you aren't on the very start of a region.
+   *
+   * @param aNeedle The element you are looking for.
+   * @param aHaystack The array that is being searched.
+   * @param aCompare A function which takes the needle and an element in the
+   *     array and returns -1, 0, or 1 depending on whether the needle is less
+   *     than, equal to, or greater than the element, respectively.
+   */
+  exports.search = function search(aNeedle, aHaystack, aCompare) {
+    return aHaystack.length > 0
+      ? recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack, aCompare)
+      : null;
+  };
+
+});
+
+},{"amdefine":29}],25:[function(require,module,exports){
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+if (typeof define !== 'function') {
+    var define = require('amdefine')(module, require);
+}
+define(function (require, exports, module) {
+
+  var util = require('./util');
+  var binarySearch = require('./binary-search');
+  var ArraySet = require('./array-set').ArraySet;
+  var base64VLQ = require('./base64-vlq');
+
+  /**
+   * A SourceMapConsumer instance represents a parsed source map which we can
+   * query for information about the original file positions by giving it a file
+   * position in the generated source.
+   *
+   * The only parameter is the raw source map (either as a JSON string, or
+   * already parsed to an object). According to the spec, source maps have the
+   * following attributes:
+   *
+   *   - version: Which version of the source map spec this map is following.
+   *   - sources: An array of URLs to the original source files.
+   *   - names: An array of identifiers which can be referrenced by individual mappings.
+   *   - sourceRoot: Optional. The URL root from which all sources are relative.
+   *   - sourcesContent: Optional. An array of contents of the original source files.
+   *   - mappings: A string of base64 VLQs which contain the actual mappings.
+   *   - file: Optional. The generated file this source map is associated with.
+   *
+   * Here is an example source map, taken from the source map spec[0]:
+   *
+   *     {
+   *       version : 3,
+   *       file: "out.js",
+   *       sourceRoot : "",
+   *       sources: ["foo.js", "bar.js"],
+   *       names: ["src", "maps", "are", "fun"],
+   *       mappings: "AA,AB;;ABCDE;"
+   *     }
+   *
+   * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1#
+   */
+  function SourceMapConsumer(aSourceMap) {
+    var sourceMap = aSourceMap;
+    if (typeof aSourceMap === 'string') {
+      sourceMap = JSON.parse(aSourceMap.replace(/^\)\]\}'/, ''));
+    }
+
+    var version = util.getArg(sourceMap, 'version');
+    var sources = util.getArg(sourceMap, 'sources');
+    // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which
+    // requires the array) to play nice here.
+    var names = util.getArg(sourceMap, 'names', []);
+    var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null);
+    var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null);
+    var mappings = util.getArg(sourceMap, 'mappings');
+    var file = util.getArg(sourceMap, 'file', null);
+
+    // Once again, Sass deviates from the spec and supplies the version as a
+    // string rather than a number, so we use loose equality checking here.
+    if (version != this._version) {
+      throw new Error('Unsupported version: ' + version);
+    }
+
+    // Pass `true` below to allow duplicate names and sources. While source maps
+    // are intended to be compressed and deduplicated, the TypeScript compiler
+    // sometimes generates source maps with duplicates in them. See Github issue
+    // #72 and bugzil.la/889492.
+    this._names = ArraySet.fromArray(names, true);
+    this._sources = ArraySet.fromArray(sources, true);
+
+    this.sourceRoot = sourceRoot;
+    this.sourcesContent = sourcesContent;
+    this._mappings = mappings;
+    this.file = file;
+  }
+
+  /**
+   * Create a SourceMapConsumer from a SourceMapGenerator.
+   *
+   * @param SourceMapGenerator aSourceMap
+   *        The source map that will be consumed.
+   * @returns SourceMapConsumer
+   */
+  SourceMapConsumer.fromSourceMap =
+    function SourceMapConsumer_fromSourceMap(aSourceMap) {
+      var smc = Object.create(SourceMapConsumer.prototype);
+
+      smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true);
+      smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true);
+      smc.sourceRoot = aSourceMap._sourceRoot;
+      smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(),
+                                                              smc.sourceRoot);
+      smc.file = aSourceMap._file;
+
+      smc.__generatedMappings = aSourceMap._mappings.slice()
+        .sort(util.compareByGeneratedPositions);
+      smc.__originalMappings = aSourceMap._mappings.slice()
+        .sort(util.compareByOriginalPositions);
+
+      return smc;
+    };
+
+  /**
+   * The version of the source mapping spec that we are consuming.
+   */
+  SourceMapConsumer.prototype._version = 3;
+
+  /**
+   * The list of original sources.
+   */
+  Object.defineProperty(SourceMapConsumer.prototype, 'sources', {
+    get: function () {
+      return this._sources.toArray().map(function (s) {
+        return this.sourceRoot ? util.join(this.sourceRoot, s) : s;
+      }, this);
+    }
+  });
+
+  // `__generatedMappings` and `__originalMappings` are arrays that hold the
+  // parsed mapping coordinates from the source map's "mappings" attribute. They
+  // are lazily instantiated, accessed via the `_generatedMappings` and
+  // `_originalMappings` getters respectively, and we only parse the mappings
+  // and create these arrays once queried for a source location. We jump through
+  // these hoops because there can be many thousands of mappings, and parsing
+  // them is expensive, so we only want to do it if we must.
+  //
+  // Each object in the arrays is of the form:
+  //
+  //     {
+  //       generatedLine: The line number in the generated code,
+  //       generatedColumn: The column number in the generated code,
+  //       source: The path to the original source file that generated this
+  //               chunk of code,
+  //       originalLine: The line number in the original source that
+  //                     corresponds to this chunk of generated code,
+  //       originalColumn: The column number in the original source that
+  //                       corresponds to this chunk of generated code,
+  //       name: The name of the original symbol which generated this chunk of
+  //             code.
+  //     }
+  //
+  // All properties except for `generatedLine` and `generatedColumn` can be
+  // `null`.
+  //
+  // `_generatedMappings` is ordered by the generated positions.
+  //
+  // `_originalMappings` is ordered by the original positions.
+
+  SourceMapConsumer.prototype.__generatedMappings = null;
+  Object.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', {
+    get: function () {
+      if (!this.__generatedMappings) {
+        this.__generatedMappings = [];
+        this.__originalMappings = [];
+        this._parseMappings(this._mappings, this.sourceRoot);
+      }
+
+      return this.__generatedMappings;
+    }
+  });
+
+  SourceMapConsumer.prototype.__originalMappings = null;
+  Object.defineProperty(SourceMapConsumer.prototype, '_originalMappings', {
+    get: function () {
+      if (!this.__originalMappings) {
+        this.__generatedMappings = [];
+        this.__originalMappings = [];
+        this._parseMappings(this._mappings, this.sourceRoot);
+      }
+
+      return this.__originalMappings;
+    }
+  });
+
+  /**
+   * Parse the mappings in a string in to a data structure which we can easily
+   * query (the ordered arrays in the `this.__generatedMappings` and
+   * `this.__originalMappings` properties).
+   */
+  SourceMapConsumer.prototype._parseMappings =
+    function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {
+      var generatedLine = 1;
+      var previousGeneratedColumn = 0;
+      var previousOriginalLine = 0;
+      var previousOriginalColumn = 0;
+      var previousSource = 0;
+      var previousName = 0;
+      var mappingSeparator = /^[,;]/;
+      var str = aStr;
+      var mapping;
+      var temp;
+
+      while (str.length > 0) {
+        if (str.charAt(0) === ';') {
+          generatedLine++;
+          str = str.slice(1);
+          previousGeneratedColumn = 0;
+        }
+        else if (str.charAt(0) === ',') {
+          str = str.slice(1);
+        }
+        else {
+          mapping = {};
+          mapping.generatedLine = generatedLine;
+
+          // Generated column.
+          temp = base64VLQ.decode(str);
+          mapping.generatedColumn = previousGeneratedColumn + temp.value;
+          previousGeneratedColumn = mapping.generatedColumn;
+          str = temp.rest;
+
+          if (str.length > 0 && !mappingSeparator.test(str.charAt(0))) {
+            // Original source.
+            temp = base64VLQ.decode(str);
+            mapping.source = this._sources.at(previousSource + temp.value);
+            previousSource += temp.value;
+            str = temp.rest;
+            if (str.length === 0 || mappingSeparator.test(str.charAt(0))) {
+              throw new Error('Found a source, but no line and column');
+            }
+
+            // Original line.
+            temp = base64VLQ.decode(str);
+            mapping.originalLine = previousOriginalLine + temp.value;
+            previousOriginalLine = mapping.originalLine;
+            // Lines are stored 0-based
+            mapping.originalLine += 1;
+            str = temp.rest;
+            if (str.length === 0 || mappingSeparator.test(str.charAt(0))) {
+              throw new Error('Found a source and line, but no column');
+            }
+
+            // Original column.
+            temp = base64VLQ.decode(str);
+            mapping.originalColumn = previousOriginalColumn + temp.value;
+            previousOriginalColumn = mapping.originalColumn;
+            str = temp.rest;
+
+            if (str.length > 0 && !mappingSeparator.test(str.charAt(0))) {
+              // Original name.
+              temp = base64VLQ.decode(str);
+              mapping.name = this._names.at(previousName + temp.value);
+              previousName += temp.value;
+              str = temp.rest;
+            }
+          }
+
+          this.__generatedMappings.push(mapping);
+          if (typeof mapping.originalLine === 'number') {
+            this.__originalMappings.push(mapping);
+          }
+        }
+      }
+
+      this.__generatedMappings.sort(util.compareByGeneratedPositions);
+      this.__originalMappings.sort(util.compareByOriginalPositions);
+    };
+
+  /**
+   * Find the mapping that best matches the hypothetical "needle" mapping that
+   * we are searching for in the given "haystack" of mappings.
+   */
+  SourceMapConsumer.prototype._findMapping =
+    function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName,
+                                           aColumnName, aComparator) {
+      // To return the position we are searching for, we must first find the
+      // mapping for the given position and then return the opposite position it
+      // points to. Because the mappings are sorted, we can use binary search to
+      // find the best mapping.
+
+      if (aNeedle[aLineName] <= 0) {
+        throw new TypeError('Line must be greater than or equal to 1, got '
+                            + aNeedle[aLineName]);
+      }
+      if (aNeedle[aColumnName] < 0) {
+        throw new TypeError('Column must be greater than or equal to 0, got '
+                            + aNeedle[aColumnName]);
+      }
+
+      return binarySearch.search(aNeedle, aMappings, aComparator);
+    };
+
+  /**
+   * Returns the original source, line, and column information for the generated
+   * source's line and column positions provided. The only argument is an object
+   * with the following properties:
+   *
+   *   - line: The line number in the generated source.
+   *   - column: The column number in the generated source.
+   *
+   * and an object is returned with the following properties:
+   *
+   *   - source: The original source file, or null.
+   *   - line: The line number in the original source, or null.
+   *   - column: The column number in the original source, or null.
+   *   - name: The original identifier, or null.
+   */
+  SourceMapConsumer.prototype.originalPositionFor =
+    function SourceMapConsumer_originalPositionFor(aArgs) {
+      var needle = {
+        generatedLine: util.getArg(aArgs, 'line'),
+        generatedColumn: util.getArg(aArgs, 'column')
+      };
+
+      var mapping = this._findMapping(needle,
+                                      this._generatedMappings,
+                                      "generatedLine",
+                                      "generatedColumn",
+                                      util.compareByGeneratedPositions);
+
+      if (mapping && mapping.generatedLine === needle.generatedLine) {
+        var source = util.getArg(mapping, 'source', null);
+        if (source && this.sourceRoot) {
+          source = util.join(this.sourceRoot, source);
+        }
+        return {
+          source: source,
+          line: util.getArg(mapping, 'originalLine', null),
+          column: util.getArg(mapping, 'originalColumn', null),
+          name: util.getArg(mapping, 'name', null)
+        };
+      }
+
+      return {
+        source: null,
+        line: null,
+        column: null,
+        name: null
+      };
+    };
+
+  /**
+   * Returns the original source content. The only argument is the url of the
+   * original source file. Returns null if no original source content is
+   * availible.
+   */
+  SourceMapConsumer.prototype.sourceContentFor =
+    function SourceMapConsumer_sourceContentFor(aSource) {
+      if (!this.sourcesContent) {
+        return null;
+      }
+
+      if (this.sourceRoot) {
+        aSource = util.relative(this.sourceRoot, aSource);
+      }
+
+      if (this._sources.has(aSource)) {
+        return this.sourcesContent[this._sources.indexOf(aSource)];
+      }
+
+      var url;
+      if (this.sourceRoot
+          && (url = util.urlParse(this.sourceRoot))) {
+        // XXX: file:// URIs and absolute paths lead to unexpected behavior for
+        // many users. We can help them out when they expect file:// URIs to
+        // behave like it would if they were running a local HTTP server. See
+        // https://bugzilla.mozilla.org/show_bug.cgi?id=885597.
+        var fileUriAbsPath = aSource.replace(/^file:\/\//, "");
+        if (url.scheme == "file"
+            && this._sources.has(fileUriAbsPath)) {
+          return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)]
+        }
+
+        if ((!url.path || url.path == "/")
+            && this._sources.has("/" + aSource)) {
+          return this.sourcesContent[this._sources.indexOf("/" + aSource)];
+        }
+      }
+
+      throw new Error('"' + aSource + '" is not in the SourceMap.');
+    };
+
+  /**
+   * Returns the generated line and column information for the original source,
+   * line, and column positions provided. The only argument is an object with
+   * the following properties:
+   *
+   *   - source: The filename of the original source.
+   *   - line: The line number in the original source.
+   *   - column: The column number in the original source.
+   *
+   * and an object is returned with the following properties:
+   *
+   *   - line: The line number in the generated source, or null.
+   *   - column: The column number in the generated source, or null.
+   */
+  SourceMapConsumer.prototype.generatedPositionFor =
+    function SourceMapConsumer_generatedPositionFor(aArgs) {
+      var needle = {
+        source: util.getArg(aArgs, 'source'),
+        originalLine: util.getArg(aArgs, 'line'),
+        originalColumn: util.getArg(aArgs, 'column')
+      };
+
+      if (this.sourceRoot) {
+        needle.source = util.relative(this.sourceRoot, needle.source);
+      }
+
+      var mapping = this._findMapping(needle,
+                                      this._originalMappings,
+                                      "originalLine",
+                                      "originalColumn",
+                                      util.compareByOriginalPositions);
+
+      if (mapping) {
+        return {
+          line: util.getArg(mapping, 'generatedLine', null),
+          column: util.getArg(mapping, 'generatedColumn', null)
+        };
+      }
+
+      return {
+        line: null,
+        column: null
+      };
+    };
+
+  SourceMapConsumer.GENERATED_ORDER = 1;
+  SourceMapConsumer.ORIGINAL_ORDER = 2;
+
+  /**
+   * Iterate over each mapping between an original source/line/column and a
+   * generated line/column in this source map.
+   *
+   * @param Function aCallback
+   *        The function that is called with each mapping.
+   * @param Object aContext
+   *        Optional. If specified, this object will be the value of `this` every
+   *        time that `aCallback` is called.
+   * @param aOrder
+   *        Either `SourceMapConsumer.GENERATED_ORDER` or
+   *        `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to
+   *        iterate over the mappings sorted by the generated file's line/column
+   *        order or the original's source/line/column order, respectively. Defaults to
+   *        `SourceMapConsumer.GENERATED_ORDER`.
+   */
+  SourceMapConsumer.prototype.eachMapping =
+    function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) {
+      var context = aContext || null;
+      var order = aOrder || SourceMapConsumer.GENERATED_ORDER;
+
+      var mappings;
+      switch (order) {
+      case SourceMapConsumer.GENERATED_ORDER:
+        mappings = this._generatedMappings;
+        break;
+      case SourceMapConsumer.ORIGINAL_ORDER:
+        mappings = this._originalMappings;
+        break;
+      default:
+        throw new Error("Unknown order of iteration.");
+      }
+
+      var sourceRoot = this.sourceRoot;
+      mappings.map(function (mapping) {
+        var source = mapping.source;
+        if (source && sourceRoot) {
+          source = util.join(sourceRoot, source);
+        }
+        return {
+          source: source,
+          generatedLine: mapping.generatedLine,
+          generatedColumn: mapping.generatedColumn,
+          originalLine: mapping.originalLine,
+          originalColumn: mapping.originalColumn,
+          name: mapping.name
+        };
+      }).forEach(aCallback, context);
+    };
+
+  exports.SourceMapConsumer = SourceMapConsumer;
+
+});
+
+},{"./array-set":21,"./base64-vlq":22,"./binary-search":24,"./util":28,"amdefine":29}],26:[function(require,module,exports){
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+if (typeof define !== 'function') {
+    var define = require('amdefine')(module, require);
+}
+define(function (require, exports, module) {
+
+  var base64VLQ = require('./base64-vlq');
+  var util = require('./util');
+  var ArraySet = require('./array-set').ArraySet;
+
+  /**
+   * An instance of the SourceMapGenerator represents a source map which is
+   * being built incrementally. You may pass an object with the following
+   * properties:
+   *
+   *   - file: The filename of the generated source.
+   *   - sourceRoot: A root for all relative URLs in this source map.
+   */
+  function SourceMapGenerator(aArgs) {
+    if (!aArgs) {
+      aArgs = {};
+    }
+    this._file = util.getArg(aArgs, 'file', null);
+    this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null);
+    this._sources = new ArraySet();
+    this._names = new ArraySet();
+    this._mappings = [];
+    this._sourcesContents = null;
+  }
+
+  SourceMapGenerator.prototype._version = 3;
+
+  /**
+   * Creates a new SourceMapGenerator based on a SourceMapConsumer
+   *
+   * @param aSourceMapConsumer The SourceMap.
+   */
+  SourceMapGenerator.fromSourceMap =
+    function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) {
+      var sourceRoot = aSourceMapConsumer.sourceRoot;
+      var generator = new SourceMapGenerator({
+        file: aSourceMapConsumer.file,
+        sourceRoot: sourceRoot
+      });
+      aSourceMapConsumer.eachMapping(function (mapping) {
+        var newMapping = {
+          generated: {
+            line: mapping.generatedLine,
+            column: mapping.generatedColumn
+          }
+        };
+
+        if (mapping.source) {
+          newMapping.source = mapping.source;
+          if (sourceRoot) {
+            newMapping.source = util.relative(sourceRoot, newMapping.source);
+          }
+
+          newMapping.original = {
+            line: mapping.originalLine,
+            column: mapping.originalColumn
+          };
+
+          if (mapping.name) {
+            newMapping.name = mapping.name;
+          }
+        }
+
+        generator.addMapping(newMapping);
+      });
+      aSourceMapConsumer.sources.forEach(function (sourceFile) {
+        var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+        if (content) {
+          generator.setSourceContent(sourceFile, content);
+        }
+      });
+      return generator;
+    };
+
+  /**
+   * Add a single mapping from original source line and column to the generated
+   * source's line and column for this source map being created. The mapping
+   * object should have the following properties:
+   *
+   *   - generated: An object with the generated line and column positions.
+   *   - original: An object with the original line and column positions.
+   *   - source: The original source file (relative to the sourceRoot).
+   *   - name: An optional original token name for this mapping.
+   */
+  SourceMapGenerator.prototype.addMapping =
+    function SourceMapGenerator_addMapping(aArgs) {
+      var generated = util.getArg(aArgs, 'generated');
+      var original = util.getArg(aArgs, 'original', null);
+      var source = util.getArg(aArgs, 'source', null);
+      var name = util.getArg(aArgs, 'name', null);
+
+      this._validateMapping(generated, original, source, name);
+
+      if (source && !this._sources.has(source)) {
+        this._sources.add(source);
+      }
+
+      if (name && !this._names.has(name)) {
+        this._names.add(name);
+      }
+
+      this._mappings.push({
+        generatedLine: generated.line,
+        generatedColumn: generated.column,
+        originalLine: original != null && original.line,
+        originalColumn: original != null && original.column,
+        source: source,
+        name: name
+      });
+    };
+
+  /**
+   * Set the source content for a source file.
+   */
+  SourceMapGenerator.prototype.setSourceContent =
+    function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) {
+      var source = aSourceFile;
+      if (this._sourceRoot) {
+        source = util.relative(this._sourceRoot, source);
+      }
+
+      if (aSourceContent !== null) {
+        // Add the source content to the _sourcesContents map.
+        // Create a new _sourcesContents map if the property is null.
+        if (!this._sourcesContents) {
+          this._sourcesContents = {};
+        }
+        this._sourcesContents[util.toSetString(source)] = aSourceContent;
+      } else {
+        // Remove the source file from the _sourcesContents map.
+        // If the _sourcesContents map is empty, set the property to null.
+        delete this._sourcesContents[util.toSetString(source)];
+        if (Object.keys(this._sourcesContents).length === 0) {
+          this._sourcesContents = null;
+        }
+      }
+    };
+
+  /**
+   * Applies the mappings of a sub-source-map for a specific source file to the
+   * source map being generated. Each mapping to the supplied source file is
+   * rewritten using the supplied source map. Note: The resolution for the
+   * resulting mappings is the minimium of this map and the supplied map.
+   *
+   * @param aSourceMapConsumer The source map to be applied.
+   * @param aSourceFile Optional. The filename of the source file.
+   *        If omitted, SourceMapConsumer's file property will be used.
+   * @param aSourceMapPath Optional. The dirname of the path to the source map
+   *        to be applied. If relative, it is relative to the SourceMapConsumer.
+   *        This parameter is needed when the two source maps aren't in the same
+   *        directory, and the source map to be applied contains relative source
+   *        paths. If so, those relative source paths need to be rewritten
+   *        relative to the SourceMapGenerator.
+   */
+  SourceMapGenerator.prototype.applySourceMap =
+    function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) {
+      // If aSourceFile is omitted, we will use the file property of the SourceMap
+      if (!aSourceFile) {
+        if (!aSourceMapConsumer.file) {
+          throw new Error(
+            'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' +
+            'or the source map\'s "file" property. Both were omitted.'
+          );
+        }
+        aSourceFile = aSourceMapConsumer.file;
+      }
+      var sourceRoot = this._sourceRoot;
+      // Make "aSourceFile" relative if an absolute Url is passed.
+      if (sourceRoot) {
+        aSourceFile = util.relative(sourceRoot, aSourceFile);
+      }
+      // Applying the SourceMap can add and remove items from the sources and
+      // the names array.
+      var newSources = new ArraySet();
+      var newNames = new ArraySet();
+
+      // Find mappings for the "aSourceFile"
+      this._mappings.forEach(function (mapping) {
+        if (mapping.source === aSourceFile && mapping.originalLine) {
+          // Check if it can be mapped by the source map, then update the mapping.
+          var original = aSourceMapConsumer.originalPositionFor({
+            line: mapping.originalLine,
+            column: mapping.originalColumn
+          });
+          if (original.source !== null) {
+            // Copy mapping
+            mapping.source = original.source;
+            if (aSourceMapPath) {
+              mapping.source = util.join(aSourceMapPath, mapping.source)
+            }
+            if (sourceRoot) {
+              mapping.source = util.relative(sourceRoot, mapping.source);
+            }
+            mapping.originalLine = original.line;
+            mapping.originalColumn = original.column;
+            if (original.name !== null && mapping.name !== null) {
+              // Only use the identifier name if it's an identifier
+              // in both SourceMaps
+              mapping.name = original.name;
+            }
+          }
+        }
+
+        var source = mapping.source;
+        if (source && !newSources.has(source)) {
+          newSources.add(source);
+        }
+
+        var name = mapping.name;
+        if (name && !newNames.has(name)) {
+          newNames.add(name);
+        }
+
+      }, this);
+      this._sources = newSources;
+      this._names = newNames;
+
+      // Copy sourcesContents of applied map.
+      aSourceMapConsumer.sources.forEach(function (sourceFile) {
+        var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+        if (content) {
+          if (sourceRoot) {
+            sourceFile = util.relative(sourceRoot, sourceFile);
+          }
+          this.setSourceContent(sourceFile, content);
+        }
+      }, this);
+    };
+
+  /**
+   * A mapping can have one of the three levels of data:
+   *
+   *   1. Just the generated position.
+   *   2. The Generated position, original position, and original source.
+   *   3. Generated and original position, original source, as well as a name
+   *      token.
+   *
+   * To maintain consistency, we validate that any new mapping being added falls
+   * in to one of these categories.
+   */
+  SourceMapGenerator.prototype._validateMapping =
+    function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource,
+                                                aName) {
+      if (aGenerated && 'line' in aGenerated && 'column' in aGenerated
+          && aGenerated.line > 0 && aGenerated.column >= 0
+          && !aOriginal && !aSource && !aName) {
+        // Case 1.
+        return;
+      }
+      else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated
+               && aOriginal && 'line' in aOriginal && 'column' in aOriginal
+               && aGenerated.line > 0 && aGenerated.column >= 0
+               && aOriginal.line > 0 && aOriginal.column >= 0
+               && aSource) {
+        // Cases 2 and 3.
+        return;
+      }
+      else {
+        throw new Error('Invalid mapping: ' + JSON.stringify({
+          generated: aGenerated,
+          source: aSource,
+          original: aOriginal,
+          name: aName
+        }));
+      }
+    };
+
+  /**
+   * Serialize the accumulated mappings in to the stream of base 64 VLQs
+   * specified by the source map format.
+   */
+  SourceMapGenerator.prototype._serializeMappings =
+    function SourceMapGenerator_serializeMappings() {
+      var previousGeneratedColumn = 0;
+      var previousGeneratedLine = 1;
+      var previousOriginalColumn = 0;
+      var previousOriginalLine = 0;
+      var previousName = 0;
+      var previousSource = 0;
+      var result = '';
+      var mapping;
+
+      // The mappings must be guaranteed to be in sorted order before we start
+      // serializing them or else the generated line numbers (which are defined
+      // via the ';' separators) will be all messed up. Note: it might be more
+      // performant to maintain the sorting as we insert them, rather than as we
+      // serialize them, but the big O is the same either way.
+      this._mappings.sort(util.compareByGeneratedPositions);
+
+      for (var i = 0, len = this._mappings.length; i < len; i++) {
+        mapping = this._mappings[i];
+
+        if (mapping.generatedLine !== previousGeneratedLine) {
+          previousGeneratedColumn = 0;
+          while (mapping.generatedLine !== previousGeneratedLine) {
+            result += ';';
+            previousGeneratedLine++;
+          }
+        }
+        else {
+          if (i > 0) {
+            if (!util.compareByGeneratedPositions(mapping, this._mappings[i - 1])) {
+              continue;
+            }
+            result += ',';
+          }
+        }
+
+        result += base64VLQ.encode(mapping.generatedColumn
+                                   - previousGeneratedColumn);
+        previousGeneratedColumn = mapping.generatedColumn;
+
+        if (mapping.source) {
+          result += base64VLQ.encode(this._sources.indexOf(mapping.source)
+                                     - previousSource);
+          previousSource = this._sources.indexOf(mapping.source);
+
+          // lines are stored 0-based in SourceMap spec version 3
+          result += base64VLQ.encode(mapping.originalLine - 1
+                                     - previousOriginalLine);
+          previousOriginalLine = mapping.originalLine - 1;
+
+          result += base64VLQ.encode(mapping.originalColumn
+                                     - previousOriginalColumn);
+          previousOriginalColumn = mapping.originalColumn;
+
+          if (mapping.name) {
+            result += base64VLQ.encode(this._names.indexOf(mapping.name)
+                                       - previousName);
+            previousName = this._names.indexOf(mapping.name);
+          }
+        }
+      }
+
+      return result;
+    };
+
+  SourceMapGenerator.prototype._generateSourcesContent =
+    function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) {
+      return aSources.map(function (source) {
+        if (!this._sourcesContents) {
+          return null;
+        }
+        if (aSourceRoot) {
+          source = util.relative(aSourceRoot, source);
+        }
+        var key = util.toSetString(source);
+        return Object.prototype.hasOwnProperty.call(this._sourcesContents,
+                                                    key)
+          ? this._sourcesContents[key]
+          : null;
+      }, this);
+    };
+
+  /**
+   * Externalize the source map.
+   */
+  SourceMapGenerator.prototype.toJSON =
+    function SourceMapGenerator_toJSON() {
+      var map = {
+        version: this._version,
+        file: this._file,
+        sources: this._sources.toArray(),
+        names: this._names.toArray(),
+        mappings: this._serializeMappings()
+      };
+      if (this._sourceRoot) {
+        map.sourceRoot = this._sourceRoot;
+      }
+      if (this._sourcesContents) {
+        map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot);
+      }
+
+      return map;
+    };
+
+  /**
+   * Render the source map being generated to a string.
+   */
+  SourceMapGenerator.prototype.toString =
+    function SourceMapGenerator_toString() {
+      return JSON.stringify(this);
+    };
+
+  exports.SourceMapGenerator = SourceMapGenerator;
+
+});
+
+},{"./array-set":21,"./base64-vlq":22,"./util":28,"amdefine":29}],27:[function(require,module,exports){
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+if (typeof define !== 'function') {
+    var define = require('amdefine')(module, require);
+}
+define(function (require, exports, module) {
+
+  var SourceMapGenerator = require('./source-map-generator').SourceMapGenerator;
+  var util = require('./util');
+
+  /**
+   * SourceNodes provide a way to abstract over interpolating/concatenating
+   * snippets of generated JavaScript source code while maintaining the line and
+   * column information associated with the original source code.
+   *
+   * @param aLine The original line number.
+   * @param aColumn The original column number.
+   * @param aSource The original source's filename.
+   * @param aChunks Optional. An array of strings which are snippets of
+   *        generated JS, or other SourceNodes.
+   * @param aName The original identifier.
+   */
+  function SourceNode(aLine, aColumn, aSource, aChunks, aName) {
+    this.children = [];
+    this.sourceContents = {};
+    this.line = aLine === undefined ? null : aLine;
+    this.column = aColumn === undefined ? null : aColumn;
+    this.source = aSource === undefined ? null : aSource;
+    this.name = aName === undefined ? null : aName;
+    if (aChunks != null) this.add(aChunks);
+  }
+
+  /**
+   * Creates a SourceNode from generated code and a SourceMapConsumer.
+   *
+   * @param aGeneratedCode The generated code
+   * @param aSourceMapConsumer The SourceMap for the generated code
+   */
+  SourceNode.fromStringWithSourceMap =
+    function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer) {
+      // The SourceNode we want to fill with the generated code
+      // and the SourceMap
+      var node = new SourceNode();
+
+      // The generated code
+      // Processed fragments are removed from this array.
+      var remainingLines = aGeneratedCode.split('\n');
+
+      // We need to remember the position of "remainingLines"
+      var lastGeneratedLine = 1, lastGeneratedColumn = 0;
+
+      // The generate SourceNodes we need a code range.
+      // To extract it current and last mapping is used.
+      // Here we store the last mapping.
+      var lastMapping = null;
+
+      aSourceMapConsumer.eachMapping(function (mapping) {
+        if (lastMapping !== null) {
+          // We add the code from "lastMapping" to "mapping":
+          // First check if there is a new line in between.
+          if (lastGeneratedLine < mapping.generatedLine) {
+            var code = "";
+            // Associate first line with "lastMapping"
+            addMappingWithCode(lastMapping, remainingLines.shift() + "\n");
+            lastGeneratedLine++;
+            lastGeneratedColumn = 0;
+            // The remaining code is added without mapping
+          } else {
+            // There is no new line in between.
+            // Associate the code between "lastGeneratedColumn" and
+            // "mapping.generatedColumn" with "lastMapping"
+            var nextLine = remainingLines[0];
+            var code = nextLine.substr(0, mapping.generatedColumn -
+                                          lastGeneratedColumn);
+            remainingLines[0] = nextLine.substr(mapping.generatedColumn -
+                                                lastGeneratedColumn);
+            lastGeneratedColumn = mapping.generatedColumn;
+            addMappingWithCode(lastMapping, code);
+            // No more remaining code, continue
+            lastMapping = mapping;
+            return;
+          }
+        }
+        // We add the generated code until the first mapping
+        // to the SourceNode without any mapping.
+        // Each line is added as separate string.
+        while (lastGeneratedLine < mapping.generatedLine) {
+          node.add(remainingLines.shift() + "\n");
+          lastGeneratedLine++;
+        }
+        if (lastGeneratedColumn < mapping.generatedColumn) {
+          var nextLine = remainingLines[0];
+          node.add(nextLine.substr(0, mapping.generatedColumn));
+          remainingLines[0] = nextLine.substr(mapping.generatedColumn);
+          lastGeneratedColumn = mapping.generatedColumn;
+        }
+        lastMapping = mapping;
+      }, this);
+      // We have processed all mappings.
+      if (remainingLines.length > 0) {
+        if (lastMapping) {
+          // Associate the remaining code in the current line with "lastMapping"
+          var lastLine = remainingLines.shift();
+          if (remainingLines.length > 0) lastLine += "\n";
+          addMappingWithCode(lastMapping, lastLine);
+        }
+        // and add the remaining lines without any mapping
+        node.add(remainingLines.join("\n"));
+      }
+
+      // Copy sourcesContent into SourceNode
+      aSourceMapConsumer.sources.forEach(function (sourceFile) {
+        var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+        if (content) {
+          node.setSourceContent(sourceFile, content);
+        }
+      });
+
+      return node;
+
+      function addMappingWithCode(mapping, code) {
+        if (mapping === null || mapping.source === undefined) {
+          node.add(code);
+        } else {
+          node.add(new SourceNode(mapping.originalLine,
+                                  mapping.originalColumn,
+                                  mapping.source,
+                                  code,
+                                  mapping.name));
+        }
+      }
+    };
+
+  /**
+   * Add a chunk of generated JS to this source node.
+   *
+   * @param aChunk A string snippet of generated JS code, another instance of
+   *        SourceNode, or an array where each member is one of those things.
+   */
+  SourceNode.prototype.add = function SourceNode_add(aChunk) {
+    if (Array.isArray(aChunk)) {
+      aChunk.forEach(function (chunk) {
+        this.add(chunk);
+      }, this);
+    }
+    else if (aChunk instanceof SourceNode || typeof aChunk === "string") {
+      if (aChunk) {
+        this.children.push(aChunk);
+      }
+    }
+    else {
+      throw new TypeError(
+        "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk
+      );
+    }
+    return this;
+  };
+
+  /**
+   * Add a chunk of generated JS to the beginning of this source node.
+   *
+   * @param aChunk A string snippet of generated JS code, another instance of
+   *        SourceNode, or an array where each member is one of those things.
+   */
+  SourceNode.prototype.prepend = function SourceNode_prepend(aChunk) {
+    if (Array.isArray(aChunk)) {
+      for (var i = aChunk.length-1; i >= 0; i--) {
+        this.prepend(aChunk[i]);
+      }
+    }
+    else if (aChunk instanceof SourceNode || typeof aChunk === "string") {
+      this.children.unshift(aChunk);
+    }
+    else {
+      throw new TypeError(
+        "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk
+      );
+    }
+    return this;
+  };
+
+  /**
+   * Walk over the tree of JS snippets in this node and its children. The
+   * walking function is called once for each snippet of JS and is passed that
+   * snippet and the its original associated source's line/column location.
+   *
+   * @param aFn The traversal function.
+   */
+  SourceNode.prototype.walk = function SourceNode_walk(aFn) {
+    var chunk;
+    for (var i = 0, len = this.children.length; i < len; i++) {
+      chunk = this.children[i];
+      if (chunk instanceof SourceNode) {
+        chunk.walk(aFn);
+      }
+      else {
+        if (chunk !== '') {
+          aFn(chunk, { source: this.source,
+                       line: this.line,
+                       column: this.column,
+                       name: this.name });
+        }
+      }
+    }
+  };
+
+  /**
+   * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between
+   * each of `this.children`.
+   *
+   * @param aSep The separator.
+   */
+  SourceNode.prototype.join = function SourceNode_join(aSep) {
+    var newChildren;
+    var i;
+    var len = this.children.length;
+    if (len > 0) {
+      newChildren = [];
+      for (i = 0; i < len-1; i++) {
+        newChildren.push(this.children[i]);
+        newChildren.push(aSep);
+      }
+      newChildren.push(this.children[i]);
+      this.children = newChildren;
+    }
+    return this;
+  };
+
+  /**
+   * Call String.prototype.replace on the very right-most source snippet. Useful
+   * for trimming whitespace from the end of a source node, etc.
+   *
+   * @param aPattern The pattern to replace.
+   * @param aReplacement The thing to replace the pattern with.
+   */
+  SourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) {
+    var lastChild = this.children[this.children.length - 1];
+    if (lastChild instanceof SourceNode) {
+      lastChild.replaceRight(aPattern, aReplacement);
+    }
+    else if (typeof lastChild === 'string') {
+      this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement);
+    }
+    else {
+      this.children.push(''.replace(aPattern, aReplacement));
+    }
+    return this;
+  };
+
+  /**
+   * Set the source content for a source file. This will be added to the SourceMapGenerator
+   * in the sourcesContent field.
+   *
+   * @param aSourceFile The filename of the source file
+   * @param aSourceContent The content of the source file
+   */
+  SourceNode.prototype.setSourceContent =
+    function SourceNode_setSourceContent(aSourceFile, aSourceContent) {
+      this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent;
+    };
+
+  /**
+   * Walk over the tree of SourceNodes. The walking function is called for each
+   * source file content and is passed the filename and source content.
+   *
+   * @param aFn The traversal function.
+   */
+  SourceNode.prototype.walkSourceContents =
+    function SourceNode_walkSourceContents(aFn) {
+      for (var i = 0, len = this.children.length; i < len; i++) {
+        if (this.children[i] instanceof SourceNode) {
+          this.children[i].walkSourceContents(aFn);
+        }
+      }
+
+      var sources = Object.keys(this.sourceContents);
+      for (var i = 0, len = sources.length; i < len; i++) {
+        aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]);
+      }
+    };
+
+  /**
+   * Return the string representation of this source node. Walks over the tree
+   * and concatenates all the various snippets together to one string.
+   */
+  SourceNode.prototype.toString = function SourceNode_toString() {
+    var str = "";
+    this.walk(function (chunk) {
+      str += chunk;
+    });
+    return str;
+  };
+
+  /**
+   * Returns the string representation of this source node along with a source
+   * map.
+   */
+  SourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) {
+    var generated = {
+      code: "",
+      line: 1,
+      column: 0
+    };
+    var map = new SourceMapGenerator(aArgs);
+    var sourceMappingActive = false;
+    var lastOriginalSource = null;
+    var lastOriginalLine = null;
+    var lastOriginalColumn = null;
+    var lastOriginalName = null;
+    this.walk(function (chunk, original) {
+      generated.code += chunk;
+      if (original.source !== null
+          && original.line !== null
+          && original.column !== null) {
+        if(lastOriginalSource !== original.source
+           || lastOriginalLine !== original.line
+           || lastOriginalColumn !== original.column
+           || lastOriginalName !== original.name) {
+          map.addMapping({
+            source: original.source,
+            original: {
+              line: original.line,
+              column: original.column
+            },
+            generated: {
+              line: generated.line,
+              column: generated.column
+            },
+            name: original.name
+          });
+        }
+        lastOriginalSource = original.source;
+        lastOriginalLine = original.line;
+        lastOriginalColumn = original.column;
+        lastOriginalName = original.name;
+        sourceMappingActive = true;
+      } else if (sourceMappingActive) {
+        map.addMapping({
+          generated: {
+            line: generated.line,
+            column: generated.column
+          }
+        });
+        lastOriginalSource = null;
+        sourceMappingActive = false;
+      }
+      chunk.split('').forEach(function (ch, idx, array) {
+        if (ch === '\n') {
+          generated.line++;
+          generated.column = 0;
+          // Mappings end at eol
+          if (idx + 1 === array.length) {
+            lastOriginalSource = null;
+            sourceMappingActive = false;
+          } else if (sourceMappingActive) {
+            map.addMapping({
+              source: original.source,
+              original: {
+                line: original.line,
+                column: original.column
+              },
+              generated: {
+                line: generated.line,
+                column: generated.column
+              },
+              name: original.name
+            });
+          }
+        } else {
+          generated.column++;
+        }
+      });
+    });
+    this.walkSourceContents(function (sourceFile, sourceContent) {
+      map.setSourceContent(sourceFile, sourceContent);
+    });
+
+    return { code: generated.code, map: map };
+  };
+
+  exports.SourceNode = SourceNode;
+
+});
+
+},{"./source-map-generator":26,"./util":28,"amdefine":29}],28:[function(require,module,exports){
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+if (typeof define !== 'function') {
+    var define = require('amdefine')(module, require);
+}
+define(function (require, exports, module) {
+
+  /**
+   * This is a helper function for getting values from parameter/options
+   * objects.
+   *
+   * @param args The object we are extracting values from
+   * @param name The name of the property we are getting.
+   * @param defaultValue An optional value to return if the property is missing
+   * from the object. If this is not specified and the property is missing, an
+   * error will be thrown.
+   */
+  function getArg(aArgs, aName, aDefaultValue) {
+    if (aName in aArgs) {
+      return aArgs[aName];
+    } else if (arguments.length === 3) {
+      return aDefaultValue;
+    } else {
+      throw new Error('"' + aName + '" is a required argument.');
+    }
+  }
+  exports.getArg = getArg;
+
+  var urlRegexp = /^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.]*)(?::(\d+))?(\S*)$/;
+  var dataUrlRegexp = /^data:.+\,.+$/;
+
+  function urlParse(aUrl) {
+    var match = aUrl.match(urlRegexp);
+    if (!match) {
+      return null;
+    }
+    return {
+      scheme: match[1],
+      auth: match[2],
+      host: match[3],
+      port: match[4],
+      path: match[5]
+    };
+  }
+  exports.urlParse = urlParse;
+
+  function urlGenerate(aParsedUrl) {
+    var url = '';
+    if (aParsedUrl.scheme) {
+      url += aParsedUrl.scheme + ':';
+    }
+    url += '//';
+    if (aParsedUrl.auth) {
+      url += aParsedUrl.auth + '@';
+    }
+    if (aParsedUrl.host) {
+      url += aParsedUrl.host;
+    }
+    if (aParsedUrl.port) {
+      url += ":" + aParsedUrl.port
+    }
+    if (aParsedUrl.path) {
+      url += aParsedUrl.path;
+    }
+    return url;
+  }
+  exports.urlGenerate = urlGenerate;
+
+  /**
+   * Normalizes a path, or the path portion of a URL:
+   *
+   * - Replaces consequtive slashes with one slash.
+   * - Removes unnecessary '.' parts.
+   * - Removes unnecessary '<dir>/..' parts.
+   *
+   * Based on code in the Node.js 'path' core module.
+   *
+   * @param aPath The path or url to normalize.
+   */
+  function normalize(aPath) {
+    var path = aPath;
+    var url = urlParse(aPath);
+    if (url) {
+      if (!url.path) {
+        return aPath;
+      }
+      path = url.path;
+    }
+    var isAbsolute = (path.charAt(0) === '/');
+
+    var parts = path.split(/\/+/);
+    for (var part, up = 0, i = parts.length - 1; i >= 0; i--) {
+      part = parts[i];
+      if (part === '.') {
+        parts.splice(i, 1);
+      } else if (part === '..') {
+        up++;
+      } else if (up > 0) {
+        if (part === '') {
+          // The first part is blank if the path is absolute. Trying to go
+          // above the root is a no-op. Therefore we can remove all '..' parts
+          // directly after the root.
+          parts.splice(i + 1, up);
+          up = 0;
+        } else {
+          parts.splice(i, 2);
+          up--;
+        }
+      }
+    }
+    path = parts.join('/');
+
+    if (path === '') {
+      path = isAbsolute ? '/' : '.';
+    }
+
+    if (url) {
+      url.path = path;
+      return urlGenerate(url);
+    }
+    return path;
+  }
+  exports.normalize = normalize;
+
+  /**
+   * Joins two paths/URLs.
+   *
+   * @param aRoot The root path or URL.
+   * @param aPath The path or URL to be joined with the root.
+   *
+   * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a
+   *   scheme-relative URL: Then the scheme of aRoot, if any, is prepended
+   *   first.
+   * - Otherwise aPath is a path. If aRoot is a URL, then its path portion
+   *   is updated with the result and aRoot is returned. Otherwise the result
+   *   is returned.
+   *   - If aPath is absolute, the result is aPath.
+   *   - Otherwise the two paths are joined with a slash.
+   * - Joining for example 'http://' and 'www.example.com' is also supported.
+   */
+  function join(aRoot, aPath) {
+    var aPathUrl = urlParse(aPath);
+    var aRootUrl = urlParse(aRoot);
+    if (aRootUrl) {
+      aRoot = aRootUrl.path || '/';
+    }
+
+    // `join(foo, '//www.example.org')`
+    if (aPathUrl && !aPathUrl.scheme) {
+      if (aRootUrl) {
+        aPathUrl.scheme = aRootUrl.scheme;
+      }
+      return urlGenerate(aPathUrl);
+    }
+
+    if (aPathUrl || aPath.match(dataUrlRegexp)) {
+      return aPath;
+    }
+
+    // `join('http://', 'www.example.com')`
+    if (aRootUrl && !aRootUrl.host && !aRootUrl.path) {
+      aRootUrl.host = aPath;
+      return urlGenerate(aRootUrl);
+    }
+
+    var joined = aPath.charAt(0) === '/'
+      ? aPath
+      : normalize(aRoot.replace(/\/+$/, '') + '/' + aPath);
+
+    if (aRootUrl) {
+      aRootUrl.path = joined;
+      return urlGenerate(aRootUrl);
+    }
+    return joined;
+  }
+  exports.join = join;
+
+  /**
+   * Because behavior goes wacky when you set `__proto__` on objects, we
+   * have to prefix all the strings in our set with an arbitrary character.
+   *
+   * See https://github.com/mozilla/source-map/pull/31 and
+   * https://github.com/mozilla/source-map/issues/30
+   *
+   * @param String aStr
+   */
+  function toSetString(aStr) {
+    return '$' + aStr;
+  }
+  exports.toSetString = toSetString;
+
+  function fromSetString(aStr) {
+    return aStr.substr(1);
+  }
+  exports.fromSetString = fromSetString;
+
+  function relative(aRoot, aPath) {
+    aRoot = aRoot.replace(/\/$/, '');
+
+    var url = urlParse(aRoot);
+    if (aPath.charAt(0) == "/" && url && url.path == "/") {
+      return aPath.slice(1);
+    }
+
+    return aPath.indexOf(aRoot + '/') === 0
+      ? aPath.substr(aRoot.length + 1)
+      : aPath;
+  }
+  exports.relative = relative;
+
+  function strcmp(aStr1, aStr2) {
+    var s1 = aStr1 || "";
+    var s2 = aStr2 || "";
+    return (s1 > s2) - (s1 < s2);
+  }
+
+  /**
+   * Comparator between two mappings where the original positions are compared.
+   *
+   * Optionally pass in `true` as `onlyCompareGenerated` to consider two
+   * mappings with the same original source/line/column, but different generated
+   * line and column the same. Useful when searching for a mapping with a
+   * stubbed out mapping.
+   */
+  function compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) {
+    var cmp;
+
+    cmp = strcmp(mappingA.source, mappingB.source);
+    if (cmp) {
+      return cmp;
+    }
+
+    cmp = mappingA.originalLine - mappingB.originalLine;
+    if (cmp) {
+      return cmp;
+    }
+
+    cmp = mappingA.originalColumn - mappingB.originalColumn;
+    if (cmp || onlyCompareOriginal) {
+      return cmp;
+    }
+
+    cmp = strcmp(mappingA.name, mappingB.name);
+    if (cmp) {
+      return cmp;
+    }
+
+    cmp = mappingA.generatedLine - mappingB.generatedLine;
+    if (cmp) {
+      return cmp;
+    }
+
+    return mappingA.generatedColumn - mappingB.generatedColumn;
+  };
+  exports.compareByOriginalPositions = compareByOriginalPositions;
+
+  /**
+   * Comparator between two mappings where the generated positions are
+   * compared.
+   *
+   * Optionally pass in `true` as `onlyCompareGenerated` to consider two
+   * mappings with the same generated line and column, but different
+   * source/name/original line and column the same. Useful when searching for a
+   * mapping with a stubbed out mapping.
+   */
+  function compareByGeneratedPositions(mappingA, mappingB, onlyCompareGenerated) {
+    var cmp;
+
+    cmp = mappingA.generatedLine - mappingB.generatedLine;
+    if (cmp) {
+      return cmp;
+    }
+
+    cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+    if (cmp || onlyCompareGenerated) {
+      return cmp;
+    }
+
+    cmp = strcmp(mappingA.source, mappingB.source);
+    if (cmp) {
+      return cmp;
+    }
+
+    cmp = mappingA.originalLine - mappingB.originalLine;
+    if (cmp) {
+      return cmp;
+    }
+
+    cmp = mappingA.originalColumn - mappingB.originalColumn;
+    if (cmp) {
+      return cmp;
+    }
+
+    return strcmp(mappingA.name, mappingB.name);
+  };
+  exports.compareByGeneratedPositions = compareByGeneratedPositions;
+
+});
+
+},{"amdefine":29}],29:[function(require,module,exports){
+(function (process,__filename){
+/** vim: et:ts=4:sw=4:sts=4
+ * @license amdefine 0.1.0 Copyright (c) 2011, The Dojo Foundation All Rights Reserved.
+ * Available via the MIT or new BSD license.
+ * see: http://github.com/jrburke/amdefine for details
+ */
+
+/*jslint node: true */
+/*global module, process */
+'use strict';
+
+/**
+ * Creates a define for node.
+ * @param {Object} module the "module" object that is defined by Node for the
+ * current module.
+ * @param {Function} [requireFn]. Node's require function for the current module.
+ * It only needs to be passed in Node versions before 0.5, when module.require
+ * did not exist.
+ * @returns {Function} a define function that is usable for the current node
+ * module.
+ */
+function amdefine(module, requireFn) {
+    'use strict';
+    var defineCache = {},
+        loaderCache = {},
+        alreadyCalled = false,
+        path = require('path'),
+        makeRequire, stringRequire;
+
+    /**
+     * Trims the . and .. from an array of path segments.
+     * It will keep a leading path segment if a .. will become
+     * the first path segment, to help with module name lookups,
+     * which act like paths, but can be remapped. But the end result,
+     * all paths that use this function should look normalized.
+     * NOTE: this method MODIFIES the input array.
+     * @param {Array} ary the array of path segments.
+     */
+    function trimDots(ary) {
+        var i, part;
+        for (i = 0; ary[i]; i+= 1) {
+            part = ary[i];
+            if (part === '.') {
+                ary.splice(i, 1);
+                i -= 1;
+            } else if (part === '..') {
+                if (i === 1 && (ary[2] === '..' || ary[0] === '..')) {
+                    //End of the line. Keep at least one non-dot
+                    //path segment at the front so it can be mapped
+                    //correctly to disk. Otherwise, there is likely
+                    //no path mapping for a path starting with '..'.
+                    //This can still fail, but catches the most reasonable
+                    //uses of ..
+                    break;
+                } else if (i > 0) {
+                    ary.splice(i - 1, 2);
+                    i -= 2;
+                }
+            }
+        }
+    }
+
+    function normalize(name, baseName) {
+        var baseParts;
+
+        //Adjust any relative paths.
+        if (name && name.charAt(0) === '.') {
+            //If have a base name, try to normalize against it,
+            //otherwise, assume it is a top-level require that will
+            //be relative to baseUrl in the end.
+            if (baseName) {
+                baseParts = baseName.split('/');
+                baseParts = baseParts.slice(0, baseParts.length - 1);
+                baseParts = baseParts.concat(name.split('/'));
+                trimDots(baseParts);
+                name = baseParts.join('/');
+            }
+        }
+
+        return name;
+    }
+
+    /**
+     * Create the normalize() function passed to a loader plugin's
+     * normalize method.
+     */
+    function makeNormalize(relName) {
+        return function (name) {
+            return normalize(name, relName);
+        };
+    }
+
+    function makeLoad(id) {
+        function load(value) {
+            loaderCache[id] = value;
+        }
+
+        load.fromText = function (id, text) {
+            //This one is difficult because the text can/probably uses
+            //define, and any relative paths and requires should be relative
+            //to that id was it would be found on disk. But this would require
+            //bootstrapping a module/require fairly deeply from node core.
+            //Not sure how best to go about that yet.
+            throw new Error('amdefine does not implement load.fromText');
+        };
+
+        return load;
+    }
+
+    makeRequire = function (systemRequire, exports, module, relId) {
+        function amdRequire(deps, callback) {
+            if (typeof deps === 'string') {
+                //Synchronous, single module require('')
+                return stringRequire(systemRequire, exports, module, deps, relId);
+            } else {
+                //Array of dependencies with a callback.
+
+                //Convert the dependencies to modules.
+                deps = deps.map(function (depName) {
+                    return stringRequire(systemRequire, exports, module, depName, relId);
+                });
+
+                //Wait for next tick to call back the require call.
+                process.nextTick(function () {
+                    callback.apply(null, deps);
+                });
+            }
+        }
+
+        amdRequire.toUrl = function (filePath) {
+            if (filePath.indexOf('.') === 0) {
+                return normalize(filePath, path.dirname(module.filename));
+            } else {
+                return filePath;
+            }
+        };
+
+        return amdRequire;
+    };
+
+    //Favor explicit value, passed in if the module wants to support Node 0.4.
+    requireFn = requireFn || function req() {
+        return module.require.apply(module, arguments);
+    };
+
+    function runFactory(id, deps, factory) {
+        var r, e, m, result;
+
+        if (id) {
+            e = loaderCache[id] = {};
+            m = {
+                id: id,
+                uri: __filename,
+                exports: e
+            };
+            r = makeRequire(requireFn, e, m, id);
+        } else {
+            //Only support one define call per file
+            if (alreadyCalled) {
+                throw new Error('amdefine with no module ID cannot be called more than once per file.');
+            }
+            alreadyCalled = true;
+
+            //Use the real variables from node
+            //Use module.exports for exports, since
+            //the exports in here is amdefine exports.
+            e = module.exports;
+            m = module;
+            r = makeRequire(requireFn, e, m, module.id);
+        }
+
+        //If there are dependencies, they are strings, so need
+        //to convert them to dependency values.
+        if (deps) {
+            deps = deps.map(function (depName) {
+                return r(depName);
+            });
+        }
+
+        //Call the factory with the right dependencies.
+        if (typeof factory === 'function') {
+            result = factory.apply(m.exports, deps);
+        } else {
+            result = factory;
+        }
+
+        if (result !== undefined) {
+            m.exports = result;
+            if (id) {
+                loaderCache[id] = m.exports;
+            }
+        }
+    }
+
+    stringRequire = function (systemRequire, exports, module, id, relId) {
+        //Split the ID by a ! so that
+        var index = id.indexOf('!'),
+            originalId = id,
+            prefix, plugin;
+
+        if (index === -1) {
+            id = normalize(id, relId);
+
+            //Straight module lookup. If it is one of the special dependencies,
+            //deal with it, otherwise, delegate to node.
+            if (id === 'require') {
+                return makeRequire(systemRequire, exports, module, relId);
+            } else if (id === 'exports') {
+                return exports;
+            } else if (id === 'module') {
+                return module;
+            } else if (loaderCache.hasOwnProperty(id)) {
+                return loaderCache[id];
+            } else if (defineCache[id]) {
+                runFactory.apply(null, defineCache[id]);
+                return loaderCache[id];
+            } else {
+                if(systemRequire) {
+                    return systemRequire(originalId);
+                } else {
+                    throw new Error('No module with ID: ' + id);
+                }
+            }
+        } else {
+            //There is a plugin in play.
+            prefix = id.substring(0, index);
+            id = id.substring(index + 1, id.length);
+
+            plugin = stringRequire(systemRequire, exports, module, prefix, relId);
+
+            if (plugin.normalize) {
+                id = plugin.normalize(id, makeNormalize(relId));
+            } else {
+                //Normalize the ID normally.
+                id = normalize(id, relId);
+            }
+
+            if (loaderCache[id]) {
+                return loaderCache[id];
+            } else {
+                plugin.load(id, makeRequire(systemRequire, exports, module, relId), makeLoad(id), {});
+
+                return loaderCache[id];
+            }
+        }
+    };
+
+    //Create a define function specific to the module asking for amdefine.
+    function define(id, deps, factory) {
+        if (Array.isArray(id)) {
+            factory = deps;
+            deps = id;
+            id = undefined;
+        } else if (typeof id !== 'string') {
+            factory = id;
+            id = deps = undefined;
+        }
+
+        if (deps && !Array.isArray(deps)) {
+            factory = deps;
+            deps = undefined;
+        }
+
+        if (!deps) {
+            deps = ['require', 'exports', 'module'];
+        }
+
+        //Set up properties for this module. If an ID, then use
+        //internal cache. If no ID, then use the external variables
+        //for this node module.
+        if (id) {
+            //Put the module in deep freeze until there is a
+            //require call for it.
+            defineCache[id] = [id, deps, factory];
+        } else {
+            runFactory(id, deps, factory);
+        }
+    }
+
+    //define.require, which has access to all the values in the
+    //cache. Useful for AMD modules that all have IDs in the file,
+    //but need to finally export a value to node based on one of those
+    //IDs.
+    define.require = function (id) {
+        if (loaderCache[id]) {
+            return loaderCache[id];
+        }
+
+        if (defineCache[id]) {
+            runFactory.apply(null, defineCache[id]);
+            return loaderCache[id];
+        }
+    };
+
+    define.amd = {};
+
+    return define;
+}
+
+module.exports = amdefine;
+
+}).call(this,require("/usr/local/lib/node_modules/browserify/node_modules/insert-module-globals/node_modules/process/browser.js"),"/../node_modules/postcss/node_modules/source-map/node_modules/amdefine/amdefine.js")
+},{"/usr/local/lib/node_modules/browserify/node_modules/insert-module-globals/node_modules/process/browser.js":31,"path":32}],30:[function(require,module,exports){
+
+},{}],31:[function(require,module,exports){
+// shim for using process in browser
+
+var process = module.exports = {};
+
+process.nextTick = (function () {
+    var canSetImmediate = typeof window !== 'undefined'
+    && window.setImmediate;
+    var canPost = typeof window !== 'undefined'
+    && window.postMessage && window.addEventListener
+    ;
+
+    if (canSetImmediate) {
+        return function (f) { return window.setImmediate(f) };
+    }
+
+    if (canPost) {
+        var queue = [];
+        window.addEventListener('message', function (ev) {
+            var source = ev.source;
+            if ((source === window || source === null) && ev.data === 'process-tick') {
+                ev.stopPropagation();
+                if (queue.length > 0) {
+                    var fn = queue.shift();
+                    fn();
+                }
+            }
+        }, true);
+
+        return function nextTick(fn) {
+            queue.push(fn);
+            window.postMessage('process-tick', '*');
+        };
+    }
+
+    return function nextTick(fn) {
+        setTimeout(fn, 0);
+    };
+})();
+
+process.title = 'browser';
+process.browser = true;
+process.env = {};
+process.argv = [];
+
+function noop() {}
+
+process.on = noop;
+process.once = noop;
+process.off = noop;
+process.emit = noop;
+
+process.binding = function (name) {
+    throw new Error('process.binding is not supported');
+}
+
+// TODO(shtylman)
+process.cwd = function () { return '/' };
+process.chdir = function (dir) {
+    throw new Error('process.chdir is not supported');
+};
+
+},{}],32:[function(require,module,exports){
+(function (process){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+// resolves . and .. elements in a path array with directory names there
+// must be no slashes, empty elements, or device names (c:\) in the array
+// (so also no leading and trailing slashes - it does not distinguish
+// relative and absolute paths)
+function normalizeArray(parts, allowAboveRoot) {
+  // if the path tries to go above the root, `up` ends up > 0
+  var up = 0;
+  for (var i = parts.length - 1; i >= 0; i--) {
+    var last = parts[i];
+    if (last === '.') {
+      parts.splice(i, 1);
+    } else if (last === '..') {
+      parts.splice(i, 1);
+      up++;
+    } else if (up) {
+      parts.splice(i, 1);
+      up--;
+    }
+  }
+
+  // if the path is allowed to go above the root, restore leading ..s
+  if (allowAboveRoot) {
+    for (; up--; up) {
+      parts.unshift('..');
+    }
+  }
+
+  return parts;
+}
+
+// Split a filename into [root, dir, basename, ext], unix version
+// 'root' is just a slash, or nothing.
+var splitPathRe =
+    /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
+var splitPath = function(filename) {
+  return splitPathRe.exec(filename).slice(1);
+};
+
+// path.resolve([from ...], to)
+// posix version
+exports.resolve = function() {
+  var resolvedPath = '',
+      resolvedAbsolute = false;
+
+  for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
+    var path = (i >= 0) ? arguments[i] : process.cwd();
+
+    // Skip empty and invalid entries
+    if (typeof path !== 'string') {
+      throw new TypeError('Arguments to path.resolve must be strings');
+    } else if (!path) {
+      continue;
+    }
+
+    resolvedPath = path + '/' + resolvedPath;
+    resolvedAbsolute = path.charAt(0) === '/';
+  }
+
+  // At this point the path should be resolved to a full absolute path, but
+  // handle relative paths to be safe (might happen when process.cwd() fails)
+
+  // Normalize the path
+  resolvedPath = normalizeArray(filter(resolvedPath.split('/'), function(p) {
+    return !!p;
+  }), !resolvedAbsolute).join('/');
+
+  return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
+};
+
+// path.normalize(path)
+// posix version
+exports.normalize = function(path) {
+  var isAbsolute = exports.isAbsolute(path),
+      trailingSlash = substr(path, -1) === '/';
+
+  // Normalize the path
+  path = normalizeArray(filter(path.split('/'), function(p) {
+    return !!p;
+  }), !isAbsolute).join('/');
+
+  if (!path && !isAbsolute) {
+    path = '.';
+  }
+  if (path && trailingSlash) {
+    path += '/';
+  }
+
+  return (isAbsolute ? '/' : '') + path;
+};
+
+// posix version
+exports.isAbsolute = function(path) {
+  return path.charAt(0) === '/';
+};
+
+// posix version
+exports.join = function() {
+  var paths = Array.prototype.slice.call(arguments, 0);
+  return exports.normalize(filter(paths, function(p, index) {
+    if (typeof p !== 'string') {
+      throw new TypeError('Arguments to path.join must be strings');
+    }
+    return p;
+  }).join('/'));
+};
+
+
+// path.relative(from, to)
+// posix version
+exports.relative = function(from, to) {
+  from = exports.resolve(from).substr(1);
+  to = exports.resolve(to).substr(1);
+
+  function trim(arr) {
+    var start = 0;
+    for (; start < arr.length; start++) {
+      if (arr[start] !== '') break;
+    }
+
+    var end = arr.length - 1;
+    for (; end >= 0; end--) {
+      if (arr[end] !== '') break;
+    }
+
+    if (start > end) return [];
+    return arr.slice(start, end - start + 1);
+  }
+
+  var fromParts = trim(from.split('/'));
+  var toParts = trim(to.split('/'));
+
+  var length = Math.min(fromParts.length, toParts.length);
+  var samePartsLength = length;
+  for (var i = 0; i < length; i++) {
+    if (fromParts[i] !== toParts[i]) {
+      samePartsLength = i;
+      break;
+    }
+  }
+
+  var outputParts = [];
+  for (var i = samePartsLength; i < fromParts.length; i++) {
+    outputParts.push('..');
+  }
+
+  outputParts = outputParts.concat(toParts.slice(samePartsLength));
+
+  return outputParts.join('/');
+};
+
+exports.sep = '/';
+exports.delimiter = ':';
+
+exports.dirname = function(path) {
+  var result = splitPath(path),
+      root = result[0],
+      dir = result[1];
+
+  if (!root && !dir) {
+    // No dirname whatsoever
+    return '.';
+  }
+
+  if (dir) {
+    // It has a dirname, strip trailing slash
+    dir = dir.substr(0, dir.length - 1);
+  }
+
+  return root + dir;
+};
+
+
+exports.basename = function(path, ext) {
+  var f = splitPath(path)[2];
+  // TODO: make this comparison case-insensitive on windows?
+  if (ext && f.substr(-1 * ext.length) === ext) {
+    f = f.substr(0, f.length - ext.length);
+  }
+  return f;
+};
+
+
+exports.extname = function(path) {
+  return splitPath(path)[3];
+};
+
+function filter (xs, f) {
+    if (xs.filter) return xs.filter(f);
+    var res = [];
+    for (var i = 0; i < xs.length; i++) {
+        if (f(xs[i], i, xs)) res.push(xs[i]);
+    }
+    return res;
+}
+
+// String.prototype.substr - negative index don't work in IE8
+var substr = 'ab'.substr(-1) === 'b'
+    ? function (str, start, len) { return str.substr(start, len) }
+    : function (str, start, len) {
+        if (start < 0) start = str.length + start;
+        return str.substr(start, len);
+    }
+;
+
+}).call(this,require("/usr/local/lib/node_modules/browserify/node_modules/insert-module-globals/node_modules/process/browser.js"))
+},{"/usr/local/lib/node_modules/browserify/node_modules/insert-module-globals/node_modules/process/browser.js":31}]},{},[])